]>
Commit | Line | Data |
---|---|---|
489d5531 | 1 | /************************************************************************* |
2 | * Copyright(c) 1998-2008, ALICE Experiment at CERN, All rights reserved. * | |
3 | * * | |
4 | * Author: The ALICE Off-line Project. * | |
5 | * Contributors are mentioned in the code where appropriate. * | |
6 | * * | |
7 | * Permission to use, copy, modify and distribute this software and its * | |
8 | * documentation strictly for non-commercial purposes is hereby granted * | |
9 | * without fee, provided that the above copyright notice appears in all * | |
10 | * copies and that both the copyright notice and this permission notice * | |
11 | * appear in the supporting documentation. The authors make no claims * | |
12 | * about the suitability of this software for any purpose. It is * | |
13 | * provided "as is" without express or implied warranty. * | |
14 | **************************************************************************/ | |
15 | ||
16 | /********************************** | |
17 | * flow analysis with Q-cumulants * | |
18 | * * | |
ff70ca91 | 19 | * author: Ante Bilandzic * |
20 | * (abilandzic@gmail.com) * | |
489d5531 | 21 | *********************************/ |
22 | ||
23 | #define AliFlowAnalysisWithQCumulants_cxx | |
24 | ||
25 | #include "Riostream.h" | |
26 | #include "AliFlowCommonConstants.h" | |
27 | #include "AliFlowCommonHist.h" | |
28 | #include "AliFlowCommonHistResults.h" | |
29 | #include "TChain.h" | |
30 | ||
31 | #include "TFile.h" | |
32 | #include "TList.h" | |
33 | #include "TGraph.h" | |
34 | #include "TParticle.h" | |
35 | #include "TRandom3.h" | |
36 | #include "TStyle.h" | |
37 | #include "TProfile.h" | |
38 | #include "TProfile2D.h" | |
489d5531 | 39 | #include "TMath.h" |
40 | #include "TArrow.h" | |
41 | #include "TPaveLabel.h" | |
42 | #include "TCanvas.h" | |
43 | #include "AliFlowEventSimple.h" | |
44 | #include "AliFlowTrackSimple.h" | |
45 | #include "AliFlowAnalysisWithQCumulants.h" | |
46 | #include "TArrayD.h" | |
47 | #include "TRandom.h" | |
48 | #include "TF1.h" | |
49 | ||
50 | class TH1; | |
51 | class TH2; | |
52 | class TGraph; | |
53 | class TPave; | |
54 | class TLatex; | |
55 | class TMarker; | |
56 | class TRandom3; | |
57 | class TObjArray; | |
58 | class TList; | |
59 | class TCanvas; | |
60 | class TSystem; | |
61 | class TROOT; | |
62 | class AliFlowVector; | |
63 | class TVector; | |
64 | ||
489d5531 | 65 | //================================================================================================================ |
66 | ||
489d5531 | 67 | ClassImp(AliFlowAnalysisWithQCumulants) |
68 | ||
69 | AliFlowAnalysisWithQCumulants::AliFlowAnalysisWithQCumulants(): | |
70 | // 0.) base: | |
71 | fHistList(NULL), | |
72 | // 1.) common: | |
62d19320 | 73 | fBookOnlyBasicCCH(kFALSE), |
489d5531 | 74 | fCommonHists(NULL), |
75 | fCommonHists2nd(NULL), | |
76 | fCommonHists4th(NULL), | |
77 | fCommonHists6th(NULL), | |
78 | fCommonHists8th(NULL), | |
79 | fCommonHistsResults2nd(NULL), | |
80 | fCommonHistsResults4th(NULL), | |
81 | fCommonHistsResults6th(NULL), | |
82 | fCommonHistsResults8th(NULL), | |
83 | fnBinsPhi(0), | |
84 | fPhiMin(0), | |
85 | fPhiMax(0), | |
86 | fPhiBinWidth(0), | |
87 | fnBinsPt(0), | |
88 | fPtMin(0), | |
89 | fPtMax(0), | |
90 | fPtBinWidth(0), | |
91 | fnBinsEta(0), | |
92 | fEtaMin(0), | |
93 | fEtaMax(0), | |
94 | fEtaBinWidth(0), | |
1268c371 | 95 | fCommonConstants(NULL), |
dd442cd2 | 96 | fFillMultipleControlHistograms(kFALSE), |
489d5531 | 97 | fHarmonic(2), |
98 | fAnalysisLabel(NULL), | |
99 | // 2a.) particle weights: | |
100 | fWeightsList(NULL), | |
101 | fUsePhiWeights(kFALSE), | |
102 | fUsePtWeights(kFALSE), | |
103 | fUseEtaWeights(kFALSE), | |
403e3389 | 104 | fUseTrackWeights(kFALSE), |
489d5531 | 105 | fUseParticleWeights(NULL), |
106 | fPhiWeights(NULL), | |
107 | fPtWeights(NULL), | |
108 | fEtaWeights(NULL), | |
109 | // 2b.) event weights: | |
110 | fMultiplicityWeight(NULL), | |
111 | // 3.) integrated flow: | |
112 | fIntFlowList(NULL), | |
113 | fIntFlowProfiles(NULL), | |
114 | fIntFlowResults(NULL), | |
3435cacb | 115 | fIntFlowAllCorrelationsVsM(NULL), |
489d5531 | 116 | fIntFlowFlags(NULL), |
b92ea2b9 | 117 | fApplyCorrectionForNUA(kFALSE), |
2001bc3a | 118 | fApplyCorrectionForNUAVsM(kFALSE), |
9da1a4f3 | 119 | fnBinsMult(10000), |
067e9bc8 | 120 | fMinMult(0.), |
121 | fMaxMult(10000.), | |
b77b6434 | 122 | fPropagateErrorAlsoFromNIT(kFALSE), |
8ed4edc7 | 123 | fCalculateCumulantsVsM(kFALSE), |
3435cacb | 124 | fCalculateAllCorrelationsVsM(kFALSE), |
0dd3b008 | 125 | fMinimumBiasReferenceFlow(kTRUE), |
e5834fcb | 126 | fForgetAboutCovariances(kFALSE), |
127 | fStorePhiDistributionForOneEvent(kFALSE), | |
489d5531 | 128 | fReQ(NULL), |
129 | fImQ(NULL), | |
1268c371 | 130 | fSpk(NULL), |
489d5531 | 131 | fIntFlowCorrelationsEBE(NULL), |
132 | fIntFlowEventWeightsForCorrelationsEBE(NULL), | |
133 | fIntFlowCorrelationsAllEBE(NULL), | |
e5834fcb | 134 | fReferenceMultiplicityEBE(0.), |
489d5531 | 135 | fAvMultiplicity(NULL), |
136 | fIntFlowCorrelationsPro(NULL), | |
b40a910e | 137 | fIntFlowSquaredCorrelationsPro(NULL), |
489d5531 | 138 | fIntFlowCorrelationsAllPro(NULL), |
139 | fIntFlowExtraCorrelationsPro(NULL), | |
140 | fIntFlowProductOfCorrelationsPro(NULL), | |
0328db2d | 141 | fIntFlowProductOfCorrectionTermsForNUAPro(NULL), |
489d5531 | 142 | fIntFlowCorrelationsHist(NULL), |
143 | fIntFlowCorrelationsAllHist(NULL), | |
144 | fIntFlowCovariances(NULL), | |
145 | fIntFlowSumOfProductOfEventWeights(NULL), | |
0328db2d | 146 | fIntFlowCovariancesNUA(NULL), |
147 | fIntFlowSumOfProductOfEventWeightsNUA(NULL), | |
489d5531 | 148 | fIntFlowQcumulants(NULL), |
b92ea2b9 | 149 | fIntFlowQcumulantsRebinnedInM(NULL), |
150 | fIntFlowQcumulantsErrorSquaredRatio(NULL), | |
489d5531 | 151 | fIntFlow(NULL), |
b3dacf6b | 152 | fIntFlowRebinnedInM(NULL), |
2001bc3a | 153 | fIntFlowDetectorBias(NULL), |
489d5531 | 154 | // 4.) differential flow: |
155 | fDiffFlowList(NULL), | |
156 | fDiffFlowProfiles(NULL), | |
157 | fDiffFlowResults(NULL), | |
1268c371 | 158 | fDiffFlow2D(NULL), |
489d5531 | 159 | fDiffFlowFlags(NULL), |
1268c371 | 160 | fCalculateDiffFlow(kTRUE), |
161 | fCalculate2DDiffFlow(kFALSE), | |
62e36168 | 162 | fCalculateDiffFlowVsEta(kTRUE), |
64e500e3 | 163 | // 5.) other differential correlators: |
164 | fOtherDiffCorrelatorsList(NULL), | |
165 | // 6.) distributions: | |
57340a27 | 166 | fDistributionsList(NULL), |
167 | fDistributionsFlags(NULL), | |
489d5531 | 168 | fStoreDistributions(kFALSE), |
64e500e3 | 169 | // 7.) various: |
e5834fcb | 170 | fVariousList(NULL), |
171 | fPhiDistributionForOneEvent(NULL), | |
489d5531 | 172 | // x.) debugging and cross-checking: |
173 | fNestedLoopsList(NULL), | |
174 | fEvaluateIntFlowNestedLoops(kFALSE), | |
175 | fEvaluateDiffFlowNestedLoops(kFALSE), | |
176 | fMaxAllowedMultiplicity(10), | |
177 | fEvaluateNestedLoops(NULL), | |
178 | fIntFlowDirectCorrelations(NULL), | |
179 | fIntFlowExtraDirectCorrelations(NULL), | |
180 | fCrossCheckInPtBinNo(10), | |
3b552efe | 181 | fCrossCheckInEtaBinNo(20), |
489d5531 | 182 | fNoOfParticlesInBin(NULL) |
183 | { | |
184 | // constructor | |
185 | ||
186 | // base list to hold all output objects: | |
187 | fHistList = new TList(); | |
188 | fHistList->SetName("cobjQC"); | |
189 | fHistList->SetOwner(kTRUE); | |
190 | ||
191 | // list to hold histograms with phi, pt and eta weights: | |
192 | fWeightsList = new TList(); | |
193 | ||
194 | // multiplicity weight: | |
195 | fMultiplicityWeight = new TString("combinations"); | |
196 | ||
197 | // analysis label; | |
198 | fAnalysisLabel = new TString(); | |
199 | ||
200 | // initialize all arrays: | |
201 | this->InitializeArraysForIntFlow(); | |
202 | this->InitializeArraysForDiffFlow(); | |
203 | this->InitializeArraysForDistributions(); | |
e5834fcb | 204 | this->InitializeArraysForVarious(); |
489d5531 | 205 | this->InitializeArraysForNestedLoops(); |
206 | ||
207 | } // end of constructor | |
208 | ||
489d5531 | 209 | //================================================================================================================ |
210 | ||
489d5531 | 211 | AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants() |
212 | { | |
213 | // destructor | |
214 | ||
215 | delete fHistList; | |
216 | ||
217 | } // end of AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants() | |
218 | ||
489d5531 | 219 | //================================================================================================================ |
220 | ||
489d5531 | 221 | void AliFlowAnalysisWithQCumulants::Init() |
222 | { | |
3b552efe | 223 | // a) Cross check if the settings make sense before starting the QC adventure; |
489d5531 | 224 | // b) Access all common constants; |
225 | // c) Book all objects; | |
3b552efe | 226 | // d) Store flags for integrated and differential flow; |
489d5531 | 227 | // e) Store flags for distributions of corelations; |
228 | // f) Store harmonic which will be estimated. | |
3b552efe | 229 | |
489d5531 | 230 | //save old value and prevent histograms from being added to directory |
231 | //to avoid name clashes in case multiple analaysis objects are used | |
232 | //in an analysis | |
233 | Bool_t oldHistAddStatus = TH1::AddDirectoryStatus(); | |
234 | TH1::AddDirectory(kFALSE); | |
235 | ||
3b552efe | 236 | // a) Cross check if the settings make sense before starting the QC adventure; |
489d5531 | 237 | this->CrossCheckSettings(); |
1268c371 | 238 | // b) Access all common constants and book a profile to hold them: |
239 | this->CommonConstants("Init"); | |
489d5531 | 240 | // c) Book all objects: |
1268c371 | 241 | this->BookAndFillWeightsHistograms(); |
489d5531 | 242 | this->BookAndNestAllLists(); |
243 | this->BookCommonHistograms(); | |
244 | this->BookEverythingForIntegratedFlow(); | |
245 | this->BookEverythingForDifferentialFlow(); | |
1268c371 | 246 | this->BookEverythingFor2DDifferentialFlow(); |
489d5531 | 247 | this->BookEverythingForDistributions(); |
e5834fcb | 248 | this->BookEverythingForVarious(); |
489d5531 | 249 | this->BookEverythingForNestedLoops(); |
250 | // d) Store flags for integrated and differential flow: | |
251 | this->StoreIntFlowFlags(); | |
3b552efe | 252 | this->StoreDiffFlowFlags(); |
489d5531 | 253 | // e) Store flags for distributions of corelations: |
254 | this->StoreFlagsForDistributions(); | |
255 | // f) Store harmonic which will be estimated: | |
256 | this->StoreHarmonic(); | |
257 | ||
258 | TH1::AddDirectory(oldHistAddStatus); | |
259 | } // end of void AliFlowAnalysisWithQCumulants::Init() | |
260 | ||
489d5531 | 261 | //================================================================================================================ |
262 | ||
489d5531 | 263 | void AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent) |
264 | { | |
265 | // Running over data only in this method. | |
266 | ||
b3dacf6b | 267 | // a) Check all pointers used in this method; |
268 | // b) Define local variables; | |
269 | // c) Fill the common control histograms and call the method to fill fAvMultiplicity; | |
1268c371 | 270 | // d) Loop over data and calculate e-b-e quantities Q_{n,k}, S_{p,k} and s_{p,k}; |
271 | // e) Calculate the final expressions for S_{p,k} and s_{p,k} (important !!!!); | |
272 | // f) Call the methods which calculate correlations for reference flow; | |
273 | // g) Call the methods which calculate correlations for differential flow; | |
274 | // h) Call the methods which calculate correlations for 2D differential flow; | |
64e500e3 | 275 | // i) Call the methods which calculate other differential correlators; |
276 | // j) Distributions of correlations; | |
277 | // k) Store phi distribution for one event to illustrate flow; | |
278 | // l) Cross-check with nested loops correlators for reference flow; | |
279 | // m) Cross-check with nested loops correlators for differential flow; | |
280 | // n) Reset all event-by-event quantities (very important !!!!). | |
489d5531 | 281 | |
b3dacf6b | 282 | // a) Check all pointers used in this method: |
283 | this->CheckPointersUsedInMake(); | |
284 | ||
285 | // b) Define local variables: | |
489d5531 | 286 | Double_t dPhi = 0.; // azimuthal angle in the laboratory frame |
287 | Double_t dPt = 0.; // transverse momentum | |
288 | Double_t dEta = 0.; // pseudorapidity | |
489d5531 | 289 | Double_t wPhi = 1.; // phi weight |
290 | Double_t wPt = 1.; // pt weight | |
291 | Double_t wEta = 1.; // eta weight | |
38a1e8b3 | 292 | Double_t wTrack = 1.; // track weight |
1268c371 | 293 | Int_t nRP = anEvent->GetEventNSelTracksRP(); // number of RPs (i.e. number of reference particles) |
e5834fcb | 294 | fReferenceMultiplicityEBE = anEvent->GetReferenceMultiplicity(); // reference multiplicity for current event |
1268c371 | 295 | Double_t ptEta[2] = {0.,0.}; // 0 = dPt, 1 = dEta |
9f33751d | 296 | |
b3dacf6b | 297 | // c) Fill the common control histograms and call the method to fill fAvMultiplicity: |
489d5531 | 298 | this->FillCommonControlHistograms(anEvent); |
299 | this->FillAverageMultiplicities(nRP); | |
300 | ||
1268c371 | 301 | // d) Loop over data and calculate e-b-e quantities Q_{n,k}, S_{p,k} and s_{p,k}: |
9f33751d | 302 | Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = total number of primary tracks, i.e. nPrim = nRP + nPOI where: |
1268c371 | 303 | // nRP = # of reference particles; |
304 | // nPOI = # of particles of interest. | |
489d5531 | 305 | AliFlowTrackSimple *aftsTrack = NULL; |
1268c371 | 306 | Int_t n = fHarmonic; // shortcut for the harmonic |
489d5531 | 307 | for(Int_t i=0;i<nPrim;i++) |
308 | { | |
309 | aftsTrack=anEvent->GetTrack(i); | |
310 | if(aftsTrack) | |
311 | { | |
1268c371 | 312 | if(!(aftsTrack->InRPSelection() || aftsTrack->InPOISelection())){continue;} // safety measure: consider only tracks which are RPs or POIs |
489d5531 | 313 | if(aftsTrack->InRPSelection()) // RP condition: |
314 | { | |
315 | dPhi = aftsTrack->Phi(); | |
316 | dPt = aftsTrack->Pt(); | |
317 | dEta = aftsTrack->Eta(); | |
318 | if(fUsePhiWeights && fPhiWeights && fnBinsPhi) // determine phi weight for this particle: | |
319 | { | |
320 | wPhi = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(dPhi*fnBinsPhi/TMath::TwoPi()))); | |
321 | } | |
322 | if(fUsePtWeights && fPtWeights && fnBinsPt) // determine pt weight for this particle: | |
323 | { | |
324 | wPt = fPtWeights->GetBinContent(1+(Int_t)(TMath::Floor((dPt-fPtMin)/fPtBinWidth))); | |
325 | } | |
326 | if(fUseEtaWeights && fEtaWeights && fEtaBinWidth) // determine eta weight for this particle: | |
327 | { | |
328 | wEta = fEtaWeights->GetBinContent(1+(Int_t)(TMath::Floor((dEta-fEtaMin)/fEtaBinWidth))); | |
38a1e8b3 | 329 | } |
330 | // Access track weight: | |
403e3389 | 331 | if(fUseTrackWeights) |
332 | { | |
333 | wTrack = aftsTrack->Weight(); | |
334 | } | |
1268c371 | 335 | // Calculate Re[Q_{m*n,k}] and Im[Q_{m*n,k}] for this event (m = 1,2,...,6, k = 0,1,...,8): |
336 | for(Int_t m=0;m<6;m++) // to be improved - hardwired 6 | |
489d5531 | 337 | { |
1268c371 | 338 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 |
489d5531 | 339 | { |
38a1e8b3 | 340 | (*fReQ)(m,k)+=pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1)*n*dPhi); |
341 | (*fImQ)(m,k)+=pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1)*n*dPhi); | |
489d5531 | 342 | } |
343 | } | |
1268c371 | 344 | // Calculate S_{p,k} for this event (Remark: final calculation of S_{p,k} follows after the loop over data bellow): |
489d5531 | 345 | for(Int_t p=0;p<8;p++) |
346 | { | |
347 | for(Int_t k=0;k<9;k++) | |
348 | { | |
38a1e8b3 | 349 | (*fSpk)(p,k)+=pow(wPhi*wPt*wEta*wTrack,k); |
489d5531 | 350 | } |
351 | } | |
1268c371 | 352 | // Differential flow: |
353 | if(fCalculateDiffFlow || fCalculate2DDiffFlow) | |
489d5531 | 354 | { |
1268c371 | 355 | ptEta[0] = dPt; |
356 | ptEta[1] = dEta; | |
357 | // Calculate r_{m*n,k} and s_{p,k} (r_{m,k} is 'p-vector' for RPs): | |
358 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
489d5531 | 359 | { |
1268c371 | 360 | for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 |
489d5531 | 361 | { |
1268c371 | 362 | if(fCalculateDiffFlow) |
363 | { | |
62e36168 | 364 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
1268c371 | 365 | { |
38a1e8b3 | 366 | fReRPQ1dEBE[0][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
367 | fImRPQ1dEBE[0][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 368 | if(m==0) // s_{p,k} does not depend on index m |
369 | { | |
38a1e8b3 | 370 | fs1dEBE[0][pe][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k),1.); |
1268c371 | 371 | } // end of if(m==0) // s_{p,k} does not depend on index m |
372 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
373 | } // end of if(fCalculateDiffFlow) | |
374 | if(fCalculate2DDiffFlow) | |
375 | { | |
38a1e8b3 | 376 | fReRPQ2dEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
377 | fImRPQ2dEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 378 | if(m==0) // s_{p,k} does not depend on index m |
379 | { | |
38a1e8b3 | 380 | fs2dEBE[0][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k),1.); |
1268c371 | 381 | } // end of if(m==0) // s_{p,k} does not depend on index m |
382 | } // end of if(fCalculate2DDiffFlow) | |
383 | } // end of for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 | |
384 | } // end of for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
385 | // Checking if RP particle is also POI particle: | |
386 | if(aftsTrack->InPOISelection()) | |
489d5531 | 387 | { |
1268c371 | 388 | // Calculate q_{m*n,k} and s_{p,k} ('q-vector' and 's' for RPs && POIs): |
389 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
489d5531 | 390 | { |
1268c371 | 391 | for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 |
489d5531 | 392 | { |
1268c371 | 393 | if(fCalculateDiffFlow) |
394 | { | |
62e36168 | 395 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
1268c371 | 396 | { |
38a1e8b3 | 397 | fReRPQ1dEBE[2][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
398 | fImRPQ1dEBE[2][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 399 | if(m==0) // s_{p,k} does not depend on index m |
400 | { | |
38a1e8b3 | 401 | fs1dEBE[2][pe][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k),1.); |
1268c371 | 402 | } // end of if(m==0) // s_{p,k} does not depend on index m |
403 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
404 | } // end of if(fCalculateDiffFlow) | |
405 | if(fCalculate2DDiffFlow) | |
406 | { | |
38a1e8b3 | 407 | fReRPQ2dEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
408 | fImRPQ2dEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 409 | if(m==0) // s_{p,k} does not depend on index m |
410 | { | |
38a1e8b3 | 411 | fs2dEBE[2][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k),1.); |
1268c371 | 412 | } // end of if(m==0) // s_{p,k} does not depend on index m |
413 | } // end of if(fCalculate2DDiffFlow) | |
414 | } // end of for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 | |
415 | } // end of for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
416 | } // end of if(aftsTrack->InPOISelection()) | |
417 | } // end of if(fCalculateDiffFlow || fCalculate2DDiffFlow) | |
489d5531 | 418 | } // end of if(pTrack->InRPSelection()) |
489d5531 | 419 | if(aftsTrack->InPOISelection()) |
420 | { | |
421 | dPhi = aftsTrack->Phi(); | |
422 | dPt = aftsTrack->Pt(); | |
423 | dEta = aftsTrack->Eta(); | |
38a1e8b3 | 424 | wPhi = 1.; |
425 | wPt = 1.; | |
426 | wEta = 1.; | |
427 | wTrack = 1.; | |
428 | if(fUsePhiWeights && fPhiWeights && fnBinsPhi && aftsTrack->InRPSelection()) // determine phi weight for POI && RP particle: | |
429 | { | |
430 | wPhi = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(dPhi*fnBinsPhi/TMath::TwoPi()))); | |
431 | } | |
432 | if(fUsePtWeights && fPtWeights && fnBinsPt && aftsTrack->InRPSelection()) // determine pt weight for POI && RP particle: | |
433 | { | |
434 | wPt = fPtWeights->GetBinContent(1+(Int_t)(TMath::Floor((dPt-fPtMin)/fPtBinWidth))); | |
435 | } | |
436 | if(fUseEtaWeights && fEtaWeights && fEtaBinWidth && aftsTrack->InRPSelection()) // determine eta weight for POI && RP particle: | |
437 | { | |
438 | wEta = fEtaWeights->GetBinContent(1+(Int_t)(TMath::Floor((dEta-fEtaMin)/fEtaBinWidth))); | |
439 | } | |
440 | // Access track weight for POI && RP particle: | |
403e3389 | 441 | if(aftsTrack->InRPSelection() && fUseTrackWeights) |
38a1e8b3 | 442 | { |
443 | wTrack = aftsTrack->Weight(); | |
444 | } | |
1268c371 | 445 | ptEta[0] = dPt; |
446 | ptEta[1] = dEta; | |
447 | // Calculate p_{m*n,k} ('p-vector' for POIs): | |
448 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
489d5531 | 449 | { |
1268c371 | 450 | for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 |
489d5531 | 451 | { |
1268c371 | 452 | if(fCalculateDiffFlow) |
453 | { | |
62e36168 | 454 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
1268c371 | 455 | { |
38a1e8b3 | 456 | fReRPQ1dEBE[1][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
457 | fImRPQ1dEBE[1][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 458 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta |
459 | } // end of if(fCalculateDiffFlow) | |
460 | if(fCalculate2DDiffFlow) | |
461 | { | |
38a1e8b3 | 462 | fReRPQ2dEBE[1][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
463 | fImRPQ2dEBE[1][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 464 | } // end of if(fCalculate2DDiffFlow) |
465 | } // end of for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 | |
466 | } // end of for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
b77b6434 | 467 | } // end of if(pTrack->InPOISelection()) |
489d5531 | 468 | } else // to if(aftsTrack) |
469 | { | |
38a1e8b3 | 470 | printf("\n WARNING (QC): No particle (i.e. aftsTrack is a NULL pointer in AFAWQC::Make())!!!!\n\n"); |
489d5531 | 471 | } |
472 | } // end of for(Int_t i=0;i<nPrim;i++) | |
473 | ||
1268c371 | 474 | // e) Calculate the final expressions for S_{p,k} and s_{p,k} (important !!!!): |
489d5531 | 475 | for(Int_t p=0;p<8;p++) |
476 | { | |
477 | for(Int_t k=0;k<9;k++) | |
478 | { | |
1268c371 | 479 | (*fSpk)(p,k)=pow((*fSpk)(p,k),p+1); |
480 | // ... for the time being s_{p,k} dosn't need higher powers, so no need to finalize it here ... | |
481 | } // end of for(Int_t k=0;k<9;k++) | |
482 | } // end of for(Int_t p=0;p<8;p++) | |
489d5531 | 483 | |
1268c371 | 484 | // f) Call the methods which calculate correlations for reference flow: |
489d5531 | 485 | if(!fEvaluateIntFlowNestedLoops) |
486 | { | |
403e3389 | 487 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 488 | { |
1268c371 | 489 | if(nRP>1){this->CalculateIntFlowCorrelations();} // without using particle weights |
403e3389 | 490 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 491 | { |
1268c371 | 492 | if(nRP>1){this->CalculateIntFlowCorrelationsUsingParticleWeights();} // with using particle weights |
493 | } | |
494 | // Whether or not using particle weights the following is calculated in the same way: | |
495 | if(nRP>3){this->CalculateIntFlowProductOfCorrelations();} | |
496 | if(nRP>1){this->CalculateIntFlowSumOfEventWeights();} | |
497 | if(nRP>1){this->CalculateIntFlowSumOfProductOfEventWeights();} | |
498 | // Non-isotropic terms: | |
403e3389 | 499 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 500 | { |
1268c371 | 501 | if(nRP>0){this->CalculateIntFlowCorrectionsForNUASinTerms();} |
502 | if(nRP>0){this->CalculateIntFlowCorrectionsForNUACosTerms();} | |
403e3389 | 503 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
b92ea2b9 | 504 | { |
1268c371 | 505 | if(nRP>0){this->CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights();} |
506 | if(nRP>0){this->CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights();} | |
507 | } | |
508 | // Whether or not using particle weights the following is calculated in the same way: | |
509 | if(nRP>0){this->CalculateIntFlowProductOfCorrectionTermsForNUA();} | |
510 | if(nRP>0){this->CalculateIntFlowSumOfEventWeightsNUA();} | |
511 | if(nRP>0){this->CalculateIntFlowSumOfProductOfEventWeightsNUA();} | |
489d5531 | 512 | } // end of if(!fEvaluateIntFlowNestedLoops) |
513 | ||
1268c371 | 514 | // g) Call the methods which calculate correlations for differential flow: |
515 | if(!fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) | |
489d5531 | 516 | { |
403e3389 | 517 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 518 | { |
1268c371 | 519 | // Without using particle weights: |
489d5531 | 520 | this->CalculateDiffFlowCorrelations("RP","Pt"); |
62e36168 | 521 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrelations("RP","Eta");} |
489d5531 | 522 | this->CalculateDiffFlowCorrelations("POI","Pt"); |
62e36168 | 523 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrelations("POI","Eta");} |
1268c371 | 524 | // Non-isotropic terms: |
b92ea2b9 | 525 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Pt"); |
62e36168 | 526 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Eta");} |
b92ea2b9 | 527 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Pt"); |
62e36168 | 528 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Eta");} |
b92ea2b9 | 529 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Pt"); |
62e36168 | 530 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Eta");} |
b92ea2b9 | 531 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Pt"); |
62e36168 | 532 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Eta");} |
403e3389 | 533 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 534 | { |
1268c371 | 535 | // With using particle weights: |
489d5531 | 536 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Pt"); |
62e36168 | 537 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Eta");} |
489d5531 | 538 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Pt"); |
62e36168 | 539 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Eta");} |
1268c371 | 540 | // Non-isotropic terms: |
b92ea2b9 | 541 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Pt"); |
62e36168 | 542 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Eta");} |
b92ea2b9 | 543 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Pt"); |
62e36168 | 544 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Eta");} |
b92ea2b9 | 545 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Pt"); |
62e36168 | 546 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Eta");} |
b92ea2b9 | 547 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Pt"); |
62e36168 | 548 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Eta");} |
1268c371 | 549 | } |
550 | // Whether or not using particle weights the following is calculated in the same way: | |
489d5531 | 551 | this->CalculateDiffFlowProductOfCorrelations("RP","Pt"); |
62e36168 | 552 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowProductOfCorrelations("RP","Eta");} |
489d5531 | 553 | this->CalculateDiffFlowProductOfCorrelations("POI","Pt"); |
62e36168 | 554 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowProductOfCorrelations("POI","Eta");} |
489d5531 | 555 | this->CalculateDiffFlowSumOfEventWeights("RP","Pt"); |
62e36168 | 556 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowSumOfEventWeights("RP","Eta");} |
489d5531 | 557 | this->CalculateDiffFlowSumOfEventWeights("POI","Pt"); |
62e36168 | 558 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowSumOfEventWeights("POI","Eta");} |
489d5531 | 559 | this->CalculateDiffFlowSumOfProductOfEventWeights("RP","Pt"); |
62e36168 | 560 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowSumOfProductOfEventWeights("RP","Eta");} |
489d5531 | 561 | this->CalculateDiffFlowSumOfProductOfEventWeights("POI","Pt"); |
62e36168 | 562 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowSumOfProductOfEventWeights("POI","Eta");} |
1268c371 | 563 | } // end of if(!fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) |
489d5531 | 564 | |
1268c371 | 565 | // h) Call the methods which calculate correlations for 2D differential flow: |
566 | if(!fEvaluateDiffFlowNestedLoops && fCalculate2DDiffFlow) | |
567 | { | |
403e3389 | 568 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 569 | { |
1268c371 | 570 | // Without using particle weights: |
571 | this->Calculate2DDiffFlowCorrelations("RP"); | |
572 | this->Calculate2DDiffFlowCorrelations("POI"); | |
573 | // Non-isotropic terms: | |
574 | // ... to be ctd ... | |
403e3389 | 575 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
1268c371 | 576 | { |
577 | // With using particle weights: | |
578 | // ... to be ctd ... | |
579 | // Non-isotropic terms: | |
580 | // ... to be ctd ... | |
581 | } | |
582 | // Whether or not using particle weights the following is calculated in the same way: | |
583 | // ... to be ctd ... | |
584 | } // end of if(!fEvaluateDiffFlowNestedLoops && fCalculate2DDiffFlow) | |
64e500e3 | 585 | |
586 | // i) Call the methods which calculate other differential correlators: | |
b84464d3 | 587 | if(!fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) |
64e500e3 | 588 | { |
403e3389 | 589 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
64e500e3 | 590 | { |
591 | // Without using particle weights: | |
592 | this->CalculateOtherDiffCorrelators("RP","Pt"); | |
62e36168 | 593 | if(fCalculateDiffFlowVsEta){this->CalculateOtherDiffCorrelators("RP","Eta");} |
64e500e3 | 594 | this->CalculateOtherDiffCorrelators("POI","Pt"); |
62e36168 | 595 | if(fCalculateDiffFlowVsEta){this->CalculateOtherDiffCorrelators("POI","Eta");} |
403e3389 | 596 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
64e500e3 | 597 | { |
598 | // With using particle weights: | |
599 | // ... to be ctd ... | |
600 | } | |
601 | // Whether or not using particle weights the following is calculated in the same way: | |
602 | // ... to be ctd ... | |
603 | } // end of if(!fEvaluateDiffFlowNestedLoops) | |
604 | ||
605 | // j) Distributions of correlations: | |
e5834fcb | 606 | if(fStoreDistributions){this->StoreDistributionsOfCorrelations();} |
607 | ||
64e500e3 | 608 | // k) Store phi distribution for one event to illustrate flow: |
e5834fcb | 609 | if(fStorePhiDistributionForOneEvent){this->StorePhiDistributionForOneEvent(anEvent);} |
1268c371 | 610 | |
64e500e3 | 611 | // l) Cross-check with nested loops correlators for reference flow: |
1268c371 | 612 | if(fEvaluateIntFlowNestedLoops){this->EvaluateIntFlowNestedLoops(anEvent);} |
613 | ||
64e500e3 | 614 | // m) Cross-check with nested loops correlators for differential flow: |
1268c371 | 615 | if(fEvaluateDiffFlowNestedLoops){this->EvaluateDiffFlowNestedLoops(anEvent);} |
489d5531 | 616 | |
64e500e3 | 617 | // n) Reset all event-by-event quantities (very important !!!!): |
489d5531 | 618 | this->ResetEventByEventQuantities(); |
619 | ||
620 | } // end of AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent) | |
621 | ||
489d5531 | 622 | //================================================================================================================================ |
623 | ||
489d5531 | 624 | void AliFlowAnalysisWithQCumulants::Finish() |
625 | { | |
626 | // Calculate the final results. | |
489d5531 | 627 | |
b3dacf6b | 628 | // a) Check all pointers used in this method; |
629 | // b) Acces the constants; | |
630 | // c) Access the flags; | |
b92ea2b9 | 631 | // d) Calculate reference cumulants (not corrected for detector effects); |
632 | // e) Correct reference cumulants for detector effects; | |
633 | // f) Calculate reference flow; | |
b77b6434 | 634 | // g) Store results for reference flow in AliFlowCommonHistResults and print them on the screen; |
b92ea2b9 | 635 | // h) Calculate the final results for differential flow (without/with weights); |
636 | // i) Correct the results for differential flow (without/with weights) for effects of non-uniform acceptance (NUA); | |
637 | // j) Calculate the final results for integrated flow (RP/POI) and store in AliFlowCommonHistResults; | |
638 | // k) Store results for differential flow in AliFlowCommonHistResults; | |
639 | // l) Print the final results for integrated flow (RP/POI) on the screen; | |
640 | // m) Cross-checking: Results from Q-vectors vs results from nested loops. | |
b3dacf6b | 641 | |
642 | // a) Check all pointers used in this method: | |
643 | this->CheckPointersUsedInFinish(); | |
644 | ||
645 | // b) Acces the constants: | |
1268c371 | 646 | this->CommonConstants("Finish"); |
489d5531 | 647 | |
b3dacf6b | 648 | if(fCommonHists && fCommonHists->GetHarmonic()) // to be improved (moved somewhere else) |
489d5531 | 649 | { |
b3dacf6b | 650 | fHarmonic = (Int_t)(fCommonHists->GetHarmonic())->GetBinContent(1); |
489d5531 | 651 | } |
b3dacf6b | 652 | |
1268c371 | 653 | // c) Access the flags: // to be improved (implement a method for this? should I store again the flags becose they can get modified with redoFinish?) |
b3dacf6b | 654 | fUsePhiWeights = (Bool_t)fUseParticleWeights->GetBinContent(1); |
655 | fUsePtWeights = (Bool_t)fUseParticleWeights->GetBinContent(2); | |
656 | fUseEtaWeights = (Bool_t)fUseParticleWeights->GetBinContent(3); | |
403e3389 | 657 | fUseTrackWeights = (Bool_t)fUseParticleWeights->GetBinContent(4); |
b3dacf6b | 658 | fApplyCorrectionForNUA = (Bool_t)fIntFlowFlags->GetBinContent(3); |
659 | fPrintFinalResults[0] = (Bool_t)fIntFlowFlags->GetBinContent(4); | |
660 | fPrintFinalResults[1] = (Bool_t)fIntFlowFlags->GetBinContent(5); | |
661 | fPrintFinalResults[2] = (Bool_t)fIntFlowFlags->GetBinContent(6); | |
662 | fPrintFinalResults[3] = (Bool_t)fIntFlowFlags->GetBinContent(7); | |
663 | fApplyCorrectionForNUAVsM = (Bool_t)fIntFlowFlags->GetBinContent(8); | |
b77b6434 | 664 | fPropagateErrorAlsoFromNIT = (Bool_t)fIntFlowFlags->GetBinContent(9); |
0dd3b008 | 665 | fCalculateCumulantsVsM = (Bool_t)fIntFlowFlags->GetBinContent(10); |
666 | fMinimumBiasReferenceFlow = (Bool_t)fIntFlowFlags->GetBinContent(11); | |
e5834fcb | 667 | fForgetAboutCovariances = (Bool_t)fIntFlowFlags->GetBinContent(12); |
668 | fStorePhiDistributionForOneEvent = (Bool_t)fIntFlowFlags->GetBinContent(13); | |
3435cacb | 669 | fFillMultipleControlHistograms = (Bool_t)fIntFlowFlags->GetBinContent(14); |
670 | fCalculateAllCorrelationsVsM = (Bool_t)fIntFlowFlags->GetBinContent(15); | |
b3dacf6b | 671 | fEvaluateIntFlowNestedLoops = (Bool_t)fEvaluateNestedLoops->GetBinContent(1); |
672 | fEvaluateDiffFlowNestedLoops = (Bool_t)fEvaluateNestedLoops->GetBinContent(2); | |
489d5531 | 673 | fCrossCheckInPtBinNo = (Int_t)fEvaluateNestedLoops->GetBinContent(3); |
674 | fCrossCheckInEtaBinNo = (Int_t)fEvaluateNestedLoops->GetBinContent(4); | |
1268c371 | 675 | |
b92ea2b9 | 676 | // d) Calculate reference cumulants (not corrected for detector effects): |
489d5531 | 677 | this->FinalizeCorrelationsIntFlow(); |
678 | this->CalculateCovariancesIntFlow(); | |
679 | this->CalculateCumulantsIntFlow(); | |
489d5531 | 680 | |
b92ea2b9 | 681 | // e) Correct reference cumulants for detector effects: |
682 | this->FinalizeCorrectionTermsForNUAIntFlow(); | |
683 | this->CalculateCovariancesNUAIntFlow(); | |
684 | this->CalculateQcumulantsCorrectedForNUAIntFlow(); | |
685 | ||
686 | // f) Calculate reference flow: | |
687 | this->CalculateReferenceFlow(); | |
489d5531 | 688 | |
b77b6434 | 689 | // g) Store results for reference flow in AliFlowCommonHistResults and print them on the screen: |
489d5531 | 690 | this->FillCommonHistResultsIntFlow(); |
b3dacf6b | 691 | if(fPrintFinalResults[0]){this->PrintFinalResultsForIntegratedFlow("RF");} |
692 | if(fPrintFinalResults[3] && fCalculateCumulantsVsM){this->PrintFinalResultsForIntegratedFlow("RF, rebinned in M");} | |
489d5531 | 693 | |
1268c371 | 694 | // h) Calculate the final results for differential flow (without/with weights): |
695 | if(fCalculateDiffFlow) | |
696 | { | |
697 | this->FinalizeReducedCorrelations("RP","Pt"); | |
62e36168 | 698 | if(fCalculateDiffFlowVsEta){this->FinalizeReducedCorrelations("RP","Eta");} |
1268c371 | 699 | this->FinalizeReducedCorrelations("POI","Pt"); |
62e36168 | 700 | if(fCalculateDiffFlowVsEta){this->FinalizeReducedCorrelations("POI","Eta");} |
1268c371 | 701 | this->CalculateDiffFlowCovariances("RP","Pt"); |
62e36168 | 702 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCovariances("RP","Eta");} |
1268c371 | 703 | this->CalculateDiffFlowCovariances("POI","Pt"); |
62e36168 | 704 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCovariances("POI","Eta");} |
1268c371 | 705 | this->CalculateDiffFlowCumulants("RP","Pt"); |
62e36168 | 706 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCumulants("RP","Eta");} |
1268c371 | 707 | this->CalculateDiffFlowCumulants("POI","Pt"); |
62e36168 | 708 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCumulants("POI","Eta");} |
1268c371 | 709 | this->CalculateDiffFlow("RP","Pt"); |
62e36168 | 710 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlow("RP","Eta");} |
1268c371 | 711 | this->CalculateDiffFlow("POI","Pt"); |
62e36168 | 712 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlow("POI","Eta");} |
1268c371 | 713 | } // if(fCalculateDiffFlow) |
714 | ||
715 | // i) Correct the results for differential flow (without/with weights) for effects of non-uniform acceptance (NUA): | |
716 | if(fCalculateDiffFlow) | |
489d5531 | 717 | { |
718 | this->FinalizeCorrectionTermsForNUADiffFlow("RP","Pt"); | |
62e36168 | 719 | if(fCalculateDiffFlowVsEta){this->FinalizeCorrectionTermsForNUADiffFlow("RP","Eta");} |
489d5531 | 720 | this->FinalizeCorrectionTermsForNUADiffFlow("POI","Pt"); |
62e36168 | 721 | if(fCalculateDiffFlowVsEta){this->FinalizeCorrectionTermsForNUADiffFlow("POI","Eta");} |
489d5531 | 722 | this->CalculateDiffFlowCumulantsCorrectedForNUA("RP","Pt"); |
62e36168 | 723 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCumulantsCorrectedForNUA("RP","Eta");} |
489d5531 | 724 | this->CalculateDiffFlowCumulantsCorrectedForNUA("POI","Pt"); |
62e36168 | 725 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCumulantsCorrectedForNUA("POI","Eta");} |
1268c371 | 726 | if(fApplyCorrectionForNUA) |
727 | { | |
728 | this->CalculateDiffFlowCorrectedForNUA("RP","Pt"); | |
62e36168 | 729 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectedForNUA("RP","Eta");} |
1268c371 | 730 | this->CalculateDiffFlowCorrectedForNUA("POI","Pt"); |
62e36168 | 731 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectedForNUA("POI","Eta");} |
1268c371 | 732 | } |
733 | } // end of if(fCalculateDiffFlow && fApplyCorrectionForNUA) | |
734 | ||
735 | // i) Calcualate final results for 2D differential flow: | |
736 | if(fCalculate2DDiffFlow) | |
737 | { | |
738 | this->Calculate2DDiffFlowCumulants("RP"); | |
739 | this->Calculate2DDiffFlowCumulants("POI"); | |
740 | this->Calculate2DDiffFlow("RP"); | |
741 | this->Calculate2DDiffFlow("POI"); | |
742 | } // end of if(fCalculate2DDiffFlow) | |
743 | ||
744 | // j) Calculate the final results for integrated flow (RP/POI) and store in AliFlowCommonHistResults: | |
745 | if(fCalculateDiffFlow) | |
746 | { | |
747 | this->CalculateFinalResultsForRPandPOIIntegratedFlow("RP"); | |
748 | this->CalculateFinalResultsForRPandPOIIntegratedFlow("POI"); | |
3b552efe | 749 | } |
489d5531 | 750 | |
1268c371 | 751 | // k) Store results for differential flow in AliFlowCommonHistResults: |
752 | if(fCalculateDiffFlow) | |
753 | { | |
754 | this->FillCommonHistResultsDiffFlow("RP"); | |
755 | this->FillCommonHistResultsDiffFlow("POI"); | |
756 | } | |
757 | ||
758 | // l) Print the final results for integrated flow (RP/POI) on the screen: | |
759 | if(fPrintFinalResults[1] && fCalculateDiffFlow){this->PrintFinalResultsForIntegratedFlow("RP");} | |
760 | if(fPrintFinalResults[2] && fCalculateDiffFlow){this->PrintFinalResultsForIntegratedFlow("POI");} | |
761 | ||
762 | // m) Cross-checking: Results from Q-vectors vs results from nested loops: | |
763 | // m1) Reference flow: | |
489d5531 | 764 | if(fEvaluateIntFlowNestedLoops) |
765 | { | |
766 | this->CrossCheckIntFlowCorrelations(); | |
767 | this->CrossCheckIntFlowCorrectionTermsForNUA(); | |
403e3389 | 768 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights){this->CrossCheckIntFlowExtraCorrelations();} |
489d5531 | 769 | } // end of if(fEvaluateIntFlowNestedLoops) |
1268c371 | 770 | // m2) Differential flow: |
771 | if(fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) | |
489d5531 | 772 | { |
b3dacf6b | 773 | // Correlations: |
489d5531 | 774 | this->PrintNumberOfParticlesInSelectedBin(); |
775 | this->CrossCheckDiffFlowCorrelations("RP","Pt"); | |
62e36168 | 776 | if(fCalculateDiffFlowVsEta){this->CrossCheckDiffFlowCorrelations("RP","Eta");} |
489d5531 | 777 | this->CrossCheckDiffFlowCorrelations("POI","Pt"); |
62e36168 | 778 | if(fCalculateDiffFlowVsEta){this->CrossCheckDiffFlowCorrelations("POI","Eta");} |
b3dacf6b | 779 | // Correction terms for non-uniform acceptance: |
489d5531 | 780 | this->CrossCheckDiffFlowCorrectionTermsForNUA("RP","Pt"); |
62e36168 | 781 | if(fCalculateDiffFlowVsEta){this->CrossCheckDiffFlowCorrectionTermsForNUA("RP","Eta");} |
489d5531 | 782 | this->CrossCheckDiffFlowCorrectionTermsForNUA("POI","Pt"); |
62e36168 | 783 | if(fCalculateDiffFlowVsEta){this->CrossCheckDiffFlowCorrectionTermsForNUA("POI","Eta");} |
64e500e3 | 784 | // Other differential correlators: |
785 | this->CrossCheckOtherDiffCorrelators("RP","Pt"); | |
62e36168 | 786 | if(fCalculateDiffFlowVsEta){this->CrossCheckOtherDiffCorrelators("RP","Eta");} |
64e500e3 | 787 | this->CrossCheckOtherDiffCorrelators("POI","Pt"); |
62e36168 | 788 | if(fCalculateDiffFlowVsEta){this->CrossCheckOtherDiffCorrelators("POI","Eta");} |
489d5531 | 789 | } // end of if(fEvaluateDiffFlowNestedLoops) |
790 | ||
791 | } // end of AliFlowAnalysisWithQCumulants::Finish() | |
792 | ||
489d5531 | 793 | //================================================================================================================================ |
794 | ||
1268c371 | 795 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowNestedLoops(AliFlowEventSimple* anEvent) |
796 | { | |
797 | // Evalauted all correlators for reference flow with nested loops. | |
798 | ||
799 | Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = nRP + nPOI | |
800 | if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 | |
801 | { | |
802 | // Without using particle weights: | |
403e3389 | 803 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
1268c371 | 804 | { |
805 | // Correlations: | |
806 | this->CalculateIntFlowCorrelations(); // from Q-vectors | |
807 | this->EvaluateIntFlowCorrelationsWithNestedLoops(anEvent); // from nested loops (to be improved: do I have to pass here anEvent or not?) | |
808 | // Correction for non-uniform acceptance: | |
809 | this->CalculateIntFlowCorrectionsForNUASinTerms(); // from Q-vectors (sin terms) | |
810 | this->CalculateIntFlowCorrectionsForNUACosTerms(); // from Q-vectors (cos terms) | |
811 | this->EvaluateIntFlowCorrectionsForNUAWithNestedLoops(anEvent); // from nested loops (both sin and cos terms) | |
812 | } | |
813 | // Using particle weights: | |
403e3389 | 814 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
1268c371 | 815 | { |
816 | // Correlations | |
817 | this->CalculateIntFlowCorrelationsUsingParticleWeights(); // from Q-vectors | |
818 | this->EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent); // from nested loops (to be improved: do I have to pass here anEvent or not?) | |
819 | // Correction for non-uniform acceptance: | |
820 | this->CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights(); // from Q-vectors (sin terms) | |
821 | this->CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights(); // from Q-vectors (cos terms) | |
822 | this->EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(anEvent); // from nested loops (both sin and cos terms) | |
823 | } | |
824 | } else if(nPrim>fMaxAllowedMultiplicity) // to if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) | |
825 | { | |
826 | cout<<endl; | |
827 | cout<<"Skipping the event because multiplicity is "<<nPrim<<". Too high to evaluate nested loops!"<<endl; | |
828 | } else | |
829 | { | |
830 | cout<<endl; | |
831 | cout<<"Skipping the event because multiplicity is "<<nPrim<<"."<<endl; | |
832 | } | |
833 | ||
834 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowNestedLoops(AliFlowEventSimple* anEvent) | |
835 | ||
836 | //================================================================================================================================ | |
837 | ||
838 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowNestedLoops(AliFlowEventSimple* anEvent) | |
839 | { | |
840 | // Evalauted all correlators for differential flow with nested loops. | |
841 | ||
842 | if(!fCalculateDiffFlow){return;} | |
843 | ||
844 | Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = nRP + nPOI | |
845 | if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 | |
846 | { | |
847 | // Without using particle weights: | |
403e3389 | 848 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
1268c371 | 849 | { |
64e500e3 | 850 | // 1.) Reduced correlations: |
1268c371 | 851 | // Q-vectors: |
852 | this->CalculateDiffFlowCorrelations("RP","Pt"); | |
853 | this->CalculateDiffFlowCorrelations("RP","Eta"); | |
854 | this->CalculateDiffFlowCorrelations("POI","Pt"); | |
855 | this->CalculateDiffFlowCorrelations("POI","Eta"); | |
856 | // Nested loops: | |
857 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"RP","Pt"); | |
858 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"RP","Eta"); | |
859 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"POI","Pt"); | |
860 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"POI","Eta"); | |
64e500e3 | 861 | // 2.) Reduced corrections for non-uniform acceptance: |
1268c371 | 862 | // Q-vectors: |
863 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Pt"); | |
864 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Eta"); | |
865 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Pt"); | |
866 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Eta"); | |
867 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Pt"); | |
868 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Eta"); | |
869 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Pt"); | |
870 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Eta"); | |
871 | // Nested loops: | |
872 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"RP","Pt"); | |
873 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"RP","Eta"); | |
874 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"POI","Pt"); | |
875 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"POI","Eta"); | |
64e500e3 | 876 | // 3.) Other differential correlators: |
877 | // Q-vectors: | |
878 | this->CalculateOtherDiffCorrelators("RP","Pt"); | |
879 | this->CalculateOtherDiffCorrelators("RP","Eta"); | |
880 | this->CalculateOtherDiffCorrelators("POI","Pt"); | |
881 | this->CalculateOtherDiffCorrelators("POI","Eta"); | |
882 | // Nested loops: | |
883 | this->EvaluateOtherDiffCorrelatorsWithNestedLoops(anEvent,"RP","Pt"); | |
884 | this->EvaluateOtherDiffCorrelatorsWithNestedLoops(anEvent,"RP","Eta"); | |
885 | this->EvaluateOtherDiffCorrelatorsWithNestedLoops(anEvent,"POI","Pt"); | |
886 | this->EvaluateOtherDiffCorrelatorsWithNestedLoops(anEvent,"POI","Eta"); | |
403e3389 | 887 | } // end of if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
1268c371 | 888 | // Using particle weights: |
403e3389 | 889 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
1268c371 | 890 | { |
891 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Pt"); | |
892 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Eta"); | |
893 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Pt"); | |
894 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Eta"); | |
895 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Pt"); | |
896 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Eta"); | |
897 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Pt"); | |
898 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Eta"); | |
899 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Pt"); | |
900 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Eta"); | |
901 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Pt"); | |
902 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Eta"); | |
903 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"RP","Pt"); | |
904 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"RP","Eta"); | |
905 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"POI","Pt"); | |
906 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"POI","Eta"); | |
907 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"RP","Pt"); | |
908 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"RP","Eta"); | |
909 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"POI","Pt"); | |
910 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"POI","Eta"); | |
403e3389 | 911 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
1268c371 | 912 | } // end of if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 |
913 | ||
914 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowNestedLoops(AliFlowEventSimple* anEvent) | |
915 | ||
916 | //================================================================================================================================ | |
917 | ||
489d5531 | 918 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTerms() |
919 | { | |
b92ea2b9 | 920 | // Calculate correction terms for non-uniform acceptance of the detector for reference flow (cos terms). |
489d5531 | 921 | |
922 | // multiplicity: | |
1268c371 | 923 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 924 | |
925 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
926 | Double_t dReQ1n = (*fReQ)(0,0); | |
927 | Double_t dReQ2n = (*fReQ)(1,0); | |
928 | //Double_t dReQ3n = (*fReQ)(2,0); | |
929 | //Double_t dReQ4n = (*fReQ)(3,0); | |
930 | Double_t dImQ1n = (*fImQ)(0,0); | |
931 | Double_t dImQ2n = (*fImQ)(1,0); | |
932 | //Double_t dImQ3n = (*fImQ)(2,0); | |
933 | //Double_t dImQ4n = (*fImQ)(3,0); | |
934 | ||
935 | // ************************************************************* | |
936 | // **** corrections for non-uniform acceptance (cos terms): **** | |
937 | // ************************************************************* | |
938 | // | |
939 | // Remark 1: corrections for non-uniform acceptance (cos terms) calculated with non-weighted Q-vectors | |
940 | // are stored in 1D profile fQCorrectionsCos. | |
941 | // Remark 2: binning of fIntFlowCorrectionTermsForNUAPro[1] is organized as follows: | |
942 | // -------------------------------------------------------------------------------------------------------------------- | |
943 | // 1st bin: <<cos(n*(phi1))>> = cosP1n | |
944 | // 2nd bin: <<cos(n*(phi1+phi2))>> = cosP1nP1n | |
945 | // 3rd bin: <<cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1n | |
946 | // 4th bin: <<cos(n*(2phi1-phi2))>> = cosP2nM1n | |
947 | // -------------------------------------------------------------------------------------------------------------------- | |
948 | ||
949 | // 1-particle: | |
950 | Double_t cosP1n = 0.; // <<cos(n*(phi1))>> | |
951 | ||
952 | if(dMult>0) | |
953 | { | |
954 | cosP1n = dReQ1n/dMult; | |
955 | ||
956 | // average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for single event: | |
957 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(1,cosP1n); | |
0328db2d | 958 | // event weights for NUA terms: |
959 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(1,dMult); | |
489d5531 | 960 | |
961 | // final average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for all events: | |
962 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(0.5,cosP1n,dMult); | |
b3dacf6b | 963 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[1][0]->Fill(dMult+0.5,cosP1n,dMult);} |
489d5531 | 964 | } |
965 | ||
966 | // 2-particle: | |
3b552efe | 967 | Double_t cosP1nP1n = 0.; // <<cos(n*(phi1+phi2))>> |
489d5531 | 968 | Double_t cosP2nM1n = 0.; // <<cos(n*(2phi1-phi2))>> |
969 | ||
970 | if(dMult>1) | |
971 | { | |
972 | cosP1nP1n = (pow(dReQ1n,2)-pow(dImQ1n,2)-dReQ2n)/(dMult*(dMult-1)); | |
973 | cosP2nM1n = (dReQ2n*dReQ1n+dImQ2n*dImQ1n-dReQ1n)/(dMult*(dMult-1)); | |
974 | ||
975 | // average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for single event: | |
3b552efe | 976 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(2,cosP1nP1n); |
489d5531 | 977 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(4,cosP2nM1n); |
0328db2d | 978 | // event weights for NUA terms: |
979 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(2,dMult*(dMult-1)); | |
980 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(4,dMult*(dMult-1)); | |
981 | ||
489d5531 | 982 | // final average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for all events: |
3b552efe | 983 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(1.5,cosP1nP1n,dMult*(dMult-1)); |
489d5531 | 984 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(3.5,cosP2nM1n,dMult*(dMult-1)); |
b3dacf6b | 985 | if(fCalculateCumulantsVsM) |
986 | { | |
987 | fIntFlowCorrectionTermsForNUAVsMPro[1][1]->Fill(dMult+0.5,cosP1nP1n,dMult*(dMult-1)); | |
988 | fIntFlowCorrectionTermsForNUAVsMPro[1][3]->Fill(dMult+0.5,cosP2nM1n,dMult*(dMult-1)); | |
989 | } | |
489d5531 | 990 | } |
991 | ||
992 | // 3-particle: | |
993 | Double_t cosP1nM1nM1n = 0.; // <<cos(n*(phi1-phi2-phi3))>> | |
994 | ||
995 | if(dMult>2) | |
996 | { | |
997 | cosP1nM1nM1n = (dReQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))-dReQ1n*dReQ2n-dImQ1n*dImQ2n-2.*(dMult-1)*dReQ1n) | |
998 | / (dMult*(dMult-1)*(dMult-2)); | |
999 | ||
1000 | // average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for single event: | |
1001 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(3,cosP1nM1nM1n); | |
0328db2d | 1002 | // event weights for NUA terms: |
1003 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(3,dMult*(dMult-1)*(dMult-2)); | |
489d5531 | 1004 | |
1005 | // final average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for all events: | |
2001bc3a | 1006 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(2.5,cosP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); |
b3dacf6b | 1007 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[1][2]->Fill(dMult+0.5,cosP1nM1nM1n,dMult*(dMult-1)*(dMult-2));} |
489d5531 | 1008 | } |
1009 | ||
1010 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTerms() | |
1011 | ||
1012 | ||
1013 | //================================================================================================================================ | |
1014 | ||
1015 | ||
1016 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTerms() | |
1017 | { | |
1018 | // calculate corrections for non-uniform acceptance of the detector for no-name integrated flow (sin terms) | |
1019 | ||
1020 | // multiplicity: | |
1268c371 | 1021 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 1022 | |
1023 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
1024 | Double_t dReQ1n = (*fReQ)(0,0); | |
1025 | Double_t dReQ2n = (*fReQ)(1,0); | |
1026 | //Double_t dReQ3n = (*fReQ)(2,0); | |
1027 | //Double_t dReQ4n = (*fReQ)(3,0); | |
1028 | Double_t dImQ1n = (*fImQ)(0,0); | |
1029 | Double_t dImQ2n = (*fImQ)(1,0); | |
1030 | //Double_t dImQ3n = (*fImQ)(2,0); | |
1031 | //Double_t dImQ4n = (*fImQ)(3,0); | |
1032 | ||
1033 | // ************************************************************* | |
1034 | // **** corrections for non-uniform acceptance (sin terms): **** | |
1035 | // ************************************************************* | |
1036 | // | |
1037 | // Remark 1: corrections for non-uniform acceptance (sin terms) calculated with non-weighted Q-vectors | |
1038 | // are stored in 1D profile fQCorrectionsSin. | |
1039 | // Remark 2: binning of fIntFlowCorrectionTermsForNUAPro[0] is organized as follows: | |
1040 | // -------------------------------------------------------------------------------------------------------------------- | |
1041 | // 1st bin: <<sin(n*(phi1))>> = sinP1n | |
1042 | // 2nd bin: <<sin(n*(phi1+phi2))>> = sinP1nP1n | |
1043 | // 3rd bin: <<sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1n | |
1044 | // 4th bin: <<sin(n*(2phi1-phi2))>> = sinP2nM1n | |
1045 | // -------------------------------------------------------------------------------------------------------------------- | |
1046 | ||
1047 | // 1-particle: | |
1048 | Double_t sinP1n = 0.; // <sin(n*(phi1))> | |
1049 | ||
1050 | if(dMult>0) | |
1051 | { | |
1052 | sinP1n = dImQ1n/dMult; | |
1053 | ||
1054 | // average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for single event: | |
0328db2d | 1055 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(1,sinP1n); |
1056 | // event weights for NUA terms: | |
1057 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(1,dMult); | |
489d5531 | 1058 | |
1059 | // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
1060 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(0.5,sinP1n,dMult); | |
b3dacf6b | 1061 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[0][0]->Fill(dMult+0.5,sinP1n,dMult);} |
489d5531 | 1062 | } |
1063 | ||
1064 | // 2-particle: | |
1065 | Double_t sinP1nP1n = 0.; // <<sin(n*(phi1+phi2))>> | |
1066 | Double_t sinP2nM1n = 0.; // <<sin(n*(2phi1-phi2))>> | |
1067 | if(dMult>1) | |
1068 | { | |
3b552efe | 1069 | sinP1nP1n = (2.*dReQ1n*dImQ1n-dImQ2n)/(dMult*(dMult-1)); |
489d5531 | 1070 | sinP2nM1n = (dImQ2n*dReQ1n-dReQ2n*dImQ1n-dImQ1n)/(dMult*(dMult-1)); |
1071 | ||
1072 | // average non-weighted 2-particle correction (sin terms) for non-uniform acceptance for single event: | |
1073 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(2,sinP1nP1n); | |
3b552efe | 1074 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(4,sinP2nM1n); |
0328db2d | 1075 | // event weights for NUA terms: |
1076 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(2,dMult*(dMult-1)); | |
1077 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(4,dMult*(dMult-1)); | |
489d5531 | 1078 | |
1079 | // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
1080 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(1.5,sinP1nP1n,dMult*(dMult-1)); | |
1081 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(3.5,sinP2nM1n,dMult*(dMult-1)); | |
b3dacf6b | 1082 | if(fCalculateCumulantsVsM) |
1083 | { | |
1084 | fIntFlowCorrectionTermsForNUAVsMPro[0][1]->Fill(dMult+0.5,sinP1nP1n,dMult*(dMult-1)); | |
1085 | fIntFlowCorrectionTermsForNUAVsMPro[0][3]->Fill(dMult+0.5,sinP2nM1n,dMult*(dMult-1)); | |
1086 | } | |
489d5531 | 1087 | } |
1088 | ||
1089 | // 3-particle: | |
1090 | Double_t sinP1nM1nM1n = 0.; // <<sin(n*(phi1-phi2-phi3))>> | |
1091 | ||
1092 | if(dMult>2) | |
1093 | { | |
1094 | sinP1nM1nM1n = (-dImQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))+dReQ1n*dImQ2n-dImQ1n*dReQ2n+2.*(dMult-1)*dImQ1n) | |
1095 | / (dMult*(dMult-1)*(dMult-2)); | |
1096 | ||
1097 | // average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for single event: | |
1098 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(3,sinP1nM1nM1n); | |
0328db2d | 1099 | // event weights for NUA terms: |
1100 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(3,dMult*(dMult-1)*(dMult-2)); | |
489d5531 | 1101 | |
1102 | // final average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for all events: | |
2001bc3a | 1103 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(2.5,sinP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); |
b3dacf6b | 1104 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[0][2]->Fill(dMult+0.5,sinP1nM1nM1n,dMult*(dMult-1)*(dMult-2));} |
489d5531 | 1105 | } |
1106 | ||
1107 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTerms() | |
1108 | ||
489d5531 | 1109 | //================================================================================================================================ |
1110 | ||
489d5531 | 1111 | void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos) |
1112 | { | |
1268c371 | 1113 | // a) Get pointers for common control and common result histograms; |
1114 | // b) Get pointers for histograms holding particle weights; | |
1115 | // c) Get pointers for reference flow histograms; | |
1116 | // d) Get pointers for differential flow histograms; | |
1117 | // e) Get pointers for 2D differential flow histograms; | |
64e500e3 | 1118 | // f) Get pointers for other differential correlators; |
1119 | // g) Get pointers for nested loops' histograms. | |
489d5531 | 1120 | |
1121 | if(outputListHistos) | |
3b552efe | 1122 | { |
1123 | this->SetHistList(outputListHistos); | |
1124 | if(!fHistList) | |
1125 | { | |
1268c371 | 1126 | printf("\n WARNING (QC): fHistList is NULL in AFAWQC::GOH() !!!!\n\n"); |
3b552efe | 1127 | exit(0); |
489d5531 | 1128 | } |
1129 | this->GetPointersForCommonHistograms(); | |
1130 | this->GetPointersForParticleWeightsHistograms(); | |
1131 | this->GetPointersForIntFlowHistograms(); | |
1132 | this->GetPointersForDiffFlowHistograms(); | |
1268c371 | 1133 | this->GetPointersFor2DDiffFlowHistograms(); |
64e500e3 | 1134 | this->GetPointersForOtherDiffCorrelators(); |
489d5531 | 1135 | this->GetPointersForNestedLoopsHistograms(); |
3b552efe | 1136 | } else |
1137 | { | |
1268c371 | 1138 | printf("\n WARNING (QC): outputListHistos is NULL in AFAWQC::GOH() !!!!\n\n"); |
3b552efe | 1139 | exit(0); |
489d5531 | 1140 | } |
1141 | ||
1142 | } // end of void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos) | |
ad87ae62 | 1143 | |
489d5531 | 1144 | //================================================================================================================================ |
1145 | ||
489d5531 | 1146 | TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) const |
ad87ae62 | 1147 | { |
489d5531 | 1148 | // project 2D profile onto pt axis to get 1D profile |
1149 | ||
1150 | Int_t nBinsPt = profilePtEta->GetNbinsX(); | |
1151 | Double_t dPtMin = (profilePtEta->GetXaxis())->GetXmin(); | |
1152 | Double_t dPtMax = (profilePtEta->GetXaxis())->GetXmax(); | |
1153 | ||
1154 | Int_t nBinsEta = profilePtEta->GetNbinsY(); | |
1155 | ||
1156 | TProfile *profilePt = new TProfile("","",nBinsPt,dPtMin,dPtMax); | |
1157 | ||
1158 | for(Int_t p=1;p<=nBinsPt;p++) | |
1159 | { | |
1160 | Double_t contentPt = 0.; | |
1161 | Double_t entryPt = 0.; | |
1162 | Double_t spreadPt = 0.; | |
1163 | Double_t sum1 = 0.; | |
1164 | Double_t sum2 = 0.; | |
1165 | Double_t sum3 = 0.; | |
1166 | for(Int_t e=1;e<=nBinsEta;e++) | |
1167 | { | |
1168 | contentPt += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))) | |
1169 | * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1170 | entryPt += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1171 | ||
1172 | sum1 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))) | |
1173 | * (pow(profilePtEta->GetBinError(profilePtEta->GetBin(p,e)),2.) | |
1174 | + pow(profilePtEta->GetBinContent(profilePtEta->GetBin(p,e)),2.)); | |
1175 | sum2 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1176 | sum3 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))) | |
1177 | * (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))); | |
1178 | } | |
1179 | if(sum2>0. && sum1/sum2-pow(sum3/sum2,2.) > 0.) | |
1180 | { | |
1181 | spreadPt = pow(sum1/sum2-pow(sum3/sum2,2.),0.5); | |
1182 | } | |
1183 | profilePt->SetBinContent(p,contentPt); | |
1184 | profilePt->SetBinEntries(p,entryPt); | |
1185 | { | |
1186 | profilePt->SetBinError(p,spreadPt); | |
1187 | } | |
1188 | ||
1189 | } | |
1190 | ||
1191 | return profilePt; | |
1192 | ||
1193 | } // end of TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) | |
1194 | ||
1195 | ||
1196 | //================================================================================================================================ | |
1197 | ||
1198 | ||
1199 | TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) const | |
1200 | { | |
1201 | // project 2D profile onto eta axis to get 1D profile | |
1202 | ||
1203 | Int_t nBinsEta = profilePtEta->GetNbinsY(); | |
1204 | Double_t dEtaMin = (profilePtEta->GetYaxis())->GetXmin(); | |
1205 | Double_t dEtaMax = (profilePtEta->GetYaxis())->GetXmax(); | |
1206 | ||
1207 | Int_t nBinsPt = profilePtEta->GetNbinsX(); | |
1208 | ||
1209 | TProfile *profileEta = new TProfile("","",nBinsEta,dEtaMin,dEtaMax); | |
1210 | ||
1211 | for(Int_t e=1;e<=nBinsEta;e++) | |
1212 | { | |
1213 | Double_t contentEta = 0.; | |
1214 | Double_t entryEta = 0.; | |
1215 | for(Int_t p=1;p<=nBinsPt;p++) | |
1216 | { | |
1217 | contentEta += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))) | |
1218 | * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1219 | entryEta += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1220 | } | |
1221 | profileEta->SetBinContent(e,contentEta); | |
1222 | profileEta->SetBinEntries(e,entryEta); | |
1223 | } | |
1224 | ||
1225 | return profileEta; | |
1226 | ||
1227 | } // end of TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) | |
1228 | ||
489d5531 | 1229 | //================================================================================================================================ |
1230 | ||
489d5531 | 1231 | void AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type) |
1232 | { | |
2001bc3a | 1233 | // Printing on the screen the final results for integrated flow (RF, POI and RP). |
489d5531 | 1234 | |
1235 | Int_t n = fHarmonic; | |
1236 | ||
489d5531 | 1237 | Double_t dVn[4] = {0.}; // array to hold Vn{2}, Vn{4}, Vn{6} and Vn{8} |
1238 | Double_t dVnErr[4] = {0.}; // array to hold errors of Vn{2}, Vn{4}, Vn{6} and Vn{8} | |
1239 | ||
2001bc3a | 1240 | if(type == "RF") |
489d5531 | 1241 | { |
0dd3b008 | 1242 | for(Int_t b=0;b<4;b++) |
1243 | { | |
b77b6434 | 1244 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlow())->GetBinContent(1); |
1245 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlow())->GetBinError(1); | |
1246 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlow())->GetBinContent(1); | |
1247 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlow())->GetBinError(1); | |
1248 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlow())->GetBinContent(1); | |
1249 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlow())->GetBinError(1); | |
1250 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlow())->GetBinContent(1); | |
1251 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlow())->GetBinError(1); | |
0dd3b008 | 1252 | } |
489d5531 | 1253 | } else if(type == "RP") |
1254 | { | |
1255 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinContent(1); | |
1256 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinError(1); | |
1257 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinContent(1); | |
1258 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinError(1); | |
1259 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinContent(1); | |
1260 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinError(1); | |
1261 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinContent(1); | |
1262 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinError(1); | |
1263 | } else if(type == "POI") | |
1264 | { | |
1265 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinContent(1); | |
1266 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinError(1); | |
1267 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinContent(1); | |
1268 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinError(1); | |
1269 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinContent(1); | |
1270 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinError(1); | |
1271 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinContent(1); | |
1272 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinError(1); | |
b77b6434 | 1273 | } else if(type == "RF, rebinned in M" && fCalculateCumulantsVsM) |
b3dacf6b | 1274 | { |
0dd3b008 | 1275 | for(Int_t b=0;b<4;b++) |
1276 | { | |
1277 | dVn[b] = fIntFlowRebinnedInM->GetBinContent(b+1); | |
1278 | dVnErr[b] = fIntFlowRebinnedInM->GetBinError(b+1); | |
1279 | } | |
b3dacf6b | 1280 | } |
489d5531 | 1281 | |
1282 | TString title = " flow estimates from Q-cumulants"; | |
1283 | TString subtitle = " ("; | |
b3dacf6b | 1284 | TString subtitle2 = " (rebinned in M)"; |
489d5531 | 1285 | |
b3dacf6b | 1286 | if(type != "RF, rebinned in M") |
489d5531 | 1287 | { |
403e3389 | 1288 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
b3dacf6b | 1289 | { |
1290 | subtitle.Append(type); | |
1291 | subtitle.Append(", without weights)"); | |
1292 | } else | |
1293 | { | |
1294 | subtitle.Append(type); | |
1295 | subtitle.Append(", with weights)"); | |
1296 | } | |
1297 | } else | |
489d5531 | 1298 | { |
403e3389 | 1299 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
b3dacf6b | 1300 | { |
1301 | subtitle.Append("RF"); | |
1302 | subtitle.Append(", without weights)"); | |
1303 | } else | |
1304 | { | |
1305 | subtitle.Append("RF"); | |
1306 | subtitle.Append(", with weights)"); | |
1307 | } | |
1308 | } | |
1309 | ||
489d5531 | 1310 | cout<<endl; |
1311 | cout<<"*************************************"<<endl; | |
1312 | cout<<"*************************************"<<endl; | |
1313 | cout<<title.Data()<<endl; | |
1314 | cout<<subtitle.Data()<<endl; | |
b3dacf6b | 1315 | if(type == "RF, rebinned in M"){cout<<subtitle2.Data()<<endl;} |
489d5531 | 1316 | cout<<endl; |
1317 | ||
1318 | for(Int_t i=0;i<4;i++) | |
1319 | { | |
2001bc3a | 1320 | cout<<" v_"<<n<<"{"<<2*(i+1)<<"} = "<<dVn[i]<<" +/- "<<dVnErr[i]<<endl; |
489d5531 | 1321 | } |
2001bc3a | 1322 | |
489d5531 | 1323 | cout<<endl; |
b92ea2b9 | 1324 | if(type == "RF") |
1325 | { | |
b77b6434 | 1326 | if(fApplyCorrectionForNUA) |
1327 | { | |
1328 | cout<<" detector bias (corrected for): "<<endl; | |
1329 | } else | |
1330 | { | |
1331 | cout<<" detector bias (not corrected for):"<<endl; | |
1332 | } | |
b92ea2b9 | 1333 | cout<<" to QC{2}: "<<fIntFlowDetectorBias->GetBinContent(1)<<" +/- "<<fIntFlowDetectorBias->GetBinError(1)<<endl; |
1334 | cout<<" to QC{4}: "<<fIntFlowDetectorBias->GetBinContent(2)<<" +/- "<<fIntFlowDetectorBias->GetBinError(2)<<endl; | |
1335 | cout<<endl; | |
1336 | } | |
b3dacf6b | 1337 | if(type == "RF" || type == "RF, rebinned in M") |
489d5531 | 1338 | { |
2001bc3a | 1339 | cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultRP()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultRP()->GetMean()<<endl; |
489d5531 | 1340 | } |
1341 | else if (type == "RP") | |
1342 | { | |
2001bc3a | 1343 | cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultRP()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultRP()->GetMean()<<endl; |
489d5531 | 1344 | } |
1345 | else if (type == "POI") | |
1346 | { | |
2001bc3a | 1347 | cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultPOI()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultPOI()->GetMean()<<endl; |
1348 | } | |
1349 | ||
489d5531 | 1350 | cout<<"*************************************"<<endl; |
1351 | cout<<"*************************************"<<endl; | |
1352 | cout<<endl; | |
1353 | ||
2001bc3a | 1354 | }// end of AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type="RF"); |
489d5531 | 1355 | |
1356 | //================================================================================================================================ | |
1357 | ||
489d5531 | 1358 | void AliFlowAnalysisWithQCumulants::WriteHistograms(TString outputFileName) |
1359 | { | |
1360 | //store the final results in output .root file | |
1361 | TFile *output = new TFile(outputFileName.Data(),"RECREATE"); | |
1362 | //output->WriteObject(fHistList, "cobjQC","SingleKey"); | |
1363 | fHistList->Write(fHistList->GetName(), TObject::kSingleKey); | |
1364 | delete output; | |
1365 | } | |
1366 | ||
1367 | ||
1368 | //================================================================================================================================ | |
1369 | ||
1370 | ||
1371 | void AliFlowAnalysisWithQCumulants::WriteHistograms(TDirectoryFile *outputFileName) | |
1372 | { | |
1373 | //store the final results in output .root file | |
1374 | fHistList->SetName("cobjQC"); | |
1375 | fHistList->SetOwner(kTRUE); | |
1376 | outputFileName->Add(fHistList); | |
1377 | outputFileName->Write(outputFileName->GetName(), TObject::kSingleKey); | |
1378 | } | |
1379 | ||
489d5531 | 1380 | //================================================================================================================================ |
1381 | ||
489d5531 | 1382 | void AliFlowAnalysisWithQCumulants::BookCommonHistograms() |
1383 | { | |
1384 | // Book common control histograms and common histograms for final results. | |
1268c371 | 1385 | // a) Book common control histograms; |
1386 | // b) Book common result histograms. | |
1387 | ||
1388 | // a) Book common control histograms: | |
1389 | // Common control histograms (all events): | |
489d5531 | 1390 | TString commonHistsName = "AliFlowCommonHistQC"; |
1391 | commonHistsName += fAnalysisLabel->Data(); | |
62d19320 | 1392 | fCommonHists = new AliFlowCommonHist(commonHistsName.Data(),commonHistsName.Data(),fBookOnlyBasicCCH); |
489d5531 | 1393 | fHistList->Add(fCommonHists); |
1268c371 | 1394 | // Common control histograms (selected events): |
dd442cd2 | 1395 | if(fFillMultipleControlHistograms) |
1396 | { | |
1268c371 | 1397 | // Common control histogram filled for events with 2 and more reference particles: |
dd442cd2 | 1398 | TString commonHists2ndOrderName = "AliFlowCommonHist2ndOrderQC"; |
1399 | commonHists2ndOrderName += fAnalysisLabel->Data(); | |
62d19320 | 1400 | fCommonHists2nd = new AliFlowCommonHist(commonHists2ndOrderName.Data(),commonHists2ndOrderName.Data(),fBookOnlyBasicCCH); |
dd442cd2 | 1401 | fHistList->Add(fCommonHists2nd); |
1268c371 | 1402 | // Common control histogram filled for events with 2 and more reference particles: |
dd442cd2 | 1403 | TString commonHists4thOrderName = "AliFlowCommonHist4thOrderQC"; |
1404 | commonHists4thOrderName += fAnalysisLabel->Data(); | |
62d19320 | 1405 | fCommonHists4th = new AliFlowCommonHist(commonHists4thOrderName.Data(),commonHists4thOrderName.Data(),fBookOnlyBasicCCH); |
dd442cd2 | 1406 | fHistList->Add(fCommonHists4th); |
1268c371 | 1407 | // Common control histogram filled for events with 6 and more reference particles: |
dd442cd2 | 1408 | TString commonHists6thOrderName = "AliFlowCommonHist6thOrderQC"; |
1409 | commonHists6thOrderName += fAnalysisLabel->Data(); | |
62d19320 | 1410 | fCommonHists6th = new AliFlowCommonHist(commonHists6thOrderName.Data(),commonHists6thOrderName.Data(),fBookOnlyBasicCCH); |
dd442cd2 | 1411 | fHistList->Add(fCommonHists6th); |
1268c371 | 1412 | // Common control histogram filled for events with 8 and more reference particles: |
dd442cd2 | 1413 | TString commonHists8thOrderName = "AliFlowCommonHist8thOrderQC"; |
1414 | commonHists8thOrderName += fAnalysisLabel->Data(); | |
62d19320 | 1415 | fCommonHists8th = new AliFlowCommonHist(commonHists8thOrderName.Data(),commonHists8thOrderName.Data(),fBookOnlyBasicCCH); |
dd442cd2 | 1416 | fHistList->Add(fCommonHists8th); |
1417 | } // end of if(fFillMultipleControlHistograms) | |
1418 | ||
1268c371 | 1419 | // b) Book common result histograms: |
1420 | // Common result histograms for QC{2}: | |
489d5531 | 1421 | TString commonHistResults2ndOrderName = "AliFlowCommonHistResults2ndOrderQC"; |
1422 | commonHistResults2ndOrderName += fAnalysisLabel->Data(); | |
62e36168 | 1423 | fCommonHistsResults2nd = new AliFlowCommonHistResults(commonHistResults2ndOrderName.Data(),"",fHarmonic); |
489d5531 | 1424 | fHistList->Add(fCommonHistsResults2nd); |
1268c371 | 1425 | // Common result histograms for QC{4}: |
489d5531 | 1426 | TString commonHistResults4thOrderName = "AliFlowCommonHistResults4thOrderQC"; |
1427 | commonHistResults4thOrderName += fAnalysisLabel->Data(); | |
62e36168 | 1428 | fCommonHistsResults4th = new AliFlowCommonHistResults(commonHistResults4thOrderName.Data(),"",fHarmonic); |
489d5531 | 1429 | fHistList->Add(fCommonHistsResults4th); |
1268c371 | 1430 | // Common result histograms for QC{6}: |
489d5531 | 1431 | TString commonHistResults6thOrderName = "AliFlowCommonHistResults6thOrderQC"; |
1432 | commonHistResults6thOrderName += fAnalysisLabel->Data(); | |
62e36168 | 1433 | fCommonHistsResults6th = new AliFlowCommonHistResults(commonHistResults6thOrderName.Data(),"",fHarmonic); |
489d5531 | 1434 | fHistList->Add(fCommonHistsResults6th); |
1268c371 | 1435 | // Common result histograms for QC{8}: |
489d5531 | 1436 | TString commonHistResults8thOrderName = "AliFlowCommonHistResults8thOrderQC"; |
1437 | commonHistResults8thOrderName += fAnalysisLabel->Data(); | |
62e36168 | 1438 | fCommonHistsResults8th = new AliFlowCommonHistResults(commonHistResults8thOrderName.Data(),"",fHarmonic); |
489d5531 | 1439 | fHistList->Add(fCommonHistsResults8th); |
1440 | ||
1441 | } // end of void AliFlowAnalysisWithQCumulants::BookCommonHistograms() | |
1442 | ||
489d5531 | 1443 | //================================================================================================================================ |
1444 | ||
489d5531 | 1445 | void AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms() |
1446 | { | |
1268c371 | 1447 | // Book and fill histograms which hold phi, pt and eta weights. |
489d5531 | 1448 | |
1449 | if(!fWeightsList) | |
1450 | { | |
1268c371 | 1451 | printf("\n WARNING (QC): fWeightsList is NULL in AFAWQC::BAFWH() !!!! \n\n"); |
489d5531 | 1452 | exit(0); |
1453 | } | |
1454 | ||
1455 | TString fUseParticleWeightsName = "fUseParticleWeightsQC"; | |
1456 | fUseParticleWeightsName += fAnalysisLabel->Data(); | |
403e3389 | 1457 | fUseParticleWeights = new TProfile(fUseParticleWeightsName.Data(),"0 = particle weight not used, 1 = particle weight used ",4,0,4); |
489d5531 | 1458 | fUseParticleWeights->SetLabelSize(0.06); |
1459 | (fUseParticleWeights->GetXaxis())->SetBinLabel(1,"w_{#phi}"); | |
1460 | (fUseParticleWeights->GetXaxis())->SetBinLabel(2,"w_{p_{T}}"); | |
1461 | (fUseParticleWeights->GetXaxis())->SetBinLabel(3,"w_{#eta}"); | |
403e3389 | 1462 | (fUseParticleWeights->GetXaxis())->SetBinLabel(4,"w_{track}"); |
489d5531 | 1463 | fUseParticleWeights->Fill(0.5,(Int_t)fUsePhiWeights); |
1464 | fUseParticleWeights->Fill(1.5,(Int_t)fUsePtWeights); | |
1465 | fUseParticleWeights->Fill(2.5,(Int_t)fUseEtaWeights); | |
403e3389 | 1466 | fUseParticleWeights->Fill(3.5,(Int_t)fUseTrackWeights); |
489d5531 | 1467 | fWeightsList->Add(fUseParticleWeights); |
1468 | ||
1469 | if(fUsePhiWeights) | |
1470 | { | |
1471 | if(fWeightsList->FindObject("phi_weights")) | |
1472 | { | |
1473 | fPhiWeights = dynamic_cast<TH1F*>(fWeightsList->FindObject("phi_weights")); | |
1268c371 | 1474 | if(!fPhiWeights) |
1475 | { | |
1476 | printf("\n WARNING (QC): fPhiWeights is NULL in AFAWQC::BAFWH() !!!!\n\n"); | |
1477 | exit(0); | |
1478 | } | |
489d5531 | 1479 | if(TMath::Abs(fPhiWeights->GetBinWidth(1)-fPhiBinWidth)>pow(10.,-6.)) |
1480 | { | |
1481 | cout<<endl; | |
1482 | cout<<"WARNING (QC): Inconsistent binning in histograms for phi-weights throughout the code."<<endl; | |
1483 | cout<<endl; | |
6fbbbbf1 | 1484 | //exit(0); |
489d5531 | 1485 | } |
1486 | } else | |
1487 | { | |
1488 | cout<<"WARNING: fWeightsList->FindObject(\"phi_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1489 | exit(0); | |
1490 | } | |
1491 | } // end of if(fUsePhiWeights) | |
1492 | ||
1493 | if(fUsePtWeights) | |
1494 | { | |
1495 | if(fWeightsList->FindObject("pt_weights")) | |
1496 | { | |
1497 | fPtWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("pt_weights")); | |
1268c371 | 1498 | if(!fPtWeights) |
1499 | { | |
1500 | printf("\n WARNING (QC): fPtWeights is NULL in AFAWQC::BAFWH() !!!!\n\n"); | |
1501 | exit(0); | |
1502 | } | |
489d5531 | 1503 | if(TMath::Abs(fPtWeights->GetBinWidth(1)-fPtBinWidth)>pow(10.,-6.)) |
1504 | { | |
1505 | cout<<endl; | |
1506 | cout<<"WARNING (QC): Inconsistent binning in histograms for pt-weights throughout the code."<<endl; | |
1507 | cout<<endl; | |
6fbbbbf1 | 1508 | //exit(0); |
489d5531 | 1509 | } |
1510 | } else | |
1511 | { | |
1512 | cout<<"WARNING: fWeightsList->FindObject(\"pt_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1513 | exit(0); | |
1514 | } | |
1515 | } // end of if(fUsePtWeights) | |
1516 | ||
1517 | if(fUseEtaWeights) | |
1518 | { | |
1519 | if(fWeightsList->FindObject("eta_weights")) | |
1520 | { | |
1521 | fEtaWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("eta_weights")); | |
1268c371 | 1522 | if(!fEtaWeights) |
1523 | { | |
1524 | printf("\n WARNING (QC): fEtaWeights is NULL in AFAWQC::BAFWH() !!!!\n\n"); | |
1525 | exit(0); | |
1526 | } | |
489d5531 | 1527 | if(TMath::Abs(fEtaWeights->GetBinWidth(1)-fEtaBinWidth)>pow(10.,-6.)) |
1528 | { | |
1529 | cout<<endl; | |
1530 | cout<<"WARNING (QC): Inconsistent binning in histograms for eta-weights throughout the code."<<endl; | |
1531 | cout<<endl; | |
6fbbbbf1 | 1532 | //exit(0); |
489d5531 | 1533 | } |
1534 | } else | |
1535 | { | |
1536 | cout<<"WARNING: fUseEtaWeights && fWeightsList->FindObject(\"eta_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1537 | exit(0); | |
1538 | } | |
1539 | } // end of if(fUseEtaWeights) | |
1540 | ||
1541 | } // end of AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms() | |
1542 | ||
489d5531 | 1543 | //================================================================================================================================ |
1544 | ||
489d5531 | 1545 | void AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow() |
1546 | { | |
1547 | // Book all objects for integrated flow: | |
e5834fcb | 1548 | // a) Book profile to hold all flags for integrated flow; |
1549 | // b) Book event-by-event quantities; | |
1550 | // c) Book profiles; // to be improved (comment) | |
489d5531 | 1551 | // d) Book histograms holding the final results. |
1552 | ||
1553 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?) | |
1554 | TString powerFlag[2] = {"linear","quadratic"}; // to be improved (should I promote this to data members?) | |
1555 | ||
1556 | // a) Book profile to hold all flags for integrated flow: | |
1557 | TString intFlowFlagsName = "fIntFlowFlags"; | |
1558 | intFlowFlagsName += fAnalysisLabel->Data(); | |
3435cacb | 1559 | fIntFlowFlags = new TProfile(intFlowFlagsName.Data(),"Flags for Integrated Flow",15,0,15); |
489d5531 | 1560 | fIntFlowFlags->SetTickLength(-0.01,"Y"); |
1561 | fIntFlowFlags->SetMarkerStyle(25); | |
403e3389 | 1562 | fIntFlowFlags->SetLabelSize(0.04); |
489d5531 | 1563 | fIntFlowFlags->SetLabelOffset(0.02,"Y"); |
1564 | fIntFlowFlags->GetXaxis()->SetBinLabel(1,"Particle Weights"); | |
1565 | fIntFlowFlags->GetXaxis()->SetBinLabel(2,"Event Weights"); | |
1566 | fIntFlowFlags->GetXaxis()->SetBinLabel(3,"Corrected for NUA?"); | |
b3dacf6b | 1567 | fIntFlowFlags->GetXaxis()->SetBinLabel(4,"Print RF results"); |
489d5531 | 1568 | fIntFlowFlags->GetXaxis()->SetBinLabel(5,"Print RP results"); |
3b552efe | 1569 | fIntFlowFlags->GetXaxis()->SetBinLabel(6,"Print POI results"); |
b3dacf6b | 1570 | fIntFlowFlags->GetXaxis()->SetBinLabel(7,"Print RF (rebinned in M) results"); |
1571 | fIntFlowFlags->GetXaxis()->SetBinLabel(8,"Corrected for NUA vs M?"); | |
1572 | fIntFlowFlags->GetXaxis()->SetBinLabel(9,"Propagate errors to v_{n} from correlations?"); | |
1573 | fIntFlowFlags->GetXaxis()->SetBinLabel(10,"Calculate cumulants vs M"); | |
0dd3b008 | 1574 | fIntFlowFlags->GetXaxis()->SetBinLabel(11,"fMinimumBiasReferenceFlow"); |
8e1cefdd | 1575 | fIntFlowFlags->GetXaxis()->SetBinLabel(12,"fForgetAboutCovariances"); |
e5834fcb | 1576 | fIntFlowFlags->GetXaxis()->SetBinLabel(13,"fStorePhiDistributionForOneEvent"); |
dd442cd2 | 1577 | fIntFlowFlags->GetXaxis()->SetBinLabel(14,"fFillMultipleControlHistograms"); |
3435cacb | 1578 | fIntFlowFlags->GetXaxis()->SetBinLabel(15,"Calculate all correlations vs M"); |
489d5531 | 1579 | fIntFlowList->Add(fIntFlowFlags); |
1580 | ||
1581 | // b) Book event-by-event quantities: | |
1582 | // Re[Q_{m*n,k}], Im[Q_{m*n,k}] and S_{p,k}^M: | |
8ed4edc7 | 1583 | fReQ = new TMatrixD(6,9); |
1584 | fImQ = new TMatrixD(6,9); | |
1268c371 | 1585 | fSpk = new TMatrixD(8,9); |
489d5531 | 1586 | // average correlations <2>, <4>, <6> and <8> for single event (bining is the same as in fIntFlowCorrelationsPro and fIntFlowCorrelationsHist): |
1587 | TString intFlowCorrelationsEBEName = "fIntFlowCorrelationsEBE"; | |
1588 | intFlowCorrelationsEBEName += fAnalysisLabel->Data(); | |
1589 | fIntFlowCorrelationsEBE = new TH1D(intFlowCorrelationsEBEName.Data(),intFlowCorrelationsEBEName.Data(),4,0,4); | |
1590 | // weights for average correlations <2>, <4>, <6> and <8> for single event: | |
1591 | TString intFlowEventWeightsForCorrelationsEBEName = "fIntFlowEventWeightsForCorrelationsEBE"; | |
1592 | intFlowEventWeightsForCorrelationsEBEName += fAnalysisLabel->Data(); | |
1593 | fIntFlowEventWeightsForCorrelationsEBE = new TH1D(intFlowEventWeightsForCorrelationsEBEName.Data(),intFlowEventWeightsForCorrelationsEBEName.Data(),4,0,4); | |
1594 | // average all correlations for single event (bining is the same as in fIntFlowCorrelationsAllPro and fIntFlowCorrelationsAllHist): | |
1595 | TString intFlowCorrelationsAllEBEName = "fIntFlowCorrelationsAllEBE"; | |
1596 | intFlowCorrelationsAllEBEName += fAnalysisLabel->Data(); | |
403e3389 | 1597 | fIntFlowCorrelationsAllEBE = new TH1D(intFlowCorrelationsAllEBEName.Data(),intFlowCorrelationsAllEBEName.Data(),64,0,64); |
489d5531 | 1598 | // average correction terms for non-uniform acceptance for single event |
1599 | // (binning is the same as in fIntFlowCorrectionTermsForNUAPro[2] and fIntFlowCorrectionTermsForNUAHist[2]): | |
1600 | TString fIntFlowCorrectionTermsForNUAEBEName = "fIntFlowCorrectionTermsForNUAEBE"; | |
1601 | fIntFlowCorrectionTermsForNUAEBEName += fAnalysisLabel->Data(); | |
1602 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
1603 | { | |
b92ea2b9 | 1604 | fIntFlowCorrectionTermsForNUAEBE[sc] = new TH1D(Form("%s: %s terms",fIntFlowCorrectionTermsForNUAEBEName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4); |
489d5531 | 1605 | } |
0328db2d | 1606 | // event weights for terms for non-uniform acceptance: |
1607 | TString fIntFlowEventWeightForCorrectionTermsForNUAEBEName = "fIntFlowEventWeightForCorrectionTermsForNUAEBE"; | |
1608 | fIntFlowEventWeightForCorrectionTermsForNUAEBEName += fAnalysisLabel->Data(); | |
1609 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
1610 | { | |
b92ea2b9 | 1611 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc] = new TH1D(Form("%s: %s terms",fIntFlowEventWeightForCorrectionTermsForNUAEBEName.Data(),sinCosFlag[sc].Data()),Form("Event weights for terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4); // to be improved - 4 |
0328db2d | 1612 | } |
489d5531 | 1613 | // c) Book profiles: // to be improved (comment) |
1614 | // profile to hold average multiplicities and number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8: | |
1615 | TString avMultiplicityName = "fAvMultiplicity"; | |
1616 | avMultiplicityName += fAnalysisLabel->Data(); | |
403e3389 | 1617 | fAvMultiplicity = new TProfile(avMultiplicityName.Data(),"Average multiplicities of reference particles (RPs)",9,0,9); |
489d5531 | 1618 | fAvMultiplicity->SetTickLength(-0.01,"Y"); |
1619 | fAvMultiplicity->SetMarkerStyle(25); | |
1620 | fAvMultiplicity->SetLabelSize(0.05); | |
1621 | fAvMultiplicity->SetLabelOffset(0.02,"Y"); | |
403e3389 | 1622 | fAvMultiplicity->SetYTitle("Average multiplicity"); |
489d5531 | 1623 | (fAvMultiplicity->GetXaxis())->SetBinLabel(1,"all evts"); |
1624 | (fAvMultiplicity->GetXaxis())->SetBinLabel(2,"n_{RP} #geq 1"); | |
1625 | (fAvMultiplicity->GetXaxis())->SetBinLabel(3,"n_{RP} #geq 2"); | |
1626 | (fAvMultiplicity->GetXaxis())->SetBinLabel(4,"n_{RP} #geq 3"); | |
1627 | (fAvMultiplicity->GetXaxis())->SetBinLabel(5,"n_{RP} #geq 4"); | |
1628 | (fAvMultiplicity->GetXaxis())->SetBinLabel(6,"n_{RP} #geq 5"); | |
1629 | (fAvMultiplicity->GetXaxis())->SetBinLabel(7,"n_{RP} #geq 6"); | |
1630 | (fAvMultiplicity->GetXaxis())->SetBinLabel(8,"n_{RP} #geq 7"); | |
1631 | (fAvMultiplicity->GetXaxis())->SetBinLabel(9,"n_{RP} #geq 8"); | |
1632 | fIntFlowProfiles->Add(fAvMultiplicity); | |
b40a910e | 1633 | // Average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with wrong errors!): |
1634 | TString correlationFlag[4] = {"#LT#LT2#GT#GT","#LT#LT4#GT#GT","#LT#LT6#GT#GT","#LT#LT8#GT#GT"}; | |
489d5531 | 1635 | TString intFlowCorrelationsProName = "fIntFlowCorrelationsPro"; |
1636 | intFlowCorrelationsProName += fAnalysisLabel->Data(); | |
1637 | fIntFlowCorrelationsPro = new TProfile(intFlowCorrelationsProName.Data(),"Average correlations for all events",4,0,4,"s"); | |
b40a910e | 1638 | fIntFlowCorrelationsPro->Sumw2(); |
489d5531 | 1639 | fIntFlowCorrelationsPro->SetTickLength(-0.01,"Y"); |
1640 | fIntFlowCorrelationsPro->SetMarkerStyle(25); | |
1641 | fIntFlowCorrelationsPro->SetLabelSize(0.06); | |
1642 | fIntFlowCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
68a3b4b1 | 1643 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 1644 | { |
68a3b4b1 | 1645 | (fIntFlowCorrelationsPro->GetXaxis())->SetBinLabel(b+1,correlationFlag[b].Data()); |
b3dacf6b | 1646 | } |
489d5531 | 1647 | fIntFlowProfiles->Add(fIntFlowCorrelationsPro); |
b40a910e | 1648 | // Average correlations squared <<2>^2>, <<4>^2>, <<6>^2> and <<8>^2> for all events: |
1649 | TString squaredCorrelationFlag[4] = {"#LT#LT2#GT^{2}#GT","#LT#LT4#GT^{2}#GT","#LT#LT6#GT^{2}#GT","#LT#LT8#GT^{2}#GT"}; | |
1650 | TString intFlowSquaredCorrelationsProName = "fIntFlowSquaredCorrelationsPro"; | |
1651 | intFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
1652 | fIntFlowSquaredCorrelationsPro = new TProfile(intFlowSquaredCorrelationsProName.Data(),"Average squared correlations for all events",4,0,4,"s"); | |
1653 | fIntFlowSquaredCorrelationsPro->Sumw2(); | |
1654 | fIntFlowSquaredCorrelationsPro->SetTickLength(-0.01,"Y"); | |
1655 | fIntFlowSquaredCorrelationsPro->SetMarkerStyle(25); | |
1656 | fIntFlowSquaredCorrelationsPro->SetLabelSize(0.06); | |
1657 | fIntFlowSquaredCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
1658 | for(Int_t b=0;b<4;b++) | |
1659 | { | |
1660 | (fIntFlowSquaredCorrelationsPro->GetXaxis())->SetBinLabel(b+1,squaredCorrelationFlag[b].Data()); | |
1661 | } | |
1662 | fIntFlowProfiles->Add(fIntFlowSquaredCorrelationsPro); | |
b3dacf6b | 1663 | if(fCalculateCumulantsVsM) |
1664 | { | |
1665 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
1666 | { | |
b40a910e | 1667 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> versus multiplicity for all events (with wrong errors): |
b3dacf6b | 1668 | TString intFlowCorrelationsVsMProName = "fIntFlowCorrelationsVsMPro"; |
1669 | intFlowCorrelationsVsMProName += fAnalysisLabel->Data(); | |
1670 | fIntFlowCorrelationsVsMPro[ci] = new TProfile(Form("%s, %s",intFlowCorrelationsVsMProName.Data(),correlationFlag[ci].Data()), | |
1671 | Form("%s vs multiplicity",correlationFlag[ci].Data()), | |
b40a910e | 1672 | fnBinsMult,fMinMult,fMaxMult,"s"); |
1673 | fIntFlowCorrelationsVsMPro[ci]->Sumw2(); | |
b3dacf6b | 1674 | fIntFlowCorrelationsVsMPro[ci]->GetYaxis()->SetTitle(correlationFlag[ci].Data()); |
1675 | fIntFlowCorrelationsVsMPro[ci]->GetXaxis()->SetTitle("M"); | |
1676 | fIntFlowProfiles->Add(fIntFlowCorrelationsVsMPro[ci]); | |
b40a910e | 1677 | // average squared correlations <<2>^2>, <<4>^2>, <<6>^2> and <<8>^2> versus multiplicity for all events: |
1678 | TString intFlowSquaredCorrelationsVsMProName = "fIntFlowSquaredCorrelationsVsMPro"; | |
1679 | intFlowSquaredCorrelationsVsMProName += fAnalysisLabel->Data(); | |
1680 | fIntFlowSquaredCorrelationsVsMPro[ci] = new TProfile(Form("%s, %s",intFlowSquaredCorrelationsVsMProName.Data(),squaredCorrelationFlag[ci].Data()), | |
1681 | Form("%s vs multiplicity",squaredCorrelationFlag[ci].Data()), | |
1682 | fnBinsMult,fMinMult,fMaxMult,"s"); | |
1683 | fIntFlowSquaredCorrelationsVsMPro[ci]->Sumw2(); | |
1684 | fIntFlowSquaredCorrelationsVsMPro[ci]->GetYaxis()->SetTitle(squaredCorrelationFlag[ci].Data()); | |
1685 | fIntFlowSquaredCorrelationsVsMPro[ci]->GetXaxis()->SetTitle("M"); | |
1686 | fIntFlowProfiles->Add(fIntFlowSquaredCorrelationsVsMPro[ci]); | |
b3dacf6b | 1687 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index |
1688 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 1689 | // averaged all correlations for all events (with wrong errors!): |
1690 | TString intFlowCorrelationsAllProName = "fIntFlowCorrelationsAllPro"; | |
1691 | intFlowCorrelationsAllProName += fAnalysisLabel->Data(); | |
403e3389 | 1692 | fIntFlowCorrelationsAllPro = new TProfile(intFlowCorrelationsAllProName.Data(),"Average all correlations for all events",64,0,64); |
b84464d3 | 1693 | fIntFlowCorrelationsAllPro->Sumw2(); |
489d5531 | 1694 | fIntFlowCorrelationsAllPro->SetTickLength(-0.01,"Y"); |
1695 | fIntFlowCorrelationsAllPro->SetMarkerStyle(25); | |
1696 | fIntFlowCorrelationsAllPro->SetLabelSize(0.03); | |
1697 | fIntFlowCorrelationsAllPro->SetLabelOffset(0.01,"Y"); | |
1698 | // 2-p correlations: | |
403e3389 | 1699 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(1,"#LT#LT2#GT#GT_{n|n}"); |
1700 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(2,"#LT#LT2#GT#GT_{2n|2n}"); | |
1701 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(3,"#LT#LT2#GT#GT_{3n|3n}"); | |
1702 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(4,"#LT#LT2#GT#GT_{4n|4n}"); | |
489d5531 | 1703 | // 3-p correlations: |
403e3389 | 1704 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(6,"#LT#LT3#GT#GT_{2n|n,n}"); |
1705 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(7,"#LT#LT3#GT#GT_{3n|2n,n}"); | |
1706 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(8,"#LT#LT3#GT#GT_{4n|2n,2n}"); | |
1707 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(9,"#LT#LT3#GT#GT_{4n|3n,n}"); | |
489d5531 | 1708 | // 4-p correlations: |
403e3389 | 1709 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(11,"#LT#LT4#GT#GT_{n,n|n,n}"); |
1710 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(12,"#LT#LT4#GT#GT_{2n,n|2n,n}"); | |
1711 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(13,"#LT#LT4#GT#GT_{2n,2n|2n,2n}"); | |
1712 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(14,"#LT#LT4#GT#GT_{3n|n,n,n}"); | |
1713 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(15,"#LT#LT4#GT#GT_{3n,n|3n,n}"); | |
1714 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(16,"#LT#LT4#GT#GT_{3n,n|2n,2n}"); | |
1715 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(17,"#LT#LT4#GT#GT_{4n|2n,n,n}"); | |
489d5531 | 1716 | // 5-p correlations: |
403e3389 | 1717 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(19,"#LT#LT5#GT#GT_{2n,n|n,n,n}"); |
1718 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(20,"#LT#LT5#GT#GT_{2n,2n|2n,n,n}"); | |
1719 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(21,"#LT#LT5#GT#GT_{3n,n|2n,n,n}"); | |
1720 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(22,"#LT#LT5#GT#GT_{4n|n,n,n,n}"); | |
489d5531 | 1721 | // 6-p correlations: |
403e3389 | 1722 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(24,"#LT#LT6#GT#GT_{n,n,n|n,n,n}"); |
1723 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(25,"#LT#LT6#GT#GT_{2n,n,n|2n,n,n}"); | |
1724 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(26,"#LT#LT6#GT#GT_{2n,2n|n,n,n,n}"); | |
1725 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(27,"#LT#LT6#GT#GT_{3n,n|n,n,n,n}"); | |
489d5531 | 1726 | // 7-p correlations: |
403e3389 | 1727 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(29,"#LT#LT7#GT#GT_{2n,n,n|n,n,n,n}"); |
489d5531 | 1728 | // 8-p correlations: |
403e3389 | 1729 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(31,"#LT#LT8#GT#GT_{n,n,n,n|n,n,n,n}"); |
b84464d3 | 1730 | // EXTRA correlations for v3{5} study: |
403e3389 | 1731 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(33,"#LT#LT4#GT#GT_{4n,2n|3n,3n}"); |
1732 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(34,"#LT#LT5#GT#GT_{3n,3n|2n,2n,2n}"); | |
b84464d3 | 1733 | // EXTRA correlations for Teaney-Yan study: |
403e3389 | 1734 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(35,"#LT#LT2#GT#GT_{5n|5n}"); |
1735 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(36,"#LT#LT2#GT#GT_{6n|6n}"); | |
1736 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(37,"#LT#LT3#GT#GT_{5n|3n,2n}"); | |
1737 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(38,"#LT#LT3#GT#GT_{5n|4n,1n}"); | |
1738 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(39,"#LT#LT3#GT#GT_{6n|3n,3n}"); | |
1739 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(40,"#LT#LT3#GT#GT_{6n|4n,2n}"); | |
1740 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(41,"#LT#LT3#GT#GT_{6n|5n,1n}"); | |
1741 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(42,"#LT#LT4#GT#GT_{6n|3n,2n,1n}"); | |
1742 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(43,"#LT#LT4#GT#GT_{3n,2n|3n,2n}"); | |
1743 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(44,"#LT#LT4#GT#GT_{4n,1n|3n,2n}"); | |
1744 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(45,"#LT#LT4#GT#GT_{3n,3n|3n,3n}"); | |
1745 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(46,"#LT#LT4#GT#GT_{4n,2n|3n,3n}"); | |
1746 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(47,"#LT#LT4#GT#GT_{5n,1n|3n,3n}"); | |
1747 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(48,"#LT#LT4#GT#GT_{4n,2n|4n,2n}"); | |
1748 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(49,"#LT#LT4#GT#GT_{5n,1n|4n,2n}"); | |
1749 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(50,"#LT#LT4#GT#GT_{5n|3n,1n,1n}"); | |
1750 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(51,"#LT#LT4#GT#GT_{5n|2n,2n,1n}"); | |
1751 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(52,"#LT#LT4#GT#GT_{5n,1n|5n,1n}"); | |
1752 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(53,"#LT#LT5#GT#GT_{3n,3n|3n,2n,1n}"); | |
1753 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(54,"#LT#LT5#GT#GT_{4n,2n|3n,2n,1n}"); | |
1754 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(55,"#LT#LT5#GT#GT_{3n,2n|3n,1n,1n}"); | |
1755 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(56,"#LT#LT5#GT#GT_{3n,2n|2n,2n,1n}"); | |
1756 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(57,"#LT#LT5#GT#GT_{5n,1n|3n,2n,1n}"); | |
1757 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(58,"#LT#LT6#GT#GT_{3n,2n,1n|3n,2n,1n}"); | |
1758 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(59,"#LT#LT4#GT#GT_{6n|4n,1n,1n}"); | |
1759 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(60,"#LT#LT4#GT#GT_{6n|2n,2n,2n}"); | |
1760 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(61,"#LT#LT5#GT#GT_{6n|2n,2n,1n,1n}"); | |
1761 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(62,"#LT#LT5#GT#GT_{4n,1n,1n|3n,3n}"); | |
1762 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(63,"#LT#LT6#GT#GT_{3n,3n|2n,2n,1n,1n}"); | |
489d5531 | 1763 | fIntFlowProfiles->Add(fIntFlowCorrelationsAllPro); |
3435cacb | 1764 | // average all correlations versus multiplicity (errors via Sumw2 - to be improved): |
1765 | if(fCalculateAllCorrelationsVsM) | |
1766 | { | |
1767 | // 2-p correlations vs M: | |
1768 | fIntFlowCorrelationsAllVsMPro[0] = new TProfile("two1n1n","#LT#LT2#GT#GT_{n|n}",fnBinsMult,fMinMult,fMaxMult); | |
1769 | fIntFlowCorrelationsAllVsMPro[0]->Sumw2(); | |
1770 | fIntFlowCorrelationsAllVsMPro[0]->GetXaxis()->SetTitle("M"); | |
1771 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[0]); | |
1772 | fIntFlowCorrelationsAllVsMPro[1] = new TProfile("two2n2n","#LT#LT2#GT#GT_{2n|2n}",fnBinsMult,fMinMult,fMaxMult); | |
1773 | fIntFlowCorrelationsAllVsMPro[1]->Sumw2(); | |
1774 | fIntFlowCorrelationsAllVsMPro[1]->GetXaxis()->SetTitle("M"); | |
1775 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[1]); | |
1776 | fIntFlowCorrelationsAllVsMPro[2] = new TProfile("two3n3n","#LT#LT2#GT#GT_{3n|3n}",fnBinsMult,fMinMult,fMaxMult); | |
1777 | fIntFlowCorrelationsAllVsMPro[2]->Sumw2(); | |
1778 | fIntFlowCorrelationsAllVsMPro[2]->GetXaxis()->SetTitle("M"); | |
1779 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[2]); | |
1780 | fIntFlowCorrelationsAllVsMPro[3] = new TProfile("two4n4n","#LT#LT2#GT#GT_{4n|4n}",fnBinsMult,fMinMult,fMaxMult); | |
1781 | fIntFlowCorrelationsAllVsMPro[3]->Sumw2(); | |
1782 | fIntFlowCorrelationsAllVsMPro[3]->GetXaxis()->SetTitle("M"); | |
1783 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[3]); | |
1784 | // 3-p correlations vs M: | |
1785 | fIntFlowCorrelationsAllVsMPro[5] = new TProfile("three2n1n1n","#LT#LT3#GT#GT_{2n|n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1786 | fIntFlowCorrelationsAllVsMPro[5]->Sumw2(); | |
1787 | fIntFlowCorrelationsAllVsMPro[5]->GetXaxis()->SetTitle("M"); | |
1788 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[5]); | |
1789 | fIntFlowCorrelationsAllVsMPro[6] = new TProfile("three3n2n1n","#LT#LT3#GT#GT_{3n|2n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1790 | fIntFlowCorrelationsAllVsMPro[6]->Sumw2(); | |
1791 | fIntFlowCorrelationsAllVsMPro[6]->GetXaxis()->SetTitle("M"); | |
1792 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[6]); | |
1793 | fIntFlowCorrelationsAllVsMPro[7] = new TProfile("three4n2n2n","#LT#LT3#GT#GT_{4n|2n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1794 | fIntFlowCorrelationsAllVsMPro[7]->Sumw2(); | |
1795 | fIntFlowCorrelationsAllVsMPro[7]->GetXaxis()->SetTitle("M"); | |
1796 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[7]); | |
1797 | fIntFlowCorrelationsAllVsMPro[8] = new TProfile("three4n3n1n","#LT#LT3#GT#GT_{4n|3n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1798 | fIntFlowCorrelationsAllVsMPro[8]->Sumw2(); | |
1799 | fIntFlowCorrelationsAllVsMPro[8]->GetXaxis()->SetTitle("M"); | |
1800 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[8]); | |
1801 | // 4-p correlations vs M: | |
1802 | fIntFlowCorrelationsAllVsMPro[10] = new TProfile("four1n1n1n1n","#LT#LT4#GT#GT_{n,n|n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1803 | fIntFlowCorrelationsAllVsMPro[10]->Sumw2(); | |
1804 | fIntFlowCorrelationsAllVsMPro[10]->GetXaxis()->SetTitle("M"); | |
1805 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[10]); | |
1806 | fIntFlowCorrelationsAllVsMPro[11] = new TProfile("four2n1n2n1n","#LT#LT4#GT#GT_{2n,n|2n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1807 | fIntFlowCorrelationsAllVsMPro[11]->Sumw2(); | |
1808 | fIntFlowCorrelationsAllVsMPro[11]->GetXaxis()->SetTitle("M"); | |
1809 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[11]); | |
1810 | fIntFlowCorrelationsAllVsMPro[12] = new TProfile("four2n2n2n2n","#LT#LT4#GT#GT_{2n,2n|2n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1811 | fIntFlowCorrelationsAllVsMPro[12]->Sumw2(); | |
1812 | fIntFlowCorrelationsAllVsMPro[12]->GetXaxis()->SetTitle("M"); | |
1813 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[12]); | |
1814 | fIntFlowCorrelationsAllVsMPro[13] = new TProfile("four3n1n1n1n","#LT#LT4#GT#GT_{3n|n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1815 | fIntFlowCorrelationsAllVsMPro[13]->Sumw2(); | |
1816 | fIntFlowCorrelationsAllVsMPro[13]->GetXaxis()->SetTitle("M"); | |
1817 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[13]); | |
1818 | fIntFlowCorrelationsAllVsMPro[14] = new TProfile("four3n1n3n1n","#LT#LT4#GT#GT_{3n,n|3n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1819 | fIntFlowCorrelationsAllVsMPro[14]->Sumw2(); | |
1820 | fIntFlowCorrelationsAllVsMPro[14]->GetXaxis()->SetTitle("M"); | |
1821 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[14]); | |
1822 | fIntFlowCorrelationsAllVsMPro[15] = new TProfile("four3n1n2n2n","#LT#LT4#GT#GT_{3n,n|2n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1823 | fIntFlowCorrelationsAllVsMPro[15]->Sumw2(); | |
1824 | fIntFlowCorrelationsAllVsMPro[15]->GetXaxis()->SetTitle("M"); | |
1825 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[15]); | |
1826 | fIntFlowCorrelationsAllVsMPro[16] = new TProfile("four4n2n1n1n","#LT#LT4#GT#GT_{4n|2n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1827 | fIntFlowCorrelationsAllVsMPro[16]->Sumw2(); | |
1828 | fIntFlowCorrelationsAllVsMPro[16]->GetXaxis()->SetTitle("M"); | |
1829 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[16]); | |
1830 | // 5-p correlations vs M: | |
403e3389 | 1831 | fIntFlowCorrelationsAllVsMPro[18] = new TProfile("five2n1n1n1n1n","#LT#LT5#GT#GT_{2n,n|n,n,n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1832 | fIntFlowCorrelationsAllVsMPro[18]->Sumw2(); |
1833 | fIntFlowCorrelationsAllVsMPro[18]->GetXaxis()->SetTitle("M"); | |
1834 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[18]); | |
1835 | fIntFlowCorrelationsAllVsMPro[19] = new TProfile("five2n2n2n1n1n","#LT#LT5#GT#GT_{2n,2n|2n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1836 | fIntFlowCorrelationsAllVsMPro[19]->Sumw2(); | |
1837 | fIntFlowCorrelationsAllVsMPro[19]->GetXaxis()->SetTitle("M"); | |
1838 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[19]); | |
1839 | fIntFlowCorrelationsAllVsMPro[20] = new TProfile("five3n1n2n1n1n","#LT#LT5#GT#GT_{3n,n|2n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1840 | fIntFlowCorrelationsAllVsMPro[20]->Sumw2(); | |
1841 | fIntFlowCorrelationsAllVsMPro[20]->GetXaxis()->SetTitle("M"); | |
1842 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[20]); | |
1843 | fIntFlowCorrelationsAllVsMPro[21] = new TProfile("five4n1n1n1n1n","#LT#LT5#GT#GT_{4n|n,n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1844 | fIntFlowCorrelationsAllVsMPro[21]->Sumw2(); | |
1845 | fIntFlowCorrelationsAllVsMPro[21]->GetXaxis()->SetTitle("M"); | |
1846 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[21]); | |
1847 | // 6-p correlations vs M: | |
1848 | fIntFlowCorrelationsAllVsMPro[23] = new TProfile("six1n1n1n1n1n1n","#LT#LT6#GT#GT_{n,n,n|n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1849 | fIntFlowCorrelationsAllVsMPro[23]->Sumw2(); | |
1850 | fIntFlowCorrelationsAllVsMPro[23]->GetXaxis()->SetTitle("M"); | |
1851 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[23]); | |
1852 | fIntFlowCorrelationsAllVsMPro[24] = new TProfile("six2n1n1n2n1n1n","#LT#LT6#GT#GT_{2n,n,n|2n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1853 | fIntFlowCorrelationsAllVsMPro[24]->Sumw2(); | |
1854 | fIntFlowCorrelationsAllVsMPro[24]->GetXaxis()->SetTitle("M"); | |
1855 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[24]); | |
1856 | fIntFlowCorrelationsAllVsMPro[25] = new TProfile("six2n2n1n1n1n1n","#LT#LT6#GT#GT_{2n,2n|n,n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1857 | fIntFlowCorrelationsAllVsMPro[25]->Sumw2(); | |
1858 | fIntFlowCorrelationsAllVsMPro[25]->GetXaxis()->SetTitle("M"); | |
1859 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[25]); | |
1860 | fIntFlowCorrelationsAllVsMPro[26] = new TProfile("six3n1n1n1n1n1n","#LT#LT6#GT#GT_{3n,n|n,n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1861 | fIntFlowCorrelationsAllVsMPro[26]->Sumw2(); | |
1862 | fIntFlowCorrelationsAllVsMPro[26]->GetXaxis()->SetTitle("M"); | |
1863 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[26]); | |
1864 | // 7-p correlations vs M: | |
1865 | fIntFlowCorrelationsAllVsMPro[28] = new TProfile("seven2n1n1n1n1n1n1n","#LT#LT7#GT#GT_{2n,n,n|n,n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1866 | fIntFlowCorrelationsAllVsMPro[28]->Sumw2(); | |
1867 | fIntFlowCorrelationsAllVsMPro[28]->GetXaxis()->SetTitle("M"); | |
1868 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[28]); | |
1869 | // 8-p correlations vs M: | |
1870 | fIntFlowCorrelationsAllVsMPro[30] = new TProfile("eight1n1n1n1n1n1n1n1n","#LT#LT8#GT#GT_{n,n,n,n|n,n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1871 | fIntFlowCorrelationsAllVsMPro[30]->Sumw2(); | |
1872 | fIntFlowCorrelationsAllVsMPro[30]->GetXaxis()->SetTitle("M"); | |
1873 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[30]); | |
b84464d3 | 1874 | // EXTRA correlations vs M for v3{5} study (to be improved - put them in a right order somewhere): |
3435cacb | 1875 | fIntFlowCorrelationsAllVsMPro[32] = new TProfile("four4n2n3n3n","#LT#LT4#GT#GT_{4n,2n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); |
1876 | fIntFlowCorrelationsAllVsMPro[32]->Sumw2(); | |
1877 | fIntFlowCorrelationsAllVsMPro[32]->GetXaxis()->SetTitle("M"); | |
1878 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[32]); | |
b84464d3 | 1879 | fIntFlowCorrelationsAllVsMPro[33] = new TProfile("five3n3n2n2n2n","#LT#LT5#GT#GT_{3n,3n|2n,2n,2n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1880 | fIntFlowCorrelationsAllVsMPro[33]->Sumw2(); |
1881 | fIntFlowCorrelationsAllVsMPro[33]->GetXaxis()->SetTitle("M"); | |
1882 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[33]); | |
b84464d3 | 1883 | // EXTRA correlations vs M for Teaney-Yan study (to be improved - put them in a right order somewhere): |
1884 | fIntFlowCorrelationsAllVsMPro[34] = new TProfile("two5n5n","#LT#LT2#GT#GT_{5n|5n}",fnBinsMult,fMinMult,fMaxMult); | |
1885 | fIntFlowCorrelationsAllVsMPro[34]->Sumw2(); | |
1886 | fIntFlowCorrelationsAllVsMPro[34]->GetXaxis()->SetTitle("M"); | |
1887 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[34]); | |
1888 | fIntFlowCorrelationsAllVsMPro[35] = new TProfile("two6n6n","#LT#LT2#GT#GT_{6n|6n}",fnBinsMult,fMinMult,fMaxMult); | |
1889 | fIntFlowCorrelationsAllVsMPro[35]->Sumw2(); | |
1890 | fIntFlowCorrelationsAllVsMPro[35]->GetXaxis()->SetTitle("M"); | |
1891 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[35]); | |
1892 | fIntFlowCorrelationsAllVsMPro[36] = new TProfile("three5n3n2n","#LT#LT3#GT#GT_{5n|3n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1893 | fIntFlowCorrelationsAllVsMPro[36]->Sumw2(); | |
1894 | fIntFlowCorrelationsAllVsMPro[36]->GetXaxis()->SetTitle("M"); | |
1895 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[36]); | |
1896 | fIntFlowCorrelationsAllVsMPro[37] = new TProfile("three5n4n1n","#LT#LT3#GT#GT_{5n|4n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1897 | fIntFlowCorrelationsAllVsMPro[37]->Sumw2(); | |
1898 | fIntFlowCorrelationsAllVsMPro[37]->GetXaxis()->SetTitle("M"); | |
1899 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[37]); | |
1900 | fIntFlowCorrelationsAllVsMPro[38] = new TProfile("three6n3n3n","#LT#LT3#GT#GT_{6n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); | |
1901 | fIntFlowCorrelationsAllVsMPro[38]->Sumw2(); | |
1902 | fIntFlowCorrelationsAllVsMPro[38]->GetXaxis()->SetTitle("M"); | |
1903 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[38]); | |
1904 | fIntFlowCorrelationsAllVsMPro[39] = new TProfile("three6n4n2n","#LT#LT3#GT#GT_{6n|4n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1905 | fIntFlowCorrelationsAllVsMPro[39]->Sumw2(); | |
1906 | fIntFlowCorrelationsAllVsMPro[39]->GetXaxis()->SetTitle("M"); | |
1907 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[39]); | |
1908 | fIntFlowCorrelationsAllVsMPro[40] = new TProfile("three6n5n1n","#LT#LT3#GT#GT_{6n|5n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1909 | fIntFlowCorrelationsAllVsMPro[40]->Sumw2(); | |
1910 | fIntFlowCorrelationsAllVsMPro[40]->GetXaxis()->SetTitle("M"); | |
1911 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[40]); | |
1912 | fIntFlowCorrelationsAllVsMPro[41] = new TProfile("four6n3n2n1n","#LT#LT4#GT#GT_{6n|3n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1913 | fIntFlowCorrelationsAllVsMPro[41]->Sumw2(); | |
1914 | fIntFlowCorrelationsAllVsMPro[41]->GetXaxis()->SetTitle("M"); | |
1915 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[41]); | |
1916 | fIntFlowCorrelationsAllVsMPro[42] = new TProfile("four3n2n3n2n","#LT#LT4#GT#GT_{3n,2n|3n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1917 | fIntFlowCorrelationsAllVsMPro[42]->Sumw2(); | |
1918 | fIntFlowCorrelationsAllVsMPro[42]->GetXaxis()->SetTitle("M"); | |
1919 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[42]); | |
1920 | fIntFlowCorrelationsAllVsMPro[43] = new TProfile("four4n1n3n2n","#LT#LT4#GT#GT_{4n,1n|3n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1921 | fIntFlowCorrelationsAllVsMPro[43]->Sumw2(); | |
1922 | fIntFlowCorrelationsAllVsMPro[43]->GetXaxis()->SetTitle("M"); | |
1923 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[43]); | |
1924 | fIntFlowCorrelationsAllVsMPro[44] = new TProfile("four3n3n3n3n","#LT#LT4#GT#GT_{3n,3n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); | |
1925 | fIntFlowCorrelationsAllVsMPro[44]->Sumw2(); | |
1926 | fIntFlowCorrelationsAllVsMPro[44]->GetXaxis()->SetTitle("M"); | |
1927 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[44]); | |
1928 | fIntFlowCorrelationsAllVsMPro[45] = new TProfile("four4n2n3n3n","#LT#LT4#GT#GT_{4n,2n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); | |
1929 | fIntFlowCorrelationsAllVsMPro[45]->Sumw2(); | |
1930 | fIntFlowCorrelationsAllVsMPro[45]->GetXaxis()->SetTitle("M"); | |
1931 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[45]); | |
1932 | fIntFlowCorrelationsAllVsMPro[46] = new TProfile("four5n1n3n3n","#LT#LT4#GT#GT_{5n,1n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); | |
1933 | fIntFlowCorrelationsAllVsMPro[46]->Sumw2(); | |
1934 | fIntFlowCorrelationsAllVsMPro[46]->GetXaxis()->SetTitle("M"); | |
1935 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[46]); | |
1936 | fIntFlowCorrelationsAllVsMPro[47] = new TProfile("four4n2n4n2n","#LT#LT4#GT#GT_{4n,2n|4n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1937 | fIntFlowCorrelationsAllVsMPro[47]->Sumw2(); | |
1938 | fIntFlowCorrelationsAllVsMPro[47]->GetXaxis()->SetTitle("M"); | |
1939 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[47]); | |
1940 | fIntFlowCorrelationsAllVsMPro[48] = new TProfile("four5n1n4n2n","#LT#LT4#GT#GT_{5n,1n|4n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1941 | fIntFlowCorrelationsAllVsMPro[48]->Sumw2(); | |
1942 | fIntFlowCorrelationsAllVsMPro[48]->GetXaxis()->SetTitle("M"); | |
1943 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[48]); | |
1944 | fIntFlowCorrelationsAllVsMPro[49] = new TProfile("four5n3n1n1n","#LT#LT4#GT#GT_{5n|3n,1n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1945 | fIntFlowCorrelationsAllVsMPro[49]->Sumw2(); | |
1946 | fIntFlowCorrelationsAllVsMPro[49]->GetXaxis()->SetTitle("M"); | |
1947 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[49]); | |
1948 | fIntFlowCorrelationsAllVsMPro[50] = new TProfile("four5n2n2n1n","#LT#LT4#GT#GT_{5n|2n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1949 | fIntFlowCorrelationsAllVsMPro[50]->Sumw2(); | |
1950 | fIntFlowCorrelationsAllVsMPro[50]->GetXaxis()->SetTitle("M"); | |
1951 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[50]); | |
1952 | fIntFlowCorrelationsAllVsMPro[51] = new TProfile("four5n1n5n1n","#LT#LT4#GT#GT_{5n,1n|5n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1953 | fIntFlowCorrelationsAllVsMPro[51]->Sumw2(); | |
1954 | fIntFlowCorrelationsAllVsMPro[51]->GetXaxis()->SetTitle("M"); | |
1955 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[51]); | |
1956 | fIntFlowCorrelationsAllVsMPro[52] = new TProfile("five3n3n3n2n1n","#LT#LT5#GT#GT_{3n,3n|3n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1957 | fIntFlowCorrelationsAllVsMPro[52]->Sumw2(); | |
1958 | fIntFlowCorrelationsAllVsMPro[52]->GetXaxis()->SetTitle("M"); | |
1959 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[52]); | |
1960 | fIntFlowCorrelationsAllVsMPro[53] = new TProfile("five4n2n3n2n1n","#LT#LT5#GT#GT_{4n,2n|3n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1961 | fIntFlowCorrelationsAllVsMPro[53]->Sumw2(); | |
1962 | fIntFlowCorrelationsAllVsMPro[53]->GetXaxis()->SetTitle("M"); | |
1963 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[53]); | |
1964 | fIntFlowCorrelationsAllVsMPro[54] = new TProfile("five3n2n3n1n1n","#LT#LT5#GT#GT_{3n,2n|3n,1n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1965 | fIntFlowCorrelationsAllVsMPro[54]->Sumw2(); | |
1966 | fIntFlowCorrelationsAllVsMPro[54]->GetXaxis()->SetTitle("M"); | |
1967 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[54]); | |
1968 | fIntFlowCorrelationsAllVsMPro[55] = new TProfile("five3n2n2n2n1n","#LT#LT5#GT#GT_{3n,2n|2n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1969 | fIntFlowCorrelationsAllVsMPro[55]->Sumw2(); | |
1970 | fIntFlowCorrelationsAllVsMPro[55]->GetXaxis()->SetTitle("M"); | |
1971 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[55]); | |
1972 | fIntFlowCorrelationsAllVsMPro[56] = new TProfile("five5n1n3n2n1n","#LT#LT5#GT#GT_{5n,1n|3n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1973 | fIntFlowCorrelationsAllVsMPro[56]->Sumw2(); | |
1974 | fIntFlowCorrelationsAllVsMPro[56]->GetXaxis()->SetTitle("M"); | |
1975 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[56]); | |
1976 | fIntFlowCorrelationsAllVsMPro[57] = new TProfile("six3n2n1n3n2n1n","#LT#LT6#GT#GT_{3n,2n,1n|3n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1977 | fIntFlowCorrelationsAllVsMPro[57]->Sumw2(); | |
1978 | fIntFlowCorrelationsAllVsMPro[57]->GetXaxis()->SetTitle("M"); | |
403e3389 | 1979 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[57]); |
1980 | fIntFlowCorrelationsAllVsMPro[58] = new TProfile("four6n4n1n1n","#LT#LT4#GT#GT_{6n|4n,1n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1981 | fIntFlowCorrelationsAllVsMPro[58]->Sumw2(); | |
1982 | fIntFlowCorrelationsAllVsMPro[58]->GetXaxis()->SetTitle("M"); | |
1983 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[58]); | |
1984 | fIntFlowCorrelationsAllVsMPro[59] = new TProfile("four6n2n2n2n","#LT#LT4#GT#GT_{6n|2n,2n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1985 | fIntFlowCorrelationsAllVsMPro[59]->Sumw2(); | |
1986 | fIntFlowCorrelationsAllVsMPro[59]->GetXaxis()->SetTitle("M"); | |
1987 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[59]); | |
1988 | fIntFlowCorrelationsAllVsMPro[60] = new TProfile("five6n2n2n1n1n","#LT#LT5#GT#GT_{6n|2n,2n,1n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1989 | fIntFlowCorrelationsAllVsMPro[60]->Sumw2(); | |
1990 | fIntFlowCorrelationsAllVsMPro[60]->GetXaxis()->SetTitle("M"); | |
1991 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[60]); | |
1992 | fIntFlowCorrelationsAllVsMPro[61] = new TProfile("five4n1n1n3n3n","#LT#LT5#GT#GT_{4n,1n,1n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); | |
1993 | fIntFlowCorrelationsAllVsMPro[61]->Sumw2(); | |
1994 | fIntFlowCorrelationsAllVsMPro[61]->GetXaxis()->SetTitle("M"); | |
1995 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[61]); | |
1996 | fIntFlowCorrelationsAllVsMPro[62] = new TProfile("six3n3n2n2n1n1n","#LT#LT6#GT#GT_{3n,3n|2n,2n,1n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1997 | fIntFlowCorrelationsAllVsMPro[62]->Sumw2(); | |
1998 | fIntFlowCorrelationsAllVsMPro[62]->GetXaxis()->SetTitle("M"); | |
1999 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[62]); | |
3435cacb | 2000 | } // end of if(fCalculateAllCorrelationsVsM) |
489d5531 | 2001 | // when particle weights are used some extra correlations appear: |
403e3389 | 2002 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 2003 | { |
2004 | TString intFlowExtraCorrelationsProName = "fIntFlowExtraCorrelationsPro"; | |
2005 | intFlowExtraCorrelationsProName += fAnalysisLabel->Data(); | |
2006 | fIntFlowExtraCorrelationsPro = new TProfile(intFlowExtraCorrelationsProName.Data(),"Average extra correlations for all events",100,0,100,"s"); | |
2007 | fIntFlowExtraCorrelationsPro->SetTickLength(-0.01,"Y"); | |
2008 | fIntFlowExtraCorrelationsPro->SetMarkerStyle(25); | |
2009 | fIntFlowExtraCorrelationsPro->SetLabelSize(0.03); | |
2010 | fIntFlowExtraCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
2011 | // extra 2-p correlations: | |
2012 | (fIntFlowExtraCorrelationsPro->GetXaxis())->SetBinLabel(1,"<<w1^3 w2 cos(n*(phi1-phi2))>>"); | |
2013 | (fIntFlowExtraCorrelationsPro->GetXaxis())->SetBinLabel(2,"<<w1 w2 w3^2 cos(n*(phi1-phi2))>>"); | |
2014 | fIntFlowProfiles->Add(fIntFlowExtraCorrelationsPro); | |
403e3389 | 2015 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 2016 | // average product of correlations <2>, <4>, <6> and <8>: |
403e3389 | 2017 | TString productFlag[6] = {"#LT#LT2#GT#LT4#GT#GT","#LT#LT2#GT#LT6#GT#GT","#LT#LT2#GT#LT8#GT#GT", |
2018 | "#LT#LT4#GT#LT6#GT#GT","#LT#LT4#GT#LT8#GT#GT","#LT#LT6#GT#LT8#GT#GT"}; | |
489d5531 | 2019 | TString intFlowProductOfCorrelationsProName = "fIntFlowProductOfCorrelationsPro"; |
2020 | intFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
2021 | fIntFlowProductOfCorrelationsPro = new TProfile(intFlowProductOfCorrelationsProName.Data(),"Average products of correlations",6,0,6); | |
2022 | fIntFlowProductOfCorrelationsPro->SetTickLength(-0.01,"Y"); | |
2023 | fIntFlowProductOfCorrelationsPro->SetMarkerStyle(25); | |
2024 | fIntFlowProductOfCorrelationsPro->SetLabelSize(0.05); | |
2025 | fIntFlowProductOfCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
68a3b4b1 | 2026 | for(Int_t b=0;b<6;b++) |
b3dacf6b | 2027 | { |
68a3b4b1 | 2028 | (fIntFlowProductOfCorrelationsPro->GetXaxis())->SetBinLabel(b+1,productFlag[b].Data()); |
b3dacf6b | 2029 | } |
2030 | fIntFlowProfiles->Add(fIntFlowProductOfCorrelationsPro); | |
ff70ca91 | 2031 | // average product of correlations <2>, <4>, <6> and <8> versus multiplicity |
2032 | // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>] | |
b3dacf6b | 2033 | if(fCalculateCumulantsVsM) |
2034 | { | |
2035 | TString intFlowProductOfCorrelationsVsMProName = "fIntFlowProductOfCorrelationsVsMPro"; | |
2036 | intFlowProductOfCorrelationsVsMProName += fAnalysisLabel->Data(); | |
2037 | for(Int_t pi=0;pi<6;pi++) | |
2038 | { | |
2039 | fIntFlowProductOfCorrelationsVsMPro[pi] = new TProfile(Form("%s, %s",intFlowProductOfCorrelationsVsMProName.Data(),productFlag[pi].Data()), | |
2040 | Form("%s versus multiplicity",productFlag[pi].Data()), | |
2041 | fnBinsMult,fMinMult,fMaxMult); | |
2042 | fIntFlowProductOfCorrelationsVsMPro[pi]->GetXaxis()->SetTitle("M"); | |
2043 | fIntFlowProfiles->Add(fIntFlowProductOfCorrelationsVsMPro[pi]); | |
2044 | } // end of for(Int_t pi=0;pi<6;pi++) | |
2045 | } // end of if(fCalculateCumulantsVsM) | |
0328db2d | 2046 | // average product of correction terms for NUA: |
2047 | TString intFlowProductOfCorrectionTermsForNUAProName = "fIntFlowProductOfCorrectionTermsForNUAPro"; | |
2048 | intFlowProductOfCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
2049 | fIntFlowProductOfCorrectionTermsForNUAPro = new TProfile(intFlowProductOfCorrectionTermsForNUAProName.Data(),"Average products of correction terms for NUA",27,0,27); | |
2050 | fIntFlowProductOfCorrectionTermsForNUAPro->SetTickLength(-0.01,"Y"); | |
2051 | fIntFlowProductOfCorrectionTermsForNUAPro->SetMarkerStyle(25); | |
403e3389 | 2052 | fIntFlowProductOfCorrectionTermsForNUAPro->SetLabelSize(0.03); |
0328db2d | 2053 | fIntFlowProductOfCorrectionTermsForNUAPro->SetLabelOffset(0.01,"Y"); |
2054 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(1,"<<2><cos(#phi)>>"); | |
2055 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(2,"<<2><sin(#phi)>>"); | |
2056 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(3,"<<cos(#phi)><sin(#phi)>>"); | |
2057 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(4,"Cov(<2>,<cos(#phi_{1}+#phi_{2})>)"); | |
2058 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(5,"Cov(<2>,<sin(#phi_{1}+#phi_{2})>)"); | |
2059 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(6,"Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2060 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(7,"Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2061 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(8,"Cov(<4>,<cos(#phi)>)"); | |
2062 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(9,"Cov(<4>,<sin(#phi)>)"); | |
2063 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(10,"Cov(<4>,<cos(#phi_{1}+#phi_{2})>)"); | |
2064 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(11,"Cov(<4>,<sin(#phi_{1}+#phi_{2})>)"); | |
2065 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(12,"Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
2066 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(13,"Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
2067 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(14,"Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
2068 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(15,"Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
2069 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(16,"Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2070 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(17,"Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2071 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(18,"Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
2072 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(19,"Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
2073 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(20,"Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2074 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(21,"Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2075 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(22,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>)"); | |
2076 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(23,"Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2077 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(24,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2078 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(25,"Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2079 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(26,"Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2080 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(27,"Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>)"); | |
2081 | fIntFlowProfiles->Add(fIntFlowProductOfCorrectionTermsForNUAPro); | |
489d5531 | 2082 | // average correction terms for non-uniform acceptance (with wrong errors!): |
2083 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2084 | { | |
2085 | TString intFlowCorrectionTermsForNUAProName = "fIntFlowCorrectionTermsForNUAPro"; | |
2086 | intFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
b92ea2b9 | 2087 | fIntFlowCorrectionTermsForNUAPro[sc] = new TProfile(Form("%s: %s terms",intFlowCorrectionTermsForNUAProName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4,"s"); |
489d5531 | 2088 | fIntFlowCorrectionTermsForNUAPro[sc]->SetTickLength(-0.01,"Y"); |
2089 | fIntFlowCorrectionTermsForNUAPro[sc]->SetMarkerStyle(25); | |
403e3389 | 2090 | fIntFlowCorrectionTermsForNUAPro[sc]->SetLabelSize(0.05); |
489d5531 | 2091 | fIntFlowCorrectionTermsForNUAPro[sc]->SetLabelOffset(0.01,"Y"); |
403e3389 | 2092 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(1,Form("#LT#LT%s(n(#phi_{1}))#GT#GT",sinCosFlag[sc].Data())); |
2093 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(2,Form("#LT#LT%s(n(#phi_{1}+#phi_{2}))#GT#GT",sinCosFlag[sc].Data())); | |
2094 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(3,Form("#LT#LT%s(n(#phi_{1}-#phi_{2}-#phi_{3}))#GT#GT",sinCosFlag[sc].Data())); | |
2095 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(4,Form("#LT#LT%s(n(2#phi_{1}-#phi_{2}))#GT#GT",sinCosFlag[sc].Data())); | |
489d5531 | 2096 | fIntFlowProfiles->Add(fIntFlowCorrectionTermsForNUAPro[sc]); |
2001bc3a | 2097 | // versus multiplicity: |
b3dacf6b | 2098 | if(fCalculateCumulantsVsM) |
2099 | { | |
2100 | TString correctionTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4 | |
2101 | for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) | |
2102 | { | |
2103 | TString intFlowCorrectionTermsForNUAVsMProName = "fIntFlowCorrectionTermsForNUAVsMPro"; | |
2104 | intFlowCorrectionTermsForNUAVsMProName += fAnalysisLabel->Data(); | |
2105 | fIntFlowCorrectionTermsForNUAVsMPro[sc][ci] = new TProfile(Form("%s: #LT#LT%s%s#GT#GT",intFlowCorrectionTermsForNUAVsMProName.Data(),sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()),Form("#LT#LT%s%s#GT#GT vs M",sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()),fnBinsMult,fMinMult,fMaxMult,"s"); | |
2106 | fIntFlowProfiles->Add(fIntFlowCorrectionTermsForNUAVsMPro[sc][ci]); | |
2107 | } | |
2108 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 2109 | } // end of for(Int_t sc=0;sc<2;sc++) |
2110 | ||
2111 | // d) Book histograms holding the final results: | |
2112 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with correct errors!): | |
2113 | TString intFlowCorrelationsHistName = "fIntFlowCorrelationsHist"; | |
2114 | intFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
2115 | fIntFlowCorrelationsHist = new TH1D(intFlowCorrelationsHistName.Data(),"Average correlations for all events",4,0,4); | |
2116 | fIntFlowCorrelationsHist->SetTickLength(-0.01,"Y"); | |
2117 | fIntFlowCorrelationsHist->SetMarkerStyle(25); | |
2118 | fIntFlowCorrelationsHist->SetLabelSize(0.06); | |
2119 | fIntFlowCorrelationsHist->SetLabelOffset(0.01,"Y"); | |
403e3389 | 2120 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(1,"#LT#LT2#GT#GT"); |
2121 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(2,"#LT#LT4#GT#GT"); | |
2122 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(3,"#LT#LT6#GT#GT"); | |
2123 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(4,"#LT#LT8#GT#GT"); | |
489d5531 | 2124 | fIntFlowResults->Add(fIntFlowCorrelationsHist); |
ff70ca91 | 2125 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with correct errors!) vs M: |
b3dacf6b | 2126 | if(fCalculateCumulantsVsM) |
2127 | { | |
2128 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2129 | { | |
2130 | TString intFlowCorrelationsVsMHistName = "fIntFlowCorrelationsVsMHist"; | |
2131 | intFlowCorrelationsVsMHistName += fAnalysisLabel->Data(); | |
2132 | fIntFlowCorrelationsVsMHist[ci] = new TH1D(Form("%s, %s",intFlowCorrelationsVsMHistName.Data(),correlationFlag[ci].Data()), | |
2133 | Form("%s vs multiplicity",correlationFlag[ci].Data()), | |
2134 | fnBinsMult,fMinMult,fMaxMult); | |
2135 | fIntFlowCorrelationsVsMHist[ci]->GetYaxis()->SetTitle(correlationFlag[ci].Data()); | |
2136 | fIntFlowCorrelationsVsMHist[ci]->GetXaxis()->SetTitle("M"); | |
2137 | fIntFlowResults->Add(fIntFlowCorrelationsVsMHist[ci]); | |
2138 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
2139 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 2140 | // average all correlations for all events (with correct errors!): |
2141 | TString intFlowCorrelationsAllHistName = "fIntFlowCorrelationsAllHist"; | |
2142 | intFlowCorrelationsAllHistName += fAnalysisLabel->Data(); | |
8ed4edc7 | 2143 | fIntFlowCorrelationsAllHist = new TH1D(intFlowCorrelationsAllHistName.Data(),"Average correlations for all events",34,0,34); |
489d5531 | 2144 | fIntFlowCorrelationsAllHist->SetTickLength(-0.01,"Y"); |
2145 | fIntFlowCorrelationsAllHist->SetMarkerStyle(25); | |
2146 | fIntFlowCorrelationsAllHist->SetLabelSize(0.03); | |
2147 | fIntFlowCorrelationsAllHist->SetLabelOffset(0.01,"Y"); | |
2148 | // 2-p correlations: | |
2149 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(1,"<<2>>_{n|n}"); | |
2150 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(2,"<<2>>_{2n|2n}"); | |
2151 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(3,"<<2>>_{3n|3n}"); | |
2152 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(4,"<<2>>_{4n|4n}"); | |
2153 | // 3-p correlations: | |
2154 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(6,"<<3>>_{2n|n,n}"); | |
2155 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}"); | |
2156 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}"); | |
2157 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}"); | |
2158 | // 4-p correlations: | |
2159 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}"); | |
2160 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}"); | |
2161 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}"); | |
2162 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}"); | |
2163 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}"); | |
2164 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}"); | |
2165 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}"); | |
2166 | // 5-p correlations: | |
2167 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}"); | |
2168 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}"); | |
2169 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}"); | |
2170 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}"); | |
2171 | // 6-p correlations: | |
2172 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}"); | |
2173 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}"); | |
2174 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}"); | |
2175 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}"); | |
2176 | // 7-p correlations: | |
2177 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}"); | |
2178 | // 8-p correlations: | |
2179 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}"); | |
2180 | fIntFlowResults->Add(fIntFlowCorrelationsAllHist); | |
2181 | // average correction terms for non-uniform acceptance (with correct errors!): | |
2182 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2183 | { | |
2184 | TString intFlowCorrectionTermsForNUAHistName = "fIntFlowCorrectionTermsForNUAHist"; | |
2185 | intFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
b92ea2b9 | 2186 | fIntFlowCorrectionTermsForNUAHist[sc] = new TH1D(Form("%s: %s terms",intFlowCorrectionTermsForNUAHistName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4); |
489d5531 | 2187 | fIntFlowCorrectionTermsForNUAHist[sc]->SetTickLength(-0.01,"Y"); |
2188 | fIntFlowCorrectionTermsForNUAHist[sc]->SetMarkerStyle(25); | |
403e3389 | 2189 | fIntFlowCorrectionTermsForNUAHist[sc]->SetLabelSize(0.05); |
489d5531 | 2190 | fIntFlowCorrectionTermsForNUAHist[sc]->SetLabelOffset(0.01,"Y"); |
b92ea2b9 | 2191 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(1,Form("#LT#LT%s(n(#phi_{1}))#GT#GT",sinCosFlag[sc].Data())); |
403e3389 | 2192 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(2,Form("#LT#LT%s(n(#phi_{1}+#phi_{2}))#GT#GT",sinCosFlag[sc].Data())); |
2193 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(3,Form("#LT#LT%s(n(#phi_{1}-#phi_{2}-#phi_{3}))#GT#GT",sinCosFlag[sc].Data())); | |
2194 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(4,Form("#LT#LT%s(n(2#phi_{1}-#phi_{2}))#GT#GT",sinCosFlag[sc].Data())); | |
489d5531 | 2195 | fIntFlowResults->Add(fIntFlowCorrectionTermsForNUAHist[sc]); |
2196 | } // end of for(Int_t sc=0;sc<2;sc++) | |
2197 | // covariances (multiplied with weight dependent prefactor): | |
2198 | TString intFlowCovariancesName = "fIntFlowCovariances"; | |
2199 | intFlowCovariancesName += fAnalysisLabel->Data(); | |
2200 | fIntFlowCovariances = new TH1D(intFlowCovariancesName.Data(),"Covariances (multiplied with weight dependent prefactor)",6,0,6); | |
2201 | fIntFlowCovariances->SetLabelSize(0.04); | |
2202 | fIntFlowCovariances->SetMarkerStyle(25); | |
403e3389 | 2203 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(1,"Cov(#LT2#GT,#LT4#GT)"); |
2204 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(2,"Cov(#LT2#GT,#LT6#GT)"); | |
2205 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(3,"Cov(#LT2#GT,#LT8#GT)"); | |
2206 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(4,"Cov(#LT4#GT,#LT6#GT)"); | |
2207 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(5,"Cov(#LT4#GT,#LT8#GT)"); | |
2208 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(6,"Cov(#LT6#GT,#LT8#GT)"); | |
489d5531 | 2209 | fIntFlowResults->Add(fIntFlowCovariances); |
2210 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8>: | |
2211 | TString intFlowSumOfEventWeightsName = "fIntFlowSumOfEventWeights"; | |
2212 | intFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
2213 | for(Int_t power=0;power<2;power++) | |
2214 | { | |
2215 | fIntFlowSumOfEventWeights[power] = new TH1D(Form("%s: %s",intFlowSumOfEventWeightsName.Data(),powerFlag[power].Data()),Form("Sum of %s event weights for correlations",powerFlag[power].Data()),4,0,4); | |
403e3389 | 2216 | fIntFlowSumOfEventWeights[power]->SetLabelSize(0.04); |
489d5531 | 2217 | fIntFlowSumOfEventWeights[power]->SetMarkerStyle(25); |
2218 | if(power == 0) | |
2219 | { | |
403e3389 | 2220 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{#LT2#GT}"); |
2221 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{#LT4#GT}"); | |
2222 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{#LT6#GT}"); | |
2223 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{#LT8#GT}"); | |
489d5531 | 2224 | } else if (power == 1) |
2225 | { | |
403e3389 | 2226 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{#LT2#GT}^{2}"); |
2227 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{#LT4#GT}^{2}"); | |
2228 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{#LT6#GT}^{2}"); | |
2229 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{#LT8#GT}^{2}"); | |
489d5531 | 2230 | } |
2231 | fIntFlowResults->Add(fIntFlowSumOfEventWeights[power]); | |
2232 | } | |
2233 | // sum of products of event weights for correlations <2>, <4>, <6> and <8>: | |
2234 | TString intFlowSumOfProductOfEventWeightsName = "fIntFlowSumOfProductOfEventWeights"; | |
2235 | intFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
2236 | fIntFlowSumOfProductOfEventWeights = new TH1D(intFlowSumOfProductOfEventWeightsName.Data(),"Sum of product of event weights for correlations",6,0,6); | |
403e3389 | 2237 | fIntFlowSumOfProductOfEventWeights->SetLabelSize(0.04); |
489d5531 | 2238 | fIntFlowSumOfProductOfEventWeights->SetMarkerStyle(25); |
403e3389 | 2239 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LT4#GT}"); |
2240 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LT6#GT}"); | |
2241 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LT8#GT}"); | |
2242 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LT6#GT}"); | |
2243 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(5,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LT8#GT}"); | |
2244 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(6,"#sum_{i=1}^{N} w_{#LT6#GT} w_{#LT8#GT}"); | |
489d5531 | 2245 | fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeights); |
ff70ca91 | 2246 | // final result for covariances of correlations (multiplied with weight dependent prefactor) versus M |
2247 | // [0=Cov(2,4),1=Cov(2,6),2=Cov(2,8),3=Cov(4,6),4=Cov(4,8),5=Cov(6,8)]: | |
b3dacf6b | 2248 | if(fCalculateCumulantsVsM) |
ff70ca91 | 2249 | { |
b3dacf6b | 2250 | TString intFlowCovariancesVsMName = "fIntFlowCovariancesVsM"; |
2251 | intFlowCovariancesVsMName += fAnalysisLabel->Data(); | |
2252 | TString covarianceFlag[6] = {"Cov(<2>,<4>)","Cov(<2>,<6>)","Cov(<2>,<8>)","Cov(<4>,<6>)","Cov(<4>,<8>)","Cov(<6>,<8>)"}; | |
2253 | for(Int_t ci=0;ci<6;ci++) | |
2254 | { | |
2255 | fIntFlowCovariancesVsM[ci] = new TH1D(Form("%s, %s",intFlowCovariancesVsMName.Data(),covarianceFlag[ci].Data()), | |
2256 | Form("%s vs multiplicity",covarianceFlag[ci].Data()), | |
2257 | fnBinsMult,fMinMult,fMaxMult); | |
2258 | fIntFlowCovariancesVsM[ci]->GetYaxis()->SetTitle(covarianceFlag[ci].Data()); | |
2259 | fIntFlowCovariancesVsM[ci]->GetXaxis()->SetTitle("M"); | |
2260 | fIntFlowResults->Add(fIntFlowCovariancesVsM[ci]); | |
2261 | } | |
2262 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 2263 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8> versus multiplicity |
2264 | // [0=sum{w_{<2>}},1=sum{w_{<4>}},2=sum{w_{<6>}},3=sum{w_{<8>}}][0=linear 1,1=quadratic]: | |
b3dacf6b | 2265 | if(fCalculateCumulantsVsM) |
ff70ca91 | 2266 | { |
b3dacf6b | 2267 | TString intFlowSumOfEventWeightsVsMName = "fIntFlowSumOfEventWeightsVsM"; |
2268 | intFlowSumOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
2269 | TString sumFlag[2][4] = {{"#sum_{i=1}^{N} w_{<2>}","#sum_{i=1}^{N} w_{<4>}","#sum_{i=1}^{N} w_{<6>}","#sum_{i=1}^{N} w_{<8>}"}, | |
2270 | {"#sum_{i=1}^{N} w_{<2>}^{2}","#sum_{i=1}^{N} w_{<4>}^{2}","#sum_{i=1}^{N} w_{<6>}^{2}","#sum_{i=1}^{N} w_{<8>}^{2}"}}; | |
2271 | for(Int_t si=0;si<4;si++) | |
ff70ca91 | 2272 | { |
b3dacf6b | 2273 | for(Int_t power=0;power<2;power++) |
2274 | { | |
2275 | fIntFlowSumOfEventWeightsVsM[si][power] = new TH1D(Form("%s, %s",intFlowSumOfEventWeightsVsMName.Data(),sumFlag[power][si].Data()), | |
2276 | Form("%s vs multiplicity",sumFlag[power][si].Data()), | |
2277 | fnBinsMult,fMinMult,fMaxMult); | |
2278 | fIntFlowSumOfEventWeightsVsM[si][power]->GetYaxis()->SetTitle(sumFlag[power][si].Data()); | |
2279 | fIntFlowSumOfEventWeightsVsM[si][power]->GetXaxis()->SetTitle("M"); | |
2280 | fIntFlowResults->Add(fIntFlowSumOfEventWeightsVsM[si][power]); | |
2281 | } // end of for(Int_t power=0;power<2;power++) | |
2282 | } // end of for(Int_t si=0;si<4;si++) | |
2283 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 2284 | // sum of products of event weights for correlations <2>, <4>, <6> and <8> vs M |
2285 | // [0=sum{w_{<2>}w_{<4>}},1=sum{w_{<2>}w_{<6>}},2=sum{w_{<2>}w_{<8>}}, | |
2286 | // 3=sum{w_{<4>}w_{<6>}},4=sum{w_{<4>}w_{<8>}},5=sum{w_{<6>}w_{<8>}}]: | |
b3dacf6b | 2287 | if(fCalculateCumulantsVsM) |
2288 | { | |
2289 | TString intFlowSumOfProductOfEventWeightsVsMName = "fIntFlowSumOfProductOfEventWeightsVsM"; | |
2290 | intFlowSumOfProductOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
2291 | TString sopowFlag[6] = {"#sum_{i=1}^{N} w_{<2>} w_{<4>}","#sum_{i=1}^{N} w_{<2>} w_{<6>}","#sum_{i=1}^{N} w_{<2>} w_{<8>}", | |
2292 | "#sum_{i=1}^{N} w_{<4>} w_{<6>}","#sum_{i=1}^{N} w_{<4>} w_{<8>}","#sum_{i=1}^{N} w_{<6>} w_{<8>}"}; | |
2293 | for(Int_t pi=0;pi<6;pi++) | |
2294 | { | |
2295 | fIntFlowSumOfProductOfEventWeightsVsM[pi] = new TH1D(Form("%s, %s",intFlowSumOfProductOfEventWeightsVsMName.Data(),sopowFlag[pi].Data()), | |
2296 | Form("%s versus multiplicity",sopowFlag[pi].Data()), | |
2297 | fnBinsMult,fMinMult,fMaxMult); | |
2298 | fIntFlowSumOfProductOfEventWeightsVsM[pi]->GetXaxis()->SetTitle("M"); | |
2299 | fIntFlowSumOfProductOfEventWeightsVsM[pi]->GetYaxis()->SetTitle(sopowFlag[pi].Data()); | |
2300 | fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeightsVsM[pi]); | |
2301 | } // end of for(Int_t pi=0;pi<6;pi++) | |
2302 | } // end of if(fCalculateCumulantsVsM) | |
0328db2d | 2303 | // covariances of NUA terms (multiplied with weight dependent prefactor): |
2304 | TString intFlowCovariancesNUAName = "fIntFlowCovariancesNUA"; | |
2305 | intFlowCovariancesNUAName += fAnalysisLabel->Data(); | |
2306 | fIntFlowCovariancesNUA = new TH1D(intFlowCovariancesNUAName.Data(),"Covariances for NUA (multiplied with weight dependent prefactor)",27,0,27); | |
2307 | fIntFlowCovariancesNUA->SetLabelSize(0.04); | |
2308 | fIntFlowCovariancesNUA->SetMarkerStyle(25); | |
2309 | fIntFlowCovariancesNUA->GetXaxis()->SetLabelSize(0.02); | |
2310 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(1,"Cov(<2>,<cos(#phi)>"); | |
2311 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(2,"Cov(<2>,<sin(#phi)>)"); | |
2312 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(3,"Cov(<cos(#phi)>,<sin(#phi)>)"); | |
2313 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(4,"Cov(<2>,<cos(#phi_{1}+#phi_{2})>)"); | |
2314 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(5,"Cov(<2>,<sin(#phi_{1}+#phi_{2})>)"); | |
2315 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(6,"Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2316 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(7,"Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2317 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(8,"Cov(<4>,<cos(#phi)>)"); | |
2318 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(9,"Cov(<4>,<sin(#phi)>)"); | |
2319 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(10,"Cov(<4>,<cos(#phi_{1}+#phi_{2})>)"); | |
2320 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(11,"Cov(<4>,<sin(#phi_{1}+#phi_{2})>)"); | |
2321 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(12,"Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
2322 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(13,"Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
2323 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(14,"Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
2324 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(15,"Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
2325 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(16,"Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2326 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(17,"Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2327 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(18,"Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
2328 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(19,"Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
2329 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(20,"Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2330 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(21,"Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2331 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(22,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>)"); | |
2332 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(23,"Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2333 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(24,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2334 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(25,"Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2335 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(26,"Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2336 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(27,"Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>)"); | |
2337 | fIntFlowResults->Add(fIntFlowCovariancesNUA); | |
2338 | // sum of linear and quadratic event weights for NUA terms: | |
2339 | TString intFlowSumOfEventWeightsNUAName = "fIntFlowSumOfEventWeightsNUA"; | |
2340 | intFlowSumOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
2341 | for(Int_t sc=0;sc<2;sc++) | |
2342 | { | |
2343 | for(Int_t power=0;power<2;power++) | |
2344 | { | |
b92ea2b9 | 2345 | fIntFlowSumOfEventWeightsNUA[sc][power] = new TH1D(Form("%s: %s, %s",intFlowSumOfEventWeightsNUAName.Data(),powerFlag[power].Data(),sinCosFlag[sc].Data()),Form("Sum of %s event weights for NUA %s terms",powerFlag[power].Data(),sinCosFlag[sc].Data()),4,0,4); // to be improved - 4 |
0328db2d | 2346 | fIntFlowSumOfEventWeightsNUA[sc][power]->SetLabelSize(0.05); |
2347 | fIntFlowSumOfEventWeightsNUA[sc][power]->SetMarkerStyle(25); | |
2348 | if(power == 0) | |
2349 | { | |
2350 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(1,Form("#sum_{i=1}^{N} w_{<%s(#phi)>}",sinCosFlag[sc].Data())); | |
2351 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(2,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}+#phi_{2})>}",sinCosFlag[sc].Data())); | |
b92ea2b9 | 2352 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(3,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}-#phi_{2}-#phi_{3})>}",sinCosFlag[sc].Data())); |
2353 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(4,Form("#sum_{i=1}^{N} w_{<%s(2#phi_{1}-#phi_{2})>}",sinCosFlag[sc].Data())); | |
0328db2d | 2354 | } else if(power == 1) |
2355 | { | |
2356 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(1,Form("#sum_{i=1}^{N} w_{<%s(#phi)>}^{2}",sinCosFlag[sc].Data())); | |
2357 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(2,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}+#phi_{2})>}^{2}",sinCosFlag[sc].Data())); | |
2358 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(3,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}-#phi_{2}-#phi_{3})>}^{2}",sinCosFlag[sc].Data())); | |
b92ea2b9 | 2359 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(4,Form("#sum_{i=1}^{N} w_{<%s(2#phi_{1}-#phi_{2})>}^{2}",sinCosFlag[sc].Data())); |
0328db2d | 2360 | } |
2361 | fIntFlowResults->Add(fIntFlowSumOfEventWeightsNUA[sc][power]); | |
2362 | } | |
2363 | } | |
2364 | // sum of products of event weights for NUA terms: | |
2365 | TString intFlowSumOfProductOfEventWeightsNUAName = "fIntFlowSumOfProductOfEventWeightsNUA"; | |
2366 | intFlowSumOfProductOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
2367 | fIntFlowSumOfProductOfEventWeightsNUA = new TH1D(intFlowSumOfProductOfEventWeightsNUAName.Data(),"Sum of product of event weights for NUA terms",27,0,27); | |
403e3389 | 2368 | fIntFlowSumOfProductOfEventWeightsNUA->SetLabelSize(0.02); |
0328db2d | 2369 | fIntFlowSumOfProductOfEventWeightsNUA->SetMarkerStyle(25); |
62e36168 | 2370 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LTcos(#phi)#GT}"); |
2371 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LTsin(#phi)#GT}"); | |
2372 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{#LTcos(#phi)#GT} w_{#LTsin(#phi)#GT}"); | |
2373 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LTcos(#phi_{1}+#phi_{2})#GT}"); | |
2374 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(5,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LTsin(#phi_{1}+#phi_{2})#GT}"); | |
2375 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(6,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LTcos(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2376 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(7,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LTsin(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2377 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(8,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LTcos(#phi)#GT}"); | |
2378 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(9,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LTsin(#phi)#GT}"); | |
2379 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(10,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LTcos(#phi_{1}+#phi_{2})#GT}"); | |
2380 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(11,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LTsin(#phi_{1}+#phi_{2})#GT}"); | |
2381 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(12,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LTcos(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2382 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(13,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LTsin(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2383 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(14,"#sum_{i=1}^{N} w_{#LTcos(#phi)#GT} w_{#LTcos(#phi_{1}+#phi_{2})#GT}"); | |
2384 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(15,"#sum_{i=1}^{N} w_{#LTcos(#phi)#GT} w_{#LTsin(#phi_{1}+#phi_{2})#GT}"); | |
2385 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(16,"#sum_{i=1}^{N} w_{#LTcos(#phi)#GT} w_{#LTcos(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2386 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(17,"#sum_{i=1}^{N} w_{#LTcos(#phi)#GT} w_{#LTsin(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2387 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(18,"#sum_{i=1}^{N} w_{#LTsin(#phi)#GT} w_{#LTcos(#phi_{1}+#phi_{2})#GT}"); | |
2388 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(19,"#sum_{i=1}^{N} w_{#LTsin(#phi)#GT} w_{#LTsin(#phi_{1}+#phi_{2})#GT}"); | |
2389 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(20,"#sum_{i=1}^{N} w_{#LTsin(#phi)#GT} w_{#LTcos(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2390 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(21,"#sum_{i=1}^{N} w_{#LTsin(#phi)#GT} w_{#LTsin(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2391 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(22,"#sum_{i=1}^{N} w_{#LTcos(#phi_{1}+#phi_{2})#GT} w_{#LTsin(#phi_{1}+#phi_{2})#GT}"); | |
2392 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(23,"#sum_{i=1}^{N} w_{#LTcos(#phi_{1}+#phi_{2})#GT} w_{#LTcos(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2393 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(24,"#sum_{i=1}^{N} w_{#LTcos(#phi_{1}+#phi_{2})#GT} w_{#LTsin(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2394 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(25,"#sum_{i=1}^{N} w_{#LTsin(#phi_{1}+#phi_{2})#GT} w_{#LTcos(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2395 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(26,"#sum_{i=1}^{N} w_{#LTsin(#phi_{1}+#phi_{2})#GT} w_{#LTsin(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2396 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(27,"#sum_{i=1}^{N} w_{#LTcos(#phi_{1}-#phi_{2}-#phi_{3})#GT} w_{#LTsin(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
0328db2d | 2397 | fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeightsNUA); |
b3dacf6b | 2398 | // Final results for reference Q-cumulants: |
2399 | TString cumulantFlag[4] = {"QC{2}","QC{4}","QC{6}","QC{8}"}; | |
489d5531 | 2400 | TString intFlowQcumulantsName = "fIntFlowQcumulants"; |
2401 | intFlowQcumulantsName += fAnalysisLabel->Data(); | |
b92ea2b9 | 2402 | fIntFlowQcumulants = new TH1D(intFlowQcumulantsName.Data(),"Reference Q-cumulants",4,0,4); |
b77b6434 | 2403 | if(fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 2404 | { |
b77b6434 | 2405 | fIntFlowQcumulants->SetTitle("Reference Q-cumulants (error from non-isotropic terms also propagated)"); |
b92ea2b9 | 2406 | } |
489d5531 | 2407 | fIntFlowQcumulants->SetLabelSize(0.05); |
2408 | fIntFlowQcumulants->SetMarkerStyle(25); | |
68a3b4b1 | 2409 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2410 | { |
68a3b4b1 | 2411 | (fIntFlowQcumulants->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data()); |
b3dacf6b | 2412 | } |
489d5531 | 2413 | fIntFlowResults->Add(fIntFlowQcumulants); |
b3dacf6b | 2414 | // Final results for reference Q-cumulants rebinned in M: |
2415 | if(fCalculateCumulantsVsM) | |
2416 | { | |
2417 | TString intFlowQcumulantsRebinnedInMName = "fIntFlowQcumulantsRebinnedInM"; | |
2418 | intFlowQcumulantsRebinnedInMName += fAnalysisLabel->Data(); | |
2419 | fIntFlowQcumulantsRebinnedInM = new TH1D(intFlowQcumulantsRebinnedInMName.Data(),"Reference Q-cumulants rebinned in M",4,0,4); | |
2420 | fIntFlowQcumulantsRebinnedInM->SetLabelSize(0.05); | |
2421 | fIntFlowQcumulantsRebinnedInM->SetMarkerStyle(25); | |
68a3b4b1 | 2422 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2423 | { |
68a3b4b1 | 2424 | (fIntFlowQcumulantsRebinnedInM->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data()); |
b3dacf6b | 2425 | } |
2426 | fIntFlowResults->Add(fIntFlowQcumulantsRebinnedInM); | |
2427 | } // end of if(fCalculateCumulantsVsM) | |
b92ea2b9 | 2428 | // Ratio between error squared: with/without non-isotropic terms: |
2429 | TString intFlowQcumulantsErrorSquaredRatioName = "fIntFlowQcumulantsErrorSquaredRatio"; | |
2430 | intFlowQcumulantsErrorSquaredRatioName += fAnalysisLabel->Data(); | |
2431 | fIntFlowQcumulantsErrorSquaredRatio = new TH1D(intFlowQcumulantsErrorSquaredRatioName.Data(),"Error squared of reference Q-cumulants: #frac{with NUA terms}{without NUA terms}",4,0,4); | |
2432 | fIntFlowQcumulantsErrorSquaredRatio->SetLabelSize(0.05); | |
2433 | fIntFlowQcumulantsErrorSquaredRatio->SetMarkerStyle(25); | |
2434 | for(Int_t b=0;b<4;b++) | |
2435 | { | |
2436 | (fIntFlowQcumulantsErrorSquaredRatio->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data()); | |
2437 | } | |
2438 | fIntFlowResults->Add(fIntFlowQcumulantsErrorSquaredRatio); | |
ff70ca91 | 2439 | // final results for integrated Q-cumulants versus multiplicity: |
b3dacf6b | 2440 | if(fCalculateCumulantsVsM) |
2441 | { | |
2442 | TString intFlowQcumulantsVsMName = "fIntFlowQcumulantsVsM"; | |
2443 | intFlowQcumulantsVsMName += fAnalysisLabel->Data(); | |
2444 | for(Int_t co=0;co<4;co++) // cumulant order | |
2445 | { | |
2446 | fIntFlowQcumulantsVsM[co] = new TH1D(Form("%s, %s",intFlowQcumulantsVsMName.Data(),cumulantFlag[co].Data()), | |
2447 | Form("%s vs multipicity",cumulantFlag[co].Data()), | |
2448 | fnBinsMult,fMinMult,fMaxMult); | |
2449 | fIntFlowQcumulantsVsM[co]->GetXaxis()->SetTitle("M"); | |
2450 | fIntFlowQcumulantsVsM[co]->GetYaxis()->SetTitle(cumulantFlag[co].Data()); | |
2451 | fIntFlowResults->Add(fIntFlowQcumulantsVsM[co]); | |
2452 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
2453 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 2454 | // final integrated flow estimates from Q-cumulants: |
b3dacf6b | 2455 | TString flowFlag[4] = {Form("v_{%d}{2,QC}",fHarmonic),Form("v_{%d}{4,QC}",fHarmonic),Form("v_{%d}{6,QC}",fHarmonic),Form("v_{%d}{8,QC}",fHarmonic)}; |
489d5531 | 2456 | TString intFlowName = "fIntFlow"; |
2457 | intFlowName += fAnalysisLabel->Data(); | |
2458 | // integrated flow from Q-cumulants: | |
b3dacf6b | 2459 | fIntFlow = new TH1D(intFlowName.Data(),"Reference flow estimates from Q-cumulants",4,0,4); |
489d5531 | 2460 | fIntFlow->SetLabelSize(0.05); |
2461 | fIntFlow->SetMarkerStyle(25); | |
68a3b4b1 | 2462 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2463 | { |
68a3b4b1 | 2464 | (fIntFlow->GetXaxis())->SetBinLabel(b+1,flowFlag[b].Data()); |
b3dacf6b | 2465 | } |
ff70ca91 | 2466 | fIntFlowResults->Add(fIntFlow); |
b3dacf6b | 2467 | // Reference flow vs M rebinned in one huge bin: |
2468 | if(fCalculateCumulantsVsM) | |
2469 | { | |
2470 | TString intFlowRebinnedInMName = "fIntFlowRebinnedInM"; | |
2471 | intFlowRebinnedInMName += fAnalysisLabel->Data(); | |
2472 | fIntFlowRebinnedInM = new TH1D(intFlowRebinnedInMName.Data(),"Reference flow estimates from Q-cumulants (rebinned in M)",4,0,4); | |
2473 | fIntFlowRebinnedInM->SetLabelSize(0.05); | |
2474 | fIntFlowRebinnedInM->SetMarkerStyle(25); | |
68a3b4b1 | 2475 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2476 | { |
68a3b4b1 | 2477 | (fIntFlowRebinnedInM->GetXaxis())->SetBinLabel(b+1,flowFlag[b].Data()); |
b3dacf6b | 2478 | } |
2479 | fIntFlowResults->Add(fIntFlowRebinnedInM); | |
2480 | } | |
ff70ca91 | 2481 | // integrated flow from Q-cumulants: versus multiplicity: |
b3dacf6b | 2482 | if(fCalculateCumulantsVsM) |
2483 | { | |
2484 | TString intFlowVsMName = "fIntFlowVsM"; | |
2485 | intFlowVsMName += fAnalysisLabel->Data(); | |
2486 | for(Int_t co=0;co<4;co++) // cumulant order | |
2487 | { | |
2488 | fIntFlowVsM[co] = new TH1D(Form("%s, %s",intFlowVsMName.Data(),flowFlag[co].Data()), | |
2489 | Form("%s vs multipicity",flowFlag[co].Data()), | |
2490 | fnBinsMult,fMinMult,fMaxMult); | |
2491 | fIntFlowVsM[co]->GetXaxis()->SetTitle("M"); | |
2492 | fIntFlowVsM[co]->GetYaxis()->SetTitle(flowFlag[co].Data()); | |
2493 | fIntFlowResults->Add(fIntFlowVsM[co]); | |
2494 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
2495 | } // end of if(fCalculateCumulantsVsM) | |
2001bc3a | 2496 | // quantifying detector effects effects to correlations: |
2497 | TString intFlowDetectorBiasName = "fIntFlowDetectorBias"; | |
2498 | intFlowDetectorBiasName += fAnalysisLabel->Data(); | |
2499 | fIntFlowDetectorBias = new TH1D(intFlowDetectorBiasName.Data(),"Quantifying detector bias",4,0,4); | |
2500 | fIntFlowDetectorBias->SetLabelSize(0.05); | |
2501 | fIntFlowDetectorBias->SetMarkerStyle(25); | |
2502 | for(Int_t ci=0;ci<4;ci++) | |
2503 | { | |
2504 | (fIntFlowDetectorBias->GetXaxis())->SetBinLabel(ci+1,Form("#frac{corrected}{measured} %s",cumulantFlag[ci].Data())); | |
2505 | } | |
2506 | fIntFlowResults->Add(fIntFlowDetectorBias); | |
2507 | // quantifying detector effects to correlations versus multiplicity: | |
b3dacf6b | 2508 | if(fCalculateCumulantsVsM) |
2001bc3a | 2509 | { |
b3dacf6b | 2510 | TString intFlowDetectorBiasVsMName = "fIntFlowDetectorBiasVsM"; |
2511 | intFlowDetectorBiasVsMName += fAnalysisLabel->Data(); | |
2512 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2513 | { | |
2514 | fIntFlowDetectorBiasVsM[ci] = new TH1D(Form("%s for %s",intFlowDetectorBiasVsMName.Data(),cumulantFlag[ci].Data()), | |
2515 | Form("Quantifying detector bias for %s vs multipicity",cumulantFlag[ci].Data()), | |
2516 | fnBinsMult,fMinMult,fMaxMult); | |
2517 | fIntFlowDetectorBiasVsM[ci]->GetXaxis()->SetTitle("M"); | |
2518 | fIntFlowDetectorBiasVsM[ci]->GetYaxis()->SetTitle("#frac{corrected}{measured}"); | |
b77b6434 | 2519 | fIntFlowResults->Add(fIntFlowDetectorBiasVsM[ci]); |
b3dacf6b | 2520 | } // end of for(Int_t co=0;co<4;co++) // cumulant order |
2521 | } // end of if(fCalculateCumulantsVsM) | |
1268c371 | 2522 | |
489d5531 | 2523 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow() |
2524 | ||
489d5531 | 2525 | //================================================================================================================================ |
2526 | ||
489d5531 | 2527 | void AliFlowAnalysisWithQCumulants::InitializeArraysForNestedLoops() |
2528 | { | |
2529 | // Initialize arrays of all objects relevant for calculations with nested loops. | |
2530 | ||
2531 | // integrated flow: | |
2532 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2533 | { | |
2534 | fIntFlowDirectCorrectionTermsForNUA[sc] = NULL; | |
2535 | } | |
2536 | ||
2537 | // differential flow: | |
2538 | // correlations: | |
2539 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
2540 | { | |
2541 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2542 | { | |
2543 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2544 | { | |
2545 | fDiffFlowDirectCorrelations[t][pe][ci] = NULL; | |
2546 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
2547 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2548 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
2549 | // correction terms for non-uniform acceptance: | |
2550 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
2551 | { | |
2552 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2553 | { | |
2554 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2555 | { | |
2556 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
2557 | { | |
2558 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = NULL; | |
2559 | } | |
2560 | } | |
2561 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2562 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
2563 | ||
64e500e3 | 2564 | // other differential correlators: |
2565 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
2566 | { | |
2567 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2568 | { | |
2569 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2570 | { | |
2571 | for(Int_t ci=0;ci<1;ci++) // correlator index | |
2572 | { | |
2573 | fOtherDirectDiffCorrelators[t][pe][sc][ci] = NULL; | |
2574 | } | |
2575 | } | |
2576 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2577 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
489d5531 | 2578 | |
2579 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForNestedLoops() | |
2580 | ||
489d5531 | 2581 | //================================================================================================================================ |
2582 | ||
489d5531 | 2583 | void AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops() |
2584 | { | |
2585 | // Book all objects relevant for calculations with nested loops. | |
2586 | ||
2587 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?) | |
2588 | TString typeFlag[2] = {"RP","POI"}; // to be improved (should I promote this to data members?) | |
2589 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; // to be improved (should I promote this to data members?) | |
2590 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; // to be improved (should I promote this to data members?) | |
2591 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
2592 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
2593 | ||
2594 | TString evaluateNestedLoopsName = "fEvaluateNestedLoops"; | |
2595 | evaluateNestedLoopsName += fAnalysisLabel->Data(); | |
2596 | fEvaluateNestedLoops = new TProfile(evaluateNestedLoopsName.Data(),"Flags for nested loops",4,0,4); | |
2597 | fEvaluateNestedLoops->SetLabelSize(0.03); | |
2598 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(1,"fEvaluateIntFlowNestedLoops"); | |
2599 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(2,"fEvaluateDiffFlowNestedLoops"); | |
2600 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(3,"fCrossCheckInPtBinNo"); | |
2601 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(4,"fCrossCheckInEtaBinNo"); | |
2602 | fEvaluateNestedLoops->Fill(0.5,(Int_t)fEvaluateIntFlowNestedLoops); | |
2603 | fEvaluateNestedLoops->Fill(1.5,(Int_t)fEvaluateDiffFlowNestedLoops); | |
2604 | fEvaluateNestedLoops->Fill(2.5,fCrossCheckInPtBinNo); | |
2605 | fEvaluateNestedLoops->Fill(3.5,fCrossCheckInEtaBinNo); | |
2606 | fNestedLoopsList->Add(fEvaluateNestedLoops); | |
2607 | // nested loops for integrated flow: | |
2608 | if(fEvaluateIntFlowNestedLoops) | |
2609 | { | |
2610 | // correlations: | |
2611 | TString intFlowDirectCorrelationsName = "fIntFlowDirectCorrelations"; | |
2612 | intFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
403e3389 | 2613 | fIntFlowDirectCorrelations = new TProfile(intFlowDirectCorrelationsName.Data(),"Multiparticle correlations calculated with nested loops (for int. flow)",64,0,64,"s"); |
489d5531 | 2614 | fNestedLoopsList->Add(fIntFlowDirectCorrelations); |
403e3389 | 2615 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 2616 | { |
2617 | TString intFlowExtraDirectCorrelationsName = "fIntFlowExtraDirectCorrelations"; | |
2618 | intFlowExtraDirectCorrelationsName += fAnalysisLabel->Data(); | |
2619 | fIntFlowExtraDirectCorrelations = new TProfile(intFlowExtraDirectCorrelationsName.Data(),"Extra multiparticle correlations calculated with nested loops (for int. flow)",100,0,100,"s"); | |
2620 | fNestedLoopsList->Add(fIntFlowExtraDirectCorrelations); | |
403e3389 | 2621 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 2622 | // correction terms for non-uniform acceptance: |
2623 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2624 | { | |
2625 | TString intFlowDirectCorrectionTermsForNUAName = "fIntFlowDirectCorrectionTermsForNUA"; | |
2626 | intFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
2627 | fIntFlowDirectCorrectionTermsForNUA[sc] = new TProfile(Form("%s: %s terms",intFlowDirectCorrectionTermsForNUAName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),10,0,10,"s"); | |
2628 | fNestedLoopsList->Add(fIntFlowDirectCorrectionTermsForNUA[sc]); | |
2629 | } // end of for(Int_t sc=0;sc<2;sc++) | |
2630 | } // end of if(fEvaluateIntFlowNestedLoops) | |
2631 | ||
2632 | // nested loops for differential flow: | |
2633 | if(fEvaluateDiffFlowNestedLoops) | |
2634 | { | |
2635 | // reduced correlations: | |
2636 | TString diffFlowDirectCorrelationsName = "fDiffFlowDirectCorrelations"; | |
2637 | diffFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
2638 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
2639 | { | |
62e36168 | 2640 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 2641 | { |
2642 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
2643 | { | |
2644 | // reduced correlations: | |
2645 | fDiffFlowDirectCorrelations[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe],"s"); | |
2646 | fDiffFlowDirectCorrelations[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data()); | |
2647 | fNestedLoopsList->Add(fDiffFlowDirectCorrelations[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations) | |
2648 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
2649 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2650 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
64e500e3 | 2651 | |
2652 | ||
489d5531 | 2653 | // correction terms for non-uniform acceptance: |
2654 | TString diffFlowDirectCorrectionTermsForNUAName = "fDiffFlowDirectCorrectionTermsForNUA"; | |
2655 | diffFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
2656 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
2657 | { | |
62e36168 | 2658 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 2659 | { |
2660 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
2661 | { | |
2662 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
2663 | { | |
2664 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = new TProfile(Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe],"s"); | |
2665 | fNestedLoopsList->Add(fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]); | |
2666 | } | |
2667 | } | |
2668 | } | |
64e500e3 | 2669 | } |
2670 | // other differential correlators: | |
2671 | TString otherDirectDiffCorrelatorsName = "fOtherDirectDiffCorrelators"; | |
2672 | otherDirectDiffCorrelatorsName += fAnalysisLabel->Data(); | |
2673 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
2674 | { | |
62e36168 | 2675 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
64e500e3 | 2676 | { |
2677 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
2678 | { | |
2679 | for(Int_t ci=0;ci<1;ci++) // correlator index | |
2680 | { | |
2681 | fOtherDirectDiffCorrelators[t][pe][sc][ci] = new TProfile(Form("%s, %s, %s, %s, ci = %d",otherDirectDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1),Form("%s, %s, %s, %s, ci = %d",otherDirectDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe]); | |
2682 | fNestedLoopsList->Add(fOtherDirectDiffCorrelators[t][pe][sc][ci]); | |
2683 | } | |
2684 | } | |
2685 | } | |
2686 | } | |
3b552efe | 2687 | // number of RPs and POIs in selected pt and eta bins for cross-checkings: |
2688 | TString noOfParticlesInBinName = "fNoOfParticlesInBin"; | |
2689 | fNoOfParticlesInBin = new TH1D(noOfParticlesInBinName.Data(),"Number of RPs and POIs in selected p_{T} and #eta bin",4,0,4); | |
489d5531 | 2690 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(1,"# of RPs in p_{T} bin"); |
2691 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(2,"# of RPs in #eta bin"); | |
2692 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(3,"# of POIs in p_{T} bin"); | |
3b552efe | 2693 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(4,"# of POIs in #eta bin"); |
489d5531 | 2694 | fNestedLoopsList->Add(fNoOfParticlesInBin); |
2695 | } // end of if(fEvaluateDiffFlowNestedLoops) | |
2696 | ||
2697 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops() | |
2698 | ||
489d5531 | 2699 | //================================================================================================================================ |
2700 | ||
489d5531 | 2701 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelations() |
2702 | { | |
b84464d3 | 2703 | // Calculate in this method all multiparticle azimuthal correlations. |
2704 | // | |
2705 | // Remark 1: All multiparticle correlations are stored in TProfile fIntFlowCorrelationsAllPro; | |
2706 | // Remark 2: There is a special TProfile fIntFlowCorrelationsPro holding results | |
2707 | // only for same harmonic's correlations <<2>>, <<4>>, <<6>> and <<8>>; | |
2708 | // Remark 3: Binning of fIntFlowCorrelationsAllPro is organized as follows: | |
2709 | // -------------------------------------------------------------------------------------------------------------------- | |
2710 | // 1st bin: <2>_{1n|1n} = two1n1n = cos(1n(phi1-phi2))> | |
2711 | // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n(phi1-phi2))> | |
2712 | // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n(phi1-phi2))> | |
2713 | // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n(phi1-phi2))> | |
2714 | // 5th bin: ---- EMPTY ---- | |
2715 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n(2*phi1-phi2-phi3))> | |
2716 | // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n(3*phi1-2*phi2-phi3))> | |
2717 | // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n(4*phi1-2*phi2-2*phi3))> | |
2718 | // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n(4*phi1-3*phi2-phi3))> | |
2719 | // 10th bin: ---- EMPTY ---- | |
2720 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n(phi1+phi2-phi3-phi4))> | |
2721 | // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(n(2*phi1+phi2-2*phi3-phi4))> | |
2722 | // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(2n(phi1+phi2-phi3-phi4))> | |
2723 | // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n(3*phi1-phi2-phi3-phi4))> | |
2724 | // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n(3*phi1+phi2-3*phi3-phi4))> | |
2725 | // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n(3*phi1+phi2-2*phi3-2*phi4))> | |
2726 | // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n(4*phi1-2*phi2-phi3-phi4))> | |
2727 | // 18th bin: ---- EMPTY ---- | |
2728 | // 19th bin: <5>_{2n,1n|1n,1n,1n} = five2n1n1n1n1n = <cos(n(2*phi1+phi2-phi3-phi4-phi5))> | |
2729 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n(2*phi1+2*phi2-2*phi3-phi4-phi5))> | |
2730 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n(3*phi1+phi2-2*phi3-phi4-phi5))> | |
2731 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n(4*phi1-phi2-phi3-phi4-phi5))> | |
2732 | // 23rd bin: ---- EMPTY ---- | |
2733 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n(phi1+phi2+phi3-phi4-phi5-phi6))> | |
2734 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n(2*phi1+phi2+phi3-2*phi4-phi5-phi6))> | |
2735 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n(2*phi1+2*phi2-phi3-phi4-phi5-phi6))> | |
2736 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n(3*phi1+phi2-phi3-phi4-phi5-phi6))> | |
2737 | // 28th bin: ---- EMPTY ---- | |
2738 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n(2*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> | |
2739 | // 30th bin: ---- EMPTY ---- | |
2740 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> | |
2741 | // 32nd bin: ---- EMPTY ---- | |
2742 | // Extra correlations for v3{5} study: | |
2743 | // 33rd bin: <4>_{4n,2n|3n,3n} = four4n2n3n3n = <cos(n(4*phi1+2*phi2-3*phi3-3*phi4))> | |
2744 | // 34th bin: <5>_{3n,3n|2n,2n,2n} = five3n3n2n2n2n = <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-2*phi5))> | |
2745 | // Extra correlations for Teaney-Yan study: | |
2746 | // 35th bin: <2>_{5n|5n} = two5n5n = <cos(5n(phi1-phi2)> | |
2747 | // 36th bin: <2>_{6n|6n} = two6n6n = <cos(6n(phi1-phi2)> | |
2748 | // 37th bin: <3>_{5n|3n,2n} = three5n3n2n = <cos(n(5*phi1-3*phi2-2*phi3)> | |
2749 | // 38th bin: <3>_{5n|4n,1n} = three5n4n1n = <cos(n(5*phi1-4*phi2-1*phi3)> | |
2750 | // 39th bin: <3>_{6n|3n,3n} = three6n3n3n = <cos(n(6*phi1-3*phi2-3*phi3)> | |
2751 | // 40th bin: <3>_{6n|4n,2n} = three6n4n2n = <cos(n(6*phi1-4*phi2-2*phi3)> | |
2752 | // 41st bin: <3>_{6n|5n,1n} = three6n5n1n = <cos(n(6*phi1-5*phi2-1*phi3)> | |
2753 | // 42nd bin: <4>_{6n|3n,2n,1n} = four6n3n2n1n = <cos(n(6*phi1-3*phi2-2*phi3-1*phi4)> | |
2754 | // 43rd bin: <4>_{3n,2n|3n,2n} = four3n2n3n2n = <cos(n(3*phi1+2*phi2-3*phi3-2*phi4)> | |
2755 | // 44th bin: <4>_{4n,1n|3n,2n} = four4n1n3n2n = <cos(n(4*phi1+1*phi2-3*phi3-2*phi4)> | |
2756 | // 45th bin: <4>_{3n,3n|3n,3n} = four3n3n3n3n = <cos(3n*(phi1+phi2-phi3-phi4))> | |
2757 | // 46th bin: <4>_{4n,2n|3n,3n} = four4n2n3n3n = <cos(n(4*phi1+2*phi2-3*phi3-3*phi4)> | |
2758 | // 47th bin: <4>_{5n,1n|3n,3n} = four5n1n3n3n = <cos(n(5*phi1+1*phi2-3*phi3-3*phi4)> | |
2759 | // 48th bin: <4>_{4n,2n|4n,2n} = four4n2n4n2n = <cos(n(4*phi1+2*phi2-4*phi3-2*phi4)> | |
2760 | // 49th bin: <4>_{5n,1n|4n,2n} = four5n1n4n2n = <cos(n(5*phi1+1*phi2-4*phi3-2*phi4)> | |
2761 | // 50th bin: <4>_{5n|3n,1n,1n} = four5n3n1n1n = <cos(n(5*phi1-3*phi2-1*phi3-1*phi4)> | |
2762 | // 51st bin: <4>_{5n|2n,2n,1n} = four5n2n2n1n = <cos(n(5*phi1-2*phi2-2*phi3-1*phi4)> | |
2763 | // 52nd bin: <4>_{5n,1n|5n,1n} = four5n1n5n1n = <cos(n(5*phi1+1*phi2-5*phi3-1*phi4)> | |
2764 | // 53rd bin: <5>_{3n,3n|3n,2n,1n} = five3n3n3n2n1n = <cos(n(3*phi1+3*phi2-3*phi3-2*phi4-1*phi5)> | |
2765 | // 54th bin: <5>_{4n,2n|3n,2n,1n} = five4n2n3n2n1n = <cos(n(4*phi1+2*phi2-3*phi3-2*phi4-1*phi5)> | |
2766 | // 55th bin: <5>_{3n,2n|3n,1n,1n} = five3n2n3n1n1n = <cos(n(3*phi1+2*phi2-3*phi3-1*phi4-1*phi5)> | |
2767 | // 56th bin: <5>_{3n,2n|2n,2n,1n} = five3n2n2n2n1n = <cos(n(3*phi1+2*phi2-2*phi3-2*phi4-1*phi5)> | |
2768 | // 57th bin: <5>_{5n,1n|3n,2n,1n} = five5n1n3n2n1n = <cos(n(5*phi1+1*phi2-3*phi3-2*phi4-1*phi5)> | |
2769 | // 58th bin: <6>_{3n,2n,1n|3n,2n,1n} = six3n2n1n3n2n1n = <cos(n(3*phi1+2*phi2+1*phi3-3*phi4-2*phi5-1*phi6)> | |
403e3389 | 2770 | // Extra correlations for Teaney-Yan study (B): |
2771 | // 59th bin: <4>_{6n|4n,1n,1n} = four6n4n1n1n = <cos(n(6*phi1-4*phi2-1*phi3-1*phi4)> | |
2772 | // 60th bin: <4>_{6n|2n,2n,2n} = four6n2n2n2n = <cos(n(6*phi1-2*phi2-2*phi3-2*phi4)> | |
2773 | // 61st bin: <5>_{6n|2n,2n,1n,1n} = five6n2n2n1n1n = <cos(n(6*phi1-2*phi2-2*phi3-1*phi4-1*phi5)> | |
2774 | // 62nd bin: <5>_{4n,1n,1n|3n,3n} = five4n1n1n3n3n = <cos(n(4*phi1+1*phi2+1*phi3-3*phi4-3*phi5)> | |
2775 | // 63rd bin: <6>_{3n,3n|2n,2n,1n,1n} = six3n3n2n2n1n1n = <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-1*phi5-1*phi6)> | |
b84464d3 | 2776 | // -------------------------------------------------------------------------------------------------------------------- |
403e3389 | 2777 | |
2778 | // Multiplicity of an event: | |
1268c371 | 2779 | Double_t dMult = (*fSpk)(0,0); |
b84464d3 | 2780 | // Real parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n, 4n, 5n and 6n: |
489d5531 | 2781 | Double_t dReQ1n = (*fReQ)(0,0); |
2782 | Double_t dReQ2n = (*fReQ)(1,0); | |
2783 | Double_t dReQ3n = (*fReQ)(2,0); | |
2784 | Double_t dReQ4n = (*fReQ)(3,0); | |
b84464d3 | 2785 | Double_t dReQ5n = (*fReQ)(4,0); |
8ed4edc7 | 2786 | Double_t dReQ6n = (*fReQ)(5,0); |
b84464d3 | 2787 | // Imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n, 4n, 5n and 6n: |
489d5531 | 2788 | Double_t dImQ1n = (*fImQ)(0,0); |
2789 | Double_t dImQ2n = (*fImQ)(1,0); | |
2790 | Double_t dImQ3n = (*fImQ)(2,0); | |
2791 | Double_t dImQ4n = (*fImQ)(3,0); | |
b84464d3 | 2792 | Double_t dImQ5n = (*fImQ)(4,0); |
8ed4edc7 | 2793 | Double_t dImQ6n = (*fImQ)(5,0); |
489d5531 | 2794 | |
b84464d3 | 2795 | // Real parts of expressions involving various combinations of Q-vectors which appears |
2796 | // simultaneously in several equations for multiparticle correlations bellow: | |
2797 | // Re[Q_{2n}Q_{n}^*Q_{n}^*] | |
2798 | Double_t reQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n; | |
2799 | // Re[Q_{6n}Q_{3n}^*Q_{3n}^*] | |
2800 | Double_t reQ6nQ3nstarQ3nstar = pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n; | |
2801 | // Re[Q_{4n}Q_{2n}^*Q_{2n}^*] | |
489d5531 | 2802 | Double_t reQ4nQ2nstarQ2nstar = pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n; |
b84464d3 | 2803 | // Re[Q_{4n}Q_{3n}^*Q_{n}^*] |
489d5531 | 2804 | Double_t reQ4nQ3nstarQ1nstar = dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n); |
b84464d3 | 2805 | // Re[Q_{3n}Q_{2n}^*Q_{n}^*] |
489d5531 | 2806 | Double_t reQ3nQ2nstarQ1nstar = dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n |
b84464d3 | 2807 | + dImQ3n*dImQ2n*dReQ1n; |
2808 | // Re[Q_{5n}Q_{3n}^*Q_{2n}^*] | |
2809 | Double_t reQ5nQ3nstarQ2nstar = dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n | |
2810 | + dImQ5n*dImQ2n*dReQ3n; | |
2811 | // Re[Q_{5n}Q_{4n}^*Q_{1n}^*] | |
2812 | Double_t reQ5nQ4nstarQ1nstar = dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n | |
2813 | + dImQ5n*dImQ4n*dReQ1n; | |
2814 | // Re[Q_{6n}Q_{5n}^*Q_{1n}^*] | |
2815 | Double_t reQ6nQ5nstarQ1nstar = dReQ6n*dReQ5n*dReQ1n-dReQ6n*dImQ5n*dImQ1n+dImQ6n*dReQ5n*dImQ1n | |
2816 | + dImQ6n*dImQ5n*dReQ1n; | |
2817 | // Re[Q_{6n}Q_{4n}^*Q_{2n}^*] | |
2818 | Double_t reQ6nQ4nstarQ2nstar = dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n | |
2819 | + dImQ6n*dImQ4n*dReQ2n; | |
2820 | // Re[Q_{3n}Q_{n}Q_{2n}^*Q_{2n}^*] | |
2821 | Double_t reQ3nQ1nQ2nstarQ2nstar = (pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n) | |
2822 | + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n); | |
2823 | // Re[Q_{3n}Q_{n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 2824 | Double_t reQ3nQ1nstarQ1nstarQ1nstar = dReQ3n*pow(dReQ1n,3)-3.*dReQ1n*dReQ3n*pow(dImQ1n,2) |
2825 | + 3.*dImQ1n*dImQ3n*pow(dReQ1n,2)-dImQ3n*pow(dImQ1n,3); | |
403e3389 | 2826 | // Re[Q_{6n}Q_{2n}^*Q_{2n}^*Q_{2n}^*] |
2827 | Double_t reQ6nQ2nstarQ2nstarQ2nstar = dReQ6n*pow(dReQ2n,3)-3.*dReQ2n*dReQ6n*pow(dImQ2n,2) | |
2828 | + 3.*dImQ2n*dImQ6n*pow(dReQ2n,2)-dImQ6n*pow(dImQ2n,3); | |
b84464d3 | 2829 | // Re[Q_{4n}Q_{2n}^*Q_{n}^*Q_{n}^*] |
2830 | Double_t reQ4nQ2nstarQ1nstarQ1nstar = (dReQ4n*dReQ2n+dImQ4n*dImQ2n)*(pow(dReQ1n,2)-pow(dImQ1n,2)) | |
2831 | + 2.*dReQ1n*dImQ1n*(dImQ4n*dReQ2n-dReQ4n*dImQ2n); | |
2832 | // Re[Q_{4n}Q_{2n}^*Q_{3n}^*Q_{3n}^*] | |
2833 | Double_t reQ4nQ2nQ3nstarQ3nstar = (dReQ4n*dReQ2n-dImQ4n*dImQ2n)*(dReQ3n*dReQ3n-dImQ3n*dImQ3n) | |
2834 | + 2.*(dReQ4n*dImQ2n+dImQ4n*dReQ2n)*dReQ3n*dImQ3n; | |
2835 | // Re[Q_{4n}Q_{n}Q_{3n}^*Q_{2n}^*] | |
2836 | Double_t reQ4nQ1nQ3nstarQ2nstar = dImQ1n*dImQ2n*dImQ3n*dImQ4n+dImQ3n*dImQ4n*dReQ1n*dReQ2n | |
2837 | + dImQ2n*dImQ4n*dReQ1n*dReQ3n-dImQ1n*dImQ4n*dReQ2n*dReQ3n | |
2838 | - dImQ2n*dImQ3n*dReQ1n*dReQ4n+dImQ1n*dImQ3n*dReQ2n*dReQ4n | |
2839 | + dImQ1n*dImQ2n*dReQ3n*dReQ4n+dReQ1n*dReQ2n*dReQ3n*dReQ4n; | |
2840 | // Re[Q_{5n}Q_{n}Q_{4n}^*Q_{2n}^*] | |
2841 | Double_t reQ5nQ1nQ4nstarQ2nstar = dImQ1n*dImQ2n*dImQ4n*dImQ5n+dImQ4n*dImQ5n*dReQ1n*dReQ2n | |
2842 | + dImQ2n*dImQ5n*dReQ1n*dReQ4n-dImQ1n*dImQ5n*dReQ2n*dReQ4n | |
2843 | - dImQ2n*dImQ4n*dReQ1n*dReQ5n+dImQ1n*dImQ4n*dReQ2n*dReQ5n | |
2844 | + dImQ1n*dImQ2n*dReQ4n*dReQ5n+dReQ1n*dReQ2n*dReQ4n*dReQ5n; | |
2845 | // Re[Q_{5n}Q_{n}Q_{3n}^*Q_{3n}^*] | |
2846 | Double_t reQ5nQ1nQ3nstarQ3nstar = dImQ1n*pow(dImQ3n,2.)*dImQ5n+2.*dImQ3n*dImQ5n*dReQ1n*dReQ3n | |
2847 | - dImQ1n*dImQ5n*pow(dReQ3n,2.)-pow(dImQ3n,2.)*dReQ1n*dReQ5n | |
2848 | + 2.*dImQ1n*dImQ3n*dReQ3n*dReQ5n+dReQ1n*pow(dReQ3n,2.)*dReQ5n; | |
2849 | // Re[Q_{5n}Q_{3n}^*Q_{n}^*Q_{n}^*] | |
2850 | Double_t reQ5nQ3nstarQ1nstarQ1nstar = -pow(dImQ1n,2.)*dImQ3n*dImQ5n+dImQ3n*dImQ5n*pow(dReQ1n,2.) | |
2851 | + 2.*dImQ1n*dImQ5n*dReQ1n*dReQ3n-2.*dImQ1n*dImQ3n*dReQ1n*dReQ5n | |
2852 | - pow(dImQ1n,2.)*dReQ3n*dReQ5n+pow(dReQ1n,2.)*dReQ3n*dReQ5n; | |
2853 | // Re[Q_{5n}Q_{2n}^*Q_{2n}^*Q_{n}^*] | |
2854 | Double_t reQ5nQ2nstarQ2nstarQ1nstar = -pow(dImQ2n,2.)*dImQ1n*dImQ5n+dImQ1n*dImQ5n*pow(dReQ2n,2.) | |
2855 | + 2.*dImQ2n*dImQ5n*dReQ2n*dReQ1n-2.*dImQ2n*dImQ1n*dReQ2n*dReQ5n | |
403e3389 | 2856 | - pow(dImQ2n,2.)*dReQ1n*dReQ5n+pow(dReQ2n,2.)*dReQ1n*dReQ5n; |
2857 | // Re[Q_{6n}Q_{4n}^*Q_{n}^*Q_{n}^*] | |
2858 | Double_t reQ6nQ4nstarQ1nstarQ1nstar = -pow(dImQ1n,2.)*dImQ4n*dImQ6n+dImQ4n*dImQ6n*pow(dReQ1n,2.) | |
2859 | + 2.*dImQ1n*dImQ6n*dReQ1n*dReQ4n-2.*dImQ1n*dImQ4n*dReQ1n*dReQ6n | |
2860 | - pow(dImQ1n,2.)*dReQ4n*dReQ6n+pow(dReQ1n,2.)*dReQ4n*dReQ6n; | |
489d5531 | 2861 | // |Q_{2n}|^2 |Q_{n}|^2 |
2862 | Double_t dQ2nQ1nQ2nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
b84464d3 | 2863 | // |Q_{4n}|^2 |Q_{2n}|^2 |
2864 | Double_t dQ4nQ2nQ4nstarQ2nstar = (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)); | |
2865 | // |Q_{3n}|^2 |Q_{2n}|^2 | |
2866 | Double_t dQ3nQ2nQ3nstarQ2nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)); | |
2867 | // |Q_{5n}|^2 |Q_{n}|^2 | |
2868 | Double_t dQ5nQ1nQ5nstarQ1nstar = (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
2869 | // Re[Q_{2n}Q_{n}Q_{n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 2870 | Double_t reQ2nQ1nQ1nstarQ1nstarQ1nstar = (dReQ2n*dReQ1n-dImQ2n*dImQ1n)*(pow(dReQ1n,3)-3.*dReQ1n*pow(dImQ1n,2)) |
b84464d3 | 2871 | + (dReQ2n*dImQ1n+dReQ1n*dImQ2n)*(3.*dImQ1n*pow(dReQ1n,2)-pow(dImQ1n,3)); |
2872 | // Re[Q_{2n}Q_{2n}Q_{2n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 2873 | Double_t reQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.)) |
2874 | * (dReQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) + 2.*dImQ2n*dReQ1n*dImQ1n); | |
b84464d3 | 2875 | // Re[Q_{4n}Q_{n}^*Q_{n}^*Q_{n}^*Q_{n}^*] |
489d5531 | 2876 | Double_t reQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dReQ4n-6.*pow(dReQ1n,2.)*dReQ4n*pow(dImQ1n,2.) |
2877 | + pow(dImQ1n,4.)*dReQ4n+4.*pow(dReQ1n,3.)*dImQ1n*dImQ4n | |
2878 | - 4.*pow(dImQ1n,3.)*dReQ1n*dImQ4n; | |
b84464d3 | 2879 | // Re[Q_{3n}Q_{n}Q_{2n}^*Q_{n}^*Q_{n}^*] |
489d5531 | 2880 | Double_t reQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
b84464d3 | 2881 | * (dReQ1n*dReQ2n*dReQ3n-dReQ3n*dImQ1n*dImQ2n |
2882 | + dReQ2n*dImQ1n*dImQ3n+dReQ1n*dImQ2n*dImQ3n); | |
2883 | // Re[Q_{6n}Q_{n}Q_{3n}^*Q_{2n}^*Q_{n}^*] | |
2884 | Double_t reQ6nQ3nstarQ2nstarQ1nstar = dReQ1n*dReQ2n*dReQ3n*dReQ6n-dReQ3n*dReQ6n*dImQ1n*dImQ2n | |
2885 | - dReQ2n*dReQ6n*dImQ1n*dImQ3n-dReQ1n*dReQ6n*dImQ2n*dImQ3n | |
2886 | + dReQ2n*dReQ3n*dImQ1n*dImQ6n+dReQ1n*dReQ3n*dImQ2n*dImQ6n | |
2887 | + dReQ1n*dReQ2n*dImQ3n*dImQ6n-dImQ1n*dImQ2n*dImQ3n*dImQ6n; | |
2888 | // Re[Q_{3n}Q_{3n}Q_{3n}^*Q_{2n}^*Q_{n}^*] | |
2889 | Double_t reQ3nQ3nQ3nstarQ2nstarQ1nstar = (pow(dImQ3n,2.)+pow(dReQ3n,2.)) | |
2890 | * (dImQ2n*dImQ3n*dReQ1n+dImQ1n*dImQ3n*dReQ2n | |
2891 | - dImQ1n*dImQ2n*dReQ3n+dReQ1n*dReQ2n*dReQ3n); | |
2892 | // Re[Q_{3n}Q_{3n}Q_{2n}^*Q_{2n}^*Q_{2n}^*] | |
2893 | Double_t reQ3nQ3nQ2nstarQ2nstarQ2nstar = pow(dReQ2n,3.)*pow(dReQ3n,2.) | |
2894 | - 3.*dReQ2n*pow(dReQ3n,2.)*pow(dImQ2n,2.) | |
2895 | + 6.*pow(dReQ2n,2.)*dReQ3n*dImQ2n*dImQ3n | |
2896 | - 2.*dReQ3n*pow(dImQ2n,3.)*dImQ3n-pow(dReQ2n,3.)*pow(dImQ3n,2.) | |
2897 | + 3.*dReQ2n*pow(dImQ2n,2.)*pow(dImQ3n,2.); | |
2898 | // Re[Q_{4n}Q_{2n}Q_{3n}^*Q_{2n}^*Q_{n}^*] | |
2899 | Double_t reQ4nQ2nQ3nstarQ2nstarQ1nstar = (pow(dImQ2n,2.)+pow(dReQ2n,2.)) | |
2900 | * (dImQ3n*dImQ4n*dReQ1n+dImQ1n*dImQ4n*dReQ3n | |
2901 | - dImQ1n*dImQ3n*dReQ4n+dReQ1n*dReQ3n*dReQ4n); | |
2902 | // Re[Q_{3n}Q_{2n}Q_{3n}^*Q_{n}^*Q_{n}^*] | |
2903 | Double_t reQ3nQ2nQ3nstarQ1nstarQ1nstar = -(pow(dImQ3n,2.)+pow(dReQ3n,2.)) | |
2904 | * (-2.*dImQ1n*dImQ2n*dReQ1n+pow(dImQ1n,2.)*dReQ2n-pow(dReQ1n,2.)*dReQ2n); | |
2905 | // Re[Q_{3n}Q_{2n}Q_{2n}^*Q_{2n}^*Q_{n}^*] | |
2906 | Double_t reQ3nQ2nQ2nstarQ2nstarQ1nstar = (pow(dImQ2n,2.)+pow(dReQ2n,2.)) | |
2907 | * (dImQ2n*dImQ3n*dReQ1n+dImQ1n*dImQ3n*dReQ2n | |
2908 | - dImQ1n*dImQ2n*dReQ3n+dReQ1n*dReQ2n*dReQ3n); | |
2909 | // Re[Q_{5n}Q_{n}Q_{3n}^*Q_{2n}^*Q_{n}^*] | |
2910 | Double_t reQ5nQ1nQ3nstarQ2nstarQ1nstar = (pow(dImQ1n,2.)+pow(dReQ1n,2.)) | |
2911 | * (dImQ3n*dImQ5n*dReQ2n+dImQ2n*dImQ5n*dReQ3n | |
2912 | - dImQ2n*dImQ3n*dReQ5n+dReQ2n*dReQ3n*dReQ5n); | |
2913 | // Re[Q_{2n}Q_{2n}Q_{n}^*Q_{n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 2914 | Double_t reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)*dReQ2n-2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.) |
2915 | + dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dImQ2n) | |
2916 | * (pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.) | |
b84464d3 | 2917 | - dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n+pow(dImQ1n,2.)*dImQ2n); |
2918 | // Re[Q_{3n}Q_{n}Q_{n}^*Q_{n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 2919 | Double_t reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
2920 | * (pow(dReQ1n,3.)*dReQ3n-3.*dReQ1n*dReQ3n*pow(dImQ1n,2.) | |
2921 | + 3.*pow(dReQ1n,2.)*dImQ1n*dImQ3n-pow(dImQ1n,3.)*dImQ3n); | |
489d5531 | 2922 | // |Q_{2n}|^2 |Q_{n}|^4 |
b84464d3 | 2923 | Double_t dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.); |
2924 | // |Q_{3n}|^2 |Q_{2n}|^2 |Q_{n}|^2 | |
2925 | Double_t dQ3nQ2nQ1nQ3nstarQ2nstarQ1nstar = (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2926 | * (pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
2927 | // Re[Q_{2n}Q_{n}Q_{n}Q_{n}^*Q_{n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 2928 | Double_t reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) |
2929 | * (pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.) | |
2930 | + 2.*dReQ1n*dImQ1n*dImQ2n); | |
489d5531 | 2931 | |
b84464d3 | 2932 | // Results for multiparticle azimuthal correlations: |
489d5531 | 2933 | // 2-particle: |
b84464d3 | 2934 | Double_t two1n1n = 0.; // <cos(n(phi1-phi2))> |
2935 | Double_t two2n2n = 0.; // <cos(2n(phi1-phi2))> | |
2936 | Double_t two3n3n = 0.; // <cos(3n(phi1-phi2))> | |
2937 | Double_t two4n4n = 0.; // <cos(4n(phi1-phi2))> | |
489d5531 | 2938 | if(dMult>1) |
2939 | { | |
2940 | two1n1n = (pow(dReQ1n,2.)+pow(dImQ1n,2.)-dMult)/(dMult*(dMult-1.)); | |
2941 | two2n2n = (pow(dReQ2n,2.)+pow(dImQ2n,2.)-dMult)/(dMult*(dMult-1.)); | |
2942 | two3n3n = (pow(dReQ3n,2.)+pow(dImQ3n,2.)-dMult)/(dMult*(dMult-1.)); | |
2943 | two4n4n = (pow(dReQ4n,2.)+pow(dImQ4n,2.)-dMult)/(dMult*(dMult-1.)); | |
b84464d3 | 2944 | // Average 2-particle correlations for single event: |
489d5531 | 2945 | fIntFlowCorrelationsAllEBE->SetBinContent(1,two1n1n); |
2946 | fIntFlowCorrelationsAllEBE->SetBinContent(2,two2n2n); | |
2947 | fIntFlowCorrelationsAllEBE->SetBinContent(3,two3n3n); | |
b84464d3 | 2948 | fIntFlowCorrelationsAllEBE->SetBinContent(4,two4n4n); |
2949 | // Average 2-particle correlations for all events: | |
2950 | fIntFlowCorrelationsAllPro->Fill(0.5,two1n1n,dMult*(dMult-1.)); | |
2951 | fIntFlowCorrelationsAllPro->Fill(1.5,two2n2n,dMult*(dMult-1.)); | |
2952 | fIntFlowCorrelationsAllPro->Fill(2.5,two3n3n,dMult*(dMult-1.)); | |
2953 | fIntFlowCorrelationsAllPro->Fill(3.5,two4n4n,dMult*(dMult-1.)); | |
2954 | // Store separetately <2>: | |
2955 | fIntFlowCorrelationsEBE->SetBinContent(1,two1n1n); // <2> | |
2956 | // Testing other multiplicity weights: | |
489d5531 | 2957 | Double_t mWeight2p = 0.; |
2958 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
2959 | { | |
2960 | mWeight2p = dMult*(dMult-1.); | |
2961 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
2962 | { | |
2963 | mWeight2p = 1.; | |
2964 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
2965 | { | |
2966 | mWeight2p = dMult; | |
b84464d3 | 2967 | } |
489d5531 | 2968 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(1,mWeight2p); // eW_<2> |
2969 | fIntFlowCorrelationsPro->Fill(0.5,two1n1n,mWeight2p); | |
b40a910e | 2970 | fIntFlowSquaredCorrelationsPro->Fill(0.5,two1n1n*two1n1n,mWeight2p); |
2971 | if(fCalculateCumulantsVsM) | |
2972 | { | |
2973 | fIntFlowCorrelationsVsMPro[0]->Fill(dMult+0.5,two1n1n,mWeight2p); | |
2974 | fIntFlowSquaredCorrelationsVsMPro[0]->Fill(dMult+0.5,two1n1n*two1n1n,mWeight2p); | |
2975 | } | |
3435cacb | 2976 | if(fCalculateAllCorrelationsVsM) |
2977 | { | |
2978 | fIntFlowCorrelationsAllVsMPro[0]->Fill(dMult+0.5,two1n1n,mWeight2p); | |
2979 | fIntFlowCorrelationsAllVsMPro[1]->Fill(dMult+0.5,two2n2n,mWeight2p); | |
2980 | fIntFlowCorrelationsAllVsMPro[2]->Fill(dMult+0.5,two3n3n,mWeight2p); | |
2981 | fIntFlowCorrelationsAllVsMPro[3]->Fill(dMult+0.5,two4n4n,mWeight2p); | |
2982 | } | |
489d5531 | 2983 | } // end of if(dMult>1) |
2984 | ||
2985 | // 3-particle: | |
b84464d3 | 2986 | Double_t three2n1n1n = 0.; // <cos(n(2*phi1-phi2-phi3))> |
2987 | Double_t three3n2n1n = 0.; // <cos(n(3*phi1-2*phi2-phi3))> | |
2988 | Double_t three4n2n2n = 0.; // <cos(n(4*phi1-2*phi2-2*phi3))> | |
2989 | Double_t three4n3n1n = 0.; // <cos(n(4*phi1-3*phi2-phi3))> | |
489d5531 | 2990 | if(dMult>2) |
2991 | { | |
2992 | three2n1n1n = (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2993 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult) | |
2994 | / (dMult*(dMult-1.)*(dMult-2.)); | |
2995 | three3n2n1n = (reQ3nQ2nstarQ1nstar-(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2996 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2997 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
2998 | / (dMult*(dMult-1.)*(dMult-2.)); | |
2999 | three4n2n2n = (reQ4nQ2nstarQ2nstar-2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3000 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*dMult) | |
3001 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3002 | three4n3n1n = (reQ4nQ3nstarQ1nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3003 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3004 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
b84464d3 | 3005 | / (dMult*(dMult-1.)*(dMult-2.)); |
3006 | // Average 3-particle correlations for single event: | |
489d5531 | 3007 | fIntFlowCorrelationsAllEBE->SetBinContent(6,three2n1n1n); |
3008 | fIntFlowCorrelationsAllEBE->SetBinContent(7,three3n2n1n); | |
3009 | fIntFlowCorrelationsAllEBE->SetBinContent(8,three4n2n2n); | |
3010 | fIntFlowCorrelationsAllEBE->SetBinContent(9,three4n3n1n); | |
b84464d3 | 3011 | // Average 3-particle correlations for all events: |
489d5531 | 3012 | fIntFlowCorrelationsAllPro->Fill(5.5,three2n1n1n,dMult*(dMult-1.)*(dMult-2.)); |
3013 | fIntFlowCorrelationsAllPro->Fill(6.5,three3n2n1n,dMult*(dMult-1.)*(dMult-2.)); | |
3014 | fIntFlowCorrelationsAllPro->Fill(7.5,three4n2n2n,dMult*(dMult-1.)*(dMult-2.)); | |
3435cacb | 3015 | fIntFlowCorrelationsAllPro->Fill(8.5,three4n3n1n,dMult*(dMult-1.)*(dMult-2.)); |
b84464d3 | 3016 | // Average 3-particle correlations vs M for all events: |
3435cacb | 3017 | if(fCalculateAllCorrelationsVsM) |
3018 | { | |
3019 | fIntFlowCorrelationsAllVsMPro[5]->Fill(dMult+0.5,three2n1n1n,dMult*(dMult-1.)*(dMult-2.)); | |
3020 | fIntFlowCorrelationsAllVsMPro[6]->Fill(dMult+0.5,three3n2n1n,dMult*(dMult-1.)*(dMult-2.)); | |
3021 | fIntFlowCorrelationsAllVsMPro[7]->Fill(dMult+0.5,three4n2n2n,dMult*(dMult-1.)*(dMult-2.)); | |
3022 | fIntFlowCorrelationsAllVsMPro[8]->Fill(dMult+0.5,three4n3n1n,dMult*(dMult-1.)*(dMult-2.)); | |
3023 | } | |
489d5531 | 3024 | } // end of if(dMult>2) |
3025 | ||
3026 | // 4-particle: | |
b84464d3 | 3027 | Double_t four1n1n1n1n = 0.; // <cos(n(phi1+phi2-phi3-phi4))> |
3028 | Double_t four2n2n2n2n = 0.; // <cos(2n(phi1+phi2-phi3-phi4))> | |
3029 | Double_t four2n1n2n1n = 0.; // <cos(n(2*phi1+phi2-2*phi3-phi4))> | |
3030 | Double_t four3n1n1n1n = 0.; // <cos(n(3*phi1-phi2-phi3-phi4))> | |
3031 | Double_t four4n2n1n1n = 0.; // <cos(n(4*phi1-2*phi2-phi3-phi4))> | |
3032 | Double_t four3n1n2n2n = 0.; // <cos(n(3*phi1+phi2-2*phi3-2*phi4))> | |
3033 | Double_t four3n1n3n1n = 0.; // <cos(n(3*phi1+phi2-3*phi3-phi4))> | |
489d5531 | 3034 | if(dMult>3) |
3035 | { | |
3036 | four1n1n1n1n = (2.*dMult*(dMult-3.)+pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ1n,2.) | |
3037 | + pow(dImQ1n,2.))-2.*reQ2nQ1nstarQ1nstar+(pow(dReQ2n,2.)+pow(dImQ2n,2.))) | |
3038 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
3039 | four2n2n2n2n = (2.*dMult*(dMult-3.)+pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ2n,2.) | |
3040 | + pow(dImQ2n,2.))-2.*reQ4nQ2nstarQ2nstar+(pow(dReQ4n,2.)+pow(dImQ4n,2.))) | |
3041 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
3042 | four2n1n2n1n = (dQ2nQ1nQ2nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar-2.*reQ2nQ1nstarQ1nstar) | |
3043 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3044 | - ((dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3045 | + (dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-(pow(dReQ3n,2.)+pow(dImQ3n,2.))) | |
3046 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3047 | + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3048 | four3n1n1n1n = (reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar-3.*reQ2nQ1nstarQ1nstar |
3049 | + 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
489d5531 | 3050 | + 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) |
3051 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3052 | four4n2n1n1n = (reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar-2.*reQ3nQ2nstarQ1nstar) | |
3053 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3054 | - (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3055 | - 3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
3056 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3057 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3058 | four3n1n2n2n = (reQ3nQ1nQ2nstarQ2nstar-reQ4nQ2nstarQ2nstar-reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar) |
489d5531 | 3059 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
b84464d3 | 3060 | - (2.*reQ2nQ1nstarQ1nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) |
489d5531 | 3061 | - 4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) |
3062 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3063 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3064 | four3n1n3n1n = ((pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
b84464d3 | 3065 | - 2.*reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar |
3066 | + pow(dReQ4n,2.)+pow(dImQ4n,2.)-(dMult-4.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3067 | + pow(dReQ2n,2.)+pow(dImQ2n,2.)-(dMult-4.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3068 | + dMult*(dMult-6.)) | |
3069 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3070 | // Average 4-particle correlations for single event: | |
489d5531 | 3071 | fIntFlowCorrelationsAllEBE->SetBinContent(11,four1n1n1n1n); |
3072 | fIntFlowCorrelationsAllEBE->SetBinContent(12,four2n1n2n1n); | |
3073 | fIntFlowCorrelationsAllEBE->SetBinContent(13,four2n2n2n2n); | |
3074 | fIntFlowCorrelationsAllEBE->SetBinContent(14,four3n1n1n1n); | |
3075 | fIntFlowCorrelationsAllEBE->SetBinContent(15,four3n1n3n1n); | |
3076 | fIntFlowCorrelationsAllEBE->SetBinContent(16,four3n1n2n2n); | |
b84464d3 | 3077 | fIntFlowCorrelationsAllEBE->SetBinContent(17,four4n2n1n1n); |
3078 | // Average 4-particle correlations for all events: | |
489d5531 | 3079 | fIntFlowCorrelationsAllPro->Fill(10.5,four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
3080 | fIntFlowCorrelationsAllPro->Fill(11.5,four2n1n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3081 | fIntFlowCorrelationsAllPro->Fill(12.5,four2n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3082 | fIntFlowCorrelationsAllPro->Fill(13.5,four3n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3083 | fIntFlowCorrelationsAllPro->Fill(14.5,four3n1n3n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3084 | fIntFlowCorrelationsAllPro->Fill(15.5,four3n1n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3085 | fIntFlowCorrelationsAllPro->Fill(16.5,four4n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
3086 | // Average 4-particle correlations vs M for all events: | |
3435cacb | 3087 | if(fCalculateAllCorrelationsVsM) |
3088 | { | |
3089 | fIntFlowCorrelationsAllVsMPro[10]->Fill(dMult+0.5,four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3090 | fIntFlowCorrelationsAllVsMPro[11]->Fill(dMult+0.5,four2n1n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3091 | fIntFlowCorrelationsAllVsMPro[12]->Fill(dMult+0.5,four2n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3092 | fIntFlowCorrelationsAllVsMPro[13]->Fill(dMult+0.5,four3n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3093 | fIntFlowCorrelationsAllVsMPro[14]->Fill(dMult+0.5,four3n1n3n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3094 | fIntFlowCorrelationsAllVsMPro[15]->Fill(dMult+0.5,four3n1n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3095 | fIntFlowCorrelationsAllVsMPro[16]->Fill(dMult+0.5,four4n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3096 | } |
3097 | // Store separetately <4>: | |
489d5531 | 3098 | fIntFlowCorrelationsEBE->SetBinContent(2,four1n1n1n1n); // <4> |
b84464d3 | 3099 | // Testing other multiplicity weights: |
489d5531 | 3100 | Double_t mWeight4p = 0.; |
3101 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
3102 | { | |
3103 | mWeight4p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
3104 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
3105 | { | |
3106 | mWeight4p = 1.; | |
3107 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
3108 | { | |
3109 | mWeight4p = dMult; | |
b84464d3 | 3110 | } |
489d5531 | 3111 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(2,mWeight4p); // eW_<4> |
3112 | fIntFlowCorrelationsPro->Fill(1.5,four1n1n1n1n,mWeight4p); | |
b40a910e | 3113 | fIntFlowSquaredCorrelationsPro->Fill(1.5,four1n1n1n1n*four1n1n1n1n,mWeight4p); |
3114 | if(fCalculateCumulantsVsM) | |
3115 | { | |
3116 | fIntFlowCorrelationsVsMPro[1]->Fill(dMult+0.5,four1n1n1n1n,mWeight4p); | |
3117 | fIntFlowSquaredCorrelationsVsMPro[1]->Fill(dMult+0.5,four1n1n1n1n*four1n1n1n1n,mWeight4p); | |
3118 | } | |
489d5531 | 3119 | } // end of if(dMult>3) |
3120 | ||
3121 | // 5-particle: | |
b84464d3 | 3122 | Double_t five2n1n1n1n1n = 0.; // <cos(n(2*phi1+phi2-phi3-phi4-phi5))> |
3123 | Double_t five2n2n2n1n1n = 0.; // <cos(n(2*phi1+2*phi2-2*phi3-phi4-phi5))> | |
3124 | Double_t five3n1n2n1n1n = 0.; // <cos(n(3*phi1+phi2-2*phi3-phi4-phi5))> | |
3125 | Double_t five4n1n1n1n1n = 0.; // <cos(n(4*phi1-phi2-phi3-phi4-phi5))> | |
489d5531 | 3126 | if(dMult>4) |
b84464d3 | 3127 | { |
3128 | five2n1n1n1n1n = (reQ2nQ1nQ1nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar+5.*reQ3nQ2nstarQ1nstar | |
3129 | - 3.*(dMult-5.)*reQ2nQ1nstarQ1nstar-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3130 | - 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3131 | + 3.*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3132 | - 3.*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
3133 | + 6.*(2.*dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult*(dMult-4.)) | |
489d5531 | 3134 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
b84464d3 | 3135 | five2n2n2n1n1n = (reQ2nQ2nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ3nQ1nQ2nstarQ2nstar |
3136 | + 3.*reQ4nQ2nstarQ2nstar+8.*reQ3nQ2nstarQ1nstar+2.*reQ4nQ3nstarQ1nstar | |
3137 | - 2.*(dMult-6.)*reQ2nQ1nstarQ1nstar | |
3138 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3139 | - pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.) | |
3140 | + 2.*(3.*dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3141 | - 4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3142 | + 4.*(dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*dMult*(dMult-6.)) | |
489d5531 | 3143 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
b84464d3 | 3144 | five4n1n1n1n1n = (reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ4nQ2nstarQ1nstarQ1nstar-4.*reQ3nQ1nstarQ1nstarQ1nstar |
3145 | + 8.*reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar+12.*reQ3nQ2nstarQ1nstar+12.*reQ2nQ1nstarQ1nstar | |
3146 | - 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-8.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3147 | - 12.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-24.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+24.*dMult) | |
3148 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3149 | five3n1n2n1n1n = (reQ3nQ1nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar | |
3150 | - reQ3nQ1nQ2nstarQ2nstar+4.*reQ4nQ3nstarQ1nstar+reQ4nQ2nstarQ2nstar | |
3151 | - (2.*dMult-13.)*reQ3nQ2nstarQ1nstar+7.*reQ2nQ1nstarQ1nstar | |
3152 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3153 | + 2.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3154 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3155 | + 2.*(dMult-6.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
489d5531 | 3156 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
3157 | - pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
b84464d3 | 3158 | + 2.*(3.*dMult-11.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*dMult*(dMult-6.)) |
3159 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3160 | // Average 5-particle correlations for single event: | |
489d5531 | 3161 | fIntFlowCorrelationsAllEBE->SetBinContent(19,five2n1n1n1n1n); |
3162 | fIntFlowCorrelationsAllEBE->SetBinContent(20,five2n2n2n1n1n); | |
3163 | fIntFlowCorrelationsAllEBE->SetBinContent(21,five3n1n2n1n1n); | |
b84464d3 | 3164 | fIntFlowCorrelationsAllEBE->SetBinContent(22,five4n1n1n1n1n); |
3165 | // Average 5-particle correlations for all events: | |
489d5531 | 3166 | fIntFlowCorrelationsAllPro->Fill(18.5,five2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
3167 | fIntFlowCorrelationsAllPro->Fill(19.5,five2n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3168 | fIntFlowCorrelationsAllPro->Fill(20.5,five3n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
b84464d3 | 3169 | fIntFlowCorrelationsAllPro->Fill(21.5,five4n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
3170 | // Average 5-particle correlations vs M for all events: | |
3435cacb | 3171 | if(fCalculateAllCorrelationsVsM) |
3172 | { | |
3173 | fIntFlowCorrelationsAllVsMPro[18]->Fill(dMult+0.5,five2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3174 | fIntFlowCorrelationsAllVsMPro[19]->Fill(dMult+0.5,five2n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3175 | fIntFlowCorrelationsAllVsMPro[20]->Fill(dMult+0.5,five3n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3176 | fIntFlowCorrelationsAllVsMPro[21]->Fill(dMult+0.5,five4n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3177 | } | |
489d5531 | 3178 | } // end of if(dMult>4) |
3179 | ||
3180 | // 6-particle: | |
b84464d3 | 3181 | Double_t six1n1n1n1n1n1n = 0.; // <cos(n(phi1+phi2+phi3-phi4-phi5-phi6))> |
3182 | Double_t six2n2n1n1n1n1n = 0.; // <cos(n(2*phi1+2*phi2-phi3-phi4-phi5-phi6))> | |
3183 | Double_t six3n1n1n1n1n1n = 0.; // <cos(n(3*phi1+phi2-phi3-phi4-phi5-phi6))> | |
3184 | Double_t six2n1n1n2n1n1n = 0.; // <cos(n(2*phi1+phi2+phi3-2*phi4-phi5-phi6))> | |
489d5531 | 3185 | if(dMult>5) |
3186 | { | |
b84464d3 | 3187 | six1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),3.)-6.*reQ2nQ1nQ1nstarQ1nstarQ1nstar |
3188 | + 4.*reQ3nQ1nstarQ1nstarQ1nstar-12.*reQ3nQ2nstarQ1nstar+18.*(dMult-4.)*reQ2nQ1nstarQ1nstar | |
3189 | + 9.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3190 | + 4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))-9.*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3191 | - 9.*(dMult-4.)*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
3192 | + 18.*(dMult*dMult-7.*dMult+10.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3193 | - 6.*dMult*(dMult*dMult-9.*dMult+20.)) | |
3194 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3195 | six2n1n1n2n1n1n = (dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar-4.*reQ3nQ1nQ2nstarQ1nstarQ1nstar | |
3196 | - 4.*reQ2nQ1nQ1nstarQ1nstarQ1nstar-2.*reQ2nQ2nQ2nstarQ1nstarQ1nstar | |
3197 | + 4.*reQ4nQ2nstarQ1nstarQ1nstar+4.*reQ3nQ1nQ2nstarQ2nstar+4.*reQ3nQ1nstarQ1nstarQ1nstar | |
3198 | - 8.*reQ4nQ3nstarQ1nstar-4.*reQ4nQ2nstarQ2nstar+4.*(2.*dMult-13.)*reQ3nQ2nstarQ1nstar | |
3199 | + 2.*(7.*dMult-34.)*reQ2nQ1nstarQ1nstar+4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3200 | - 4.*(dMult-7.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3201 | + 4.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-4.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3202 | + pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)+(2.*dMult*dMult-27.*dMult+76.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3203 | - (dMult-12.)*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
3204 | + 4.*(dMult*dMult-15.*dMult+34.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3205 | - 2.*dMult*(dMult*dMult-17.*dMult+60.)) | |
3206 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3207 | six2n2n1n1n1n1n = (reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ2nQ2nQ2nstarQ1nstarQ1nstar-reQ4nQ1nstarQ1nstarQ1nstarQ1nstar | |
3208 | - 8.*reQ2nQ1nQ1nstarQ1nstarQ1nstar+8.*reQ3nQ1nstarQ1nstarQ1nstar+6.*reQ4nQ2nstarQ1nstarQ1nstar | |
3209 | + 8.*reQ3nQ1nQ2nstarQ2nstar-40.*reQ3nQ2nstarQ1nstar-8.*reQ4nQ3nstarQ1nstar-9.*reQ4nQ2nstarQ2nstar | |
3210 | + 24.*(dMult-4.)*reQ2nQ1nstarQ1nstar+24.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3211 | + 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+16.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3212 | + 3.*pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)-12.*(2.*dMult-7.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3213 | + 12.*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)-48.*(dMult-3.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3214 | + 24.*dMult*(dMult-5.)) | |
3215 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3216 | six3n1n1n1n1n1n = (reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ3nQ1nQ2nstarQ1nstarQ1nstar+6.*reQ4nQ2nstarQ1nstarQ1nstar | |
3217 | - reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-4.*reQ2nQ1nQ1nstarQ1nstarQ1nstar+3.*reQ3nQ1nQ2nstarQ2nstar | |
3218 | - 4.*(dMult-5.)*reQ3nQ1nstarQ1nstarQ1nstar-14.*reQ4nQ3nstarQ1nstar | |
3219 | - 3.*reQ4nQ2nstarQ2nstar+4.*(3.*dMult-17.)*reQ3nQ2nstarQ1nstar+12.*(dMult-6.)*reQ2nQ1nstarQ1nstar | |
3220 | + 12.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3221 | + 8.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3222 | + 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-8.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3223 | - 12.*(dMult-5.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-48.*(dMult-3.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3224 | + 12.*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)+24.*dMult*(dMult-5.)) | |
3225 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3226 | // Average 6-particle correlations for single event: | |
489d5531 | 3227 | fIntFlowCorrelationsAllEBE->SetBinContent(24,six1n1n1n1n1n1n); |
3228 | fIntFlowCorrelationsAllEBE->SetBinContent(25,six2n1n1n2n1n1n); | |
3229 | fIntFlowCorrelationsAllEBE->SetBinContent(26,six2n2n1n1n1n1n); | |
3230 | fIntFlowCorrelationsAllEBE->SetBinContent(27,six3n1n1n1n1n1n); | |
b84464d3 | 3231 | // Average 6-particle correlations for all events: |
489d5531 | 3232 | fIntFlowCorrelationsAllPro->Fill(23.5,six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
3233 | fIntFlowCorrelationsAllPro->Fill(24.5,six2n1n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3234 | fIntFlowCorrelationsAllPro->Fill(25.5,six2n2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3235 | fIntFlowCorrelationsAllPro->Fill(26.5,six3n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
b84464d3 | 3236 | // Average 6-particle correlations vs M for all events: |
3435cacb | 3237 | if(fCalculateAllCorrelationsVsM) |
3238 | { | |
3239 | fIntFlowCorrelationsAllVsMPro[23]->Fill(dMult+0.5,six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3240 | fIntFlowCorrelationsAllVsMPro[24]->Fill(dMult+0.5,six2n1n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3241 | fIntFlowCorrelationsAllVsMPro[25]->Fill(dMult+0.5,six2n2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3242 | fIntFlowCorrelationsAllVsMPro[26]->Fill(dMult+0.5,six3n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3243 | } | |
b84464d3 | 3244 | // Store separetately <6>: |
489d5531 | 3245 | fIntFlowCorrelationsEBE->SetBinContent(3,six1n1n1n1n1n1n); // <6> |
b84464d3 | 3246 | // Testing other multiplicity weights: |
489d5531 | 3247 | Double_t mWeight6p = 0.; |
3248 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
3249 | { | |
3250 | mWeight6p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.); | |
3251 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
3252 | { | |
3253 | mWeight6p = 1.; | |
3254 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
3255 | { | |
3256 | mWeight6p = dMult; | |
3257 | } | |
489d5531 | 3258 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(3,mWeight6p); // eW_<6> |
3259 | fIntFlowCorrelationsPro->Fill(2.5,six1n1n1n1n1n1n,mWeight6p); | |
b40a910e | 3260 | fIntFlowSquaredCorrelationsPro->Fill(2.5,six1n1n1n1n1n1n*six1n1n1n1n1n1n,mWeight6p); |
3261 | if(fCalculateCumulantsVsM) | |
3262 | { | |
3263 | fIntFlowCorrelationsVsMPro[2]->Fill(dMult+0.5,six1n1n1n1n1n1n,mWeight6p); | |
3264 | fIntFlowSquaredCorrelationsVsMPro[2]->Fill(dMult+0.5,six1n1n1n1n1n1n*six1n1n1n1n1n1n,mWeight6p); | |
3265 | } | |
489d5531 | 3266 | } // end of if(dMult>5) |
3267 | ||
3268 | // 7-particle: | |
b84464d3 | 3269 | Double_t seven2n1n1n1n1n1n1n = 0.; // <cos(n(2*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> |
489d5531 | 3270 | if(dMult>6) |
3271 | { | |
b84464d3 | 3272 | seven2n1n1n1n1n1n1n = (reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-4.*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),3.) |
3273 | - reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar-2.*reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar | |
3274 | + 9.*reQ2nQ2nQ2nstarQ1nstarQ1nstar+20.*reQ3nQ1nQ2nstarQ1nstarQ1nstar | |
3275 | + 2.*reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-8.*(dMult-8.)*reQ2nQ1nQ1nstarQ1nstarQ1nstar | |
3276 | - 18.*reQ4nQ2nstarQ1nstarQ1nstar-14.*reQ3nQ1nQ2nstarQ2nstar | |
3277 | + 8.*(dMult-7.)*reQ3nQ1nstarQ1nstarQ1nstar+28.*reQ4nQ3nstarQ1nstar | |
3278 | + 12.*reQ4nQ2nstarQ2nstar-8.*(5.*dMult-31.)*reQ3nQ2nstarQ1nstar | |
3279 | + 12.*(dMult*dMult-15.*dMult+46.)*reQ2nQ1nstarQ1nstar | |
3280 | - 16.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3281 | - 6.*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),2.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3282 | - 3.*pow(pow(dReQ2n,2.)+pow(dImQ2n,2.),2.) | |
3283 | + 12.*(2.*dMult-13.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3284 | - 12.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+16.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3285 | - 12.*(dMult-8.)*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3286 | + 12.*(3.*dMult-14.)*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),2.) | |
3287 | - 24.*(3.*dMult-7.)*(dMult-6.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3288 | + 24.*dMult*(dMult-5.)*(dMult-6.)) | |
3289 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)); | |
3290 | // Average 7-particle correlations for single event: | |
3291 | fIntFlowCorrelationsAllEBE->SetBinContent(29,seven2n1n1n1n1n1n1n); | |
3292 | // Average 7-particle correlations for all events: | |
3293 | fIntFlowCorrelationsAllPro->Fill(28.5,seven2n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) | |
3294 | *(dMult-4.)*(dMult-5.)*(dMult-6.)); | |
3295 | // Average 7-particle correlations vs M for all events: | |
3435cacb | 3296 | if(fCalculateAllCorrelationsVsM) |
3297 | { | |
b84464d3 | 3298 | fIntFlowCorrelationsAllVsMPro[28]->Fill(dMult+0.5,seven2n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) |
3299 | *(dMult-4.)*(dMult-5.)*(dMult-6.)); | |
3435cacb | 3300 | } |
489d5531 | 3301 | } // end of if(dMult>6) |
3302 | ||
3303 | // 8-particle: | |
b84464d3 | 3304 | Double_t eight1n1n1n1n1n1n1n1n = 0.; // <cos(n(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> |
489d5531 | 3305 | if(dMult>7) |
b84464d3 | 3306 | { |
3307 | eight1n1n1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),4.)-12.*reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar | |
3308 | + 16.*reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar+6.*reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar | |
3309 | - 12.*reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-36.*reQ2nQ2nQ2nstarQ1nstarQ1nstar | |
3310 | - 96.*reQ3nQ1nQ2nstarQ1nstarQ1nstar | |
3311 | + 72.*reQ4nQ2nstarQ1nstarQ1nstar+48.*reQ3nQ1nQ2nstarQ2nstar | |
3312 | - 64.*(dMult-6.)*reQ3nQ1nstarQ1nstarQ1nstar | |
3313 | + 96.*(dMult-6.)*reQ2nQ1nQ1nstarQ1nstarQ1nstar | |
3314 | - 96.*reQ4nQ3nstarQ1nstar-36.*reQ4nQ2nstarQ2nstar | |
3315 | + 192.*(dMult-6.)*reQ3nQ2nstarQ1nstar | |
3316 | - 144.*(dMult-7.)*(dMult-4.)*reQ2nQ1nstarQ1nstar | |
3317 | + 64.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3318 | - 144.*(dMult-6.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3319 | + 72.*(dMult-7.)*(dMult-4.)*(pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3320 | - 96.*(dMult-7.)*(dMult-6.)*(dMult-2.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3321 | + 36.*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),2.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3322 | + 9.*pow(pow(dReQ2n,2.)+pow(dImQ2n,2.),2.) | |
3323 | - 64.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3324 | + 36.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3325 | - 16.*(dMult-6.)*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),3.) | |
3326 | + 24.*dMult*(dMult-7.)*(dMult-6.)*(dMult-5.)) | |
3327 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); | |
3328 | // Average 8-particle correlations for single event: | |
3329 | fIntFlowCorrelationsAllEBE->SetBinContent(31,eight1n1n1n1n1n1n1n1n); | |
3330 | // Average 8-particle correlations for all events: | |
3331 | fIntFlowCorrelationsAllPro->Fill(30.5,eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) | |
3332 | *(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); | |
3333 | // Average 8-particle correlations vs M for all events: | |
3435cacb | 3334 | if(fCalculateAllCorrelationsVsM) |
3335 | { | |
b84464d3 | 3336 | fIntFlowCorrelationsAllVsMPro[30]->Fill(dMult+0.5,eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) |
3337 | *(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); | |
3338 | } | |
3339 | // Store separetately <8>: | |
489d5531 | 3340 | fIntFlowCorrelationsEBE->SetBinContent(4,eight1n1n1n1n1n1n1n1n); // <8> |
b84464d3 | 3341 | // Testing other multiplicity weights: |
489d5531 | 3342 | Double_t mWeight8p = 0.; |
3343 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
3344 | { | |
3345 | mWeight8p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.); | |
3346 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
3347 | { | |
3348 | mWeight8p = 1.; | |
3349 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
3350 | { | |
3351 | mWeight8p = dMult; | |
b84464d3 | 3352 | } |
489d5531 | 3353 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(4,mWeight8p); // eW_<8> |
b40a910e | 3354 | fIntFlowCorrelationsPro->Fill(3.5,eight1n1n1n1n1n1n1n1n,mWeight8p); |
3355 | fIntFlowSquaredCorrelationsPro->Fill(3.5,eight1n1n1n1n1n1n1n1n*eight1n1n1n1n1n1n1n1n,mWeight8p); | |
3356 | if(fCalculateCumulantsVsM) | |
3357 | { | |
3358 | fIntFlowCorrelationsVsMPro[3]->Fill(dMult+0.5,eight1n1n1n1n1n1n1n1n,mWeight8p); | |
3359 | fIntFlowSquaredCorrelationsVsMPro[3]->Fill(dMult+0.5,eight1n1n1n1n1n1n1n1n*eight1n1n1n1n1n1n1n1n,mWeight8p); | |
3360 | } | |
489d5531 | 3361 | } // end of if(dMult>7) |
3362 | ||
b84464d3 | 3363 | // EXTRA correlations for v3{5} study: |
8ed4edc7 | 3364 | // 4-particle: |
b84464d3 | 3365 | Double_t four4n2n3n3n = 0.; // <cos(n(4*phi1+2*phi2-3*phi3-3*phi4))> |
8ed4edc7 | 3366 | if(dMult>3.) |
3367 | { | |
11d3e40e | 3368 | four4n2n3n3n = (reQ4nQ2nQ3nstarQ3nstar-reQ6nQ4nstarQ2nstar-reQ6nQ3nstarQ3nstar |
3369 | - 2.*reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar | |
3370 | + (pow(dReQ6n,2.)+pow(dImQ6n,2.))+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3371 | + 2.*(2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3372 | + (pow(dReQ1n,2.)+pow(dImQ1n,2.))-3.*dMult)) | |
b84464d3 | 3373 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
8ed4edc7 | 3374 | fIntFlowCorrelationsAllPro->Fill(32.5,four4n2n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
b84464d3 | 3375 | // Average 4-particle correlations vs M for all events: |
3435cacb | 3376 | if(fCalculateAllCorrelationsVsM) |
3377 | { | |
3378 | fIntFlowCorrelationsAllVsMPro[32]->Fill(dMult+0.5,four4n2n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3379 | } | |
11d3e40e | 3380 | } // end of if(dMult>3.) |
8ed4edc7 | 3381 | |
3382 | // 5-particle: | |
b84464d3 | 3383 | Double_t five3n3n2n2n2n = 0.; // <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-2*phi5))> |
8ed4edc7 | 3384 | if(dMult>4.) |
3385 | { | |
b84464d3 | 3386 | five3n3n2n2n2n = (reQ3nQ3nQ2nstarQ2nstarQ2nstar-reQ6nQ2nstarQ2nstarQ2nstar-3.*reQ4nQ2nQ3nstarQ3nstar |
3387 | - 6.*reQ3nQ1nQ2nstarQ2nstar+2.*reQ6nQ3nstarQ3nstar+3.*reQ6nQ4nstarQ2nstar | |
3388 | + 6.*reQ4nQ3nstarQ1nstar+6.*reQ4nQ2nstarQ2nstar | |
3389 | + 12.*reQ3nQ2nstarQ1nstar+6.*reQ2nQ1nstarQ1nstar | |
11d3e40e | 3390 | - 2.*((pow(dReQ6n,2.)+pow(dImQ6n,2.)) |
3391 | + 3.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3392 | + 6.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3393 | + 9.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3394 | + 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-12.*dMult)) | |
b84464d3 | 3395 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
3396 | fIntFlowCorrelationsAllPro->Fill(33.5,five3n3n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3435cacb | 3397 | if(fCalculateAllCorrelationsVsM) |
3398 | { | |
b84464d3 | 3399 | fIntFlowCorrelationsAllVsMPro[33]->Fill(dMult+0.5,five3n3n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
3435cacb | 3400 | } |
11d3e40e | 3401 | } // end of if(dMult>4.) |
8ed4edc7 | 3402 | |
b84464d3 | 3403 | // EXTRA correlations for Teaney-Yan study: |
3404 | // 2-particle: | |
3405 | Double_t two5n5n = 0.; // <cos(5n(phi1-phi2))> | |
3406 | Double_t two6n6n = 0.; // <cos(6n(phi1-phi2))> | |
3407 | if(dMult>1) | |
3408 | { | |
3409 | two5n5n = (pow(dReQ5n,2.)+pow(dImQ5n,2.)-dMult)/(dMult*(dMult-1.)); | |
3410 | two6n6n = (pow(dReQ6n,2.)+pow(dImQ6n,2.)-dMult)/(dMult*(dMult-1.)); | |
3411 | // Average 2-particle correlations for all events: | |
3412 | fIntFlowCorrelationsAllPro->Fill(34.5,two5n5n,dMult*(dMult-1.)); | |
3413 | fIntFlowCorrelationsAllPro->Fill(35.5,two6n6n,dMult*(dMult-1.)); | |
3414 | if(fCalculateAllCorrelationsVsM) | |
3415 | { | |
3416 | fIntFlowCorrelationsAllVsMPro[34]->Fill(dMult+0.5,two5n5n,dMult*(dMult-1.)); | |
3417 | fIntFlowCorrelationsAllVsMPro[35]->Fill(dMult+0.5,two6n6n,dMult*(dMult-1.)); | |
3418 | } | |
3419 | } // end of if(dMult>1) | |
3420 | ||
3421 | // 3-particle: | |
3422 | Double_t three5n3n2n = 0.; // <cos(n(5*phi1-3*phi2-2*phi3)> | |
3423 | Double_t three5n4n1n = 0.; // <cos(n(5*phi1-4*phi2-1*phi3)> | |
3424 | Double_t three6n3n3n = 0.; // <cos(n(6*phi1-3*phi2-3*phi3)> | |
3425 | Double_t three6n4n2n = 0.; // <cos(n(6*phi1-4*phi2-2*phi3)> | |
3426 | Double_t three6n5n1n = 0.; // <cos(n(6*phi1-5*phi2-1*phi3)> | |
3427 | if(dMult>2) | |
3428 | { | |
3429 | three5n3n2n = (reQ5nQ3nstarQ2nstar-(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3430 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3431 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult) | |
3432 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3433 | three5n4n1n = (reQ5nQ4nstarQ1nstar-(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3434 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3435 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
3436 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3437 | three6n3n3n = (reQ6nQ3nstarQ3nstar-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3438 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))+2.*dMult) | |
3439 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3440 | three6n4n2n = (reQ6nQ4nstarQ2nstar-(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
3441 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3442 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult) | |
3443 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3444 | three6n5n1n = (reQ6nQ5nstarQ1nstar-(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
3445 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3446 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
3447 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3448 | // Average 3-particle correlations for all events: | |
3449 | fIntFlowCorrelationsAllPro->Fill(36.5,three5n3n2n,dMult*(dMult-1.)*(dMult-2.)); // <<cos(n(5*phi1-3*phi2-2*phi3)>> | |
3450 | fIntFlowCorrelationsAllPro->Fill(37.5,three5n4n1n,dMult*(dMult-1.)*(dMult-2.)); // <<cos(n(5*phi1-4*phi2-1*phi3)>> | |
3451 | fIntFlowCorrelationsAllPro->Fill(38.5,three6n3n3n,dMult*(dMult-1.)*(dMult-2.)); // <<cos(n(6*phi1-3*phi2-3*phi3)>> | |
3452 | fIntFlowCorrelationsAllPro->Fill(39.5,three6n4n2n,dMult*(dMult-1.)*(dMult-2.)); // <<cos(n(6*phi1-4*phi2-2*phi3)>> | |
3453 | fIntFlowCorrelationsAllPro->Fill(40.5,three6n5n1n,dMult*(dMult-1.)*(dMult-2.)); // <<cos(n(6*phi1-5*phi2-1*phi3)>> | |
3454 | if(fCalculateAllCorrelationsVsM) | |
3455 | { | |
3456 | fIntFlowCorrelationsAllVsMPro[36]->Fill(dMult+0.5,three5n3n2n,dMult*(dMult-1.)*(dMult-2.)); | |
3457 | fIntFlowCorrelationsAllVsMPro[37]->Fill(dMult+0.5,three5n4n1n,dMult*(dMult-1.)*(dMult-2.)); | |
3458 | fIntFlowCorrelationsAllVsMPro[38]->Fill(dMult+0.5,three6n3n3n,dMult*(dMult-1.)*(dMult-2.)); | |
3459 | fIntFlowCorrelationsAllVsMPro[39]->Fill(dMult+0.5,three6n4n2n,dMult*(dMult-1.)*(dMult-2.)); | |
3460 | fIntFlowCorrelationsAllVsMPro[40]->Fill(dMult+0.5,three6n5n1n,dMult*(dMult-1.)*(dMult-2.)); | |
3461 | } | |
3462 | } // end of if(dMult>2) | |
3463 | ||
3464 | // 4-particle: | |
3465 | Double_t four6n3n2n1n = 0.; // <cos(n(6*phi1-3*phi2-2*phi3-1*phi4)> | |
3466 | Double_t four3n2n3n2n = 0.; // <cos(n(3*phi1+2*phi2-3*phi3-2*phi4)> | |
3467 | Double_t four4n1n3n2n = 0.; // <cos(n(4*phi1+1*phi2-3*phi3-2*phi4)> | |
3468 | Double_t four3n3n3n3n = 0.; // <cos(3n(phi1+phi2-phi3-phi4))> | |
3469 | //Double_t four4n2n3n3n = 0.; // <cos(n(4*phi1+2*phi2-3*phi3-3*phi4)> // I already have this one above | |
3470 | Double_t four5n1n3n3n = 0.; // <cos(n(5*phi1+1*phi2-3*phi3-3*phi4)> | |
3471 | Double_t four4n2n4n2n = 0.; // <cos(n(4*phi1+2*phi2-4*phi3-2*phi4)> | |
3472 | Double_t four5n1n4n2n = 0.; // <cos(n(5*phi1+1*phi2-4*phi3-2*phi4)> | |
3473 | Double_t four5n3n1n1n = 0.; // <cos(n(5*phi1-3*phi2-1*phi3-1*phi4)> | |
3474 | Double_t four5n2n2n1n = 0.; // <cos(n(5*phi1-2*phi2-2*phi3-1*phi4)> | |
403e3389 | 3475 | Double_t four5n1n5n1n = 0.; // <cos(n(5*phi1+1*phi2-5*phi3-1*phi4)> |
3476 | Double_t four6n4n1n1n = 0.; // <cos(n(6*phi1-4*phi2-1*phi3-1*phi4)> | |
3477 | Double_t four6n2n2n2n = 0.; // <cos(n(6*phi1-2*phi2-2*phi3-2*phi4)> | |
b84464d3 | 3478 | if(dMult>3) |
3479 | { | |
3480 | four6n3n2n1n = (reQ6nQ3nstarQ2nstarQ1nstar-reQ6nQ4nstarQ2nstar-reQ6nQ3nstarQ3nstar-reQ6nQ5nstarQ1nstar | |
3481 | - reQ5nQ3nstarQ2nstar-reQ4nQ3nstarQ1nstar-reQ3nQ2nstarQ1nstar | |
3482 | + 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))+pow(dReQ5n,2.)+pow(dImQ5n,2.) | |
3483 | + pow(dReQ4n,2.)+pow(dImQ4n,2.)+3.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3484 | + 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
3485 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3486 | four3n2n3n2n = (dQ3nQ2nQ3nstarQ2nstar-2.*reQ5nQ3nstarQ2nstar-2.*reQ3nQ2nstarQ1nstar | |
3487 | + pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.) | |
3488 | -(dMult-4.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3489 | + dMult*(dMult-6.)) | |
3490 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3491 | four4n1n3n2n = (reQ4nQ1nQ3nstarQ2nstar-reQ5nQ3nstarQ2nstar-reQ5nQ4nstarQ1nstar-reQ4nQ3nstarQ1nstar | |
3492 | - reQ4nQ2nstarQ2nstar-reQ3nQ2nstarQ1nstar-reQ2nQ1nstarQ1nstar | |
3493 | + pow(dReQ5n,2.)+pow(dImQ5n,2.)+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3494 | + 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3495 | + 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
3496 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3497 | four3n3n3n3n = (2.*dMult*(dMult-3.)+pow((pow(dReQ3n,2.)+pow(dImQ3n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ3n,2.) | |
3498 | + pow(dImQ3n,2.))-2.*reQ6nQ3nstarQ3nstar+(pow(dReQ6n,2.)+pow(dImQ6n,2.))) | |
3499 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
3500 | //four4n2n3n3n = ; // I already have this one above | |
3501 | four5n1n3n3n = (reQ5nQ1nQ3nstarQ3nstar-reQ6nQ5nstarQ1nstar-reQ6nQ3nstarQ3nstar-2.*reQ5nQ3nstarQ2nstar | |
3502 | - 2.*reQ3nQ2nstarQ1nstar+pow(dReQ6n,2.)+pow(dImQ6n,2.)+2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3503 | + 4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3504 | + 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
3505 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3506 | four4n2n4n2n = (dQ4nQ2nQ4nstarQ2nstar-2.*reQ6nQ4nstarQ2nstar-2.*reQ4nQ2nstarQ2nstar) | |
3507 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3508 | - ((dMult-5.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3509 | + (dMult-4.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-(pow(dReQ6n,2.)+pow(dImQ6n,2.))) | |
3510 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3511 | + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3512 | four5n1n4n2n = (reQ5nQ1nQ4nstarQ2nstar-reQ6nQ5nstarQ1nstar-reQ6nQ4nstarQ2nstar-reQ5nQ4nstarQ1nstar | |
3513 | - reQ5nQ3nstarQ2nstar-reQ4nQ3nstarQ1nstar-reQ2nQ1nstarQ1nstar+pow(dReQ6n,2.)+pow(dImQ6n,2.) | |
3514 | + 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3515 | + pow(dReQ3n,2.)+pow(dImQ3n,2.)+2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3516 | + 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
3517 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3518 | four5n3n1n1n = (reQ5nQ3nstarQ1nstarQ1nstar-2.*reQ5nQ4nstarQ1nstar-reQ5nQ3nstarQ2nstar-2.*reQ4nQ3nstarQ1nstar | |
3519 | - reQ2nQ1nstarQ1nstar+2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3520 | + 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+pow(dReQ2n,2.)+pow(dImQ2n,2.) | |
3521 | + 4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
3522 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3523 | four5n2n2n1n = (reQ5nQ2nstarQ2nstarQ1nstar-reQ5nQ4nstarQ1nstar-2.*reQ5nQ3nstarQ2nstar-reQ4nQ2nstarQ2nstar | |
3524 | - 2.*reQ3nQ2nstarQ1nstar+2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))+pow(dReQ4n,2.)+pow(dImQ4n,2.) | |
3525 | + 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3526 | + 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
3527 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3528 | four5n1n5n1n = (dQ5nQ1nQ5nstarQ1nstar-2.*reQ6nQ5nstarQ1nstar-2.*reQ5nQ4nstarQ1nstar | |
3529 | + pow(dReQ6n,2.)+pow(dImQ6n,2.)-(dMult-4.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3530 | + pow(dReQ4n,2.)+pow(dImQ4n,2.)-(dMult-4.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+dMult*(dMult-6.)) | |
3531 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
403e3389 | 3532 | |
3533 | four6n4n1n1n = (reQ6nQ4nstarQ1nstarQ1nstar | |
3534 | - dMult*(dMult-1.)*(dMult-2.)*(three2n1n1n+2.*three5n4n1n+2.*three6n5n1n+three6n4n2n) | |
3535 | - dMult*(dMult-1.)*(2.*two1n1n+1.*two4n4n+1.*two6n6n+1.*two2n2n+2.*two5n5n) | |
3536 | - 1.*dMult) | |
3537 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3538 | ||
3539 | four6n2n2n2n = (reQ6nQ2nstarQ2nstarQ2nstar-3.*reQ6nQ4nstarQ2nstar-3.*reQ4nQ2nstarQ2nstar | |
3540 | + 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))+3.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3541 | + 6.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-6.*dMult) | |
3542 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3543 | // Average 4-particle correlations for all events: |
3544 | fIntFlowCorrelationsAllPro->Fill(41.5,four6n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3545 | fIntFlowCorrelationsAllPro->Fill(42.5,four3n2n3n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3546 | fIntFlowCorrelationsAllPro->Fill(43.5,four4n1n3n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3547 | fIntFlowCorrelationsAllPro->Fill(44.5,four3n3n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3548 | //fIntFlowCorrelationsAllPro->Fill(45.5,four4n2n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); // I already have this one above | |
3549 | fIntFlowCorrelationsAllPro->Fill(46.5,four5n1n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3550 | fIntFlowCorrelationsAllPro->Fill(47.5,four4n2n4n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3551 | fIntFlowCorrelationsAllPro->Fill(48.5,four5n1n4n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3552 | fIntFlowCorrelationsAllPro->Fill(49.5,four5n3n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3553 | fIntFlowCorrelationsAllPro->Fill(50.5,four5n2n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3554 | fIntFlowCorrelationsAllPro->Fill(51.5,four5n1n5n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
403e3389 | 3555 | fIntFlowCorrelationsAllPro->Fill(58.5,four6n4n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
3556 | fIntFlowCorrelationsAllPro->Fill(59.5,four6n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3557 | if(fCalculateAllCorrelationsVsM) |
3558 | { | |
3559 | fIntFlowCorrelationsAllVsMPro[41]->Fill(dMult+0.5,four6n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3560 | fIntFlowCorrelationsAllVsMPro[42]->Fill(dMult+0.5,four3n2n3n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3561 | fIntFlowCorrelationsAllVsMPro[43]->Fill(dMult+0.5,four4n1n3n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3562 | fIntFlowCorrelationsAllVsMPro[44]->Fill(dMult+0.5,four3n3n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3563 | //fIntFlowCorrelationsAllVsMPro[45]->Fill(dMult+0.5,four4n2n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3564 | fIntFlowCorrelationsAllVsMPro[46]->Fill(dMult+0.5,four5n1n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3565 | fIntFlowCorrelationsAllVsMPro[47]->Fill(dMult+0.5,four4n2n4n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3566 | fIntFlowCorrelationsAllVsMPro[48]->Fill(dMult+0.5,four5n1n4n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3567 | fIntFlowCorrelationsAllVsMPro[49]->Fill(dMult+0.5,four5n3n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3568 | fIntFlowCorrelationsAllVsMPro[50]->Fill(dMult+0.5,four5n2n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3569 | fIntFlowCorrelationsAllVsMPro[51]->Fill(dMult+0.5,four5n1n5n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
403e3389 | 3570 | fIntFlowCorrelationsAllVsMPro[58]->Fill(dMult+0.5,four6n4n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
3571 | fIntFlowCorrelationsAllVsMPro[59]->Fill(dMult+0.5,four6n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3572 | } |
3573 | } // end of if(dMult>3) | |
3574 | ||
3575 | // 5-particle: | |
3576 | Double_t five3n3n3n2n1n = 0.; // <cos(n(3*phi1+3*phi2-3*phi3-2*phi4-1*phi5)> | |
3577 | Double_t five4n2n3n2n1n = 0.; // <cos(n(4*phi1+2*phi2-3*phi3-2*phi4-1*phi5)> | |
3578 | Double_t five3n2n3n1n1n = 0.; // <cos(n(3*phi1+2*phi2-3*phi3-1*phi4-1*phi5)> | |
3579 | Double_t five3n2n2n2n1n = 0.; // <cos(n(3*phi1+2*phi2-2*phi3-2*phi4-1*phi5)> | |
3580 | Double_t five5n1n3n2n1n = 0.; // <cos(n(5*phi1+1*phi2-3*phi3-2*phi4-1*phi5)> | |
403e3389 | 3581 | Double_t five6n2n2n1n1n = 0.; // <cos(n(6*phi1-2*phi2-2*phi3-1*phi4-1*phi5)> |
3582 | Double_t five4n1n1n3n3n = 0.; // <cos(n(4*phi1+1*phi2+1*phi3-3*phi4-3*phi5)> | |
b84464d3 | 3583 | if(dMult>4) |
3584 | { | |
3585 | five3n3n3n2n1n = (reQ3nQ3nQ3nstarQ2nstarQ1nstar-reQ6nQ3nstarQ2nstarQ1nstar-reQ5nQ1nQ3nstarQ3nstar-reQ4nQ2nQ3nstarQ3nstar | |
3586 | + reQ6nQ5nstarQ1nstar+reQ6nQ4nstarQ2nstar+3.*reQ6nQ3nstarQ3nstar+4.*reQ5nQ3nstarQ2nstar+4.*reQ4nQ3nstarQ1nstar | |
3587 | - 2.*(dMult-6.)*reQ3nQ2nstarQ1nstar-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3588 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3589 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3590 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*(3.*dMult-10.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3591 | - pow((pow(dReQ3n,2.)+pow(dImQ3n,2.)),2.)+2.*(dMult-5.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3592 | + 2.*(dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*dMult*(dMult-6.)) | |
3593 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3594 | five4n2n3n2n1n = (reQ4nQ2nQ3nstarQ2nstarQ1nstar-reQ6nQ3nstarQ2nstarQ1nstar-reQ5nQ1nQ4nstarQ2nstar | |
3595 | - reQ4nQ2nQ3nstarQ3nstar-reQ4nQ1nQ3nstarQ2nstar-reQ4nQ2nstarQ1nstarQ1nstar | |
3596 | - reQ3nQ1nQ2nstarQ2nstar-(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3597 | + 3.*reQ6nQ4nstarQ2nstar+reQ6nQ5nstarQ1nstar+reQ6nQ3nstarQ3nstar+reQ5nQ4nstarQ1nstar | |
3598 | + 3.*reQ5nQ3nstarQ2nstar-(dMult-7.)*reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar+7.*reQ3nQ2nstarQ1nstar | |
3599 | + 4.*reQ2nQ1nstarQ1nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3600 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3601 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3602 | + (dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+(dMult-10.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3603 | + 2.*(dMult-7.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+(dMult-12.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3604 | - 2.*dMult*(dMult-12.)) | |
3605 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3606 | five3n2n3n1n1n = (reQ3nQ2nQ3nstarQ1nstarQ1nstar-reQ5nQ3nstarQ1nstarQ1nstar-2.*reQ4nQ1nQ3nstarQ2nstar-reQ3nQ1nstarQ1nstarQ1nstar | |
3607 | - 2.*reQ3nQ1nQ2nstarQ2nstar+2.*reQ5nQ4nstarQ1nstar+3.*reQ5nQ3nstarQ2nstar+6.*reQ4nQ3nstarQ1nstar | |
3608 | + 2.*reQ4nQ2nstarQ2nstar+9.*reQ3nQ2nstarQ1nstar-(dMult-8.)*reQ2nQ1nstarQ1nstar | |
3609 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3610 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3611 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))-4.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3612 | + 2.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+(dMult-12.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3613 | + 2.*(dMult-9.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-2.*dMult*(dMult-12.)) | |
3614 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3615 | five3n2n2n2n1n = (reQ3nQ2nQ2nstarQ2nstarQ1nstar-reQ5nQ2nstarQ2nstarQ1nstar-reQ4nQ1nQ3nstarQ2nstar-reQ3nQ1nQ2nstarQ2nstar | |
3616 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+reQ5nQ4nstarQ1nstar | |
3617 | + 4.*reQ5nQ3nstarQ2nstar+reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar-2.*(dMult-6.)*reQ3nQ2nstarQ1nstar | |
3618 | + 4.*reQ2nQ1nstarQ1nstar-2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3619 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3620 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3621 | - pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)+2.*(3.*dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3622 | + 2.*(dMult-6.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*dMult*(dMult-6.)) | |
3623 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3624 | five5n1n3n2n1n = (reQ5nQ1nQ3nstarQ2nstarQ1nstar-reQ6nQ3nstarQ2nstarQ1nstar-reQ5nQ1nQ4nstarQ2nstar-reQ5nQ1nQ3nstarQ3nstar | |
3625 | - reQ4nQ1nQ3nstarQ2nstar-reQ5nQ3nstarQ1nstarQ1nstar-reQ5nQ2nstarQ2nstarQ1nstar | |
3626 | + 3.*reQ6nQ5nstarQ1nstar+reQ6nQ4nstarQ2nstar+reQ6nQ3nstarQ3nstar+4.*reQ5nQ4nstarQ1nstar | |
3627 | - (dMult-7.)*reQ5nQ3nstarQ2nstar+4.*reQ4nQ3nstarQ1nstar+reQ4nQ2nstarQ2nstar+6.*reQ3nQ2nstarQ1nstar | |
3628 | + 3.*reQ2nQ1nstarQ1nstar-(pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3629 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3630 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3631 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))+(dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3632 | - 4.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+(dMult-10.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3633 | + (dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*(dMult-7.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3634 | - 2.*dMult*(dMult-12.)) | |
3635 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
403e3389 | 3636 | |
3637 | // five6n2n2n1n1n = ; | |
3638 | // five4n1n1n3n3n = ; | |
3639 | ||
b84464d3 | 3640 | // Average 5-particle correlations for all events: |
3641 | fIntFlowCorrelationsAllPro->Fill(52.5,five3n3n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3642 | fIntFlowCorrelationsAllPro->Fill(53.5,five4n2n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3643 | fIntFlowCorrelationsAllPro->Fill(54.5,five3n2n3n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3644 | fIntFlowCorrelationsAllPro->Fill(55.5,five3n2n2n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3645 | fIntFlowCorrelationsAllPro->Fill(56.5,five5n1n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
403e3389 | 3646 | fIntFlowCorrelationsAllPro->Fill(60.5,five6n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
3647 | fIntFlowCorrelationsAllPro->Fill(61.5,five4n1n1n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
b84464d3 | 3648 | if(fCalculateAllCorrelationsVsM) |
3649 | { | |
3650 | fIntFlowCorrelationsAllVsMPro[52]->Fill(dMult+0.5,five3n3n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3651 | fIntFlowCorrelationsAllVsMPro[53]->Fill(dMult+0.5,five4n2n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3652 | fIntFlowCorrelationsAllVsMPro[54]->Fill(dMult+0.5,five3n2n3n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3653 | fIntFlowCorrelationsAllVsMPro[55]->Fill(dMult+0.5,five3n2n2n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3654 | fIntFlowCorrelationsAllVsMPro[56]->Fill(dMult+0.5,five5n1n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
403e3389 | 3655 | fIntFlowCorrelationsAllVsMPro[60]->Fill(dMult+0.5,five6n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
3656 | fIntFlowCorrelationsAllVsMPro[61]->Fill(dMult+0.5,five4n1n1n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
b84464d3 | 3657 | } |
3658 | } // end of if(dMult>4) | |
3659 | ||
3660 | // 6-particle: | |
3661 | Double_t six3n2n1n3n2n1n = 0.; // <cos(n(3*phi1+2*phi2+1*phi3-3*phi4-2*phi5-1*phi6)> | |
403e3389 | 3662 | Double_t six3n3n2n2n1n1n = 0.; // <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-1*phi5-1*phi6)> |
b84464d3 | 3663 | if(dMult>5.) |
3664 | { | |
3665 | six3n2n1n3n2n1n = (dQ3nQ2nQ1nQ3nstarQ2nstarQ1nstar-2.*reQ3nQ3nQ3nstarQ2nstarQ1nstar | |
3666 | - 2.*reQ3nQ2nQ2nstarQ2nstarQ1nstar-2.*reQ3nQ1nQ2nstarQ1nstarQ1nstar | |
3667 | - 2.*reQ3nQ2nQ3nstarQ1nstarQ1nstar-2.*reQ4nQ2nQ3nstarQ2nstarQ1nstar | |
3668 | - 2.*reQ5nQ1nQ3nstarQ2nstarQ1nstar+4.*reQ6nQ3nstarQ2nstarQ1nstar | |
3669 | + 2.*reQ5nQ1nQ4nstarQ2nstar+2.*reQ5nQ1nQ3nstarQ3nstar | |
3670 | + 2.*reQ4nQ2nQ3nstarQ3nstar+6.*reQ4nQ1nQ3nstarQ2nstar | |
3671 | + 2.*reQ5nQ3nstarQ1nstarQ1nstar+2.*reQ5nQ2nstarQ2nstarQ1nstar | |
3672 | + 6.*reQ3nQ1nQ2nstarQ2nstar+2.*reQ4nQ2nstarQ1nstarQ1nstar | |
3673 | - 4.*reQ6nQ5nstarQ1nstar-4.*reQ6nQ4nstarQ2nstar-6.*reQ5nQ4nstarQ1nstar | |
3674 | - 4.*reQ6nQ3nstarQ3nstar+2.*(dMult-11.)*reQ5nQ3nstarQ2nstar | |
3675 | + 2.*(dMult-13.)*reQ4nQ3nstarQ1nstar-8.*reQ4nQ2nstarQ2nstar | |
3676 | + 2.*(5.*dMult-32.)*reQ3nQ2nstarQ1nstar+2.*reQ3nQ1nstarQ1nstarQ1nstar | |
3677 | + 2.*(dMult-13.)*reQ2nQ1nstarQ1nstar | |
3678 | - (dMult-10.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3679 | + (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3680 | + (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3681 | - (dMult-11.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3682 | - (dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3683 | + 4.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-(dMult-12.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3684 | - (dMult-16.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+pow((pow(dReQ3n,2.)+pow(dImQ3n,2.)),2.) | |
3685 | + (dMult*dMult-19.*dMult+68.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3686 | + (dMult*dMult-19.*dMult+72.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3687 | + pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)+pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
3688 | + (dMult*dMult-20.*dMult+80.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3689 | - dMult*(dMult-12.)*(dMult-10.)) | |
3690 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
403e3389 | 3691 | |
3692 | // six3n3n2n2n1n1n = ; | |
3693 | ||
b84464d3 | 3694 | // Average 6-particle correlations for all events: |
3695 | fIntFlowCorrelationsAllPro->Fill(57.5,six3n2n1n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
403e3389 | 3696 | fIntFlowCorrelationsAllPro->Fill(62.5,six3n3n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
b84464d3 | 3697 | if(fCalculateAllCorrelationsVsM) |
3698 | { | |
3699 | fIntFlowCorrelationsAllVsMPro[57]->Fill(dMult+0.5,six3n2n1n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
403e3389 | 3700 | fIntFlowCorrelationsAllVsMPro[62]->Fill(dMult+0.5,six3n3n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
b84464d3 | 3701 | } |
3702 | } // end of if(dMult>5.) | |
3703 | ||
489d5531 | 3704 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelations() |
3705 | ||
489d5531 | 3706 | //================================================================================================================================ |
3707 | ||
e5834fcb | 3708 | void AliFlowAnalysisWithQCumulants::StorePhiDistributionForOneEvent(AliFlowEventSimple *anEvent) |
3709 | { | |
3710 | // Store phi distribution for one event to illustrate flow. | |
3711 | ||
3712 | if(fPhiDistributionForOneEvent->GetEntries()>0){return;} // store only phi distribution for one event | |
3713 | ||
3714 | Double_t vMin = fPhiDistributionForOneEventSettings[0]; | |
3715 | Double_t vMax = fPhiDistributionForOneEventSettings[1]; | |
3716 | Double_t refMultMin = fPhiDistributionForOneEventSettings[2]; | |
3717 | Double_t refMultMax = fPhiDistributionForOneEventSettings[3]; | |
3718 | ||
3719 | Double_t vEBE = 0.; | |
3720 | Double_t cumulant4thEBE = fIntFlowCorrelationsEBE->GetBinContent(2)-2.*pow(fIntFlowCorrelationsEBE->GetBinContent(1),2.); | |
3721 | if(cumulant4thEBE<0.) | |
3722 | { | |
3723 | vEBE = pow(-1.*cumulant4thEBE,0.25); | |
3724 | if((vEBE>vMin && vEBE<vMax) && (fReferenceMultiplicityEBE>refMultMin && fReferenceMultiplicityEBE<refMultMax)) | |
3725 | { | |
3958eee6 | 3726 | fPhiDistributionForOneEvent->SetTitle(Form("v_{%i} = %f",fHarmonic,vEBE)); |
e5834fcb | 3727 | for(Int_t p=0;p<anEvent->NumberOfTracks();p++) |
3728 | { | |
3729 | if(anEvent->GetTrack(p)->InRPSelection()) | |
3730 | { | |
3731 | fPhiDistributionForOneEvent->Fill(anEvent->GetTrack(p)->Phi()); | |
3732 | } | |
3733 | } // end of for(Int_t p=0;p<anEvent->NumberOfTracks();p++) | |
3958eee6 | 3734 | } else |
3735 | { | |
3736 | fPhiDistributionForOneEvent->SetTitle(Form("v_{%i} = %f, out of specified boundaries",fHarmonic,vEBE)); | |
3737 | } | |
3738 | ||
e5834fcb | 3739 | } // end of if(cumulant4thEBE<0.) |
3740 | ||
3741 | } // end of void AliFlowAnalysisWithQCumulants::StorePhiDistributionForOneEvent(AliFlowEventSimple *anEvent) | |
3742 | ||
3743 | //================================================================================================================================ | |
489d5531 | 3744 | |
3745 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrelations() | |
3746 | { | |
0328db2d | 3747 | // Calculate averages of products of correlations for integrated flow. |
489d5531 | 3748 | |
2001bc3a | 3749 | // multiplicity: |
1268c371 | 3750 | Double_t dMult = (*fSpk)(0,0); |
2001bc3a | 3751 | |
489d5531 | 3752 | Int_t counter = 0; |
3753 | ||
3754 | for(Int_t ci1=1;ci1<4;ci1++) | |
3755 | { | |
3756 | for(Int_t ci2=ci1+1;ci2<=4;ci2++) | |
3757 | { | |
ff70ca91 | 3758 | fIntFlowProductOfCorrelationsPro->Fill(0.5+counter, |
3759 | fIntFlowCorrelationsEBE->GetBinContent(ci1)* | |
3760 | fIntFlowCorrelationsEBE->GetBinContent(ci2), | |
3761 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
3762 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); | |
3763 | // products versus multiplicity: // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>] | |
b3dacf6b | 3764 | if(fCalculateCumulantsVsM) |
3765 | { | |
3766 | fIntFlowProductOfCorrelationsVsMPro[counter]->Fill(dMult+0.5, // to be improved: dMult => sum of weights ? | |
3767 | fIntFlowCorrelationsEBE->GetBinContent(ci1)* | |
3768 | fIntFlowCorrelationsEBE->GetBinContent(ci2), | |
3769 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
3770 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); | |
3771 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 3772 | counter++; |
489d5531 | 3773 | } |
3774 | } | |
3775 | ||
3776 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrelations() | |
3777 | ||
3778 | ||
3779 | //================================================================================================================================ | |
3780 | ||
3781 | ||
0328db2d | 3782 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrectionTermsForNUA() |
3783 | { | |
3784 | // Calculate averages of products of correction terms for NUA. | |
3785 | ||
3786 | // a) Binning of fIntFlowProductOfCorrectionTermsForNUAPro is organized as follows: | |
3787 | // 1st bin: <<2><cos(phi)>> | |
3788 | // 2nd bin: <<2><sin(phi)>> | |
3789 | // 3rd bin: <<cos(phi)><sin(phi)>> | |
3790 | // 4th bin: <<2><cos(phi1+phi2)>> | |
3791 | // 5th bin: <<2><sin(phi1+phi2)>> | |
3792 | // 6th bin: <<2><cos(phi1-phi2-phi3)>> | |
3793 | // 7th bin: <<2><sin(phi1-phi2-phi3)>> | |
3794 | // 8th bin: <<4><cos(phi1)>> | |
3795 | // 9th bin: <<4><sin(phi1)>> | |
3796 | // 10th bin: <<4><cos(phi1+phi2)>> | |
3797 | // 11th bin: <<4><sin(phi1+phi2)>> | |
3798 | // 12th bin: <<4><cos(phi1-phi2-phi3)>> | |
3799 | // 13th bin: <<4><sin(phi1-phi2-phi3)>> | |
3800 | // 14th bin: <<cos(phi1)><cos(phi1+phi2)>> | |
3801 | // 15th bin: <<cos(phi1)><sin(phi1+phi2)>> | |
3802 | // 16th bin: <<cos(phi1)><cos(phi1-phi2-phi3)>> | |
3803 | // 17th bin: <<cos(phi1)><sin(phi1-phi2-phi3)>> | |
3804 | // 18th bin: <<sin(phi1)><cos(phi1+phi2)>> | |
3805 | // 19th bin: <<sin(phi1)><sin(phi1+phi2)>> | |
3806 | // 20th bin: <<sin(phi1)><cos(phi1-phi2-phi3)>> | |
3807 | // 21st bin: <<sin(phi1)><sin(phi1-phi2-phi3)>> | |
3808 | // 22nd bin: <<cos(phi1+phi2)><sin(phi1+phi2)>> | |
3809 | // 23rd bin: <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
3810 | // 24th bin: <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
3811 | // 25th bin: <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
3812 | // 26th bin: <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
3813 | // 27th bin: <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>> | |
3814 | ||
3815 | // <<2><cos(phi)>>: | |
3816 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(0.5, | |
3817 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1), | |
3818 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3819 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
3820 | // <<2><sin(phi)>>: | |
3821 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(1.5, | |
3822 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1), | |
3823 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3824 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
3825 | // <<cos(phi)><sin(phi)>>: | |
3826 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(2.5, | |
3827 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1), | |
3828 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3829 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
3830 | // <<2><cos(phi1+phi2)>>: | |
3831 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(3.5, | |
3832 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3833 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3834 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3835 | // <<2><sin(phi1+phi2)>>: | |
3836 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(4.5, | |
3837 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3838 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3839 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3840 | // <<2><cos(phi1-phi2-phi3)>>: | |
3841 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(5.5, | |
3842 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3843 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3844 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3845 | // <<2><sin(phi1-phi2-phi3)>>: | |
3846 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(6.5, | |
3847 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3848 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3849 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3850 | // <<4><cos(phi1)>>: | |
3851 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(7.5, | |
3852 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1), | |
3853 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3854 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
3855 | // <<4><sin(phi1)>>: | |
3856 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(8.5, | |
3857 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1), | |
3858 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3859 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
3860 | // <<4><cos(phi1+phi2)>>: | |
3861 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(9.5, | |
3862 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3863 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3864 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3865 | // <<4><sin(phi1+phi2)>>: | |
3866 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(10.5, | |
3867 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3868 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3869 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3870 | // <<4><cos(phi1-phi2-phi3)>>: | |
3871 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(11.5, | |
3872 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3873 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3874 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3875 | // <<4><sin(phi1-phi2-phi3)>>: | |
3876 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(12.5, | |
3877 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3878 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3879 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3880 | // <<cos(phi1)><cos(phi1+phi2)>>: | |
3881 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(13.5, | |
3882 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3883 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3884 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3885 | // <<cos(phi1)><sin(phi1+phi2)>>: | |
3886 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(14.5, | |
3887 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3888 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3889 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3890 | // <<cos(phi1)><cos(phi1-phi2-phi3)>>: | |
3891 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(15.5, | |
3892 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3893 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3894 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3895 | // <<cos(phi1)><sin(phi1-phi2-phi3)>>: | |
3896 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(16.5, | |
3897 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3898 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3899 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3900 | // <<sin(phi1)><cos(phi1+phi2)>>: | |
3901 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(17.5, | |
3902 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3903 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3904 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3905 | // <<sin(phi1)><sin(phi1+phi2)>>: | |
3906 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(18.5, | |
3907 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3908 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3909 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3910 | // <<sin(phi1)><cos(phi1-phi2-phi3)>>: | |
3911 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(19.5, | |
3912 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3913 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3914 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3915 | // <<sin(phi1)><sin(phi1-phi2-phi3)>>: | |
3916 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(20.5, | |
3917 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3918 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3919 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3920 | // <<cos(phi1+phi2)><sin(phi1+phi2)>>: | |
3921 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(21.5, | |
3922 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3923 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2) | |
3924 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3925 | // <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>>: | |
3926 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(22.5, | |
3927 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3928 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2) | |
3929 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3930 | // <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>>: | |
3931 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(23.5, | |
3932 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3933 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2) | |
3934 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3935 | // <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>>: | |
3936 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(24.5, | |
3937 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3938 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2) | |
3939 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3940 | // <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>>: | |
3941 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(25.5, | |
3942 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3943 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2) | |
3944 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3945 | // <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>>: | |
3946 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(26.5, | |
3947 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3948 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3) | |
3949 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3950 | ||
3951 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrectionTermsForNUA() | |
3952 | ||
0328db2d | 3953 | //================================================================================================================================ |
3954 | ||
489d5531 | 3955 | void AliFlowAnalysisWithQCumulants::CalculateCovariancesIntFlow() |
3956 | { | |
3957 | // a) Calculate unbiased estimators Cov(<2>,<4>), Cov(<2>,<6>), Cov(<2>,<8>), Cov(<4>,<6>), Cov(<4>,<8>) and Cov(<6>,<8>) | |
3958 | // for covariances V_(<2>,<4>), V_(<2>,<6>), V_(<2>,<8>), V_(<4>,<6>), V_(<4>,<8>) and V_(<6>,<8>). | |
3959 | // b) Store in histogram fIntFlowCovariances for instance the following: | |
3960 | // | |
3961 | // Cov(<2>,<4>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4>}_j)] | |
3962 | // | |
3963 | // where N is the number of events, w_{<2>} is event weight for <2> and w_{<4>} is event weight for <4>. | |
3964 | // c) Binning of fIntFlowCovariances is organized as follows: | |
3965 | // | |
3966 | // 1st bin: Cov(<2>,<4>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4>}_j)] | |
3967 | // 2nd bin: Cov(<2>,<6>) * (sum_{i=1}^{N} w_{<2>}_i w_{<6>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<6>}_j)] | |
3968 | // 3rd bin: Cov(<2>,<8>) * (sum_{i=1}^{N} w_{<2>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<8>}_j)] | |
3969 | // 4th bin: Cov(<4>,<6>) * (sum_{i=1}^{N} w_{<4>}_i w_{<6>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<6>}_j)] | |
3970 | // 5th bin: Cov(<4>,<8>) * (sum_{i=1}^{N} w_{<4>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<8>}_j)] | |
3971 | // 6th bin: Cov(<6>,<8>) * (sum_{i=1}^{N} w_{<6>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<6>}_i) * (sum_{j=1}^{N} w_{<8>}_j)] | |
b3dacf6b | 3972 | // |
489d5531 | 3973 | |
b3dacf6b | 3974 | // Average 2-, 4-, 6- and 8-particle correlations for all events: |
489d5531 | 3975 | Double_t correlation[4] = {0.}; |
3976 | for(Int_t ci=0;ci<4;ci++) | |
3977 | { | |
3978 | correlation[ci] = fIntFlowCorrelationsPro->GetBinContent(ci+1); | |
3979 | } | |
b3dacf6b | 3980 | // Average products of 2-, 4-, 6- and 8-particle correlations: |
489d5531 | 3981 | Double_t productOfCorrelations[4][4] = {{0.}}; |
3982 | Int_t productOfCorrelationsLabel = 1; | |
b3dacf6b | 3983 | // Denominators in the expressions for the unbiased estimator for covariance: |
489d5531 | 3984 | Double_t denominator[4][4] = {{0.}}; |
3985 | Int_t sumOfProductOfEventWeightsLabel1 = 1; | |
b3dacf6b | 3986 | // Weight dependent prefactor which multiply unbiased estimators for covariances: |
489d5531 | 3987 | Double_t wPrefactor[4][4] = {{0.}}; |
3988 | Int_t sumOfProductOfEventWeightsLabel2 = 1; | |
3989 | for(Int_t c1=0;c1<4;c1++) | |
3990 | { | |
3991 | for(Int_t c2=c1+1;c2<4;c2++) | |
3992 | { | |
3993 | productOfCorrelations[c1][c2] = fIntFlowProductOfCorrelationsPro->GetBinContent(productOfCorrelationsLabel); | |
b3dacf6b | 3994 | if(TMath::Abs(fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1)) > 1.e-44 && TMath::Abs(fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)) > 1.e-44) |
3995 | { | |
3996 | denominator[c1][c2] = 1.-(fIntFlowSumOfProductOfEventWeights->GetBinContent(sumOfProductOfEventWeightsLabel1)) | |
3997 | / (fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1) | |
3998 | * fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)); | |
3999 | wPrefactor[c1][c2] = fIntFlowSumOfProductOfEventWeights->GetBinContent(sumOfProductOfEventWeightsLabel2) | |
4000 | / (fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1) | |
4001 | * fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)); | |
489d5531 | 4002 | } |
b3dacf6b | 4003 | productOfCorrelationsLabel++; // to be improved - do I need here all 3 counters? |
489d5531 | 4004 | sumOfProductOfEventWeightsLabel1++; |
4005 | sumOfProductOfEventWeightsLabel2++; | |
b3dacf6b | 4006 | } // end of for(Int_t c2=c1+1;c2<4;c2++) |
4007 | } // end of for(Int_t c1=0;c1<4;c1++) | |
489d5531 | 4008 | |
489d5531 | 4009 | Int_t covarianceLabel = 1; |
4010 | for(Int_t c1=0;c1<4;c1++) | |
4011 | { | |
4012 | for(Int_t c2=c1+1;c2<4;c2++) | |
4013 | { | |
b3dacf6b | 4014 | if(TMath::Abs(denominator[c1][c2]) > 1.e-44) |
489d5531 | 4015 | { |
b3dacf6b | 4016 | // Covariances: |
489d5531 | 4017 | Double_t cov = (productOfCorrelations[c1][c2]-correlation[c1]*correlation[c2])/denominator[c1][c2]; |
b3dacf6b | 4018 | // Covariances multiplied with weight dependent prefactor: |
489d5531 | 4019 | Double_t wCov = cov * wPrefactor[c1][c2]; |
4020 | fIntFlowCovariances->SetBinContent(covarianceLabel,wCov); | |
4021 | } | |
4022 | covarianceLabel++; | |
b3dacf6b | 4023 | } // end of for(Int_t c2=c1+1;c2<4;c2++) |
4024 | } // end of for(Int_t c1=0;c1<4;c1++) | |
489d5531 | 4025 | |
b3dacf6b | 4026 | // Versus multiplicity: |
4027 | if(!fCalculateCumulantsVsM){return;} | |
9da1a4f3 | 4028 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) |
4029 | for(Int_t b=1;b<=nBins;b++) | |
4030 | { | |
b3dacf6b | 4031 | // Average 2-, 4-, 6- and 8-particle correlations for all events: |
9da1a4f3 | 4032 | Double_t correlationVsM[4] = {0.}; |
4033 | for(Int_t ci=0;ci<4;ci++) | |
4034 | { | |
4035 | correlationVsM[ci] = fIntFlowCorrelationsVsMPro[ci]->GetBinContent(b); | |
4036 | } // end of for(Int_t ci=0;ci<4;ci++) | |
b3dacf6b | 4037 | // Average products of 2-, 4-, 6- and 8-particle correlations: |
9da1a4f3 | 4038 | Double_t productOfCorrelationsVsM[4][4] = {{0.}}; |
4039 | Int_t productOfCorrelationsLabelVsM = 1; | |
b3dacf6b | 4040 | // Denominators in the expressions for the unbiased estimator for covariance: |
9da1a4f3 | 4041 | Double_t denominatorVsM[4][4] = {{0.}}; |
4042 | Int_t sumOfProductOfEventWeightsLabel1VsM = 1; | |
b3dacf6b | 4043 | // Weight dependent prefactor which multiply unbiased estimators for covariances: |
9da1a4f3 | 4044 | Double_t wPrefactorVsM[4][4] = {{0.}}; |
4045 | Int_t sumOfProductOfEventWeightsLabel2VsM = 1; | |
4046 | for(Int_t c1=0;c1<4;c1++) | |
4047 | { | |
4048 | for(Int_t c2=c1+1;c2<4;c2++) | |
4049 | { | |
4050 | productOfCorrelationsVsM[c1][c2] = fIntFlowProductOfCorrelationsVsMPro[productOfCorrelationsLabelVsM-1]->GetBinContent(b); | |
b3dacf6b | 4051 | if(TMath::Abs(fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b)) > 1.e-44 && TMath::Abs(fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)) > 1.e-44) |
4052 | { | |
4053 | denominatorVsM[c1][c2] = 1.-(fIntFlowSumOfProductOfEventWeightsVsM[sumOfProductOfEventWeightsLabel1VsM-1]->GetBinContent(b)) | |
4054 | / (fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b) | |
4055 | * fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)); | |
4056 | wPrefactorVsM[c1][c2] = fIntFlowSumOfProductOfEventWeightsVsM[sumOfProductOfEventWeightsLabel2VsM-1]->GetBinContent(b) | |
4057 | / (fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b) | |
4058 | * fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)); | |
9da1a4f3 | 4059 | } |
4060 | productOfCorrelationsLabelVsM++; | |
4061 | sumOfProductOfEventWeightsLabel1VsM++; | |
4062 | sumOfProductOfEventWeightsLabel2VsM++; | |
4063 | } // end of for(Int_t c1=0;c1<4;c1++) | |
4064 | } // end of for(Int_t c2=c1+1;c2<4;c2++) | |
b3dacf6b | 4065 | |
9da1a4f3 | 4066 | Int_t covarianceLabelVsM = 1; |
4067 | for(Int_t c1=0;c1<4;c1++) | |
4068 | { | |
4069 | for(Int_t c2=c1+1;c2<4;c2++) | |
4070 | { | |
b3dacf6b | 4071 | if(TMath::Abs(denominatorVsM[c1][c2]) > 1.e-44) |
9da1a4f3 | 4072 | { |
b3dacf6b | 4073 | // Covariances: |
9da1a4f3 | 4074 | Double_t covVsM = (productOfCorrelationsVsM[c1][c2]-correlationVsM[c1]*correlationVsM[c2])/denominatorVsM[c1][c2]; |
b3dacf6b | 4075 | // Covariances multiplied with weight dependent prefactor: |
9da1a4f3 | 4076 | Double_t wCovVsM = covVsM * wPrefactorVsM[c1][c2]; |
4077 | fIntFlowCovariancesVsM[covarianceLabelVsM-1]->SetBinContent(b,wCovVsM); | |
4078 | } | |
4079 | covarianceLabelVsM++; | |
b3dacf6b | 4080 | } // end of for(Int_t c2=c1+1;c2<4;c2++) |
4081 | } // end of for(Int_t c1=0;c1<4;c1++) | |
9da1a4f3 | 4082 | } // end of for(Int_t b=1;b<=nBins;b++) |
4083 | ||
489d5531 | 4084 | } // end of AliFlowAnalysisWithQCumulants::CalculateCovariancesIntFlow() |
4085 | ||
489d5531 | 4086 | //================================================================================================================================ |
4087 | ||
0328db2d | 4088 | void AliFlowAnalysisWithQCumulants::CalculateCovariancesNUAIntFlow() |
4089 | { | |
4090 | // a) Calculate unbiased estimators Cov(*,*) for true covariances V_(*,*) for NUA terms. | |
4091 | // b) Store in histogram fIntFlowCovariancesNUA for instance the following: | |
4092 | // | |
4093 | // Cov(<2>,<cos(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<cos(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<cos(phi)>}_j)] | |
4094 | // | |
4095 | // where N is the number of events, w_{<2>} is event weight for <2> and w_{<cos(phi)>} is event weight for <cos(phi)>. | |
4096 | // c) Binning of fIntFlowCovariancesNUA is organized as follows: | |
4097 | // | |
4098 | // 1st bin: Cov(<2>,<cos(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<cos(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<cos(phi)>}_j)] | |
4099 | // 2nd bin: Cov(<2>,<sin(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<sin(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<sin(phi)>}_j)] | |
4100 | // 3rd bin: Cov(<cos(phi)>,<sin(phi)>) * (sum_{i=1}^{N} w_{<cos(phi)>}_i w_{<sin(phi)>}_i )/[(sum_{i=1}^{N} w_{<cos(phi)>}_i) * (sum_{j=1}^{N} w_{<sin(phi)>}_j)] | |
4101 | // ... | |
4102 | ||
4103 | // Cov(<2>,<cos(phi)>): | |
4104 | Double_t product1 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(1); // <<2><cos(phi)>> | |
4105 | Double_t term1st1 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
4106 | Double_t term2nd1 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi)>> | |
4107 | Double_t sumOfW1st1 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
4108 | Double_t sumOfW2nd1 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi)>} | |
4109 | Double_t sumOfWW1 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(1); // W_{<2>} * W_{<cos(phi)>} | |
4110 | // numerator in the expression for the the unbiased estimator for covariance: | |
4111 | Double_t numerator1 = product1 - term1st1*term2nd1; | |
4112 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4113 | Double_t denominator1 = 0.; |
4114 | if(TMath::Abs(sumOfW1st1*sumOfW2nd1)>0.) | |
4115 | { | |
4116 | denominator1 = 1.-sumOfWW1/(sumOfW1st1*sumOfW2nd1); | |
4117 | if(TMath::Abs(denominator1)>0.) | |
4118 | { | |
4119 | // covariance: | |
4120 | Double_t covariance1 = numerator1/denominator1; | |
4121 | // weight dependent prefactor for covariance: | |
4122 | Double_t wPrefactor1 = sumOfWW1/(sumOfW1st1*sumOfW2nd1); | |
4123 | // finally, store "weighted" covariance: | |
4124 | fIntFlowCovariancesNUA->SetBinContent(1,wPrefactor1*covariance1); | |
4125 | } // end of if(TMath::Abs(denominator)>0.) | |
4126 | } // end of if(TMath::Abs(sumOfW1st1*sumOfW2nd1)>0.) | |
4127 | ||
0328db2d | 4128 | // Cov(<2>,<sin(phi)>): |
4129 | Double_t product2 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(2); // <<2><sin(phi)>> | |
4130 | Double_t term1st2 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
4131 | Double_t term2nd2 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi)>> | |
4132 | Double_t sumOfW1st2 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
4133 | Double_t sumOfW2nd2 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi)>} | |
4134 | Double_t sumOfWW2 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(2); // W_{<2>} * W_{<sin(phi)>} | |
4135 | // numerator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4136 | Double_t numerator2 = product2 - term1st2*term2nd2; |
0328db2d | 4137 | // denominator in the expression for the the unbiased estimator for covariance: |
b92ea2b9 | 4138 | Double_t denominator2 = 0.; |
4139 | if(TMath::Abs(sumOfW1st2*sumOfW2nd2)>0.) | |
4140 | { | |
4141 | denominator2 = 1.-sumOfWW2/(sumOfW1st2*sumOfW2nd2); | |
4142 | if(TMath::Abs(denominator2)>0.) | |
4143 | { | |
4144 | // covariance: | |
4145 | Double_t covariance2 = numerator2/denominator2; | |
4146 | // weight dependent prefactor for covariance: | |
4147 | Double_t wPrefactor2 = sumOfWW2/(sumOfW1st2*sumOfW2nd2); | |
4148 | // finally, store "weighted" covariance: | |
4149 | fIntFlowCovariancesNUA->SetBinContent(2,wPrefactor2*covariance2); | |
4150 | } // end of if(TMath::Abs(denominator2)>0.) | |
4151 | } // end of if(TMath::Abs(sumOfW1st2*sumOfW2nd2)>0.) | |
0328db2d | 4152 | |
4153 | // Cov(<cos(phi)>,<sin(phi)>): | |
4154 | Double_t product3 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(3); // <<cos(phi)><sin(phi)>> | |
4155 | Double_t term1st3 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi)>> | |
4156 | Double_t term2nd3 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi)>> | |
4157 | Double_t sumOfW1st3 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi)>} | |
4158 | Double_t sumOfW2nd3 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi)>} | |
4159 | Double_t sumOfWW3 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(3); // W_{<cos(phi)>} * W_{<sin(phi)>} | |
4160 | // numerator in the expression for the the unbiased estimator for covariance: | |
4161 | Double_t numerator3 = product3 - term1st3*term2nd3; | |
4162 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4163 | Double_t denominator3 = 0; |
4164 | if(TMath::Abs(sumOfW1st3*sumOfW2nd3)>0.) | |
4165 | { | |
4166 | denominator3 = 1.-sumOfWW3/(sumOfW1st3*sumOfW2nd3); | |
4167 | if(TMath::Abs(denominator3)>0.) | |
4168 | { | |
4169 | // covariance: | |
4170 | Double_t covariance3 = numerator3/denominator3; | |
4171 | // weight dependent prefactor for covariance: | |
4172 | Double_t wPrefactor3 = sumOfWW3/(sumOfW1st3*sumOfW2nd3); | |
4173 | // finally, store "weighted" covariance: | |
4174 | fIntFlowCovariancesNUA->SetBinContent(3,wPrefactor3*covariance3); | |
4175 | } // end of if(TMath::Abs(denominator3)>0.) | |
4176 | } // end of if(TMath::Abs(sumOfW1st3*sumOfW2nd3)>0.) | |
0328db2d | 4177 | |
4178 | // Cov(<2>,<cos(phi1+phi2)>): | |
4179 | Double_t product4 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(4); // <<2><cos(phi1+phi2)>> | |
4180 | Double_t term1st4 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
4181 | Double_t term2nd4 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
4182 | Double_t sumOfW1st4 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
4183 | Double_t sumOfW2nd4 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
4184 | Double_t sumOfWW4 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(4); // W_{<2>} * W_{<cos(phi1+phi2)>} | |
4185 | // numerator in the expression for the the unbiased estimator for covariance: | |
4186 | Double_t numerator4 = product4 - term1st4*term2nd4; | |
4187 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4188 | Double_t denominator4 = 0.; |
4189 | if(TMath::Abs(sumOfW1st4*sumOfW2nd4)>0.) | |
4190 | { | |
4191 | denominator4 = 1.-sumOfWW4/(sumOfW1st4*sumOfW2nd4); | |
4192 | if(TMath::Abs(denominator4)>0.) | |
4193 | { | |
4194 | // covariance: | |
4195 | Double_t covariance4 = numerator4/denominator4; | |
4196 | // weight dependent prefactor for covariance: | |
4197 | Double_t wPrefactor4 = sumOfWW4/(sumOfW1st4*sumOfW2nd4); | |
4198 | // finally, store "weighted" covariance: | |
4199 | fIntFlowCovariancesNUA->SetBinContent(4,wPrefactor4*covariance4); | |
4200 | } // end of if(TMath::Abs(denominator4)>0.) | |
4201 | } // end of if(TMath::Abs(sumOfW1st4*sumOfW2nd4)>0.) | |
4202 | ||
0328db2d | 4203 | // Cov(<2>,<sin(phi1+phi2)>): |
4204 | Double_t product5 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(5); // <<2><sin(phi1+phi2)>> | |
4205 | Double_t term1st5 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
4206 | Double_t term2nd5 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4207 | Double_t sumOfW1st5 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
4208 | Double_t sumOfW2nd5 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4209 | Double_t sumOfWW5 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(5); // W_{<2>} * W_{<sin(phi1+phi2)>} | |
4210 | // numerator in the expression for the the unbiased estimator for covariance: | |
4211 | Double_t numerator5 = product5 - term1st5*term2nd5; | |
4212 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4213 | Double_t denominator5 = 0.; |
4214 | if(TMath::Abs(sumOfW1st5*sumOfW2nd5)>0.) | |
4215 | { | |
4216 | denominator5 = 1.-sumOfWW5/(sumOfW1st5*sumOfW2nd5); | |
4217 | if(TMath::Abs(denominator5)>0.) | |
4218 | { | |
4219 | // covariance: | |
4220 | Double_t covariance5 = numerator5/denominator5; | |
4221 | // weight dependent prefactor for covariance: | |
4222 | Double_t wPrefactor5 = sumOfWW5/(sumOfW1st5*sumOfW2nd5); | |
4223 | // finally, store "weighted" covariance: | |
4224 | fIntFlowCovariancesNUA->SetBinContent(5,wPrefactor5*covariance5); | |
4225 | } // end of if(TMath::Abs(denominator5)>0.) | |
4226 | } // end of if(TMath::Abs(sumOfW1st5*sumOfW2nd5)>0.) | |
4227 | ||
0328db2d | 4228 | // Cov(<2>,<cos(phi1-phi2-phi3)>): |
4229 | Double_t product6 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(6); // <<2><cos(phi1-phi2-phi3)>> | |
4230 | Double_t term1st6 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
4231 | Double_t term2nd6 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
4232 | Double_t sumOfW1st6 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
4233 | Double_t sumOfW2nd6 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
4234 | Double_t sumOfWW6 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(6); // W_{<2>} * W_{<cos(phi1-phi2-phi3)>} | |
4235 | // numerator in the expression for the the unbiased estimator for covariance: | |
4236 | Double_t numerator6 = product6 - term1st6*term2nd6; | |
4237 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4238 | Double_t denominator6 = 0.; |
4239 | if(TMath::Abs(sumOfW1st6*sumOfW2nd6)>0.) | |
4240 | { | |
4241 | denominator6 = 1.-sumOfWW6/(sumOfW1st6*sumOfW2nd6); | |
4242 | if(TMath::Abs(denominator6)>0.) | |
4243 | { | |
4244 | // covariance: | |
4245 | Double_t covariance6 = numerator6/denominator6; | |
4246 | // weight dependent prefactor for covariance: | |
4247 | Double_t wPrefactor6 = sumOfWW6/(sumOfW1st6*sumOfW2nd6); | |
4248 | // finally, store "weighted" covariance: | |
4249 | fIntFlowCovariancesNUA->SetBinContent(6,wPrefactor6*covariance6); | |
4250 | } // end of if(TMath::Abs(denominator6)>0.) | |
4251 | } // end of if(TMath::Abs(sumOfW1st6*sumOfW2nd6)>0.) | |
4252 | ||
0328db2d | 4253 | // Cov(<2>,<sin(phi1-phi2-phi3)>): |
4254 | Double_t product7 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(7); // <<2><sin(phi1-phi2-phi3)>> | |
4255 | Double_t term1st7 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
4256 | Double_t term2nd7 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
4257 | Double_t sumOfW1st7 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
4258 | Double_t sumOfW2nd7 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
4259 | Double_t sumOfWW7 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(7); // W_{<2>} * W_{<sin(phi1-phi2-phi3)>} | |
4260 | // numerator in the expression for the the unbiased estimator for covariance: | |
4261 | Double_t numerator7 = product7 - term1st7*term2nd7; | |
4262 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4263 | Double_t denominator7 = 0.; |
4264 | if(TMath::Abs(sumOfW1st7*sumOfW2nd7)>0.) | |
4265 | { | |
4266 | denominator7 = 1.-sumOfWW7/(sumOfW1st7*sumOfW2nd7); | |
4267 | if(TMath::Abs(denominator7)>0.) | |
4268 | { | |
4269 | // covariance: | |
4270 | Double_t covariance7 = numerator7/denominator7; | |
4271 | // weight dependent prefactor for covariance: | |
4272 | Double_t wPrefactor7 = sumOfWW7/(sumOfW1st7*sumOfW2nd7); | |
4273 | // finally, store "weighted" covariance: | |
4274 | fIntFlowCovariancesNUA->SetBinContent(7,wPrefactor7*covariance7); | |
4275 | } // end of if(TMath::Abs(denominator7)>0.) | |
4276 | } // end of if(TMath::Abs(sumOfW1st7*sumOfW2nd7)>0.) | |
4277 | ||
0328db2d | 4278 | // Cov(<4>,<cos(phi1>): |
4279 | Double_t product8 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(8); // <<4><cos(phi1)>> | |
4280 | Double_t term1st8 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
4281 | Double_t term2nd8 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
4282 | Double_t sumOfW1st8 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
4283 | Double_t sumOfW2nd8 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
4284 | Double_t sumOfWW8 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(8); // W_{<4>} * W_{<cos(phi1)>} | |
4285 | // numerator in the expression for the the unbiased estimator for covariance: | |
4286 | Double_t numerator8 = product8 - term1st8*term2nd8; | |
4287 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4288 | Double_t denominator8 = 0.; |
4289 | if(TMath::Abs(sumOfW1st8*sumOfW2nd8)>0.) | |
4290 | { | |
4291 | denominator8 = 1.-sumOfWW8/(sumOfW1st8*sumOfW2nd8); | |
4292 | if(TMath::Abs(denominator8)>0.) | |
4293 | { | |
4294 | // covariance: | |
4295 | Double_t covariance8 = numerator8/denominator8; | |
4296 | // weight dependent prefactor for covariance: | |
4297 | Double_t wPrefactor8 = sumOfWW8/(sumOfW1st8*sumOfW2nd8); | |
4298 | // finally, store "weighted" covariance: | |
4299 | fIntFlowCovariancesNUA->SetBinContent(8,wPrefactor8*covariance8); | |
4300 | } // end of if(TMath::Abs(denominator8)>0.) | |
4301 | } // end of if(TMath::Abs(sumOfW1st8*sumOfW2nd8)>0.) | |
4302 | ||
0328db2d | 4303 | // Cov(<4>,<sin(phi1)>): |
4304 | Double_t product9 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(9); // <<4><sin(phi1)>> | |
4305 | Double_t term1st9 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
4306 | Double_t term2nd9 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
4307 | Double_t sumOfW1st9 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
4308 | Double_t sumOfW2nd9 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
4309 | Double_t sumOfWW9 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(9); // W_{<4>} * W_{<sin(phi1)>} | |
4310 | // numerator in the expression for the the unbiased estimator for covariance: | |
4311 | Double_t numerator9 = product9 - term1st9*term2nd9; | |
4312 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4313 | Double_t denominator9 = 0.; |
4314 | if(TMath::Abs(sumOfW1st9*sumOfW2nd9)>0.) | |
4315 | { | |
4316 | denominator9 = 1.-sumOfWW9/(sumOfW1st9*sumOfW2nd9); | |
4317 | if(TMath::Abs(denominator9)>0.) | |
4318 | { | |
4319 | // covariance: | |
4320 | Double_t covariance9 = numerator9/denominator9; | |
4321 | // weight dependent prefactor for covariance: | |
4322 | Double_t wPrefactor9 = sumOfWW9/(sumOfW1st9*sumOfW2nd9); | |
4323 | // finally, store "weighted" covariance: | |
4324 | fIntFlowCovariancesNUA->SetBinContent(9,wPrefactor9*covariance9); | |
4325 | } | |
4326 | } // end of if(TMath::Abs(sumOfW1st9*sumOfW2nd9)>0.) | |
4327 | ||
0328db2d | 4328 | // Cov(<4>,<cos(phi1+phi2)>): |
4329 | Double_t product10 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(10); // <<4><cos(phi1+phi2)>> | |
4330 | Double_t term1st10 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
4331 | Double_t term2nd10 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
4332 | Double_t sumOfW1st10 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
4333 | Double_t sumOfW2nd10 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
4334 | Double_t sumOfWW10 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(10); // W_{<4>} * W_{<cos(phi1+phi2)>} | |
4335 | // numerator in the expression for the the unbiased estimator for covariance: | |
4336 | Double_t numerator10 = product10 - term1st10*term2nd10; | |
4337 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4338 | Double_t denominator10 = 0.; |
4339 | if(TMath::Abs(sumOfW1st10*sumOfW2nd10)>0.) | |
4340 | { | |
4341 | denominator10 = 1.-sumOfWW10/(sumOfW1st10*sumOfW2nd10); | |
4342 | if(TMath::Abs(denominator10)>0.) | |
4343 | { | |
4344 | // covariance: | |
4345 | Double_t covariance10 = numerator10/denominator10; | |
4346 | // weight dependent prefactor for covariance: | |
4347 | Double_t wPrefactor10 = sumOfWW10/(sumOfW1st10*sumOfW2nd10); | |
4348 | // finally, store "weighted" covariance: | |
4349 | fIntFlowCovariancesNUA->SetBinContent(10,wPrefactor10*covariance10); | |
4350 | } // end of if(TMath::Abs(denominator10)>0.) | |
4351 | } // end of if(TMath::Abs(sumOfW1st10*sumOfW2nd10)>0.) | |
4352 | ||
0328db2d | 4353 | // Cov(<4>,<sin(phi1+phi2)>): |
4354 | Double_t product11 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(11); // <<4><sin(phi1+phi2)>> | |
4355 | Double_t term1st11 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
4356 | Double_t term2nd11 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4357 | Double_t sumOfW1st11 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
4358 | Double_t sumOfW2nd11 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4359 | Double_t sumOfWW11 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(11); // W_{<4>} * W_{<sin(phi1+phi2)>} | |
4360 | // numerator in the expression for the the unbiased estimator for covariance: | |
4361 | Double_t numerator11 = product11 - term1st11*term2nd11; | |
4362 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4363 | Double_t denominator11 = 0.; |
4364 | if(TMath::Abs(sumOfW1st11*sumOfW2nd11)>0.) | |
4365 | { | |
4366 | denominator11 = 1.-sumOfWW11/(sumOfW1st11*sumOfW2nd11); | |
4367 | if(TMath::Abs(denominator11)>0.) | |
4368 | { | |
4369 | // covariance: | |
4370 | Double_t covariance11 = numerator11/denominator11; | |
4371 | // weight dependent prefactor for covariance: | |
4372 | Double_t wPrefactor11 = sumOfWW11/(sumOfW1st11*sumOfW2nd11); | |
4373 | // finally, store "weighted" covariance: | |
4374 | fIntFlowCovariancesNUA->SetBinContent(11,wPrefactor11*covariance11); | |
4375 | } // end of if(TMath::Abs(denominator11)>0.) | |
4376 | } // end of if(TMath::Abs(sumOfW1st11*sumOfW2nd11)>0.) | |
0328db2d | 4377 | |
4378 | // Cov(<4>,<cos(phi1-phi2-phi3)>): | |
4379 | Double_t product12 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(12); // <<4><cos(phi1-phi2-phi3)>> | |
4380 | Double_t term1st12 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
4381 | Double_t term2nd12 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
4382 | Double_t sumOfW1st12 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
4383 | Double_t sumOfW2nd12 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
4384 | Double_t sumOfWW12 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(12); // W_{<4>} * W_{<cos(phi1-phi2-phi3)>} | |
4385 | // numerator in the expression for the the unbiased estimator for covariance: | |
4386 | Double_t numerator12 = product12 - term1st12*term2nd12; | |
4387 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4388 | Double_t denominator12 = 0.; |
4389 | if(TMath::Abs(sumOfW1st12*sumOfW2nd12)>0.) | |
4390 | { | |
4391 | denominator12 = 1.-sumOfWW12/(sumOfW1st12*sumOfW2nd12); | |
4392 | if(TMath::Abs(denominator12)>0.) | |
4393 | { | |
4394 | // covariance: | |
4395 | Double_t covariance12 = numerator12/denominator12; | |
4396 | // weight dependent prefactor for covariance: | |
4397 | Double_t wPrefactor12 = sumOfWW12/(sumOfW1st12*sumOfW2nd12); | |
4398 | // finally, store "weighted" covariance: | |
4399 | fIntFlowCovariancesNUA->SetBinContent(12,wPrefactor12*covariance12); | |
4400 | } // end of if(TMath::Abs(denominator12)>0.) | |
4401 | } // end of if(TMath::Abs(sumOfW1st12*sumOfW2nd12)>0.) | |
0328db2d | 4402 | |
4403 | // Cov(<4>,<sin(phi1-phi2-phi3)>): | |
4404 | Double_t product13 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(13); // <<4><sin(phi1-phi2-phi3)>> | |
4405 | Double_t term1st13 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
4406 | Double_t term2nd13 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
4407 | Double_t sumOfW1st13 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
4408 | Double_t sumOfW2nd13 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
4409 | Double_t sumOfWW13 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(13); // W_{<4>} * W_{<sin(phi1-phi2-phi3)>} | |
4410 | // numerator in the expression for the the unbiased estimator for covariance: | |
4411 | Double_t numerator13 = product13 - term1st13*term2nd13; | |
4412 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4413 | Double_t denominator13 = 0.; |
4414 | if(TMath::Abs(sumOfW1st13*sumOfW2nd13)>0.) | |
4415 | { | |
4416 | denominator13 = 1.-sumOfWW13/(sumOfW1st13*sumOfW2nd13); | |
4417 | if(TMath::Abs(denominator13)>0.) | |
4418 | { | |
4419 | // covariance: | |
4420 | Double_t covariance13 = numerator13/denominator13; | |
4421 | // weight dependent prefactor for covariance: | |
4422 | Double_t wPrefactor13 = sumOfWW13/(sumOfW1st13*sumOfW2nd13); | |
4423 | // finally, store "weighted" covariance: | |
4424 | fIntFlowCovariancesNUA->SetBinContent(13,wPrefactor13*covariance13); | |
4425 | } // end of if(TMath::Abs(denominator13)>0.) | |
4426 | } // end of if(TMath::Abs(sumOfW1st13*sumOfW2nd13)>0.) | |
0328db2d | 4427 | |
4428 | // Cov(<cos(phi1)>,<cos(phi1+phi2)>): | |
4429 | Double_t product14 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(14); // <<cos(phi1)><cos(phi1+phi2)>> | |
4430 | Double_t term1st14 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
4431 | Double_t term2nd14 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
4432 | Double_t sumOfW1st14 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
4433 | Double_t sumOfW2nd14 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
4434 | Double_t sumOfWW14 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(14); // W_{<cos(phi1)>} * W_{<cos(phi1+phi2)>} | |
4435 | // numerator in the expression for the the unbiased estimator for covariance: | |
4436 | Double_t numerator14 = product14 - term1st14*term2nd14; | |
4437 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4438 | Double_t denominator14 = 0.; |
4439 | if(TMath::Abs(sumOfW1st14*sumOfW2nd14)>0.) | |
4440 | { | |
4441 | denominator14 = 1.-sumOfWW14/(sumOfW1st14*sumOfW2nd14); | |
4442 | if(TMath::Abs(denominator14)>0.) | |
4443 | { | |
4444 | // covariance: | |
4445 | Double_t covariance14 = numerator14/denominator14; | |
4446 | // weight dependent prefactor for covariance: | |
4447 | Double_t wPrefactor14 = sumOfWW14/(sumOfW1st14*sumOfW2nd14); | |
4448 | // finally, store "weighted" covariance: | |
4449 | fIntFlowCovariancesNUA->SetBinContent(14,wPrefactor14*covariance14); | |
4450 | } // end of if(TMath::Abs(denominator14)>0.) | |
4451 | } // end of if(TMath::Abs(sumOfW1st14*sumOfW2nd14)>0.) | |
0328db2d | 4452 | |
4453 | // Cov(<cos(phi1)>,<sin(phi1+phi2)>): | |
4454 | Double_t product15 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(15); // <<cos(phi1)><sin(phi1+phi2)>> | |
4455 | Double_t term1st15 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
4456 | Double_t term2nd15 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4457 | Double_t sumOfW1st15 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
4458 | Double_t sumOfW2nd15 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4459 | Double_t sumOfWW15 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(15); // W_{<cos(phi1)>} * W_{<sin(phi1+phi2)>} | |
4460 | // numerator in the expression for the the unbiased estimator for covariance: | |
4461 | Double_t numerator15 = product15 - term1st15*term2nd15; | |
4462 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4463 | Double_t denominator15 = 0.; |
4464 | if(TMath::Abs(sumOfW1st15*sumOfW2nd15)>0.) | |
4465 | { | |
4466 | denominator15 = 1.-sumOfWW15/(sumOfW1st15*sumOfW2nd15); | |
4467 | if(TMath::Abs(denominator15)>0.) | |
4468 | { | |
4469 | // covariance: | |
4470 | Double_t covariance15 = numerator15/denominator15; | |
4471 | // weight dependent prefactor for covariance: | |
4472 | Double_t wPrefactor15 = sumOfWW15/(sumOfW1st15*sumOfW2nd15); | |
4473 | // finally, store "weighted" covariance: | |
4474 | fIntFlowCovariancesNUA->SetBinContent(15,wPrefactor15*covariance15); | |
4475 | } // end of if(TMath::Abs(denominator15)>0.) | |
4476 | } // end of if(TMath::Abs(sumOfW1st15*sumOfW2nd15)>0.) | |
4477 | ||
0328db2d | 4478 | // Cov(<cos(phi1)>,<cos(phi1-phi2-phi3)>): |
4479 | Double_t product16 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(16); // <<cos(phi1)><cos(phi1-phi2-phi3)>> | |
4480 | Double_t term1st16 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
4481 | Double_t term2nd16 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
4482 | Double_t sumOfW1st16 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
4483 | Double_t sumOfW2nd16 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
4484 | Double_t sumOfWW16 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(16); // W_{<cos(phi1)>} * W_{<cos(phi1-phi2-phi3)>} | |
4485 | // numerator in the expression for the the unbiased estimator for covariance: | |
4486 | Double_t numerator16 = product16 - term1st16*term2nd16; | |
4487 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4488 | Double_t denominator16 = 0.; |
4489 | if(TMath::Abs(sumOfW1st16*sumOfW2nd16)>0.) | |
4490 | { | |
4491 | denominator16 = 1.-sumOfWW16/(sumOfW1st16*sumOfW2nd16); | |
4492 | if(TMath::Abs(denominator16)>0.) | |
4493 | { | |
4494 | // covariance: | |
4495 | Double_t covariance16 = numerator16/denominator16; | |
4496 | // weight dependent prefactor for covariance: | |
4497 | Double_t wPrefactor16 = sumOfWW16/(sumOfW1st16*sumOfW2nd16); | |
4498 | // finally, store "weighted" covariance: | |
4499 | fIntFlowCovariancesNUA->SetBinContent(16,wPrefactor16*covariance16); | |
4500 | } // end of if(TMath::Abs(denominator16)>0.) | |
4501 | } // end ofif(TMath::Abs(sumOfW1st16*sumOfW2nd16)>0.) | |
4502 | ||
0328db2d | 4503 | // Cov(<cos(phi1)>,<sin(phi1-phi2-phi3)>): |
4504 | Double_t product17 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(17); // <<cos(phi1)><sin(phi1-phi2-phi3)>> | |
4505 | Double_t term1st17 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
4506 | Double_t term2nd17 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
4507 | Double_t sumOfW1st17 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
4508 | Double_t sumOfW2nd17 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
4509 | Double_t sumOfWW17 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(17); // W_{<cos(phi1)>} * W_{<sin(phi1-phi2-phi3)>} | |
4510 | // numerator in the expression for the the unbiased estimator for covariance: | |
4511 | Double_t numerator17 = product17 - term1st17*term2nd17; | |
4512 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4513 | Double_t denominator17 = 0.; |
4514 | if(TMath::Abs(sumOfW1st17*sumOfW2nd17)>0.) | |
4515 | { | |
4516 | denominator17 = 1.-sumOfWW17/(sumOfW1st17*sumOfW2nd17); | |
4517 | if(TMath::Abs(denominator17)>0.) | |
4518 | { | |
4519 | // covariance: | |
4520 | Double_t covariance17 = numerator17/denominator17; | |
4521 | // weight dependent prefactor for covariance: | |
4522 | Double_t wPrefactor17 = sumOfWW17/(sumOfW1st17*sumOfW2nd17); | |
4523 | // finally, store "weighted" covariance: | |
4524 | fIntFlowCovariancesNUA->SetBinContent(17,wPrefactor17*covariance17); | |
4525 | } // end of if(TMath::Abs(denominator17)>0.) | |
4526 | } // end of if(TMath::Abs(sumOfW1st17*sumOfW2nd17)>0.) | |
0328db2d | 4527 | |
4528 | // Cov(<sin(phi1)>,<cos(phi1+phi2)>): | |
4529 | Double_t product18 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(18); // <<sin(phi1)><cos(phi1+phi2)>> | |
4530 | Double_t term1st18 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
4531 | Double_t term2nd18 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
4532 | Double_t sumOfW1st18 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
4533 | Double_t sumOfW2nd18 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
4534 | Double_t sumOfWW18 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(18); // W_{<sin(phi1)>} * W_{<cos(phi1+phi2)>} | |
4535 | // numerator in the expression for the the unbiased estimator for covariance: | |
4536 | Double_t numerator18 = product18 - term1st18*term2nd18; | |
4537 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4538 | Double_t denominator18 = 0.; |
4539 | if(TMath::Abs(sumOfW1st18*sumOfW2nd18)>0.) | |
4540 | { | |
4541 | denominator18 = 1.-sumOfWW18/(sumOfW1st18*sumOfW2nd18); | |
4542 | if(TMath::Abs(denominator18)>0.) | |
4543 | { | |
4544 | // covariance: | |
4545 | Double_t covariance18 = numerator18/denominator18; | |
4546 | // weight dependent prefactor for covariance: | |
4547 | Double_t wPrefactor18 = sumOfWW18/(sumOfW1st18*sumOfW2nd18); | |
4548 | // finally, store "weighted" covariance: | |
4549 | fIntFlowCovariancesNUA->SetBinContent(18,wPrefactor18*covariance18); | |
4550 | } // end of if(TMath::Abs(denominator18)>0.) | |
4551 | } // end of if(TMath::Abs(sumOfW1st18*sumOfW2nd18)>0.) | |
0328db2d | 4552 | |
4553 | // Cov(<sin(phi1)>,<sin(phi1+phi2)>): | |
4554 | Double_t product19 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(19); // <<sin(phi1)><sin(phi1+phi2)>> | |
4555 | Double_t term1st19 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
4556 | Double_t term2nd19 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4557 | Double_t sumOfW1st19 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
4558 | Double_t sumOfW2nd19 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4559 | Double_t sumOfWW19 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(19); // W_{<sin(phi1)>} * W_{<sin(phi1+phi2)>} | |
4560 | // numerator in the expression for the the unbiased estimator for covariance: | |
4561 | Double_t numerator19 = product19 - term1st19*term2nd19; | |
4562 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4563 | Double_t denominator19 = 0.; |
4564 | if(TMath::Abs(sumOfW1st19*sumOfW2nd19)>0.) | |
4565 | { | |
4566 | denominator19 = 1.-sumOfWW19/(sumOfW1st19*sumOfW2nd19); | |
4567 | if(TMath::Abs(denominator19)>0.) | |
4568 | { | |
4569 | // covariance: | |
4570 | Double_t covariance19 = numerator19/denominator19; | |
4571 | // weight dependent prefactor for covariance: | |
4572 | Double_t wPrefactor19 = sumOfWW19/(sumOfW1st19*sumOfW2nd19); | |
4573 | // finally, store "weighted" covariance: | |
4574 | fIntFlowCovariancesNUA->SetBinContent(19,wPrefactor19*covariance19); | |
4575 | } // end of if(TMath::Abs(denominator19)>0.) | |
4576 | } // end of if(TMath::Abs(sumOfW1st19*sumOfW2nd19)>0.) | |
4577 | ||
0328db2d | 4578 | // Cov(<sin(phi1)>,<cos(phi1-phi2-phi3)>): |
4579 | Double_t product20 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(20); // <<sin(phi1)><cos(phi1-phi2-phi3)>> | |
4580 | Double_t term1st20 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
4581 | Double_t term2nd20 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
4582 | Double_t sumOfW1st20 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
4583 | Double_t sumOfW2nd20 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
4584 | Double_t sumOfWW20 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(20); // W_{<sin(phi1)>} * W_{<cos(phi1-phi2-phi3)>} | |
4585 | // numerator in the expression for the the unbiased estimator for covariance: | |
4586 | Double_t numerator20 = product20 - term1st20*term2nd20; | |
4587 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4588 | Double_t denominator20 = 0.; |
4589 | if(TMath::Abs(sumOfW1st20*sumOfW2nd20)>0.) | |
4590 | { | |
4591 | denominator20 = 1.-sumOfWW20/(sumOfW1st20*sumOfW2nd20); | |
4592 | if(TMath::Abs(denominator20)>0.) | |
4593 | { | |
4594 | // covariance: | |
4595 | Double_t covariance20 = numerator20/denominator20; | |
4596 | // weight dependent prefactor for covariance: | |
4597 | Double_t wPrefactor20 = sumOfWW20/(sumOfW1st20*sumOfW2nd20); | |
4598 | // finally, store "weighted" covariance: | |
4599 | fIntFlowCovariancesNUA->SetBinContent(20,wPrefactor20*covariance20); | |
4600 | } // end of if(TMath::Abs(denominator20)>0.) | |
4601 | } // end of if(TMath::Abs(sumOfW1st20*sumOfW2nd20)>0.) | |
0328db2d | 4602 | |
4603 | // Cov(<sin(phi1)>,<sin(phi1-phi2-phi3)>): | |
4604 | Double_t product21 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(21); // <<sin(phi1)><sin(phi1-phi2-phi3)>> | |
4605 | Double_t term1st21 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
4606 | Double_t term2nd21 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
4607 | Double_t sumOfW1st21 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
4608 | Double_t sumOfW2nd21 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
4609 | Double_t sumOfWW21 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(21); // W_{<sin(phi1)>} * W_{<sin(phi1-phi2-phi3)>} | |
4610 | // numerator in the expression for the the unbiased estimator for covariance: | |
4611 | Double_t numerator21 = product21 - term1st21*term2nd21; | |
4612 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4613 | Double_t denominator21 = 0.; |
4614 | if(TMath::Abs(sumOfW1st21*sumOfW2nd21)>0.) | |
4615 | { | |
4616 | denominator21 = 1.-sumOfWW21/(sumOfW1st21*sumOfW2nd21); | |
4617 | if(TMath::Abs(denominator21)>0.) | |
4618 | { | |
4619 | // covariance: | |
4620 | Double_t covariance21 = numerator21/denominator21; | |
4621 | // weight dependent prefactor for covariance: | |
4622 | Double_t wPrefactor21 = sumOfWW21/(sumOfW1st21*sumOfW2nd21); | |
4623 | // finally, store "weighted" covariance: | |
4624 | fIntFlowCovariancesNUA->SetBinContent(21,wPrefactor21*covariance21); | |
4625 | } // end of if(TMath::Abs(denominator21)>0.) | |
4626 | } // end of if(TMath::Abs(sumOfW1st21*sumOfW2nd21)>0.) | |
0328db2d | 4627 | |
4628 | // Cov(<cos(phi1+phi2)>,<sin(phi1+phi2)>): | |
4629 | Double_t product22 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(22); // <<cos(phi1+phi2)><sin(phi1+phi2)>> | |
4630 | Double_t term1st22 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
4631 | Double_t term2nd22 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4632 | Double_t sumOfW1st22 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
4633 | Double_t sumOfW2nd22 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4634 | Double_t sumOfWW22 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(22); // W_{<cos(phi1+phi2)>} * W_{<sin(phi1+phi2)>} | |
4635 | // numerator in the expression for the the unbiased estimator for covariance: | |
4636 | Double_t numerator22 = product22 - term1st22*term2nd22; | |
4637 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4638 | Double_t denominator22 = 0.; |
4639 | if(TMath::Abs(sumOfW1st22*sumOfW2nd22)>0.) | |
4640 | { | |
4641 | denominator22 = 1.-sumOfWW22/(sumOfW1st22*sumOfW2nd22); | |
4642 | if(TMath::Abs(denominator22)>0.) | |
4643 | { | |
4644 | // covariance: | |
4645 | Double_t covariance22 = numerator22/denominator22; | |
4646 | // weight dependent prefactor for covariance: | |
4647 | Double_t wPrefactor22 = sumOfWW22/(sumOfW1st22*sumOfW2nd22); | |
4648 | // finally, store "weighted" covariance: | |
4649 | fIntFlowCovariancesNUA->SetBinContent(22,wPrefactor22*covariance22); | |
4650 | } // end of if(TMath::Abs(denominator22)>0.) | |
4651 | } // end of if(TMath::Abs(sumOfW1st22*sumOfW2nd22)>0.) | |
0328db2d | 4652 | |
4653 | // Cov(<cos(phi1+phi2)>,<cos(phi1-phi2-phi3)>): | |
4654 | Double_t product23 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(23); // <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
4655 | Double_t term1st23 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
4656 | Double_t term2nd23 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
4657 | Double_t sumOfW1st23 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
4658 | Double_t sumOfW2nd23 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
4659 | Double_t sumOfWW23 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(23); // W_{<cos(phi1+phi2)>} * W_{<cos(phi1-phi2-phi3)>} | |
4660 | // numerator in the expression for the the unbiased estimator for covariance: | |
4661 | Double_t numerator23 = product23 - term1st23*term2nd23; | |
4662 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4663 | Double_t denominator23 = 0.; |
4664 | if(TMath::Abs(sumOfW1st23*sumOfW2nd23)>0.) | |
4665 | { | |
4666 | denominator23 = 1.-sumOfWW23/(sumOfW1st23*sumOfW2nd23); | |
4667 | if(TMath::Abs(denominator23)>0.) | |
4668 | { | |
4669 | // covariance: | |
4670 | Double_t covariance23 = numerator23/denominator23; | |
4671 | // weight dependent prefactor for covariance: | |
4672 | Double_t wPrefactor23 = sumOfWW23/(sumOfW1st23*sumOfW2nd23); | |
4673 | // finally, store "weighted" covariance: | |
4674 | fIntFlowCovariancesNUA->SetBinContent(23,wPrefactor23*covariance23); | |
4675 | } // end of if(TMath::Abs(denominator23)>0.) | |
4676 | } // end of if(TMath::Abs(sumOfW1st23*sumOfW2nd23)>0.) | |
4677 | ||
0328db2d | 4678 | // Cov(<cos(phi1+phi2)>,<sin(phi1-phi2-phi3)>): |
4679 | Double_t product24 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(24); // <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
4680 | Double_t term1st24 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
4681 | Double_t term2nd24 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
4682 | Double_t sumOfW1st24 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
4683 | Double_t sumOfW2nd24 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
4684 | Double_t sumOfWW24 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(24); // W_{<cos(phi1+phi2)>} * W_{<sin(phi1-phi2-phi3)>} | |
4685 | // numerator in the expression for the the unbiased estimator for covariance: | |
4686 | Double_t numerator24 = product24 - term1st24*term2nd24; | |
4687 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4688 | Double_t denominator24 = 0.; |
4689 | if(TMath::Abs(sumOfW1st24*sumOfW2nd24)>0.) | |
4690 | { | |
4691 | denominator24 = 1.-sumOfWW24/(sumOfW1st24*sumOfW2nd24); | |
4692 | if(TMath::Abs(denominator24)>0.) | |
4693 | { | |
4694 | // covariance: | |
4695 | Double_t covariance24 = numerator24/denominator24; | |
4696 | // weight dependent prefactor for covariance: | |
4697 | Double_t wPrefactor24 = sumOfWW24/(sumOfW1st24*sumOfW2nd24); | |
4698 | // finally, store "weighted" covariance: | |
4699 | fIntFlowCovariancesNUA->SetBinContent(24,wPrefactor24*covariance24); | |
4700 | } // end of if(TMath::Abs(denominator24)>0.) | |
4701 | } // end of if(TMath::Abs(sumOfW1st24*sumOfW2nd24)>0.) | |
0328db2d | 4702 | |
4703 | // Cov(<sin(phi1+phi2)>,<cos(phi1-phi2-phi3)>): | |
4704 | Double_t product25 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(25); // <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
4705 | Double_t term1st25 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4706 | Double_t term2nd25 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
4707 | Double_t sumOfW1st25 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4708 | Double_t sumOfW2nd25 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
4709 | Double_t sumOfWW25 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(25); // W_{<sin(phi1+phi2)>} * W_{<cos(phi1-phi2-phi3)>} | |
4710 | // numerator in the expression for the the unbiased estimator for covariance: | |
4711 | Double_t numerator25 = product25 - term1st25*term2nd25; | |
4712 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4713 | Double_t denominator25 = 0.; |
4714 | if(TMath::Abs(sumOfW1st25*sumOfW2nd25)>0.) | |
4715 | { | |
4716 | denominator25 = 1.-sumOfWW25/(sumOfW1st25*sumOfW2nd25); | |
4717 | if(TMath::Abs(denominator25)>0.) | |
4718 | { | |
4719 | // covariance: | |
4720 | Double_t covariance25 = numerator25/denominator25; | |
4721 | // weight dependent prefactor for covariance: | |
4722 | Double_t wPrefactor25 = sumOfWW25/(sumOfW1st25*sumOfW2nd25); | |
4723 | // finally, store "weighted" covariance: | |
4724 | fIntFlowCovariancesNUA->SetBinContent(25,wPrefactor25*covariance25); | |
4725 | } // end of if(TMath::Abs(denominator25)>0.) | |
4726 | } // end of if(TMath::Abs(sumOfW1st25*sumOfW2nd25)>0.) | |
4727 | ||
0328db2d | 4728 | // Cov(<sin(phi1+phi2)>,<sin(phi1-phi2-phi3)>): |
4729 | Double_t product26 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(26); // <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
4730 | Double_t term1st26 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4731 | Double_t term2nd26 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
4732 | Double_t sumOfW1st26 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4733 | Double_t sumOfW2nd26 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
4734 | Double_t sumOfWW26 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(26); // W_{<sin(phi1+phi2)>} * W_{<sin(phi1-phi2-phi3)>} | |
4735 | // numerator in the expression for the the unbiased estimator for covariance: | |
4736 | Double_t numerator26 = product26 - term1st26*term2nd26; | |
4737 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4738 | Double_t denominator26 = 0.; |
4739 | if(TMath::Abs(sumOfW1st26*sumOfW2nd26)>0.) | |
4740 | { | |
4741 | denominator26 = 1.-sumOfWW26/(sumOfW1st26*sumOfW2nd26); | |
4742 | if(TMath::Abs(denominator26)>0.) | |
4743 | { | |
4744 | // covariance: | |
4745 | Double_t covariance26 = numerator26/denominator26; | |
4746 | // weight dependent prefactor for covariance: | |
4747 | Double_t wPrefactor26 = sumOfWW26/(sumOfW1st26*sumOfW2nd26); | |
4748 | // finally, store "weighted" covariance: | |
4749 | fIntFlowCovariancesNUA->SetBinContent(26,wPrefactor26*covariance26); | |
4750 | } // end of if(TMath::Abs(denominator26)>0.) | |
4751 | } // end of if(TMath::Abs(sumOfW1st26*sumOfW2nd26)>0.) | |
4752 | ||
0328db2d | 4753 | // Cov(<cos(phi1-phi2-phi3)>,<sin(phi1-phi2-phi3)>): |
4754 | Double_t product27 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(27); // <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>> | |
b92ea2b9 | 4755 | Double_t term1st27 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> |
0328db2d | 4756 | Double_t term2nd27 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> |
b92ea2b9 | 4757 | Double_t sumOfW1st27 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} |
0328db2d | 4758 | Double_t sumOfW2nd27 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} |
4759 | Double_t sumOfWW27 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(27); // W_{<cos(phi1-phi2-phi3)>} * W_{<sin(phi1-phi2-phi3)>} | |
4760 | // numerator in the expression for the the unbiased estimator for covariance: | |
4761 | Double_t numerator27 = product27 - term1st27*term2nd27; | |
4762 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4763 | Double_t denominator27 = 0.; |
4764 | if(TMath::Abs(sumOfW1st27*sumOfW2nd27)>0.) | |
4765 | { | |
4766 | denominator27 = 1.-sumOfWW27/(sumOfW1st27*sumOfW2nd27); | |
4767 | if(TMath::Abs(denominator27)>0.) | |
4768 | { | |
4769 | // covariance: | |
4770 | Double_t covariance27 = numerator27/denominator27; | |
4771 | // weight dependent prefactor for covariance: | |
4772 | Double_t wPrefactor27 = sumOfWW27/(sumOfW1st27*sumOfW2nd27); | |
4773 | // finally, store "weighted" covariance: | |
4774 | fIntFlowCovariancesNUA->SetBinContent(27,wPrefactor27*covariance27); | |
4775 | } // end of if(TMath::Abs(denominator27)>0.) | |
4776 | } // end of if(TMath::Abs(sumOfW1st27*sumOfW2nd27)>0.) | |
4777 | ||
0328db2d | 4778 | } // end of AliFlowAnalysisWithQCumulants::CalculateCovariancesNUAIntFlow() |
4779 | ||
0328db2d | 4780 | //================================================================================================================================ |
4781 | ||
489d5531 | 4782 | void AliFlowAnalysisWithQCumulants::FinalizeCorrelationsIntFlow() |
4783 | { | |
4784 | // From profile fIntFlowCorrelationsPro access measured correlations and spread, | |
4785 | // correctly calculate the statistical errors and store the final results and | |
4786 | // statistical errors for correlations in histogram fIntFlowCorrelationsHist. | |
4787 | // | |
4788 | // Remark: Statistical error of correlation is calculated as: | |
4789 | // | |
4790 | // statistical error = termA * spread * termB: | |
4791 | // termA = sqrt{sum_{i=1}^{N} w^2}/(sum_{i=1}^{N} w) | |
4792 | // termB = 1/sqrt(1-termA^2) | |
b3dacf6b | 4793 | // |
4794 | ||
489d5531 | 4795 | for(Int_t ci=1;ci<=4;ci++) // correlation index |
4796 | { | |
b40a910e | 4797 | if(fIntFlowCorrelationsPro->GetBinEffectiveEntries(ci) < 2 || fIntFlowSquaredCorrelationsPro->GetBinEffectiveEntries(ci) < 2) |
4798 | { | |
4799 | fIntFlowCorrelationsPro->SetBinError(ci,0.); | |
4800 | fIntFlowSquaredCorrelationsPro->SetBinError(ci,0.); | |
4801 | continue; | |
4802 | } | |
489d5531 | 4803 | Double_t correlation = fIntFlowCorrelationsPro->GetBinContent(ci); |
b40a910e | 4804 | Double_t squaredCorrelation = fIntFlowSquaredCorrelationsPro->GetBinContent(ci); |
4805 | Double_t spread = 0.; | |
4806 | if(squaredCorrelation-correlation*correlation >= 0.) | |
4807 | { | |
4808 | spread = pow(squaredCorrelation-correlation*correlation,0.5); | |
4809 | } else | |
4810 | { | |
4811 | cout<<endl; | |
4812 | cout<<Form(" WARNING: Imaginary 'spread' for %d-particle correlation!!!! ",2*ci)<<endl; | |
4813 | cout<<endl; | |
4814 | } | |
489d5531 | 4815 | Double_t sumOfLinearEventWeights = fIntFlowSumOfEventWeights[0]->GetBinContent(ci); |
4816 | Double_t sumOfQuadraticEventWeights = fIntFlowSumOfEventWeights[1]->GetBinContent(ci); | |
4817 | Double_t termA = 0.; | |
4818 | Double_t termB = 0.; | |
b3dacf6b | 4819 | if(TMath::Abs(sumOfLinearEventWeights) > 0.) // to be improved - shall I omitt here Abs() ? |
489d5531 | 4820 | { |
4821 | termA = pow(sumOfQuadraticEventWeights,0.5)/sumOfLinearEventWeights; | |
4822 | } else | |
4823 | { | |
b3dacf6b | 4824 | cout<<endl; |
4825 | cout<<" WARNING (QC): sumOfLinearEventWeights == 0 in method FinalizeCorrelationsIntFlow() !!!!"<<endl; | |
4826 | cout<<" (for "<<2*ci<<"-particle correlation)"<<endl; | |
4827 | cout<<endl; | |
489d5531 | 4828 | } |
4829 | if(1.-pow(termA,2.) > 0.) | |
4830 | { | |
4831 | termB = 1./pow(1-pow(termA,2.),0.5); | |
4832 | } else | |
4833 | { | |
b3dacf6b | 4834 | cout<<endl; |
4835 | cout<<" WARNING (QC): 1.-pow(termA,2.) <= 0 in method FinalizeCorrelationsIntFlow() !!!!"<<endl; | |
4836 | cout<<" (for "<<2*ci<<"-particle correlation)"<<endl; | |
4837 | cout<<endl; | |
489d5531 | 4838 | } |
4839 | Double_t statisticalError = termA * spread * termB; | |
4840 | fIntFlowCorrelationsHist->SetBinContent(ci,correlation); | |
4841 | fIntFlowCorrelationsHist->SetBinError(ci,statisticalError); | |
ff70ca91 | 4842 | } // end of for(Int_t ci=1;ci<=4;ci++) // correlation index |
4843 | ||
b3dacf6b | 4844 | // Versus multiplicity: |
4845 | if(!fCalculateCumulantsVsM){return;} | |
ff70ca91 | 4846 | for(Int_t ci=0;ci<=3;ci++) // correlation index |
4847 | { | |
4848 | Int_t nBins = fIntFlowCorrelationsVsMPro[ci]->GetNbinsX(); | |
4849 | for(Int_t b=1;b<=nBins;b++) // looping over multiplicity bins | |
4850 | { | |
b40a910e | 4851 | if(fIntFlowCorrelationsVsMPro[ci]->GetBinEffectiveEntries(b) < 2 || fIntFlowSquaredCorrelationsVsMPro[ci]->GetBinEffectiveEntries(b) < 2) |
4852 | { | |
4853 | fIntFlowCorrelationsVsMPro[ci]->SetBinError(b,0.); | |
4854 | fIntFlowSquaredCorrelationsVsMPro[ci]->SetBinError(b,0.); | |
4855 | continue; | |
4856 | } | |
ff70ca91 | 4857 | Double_t correlationVsM = fIntFlowCorrelationsVsMPro[ci]->GetBinContent(b); |
b40a910e | 4858 | Double_t squaredCorrelationVsM = fIntFlowSquaredCorrelationsVsMPro[ci]->GetBinContent(b); |
4859 | Double_t spreadVsM = 0.; | |
4860 | if(squaredCorrelationVsM-correlationVsM*correlationVsM >= 0.) | |
4861 | { | |
4862 | spreadVsM = pow(squaredCorrelationVsM-correlationVsM*correlationVsM,0.5); | |
4863 | } else | |
4864 | { | |
4865 | cout<<endl; | |
4866 | cout<<Form(" WARNING (QC): Imaginary 'spreadVsM' for ci = %d, bin = %d, entries = %f !!!!", | |
4867 | ci,b,fIntFlowCorrelationsVsMPro[ci]->GetBinEffectiveEntries(b))<<endl; | |
4868 | cout<<endl; | |
4869 | } | |
ff70ca91 | 4870 | Double_t sumOfLinearEventWeightsVsM = fIntFlowSumOfEventWeightsVsM[ci][0]->GetBinContent(b); |
4871 | Double_t sumOfQuadraticEventWeightsVsM = fIntFlowSumOfEventWeightsVsM[ci][1]->GetBinContent(b); | |
4872 | Double_t termAVsM = 0.; | |
4873 | Double_t termBVsM = 0.; | |
b40a910e | 4874 | if(sumOfLinearEventWeightsVsM > 0.) |
ff70ca91 | 4875 | { |
4876 | termAVsM = pow(sumOfQuadraticEventWeightsVsM,0.5)/sumOfLinearEventWeightsVsM; | |
b3dacf6b | 4877 | } |
ff70ca91 | 4878 | if(1.-pow(termAVsM,2.) > 0.) |
4879 | { | |
4880 | termBVsM = 1./pow(1-pow(termAVsM,2.),0.5); | |
b3dacf6b | 4881 | } |
ff70ca91 | 4882 | Double_t statisticalErrorVsM = termAVsM * spreadVsM * termBVsM; |
4883 | fIntFlowCorrelationsVsMHist[ci]->SetBinContent(b,correlationVsM); | |
4884 | fIntFlowCorrelationsVsMHist[ci]->SetBinError(b,statisticalErrorVsM); | |
4885 | } // end of for(Int_t b=1;b<=nBins;b++) | |
4886 | } // end of for(Int_t ci=1;ci<=4;ci++) // correlation index | |
4887 | ||
489d5531 | 4888 | } // end of AliFlowAnalysisWithQCumulants::FinalizeCorrelationsIntFlow() |
4889 | ||
489d5531 | 4890 | //================================================================================================================================ |
4891 | ||
489d5531 | 4892 | void AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(Int_t nRP) |
4893 | { | |
b77b6434 | 4894 | // Fill profile fAverageMultiplicity to hold average multiplicities and |
4895 | // number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8 | |
489d5531 | 4896 | |
4897 | // Binning of fAverageMultiplicity is organized as follows: | |
4898 | // 1st bin: all events (including the empty ones) | |
4899 | // 2nd bin: event with # of RPs greater or equal to 1 | |
4900 | // 3rd bin: event with # of RPs greater or equal to 2 | |
4901 | // 4th bin: event with # of RPs greater or equal to 3 | |
4902 | // 5th bin: event with # of RPs greater or equal to 4 | |
4903 | // 6th bin: event with # of RPs greater or equal to 5 | |
4904 | // 7th bin: event with # of RPs greater or equal to 6 | |
4905 | // 8th bin: event with # of RPs greater or equal to 7 | |
4906 | // 9th bin: event with # of RPs greater or equal to 8 | |
4907 | ||
489d5531 | 4908 | if(nRP<0) |
4909 | { | |
b77b6434 | 4910 | cout<<endl; |
4911 | cout<<" WARNING (QC): nRP<0 in in AFAWQC::FAM() !!!!"<<endl; | |
4912 | cout<<endl; | |
489d5531 | 4913 | exit(0); |
4914 | } | |
4915 | ||
4916 | for(Int_t i=0;i<9;i++) | |
4917 | { | |
b77b6434 | 4918 | if(nRP>=i){fAvMultiplicity->Fill(i+0.5,nRP,1);} |
489d5531 | 4919 | } |
4920 | ||
4921 | } // end of AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(nRP) | |
4922 | ||
489d5531 | 4923 | //================================================================================================================================ |
4924 | ||
489d5531 | 4925 | void AliFlowAnalysisWithQCumulants::CalculateCumulantsIntFlow() |
b3dacf6b | 4926 | { |
b92ea2b9 | 4927 | // a) Calculate Q-cumulants from the measured multiparticle correlations; |
4928 | // b) Propagate the statistical errors from measured multiparticle correlations to statistical errors of Q-cumulants; | |
4929 | // c) Remark: Q-cumulants calculated in this method are biased by non-uniform acceptance of detector !!!! | |
4930 | // Method CalculateQcumulantsCorrectedForNUAIntFlow() is called afterwards to correct for this bias; | |
4931 | // d) Store the results and statistical error of Q-cumulants in histogram fIntFlowQcumulants. | |
4932 | // Binning of fIntFlowQcumulants is organized as follows: | |
489d5531 | 4933 | // |
b3dacf6b | 4934 | // 1st bin: QC{2} |
4935 | // 2nd bin: QC{4} | |
4936 | // 3rd bin: QC{6} | |
4937 | // 4th bin: QC{8} | |
4938 | // | |
489d5531 | 4939 | |
b3dacf6b | 4940 | // Correlations: |
489d5531 | 4941 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> |
4942 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> | |
4943 | Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> | |
4944 | Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> | |
b3dacf6b | 4945 | // Statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations: |
489d5531 | 4946 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <2> |
4947 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <4> | |
4948 | Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <6> | |
4949 | Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <8> | |
b3dacf6b | 4950 | // Covariances (multiplied by prefactor depending on weights - see comments in CalculateCovariancesIntFlow()): |
8e1cefdd | 4951 | Double_t wCov24 = 0.; // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) |
4952 | Double_t wCov26 = 0.; // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>) | |
4953 | Double_t wCov28 = 0.; // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>) | |
4954 | Double_t wCov46 = 0.; // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>) | |
4955 | Double_t wCov48 = 0.; // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>) | |
4956 | Double_t wCov68 = 0.; // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>) | |
4957 | if(!fForgetAboutCovariances) | |
4958 | { | |
4959 | wCov24 = fIntFlowCovariances->GetBinContent(1); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) | |
4960 | wCov26 = fIntFlowCovariances->GetBinContent(2); // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>) | |
4961 | wCov28 = fIntFlowCovariances->GetBinContent(3); // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>) | |
4962 | wCov46 = fIntFlowCovariances->GetBinContent(4); // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>) | |
4963 | wCov48 = fIntFlowCovariances->GetBinContent(5); // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>) | |
4964 | wCov68 = fIntFlowCovariances->GetBinContent(6); // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>) | |
4965 | } | |
489d5531 | 4966 | // Q-cumulants: |
4967 | Double_t qc2 = 0.; // QC{2} | |
4968 | Double_t qc4 = 0.; // QC{4} | |
4969 | Double_t qc6 = 0.; // QC{6} | |
4970 | Double_t qc8 = 0.; // QC{8} | |
b3dacf6b | 4971 | if(TMath::Abs(two) > 0.){qc2 = two;} |
4972 | if(TMath::Abs(four) > 0.){qc4 = four-2.*pow(two,2.);} | |
4973 | if(TMath::Abs(six) > 0.){qc6 = six-9.*two*four+12.*pow(two,3.);} | |
4974 | if(TMath::Abs(eight) > 0.){qc8 = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.);} | |
4975 | // Statistical errors of Q-cumulants: | |
489d5531 | 4976 | Double_t qc2Error = 0.; |
4977 | Double_t qc4Error = 0.; | |
4978 | Double_t qc6Error = 0.; | |
b3dacf6b | 4979 | Double_t qc8Error = 0.; |
4980 | // Squared statistical errors of Q-cumulants: | |
489d5531 | 4981 | //Double_t qc2ErrorSquared = 0.; |
4982 | Double_t qc4ErrorSquared = 0.; | |
4983 | Double_t qc6ErrorSquared = 0.; | |
b3dacf6b | 4984 | Double_t qc8ErrorSquared = 0.; |
4985 | // Statistical error of QC{2}: | |
4986 | qc2Error = twoError; | |
4987 | // Statistical error of QC{4}: | |
489d5531 | 4988 | qc4ErrorSquared = 16.*pow(two,2.)*pow(twoError,2)+pow(fourError,2.) |
4989 | - 8.*two*wCov24; | |
4990 | if(qc4ErrorSquared>0.) | |
4991 | { | |
4992 | qc4Error = pow(qc4ErrorSquared,0.5); | |
4993 | } else | |
4994 | { | |
b3dacf6b | 4995 | cout<<" WARNING (QC): Statistical error of QC{4} is imaginary !!!!"<<endl; |
4996 | } | |
4997 | // Statistical error of QC{6}: | |
489d5531 | 4998 | qc6ErrorSquared = 81.*pow(4.*pow(two,2.)-four,2.)*pow(twoError,2.) |
4999 | + 81.*pow(two,2.)*pow(fourError,2.) | |
5000 | + pow(sixError,2.) | |
5001 | - 162.*two*(4.*pow(two,2.)-four)*wCov24 | |
5002 | + 18.*(4.*pow(two,2.)-four)*wCov26 | |
b3dacf6b | 5003 | - 18.*two*wCov46; |
489d5531 | 5004 | if(qc6ErrorSquared>0.) |
5005 | { | |
5006 | qc6Error = pow(qc6ErrorSquared,0.5); | |
5007 | } else | |
5008 | { | |
b3dacf6b | 5009 | cout<<" WARNING (QC): Statistical error of QC{6} is imaginary !!!!"<<endl; |
5010 | } | |
5011 | // Statistical error of QC{8}: | |
489d5531 | 5012 | qc8ErrorSquared = 256.*pow(36.*pow(two,3.)-18.*four*two+six,2.)*pow(twoError,2.) |
5013 | + 1296.*pow(4.*pow(two,2.)-four,2.)*pow(fourError,2.) | |
5014 | + 256.*pow(two,2.)*pow(sixError,2.) | |
5015 | + pow(eightError,2.) | |
5016 | - 1152.*(36.*pow(two,3.)-18.*four*two+six)*(4.*pow(two,2.)-four)*wCov24 | |
5017 | + 512.*two*(36.*pow(two,3.)-18.*four*two+six)*wCov26 | |
5018 | - 32.*(36.*pow(two,3.)-18.*four*two+six)*wCov28 | |
5019 | - 1152.*two*(4.*pow(two,2.)-four)*wCov46 | |
5020 | + 72.*(4.*pow(two,2.)-four)*wCov48 | |
5021 | - 32.*two*wCov68; | |
5022 | if(qc8ErrorSquared>0.) | |
5023 | { | |
5024 | qc8Error = pow(qc8ErrorSquared,0.5); | |
5025 | } else | |
5026 | { | |
b3dacf6b | 5027 | cout<<"WARNING (QC): Statistical error of QC{8} is imaginary !!!!"<<endl; |
489d5531 | 5028 | } |
b3dacf6b | 5029 | // Store the results and statistical errors for Q-cumulants: |
5030 | if(TMath::Abs(qc2)>0.) | |
5031 | { | |
5032 | fIntFlowQcumulants->SetBinContent(1,qc2); | |
5033 | fIntFlowQcumulants->SetBinError(1,qc2Error); | |
5034 | } | |
5035 | if(TMath::Abs(qc4)>0.) | |
5036 | { | |
5037 | fIntFlowQcumulants->SetBinContent(2,qc4); | |
5038 | fIntFlowQcumulants->SetBinError(2,qc4Error); | |
5039 | } | |
5040 | if(TMath::Abs(qc6)>0.) | |
5041 | { | |
5042 | fIntFlowQcumulants->SetBinContent(3,qc6); | |
5043 | fIntFlowQcumulants->SetBinError(3,qc6Error); | |
5044 | } | |
5045 | if(TMath::Abs(qc8)>0.) | |
5046 | { | |
5047 | fIntFlowQcumulants->SetBinContent(4,qc8); | |
5048 | fIntFlowQcumulants->SetBinError(4,qc8Error); | |
5049 | } | |
5050 | ||
5051 | // Versus multiplicity: | |
5052 | if(!fCalculateCumulantsVsM){return;} | |
9da1a4f3 | 5053 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) |
b3dacf6b | 5054 | Double_t value[4] = {0.}; // QCs vs M |
5055 | Double_t error[4] = {0.}; // error of QCs vs M | |
5056 | Double_t dSum1[4] = {0.}; // sum value_i/(error_i)^2 | |
5057 | Double_t dSum2[4] = {0.}; // sum 1/(error_i)^2 | |
9da1a4f3 | 5058 | for(Int_t b=1;b<=nBins;b++) |
5059 | { | |
b3dacf6b | 5060 | // Correlations: |
9da1a4f3 | 5061 | two = fIntFlowCorrelationsVsMHist[0]->GetBinContent(b); // <<2>> |
5062 | four = fIntFlowCorrelationsVsMHist[1]->GetBinContent(b); // <<4>> | |
5063 | six = fIntFlowCorrelationsVsMHist[2]->GetBinContent(b); // <<6>> | |
5064 | eight = fIntFlowCorrelationsVsMHist[3]->GetBinContent(b); // <<8>> | |
b3dacf6b | 5065 | // Statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations: |
9da1a4f3 | 5066 | twoError = fIntFlowCorrelationsVsMHist[0]->GetBinError(b); // statistical error of <2> |
5067 | fourError = fIntFlowCorrelationsVsMHist[1]->GetBinError(b); // statistical error of <4> | |
5068 | sixError = fIntFlowCorrelationsVsMHist[2]->GetBinError(b); // statistical error of <6> | |
5069 | eightError = fIntFlowCorrelationsVsMHist[3]->GetBinError(b); // statistical error of <8> | |
b3dacf6b | 5070 | // Covariances (multiplied by prefactor depending on weights - see comments in CalculateCovariancesIntFlow()): |
8e1cefdd | 5071 | if(!fForgetAboutCovariances) |
5072 | { | |
5073 | wCov24 = fIntFlowCovariancesVsM[0]->GetBinContent(b); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) | |
5074 | wCov26 = fIntFlowCovariancesVsM[1]->GetBinContent(b); // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>) | |
5075 | wCov28 = fIntFlowCovariancesVsM[2]->GetBinContent(b); // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>) | |
5076 | wCov46 = fIntFlowCovariancesVsM[3]->GetBinContent(b); // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>) | |
5077 | wCov48 = fIntFlowCovariancesVsM[4]->GetBinContent(b); // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>) | |
5078 | wCov68 = fIntFlowCovariancesVsM[5]->GetBinContent(b); // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>) | |
5079 | } | |
9da1a4f3 | 5080 | // Q-cumulants: |
5081 | qc2 = 0.; // QC{2} | |
5082 | qc4 = 0.; // QC{4} | |
5083 | qc6 = 0.; // QC{6} | |
5084 | qc8 = 0.; // QC{8} | |
b3dacf6b | 5085 | if(TMath::Abs(two) > 0.){qc2 = two;} |
5086 | if(TMath::Abs(four) > 0.){qc4 = four-2.*pow(two,2.);} | |
5087 | if(TMath::Abs(six) > 0.){qc6 = six-9.*two*four+12.*pow(two,3.);} | |
5088 | if(TMath::Abs(eight) > 0.){qc8 = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.);} | |
5089 | // Statistical errors of Q-cumulants: | |
9da1a4f3 | 5090 | qc2Error = 0.; |
5091 | qc4Error = 0.; | |
5092 | qc6Error = 0.; | |
b3dacf6b | 5093 | qc8Error = 0.; |
5094 | // Squared statistical errors of Q-cumulants: | |
9da1a4f3 | 5095 | //Double_t qc2ErrorSquared = 0.; |
5096 | qc4ErrorSquared = 0.; | |
5097 | qc6ErrorSquared = 0.; | |
b3dacf6b | 5098 | qc8ErrorSquared = 0.; |
5099 | // Statistical error of QC{2}: | |
5100 | qc2Error = twoError; | |
5101 | // Statistical error of QC{4}: | |
9da1a4f3 | 5102 | qc4ErrorSquared = 16.*pow(two,2.)*pow(twoError,2)+pow(fourError,2.) |
5103 | - 8.*two*wCov24; | |
5104 | if(qc4ErrorSquared>0.) | |
5105 | { | |
5106 | qc4Error = pow(qc4ErrorSquared,0.5); | |
5107 | } else | |
5108 | { | |
5109 | // cout<<"WARNING: Statistical error of QC{4} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl; | |
b3dacf6b | 5110 | } |
5111 | // Statistical error of QC{6}: | |
9da1a4f3 | 5112 | qc6ErrorSquared = 81.*pow(4.*pow(two,2.)-four,2.)*pow(twoError,2.) |
5113 | + 81.*pow(two,2.)*pow(fourError,2.) | |
5114 | + pow(sixError,2.) | |
5115 | - 162.*two*(4.*pow(two,2.)-four)*wCov24 | |
5116 | + 18.*(4.*pow(two,2.)-four)*wCov26 | |
b3dacf6b | 5117 | - 18.*two*wCov46; |
9da1a4f3 | 5118 | if(qc6ErrorSquared>0.) |
5119 | { | |
5120 | qc6Error = pow(qc6ErrorSquared,0.5); | |
5121 | } else | |
5122 | { | |
5123 | // cout<<"WARNING: Statistical error of QC{6} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl; | |
b3dacf6b | 5124 | } |
5125 | // Statistical error of QC{8}: | |
9da1a4f3 | 5126 | qc8ErrorSquared = 256.*pow(36.*pow(two,3.)-18.*four*two+six,2.)*pow(twoError,2.) |
5127 | + 1296.*pow(4.*pow(two,2.)-four,2.)*pow(fourError,2.) | |
5128 | + 256.*pow(two,2.)*pow(sixError,2.) | |
5129 | + pow(eightError,2.) | |
5130 | - 1152.*(36.*pow(two,3.)-18.*four*two+six)*(4.*pow(two,2.)-four)*wCov24 | |
5131 | + 512.*two*(36.*pow(two,3.)-18.*four*two+six)*wCov26 | |
5132 | - 32.*(36.*pow(two,3.)-18.*four*two+six)*wCov28 | |
5133 | - 1152.*two*(4.*pow(two,2.)-four)*wCov46 | |
5134 | + 72.*(4.*pow(two,2.)-four)*wCov48 | |
5135 | - 32.*two*wCov68; | |
5136 | if(qc8ErrorSquared>0.) | |
5137 | { | |
5138 | qc8Error = pow(qc8ErrorSquared,0.5); | |
5139 | } else | |
5140 | { | |
5141 | // cout<<"WARNING: Statistical error of QC{8} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl; | |
5142 | } | |
b3dacf6b | 5143 | // Store the results and statistical errors for Q-cumulants: |
5144 | if(TMath::Abs(qc2)>0.) | |
5145 | { | |
5146 | fIntFlowQcumulantsVsM[0]->SetBinContent(b,qc2); | |
5147 | fIntFlowQcumulantsVsM[0]->SetBinError(b,qc2Error); | |
5148 | } | |
5149 | if(TMath::Abs(qc4)>0.) | |
5150 | { | |
5151 | fIntFlowQcumulantsVsM[1]->SetBinContent(b,qc4); | |
5152 | fIntFlowQcumulantsVsM[1]->SetBinError(b,qc4Error); | |
5153 | } | |
5154 | if(TMath::Abs(qc6)>0.) | |
5155 | { | |
5156 | fIntFlowQcumulantsVsM[2]->SetBinContent(b,qc6); | |
5157 | fIntFlowQcumulantsVsM[2]->SetBinError(b,qc6Error); | |
5158 | } | |
5159 | if(TMath::Abs(qc8)>0.) | |
5160 | { | |
5161 | fIntFlowQcumulantsVsM[3]->SetBinContent(b,qc8); | |
5162 | fIntFlowQcumulantsVsM[3]->SetBinError(b,qc8Error); | |
5163 | } | |
5164 | // Rebin in M: | |
5165 | for(Int_t co=0;co<4;co++) | |
5166 | { | |
b40a910e | 5167 | if(fIntFlowCorrelationsVsMPro[co]->GetBinEffectiveEntries(b)<2){continue;} |
b3dacf6b | 5168 | value[co] = fIntFlowQcumulantsVsM[co]->GetBinContent(b); |
5169 | error[co] = fIntFlowQcumulantsVsM[co]->GetBinError(b); | |
5170 | if(error[co]>0.) | |
5171 | { | |
5172 | dSum1[co]+=value[co]/(error[co]*error[co]); | |
5173 | dSum2[co]+=1./(error[co]*error[co]); | |
5174 | } | |
5175 | } // end of for(Int_t co=0;co<4;co++) | |
9da1a4f3 | 5176 | } // end of for(Int_t b=1;b<=nBins;b++) |
b3dacf6b | 5177 | // Store rebinned Q-cumulants: |
5178 | for(Int_t co=0;co<4;co++) | |
5179 | { | |
5180 | if(dSum2[co]>0.) | |
5181 | { | |
5182 | fIntFlowQcumulantsRebinnedInM->SetBinContent(co+1,dSum1[co]/dSum2[co]); | |
5183 | fIntFlowQcumulantsRebinnedInM->SetBinError(co+1,pow(1./dSum2[co],0.5)); | |
5184 | } | |
5185 | } // end of for(Int_t co=0;co<4;co++) | |
5186 | ||
489d5531 | 5187 | } // end of AliFlowAnalysisWithQCumulants::CalculateCumulantsIntFlow() |
5188 | ||
489d5531 | 5189 | //================================================================================================================================ |
5190 | ||
b92ea2b9 | 5191 | void AliFlowAnalysisWithQCumulants::CalculateReferenceFlow() |
489d5531 | 5192 | { |
b92ea2b9 | 5193 | // a) Calculate the final results for reference flow estimates from Q-cumulants; |
5194 | // b) Propagate the statistical errors to reference flow estimates from statistical error of Q-cumulants; | |
0328db2d | 5195 | // c) Store the results and statistical errors of reference flow estimates in histogram fIntFlow. |
489d5531 | 5196 | // Binning of fIntFlow is organized as follows: |
5197 | // | |
b3dacf6b | 5198 | // 1st bin: v{2,QC} |
5199 | // 2nd bin: v{4,QC} | |
5200 | // 3rd bin: v{6,QC} | |
5201 | // 4th bin: v{8,QC} | |
5202 | // | |
489d5531 | 5203 | |
b3dacf6b | 5204 | // Reference flow estimates: |
489d5531 | 5205 | Double_t v2 = 0.; // v{2,QC} |
5206 | Double_t v4 = 0.; // v{4,QC} | |
5207 | Double_t v6 = 0.; // v{6,QC} | |
5208 | Double_t v8 = 0.; // v{8,QC} | |
b3dacf6b | 5209 | // Reference flow's statistical errors: |
5210 | Double_t v2Error = 0.; // v{2,QC} stat. error | |
5211 | Double_t v4Error = 0.; // v{4,QC} stat. error | |
5212 | Double_t v6Error = 0.; // v{6,QC} stat. error | |
5213 | Double_t v8Error = 0.; // v{8,QC} stat. error | |
5214 | ||
b92ea2b9 | 5215 | // Q-cumulants: |
5216 | Double_t qc2 = fIntFlowQcumulants->GetBinContent(1); // QC{2} | |
5217 | Double_t qc4 = fIntFlowQcumulants->GetBinContent(2); // QC{4} | |
5218 | Double_t qc6 = fIntFlowQcumulants->GetBinContent(3); // QC{6} | |
5219 | Double_t qc8 = fIntFlowQcumulants->GetBinContent(4); // QC{8} | |
5220 | // Q-cumulants's statistical errors: | |
5221 | Double_t qc2Error = fIntFlowQcumulants->GetBinError(1); // QC{2} stat. error | |
5222 | Double_t qc4Error = fIntFlowQcumulants->GetBinError(2); // QC{4} stat. error | |
5223 | Double_t qc6Error = fIntFlowQcumulants->GetBinError(3); // QC{6} stat. error | |
5224 | Double_t qc8Error = fIntFlowQcumulants->GetBinError(4); // QC{8} stat. error | |
5225 | // Calculate reference flow estimates from Q-cumulants: | |
1268c371 | 5226 | if(qc2>=0.){v2 = pow(qc2,0.5);} |
b92ea2b9 | 5227 | if(qc4<=0.){v4 = pow(-1.*qc4,1./4.);} |
5228 | if(qc6>=0.){v6 = pow((1./4.)*qc6,1./6.);} | |
5229 | if(qc8<=0.){v8 = pow((-1./33.)*qc8,1./8.);} | |
5230 | // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants: | |
1268c371 | 5231 | if(qc2>0.){v2Error = (1./2.)*pow(qc2,-0.5)*qc2Error;} |
b92ea2b9 | 5232 | if(qc4<0.){v4Error = (1./4.)*pow(-qc4,-3./4.)*qc4Error;} |
5233 | if(qc6>0.){v6Error = (1./6.)*pow(2.,-1./3.)*pow(qc6,-5./6.)*qc6Error;} | |
5234 | if(qc8<0.){v8Error = (1./8.)*pow(33.,-1./8.)*pow(-qc8,-7./8.)*qc8Error;} | |
5235 | // Print warnings for the 'wrong sign' cumulants: | |
5236 | if(TMath::Abs(v2) < 1.e-44) | |
5237 | { | |
5238 | cout<<" WARNING: Wrong sign QC{2}, couldn't calculate v{2,QC} !!!!"<<endl; | |
5239 | } | |
5240 | if(TMath::Abs(v4) < 1.e-44) | |
5241 | { | |
5242 | cout<<" WARNING: Wrong sign QC{4}, couldn't calculate v{4,QC} !!!!"<<endl; | |
5243 | } | |
5244 | if(TMath::Abs(v6) < 1.e-44) | |
5245 | { | |
5246 | cout<<" WARNING: Wrong sign QC{6}, couldn't calculate v{6,QC} !!!!"<<endl; | |
5247 | } | |
5248 | if(TMath::Abs(v8) < 1.e-44) | |
5249 | { | |
5250 | cout<<" WARNING: Wrong sign QC{8}, couldn't calculate v{8,QC} !!!!"<<endl; | |
5251 | } | |
5252 | // Store the results and statistical errors of integrated flow estimates: | |
5253 | fIntFlow->SetBinContent(1,v2); | |
5254 | fIntFlow->SetBinError(1,v2Error); | |
5255 | fIntFlow->SetBinContent(2,v4); | |
5256 | fIntFlow->SetBinError(2,v4Error); | |
5257 | fIntFlow->SetBinContent(3,v6); | |
5258 | fIntFlow->SetBinError(3,v6Error); | |
5259 | fIntFlow->SetBinContent(4,v8); | |
5260 | fIntFlow->SetBinError(4,v8Error); | |
5261 | ||
5262 | // Versus multiplicity: | |
5263 | if(!fCalculateCumulantsVsM){return;} | |
5264 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) | |
5265 | for(Int_t b=1;b<=nBins;b++) | |
9da1a4f3 | 5266 | { |
5267 | // Q-cumulants: | |
b92ea2b9 | 5268 | Double_t qc2VsM = fIntFlowQcumulantsVsM[0]->GetBinContent(b); // QC{2} |
5269 | Double_t qc4VsM = fIntFlowQcumulantsVsM[1]->GetBinContent(b); // QC{4} | |
5270 | Double_t qc6VsM = fIntFlowQcumulantsVsM[2]->GetBinContent(b); // QC{6} | |
5271 | Double_t qc8VsM = fIntFlowQcumulantsVsM[3]->GetBinContent(b); // QC{8} | |
b3dacf6b | 5272 | // Q-cumulants's statistical errors: |
b92ea2b9 | 5273 | Double_t qc2ErrorVsM = fIntFlowQcumulantsVsM[0]->GetBinError(b); // QC{2} stat. error |
5274 | Double_t qc4ErrorVsM = fIntFlowQcumulantsVsM[1]->GetBinError(b); // QC{4} stat. error | |
5275 | Double_t qc6ErrorVsM = fIntFlowQcumulantsVsM[2]->GetBinError(b); // QC{6} stat. error | |
5276 | Double_t qc8ErrorVsM = fIntFlowQcumulantsVsM[3]->GetBinError(b); // QC{8} stat. error | |
b3dacf6b | 5277 | // Reference flow estimates: |
b92ea2b9 | 5278 | Double_t v2VsM = 0.; // v{2,QC} |
5279 | Double_t v4VsM = 0.; // v{4,QC} | |
5280 | Double_t v6VsM = 0.; // v{6,QC} | |
5281 | Double_t v8VsM = 0.; // v{8,QC} | |
5282 | // Reference flow estimates errors: | |
5283 | Double_t v2ErrorVsM = 0.; // v{2,QC} stat. error | |
5284 | Double_t v4ErrorVsM = 0.; // v{4,QC} stat. error | |
5285 | Double_t v6ErrorVsM = 0.; // v{6,QC} stat. error | |
5286 | Double_t v8ErrorVsM = 0.; // v{8,QC} stat. error | |
b3dacf6b | 5287 | // Calculate reference flow estimates from Q-cumulants: |
1268c371 | 5288 | if(qc2VsM>=0.){v2VsM = pow(qc2VsM,0.5);} |
b92ea2b9 | 5289 | if(qc4VsM<=0.){v4VsM = pow(-1.*qc4VsM,1./4.);} |
5290 | if(qc6VsM>=0.){v6VsM = pow((1./4.)*qc6VsM,1./6.);} | |
5291 | if(qc8VsM<=0.){v8VsM = pow((-1./33.)*qc8VsM,1./8.);} | |
b3dacf6b | 5292 | // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants: |
1268c371 | 5293 | if(qc2VsM>0.){v2ErrorVsM = (1./2.)*pow(qc2VsM,-0.5)*qc2ErrorVsM;} |
b92ea2b9 | 5294 | if(qc4VsM<0.){v4ErrorVsM = (1./4.)*pow(-qc4VsM,-3./4.)*qc4ErrorVsM;} |
5295 | if(qc6VsM>0.){v6ErrorVsM = (1./6.)*pow(2.,-1./3.)*pow(qc6VsM,-5./6.)*qc6ErrorVsM;} | |
5296 | if(qc8VsM<0.){v8ErrorVsM = (1./8.)*pow(33.,-1./8.)*pow(-qc8VsM,-7./8.)*qc8ErrorVsM;} | |
b3dacf6b | 5297 | // Store the results and statistical errors of integrated flow estimates: |
b92ea2b9 | 5298 | fIntFlowVsM[0]->SetBinContent(b,v2VsM); |
5299 | fIntFlowVsM[0]->SetBinError(b,v2ErrorVsM); | |
5300 | fIntFlowVsM[1]->SetBinContent(b,v4VsM); | |
5301 | fIntFlowVsM[1]->SetBinError(b,v4ErrorVsM); | |
5302 | fIntFlowVsM[2]->SetBinContent(b,v6VsM); | |
5303 | fIntFlowVsM[2]->SetBinError(b,v6ErrorVsM); | |
5304 | fIntFlowVsM[3]->SetBinContent(b,v8VsM); | |
5305 | fIntFlowVsM[3]->SetBinError(b,v8ErrorVsM); | |
5306 | } // end of for(Int_t b=1;b<=nBins;b++) | |
5307 | ||
5308 | // 'Rebinned in M' calculation: // to be improved - this can be implemented better: | |
5309 | // Reference flow estimates: | |
5310 | Double_t v2RebinnedInM = 0.; // v{2,QC} | |
5311 | Double_t v4RebinnedInM = 0.; // v{4,QC} | |
5312 | Double_t v6RebinnedInM = 0.; // v{6,QC} | |
5313 | Double_t v8RebinnedInM = 0.; // v{8,QC} | |
5314 | // Reference flow's statistical errors: | |
5315 | Double_t v2ErrorRebinnedInM = 0.; // v{2,QC} stat. error | |
5316 | Double_t v4ErrorRebinnedInM = 0.; // v{4,QC} stat. error | |
5317 | Double_t v6ErrorRebinnedInM = 0.; // v{6,QC} stat. error | |
5318 | Double_t v8ErrorRebinnedInM = 0.; // v{8,QC} stat. error | |
5319 | // Q-cumulants: | |
5320 | Double_t qc2RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(1); // QC{2} | |
5321 | Double_t qc4RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(2); // QC{4} | |
5322 | Double_t qc6RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(3); // QC{6} | |
5323 | Double_t qc8RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(4); // QC{8} | |
5324 | // Q-cumulants's statistical errors: | |
5325 | Double_t qc2ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(1); // QC{2} stat. error | |
5326 | Double_t qc4ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(2); // QC{4} stat. error | |
5327 | Double_t qc6ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(3); // QC{6} stat. error | |
5328 | Double_t qc8ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(4); // QC{8} stat. error | |
5329 | // Calculate reference flow estimates from Q-cumulants: | |
1268c371 | 5330 | if(qc2RebinnedInM>=0.){v2RebinnedInM = pow(qc2RebinnedInM,0.5);} |
b92ea2b9 | 5331 | if(qc4RebinnedInM<=0.){v4RebinnedInM = pow(-1.*qc4RebinnedInM,1./4.);} |
5332 | if(qc6RebinnedInM>=0.){v6RebinnedInM = pow((1./4.)*qc6RebinnedInM,1./6.);} | |
5333 | if(qc8RebinnedInM<=0.){v8RebinnedInM = pow((-1./33.)*qc8RebinnedInM,1./8.);} | |
5334 | // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants: | |
1268c371 | 5335 | if(qc2RebinnedInM>0.){v2ErrorRebinnedInM = (1./2.)*pow(qc2RebinnedInM,-0.5)*qc2ErrorRebinnedInM;} |
b92ea2b9 | 5336 | if(qc4RebinnedInM<0.){v4ErrorRebinnedInM = (1./4.)*pow(-qc4RebinnedInM,-3./4.)*qc4ErrorRebinnedInM;} |
5337 | if(qc6RebinnedInM>0.){v6ErrorRebinnedInM = (1./6.)*pow(2.,-1./3.)*pow(qc6RebinnedInM,-5./6.)*qc6ErrorRebinnedInM;} | |
5338 | if(qc8RebinnedInM<0.){v8ErrorRebinnedInM = (1./8.)*pow(33.,-1./8.)*pow(-qc8RebinnedInM,-7./8.)*qc8ErrorRebinnedInM;} | |
5339 | // Print warnings for the 'wrong sign' cumulants: | |
5340 | if(TMath::Abs(v2RebinnedInM) < 1.e-44) | |
5341 | { | |
5342 | cout<<" WARNING: Wrong sign QC{2} rebinned in M, couldn't calculate v{2,QC} !!!!"<<endl; | |
5343 | } | |
5344 | if(TMath::Abs(v4RebinnedInM) < 1.e-44) | |
5345 | { | |
5346 | cout<<" WARNING: Wrong sign QC{4} rebinned in M, couldn't calculate v{4,QC} !!!!"<<endl; | |
5347 | } | |
5348 | if(TMath::Abs(v6RebinnedInM) < 1.e-44) | |
5349 | { | |
5350 | cout<<" WARNING: Wrong sign QC{6} rebinned in M, couldn't calculate v{6,QC} !!!!"<<endl; | |
5351 | } | |
5352 | if(TMath::Abs(v8RebinnedInM) < 1.e-44) | |
5353 | { | |
5354 | cout<<" WARNING: Wrong sign QC{8} rebinned in M, couldn't calculate v{8,QC} !!!!"<<endl; | |
5355 | } | |
5356 | // Store the results and statistical errors of integrated flow estimates: | |
5357 | fIntFlowRebinnedInM->SetBinContent(1,v2RebinnedInM); | |
5358 | fIntFlowRebinnedInM->SetBinError(1,v2ErrorRebinnedInM); | |
5359 | fIntFlowRebinnedInM->SetBinContent(2,v4RebinnedInM); | |
5360 | fIntFlowRebinnedInM->SetBinError(2,v4ErrorRebinnedInM); | |
5361 | fIntFlowRebinnedInM->SetBinContent(3,v6RebinnedInM); | |
5362 | fIntFlowRebinnedInM->SetBinError(3,v6ErrorRebinnedInM); | |
5363 | fIntFlowRebinnedInM->SetBinContent(4,v8RebinnedInM); | |
5364 | fIntFlowRebinnedInM->SetBinError(4,v8ErrorRebinnedInM); | |
5365 | ||
5366 | } // end of AliFlowAnalysisWithQCumulants::CalculateReferenceFlow() | |
489d5531 | 5367 | |
489d5531 | 5368 | //================================================================================================================================ |
5369 | ||
489d5531 | 5370 | void AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow() |
5371 | { | |
0dd3b008 | 5372 | // Fill in AliFlowCommonHistResults histograms relevant for reference flow. |
489d5531 | 5373 | |
0dd3b008 | 5374 | // There are two possibilities here: |
5375 | // a) Store minimum bias reference flow - use SetMinimumBiasReferenceFlow(kTRUE). This result is | |
5376 | // biased by the interplay between nonflow correlations and multiplicity fluctuations and is | |
5377 | // also stored in local histogram fIntFlow; | |
5378 | // b) Store reference flow obtained from flow analysis performed at fixed multiplicity and | |
5379 | // rebinned only at the end of the day - use SetMinimumBiasReferenceFlow(kFALSE). This result | |
5380 | // is also stored in local histogram fIntFlowRebinnedInM. | |
489d5531 | 5381 | |
0dd3b008 | 5382 | // Reference flow estimates: |
5383 | Double_t v[4] = {0.}; | |
5384 | // Statistical errors of reference flow estimates: | |
5385 | Double_t vError[4] = {0.}; | |
489d5531 | 5386 | |
0dd3b008 | 5387 | for(Int_t b=0;b<4;b++) |
5388 | { | |
5389 | if(fMinimumBiasReferenceFlow) | |
5390 | { | |
5391 | v[b] = fIntFlow->GetBinContent(b+1); | |
5392 | vError[b] = fIntFlow->GetBinError(b+1); | |
5393 | } else | |
5394 | { | |
5395 | v[b] = fIntFlowRebinnedInM->GetBinContent(b+1); | |
5396 | vError[b] = fIntFlowRebinnedInM->GetBinError(b+1); | |
5397 | } | |
5398 | } // end of for(Int_t b=0;b<4;b++) | |
5399 | ||
5400 | // Fill AliFlowCommonHistResults histogram: | |
5401 | fCommonHistsResults2nd->FillIntegratedFlow(v[0],vError[0]); // to be improved (hardwired 2nd in the name) | |
5402 | fCommonHistsResults4th->FillIntegratedFlow(v[1],vError[1]); // to be improved (hardwired 4th in the name) | |
403e3389 | 5403 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) // to be improved (calculate also 6th and 8th order) |
489d5531 | 5404 | { |
0dd3b008 | 5405 | fCommonHistsResults6th->FillIntegratedFlow(v[2],vError[2]); // to be improved (hardwired 6th in the name) |
5406 | fCommonHistsResults8th->FillIntegratedFlow(v[3],vError[3]); // to be improved (hardwired 8th in the name) | |
489d5531 | 5407 | } |
5408 | ||
5409 | } // end of AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow() | |
5410 | ||
489d5531 | 5411 | //================================================================================================================================ |
5412 | ||
489d5531 | 5413 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelationsUsingParticleWeights() |
5414 | { | |
5415 | // Calculate all correlations needed for integrated flow using particle weights. | |
5416 | ||
5417 | // Remark 1: When particle weights are used the binning of fIntFlowCorrelationAllPro is organized as follows: | |
5418 | // | |
5419 | // 1st bin: <2>_{1n|1n} = two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))> | |
5420 | // 2nd bin: <2>_{2n|2n} = two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
5421 | // 3rd bin: <2>_{3n|3n} = two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
5422 | // 4th bin: <2>_{4n|4n} = two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
5423 | // 5th bin: ---- EMPTY ---- | |
5424 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
5425 | // 7th bin: <3>_{3n|2n,1n} = ... | |
5426 | // 8th bin: <3>_{4n|2n,2n} = ... | |
5427 | // 9th bin: <3>_{4n|3n,1n} = ... | |
5428 | // 10th bin: ---- EMPTY ---- | |
5429 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
5430 | // 12th bin: <4>_{2n,1n|2n,1n} = ... | |
5431 | // 13th bin: <4>_{2n,2n|2n,2n} = ... | |
5432 | // 14th bin: <4>_{3n|1n,1n,1n} = ... | |
5433 | // 15th bin: <4>_{3n,1n|3n,1n} = ... | |
5434 | // 16th bin: <4>_{3n,1n|2n,2n} = ... | |
5435 | // 17th bin: <4>_{4n|2n,1n,1n} = ... | |
5436 | // 18th bin: ---- EMPTY ---- | |
5437 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = ... | |
5438 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = ... | |
5439 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = ... | |
5440 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = ... | |
5441 | // 23rd bin: ---- EMPTY ---- | |
5442 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = ... | |
5443 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = ... | |
5444 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = ... | |
5445 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = ... | |
5446 | // 28th bin: ---- EMPTY ---- | |
5447 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = ... | |
5448 | // 30th bin: ---- EMPTY ---- | |
5449 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = ... | |
5450 | ||
5451 | // Remark 2: When particle weights are used there are some extra correlations. They are stored in | |
5452 | // fIntFlowExtraCorrelationsPro binning of which is organized as follows: | |
5453 | ||
5454 | // 1st bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))> | |
5455 | // 2nd bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
5456 | ||
5457 | // multiplicity (number of particles used to determine the reaction plane) | |
1268c371 | 5458 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 5459 | |
5460 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
5461 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
5462 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
5463 | Double_t dReQ3n3k = (*fReQ)(2,3); | |
5464 | Double_t dReQ4n4k = (*fReQ)(3,4); | |
5465 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
5466 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
5467 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
5468 | Double_t dImQ3n3k = (*fImQ)(2,3); | |
5469 | Double_t dImQ4n4k = (*fImQ)(3,4); | |
5470 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
5471 | ||
5472 | // dMs are variables introduced in order to simplify some Eqs. bellow: | |
5473 | //.............................................................................................. | |
1268c371 | 5474 | Double_t dM11 = (*fSpk)(1,1)-(*fSpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
5475 | Double_t dM22 = (*fSpk)(1,2)-(*fSpk)(0,4); // dM22 = sum_{i,j=1,i!=j}^M w_i^2 w_j^2 | |
5476 | Double_t dM33 = (*fSpk)(1,3)-(*fSpk)(0,6); // dM33 = sum_{i,j=1,i!=j}^M w_i^3 w_j^3 | |
5477 | Double_t dM44 = (*fSpk)(1,4)-(*fSpk)(0,8); // dM44 = sum_{i,j=1,i!=j}^M w_i^4 w_j^4 | |
5478 | Double_t dM31 = (*fSpk)(0,3)*(*fSpk)(0,1)-(*fSpk)(0,4); // dM31 = sum_{i,j=1,i!=j}^M w_i^3 w_j | |
5479 | Double_t dM211 = (*fSpk)(0,2)*(*fSpk)(1,1)-2.*(*fSpk)(0,3)*(*fSpk)(0,1) | |
5480 | - (*fSpk)(1,2)+2.*(*fSpk)(0,4); // dM211 = sum_{i,j,k=1,i!=j!=k}^M w_i^2 w_j w_k | |
5481 | Double_t dM1111 = (*fSpk)(3,1)-6.*(*fSpk)(0,2)*(*fSpk)(1,1) | |
5482 | + 8.*(*fSpk)(0,3)*(*fSpk)(0,1) | |
5483 | + 3.*(*fSpk)(1,2)-6.*(*fSpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l | |
489d5531 | 5484 | //.............................................................................................. |
5485 | ||
5486 | // 2-particle correlations: | |
5487 | Double_t two1n1nW1W1 = 0.; // <w1 w2 cos(n*(phi1-phi2))> | |
5488 | Double_t two2n2nW2W2 = 0.; // <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
5489 | Double_t two3n3nW3W3 = 0.; // <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
5490 | Double_t two4n4nW4W4 = 0.; // <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
5491 | if(dMult>1) | |
5492 | { | |
5493 | if(dM11) | |
5494 | { | |
1268c371 | 5495 | two1n1nW1W1 = (pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSpk)(0,2))/dM11; |
489d5531 | 5496 | // average correlation <w1 w2 cos(n*(phi1-phi2))> for single event: |
5497 | fIntFlowCorrelationsEBE->SetBinContent(1,two1n1nW1W1); | |
5498 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(1,dM11); | |
5499 | // average correlation <w1 w2 cos(n*(phi1-phi2))> for all events: | |
b40a910e | 5500 | fIntFlowCorrelationsPro->Fill(0.5,two1n1nW1W1,dM11); |
5501 | // average squared correlation <w1 w2 cos(n*(phi1-phi2))> for all events: | |
5502 | fIntFlowSquaredCorrelationsPro->Fill(0.5,two1n1nW1W1*two1n1nW1W1,dM11); | |
489d5531 | 5503 | fIntFlowCorrelationsAllPro->Fill(0.5,two1n1nW1W1,dM11); |
5504 | } | |
5505 | if(dM22) | |
5506 | { | |
1268c371 | 5507 | two2n2nW2W2 = (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)-(*fSpk)(0,4))/dM22; |
489d5531 | 5508 | // ... |
5509 | // average correlation <w1^2 w2^2 cos(2n*(phi1-phi2))> for all events: | |
5510 | fIntFlowCorrelationsAllPro->Fill(1.5,two2n2nW2W2,dM22); | |
5511 | } | |
5512 | if(dM33) | |
5513 | { | |
1268c371 | 5514 | two3n3nW3W3 = (pow(dReQ3n3k,2)+pow(dImQ3n3k,2)-(*fSpk)(0,6))/dM33; |
489d5531 | 5515 | // ... |
5516 | // average correlation <w1^3 w2^3 cos(3n*(phi1-phi2))> for all events: | |
5517 | fIntFlowCorrelationsAllPro->Fill(2.5,two3n3nW3W3,dM33); | |
5518 | } | |
5519 | if(dM44) | |
5520 | { | |
1268c371 | 5521 | two4n4nW4W4 = (pow(dReQ4n4k,2)+pow(dImQ4n4k,2)-(*fSpk)(0,8))/dM44; |
489d5531 | 5522 | // ... |
5523 | // average correlation <w1^4 w2^4 cos(4n*(phi1-phi2))> for all events: | |
5524 | fIntFlowCorrelationsAllPro->Fill(3.5,two4n4nW4W4,dM44); | |
5525 | } | |
5526 | } // end of if(dMult>1) | |
5527 | ||
5528 | // extra 2-particle correlations: | |
5529 | Double_t two1n1nW3W1 = 0.; // <w1^3 w2 cos(n*(phi1-phi2))> | |
5530 | Double_t two1n1nW1W1W2 = 0.; // <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
5531 | if(dMult>1) | |
5532 | { | |
5533 | if(dM31) | |
5534 | { | |
1268c371 | 5535 | two1n1nW3W1 = (dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k-(*fSpk)(0,4))/dM31; |
489d5531 | 5536 | fIntFlowExtraCorrelationsPro->Fill(0.5,two1n1nW3W1,dM31); |
5537 | } | |
5538 | if(dM211) | |
5539 | { | |
1268c371 | 5540 | two1n1nW1W1W2 = ((*fSpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSpk)(0,2)) |
489d5531 | 5541 | - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k |
1268c371 | 5542 | - (*fSpk)(0,4)))/dM211; |
489d5531 | 5543 | fIntFlowExtraCorrelationsPro->Fill(1.5,two1n1nW1W1W2,dM211); |
5544 | } | |
5545 | } // end of if(dMult>1) | |
5546 | //.............................................................................................. | |
5547 | ||
5548 | //.............................................................................................. | |
5549 | // 3-particle correlations: | |
5550 | Double_t three2n1n1nW2W1W1 = 0.; // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
5551 | ||
5552 | if(dMult>2) | |
5553 | { | |
5554 | if(dM211) | |
5555 | { | |
5556 | three2n1n1nW2W1W1 = (pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k | |
5557 | - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k) | |
5558 | - pow(dReQ2n2k,2)-pow(dImQ2n2k,2) | |
1268c371 | 5559 | + 2.*(*fSpk)(0,4))/dM211; |
489d5531 | 5560 | fIntFlowCorrelationsAllPro->Fill(5.5,three2n1n1nW2W1W1,dM211); |
5561 | } | |
5562 | } // end of if(dMult>2) | |
5563 | //.............................................................................................. | |
5564 | ||
5565 | //.............................................................................................. | |
5566 | // 4-particle correlations: | |
5567 | Double_t four1n1n1n1nW1W1W1W1 = 0.; // <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
5568 | if(dMult>3) | |
5569 | { | |
5570 | if(dM1111) | |
5571 | { | |
5572 | four1n1n1n1nW1W1W1W1 = (pow(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.),2) | |
5573 | - 2.*(pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k) | |
5574 | + 8.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k) | |
5575 | + (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)) | |
1268c371 | 5576 | - 4.*(*fSpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
5577 | - 6.*(*fSpk)(0,4)+2.*(*fSpk)(1,2))/dM1111; | |
489d5531 | 5578 | |
5579 | // average correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for single event: | |
5580 | fIntFlowCorrelationsEBE->SetBinContent(2,four1n1n1n1nW1W1W1W1); | |
5581 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(2,dM1111); | |
5582 | // average correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for all events: | |
5583 | fIntFlowCorrelationsPro->Fill(1.5,four1n1n1n1nW1W1W1W1,dM1111); | |
b40a910e | 5584 | // average squared correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for all events: |
5585 | fIntFlowSquaredCorrelationsPro->Fill(1.5,four1n1n1n1nW1W1W1W1*four1n1n1n1nW1W1W1W1,dM1111); | |
489d5531 | 5586 | fIntFlowCorrelationsAllPro->Fill(10.5,four1n1n1n1nW1W1W1W1,dM1111); |
5587 | } | |
5588 | } // end of if(dMult>3) | |
5589 | //.............................................................................................. | |
5590 | ||
5591 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelationsUsingParticleWeights() | |
5592 | ||
489d5531 | 5593 | //================================================================================================================================ |
5594 | ||
489d5531 | 5595 | void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow() |
5596 | { | |
5597 | // Initialize all arrays used to calculate integrated flow. | |
5598 | ||
5599 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
5600 | { | |
5601 | fIntFlowCorrectionTermsForNUAEBE[sc] = NULL; | |
0328db2d | 5602 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc] = NULL; |
489d5531 | 5603 | fIntFlowCorrectionTermsForNUAPro[sc] = NULL; |
5604 | fIntFlowCorrectionTermsForNUAHist[sc] = NULL; | |
b92ea2b9 | 5605 | for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) |
2001bc3a | 5606 | { |
5607 | fIntFlowCorrectionTermsForNUAVsMPro[sc][ci] = NULL; | |
5608 | } | |
0328db2d | 5609 | for(Int_t power=0;power<2;power++) // linear or quadratic |
5610 | { | |
5611 | fIntFlowSumOfEventWeightsNUA[sc][power] = NULL; | |
5612 | } | |
489d5531 | 5613 | } |
5614 | for(Int_t power=0;power<2;power++) // linear or quadratic | |
5615 | { | |
5616 | fIntFlowSumOfEventWeights[power] = NULL; | |
5617 | } | |
b3dacf6b | 5618 | for(Int_t i=0;i<4;i++) // print on the screen the final results (0=RF, 1=RP, 2=POI, 3=RF (rebbined in M)) |
489d5531 | 5619 | { |
5620 | fPrintFinalResults[i] = kTRUE; | |
5621 | } | |
ff70ca91 | 5622 | for(Int_t ci=0;ci<4;ci++) // correlation index or cumulant order |
5623 | { | |
5624 | fIntFlowCorrelationsVsMPro[ci] = NULL; | |
b40a910e | 5625 | fIntFlowSquaredCorrelationsVsMPro[ci] = NULL; |
ff70ca91 | 5626 | fIntFlowCorrelationsVsMHist[ci] = NULL; |
5627 | fIntFlowQcumulantsVsM[ci] = NULL; | |
5628 | fIntFlowVsM[ci] = NULL; | |
2001bc3a | 5629 | fIntFlowDetectorBiasVsM[ci] = NULL; |
ff70ca91 | 5630 | for(Int_t lc=0;lc<2;lc++) |
5631 | { | |
5632 | fIntFlowSumOfEventWeightsVsM[ci][lc] = NULL; | |
5633 | } | |
5634 | } | |
5635 | for(Int_t pi=0;pi<6;pi++) // product or covariance index | |
5636 | { | |
5637 | fIntFlowProductOfCorrelationsVsMPro[pi] = NULL; | |
5638 | fIntFlowCovariancesVsM[pi] = NULL; | |
5639 | fIntFlowSumOfProductOfEventWeightsVsM[pi] = NULL; | |
5640 | } | |
403e3389 | 5641 | for(Int_t ci=0;ci<64;ci++) // correlation index for all correlations vs M profiles (to be improved - hardwired 64) |
3435cacb | 5642 | { |
5643 | fIntFlowCorrelationsAllVsMPro[ci] = NULL; | |
5644 | } | |
5645 | ||
489d5531 | 5646 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow() |
5647 | ||
489d5531 | 5648 | //================================================================================================================================ |
5649 | ||
489d5531 | 5650 | void AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow() |
5651 | { | |
5652 | // Initialize all arrays needed to calculate differential flow. | |
5653 | // a) Initialize lists holding profiles; | |
5654 | // b) Initialize lists holding histograms; | |
5655 | // c) Initialize event-by-event quantities; | |
5656 | // d) Initialize profiles; | |
5657 | // e) Initialize histograms holding final results. | |
5658 | ||
5659 | // a) Initialize lists holding profiles; | |
5660 | for(Int_t t=0;t<2;t++) // type (RP, POI) | |
5661 | { | |
5662 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5663 | { | |
5664 | fDiffFlowCorrelationsProList[t][pe] = NULL; | |
5665 | fDiffFlowProductOfCorrelationsProList[t][pe] = NULL; | |
5666 | fDiffFlowCorrectionsProList[t][pe] = NULL; | |
5667 | } | |
1268c371 | 5668 | // 2D: |
5669 | f2DDiffFlowCorrelationsProList[t] = NULL; | |
489d5531 | 5670 | } |
5671 | ||
5672 | // b) Initialize lists holding histograms; | |
5673 | for(Int_t t=0;t<2;t++) // type (RP, POI) | |
5674 | { | |
5675 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5676 | { | |
5677 | fDiffFlowCorrelationsHistList[t][pe] = NULL; | |
5678 | for(Int_t power=0;power<2;power++) | |
5679 | { | |
5680 | fDiffFlowSumOfEventWeightsHistList[t][pe][power] = NULL; | |
5681 | } // end of for(Int_t power=0;power<2;power++) | |
5682 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe] = NULL; | |
5683 | fDiffFlowCorrectionsHistList[t][pe] = NULL; | |
5684 | fDiffFlowCovariancesHistList[t][pe] = NULL; | |
5685 | fDiffFlowCumulantsHistList[t][pe] = NULL; | |
1268c371 | 5686 | fDiffFlowDetectorBiasHistList[t][pe] = NULL; |
489d5531 | 5687 | fDiffFlowHistList[t][pe] = NULL; |
5688 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5689 | } // enf of for(Int_t t=0;t<2;t++) // type (RP, POI) | |
5690 | ||
5691 | // c) Initialize event-by-event quantities: | |
5692 | // 1D: | |
5693 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
5694 | { | |
5695 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5696 | { | |
5697 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
5698 | { | |
5699 | for(Int_t k=0;k<9;k++) // power of weight | |
5700 | { | |
5701 | fReRPQ1dEBE[t][pe][m][k] = NULL; | |
5702 | fImRPQ1dEBE[t][pe][m][k] = NULL; | |
5703 | fs1dEBE[t][pe][k] = NULL; // to be improved (this doesn't need to be within loop over m) | |
5704 | } | |
5705 | } | |
5706 | } | |
5707 | } | |
5708 | // 1D: | |
5709 | for(Int_t t=0;t<2;t++) // type (RP or POI) | |
5710 | { | |
5711 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5712 | { | |
5713 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
5714 | { | |
5715 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
5716 | { | |
5717 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti] = NULL; | |
5718 | } | |
5719 | } | |
5720 | } | |
5721 | } | |
5722 | // 2D: | |
5723 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
5724 | { | |
5725 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
5726 | { | |
5727 | for(Int_t k=0;k<9;k++) // power of weight | |
5728 | { | |
5729 | fReRPQ2dEBE[t][m][k] = NULL; | |
5730 | fImRPQ2dEBE[t][m][k] = NULL; | |
5731 | fs2dEBE[t][k] = NULL; // to be improved (this doesn't need to be within loop over m) | |
5732 | } | |
5733 | } | |
5734 | } | |
5735 | ||
5736 | // d) Initialize profiles: | |
5737 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
5738 | { | |
5739 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5740 | { | |
5741 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
5742 | { | |
5743 | fDiffFlowCorrelationsPro[t][pe][ci] = NULL; | |
b40a910e | 5744 | fDiffFlowSquaredCorrelationsPro[t][pe][ci] = NULL; |
489d5531 | 5745 | } // end of for(Int_t ci=0;ci<4;ci++) |
5746 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
5747 | { | |
5748 | for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index | |
5749 | { | |
5750 | fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = NULL; | |
5751 | } // end of for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index | |
5752 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
5753 | // correction terms for nua: | |
5754 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
5755 | { | |
5756 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
5757 | { | |
5758 | fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = NULL; | |
5759 | } | |
5760 | } | |
64e500e3 | 5761 | // other differential correlators: |
5762 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
5763 | { | |
5764 | for(Int_t ci=0;ci<1;ci++) // correction term index | |
5765 | { | |
5766 | fOtherDiffCorrelators[t][pe][sc][ci] = NULL; | |
5767 | } | |
5768 | } | |
489d5531 | 5769 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta |
1268c371 | 5770 | for(Int_t ci=0;ci<4;ci++) // correlation index |
5771 | { | |
5772 | f2DDiffFlowCorrelationsPro[t][ci] = NULL; | |
5773 | } | |
489d5531 | 5774 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI |
5775 | ||
5776 | // e) Initialize histograms holding final results. | |
5777 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
5778 | { | |
5779 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5780 | { | |
5781 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
5782 | { | |
5783 | fDiffFlowCorrelationsHist[t][pe][ci] = NULL; | |
5784 | fDiffFlowCumulants[t][pe][ci] = NULL; | |
1268c371 | 5785 | fDiffFlowDetectorBias[t][pe][ci] = NULL; |
489d5531 | 5786 | fDiffFlow[t][pe][ci] = NULL; |
5787 | } // end of for(Int_t ci=0;ci<4;ci++) | |
5788 | for(Int_t covarianceIndex=0;covarianceIndex<5;covarianceIndex++) | |
5789 | { | |
5790 | fDiffFlowCovariances[t][pe][covarianceIndex] = NULL; | |
5791 | } // end of for(Int_t covarianceIndex=0;covarianceIndex<5;covarianceIndex++) | |
5792 | // correction terms for nua: | |
5793 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
5794 | { | |
5795 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
5796 | { | |
5797 | fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = NULL; | |
5798 | } | |
5799 | } | |
5800 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
1268c371 | 5801 | for(Int_t ci=0;ci<4;ci++) // correlation index |
5802 | { | |
5803 | f2DDiffFlowCumulants[t][ci] = NULL; | |
5804 | f2DDiffFlow[t][ci] = NULL; | |
5805 | } | |
489d5531 | 5806 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI |
5807 | ||
5808 | // sum of event weights for reduced correlations: | |
5809 | for(Int_t t=0;t<2;t++) // type = RP or POI | |
5810 | { | |
5811 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5812 | { | |
5813 | for(Int_t p=0;p<2;p++) // power of weight is 1 or 2 | |
5814 | { | |
5815 | for(Int_t ew=0;ew<4;ew++) // event weight index for reduced correlations | |
5816 | { | |
5817 | fDiffFlowSumOfEventWeights[t][pe][p][ew] = NULL; | |
5818 | } | |
5819 | } | |
5820 | } | |
5821 | } | |
5822 | // product of event weights for both types of correlations: | |
5823 | for(Int_t t=0;t<2;t++) // type = RP or POI | |
5824 | { | |
5825 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5826 | { | |
5827 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
5828 | { | |
5829 | for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index | |
5830 | { | |
5831 | fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = NULL; | |
5832 | } | |
5833 | } | |
5834 | } | |
5835 | } | |
1268c371 | 5836 | |
5837 | } // end of AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow() | |
5838 | ||
5839 | //================================================================================================================================ | |
489d5531 | 5840 | |
1268c371 | 5841 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulants(TString type, TString ptOrEta) |
5842 | { | |
5843 | // Calculate differential flow cumulants from measured multiparticle correlations. | |
489d5531 | 5844 | |
1268c371 | 5845 | // REMARK: Cumulants calculated in this method are NOT corrected for non-uniform acceptance. |
5846 | // This correction, if enabled via setter SetApplyCorrectionForNUA(Bool_t), is applied | |
5847 | // in the method CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta) | |
489d5531 | 5848 | |
1268c371 | 5849 | Int_t t = 0; |
5850 | Int_t pe = 0; | |
5851 | ||
5852 | if(type == "RP") | |
5853 | { | |
5854 | t = 0; | |
5855 | } else if(type == "POI") | |
5856 | { | |
5857 | t = 1; | |
5858 | } | |
5859 | ||
5860 | if(ptOrEta == "Pt") | |
5861 | { | |
5862 | pe = 0; | |
5863 | } else if(ptOrEta == "Eta") | |
5864 | { | |
5865 | pe = 1; | |
5866 | } | |
5867 | ||
5868 | // Common: | |
5869 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
489d5531 | 5870 | |
1268c371 | 5871 | // Correlation <<2>>: |
5872 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); | |
5873 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); | |
489d5531 | 5874 | |
1268c371 | 5875 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) |
489d5531 | 5876 | { |
1268c371 | 5877 | // Reduced correlations: |
5878 | Double_t twoPrime = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); // <<2'>> | |
5879 | Double_t twoPrimeError = fDiffFlowCorrelationsHist[t][pe][0]->GetBinError(b); // stat. error of <<2'>> | |
5880 | Double_t fourPrime = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); // <<4'>> | |
5881 | Double_t fourPrimeError = fDiffFlowCorrelationsHist[t][pe][1]->GetBinError(b); // stat. error of <<4'>> | |
5882 | // Covariances: | |
5883 | Double_t wCovTwoTwoReduced = fDiffFlowCovariances[t][pe][0]->GetBinContent(b); // Cov(<2>,<2'>) * prefactor(<2>,<2'>) | |
5884 | Double_t wCovTwoFourReduced = fDiffFlowCovariances[t][pe][1]->GetBinContent(b); // Cov(<2>,<4'>) * prefactor(<2>,<4'>) | |
5885 | Double_t wCovTwoReducedFourReduced = fDiffFlowCovariances[t][pe][4]->GetBinContent(b); // Cov(<2'>,<4'>) * prefactor(<2'>,<4'>) | |
5886 | // QC{2'}: | |
5887 | Double_t qc2Prime = twoPrime; // QC{2'} | |
5888 | Double_t qc2PrimeError = twoPrimeError; // stat. error of QC{2'} | |
5889 | fDiffFlowCumulants[t][pe][0]->SetBinContent(b,qc2Prime); | |
5890 | fDiffFlowCumulants[t][pe][0]->SetBinError(b,qc2PrimeError); | |
5891 | // QC{4'}: | |
5892 | Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>> | |
5893 | Double_t qc4PrimeError = 0.; // stat. error of QC{4'} | |
5894 | Double_t qc4PrimeErrorSquared = 4.*pow(twoPrime,2.)*pow(twoError,2.) | |
5895 | + 4.*pow(two,2.)*pow(twoPrimeError,2.) | |
5896 | + pow(fourPrimeError,2.) | |
5897 | + 8.*two*twoPrime*wCovTwoTwoReduced | |
5898 | - 4.*twoPrime*wCovTwoFourReduced | |
5899 | - 4.*two*wCovTwoReducedFourReduced; | |
5900 | if(qc4PrimeErrorSquared>0.) | |
5901 | { | |
5902 | qc4PrimeError = pow(qc4PrimeErrorSquared,0.5); | |
489d5531 | 5903 | } |
1268c371 | 5904 | fDiffFlowCumulants[t][pe][1]->SetBinContent(b,qc4Prime); |
5905 | fDiffFlowCumulants[t][pe][1]->SetBinError(b,qc4PrimeError); | |
489d5531 | 5906 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
489d5531 | 5907 | |
1268c371 | 5908 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulants(TString type, Bool_t useParticleWeights, TString eventWeights); |
489d5531 | 5909 | |
5910 | //================================================================================================================================ | |
5911 | ||
1268c371 | 5912 | void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCumulants(TString type) |
489d5531 | 5913 | { |
1268c371 | 5914 | // Calculate 2D differential cumulants. |
489d5531 | 5915 | |
1268c371 | 5916 | // Remark: correction for detector effects and error propagation not implemented yet for 2D differential cumulants. |
489d5531 | 5917 | |
1268c371 | 5918 | Int_t t = 0; |
489d5531 | 5919 | |
5920 | if(type == "RP") | |
5921 | { | |
1268c371 | 5922 | t = 0; |
489d5531 | 5923 | } else if(type == "POI") |
5924 | { | |
1268c371 | 5925 | t = 1; |
5926 | } | |
5927 | ||
5928 | // Reference correlation <<2>>: | |
5929 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); | |
489d5531 | 5930 | |
1268c371 | 5931 | // Looping over all (pt,eta) bins and calculating differential flow cumulants: |
5932 | for(Int_t p=1;p<=fnBinsPt;p++) | |
489d5531 | 5933 | { |
5934 | for(Int_t e=1;e<=fnBinsEta;e++) | |
5935 | { | |
1268c371 | 5936 | // Reduced correlations: |
5937 | Double_t twoPrime = f2DDiffFlowCorrelationsPro[t][0]->GetBinContent(f2DDiffFlowCorrelationsPro[t][0]->GetBin(p,e)); // <<2'>>(pt,eta) | |
5938 | Double_t fourPrime = f2DDiffFlowCorrelationsPro[t][1]->GetBinContent(f2DDiffFlowCorrelationsPro[t][1]->GetBin(p,e)); // <<4'>>(pt,eta) | |
5939 | // Cumulants: | |
5940 | Double_t qc2Prime = twoPrime; // QC{2'} = <<2'>> | |
5941 | f2DDiffFlowCumulants[t][0]->SetBinContent(f2DDiffFlowCumulants[t][0]->GetBin(p,e),qc2Prime); | |
5942 | Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>> | |
5943 | f2DDiffFlowCumulants[t][1]->SetBinContent(f2DDiffFlowCumulants[t][1]->GetBin(p,e),qc4Prime); | |
489d5531 | 5944 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) |
489d5531 | 5945 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
5946 | ||
1268c371 | 5947 | } // end of void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCumulants(TString type) |
489d5531 | 5948 | |
489d5531 | 5949 | //================================================================================================================================ |
5950 | ||
489d5531 | 5951 | void AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type) |
5952 | { | |
1268c371 | 5953 | // Calculate final results for integrated flow of RPs and POIs. |
489d5531 | 5954 | |
1268c371 | 5955 | // to be improved - check if the integrated flow calculation here is actually correct |
5956 | ||
5957 | Int_t t = 0; // RP = 0, POI = 1 | |
489d5531 | 5958 | |
5959 | if(type == "RP") | |
5960 | { | |
1268c371 | 5961 | t = 0; |
489d5531 | 5962 | } else if(type == "POI") |
5963 | { | |
1268c371 | 5964 | t = 1; |
5965 | } | |
489d5531 | 5966 | |
489d5531 | 5967 | // pt yield: |
5968 | TH1F *yield2ndPt = NULL; | |
5969 | TH1F *yield4thPt = NULL; | |
5970 | TH1F *yield6thPt = NULL; | |
5971 | TH1F *yield8thPt = NULL; | |
5972 | ||
5973 | if(type == "POI") | |
5974 | { | |
dd442cd2 | 5975 | if(fFillMultipleControlHistograms) |
5976 | { | |
5977 | yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtPOI())->Clone(); | |
5978 | yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtPOI())->Clone(); | |
5979 | yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtPOI())->Clone(); | |
5980 | yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtPOI())->Clone(); | |
5981 | } else | |
5982 | { | |
5983 | yield2ndPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
5984 | yield4thPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
5985 | yield6thPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
5986 | yield8thPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
5987 | } | |
489d5531 | 5988 | } |
5989 | else if(type == "RP") | |
5990 | { | |
dd442cd2 | 5991 | if(fFillMultipleControlHistograms) |
5992 | { | |
5993 | yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtRP())->Clone(); | |
5994 | yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtRP())->Clone(); | |
5995 | yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtRP())->Clone(); | |
5996 | yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtRP())->Clone(); | |
5997 | } else | |
5998 | { | |
5999 | yield2ndPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
6000 | yield4thPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
6001 | yield6thPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
6002 | yield8thPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
6003 | } | |
489d5531 | 6004 | } |
6005 | ||
0d11c335 | 6006 | if(!yield2ndPt){return;} |
6007 | if(!yield4thPt){return;} | |
6008 | if(!yield6thPt){return;} | |
6009 | if(!yield8thPt){return;} | |
6010 | ||
489d5531 | 6011 | Int_t nBinsPt = yield2ndPt->GetNbinsX(); |
6012 | ||
6013 | TH1D *flow2ndPt = NULL; | |
6014 | TH1D *flow4thPt = NULL; | |
6015 | TH1D *flow6thPt = NULL; | |
6016 | TH1D *flow8thPt = NULL; | |
6017 | ||
6018 | // to be improved (hardwired pt index) | |
6019 | flow2ndPt = (TH1D*)fDiffFlow[t][0][0]->Clone(); | |
6020 | flow4thPt = (TH1D*)fDiffFlow[t][0][1]->Clone(); | |
6021 | flow6thPt = (TH1D*)fDiffFlow[t][0][2]->Clone(); | |
6022 | flow8thPt = (TH1D*)fDiffFlow[t][0][3]->Clone(); | |
0d11c335 | 6023 | |
6024 | if(!flow2ndPt){return;} | |
6025 | if(!flow4thPt){return;} | |
6026 | if(!flow6thPt){return;} | |
6027 | if(!flow8thPt){return;} | |
489d5531 | 6028 | |
6029 | Double_t dvn2nd = 0., dvn4th = 0., dvn6th = 0., dvn8th = 0.; // differential flow | |
6030 | Double_t dErrvn2nd = 0., dErrvn4th = 0., dErrvn6th = 0., dErrvn8th = 0.; // error on differential flow | |
6031 | ||
6032 | Double_t dVn2nd = 0., dVn4th = 0., dVn6th = 0., dVn8th = 0.; // integrated flow | |
6033 | Double_t dErrVn2nd = 0., dErrVn4th = 0., dErrVn6th = 0., dErrVn8th = 0.; // error on integrated flow | |
6034 | ||
6035 | Double_t dYield2nd = 0., dYield4th = 0., dYield6th = 0., dYield8th = 0.; // pt yield | |
6036 | Double_t dSum2nd = 0., dSum4th = 0., dSum6th = 0., dSum8th = 0.; // needed for normalizing integrated flow | |
6037 | ||
6038 | // looping over pt bins: | |
6039 | for(Int_t p=1;p<nBinsPt+1;p++) | |
6040 | { | |
6041 | dvn2nd = flow2ndPt->GetBinContent(p); | |
6042 | dvn4th = flow4thPt->GetBinContent(p); | |
6043 | dvn6th = flow6thPt->GetBinContent(p); | |
6044 | dvn8th = flow8thPt->GetBinContent(p); | |
6045 | ||
6046 | dErrvn2nd = flow2ndPt->GetBinError(p); | |
6047 | dErrvn4th = flow4thPt->GetBinError(p); | |
6048 | dErrvn6th = flow6thPt->GetBinError(p); | |
6049 | dErrvn8th = flow8thPt->GetBinError(p); | |
6050 | ||
6051 | dYield2nd = yield2ndPt->GetBinContent(p); | |
6052 | dYield4th = yield4thPt->GetBinContent(p); | |
6053 | dYield6th = yield6thPt->GetBinContent(p); | |
6054 | dYield8th = yield8thPt->GetBinContent(p); | |
6055 | ||
6056 | dVn2nd += dvn2nd*dYield2nd; | |
6057 | dVn4th += dvn4th*dYield4th; | |
6058 | dVn6th += dvn6th*dYield6th; | |
6059 | dVn8th += dvn8th*dYield8th; | |
6060 | ||
6061 | dSum2nd += dYield2nd; | |
6062 | dSum4th += dYield4th; | |
6063 | dSum6th += dYield6th; | |
6064 | dSum8th += dYield8th; | |
6065 | ||
6066 | dErrVn2nd += dYield2nd*dYield2nd*dErrvn2nd*dErrvn2nd; // ro be improved (check this relation) | |
6067 | dErrVn4th += dYield4th*dYield4th*dErrvn4th*dErrvn4th; | |
6068 | dErrVn6th += dYield6th*dYield6th*dErrvn6th*dErrvn6th; | |
6069 | dErrVn8th += dYield8th*dYield8th*dErrvn8th*dErrvn8th; | |
6070 | ||
6071 | } // end of for(Int_t p=1;p<nBinsPt+1;p++) | |
6072 | ||
6073 | // normalizing the results for integrated flow: | |
6074 | if(dSum2nd) | |
6075 | { | |
6076 | dVn2nd /= dSum2nd; | |
6077 | dErrVn2nd /= (dSum2nd*dSum2nd); | |
6078 | dErrVn2nd = TMath::Sqrt(dErrVn2nd); | |
6079 | } | |
6080 | if(dSum4th) | |
6081 | { | |
6082 | dVn4th /= dSum4th; | |
6083 | dErrVn4th /= (dSum4th*dSum4th); | |
6084 | dErrVn4th = TMath::Sqrt(dErrVn4th); | |
6085 | } | |
6086 | //if(dSum6th) dVn6th/=dSum6th; | |
6087 | //if(dSum8th) dVn8th/=dSum8th; | |
6088 | ||
6089 | // storing the results for integrated flow in common histos: (to be improved: new method for this?) | |
6090 | if(type == "POI") | |
6091 | { | |
6092 | fCommonHistsResults2nd->FillIntegratedFlowPOI(dVn2nd,dErrVn2nd); | |
6093 | fCommonHistsResults4th->FillIntegratedFlowPOI(dVn4th,dErrVn4th); | |
6094 | fCommonHistsResults6th->FillIntegratedFlowPOI(dVn6th,0.); // to be improved (errors) | |
6095 | fCommonHistsResults8th->FillIntegratedFlowPOI(dVn8th,0.); // to be improved (errors) | |
6096 | } | |
6097 | else if (type == "RP") | |
6098 | { | |
6099 | fCommonHistsResults2nd->FillIntegratedFlowRP(dVn2nd,dErrVn2nd); | |
6100 | fCommonHistsResults4th->FillIntegratedFlowRP(dVn4th,dErrVn4th); | |
6101 | fCommonHistsResults6th->FillIntegratedFlowRP(dVn6th,0.); // to be improved (errors) | |
6102 | fCommonHistsResults8th->FillIntegratedFlowRP(dVn8th,0.); // to be improved (errors) | |
6103 | } | |
6104 | ||
6105 | delete flow2ndPt; | |
6106 | delete flow4thPt; | |
6107 | //delete flow6thPt; | |
6108 | //delete flow8thPt; | |
6109 | ||
6110 | delete yield2ndPt; | |
6111 | delete yield4thPt; | |
6112 | delete yield6thPt; | |
6113 | delete yield8thPt; | |
6114 | ||
6115 | } // end of AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type) | |
6116 | ||
489d5531 | 6117 | //================================================================================================================================ |
6118 | ||
489d5531 | 6119 | void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions() |
6120 | { | |
6121 | // Initialize all arrays used for distributions. | |
6122 | ||
6123 | // a) Initialize arrays of histograms used to hold distributions of correlations; | |
6124 | // b) Initialize array to hold min and max values of correlations. | |
6125 | ||
6126 | // a) Initialize arrays of histograms used to hold distributions of correlations: | |
6127 | for(Int_t di=0;di<4;di++) // distribution index | |
6128 | { | |
6129 | fDistributions[di] = NULL; | |
6130 | } | |
6131 | ||
6132 | // b) Initialize default min and max values of correlations: | |
6133 | // (Remark: The default values bellow were chosen for v2=5% and M=500) | |
6134 | fMinValueOfCorrelation[0] = -0.01; // <2>_min | |
6135 | fMaxValueOfCorrelation[0] = 0.04; // <2>_max | |
6136 | fMinValueOfCorrelation[1] = -0.00002; // <4>_min | |
6137 | fMaxValueOfCorrelation[1] = 0.00015; // <4>_max | |
6138 | fMinValueOfCorrelation[2] = -0.0000003; // <6>_min | |
6139 | fMaxValueOfCorrelation[2] = 0.0000006; // <6>_max | |
6140 | fMinValueOfCorrelation[3] = -0.000000006; // <8>_min | |
6141 | fMaxValueOfCorrelation[3] = 0.000000003; // <8>_max | |
6142 | ||
6143 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions() | |
6144 | ||
489d5531 | 6145 | //================================================================================================================================ |
6146 | ||
e5834fcb | 6147 | void AliFlowAnalysisWithQCumulants::InitializeArraysForVarious() |
6148 | { | |
6149 | // Initialize all arrays used for various unclassified objects. | |
6150 | ||
6151 | for(Int_t p=0;p<4;p++) // [v_min,v_max,refMult_min,refMult_max] | |
6152 | { | |
6153 | fPhiDistributionForOneEventSettings[p] = 0.; | |
6154 | } | |
6155 | ||
6156 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForVarious() | |
6157 | ||
6158 | //================================================================================================================================ | |
489d5531 | 6159 | |
6160 | void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions() | |
6161 | { | |
6162 | // a) Book profile to hold all flags for distributions of correlations; | |
6163 | // b) Book all histograms to hold distributions of correlations. | |
6164 | ||
6165 | TString correlationIndex[4] = {"<2>","<4>","<6>","<8>"}; // to be improved (should I promote this to data members?) | |
6166 | ||
6167 | // a) Book profile to hold all flags for distributions of correlations: | |
6168 | TString distributionsFlagsName = "fDistributionsFlags"; | |
6169 | distributionsFlagsName += fAnalysisLabel->Data(); | |
6170 | fDistributionsFlags = new TProfile(distributionsFlagsName.Data(),"Flags for Distributions of Correlations",9,0,9); | |
6171 | fDistributionsFlags->SetTickLength(-0.01,"Y"); | |
6172 | fDistributionsFlags->SetMarkerStyle(25); | |
6173 | fDistributionsFlags->SetLabelSize(0.05); | |
6174 | fDistributionsFlags->SetLabelOffset(0.02,"Y"); | |
6175 | fDistributionsFlags->GetXaxis()->SetBinLabel(1,"Store or not?"); | |
6176 | fDistributionsFlags->GetXaxis()->SetBinLabel(2,"<2>_{min}"); | |
6177 | fDistributionsFlags->GetXaxis()->SetBinLabel(3,"<2>_{max}"); | |
6178 | fDistributionsFlags->GetXaxis()->SetBinLabel(4,"<4>_{min}"); | |
6179 | fDistributionsFlags->GetXaxis()->SetBinLabel(5,"<4>_{max}"); | |
6180 | fDistributionsFlags->GetXaxis()->SetBinLabel(6,"<6>_{min}"); | |
6181 | fDistributionsFlags->GetXaxis()->SetBinLabel(7,"<6>_{max}"); | |
6182 | fDistributionsFlags->GetXaxis()->SetBinLabel(8,"<8>_{min}"); | |
6183 | fDistributionsFlags->GetXaxis()->SetBinLabel(9,"<8>_{max}"); | |
6184 | fDistributionsList->Add(fDistributionsFlags); | |
6185 | ||
6186 | // b) Book all histograms to hold distributions of correlations. | |
6187 | if(fStoreDistributions) | |
6188 | { | |
6189 | TString distributionsName = "fDistributions"; | |
6190 | distributionsName += fAnalysisLabel->Data(); | |
6191 | for(Int_t di=0;di<4;di++) // distribution index | |
6192 | { | |
6193 | fDistributions[di] = new TH1D(Form("Distribution of %s",correlationIndex[di].Data()),Form("Distribution of %s",correlationIndex[di].Data()),10000,fMinValueOfCorrelation[di],fMaxValueOfCorrelation[di]); | |
6194 | fDistributions[di]->SetXTitle(correlationIndex[di].Data()); | |
6195 | fDistributionsList->Add(fDistributions[di]); | |
6196 | } // end of for(Int_t di=0;di<4;di++) // distribution index | |
6197 | } // end of if(fStoreDistributions) | |
6198 | ||
6199 | } // end of void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions() | |
6200 | ||
489d5531 | 6201 | //================================================================================================================================ |
6202 | ||
e5834fcb | 6203 | void AliFlowAnalysisWithQCumulants::BookEverythingForVarious() |
6204 | { | |
6205 | // Book all objects for various unclassified quantities. | |
6206 | ||
6207 | if(!fStorePhiDistributionForOneEvent){return;} | |
6208 | ||
6209 | // a) Book histogram holding phi distribution for single event to illustrate flow. | |
6210 | ||
6211 | // a) Book histogram holding phi distribution for single event to illustrate flow: | |
6212 | fPhiDistributionForOneEvent = new TH1D("fPhiDistributionForOneEvent","",360,0.,TMath::TwoPi()); | |
6213 | fPhiDistributionForOneEvent->GetXaxis()->SetTitle("#phi"); | |
6214 | fVariousList->Add(fPhiDistributionForOneEvent); | |
6215 | ||
6216 | } // end of void AliFlowAnalysisWithQCumulants::BookEverythingForVarious() | |
6217 | ||
6218 | //================================================================================================================================ | |
489d5531 | 6219 | |
6220 | void AliFlowAnalysisWithQCumulants::StoreFlagsForDistributions() | |
6221 | { | |
6222 | // Store all flags for distributiuons of correlations in profile fDistributionsFlags. | |
6223 | ||
6224 | if(!fDistributionsFlags) | |
6225 | { | |
6226 | cout<<"WARNING: fDistributionsFlags is NULL in AFAWQC::SDF() !!!!"<<endl; | |
6227 | exit(0); | |
6228 | } | |
6229 | ||
6230 | fDistributionsFlags->Fill(0.5,(Int_t)fStoreDistributions); // histos with distributions of correlations stored or not in the output file | |
6231 | // store min and max values of correlations: | |
6232 | for(Int_t di=0;di<4;di++) // distribution index | |
6233 | { | |
6234 | fDistributionsFlags->Fill(1.5+2.*(Double_t)di,fMinValueOfCorrelation[di]); | |
6235 | fDistributionsFlags->Fill(2.5+2.*(Double_t)di,fMaxValueOfCorrelation[di]); | |
6236 | } | |
6237 | ||
6238 | } // end of void AliFlowAnalysisWithQCumulants::StoreFlagsForDistributions() | |
6239 | ||
489d5531 | 6240 | //================================================================================================================================ |
6241 | ||
489d5531 | 6242 | void AliFlowAnalysisWithQCumulants::StoreDistributionsOfCorrelations() |
6243 | { | |
6244 | // Store distributions of correlations. | |
6245 | ||
6246 | if(!(fIntFlowCorrelationsEBE && fIntFlowEventWeightsForCorrelationsEBE)) | |
6247 | { | |
6248 | cout<<"WARNING: fIntFlowCorrelationsEBE && fIntFlowEventWeightsForCorrelationsEBE"<<endl; | |
6249 | cout<<" is NULL in AFAWQC::SDOC() !!!!"<<endl; | |
6250 | exit(0); | |
6251 | } | |
6252 | ||
6253 | for(Int_t di=0;di<4;di++) // distribution index | |
6254 | { | |
6255 | if(!fDistributions[di]) | |
6256 | { | |
6257 | cout<<"WARNING: fDistributions[di] is NULL in AFAWQC::SDOC() !!!!"<<endl; | |
6258 | cout<<"di = "<<di<<endl; | |
6259 | exit(0); | |
6260 | } else | |
6261 | { | |
6262 | fDistributions[di]->Fill(fIntFlowCorrelationsEBE->GetBinContent(di+1),fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(di+1)); | |
6263 | } | |
6264 | } // end of for(Int_t di=0;di<4;di++) // distribution index | |
6265 | ||
6266 | } // end of void AliFlowAnalysisWithQCumulants::StoreDistributionsOfCorrelations() | |
6267 | ||
489d5531 | 6268 | //================================================================================================================================ |
6269 | ||
489d5531 | 6270 | void AliFlowAnalysisWithQCumulants::BookAndNestAllLists() |
6271 | { | |
6272 | // Book and nest all lists nested in the base list fHistList. | |
6273 | // a) Book and nest lists for integrated flow; | |
6274 | // b) Book and nest lists for differential flow; | |
6275 | // c) Book and nest list for particle weights; | |
6276 | // d) Book and nest list for distributions; | |
e5834fcb | 6277 | // e) Book and nest list for various unclassified objects; |
6278 | // f) Book and nest list for nested loops. | |
489d5531 | 6279 | |
6280 | // a) Book and nest all lists for integrated flow: | |
1268c371 | 6281 | // Base list for integrated flow: |
489d5531 | 6282 | fIntFlowList = new TList(); |
6283 | fIntFlowList->SetName("Integrated Flow"); | |
6284 | fIntFlowList->SetOwner(kTRUE); | |
6285 | fHistList->Add(fIntFlowList); | |
1268c371 | 6286 | // List holding profiles: |
489d5531 | 6287 | fIntFlowProfiles = new TList(); |
6288 | fIntFlowProfiles->SetName("Profiles"); | |
6289 | fIntFlowProfiles->SetOwner(kTRUE); | |
6290 | fIntFlowList->Add(fIntFlowProfiles); | |
3435cacb | 6291 | // List holding all profiles with results for correlations vs M: |
6292 | if(fCalculateAllCorrelationsVsM) | |
6293 | { | |
6294 | fIntFlowAllCorrelationsVsM = new TList(); | |
6295 | fIntFlowAllCorrelationsVsM->SetName("Correlations vs M"); | |
6296 | fIntFlowAllCorrelationsVsM->SetOwner(kTRUE); | |
6297 | fIntFlowProfiles->Add(fIntFlowAllCorrelationsVsM); | |
6298 | } // end of if(fCalculateAllCorrelationsVsM) | |
1268c371 | 6299 | // List holding histograms with results: |
489d5531 | 6300 | fIntFlowResults = new TList(); |
6301 | fIntFlowResults->SetName("Results"); | |
6302 | fIntFlowResults->SetOwner(kTRUE); | |
6303 | fIntFlowList->Add(fIntFlowResults); | |
6304 | ||
1268c371 | 6305 | // b) Book and nest lists for differential flow: |
6306 | this->BookAndNestListsForDifferentialFlow(); | |
6307 | ||
6308 | // c) Book and nest list for particle weights: | |
6309 | fWeightsList->SetName("Weights"); | |
6310 | fWeightsList->SetOwner(kTRUE); | |
6311 | fHistList->Add(fWeightsList); | |
6312 | ||
6313 | // d) Book and nest list for distributions: | |
6314 | fDistributionsList = new TList(); | |
6315 | fDistributionsList->SetName("Distributions"); | |
6316 | fDistributionsList->SetOwner(kTRUE); | |
6317 | fHistList->Add(fDistributionsList); | |
6318 | ||
6319 | // e) Book and nest list for various unclassified objects: | |
6320 | if(fStorePhiDistributionForOneEvent) | |
6321 | { | |
6322 | fVariousList = new TList(); | |
6323 | fVariousList->SetName("Various"); | |
6324 | fVariousList->SetOwner(kTRUE); | |
6325 | fHistList->Add(fVariousList); | |
6326 | } | |
6327 | ||
64e500e3 | 6328 | // f) Book and nest list for other differential correlators: |
6329 | fOtherDiffCorrelatorsList = new TList(); | |
6330 | fOtherDiffCorrelatorsList->SetName("Other differential correlators"); | |
6331 | fOtherDiffCorrelatorsList->SetOwner(kTRUE); | |
62e36168 | 6332 | if(fCalculateDiffFlow){fHistList->Add(fOtherDiffCorrelatorsList);} // TBI: Use another flag here instead of fCalculateDiffFlow |
64e500e3 | 6333 | |
6334 | // g) Book and nest list for nested loops: | |
1268c371 | 6335 | fNestedLoopsList = new TList(); |
6336 | fNestedLoopsList->SetName("Nested Loops"); | |
6337 | fNestedLoopsList->SetOwner(kTRUE); | |
6338 | fHistList->Add(fNestedLoopsList); | |
6339 | ||
6340 | } // end of void AliFlowAnalysisWithQCumulants::BookAndNestAllLists() | |
6341 | ||
6342 | //================================================================================================================================ | |
6343 | ||
6344 | void AliFlowAnalysisWithQCumulants::BookAndNestListsForDifferentialFlow() | |
6345 | { | |
6346 | // Book and nest lists for differential flow. | |
6347 | ||
6348 | // Base list for differential flow objects: | |
489d5531 | 6349 | fDiffFlowList = new TList(); |
6350 | fDiffFlowList->SetName("Differential Flow"); | |
6351 | fDiffFlowList->SetOwner(kTRUE); | |
6352 | fHistList->Add(fDiffFlowList); | |
1268c371 | 6353 | |
6354 | // Local flags: | |
6355 | TString typeFlag[2] = {"RP","POI"}; | |
6356 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
6357 | TString powerFlag[2] = {"linear","quadratic"}; | |
6358 | ||
6359 | // 2D: | |
6360 | if(fCalculate2DDiffFlow) | |
6361 | { | |
6362 | fDiffFlow2D = new TList(); | |
6363 | fDiffFlow2D->SetName("2D"); | |
6364 | fDiffFlow2D->SetOwner(kTRUE); | |
6365 | fDiffFlowList->Add(fDiffFlow2D); | |
6366 | for(Int_t t=0;t<2;t++) | |
6367 | { | |
6368 | f2DDiffFlowCorrelationsProList[t] = new TList(); | |
6369 | f2DDiffFlowCorrelationsProList[t]->SetOwner(kTRUE); | |
6370 | f2DDiffFlowCorrelationsProList[t]->SetName(Form("Profiles with 2D correlations (%s)",typeFlag[t].Data())); | |
6371 | fDiffFlow2D->Add(f2DDiffFlowCorrelationsProList[t]); | |
6372 | } // end of for(Int_t t=0;t<2;t++) | |
6373 | } // end of if(fCalculate2DDiffFlow) | |
6374 | ||
6375 | // What follows bellow in this method is relevant only for 1D differential flow: | |
6376 | if(!fCalculateDiffFlow){return;} | |
6377 | ||
6378 | // List holding profiles: | |
489d5531 | 6379 | fDiffFlowProfiles = new TList(); |
6380 | fDiffFlowProfiles->SetName("Profiles"); | |
6381 | fDiffFlowProfiles->SetOwner(kTRUE); | |
6382 | fDiffFlowList->Add(fDiffFlowProfiles); | |
1268c371 | 6383 | // List holding histograms with results: |
489d5531 | 6384 | fDiffFlowResults = new TList(); |
6385 | fDiffFlowResults->SetName("Results"); | |
6386 | fDiffFlowResults->SetOwner(kTRUE); | |
6387 | fDiffFlowList->Add(fDiffFlowResults); | |
1268c371 | 6388 | // Flags used for naming nested lists in list fDiffFlowProfiles and fDiffFlowResults: |
489d5531 | 6389 | TList list; |
6390 | list.SetOwner(kTRUE); | |
1268c371 | 6391 | // Nested lists in fDiffFlowProfiles (~/Differential Flow/Profiles): |
489d5531 | 6392 | for(Int_t t=0;t<2;t++) // type: RP or POI |
6393 | { | |
62e36168 | 6394 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 6395 | { |
6396 | // list holding profiles with correlations: | |
6397 | fDiffFlowCorrelationsProList[t][pe] = (TList*)list.Clone(); | |
6398 | fDiffFlowCorrelationsProList[t][pe]->SetName(Form("Profiles with correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6399 | fDiffFlowProfiles->Add(fDiffFlowCorrelationsProList[t][pe]); | |
6400 | // list holding profiles with products of correlations: | |
6401 | fDiffFlowProductOfCorrelationsProList[t][pe] = (TList*)list.Clone(); | |
6402 | fDiffFlowProductOfCorrelationsProList[t][pe]->SetName(Form("Profiles with products of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6403 | fDiffFlowProfiles->Add(fDiffFlowProductOfCorrelationsProList[t][pe]); | |
6404 | // list holding profiles with corrections: | |
6405 | fDiffFlowCorrectionsProList[t][pe] = (TList*)list.Clone(); | |
6406 | fDiffFlowCorrectionsProList[t][pe]->SetName(Form("Profiles with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6407 | fDiffFlowProfiles->Add(fDiffFlowCorrectionsProList[t][pe]); | |
6408 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
6409 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
6410 | // nested lists in fDiffFlowResults (~/Differential Flow/Results): | |
6411 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
6412 | { | |
62e36168 | 6413 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 6414 | { |
6415 | // list holding histograms with correlations: | |
6416 | fDiffFlowCorrelationsHistList[t][pe] = (TList*)list.Clone(); | |
6417 | fDiffFlowCorrelationsHistList[t][pe]->SetName(Form("Correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6418 | fDiffFlowResults->Add(fDiffFlowCorrelationsHistList[t][pe]); | |
6419 | // list holding histograms with corrections: | |
6420 | fDiffFlowCorrectionsHistList[t][pe] = (TList*)list.Clone(); | |
6421 | fDiffFlowCorrectionsHistList[t][pe]->SetName(Form("Histograms with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6422 | fDiffFlowResults->Add(fDiffFlowCorrectionsHistList[t][pe]); | |
6423 | for(Int_t power=0;power<2;power++) | |
6424 | { | |
6425 | // list holding histograms with sums of event weights: | |
6426 | fDiffFlowSumOfEventWeightsHistList[t][pe][power] = (TList*)list.Clone(); | |
6427 | fDiffFlowSumOfEventWeightsHistList[t][pe][power]->SetName(Form("Sum of %s event weights (%s, %s)",powerFlag[power].Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6428 | fDiffFlowResults->Add(fDiffFlowSumOfEventWeightsHistList[t][pe][power]); | |
6429 | } // end of for(Int_t power=0;power<2;power++) | |
6430 | // list holding histograms with sums of products of event weights: | |
6431 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe] = (TList*)list.Clone(); | |
6432 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]->SetName(Form("Sum of products of event weights (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6433 | fDiffFlowResults->Add(fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]); | |
6434 | // list holding histograms with covariances of correlations: | |
6435 | fDiffFlowCovariancesHistList[t][pe] = (TList*)list.Clone(); | |
6436 | fDiffFlowCovariancesHistList[t][pe]->SetName(Form("Covariances of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6437 | fDiffFlowResults->Add(fDiffFlowCovariancesHistList[t][pe]); | |
6438 | // list holding histograms with differential Q-cumulants: | |
6439 | fDiffFlowCumulantsHistList[t][pe] = (TList*)list.Clone(); | |
6440 | fDiffFlowCumulantsHistList[t][pe]->SetName(Form("Differential Q-cumulants (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6441 | fDiffFlowResults->Add(fDiffFlowCumulantsHistList[t][pe]); | |
1268c371 | 6442 | // list holding histograms which quantify detector bias to differential Q-cumulants: |
6443 | fDiffFlowDetectorBiasHistList[t][pe] = (TList*)list.Clone(); | |
6444 | fDiffFlowDetectorBiasHistList[t][pe]->SetName(Form("Detector bias (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6445 | fDiffFlowResults->Add(fDiffFlowDetectorBiasHistList[t][pe]); | |
489d5531 | 6446 | // list holding histograms with differential flow estimates from Q-cumulants: |
6447 | fDiffFlowHistList[t][pe] = (TList*)list.Clone(); | |
6448 | fDiffFlowHistList[t][pe]->SetName(Form("Differential flow (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6449 | fDiffFlowResults->Add(fDiffFlowHistList[t][pe]); | |
6450 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
6451 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
6452 | ||
1268c371 | 6453 | } // end of void AliFlowAnalysisWithQCumulants::BookAndNestListsForDifferentialFlow() |
489d5531 | 6454 | |
6455 | //================================================================================================================================ | |
6456 | ||
489d5531 | 6457 | void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type) |
6458 | { | |
1268c371 | 6459 | // Fill common result histograms for differential flow. |
489d5531 | 6460 | |
1268c371 | 6461 | Int_t t = 0; |
489d5531 | 6462 | |
6463 | if(type == "RP") | |
6464 | { | |
1268c371 | 6465 | t = 0; |
489d5531 | 6466 | } else if(type == "POI") |
6467 | { | |
1268c371 | 6468 | t = 1; |
489d5531 | 6469 | } |
1268c371 | 6470 | |
6471 | // to be improved - check all pointers used in this method | |
489d5531 | 6472 | |
6473 | if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th)) | |
6474 | { | |
6475 | cout<<"WARNING: fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th"<<endl; | |
6476 | cout<<" is NULL in AFAWQC::FCHRIF() !!!!"<<endl; | |
6477 | exit(0); | |
6478 | } | |
6479 | ||
6480 | // pt: | |
6481 | for(Int_t p=1;p<=fnBinsPt;p++) | |
6482 | { | |
6483 | Double_t v2 = fDiffFlow[t][0][0]->GetBinContent(p); | |
6484 | Double_t v4 = fDiffFlow[t][0][1]->GetBinContent(p); | |
6485 | Double_t v6 = fDiffFlow[t][0][2]->GetBinContent(p); | |
6486 | Double_t v8 = fDiffFlow[t][0][3]->GetBinContent(p); | |
6487 | ||
6488 | Double_t v2Error = fDiffFlow[t][0][0]->GetBinError(p); | |
6489 | Double_t v4Error = fDiffFlow[t][0][1]->GetBinError(p); | |
6490 | //Double_t v6Error = fFinalFlow1D[t][pW][nua][0][2]->GetBinError(p); | |
6491 | //Double_t v8Error = fFinalFlow1D[t][pW][nua][0][3]->GetBinError(p); | |
6492 | ||
6493 | if(type == "RP") | |
6494 | { | |
6495 | fCommonHistsResults2nd->FillDifferentialFlowPtRP(p,v2,v2Error); | |
6496 | fCommonHistsResults4th->FillDifferentialFlowPtRP(p,v4,v4Error); | |
6497 | fCommonHistsResults6th->FillDifferentialFlowPtRP(p,v6,0.); | |
6498 | fCommonHistsResults8th->FillDifferentialFlowPtRP(p,v8,0.); | |
6499 | } else if(type == "POI") | |
6500 | { | |
6501 | fCommonHistsResults2nd->FillDifferentialFlowPtPOI(p,v2,v2Error); | |
6502 | fCommonHistsResults4th->FillDifferentialFlowPtPOI(p,v4,v4Error); | |
6503 | fCommonHistsResults6th->FillDifferentialFlowPtPOI(p,v6,0.); | |
6504 | fCommonHistsResults8th->FillDifferentialFlowPtPOI(p,v8,0.); | |
6505 | } | |
6506 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
6507 | ||
6508 | // eta: | |
62e36168 | 6509 | if(!fCalculateDiffFlowVsEta){return;} |
489d5531 | 6510 | for(Int_t e=1;e<=fnBinsEta;e++) |
6511 | { | |
6512 | Double_t v2 = fDiffFlow[t][1][0]->GetBinContent(e); | |
6513 | Double_t v4 = fDiffFlow[t][1][1]->GetBinContent(e); | |
6514 | Double_t v6 = fDiffFlow[t][1][2]->GetBinContent(e); | |
6515 | Double_t v8 = fDiffFlow[t][1][3]->GetBinContent(e); | |
6516 | ||
6517 | Double_t v2Error = fDiffFlow[t][1][0]->GetBinError(e); | |
6518 | Double_t v4Error = fDiffFlow[t][1][1]->GetBinError(e); | |
6519 | //Double_t v6Error = fDiffFlow[t][1][2]->GetBinError(e); | |
6520 | //Double_t v8Error = fDiffFlow[t][1][3]->GetBinError(e); | |
6521 | ||
6522 | if(type == "RP") | |
6523 | { | |
6524 | fCommonHistsResults2nd->FillDifferentialFlowEtaRP(e,v2,v2Error); | |
6525 | fCommonHistsResults4th->FillDifferentialFlowEtaRP(e,v4,v4Error); | |
6526 | fCommonHistsResults6th->FillDifferentialFlowEtaRP(e,v6,0.); | |
6527 | fCommonHistsResults8th->FillDifferentialFlowEtaRP(e,v8,0.); | |
6528 | } else if(type == "POI") | |
6529 | { | |
6530 | fCommonHistsResults2nd->FillDifferentialFlowEtaPOI(e,v2,v2Error); | |
6531 | fCommonHistsResults4th->FillDifferentialFlowEtaPOI(e,v4,v4Error); | |
6532 | fCommonHistsResults6th->FillDifferentialFlowEtaPOI(e,v6,0.); | |
6533 | fCommonHistsResults8th->FillDifferentialFlowEtaPOI(e,v8,0.); | |
6534 | } | |
6535 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
6536 | ||
6537 | } // end of void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights, Bool_t correctedForNUA) | |
6538 | ||
489d5531 | 6539 | //================================================================================================================================ |
6540 | ||
1268c371 | 6541 | void AliFlowAnalysisWithQCumulants::CommonConstants(TString method) |
489d5531 | 6542 | { |
1268c371 | 6543 | // Access and store common constants. |
6544 | ||
6545 | // a) If this method was called in Init() access common constants from AliFlowCommonConstants; | |
6546 | // b) If this method was called in Init() book and fill TProfile to hold constants accessed in a); | |
6547 | // c) If this method was called in Finish() access common constants from TProfile booked and filled in b). | |
6548 | ||
6549 | if(method == "Init") | |
6550 | { | |
6551 | // a) If this method was called in Init() access common constants from AliFlowCommonConstants: | |
6552 | fnBinsPhi = AliFlowCommonConstants::GetMaster()->GetNbinsPhi(); | |
6553 | fPhiMin = AliFlowCommonConstants::GetMaster()->GetPhiMin(); | |
6554 | fPhiMax = AliFlowCommonConstants::GetMaster()->GetPhiMax(); | |
6555 | if(fnBinsPhi){fPhiBinWidth = (fPhiMax-fPhiMin)/fnBinsPhi;} | |
6556 | fnBinsPt = AliFlowCommonConstants::GetMaster()->GetNbinsPt(); | |
6557 | fPtMin = AliFlowCommonConstants::GetMaster()->GetPtMin(); | |
6558 | fPtMax = AliFlowCommonConstants::GetMaster()->GetPtMax(); | |
6559 | if(fnBinsPt){fPtBinWidth = (fPtMax-fPtMin)/fnBinsPt;} | |
6560 | fnBinsEta = AliFlowCommonConstants::GetMaster()->GetNbinsEta(); | |
6561 | fEtaMin = AliFlowCommonConstants::GetMaster()->GetEtaMin(); | |
6562 | fEtaMax = AliFlowCommonConstants::GetMaster()->GetEtaMax(); | |
6563 | if(fnBinsEta){fEtaBinWidth = (fEtaMax-fEtaMin)/fnBinsEta;} | |
6564 | ||
6565 | // b) If this method was called in Init() book and fill TProfile to hold constants accessed in a): | |
6566 | TString fCommonConstantsName = "fCommonConstants"; | |
6567 | fCommonConstantsName += fAnalysisLabel->Data(); | |
6568 | fCommonConstants = new TProfile(fCommonConstantsName.Data(),"Common constants",9,0.,9.); | |
6569 | fCommonConstants->SetLabelSize(0.05); | |
6570 | fCommonConstants->GetXaxis()->SetBinLabel(1,"nBins (#phi)"); | |
6571 | fCommonConstants->Fill(0.5,fnBinsPhi); | |
6572 | fCommonConstants->GetXaxis()->SetBinLabel(2,"#phi_{min}"); | |
6573 | fCommonConstants->Fill(1.5,fPhiMin); | |
6574 | fCommonConstants->GetXaxis()->SetBinLabel(3,"#phi_{max}"); | |
6575 | fCommonConstants->Fill(2.5,fPhiMax); | |
6576 | fCommonConstants->GetXaxis()->SetBinLabel(4,"nBins (p_{t})"); | |
6577 | fCommonConstants->Fill(3.5,fnBinsPt); | |
6578 | fCommonConstants->GetXaxis()->SetBinLabel(5,"(p_{t})_{min}"); | |
6579 | fCommonConstants->Fill(4.5,fPtMin); | |
6580 | fCommonConstants->GetXaxis()->SetBinLabel(6,"(p_{t})_{max}"); | |
6581 | fCommonConstants->Fill(5.5,fPtMax); | |
6582 | fCommonConstants->GetXaxis()->SetBinLabel(7,"nBins (#eta)"); | |
6583 | fCommonConstants->Fill(6.5,fnBinsEta); | |
6584 | fCommonConstants->GetXaxis()->SetBinLabel(8,"#eta_{min}"); | |
6585 | fCommonConstants->Fill(7.5,fEtaMin); | |
6586 | fCommonConstants->GetXaxis()->SetBinLabel(9,"#eta_{max}"); | |
6587 | fCommonConstants->Fill(8.5,fEtaMax); | |
6588 | fHistList->Add(fCommonConstants); | |
6589 | } // end of if(method == "Init") | |
6590 | else if(method == "Finish") | |
6591 | { | |
6592 | // c) If this method was called in Finish() access common constants from TProfile booked and filled in b): | |
6593 | if(!fCommonConstants) | |
6594 | { | |
6595 | printf("\n WARNING (QC): fCommonConstants is NULL in AFAWQC::AC(\"%s\") !!!!\n\n",method.Data()); | |
6596 | exit(0); | |
6597 | } | |
6598 | fnBinsPhi = (Int_t)fCommonConstants->GetBinContent(1); | |
6599 | fPhiMin = fCommonConstants->GetBinContent(2); | |
6600 | fPhiMax = fCommonConstants->GetBinContent(3); | |
6601 | if(fnBinsPhi){fPhiBinWidth = (fPhiMax-fPhiMin)/fnBinsPhi;} | |
6602 | fnBinsPt = (Int_t)fCommonConstants->GetBinContent(4); | |
6603 | fPtMin = fCommonConstants->GetBinContent(5); | |
6604 | fPtMax = fCommonConstants->GetBinContent(6); | |
6605 | if(fnBinsPt){fPtBinWidth = (fPtMax-fPtMin)/fnBinsPt;} | |
6606 | fnBinsEta = (Int_t)fCommonConstants->GetBinContent(7); | |
6607 | fEtaMin = fCommonConstants->GetBinContent(8); | |
6608 | fEtaMax = fCommonConstants->GetBinContent(9); | |
6609 | if(fnBinsEta){fEtaBinWidth = (fEtaMax-fEtaMin)/fnBinsEta;} | |
6610 | } // end of else if(method == "Finish") | |
6611 | ||
6612 | } // end of void AliFlowAnalysisWithQCumulants::CommonConstants(TString method) | |
489d5531 | 6613 | |
489d5531 | 6614 | //================================================================================================================================ |
6615 | ||
489d5531 | 6616 | void AliFlowAnalysisWithQCumulants::CrossCheckSettings() |
6617 | { | |
1268c371 | 6618 | // a) Cross check if the choice for multiplicity weights make sense. |
489d5531 | 6619 | |
6620 | // a) Cross check if the choice for multiplicity weights make sense: | |
6621 | if(strcmp(fMultiplicityWeight->Data(),"combinations") && | |
6622 | strcmp(fMultiplicityWeight->Data(),"unit") && | |
6623 | strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
6624 | { | |
6625 | cout<<"WARNING (QC): Multiplicity weight can be either \"combinations\", \"unit\""<<endl; | |
6626 | cout<<" or \"multiplicity\". Certainly not \""<<fMultiplicityWeight->Data()<<"\"."<<endl; | |
6627 | exit(0); | |
6628 | } | |
6629 | ||
6630 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckSettings() | |
6631 | ||
489d5531 | 6632 | //================================================================================================================================ |
6633 | ||
489d5531 | 6634 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeights() |
6635 | { | |
0328db2d | 6636 | // Calculate sum of linear and quadratic event weights for correlations. |
2001bc3a | 6637 | |
6638 | // multiplicity: | |
1268c371 | 6639 | Double_t dMult = (*fSpk)(0,0); |
9f33751d | 6640 | |
489d5531 | 6641 | for(Int_t p=0;p<2;p++) // power-1 |
6642 | { | |
6643 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
6644 | { | |
6645 | fIntFlowSumOfEventWeights[p]->Fill(ci+0.5,pow(fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci+1),p+1)); | |
b3dacf6b | 6646 | if(fCalculateCumulantsVsM) |
6647 | { | |
6648 | fIntFlowSumOfEventWeightsVsM[ci][p]->Fill(dMult+0.5,pow(fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci+1),p+1)); // to be improved: dMult => sum of weights? | |
6649 | } | |
489d5531 | 6650 | } |
6651 | } | |
6652 | ||
6653 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeights() | |
6654 | ||
489d5531 | 6655 | //================================================================================================================================ |
6656 | ||
0328db2d | 6657 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeightsNUA() |
489d5531 | 6658 | { |
0328db2d | 6659 | // Calculate sum of linear and quadratic event weights for NUA terms. |
6660 | ||
6661 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
489d5531 | 6662 | { |
0328db2d | 6663 | for(Int_t p=0;p<2;p++) // power-1 |
6664 | { | |
b92ea2b9 | 6665 | for(Int_t ci=0;ci<4;ci++) // nua term index |
0328db2d | 6666 | { |
6667 | fIntFlowSumOfEventWeightsNUA[sc][p]->Fill(ci+0.5,pow(fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc]->GetBinContent(ci+1),p+1)); | |
489d5531 | 6668 | } |
0328db2d | 6669 | } |
6670 | } | |
6671 | ||
6672 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeightsNUA() | |
489d5531 | 6673 | |
0328db2d | 6674 | //================================================================================================================================ |
6675 | ||
0328db2d | 6676 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeights() |
6677 | { | |
ff70ca91 | 6678 | // Calculate sum of product of event weights for correlations. |
2001bc3a | 6679 | |
6680 | // multiplicity: | |
1268c371 | 6681 | Double_t dMult = (*fSpk)(0,0); |
2001bc3a | 6682 | |
489d5531 | 6683 | Int_t counter = 0; |
6684 | ||
6685 | for(Int_t ci1=1;ci1<4;ci1++) | |
6686 | { | |
6687 | for(Int_t ci2=ci1+1;ci2<=4;ci2++) | |
6688 | { | |
ff70ca91 | 6689 | fIntFlowSumOfProductOfEventWeights->Fill(0.5+counter, |
6690 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
b3dacf6b | 6691 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); |
6692 | if(fCalculateCumulantsVsM) | |
6693 | { | |
6694 | fIntFlowSumOfProductOfEventWeightsVsM[counter]->Fill(dMult+0.5, // to be improved: dMult => sum of weights? | |
6695 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
6696 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); | |
6697 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 6698 | counter++; |
489d5531 | 6699 | } |
6700 | } | |
6701 | ||
0328db2d | 6702 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeights() |
6703 | ||
0328db2d | 6704 | //================================================================================================================================ |
6705 | ||
0328db2d | 6706 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeightsNUA() |
6707 | { | |
6708 | // Calculate sum of product of event weights for NUA terms. | |
6709 | ||
6710 | // w_{<2>} * w_{<cos(#phi)>}: | |
6711 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(0.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6712 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
6713 | // w_{<2>} * w_{<sin(#phi)>}: | |
6714 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(1.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6715 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
6716 | // w_{<cos(#phi)> * w_{<sin(#phi)>}: | |
6717 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(2.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6718 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
6719 | // w_{<2>} * w{<cos(phi1+phi2)>} | |
6720 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(3.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6721 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6722 | // w_{<2>} * w{<sin(phi1+phi2)>} | |
6723 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(4.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6724 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6725 | // w_{<2>} * w{<cos(phi1-phi2-phi3)>} | |
6726 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(5.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6727 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6728 | // w_{<2>} * w{<sin(phi1-phi2-phi3)>} | |
6729 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(6.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6730 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6731 | // w_{<4>} * w{<cos(phi1)>} | |
6732 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(7.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6733 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
6734 | // w_{<4>} * w{<sin(phi1)>} | |
6735 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(8.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6736 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
6737 | // w_{<4>} * w{<cos(phi1+phi2)>} | |
6738 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(9.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6739 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6740 | // w_{<4>} * w{<sin(phi1+phi2)>} | |
6741 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(10.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6742 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6743 | // w_{<4>} * w{<cos(phi1-phi2-phi3)>} | |
6744 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(11.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6745 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6746 | // w_{<4>} * w{<sin(phi1-phi2-phi3)>} | |
6747 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(12.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6748 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6749 | // w_{<cos(phi1)>} * w{<cos(phi1+phi2)>} | |
6750 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(13.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6751 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6752 | // w_{<cos(phi1)>} * w{<sin(phi1+phi2)>} | |
6753 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(14.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6754 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6755 | // w_{<cos(phi1)>} * w{<cos(phi1-phi2-phi3)>} | |
6756 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(15.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6757 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6758 | // w_{<cos(phi1)>} * w{<sin(phi1-phi2-phi3)>} | |
6759 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(16.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6760 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6761 | // w_{<sin(phi1)>} * w{<cos(phi1+phi2)>} | |
6762 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(17.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6763 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6764 | // w_{<sin(phi1)>} * w{<sin(phi1+phi2)>} | |
6765 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(18.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6766 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6767 | // w_{<sin(phi1)>} * w{<cos(phi1-phi2-phi3)>} | |
6768 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(19.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6769 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6770 | // w_{<sin(phi1)>} * w{<sin(phi1-phi2-phi3)>} | |
6771 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(20.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6772 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6773 | // w_{<cos(phi1+phi2)>} * w{<sin(phi1+phi2))>} | |
6774 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(21.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)* | |
6775 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6776 | // w_{<cos(phi1+phi2)>} * w{<cos(phi1-phi2-phi3)>} | |
6777 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(22.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)* | |
6778 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6779 | // w_{<cos(phi1+phi2)>} * w{<sin(phi1-phi2-phi3)>} | |
6780 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(23.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)* | |
6781 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6782 | // w_{<sin(phi1+phi2)>} * w{<cos(phi1-phi2-phi3)>} | |
6783 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(24.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)* | |
6784 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6785 | // w_{<sin(phi1+phi2)>} * w{<sin(phi1-phi2-phi3)>} | |
6786 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(25.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)* | |
6787 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6788 | // w_{<cos(phi1-phi2-phi3)>} * w{<sin(phi1-phi2-phi3)>} | |
6789 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(26.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)* | |
6790 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6791 | ||
6792 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowIntFlowSumOfProductOfEventWeightsNUA() | |
489d5531 | 6793 | |
489d5531 | 6794 | //================================================================================================================================ |
6795 | ||
489d5531 | 6796 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelations(TString type, TString ptOrEta) |
6797 | { | |
1268c371 | 6798 | // Calculate reduced correlations for RPs or POIs for all pt and eta bins. |
489d5531 | 6799 | |
1268c371 | 6800 | // Multiplicity: |
6801 | Double_t dMult = (*fSpk)(0,0); | |
489d5531 | 6802 | |
6803 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
6804 | Double_t dReQ1n = (*fReQ)(0,0); | |
6805 | Double_t dReQ2n = (*fReQ)(1,0); | |
6806 | //Double_t dReQ3n = (*fReQ)(2,0); | |
6807 | //Double_t dReQ4n = (*fReQ)(3,0); | |
6808 | Double_t dImQ1n = (*fImQ)(0,0); | |
6809 | Double_t dImQ2n = (*fImQ)(1,0); | |
6810 | //Double_t dImQ3n = (*fImQ)(2,0); | |
6811 | //Double_t dImQ4n = (*fImQ)(3,0); | |
6812 | ||
6813 | // reduced correlations are stored in fDiffFlowCorrelationsPro[0=RP,1=POI][0=pt,1=eta][correlation index]. Correlation index runs as follows: | |
6814 | // | |
6815 | // 0: <<2'>> | |
6816 | // 1: <<4'>> | |
6817 | // 2: <<6'>> | |
6818 | // 3: <<8'>> | |
6819 | ||
2a98ceb8 | 6820 | Int_t t = 0; // type flag |
6821 | Int_t pe = 0; // ptEta flag | |
489d5531 | 6822 | |
6823 | if(type == "RP") | |
6824 | { | |
6825 | t = 0; | |
6826 | } else if(type == "POI") | |
6827 | { | |
6828 | t = 1; | |
6829 | } | |
6830 | ||
6831 | if(ptOrEta == "Pt") | |
6832 | { | |
6833 | pe = 0; | |
6834 | } else if(ptOrEta == "Eta") | |
6835 | { | |
6836 | pe = 1; | |
6837 | } | |
6838 | ||
6839 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
6840 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
6841 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
6842 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
6843 | ||
6844 | // looping over all bins and calculating reduced correlations: | |
6845 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6846 | { | |
6847 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
6848 | Double_t p1n0kRe = 0.; | |
6849 | Double_t p1n0kIm = 0.; | |
6850 | ||
6851 | // number of POIs in particular pt or eta bin: | |
6852 | Double_t mp = 0.; | |
6853 | ||
6854 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
6855 | Double_t q1n0kRe = 0.; | |
6856 | Double_t q1n0kIm = 0.; | |
6857 | Double_t q2n0kRe = 0.; | |
6858 | Double_t q2n0kIm = 0.; | |
6859 | ||
6860 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
6861 | Double_t mq = 0.; | |
6862 | ||
6863 | if(type == "POI") | |
6864 | { | |
6865 | // q_{m*n,0}: | |
6866 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
6867 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
6868 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
6869 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
6870 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
6871 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
6872 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
6873 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
6874 | ||
6875 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
6876 | } | |
6877 | else if(type == "RP") | |
6878 | { | |
6879 | // q_{m*n,0}: | |
6880 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
6881 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
6882 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
6883 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
6884 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
6885 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
6886 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
6887 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
6888 | ||
6889 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
6890 | } | |
6891 | ||
6892 | if(type == "POI") | |
6893 | { | |
6894 | // p_{m*n,0}: | |
6895 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
6896 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
6897 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
6898 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
6899 | ||
6900 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
6901 | ||
6902 | t = 1; // typeFlag = RP or POI | |
6903 | } | |
6904 | else if(type == "RP") | |
6905 | { | |
6906 | // p_{m*n,0} = q_{m*n,0}: | |
6907 | p1n0kRe = q1n0kRe; | |
6908 | p1n0kIm = q1n0kIm; | |
6909 | ||
6910 | mp = mq; | |
6911 | ||
6912 | t = 0; // typeFlag = RP or POI | |
6913 | } | |
6914 | ||
1268c371 | 6915 | // 2'-particle correlation for particular pt or eta bin: |
489d5531 | 6916 | Double_t two1n1nPtEta = 0.; |
b40a910e | 6917 | Double_t mWeight2pPrime = 0.; // multiplicity weight for <2'> |
489d5531 | 6918 | if(mp*dMult-mq) |
6919 | { | |
6920 | two1n1nPtEta = (p1n0kRe*dReQ1n+p1n0kIm*dImQ1n-mq) | |
6921 | / (mp*dMult-mq); | |
b40a910e | 6922 | // determine multiplicity weight: |
6923 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
6924 | { | |
6925 | mWeight2pPrime = mp*dMult-mq; | |
6926 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
6927 | { | |
6928 | mWeight2pPrime = 1.; | |
6929 | } | |
489d5531 | 6930 | if(type == "POI") // to be improved (I do not this if) |
6931 | { | |
6932 | // fill profile to get <<2'>> for POIs | |
b40a910e | 6933 | fDiffFlowCorrelationsPro[1][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta,mWeight2pPrime); |
6934 | // fill profile to get <<2'>^2> for POIs | |
6935 | fDiffFlowSquaredCorrelationsPro[1][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta*two1n1nPtEta,mWeight2pPrime); | |
489d5531 | 6936 | // histogram to store <2'> for POIs e-b-e (needed in some other methods): |
6937 | fDiffFlowCorrelationsEBE[1][pe][0]->SetBinContent(b,two1n1nPtEta); | |
b40a910e | 6938 | fDiffFlowEventWeightsForCorrelationsEBE[1][pe][0]->SetBinContent(b,mWeight2pPrime); |
489d5531 | 6939 | } |
6940 | else if(type == "RP") // to be improved (I do not this if) | |
6941 | { | |
6942 | // profile to get <<2'>> for RPs: | |
b40a910e | 6943 | fDiffFlowCorrelationsPro[0][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta,mWeight2pPrime); |
6944 | // profile to get <<2'>^2> for RPs: | |
6945 | fDiffFlowSquaredCorrelationsPro[0][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta*two1n1nPtEta,mWeight2pPrime); | |
489d5531 | 6946 | // histogram to store <2'> for RPs e-b-e (needed in some other methods): |
6947 | fDiffFlowCorrelationsEBE[0][pe][0]->SetBinContent(b,two1n1nPtEta); | |
b40a910e | 6948 | fDiffFlowEventWeightsForCorrelationsEBE[0][pe][0]->SetBinContent(b,mWeight2pPrime); |
489d5531 | 6949 | } |
6950 | } // end of if(mp*dMult-mq) | |
6951 | ||
6952 | // 4'-particle correlation: | |
6953 | Double_t four1n1n1n1nPtEta = 0.; | |
b40a910e | 6954 | Double_t mWeight4pPrime = 0.; // multiplicity weight for <4'> |
489d5531 | 6955 | if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) |
6956 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression) | |
6957 | { | |
6958 | four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
6959 | - q2n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) | |
6960 | - 2.*q2n0kIm*dReQ1n*dImQ1n | |
6961 | - p1n0kRe*(dReQ1n*dReQ2n+dImQ1n*dImQ2n) | |
6962 | + p1n0kIm*(dImQ1n*dReQ2n-dReQ1n*dImQ2n) | |
6963 | - 2.*dMult*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
6964 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*mq | |
6965 | + 6.*(q1n0kRe*dReQ1n+q1n0kIm*dImQ1n) | |
6966 | + 1.*(q2n0kRe*dReQ2n+q2n0kIm*dImQ2n) | |
6967 | + 2.*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
6968 | + 2.*mq*dMult | |
6969 | - 6.*mq) | |
6970 | / ((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6971 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b40a910e | 6972 | // determine multiplicity weight: |
6973 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
6974 | { | |
6975 | mWeight4pPrime = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
6976 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
6977 | { | |
6978 | mWeight4pPrime = 1.; | |
6979 | } | |
489d5531 | 6980 | if(type == "POI") |
6981 | { | |
6982 | // profile to get <<4'>> for POIs: | |
b40a910e | 6983 | fDiffFlowCorrelationsPro[1][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta,mWeight4pPrime); |
6984 | // profile to get <<4'>^2> for POIs: | |
6985 | fDiffFlowSquaredCorrelationsPro[1][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta*four1n1n1n1nPtEta,mWeight4pPrime); | |
489d5531 | 6986 | // histogram to store <4'> for POIs e-b-e (needed in some other methods): |
6987 | fDiffFlowCorrelationsEBE[1][pe][1]->SetBinContent(b,four1n1n1n1nPtEta); | |
b40a910e | 6988 | fDiffFlowEventWeightsForCorrelationsEBE[1][pe][1]->SetBinContent(b,mWeight4pPrime); |
489d5531 | 6989 | } |
6990 | else if(type == "RP") | |
6991 | { | |
6992 | // profile to get <<4'>> for RPs: | |
b40a910e | 6993 | fDiffFlowCorrelationsPro[0][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta,mWeight4pPrime); |
6994 | // profile to get <<4'>^2> for RPs: | |
6995 | fDiffFlowSquaredCorrelationsPro[0][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta*four1n1n1n1nPtEta,mWeight4pPrime); | |
489d5531 | 6996 | // histogram to store <4'> for RPs e-b-e (needed in some other methods): |
6997 | fDiffFlowCorrelationsEBE[0][pe][1]->SetBinContent(b,four1n1n1n1nPtEta); | |
b40a910e | 6998 | fDiffFlowEventWeightsForCorrelationsEBE[0][pe][1]->SetBinContent(b,mWeight4pPrime); |
489d5531 | 6999 | } |
7000 | } // end of if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
7001 | // +mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
7002 | ||
7003 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7004 | ||
7005 | ||
7006 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelations(TString type, TString ptOrEta); | |
7007 | ||
489d5531 | 7008 | //================================================================================================================================ |
7009 | ||
64e500e3 | 7010 | void AliFlowAnalysisWithQCumulants::CalculateOtherDiffCorrelators(TString type, TString ptOrEta) |
7011 | { | |
7012 | // Calculate other differential correlators for RPs or POIs for all pt and eta bins. | |
7013 | ||
7014 | // Multiplicity: | |
7015 | Double_t dMult = (*fSpk)(0,0); | |
7016 | ||
7017 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
7018 | Double_t dReQ1n = (*fReQ)(0,0); | |
7019 | Double_t dReQ2n = (*fReQ)(1,0); | |
7020 | Double_t dReQ3n = (*fReQ)(2,0); | |
7021 | //Double_t dReQ4n = (*fReQ)(3,0); | |
7022 | Double_t dImQ1n = (*fImQ)(0,0); | |
7023 | Double_t dImQ2n = (*fImQ)(1,0); | |
7024 | Double_t dImQ3n = (*fImQ)(2,0); | |
7025 | //Double_t dImQ4n = (*fImQ)(3,0); | |
7026 | ||
7027 | // Other correlations are stored in fOtherDiffCorrelators[2][2][2][1], [0=RP,1=POI][0=pt,1=eta][0=sin terms,1=cos terms][correlator index] | |
7028 | // Correlation index runs as follows: | |
7029 | // | |
7030 | // 0: <exp[in(psi1-3phi2+2phi3)]> | |
7031 | ||
7032 | Int_t t = 0; // type flag | |
7033 | Int_t pe = 0; // ptEta flag | |
7034 | ||
7035 | if(type == "RP") | |
7036 | { | |
7037 | t = 0; | |
7038 | } else if(type == "POI") | |
7039 | { | |
7040 | t = 1; | |
7041 | } | |
7042 | ||
7043 | if(ptOrEta == "Pt") | |
7044 | { | |
7045 | pe = 0; | |
7046 | } else if(ptOrEta == "Eta") | |
7047 | { | |
7048 | pe = 1; | |
7049 | } | |
7050 | ||
7051 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
7052 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
7053 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
7054 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
7055 | ||
7056 | // looping over all bins and calculating reduced correlations: | |
7057 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7058 | { | |
7059 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
7060 | Double_t p1n0kRe = 0.; | |
7061 | Double_t p1n0kIm = 0.; | |
7062 | ||
7063 | // number of POIs in particular pt or eta bin: | |
7064 | Double_t mp = 0.; | |
7065 | ||
7066 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
7067 | Double_t q1n0kRe = 0.; | |
7068 | Double_t q1n0kIm = 0.; | |
7069 | Double_t q2n0kRe = 0.; | |
7070 | Double_t q2n0kIm = 0.; | |
7071 | Double_t q3n0kRe = 0.; | |
7072 | Double_t q3n0kIm = 0.; | |
7073 | ||
7074 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
7075 | Double_t mq = 0.; | |
7076 | ||
7077 | if(type == "POI") | |
7078 | { | |
7079 | // q_{m*n,0}: | |
7080 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
7081 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
7082 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
7083 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
7084 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
7085 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
7086 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
7087 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
7088 | q3n0kRe = fReRPQ1dEBE[2][pe][2][0]->GetBinContent(fReRPQ1dEBE[2][pe][2][0]->GetBin(b)) | |
7089 | * fReRPQ1dEBE[2][pe][2][0]->GetBinEntries(fReRPQ1dEBE[2][pe][2][0]->GetBin(b)); | |
7090 | q3n0kIm = fImRPQ1dEBE[2][pe][2][0]->GetBinContent(fImRPQ1dEBE[2][pe][2][0]->GetBin(b)) | |
7091 | * fImRPQ1dEBE[2][pe][2][0]->GetBinEntries(fImRPQ1dEBE[2][pe][2][0]->GetBin(b)); | |
7092 | ||
7093 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
7094 | } | |
7095 | else if(type == "RP") | |
7096 | { | |
7097 | // q_{m*n,0}: | |
7098 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
7099 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
7100 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
7101 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
7102 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
7103 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
7104 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
7105 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
7106 | q3n0kRe = fReRPQ1dEBE[0][pe][2][0]->GetBinContent(fReRPQ1dEBE[0][pe][2][0]->GetBin(b)) | |
7107 | * fReRPQ1dEBE[0][pe][2][0]->GetBinEntries(fReRPQ1dEBE[0][pe][2][0]->GetBin(b)); | |
7108 | q3n0kIm = fImRPQ1dEBE[0][pe][2][0]->GetBinContent(fImRPQ1dEBE[0][pe][2][0]->GetBin(b)) | |
7109 | * fImRPQ1dEBE[0][pe][2][0]->GetBinEntries(fImRPQ1dEBE[0][pe][2][0]->GetBin(b)); | |
7110 | ||
7111 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
7112 | } | |
7113 | ||
7114 | if(type == "POI") | |
7115 | { | |
7116 | // p_{m*n,0}: | |
7117 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
7118 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
7119 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
7120 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
7121 | ||
7122 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
7123 | ||
7124 | t = 1; // typeFlag = RP or POI | |
7125 | } | |
7126 | else if(type == "RP") | |
7127 | { | |
7128 | // p_{m*n,0} = q_{m*n,0}: | |
7129 | p1n0kRe = q1n0kRe; | |
7130 | p1n0kIm = q1n0kIm; | |
7131 | ||
7132 | mp = mq; | |
7133 | ||
7134 | t = 0; // typeFlag = RP or POI | |
7135 | } | |
7136 | ||
7137 | // 3'-particle correlators: | |
7138 | // Taeney-Yan correlator: | |
7139 | Double_t dTaeneyYan = 0.; | |
7140 | Double_t mWeightTaeneyYan = 0.; // multiplicity weight for Taeney-Yan correlator | |
7141 | if((mp*dMult-2.*mq)*(dMult-1.) > 0.) // to be improved - is this condition fully justified? | |
7142 | { | |
7143 | dTaeneyYan = (dReQ3n*(p1n0kRe*dReQ2n-p1n0kIm*dImQ2n)+dImQ3n*(p1n0kIm*dReQ2n+p1n0kRe*dImQ2n) | |
7144 | - p1n0kRe*dReQ1n - p1n0kIm*dImQ1n | |
7145 | - q2n0kRe*dReQ2n - q2n0kIm*dImQ2n | |
7146 | - q3n0kRe*dReQ3n - q3n0kIm*dImQ3n | |
7147 | + 2.*mq) | |
7148 | / ((mp*dMult-2.*mq)*(dMult-1.)); | |
7149 | // determine multiplicity weight: | |
7150 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
7151 | { | |
7152 | mWeightTaeneyYan = (mp*dMult-2.*mq)*(dMult-1.); | |
7153 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
7154 | { | |
7155 | mWeightTaeneyYan = 1.; | |
7156 | } | |
7157 | // Fill profiles: | |
7158 | fOtherDiffCorrelators[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dTaeneyYan,mWeightTaeneyYan); | |
7159 | } // end of if((mp*dMult-2.*mq)*(dMult-1.) > 0.) | |
7160 | ||
7161 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7162 | ||
7163 | } // end of void AliFlowAnalysisWithQCumulants::CalculateOtherDiffCorrelators(TString type, TString ptOrEta) | |
7164 | ||
7165 | //================================================================================================================================ | |
7166 | ||
1268c371 | 7167 | void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCorrelations(TString type) |
7168 | { | |
7169 | // Calculate all reduced correlations needed for 2D differential flow for each (pt,eta) bin. | |
7170 | ||
7171 | // Multiplicity: | |
7172 | Double_t dMult = (*fSpk)(0,0); | |
7173 | // Real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
7174 | Double_t dReQ1n = (*fReQ)(0,0); | |
7175 | Double_t dReQ2n = (*fReQ)(1,0); | |
7176 | //Double_t dReQ3n = (*fReQ)(2,0); | |
7177 | //Double_t dReQ4n = (*fReQ)(3,0); | |
7178 | Double_t dImQ1n = (*fImQ)(0,0); | |
7179 | Double_t dImQ2n = (*fImQ)(1,0); | |
7180 | //Double_t dImQ3n = (*fImQ)(2,0); | |
7181 | //Double_t dImQ4n = (*fImQ)(3,0); | |
7182 | ||
7183 | // 2D reduced correlations are stored in TProfile2D f2DDiffFlowCorrelationsPro[0=RP,1=POI][correlation index]. | |
7184 | // Correlation index runs as follows: | |
7185 | // 0: <<2'>> | |
7186 | // 1: <<4'>> | |
7187 | // 2: <<6'>> | |
7188 | // 3: <<8'>> | |
7189 | ||
7190 | Int_t t = 0; // type flag | |
7191 | if(type == "RP") | |
7192 | { | |
7193 | t = 0; | |
7194 | } else if(type == "POI") | |
7195 | { | |
7196 | t = 1; | |
7197 | } | |
7198 | ||
7199 | // Looping over all (pt,eta) bins and calculating correlations needed for differential flow: | |
7200 | for(Int_t p=1;p<=fnBinsPt;p++) | |
7201 | { | |
7202 | for(Int_t e=1;e<=fnBinsEta;e++) | |
7203 | { | |
7204 | // Real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): | |
7205 | Double_t p1n0kRe = 0.; | |
7206 | Double_t p1n0kIm = 0.; | |
7207 | // Number of POIs in particular pt or eta bin: | |
7208 | Double_t mp = 0.; | |
7209 | // Real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for 'RP && POI particles' in particular pt or eta bin): | |
7210 | Double_t q1n0kRe = 0.; | |
7211 | Double_t q1n0kIm = 0.; | |
7212 | Double_t q2n0kRe = 0.; | |
7213 | Double_t q2n0kIm = 0.; | |
7214 | // Number of 'RP && POI particles' in particular pt or eta bin: | |
7215 | Double_t mq = 0.; | |
7216 | if(type == "POI") | |
7217 | { | |
7218 | // q_{m*n,0}: | |
7219 | q1n0kRe = fReRPQ2dEBE[2][0][0]->GetBinContent(fReRPQ2dEBE[2][0][0]->GetBin(p,e)) | |
7220 | * fReRPQ2dEBE[2][0][0]->GetBinEntries(fReRPQ2dEBE[2][0][0]->GetBin(p,e)); | |
7221 | q1n0kIm = fImRPQ2dEBE[2][0][0]->GetBinContent(fImRPQ2dEBE[2][0][0]->GetBin(p,e)) | |
7222 | * fImRPQ2dEBE[2][0][0]->GetBinEntries(fImRPQ2dEBE[2][0][0]->GetBin(p,e)); | |
7223 | q2n0kRe = fReRPQ2dEBE[2][1][0]->GetBinContent(fReRPQ2dEBE[2][1][0]->GetBin(p,e)) | |
7224 | * fReRPQ2dEBE[2][1][0]->GetBinEntries(fReRPQ2dEBE[2][1][0]->GetBin(p,e)); | |
7225 | q2n0kIm = fImRPQ2dEBE[2][1][0]->GetBinContent(fImRPQ2dEBE[2][1][0]->GetBin(p,e)) | |
7226 | * fImRPQ2dEBE[2][1][0]->GetBinEntries(fImRPQ2dEBE[2][1][0]->GetBin(p,e)); | |
7227 | // m_{q}: | |
7228 | mq = fReRPQ2dEBE[2][0][0]->GetBinEntries(fReRPQ2dEBE[2][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) | |
7229 | } // end of if(type == "POI") | |
7230 | else if(type == "RP") | |
7231 | { | |
7232 | // q_{m*n,0}: | |
7233 | q1n0kRe = fReRPQ2dEBE[0][0][0]->GetBinContent(fReRPQ2dEBE[0][0][0]->GetBin(p,e)) | |
7234 | * fReRPQ2dEBE[0][0][0]->GetBinEntries(fReRPQ2dEBE[0][0][0]->GetBin(p,e)); | |
7235 | q1n0kIm = fImRPQ2dEBE[0][0][0]->GetBinContent(fImRPQ2dEBE[0][0][0]->GetBin(p,e)) | |
7236 | * fImRPQ2dEBE[0][0][0]->GetBinEntries(fImRPQ2dEBE[0][0][0]->GetBin(p,e)); | |
7237 | q2n0kRe = fReRPQ2dEBE[0][1][0]->GetBinContent(fReRPQ2dEBE[0][1][0]->GetBin(p,e)) | |
7238 | * fReRPQ2dEBE[0][1][0]->GetBinEntries(fReRPQ2dEBE[0][1][0]->GetBin(p,e)); | |
7239 | q2n0kIm = fImRPQ2dEBE[0][1][0]->GetBinContent(fImRPQ2dEBE[0][1][0]->GetBin(p,e)) | |
7240 | * fImRPQ2dEBE[0][1][0]->GetBinEntries(fImRPQ2dEBE[0][1][0]->GetBin(p,e)); | |
7241 | // m_{q}: | |
7242 | mq = fReRPQ2dEBE[0][0][0]->GetBinEntries(fReRPQ2dEBE[0][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) | |
7243 | } // end of else if(type == "RP") | |
7244 | if(type == "POI") | |
7245 | { | |
7246 | // p_{m*n,0}: | |
7247 | p1n0kRe = fReRPQ2dEBE[1][0][0]->GetBinContent(fReRPQ2dEBE[1][0][0]->GetBin(p,e)) | |
7248 | * fReRPQ2dEBE[1][0][0]->GetBinEntries(fReRPQ2dEBE[1][0][0]->GetBin(p,e)); | |
7249 | p1n0kIm = fImRPQ2dEBE[1][0][0]->GetBinContent(fImRPQ2dEBE[1][0][0]->GetBin(p,e)) | |
7250 | * fImRPQ2dEBE[1][0][0]->GetBinEntries(fImRPQ2dEBE[1][0][0]->GetBin(p,e)); | |
7251 | // m_{p} | |
7252 | mp = fReRPQ2dEBE[1][0][0]->GetBinEntries(fReRPQ2dEBE[1][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) | |
7253 | ||
7254 | t = 1; // typeFlag = RP or POI | |
7255 | } // end of if(type == "POI") | |
7256 | else if(type == "RP") | |
7257 | { | |
7258 | // p_{m*n,0} = q_{m*n,0}: | |
7259 | p1n0kRe = q1n0kRe; | |
7260 | p1n0kIm = q1n0kIm; | |
7261 | // m_{p} = m_{q}: | |
7262 | mp = mq; | |
7263 | ||
7264 | t = 0; // typeFlag = RP or POI | |
7265 | } // end of if(type == "RP") | |
7266 | ||
7267 | // 2'-particle correlation for particular (pt,eta) bin: | |
7268 | Double_t two1n1nPtEta = 0.; | |
7269 | Double_t mWeight2pPrime = 0.; // multiplicity weight for <2'> | |
7270 | if(mp*dMult-mq) | |
7271 | { | |
7272 | two1n1nPtEta = (p1n0kRe*dReQ1n+p1n0kIm*dImQ1n-mq) | |
7273 | / (mp*dMult-mq); | |
7274 | // Determine multiplicity weight: | |
7275 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
7276 | { | |
7277 | mWeight2pPrime = mp*dMult-mq; | |
7278 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
7279 | { | |
7280 | mWeight2pPrime = 1.; | |
7281 | } | |
7282 | // Fill 2D profile holding <<2'>>: | |
7283 | f2DDiffFlowCorrelationsPro[t][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mWeight2pPrime); | |
7284 | } // end of if(mp*dMult-mq) | |
7285 | ||
7286 | // 4'-particle correlation: | |
7287 | Double_t four1n1n1n1nPtEta = 0.; | |
7288 | Double_t mWeight4pPrime = 0.; // multiplicity weight for <4'> | |
7289 | if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
7290 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression) | |
7291 | { | |
7292 | four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
7293 | - q2n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) | |
7294 | - 2.*q2n0kIm*dReQ1n*dImQ1n | |
7295 | - p1n0kRe*(dReQ1n*dReQ2n+dImQ1n*dImQ2n) | |
7296 | + p1n0kIm*(dImQ1n*dReQ2n-dReQ1n*dImQ2n) | |
7297 | - 2.*dMult*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
7298 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*mq | |
7299 | + 6.*(q1n0kRe*dReQ1n+q1n0kIm*dImQ1n) | |
7300 | + 1.*(q2n0kRe*dReQ2n+q2n0kIm*dImQ2n) | |
7301 | + 2.*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
7302 | + 2.*mq*dMult | |
7303 | - 6.*mq) | |
7304 | / ((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
7305 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
7306 | // Determine multiplicity weight: | |
7307 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
7308 | { | |
7309 | mWeight4pPrime = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
7310 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
7311 | { | |
7312 | mWeight4pPrime = 1.; | |
7313 | } | |
7314 | // Fill 2D profile holding <<4'>>: | |
7315 | f2DDiffFlowCorrelationsPro[t][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta,mWeight4pPrime); | |
7316 | } // end of if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
7317 | // +mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
7318 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
7319 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
7320 | ||
7321 | } // end of AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCorrelations(TString type) | |
7322 | ||
7323 | //================================================================================================================================ | |
7324 | ||
489d5531 | 7325 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfEventWeights(TString type, TString ptOrEta) |
7326 | { | |
7327 | // Calculate sums of various event weights for reduced correlations. | |
7328 | // (These quantitites are needed in expressions for unbiased estimators relevant for the statistical errors.) | |
7329 | ||
2a98ceb8 | 7330 | Int_t typeFlag = 0; |
7331 | Int_t ptEtaFlag = 0; | |
489d5531 | 7332 | |
7333 | if(type == "RP") | |
7334 | { | |
7335 | typeFlag = 0; | |
7336 | } else if(type == "POI") | |
7337 | { | |
7338 | typeFlag = 1; | |
7339 | } | |
7340 | ||
7341 | if(ptOrEta == "Pt") | |
7342 | { | |
7343 | ptEtaFlag = 0; | |
7344 | } else if(ptOrEta == "Eta") | |
7345 | { | |
7346 | ptEtaFlag = 1; | |
7347 | } | |
7348 | ||
7349 | // shortcuts: | |
7350 | Int_t t = typeFlag; | |
7351 | Int_t pe = ptEtaFlag; | |
7352 | ||
7353 | // binning: | |
7354 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
7355 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
7356 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
7357 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
7358 | ||
7359 | for(Int_t rpq=0;rpq<3;rpq++) | |
7360 | { | |
7361 | for(Int_t m=0;m<4;m++) | |
7362 | { | |
7363 | for(Int_t k=0;k<9;k++) | |
7364 | { | |
7365 | if(!fReRPQ1dEBE[rpq][pe][m][k]) | |
7366 | { | |
7367 | cout<<"WARNING: fReRPQ1dEBE[rpq][pe][m][k] is NULL in AFAWQC::CSAPOEWFDF() !!!!"<<endl; | |
7368 | cout<<"pe = "<<pe<<endl; | |
7369 | cout<<"rpq = "<<rpq<<endl; | |
7370 | cout<<"m = "<<m<<endl; | |
7371 | cout<<"k = "<<k<<endl; | |
7372 | exit(0); | |
7373 | } | |
7374 | } | |
7375 | } | |
7376 | } | |
7377 | ||
7378 | // multiplicities: | |
1268c371 | 7379 | Double_t dMult = (*fSpk)(0,0); // total event multiplicity |
489d5531 | 7380 | //Double_t mr = 0.; // number of RPs in particular pt or eta bin |
7381 | Double_t mp = 0.; // number of POIs in particular pt or eta bin | |
7382 | Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin | |
7383 | ||
7384 | // event weights for reduced correlations: | |
7385 | Double_t dw2 = 0.; // event weight for <2'> | |
7386 | Double_t dw4 = 0.; // event weight for <4'> | |
7387 | //Double_t dw6 = 0.; // event weight for <6'> | |
7388 | //Double_t dw8 = 0.; // event weight for <8'> | |
7389 | ||
7390 | // looping over bins: | |
7391 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7392 | { | |
7393 | if(type == "RP") | |
7394 | { | |
7395 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b); | |
7396 | mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow | |
7397 | } else if(type == "POI") | |
7398 | { | |
7399 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b); | |
7400 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); | |
7401 | } | |
7402 | ||
7403 | // event weight for <2'>: | |
7404 | dw2 = mp*dMult-mq; | |
7405 | fDiffFlowSumOfEventWeights[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2); | |
7406 | fDiffFlowSumOfEventWeights[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw2,2.)); | |
7407 | ||
7408 | // event weight for <4'>: | |
7409 | dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
7410 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
7411 | fDiffFlowSumOfEventWeights[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4); | |
7412 | fDiffFlowSumOfEventWeights[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw4,2.)); | |
7413 | ||
7414 | // event weight for <6'>: | |
7415 | //dw6 = ...; | |
7416 | //fDiffFlowSumOfEventWeights[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6); | |
7417 | //fDiffFlowSumOfEventWeights[t][pe][t][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw6,2.)); | |
7418 | ||
7419 | // event weight for <8'>: | |
7420 | //dw8 = ...; | |
7421 | //fDiffFlowSumOfEventWeights[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw8); | |
7422 | //fDiffFlowSumOfEventWeights[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw8,2.)); | |
7423 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7424 | ||
7425 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfEventWeights() | |
7426 | ||
7427 | ||
7428 | //================================================================================================================================ | |
7429 | ||
7430 | ||
7431 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfProductOfEventWeights(TString type, TString ptOrEta) | |
7432 | { | |
7433 | // Calculate sum of products of various event weights for both types of correlations (the ones for int. and diff. flow). | |
7434 | // (These quantitites are needed in expressions for unbiased estimators relevant for the statistical errors.) | |
7435 | // | |
7436 | // Important: To fill fDiffFlowSumOfProductOfEventWeights[][][][] use bellow table (i,j) with following constraints: | |
7437 | // 1.) i<j | |
7438 | // 2.) do not store terms which DO NOT include reduced correlations; | |
7439 | // Table: | |
7440 | // [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] x [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] | |
7441 | ||
2a98ceb8 | 7442 | Int_t typeFlag = 0; |
7443 | Int_t ptEtaFlag = 0; | |
489d5531 | 7444 | |
7445 | if(type == "RP") | |
7446 | { | |
7447 | typeFlag = 0; | |
7448 | } else if(type == "POI") | |
7449 | { | |
7450 | typeFlag = 1; | |
7451 | } | |
7452 | ||
7453 | if(ptOrEta == "Pt") | |
7454 | { | |
7455 | ptEtaFlag = 0; | |
7456 | } else if(ptOrEta == "Eta") | |
7457 | { | |
7458 | ptEtaFlag = 1; | |
7459 | } | |
7460 | ||
7461 | // shortcuts: | |
7462 | Int_t t = typeFlag; | |
7463 | Int_t pe = ptEtaFlag; | |
7464 | ||
7465 | // binning: | |
7466 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
7467 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
7468 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
7469 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
7470 | ||
7471 | // protection: | |
7472 | for(Int_t rpq=0;rpq<3;rpq++) | |
7473 | { | |
7474 | for(Int_t m=0;m<4;m++) | |
7475 | { | |
7476 | for(Int_t k=0;k<9;k++) | |
7477 | { | |
7478 | if(!fReRPQ1dEBE[rpq][pe][m][k]) | |
7479 | { | |
7480 | cout<<"WARNING: fReRPQ1dEBE[rpq][pe][m][k] is NULL in AFAWQC::CSAPOEWFDF() !!!!"<<endl; | |
7481 | cout<<"pe = "<<pe<<endl; | |
7482 | cout<<"rpq = "<<rpq<<endl; | |
7483 | cout<<"m = "<<m<<endl; | |
7484 | cout<<"k = "<<k<<endl; | |
7485 | exit(0); | |
7486 | } | |
7487 | } | |
7488 | } | |
7489 | } | |
7490 | ||
7491 | // multiplicities: | |
1268c371 | 7492 | Double_t dMult = (*fSpk)(0,0); // total event multiplicity |
489d5531 | 7493 | //Double_t mr = 0.; // number of RPs in particular pt or eta bin |
7494 | Double_t mp = 0.; // number of POIs in particular pt or eta bin | |
7495 | Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin | |
7496 | ||
7497 | // event weights for correlations: | |
7498 | Double_t dW2 = dMult*(dMult-1); // event weight for <2> | |
7499 | Double_t dW4 = dMult*(dMult-1)*(dMult-2)*(dMult-3); // event weight for <4> | |
7500 | Double_t dW6 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5); // event weight for <6> | |
7501 | Double_t dW8 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)*(dMult-6)*(dMult-7); // event weight for <8> | |
7502 | ||
7503 | // event weights for reduced correlations: | |
7504 | Double_t dw2 = 0.; // event weight for <2'> | |
7505 | Double_t dw4 = 0.; // event weight for <4'> | |
7506 | //Double_t dw6 = 0.; // event weight for <6'> | |
7507 | //Double_t dw8 = 0.; // event weight for <8'> | |
7508 | ||
7509 | // looping over bins: | |
7510 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7511 | { | |
7512 | if(type == "RP") | |
7513 | { | |
7514 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b); | |
7515 | mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow | |
7516 | } else if(type == "POI") | |
7517 | { | |
7518 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b); | |
7519 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); | |
7520 | } | |
7521 | ||
7522 | // event weight for <2'>: | |
7523 | dw2 = mp*dMult-mq; | |
7524 | fDiffFlowSumOfProductOfEventWeights[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw2); // storing product of even weights for <2> and <2'> | |
7525 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW4); // storing product of even weights for <4> and <2'> | |
7526 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW6); // storing product of even weights for <6> and <2'> | |
7527 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW8); // storing product of even weights for <8> and <2'> | |
7528 | ||
7529 | // event weight for <4'>: | |
7530 | dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
7531 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
7532 | fDiffFlowSumOfProductOfEventWeights[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw4); // storing product of even weights for <2> and <4'> | |
7533 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw4); // storing product of even weights for <2'> and <4'> | |
7534 | fDiffFlowSumOfProductOfEventWeights[t][pe][2][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw4); // storing product of even weights for <4> and <4'> | |
7535 | fDiffFlowSumOfProductOfEventWeights[t][pe][3][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dW6); // storing product of even weights for <6> and <4'> | |
7536 | fDiffFlowSumOfProductOfEventWeights[t][pe][3][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dW8); // storing product of even weights for <8> and <4'> | |
7537 | ||
7538 | // event weight for <6'>: | |
7539 | //dw6 = ...; | |
7540 | //fDiffFlowSumOfProductOfEventWeights[t][pe][0][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw6); // storing product of even weights for <2> and <6'> | |
7541 | //fDiffFlowSumOfProductOfEventWeights[t][pe][1][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw6); // storing product of even weights for <2'> and <6'> | |
7542 | //fDiffFlowSumOfProductOfEventWeights[t][pe][2][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw6); // storing product of even weights for <4> and <6'> | |
7543 | //fDiffFlowSumOfProductOfEventWeights[t][pe][3][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dw6); // storing product of even weights for <4'> and <6'> | |
7544 | //fDiffFlowSumOfProductOfEventWeights[t][pe][4][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW6*dw6); // storing product of even weights for <6> and <6'> | |
7545 | //fDiffFlowSumOfProductOfEventWeights[t][pe][5][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dW8); // storing product of even weights for <6'> and <8> | |
7546 | //fDiffFlowSumOfProductOfEventWeights[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dw8); // storing product of even weights for <6'> and <8'> | |
7547 | ||
7548 | // event weight for <8'>: | |
7549 | //dw8 = ...; | |
7550 | //fDiffFlowSumOfProductOfEventWeights[t][pe][0][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw8); // storing product of even weights for <2> and <8'> | |
7551 | //fDiffFlowSumOfProductOfEventWeights[t][pe][1][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw8); // storing product of even weights for <2'> and <8'> | |
7552 | //fDiffFlowSumOfProductOfEventWeights[t][pe][2][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw8); // storing product of even weights for <4> and <8'> | |
7553 | //fDiffFlowSumOfProductOfEventWeights[t][pe][3][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dw8); // storing product of even weights for <4'> and <8'> | |
7554 | //fDiffFlowSumOfProductOfEventWeights[t][pe][4][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW6*dw8); // storing product of even weights for <6> and <8'> | |
7555 | //fDiffFlowSumOfProductOfEventWeights[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dw8); // storing product of even weights for <6'> and <8'> | |
7556 | //fDiffFlowSumOfProductOfEventWeights[t][pe][6][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW8*dw8); // storing product of even weights for <8> and <8'> | |
7557 | ||
7558 | // Table: | |
7559 | // [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] x [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] | |
7560 | ||
7561 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7562 | ||
7563 | ||
7564 | ||
7565 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfProductOfEventWeights(TString type, TString ptOrEta) | |
7566 | ||
489d5531 | 7567 | //================================================================================================================================ |
7568 | ||
489d5531 | 7569 | void AliFlowAnalysisWithQCumulants::FinalizeReducedCorrelations(TString type, TString ptOrEta) |
7570 | { | |
7571 | // Transfer profiles into histograms and calculate statistical errors correctly. | |
7572 | ||
1268c371 | 7573 | Int_t t = 0; // RP or POI |
7574 | Int_t pe = 0; // pt or eta | |
489d5531 | 7575 | |
7576 | if(type == "RP") | |
7577 | { | |
1268c371 | 7578 | t = 0; |
489d5531 | 7579 | } else if(type == "POI") |
7580 | { | |
1268c371 | 7581 | t = 1; |
489d5531 | 7582 | } |
7583 | ||
7584 | if(ptOrEta == "Pt") | |
7585 | { | |
1268c371 | 7586 | pe = 0; |
489d5531 | 7587 | } else if(ptOrEta == "Eta") |
7588 | { | |
1268c371 | 7589 | pe = 1; |
489d5531 | 7590 | } |
1268c371 | 7591 | |
7592 | for(Int_t rci=0;rci<4;rci++) // to be improved - moved into the method CheckPointersUsedInFinish() | |
489d5531 | 7593 | { |
7594 | if(!fDiffFlowCorrelationsPro[t][pe][rci]) | |
7595 | { | |
7596 | cout<<"WARNING: fDiffFlowCorrelationsPro[t][pe][rci] is NULL in AFAWQC::FRC() !!!!"<<endl; | |
7597 | cout<<"t = "<<t<<endl; | |
7598 | cout<<"pe = "<<pe<<endl; | |
7599 | cout<<"rci = "<<rci<<endl; | |
7600 | exit(0); | |
7601 | } | |
b40a910e | 7602 | if(!fDiffFlowSquaredCorrelationsPro[t][pe][rci]) |
7603 | { | |
7604 | cout<<"WARNING: fDiffFlowSquaredCorrelationsPro[t][pe][rci] is NULL in AFAWQC::FRC() !!!!"<<endl; | |
7605 | cout<<"t = "<<t<<endl; | |
7606 | cout<<"pe = "<<pe<<endl; | |
7607 | cout<<"rci = "<<rci<<endl; | |
7608 | exit(0); | |
7609 | } | |
489d5531 | 7610 | for(Int_t power=0;power<2;power++) |
7611 | { | |
7612 | if(!fDiffFlowSumOfEventWeights[t][pe][power][rci]) | |
7613 | { | |
7614 | cout<<"WARNING: fDiffFlowSumOfEventWeights[t][pe][power][rci] is NULL in AFAWQC::FRC() !!!!"<<endl; | |
7615 | cout<<"t = "<<t<<endl; | |
7616 | cout<<"pe = "<<pe<<endl; | |
7617 | cout<<"power = "<<power<<endl; | |
7618 | cout<<"rci = "<<rci<<endl; | |
7619 | exit(0); | |
7620 | } | |
7621 | } // end of for(Int_t power=0;power<2;power++) | |
7622 | } // end of for(Int_t rci=0;rci<4;rci++) | |
7623 | ||
7624 | // common: | |
b40a910e | 7625 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
489d5531 | 7626 | // transfer 1D profile into 1D histogram: |
7627 | Double_t correlation = 0.; | |
b40a910e | 7628 | Double_t squaredCorrelation = 0.; |
489d5531 | 7629 | Double_t spread = 0.; |
7630 | Double_t sumOfWeights = 0.; // sum of weights for particular reduced correlations for particular pt or eta bin | |
7631 | Double_t sumOfSquaredWeights = 0.; // sum of squared weights for particular reduced correlations for particular pt or eta bin | |
7632 | Double_t error = 0.; // error = termA * spread * termB | |
7633 | // termA = (sqrt(sumOfSquaredWeights)/sumOfWeights) | |
7634 | // termB = 1/pow(1-termA^2,0.5) | |
7635 | Double_t termA = 0.; | |
7636 | Double_t termB = 0.; | |
7637 | for(Int_t rci=0;rci<4;rci++) // index of reduced correlation | |
7638 | { | |
7639 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) // number of pt or eta bins | |
7640 | { | |
b40a910e | 7641 | if(fDiffFlowCorrelationsPro[t][pe][rci]->GetBinEffectiveEntries(b) < 2 || |
7642 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->GetBinEffectiveEntries(b) < 2) | |
7643 | { | |
7644 | fDiffFlowCorrelationsPro[t][pe][rci]->SetBinError(b,0.); | |
7645 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->SetBinError(b,0.); | |
7646 | continue; // to be improved - should I ignore results in pt bins with one entry for reduced correlations or not? | |
7647 | } | |
489d5531 | 7648 | correlation = fDiffFlowCorrelationsPro[t][pe][rci]->GetBinContent(b); |
b40a910e | 7649 | squaredCorrelation = fDiffFlowSquaredCorrelationsPro[t][pe][rci]->GetBinContent(b); |
7650 | if(squaredCorrelation-correlation*correlation >= 0.) | |
7651 | { | |
7652 | spread = pow(squaredCorrelation-correlation*correlation,0.5); | |
7653 | } else | |
7654 | { | |
7655 | cout<<endl; | |
7656 | cout<<Form(" WARNING: Imaginary 'spread' for rci = %d, pe = %d, bin = %d !!!!",rci,pe,b)<<endl; | |
7657 | cout<<endl; | |
7658 | } | |
489d5531 | 7659 | sumOfWeights = fDiffFlowSumOfEventWeights[t][pe][0][rci]->GetBinContent(b); |
7660 | sumOfSquaredWeights = fDiffFlowSumOfEventWeights[t][pe][1][rci]->GetBinContent(b); | |
1268c371 | 7661 | if(TMath::Abs(sumOfWeights)>0.){termA = (pow(sumOfSquaredWeights,0.5)/sumOfWeights);} |
7662 | if(1.-pow(termA,2.)>0.){termB = 1./pow(1.-pow(termA,2.),0.5);} | |
489d5531 | 7663 | error = termA*spread*termB; // final error (unbiased estimator for standard deviation) |
7664 | fDiffFlowCorrelationsHist[t][pe][rci]->SetBinContent(b,correlation); | |
7665 | fDiffFlowCorrelationsHist[t][pe][rci]->SetBinError(b,error); | |
7666 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7667 | } // end of for(Int_t rci=0;rci<4;rci++) | |
7668 | ||
7669 | } // end of void AliFlowAnalysisWithQCumulants::FinalizeReducedCorrelations(TString type, TString ptOrEta) | |
7670 | ||
489d5531 | 7671 | //================================================================================================================================ |
7672 | ||
489d5531 | 7673 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowProductOfCorrelations(TString type, TString ptOrEta) |
7674 | { | |
7675 | // store products: <2><2'>, <2><4'>, <2><6'>, <2><8'>, <2'><4>, | |
7676 | // <2'><4'>, <2'><6>, <2'><6'>, <2'><8>, <2'><8'>, | |
7677 | // <4><4'>, <4><6'>, <4><8'>, <4'><6>, <4'><6'>, | |
7678 | // <4'><8>, <4'><8'>, <6><6'>, <6><8'>, <6'><8>, | |
7679 | // <6'><8'>, <8><8'>. | |
7680 | ||
2a98ceb8 | 7681 | Int_t typeFlag = 0; |
7682 | Int_t ptEtaFlag = 0; | |
489d5531 | 7683 | |
7684 | if(type == "RP") | |
7685 | { | |
7686 | typeFlag = 0; | |
7687 | } else if(type == "POI") | |
7688 | { | |
7689 | typeFlag = 1; | |
7690 | } | |
7691 | ||
7692 | if(ptOrEta == "Pt") | |
7693 | { | |
7694 | ptEtaFlag = 0; | |
7695 | } else if(ptOrEta == "Eta") | |
7696 | { | |
7697 | ptEtaFlag = 1; | |
7698 | } | |
7699 | ||
7700 | // shortcuts: | |
7701 | Int_t t = typeFlag; | |
7702 | Int_t pe = ptEtaFlag; | |
7703 | ||
7704 | // common: | |
7705 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
7706 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
7707 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
7708 | ||
7709 | // protections // to be improved (add protection for all pointers in this method) | |
7710 | if(!fIntFlowCorrelationsEBE) | |
7711 | { | |
7712 | cout<<"WARNING: fIntFlowCorrelationsEBE is NULL in AFAWQC::CDFPOC() !!!!"<<endl; | |
7713 | exit(0); | |
7714 | } | |
7715 | ||
7716 | /* | |
1268c371 | 7717 | Double_t dMult = (*fSpk)(0,0); // multiplicity (number of particles used to determine the reaction plane) |
489d5531 | 7718 | //Double_t mr = 0.; // number of RPs in particular pt or eta bin |
7719 | Double_t mp = 0.; // number of POIs in particular pt or eta bin | |
7720 | Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin | |
7721 | */ | |
7722 | ||
7723 | // e-b-e correlations: | |
7724 | Double_t twoEBE = fIntFlowCorrelationsEBE->GetBinContent(1); // <2> | |
7725 | Double_t fourEBE = fIntFlowCorrelationsEBE->GetBinContent(2); // <4> | |
7726 | Double_t sixEBE = fIntFlowCorrelationsEBE->GetBinContent(3); // <6> | |
7727 | Double_t eightEBE = fIntFlowCorrelationsEBE->GetBinContent(4); // <8> | |
7728 | ||
7729 | // event weights for correlations: | |
7730 | Double_t dW2 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1); // event weight for <2> | |
7731 | Double_t dW4 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2); // event weight for <4> | |
7732 | Double_t dW6 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(3); // event weight for <6> | |
7733 | Double_t dW8 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(4); // event weight for <8> | |
7734 | ||
7735 | // e-b-e reduced correlations: | |
7736 | Double_t twoReducedEBE = 0.; // <2'> | |
7737 | Double_t fourReducedEBE = 0.; // <4'> | |
7738 | Double_t sixReducedEBE = 0.; // <6'> | |
7739 | Double_t eightReducedEBE = 0.; // <8'> | |
7740 | ||
7741 | // event weights for reduced correlations: | |
7742 | Double_t dw2 = 0.; // event weight for <2'> | |
7743 | Double_t dw4 = 0.; // event weight for <4'> | |
7744 | //Double_t dw6 = 0.; // event weight for <6'> | |
7745 | //Double_t dw8 = 0.; // event weight for <8'> | |
7746 | ||
7747 | // looping over bins: | |
7748 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7749 | { | |
7750 | // e-b-e reduced correlations: | |
7751 | twoReducedEBE = fDiffFlowCorrelationsEBE[t][pe][0]->GetBinContent(b); | |
7752 | fourReducedEBE = fDiffFlowCorrelationsEBE[t][pe][1]->GetBinContent(b); | |
7753 | sixReducedEBE = fDiffFlowCorrelationsEBE[t][pe][2]->GetBinContent(b); | |
7754 | eightReducedEBE = fDiffFlowCorrelationsEBE[t][pe][3]->GetBinContent(b); | |
7755 | ||
7756 | /* | |
7757 | // to be improved (I should not do this here again) | |
7758 | if(type == "RP") | |
7759 | { | |
7760 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b); | |
7761 | mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow | |
7762 | } else if(type == "POI") | |
7763 | { | |
7764 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b); | |
7765 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); | |
7766 | } | |
7767 | ||
7768 | // event weights for reduced correlations: | |
7769 | dw2 = mp*dMult-mq; // weight for <2'> | |
7770 | dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
7771 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); // weight for <4'> | |
7772 | //dw6 = ... | |
7773 | //dw8 = ... | |
7774 | ||
7775 | */ | |
7776 | ||
7777 | dw2 = fDiffFlowEventWeightsForCorrelationsEBE[t][pe][0]->GetBinContent(b); | |
7778 | dw4 = fDiffFlowEventWeightsForCorrelationsEBE[t][pe][1]->GetBinContent(b); | |
7779 | ||
7780 | // storing all products: | |
7781 | fDiffFlowProductOfCorrelationsPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*twoReducedEBE,dW2*dw2); // storing <2><2'> | |
7782 | fDiffFlowProductOfCorrelationsPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*twoReducedEBE,dW4*dw2); // storing <4><2'> | |
7783 | fDiffFlowProductOfCorrelationsPro[t][pe][1][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*twoReducedEBE,dW6*dw2); // storing <6><2'> | |
7784 | fDiffFlowProductOfCorrelationsPro[t][pe][1][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*twoReducedEBE,dW8*dw2); // storing <8><2'> | |
7785 | ||
7786 | // event weight for <4'>: | |
7787 | fDiffFlowProductOfCorrelationsPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*fourReducedEBE,dW2*dw4); // storing <2><4'> | |
7788 | fDiffFlowProductOfCorrelationsPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*fourReducedEBE,dw2*dw4); // storing <2'><4'> | |
7789 | fDiffFlowProductOfCorrelationsPro[t][pe][2][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*fourReducedEBE,dW4*dw4); // storing <4><4'> | |
7790 | fDiffFlowProductOfCorrelationsPro[t][pe][3][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*fourReducedEBE,dW6*dw4); // storing <6><4'> | |
7791 | fDiffFlowProductOfCorrelationsPro[t][pe][3][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*fourReducedEBE,dW8*dw4); // storing <8><4'> | |
7792 | ||
7793 | // event weight for <6'>: | |
7794 | //dw6 = ...; | |
7795 | //fDiffFlowProductOfCorrelationsPro[t][pe][0][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*sixReducedEBE,dW2*dw6); // storing <2><6'> | |
7796 | //fDiffFlowProductOfCorrelationsPro[t][pe][1][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*sixReducedEBE,dw2*dw6); // storing <2'><6'> | |
7797 | //fDiffFlowProductOfCorrelationsPro[t][pe][2][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*sixReducedEBE,dW4*dw6); // storing <4><6'> | |
7798 | //fDiffFlowProductOfCorrelationsPro[t][pe][3][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourReducedEBE*sixReducedEBE,dw4*dw6); // storing <4'><6'> | |
7799 | //fDiffFlowProductOfCorrelationsPro[t][pe][4][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*sixReducedEBE,dW6*dw6); // storing <6><6'> | |
7800 | //fDiffFlowProductOfCorrelationsPro[t][pe][5][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightEBE,dw6*dW8); // storing <6'><8> | |
7801 | //fDiffFlowProductOfCorrelationsPro[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightReducedEBE,dw6*dw8); // storing <6'><8'> | |
7802 | ||
7803 | // event weight for <8'>: | |
7804 | //dw8 = ...; | |
7805 | //fDiffFlowProductOfCorrelationsPro[t][pe][0][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*eightReducedEBE,dW2*dw8); // storing <2><8'> | |
7806 | //fDiffFlowProductOfCorrelationsPro[t][pe][1][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*eightReducedEBE,dw2*dw8); // storing <2'><8'> | |
7807 | //fDiffFlowProductOfCorrelationsPro[t][pe][2][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*eightReducedEBE,dW4*dw8); // storing <4><8'> | |
7808 | //fDiffFlowProductOfCorrelationsPro[t][pe][3][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourReducedEBE*eightReducedEBE,dw4*dw8); // storing <4'><8'> | |
7809 | //fDiffFlowProductOfCorrelationsPro[t][pe][4][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*eightReducedEBE,dW6*dw8); // storing <6><8'> | |
7810 | //fDiffFlowProductOfCorrelationsPro[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightReducedEBE,dw6*dw8); // storing <6'><8'> | |
7811 | //fDiffFlowProductOfCorrelationsPro[t][pe][6][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*eightReducedEBE,dW8*dw8); // storing <8><8'> | |
7812 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++ | |
7813 | ||
7814 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowProductOfCorrelations(TString type, TString ptOrEta) | |
7815 | ||
489d5531 | 7816 | //================================================================================================================================ |
7817 | ||
489d5531 | 7818 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCovariances(TString type, TString ptOrEta) // to be improved (reimplemented) |
7819 | { | |
7820 | // a) Calculate unbiased estimators Cov(<2>,<2'>), Cov(<2>,<4'>), Cov(<4>,<2'>), Cov(<4>,<4'>) and Cov(<2'>,<4'>) | |
7821 | // for covariances V(<2>,<2'>), V(<2>,<4'>), V(<4>,<2'>), V(<4>,<4'>) and V(<2'>,<4'>). | |
7822 | // b) Store in histogram fDiffFlowCovariances[t][pe][index] for instance the following: | |
7823 | // | |
7824 | // Cov(<2>,<2'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] | |
7825 | // | |
7826 | // where N is the number of events, w_{<2>} is event weight for <2> and w_{<2'>} is event weight for <2'>. | |
7827 | // c) Binning of fDiffFlowCovariances[t][pe][index] is organized as follows: | |
7828 | // | |
7829 | // 1st bin: Cov(<2>,<2'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] | |
7830 | // 2nd bin: Cov(<2>,<4'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] | |
7831 | // 3rd bin: Cov(<4>,<2'>) * (sum_{i=1}^{N} w_{<4>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] | |
7832 | // 4th bin: Cov(<4>,<4'>) * (sum_{i=1}^{N} w_{<4>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] | |
7833 | // 5th bin: Cov(<2'>,<4'>) * (sum_{i=1}^{N} w_{<2'>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<2'>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] | |
7834 | // ... | |
7835 | ||
2a98ceb8 | 7836 | Int_t typeFlag = 0; |
7837 | Int_t ptEtaFlag = 0; | |
489d5531 | 7838 | |
7839 | if(type == "RP") | |
7840 | { | |
7841 | typeFlag = 0; | |
7842 | } else if(type == "POI") | |
7843 | { | |
7844 | typeFlag = 1; | |
7845 | } | |
7846 | ||
7847 | if(ptOrEta == "Pt") | |
7848 | { | |
7849 | ptEtaFlag = 0; | |
7850 | } else if(ptOrEta == "Eta") | |
7851 | { | |
7852 | ptEtaFlag = 1; | |
7853 | } | |
7854 | ||
7855 | // shortcuts: | |
7856 | Int_t t = typeFlag; | |
7857 | Int_t pe = ptEtaFlag; | |
7858 | ||
7859 | // common: | |
7860 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
7861 | //Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
7862 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
7863 | //Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
7864 | ||
7865 | // average correlations: | |
7866 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> | |
7867 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> | |
7868 | //Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> | |
7869 | //Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> | |
7870 | ||
7871 | // sum of weights for correlation: | |
7872 | Double_t sumOfWeightsForTwo = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // sum_{i=1}^{N} w_{<2>} | |
7873 | Double_t sumOfWeightsForFour = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // sum_{i=1}^{N} w_{<4>} | |
7874 | //Double_t sumOfWeightsForSix = fIntFlowSumOfEventWeights[0]->GetBinContent(3); // sum_{i=1}^{N} w_{<6>} | |
7875 | //Double_t sumOfWeightsForEight = fIntFlowSumOfEventWeights[0]->GetBinContent(4); // sum_{i=1}^{N} w_{<8>} | |
7876 | ||
7877 | // average reduced correlations: | |
7878 | Double_t twoReduced = 0.; // <<2'>> | |
7879 | Double_t fourReduced = 0.; // <<4'>> | |
7880 | //Double_t sixReduced = 0.; // <<6'>> | |
7881 | //Double_t eightReduced = 0.; // <<8'>> | |
7882 | ||
7883 | // sum of weights for reduced correlation: | |
7884 | Double_t sumOfWeightsForTwoReduced = 0.; // sum_{i=1}^{N} w_{<2'>} | |
7885 | Double_t sumOfWeightsForFourReduced = 0.; // sum_{i=1}^{N} w_{<4'>} | |
7886 | //Double_t sumOfWeightsForSixReduced = 0.; // sum_{i=1}^{N} w_{<6'>} | |
7887 | //Double_t sumOfWeightsForEightReduced = 0.; // sum_{i=1}^{N} w_{<8'>} | |
7888 | ||
7889 | // product of weights for reduced correlation: | |
7890 | Double_t productOfWeightsForTwoTwoReduced = 0.; // sum_{i=1}^{N} w_{<2>}w_{<2'>} | |
7891 | Double_t productOfWeightsForTwoFourReduced = 0.; // sum_{i=1}^{N} w_{<2>}w_{<4'>} | |
7892 | Double_t productOfWeightsForFourTwoReduced = 0.; // sum_{i=1}^{N} w_{<4>}w_{<2'>} | |
7893 | Double_t productOfWeightsForFourFourReduced = 0.; // sum_{i=1}^{N} w_{<4>}w_{<4'>} | |
7894 | Double_t productOfWeightsForTwoReducedFourReduced = 0.; // sum_{i=1}^{N} w_{<2'>}w_{<4'>} | |
7895 | // ... | |
7896 | ||
7897 | // products for differential flow: | |
7898 | Double_t twoTwoReduced = 0; // <<2><2'>> | |
7899 | Double_t twoFourReduced = 0; // <<2><4'>> | |
7900 | Double_t fourTwoReduced = 0; // <<4><2'>> | |
7901 | Double_t fourFourReduced = 0; // <<4><4'>> | |
7902 | Double_t twoReducedFourReduced = 0; // <<2'><4'>> | |
7903 | ||
7904 | // denominators in the expressions for the unbiased estimators for covariances: | |
7905 | // denominator = 1 - term1/(term2*term3) | |
7906 | // prefactor = term1/(term2*term3) | |
7907 | Double_t denominator = 0.; | |
7908 | Double_t prefactor = 0.; | |
7909 | Double_t term1 = 0.; | |
7910 | Double_t term2 = 0.; | |
7911 | Double_t term3 = 0.; | |
7912 | ||
7913 | // unbiased estimators for covariances for differential flow: | |
7914 | Double_t covTwoTwoReduced = 0.; // Cov(<2>,<2'>) | |
7915 | Double_t wCovTwoTwoReduced = 0.; // Cov(<2>,<2'>) * prefactor(w_{<2>},w_{<2'>}) | |
7916 | Double_t covTwoFourReduced = 0.; // Cov(<2>,<4'>) | |
7917 | Double_t wCovTwoFourReduced = 0.; // Cov(<2>,<4'>) * prefactor(w_{<2>},w_{<4'>}) | |
7918 | Double_t covFourTwoReduced = 0.; // Cov(<4>,<2'>) | |
7919 | Double_t wCovFourTwoReduced = 0.; // Cov(<4>,<2'>) * prefactor(w_{<4>},w_{<2'>}) | |
7920 | Double_t covFourFourReduced = 0.; // Cov(<4>,<4'>) | |
7921 | Double_t wCovFourFourReduced = 0.; // Cov(<4>,<4'>) * prefactor(w_{<4>},w_{<4'>}) | |
7922 | Double_t covTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) | |
7923 | Double_t wCovTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) * prefactor(w_{<2'>},w_{<4'>}) | |
7924 | ||
7925 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7926 | { | |
7927 | // average reduced corelations: | |
7928 | twoReduced = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); | |
7929 | fourReduced = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); | |
7930 | // average products: | |
7931 | twoTwoReduced = fDiffFlowProductOfCorrelationsPro[t][pe][0][1]->GetBinContent(b); | |
7932 | twoFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][0][3]->GetBinContent(b); | |
7933 | fourTwoReduced = fDiffFlowProductOfCorrelationsPro[t][pe][1][2]->GetBinContent(b); | |
7934 | fourFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][2][3]->GetBinContent(b); | |
7935 | twoReducedFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][1][3]->GetBinContent(b); | |
7936 | // sum of weights for reduced correlations: | |
7937 | sumOfWeightsForTwoReduced = fDiffFlowSumOfEventWeights[t][pe][0][0]->GetBinContent(b); | |
7938 | sumOfWeightsForFourReduced = fDiffFlowSumOfEventWeights[t][pe][0][1]->GetBinContent(b); | |
7939 | // products of weights for correlations: | |
7940 | productOfWeightsForTwoTwoReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][0][1]->GetBinContent(b); | |
7941 | productOfWeightsForTwoFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][0][3]->GetBinContent(b); | |
7942 | productOfWeightsForFourTwoReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][1][2]->GetBinContent(b); | |
7943 | productOfWeightsForFourFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][2][3]->GetBinContent(b); | |
7944 | productOfWeightsForTwoReducedFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][1][3]->GetBinContent(b); | |
7945 | // denominator for the unbiased estimator for covariances: 1 - term1/(term2*term3) | |
7946 | // prefactor (multiplies Cov's) = term1/(term2*term3) | |
7947 | // <2>,<2'>: | |
7948 | term1 = productOfWeightsForTwoTwoReduced; | |
7949 | term2 = sumOfWeightsForTwo; | |
7950 | term3 = sumOfWeightsForTwoReduced; | |
7951 | if(term2*term3>0.) | |
7952 | { | |
7953 | denominator = 1.-term1/(term2*term3); | |
7954 | prefactor = term1/(term2*term3); | |
1268c371 | 7955 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 7956 | { |
7957 | covTwoTwoReduced = (twoTwoReduced-two*twoReduced)/denominator; | |
7958 | wCovTwoTwoReduced = covTwoTwoReduced*prefactor; | |
7959 | fDiffFlowCovariances[t][pe][0]->SetBinContent(b,wCovTwoTwoReduced); | |
7960 | } | |
7961 | } | |
7962 | // <2>,<4'>: | |
7963 | term1 = productOfWeightsForTwoFourReduced; | |
7964 | term2 = sumOfWeightsForTwo; | |
7965 | term3 = sumOfWeightsForFourReduced; | |
7966 | if(term2*term3>0.) | |
7967 | { | |
7968 | denominator = 1.-term1/(term2*term3); | |
7969 | prefactor = term1/(term2*term3); | |
1268c371 | 7970 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 7971 | { |
7972 | covTwoFourReduced = (twoFourReduced-two*fourReduced)/denominator; | |
7973 | wCovTwoFourReduced = covTwoFourReduced*prefactor; | |
7974 | fDiffFlowCovariances[t][pe][1]->SetBinContent(b,wCovTwoFourReduced); | |
7975 | } | |
7976 | } | |
7977 | // <4>,<2'>: | |
7978 | term1 = productOfWeightsForFourTwoReduced; | |
7979 | term2 = sumOfWeightsForFour; | |
7980 | term3 = sumOfWeightsForTwoReduced; | |
7981 | if(term2*term3>0.) | |
7982 | { | |
7983 | denominator = 1.-term1/(term2*term3); | |
7984 | prefactor = term1/(term2*term3); | |
1268c371 | 7985 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 7986 | { |
7987 | covFourTwoReduced = (fourTwoReduced-four*twoReduced)/denominator; | |
7988 | wCovFourTwoReduced = covFourTwoReduced*prefactor; | |
7989 | fDiffFlowCovariances[t][pe][2]->SetBinContent(b,wCovFourTwoReduced); | |
7990 | } | |
7991 | } | |
7992 | // <4>,<4'>: | |
7993 | term1 = productOfWeightsForFourFourReduced; | |
7994 | term2 = sumOfWeightsForFour; | |
7995 | term3 = sumOfWeightsForFourReduced; | |
7996 | if(term2*term3>0.) | |
7997 | { | |
7998 | denominator = 1.-term1/(term2*term3); | |
7999 | prefactor = term1/(term2*term3); | |
1268c371 | 8000 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 8001 | { |
8002 | covFourFourReduced = (fourFourReduced-four*fourReduced)/denominator; | |
8003 | wCovFourFourReduced = covFourFourReduced*prefactor; | |
8004 | fDiffFlowCovariances[t][pe][3]->SetBinContent(b,wCovFourFourReduced); | |
8005 | } | |
8006 | } | |
8007 | // <2'>,<4'>: | |
8008 | term1 = productOfWeightsForTwoReducedFourReduced; | |
8009 | term2 = sumOfWeightsForTwoReduced; | |
8010 | term3 = sumOfWeightsForFourReduced; | |
8011 | if(term2*term3>0.) | |
8012 | { | |
8013 | denominator = 1.-term1/(term2*term3); | |
8014 | prefactor = term1/(term2*term3); | |
1268c371 | 8015 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 8016 | { |
8017 | covTwoReducedFourReduced = (twoReducedFourReduced-twoReduced*fourReduced)/denominator; | |
8018 | wCovTwoReducedFourReduced = covTwoReducedFourReduced*prefactor; | |
8019 | fDiffFlowCovariances[t][pe][4]->SetBinContent(b,wCovTwoReducedFourReduced); | |
8020 | } | |
8021 | } | |
8022 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
8023 | ||
8024 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCovariances(TString type, TString ptOrEta) | |
8025 | ||
489d5531 | 8026 | //================================================================================================================================ |
8027 | ||
489d5531 | 8028 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, TString ptOrEta) |
8029 | { | |
1268c371 | 8030 | // Calculate final results for differential flow. |
489d5531 | 8031 | |
1268c371 | 8032 | // REMARK: Differential flow calculated in this method is NOT corrected for non-uniform acceptance. |
8033 | // This correction, if enabled via setter SetApplyCorrectionForNUA(Bool_t), is applied in the method | |
8034 | // CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta) | |
8035 | ||
8036 | Int_t t = 0; // RP or POI | |
8037 | Int_t pe = 0; // pt or eta | |
489d5531 | 8038 | |
8039 | if(type == "RP") | |
8040 | { | |
1268c371 | 8041 | t = 0; |
489d5531 | 8042 | } else if(type == "POI") |
8043 | { | |
1268c371 | 8044 | t = 1; |
489d5531 | 8045 | } |
8046 | ||
8047 | if(ptOrEta == "Pt") | |
8048 | { | |
1268c371 | 8049 | pe = 0; |
489d5531 | 8050 | } else if(ptOrEta == "Eta") |
8051 | { | |
1268c371 | 8052 | pe = 1; |
489d5531 | 8053 | } |
1268c371 | 8054 | |
8055 | // Common: | |
489d5531 | 8056 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
1268c371 | 8057 | // Correlations: |
489d5531 | 8058 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> |
1268c371 | 8059 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> |
8060 | // Statistical errors of correlations: | |
489d5531 | 8061 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); |
8062 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); | |
1268c371 | 8063 | // Reduced correlations: |
489d5531 | 8064 | Double_t twoReduced = 0.; // <<2'>> |
8065 | Double_t fourReduced = 0.; // <<4'>> | |
1268c371 | 8066 | // Statistical errors of reduced correlations: |
489d5531 | 8067 | Double_t twoReducedError = 0.; |
8068 | Double_t fourReducedError = 0.; | |
1268c371 | 8069 | // Covariances: |
8e1cefdd | 8070 | Double_t wCovTwoFour = 0.; // Cov(<2>,<4>) * prefactor(<2>,<4>) |
8071 | if(!fForgetAboutCovariances) | |
8072 | { | |
8073 | wCovTwoFour = fIntFlowCovariances->GetBinContent(1); // Cov(<2>,<4>) * prefactor(<2>,<4>) | |
8074 | } | |
489d5531 | 8075 | Double_t wCovTwoTwoReduced = 0.; // Cov(<2>,<2'>) * prefactor(<2>,<2'>) |
8076 | Double_t wCovTwoFourReduced = 0.; // Cov(<2>,<4'>) * prefactor(<2>,<4'>) | |
8077 | Double_t wCovFourTwoReduced = 0.; // Cov(<4>,<2'>) * prefactor(<4>,<2'>) | |
8078 | Double_t wCovFourFourReduced = 0.; // Cov(<4>,<4'>) * prefactor(<4>,<4'>) | |
8079 | Double_t wCovTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) * prefactor(<2'>,<4'>) | |
1268c371 | 8080 | // Differential flow: |
489d5531 | 8081 | Double_t v2Prime = 0.; // v'{2} |
8082 | Double_t v4Prime = 0.; // v'{4} | |
1268c371 | 8083 | // Statistical error of differential flow: |
489d5531 | 8084 | Double_t v2PrimeError = 0.; |
8085 | Double_t v4PrimeError = 0.; | |
1268c371 | 8086 | // Squared statistical error of differential flow: |
489d5531 | 8087 | Double_t v2PrimeErrorSquared = 0.; |
8088 | Double_t v4PrimeErrorSquared = 0.; | |
1268c371 | 8089 | // Loop over pt or eta bins: |
489d5531 | 8090 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) |
8091 | { | |
1268c371 | 8092 | // Reduced correlations and statistical errors: |
489d5531 | 8093 | twoReduced = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); |
8094 | twoReducedError = fDiffFlowCorrelationsHist[t][pe][0]->GetBinError(b); | |
8095 | fourReduced = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); | |
8096 | fourReducedError = fDiffFlowCorrelationsHist[t][pe][1]->GetBinError(b); | |
1268c371 | 8097 | // Covariances: |
8e1cefdd | 8098 | if(!fForgetAboutCovariances) |
8099 | { | |
8100 | wCovTwoTwoReduced = fDiffFlowCovariances[t][pe][0]->GetBinContent(b); | |
8101 | wCovTwoFourReduced = fDiffFlowCovariances[t][pe][1]->GetBinContent(b); | |
8102 | wCovFourTwoReduced = fDiffFlowCovariances[t][pe][2]->GetBinContent(b); | |
8103 | wCovFourFourReduced = fDiffFlowCovariances[t][pe][3]->GetBinContent(b); | |
8104 | wCovTwoReducedFourReduced = fDiffFlowCovariances[t][pe][4]->GetBinContent(b); | |
8105 | } | |
1268c371 | 8106 | // Differential flow: |
489d5531 | 8107 | // v'{2}: |
8108 | if(two>0.) | |
8109 | { | |
8110 | v2Prime = twoReduced/pow(two,0.5); | |
1268c371 | 8111 | v2PrimeErrorSquared = (1./4.)*pow(two,-3.)*(pow(twoReduced,2.)*pow(twoError,2.) |
8112 | + 4.*pow(two,2.)*pow(twoReducedError,2.) | |
8113 | - 4.*two*twoReduced*wCovTwoTwoReduced); | |
8114 | if(v2PrimeErrorSquared>0.){v2PrimeError = pow(v2PrimeErrorSquared,0.5);} | |
8115 | if(TMath::Abs(v2Prime)>0.) | |
8116 | { | |
8117 | fDiffFlow[t][pe][0]->SetBinContent(b,v2Prime); | |
8118 | fDiffFlow[t][pe][0]->SetBinError(b,v2PrimeError); | |
8119 | } | |
8120 | } // end of if(two>0.) | |
489d5531 | 8121 | // differential flow: |
8122 | // v'{4} | |
8123 | if(2.*pow(two,2.)-four > 0.) | |
8124 | { | |
8125 | v4Prime = (2.*two*twoReduced-fourReduced)/pow(2.*pow(two,2.)-four,3./4.); | |
1268c371 | 8126 | v4PrimeErrorSquared = pow(2.*pow(two,2.)-four,-7./2.) |
8127 | * (pow(2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced,2.)*pow(twoError,2.) | |
8128 | + (9./16.)*pow(2.*two*twoReduced-fourReduced,2.)*pow(fourError,2.) | |
8129 | + 4.*pow(two,2.)*pow(2.*pow(two,2.)-four,2.)*pow(twoReducedError,2.) | |
8130 | + pow(2.*pow(two,2.)-four,2.)*pow(fourReducedError,2.) | |
8131 | - (3./2.)*(2.*two*twoReduced-fourReduced) | |
8132 | * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoFour | |
8133 | - 4.*two*(2.*pow(two,2.)-four) | |
8134 | * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoTwoReduced | |
8135 | + 2.*(2.*pow(two,2.)-four) | |
8136 | * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoFourReduced | |
8137 | + 3.*two*(2.*pow(two,2.)-four)*(2.*two*twoReduced-fourReduced)*wCovFourTwoReduced | |
8138 | - (3./2.)*(2.*pow(two,2.)-four)*(2.*two*twoReduced-fourReduced)*wCovFourFourReduced | |
8139 | - 4.*two*pow(2.*pow(two,2.)-four,2.)*wCovTwoReducedFourReduced); | |
8140 | if(v4PrimeErrorSquared>0.){v4PrimeError = pow(v4PrimeErrorSquared,0.5);} | |
8141 | if(TMath::Abs(v4Prime)>0.) | |
8142 | { | |
8143 | fDiffFlow[t][pe][1]->SetBinContent(b,v4Prime); | |
8144 | fDiffFlow[t][pe][1]->SetBinError(b,v4PrimeError); | |
8145 | } | |
8146 | } // end of if(2.*pow(two,2.)-four > 0.) | |
489d5531 | 8147 | } // end of for(Int_t b=1;b<=fnBinsPtEta[pe];b++) |
1268c371 | 8148 | |
8149 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, Bool_t useParticleWeights) | |
8150 | ||
8151 | //================================================================================================================================ | |
8152 | ||
8153 | void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlow(TString type) | |
8154 | { | |
8155 | // Calculate final results for 2D diferential flow. | |
8156 | ||
8157 | // to be improved - check pointers used in this method | |
8158 | ||
8159 | Int_t t = 0; // RP or POI | |
8160 | ||
8161 | if(type == "RP") | |
8162 | { | |
8163 | t = 0; | |
8164 | } else if(type == "POI") | |
8165 | { | |
8166 | t = 1; | |
8167 | } | |
489d5531 | 8168 | |
1268c371 | 8169 | // Differential flow: |
8170 | Double_t v2Prime = 0.; // v'{2} | |
8171 | Double_t v4Prime = 0.; // v'{4} | |
8172 | // Differential cumulants: | |
8173 | Double_t qc2Prime = 0.; // QC{2'} | |
8174 | Double_t qc4Prime = 0.; // QC{4'} | |
8175 | // Looping over all (pt,eta) bins and calculating differential flow: | |
8176 | for(Int_t p=1;p<=fnBinsPt;p++) | |
489d5531 | 8177 | { |
1268c371 | 8178 | for(Int_t e=1;e<=fnBinsEta;e++) |
489d5531 | 8179 | { |
1268c371 | 8180 | // QC{2'}: |
8181 | qc2Prime = f2DDiffFlowCumulants[t][0]->GetBinContent(f2DDiffFlowCumulants[t][0]->GetBin(p,e)); | |
8182 | if(qc2Prime>=0.) | |
8183 | { | |
8184 | v2Prime = pow(qc2Prime,0.5); | |
8185 | f2DDiffFlow[t][0]->SetBinContent(f2DDiffFlow[t][0]->GetBin(p,e),v2Prime); | |
8186 | } | |
8187 | // QC{4'}: | |
8188 | qc4Prime = f2DDiffFlowCumulants[t][1]->GetBinContent(f2DDiffFlowCumulants[t][1]->GetBin(p,e)); | |
8189 | if(qc4Prime<=0.) | |
8190 | { | |
8191 | v4Prime = pow(-1.*qc4Prime,1./4.); | |
8192 | f2DDiffFlow[t][1]->SetBinContent(f2DDiffFlow[t][1]->GetBin(p,e),v4Prime); | |
8193 | } | |
8194 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
8195 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
8196 | ||
8197 | } // end of void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlow(TString type) | |
489d5531 | 8198 | |
489d5531 | 8199 | //================================================================================================================================ |
8200 | ||
489d5531 | 8201 | void AliFlowAnalysisWithQCumulants::StoreIntFlowFlags() |
8202 | { | |
8203 | // a) Store all flags for integrated flow in profile fIntFlowFlags. | |
8204 | ||
8205 | if(!fIntFlowFlags) | |
8206 | { | |
8207 | cout<<"WARNING: fIntFlowFlags is NULL in AFAWQC::SFFIF() !!!!"<<endl; | |
8208 | exit(0); | |
8209 | } | |
8210 | ||
8211 | // particle weights used or not: | |
403e3389 | 8212 | fIntFlowFlags->Fill(0.5,(Int_t)fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights); |
489d5531 | 8213 | // which event weights were used: |
8214 | if(strcmp(fMultiplicityWeight->Data(),"combinations")) | |
8215 | { | |
8216 | fIntFlowFlags->Fill(1.5,0); // 0 = "combinations" (default) | |
8217 | } else if(strcmp(fMultiplicityWeight->Data(),"unit")) | |
8218 | { | |
8219 | fIntFlowFlags->Fill(1.5,1); // 1 = "unit" | |
8220 | } else if(strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
8221 | { | |
8222 | fIntFlowFlags->Fill(1.5,2); // 2 = "multiplicity" | |
8223 | } | |
489d5531 | 8224 | fIntFlowFlags->Fill(2.5,(Int_t)fApplyCorrectionForNUA); |
8225 | fIntFlowFlags->Fill(3.5,(Int_t)fPrintFinalResults[0]); | |
8226 | fIntFlowFlags->Fill(4.5,(Int_t)fPrintFinalResults[1]); | |
8227 | fIntFlowFlags->Fill(5.5,(Int_t)fPrintFinalResults[2]); | |
b3dacf6b | 8228 | fIntFlowFlags->Fill(6.5,(Int_t)fPrintFinalResults[3]); |
8229 | fIntFlowFlags->Fill(7.5,(Int_t)fApplyCorrectionForNUAVsM); | |
b77b6434 | 8230 | fIntFlowFlags->Fill(8.5,(Int_t)fPropagateErrorAlsoFromNIT); |
b3dacf6b | 8231 | fIntFlowFlags->Fill(9.5,(Int_t)fCalculateCumulantsVsM); |
0dd3b008 | 8232 | fIntFlowFlags->Fill(10.5,(Int_t)fMinimumBiasReferenceFlow); |
8e1cefdd | 8233 | fIntFlowFlags->Fill(11.5,(Int_t)fForgetAboutCovariances); |
e5834fcb | 8234 | fIntFlowFlags->Fill(12.5,(Int_t)fStorePhiDistributionForOneEvent); |
dd442cd2 | 8235 | fIntFlowFlags->Fill(13.5,(Int_t)fFillMultipleControlHistograms); |
3435cacb | 8236 | fIntFlowFlags->Fill(14.5,(Int_t)fCalculateAllCorrelationsVsM); |
489d5531 | 8237 | } // end of void AliFlowAnalysisWithQCumulants::StoreIntFlowFlags() |
8238 | ||
489d5531 | 8239 | //================================================================================================================================ |
8240 | ||
489d5531 | 8241 | void AliFlowAnalysisWithQCumulants::StoreDiffFlowFlags() |
8242 | { | |
8243 | // Store all flags for differential flow in the profile fDiffFlowFlags. | |
8244 | ||
8245 | if(!fDiffFlowFlags) | |
8246 | { | |
1268c371 | 8247 | printf("\n WARNING (QC): fDiffFlowFlags is NULL in AFAWQC::SDFF() !!!!\n\n"); |
489d5531 | 8248 | exit(0); |
8249 | } | |
8250 | ||
1268c371 | 8251 | fDiffFlowFlags->Fill(0.5,fCalculateDiffFlow); // calculate differential flow |
403e3389 | 8252 | fDiffFlowFlags->Fill(1.5,fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights); // particle weights used or not? |
1268c371 | 8253 | //fDiffFlowFlags->Fill(2.5,""); // which event weight was used? ("combinations", "unit" or "multiplicity") to be improved - finalized |
8254 | fDiffFlowFlags->Fill(3.5,fApplyCorrectionForNUA); // corrected for non-uniform acceptance or not | |
8255 | fDiffFlowFlags->Fill(4.5,fCalculate2DDiffFlow); // calculate also 2D differential flow vs (pt,eta) | |
62e36168 | 8256 | fDiffFlowFlags->Fill(5.5,fCalculateDiffFlowVsEta); // if you set kFALSE only differential flow vs pt is calculated |
1268c371 | 8257 | |
489d5531 | 8258 | } // end of void AliFlowAnalysisWithQCumulants::StoreDiffFlowFlags() |
8259 | ||
489d5531 | 8260 | //================================================================================================================================ |
8261 | ||
489d5531 | 8262 | void AliFlowAnalysisWithQCumulants::GetPointersForCommonHistograms() |
8263 | { | |
8264 | // Access all pointers to common control and common result histograms and profiles. | |
8265 | ||
1268c371 | 8266 | TString sCommonConstantsName = "fCommonConstants"; |
8267 | sCommonConstantsName += fAnalysisLabel->Data(); | |
8268 | fCommonConstants = dynamic_cast<TProfile*>(fHistList->FindObject(sCommonConstantsName.Data())); | |
8269 | if(!fCommonConstants) | |
8270 | { | |
8271 | printf("\n WARNING (QC): fCommonConstants is NULL in AFAWQC::GPFCH() !!!!\n\n"); | |
8272 | exit(0); | |
8273 | } | |
8274 | ||
8275 | // to be improved - lines bellow can be implemented better. | |
8276 | ||
489d5531 | 8277 | TString commonHistsName = "AliFlowCommonHistQC"; |
8278 | commonHistsName += fAnalysisLabel->Data(); | |
8279 | AliFlowCommonHist *commonHist = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHistsName.Data())); | |
b77b6434 | 8280 | if(commonHist) |
8281 | { | |
8282 | this->SetCommonHists(commonHist); | |
8283 | if(fCommonHists->GetHarmonic()) | |
8284 | { | |
8285 | fHarmonic = (Int_t)(fCommonHists->GetHarmonic())->GetBinContent(1); | |
8286 | } | |
8287 | } // end of if(commonHist) | |
489d5531 | 8288 | TString commonHists2ndOrderName = "AliFlowCommonHist2ndOrderQC"; |
8289 | commonHists2ndOrderName += fAnalysisLabel->Data(); | |
8290 | AliFlowCommonHist *commonHist2nd = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists2ndOrderName.Data())); | |
8291 | if(commonHist2nd) this->SetCommonHists2nd(commonHist2nd); | |
8292 | TString commonHists4thOrderName = "AliFlowCommonHist4thOrderQC"; | |
8293 | commonHists4thOrderName += fAnalysisLabel->Data(); | |
8294 | AliFlowCommonHist *commonHist4th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists4thOrderName.Data())); | |
8295 | if(commonHist4th) this->SetCommonHists4th(commonHist4th); | |
8296 | TString commonHists6thOrderName = "AliFlowCommonHist6thOrderQC"; | |
8297 | commonHists6thOrderName += fAnalysisLabel->Data(); | |
8298 | AliFlowCommonHist *commonHist6th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists6thOrderName.Data())); | |
8299 | if(commonHist6th) this->SetCommonHists6th(commonHist6th); | |
8300 | TString commonHists8thOrderName = "AliFlowCommonHist8thOrderQC"; | |
8301 | commonHists8thOrderName += fAnalysisLabel->Data(); | |
8302 | AliFlowCommonHist *commonHist8th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists8thOrderName.Data())); | |
dd442cd2 | 8303 | if(commonHist8th) this->SetCommonHists8th(commonHist8th); |
8304 | ||
489d5531 | 8305 | TString commonHistResults2ndOrderName = "AliFlowCommonHistResults2ndOrderQC"; |
8306 | commonHistResults2ndOrderName += fAnalysisLabel->Data(); | |
b77b6434 | 8307 | AliFlowCommonHistResults *commonHistRes2nd = dynamic_cast<AliFlowCommonHistResults*> |
8308 | (fHistList->FindObject(commonHistResults2ndOrderName.Data())); | |
489d5531 | 8309 | if(commonHistRes2nd) this->SetCommonHistsResults2nd(commonHistRes2nd); |
8310 | TString commonHistResults4thOrderName = "AliFlowCommonHistResults4thOrderQC"; | |
8311 | commonHistResults4thOrderName += fAnalysisLabel->Data(); | |
8312 | AliFlowCommonHistResults *commonHistRes4th = dynamic_cast<AliFlowCommonHistResults*> | |
8313 | (fHistList->FindObject(commonHistResults4thOrderName.Data())); | |
8314 | if(commonHistRes4th) this->SetCommonHistsResults4th(commonHistRes4th); | |
8315 | TString commonHistResults6thOrderName = "AliFlowCommonHistResults6thOrderQC"; | |
8316 | commonHistResults6thOrderName += fAnalysisLabel->Data(); | |
8317 | AliFlowCommonHistResults *commonHistRes6th = dynamic_cast<AliFlowCommonHistResults*> | |
8318 | (fHistList->FindObject(commonHistResults6thOrderName.Data())); | |
8319 | if(commonHistRes6th) this->SetCommonHistsResults6th(commonHistRes6th); | |
8320 | TString commonHistResults8thOrderName = "AliFlowCommonHistResults8thOrderQC"; | |
8321 | commonHistResults8thOrderName += fAnalysisLabel->Data(); | |
8322 | AliFlowCommonHistResults *commonHistRes8th = dynamic_cast<AliFlowCommonHistResults*> | |
8323 | (fHistList->FindObject(commonHistResults8thOrderName.Data())); | |
8324 | if(commonHistRes8th) this->SetCommonHistsResults8th(commonHistRes8th); | |
8325 | ||
8326 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForCommonHistograms() | |
8327 | ||
489d5531 | 8328 | //================================================================================================================================ |
8329 | ||
489d5531 | 8330 | void AliFlowAnalysisWithQCumulants::GetPointersForParticleWeightsHistograms() |
8331 | { | |
8332 | // Get pointers for histograms with particle weights. | |
8333 | ||
8334 | TList *weightsList = dynamic_cast<TList*>(fHistList->FindObject("Weights")); | |
ca5f47e7 | 8335 | if(!weightsList){printf("\n WARNING (QC): weightsList is NULL in AFAWQC::GPFPWH() !!!!\n");exit(0);} |
8336 | this->SetWeightsList(weightsList); | |
489d5531 | 8337 | TString fUseParticleWeightsName = "fUseParticleWeightsQC"; // to be improved (hirdwired label QC) |
8338 | fUseParticleWeightsName += fAnalysisLabel->Data(); | |
8339 | TProfile *useParticleWeights = dynamic_cast<TProfile*>(weightsList->FindObject(fUseParticleWeightsName.Data())); | |
8340 | if(useParticleWeights) | |
8341 | { | |
8342 | this->SetUseParticleWeights(useParticleWeights); | |
8343 | fUsePhiWeights = (Int_t)fUseParticleWeights->GetBinContent(1); | |
8344 | fUsePtWeights = (Int_t)fUseParticleWeights->GetBinContent(2); | |
8345 | fUseEtaWeights = (Int_t)fUseParticleWeights->GetBinContent(3); | |
403e3389 | 8346 | fUseTrackWeights = (Int_t)fUseParticleWeights->GetBinContent(4); |
489d5531 | 8347 | } |
8348 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForParticleWeightsHistograms(); | |
8349 | ||
489d5531 | 8350 | //================================================================================================================================ |
8351 | ||
489d5531 | 8352 | void AliFlowAnalysisWithQCumulants::GetPointersForIntFlowHistograms() |
8353 | { | |
8354 | // Get pointers for histograms and profiles relevant for integrated flow: | |
8355 | // a) Get pointer to base list for integrated flow holding profile fIntFlowFlags and lists fIntFlowProfiles and fIntFlowResults. | |
8356 | // b) Get pointer to profile fIntFlowFlags holding all flags for integrated flow. | |
8357 | // c) Get pointer to list fIntFlowProfiles and pointers to all objects that she holds. | |
8358 | // d) Get pointer to list fIntFlowResults and pointers to all objects that she holds. | |
8359 | ||
8360 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data member?) | |
8361 | TString powerFlag[2] = {"linear","quadratic"}; // to be improved (should I promote this to data member?) | |
b40a910e | 8362 | TString correlationFlag[4] = {"#LT#LT2#GT#GT","#LT#LT4#GT#GT","#LT#LT6#GT#GT","#LT#LT8#GT#GT"}; // to be improved (should I promote this to data member?) |
8363 | TString squaredCorrelationFlag[4] = {"#LT#LT2#GT^{2}#GT","#LT#LT4#GT^{2}#GT","#LT#LT6#GT^{2}#GT","#LT#LT8#GT^{2}#GT"}; // to be improved (should I promote this to data member?) | |
489d5531 | 8364 | |
8365 | // a) Get pointer to base list for integrated flow holding profile fIntFlowFlags and lists fIntFlowProfiles and fIntFlowResults: | |
8366 | TList *intFlowList = NULL; | |
8367 | intFlowList = dynamic_cast<TList*>(fHistList->FindObject("Integrated Flow")); | |
8368 | if(!intFlowList) | |
8369 | { | |
8370 | cout<<"WARNING: intFlowList is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8371 | exit(0); | |
8372 | } | |
8373 | ||
b92ea2b9 | 8374 | // b) Get pointer to profile fIntFlowFlags holding all flags for integrated flow: |
8375 | TString intFlowFlagsName = "fIntFlowFlags"; | |
8376 | intFlowFlagsName += fAnalysisLabel->Data(); | |
8377 | TProfile *intFlowFlags = dynamic_cast<TProfile*>(intFlowList->FindObject(intFlowFlagsName.Data())); | |
8378 | if(intFlowFlags) | |
8379 | { | |
8380 | this->SetIntFlowFlags(intFlowFlags); | |
8381 | fApplyCorrectionForNUA = (Bool_t)intFlowFlags->GetBinContent(3); | |
8382 | fApplyCorrectionForNUAVsM = (Bool_t)intFlowFlags->GetBinContent(8); | |
8383 | fCalculateCumulantsVsM = (Bool_t)intFlowFlags->GetBinContent(10); | |
8384 | } else | |
8385 | { | |
8386 | cout<<"WARNING: intFlowFlags is NULL in FAWQC::GPFIFH() !!!!"<<endl; | |
8387 | } | |
489d5531 | 8388 | |
8389 | // c) Get pointer to list fIntFlowProfiles and pointers to all objects that she holds: | |
8390 | TList *intFlowProfiles = NULL; | |
8391 | intFlowProfiles = dynamic_cast<TList*>(intFlowList->FindObject("Profiles")); | |
8392 | if(intFlowProfiles) | |
8393 | { | |
8394 | // average multiplicities: | |
8395 | TString avMultiplicityName = "fAvMultiplicity"; | |
8396 | avMultiplicityName += fAnalysisLabel->Data(); | |
8397 | TProfile *avMultiplicity = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(avMultiplicityName.Data())); | |
8398 | if(avMultiplicity) | |
8399 | { | |
8400 | this->SetAvMultiplicity(avMultiplicity); | |
8401 | } else | |
8402 | { | |
8403 | cout<<"WARNING: avMultiplicity is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8404 | } | |
8405 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with wrong errors!): | |
8406 | TString intFlowCorrelationsProName = "fIntFlowCorrelationsPro"; | |
8407 | intFlowCorrelationsProName += fAnalysisLabel->Data(); | |
8408 | TProfile *intFlowCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowCorrelationsProName.Data())); | |
8409 | if(intFlowCorrelationsPro) | |
8410 | { | |
8411 | this->SetIntFlowCorrelationsPro(intFlowCorrelationsPro); | |
8412 | } else | |
8413 | { | |
8414 | cout<<"WARNING: intFlowCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
ff70ca91 | 8415 | } |
b40a910e | 8416 | // average squared correlations <<2>^2>, <<4>^2>, <<6>^2> and <<8^2>>: |
8417 | TString intFlowSquaredCorrelationsProName = "fIntFlowSquaredCorrelationsPro"; | |
8418 | intFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
8419 | TProfile *intFlowSquaredCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowSquaredCorrelationsProName.Data())); | |
8420 | if(intFlowSquaredCorrelationsPro) | |
8421 | { | |
8422 | this->SetIntFlowSquaredCorrelationsPro(intFlowSquaredCorrelationsPro); | |
8423 | } else | |
8424 | { | |
8425 | cout<<"WARNING: intFlowSquaredCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8426 | } | |
b3dacf6b | 8427 | if(fCalculateCumulantsVsM) |
ff70ca91 | 8428 | { |
b40a910e | 8429 | // Average correlations <<2>>, <<4>>, <<6>> and <<8>> versus multiplicity for all events (error is wrong here): |
b3dacf6b | 8430 | TString intFlowCorrelationsVsMProName = "fIntFlowCorrelationsVsMPro"; |
8431 | intFlowCorrelationsVsMProName += fAnalysisLabel->Data(); | |
8432 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
ff70ca91 | 8433 | { |
b3dacf6b | 8434 | TProfile *intFlowCorrelationsVsMPro = dynamic_cast<TProfile*> |
8435 | (intFlowProfiles->FindObject(Form("%s, %s",intFlowCorrelationsVsMProName.Data(),correlationFlag[ci].Data()))); | |
8436 | if(intFlowCorrelationsVsMPro) | |
8437 | { | |
8438 | this->SetIntFlowCorrelationsVsMPro(intFlowCorrelationsVsMPro,ci); | |
8439 | } else | |
8440 | { | |
8441 | cout<<"WARNING: "<<Form("intFlowCorrelationsVsMPro[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8442 | } | |
8443 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
b40a910e | 8444 | // Average squared correlations <<2>^2>, <<4>^2>, <<6>^2> and <<8>^2> versus multiplicity for all events: |
8445 | TString intFlowSquaredCorrelationsVsMProName = "fIntFlowSquaredCorrelationsVsMPro"; | |
8446 | intFlowSquaredCorrelationsVsMProName += fAnalysisLabel->Data(); | |
8447 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
8448 | { | |
8449 | TProfile *intFlowSquaredCorrelationsVsMPro = dynamic_cast<TProfile*> | |
8450 | (intFlowProfiles->FindObject(Form("%s, %s",intFlowSquaredCorrelationsVsMProName.Data(),squaredCorrelationFlag[ci].Data()))); | |
8451 | if(intFlowSquaredCorrelationsVsMPro) | |
8452 | { | |
8453 | this->SetIntFlowSquaredCorrelationsVsMPro(intFlowSquaredCorrelationsVsMPro,ci); | |
8454 | } else | |
8455 | { | |
8456 | cout<<"WARNING: "<<Form("intFlowSquaredCorrelationsVsMPro[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8457 | } | |
8458 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
b3dacf6b | 8459 | } // end of if(fCalculateCumulantsVsM) |
489d5531 | 8460 | // average all correlations for integrated flow (with wrong errors!): |
8461 | TString intFlowCorrelationsAllProName = "fIntFlowCorrelationsAllPro"; | |
8462 | intFlowCorrelationsAllProName += fAnalysisLabel->Data(); | |
8463 | TProfile *intFlowCorrelationsAllPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowCorrelationsAllProName.Data())); | |
8464 | if(intFlowCorrelationsAllPro) | |
8465 | { | |
8466 | this->SetIntFlowCorrelationsAllPro(intFlowCorrelationsAllPro); | |
8467 | } else | |
8468 | { | |
8469 | cout<<"WARNING: intFlowCorrelationsAllPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8470 | } | |
8471 | // average extra correlations for integrated flow (which appear only when particle weights are used): | |
8472 | // (to be improved: Weak point in implementation, I am assuming here that method GetPointersForParticleWeightsHistograms() was called) | |
403e3389 | 8473 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 8474 | { |
8475 | TString intFlowExtraCorrelationsProName = "fIntFlowExtraCorrelationsPro"; | |
8476 | intFlowExtraCorrelationsProName += fAnalysisLabel->Data(); | |
8477 | TProfile *intFlowExtraCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowExtraCorrelationsProName.Data())); | |
8478 | if(intFlowExtraCorrelationsPro) | |
8479 | { | |
8480 | this->SetIntFlowExtraCorrelationsPro(intFlowExtraCorrelationsPro); | |
8481 | } else | |
8482 | { | |
8483 | cout<<"WARNING: intFlowExtraCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8484 | } | |
403e3389 | 8485 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 8486 | // average products of correlations <2>, <4>, <6> and <8>: |
8487 | TString intFlowProductOfCorrelationsProName = "fIntFlowProductOfCorrelationsPro"; | |
8488 | intFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
8489 | TProfile *intFlowProductOfCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowProductOfCorrelationsProName.Data())); | |
8490 | if(intFlowProductOfCorrelationsPro) | |
8491 | { | |
8492 | this->SetIntFlowProductOfCorrelationsPro(intFlowProductOfCorrelationsPro); | |
8493 | } else | |
8494 | { | |
8495 | cout<<"WARNING: intFlowProductOfCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
ff70ca91 | 8496 | } |
8497 | // average product of correlations <2>, <4>, <6> and <8> versus multiplicity | |
8498 | // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>] | |
b3dacf6b | 8499 | if(fCalculateCumulantsVsM) |
8500 | { | |
8501 | TString intFlowProductOfCorrelationsVsMProName = "fIntFlowProductOfCorrelationsVsMPro"; | |
8502 | intFlowProductOfCorrelationsVsMProName += fAnalysisLabel->Data(); | |
403e3389 | 8503 | TString productFlag[6] = {"#LT#LT2#GT#LT4#GT#GT","#LT#LT2#GT#LT6#GT#GT","#LT#LT2#GT#LT8#GT#GT", |
8504 | "#LT#LT4#GT#LT6#GT#GT","#LT#LT4#GT#LT8#GT#GT","#LT#LT6#GT#LT8#GT#GT"}; | |
b3dacf6b | 8505 | for(Int_t pi=0;pi<6;pi++) |
8506 | { | |
8507 | TProfile *intFlowProductOfCorrelationsVsMPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(Form("%s, %s",intFlowProductOfCorrelationsVsMProName.Data(),productFlag[pi].Data()))); | |
8508 | if(intFlowProductOfCorrelationsVsMPro) | |
8509 | { | |
8510 | this->SetIntFlowProductOfCorrelationsVsMPro(intFlowProductOfCorrelationsVsMPro,pi); | |
8511 | } else | |
8512 | { | |
8513 | cout<<"WARNING: "<<Form("intFlowProductOfCorrelationsVsMPro[%d]",pi)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8514 | } | |
8515 | } // end of for(Int_t pi=0;pi<6;pi++) | |
8516 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 8517 | // average correction terms for non-uniform acceptance (with wrong errors!): |
8518 | for(Int_t sc=0;sc<2;sc++) | |
8519 | { | |
8520 | TString intFlowCorrectionTermsForNUAProName = "fIntFlowCorrectionTermsForNUAPro"; | |
8521 | intFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
8522 | TProfile *intFlowCorrectionTermsForNUAPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject((Form("%s: %s terms",intFlowCorrectionTermsForNUAProName.Data(),sinCosFlag[sc].Data())))); | |
8523 | if(intFlowCorrectionTermsForNUAPro) | |
8524 | { | |
8525 | this->SetIntFlowCorrectionTermsForNUAPro(intFlowCorrectionTermsForNUAPro,sc); | |
8526 | } else | |
8527 | { | |
8528 | cout<<"WARNING: intFlowCorrectionTermsForNUAPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8529 | cout<<"sc = "<<sc<<endl; | |
8530 | } | |
2001bc3a | 8531 | // versus multiplicity: |
b3dacf6b | 8532 | if(fCalculateCumulantsVsM) |
2001bc3a | 8533 | { |
b3dacf6b | 8534 | TString correctionTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4 |
8535 | TString intFlowCorrectionTermsForNUAVsMProName = "fIntFlowCorrectionTermsForNUAVsMPro"; | |
8536 | intFlowCorrectionTermsForNUAVsMProName += fAnalysisLabel->Data(); | |
8537 | for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) | |
2001bc3a | 8538 | { |
b3dacf6b | 8539 | TProfile *intFlowCorrectionTermsForNUAVsMPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(Form("%s: #LT#LT%s%s#GT#GT",intFlowCorrectionTermsForNUAVsMProName.Data(),sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()))); |
8540 | if(intFlowCorrectionTermsForNUAVsMPro) | |
8541 | { | |
8542 | this->SetIntFlowCorrectionTermsForNUAVsMPro(intFlowCorrectionTermsForNUAVsMPro,sc,ci); | |
8543 | } else | |
8544 | { | |
8545 | cout<<"WARNING: intFlowCorrectionTermsForNUAVsMPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8546 | cout<<"sc = "<<sc<<endl; | |
8547 | cout<<"ci = "<<ci<<endl; | |
8548 | } | |
8549 | } // end of for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) | |
8550 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 8551 | } // end of for(Int_t sc=0;sc<2;sc++) |
0328db2d | 8552 | // average products of correction terms for NUA: |
8553 | TString intFlowProductOfCorrectionTermsForNUAProName = "fIntFlowProductOfCorrectionTermsForNUAPro"; | |
8554 | intFlowProductOfCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
8555 | TProfile *intFlowProductOfCorrectionTermsForNUAPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowProductOfCorrectionTermsForNUAProName.Data())); | |
8556 | if(intFlowProductOfCorrectionTermsForNUAPro) | |
8557 | { | |
8558 | this->SetIntFlowProductOfCorrectionTermsForNUAPro(intFlowProductOfCorrectionTermsForNUAPro); | |
8559 | } else | |
8560 | { | |
8561 | cout<<"WARNING: intFlowProductOfCorrectionTermsForNUAPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8562 | } | |
489d5531 | 8563 | } else // to if(intFlowProfiles) |
8564 | { | |
8565 | cout<<"WARNING: intFlowProfiles is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8566 | } | |
8567 | ||
8568 | // d) Get pointer to list fIntFlowResults and pointers to all objects that she holds. | |
8569 | TList *intFlowResults = NULL; | |
8570 | intFlowResults = dynamic_cast<TList*>(intFlowList->FindObject("Results")); | |
8571 | if(intFlowResults) | |
8572 | { | |
8573 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with correct errors!): | |
8574 | TString intFlowCorrelationsHistName = "fIntFlowCorrelationsHist"; | |
8575 | intFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
8576 | TH1D *intFlowCorrelationsHist = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCorrelationsHistName.Data())); | |
8577 | if(intFlowCorrelationsHist) | |
8578 | { | |
8579 | this->SetIntFlowCorrelationsHist(intFlowCorrelationsHist); | |
8580 | } else | |
8581 | { | |
8582 | cout<<"WARNING: intFlowCorrelationsHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8583 | } | |
ff70ca91 | 8584 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with correct errors!) vs M: |
b3dacf6b | 8585 | if(fCalculateCumulantsVsM) |
ff70ca91 | 8586 | { |
b3dacf6b | 8587 | TString intFlowCorrelationsVsMHistName = "fIntFlowCorrelationsVsMHist"; |
8588 | intFlowCorrelationsVsMHistName += fAnalysisLabel->Data(); | |
8589 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
ff70ca91 | 8590 | { |
b3dacf6b | 8591 | TH1D *intFlowCorrelationsVsMHist = dynamic_cast<TH1D*> |
8592 | (intFlowResults->FindObject(Form("%s, %s",intFlowCorrelationsVsMHistName.Data(),correlationFlag[ci].Data()))); | |
8593 | if(intFlowCorrelationsVsMHist) | |
8594 | { | |
8595 | this->SetIntFlowCorrelationsVsMHist(intFlowCorrelationsVsMHist,ci); | |
8596 | } else | |
8597 | { | |
8598 | cout<<"WARNING: "<<Form("intFlowCorrelationsVsMHist[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8599 | } | |
8600 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
8601 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 8602 | // average all correlations for integrated flow (with correct errors!): |
8603 | TString intFlowCorrelationsAllHistName = "fIntFlowCorrelationsAllHist"; | |
8604 | intFlowCorrelationsAllHistName += fAnalysisLabel->Data(); | |
8605 | TH1D *intFlowCorrelationsAllHist = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCorrelationsAllHistName.Data())); | |
8606 | if(intFlowCorrelationsAllHist) | |
8607 | { | |
8608 | this->SetIntFlowCorrelationsAllHist(intFlowCorrelationsAllHist); | |
8609 | } else | |
8610 | { | |
8611 | cout<<"WARNING: intFlowCorrelationsAllHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8612 | } | |
8613 | // average correction terms for non-uniform acceptance (with correct errors!): | |
8614 | TString intFlowCorrectionTermsForNUAHistName = "fIntFlowCorrectionTermsForNUAHist"; | |
8615 | intFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
8616 | for(Int_t sc=0;sc<2;sc++) | |
8617 | { | |
8618 | TH1D *intFlowCorrectionTermsForNUAHist = dynamic_cast<TH1D*>(intFlowResults->FindObject((Form("%s: %s terms",intFlowCorrectionTermsForNUAHistName.Data(),sinCosFlag[sc].Data())))); | |
8619 | if(intFlowCorrectionTermsForNUAHist) | |
8620 | { | |
8621 | this->SetIntFlowCorrectionTermsForNUAHist(intFlowCorrectionTermsForNUAHist,sc); | |
8622 | } else | |
8623 | { | |
8624 | cout<<"WARNING: intFlowCorrectionTermsForNUAHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8625 | cout<<"sc = "<<sc<<endl; | |
8626 | } | |
8627 | } // end of for(Int_t sc=0;sc<2;sc++) | |
8628 | // covariances (multiplied with weight dependent prefactor): | |
8629 | TString intFlowCovariancesName = "fIntFlowCovariances"; | |
8630 | intFlowCovariancesName += fAnalysisLabel->Data(); | |
8631 | TH1D *intFlowCovariances = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCovariancesName.Data())); | |
8632 | if(intFlowCovariances) | |
8633 | { | |
8634 | this->SetIntFlowCovariances(intFlowCovariances); | |
8635 | } else | |
8636 | { | |
8637 | cout<<"WARNING: intFlowCovariances is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8638 | } | |
8639 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8>: | |
8640 | TString intFlowSumOfEventWeightsName = "fIntFlowSumOfEventWeights"; | |
8641 | intFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
8642 | for(Int_t power=0;power<2;power++) | |
8643 | { | |
8644 | TH1D *intFlowSumOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s: %s",intFlowSumOfEventWeightsName.Data(),powerFlag[power].Data()))); | |
8645 | if(intFlowSumOfEventWeights) | |
8646 | { | |
8647 | this->SetIntFlowSumOfEventWeights(intFlowSumOfEventWeights,power); | |
8648 | } else | |
8649 | { | |
8650 | cout<<"WARNING: intFlowSumOfEventWeights is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8651 | cout<<"power = "<<power<<endl; | |
8652 | } | |
8653 | } // end of for(Int_t power=0;power<2;power++) | |
8654 | // sum of products of event weights for correlations <2>, <4>, <6> and <8>: | |
8655 | TString intFlowSumOfProductOfEventWeightsName = "fIntFlowSumOfProductOfEventWeights"; | |
8656 | intFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
8657 | TH1D *intFlowSumOfProductOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowSumOfProductOfEventWeightsName.Data())); | |
8658 | if(intFlowSumOfProductOfEventWeights) | |
8659 | { | |
8660 | this->SetIntFlowSumOfProductOfEventWeights(intFlowSumOfProductOfEventWeights); | |
8661 | } else | |
8662 | { | |
8663 | cout<<"WARNING: intFlowSumOfProductOfEventWeights is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8664 | } | |
ff70ca91 | 8665 | // final result for covariances of correlations (multiplied with weight dependent prefactor) versus M |
8666 | // [0=Cov(2,4),1=Cov(2,6),2=Cov(2,8),3=Cov(4,6),4=Cov(4,8),5=Cov(6,8)]: | |
b3dacf6b | 8667 | if(fCalculateCumulantsVsM) |
ff70ca91 | 8668 | { |
b3dacf6b | 8669 | TString intFlowCovariancesVsMName = "fIntFlowCovariancesVsM"; |
8670 | intFlowCovariancesVsMName += fAnalysisLabel->Data(); | |
8671 | TString covarianceFlag[6] = {"Cov(<2>,<4>)","Cov(<2>,<6>)","Cov(<2>,<8>)","Cov(<4>,<6>)","Cov(<4>,<8>)","Cov(<6>,<8>)"}; | |
8672 | for(Int_t ci=0;ci<6;ci++) | |
8673 | { | |
8674 | TH1D *intFlowCovariancesVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowCovariancesVsMName.Data(),covarianceFlag[ci].Data()))); | |
8675 | if(intFlowCovariancesVsM) | |
ff70ca91 | 8676 | { |
b3dacf6b | 8677 | this->SetIntFlowCovariancesVsM(intFlowCovariancesVsM,ci); |
ff70ca91 | 8678 | } else |
8679 | { | |
b3dacf6b | 8680 | cout<<"WARNING: "<<Form("intFlowCovariancesVsM[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; |
ff70ca91 | 8681 | } |
b3dacf6b | 8682 | } // end of for(Int_t ci=0;ci<6;ci++) |
8683 | } // end of if(fCalculateCumulantsVsM) | |
8684 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8> versus multiplicity | |
8685 | // [0=sum{w_{<2>}},1=sum{w_{<4>}},2=sum{w_{<6>}},3=sum{w_{<8>}}][0=linear 1,1=quadratic]: | |
8686 | if(fCalculateCumulantsVsM) | |
8687 | { | |
8688 | TString intFlowSumOfEventWeightsVsMName = "fIntFlowSumOfEventWeightsVsM"; | |
8689 | intFlowSumOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
8690 | TString sumFlag[2][4] = {{"#sum_{i=1}^{N} w_{<2>}","#sum_{i=1}^{N} w_{<4>}","#sum_{i=1}^{N} w_{<6>}","#sum_{i=1}^{N} w_{<8>}"}, | |
8691 | {"#sum_{i=1}^{N} w_{<2>}^{2}","#sum_{i=1}^{N} w_{<4>}^{2}","#sum_{i=1}^{N} w_{<6>}^{2}","#sum_{i=1}^{N} w_{<8>}^{2}"}}; | |
8692 | for(Int_t si=0;si<4;si++) | |
8693 | { | |
8694 | for(Int_t power=0;power<2;power++) | |
8695 | { | |
8696 | TH1D *intFlowSumOfEventWeightsVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowSumOfEventWeightsVsMName.Data(),sumFlag[power][si].Data()))); | |
8697 | if(intFlowSumOfEventWeightsVsM) | |
8698 | { | |
8699 | this->SetIntFlowSumOfEventWeightsVsM(intFlowSumOfEventWeightsVsM,si,power); | |
8700 | } else | |
8701 | { | |
8702 | cout<<"WARNING: "<<Form("intFlowSumOfEventWeightsVsM[%d][%d]",si,power)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8703 | } | |
8704 | } // end of for(Int_t power=0;power<2;power++) | |
8705 | } // end of for(Int_t si=0;si<4;si++) | |
8706 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 8707 | // sum of products of event weights for correlations <2>, <4>, <6> and <8> vs M |
8708 | // [0=sum{w_{<2>}w_{<4>}},1=sum{w_{<2>}w_{<6>}},2=sum{w_{<2>}w_{<8>}}, | |
8709 | // 3=sum{w_{<4>}w_{<6>}},4=sum{w_{<4>}w_{<8>}},5=sum{w_{<6>}w_{<8>}}]: | |
b3dacf6b | 8710 | if(fCalculateCumulantsVsM) |
ff70ca91 | 8711 | { |
b3dacf6b | 8712 | TString intFlowSumOfProductOfEventWeightsVsMName = "fIntFlowSumOfProductOfEventWeightsVsM"; |
8713 | intFlowSumOfProductOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
8714 | TString sopowFlag[6] = {"#sum_{i=1}^{N} w_{<2>} w_{<4>}","#sum_{i=1}^{N} w_{<2>} w_{<6>}","#sum_{i=1}^{N} w_{<2>} w_{<8>}", | |
8715 | "#sum_{i=1}^{N} w_{<4>} w_{<6>}","#sum_{i=1}^{N} w_{<4>} w_{<8>}","#sum_{i=1}^{N} w_{<6>} w_{<8>}"}; | |
8716 | for(Int_t pi=0;pi<6;pi++) | |
ff70ca91 | 8717 | { |
b3dacf6b | 8718 | TH1D *intFlowSumOfProductOfEventWeightsVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowSumOfProductOfEventWeightsVsMName.Data(),sopowFlag[pi].Data()))); |
8719 | if(intFlowSumOfProductOfEventWeightsVsM) | |
8720 | { | |
8721 | this->SetIntFlowSumOfProductOfEventWeightsVsM(intFlowSumOfProductOfEventWeightsVsM,pi); | |
8722 | } else | |
8723 | { | |
8724 | cout<<"WARNING: "<<Form("intFlowSumOfProductOfEventWeightsVsM[%d]",pi)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8725 | } | |
8726 | } // end of for(Int_t pi=0;pi<6;pi++) | |
8727 | } // end of if(fCalculateCumulantsVsM) | |
0328db2d | 8728 | // covariances for NUA (multiplied with weight dependent prefactor): |
8729 | TString intFlowCovariancesNUAName = "fIntFlowCovariancesNUA"; | |
8730 | intFlowCovariancesNUAName += fAnalysisLabel->Data(); | |
8731 | TH1D *intFlowCovariancesNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCovariancesNUAName.Data())); | |
8732 | if(intFlowCovariancesNUA) | |
8733 | { | |
8734 | this->SetIntFlowCovariancesNUA(intFlowCovariancesNUA); | |
8735 | } else | |
8736 | { | |
8737 | cout<<"WARNING: intFlowCovariancesNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8738 | } | |
8739 | // sum of linear and quadratic event weights NUA terms: | |
8740 | TString intFlowSumOfEventWeightsNUAName = "fIntFlowSumOfEventWeightsNUA"; | |
8741 | intFlowSumOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
8742 | for(Int_t sc=0;sc<2;sc++) | |
8743 | { | |
8744 | for(Int_t power=0;power<2;power++) | |
8745 | { | |
8746 | TH1D *intFlowSumOfEventWeightsNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s: %s, %s",intFlowSumOfEventWeightsNUAName.Data(),powerFlag[power].Data(),sinCosFlag[sc].Data()))); | |
8747 | if(intFlowSumOfEventWeightsNUA) | |
8748 | { | |
8749 | this->SetIntFlowSumOfEventWeightsNUA(intFlowSumOfEventWeightsNUA,sc,power); | |
8750 | } else | |
8751 | { | |
8752 | cout<<"WARNING: intFlowSumOfEventWeightsNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8753 | cout<<"sc = "<<sc<<endl; | |
8754 | cout<<"power = "<<power<<endl; | |
8755 | } | |
8756 | } // end of for(Int_t power=0;power<2;power++) | |
8757 | } // end of for(Int_t sc=0;sc<2;sc++) | |
8758 | // sum of products of event weights for NUA terms: | |
8759 | TString intFlowSumOfProductOfEventWeightsNUAName = "fIntFlowSumOfProductOfEventWeightsNUA"; | |
8760 | intFlowSumOfProductOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
8761 | TH1D *intFlowSumOfProductOfEventWeightsNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowSumOfProductOfEventWeightsNUAName.Data())); | |
8762 | if(intFlowSumOfProductOfEventWeightsNUA) | |
8763 | { | |
8764 | this->SetIntFlowSumOfProductOfEventWeightsNUA(intFlowSumOfProductOfEventWeightsNUA); | |
8765 | } else | |
8766 | { | |
8767 | cout<<"WARNING: intFlowSumOfProductOfEventWeightsNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8768 | } | |
b3dacf6b | 8769 | // Final results for reference Q-cumulants: |
489d5531 | 8770 | TString intFlowQcumulantsName = "fIntFlowQcumulants"; |
8771 | intFlowQcumulantsName += fAnalysisLabel->Data(); | |
8772 | TH1D *intFlowQcumulants = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsName.Data())); | |
8773 | if(intFlowQcumulants) | |
8774 | { | |
8775 | this->SetIntFlowQcumulants(intFlowQcumulants); | |
8776 | } else | |
8777 | { | |
8778 | cout<<"WARNING: intFlowQcumulants is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8779 | } | |
b3dacf6b | 8780 | // Final results for reference Q-cumulants rebinned in M: |
8781 | if(fCalculateCumulantsVsM) | |
8782 | { | |
8783 | TString intFlowQcumulantsRebinnedInMName = "fIntFlowQcumulantsRebinnedInM"; | |
8784 | intFlowQcumulantsRebinnedInMName += fAnalysisLabel->Data(); | |
8785 | TH1D *intFlowQcumulantsRebinnedInM = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsRebinnedInMName.Data())); | |
8786 | if(intFlowQcumulantsRebinnedInM) | |
8787 | { | |
8788 | this->SetIntFlowQcumulantsRebinnedInM(intFlowQcumulantsRebinnedInM); | |
8789 | } else | |
8790 | { | |
8791 | cout<<"WARNING: intFlowQcumulantsRebinnedInM is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8792 | } | |
8793 | } // end of if(fCalculateCumulantsVsM) | |
b92ea2b9 | 8794 | // Ratio between error squared: with/without non-isotropic terms: |
8795 | TString intFlowQcumulantsErrorSquaredRatioName = "fIntFlowQcumulantsErrorSquaredRatio"; | |
8796 | intFlowQcumulantsErrorSquaredRatioName += fAnalysisLabel->Data(); | |
8797 | TH1D *intFlowQcumulantsErrorSquaredRatio = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsErrorSquaredRatioName.Data())); | |
8798 | if(intFlowQcumulantsErrorSquaredRatio) | |
8799 | { | |
8800 | this->SetIntFlowQcumulantsErrorSquaredRatio(intFlowQcumulantsErrorSquaredRatio); | |
8801 | } else | |
8802 | { | |
8803 | cout<<" WARNING: intntFlowQcumulantsErrorSquaredRatio is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8804 | } | |
ff70ca91 | 8805 | // final results for integrated Q-cumulants versus multiplicity: |
ff70ca91 | 8806 | TString cumulantFlag[4] = {"QC{2}","QC{4}","QC{6}","QC{8}"}; |
b3dacf6b | 8807 | if(fCalculateCumulantsVsM) |
ff70ca91 | 8808 | { |
b3dacf6b | 8809 | TString intFlowQcumulantsVsMName = "fIntFlowQcumulantsVsM"; |
8810 | intFlowQcumulantsVsMName += fAnalysisLabel->Data(); | |
8811 | for(Int_t co=0;co<4;co++) // cumulant order | |
ff70ca91 | 8812 | { |
b3dacf6b | 8813 | TH1D *intFlowQcumulantsVsM = dynamic_cast<TH1D*> |
8814 | (intFlowResults->FindObject(Form("%s, %s",intFlowQcumulantsVsMName.Data(),cumulantFlag[co].Data()))); | |
8815 | if(intFlowQcumulantsVsM) | |
8816 | { | |
8817 | this->SetIntFlowQcumulantsVsM(intFlowQcumulantsVsM,co); | |
8818 | } else | |
8819 | { | |
8820 | cout<<"WARNING: "<<Form("intFlowQcumulantsVsM[%d]",co)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8821 | } | |
8822 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
8823 | } // end of if(fCalculateCumulantsVsM) | |
8824 | // Final reference flow estimates from Q-cumulants: | |
489d5531 | 8825 | TString intFlowName = "fIntFlow"; |
8826 | intFlowName += fAnalysisLabel->Data(); | |
8827 | TH1D *intFlow = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowName.Data())); | |
8828 | if(intFlow) | |
8829 | { | |
8830 | this->SetIntFlow(intFlow); | |
8831 | } else | |
8832 | { | |
8833 | cout<<"WARNING: intFlow is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
ff70ca91 | 8834 | } |
b3dacf6b | 8835 | // Final reference flow estimates from Q-cumulants vs M rebinned in M: |
8836 | if(fCalculateCumulantsVsM) | |
ff70ca91 | 8837 | { |
b3dacf6b | 8838 | TString intFlowRebinnedInMName = "fIntFlowRebinnedInM"; |
8839 | intFlowRebinnedInMName += fAnalysisLabel->Data(); | |
8840 | TH1D *intFlowRebinnedInM = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowRebinnedInMName.Data())); | |
8841 | if(intFlowRebinnedInM) | |
ff70ca91 | 8842 | { |
b3dacf6b | 8843 | this->SetIntFlowRebinnedInM(intFlowRebinnedInM); |
8844 | } else | |
ff70ca91 | 8845 | { |
b3dacf6b | 8846 | cout<<"WARNING: intFlowRebinnedInM is NULL in AFAWQC::GPFIFH() !!!!"<<endl; |
8847 | } | |
8848 | } // end of if(fCalculateCumulantsVsM) | |
8849 | // integrated flow from Q-cumulants versus multiplicity: | |
8850 | if(fCalculateCumulantsVsM) | |
8851 | { | |
8852 | TString intFlowVsMName = "fIntFlowVsM"; | |
8853 | intFlowVsMName += fAnalysisLabel->Data(); | |
b77b6434 | 8854 | TString flowFlag[4] = {Form("v_{%d}{2,QC}",fHarmonic),Form("v_{%d}{4,QC}",fHarmonic),Form("v_{%d}{6,QC}",fHarmonic),Form("v_{%d}{8,QC}",fHarmonic)}; |
b3dacf6b | 8855 | for(Int_t co=0;co<4;co++) // cumulant order |
8856 | { | |
8857 | TH1D *intFlowVsM = dynamic_cast<TH1D*> | |
b77b6434 | 8858 | (intFlowResults->FindObject(Form("%s, %s",intFlowVsMName.Data(),flowFlag[co].Data()))); |
b3dacf6b | 8859 | if(intFlowVsM) |
8860 | { | |
8861 | this->SetIntFlowVsM(intFlowVsM,co); | |
8862 | } else | |
8863 | { | |
8864 | cout<<"WARNING: "<<Form("intFlowVsM[%d]",co)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8865 | } | |
8866 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
8867 | } // end of if(fCalculateCumulantsVsM) | |
2001bc3a | 8868 | // quantifying detector effects effects to correlations: |
8869 | TString intFlowDetectorBiasName = "fIntFlowDetectorBias"; | |
8870 | intFlowDetectorBiasName += fAnalysisLabel->Data(); | |
8871 | TH1D *intFlowDetectorBias = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowDetectorBiasName.Data())); | |
8872 | if(intFlowDetectorBias) | |
8873 | { | |
8874 | this->SetIntFlowDetectorBias(intFlowDetectorBias); | |
8875 | } else | |
8876 | { | |
8877 | cout<<"WARNING: intFlowDetectorBias is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8878 | } | |
8879 | // quantifying detector effects effects to correlations vs multiplicity: | |
b77b6434 | 8880 | if(fCalculateCumulantsVsM) |
2001bc3a | 8881 | { |
3c5d5752 | 8882 | TString intFlowDetectorBiasVsMName = "fIntFlowDetectorBiasVsM"; |
8883 | intFlowDetectorBiasVsMName += fAnalysisLabel->Data(); | |
8884 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2001bc3a | 8885 | { |
3c5d5752 | 8886 | TH1D *intFlowDetectorBiasVsM = dynamic_cast<TH1D*> |
8887 | (intFlowResults->FindObject(Form("%s for %s",intFlowDetectorBiasVsMName.Data(),cumulantFlag[ci].Data()))); | |
8888 | if(intFlowDetectorBiasVsM) | |
8889 | { | |
8890 | this->SetIntFlowDetectorBiasVsM(intFlowDetectorBiasVsM,ci); | |
8891 | } else | |
8892 | { | |
8893 | cout<<"WARNING: "<<Form("intFlowDetectorBiasVsM[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8894 | } | |
8895 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
b77b6434 | 8896 | } // end of if(fCalculateCumulantsVsM) |
489d5531 | 8897 | } else // to if(intFlowResults) |
8898 | { | |
8899 | cout<<"WARNING: intFlowResults is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8900 | } | |
ff70ca91 | 8901 | |
489d5531 | 8902 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForIntFlowHistograms() |
8903 | ||
489d5531 | 8904 | //================================================================================================================================ |
8905 | ||
1268c371 | 8906 | void AliFlowAnalysisWithQCumulants::GetPointersFor2DDiffFlowHistograms() |
8907 | { | |
8908 | // Get pointers for 2D differential flow histograms. | |
8909 | // a) Check pointers used in this method; | |
8910 | // b) Get pointers to 2D differential flow lists; | |
8911 | // c) Get pointers to 2D differential flow profiles; | |
8912 | // d) Get pointers to 2D differential flow histograms. | |
8913 | ||
8914 | // a) Check pointers used in this method: | |
8915 | if(!fDiffFlowList) | |
8916 | { | |
8917 | printf("\n WARNING (QC): fDiffFlowList is NULL in AFAWQC::GPF2DDFH() !!!!\n"); | |
8918 | printf(" Call method GetPointersForDiffFlowHistograms() first.\n\n"); | |
8919 | exit(0); | |
8920 | } | |
8921 | if(!fDiffFlowFlags) | |
8922 | { | |
8923 | printf("\n WARNING (QC): fDiffFlowFlags is NULL in AFAWQC::GPF2DDFH() !!!!\n\n"); | |
8924 | printf(" Call method GetPointersForDiffFlowHistograms() first.\n\n"); | |
8925 | exit(0); | |
8926 | } | |
8927 | ||
8928 | // b) Get pointers to 2D differential flow lists: | |
8929 | this->SetCalculate2DDiffFlow((Bool_t)fDiffFlowFlags->GetBinContent(5)); // to be improved - hardwired 5 | |
8930 | if(!fCalculate2DDiffFlow){return;} | |
8931 | TString typeFlag[2] = {"RP","POI"}; | |
8932 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
8933 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
8934 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
8935 | // Base list: | |
8936 | TString diffFlow2DListName = "2D"; | |
8937 | diffFlow2DListName += fAnalysisLabel->Data(); | |
8938 | fDiffFlow2D = dynamic_cast<TList*>(fDiffFlowList->FindObject(diffFlow2DListName.Data())); | |
8939 | if(!fDiffFlow2D) | |
8940 | { | |
8941 | printf("\n WARNING (QC): fDiffFlow2D is NULL in AFAWQC::GPFDFH() !!!!\n\n"); | |
8942 | exit(0); | |
8943 | } | |
8944 | // Lists holding profiles with 2D correlations: | |
8945 | TString s2DDiffFlowCorrelationsProListName = "Profiles with 2D correlations"; | |
8946 | s2DDiffFlowCorrelationsProListName += fAnalysisLabel->Data(); // to be improved | |
8947 | for(Int_t t=0;t<2;t++) | |
8948 | { | |
8949 | f2DDiffFlowCorrelationsProList[t] = dynamic_cast<TList*>(fDiffFlow2D->FindObject(Form("Profiles with 2D correlations (%s)",typeFlag[t].Data()))); | |
8950 | if(!f2DDiffFlowCorrelationsProList[t]) | |
8951 | { | |
8952 | printf("\n WARNING (QC): f2DDiffFlowCorrelationsProList[%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t); | |
8953 | exit(0); | |
8954 | } | |
8955 | } // end of for(Int_t t=0;t<2;t++) | |
8956 | ||
8957 | // c) Get pointers to 2D differential flow profiles: | |
8958 | TString s2DDiffFlowCorrelationsProName = "f2DDiffFlowCorrelationsPro"; | |
8959 | s2DDiffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
8960 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8961 | { | |
8962 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8963 | { | |
8964 | f2DDiffFlowCorrelationsPro[t][rci] = dynamic_cast<TProfile2D*>(f2DDiffFlowCorrelationsProList[t]->FindObject(Form("%s, %s, %s",s2DDiffFlowCorrelationsProName.Data(),typeFlag[t].Data(),reducedCorrelationIndex[rci].Data()))); | |
8965 | if(!f2DDiffFlowCorrelationsPro[t][rci]) | |
8966 | { | |
8967 | printf("\n WARNING (QC): f2DDiffFlowCorrelationsPro[%i][%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t,rci); | |
8968 | exit(0); | |
8969 | } else | |
8970 | { | |
8971 | this->Set2DDiffFlowCorrelationsPro(f2DDiffFlowCorrelationsPro[t][rci],t,rci); | |
8972 | } | |
8973 | } // end of for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8974 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
8975 | ||
8976 | // d) Get pointers to 2D differential flow histograms: | |
8977 | TString s2DDiffFlowCumulantsName = "f2DDiffFlowCumulants"; | |
8978 | s2DDiffFlowCumulantsName += fAnalysisLabel->Data(); | |
8979 | TString s2DDiffFlowName = "f2DDiffFlow"; | |
8980 | s2DDiffFlowName += fAnalysisLabel->Data(); | |
8981 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8982 | { | |
8983 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8984 | { | |
8985 | // 2D differential cumulants: | |
8986 | f2DDiffFlowCumulants[t][rci] = dynamic_cast<TH2D*>(f2DDiffFlowCorrelationsProList[t]->FindObject(Form("%s, %s, %s",s2DDiffFlowCumulantsName.Data(),typeFlag[t].Data(),differentialCumulantIndex[rci].Data()))); | |
8987 | if(!f2DDiffFlowCumulants[t][rci]) | |
8988 | { | |
8989 | printf("\n WARNING (QC): f2DDiffFlowCumulants[%i][%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t,rci); | |
8990 | exit(0); | |
8991 | } else | |
8992 | { | |
8993 | this->Set2DDiffFlowCumulants(f2DDiffFlowCumulants[t][rci],t,rci); | |
8994 | } | |
8995 | // 2D differential flow: | |
8996 | f2DDiffFlow[t][rci] = dynamic_cast<TH2D*>(f2DDiffFlowCorrelationsProList[t]->FindObject(Form("%s, %s, %s",s2DDiffFlowName.Data(),typeFlag[t].Data(),differentialFlowIndex[rci].Data()))); | |
8997 | if(!f2DDiffFlow[t][rci]) | |
8998 | { | |
8999 | printf("\n WARNING (QC): f2DDiffFlow[%i][%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t,rci); | |
9000 | exit(0); | |
9001 | } else | |
9002 | { | |
9003 | this->Set2DDiffFlow(f2DDiffFlow[t][rci],t,rci); | |
9004 | } | |
9005 | } // end of for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
9006 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
9007 | ||
9008 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersFor2DDiffFlowHistograms() | |
9009 | ||
9010 | //================================================================================================================================ | |
9011 | ||
64e500e3 | 9012 | void AliFlowAnalysisWithQCumulants::GetPointersForOtherDiffCorrelators() |
9013 | { | |
9014 | // Get pointers for other differential correlators. | |
9015 | // a) Get pointer to list with other differential correlators; | |
9016 | // b) Declare local flags; | |
9017 | // c) Get pointers to other differential profiles. | |
9018 | ||
62e36168 | 9019 | if(!fCalculateDiffFlow){return;} // TBI: This must eventually be moved somewhere else |
9020 | ||
64e500e3 | 9021 | // a) Get pointer to list with other differential correlators: |
9022 | fOtherDiffCorrelatorsList = dynamic_cast<TList*>(fHistList->FindObject("Other differential correlators")); | |
9023 | if(!fOtherDiffCorrelatorsList) | |
9024 | { | |
9025 | printf("\n WARNING (QC): fOtherDiffCorrelatorsList is NULL in AFAWQC::GPFDFH() !!!!\n\n"); | |
9026 | exit(0); | |
9027 | } | |
9028 | ||
9029 | // b) Declare local flags: // (to be improved - promoted to data members) | |
9030 | TString typeFlag[2] = {"RP","POI"}; | |
9031 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
9032 | TString sinCosFlag[2] = {"sin","cos"}; | |
9033 | ||
9034 | // c) Get pointers to other differential profiles: | |
9035 | TString otherDiffCorrelatorsName = "fOtherDiffCorrelators"; | |
9036 | otherDiffCorrelatorsName += fAnalysisLabel->Data(); | |
9037 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
9038 | { | |
62e36168 | 9039 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
64e500e3 | 9040 | { |
9041 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9042 | { | |
9043 | for(Int_t ci=0;ci<1;ci++) // correlator index | |
9044 | { | |
9045 | fOtherDiffCorrelators[t][pe][sc][ci] = dynamic_cast<TProfile*>(fOtherDiffCorrelatorsList->FindObject(Form("%s, %s, %s, %s, ci = %d",otherDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1))); | |
9046 | if(!fOtherDiffCorrelators[t][pe][sc][ci]) | |
9047 | { | |
9048 | printf("\n WARNING (QC): fOtherDiffCorrelators[%i][%i][%i][%i] is NULL in AFAWQC::GPFODC() !!!!\n\n",t,pe,sc,ci); | |
9049 | exit(0); | |
9050 | } else | |
9051 | { | |
9052 | this->SetOtherDiffCorrelators(fOtherDiffCorrelators[t][pe][sc][ci],t,pe,sc,ci); | |
9053 | } | |
9054 | } // end of for(Int_t ci=0;ci<1;ci++) // correlator index | |
9055 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9056 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9057 | } // end of for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
9058 | ||
9059 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForOtherDiffCorrelators() | |
9060 | ||
9061 | //================================================================================================================================ | |
9062 | ||
489d5531 | 9063 | void AliFlowAnalysisWithQCumulants::GetPointersForDiffFlowHistograms() |
9064 | { | |
9065 | // Get pointer to all objects relevant for differential flow. | |
1268c371 | 9066 | // a) Get pointer to base list for differential flow fDiffFlowList; |
9067 | // b) Get pointer to profile fDiffFlowFlags holding all flags for differential flow. Access and set some flags; | |
9068 | // c) Get pointers to nested lists fDiffFlowListProfiles and fDiffFlowListResults; | |
9069 | // d) Define flags locally (to be improved: should I promote these flags to data members?); | |
9070 | // e) Get pointers to all nested lists in fDiffFlowListProfiles and to profiles which they hold; | |
9071 | // f) Get pointers to all nested lists in fDiffFlowListResults and to histograms which they hold. | |
9072 | ||
9073 | // a) Get pointer to base list for differential flow fDiffFlowList: | |
9074 | fDiffFlowList = dynamic_cast<TList*>(fHistList->FindObject("Differential Flow")); | |
9075 | if(!fDiffFlowList) | |
489d5531 | 9076 | { |
1268c371 | 9077 | printf("\n WARNING (QC): fDiffFlowList is NULL in AFAWQC::GPFDFH() !!!!\n\n"); |
489d5531 | 9078 | exit(0); |
9079 | } | |
1268c371 | 9080 | |
9081 | // b) Get pointer to profile fDiffFlowFlags holding all flags for differential flow. Access and set some flags: | |
9082 | TString diffFlowFlagsName = "fDiffFlowFlags"; | |
9083 | diffFlowFlagsName += fAnalysisLabel->Data(); | |
9084 | fDiffFlowFlags = dynamic_cast<TProfile*>(fDiffFlowList->FindObject(diffFlowFlagsName.Data())); | |
9085 | if(fDiffFlowFlags) | |
9086 | { | |
62d19320 | 9087 | this->SetCalculateDiffFlow((Bool_t)fDiffFlowFlags->GetBinContent(1)); // to be improved - hardwired 1 |
62e36168 | 9088 | this->SetCalculateDiffFlowVsEta((Bool_t)fDiffFlowFlags->GetBinContent(6)); // to be improved - hardwired 6 |
1268c371 | 9089 | } else |
9090 | { | |
9091 | printf("\n WARNING (QC): fDiffFlowFlags is NULL in AFAWQC::GPFDFH() !!!!\n\n"); | |
9092 | printf("\n Flags in method Finish() are wrong.\n\n"); | |
9093 | exit(0); | |
9094 | } | |
9095 | ||
9096 | if(!fCalculateDiffFlow){return;} // IMPORTANT: do not move this anywhere above in this method (to be improved) | |
9097 | ||
9098 | // c) Get pointers to nested lists fDiffFlowListProfiles and fDiffFlowListResults: | |
9099 | // List holding nested lists holding profiles: | |
489d5531 | 9100 | TList *diffFlowListProfiles = NULL; |
1268c371 | 9101 | diffFlowListProfiles = dynamic_cast<TList*>(fDiffFlowList->FindObject("Profiles")); |
489d5531 | 9102 | if(!diffFlowListProfiles) |
9103 | { | |
1268c371 | 9104 | printf("\n WARNING (QC): diffFlowListProfiles is NULL in AFAWQC::GPFDFH() !!!!\n\n"); |
489d5531 | 9105 | exit(0); |
9106 | } | |
1268c371 | 9107 | // List holding nested lists holding histograms with final results: |
489d5531 | 9108 | TList *diffFlowListResults = NULL; |
1268c371 | 9109 | diffFlowListResults = dynamic_cast<TList*>(fDiffFlowList->FindObject("Results")); |
489d5531 | 9110 | if(!diffFlowListResults) |
9111 | { | |
1268c371 | 9112 | printf("\n WARNING (QC): diffFlowListResults is NULL in AFAWQC::GPFDFH() !!!!\n\n"); |
489d5531 | 9113 | exit(0); |
9114 | } | |
9115 | ||
1268c371 | 9116 | // d) Define flags locally (to be improved: should I promote these flags to data members?): |
9117 | TString typeFlag[2] = {"RP","POI"}; | |
9118 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
9119 | TString powerFlag[2] = {"linear","quadratic"}; | |
9120 | TString sinCosFlag[2] = {"sin","cos"}; | |
9121 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
9122 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
9123 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
9124 | TString reducedSquaredCorrelationIndex[4] = {"<2'>^{2}","<4'>^{2}","<6'>^{2}","<8'>^{2}"}; | |
9125 | TString mixedCorrelationIndex[8] = {"<2>","<2'>","<4>","<4'>","<6>","<6'>","<8>","<8'>"}; | |
9126 | TString covarianceName[5] = {"Cov(<2>,<2'>)","Cov(<2>,<4'>)","Cov(<4>,<2'>)","Cov(<4>,<4'>)","Cov(<2'>,<4'>)"}; | |
489d5531 | 9127 | |
1268c371 | 9128 | // e) Get pointers to all nested lists in fDiffFlowListProfiles and to profiles which they hold: |
489d5531 | 9129 | // correlations: |
9130 | TList *diffFlowCorrelationsProList[2][2] = {{NULL}}; | |
9131 | TString diffFlowCorrelationsProName = "fDiffFlowCorrelationsPro"; | |
9132 | diffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
b40a910e | 9133 | TProfile *diffFlowCorrelationsPro[2][2][4] = {{{NULL}}}; |
9134 | // squared correlations: | |
9135 | TString diffFlowSquaredCorrelationsProName = "fDiffFlowSquaredCorrelationsPro"; | |
9136 | diffFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
9137 | TProfile *diffFlowSquaredCorrelationsPro[2][2][4] = {{{NULL}}}; | |
489d5531 | 9138 | // products of correlations: |
9139 | TList *diffFlowProductOfCorrelationsProList[2][2] = {{NULL}}; | |
9140 | TString diffFlowProductOfCorrelationsProName = "fDiffFlowProductOfCorrelationsPro"; | |
9141 | diffFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
9142 | TProfile *diffFlowProductOfCorrelationsPro[2][2][8][8] = {{{{NULL}}}}; | |
9143 | // corrections: | |
9144 | TList *diffFlowCorrectionsProList[2][2] = {{NULL}}; | |
9145 | TString diffFlowCorrectionTermsForNUAProName = "fDiffFlowCorrectionTermsForNUAPro"; | |
9146 | diffFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
9147 | TProfile *diffFlowCorrectionTermsForNUAPro[2][2][2][10] = {{{{NULL}}}}; | |
9148 | for(Int_t t=0;t<2;t++) | |
9149 | { | |
62e36168 | 9150 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) |
489d5531 | 9151 | { |
9152 | diffFlowCorrelationsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9153 | if(!diffFlowCorrelationsProList[t][pe]) | |
9154 | { | |
9155 | cout<<"WARNING: diffFlowCorrelationsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9156 | cout<<"t = "<<t<<endl; | |
9157 | cout<<"pe = "<<pe<<endl; | |
9158 | exit(0); | |
9159 | } | |
9160 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
9161 | { | |
b40a910e | 9162 | // reduced correlations: |
489d5531 | 9163 | diffFlowCorrelationsPro[t][pe][ci] = dynamic_cast<TProfile*>(diffFlowCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[ci].Data()))); |
9164 | if(diffFlowCorrelationsPro[t][pe][ci]) | |
9165 | { | |
9166 | this->SetDiffFlowCorrelationsPro(diffFlowCorrelationsPro[t][pe][ci],t,pe,ci); | |
9167 | } else | |
9168 | { | |
9169 | cout<<"WARNING: diffFlowCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9170 | cout<<"t = "<<t<<endl; | |
9171 | cout<<"pe = "<<pe<<endl; | |
9172 | cout<<"ci = "<<ci<<endl; | |
9173 | } | |
b40a910e | 9174 | // reduced squared correlations: |
9175 | diffFlowSquaredCorrelationsPro[t][pe][ci] = dynamic_cast<TProfile*>(diffFlowCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowSquaredCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedSquaredCorrelationIndex[ci].Data()))); | |
9176 | if(diffFlowSquaredCorrelationsPro[t][pe][ci]) | |
9177 | { | |
9178 | this->SetDiffFlowSquaredCorrelationsPro(diffFlowSquaredCorrelationsPro[t][pe][ci],t,pe,ci); | |
9179 | } else | |
9180 | { | |
9181 | cout<<"WARNING: diffFlowSquaredCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9182 | cout<<"t = "<<t<<endl; | |
9183 | cout<<"pe = "<<pe<<endl; | |
9184 | cout<<"ci = "<<ci<<endl; | |
9185 | } | |
489d5531 | 9186 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index |
9187 | // products of correlations: | |
9188 | diffFlowProductOfCorrelationsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with products of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9189 | if(!diffFlowProductOfCorrelationsProList[t][pe]) | |
9190 | { | |
9191 | cout<<"WARNING: ddiffFlowProductOfCorrelationsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9192 | cout<<"t = "<<t<<endl; | |
9193 | cout<<"pe = "<<pe<<endl; | |
9194 | exit(0); | |
9195 | } | |
9196 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
9197 | { | |
9198 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
9199 | { | |
9200 | diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = dynamic_cast<TProfile*>(diffFlowProductOfCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()))); | |
9201 | if(diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]) | |
9202 | { | |
9203 | this->SetDiffFlowProductOfCorrelationsPro(diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2],t,pe,mci1,mci2); | |
9204 | } else | |
9205 | { | |
b40a910e | 9206 | cout<<"WARNING: diffFlowProductOfCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; |
489d5531 | 9207 | cout<<"t = "<<t<<endl; |
9208 | cout<<"pe = "<<pe<<endl; | |
9209 | cout<<"mci1 = "<<mci1<<endl; | |
9210 | cout<<"mci2 = "<<mci2<<endl; | |
9211 | } | |
9212 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
9213 | } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
9214 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
9215 | // corrections: | |
9216 | diffFlowCorrectionsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9217 | if(!diffFlowCorrectionsProList[t][pe]) | |
9218 | { | |
9219 | cout<<"WARNING: diffFlowCorrectionsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9220 | cout<<"t = "<<t<<endl; | |
9221 | cout<<"pe = "<<pe<<endl; | |
9222 | exit(0); | |
9223 | } | |
9224 | // correction terms for NUA: | |
9225 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9226 | { | |
9227 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
9228 | { | |
9229 | diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = dynamic_cast<TProfile*>(diffFlowCorrectionsProList[t][pe]->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1))); | |
9230 | if(diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]) | |
9231 | { | |
9232 | this->SetDiffFlowCorrectionTermsForNUAPro(diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti],t,pe,sc,cti); | |
9233 | } else | |
9234 | { | |
9235 | cout<<"WARNING: diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9236 | cout<<"t = "<<t<<endl; | |
9237 | cout<<"pe = "<<pe<<endl; | |
9238 | cout<<"sc = "<<sc<<endl; | |
9239 | cout<<"cti = "<<cti<<endl; | |
9240 | } | |
9241 | } // end of for(Int_t cti=0;cti<9;cti++) // correction term index | |
9242 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9243 | // ... | |
9244 | } // end of for(Int_t pe=0;pe<2;pe++) | |
9245 | } // end of for(Int_t t=0;t<2;t++) | |
9246 | ||
1268c371 | 9247 | // f) Get pointers to all nested lists in fDiffFlowListResults and to histograms which they hold: |
489d5531 | 9248 | // reduced correlations: |
9249 | TList *diffFlowCorrelationsHistList[2][2] = {{NULL}}; | |
9250 | TString diffFlowCorrelationsHistName = "fDiffFlowCorrelationsHist"; | |
9251 | diffFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
9252 | TH1D *diffFlowCorrelationsHist[2][2][4] = {{{NULL}}}; | |
9253 | // corrections for NUA: | |
9254 | TList *diffFlowCorrectionsHistList[2][2] = {{NULL}}; | |
9255 | TString diffFlowCorrectionTermsForNUAHistName = "fDiffFlowCorrectionTermsForNUAHist"; | |
9256 | diffFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
9257 | TH1D *diffFlowCorrectionTermsForNUAHist[2][2][2][10] = {{{{NULL}}}}; | |
9258 | // differential Q-cumulants: | |
9259 | TList *diffFlowCumulantsHistList[2][2] = {{NULL}}; | |
9260 | TString diffFlowCumulantsName = "fDiffFlowCumulants"; | |
9261 | diffFlowCumulantsName += fAnalysisLabel->Data(); | |
9262 | TH1D *diffFlowCumulants[2][2][4] = {{{NULL}}}; | |
1268c371 | 9263 | // detector bias to differential Q-cumulants: |
9264 | TList *diffFlowDetectorBiasHistList[2][2] = {{NULL}}; | |
9265 | TString diffFlowDetectorBiasName = "fDiffFlowDetectorBias"; | |
9266 | diffFlowDetectorBiasName += fAnalysisLabel->Data(); | |
9267 | TH1D *diffFlowDetectorBias[2][2][4] = {{{NULL}}}; | |
489d5531 | 9268 | // differential flow estimates from Q-cumulants: |
9269 | TList *diffFlowHistList[2][2] = {{NULL}}; | |
9270 | TString diffFlowName = "fDiffFlow"; | |
9271 | diffFlowName += fAnalysisLabel->Data(); | |
9272 | TH1D *diffFlow[2][2][4] = {{{NULL}}}; | |
9273 | // differential covariances: | |
9274 | TList *diffFlowCovariancesHistList[2][2] = {{NULL}}; | |
9275 | TString diffFlowCovariancesName = "fDiffFlowCovariances"; | |
9276 | diffFlowCovariancesName += fAnalysisLabel->Data(); | |
9277 | TH1D *diffFlowCovariances[2][2][5] = {{{NULL}}}; | |
9278 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9279 | { | |
62e36168 | 9280 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9281 | { |
9282 | // reduced correlations: | |
9283 | diffFlowCorrelationsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9284 | if(!diffFlowCorrelationsHistList[t][pe]) | |
9285 | { | |
9286 | cout<<"WARNING: diffFlowCorrelationsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9287 | cout<<"t = "<<t<<endl; | |
9288 | cout<<"pe = "<<pe<<endl; | |
9289 | exit(0); | |
9290 | } | |
9291 | for(Int_t index=0;index<4;index++) | |
9292 | { | |
9293 | diffFlowCorrelationsHist[t][pe][index] = dynamic_cast<TH1D*>(diffFlowCorrelationsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()))); | |
9294 | if(diffFlowCorrelationsHist[t][pe][index]) | |
9295 | { | |
9296 | this->SetDiffFlowCorrelationsHist(diffFlowCorrelationsHist[t][pe][index],t,pe,index); | |
9297 | } else | |
9298 | { | |
9299 | cout<<"WARNING: diffFlowCorrelationsHist[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9300 | cout<<"t = "<<t<<endl; | |
9301 | cout<<"pe = "<<pe<<endl; | |
9302 | cout<<"index = "<<index<<endl; | |
9303 | exit(0); | |
9304 | } | |
9305 | } // end of for(Int_t index=0;index<4;index++) | |
9306 | // corrections: | |
9307 | diffFlowCorrectionsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Histograms with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9308 | if(!diffFlowCorrectionsHistList[t][pe]) | |
9309 | { | |
9310 | cout<<"WARNING: diffFlowCorrectionsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9311 | cout<<"t = "<<t<<endl; | |
9312 | cout<<"pe = "<<pe<<endl; | |
9313 | exit(0); | |
9314 | } | |
9315 | // correction terms for NUA: | |
9316 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9317 | { | |
9318 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
9319 | { | |
9320 | diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = dynamic_cast<TH1D*>(diffFlowCorrectionsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1))); | |
9321 | if(diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]) | |
9322 | { | |
9323 | this->SetDiffFlowCorrectionTermsForNUAHist(diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti],t,pe,sc,cti); | |
9324 | } else | |
9325 | { | |
9326 | cout<<"WARNING: diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9327 | cout<<"t = "<<t<<endl; | |
9328 | cout<<"pe = "<<pe<<endl; | |
9329 | cout<<"sc = "<<sc<<endl; | |
9330 | cout<<"cti = "<<cti<<endl; | |
9331 | } | |
9332 | } // end of for(Int_t cti=0;cti<9;cti++) // correction term index | |
9333 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9334 | // ... | |
9335 | // differential Q-cumulants: | |
9336 | diffFlowCumulantsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Differential Q-cumulants (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9337 | if(!diffFlowCumulantsHistList[t][pe]) | |
9338 | { | |
9339 | cout<<"WARNING: diffFlowCumulantsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9340 | cout<<"t = "<<t<<endl; | |
9341 | cout<<"pe = "<<pe<<endl; | |
9342 | exit(0); | |
9343 | } | |
9344 | for(Int_t index=0;index<4;index++) | |
9345 | { | |
9346 | diffFlowCumulants[t][pe][index] = dynamic_cast<TH1D*>(diffFlowCumulantsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()))); | |
9347 | if(diffFlowCumulants[t][pe][index]) | |
9348 | { | |
9349 | this->SetDiffFlowCumulants(diffFlowCumulants[t][pe][index],t,pe,index); | |
9350 | } else | |
9351 | { | |
9352 | cout<<"WARNING: diffFlowCumulants[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9353 | cout<<"t = "<<t<<endl; | |
9354 | cout<<"pe = "<<pe<<endl; | |
9355 | cout<<"index = "<<index<<endl; | |
9356 | exit(0); | |
9357 | } | |
9358 | } // end of for(Int_t index=0;index<4;index++) | |
1268c371 | 9359 | // Detector bias to differential Q-cumulants: |
9360 | diffFlowDetectorBiasHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Detector bias (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9361 | if(!diffFlowDetectorBiasHistList[t][pe]) | |
9362 | { | |
9363 | cout<<"WARNING: diffFlowDetectorBiasHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9364 | cout<<"t = "<<t<<endl; | |
9365 | cout<<"pe = "<<pe<<endl; | |
9366 | exit(0); | |
9367 | } | |
9368 | for(Int_t index=0;index<4;index++) | |
9369 | { | |
9370 | diffFlowDetectorBias[t][pe][index] = dynamic_cast<TH1D*>(diffFlowDetectorBiasHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowDetectorBiasName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()))); | |
9371 | if(diffFlowDetectorBias[t][pe][index]) | |
9372 | { | |
9373 | this->SetDiffFlowDetectorBias(diffFlowDetectorBias[t][pe][index],t,pe,index); | |
9374 | } else | |
9375 | { | |
9376 | cout<<"WARNING: diffFlowDetectorBias[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9377 | cout<<"t = "<<t<<endl; | |
9378 | cout<<"pe = "<<pe<<endl; | |
9379 | cout<<"index = "<<index<<endl; | |
9380 | exit(0); | |
9381 | } | |
9382 | } // end of for(Int_t index=0;index<4;index++) | |
489d5531 | 9383 | // differential flow estimates from Q-cumulants: |
9384 | diffFlowHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Differential flow (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9385 | if(!diffFlowHistList[t][pe]) | |
9386 | { | |
9387 | cout<<"WARNING: diffFlowHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9388 | cout<<"t = "<<t<<endl; | |
9389 | cout<<"pe = "<<pe<<endl; | |
9390 | exit(0); | |
9391 | } | |
9392 | for(Int_t index=0;index<4;index++) | |
9393 | { | |
9394 | diffFlow[t][pe][index] = dynamic_cast<TH1D*>(diffFlowHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()))); | |
9395 | if(diffFlow[t][pe][index]) | |
9396 | { | |
9397 | this->SetDiffFlow(diffFlow[t][pe][index],t,pe,index); | |
9398 | } else | |
9399 | { | |
9400 | cout<<"WARNING: diffFlow[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9401 | cout<<"t = "<<t<<endl; | |
9402 | cout<<"pe = "<<pe<<endl; | |
9403 | cout<<"index = "<<index<<endl; | |
9404 | exit(0); | |
9405 | } | |
9406 | } // end of for(Int_t index=0;index<4;index++) | |
9407 | // differential covariances: | |
9408 | diffFlowCovariancesHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Covariances of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9409 | if(!diffFlowCovariancesHistList[t][pe]) | |
9410 | { | |
9411 | cout<<"WARNING: diffFlowCovariancesHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9412 | cout<<"t = "<<t<<endl; | |
9413 | cout<<"pe = "<<pe<<endl; | |
9414 | exit(0); | |
9415 | } | |
9416 | for(Int_t covIndex=0;covIndex<5;covIndex++) | |
9417 | { | |
9418 | diffFlowCovariances[t][pe][covIndex] = dynamic_cast<TH1D*>(diffFlowCovariancesHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()))); | |
9419 | if(diffFlowCovariances[t][pe][covIndex]) | |
9420 | { | |
9421 | this->SetDiffFlowCovariances(diffFlowCovariances[t][pe][covIndex],t,pe,covIndex); | |
9422 | } else | |
9423 | { | |
9424 | cout<<"WARNING: diffFlowCovariances[t][pe][covIndex] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9425 | cout<<"t = "<<t<<endl; | |
9426 | cout<<"pe = "<<pe<<endl; | |
9427 | cout<<"covIndex = "<<covIndex<<endl; | |
9428 | exit(0); | |
9429 | } | |
9430 | } // end of for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index | |
9431 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9432 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
9433 | // sum of event weights for reduced correlations: | |
9434 | TList *diffFlowSumOfEventWeightsHistList[2][2][2] = {{{NULL}}}; | |
9435 | TString diffFlowSumOfEventWeightsName = "fDiffFlowSumOfEventWeights"; | |
9436 | diffFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
9437 | TH1D *diffFlowSumOfEventWeights[2][2][2][4] = {{{{NULL}}}}; | |
9438 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
9439 | { | |
62e36168 | 9440 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9441 | { |
9442 | for(Int_t p=0;p<2;p++) // power of event weights is either 1 or 2 | |
9443 | { | |
9444 | diffFlowSumOfEventWeightsHistList[t][pe][p] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Sum of %s event weights (%s, %s)",powerFlag[p].Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9445 | if(!diffFlowSumOfEventWeightsHistList[t][pe][p]) | |
9446 | { | |
9447 | cout<<"WARNING: diffFlowSumOfEventWeightsHistList[t][pe][p] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9448 | cout<<"t = "<<t<<endl; | |
9449 | cout<<"pe = "<<pe<<endl; | |
9450 | cout<<"power = "<<p<<endl; | |
9451 | exit(0); | |
9452 | } | |
9453 | for(Int_t ew=0;ew<4;ew++) // index of reduced correlation | |
9454 | { | |
9455 | diffFlowSumOfEventWeights[t][pe][p][ew] = dynamic_cast<TH1D*>(diffFlowSumOfEventWeightsHistList[t][pe][p]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()))); | |
9456 | if(diffFlowSumOfEventWeights[t][pe][p][ew]) | |
9457 | { | |
9458 | this->SetDiffFlowSumOfEventWeights(diffFlowSumOfEventWeights[t][pe][p][ew],t,pe,p,ew); | |
9459 | } else | |
9460 | { | |
9461 | cout<<"WARNING: diffFlowSumOfEventWeights[t][pe][p][ew] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9462 | cout<<"t = "<<t<<endl; | |
9463 | cout<<"pe = "<<pe<<endl; | |
9464 | cout<<"power = "<<p<<endl; | |
9465 | cout<<"ew = "<<ew<<endl; | |
9466 | exit(0); | |
9467 | } | |
9468 | } | |
9469 | } // end of for(Int_t p=0;p<2;p++) // power of event weights is either 1 or 2 | |
9470 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9471 | } // end of for(Int_t t=0;t<2;t++) // type is RP or POI | |
9472 | // | |
9473 | TList *diffFlowSumOfProductOfEventWeightsHistList[2][2] = {{NULL}}; | |
9474 | TString diffFlowSumOfProductOfEventWeightsName = "fDiffFlowSumOfProductOfEventWeights"; | |
9475 | diffFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
9476 | TH1D *diffFlowSumOfProductOfEventWeights[2][2][8][8] = {{{{NULL}}}}; | |
9477 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
9478 | { | |
62e36168 | 9479 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9480 | { |
9481 | diffFlowSumOfProductOfEventWeightsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Sum of products of event weights (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9482 | if(!diffFlowSumOfProductOfEventWeightsHistList[t][pe]) | |
9483 | { | |
9484 | cout<<"WARNING: diffFlowSumOfProductOfEventWeightsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9485 | cout<<"t = "<<t<<endl; | |
9486 | cout<<"pe = "<<pe<<endl; | |
9487 | exit(0); | |
9488 | } | |
9489 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
9490 | { | |
9491 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
9492 | { | |
9493 | diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = dynamic_cast<TH1D*>(diffFlowSumOfProductOfEventWeightsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()))); | |
9494 | if(diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]) | |
9495 | { | |
9496 | this->SetDiffFlowSumOfProductOfEventWeights(diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2],t,pe,mci1,mci2); | |
9497 | } else | |
9498 | { | |
9499 | cout<<"WARNING: diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9500 | cout<<"t = "<<t<<endl; | |
9501 | cout<<"pe = "<<pe<<endl; | |
9502 | cout<<"mci1 = "<<mci1<<endl; | |
9503 | cout<<"mci2 = "<<mci2<<endl; | |
9504 | exit(0); | |
9505 | } | |
9506 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
9507 | } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
9508 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
9509 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9510 | } // end of for(Int_t t=0;t<2;t++) // type is RP or POI | |
9511 | ||
9512 | } // end void AliFlowAnalysisWithQCumulants::GetPointersForDiffFlowHistograms() | |
9513 | ||
489d5531 | 9514 | //================================================================================================================================ |
9515 | ||
1268c371 | 9516 | void AliFlowAnalysisWithQCumulants::BookEverythingFor2DDifferentialFlow() |
9517 | { | |
9518 | // Book all objects needed for 2D differential flow. | |
9519 | // a) Define flags locally (to be improved: should I promote flags to data members?); | |
9520 | // b) Book e-b-e quantities; | |
9521 | // c) Book 2D profiles; | |
9522 | // d) Book 2D histograms. | |
9523 | ||
9524 | if(!fCalculate2DDiffFlow){return;} | |
9525 | ||
9526 | // a) Define flags locally (to be improved: should I promote flags to data members?): | |
9527 | TString typeFlag[2] = {"RP","POI"}; | |
9528 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
9529 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
9530 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
9531 | ||
9532 | // b) Book e-b-e quantities: | |
9533 | TProfile2D styleRe("typeMultiplePowerRe","typeMultiplePowerRe",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
9534 | TProfile2D styleIm("typeMultiplePowerIm","typeMultiplePowerIm",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
9535 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) | |
9536 | { | |
9537 | for(Int_t m=0;m<4;m++) | |
9538 | { | |
9539 | for(Int_t k=0;k<9;k++) | |
9540 | { | |
9541 | fReRPQ2dEBE[t][m][k] = (TProfile2D*)styleRe.Clone(Form("typeFlag%dmultiple%dpower%dRe",t,m,k)); | |
9542 | fImRPQ2dEBE[t][m][k] = (TProfile2D*)styleIm.Clone(Form("typeFlag%dmultiple%dpower%dIm",t,m,k)); | |
9543 | } | |
9544 | } | |
9545 | } | |
9546 | TProfile2D styleS("typePower","typePower",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
9547 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) | |
9548 | { | |
9549 | for(Int_t k=0;k<9;k++) | |
9550 | { | |
9551 | fs2dEBE[t][k] = (TProfile2D*)styleS.Clone(Form("typeFlag%dpower%d",t,k)); | |
9552 | } | |
9553 | } | |
9554 | ||
9555 | // c) Book 2D profiles: | |
9556 | TString s2DDiffFlowCorrelationsProName = "f2DDiffFlowCorrelationsPro"; | |
9557 | s2DDiffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
9558 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9559 | { | |
9560 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
9561 | { | |
9562 | f2DDiffFlowCorrelationsPro[t][rci] = new TProfile2D(Form("%s, %s, %s",s2DDiffFlowCorrelationsProName.Data(),typeFlag[t].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s",s2DDiffFlowCorrelationsProName.Data(),typeFlag[t].Data(),reducedCorrelationIndex[rci].Data()),fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,""); | |
9563 | f2DDiffFlowCorrelationsPro[t][rci]->Sumw2(); | |
9564 | f2DDiffFlowCorrelationsPro[t][rci]->SetXTitle("p_{t}"); | |
9565 | f2DDiffFlowCorrelationsPro[t][rci]->SetYTitle("#eta"); | |
9566 | f2DDiffFlowCorrelationsProList[t]->Add(f2DDiffFlowCorrelationsPro[t][rci]); | |
9567 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
9568 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POIs | |
9569 | ||
9570 | // d) Book 2D histograms: | |
9571 | TString s2DDiffFlowCumulantsName = "f2DDiffFlowCumulants"; | |
9572 | s2DDiffFlowCumulantsName += fAnalysisLabel->Data(); | |
9573 | TString s2DDiffFlowName = "f2DDiffFlow"; | |
9574 | s2DDiffFlowName += fAnalysisLabel->Data(); | |
9575 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9576 | { | |
9577 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
9578 | { | |
9579 | // 2D diferential cumulants: | |
9580 | f2DDiffFlowCumulants[t][rci] = new TH2D(Form("%s, %s, %s",s2DDiffFlowCumulantsName.Data(),typeFlag[t].Data(),differentialCumulantIndex[rci].Data()),Form("%s, %s, %s",s2DDiffFlowCumulantsName.Data(),typeFlag[t].Data(),differentialCumulantIndex[rci].Data()),fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
9581 | f2DDiffFlowCumulants[t][rci]->SetXTitle("p_{t}"); | |
9582 | f2DDiffFlowCumulants[t][rci]->SetYTitle("#eta"); | |
9583 | f2DDiffFlowCorrelationsProList[t]->Add(f2DDiffFlowCumulants[t][rci]); // to be improved - moved to another list | |
9584 | // 2D differential flow: | |
9585 | f2DDiffFlow[t][rci] = new TH2D(Form("%s, %s, %s",s2DDiffFlowName.Data(),typeFlag[t].Data(),differentialFlowIndex[rci].Data()),Form("%s, %s, %s",s2DDiffFlowName.Data(),typeFlag[t].Data(),differentialFlowIndex[rci].Data()),fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
9586 | f2DDiffFlow[t][rci]->SetXTitle("p_{t}"); | |
9587 | f2DDiffFlow[t][rci]->SetYTitle("#eta"); | |
9588 | f2DDiffFlowCorrelationsProList[t]->Add(f2DDiffFlow[t][rci]); // to be improved - moved to another list | |
9589 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
9590 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POIs | |
9591 | ||
9592 | } // void AliFlowAnalysisWithQCumulants::BookEverythingFor2DDifferentialFlow() | |
9593 | ||
9594 | //================================================================================================================================ | |
489d5531 | 9595 | |
9596 | void AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow() | |
9597 | { | |
9598 | // Book all histograms and profiles needed for differential flow. | |
1268c371 | 9599 | // a) Book profile to hold all flags for differential flow; |
9600 | // b) Define flags locally (to be improved: should I promote flags to data members?); | |
489d5531 | 9601 | // c) Book e-b-e quantities; |
9602 | // d) Book profiles; | |
9603 | // e) Book histograms holding final results. | |
9604 | ||
1268c371 | 9605 | // a) Book profile to hold all flags for differential flow: |
9606 | TString diffFlowFlagsName = "fDiffFlowFlags"; | |
9607 | diffFlowFlagsName += fAnalysisLabel->Data(); | |
62e36168 | 9608 | fDiffFlowFlags = new TProfile(diffFlowFlagsName.Data(),"Flags for differential flow",6,0,6); |
1268c371 | 9609 | fDiffFlowFlags->SetTickLength(-0.01,"Y"); |
9610 | fDiffFlowFlags->SetMarkerStyle(25); | |
9611 | fDiffFlowFlags->SetLabelSize(0.04,"X"); | |
9612 | fDiffFlowFlags->SetLabelOffset(0.02,"Y"); | |
9613 | fDiffFlowFlags->GetXaxis()->SetBinLabel(1,"Calculate diff. flow"); | |
9614 | fDiffFlowFlags->GetXaxis()->SetBinLabel(2,"Particle weights"); | |
9615 | fDiffFlowFlags->GetXaxis()->SetBinLabel(3,"Event weights"); | |
9616 | fDiffFlowFlags->GetXaxis()->SetBinLabel(4,"Correct for NUA"); | |
9617 | fDiffFlowFlags->GetXaxis()->SetBinLabel(5,"Calculate 2D diff. flow"); | |
62e36168 | 9618 | fDiffFlowFlags->GetXaxis()->SetBinLabel(6,"Calculate diff. flow vs eta"); |
1268c371 | 9619 | fDiffFlowList->Add(fDiffFlowFlags); |
9620 | ||
9621 | if(!fCalculateDiffFlow){return;} | |
9622 | ||
9623 | // b) Define flags locally (to be improved: should I promote flags to data members?): | |
489d5531 | 9624 | TString typeFlag[2] = {"RP","POI"}; |
9625 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
9626 | TString powerFlag[2] = {"linear","quadratic"}; | |
9627 | TString sinCosFlag[2] = {"sin","cos"}; | |
9628 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
9629 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
9630 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
b40a910e | 9631 | TString reducedSquaredCorrelationIndex[4] = {"<2'>^{2}","<4'>^{2}","<6'>^{2}","<8'>^{2}"}; |
489d5531 | 9632 | TString mixedCorrelationIndex[8] = {"<2>","<2'>","<4>","<4'>","<6>","<6'>","<8>","<8'>"}; |
9633 | TString covarianceName[5] = {"Cov(<2>,<2'>)","Cov(<2>,<4'>)","Cov(<4>,<2'>)","Cov(<4>,<4'>)","Cov(<2'>,<4'>)"}; | |
9634 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
9635 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
9636 | Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
1268c371 | 9637 | |
489d5531 | 9638 | // c) Book e-b-e quantities: |
9639 | // Event-by-event r_{m*n,k}(pt,eta), p_{m*n,k}(pt,eta) and q_{m*n,k}(pt,eta) | |
9640 | // Explanantion of notation: | |
9641 | // 1.) n is harmonic, m is multiple of harmonic; | |
9642 | // 2.) k is power of particle weight; | |
9643 | // 3.) r_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for RPs in particular (pt,eta) bin (i-th RP is weighted with w_i^k); | |
9644 | // 4.) p_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for POIs in particular (pt,eta) bin | |
9645 | // (if i-th POI is also RP, than it is weighted with w_i^k); | |
9646 | // 5.) q_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for particles which are both RPs and POIs in particular (pt,eta) bin | |
9647 | // (i-th RP&&POI is weighted with w_i^k) | |
9648 | ||
9649 | // 1D: | |
9650 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP && POI ) | |
9651 | { | |
62e36168 | 9652 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9653 | { |
9654 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
9655 | { | |
9656 | for(Int_t k=0;k<9;k++) // power of particle weight | |
9657 | { | |
9658 | fReRPQ1dEBE[t][pe][m][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%dpower%dRe",t,pe,m,k), | |
9659 | Form("TypeFlag%dpteta%dmultiple%dpower%dRe",t,pe,m,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9660 | fImRPQ1dEBE[t][pe][m][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%dpower%dIm",t,pe,m,k), | |
9661 | Form("TypeFlag%dpteta%dmultiple%dpower%dIm",t,pe,m,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9662 | } | |
9663 | } | |
9664 | } | |
9665 | } | |
9666 | // to be improved (add explanation of fs1dEBE[t][pe][k]): | |
9667 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) | |
9668 | { | |
62e36168 | 9669 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9670 | { |
9671 | for(Int_t k=0;k<9;k++) // power of particle weight | |
9672 | { | |
9673 | fs1dEBE[t][pe][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%d",t,pe,k), | |
9674 | Form("TypeFlag%dpteta%dmultiple%d",t,pe,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9675 | } | |
9676 | } | |
9677 | } | |
9678 | // correction terms for nua: | |
9679 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
9680 | { | |
62e36168 | 9681 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9682 | { |
9683 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9684 | { | |
9685 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
9686 | { | |
9687 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti] = new TH1D(Form("typeFlag%d pteta%d sincos%d cti%d",t,pe,sc,cti), | |
9688 | Form("typeFlag%d pteta%d sincos%d cti%d",t,pe,sc,cti),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9689 | } | |
9690 | } | |
9691 | } | |
9692 | } | |
489d5531 | 9693 | // reduced correlations e-b-e: |
9694 | TString diffFlowCorrelationsEBEName = "fDiffFlowCorrelationsEBE"; | |
9695 | diffFlowCorrelationsEBEName += fAnalysisLabel->Data(); | |
9696 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9697 | { | |
62e36168 | 9698 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9699 | { |
9700 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
9701 | { | |
9702 | fDiffFlowCorrelationsEBE[t][pe][rci] = new TH1D(Form("%s, %s, %s, %s",diffFlowCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9703 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
9704 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9705 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
9706 | // event weights for reduced correlations e-b-e: | |
9707 | TString diffFlowEventWeightsForCorrelationsEBEName = "fDiffFlowEventWeightsForCorrelationsEBE"; | |
9708 | diffFlowEventWeightsForCorrelationsEBEName += fAnalysisLabel->Data(); | |
9709 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9710 | { | |
62e36168 | 9711 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9712 | { |
9713 | for(Int_t rci=0;rci<4;rci++) // event weight for reduced correlation index | |
9714 | { | |
9715 | fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci] = new TH1D(Form("%s, %s, %s, eW for %s",diffFlowEventWeightsForCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, eW for %s",diffFlowEventWeightsForCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9716 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
9717 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9718 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
9719 | ||
9720 | // d) Book profiles; | |
9721 | // reduced correlations: | |
9722 | TString diffFlowCorrelationsProName = "fDiffFlowCorrelationsPro"; | |
9723 | diffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
b40a910e | 9724 | // reduced squared correlations: |
9725 | TString diffFlowSquaredCorrelationsProName = "fDiffFlowSquaredCorrelationsPro"; | |
9726 | diffFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
489d5531 | 9727 | // corrections terms: |
9728 | TString diffFlowCorrectionTermsForNUAProName = "fDiffFlowCorrectionTermsForNUAPro"; | |
9729 | diffFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
b40a910e | 9730 | // reduced correlations: |
489d5531 | 9731 | for(Int_t t=0;t<2;t++) // type: RP or POI |
9732 | { | |
62e36168 | 9733 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9734 | { |
9735 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
9736 | { | |
489d5531 | 9737 | fDiffFlowCorrelationsPro[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe],"s"); |
b40a910e | 9738 | fDiffFlowCorrelationsPro[t][pe][rci]->Sumw2(); |
489d5531 | 9739 | fDiffFlowCorrelationsPro[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data()); |
9740 | fDiffFlowCorrelationsProList[t][pe]->Add(fDiffFlowCorrelationsPro[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations) | |
9741 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
9742 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9743 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
b40a910e | 9744 | // reduced squared correlations: |
9745 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9746 | { | |
62e36168 | 9747 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
b40a910e | 9748 | { |
9749 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
9750 | { | |
9751 | fDiffFlowSquaredCorrelationsPro[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowSquaredCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedSquaredCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowSquaredCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedSquaredCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe],"s"); | |
9752 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->Sumw2(); | |
9753 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data()); | |
9754 | fDiffFlowCorrelationsProList[t][pe]->Add(fDiffFlowSquaredCorrelationsPro[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations) | |
9755 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
9756 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9757 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
489d5531 | 9758 | // correction terms for nua: |
9759 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
9760 | { | |
62e36168 | 9761 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9762 | { |
9763 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9764 | { | |
9765 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
9766 | { | |
9767 | fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = new TProfile(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9768 | fDiffFlowCorrectionsProList[t][pe]->Add(fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]); | |
9769 | } | |
9770 | } | |
9771 | } | |
9772 | } | |
64e500e3 | 9773 | // Other differential correlators: |
9774 | TString otherDiffCorrelatorsName = "fOtherDiffCorrelators"; | |
9775 | otherDiffCorrelatorsName += fAnalysisLabel->Data(); | |
9776 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
9777 | { | |
62e36168 | 9778 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
64e500e3 | 9779 | { |
9780 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9781 | { | |
9782 | for(Int_t ci=0;ci<1;ci++) // correlator index | |
9783 | { | |
9784 | fOtherDiffCorrelators[t][pe][sc][ci] = new TProfile(Form("%s, %s, %s, %s, ci = %d",otherDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1),Form("%s, %s, %s, %s, ci = %d",otherDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9785 | fOtherDiffCorrelators[t][pe][sc][ci]->Sumw2(); | |
9786 | fOtherDiffCorrelatorsList->Add(fOtherDiffCorrelators[t][pe][sc][ci]); | |
9787 | } | |
9788 | } | |
9789 | } | |
9790 | } | |
489d5531 | 9791 | // e) Book histograms holding final results. |
9792 | // reduced correlations: | |
9793 | TString diffFlowCorrelationsHistName = "fDiffFlowCorrelationsHist"; | |
9794 | diffFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
9795 | // corrections terms: | |
9796 | TString diffFlowCorrectionTermsForNUAHistName = "fDiffFlowCorrectionTermsForNUAHist"; | |
9797 | diffFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
9798 | // differential covariances: | |
9799 | TString diffFlowCovariancesName = "fDiffFlowCovariances"; | |
9800 | diffFlowCovariancesName += fAnalysisLabel->Data(); | |
9801 | // differential Q-cumulants: | |
9802 | TString diffFlowCumulantsName = "fDiffFlowCumulants"; | |
9803 | diffFlowCumulantsName += fAnalysisLabel->Data(); | |
1268c371 | 9804 | // Detector bias to differential Q-cumulants: |
9805 | TString diffFlowDetectorBiasName = "fDiffFlowDetectorBias"; | |
9806 | diffFlowDetectorBiasName += fAnalysisLabel->Data(); | |
489d5531 | 9807 | // differential flow: |
9808 | TString diffFlowName = "fDiffFlow"; | |
9809 | diffFlowName += fAnalysisLabel->Data(); | |
9810 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9811 | { | |
62e36168 | 9812 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9813 | { |
9814 | for(Int_t index=0;index<4;index++) | |
9815 | { | |
9816 | // reduced correlations: | |
9817 | fDiffFlowCorrelationsHist[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9818 | fDiffFlowCorrelationsHist[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
9819 | fDiffFlowCorrelationsHistList[t][pe]->Add(fDiffFlowCorrelationsHist[t][pe][index]); | |
9820 | // differential Q-cumulants: | |
9821 | fDiffFlowCumulants[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9822 | fDiffFlowCumulants[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
9823 | fDiffFlowCumulantsHistList[t][pe]->Add(fDiffFlowCumulants[t][pe][index]); | |
1268c371 | 9824 | // Detector bias to differential Q-cumulants: |
9825 | fDiffFlowDetectorBias[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowDetectorBiasName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowDetectorBiasName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9826 | fDiffFlowDetectorBias[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
9827 | fDiffFlowDetectorBias[t][pe][index]->SetTitle(Form("#frac{corrected}{measured} %s",differentialCumulantIndex[index].Data())); | |
9828 | fDiffFlowDetectorBiasHistList[t][pe]->Add(fDiffFlowDetectorBias[t][pe][index]); | |
489d5531 | 9829 | // differential flow estimates from Q-cumulants: |
9830 | fDiffFlow[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9831 | fDiffFlow[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
9832 | fDiffFlowHistList[t][pe]->Add(fDiffFlow[t][pe][index]); | |
9833 | } // end of for(Int_t index=0;index<4;index++) | |
9834 | for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index | |
9835 | { | |
9836 | // differential covariances: | |
9837 | fDiffFlowCovariances[t][pe][covIndex] = new TH1D(Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()),Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9838 | fDiffFlowCovariances[t][pe][covIndex]->SetXTitle(ptEtaFlag[pe].Data()); | |
9839 | fDiffFlowCovariancesHistList[t][pe]->Add(fDiffFlowCovariances[t][pe][covIndex]); | |
9840 | } // end of for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index | |
9841 | // products of both types of correlations: | |
9842 | TString diffFlowProductOfCorrelationsProName = "fDiffFlowProductOfCorrelationsPro"; | |
9843 | diffFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
9844 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
9845 | { | |
9846 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
9847 | { | |
9848 | fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = new TProfile(Form("%s, %s, %s, %s, %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),Form("%s, %s, %s, %s #times %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9849 | fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]->SetXTitle(ptEtaFlag[pe].Data()); | |
9850 | fDiffFlowProductOfCorrelationsProList[t][pe]->Add(fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]); | |
9851 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
9852 | } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
9853 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
9854 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9855 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
9856 | // sums of event weights for reduced correlations: | |
9857 | TString diffFlowSumOfEventWeightsName = "fDiffFlowSumOfEventWeights"; | |
9858 | diffFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
9859 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
9860 | { | |
62e36168 | 9861 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9862 | { |
9863 | for(Int_t p=0;p<2;p++) // power of weights is either 1 or 2 | |
9864 | { | |
9865 | for(Int_t ew=0;ew<4;ew++) // index of reduced correlation | |
9866 | { | |
9867 | fDiffFlowSumOfEventWeights[t][pe][p][ew] = new TH1D(Form("%s, %s, %s, %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()),Form("%s, %s, %s, power = %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9868 | fDiffFlowSumOfEventWeights[t][pe][p][ew]->SetXTitle(ptEtaFlag[pe].Data()); | |
9869 | fDiffFlowSumOfEventWeightsHistList[t][pe][p]->Add(fDiffFlowSumOfEventWeights[t][pe][p][ew]); // to be improved (add dedicated list to hold all this) | |
9870 | } | |
9871 | } | |
9872 | } | |
9873 | } | |
9874 | // sum of products of event weights for both types of correlations: | |
9875 | TString diffFlowSumOfProductOfEventWeightsName = "fDiffFlowSumOfProductOfEventWeights"; | |
9876 | diffFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
9877 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
9878 | { | |
62e36168 | 9879 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9880 | { |
9881 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
9882 | { | |
9883 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
9884 | { | |
9885 | fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = new TH1D(Form("%s, %s, %s, %s, %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),Form("%s, %s, %s, %s #times %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9886 | fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]->SetXTitle(ptEtaFlag[pe].Data()); | |
9887 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]->Add(fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]); | |
9888 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
9889 | } | |
9890 | } | |
9891 | } | |
9892 | } | |
9893 | // correction terms for nua: | |
9894 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
9895 | { | |
62e36168 | 9896 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9897 | { |
9898 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9899 | { | |
9900 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
9901 | { | |
9902 | fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = new TH1D(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9903 | fDiffFlowCorrectionsHistList[t][pe]->Add(fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]); | |
9904 | } | |
9905 | } | |
9906 | } | |
9907 | } | |
9908 | ||
9909 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow() | |
9910 | ||
489d5531 | 9911 | //================================================================================================================================ |
9912 | ||
489d5531 | 9913 | void AliFlowAnalysisWithQCumulants::CalculateQcumulantsCorrectedForNUAIntFlow() |
9914 | { | |
9915 | // Calculate generalized Q-cumulants (cumulants corrected for non-unifom acceptance). | |
9916 | ||
b92ea2b9 | 9917 | // Isotropic cumulants: |
2701c4bc | 9918 | Double_t qc2 = fIntFlowQcumulants->GetBinContent(1); |
9919 | Double_t qc2Error = fIntFlowQcumulants->GetBinError(1); | |
9920 | Double_t qc4 = fIntFlowQcumulants->GetBinContent(2); | |
9921 | Double_t qc4Error = fIntFlowQcumulants->GetBinError(2); | |
9922 | //Double_t qc6 = fIntFlowQcumulants->GetBinContent(3); | |
9923 | //Double_t qc6Error = fIntFlowQcumulants->GetBinError(3); | |
9924 | //Double_t qc8 = fIntFlowQcumulants->GetBinContent(4); | |
9925 | //Double_t qc8Error = fIntFlowQcumulants->GetBinError(4); | |
b92ea2b9 | 9926 | |
9927 | // Measured 2-, 4-, 6- and 8-particle correlations: | |
489d5531 | 9928 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> |
b92ea2b9 | 9929 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <<2>> |
489d5531 | 9930 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> |
b92ea2b9 | 9931 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <<4>> |
489d5531 | 9932 | //Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> |
489d5531 | 9933 | //Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <<6>> |
b92ea2b9 | 9934 | //Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> |
489d5531 | 9935 | //Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <<8>> |
b92ea2b9 | 9936 | |
9937 | // Non-isotropic terms: | |
9938 | Double_t c1 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1); // <<cos(n*phi1)>> | |
9939 | Double_t c1Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(1); // statistical error of <<cos(n*phi1)>> | |
9940 | Double_t c2 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2); // <<cos(n*(phi1+phi2))>> | |
9941 | Double_t c2Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(2); // statistical error of <<cos(n*(phi1+phi2))>> | |
9942 | Double_t c3 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(3); // <<cos(n*(phi1-phi2-phi3))>> | |
9943 | Double_t c3Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(3); // statistical error of <<cos(n*(phi1-phi2-phi3))>> | |
9944 | Double_t s1 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1); // <<sin(n*phi1)>> | |
9945 | Double_t s1Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(1); // statistical error of <<sin(n*phi1)>> | |
9946 | Double_t s2 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2); // <<sin(n*(phi1+phi2))>> | |
9947 | Double_t s2Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(2); // statistical error of <<sin(n*(phi1+phi2))>> | |
9948 | Double_t s3 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(3); // <<sin(n*(phi1-phi2-phi3))>> | |
9949 | Double_t s3Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(3); // statistical error of <<sin(n*(phi1-phi2-phi3))>> | |
9950 | ||
9951 | // Shortcuts: | |
9952 | Double_t a1 = 2.*pow(c1,2.)+2.*pow(s1,2.)-two; | |
9953 | Double_t a2 = 6.*pow(c1,3.)-2.*c1*c2+c3+6.*c1*pow(s1,2.)-2.*s1*s2-4.*c1*two; | |
9954 | Double_t a3 = 2.*pow(s1,2.)-2.*pow(c1,2.)+c2; | |
9955 | Double_t a4 = 6.*pow(s1,3.)+6.*pow(c1,2.)*s1+2.*c2*s1-2.*c1*s2-s3-4.*s1*two; | |
9956 | Double_t a5 = 4.*c1*s1-s2; | |
9957 | ||
9958 | // Covariances (including weight dependent prefactor): | |
8e1cefdd | 9959 | Double_t wCov1 = 0.; // w*Cov(<2>,<cos(phi)) |
9960 | Double_t wCov2 = 0.; // w*Cov(<2>,<sin(phi)) | |
9961 | Double_t wCov3 = 0.; // w*Cov(<cos(phi),<sin(phi)) | |
9962 | Double_t wCov4 = 0.; // w*Cov(<2>,<4>) | |
9963 | Double_t wCov5 = 0.; // w*Cov(<2>,<cos(#phi_{1}+#phi_{2})>) | |
9964 | Double_t wCov6 = 0.; // w*Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9965 | Double_t wCov7 = 0.; // w*Cov(<2>,<sin(#phi_{1}+#phi_{2})>) | |
9966 | Double_t wCov8 = 0.; // w*Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9967 | Double_t wCov9 = 0.; // w*Cov(<4>,<cos(#phi)> | |
9968 | Double_t wCov10 = 0.; // w*Cov(<4>,<cos(#phi_{1}+#phi_{2})>) | |
9969 | Double_t wCov11 = 0.; // w*Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9970 | Double_t wCov12 = 0.; // w*Cov(<4>,<sin(#phi)> | |
9971 | Double_t wCov13 = 0.; // w*Cov(<4>,<sin(#phi_{1}+#phi_{2})>) | |
9972 | Double_t wCov14 = 0.; // w*Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9973 | Double_t wCov15 = 0.; // w*Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
9974 | Double_t wCov16 = 0.; // w*Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9975 | Double_t wCov17 = 0.; // w*Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
9976 | Double_t wCov18 = 0.; // w*Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9977 | Double_t wCov19 = 0.; // w*Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9978 | Double_t wCov20 = 0.; // w*Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
9979 | Double_t wCov21 = 0.; // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>) | |
9980 | Double_t wCov22 = 0.; // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9981 | Double_t wCov23 = 0.; // w*Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9982 | Double_t wCov24 = 0.; // w*Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9983 | Double_t wCov25 = 0.; // w*Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>) | |
9984 | Double_t wCov26 = 0.; // w*Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
9985 | Double_t wCov27 = 0.; // w*Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9986 | Double_t wCov28 = 0.; // w*Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9987 | if(!fForgetAboutCovariances) | |
9988 | { | |
9989 | wCov1 = fIntFlowCovariancesNUA->GetBinContent(1); // w*Cov(<2>,<cos(phi)) | |
9990 | wCov2 = fIntFlowCovariancesNUA->GetBinContent(2); // w*Cov(<2>,<sin(phi)) | |
9991 | wCov3 = fIntFlowCovariancesNUA->GetBinContent(3); // w*Cov(<cos(phi),<sin(phi)) | |
9992 | wCov4 = fIntFlowCovariances->GetBinContent(1); // w*Cov(<2>,<4>) | |
9993 | wCov5 = fIntFlowCovariancesNUA->GetBinContent(4); // w*Cov(<2>,<cos(#phi_{1}+#phi_{2})>) | |
9994 | wCov6 = fIntFlowCovariancesNUA->GetBinContent(6); // w*Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9995 | wCov7 = fIntFlowCovariancesNUA->GetBinContent(5); // w*Cov(<2>,<sin(#phi_{1}+#phi_{2})>) | |
9996 | wCov8 = fIntFlowCovariancesNUA->GetBinContent(7); // w*Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9997 | wCov9 = fIntFlowCovariancesNUA->GetBinContent(8); // w*Cov(<4>,<cos(#phi)> | |
9998 | wCov10 = fIntFlowCovariancesNUA->GetBinContent(10); // w*Cov(<4>,<cos(#phi_{1}+#phi_{2})>) | |
9999 | wCov11 = fIntFlowCovariancesNUA->GetBinContent(12); // w*Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10000 | wCov12 = fIntFlowCovariancesNUA->GetBinContent(9); // w*Cov(<4>,<sin(#phi)> | |
10001 | wCov13 = fIntFlowCovariancesNUA->GetBinContent(11); // w*Cov(<4>,<sin(#phi_{1}+#phi_{2})>) | |
10002 | wCov14 = fIntFlowCovariancesNUA->GetBinContent(13); // w*Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10003 | wCov15 = fIntFlowCovariancesNUA->GetBinContent(14); // w*Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
10004 | wCov16 = fIntFlowCovariancesNUA->GetBinContent(16); // w*Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10005 | wCov17 = fIntFlowCovariancesNUA->GetBinContent(15); // w*Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
10006 | wCov18 = fIntFlowCovariancesNUA->GetBinContent(17); // w*Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10007 | wCov19 = fIntFlowCovariancesNUA->GetBinContent(23); // w*Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10008 | wCov20 = fIntFlowCovariancesNUA->GetBinContent(18); // w*Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
10009 | wCov21 = fIntFlowCovariancesNUA->GetBinContent(22); // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>) | |
10010 | wCov22 = fIntFlowCovariancesNUA->GetBinContent(24); // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10011 | wCov23 = fIntFlowCovariancesNUA->GetBinContent(20); // w*Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10012 | wCov24 = fIntFlowCovariancesNUA->GetBinContent(25); // w*Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10013 | wCov25 = fIntFlowCovariancesNUA->GetBinContent(27); // w*Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>) | |
10014 | wCov26 = fIntFlowCovariancesNUA->GetBinContent(19); // w*Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
10015 | wCov27 = fIntFlowCovariancesNUA->GetBinContent(21); // w*Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10016 | wCov28 = fIntFlowCovariancesNUA->GetBinContent(26); // w*Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10017 | } // end of if(!fForgetAboutCovariances) | |
10018 | ||
b92ea2b9 | 10019 | // Calculating generalized QC{2}: |
10020 | // Generalized QC{2}: | |
10021 | Double_t gQC2 = two - pow(c1,2.) - pow(s1,2.); | |
10022 | if(fApplyCorrectionForNUA){fIntFlowQcumulants->SetBinContent(1,gQC2);} | |
10023 | // Statistical error of generalized QC{2}: | |
10024 | Double_t gQC2ErrorSquared = pow(twoError,2.)+4.*pow(c1,2.)*pow(c1Error,2.) | |
10025 | + 4.*pow(s1,2.)*pow(s1Error,2.) | |
10026 | - 4*c1*wCov1-4*s1*wCov2 | |
10027 | + 8.*c1*s1*wCov3; | |
10028 | // Store ratio of error squared - with/without NUA terms: | |
10029 | Double_t ratioErrorSquaredQC2 = 0.; | |
10030 | if(fIntFlowQcumulants->GetBinError(1)>0.) | |
10031 | { | |
10032 | ratioErrorSquaredQC2 = (gQC2ErrorSquared/pow(fIntFlowQcumulants->GetBinError(1),2.)); | |
10033 | fIntFlowQcumulantsErrorSquaredRatio->SetBinContent(1,ratioErrorSquaredQC2); | |
10034 | } | |
10035 | // If enabled, store error by including non-isotropic terms: | |
b77b6434 | 10036 | if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 10037 | { |
10038 | if(gQC2ErrorSquared>=0.) | |
10039 | { | |
10040 | fIntFlowQcumulants->SetBinError(1,pow(gQC2ErrorSquared,0.5)); | |
10041 | } else | |
10042 | { | |
10043 | fIntFlowQcumulants->SetBinError(1,0.); | |
10044 | cout<<endl; | |
10045 | cout<<" WARNING (QC): Statistical error of generalized QC{2} is imaginary !!!!"<<endl; | |
10046 | cout<<endl; | |
10047 | } | |
b77b6434 | 10048 | } // end of if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 10049 | // Quantify detector bias to QC{2}: |
2701c4bc | 10050 | if(TMath::Abs(qc2)>0.) |
b92ea2b9 | 10051 | { |
2701c4bc | 10052 | fIntFlowDetectorBias->SetBinContent(1,gQC2/qc2); |
10053 | if(qc2Error>0.) | |
b92ea2b9 | 10054 | { |
2701c4bc | 10055 | Double_t errorSquared = gQC2ErrorSquared/pow(qc2,2.)+pow(gQC2,2.)*pow(qc2Error,2.)/pow(qc2,4.); |
b92ea2b9 | 10056 | if(errorSquared>0.) |
10057 | { | |
10058 | fIntFlowDetectorBias->SetBinError(1,pow(errorSquared,0.5)); | |
10059 | } | |
10060 | } | |
2701c4bc | 10061 | } // end of if(TMath::Abs(qc2)>0.) |
b92ea2b9 | 10062 | |
10063 | // Calculating generalized QC{4}: | |
10064 | // Generalized QC{4}: | |
10065 | Double_t gQC4 = four-2.*pow(two,2.) | |
10066 | - 4.*c1*c3+4.*s1*s3-pow(c2,2.)-pow(s2,2.) | |
10067 | + 4.*c2*(pow(c1,2.)-pow(s1,2.))+8.*s2*s1*c1 | |
10068 | + 8.*two*(pow(c1,2.)+pow(s1,2.))-6.*pow((pow(c1,2.)+pow(s1,2.)),2.); | |
10069 | if(fApplyCorrectionForNUA){fIntFlowQcumulants->SetBinContent(2,gQC4);} | |
10070 | // Statistical error of generalized QC{4}: | |
10071 | Double_t gQC4ErrorSquared = 16.*pow(a1,2.)*pow(twoError,2.)+pow(fourError,2.)+16.*pow(a2,2.)*pow(c1Error,2.) | |
10072 | + 4.*pow(a3,2.)*pow(c2Error,2.)+16.*pow(c1,2.)*pow(c3Error,2.) | |
10073 | + 16.*pow(a4,2.)*pow(s1Error,2.)+4.*pow(a5,2.)*pow(s2Error,2.) | |
10074 | + 16.*pow(s1,2.)*pow(s3Error,2.)+8.*a1*wCov4-32.*a1*a2*wCov1 | |
10075 | - 16.*a3*a1*wCov5-32.*c1*a1*wCov6-32.*a1*a4*wCov2+16.*a5*a1*wCov7 | |
10076 | + 32.*s1*a1*wCov8-8.*a2*wCov9-4.*a3*wCov10-8.*c1*wCov11-8.*a4*wCov12 | |
10077 | + 4.*a5*wCov13+8.*s1*wCov14+16.*a3*a2*wCov15+32.*c1*a2*wCov16+32.*a2*a4*wCov3 | |
10078 | - 16.*a5*a2*wCov17-32.*s1*a2*wCov18+16.*c1*a3*wCov19+16.*a3*a4*wCov20 | |
10079 | - 8.*a3*a5*wCov21-16.*s1*a3*wCov22+32.*c1*a4*wCov23-16.*c1*a5*wCov24 | |
10080 | - 32.*c1*s1*wCov25-16.*a5*a4*wCov26-32.*s1*a4*wCov27+16.*s1*a5*wCov28; | |
10081 | // Store ratio of error squared - with/without NUA terms: | |
10082 | Double_t ratioErrorSquaredQC4 = 0.; | |
10083 | if(fIntFlowQcumulants->GetBinError(2)>0.) | |
10084 | { | |
10085 | ratioErrorSquaredQC4 = (gQC4ErrorSquared/pow(fIntFlowQcumulants->GetBinError(2),2.)); | |
10086 | fIntFlowQcumulantsErrorSquaredRatio->SetBinContent(2,ratioErrorSquaredQC4); | |
10087 | } | |
b77b6434 | 10088 | if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 10089 | { |
10090 | if(gQC4ErrorSquared>=0.) | |
10091 | { | |
10092 | fIntFlowQcumulants->SetBinError(2,pow(gQC4ErrorSquared,0.5)); | |
10093 | } else | |
10094 | { | |
10095 | fIntFlowQcumulants->SetBinError(2,0.); | |
10096 | cout<<endl; | |
10097 | cout<<" WARNING (QC): Statistical error of generalized QC{4} is imaginary !!!!"<<endl; | |
10098 | cout<<endl; | |
10099 | } | |
b77b6434 | 10100 | } // end of if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 10101 | // Quantify detector bias to QC{4}: |
2701c4bc | 10102 | if(TMath::Abs(qc4)>0.) |
b92ea2b9 | 10103 | { |
2701c4bc | 10104 | fIntFlowDetectorBias->SetBinContent(2,gQC4/qc4); |
10105 | if(qc4Error>0.) | |
b92ea2b9 | 10106 | { |
2701c4bc | 10107 | Double_t errorSquared = gQC4ErrorSquared/pow(qc4,2.)+pow(gQC4,2.)*pow(qc4Error,2.)/pow(qc4,4.); |
b92ea2b9 | 10108 | if(errorSquared>0.) |
10109 | { | |
10110 | fIntFlowDetectorBias->SetBinError(2,pow(errorSquared,0.5)); | |
10111 | } | |
10112 | } | |
2701c4bc | 10113 | } // end of if(TMath::Abs(qc4)>0.) |
489d5531 | 10114 | |
b92ea2b9 | 10115 | |
10116 | // .... to be improved (continued for 6th and 8th order) .... | |
10117 | ||
10118 | ||
2001bc3a | 10119 | // versus multiplicity: |
b77b6434 | 10120 | if(fCalculateCumulantsVsM) // to be improved - propagate error for nua terms vs M |
2001bc3a | 10121 | { |
10122 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) | |
b77b6434 | 10123 | Double_t value[4] = {0.}; // QCs vs M |
10124 | Double_t error[4] = {0.}; // error of QCs vs M | |
10125 | Double_t dSum1[4] = {0.}; // sum value_i/(error_i)^2 | |
10126 | Double_t dSum2[4] = {0.}; // sum 1/(error_i)^2 | |
2001bc3a | 10127 | for(Int_t b=1;b<=nBins;b++) |
10128 | { | |
b92ea2b9 | 10129 | // Measured correlations: |
2001bc3a | 10130 | two = fIntFlowCorrelationsVsMHist[0]->GetBinContent(b); // <<2>> vs M |
10131 | four = fIntFlowCorrelationsVsMHist[1]->GetBinContent(b); // <<4>> vs M | |
b92ea2b9 | 10132 | // Isotropic cumulants: |
2701c4bc | 10133 | qc2 = two; |
10134 | qc4 = four-2.*pow(two,2.); | |
b92ea2b9 | 10135 | // Non-isotropic terms: |
10136 | c1 = fIntFlowCorrectionTermsForNUAVsMPro[1][0]->GetBinContent(b); // <<cos(n*phi1)>> | |
10137 | c2 = fIntFlowCorrectionTermsForNUAVsMPro[1][1]->GetBinContent(b); // <<cos(n*(phi1+phi2))>> | |
10138 | c3 = fIntFlowCorrectionTermsForNUAVsMPro[1][2]->GetBinContent(b); // <<cos(n*(phi1-phi2-phi3))>> | |
10139 | s1 = fIntFlowCorrectionTermsForNUAVsMPro[0][0]->GetBinContent(b); // <<sin(n*phi1)>> | |
10140 | s2 = fIntFlowCorrectionTermsForNUAVsMPro[0][1]->GetBinContent(b); // <<sin(n*(phi1+phi2))>> | |
10141 | s3 = fIntFlowCorrectionTermsForNUAVsMPro[0][2]->GetBinContent(b); // <<sin(n*(phi1-phi2-phi3))>> | |
10142 | // Generalized QC{2} vs M: | |
10143 | gQC2 = two - pow(c1,2.) - pow(s1,2.); | |
b77b6434 | 10144 | if(fApplyCorrectionForNUAVsM){fIntFlowQcumulantsVsM[0]->SetBinContent(b,gQC2);} |
b92ea2b9 | 10145 | // Generalized QC{4} vs M: |
10146 | gQC4 = four-2.*pow(two,2.) | |
10147 | - 4.*c1*c3+4.*s1*s3-pow(c2,2.)-pow(s2,2.) | |
10148 | + 4.*c2*(pow(c1,2.)-pow(s1,2.))+8.*s2*s1*c1 | |
10149 | + 8.*two*(pow(c1,2.)+pow(s1,2.))-6.*pow((pow(c1,2.)+pow(s1,2.)),2.); | |
b77b6434 | 10150 | if(fApplyCorrectionForNUAVsM){fIntFlowQcumulantsVsM[1]->SetBinContent(b,gQC4);} |
b92ea2b9 | 10151 | // Detector bias vs M: |
2701c4bc | 10152 | if(TMath::Abs(qc2)>0.) |
b92ea2b9 | 10153 | { |
2701c4bc | 10154 | fIntFlowDetectorBiasVsM[0]->SetBinContent(b,gQC2/qc2); |
10155 | } // end of if(TMath::Abs(qc2)>0.) | |
10156 | if(TMath::Abs(qc4)>0.) | |
b92ea2b9 | 10157 | { |
2701c4bc | 10158 | fIntFlowDetectorBiasVsM[1]->SetBinContent(b,gQC4/qc4); |
10159 | } // end of if(TMath::Abs(qc4)>0.) | |
b77b6434 | 10160 | // Rebin in M: |
10161 | for(Int_t co=0;co<4;co++) | |
10162 | { | |
10163 | value[co] = fIntFlowQcumulantsVsM[co]->GetBinContent(b); | |
10164 | error[co] = fIntFlowQcumulantsVsM[co]->GetBinError(b); | |
10165 | if(error[co]>0.) | |
10166 | { | |
10167 | dSum1[co]+=value[co]/(error[co]*error[co]); | |
10168 | dSum2[co]+=1./(error[co]*error[co]); | |
10169 | } | |
10170 | } // end of for(Int_t co=0;co<4;co++) | |
10171 | } // end of for(Int_t b=1;b<=nBins;b++) | |
10172 | // Store rebinned Q-cumulants: | |
10173 | if(fApplyCorrectionForNUAVsM) | |
10174 | { | |
10175 | for(Int_t co=0;co<4;co++) | |
10176 | { | |
10177 | if(dSum2[co]>0.) | |
10178 | { | |
10179 | fIntFlowQcumulantsRebinnedInM->SetBinContent(co+1,dSum1[co]/dSum2[co]); | |
10180 | fIntFlowQcumulantsRebinnedInM->SetBinError(co+1,pow(1./dSum2[co],0.5)); | |
10181 | } | |
10182 | } // end of for(Int_t co=0;co<4;co++) | |
10183 | } // end of if(fApplyCorrectionForNUAVsM) | |
10184 | } // end of if(fCalculateCumulantsVsM) | |
2001bc3a | 10185 | |
489d5531 | 10186 | } // end of void AliFlowAnalysisWithQCumulants::CalculateQcumulantsCorrectedForNUAIntFlow() |
0328db2d | 10187 | |
489d5531 | 10188 | //================================================================================================================================ |
10189 | ||
489d5531 | 10190 | void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUAIntFlow() |
10191 | { | |
0328db2d | 10192 | // From profile fIntFlowCorrectionTermsForNUAPro[sc] access measured correction terms for NUA |
489d5531 | 10193 | // and their spread, correctly calculate the statistical errors and store the final |
0328db2d | 10194 | // results and statistical errors for correction terms for NUA in histogram fIntFlowCorrectionTermsForNUAHist[sc]. |
489d5531 | 10195 | // |
10196 | // Remark: Statistical error of correction temrs is calculated as: | |
10197 | // | |
10198 | // statistical error = termA * spread * termB: | |
10199 | // termA = sqrt{sum_{i=1}^{N} w^2}/(sum_{i=1}^{N} w) | |
10200 | // termB = 1/sqrt(1-termA^2) | |
10201 | ||
b92ea2b9 | 10202 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved - promore this to data member? |
10203 | TString nonisotropicTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4 | |
10204 | ||
489d5531 | 10205 | for(Int_t sc=0;sc<2;sc++) // sin or cos correction terms |
10206 | { | |
b92ea2b9 | 10207 | for(Int_t ci=1;ci<=4;ci++) // correction term index (to be improved - hardwired 4) |
489d5531 | 10208 | { |
10209 | Double_t correction = fIntFlowCorrectionTermsForNUAPro[sc]->GetBinContent(ci); | |
0328db2d | 10210 | Double_t spread = fIntFlowCorrectionTermsForNUAPro[sc]->GetBinError(ci); |
10211 | Double_t sumOfLinearEventWeights = fIntFlowSumOfEventWeightsNUA[sc][0]->GetBinContent(ci); | |
10212 | Double_t sumOfQuadraticEventWeights = fIntFlowSumOfEventWeightsNUA[sc][1]->GetBinContent(ci); | |
10213 | Double_t termA = 0.; | |
10214 | Double_t termB = 0.; | |
b92ea2b9 | 10215 | if(TMath::Abs(sumOfLinearEventWeights)>1.e-44) |
0328db2d | 10216 | { |
10217 | termA = pow(sumOfQuadraticEventWeights,0.5)/sumOfLinearEventWeights; | |
10218 | } else | |
10219 | { | |
b92ea2b9 | 10220 | cout<<" WARNING (QC): sumOfLinearEventWeights == 0 in AFAWQC::FCTFNIF() !!!!"<<endl; |
10221 | cout<<Form(" (for <<%s[%s]>> non-isotropic term)",sinCosFlag[sc].Data(),nonisotropicTermFlag[ci-1].Data())<<endl; | |
0328db2d | 10222 | } |
489d5531 | 10223 | if(1.-pow(termA,2.) > 0.) |
10224 | { | |
10225 | termB = 1./pow(1-pow(termA,2.),0.5); | |
10226 | } else | |
10227 | { | |
b92ea2b9 | 10228 | cout<<" WARNING (QC): 1.-pow(termA,2.) <= 0 in AFAWQC::FCTFNIF() !!!!"<<endl; |
10229 | cout<<Form(" (for <<%s[%s]>> non-isotropic term)",sinCosFlag[sc].Data(),nonisotropicTermFlag[ci-1].Data())<<endl; | |
489d5531 | 10230 | } |
10231 | Double_t statisticalError = termA * spread * termB; | |
489d5531 | 10232 | fIntFlowCorrectionTermsForNUAHist[sc]->SetBinContent(ci,correction); |
0328db2d | 10233 | fIntFlowCorrectionTermsForNUAHist[sc]->SetBinError(ci,statisticalError); |
b92ea2b9 | 10234 | } // end of for(Int_t ci=1;ci<=4;ci++) // correction term index |
489d5531 | 10235 | } // end of for(Int sc=0;sc<2;sc++) // sin or cos correction terms |
10236 | ||
10237 | } // end of void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUAIntFlow() | |
10238 | ||
489d5531 | 10239 | //================================================================================================================================ |
10240 | ||
489d5531 | 10241 | void AliFlowAnalysisWithQCumulants::GetPointersForNestedLoopsHistograms() |
10242 | { | |
10243 | // Get pointers to all objects relevant for calculations with nested loops. | |
10244 | ||
10245 | TList *nestedLoopsList = dynamic_cast<TList*>(fHistList->FindObject("Nested Loops")); | |
10246 | if(nestedLoopsList) | |
10247 | { | |
10248 | this->SetNestedLoopsList(nestedLoopsList); | |
10249 | } else | |
10250 | { | |
10251 | cout<<"WARNING: nestedLoopsList is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
10252 | exit(0); | |
10253 | } | |
10254 | ||
10255 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?) | |
10256 | TString typeFlag[2] = {"RP","POI"}; // to be improved (should I promote this to data members?) | |
10257 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; // to be improved (should I promote this to data members?) | |
10258 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; // to be improved (should I promote this to data members?) | |
10259 | ||
10260 | TString evaluateNestedLoopsName = "fEvaluateNestedLoops"; | |
10261 | evaluateNestedLoopsName += fAnalysisLabel->Data(); | |
10262 | TProfile *evaluateNestedLoops = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(evaluateNestedLoopsName.Data())); | |
10263 | Bool_t bEvaluateIntFlowNestedLoops = kFALSE; | |
10264 | Bool_t bEvaluateDiffFlowNestedLoops = kFALSE; | |
10265 | if(evaluateNestedLoops) | |
10266 | { | |
10267 | this->SetEvaluateNestedLoops(evaluateNestedLoops); | |
10268 | bEvaluateIntFlowNestedLoops = (Int_t)evaluateNestedLoops->GetBinContent(1); | |
10269 | bEvaluateDiffFlowNestedLoops = (Int_t)evaluateNestedLoops->GetBinContent(2); | |
10270 | } | |
10271 | // nested loops relevant for integrated flow: | |
10272 | if(bEvaluateIntFlowNestedLoops) | |
10273 | { | |
10274 | // correlations: | |
10275 | TString intFlowDirectCorrelationsName = "fIntFlowDirectCorrelations"; | |
10276 | intFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
10277 | TProfile *intFlowDirectCorrelations = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(intFlowDirectCorrelationsName.Data())); | |
10278 | if(intFlowDirectCorrelations) | |
10279 | { | |
10280 | this->SetIntFlowDirectCorrelations(intFlowDirectCorrelations); | |
10281 | } else | |
10282 | { | |
10283 | cout<<"WARNING: intFlowDirectCorrelations is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
10284 | exit(0); | |
10285 | } | |
403e3389 | 10286 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 10287 | { |
10288 | TString intFlowExtraDirectCorrelationsName = "fIntFlowExtraDirectCorrelations"; | |
10289 | intFlowExtraDirectCorrelationsName += fAnalysisLabel->Data(); | |
10290 | TProfile *intFlowExtraDirectCorrelations = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(intFlowExtraDirectCorrelationsName.Data())); | |
10291 | if(intFlowExtraDirectCorrelations) | |
10292 | { | |
10293 | this->SetIntFlowExtraDirectCorrelations(intFlowExtraDirectCorrelations); | |
10294 | } else | |
10295 | { | |
10296 | cout<<"WARNING: intFlowExtraDirectCorrelations is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
10297 | exit(0); | |
10298 | } | |
403e3389 | 10299 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 10300 | // correction terms for non-uniform acceptance: |
10301 | TString intFlowDirectCorrectionTermsForNUAName = "fIntFlowDirectCorrectionTermsForNUA"; | |
10302 | intFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
10303 | TProfile *intFlowDirectCorrectionTermsForNUA[2] = {NULL}; | |
10304 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
10305 | { | |
10306 | intFlowDirectCorrectionTermsForNUA[sc] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s: %s terms",intFlowDirectCorrectionTermsForNUAName.Data(),sinCosFlag[sc].Data()))); | |
10307 | if(intFlowDirectCorrectionTermsForNUA[sc]) | |
10308 | { | |
10309 | this->SetIntFlowDirectCorrectionTermsForNUA(intFlowDirectCorrectionTermsForNUA[sc],sc); | |
10310 | } else | |
10311 | { | |
10312 | cout<<"WARNING: intFlowDirectCorrectionTermsForNUA[sc] is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
10313 | cout<<"sc = "<<sc<<endl; | |
10314 | exit(0); | |
10315 | } | |
10316 | } // end of for(Int_t sc=0;sc<2;sc++) | |
10317 | } // end of if(bEvaluateIntFlowNestedLoops) | |
10318 | ||
10319 | // nested loops relevant for differential flow: | |
10320 | if(bEvaluateDiffFlowNestedLoops) | |
10321 | { | |
10322 | // correlations: | |
10323 | TString diffFlowDirectCorrelationsName = "fDiffFlowDirectCorrelations"; | |
10324 | diffFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
10325 | TProfile *diffFlowDirectCorrelations[2][2][4] = {{{NULL}}}; | |
10326 | for(Int_t t=0;t<2;t++) | |
10327 | { | |
10328 | for(Int_t pe=0;pe<2;pe++) | |
10329 | { | |
10330 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
10331 | { | |
10332 | diffFlowDirectCorrelations[t][pe][ci] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[ci].Data()))); | |
10333 | if(diffFlowDirectCorrelations[t][pe][ci]) | |
10334 | { | |
10335 | this->SetDiffFlowDirectCorrelations(diffFlowDirectCorrelations[t][pe][ci],t,pe,ci); | |
10336 | } else | |
10337 | { | |
10338 | cout<<"WARNING: diffFlowDirectCorrelations[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
10339 | cout<<"t = "<<t<<endl; | |
10340 | cout<<"pe = "<<pe<<endl; | |
10341 | cout<<"ci = "<<ci<<endl; | |
10342 | } | |
10343 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
10344 | } // end of for(Int_t pe=0;pe<2;pe++) | |
10345 | } // end of for(Int_t t=0;t<2;t++) | |
10346 | // correction terms for non-uniform acceptance: | |
10347 | TString diffFlowDirectCorrectionTermsForNUAName = "fDiffFlowDirectCorrectionTermsForNUA"; | |
10348 | diffFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
10349 | TProfile *diffFlowDirectCorrectionTermsForNUA[2][2][2][10] = {{{{NULL}}}}; | |
10350 | for(Int_t t=0;t<2;t++) | |
10351 | { | |
10352 | for(Int_t pe=0;pe<2;pe++) | |
10353 | { | |
10354 | // correction terms for NUA: | |
10355 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
10356 | { | |
10357 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
10358 | { | |
10359 | diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1))); | |
10360 | if(diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]) | |
10361 | { | |
10362 | this->SetDiffFlowDirectCorrectionTermsForNUA(diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti],t,pe,sc,cti); | |
10363 | } else | |
10364 | { | |
10365 | cout<<"WARNING: diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
10366 | cout<<"t = "<<t<<endl; | |
10367 | cout<<"pe = "<<pe<<endl; | |
10368 | cout<<"sc = "<<sc<<endl; | |
10369 | cout<<"cti = "<<cti<<endl; | |
10370 | } | |
10371 | } // end of for(Int_t cti=0;cti<9;cti++) // correction term index | |
10372 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
10373 | } // end of for(Int_t pe=0;pe<2;pe++) | |
10374 | } // end of for(Int_t t=0;t<2;t++) | |
64e500e3 | 10375 | // other differential correlators: |
10376 | TString otherDirectDiffCorrelatorsName = "fOtherDirectDiffCorrelators"; | |
10377 | otherDirectDiffCorrelatorsName += fAnalysisLabel->Data(); | |
10378 | TProfile *otherDirectDiffCorrelators[2][2][2][1] = {{{{NULL}}}}; | |
10379 | for(Int_t t=0;t<2;t++) | |
10380 | { | |
10381 | for(Int_t pe=0;pe<2;pe++) | |
10382 | { | |
10383 | // correction terms for NUA: | |
10384 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
10385 | { | |
10386 | for(Int_t ci=0;ci<1;ci++) // correlator index | |
10387 | { | |
10388 | otherDirectDiffCorrelators[t][pe][sc][ci] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s, ci = %d",otherDirectDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1))); | |
10389 | if(otherDirectDiffCorrelators[t][pe][sc][ci]) | |
10390 | { | |
10391 | this->SetOtherDirectDiffCorrelators(otherDirectDiffCorrelators[t][pe][sc][ci],t,pe,sc,ci); | |
10392 | } else | |
10393 | { | |
10394 | cout<<"WARNING: otherDirectDiffCorrelators[t][pe][sc][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
10395 | cout<<"t = "<<t<<endl; | |
10396 | cout<<"pe = "<<pe<<endl; | |
10397 | cout<<"sc = "<<sc<<endl; | |
10398 | cout<<"ci = "<<ci<<endl; | |
10399 | } | |
10400 | } // end of for(Int_t ci=0;ci<9;ci++) // correction term index | |
10401 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
10402 | } // end of for(Int_t pe=0;pe<2;pe++) | |
10403 | } // end of for(Int_t t=0;t<2;t++) | |
489d5531 | 10404 | // number of RPs and POIs in selected pt and eta bins for cross-checkings: |
10405 | TString noOfParticlesInBinName = "fNoOfParticlesInBin"; | |
10406 | TH1D *noOfParticlesInBin = NULL; | |
10407 | noOfParticlesInBin = dynamic_cast<TH1D*>(nestedLoopsList->FindObject(noOfParticlesInBinName.Data())); | |
10408 | if(noOfParticlesInBin) | |
10409 | { | |
10410 | this->SetNoOfParticlesInBin(noOfParticlesInBin); | |
10411 | } else | |
10412 | { | |
10413 | cout<<endl; | |
10414 | cout<<" WARNING (QC): noOfParticlesInBin is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
10415 | cout<<endl; | |
10416 | } | |
10417 | } // end of if(bEvaluateDiffFlowNestedLoops) | |
10418 | ||
10419 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForNestedLoopsHistograms() | |
10420 | ||
489d5531 | 10421 | //================================================================================================================================ |
10422 | ||
489d5531 | 10423 | void AliFlowAnalysisWithQCumulants::StoreHarmonic() |
10424 | { | |
10425 | // Store flow harmonic in common control histograms. | |
10426 | ||
10427 | (fCommonHists->GetHarmonic())->Fill(0.5,fHarmonic); | |
dd442cd2 | 10428 | if(fFillMultipleControlHistograms) |
10429 | { | |
10430 | (fCommonHists2nd->GetHarmonic())->Fill(0.5,fHarmonic); | |
10431 | (fCommonHists4th->GetHarmonic())->Fill(0.5,fHarmonic); | |
10432 | (fCommonHists6th->GetHarmonic())->Fill(0.5,fHarmonic); | |
10433 | (fCommonHists8th->GetHarmonic())->Fill(0.5,fHarmonic); | |
10434 | } | |
10435 | ||
489d5531 | 10436 | } // end of void AliFlowAnalysisWithQCumulants::StoreHarmonic() |
10437 | ||
489d5531 | 10438 | //================================================================================================================================ |
10439 | ||
489d5531 | 10440 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelationsUsingParticleWeights(TString type, TString ptOrEta) // type = RP or POI |
10441 | { | |
10442 | // Calculate all correlations needed for differential flow using particle weights. | |
10443 | ||
2a98ceb8 | 10444 | Int_t t = 0; // type flag |
10445 | Int_t pe = 0; // ptEta flag | |
489d5531 | 10446 | |
10447 | if(type == "RP") | |
10448 | { | |
10449 | t = 0; | |
10450 | } else if(type == "POI") | |
10451 | { | |
10452 | t = 1; | |
10453 | } | |
10454 | ||
10455 | if(ptOrEta == "Pt") | |
10456 | { | |
10457 | pe = 0; | |
10458 | } else if(ptOrEta == "Eta") | |
10459 | { | |
10460 | pe = 1; | |
10461 | } | |
10462 | ||
10463 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
10464 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
10465 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
10466 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
10467 | ||
10468 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
10469 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
10470 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
10471 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
10472 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
10473 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
10474 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
10475 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
10476 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
10477 | ||
1268c371 | 10478 | // S^M_{p,k} (see .h file for the definition of fSpk): |
10479 | Double_t dSM1p1k = (*fSpk)(0,1); | |
10480 | Double_t dSM1p2k = (*fSpk)(0,2); | |
10481 | Double_t dSM1p3k = (*fSpk)(0,3); | |
10482 | Double_t dSM2p1k = (*fSpk)(1,1); | |
10483 | Double_t dSM3p1k = (*fSpk)(2,1); | |
489d5531 | 10484 | |
10485 | // looping over all bins and calculating reduced correlations: | |
10486 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10487 | { | |
10488 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): | |
10489 | Double_t p1n0kRe = 0.; | |
10490 | Double_t p1n0kIm = 0.; | |
10491 | ||
10492 | // number of POIs in particular (pt,eta) bin): | |
10493 | Double_t mp = 0.; | |
10494 | ||
10495 | // real and imaginary parts of q_{m*n,k}: | |
10496 | // (weighted Q-vector evaluated for particles which are both RPs and POIs in particular (pt,eta) bin) | |
10497 | Double_t q1n2kRe = 0.; | |
10498 | Double_t q1n2kIm = 0.; | |
10499 | Double_t q2n1kRe = 0.; | |
10500 | Double_t q2n1kIm = 0.; | |
10501 | ||
10502 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
10503 | Double_t s1p1k = 0.; | |
10504 | Double_t s1p2k = 0.; | |
10505 | Double_t s1p3k = 0.; | |
10506 | ||
10507 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
10508 | Double_t dM0111 = 0.; | |
10509 | ||
10510 | if(type == "POI") | |
10511 | { | |
10512 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
10513 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
10514 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
10515 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
10516 | ||
10517 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10518 | ||
10519 | t = 1; // typeFlag = RP or POI | |
10520 | ||
10521 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
10522 | q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
10523 | * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
10524 | q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
10525 | * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
10526 | q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
10527 | * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
10528 | q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
10529 | * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
10530 | ||
10531 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
10532 | s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); | |
10533 | s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); | |
10534 | s1p3k = pow(fs1dEBE[2][pe][3]->GetBinContent(b)*fs1dEBE[2][pe][3]->GetBinEntries(b),1.); | |
10535 | ||
10536 | // M0111 from Eq. (118) in QC2c (to be improved (notation)): | |
10537 | dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k) | |
10538 | - 3.*(s1p1k*(dSM2p1k-dSM1p2k) | |
10539 | + 2.*(s1p3k-s1p2k*dSM1p1k)); | |
10540 | } | |
10541 | else if(type == "RP") | |
10542 | { | |
10543 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
10544 | q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
10545 | * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
10546 | q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
10547 | * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
10548 | q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
10549 | * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
10550 | q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
10551 | * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
10552 | ||
10553 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
10554 | s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); | |
10555 | s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); | |
10556 | s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); | |
10557 | ||
10558 | // to be improved (cross-checked): | |
10559 | p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
10560 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
10561 | p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
10562 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
10563 | ||
10564 | mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10565 | ||
10566 | t = 0; // typeFlag = RP or POI | |
10567 | ||
10568 | // M0111 from Eq. (118) in QC2c (to be improved (notation)): | |
10569 | dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k) | |
10570 | - 3.*(s1p1k*(dSM2p1k-dSM1p2k) | |
10571 | + 2.*(s1p3k-s1p2k*dSM1p1k)); | |
10572 | //............................................................................................... | |
10573 | } | |
10574 | ||
10575 | // 2'-particle correlation: | |
10576 | Double_t two1n1nW0W1 = 0.; | |
10577 | if(mp*dSM1p1k-s1p1k) | |
10578 | { | |
10579 | two1n1nW0W1 = (p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k-s1p1k) | |
10580 | / (mp*dSM1p1k-s1p1k); | |
10581 | ||
10582 | // fill profile to get <<2'>> | |
b40a910e | 10583 | fDiffFlowCorrelationsPro[t][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nW0W1,mp*dSM1p1k-s1p1k); |
10584 | // fill profile to get <<2'>^2> | |
10585 | fDiffFlowSquaredCorrelationsPro[t][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nW0W1*two1n1nW0W1,mp*dSM1p1k-s1p1k); | |
489d5531 | 10586 | // histogram to store <2'> e-b-e (needed in some other methods): |
10587 | fDiffFlowCorrelationsEBE[t][pe][0]->SetBinContent(b,two1n1nW0W1); | |
10588 | fDiffFlowEventWeightsForCorrelationsEBE[t][pe][0]->SetBinContent(b,mp*dSM1p1k-s1p1k); | |
10589 | } // end of if(mp*dSM1p1k-s1p1k) | |
10590 | ||
10591 | // 4'-particle correlation: | |
10592 | Double_t four1n1n1n1nW0W1W1W1 = 0.; | |
10593 | if(dM0111) | |
10594 | { | |
10595 | four1n1n1n1nW0W1W1W1 = ((pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k) | |
10596 | - q2n1kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.)) | |
10597 | - 2.*q2n1kIm*dReQ1n1k*dImQ1n1k | |
10598 | - p1n0kRe*(dReQ1n1k*dReQ2n2k+dImQ1n1k*dImQ2n2k) | |
10599 | + p1n0kIm*(dImQ1n1k*dReQ2n2k-dReQ1n1k*dImQ2n2k) | |
10600 | - 2.*dSM1p2k*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k) | |
10601 | - 2.*(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*s1p1k | |
10602 | + 6.*(q1n2kRe*dReQ1n1k+q1n2kIm*dImQ1n1k) | |
10603 | + 1.*(q2n1kRe*dReQ2n2k+q2n1kIm*dImQ2n2k) | |
10604 | + 2.*(p1n0kRe*dReQ1n3k+p1n0kIm*dImQ1n3k) | |
10605 | + 2.*s1p1k*dSM1p2k | |
10606 | - 6.*s1p3k) | |
10607 | / dM0111; // to be improved (notation of dM0111) | |
10608 | ||
10609 | // fill profile to get <<4'>> | |
b40a910e | 10610 | fDiffFlowCorrelationsPro[t][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nW0W1W1W1,dM0111); |
10611 | // fill profile to get <<4'>^2> | |
10612 | fDiffFlowSquaredCorrelationsPro[t][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nW0W1W1W1*four1n1n1n1nW0W1W1W1,dM0111); | |
489d5531 | 10613 | // histogram to store <4'> e-b-e (needed in some other methods): |
10614 | fDiffFlowCorrelationsEBE[t][pe][1]->SetBinContent(b,four1n1n1n1nW0W1W1W1); | |
10615 | fDiffFlowEventWeightsForCorrelationsEBE[t][pe][1]->SetBinContent(b,dM0111); | |
10616 | } // end of if(dM0111) | |
10617 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10618 | ||
10619 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelationsUsingParticleWeights(TString type, TString ptOrEta); // type = RP or POI | |
10620 | ||
489d5531 | 10621 | //================================================================================================================================ |
10622 | ||
489d5531 | 10623 | void AliFlowAnalysisWithQCumulants::FillCommonControlHistograms(AliFlowEventSimple *anEvent) |
10624 | { | |
10625 | // Fill common control histograms. | |
10626 | ||
10627 | Int_t nRP = anEvent->GetEventNSelTracksRP(); // number of RPs (i.e. number of particles used to determine the reaction plane) | |
10628 | fCommonHists->FillControlHistograms(anEvent); | |
dd442cd2 | 10629 | if(fFillMultipleControlHistograms) |
489d5531 | 10630 | { |
dd442cd2 | 10631 | if(nRP>1) |
489d5531 | 10632 | { |
dd442cd2 | 10633 | fCommonHists2nd->FillControlHistograms(anEvent); |
10634 | if(nRP>3) | |
489d5531 | 10635 | { |
dd442cd2 | 10636 | fCommonHists4th->FillControlHistograms(anEvent); |
10637 | if(nRP>5) | |
489d5531 | 10638 | { |
dd442cd2 | 10639 | fCommonHists6th->FillControlHistograms(anEvent); |
10640 | if(nRP>7) | |
10641 | { | |
10642 | fCommonHists8th->FillControlHistograms(anEvent); | |
10643 | } // end of if(nRP>7) | |
10644 | } // end of if(nRP>5) | |
10645 | } // end of if(nRP>3) | |
10646 | } // end of if(nRP>1) | |
10647 | } // end of if(fFillMultipleControlHistograms) | |
489d5531 | 10648 | |
10649 | } // end of void AliFlowAnalysisWithQCumulants::FillCommonControlHistograms(AliFlowEventSimple *anEvent) | |
10650 | ||
489d5531 | 10651 | //================================================================================================================================ |
10652 | ||
489d5531 | 10653 | void AliFlowAnalysisWithQCumulants::ResetEventByEventQuantities() |
10654 | { | |
10655 | // Reset all event by event quantities. | |
10656 | ||
1268c371 | 10657 | // Reference flow: |
489d5531 | 10658 | fReQ->Zero(); |
10659 | fImQ->Zero(); | |
1268c371 | 10660 | fSpk->Zero(); |
489d5531 | 10661 | fIntFlowCorrelationsEBE->Reset(); |
10662 | fIntFlowEventWeightsForCorrelationsEBE->Reset(); | |
10663 | fIntFlowCorrelationsAllEBE->Reset(); | |
10664 | ||
b92ea2b9 | 10665 | for(Int_t sc=0;sc<2;sc++) |
489d5531 | 10666 | { |
b92ea2b9 | 10667 | fIntFlowCorrectionTermsForNUAEBE[sc]->Reset(); |
10668 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc]->Reset(); | |
489d5531 | 10669 | } |
10670 | ||
1268c371 | 10671 | // Differential flow: |
10672 | if(fCalculateDiffFlow) | |
489d5531 | 10673 | { |
1268c371 | 10674 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) |
489d5531 | 10675 | { |
62e36168 | 10676 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // 1D in pt or eta |
489d5531 | 10677 | { |
1268c371 | 10678 | for(Int_t m=0;m<4;m++) // multiple of harmonic |
489d5531 | 10679 | { |
1268c371 | 10680 | for(Int_t k=0;k<9;k++) // power of weight |
10681 | { | |
10682 | if(fReRPQ1dEBE[t][pe][m][k]) fReRPQ1dEBE[t][pe][m][k]->Reset(); | |
10683 | if(fImRPQ1dEBE[t][pe][m][k]) fImRPQ1dEBE[t][pe][m][k]->Reset(); | |
10684 | } | |
10685 | } | |
489d5531 | 10686 | } |
1268c371 | 10687 | } |
10688 | for(Int_t t=0;t<3;t++) // type (0 = RP, 1 = POI, 2 = RP&&POI ) | |
10689 | { | |
62e36168 | 10690 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // 1D in pt or eta |
489d5531 | 10691 | { |
1268c371 | 10692 | for(Int_t k=0;k<9;k++) |
10693 | { | |
10694 | if(fs1dEBE[t][pe][k]) fs1dEBE[t][pe][k]->Reset(); | |
10695 | } | |
489d5531 | 10696 | } |
10697 | } | |
1268c371 | 10698 | // e-b-e reduced correlations: |
10699 | for(Int_t t=0;t<2;t++) // type (0 = RP, 1 = POI) | |
10700 | { | |
62e36168 | 10701 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 10702 | { |
1268c371 | 10703 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index |
10704 | { | |
10705 | if(fDiffFlowCorrelationsEBE[t][pe][rci]) fDiffFlowCorrelationsEBE[t][pe][rci]->Reset(); | |
10706 | if(fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci]) fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci]->Reset(); | |
10707 | } | |
489d5531 | 10708 | } |
1268c371 | 10709 | } |
10710 | // correction terms for NUA: | |
10711 | for(Int_t t=0;t<2;t++) // type (0 = RP, 1 = POI) | |
10712 | { | |
62e36168 | 10713 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 10714 | { |
1268c371 | 10715 | for(Int_t sc=0;sc<2;sc++) // sin or cos |
489d5531 | 10716 | { |
1268c371 | 10717 | for(Int_t cti=0;cti<9;cti++) // correction term index |
10718 | { | |
489d5531 | 10719 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti]->Reset(); |
1268c371 | 10720 | } |
489d5531 | 10721 | } |
1268c371 | 10722 | } |
10723 | } | |
10724 | } // end of if(fCalculateDiffFlow) | |
10725 | ||
489d5531 | 10726 | // 2D (pt,eta) |
1268c371 | 10727 | if(fCalculate2DDiffFlow) |
489d5531 | 10728 | { |
10729 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
10730 | { | |
10731 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
10732 | { | |
10733 | for(Int_t k=0;k<9;k++) // power of weight | |
10734 | { | |
b77b6434 | 10735 | if(fReRPQ2dEBE[t][m][k]){fReRPQ2dEBE[t][m][k]->Reset();} |
10736 | if(fImRPQ2dEBE[t][m][k]){fImRPQ2dEBE[t][m][k]->Reset();} | |
489d5531 | 10737 | } |
10738 | } | |
10739 | } | |
10740 | for(Int_t t=0;t<3;t++) // type (0 = RP, 1 = POI, 2 = RP&&POI ) | |
10741 | { | |
10742 | for(Int_t k=0;k<9;k++) | |
10743 | { | |
b77b6434 | 10744 | if(fs2dEBE[t][k]){fs2dEBE[t][k]->Reset();} |
489d5531 | 10745 | } |
10746 | } | |
1268c371 | 10747 | } // end of if(fCalculate2DDiffFlow) |
489d5531 | 10748 | |
10749 | } // end of void AliFlowAnalysisWithQCumulants::ResetEventByEventQuantities(); | |
10750 | ||
489d5531 | 10751 | //================================================================================================================================ |
10752 | ||
489d5531 | 10753 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTerms(TString type, TString ptOrEta) |
10754 | { | |
10755 | // Calculate correction terms for non-uniform acceptance for differential flow (sin terms). | |
10756 | ||
10757 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][0][cti], where cti runs as follows: | |
10758 | // 0: <<sin n(psi1)>> | |
10759 | // 1: <<sin n(psi1+phi2)>> | |
10760 | // 2: <<sin n(psi1+phi2-phi3)>> | |
10761 | // 3: <<sin n(psi1-phi2-phi3)>>: | |
10762 | // 4: | |
10763 | // 5: | |
10764 | // 6: | |
10765 | ||
10766 | // multiplicity: | |
1268c371 | 10767 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 10768 | |
10769 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
10770 | Double_t dReQ1n = (*fReQ)(0,0); | |
10771 | Double_t dReQ2n = (*fReQ)(1,0); | |
10772 | //Double_t dReQ3n = (*fReQ)(2,0); | |
10773 | //Double_t dReQ4n = (*fReQ)(3,0); | |
10774 | Double_t dImQ1n = (*fImQ)(0,0); | |
10775 | Double_t dImQ2n = (*fImQ)(1,0); | |
10776 | //Double_t dImQ3n = (*fImQ)(2,0); | |
10777 | //Double_t dImQ4n = (*fImQ)(3,0); | |
10778 | ||
2a98ceb8 | 10779 | Int_t t = 0; // type flag |
10780 | Int_t pe = 0; // ptEta flag | |
489d5531 | 10781 | |
10782 | if(type == "RP") | |
10783 | { | |
10784 | t = 0; | |
10785 | } else if(type == "POI") | |
10786 | { | |
10787 | t = 1; | |
10788 | } | |
10789 | ||
10790 | if(ptOrEta == "Pt") | |
10791 | { | |
10792 | pe = 0; | |
10793 | } else if(ptOrEta == "Eta") | |
10794 | { | |
10795 | pe = 1; | |
10796 | } | |
10797 | ||
10798 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
10799 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
10800 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
10801 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
10802 | ||
10803 | // looping over all bins and calculating correction terms: | |
10804 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10805 | { | |
10806 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
10807 | Double_t p1n0kRe = 0.; | |
10808 | Double_t p1n0kIm = 0.; | |
10809 | ||
10810 | // number of POIs in particular pt or eta bin: | |
10811 | Double_t mp = 0.; | |
10812 | ||
10813 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
10814 | Double_t q1n0kRe = 0.; | |
10815 | Double_t q1n0kIm = 0.; | |
10816 | Double_t q2n0kRe = 0.; | |
10817 | Double_t q2n0kIm = 0.; | |
10818 | ||
10819 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
10820 | Double_t mq = 0.; | |
10821 | ||
10822 | if(type == "POI") | |
10823 | { | |
10824 | // q_{m*n,0}: | |
10825 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
10826 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
10827 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
10828 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
10829 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
10830 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
10831 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
10832 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
10833 | ||
10834 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10835 | } | |
10836 | else if(type == "RP") | |
10837 | { | |
10838 | // q_{m*n,0}: | |
10839 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
10840 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
10841 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
10842 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
10843 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
10844 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
10845 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
10846 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
10847 | ||
10848 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10849 | } | |
10850 | if(type == "POI") | |
10851 | { | |
10852 | // p_{m*n,0}: | |
10853 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
10854 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
10855 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
10856 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
10857 | ||
10858 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10859 | ||
10860 | t = 1; // typeFlag = RP or POI | |
10861 | } | |
10862 | else if(type == "RP") | |
10863 | { | |
10864 | // p_{m*n,0} = q_{m*n,0}: | |
10865 | p1n0kRe = q1n0kRe; | |
10866 | p1n0kIm = q1n0kIm; | |
10867 | ||
10868 | mp = mq; | |
10869 | ||
10870 | t = 0; // typeFlag = RP or POI | |
10871 | } | |
10872 | ||
10873 | // <<sin n(psi1)>>: | |
10874 | Double_t sinP1nPsi = 0.; | |
10875 | if(mp) | |
10876 | { | |
10877 | sinP1nPsi = p1n0kIm/mp; | |
10878 | // fill profile for <<sin n(psi1)>>: | |
10879 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi,mp); | |
10880 | // histogram to store <sin n(psi1)> e-b-e (needed in some other methods): | |
10881 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][0]->SetBinContent(b,sinP1nPsi); | |
10882 | } // end of if(mp) | |
10883 | ||
10884 | // <<sin n(psi1+phi2)>>: | |
10885 | Double_t sinP1nPsiP1nPhi = 0.; | |
10886 | if(mp*dMult-mq) | |
10887 | { | |
10888 | sinP1nPsiP1nPhi = (p1n0kRe*dImQ1n+p1n0kIm*dReQ1n-q2n0kIm)/(mp*dMult-mq); | |
10889 | // fill profile for <<sin n(psi1+phi2)>>: | |
10890 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsiP1nPhi,mp*dMult-mq); | |
10891 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
10892 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][1]->SetBinContent(b,sinP1nPsiP1nPhi); | |
10893 | } // end of if(mp*dMult-mq) | |
10894 | ||
10895 | // <<sin n(psi1+phi2-phi3)>>: | |
10896 | Double_t sinP1nPsi1P1nPhi2MPhi3 = 0.; | |
10897 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
10898 | { | |
10899 | sinP1nPsi1P1nPhi2MPhi3 = (p1n0kIm*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult) | |
10900 | - 1.*(q2n0kIm*dReQ1n-q2n0kRe*dImQ1n) | |
10901 | - mq*dImQ1n+2.*q1n0kIm) | |
10902 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
10903 | // fill profile for <<sin n(psi1+phi2)>>: | |
10904 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
10905 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
10906 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][2]->SetBinContent(b,sinP1nPsi1P1nPhi2MPhi3); | |
10907 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
10908 | ||
10909 | // <<sin n(psi1-phi2-phi3)>>: | |
10910 | Double_t sinP1nPsi1M1nPhi2MPhi3 = 0.; | |
10911 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
10912 | { | |
10913 | sinP1nPsi1M1nPhi2MPhi3 = (p1n0kIm*(pow(dReQ1n,2.)-pow(dImQ1n,2.))-2.*p1n0kRe*dReQ1n*dImQ1n | |
10914 | - 1.*(p1n0kIm*dReQ2n-p1n0kRe*dImQ2n) | |
10915 | + 2.*mq*dImQ1n-2.*q1n0kIm) | |
10916 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
10917 | // fill profile for <<sin n(psi1+phi2)>>: | |
10918 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
10919 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
10920 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][3]->SetBinContent(b,sinP1nPsi1M1nPhi2MPhi3); | |
10921 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
10922 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10923 | ||
10924 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTerms(TString type, TString ptOrEta) | |
10925 | ||
10926 | ||
10927 | //================================================================================================================================ | |
10928 | ||
10929 | ||
10930 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTerms(TString type, TString ptOrEta) | |
10931 | { | |
10932 | // Calculate correction terms for non-uniform acceptance for differential flow (cos terms). | |
10933 | ||
10934 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][1][cti], where cti runs as follows: | |
10935 | // 0: <<cos n(psi)>> | |
10936 | // 1: <<cos n(psi1+phi2)>> | |
10937 | // 2: <<cos n(psi1+phi2-phi3)>> | |
10938 | // 3: <<cos n(psi1-phi2-phi3)>> | |
10939 | // 4: | |
10940 | // 5: | |
10941 | // 6: | |
10942 | ||
10943 | // multiplicity: | |
1268c371 | 10944 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 10945 | |
10946 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
10947 | Double_t dReQ1n = (*fReQ)(0,0); | |
10948 | Double_t dReQ2n = (*fReQ)(1,0); | |
10949 | //Double_t dReQ3n = (*fReQ)(2,0); | |
10950 | //Double_t dReQ4n = (*fReQ)(3,0); | |
10951 | Double_t dImQ1n = (*fImQ)(0,0); | |
10952 | Double_t dImQ2n = (*fImQ)(1,0); | |
10953 | //Double_t dImQ3n = (*fImQ)(2,0); | |
10954 | //Double_t dImQ4n = (*fImQ)(3,0); | |
10955 | ||
2a98ceb8 | 10956 | Int_t t = 0; // type flag |
10957 | Int_t pe = 0; // ptEta flag | |
489d5531 | 10958 | |
10959 | if(type == "RP") | |
10960 | { | |
10961 | t = 0; | |
10962 | } else if(type == "POI") | |
10963 | { | |
10964 | t = 1; | |
10965 | } | |
10966 | ||
10967 | if(ptOrEta == "Pt") | |
10968 | { | |
10969 | pe = 0; | |
10970 | } else if(ptOrEta == "Eta") | |
10971 | { | |
10972 | pe = 1; | |
10973 | } | |
10974 | ||
10975 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
10976 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
10977 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
10978 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
10979 | ||
10980 | // looping over all bins and calculating correction terms: | |
10981 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10982 | { | |
10983 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
10984 | Double_t p1n0kRe = 0.; | |
10985 | Double_t p1n0kIm = 0.; | |
10986 | ||
10987 | // number of POIs in particular pt or eta bin: | |
10988 | Double_t mp = 0.; | |
10989 | ||
10990 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
10991 | Double_t q1n0kRe = 0.; | |
10992 | Double_t q1n0kIm = 0.; | |
10993 | Double_t q2n0kRe = 0.; | |
10994 | Double_t q2n0kIm = 0.; | |
10995 | ||
10996 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
10997 | Double_t mq = 0.; | |
10998 | ||
10999 | if(type == "POI") | |
11000 | { | |
11001 | // q_{m*n,0}: | |
11002 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
11003 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
11004 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
11005 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
11006 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
11007 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
11008 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
11009 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
11010 | ||
11011 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
11012 | } | |
11013 | else if(type == "RP") | |
11014 | { | |
11015 | // q_{m*n,0}: | |
11016 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
11017 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
11018 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
11019 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
11020 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
11021 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
11022 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
11023 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
11024 | ||
11025 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
11026 | } | |
11027 | if(type == "POI") | |
11028 | { | |
11029 | // p_{m*n,0}: | |
11030 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
11031 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
11032 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
11033 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
11034 | ||
11035 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
11036 | ||
11037 | t = 1; // typeFlag = RP or POI | |
11038 | } | |
11039 | else if(type == "RP") | |
11040 | { | |
11041 | // p_{m*n,0} = q_{m*n,0}: | |
11042 | p1n0kRe = q1n0kRe; | |
11043 | p1n0kIm = q1n0kIm; | |
11044 | ||
11045 | mp = mq; | |
11046 | ||
11047 | t = 0; // typeFlag = RP or POI | |
11048 | } | |
11049 | ||
11050 | // <<cos n(psi1)>>: | |
11051 | Double_t cosP1nPsi = 0.; | |
11052 | if(mp) | |
11053 | { | |
11054 | cosP1nPsi = p1n0kRe/mp; | |
11055 | ||
11056 | // fill profile for <<cos n(psi1)>>: | |
11057 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi,mp); | |
11058 | // histogram to store <cos n(psi1)> e-b-e (needed in some other methods): | |
11059 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][0]->SetBinContent(b,cosP1nPsi); | |
11060 | } // end of if(mp) | |
11061 | ||
11062 | // <<cos n(psi1+phi2)>>: | |
11063 | Double_t cosP1nPsiP1nPhi = 0.; | |
11064 | if(mp*dMult-mq) | |
11065 | { | |
11066 | cosP1nPsiP1nPhi = (p1n0kRe*dReQ1n-p1n0kIm*dImQ1n-q2n0kRe)/(mp*dMult-mq); | |
11067 | // fill profile for <<sin n(psi1+phi2)>>: | |
11068 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsiP1nPhi,mp*dMult-mq); | |
11069 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
11070 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][1]->SetBinContent(b,cosP1nPsiP1nPhi); | |
11071 | } // end of if(mp*dMult-mq) | |
11072 | ||
11073 | // <<cos n(psi1+phi2-phi3)>>: | |
11074 | Double_t cosP1nPsi1P1nPhi2MPhi3 = 0.; | |
11075 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
11076 | { | |
11077 | cosP1nPsi1P1nPhi2MPhi3 = (p1n0kRe*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult) | |
11078 | - 1.*(q2n0kRe*dReQ1n+q2n0kIm*dImQ1n) | |
11079 | - mq*dReQ1n+2.*q1n0kRe) | |
11080 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
11081 | // fill profile for <<sin n(psi1+phi2)>>: | |
11082 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
11083 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
11084 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][2]->SetBinContent(b,cosP1nPsi1P1nPhi2MPhi3); | |
11085 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
11086 | ||
11087 | // <<cos n(psi1-phi2-phi3)>>: | |
11088 | Double_t cosP1nPsi1M1nPhi2MPhi3 = 0.; | |
11089 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
11090 | { | |
11091 | cosP1nPsi1M1nPhi2MPhi3 = (p1n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.))+2.*p1n0kIm*dReQ1n*dImQ1n | |
11092 | - 1.*(p1n0kRe*dReQ2n+p1n0kIm*dImQ2n) | |
11093 | - 2.*mq*dReQ1n+2.*q1n0kRe) | |
11094 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
11095 | // fill profile for <<sin n(psi1+phi2)>>: | |
11096 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
11097 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
11098 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][3]->SetBinContent(b,cosP1nPsi1M1nPhi2MPhi3); | |
11099 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
11100 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
11101 | ||
11102 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTerms(TString type, TString ptOrEta) | |
11103 | ||
489d5531 | 11104 | //================================================================================================================================== |
11105 | ||
489d5531 | 11106 | void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUADiffFlow(TString type, TString ptOrEta) |
11107 | { | |
1268c371 | 11108 | // Transfer profiles into histogams and correctly propagate the error. |
489d5531 | 11109 | |
2a98ceb8 | 11110 | Int_t t = 0; // type flag |
11111 | Int_t pe = 0; // ptEta flag | |
489d5531 | 11112 | |
11113 | if(type == "RP") | |
11114 | { | |
11115 | t = 0; | |
11116 | } else if(type == "POI") | |
11117 | { | |
11118 | t = 1; | |
11119 | } | |
11120 | ||
11121 | if(ptOrEta == "Pt") | |
11122 | { | |
11123 | pe = 0; | |
11124 | } else if(ptOrEta == "Eta") | |
11125 | { | |
11126 | pe = 1; | |
11127 | } | |
11128 | ||
11129 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
11130 | //Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
11131 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
11132 | //Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
11133 | ||
11134 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
11135 | { | |
11136 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
11137 | { | |
11138 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
11139 | { | |
11140 | Double_t correctionTerm = fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]->GetBinContent(b); | |
11141 | fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]->SetBinContent(b,correctionTerm); | |
11142 | // to be improved (propagate error correctly) | |
11143 | // ... | |
11144 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
11145 | } // correction term index | |
11146 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
11147 | ||
11148 | }// end of void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUADiffFlow(TString type, TString ptOrEta) | |
11149 | ||
489d5531 | 11150 | //================================================================================================================================== |
11151 | ||
489d5531 | 11152 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta) |
11153 | { | |
1268c371 | 11154 | // Calculate generalized differential flow cumulants (corrected for non-uniform acceptance). |
11155 | ||
11156 | // to be improved - propagate error also from non-isotropic terms | |
489d5531 | 11157 | |
1268c371 | 11158 | Int_t t = 0; // RP = 0, POI = 1 |
11159 | Int_t pe = 0; // pt = 0, eta = 1 | |
489d5531 | 11160 | |
11161 | if(type == "RP") | |
11162 | { | |
1268c371 | 11163 | t = 0; |
489d5531 | 11164 | } else if(type == "POI") |
11165 | { | |
1268c371 | 11166 | t = 1; |
489d5531 | 11167 | } |
11168 | ||
11169 | if(ptOrEta == "Pt") | |
11170 | { | |
1268c371 | 11171 | pe = 0; |
489d5531 | 11172 | } else if(ptOrEta == "Eta") |
11173 | { | |
1268c371 | 11174 | pe = 1; |
489d5531 | 11175 | } |
1268c371 | 11176 | |
11177 | // Common: | |
489d5531 | 11178 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
489d5531 | 11179 | // 2-particle correlation: |
11180 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> | |
1268c371 | 11181 | // sinus terms coming from reference flow: |
489d5531 | 11182 | Double_t sinP1nPhi = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1); // <<sin(n*phi1)>> |
11183 | Double_t sinP1nPhi1P1nPhi2 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2); // <<sin(n*(phi1+phi2))>> | |
11184 | Double_t sinP1nPhi1M1nPhi2M1nPhi3 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(3); // <<sin(n*(phi1-phi2-phi3))>> | |
1268c371 | 11185 | // cosinus terms coming from reference flow: |
489d5531 | 11186 | Double_t cosP1nPhi = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1); // <<cos(n*phi1)>> |
11187 | Double_t cosP1nPhi1P1nPhi2 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2); // <<cos(n*(phi1+phi2))>> | |
11188 | Double_t cosP1nPhi1M1nPhi2M1nPhi3 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(3); // <<cos(n*(phi1-phi2-phi3))>> | |
11189 | ||
11190 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
11191 | { | |
11192 | Double_t twoPrime = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); // <<2'>> | |
11193 | Double_t fourPrime = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); // <<4'>> | |
11194 | Double_t sinP1nPsi = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][0]->GetBinContent(b); // <<sin n(Psi)>> | |
11195 | Double_t cosP1nPsi = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][0]->GetBinContent(b); // <<cos n(Psi)>> | |
11196 | Double_t sinP1nPsi1P1nPhi2 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][1]->GetBinContent(b); // <<sin n(psi1+phi2)>> | |
11197 | Double_t cosP1nPsi1P1nPhi2 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][1]->GetBinContent(b); // <<cos n(psi1+phi2)>> | |
11198 | Double_t sinP1nPsi1P1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][2]->GetBinContent(b); // <<sin n(psi1+phi2-phi3)>> | |
11199 | Double_t cosP1nPsi1P1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][2]->GetBinContent(b); // <<cos n(psi1+phi2-phi3)>> | |
11200 | Double_t sinP1nPsi1M1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][3]->GetBinContent(b); // <<sin n(psi1-phi2-phi3)>> | |
11201 | Double_t cosP1nPsi1M1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][3]->GetBinContent(b); // <<cos n(psi1-phi2-phi3)>> | |
1268c371 | 11202 | // Generalized QC{2'}: |
489d5531 | 11203 | Double_t qc2Prime = twoPrime - sinP1nPsi*sinP1nPhi - cosP1nPsi*cosP1nPhi; |
1268c371 | 11204 | if(fApplyCorrectionForNUA) |
11205 | { | |
11206 | fDiffFlowCumulants[t][pe][0]->SetBinContent(b,qc2Prime); | |
11207 | } | |
11208 | if(TMath::Abs(twoPrime)>0.) | |
11209 | { | |
11210 | fDiffFlowDetectorBias[t][pe][0]->SetBinContent(b,qc2Prime/twoPrime); // detector bias = generalized/isotropic cumulant. | |
11211 | } | |
11212 | // Generalized QC{4'}: | |
489d5531 | 11213 | Double_t qc4Prime = fourPrime-2.*twoPrime*two |
11214 | - cosP1nPsi*cosP1nPhi1M1nPhi2M1nPhi3 | |
11215 | + sinP1nPsi*sinP1nPhi1M1nPhi2M1nPhi3 | |
11216 | - cosP1nPhi*cosP1nPsi1M1nPhi2M1nPhi3 | |
11217 | + sinP1nPhi*sinP1nPsi1M1nPhi2M1nPhi3 | |
11218 | - 2.*cosP1nPhi*cosP1nPsi1P1nPhi2M1nPhi3 | |
11219 | - 2.*sinP1nPhi*sinP1nPsi1P1nPhi2M1nPhi3 | |
11220 | - cosP1nPsi1P1nPhi2*cosP1nPhi1P1nPhi2 | |
11221 | - sinP1nPsi1P1nPhi2*sinP1nPhi1P1nPhi2 | |
11222 | + 2.*cosP1nPhi1P1nPhi2*(cosP1nPsi*cosP1nPhi-sinP1nPsi*sinP1nPhi) | |
11223 | + 2.*sinP1nPhi1P1nPhi2*(cosP1nPsi*sinP1nPhi+sinP1nPsi*cosP1nPhi) | |
11224 | + 4.*two*(cosP1nPsi*cosP1nPhi+sinP1nPsi*sinP1nPhi) | |
11225 | + 2.*cosP1nPsi1P1nPhi2*(pow(cosP1nPhi,2.)-pow(sinP1nPhi,2.)) | |
11226 | + 4.*sinP1nPsi1P1nPhi2*cosP1nPhi*sinP1nPhi | |
11227 | + 4.*twoPrime*(pow(cosP1nPhi,2.)+pow(sinP1nPhi,2.)) | |
11228 | - 6.*(pow(cosP1nPhi,2.)-pow(sinP1nPhi,2.)) | |
11229 | * (cosP1nPsi*cosP1nPhi-sinP1nPsi*sinP1nPhi) | |
11230 | - 12.*cosP1nPhi*sinP1nPhi | |
11231 | * (sinP1nPsi*cosP1nPhi+cosP1nPsi*sinP1nPhi); | |
1268c371 | 11232 | if(fApplyCorrectionForNUA) |
11233 | { | |
11234 | fDiffFlowCumulants[t][pe][1]->SetBinContent(b,qc4Prime); | |
11235 | } | |
11236 | if(TMath::Abs(fourPrime-2.*twoPrime*two)>0.) | |
11237 | { | |
11238 | fDiffFlowDetectorBias[t][pe][1]->SetBinContent(b,qc4Prime/(fourPrime-2.*twoPrime*two)); // detector bias = generalized/isotropic cumulant. | |
11239 | } | |
489d5531 | 11240 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
11241 | ||
11242 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta) | |
11243 | ||
1268c371 | 11244 | //================================================================================================================================== |
489d5531 | 11245 | |
11246 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta) | |
11247 | { | |
11248 | // Calculate differential flow corrected for non-uniform acceptance. | |
11249 | ||
1268c371 | 11250 | // to be improved: eventually I will have to access here masured correlations and NUA terms |
11251 | // instead of cumulants in order to propagate statistical error correctly also | |
11252 | // to NUA terms (propagating errors directly from cumulants is WRONG for | |
11253 | // differential flow becuase that doesn't account at all cross-covariance terms) | |
489d5531 | 11254 | |
1268c371 | 11255 | // REMARK: When NUA correction is apllied error for differential flow DOES NOT get corrected, |
11256 | // i.e. only value is being corrected, error is still the one relevant for isotropic | |
11257 | // case. This eventually will be resolved. | |
11258 | ||
11259 | ||
11260 | Int_t t = 0; // RP or POI | |
11261 | Int_t pe = 0; // pt or eta | |
489d5531 | 11262 | |
11263 | if(type == "RP") | |
11264 | { | |
1268c371 | 11265 | t = 0; |
489d5531 | 11266 | } else if(type == "POI") |
11267 | { | |
1268c371 | 11268 | t = 1; |
11269 | } | |
489d5531 | 11270 | if(ptOrEta == "Pt") |
11271 | { | |
1268c371 | 11272 | pe = 0; |
489d5531 | 11273 | } else if(ptOrEta == "Eta") |
11274 | { | |
1268c371 | 11275 | pe = 1; |
489d5531 | 11276 | } |
11277 | ||
1268c371 | 11278 | // Common: |
489d5531 | 11279 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
1268c371 | 11280 | // Reference Q-cumulants |
11281 | Double_t qc2 = fIntFlowQcumulants->GetBinContent(1); // QC{2} | |
11282 | Double_t qc4 = fIntFlowQcumulants->GetBinContent(2); // QC{4} | |
11283 | // Loop over pt or eta bins: | |
489d5531 | 11284 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) |
11285 | { | |
1268c371 | 11286 | // Differential Q-cumulants: |
11287 | Double_t qc2Prime = fDiffFlowCumulants[t][pe][0]->GetBinContent(b); // QC{2'} | |
11288 | Double_t qc4Prime = fDiffFlowCumulants[t][pe][1]->GetBinContent(b); // QC{4'} | |
489d5531 | 11289 | // v'{2}: |
1268c371 | 11290 | if(qc2>0.) |
489d5531 | 11291 | { |
1268c371 | 11292 | Double_t v2Prime = qc2Prime/pow(qc2,0.5); |
11293 | if(TMath::Abs(v2Prime)>0.){fDiffFlow[t][pe][0]->SetBinContent(b,v2Prime);} | |
489d5531 | 11294 | } |
489d5531 | 11295 | // v'{4}: |
1268c371 | 11296 | if(qc4<0.) |
489d5531 | 11297 | { |
1268c371 | 11298 | Double_t v4Prime = -qc4Prime/pow(-qc4,3./4.); |
11299 | if(TMath::Abs(v4Prime)>0.){fDiffFlow[t][pe][1]->SetBinContent(b,v4Prime);} | |
489d5531 | 11300 | } |
11301 | } // end of for(Int_t b=1;b<=fnBinsPtEta[pe];b++) | |
11302 | ||
11303 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta); | |
11304 | ||
489d5531 | 11305 | //================================================================================================================================== |
11306 | ||
0328db2d | 11307 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoops(AliFlowEventSimple * const anEvent) |
489d5531 | 11308 | { |
11309 | // Evaluate with nested loops multiparticle correlations for integrated flow (without using the particle weights). | |
11310 | ||
11311 | // Remark: Results are stored in profile fIntFlowDirectCorrelations whose binning is organized as follows: | |
11312 | // | |
11313 | // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))> | |
11314 | // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))> | |
11315 | // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))> | |
11316 | // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))> | |
11317 | // 5th bin: ---- EMPTY ---- | |
11318 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))> | |
11319 | // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))> | |
11320 | // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))> | |
11321 | // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))> | |
11322 | // 10th bin: ---- EMPTY ---- | |
11323 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))> | |
11324 | // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))> | |
11325 | // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))> | |
11326 | // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))> | |
11327 | // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))> | |
11328 | // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))> | |
11329 | // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> | |
11330 | // 18th bin: ---- EMPTY ---- | |
11331 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))> | |
11332 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))> | |
11333 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))> | |
11334 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))> | |
11335 | // 23rd bin: ---- EMPTY ---- | |
11336 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> | |
11337 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))> | |
11338 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))> | |
11339 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))> | |
11340 | // 28th bin: ---- EMPTY ---- | |
11341 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> | |
11342 | // 30th bin: ---- EMPTY ---- | |
11343 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> | |
8ed4edc7 | 11344 | // 32nd bin: ---- EMPTY ---- |
b84464d3 | 11345 | // Extra correlations for 3p TY study: |
8ed4edc7 | 11346 | // 33rd bin: <4>_{4n,2n|3n,3n}= four4n2n3n3n = <cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4))> |
b84464d3 | 11347 | // 34th bin: <5>_{3n,3n|2n,2n,2n} = five3n3n2n2n2n = <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-2*phi5))> |
11348 | // Extra correlations for 6p TY study: | |
11349 | // 35th bin: <2>_{5n|5n} = two5n5n = <cos(5n*(phi1-phi2)> T | |
11350 | // 36th bin: <2>_{6n|6n} = two6n6n = <cos(6n*(phi1-phi2)> T | |
11351 | // 37th bin: <3>_{5n|3n,2n} = three5n3n2n = <cos(n*(5*phi1-3*phi2-2*phi3)> | |
11352 | // 38th bin: <3>_{5n|4n,1n} = three5n4n1n = <cos(n*(5*phi1-4*phi2-1*phi3)> | |
11353 | // 39th bin: <3>_{6n|3n,3n} = three6n3n3n = <cos(n*(6*phi1-3*phi2-3*phi3)> T | |
11354 | // 40th bin: <3>_{6n|4n,2n} = three6n4n2n = <cos(n*(6*phi1-4*phi2-2*phi3)> T | |
11355 | // 41st bin: <3>_{6n|5n,1n} = three6n5n1n = <cos(n*(6*phi1-5*phi2-1*phi3)> | |
11356 | // 42nd bin: <4>_{6n|3n,2n,1n} = four6n3n2n1n = <cos(n*(6*phi1-3*phi2-2*phi3-1*phi4)> | |
11357 | // 43rd bin: <4>_{3n,2n|3n,2n} = four3n2n3n2n = <cos(n*(3*phi1+2*phi2-3*phi3-2*phi4)> | |
11358 | // 44th bin: <4>_{4n,1n|3n,2n} = four4n1n3n2n = <cos(n*(4*phi1+1*phi2-3*phi3-2*phi4)> | |
11359 | // 45th bin: <4>_{3n,3n|3n,3n} = four3n3n3n3n = <cos(3.*n*(phi1+phi2-phi3-phi4))> T | |
11360 | // 46th bin: <4>_{4n,2n|3n,3n} = four4n2n3n3n = <cos(n*(4*phi1+2*phi2-3*phi3-3*phi4)> | |
11361 | // 47th bin: <4>_{5n,1n|3n,3n} = four5n1n3n3n = <cos(n*(5*phi1+1*phi2-3*phi3-3*phi4)> | |
11362 | // 48th bin: <4>_{4n,2n|4n,2n} = four4n2n4n2n = <cos(n*(4*phi1+2*phi2-4*phi3-2*phi4)> T | |
11363 | // 49th bin: <4>_{5n,1n|4n,2n} = four5n1n4n2n = <cos(n*(5*phi1+1*phi2-4*phi3-2*phi4)> | |
11364 | // 50th bin: <4>_{5n|3n,1n,1n} = four5n3n1n1n = <cos(n*(5*phi1-3*phi2-1*phi3-1*phi4)> | |
11365 | // 51st bin: <4>_{5n|2n,2n,1n} = four5n2n2n1n = <cos(n*(5*phi1-2*phi2-2*phi3-1*phi4)> | |
11366 | // 52nd bin: <4>_{5n,1n|5n,1n} = four5n1n5n1n = <cos(n*(5*phi1+1*phi2-5*phi3-1*phi4)> | |
11367 | // 53rd bin: <5>_{3n,3n|3n,2n,1n} = four3n3n3n2n1n = <cos(n*(3*phi1+3*phi2-3*phi3-2*phi4-1*phi5)> | |
11368 | // 54th bin: <5>_{4n,2n|3n,2n,1n} = four4n2n3n2n1n = <cos(n*(4*phi1+2*phi2-3*phi3-2*phi4-1*phi5)> | |
11369 | // 55th bin: <5>_{3n,2n|3n,1n,1n} = four3n2n3n1n1n = <cos(n*(3*phi1+2*phi2-3*phi3-1*phi4-1*phi5)> | |
11370 | // 56th bin: <5>_{3n,2n|2n,2n,1n} = four3n2n2n2n1n = <cos(n*(3*phi1+2*phi2-2*phi3-2*phi4-1*phi5)> | |
11371 | // 57th bin: <5>_{5n,1n|3n,2n,1n} = four5n1n3n2n1n = <cos(n*(5*phi1+1*phi2-3*phi3-2*phi4-1*phi5)> | |
11372 | // 58th bin: <6>_{3n,2n,1n|3n,2n,1n} = six3n2n1n3n2n1n = <cos(n*(3*phi1+2*phi2+1*phi3-3*phi4-2*phi5-1*phi6)> | |
8ed4edc7 | 11373 | |
489d5531 | 11374 | Int_t nPrim = anEvent->NumberOfTracks(); |
11375 | AliFlowTrackSimple *aftsTrack = NULL; | |
11376 | Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; | |
11377 | Int_t n = fHarmonic; | |
11378 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 11379 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 11380 | cout<<endl; |
11381 | cout<<"Multiparticle correlations: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
11382 | if(dMult<2) | |
11383 | { | |
11384 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
11385 | } else if (dMult>fMaxAllowedMultiplicity) | |
11386 | { | |
11387 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
11388 | } else | |
11389 | { | |
11390 | cout<<"... evaluating nested loops (without using particle weights)..."<<endl; | |
11391 | } | |
11392 | ||
11393 | // 2-particle correlations: | |
11394 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
11395 | { | |
11396 | for(Int_t i1=0;i1<nPrim;i1++) | |
11397 | { | |
11398 | aftsTrack=anEvent->GetTrack(i1); | |
11399 | if(!(aftsTrack->InRPSelection())) continue; | |
11400 | phi1=aftsTrack->Phi(); | |
11401 | for(Int_t i2=0;i2<nPrim;i2++) | |
11402 | { | |
11403 | if(i2==i1)continue; | |
11404 | aftsTrack=anEvent->GetTrack(i2); | |
11405 | if(!(aftsTrack->InRPSelection())) continue; | |
11406 | phi2=aftsTrack->Phi(); | |
11407 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
11408 | // fill the profile with 2-p correlations: | |
b84464d3 | 11409 | fIntFlowDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),1.); // <cos(n*(phi1-phi2))> |
11410 | fIntFlowDirectCorrelations->Fill(1.5,cos(2.*n*(phi1-phi2)),1.); // <cos(2n*(phi1-phi2))> | |
11411 | fIntFlowDirectCorrelations->Fill(2.5,cos(3.*n*(phi1-phi2)),1.); // <cos(3n*(phi1-phi2))> | |
11412 | fIntFlowDirectCorrelations->Fill(3.5,cos(4.*n*(phi1-phi2)),1.); // <cos(4n*(phi1-phi2))> | |
11413 | fIntFlowDirectCorrelations->Fill(34.5,cos(5.*n*(phi1-phi2)),1.); // <cos(5n*(phi1-phi2))> | |
11414 | fIntFlowDirectCorrelations->Fill(35.5,cos(6.*n*(phi1-phi2)),1.); // <cos(6n*(phi1-phi2))> | |
489d5531 | 11415 | } // end of for(Int_t i2=0;i2<nPrim;i2++) |
11416 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11417 | } // end of if(nPrim>=2) | |
11418 | ||
11419 | // 3-particle correlations: | |
11420 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
11421 | { | |
11422 | for(Int_t i1=0;i1<nPrim;i1++) | |
11423 | { | |
11424 | aftsTrack=anEvent->GetTrack(i1); | |
11425 | if(!(aftsTrack->InRPSelection())) continue; | |
11426 | phi1=aftsTrack->Phi(); | |
11427 | for(Int_t i2=0;i2<nPrim;i2++) | |
11428 | { | |
11429 | if(i2==i1)continue; | |
11430 | aftsTrack=anEvent->GetTrack(i2); | |
11431 | if(!(aftsTrack->InRPSelection())) continue; | |
11432 | phi2=aftsTrack->Phi(); | |
11433 | for(Int_t i3=0;i3<nPrim;i3++) | |
11434 | { | |
11435 | if(i3==i1||i3==i2)continue; | |
11436 | aftsTrack=anEvent->GetTrack(i3); | |
11437 | if(!(aftsTrack->InRPSelection())) continue; | |
11438 | phi3=aftsTrack->Phi(); | |
11439 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
11440 | // fill the profile with 3-p correlations: | |
b84464d3 | 11441 | fIntFlowDirectCorrelations->Fill(5.,cos(2.*n*phi1-n*(phi2+phi3)),1.); //<3>_{2n|nn,n} |
11442 | fIntFlowDirectCorrelations->Fill(6.,cos(3.*n*phi1-2.*n*phi2-n*phi3),1.); //<3>_{3n|2n,n} | |
11443 | fIntFlowDirectCorrelations->Fill(7.,cos(4.*n*phi1-2.*n*phi2-2.*n*phi3),1.); //<3>_{4n|2n,2n} | |
11444 | fIntFlowDirectCorrelations->Fill(8.,cos(4.*n*phi1-3.*n*phi2-n*phi3),1.); //<3>_{4n|3n,n} | |
11445 | fIntFlowDirectCorrelations->Fill(36.5,cos(5.*n*phi1-3.*n*phi2-2.*n*phi3),1.); //<3>_{5n|3n,2n} | |
11446 | fIntFlowDirectCorrelations->Fill(37.5,cos(5.*n*phi1-4.*n*phi2-1.*n*phi3),1.); //<3>_{5n|4n,1n} | |
11447 | fIntFlowDirectCorrelations->Fill(38.5,cos(6.*n*phi1-3.*n*phi2-3.*n*phi3),1.); //<3>_{6n|3n,3n} | |
11448 | fIntFlowDirectCorrelations->Fill(39.5,cos(6.*n*phi1-4.*n*phi2-2.*n*phi3),1.); //<3>_{6n|4n,2n} | |
11449 | fIntFlowDirectCorrelations->Fill(40.5,cos(6.*n*phi1-5.*n*phi2-1.*n*phi3),1.); //<3>_{6n|5n,1n} | |
489d5531 | 11450 | } // end of for(Int_t i3=0;i3<nPrim;i3++) |
11451 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11452 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11453 | } // end of if(nPrim>=3) | |
11454 | ||
11455 | // 4-particle correlations: | |
11456 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) | |
11457 | { | |
11458 | for(Int_t i1=0;i1<nPrim;i1++) | |
11459 | { | |
11460 | aftsTrack=anEvent->GetTrack(i1); | |
11461 | if(!(aftsTrack->InRPSelection())) continue; | |
11462 | phi1=aftsTrack->Phi(); | |
11463 | for(Int_t i2=0;i2<nPrim;i2++) | |
11464 | { | |
11465 | if(i2==i1)continue; | |
11466 | aftsTrack=anEvent->GetTrack(i2); | |
11467 | if(!(aftsTrack->InRPSelection())) continue; | |
11468 | phi2=aftsTrack->Phi(); | |
11469 | for(Int_t i3=0;i3<nPrim;i3++) | |
11470 | { | |
11471 | if(i3==i1||i3==i2)continue; | |
11472 | aftsTrack=anEvent->GetTrack(i3); | |
11473 | if(!(aftsTrack->InRPSelection())) continue; | |
11474 | phi3=aftsTrack->Phi(); | |
11475 | for(Int_t i4=0;i4<nPrim;i4++) | |
11476 | { | |
11477 | if(i4==i1||i4==i2||i4==i3)continue; | |
11478 | aftsTrack=anEvent->GetTrack(i4); | |
11479 | if(!(aftsTrack->InRPSelection())) continue; | |
11480 | phi4=aftsTrack->Phi(); | |
11481 | if(nPrim==4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; | |
11482 | // fill the profile with 4-p correlations: | |
11483 | fIntFlowDirectCorrelations->Fill(10.,cos(n*phi1+n*phi2-n*phi3-n*phi4),1.); // <4>_{n,n|n,n} | |
11484 | fIntFlowDirectCorrelations->Fill(11.,cos(2.*n*phi1+n*phi2-2.*n*phi3-n*phi4),1.); // <4>_{2n,n|2n,n} | |
11485 | fIntFlowDirectCorrelations->Fill(12.,cos(2.*n*phi1+2*n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{2n,2n|2n,2n} | |
11486 | fIntFlowDirectCorrelations->Fill(13.,cos(3.*n*phi1-n*phi2-n*phi3-n*phi4),1.); // <4>_{3n|n,n,n} | |
11487 | fIntFlowDirectCorrelations->Fill(14.,cos(3.*n*phi1+n*phi2-3.*n*phi3-n*phi4),1.); // <4>_{3n,n|3n,n} | |
11488 | fIntFlowDirectCorrelations->Fill(15.,cos(3.*n*phi1+n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{3n,n|2n,2n} | |
11489 | fIntFlowDirectCorrelations->Fill(16.,cos(4.*n*phi1-2.*n*phi2-n*phi3-n*phi4),1.); // <4>_{4n|2n,n,n} | |
b84464d3 | 11490 | fIntFlowDirectCorrelations->Fill(32.,cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4)),1.); // <4>_{4n,2n|3n,3n} |
11491 | fIntFlowDirectCorrelations->Fill(41.5,cos(n*(6.*phi1-3.*phi2-2.*phi3-1.*phi4)),1.); // <4>_{6n|3n,2n,1n} | |
11492 | fIntFlowDirectCorrelations->Fill(42.5,cos(n*(3.*phi1+2.*phi2-3.*phi3-2.*phi4)),1.); // <4>_{3n,2n|3n,2n} | |
11493 | fIntFlowDirectCorrelations->Fill(43.5,cos(n*(4.*phi1+1.*phi2-3.*phi3-2.*phi4)),1.); // <4>_{4n,1n|3n,2n} | |
11494 | fIntFlowDirectCorrelations->Fill(44.5,cos(n*(3.*phi1+3.*phi2-3.*phi3-3.*phi4)),1.); // <4>_{3n,3n|3n,3n} | |
11495 | fIntFlowDirectCorrelations->Fill(45.5,cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4)),1.); // <4>_{4n,2n|3n,3n} | |
11496 | fIntFlowDirectCorrelations->Fill(46.5,cos(n*(5.*phi1+1.*phi2-3.*phi3-3.*phi4)),1.); // <4>_{5n,1n|3n,3n} | |
11497 | fIntFlowDirectCorrelations->Fill(47.5,cos(n*(4.*phi1+2.*phi2-4.*phi3-2.*phi4)),1.); // <4>_{4n,2n|4n,2n} | |
11498 | fIntFlowDirectCorrelations->Fill(48.5,cos(n*(5.*phi1+1.*phi2-4.*phi3-2.*phi4)),1.); // <4>_{5n,1n|4n,2n} | |
11499 | fIntFlowDirectCorrelations->Fill(49.5,cos(n*(5.*phi1-3.*phi2-1.*phi3-1.*phi4)),1.); // <4>_{5n|3n,1n,1n} | |
11500 | fIntFlowDirectCorrelations->Fill(50.5,cos(n*(5.*phi1-2.*phi2-2.*phi3-1.*phi4)),1.); // <4>_{5n|2n,2n,1n} | |
403e3389 | 11501 | fIntFlowDirectCorrelations->Fill(51.5,cos(n*(5.*phi1+1.*phi2-5.*phi3-1.*phi4)),1.); // <4>_{5n,1n|5n,1n} |
11502 | fIntFlowDirectCorrelations->Fill(58.5,cos(n*(6.*phi1-4.*phi2-1.*phi3-1.*phi4)),1.); // <4>_{6n|4n,1n,1n} | |
11503 | fIntFlowDirectCorrelations->Fill(59.5,cos(n*(6.*phi1-2.*phi2-2.*phi3-2.*phi4)),1.); // <4>_{6n|2n,2n,2n} | |
489d5531 | 11504 | } // end of for(Int_t i4=0;i4<nPrim;i4++) |
11505 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11506 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11507 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11508 | } // end of if(nPrim>=) | |
11509 | ||
11510 | // 5-particle correlations: | |
11511 | if(nPrim>=5 && nPrim<=fMaxAllowedMultiplicity) | |
11512 | { | |
11513 | for(Int_t i1=0;i1<nPrim;i1++) | |
11514 | { | |
11515 | aftsTrack=anEvent->GetTrack(i1); | |
11516 | if(!(aftsTrack->InRPSelection())) continue; | |
11517 | phi1=aftsTrack->Phi(); | |
11518 | for(Int_t i2=0;i2<nPrim;i2++) | |
11519 | { | |
11520 | if(i2==i1)continue; | |
11521 | aftsTrack=anEvent->GetTrack(i2); | |
11522 | if(!(aftsTrack->InRPSelection())) continue; | |
11523 | phi2=aftsTrack->Phi(); | |
11524 | for(Int_t i3=0;i3<nPrim;i3++) | |
11525 | { | |
11526 | if(i3==i1||i3==i2)continue; | |
11527 | aftsTrack=anEvent->GetTrack(i3); | |
11528 | if(!(aftsTrack->InRPSelection())) continue; | |
11529 | phi3=aftsTrack->Phi(); | |
11530 | for(Int_t i4=0;i4<nPrim;i4++) | |
11531 | { | |
11532 | if(i4==i1||i4==i2||i4==i3)continue; | |
11533 | aftsTrack=anEvent->GetTrack(i4); | |
11534 | if(!(aftsTrack->InRPSelection())) continue; | |
11535 | phi4=aftsTrack->Phi(); | |
11536 | for(Int_t i5=0;i5<nPrim;i5++) | |
11537 | { | |
11538 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
11539 | aftsTrack=anEvent->GetTrack(i5); | |
11540 | if(!(aftsTrack->InRPSelection())) continue; | |
11541 | phi5=aftsTrack->Phi(); | |
11542 | if(nPrim==5) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<"\r"<<flush; | |
11543 | // fill the profile with 5-p correlations: | |
b84464d3 | 11544 | fIntFlowDirectCorrelations->Fill(18.,cos(2.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5),1.); // <5>_{2n,n|n,n,n} |
11545 | fIntFlowDirectCorrelations->Fill(19.,cos(2.*n*phi1+2.*n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); // <5>_{2n,2n|2n,n,n} | |
11546 | fIntFlowDirectCorrelations->Fill(20.,cos(3.*n*phi1+n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); // <5>_{3n,n|2n,n,n} | |
11547 | fIntFlowDirectCorrelations->Fill(21.,cos(4.*n*phi1-n*phi2-n*phi3-n*phi4-n*phi5),1.); // <5>_{4n|n,n,n,n} | |
11548 | fIntFlowDirectCorrelations->Fill(33.,cos(3.*n*phi1+3.*n*phi2-2.*n*phi3-2.*n*phi4-2.*n*phi5),1.); // <5>_{3n,3n|2n,2n,2n} | |
11549 | fIntFlowDirectCorrelations->Fill(52.5,cos(3.*n*phi1+3.*n*phi2-3.*n*phi3-2.*n*phi4-1.*n*phi5),1.); // <5>_{3n,3n|3n,2n,1n} | |
11550 | fIntFlowDirectCorrelations->Fill(53.5,cos(4.*n*phi1+2.*n*phi2-3.*n*phi3-2.*n*phi4-1.*n*phi5),1.); // <5>_{4n,2n|3n,2n,1n} | |
11551 | fIntFlowDirectCorrelations->Fill(54.5,cos(3.*n*phi1+2.*n*phi2-3.*n*phi3-1.*n*phi4-1.*n*phi5),1.); // <5>_{3n,2n|3n,1n,1n} | |
11552 | fIntFlowDirectCorrelations->Fill(55.5,cos(3.*n*phi1+2.*n*phi2-2.*n*phi3-2.*n*phi4-1.*n*phi5),1.); // <5>_{3n,2n|2n,2n,1n} | |
11553 | fIntFlowDirectCorrelations->Fill(56.5,cos(5.*n*phi1+1.*n*phi2-3.*n*phi3-2.*n*phi4-1.*n*phi5),1.); // <5>_{5n,1n|3n,2n,1n} | |
403e3389 | 11554 | fIntFlowDirectCorrelations->Fill(60.5,cos(6.*n*phi1-2.*n*phi2-2.*n*phi3-1.*n*phi4-1.*n*phi5),1.); // <5>_{6n|2n,2n,1n,1n} |
11555 | fIntFlowDirectCorrelations->Fill(61.5,cos(4.*n*phi1+1.*n*phi2+1.*n*phi3-3.*n*phi4-3.*n*phi5),1.); // <5>_{4n,1n,1n|3n,3n} | |
489d5531 | 11556 | } // end of for(Int_t i5=0;i5<nPrim;i5++) |
11557 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
11558 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11559 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11560 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11561 | } // end of if(nPrim>=5) | |
11562 | ||
11563 | // 6-particle correlations: | |
11564 | if(nPrim>=6 && nPrim<=fMaxAllowedMultiplicity) | |
11565 | { | |
11566 | for(Int_t i1=0;i1<nPrim;i1++) | |
11567 | { | |
11568 | aftsTrack=anEvent->GetTrack(i1); | |
11569 | if(!(aftsTrack->InRPSelection())) continue; | |
11570 | phi1=aftsTrack->Phi(); | |
11571 | for(Int_t i2=0;i2<nPrim;i2++) | |
11572 | { | |
11573 | if(i2==i1)continue; | |
11574 | aftsTrack=anEvent->GetTrack(i2); | |
11575 | if(!(aftsTrack->InRPSelection())) continue; | |
11576 | phi2=aftsTrack->Phi(); | |
11577 | for(Int_t i3=0;i3<nPrim;i3++) | |
11578 | { | |
11579 | if(i3==i1||i3==i2)continue; | |
11580 | aftsTrack=anEvent->GetTrack(i3); | |
11581 | if(!(aftsTrack->InRPSelection())) continue; | |
11582 | phi3=aftsTrack->Phi(); | |
11583 | for(Int_t i4=0;i4<nPrim;i4++) | |
11584 | { | |
11585 | if(i4==i1||i4==i2||i4==i3)continue; | |
11586 | aftsTrack=anEvent->GetTrack(i4); | |
11587 | if(!(aftsTrack->InRPSelection())) continue; | |
11588 | phi4=aftsTrack->Phi(); | |
11589 | for(Int_t i5=0;i5<nPrim;i5++) | |
11590 | { | |
11591 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
11592 | aftsTrack=anEvent->GetTrack(i5); | |
11593 | if(!(aftsTrack->InRPSelection())) continue; | |
11594 | phi5=aftsTrack->Phi(); | |
11595 | for(Int_t i6=0;i6<nPrim;i6++) | |
11596 | { | |
11597 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
11598 | aftsTrack=anEvent->GetTrack(i6); | |
11599 | if(!(aftsTrack->InRPSelection())) continue; | |
11600 | phi6=aftsTrack->Phi(); | |
11601 | if(nPrim==6) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<"\r"<<flush; | |
11602 | // fill the profile with 6-p correlations: | |
403e3389 | 11603 | fIntFlowDirectCorrelations->Fill(23.,cos(n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6),1.); // <6>_{1n,1n,1n|1n,1n,1n} |
11604 | fIntFlowDirectCorrelations->Fill(24.,cos(2.*n*phi1+n*phi2+n*phi3-2.*n*phi4-n*phi5-n*phi6),1.); // <6>_{2n,1n,1n|2n,1n,1n} | |
11605 | fIntFlowDirectCorrelations->Fill(25.,cos(2.*n*phi1+2.*n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); // <6>_{2n,2n|1n,1n,1n,1n} | |
11606 | fIntFlowDirectCorrelations->Fill(26.,cos(3.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); // <6>_{3n,1n|1n,1n,1n,1n} | |
b84464d3 | 11607 | fIntFlowDirectCorrelations->Fill(57.5,cos(3.*n*phi1+2.*n*phi2+1.*n*phi3-3.*n*phi4-2.*n*phi5-1.*n*phi6),1.); // <6>_{3n,2n,1n|3n,2n,1n} |
403e3389 | 11608 | fIntFlowDirectCorrelations->Fill(62.5,cos(3.*n*phi1+3.*n*phi2-2.*n*phi3-2.*n*phi4-1.*n*phi5-1.*n*phi6),1.); // <6>_{3n,3n|2n,2n,1n,1n} |
489d5531 | 11609 | } // end of for(Int_t i6=0;i6<nPrim;i6++) |
11610 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
11611 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
11612 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11613 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11614 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11615 | } // end of if(nPrim>=6) | |
11616 | ||
11617 | // 7-particle correlations: | |
11618 | if(nPrim>=7 && nPrim<=fMaxAllowedMultiplicity) | |
11619 | { | |
11620 | for(Int_t i1=0;i1<nPrim;i1++) | |
11621 | { | |
11622 | aftsTrack=anEvent->GetTrack(i1); | |
11623 | if(!(aftsTrack->InRPSelection())) continue; | |
11624 | phi1=aftsTrack->Phi(); | |
11625 | for(Int_t i2=0;i2<nPrim;i2++) | |
11626 | { | |
11627 | if(i2==i1)continue; | |
11628 | aftsTrack=anEvent->GetTrack(i2); | |
11629 | if(!(aftsTrack->InRPSelection())) continue; | |
11630 | phi2=aftsTrack->Phi(); | |
11631 | for(Int_t i3=0;i3<nPrim;i3++) | |
11632 | { | |
11633 | if(i3==i1||i3==i2)continue; | |
11634 | aftsTrack=anEvent->GetTrack(i3); | |
11635 | if(!(aftsTrack->InRPSelection())) continue; | |
11636 | phi3=aftsTrack->Phi(); | |
11637 | for(Int_t i4=0;i4<nPrim;i4++) | |
11638 | { | |
11639 | if(i4==i1||i4==i2||i4==i3)continue; | |
11640 | aftsTrack=anEvent->GetTrack(i4); | |
11641 | if(!(aftsTrack->InRPSelection())) continue; | |
11642 | phi4=aftsTrack->Phi(); | |
11643 | for(Int_t i5=0;i5<nPrim;i5++) | |
11644 | { | |
11645 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
11646 | aftsTrack=anEvent->GetTrack(i5); | |
11647 | if(!(aftsTrack->InRPSelection())) continue; | |
11648 | phi5=aftsTrack->Phi(); | |
11649 | for(Int_t i6=0;i6<nPrim;i6++) | |
11650 | { | |
11651 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
11652 | aftsTrack=anEvent->GetTrack(i6); | |
11653 | if(!(aftsTrack->InRPSelection())) continue; | |
11654 | phi6=aftsTrack->Phi(); | |
11655 | for(Int_t i7=0;i7<nPrim;i7++) | |
11656 | { | |
11657 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; | |
11658 | aftsTrack=anEvent->GetTrack(i7); | |
11659 | if(!(aftsTrack->InRPSelection())) continue; | |
11660 | phi7=aftsTrack->Phi(); | |
11661 | if(nPrim==7) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<" "<<i7<<"\r"<<flush; | |
11662 | // fill the profile with 7-p correlation: | |
11663 | fIntFlowDirectCorrelations->Fill(28.,cos(2.*n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6-n*phi7),1.); // <7>_{2n,n,n|n,n,n,n} | |
11664 | } // end of for(Int_t i7=0;i7<nPrim;i7++) | |
11665 | } // end of for(Int_t i6=0;i6<nPrim;i6++) | |
11666 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
11667 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
11668 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11669 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11670 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11671 | } // end of if(nPrim>=7) | |
11672 | ||
11673 | // 8-particle correlations: | |
11674 | if(nPrim>=8 && nPrim<=fMaxAllowedMultiplicity) | |
11675 | { | |
11676 | for(Int_t i1=0;i1<nPrim;i1++) | |
11677 | { | |
11678 | aftsTrack=anEvent->GetTrack(i1); | |
11679 | if(!(aftsTrack->InRPSelection())) continue; | |
11680 | phi1=aftsTrack->Phi(); | |
11681 | for(Int_t i2=0;i2<nPrim;i2++) | |
11682 | { | |
11683 | if(i2==i1)continue; | |
11684 | aftsTrack=anEvent->GetTrack(i2); | |
11685 | if(!(aftsTrack->InRPSelection())) continue; | |
11686 | phi2=aftsTrack->Phi(); | |
11687 | for(Int_t i3=0;i3<nPrim;i3++) | |
11688 | { | |
11689 | if(i3==i1||i3==i2)continue; | |
11690 | aftsTrack=anEvent->GetTrack(i3); | |
11691 | if(!(aftsTrack->InRPSelection())) continue; | |
11692 | phi3=aftsTrack->Phi(); | |
11693 | for(Int_t i4=0;i4<nPrim;i4++) | |
11694 | { | |
11695 | if(i4==i1||i4==i2||i4==i3)continue; | |
11696 | aftsTrack=anEvent->GetTrack(i4); | |
11697 | if(!(aftsTrack->InRPSelection())) continue; | |
11698 | phi4=aftsTrack->Phi(); | |
11699 | for(Int_t i5=0;i5<nPrim;i5++) | |
11700 | { | |
11701 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
11702 | aftsTrack=anEvent->GetTrack(i5); | |
11703 | if(!(aftsTrack->InRPSelection())) continue; | |
11704 | phi5=aftsTrack->Phi(); | |
11705 | for(Int_t i6=0;i6<nPrim;i6++) | |
11706 | { | |
11707 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
11708 | aftsTrack=anEvent->GetTrack(i6); | |
11709 | if(!(aftsTrack->InRPSelection())) continue; | |
11710 | phi6=aftsTrack->Phi(); | |
11711 | for(Int_t i7=0;i7<nPrim;i7++) | |
11712 | { | |
11713 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; | |
11714 | aftsTrack=anEvent->GetTrack(i7); | |
11715 | if(!(aftsTrack->InRPSelection())) continue; | |
11716 | phi7=aftsTrack->Phi(); | |
11717 | for(Int_t i8=0;i8<nPrim;i8++) | |
11718 | { | |
11719 | if(i8==i1||i8==i2||i8==i3||i8==i4||i8==i5||i8==i6||i8==i7)continue; | |
11720 | aftsTrack=anEvent->GetTrack(i8); | |
11721 | if(!(aftsTrack->InRPSelection())) continue; | |
11722 | phi8=aftsTrack->Phi(); | |
11723 | cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<" "<<i7<<" "<<i8<<"\r"<<flush; | |
11724 | // fill the profile with 8-p correlation: | |
11725 | fIntFlowDirectCorrelations->Fill(30.,cos(n*phi1+n*phi2+n*phi3+n*phi4-n*phi5-n*phi6-n*phi7-n*phi8),1.); // <8>_{n,n,n,n|n,n,n,n} | |
11726 | } // end of for(Int_t i8=0;i8<nPrim;i8++) | |
11727 | } // end of for(Int_t i7=0;i7<nPrim;i7++) | |
11728 | } // end of for(Int_t i6=0;i6<nPrim;i6++) | |
11729 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
11730 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
11731 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11732 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11733 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11734 | } // end of if(nPrim>=8) | |
11735 | ||
11736 | cout<<endl; | |
11737 | ||
11738 | } // end of AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent) | |
11739 | ||
11740 | ||
11741 | //================================================================================================================================== | |
11742 | ||
11743 | ||
11744 | void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrelations() | |
11745 | { | |
11746 | // Cross-check results for multiparticle correlations needed for int. flow: results from Q-vectors vs results from nested loops. | |
11747 | ||
11748 | cout<<endl; | |
11749 | cout<<endl; | |
11750 | cout<<" *****************************************"<<endl; | |
11751 | cout<<" **** cross-checking the correlations ****"<<endl; | |
11752 | cout<<" **** for integrated flow ****"<<endl; | |
403e3389 | 11753 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 11754 | { |
11755 | cout<<" **** (particle weights not used) ****"<<endl; | |
11756 | } else | |
11757 | { | |
11758 | cout<<" **** (particle weights used) ****"<<endl; | |
11759 | } | |
11760 | cout<<" *****************************************"<<endl; | |
11761 | cout<<endl; | |
11762 | cout<<endl; | |
11763 | ||
403e3389 | 11764 | Int_t ciMax = 64; // to be improved (removed eventually when I calculate 6th and 8th order with particle weights) |
489d5531 | 11765 | |
403e3389 | 11766 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 11767 | { |
11768 | ciMax = 11; | |
11769 | } | |
11770 | ||
11771 | for(Int_t ci=1;ci<=ciMax;ci++) | |
11772 | { | |
11773 | if(strcmp((fIntFlowCorrelationsAllPro->GetXaxis())->GetBinLabel(ci), "") == 0) continue; // to be improved (access finalized histogram here) | |
11774 | cout<<(fIntFlowCorrelationsAllPro->GetXaxis())->GetBinLabel(ci)<<":"<<endl; // to be improved (access finalized histogram here) | |
11775 | cout<<"from Q-vectors = "<<fIntFlowCorrelationsAllPro->GetBinContent(ci)<<endl; // to be improved (access finalized histogram here) | |
11776 | cout<<"from nested loops = "<<fIntFlowDirectCorrelations->GetBinContent(ci)<<endl; | |
11777 | cout<<endl; | |
11778 | } | |
11779 | ||
11780 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrelations() | |
11781 | ||
489d5531 | 11782 | //================================================================================================================================ |
11783 | ||
489d5531 | 11784 | void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrectionTermsForNUA() |
11785 | { | |
11786 | // Cross-check results for corrections terms for non-uniform acceptance needed for int. flow: results from Q-vectors vs results from nested loops. | |
11787 | ||
11788 | cout<<endl; | |
11789 | cout<<endl; | |
11790 | cout<<" *********************************************"<<endl; | |
11791 | cout<<" **** cross-checking the correction terms ****"<<endl; | |
11792 | cout<<" **** for non-uniform acceptance relevant ****"<<endl; | |
11793 | cout<<" **** for integrated flow ****"<<endl; | |
403e3389 | 11794 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 11795 | { |
11796 | cout<<" **** (particle weights not used) ****"<<endl; | |
11797 | } else | |
11798 | { | |
11799 | cout<<" **** (particle weights used) ****"<<endl; | |
11800 | } | |
11801 | cout<<" *********************************************"<<endl; | |
11802 | cout<<endl; | |
11803 | cout<<endl; | |
11804 | ||
b92ea2b9 | 11805 | for(Int_t ci=1;ci<=4;ci++) // correction term index (to be improved - hardwired 4) |
489d5531 | 11806 | { |
11807 | for(Int_t sc=0;sc<2;sc++) // sin or cos term | |
11808 | { | |
11809 | if(strcmp((fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->GetBinLabel(ci), "") == 0) continue; // to be improved (access finalized histogram here) | |
11810 | cout<<(fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->GetBinLabel(ci)<<":"<<endl; // to be improved (access finalized histogram here) | |
11811 | cout<<"from Q-vectors = "<<fIntFlowCorrectionTermsForNUAPro[sc]->GetBinContent(ci)<<endl; // to be improved (access finalized histogram here) | |
11812 | cout<<"from nested loops = "<<fIntFlowDirectCorrectionTermsForNUA[sc]->GetBinContent(ci)<<endl; | |
11813 | cout<<endl; | |
11814 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos term | |
11815 | } // end of for(Int_t ci=1;ci<=10;ci++) // correction term index | |
11816 | ||
11817 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrectionTermsForNUA() | |
11818 | ||
489d5531 | 11819 | //================================================================================================================================ |
11820 | ||
0328db2d | 11821 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent) |
489d5531 | 11822 | { |
11823 | // Evaluate with nested loops multiparticle correlations for integrated flow (using the particle weights). | |
11824 | ||
11825 | // Results are stored in profile fIntFlowDirectCorrelations. | |
11826 | // Remark 1: When particle weights are used the binning of fIntFlowDirectCorrelations is organized as follows: | |
11827 | // | |
11828 | // 1st bin: <2>_{1n|1n} = two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))> | |
11829 | // 2nd bin: <2>_{2n|2n} = two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
11830 | // 3rd bin: <2>_{3n|3n} = two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
11831 | // 4th bin: <2>_{4n|4n} = two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
11832 | // 5th bin: ---- EMPTY ---- | |
11833 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
11834 | // 7th bin: <3>_{3n|2n,1n} = ... | |
11835 | // 8th bin: <3>_{4n|2n,2n} = ... | |
11836 | // 9th bin: <3>_{4n|3n,1n} = ... | |
11837 | // 10th bin: ---- EMPTY ---- | |
11838 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
11839 | // 12th bin: <4>_{2n,1n|2n,1n} = ... | |
11840 | // 13th bin: <4>_{2n,2n|2n,2n} = ... | |
11841 | // 14th bin: <4>_{3n|1n,1n,1n} = ... | |
11842 | // 15th bin: <4>_{3n,1n|3n,1n} = ... | |
11843 | // 16th bin: <4>_{3n,1n|2n,2n} = ... | |
11844 | // 17th bin: <4>_{4n|2n,1n,1n} = ... | |
11845 | // 18th bin: ---- EMPTY ---- | |
11846 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = ... | |
11847 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = ... | |
11848 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = ... | |
11849 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = ... | |
11850 | // 23rd bin: ---- EMPTY ---- | |
11851 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = ... | |
11852 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = ... | |
11853 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = ... | |
11854 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = ... | |
11855 | // 28th bin: ---- EMPTY ---- | |
11856 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = ... | |
11857 | // 30th bin: ---- EMPTY ---- | |
11858 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = ... | |
57340a27 | 11859 | |
489d5531 | 11860 | // Remark 2: When particle weights are used there are some extra correlations. They are stored in |
11861 | // fIntFlowExtraDirectCorrelations binning of which is organized as follows: | |
57340a27 | 11862 | |
489d5531 | 11863 | // 1st bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))> |
11864 | // 2nd bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
11865 | // ... | |
57340a27 | 11866 | |
489d5531 | 11867 | Int_t nPrim = anEvent->NumberOfTracks(); |
11868 | AliFlowTrackSimple *aftsTrack = NULL; | |
11869 | //Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; | |
11870 | //Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
11871 | Double_t phi1=0., phi2=0., phi3=0., phi4=0.; | |
11872 | Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1.; | |
11873 | Int_t n = fHarmonic; | |
11874 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 11875 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 11876 | cout<<endl; |
11877 | cout<<"Multiparticle correlations: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
11878 | if(dMult<2) | |
11879 | { | |
11880 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
11881 | } else if (dMult>fMaxAllowedMultiplicity) | |
11882 | { | |
11883 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
11884 | } else | |
11885 | { | |
11886 | cout<<"... evaluating nested loops (using particle weights) ..."<<endl; | |
11887 | } | |
11888 | ||
11889 | // 2-particle correlations: | |
11890 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
11891 | { | |
11892 | // 2 nested loops multiparticle correlations using particle weights: | |
11893 | for(Int_t i1=0;i1<nPrim;i1++) | |
11894 | { | |
11895 | aftsTrack=anEvent->GetTrack(i1); | |
11896 | if(!(aftsTrack->InRPSelection())) continue; | |
11897 | phi1=aftsTrack->Phi(); | |
11898 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
11899 | for(Int_t i2=0;i2<nPrim;i2++) | |
11900 | { | |
11901 | if(i2==i1)continue; | |
11902 | aftsTrack=anEvent->GetTrack(i2); | |
11903 | if(!(aftsTrack->InRPSelection())) continue; | |
11904 | phi2=aftsTrack->Phi(); | |
11905 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
11906 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
11907 | // 2-p correlations using particle weights: | |
11908 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),wPhi1*wPhi2); // <w1 w2 cos( n*(phi1-phi2))> | |
11909 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(1.5,cos(2.*n*(phi1-phi2)),pow(wPhi1,2)*pow(wPhi2,2)); // <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
11910 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(2.5,cos(3.*n*(phi1-phi2)),pow(wPhi1,3)*pow(wPhi2,3)); // <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
11911 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(3.5,cos(4.*n*(phi1-phi2)),pow(wPhi1,4)*pow(wPhi2,4)); // <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
11912 | // extra correlations: | |
11913 | // 2-p extra correlations (do not appear if particle weights are not used): | |
11914 | if(fUsePhiWeights) fIntFlowExtraDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),pow(wPhi1,3)*wPhi2); // <w1^3 w2 cos(n*(phi1-phi2))> | |
11915 | // ... | |
11916 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11917 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11918 | } // end of if(nPrim>=2) | |
11919 | ||
11920 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
57340a27 | 11921 | { |
489d5531 | 11922 | // 3 nested loops multiparticle correlations using particle weights: |
11923 | for(Int_t i1=0;i1<nPrim;i1++) | |
57340a27 | 11924 | { |
489d5531 | 11925 | aftsTrack=anEvent->GetTrack(i1); |
11926 | if(!(aftsTrack->InRPSelection())) continue; | |
11927 | phi1=aftsTrack->Phi(); | |
11928 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
11929 | for(Int_t i2=0;i2<nPrim;i2++) | |
11930 | { | |
11931 | if(i2==i1)continue; | |
11932 | aftsTrack=anEvent->GetTrack(i2); | |
11933 | if(!(aftsTrack->InRPSelection())) continue; | |
11934 | phi2=aftsTrack->Phi(); | |
11935 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
11936 | for(Int_t i3=0;i3<nPrim;i3++) | |
11937 | { | |
11938 | if(i3==i1||i3==i2)continue; | |
11939 | aftsTrack=anEvent->GetTrack(i3); | |
11940 | if(!(aftsTrack->InRPSelection())) continue; | |
11941 | phi3=aftsTrack->Phi(); | |
11942 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
11943 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
11944 | // 3-p correlations using particle weights: | |
11945 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(5.5,cos(2.*n*phi1-n*(phi2+phi3)),pow(wPhi1,2)*wPhi2*wPhi3); // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
11946 | // ... | |
11947 | // extra correlations: | |
11948 | // 2-p extra correlations (do not appear if particle weights are not used): | |
11949 | if(fUsePhiWeights) fIntFlowExtraDirectCorrelations->Fill(1.5,cos(n*(phi1-phi2)),wPhi1*wPhi2*pow(wPhi3,2)); // <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
11950 | // ... | |
11951 | // 3-p extra correlations (do not appear if particle weights are not used): | |
11952 | // ... | |
11953 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11954 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11955 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11956 | } // end of if(nPrim>=3) | |
57340a27 | 11957 | |
489d5531 | 11958 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) |
11959 | { | |
11960 | // 4 nested loops multiparticle correlations using particle weights: | |
11961 | for(Int_t i1=0;i1<nPrim;i1++) | |
11962 | { | |
11963 | aftsTrack=anEvent->GetTrack(i1); | |
11964 | if(!(aftsTrack->InRPSelection())) continue; | |
11965 | phi1=aftsTrack->Phi(); | |
11966 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
11967 | for(Int_t i2=0;i2<nPrim;i2++) | |
11968 | { | |
11969 | if(i2==i1)continue; | |
11970 | aftsTrack=anEvent->GetTrack(i2); | |
11971 | if(!(aftsTrack->InRPSelection())) continue; | |
11972 | phi2=aftsTrack->Phi(); | |
11973 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
11974 | for(Int_t i3=0;i3<nPrim;i3++) | |
11975 | { | |
11976 | if(i3==i1||i3==i2)continue; | |
11977 | aftsTrack=anEvent->GetTrack(i3); | |
11978 | if(!(aftsTrack->InRPSelection())) continue; | |
11979 | phi3=aftsTrack->Phi(); | |
11980 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
11981 | for(Int_t i4=0;i4<nPrim;i4++) | |
11982 | { | |
11983 | if(i4==i1||i4==i2||i4==i3)continue; | |
11984 | aftsTrack=anEvent->GetTrack(i4); | |
11985 | if(!(aftsTrack->InRPSelection())) continue; | |
11986 | phi4=aftsTrack->Phi(); | |
11987 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); | |
11988 | if(nPrim>=4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; // to be improved (replace eventually this if statement with if(nPrim==4)) | |
11989 | // 4-p correlations using particle weights: | |
11990 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(10.5,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); | |
11991 | // extra correlations: | |
11992 | // 2-p extra correlations (do not appear if particle weights are not used): | |
11993 | // ... | |
11994 | // 3-p extra correlations (do not appear if particle weights are not used): | |
11995 | // ... | |
11996 | // 4-p extra correlations (do not appear if particle weights are not used): | |
11997 | // ... | |
11998 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
11999 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
12000 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
12001 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
12002 | } // end of if(nPrim>=4) | |
57340a27 | 12003 | |
489d5531 | 12004 | cout<<endl; |
57340a27 | 12005 | |
489d5531 | 12006 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent) |
57340a27 | 12007 | |
489d5531 | 12008 | //================================================================================================================================ |
12009 | ||
489d5531 | 12010 | void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowExtraCorrelations() |
57340a27 | 12011 | { |
489d5531 | 12012 | // Cross-check results for extra multiparticle correlations needed for int. flow |
12013 | // which appear only when particle weights are used: results from Q-vectors vs results from nested loops. | |
57340a27 | 12014 | |
489d5531 | 12015 | cout<<endl; |
12016 | cout<<endl; | |
12017 | cout<<" ***********************************************"<<endl; | |
12018 | cout<<" **** cross-checking the extra correlations ****"<<endl; | |
12019 | cout<<" **** for integrated flow ****"<<endl; | |
12020 | cout<<" ***********************************************"<<endl; | |
12021 | cout<<endl; | |
12022 | cout<<endl; | |
12023 | ||
12024 | for(Int_t eci=1;eci<=2;eci++) // to be improved (increased eciMax eventually when I calculate 6th and 8th) | |
57340a27 | 12025 | { |
489d5531 | 12026 | if(strcmp((fIntFlowExtraCorrelationsPro->GetXaxis())->GetBinLabel(eci), "") == 0) continue; |
12027 | cout<<(fIntFlowExtraCorrelationsPro->GetXaxis())->GetBinLabel(eci)<<":"<<endl; | |
12028 | cout<<"from Q-vectors = "<<fIntFlowExtraCorrelationsPro->GetBinContent(eci)<<endl; | |
12029 | cout<<"from nested loops = "<<fIntFlowExtraDirectCorrelations->GetBinContent(eci)<<endl; | |
12030 | cout<<endl; | |
12031 | } | |
57340a27 | 12032 | |
489d5531 | 12033 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowExtraCorrelations() |
57340a27 | 12034 | |
489d5531 | 12035 | //================================================================================================================================ |
3b552efe | 12036 | |
0328db2d | 12037 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoops(AliFlowEventSimple * const anEvent) |
489d5531 | 12038 | { |
12039 | // Evaluate with nested loops correction terms for non-uniform acceptance relevant for NONAME integrated flow (to be improved (name)). | |
12040 | // | |
12041 | // Remark: Both sin and cos correction terms are calculated in this method. Sin terms are stored in fIntFlowDirectCorrectionTermsForNUA[0], | |
12042 | // and cos terms in fIntFlowDirectCorrectionTermsForNUA[1]. Binning of fIntFlowDirectCorrectionTermsForNUA[sc] is organized as follows | |
12043 | // (sc stands for either sin or cos): | |
12044 | ||
12045 | // 1st bin: <<sc(n*(phi1))>> | |
12046 | // 2nd bin: <<sc(n*(phi1+phi2))>> | |
12047 | // 3rd bin: <<sc(n*(phi1-phi2-phi3))>> | |
12048 | // 4th bin: <<sc(n*(2phi1-phi2))>> | |
12049 | ||
12050 | Int_t nPrim = anEvent->NumberOfTracks(); | |
12051 | AliFlowTrackSimple *aftsTrack = NULL; | |
12052 | Double_t phi1=0., phi2=0., phi3=0.; | |
12053 | Int_t n = fHarmonic; | |
12054 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 12055 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 12056 | cout<<endl; |
12057 | cout<<"Correction terms for non-uniform acceptance: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
12058 | if(dMult<1) | |
3b552efe | 12059 | { |
489d5531 | 12060 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; |
12061 | } else if (dMult>fMaxAllowedMultiplicity) | |
3b552efe | 12062 | { |
489d5531 | 12063 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; |
12064 | } else | |
12065 | { | |
12066 | cout<<"... evaluating nested loops (without using particle weights)..."<<endl; | |
12067 | } | |
12068 | ||
12069 | if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity) | |
12070 | { | |
12071 | // 1-particle correction terms for non-uniform acceptance: | |
12072 | for(Int_t i1=0;i1<nPrim;i1++) | |
12073 | { | |
12074 | aftsTrack=anEvent->GetTrack(i1); | |
12075 | if(!(aftsTrack->InRPSelection())) continue; | |
12076 | phi1=aftsTrack->Phi(); | |
12077 | if(nPrim==1) cout<<i1<<"\r"<<flush; | |
12078 | // sin terms: | |
12079 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(0.5,sin(n*phi1),1.); // <sin(n*phi1)> | |
12080 | // cos terms: | |
12081 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(0.5,cos(n*phi1),1.); // <cos(n*phi1)> | |
12082 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
12083 | } // end of if(nPrim>=1) | |
12084 | ||
12085 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
12086 | { | |
12087 | // 2-particle correction terms for non-uniform acceptance: | |
12088 | for(Int_t i1=0;i1<nPrim;i1++) | |
12089 | { | |
12090 | aftsTrack=anEvent->GetTrack(i1); | |
12091 | if(!(aftsTrack->InRPSelection())) continue; | |
12092 | phi1=aftsTrack->Phi(); | |
12093 | for(Int_t i2=0;i2<nPrim;i2++) | |
3b552efe | 12094 | { |
489d5531 | 12095 | if(i2==i1)continue; |
12096 | aftsTrack=anEvent->GetTrack(i2); | |
12097 | if(!(aftsTrack->InRPSelection())) continue; | |
12098 | phi2=aftsTrack->Phi(); | |
12099 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
12100 | // sin terms: | |
3b552efe | 12101 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(1.5,sin(n*(phi1+phi2)),1.); // <<sin(n*(phi1+phi2))>> |
489d5531 | 12102 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(3.5,sin(n*(2*phi1-phi2)),1.); // <<sin(n*(2*phi1-phi2))>> |
12103 | // cos terms: | |
3b552efe | 12104 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(1.5,cos(n*(phi1+phi2)),1.); // <<cos(n*(phi1+phi2))>> |
489d5531 | 12105 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(3.5,cos(n*(2*phi1-phi2)),1.); // <<cos(n*(2*phi1-phi2))>> |
12106 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
12107 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
12108 | } // end of if(nPrim>=2) | |
12109 | ||
12110 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
12111 | { | |
12112 | // 3-particle correction terms for non-uniform acceptance: | |
12113 | for(Int_t i1=0;i1<nPrim;i1++) | |
12114 | { | |
12115 | aftsTrack=anEvent->GetTrack(i1); | |
12116 | if(!(aftsTrack->InRPSelection())) continue; | |
12117 | phi1=aftsTrack->Phi(); | |
12118 | for(Int_t i2=0;i2<nPrim;i2++) | |
12119 | { | |
12120 | if(i2==i1)continue; | |
12121 | aftsTrack=anEvent->GetTrack(i2); | |
12122 | if(!(aftsTrack->InRPSelection())) continue; | |
12123 | phi2=aftsTrack->Phi(); | |
12124 | for(Int_t i3=0;i3<nPrim;i3++) | |
12125 | { | |
12126 | if(i3==i1||i3==i2)continue; | |
12127 | aftsTrack=anEvent->GetTrack(i3); | |
12128 | if(!(aftsTrack->InRPSelection())) continue; | |
12129 | phi3=aftsTrack->Phi(); | |
12130 | if(nPrim>=3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; // to be improved (eventually I will change this if statement) | |
12131 | // sin terms: | |
12132 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(2.5,sin(n*(phi1-phi2-phi3)),1.); // <<sin(n*(phi1-phi2-phi3))>> | |
12133 | // cos terms: | |
12134 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(2.5,cos(n*(phi1-phi2-phi3)),1.); // <<cos(n*(phi1-phi2-phi3))>> | |
12135 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
12136 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
12137 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
12138 | } // end of if(nPrim>=3) | |
12139 | ||
12140 | cout<<endl; | |
12141 | } | |
64e500e3 | 12142 | |
489d5531 | 12143 | //================================================================================================================================ |
64e500e3 | 12144 | |
0328db2d | 12145 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 12146 | { |
12147 | // Evaluate reduced correlations with nested loops without using the particle weights. | |
12148 | ||
12149 | // Remark 1: Reduced correlations are evaluated in pt bin number fCrossCheckInPtBinNo and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
12150 | // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrelations[t][pe][ci], where indices runs as follows: | |
12151 | // [0=RP,1=POI][0=Pt,1=Eta][0=<2'>,1=<4'>,2=<6'>,3=<8'>] | |
12152 | // Remark 3: <2'> = <cos(n*(psi1-phi2))> | |
12153 | // <4'> = <cos(n*(psi1+phi2-phi3-phi4))> | |
12154 | // ... | |
12155 | ||
2a98ceb8 | 12156 | Int_t typeFlag = 0; |
12157 | Int_t ptEtaFlag = 0; | |
489d5531 | 12158 | if(type == "RP") |
12159 | { | |
12160 | typeFlag = 0; | |
12161 | } else if(type == "POI") | |
12162 | { | |
12163 | typeFlag = 1; | |
12164 | } | |
12165 | if(ptOrEta == "Pt") | |
12166 | { | |
12167 | ptEtaFlag = 0; | |
12168 | } else if(ptOrEta == "Eta") | |
12169 | { | |
12170 | ptEtaFlag = 1; | |
12171 | } | |
12172 | // shortcuts: | |
12173 | Int_t t = typeFlag; | |
12174 | Int_t pe = ptEtaFlag; | |
12175 | ||
12176 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12177 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12178 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
12179 | ||
12180 | Int_t nPrim = anEvent->NumberOfTracks(); | |
12181 | AliFlowTrackSimple *aftsTrack = NULL; | |
12182 | ||
12183 | Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
12184 | ||
3b552efe | 12185 | Int_t n = fHarmonic; |
489d5531 | 12186 | |
12187 | // 2'-particle correlations: | |
12188 | for(Int_t i1=0;i1<nPrim;i1++) | |
12189 | { | |
12190 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12191 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12192 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12193 | { |
12194 | if(ptOrEta == "Pt") | |
12195 | { | |
12196 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12197 | } else if (ptOrEta == "Eta") | |
12198 | { | |
12199 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12200 | } |
12201 | } else // this is diff flow of RPs | |
12202 | { | |
489d5531 | 12203 | if(ptOrEta == "Pt") |
12204 | { | |
12205 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12206 | } else if (ptOrEta == "Eta") | |
12207 | { | |
12208 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12209 | } |
12210 | } | |
489d5531 | 12211 | |
12212 | psi1=aftsTrack->Phi(); | |
12213 | for(Int_t i2=0;i2<nPrim;i2++) | |
12214 | { | |
12215 | if(i2==i1)continue; | |
12216 | aftsTrack=anEvent->GetTrack(i2); | |
12217 | // RP condition (!(first) particle in the correlator must be RP): | |
12218 | if(!(aftsTrack->InRPSelection()))continue; | |
12219 | phi2=aftsTrack->Phi(); | |
12220 | // 2'-particle correlations: | |
12221 | fDiffFlowDirectCorrelations[t][pe][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(1.*n*(psi1-phi2)),1.); // <cos(n*(psi1-phi2)) | |
12222 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12223 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12224 | ||
12225 | /* | |
12226 | ||
12227 | // 3'-particle correlations: | |
12228 | for(Int_t i1=0;i1<nPrim;i1++) | |
12229 | { | |
12230 | aftsTrack=anEvent->GetTrack(i1); | |
12231 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
12232 | if(ptOrEta == "Pt") | |
12233 | { | |
12234 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12235 | } else if (ptOrEta == "Eta") | |
12236 | { | |
12237 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12238 | } | |
12239 | psi1=aftsTrack->Phi(); | |
12240 | for(Int_t i2=0;i2<nPrim;i2++) | |
12241 | { | |
12242 | if(i2==i1)continue; | |
12243 | aftsTrack=anEvent->GetTrack(i2); | |
12244 | // RP condition (!(first) particle in the correlator must be RP): | |
12245 | if(!(aftsTrack->InRPSelection())) continue; | |
12246 | phi2=aftsTrack->Phi(); | |
12247 | for(Int_t i3=0;i3<nPrim;i3++) | |
12248 | { | |
12249 | if(i3==i1||i3==i2)continue; | |
12250 | aftsTrack=anEvent->GetTrack(i3); | |
12251 | // RP condition (!(first) particle in the correlator must be RP): | |
12252 | if(!(aftsTrack->InRPSelection())) continue; | |
12253 | phi3=aftsTrack->Phi(); | |
12254 | // to be improved : where to store it? ->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(2.*phi1-phi2-phi3)),1.); // <w1 w2 w3 cos(n(2psi1-phi2-phi3))> | |
12255 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
12256 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12257 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12258 | ||
12259 | */ | |
12260 | ||
12261 | // 4'-particle correlations: | |
12262 | for(Int_t i1=0;i1<nPrim;i1++) | |
12263 | { | |
12264 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12265 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12266 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12267 | { |
12268 | if(ptOrEta == "Pt") | |
12269 | { | |
12270 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12271 | } else if (ptOrEta == "Eta") | |
12272 | { | |
12273 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12274 | } |
12275 | } else // this is diff flow of RPs | |
12276 | { | |
489d5531 | 12277 | if(ptOrEta == "Pt") |
12278 | { | |
12279 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12280 | } else if (ptOrEta == "Eta") | |
12281 | { | |
12282 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12283 | } |
12284 | } | |
489d5531 | 12285 | |
12286 | psi1=aftsTrack->Phi(); | |
12287 | for(Int_t i2=0;i2<nPrim;i2++) | |
12288 | { | |
12289 | if(i2==i1) continue; | |
12290 | aftsTrack=anEvent->GetTrack(i2); | |
12291 | // RP condition (!(first) particle in the correlator must be RP): | |
12292 | if(!(aftsTrack->InRPSelection())) continue; | |
12293 | phi2=aftsTrack->Phi(); | |
12294 | for(Int_t i3=0;i3<nPrim;i3++) | |
12295 | { | |
12296 | if(i3==i1||i3==i2) continue; | |
12297 | aftsTrack=anEvent->GetTrack(i3); | |
12298 | // RP condition (!(first) particle in the correlator must be RP): | |
12299 | if(!(aftsTrack->InRPSelection())) continue; | |
12300 | phi3=aftsTrack->Phi(); | |
12301 | for(Int_t i4=0;i4<nPrim;i4++) | |
12302 | { | |
12303 | if(i4==i1||i4==i2||i4==i3) continue; | |
12304 | aftsTrack=anEvent->GetTrack(i4); | |
12305 | // RP condition (!(first) particle in the correlator must be RP): | |
12306 | if(!(aftsTrack->InRPSelection())) continue; | |
12307 | phi4=aftsTrack->Phi(); | |
12308 | // 4'-particle correlations: | |
12309 | fDiffFlowDirectCorrelations[t][pe][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3-phi4)),1.); // <cos(n(psi1+phi2-phi3-phi4))> | |
12310 | }//end of for(Int_t i4=0;i4<nPrim;i4++) | |
12311 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
12312 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12313 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12314 | ||
12315 | // count # of RPs and POIs in selected pt and eta bins for cross-checkings: | |
3b552efe | 12316 | for(Int_t i=0;i<nPrim;i++) |
12317 | { | |
12318 | aftsTrack=anEvent->GetTrack(i); | |
12319 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
12320 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12321 | { |
12322 | if(ptOrEta == "Pt") | |
12323 | { | |
12324 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12325 | } else if (ptOrEta == "Eta") | |
12326 | { | |
12327 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12328 | } |
12329 | } else // this is diff flow of RPs | |
12330 | { | |
489d5531 | 12331 | if(ptOrEta == "Pt") |
12332 | { | |
12333 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12334 | } else if (ptOrEta == "Eta") | |
12335 | { | |
12336 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12337 | } |
12338 | } | |
12339 | if(t==1)t++; | |
12340 | fNoOfParticlesInBin->Fill(t+pe+0.5); | |
489d5531 | 12341 | } |
12342 | ||
12343 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
12344 | ||
489d5531 | 12345 | //================================================================================================================================ |
12346 | ||
64e500e3 | 12347 | void AliFlowAnalysisWithQCumulants::EvaluateOtherDiffCorrelatorsWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
12348 | { | |
12349 | // Evaluate other differential correlators with nested loops without using the particle weights. | |
12350 | ||
12351 | // Remark 1: Other differential correlators are evaluated in pt bin number fCrossCheckInPtBinNo | |
12352 | // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
12353 | // Remark 2: Results are stored in 1 bin profiles fOtherDirectDiffCorrelators[t][pe][sc][ci], where indices runs as follows: | |
12354 | // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms][ci = correlator index] | |
12355 | // Remark 3: Correlator index 'ci' runs as follows: | |
12356 | // 0: <exp(n*(psi1-3phi2+2phi3))> (Teaney-Yan correlator) | |
12357 | ||
12358 | Int_t typeFlag = 0; | |
12359 | Int_t ptEtaFlag = 0; | |
12360 | if(type == "RP") | |
12361 | { | |
12362 | typeFlag = 0; | |
12363 | } else if(type == "POI") | |
12364 | { | |
12365 | typeFlag = 1; | |
12366 | } | |
12367 | if(ptOrEta == "Pt") | |
12368 | { | |
12369 | ptEtaFlag = 0; | |
12370 | } else if(ptOrEta == "Eta") | |
12371 | { | |
12372 | ptEtaFlag = 1; | |
12373 | } | |
12374 | // shortcuts: | |
12375 | Int_t t = typeFlag; | |
12376 | Int_t pe = ptEtaFlag; | |
12377 | ||
12378 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12379 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12380 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
12381 | ||
12382 | Int_t nPrim = anEvent->NumberOfTracks(); | |
12383 | AliFlowTrackSimple *aftsTrack = NULL; | |
12384 | ||
12385 | Double_t psi1=0., phi2=0., phi3=0.; | |
12386 | ||
12387 | Int_t n = fHarmonic; | |
12388 | ||
12389 | // 3-p correlators: | |
12390 | for(Int_t i1=0;i1<nPrim;i1++) | |
12391 | { | |
12392 | aftsTrack=anEvent->GetTrack(i1); | |
12393 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
12394 | if(typeFlag==1) // this is diff flow of POIs | |
12395 | { | |
12396 | if(ptOrEta == "Pt") | |
12397 | { | |
12398 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12399 | } else if (ptOrEta == "Eta") | |
12400 | { | |
12401 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12402 | } | |
12403 | } else // this is diff flow of RPs | |
12404 | { | |
12405 | if(ptOrEta == "Pt") | |
12406 | { | |
12407 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12408 | } else if (ptOrEta == "Eta") | |
12409 | { | |
12410 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12411 | } | |
12412 | } | |
12413 | psi1=aftsTrack->Phi(); | |
12414 | for(Int_t i2=0;i2<nPrim;i2++) | |
12415 | { | |
12416 | if(i2==i1) continue; | |
12417 | aftsTrack=anEvent->GetTrack(i2); | |
12418 | // RP condition (!(first) particle in the correlator must be RP): | |
12419 | if(!(aftsTrack->InRPSelection())) continue; | |
12420 | phi2=aftsTrack->Phi(); | |
12421 | for(Int_t i3=0;i3<nPrim;i3++) | |
12422 | { | |
12423 | if(i3==i1||i3==i2) continue; | |
12424 | aftsTrack=anEvent->GetTrack(i3); | |
12425 | // RP condition (!(first) particle in the correlator must be RP): | |
12426 | if(!(aftsTrack->InRPSelection())) continue; | |
12427 | phi3=aftsTrack->Phi(); | |
12428 | // Fill 3-p correlators: | |
12429 | fOtherDirectDiffCorrelators[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-3.*phi2+2.*phi3)),1.); // <cos(n(psi1-3.*phi2+2.*phi3))> | |
12430 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
12431 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12432 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12433 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateOtherDiffCorrelatorsWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) | |
12434 | ||
12435 | //================================================================================================================================ | |
489d5531 | 12436 | |
12437 | void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrelations(TString type, TString ptOrEta) | |
12438 | { | |
12439 | // Compare correlations needed for diff. flow calculated with nested loops and those calculated from Q-vectors | |
12440 | ||
2a98ceb8 | 12441 | Int_t typeFlag = 0; |
12442 | Int_t ptEtaFlag = 0; | |
489d5531 | 12443 | if(type == "RP") |
12444 | { | |
12445 | typeFlag = 0; | |
12446 | } else if(type == "POI") | |
12447 | { | |
12448 | typeFlag = 1; | |
12449 | } | |
12450 | if(ptOrEta == "Pt") | |
12451 | { | |
12452 | ptEtaFlag = 0; | |
12453 | } else if(ptOrEta == "Eta") | |
12454 | { | |
12455 | ptEtaFlag = 1; | |
12456 | } | |
12457 | // shortcuts: | |
12458 | Int_t t = typeFlag; | |
12459 | Int_t pe = ptEtaFlag; | |
12460 | ||
12461 | TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
12462 | TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
12463 | TString reducedCorrelations[4] = {"<<cos(n(psi1-phi2))>>","<<cos(n(psi1+phi2-phi3-phi4))>>","",""}; // to be improved (access this from pro or hist) | |
12464 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12465 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12466 | ||
12467 | Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo}; | |
12468 | ||
12469 | ||
12470 | cout<<endl; | |
12471 | cout<<" *****************************************"<<endl; | |
12472 | cout<<" **** cross-checking the correlations ****"<<endl; | |
12473 | cout<<" **** for differential flow ("<<rpORpoiString[t]<<") ****"<<endl; | |
403e3389 | 12474 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 12475 | { |
12476 | cout<<" **** (particle weights not used) ****"<<endl; | |
12477 | } else | |
12478 | { | |
12479 | cout<<" **** (particle weights used) ****"<<endl; | |
12480 | } | |
12481 | cout<<" *****************************************"<<endl; | |
12482 | cout<<endl; | |
12483 | cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl; | |
12484 | cout<<endl; | |
12485 | ||
12486 | for(Int_t rci=0;rci<2;rci++) // to be improved (calculate 6th and 8th order) | |
12487 | { | |
12488 | cout<<" "<<reducedCorrelations[rci].Data()<<":"<<endl; | |
12489 | cout<<" from Q-vectors = "<<fDiffFlowCorrelationsPro[t][pe][rci]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl; | |
12490 | cout<<" from nested loops = "<<fDiffFlowDirectCorrelations[t][pe][rci]->GetBinContent(1)<<endl; | |
12491 | cout<<endl; | |
12492 | } // end of for(Int_t rci=0;rci<4;rci++) | |
12493 | ||
12494 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrelations(TString type, TString ptOrEta) | |
12495 | ||
3b552efe | 12496 | //================================================================================================================================ |
12497 | ||
64e500e3 | 12498 | void AliFlowAnalysisWithQCumulants::CrossCheckOtherDiffCorrelators(TString type, TString ptOrEta) |
12499 | { | |
12500 | // Compare correlations needed for diff. flow calculated with nested loops and those calculated from Q-vectors | |
12501 | ||
12502 | Int_t typeFlag = 0; | |
12503 | Int_t ptEtaFlag = 0; | |
12504 | if(type == "RP") | |
12505 | { | |
12506 | typeFlag = 0; | |
12507 | } else if(type == "POI") | |
12508 | { | |
12509 | typeFlag = 1; | |
12510 | } | |
12511 | if(ptOrEta == "Pt") | |
12512 | { | |
12513 | ptEtaFlag = 0; | |
12514 | } else if(ptOrEta == "Eta") | |
12515 | { | |
12516 | ptEtaFlag = 1; | |
12517 | } | |
12518 | // shortcuts: | |
12519 | Int_t t = typeFlag; | |
12520 | Int_t pe = ptEtaFlag; | |
12521 | ||
12522 | TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
12523 | TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
12524 | TString otherCorrelators[1] = {"<<cos(n(psi1-3phi2+2phi3))>>"}; // to be improved (access this from pro or hist) | |
12525 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12526 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12527 | ||
12528 | Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo}; | |
12529 | ||
12530 | cout<<endl; | |
12531 | cout<<" *****************************************"<<endl; | |
12532 | cout<<" **** cross-checking the other ****"<<endl; | |
12533 | cout<<" **** diff. correlators ("<<rpORpoiString[t]<<") ****"<<endl; | |
403e3389 | 12534 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
64e500e3 | 12535 | { |
12536 | cout<<" **** (particle weights not used) ****"<<endl; | |
12537 | } else | |
12538 | { | |
12539 | cout<<" **** (particle weights used) ****"<<endl; | |
12540 | } | |
12541 | cout<<" *****************************************"<<endl; | |
12542 | cout<<endl; | |
12543 | cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl; | |
12544 | cout<<endl; | |
12545 | ||
12546 | for(Int_t ci=0;ci<1;ci++) | |
12547 | { | |
12548 | cout<<" "<<otherCorrelators[ci].Data()<<":"<<endl; | |
12549 | cout<<" from Q-vectors = "<<fOtherDiffCorrelators[t][pe][1][ci]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl; | |
12550 | cout<<" from nested loops = "<<fOtherDirectDiffCorrelators[t][pe][1][ci]->GetBinContent(1)<<endl; | |
12551 | cout<<endl; | |
12552 | } // end of for(Int_t ci=0;ci<1;ci++) | |
12553 | ||
12554 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckOtherDiffCorrelators(TString type, TString ptOrEta) | |
12555 | ||
12556 | //================================================================================================================================ | |
12557 | ||
489d5531 | 12558 | void AliFlowAnalysisWithQCumulants::PrintNumberOfParticlesInSelectedBin() |
3b552efe | 12559 | { |
12560 | // Print on the screen number of RPs and POIs in selected pt and eta bin for cross checkings. | |
12561 | ||
12562 | cout<<endl; | |
12563 | cout<<"Number of RPs in selected pt bin = "<<fNoOfParticlesInBin->GetBinContent(1)<<endl; | |
12564 | cout<<"Number of RPs in selected eta bin = "<<fNoOfParticlesInBin->GetBinContent(2)<<endl; | |
12565 | cout<<"Number of POIs in selected pt bin = "<<fNoOfParticlesInBin->GetBinContent(3)<<endl; | |
12566 | cout<<"Number of POIs in selected eta bin = "<<fNoOfParticlesInBin->GetBinContent(4)<<endl; | |
12567 | ||
489d5531 | 12568 | } // end of void AliFlowAnalysisWithQCumulants::PrintNumberOfParticlesInSelectedBin() |
12569 | ||
3b552efe | 12570 | //================================================================================================================================ |
12571 | ||
0328db2d | 12572 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 12573 | { |
12574 | // Evaluate reduced correlations with nested loops without using the particle weights. | |
12575 | ||
12576 | // Remark 1: Reduced correlations are evaluated in pt bin number fCrossCheckInPtBinNo and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
12577 | // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrelations[t][pe][ci], where indices runs as follows: | |
12578 | // [0=RP,1=POI][0=Pt,1=Eta][0=<2'>,1=<4'>,2=<6'>,3=<8'>] | |
12579 | // Remark 3: <2'> = <w2 cos(n*(psi1-phi2))> | |
12580 | // <4'> = <w2 w3 w4 cos(n*(psi1+phi2-phi3-phi4))> | |
12581 | // ... | |
12582 | ||
2a98ceb8 | 12583 | Int_t typeFlag = 0; |
12584 | Int_t ptEtaFlag = 0; | |
489d5531 | 12585 | if(type == "RP") |
12586 | { | |
12587 | typeFlag = 0; | |
12588 | } else if(type == "POI") | |
12589 | { | |
12590 | typeFlag = 1; | |
12591 | } | |
12592 | if(ptOrEta == "Pt") | |
12593 | { | |
12594 | ptEtaFlag = 0; | |
12595 | } else if(ptOrEta == "Eta") | |
12596 | { | |
12597 | ptEtaFlag = 1; | |
12598 | } | |
12599 | // shortcuts: | |
12600 | Int_t t = typeFlag; | |
12601 | Int_t pe = ptEtaFlag; | |
12602 | ||
12603 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12604 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12605 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
12606 | ||
12607 | Int_t nPrim = anEvent->NumberOfTracks(); | |
12608 | AliFlowTrackSimple *aftsTrack = NULL; | |
12609 | ||
12610 | Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
12611 | Double_t wPhi2=1., wPhi3=1., wPhi4=1.;// wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
12612 | ||
12613 | Int_t n = fHarmonic; | |
12614 | ||
12615 | // 2'-particle correlations: | |
12616 | for(Int_t i1=0;i1<nPrim;i1++) | |
12617 | { | |
12618 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12619 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12620 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12621 | { |
12622 | if(ptOrEta == "Pt") | |
12623 | { | |
12624 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12625 | } else if (ptOrEta == "Eta") | |
12626 | { | |
12627 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12628 | } |
12629 | } else // this is diff flow of RPs | |
12630 | { | |
489d5531 | 12631 | if(ptOrEta == "Pt") |
12632 | { | |
12633 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12634 | } else if (ptOrEta == "Eta") | |
12635 | { | |
12636 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12637 | } |
489d5531 | 12638 | } |
12639 | psi1=aftsTrack->Phi(); | |
12640 | for(Int_t i2=0;i2<nPrim;i2++) | |
12641 | { | |
12642 | if(i2==i1) continue; | |
12643 | aftsTrack=anEvent->GetTrack(i2); | |
12644 | // RP condition (!(first) particle in the correlator must be RP): | |
12645 | if(!(aftsTrack->InRPSelection())) continue; | |
12646 | phi2=aftsTrack->Phi(); | |
12647 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
12648 | // 2'-particle correlations: | |
12649 | fDiffFlowDirectCorrelations[t][pe][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(1.*n*(psi1-phi2)),wPhi2); // <w2 cos(n*(psi1-phi2)) | |
12650 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12651 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12652 | ||
12653 | // 4'-particle correlations: | |
12654 | for(Int_t i1=0;i1<nPrim;i1++) | |
12655 | { | |
12656 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12657 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12658 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12659 | { |
12660 | if(ptOrEta == "Pt") | |
12661 | { | |
12662 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12663 | } else if (ptOrEta == "Eta") | |
12664 | { | |
12665 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12666 | } |
12667 | } else // this is diff flow of RPs | |
12668 | { | |
489d5531 | 12669 | if(ptOrEta == "Pt") |
12670 | { | |
12671 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12672 | } else if (ptOrEta == "Eta") | |
12673 | { | |
12674 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12675 | } |
489d5531 | 12676 | } |
12677 | psi1=aftsTrack->Phi(); | |
12678 | for(Int_t i2=0;i2<nPrim;i2++) | |
12679 | { | |
12680 | if(i2==i1) continue; | |
12681 | aftsTrack=anEvent->GetTrack(i2); | |
12682 | // RP condition (!(first) particle in the correlator must be RP): | |
12683 | if(!(aftsTrack->InRPSelection())) continue; | |
12684 | phi2=aftsTrack->Phi(); | |
12685 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
12686 | for(Int_t i3=0;i3<nPrim;i3++) | |
12687 | { | |
12688 | if(i3==i1||i3==i2) continue; | |
12689 | aftsTrack=anEvent->GetTrack(i3); | |
12690 | // RP condition (!(first) particle in the correlator must be RP): | |
12691 | if(!(aftsTrack->InRPSelection())) continue; | |
12692 | phi3=aftsTrack->Phi(); | |
12693 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
12694 | for(Int_t i4=0;i4<nPrim;i4++) | |
12695 | { | |
12696 | if(i4==i1||i4==i2||i4==i3) continue; | |
12697 | aftsTrack=anEvent->GetTrack(i4); | |
12698 | // RP condition (!(first) particle in the correlator must be RP): | |
12699 | if(!(aftsTrack->InRPSelection())) continue; | |
12700 | phi4=aftsTrack->Phi(); | |
12701 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); | |
12702 | // 4'-particle correlations <w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))>: | |
12703 | fDiffFlowDirectCorrelations[t][pe][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3-phi4)),wPhi2*wPhi3*wPhi4); | |
12704 | }//end of for(Int_t i4=0;i4<nPrim;i4++) | |
12705 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
12706 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12707 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12708 | ||
12709 | // count # of RPs and POIs in selected pt and eta bins for cross-checkings: (to be improved - moved to dedicated method) | |
3b552efe | 12710 | for(Int_t i=0;i<nPrim;i++) |
12711 | { | |
489d5531 | 12712 | aftsTrack=anEvent->GetTrack(i); |
12713 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
12714 | if(typeFlag==1) // this is diff flow of POIs | |
12715 | { | |
12716 | if(ptOrEta == "Pt") | |
12717 | { | |
12718 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12719 | } else if (ptOrEta == "Eta") | |
12720 | { | |
12721 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12722 | } | |
12723 | } else // this is diff flow of RPs | |
12724 | { | |
12725 | if(ptOrEta == "Pt") | |
12726 | { | |
12727 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12728 | } else if (ptOrEta == "Eta") | |
12729 | { | |
12730 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12731 | } | |
12732 | } | |
12733 | if(t==1)t++; | |
12734 | fNoOfParticlesInBin->Fill(t+pe+0.5); | |
12735 | } | |
12736 | ||
12737 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
12738 | ||
489d5531 | 12739 | //================================================================================================================================ |
12740 | ||
0328db2d | 12741 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 12742 | { |
12743 | // Evaluate with nested loops correction terms for non-uniform acceptance (both sin and cos terms) relevant for differential flow. | |
12744 | ||
12745 | // Remark 1: Reduced correction terms for non-uniform acceptance are evaluated in pt bin number fCrossCheckInPtBinNo | |
12746 | // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
12747 | // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrections[t][pe][sc][cti], where first three indices runs as: | |
12748 | // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms], whilst the cti (correction term index) runs as follows: | |
12749 | // cti: | |
12750 | // 0: <<sc n(psi1)>> | |
12751 | // 1: <<sc n(psi1+phi2)>> | |
12752 | // 2: <<sc n(psi1+phi2-phi3)>> | |
12753 | // 3: <<sc n(psi1-phi2-phi3)>> | |
12754 | // 4: | |
12755 | // 5: | |
12756 | // 6: | |
12757 | ||
2a98ceb8 | 12758 | Int_t typeFlag = 0; |
12759 | Int_t ptEtaFlag = 0; | |
489d5531 | 12760 | if(type == "RP") |
12761 | { | |
12762 | typeFlag = 0; | |
12763 | } else if(type == "POI") | |
12764 | { | |
12765 | typeFlag = 1; | |
12766 | } | |
12767 | if(ptOrEta == "Pt") | |
12768 | { | |
12769 | ptEtaFlag = 0; | |
12770 | } else if(ptOrEta == "Eta") | |
12771 | { | |
12772 | ptEtaFlag = 1; | |
12773 | } | |
12774 | // shortcuts: | |
12775 | Int_t t = typeFlag; | |
12776 | Int_t pe = ptEtaFlag; | |
12777 | ||
12778 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12779 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12780 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
12781 | ||
12782 | Int_t nPrim = anEvent->NumberOfTracks(); | |
12783 | AliFlowTrackSimple *aftsTrack = NULL; | |
12784 | ||
12785 | Double_t psi1=0., phi2=0., phi3=0.;// phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
12786 | ||
12787 | Int_t n = fHarmonic; | |
12788 | ||
12789 | // 1-particle correction terms: | |
12790 | for(Int_t i1=0;i1<nPrim;i1++) | |
12791 | { | |
12792 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12793 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12794 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12795 | { |
12796 | if(ptOrEta == "Pt") | |
12797 | { | |
12798 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12799 | } else if (ptOrEta == "Eta") | |
12800 | { | |
12801 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12802 | } |
12803 | } else // this is diff flow of RPs | |
12804 | { | |
489d5531 | 12805 | if(ptOrEta == "Pt") |
12806 | { | |
12807 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12808 | } else if (ptOrEta == "Eta") | |
12809 | { | |
12810 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12811 | } |
12812 | } | |
489d5531 | 12813 | psi1=aftsTrack->Phi(); |
12814 | // sin terms: | |
12815 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*psi1),1.); // <<sin(n*(psi1))>> | |
12816 | // cos terms: | |
12817 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*psi1),1.); // <<cos(n*(psi1))>> | |
12818 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12819 | ||
12820 | // 2-particle correction terms: | |
12821 | for(Int_t i1=0;i1<nPrim;i1++) | |
12822 | { | |
12823 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12824 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12825 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12826 | { |
12827 | if(ptOrEta == "Pt") | |
12828 | { | |
12829 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12830 | } else if (ptOrEta == "Eta") | |
12831 | { | |
12832 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12833 | } |
12834 | } else // this is diff flow of RPs | |
12835 | { | |
489d5531 | 12836 | if(ptOrEta == "Pt") |
12837 | { | |
12838 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12839 | } else if (ptOrEta == "Eta") | |
12840 | { | |
12841 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12842 | } |
489d5531 | 12843 | } |
12844 | psi1=aftsTrack->Phi(); | |
12845 | for(Int_t i2=0;i2<nPrim;i2++) | |
12846 | { | |
12847 | if(i2==i1) continue; | |
12848 | aftsTrack=anEvent->GetTrack(i2); | |
12849 | // RP condition (!(first) particle in the correlator must be RP): | |
12850 | if(!(aftsTrack->InRPSelection())) continue; | |
12851 | phi2=aftsTrack->Phi(); | |
12852 | // sin terms: | |
12853 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2)),1.); // <<sin(n*(psi1+phi2))>> | |
12854 | // cos terms: | |
12855 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2)),1.); // <<cos(n*(psi1+phi2))>> | |
12856 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12857 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12858 | ||
12859 | // 3-particle correction terms: | |
12860 | for(Int_t i1=0;i1<nPrim;i1++) | |
12861 | { | |
12862 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12863 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12864 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12865 | { |
12866 | if(ptOrEta == "Pt") | |
12867 | { | |
12868 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12869 | } else if (ptOrEta == "Eta") | |
12870 | { | |
12871 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12872 | } |
12873 | } else // this is diff flow of RPs | |
12874 | { | |
489d5531 | 12875 | if(ptOrEta == "Pt") |
12876 | { | |
12877 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12878 | } else if (ptOrEta == "Eta") | |
12879 | { | |
12880 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12881 | } |
489d5531 | 12882 | } |
12883 | psi1=aftsTrack->Phi(); | |
12884 | for(Int_t i2=0;i2<nPrim;i2++) | |
12885 | { | |
12886 | if(i2==i1) continue; | |
12887 | aftsTrack=anEvent->GetTrack(i2); | |
12888 | // RP condition (!(first) particle in the correlator must be RP): | |
12889 | if(!(aftsTrack->InRPSelection())) continue; | |
12890 | phi2=aftsTrack->Phi(); | |
12891 | for(Int_t i3=0;i3<nPrim;i3++) | |
12892 | { | |
12893 | if(i3==i1||i3==i2) continue; | |
12894 | aftsTrack=anEvent->GetTrack(i3); | |
12895 | // RP condition (!(first) particle in the correlator must be RP): | |
12896 | if(!(aftsTrack->InRPSelection())) continue; | |
12897 | phi3=aftsTrack->Phi(); | |
12898 | // sin terms: | |
12899 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2-phi3)),1.); // <<sin(n*(psi1+phi2-phi3))>> | |
12900 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1-phi2-phi3)),1.); // <<sin(n*(psi1-phi2-phi3))>> | |
12901 | // cos terms: | |
12902 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3)),1.); // <<cos(n*(psi1+phi2-phi3))>> | |
12903 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-phi2-phi3)),1.); // <<cos(n*(psi1-phi2-phi3))>> | |
12904 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
12905 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12906 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12907 | ||
12908 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
12909 | ||
12910 | ||
12911 | //================================================================================================================================ | |
12912 | ||
12913 | ||
12914 | void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrectionTermsForNUA(TString type, TString ptOrEta) | |
12915 | { | |
12916 | // Compare corrections temrs for non-uniform acceptance needed for diff. flow calculated with nested loops and those calculated from Q-vectors | |
12917 | ||
2a98ceb8 | 12918 | Int_t typeFlag = 0; |
12919 | Int_t ptEtaFlag = 0; | |
489d5531 | 12920 | if(type == "RP") |
12921 | { | |
12922 | typeFlag = 0; | |
12923 | } else if(type == "POI") | |
12924 | { | |
12925 | typeFlag = 1; | |
12926 | } | |
12927 | if(ptOrEta == "Pt") | |
12928 | { | |
12929 | ptEtaFlag = 0; | |
12930 | } else if(ptOrEta == "Eta") | |
12931 | { | |
12932 | ptEtaFlag = 1; | |
12933 | } | |
12934 | // shortcuts: | |
12935 | Int_t t = typeFlag; | |
12936 | Int_t pe = ptEtaFlag; | |
12937 | ||
12938 | TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
12939 | TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
12940 | //TString sinCosFlag[2] = {"sin","cos"}; // to be improved (eventually promote to data member) | |
12941 | TString reducedCorrectionSinTerms[4] = {"<<sin(n(psi1))>>","<<sin(n(psi1+phi2))>>","<<sin(n*(psi1+phi2-phi3))>>","<<sin(n*(psi1-phi2-phi3))>>"}; // to be improved (access this from pro or hist) | |
12942 | TString reducedCorrectionCosTerms[4] = {"<<cos(n(psi1))>>","<<cos(n(psi1+phi2))>>","<<cos(n*(psi1+phi2-phi3))>>","<<cos(n*(psi1-phi2-phi3))>>"}; // to be improved (access this from pro or hist) | |
12943 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12944 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12945 | ||
12946 | Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo}; | |
12947 | ||
12948 | cout<<endl; | |
12949 | cout<<" ******************************************"<<endl; | |
12950 | cout<<" **** cross-checking the correction ****"<<endl; | |
46b94261 | 12951 | cout<<" **** terms for non-uniform acceptance ****"<<endl; |
489d5531 | 12952 | cout<<" **** for differential flow ("<<rpORpoiString[t]<<") ****"<<endl; |
403e3389 | 12953 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 12954 | { |
12955 | cout<<" **** (particle weights not used) ****"<<endl; | |
12956 | } else | |
12957 | { | |
12958 | cout<<" **** (particle weights used) ****"<<endl; | |
12959 | } | |
12960 | cout<<" ******************************************"<<endl; | |
12961 | cout<<endl; | |
12962 | cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl; | |
12963 | cout<<endl; | |
12964 | ||
12965 | for(Int_t cti=0;cti<4;cti++) // correction term index | |
12966 | { | |
12967 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
12968 | { | |
12969 | if(sc==0) // to be improved (this can be implemented better) | |
12970 | { | |
12971 | cout<<" "<<reducedCorrectionSinTerms[cti].Data()<<":"<<endl; | |
12972 | } else | |
12973 | { | |
12974 | cout<<" "<<reducedCorrectionCosTerms[cti].Data()<<":"<<endl; | |
12975 | } | |
12976 | cout<<" from Q-vectors = "<<fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl; | |
12977 | cout<<" from nested loops = "<<fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]->GetBinContent(1)<<endl; | |
12978 | cout<<endl; | |
12979 | } | |
12980 | } // end of for(Int_t rci=0;rci<4;rci++) | |
12981 | ||
12982 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrectionTermsForNUA(TString type, TString ptOrEta) | |
12983 | ||
57340a27 | 12984 | //================================================================================================================================ |
12985 | ||
489d5531 | 12986 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights() |
12987 | { | |
12988 | // Calculate corrections using particle weights for non-uniform acceptance of the detector for no-name integrated flow (cos terms). | |
12989 | ||
12990 | // ********************************************************************** | |
12991 | // **** weighted corrections for non-uniform acceptance (cos terms): **** | |
12992 | // ********************************************************************** | |
57340a27 | 12993 | |
489d5531 | 12994 | // Remark 1: When particle weights are used the binning of fIntFlowCorrectionTermsForNUAPro[1] is organized as follows: |
57340a27 | 12995 | // |
489d5531 | 12996 | // 1st bin: <<w1 cos(n*(phi1))>> = cosP1nW1 |
12997 | // 2nd bin: <<w1 w2 cos(n*(phi1+phi2))>> = cosP1nP1nW1W1 | |
12998 | // 3rd bin: <<w1 w2 w3 cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1nW1W1W1 | |
12999 | // ... | |
13000 | ||
13001 | // multiplicity (number of particles used to determine the reaction plane) | |
1268c371 | 13002 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 13003 | |
13004 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
13005 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
13006 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
13007 | //Double_t dReQ3n3k = (*fReQ)(2,3); | |
13008 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
13009 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
13010 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
13011 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
13012 | //Double_t dImQ3n3k = (*fImQ)(2,3); | |
13013 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
13014 | //Double_t dImQ1n3k = (*fImQ)(0,3); | |
13015 | ||
13016 | // dMs are variables introduced in order to simplify some Eqs. bellow: | |
13017 | //.............................................................................................. | |
1268c371 | 13018 | Double_t dM11 = (*fSpk)(1,1)-(*fSpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
13019 | Double_t dM111 = (*fSpk)(2,1)-3.*(*fSpk)(0,2)*(*fSpk)(0,1) | |
13020 | + 2.*(*fSpk)(0,3); // dM111 = sum_{i,j,k=1,i!=j!=k}^M w_i w_j w_k | |
489d5531 | 13021 | //.............................................................................................. |
ecac11c2 | 13022 | // 1-particle: |
489d5531 | 13023 | Double_t cosP1nW1 = 0.; // <<w1 cos(n*(phi1))>> |
13024 | ||
1268c371 | 13025 | if(dMult>0 && TMath::Abs((*fSpk)(0,1))>1.e-6) |
489d5531 | 13026 | { |
1268c371 | 13027 | cosP1nW1 = dReQ1n1k/(*fSpk)(0,1); |
489d5531 | 13028 | |
13029 | // average weighted 1-particle correction (cos terms) for non-uniform acceptance for single event: | |
13030 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(1,cosP1nW1); | |
13031 | ||
13032 | // final average weighted 1-particle correction (cos terms) for non-uniform acceptance for all events: | |
1268c371 | 13033 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(0.5,cosP1nW1,(*fSpk)(0,1)); |
489d5531 | 13034 | } |
13035 | ||
13036 | // 2-particle: | |
13037 | Double_t cosP1nP1nW1W1 = 0.; // <<w1 w2 cos(n*(phi1+phi2))>> | |
13038 | ||
1268c371 | 13039 | if(dMult>1 && TMath::Abs(dM11)>1.e-6) |
489d5531 | 13040 | { |
13041 | cosP1nP1nW1W1 = (pow(dReQ1n1k,2)-pow(dImQ1n1k,2)-dReQ2n2k)/dM11; | |
13042 | ||
13043 | // average weighted 2-particle correction (cos terms) for non-uniform acceptance for single event: | |
13044 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(2,cosP1nP1nW1W1); | |
13045 | ||
13046 | // final average weighted 2-particle correction (cos terms) for non-uniform acceptance for all events: | |
13047 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(1.5,cosP1nP1nW1W1,dM11); | |
13048 | } | |
13049 | ||
13050 | // 3-particle: | |
13051 | Double_t cosP1nM1nM1nW1W1W1 = 0.; // <<w1 w2 w3 cos(n*(phi1-phi2-phi3))>> | |
13052 | ||
1268c371 | 13053 | if(dMult>2 && TMath::Abs(dM111)>1.e-6) |
489d5531 | 13054 | { |
57340a27 | 13055 | cosP1nM1nM1nW1W1W1 = (dReQ1n1k*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
13056 | - dReQ1n1k*dReQ2n2k-dImQ1n1k*dImQ2n2k | |
1268c371 | 13057 | - 2.*((*fSpk)(0,2))*dReQ1n1k |
489d5531 | 13058 | + 2.*dReQ1n3k) |
13059 | / dM111; | |
13060 | ||
13061 | // average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for single event: | |
13062 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(3,cosP1nM1nM1nW1W1W1); | |
13063 | ||
13064 | // final average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for all events: | |
13065 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(2.5,cosP1nM1nM1nW1W1W1,dM111); | |
13066 | } | |
13067 | ||
13068 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights() | |
13069 | ||
13070 | ||
13071 | //================================================================================================================================ | |
13072 | ||
13073 | ||
13074 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights() | |
13075 | { | |
13076 | // calculate corrections using particle weights for non-uniform acceptance of the detector for no-name integrated flow (sin terms) | |
13077 | ||
13078 | // ********************************************************************** | |
13079 | // **** weighted corrections for non-uniform acceptance (sin terms): **** | |
13080 | // ********************************************************************** | |
13081 | ||
13082 | // Remark 1: When particle weights are used the binning of fIntFlowCorrectionTermsForNUAPro[0] is organized as follows: | |
57340a27 | 13083 | // |
489d5531 | 13084 | // 1st bin: <<w1 sin(n*(phi1))>> = sinP1nW1 |
13085 | // 2nd bin: <<w1 w2 sin(n*(phi1+phi2))>> = sinP1nP1nW1W1 | |
13086 | // 3rd bin: <<w1 w2 w3 sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1nW1W1W1 | |
13087 | // ... | |
13088 | ||
13089 | // multiplicity (number of particles used to determine the reaction plane) | |
1268c371 | 13090 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 13091 | |
13092 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
13093 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
13094 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
13095 | //Double_t dReQ3n3k = (*fReQ)(2,3); | |
13096 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
13097 | //Double_t dReQ1n3k = (*fReQ)(0,3); | |
13098 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
13099 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
13100 | //Double_t dImQ3n3k = (*fImQ)(2,3); | |
13101 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
13102 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
13103 | ||
13104 | // dMs are variables introduced in order to simplify some Eqs. bellow: | |
13105 | //.............................................................................................. | |
1268c371 | 13106 | Double_t dM11 = (*fSpk)(1,1)-(*fSpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
13107 | Double_t dM111 = (*fSpk)(2,1)-3.*(*fSpk)(0,2)*(*fSpk)(0,1) | |
13108 | + 2.*(*fSpk)(0,3); // dM111 = sum_{i,j,k=1,i!=j!=k}^M w_i w_j w_k | |
489d5531 | 13109 | //.............................................................................................. |
13110 | ||
13111 | // 1-particle: | |
13112 | Double_t sinP1nW1 = 0.; // <<w1 sin(n*(phi1))>> | |
13113 | ||
1268c371 | 13114 | if(dMult>0 && TMath::Abs((*fSpk)(0,1))>1.e-6) |
489d5531 | 13115 | { |
1268c371 | 13116 | sinP1nW1 = dImQ1n1k/((*fSpk)(0,1)); |
489d5531 | 13117 | |
13118 | // average weighted 1-particle correction (sin terms) for non-uniform acceptance for single event: | |
13119 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(1,sinP1nW1); | |
13120 | ||
13121 | // final average weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
1268c371 | 13122 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(0.5,sinP1nW1,(*fSpk)(0,1)); |
489d5531 | 13123 | } |
13124 | ||
13125 | // 2-particle: | |
13126 | Double_t sinP1nP1nW1W1 = 0.; // <<w1 w2 sin(n*(phi1+phi2))>> | |
13127 | ||
1268c371 | 13128 | if(dMult>1 && TMath::Abs(dM11)>1.e-6) |
489d5531 | 13129 | { |
13130 | sinP1nP1nW1W1 = (2.*dReQ1n1k*dImQ1n1k-dImQ2n2k)/dM11; | |
13131 | ||
13132 | // average weighted 2-particle correction (sin terms) for non-uniform acceptance for single event: | |
13133 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(2,sinP1nP1nW1W1); | |
13134 | ||
13135 | // final average weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
13136 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(1.5,sinP1nP1nW1W1,dM11); | |
13137 | } | |
13138 | ||
13139 | // 3-particle: | |
13140 | Double_t sinP1nM1nM1nW1W1W1 = 0.; // <<w1 w2 w3 sin(n*(phi1-phi2-phi3))>> | |
13141 | ||
1268c371 | 13142 | if(dMult>2 && TMath::Abs(dM111)>1.e-6) |
489d5531 | 13143 | { |
57340a27 | 13144 | sinP1nM1nM1nW1W1W1 = (-dImQ1n1k*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
13145 | + dReQ1n1k*dImQ2n2k-dImQ1n1k*dReQ2n2k | |
1268c371 | 13146 | + 2.*((*fSpk)(0,2))*dImQ1n1k |
489d5531 | 13147 | - 2.*dImQ1n3k) |
13148 | / dM111; | |
13149 | ||
13150 | // average weighted 3-particle correction (sin terms) for non-uniform acceptance for single event: | |
13151 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(3,sinP1nM1nM1nW1W1W1); | |
13152 | ||
13153 | // final average weighted 3-particle correction (sin terms) for non-uniform acceptance for all events: | |
13154 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(2.5,sinP1nM1nM1nW1W1W1,dM111); | |
13155 | } | |
13156 | ||
13157 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights() | |
13158 | ||
57340a27 | 13159 | //================================================================================================================================ |
489d5531 | 13160 | |
0328db2d | 13161 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent) |
489d5531 | 13162 | { |
13163 | // Evaluate with nested loops correction terms for non-uniform acceptance for integrated flow (using the particle weights). | |
13164 | ||
57340a27 | 13165 | // Results are stored in profiles fIntFlowDirectCorrectionTermsForNUA[0] (sin terms) and |
13166 | // fIntFlowDirectCorrectionTermsForNUA[1] (cos terms). | |
489d5531 | 13167 | |
57340a27 | 13168 | // Remark 1: When particle weights are used the binning of fIntFlowDirectCorrectionTermsForNUA[sc] is |
489d5531 | 13169 | // organized as follows (sc stands for either sin or cos): |
13170 | // | |
13171 | // 1st bin: <<w1 sc(n*(phi1))>> = scP1nW1 | |
13172 | // 2nd bin: <<w1 w2 sc(n*(phi1+phi2))>> = scP1nP1nW1W1 | |
13173 | // 3rd bin: <<w1 w2 w3 sc(n*(phi1-phi2-phi3))>> = scP1nM1nM1nW1W1W1 | |
3b552efe | 13174 | // ... |
489d5531 | 13175 | |
13176 | Int_t nPrim = anEvent->NumberOfTracks(); | |
13177 | AliFlowTrackSimple *aftsTrack = NULL; | |
13178 | //Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; | |
13179 | //Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
13180 | Double_t phi1=0., phi2=0., phi3=0.; | |
13181 | Double_t wPhi1=1., wPhi2=1., wPhi3=1.; | |
13182 | Int_t n = fHarmonic; | |
13183 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 13184 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 13185 | cout<<endl; |
13186 | cout<<"Correction terms for non-uniform acceptance: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
13187 | if(dMult<1) | |
13188 | { | |
13189 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
13190 | } else if (dMult>fMaxAllowedMultiplicity) | |
13191 | { | |
13192 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
13193 | } else | |
13194 | { | |
13195 | cout<<"... evaluating nested loops (using particle weights) ..."<<endl; | |
13196 | } | |
13197 | ||
13198 | // 1-particle correction terms using particle weights: | |
13199 | if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity) | |
13200 | { | |
13201 | for(Int_t i1=0;i1<nPrim;i1++) | |
13202 | { | |
13203 | aftsTrack=anEvent->GetTrack(i1); | |
13204 | if(!(aftsTrack->InRPSelection())) continue; | |
13205 | phi1=aftsTrack->Phi(); | |
13206 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
57340a27 | 13207 | // 1-particle correction terms using particle weights: |
489d5531 | 13208 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(0.5,sin(n*phi1),wPhi1); // <w1 sin(n*phi1)> |
13209 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(0.5,cos(n*phi1),wPhi1); // <w1 cos(n*phi1)> | |
57340a27 | 13210 | } // end of for(Int_t i1=0;i1<nPrim;i1++) |
13211 | } // end of if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity) | |
13212 | ||
489d5531 | 13213 | // 2-particle correction terms using particle weights: |
13214 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
13215 | { | |
13216 | for(Int_t i1=0;i1<nPrim;i1++) | |
13217 | { | |
13218 | aftsTrack=anEvent->GetTrack(i1); | |
13219 | if(!(aftsTrack->InRPSelection())) continue; | |
13220 | phi1=aftsTrack->Phi(); | |
13221 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
13222 | for(Int_t i2=0;i2<nPrim;i2++) | |
13223 | { | |
13224 | if(i2==i1)continue; | |
13225 | aftsTrack=anEvent->GetTrack(i2); | |
13226 | if(!(aftsTrack->InRPSelection())) continue; | |
13227 | phi2=aftsTrack->Phi(); | |
13228 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
13229 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
57340a27 | 13230 | // 2-p correction terms using particle weights: |
489d5531 | 13231 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(1.5,sin(n*(phi1+phi2)),wPhi1*wPhi2); // <w1 w2 sin(n*(phi1+phi2))> |
13232 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(1.5,cos(n*(phi1+phi2)),wPhi1*wPhi2); // <w1 w2 cos(n*(phi1+phi2))> | |
13233 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
13234 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
13235 | } // end of if(nPrim>=2) | |
13236 | ||
13237 | // 3-particle correction terms using particle weights: | |
13238 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
13239 | { | |
13240 | for(Int_t i1=0;i1<nPrim;i1++) | |
13241 | { | |
13242 | aftsTrack=anEvent->GetTrack(i1); | |
13243 | if(!(aftsTrack->InRPSelection())) continue; | |
13244 | phi1=aftsTrack->Phi(); | |
13245 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
13246 | for(Int_t i2=0;i2<nPrim;i2++) | |
13247 | { | |
13248 | if(i2==i1)continue; | |
13249 | aftsTrack=anEvent->GetTrack(i2); | |
13250 | if(!(aftsTrack->InRPSelection())) continue; | |
13251 | phi2=aftsTrack->Phi(); | |
13252 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
13253 | for(Int_t i3=0;i3<nPrim;i3++) | |
13254 | { | |
13255 | if(i3==i1||i3==i2)continue; | |
13256 | aftsTrack=anEvent->GetTrack(i3); | |
13257 | if(!(aftsTrack->InRPSelection())) continue; | |
13258 | phi3=aftsTrack->Phi(); | |
13259 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
13260 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
57340a27 | 13261 | // 3-p correction terms using particle weights: |
489d5531 | 13262 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(2.5,sin(n*(phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 sin(n*(phi1-phi2-phi3))> |
13263 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(2.5,cos(n*(phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 cos(n*(phi1-phi2-phi3))> | |
13264 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
13265 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
13266 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
13267 | } // end of if(nPrim>=3) | |
13268 | ||
57340a27 | 13269 | /* |
13270 | ||
489d5531 | 13271 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) |
13272 | { | |
13273 | // 4 nested loops multiparticle correlations using particle weights: | |
13274 | for(Int_t i1=0;i1<nPrim;i1++) | |
13275 | { | |
13276 | aftsTrack=anEvent->GetTrack(i1); | |
13277 | if(!(aftsTrack->InRPSelection())) continue; | |
13278 | phi1=aftsTrack->Phi(); | |
13279 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
13280 | for(Int_t i2=0;i2<nPrim;i2++) | |
13281 | { | |
13282 | if(i2==i1)continue; | |
13283 | aftsTrack=anEvent->GetTrack(i2); | |
13284 | if(!(aftsTrack->InRPSelection())) continue; | |
13285 | phi2=aftsTrack->Phi(); | |
13286 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
13287 | for(Int_t i3=0;i3<nPrim;i3++) | |
13288 | { | |
13289 | if(i3==i1||i3==i2)continue; | |
13290 | aftsTrack=anEvent->GetTrack(i3); | |
13291 | if(!(aftsTrack->InRPSelection())) continue; | |
13292 | phi3=aftsTrack->Phi(); | |
13293 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
13294 | for(Int_t i4=0;i4<nPrim;i4++) | |
13295 | { | |
13296 | if(i4==i1||i4==i2||i4==i3)continue; | |
13297 | aftsTrack=anEvent->GetTrack(i4); | |
13298 | if(!(aftsTrack->InRPSelection())) continue; | |
13299 | phi4=aftsTrack->Phi(); | |
13300 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); | |
13301 | if(nPrim>=4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; // to be improved (replace eventually this if statement with if(nPrim==4)) | |
13302 | // 4-p correlations using particle weights: | |
13303 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(10.5,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); | |
13304 | // extra correlations: | |
13305 | // 2-p extra correlations (do not appear if particle weights are not used): | |
13306 | // ... | |
13307 | // 3-p extra correlations (do not appear if particle weights are not used): | |
13308 | // ... | |
13309 | // 4-p extra correlations (do not appear if particle weights are not used): | |
13310 | // ... | |
13311 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
13312 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
13313 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
13314 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
13315 | } // end of if(nPrim>=4) | |
13316 | ||
13317 | */ | |
13318 | ||
13319 | cout<<endl; | |
13320 | ||
13321 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent) | |
13322 | ||
57340a27 | 13323 | //================================================================================================================================ |
489d5531 | 13324 | |
489d5531 | 13325 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights(TString type, TString ptOrEta) |
13326 | { | |
13327 | // Calculate correction terms for non-uniform acceptance for differential flow (cos terms) using particle weights. | |
57340a27 | 13328 | |
489d5531 | 13329 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][1][cti], where cti runs as follows: |
57340a27 | 13330 | // |
489d5531 | 13331 | // 0: <<cos n(psi)>> |
13332 | // 1: <<w2 cos n(psi1+phi2)>> | |
13333 | // 2: <<w2 w3 cos n(psi1+phi2-phi3)>> | |
13334 | // 3: <<w2 w3 cos n(psi1-phi2-phi3)>> | |
13335 | // 4: | |
13336 | // 5: | |
13337 | // 6: | |
13338 | ||
13339 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
13340 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
13341 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
13342 | //Double_t dReQ1n3k = (*fReQ)(0,3); | |
13343 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
13344 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
13345 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
13346 | //Double_t dImQ1n3k = (*fImQ)(0,3); | |
13347 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
13348 | ||
1268c371 | 13349 | // S^M_{p,k} (see .h file for the definition of fSpk): |
13350 | Double_t dSM1p1k = (*fSpk)(0,1); | |
13351 | Double_t dSM1p2k = (*fSpk)(0,2); | |
13352 | Double_t dSM2p1k = (*fSpk)(1,1); | |
489d5531 | 13353 | |
2a98ceb8 | 13354 | Int_t t = 0; // type flag |
13355 | Int_t pe = 0; // ptEta flag | |
489d5531 | 13356 | |
13357 | if(type == "RP") | |
13358 | { | |
13359 | t = 0; | |
13360 | } else if(type == "POI") | |
13361 | { | |
13362 | t = 1; | |
13363 | } | |
13364 | ||
13365 | if(ptOrEta == "Pt") | |
13366 | { | |
13367 | pe = 0; | |
13368 | } else if(ptOrEta == "Eta") | |
13369 | { | |
13370 | pe = 1; | |
13371 | } | |
13372 | ||
13373 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
13374 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
13375 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
13376 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
13377 | ||
13378 | // looping over all bins and calculating correction terms: | |
13379 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
13380 | { | |
13381 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
13382 | Double_t p1n0kRe = 0.; | |
13383 | Double_t p1n0kIm = 0.; | |
13384 | ||
13385 | // number of POIs in particular pt or eta bin: | |
13386 | Double_t mp = 0.; | |
13387 | ||
13388 | // real and imaginary parts of q_{m*n,0} (weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
13389 | Double_t q1n2kRe = 0.; | |
13390 | Double_t q1n2kIm = 0.; | |
13391 | Double_t q2n1kRe = 0.; | |
13392 | Double_t q2n1kIm = 0.; | |
46b94261 | 13393 | |
489d5531 | 13394 | // s_{1,1}, s_{1,2} // to be improved (add explanation) |
13395 | Double_t s1p1k = 0.; | |
13396 | Double_t s1p2k = 0.; | |
46b94261 | 13397 | |
489d5531 | 13398 | // number of particles which are both RPs and POIs in particular pt or eta bin: |
46b94261 | 13399 | Double_t mq = 0.; |
489d5531 | 13400 | |
13401 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
13402 | Double_t dM01 = 0.; | |
13403 | Double_t dM011 = 0.; | |
13404 | ||
13405 | if(type == "POI") | |
13406 | { | |
13407 | // q_{m*n,k}: | |
13408 | q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
13409 | * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
13410 | q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
13411 | * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
13412 | q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
13413 | * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
13414 | q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
13415 | * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
13416 | mq = fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
46b94261 | 13417 | |
489d5531 | 13418 | s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); |
13419 | s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); | |
13420 | }else if(type == "RP") | |
13421 | { | |
13422 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
13423 | q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
13424 | * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
13425 | q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
13426 | * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
13427 | q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
13428 | * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
13429 | q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
13430 | * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
13431 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
13432 | s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); | |
13433 | s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); | |
3b552efe | 13434 | //s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); |
13435 | ||
489d5531 | 13436 | mq = fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) |
13437 | } | |
3b552efe | 13438 | |
489d5531 | 13439 | if(type == "POI") |
3b552efe | 13440 | { |
13441 | // p_{m*n,k}: | |
489d5531 | 13442 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) |
13443 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
13444 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
3b552efe | 13445 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); |
13446 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
489d5531 | 13447 | // M01 from Eq. (118) in QC2c (to be improved (notation)): |
3b552efe | 13448 | dM01 = mp*dSM1p1k-s1p1k; |
13449 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
13450 | - 2.*(s1p1k*dSM1p1k-s1p2k); | |
13451 | ||
13452 | // typeFlag = RP (0) or POI (1): | |
13453 | t = 1; | |
13454 | } else if(type == "RP") | |
489d5531 | 13455 | { |
13456 | // to be improved (cross-checked): | |
13457 | p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
13458 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
13459 | p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
13460 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
13461 | mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
13462 | // M01 from Eq. (118) in QC2c (to be improved (notation)): | |
3b552efe | 13463 | dM01 = mp*dSM1p1k-s1p1k; |
13464 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
13465 | - 2.*(s1p1k*dSM1p1k-s1p2k); | |
489d5531 | 13466 | // typeFlag = RP (0) or POI (1): |
3b552efe | 13467 | t = 0; |
13468 | } | |
489d5531 | 13469 | |
13470 | // <<cos n(psi1)>>: | |
13471 | Double_t cosP1nPsi = 0.; | |
13472 | if(mp) | |
13473 | { | |
13474 | cosP1nPsi = p1n0kRe/mp; | |
13475 | ||
13476 | // fill profile for <<cos n(psi1)>>: | |
13477 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi,mp); | |
13478 | // histogram to store <cos n(psi1)> e-b-e (needed in some other methods): | |
13479 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][0]->SetBinContent(b,cosP1nPsi); | |
46b94261 | 13480 | } // end of if(mp) |
57340a27 | 13481 | |
489d5531 | 13482 | // <<w2 cos n(psi1+phi2)>>: |
13483 | Double_t cosP1nPsiP1nPhiW2 = 0.; | |
13484 | if(dM01) | |
13485 | { | |
13486 | cosP1nPsiP1nPhiW2 = (p1n0kRe*dReQ1n1k-p1n0kIm*dImQ1n1k-q2n1kRe)/(dM01); | |
13487 | // fill profile for <<w2 cos n(psi1+phi2)>>: | |
13488 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsiP1nPhiW2,dM01); | |
13489 | // histogram to store <w2 cos n(psi1+phi2)> e-b-e (needed in some other methods): | |
13490 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][1]->SetBinContent(b,cosP1nPsiP1nPhiW2); | |
13491 | } // end of if(dM01) | |
13492 | ||
13493 | // <<w2 w3 cos n(psi1+phi2-phi3)>>: | |
13494 | Double_t cosP1nPsi1P1nPhi2MPhi3W2W3 = 0.; | |
13495 | if(dM011) | |
13496 | { | |
46b94261 | 13497 | cosP1nPsi1P1nPhi2MPhi3W2W3 = (p1n0kRe*(pow(dImQ1n1k,2.)+pow(dReQ1n1k,2.)) |
13498 | - p1n0kRe*dSM1p2k | |
13499 | - q2n1kRe*dReQ1n1k-q2n1kIm*dImQ1n1k | |
13500 | - s1p1k*dReQ1n1k | |
13501 | + 2.*q1n2kRe) | |
13502 | / dM011; | |
489d5531 | 13503 | // fill profile for <<w1 w2 w3 cos n(psi1+phi2)>>: |
13504 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1P1nPhi2MPhi3W2W3,dM011); | |
13505 | // histogram to store <w1 w2 w3 cos n(psi1+phi2)> e-b-e (needed in some other methods): | |
13506 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][2]->SetBinContent(b,cosP1nPsi1P1nPhi2MPhi3W2W3); | |
13507 | } // end of if(dM011) | |
13508 | ||
13509 | // <<w2 w3 cos n(psi1-phi2-phi3)>>: | |
13510 | Double_t cosP1nPsi1M1nPhi2MPhi3W2W3 = 0.; | |
13511 | if(dM011) | |
13512 | { | |
13513 | cosP1nPsi1M1nPhi2MPhi3W2W3 = (p1n0kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))+2.*p1n0kIm*dReQ1n1k*dImQ1n1k | |
13514 | - 1.*(p1n0kRe*dReQ2n2k+p1n0kIm*dImQ2n2k) | |
46b94261 | 13515 | - 2.*s1p1k*dReQ1n1k |
489d5531 | 13516 | + 2.*q1n2kRe) |
13517 | / dM011; | |
13518 | // fill profile for <<w1 w2 w3 cos n(psi1+phi2)>>: | |
13519 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1M1nPhi2MPhi3W2W3,dM011); | |
13520 | // histogram to store <w1 w2 w3 cos n(psi1+phi2)> e-b-e (needed in some other methods): | |
13521 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][3]->SetBinContent(b,cosP1nPsi1M1nPhi2MPhi3W2W3); | |
13522 | } // end of if(dM011) | |
13523 | ||
13524 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
46b94261 | 13525 | |
57340a27 | 13526 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights(TString type, TString ptOrEta) |
13527 | ||
489d5531 | 13528 | |
13529 | //================================================================================================================================ | |
13530 | ||
13531 | ||
13532 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights(TString type, TString ptOrEta) | |
13533 | { | |
13534 | // Calculate correction terms for non-uniform acceptance for differential flow (sin terms). | |
13535 | ||
13536 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][0][cti], where cti runs as follows: | |
13537 | // 0: <<sin n(psi1)>> | |
13538 | // 1: <<w2 sin n(psi1+phi2)>> | |
13539 | // 2: <<w2 w3 sin n(psi1+phi2-phi3)>> | |
13540 | // 3: <<w2 w3 sin n(psi1-phi2-phi3)>>: | |
13541 | // 4: | |
13542 | // 5: | |
13543 | // 6: | |
13544 | ||
13545 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
13546 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
13547 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
13548 | //Double_t dReQ1n3k = (*fReQ)(0,3); | |
13549 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
13550 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
13551 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
13552 | //Double_t dImQ1n3k = (*fImQ)(0,3); | |
13553 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
13554 | ||
1268c371 | 13555 | // S^M_{p,k} (see .h file for the definition of fSpk): |
13556 | Double_t dSM1p1k = (*fSpk)(0,1); | |
13557 | Double_t dSM1p2k = (*fSpk)(0,2); | |
13558 | Double_t dSM2p1k = (*fSpk)(1,1); | |
489d5531 | 13559 | |
2a98ceb8 | 13560 | Int_t t = 0; // type flag |
13561 | Int_t pe = 0; // ptEta flag | |
489d5531 | 13562 | |
13563 | if(type == "RP") | |
13564 | { | |
13565 | t = 0; | |
13566 | } else if(type == "POI") | |
13567 | { | |
13568 | t = 1; | |
13569 | } | |
13570 | ||
13571 | if(ptOrEta == "Pt") | |
13572 | { | |
13573 | pe = 0; | |
13574 | } else if(ptOrEta == "Eta") | |
13575 | { | |
13576 | pe = 1; | |
13577 | } | |
13578 | ||
13579 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
13580 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
13581 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
13582 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
13583 | ||
13584 | // looping over all bins and calculating correction terms: | |
13585 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
13586 | { | |
13587 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
13588 | Double_t p1n0kRe = 0.; | |
13589 | Double_t p1n0kIm = 0.; | |
13590 | ||
13591 | // number of POIs in particular pt or eta bin: | |
13592 | Double_t mp = 0.; | |
13593 | ||
13594 | // real and imaginary parts of q_{m*n,0} (weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
13595 | Double_t q1n2kRe = 0.; | |
13596 | Double_t q1n2kIm = 0.; | |
13597 | Double_t q2n1kRe = 0.; | |
13598 | Double_t q2n1kIm = 0.; | |
46b94261 | 13599 | |
489d5531 | 13600 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) |
13601 | Double_t s1p1k = 0.; | |
13602 | Double_t s1p2k = 0.; | |
46b94261 | 13603 | |
489d5531 | 13604 | // number of particles which are both RPs and POIs in particular pt or eta bin: |
46b94261 | 13605 | Double_t mq = 0.; |
489d5531 | 13606 | |
13607 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
13608 | Double_t dM01 = 0.; | |
13609 | Double_t dM011 = 0.; | |
13610 | ||
13611 | if(type == "POI") | |
13612 | { | |
13613 | // q_{m*n,k}: | |
13614 | q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
13615 | * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
13616 | q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
13617 | * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
13618 | q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
13619 | * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
13620 | q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
13621 | * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
13622 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
46b94261 | 13623 | |
489d5531 | 13624 | s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); |
13625 | s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); | |
13626 | }else if(type == "RP") | |
13627 | { | |
13628 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
13629 | q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
13630 | * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
13631 | q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
13632 | * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
13633 | q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
13634 | * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
13635 | q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
13636 | * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
13637 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
13638 | s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); | |
13639 | s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); | |
13640 | //s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); | |
3b552efe | 13641 | } |
13642 | ||
13643 | if(type == "POI") | |
13644 | { | |
13645 | // p_{m*n,k}: | |
489d5531 | 13646 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) |
13647 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
13648 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
3b552efe | 13649 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); |
13650 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
489d5531 | 13651 | // M01 from Eq. (118) in QC2c (to be improved (notation)): |
3b552efe | 13652 | dM01 = mp*dSM1p1k-s1p1k; |
13653 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
13654 | - 2.*(s1p1k*dSM1p1k-s1p2k); | |
13655 | // typeFlag = RP (0) or POI (1): | |
13656 | t = 1; | |
489d5531 | 13657 | } else if(type == "RP") |
3b552efe | 13658 | { |
489d5531 | 13659 | // to be improved (cross-checked): |
13660 | p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
13661 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
13662 | p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
13663 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
13664 | mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
13665 | // M01 from Eq. (118) in QC2c (to be improved (notation)): | |
3b552efe | 13666 | dM01 = mp*dSM1p1k-s1p1k; |
13667 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
489d5531 | 13668 | - 2.*(s1p1k*dSM1p1k-s1p2k); |
13669 | // typeFlag = RP (0) or POI (1): | |
3b552efe | 13670 | t = 0; |
13671 | } | |
13672 | ||
489d5531 | 13673 | // <<sin n(psi1)>>: |
13674 | Double_t sinP1nPsi = 0.; | |
13675 | if(mp) | |
13676 | { | |
13677 | sinP1nPsi = p1n0kIm/mp; | |
13678 | ||
13679 | // fill profile for <<sin n(psi1)>>: | |
13680 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi,mp); | |
13681 | // histogram to store <sin n(psi1)> e-b-e (needed in some other methods): | |
13682 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][0]->SetBinContent(b,sinP1nPsi); | |
46b94261 | 13683 | } // end of if(mp) |
13684 | ||
489d5531 | 13685 | // <<w2 sin n(psi1+phi2)>>: |
13686 | Double_t sinP1nPsiP1nPhiW2 = 0.; | |
13687 | if(dM01) | |
13688 | { | |
13689 | sinP1nPsiP1nPhiW2 = (p1n0kRe*dImQ1n1k+p1n0kIm*dReQ1n1k-q2n1kIm)/(dM01); | |
13690 | // fill profile for <<w2 sin n(psi1+phi2)>>: | |
13691 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsiP1nPhiW2,dM01); | |
13692 | // histogram to store <w2 sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
13693 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][1]->SetBinContent(b,sinP1nPsiP1nPhiW2); | |
13694 | } // end of if(mp*dMult-mq) | |
13695 | ||
13696 | // <<w2 w3 sin n(psi1+phi2-phi3)>>: | |
13697 | Double_t sinP1nPsi1P1nPhi2MPhi3W2W3 = 0.; | |
13698 | if(dM011) | |
13699 | { | |
46b94261 | 13700 | sinP1nPsi1P1nPhi2MPhi3W2W3 = (p1n0kIm*(pow(dImQ1n1k,2.)+pow(dReQ1n1k,2.)) |
13701 | - p1n0kIm*dSM1p2k | |
13702 | + q2n1kRe*dImQ1n1k-q2n1kIm*dReQ1n1k | |
13703 | - s1p1k*dImQ1n1k | |
13704 | + 2.*q1n2kIm) | |
13705 | / dM011; | |
489d5531 | 13706 | // fill profile for <<w2 w3 sin n(psi1+phi2-phi3)>>: |
13707 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1P1nPhi2MPhi3W2W3,dM011); | |
13708 | // histogram to store <w2 w3 sin n(psi1+phi2-phi3)> e-b-e (needed in some other methods): | |
13709 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][2]->SetBinContent(b,sinP1nPsi1P1nPhi2MPhi3W2W3); | |
13710 | } // end of if(dM011) | |
13711 | ||
13712 | // <<w2 w3 sin n(psi1-phi2-phi3)>>: | |
13713 | Double_t sinP1nPsi1M1nPhi2MPhi3W2W3 = 0.; | |
13714 | if(dM011) | |
13715 | { | |
13716 | sinP1nPsi1M1nPhi2MPhi3W2W3 = (p1n0kIm*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))-2.*p1n0kRe*dReQ1n1k*dImQ1n1k | |
13717 | + 1.*(p1n0kRe*dImQ2n2k-p1n0kIm*dReQ2n2k) | |
46b94261 | 13718 | + 2.*s1p1k*dImQ1n1k |
489d5531 | 13719 | - 2.*q1n2kIm) |
13720 | / dM011; | |
13721 | // fill profile for <<w2 w3 sin n(psi1-phi2-phi3)>>: | |
13722 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1M1nPhi2MPhi3W2W3,dM011); | |
13723 | // histogram to store <w2 w3 sin n(psi1-phi2-phi3)> e-b-e (needed in some other methods): | |
13724 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][3]->SetBinContent(b,sinP1nPsi1M1nPhi2MPhi3W2W3); | |
13725 | } // end of if(dM011) | |
13726 | ||
13727 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
13728 | ||
13729 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights(TString type, TString ptOrEta) | |
13730 | ||
489d5531 | 13731 | //================================================================================================================================ |
489d5531 | 13732 | |
0328db2d | 13733 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 13734 | { |
57340a27 | 13735 | // Evaluate with nested loops correction terms for non-uniform acceptance |
489d5531 | 13736 | // with using particle weights (both sin and cos terms) relevant for differential flow. |
13737 | ||
57340a27 | 13738 | // Remark 1: "w1" in expressions bellow is a particle weight used only for particles which were |
13739 | // flagged both as POI and RP. | |
489d5531 | 13740 | // Remark 2: Reduced correction terms for non-uniform acceptance are evaluated in pt bin number fCrossCheckInPtBinNo |
13741 | // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
13742 | // Remark 3: Results are stored in 1 bin profiles fDiffFlowDirectCorrections[t][pe][sc][cti], where first three indices runs as: | |
13743 | // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms], whilst the cti (correction term index) runs as follows: | |
13744 | // cti: | |
13745 | // 0: <<sc n(psi1)>> | |
13746 | // 1: <<w2 sc n(psi1+phi2)>> | |
13747 | // 2: <<w2 w3 sc n(psi1+phi2-phi3)>> | |
13748 | // 3: <<w2 w3 sc n(psi1-phi2-phi3)>> | |
13749 | // 4: | |
13750 | // 5: | |
13751 | // 6: | |
46b94261 | 13752 | |
2a98ceb8 | 13753 | Int_t typeFlag = 0; |
13754 | Int_t ptEtaFlag = 0; | |
489d5531 | 13755 | if(type == "RP") |
13756 | { | |
13757 | typeFlag = 0; | |
13758 | } else if(type == "POI") | |
13759 | { | |
13760 | typeFlag = 1; | |
13761 | } | |
13762 | if(ptOrEta == "Pt") | |
13763 | { | |
13764 | ptEtaFlag = 0; | |
13765 | } else if(ptOrEta == "Eta") | |
13766 | { | |
13767 | ptEtaFlag = 1; | |
13768 | } | |
13769 | // shortcuts: | |
13770 | Int_t t = typeFlag; | |
13771 | Int_t pe = ptEtaFlag; | |
13772 | ||
13773 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
13774 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
13775 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
13776 | ||
13777 | Int_t nPrim = anEvent->NumberOfTracks(); | |
13778 | AliFlowTrackSimple *aftsTrack = NULL; | |
13779 | ||
13780 | Double_t psi1=0., phi2=0., phi3=0.;// phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
13781 | Double_t wPhi2=1., wPhi3=1.; | |
13782 | ||
13783 | Int_t n = fHarmonic; | |
13784 | ||
13785 | // 1'-particle correction terms: | |
13786 | for(Int_t i1=0;i1<nPrim;i1++) | |
13787 | { | |
13788 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 13789 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
13790 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 13791 | { |
13792 | if(ptOrEta == "Pt") | |
13793 | { | |
13794 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
13795 | } else if (ptOrEta == "Eta") | |
13796 | { | |
13797 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 13798 | } |
13799 | } else // this is diff flow of RPs | |
13800 | { | |
489d5531 | 13801 | if(ptOrEta == "Pt") |
13802 | { | |
13803 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
13804 | } else if (ptOrEta == "Eta") | |
13805 | { | |
13806 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 13807 | } |
489d5531 | 13808 | } |
13809 | psi1=aftsTrack->Phi(); | |
13810 | // sin terms: | |
13811 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*psi1),1.); // <<sin(n*(psi1))>> | |
13812 | // cos terms: | |
13813 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*psi1),1.); // <<cos(n*(psi1))>> | |
13814 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
13815 | ||
13816 | // 2'-particle correction terms: | |
13817 | for(Int_t i1=0;i1<nPrim;i1++) | |
13818 | { | |
13819 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 13820 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
13821 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 13822 | { |
13823 | if(ptOrEta == "Pt") | |
13824 | { | |
13825 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
13826 | } else if (ptOrEta == "Eta") | |
13827 | { | |
13828 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 13829 | } |
13830 | } else // this is diff flow of RPs | |
13831 | { | |
489d5531 | 13832 | if(ptOrEta == "Pt") |
13833 | { | |
13834 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
13835 | } else if (ptOrEta == "Eta") | |
13836 | { | |
13837 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 13838 | } |
489d5531 | 13839 | } |
13840 | psi1=aftsTrack->Phi(); | |
13841 | for(Int_t i2=0;i2<nPrim;i2++) | |
13842 | { | |
13843 | if(i2==i1) continue; | |
13844 | aftsTrack=anEvent->GetTrack(i2); | |
13845 | // RP condition (!(first) particle in the correlator must be RP): | |
13846 | if(!(aftsTrack->InRPSelection())) continue; | |
46b94261 | 13847 | phi2=aftsTrack->Phi(); |
489d5531 | 13848 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); |
13849 | // sin terms: | |
13850 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2)),wPhi2); // <<w2 sin(n*(psi1+phi2))>> | |
13851 | // cos terms: | |
13852 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2)),wPhi2); // <<w2 cos(n*(psi1+phi2))>> | |
13853 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
13854 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
13855 | ||
13856 | // 3'-particle correction terms: | |
13857 | for(Int_t i1=0;i1<nPrim;i1++) | |
13858 | { | |
13859 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 13860 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
13861 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 13862 | { |
13863 | if(ptOrEta == "Pt") | |
13864 | { | |
13865 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
13866 | } else if (ptOrEta == "Eta") | |
13867 | { | |
13868 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 13869 | } |
13870 | } else // this is diff flow of RPs | |
13871 | { | |
489d5531 | 13872 | if(ptOrEta == "Pt") |
13873 | { | |
13874 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
13875 | } else if (ptOrEta == "Eta") | |
13876 | { | |
13877 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 13878 | } |
489d5531 | 13879 | } |
13880 | psi1=aftsTrack->Phi(); | |
13881 | for(Int_t i2=0;i2<nPrim;i2++) | |
13882 | { | |
13883 | if(i2==i1) continue; | |
13884 | aftsTrack=anEvent->GetTrack(i2); | |
13885 | // RP condition (!(first) particle in the correlator must be RP): | |
13886 | if(!(aftsTrack->InRPSelection())) continue; | |
13887 | phi2=aftsTrack->Phi(); | |
13888 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
13889 | for(Int_t i3=0;i3<nPrim;i3++) | |
13890 | { | |
13891 | if(i3==i1||i3==i2) continue; | |
13892 | aftsTrack=anEvent->GetTrack(i3); | |
13893 | // RP condition (!(first) particle in the correlator must be RP): | |
13894 | if(!(aftsTrack->InRPSelection())) continue; | |
13895 | phi3=aftsTrack->Phi(); | |
13896 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
13897 | // sin terms: | |
13898 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 sin(n*(psi1+phi2-phi3))>> | |
13899 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1-phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 sin(n*(psi1-phi2-phi3))>> | |
13900 | // cos terms: | |
13901 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 cos(n*(psi1+phi2-phi3))>> | |
13902 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 cos(n*(psi1-phi2-phi3))>> | |
13903 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
13904 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
46b94261 | 13905 | }//end of for(Int_t i1=0;i1<nPrim;i1++) |
489d5531 | 13906 | |
13907 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
13908 | ||
2001bc3a | 13909 | //================================================================================================================================ |
13910 | ||
b3dacf6b | 13911 | void AliFlowAnalysisWithQCumulants::CheckPointersUsedInFinish() |
13912 | { | |
13913 | // Check all pointers used in method Finish(). | |
13914 | ||
b77b6434 | 13915 | if(!fAvMultiplicity) |
13916 | { | |
13917 | cout<<endl; | |
13918 | cout<<" WARNING (QC): fAvMultiplicity is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13919 | cout<<endl; | |
13920 | exit(0); | |
13921 | } | |
b3dacf6b | 13922 | if(!fIntFlowCorrelationsPro) |
13923 | { | |
13924 | cout<<endl; | |
13925 | cout<<" WARNING (QC): fIntFlowCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13926 | cout<<endl; | |
13927 | exit(0); | |
13928 | } | |
b40a910e | 13929 | if(!fIntFlowSquaredCorrelationsPro) |
13930 | { | |
13931 | cout<<endl; | |
13932 | cout<<" WARNING (QC): fIntFlowSquaredCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13933 | cout<<endl; | |
13934 | exit(0); | |
13935 | } | |
b3dacf6b | 13936 | if(!fIntFlowCorrelationsHist) |
13937 | { | |
13938 | cout<<endl; | |
13939 | cout<<" WARNING (QC): fIntFlowCorrelationsHist is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13940 | cout<<endl; | |
13941 | exit(0); | |
13942 | } | |
403e3389 | 13943 | if((fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) && !fIntFlowExtraCorrelationsPro) |
b77b6434 | 13944 | { |
13945 | cout<<endl; | |
13946 | cout<<" WARNING (QC): fIntFlowExtraCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13947 | cout<<endl; | |
13948 | exit(0); | |
13949 | } | |
b3dacf6b | 13950 | for(Int_t power=0;power<2;power++) |
13951 | { | |
13952 | if(!fIntFlowSumOfEventWeights[power]) | |
13953 | { | |
13954 | cout<<endl; | |
13955 | cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeights[%d] is NULL in CheckPointersUsedInFinish() !!!!",power)<<endl; | |
13956 | cout<<endl; | |
13957 | exit(0); | |
13958 | } | |
13959 | } // end of for(Int_t power=0;power<2;power++) | |
13960 | if(!fIntFlowProductOfCorrelationsPro) | |
13961 | { | |
13962 | cout<<endl; | |
13963 | cout<<" WARNING (QC): fIntFlowProductOfCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13964 | cout<<endl; | |
13965 | exit(0); | |
13966 | } | |
13967 | if(!fIntFlowSumOfProductOfEventWeights) | |
13968 | { | |
13969 | cout<<endl; | |
13970 | cout<<" WARNING (QC): fIntFlowSumOfProductOfEventWeights is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13971 | cout<<endl; | |
13972 | exit(0); | |
13973 | } | |
13974 | if(!fIntFlowCovariances) | |
13975 | { | |
13976 | cout<<endl; | |
13977 | cout<<" WARNING (QC): fIntFlowCovariances is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13978 | cout<<endl; | |
13979 | exit(0); | |
13980 | } | |
13981 | if(!fIntFlowQcumulants) | |
13982 | { | |
13983 | cout<<endl; | |
13984 | cout<<" WARNING (QC): fIntFlowQcumulants is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13985 | cout<<endl; | |
13986 | exit(0); | |
13987 | } | |
0dd3b008 | 13988 | if(!fIntFlow) |
13989 | { | |
13990 | cout<<endl; | |
13991 | cout<<" WARNING (QC): fIntFlow is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13992 | cout<<endl; | |
13993 | exit(0); | |
13994 | } | |
13995 | if(!fCommonHists) | |
13996 | { | |
13997 | cout<<endl; | |
13998 | cout<<" WARNING (QC): fCommonHists is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13999 | cout<<endl; | |
14000 | exit(0); | |
14001 | } | |
14002 | if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th)) | |
14003 | { | |
14004 | cout<<endl; | |
14005 | cout<<" WARNING (QC): fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th"<<endl; | |
14006 | cout<<" && fCommonHistsResults8th is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14007 | cout<<endl; | |
14008 | exit(0); | |
14009 | } | |
b3dacf6b | 14010 | |
b92ea2b9 | 14011 | // NUA stuff: |
14012 | for(Int_t sc=0;sc<2;sc++) // sin/cos | |
14013 | { | |
14014 | if(!fIntFlowCorrectionTermsForNUAPro[sc]) | |
14015 | { | |
14016 | cout<<endl; | |
14017 | cout<<Form(" WARNING (QC): fIntFlowCorrectionTermsForNUAPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",sc)<<endl; | |
14018 | cout<<endl; | |
14019 | exit(0); | |
14020 | } | |
14021 | if(!fIntFlowCorrectionTermsForNUAHist[sc]) | |
14022 | { | |
14023 | cout<<endl; | |
14024 | cout<<Form(" WARNING (QC): fIntFlowCorrectionTermsForNUAHist[%d] is NULL in CheckPointersUsedInFinish() !!!!",sc)<<endl; | |
14025 | cout<<endl; | |
14026 | exit(0); | |
14027 | } | |
14028 | for(Int_t lq=0;lq<2;lq++) // linear/quadratic | |
14029 | { | |
14030 | if(!fIntFlowSumOfEventWeightsNUA[sc][lq]) | |
14031 | { | |
14032 | cout<<endl; | |
14033 | cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeightsNUA[%d][%d] is NULL in CheckPointersUsedInFinish() !!!!",sc,lq)<<endl; | |
14034 | cout<<endl; | |
14035 | exit(0); | |
14036 | } | |
14037 | } // end of for(Int_t lq=0;lq<2;lq++) // linear/quadratic | |
14038 | } // end of for(Int_t power=0;power<2;power++) | |
14039 | if(!fIntFlowProductOfCorrectionTermsForNUAPro) | |
14040 | { | |
14041 | cout<<endl; | |
14042 | cout<<" WARNING (QC): fIntFlowProductOfCorrectionTermsForNUAPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14043 | cout<<endl; | |
14044 | exit(0); | |
14045 | } | |
14046 | if(!fIntFlowSumOfProductOfEventWeightsNUA) | |
14047 | { | |
14048 | cout<<endl; | |
14049 | cout<<" WARNING (QC): fIntFlowSumOfProductOfEventWeightsNUA is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14050 | cout<<endl; | |
14051 | exit(0); | |
14052 | } | |
14053 | if(!fIntFlowCovariancesNUA) | |
14054 | { | |
14055 | cout<<endl; | |
14056 | cout<<" WARNING (QC): fIntFlowCovariancesNUA is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14057 | cout<<endl; | |
14058 | exit(0); | |
14059 | } | |
14060 | if(!fIntFlowQcumulantsErrorSquaredRatio) | |
14061 | { | |
14062 | cout<<endl; | |
14063 | cout<<" WARNING (QC): fIntFlowQcumulantsErrorSquaredRatio is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14064 | cout<<endl; | |
14065 | exit(0); | |
14066 | } | |
14067 | if(!fIntFlowDetectorBias) | |
14068 | { | |
14069 | cout<<endl; | |
14070 | cout<<" WARNING (QC): fIntFlowDetectorBias is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14071 | cout<<endl; | |
14072 | exit(0); | |
14073 | } | |
14074 | ||
b3dacf6b | 14075 | // Versus multiplicity: |
14076 | if(!fCalculateCumulantsVsM){return;} | |
b77b6434 | 14077 | for(Int_t co=0;co<=3;co++) // cumulant order |
b3dacf6b | 14078 | { |
b77b6434 | 14079 | if(!fIntFlowQcumulantsVsM[co]) |
b3dacf6b | 14080 | { |
14081 | cout<<endl; | |
b77b6434 | 14082 | cout<<Form(" WARNING (QC): fIntFlowQcumulantsVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",co)<<endl; |
b3dacf6b | 14083 | cout<<endl; |
14084 | exit(0); | |
14085 | } | |
b77b6434 | 14086 | if(!fIntFlowVsM[co]) |
b3dacf6b | 14087 | { |
14088 | cout<<endl; | |
b77b6434 | 14089 | cout<<Form(" WARNING (QC): fIntFlowVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",co)<<endl; |
14090 | cout<<endl; | |
14091 | exit(0); | |
14092 | } | |
14093 | if(!fIntFlowDetectorBiasVsM[co]) | |
14094 | { | |
14095 | cout<<endl; | |
14096 | cout<<Form(" WARNING (QC): fIntFlowDetectorBiasVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",co)<<endl; | |
14097 | cout<<endl; | |
14098 | exit(0); | |
14099 | } | |
14100 | } // end of for(Int_t c0=0;c0<=3;c0++) // cumulant order | |
14101 | for(Int_t ci=0;ci<=3;ci++) // correlation index | |
14102 | { | |
14103 | if(!fIntFlowCorrelationsVsMPro[ci]) | |
14104 | { | |
14105 | cout<<endl; | |
14106 | cout<<Form(" WARNING (QC): fIntFlowCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl; | |
b3dacf6b | 14107 | cout<<endl; |
14108 | exit(0); | |
14109 | } | |
b40a910e | 14110 | if(!fIntFlowSquaredCorrelationsVsMPro[ci]) |
14111 | { | |
14112 | cout<<endl; | |
14113 | cout<<Form(" WARNING (QC): fIntFlowSquaredCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl; | |
14114 | cout<<endl; | |
14115 | exit(0); | |
14116 | } | |
b77b6434 | 14117 | if(!fIntFlowCorrelationsVsMHist[ci]) |
b92ea2b9 | 14118 | { |
14119 | cout<<endl; | |
b77b6434 | 14120 | cout<<Form(" WARNING (QC): fIntFlowCorrelationsVsMHist[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl; |
b92ea2b9 | 14121 | cout<<endl; |
14122 | exit(0); | |
14123 | } | |
b3dacf6b | 14124 | for(Int_t power=0;power<2;power++) |
14125 | { | |
14126 | if(!fIntFlowSumOfEventWeightsVsM[ci][power]) | |
14127 | { | |
14128 | cout<<endl; | |
14129 | cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeightsVsM[%d][%d] is NULL in CheckPointersUsedInFinish() !!!!",ci,power)<<endl; | |
14130 | cout<<endl; | |
14131 | exit(0); | |
14132 | } | |
14133 | } // end of for(Int_t power=0;power<2;power++) | |
14134 | } // end of for(Int_t ci=0;ci<=3;ci++) // correlation index | |
14135 | for(Int_t i=0;i<6;i++) | |
14136 | { | |
14137 | if(!fIntFlowProductOfCorrelationsVsMPro[i]) | |
14138 | { | |
14139 | cout<<endl; | |
14140 | cout<<Form(" WARNING (QC): fIntFlowProductOfCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl; | |
14141 | cout<<endl; | |
14142 | exit(0); | |
14143 | } | |
14144 | if(!fIntFlowSumOfProductOfEventWeightsVsM[i]) | |
14145 | { | |
14146 | cout<<endl; | |
14147 | cout<<Form(" WARNING (QC): fIntFlowSumOfProductOfEventWeightsVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl; | |
14148 | cout<<endl; | |
14149 | exit(0); | |
14150 | } | |
14151 | if(!fIntFlowCovariancesVsM[i]) | |
14152 | { | |
14153 | cout<<endl; | |
14154 | cout<<Form(" WARNING (QC): fIntFlowCovariancesVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl; | |
14155 | cout<<endl; | |
14156 | exit(0); | |
14157 | } | |
14158 | } // end of for(Int_t i=0;i<6;i++) | |
14159 | if(!fIntFlowRebinnedInM) | |
14160 | { | |
14161 | cout<<endl; | |
14162 | cout<<" WARNING (QC): fIntFlowRebinnedInM is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14163 | cout<<endl; | |
14164 | exit(0); | |
14165 | } | |
14166 | if(!fIntFlowQcumulantsRebinnedInM) | |
14167 | { | |
14168 | cout<<endl; | |
14169 | cout<<" WARNING (QC): fIntFlowQcumulantsRebinnedInM is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14170 | cout<<endl; | |
14171 | exit(0); | |
14172 | } | |
14173 | ||
14174 | } // end of void AliFlowAnalysisWithQCumulants::CheckPointersUsedInFinish() | |
14175 | ||
14176 | //================================================================================================================================ | |
14177 | ||
14178 | void AliFlowAnalysisWithQCumulants::CheckPointersUsedInMake() | |
14179 | { | |
1268c371 | 14180 | // Check all pointers used in method Make(). // to be improved - check other pointers as well |
b3dacf6b | 14181 | |
b77b6434 | 14182 | if(!fAvMultiplicity) |
14183 | { | |
1268c371 | 14184 | printf("\n WARNING (QC): fAvMultiplicity is NULL in CheckPointersUsedInMake() !!!!\n\n"); |
b77b6434 | 14185 | exit(0); |
14186 | } | |
403e3389 | 14187 | if((fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) && !fIntFlowExtraCorrelationsPro) |
b77b6434 | 14188 | { |
1268c371 | 14189 | printf("\n WARNING (QC): fIntFlowExtraCorrelationsPro is NULL in CheckPointersUsedInMake() !!!!\n\n"); |
b77b6434 | 14190 | exit(0); |
14191 | } | |
1268c371 | 14192 | // 2D: |
14193 | if(fCalculate2DDiffFlow) | |
14194 | { | |
14195 | for(Int_t t=0;t<2;t++) // type = RP or POI | |
14196 | { | |
14197 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
14198 | { | |
14199 | if(!f2DDiffFlowCorrelationsPro[t][rci]) | |
14200 | { | |
14201 | printf("\n WARNING (QC): f2DDiffFlowCorrelationsPro[%i][%i] is NULL in CheckPointersUsedInMake() !!!!\n\n",t,rci); | |
14202 | exit(0); | |
14203 | } // end of if(!f2DDiffFlowCorrelationsPro[t][rci]) | |
14204 | } // end of for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
14205 | } // end of for(Int_t t=0;t<2;t++) | |
14206 | } // end of if(fCalculate2DDiffFlow) | |
b3dacf6b | 14207 | |
14208 | } // end of void AliFlowAnalysisWithQCumulants::CheckPointersUsedInMake() | |
14209 | ||
57340a27 | 14210 |