/* *************************************************************************** * * $Id$ * * *************************************************************************** * * * * *************************************************************************** * * $Log$ * Revision 1.3 2007/05/22 09:01:42 akisiel * Add the possibiloity to save cut settings in the ROOT file * * Revision 1.2 2007/05/21 10:38:25 akisiel * More coding rule conformance * * Revision 1.1 2007/05/16 10:25:06 akisiel * Making the directory structure of AliFemtoUser flat. All files go into one common directory * * Revision 1.4 2007/05/03 09:46:10 akisiel * Fixing Effective C++ warnings * * Revision 1.3 2007/04/27 07:25:59 akisiel * Make revisions needed for compilation from the main AliRoot tree * * Revision 1.1.1.1 2007/04/25 15:38:41 panos * Importing the HBT code dir * * Revision 1.4 2007-04-03 16:00:08 mchojnacki * Changes to iprove memory managing * * Revision 1.3 2007/03/13 15:30:03 mchojnacki * adding reader for simulated data * * Revision 1.2 2007/03/08 14:58:03 mchojnacki * adding some alice stuff * * Revision 1.1.1.1 2007/03/07 10:14:49 mchojnacki * First version on CVS * **************************************************************************/ #include "AliFemtoESDTrackCut.h" #include #ifdef __ROOT__ ClassImp(AliFemtoESDTrackCut) #endif // electron // 0.13 - 1.8 // 0 7.594129e-02 8.256141e-03 // 1 -5.535827e-01 8.170825e-02 // 2 1.728591e+00 3.104210e-01 // 3 -2.827893e+00 5.827802e-01 // 4 2.503553e+00 5.736207e-01 // 5 -1.125965e+00 2.821170e-01 // 6 2.009036e-01 5.438876e-02 // pion // 0.13 - 2.0 // 0 1.063457e+00 8.872043e-03 // 1 -4.222208e-01 2.534402e-02 // 2 1.042004e-01 1.503945e-02 // kaon // 0.18 - 2.0 // 0 -7.289406e-02 1.686074e-03 // 1 4.415666e-01 1.143939e-02 // 2 -2.996790e-01 1.840964e-02 // 3 6.704652e-02 7.783990e-03 // proton // 0.26 - 2.0 // 0 -3.730200e-02 2.347311e-03 // 1 1.163684e-01 1.319316e-02 // 2 8.354116e-02 1.997948e-02 // 3 -4.608098e-02 8.336400e-03 AliFemtoESDTrackCut::AliFemtoESDTrackCut() : fCharge(0), fLabel(0), fStatus(0), fPIDMethod(knSigma), fminTPCclsF(0), fminTPCncls(0), fminITScls(0), fMaxITSchiNdof(1000.0), fMaxTPCchiNdof(1000.0), fMaxSigmaToVertex(1000.0), fNTracksPassed(0), fNTracksFailed(0), fRemoveKinks(kFALSE), fRemoveITSFake(kFALSE), fMostProbable(0), fMaxImpactXY(1000.0), fMaxImpactZ(1000.0), fMaxImpactXYPtOff(1000.0), fMaxImpactXYPtNrm(1000.0), fMaxImpactXYPtPow(1000.0), fMinPforTOFpid(0.0), fMaxPforTOFpid(10000.0), fMinPforTPCpid(0.0), fMaxPforTPCpid(10000.0), fMinPforITSpid(0.0), fMaxPforITSpid(10000.0) { // Default constructor fNTracksPassed = fNTracksFailed = 0; fCharge = 0; // takes both charges 0 fPt[0]=0.0; fPt[1] = 100.0;//100 fRapidity[0]=-2; fRapidity[1]=2;//-2 2 fEta[0]=-2; fEta[1]=2;//-2 2 fPidProbElectron[0]=-1;fPidProbElectron[1]=2; fPidProbPion[0]=-1; fPidProbPion[1]=2; fPidProbKaon[0]=-1;fPidProbKaon[1]=2; fPidProbProton[0]=-1;fPidProbProton[1]=2; fPidProbMuon[0]=-1;fPidProbMuon[1]=2; fLabel=false; fStatus=0; fminTPCclsF=0; fminITScls=0; fPIDMethod=knSigma; } //------------------------------ AliFemtoESDTrackCut::~AliFemtoESDTrackCut(){ /* noop */ } //------------------------------ bool AliFemtoESDTrackCut::Pass(const AliFemtoTrack* track) { // test the particle and return // true if it meets all the criteria // false if it doesn't meet at least one of the criteria float tMost[5]; //cout<<"AliFemtoESD cut"<Label()<<" "<Flags()<<" "<TPCnclsF()<<" "<ITSncls()<Flags()&fStatus)!=fStatus) { // cout<Flags()<<" "<KinkIndex(0)) || (track->KinkIndex(1)) || (track->KinkIndex(2))) return false; } if (fRemoveITSFake) { if (track->ITSncls() < 0) return false; } if (fminTPCclsF>track->TPCnclsF()) { //cout<<" No go because TPC Number of ClsF"<TPCnclsF()<track->TPCncls()) { //cout<<" No go because TPC Number of ClsF"<TPCnclsF()<track->ITSncls()) { //cout<<" No go because ITS Number of Cls"<ITSncls()<ImpactD())) return false; if (fMaxImpactZ < TMath::Abs(track->ImpactZ())) return false; if (fMaxSigmaToVertex < track->SigmaToVertex()) { return false; } if (track->ITSncls() > 0) if ((track->ITSchi2()/track->ITSncls()) > fMaxITSchiNdof) { return false; } if (track->TPCncls() > 0) if ((track->TPCchi2()/track->TPCncls()) > fMaxTPCchiNdof) { return false; } if (fLabel) { //cout<<"labels"<Label()<0) { fNTracksFailed++; // cout<<"No Go Through the cut"<fEta[1])) { fNTracksFailed++; //cout<<"No Go Through the cut"<fPt[1])) { fNTracksFailed++; //cout<<"No Go Through the cut"<PidProbElectron() << " " // << track->PidProbMuon() << " " // << track->PidProbPion() << " " // << track->PidProbKaon() << " " // << track->PidProbProton() << " " // << track->PidProbElectron()+track->PidProbMuon()+track->PidProbPion()+track->PidProbKaon()+track->PidProbProton() << endl; if ((track->PidProbElectron()PidProbElectron()>fPidProbElectron[1])) { fNTracksFailed++; //cout<<"No Go Through the cut"<PidProbPion()PidProbPion()>fPidProbPion[1])) { fNTracksFailed++; //cout<<"No Go Through the cut"<PidProbKaon()PidProbKaon()>fPidProbKaon[1])) { fNTracksFailed++; //cout<<"No Go Through the cut"<PidProbProton()PidProbProton()>fPidProbProton[1])) { fNTracksFailed++; //cout<<"No Go Through the cut"<PidProbMuon()PidProbMuon()>fPidProbMuon[1])) { fNTracksFailed++; //cout<<"No Go Through the cut"<PidProbElectron()*PidFractionElectron(track->P().Mag()); tMost[1] = 0.0; tMost[2] = track->PidProbPion()*PidFractionPion(track->P().Mag()); tMost[3] = track->PidProbKaon()*PidFractionKaon(track->P().Mag()); tMost[4] = track->PidProbProton()*PidFractionProton(track->P().Mag()); float ipidmax = 0.0; //****N Sigma Method**** if(fPIDMethod==0){ // Looking for pions if (fMostProbable == 2) { if (IsPionNSigma(track->P().Mag(), track->NSigmaTPCPi(), track->NSigmaTOFPi())) imost = 2; } else if (fMostProbable == 3) { if (IsKaonNSigma(track->P().Mag(), track->NSigmaTPCK(), track->NSigmaTOFK())){ imost = 3; } } else if (fMostProbable == 4) { // proton nsigma-PID required contour adjusting if (IsProtonNSigma(track->P().Mag(), track->NSigmaTPCP(), track->NSigmaTOFP()) && IsProtonTPCdEdx(track->P().Mag(), track->TPCsignal())) imost = 4; } } //****Contour Method**** if(fPIDMethod==1){ for (int ip=0; ip<5; ip++) if (tMost[ip] > ipidmax) { ipidmax = tMost[ip]; imost = ip; }; // Looking for pions if (fMostProbable == 2) { if (imost == 2) { // Using the TPC to reject non-pions if (!(IsPionTPCdEdx(track->P().Mag(), track->TPCsignal()))) imost = 0; if (0) { // Using the TOF to reject non-pions if (track->P().Mag() < 0.6) { if (tTOFPidIn) if (!IsPionTOFTime(track->P().Mag(), track->TOFpionTime())) imost = 0; } else { if (tTOFPidIn) { if (!IsPionTOFTime(track->P().Mag(), track->TOFpionTime())) imost = 0; } else { imost = 0; } } } } } // Looking for kaons else if (fMostProbable == 3) { // if (imost == 3) { // Using the TPC to reject non-kaons if (track->P().Mag() < 0.6) { if (!(IsKaonTPCdEdx(track->P().Mag(), track->TPCsignal()))) imost = 0; else imost = 3; if (1) { // Using the TOF to reject non-kaons if (tTOFPidIn) if (!IsKaonTOFTime(track->P().Mag(), track->TOFkaonTime())) imost = 0; } } else { if (1) { if (tTOFPidIn) { if (!IsKaonTOFTime(track->P().Mag(), track->TOFkaonTime())) imost = 0; else imost = 3; } else { if (!(IsKaonTPCdEdx(track->P().Mag(), track->TPCsignal()))) imost = 0; else imost = 3; } } } // } } // Looking for protons else if (fMostProbable == 4) { // if (imost == 3) { // Using the TPC to reject non-kaons if (track->P().Mag() < 0.8) { if (!(IsProtonTPCdEdx(track->P().Mag(), track->TPCsignal()))) imost = 0; else imost = 4; if (0) { // Using the TOF to reject non-kaons if (tTOFPidIn) if (!IsKaonTOFTime(track->P().Mag(), track->TOFkaonTime())) imost = 0; } } else { if (0) { if (tTOFPidIn) { if (!IsKaonTOFTime(track->P().Mag(), track->TOFkaonTime())) imost = 0; else imost = 3; } else { if (!(IsKaonTPCdEdx(track->P().Mag(), track->TPCsignal()))) imost = 0; else imost = 3; } } } // } } } if (imost != fMostProbable) return false; } //fan //cout<<"****** Go Through the cut ******"<Mass()); tStemp=tCtemp; snprintf(tCtemp , 100, "Particle charge:\t%d\n",fCharge); tStemp+=tCtemp; snprintf(tCtemp , 100, "Particle pT:\t%E - %E\n",fPt[0],fPt[1]); tStemp+=tCtemp; snprintf(tCtemp , 100, "Particle rapidity:\t%E - %E\n",fRapidity[0],fRapidity[1]); tStemp+=tCtemp; snprintf(tCtemp , 100, "Particle eta:\t%E - %E\n",fEta[0],fEta[1]); tStemp+=tCtemp; snprintf(tCtemp , 100, "Number of tracks which passed:\t%ld Number which failed:\t%ld\n",fNTracksPassed,fNTracksFailed); tStemp += tCtemp; AliFemtoString returnThis = tStemp; return returnThis; } TList *AliFemtoESDTrackCut::ListSettings() { // return a list of settings in a writable form TList *tListSetttings = new TList(); char buf[200]; snprintf(buf, 200, "AliFemtoESDTrackCut.mass=%f", this->Mass()); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.charge=%i", fCharge); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.pidprobpion.minimum=%f", fPidProbPion[0]); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.pidprobpion.maximum=%f", fPidProbPion[1]); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.pidprobkaon.minimum=%f", fPidProbKaon[0]); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.pidprobkaon.maximum=%f", fPidProbKaon[1]); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.pidprobproton.minimum=%f", fPidProbProton[0]); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.pidprobproton.maximum=%f", fPidProbProton[1]); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.pidprobelectron.minimum=%f", fPidProbElectron[0]); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.pidprobelectron.maximum=%f", fPidProbElectron[1]); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.pidprobMuon.minimum=%f", fPidProbMuon[0]); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.pidprobMuon.maximum=%f", fPidProbMuon[1]); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.minimumtpcclusters=%i", fminTPCclsF); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.minimumitsclusters=%i", fminTPCclsF); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.pt.minimum=%f", fPt[0]); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.pt.maximum=%f", fPt[1]); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.rapidity.minimum=%f", fRapidity[0]); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.rapidity.maximum=%f", fRapidity[1]); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.removekinks=%i", fRemoveKinks); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.maxitschindof=%f", fMaxITSchiNdof); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.maxtpcchindof=%f", fMaxTPCchiNdof); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.maxsigmatovertex=%f", fMaxSigmaToVertex); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.maximpactxy=%f", fMaxImpactXY); tListSetttings->AddLast(new TObjString(buf)); snprintf(buf, 200, "AliFemtoESDTrackCut.maximpactz=%f", fMaxImpactZ); tListSetttings->AddLast(new TObjString(buf)); if (fMostProbable) { if (fMostProbable == 2) snprintf(buf, 200, "AliFemtoESDTrackCut.mostprobable=%s", "Pion"); if (fMostProbable == 3) snprintf(buf, 200, "AliFemtoESDTrackCut.mostprobable=%s", "Kaon"); if (fMostProbable == 4) snprintf(buf, 200, "AliFemtoESDTrackCut.mostprobable=%s", "Proton"); tListSetttings->AddLast(new TObjString(buf)); } return tListSetttings; } void AliFemtoESDTrackCut::SetRemoveKinks(const bool& flag) { fRemoveKinks = flag; } void AliFemtoESDTrackCut::SetRemoveITSFake(const bool& flag) { fRemoveITSFake = flag; } // electron // 0.13 - 1.8 // 0 7.594129e-02 8.256141e-03 // 1 -5.535827e-01 8.170825e-02 // 2 1.728591e+00 3.104210e-01 // 3 -2.827893e+00 5.827802e-01 // 4 2.503553e+00 5.736207e-01 // 5 -1.125965e+00 2.821170e-01 // 6 2.009036e-01 5.438876e-02 float AliFemtoESDTrackCut::PidFractionElectron(float mom) const { // Provide a parameterized fraction of electrons dependent on momentum if (mom<0.13) return (7.594129e-02 -5.535827e-01*0.13 +1.728591e+00*0.13*0.13 -2.827893e+00*0.13*0.13*0.13 +2.503553e+00*0.13*0.13*0.13*0.13 -1.125965e+00*0.13*0.13*0.13*0.13*0.13 +2.009036e-01*0.13*0.13*0.13*0.13*0.13*0.13); if (mom>1.8) return (7.594129e-02 -5.535827e-01*1.8 +1.728591e+00*1.8*1.8 -2.827893e+00*1.8*1.8*1.8 +2.503553e+00*1.8*1.8*1.8*1.8 -1.125965e+00*1.8*1.8*1.8*1.8*1.8 +2.009036e-01*1.8*1.8*1.8*1.8*1.8*1.8); return (7.594129e-02 -5.535827e-01*mom +1.728591e+00*mom*mom -2.827893e+00*mom*mom*mom +2.503553e+00*mom*mom*mom*mom -1.125965e+00*mom*mom*mom*mom*mom +2.009036e-01*mom*mom*mom*mom*mom*mom); } // pion // 0.13 - 2.0 // 0 1.063457e+00 8.872043e-03 // 1 -4.222208e-01 2.534402e-02 // 2 1.042004e-01 1.503945e-02 float AliFemtoESDTrackCut::PidFractionPion(float mom) const { // Provide a parameterized fraction of pions dependent on momentum if (mom<0.13) return ( 1.063457e+00 -4.222208e-01*0.13 +1.042004e-01*0.0169); if (mom>2.0) return ( 1.063457e+00 -4.222208e-01*2.0 +1.042004e-01*4.0); return ( 1.063457e+00 -4.222208e-01*mom +1.042004e-01*mom*mom); } // kaon // 0.18 - 2.0 // 0 -7.289406e-02 1.686074e-03 // 1 4.415666e-01 1.143939e-02 // 2 -2.996790e-01 1.840964e-02 // 3 6.704652e-02 7.783990e-03 float AliFemtoESDTrackCut::PidFractionKaon(float mom) const { // Provide a parameterized fraction of kaons dependent on momentum if (mom<0.18) return (-7.289406e-02 +4.415666e-01*0.18 -2.996790e-01*0.18*0.18 +6.704652e-02*0.18*0.18*0.18); if (mom>2.0) return (-7.289406e-02 +4.415666e-01*2.0 -2.996790e-01*2.0*2.0 +6.704652e-02*2.0*2.0*2.0); return (-7.289406e-02 +4.415666e-01*mom -2.996790e-01*mom*mom +6.704652e-02*mom*mom*mom); } // proton // 0.26 - 2.0 // 0 -3.730200e-02 2.347311e-03 // 1 1.163684e-01 1.319316e-02 // 2 8.354116e-02 1.997948e-02 // 3 -4.608098e-02 8.336400e-03 float AliFemtoESDTrackCut::PidFractionProton(float mom) const { // Provide a parameterized fraction of protons dependent on momentum if (mom<0.26) return 0.0; if (mom>2.0) return (-3.730200e-02 +1.163684e-01*2.0 +8.354116e-02*2.0*2.0 -4.608098e-02*2.0*2.0*2.0); return (-3.730200e-02 +1.163684e-01*mom +8.354116e-02*mom*mom -4.608098e-02*mom*mom*mom); } void AliFemtoESDTrackCut::SetMomRangeTOFpidIs(const float& minp, const float& maxp) { fMinPforTOFpid = minp; fMaxPforTOFpid = maxp; } void AliFemtoESDTrackCut::SetMomRangeTPCpidIs(const float& minp, const float& maxp) { fMinPforTPCpid = minp; fMaxPforTPCpid = maxp; } void AliFemtoESDTrackCut::SetMomRangeITSpidIs(const float& minp, const float& maxp) { fMinPforITSpid = minp; fMaxPforITSpid = maxp; } bool AliFemtoESDTrackCut::IsPionTPCdEdx(float mom, float dEdx) { // double a1 = -95.4545, b1 = 86.5455; // double a2 = 0.0, b2 = 56.0; double a1 = -343.75, b1 = 168.125; double a2 = 0.0, b2 = 65.0; if (mom < 0.32) { if (dEdx < a1*mom+b1) return true; } if (dEdx < a2*mom+b2) return true; return false; } bool AliFemtoESDTrackCut::IsKaonTPCdEdx(float mom, float dEdx) { // double a1 = -547.0; double b1 = 297.0; // double a2 = -125.0; double b2 = 145.0; // double a3 = -420.0; double b3 = 357.0; // double a4 = -110.0; double b4 = 171.0; // double b5 = 72.0; // if (mom<0.2) return false; // if (mom<0.36) { // if (dEdx < a1*mom+b1) return false; // if (dEdx > a3*mom+b3) return false; // } // else if (mom<0.6) { // if (dEdx < a2*mom+b2) return false; // if (dEdx > a3*mom+b3) return false; // } // else if (mom<0.9) { // if (dEdx > a4*mom+b4) return false; // if (dEdx < b5) return false; // } // else // return false; // // else { // // if (dEdx > b5) return false; // // } // return true; double a1 = -268.896; double b1 = 198.669; double a2 = -49.0012; double b2 = 88.7214; if (mom<0.2) return false; if (mom>0.3 && mom<0.5) { if (dEdx < a1*mom+b1) return false; } else if (mom<1.2) { if (dEdx < a2*mom+b2) return false; } return true; } bool AliFemtoESDTrackCut::IsProtonTPCdEdx(float mom, float dEdx) { double a1 = -1800.0; double b1 = 940.0; double a2 = -500.0; double b2 = 420.0; double a3 = -216.7; double b3 = 250.0; if (mom<0.2) return false; if (mom>0.3 && mom<0.4) { if (dEdx < a1*mom+b1) return false; } else if (mom<0.6) { if (dEdx < a2*mom+b2) return false; } else if (mom<0.9) { if (dEdx < a3*mom+b3) return false; } return true; } bool AliFemtoESDTrackCut::IsPionTOFTime(float mom, float ttof) { double a1 = -427.0; double b1 = 916.0; double a2 = 327.0; double b2 = -888.0; if (mom<0.3) return kFALSE; if (mom>2.0) return kFALSE; if (ttof > a1*mom+b1) return kFALSE; if (ttof < a2*mom+b2) return kFALSE; return kTRUE; } bool AliFemtoESDTrackCut::IsKaonTOFTime(float mom, float ttof) { double a1 = 000.0; double b1 = -500.0; double a2 = 000.0; double b2 = 500.0; double a3 = 850.0; double b3 = -1503.0; double a4 = -1637.0; double b4 = 3621.0; if (mom<0.3) return kFALSE; if (mom>2.06) return kFALSE; if (mom<1.2) { if (ttof > a2*mom+b2) return kFALSE; if (ttof < a1*mom+b1) return kFALSE; } if (mom<1.9) { if (ttof > a2*mom+b2) return kFALSE; if (ttof < a3*mom+b3) return kFALSE; } if (mom<2.06) { if (ttof > a4*mom+b4) return kFALSE; if (ttof < a3*mom+b3) return kFALSE; } return kTRUE; } bool AliFemtoESDTrackCut::IsProtonTOFTime(float mom, float ttof) { double a1 = 000.0; double b1 = -915.0; double a2 = 000.0; double b2 = 600.0; double a3 = 572.0; double b3 = -1715.0; if (mom<0.3) return kFALSE; if (mom>3.0) return kFALSE; if (mom<1.4) { if (ttof > a2*mom+b2) return kFALSE; if (ttof < a1*mom+b1) return kFALSE; } if (mom<3.0) { if (ttof > a2*mom+b2) return kFALSE; if (ttof < a3*mom+b3) return kFALSE; } return kTRUE; } bool AliFemtoESDTrackCut::IsKaonTPCdEdxNSigma(float mom, float nsigmaK) { cout<<" AliFemtoESDTrackCut::IsKaonTPCdEdxNSigma "<=0.35 && mom<0.5 && TMath::Abs(nsigmaK)<3.0)return true; if(mom>=0.5 && mom<0.7 && TMath::Abs(nsigmaK)<2.0)return true; return false; } bool AliFemtoESDTrackCut::IsKaonTOFNSigma(float mom, float nsigmaK) { cout<<" AliFemtoESDTrackCut::IsKaonTPCdEdxNSigma "<=1.5 && TMath::Abs(nsigmaK)<2.0)return true; return false; } //ML according with Roberto Preghenella talk bool AliFemtoESDTrackCut::IsKaonNSigma(float mom, float nsigmaTPCK, float nsigmaTOFK) { //cout<<"//////// AliFemtoESDTrackCut::IsKaonNSigma "<1.5 && TMath::Abs(nsigmaTPCK)<3.0)return true; //no TOF signal if(nsigmaTOFK<=-1000.){ //cout<<"//////// AliFemtoESDTrackCut::IsKaonNSigma P= "<=0.4 && mom<0.5 && TMath::Abs(nsigmaTPCK)<2.0)return true; if(mom>=0.5 && mom<0.6 && TMath::Abs(nsigmaTPCK)<2.0)return true; } return false; } bool AliFemtoESDTrackCut::IsPionNSigma(float mom, float nsigmaTPCPi, float nsigmaTOFPi) { // cout<<" AliFemtoESDTrackCut::IsKaonNSigma "<1.5 && TMath::Abs(nsigmaTPCPi)<5.0)return true; //no TOF signal if(nsigmaTOFPi<-999.){ if(mom<0.35 && TMath::Abs(nsigmaTPCPi)<5.0)return true; if(mom>=0.35 && mom<0.5 && TMath::Abs(nsigmaTPCPi)<3.0)return true; if(mom>=0.5 && TMath::Abs(nsigmaTPCPi)<2.0)return true; } return false; } bool AliFemtoESDTrackCut::IsProtonNSigma(float mom, float nsigmaTPCP, float nsigmaTOFP) { // cout<<" AliFemtoESDTrackCut::IsKaonNSigma "<1.5 && TMath::Abs(nsigmaTPCP)<3.0)return true; //no TOF signal if(nsigmaTOFP<-999.){ if(mom<0.5 && TMath::Abs(nsigmaTPCP)<3.0)return true; if(mom>=0.5 && mom<0.8 && TMath::Abs(nsigmaTPCP)<2.0)return true; } return false; } void AliFemtoESDTrackCut::SetPIDMethod(ReadPIDMethodType newMethod) { fPIDMethod = newMethod; }