| bc92c0cb |
1 | /************************************************************************* |
| 2 | * Copyright(c) 1998-2008, ALICE Experiment at CERN, All rights reserved. * |
| 3 | * * |
| 4 | * Author: The ALICE Off-line Project. * |
| 5 | * Contributors are mentioned in the code where appropriate. * |
| 6 | * * |
| 7 | * Permission to use, copy, modify and distribute this software and its * |
| 8 | * documentation strictly for non-commercial purposes is hereby granted * |
| 9 | * without fee, provided that the above copyright notice appears in all * |
| 10 | * copies and that both the copyright notice and this permission notice * |
| 11 | * appear in the supporting documentation. The authors make no claims * |
| 12 | * about the suitability of this software for any purpose. It is * |
| 13 | * provided "as is" without express or implied warranty. * |
| 14 | **************************************************************************/ |
| 15 | |
| 16 | /********************************** |
| 17 | * flow analysis with Q-cumulants * |
| 18 | * * |
| 19 | * author: Ante Bilandzic * |
| 20 | * (anteb@nikhef.nl) * |
| 21 | *********************************/ |
| 22 | |
| 23 | #define AliFlowAnalysisWithQCumulants_cxx |
| 24 | |
| 25 | #include "Riostream.h" |
| 26 | #include "AliFlowCommonConstants.h" |
| 27 | #include "AliFlowCommonHist.h" |
| 28 | #include "AliFlowCommonHistResults.h" |
| 29 | #include "TChain.h" |
| 30 | #include "TFile.h" |
| 1315fe58 |
31 | #include "TList.h" |
| e085f1a9 |
32 | #include "TGraph.h" |
| bc92c0cb |
33 | #include "TParticle.h" |
| 34 | #include "TRandom3.h" |
| 1315fe58 |
35 | #include "TStyle.h" |
| bc92c0cb |
36 | #include "TProfile.h" |
| 37 | #include "TProfile2D.h" |
| 38 | #include "TProfile3D.h" |
| 1dfa3c16 |
39 | #include "TMath.h" |
| e085f1a9 |
40 | #include "TArrow.h" |
| 41 | #include "TPaveLabel.h" |
| 42 | #include "TCanvas.h" |
| bc92c0cb |
43 | #include "AliFlowEventSimple.h" |
| 44 | #include "AliFlowTrackSimple.h" |
| 45 | #include "AliFlowAnalysisWithQCumulants.h" |
| 3d824203 |
46 | #include "TArrayD.h" |
| bc92c0cb |
47 | #include "TRandom.h" |
| 2bdc5281 |
48 | #include "TF1.h" |
| bc92c0cb |
49 | |
| 50 | class TH1; |
| 9c1a9547 |
51 | class TH2; |
| bc92c0cb |
52 | class TGraph; |
| 53 | class TPave; |
| 54 | class TLatex; |
| 55 | class TMarker; |
| 56 | class TRandom3; |
| 57 | class TObjArray; |
| 58 | class TList; |
| 59 | class TCanvas; |
| 60 | class TSystem; |
| 61 | class TROOT; |
| 62 | class AliFlowVector; |
| 63 | class TVector; |
| 64 | |
| 65 | //================================================================================================================ |
| 66 | |
| 67 | ClassImp(AliFlowAnalysisWithQCumulants) |
| 68 | |
| 69 | AliFlowAnalysisWithQCumulants::AliFlowAnalysisWithQCumulants(): |
| 70 | fTrack(NULL), |
| 71 | fHistList(NULL), |
| ae733b3b |
72 | fDiffFlowList(NULL), |
| 03a02aca |
73 | fWeightsList(NULL), |
| 9c1a9547 |
74 | fResultsList(NULL), |
| 1315fe58 |
75 | fAvMultIntFlowQC(NULL), |
| bc92c0cb |
76 | fQvectorComponents(NULL), |
| 1315fe58 |
77 | fDiffFlowResults2ndOrderQC(NULL), |
| 78 | fDiffFlowResults4thOrderQC(NULL), |
| 79 | fCovariances(NULL), |
| e085f1a9 |
80 | fQvectorForEachEventX(NULL),//to be removed |
| 81 | fQvectorForEachEventY(NULL),//to be removed |
| bc92c0cb |
82 | fQCorrelations(NULL), |
| 9c1a9547 |
83 | fQCorrelationsW(NULL), |
| c365fe76 |
84 | fQCorrectionsCos(NULL), |
| 85 | fQCorrectionsSin(NULL), |
| 8842fb2b |
86 | fQProduct(NULL), |
| bc92c0cb |
87 | fDirectCorrelations(NULL), |
| 9c1a9547 |
88 | fDirectCorrelationsW(NULL), |
| 89 | fDirectCorrelationsDiffFlow(NULL), |
| 90 | fDirectCorrelationsDiffFlowW(NULL), |
| c365fe76 |
91 | fDirectCorrectionsCos(NULL), |
| 92 | fDirectCorrectionsSin(NULL), |
| 2bdc5281 |
93 | fDirectCorrectionsDiffFlowCos(NULL), |
| 94 | fDirectCorrectionsDiffFlowSin(NULL), |
| 1dfa3c16 |
95 | f2PerPtBin1n1nPOI(NULL), |
| 1dfa3c16 |
96 | f4PerPtBin1n1n1n1nPOI(NULL), |
| 1dfa3c16 |
97 | f2PerEtaBin1n1nPOI(NULL), |
| 1dfa3c16 |
98 | f4PerEtaBin1n1n1n1nPOI(NULL), |
| 3d824203 |
99 | f2WPerPtBin1n1nPOI(NULL), |
| 3d824203 |
100 | f4WPerPtBin1n1n1n1nPOI(NULL), |
| 3d824203 |
101 | f2WPerEtaBin1n1nPOI(NULL), |
| 102 | f4WPerEtaBin1n1n1n1nPOI(NULL), |
| 77515452 |
103 | f2PerPtBin1n1nRP(NULL), |
| 104 | f4PerPtBin1n1n1n1nRP(NULL), |
| 105 | f2PerEtaBin1n1nRP(NULL), |
| 106 | f4PerEtaBin1n1n1n1nRP(NULL), |
| 3d824203 |
107 | f2WPerPtBin1n1nRP(NULL), |
| 108 | f4WPerPtBin1n1n1n1nRP(NULL), |
| 3d824203 |
109 | f2WPerEtaBin1n1nRP(NULL), |
| 110 | f4WPerEtaBin1n1n1n1nRP(NULL), |
| cb308e83 |
111 | fCommonHists2nd(NULL), |
| 112 | fCommonHists4th(NULL), |
| 113 | fCommonHists6th(NULL), |
| 114 | fCommonHists8th(NULL), |
| 8842fb2b |
115 | fCommonHistsResults2nd(NULL), |
| 116 | fCommonHistsResults4th(NULL), |
| 117 | fCommonHistsResults6th(NULL), |
| 118 | fCommonHistsResults8th(NULL), |
| 52021ae2 |
119 | f2pDistribution(NULL), |
| 120 | f4pDistribution(NULL), |
| 121 | f6pDistribution(NULL), |
| 5e838eeb |
122 | f8pDistribution(NULL), |
| 8842fb2b |
123 | fnBinsPt(0), |
| 124 | fPtMin(0), |
| 1dfa3c16 |
125 | fPtMax(0), |
| 126 | fnBinsEta(0), |
| 127 | fEtaMin(0), |
| e085f1a9 |
128 | fEtaMax(0), |
| 129 | fEventCounter(0), |
| 130 | fUsePhiWeights(kFALSE), |
| 131 | fUsePtWeights(kFALSE), |
| 9c1a9547 |
132 | fUseEtaWeights(kFALSE), |
| 133 | fUseWeights(kFALSE), |
| 134 | fUseWeightsBits(NULL), |
| 2bdc5281 |
135 | |
| 136 | // .................................................... |
| 137 | // POI: |
| 138 | fCorrectionsCosP1nPsiPtEtaPOI(NULL), |
| 139 | fCorrectionsSinP1nPsiPtEtaPOI(NULL), |
| 140 | |
| 141 | // RP: |
| 142 | fCorrectionsCosP1nPsiPtEtaRP(NULL), |
| 143 | fCorrectionsSinP1nPsiPtEtaRP(NULL), |
| 144 | // .................................................... |
| 145 | |
| 9c1a9547 |
146 | |
| 147 | // ................................................................................................................... |
| 148 | // Q_{n,k} and S^M_{n,k}: |
| 149 | fReQ(NULL), |
| 150 | fImQ(NULL), |
| 151 | fSMpk(NULL), |
| 152 | |
| 153 | // q_n and m: |
| 154 | fReqnPtEta(NULL), |
| 155 | fImqnPtEta(NULL), |
| 156 | fmPtEta(NULL), |
| 157 | |
| 158 | // non-weighted q''_{n} and q''_{2n}: |
| 159 | fReqPrimePrime1nPtEta(NULL), |
| 160 | fImqPrimePrime1nPtEta(NULL), |
| 161 | fReqPrimePrime2nPtEta(NULL), |
| 162 | fImqPrimePrime2nPtEta(NULL), |
| 163 | |
| 164 | // weighted q''_{n,2k} and q''_{2n,k}: |
| 165 | fReqPrimePrime1n2kPtEta(NULL), |
| 166 | fImqPrimePrime1n2kPtEta(NULL), |
| 167 | fReqPrimePrime2n1kPtEta(NULL), |
| 168 | fImqPrimePrime2n1kPtEta(NULL), |
| 169 | |
| 170 | // m'' |
| 171 | fmPrimePrimePtEta(NULL), |
| 172 | |
| 173 | // S^{m''}_{n,k} |
| 174 | fSmPrimePrime1p1kPtEta(NULL), |
| 175 | fSmPrimePrime1p2kPtEta(NULL), |
| 176 | fSmPrimePrime1p3kPtEta(NULL), |
| 177 | |
| 178 | // non-weighted q_RP{n} and q_RP{2n}: |
| 179 | fReqRP1nPtEta(NULL), |
| 180 | fImqRP1nPtEta(NULL), |
| 181 | fReqRP2nPtEta(NULL), |
| 182 | fImqRP2nPtEta(NULL), |
| 183 | |
| 184 | // weighted q_RP{n,2k} and q_RP{2n,k} (for each (pt,eta) bin for RPs) |
| 185 | fReqRP1n2kPtEta(NULL), |
| 186 | fImqRP1n2kPtEta(NULL), |
| 187 | fReqRP2n1kPtEta(NULL), |
| 188 | fImqRP2n1kPtEta(NULL), |
| 189 | |
| 190 | // m_RP: |
| 191 | fmRPPtEta(NULL), // # of particles which are RPs for each (pt,eta) bin |
| 192 | |
| 193 | // S^{m_RP}_{p,k} (for each (pt,eta) bin for RPs): |
| 194 | fSmRP1p1kPtEta(NULL), |
| 195 | fSmRP1p2kPtEta(NULL), |
| 196 | fSmRP1p3kPtEta(NULL), |
| 197 | |
| 198 | // ----- RESULTS ---- |
| 199 | |
| c365fe76 |
200 | fFinalCorrectionsForNUA(NULL), // NUA = non-uniform acceptance |
| 201 | |
| 9c1a9547 |
202 | // non-weighted integrated flow: |
| 203 | fIntFlowResultsQC(NULL), |
| 204 | fIntFlowResultsPOIQC(NULL), |
| 205 | fIntFlowResultsRPQC(NULL), |
| 206 | |
| 207 | // weighted integrated flow: |
| 208 | fIntFlowResultsQCW(NULL), |
| 209 | fIntFlowResultsPOIQCW(NULL), |
| 210 | fIntFlowResultsRPQCW(NULL), |
| 211 | |
| 212 | // non-weighted correlations for each (pt,eta) bin for POIs: |
| 213 | f2pPtEtaPOI(NULL), |
| 214 | f4pPtEtaPOI(NULL), |
| 215 | f6pPtEtaPOI(NULL), |
| 216 | f8pPtEtaPOI(NULL), |
| 217 | |
| 2bdc5281 |
218 | // corrections for non-uniform acceptance to non-weighted correlations for each (pt,eta) bin for POIs: |
| 219 | f2pFinalCorrectionsForNUAPtEtaPOI(NULL), |
| 220 | f4pFinalCorrectionsForNUAPtEtaPOI(NULL), |
| 221 | f6pFinalCorrectionsForNUAPtEtaPOI(NULL), |
| 222 | f8pFinalCorrectionsForNUAPtEtaPOI(NULL), |
| 223 | |
| 224 | // corrections for non-uniform acceptance to non-weighted correlations for each (pt) bin for POIs: |
| 225 | f2pFinalCorrectionsForNUAPtPOI(NULL), |
| 226 | f4pFinalCorrectionsForNUAPtPOI(NULL), |
| 227 | f6pFinalCorrectionsForNUAPtPOI(NULL), |
| 228 | f8pFinalCorrectionsForNUAPtPOI(NULL), |
| 229 | |
| 230 | // corrections for non-uniform acceptance to non-weighted correlations for each (eta) bin for POIs: |
| 231 | f2pFinalCorrectionsForNUAEtaPOI(NULL), |
| 232 | f4pFinalCorrectionsForNUAEtaPOI(NULL), |
| 233 | f6pFinalCorrectionsForNUAEtaPOI(NULL), |
| 234 | f8pFinalCorrectionsForNUAEtaPOI(NULL), |
| 235 | |
| 9c1a9547 |
236 | // non-weighted final results for differential flow for POIs: |
| 237 | // 3D (pt,eta) |
| 238 | fvn2ndPtEtaPOI(NULL), |
| 239 | fvn4thPtEtaPOI(NULL), |
| 240 | fvn6thPtEtaPOI(NULL), |
| 241 | fvn8thPtEtaPOI(NULL), |
| 242 | // 2D (pt) |
| 243 | fvn2ndPtPOI(NULL), |
| 244 | fvn4thPtPOI(NULL), |
| 245 | fvn6thPtPOI(NULL), |
| 246 | fvn8thPtPOI(NULL), |
| 247 | // 2D (eta) |
| 248 | fvn2ndEtaPOI(NULL), |
| 249 | fvn4thEtaPOI(NULL), |
| 250 | fvn6thEtaPOI(NULL), |
| 251 | fvn8thEtaPOI(NULL), |
| 252 | |
| 253 | // weighted correlations for each (pt,eta) bin for POIs: |
| 254 | f2pPtEtaPOIW(NULL), |
| 255 | f4pPtEtaPOIW(NULL), |
| 256 | f6pPtEtaPOIW(NULL), |
| 257 | f8pPtEtaPOIW(NULL), |
| 258 | |
| 259 | // weighted final results for differential flow for POIs: |
| 260 | // 3D (pt,eta) |
| 261 | fvn2ndPtEtaPOIW(NULL), |
| 262 | fvn4thPtEtaPOIW(NULL), |
| 263 | fvn6thPtEtaPOIW(NULL), |
| 264 | fvn8thPtEtaPOIW(NULL), |
| 265 | // 2D (pt) |
| 266 | fvn2ndPtPOIW(NULL), |
| 267 | fvn4thPtPOIW(NULL), |
| 268 | fvn6thPtPOIW(NULL), |
| 269 | fvn8thPtPOIW(NULL), |
| 270 | // 2D (eta) |
| 271 | fvn2ndEtaPOIW(NULL), |
| 272 | fvn4thEtaPOIW(NULL), |
| 273 | fvn6thEtaPOIW(NULL), |
| 274 | fvn8thEtaPOIW(NULL), |
| 275 | |
| 276 | // non-weighted correlations for each (pt,eta) bin for RPs: |
| 277 | f2pPtEtaRP(NULL), |
| 278 | f4pPtEtaRP(NULL), |
| 279 | f6pPtEtaRP(NULL), |
| 280 | f8pPtEtaRP(NULL), |
| 281 | |
| 2bdc5281 |
282 | // corrections for non-uniform acceptance to non-weighted correlations for each (pt,eta) bin for RPs: |
| 283 | f2pFinalCorrectionsForNUAPtEtaRP(NULL), |
| 284 | f4pFinalCorrectionsForNUAPtEtaRP(NULL), |
| 285 | f6pFinalCorrectionsForNUAPtEtaRP(NULL), |
| 286 | f8pFinalCorrectionsForNUAPtEtaRP(NULL), |
| 287 | |
| 288 | // corrections for non-uniform acceptance to non-weighted correlations for each (pt) bin for RPs: |
| 289 | f2pFinalCorrectionsForNUAPtRP(NULL), |
| 290 | f4pFinalCorrectionsForNUAPtRP(NULL), |
| 291 | f6pFinalCorrectionsForNUAPtRP(NULL), |
| 292 | f8pFinalCorrectionsForNUAPtRP(NULL), |
| 293 | |
| 294 | // corrections for non-uniform acceptance to non-weighted correlations for each (eta) bin for RPs: |
| 295 | f2pFinalCorrectionsForNUAEtaRP(NULL), |
| 296 | f4pFinalCorrectionsForNUAEtaRP(NULL), |
| 297 | f6pFinalCorrectionsForNUAEtaRP(NULL), |
| 298 | f8pFinalCorrectionsForNUAEtaRP(NULL), |
| 299 | |
| 9c1a9547 |
300 | // non-weighted final results for differential flow for RPs: |
| 301 | // 3D (pt,eta) |
| 302 | fvn2ndPtEtaRP(NULL), |
| 303 | fvn4thPtEtaRP(NULL), |
| 304 | fvn6thPtEtaRP(NULL), |
| 305 | fvn8thPtEtaRP(NULL), |
| 306 | // 2D (pt) |
| 307 | fvn2ndPtRP(NULL), |
| 308 | fvn4thPtRP(NULL), |
| 309 | fvn6thPtRP(NULL), |
| 310 | fvn8thPtRP(NULL), |
| 311 | // 2D (eta) |
| 312 | fvn2ndEtaRP(NULL), |
| 313 | fvn4thEtaRP(NULL), |
| 314 | fvn6thEtaRP(NULL), |
| 315 | fvn8thEtaRP(NULL), |
| 316 | |
| 317 | // weighted correlations for each (pt,eta) bin for RPs: |
| 318 | f2pPtEtaRPW(NULL), |
| 319 | f4pPtEtaRPW(NULL), |
| 320 | f6pPtEtaRPW(NULL), |
| 321 | f8pPtEtaRPW(NULL), |
| 322 | |
| 323 | // weighted final results for differential flow for RPs: |
| 324 | // 3D (pt,eta) |
| 325 | fvn2ndPtEtaRPW(NULL), |
| 326 | fvn4thPtEtaRPW(NULL), |
| 327 | fvn6thPtEtaRPW(NULL), |
| 328 | fvn8thPtEtaRPW(NULL), |
| 329 | // 2D (pt) |
| 330 | fvn2ndPtRPW(NULL), |
| 331 | fvn4thPtRPW(NULL), |
| 332 | fvn6thPtRPW(NULL), |
| 333 | fvn8thPtRPW(NULL), |
| 334 | // 2D (eta) |
| 335 | fvn2ndEtaRPW(NULL), |
| 336 | fvn4thEtaRPW(NULL), |
| 337 | fvn6thEtaRPW(NULL), |
| 338 | fvn8thEtaRPW(NULL) |
| 339 | // ................................................................................................................... |
| 340 | |
| bc92c0cb |
341 | { |
| 9c1a9547 |
342 | // constructor |
| ae733b3b |
343 | fHistList = new TList(); |
| 344 | fDiffFlowList = new TList(); |
| 345 | fDiffFlowList->SetName("DifferentialFlow"); |
| 9455e15e |
346 | fDiffFlowList->SetOwner(kTRUE); |
| 03a02aca |
347 | fWeightsList = new TList(); |
| ae733b3b |
348 | fWeightsList->SetName("Weights"); |
| 9455e15e |
349 | fWeightsList->SetOwner(kTRUE); |
| 9c1a9547 |
350 | fResultsList = new TList(); |
| 351 | fResultsList->SetName("Results"); |
| 9455e15e |
352 | fResultsList->SetOwner(kTRUE); |
| 03a02aca |
353 | |
| 8842fb2b |
354 | fnBinsPt = AliFlowCommonConstants::GetNbinsPt(); |
| 355 | fPtMin = AliFlowCommonConstants::GetPtMin(); |
| 356 | fPtMax = AliFlowCommonConstants::GetPtMax(); |
| 357 | |
| 1dfa3c16 |
358 | fnBinsEta = AliFlowCommonConstants::GetNbinsEta(); |
| 359 | fEtaMin = AliFlowCommonConstants::GetEtaMin(); |
| 360 | fEtaMax = AliFlowCommonConstants::GetEtaMax(); |
| bc92c0cb |
361 | } |
| 362 | |
| 363 | AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants() |
| 364 | { |
| 03a02aca |
365 | //destructor |
| bc92c0cb |
366 | delete fHistList; |
| ae733b3b |
367 | delete fDiffFlowList; |
| 368 | delete fWeightsList; |
| 9c1a9547 |
369 | delete fResultsList; |
| bc92c0cb |
370 | } |
| 371 | |
| 372 | //================================================================================================================ |
| 373 | |
| e085f1a9 |
374 | void AliFlowAnalysisWithQCumulants::Init() |
| bc92c0cb |
375 | { |
| 376 | //various output histograms |
| bc92c0cb |
377 | //avarage multiplicity |
| 1315fe58 |
378 | fAvMultIntFlowQC = new TProfile("fAvMultIntFlowQC","Average Multiplicity",1,0,1,"s"); |
| 379 | fAvMultIntFlowQC->SetXTitle(""); |
| 380 | fAvMultIntFlowQC->SetYTitle(""); |
| 381 | fAvMultIntFlowQC->SetLabelSize(0.06); |
| 382 | fAvMultIntFlowQC->SetMarkerStyle(25); |
| 383 | fAvMultIntFlowQC->SetLabelOffset(0.01); |
| 384 | (fAvMultIntFlowQC->GetXaxis())->SetBinLabel(1,"Average Multiplicity"); |
| 385 | fHistList->Add(fAvMultIntFlowQC); |
| bc92c0cb |
386 | |
| 387 | //Q-vector stuff |
| 388 | fQvectorComponents = new TProfile("fQvectorComponents","Avarage of Q-vector components",44,0.,44.,"s"); |
| 389 | fQvectorComponents->SetXTitle(""); |
| 390 | fQvectorComponents->SetYTitle(""); |
| 391 | //fHistList->Add(fQvectorComponents); |
| 392 | |
| bc92c0cb |
393 | //final results for differential flow from 2nd order Q-cumulant |
| 8842fb2b |
394 | fDiffFlowResults2ndOrderQC = new TH1D("fDiffFlowResults2ndOrderQC","Differential Flow from 2nd Order Q-cumulant",fnBinsPt,fPtMin,fPtMax); |
| 1315fe58 |
395 | fDiffFlowResults2ndOrderQC->SetXTitle("p_{t} [GeV]"); |
| 396 | //fDiffFlowResults2ndOrderQC->SetYTitle("Differential Flow"); |
| 397 | fHistList->Add(fDiffFlowResults2ndOrderQC); |
| bc92c0cb |
398 | |
| 399 | //final results for differential flow from 4th order Q-cumulant |
| 8842fb2b |
400 | fDiffFlowResults4thOrderQC = new TH1D("fDiffFlowResults4thOrderQC","Differential Flow from 4th Order Q-cumulant",fnBinsPt,fPtMin,fPtMax); |
| 1315fe58 |
401 | fDiffFlowResults4thOrderQC->SetXTitle("p_{t} [GeV]"); |
| 402 | //fDiffFlowResults4thOrderQC->SetYTitle("Differential Flow"); |
| 403 | fHistList->Add(fDiffFlowResults4thOrderQC); |
| 404 | |
| 405 | //final results for covariances (1st bin: <2*4>-<2>*<4>, 2nd bin: <2*6>-<2>*<6>, ...) |
| 406 | fCovariances = new TH1D("fCovariances","Covariances",6,0,6); |
| 407 | //fCovariances->SetXTitle(""); |
| 408 | //fCovariances->SetYTitle("<covariance>"); |
| 409 | fCovariances->SetLabelSize(0.04); |
| 410 | fCovariances->SetTickLength(1); |
| 411 | fCovariances->SetMarkerStyle(25); |
| 412 | (fCovariances->GetXaxis())->SetBinLabel(1,"Cov(2,4)"); |
| 413 | (fCovariances->GetXaxis())->SetBinLabel(2,"Cov(2,6)"); |
| 414 | (fCovariances->GetXaxis())->SetBinLabel(3,"Cov(2,8)"); |
| 415 | (fCovariances->GetXaxis())->SetBinLabel(4,"Cov(4,6)"); |
| 416 | (fCovariances->GetXaxis())->SetBinLabel(5,"Cov(4,8)"); |
| 417 | (fCovariances->GetXaxis())->SetBinLabel(6,"Cov(6,8)"); |
| 418 | fHistList->Add(fCovariances); |
| bc92c0cb |
419 | |
| e085f1a9 |
420 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| 421 | // !!!! to be removed !!!! |
| 422 | //profile containing the x-components of Q-vectors from all events |
| 423 | fQvectorForEachEventX = new TProfile("fQvectorForEachEventX","x-components of Q-vectors",44000,1,44000,"s"); |
| 424 | fHistList->Add(fQvectorForEachEventX); |
| 425 | |
| 426 | //profile containing the y-components of Q-vectors from all events |
| 427 | fQvectorForEachEventY = new TProfile("fQvectorForEachEventY","y-components of Q-vectors",44000,1,44000,"s"); |
| 428 | fHistList->Add(fQvectorForEachEventY); |
| 429 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| 430 | |
| 9c1a9547 |
431 | // multi-particle correlations calculated from Q-vectors |
| dee1e0e0 |
432 | fQCorrelations = new TProfile("fQCorrelations","multi-particle correlations from Q-vectors",32,0,32,"s"); |
| 1315fe58 |
433 | fQCorrelations->SetTickLength(-0.01,"Y"); |
| 434 | fQCorrelations->SetMarkerStyle(25); |
| 435 | fQCorrelations->SetLabelSize(0.03); |
| 436 | fQCorrelations->SetLabelOffset(0.01,"Y"); |
| 9c1a9547 |
437 | // 2-p: |
| 1315fe58 |
438 | (fQCorrelations->GetXaxis())->SetBinLabel(1,"<<2>>_{n|n}"); |
| 439 | (fQCorrelations->GetXaxis())->SetBinLabel(2,"<<2>>_{2n|2n}"); |
| 440 | (fQCorrelations->GetXaxis())->SetBinLabel(3,"<<2>>_{3n|3n}"); |
| 441 | (fQCorrelations->GetXaxis())->SetBinLabel(4,"<<2>>_{4n|4n}"); |
| 9c1a9547 |
442 | // 3-p: |
| 1315fe58 |
443 | (fQCorrelations->GetXaxis())->SetBinLabel(6,"<<3>>_{2n|n,n}"); |
| 444 | (fQCorrelations->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}"); |
| 445 | (fQCorrelations->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}"); |
| 446 | (fQCorrelations->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}"); |
| 9c1a9547 |
447 | // 4-p: |
| 1315fe58 |
448 | (fQCorrelations->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}"); |
| 449 | (fQCorrelations->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}"); |
| dee1e0e0 |
450 | (fQCorrelations->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}"); |
| 451 | (fQCorrelations->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}"); |
| 452 | (fQCorrelations->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}"); |
| 453 | (fQCorrelations->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}"); |
| 454 | (fQCorrelations->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}"); |
| 9c1a9547 |
455 | // 5-p: |
| dee1e0e0 |
456 | (fQCorrelations->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}"); |
| 457 | (fQCorrelations->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}"); |
| 458 | (fQCorrelations->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}"); |
| 459 | (fQCorrelations->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}"); |
| 9c1a9547 |
460 | // 6-p: |
| dee1e0e0 |
461 | (fQCorrelations->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}"); |
| 462 | (fQCorrelations->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}"); |
| 463 | (fQCorrelations->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}"); |
| 464 | (fQCorrelations->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}"); |
| 9c1a9547 |
465 | // 7-p: |
| dee1e0e0 |
466 | (fQCorrelations->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}"); |
| 9c1a9547 |
467 | // 8-p: |
| dee1e0e0 |
468 | (fQCorrelations->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}"); |
| 9c1a9547 |
469 | // add fQCorrelations to the main list: |
| bc92c0cb |
470 | fHistList->Add(fQCorrelations); |
| 471 | |
| 9c1a9547 |
472 | //......................................................................... |
| 3d824203 |
473 | //weighted multi-particle correlations calculated from Q-vectors |
| 9c1a9547 |
474 | fQCorrelationsW = new TProfile("fQCorrelationsW","weighted multi-particle correlations from Q-vectors",200,0,200,"s"); |
| 475 | fQCorrelationsW->SetTickLength(-0.01,"Y"); |
| 476 | fQCorrelationsW->SetMarkerStyle(25); |
| 477 | fQCorrelationsW->SetLabelSize(0.03); |
| 478 | fQCorrelationsW->SetLabelOffset(0.01,"Y"); |
| 479 | // 2-p: |
| 480 | (fQCorrelationsW->GetXaxis())->SetBinLabel(1,"<w_{1}w_{2}cos(n(#phi_{1}-#phi_{2}))>"); |
| 481 | (fQCorrelationsW->GetXaxis())->SetBinLabel(2,"<w_{1}^{2}w_{2}^{2}cos(2n(#phi_{1}-#phi_{2}))>"); |
| 482 | (fQCorrelationsW->GetXaxis())->SetBinLabel(3,"<w_{1}^{3}w_{2}^{3}cos(3n(#phi_{1}-#phi_{2}))>"); |
| 483 | (fQCorrelationsW->GetXaxis())->SetBinLabel(4,"<w_{1}^{4}w_{2}^{4}cos(4n(#phi_{1}-#phi_{2}))>"); |
| 484 | (fQCorrelationsW->GetXaxis())->SetBinLabel(5,"<w_{1}^{3}w_{2}cos(n(#phi_{1}-#phi_{2}))>"); |
| 485 | (fQCorrelationsW->GetXaxis())->SetBinLabel(6,"<w_{1}^{2}w_{2}w_{3}cos(n(#phi_{1}-#phi_{2}))>"); |
| 486 | // 3-p: |
| 487 | (fQCorrelationsW->GetXaxis())->SetBinLabel(21,"<w_{1}w_{2}w_{3}^{2}cos(n(2#phi_{1}-#phi_{2}-#phi_{3}))>"); |
| 488 | // 4-p: |
| 489 | (fQCorrelationsW->GetXaxis())->SetBinLabel(41,"<w_{1}w_{2}w_{3}w_{4}cos(n(#phi_{1}+#phi_{2}-#phi_{3}-#phi_{4}))>"); |
| 490 | // add fQCorrelationsW to the main list: |
| 491 | fHistList->Add(fQCorrelationsW); |
| 492 | //......................................................................... |
| 3d824203 |
493 | |
| c365fe76 |
494 | //......................................................................... |
| 495 | // corrections for non-uniform acceptance (cos terms) calculated from Q-vectors |
| 496 | fQCorrectionsCos = new TProfile("fQCorrectionsCos"," corrections for non-uniform acceptance (cos terms)",100,0,100,"s"); |
| 497 | fQCorrectionsCos->SetTickLength(-0.01,"Y"); |
| 498 | fQCorrectionsCos->SetMarkerStyle(25); |
| 499 | fQCorrectionsCos->SetLabelSize(0.03); |
| 500 | fQCorrectionsCos->SetLabelOffset(0.01,"Y"); |
| 501 | // 1-p: |
| 502 | (fQCorrectionsCos->GetXaxis())->SetBinLabel(1,"cos(n(#phi_{1}))>"); |
| 503 | // 2-p: |
| 504 | // 3-p: |
| 3d824203 |
505 | |
| c365fe76 |
506 | // add fQCorrectionsCos to the main list: |
| 507 | fHistList->Add(fQCorrectionsCos); |
| 508 | //......................................................................... |
| 509 | |
| 510 | // corrections for non-uniform acceptance (cos terms) calculated with nested loops |
| 511 | fDirectCorrectionsCos = new TProfile("fDirectCorrectionsCos"," corrections for non-uniform acceptance (cos terms)",100,0,100,"s"); |
| 512 | fDirectCorrectionsCos->SetTickLength(-0.01,"Y"); |
| 513 | fDirectCorrectionsCos->SetMarkerStyle(25); |
| 514 | fDirectCorrectionsCos->SetLabelSize(0.03); |
| 515 | fDirectCorrectionsCos->SetLabelOffset(0.01,"Y"); |
| 516 | // binned in the samw way as fQCorrectionsCos (see above) |
| 517 | // add fDirectCorrectionsCos to the main list: |
| 518 | fHistList->Add(fDirectCorrectionsCos); |
| 519 | |
| 520 | //......................................................................... |
| 521 | // corrections for non-uniform acceptance (sin terms) calculated from Q-vectors |
| 522 | fQCorrectionsSin = new TProfile("fQCorrectionsSin"," corrections for non-uniform acceptance (sin terms)",100,0,100,"s"); |
| 523 | fQCorrectionsSin->SetTickLength(-0.01,"Y"); |
| 524 | fQCorrectionsSin->SetMarkerStyle(25); |
| 525 | fQCorrectionsSin->SetLabelSize(0.03); |
| 526 | fQCorrectionsSin->SetLabelOffset(0.01,"Y"); |
| 527 | // 1-p: |
| 528 | (fQCorrectionsSin->GetXaxis())->SetBinLabel(1,"sin(n(#phi_{1}))>"); |
| 529 | // 2-p: |
| 530 | // 3-p: |
| 531 | |
| 532 | // add fQCorrectionsSin to the main list: |
| 533 | fHistList->Add(fQCorrectionsSin); |
| 534 | //......................................................................... |
| 535 | |
| 536 | // corrections for non-uniform acceptance (sin terms) calculated with nested loops |
| 537 | fDirectCorrectionsSin = new TProfile("fDirectCorrectionsSin"," corrections for non-uniform acceptance (sin terms)",100,0,100,"s"); |
| 538 | fDirectCorrectionsSin->SetTickLength(-0.01,"Y"); |
| 539 | fDirectCorrectionsSin->SetMarkerStyle(25); |
| 540 | fDirectCorrectionsSin->SetLabelSize(0.03); |
| 541 | fDirectCorrectionsSin->SetLabelOffset(0.01,"Y"); |
| 542 | // binned in the samw way as fQCorrectionsSin (see above) |
| 543 | // add fDirectCorrectionsSin to the main list: |
| 2bdc5281 |
544 | fHistList->Add(fDirectCorrectionsSin); |
| 545 | |
| 546 | // corrections for non-uniform acceptance (cos terms) calculated with nested loops (needed for diff. flow) |
| 547 | fDirectCorrectionsDiffFlowCos = new TProfile("fDirectCorrectionsDiffFlowCos","corrections for non-uniform acceptance (cos terms) with nested loops",200,0,200,"s"); |
| 548 | fDirectCorrectionsDiffFlowCos->SetXTitle(""); |
| 549 | fDirectCorrectionsDiffFlowCos->SetYTitle("corrections"); |
| 550 | fHistList->Add(fDirectCorrectionsDiffFlowCos); |
| 551 | |
| 552 | // corrections for non-uniform acceptance (sin terms) calculated with nested loops (needed for diff. flow) |
| 553 | fDirectCorrectionsDiffFlowSin = new TProfile("fDirectCorrectionsDiffFlowSin","corrections for non-uniform acceptance (sin terms) with nested loops",200,0,200,"s"); |
| 554 | fDirectCorrectionsDiffFlowSin->SetXTitle(""); |
| 555 | fDirectCorrectionsDiffFlowSin->SetYTitle("corrections"); |
| 556 | fHistList->Add(fDirectCorrectionsDiffFlowSin); |
| c365fe76 |
557 | |
| 8842fb2b |
558 | //average products |
| 559 | fQProduct = new TProfile("fQProduct","average of products",6,0,6,"s"); |
| 560 | fQProduct->SetTickLength(-0.01,"Y"); |
| 561 | fQProduct->SetMarkerStyle(25); |
| 562 | fQProduct->SetLabelSize(0.03); |
| 563 | fQProduct->SetLabelOffset(0.01,"Y"); |
| 564 | (fQProduct->GetXaxis())->SetBinLabel(1,"<<2*4>>"); |
| 565 | (fQProduct->GetXaxis())->SetBinLabel(2,"<<2*6>>"); |
| 566 | (fQProduct->GetXaxis())->SetBinLabel(3,"<<2*8>>"); |
| 567 | (fQProduct->GetXaxis())->SetBinLabel(4,"<<4*6>>"); |
| 568 | (fQProduct->GetXaxis())->SetBinLabel(5,"<<4*8>>"); |
| 569 | (fQProduct->GetXaxis())->SetBinLabel(6,"<<6*8>>"); |
| 570 | fQProduct->SetXTitle(""); |
| 571 | fQProduct->SetYTitle(""); |
| 572 | fHistList->Add(fQProduct); |
| bc92c0cb |
573 | |
| 9c1a9547 |
574 | // multi-particle correlations calculated with nested loops (needed for int. flow) |
| 575 | fDirectCorrelations = new TProfile("fDirectCorrelations","multi-particle correlations with nested loops",100,0,100,"s"); |
| bc92c0cb |
576 | fDirectCorrelations->SetXTitle(""); |
| 577 | fDirectCorrelations->SetYTitle("correlations"); |
| 578 | fHistList->Add(fDirectCorrelations); |
| 579 | |
| 9c1a9547 |
580 | // multi-particle correlations calculated with nested loops (needed for weighted int. flow) |
| 581 | fDirectCorrelationsW = new TProfile("fDirectCorrelationsW","multi-particle correlations with nested loops",200,0,200,"s"); |
| 582 | fDirectCorrelationsW->SetXTitle(""); |
| 583 | fDirectCorrelationsW->SetYTitle("correlations"); |
| 584 | fHistList->Add(fDirectCorrelationsW); |
| 585 | |
| 586 | // multi-particle correlations calculated with nested loops (needed for diff. flow) |
| 587 | fDirectCorrelationsDiffFlow = new TProfile("fDirectCorrelationsDiffFlow","multi-particle correlations with nested loops",200,0,200,"s"); |
| 588 | fDirectCorrelationsDiffFlow->SetXTitle(""); |
| 589 | fDirectCorrelationsDiffFlow->SetYTitle("correlations"); |
| 590 | fHistList->Add(fDirectCorrelationsDiffFlow); |
| 591 | |
| 592 | // multi-particle correlations calculated with nested loops (needed for weighted diff. flow) |
| 593 | fDirectCorrelationsDiffFlowW = new TProfile("fDirectCorrelationsDiffFlowW","multi-particle correlations with nested loops",200,0,200,"s"); |
| 594 | fDirectCorrelationsDiffFlowW->SetXTitle(""); |
| 595 | fDirectCorrelationsDiffFlowW->SetYTitle("correlations"); |
| 596 | fHistList->Add(fDirectCorrelationsDiffFlowW); |
| 597 | |
| 1dfa3c16 |
598 | //f2PerPtBin1n1nRP |
| 599 | f2PerPtBin1n1nRP = new TProfile("f2PerPtBin1n1nRP","<2'>_{n|n}",fnBinsPt,fPtMin,fPtMax,"s"); |
| 600 | f2PerPtBin1n1nRP->SetXTitle("p_{t} [GeV]"); |
| ae733b3b |
601 | fDiffFlowList->Add(f2PerPtBin1n1nRP); |
| 1dfa3c16 |
602 | |
| 1dfa3c16 |
603 | //f4PerPtBin1n1n1n1nRP |
| 604 | f4PerPtBin1n1n1n1nRP = new TProfile("f4PerPtBin1n1n1n1nRP","<4'>_{n,n|n,n}",fnBinsPt,fPtMin,fPtMax,"s"); |
| 605 | f4PerPtBin1n1n1n1nRP->SetXTitle("p_{t} [GeV]"); |
| ae733b3b |
606 | fDiffFlowList->Add(f4PerPtBin1n1n1n1nRP); |
| 1dfa3c16 |
607 | |
| 1dfa3c16 |
608 | //f2PerEtaBin1n1nRP |
| 609 | f2PerEtaBin1n1nRP = new TProfile("f2PerEtaBin1n1nRP","<2'>_{n|n}",fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 610 | f2PerEtaBin1n1nRP->SetXTitle("#eta"); |
| ae733b3b |
611 | fDiffFlowList->Add(f2PerEtaBin1n1nRP); |
| 1dfa3c16 |
612 | |
| 1dfa3c16 |
613 | //f4PerEtaBin1n1n1n1nRP |
| 614 | f4PerEtaBin1n1n1n1nRP = new TProfile("f4PerEtaBin1n1n1n1nRP","<4'>_{n,n|n,n}",fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 615 | f4PerEtaBin1n1n1n1nRP->SetXTitle("#eta"); |
| ae733b3b |
616 | fDiffFlowList->Add(f4PerEtaBin1n1n1n1nRP); |
| 1dfa3c16 |
617 | |
| 1dfa3c16 |
618 | //f2PerPtBin1n1nPOI |
| 619 | f2PerPtBin1n1nPOI = new TProfile("f2PerPtBin1n1nPOI","<2'>_{n|n}",fnBinsPt,fPtMin,fPtMax,"s"); |
| 4057ba99 |
620 | f2PerPtBin1n1nPOI->SetXTitle("#eta"); |
| ae733b3b |
621 | fDiffFlowList->Add(f2PerPtBin1n1nPOI); |
| 1dfa3c16 |
622 | |
| 1dfa3c16 |
623 | //f4PerPtBin1n1n1n1nPOI |
| 624 | f4PerPtBin1n1n1n1nPOI = new TProfile("f4PerPtBin1n1n1n1nPOI","<4'>_{n,n|n,n}",fnBinsPt,fPtMin,fPtMax,"s"); |
| 625 | f4PerPtBin1n1n1n1nPOI->SetXTitle("p_{t} [GeV]"); |
| ae733b3b |
626 | fDiffFlowList->Add(f4PerPtBin1n1n1n1nPOI); |
| 1dfa3c16 |
627 | |
| 1dfa3c16 |
628 | //f2PerEtaBin1n1nPOI |
| 629 | f2PerEtaBin1n1nPOI = new TProfile("f2PerEtaBin1n1nPOI","<2'>_{n|n}",fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 630 | f2PerEtaBin1n1nPOI->SetXTitle("#eta"); |
| ae733b3b |
631 | fDiffFlowList->Add(f2PerEtaBin1n1nPOI); |
| 1dfa3c16 |
632 | |
| 1dfa3c16 |
633 | //f4PerEtaBin1n1n1n1nPOI |
| 634 | f4PerEtaBin1n1n1n1nPOI = new TProfile("f4PerEtaBin1n1n1n1nPOI","<4'>_{n,n|n,n}",fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 635 | f4PerEtaBin1n1n1n1nPOI->SetXTitle("#eta"); |
| ae733b3b |
636 | fDiffFlowList->Add(f4PerEtaBin1n1n1n1nPOI); |
| bc92c0cb |
637 | |
| 3d824203 |
638 | //f2WPerPtBin1n1nPOI |
| 639 | f2WPerPtBin1n1nPOI = new TProfile("f2WPerPtBin1n1nPOI","<2'>_{n|n}",fnBinsPt,fPtMin,fPtMax,"s"); |
| 640 | f2WPerPtBin1n1nPOI->SetXTitle("#pt"); |
| 641 | fDiffFlowList->Add(f2WPerPtBin1n1nPOI); |
| 642 | |
| 3d824203 |
643 | //f4WPerPtBin1n1n1n1nPOI |
| 644 | f4WPerPtBin1n1n1n1nPOI = new TProfile("f4WPerPtBin1n1n1n1nPOI","<4'>_{n,n|n,n}",fnBinsPt,fPtMin,fPtMax,"s"); |
| 645 | f4WPerPtBin1n1n1n1nPOI->SetXTitle("#Pt"); |
| 646 | fDiffFlowList->Add(f4WPerPtBin1n1n1n1nPOI); |
| 647 | |
| 3d824203 |
648 | //f2WPerEtaBin1n1nPOI |
| 649 | f2WPerEtaBin1n1nPOI = new TProfile("f2WPerEtaBin1n1nPOI","<2'>_{n|n}",fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 650 | f2WPerEtaBin1n1nPOI->SetXTitle("#eta"); |
| 651 | fDiffFlowList->Add(f2WPerEtaBin1n1nPOI); |
| 652 | |
| 653 | //f4WPerEtaBin1n1n1n1nPOI |
| 654 | f4WPerEtaBin1n1n1n1nPOI = new TProfile("f4WPerEtaBin1n1n1n1nPOI","<4'>_{n,n|n,n}",fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 655 | f4WPerEtaBin1n1n1n1nPOI->SetXTitle("#eta"); |
| 656 | fDiffFlowList->Add(f4WPerEtaBin1n1n1n1nPOI); |
| 657 | |
| 3d824203 |
658 | //f2WPerPtBin1n1nRP |
| 659 | f2WPerPtBin1n1nRP = new TProfile("f2WPerPtBin1n1nRP","<2'>_{n|n}",fnBinsPt,fPtMin,fPtMax,"s"); |
| 660 | f2WPerPtBin1n1nRP->SetXTitle("#pt"); |
| 661 | fDiffFlowList->Add(f2WPerPtBin1n1nRP); |
| 662 | |
| 663 | //f4WPerPtBin1n1n1n1nRP |
| 664 | f4WPerPtBin1n1n1n1nRP = new TProfile("f4WPerPtBin1n1n1n1nRP","<4'>_{n,n|n,n}",fnBinsPt,fPtMin,fPtMax,"s"); |
| 665 | f4WPerPtBin1n1n1n1nRP->SetXTitle("#Pt"); |
| 666 | fDiffFlowList->Add(f4WPerPtBin1n1n1n1nRP); |
| 667 | |
| 3d824203 |
668 | //f2WPerEtaBin1n1nRP |
| 669 | f2WPerEtaBin1n1nRP = new TProfile("f2WPerEtaBin1n1nRP","<2'>_{n|n}",fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 670 | f2WPerEtaBin1n1nRP->SetXTitle("#eta"); |
| 671 | fDiffFlowList->Add(f2WPerEtaBin1n1nRP); |
| 672 | |
| 673 | //f4WPerEtaBin1n1n1n1nRP |
| 674 | f4WPerEtaBin1n1n1n1nRP = new TProfile("f4WPerEtaBin1n1n1n1nRP","<4'>_{n,n|n,n}",fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 675 | f4WPerEtaBin1n1n1n1nRP->SetXTitle("#eta"); |
| 676 | fDiffFlowList->Add(f4WPerEtaBin1n1n1n1nRP); |
| 677 | |
| cb308e83 |
678 | //common control histogram (2nd order) |
| 679 | fCommonHists2nd = new AliFlowCommonHist("AliFlowCommonHist2ndOrderQC"); |
| 680 | fHistList->Add(fCommonHists2nd); |
| 1315fe58 |
681 | |
| cb308e83 |
682 | //common control histogram (4th order) |
| 683 | fCommonHists4th = new AliFlowCommonHist("AliFlowCommonHist4thOrderQC"); |
| 684 | fHistList->Add(fCommonHists4th); |
| 685 | |
| 686 | //common control histogram (6th order) |
| 687 | fCommonHists6th = new AliFlowCommonHist("AliFlowCommonHist6thOrderQC"); |
| 688 | fHistList->Add(fCommonHists6th); |
| 689 | |
| 690 | //common control histogram (8th order) |
| 691 | fCommonHists8th = new AliFlowCommonHist("AliFlowCommonHist8thOrderQC"); |
| 692 | fHistList->Add(fCommonHists8th); |
| 4057ba99 |
693 | |
| 8842fb2b |
694 | //common histograms for final results (2nd order) |
| 1315fe58 |
695 | fCommonHistsResults2nd = new AliFlowCommonHistResults("AliFlowCommonHistResults2ndOrderQC"); |
| 696 | fHistList->Add(fCommonHistsResults2nd); |
| 697 | |
| 8842fb2b |
698 | //common histograms for final results (4th order) |
| 1315fe58 |
699 | fCommonHistsResults4th = new AliFlowCommonHistResults("AliFlowCommonHistResults4thOrderQC"); |
| 700 | fHistList->Add(fCommonHistsResults4th); |
| 701 | |
| 8842fb2b |
702 | //common histograms for final results (6th order) |
| 1315fe58 |
703 | fCommonHistsResults6th = new AliFlowCommonHistResults("AliFlowCommonHistResults6thOrderQC"); |
| 704 | fHistList->Add(fCommonHistsResults6th); |
| 705 | |
| 8842fb2b |
706 | //common histograms for final results (8th order) |
| 1315fe58 |
707 | fCommonHistsResults8th = new AliFlowCommonHistResults("AliFlowCommonHistResults8thOrderQC"); |
| 708 | fHistList->Add(fCommonHistsResults8th); |
| 1315fe58 |
709 | |
| 710 | //weighted <2>_{n|n} distribution |
| 52021ae2 |
711 | f2pDistribution = new TH1D("f2pDistribution","<2>_{n|n} distribution",100000,-0.02,0.1); |
| 712 | f2pDistribution->SetXTitle("<2>_{n|n}"); |
| 713 | f2pDistribution->SetYTitle("Counts"); |
| 714 | fHistList->Add(f2pDistribution); |
| 1315fe58 |
715 | |
| 716 | //weighted <4>_{n,n|n,n} distribution |
| 52021ae2 |
717 | f4pDistribution = new TH1D("f4pDistribution","<4>_{n,n|n,n} distribution",100000,-0.00025,0.002); |
| 718 | f4pDistribution->SetXTitle("<4>_{n,n|n,n}"); |
| 719 | f4pDistribution->SetYTitle("Counts"); |
| 720 | fHistList->Add(f4pDistribution); |
| 1315fe58 |
721 | |
| 722 | //weighted <6>_{n,n,n|n,n,n} distribution |
| 52021ae2 |
723 | f6pDistribution = new TH1D("f6pDistribution","<6>_{n,n,n|n,n,n} distribution",100000,-0.000005,0.000025); |
| 724 | f6pDistribution->SetXTitle("<6>_{n,n,n|n,n,n}"); |
| 725 | f6pDistribution->SetYTitle("Counts"); |
| 726 | fHistList->Add(f6pDistribution); |
| bc92c0cb |
727 | |
| 5e838eeb |
728 | //weighted <8>_{n,n,n,n|n,n,n,n} distribution |
| 729 | f8pDistribution = new TH1D("f8pDistribution","<8>_{n,n,n,n|n,n,n,n} distribution",100000,-0.000000001,0.00000001); |
| 730 | f8pDistribution->SetXTitle("<8>_{n,n,n,n|n,n,n,n}"); |
| 731 | f8pDistribution->SetYTitle("Counts"); |
| 732 | fHistList->Add(f8pDistribution); |
| ae733b3b |
733 | |
| 2bdc5281 |
734 | // ....................................................................................................................................... |
| 735 | // POI: |
| 736 | // <<cos n(psi1>> for POIs: |
| 737 | fCorrectionsCosP1nPsiPtEtaPOI = new TProfile2D("fCorrectionsCosP1nPsiPtEtaPOI","<<cos n(#psi_{1})>> (p_{t},#eta) for POIs", |
| 738 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 739 | fCorrectionsCosP1nPsiPtEtaPOI->SetXTitle("p_{t}"); |
| 740 | fCorrectionsCosP1nPsiPtEtaPOI->SetYTitle("#eta"); |
| 741 | fDiffFlowList->Add(fCorrectionsCosP1nPsiPtEtaPOI); |
| ae733b3b |
742 | |
| 2bdc5281 |
743 | // <<sin n(psi1>> for POIs: |
| 744 | fCorrectionsSinP1nPsiPtEtaPOI = new TProfile2D("fCorrectionsSinP1nPsiPtEtaPOI","<<Sin n(#psi_{1})>> (p_{t},#eta) for POIs", |
| 745 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 746 | fCorrectionsSinP1nPsiPtEtaPOI->SetXTitle("p_{t}"); |
| 747 | fCorrectionsSinP1nPsiPtEtaPOI->SetYTitle("#eta"); |
| 748 | fDiffFlowList->Add(fCorrectionsSinP1nPsiPtEtaPOI); |
| 03a02aca |
749 | |
| ae733b3b |
750 | |
| bc92c0cb |
751 | |
| ae733b3b |
752 | |
| 2bdc5281 |
753 | // RP: |
| 754 | // <<cos n(psi1>> for RPs: |
| 755 | fCorrectionsCosP1nPsiPtEtaRP = new TProfile2D("fCorrectionsCosP1nPsiPtEtaRP","<<cos n(#psi_{1})>> (p_{t},#eta) for RPs", |
| 756 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 757 | fCorrectionsCosP1nPsiPtEtaRP->SetXTitle("p_{t}"); |
| 758 | fCorrectionsCosP1nPsiPtEtaRP->SetYTitle("#eta"); |
| 759 | fDiffFlowList->Add(fCorrectionsCosP1nPsiPtEtaRP); |
| ae733b3b |
760 | |
| 2bdc5281 |
761 | // <<sin n(psi1>> for RPs: |
| 762 | fCorrectionsSinP1nPsiPtEtaRP = new TProfile2D("fCorrectionsSinP1nPsiPtEtaRP","<<Sin n(#psi_{1})>> (p_{t},#eta) for RPs", |
| 763 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 764 | fCorrectionsSinP1nPsiPtEtaRP->SetXTitle("p_{t}"); |
| 765 | fCorrectionsSinP1nPsiPtEtaRP->SetYTitle("#eta"); |
| 766 | fDiffFlowList->Add(fCorrectionsSinP1nPsiPtEtaRP); |
| 767 | // ....................................................................................................................................... |
| ae733b3b |
768 | |
| 9c1a9547 |
769 | // ....................................................................................................................................... |
| 770 | // Q_{n,k} and S^M_{n,k}: |
| 771 | fReQ = new TMatrixD(4,9); |
| 772 | fImQ = new TMatrixD(4,9); |
| 773 | fSMpk = new TMatrixD(8,9); |
| ae733b3b |
774 | |
| 9c1a9547 |
775 | // q'_{n}: |
| 776 | fReqnPtEta = new TH2D("fReqnPtEta","Re[q_{n}(p_{t},#eta)]",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 777 | fImqnPtEta = new TH2D("fImqnPtEta","Im[q_{n}(p_{t},#eta)]",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 778 | fmPtEta = new TH2D("fmPtEta","m(p_{t},#eta)",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| bc92c0cb |
779 | |
| 9c1a9547 |
780 | // non-weighted q''_{n} and q''_{2n}: |
| 781 | fReqPrimePrime1nPtEta = new TH2D("fReqPrimePrime1nPtEta","Re[q''_{n}(p_{t},#eta)]",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 782 | fImqPrimePrime1nPtEta = new TH2D("fImqPrimePrime1nPtEta","Im[q''_{n}(p_{t},#eta)]",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 783 | fReqPrimePrime2nPtEta = new TH2D("fReqPrimePrime2nPtEta","Re[q''_{2n}(p_{t},#eta)]",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 784 | fImqPrimePrime2nPtEta = new TH2D("fImqPrimePrime2nPtEta","Im[q''_{2n}(p_{t},#eta)]",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 785 | |
| 786 | // weighted q''_{n,2k} and q''_{2n,k}: |
| 787 | fReqPrimePrime1n2kPtEta = new TH2D("fReqPrimePrime1n2kPtEta","Re[q''_{n,2}(p_{t},#eta)]",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 788 | fImqPrimePrime1n2kPtEta = new TH2D("fImqPrimePrime1n2kPtEta","Im[q''_{n,2}(p_{t},#eta)]",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 789 | fReqPrimePrime2n1kPtEta = new TH2D("fReqPrimePrime2n1kPtEta","Re[q''_{2n,1(p_{t},#eta)}]",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 790 | fImqPrimePrime2n1kPtEta = new TH2D("fImqPrimePrime2n1kPtEta","Im[q''_{2n,1}(p_{t},#eta)]",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 1dfa3c16 |
791 | |
| 9c1a9547 |
792 | // m'': |
| 793 | fmPrimePrimePtEta = new TH2D("fmPrimePrimePtEta","m''(p_{t},#eta)",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| bc92c0cb |
794 | |
| 9c1a9547 |
795 | // S^{m''}_{p,k}: |
| 796 | fSmPrimePrime1p1kPtEta = new TH2D("fSmPrimePrime1p1kPtEta","S^{m''}_{1,1}(p_{t},#eta)",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 797 | fSmPrimePrime1p2kPtEta = new TH2D("fSmPrimePrime1p2kPtEta","S^{m''}_{1,2}(p_{t},#eta)",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 798 | fSmPrimePrime1p3kPtEta = new TH2D("fSmPrimePrime1p3kPtEta","S^{m''}_{1,3}(p_{t},#eta)",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 799 | |
| 800 | // non-weighted q_RP{n} and q_RP{2n}: |
| 801 | fReqRP1nPtEta = new TH2D("fReqRP1nPtEta","Re[q_{n}(p_{t},#eta)] for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 802 | fImqRP1nPtEta = new TH2D("fImqRP1nPtEta","Im[q_{n}(p_{t},#eta)] for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 803 | fReqRP2nPtEta = new TH2D("fReqRP2nPtEta","Re[q_{2n}(p_{t},#eta)] for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 804 | fImqRP2nPtEta = new TH2D("fImqRP2nPtEta","Im[q_{2n}(p_{t},#eta)] for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| bc92c0cb |
805 | |
| 9c1a9547 |
806 | // weighted q_RP{n,2k} and q_RP{2n,k}: |
| 807 | fReqRP1n2kPtEta = new TH2D("fReqRP1n2kPtEta","Re[q_{n,2}(p_{t},#eta)] for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 808 | fImqRP1n2kPtEta = new TH2D("fImqRP1n2kPtEta","Im[q_{n,2}(p_{t},#eta)] for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 809 | fReqRP2n1kPtEta = new TH2D("fReqRP2n1kPtEta","Re[q_{2n,1(p_{t},#eta)}] for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 810 | fImqRP2n1kPtEta = new TH2D("fImqRP2n1kPtEta","Im[q_{2n,1}(p_{t},#eta)] for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| cb308e83 |
811 | |
| 9c1a9547 |
812 | // mRP: |
| 813 | fmRPPtEta = new TH2D("fmRPPtEta","m(p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| dee1e0e0 |
814 | |
| 9c1a9547 |
815 | // S^{mRP}_{p,k}: |
| 816 | fSmRP1p1kPtEta = new TH2D("fSmRP1p1kPtEta","S^{m}_{1,1}(p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 817 | fSmRP1p2kPtEta = new TH2D("fSmRP1p2kPtEta","S^{m}_{1,2}(p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 818 | fSmRP1p3kPtEta = new TH2D("fSmRP1p3kPtEta","S^{m}_{1,3}(p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| dee1e0e0 |
819 | |
| 9c1a9547 |
820 | // ----- RESULTS ---- |
| dee1e0e0 |
821 | |
| c365fe76 |
822 | // final corrections for non-uniform acceptance for QC{2}, QC{4}, QC{6} and QC{8}: |
| 823 | fFinalCorrectionsForNUA = new TH1D("fFinalCorrectionsForNUA","Corrections for non-uniform acceptance to Q-cumulants",4,0,4); |
| 824 | fFinalCorrectionsForNUA->SetLabelSize(0.06); |
| 825 | fFinalCorrectionsForNUA->SetMarkerStyle(25); |
| 826 | (fFinalCorrectionsForNUA->GetXaxis())->SetBinLabel(1,"QC{2}"); |
| 827 | (fFinalCorrectionsForNUA->GetXaxis())->SetBinLabel(2,"QC{4}"); |
| 828 | (fFinalCorrectionsForNUA->GetXaxis())->SetBinLabel(3,"QC{6}"); |
| 829 | (fFinalCorrectionsForNUA->GetXaxis())->SetBinLabel(4,"QC{8}"); |
| 830 | fResultsList->Add(fFinalCorrectionsForNUA); |
| 831 | |
| 9c1a9547 |
832 | // final results for non-weighted no-name integrated flow: |
| 833 | fIntFlowResultsQC = new TH1D("fIntFlowResultsQC","Integrated Flow from Q-cumulants",4,0,4); |
| 834 | fIntFlowResultsQC->SetLabelSize(0.06); |
| 835 | fIntFlowResultsQC->SetMarkerStyle(25); |
| 836 | (fIntFlowResultsQC->GetXaxis())->SetBinLabel(1,"v_{n}{2}"); |
| 837 | (fIntFlowResultsQC->GetXaxis())->SetBinLabel(2,"v_{n}{4}"); |
| 838 | (fIntFlowResultsQC->GetXaxis())->SetBinLabel(3,"v_{n}{6}"); |
| 839 | (fIntFlowResultsQC->GetXaxis())->SetBinLabel(4,"v_{n}{8}"); |
| 840 | fResultsList->Add(fIntFlowResultsQC); |
| 841 | |
| 842 | // final results for non-weighted POIs integrated flow: |
| 843 | fIntFlowResultsPOIQC = new TH1D("fIntFlowResultsPOIQC","Integrated Flow (POI) from Q-cumulants",4,0,4); |
| 844 | fIntFlowResultsPOIQC->SetLabelSize(0.06); |
| 845 | fIntFlowResultsPOIQC->SetMarkerStyle(25); |
| 846 | (fIntFlowResultsPOIQC->GetXaxis())->SetBinLabel(1,"v_{n}{2}"); |
| 847 | (fIntFlowResultsPOIQC->GetXaxis())->SetBinLabel(2,"v_{n}{4}"); |
| 848 | (fIntFlowResultsPOIQC->GetXaxis())->SetBinLabel(3,"v_{n}{6}"); |
| 849 | (fIntFlowResultsPOIQC->GetXaxis())->SetBinLabel(4,"v_{n}{8}"); |
| 850 | fResultsList->Add(fIntFlowResultsPOIQC); |
| 851 | |
| 852 | // final results for non-weighted RPs integrated flow: |
| 853 | fIntFlowResultsRPQC = new TH1D("fIntFlowResultsRPQC","Integrated Flow (RP) from Q-cumulants",4,0,4); |
| 854 | fIntFlowResultsRPQC->SetLabelSize(0.06); |
| 855 | fIntFlowResultsRPQC->SetMarkerStyle(25); |
| 856 | (fIntFlowResultsRPQC->GetXaxis())->SetBinLabel(1,"v_{n}{2}"); |
| 857 | (fIntFlowResultsRPQC->GetXaxis())->SetBinLabel(2,"v_{n}{4}"); |
| 858 | (fIntFlowResultsRPQC->GetXaxis())->SetBinLabel(3,"v_{n}{6}"); |
| 859 | (fIntFlowResultsRPQC->GetXaxis())->SetBinLabel(4,"v_{n}{8}"); |
| 860 | fResultsList->Add(fIntFlowResultsRPQC); |
| 861 | |
| 862 | // final results for weighted no-name integrated flow: |
| 863 | fIntFlowResultsQCW = new TH1D("fIntFlowResultsQCW","Integrated Flow from Q-cumulants with Weights",4,0,4); |
| 864 | fIntFlowResultsQCW->SetLabelSize(0.06); |
| 865 | fIntFlowResultsQCW->SetMarkerStyle(25); |
| 866 | (fIntFlowResultsQCW->GetXaxis())->SetBinLabel(1,"v_{n}{2}"); |
| 867 | (fIntFlowResultsQCW->GetXaxis())->SetBinLabel(2,"v_{n}{4}"); |
| 868 | (fIntFlowResultsQCW->GetXaxis())->SetBinLabel(3,"v_{n}{6}"); |
| 869 | (fIntFlowResultsQCW->GetXaxis())->SetBinLabel(4,"v_{n}{8}"); |
| 870 | fResultsList->Add(fIntFlowResultsQCW); |
| 871 | |
| 872 | // final results for weighted POIs integrated flow: |
| 873 | fIntFlowResultsPOIQCW = new TH1D("fIntFlowResultsPOIQCW","Integrated Flow (POI) from Q-cumulants with Weights",4,0,4); |
| 874 | fIntFlowResultsPOIQCW->SetLabelSize(0.06); |
| 875 | fIntFlowResultsPOIQCW->SetMarkerStyle(25); |
| 876 | (fIntFlowResultsPOIQCW->GetXaxis())->SetBinLabel(1,"v_{n}{2}"); |
| 877 | (fIntFlowResultsPOIQCW->GetXaxis())->SetBinLabel(2,"v_{n}{4}"); |
| 878 | (fIntFlowResultsPOIQCW->GetXaxis())->SetBinLabel(3,"v_{n}{6}"); |
| 879 | (fIntFlowResultsPOIQCW->GetXaxis())->SetBinLabel(4,"v_{n}{8}"); |
| 880 | fResultsList->Add(fIntFlowResultsPOIQCW); |
| 881 | |
| 882 | // final results for weighted RPs integrated flow: |
| 883 | fIntFlowResultsRPQCW = new TH1D("fIntFlowResultsRPQCW","Integrated Flow (RP) from Q-cumulants with Weights",4,0,4); |
| 884 | fIntFlowResultsRPQCW->SetLabelSize(0.06); |
| 885 | fIntFlowResultsRPQCW->SetMarkerStyle(25); |
| 886 | (fIntFlowResultsRPQCW->GetXaxis())->SetBinLabel(1,"v_{n}{2}"); |
| 887 | (fIntFlowResultsRPQCW->GetXaxis())->SetBinLabel(2,"v_{n}{4}"); |
| 888 | (fIntFlowResultsRPQCW->GetXaxis())->SetBinLabel(3,"v_{n}{6}"); |
| 889 | (fIntFlowResultsRPQCW->GetXaxis())->SetBinLabel(4,"v_{n}{8}"); |
| 890 | fResultsList->Add(fIntFlowResultsRPQCW); |
| 891 | |
| 2bdc5281 |
892 | // <<cos n(psi1-phi2)>> for POIs: |
| 893 | f2pPtEtaPOI = new TProfile2D("f2pPtEtaPOI","<<cos n(#psi_{1}-#phi_{2})>> (p_{t},#eta) for POIs", |
| 9c1a9547 |
894 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 895 | f2pPtEtaPOI->SetXTitle("p_{t}"); |
| 896 | f2pPtEtaPOI->SetYTitle("#eta"); |
| 897 | fDiffFlowList->Add(f2pPtEtaPOI); |
| 898 | |
| 2bdc5281 |
899 | // <<cos n(psi1+phi2-phi3-phi4)>> for POIs: |
| 900 | f4pPtEtaPOI = new TProfile2D("f4pPtEtaPOI","<<cos n(#psi_{1}+#phi_{2}-#phi_{3}-#phi_{4})>> (p_{t},#eta) for POIs", |
| 9c1a9547 |
901 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 902 | f4pPtEtaPOI->SetXTitle("p_{t}"); |
| 903 | f4pPtEtaPOI->SetYTitle("#eta"); |
| 904 | fDiffFlowList->Add(f4pPtEtaPOI); |
| 905 | |
| 2bdc5281 |
906 | // <<cos n(psi1+phi2+phi3-phi4-phi5-phi6)>> for POIs: |
| 907 | f6pPtEtaPOI = new TProfile2D("f6pPtEtaPOI","<<cos n(#psi_{1}+#phi_{2}+#phi_{3}-#phi_{4}-#phi_{5}-#phi_{6})>> (p_{t},#eta) for POIs", |
| 9c1a9547 |
908 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 909 | f6pPtEtaPOI->SetXTitle("p_{t}"); |
| 910 | f6pPtEtaPOI->SetYTitle("#eta"); |
| 911 | fDiffFlowList->Add(f6pPtEtaPOI); |
| 912 | |
| 2bdc5281 |
913 | // <<cos n(psi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)>> for POIs: |
| 914 | f8pPtEtaPOI = new TProfile2D("f8pPtEtaPOI","<<cos n(#psi_{1}+#phi_{2}+#phi_{3}+#phi_{4}-#phi_{5}-#phi_{6}-#phi_{7}-#phi_{8})>> (p_{t},#eta) for POIs", |
| 9c1a9547 |
915 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 916 | f8pPtEtaPOI->SetXTitle("p_{t}"); |
| 917 | f8pPtEtaPOI->SetYTitle("#eta"); |
| 918 | fDiffFlowList->Add(f8pPtEtaPOI); |
| 919 | |
| 2bdc5281 |
920 | // correction for non-uniform acceptance to <<cos n(psi1-phi2)>> for POIs: |
| 921 | f2pFinalCorrectionsForNUAPtEtaPOI = new TH2D("f2pFinalCorrectionsForNUAPtEtaPOI", |
| 922 | "correction for NUA to <<cos n(#psi_{1}-#phi_{2})>> (p_{t},#eta) for POIs", |
| 923 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 924 | f2pFinalCorrectionsForNUAPtEtaPOI->SetXTitle("p_{t}"); |
| 925 | f2pFinalCorrectionsForNUAPtEtaPOI->SetYTitle("#eta"); |
| 926 | fResultsList->Add(f2pFinalCorrectionsForNUAPtEtaPOI); |
| 927 | |
| 928 | // correction for non-uniform acceptance to <<cos n(psi1+phi2-phi3-phi4)>> for POIs: |
| 929 | f4pFinalCorrectionsForNUAPtEtaPOI = new TH2D("f4pFinalCorrectionsForNUAPtEtaPOI", |
| 930 | "correction for NUA to <<cos n(psi1+phi2-phi3-phi4)>> (p_{t},#eta) for POIs", |
| 931 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 932 | f4pFinalCorrectionsForNUAPtEtaPOI->SetXTitle("p_{t}"); |
| 933 | f4pFinalCorrectionsForNUAPtEtaPOI->SetYTitle("#eta"); |
| 934 | fResultsList->Add(f4pFinalCorrectionsForNUAPtEtaPOI); |
| 935 | |
| 936 | // correction for non-uniform acceptance to <<cos n(psi1+phi2+phi3-phi4-phi5-phi6)>> for POIs: |
| 937 | f6pFinalCorrectionsForNUAPtEtaPOI = new TH2D("f6pFinalCorrectionsForNUAPtEtaPOI", |
| 938 | "correction for NUA to <<cos n(psi1+phi2+phi3-phi4-phi5-phi6)>> (p_{t},#eta) for POIs", |
| 939 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 940 | f6pFinalCorrectionsForNUAPtEtaPOI->SetXTitle("p_{t}"); |
| 941 | f6pFinalCorrectionsForNUAPtEtaPOI->SetYTitle("#eta"); |
| 942 | fResultsList->Add(f6pFinalCorrectionsForNUAPtEtaPOI); |
| 943 | |
| 944 | // correction for non-uniform acceptance to <<cos n(psi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)>> for POIs: |
| 945 | f8pFinalCorrectionsForNUAPtEtaPOI = new TH2D("f8pFinalCorrectionsForNUAPtEtaPOI", |
| 946 | "correction for NUA to <<cos n(psi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)>> (p_{t},#eta) for POIs", |
| 947 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 948 | f8pFinalCorrectionsForNUAPtEtaPOI->SetXTitle("p_{t}"); |
| 949 | f8pFinalCorrectionsForNUAPtEtaPOI->SetYTitle("#eta"); |
| 950 | fResultsList->Add(f8pFinalCorrectionsForNUAPtEtaPOI); |
| 951 | |
| 952 | // correction for non-uniform acceptance to <<cos n(psi1-phi2)>> for POIs: |
| 953 | f2pFinalCorrectionsForNUAPtPOI = new TH1D("f2pFinalCorrectionsForNUAPtPOI", |
| 954 | "correction for NUA to <<cos n(#psi_{1}-#phi_{2})>> (p_{t}) for POIs", |
| 955 | fnBinsPt,fPtMin,fPtMax); |
| 956 | f2pFinalCorrectionsForNUAPtPOI->SetXTitle("p_{t}"); |
| 957 | fResultsList->Add(f2pFinalCorrectionsForNUAPtPOI); |
| 958 | |
| 959 | // correction for non-uniform acceptance to <<cos n(psi1+phi2-phi3-phi4)>> for POIs: |
| 960 | f4pFinalCorrectionsForNUAPtPOI = new TH1D("f4pFinalCorrectionsForNUAPtPOI", |
| 961 | "correction for NUA to <<cos n(psi1+phi2-phi3-phi4)>> (p_{t}) for POIs", |
| 962 | fnBinsPt,fPtMin,fPtMax); |
| 963 | f4pFinalCorrectionsForNUAPtPOI->SetXTitle("p_{t}"); |
| 964 | fResultsList->Add(f4pFinalCorrectionsForNUAPtPOI); |
| 965 | |
| 966 | // correction for non-uniform acceptance to <<cos n(psi1+phi2+phi3-phi4-phi5-phi6)>> for POIs: |
| 967 | f6pFinalCorrectionsForNUAPtPOI = new TH1D("f6pFinalCorrectionsForNUAPtPOI", |
| 968 | "correction for NUA to <<cos n(psi1+phi2+phi3-phi4-phi5-phi6)>> (p_{t}) for POIs", |
| 969 | fnBinsPt,fPtMin,fPtMax); |
| 970 | f6pFinalCorrectionsForNUAPtPOI->SetXTitle("p_{t}"); |
| 971 | fResultsList->Add(f6pFinalCorrectionsForNUAPtPOI); |
| 972 | |
| 973 | // correction for non-uniform acceptance to <<cos n(psi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)>> for POIs: |
| 974 | f8pFinalCorrectionsForNUAPtPOI = new TH1D("f8pFinalCorrectionsForNUAPtPOI", |
| 975 | "correction for NUA to <<cos n(psi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)>> (p_{t}) for POIs", |
| 976 | fnBinsPt,fPtMin,fPtMax); |
| 977 | f8pFinalCorrectionsForNUAPtPOI->SetXTitle("p_{t}"); |
| 978 | fResultsList->Add(f8pFinalCorrectionsForNUAPtPOI); |
| 979 | |
| 980 | // correction for non-uniform acceEtaance to <<cos n(psi1-phi2)>> for POIs: |
| 981 | f2pFinalCorrectionsForNUAEtaPOI = new TH1D("f2pFinalCorrectionsForNUAEtaPOI", |
| 982 | "correction for NUA to <<cos n(#psi_{1}-#phi_{2})>> (#eta) for POIs", |
| 983 | fnBinsEta,fEtaMin,fEtaMax); |
| 984 | f2pFinalCorrectionsForNUAEtaPOI->SetXTitle("#eta"); |
| 985 | fResultsList->Add(f2pFinalCorrectionsForNUAEtaPOI); |
| 986 | |
| 987 | // correction for non-uniform acceEtaance to <<cos n(psi1+phi2-phi3-phi4)>> for POIs: |
| 988 | f4pFinalCorrectionsForNUAEtaPOI = new TH1D("f4pFinalCorrectionsForNUAEtaPOI", |
| 989 | "correction for NUA to <<cos n(psi1+phi2-phi3-phi4)>> (#eta) for POIs", |
| 990 | fnBinsEta,fEtaMin,fEtaMax); |
| 991 | f4pFinalCorrectionsForNUAEtaPOI->SetXTitle("#eta"); |
| 992 | fResultsList->Add(f4pFinalCorrectionsForNUAEtaPOI); |
| 993 | |
| 994 | // correction for non-uniform acceEtaance to <<cos n(psi1+phi2+phi3-phi4-phi5-phi6)>> for POIs: |
| 995 | f6pFinalCorrectionsForNUAEtaPOI = new TH1D("f6pFinalCorrectionsForNUAEtaPOI", |
| 996 | "correction for NUA to <<cos n(psi1+phi2+phi3-phi4-phi5-phi6)>> (#eta) for POIs", |
| 997 | fnBinsEta,fEtaMin,fEtaMax); |
| 998 | f6pFinalCorrectionsForNUAEtaPOI->SetXTitle("#eta"); |
| 999 | fResultsList->Add(f6pFinalCorrectionsForNUAEtaPOI); |
| 1000 | |
| 1001 | // correction for non-uniform acceEtaance to <<cos n(psi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)>> for POIs: |
| 1002 | f8pFinalCorrectionsForNUAEtaPOI = new TH1D("f8pFinalCorrectionsForNUAEtaPOI", |
| 1003 | "correction for NUA to <<cos n(psi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)>> (#eta) for POIs", |
| 1004 | fnBinsEta,fEtaMin,fEtaMax); |
| 1005 | f8pFinalCorrectionsForNUAEtaPOI->SetXTitle("#eta"); |
| 1006 | fResultsList->Add(f8pFinalCorrectionsForNUAEtaPOI); |
| 1007 | |
| 1008 | |
| 9c1a9547 |
1009 | // non-weighted v'_{n}{2,QC} (pt,eta) for POIs |
| 1010 | fvn2ndPtEtaPOI = new TH2D("fvn2ndPtEtaPOI","v'_{n}{2,QC} (p_{t},#eta) for POIs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 1011 | fvn2ndPtEtaPOI->SetXTitle("p_{t}"); |
| 1012 | fvn2ndPtEtaPOI->SetYTitle("#eta"); |
| 1013 | fResultsList->Add(fvn2ndPtEtaPOI); |
| 1014 | |
| 1015 | // non-weighted v'_{n}{4,QC} (pt,eta) for POIs |
| 1016 | fvn4thPtEtaPOI = new TH2D("fvn4thPtEtaPOI","v'_{n}{4,QC} (p_{t},#eta) for POIs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 1017 | fvn4thPtEtaPOI->SetXTitle("p_{t}"); |
| 1018 | fvn4thPtEtaPOI->SetYTitle("#eta"); |
| 1019 | fResultsList->Add(fvn4thPtEtaPOI); |
| 1020 | |
| 1021 | // non-weighted v'_{n}{6,QC} (pt,eta) for POIs |
| 1022 | fvn6thPtEtaPOI = new TH2D("fvn6thPtEtaPOI","v'_{n}{6,QC} (p_{t},#eta) for POIs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 1023 | fvn6thPtEtaPOI->SetXTitle("p_{t}"); |
| 1024 | fvn6thPtEtaPOI->SetYTitle("#eta"); |
| 1025 | fResultsList->Add(fvn6thPtEtaPOI); |
| 1026 | |
| 1027 | // non-weighted v'_{n}{8,QC} (pt,eta) for POIs |
| 1028 | fvn8thPtEtaPOI = new TH2D("fvn8thPtEtaPOI","v'_{n}{8,QC} (p_{t},#eta) for POIs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 1029 | fvn8thPtEtaPOI->SetXTitle("p_{t}"); |
| 1030 | fvn8thPtEtaPOI->SetYTitle("#eta"); |
| 1031 | fResultsList->Add(fvn8thPtEtaPOI); |
| 1032 | |
| 1033 | // non-weighted v'_{n}{2,QC} (pt) for POIs |
| 1034 | fvn2ndPtPOI = new TH1D("fvn2ndPtPOI","v'_{n}{2,QC} (p_{t}) for POIs",fnBinsPt,fPtMin,fPtMax); |
| 1035 | fvn2ndPtPOI->SetXTitle("p_{t}"); |
| 1036 | fResultsList->Add(fvn2ndPtPOI); |
| 1037 | |
| 1038 | // non-weighted v'_{n}{4,QC} (pt) for POIs |
| 1039 | fvn4thPtPOI = new TH1D("fvn4thPtPOI","v'_{n}{4,QC} (p_{t}) for POIs",fnBinsPt,fPtMin,fPtMax); |
| 1040 | fvn4thPtPOI->SetXTitle("p_{t}"); |
| 1041 | fvn4thPtPOI->SetYTitle("#eta"); |
| 1042 | fResultsList->Add(fvn4thPtPOI); |
| 1043 | |
| 1044 | // non-weighted v'_{n}{6,QC} (pt) for POIs |
| 1045 | fvn6thPtPOI = new TH1D("fvn6thPtPOI","v'_{n}{6,QC} (p_{t}) for POIs",fnBinsPt,fPtMin,fPtMax); |
| 1046 | fvn6thPtPOI->SetXTitle("p_{t}"); |
| 1047 | fResultsList->Add(fvn6thPtPOI); |
| 1048 | |
| 1049 | // non-weighted v'_{n}{8,QC} (pt) for POIs |
| 1050 | fvn8thPtPOI = new TH1D("fvn8thPtPOI","v'_{n}{8,QC} (p_{t}) for POIs",fnBinsPt,fPtMin,fPtMax); |
| 1051 | fvn8thPtPOI->SetXTitle("p_{t}"); |
| 1052 | fResultsList->Add(fvn8thPtPOI); |
| 1053 | |
| 1054 | // non-weighted v'_{n}{2,QC} (eta) for POIs |
| 1055 | fvn2ndEtaPOI = new TH1D("fvn2ndEtaPOI","v'_{n}{2,QC} (#eta) for POIs",fnBinsEta,fEtaMin,fEtaMax); |
| 1056 | fvn2ndEtaPOI->SetXTitle("#eta"); |
| 1057 | fResultsList->Add(fvn2ndEtaPOI); |
| 1058 | |
| 1059 | // non-weighted v'_{n}{4,QC} (eta) for POIs |
| 1060 | fvn4thEtaPOI = new TH1D("fvn4thEtaPOI","v'_{n}{4,QC} (#eta) for POIs",fnBinsEta,fEtaMin,fEtaMax); |
| 1061 | fvn4thEtaPOI->SetXTitle("#eta"); |
| 1062 | fResultsList->Add(fvn4thEtaPOI); |
| 1063 | |
| 1064 | // non-weighted v'_{n}{6,QC} (eta) for POIs |
| 1065 | fvn6thEtaPOI = new TH1D("fvn6thEtaPOI","v'_{n}{6,QC} (#eta) for POIs",fnBinsEta,fEtaMin,fEtaMax); |
| 1066 | fvn6thEtaPOI->SetXTitle("#eta"); |
| 1067 | fResultsList->Add(fvn6thEtaPOI); |
| 1068 | |
| 1069 | // non-weighted v'_{n}{8,QC} (eta) for POIs |
| 1070 | fvn8thEtaPOI = new TH1D("fvn8thEtaPOI","v'_{n}{8,QC} (#eta) for POIs",fnBinsEta,fEtaMin,fEtaMax); |
| 1071 | fvn8thEtaPOI->SetXTitle("p_{t}"); |
| 1072 | fResultsList->Add(fvn8thEtaPOI); |
| 1073 | |
| 1074 | // <w2 cos n(psi1-phi2)> for POIs: |
| 1075 | f2pPtEtaPOIW = new TProfile2D("f2pPtEtaPOIW","<w_{2} cos n(#psi_{1}-#phi_{2})> (p_{t},#eta) for POIs", |
| 1076 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 1077 | f2pPtEtaPOIW->SetXTitle("p_{t}"); |
| 1078 | fDiffFlowList->Add(f2pPtEtaPOIW); |
| 1079 | |
| 1080 | // <w2 w3 w4 cos n(psi1+phi2-phi3-phi4)> for POIs: |
| 1081 | f4pPtEtaPOIW = new TProfile2D("f4pPtEtaPOIW","<w_{2}w_{3}w_{4} cos n(#psi_{1}+#phi_{2}-#phi_{3}-#phi_{4})> (p_{t},#eta) for POIs", |
| 1082 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 1083 | f4pPtEtaPOIW->SetXTitle("p_{t}"); |
| 1084 | fDiffFlowList->Add(f4pPtEtaPOIW); |
| 1085 | |
| 1086 | // <w2 w3 w4 w5 w6 cos n(psi1+phi2+phi3-phi4-phi5-phi6)> for POIs: |
| 1087 | f6pPtEtaPOIW = new TProfile2D("f6pPtEtaPOIW","<w_{2}w_{3}w_{4}w_{5}w_{6} cos n(#psi_{1}+#phi_{2}+#phi_{3}-#phi_{4}-#phi_{5}-#phi_{6})> (p_{t},#eta) for POIs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 1088 | f6pPtEtaPOIW->SetXTitle("p_{t}"); |
| 1089 | fDiffFlowList->Add(f6pPtEtaPOIW); |
| 1090 | |
| 1091 | // <w2 w3 w4 w5 w6 w7 w8 cos n(psi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)> for POIs: |
| 1092 | f8pPtEtaPOIW = new TProfile2D("f8pPtEtaPOIW","<w_{2}w_{3}w_{4}w_{5}w_{6}w_{7}w_{8} cos n(#psi_{1}+#phi_{2}+#phi_{3}+#phi_{4}-#phi_{5}-#phi_{6}-#phi_{7}-#phi_{8})> (p_{t},#eta) for POIs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 1093 | f8pPtEtaPOIW->SetXTitle("p_{t}"); |
| 1094 | f8pPtEtaPOIW->SetYTitle("#eta"); |
| 1095 | fDiffFlowList->Add(f8pPtEtaPOIW); |
| 1096 | |
| 1097 | // weighted v'_{n}{2,QC} (pt,eta) for POIs |
| 1098 | fvn2ndPtEtaPOIW = new TH2D("fvn2ndPtEtaPOIW","weighted v'_{n}{2,QC} (p_{t},#eta) for POIs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 1099 | fvn2ndPtEtaPOIW->SetXTitle("p_{t}"); |
| 1100 | fvn2ndPtEtaPOIW->SetYTitle("#eta"); |
| 1101 | fResultsList->Add(fvn2ndPtEtaPOIW); |
| 1102 | |
| 1103 | // weighted v'_{n}{4,QC} (pt,eta) for POIs |
| 1104 | fvn4thPtEtaPOIW = new TH2D("fvn4thPtEtaPOIW","weighted v'_{n}{4,QC} (p_{t},#eta) for POIs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 1105 | fvn4thPtEtaPOIW->SetXTitle("p_{t}"); |
| 1106 | fvn4thPtEtaPOIW->SetYTitle("#eta"); |
| 1107 | fResultsList->Add(fvn4thPtEtaPOIW); |
| 1108 | |
| 1109 | // weighted v'_{n}{6,QC} (pt,eta) for POIs |
| 1110 | fvn6thPtEtaPOIW = new TH2D("fvn6thPtEtaPOIW","weighted v'_{n}{6,QC} (p_{t},#eta) for POIs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 1111 | fvn6thPtEtaPOIW->SetXTitle("p_{t}"); |
| 1112 | fvn6thPtEtaPOIW->SetYTitle("#eta"); |
| 1113 | fResultsList->Add(fvn6thPtEtaPOIW); |
| 1114 | |
| 1115 | // weighted v'_{n}{8,QC} (pt,eta) for POIs |
| 1116 | fvn8thPtEtaPOIW = new TH2D("fvn8thPtEtaPOIW","weighted v'_{n}{8,QC} (p_{t},#eta) for POIs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 1117 | fvn8thPtEtaPOIW->SetXTitle("p_{t}"); |
| 1118 | fvn8thPtEtaPOIW->SetYTitle("#eta"); |
| 1119 | fResultsList->Add(fvn8thPtEtaPOIW); |
| 1120 | |
| 1121 | // weighted v'_{n}{2,QC} (pt) for POIs |
| 1122 | fvn2ndPtPOIW = new TH1D("fvn2ndPtPOIW","weighted v'_{n}{2,QC} (p_{t}) for POIs",fnBinsPt,fPtMin,fPtMax); |
| 1123 | fvn2ndPtPOIW->SetXTitle("p_{t}"); |
| 1124 | fResultsList->Add(fvn2ndPtPOIW); |
| 1125 | |
| 1126 | // weighted v'_{n}{4,QC} (pt) for POIs |
| 1127 | fvn4thPtPOIW = new TH1D("fvn4thPtPOIW","weighted v'_{n}{4,QC} (p_{t}) for POIs",fnBinsPt,fPtMin,fPtMax); |
| 1128 | fvn4thPtPOIW->SetXTitle("p_{t}"); |
| 1129 | fResultsList->Add(fvn4thPtPOIW); |
| 1130 | |
| 1131 | // weighted v'_{n}{6,QC} (pt) for POIs |
| 1132 | fvn6thPtPOIW = new TH1D("fvn6thPtPOIW","weighted v'_{n}{6,QC} (p_{t}) for POIs",fnBinsPt,fPtMin,fPtMax); |
| 1133 | fvn6thPtPOIW->SetXTitle("p_{t}"); |
| 1134 | fResultsList->Add(fvn6thPtPOIW); |
| 1135 | |
| 1136 | // weighted v'_{n}{8,QC} (pt) for POIs |
| 1137 | fvn8thPtPOIW = new TH1D("fvn8thPtPOIW","weighted v'_{n}{8,QC} (p_{t}) for POIs",fnBinsPt,fPtMin,fPtMax); |
| 1138 | fvn8thPtPOIW->SetXTitle("p_{t}"); |
| 1139 | fResultsList->Add(fvn8thPtPOIW); |
| 1140 | |
| 1141 | // weighted v'_{n}{2,QC} (eta) for POIs |
| 1142 | fvn2ndEtaPOIW = new TH1D("fvn2ndEtaPOIW","weighted v'_{n}{2,QC} (#eta) for POIs",fnBinsEta,fEtaMin,fEtaMax); |
| 1143 | fvn2ndEtaPOIW->SetXTitle("#eta"); |
| 1144 | fResultsList->Add(fvn2ndEtaPOIW); |
| 1145 | |
| 1146 | // weighted v'_{n}{4,QC} (eta) for POIs |
| 1147 | fvn4thEtaPOIW = new TH1D("fvn4thEtaPOIW","weighted v'_{n}{4,QC} (#eta) for POIs",fnBinsEta,fEtaMin,fEtaMax); |
| 1148 | fvn4thEtaPOIW->SetXTitle("#eta"); |
| 1149 | fResultsList->Add(fvn4thEtaPOIW); |
| 1150 | |
| 1151 | // weighted v'_{n}{6,QC} (eta) for POIs |
| 1152 | fvn6thEtaPOIW = new TH1D("fvn6thEtaPOIW","weighted v'_{n}{6,QC} (#eta) for POIs",fnBinsEta,fEtaMin,fEtaMax); |
| 1153 | fvn6thEtaPOIW->SetXTitle("#eta"); |
| 1154 | fResultsList->Add(fvn6thEtaPOIW); |
| 1155 | |
| 1156 | // weighted v'_{n}{8,QC} (eta) for POIs |
| 1157 | fvn8thEtaPOIW = new TH1D("fvn8thEtaPOIW","weighted v'_{n}{8,QC} (#eta) for POIs",fnBinsEta,fEtaMin,fEtaMax); |
| 1158 | fvn8thEtaPOIW->SetXTitle("#eta"); |
| 1159 | fResultsList->Add(fvn8thEtaPOIW); |
| 1160 | |
| 2bdc5281 |
1161 | // <<cos n(psi1-phi2)>> for RPs: |
| 1162 | f2pPtEtaRP = new TProfile2D("f2pPtEtaRP","<<cos n(#psi_{1}-#phi_{2})>> (p_{t},#eta) for RPs", |
| 9c1a9547 |
1163 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 1164 | f2pPtEtaRP->SetXTitle("p_{t}"); |
| 1165 | f2pPtEtaRP->SetYTitle("#eta"); |
| 1166 | fDiffFlowList->Add(f2pPtEtaRP); |
| 1167 | |
| 2bdc5281 |
1168 | // <<cos n(psi1+phi2-phi3-phi4)>> for RPs: |
| 1169 | f4pPtEtaRP = new TProfile2D("f4pPtEtaRP","<<cos n(#psi_{1}+#phi_{2}-#phi_{3}-#phi_{4})>> (p_{t},#eta) for RPs", |
| 9c1a9547 |
1170 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 1171 | f4pPtEtaRP->SetXTitle("p_{t}"); |
| 1172 | f4pPtEtaRP->SetYTitle("#eta"); |
| 1173 | fDiffFlowList->Add(f4pPtEtaRP); |
| 1174 | |
| 2bdc5281 |
1175 | // <<cos n(psi1+phi2+phi3-phi4-phi5-phi6)>> for RPs: |
| 1176 | f6pPtEtaRP = new TProfile2D("f6pPtEtaRP","<<cos n(#psi_{1}+#phi_{2}+#phi_{3}-#phi_{4}-#phi_{5}-#phi_{6})>> (p_{t},#eta) for RPs", |
| 9c1a9547 |
1177 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 1178 | f6pPtEtaRP->SetXTitle("p_{t}"); |
| 1179 | f6pPtEtaRP->SetYTitle("#eta"); |
| 1180 | fDiffFlowList->Add(f6pPtEtaRP); |
| 1181 | |
| 2bdc5281 |
1182 | // <<cos n(psi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)>> for RPs: |
| 1183 | f8pPtEtaRP = new TProfile2D("f8pPtEtaRP","<<cos n(#psi_{1}+#phi_{2}+#phi_{3}+#phi_{4}-#phi_{5}-#phi_{6}-#phi_{7}-#phi_{8})>> (p_{t},#eta) for RPs", |
| 9c1a9547 |
1184 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 1185 | f8pPtEtaRP->SetXTitle("p_{t}"); |
| 1186 | f8pPtEtaRP->SetYTitle("#eta"); |
| 1187 | fDiffFlowList->Add(f8pPtEtaRP); |
| 2bdc5281 |
1188 | |
| 1189 | // correction for non-uniform acceptance to <<cos n(psi1-phi2)>> for RPs: |
| 1190 | f2pFinalCorrectionsForNUAPtEtaRP = new TH2D("f2pFinalCorrectionsForNUAPtEtaRP", |
| 1191 | "correction for NUA to <<cos n(#psi_{1}-#phi_{2})>> (p_{t},#eta) for RPs", |
| 1192 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 1193 | f2pFinalCorrectionsForNUAPtEtaRP->SetXTitle("p_{t}"); |
| 1194 | f2pFinalCorrectionsForNUAPtEtaRP->SetYTitle("#eta"); |
| 1195 | fResultsList->Add(f2pFinalCorrectionsForNUAPtEtaRP); |
| 1196 | |
| 1197 | // correction for non-uniform acceptance to <<cos n(psi1+phi2-phi3-phi4)>> for RPs: |
| 1198 | f4pFinalCorrectionsForNUAPtEtaRP = new TH2D("f4pFinalCorrectionsForNUAPtEtaRP", |
| 1199 | "correction for NUA to <<cos n(psi1+phi2-phi3-phi4)>> (p_{t},#eta) for RPs", |
| 1200 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 1201 | f4pFinalCorrectionsForNUAPtEtaRP->SetXTitle("p_{t}"); |
| 1202 | f4pFinalCorrectionsForNUAPtEtaRP->SetYTitle("#eta"); |
| 1203 | fResultsList->Add(f4pFinalCorrectionsForNUAPtEtaRP); |
| 1204 | |
| 1205 | // correction for non-uniform acceptance to <<cos n(psi1+phi2+phi3-phi4-phi5-phi6)>> for RPs: |
| 1206 | f6pFinalCorrectionsForNUAPtEtaRP = new TH2D("f6pFinalCorrectionsForNUAPtEtaRP", |
| 1207 | "correction for NUA to <<cos n(psi1+phi2+phi3-phi4-phi5-phi6)>> (p_{t},#eta) for RPs", |
| 1208 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 1209 | f6pFinalCorrectionsForNUAPtEtaRP->SetXTitle("p_{t}"); |
| 1210 | f6pFinalCorrectionsForNUAPtEtaRP->SetYTitle("#eta"); |
| 1211 | fResultsList->Add(f6pFinalCorrectionsForNUAPtEtaRP); |
| 1212 | |
| 1213 | // correction for non-uniform acceptance to <<cos n(psi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)>> for RPs: |
| 1214 | f8pFinalCorrectionsForNUAPtEtaRP = new TH2D("f8pFinalCorrectionsForNUAPtEtaRP", |
| 1215 | "correction for NUA to <<cos n(psi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)>> (p_{t},#eta) for RPs", |
| 1216 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 1217 | f8pFinalCorrectionsForNUAPtEtaRP->SetXTitle("p_{t}"); |
| 1218 | f8pFinalCorrectionsForNUAPtEtaRP->SetYTitle("#eta"); |
| 1219 | fResultsList->Add(f8pFinalCorrectionsForNUAPtEtaRP); |
| 1220 | |
| 1221 | // correction for non-uniform acceptance to <<cos n(psi1-phi2)>> for RPs: |
| 1222 | f2pFinalCorrectionsForNUAPtRP = new TH1D("f2pFinalCorrectionsForNUAPtRP", |
| 1223 | "correction for NUA to <<cos n(#psi_{1}-#phi_{2})>> (p_{t}) for RPs", |
| 1224 | fnBinsPt,fPtMin,fPtMax); |
| 1225 | f2pFinalCorrectionsForNUAPtRP->SetXTitle("p_{t}"); |
| 1226 | fResultsList->Add(f2pFinalCorrectionsForNUAPtRP); |
| 1227 | |
| 1228 | // correction for non-uniform acceptance to <<cos n(psi1+phi2-phi3-phi4)>> for RPs: |
| 1229 | f4pFinalCorrectionsForNUAPtRP = new TH1D("f4pFinalCorrectionsForNUAPtRP", |
| 1230 | "correction for NUA to <<cos n(psi1+phi2-phi3-phi4)>> (p_{t}) for RPs", |
| 1231 | fnBinsPt,fPtMin,fPtMax); |
| 1232 | f4pFinalCorrectionsForNUAPtRP->SetXTitle("p_{t}"); |
| 1233 | fResultsList->Add(f4pFinalCorrectionsForNUAPtRP); |
| 1234 | |
| 1235 | // correction for non-uniform acceptance to <<cos n(psi1+phi2+phi3-phi4-phi5-phi6)>> for RPs: |
| 1236 | f6pFinalCorrectionsForNUAPtRP = new TH1D("f6pFinalCorrectionsForNUAPtRP", |
| 1237 | "correction for NUA to <<cos n(psi1+phi2+phi3-phi4-phi5-phi6)>> (p_{t}) for RPs", |
| 1238 | fnBinsPt,fPtMin,fPtMax); |
| 1239 | f6pFinalCorrectionsForNUAPtRP->SetXTitle("p_{t}"); |
| 1240 | fResultsList->Add(f6pFinalCorrectionsForNUAPtRP); |
| 1241 | |
| 1242 | // correction for non-uniform acceptance to <<cos n(psi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)>> for RPs: |
| 1243 | f8pFinalCorrectionsForNUAPtRP = new TH1D("f8pFinalCorrectionsForNUAPtRP", |
| 1244 | "correction for NUA to <<cos n(psi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)>> (p_{t}) for RPs", |
| 1245 | fnBinsPt,fPtMin,fPtMax); |
| 1246 | f8pFinalCorrectionsForNUAPtRP->SetXTitle("p_{t}"); |
| 1247 | fResultsList->Add(f8pFinalCorrectionsForNUAPtRP); |
| 1248 | |
| 1249 | // correction for non-uniform acceEtaance to <<cos n(psi1-phi2)>> for RPs: |
| 1250 | f2pFinalCorrectionsForNUAEtaRP = new TH1D("f2pFinalCorrectionsForNUAEtaRP", |
| 1251 | "correction for NUA to <<cos n(#psi_{1}-#phi_{2})>> (#eta) for RPs", |
| 1252 | fnBinsEta,fEtaMin,fEtaMax); |
| 1253 | f2pFinalCorrectionsForNUAEtaRP->SetXTitle("#eta"); |
| 1254 | fResultsList->Add(f2pFinalCorrectionsForNUAEtaRP); |
| 1255 | |
| 1256 | // correction for non-uniform acceEtaance to <<cos n(psi1+phi2-phi3-phi4)>> for RPs: |
| 1257 | f4pFinalCorrectionsForNUAEtaRP = new TH1D("f4pFinalCorrectionsForNUAEtaRP", |
| 1258 | "correction for NUA to <<cos n(psi1+phi2-phi3-phi4)>> (#eta) for RPs", |
| 1259 | fnBinsEta,fEtaMin,fEtaMax); |
| 1260 | f4pFinalCorrectionsForNUAEtaRP->SetXTitle("#eta"); |
| 1261 | fResultsList->Add(f4pFinalCorrectionsForNUAEtaRP); |
| 1262 | |
| 1263 | // correction for non-uniform acceEtaance to <<cos n(psi1+phi2+phi3-phi4-phi5-phi6)>> for RPs: |
| 1264 | f6pFinalCorrectionsForNUAEtaRP = new TH1D("f6pFinalCorrectionsForNUAEtaRP", |
| 1265 | "correction for NUA to <<cos n(psi1+phi2+phi3-phi4-phi5-phi6)>> (#eta) for RPs", |
| 1266 | fnBinsEta,fEtaMin,fEtaMax); |
| 1267 | f6pFinalCorrectionsForNUAEtaRP->SetXTitle("#eta"); |
| 1268 | fResultsList->Add(f6pFinalCorrectionsForNUAEtaRP); |
| 1269 | |
| 1270 | // correction for non-uniform acceEtaance to <<cos n(psi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)>> for RPs: |
| 1271 | f8pFinalCorrectionsForNUAEtaRP = new TH1D("f8pFinalCorrectionsForNUAEtaRP", |
| 1272 | "correction for NUA to <<cos n(psi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)>> (#eta) for RPs", |
| 1273 | fnBinsEta,fEtaMin,fEtaMax); |
| 1274 | f8pFinalCorrectionsForNUAEtaRP->SetXTitle("#eta"); |
| 1275 | fResultsList->Add(f8pFinalCorrectionsForNUAEtaRP); |
| 9c1a9547 |
1276 | |
| 1277 | // non-weighted v'_{n}{2,QC} (pt,eta) for RPs |
| 1278 | fvn2ndPtEtaRP = new TH2D("fvn2ndPtEtaRP","v'_{n}{2,QC} (p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 1279 | fvn2ndPtEtaRP->SetXTitle("p_{t}"); |
| 1280 | fvn2ndPtEtaRP->SetYTitle("#eta"); |
| 1281 | fResultsList->Add(fvn2ndPtEtaRP); |
| 1282 | |
| 1283 | // non-weighted v'_{n}{4,QC} (pt,eta) for RPs |
| 1284 | fvn4thPtEtaRP = new TH2D("fvn4thPtEtaRP","v'_{n}{4,QC} (p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 1285 | fvn4thPtEtaRP->SetXTitle("p_{t}"); |
| 1286 | fvn4thPtEtaRP->SetYTitle("#eta"); |
| 1287 | fResultsList->Add(fvn4thPtEtaRP); |
| 1288 | |
| 1289 | // non-weighted v'_{n}{6,QC} (pt,eta) for RPs |
| 1290 | fvn6thPtEtaRP = new TH2D("fvn6thPtEtaRP","v'_{n}{6,QC} (p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 1291 | fvn6thPtEtaRP->SetXTitle("p_{t}"); |
| 1292 | fvn6thPtEtaRP->SetYTitle("#eta"); |
| 1293 | fResultsList->Add(fvn6thPtEtaRP); |
| 1294 | |
| 1295 | // non-weighted v'_{n}{8,QC} (pt,eta) for RPs |
| 1296 | fvn8thPtEtaRP = new TH2D("fvn8thPtEtaRP","v'_{n}{8,QC} (p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 1297 | fvn8thPtEtaRP->SetXTitle("p_{t}"); |
| 1298 | fvn8thPtEtaRP->SetYTitle("#eta"); |
| 1299 | fResultsList->Add(fvn8thPtEtaRP); |
| 1300 | |
| 1301 | // non-weighted v'_{n}{2,QC} (pt) for RPs |
| 1302 | fvn2ndPtRP = new TH1D("fvn2ndPtRP","v'_{n}{2,QC} (p_{t}) for RPs",fnBinsPt,fPtMin,fPtMax); |
| 1303 | fvn2ndPtRP->SetXTitle("p_{t}"); |
| 1304 | fResultsList->Add(fvn2ndPtRP); |
| 1305 | |
| 1306 | // non-weighted v'_{n}{4,QC} (pt) for RPs |
| 1307 | fvn4thPtRP = new TH1D("fvn4thPtRP","v'_{n}{4,QC} (p_{t}) for RPs",fnBinsPt,fPtMin,fPtMax); |
| 1308 | fvn4thPtRP->SetXTitle("p_{t}"); |
| 1309 | fResultsList->Add(fvn4thPtRP); |
| 1310 | |
| 1311 | // non-weighted v'_{n}{6,QC} (pt) for RPs |
| 1312 | fvn6thPtRP = new TH1D("fvn6thPtRP","v'_{n}{6,QC} (p_{t}) for RPs",fnBinsPt,fPtMin,fPtMax); |
| 1313 | fvn6thPtRP->SetXTitle("p_{t}"); |
| 1314 | fResultsList->Add(fvn6thPtRP); |
| 1315 | |
| 1316 | // non-weighted v'_{n}{8,QC} (pt) for RPs |
| 1317 | fvn8thPtRP = new TH1D("fvn8thPtRP","v'_{n}{8,QC} (p_{t}) for RPs",fnBinsPt,fPtMin,fPtMax); |
| 1318 | fvn8thPtRP->SetXTitle("p_{t}"); |
| 1319 | fResultsList->Add(fvn8thPtRP); |
| 1320 | |
| 1321 | // non-weighted v'_{n}{2,QC} (eta) for RPs |
| 1322 | fvn2ndEtaRP = new TH1D("fvn2ndEtaRP","v'_{n}{2,QC} (#eta) for RPs",fnBinsEta,fEtaMin,fEtaMax); |
| 1323 | fvn2ndEtaRP->SetXTitle("#eta"); |
| 1324 | fResultsList->Add(fvn2ndEtaRP); |
| 1325 | |
| 1326 | // non-weighted v'_{n}{4,QC} (eta) for RPs |
| 1327 | fvn4thEtaRP = new TH1D("fvn4thEtaRP","v'_{n}{4,QC} (#eta) for RPs",fnBinsEta,fEtaMin,fEtaMax); |
| 1328 | fvn4thEtaRP->SetXTitle("#eta"); |
| 1329 | fResultsList->Add(fvn4thEtaRP); |
| 1330 | |
| 1331 | // non-weighted v'_{n}{6,QC} (eta) for RPs |
| 1332 | fvn6thEtaRP = new TH1D("fvn6thEtaRP","v'_{n}{6,QC} (#eta) for RPs",fnBinsEta,fEtaMin,fEtaMax); |
| 1333 | fvn6thEtaRP->SetXTitle("#eta"); |
| 1334 | fResultsList->Add(fvn6thEtaRP); |
| 1335 | |
| 1336 | // non-weighted v'_{n}{8,QC} (eta) for RPs |
| 1337 | fvn8thEtaRP = new TH1D("fvn8thEtaRP","v'_{n}{8,QC} (#eta) for RPs",fnBinsEta,fEtaMin,fEtaMax); |
| 1338 | fvn8thEtaRP->SetXTitle("#eta"); |
| 1339 | fResultsList->Add(fvn8thEtaRP); |
| 1340 | |
| 1341 | // <w2 cos n(psi1-phi2)> for RPs: |
| 1342 | f2pPtEtaRPW = new TProfile2D("f2pPtEtaRPW","<w_{2} cos n(#psi_{1}-#phi_{2})> (p_{t},#eta) for RPs", |
| 1343 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 1344 | f2pPtEtaRPW->SetXTitle("p_{t}"); |
| 1345 | f2pPtEtaRPW->SetYTitle("#eta"); |
| 1346 | fDiffFlowList->Add(f2pPtEtaRPW); |
| 1347 | |
| 1348 | // <w2 w3 w4 cos n(psi1+phi2-phi3-phi4)> for RPs: |
| 1349 | f4pPtEtaRPW = new TProfile2D("f4pPtEtaRPW","<w_{2}w_{3}w_{4} cos n(#psi_{1}+#phi_{2}-#phi_{3}-#phi_{4})> (p_{t},#eta) for RPs", |
| 1350 | fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 1351 | f4pPtEtaRPW->SetXTitle("p_{t}"); |
| 1352 | f4pPtEtaRPW->SetYTitle("#eta"); |
| 1353 | fDiffFlowList->Add(f4pPtEtaRPW); |
| 1354 | |
| 1355 | // <w2 w3 w4 w5 w6 cos n(psi1+phi2+phi3-phi4-phi5-phi6)> for RPs: |
| 1356 | f6pPtEtaRPW = new TProfile2D("f6pPtEtaRPW","<w_{2}w_{3}w_{4}w_{5}w_{6} cos n(#psi_{1}+#phi_{2}+#phi_{3}-#phi_{4}-#phi_{5}-#phi_{6})> (p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 1357 | f6pPtEtaRPW->SetXTitle("p_{t}"); |
| 1358 | f6pPtEtaRPW->SetYTitle("#eta"); |
| 1359 | fDiffFlowList->Add(f6pPtEtaRPW); |
| 1360 | |
| 1361 | // <w2 w3 w4 w5 w6 w7 w8 cos n(psi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)> for RPs: |
| 1362 | f8pPtEtaRPW = new TProfile2D("f8pPtEtaRPW","<w_{2}w_{3}w_{4}w_{5}w_{6}w_{7}w_{8} cos n(#psi_{1}+#phi_{2}+#phi_{3}+#phi_{4}-#phi_{5}-#phi_{6}-#phi_{7}-#phi_{8})> (p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s"); |
| 1363 | f8pPtEtaRPW->SetXTitle("p_{t}"); |
| 1364 | f8pPtEtaRPW->SetYTitle("#eta"); |
| 1365 | fDiffFlowList->Add(f8pPtEtaRPW); |
| 1366 | |
| 1367 | // weighted v'_{n}{2,QC} (pt,eta) for RPs |
| 1368 | fvn2ndPtEtaRPW = new TH2D("fvn2ndPtEtaRPW","weighted v'_{n}{2,QC} (p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 1369 | fvn2ndPtEtaRPW->SetXTitle("p_{t}"); |
| 1370 | fvn2ndPtEtaRPW->SetYTitle("#eta"); |
| 1371 | fResultsList->Add(fvn2ndPtEtaRPW); |
| 1372 | |
| 1373 | // weighted v'_{n}{4,QC} (pt,eta) for RPs |
| 1374 | fvn4thPtEtaRPW = new TH2D("fvn4thPtEtaRPW","weighted v'_{n}{4,QC} (p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 1375 | fvn4thPtEtaRPW->SetXTitle("p_{t}"); |
| 1376 | fvn4thPtEtaRPW->SetYTitle("#eta"); |
| 1377 | fResultsList->Add(fvn4thPtEtaRPW); |
| 1378 | |
| 1379 | // weighted v'_{n}{6,QC} (pt,eta) for RPs |
| 1380 | fvn6thPtEtaRPW = new TH2D("fvn6thPtEtaRPW","weighted v'_{n}{6,QC} (p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 1381 | fvn6thPtEtaRPW->SetXTitle("p_{t}"); |
| 1382 | fvn6thPtEtaRPW->SetYTitle("#eta"); |
| 1383 | fResultsList->Add(fvn6thPtEtaRPW); |
| 1384 | |
| 1385 | // weighted v'_{n}{8,QC} (pt,eta) for RPs |
| 1386 | fvn8thPtEtaRPW = new TH2D("fvn8thPtEtaRPW","weighted v'_{n}{8,QC} (p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 1387 | fvn8thPtEtaRPW->SetXTitle("p_{t}"); |
| 1388 | fvn8thPtEtaRPW->SetYTitle("#eta"); |
| 1389 | fResultsList->Add(fvn8thPtEtaRPW); |
| 1390 | |
| 1391 | // weighted v'_{n}{2,QC} (pt) for RPs |
| 1392 | fvn2ndPtRPW = new TH1D("fvn2ndPtRPW","weighted v'_{n}{2,QC} (p_{t}) for RPs",fnBinsPt,fPtMin,fPtMax); |
| 1393 | fvn2ndPtRPW->SetXTitle("p_{t}"); |
| 1394 | fResultsList->Add(fvn2ndPtRPW); |
| 1395 | |
| 1396 | // weighted v'_{n}{4,QC} (pt) for RPs |
| 1397 | fvn4thPtRPW = new TH1D("fvn4thPtRPW","weighted v'_{n}{4,QC} (p_{t}) for RPs",fnBinsPt,fPtMin,fPtMax); |
| 1398 | fvn4thPtRPW->SetXTitle("p_{t}"); |
| 1399 | fResultsList->Add(fvn4thPtRPW); |
| 1400 | |
| 1401 | // weighted v'_{n}{6,QC} (pt) for RPs |
| 1402 | fvn6thPtRPW = new TH1D("fvn6thPtRPW","weighted v'_{n}{6,QC} (p_{t}) for RPs",fnBinsPt,fPtMin,fPtMax); |
| 1403 | fvn6thPtRPW->SetXTitle("p_{t}"); |
| 1404 | fResultsList->Add(fvn6thPtRPW); |
| 1405 | |
| 1406 | // weighted v'_{n}{8,QC} (pt) for RPs |
| 1407 | fvn8thPtRPW = new TH1D("fvn8thPtRPW","weighted v'_{n}{8,QC} (p_{t}) for RPs",fnBinsPt,fPtMin,fPtMax); |
| 1408 | fvn8thPtRPW->SetXTitle("p_{t}"); |
| 1409 | fResultsList->Add(fvn8thPtRPW); |
| 1410 | |
| 1411 | // weighted v'_{n}{2,QC} (eta) for RPs |
| 1412 | fvn2ndEtaRPW = new TH1D("fvn2ndEtaRPW","weighted v'_{n}{2,QC} (#eta) for RPs",fnBinsEta,fEtaMin,fEtaMax); |
| 1413 | fvn2ndEtaRPW->SetXTitle("#eta"); |
| 1414 | fResultsList->Add(fvn2ndEtaRPW); |
| 1415 | |
| 1416 | // weighted v'_{n}{4,QC} (eta) for RPs |
| 1417 | fvn4thEtaRPW = new TH1D("fvn4thEtaRPW","weighted v'_{n}{4,QC} (#eta) for RPs",fnBinsEta,fEtaMin,fEtaMax); |
| 1418 | fvn4thEtaRPW->SetXTitle("#eta"); |
| 1419 | fResultsList->Add(fvn4thEtaRPW); |
| 1420 | |
| 1421 | // weighted v'_{n}{6,QC} (eta) for RPs |
| 1422 | fvn6thEtaRPW = new TH1D("fvn6thEtaRPW","weighted v'_{n}{6,QC} (#eta) for RPs",fnBinsEta,fEtaMin,fEtaMax); |
| 1423 | fvn6thEtaRPW->SetXTitle("#eta"); |
| 1424 | fResultsList->Add(fvn6thEtaRPW); |
| 1425 | |
| 1426 | // weighted v'_{n}{8,QC} (eta) for RPs |
| 1427 | fvn8thEtaRP = new TH1D("fvn8thEtaEtaRP","weighted v'_{n}{8,QC} (#eta) for RPs",fnBinsEta,fEtaMin,fEtaMax); |
| 1428 | fvn8thEtaRP->SetXTitle("#eta"); |
| 1429 | fResultsList->Add(fvn8thEtaRP); |
| 1430 | // ..................................................................................................................................... |
| 1431 | |
| 1432 | |
| 1433 | |
| 1434 | |
| 1435 | // add fUseWeightsBits to the main list (to be improved) |
| 1436 | fUseWeightsBits = new TBits(1); |
| 1437 | fHistList->Add(fUseWeightsBits); |
| 1438 | |
| 1439 | // add list fWeightsList with weights to the main list |
| 1440 | fHistList->Add(fWeightsList); |
| dee1e0e0 |
1441 | |
| 9c1a9547 |
1442 | // add list fDiffFlowList with histograms and profiles needed for differential flow to the main list |
| 1443 | fHistList->Add(fDiffFlowList); |
| 5e838eeb |
1444 | |
| 9c1a9547 |
1445 | // add list fResultsList with final results to the main list |
| 1446 | fHistList->Add(fResultsList); |
| 3c16adde |
1447 | |
| 9c1a9547 |
1448 | |
| 1449 | }//end of Init() |
| 3d824203 |
1450 | |
| 9c1a9547 |
1451 | |
| 1452 | //================================================================================================================ |
| 1453 | |
| 1454 | |
| 1455 | void AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent) |
| 1456 | { |
| 1457 | // running over data only in this method |
| 1458 | |
| 1459 | |
| 1460 | |
| 1461 | |
| 1462 | // ********************************************* |
| 1463 | // **** ACCESS THE OUTPUT FILE WITH WEIGHTS **** |
| 1464 | // ********************************************* |
| 1465 | |
| 1466 | fUseWeights = fUsePhiWeights||fUsePtWeights||fUseEtaWeights; |
| 1467 | fUseWeightsBits->SetBitNumber(1,fUseWeights); // to be improved (how to pass boolean to Finish()?) |
| 1468 | |
| 3d824203 |
1469 | TH1F *phiWeights = NULL; // histogram with phi weights |
| 1470 | TH1D *ptWeights = NULL; // histogram with pt weights |
| 1471 | TH1D *etaWeights = NULL; // histogram with eta weights |
| 1472 | |
| 9c1a9547 |
1473 | if(fUseWeights) |
| 3d824203 |
1474 | { |
| 1475 | if(!fWeightsList) |
| 1315fe58 |
1476 | { |
| 9c1a9547 |
1477 | cout<<" WARNING: fWeightsList is NULL pointer in AFAWQC::Make(). "<<endl; |
| 3d824203 |
1478 | exit(0); |
| 1479 | } |
| 1480 | if(fUsePhiWeights) |
| 1481 | { |
| 1482 | phiWeights = dynamic_cast<TH1F *>(fWeightsList->FindObject("phi_weights")); |
| 1483 | if(!phiWeights) |
| ae733b3b |
1484 | { |
| 9c1a9547 |
1485 | cout<<" WARNING: couldn't access the histogram with phi weights in AFAWQC::Make(). "<<endl; |
| 3d824203 |
1486 | exit(0); |
| ae733b3b |
1487 | } |
| 3d824203 |
1488 | } |
| 1489 | if(fUsePtWeights) |
| 1490 | { |
| 1491 | ptWeights = dynamic_cast<TH1D *>(fWeightsList->FindObject("pt_weights")); |
| 1492 | if(!ptWeights) |
| 1493 | { |
| 9c1a9547 |
1494 | cout<<" WARNING: couldn't access the histogram with pt weights in AFAWQC::Make(). "<<endl; |
| 3d824203 |
1495 | exit(0); |
| 1496 | } |
| 1497 | } |
| 1498 | if(fUseEtaWeights) |
| 1499 | { |
| 1500 | etaWeights = dynamic_cast<TH1D *>(fWeightsList->FindObject("eta_weights")); |
| 1501 | if(!etaWeights) |
| 1502 | { |
| 9c1a9547 |
1503 | cout<<" WARNING: couldn't access the histogram with eta weights in AFAWQC::Make(). "<<endl; |
| 3d824203 |
1504 | exit(0); |
| 1505 | } |
| 1506 | } |
| 1507 | } |
| 1508 | |
| 77515452 |
1509 | Int_t nBinsPhi = 0; |
| 9c1a9547 |
1510 | Double_t dBinWidthPt = 0.; |
| 1511 | Double_t dBinWidthEta = 0.; |
| 1512 | |
| 77515452 |
1513 | if(fnBinsPt) |
| 1514 | { |
| 1515 | dBinWidthPt=(fPtMax-fPtMin)/fnBinsPt; |
| 1516 | } |
| 9c1a9547 |
1517 | |
| 77515452 |
1518 | if(fnBinsEta) |
| 1519 | { |
| 1520 | dBinWidthEta=(fEtaMax-fEtaMin)/fnBinsEta; |
| 1521 | } |
| 3d824203 |
1522 | |
| 1523 | if(fWeightsList) |
| 9c1a9547 |
1524 | { |
| 1525 | if(fUsePhiWeights) |
| 3d824203 |
1526 | { |
| 9c1a9547 |
1527 | if(phiWeights) nBinsPhi = phiWeights->GetNbinsX(); |
| 1528 | } |
| 1529 | if(fUsePtWeights) |
| 1530 | { |
| 1531 | if(ptWeights) |
| 3d824203 |
1532 | { |
| 9c1a9547 |
1533 | Double_t dBinWidthPtW = ptWeights->GetBinWidth(1); // assuming that all bins have the same width |
| 1534 | if(dBinWidthPtW != dBinWidthPt) |
| 3d824203 |
1535 | { |
| 9c1a9547 |
1536 | cout<<" WARNING: dBinWidthPtW != dBinWidthPt in AFAWQC::Make()."<<endl; |
| 1537 | exit(0); |
| 1538 | } |
| 1539 | Double_t dPtMinW = (ptWeights->GetXaxis())->GetXmin(); |
| 1540 | if(dPtMinW != fPtMin) |
| 1541 | { |
| 1542 | cout<<" WARNING: dPtMinW != fPtMin in AFAWQC::Make()."<<endl; |
| 1543 | exit(0); |
| 1544 | } |
| 1545 | } |
| 1546 | } |
| 1547 | if(fUseEtaWeights) |
| 1548 | { |
| 1549 | if(etaWeights) |
| 3d824203 |
1550 | { |
| 9c1a9547 |
1551 | Double_t dBinWidthEtaW = etaWeights->GetBinWidth(1); // assuming that all bins have the same width |
| 1552 | if(dBinWidthEtaW != dBinWidthEta) |
| 3d824203 |
1553 | { |
| 9c1a9547 |
1554 | cout<<" WARNING: dBinWidthEtaW != dBinWidthEta in AFAWQC::Make()."<<endl; |
| 1555 | exit(0); |
| 1556 | } |
| 1557 | Double_t dEtaMinW = (etaWeights->GetXaxis())->GetXmin(); |
| 1558 | if(dEtaMinW != fEtaMin) |
| 1559 | { |
| 1560 | cout<<" WARNING: dEtaMinW != fEtaMin in AFAWQC::Make()."<<endl; |
| 1561 | exit(0); |
| 1562 | } |
| 1563 | } |
| 1564 | } |
| 1565 | } // end of if(weightsList) |
| 3d824203 |
1566 | |
| 9c1a9547 |
1567 | Double_t dPhi = 0.; // azumithal angle in the laboratory frame |
| 1568 | Double_t dPt = 0.; // transverse momentum |
| 1569 | Double_t dEta = 0.; // pseudorapidity |
| 1570 | |
| 3d824203 |
1571 | Double_t wPhi = 1.; // phi weight |
| 1572 | Double_t wPt = 1.; // pt weight |
| 1573 | Double_t wEta = 1.; // eta weight |
| 1574 | |
| 9c1a9547 |
1575 | |
| 1576 | |
| 1577 | |
| 1578 | // ******************************************** |
| 1579 | // **** FILL THE COMMON CONTROL HISTOGRAMS **** |
| 1580 | // ******************************************** |
| 1581 | |
| 1582 | Int_t nRP = anEvent->GetEventNSelTracksRP(); |
| 1583 | if(nRP>1) |
| 1584 | { |
| 1585 | fCommonHists2nd->FillControlHistograms(anEvent); |
| 1586 | if(nRP>3) |
| 1587 | { |
| 1588 | fCommonHists4th->FillControlHistograms(anEvent); |
| 1589 | if(nRP>5) |
| 3d824203 |
1590 | { |
| 9c1a9547 |
1591 | fCommonHists6th->FillControlHistograms(anEvent); |
| 1592 | if(nRP>7) |
| 3d824203 |
1593 | { |
| 9c1a9547 |
1594 | fCommonHists8th->FillControlHistograms(anEvent); |
| 1595 | } // end of if(nRP>7) |
| 1596 | } // end of if(nRP>5) |
| 1597 | } // end of if(nRP>3) |
| 1598 | } // end of if(nRP>1) |
| 3d824203 |
1599 | |
| 3d824203 |
1600 | |
| 3d824203 |
1601 | |
| 9c1a9547 |
1602 | |
| 1603 | // *************************** |
| 1604 | // **** LOOPING OVER DATA **** |
| 1605 | // *************************** |
| 3d824203 |
1606 | |
| 9c1a9547 |
1607 | Int_t nPrim = anEvent->NumberOfTracks(); |
| 3d824203 |
1608 | |
| 9c1a9547 |
1609 | // nPrim = total number of primary tracks, i.e. nPrim = nRP + nPOI + rest, where: |
| 1610 | // nRP = # of particles used to determine the reaction plane; |
| 1611 | // nPOI = # of particles of interest for a detailed flow analysis; |
| 1612 | // rest = # of particles which are niether RPs not POIs. |
| 3d824203 |
1613 | |
| 9c1a9547 |
1614 | for(Int_t i=0;i<nPrim;i++) |
| 3d824203 |
1615 | { |
| 9c1a9547 |
1616 | fTrack=anEvent->GetTrack(i); |
| 77515452 |
1617 | if(fTrack) |
| 1618 | { |
| 9c1a9547 |
1619 | if(!(fTrack->InRPSelection() || fTrack->InPOISelection())) continue; |
| 1620 | |
| 1621 | // checking the RP condition: |
| 1622 | if(fTrack->InRPSelection()) |
| 1623 | { |
| 1624 | dPhi = fTrack->Phi(); |
| 1625 | dPt = fTrack->Pt(); |
| 1626 | dEta = fTrack->Eta(); |
| 1627 | |
| 1628 | // determine phi weight for this particle: |
| 1629 | if(phiWeights && nBinsPhi) |
| 3d824203 |
1630 | { |
| 9c1a9547 |
1631 | wPhi = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(dPhi*nBinsPhi/TMath::TwoPi()))); |
| 1632 | } |
| 1633 | // determine pt weight for this particle: |
| 1634 | if(ptWeights && dBinWidthPt) |
| 1635 | { |
| 1636 | wPt = ptWeights->GetBinContent(1+(Int_t)(TMath::Floor((dPt-fPtMin)/dBinWidthPt))); |
| 1637 | } |
| 1638 | // determine eta weight for this particle: |
| 1639 | if(etaWeights && dBinWidthEta) |
| 1640 | { |
| 1641 | wEta = etaWeights->GetBinContent(1+(Int_t)(TMath::Floor((dEta-fEtaMin)/dBinWidthEta))); |
| 1642 | } |
| 1643 | |
| 1644 | // fill Re[Q_{n,k}] and Im[Q_{n,k}]: |
| 1645 | for(Int_t n=0;n<4;n++) |
| 1646 | { |
| 1647 | for(Int_t k=0;k<9;k++) |
| 77515452 |
1648 | { |
| 9c1a9547 |
1649 | (*fReQ)(n,k)+=pow(wPhi*wPt*wEta,k)*TMath::Cos(2*(n+1)*dPhi); |
| 1650 | (*fImQ)(n,k)+=pow(wPhi*wPt*wEta,k)*TMath::Sin(2*(n+1)*dPhi); |
| 77515452 |
1651 | } |
| 9c1a9547 |
1652 | } |
| 1653 | |
| 1654 | // fill S^{M}_{p,k}: |
| 1655 | for(Int_t p=0;p<8;p++) |
| 1656 | { |
| 1657 | for(Int_t k=0;k<9;k++) |
| 1658 | { |
| 1659 | (*fSMpk)(p,k)+=pow(wPhi*wPt*wEta,k); |
| 77515452 |
1660 | } |
| 9c1a9547 |
1661 | } |
| 77515452 |
1662 | |
| 9c1a9547 |
1663 | Int_t n = 2; // to be improved (add setter for harmonic) |
| 77515452 |
1664 | |
| 9c1a9547 |
1665 | // fill non-weighted q_RPs |
| 1666 | fReqRP1nPtEta->Fill(dPt,dEta,TMath::Cos(1.*n*dPhi)); |
| 1667 | fImqRP1nPtEta->Fill(dPt,dEta,TMath::Sin(1.*n*dPhi)); |
| 1668 | fReqRP2nPtEta->Fill(dPt,dEta,TMath::Cos(2.*n*dPhi)); |
| 1669 | fImqRP2nPtEta->Fill(dPt,dEta,TMath::Sin(2.*n*dPhi)); |
| 77515452 |
1670 | |
| 9c1a9547 |
1671 | // mRP: |
| 1672 | fmRPPtEta->Fill(dPt,dEta,1); |
| 1673 | |
| 1674 | // fill weighted q_RPs |
| 1675 | if(fUseWeights) |
| 3d824203 |
1676 | { |
| 9c1a9547 |
1677 | n = 2; // to be improved (add setter for harmonic) |
| 77515452 |
1678 | |
| 9c1a9547 |
1679 | // qRP_{n,k} (weighted qRP): |
| 1680 | fReqRP1n2kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,2.)*TMath::Cos(1.*n*dPhi)); |
| 1681 | fImqRP1n2kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,2.)*TMath::Sin(1.*n*dPhi)); |
| 1682 | fReqRP2n1kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,1.)*TMath::Cos(2.*n*dPhi)); |
| 1683 | fImqRP2n1kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,1.)*TMath::Sin(2.*n*dPhi)); |
| 3d824203 |
1684 | |
| 9c1a9547 |
1685 | // S^{mRP}_{p,k}: |
| 1686 | fSmRP1p1kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,1.)); |
| 1687 | fSmRP1p2kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,2.)); |
| 1688 | fSmRP1p3kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,3.)); |
| 1689 | } |
| 1690 | |
| 1691 | // checking if RP particle is also POI particle: |
| 1692 | if(fTrack->InPOISelection()) |
| 1693 | { |
| 1694 | n = 2; // to be improved (add setter for harmonic) |
| 1695 | |
| 1696 | // q''_{n} (non-weighted q''): |
| 1697 | fReqPrimePrime1nPtEta->Fill(dPt,dEta,TMath::Cos(1.*n*dPhi)); |
| 1698 | fImqPrimePrime1nPtEta->Fill(dPt,dEta,TMath::Sin(1.*n*dPhi)); |
| 1699 | fReqPrimePrime2nPtEta->Fill(dPt,dEta,TMath::Cos(2.*n*dPhi)); |
| 1700 | fImqPrimePrime2nPtEta->Fill(dPt,dEta,TMath::Sin(2.*n*dPhi)); |
| 1701 | |
| 1702 | // m'': |
| 1703 | fmPrimePrimePtEta->Fill(dPt,dEta,1); |
| 3d824203 |
1704 | |
| 9c1a9547 |
1705 | if(fUseWeights) |
| 1706 | { |
| 1707 | // q''_{n,k} (weighted q''): |
| 1708 | fReqPrimePrime1n2kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,2.)*TMath::Cos(1.*n*dPhi)); |
| 1709 | fImqPrimePrime1n2kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,2.)*TMath::Sin(1.*n*dPhi)); |
| 1710 | fReqPrimePrime2n1kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,1.)*TMath::Cos(2.*n*dPhi)); |
| 1711 | fImqPrimePrime2n1kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,1.)*TMath::Sin(2.*n*dPhi)); |
| b7cb54d5 |
1712 | |
| 9c1a9547 |
1713 | // S^{m''}_{p,k}: |
| 1714 | fSmPrimePrime1p1kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,1.)); |
| 1715 | fSmPrimePrime1p2kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,2.)); |
| 1716 | fSmPrimePrime1p3kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,3.)); |
| 1717 | } |
| 1718 | } // end of if(fTrack->InPOISelection()) |
| 1719 | } // end of if(pTrack->InRPSelection()) |
| b7cb54d5 |
1720 | |
| 9c1a9547 |
1721 | // checking the POI condition: |
| 1722 | if(fTrack->InPOISelection()) |
| 1723 | { |
| 1724 | Int_t n = 2; // to be improved (add setter for harmonic) |
| 1725 | |
| 1726 | dPhi = fTrack->Phi(); |
| 1727 | dPt = fTrack->Pt(); |
| 1728 | dEta = fTrack->Eta(); |
| b7cb54d5 |
1729 | |
| 9c1a9547 |
1730 | // q_n: |
| 1731 | fReqnPtEta->Fill(dPt,dEta,TMath::Cos(1.*n*dPhi)); |
| 1732 | fImqnPtEta->Fill(dPt,dEta,TMath::Sin(1.*n*dPhi)); |
| 1733 | |
| 1734 | // m: |
| 1735 | fmPtEta->Fill(dPt,dEta,1); |
| 3d824203 |
1736 | |
| 9c1a9547 |
1737 | } // end of if(pTrack->InPOISelection() ) |
| 1738 | } // end of if(fTrack) |
| 1739 | else{ |
| 1740 | cout<<endl; |
| 1741 | cout<<" WARNING: no particle! (i.e. fTrack is a NULL pointer in AFAWQC::Make().)"<<endl; |
| 1742 | cout<<endl; |
| 1743 | } |
| 1744 | } // end of for(Int_t i=0;i<nPrim;i++) |
| 3d824203 |
1745 | |
| 9c1a9547 |
1746 | // calculate the final expressions for S^{M}_{p,k} = (sum_{i=1}^{M} w_{i}^{k})^{p}: |
| 1747 | for(Int_t p=0;p<8;p++) |
| 1748 | { |
| 1749 | for(Int_t k=0;k<9;k++) |
| 77515452 |
1750 | { |
| 9c1a9547 |
1751 | (*fSMpk)(p,k)=pow((*fSMpk)(p,k),p+1); |
| 1752 | } |
| 1753 | } |
| 77515452 |
1754 | |
| 2bdc5281 |
1755 | |
| 77515452 |
1756 | |
| 77515452 |
1757 | |
| 9c1a9547 |
1758 | // ***************************** |
| 1759 | // **** CALLING THE METHODS **** |
| 1760 | // ***************************** |
| 77515452 |
1761 | |
| 9c1a9547 |
1762 | // nested loops (needed for cross-checking the results): |
| 1763 | Bool_t evaluateNestedLoopsForIntegratedFlow = kFALSE; // to be improved / removed |
| 1764 | Bool_t evaluateNestedLoopsForDifferentialFlow = kFALSE; // to be improved / removed |
| 2bdc5281 |
1765 | // Remark: setBefore in AliFlowCommonConstants: |
| 1766 | // Double_t AliFlowCommonConstants::fgEtaMin = -1.; |
| 1767 | // Double_t AliFlowCommonConstants::fgEtaMax = 1.; |
| 77515452 |
1768 | |
| 9c1a9547 |
1769 | if(evaluateNestedLoopsForIntegratedFlow && nPrim>0 && nPrim<14) // to be improved / removed (eventually I would not need this if()) |
| 1770 | { |
| 1771 | // calculate all correlations needed for 'no-name' integrated flow WITHOUT weights |
| 1772 | // (the results are stored in 1D profile fQCorrelations) |
| c365fe76 |
1773 | if(!(fUseWeights)) |
| 1774 | { |
| 1775 | this->CalculateCorrelationsForIntegratedFlow(); |
| 2bdc5281 |
1776 | this->CalculateCorrectionsForNonUniformAcceptanceForNoNameIntegratedFlowCosTerms(); |
| 1777 | this->CalculateCorrectionsForNonUniformAcceptanceForNoNameIntegratedFlowSinTerms(); |
| c365fe76 |
1778 | } |
| 9c1a9547 |
1779 | // calculate all correlations needed for 'no-name' integrated flow WITH weights |
| 1780 | // (the results are stored in 1D profile fQCorrelationsW) |
| 1781 | if(fUseWeights) this->CalculateWeightedCorrelationsForIntegratedFlow(); |
| 1782 | } |
| 1783 | else if (!evaluateNestedLoopsForIntegratedFlow) |
| 1784 | { |
| 1785 | this->CalculateCorrelationsForIntegratedFlow(); |
| 2bdc5281 |
1786 | this->CalculateCorrectionsForNonUniformAcceptanceForNoNameIntegratedFlowCosTerms(); |
| 1787 | this->CalculateCorrectionsForNonUniformAcceptanceForNoNameIntegratedFlowSinTerms(); |
| 9c1a9547 |
1788 | if(fUseWeights) this->CalculateWeightedCorrelationsForIntegratedFlow(); |
| 1789 | } |
| 77515452 |
1790 | |
| 9c1a9547 |
1791 | if(evaluateNestedLoopsForDifferentialFlow && nPrim>0 && nPrim<14 ) // to be improved / removed (eventually I would not need this if()) |
| 1792 | { |
| 1793 | // calculate all correlations needed for differential flow WITHOUT weights |
| 1794 | // and store the results in 2D profiles (pt,eta): |
| 1795 | // a) POIs: f2pPtEtaPOI, f4pPtEtaPOI, f6pPtEtaPOI and f8pPtEtaPOI; |
| 1796 | // b) RPs: f2pPtEtaRP, f4pPtEtaRP, f6pPtEtaRP and f8pPtEtaRP. |
| 1797 | if(!(fUseWeights)) |
| 77515452 |
1798 | { |
| 9c1a9547 |
1799 | this->CalculateCorrelationsForDifferentialFlow("POI"); |
| 1800 | this->CalculateCorrelationsForDifferentialFlow("RP"); |
| 2bdc5281 |
1801 | this->CalculateCorrectionsForNonUniformAcceptanceForDifferentialFlowCosTerms("POI"); |
| 1802 | this->CalculateCorrectionsForNonUniformAcceptanceForDifferentialFlowSinTerms("POI"); |
| 1803 | this->CalculateCorrectionsForNonUniformAcceptanceForDifferentialFlowCosTerms("RP"); |
| 1804 | this->CalculateCorrectionsForNonUniformAcceptanceForDifferentialFlowSinTerms("RP"); |
| 77515452 |
1805 | } |
| 9c1a9547 |
1806 | // calculate all correlations needed for differential flow WITH weights |
| 1807 | // and store the results in 2D profiles (pt,eta): |
| 1808 | // a) POIs: f2pPtEtaPOIW, f4pPtEtaPOIW, f6pPtEtaPOIW and f8pPtEtaPOIW; |
| 1809 | // b) RPs: f2pPtEtaRPW, f4pPtEtaRPW, f6pPtEtaRPW and f8pPtEtaRPW. |
| 1810 | if(fUseWeights) |
| 1811 | { |
| 1812 | this->CalculateWeightedCorrelationsForDifferentialFlow("POI"); |
| 1813 | this->CalculateWeightedCorrelationsForDifferentialFlow("RP"); |
| 1814 | } |
| 1815 | } |
| 1816 | else if (!evaluateNestedLoopsForDifferentialFlow) |
| 1817 | { |
| 1818 | this->CalculateCorrelationsForDifferentialFlow("POI"); |
| 1819 | this->CalculateCorrelationsForDifferentialFlow("RP"); |
| 2bdc5281 |
1820 | this->CalculateCorrectionsForNonUniformAcceptanceForDifferentialFlowCosTerms("POI"); |
| 1821 | this->CalculateCorrectionsForNonUniformAcceptanceForDifferentialFlowSinTerms("POI"); |
| 1822 | this->CalculateCorrectionsForNonUniformAcceptanceForDifferentialFlowCosTerms("RP"); |
| 1823 | this->CalculateCorrectionsForNonUniformAcceptanceForDifferentialFlowSinTerms("RP"); |
| 3d824203 |
1824 | |
| 9c1a9547 |
1825 | if(fUseWeights) |
| 77515452 |
1826 | { |
| 9c1a9547 |
1827 | this->CalculateWeightedCorrelationsForDifferentialFlow("POI"); |
| 1828 | this->CalculateWeightedCorrelationsForDifferentialFlow("RP"); |
| 77515452 |
1829 | } |
| 3d824203 |
1830 | |
| 9c1a9547 |
1831 | } |
| 77515452 |
1832 | |
| 9c1a9547 |
1833 | if(evaluateNestedLoopsForIntegratedFlow && nPrim>0 && nPrim<14) // to be improved / removed (eventually I would not need this if()) |
| 1834 | { |
| 1835 | this->EvaluateNestedLoopsForIntegratedFlow(anEvent); |
| 1836 | } |
| 3d824203 |
1837 | |
| 9c1a9547 |
1838 | if(evaluateNestedLoopsForDifferentialFlow && nPrim>0 && nPrim<14) // to be improved / removed (eventually I would not need this if()) |
| 1839 | { |
| 1840 | this->EvaluateNestedLoopsForDifferentialFlow(anEvent); |
| 1841 | } |
| 3d824203 |
1842 | |
| 3d824203 |
1843 | |
| 9c1a9547 |
1844 | |
| 1845 | |
| 1846 | // ******************************** |
| 1847 | // **** RESET E-B-E QUANTITIES **** |
| 1848 | // ******************************** |
| 3d824203 |
1849 | |
| 9c1a9547 |
1850 | fReQ->Zero(); |
| 1851 | fImQ->Zero(); |
| 1852 | fSMpk->Zero(); |
| 1853 | fReqnPtEta->Reset(); |
| 1854 | fImqnPtEta->Reset(); |
| 1855 | fmPtEta->Reset(); |
| 1856 | fReqPrimePrime1nPtEta->Reset(); |
| 1857 | fImqPrimePrime1nPtEta->Reset(); |
| 1858 | fReqPrimePrime2nPtEta->Reset(); |
| 1859 | fImqPrimePrime2nPtEta->Reset(); |
| 1860 | fmPrimePrimePtEta->Reset(); |
| 1861 | fReqPrimePrime1n2kPtEta->Reset(); |
| 1862 | fImqPrimePrime1n2kPtEta->Reset(); |
| 1863 | fReqPrimePrime2n1kPtEta->Reset(); |
| 1864 | fImqPrimePrime2n1kPtEta->Reset(); |
| 1865 | fSmPrimePrime1p1kPtEta->Reset(); |
| 1866 | fSmPrimePrime1p2kPtEta->Reset(); |
| 1867 | fSmPrimePrime1p3kPtEta->Reset(); |
| 1868 | // qRPs (to be improved - notation) |
| 1869 | fReqRP1nPtEta->Reset(); |
| 1870 | fImqRP1nPtEta->Reset(); |
| 1871 | fReqRP2nPtEta->Reset(); |
| 1872 | fImqRP2nPtEta->Reset(); |
| 1873 | fmRPPtEta->Reset(); |
| 1874 | fReqRP1n2kPtEta->Reset(); |
| 1875 | fImqRP1n2kPtEta->Reset(); |
| 1876 | fReqRP2n1kPtEta->Reset(); |
| 1877 | fImqRP2n1kPtEta->Reset(); |
| 1878 | fSmRP1p1kPtEta->Reset(); |
| 1879 | fSmRP1p2kPtEta->Reset(); |
| 1880 | fSmRP1p3kPtEta->Reset(); |
| 1881 | |
| 1882 | } // end of AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent) |
| 1883 | |
| 1884 | |
| 1885 | //================================================================================================================================ |
| 1886 | |
| 1887 | |
| 1888 | void AliFlowAnalysisWithQCumulants::CalculateCorrelationsForIntegratedFlow() |
| 1889 | { |
| 1890 | // calculate all correlations needed for 'no-name' integrated flow // to be improved (name) |
| 1891 | |
| 1892 | // multiplicity: |
| 1893 | Double_t dMult = (*fSMpk)(0,0); |
| 1894 | |
| 1895 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: |
| 1896 | Double_t dReQ1n = (*fReQ)(0,0); |
| 1897 | Double_t dReQ2n = (*fReQ)(1,0); |
| 1898 | Double_t dReQ3n = (*fReQ)(2,0); |
| 1899 | Double_t dReQ4n = (*fReQ)(3,0); |
| 1900 | Double_t dImQ1n = (*fImQ)(0,0); |
| 1901 | Double_t dImQ2n = (*fImQ)(1,0); |
| 1902 | Double_t dImQ3n = (*fImQ)(2,0); |
| 1903 | Double_t dImQ4n = (*fImQ)(3,0); |
| 3d824203 |
1904 | |
| 9c1a9547 |
1905 | // real and imaginary parts of some expressions involving various combinations of Q-vectors evaluated in harmonics n, 2n, 3n and 4n: |
| 1906 | // (these expression appear in the Eqs. for the multi-particle correlations bellow) |
| 77515452 |
1907 | |
| 9c1a9547 |
1908 | // Re[Q_{2n} Q_{n}^* Q_{n}^*] |
| 1909 | Double_t reQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dReQ2n + 2.*dReQ1n*dImQ1n*dImQ2n - pow(dImQ1n,2.)*dReQ2n; |
| 77515452 |
1910 | |
| 9c1a9547 |
1911 | // Im[Q_{2n} Q_{n}^* Q_{n}^*] |
| 1912 | //Double_t imQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dImQ2n-2.*dReQ1n*dImQ1n*dReQ2n-pow(dImQ1n,2.)*dImQ2n; |
| 77515452 |
1913 | |
| 9c1a9547 |
1914 | // Re[Q_{n} Q_{n} Q_{2n}^*] = Re[Q_{2n} Q_{n}^* Q_{n}^*] |
| 1915 | Double_t reQ1nQ1nQ2nstar = reQ2nQ1nstarQ1nstar; |
| 77515452 |
1916 | |
| 9c1a9547 |
1917 | // Re[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*] |
| 1918 | Double_t reQ3nQ1nQ2nstarQ2nstar = (pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n) |
| 1919 | + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n); |
| 77515452 |
1920 | |
| 9c1a9547 |
1921 | // Im[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*] |
| 1922 | //Double_t imQ3nQ1nQ2nstarQ2nstar = calculate and implement this (deleteMe) |
| 1923 | |
| 1924 | // Re[Q_{2n} Q_{2n} Q_{3n}^* Q_{1n}^*] = Re[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*] |
| 1925 | Double_t reQ2nQ2nQ3nstarQ1nstar = reQ3nQ1nQ2nstarQ2nstar; |
| 1926 | |
| 1927 | // Re[Q_{4n} Q_{2n}^* Q_{2n}^*] |
| 1928 | Double_t reQ4nQ2nstarQ2nstar = pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n; |
| 77515452 |
1929 | |
| 9c1a9547 |
1930 | // Im[Q_{4n} Q_{2n}^* Q_{2n}^*] |
| 1931 | //Double_t imQ4nQ2nstarQ2nstar = calculate and implement this (deleteMe) |
| 77515452 |
1932 | |
| 9c1a9547 |
1933 | // Re[Q_{2n} Q_{2n} Q_{4n}^*] = Re[Q_{4n} Q_{2n}^* Q_{2n}^*] |
| 1934 | Double_t reQ2nQ2nQ4nstar = reQ4nQ2nstarQ2nstar; |
| 77515452 |
1935 | |
| 9c1a9547 |
1936 | // Re[Q_{4n} Q_{3n}^* Q_{n}^*] |
| 1937 | Double_t reQ4nQ3nstarQ1nstar = dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n); |
| 77515452 |
1938 | |
| 9c1a9547 |
1939 | // Re[Q_{3n} Q_{n} Q_{4n}^*] = Re[Q_{4n} Q_{3n}^* Q_{n}^*] |
| 1940 | Double_t reQ3nQ1nQ4nstar = reQ4nQ3nstarQ1nstar; |
| 77515452 |
1941 | |
| 9c1a9547 |
1942 | // Im[Q_{4n} Q_{3n}^* Q_{n}^*] |
| 1943 | //Double_t imQ4nQ3nstarQ1nstar = calculate and implement this (deleteMe) |
| 6f366058 |
1944 | |
| 9c1a9547 |
1945 | // Re[Q_{3n} Q_{2n}^* Q_{n}^*] |
| 1946 | Double_t reQ3nQ2nstarQ1nstar = dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n |
| 1947 | + dImQ3n*dImQ2n*dReQ1n; |
| 1948 | |
| 1949 | // Re[Q_{2n} Q_{n} Q_{3n}^*] = Re[Q_{3n} Q_{2n}^* Q_{n}^*] |
| 1950 | Double_t reQ2nQ1nQ3nstar = reQ3nQ2nstarQ1nstar; |
| 3d824203 |
1951 | |
| 9c1a9547 |
1952 | // Im[Q_{3n} Q_{2n}^* Q_{n}^*] |
| 1953 | //Double_t imQ3nQ2nstarQ1nstar; //calculate and implement this (deleteMe) |
| 3d824203 |
1954 | |
| 9c1a9547 |
1955 | // Re[Q_{3n} Q_{n}^* Q_{n}^* Q_{n}^*] |
| 1956 | Double_t reQ3nQ1nstarQ1nstarQ1nstar = dReQ3n*pow(dReQ1n,3)-3.*dReQ1n*dReQ3n*pow(dImQ1n,2) |
| 1957 | + 3.*dImQ1n*dImQ3n*pow(dReQ1n,2)-dImQ3n*pow(dImQ1n,3); |
| 1958 | |
| 1959 | // Im[Q_{3n} Q_{n}^* Q_{n}^* Q_{n}^*] |
| 1960 | //Double_t imQ3nQ1nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe) |
| 3d824203 |
1961 | |
| 9c1a9547 |
1962 | // |Q_{2n}|^2 |Q_{n}|^2 |
| 1963 | Double_t dQ2nQ1nQ2nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)); |
| 3d824203 |
1964 | |
| 9c1a9547 |
1965 | // Re[Q_{4n} Q_{2n}^* Q_{n}^* Q_{n}^*] |
| 1966 | Double_t reQ4nQ2nstarQ1nstarQ1nstar = (dReQ4n*dReQ2n+dImQ4n*dImQ2n)*(pow(dReQ1n,2)-pow(dImQ1n,2)) |
| 1967 | + 2.*dReQ1n*dImQ1n*(dImQ4n*dReQ2n-dReQ4n*dImQ2n); |
| 3d824203 |
1968 | |
| 9c1a9547 |
1969 | // Im[Q_{4n} Q_{2n}^* Q_{n}^* Q_{n}^*] |
| 1970 | //Double_t imQ4nQ2nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe) |
| 3d824203 |
1971 | |
| 9c1a9547 |
1972 | // Re[Q_{2n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^*] |
| 1973 | Double_t reQ2nQ1nQ1nstarQ1nstarQ1nstar = (dReQ2n*dReQ1n-dImQ2n*dImQ1n)*(pow(dReQ1n,3)-3.*dReQ1n*pow(dImQ1n,2)) |
| 1974 | + (dReQ2n*dImQ1n+dReQ1n*dImQ2n)*(3.*dImQ1n*pow(dReQ1n,2)-pow(dImQ1n,3)); |
| 1975 | |
| 1976 | // Im[Q_{2n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^*] |
| 1977 | //Double_t imQ2nQ1nQ1nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe) |
| 1dfa3c16 |
1978 | |
| 9c1a9547 |
1979 | // Re[Q_{2n} Q_{2n} Q_{2n}^* Q_{n}^* Q_{n}^*] |
| 1980 | Double_t reQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.)) |
| 1981 | * (dReQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) + 2.*dImQ2n*dReQ1n*dImQ1n); |
| 1982 | |
| 1983 | // Im[Q_{2n} Q_{2n} Q_{2n}^* Q_{n}^* Q_{n}^*] |
| 1984 | //Double_t imQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.)) |
| 1985 | // * (dImQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) - 2.*dReQ2n*dReQ1n*dImQ1n); |
| 1986 | |
| 1987 | // Re[Q_{4n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] |
| 1988 | Double_t reQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dReQ4n-6.*pow(dReQ1n,2.)*dReQ4n*pow(dImQ1n,2.) |
| 1989 | + pow(dImQ1n,4.)*dReQ4n+4.*pow(dReQ1n,3.)*dImQ1n*dImQ4n |
| 1990 | - 4.*pow(dImQ1n,3.)*dReQ1n*dImQ4n; |
| 1991 | |
| 1992 | // Im[Q_{4n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] |
| 1993 | //Double_t imQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dImQ4n-6.*pow(dReQ1n,2.)*dImQ4n*pow(dImQ1n,2.) |
| 1994 | // + pow(dImQ1n,4.)*dImQ4n+4.*pow(dImQ1n,3.)*dReQ1n*dReQ4n |
| 1995 | // - 4.*pow(dReQ1n,3.)*dImQ1n*dReQ4n; |
| 1996 | |
| 1997 | // Re[Q_{3n} Q_{n} Q_{2n}^* Q_{n}^* Q_{n}^*] |
| 1998 | Double_t reQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
| 1999 | * (dReQ1n*dReQ2n*dReQ3n-dReQ3n*dImQ1n*dImQ2n+dReQ2n*dImQ1n*dImQ3n+dReQ1n*dImQ2n*dImQ3n); |
| 2000 | |
| 2001 | // Im[Q_{3n} Q_{n} Q_{2n}^* Q_{n}^* Q_{n}^*] |
| 2002 | //Double_t imQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
| 2003 | // * (-dReQ2n*dReQ3n*dImQ1n-dReQ1n*dReQ3n*dImQ2n+dReQ1n*dReQ2n*dImQ3n-dImQ1n*dImQ2n*dImQ3n); |
| 2004 | |
| 2005 | |
| 2006 | // Re[Q_{2n} Q_{2n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] |
| 2007 | Double_t reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)*dReQ2n-2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.) |
| 2008 | + dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dImQ2n) |
| 2009 | * (pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.) |
| 2010 | - dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n+pow(dImQ1n,2.)*dImQ2n); |
| 2011 | |
| 2012 | // Im[Q_{2n} Q_{2n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] |
| 2013 | //Double_t imQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = 2.*(pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.) |
| 2014 | // + 2.*dReQ1n*dImQ1n*dImQ2n)*(pow(dReQ1n,2.)*dImQ2n |
| 2015 | // - 2.*dReQ1n*dImQ1n*dReQ2n-pow(dImQ1n,2.)*dImQ2n); |
| 2016 | |
| 2017 | // Re[Q_{3n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] |
| 2018 | Double_t reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
| 2019 | * (pow(dReQ1n,3.)*dReQ3n-3.*dReQ1n*dReQ3n*pow(dImQ1n,2.) |
| 2020 | + 3.*pow(dReQ1n,2.)*dImQ1n*dImQ3n-pow(dImQ1n,3.)*dImQ3n); |
| 2021 | |
| 2022 | // Im[Q_{3n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] |
| 2023 | //Double_t imQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
| 2024 | // * (pow(dImQ1n,3.)*dReQ3n-3.*dImQ1n*dReQ3n*pow(dReQ1n,2.) |
| 2025 | // - 3.*pow(dImQ1n,2.)*dReQ1n*dImQ3n+pow(dReQ1n,3.)*dImQ3n); |
| 2026 | |
| 2027 | // |Q_{2n}|^2 |Q_{n}|^4 |
| 2028 | Double_t dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.); |
| 2029 | |
| 2030 | // Re[Q_{2n} Q_{n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] |
| 2031 | Double_t reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) |
| 2032 | * (pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.) |
| 2033 | + 2.*dReQ1n*dImQ1n*dImQ2n); |
| 2034 | |
| 2035 | // Im[Q_{2n} Q_{n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] |
| 2036 | //Double_t imQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) |
| 2037 | // * (pow(dReQ1n,2.)*dImQ2n-dImQ2n*pow(dImQ1n,2.) |
| 2038 | // - 2.*dReQ1n*dReQ2n*dImQ1n); |
| ae733b3b |
2039 | |
| 9c1a9547 |
2040 | |
| 1dfa3c16 |
2041 | |
| 9c1a9547 |
2042 | |
| 2043 | // ************************************** |
| 2044 | // **** multi-particle correlations: **** |
| 2045 | // ************************************** |
| 2046 | // |
| 2047 | // Remark 1: multi-particle correlations calculated with non-weighted Q-vectors are stored in 1D profile fQCorrelations. |
| 2048 | // Remark 2: binning of fQCorrelations is organized as follows: |
| 2049 | // -------------------------------------------------------------------------------------------------------------------- |
| 2050 | // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))> |
| 2051 | // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))> |
| 2052 | // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))> |
| 2053 | // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))> |
| 2054 | // 5th bin: ---- EMPTY ---- |
| 2055 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))> |
| 2056 | // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))> |
| 2057 | // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))> |
| 2058 | // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))> |
| 2059 | // 10th bin: ---- EMPTY ---- |
| 2060 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))> |
| 2061 | // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))> |
| 2062 | // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))> |
| 2063 | // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))> |
| 2064 | // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))> |
| 2065 | // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))> |
| 2066 | // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> |
| 2067 | // 18th bin: ---- EMPTY ---- |
| 2068 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))> |
| 2069 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))> |
| 2070 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))> |
| 2071 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))> |
| 2072 | // 23rd bin: ---- EMPTY ---- |
| 2073 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> |
| 2074 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))> |
| 2075 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))> |
| 2076 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))> |
| 2077 | // 28th bin: ---- EMPTY ---- |
| 2078 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> |
| 2079 | // 30th bin: ---- EMPTY ---- |
| 2080 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> |
| 2081 | // -------------------------------------------------------------------------------------------------------------------- |
| 2082 | |
| 2083 | // 2-particle: |
| 2084 | Double_t two1n1n = 0.; // <cos(n*(phi1-phi2))> |
| 2085 | Double_t two2n2n = 0.; // <cos(2n*(phi1-phi2))> |
| 2086 | Double_t two3n3n = 0.; // <cos(3n*(phi1-phi2))> |
| 2087 | Double_t two4n4n = 0.; // <cos(4n*(phi1-phi2))> |
| 1dfa3c16 |
2088 | |
| 9c1a9547 |
2089 | if(dMult>1) |
| 2090 | { |
| 2091 | two1n1n = (pow(dReQ1n,2.)+pow(dImQ1n,2.)-dMult)/(dMult*(dMult-1.)); |
| 2092 | two2n2n = (pow(dReQ2n,2.)+pow(dImQ2n,2.)-dMult)/(dMult*(dMult-1.)); |
| 2093 | two3n3n = (pow(dReQ3n,2.)+pow(dImQ3n,2.)-dMult)/(dMult*(dMult-1.)); |
| 2094 | two4n4n = (pow(dReQ4n,2.)+pow(dImQ4n,2.)-dMult)/(dMult*(dMult-1.)); |
| 2095 | |
| 2096 | fQCorrelations->Fill(0.,two1n1n,dMult*(dMult-1.)); |
| 2097 | fQCorrelations->Fill(1.,two2n2n,dMult*(dMult-1.)); |
| 2098 | fQCorrelations->Fill(2.,two3n3n,dMult*(dMult-1.)); |
| 2099 | fQCorrelations->Fill(3.,two4n4n,dMult*(dMult-1.)); |
| 2100 | |
| 2101 | // distribution of <cos(n*(phi1-phi2))>: |
| 2102 | f2pDistribution->Fill(two1n1n,dMult*(dMult-1.)); |
| 2103 | } // end of if(dMult>1) |
| ae733b3b |
2104 | |
| 9c1a9547 |
2105 | // 3-particle: |
| 2106 | Double_t three2n1n1n = 0.; // <cos(n*(2.*phi1-phi2-phi3))> |
| 2107 | Double_t three3n2n1n = 0.; // <cos(n*(3.*phi1-2.*phi2-phi3))> |
| 2108 | Double_t three4n2n2n = 0.; // <cos(n*(4.*phi1-2.*phi2-2.*phi3))> |
| 2109 | Double_t three4n3n1n = 0.; // <cos(n*(4.*phi1-3.*phi2-phi3))> |
| ae733b3b |
2110 | |
| 9c1a9547 |
2111 | if(dMult>2) |
| 2112 | { |
| 2113 | three2n1n1n = (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
| 2114 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult) |
| 2115 | / (dMult*(dMult-1.)*(dMult-2.)); |
| 2116 | three3n2n1n = (reQ3nQ2nstarQ1nstar-(pow(dReQ3n,2.)+pow(dImQ3n,2.)) |
| 2117 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.)) |
| 2118 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) |
| 2119 | / (dMult*(dMult-1.)*(dMult-2.)); |
| 2120 | three4n2n2n = (reQ4nQ2nstarQ2nstar-2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) |
| 2121 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*dMult) |
| 2122 | / (dMult*(dMult-1.)*(dMult-2.)); |
| 2123 | three4n3n1n = (reQ4nQ3nstarQ1nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.)) |
| 2124 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.)) |
| 2125 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) |
| 2126 | / (dMult*(dMult-1.)*(dMult-2.)); |
| 2127 | |
| 2128 | fQCorrelations->Fill(5.,three2n1n1n,dMult*(dMult-1.)*(dMult-2.)); |
| 2129 | fQCorrelations->Fill(6.,three3n2n1n,dMult*(dMult-1.)*(dMult-2.)); |
| 2130 | fQCorrelations->Fill(7.,three4n2n2n,dMult*(dMult-1.)*(dMult-2.)); |
| 2131 | fQCorrelations->Fill(8.,three4n3n1n,dMult*(dMult-1.)*(dMult-2.)); |
| 2132 | } // end of if(dMult>2) |
| ae733b3b |
2133 | |
| 9c1a9547 |
2134 | // 4-particle: |
| 2135 | Double_t four1n1n1n1n = 0.; // <cos(n*(phi1+phi2-phi3-phi4))> |
| 2136 | Double_t four2n2n2n2n = 0.; // <cos(2.*n*(phi1+phi2-phi3-phi4))> |
| 2137 | Double_t four2n1n2n1n = 0.; // <cos(n*(2.*phi1+phi2-2.*phi3-phi4))> |
| 2138 | Double_t four3n1n1n1n = 0.; // <cos(n*(3.*phi1-phi2-phi3-phi4))> |
| 2139 | Double_t four4n2n1n1n = 0.; // <cos(n*(4.*phi1-2.*phi2-phi3-phi4))> |
| 2140 | Double_t four3n1n2n2n = 0.; // <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))> |
| 2141 | Double_t four3n1n3n1n = 0.; // <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> |
| 1dfa3c16 |
2142 | |
| 9c1a9547 |
2143 | if(dMult>3) |
| 2144 | { |
| 2145 | four1n1n1n1n = (2.*dMult*(dMult-3.)+pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ1n,2.) |
| 2146 | + pow(dImQ1n,2.))-2.*reQ2nQ1nstarQ1nstar+(pow(dReQ2n,2.)+pow(dImQ2n,2.))) |
| 2147 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); |
| 2148 | four2n2n2n2n = (2.*dMult*(dMult-3.)+pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ2n,2.) |
| 2149 | + pow(dImQ2n,2.))-2.*reQ4nQ2nstarQ2nstar+(pow(dReQ4n,2.)+pow(dImQ4n,2.))) |
| 2150 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); |
| 2151 | four2n1n2n1n = (dQ2nQ1nQ2nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar-2.*reQ2nQ1nstarQ1nstar) |
| 2152 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 2153 | - ((dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
| 2154 | + (dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-(pow(dReQ3n,2.)+pow(dImQ3n,2.))) |
| 2155 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 2156 | + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 2157 | four3n1n1n1n = (reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar-3.*reQ2nQ1nstarQ1nstar) |
| 2158 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 2159 | + (2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) |
| 2160 | + 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) |
| 2161 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 2162 | four4n2n1n1n = (reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar-2.*reQ3nQ2nstarQ1nstar) |
| 2163 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 2164 | - (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) |
| 2165 | - 3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) |
| 2166 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 2167 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 2168 | four3n1n2n2n = (reQ3nQ1nQ2nstarQ2nstar-reQ4nQ2nstarQ2nstar-reQ3nQ1nQ4nstar-2.*reQ3nQ2nstarQ1nstar) |
| 2169 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 2170 | - (2.*reQ1nQ1nQ2nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) |
| 2171 | - 4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) |
| 2172 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 2173 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 2174 | four3n1n3n1n = ((pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
| 2175 | - 2.*reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar) |
| 2176 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 2177 | + ((pow(dReQ4n,2.)+pow(dImQ4n,2.))-(dMult-4.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) |
| 2178 | + (pow(dReQ2n,2.)+pow(dImQ2n,2.))-(dMult-4.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) |
| 2179 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 2180 | + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 2181 | |
| 2182 | fQCorrelations->Fill(10.,four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 2183 | fQCorrelations->Fill(11.,four2n1n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 2184 | fQCorrelations->Fill(12.,four2n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 2185 | fQCorrelations->Fill(13.,four3n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 2186 | fQCorrelations->Fill(14.,four3n1n3n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 2187 | fQCorrelations->Fill(15.,four3n1n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 2188 | fQCorrelations->Fill(16.,four4n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 2189 | |
| 2190 | // distribution of <cos(n*(phi1+phi2-phi3-phi4))> |
| 2191 | f4pDistribution->Fill(four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 2192 | |
| 2193 | // fQProduct->Fill(0.,two1n1n*four1n1n1n1n,dMult*(dMult-1.)*dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 2194 | } // end of if(dMult>3) |
| 2195 | |
| 2196 | // 5-particle: |
| 2197 | Double_t five2n1n1n1n1n = 0.; // <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))> |
| 2198 | Double_t five2n2n2n1n1n = 0.; // <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))> |
| 2199 | Double_t five3n1n2n1n1n = 0.; // <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))> |
| 2200 | Double_t five4n1n1n1n1n = 0.; // <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))> |
| 4057ba99 |
2201 | |
| 9c1a9547 |
2202 | if(dMult>4) |
| 2203 | { |
| 2204 | five2n1n1n1n1n = (reQ2nQ1nQ1nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar+6.*reQ3nQ2nstarQ1nstar) |
| 2205 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 2206 | - (reQ2nQ1nQ3nstar+3.*(dMult-6.)*reQ2nQ1nstarQ1nstar+3.*reQ1nQ1nQ2nstar) |
| 2207 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 2208 | - (2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) |
| 2209 | + 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) |
| 2210 | - 3.*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))) |
| 2211 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 2212 | - 3.*(pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) |
| 2213 | - 2.*(2*dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult*(dMult-4.)) |
| 2214 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
| 2215 | |
| 2216 | five2n2n2n1n1n = (reQ2nQ2nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ2nQ2nQ3nstarQ1nstar) |
| 2217 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 2218 | + 2.*(reQ4nQ2nstarQ2nstar+4.*reQ3nQ2nstarQ1nstar+reQ3nQ1nQ4nstar) |
| 2219 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 2220 | + (reQ2nQ2nQ4nstar-2.*(dMult-5.)*reQ2nQ1nstarQ1nstar+2.*reQ1nQ1nQ2nstar) |
| 2221 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 2222 | - (2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) |
| 2223 | + 1.*pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.) |
| 2224 | - 2.*(3.*dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))) |
| 2225 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 2226 | - (4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) |
| 2227 | - 4.*(dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+4.*dMult*(dMult-6.)) |
| 2228 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
| 2229 | |
| 2230 | five4n1n1n1n1n = (reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ4nQ2nstarQ1nstarQ1nstar-4.*reQ3nQ1nstarQ1nstarQ1nstar) |
| 2231 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 2232 | + (8.*reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar+12.*reQ3nQ2nstarQ1nstar+12.*reQ2nQ1nstarQ1nstar) |
| 2233 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 2234 | - (6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+8.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) |
| 2235 | + 12.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+24.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-24.*dMult) |
| 2236 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
| 2237 | |
| 2238 | five3n1n2n1n1n = (reQ3nQ1nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar) |
| 2239 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 2240 | - (reQ3nQ1nQ2nstarQ2nstar-3.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar) |
| 2241 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 2242 | - ((2.*dMult-13.)*reQ3nQ2nstarQ1nstar-reQ3nQ1nQ4nstar-9.*reQ2nQ1nstarQ1nstar) |
| 2243 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 2244 | - (2.*reQ1nQ1nQ2nstar+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) |
| 2245 | - 2.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+2.*(pow(dReQ3n,2.) |
| 2246 | + pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) |
| 2247 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 2248 | + (2.*(dMult-6.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) |
| 2249 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
| 2250 | - pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) |
| 2251 | + 2.*(3.*dMult-11.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) |
| 2252 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 2253 | - 4.*(dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
| 2254 | |
| 2255 | fQCorrelations->Fill(18.,five2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
| 2256 | fQCorrelations->Fill(19.,five2n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
| 2257 | fQCorrelations->Fill(20.,five3n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
| 2258 | fQCorrelations->Fill(21.,five4n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
| 2259 | } // end of if(dMult>4) |
| 2260 | |
| 2261 | // 6-particle: |
| 2262 | Double_t six1n1n1n1n1n1n = 0.; // <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> |
| 2263 | Double_t six2n2n1n1n1n1n = 0.; // <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))> |
| 2264 | Double_t six3n1n1n1n1n1n = 0.; // <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))> |
| 2265 | Double_t six2n1n1n2n1n1n = 0.; // <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))> |
| ae733b3b |
2266 | |
| 9c1a9547 |
2267 | if(dMult>5) |
| 2268 | { |
| 2269 | six1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),3.)+9.*dQ2nQ1nQ2nstarQ1nstar-6.*reQ2nQ1nQ1nstarQ1nstarQ1nstar) |
| 2270 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)) |
| 2271 | + 4.*(reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar) |
| 2272 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)) |
| 2273 | + 2.*(9.*(dMult-4.)*reQ2nQ1nstarQ1nstar+2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))) |
| 2274 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)) |
| 2275 | - 9.*(pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)+(pow(dReQ2n,2.)+pow(dImQ2n,2.))) |
| 2276 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-5.)) |
| 2277 | + (18.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) |
| 2278 | / (dMult*(dMult-1)*(dMult-3)*(dMult-4)) |
| 2279 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 2280 | |
| 2281 | six2n1n1n2n1n1n = (dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.) |
| 2282 | * (2.*five2n2n2n1n1n+4.*five2n1n1n1n1n+4.*five3n1n2n1n1n+4.*four2n1n2n1n+1.*four1n1n1n1n) |
| 2283 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four1n1n1n1n+4.*two1n1n |
| 2284 | + 2.*three2n1n1n+2.*three2n1n1n+4.*four3n1n1n1n+8.*three2n1n1n+2.*four4n2n1n1n |
| 2285 | + 4.*four2n1n2n1n+2.*two2n2n+8.*four2n1n2n1n+4.*four3n1n3n1n+8.*three3n2n1n |
| 2286 | + 4.*four3n1n2n2n+4.*four1n1n1n1n+4.*four2n1n2n1n+1.*four2n2n2n2n) |
| 2287 | - dMult*(dMult-1.)*(dMult-2.)*(2.*three2n1n1n+8.*two1n1n+4.*two1n1n+2. |
| 2288 | + 4.*two1n1n+4.*three2n1n1n+2.*two2n2n+4.*three2n1n1n+8.*three3n2n1n |
| 2289 | + 8.*two2n2n+4.*three4n3n1n+4.*two3n3n+4.*three3n2n1n+4.*two1n1n |
| 2290 | + 8.*three2n1n1n+4.*two1n1n+4.*three3n2n1n+4.*three2n1n1n+2.*two2n2n |
| 2291 | + 4.*three3n2n1n+2.*three4n2n2n)-dMult*(dMult-1.) |
| 2292 | * (4.*two1n1n+4.+4.*two1n1n+2.*two2n2n+1.+4.*two1n1n+4.*two2n2n+4.*two3n3n |
| 2293 | + 1.+2.*two2n2n+1.*two4n4n)-dMult) |
| 2294 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed) |
| 2295 | |
| 2296 | six2n2n1n1n1n1n = (reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.) |
| 2297 | * (five4n1n1n1n1n+8.*five2n1n1n1n1n+6.*five2n2n2n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) |
| 2298 | * (4.*four3n1n1n1n+6.*four4n2n1n1n+12.*three2n1n1n+12.*four1n1n1n1n+24.*four2n1n2n1n |
| 2299 | + 4.*four3n1n2n2n+3.*four2n2n2n2n)-dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+12.*three3n2n1n |
| 2300 | + 4.*three4n3n1n+3.*three4n2n2n+8.*three2n1n1n+24.*two1n1n+12.*two2n2n+12.*three2n1n1n+8.*three3n2n1n |
| 2301 | + 1.*three4n2n2n)-dMult*(dMult-1.)*(4.*two1n1n+6.*two2n2n+4.*two3n3n+1.*two4n4n+2.*two2n2n+8.*two1n1n+6.)-dMult) |
| 2302 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed) |
| 2303 | |
| 2304 | six3n1n1n1n1n1n = (reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.) |
| 2305 | * (five4n1n1n1n1n+4.*five2n1n1n1n1n+6.*five3n1n2n1n1n+4.*four3n1n1n1n) |
| 2306 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four3n1n1n1n+6.*four4n2n1n1n+6.*four1n1n1n1n |
| 2307 | + 12.*three2n1n1n+12.*four2n1n2n1n+6.*four3n1n1n1n+12.*three3n2n1n+4.*four3n1n3n1n+3.*four3n1n2n2n) |
| 2308 | - dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+12.*three3n2n1n+4.*three4n3n1n+3.*three4n2n2n+4.*two1n1n |
| 2309 | + 12.*two1n1n+6.*three2n1n1n+12.*three2n1n1n+4.*three3n2n1n+12.*two2n2n+4.*three3n2n1n+4.*two3n3n+1.*three4n3n1n |
| 2310 | + 6.*three3n2n1n)-dMult*(dMult-1.)*(4.*two1n1n+6.*two2n2n+4.*two3n3n+1.*two4n4n+1.*two1n1n+4.+6.*two1n1n+4.*two2n2n |
| 2311 | + 1.*two3n3n)-dMult)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed) |
| 2312 | |
| 2313 | fQCorrelations->Fill(23.,six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
| 2314 | fQCorrelations->Fill(24.,six2n1n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
| 2315 | fQCorrelations->Fill(25.,six2n2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
| 2316 | fQCorrelations->Fill(26.,six3n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
| 2317 | |
| 2318 | // distribution of <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> |
| 2319 | f6pDistribution->Fill(six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
| 2320 | |
| 2321 | //fQProduct->Fill(1.,two1n1n*six1n1n1n1n1n1n,dMult*(dMult-1.)*dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
| 2322 | //fQProduct->Fill(3.,four1n1n1n1n*six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
| 2323 | } // end of if(dMult>5) |
| 4057ba99 |
2324 | |
| 9c1a9547 |
2325 | // 7-particle: |
| 2326 | Double_t seven2n1n1n1n1n1n1n = 0.; // <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> |
| 1dfa3c16 |
2327 | |
| 9c1a9547 |
2328 | if(dMult>6) |
| 2329 | { |
| 2330 | seven2n1n1n1n1n1n1n = (reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.) |
| 2331 | * (2.*six3n1n1n1n1n1n+4.*six1n1n1n1n1n1n+1.*six2n2n1n1n1n1n+6.*six2n1n1n2n1n1n+8.*five2n1n1n1n1n) |
| 2332 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(1.*five4n1n1n1n1n +8.*five2n1n1n1n1n+8.*four3n1n1n1n |
| 2333 | + 12.*five3n1n2n1n1n+4.*five2n1n1n1n1n+3.*five2n2n2n1n1n+6.*five2n2n2n1n1n+6.*four1n1n1n1n+24.*four1n1n1n1n |
| 2334 | + 12.*five2n1n1n1n1n+12.*five2n1n1n1n1n+12.*three2n1n1n+24.*four2n1n2n1n+4.*five3n1n2n1n1n+4.*five2n1n1n1n1n) |
| 2335 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four3n1n1n1n+6.*four4n2n1n1n+12.*four1n1n1n1n+24.*three2n1n1n |
| 2336 | + 24.*four2n1n2n1n+12.*four3n1n1n1n+24.*three3n2n1n+8.*four3n1n3n1n+6.*four3n1n2n2n+6.*three2n1n1n+12.*four1n1n1n1n |
| 2337 | + 12.*four2n1n2n1n+6.*three2n1n1n+12.*four2n1n2n1n+4.*four3n1n2n2n+3.*four2n2n2n2n+4.*four1n1n1n1n+6.*three2n1n1n |
| 2338 | + 24.*two1n1n+24.*four1n1n1n1n+4.*four3n1n1n1n+24.*two1n1n+24.*three2n1n1n+12.*two2n2n+24.*three2n1n1n+12.*four2n1n2n1n |
| 2339 | + 8.*three3n2n1n+8.*four2n1n2n1n+1.*four4n2n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+1.*three2n1n1n+8.*two1n1n |
| 2340 | + 12.*three3n2n1n+24.*two1n1n+12.*three2n1n1n+4.*three2n1n1n+8.*two1n1n+4.*three4n3n1n+24.*three2n1n1n+8.*three3n2n1n |
| 2341 | + 12.*two1n1n+12.*two1n1n+3.*three4n2n2n+24.*two2n2n+6.*two2n2n+12.+12.*three3n2n1n+8.*two3n3n+12.*three2n1n1n+24.*two1n1n |
| 2342 | + 4.*three3n2n1n+8.*three3n2n1n+2.*three4n3n1n+12.*two1n1n+8.*three2n1n1n+4.*three2n1n1n+2.*three3n2n1n+6.*two2n2n+8.*two2n2n |
| 2343 | + 1.*three4n2n2n+4.*three3n2n1n+6.*three2n1n1n)-dMult*(dMult-1.)*(4.*two1n1n+2.*two1n1n+6.*two2n2n+8.+1.*two2n2n+4.*two3n3n |
| 2344 | + 12.*two1n1n+4.*two1n1n+1.*two4n4n+8.*two2n2n+6.+2.*two3n3n+4.*two1n1n+1.*two2n2n)-dMult) |
| 2345 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)); // to be improved (direct formula needed) |
| 2346 | |
| 2347 | fQCorrelations->Fill(28.,seven2n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)); |
| 2348 | } // end of if(dMult>6) |
| ae733b3b |
2349 | |
| 9c1a9547 |
2350 | // 8-particle: |
| 2351 | Double_t eight1n1n1n1n1n1n1n1n = 0.; // <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> |
| 2352 | if(dMult>7) |
| 2353 | { |
| 2354 | eight1n1n1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),4.)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.) |
| 2355 | * (12.*seven2n1n1n1n1n1n1n+16.*six1n1n1n1n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.) |
| 2356 | * (8.*six3n1n1n1n1n1n+48.*six1n1n1n1n1n1n+6.*six2n2n1n1n1n1n+96.*five2n1n1n1n1n+72.*four1n1n1n1n+36.*six2n1n1n2n1n1n) |
| 2357 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(2.*five4n1n1n1n1n+32.*five2n1n1n1n1n+36.*four1n1n1n1n |
| 2358 | + 32.*four3n1n1n1n+48.*five2n1n1n1n1n+48.*five3n1n2n1n1n+144.*five2n1n1n1n1n+288.*four1n1n1n1n+36.*five2n2n2n1n1n |
| 2359 | + 144.*three2n1n1n+96.*two1n1n+144.*four2n1n2n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) |
| 2360 | * (8.*four3n1n1n1n+48.*four1n1n1n1n+12.*four4n2n1n1n+96.*four2n1n2n1n+96.*three2n1n1n+72.*three2n1n1n+144.*two1n1n |
| 2361 | + 16.*four3n1n3n1n+48.*four3n1n1n1n+144.*four1n1n1n1n+72.*four1n1n1n1n+96.*three3n2n1n+24.*four3n1n2n2n+144.*four2n1n2n1n |
| 2362 | + 288.*two1n1n+288.*three2n1n1n+9.*four2n2n2n2n+72.*two2n2n+24.)-dMult*(dMult-1.)*(dMult-2.)*(12.*three2n1n1n+16.*two1n1n |
| 2363 | + 24.*three3n2n1n+48.*three2n1n1n+96.*two1n1n+8.*three4n3n1n+32.*three3n2n1n+96.*three2n1n1n+144.*two1n1n+6.*three4n2n2n |
| 2364 | + 96.*two2n2n+36.*two2n2n+72.+48.*three3n2n1n+16.*two3n3n+72.*three2n1n1n+144.*two1n1n)-dMult*(dMult-1.)*(8.*two1n1n |
| 2365 | + 12.*two2n2n+16.+8.*two3n3n+48.*two1n1n+1.*two4n4n+16.*two2n2n+18.)-dMult) |
| 2366 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); // to be improved (direct formula needed) |
| 2367 | |
| 2368 | fQCorrelations->Fill(30.,eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); |
| ae733b3b |
2369 | |
| 9c1a9547 |
2370 | // distribution of <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> |
| 2371 | f8pDistribution->Fill(eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); |
| 2372 | |
| 2373 | } // end of if(dMult>7) |
| 1dfa3c16 |
2374 | |
| 9c1a9547 |
2375 | } // end of AliFlowAnalysisWithQCumulants::CalculateCorrelationsForIntegratedFlow() |
| bc92c0cb |
2376 | |
| 2377 | |
| 9c1a9547 |
2378 | //================================================================================================================================ |
| bc92c0cb |
2379 | |
| 2380 | |
| 9c1a9547 |
2381 | void AliFlowAnalysisWithQCumulants::CalculateWeightedCorrelationsForIntegratedFlow() |
| 2382 | { |
| 2383 | // calculate all weighted correlations needed for 'no-name' integrated flow and store them in 1D profile fQCorrelationsW |
| 2384 | |
| 2385 | // Remark 1: binning of fQCorrelationsW is organized as follows: |
| 2386 | //.............................................................................................. |
| 2387 | // ---- bins 1-20: 2-particle correlations ---- |
| 2388 | // 1st bin: two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))> |
| 2389 | // 2nd bin: two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))> |
| 2390 | // 3rd bin: two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> |
| 2391 | // 4th bin: two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))> |
| 2392 | // 5th bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))> |
| 2393 | // 6th bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> |
| 2394 | // ---- bins 21-40: 3-particle correlations ---- |
| 2395 | // 21st bin: three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> |
| 2396 | // ---- bins 41-60: 4-particle correlations ---- |
| 2397 | // 41st bin: four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> |
| 2398 | // ---- bins 61-80: 5-particle correlations ---- |
| 2399 | // ---- bins 81-100: 6-particle correlations ---- |
| 2400 | // ---- bins 101-120: 7-particle correlations ---- |
| 2401 | // ---- bins 121-140: 8-particle correlations ---- |
| 2402 | //.............................................................................................. |
| 2403 | |
| 2404 | // multiplicity (number of particles used to determine the reaction plane) |
| 2405 | Double_t dMult = (*fSMpk)(0,0); |
| 2406 | |
| 2407 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: |
| 2408 | Double_t dReQ1n1k = (*fReQ)(0,1); |
| 2409 | Double_t dReQ2n2k = (*fReQ)(1,2); |
| 2410 | Double_t dReQ3n3k = (*fReQ)(2,3); |
| 2411 | Double_t dReQ4n4k = (*fReQ)(3,4); |
| 2412 | Double_t dReQ1n3k = (*fReQ)(0,3); |
| 2413 | Double_t dImQ1n1k = (*fImQ)(0,1); |
| 2414 | Double_t dImQ2n2k = (*fImQ)(1,2); |
| 2415 | Double_t dImQ3n3k = (*fImQ)(2,3); |
| 2416 | Double_t dImQ4n4k = (*fImQ)(3,4); |
| 2417 | Double_t dImQ1n3k = (*fImQ)(0,3); |
| 2418 | |
| 2419 | // dMs are variables introduced in order to simplify some Eqs. bellow: |
| 2420 | //.............................................................................................. |
| 2421 | Double_t dM11 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
| 2422 | Double_t dM22 = (*fSMpk)(1,2)-(*fSMpk)(0,4); // dM22 = sum_{i,j=1,i!=j}^M w_i^2 w_j^2 |
| 2423 | Double_t dM33 = (*fSMpk)(1,3)-(*fSMpk)(0,6); // dM33 = sum_{i,j=1,i!=j}^M w_i^3 w_j^3 |
| 2424 | Double_t dM44 = (*fSMpk)(1,4)-(*fSMpk)(0,8); // dM44 = sum_{i,j=1,i!=j}^M w_i^4 w_j^4 |
| 2425 | Double_t dM31 = (*fSMpk)(0,3)*(*fSMpk)(0,1)-(*fSMpk)(0,4); // dM31 = sum_{i,j=1,i!=j}^M w_i^3 w_j |
| 2426 | Double_t dM211 = (*fSMpk)(0,2)*(*fSMpk)(1,1)-2.*(*fSMpk)(0,3)*(*fSMpk)(0,1) |
| 2427 | - (*fSMpk)(1,2)+2.*(*fSMpk)(0,4); // dM211 = sum_{i,j,k=1,i!=j!=k}^M w_i^2 w_j w_k |
| 2428 | Double_t dM1111 = (*fSMpk)(3,1)-6.*(*fSMpk)(0,2)*(*fSMpk)(1,1) |
| 2429 | + 8.*(*fSMpk)(0,3)*(*fSMpk)(0,1) |
| 2430 | + 3.*(*fSMpk)(1,2)-6.*(*fSMpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l |
| 2431 | //.............................................................................................. |
| bc92c0cb |
2432 | |
| 2433 | |
| 9c1a9547 |
2434 | |
| bc92c0cb |
2435 | |
| 9c1a9547 |
2436 | // *********************************************** |
| 2437 | // **** weighted multi-particle correlations: **** |
| 2438 | // *********************************************** |
| 2439 | //.............................................................................................. |
| 2440 | // weighted 2-particle correlations: |
| 2441 | Double_t two1n1nW1W1 = 0.; // <w1 w2 cos(n*(phi1-phi2))> |
| 2442 | Double_t two2n2nW2W2 = 0.; // <w1^2 w2^2 cos(2n*(phi1-phi2))> |
| 2443 | Double_t two3n3nW3W3 = 0.; // <w1^3 w2^3 cos(3n*(phi1-phi2))> |
| 2444 | Double_t two4n4nW4W4 = 0.; // <w1^4 w2^4 cos(4n*(phi1-phi2))> |
| 2445 | Double_t two1n1nW3W1 = 0.; // <w1^3 w2 cos(n*(phi1-phi2))> |
| 2446 | Double_t two1n1nW1W1W2 = 0.; // <w1 w2 w3^2 cos(n*(phi1-phi2))> |
| 2447 | |
| 2448 | if(dMult>1) |
| 2449 | { |
| 2450 | if(dM11) |
| 2451 | { |
| 2452 | two1n1nW1W1 = (pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSMpk)(0,2))/dM11; |
| 2453 | fQCorrelationsW->Fill(0.,two1n1nW1W1,dM11); |
| 2454 | } |
| 2455 | if(dM22) |
| 2456 | { |
| 2457 | two2n2nW2W2 = (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)-(*fSMpk)(0,4))/dM22; |
| 2458 | fQCorrelationsW->Fill(1.,two2n2nW2W2,dM22); |
| 2459 | } |
| 2460 | if(dM33) |
| 2461 | { |
| 2462 | two3n3nW3W3 = (pow(dReQ3n3k,2)+pow(dImQ3n3k,2)-(*fSMpk)(0,6))/dM33; |
| 2463 | fQCorrelationsW->Fill(2.,two3n3nW3W3,dM33); |
| 2464 | } |
| 2465 | if(dM44) |
| 2466 | { |
| 2467 | two4n4nW4W4 = (pow(dReQ4n4k,2)+pow(dImQ4n4k,2)-(*fSMpk)(0,8))/dM44; |
| 2468 | fQCorrelationsW->Fill(3.,two4n4nW4W4,dM44); |
| 2469 | } |
| 2470 | if(dM31) |
| 2471 | { |
| 2472 | two1n1nW3W1 = (dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k-(*fSMpk)(0,4))/dM31; |
| 2473 | fQCorrelationsW->Fill(4.,two1n1nW3W1,dM31); |
| 2474 | } |
| 2475 | if(dM211) |
| 2476 | { |
| 2477 | two1n1nW1W1W2 = ((*fSMpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSMpk)(0,2)) |
| 2478 | - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k |
| 2479 | - (*fSMpk)(0,4)))/dM211; |
| 2480 | fQCorrelationsW->Fill(5.,two1n1nW1W1W2,dM211); |
| 2481 | } |
| 2482 | } // end of if(dMult>1) |
| 2483 | //.............................................................................................. |
| 2484 | |
| 2485 | //.............................................................................................. |
| 2486 | // weighted 3-particle correlations: |
| 2487 | Double_t three2n1n1nW2W1W1 = 0.; // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> |
| 2488 | |
| 2489 | if(dMult>2) |
| 2490 | { |
| 2491 | if(dM211) |
| 2492 | { |
| 2493 | three2n1n1nW2W1W1 = (pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k |
| 2494 | - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k) |
| 2495 | - pow(dReQ2n2k,2)-pow(dImQ2n2k,2) |
| 2496 | + 2.*(*fSMpk)(0,4))/dM211; |
| 2497 | fQCorrelationsW->Fill(20.,three2n1n1nW2W1W1,dM211); |
| 2498 | } |
| 2499 | } // end of if(dMult>2) |
| 2500 | //.............................................................................................. |
| 2501 | |
| 2502 | //.............................................................................................. |
| 2503 | // weighted 4-particle correlations: |
| 2504 | Double_t four1n1n1n1nW1W1W1W1 = 0.; // <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> |
| 2505 | if(dMult>3) |
| 2506 | { |
| 2507 | if(dM1111) |
| 2508 | { |
| 2509 | four1n1n1n1nW1W1W1W1 = (pow(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.),2) |
| 2510 | - 2.*(pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k) |
| 2511 | + 8.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k) |
| 2512 | + (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)) |
| 2513 | - 4.*(*fSMpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
| 2514 | - 6.*(*fSMpk)(0,4)+2.*(*fSMpk)(1,2))/dM1111; |
| 2515 | fQCorrelationsW->Fill(40.,four1n1n1n1nW1W1W1W1,dM1111); |
| 2516 | } |
| 2517 | } // end of if(dMult>3) |
| 2518 | //.............................................................................................. |
| 2519 | |
| 2520 | } // end of AliFlowAnalysisWithQCumulants::CalculateWeightedCorrelationsForIntegratedFlow() |
| bc92c0cb |
2521 | |
| 2522 | |
| 9c1a9547 |
2523 | //================================================================================================================================ |
| bc92c0cb |
2524 | |
| 2525 | |
| 9c1a9547 |
2526 | void AliFlowAnalysisWithQCumulants::CalculateCorrelationsForDifferentialFlow(TString type) |
| 2527 | { |
| 2528 | // calculate all correlations needed for differential flow for each (pt,eta) bin: |
| 2529 | |
| 2530 | // pt and eta bin width: |
| 2531 | Double_t dBinWidthPt = 0.; // to be improved (should I promote this variable to data members?) |
| 2532 | Double_t dBinWidthEta = 0.; // to be improved (should I promote this variable to data members?) |
| 2533 | |
| 2534 | if(fnBinsPt) dBinWidthPt=(fPtMax-fPtMin)/fnBinsPt; |
| 2535 | if(fnBinsEta) dBinWidthEta=(fEtaMax-fEtaMin)/fnBinsEta; |
| 2536 | |
| 2537 | // multiplicity: |
| 2538 | Double_t dMult = (*fSMpk)(0,0); |
| 2539 | |
| 2540 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: |
| 2541 | Double_t dReQ1n = (*fReQ)(0,0); |
| 2542 | Double_t dReQ2n = (*fReQ)(1,0); |
| 2543 | //Double_t dReQ3n = (*fReQ)(2,0); |
| 2544 | //Double_t dReQ4n = (*fReQ)(3,0); |
| 2545 | Double_t dImQ1n = (*fImQ)(0,0); |
| 2546 | Double_t dImQ2n = (*fImQ)(1,0); |
| 2547 | //Double_t dImQ3n = (*fImQ)(2,0); |
| 2548 | //Double_t dImQ4n = (*fImQ)(3,0); |
| 2549 | |
| 2550 | // looping over all (pt,eta) bins and calculating correlations needed for differential flow: |
| 2551 | for(Int_t p=1;p<=fnBinsPt;p++) |
| 2552 | { |
| 2553 | for(Int_t e=1;e<=fnBinsEta;e++) |
| 2554 | { |
| 2555 | // real and imaginary parts of q_n (non-weighted Q-vector evaluated only for POIs in harmonic n for each (pt,eta) bin): |
| 2556 | Double_t dReqnPtEta = 0.; |
| 2557 | Double_t dImqnPtEta = 0.; |
| 2558 | |
| 2559 | // number of POIs in each (pt,eta) bin: |
| 2560 | Double_t dmPtEta = 0.; |
| 2561 | |
| 2562 | // real and imaginary parts of q''_{n}, q''_{2n}, ... |
| 2563 | // (non-weighted Q-vectors evaluated only for particles which are both RPs and POIs in harmonic n, 2n, ... for each (pt,eta) bin): |
| 2564 | Double_t dReqPrimePrime1nPtEta = 0.; |
| 2565 | Double_t dImqPrimePrime1nPtEta = 0.; |
| 2566 | Double_t dReqPrimePrime2nPtEta = 0.; |
| 2567 | Double_t dImqPrimePrime2nPtEta = 0.; |
| 2568 | |
| 2569 | // number of particles which are both RPs and POIs in each (pt,eta) bin: |
| 2570 | Double_t dmPrimePrimePtEta = 0.; |
| 2571 | |
| 2572 | if(type == "POI") |
| 2573 | { |
| 2574 | // q''_{n}, q''_{2n}: |
| 2575 | //............................................................................................... |
| 2576 | dReqPrimePrime1nPtEta = fReqPrimePrime1nPtEta->GetBinContent(fReqPrimePrime1nPtEta->GetBin(p,e)); |
| 2577 | dImqPrimePrime1nPtEta = fImqPrimePrime1nPtEta->GetBinContent(fImqPrimePrime1nPtEta->GetBin(p,e)); |
| 2578 | dReqPrimePrime2nPtEta = fReqPrimePrime2nPtEta->GetBinContent(fReqPrimePrime2nPtEta->GetBin(p,e)); |
| 2579 | dImqPrimePrime2nPtEta = fImqPrimePrime2nPtEta->GetBinContent(fImqPrimePrime2nPtEta->GetBin(p,e)); |
| 2580 | //............................................................................................... |
| 2581 | |
| 2582 | // m'': |
| 2583 | dmPrimePrimePtEta = fmPrimePrimePtEta->GetBinContent(fmPrimePrimePtEta->GetBin(p,e)); |
| 2584 | |
| 2585 | // q'_{n}: |
| 2586 | dReqnPtEta = fReqnPtEta->GetBinContent(fReqnPtEta->GetBin(p,e)); |
| 2587 | dImqnPtEta = fImqnPtEta->GetBinContent(fImqnPtEta->GetBin(p,e)); |
| 2588 | dmPtEta = fmPtEta->GetBinContent(fmPtEta->GetBin(p,e)); |
| 2589 | } |
| 2590 | else if(type == "RP") |
| 2591 | { |
| 2592 | // q_RP{n}, q_RP{2n}: |
| 2593 | //............................................................................................... |
| 2594 | dReqPrimePrime1nPtEta = fReqRP1nPtEta->GetBinContent(fReqRP1nPtEta->GetBin(p,e)); |
| 2595 | dImqPrimePrime1nPtEta = fImqRP1nPtEta->GetBinContent(fImqRP1nPtEta->GetBin(p,e)); |
| 2596 | dReqPrimePrime2nPtEta = fReqRP2nPtEta->GetBinContent(fReqRP2nPtEta->GetBin(p,e)); |
| 2597 | dImqPrimePrime2nPtEta = fImqRP2nPtEta->GetBinContent(fImqRP2nPtEta->GetBin(p,e)); |
| 2598 | //............................................................................................... |
| 2599 | |
| 2600 | // m'': |
| 2601 | dmPrimePrimePtEta = fmRPPtEta->GetBinContent(fmRPPtEta->GetBin(p,e)); |
| 2602 | |
| 2603 | dReqnPtEta = fReqRP1nPtEta->GetBinContent(fReqRP1nPtEta->GetBin(p,e)); // not a bug ;-) |
| 2604 | dImqnPtEta = fImqRP1nPtEta->GetBinContent(fImqRP1nPtEta->GetBin(p,e)); // not a bug ;-) |
| 2605 | dmPtEta = fmRPPtEta->GetBinContent(fmRPPtEta->GetBin(p,e)); // not a bug ;-) |
| 2606 | } |
| 2607 | |
| 2608 | // 2'-particle correlation: |
| 2609 | Double_t two1n1nPtEta = 0.; |
| 2610 | if(dmPtEta*dMult-dmPrimePrimePtEta) |
| 2611 | { |
| 2612 | two1n1nPtEta = (dReqnPtEta*dReQ1n+dImqnPtEta*dImQ1n-dmPrimePrimePtEta) |
| 2613 | / (dmPtEta*dMult-dmPrimePrimePtEta); |
| 2614 | |
| 2615 | // fill the 2D profile to get the average correlation for each (pt, eta) bin: |
| 2616 | if(type == "POI") |
| 2bdc5281 |
2617 | { |
| 9c1a9547 |
2618 | f2pPtEtaPOI->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta,two1n1nPtEta,dmPtEta*dMult-dmPrimePrimePtEta); |
| 2619 | } |
| 2620 | else if(type == "RP") |
| 2621 | { |
| 2622 | f2pPtEtaRP->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta,two1n1nPtEta,dmPtEta*dMult-dmPrimePrimePtEta); |
| 2623 | } |
| 2624 | } // end of if(dmPtEta*dMult-dmPrimePrimePtEta) |
| 2bdc5281 |
2625 | |
| 9c1a9547 |
2626 | // 4'-particle correlation: |
| 2627 | Double_t four1n1n1n1nPtEta = 0.; |
| 2628 | if((dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 2629 | + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression) |
| 2630 | { |
| 2631 | four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(dReqnPtEta*dReQ1n+dImqnPtEta*dImQ1n) |
| 2632 | - dReqPrimePrime2nPtEta*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) |
| 2633 | - 2.*dImqPrimePrime2nPtEta*dReQ1n*dImQ1n |
| 2634 | - dReqnPtEta*(dReQ1n*dReQ2n+dImQ1n*dImQ2n) |
| 2635 | + dImqnPtEta*(dImQ1n*dReQ2n-dReQ1n*dImQ2n) |
| 2636 | - 2.*dMult*(dReqnPtEta*dReQ1n+dImqnPtEta*dImQ1n) |
| 2637 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*dmPrimePrimePtEta |
| 2638 | + 6.*(dReqPrimePrime1nPtEta*dReQ1n+dImqPrimePrime1nPtEta*dImQ1n) |
| 2639 | + 1.*(dReqPrimePrime2nPtEta*dReQ2n+dImqPrimePrime2nPtEta*dImQ2n) |
| 2640 | + 2.*(dReqnPtEta*dReQ1n+dImqnPtEta*dImQ1n) |
| 2641 | + 2.*dmPrimePrimePtEta*dMult |
| 2642 | - 6.*dmPrimePrimePtEta) |
| 2643 | / ((dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 2644 | + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 2645 | |
| 2646 | // fill the 2D profile to get the average correlation for each (pt, eta) bin: |
| 2647 | if(type == "POI") |
| 2648 | { |
| 2649 | f4pPtEtaPOI->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta,four1n1n1n1nPtEta, |
| 2650 | (dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 2651 | + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 2652 | } |
| 2653 | else if(type == "RP") |
| 2654 | { |
| 2655 | f4pPtEtaRP->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta,four1n1n1n1nPtEta, |
| 2656 | (dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 2657 | + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 2658 | } |
| 2659 | } // end of if((dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 2660 | // +dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 2661 | |
| 2662 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) |
| 2663 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
| 2664 | |
| 2665 | } // end of AliFlowAnalysisWithQCumulants::CalculateCorrelationsForDifferentialFlow() |
| bc92c0cb |
2666 | |
| bc92c0cb |
2667 | |
| 9c1a9547 |
2668 | //================================================================================================================================ |
| bc92c0cb |
2669 | |
| 2670 | |
| 9c1a9547 |
2671 | void AliFlowAnalysisWithQCumulants::CalculateWeightedCorrelationsForDifferentialFlow(TString type) |
| 2672 | { |
| 2673 | // calculate all weighted correlations needed for differential flow |
| 2674 | |
| 2675 | // pt and eta bin width: |
| 2676 | Double_t dBinWidthPt = 0.; // to be improved (should I promote this variable to data members?) |
| 2677 | Double_t dBinWidthEta = 0.; // to be improved (should I promote this variable to data members?) |
| 2678 | |
| 2679 | if(fnBinsPt) dBinWidthPt=(fPtMax-fPtMin)/fnBinsPt; |
| 2680 | if(fnBinsEta) dBinWidthEta=(fEtaMax-fEtaMin)/fnBinsEta; |
| 2681 | |
| 2682 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: |
| 2683 | Double_t dReQ1n1k = (*fReQ)(0,1); |
| 2684 | Double_t dReQ2n2k = (*fReQ)(1,2); |
| 2685 | Double_t dReQ1n3k = (*fReQ)(0,3); |
| 2686 | //Double_t dReQ4n4k = (*fReQ)(3,4); |
| 2687 | Double_t dImQ1n1k = (*fImQ)(0,1); |
| 2688 | Double_t dImQ2n2k = (*fImQ)(1,2); |
| 2689 | Double_t dImQ1n3k = (*fImQ)(0,3); |
| 2690 | //Double_t dImQ4n4k = (*fImQ)(3,4); |
| 2691 | |
| 2692 | // S^M_{p,k} (see .h file for the definition of fSMpk): |
| 2693 | Double_t dSM1p1k = (*fSMpk)(0,1); |
| 2694 | Double_t dSM1p2k = (*fSMpk)(0,2); |
| 2695 | Double_t dSM1p3k = (*fSMpk)(0,3); |
| 2696 | Double_t dSM2p1k = (*fSMpk)(1,1); |
| 2697 | Double_t dSM3p1k = (*fSMpk)(2,1); |
| 2698 | |
| 2699 | // looping over all (pt,eta) bins and calculating weighted correlations needed for differential flow: |
| 2700 | for(Int_t p=1;p<=fnBinsPt;p++) |
| 2701 | { |
| 2702 | for(Int_t e=1;e<=fnBinsEta;e++) |
| 2703 | { |
| 2704 | // real and imaginary parts of q_n (non-weighted Q-vector evaluated only for POIs in harmonic n for each (pt,eta) bin): |
| 2705 | Double_t dReqnPtEta = 0.; |
| 2706 | Double_t dImqnPtEta = 0.; |
| 2707 | |
| 2708 | // number of POIs in each (pt,eta) bin: |
| 2709 | Double_t dmPtEta = 0.; |
| 2710 | |
| 2711 | // real and imaginary parts of q''_{n,2k}, q''_{2n,1k}, ... |
| 2712 | // (weighted Q-vectors evaluated only for particles which are both RPs and POIs in harmonic n, 2n, ... for each (pt,eta) bin): |
| 2713 | Double_t dReqPrimePrime1n2kPtEta = 0.; |
| 2714 | Double_t dImqPrimePrime1n2kPtEta = 0.; |
| 2715 | Double_t dReqPrimePrime2n1kPtEta = 0.; |
| 2716 | Double_t dImqPrimePrime2n1kPtEta = 0.; |
| 2717 | |
| 2718 | // S^{m''}_{1,1}, S^{m''}_{1,2}, S^{m''}_{1,3}... (see .h file for the definition): |
| 2719 | Double_t dSmPrimePrime1p1kPtEta = 0.; |
| 2720 | Double_t dSmPrimePrime1p2kPtEta = 0.; |
| 2721 | Double_t dSmPrimePrime1p3kPtEta = 0.; |
| 2722 | |
| 2723 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) |
| 2724 | Double_t dM0111 = 0.; |
| 2725 | |
| 2726 | // qPOI_{n}: // to be improved (notation) |
| 2727 | if(type == "POI") |
| 2728 | { |
| 2729 | dReqnPtEta = fReqnPtEta->GetBinContent(fReqnPtEta->GetBin(p,e)); |
| 2730 | dImqnPtEta = fImqnPtEta->GetBinContent(fImqnPtEta->GetBin(p,e)); |
| 2731 | dmPtEta = fmPtEta->GetBinContent(fmPtEta->GetBin(p,e)); |
| 2732 | |
| 2733 | //............................................................................................... |
| 2734 | // q''_{n,2k}, q''_{2n,1k}: |
| 2735 | dReqPrimePrime1n2kPtEta = fReqPrimePrime1n2kPtEta->GetBinContent(fReqPrimePrime1n2kPtEta->GetBin(p,e)); |
| 2736 | dImqPrimePrime1n2kPtEta = fImqPrimePrime1n2kPtEta->GetBinContent(fImqPrimePrime1n2kPtEta->GetBin(p,e)); |
| 2737 | dReqPrimePrime2n1kPtEta = fReqPrimePrime2n1kPtEta->GetBinContent(fReqPrimePrime2n1kPtEta->GetBin(p,e)); |
| 2738 | dImqPrimePrime2n1kPtEta = fImqPrimePrime2n1kPtEta->GetBinContent(fImqPrimePrime2n1kPtEta->GetBin(p,e)); |
| 2739 | |
| 2740 | // S^{m''}_{1,1}, S^{m''}_{1,2}, S^{m''}_{1,3}...: |
| 2741 | dSmPrimePrime1p1kPtEta = fSmPrimePrime1p1kPtEta->GetBinContent(fSmPrimePrime1p1kPtEta->GetBin(p,e)); |
| 2742 | dSmPrimePrime1p2kPtEta = fSmPrimePrime1p2kPtEta->GetBinContent(fSmPrimePrime1p2kPtEta->GetBin(p,e)); |
| 2743 | dSmPrimePrime1p3kPtEta = fSmPrimePrime1p3kPtEta->GetBinContent(fSmPrimePrime1p3kPtEta->GetBin(p,e)); |
| 2744 | |
| 2745 | // M0111 from Eq. (118) in QC2c (to be improved (notation)): |
| 2746 | dM0111 = dmPtEta*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k) |
| 2747 | - 3.*(dSmPrimePrime1p1kPtEta*(dSM2p1k-dSM1p2k) |
| 2748 | + 2.*(dSmPrimePrime1p3kPtEta-dSmPrimePrime1p2kPtEta*dSM1p1k)); |
| 2749 | //............................................................................................... |
| 2750 | } |
| 2751 | else if(type == "RP") |
| 2752 | { |
| 2753 | dReqnPtEta = fReqRP1nPtEta->GetBinContent(fReqRP1nPtEta->GetBin(p,e)); // not a bug ;-) |
| 2754 | dImqnPtEta = fImqRP1nPtEta->GetBinContent(fImqRP1nPtEta->GetBin(p,e)); // not a bug ;-) |
| 2755 | dmPtEta = fmRPPtEta->GetBinContent(fmRPPtEta->GetBin(p,e)); // not a bug ;-) |
| 2756 | |
| 2757 | //............................................................................................... |
| 2758 | // q''_{n,2k}, q''_{2n,1k}: (to be improved (notation)): |
| 2759 | dReqPrimePrime1n2kPtEta = fReqRP1n2kPtEta->GetBinContent(fReqRP1n2kPtEta->GetBin(p,e)); |
| 2760 | dImqPrimePrime1n2kPtEta = fImqRP1n2kPtEta->GetBinContent(fImqRP1n2kPtEta->GetBin(p,e)); |
| 2761 | dReqPrimePrime2n1kPtEta = fReqRP2n1kPtEta->GetBinContent(fReqRP2n1kPtEta->GetBin(p,e)); |
| 2762 | dImqPrimePrime2n1kPtEta = fImqRP2n1kPtEta->GetBinContent(fImqRP2n1kPtEta->GetBin(p,e)); |
| 2763 | |
| 2764 | // S^{m''}_{1,1}, S^{m''}_{1,2}, S^{m''}_{1,3}...: (to be improved (notation)): |
| 2765 | dSmPrimePrime1p1kPtEta = fSmRP1p1kPtEta->GetBinContent(fSmRP1p1kPtEta->GetBin(p,e)); |
| 2766 | dSmPrimePrime1p2kPtEta = fSmRP1p2kPtEta->GetBinContent(fSmRP1p2kPtEta->GetBin(p,e)); |
| 2767 | dSmPrimePrime1p3kPtEta = fSmRP1p3kPtEta->GetBinContent(fSmRP1p3kPtEta->GetBin(p,e)); |
| 2768 | |
| 2769 | // M0111 from Eq. (118) in QC2c (to be improved (notation)): |
| 2770 | dM0111 = dmPtEta*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k) |
| 2771 | - 3.*(dSmPrimePrime1p1kPtEta*(dSM2p1k-dSM1p2k) |
| 2772 | + 2.*(dSmPrimePrime1p3kPtEta-dSmPrimePrime1p2kPtEta*dSM1p1k)); |
| 2773 | //............................................................................................... |
| 2774 | } |
| 2775 | |
| 2776 | // 2'-particle correlation: |
| 2777 | Double_t two1n1nW0W1PtEta = 0.; |
| 2778 | if(dmPtEta*dSM1p1k-dSmPrimePrime1p1kPtEta) |
| 2779 | { |
| 2780 | two1n1nW0W1PtEta = (dReqnPtEta*dReQ1n1k+dImqnPtEta*dImQ1n1k-dSmPrimePrime1p1kPtEta) |
| 2781 | / (dmPtEta*dSM1p1k-dSmPrimePrime1p1kPtEta); |
| 2782 | |
| 2783 | // fill the 2D profile to get the average correlation for each (pt, eta) bin: |
| 2784 | if(type == "POI") |
| 2785 | { |
| 2786 | f2pPtEtaPOIW->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta,two1n1nW0W1PtEta, |
| 2787 | dmPtEta*dSM1p1k-dSmPrimePrime1p1kPtEta); |
| 2788 | } |
| 2789 | else if(type == "RP") |
| 2790 | { |
| 2791 | f2pPtEtaRPW->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta,two1n1nW0W1PtEta, |
| 2792 | dmPtEta*dSM1p1k-dSmPrimePrime1p1kPtEta); |
| 2793 | } |
| 2794 | } // end of if(dmPtEta*dMult-dmPrimePrimePtEta) |
| 2795 | |
| 2796 | // 4'-particle correlation: |
| 2797 | Double_t four1n1n1n1nW0W1W1W1PtEta = 0.; |
| 2798 | if(dM0111) |
| 2799 | { |
| 2800 | four1n1n1n1nW0W1W1W1PtEta = ((pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*(dReqnPtEta*dReQ1n1k+dImqnPtEta*dImQ1n1k) |
| 2801 | - dReqPrimePrime2n1kPtEta*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.)) |
| 2802 | - 2.*dImqPrimePrime2n1kPtEta*dReQ1n1k*dImQ1n1k |
| 2803 | - dReqnPtEta*(dReQ1n1k*dReQ2n2k+dImQ1n1k*dImQ2n2k) |
| 2804 | + dImqnPtEta*(dImQ1n1k*dReQ2n2k-dReQ1n1k*dImQ2n2k) |
| 2805 | - 2.*dSM1p2k*(dReqnPtEta*dReQ1n1k+dImqnPtEta*dImQ1n1k) |
| 2806 | - 2.*(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*dSmPrimePrime1p1kPtEta |
| 2807 | + 6.*(dReqPrimePrime1n2kPtEta*dReQ1n1k+dImqPrimePrime1n2kPtEta*dImQ1n1k) |
| 2808 | + 1.*(dReqPrimePrime2n1kPtEta*dReQ2n2k+dImqPrimePrime2n1kPtEta*dImQ2n2k) |
| 2809 | + 2.*(dReqnPtEta*dReQ1n3k+dImqnPtEta*dImQ1n3k) |
| 2810 | + 2.*dSmPrimePrime1p1kPtEta*dSM1p2k |
| 2811 | - 6.*dSmPrimePrime1p3kPtEta) |
| 2812 | / dM0111; // to be imropoved (notation of dM0111) |
| 2813 | |
| 2814 | // fill the 2D profile to get the average correlation for each (pt, eta) bin: |
| 2815 | if(type == "POI") |
| 2816 | { |
| 2817 | f4pPtEtaPOIW->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta,four1n1n1n1nW0W1W1W1PtEta,dM0111); |
| 2818 | } |
| 2819 | else if(type == "RP") |
| 2820 | { |
| 2821 | f4pPtEtaRPW->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta,four1n1n1n1nW0W1W1W1PtEta,dM0111); |
| 2822 | } |
| 2823 | } // end of if(dM0111) |
| 2824 | |
| 2825 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) |
| 2826 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
| 2827 | |
| 2828 | } // end of AliFlowAnalysisWithQCumulants::CalculateWeightedCorrelationsForDifferentialFlow(TString type) |
| bc92c0cb |
2829 | |
| 2830 | |
| 9c1a9547 |
2831 | //================================================================================================================================ |
| bc92c0cb |
2832 | |
| 2833 | |
| 2bdc5281 |
2834 | void AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNonUniformAcceptanceForNoNameIntegratedFlowCosTerms() |
| c365fe76 |
2835 | { |
| 2bdc5281 |
2836 | // calculate corrections for non-uniform acceptance of the detector for no-name integrated flow (cos terms) |
| c365fe76 |
2837 | |
| 2838 | // multiplicity: |
| 2839 | Double_t dMult = (*fSMpk)(0,0); |
| 2840 | |
| 2841 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: |
| 2842 | Double_t dReQ1n = (*fReQ)(0,0); |
| 2843 | Double_t dReQ2n = (*fReQ)(1,0); |
| 2844 | //Double_t dReQ3n = (*fReQ)(2,0); |
| 2845 | //Double_t dReQ4n = (*fReQ)(3,0); |
| 2846 | Double_t dImQ1n = (*fImQ)(0,0); |
| 2847 | Double_t dImQ2n = (*fImQ)(1,0); |
| 2848 | //Double_t dImQ3n = (*fImQ)(2,0); |
| 2849 | //Double_t dImQ4n = (*fImQ)(3,0); |
| 2850 | |
| 2851 | // ************************************************************* |
| 2852 | // **** corrections for non-uniform acceptance (cos terms): **** |
| 2853 | // ************************************************************* |
| 2854 | // |
| 2855 | // Remark 1: corrections for non-uniform acceptance (cos terms) calculated with non-weighted Q-vectors |
| 2856 | // are stored in 1D profile fQCorrectionsCos. |
| 2857 | // Remark 2: binning of fQCorrectionsCos is organized as follows: |
| 2858 | // -------------------------------------------------------------------------------------------------------------------- |
| 2859 | // 1st bin: <<cos(n*(phi1))>> = cosP1n |
| 2860 | // 2nd bin: <<cos(n*(phi1+phi2))>> = cosP1nP1n |
| 2861 | // 3rd bin: <<cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1n |
| 2862 | // ... |
| 2863 | // -------------------------------------------------------------------------------------------------------------------- |
| 2864 | |
| 2865 | // 1-particle: |
| 2866 | Double_t cosP1n = 0.; // <<cos(n*(phi1))>> |
| 2867 | |
| 2868 | if(dMult>0) |
| 2869 | { |
| 2870 | cosP1n = dReQ1n/dMult; |
| 2871 | |
| 2872 | fQCorrectionsCos->Fill(0.,cosP1n,dMult); |
| 2873 | } |
| 2874 | |
| 2875 | // 2-particle: |
| 2876 | Double_t cosP1nP1n = 0.; // <<cos(n*(phi1+phi2))>> |
| 2877 | |
| 2878 | if(dMult>1) |
| 2879 | { |
| 2880 | cosP1nP1n = (pow(dReQ1n,2)-pow(dImQ1n,2)-dReQ2n)/(dMult*(dMult-1)); |
| 2881 | |
| 2882 | fQCorrectionsCos->Fill(1.,cosP1nP1n,dMult*(dMult-1)); |
| 2883 | } |
| 2884 | |
| 2885 | // 3-particle: |
| 2886 | Double_t cosP1nM1nM1n = 0.; // <<cos(n*(phi1-phi2-phi3))>> |
| 2887 | |
| 2888 | if(dMult>2) |
| 2889 | { |
| 2890 | cosP1nM1nM1n = ( dReQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2)) - dReQ1n*dReQ2n - dImQ1n*dImQ2n - 2.*(dMult-1)*dReQ1n ) /(dMult*(dMult-1)*(dMult-2)); |
| 2891 | |
| 2892 | fQCorrectionsCos->Fill(2.,cosP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); |
| 2893 | } |
| 2894 | |
| 2bdc5281 |
2895 | } // end of AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNonUniformAcceptanceForNoNameIntegratedFlowCosTerms() |
| c365fe76 |
2896 | |
| 2897 | |
| 2898 | //================================================================================================================================ |
| 2899 | |
| 2900 | |
| 2bdc5281 |
2901 | void AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNonUniformAcceptanceForNoNameIntegratedFlowSinTerms() |
| c365fe76 |
2902 | { |
| 2bdc5281 |
2903 | // calculate corrections for non-uniform acceptance of the detector for no-name integrated flow (sin terms) |
| c365fe76 |
2904 | |
| 2905 | // multiplicity: |
| 2906 | Double_t dMult = (*fSMpk)(0,0); |
| 2907 | |
| 2908 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: |
| 2909 | Double_t dReQ1n = (*fReQ)(0,0); |
| 2910 | Double_t dReQ2n = (*fReQ)(1,0); |
| 2911 | //Double_t dReQ3n = (*fReQ)(2,0); |
| 2912 | //Double_t dReQ4n = (*fReQ)(3,0); |
| 2913 | Double_t dImQ1n = (*fImQ)(0,0); |
| 2914 | Double_t dImQ2n = (*fImQ)(1,0); |
| 2915 | //Double_t dImQ3n = (*fImQ)(2,0); |
| 2916 | //Double_t dImQ4n = (*fImQ)(3,0); |
| 2917 | |
| 2918 | // ************************************************************* |
| 2919 | // **** corrections for non-uniform acceptance (sin terms): **** |
| 2920 | // ************************************************************* |
| 2921 | // |
| 2922 | // Remark 1: corrections for non-uniform acceptance (sin terms) calculated with non-weighted Q-vectors |
| 2923 | // are stored in 1D profile fQCorrectionsSin. |
| 2924 | // Remark 2: binning of fQCorrectionsSin is organized as follows: |
| 2925 | // -------------------------------------------------------------------------------------------------------------------- |
| 2926 | // 1st bin: <<sin(n*(phi1))>> = sinP1n |
| 2927 | // 2nd bin: <<sin(n*(phi1+phi2))>> = sinP1nP1n |
| 2928 | // 3rd bin: <<sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1n |
| 2929 | // ... |
| 2930 | // -------------------------------------------------------------------------------------------------------------------- |
| 2931 | |
| 2932 | // 1-particle: |
| 2933 | Double_t sinP1n = 0.; // <sin(n*(phi1))> |
| 2934 | |
| 2935 | if(dMult>0) |
| 2936 | { |
| 2937 | sinP1n = dImQ1n/dMult; |
| 2938 | |
| 2939 | fQCorrectionsSin->Fill(0.,sinP1n,dMult); |
| 2940 | } |
| 2941 | |
| 2942 | // 2-particle: |
| 2943 | Double_t sinP1nP1n = 0.; // <<sin(n*(phi1+phi2))>> |
| 2944 | |
| 2945 | if(dMult>1) |
| 2946 | { |
| 2947 | sinP1nP1n = (2.*dReQ1n*dImQ1n-dImQ2n)/(dMult*(dMult-1)); |
| 2948 | |
| 2949 | fQCorrectionsSin->Fill(1.,sinP1nP1n,dMult*(dMult-1)); |
| 2950 | } |
| 2951 | |
| 2952 | // 3-particle: |
| 2953 | Double_t sinP1nM1nM1n = 0.; // <<sin(n*(phi1-phi2-phi3))>> |
| 2954 | |
| 2955 | if(dMult>2) |
| 2956 | { |
| 2957 | sinP1nM1nM1n = ( -dImQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2)) + dReQ1n*dImQ2n - dImQ1n*dReQ2n + 2.*(dMult-1)*dImQ1n ) /(dMult*(dMult-1)*(dMult-2)); |
| 2958 | |
| 2959 | fQCorrectionsSin->Fill(2.,sinP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); |
| 2960 | } |
| 2961 | |
| 2bdc5281 |
2962 | } // end of AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNonUniformAcceptanceForNoNameIntegratedFlowSinTerms() |
| 2963 | |
| 2964 | |
| 2965 | //================================================================================================================================ |
| 2966 | |
| 2967 | |
| 2968 | void AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNonUniformAcceptanceForDifferentialFlowCosTerms(TString type) |
| 2969 | { |
| 2970 | // calculate corrections for non-uniform acceptance of the detector for differential flow (cos terms) |
| 2971 | |
| 2972 | // pt and eta bin width: |
| 2973 | Double_t dBinWidthPt = 0.; // to be improved (should I promote this variable to data members?) |
| 2974 | Double_t dBinWidthEta = 0.; // to be improved (should I promote this variable to data members?) |
| 2975 | |
| 2976 | if(fnBinsPt) dBinWidthPt=(fPtMax-fPtMin)/fnBinsPt; |
| 2977 | if(fnBinsEta) dBinWidthEta=(fEtaMax-fEtaMin)/fnBinsEta; |
| 2978 | |
| 2979 | // multiplicity: |
| 2980 | //Double_t dMult = (*fSMpk)(0,0); |
| 2981 | |
| 2982 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: |
| 2983 | //Double_t dReQ1n = (*fReQ)(0,0); |
| 2984 | //Double_t dReQ2n = (*fReQ)(1,0); |
| 2985 | //Double_t dReQ3n = (*fReQ)(2,0); |
| 2986 | //Double_t dReQ4n = (*fReQ)(3,0); |
| 2987 | //Double_t dImQ1n = (*fImQ)(0,0); |
| 2988 | //Double_t dImQ2n = (*fImQ)(1,0); |
| 2989 | //Double_t dImQ3n = (*fImQ)(2,0); |
| 2990 | //Double_t dImQ4n = (*fImQ)(3,0); |
| 2991 | |
| 2992 | // looping over all (pt,eta) bins and calculating correlations needed for differential flow: |
| 2993 | for(Int_t p=1;p<=fnBinsPt;p++) |
| 2994 | { |
| 2995 | for(Int_t e=1;e<=fnBinsEta;e++) |
| 2996 | { |
| 2997 | // real and imaginary parts of q_n (non-weighted Q-vector evaluated only for POIs in harmonic n for each (pt,eta) bin): |
| 2998 | Double_t dReqnPtEta = 0.; |
| 2999 | Double_t dImqnPtEta = 0.; |
| 3000 | |
| 3001 | // number of POIs in each (pt,eta) bin: |
| 3002 | Double_t dmPtEta = 0.; |
| 3003 | |
| 3004 | // real and imaginary parts of q''_{n}, q''_{2n}, ... |
| 3005 | // (non-weighted Q-vectors evaluated only for particles which are both RPs and POIs in harmonic n, 2n, ... for each (pt,eta) bin): |
| 3006 | //Double_t dReqPrimePrime1nPtEta = 0.; |
| 3007 | //Double_t dImqPrimePrime1nPtEta = 0.; |
| 3008 | //Double_t dReqPrimePrime2nPtEta = 0.; |
| 3009 | //Double_t dImqPrimePrime2nPtEta = 0.; |
| 3010 | |
| 3011 | // number of particles which are both RPs and POIs in each (pt,eta) bin: |
| 3012 | //Double_t dmPrimePrimePtEta = 0.; |
| 3013 | |
| 3014 | if(type == "POI") |
| 3015 | { |
| 3016 | // q''_{n}, q''_{2n}: |
| 3017 | //............................................................................................... |
| 3018 | //dReqPrimePrime1nPtEta = fReqPrimePrime1nPtEta->GetBinContent(fReqPrimePrime1nPtEta->GetBin(p,e)); |
| 3019 | //dImqPrimePrime1nPtEta = fImqPrimePrime1nPtEta->GetBinContent(fImqPrimePrime1nPtEta->GetBin(p,e)); |
| 3020 | //dReqPrimePrime2nPtEta = fReqPrimePrime2nPtEta->GetBinContent(fReqPrimePrime2nPtEta->GetBin(p,e)); |
| 3021 | //dImqPrimePrime2nPtEta = fImqPrimePrime2nPtEta->GetBinContent(fImqPrimePrime2nPtEta->GetBin(p,e)); |
| 3022 | //............................................................................................... |
| 3023 | |
| 3024 | // m'': |
| 3025 | //dmPrimePrimePtEta = fmPrimePrimePtEta->GetBinContent(fmPrimePrimePtEta->GetBin(p,e)); |
| 3026 | |
| 3027 | // q'_{n}: |
| 3028 | dReqnPtEta = fReqnPtEta->GetBinContent(fReqnPtEta->GetBin(p,e)); |
| 3029 | dImqnPtEta = fImqnPtEta->GetBinContent(fImqnPtEta->GetBin(p,e)); |
| 3030 | dmPtEta = fmPtEta->GetBinContent(fmPtEta->GetBin(p,e)); |
| 3031 | } |
| 3032 | else if(type == "RP") |
| 3033 | { |
| 3034 | // q_RP{n}, q_RP{2n}: |
| 3035 | //............................................................................................... |
| 3036 | //dReqPrimePrime1nPtEta = fReqRP1nPtEta->GetBinContent(fReqRP1nPtEta->GetBin(p,e)); |
| 3037 | //dImqPrimePrime1nPtEta = fImqRP1nPtEta->GetBinContent(fImqRP1nPtEta->GetBin(p,e)); |
| 3038 | //dReqPrimePrime2nPtEta = fReqRP2nPtEta->GetBinContent(fReqRP2nPtEta->GetBin(p,e)); |
| 3039 | //dImqPrimePrime2nPtEta = fImqRP2nPtEta->GetBinContent(fImqRP2nPtEta->GetBin(p,e)); |
| 3040 | //............................................................................................... |
| 3041 | |
| 3042 | // m'': |
| 3043 | //dmPrimePrimePtEta = fmRPPtEta->GetBinContent(fmRPPtEta->GetBin(p,e)); |
| 3044 | |
| 3045 | dReqnPtEta = fReqRP1nPtEta->GetBinContent(fReqRP1nPtEta->GetBin(p,e)); // not a bug ;-) |
| 3046 | dImqnPtEta = fImqRP1nPtEta->GetBinContent(fImqRP1nPtEta->GetBin(p,e)); // not a bug ;-) |
| 3047 | dmPtEta = fmRPPtEta->GetBinContent(fmRPPtEta->GetBin(p,e)); // not a bug ;-) |
| 3048 | } |
| 3049 | |
| 3050 | // 1'-p correction: |
| 3051 | Double_t oneCosP1nPsiPtEta = 0.; |
| 3052 | |
| 3053 | if(dmPtEta) |
| 3054 | { |
| 3055 | oneCosP1nPsiPtEta = dReqnPtEta/dmPtEta; |
| 3056 | |
| 3057 | // fill the 2D profile to get the average 1'-p correction for each (pt, eta) bin: |
| 3058 | if(type == "POI") |
| 3059 | { |
| 3060 | fCorrectionsCosP1nPsiPtEtaPOI->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta, |
| 3061 | oneCosP1nPsiPtEta,dmPtEta); |
| 3062 | } |
| 3063 | else if(type == "RP") |
| 3064 | { |
| 3065 | fCorrectionsCosP1nPsiPtEtaRP->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta, |
| 3066 | oneCosP1nPsiPtEta,dmPtEta); |
| 3067 | } |
| 3068 | } // end of if(dmPtEta*dMult-dmPrimePrimePtEta) |
| 3069 | |
| 3070 | /* |
| 3071 | |
| 3072 | // 4'-particle correlation: |
| 3073 | Double_t four1n1n1n1nPtEta = 0.; |
| 3074 | if((dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 3075 | + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression) |
| 3076 | { |
| 3077 | four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(dReqnPtEta*dReQ1n+dImqnPtEta*dImQ1n) |
| 3078 | - dReqPrimePrime2nPtEta*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) |
| 3079 | - 2.*dImqPrimePrime2nPtEta*dReQ1n*dImQ1n |
| 3080 | - dReqnPtEta*(dReQ1n*dReQ2n+dImQ1n*dImQ2n) |
| 3081 | + dImqnPtEta*(dImQ1n*dReQ2n-dReQ1n*dImQ2n) |
| 3082 | - 2.*dMult*(dReqnPtEta*dReQ1n+dImqnPtEta*dImQ1n) |
| 3083 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*dmPrimePrimePtEta |
| 3084 | + 6.*(dReqPrimePrime1nPtEta*dReQ1n+dImqPrimePrime1nPtEta*dImQ1n) |
| 3085 | + 1.*(dReqPrimePrime2nPtEta*dReQ2n+dImqPrimePrime2nPtEta*dImQ2n) |
| 3086 | + 2.*(dReqnPtEta*dReQ1n+dImqnPtEta*dImQ1n) |
| 3087 | + 2.*dmPrimePrimePtEta*dMult |
| 3088 | - 6.*dmPrimePrimePtEta) |
| 3089 | / ((dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 3090 | + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 3091 | |
| 3092 | // fill the 2D profile to get the average correlation for each (pt, eta) bin: |
| 3093 | if(type == "POI") |
| 3094 | { |
| 3095 | f4pPtEtaPOI->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta,four1n1n1n1nPtEta, |
| 3096 | (dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 3097 | + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 3098 | } |
| 3099 | else if(type == "RP") |
| 3100 | { |
| 3101 | f4pPtEtaRP->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta,four1n1n1n1nPtEta, |
| 3102 | (dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 3103 | + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 3104 | } |
| 3105 | } // end of if((dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 3106 | // +dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 3107 | |
| 3108 | */ |
| 3109 | |
| 3110 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) |
| 3111 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
| 3112 | |
| 3113 | } // end of AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNonUniformAcceptanceForDifferentialFlowCosTerms(TString type) |
| 3114 | |
| 3115 | |
| 3116 | //================================================================================================================================ |
| 3117 | |
| 3118 | |
| 3119 | void AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNonUniformAcceptanceForDifferentialFlowSinTerms(TString type) |
| 3120 | { |
| 3121 | // calculate corrections for non-uniform acceptance of the detector for differential flow (sin terms) |
| 3122 | |
| 3123 | // pt and eta bin width: |
| 3124 | Double_t dBinWidthPt = 0.; // to be improved (should I promote this variable to data members?) |
| 3125 | Double_t dBinWidthEta = 0.; // to be improved (should I promote this variable to data members?) |
| 3126 | |
| 3127 | if(fnBinsPt) dBinWidthPt=(fPtMax-fPtMin)/fnBinsPt; |
| 3128 | if(fnBinsEta) dBinWidthEta=(fEtaMax-fEtaMin)/fnBinsEta; |
| 3129 | |
| 3130 | // multiplicity: |
| 3131 | //Double_t dMult = (*fSMpk)(0,0); |
| 3132 | |
| 3133 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: |
| 3134 | //Double_t dReQ1n = (*fReQ)(0,0); |
| 3135 | //Double_t dReQ2n = (*fReQ)(1,0); |
| 3136 | //Double_t dReQ3n = (*fReQ)(2,0); |
| 3137 | //Double_t dReQ4n = (*fReQ)(3,0); |
| 3138 | //Double_t dImQ1n = (*fImQ)(0,0); |
| 3139 | //Double_t dImQ2n = (*fImQ)(1,0); |
| 3140 | //Double_t dImQ3n = (*fImQ)(2,0); |
| 3141 | //Double_t dImQ4n = (*fImQ)(3,0); |
| 3142 | |
| 3143 | // looping over all (pt,eta) bins and calculating correlations needed for differential flow: |
| 3144 | for(Int_t p=1;p<=fnBinsPt;p++) |
| 3145 | { |
| 3146 | for(Int_t e=1;e<=fnBinsEta;e++) |
| 3147 | { |
| 3148 | // real and imaginary parts of q_n (non-weighted Q-vector evaluated only for POIs in harmonic n for each (pt,eta) bin): |
| 3149 | Double_t dReqnPtEta = 0.; |
| 3150 | Double_t dImqnPtEta = 0.; |
| 3151 | |
| 3152 | // number of POIs in each (pt,eta) bin: |
| 3153 | Double_t dmPtEta = 0.; |
| 3154 | |
| 3155 | // real and imaginary parts of q''_{n}, q''_{2n}, ... |
| 3156 | // (non-weighted Q-vectors evaluated only for particles which are both RPs and POIs in harmonic n, 2n, ... for each (pt,eta) bin): |
| 3157 | //Double_t dReqPrimePrime1nPtEta = 0.; |
| 3158 | //Double_t dImqPrimePrime1nPtEta = 0.; |
| 3159 | //Double_t dReqPrimePrime2nPtEta = 0.; |
| 3160 | //Double_t dImqPrimePrime2nPtEta = 0.; |
| 3161 | |
| 3162 | // number of particles which are both RPs and POIs in each (pt,eta) bin: |
| 3163 | //Double_t dmPrimePrimePtEta = 0.; |
| 3164 | |
| 3165 | if(type == "POI") |
| 3166 | { |
| 3167 | // q''_{n}, q''_{2n}: |
| 3168 | //............................................................................................... |
| 3169 | //dReqPrimePrime1nPtEta = fReqPrimePrime1nPtEta->GetBinContent(fReqPrimePrime1nPtEta->GetBin(p,e)); |
| 3170 | //dImqPrimePrime1nPtEta = fImqPrimePrime1nPtEta->GetBinContent(fImqPrimePrime1nPtEta->GetBin(p,e)); |
| 3171 | //dReqPrimePrime2nPtEta = fReqPrimePrime2nPtEta->GetBinContent(fReqPrimePrime2nPtEta->GetBin(p,e)); |
| 3172 | //dImqPrimePrime2nPtEta = fImqPrimePrime2nPtEta->GetBinContent(fImqPrimePrime2nPtEta->GetBin(p,e)); |
| 3173 | //............................................................................................... |
| 3174 | |
| 3175 | // m'': |
| 3176 | //dmPrimePrimePtEta = fmPrimePrimePtEta->GetBinContent(fmPrimePrimePtEta->GetBin(p,e)); |
| 3177 | |
| 3178 | // q'_{n}: |
| 3179 | dReqnPtEta = fReqnPtEta->GetBinContent(fReqnPtEta->GetBin(p,e)); |
| 3180 | dImqnPtEta = fImqnPtEta->GetBinContent(fImqnPtEta->GetBin(p,e)); |
| 3181 | dmPtEta = fmPtEta->GetBinContent(fmPtEta->GetBin(p,e)); |
| 3182 | } |
| 3183 | else if(type == "RP") |
| 3184 | { |
| 3185 | // q_RP{n}, q_RP{2n}: |
| 3186 | //............................................................................................... |
| 3187 | //dReqPrimePrime1nPtEta = fReqRP1nPtEta->GetBinContent(fReqRP1nPtEta->GetBin(p,e)); |
| 3188 | //dImqPrimePrime1nPtEta = fImqRP1nPtEta->GetBinContent(fImqRP1nPtEta->GetBin(p,e)); |
| 3189 | //dReqPrimePrime2nPtEta = fReqRP2nPtEta->GetBinContent(fReqRP2nPtEta->GetBin(p,e)); |
| 3190 | //dImqPrimePrime2nPtEta = fImqRP2nPtEta->GetBinContent(fImqRP2nPtEta->GetBin(p,e)); |
| 3191 | //............................................................................................... |
| 3192 | |
| 3193 | // m'': |
| 3194 | //dmPrimePrimePtEta = fmRPPtEta->GetBinContent(fmRPPtEta->GetBin(p,e)); |
| 3195 | |
| 3196 | dReqnPtEta = fReqRP1nPtEta->GetBinContent(fReqRP1nPtEta->GetBin(p,e)); // not a bug ;-) |
| 3197 | dImqnPtEta = fImqRP1nPtEta->GetBinContent(fImqRP1nPtEta->GetBin(p,e)); // not a bug ;-) |
| 3198 | dmPtEta = fmRPPtEta->GetBinContent(fmRPPtEta->GetBin(p,e)); // not a bug ;-) |
| 3199 | } |
| 3200 | |
| 3201 | // 1'-p correction: |
| 3202 | Double_t oneSinP1nPsiPtEta = 0.; |
| 3203 | |
| 3204 | if(dmPtEta) |
| 3205 | { |
| 3206 | oneSinP1nPsiPtEta = dImqnPtEta/dmPtEta; |
| 3207 | |
| 3208 | // fill the 2D profile to get the average 1'-p correction for each (pt, eta) bin: |
| 3209 | if(type == "POI") |
| 3210 | { |
| 3211 | fCorrectionsSinP1nPsiPtEtaPOI->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta, |
| 3212 | oneSinP1nPsiPtEta,dmPtEta); |
| 3213 | } |
| 3214 | else if(type == "RP") |
| 3215 | { |
| 3216 | fCorrectionsSinP1nPsiPtEtaRP->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta, |
| 3217 | oneSinP1nPsiPtEta,dmPtEta); |
| 3218 | } |
| 3219 | } // end of if(dmPtEta*dMult-dmPrimePrimePtEta) |
| 3220 | |
| 3221 | /* |
| 3222 | |
| 3223 | // 4'-particle correlation: |
| 3224 | Double_t four1n1n1n1nPtEta = 0.; |
| 3225 | if((dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 3226 | + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression) |
| 3227 | { |
| 3228 | four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(dReqnPtEta*dReQ1n+dImqnPtEta*dImQ1n) |
| 3229 | - dReqPrimePrime2nPtEta*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) |
| 3230 | - 2.*dImqPrimePrime2nPtEta*dReQ1n*dImQ1n |
| 3231 | - dReqnPtEta*(dReQ1n*dReQ2n+dImQ1n*dImQ2n) |
| 3232 | + dImqnPtEta*(dImQ1n*dReQ2n-dReQ1n*dImQ2n) |
| 3233 | - 2.*dMult*(dReqnPtEta*dReQ1n+dImqnPtEta*dImQ1n) |
| 3234 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*dmPrimePrimePtEta |
| 3235 | + 6.*(dReqPrimePrime1nPtEta*dReQ1n+dImqPrimePrime1nPtEta*dImQ1n) |
| 3236 | + 1.*(dReqPrimePrime2nPtEta*dReQ2n+dImqPrimePrime2nPtEta*dImQ2n) |
| 3237 | + 2.*(dReqnPtEta*dReQ1n+dImqnPtEta*dImQ1n) |
| 3238 | + 2.*dmPrimePrimePtEta*dMult |
| 3239 | - 6.*dmPrimePrimePtEta) |
| 3240 | / ((dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 3241 | + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 3242 | |
| 3243 | // fill the 2D profile to get the average correlation for each (pt, eta) bin: |
| 3244 | if(type == "POI") |
| 3245 | { |
| 3246 | f4pPtEtaPOI->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta,four1n1n1n1nPtEta, |
| 3247 | (dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 3248 | + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 3249 | } |
| 3250 | else if(type == "RP") |
| 3251 | { |
| 3252 | f4pPtEtaRP->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta,four1n1n1n1nPtEta, |
| 3253 | (dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 3254 | + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 3255 | } |
| 3256 | } // end of if((dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 3257 | // +dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 3258 | |
| 3259 | */ |
| 3260 | |
| 3261 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) |
| 3262 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
| 3263 | |
| 3264 | } // end of AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNonUniformAcceptanceForDifferentialFlowSinTerms(TString type) |
| c365fe76 |
3265 | |
| 3266 | |
| 3267 | //================================================================================================================================ |
| 3268 | |
| 3269 | |
| 9c1a9547 |
3270 | void AliFlowAnalysisWithQCumulants::EvaluateNestedLoopsForIntegratedFlow(AliFlowEventSimple* anEvent) |
| 3271 | { |
| 3272 | // evaluate the nested loops relevant for integrated flow (needed for cross-checking the results) |
| 3d824203 |
3273 | |
| 9c1a9547 |
3274 | Int_t nPrim = anEvent->NumberOfTracks(); |
| dee1e0e0 |
3275 | |
| 9c1a9547 |
3276 | TH1F *phiWeights = NULL; // histogram with phi weights |
| 3277 | Int_t nBinsPhi = 0; |
| 3d824203 |
3278 | |
| 9c1a9547 |
3279 | if(fUsePhiWeights) |
| 3280 | { |
| 3281 | if(!fWeightsList) |
| 3282 | { |
| 3283 | cout<<" WARNING: fWeightsList is NULL pointer in AFAWQC::ENLFIF(). "<<endl; |
| 3284 | exit(0); |
| 3285 | } |
| 3286 | phiWeights = dynamic_cast<TH1F *>(fWeightsList->FindObject("phi_weights")); |
| 3287 | if(!phiWeights) |
| 3288 | { |
| 3289 | cout<<" WARNING: couldn't access the histogram with phi weights in AFAWQC::ENLFIF(). "<<endl; |
| 3290 | exit(0); |
| 3291 | } |
| 3292 | nBinsPhi = phiWeights->GetNbinsX(); |
| 3293 | } |
| 77515452 |
3294 | |
| 9c1a9547 |
3295 | Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; |
| 3296 | Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; |
| 77515452 |
3297 | |
| 9c1a9547 |
3298 | Int_t n=2; // to be improved |
| 77515452 |
3299 | |
| 9c1a9547 |
3300 | // ****************************************** |
| 3301 | // **** NESTED LOOPS FOR INTEGRATED FLOW **** |
| 3302 | // ****************************************** |
| 3303 | // |
| 3304 | // Remark 1: multi-particle correlations calculated with nested loops without weights are stored in 1D profile fDirectCorrelations; |
| 3305 | // Remark 2: multi-particle correlations calculated with nested loops with weights are stored in 1D profile fDirectCorrelationsW; |
| 3306 | |
| 3307 | // Remark 3: binning of fDirectCorrelations is organized as follows: |
| 3308 | // -------------------------------------------------------------------------------------------------------------------- |
| 3309 | // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))> |
| 3310 | // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))> |
| 3311 | // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))> |
| 3312 | // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))> |
| 3313 | // 5th bin: ---- EMPTY ---- |
| 3314 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))> |
| 3315 | // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))> |
| 3316 | // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))> |
| 3317 | // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))> |
| 3318 | // 10th bin: ---- EMPTY ---- |
| 3319 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))> |
| 3320 | // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))> |
| 3321 | // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))> |
| 3322 | // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))> |
| 3323 | // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))> |
| 3324 | // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))> |
| 3325 | // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> |
| 3326 | // 18th bin: ---- EMPTY ---- |
| 3327 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))> |
| 3328 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))> |
| 3329 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))> |
| 3330 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))> |
| 3331 | // 23rd bin: ---- EMPTY ---- |
| 3332 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> |
| 3333 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))> |
| 3334 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))> |
| 3335 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))> |
| 3336 | // 28th bin: ---- EMPTY ---- |
| 3337 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> |
| 3338 | // 30th bin: ---- EMPTY ---- |
| 3339 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> |
| 3340 | // -------------------------------------------------------------------------------------------------------------------- |
| 3341 | |
| 3342 | // Remark 4: binning of fDirectCorrelationsW is organized as follows: |
| 3343 | //.............................................................................................. |
| 3344 | // ---- bins 1-20: 2-particle correlations ---- |
| 3345 | // 1st bin: two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))> |
| 3346 | // 2nd bin: two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))> |
| 3347 | // 3rd bin: two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> |
| 3348 | // 4th bin: two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))> |
| 3349 | // 5th bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))> |
| 3350 | // 6th bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> |
| 3351 | // ---- bins 21-40: 3-particle correlations ---- |
| 3352 | // 21st bin: three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> |
| 3353 | // ---- bins 41-60: 4-particle correlations ---- |
| 3354 | // 41st bin: four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> |
| 3355 | // ---- bins 61-80: 5-particle correlations ---- |
| 3356 | // ---- bins 81-100: 6-particle correlations ---- |
| 3357 | // ---- bins 101-120: 7-particle correlations ---- |
| 3358 | // ---- bins 121-140: 8-particle correlations ---- |
| 3359 | //.............................................................................................. |
| 77515452 |
3360 | |
| c365fe76 |
3361 | // Remark 5: corrections for non-uniform acceptance (cos terms) calculated with nested loops are stored |
| 3362 | // in 1D profile fDirectCorrectionsCos (binning is the same as in fQCorrectionsCos - see above); |
| 3363 | // Remark 6: corrections for non-uniform acceptance (sin terms) calculated with nested loops are stored |
| 3364 | // in 1D profile fDirectCorrectionsSin (binning is the same as in fQCorrectionsSin - see above); |
| 77515452 |
3365 | |
| 9c1a9547 |
3366 | // 2-particle correlations: |
| 3367 | for(Int_t i1=0;i1<nPrim;i1++) |
| bc92c0cb |
3368 | { |
| dee1e0e0 |
3369 | fTrack=anEvent->GetTrack(i1); |
| 9c1a9547 |
3370 | if(!(fTrack->InRPSelection())) continue; |
| bc92c0cb |
3371 | phi1=fTrack->Phi(); |
| 3d824203 |
3372 | if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi()))); |
| c365fe76 |
3373 | // corrections for non-uniform acceptance (cos terms) |
| 3374 | fDirectCorrectionsCos->Fill(0.,cos(n*phi1),1.); // <cos(n*phi1)> |
| 3375 | // corrections for non-uniform acceptance (sin terms) |
| 3376 | fDirectCorrectionsSin->Fill(0.,sin(n*phi1),1.); // <sin(n*phi1)> |
| 9c1a9547 |
3377 | for(Int_t i2=0;i2<nPrim;i2++) |
| bc92c0cb |
3378 | { |
| dee1e0e0 |
3379 | if(i2==i1)continue; |
| 3380 | fTrack=anEvent->GetTrack(i2); |
| 9c1a9547 |
3381 | if(!(fTrack->InRPSelection())) continue; |
| bc92c0cb |
3382 | phi2=fTrack->Phi(); |
| 3d824203 |
3383 | if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3384 | |
| 3385 | // non-weighted: |
| 3386 | //------------------------------------------------------------------------------ |
| 3387 | fDirectCorrelations->Fill(0.,cos(n*(phi1-phi2)),1.); // <cos(n*(phi1-phi2))> |
| 3388 | fDirectCorrelations->Fill(1.,cos(2.*n*(phi1-phi2)),1.); // <cos(2n*(phi1-phi2))> |
| 3389 | fDirectCorrelations->Fill(2.,cos(3.*n*(phi1-phi2)),1.); // <cos(3n*(phi1-phi2))> |
| 3390 | fDirectCorrelations->Fill(3.,cos(4.*n*(phi1-phi2)),1.); // <cos(4n*(phi1-phi2))> |
| 3391 | //------------------------------------------------------------------------------ |
| 3392 | |
| 3393 | // weighted: |
| 3394 | //................................................................................................................ |
| 3395 | fDirectCorrelationsW->Fill(0.,cos(n*(phi1-phi2)),wPhi1*wPhi2); // <w1 w2 cos( n*(phi1-phi2))> |
| 3396 | fDirectCorrelationsW->Fill(1.,cos(2.*n*(phi1-phi2)),pow(wPhi1,2)*pow(wPhi2,2)); // <w1^2 w2^2 cos(2n*(phi1-phi2))> |
| 3397 | fDirectCorrelationsW->Fill(2.,cos(3.*n*(phi1-phi2)),pow(wPhi1,3)*pow(wPhi2,3)); // <w1^3 w2^3 cos(3n*(phi1-phi2))> |
| 3398 | fDirectCorrelationsW->Fill(3.,cos(4.*n*(phi1-phi2)),pow(wPhi1,4)*pow(wPhi2,4)); // <w1^4 w2^4 cos(4n*(phi1-phi2))> |
| 3399 | fDirectCorrelationsW->Fill(4.,cos(n*(phi1-phi2)),pow(wPhi1,3)*wPhi2); // <w1^3 w2 cos(n*(phi1-phi2))> |
| 3400 | //................................................................................................................ |
| c365fe76 |
3401 | |
| 3402 | // corrections for non-uniform acceptance (cos terms) |
| 3403 | //................................................................................................................ |
| 3404 | fDirectCorrectionsCos->Fill(1.,cos(n*(phi1+phi2)),1.); // <<cos(n*(phi1+phi2))>> |
| 3405 | //................................................................................................................ |
| 3406 | |
| 3407 | // corrections for non-uniform acceptance (sin terms) |
| 3408 | //................................................................................................................ |
| 3409 | fDirectCorrectionsSin->Fill(1.,sin(n*(phi1+phi2)),1.); // <<sin(n*(phi1+phi2))>> |
| 3410 | //................................................................................................................ |
| 3411 | |
| bc92c0cb |
3412 | } |
| 3413 | } |
| c365fe76 |
3414 | |
| 9c1a9547 |
3415 | // 3-particle correlations: |
| 3416 | for(Int_t i1=0;i1<nPrim;i1++) |
| bc92c0cb |
3417 | { |
| dee1e0e0 |
3418 | fTrack=anEvent->GetTrack(i1); |
| 9c1a9547 |
3419 | if(!(fTrack->InRPSelection())) continue; |
| bc92c0cb |
3420 | phi1=fTrack->Phi(); |
| 3d824203 |
3421 | if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3422 | for(Int_t i2=0;i2<nPrim;i2++) |
| bc92c0cb |
3423 | { |
| dee1e0e0 |
3424 | if(i2==i1)continue; |
| 3425 | fTrack=anEvent->GetTrack(i2); |
| 9c1a9547 |
3426 | if(!(fTrack->InRPSelection())) continue; |
| bc92c0cb |
3427 | phi2=fTrack->Phi(); |
| 3d824203 |
3428 | if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3429 | for(Int_t i3=0;i3<nPrim;i3++) |
| bc92c0cb |
3430 | { |
| dee1e0e0 |
3431 | if(i3==i1||i3==i2)continue; |
| 3432 | fTrack=anEvent->GetTrack(i3); |
| 9c1a9547 |
3433 | if(!(fTrack->InRPSelection())) continue; |
| bc92c0cb |
3434 | phi3=fTrack->Phi(); |
| 3d824203 |
3435 | if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi()))); |
| 3d824203 |
3436 | |
| 9c1a9547 |
3437 | // non-weighted: |
| 3438 | //----------------------------------------------------------------------------------- |
| 3439 | fDirectCorrelations->Fill(5.,cos(2.*n*phi1-n*(phi2+phi3)),1.); //<3>_{2n|nn,n} |
| 3440 | fDirectCorrelations->Fill(6.,cos(3.*n*phi1-2.*n*phi2-n*phi3),1.); //<3>_{3n|2n,n} |
| 3441 | fDirectCorrelations->Fill(7.,cos(4.*n*phi1-2.*n*phi2-2.*n*phi3),1.); //<3>_{4n|2n,2n} |
| 3442 | fDirectCorrelations->Fill(8.,cos(4.*n*phi1-3.*n*phi2-n*phi3),1.); //<3>_{4n|3n,n} |
| 3443 | //----------------------------------------------------------------------------------- |
| 3d824203 |
3444 | |
| 9c1a9547 |
3445 | // weighted: |
| 3446 | //.............................................................................................................................. |
| 3447 | // 2-p: |
| 3448 | fDirectCorrelationsW->Fill(5.,cos(n*(phi1-phi2)),wPhi1*wPhi2*pow(wPhi3,2)); // <w1 w2 w3^2 cos(n*(phi1-phi2))> |
| 3d824203 |
3449 | |
| 9c1a9547 |
3450 | // 3-p: |
| 3451 | fDirectCorrelationsW->Fill(20.,cos(2.*n*phi1-n*(phi2+phi3)),pow(wPhi1,2)*wPhi2*wPhi3); // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> |
| 3452 | //.............................................................................................................................. |
| 3d824203 |
3453 | |
| c365fe76 |
3454 | |
| 3455 | // corrections for non-uniform acceptance (cos terms) |
| 3456 | //................................................................................................................ |
| 3457 | fDirectCorrectionsCos->Fill(2.,cos(n*(phi1-phi2-phi3)),1.); // <<cos(n*(phi1-phi2-phi3))>> |
| 3458 | //................................................................................................................ |
| 3459 | |
| 3460 | // corrections for non-uniform acceptance (sin terms) |
| 3461 | //................................................................................................................ |
| 3462 | fDirectCorrectionsSin->Fill(2.,sin(n*(phi1-phi2-phi3)),1.); // <<sin(n*(phi1-phi2-phi3))>> |
| 3463 | //................................................................................................................ |
| 3464 | |
| bc92c0cb |
3465 | } |
| 3466 | } |
| 3467 | } |
| 3d824203 |
3468 | |
| 9c1a9547 |
3469 | // 4-particle correlations: |
| 3470 | for(Int_t i1=0;i1<nPrim;i1++) |
| bc92c0cb |
3471 | { |
| dee1e0e0 |
3472 | fTrack=anEvent->GetTrack(i1); |
| 9c1a9547 |
3473 | if(!(fTrack->InRPSelection())) continue; |
| bc92c0cb |
3474 | phi1=fTrack->Phi(); |
| 3d824203 |
3475 | if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3476 | for(Int_t i2=0;i2<nPrim;i2++) |
| bc92c0cb |
3477 | { |
| dee1e0e0 |
3478 | if(i2==i1)continue; |
| 3479 | fTrack=anEvent->GetTrack(i2); |
| 9c1a9547 |
3480 | if(!(fTrack->InRPSelection())) continue; |
| bc92c0cb |
3481 | phi2=fTrack->Phi(); |
| 3d824203 |
3482 | if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3483 | for(Int_t i3=0;i3<nPrim;i3++) |
| bc92c0cb |
3484 | { |
| dee1e0e0 |
3485 | if(i3==i1||i3==i2)continue; |
| 3486 | fTrack=anEvent->GetTrack(i3); |
| 9c1a9547 |
3487 | if(!(fTrack->InRPSelection())) continue; |
| bc92c0cb |
3488 | phi3=fTrack->Phi(); |
| 3d824203 |
3489 | if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3490 | for(Int_t i4=0;i4<nPrim;i4++) |
| bc92c0cb |
3491 | { |
| dee1e0e0 |
3492 | if(i4==i1||i4==i2||i4==i3)continue; |
| 3493 | fTrack=anEvent->GetTrack(i4); |
| 9c1a9547 |
3494 | if(!(fTrack->InRPSelection())) continue; |
| bc92c0cb |
3495 | phi4=fTrack->Phi(); |
| 3d824203 |
3496 | if(phiWeights) wPhi4 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*nBinsPhi/TMath::TwoPi()))); |
| 3d824203 |
3497 | |
| 9c1a9547 |
3498 | // non-weighted: |
| 3499 | //------------------------------------------------------------------------------------------------- |
| 3500 | fDirectCorrelations->Fill(10.,cos(n*phi1+n*phi2-n*phi3-n*phi4),1.); // <4>_{n,n|n,n} |
| 3501 | fDirectCorrelations->Fill(11.,cos(2.*n*phi1+n*phi2-2.*n*phi3-n*phi4),1.); // <4>_{2n,n|2n,n} |
| 3502 | fDirectCorrelations->Fill(12.,cos(2.*n*phi1+2*n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{2n,2n|2n,2n} |
| 3503 | fDirectCorrelations->Fill(13.,cos(3.*n*phi1-n*phi2-n*phi3-n*phi4),1.); // <4>_{3n|n,n,n} |
| 3504 | fDirectCorrelations->Fill(14.,cos(3.*n*phi1+n*phi2-3.*n*phi3-n*phi4),1.); // <4>_{3n,n|3n,n} |
| 3505 | fDirectCorrelations->Fill(15.,cos(3.*n*phi1+n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{3n,n|2n,2n} |
| 3506 | fDirectCorrelations->Fill(16.,cos(4.*n*phi1-2.*n*phi2-n*phi3-n*phi4),1.); // <4>_{4n|2n,n,n} |
| 3507 | //------------------------------------------------------------------------------------------------- |
| 3508 | |
| 3509 | // weighted: |
| 3510 | //....................................................................................... |
| 3511 | // 4-p: |
| 3512 | fDirectCorrelationsW->Fill(40.,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); |
| 3513 | //....................................................................................... |
| 3514 | |
| bc92c0cb |
3515 | } |
| 3516 | } |
| 3517 | } |
| 3518 | } |
| 9c1a9547 |
3519 | |
| 3520 | // 5-particle correlations: |
| 3521 | for(Int_t i1=0;i1<nPrim;i1++) |
| bc92c0cb |
3522 | { |
| dee1e0e0 |
3523 | //cout<<"i1 = "<<i1<<endl; |
| 3524 | fTrack=anEvent->GetTrack(i1); |
| 9c1a9547 |
3525 | if(!(fTrack->InRPSelection())) continue; |
| bc92c0cb |
3526 | phi1=fTrack->Phi(); |
| 3d824203 |
3527 | if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3528 | for(Int_t i2=0;i2<nPrim;i2++) |
| bc92c0cb |
3529 | { |
| dee1e0e0 |
3530 | if(i2==i1)continue; |
| 3531 | fTrack=anEvent->GetTrack(i2); |
| 9c1a9547 |
3532 | if(!(fTrack->InRPSelection())) continue; |
| bc92c0cb |
3533 | phi2=fTrack->Phi(); |
| 3d824203 |
3534 | if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3535 | for(Int_t i3=0;i3<nPrim;i3++) |
| bc92c0cb |
3536 | { |
| dee1e0e0 |
3537 | if(i3==i1||i3==i2)continue; |
| 3538 | fTrack=anEvent->GetTrack(i3); |
| 9c1a9547 |
3539 | if(!(fTrack->InRPSelection())) continue; |
| bc92c0cb |
3540 | phi3=fTrack->Phi(); |
| 3d824203 |
3541 | if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3542 | for(Int_t i4=0;i4<nPrim;i4++) |
| bc92c0cb |
3543 | { |
| dee1e0e0 |
3544 | if(i4==i1||i4==i2||i4==i3)continue; |
| 3545 | fTrack=anEvent->GetTrack(i4); |
| 9c1a9547 |
3546 | if(!(fTrack->InRPSelection())) continue; |
| bc92c0cb |
3547 | phi4=fTrack->Phi(); |
| 3d824203 |
3548 | if(phiWeights) wPhi4 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3549 | for(Int_t i5=0;i5<nPrim;i5++) |
| bc92c0cb |
3550 | { |
| dee1e0e0 |
3551 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; |
| 3552 | fTrack=anEvent->GetTrack(i5); |
| 9c1a9547 |
3553 | if(!(fTrack->InRPSelection())) continue; |
| bc92c0cb |
3554 | phi5=fTrack->Phi(); |
| 3d824203 |
3555 | if(phiWeights) wPhi5 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi5*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3556 | |
| 3557 | // non-weighted: |
| 3558 | //------------------------------------------------------------------------------------------------------ |
| 3559 | fDirectCorrelations->Fill(18.,cos(2.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5),1.); //<5>_{2n,n|n,n,n} |
| 3560 | fDirectCorrelations->Fill(19.,cos(2.*n*phi1+2.*n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); //<5>_{2n,2n|2n,n,n} |
| 3561 | fDirectCorrelations->Fill(20.,cos(3.*n*phi1+n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); //<5>_{3n,n|2n,n,n} |
| 3562 | fDirectCorrelations->Fill(21.,cos(4.*n*phi1-n*phi2-n*phi3-n*phi4-n*phi5),1.); //<5>_{4n|n,n,n,n} |
| 3563 | //------------------------------------------------------------------------------------------------------ |
| 3564 | |
| 3565 | // weighted: |
| 3566 | //.............................................................................................................. |
| 3567 | // 5-p: |
| 3568 | fDirectCorrelationsW->Fill(60.,cos(2.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5),pow(wPhi1,2)*wPhi2*wPhi3*wPhi4*wPhi5); |
| 3569 | //.............................................................................................................. |
| 3570 | |
| bc92c0cb |
3571 | } |
| 3572 | } |
| 3573 | } |
| 3574 | } |
| 3575 | } |
| 3576 | |
| 9c1a9547 |
3577 | // 6-particle correlations: |
| 3578 | for(Int_t i1=0;i1<nPrim;i1++) |
| dee1e0e0 |
3579 | { |
| 3580 | //cout<<"i1 = "<<i1<<endl; |
| 3581 | fTrack=anEvent->GetTrack(i1); |
| 9c1a9547 |
3582 | if(!(fTrack->InRPSelection())) continue; |
| dee1e0e0 |
3583 | phi1=fTrack->Phi(); |
| 3d824203 |
3584 | if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3585 | for(Int_t i2=0;i2<nPrim;i2++) |
| dee1e0e0 |
3586 | { |
| 3587 | if(i2==i1)continue; |
| 3588 | fTrack=anEvent->GetTrack(i2); |
| 9c1a9547 |
3589 | if(!(fTrack->InRPSelection())) continue; |
| dee1e0e0 |
3590 | phi2=fTrack->Phi(); |
| 3d824203 |
3591 | if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3592 | for(Int_t i3=0;i3<nPrim;i3++) |
| dee1e0e0 |
3593 | { |
| 3594 | if(i3==i1||i3==i2)continue; |
| 3595 | fTrack=anEvent->GetTrack(i3); |
| 9c1a9547 |
3596 | if(!(fTrack->InRPSelection())) continue; |
| dee1e0e0 |
3597 | phi3=fTrack->Phi(); |
| 3d824203 |
3598 | if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3599 | for(Int_t i4=0;i4<nPrim;i4++) |
| dee1e0e0 |
3600 | { |
| 3601 | if(i4==i1||i4==i2||i4==i3)continue; |
| 3602 | fTrack=anEvent->GetTrack(i4); |
| 9c1a9547 |
3603 | if(!(fTrack->InRPSelection())) continue; |
| dee1e0e0 |
3604 | phi4=fTrack->Phi(); |
| 3d824203 |
3605 | if(phiWeights) wPhi4 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3606 | for(Int_t i5=0;i5<nPrim;i5++) |
| dee1e0e0 |
3607 | { |
| 3608 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; |
| 3609 | fTrack=anEvent->GetTrack(i5); |
| 9c1a9547 |
3610 | if(!(fTrack->InRPSelection())) continue; |
| dee1e0e0 |
3611 | phi5=fTrack->Phi(); |
| 3d824203 |
3612 | if(phiWeights) wPhi5 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi5*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3613 | for(Int_t i6=0;i6<nPrim;i6++) |
| dee1e0e0 |
3614 | { |
| 3615 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; |
| 3616 | fTrack=anEvent->GetTrack(i6); |
| 9c1a9547 |
3617 | if(!(fTrack->InRPSelection())) continue; |
| dee1e0e0 |
3618 | phi6=fTrack->Phi(); |
| 3d824203 |
3619 | if(phiWeights) wPhi6 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi6*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3620 | |
| 3621 | // non-weighted: |
| 3622 | //----------------------------------------------------------------------------------------------------------- |
| 3623 | fDirectCorrelations->Fill(23.,cos(n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{n,n,n|n,n,n} |
| 3624 | fDirectCorrelations->Fill(24.,cos(2.*n*phi1+n*phi2+n*phi3-2.*n*phi4-n*phi5-n*phi6),1.); //<6>_{2n,n,n|2n,n,n} |
| 3625 | fDirectCorrelations->Fill(25.,cos(2.*n*phi1+2.*n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{2n,2n|n,n,n,n} |
| 3626 | fDirectCorrelations->Fill(26.,cos(3.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{3n,n|n,n,n,n} |
| 3627 | //----------------------------------------------------------------------------------------------------------- |
| 3628 | |
| 3629 | // weighted: |
| 3630 | //................................................................................................................. |
| 3631 | // 6-p: |
| 3632 | fDirectCorrelationsW->Fill(80.,cos(n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6),wPhi1*wPhi2*wPhi3*wPhi4*wPhi5*wPhi6); |
| 3633 | //................................................................................................................. |
| 3634 | |
| dee1e0e0 |
3635 | } |
| 3636 | } |
| 3637 | } |
| 3638 | } |
| 3639 | } |
| 3640 | } |
| 3d824203 |
3641 | |
| 9c1a9547 |
3642 | // 7-particle correlations: |
| 3643 | for(Int_t i1=0;i1<nPrim;i1++) |
| bc92c0cb |
3644 | { |
| dee1e0e0 |
3645 | //cout<<"i1 = "<<i1<<endl; |
| 3646 | fTrack=anEvent->GetTrack(i1); |
| 9c1a9547 |
3647 | if(!(fTrack->InRPSelection())) continue; |
| bc92c0cb |
3648 | phi1=fTrack->Phi(); |
| 3d824203 |
3649 | if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3650 | for(Int_t i2=0;i2<nPrim;i2++) |
| bc92c0cb |
3651 | { |
| dee1e0e0 |
3652 | if(i2==i1)continue; |
| 3653 | fTrack=anEvent->GetTrack(i2); |
| 9c1a9547 |
3654 | if(!(fTrack->InRPSelection())) continue; |
| bc92c0cb |
3655 | phi2=fTrack->Phi(); |
| 3d824203 |
3656 | if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3657 | for(Int_t i3=0;i3<nPrim;i3++) |
| bc92c0cb |
3658 | { |
| dee1e0e0 |
3659 | if(i3==i1||i3==i2)continue; |
| 3660 | fTrack=anEvent->GetTrack(i3); |
| 9c1a9547 |
3661 | if(!(fTrack->InRPSelection())) continue; |
| bc92c0cb |
3662 | phi3=fTrack->Phi(); |
| 3d824203 |
3663 | if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3664 | for(Int_t i4=0;i4<nPrim;i4++) |
| bc92c0cb |
3665 | { |
| dee1e0e0 |
3666 | if(i4==i1||i4==i2||i4==i3)continue; |
| 3667 | fTrack=anEvent->GetTrack(i4); |
| 9c1a9547 |
3668 | if(!(fTrack->InRPSelection())) continue; |
| bc92c0cb |
3669 | phi4=fTrack->Phi(); |
| 3d824203 |
3670 | if(phiWeights) wPhi4 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3671 | for(Int_t i5=0;i5<nPrim;i5++) |
| bc92c0cb |
3672 | { |
| dee1e0e0 |
3673 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; |
| 3674 | fTrack=anEvent->GetTrack(i5); |
| 9c1a9547 |
3675 | if(!(fTrack->InRPSelection())) continue; |
| bc92c0cb |
3676 | phi5=fTrack->Phi(); |
| 3d824203 |
3677 | if(phiWeights) wPhi5 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi5*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3678 | for(Int_t i6=0;i6<nPrim;i6++) |
| bc92c0cb |
3679 | { |
| dee1e0e0 |
3680 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; |
| 3681 | fTrack=anEvent->GetTrack(i6); |
| 9c1a9547 |
3682 | if(!(fTrack->InRPSelection())) continue; |
| bc92c0cb |
3683 | phi6=fTrack->Phi(); |
| 3d824203 |
3684 | if(phiWeights) wPhi6 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi6*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3685 | for(Int_t i7=0;i7<nPrim;i7++) |
| dee1e0e0 |
3686 | { |
| 3687 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; |
| 3688 | fTrack=anEvent->GetTrack(i7); |
| 9c1a9547 |
3689 | if(!(fTrack->InRPSelection())) continue; |
| dee1e0e0 |
3690 | phi7=fTrack->Phi(); |
| 3d824203 |
3691 | if(phiWeights) wPhi7 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi7*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3692 | |
| 3693 | // non-weighted: |
| 3694 | //--------------------------------------------------------------------------------------------------------------- |
| 3695 | fDirectCorrelations->Fill(28.,cos(2.*n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6-n*phi7),1.);//<7>_{2n,n,n|n,n,n,n} |
| 3696 | //--------------------------------------------------------------------------------------------------------------- |
| 3697 | |
| 3698 | // weighted: |
| 3699 | //.......................................................................................................................................... |
| 3700 | fDirectCorrelationsW->Fill(100.,cos(2.*n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6-n*phi7),pow(wPhi1,2.)*wPhi2*wPhi3*wPhi4*wPhi5*wPhi6*wPhi7); |
| 3701 | //.......................................................................................................................................... |
| 3702 | |
| dee1e0e0 |
3703 | } |
| bc92c0cb |
3704 | } |
| 3705 | } |
| 3706 | } |
| 3707 | } |
| 3708 | } |
| 3709 | } |
| 52021ae2 |
3710 | |
| 9c1a9547 |
3711 | // 8-particle correlations: |
| 3712 | for(Int_t i1=0;i1<nPrim;i1++) |
| dee1e0e0 |
3713 | { |
| 3714 | cout<<"i1 = "<<i1<<endl; |
| 3715 | fTrack=anEvent->GetTrack(i1); |
| 9c1a9547 |
3716 | if(!(fTrack->InRPSelection())) continue; |
| dee1e0e0 |
3717 | phi1=fTrack->Phi(); |
| 3d824203 |
3718 | if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3719 | for(Int_t i2=0;i2<nPrim;i2++) |
| dee1e0e0 |
3720 | { |
| 3721 | if(i2==i1)continue; |
| 3722 | fTrack=anEvent->GetTrack(i2); |
| 9c1a9547 |
3723 | if(!(fTrack->InRPSelection())) continue; |
| dee1e0e0 |
3724 | phi2=fTrack->Phi(); |
| 3d824203 |
3725 | if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3726 | for(Int_t i3=0;i3<nPrim;i3++) |
| dee1e0e0 |
3727 | { |
| 3728 | if(i3==i1||i3==i2)continue; |
| 3729 | fTrack=anEvent->GetTrack(i3); |
| 9c1a9547 |
3730 | if(!(fTrack->InRPSelection())) continue; |
| dee1e0e0 |
3731 | phi3=fTrack->Phi(); |
| 3d824203 |
3732 | if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3733 | for(Int_t i4=0;i4<nPrim;i4++) |
| dee1e0e0 |
3734 | { |
| 3735 | if(i4==i1||i4==i2||i4==i3)continue; |
| 3736 | fTrack=anEvent->GetTrack(i4); |
| 9c1a9547 |
3737 | if(!(fTrack->InRPSelection())) continue; |
| dee1e0e0 |
3738 | phi4=fTrack->Phi(); |
| 3d824203 |
3739 | if(phiWeights) wPhi4 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3740 | for(Int_t i5=0;i5<nPrim;i5++) |
| dee1e0e0 |
3741 | { |
| 3742 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; |
| 3743 | fTrack=anEvent->GetTrack(i5); |
| 9c1a9547 |
3744 | if(!(fTrack->InRPSelection())) continue; |
| dee1e0e0 |
3745 | phi5=fTrack->Phi(); |
| 3d824203 |
3746 | if(phiWeights) wPhi5 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi5*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3747 | for(Int_t i6=0;i6<nPrim;i6++) |
| dee1e0e0 |
3748 | { |
| 3749 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; |
| 3750 | fTrack=anEvent->GetTrack(i6); |
| 9c1a9547 |
3751 | if(!(fTrack->InRPSelection())) continue; |
| 3d824203 |
3752 | phi6=fTrack->Phi(); |
| 3753 | if(phiWeights) wPhi6 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi6*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3754 | for(Int_t i7=0;i7<nPrim;i7++) |
| dee1e0e0 |
3755 | { |
| 3756 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; |
| 3757 | fTrack=anEvent->GetTrack(i7); |
| 9c1a9547 |
3758 | if(!(fTrack->InRPSelection())) continue; |
| 3d824203 |
3759 | phi7=fTrack->Phi(); |
| 3760 | if(phiWeights) wPhi7 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi7*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3761 | for(Int_t i8=0;i8<nPrim;i8++) |
| dee1e0e0 |
3762 | { |
| 3763 | if(i8==i1||i8==i2||i8==i3||i8==i4||i8==i5||i8==i6||i8==i7)continue; |
| 3764 | fTrack=anEvent->GetTrack(i8); |
| 9c1a9547 |
3765 | if(!(fTrack->InRPSelection())) continue; |
| 3d824203 |
3766 | phi8=fTrack->Phi(); |
| 9c1a9547 |
3767 | if(phiWeights) wPhi8 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi8*nBinsPhi/TMath::TwoPi()))); |
| 3768 | |
| 3769 | // non-weighted: |
| 3770 | //-------------------------------------------------------------------------------------------------------------------- |
| 3771 | fDirectCorrelations->Fill(30.,cos(n*phi1+n*phi2+n*phi3+n*phi4-n*phi5-n*phi6-n*phi7-n*phi8),1.);//<8>_{n,n,n,n|n,n,n,n} |
| 3772 | //-------------------------------------------------------------------------------------------------------------------- |
| 3773 | |
| 3774 | // weighted: |
| 3775 | //........................................................................................................................................... |
| 3776 | fDirectCorrelations->Fill(120.,cos(n*phi1+n*phi2+n*phi3+n*phi4-n*phi5-n*phi6-n*phi7-n*phi8),wPhi1*wPhi2*wPhi3*wPhi4*wPhi5*wPhi6*wPhi7*wPhi8); |
| 3777 | //........................................................................................................................................... |
| 3778 | |
| dee1e0e0 |
3779 | } |
| 3780 | } |
| 3781 | } |
| 3782 | } |
| 3783 | } |
| 3784 | } |
| 3785 | } |
| 9c1a9547 |
3786 | } |
| 3787 | |
| 3788 | } // end of AliFlowAnalysisWithQCumulants::EvaluateNestedLoopsForIntegratedFlow(AliFlowEventSimple* anEvent) |
| 3789 | |
| 3790 | |
| 3791 | //================================================================================================================================ |
| 3792 | |
| 3793 | |
| 3794 | void AliFlowAnalysisWithQCumulants::EvaluateNestedLoopsForDifferentialFlow(AliFlowEventSimple* anEvent) |
| 3795 | { |
| 3796 | // evaluate the nested loops relevant for differential flow (needed for cross-checking the results) |
| 3797 | |
| 3798 | Int_t nPrim = anEvent->NumberOfTracks(); |
| 3799 | |
| 3800 | TH1F *phiWeights = NULL; // histogram with phi weights |
| 3801 | Int_t nBinsPhi = 0; |
| 3802 | |
| 3803 | if(fUsePhiWeights) |
| 3804 | { |
| 3805 | if(!fWeightsList) |
| 3806 | { |
| 3807 | cout<<" WARNING: fWeightsList is NULL pointer in AFAWQC::ENLFDF(). "<<endl; |
| 3808 | exit(0); |
| 3809 | } |
| 3810 | phiWeights = dynamic_cast<TH1F *>(fWeightsList->FindObject("phi_weights")); |
| 3811 | if(!phiWeights) |
| 3812 | { |
| 3813 | cout<<" WARNING: couldn't access the histogram with phi weights in AFAWQC::ENLFDF(). "<<endl; |
| 3814 | exit(0); |
| 3815 | } |
| 3816 | nBinsPhi = phiWeights->GetNbinsX(); |
| 3817 | } |
| bc92c0cb |
3818 | |
| 9c1a9547 |
3819 | Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; |
| 3820 | Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1.;// wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; |
| 77515452 |
3821 | |
| 9c1a9547 |
3822 | Int_t n=2; // to be improved |
| 3823 | |
| 3824 | // ******************************************** |
| 3825 | // **** NESTED LOOPS FOR DIFFERENTIAL FLOW **** |
| 3826 | // ******************************************** |
| 3827 | |
| 3828 | // Remark 1: (pt,eta) bin in which the cross-checking will be performed is given by 1.1 < pt < 1.2 GeV and -0.55 < eta < -0.525 |
| 3829 | |
| 3830 | // Remark 2: multi-particle correlations needed for diff. flow calculated with nested loops without weights are stored in 1D profile |
| 3831 | // fDirectCorrelationsDiffFlow |
| 4057ba99 |
3832 | |
| 9c1a9547 |
3833 | // Remark 3: multi-particle correlations needed for diff. flow calculated with nested loops with weights are stored in 1D profile |
| 3834 | // fDirectCorrelationsDiffFlowW; |
| bc92c0cb |
3835 | |
| 9c1a9547 |
3836 | // Remark 4: binning of fDirectCorrelationsDiffFlow is organized as follows: |
| 3837 | //...................................................................................... |
| 3838 | // ---- bins 1-20: 2-particle correlations ---- |
| 3839 | // 1st bin: <2'>_{1n|1n} = twoPrime1n1n = <cos(n*(psi1-phi2))> |
| 3840 | // ---- bins 21-40: 3-particle correlations ---- |
| 3841 | // ---- bins 41-60: 4-particle correlations ---- |
| 3842 | // 41st bin: <4'>_{1n,1n|1n,1n} = fourPrime1n1n1n1n = <cos(n*(psi1+phi2-phi3-phi4))> |
| 3843 | //...................................................................................... |
| b7cb54d5 |
3844 | |
| 9c1a9547 |
3845 | // Remark 5: binning of fDirectCorrelationsDiffFlow is organized as follows: |
| 3846 | //...................................................................................... |
| 3847 | // ---- bins 1-20: 2-particle correlations ---- |
| 3848 | // 1st bin: twoPrime1n1nW0W1 = <w2 cos(n*(psi1-phi2))> |
| 3849 | // ---- bins 21-40: 3-particle correlations ---- |
| 3850 | // ---- bins 41-60: 4-particle correlations ---- |
| 3851 | // 41st bin: fourPrime1n1n1n1nW0W1W1W1 = <w2 w3 w4 cos(n*(psi1+phi2-phi3-phi4))> |
| 3852 | //...................................................................................... |
| 77515452 |
3853 | |
| 9c1a9547 |
3854 | // 2'-particle: |
| 4057ba99 |
3855 | for(Int_t i1=0;i1<nPrim;i1++) |
| bc92c0cb |
3856 | { |
| dee1e0e0 |
3857 | fTrack=anEvent->GetTrack(i1); |
| 9c1a9547 |
3858 | // POI condition (first particle in the correlator must be POI): |
| 3859 | if(!((fTrack->Pt()>=1.1 && fTrack->Pt()<1.2) && (fTrack->Eta()>=-0.55 && fTrack->Eta()<-0.525) && (fTrack->InPOISelection())))continue; |
| 3860 | psi1=fTrack->Phi(); |
| 3861 | if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(psi1*nBinsPhi/TMath::TwoPi()))); |
| 2bdc5281 |
3862 | |
| 3863 | fDirectCorrectionsDiffFlowCos->Fill(0.,cos(1.*n*(psi1)),1.); // <<cos(n*(psi1))>> |
| 3864 | fDirectCorrectionsDiffFlowSin->Fill(0.,sin(1.*n*(psi1)),1.); // <<sin(n*(psi1))>> |
| 3865 | |
| 4057ba99 |
3866 | for(Int_t i2=0;i2<nPrim;i2++) |
| bc92c0cb |
3867 | { |
| 4057ba99 |
3868 | if(i2==i1)continue; |
| 3869 | fTrack=anEvent->GetTrack(i2); |
| 9c1a9547 |
3870 | // RP condition (!(first) particle in the correlator must be RP): |
| 3871 | if(!(fTrack->InRPSelection()))continue; |
| 4057ba99 |
3872 | phi2=fTrack->Phi(); |
| 3d824203 |
3873 | if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
3874 | |
| 3875 | // non-weighted: |
| 3876 | //..................................................................................... |
| 3877 | fDirectCorrelationsDiffFlow->Fill(0.,cos(1.*n*(psi1-phi2)),1.); // <cos(n*(psi1-phi2))> |
| 3878 | //..................................................................................... |
| 3d824203 |
3879 | |
| 9c1a9547 |
3880 | // weighted: |
| 3881 | //..................................................................................... |
| 3882 | fDirectCorrelationsDiffFlowW->Fill(0.,cos(1.*n*(psi1-phi2)),wPhi2); // <w2 cos(n*(psi1-phi2))> |
| 3883 | //..................................................................................... |
| 3d824203 |
3884 | |
| 9c1a9547 |
3885 | //fDirectCorrelations->Fill(103.,cos(1.*n*(phi1-phi2)),pow(wPhi1,2)*wPhi2);//<2'>_{n,n} |
| 3886 | //fDirectCorrelations->Fill(104.,cos(2.*n*(phi1-phi2)),wPhi1*pow(wPhi2,2));//<2'>_{n,n} |
| 3887 | //fDirectCorrelations->Fill(105.,cos(1.*n*(phi1-phi2)),pow(wPhi2,3));//<2'>_{n,n} |
| 3888 | //fDirectCorrelations->Fill(41.,cos(2.*n*(phi1-phi2)),1);//<2'>_{2n,2n} |
| 3889 | //fDirectCorrelations->Fill(42.,cos(3.*n*(phi1-phi2)),1);//<2'>_{3n,3n} |
| 3890 | //fDirectCorrelations->Fill(43.,cos(4.*n*(phi1-phi2)),1);//<2'>_{4n,4n} |
| 3d824203 |
3891 | |
| 4057ba99 |
3892 | }//end of for(Int_t i2=0;i2<nPrim;i2++) |
| 3893 | }//end of for(Int_t i1=0;i1<nPrim;i1++) |
| b7cb54d5 |
3894 | |
| 3d824203 |
3895 | |
| 3896 | |
| 3897 | /* |
| 3898 | |
| bc92c0cb |
3899 | //<3'>_{2n|n,n} |
| 4057ba99 |
3900 | for(Int_t i1=0;i1<nPrim;i1++) |
| bc92c0cb |
3901 | { |
| dee1e0e0 |
3902 | fTrack=anEvent->GetTrack(i1); |
| b7cb54d5 |
3903 | if(!((fTrack->Pt()>=0.5&&fTrack->Pt()<0.6)&&(fTrack->InPOISelection())))continue;//POI condition |
| 9c1a9547 |
3904 | psi1=fTrack->Phi(); |
| 3905 | if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(psi1*nBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
3906 | for(Int_t i2=0;i2<nPrim;i2++) |
| bc92c0cb |
3907 | { |
| 4057ba99 |
3908 | if(i2==i1)continue; |
| 3909 | fTrack=anEvent->GetTrack(i2); |
| b7cb54d5 |
3910 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
3911 | phi2=fTrack->Phi(); |
| 3d824203 |
3912 | if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
3913 | for(Int_t i3=0;i3<nPrim;i3++) |
| bc92c0cb |
3914 | { |
| 4057ba99 |
3915 | if(i3==i1||i3==i2)continue; |
| 3916 | fTrack=anEvent->GetTrack(i3); |
| b7cb54d5 |
3917 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
3918 | phi3=fTrack->Phi(); |
| 3d824203 |
3919 | if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi()))); |
| 3920 | //fill the fDirectCorrelations: |
| 3921 | |
| 3922 | // 2-p |
| 9c1a9547 |
3923 | //fDirectCorrelations->Fill(101.,cos(n*(phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 cos(n(phi2-phi3))> |
| 3924 | //fDirectCorrelations->Fill(102.,cos(n*(phi1-phi3)),pow(wPhi2,2.)*wPhi3); // <w2^2 w3 cos(n(psi1-phi2))> |
| 3d824203 |
3925 | |
| 3926 | // 3-p |
| 9c1a9547 |
3927 | //fDirectCorrelations->Fill(110.,cos(n*(2.*phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 cos(n(2psi1-phi2-phi3))> |
| 3928 | //fDirectCorrelations->Fill(111.,cos(n*(phi1+phi2-2.*phi3)),wPhi2*pow(wPhi3,2.)); // <w2 w3^2 cos(n(psi1+phi2-2.*phi3))> |
| 3d824203 |
3929 | |
| 3930 | |
| 3931 | //fDirectCorrelations->Fill(46.,cos(n*(phi1+phi2-2.*phi3)),1);//<3'>_{n,n|2n} |
| 4057ba99 |
3932 | }//end of for(Int_t i3=0;i3<nPrim;i3++) |
| 3933 | }//end of for(Int_t i2=0;i2<nPrim;i2++) |
| 9c1a9547 |
3934 | }//end of for(Int_t i1=0;i1<nPrim;i1++) |
| 3d824203 |
3935 | */ |
| 3936 | |
| 9c1a9547 |
3937 | // 4'-particle: |
| 4057ba99 |
3938 | for(Int_t i1=0;i1<nPrim;i1++) |
| bc92c0cb |
3939 | { |
| dee1e0e0 |
3940 | fTrack=anEvent->GetTrack(i1); |
| 9c1a9547 |
3941 | // POI condition (first particle in the correlator must be POI): |
| 3942 | if(!((fTrack->Pt()>=1.1 && fTrack->Pt()<1.2) && (fTrack->Eta()>=-0.55 && fTrack->Eta()<-0.525) && (fTrack->InPOISelection())))continue; |
| 3943 | psi1=fTrack->Phi(); |
| 3944 | if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(psi1*nBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
3945 | for(Int_t i2=0;i2<nPrim;i2++) |
| bc92c0cb |
3946 | { |
| 4057ba99 |
3947 | if(i2==i1)continue; |
| 3948 | fTrack=anEvent->GetTrack(i2); |
| 9c1a9547 |
3949 | // RP condition (!(first) particle in the correlator must be RP): |
| 3950 | if(!(fTrack->InRPSelection()))continue; |
| 4057ba99 |
3951 | phi2=fTrack->Phi(); |
| 3d824203 |
3952 | if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
3953 | for(Int_t i3=0;i3<nPrim;i3++) |
| 3954 | { |
| 3955 | if(i3==i1||i3==i2)continue; |
| 3956 | fTrack=anEvent->GetTrack(i3); |
| 9c1a9547 |
3957 | // RP condition (!(first) particle in the correlator must be RP): |
| 3958 | if(!(fTrack->InRPSelection()))continue; |
| 4057ba99 |
3959 | phi3=fTrack->Phi(); |
| 3d824203 |
3960 | if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
3961 | for(Int_t i4=0;i4<nPrim;i4++) |
| bc92c0cb |
3962 | { |
| 4057ba99 |
3963 | if(i4==i1||i4==i2||i4==i3)continue; |
| 3964 | fTrack=anEvent->GetTrack(i4); |
| 9c1a9547 |
3965 | // RP condition (!(first) particle in the correlator must be RP): |
| 3966 | if(!(fTrack->InRPSelection()))continue; |
| 4057ba99 |
3967 | phi4=fTrack->Phi(); |
| 3d824203 |
3968 | if(phiWeights) wPhi4 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*nBinsPhi/TMath::TwoPi()))); |
| 3d824203 |
3969 | |
| 9c1a9547 |
3970 | // non-weighted: |
| 3971 | //......................................................................................................................... |
| 3972 | fDirectCorrelationsDiffFlow->Fill(40.,cos(n*(psi1+phi2-phi3-phi4)),1.); // <cos(n(psi1+phi1-phi2-phi3))> |
| 3973 | //......................................................................................................................... |
| 3974 | |
| 3975 | // weighted: |
| 3976 | //............................................................................................................................... |
| 3977 | fDirectCorrelationsDiffFlowW->Fill(40.,cos(n*(psi1+phi2-phi3-phi4)),wPhi2*wPhi3*wPhi4); // <w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))> |
| 3978 | //............................................................................................................................... |
| 3979 | |
| 4057ba99 |
3980 | }//end of for(Int_t i4=0;i4<nPrim;i4++) |
| 3981 | }//end of for(Int_t i3=0;i3<nPrim;i3++) |
| 3982 | }//end of for(Int_t i2=0;i2<nPrim;i2++) |
| 3983 | }//end of for(Int_t i1=0;i1<nPrim;i1++) |
| ae733b3b |
3984 | |
| 9c1a9547 |
3985 | /* |
| 4057ba99 |
3986 | //<5'>_{2n,n|n,n,n} |
| 3987 | for(Int_t i1=0;i1<nPrim;i1++) |
| 3988 | { |
| 3989 | fTrack=anEvent->GetTrack(i1); |
| b7cb54d5 |
3990 | if(!((fTrack->Pt()>=0.5&&fTrack->Pt()<0.6)&&(fTrack->InPOISelection())))continue;//POI condition |
| 4057ba99 |
3991 | phi1=fTrack->Phi(); |
| 3992 | for(Int_t i2=0;i2<nPrim;i2++) |
| 3993 | { |
| 3994 | if(i2==i1)continue; |
| 3995 | fTrack=anEvent->GetTrack(i2); |
| b7cb54d5 |
3996 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
3997 | phi2=fTrack->Phi(); |
| 3998 | for(Int_t i3=0;i3<nPrim;i3++) |
| 3999 | { |
| 4000 | if(i3==i1||i3==i2)continue; |
| 4001 | fTrack=anEvent->GetTrack(i3); |
| b7cb54d5 |
4002 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
4003 | phi3=fTrack->Phi(); |
| 4004 | for(Int_t i4=0;i4<nPrim;i4++) |
| 4005 | { |
| 4006 | if(i4==i1||i4==i2||i4==i3)continue; |
| 4007 | fTrack=anEvent->GetTrack(i4); |
| b7cb54d5 |
4008 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| ae733b3b |
4009 | phi4=fTrack->Phi();// |
| 4057ba99 |
4010 | for(Int_t i5=0;i5<nPrim;i5++) |
| bc92c0cb |
4011 | { |
| 4057ba99 |
4012 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; |
| 4013 | fTrack=anEvent->GetTrack(i5); |
| b7cb54d5 |
4014 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
4015 | phi5=fTrack->Phi(); |
| 4016 | //fill the fDirectCorrelations:if(bNestedLoops) |
| 9c1a9547 |
4017 | //fDirectCorrelations->Fill(55.,cos(2.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5),1);//<5'>_{2n,n|n,n,n} |
| 4057ba99 |
4018 | }//end of for(Int_t i5=0;i5<nPrim;i5++) |
| 4019 | }//end of for(Int_t i4=0;i4<nPrim;i4++) |
| 4020 | }//end of for(Int_t i3=0;i3<nPrim;i3++) |
| 4021 | }//end of for(Int_t i2=0;i2<nPrim;i2++) |
| 4022 | }//end of for(Int_t i1=0;i1<nPrim;i1++) |
| 4023 | |
| 9c1a9547 |
4024 | |
| 4025 | |
| 4026 | */ |
| 4027 | /* |
| 4028 | |
| 4029 | |
| 4030 | |
| 4057ba99 |
4031 | //<6'>_{n,n,n|n,n,n} |
| 4032 | for(Int_t i1=0;i1<nPrim;i1++) |
| 4033 | { |
| 4034 | fTrack=anEvent->GetTrack(i1); |
| b7cb54d5 |
4035 | if(!((fTrack->Pt()>=0.5&&fTrack->Pt()<0.6)&&(fTrack->InPOISelection())))continue;//POI condition |
| 4057ba99 |
4036 | phi1=fTrack->Phi(); |
| 4037 | for(Int_t i2=0;i2<nPrim;i2++) |
| 4038 | { |
| 4039 | if(i2==i1)continue; |
| 4040 | fTrack=anEvent->GetTrack(i2); |
| b7cb54d5 |
4041 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
4042 | phi2=fTrack->Phi(); |
| 4043 | for(Int_t i3=0;i3<nPrim;i3++) |
| 4044 | { |
| 4045 | if(i3==i1||i3==i2)continue; |
| 4046 | fTrack=anEvent->GetTrack(i3); |
| b7cb54d5 |
4047 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
4048 | phi3=fTrack->Phi(); |
| 4049 | for(Int_t i4=0;i4<nPrim;i4++) |
| 4050 | { |
| 4051 | if(i4==i1||i4==i2||i4==i3)continue; |
| 4052 | fTrack=anEvent->GetTrack(i4); |
| b7cb54d5 |
4053 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
4054 | phi4=fTrack->Phi(); |
| 4055 | for(Int_t i5=0;i5<nPrim;i5++) |
| 4056 | { |
| 4057 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; |
| 4058 | fTrack=anEvent->GetTrack(i5); |
| b7cb54d5 |
4059 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
4060 | phi5=fTrack->Phi(); |
| 4061 | for(Int_t i6=0;i6<nPrim;i6++) |
| 4062 | { |
| 4063 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; |
| 4064 | fTrack=anEvent->GetTrack(i6); |
| b7cb54d5 |
4065 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
4066 | phi6=fTrack->Phi(); |
| 4067 | //fill the fDirectCorrelations: |
| 9c1a9547 |
4068 | //fDirectCorrelations->Fill(60.,cos(n*(phi1+phi2+phi3-phi4-phi5-phi6)),1);//<6'>_{n,n,n|n,n,n} |
| 4057ba99 |
4069 | }//end of for(Int_t i6=0;i6<nPrim;i6++) |
| 4070 | }//end of for(Int_t i5=0;i5<nPrim;i5++) |
| 4071 | }//end of for(Int_t i4=0;i4<nPrim;i4++) |
| 4072 | }//end of for(Int_t i3=0;i3<nPrim;i3++) |
| 4073 | }//end of for(Int_t i2=0;i2<nPrim;i2++) |
| 4074 | }//end of for(Int_t i1=0;i1<nPrim;i1++) |
| 9c1a9547 |
4075 | |
| 4057ba99 |
4076 | |
| 9c1a9547 |
4077 | */ |
| 4078 | /* |
| 4079 | |
| 4080 | |
| 4057ba99 |
4081 | //<7'>_{2n,n,n|n,n,n,n} |
| 4082 | for(Int_t i1=0;i1<nPrim;i1++) |
| 4083 | { |
| 4084 | fTrack=anEvent->GetTrack(i1); |
| b7cb54d5 |
4085 | if(!((fTrack->Pt()>=0.5&&fTrack->Pt()<0.6)&&(fTrack->InPOISelection())))continue;//POI condition |
| 4057ba99 |
4086 | phi1=fTrack->Phi(); |
| 4087 | for(Int_t i2=0;i2<nPrim;i2++) |
| 4088 | { |
| 4089 | if(i2==i1)continue; |
| 4090 | fTrack=anEvent->GetTrack(i2); |
| b7cb54d5 |
4091 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
4092 | phi2=fTrack->Phi(); |
| 4093 | for(Int_t i3=0;i3<nPrim;i3++) |
| 4094 | { |
| 4095 | if(i3==i1||i3==i2)continue; |
| 4096 | fTrack=anEvent->GetTrack(i3); |
| b7cb54d5 |
4097 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
4098 | phi3=fTrack->Phi(); |
| 4099 | for(Int_t i4=0;i4<nPrim;i4++) |
| 4100 | { |
| 4101 | if(i4==i1||i4==i2||i4==i3)continue; |
| 4102 | fTrack=anEvent->GetTrack(i4); |
| b7cb54d5 |
4103 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
4104 | phi4=fTrack->Phi(); |
| 4105 | for(Int_t i5=0;i5<nPrim;i5++) |
| 4106 | { |
| 4107 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; |
| 4108 | fTrack=anEvent->GetTrack(i5); |
| b7cb54d5 |
4109 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
4110 | phi5=fTrack->Phi(); |
| 4111 | for(Int_t i6=0;i6<nPrim;i6++) |
| 4112 | { |
| 4113 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; |
| 4114 | fTrack=anEvent->GetTrack(i6); |
| b7cb54d5 |
4115 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
4116 | phi6=fTrack->Phi(); |
| 4117 | for(Int_t i7=0;i7<nPrim;i7++) |
| 4118 | { |
| 4119 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; |
| 4120 | fTrack=anEvent->GetTrack(i7); |
| b7cb54d5 |
4121 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
4122 | phi7=fTrack->Phi(); |
| 4123 | //fill the fDirectCorrelations: |
| 9c1a9547 |
4124 | //fDirectCorrelations->Fill(65.,cos(2.*n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6-n*phi7),1);//<7'>_{2n,n,n|n,n,n,n} |
| 4057ba99 |
4125 | }//end of for(Int_t i7=0;i7<nPrim;i7++) |
| 4126 | }//end of for(Int_t i6=0;i6<nPrim;i6++) |
| 4127 | }//end of for(Int_t i5=0;i5<nPrim;i5++) |
| 4128 | }//end of for(Int_t i4=0;i4<nPrim;i4++) |
| 4129 | }//end of for(Int_t i3=0;i3<nPrim;i3++) |
| 4130 | }//end of for(Int_t i2=0;i2<nPrim;i2++) |
| 4131 | }//end of for(Int_t i1=0;i1<nPrim;i1++) |
| 9c1a9547 |
4132 | |
| 4057ba99 |
4133 | |
| 9c1a9547 |
4134 | |
| 4135 | */ |
| 4136 | /* |
| 4137 | |
| 4138 | |
| 4139 | |
| 4057ba99 |
4140 | //<8'>_{n,n,n,n|n,n,n,n} |
| 4141 | for(Int_t i1=0;i1<nPrim;i1++) |
| 4142 | { |
| 4143 | fTrack=anEvent->GetTrack(i1); |
| b7cb54d5 |
4144 | if(!((fTrack->Pt()>=0.5&&fTrack->Pt()<0.6)&&(fTrack->InPOISelection())))continue;//POI condition |
| 4057ba99 |
4145 | phi1=fTrack->Phi(); |
| 4146 | for(Int_t i2=0;i2<nPrim;i2++) |
| 4147 | { |
| 4148 | if(i2==i1)continue; |
| 4149 | fTrack=anEvent->GetTrack(i2); |
| b7cb54d5 |
4150 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
4151 | phi2=fTrack->Phi(); |
| 4152 | for(Int_t i3=0;i3<nPrim;i3++) |
| 4153 | { |
| 4154 | if(i3==i1||i3==i2)continue; |
| 4155 | fTrack=anEvent->GetTrack(i3); |
| b7cb54d5 |
4156 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
4157 | phi3=fTrack->Phi(); |
| 4158 | for(Int_t i4=0;i4<nPrim;i4++) |
| 4159 | { |
| 4160 | if(i4==i1||i4==i2||i4==i3)continue; |
| 4161 | fTrack=anEvent->GetTrack(i4); |
| b7cb54d5 |
4162 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
4163 | phi4=fTrack->Phi(); |
| 4164 | for(Int_t i5=0;i5<nPrim;i5++) |
| 4165 | { |
| 4166 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; |
| 4167 | fTrack=anEvent->GetTrack(i5); |
| b7cb54d5 |
4168 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
4169 | phi5=fTrack->Phi(); |
| 4170 | for(Int_t i6=0;i6<nPrim;i6++) |
| 4171 | { |
| 4172 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; |
| 4173 | fTrack=anEvent->GetTrack(i6); |
| b7cb54d5 |
4174 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
4175 | phi6=fTrack->Phi(); |
| 4176 | for(Int_t i7=0;i7<nPrim;i7++) |
| 4177 | { |
| 4178 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; |
| 4179 | fTrack=anEvent->GetTrack(i7); |
| b7cb54d5 |
4180 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
4181 | phi7=fTrack->Phi(); |
| 4182 | for(Int_t i8=0;i8<nPrim;i8++) |
| 4183 | { |
| 4184 | if(i8==i1||i8==i2||i8==i3||i8==i4||i8==i5||i8==i6||i8==i7)continue; |
| 4185 | fTrack=anEvent->GetTrack(i8); |
| b7cb54d5 |
4186 | if(!(fTrack->InRPSelection()))continue;//RP condition |
| 4057ba99 |
4187 | phi8=fTrack->Phi(); |
| 4188 | //fill the fDirectCorrelations: |
| 9c1a9547 |
4189 | //fDirectCorrelations->Fill(70.,cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)),1);//<8'>_{n,n,n,n|n,n,n,n} |
| 4057ba99 |
4190 | }//end of for(Int_t i8=0;i8<nPrim;i8++) |
| 4191 | }//end of for(Int_t i7=0;i7<nPrim;i7++) |
| 4192 | }//end of for(Int_t i6=0;i6<nPrim;i6++) |
| 4193 | }//end of for(Int_t i5=0;i5<nPrim;i5++) |
| 4194 | }//end of for(Int_t i4=0;i4<nPrim;i4++) |
| 4195 | }//end of for(Int_t i3=0;i3<nPrim;i3++) |
| 4196 | }//end of for(Int_t i2=0;i2<nPrim;i2++) |
| 4197 | }//end of for(Int_t i1=0;i1<nPrim;i1++) |
| 4198 | |
| 4199 | |
| 4200 | |
| 9c1a9547 |
4201 | */ |
| 4202 | |
| 4203 | |
| 4204 | |
| 3d824203 |
4205 | |
| 9c1a9547 |
4206 | } // end of AliFlowAnalysisWithQCumulants::EvaluateNestedLoopsForDifferentialFlow(AliFlowEventSimple* anEvent) |
| 4207 | |
| 4208 | |
| 4209 | //================================================================================================================================ |
| 4210 | |
| 4211 | |
| fd46c3dd |
4212 | void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos) |
| 4213 | { |
| 4214 | // get pointers to all output histograms (called before Finish()) |
| 4215 | if(outputListHistos) |
| 4216 | { |
| 4217 | // with or without weights |
| 4218 | TBits *useWeightsBits = dynamic_cast<TBits*>(outputListHistos->FindObject("TBits")); |
| c365fe76 |
4219 | |
| 4220 | //final results (no-name integrated flow without weights) |
| 4221 | TH1D *finalCorrectionsForNUA = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fFinalCorrectionsForNUA")); |
| fd46c3dd |
4222 | |
| 4223 | //final results (no-name integrated flow without weights) |
| 4224 | TH1D *intFlowResultsQC = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fIntFlowResultsQC")); |
| 4225 | |
| 4226 | //final results (no-name integrated flow with weights) |
| 4227 | TH1D *intFlowResultsQCW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fIntFlowResultsQCW")); |
| 4228 | |
| 4229 | //final results (POIs integrated flow without weights) |
| 4230 | TH1D *intFlowResultsPOIQC = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fIntFlowResultsPOIQC")); |
| 4231 | |
| 4232 | //final results (POIs integrated flow with weights) |
| 4233 | TH1D *intFlowResultsPOIQCW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fIntFlowResultsPOIQCW")); |
| 4234 | |
| 4235 | //final results (RPs integrated flow without weights) |
| 4236 | TH1D *intFlowResultsRPQC = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fIntFlowResultsRPQC")); |
| 4237 | |
| 4238 | //final results (RPs integrated flow with weights) |
| 4239 | TH1D *intFlowResultsRPQCW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fIntFlowResultsRPQCW")); |
| 4240 | |
| 4241 | //final results (differential flow) |
| 4242 | TH1D *diffFlowResults2ndOrder = dynamic_cast<TH1D*>(outputListHistos->FindObject("fDiffFlowResults2ndOrderQC")); |
| 4243 | TH1D *diffFlowResults4thOrder = dynamic_cast<TH1D*>(outputListHistos->FindObject("fDiffFlowResults4thOrderQC")); |
| 4244 | |
| 4245 | //final results for covariances (1st bin <2*4>-<2>*<4>, 2nd bin <2*6>-<2>*<6>, ...) |
| 4246 | TH1D *covariances = dynamic_cast<TH1D*>(outputListHistos->FindObject("fCovariances")); |
| 4247 | |
| 4248 | //common control histograms (taking into account only the events with 2 and more particles) |
| 4249 | AliFlowCommonHist *commonHist2nd = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject("AliFlowCommonHist2ndOrderQC")); |
| 4250 | |
| 4251 | //common control histograms (taking into account only the events with 4 and more particles) |
| 4252 | AliFlowCommonHist *commonHist4th = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject("AliFlowCommonHist4thOrderQC")); |
| 4253 | |
| 4254 | //common control histograms (taking into account only the events with 6 and more particles) |
| 4255 | AliFlowCommonHist *commonHist6th = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject("AliFlowCommonHist6thOrderQC")); |
| 4256 | |
| 4257 | //common control histograms (taking into account only the events with 8 and more particles) |
| 4258 | AliFlowCommonHist *commonHist8th = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject("AliFlowCommonHist8thOrderQC")); |
| 4259 | |
| 4260 | //common histograms to store the final results for the 2nd order integrated and differential flow |
| 4261 | AliFlowCommonHistResults *commonHistRes2nd = dynamic_cast<AliFlowCommonHistResults*>(outputListHistos->FindObject("AliFlowCommonHistResults2ndOrderQC")); |
| 4262 | |
| 4263 | //common histograms to store the final results for the 4th order integrated and differential flow |
| 4264 | AliFlowCommonHistResults *commonHistRes4th = dynamic_cast<AliFlowCommonHistResults*>(outputListHistos->FindObject("AliFlowCommonHistResults4thOrderQC")); |
| 4265 | |
| 4266 | //common histograms to store the final results for the 6th order integrated and differential flow |
| 4267 | AliFlowCommonHistResults *commonHistRes6th = dynamic_cast<AliFlowCommonHistResults*>(outputListHistos->FindObject("AliFlowCommonHistResults6thOrderQC")); |
| 4268 | |
| 4269 | //common histograms to store the final results for the 8th order integrated and differential flow |
| 4270 | AliFlowCommonHistResults *commonHistRes8th = dynamic_cast<AliFlowCommonHistResults*>(outputListHistos->FindObject("AliFlowCommonHistResults8thOrderQC")); |
| 4271 | |
| 4272 | //average selected multiplicity (for int. flow) |
| 4273 | TProfile *AvMult = dynamic_cast<TProfile*>(outputListHistos->FindObject("fAvMultIntFlowQC")); |
| 4274 | |
| 4275 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| 4276 | // !!!! to be removed !!!! |
| 4277 | //profiles containing the Q-vectors from all events |
| 4278 | TProfile *qvectorForEachEventX = dynamic_cast<TProfile*>(outputListHistos->FindObject("fQvectorForEachEventX")); |
| 4279 | TProfile *qvectorForEachEventY = dynamic_cast<TProfile*>(outputListHistos->FindObject("fQvectorForEachEventY")); |
| 4280 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| 4281 | |
| 4282 | //multi-particle correlations calculated from Q-vectors |
| 4283 | TProfile *qCorrelations = dynamic_cast<TProfile*>(outputListHistos->FindObject("fQCorrelations")); |
| 4284 | |
| 4285 | //weighted multi-particle correlations calculated from Q-vectors |
| 4286 | TProfile *qCorrelationsW = dynamic_cast<TProfile*>(outputListHistos->FindObject("fQCorrelationsW")); |
| c365fe76 |
4287 | |
| 4288 | // corrections for non-uniform acceptance (cos terms) calculated from Q-vectors |
| 4289 | TProfile *qCorrectionsCos = dynamic_cast<TProfile*>(outputListHistos->FindObject("fQCorrectionsCos")); |
| fd46c3dd |
4290 | |
| c365fe76 |
4291 | // corrections for non-uniform acceptance (sin terms) calculated from Q-vectors |
| 4292 | TProfile *qCorrectionsSin = dynamic_cast<TProfile*>(outputListHistos->FindObject("fQCorrectionsSin")); |
| 4293 | |
| fd46c3dd |
4294 | //average of products: 1st bin: <2*4>, 2nd bin: <2*6>, ... |
| 4295 | TProfile *QProduct = dynamic_cast<TProfile*>(outputListHistos->FindObject("fQProduct")); |
| 4296 | |
| 4297 | //average 2- and 4-particle correlations per pt-bin |
| 4298 | TProfile *binnedPt2p1n1nRP = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2PerPtBin1n1nRP")); |
| 4299 | TProfile *binnedPt4p1n1n1n1nRP = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4PerPtBin1n1n1n1nRP")); |
| 4300 | |
| 4301 | //average 2- and 4-particle correlations per eta-bin |
| 4302 | TProfile *binnedEta2p1n1nRP = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2PerEtaBin1n1nRP")); |
| 4303 | TProfile *binnedEta4p1n1n1n1nRP = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4PerEtaBin1n1n1n1nRP")); |
| 4304 | |
| 4305 | //average 2- and 4-particle correlations per pt-bin |
| 4306 | TProfile *binnedPt2p1n1nPOI = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2PerPtBin1n1nPOI")); |
| 4307 | TProfile *binnedPt4p1n1n1n1nPOI = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4PerPtBin1n1n1n1nPOI")); |
| 4308 | |
| 4309 | //average 2- and 4-particle correlations per eta-bin |
| 4310 | TProfile *binnedEta2p1n1nPOI = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2PerEtaBin1n1nPOI")); |
| 4311 | TProfile *binnedEta4p1n1n1n1nPOI = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4PerEtaBin1n1n1n1nPOI")); |
| 4312 | |
| 4313 | //average 2- and 4-particle correlations per pt-bin |
| 4314 | TProfile *binnedWPt2p1n1nPOI = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2WPerPtBin1n1nPOI")); |
| 4315 | TProfile *binnedWPt4p1n1n1n1nPOI = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4WPerPtBin1n1n1n1nPOI")); |
| 4316 | |
| 4317 | TProfile *binnedWEta2p1n1nPOI = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2WPerEtaBin1n1nPOI")); |
| 4318 | TProfile *binnedWEta4p1n1n1n1nPOI = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4WPerEtaBin1n1n1n1nPOI")); |
| 4319 | |
| 4320 | TProfile *binnedWPt2p1n1nRP = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2WPerPtBin1n1nRP")); |
| 4321 | TProfile *binnedWPt4p1n1n1n1nRP = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4WPerPtBin1n1n1n1nRP")); |
| 4322 | |
| 4323 | TProfile *binnedWEta2p1n1nRP = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2WPerEtaBin1n1nRP")); |
| 4324 | TProfile *binnedWEta4p1n1n1n1nRP = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4WPerEtaBin1n1n1n1nRP")); |
| 4325 | |
| 4326 | //average values of Q-vector components (1st bin: <Q_x>, 2nd bin: <Q_y>, 3rd bin: <(Q_x)^2>, 4th bin: <(Q_y)^2>) |
| 4327 | TProfile *QVectorComponents = dynamic_cast<TProfile*>(outputListHistos->FindObject("fQvectorComponents")); |
| 4328 | |
| 4329 | // multi-particle correlations calculated with nested loop (needed for int. flow) |
| 4330 | TProfile *directCorrelations = dynamic_cast<TProfile*>(outputListHistos->FindObject("fDirectCorrelations")); |
| 4331 | |
| 4332 | // multi-particle correlations calculated with nested loop (needed for weighted int. flow) |
| 4333 | TProfile *directCorrelationsW = dynamic_cast<TProfile*>(outputListHistos->FindObject("fDirectCorrelationsW")); |
| 4334 | |
| 4335 | // multi-particle correlations calculated with nested loop (needed for diff. flow) |
| 4336 | TProfile *directCorrelationsDiffFlow = dynamic_cast<TProfile*>(outputListHistos->FindObject("fDirectCorrelationsDiffFlow")); |
| 4337 | |
| 4338 | // multi-particle correlations calculated with nested loop (needed for int. flow) |
| 4339 | TProfile *directCorrelationsDiffFlowW = dynamic_cast<TProfile*>(outputListHistos->FindObject("fDirectCorrelationsDiffFlowW")); |
| 4340 | |
| 2bdc5281 |
4341 | // corrections for non-uniform acceptance (cos terms) calculated with nested loop (integrated flow) |
| c365fe76 |
4342 | TProfile *directCorrectionsCos = dynamic_cast<TProfile*>(outputListHistos->FindObject("fDirectCorrectionsCos")); |
| fd46c3dd |
4343 | |
| 2bdc5281 |
4344 | // corrections for non-uniform acceptance (sin terms) calculated with nested loop (integrated flow) |
| c365fe76 |
4345 | TProfile *directCorrectionsSin = dynamic_cast<TProfile*>(outputListHistos->FindObject("fDirectCorrectionsSin")); |
| fd46c3dd |
4346 | |
| 2bdc5281 |
4347 | // corrections for non-uniform acceptance (cos terms) calculated with nested loop (differential flow) |
| 4348 | TProfile *directCorrectionsDiffFlowCos = dynamic_cast<TProfile*>(outputListHistos->FindObject("fDirectCorrectionsDiffFlowCos")); |
| fd46c3dd |
4349 | |
| 2bdc5281 |
4350 | // corrections for non-uniform acceptance (sin terms) calculated with nested loop (differential flow) |
| 4351 | TProfile *directCorrectionsDiffFlowSin = dynamic_cast<TProfile*>(outputListHistos->FindObject("fDirectCorrectionsDiffFlowSin")); |
| 4352 | |
| fd46c3dd |
4353 | // ............................................................................................................................................... |
| 4354 | // non-weighted correlations for each (pt,eta) bin for POIs: |
| 4355 | TProfile2D *twoPtEtaPOI = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2pPtEtaPOI")); |
| 4356 | TProfile2D *fourPtEtaPOI = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4pPtEtaPOI")); |
| 4357 | TProfile2D *sixPtEtaPOI = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f6pPtEtaPOI")); |
| 4358 | TProfile2D *eightPtEtaPOI = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f8pPtEtaPOI")); |
| 2bdc5281 |
4359 | |
| 4360 | |
| 4361 | //...................................................................................................... |
| 4362 | |
| 4363 | |
| 4364 | // terms: corrections for non-uniform acceptance to non-weighted correlations for differential flow of POIs: |
| 4365 | TProfile2D *correctionsCosP1nPsiPtEtaPOI = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("fCorrectionsCosP1nPsiPtEtaPOI")); |
| 4366 | TProfile2D *correctionsSinP1nPsiPtEtaPOI = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("fCorrectionsSinP1nPsiPtEtaPOI")); |
| 4367 | |
| 4368 | |
| 4369 | //.... |
| 4370 | |
| 4371 | |
| 4372 | // terms: corrections for non-uniform acceptance to non-weighted correlations for differential flow of POIs: |
| 4373 | TProfile2D *correctionsCosP1nPsiPtEtaRP = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("fCorrectionsCosP1nPsiPtEtaRP")); |
| 4374 | TProfile2D *correctionsSinP1nPsiPtEtaRP = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("fCorrectionsSinP1nPsiPtEtaRP")); |
| 4375 | |
| 4376 | |
| 4377 | //...................................................................................................... |
| 4378 | |
| 4379 | |
| 4380 | // corrections for non-uniform acceptance to non-weighted correlations for differential flow of POIs: |
| 4381 | TH2D *twoFinalCorrectionForNUAPtEtaPOI = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f2pFinalCorrectionsForNUAPtEtaPOI")); |
| 4382 | TH2D *fourFinalCorrectionForNUAPtEtaPOI = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f4pFinalCorrectionsForNUAPtEtaPOI")); |
| 4383 | TH2D *sixFinalCorrectionForNUAPtEtaPOI = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f6pFinalCorrectionsForNUAPtEtaPOI")); |
| 4384 | TH2D *eightFinalCorrectionForNUAPtEtaPOI = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f8pFinalCorrectionsForNUAPtEtaPOI")); |
| 4385 | |
| 4386 | // corrections for non-uniform acceptance to non-weighted correlations for differential flow of POIs: |
| 4387 | TH1D *twoFinalCorrectionForNUAPtPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f2pFinalCorrectionsForNUAPtPOI")); |
| 4388 | TH1D *fourFinalCorrectionForNUAPtPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f4pFinalCorrectionsForNUAPtPOI")); |
| 4389 | TH1D *sixFinalCorrectionForNUAPtPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f6pFinalCorrectionsForNUAPtPOI")); |
| 4390 | TH1D *eightFinalCorrectionForNUAPtPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f8pFinalCorrectionsForNUAPtPOI")); |
| 4391 | |
| 4392 | // corrections for non-uniform acceptance to non-weighted correlations for differential flow of POIs: |
| 4393 | TH1D *twoFinalCorrectionForNUAEtaPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f2pFinalCorrectionsForNUAEtaPOI")); |
| 4394 | TH1D *fourFinalCorrectionForNUAEtaPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f4pFinalCorrectionsForNUAEtaPOI")); |
| 4395 | TH1D *sixFinalCorrectionForNUAEtaPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f6pFinalCorrectionsForNUAEtaPOI")); |
| 4396 | TH1D *eightFinalCorrectionForNUAEtaPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f8pFinalCorrectionsForNUAEtaPOI")); |
| fd46c3dd |
4397 | |
| 4398 | // non-weighted final results for differential flow for each for POIs: |
| 4399 | // 3D (pt,eta) |
| 4400 | TH2D *vn2ndPtEtaPOI = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndPtEtaPOI")); |
| 4401 | TH2D *vn4thPtEtaPOI = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thPtEtaPOI")); |
| 4402 | TH2D *vn6thPtEtaPOI = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thPtEtaPOI")); |
| 4403 | TH2D *vn8thPtEtaPOI = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thPtEtaPOI")); |
| 4404 | // 2D (pt) |
| 4405 | TH1D *vn2ndPtPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndPtPOI")); |
| 4406 | TH1D *vn4thPtPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thPtPOI")); |
| 4407 | TH1D *vn6thPtPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thPtPOI")); |
| 4408 | TH1D *vn8thPtPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thPtPOI")); |
| 4409 | // 2D (eta) |
| 4410 | TH1D *vn2ndEtaPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndEtaPOI")); |
| 4411 | TH1D *vn4thEtaPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thEtaPOI")); |
| 4412 | TH1D *vn6thEtaPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thEtaPOI")); |
| 4413 | TH1D *vn8thEtaPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thEtaPOI")); |
| 4414 | |
| 4415 | // weighted correlations for each (pt,eta) bin for POIs: |
| 4416 | TProfile2D *twoPtEtaPOIW = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2pPtEtaPOIW")); |
| 4417 | TProfile2D *fourPtEtaPOIW = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4pPtEtaPOIW")); |
| 4418 | TProfile2D *sixPtEtaPOIW = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f6pPtEtaPOIW")); |
| 4419 | TProfile2D *eightPtEtaPOIW = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f8pPtEtaPOIW")); |
| 4420 | |
| 4421 | // weighted final results for differential flow for each for POIs: |
| 4422 | // 3D (pt,eta) |
| 4423 | TH2D *vn2ndPtEtaPOIW = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndPtEtaPOIW")); |
| 4424 | TH2D *vn4thPtEtaPOIW = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thPtEtaPOIW")); |
| 4425 | TH2D *vn6thPtEtaPOIW = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thPtEtaPOIW")); |
| 4426 | TH2D *vn8thPtEtaPOIW = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thPtEtaPOIW")); |
| 4427 | // 2D (pt) |
| 4428 | TH1D *vn2ndPtPOIW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndPtPOIW")); |
| 4429 | TH1D *vn4thPtPOIW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thPtPOIW")); |
| 4430 | TH1D *vn6thPtPOIW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thPtPOIW")); |
| 2bdc5281 |
4431 | TH1D *vn8thPtPOIW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thPtPOIW")); |
| fd46c3dd |
4432 | // 2D (eta) |
| 4433 | TH1D *vn2ndEtaPOIW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndEtaPOIW")); |
| 4434 | TH1D *vn4thEtaPOIW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thEtaPOIW")); |
| 4435 | TH1D *vn6thEtaPOIW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thEtaPOIW")); |
| 4436 | TH1D *vn8thEtaPOIW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thEtaPOIW")); |
| 4437 | |
| 4438 | // non-weighted correlations for each (pt,eta) bin for RPs: |
| 4439 | TProfile2D *twoPtEtaRP = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2pPtEtaRP")); |
| 4440 | TProfile2D *fourPtEtaRP = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4pPtEtaRP")); |
| 4441 | TProfile2D *sixPtEtaRP = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f6pPtEtaRP")); |
| 4442 | TProfile2D *eightPtEtaRP = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f8pPtEtaRP")); |
| 2bdc5281 |
4443 | |
| 4444 | // corrections for non-uniform acceptance to non-weighted correlations for differential flow of RPs: |
| 4445 | TH2D *twoFinalCorrectionForNUAPtEtaRP = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f2pFinalCorrectionsForNUAPtEtaRP")); |
| 4446 | TH2D *fourFinalCorrectionForNUAPtEtaRP = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f4pFinalCorrectionsForNUAPtEtaRP")); |
| 4447 | TH2D *sixFinalCorrectionForNUAPtEtaRP = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f6pFinalCorrectionsForNUAPtEtaRP")); |
| 4448 | TH2D *eightFinalCorrectionForNUAPtEtaRP = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f8pFinalCorrectionsForNUAPtEtaRP")); |
| 4449 | |
| 4450 | // corrections for non-uniform acceptance to non-weighted correlations for differential flow of RPs: |
| 4451 | TH1D *twoFinalCorrectionForNUAPtRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f2pFinalCorrectionsForNUAPtRP")); |
| 4452 | TH1D *fourFinalCorrectionForNUAPtRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f4pFinalCorrectionsForNUAPtRP")); |
| 4453 | TH1D *sixFinalCorrectionForNUAPtRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f6pFinalCorrectionsForNUAPtRP")); |
| 4454 | TH1D *eightFinalCorrectionForNUAPtRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f8pFinalCorrectionsForNUAPtRP")); |
| 4455 | |
| 4456 | // corrections for non-uniform acceptance to non-weighted correlations for differential flow of RPs: |
| 4457 | TH1D *twoFinalCorrectionForNUAEtaRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f2pFinalCorrectionsForNUAEtaRP")); |
| 4458 | TH1D *fourFinalCorrectionForNUAEtaRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f4pFinalCorrectionsForNUAEtaRP")); |
| 4459 | TH1D *sixFinalCorrectionForNUAEtaRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f6pFinalCorrectionsForNUAEtaRP")); |
| 4460 | TH1D *eightFinalCorrectionForNUAEtaRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("f8pFinalCorrectionsForNUAEtaRP")); |
| fd46c3dd |
4461 | |
| 4462 | // non-weighted final results for differential flow for RPs: |
| 4463 | // 3D (pt,eta) |
| 4464 | TH2D *vn2ndPtEtaRP = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndPtEtaRP")); |
| 4465 | TH2D *vn4thPtEtaRP = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thPtEtaRP")); |
| 4466 | TH2D *vn6thPtEtaRP = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thPtEtaRP")); |
| 4467 | TH2D *vn8thPtEtaRP = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thPtEtaRP")); |
| 4468 | // 2D (pt) |
| 4469 | TH1D *vn2ndPtRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndPtRP")); |
| 4470 | TH1D *vn4thPtRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thPtRP")); |
| 4471 | TH1D *vn6thPtRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thPtRP")); |
| 4472 | TH1D *vn8thPtRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thPtRP")); |
| 4473 | // 2D (eta) |
| 4474 | TH1D *vn2ndEtaRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndEtaRP")); |
| 4475 | TH1D *vn4thEtaRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thEtaRP")); |
| 4476 | TH1D *vn6thEtaRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thEtaRP")); |
| 4477 | TH1D *vn8thEtaRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thEtaRP")); |
| 4478 | |
| 4479 | // weighted correlations for each (pt,eta) bin for RPs: |
| 4480 | TProfile2D *twoPtEtaRPW = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2pPtEtaRPW")); |
| 4481 | TProfile2D *fourPtEtaRPW = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4pPtEtaRPW")); |
| 4482 | TProfile2D *sixPtEtaRPW = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f6pPtEtaRPW")); |
| 4483 | TProfile2D *eightPtEtaRPW = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f8pPtEtaRPW")); |
| 4484 | |
| 4485 | // weighted final results for differential flow for RPs: |
| 4486 | // 3D (pt,eta) |
| 4487 | TH2D *vn2ndPtEtaRPW = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndPtEtaRPW")); |
| 4488 | TH2D *vn4thPtEtaRPW = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thPtEtaRPW")); |
| 4489 | TH2D *vn6thPtEtaRPW = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thPtEtaRPW")); |
| 4490 | TH2D *vn8thPtEtaRPW = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thPtEtaRPW")); |
| 4491 | // 2D (pt) |
| 4492 | TH1D *vn2ndPtRPW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndPtRPW")); |
| 4493 | TH1D *vn4thPtRPW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thPtRPW")); |
| 4494 | TH1D *vn6thPtRPW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thPtRPW")); |
| 4495 | TH1D *vn8thPtRPW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thPtRPW")); |
| 4496 | // 2D (eta) |
| 4497 | TH1D *vn2ndEtaRPW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndEtaRPW")); |
| 4498 | TH1D *vn4thEtaRPW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thEtaRPW")); |
| 4499 | TH1D *vn6thEtaRPW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thEtaRPW")); |
| 4500 | TH1D *vn8thEtaRPW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thEtaRPW")); |
| 4501 | // ............................................................................................................................................... |
| 4502 | |
| 4503 | |
| 4504 | |
| 4505 | //---------------------------------------------------- |
| 4506 | |
| 4507 | this->SetUseWeightsBits(useWeightsBits); |
| c365fe76 |
4508 | this->SetFinalCorrectionsForNUA(finalCorrectionsForNUA); |
| fd46c3dd |
4509 | this->SetIntFlowResults(intFlowResultsQC); |
| 4510 | this->SetIntFlowResultsW(intFlowResultsQCW); |
| 4511 | this->SetIntFlowResultsPOI(intFlowResultsPOIQC); |
| 4512 | this->SetIntFlowResultsPOIW(intFlowResultsPOIQCW); |
| 4513 | this->SetIntFlowResultsRP(intFlowResultsRPQC); |
| 4514 | this->SetIntFlowResultsRPW(intFlowResultsRPQCW); |
| 4515 | |
| 4516 | this->SetDiffFlowResults2nd(diffFlowResults2ndOrder); |
| 4517 | this->SetDiffFlowResults4th(diffFlowResults4thOrder); |
| 4518 | this->SetCovariances(covariances); |
| 4519 | |
| 4520 | this->SetCommonHists2nd(commonHist2nd); |
| 4521 | this->SetCommonHists4th(commonHist4th); |
| 4522 | this->SetCommonHists6th(commonHist6th); |
| 4523 | this->SetCommonHists8th(commonHist8th); |
| 4524 | |
| 4525 | this->SetCommonHistsResults2nd(commonHistRes2nd); |
| 4526 | this->SetCommonHistsResults4th(commonHistRes4th); |
| 4527 | this->SetCommonHistsResults6th(commonHistRes6th); |
| 4528 | this->SetCommonHistsResults8th(commonHistRes8th); |
| 4529 | |
| 4530 | this->SetAverageMultiplicity(AvMult); |
| 4531 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| 4532 | // !!!! to be removed !!!! |
| 4533 | this->SetQvectorForEachEventX(qvectorForEachEventX); |
| 4534 | this->SetQvectorForEachEventY(qvectorForEachEventY); |
| 4535 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| 4536 | this->SetQCorrelations(qCorrelations); |
| 4537 | this->SetQCorrelationsW(qCorrelationsW); |
| c365fe76 |
4538 | this->SetQCorrectionsCos(qCorrectionsCos); |
| 4539 | this->SetQCorrectionsSin(qCorrectionsSin); |
| fd46c3dd |
4540 | this->SetQProduct(QProduct); |
| 4541 | this->SetQVectorComponents(QVectorComponents); |
| 4542 | |
| 4543 | this->SetTwo1n1nPerPtBinRP(binnedPt2p1n1nRP); |
| 4544 | this->SetFour1n1n1n1nPerPtBinRP(binnedPt4p1n1n1n1nRP); |
| 4545 | |
| 4546 | this->SetTwo1n1nPerEtaBinRP(binnedEta2p1n1nRP); |
| 4547 | this->SetFour1n1n1n1nPerEtaBinRP(binnedEta4p1n1n1n1nRP); |
| 4548 | |
| 4549 | this->SetTwo1n1nPerPtBinPOI(binnedPt2p1n1nPOI); |
| 4550 | this->SetFour1n1n1n1nPerPtBinPOI(binnedPt4p1n1n1n1nPOI); |
| 4551 | |
| 4552 | this->SetTwo1n1nPerEtaBinPOI(binnedEta2p1n1nPOI); |
| 4553 | this->SetFour1n1n1n1nPerEtaBinPOI(binnedEta4p1n1n1n1nPOI); |
| 4554 | |
| 4555 | this->SetTwo1n1nWPerPtBinPOI(binnedWPt2p1n1nPOI); |
| 4556 | this->SetFour1n1n1n1nWPerPtBinPOI(binnedWPt4p1n1n1n1nPOI); |
| 4557 | |
| 4558 | this->SetTwo1n1nWPerEtaBinPOI(binnedWEta2p1n1nPOI); |
| 4559 | this->SetFour1n1n1n1nWPerEtaBinPOI(binnedWEta4p1n1n1n1nPOI); |
| 4560 | |
| 4561 | this->SetTwo1n1nWPerPtBinRP(binnedWPt2p1n1nRP); |
| 4562 | this->SetFour1n1n1n1nWPerPtBinRP(binnedWPt4p1n1n1n1nRP); |
| 4563 | |
| 4564 | this->SetTwo1n1nWPerEtaBinRP(binnedWEta2p1n1nRP); |
| 4565 | this->SetFour1n1n1n1nWPerEtaBinRP(binnedWEta4p1n1n1n1nRP); |
| 4566 | |
| 4567 | // nested loops results: |
| 4568 | this->SetDirectCorrelations(directCorrelations); |
| 4569 | this->SetDirectCorrelationsW(directCorrelationsW); |
| 4570 | this->SetDirectCorrelationsDiffFlow(directCorrelationsDiffFlow); |
| 4571 | this->SetDirectCorrelationsDiffFlowW(directCorrelationsDiffFlowW); |
| c365fe76 |
4572 | this->SetDirectCorrectionsCos(directCorrectionsCos); |
| 4573 | this->SetDirectCorrectionsSin(directCorrectionsSin); |
| 2bdc5281 |
4574 | this->SetDirectCorrectionsDiffFlowCos(directCorrectionsDiffFlowCos); |
| 4575 | this->SetDirectCorrectionsDiffFlowSin(directCorrectionsDiffFlowSin); |
| fd46c3dd |
4576 | |
| 4577 | // non-weighted correlations for each (pt,eta) bin for POIs: |
| 4578 | this->Set2pPtEtaPOI(twoPtEtaPOI); |
| 4579 | this->Set4pPtEtaPOI(fourPtEtaPOI); |
| 4580 | this->Set6pPtEtaPOI(sixPtEtaPOI); |
| 4581 | this->Set8pPtEtaPOI(eightPtEtaPOI); |
| 4582 | |
| 2bdc5281 |
4583 | |
| 4584 | //............................................ |
| 4585 | // terms: corrections for non-uniform acceptance to non-weighted correlations for differential flow of POIs: |
| 4586 | this->SetCorrectionsCosP1nPsiPtEtaPOI(correctionsCosP1nPsiPtEtaPOI); |
| 4587 | this->SetCorrectionsSinP1nPsiPtEtaPOI(correctionsSinP1nPsiPtEtaPOI); |
| 4588 | |
| 4589 | |
| 4590 | //.... |
| 4591 | |
| 4592 | |
| 4593 | this->SetCorrectionsCosP1nPsiPtEtaRP(correctionsCosP1nPsiPtEtaRP); |
| 4594 | this->SetCorrectionsSinP1nPsiPtEtaRP(correctionsSinP1nPsiPtEtaRP); |
| 4595 | //............................................ |
| 4596 | |
| 4597 | // corrections for non-uniform acceptance to non-weighted correlations for differential flow of POIs: |
| 4598 | this->Set2pFinalCorrectionsForNUAPtEtaPOI(twoFinalCorrectionForNUAPtEtaPOI); |
| 4599 | this->Set4pFinalCorrectionsForNUAPtEtaPOI(fourFinalCorrectionForNUAPtEtaPOI); |
| 4600 | this->Set6pFinalCorrectionsForNUAPtEtaPOI(sixFinalCorrectionForNUAPtEtaPOI); |
| 4601 | this->Set8pFinalCorrectionsForNUAPtEtaPOI(eightFinalCorrectionForNUAPtEtaPOI); |
| 4602 | |
| 4603 | // corrections for non-uniform acceptance to non-weighted correlations for differential flow of POIs: |
| 4604 | this->Set2pFinalCorrectionsForNUAPtPOI(twoFinalCorrectionForNUAPtPOI); |
| 4605 | this->Set4pFinalCorrectionsForNUAPtPOI(fourFinalCorrectionForNUAPtPOI); |
| 4606 | this->Set6pFinalCorrectionsForNUAPtPOI(sixFinalCorrectionForNUAPtPOI); |
| 4607 | this->Set8pFinalCorrectionsForNUAPtPOI(eightFinalCorrectionForNUAPtPOI); |
| 4608 | |
| 4609 | // corrections for non-uniform acceptance to non-weighted correlations for differential flow of POIs: |
| 4610 | this->Set2pFinalCorrectionsForNUAEtaPOI(twoFinalCorrectionForNUAEtaPOI); |
| 4611 | this->Set4pFinalCorrectionsForNUAEtaPOI(fourFinalCorrectionForNUAEtaPOI); |
| 4612 | this->Set6pFinalCorrectionsForNUAEtaPOI(sixFinalCorrectionForNUAEtaPOI); |
| 4613 | this->Set8pFinalCorrectionsForNUAEtaPOI(eightFinalCorrectionForNUAEtaPOI); |
| 4614 | |
| fd46c3dd |
4615 | // non-weighted final results for differential flow for POIs: |
| 4616 | // 3D (pt,eta) |
| 4617 | this->Setvn2ndPtEtaPOI(vn2ndPtEtaPOI); |
| 4618 | this->Setvn4thPtEtaPOI(vn4thPtEtaPOI); |
| 4619 | this->Setvn6thPtEtaPOI(vn6thPtEtaPOI); |
| 4620 | this->Setvn8thPtEtaPOI(vn8thPtEtaPOI); |
| 4621 | // 2D (pt) |
| 4622 | this->Setvn2ndPtPOI(vn2ndPtPOI); |
| 4623 | this->Setvn4thPtPOI(vn4thPtPOI); |
| 4624 | this->Setvn6thPtPOI(vn6thPtPOI); |
| 4625 | this->Setvn8thPtPOI(vn8thPtPOI); |
| 4626 | // 2D (eta) |
| 4627 | this->Setvn2ndEtaPOI(vn2ndEtaPOI); |
| 4628 | this->Setvn4thEtaPOI(vn4thEtaPOI); |
| 4629 | this->Setvn6thEtaPOI(vn6thEtaPOI); |
| 4630 | this->Setvn8thEtaPOI(vn8thEtaPOI); |
| 4631 | |
| 4632 | // weighted correlations for each (pt,eta) bin for POIs: |
| 4633 | this->Set2pPtEtaPOIW(twoPtEtaPOIW); |
| 4634 | this->Set4pPtEtaPOIW(fourPtEtaPOIW); |
| 4635 | this->Set6pPtEtaPOIW(sixPtEtaPOIW); |
| 4636 | this->Set8pPtEtaPOIW(eightPtEtaPOIW); |
| 4637 | |
| 4638 | // weighted final results for differential flow for POIs: |
| 4639 | // 3D (pt,eta) |
| 4640 | this->Setvn2ndPtEtaPOIW(vn2ndPtEtaPOIW); |
| 4641 | this->Setvn4thPtEtaPOIW(vn4thPtEtaPOIW); |
| 4642 | this->Setvn6thPtEtaPOIW(vn6thPtEtaPOIW); |
| 4643 | this->Setvn8thPtEtaPOIW(vn8thPtEtaPOIW); |
| 4644 | // 2D (pt) |
| 4645 | this->Setvn2ndPtPOIW(vn2ndPtPOIW); |
| 4646 | this->Setvn4thPtPOIW(vn4thPtPOIW); |
| 4647 | this->Setvn6thPtPOIW(vn6thPtPOIW); |
| 4648 | this->Setvn8thPtPOIW(vn8thPtPOIW); |
| 4649 | // 2D (eta) |
| 4650 | this->Setvn2ndEtaPOIW(vn2ndEtaPOIW); |
| 4651 | this->Setvn4thEtaPOIW(vn4thEtaPOIW); |
| 4652 | this->Setvn6thEtaPOIW(vn6thEtaPOIW); |
| 4653 | this->Setvn8thEtaPOIW(vn8thEtaPOIW); |
| 4654 | |
| 4655 | // non-weighted correlations for each (pt,eta) bin for RPs: |
| 4656 | this->Set2pPtEtaRP(twoPtEtaRP); |
| 4657 | this->Set4pPtEtaRP(fourPtEtaRP); |
| 4658 | this->Set6pPtEtaRP(sixPtEtaRP); |
| 4659 | this->Set8pPtEtaRP(eightPtEtaRP); |
| 4660 | |
| 2bdc5281 |
4661 | // corrections for non-uniform acceptance to non-weighted correlations for differential flow of RPs: |
| 4662 | this->Set2pFinalCorrectionsForNUAPtEtaRP(twoFinalCorrectionForNUAPtEtaRP); |
| 4663 | this->Set4pFinalCorrectionsForNUAPtEtaRP(fourFinalCorrectionForNUAPtEtaRP); |
| 4664 | this->Set6pFinalCorrectionsForNUAPtEtaRP(sixFinalCorrectionForNUAPtEtaRP); |
| 4665 | this->Set8pFinalCorrectionsForNUAPtEtaRP(eightFinalCorrectionForNUAPtEtaRP); |
| 4666 | |
| 4667 | // corrections for non-uniform acceptance to non-weighted correlations for differential flow of RPs: |
| 4668 | this->Set2pFinalCorrectionsForNUAPtRP(twoFinalCorrectionForNUAPtRP); |
| 4669 | this->Set4pFinalCorrectionsForNUAPtRP(fourFinalCorrectionForNUAPtRP); |
| 4670 | this->Set6pFinalCorrectionsForNUAPtRP(sixFinalCorrectionForNUAPtRP); |
| 4671 | this->Set8pFinalCorrectionsForNUAPtRP(eightFinalCorrectionForNUAPtRP); |
| 4672 | |
| 4673 | // corrections for non-uniform acceptance to non-weighted correlations for differential flow of RPs: |
| 4674 | this->Set2pFinalCorrectionsForNUAEtaRP(twoFinalCorrectionForNUAEtaRP); |
| 4675 | this->Set4pFinalCorrectionsForNUAEtaRP(fourFinalCorrectionForNUAEtaRP); |
| 4676 | this->Set6pFinalCorrectionsForNUAEtaRP(sixFinalCorrectionForNUAEtaRP); |
| 4677 | this->Set8pFinalCorrectionsForNUAEtaRP(eightFinalCorrectionForNUAEtaRP); |
| 4678 | |
| fd46c3dd |
4679 | // non-weighted final results for differential flow for RPs: |
| 4680 | // 3D (pt,eta) |
| 4681 | this->Setvn2ndPtEtaRP(vn2ndPtEtaRP); |
| 4682 | this->Setvn4thPtEtaRP(vn4thPtEtaRP); |
| 4683 | this->Setvn6thPtEtaRP(vn6thPtEtaRP); |
| 4684 | this->Setvn8thPtEtaRP(vn8thPtEtaRP); |
| 4685 | // 2D (pt) |
| 4686 | this->Setvn2ndPtRP(vn2ndPtRP); |
| 4687 | this->Setvn4thPtRP(vn4thPtRP); |
| 4688 | this->Setvn6thPtRP(vn6thPtRP); |
| 4689 | this->Setvn8thPtRP(vn8thPtRP); |
| 4690 | // 2D (eta) |
| 4691 | this->Setvn2ndEtaRP(vn2ndEtaRP); |
| 4692 | this->Setvn4thEtaRP(vn4thEtaRP); |
| 4693 | this->Setvn6thEtaRP(vn6thEtaRP); |
| 4694 | this->Setvn8thEtaRP(vn8thEtaRP); |
| 4695 | |
| 4696 | // weighted correlations for each (pt,eta) bin for RPs: |
| 4697 | this->Set2pPtEtaRPW(twoPtEtaRPW); |
| 4698 | this->Set4pPtEtaRPW(fourPtEtaRPW); |
| 4699 | this->Set6pPtEtaRPW(sixPtEtaRPW); |
| 4700 | this->Set8pPtEtaRPW(eightPtEtaRPW); |
| 4701 | |
| 4702 | // weighted final results for differential flow for RPs: |
| 4703 | // 3D (pt,eta) |
| 4704 | this->Setvn2ndPtEtaRPW(vn2ndPtEtaRPW); |
| 4705 | this->Setvn4thPtEtaRPW(vn4thPtEtaRPW); |
| 4706 | this->Setvn6thPtEtaRPW(vn6thPtEtaRPW); |
| 4707 | this->Setvn8thPtEtaRPW(vn8thPtEtaRPW); |
| 4708 | // 2D (pt) |
| 4709 | this->Setvn2ndPtRPW(vn2ndPtRPW); |
| 4710 | this->Setvn4thPtRPW(vn4thPtRPW); |
| 4711 | this->Setvn6thPtRPW(vn6thPtRPW); |
| 4712 | this->Setvn8thPtRPW(vn8thPtRPW); |
| 4713 | // 2D (eta) |
| 4714 | this->Setvn2ndEtaRPW(vn2ndEtaRPW); |
| 4715 | this->Setvn4thEtaRPW(vn4thEtaRPW); |
| 4716 | this->Setvn6thEtaRPW(vn6thEtaRPW); |
| 4717 | this->Setvn8thEtaRPW(vn8thEtaRPW); |
| 4718 | } |
| 4719 | } |
| 4720 | |
| 4721 | |
| 4722 | //================================================================================================================================ |
| 4723 | |
| 4724 | |
| 9c1a9547 |
4725 | void AliFlowAnalysisWithQCumulants::Finish() |
| 4726 | { |
| 4727 | // calculate the final results |
| 3d824203 |
4728 | |
| 9c1a9547 |
4729 | fUseWeights = fUseWeightsBits->TestBitNumber(1); // to be improved |
| 3d824203 |
4730 | |
| 9c1a9547 |
4731 | // compare correlations needed for integrated flow: |
| 4732 | if(fDirectCorrelations->GetBinContent(1) != 0 || fDirectCorrelationsW->GetBinContent(1) != 0) |
| 4733 | { |
| 4734 | this->CompareDirectAndQCorrelationsForIntegratedFlow(fUseWeights); |
| 4735 | } |
| 2bdc5281 |
4736 | // compare correlations needed for differential flow: |
| 9c1a9547 |
4737 | if(fDirectCorrelationsDiffFlow->GetBinContent(1) != 0 || fDirectCorrelationsDiffFlowW->GetBinContent(1) != 0) |
| 4738 | { |
| 4739 | this->CompareDirectAndQCorrelationsForDifferentialFlow(fUseWeights); |
| 4740 | } |
| 3d824203 |
4741 | |
| 9c1a9547 |
4742 | |
| 3d824203 |
4743 | |
| 9c1a9547 |
4744 | |
| 4745 | // ************************************* |
| 4746 | // **** CALCULATE THE FINAL RESULTS **** |
| 4747 | // ************************************* |
| 4748 | |
| 2bdc5281 |
4749 | if(!fUseWeights) |
| 4750 | { |
| 4751 | this->CalculateFinalCorrectionsForNonUniformAcceptanceForNoNameIntegratedFlow(); // to be improved (to calculate also when weights are used) |
| 4752 | this->CalculateFinalCorrectionsForNonUniformAcceptanceForDifferentialFlow(kFALSE,"POI"); // to be improved (to calculate also when weights are used) |
| 4753 | this->CalculateFinalCorrectionsForNonUniformAcceptanceForDifferentialFlow(kFALSE,"RP"); // to be improved (to calculate also when weights are used) |
| 4754 | } |
| c365fe76 |
4755 | |
| 9c1a9547 |
4756 | // integrated flow ('no-name') without weights: |
| 4757 | // calculate final results for no-name integrated flow without weights: |
| 4758 | this->CalculateFinalResultsForNoNameIntegratedFlow(kFALSE); |
| 4759 | |
| 4760 | // integrated flow ('no-name') with weights: |
| 4761 | // calculate final results for no-name integrated flow with weights: |
| 4762 | if(fUseWeights) this->CalculateFinalResultsForNoNameIntegratedFlow(fUseWeights); |
| 4763 | |
| 9c1a9547 |
4764 | // **** POI **** |
| 4765 | |
| 4766 | // differential flow (POI) without weights: |
| 4767 | // calculate final results for 2nd order differential flow of POIs without weights: |
| 3c16adde |
4768 | this->CalculateFinalResultsForDifferentialFlow(fvn2ndPtEtaPOI,fvn2ndPtPOI,fvn2ndEtaPOI,f2pPtEtaPOI); |
| 9c1a9547 |
4769 | // calculate final results for 4th order differential flow of POIs without weights: |
| 3c16adde |
4770 | this->CalculateFinalResultsForDifferentialFlow(fvn4thPtEtaPOI,fvn4thPtPOI,fvn4thEtaPOI,f2pPtEtaPOI,f4pPtEtaPOI); |
| 9c1a9547 |
4771 | // calculate final results for 6th order differential flow of POIs without weights: |
| 3c16adde |
4772 | // this->CalculateFinalResultsForDifferentialFlow(fvn6thPtEtaPOI,fvn6thPtPOI,fvn6thEtaPOI,f2pPtEtaPOI,f4pPtEtaPOI,f6pPtEtaPOI); |
| 9c1a9547 |
4773 | // calculate final results for 8th order differential flow of POIs without weights: |
| 3c16adde |
4774 | // this->CalculateFinalResultsForDifferentialFlow(fvn8thPtEtaPOI,fvn8thPtPOI,fvn8thEtaPOI,f2pPtEtaPOI,f4pPtEtaPOI,f6pPtEtaPOI,f8pPtEtaPOI); |
| 9c1a9547 |
4775 | |
| 4776 | // differential flow (POI) with weights: |
| 4777 | // calculate final results for 2nd order differential flow of POIs with weights: |
| 3c16adde |
4778 | if(fUseWeights) this->CalculateFinalResultsForDifferentialFlow(fvn2ndPtEtaPOIW,fvn2ndPtPOIW,fvn2ndEtaPOIW,f2pPtEtaPOIW); |
| 9c1a9547 |
4779 | // calculate final results for 4th order differential flow of POIs without weights: |
| 3c16adde |
4780 | if(fUseWeights) this->CalculateFinalResultsForDifferentialFlow(fvn4thPtEtaPOIW,fvn4thPtPOIW,fvn4thEtaPOIW,f2pPtEtaPOIW,f4pPtEtaPOIW); |
| 9c1a9547 |
4781 | // calculate final results for 6th order differential flow of POIs with weights: |
| 3c16adde |
4782 | // if(fUseWeights) this->CalculateFinalResultsForDifferentialFlow(fvn6thPtEtaPOIW,fvn6thPtPOIW,fvn6thEtaPOIW,f2pPtEtaPOIW,f4pPtEtaPOIW,f6pPtEtaPOIW); |
| 9c1a9547 |
4783 | // calculate final results for 8th order differential flow of POIs without weights: |
| 3c16adde |
4784 | // if(fUseWeights) this->CalculateFinalResultsForDifferentialFlow(fvn8thPtEtaPOIW,fvn8thPtPOIW,fvn8thEtaPOIW,f2pPtEtaPOIW,f4pPtEtaPOIW,f6pPtEtaPOIW,f8pPtEtaPOIW); |
| 9c1a9547 |
4785 | |
| 4786 | // integrated flow (POI) without weights: |
| 4787 | // calculate final results for integrated flow of POIs without weights: |
| 4788 | this->CalculateFinalResultsForRPandPOIIntegratedFlow(kFALSE,"POI"); |
| 4789 | |
| 4790 | // integrated flow (POI) with weights: |
| 4791 | // calculate final results for integrated flow of POIs with weights: |
| fcb2164b |
4792 | if(fUseWeights) this->CalculateFinalResultsForRPandPOIIntegratedFlow(kTRUE,"POI"); |
| 9c1a9547 |
4793 | |
| 4794 | |
| 4795 | // **** RP **** |
| 4796 | |
| 4797 | // differential flow (RP) without weights: |
| 4798 | // calculate final results for 2nd order differential flow of RPs without weights: |
| 3c16adde |
4799 | this->CalculateFinalResultsForDifferentialFlow(fvn2ndPtEtaRP,fvn2ndPtRP,fvn2ndEtaRP,f2pPtEtaRP); |
| 9c1a9547 |
4800 | // calculate final results for 4th order differential flow of RPs without weights: |
| 3c16adde |
4801 | this->CalculateFinalResultsForDifferentialFlow(fvn4thPtEtaRP,fvn4thPtRP,fvn4thEtaRP,f2pPtEtaRP,f4pPtEtaRP); |
| 9c1a9547 |
4802 | // calculate final results for 6th order differential flow of RPs without weights: |
| 3c16adde |
4803 | // this->CalculateFinalResultsForDifferentialFlow(fvn6thPtEtaRP,fvn6thPtRP,fvn6thEtaRP,f2pPtEtaRP,f4pPtEtaRP,f6pPtEtaRP); |
| 9c1a9547 |
4804 | // calculate final results for 8th order differential flow of RPs without weights: |
| 3c16adde |
4805 | // this->CalculateFinalResultsForDifferentialFlow(fvn8thPtEtaRP,fvn8thPtRP,fvn8thEtaRP,f2pPtEtaRP,f4pPtEtaRP,f6pPtEtaRP,f8pPtEtaRP); |
| 9c1a9547 |
4806 | |
| 4807 | // differential flow (RP) with weights: |
| 4808 | // calculate final results for 2nd order differential flow of RPs with weights: |
| 3c16adde |
4809 | if(fUseWeights) this->CalculateFinalResultsForDifferentialFlow(fvn2ndPtEtaRPW,fvn2ndPtRPW,fvn2ndEtaRPW,f2pPtEtaRPW); |
| 9c1a9547 |
4810 | // calculate final results for 4th order differential flow of RPs without weights: |
| 3c16adde |
4811 | if(fUseWeights) this->CalculateFinalResultsForDifferentialFlow(fvn4thPtEtaRPW,fvn4thPtRPW,fvn4thEtaRPW,f2pPtEtaRPW,f4pPtEtaRPW); |
| 9c1a9547 |
4812 | // calculate final results for 6th order differential flow of RPs with weights: |
| 3c16adde |
4813 | // if(fUseWeights) this->CalculateFinalResultsForDifferentialFlow(fvn6thPtEtaRPW,fvn6thPtRPW,fvn6thEtaRPW,f2pPtEtaRPW,f4pPtEtaRPW,f6pPtEtaRPW); |
| 9c1a9547 |
4814 | // calculate final results for 8th order differential flow of RPs without weights: |
| 3c16adde |
4815 | // if(fUseWeights) this->CalculateFinalResultsForDifferentialFlow(fvn8thPtEtaRPW,fvn8thPtRPW,fvn8thEtaRPW,f2pPtEtaRPW,f4pPtEtaRPW,f6pPtEtaRPW,f8pPtEtaRPW); |
| 9c1a9547 |
4816 | |
| 4817 | // integrated flow (RP) without weights: |
| 4818 | // calculate final results for integrated flow of RPs without weights: |
| 4819 | this->CalculateFinalResultsForRPandPOIIntegratedFlow(kFALSE,"RP"); |
| 4820 | |
| 4821 | // integrated flow (RP) with weights: |
| 4822 | // calculate final results for integrated flow of POIs with weights: |
| fcb2164b |
4823 | if(fUseWeights) this->CalculateFinalResultsForRPandPOIIntegratedFlow(kTRUE,"RP"); |
| 3d824203 |
4824 | |
| 9c1a9547 |
4825 | |
| 3d824203 |
4826 | |
| 9c1a9547 |
4827 | // ***************************************************** |
| 4828 | // **** PRINT THE FINAL RESULTS FOR INTEGRATED FLOW **** |
| 4829 | // ***************************************************** |
| 4830 | |
| 4831 | // print the final results for 'no-name' integrated flow without weights: |
| 4832 | this->PrintFinalResultsForIntegratedFlow(kFALSE,"NONAME"); // OK tested (just still nEvts and AvM) |
| 4833 | |
| 4834 | // print the final results for 'no-name' integrated flow with weights: |
| 4835 | if(fUseWeights) this->PrintFinalResultsForIntegratedFlow(fUseWeights,"NONAME"); // OK tested (just still nEvts and AvM) |
| 4836 | |
| 4837 | // print the final results for RPs integrated flow without weights: |
| 4838 | this->PrintFinalResultsForIntegratedFlow(kFALSE,"RP"); |
| 4839 | |
| 4840 | // print the final results for RPs integrated flow with weights: |
| 4841 | if(fUseWeights) this->PrintFinalResultsForIntegratedFlow(kTRUE,"RP"); |
| 4842 | |
| 4843 | // print the final results for POIs integrated flow without weights: |
| 4844 | this->PrintFinalResultsForIntegratedFlow(kFALSE,"POI"); |
| 4845 | |
| 4846 | // print the final results for POIs integrated flow with weights: |
| 4847 | if(fUseWeights) this->PrintFinalResultsForIntegratedFlow(kTRUE,"POI"); |
| 4848 | |
| 4849 | //this->TempDeleteMe(); |
| 4850 | |
| 4851 | } // end of AliFlowAnalysisWithQCumulants::Finish() |
| 4852 | |
| 4853 | |
| 4854 | //================================================================================================================================ |
| 4855 | |
| 4856 | |
| 4857 | TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) const |
| 4858 | { |
| 4859 | // project 2D profile onto pt axis to get 1D profile |
| 4860 | |
| 4861 | Int_t nBinsPt = profilePtEta->GetNbinsX(); |
| 4862 | Double_t dPtMin = (profilePtEta->GetXaxis())->GetXmin(); |
| 4863 | Double_t dPtMax = (profilePtEta->GetXaxis())->GetXmax(); |
| 4864 | |
| 4865 | Int_t nBinsEta = profilePtEta->GetNbinsY(); |
| 4866 | |
| 4867 | TProfile *profilePt = new TProfile("","",nBinsPt,dPtMin,dPtMax); |
| 4868 | |
| 4869 | for(Int_t p=1;p<=nBinsPt;p++) |
| 4870 | { |
| 4871 | Double_t contentPt = 0.; |
| 4872 | Double_t entryPt = 0.; |
| 4873 | for(Int_t e=1;e<=nBinsEta;e++) |
| 4874 | { |
| 4875 | contentPt += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))) |
| 4876 | * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); |
| 4877 | entryPt += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); |
| 4878 | } |
| 4879 | profilePt->SetBinContent(p,contentPt); |
| 4880 | profilePt->SetBinEntries(p,entryPt); |
| 4881 | } |
| 4882 | |
| 4883 | return profilePt; |
| 4884 | |
| 4885 | } // end of TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) |
| 4886 | |
| 4887 | |
| 4888 | //================================================================================================================================ |
| 4889 | |
| 4890 | |
| 4891 | TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) const |
| 4892 | { |
| 4893 | // project 2D profile onto eta axis to get 1D profile |
| 4894 | |
| 4895 | Int_t nBinsEta = profilePtEta->GetNbinsY(); |
| 4896 | Double_t dEtaMin = (profilePtEta->GetYaxis())->GetXmin(); |
| 4897 | Double_t dEtaMax = (profilePtEta->GetYaxis())->GetXmax(); |
| 4898 | |
| 4899 | Int_t nBinsPt = profilePtEta->GetNbinsX(); |
| 4900 | |
| 4901 | TProfile *profileEta = new TProfile("","",nBinsEta,dEtaMin,dEtaMax); |
| 4902 | |
| 4903 | for(Int_t e=1;e<=nBinsEta;e++) |
| 4904 | { |
| 4905 | Double_t contentEta = 0.; |
| 4906 | Double_t entryEta = 0.; |
| 4907 | for(Int_t p=1;p<=nBinsPt;p++) |
| 4908 | { |
| 4909 | contentEta += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))) |
| 4910 | * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); |
| 4911 | entryEta += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); |
| 4912 | } |
| 4913 | profileEta->SetBinContent(e,contentEta); |
| 4914 | profileEta->SetBinEntries(e,entryEta); |
| 4915 | } |
| 4916 | |
| 4917 | return profileEta; |
| 4918 | |
| 4919 | } // end of TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) |
| 4920 | |
| 4921 | |
| 4922 | //================================================================================================================================ |
| 4923 | |
| 4924 | |
| 2bdc5281 |
4925 | void AliFlowAnalysisWithQCumulants::CalculateFinalCorrectionsForNonUniformAcceptanceForNoNameIntegratedFlow(Bool_t useWeights) |
| c365fe76 |
4926 | { |
| 4927 | // final corrections for non-uniform acceptance for QC{2}, QC{4}, QC{6} and QC{8} |
| 4928 | |
| 4929 | // 2-, 4-, 6- and 8-particle azimuthal correlation (not corrected for bias from non-uniform accaptance!): |
| 4930 | Double_t two = 0.; // <<2>>_{n|n} |
| 4931 | Double_t four = 0.; // <<4>>_{n,n|n,n} |
| 4932 | Double_t six = 0.; // <<6>>_{n,n,n|n,n,n} |
| 4933 | Double_t eight = 0.; // <<8>>_{n,n,n,n|n,n,n,n} |
| 4934 | |
| 4935 | if(!(useWeights)) |
| 4936 | { |
| 4937 | // measured multi-particle correlations: |
| 4938 | two = fQCorrelations->GetBinContent(1); |
| 4939 | four = fQCorrelations->GetBinContent(11); |
| 4940 | six = fQCorrelations->GetBinContent(24); |
| 4941 | eight = fQCorrelations->GetBinContent(31); |
| 4942 | } |
| 4943 | |
| 4944 | // corrections for non-uniform acceptance for QC{2}, QC{4}, QC{6} and QC{8} |
| 4945 | Double_t twoCorrection = 0.; // bias to QC{2} coming from non-uniform acceptance of the detector |
| 4946 | Double_t fourCorrection = 0.; // bias to QC{4} coming from non-uniform acceptance of the detector |
| 4947 | //Double_t sixCorrection = 0.; // bias to QC{6} coming from non-uniform acceptance of the detector |
| 4948 | //Double_t eightCorrection = 0.; // bias to QC{8} coming from non-uniform acceptance of the detector |
| 4949 | |
| 2bdc5281 |
4950 | if(fQCorrectionsCos && fQCorrectionsSin && fFinalCorrectionsForNUA) |
| c365fe76 |
4951 | { |
| 4952 | // correction to QC{2}: |
| 4953 | Double_t twoCorrection1stTerm = pow(fQCorrectionsCos->GetBinContent(1),2); // <<cos(n*phi1)>>^2 |
| 4954 | Double_t twoCorrection2ndTerm = pow(fQCorrectionsSin->GetBinContent(1),2); // <<sin(n*phi1)>>^2 |
| 4955 | // final correction to QC{2}: |
| 4956 | twoCorrection = twoCorrection1stTerm + twoCorrection2ndTerm; |
| 4957 | // store final correction to QC{2}: |
| 4958 | fFinalCorrectionsForNUA->SetBinContent(1,twoCorrection); |
| 4959 | |
| 4960 | cout<<"Quantifying corrections for non-uniform acceptance for QC:"<<endl; |
| 4961 | cout<<endl; |
| 4962 | |
| 4963 | if(two-twoCorrection) |
| 4964 | { |
| 4965 | cout<<" QC{2,biased}/QC{2,corrected} = "<<two/(two-twoCorrection)<<endl; |
| 4966 | } else |
| 4967 | { |
| 4968 | cout<<" QC{2,corrected} = 0"<<endl; |
| 4969 | } |
| 4970 | |
| 4971 | // correction to QC{4}: |
| 4972 | Double_t fourCorrection1stTerm = fQCorrectionsCos->GetBinContent(1) |
| 4973 | * fQCorrectionsCos->GetBinContent(3); // <<cos(n*phi1)>><<cos(n*(phi1-phi2-phi3))>> |
| 4974 | Double_t fourCorrection2ndTerm = fQCorrectionsSin->GetBinContent(1) |
| 4975 | * fQCorrectionsSin->GetBinContent(3); // <<sin(n*phi1)>><<sin(n*(phi1-phi2-phi3))>> |
| 4976 | Double_t fourCorrection3rdTerm = pow(fQCorrectionsCos->GetBinContent(2),2); // <<cos(n*(phi1+phi2))>>^2 |
| 4977 | Double_t fourCorrection4thTerm = pow(fQCorrectionsSin->GetBinContent(2),2); // <<sin(n*(phi1+phi2))>>^2 |
| 4978 | Double_t fourCorrection5thTerm = fQCorrectionsCos->GetBinContent(2) |
| 4979 | * (pow(fQCorrectionsCos->GetBinContent(1),2) |
| 4980 | - pow(fQCorrectionsSin->GetBinContent(1),2)); // <<cos(n*(phi1+phi2))>>(<<cos(n*phi1)>>^2+<<sin(n*phi1)>>^2) |
| 4981 | Double_t fourCorrection6thTerm = fQCorrectionsSin->GetBinContent(2) |
| 4982 | * fQCorrectionsCos->GetBinContent(1) |
| 4983 | * fQCorrectionsSin->GetBinContent(1); // <<sin(n*(phi1+phi2))>><<cos(n*phi1)>><<sin(n*phi1)>> |
| 4984 | Double_t fourCorrection7thTerm = two*(pow(fQCorrectionsCos->GetBinContent(1),2) |
| 4985 | + pow(fQCorrectionsSin->GetBinContent(1),2)); // <<cos(n*(phi1-phi2))>>(<<cos(n*phi1)>>^2+<<sin(n*phi1)>>^2) |
| 4986 | Double_t fourCorrection8thTerm = pow(pow(fQCorrectionsCos->GetBinContent(1),2) |
| 4987 | + pow(fQCorrectionsSin->GetBinContent(1),2),2); // (<<cos(n*phi1)>>^2+<<sin(n*phi1)>>^2)^2 |
| 4988 | // final correction to QC{4}: |
| 4989 | fourCorrection = 4.*fourCorrection1stTerm-4.*fourCorrection2ndTerm |
| 4990 | + fourCorrection3rdTerm+fourCorrection4thTerm |
| 4991 | - 4.*fourCorrection5thTerm-8.*fourCorrection6thTerm |
| 4992 | - 8.*fourCorrection7thTerm+6.*fourCorrection8thTerm; |
| 4993 | // store final correction to QC{4}: |
| 4994 | fFinalCorrectionsForNUA->SetBinContent(2,fourCorrection); |
| 4995 | |
| 4996 | if(four-2.*pow(two,2.)-fourCorrection) |
| 4997 | { |
| 4998 | cout<<" QC{4,biased}/QC{4,corrected} = "<<(four-2.*pow(two,2.))/(four-2.*pow(two,2.)-fourCorrection)<<endl; |
| 4999 | } else |
| 5000 | { |
| 5001 | cout<<" QC{4,corrected} = 0"<<endl; |
| 5002 | } |
| 5003 | |
| 5004 | } else |
| 5005 | { |
| 2bdc5281 |
5006 | cout<<"WARNING: fQCorrectionsCos, fQCorrectionsSin or fFinalCorrectionsForNUA is NULL in QC::CFCFNUA !!!!"<<endl; |
| 5007 | cout<<" Corrections for non-uniform acceptance were not calculated for 'noname' integrated flow. "<<endl; |
| c365fe76 |
5008 | } |
| 5009 | |
| 2bdc5281 |
5010 | } // end of AliFlowAnalysisWithQCumulants::CalculateFinalCorrectionsForNonUniformAcceptanceForNoNameIntegratedFlow(Bool_t useWeights) |
| 5011 | |
| 5012 | |
| 5013 | //================================================================================================================================ |
| 5014 | |
| 5015 | |
| 5016 | void AliFlowAnalysisWithQCumulants::CalculateFinalCorrectionsForNonUniformAcceptanceForDifferentialFlow(Bool_t useWeights,TString type) |
| 5017 | { |
| 5018 | // calculate final corrections due to non-uniform acceptance of the detector to reduced multi-particle correlations |
| 5019 | if(!(useWeights)) |
| 5020 | { |
| 5021 | if(type == "POI") |
| 5022 | { |
| 5023 | // **** corrections for non-uniform acceptance for 2nd order QC' for POI's **** |
| 5024 | |
| 5025 | // 1st term: <<cos(n*psi)>><<cos(n*phi)>>: |
| 5026 | if(fCorrectionsCosP1nPsiPtEtaPOI && fQCorrectionsCos) |
| 5027 | { |
| 5028 | // pt,eta: |
| a228a60e |
5029 | if(f2pFinalCorrectionsForNUAPtEtaPOI) f2pFinalCorrectionsForNUAPtEtaPOI->Reset(); // to be improved |
| 2bdc5281 |
5030 | TH2D *correctionPtEta1stTerm = new TH2D(*(fCorrectionsCosP1nPsiPtEtaPOI->ProjectionXY("","e"))); |
| 5031 | correctionPtEta1stTerm->Scale(fQCorrectionsCos->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 5032 | if(f2pFinalCorrectionsForNUAPtEtaPOI) f2pFinalCorrectionsForNUAPtEtaPOI->Add(correctionPtEta1stTerm); // to be improved (if condition goes somewhere else) |
| 5033 | delete correctionPtEta1stTerm; |
| 5034 | // pt: |
| a228a60e |
5035 | if(f2pFinalCorrectionsForNUAPtPOI) f2pFinalCorrectionsForNUAPtPOI->Reset(); // to be improved |
| 2bdc5281 |
5036 | TH1D *correctionPt1stTerm = new TH1D(*((this->MakePtProjection(fCorrectionsCosP1nPsiPtEtaPOI))->ProjectionX("","e"))); // to be improved: are errors propagated correctly here? |
| 5037 | correctionPt1stTerm->Scale(fQCorrectionsCos->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 5038 | if(f2pFinalCorrectionsForNUAPtPOI) f2pFinalCorrectionsForNUAPtPOI->Add(correctionPt1stTerm); // to be improved (if condition goes somewhere else) |
| 5039 | delete correctionPt1stTerm; |
| 5040 | // eta: |
| a228a60e |
5041 | if(f2pFinalCorrectionsForNUAEtaPOI) f2pFinalCorrectionsForNUAEtaPOI->Reset(); // to be improved |
| 2bdc5281 |
5042 | TH1D *correctionEta1stTerm = new TH1D(*((this->MakeEtaProjection(fCorrectionsCosP1nPsiPtEtaPOI))->ProjectionX("","e"))); // to be improved: are errors propagated correctly here? |
| 5043 | correctionEta1stTerm->Scale(fQCorrectionsCos->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 5044 | if(f2pFinalCorrectionsForNUAEtaPOI) f2pFinalCorrectionsForNUAEtaPOI->Add(correctionEta1stTerm); // to be improved (if condition goes somewhere else) |
| 5045 | delete correctionEta1stTerm; |
| 5046 | } else |
| 5047 | { |
| 5048 | cout<<"WARNING: (fCorrectionsCosP1nPsiPtEtaPOI && fQCorrectionsCos && f2pFinalCorrectionsForNUAPtEtaPOI) is NULL in QC::CFCFNUAFDF() !!!! "<<endl; |
| 5049 | cout<<" Corrections for non-uniform acceptance for differential flow are not correct."<<endl; |
| 5050 | } |
| 5051 | |
| 5052 | // 2nd term: <<sin(n*psi)>><<sin(n*phi)>>: |
| 5053 | if(fCorrectionsSinP1nPsiPtEtaPOI && fQCorrectionsSin) |
| 5054 | { |
| a228a60e |
5055 | // pt,eta: |
| 2bdc5281 |
5056 | TH2D *correctionPtEta2ndTerm = new TH2D(*(fCorrectionsSinP1nPsiPtEtaPOI->ProjectionXY("","e"))); |
| 5057 | correctionPtEta2ndTerm->Scale(fQCorrectionsSin->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 5058 | if(f2pFinalCorrectionsForNUAPtEtaPOI) f2pFinalCorrectionsForNUAPtEtaPOI->Add(correctionPtEta2ndTerm); // to be improved (if condition goes somewhere else) |
| 5059 | delete correctionPtEta2ndTerm; |
| 5060 | // pt: |
| 5061 | TH1D *correctionPt2ndTerm = new TH1D(*((this->MakePtProjection(fCorrectionsSinP1nPsiPtEtaPOI))->ProjectionX("","e"))); // to be improved: are errors propagated correctly here? |
| 5062 | correctionPt2ndTerm->Scale(fQCorrectionsSin->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 5063 | if(f2pFinalCorrectionsForNUAPtPOI) f2pFinalCorrectionsForNUAPtPOI->Add(correctionPt2ndTerm); // to be improved (if condition goes somewhere else) |
| 5064 | delete correctionPt2ndTerm; |
| 5065 | // eta: |
| 5066 | TH1D *correctionEta2ndTerm = new TH1D(*((this->MakeEtaProjection(fCorrectionsSinP1nPsiPtEtaPOI))->ProjectionX("","e"))); // to be improved: are errors propagated correctly here? |
| 5067 | correctionEta2ndTerm->Scale(fQCorrectionsSin->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 5068 | if(f2pFinalCorrectionsForNUAEtaPOI) f2pFinalCorrectionsForNUAEtaPOI->Add(correctionEta2ndTerm); // to be improved (if condition goes somewhere else) |
| 5069 | delete correctionEta2ndTerm; |
| 5070 | } else |
| 5071 | { |
| 5072 | cout<<"WARNING: (fCorrectionsSinP1nPsiPtEtaPOI && fQCorrectionsSin) is NULL in QC::CFCFNUAFDF() !!!! "<<endl; |
| 5073 | cout<<" Corrections for non-uniform acceptance for differential flow are not correct."<<endl; |
| 5074 | } |
| 5075 | } else if(type == "RP") |
| 5076 | { |
| 5077 | // **** corrections for non-uniform acceptance for 2nd order QC' for RP's **** |
| 5078 | |
| 5079 | // 1st term: <<cos(n*psi)>><<cos(n*phi)>>: |
| 5080 | if(fCorrectionsCosP1nPsiPtEtaRP && fQCorrectionsCos) |
| 5081 | { |
| 5082 | // pt,eta: |
| a228a60e |
5083 | if(f2pFinalCorrectionsForNUAPtEtaRP) f2pFinalCorrectionsForNUAPtEtaRP->Reset(); // to be improved |
| 2bdc5281 |
5084 | TH2D *correctionPtEta1stTerm = new TH2D(*(fCorrectionsCosP1nPsiPtEtaRP->ProjectionXY("","e"))); |
| 5085 | correctionPtEta1stTerm->Scale(fQCorrectionsCos->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 5086 | if(f2pFinalCorrectionsForNUAPtEtaRP) f2pFinalCorrectionsForNUAPtEtaRP->Add(correctionPtEta1stTerm); // to be improved (if condition goes somewhere else) |
| 5087 | delete correctionPtEta1stTerm; |
| 5088 | // pt: |
| a228a60e |
5089 | if(f2pFinalCorrectionsForNUAPtRP) f2pFinalCorrectionsForNUAPtRP->Reset(); // to be improved |
| 2bdc5281 |
5090 | TH1D *correctionPt1stTerm = new TH1D(*((this->MakePtProjection(fCorrectionsCosP1nPsiPtEtaRP))->ProjectionX("","e"))); // to be improved: are errors propagated correctly here? |
| 5091 | correctionPt1stTerm->Scale(fQCorrectionsCos->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 5092 | if(f2pFinalCorrectionsForNUAPtRP) f2pFinalCorrectionsForNUAPtRP->Add(correctionPt1stTerm); // to be improved (if condition goes somewhere else) |
| 5093 | delete correctionPt1stTerm; |
| 5094 | // eta: |
| a228a60e |
5095 | if(f2pFinalCorrectionsForNUAEtaRP) f2pFinalCorrectionsForNUAEtaRP->Reset(); // to be improved |
| 2bdc5281 |
5096 | TH1D *correctionEta1stTerm = new TH1D(*((this->MakeEtaProjection(fCorrectionsCosP1nPsiPtEtaRP))->ProjectionX("","e"))); // to be improved: are errors propagated correctly here? |
| 5097 | correctionEta1stTerm->Scale(fQCorrectionsCos->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 5098 | if(f2pFinalCorrectionsForNUAEtaRP) f2pFinalCorrectionsForNUAEtaRP->Add(correctionEta1stTerm); // to be improved (if condition goes somewhere else) |
| 5099 | delete correctionEta1stTerm; |
| 5100 | } else |
| 5101 | { |
| 5102 | cout<<"WARNING: (fCorrectionsCosP1nPsiPtEtaRP && fQCorrectionsCos) is NULL in QC::CFCFNUAFDF() !!!! "<<endl; |
| 5103 | cout<<" Corrections for non-uniform acceptance for differential flow are not correct."<<endl; |
| 5104 | } |
| 5105 | // 2nd term: <<sin(n*psi)>><<sin(n*phi)>>: |
| 5106 | if(fCorrectionsSinP1nPsiPtEtaRP && fQCorrectionsSin) |
| 5107 | { |
| 5108 | // pt,eta: |
| 5109 | TH2D *correctionPtEta2ndTerm = new TH2D(*(fCorrectionsSinP1nPsiPtEtaRP->ProjectionXY("","e"))); |
| 5110 | correctionPtEta2ndTerm->Scale(fQCorrectionsSin->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 5111 | if(f2pFinalCorrectionsForNUAPtEtaRP) f2pFinalCorrectionsForNUAPtEtaRP->Add(correctionPtEta2ndTerm); // to be improved (if condition goes somewhere else) |
| 5112 | delete correctionPtEta2ndTerm; |
| 5113 | // pt: |
| 5114 | TH1D *correctionPt2ndTerm = new TH1D(*((this->MakePtProjection(fCorrectionsSinP1nPsiPtEtaRP))->ProjectionX("","e"))); // to be improved: are errors propagated correctly here? |
| 5115 | correctionPt2ndTerm->Scale(fQCorrectionsSin->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 5116 | if(f2pFinalCorrectionsForNUAPtRP) f2pFinalCorrectionsForNUAPtRP->Add(correctionPt2ndTerm); // to be improved (if condition goes somewhere else) |
| 5117 | delete correctionPt2ndTerm; |
| 5118 | // eta: |
| 5119 | TH1D *correctionEta2ndTerm = new TH1D(*((this->MakeEtaProjection(fCorrectionsSinP1nPsiPtEtaRP))->ProjectionX("","e"))); // to be improved: are errors propagated correctly here? |
| 5120 | correctionEta2ndTerm->Scale(fQCorrectionsSin->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 5121 | if(f2pFinalCorrectionsForNUAEtaRP) f2pFinalCorrectionsForNUAEtaRP->Add(correctionEta2ndTerm); // to be improved (if condition goes somewhere else) |
| 5122 | delete correctionEta2ndTerm; |
| 5123 | } else |
| 5124 | { |
| 5125 | cout<<"WARNING: (fCorrectionsSinP1nPsiPtEtaRP && fQCorrectionsSin) is NULL in QC::CFCFNUAFDF() !!!! "<<endl; |
| 5126 | cout<<" Corrections for non-uniform acceptance for differential flow are not correct."<<endl; |
| 5127 | } |
| 5128 | } else // to else if(type == "RP") |
| 5129 | { |
| 5130 | cout<<"WARNING: Type must be either POI or RP in QC::CFCFNUAFDF() !!!! "<<endl; |
| 5131 | cout<<" Corrections for non-uniform acceptance for differential flow were not calculated."<<endl; |
| 5132 | } |
| 5133 | } else // to if(!(useWeights)) |
| 5134 | { |
| 5135 | // ... |
| 5136 | } |
| 5137 | |
| 5138 | } // end of AliFlowAnalysisWithQCumulants::CalculateFinalCorrectionsForNonUniformAcceptanceForDifferentialFlow(Bool_t useWeights,TString type) |
| c365fe76 |
5139 | |
| 5140 | |
| 5141 | //================================================================================================================================ |
| 5142 | |
| 5143 | |
| 9c1a9547 |
5144 | void AliFlowAnalysisWithQCumulants::CalculateFinalResultsForNoNameIntegratedFlow(Bool_t useWeights) |
| 5145 | { |
| 5146 | // calculate final results for 'no-name' integrated flow |
| 5147 | |
| 5148 | // 2-, 4-, 6- and 8-particle azimuthal correlation: |
| 5149 | Double_t two = 0.; // <<2>>_{n|n} |
| 5150 | Double_t four = 0.; // <<4>>_{n,n|n,n} |
| 5151 | Double_t six = 0.; // <<6>>_{n,n,n|n,n,n} |
| 5152 | Double_t eight = 0.; // <<8>>_{n,n,n,n|n,n,n,n} |
| 5153 | |
| 5154 | if(!(useWeights)) |
| 5155 | { |
| c365fe76 |
5156 | // measured multi-particle correlations: |
| 9c1a9547 |
5157 | two = fQCorrelations->GetBinContent(1); |
| 5158 | four = fQCorrelations->GetBinContent(11); |
| 5159 | six = fQCorrelations->GetBinContent(24); |
| c365fe76 |
5160 | eight = fQCorrelations->GetBinContent(31); |
| 9c1a9547 |
5161 | } |
| 5162 | |
| 5163 | if(useWeights) |
| 5164 | { |
| 5165 | two = fQCorrelationsW->GetBinContent(1); |
| 5166 | four = fQCorrelationsW->GetBinContent(41); |
| 5167 | six = fQCorrelationsW->GetBinContent(81); |
| 5168 | eight = fQCorrelationsW->GetBinContent(121); |
| 5169 | } |
| 5170 | |
| 5171 | // 2nd, 4th, 6th and 8th order Q-cumulant: |
| 5172 | Double_t secondOrderQCumulant = two; // c_n{2} |
| 5173 | Double_t fourthOrderQCumulant = four-2.*pow(two,2.); // c_n{4} |
| 5174 | Double_t sixthOrderQCumulant = six-9.*two*four+12.*pow(two,3.); // c_n{6} |
| 5175 | Double_t eightOrderQCumulant = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.); // c_n{8} |
| 5176 | |
| c365fe76 |
5177 | // corrections for non-uniform acceptance for QC{2}, QC{4}, QC{6} and QC{8} |
| f4d9977e |
5178 | Double_t twoCorrection = 0.; |
| 5179 | Double_t fourCorrection = 0.; |
| 5180 | //Double_t sixCorrection = 0.; |
| 5181 | //Double_t eightCorrection = 0.; |
| 5182 | if(fFinalCorrectionsForNUA) |
| 5183 | { |
| 5184 | twoCorrection = fFinalCorrectionsForNUA->GetBinContent(1); // bias to QC{2} coming from non-uniform acceptance of the detector |
| 5185 | fourCorrection = fFinalCorrectionsForNUA->GetBinContent(2); // bias to QC{4} coming from non-uniform acceptance of the detector |
| 5186 | // sixCorrection = fFinalCorrectionsForNUA->GetBinContent(3); // bias to QC{6} coming from non-uniform acceptance of the detector |
| 5187 | // eightCorrection = fFinalCorrectionsForNUA->GetBinContent(4); // bias to QC{8} coming from non-uniform acceptance of the detector |
| 5188 | } |
| c365fe76 |
5189 | |
| 5190 | // applying the corrections for non-uniform acceptance: |
| 5191 | secondOrderQCumulant = secondOrderQCumulant - twoCorrection; |
| 5192 | fourthOrderQCumulant = fourthOrderQCumulant - fourCorrection; |
| 5193 | //sixthOrderQCumulant = sixthOrderQCumulant - sixCorrection; |
| 5194 | //eightOrderQCumulant = eightOrderQCumulant - eightCorrection; |
| 5195 | |
| cad7c05a |
5196 | // errors: (to be improved i.e. reimplemented) |
| 5197 | Double_t secondOrderError = 0; |
| 5198 | if(two > 0. && !(useWeights)) |
| 5199 | { |
| 5200 | Double_t nEvtsNoName = (fCommonHists2nd->GetHistMultRP())->GetEntries(); |
| 5201 | if(nEvtsNoName>0) secondOrderError = (fQCorrelations->GetBinError(1)/(2.*pow(two,0.5)))/(pow(nEvtsNoName,0.5)); |
| 5202 | } |
| 5203 | |
| 9c1a9547 |
5204 | if(useWeights) sixthOrderQCumulant = 0.; // to be removed (once 6th order with weights is calculated) |
| 5205 | if(useWeights) eightOrderQCumulant = 0.; // to be removed (once 8th order with weights is calculated) |
| 5206 | |
| 5207 | // "no-name" integrated flow estimates from Q-cumulants: |
| 5208 | Double_t dVn2 = 0.,dVn4 = 0.,dVn6 = 0.,dVn8 = 0.; |
| 5209 | // Double_t sd2=0.,sd4=0.,sd6=0.,sd8=0.; // to be improved (errors needed) |
| 5210 | if(secondOrderQCumulant>0.) |
| 5211 | { |
| 5212 | // v_n{2} |
| 5213 | dVn2 = pow(secondOrderQCumulant,0.5); |
| 5214 | if(!(useWeights)) |
| 5215 | { |
| 5216 | fIntFlowResultsQC->SetBinContent(1,dVn2); |
| cad7c05a |
5217 | fIntFlowResultsQC->SetBinError(1,secondOrderError); // to be improved |
| 9c1a9547 |
5218 | } |
| 5219 | if(useWeights) |
| 5220 | { |
| 5221 | fIntFlowResultsQCW->SetBinContent(1,dVn2); |
| 5222 | fIntFlowResultsQCW->SetBinError(1,0.); // to be improved |
| 5223 | } |
| 5224 | |
| 5225 | // fill common histogram: |
| cad7c05a |
5226 | fCommonHistsResults2nd->FillIntegratedFlow(dVn2,secondOrderError); // to be improved |
| 9c1a9547 |
5227 | |
| 5228 | } |
| 5229 | if(fourthOrderQCumulant<0.) |
| 5230 | { |
| 5231 | // v_n{4} |
| 5232 | dVn4 = pow(-fourthOrderQCumulant,1./4.); |
| 5233 | if(!(useWeights)) |
| 5234 | { |
| 5235 | fIntFlowResultsQC->SetBinContent(2,dVn4); |
| 5236 | fIntFlowResultsQC->SetBinError(2,0.); // to be improved |
| 5237 | } |
| 5238 | if(useWeights) |
| 5239 | { |
| 5240 | fIntFlowResultsQCW->SetBinContent(2,dVn4); |
| 5241 | fIntFlowResultsQCW->SetBinError(2,0.); // to be improved |
| 5242 | } |
| 5243 | |
| 5244 | // fill common histogram: |
| 5245 | fCommonHistsResults4th->FillIntegratedFlow(dVn4, 0.); // to be improved |
| 5246 | |
| 5247 | } |
| 5248 | if(sixthOrderQCumulant>0.) |
| 5249 | { |
| 5250 | // v_n{6} |
| 5251 | dVn6 = pow((1./4.)*sixthOrderQCumulant,1./6.); |
| 5252 | if(!(useWeights)) |
| 5253 | { |
| 5254 | fIntFlowResultsQC->SetBinContent(3,dVn6); |
| 5255 | fIntFlowResultsQC->SetBinError(3,0.); // to be improved |
| 5256 | } |
| 5257 | if(useWeights) |
| 5258 | { |
| 5259 | fIntFlowResultsQCW->SetBinContent(3,dVn6); |
| 5260 | fIntFlowResultsQCW->SetBinError(3,0.); // to be improved |
| 5261 | } |
| 5262 | |
| 5263 | // fill common histogram: |
| 5264 | fCommonHistsResults6th->FillIntegratedFlow(dVn6, 0.); // to be improved |
| 5265 | |
| 5266 | } |
| 5267 | if(eightOrderQCumulant<0.) |
| 5268 | { |
| 5269 | // v_n{8} |
| 5270 | dVn8 = pow((-1./33.)*eightOrderQCumulant,1./8.); |
| 5271 | if(!(useWeights)) |
| 5272 | { |
| 5273 | fIntFlowResultsQC->SetBinContent(4,dVn8); |
| 5274 | fIntFlowResultsQC->SetBinError(4,0.); // to be improved |
| 5275 | } |
| 5276 | if(useWeights) |
| 5277 | { |
| 5278 | fIntFlowResultsQCW->SetBinContent(4,dVn8); |
| 5279 | fIntFlowResultsQCW->SetBinError(4,0.); // to be improved |
| 5280 | } |
| 5281 | |
| 5282 | // fill common histogram: |
| 5283 | fCommonHistsResults8th->FillIntegratedFlow(dVn8, 0.); // to be improved |
| 5284 | |
| 5285 | } |
| 4057ba99 |
5286 | |
| 9c1a9547 |
5287 | } // end of AliFlowAnalysisWithQCumulants::CalculateFinalResultsForNoNameIntegratedFlow(Bool_t useWeights) |
| 5288 | |
| 5289 | |
| 5290 | //================================================================================================================================ |
| 5291 | |
| 5292 | |
| 5293 | void AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(Bool_t useWeights, TString type) |
| 5294 | { |
| 5295 | // calculate final results for integrated flow of RPs and POIs |
| 5296 | |
| 5297 | TH1F *yield2ndPt = NULL; |
| 5298 | TH1F *yield4thPt = NULL; |
| 5299 | TH1F *yield6thPt = NULL; |
| 5300 | TH1F *yield8thPt = NULL; |
| 4057ba99 |
5301 | |
| 9c1a9547 |
5302 | if(type == "POI") |
| 5303 | { |
| 5304 | yield2ndPt = new TH1F(*(fCommonHists2nd->GetHistPtPOI())); |
| 5305 | yield4thPt = new TH1F(*(fCommonHists4th->GetHistPtPOI())); |
| 5306 | yield6thPt = new TH1F(*(fCommonHists6th->GetHistPtPOI())); |
| 5307 | yield8thPt = new TH1F(*(fCommonHists8th->GetHistPtPOI())); |
| 5308 | } |
| 5309 | else if (type == "RP") |
| 5310 | { |
| 5311 | yield2ndPt = new TH1F(*(fCommonHists2nd->GetHistPtRP())); |
| 5312 | yield4thPt = new TH1F(*(fCommonHists4th->GetHistPtRP())); |
| 5313 | yield6thPt = new TH1F(*(fCommonHists6th->GetHistPtRP())); |
| 5314 | yield8thPt = new TH1F(*(fCommonHists8th->GetHistPtRP())); |
| 5315 | } |
| 3d824203 |
5316 | |
| 9c1a9547 |
5317 | Int_t nBinsPt = yield2ndPt->GetNbinsX(); |
| 3d824203 |
5318 | |
| 9c1a9547 |
5319 | TH1D *flow2ndPt = NULL; |
| 5320 | TH1D *flow4thPt = NULL; |
| 5321 | TH1D *flow6thPt = NULL; |
| 5322 | TH1D *flow8thPt = NULL; |
| 3d824203 |
5323 | |
| 9c1a9547 |
5324 | if(!(useWeights)) |
| 5325 | { |
| 5326 | if(type == "POI") |
| 5327 | { |
| 5328 | flow2ndPt = new TH1D(*fvn2ndPtPOI); |
| 5329 | flow4thPt = new TH1D(*fvn4thPtPOI); |
| 5330 | flow6thPt = new TH1D(*fvn6thPtPOI); |
| 5331 | flow8thPt = new TH1D(*fvn8thPtPOI); |
| 5332 | } |
| 5333 | else if (type == "RP") |
| 5334 | { |
| 5335 | flow2ndPt = new TH1D(*fvn2ndPtRP); |
| 5336 | flow4thPt = new TH1D(*fvn4thPtRP); |
| 5337 | flow6thPt = new TH1D(*fvn6thPtRP); |
| 5338 | flow8thPt = new TH1D(*fvn8thPtRP); |
| 5339 | } |
| 5340 | } |
| 5341 | else if (useWeights) |
| 5342 | { |
| 5343 | if(type == "POI") |
| 5344 | { |
| 5345 | flow2ndPt = new TH1D(*fvn2ndPtPOIW); |
| 5346 | flow4thPt = new TH1D(*fvn4thPtPOIW); |
| 5347 | flow6thPt = new TH1D(*fvn6thPtPOIW); |
| 5348 | flow8thPt = new TH1D(*fvn8thPtPOIW); |
| 5349 | } |
| 5350 | else if (type == "RP") |
| 5351 | { |
| 5352 | flow2ndPt = new TH1D(*fvn2ndPtRPW); |
| 5353 | flow4thPt = new TH1D(*fvn4thPtRPW); |
| 5354 | flow6thPt = new TH1D(*fvn6thPtRPW); |
| 5355 | flow8thPt = new TH1D(*fvn8thPtRPW); |
| 5356 | } |
| 5357 | } |
| 3d824203 |
5358 | |
| 9c1a9547 |
5359 | Double_t dvn2nd = 0., dvn4th = 0., dvn6th = 0., dvn8th = 0.; // differential flow |
| 5360 | Double_t dVn2nd = 0., dVn4th = 0., dVn6th = 0., dVn8th = 0.; // integrated flow |
| 5361 | Double_t dSd2nd = 0., dSd4th = 0., dSd6th = 0., dSd8th = 0.; // error on integrated flow (to be improved - calculation needed) |
| 5362 | |
| 5363 | Double_t dYield2nd = 0., dYield4th = 0., dYield6th = 0., dYield8th = 0.; // pt yield |
| 5364 | Double_t dSum2nd = 0., dSum4th = 0., dSum6th = 0., dSum8th = 0.; // needed for normalizing integrated flow |
| 3d824203 |
5365 | |
| 9c1a9547 |
5366 | // looping over pt bins: |
| 5367 | for(Int_t p=1;p<nBinsPt+1;p++) |
| 5368 | { |
| 9c1a9547 |
5369 | dvn2nd = flow2ndPt->GetBinContent(p); |
| 5370 | dvn4th = flow4thPt->GetBinContent(p); |
| 5371 | dvn6th = flow6thPt->GetBinContent(p); |
| 5372 | dvn8th = flow8thPt->GetBinContent(p); |
| 5373 | |
| fcb2164b |
5374 | dYield2nd = yield2ndPt->GetBinContent(p); |
| 9c1a9547 |
5375 | dYield4th = yield4thPt->GetBinContent(p); |
| 5376 | dYield6th = yield6thPt->GetBinContent(p); |
| 5377 | dYield8th = yield8thPt->GetBinContent(p); |
| 5378 | |
| 5379 | dVn2nd += dvn2nd*dYield2nd; |
| 5380 | dVn4th += dvn4th*dYield4th; |
| 5381 | dVn6th += dvn6th*dYield6th; |
| 5382 | dVn8th += dvn8th*dYield8th; |
| 5383 | |
| 5384 | dSum2nd += dYield2nd; |
| 5385 | dSum4th += dYield4th; |
| 5386 | dSum6th += dYield6th; |
| 5387 | dSum8th += dYield8th; |
| 5388 | |
| 5389 | // ... to be improved - errors needed to be calculated |
| 5390 | |
| 5391 | } // end of for(Int_t p=1;p<nBinsPt+1;p++) |
| 5392 | |
| 5393 | // normalizing the results for integrated flow: |
| 5394 | if(dSum2nd) dVn2nd/=dSum2nd; |
| 5395 | if(dSum4th) dVn4th/=dSum4th; |
| 5396 | if(dSum6th) dVn6th/=dSum6th; |
| 5397 | if(dSum8th) dVn8th/=dSum8th; |
| 3d824203 |
5398 | |
| 9c1a9547 |
5399 | // storing the results for integrated flow: |
| 5400 | if(!(useWeights)) |
| 5401 | { |
| 5402 | if(type == "POI") |
| 5403 | { |
| 5404 | // 2nd: |
| 5405 | fIntFlowResultsPOIQC->SetBinContent(1,dVn2nd); |
| 5406 | fIntFlowResultsPOIQC->SetBinError(1,dSd2nd); |
| 5407 | // 4th: |
| 5408 | fIntFlowResultsPOIQC->SetBinContent(2,dVn4th); |
| 5409 | fIntFlowResultsPOIQC->SetBinError(2,dSd4th); |
| 5410 | // 6th: |
| 5411 | fIntFlowResultsPOIQC->SetBinContent(3,dVn6th); |
| 5412 | fIntFlowResultsPOIQC->SetBinError(3,dSd6th); |
| 5413 | // 8th: |
| 5414 | fIntFlowResultsPOIQC->SetBinContent(4,dVn8th); |
| 5415 | fIntFlowResultsPOIQC->SetBinError(4,dSd8th); |
| 5416 | } |
| 5417 | else if (type == "RP") |
| 5418 | { |
| 5419 | // 2nd: |
| 5420 | fIntFlowResultsRPQC->SetBinContent(1,dVn2nd); |
| 5421 | fIntFlowResultsRPQC->SetBinError(1,dSd2nd); |
| 5422 | // 4th: |
| 5423 | fIntFlowResultsRPQC->SetBinContent(2,dVn4th); |
| 5424 | fIntFlowResultsRPQC->SetBinError(2,dSd4th); |
| 5425 | // 6th: |
| 5426 | fIntFlowResultsRPQC->SetBinContent(3,dVn6th); |
| 5427 | fIntFlowResultsRPQC->SetBinError(3,dSd6th); |
| 5428 | // 8th: |
| 5429 | fIntFlowResultsRPQC->SetBinContent(4,dVn8th); |
| 5430 | fIntFlowResultsRPQC->SetBinError(4,dSd8th); |
| 5431 | } |
| 5432 | } |
| 5433 | else if (useWeights) |
| 5434 | { |
| 5435 | if(type == "POI") |
| 5436 | { |
| 5437 | // 2nd: |
| 5438 | fIntFlowResultsPOIQCW->SetBinContent(1,dVn2nd); |
| 5439 | fIntFlowResultsPOIQCW->SetBinError(1,dSd2nd); |
| 5440 | // 4th: |
| 5441 | fIntFlowResultsPOIQCW->SetBinContent(2,dVn4th); |
| 5442 | fIntFlowResultsPOIQCW->SetBinError(2,dSd4th); |
| 5443 | // 6th: |
| 5444 | fIntFlowResultsPOIQCW->SetBinContent(3,dVn6th); |
| 5445 | fIntFlowResultsPOIQCW->SetBinError(3,dSd6th); |
| 5446 | // 8th: |
| 5447 | fIntFlowResultsPOIQCW->SetBinContent(4,dVn8th); |
| 5448 | fIntFlowResultsPOIQCW->SetBinError(4,dSd8th); |
| 5449 | } |
| 5450 | else if (type == "RP") |
| 5451 | { |
| 5452 | // 2nd: |
| 5453 | fIntFlowResultsRPQCW->SetBinContent(1,dVn2nd); |
| 5454 | fIntFlowResultsRPQCW->SetBinError(1,dSd2nd); |
| 5455 | // 4th: |
| 5456 | fIntFlowResultsRPQCW->SetBinContent(2,dVn4th); |
| 5457 | fIntFlowResultsRPQCW->SetBinError(2,dSd4th); |
| 5458 | // 6th: |
| 5459 | fIntFlowResultsRPQCW->SetBinContent(3,dVn6th); |
| 5460 | fIntFlowResultsRPQCW->SetBinError(3,dSd6th); |
| 5461 | // 8th: |
| 5462 | fIntFlowResultsRPQCW->SetBinContent(4,dVn8th); |
| 5463 | fIntFlowResultsRPQCW->SetBinError(4,dSd8th); |
| 5464 | } |
| 5465 | } |
| 3d824203 |
5466 | |
| 9c1a9547 |
5467 | // storing the results for integrated flow in common histos: |
| 5468 | // to be improved - now they are being filled twice ... |
| 5469 | if(type == "POI") |
| 5470 | { |
| 5471 | fCommonHistsResults2nd->FillIntegratedFlowPOI(dVn2nd,0.); // to be improved (errors) |
| 5472 | fCommonHistsResults4th->FillIntegratedFlowPOI(dVn4th,0.); // to be improved (errors) |
| 5473 | fCommonHistsResults6th->FillIntegratedFlowPOI(dVn6th,0.); // to be improved (errors) |
| 5474 | fCommonHistsResults8th->FillIntegratedFlowPOI(dVn8th,0.); // to be improved (errors) |
| 5475 | } |
| 5476 | else if (type == "RP") |
| 5477 | { |
| 5478 | fCommonHistsResults2nd->FillIntegratedFlowRP(dVn2nd,0.); // to be improved (errors) |
| 5479 | fCommonHistsResults4th->FillIntegratedFlowRP(dVn4th,0.); // to be improved (errors) |
| 5480 | fCommonHistsResults6th->FillIntegratedFlowRP(dVn6th,0.); // to be improved (errors) |
| 5481 | fCommonHistsResults8th->FillIntegratedFlowRP(dVn8th,0.); // to be improved (errors) |
| 5482 | } |
| 3d824203 |
5483 | |
| 9c1a9547 |
5484 | delete flow2ndPt; |
| 5485 | delete flow4thPt; |
| 5486 | delete flow6thPt; |
| 5487 | delete flow8thPt; |
| 3d824203 |
5488 | |
| 9c1a9547 |
5489 | delete yield2ndPt; |
| 5490 | delete yield4thPt; |
| 5491 | delete yield6thPt; |
| 5492 | delete yield8thPt; |
| 5493 | |
| 5494 | } // end of AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(Bool_t useWeights, TString type) |
| 5495 | |
| 5496 | |
| 5497 | //================================================================================================================================== |
| 5498 | |
| 5499 | |
| 3c16adde |
5500 | void AliFlowAnalysisWithQCumulants::CalculateFinalResultsForDifferentialFlow( |
| 5501 | TH2D *flowPtEta, TH1D *flowPt, TH1D *flowEta, |
| 5502 | TProfile2D *profile2ndPtEta, TProfile2D *profile4thPtEta, |
| 5503 | TProfile2D *profile6thPtEta, TProfile2D *profile8thPtEta) |
| 9c1a9547 |
5504 | { |
| 5505 | // calculate and store the final results for integrated flow |
| 3d824203 |
5506 | |
| 9c1a9547 |
5507 | TString *namePtEta = new TString(); |
| 5508 | TString *type = new TString(); |
| 3c16adde |
5509 | TString *order2nd = new TString(); |
| 5510 | TString *order4th = new TString(); |
| 5511 | TString *order6th = new TString(); |
| 5512 | TString *order8th = new TString(); |
| 9c1a9547 |
5513 | TString *w = new TString(); |
| 5514 | |
| 3c16adde |
5515 | if(profile2ndPtEta) *namePtEta = profile2ndPtEta->GetName(); |
| 9c1a9547 |
5516 | if(namePtEta->Contains("POI")) *type = "POI"; |
| 5517 | if(namePtEta->Contains("RP")) *type = "RP"; |
| 9c1a9547 |
5518 | if(namePtEta->Contains("W")) *w = "W"; |
| 3c16adde |
5519 | if(namePtEta->Contains("2")) *order2nd = "2"; |
| 3c16adde |
5520 | if(profile4thPtEta) *namePtEta = profile4thPtEta->GetName(); |
| 5521 | if(namePtEta->Contains("4")) *order4th = "4"; |
| 5522 | |
| 5523 | if(profile6thPtEta) *namePtEta = profile6thPtEta->GetName(); |
| 5524 | if(namePtEta->Contains("6")) *order6th = "6"; |
| 5525 | |
| 5526 | if(profile8thPtEta) *namePtEta = profile8thPtEta->GetName(); |
| 5527 | if(namePtEta->Contains("8")) *order8th = "8"; |
| 2bdc5281 |
5528 | |
| 3c16adde |
5529 | TProfile *profile2ndPt = NULL; |
| 5530 | TProfile *profile4thPt = NULL; |
| 5531 | TProfile *profile6thPt = NULL; |
| 5532 | TProfile *profile8thPt = NULL; |
| 5533 | |
| 5534 | TProfile *profile2ndEta = NULL; |
| 5535 | TProfile *profile4thEta = NULL; |
| 5536 | TProfile *profile6thEta = NULL; |
| 5537 | TProfile *profile8thEta = NULL; |
| 5538 | |
| 5539 | if(*order2nd == "2") |
| 5540 | { |
| 5541 | profile2ndPt = new TProfile(*(this->MakePtProjection(profile2ndPtEta))); |
| 5542 | profile2ndEta = new TProfile(*(this->MakeEtaProjection(profile2ndPtEta))); |
| 5543 | if(*order4th == "4") |
| 5544 | { |
| 5545 | profile4thPt = new TProfile(*(this->MakePtProjection(profile4thPtEta))); |
| 5546 | profile4thEta = new TProfile(*(this->MakeEtaProjection(profile4thPtEta))); |
| 5547 | if(*order6th == "6") |
| 5548 | { |
| 5549 | profile6thPt = new TProfile(*(this->MakePtProjection(profile6thPtEta))); |
| 5550 | profile6thEta = new TProfile(*(this->MakeEtaProjection(profile6thPtEta))); |
| 5551 | if(*order8th == "8") |
| 5552 | { |
| 5553 | profile8thPt = new TProfile(*(this->MakePtProjection(profile8thPtEta))); |
| 5554 | profile8thEta = new TProfile(*(this->MakeEtaProjection(profile8thPtEta))); |
| 5555 | } |
| 5556 | } |
| 5557 | } |
| 5558 | } |
| 3d824203 |
5559 | |
| 3c16adde |
5560 | Int_t nBinsPt = profile2ndPt->GetNbinsX(); |
| 5561 | Int_t nBinsEta = profile2ndEta->GetNbinsX(); |
| 3d824203 |
5562 | |
| 3c16adde |
5563 | Double_t dV2 = 0.; |
| 5564 | Double_t dV4 = 0.; |
| 5565 | Double_t dV6 = 0.; |
| 9c1a9547 |
5566 | Double_t dV8 = 0.; |
| 3d824203 |
5567 | |
| 9c1a9547 |
5568 | if(!(*w == "W")) |
| 5569 | { |
| 2bdc5281 |
5570 | dV2 = fIntFlowResultsQC->GetBinContent(1); |
| 9c1a9547 |
5571 | dV4 = fIntFlowResultsQC->GetBinContent(2); |
| 5572 | dV6 = fIntFlowResultsQC->GetBinContent(3); |
| 5573 | dV8 = fIntFlowResultsQC->GetBinContent(4); |
| 5574 | } |
| 5575 | else if(*w == "W") |
| 5576 | { |
| 5577 | dV2 = fIntFlowResultsQCW->GetBinContent(1); |
| 5578 | dV4 = fIntFlowResultsQCW->GetBinContent(2); |
| 5579 | dV6 = fIntFlowResultsQCW->GetBinContent(3); |
| 5580 | dV8 = fIntFlowResultsQCW->GetBinContent(4); |
| 5581 | } |
| 5582 | |
| 5583 | // 3D (pt,eta): |
| 5584 | Double_t twoPrimePtEta = 0.; // <<2'>> (pt,eta) |
| 5585 | Double_t fourPrimePtEta = 0.; // <<4'>> (pt,eta) |
| 5586 | //Double_t sixPrimePtEta = 0.; // <<6'>> (pt,eta) |
| 5587 | //Double_t eightPrimePtEta = 0.; // <<8'>> (pt,eta) |
| 5588 | Double_t secondOrderDiffFlowCumulantPtEta = 0.; // d_n{2,Q} (pt,eta) |
| 5589 | Double_t fourthOrderDiffFlowCumulantPtEta = 0.; // d_n{4,Q} (pt,eta) |
| 5590 | //Double_t sixthOrderDiffFlowCumulantPtEta = 0.; // d_n{6,Q} (pt,eta) |
| 5591 | //Double_t eightOrderDiffFlowCumulantPtEta = 0.; // d_n{8,Q} (pt,eta)2nd |
| 5592 | Double_t dv2PtEta = 0.; // v'_n{2} (pt,eta) |
| 5593 | Double_t dv4PtEta = 0.; // v'_n{4} (pt,eta) |
| 5594 | //Double_t dv6PtEta = 0.; // v'_n{6} (pt,eta) |
| 5595 | //Double_t dv8PtEta = 0.; // v'_n{8} (pt,eta) |
| 5596 | |
| 5597 | // 2D (pt): |
| 5598 | Double_t twoPrimePt = 0.; // <<2'>> (pt) |
| 5599 | Double_t fourPrimePt = 0.; // <<4'>> (pt) |
| 5600 | //Double_t sixPrimePt = 0.; // <<6'>> (pt) |
| 5601 | //Double_t eightPrimePt = 0.; // <<8'>> (pt) |
| 5602 | Double_t secondOrderDiffFlowCumulantPt = 0.; // d_n{2,Q} (pt) |
| 5603 | Double_t fourthOrderDiffFlowCumulantPt = 0.; // d_n{4,Q} (pt) |
| 5604 | //Double_t sixthOrderDiffFlowCumulantPt = 0.; // d_n{6,Q} (pt) |
| 5605 | //Double_t eightOrderDiffFlowCumulantPt = 0.; // d_n{8,Q} (pt) |
| 5606 | Double_t dv2Pt = 0.; // v'_n{2} (pt) |
| 5607 | Double_t dv4Pt = 0.; // v'_n{4} (pt) |
| 5608 | //Double_t dv6Pt = 0.; // v'_n{6} (pt) |
| 5609 | //Double_t dv8Pt = 0.; // v'_n{8} (pt) |
| 5610 | |
| 5611 | // 2D (eta): |
| 5612 | Double_t twoPrimeEta = 0.; // <<2'>> (eta) |
| 5613 | Double_t fourPrimeEta = 0.; // <<4>> (eta) |
| 5614 | //Double_t sixPrimeEta = 0.; // <<6>> (eta) |
| 5615 | //Double_t eightPrimeEta = 0.; // <<8'>> (eta) |
| 5616 | Double_t secondOrderDiffFlowCumulantEta = 0.; // d_n{2,Q} (eta) |
| 5617 | Double_t fourthOrderDiffFlowCumulantEta = 0.; // d_n{4,Q} (eta) |
| 5618 | //Double_t sixthOrderDiffFlowCumulantEta = 0.; // d_n{6,Q} (eta) |
| 5619 | //Double_t eightOrderDiffFlowCumulantEta = 0.; // d_n{8,Q} (eta) |
| 5620 | Double_t dv2Eta = 0.; // v'_n{2} (eta) |
| 5621 | Double_t dv4Eta = 0.; // v'_n{4} (eta) |
| 5622 | //Double_t dv6Eta = 0.; // v'_n{6} (eta) |
| 5623 | //Double_t dv8Eta = 0.; // v'_n{8} (eta) |
| 5624 | |
| 5625 | |
| 5626 | // looping over (pt,eta) bins to calculate v'(pt,eta) |
| 5627 | for(Int_t p=1;p<nBinsPt+1;p++) |
| 5628 | { |
| 5629 | for(Int_t e=1;e<nBinsEta+1;e++) |
| 5630 | { |
| 5631 | |
| 5632 | // 2nd order: |
| 3c16adde |
5633 | twoPrimePtEta = profile2ndPtEta->GetBinContent(profile2ndPtEta->GetBin(p,e)); |
| 9c1a9547 |
5634 | secondOrderDiffFlowCumulantPtEta = twoPrimePtEta; |
| 2bdc5281 |
5635 | |
| 5636 | |
| 5637 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| 5638 | // to be improved (applying correction for NUA): |
| 5639 | if(namePtEta->Contains("POI")) |
| 5640 | { |
| 5641 | if(f2pFinalCorrectionsForNUAPtEtaPOI) secondOrderDiffFlowCumulantPtEta = twoPrimePtEta |
| 5642 | - f2pFinalCorrectionsForNUAPtEtaPOI->GetBinContent(f2pFinalCorrectionsForNUAPtEtaPOI->GetBin(p,e)) ; |
| 5643 | } else if (namePtEta->Contains("RP")) |
| 5644 | { |
| 5645 | if(f2pFinalCorrectionsForNUAPtEtaRP) secondOrderDiffFlowCumulantPtEta = twoPrimePtEta |
| 5646 | - f2pFinalCorrectionsForNUAPtEtaRP->GetBinContent(f2pFinalCorrectionsForNUAPtEtaRP->GetBin(p,e)); |
| 5647 | } |
| 5648 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| 5649 | |
| 5650 | |
| 9c1a9547 |
5651 | if(dV2) |
| 5652 | { |
| 5653 | dv2PtEta = secondOrderDiffFlowCumulantPtEta/dV2; |
| 3c16adde |
5654 | if(*order2nd == "2") |
| 5655 | { |
| 5656 | flowPtEta->SetBinContent(p,e,dv2PtEta); |
| 5657 | } |
| 9c1a9547 |
5658 | } |
| 5659 | |
| 5660 | // 4th order: |
| 3c16adde |
5661 | if(*order4th == "4" || *order6th == "6" || *order8th == "8") |
| 9c1a9547 |
5662 | { |
| 3c16adde |
5663 | fourPrimePtEta = profile4thPtEta->GetBinContent(profile4thPtEta->GetBin(p,e)); |
| 9c1a9547 |
5664 | fourthOrderDiffFlowCumulantPtEta = fourPrimePtEta - 2.*twoPrimePtEta*pow(dV2,2.); // to be improved (correlations instead of pow(dV2,2.)) |
| 5665 | if(dV4) |
| 5666 | { |
| 3c16adde |
5667 | dv4PtEta = -fourthOrderDiffFlowCumulantPtEta/pow(dV4,3); |
| 5668 | if(*order4th == "4") |
| 5669 | { |
| 5670 | flowPtEta->SetBinContent(p,e,dv4PtEta); |
| 5671 | } |
| 9c1a9547 |
5672 | } |
| 5673 | } |
| 5674 | |
| 5675 | } // end of for(Int_t e=1;e<nBinsEta+1;e++) |
| 5676 | } // end of for(Int_t p=1;p<nBinsPt+1;p++) |
| 5677 | |
| 5678 | |
| 5679 | // looping over (pt) bins to calcualate v'(pt) |
| 5680 | for(Int_t p=1;p<nBinsPt+1;p++) |
| 5681 | { |
| 3d824203 |
5682 | |
| 9c1a9547 |
5683 | // 2nd order: |
| 3c16adde |
5684 | twoPrimePt = profile2ndPt->GetBinContent(p); |
| 9c1a9547 |
5685 | secondOrderDiffFlowCumulantPt = twoPrimePt; |
| 2bdc5281 |
5686 | |
| 5687 | |
| 5688 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| 5689 | // to be improved (applying correction for NUA): |
| 5690 | if(namePtEta->Contains("POI")) |
| 5691 | { |
| 5692 | if(f2pFinalCorrectionsForNUAPtPOI) secondOrderDiffFlowCumulantPt = twoPrimePt |
| 5693 | - f2pFinalCorrectionsForNUAPtPOI->GetBinContent(p) ; |
| 5694 | } else if (namePtEta->Contains("RP")) |
| 5695 | { |
| 5696 | if(f2pFinalCorrectionsForNUAPtRP) secondOrderDiffFlowCumulantPt = twoPrimePt |
| 5697 | - f2pFinalCorrectionsForNUAPtRP->GetBinContent(p); |
| 5698 | } |
| 5699 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| 5700 | |
| 5701 | |
| 9c1a9547 |
5702 | if(dV2) |
| 5703 | { |
| 5704 | dv2Pt = secondOrderDiffFlowCumulantPt/dV2; |
| 3c16adde |
5705 | if(*order2nd == "2") |
| 5706 | { |
| 5707 | flowPt->SetBinContent(p,dv2Pt); |
| 5708 | } |
| 9c1a9547 |
5709 | |
| 5710 | // common control histos: (to be improved fill only once. now they are filled first without weights and then with weights): |
| 3c16adde |
5711 | if(namePtEta->Contains("POI") && *order2nd == "2") |
| 9c1a9547 |
5712 | { |
| 5713 | fCommonHistsResults2nd->FillDifferentialFlowPtPOI(p,dv2Pt,0.); //to be improved (errors && bb or bb+1 ?) |
| 5714 | } |
| 3c16adde |
5715 | else if(namePtEta->Contains("RP") && *order2nd == "2") |
| 9c1a9547 |
5716 | { |
| 5717 | fCommonHistsResults2nd->FillDifferentialFlowPtRP(p,dv2Pt,0.); //to be improved (errors && bb or bb+1 ?) |
| 5718 | } |
| 5719 | |
| 5720 | } |
| 5721 | |
| 5722 | // 4th order: |
| 3c16adde |
5723 | if(*order4th == "4" || *order6th == "6" || *order8th == "8") |
| 9c1a9547 |
5724 | { |
| 3c16adde |
5725 | fourPrimePt = profile4thPt->GetBinContent(profile4thPt->GetBin(p)); |
| 9c1a9547 |
5726 | fourthOrderDiffFlowCumulantPt = fourPrimePt - 2.*twoPrimePt*pow(dV2,2.); // to be improved (correlations instead of pow(dV2,2.)) |
| 5727 | if(dV4) |
| 5728 | { |
| 3c16adde |
5729 | dv4Pt = -fourthOrderDiffFlowCumulantPt/pow(dV4,3); |
| 5730 | if(*order4th == "4") |
| 5731 | { |
| 5732 | flowPt->SetBinContent(p,dv4Pt); |
| 5733 | } |
| 9c1a9547 |
5734 | |
| 5735 | // common control histos: (to be improved): |
| 3c16adde |
5736 | if(namePtEta->Contains("POI") && *order4th == "4") |
| 9c1a9547 |
5737 | { |
| 5738 | fCommonHistsResults4th->FillDifferentialFlowPtPOI(p,dv4Pt,0.); //to be improved (errors && bb or bb+1 ?) |
| 5739 | } |
| 3c16adde |
5740 | else if(namePtEta->Contains("RP") && *order4th == "4" ) |
| 9c1a9547 |
5741 | { |
| 5742 | fCommonHistsResults4th->FillDifferentialFlowPtRP(p,dv4Pt,0.); //to be improved (errors && bb or bb+1 ?) |
| 5743 | } |
| 5744 | |
| 5745 | } |
| 5746 | } |
| 5747 | |
| 5748 | } // end of for(Int_t p=1;p<nBinsPt+1;p++) |
| 3d824203 |
5749 | |
| 5750 | |
| 9c1a9547 |
5751 | // looping over (eta) bins to calcualate v'(eta) |
| 5752 | for(Int_t e=1;e<nBinsEta+1;e++) |
| 5753 | { |
| 3d824203 |
5754 | |
| 9c1a9547 |
5755 | // 2nd order: |
| 3c16adde |
5756 | twoPrimeEta = profile2ndEta->GetBinContent(e); |
| 9c1a9547 |
5757 | secondOrderDiffFlowCumulantEta = twoPrimeEta; |
| 2bdc5281 |
5758 | |
| 5759 | |
| 5760 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| 5761 | // to be improved (applying correction for NUA): |
| 5762 | if(namePtEta->Contains("POI")) |
| 5763 | { |
| 5764 | if(f2pFinalCorrectionsForNUAEtaPOI) secondOrderDiffFlowCumulantEta = twoPrimeEta |
| 5765 | - f2pFinalCorrectionsForNUAEtaPOI->GetBinContent(e) ; |
| 5766 | } else if (namePtEta->Contains("RP")) |
| 5767 | { |
| 5768 | if(f2pFinalCorrectionsForNUAEtaRP) secondOrderDiffFlowCumulantEta = twoPrimeEta |
| 5769 | - f2pFinalCorrectionsForNUAEtaRP->GetBinContent(e); |
| 5770 | } |
| 5771 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| 5772 | |
| 5773 | |
| 9c1a9547 |
5774 | if(dV2) |
| 5775 | { |
| 5776 | dv2Eta = secondOrderDiffFlowCumulantEta/dV2; |
| 3c16adde |
5777 | if(*order2nd == "2") |
| 5778 | { |
| 5779 | flowEta->SetBinContent(e,dv2Eta); |
| 5780 | } |
| 9c1a9547 |
5781 | |
| 5782 | // common control histos: (to be improved): |
| 3c16adde |
5783 | if(namePtEta->Contains("POI") && *order2nd == "2") |
| 9c1a9547 |
5784 | { |
| 5785 | fCommonHistsResults2nd->FillDifferentialFlowEtaPOI(e,dv2Eta,0.); //to be improved (errors && bb or bb+1 ?) |
| 5786 | } |
| 3c16adde |
5787 | else if(namePtEta->Contains("RP") && *order2nd == "2") |
| 9c1a9547 |
5788 | { |
| 5789 | fCommonHistsResults2nd->FillDifferentialFlowEtaRP(e,dv2Eta,0.); //to be improved (errors && bb or bb+1 ?) |
| 5790 | } |
| 5791 | |
| 2bdc5281 |
5792 | |
| 9c1a9547 |
5793 | } |
| 5794 | |
| 5795 | // 4th order: |
| 3c16adde |
5796 | if(*order4th == "4" || *order6th == "6" || *order8th == "8") |
| 9c1a9547 |
5797 | { |
| 3c16adde |
5798 | fourPrimeEta = profile4thEta->GetBinContent(profile4thEta->GetBin(e)); |
| 9c1a9547 |
5799 | fourthOrderDiffFlowCumulantEta = fourPrimeEta - 2.*twoPrimeEta*pow(dV2,2.); // to be improved (correlations instead of pow(dV2,2.)) |
| 5800 | if(dV4) |
| 5801 | { |
| 3c16adde |
5802 | dv4Eta = -fourthOrderDiffFlowCumulantEta/pow(dV4,3); |
| 5803 | if(*order4th == "4") |
| 5804 | { |
| 5805 | flowEta->SetBinContent(e,dv4Eta); |
| 5806 | } |
| 9c1a9547 |
5807 | |
| 5808 | // common control histos: (to be improved): |
| 3c16adde |
5809 | if(namePtEta->Contains("POI") && *order4th == "4") |
| 9c1a9547 |
5810 | { |
| 5811 | fCommonHistsResults4th->FillDifferentialFlowEtaPOI(e,dv4Eta,0.); //to be improved (errors && bb or bb+1 ?) |
| 5812 | } |
| 3c16adde |
5813 | else if(namePtEta->Contains("RP") && *order4th == "4") |
| 9c1a9547 |
5814 | { |
| 5815 | fCommonHistsResults4th->FillDifferentialFlowEtaRP(e,dv4Eta,0.); //to be improved (errors && bb or bb+1 ?) |
| 5816 | } |
| 5817 | |
| 5818 | } |
| 5819 | } |
| 5820 | |
| 5821 | } // end of for(Int_t e=1;e<nBinsEta+1;e++) |
| 5822 | |
| 5823 | delete namePtEta; |
| 5824 | delete type; |
| 3c16adde |
5825 | delete order2nd; |
| 5826 | delete order4th; |
| 5827 | delete order6th; |
| 5828 | delete order8th; |
| 9c1a9547 |
5829 | delete w; |
| 3c16adde |
5830 | delete profile2ndPt; |
| 5831 | delete profile4thPt; |
| 5832 | delete profile6thPt; |
| 5833 | delete profile8thPt; |
| 5834 | delete profile2ndEta; |
| 5835 | delete profile4thEta; |
| 5836 | delete profile6thEta; |
| 5837 | delete profile8thEta; |
| 3d824203 |
5838 | |
| 9c1a9547 |
5839 | } // end of AliFlowAnalysisWithQCumulants::CalculateFinalResultsForDifferentialFlow(Bool_t useWeights, TString type) |
| bc92c0cb |
5840 | |
| bc92c0cb |
5841 | |
| 9c1a9547 |
5842 | //================================================================================================================================ |
| bc92c0cb |
5843 | |
| 9c1a9547 |
5844 | |
| 5845 | void AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(Bool_t useWeights, TString type) |
| bc92c0cb |
5846 | { |
| 9c1a9547 |
5847 | // printing on the screen the final results for integrated flow ('no-name', POI and RP, without/with weights) |
| 3d824203 |
5848 | |
| 9c1a9547 |
5849 | Int_t n = 2; // to be improved / removed |
| 77515452 |
5850 | |
| 9c1a9547 |
5851 | Double_t nEvtsNoName = (fCommonHists2nd->GetHistMultRP())->GetEntries(); // to be improved |
| 5852 | Double_t dMultNoName = (fCommonHists2nd->GetHistMultRP())->GetMean(); // to be improved |
| 5853 | Double_t nEvtsPOI = (fCommonHists2nd->GetHistMultPOI())->GetEntries(); // to be improved |
| 5854 | Double_t dMultPOI = (fCommonHists2nd->GetHistMultPOI())->GetMean(); // to be improved |
| 5855 | Double_t nEvtsRP = (fCommonHists2nd->GetHistMultRP())->GetEntries(); // to be improved |
| 5856 | Double_t dMultRP = (fCommonHists2nd->GetHistMultRP())->GetMean(); // to be improved |
| 77515452 |
5857 | |
| 9c1a9547 |
5858 | TH1D *finalResultsIntFlow = NULL; |
| 77515452 |
5859 | |
| 9c1a9547 |
5860 | if(!(useWeights)) |
| 5861 | { |
| 5862 | if(type == "NONAME") finalResultsIntFlow = new TH1D(*fIntFlowResultsQC); |
| 5863 | if(type == "POI") finalResultsIntFlow = new TH1D(*fIntFlowResultsPOIQC); |
| 5864 | if(type == "RP") finalResultsIntFlow = new TH1D(*fIntFlowResultsRPQC); |
| 5865 | } |
| 77515452 |
5866 | |
| 9c1a9547 |
5867 | if(useWeights) |
| 77515452 |
5868 | { |
| 9c1a9547 |
5869 | if(type == "NONAME") finalResultsIntFlow = new TH1D(*fIntFlowResultsQCW); |
| 5870 | if(type == "POI") finalResultsIntFlow = new TH1D(*fIntFlowResultsPOIQCW); |
| 5871 | if(type == "RP") finalResultsIntFlow = new TH1D(*fIntFlowResultsRPQCW); |
| 5872 | } |
| 5873 | |
| 5874 | Double_t dVn[4] = {0.}; // array to hold Vn{2}, Vn{4}, Vn{6} and Vn{8} |
| 5875 | Double_t dVnErr[4] = {0.}; // array to hold errors of Vn{2}, Vn{4}, Vn{6} and Vn{8} |
| 5876 | |
| 5877 | if(finalResultsIntFlow) |
| 77515452 |
5878 | { |
| 9c1a9547 |
5879 | for(Int_t i=0;i<4;i++) |
| 5880 | { |
| 5881 | dVn[i] = finalResultsIntFlow->GetBinContent(i+1); |
| 5882 | dVnErr[i] = finalResultsIntFlow->GetBinError(i+1); |
| 5883 | } |
| 5884 | } |
| 5885 | |
| 5886 | TString title = " flow estimates from Q-cumulants"; |
| 5887 | TString subtitle = " ("; |
| 5888 | |
| 5889 | if(!(useWeights)) |
| 77515452 |
5890 | { |
| 9c1a9547 |
5891 | subtitle.Append(type); |
| 5892 | subtitle.Append(", without weights)"); |
| 5893 | } |
| 5894 | |
| 5895 | if(useWeights) |
| 77515452 |
5896 | { |
| 9c1a9547 |
5897 | subtitle.Append(type); |
| 5898 | subtitle.Append(", with weights)"); |
| 77515452 |
5899 | } |
| 9c1a9547 |
5900 | |
| 77515452 |
5901 | cout<<endl; |
| 9c1a9547 |
5902 | cout<<"**********************************"<<endl; |
| 5903 | cout<<"**********************************"<<endl; |
| 5904 | cout<<title.Data()<<endl; |
| 5905 | cout<<subtitle.Data()<<endl; |
| 77515452 |
5906 | cout<<endl; |
| 9c1a9547 |
5907 | |
| 5908 | for(Int_t i=0;i<4;i++) |
| 5909 | { |
| 5910 | if(dVn[i]>=0.) |
| 5911 | { |
| 5912 | cout<<" v_"<<n<<"{"<<2*(i+1)<<"} = "<<dVn[i]<<" +/- "<<dVnErr[i]<<endl; |
| 5913 | } |
| 5914 | else |
| 5915 | { |
| 5916 | cout<<" v_"<<n<<"{"<<2*(i+1)<<"} = Im"<<endl; |
| 5917 | } |
| 77515452 |
5918 | } |
| 9c1a9547 |
5919 | |
| 77515452 |
5920 | cout<<endl; |
| 9c1a9547 |
5921 | if(type == "NONAME") |
| 5922 | { |
| 5923 | cout<<" nEvts = "<<nEvtsNoName<<", AvM = "<<dMultNoName<<endl; // to be improved |
| 5924 | } |
| 5925 | else if (type == "RP") |
| 5926 | { |
| 5927 | cout<<" nEvts = "<<nEvtsRP<<", AvM = "<<dMultRP<<endl; // to be improved |
| 5928 | } |
| 5929 | else if (type == "POI") |
| 5930 | { |
| 5931 | cout<<" nEvts = "<<nEvtsPOI<<", AvM = "<<dMultPOI<<endl; // to be improved |
| 5932 | } |
| 5933 | cout<<"**********************************"<<endl; |
| 5934 | cout<<"**********************************"<<endl; |
| 77515452 |
5935 | cout<<endl; |
| 9c1a9547 |
5936 | |
| 5937 | }// end of AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(Bool_t useWeights=kTRUE, TString type="NONAME"); |
| 77515452 |
5938 | |
| 77515452 |
5939 | |
| 9c1a9547 |
5940 | //================================================================================================================================ |
| 77515452 |
5941 | |
| 9c1a9547 |
5942 | |
| 5943 | void AliFlowAnalysisWithQCumulants::CompareDirectAndQCorrelationsForIntegratedFlow(Bool_t useWeights) |
| 77515452 |
5944 | { |
| 9c1a9547 |
5945 | // compare correlations needed for int. flow calculated with nested loops and those calculated from Q-vectors |
| 5946 | |
| 5947 | cout<<endl; |
| 5948 | cout<<" *************************************"<<endl; |
| 5949 | cout<<" **** cross-checking the formulas ****"<<endl; |
| 5950 | cout<<" **** for integrated flow ****"<<endl; |
| 5951 | cout<<" *************************************"<<endl; |
| 5952 | cout<<endl; |
| 5953 | |
| 5954 | if(!(useWeights)) |
| 77515452 |
5955 | { |
| 9c1a9547 |
5956 | cout<<"<2>_{1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(1)<<endl; |
| 5957 | cout<<"<2>_{1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(1)<<endl; |
| 5958 | cout<<endl; |
| 5959 | cout<<"<2>_{2n,2n} from Q-vectors = "<<fQCorrelations->GetBinContent(2)<<endl; |
| 5960 | cout<<"<2>_{2n,2n} from nested loops = "<<fDirectCorrelations->GetBinContent(2)<<endl; |
| 5961 | cout<<endl; |
| 5962 | cout<<"<2>_{3n,3n} from Q-vectors = "<<fQCorrelations->GetBinContent(3)<<endl; |
| 5963 | cout<<"<2>_{3n,3n} from nested loops = "<<fDirectCorrelations->GetBinContent(3)<<endl; |
| 5964 | cout<<endl; |
| 5965 | cout<<"<2>_{4n,4n} from Q-vectors = "<<fQCorrelations->GetBinContent(4)<<endl; |
| 5966 | cout<<"<2>_{4n,4n} from nested loops = "<<fDirectCorrelations->GetBinContent(4)<<endl; |
| 5967 | cout<<endl; |
| 5968 | cout<<"<3>_{2n|1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(6)<<endl; |
| 5969 | cout<<"<3>_{2n|1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(6)<<endl; |
| 5970 | cout<<endl; |
| 5971 | cout<<"<3>_{3n|2n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(7)<<endl; |
| 5972 | cout<<"<3>_{3n|2n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(7)<<endl; |
| 5973 | cout<<endl; |
| 5974 | cout<<"<3>_{4n,2n,2n} from Q-vectors = "<<fQCorrelations->GetBinContent(8)<<endl; |
| 5975 | cout<<"<3>_{4n,2n,2n} from nested loops = "<<fDirectCorrelations->GetBinContent(8)<<endl; |
| 5976 | cout<<endl; |
| 5977 | cout<<"<3>_{4n,3n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(9)<<endl; |
| 5978 | cout<<"<3>_{4n,3n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(9)<<endl; |
| 5979 | cout<<endl; |
| 5980 | cout<<"<4>_{1n,1n|1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(11)<<endl; |
| 5981 | cout<<"<4>_{1n,1n|1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(11)<<endl; |
| 5982 | cout<<endl; |
| 5983 | cout<<"<4>_{2n,1n|2n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(12)<<endl; |
| 5984 | cout<<"<4>_{2n,1n|2n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(12)<<endl; |
| 5985 | cout<<endl; |
| 5986 | cout<<"<4>_{2n,2n|2n,2n} from Q-vectors = "<<fQCorrelations->GetBinContent(13)<<endl; |
| 5987 | cout<<"<4>_{2n,2n|2n,2n} from nested loops = "<<fDirectCorrelations->GetBinContent(13)<<endl; |
| 5988 | cout<<endl; |
| 5989 | cout<<"<4>_{3n|1n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(14)<<endl; |
| 5990 | cout<<"<4>_{3n|1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(14)<<endl; |
| 5991 | cout<<endl; |
| 5992 | cout<<"<4>_{3n,1n|3n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(15)<<endl; |
| 5993 | cout<<"<4>_{3n,1n|3n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(15)<<endl; |
| 5994 | cout<<endl; |
| 5995 | cout<<"<4>_{3n,1n|2n,2n} from Q-vectors = "<<fQCorrelations->GetBinContent(16)<<endl; |
| 5996 | cout<<"<4>_{3n,1n|2n,2n} from nested loops = "<<fDirectCorrelations->GetBinContent(16)<<endl; |
| 5997 | cout<<endl; |
| 5998 | cout<<"<4>_{4n|2n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(17)<<endl; |
| 5999 | cout<<"<4>_{4n|2n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(17)<<endl; |
| 6000 | cout<<endl; |
| 6001 | cout<<"<5>_{2n,1n|1n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(19)<<endl; |
| 6002 | cout<<"<5>_{2n,1n|1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(19)<<endl; |
| 6003 | cout<<endl; |
| 6004 | cout<<"<5>_{2n,2n|2n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(20)<<endl; |
| 6005 | cout<<"<5>_{2n,2n|2n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(20)<<endl; |
| 6006 | cout<<endl; |
| 6007 | cout<<"<5>_{3n,1n|2n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(21)<<endl; |
| 6008 | cout<<"<5>_{3n,1n|2n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(21)<<endl; |
| 6009 | cout<<endl; |
| 6010 | cout<<"<5>_{4n|1n,1n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(22)<<endl; |
| 6011 | cout<<"<5>_{4n|1n,1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(22)<<endl; |
| 6012 | cout<<endl; |
| 6013 | cout<<"<6>_{1n,1n,1n|1n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(24)<<endl; |
| 6014 | cout<<"<6>_{1n,1n,1n|1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(24)<<endl; |
| 6015 | cout<<endl; |
| 6016 | cout<<"<6>_{2n,1n,1n|2n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(25)<<endl; |
| 6017 | cout<<"<6>_{2n,1n,1n|2n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(25)<<endl; |
| 6018 | cout<<endl; |
| 6019 | cout<<"<6>_{2n,2n|1n,1n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(26)<<endl; |
| 6020 | cout<<"<6>_{2n,2n|1n,1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(26)<<endl; |
| 6021 | cout<<endl; |
| 6022 | cout<<"<6>_{3n,1n|1n,1n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(27)<<endl; |
| 6023 | cout<<"<6>_{3n,1n|1n,1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(27)<<endl; |
| 6024 | cout<<endl; |
| 6025 | cout<<"<7>_{2n,1n,1n|1n,1n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(29)<<endl; |
| 6026 | cout<<"<7>_{2n,1n,1n|1n,1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(29)<<endl; |
| 6027 | cout<<endl; |
| 6028 | cout<<"<8>_{1n,1n,1n,1n|1n,1n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(31)<<endl; |
| 6029 | cout<<"<8>_{1n,1n,1n,1n|1n,1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(31)<<endl; |
| 6030 | cout<<endl; |
| c365fe76 |
6031 | cout<<"****************************************************"<<endl; |
| 6032 | cout<<"****************************************************"<<endl; |
| 6033 | cout<<endl; |
| 6034 | cout<<"<cos(n*phi1)> from Q-vectors = "<<fQCorrectionsCos->GetBinContent(1)<<endl; |
| 6035 | cout<<"<cos(n*phi1)> from nested loops = "<<fDirectCorrectionsCos->GetBinContent(1)<<endl; |
| 6036 | cout<<endl; |
| 6037 | cout<<"<sin(n*phi1)> from Q-vectors = "<<fQCorrectionsSin->GetBinContent(1)<<endl; |
| 6038 | cout<<"<sin(n*phi1)> from nested loops = "<<fDirectCorrectionsSin->GetBinContent(1)<<endl; |
| 6039 | cout<<endl; |
| 6040 | cout<<"<cos(n*(phi1+phi2))> from Q-vectors = "<<fQCorrectionsCos->GetBinContent(2)<<endl; |
| 6041 | cout<<"<cos(n*(phi1+phi2))> from nested loops = "<<fDirectCorrectionsCos->GetBinContent(2)<<endl; |
| 6042 | cout<<endl; |
| 6043 | cout<<"<sin(n*(phi1+phi2))> from Q-vectors = "<<fQCorrectionsSin->GetBinContent(2)<<endl; |
| 6044 | cout<<"<sin(n*(phi1+phi2))> from nested loops = "<<fDirectCorrectionsSin->GetBinContent(2)<<endl; |
| 6045 | cout<<endl; |
| 6046 | cout<<"<cos(n*(phi1-phi2-phi3))> from Q-vectors = "<<fQCorrectionsCos->GetBinContent(3)<<endl; |
| 6047 | cout<<"<cos(n*(phi1-phi2-phi3))> from nested loops = "<<fDirectCorrectionsCos->GetBinContent(3)<<endl; |
| 6048 | cout<<endl; |
| 6049 | cout<<"<sin(n*(phi1-phi2-phi3))> from Q-vectors = "<<fQCorrectionsSin->GetBinContent(3)<<endl; |
| 6050 | cout<<"<sin(n*(phi1-phi2-phi3))> from nested loops = "<<fDirectCorrectionsSin->GetBinContent(3)<<endl; |
| 6051 | cout<<endl; |
| 77515452 |
6052 | } |
| 9c1a9547 |
6053 | |
| 6054 | if(useWeights) |
| 77515452 |
6055 | { |
| 9c1a9547 |
6056 | //......................................................................................... |
| 6057 | cout<<"<w1 w2 cos(n*(phi1-phi2))> from Q-vectors = "<<fQCorrelationsW->GetBinContent(1)<<endl; |
| 6058 | cout<<"<<w1 w2 cos(n*(phi1-phi2))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(1)<<endl; |
| 6059 | cout<<endl; |
| 6060 | cout<<"<w1^2 w2^2 cos(2n*(phi1-phi2))> from Q-vectors = "<<fQCorrelationsW->GetBinContent(2)<<endl; |
| 6061 | cout<<"<w1^2 w2^2 cos(2n*(phi1-phi2))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(2)<<endl; |
| 6062 | cout<<endl; |
| 6063 | cout<<"<w1^3 w2^3 cos(3n*(phi1-phi2))> from Q-vectors = "<<fQCorrelationsW->GetBinContent(3)<<endl; |
| 6064 | cout<<"<w1^3 w2^3 cos(3n*(phi1-phi2))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(3)<<endl; |
| 6065 | cout<<endl; |
| 6066 | cout<<"<w1^4 w2^4 cos(4n*(phi1-phi2))> from Q-vectors = "<<fQCorrelationsW->GetBinContent(4)<<endl; |
| 6067 | cout<<"<w1^4 w2^4 cos(4n*(phi1-phi2))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(4)<<endl; |
| 6068 | cout<<endl; |
| 6069 | cout<<"<w1^3 w2 cos(n*(phi1-phi2))> from Q-vectors = "<<fQCorrelationsW->GetBinContent(5)<<endl; |
| 6070 | cout<<"<w1^3 w2 cos(n*(phi1-phi2))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(5)<<endl; |
| 6071 | cout<<endl; |
| 6072 | cout<<"<w1 w2 w3^2 cos(n*(phi1-phi2))> from Q-vectors = "<<fQCorrelationsW->GetBinContent(6)<<endl; |
| 6073 | cout<<"<w1 w2 w3^2 cos(n*(phi1-phi2))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(6)<<endl; |
| 6074 | cout<<endl; |
| 6075 | cout<<"<w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> from Q-vectors = "<<fQCorrelationsW->GetBinContent(21)<<endl; |
| 6076 | cout<<"<w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(21)<<endl; |
| 6077 | cout<<endl; |
| 6078 | cout<<"<w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> from Q-vectors = "<<fQCorrelationsW->GetBinContent(41)<<endl; |
| 6079 | cout<<"<w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(41)<<endl; |
| 6080 | cout<<endl; |
| 6081 | //......................................................................................... |
| 77515452 |
6082 | } |
| 9c1a9547 |
6083 | |
| 6084 | } // end of AliFlowAnalysisWithQCumulants::CompareDirectAndQCorrelationsForIntegratedFlow(Bool_t useWeights) |
| 6085 | |
| 77515452 |
6086 | |
| 9c1a9547 |
6087 | //================================================================================================================================ |
| 77515452 |
6088 | |
| 77515452 |
6089 | |
| 9c1a9547 |
6090 | void AliFlowAnalysisWithQCumulants::CompareDirectAndQCorrelationsForDifferentialFlow(Bool_t useWeights) |
| 77515452 |
6091 | { |
| 9c1a9547 |
6092 | // compare correlations needed for diff. flow calculated with nested loops and those calculated from Q-vectors |
| 6093 | |
| 6094 | cout<<endl; |
| 6095 | cout<<" *************************************"<<endl; |
| 6096 | cout<<" **** cross-checking the formulas ****"<<endl; |
| 6097 | cout<<" **** for differential flow ****"<<endl; |
| 6098 | cout<<" **** ****"<<endl; |
| 6099 | cout<<" **** (pt,eta) bin: ****"<<endl; |
| 6100 | cout<<" **** 1.1 < pt < 1.2 GeV ****"<<endl; |
| 6101 | cout<<" **** -0.55 < eta < -0.525 ****"<<endl; |
| 6102 | cout<<" *************************************"<<endl; |
| 6103 | cout<<endl; |
| 6104 | |
| 6105 | if(!useWeights) |
| 6106 | { |
| 6107 | cout<<"<cos(n(psi1-phi2))> from Q-vectors = "<<f2pPtEtaPOI->GetBinContent(f2pPtEtaPOI->GetBin(12,19))<<endl; |
| 6108 | cout<<"<cos(n(psi1-phi2))> from nested loops = "<<fDirectCorrelationsDiffFlow->GetBinContent(1)<<endl; |
| 6109 | cout<<endl; |
| 6110 | cout<<"<cos(n(psi1+phi2-phi3-phi4))> from Q-vectors = "<<f4pPtEtaPOI->GetBinContent(f4pPtEtaPOI->GetBin(12,19))<<endl; |
| 6111 | cout<<"<cos(n(psi1+phi2-phi3-phi4))> from nested loops = "<<fDirectCorrelationsDiffFlow->GetBinContent(41)<<endl; |
| 2bdc5281 |
6112 | cout<<endl; |
| 6113 | cout<<"****************************************************"<<endl; |
| 6114 | cout<<"****************************************************"<<endl; |
| 6115 | cout<<endl; |
| 6116 | cout<<"<cos(n(psi1))> from Q-vectors = "<<fCorrectionsCosP1nPsiPtEtaPOI->GetBinContent(fCorrectionsCosP1nPsiPtEtaPOI->GetBin(12,19))<<endl; |
| 6117 | cout<<"<cos(n(psi1))> from nested loops = "<<fDirectCorrectionsDiffFlowCos->GetBinContent(1)<<endl; |
| 6118 | cout<<endl; |
| 6119 | cout<<"<sin(n(psi1))> from Q-vectors = "<<fCorrectionsSinP1nPsiPtEtaPOI->GetBinContent(fCorrectionsSinP1nPsiPtEtaPOI->GetBin(12,19))<<endl; |
| 6120 | cout<<"<sin(n(psi1))> from nested loops = "<<fDirectCorrectionsDiffFlowSin->GetBinContent(1)<<endl; |
| 9c1a9547 |
6121 | cout<<endl; |
| 77515452 |
6122 | } |
| 9c1a9547 |
6123 | |
| 6124 | if(useWeights) |
| 77515452 |
6125 | { |
| 9c1a9547 |
6126 | cout<<"<w2 cos(n(psi1-phi2))> from Q-vectors = "<<f2pPtEtaPOIW->GetBinContent(f2pPtEtaPOIW->GetBin(12,19))<<endl; |
| 6127 | cout<<"<w2 cos(n(psi1-phi2))> from nested loops = "<<fDirectCorrelationsDiffFlowW->GetBinContent(1)<<endl; |
| 6128 | cout<<endl; |
| 6129 | cout<<"<w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))> from Q-vectors = "<<f4pPtEtaPOIW->GetBinContent(f4pPtEtaPOIW->GetBin(12,19))<<endl; |
| 6130 | cout<<"<w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))> from nested loops = "<<fDirectCorrelationsDiffFlowW->GetBinContent(41)<<endl; |
| 6131 | cout<<endl; |
| 77515452 |
6132 | } |
| 3d824203 |
6133 | |
| 9c1a9547 |
6134 | } // end of void AliFlowAnalysisWithQCumulants::CompareDirectAndQCorrelationsForDifferentialFlow() |
| 77515452 |
6135 | |
| 7e58a232 |
6136 | |
| 9c1a9547 |
6137 | //================================================================================================================================ |
| 77515452 |
6138 | |
| 77515452 |
6139 | |
| 9c1a9547 |
6140 | void AliFlowAnalysisWithQCumulants::WriteHistograms(TString outputFileName) |
| 77515452 |
6141 | { |
| 9c1a9547 |
6142 | //store the final results in output .root file |
| 6143 | TFile *output = new TFile(outputFileName.Data(),"RECREATE"); |
| 0fe80f88 |
6144 | //output->WriteObject(fHistList, "cobjQC","SingleKey"); |
| 6145 | fHistList->SetName("cobjQC"); |
| 9455e15e |
6146 | fHistList->SetOwner(kTRUE); |
| 0fe80f88 |
6147 | fHistList->Write(fHistList->GetName(), TObject::kSingleKey); |
| 9c1a9547 |
6148 | delete output; |
| 6149 | } |
| 77515452 |
6150 | |
| 77515452 |
6151 | |
| 9c1a9547 |
6152 | //================================================================================================================================ |
| 77515452 |
6153 | |
| b7cb54d5 |
6154 | |
| 9c1a9547 |
6155 | void AliFlowAnalysisWithQCumulants::TempDeleteMe() |
| 6156 | { |
| 2bdc5281 |
6157 | /* |
| 6158 | TProfile *tempDeleteMe = new TProfile("tempDeleteMe","tempDeleteMe",2,0,2); |
| 6159 | tempDeleteMe->Fill(0.5,10); |
| 6160 | tempDeleteMe->Fill(0.5,20); |
| 6161 | |
| 6162 | tempDeleteMe->Fill(1.5,100); |
| 6163 | tempDeleteMe->Fill(1.5,200); |
| 6164 | |
| 6165 | cout<<tempDeleteMe->GetBinContent(1)<<endl; |
| 6166 | cout<<tempDeleteMe->GetBinContent(2)<<endl; |
| 6167 | */ |
| 6168 | |
| 6169 | |
| 6170 | |
| 77515452 |
6171 | /* |
| 9c1a9547 |
6172 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| e085f1a9 |
6173 | TCanvas* qvectorPlot = new TCanvas("qvectorPlot","Q-vector Plot",1000,1000); |
| 6174 | |
| 6175 | qvectorPlot->cd(1); |
| 6176 | |
| 6177 | TH1D* style = new TH1D("style","Q-vectors",100,-244,244); |
| 6178 | (style->GetYaxis())->SetRangeUser(-244,244); |
| 6179 | |
| 6180 | style->Draw(); |
| 6181 | |
| 6182 | Int_t nBins=fQvectorForEachEventX->GetNbinsX(); |
| 6183 | Double_t qxxx=0.,qyyy=0.; |
| 6184 | //cout<<"nBins = "<<nBins<<endl; |
| 6185 | //cout<<fQvectorForEachEventX->GetBinEntries(4)<<endl; |
| 6186 | //cout<<fQvectorForEachEventY->GetBinEntries(4)<<endl; |
| 6187 | |
| 6188 | for(Int_t b=1;b<nBins+1;b++) |
| 6189 | { |
| 6190 | if(fQvectorForEachEventX->GetBinEntries(b)==1 && fQvectorForEachEventY->GetBinEntries(b)==1) |
| 6191 | { |
| 6192 | qxxx=fQvectorForEachEventX->GetBinContent(b); |
| 6193 | qyyy=fQvectorForEachEventY->GetBinContent(b); |
| 6194 | //cout<<qxxx<<" "<<qyyy<<endl; |
| 6195 | TArrow *qvector = new TArrow(0.0,0.0,qxxx,qyyy,0.0144,"|>"); |
| 6196 | qvector->SetAngle(40); |
| 6197 | qvector->SetLineWidth(2); |
| 6198 | qvector->Draw(""); |
| 6199 | } |
| 6200 | } |
| e085f1a9 |
6201 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| 9c1a9547 |
6202 | */ |
| 6203 | |
| 6204 | |
| 2bdc5281 |
6205 | /* |
| 9c1a9547 |
6206 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| 6207 | Int_t nBinsPt=3, nBinsEta=2; |
| 6208 | Double_t ptMin=0., ptMax=3.; |
| 6209 | Double_t etaMin=0., etaMax=2.; |
| 6210 | |
| e085f1a9 |
6211 | |
| 9c1a9547 |
6212 | //avarage of the generating function for integrated flow <G[p][q]> |
| 6213 | TProfile2D *tempPtEta = new TProfile2D("tempPtEta","<2'>(pt,eta)",nBinsPt,ptMin,ptMax,nBinsEta,etaMin,etaMax); |
| 6214 | tempPtEta->SetXTitle("pt"); |
| 6215 | tempPtEta->SetYTitle("eta"); |
| 6216 | |
| 6217 | // (1,1): |
| 6218 | tempPtEta->Fill(0.5,0.67,0.4,2); |
| 6219 | tempPtEta->Fill(0.1,0.44,0.6,3); |
| 6220 | |
| 6221 | // (3,1): |
| 6222 | tempPtEta->Fill(2.5,0.01,2.2,4); |
| 6223 | tempPtEta->Fill(2.1,0.74,2.6,3.7); |
| 6224 | |
| 6225 | //tempPtEta->Fill(2.5,0.5,1,2); |
| 6226 | //tempPtEta->Fill(2.5,1.5,3,1); |
| 6227 | //tempPtEta->Fill(2.6,0.6,7,3); |
| 6228 | //tempPtEta->Fill(2.5,0.5,1,1); |
| 6229 | |
| 6230 | |
| 6231 | |
| 6232 | TCanvas* tempCanvas = new TCanvas("tempCanvas","tempCanvas",1000,600); |
| 6233 | |
| 6234 | tempCanvas->Divide(1,2); |
| 6235 | |
| 6236 | tempCanvas->cd(1); |
| 6237 | tempPtEta->Draw("SURF1"); |
| 6238 | |
| 6239 | (tempCanvas->cd(2))->Divide(1,2); |
| 6240 | |
| 6241 | tempCanvas->cd(1); |
| 6242 | //tempPt->Draw(); |
| 6243 | |
| 6244 | tempCanvas->cd(2); |
| 6245 | //tempEta->Draw(); |
| 2bdc5281 |
6246 | |
| 6247 | */ |
| 6248 | |
| 9c1a9547 |
6249 | |
| 6250 | /* |
| 6251 | cout<<tempPtEta->GetBinContent(tempPtEta->GetBin(1,1))<<endl; |
| 6252 | cout<<tempPtEta->GetBinContent(tempPtEta->GetBin(3,1))<<endl; |
| 6253 | cout<<tempEta->GetBinContent(1)<<endl; |
| 6254 | cout<<tempEta->GetBinEntries(1)<<endl; |
| 6255 | cout<<tempEta->GetBinContent(2)<<endl; |
| 6256 | cout<<tempEta->GetBinEntries(2)<<endl; |
| 6257 | cout<<endl; |
| 6258 | */ |
| 6259 | /* |
| 6260 | cout<<tempPtEta->GetBinContent(3,1)<<endl; |
| 6261 | cout<<tempPtEta->GetBinEntries(tempPtEta->GetBin(3,1))<<endl; |
| 6262 | cout<<endl; |
| 6263 | |
| 6264 | cout<<tempPtEta->GetBinContent(1,2)<<endl; |
| 6265 | cout<<tempPtEta->GetBinEntries(tempPtEta->GetBin(1,2))<<endl; |
| 6266 | cout<<endl; |
| 6267 | |
| 6268 | cout<<"xy"<<endl; |
| 6269 | cout<<tempPt->GetBinContent(1)<<endl; |
| 6270 | //cout<<tempPt->GetBinEntries(1)<<endl; |
| 6271 | cout<<tempPt->GetBinContent(3)<<endl; |
| 6272 | //cout<<tempPt->GetBinEntries(3)<<endl; |
| 6273 | cout<<endl; |
| 6274 | |
| 6275 | cout<<tempEta->GetBinContent(1)<<endl; |
| 6276 | //cout<<tempEta->GetBinEntries(1)<<endl; |
| 6277 | cout<<tempEta->GetBinContent(2)<<endl; |
| 6278 | //cout<<tempEta->GetBinEntries(2)<<endl; |
| 6279 | cout<<endl; |
| 6280 | |
| 6281 | //tempPtEta->Draw("LEGO2"); |
| 6282 | */ |
| 6283 | |
| 6284 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| bc92c0cb |
6285 | |
| 6286 | |
| 1315fe58 |
6287 | } |
| bc92c0cb |
6288 | |
| dee1e0e0 |
6289 | |
| 9c1a9547 |
6290 | //================================================================================================================================ |
| 4057ba99 |
6291 | |
| 6292 | |
git://git.uio.no / u / mrichter / AliRoot.git / blame