]>
Commit | Line | Data |
---|---|---|
489d5531 | 1 | /************************************************************************* |
2 | * Copyright(c) 1998-2008, ALICE Experiment at CERN, All rights reserved. * | |
3 | * * | |
4 | * Author: The ALICE Off-line Project. * | |
5 | * Contributors are mentioned in the code where appropriate. * | |
6 | * * | |
7 | * Permission to use, copy, modify and distribute this software and its * | |
8 | * documentation strictly for non-commercial purposes is hereby granted * | |
9 | * without fee, provided that the above copyright notice appears in all * | |
10 | * copies and that both the copyright notice and this permission notice * | |
11 | * appear in the supporting documentation. The authors make no claims * | |
12 | * about the suitability of this software for any purpose. It is * | |
13 | * provided "as is" without express or implied warranty. * | |
14 | **************************************************************************/ | |
15 | ||
16 | /********************************** | |
17 | * flow analysis with Q-cumulants * | |
18 | * * | |
ff70ca91 | 19 | * author: Ante Bilandzic * |
20 | * (abilandzic@gmail.com) * | |
489d5531 | 21 | *********************************/ |
22 | ||
23 | #define AliFlowAnalysisWithQCumulants_cxx | |
24 | ||
25 | #include "Riostream.h" | |
26 | #include "AliFlowCommonConstants.h" | |
27 | #include "AliFlowCommonHist.h" | |
28 | #include "AliFlowCommonHistResults.h" | |
29 | #include "TChain.h" | |
30 | ||
31 | #include "TFile.h" | |
32 | #include "TList.h" | |
33 | #include "TGraph.h" | |
34 | #include "TParticle.h" | |
35 | #include "TRandom3.h" | |
36 | #include "TStyle.h" | |
37 | #include "TProfile.h" | |
38 | #include "TProfile2D.h" | |
489d5531 | 39 | #include "TMath.h" |
40 | #include "TArrow.h" | |
41 | #include "TPaveLabel.h" | |
42 | #include "TCanvas.h" | |
43 | #include "AliFlowEventSimple.h" | |
44 | #include "AliFlowTrackSimple.h" | |
45 | #include "AliFlowAnalysisWithQCumulants.h" | |
46 | #include "TArrayD.h" | |
47 | #include "TRandom.h" | |
48 | #include "TF1.h" | |
49 | ||
50 | class TH1; | |
51 | class TH2; | |
52 | class TGraph; | |
53 | class TPave; | |
54 | class TLatex; | |
55 | class TMarker; | |
56 | class TRandom3; | |
57 | class TObjArray; | |
58 | class TList; | |
59 | class TCanvas; | |
60 | class TSystem; | |
61 | class TROOT; | |
62 | class AliFlowVector; | |
63 | class TVector; | |
64 | ||
489d5531 | 65 | //================================================================================================================ |
66 | ||
489d5531 | 67 | ClassImp(AliFlowAnalysisWithQCumulants) |
68 | ||
69 | AliFlowAnalysisWithQCumulants::AliFlowAnalysisWithQCumulants(): | |
70 | // 0.) base: | |
71 | fHistList(NULL), | |
72 | // 1.) common: | |
73 | fCommonHists(NULL), | |
74 | fCommonHists2nd(NULL), | |
75 | fCommonHists4th(NULL), | |
76 | fCommonHists6th(NULL), | |
77 | fCommonHists8th(NULL), | |
78 | fCommonHistsResults2nd(NULL), | |
79 | fCommonHistsResults4th(NULL), | |
80 | fCommonHistsResults6th(NULL), | |
81 | fCommonHistsResults8th(NULL), | |
82 | fnBinsPhi(0), | |
83 | fPhiMin(0), | |
84 | fPhiMax(0), | |
85 | fPhiBinWidth(0), | |
86 | fnBinsPt(0), | |
87 | fPtMin(0), | |
88 | fPtMax(0), | |
89 | fPtBinWidth(0), | |
90 | fnBinsEta(0), | |
91 | fEtaMin(0), | |
92 | fEtaMax(0), | |
93 | fEtaBinWidth(0), | |
1268c371 | 94 | fCommonConstants(NULL), |
dd442cd2 | 95 | fFillMultipleControlHistograms(kFALSE), |
489d5531 | 96 | fHarmonic(2), |
97 | fAnalysisLabel(NULL), | |
98 | // 2a.) particle weights: | |
99 | fWeightsList(NULL), | |
100 | fUsePhiWeights(kFALSE), | |
101 | fUsePtWeights(kFALSE), | |
102 | fUseEtaWeights(kFALSE), | |
103 | fUseParticleWeights(NULL), | |
104 | fPhiWeights(NULL), | |
105 | fPtWeights(NULL), | |
106 | fEtaWeights(NULL), | |
107 | // 2b.) event weights: | |
108 | fMultiplicityWeight(NULL), | |
109 | // 3.) integrated flow: | |
110 | fIntFlowList(NULL), | |
111 | fIntFlowProfiles(NULL), | |
112 | fIntFlowResults(NULL), | |
113 | fIntFlowFlags(NULL), | |
b92ea2b9 | 114 | fApplyCorrectionForNUA(kFALSE), |
2001bc3a | 115 | fApplyCorrectionForNUAVsM(kFALSE), |
9da1a4f3 | 116 | fnBinsMult(10000), |
067e9bc8 | 117 | fMinMult(0.), |
118 | fMaxMult(10000.), | |
b77b6434 | 119 | fPropagateErrorAlsoFromNIT(kFALSE), |
8ed4edc7 | 120 | fCalculateCumulantsVsM(kFALSE), |
0dd3b008 | 121 | fMinimumBiasReferenceFlow(kTRUE), |
e5834fcb | 122 | fForgetAboutCovariances(kFALSE), |
123 | fStorePhiDistributionForOneEvent(kFALSE), | |
489d5531 | 124 | fReQ(NULL), |
125 | fImQ(NULL), | |
1268c371 | 126 | fSpk(NULL), |
489d5531 | 127 | fIntFlowCorrelationsEBE(NULL), |
128 | fIntFlowEventWeightsForCorrelationsEBE(NULL), | |
129 | fIntFlowCorrelationsAllEBE(NULL), | |
e5834fcb | 130 | fReferenceMultiplicityEBE(0.), |
489d5531 | 131 | fAvMultiplicity(NULL), |
132 | fIntFlowCorrelationsPro(NULL), | |
b40a910e | 133 | fIntFlowSquaredCorrelationsPro(NULL), |
489d5531 | 134 | fIntFlowCorrelationsAllPro(NULL), |
135 | fIntFlowExtraCorrelationsPro(NULL), | |
136 | fIntFlowProductOfCorrelationsPro(NULL), | |
0328db2d | 137 | fIntFlowProductOfCorrectionTermsForNUAPro(NULL), |
489d5531 | 138 | fIntFlowCorrelationsHist(NULL), |
139 | fIntFlowCorrelationsAllHist(NULL), | |
140 | fIntFlowCovariances(NULL), | |
141 | fIntFlowSumOfProductOfEventWeights(NULL), | |
0328db2d | 142 | fIntFlowCovariancesNUA(NULL), |
143 | fIntFlowSumOfProductOfEventWeightsNUA(NULL), | |
489d5531 | 144 | fIntFlowQcumulants(NULL), |
b92ea2b9 | 145 | fIntFlowQcumulantsRebinnedInM(NULL), |
146 | fIntFlowQcumulantsErrorSquaredRatio(NULL), | |
489d5531 | 147 | fIntFlow(NULL), |
b3dacf6b | 148 | fIntFlowRebinnedInM(NULL), |
2001bc3a | 149 | fIntFlowDetectorBias(NULL), |
489d5531 | 150 | // 4.) differential flow: |
151 | fDiffFlowList(NULL), | |
152 | fDiffFlowProfiles(NULL), | |
153 | fDiffFlowResults(NULL), | |
1268c371 | 154 | fDiffFlow2D(NULL), |
489d5531 | 155 | fDiffFlowFlags(NULL), |
1268c371 | 156 | fCalculateDiffFlow(kTRUE), |
157 | fCalculate2DDiffFlow(kFALSE), | |
489d5531 | 158 | // 5.) distributions: |
57340a27 | 159 | fDistributionsList(NULL), |
160 | fDistributionsFlags(NULL), | |
489d5531 | 161 | fStoreDistributions(kFALSE), |
e5834fcb | 162 | // 6.) various: |
163 | fVariousList(NULL), | |
164 | fPhiDistributionForOneEvent(NULL), | |
489d5531 | 165 | // x.) debugging and cross-checking: |
166 | fNestedLoopsList(NULL), | |
167 | fEvaluateIntFlowNestedLoops(kFALSE), | |
168 | fEvaluateDiffFlowNestedLoops(kFALSE), | |
169 | fMaxAllowedMultiplicity(10), | |
170 | fEvaluateNestedLoops(NULL), | |
171 | fIntFlowDirectCorrelations(NULL), | |
172 | fIntFlowExtraDirectCorrelations(NULL), | |
173 | fCrossCheckInPtBinNo(10), | |
3b552efe | 174 | fCrossCheckInEtaBinNo(20), |
489d5531 | 175 | fNoOfParticlesInBin(NULL) |
176 | { | |
177 | // constructor | |
178 | ||
179 | // base list to hold all output objects: | |
180 | fHistList = new TList(); | |
181 | fHistList->SetName("cobjQC"); | |
182 | fHistList->SetOwner(kTRUE); | |
183 | ||
184 | // list to hold histograms with phi, pt and eta weights: | |
185 | fWeightsList = new TList(); | |
186 | ||
187 | // multiplicity weight: | |
188 | fMultiplicityWeight = new TString("combinations"); | |
189 | ||
190 | // analysis label; | |
191 | fAnalysisLabel = new TString(); | |
192 | ||
193 | // initialize all arrays: | |
194 | this->InitializeArraysForIntFlow(); | |
195 | this->InitializeArraysForDiffFlow(); | |
196 | this->InitializeArraysForDistributions(); | |
e5834fcb | 197 | this->InitializeArraysForVarious(); |
489d5531 | 198 | this->InitializeArraysForNestedLoops(); |
199 | ||
200 | } // end of constructor | |
201 | ||
489d5531 | 202 | //================================================================================================================ |
203 | ||
489d5531 | 204 | AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants() |
205 | { | |
206 | // destructor | |
207 | ||
208 | delete fHistList; | |
209 | ||
210 | } // end of AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants() | |
211 | ||
489d5531 | 212 | //================================================================================================================ |
213 | ||
489d5531 | 214 | void AliFlowAnalysisWithQCumulants::Init() |
215 | { | |
3b552efe | 216 | // a) Cross check if the settings make sense before starting the QC adventure; |
489d5531 | 217 | // b) Access all common constants; |
218 | // c) Book all objects; | |
3b552efe | 219 | // d) Store flags for integrated and differential flow; |
489d5531 | 220 | // e) Store flags for distributions of corelations; |
221 | // f) Store harmonic which will be estimated. | |
3b552efe | 222 | |
489d5531 | 223 | //save old value and prevent histograms from being added to directory |
224 | //to avoid name clashes in case multiple analaysis objects are used | |
225 | //in an analysis | |
226 | Bool_t oldHistAddStatus = TH1::AddDirectoryStatus(); | |
227 | TH1::AddDirectory(kFALSE); | |
228 | ||
3b552efe | 229 | // a) Cross check if the settings make sense before starting the QC adventure; |
489d5531 | 230 | this->CrossCheckSettings(); |
1268c371 | 231 | // b) Access all common constants and book a profile to hold them: |
232 | this->CommonConstants("Init"); | |
489d5531 | 233 | // c) Book all objects: |
1268c371 | 234 | this->BookAndFillWeightsHistograms(); |
489d5531 | 235 | this->BookAndNestAllLists(); |
236 | this->BookCommonHistograms(); | |
237 | this->BookEverythingForIntegratedFlow(); | |
238 | this->BookEverythingForDifferentialFlow(); | |
1268c371 | 239 | this->BookEverythingFor2DDifferentialFlow(); |
489d5531 | 240 | this->BookEverythingForDistributions(); |
e5834fcb | 241 | this->BookEverythingForVarious(); |
489d5531 | 242 | this->BookEverythingForNestedLoops(); |
243 | // d) Store flags for integrated and differential flow: | |
244 | this->StoreIntFlowFlags(); | |
3b552efe | 245 | this->StoreDiffFlowFlags(); |
489d5531 | 246 | // e) Store flags for distributions of corelations: |
247 | this->StoreFlagsForDistributions(); | |
248 | // f) Store harmonic which will be estimated: | |
249 | this->StoreHarmonic(); | |
250 | ||
251 | TH1::AddDirectory(oldHistAddStatus); | |
252 | } // end of void AliFlowAnalysisWithQCumulants::Init() | |
253 | ||
489d5531 | 254 | //================================================================================================================ |
255 | ||
489d5531 | 256 | void AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent) |
257 | { | |
258 | // Running over data only in this method. | |
259 | ||
b3dacf6b | 260 | // a) Check all pointers used in this method; |
261 | // b) Define local variables; | |
262 | // c) Fill the common control histograms and call the method to fill fAvMultiplicity; | |
1268c371 | 263 | // d) Loop over data and calculate e-b-e quantities Q_{n,k}, S_{p,k} and s_{p,k}; |
264 | // e) Calculate the final expressions for S_{p,k} and s_{p,k} (important !!!!); | |
265 | // f) Call the methods which calculate correlations for reference flow; | |
266 | // g) Call the methods which calculate correlations for differential flow; | |
267 | // h) Call the methods which calculate correlations for 2D differential flow; | |
268 | // i) Distributions of correlations; | |
269 | // j) Store phi distribution for one event to illustrate flow; | |
270 | // k) Cross-check with nested loops correlators for reference flow; | |
271 | // l) Cross-check with nested loops correlators for differential flow; | |
272 | // m) Reset all event-by-event quantities (very important !!!!). | |
489d5531 | 273 | |
b3dacf6b | 274 | // a) Check all pointers used in this method: |
275 | this->CheckPointersUsedInMake(); | |
276 | ||
277 | // b) Define local variables: | |
489d5531 | 278 | Double_t dPhi = 0.; // azimuthal angle in the laboratory frame |
279 | Double_t dPt = 0.; // transverse momentum | |
280 | Double_t dEta = 0.; // pseudorapidity | |
489d5531 | 281 | Double_t wPhi = 1.; // phi weight |
282 | Double_t wPt = 1.; // pt weight | |
283 | Double_t wEta = 1.; // eta weight | |
1268c371 | 284 | Int_t nRP = anEvent->GetEventNSelTracksRP(); // number of RPs (i.e. number of reference particles) |
e5834fcb | 285 | fReferenceMultiplicityEBE = anEvent->GetReferenceMultiplicity(); // reference multiplicity for current event |
1268c371 | 286 | Double_t ptEta[2] = {0.,0.}; // 0 = dPt, 1 = dEta |
9f33751d | 287 | |
b3dacf6b | 288 | // c) Fill the common control histograms and call the method to fill fAvMultiplicity: |
489d5531 | 289 | this->FillCommonControlHistograms(anEvent); |
290 | this->FillAverageMultiplicities(nRP); | |
291 | ||
1268c371 | 292 | // d) Loop over data and calculate e-b-e quantities Q_{n,k}, S_{p,k} and s_{p,k}: |
9f33751d | 293 | Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = total number of primary tracks, i.e. nPrim = nRP + nPOI where: |
1268c371 | 294 | // nRP = # of reference particles; |
295 | // nPOI = # of particles of interest. | |
489d5531 | 296 | AliFlowTrackSimple *aftsTrack = NULL; |
1268c371 | 297 | Int_t n = fHarmonic; // shortcut for the harmonic |
489d5531 | 298 | for(Int_t i=0;i<nPrim;i++) |
299 | { | |
300 | aftsTrack=anEvent->GetTrack(i); | |
301 | if(aftsTrack) | |
302 | { | |
1268c371 | 303 | if(!(aftsTrack->InRPSelection() || aftsTrack->InPOISelection())){continue;} // safety measure: consider only tracks which are RPs or POIs |
489d5531 | 304 | if(aftsTrack->InRPSelection()) // RP condition: |
305 | { | |
306 | dPhi = aftsTrack->Phi(); | |
307 | dPt = aftsTrack->Pt(); | |
308 | dEta = aftsTrack->Eta(); | |
309 | if(fUsePhiWeights && fPhiWeights && fnBinsPhi) // determine phi weight for this particle: | |
310 | { | |
311 | wPhi = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(dPhi*fnBinsPhi/TMath::TwoPi()))); | |
312 | } | |
313 | if(fUsePtWeights && fPtWeights && fnBinsPt) // determine pt weight for this particle: | |
314 | { | |
315 | wPt = fPtWeights->GetBinContent(1+(Int_t)(TMath::Floor((dPt-fPtMin)/fPtBinWidth))); | |
316 | } | |
317 | if(fUseEtaWeights && fEtaWeights && fEtaBinWidth) // determine eta weight for this particle: | |
318 | { | |
319 | wEta = fEtaWeights->GetBinContent(1+(Int_t)(TMath::Floor((dEta-fEtaMin)/fEtaBinWidth))); | |
1268c371 | 320 | } |
321 | // Calculate Re[Q_{m*n,k}] and Im[Q_{m*n,k}] for this event (m = 1,2,...,6, k = 0,1,...,8): | |
322 | for(Int_t m=0;m<6;m++) // to be improved - hardwired 6 | |
489d5531 | 323 | { |
1268c371 | 324 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 |
489d5531 | 325 | { |
326 | (*fReQ)(m,k)+=pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1)*n*dPhi); | |
327 | (*fImQ)(m,k)+=pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1)*n*dPhi); | |
328 | } | |
329 | } | |
1268c371 | 330 | // Calculate S_{p,k} for this event (Remark: final calculation of S_{p,k} follows after the loop over data bellow): |
489d5531 | 331 | for(Int_t p=0;p<8;p++) |
332 | { | |
333 | for(Int_t k=0;k<9;k++) | |
334 | { | |
1268c371 | 335 | (*fSpk)(p,k)+=pow(wPhi*wPt*wEta,k); |
489d5531 | 336 | } |
337 | } | |
1268c371 | 338 | // Differential flow: |
339 | if(fCalculateDiffFlow || fCalculate2DDiffFlow) | |
489d5531 | 340 | { |
1268c371 | 341 | ptEta[0] = dPt; |
342 | ptEta[1] = dEta; | |
343 | // Calculate r_{m*n,k} and s_{p,k} (r_{m,k} is 'p-vector' for RPs): | |
344 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
489d5531 | 345 | { |
1268c371 | 346 | for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 |
489d5531 | 347 | { |
1268c371 | 348 | if(fCalculateDiffFlow) |
349 | { | |
350 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
351 | { | |
352 | fReRPQ1dEBE[0][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.); | |
353 | fImRPQ1dEBE[0][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
354 | if(m==0) // s_{p,k} does not depend on index m | |
355 | { | |
356 | fs1dEBE[0][pe][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta,k),1.); | |
357 | } // end of if(m==0) // s_{p,k} does not depend on index m | |
358 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
359 | } // end of if(fCalculateDiffFlow) | |
360 | if(fCalculate2DDiffFlow) | |
361 | { | |
362 | fReRPQ2dEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.); | |
363 | fImRPQ2dEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
364 | if(m==0) // s_{p,k} does not depend on index m | |
365 | { | |
366 | fs2dEBE[0][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k),1.); | |
367 | } // end of if(m==0) // s_{p,k} does not depend on index m | |
368 | } // end of if(fCalculate2DDiffFlow) | |
369 | } // end of for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 | |
370 | } // end of for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
371 | // Checking if RP particle is also POI particle: | |
372 | if(aftsTrack->InPOISelection()) | |
489d5531 | 373 | { |
1268c371 | 374 | // Calculate q_{m*n,k} and s_{p,k} ('q-vector' and 's' for RPs && POIs): |
375 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
489d5531 | 376 | { |
1268c371 | 377 | for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 |
489d5531 | 378 | { |
1268c371 | 379 | if(fCalculateDiffFlow) |
380 | { | |
381 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
382 | { | |
383 | fReRPQ1dEBE[2][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.); | |
384 | fImRPQ1dEBE[2][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
385 | if(m==0) // s_{p,k} does not depend on index m | |
386 | { | |
387 | fs1dEBE[2][pe][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta,k),1.); | |
388 | } // end of if(m==0) // s_{p,k} does not depend on index m | |
389 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
390 | } // end of if(fCalculateDiffFlow) | |
391 | if(fCalculate2DDiffFlow) | |
392 | { | |
393 | fReRPQ2dEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.); | |
394 | fImRPQ2dEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
395 | if(m==0) // s_{p,k} does not depend on index m | |
396 | { | |
397 | fs2dEBE[2][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k),1.); | |
398 | } // end of if(m==0) // s_{p,k} does not depend on index m | |
399 | } // end of if(fCalculate2DDiffFlow) | |
400 | } // end of for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 | |
401 | } // end of for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
402 | } // end of if(aftsTrack->InPOISelection()) | |
403 | } // end of if(fCalculateDiffFlow || fCalculate2DDiffFlow) | |
489d5531 | 404 | } // end of if(pTrack->InRPSelection()) |
489d5531 | 405 | if(aftsTrack->InPOISelection()) |
406 | { | |
407 | dPhi = aftsTrack->Phi(); | |
408 | dPt = aftsTrack->Pt(); | |
409 | dEta = aftsTrack->Eta(); | |
1268c371 | 410 | ptEta[0] = dPt; |
411 | ptEta[1] = dEta; | |
412 | // Calculate p_{m*n,k} ('p-vector' for POIs): | |
413 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
489d5531 | 414 | { |
1268c371 | 415 | for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 |
489d5531 | 416 | { |
1268c371 | 417 | if(fCalculateDiffFlow) |
418 | { | |
419 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
420 | { | |
421 | fReRPQ1dEBE[1][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.); | |
422 | fImRPQ1dEBE[1][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
423 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
424 | } // end of if(fCalculateDiffFlow) | |
425 | if(fCalculate2DDiffFlow) | |
426 | { | |
427 | fReRPQ2dEBE[1][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.); | |
428 | fImRPQ2dEBE[1][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
429 | } // end of if(fCalculate2DDiffFlow) | |
430 | } // end of for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 | |
431 | } // end of for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
b77b6434 | 432 | } // end of if(pTrack->InPOISelection()) |
489d5531 | 433 | } else // to if(aftsTrack) |
434 | { | |
1268c371 | 435 | printf(" WARNING (QC): No particle (i.e. aftsTrack is a NULL pointer in AFAWQC::Make())!!!!\n\n"); |
489d5531 | 436 | } |
437 | } // end of for(Int_t i=0;i<nPrim;i++) | |
438 | ||
1268c371 | 439 | // e) Calculate the final expressions for S_{p,k} and s_{p,k} (important !!!!): |
489d5531 | 440 | for(Int_t p=0;p<8;p++) |
441 | { | |
442 | for(Int_t k=0;k<9;k++) | |
443 | { | |
1268c371 | 444 | (*fSpk)(p,k)=pow((*fSpk)(p,k),p+1); |
445 | // ... for the time being s_{p,k} dosn't need higher powers, so no need to finalize it here ... | |
446 | } // end of for(Int_t k=0;k<9;k++) | |
447 | } // end of for(Int_t p=0;p<8;p++) | |
489d5531 | 448 | |
1268c371 | 449 | // f) Call the methods which calculate correlations for reference flow: |
489d5531 | 450 | if(!fEvaluateIntFlowNestedLoops) |
451 | { | |
452 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
453 | { | |
1268c371 | 454 | if(nRP>1){this->CalculateIntFlowCorrelations();} // without using particle weights |
0328db2d | 455 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) |
489d5531 | 456 | { |
1268c371 | 457 | if(nRP>1){this->CalculateIntFlowCorrelationsUsingParticleWeights();} // with using particle weights |
458 | } | |
459 | // Whether or not using particle weights the following is calculated in the same way: | |
460 | if(nRP>3){this->CalculateIntFlowProductOfCorrelations();} | |
461 | if(nRP>1){this->CalculateIntFlowSumOfEventWeights();} | |
462 | if(nRP>1){this->CalculateIntFlowSumOfProductOfEventWeights();} | |
463 | // Non-isotropic terms: | |
b92ea2b9 | 464 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) |
489d5531 | 465 | { |
1268c371 | 466 | if(nRP>0){this->CalculateIntFlowCorrectionsForNUASinTerms();} |
467 | if(nRP>0){this->CalculateIntFlowCorrectionsForNUACosTerms();} | |
b92ea2b9 | 468 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) |
469 | { | |
1268c371 | 470 | if(nRP>0){this->CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights();} |
471 | if(nRP>0){this->CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights();} | |
472 | } | |
473 | // Whether or not using particle weights the following is calculated in the same way: | |
474 | if(nRP>0){this->CalculateIntFlowProductOfCorrectionTermsForNUA();} | |
475 | if(nRP>0){this->CalculateIntFlowSumOfEventWeightsNUA();} | |
476 | if(nRP>0){this->CalculateIntFlowSumOfProductOfEventWeightsNUA();} | |
489d5531 | 477 | } // end of if(!fEvaluateIntFlowNestedLoops) |
478 | ||
1268c371 | 479 | // g) Call the methods which calculate correlations for differential flow: |
480 | if(!fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) | |
489d5531 | 481 | { |
482 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
483 | { | |
1268c371 | 484 | // Without using particle weights: |
489d5531 | 485 | this->CalculateDiffFlowCorrelations("RP","Pt"); |
486 | this->CalculateDiffFlowCorrelations("RP","Eta"); | |
487 | this->CalculateDiffFlowCorrelations("POI","Pt"); | |
57340a27 | 488 | this->CalculateDiffFlowCorrelations("POI","Eta"); |
1268c371 | 489 | // Non-isotropic terms: |
b92ea2b9 | 490 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Pt"); |
491 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Eta"); | |
492 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Pt"); | |
493 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Eta"); | |
494 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Pt"); | |
495 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Eta"); | |
496 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Pt"); | |
497 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Eta"); | |
489d5531 | 498 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) |
499 | { | |
1268c371 | 500 | // With using particle weights: |
489d5531 | 501 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Pt"); |
502 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Eta"); | |
503 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Pt"); | |
504 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Eta"); | |
1268c371 | 505 | // Non-isotropic terms: |
b92ea2b9 | 506 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Pt"); |
507 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Eta"); | |
508 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Pt"); | |
509 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Eta"); | |
510 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Pt"); | |
511 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Eta"); | |
512 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Pt"); | |
513 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Eta"); | |
1268c371 | 514 | } |
515 | // Whether or not using particle weights the following is calculated in the same way: | |
489d5531 | 516 | this->CalculateDiffFlowProductOfCorrelations("RP","Pt"); |
517 | this->CalculateDiffFlowProductOfCorrelations("RP","Eta"); | |
518 | this->CalculateDiffFlowProductOfCorrelations("POI","Pt"); | |
519 | this->CalculateDiffFlowProductOfCorrelations("POI","Eta"); | |
520 | this->CalculateDiffFlowSumOfEventWeights("RP","Pt"); | |
521 | this->CalculateDiffFlowSumOfEventWeights("RP","Eta"); | |
522 | this->CalculateDiffFlowSumOfEventWeights("POI","Pt"); | |
523 | this->CalculateDiffFlowSumOfEventWeights("POI","Eta"); | |
524 | this->CalculateDiffFlowSumOfProductOfEventWeights("RP","Pt"); | |
525 | this->CalculateDiffFlowSumOfProductOfEventWeights("RP","Eta"); | |
526 | this->CalculateDiffFlowSumOfProductOfEventWeights("POI","Pt"); | |
527 | this->CalculateDiffFlowSumOfProductOfEventWeights("POI","Eta"); | |
1268c371 | 528 | } // end of if(!fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) |
489d5531 | 529 | |
1268c371 | 530 | // h) Call the methods which calculate correlations for 2D differential flow: |
531 | if(!fEvaluateDiffFlowNestedLoops && fCalculate2DDiffFlow) | |
532 | { | |
533 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
489d5531 | 534 | { |
1268c371 | 535 | // Without using particle weights: |
536 | this->Calculate2DDiffFlowCorrelations("RP"); | |
537 | this->Calculate2DDiffFlowCorrelations("POI"); | |
538 | // Non-isotropic terms: | |
539 | // ... to be ctd ... | |
540 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
541 | { | |
542 | // With using particle weights: | |
543 | // ... to be ctd ... | |
544 | // Non-isotropic terms: | |
545 | // ... to be ctd ... | |
546 | } | |
547 | // Whether or not using particle weights the following is calculated in the same way: | |
548 | // ... to be ctd ... | |
549 | } // end of if(!fEvaluateDiffFlowNestedLoops && fCalculate2DDiffFlow) | |
550 | ||
551 | // i) Distributions of correlations: | |
e5834fcb | 552 | if(fStoreDistributions){this->StoreDistributionsOfCorrelations();} |
553 | ||
1268c371 | 554 | // j) Store phi distribution for one event to illustrate flow: |
e5834fcb | 555 | if(fStorePhiDistributionForOneEvent){this->StorePhiDistributionForOneEvent(anEvent);} |
1268c371 | 556 | |
557 | // k) Cross-check with nested loops correlators for reference flow: | |
558 | if(fEvaluateIntFlowNestedLoops){this->EvaluateIntFlowNestedLoops(anEvent);} | |
559 | ||
560 | // l) Cross-check with nested loops correlators for differential flow: | |
561 | if(fEvaluateDiffFlowNestedLoops){this->EvaluateDiffFlowNestedLoops(anEvent);} | |
489d5531 | 562 | |
1268c371 | 563 | // m) Reset all event-by-event quantities (very important !!!!): |
489d5531 | 564 | this->ResetEventByEventQuantities(); |
565 | ||
566 | } // end of AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent) | |
567 | ||
489d5531 | 568 | //================================================================================================================================ |
569 | ||
489d5531 | 570 | void AliFlowAnalysisWithQCumulants::Finish() |
571 | { | |
572 | // Calculate the final results. | |
489d5531 | 573 | |
b3dacf6b | 574 | // a) Check all pointers used in this method; |
575 | // b) Acces the constants; | |
576 | // c) Access the flags; | |
b92ea2b9 | 577 | // d) Calculate reference cumulants (not corrected for detector effects); |
578 | // e) Correct reference cumulants for detector effects; | |
579 | // f) Calculate reference flow; | |
b77b6434 | 580 | // g) Store results for reference flow in AliFlowCommonHistResults and print them on the screen; |
b92ea2b9 | 581 | // h) Calculate the final results for differential flow (without/with weights); |
582 | // i) Correct the results for differential flow (without/with weights) for effects of non-uniform acceptance (NUA); | |
583 | // j) Calculate the final results for integrated flow (RP/POI) and store in AliFlowCommonHistResults; | |
584 | // k) Store results for differential flow in AliFlowCommonHistResults; | |
585 | // l) Print the final results for integrated flow (RP/POI) on the screen; | |
586 | // m) Cross-checking: Results from Q-vectors vs results from nested loops. | |
b3dacf6b | 587 | |
588 | // a) Check all pointers used in this method: | |
589 | this->CheckPointersUsedInFinish(); | |
590 | ||
591 | // b) Acces the constants: | |
1268c371 | 592 | this->CommonConstants("Finish"); |
489d5531 | 593 | |
b3dacf6b | 594 | if(fCommonHists && fCommonHists->GetHarmonic()) // to be improved (moved somewhere else) |
489d5531 | 595 | { |
b3dacf6b | 596 | fHarmonic = (Int_t)(fCommonHists->GetHarmonic())->GetBinContent(1); |
489d5531 | 597 | } |
b3dacf6b | 598 | |
1268c371 | 599 | // c) Access the flags: // to be improved (implement a method for this? should I store again the flags becose they can get modified with redoFinish?) |
b3dacf6b | 600 | fUsePhiWeights = (Bool_t)fUseParticleWeights->GetBinContent(1); |
601 | fUsePtWeights = (Bool_t)fUseParticleWeights->GetBinContent(2); | |
602 | fUseEtaWeights = (Bool_t)fUseParticleWeights->GetBinContent(3); | |
603 | fApplyCorrectionForNUA = (Bool_t)fIntFlowFlags->GetBinContent(3); | |
604 | fPrintFinalResults[0] = (Bool_t)fIntFlowFlags->GetBinContent(4); | |
605 | fPrintFinalResults[1] = (Bool_t)fIntFlowFlags->GetBinContent(5); | |
606 | fPrintFinalResults[2] = (Bool_t)fIntFlowFlags->GetBinContent(6); | |
607 | fPrintFinalResults[3] = (Bool_t)fIntFlowFlags->GetBinContent(7); | |
608 | fApplyCorrectionForNUAVsM = (Bool_t)fIntFlowFlags->GetBinContent(8); | |
b77b6434 | 609 | fPropagateErrorAlsoFromNIT = (Bool_t)fIntFlowFlags->GetBinContent(9); |
0dd3b008 | 610 | fCalculateCumulantsVsM = (Bool_t)fIntFlowFlags->GetBinContent(10); |
611 | fMinimumBiasReferenceFlow = (Bool_t)fIntFlowFlags->GetBinContent(11); | |
e5834fcb | 612 | fForgetAboutCovariances = (Bool_t)fIntFlowFlags->GetBinContent(12); |
613 | fStorePhiDistributionForOneEvent = (Bool_t)fIntFlowFlags->GetBinContent(13); | |
dd442cd2 | 614 | fFillMultipleControlHistograms = (Bool_t)fIntFlowFlags->GetBinContent(14); |
b3dacf6b | 615 | fEvaluateIntFlowNestedLoops = (Bool_t)fEvaluateNestedLoops->GetBinContent(1); |
616 | fEvaluateDiffFlowNestedLoops = (Bool_t)fEvaluateNestedLoops->GetBinContent(2); | |
489d5531 | 617 | fCrossCheckInPtBinNo = (Int_t)fEvaluateNestedLoops->GetBinContent(3); |
618 | fCrossCheckInEtaBinNo = (Int_t)fEvaluateNestedLoops->GetBinContent(4); | |
1268c371 | 619 | |
b92ea2b9 | 620 | // d) Calculate reference cumulants (not corrected for detector effects): |
489d5531 | 621 | this->FinalizeCorrelationsIntFlow(); |
622 | this->CalculateCovariancesIntFlow(); | |
623 | this->CalculateCumulantsIntFlow(); | |
489d5531 | 624 | |
b92ea2b9 | 625 | // e) Correct reference cumulants for detector effects: |
626 | this->FinalizeCorrectionTermsForNUAIntFlow(); | |
627 | this->CalculateCovariancesNUAIntFlow(); | |
628 | this->CalculateQcumulantsCorrectedForNUAIntFlow(); | |
629 | ||
630 | // f) Calculate reference flow: | |
631 | this->CalculateReferenceFlow(); | |
489d5531 | 632 | |
b77b6434 | 633 | // g) Store results for reference flow in AliFlowCommonHistResults and print them on the screen: |
489d5531 | 634 | this->FillCommonHistResultsIntFlow(); |
b3dacf6b | 635 | if(fPrintFinalResults[0]){this->PrintFinalResultsForIntegratedFlow("RF");} |
636 | if(fPrintFinalResults[3] && fCalculateCumulantsVsM){this->PrintFinalResultsForIntegratedFlow("RF, rebinned in M");} | |
489d5531 | 637 | |
1268c371 | 638 | // h) Calculate the final results for differential flow (without/with weights): |
639 | if(fCalculateDiffFlow) | |
640 | { | |
641 | this->FinalizeReducedCorrelations("RP","Pt"); | |
642 | this->FinalizeReducedCorrelations("RP","Eta"); | |
643 | this->FinalizeReducedCorrelations("POI","Pt"); | |
644 | this->FinalizeReducedCorrelations("POI","Eta"); | |
645 | this->CalculateDiffFlowCovariances("RP","Pt"); | |
646 | this->CalculateDiffFlowCovariances("RP","Eta"); | |
647 | this->CalculateDiffFlowCovariances("POI","Pt"); | |
648 | this->CalculateDiffFlowCovariances("POI","Eta"); | |
649 | this->CalculateDiffFlowCumulants("RP","Pt"); | |
650 | this->CalculateDiffFlowCumulants("RP","Eta"); | |
651 | this->CalculateDiffFlowCumulants("POI","Pt"); | |
652 | this->CalculateDiffFlowCumulants("POI","Eta"); | |
653 | this->CalculateDiffFlow("RP","Pt"); | |
654 | this->CalculateDiffFlow("RP","Eta"); | |
655 | this->CalculateDiffFlow("POI","Pt"); | |
656 | this->CalculateDiffFlow("POI","Eta"); | |
657 | } // if(fCalculateDiffFlow) | |
658 | ||
659 | // i) Correct the results for differential flow (without/with weights) for effects of non-uniform acceptance (NUA): | |
660 | if(fCalculateDiffFlow) | |
489d5531 | 661 | { |
662 | this->FinalizeCorrectionTermsForNUADiffFlow("RP","Pt"); | |
663 | this->FinalizeCorrectionTermsForNUADiffFlow("RP","Eta"); | |
664 | this->FinalizeCorrectionTermsForNUADiffFlow("POI","Pt"); | |
665 | this->FinalizeCorrectionTermsForNUADiffFlow("POI","Eta"); | |
666 | this->CalculateDiffFlowCumulantsCorrectedForNUA("RP","Pt"); | |
667 | this->CalculateDiffFlowCumulantsCorrectedForNUA("RP","Eta"); | |
668 | this->CalculateDiffFlowCumulantsCorrectedForNUA("POI","Pt"); | |
669 | this->CalculateDiffFlowCumulantsCorrectedForNUA("POI","Eta"); | |
1268c371 | 670 | if(fApplyCorrectionForNUA) |
671 | { | |
672 | this->CalculateDiffFlowCorrectedForNUA("RP","Pt"); | |
673 | this->CalculateDiffFlowCorrectedForNUA("RP","Eta"); | |
674 | this->CalculateDiffFlowCorrectedForNUA("POI","Pt"); | |
675 | this->CalculateDiffFlowCorrectedForNUA("POI","Eta"); | |
676 | } | |
677 | } // end of if(fCalculateDiffFlow && fApplyCorrectionForNUA) | |
678 | ||
679 | // i) Calcualate final results for 2D differential flow: | |
680 | if(fCalculate2DDiffFlow) | |
681 | { | |
682 | this->Calculate2DDiffFlowCumulants("RP"); | |
683 | this->Calculate2DDiffFlowCumulants("POI"); | |
684 | this->Calculate2DDiffFlow("RP"); | |
685 | this->Calculate2DDiffFlow("POI"); | |
686 | } // end of if(fCalculate2DDiffFlow) | |
687 | ||
688 | // j) Calculate the final results for integrated flow (RP/POI) and store in AliFlowCommonHistResults: | |
689 | if(fCalculateDiffFlow) | |
690 | { | |
691 | this->CalculateFinalResultsForRPandPOIIntegratedFlow("RP"); | |
692 | this->CalculateFinalResultsForRPandPOIIntegratedFlow("POI"); | |
3b552efe | 693 | } |
489d5531 | 694 | |
1268c371 | 695 | // k) Store results for differential flow in AliFlowCommonHistResults: |
696 | if(fCalculateDiffFlow) | |
697 | { | |
698 | this->FillCommonHistResultsDiffFlow("RP"); | |
699 | this->FillCommonHistResultsDiffFlow("POI"); | |
700 | } | |
701 | ||
702 | // l) Print the final results for integrated flow (RP/POI) on the screen: | |
703 | if(fPrintFinalResults[1] && fCalculateDiffFlow){this->PrintFinalResultsForIntegratedFlow("RP");} | |
704 | if(fPrintFinalResults[2] && fCalculateDiffFlow){this->PrintFinalResultsForIntegratedFlow("POI");} | |
705 | ||
706 | // m) Cross-checking: Results from Q-vectors vs results from nested loops: | |
707 | // m1) Reference flow: | |
489d5531 | 708 | if(fEvaluateIntFlowNestedLoops) |
709 | { | |
710 | this->CrossCheckIntFlowCorrelations(); | |
711 | this->CrossCheckIntFlowCorrectionTermsForNUA(); | |
1268c371 | 712 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights){this->CrossCheckIntFlowExtraCorrelations();} |
489d5531 | 713 | } // end of if(fEvaluateIntFlowNestedLoops) |
1268c371 | 714 | // m2) Differential flow: |
715 | if(fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) | |
489d5531 | 716 | { |
b3dacf6b | 717 | // Correlations: |
489d5531 | 718 | this->PrintNumberOfParticlesInSelectedBin(); |
719 | this->CrossCheckDiffFlowCorrelations("RP","Pt"); | |
720 | this->CrossCheckDiffFlowCorrelations("RP","Eta"); | |
721 | this->CrossCheckDiffFlowCorrelations("POI","Pt"); | |
722 | this->CrossCheckDiffFlowCorrelations("POI","Eta"); | |
b3dacf6b | 723 | // Correction terms for non-uniform acceptance: |
489d5531 | 724 | this->CrossCheckDiffFlowCorrectionTermsForNUA("RP","Pt"); |
725 | this->CrossCheckDiffFlowCorrectionTermsForNUA("RP","Eta"); | |
726 | this->CrossCheckDiffFlowCorrectionTermsForNUA("POI","Pt"); | |
727 | this->CrossCheckDiffFlowCorrectionTermsForNUA("POI","Eta"); | |
728 | } // end of if(fEvaluateDiffFlowNestedLoops) | |
729 | ||
730 | } // end of AliFlowAnalysisWithQCumulants::Finish() | |
731 | ||
489d5531 | 732 | //================================================================================================================================ |
733 | ||
1268c371 | 734 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowNestedLoops(AliFlowEventSimple* anEvent) |
735 | { | |
736 | // Evalauted all correlators for reference flow with nested loops. | |
737 | ||
738 | Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = nRP + nPOI | |
739 | if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 | |
740 | { | |
741 | // Without using particle weights: | |
742 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
743 | { | |
744 | // Correlations: | |
745 | this->CalculateIntFlowCorrelations(); // from Q-vectors | |
746 | this->EvaluateIntFlowCorrelationsWithNestedLoops(anEvent); // from nested loops (to be improved: do I have to pass here anEvent or not?) | |
747 | // Correction for non-uniform acceptance: | |
748 | this->CalculateIntFlowCorrectionsForNUASinTerms(); // from Q-vectors (sin terms) | |
749 | this->CalculateIntFlowCorrectionsForNUACosTerms(); // from Q-vectors (cos terms) | |
750 | this->EvaluateIntFlowCorrectionsForNUAWithNestedLoops(anEvent); // from nested loops (both sin and cos terms) | |
751 | } | |
752 | // Using particle weights: | |
753 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
754 | { | |
755 | // Correlations | |
756 | this->CalculateIntFlowCorrelationsUsingParticleWeights(); // from Q-vectors | |
757 | this->EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent); // from nested loops (to be improved: do I have to pass here anEvent or not?) | |
758 | // Correction for non-uniform acceptance: | |
759 | this->CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights(); // from Q-vectors (sin terms) | |
760 | this->CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights(); // from Q-vectors (cos terms) | |
761 | this->EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(anEvent); // from nested loops (both sin and cos terms) | |
762 | } | |
763 | } else if(nPrim>fMaxAllowedMultiplicity) // to if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) | |
764 | { | |
765 | cout<<endl; | |
766 | cout<<"Skipping the event because multiplicity is "<<nPrim<<". Too high to evaluate nested loops!"<<endl; | |
767 | } else | |
768 | { | |
769 | cout<<endl; | |
770 | cout<<"Skipping the event because multiplicity is "<<nPrim<<"."<<endl; | |
771 | } | |
772 | ||
773 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowNestedLoops(AliFlowEventSimple* anEvent) | |
774 | ||
775 | //================================================================================================================================ | |
776 | ||
777 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowNestedLoops(AliFlowEventSimple* anEvent) | |
778 | { | |
779 | // Evalauted all correlators for differential flow with nested loops. | |
780 | ||
781 | if(!fCalculateDiffFlow){return;} | |
782 | ||
783 | Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = nRP + nPOI | |
784 | if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 | |
785 | { | |
786 | // Without using particle weights: | |
787 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
788 | { | |
789 | // Reduced correlations: | |
790 | // Q-vectors: | |
791 | this->CalculateDiffFlowCorrelations("RP","Pt"); | |
792 | this->CalculateDiffFlowCorrelations("RP","Eta"); | |
793 | this->CalculateDiffFlowCorrelations("POI","Pt"); | |
794 | this->CalculateDiffFlowCorrelations("POI","Eta"); | |
795 | // Nested loops: | |
796 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"RP","Pt"); | |
797 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"RP","Eta"); | |
798 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"POI","Pt"); | |
799 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"POI","Eta"); | |
800 | // Reduced corrections for non-uniform acceptance: | |
801 | // Q-vectors: | |
802 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Pt"); | |
803 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Eta"); | |
804 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Pt"); | |
805 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Eta"); | |
806 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Pt"); | |
807 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Eta"); | |
808 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Pt"); | |
809 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Eta"); | |
810 | // Nested loops: | |
811 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"RP","Pt"); | |
812 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"RP","Eta"); | |
813 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"POI","Pt"); | |
814 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"POI","Eta"); | |
815 | } // end of if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
816 | // Using particle weights: | |
817 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
818 | { | |
819 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Pt"); | |
820 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Eta"); | |
821 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Pt"); | |
822 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Eta"); | |
823 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Pt"); | |
824 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Eta"); | |
825 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Pt"); | |
826 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Eta"); | |
827 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Pt"); | |
828 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Eta"); | |
829 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Pt"); | |
830 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Eta"); | |
831 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"RP","Pt"); | |
832 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"RP","Eta"); | |
833 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"POI","Pt"); | |
834 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"POI","Eta"); | |
835 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"RP","Pt"); | |
836 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"RP","Eta"); | |
837 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"POI","Pt"); | |
838 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"POI","Eta"); | |
839 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
840 | } // end of if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 | |
841 | ||
842 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowNestedLoops(AliFlowEventSimple* anEvent) | |
843 | ||
844 | //================================================================================================================================ | |
845 | ||
489d5531 | 846 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTerms() |
847 | { | |
b92ea2b9 | 848 | // Calculate correction terms for non-uniform acceptance of the detector for reference flow (cos terms). |
489d5531 | 849 | |
850 | // multiplicity: | |
1268c371 | 851 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 852 | |
853 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
854 | Double_t dReQ1n = (*fReQ)(0,0); | |
855 | Double_t dReQ2n = (*fReQ)(1,0); | |
856 | //Double_t dReQ3n = (*fReQ)(2,0); | |
857 | //Double_t dReQ4n = (*fReQ)(3,0); | |
858 | Double_t dImQ1n = (*fImQ)(0,0); | |
859 | Double_t dImQ2n = (*fImQ)(1,0); | |
860 | //Double_t dImQ3n = (*fImQ)(2,0); | |
861 | //Double_t dImQ4n = (*fImQ)(3,0); | |
862 | ||
863 | // ************************************************************* | |
864 | // **** corrections for non-uniform acceptance (cos terms): **** | |
865 | // ************************************************************* | |
866 | // | |
867 | // Remark 1: corrections for non-uniform acceptance (cos terms) calculated with non-weighted Q-vectors | |
868 | // are stored in 1D profile fQCorrectionsCos. | |
869 | // Remark 2: binning of fIntFlowCorrectionTermsForNUAPro[1] is organized as follows: | |
870 | // -------------------------------------------------------------------------------------------------------------------- | |
871 | // 1st bin: <<cos(n*(phi1))>> = cosP1n | |
872 | // 2nd bin: <<cos(n*(phi1+phi2))>> = cosP1nP1n | |
873 | // 3rd bin: <<cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1n | |
874 | // 4th bin: <<cos(n*(2phi1-phi2))>> = cosP2nM1n | |
875 | // -------------------------------------------------------------------------------------------------------------------- | |
876 | ||
877 | // 1-particle: | |
878 | Double_t cosP1n = 0.; // <<cos(n*(phi1))>> | |
879 | ||
880 | if(dMult>0) | |
881 | { | |
882 | cosP1n = dReQ1n/dMult; | |
883 | ||
884 | // average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for single event: | |
885 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(1,cosP1n); | |
0328db2d | 886 | // event weights for NUA terms: |
887 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(1,dMult); | |
489d5531 | 888 | |
889 | // final average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for all events: | |
890 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(0.5,cosP1n,dMult); | |
b3dacf6b | 891 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[1][0]->Fill(dMult+0.5,cosP1n,dMult);} |
489d5531 | 892 | } |
893 | ||
894 | // 2-particle: | |
3b552efe | 895 | Double_t cosP1nP1n = 0.; // <<cos(n*(phi1+phi2))>> |
489d5531 | 896 | Double_t cosP2nM1n = 0.; // <<cos(n*(2phi1-phi2))>> |
897 | ||
898 | if(dMult>1) | |
899 | { | |
900 | cosP1nP1n = (pow(dReQ1n,2)-pow(dImQ1n,2)-dReQ2n)/(dMult*(dMult-1)); | |
901 | cosP2nM1n = (dReQ2n*dReQ1n+dImQ2n*dImQ1n-dReQ1n)/(dMult*(dMult-1)); | |
902 | ||
903 | // average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for single event: | |
3b552efe | 904 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(2,cosP1nP1n); |
489d5531 | 905 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(4,cosP2nM1n); |
0328db2d | 906 | // event weights for NUA terms: |
907 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(2,dMult*(dMult-1)); | |
908 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(4,dMult*(dMult-1)); | |
909 | ||
489d5531 | 910 | // final average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for all events: |
3b552efe | 911 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(1.5,cosP1nP1n,dMult*(dMult-1)); |
489d5531 | 912 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(3.5,cosP2nM1n,dMult*(dMult-1)); |
b3dacf6b | 913 | if(fCalculateCumulantsVsM) |
914 | { | |
915 | fIntFlowCorrectionTermsForNUAVsMPro[1][1]->Fill(dMult+0.5,cosP1nP1n,dMult*(dMult-1)); | |
916 | fIntFlowCorrectionTermsForNUAVsMPro[1][3]->Fill(dMult+0.5,cosP2nM1n,dMult*(dMult-1)); | |
917 | } | |
489d5531 | 918 | } |
919 | ||
920 | // 3-particle: | |
921 | Double_t cosP1nM1nM1n = 0.; // <<cos(n*(phi1-phi2-phi3))>> | |
922 | ||
923 | if(dMult>2) | |
924 | { | |
925 | cosP1nM1nM1n = (dReQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))-dReQ1n*dReQ2n-dImQ1n*dImQ2n-2.*(dMult-1)*dReQ1n) | |
926 | / (dMult*(dMult-1)*(dMult-2)); | |
927 | ||
928 | // average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for single event: | |
929 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(3,cosP1nM1nM1n); | |
0328db2d | 930 | // event weights for NUA terms: |
931 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(3,dMult*(dMult-1)*(dMult-2)); | |
489d5531 | 932 | |
933 | // final average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for all events: | |
2001bc3a | 934 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(2.5,cosP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); |
b3dacf6b | 935 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[1][2]->Fill(dMult+0.5,cosP1nM1nM1n,dMult*(dMult-1)*(dMult-2));} |
489d5531 | 936 | } |
937 | ||
938 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTerms() | |
939 | ||
940 | ||
941 | //================================================================================================================================ | |
942 | ||
943 | ||
944 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTerms() | |
945 | { | |
946 | // calculate corrections for non-uniform acceptance of the detector for no-name integrated flow (sin terms) | |
947 | ||
948 | // multiplicity: | |
1268c371 | 949 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 950 | |
951 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
952 | Double_t dReQ1n = (*fReQ)(0,0); | |
953 | Double_t dReQ2n = (*fReQ)(1,0); | |
954 | //Double_t dReQ3n = (*fReQ)(2,0); | |
955 | //Double_t dReQ4n = (*fReQ)(3,0); | |
956 | Double_t dImQ1n = (*fImQ)(0,0); | |
957 | Double_t dImQ2n = (*fImQ)(1,0); | |
958 | //Double_t dImQ3n = (*fImQ)(2,0); | |
959 | //Double_t dImQ4n = (*fImQ)(3,0); | |
960 | ||
961 | // ************************************************************* | |
962 | // **** corrections for non-uniform acceptance (sin terms): **** | |
963 | // ************************************************************* | |
964 | // | |
965 | // Remark 1: corrections for non-uniform acceptance (sin terms) calculated with non-weighted Q-vectors | |
966 | // are stored in 1D profile fQCorrectionsSin. | |
967 | // Remark 2: binning of fIntFlowCorrectionTermsForNUAPro[0] is organized as follows: | |
968 | // -------------------------------------------------------------------------------------------------------------------- | |
969 | // 1st bin: <<sin(n*(phi1))>> = sinP1n | |
970 | // 2nd bin: <<sin(n*(phi1+phi2))>> = sinP1nP1n | |
971 | // 3rd bin: <<sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1n | |
972 | // 4th bin: <<sin(n*(2phi1-phi2))>> = sinP2nM1n | |
973 | // -------------------------------------------------------------------------------------------------------------------- | |
974 | ||
975 | // 1-particle: | |
976 | Double_t sinP1n = 0.; // <sin(n*(phi1))> | |
977 | ||
978 | if(dMult>0) | |
979 | { | |
980 | sinP1n = dImQ1n/dMult; | |
981 | ||
982 | // average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for single event: | |
0328db2d | 983 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(1,sinP1n); |
984 | // event weights for NUA terms: | |
985 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(1,dMult); | |
489d5531 | 986 | |
987 | // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
988 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(0.5,sinP1n,dMult); | |
b3dacf6b | 989 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[0][0]->Fill(dMult+0.5,sinP1n,dMult);} |
489d5531 | 990 | } |
991 | ||
992 | // 2-particle: | |
993 | Double_t sinP1nP1n = 0.; // <<sin(n*(phi1+phi2))>> | |
994 | Double_t sinP2nM1n = 0.; // <<sin(n*(2phi1-phi2))>> | |
995 | if(dMult>1) | |
996 | { | |
3b552efe | 997 | sinP1nP1n = (2.*dReQ1n*dImQ1n-dImQ2n)/(dMult*(dMult-1)); |
489d5531 | 998 | sinP2nM1n = (dImQ2n*dReQ1n-dReQ2n*dImQ1n-dImQ1n)/(dMult*(dMult-1)); |
999 | ||
1000 | // average non-weighted 2-particle correction (sin terms) for non-uniform acceptance for single event: | |
1001 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(2,sinP1nP1n); | |
3b552efe | 1002 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(4,sinP2nM1n); |
0328db2d | 1003 | // event weights for NUA terms: |
1004 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(2,dMult*(dMult-1)); | |
1005 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(4,dMult*(dMult-1)); | |
489d5531 | 1006 | |
1007 | // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
1008 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(1.5,sinP1nP1n,dMult*(dMult-1)); | |
1009 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(3.5,sinP2nM1n,dMult*(dMult-1)); | |
b3dacf6b | 1010 | if(fCalculateCumulantsVsM) |
1011 | { | |
1012 | fIntFlowCorrectionTermsForNUAVsMPro[0][1]->Fill(dMult+0.5,sinP1nP1n,dMult*(dMult-1)); | |
1013 | fIntFlowCorrectionTermsForNUAVsMPro[0][3]->Fill(dMult+0.5,sinP2nM1n,dMult*(dMult-1)); | |
1014 | } | |
489d5531 | 1015 | } |
1016 | ||
1017 | // 3-particle: | |
1018 | Double_t sinP1nM1nM1n = 0.; // <<sin(n*(phi1-phi2-phi3))>> | |
1019 | ||
1020 | if(dMult>2) | |
1021 | { | |
1022 | sinP1nM1nM1n = (-dImQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))+dReQ1n*dImQ2n-dImQ1n*dReQ2n+2.*(dMult-1)*dImQ1n) | |
1023 | / (dMult*(dMult-1)*(dMult-2)); | |
1024 | ||
1025 | // average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for single event: | |
1026 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(3,sinP1nM1nM1n); | |
0328db2d | 1027 | // event weights for NUA terms: |
1028 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(3,dMult*(dMult-1)*(dMult-2)); | |
489d5531 | 1029 | |
1030 | // final average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for all events: | |
2001bc3a | 1031 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(2.5,sinP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); |
b3dacf6b | 1032 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[0][2]->Fill(dMult+0.5,sinP1nM1nM1n,dMult*(dMult-1)*(dMult-2));} |
489d5531 | 1033 | } |
1034 | ||
1035 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTerms() | |
1036 | ||
489d5531 | 1037 | //================================================================================================================================ |
1038 | ||
489d5531 | 1039 | void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos) |
1040 | { | |
1268c371 | 1041 | // a) Get pointers for common control and common result histograms; |
1042 | // b) Get pointers for histograms holding particle weights; | |
1043 | // c) Get pointers for reference flow histograms; | |
1044 | // d) Get pointers for differential flow histograms; | |
1045 | // e) Get pointers for 2D differential flow histograms; | |
1046 | // f) Get pointers for nested loops' histograms. | |
489d5531 | 1047 | |
1048 | if(outputListHistos) | |
3b552efe | 1049 | { |
1050 | this->SetHistList(outputListHistos); | |
1051 | if(!fHistList) | |
1052 | { | |
1268c371 | 1053 | printf("\n WARNING (QC): fHistList is NULL in AFAWQC::GOH() !!!!\n\n"); |
3b552efe | 1054 | exit(0); |
489d5531 | 1055 | } |
1056 | this->GetPointersForCommonHistograms(); | |
1057 | this->GetPointersForParticleWeightsHistograms(); | |
1058 | this->GetPointersForIntFlowHistograms(); | |
1059 | this->GetPointersForDiffFlowHistograms(); | |
1268c371 | 1060 | this->GetPointersFor2DDiffFlowHistograms(); |
489d5531 | 1061 | this->GetPointersForNestedLoopsHistograms(); |
3b552efe | 1062 | } else |
1063 | { | |
1268c371 | 1064 | printf("\n WARNING (QC): outputListHistos is NULL in AFAWQC::GOH() !!!!\n\n"); |
3b552efe | 1065 | exit(0); |
489d5531 | 1066 | } |
1067 | ||
1068 | } // end of void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos) | |
ad87ae62 | 1069 | |
489d5531 | 1070 | //================================================================================================================================ |
1071 | ||
489d5531 | 1072 | TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) const |
ad87ae62 | 1073 | { |
489d5531 | 1074 | // project 2D profile onto pt axis to get 1D profile |
1075 | ||
1076 | Int_t nBinsPt = profilePtEta->GetNbinsX(); | |
1077 | Double_t dPtMin = (profilePtEta->GetXaxis())->GetXmin(); | |
1078 | Double_t dPtMax = (profilePtEta->GetXaxis())->GetXmax(); | |
1079 | ||
1080 | Int_t nBinsEta = profilePtEta->GetNbinsY(); | |
1081 | ||
1082 | TProfile *profilePt = new TProfile("","",nBinsPt,dPtMin,dPtMax); | |
1083 | ||
1084 | for(Int_t p=1;p<=nBinsPt;p++) | |
1085 | { | |
1086 | Double_t contentPt = 0.; | |
1087 | Double_t entryPt = 0.; | |
1088 | Double_t spreadPt = 0.; | |
1089 | Double_t sum1 = 0.; | |
1090 | Double_t sum2 = 0.; | |
1091 | Double_t sum3 = 0.; | |
1092 | for(Int_t e=1;e<=nBinsEta;e++) | |
1093 | { | |
1094 | contentPt += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))) | |
1095 | * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1096 | entryPt += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1097 | ||
1098 | sum1 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))) | |
1099 | * (pow(profilePtEta->GetBinError(profilePtEta->GetBin(p,e)),2.) | |
1100 | + pow(profilePtEta->GetBinContent(profilePtEta->GetBin(p,e)),2.)); | |
1101 | sum2 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1102 | sum3 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))) | |
1103 | * (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))); | |
1104 | } | |
1105 | if(sum2>0. && sum1/sum2-pow(sum3/sum2,2.) > 0.) | |
1106 | { | |
1107 | spreadPt = pow(sum1/sum2-pow(sum3/sum2,2.),0.5); | |
1108 | } | |
1109 | profilePt->SetBinContent(p,contentPt); | |
1110 | profilePt->SetBinEntries(p,entryPt); | |
1111 | { | |
1112 | profilePt->SetBinError(p,spreadPt); | |
1113 | } | |
1114 | ||
1115 | } | |
1116 | ||
1117 | return profilePt; | |
1118 | ||
1119 | } // end of TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) | |
1120 | ||
1121 | ||
1122 | //================================================================================================================================ | |
1123 | ||
1124 | ||
1125 | TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) const | |
1126 | { | |
1127 | // project 2D profile onto eta axis to get 1D profile | |
1128 | ||
1129 | Int_t nBinsEta = profilePtEta->GetNbinsY(); | |
1130 | Double_t dEtaMin = (profilePtEta->GetYaxis())->GetXmin(); | |
1131 | Double_t dEtaMax = (profilePtEta->GetYaxis())->GetXmax(); | |
1132 | ||
1133 | Int_t nBinsPt = profilePtEta->GetNbinsX(); | |
1134 | ||
1135 | TProfile *profileEta = new TProfile("","",nBinsEta,dEtaMin,dEtaMax); | |
1136 | ||
1137 | for(Int_t e=1;e<=nBinsEta;e++) | |
1138 | { | |
1139 | Double_t contentEta = 0.; | |
1140 | Double_t entryEta = 0.; | |
1141 | for(Int_t p=1;p<=nBinsPt;p++) | |
1142 | { | |
1143 | contentEta += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))) | |
1144 | * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1145 | entryEta += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1146 | } | |
1147 | profileEta->SetBinContent(e,contentEta); | |
1148 | profileEta->SetBinEntries(e,entryEta); | |
1149 | } | |
1150 | ||
1151 | return profileEta; | |
1152 | ||
1153 | } // end of TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) | |
1154 | ||
489d5531 | 1155 | //================================================================================================================================ |
1156 | ||
489d5531 | 1157 | void AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type) |
1158 | { | |
2001bc3a | 1159 | // Printing on the screen the final results for integrated flow (RF, POI and RP). |
489d5531 | 1160 | |
1161 | Int_t n = fHarmonic; | |
1162 | ||
489d5531 | 1163 | Double_t dVn[4] = {0.}; // array to hold Vn{2}, Vn{4}, Vn{6} and Vn{8} |
1164 | Double_t dVnErr[4] = {0.}; // array to hold errors of Vn{2}, Vn{4}, Vn{6} and Vn{8} | |
1165 | ||
2001bc3a | 1166 | if(type == "RF") |
489d5531 | 1167 | { |
0dd3b008 | 1168 | for(Int_t b=0;b<4;b++) |
1169 | { | |
b77b6434 | 1170 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlow())->GetBinContent(1); |
1171 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlow())->GetBinError(1); | |
1172 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlow())->GetBinContent(1); | |
1173 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlow())->GetBinError(1); | |
1174 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlow())->GetBinContent(1); | |
1175 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlow())->GetBinError(1); | |
1176 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlow())->GetBinContent(1); | |
1177 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlow())->GetBinError(1); | |
0dd3b008 | 1178 | } |
489d5531 | 1179 | } else if(type == "RP") |
1180 | { | |
1181 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinContent(1); | |
1182 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinError(1); | |
1183 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinContent(1); | |
1184 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinError(1); | |
1185 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinContent(1); | |
1186 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinError(1); | |
1187 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinContent(1); | |
1188 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinError(1); | |
1189 | } else if(type == "POI") | |
1190 | { | |
1191 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinContent(1); | |
1192 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinError(1); | |
1193 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinContent(1); | |
1194 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinError(1); | |
1195 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinContent(1); | |
1196 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinError(1); | |
1197 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinContent(1); | |
1198 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinError(1); | |
b77b6434 | 1199 | } else if(type == "RF, rebinned in M" && fCalculateCumulantsVsM) |
b3dacf6b | 1200 | { |
0dd3b008 | 1201 | for(Int_t b=0;b<4;b++) |
1202 | { | |
1203 | dVn[b] = fIntFlowRebinnedInM->GetBinContent(b+1); | |
1204 | dVnErr[b] = fIntFlowRebinnedInM->GetBinError(b+1); | |
1205 | } | |
b3dacf6b | 1206 | } |
489d5531 | 1207 | |
1208 | TString title = " flow estimates from Q-cumulants"; | |
1209 | TString subtitle = " ("; | |
b3dacf6b | 1210 | TString subtitle2 = " (rebinned in M)"; |
489d5531 | 1211 | |
b3dacf6b | 1212 | if(type != "RF, rebinned in M") |
489d5531 | 1213 | { |
b3dacf6b | 1214 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) |
1215 | { | |
1216 | subtitle.Append(type); | |
1217 | subtitle.Append(", without weights)"); | |
1218 | } else | |
1219 | { | |
1220 | subtitle.Append(type); | |
1221 | subtitle.Append(", with weights)"); | |
1222 | } | |
1223 | } else | |
489d5531 | 1224 | { |
b3dacf6b | 1225 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) |
1226 | { | |
1227 | subtitle.Append("RF"); | |
1228 | subtitle.Append(", without weights)"); | |
1229 | } else | |
1230 | { | |
1231 | subtitle.Append("RF"); | |
1232 | subtitle.Append(", with weights)"); | |
1233 | } | |
1234 | } | |
1235 | ||
489d5531 | 1236 | cout<<endl; |
1237 | cout<<"*************************************"<<endl; | |
1238 | cout<<"*************************************"<<endl; | |
1239 | cout<<title.Data()<<endl; | |
1240 | cout<<subtitle.Data()<<endl; | |
b3dacf6b | 1241 | if(type == "RF, rebinned in M"){cout<<subtitle2.Data()<<endl;} |
489d5531 | 1242 | cout<<endl; |
1243 | ||
1244 | for(Int_t i=0;i<4;i++) | |
1245 | { | |
2001bc3a | 1246 | cout<<" v_"<<n<<"{"<<2*(i+1)<<"} = "<<dVn[i]<<" +/- "<<dVnErr[i]<<endl; |
489d5531 | 1247 | } |
2001bc3a | 1248 | |
489d5531 | 1249 | cout<<endl; |
b92ea2b9 | 1250 | if(type == "RF") |
1251 | { | |
b77b6434 | 1252 | if(fApplyCorrectionForNUA) |
1253 | { | |
1254 | cout<<" detector bias (corrected for): "<<endl; | |
1255 | } else | |
1256 | { | |
1257 | cout<<" detector bias (not corrected for):"<<endl; | |
1258 | } | |
b92ea2b9 | 1259 | cout<<" to QC{2}: "<<fIntFlowDetectorBias->GetBinContent(1)<<" +/- "<<fIntFlowDetectorBias->GetBinError(1)<<endl; |
1260 | cout<<" to QC{4}: "<<fIntFlowDetectorBias->GetBinContent(2)<<" +/- "<<fIntFlowDetectorBias->GetBinError(2)<<endl; | |
1261 | cout<<endl; | |
1262 | } | |
b3dacf6b | 1263 | if(type == "RF" || type == "RF, rebinned in M") |
489d5531 | 1264 | { |
2001bc3a | 1265 | cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultRP()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultRP()->GetMean()<<endl; |
489d5531 | 1266 | } |
1267 | else if (type == "RP") | |
1268 | { | |
2001bc3a | 1269 | cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultRP()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultRP()->GetMean()<<endl; |
489d5531 | 1270 | } |
1271 | else if (type == "POI") | |
1272 | { | |
2001bc3a | 1273 | cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultPOI()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultPOI()->GetMean()<<endl; |
1274 | } | |
1275 | ||
489d5531 | 1276 | cout<<"*************************************"<<endl; |
1277 | cout<<"*************************************"<<endl; | |
1278 | cout<<endl; | |
1279 | ||
2001bc3a | 1280 | }// end of AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type="RF"); |
489d5531 | 1281 | |
1282 | //================================================================================================================================ | |
1283 | ||
489d5531 | 1284 | void AliFlowAnalysisWithQCumulants::WriteHistograms(TString outputFileName) |
1285 | { | |
1286 | //store the final results in output .root file | |
1287 | TFile *output = new TFile(outputFileName.Data(),"RECREATE"); | |
1288 | //output->WriteObject(fHistList, "cobjQC","SingleKey"); | |
1289 | fHistList->Write(fHistList->GetName(), TObject::kSingleKey); | |
1290 | delete output; | |
1291 | } | |
1292 | ||
1293 | ||
1294 | //================================================================================================================================ | |
1295 | ||
1296 | ||
1297 | void AliFlowAnalysisWithQCumulants::WriteHistograms(TDirectoryFile *outputFileName) | |
1298 | { | |
1299 | //store the final results in output .root file | |
1300 | fHistList->SetName("cobjQC"); | |
1301 | fHistList->SetOwner(kTRUE); | |
1302 | outputFileName->Add(fHistList); | |
1303 | outputFileName->Write(outputFileName->GetName(), TObject::kSingleKey); | |
1304 | } | |
1305 | ||
489d5531 | 1306 | //================================================================================================================================ |
1307 | ||
489d5531 | 1308 | void AliFlowAnalysisWithQCumulants::BookCommonHistograms() |
1309 | { | |
1310 | // Book common control histograms and common histograms for final results. | |
1268c371 | 1311 | // a) Book common control histograms; |
1312 | // b) Book common result histograms. | |
1313 | ||
1314 | // a) Book common control histograms: | |
1315 | // Common control histograms (all events): | |
489d5531 | 1316 | TString commonHistsName = "AliFlowCommonHistQC"; |
1317 | commonHistsName += fAnalysisLabel->Data(); | |
1318 | fCommonHists = new AliFlowCommonHist(commonHistsName.Data()); | |
1319 | fHistList->Add(fCommonHists); | |
1268c371 | 1320 | // Common control histograms (selected events): |
dd442cd2 | 1321 | if(fFillMultipleControlHistograms) |
1322 | { | |
1268c371 | 1323 | // Common control histogram filled for events with 2 and more reference particles: |
dd442cd2 | 1324 | TString commonHists2ndOrderName = "AliFlowCommonHist2ndOrderQC"; |
1325 | commonHists2ndOrderName += fAnalysisLabel->Data(); | |
1326 | fCommonHists2nd = new AliFlowCommonHist(commonHists2ndOrderName.Data()); | |
1327 | fHistList->Add(fCommonHists2nd); | |
1268c371 | 1328 | // Common control histogram filled for events with 2 and more reference particles: |
dd442cd2 | 1329 | TString commonHists4thOrderName = "AliFlowCommonHist4thOrderQC"; |
1330 | commonHists4thOrderName += fAnalysisLabel->Data(); | |
1331 | fCommonHists4th = new AliFlowCommonHist(commonHists4thOrderName.Data()); | |
1332 | fHistList->Add(fCommonHists4th); | |
1268c371 | 1333 | // Common control histogram filled for events with 6 and more reference particles: |
dd442cd2 | 1334 | TString commonHists6thOrderName = "AliFlowCommonHist6thOrderQC"; |
1335 | commonHists6thOrderName += fAnalysisLabel->Data(); | |
1336 | fCommonHists6th = new AliFlowCommonHist(commonHists6thOrderName.Data()); | |
1337 | fHistList->Add(fCommonHists6th); | |
1268c371 | 1338 | // Common control histogram filled for events with 8 and more reference particles: |
dd442cd2 | 1339 | TString commonHists8thOrderName = "AliFlowCommonHist8thOrderQC"; |
1340 | commonHists8thOrderName += fAnalysisLabel->Data(); | |
1341 | fCommonHists8th = new AliFlowCommonHist(commonHists8thOrderName.Data()); | |
1342 | fHistList->Add(fCommonHists8th); | |
1343 | } // end of if(fFillMultipleControlHistograms) | |
1344 | ||
1268c371 | 1345 | // b) Book common result histograms: |
1346 | // Common result histograms for QC{2}: | |
489d5531 | 1347 | TString commonHistResults2ndOrderName = "AliFlowCommonHistResults2ndOrderQC"; |
1348 | commonHistResults2ndOrderName += fAnalysisLabel->Data(); | |
1349 | fCommonHistsResults2nd = new AliFlowCommonHistResults(commonHistResults2ndOrderName.Data()); | |
1350 | fHistList->Add(fCommonHistsResults2nd); | |
1268c371 | 1351 | // Common result histograms for QC{4}: |
489d5531 | 1352 | TString commonHistResults4thOrderName = "AliFlowCommonHistResults4thOrderQC"; |
1353 | commonHistResults4thOrderName += fAnalysisLabel->Data(); | |
1354 | fCommonHistsResults4th = new AliFlowCommonHistResults(commonHistResults4thOrderName.Data()); | |
1355 | fHistList->Add(fCommonHistsResults4th); | |
1268c371 | 1356 | // Common result histograms for QC{6}: |
489d5531 | 1357 | TString commonHistResults6thOrderName = "AliFlowCommonHistResults6thOrderQC"; |
1358 | commonHistResults6thOrderName += fAnalysisLabel->Data(); | |
1359 | fCommonHistsResults6th = new AliFlowCommonHistResults(commonHistResults6thOrderName.Data()); | |
1360 | fHistList->Add(fCommonHistsResults6th); | |
1268c371 | 1361 | // Common result histograms for QC{8}: |
489d5531 | 1362 | TString commonHistResults8thOrderName = "AliFlowCommonHistResults8thOrderQC"; |
1363 | commonHistResults8thOrderName += fAnalysisLabel->Data(); | |
1364 | fCommonHistsResults8th = new AliFlowCommonHistResults(commonHistResults8thOrderName.Data()); | |
1365 | fHistList->Add(fCommonHistsResults8th); | |
1366 | ||
1367 | } // end of void AliFlowAnalysisWithQCumulants::BookCommonHistograms() | |
1368 | ||
489d5531 | 1369 | //================================================================================================================================ |
1370 | ||
489d5531 | 1371 | void AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms() |
1372 | { | |
1268c371 | 1373 | // Book and fill histograms which hold phi, pt and eta weights. |
489d5531 | 1374 | |
1375 | if(!fWeightsList) | |
1376 | { | |
1268c371 | 1377 | printf("\n WARNING (QC): fWeightsList is NULL in AFAWQC::BAFWH() !!!! \n\n"); |
489d5531 | 1378 | exit(0); |
1379 | } | |
1380 | ||
1381 | TString fUseParticleWeightsName = "fUseParticleWeightsQC"; | |
1382 | fUseParticleWeightsName += fAnalysisLabel->Data(); | |
1383 | fUseParticleWeights = new TProfile(fUseParticleWeightsName.Data(),"0 = particle weight not used, 1 = particle weight used ",3,0,3); | |
1384 | fUseParticleWeights->SetLabelSize(0.06); | |
1385 | (fUseParticleWeights->GetXaxis())->SetBinLabel(1,"w_{#phi}"); | |
1386 | (fUseParticleWeights->GetXaxis())->SetBinLabel(2,"w_{p_{T}}"); | |
1387 | (fUseParticleWeights->GetXaxis())->SetBinLabel(3,"w_{#eta}"); | |
1388 | fUseParticleWeights->Fill(0.5,(Int_t)fUsePhiWeights); | |
1389 | fUseParticleWeights->Fill(1.5,(Int_t)fUsePtWeights); | |
1390 | fUseParticleWeights->Fill(2.5,(Int_t)fUseEtaWeights); | |
1391 | fWeightsList->Add(fUseParticleWeights); | |
1392 | ||
1393 | if(fUsePhiWeights) | |
1394 | { | |
1395 | if(fWeightsList->FindObject("phi_weights")) | |
1396 | { | |
1397 | fPhiWeights = dynamic_cast<TH1F*>(fWeightsList->FindObject("phi_weights")); | |
1268c371 | 1398 | if(!fPhiWeights) |
1399 | { | |
1400 | printf("\n WARNING (QC): fPhiWeights is NULL in AFAWQC::BAFWH() !!!!\n\n"); | |
1401 | exit(0); | |
1402 | } | |
489d5531 | 1403 | if(TMath::Abs(fPhiWeights->GetBinWidth(1)-fPhiBinWidth)>pow(10.,-6.)) |
1404 | { | |
1405 | cout<<endl; | |
1406 | cout<<"WARNING (QC): Inconsistent binning in histograms for phi-weights throughout the code."<<endl; | |
1407 | cout<<endl; | |
6fbbbbf1 | 1408 | //exit(0); |
489d5531 | 1409 | } |
1410 | } else | |
1411 | { | |
1412 | cout<<"WARNING: fWeightsList->FindObject(\"phi_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1413 | exit(0); | |
1414 | } | |
1415 | } // end of if(fUsePhiWeights) | |
1416 | ||
1417 | if(fUsePtWeights) | |
1418 | { | |
1419 | if(fWeightsList->FindObject("pt_weights")) | |
1420 | { | |
1421 | fPtWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("pt_weights")); | |
1268c371 | 1422 | if(!fPtWeights) |
1423 | { | |
1424 | printf("\n WARNING (QC): fPtWeights is NULL in AFAWQC::BAFWH() !!!!\n\n"); | |
1425 | exit(0); | |
1426 | } | |
489d5531 | 1427 | if(TMath::Abs(fPtWeights->GetBinWidth(1)-fPtBinWidth)>pow(10.,-6.)) |
1428 | { | |
1429 | cout<<endl; | |
1430 | cout<<"WARNING (QC): Inconsistent binning in histograms for pt-weights throughout the code."<<endl; | |
1431 | cout<<endl; | |
6fbbbbf1 | 1432 | //exit(0); |
489d5531 | 1433 | } |
1434 | } else | |
1435 | { | |
1436 | cout<<"WARNING: fWeightsList->FindObject(\"pt_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1437 | exit(0); | |
1438 | } | |
1439 | } // end of if(fUsePtWeights) | |
1440 | ||
1441 | if(fUseEtaWeights) | |
1442 | { | |
1443 | if(fWeightsList->FindObject("eta_weights")) | |
1444 | { | |
1445 | fEtaWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("eta_weights")); | |
1268c371 | 1446 | if(!fEtaWeights) |
1447 | { | |
1448 | printf("\n WARNING (QC): fEtaWeights is NULL in AFAWQC::BAFWH() !!!!\n\n"); | |
1449 | exit(0); | |
1450 | } | |
489d5531 | 1451 | if(TMath::Abs(fEtaWeights->GetBinWidth(1)-fEtaBinWidth)>pow(10.,-6.)) |
1452 | { | |
1453 | cout<<endl; | |
1454 | cout<<"WARNING (QC): Inconsistent binning in histograms for eta-weights throughout the code."<<endl; | |
1455 | cout<<endl; | |
6fbbbbf1 | 1456 | //exit(0); |
489d5531 | 1457 | } |
1458 | } else | |
1459 | { | |
1460 | cout<<"WARNING: fUseEtaWeights && fWeightsList->FindObject(\"eta_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1461 | exit(0); | |
1462 | } | |
1463 | } // end of if(fUseEtaWeights) | |
1464 | ||
1465 | } // end of AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms() | |
1466 | ||
489d5531 | 1467 | //================================================================================================================================ |
1468 | ||
489d5531 | 1469 | void AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow() |
1470 | { | |
1471 | // Book all objects for integrated flow: | |
e5834fcb | 1472 | // a) Book profile to hold all flags for integrated flow; |
1473 | // b) Book event-by-event quantities; | |
1474 | // c) Book profiles; // to be improved (comment) | |
489d5531 | 1475 | // d) Book histograms holding the final results. |
1476 | ||
1477 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?) | |
1478 | TString powerFlag[2] = {"linear","quadratic"}; // to be improved (should I promote this to data members?) | |
1479 | ||
1480 | // a) Book profile to hold all flags for integrated flow: | |
1481 | TString intFlowFlagsName = "fIntFlowFlags"; | |
1482 | intFlowFlagsName += fAnalysisLabel->Data(); | |
dd442cd2 | 1483 | fIntFlowFlags = new TProfile(intFlowFlagsName.Data(),"Flags for Integrated Flow",14,0,14); |
489d5531 | 1484 | fIntFlowFlags->SetTickLength(-0.01,"Y"); |
1485 | fIntFlowFlags->SetMarkerStyle(25); | |
1486 | fIntFlowFlags->SetLabelSize(0.05); | |
1487 | fIntFlowFlags->SetLabelOffset(0.02,"Y"); | |
1488 | fIntFlowFlags->GetXaxis()->SetBinLabel(1,"Particle Weights"); | |
1489 | fIntFlowFlags->GetXaxis()->SetBinLabel(2,"Event Weights"); | |
1490 | fIntFlowFlags->GetXaxis()->SetBinLabel(3,"Corrected for NUA?"); | |
b3dacf6b | 1491 | fIntFlowFlags->GetXaxis()->SetBinLabel(4,"Print RF results"); |
489d5531 | 1492 | fIntFlowFlags->GetXaxis()->SetBinLabel(5,"Print RP results"); |
3b552efe | 1493 | fIntFlowFlags->GetXaxis()->SetBinLabel(6,"Print POI results"); |
b3dacf6b | 1494 | fIntFlowFlags->GetXaxis()->SetBinLabel(7,"Print RF (rebinned in M) results"); |
1495 | fIntFlowFlags->GetXaxis()->SetBinLabel(8,"Corrected for NUA vs M?"); | |
1496 | fIntFlowFlags->GetXaxis()->SetBinLabel(9,"Propagate errors to v_{n} from correlations?"); | |
1497 | fIntFlowFlags->GetXaxis()->SetBinLabel(10,"Calculate cumulants vs M"); | |
0dd3b008 | 1498 | fIntFlowFlags->GetXaxis()->SetBinLabel(11,"fMinimumBiasReferenceFlow"); |
8e1cefdd | 1499 | fIntFlowFlags->GetXaxis()->SetBinLabel(12,"fForgetAboutCovariances"); |
e5834fcb | 1500 | fIntFlowFlags->GetXaxis()->SetBinLabel(13,"fStorePhiDistributionForOneEvent"); |
dd442cd2 | 1501 | fIntFlowFlags->GetXaxis()->SetBinLabel(14,"fFillMultipleControlHistograms"); |
489d5531 | 1502 | fIntFlowList->Add(fIntFlowFlags); |
1503 | ||
1504 | // b) Book event-by-event quantities: | |
1505 | // Re[Q_{m*n,k}], Im[Q_{m*n,k}] and S_{p,k}^M: | |
8ed4edc7 | 1506 | fReQ = new TMatrixD(6,9); |
1507 | fImQ = new TMatrixD(6,9); | |
1268c371 | 1508 | fSpk = new TMatrixD(8,9); |
489d5531 | 1509 | // average correlations <2>, <4>, <6> and <8> for single event (bining is the same as in fIntFlowCorrelationsPro and fIntFlowCorrelationsHist): |
1510 | TString intFlowCorrelationsEBEName = "fIntFlowCorrelationsEBE"; | |
1511 | intFlowCorrelationsEBEName += fAnalysisLabel->Data(); | |
1512 | fIntFlowCorrelationsEBE = new TH1D(intFlowCorrelationsEBEName.Data(),intFlowCorrelationsEBEName.Data(),4,0,4); | |
1513 | // weights for average correlations <2>, <4>, <6> and <8> for single event: | |
1514 | TString intFlowEventWeightsForCorrelationsEBEName = "fIntFlowEventWeightsForCorrelationsEBE"; | |
1515 | intFlowEventWeightsForCorrelationsEBEName += fAnalysisLabel->Data(); | |
1516 | fIntFlowEventWeightsForCorrelationsEBE = new TH1D(intFlowEventWeightsForCorrelationsEBEName.Data(),intFlowEventWeightsForCorrelationsEBEName.Data(),4,0,4); | |
1517 | // average all correlations for single event (bining is the same as in fIntFlowCorrelationsAllPro and fIntFlowCorrelationsAllHist): | |
1518 | TString intFlowCorrelationsAllEBEName = "fIntFlowCorrelationsAllEBE"; | |
1519 | intFlowCorrelationsAllEBEName += fAnalysisLabel->Data(); | |
8ed4edc7 | 1520 | fIntFlowCorrelationsAllEBE = new TH1D(intFlowCorrelationsAllEBEName.Data(),intFlowCorrelationsAllEBEName.Data(),34,0,34); |
489d5531 | 1521 | // average correction terms for non-uniform acceptance for single event |
1522 | // (binning is the same as in fIntFlowCorrectionTermsForNUAPro[2] and fIntFlowCorrectionTermsForNUAHist[2]): | |
1523 | TString fIntFlowCorrectionTermsForNUAEBEName = "fIntFlowCorrectionTermsForNUAEBE"; | |
1524 | fIntFlowCorrectionTermsForNUAEBEName += fAnalysisLabel->Data(); | |
1525 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
1526 | { | |
b92ea2b9 | 1527 | fIntFlowCorrectionTermsForNUAEBE[sc] = new TH1D(Form("%s: %s terms",fIntFlowCorrectionTermsForNUAEBEName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4); |
489d5531 | 1528 | } |
0328db2d | 1529 | // event weights for terms for non-uniform acceptance: |
1530 | TString fIntFlowEventWeightForCorrectionTermsForNUAEBEName = "fIntFlowEventWeightForCorrectionTermsForNUAEBE"; | |
1531 | fIntFlowEventWeightForCorrectionTermsForNUAEBEName += fAnalysisLabel->Data(); | |
1532 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
1533 | { | |
b92ea2b9 | 1534 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc] = new TH1D(Form("%s: %s terms",fIntFlowEventWeightForCorrectionTermsForNUAEBEName.Data(),sinCosFlag[sc].Data()),Form("Event weights for terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4); // to be improved - 4 |
0328db2d | 1535 | } |
489d5531 | 1536 | // c) Book profiles: // to be improved (comment) |
1537 | // profile to hold average multiplicities and number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8: | |
1538 | TString avMultiplicityName = "fAvMultiplicity"; | |
1539 | avMultiplicityName += fAnalysisLabel->Data(); | |
1540 | fAvMultiplicity = new TProfile(avMultiplicityName.Data(),"Average Multiplicities of RPs",9,0,9); | |
1541 | fAvMultiplicity->SetTickLength(-0.01,"Y"); | |
1542 | fAvMultiplicity->SetMarkerStyle(25); | |
1543 | fAvMultiplicity->SetLabelSize(0.05); | |
1544 | fAvMultiplicity->SetLabelOffset(0.02,"Y"); | |
1545 | fAvMultiplicity->SetYTitle("Average Multiplicity"); | |
1546 | (fAvMultiplicity->GetXaxis())->SetBinLabel(1,"all evts"); | |
1547 | (fAvMultiplicity->GetXaxis())->SetBinLabel(2,"n_{RP} #geq 1"); | |
1548 | (fAvMultiplicity->GetXaxis())->SetBinLabel(3,"n_{RP} #geq 2"); | |
1549 | (fAvMultiplicity->GetXaxis())->SetBinLabel(4,"n_{RP} #geq 3"); | |
1550 | (fAvMultiplicity->GetXaxis())->SetBinLabel(5,"n_{RP} #geq 4"); | |
1551 | (fAvMultiplicity->GetXaxis())->SetBinLabel(6,"n_{RP} #geq 5"); | |
1552 | (fAvMultiplicity->GetXaxis())->SetBinLabel(7,"n_{RP} #geq 6"); | |
1553 | (fAvMultiplicity->GetXaxis())->SetBinLabel(8,"n_{RP} #geq 7"); | |
1554 | (fAvMultiplicity->GetXaxis())->SetBinLabel(9,"n_{RP} #geq 8"); | |
1555 | fIntFlowProfiles->Add(fAvMultiplicity); | |
b40a910e | 1556 | // Average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with wrong errors!): |
1557 | TString correlationFlag[4] = {"#LT#LT2#GT#GT","#LT#LT4#GT#GT","#LT#LT6#GT#GT","#LT#LT8#GT#GT"}; | |
489d5531 | 1558 | TString intFlowCorrelationsProName = "fIntFlowCorrelationsPro"; |
1559 | intFlowCorrelationsProName += fAnalysisLabel->Data(); | |
1560 | fIntFlowCorrelationsPro = new TProfile(intFlowCorrelationsProName.Data(),"Average correlations for all events",4,0,4,"s"); | |
b40a910e | 1561 | fIntFlowCorrelationsPro->Sumw2(); |
489d5531 | 1562 | fIntFlowCorrelationsPro->SetTickLength(-0.01,"Y"); |
1563 | fIntFlowCorrelationsPro->SetMarkerStyle(25); | |
1564 | fIntFlowCorrelationsPro->SetLabelSize(0.06); | |
1565 | fIntFlowCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
68a3b4b1 | 1566 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 1567 | { |
68a3b4b1 | 1568 | (fIntFlowCorrelationsPro->GetXaxis())->SetBinLabel(b+1,correlationFlag[b].Data()); |
b3dacf6b | 1569 | } |
489d5531 | 1570 | fIntFlowProfiles->Add(fIntFlowCorrelationsPro); |
b40a910e | 1571 | // Average correlations squared <<2>^2>, <<4>^2>, <<6>^2> and <<8>^2> for all events: |
1572 | TString squaredCorrelationFlag[4] = {"#LT#LT2#GT^{2}#GT","#LT#LT4#GT^{2}#GT","#LT#LT6#GT^{2}#GT","#LT#LT8#GT^{2}#GT"}; | |
1573 | TString intFlowSquaredCorrelationsProName = "fIntFlowSquaredCorrelationsPro"; | |
1574 | intFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
1575 | fIntFlowSquaredCorrelationsPro = new TProfile(intFlowSquaredCorrelationsProName.Data(),"Average squared correlations for all events",4,0,4,"s"); | |
1576 | fIntFlowSquaredCorrelationsPro->Sumw2(); | |
1577 | fIntFlowSquaredCorrelationsPro->SetTickLength(-0.01,"Y"); | |
1578 | fIntFlowSquaredCorrelationsPro->SetMarkerStyle(25); | |
1579 | fIntFlowSquaredCorrelationsPro->SetLabelSize(0.06); | |
1580 | fIntFlowSquaredCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
1581 | for(Int_t b=0;b<4;b++) | |
1582 | { | |
1583 | (fIntFlowSquaredCorrelationsPro->GetXaxis())->SetBinLabel(b+1,squaredCorrelationFlag[b].Data()); | |
1584 | } | |
1585 | fIntFlowProfiles->Add(fIntFlowSquaredCorrelationsPro); | |
b3dacf6b | 1586 | if(fCalculateCumulantsVsM) |
1587 | { | |
1588 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
1589 | { | |
b40a910e | 1590 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> versus multiplicity for all events (with wrong errors): |
b3dacf6b | 1591 | TString intFlowCorrelationsVsMProName = "fIntFlowCorrelationsVsMPro"; |
1592 | intFlowCorrelationsVsMProName += fAnalysisLabel->Data(); | |
1593 | fIntFlowCorrelationsVsMPro[ci] = new TProfile(Form("%s, %s",intFlowCorrelationsVsMProName.Data(),correlationFlag[ci].Data()), | |
1594 | Form("%s vs multiplicity",correlationFlag[ci].Data()), | |
b40a910e | 1595 | fnBinsMult,fMinMult,fMaxMult,"s"); |
1596 | fIntFlowCorrelationsVsMPro[ci]->Sumw2(); | |
b3dacf6b | 1597 | fIntFlowCorrelationsVsMPro[ci]->GetYaxis()->SetTitle(correlationFlag[ci].Data()); |
1598 | fIntFlowCorrelationsVsMPro[ci]->GetXaxis()->SetTitle("M"); | |
1599 | fIntFlowProfiles->Add(fIntFlowCorrelationsVsMPro[ci]); | |
b40a910e | 1600 | // average squared correlations <<2>^2>, <<4>^2>, <<6>^2> and <<8>^2> versus multiplicity for all events: |
1601 | TString intFlowSquaredCorrelationsVsMProName = "fIntFlowSquaredCorrelationsVsMPro"; | |
1602 | intFlowSquaredCorrelationsVsMProName += fAnalysisLabel->Data(); | |
1603 | fIntFlowSquaredCorrelationsVsMPro[ci] = new TProfile(Form("%s, %s",intFlowSquaredCorrelationsVsMProName.Data(),squaredCorrelationFlag[ci].Data()), | |
1604 | Form("%s vs multiplicity",squaredCorrelationFlag[ci].Data()), | |
1605 | fnBinsMult,fMinMult,fMaxMult,"s"); | |
1606 | fIntFlowSquaredCorrelationsVsMPro[ci]->Sumw2(); | |
1607 | fIntFlowSquaredCorrelationsVsMPro[ci]->GetYaxis()->SetTitle(squaredCorrelationFlag[ci].Data()); | |
1608 | fIntFlowSquaredCorrelationsVsMPro[ci]->GetXaxis()->SetTitle("M"); | |
1609 | fIntFlowProfiles->Add(fIntFlowSquaredCorrelationsVsMPro[ci]); | |
b3dacf6b | 1610 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index |
1611 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 1612 | // averaged all correlations for all events (with wrong errors!): |
1613 | TString intFlowCorrelationsAllProName = "fIntFlowCorrelationsAllPro"; | |
1614 | intFlowCorrelationsAllProName += fAnalysisLabel->Data(); | |
8ed4edc7 | 1615 | fIntFlowCorrelationsAllPro = new TProfile(intFlowCorrelationsAllProName.Data(),"Average correlations for all events",34,0,34,"s"); |
489d5531 | 1616 | fIntFlowCorrelationsAllPro->SetTickLength(-0.01,"Y"); |
1617 | fIntFlowCorrelationsAllPro->SetMarkerStyle(25); | |
1618 | fIntFlowCorrelationsAllPro->SetLabelSize(0.03); | |
1619 | fIntFlowCorrelationsAllPro->SetLabelOffset(0.01,"Y"); | |
1620 | // 2-p correlations: | |
1621 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(1,"<<2>>_{n|n}"); | |
1622 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(2,"<<2>>_{2n|2n}"); | |
1623 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(3,"<<2>>_{3n|3n}"); | |
1624 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(4,"<<2>>_{4n|4n}"); | |
1625 | // 3-p correlations: | |
1626 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(6,"<<3>>_{2n|n,n}"); | |
1627 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}"); | |
1628 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}"); | |
1629 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}"); | |
1630 | // 4-p correlations: | |
1631 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}"); | |
1632 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}"); | |
1633 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}"); | |
1634 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}"); | |
1635 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}"); | |
1636 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}"); | |
1637 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}"); | |
1638 | // 5-p correlations: | |
1639 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}"); | |
1640 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}"); | |
1641 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}"); | |
1642 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}"); | |
1643 | // 6-p correlations: | |
1644 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}"); | |
1645 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}"); | |
1646 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}"); | |
1647 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}"); | |
1648 | // 7-p correlations: | |
1649 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}"); | |
1650 | // 8-p correlations: | |
1651 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}"); | |
8ed4edc7 | 1652 | // EXTRA correlations: |
1653 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(33,"<<4>>_{4n,2n|3n,3n}"); | |
1654 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(34,"<<5>>_{2n,2n,2n|3n,3n}"); | |
489d5531 | 1655 | fIntFlowProfiles->Add(fIntFlowCorrelationsAllPro); |
1656 | // when particle weights are used some extra correlations appear: | |
1657 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
1658 | { | |
1659 | TString intFlowExtraCorrelationsProName = "fIntFlowExtraCorrelationsPro"; | |
1660 | intFlowExtraCorrelationsProName += fAnalysisLabel->Data(); | |
1661 | fIntFlowExtraCorrelationsPro = new TProfile(intFlowExtraCorrelationsProName.Data(),"Average extra correlations for all events",100,0,100,"s"); | |
1662 | fIntFlowExtraCorrelationsPro->SetTickLength(-0.01,"Y"); | |
1663 | fIntFlowExtraCorrelationsPro->SetMarkerStyle(25); | |
1664 | fIntFlowExtraCorrelationsPro->SetLabelSize(0.03); | |
1665 | fIntFlowExtraCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
1666 | // extra 2-p correlations: | |
1667 | (fIntFlowExtraCorrelationsPro->GetXaxis())->SetBinLabel(1,"<<w1^3 w2 cos(n*(phi1-phi2))>>"); | |
1668 | (fIntFlowExtraCorrelationsPro->GetXaxis())->SetBinLabel(2,"<<w1 w2 w3^2 cos(n*(phi1-phi2))>>"); | |
1669 | fIntFlowProfiles->Add(fIntFlowExtraCorrelationsPro); | |
1670 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
1671 | // average product of correlations <2>, <4>, <6> and <8>: | |
b3dacf6b | 1672 | TString productFlag[6] = {"<<2><4>>","<<2><6>>","<<2><8>>","<<4><6>>","<<4><8>>","<<6><8>>"}; |
489d5531 | 1673 | TString intFlowProductOfCorrelationsProName = "fIntFlowProductOfCorrelationsPro"; |
1674 | intFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
1675 | fIntFlowProductOfCorrelationsPro = new TProfile(intFlowProductOfCorrelationsProName.Data(),"Average products of correlations",6,0,6); | |
1676 | fIntFlowProductOfCorrelationsPro->SetTickLength(-0.01,"Y"); | |
1677 | fIntFlowProductOfCorrelationsPro->SetMarkerStyle(25); | |
1678 | fIntFlowProductOfCorrelationsPro->SetLabelSize(0.05); | |
1679 | fIntFlowProductOfCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
68a3b4b1 | 1680 | for(Int_t b=0;b<6;b++) |
b3dacf6b | 1681 | { |
68a3b4b1 | 1682 | (fIntFlowProductOfCorrelationsPro->GetXaxis())->SetBinLabel(b+1,productFlag[b].Data()); |
b3dacf6b | 1683 | } |
1684 | fIntFlowProfiles->Add(fIntFlowProductOfCorrelationsPro); | |
ff70ca91 | 1685 | // average product of correlations <2>, <4>, <6> and <8> versus multiplicity |
1686 | // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>] | |
b3dacf6b | 1687 | if(fCalculateCumulantsVsM) |
1688 | { | |
1689 | TString intFlowProductOfCorrelationsVsMProName = "fIntFlowProductOfCorrelationsVsMPro"; | |
1690 | intFlowProductOfCorrelationsVsMProName += fAnalysisLabel->Data(); | |
1691 | for(Int_t pi=0;pi<6;pi++) | |
1692 | { | |
1693 | fIntFlowProductOfCorrelationsVsMPro[pi] = new TProfile(Form("%s, %s",intFlowProductOfCorrelationsVsMProName.Data(),productFlag[pi].Data()), | |
1694 | Form("%s versus multiplicity",productFlag[pi].Data()), | |
1695 | fnBinsMult,fMinMult,fMaxMult); | |
1696 | fIntFlowProductOfCorrelationsVsMPro[pi]->GetXaxis()->SetTitle("M"); | |
1697 | fIntFlowProfiles->Add(fIntFlowProductOfCorrelationsVsMPro[pi]); | |
1698 | } // end of for(Int_t pi=0;pi<6;pi++) | |
1699 | } // end of if(fCalculateCumulantsVsM) | |
0328db2d | 1700 | // average product of correction terms for NUA: |
1701 | TString intFlowProductOfCorrectionTermsForNUAProName = "fIntFlowProductOfCorrectionTermsForNUAPro"; | |
1702 | intFlowProductOfCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
1703 | fIntFlowProductOfCorrectionTermsForNUAPro = new TProfile(intFlowProductOfCorrectionTermsForNUAProName.Data(),"Average products of correction terms for NUA",27,0,27); | |
1704 | fIntFlowProductOfCorrectionTermsForNUAPro->SetTickLength(-0.01,"Y"); | |
1705 | fIntFlowProductOfCorrectionTermsForNUAPro->SetMarkerStyle(25); | |
1706 | fIntFlowProductOfCorrectionTermsForNUAPro->SetLabelSize(0.05); | |
1707 | fIntFlowProductOfCorrectionTermsForNUAPro->SetLabelOffset(0.01,"Y"); | |
1708 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(1,"<<2><cos(#phi)>>"); | |
1709 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(2,"<<2><sin(#phi)>>"); | |
1710 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(3,"<<cos(#phi)><sin(#phi)>>"); | |
1711 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(4,"Cov(<2>,<cos(#phi_{1}+#phi_{2})>)"); | |
1712 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(5,"Cov(<2>,<sin(#phi_{1}+#phi_{2})>)"); | |
1713 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(6,"Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1714 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(7,"Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1715 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(8,"Cov(<4>,<cos(#phi)>)"); | |
1716 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(9,"Cov(<4>,<sin(#phi)>)"); | |
1717 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(10,"Cov(<4>,<cos(#phi_{1}+#phi_{2})>)"); | |
1718 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(11,"Cov(<4>,<sin(#phi_{1}+#phi_{2})>)"); | |
1719 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(12,"Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
1720 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(13,"Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
1721 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(14,"Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
1722 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(15,"Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
1723 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(16,"Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1724 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(17,"Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1725 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(18,"Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
1726 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(19,"Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
1727 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(20,"Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1728 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(21,"Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1729 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(22,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>)"); | |
1730 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(23,"Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1731 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(24,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1732 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(25,"Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1733 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(26,"Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1734 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(27,"Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>)"); | |
1735 | fIntFlowProfiles->Add(fIntFlowProductOfCorrectionTermsForNUAPro); | |
489d5531 | 1736 | // average correction terms for non-uniform acceptance (with wrong errors!): |
1737 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
1738 | { | |
1739 | TString intFlowCorrectionTermsForNUAProName = "fIntFlowCorrectionTermsForNUAPro"; | |
1740 | intFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
b92ea2b9 | 1741 | fIntFlowCorrectionTermsForNUAPro[sc] = new TProfile(Form("%s: %s terms",intFlowCorrectionTermsForNUAProName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4,"s"); |
489d5531 | 1742 | fIntFlowCorrectionTermsForNUAPro[sc]->SetTickLength(-0.01,"Y"); |
1743 | fIntFlowCorrectionTermsForNUAPro[sc]->SetMarkerStyle(25); | |
1744 | fIntFlowCorrectionTermsForNUAPro[sc]->SetLabelSize(0.03); | |
1745 | fIntFlowCorrectionTermsForNUAPro[sc]->SetLabelOffset(0.01,"Y"); | |
b92ea2b9 | 1746 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(1,Form("#LT#LT%s(n(phi1))#GT#GT",sinCosFlag[sc].Data())); |
1747 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(2,Form("#LT#LT%s(n(phi1+phi2))#GT#GT",sinCosFlag[sc].Data())); | |
1748 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(3,Form("#LT#LT%s(n(phi1-phi2-phi3))#GT#GT",sinCosFlag[sc].Data())); | |
1749 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(4,Form("#LT#LT%s(n(2phi1-phi2))#GT#GT",sinCosFlag[sc].Data())); | |
489d5531 | 1750 | fIntFlowProfiles->Add(fIntFlowCorrectionTermsForNUAPro[sc]); |
2001bc3a | 1751 | // versus multiplicity: |
b3dacf6b | 1752 | if(fCalculateCumulantsVsM) |
1753 | { | |
1754 | TString correctionTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4 | |
1755 | for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) | |
1756 | { | |
1757 | TString intFlowCorrectionTermsForNUAVsMProName = "fIntFlowCorrectionTermsForNUAVsMPro"; | |
1758 | intFlowCorrectionTermsForNUAVsMProName += fAnalysisLabel->Data(); | |
1759 | fIntFlowCorrectionTermsForNUAVsMPro[sc][ci] = new TProfile(Form("%s: #LT#LT%s%s#GT#GT",intFlowCorrectionTermsForNUAVsMProName.Data(),sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()),Form("#LT#LT%s%s#GT#GT vs M",sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()),fnBinsMult,fMinMult,fMaxMult,"s"); | |
1760 | fIntFlowProfiles->Add(fIntFlowCorrectionTermsForNUAVsMPro[sc][ci]); | |
1761 | } | |
1762 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 1763 | } // end of for(Int_t sc=0;sc<2;sc++) |
1764 | ||
1765 | // d) Book histograms holding the final results: | |
1766 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with correct errors!): | |
1767 | TString intFlowCorrelationsHistName = "fIntFlowCorrelationsHist"; | |
1768 | intFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
1769 | fIntFlowCorrelationsHist = new TH1D(intFlowCorrelationsHistName.Data(),"Average correlations for all events",4,0,4); | |
1770 | fIntFlowCorrelationsHist->SetTickLength(-0.01,"Y"); | |
1771 | fIntFlowCorrelationsHist->SetMarkerStyle(25); | |
1772 | fIntFlowCorrelationsHist->SetLabelSize(0.06); | |
1773 | fIntFlowCorrelationsHist->SetLabelOffset(0.01,"Y"); | |
1774 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(1,"<<2>>"); | |
1775 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(2,"<<4>>"); | |
1776 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(3,"<<6>>"); | |
1777 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(4,"<<8>>"); | |
1778 | fIntFlowResults->Add(fIntFlowCorrelationsHist); | |
ff70ca91 | 1779 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with correct errors!) vs M: |
b3dacf6b | 1780 | if(fCalculateCumulantsVsM) |
1781 | { | |
1782 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
1783 | { | |
1784 | TString intFlowCorrelationsVsMHistName = "fIntFlowCorrelationsVsMHist"; | |
1785 | intFlowCorrelationsVsMHistName += fAnalysisLabel->Data(); | |
1786 | fIntFlowCorrelationsVsMHist[ci] = new TH1D(Form("%s, %s",intFlowCorrelationsVsMHistName.Data(),correlationFlag[ci].Data()), | |
1787 | Form("%s vs multiplicity",correlationFlag[ci].Data()), | |
1788 | fnBinsMult,fMinMult,fMaxMult); | |
1789 | fIntFlowCorrelationsVsMHist[ci]->GetYaxis()->SetTitle(correlationFlag[ci].Data()); | |
1790 | fIntFlowCorrelationsVsMHist[ci]->GetXaxis()->SetTitle("M"); | |
1791 | fIntFlowResults->Add(fIntFlowCorrelationsVsMHist[ci]); | |
1792 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
1793 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 1794 | // average all correlations for all events (with correct errors!): |
1795 | TString intFlowCorrelationsAllHistName = "fIntFlowCorrelationsAllHist"; | |
1796 | intFlowCorrelationsAllHistName += fAnalysisLabel->Data(); | |
8ed4edc7 | 1797 | fIntFlowCorrelationsAllHist = new TH1D(intFlowCorrelationsAllHistName.Data(),"Average correlations for all events",34,0,34); |
489d5531 | 1798 | fIntFlowCorrelationsAllHist->SetTickLength(-0.01,"Y"); |
1799 | fIntFlowCorrelationsAllHist->SetMarkerStyle(25); | |
1800 | fIntFlowCorrelationsAllHist->SetLabelSize(0.03); | |
1801 | fIntFlowCorrelationsAllHist->SetLabelOffset(0.01,"Y"); | |
1802 | // 2-p correlations: | |
1803 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(1,"<<2>>_{n|n}"); | |
1804 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(2,"<<2>>_{2n|2n}"); | |
1805 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(3,"<<2>>_{3n|3n}"); | |
1806 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(4,"<<2>>_{4n|4n}"); | |
1807 | // 3-p correlations: | |
1808 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(6,"<<3>>_{2n|n,n}"); | |
1809 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}"); | |
1810 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}"); | |
1811 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}"); | |
1812 | // 4-p correlations: | |
1813 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}"); | |
1814 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}"); | |
1815 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}"); | |
1816 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}"); | |
1817 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}"); | |
1818 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}"); | |
1819 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}"); | |
1820 | // 5-p correlations: | |
1821 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}"); | |
1822 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}"); | |
1823 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}"); | |
1824 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}"); | |
1825 | // 6-p correlations: | |
1826 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}"); | |
1827 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}"); | |
1828 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}"); | |
1829 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}"); | |
1830 | // 7-p correlations: | |
1831 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}"); | |
1832 | // 8-p correlations: | |
1833 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}"); | |
1834 | fIntFlowResults->Add(fIntFlowCorrelationsAllHist); | |
1835 | // average correction terms for non-uniform acceptance (with correct errors!): | |
1836 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
1837 | { | |
1838 | TString intFlowCorrectionTermsForNUAHistName = "fIntFlowCorrectionTermsForNUAHist"; | |
1839 | intFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
b92ea2b9 | 1840 | fIntFlowCorrectionTermsForNUAHist[sc] = new TH1D(Form("%s: %s terms",intFlowCorrectionTermsForNUAHistName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4); |
489d5531 | 1841 | fIntFlowCorrectionTermsForNUAHist[sc]->SetTickLength(-0.01,"Y"); |
1842 | fIntFlowCorrectionTermsForNUAHist[sc]->SetMarkerStyle(25); | |
1843 | fIntFlowCorrectionTermsForNUAHist[sc]->SetLabelSize(0.03); | |
1844 | fIntFlowCorrectionTermsForNUAHist[sc]->SetLabelOffset(0.01,"Y"); | |
b92ea2b9 | 1845 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(1,Form("#LT#LT%s(n(#phi_{1}))#GT#GT",sinCosFlag[sc].Data())); |
1846 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(2,Form("#LT#LT%s(n(phi1+phi2))#GT#GT",sinCosFlag[sc].Data())); | |
1847 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(3,Form("#LT#LT%s(n(phi1-phi2-phi3))#GT#GT",sinCosFlag[sc].Data())); | |
1848 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(4,Form("#LT#LT%s(n(2phi1-phi2))#GT#GT",sinCosFlag[sc].Data())); | |
489d5531 | 1849 | fIntFlowResults->Add(fIntFlowCorrectionTermsForNUAHist[sc]); |
1850 | } // end of for(Int_t sc=0;sc<2;sc++) | |
1851 | // covariances (multiplied with weight dependent prefactor): | |
1852 | TString intFlowCovariancesName = "fIntFlowCovariances"; | |
1853 | intFlowCovariancesName += fAnalysisLabel->Data(); | |
1854 | fIntFlowCovariances = new TH1D(intFlowCovariancesName.Data(),"Covariances (multiplied with weight dependent prefactor)",6,0,6); | |
1855 | fIntFlowCovariances->SetLabelSize(0.04); | |
1856 | fIntFlowCovariances->SetMarkerStyle(25); | |
1857 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(1,"Cov(<2>,<4>)"); | |
1858 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(2,"Cov(<2>,<6>)"); | |
1859 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(3,"Cov(<2>,<8>)"); | |
1860 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(4,"Cov(<4>,<6>)"); | |
1861 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(5,"Cov(<4>,<8>)"); | |
1862 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(6,"Cov(<6>,<8>)"); | |
1863 | fIntFlowResults->Add(fIntFlowCovariances); | |
1864 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8>: | |
1865 | TString intFlowSumOfEventWeightsName = "fIntFlowSumOfEventWeights"; | |
1866 | intFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
1867 | for(Int_t power=0;power<2;power++) | |
1868 | { | |
1869 | fIntFlowSumOfEventWeights[power] = new TH1D(Form("%s: %s",intFlowSumOfEventWeightsName.Data(),powerFlag[power].Data()),Form("Sum of %s event weights for correlations",powerFlag[power].Data()),4,0,4); | |
1870 | fIntFlowSumOfEventWeights[power]->SetLabelSize(0.05); | |
1871 | fIntFlowSumOfEventWeights[power]->SetMarkerStyle(25); | |
1872 | if(power == 0) | |
1873 | { | |
1874 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>}"); | |
1875 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<4>}"); | |
1876 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<6>}"); | |
1877 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{<8>}"); | |
1878 | } else if (power == 1) | |
1879 | { | |
1880 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>}^{2}"); | |
1881 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<4>}^{2}"); | |
1882 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<6>}^{2}"); | |
1883 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{<8>}^{2}"); | |
1884 | } | |
1885 | fIntFlowResults->Add(fIntFlowSumOfEventWeights[power]); | |
1886 | } | |
1887 | // sum of products of event weights for correlations <2>, <4>, <6> and <8>: | |
1888 | TString intFlowSumOfProductOfEventWeightsName = "fIntFlowSumOfProductOfEventWeights"; | |
1889 | intFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
1890 | fIntFlowSumOfProductOfEventWeights = new TH1D(intFlowSumOfProductOfEventWeightsName.Data(),"Sum of product of event weights for correlations",6,0,6); | |
1891 | fIntFlowSumOfProductOfEventWeights->SetLabelSize(0.05); | |
1892 | fIntFlowSumOfProductOfEventWeights->SetMarkerStyle(25); | |
1893 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>} w_{<4>}"); | |
1894 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<2>} w_{<6>}"); | |
1895 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<2>} w_{<8>}"); | |
1896 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{<4>} w_{<6>}"); | |
1897 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(5,"#sum_{i=1}^{N} w_{<4>} w_{<8>}"); | |
1898 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(6,"#sum_{i=1}^{N} w_{<6>} w_{<8>}"); | |
1899 | fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeights); | |
ff70ca91 | 1900 | // final result for covariances of correlations (multiplied with weight dependent prefactor) versus M |
1901 | // [0=Cov(2,4),1=Cov(2,6),2=Cov(2,8),3=Cov(4,6),4=Cov(4,8),5=Cov(6,8)]: | |
b3dacf6b | 1902 | if(fCalculateCumulantsVsM) |
ff70ca91 | 1903 | { |
b3dacf6b | 1904 | TString intFlowCovariancesVsMName = "fIntFlowCovariancesVsM"; |
1905 | intFlowCovariancesVsMName += fAnalysisLabel->Data(); | |
1906 | TString covarianceFlag[6] = {"Cov(<2>,<4>)","Cov(<2>,<6>)","Cov(<2>,<8>)","Cov(<4>,<6>)","Cov(<4>,<8>)","Cov(<6>,<8>)"}; | |
1907 | for(Int_t ci=0;ci<6;ci++) | |
1908 | { | |
1909 | fIntFlowCovariancesVsM[ci] = new TH1D(Form("%s, %s",intFlowCovariancesVsMName.Data(),covarianceFlag[ci].Data()), | |
1910 | Form("%s vs multiplicity",covarianceFlag[ci].Data()), | |
1911 | fnBinsMult,fMinMult,fMaxMult); | |
1912 | fIntFlowCovariancesVsM[ci]->GetYaxis()->SetTitle(covarianceFlag[ci].Data()); | |
1913 | fIntFlowCovariancesVsM[ci]->GetXaxis()->SetTitle("M"); | |
1914 | fIntFlowResults->Add(fIntFlowCovariancesVsM[ci]); | |
1915 | } | |
1916 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 1917 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8> versus multiplicity |
1918 | // [0=sum{w_{<2>}},1=sum{w_{<4>}},2=sum{w_{<6>}},3=sum{w_{<8>}}][0=linear 1,1=quadratic]: | |
b3dacf6b | 1919 | if(fCalculateCumulantsVsM) |
ff70ca91 | 1920 | { |
b3dacf6b | 1921 | TString intFlowSumOfEventWeightsVsMName = "fIntFlowSumOfEventWeightsVsM"; |
1922 | intFlowSumOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
1923 | TString sumFlag[2][4] = {{"#sum_{i=1}^{N} w_{<2>}","#sum_{i=1}^{N} w_{<4>}","#sum_{i=1}^{N} w_{<6>}","#sum_{i=1}^{N} w_{<8>}"}, | |
1924 | {"#sum_{i=1}^{N} w_{<2>}^{2}","#sum_{i=1}^{N} w_{<4>}^{2}","#sum_{i=1}^{N} w_{<6>}^{2}","#sum_{i=1}^{N} w_{<8>}^{2}"}}; | |
1925 | for(Int_t si=0;si<4;si++) | |
ff70ca91 | 1926 | { |
b3dacf6b | 1927 | for(Int_t power=0;power<2;power++) |
1928 | { | |
1929 | fIntFlowSumOfEventWeightsVsM[si][power] = new TH1D(Form("%s, %s",intFlowSumOfEventWeightsVsMName.Data(),sumFlag[power][si].Data()), | |
1930 | Form("%s vs multiplicity",sumFlag[power][si].Data()), | |
1931 | fnBinsMult,fMinMult,fMaxMult); | |
1932 | fIntFlowSumOfEventWeightsVsM[si][power]->GetYaxis()->SetTitle(sumFlag[power][si].Data()); | |
1933 | fIntFlowSumOfEventWeightsVsM[si][power]->GetXaxis()->SetTitle("M"); | |
1934 | fIntFlowResults->Add(fIntFlowSumOfEventWeightsVsM[si][power]); | |
1935 | } // end of for(Int_t power=0;power<2;power++) | |
1936 | } // end of for(Int_t si=0;si<4;si++) | |
1937 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 1938 | // sum of products of event weights for correlations <2>, <4>, <6> and <8> vs M |
1939 | // [0=sum{w_{<2>}w_{<4>}},1=sum{w_{<2>}w_{<6>}},2=sum{w_{<2>}w_{<8>}}, | |
1940 | // 3=sum{w_{<4>}w_{<6>}},4=sum{w_{<4>}w_{<8>}},5=sum{w_{<6>}w_{<8>}}]: | |
b3dacf6b | 1941 | if(fCalculateCumulantsVsM) |
1942 | { | |
1943 | TString intFlowSumOfProductOfEventWeightsVsMName = "fIntFlowSumOfProductOfEventWeightsVsM"; | |
1944 | intFlowSumOfProductOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
1945 | TString sopowFlag[6] = {"#sum_{i=1}^{N} w_{<2>} w_{<4>}","#sum_{i=1}^{N} w_{<2>} w_{<6>}","#sum_{i=1}^{N} w_{<2>} w_{<8>}", | |
1946 | "#sum_{i=1}^{N} w_{<4>} w_{<6>}","#sum_{i=1}^{N} w_{<4>} w_{<8>}","#sum_{i=1}^{N} w_{<6>} w_{<8>}"}; | |
1947 | for(Int_t pi=0;pi<6;pi++) | |
1948 | { | |
1949 | fIntFlowSumOfProductOfEventWeightsVsM[pi] = new TH1D(Form("%s, %s",intFlowSumOfProductOfEventWeightsVsMName.Data(),sopowFlag[pi].Data()), | |
1950 | Form("%s versus multiplicity",sopowFlag[pi].Data()), | |
1951 | fnBinsMult,fMinMult,fMaxMult); | |
1952 | fIntFlowSumOfProductOfEventWeightsVsM[pi]->GetXaxis()->SetTitle("M"); | |
1953 | fIntFlowSumOfProductOfEventWeightsVsM[pi]->GetYaxis()->SetTitle(sopowFlag[pi].Data()); | |
1954 | fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeightsVsM[pi]); | |
1955 | } // end of for(Int_t pi=0;pi<6;pi++) | |
1956 | } // end of if(fCalculateCumulantsVsM) | |
0328db2d | 1957 | // covariances of NUA terms (multiplied with weight dependent prefactor): |
1958 | TString intFlowCovariancesNUAName = "fIntFlowCovariancesNUA"; | |
1959 | intFlowCovariancesNUAName += fAnalysisLabel->Data(); | |
1960 | fIntFlowCovariancesNUA = new TH1D(intFlowCovariancesNUAName.Data(),"Covariances for NUA (multiplied with weight dependent prefactor)",27,0,27); | |
1961 | fIntFlowCovariancesNUA->SetLabelSize(0.04); | |
1962 | fIntFlowCovariancesNUA->SetMarkerStyle(25); | |
1963 | fIntFlowCovariancesNUA->GetXaxis()->SetLabelSize(0.02); | |
1964 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(1,"Cov(<2>,<cos(#phi)>"); | |
1965 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(2,"Cov(<2>,<sin(#phi)>)"); | |
1966 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(3,"Cov(<cos(#phi)>,<sin(#phi)>)"); | |
1967 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(4,"Cov(<2>,<cos(#phi_{1}+#phi_{2})>)"); | |
1968 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(5,"Cov(<2>,<sin(#phi_{1}+#phi_{2})>)"); | |
1969 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(6,"Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1970 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(7,"Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1971 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(8,"Cov(<4>,<cos(#phi)>)"); | |
1972 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(9,"Cov(<4>,<sin(#phi)>)"); | |
1973 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(10,"Cov(<4>,<cos(#phi_{1}+#phi_{2})>)"); | |
1974 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(11,"Cov(<4>,<sin(#phi_{1}+#phi_{2})>)"); | |
1975 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(12,"Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
1976 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(13,"Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
1977 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(14,"Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
1978 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(15,"Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
1979 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(16,"Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1980 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(17,"Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1981 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(18,"Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
1982 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(19,"Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
1983 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(20,"Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1984 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(21,"Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1985 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(22,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>)"); | |
1986 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(23,"Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1987 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(24,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1988 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(25,"Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1989 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(26,"Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1990 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(27,"Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>)"); | |
1991 | fIntFlowResults->Add(fIntFlowCovariancesNUA); | |
1992 | // sum of linear and quadratic event weights for NUA terms: | |
1993 | TString intFlowSumOfEventWeightsNUAName = "fIntFlowSumOfEventWeightsNUA"; | |
1994 | intFlowSumOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
1995 | for(Int_t sc=0;sc<2;sc++) | |
1996 | { | |
1997 | for(Int_t power=0;power<2;power++) | |
1998 | { | |
b92ea2b9 | 1999 | fIntFlowSumOfEventWeightsNUA[sc][power] = new TH1D(Form("%s: %s, %s",intFlowSumOfEventWeightsNUAName.Data(),powerFlag[power].Data(),sinCosFlag[sc].Data()),Form("Sum of %s event weights for NUA %s terms",powerFlag[power].Data(),sinCosFlag[sc].Data()),4,0,4); // to be improved - 4 |
0328db2d | 2000 | fIntFlowSumOfEventWeightsNUA[sc][power]->SetLabelSize(0.05); |
2001 | fIntFlowSumOfEventWeightsNUA[sc][power]->SetMarkerStyle(25); | |
2002 | if(power == 0) | |
2003 | { | |
2004 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(1,Form("#sum_{i=1}^{N} w_{<%s(#phi)>}",sinCosFlag[sc].Data())); | |
2005 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(2,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}+#phi_{2})>}",sinCosFlag[sc].Data())); | |
b92ea2b9 | 2006 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(3,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}-#phi_{2}-#phi_{3})>}",sinCosFlag[sc].Data())); |
2007 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(4,Form("#sum_{i=1}^{N} w_{<%s(2#phi_{1}-#phi_{2})>}",sinCosFlag[sc].Data())); | |
0328db2d | 2008 | } else if(power == 1) |
2009 | { | |
2010 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(1,Form("#sum_{i=1}^{N} w_{<%s(#phi)>}^{2}",sinCosFlag[sc].Data())); | |
2011 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(2,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}+#phi_{2})>}^{2}",sinCosFlag[sc].Data())); | |
2012 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(3,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}-#phi_{2}-#phi_{3})>}^{2}",sinCosFlag[sc].Data())); | |
b92ea2b9 | 2013 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(4,Form("#sum_{i=1}^{N} w_{<%s(2#phi_{1}-#phi_{2})>}^{2}",sinCosFlag[sc].Data())); |
0328db2d | 2014 | } |
2015 | fIntFlowResults->Add(fIntFlowSumOfEventWeightsNUA[sc][power]); | |
2016 | } | |
2017 | } | |
2018 | // sum of products of event weights for NUA terms: | |
2019 | TString intFlowSumOfProductOfEventWeightsNUAName = "fIntFlowSumOfProductOfEventWeightsNUA"; | |
2020 | intFlowSumOfProductOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
2021 | fIntFlowSumOfProductOfEventWeightsNUA = new TH1D(intFlowSumOfProductOfEventWeightsNUAName.Data(),"Sum of product of event weights for NUA terms",27,0,27); | |
2022 | fIntFlowSumOfProductOfEventWeightsNUA->SetLabelSize(0.05); | |
2023 | fIntFlowSumOfProductOfEventWeightsNUA->SetMarkerStyle(25); | |
2024 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>} w_{<cos(#phi)>}"); | |
2025 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<2>} w_{<sin(#phi)>}"); | |
2026 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<cos(#phi)>} w_{<sin(#phi)>}"); | |
2027 | // .... | |
2028 | // to be improved - add labels for remaining bins | |
2029 | // .... | |
2030 | fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeightsNUA); | |
b3dacf6b | 2031 | // Final results for reference Q-cumulants: |
2032 | TString cumulantFlag[4] = {"QC{2}","QC{4}","QC{6}","QC{8}"}; | |
489d5531 | 2033 | TString intFlowQcumulantsName = "fIntFlowQcumulants"; |
2034 | intFlowQcumulantsName += fAnalysisLabel->Data(); | |
b92ea2b9 | 2035 | fIntFlowQcumulants = new TH1D(intFlowQcumulantsName.Data(),"Reference Q-cumulants",4,0,4); |
b77b6434 | 2036 | if(fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 2037 | { |
b77b6434 | 2038 | fIntFlowQcumulants->SetTitle("Reference Q-cumulants (error from non-isotropic terms also propagated)"); |
b92ea2b9 | 2039 | } |
489d5531 | 2040 | fIntFlowQcumulants->SetLabelSize(0.05); |
2041 | fIntFlowQcumulants->SetMarkerStyle(25); | |
68a3b4b1 | 2042 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2043 | { |
68a3b4b1 | 2044 | (fIntFlowQcumulants->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data()); |
b3dacf6b | 2045 | } |
489d5531 | 2046 | fIntFlowResults->Add(fIntFlowQcumulants); |
b3dacf6b | 2047 | // Final results for reference Q-cumulants rebinned in M: |
2048 | if(fCalculateCumulantsVsM) | |
2049 | { | |
2050 | TString intFlowQcumulantsRebinnedInMName = "fIntFlowQcumulantsRebinnedInM"; | |
2051 | intFlowQcumulantsRebinnedInMName += fAnalysisLabel->Data(); | |
2052 | fIntFlowQcumulantsRebinnedInM = new TH1D(intFlowQcumulantsRebinnedInMName.Data(),"Reference Q-cumulants rebinned in M",4,0,4); | |
2053 | fIntFlowQcumulantsRebinnedInM->SetLabelSize(0.05); | |
2054 | fIntFlowQcumulantsRebinnedInM->SetMarkerStyle(25); | |
68a3b4b1 | 2055 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2056 | { |
68a3b4b1 | 2057 | (fIntFlowQcumulantsRebinnedInM->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data()); |
b3dacf6b | 2058 | } |
2059 | fIntFlowResults->Add(fIntFlowQcumulantsRebinnedInM); | |
2060 | } // end of if(fCalculateCumulantsVsM) | |
b92ea2b9 | 2061 | // Ratio between error squared: with/without non-isotropic terms: |
2062 | TString intFlowQcumulantsErrorSquaredRatioName = "fIntFlowQcumulantsErrorSquaredRatio"; | |
2063 | intFlowQcumulantsErrorSquaredRatioName += fAnalysisLabel->Data(); | |
2064 | fIntFlowQcumulantsErrorSquaredRatio = new TH1D(intFlowQcumulantsErrorSquaredRatioName.Data(),"Error squared of reference Q-cumulants: #frac{with NUA terms}{without NUA terms}",4,0,4); | |
2065 | fIntFlowQcumulantsErrorSquaredRatio->SetLabelSize(0.05); | |
2066 | fIntFlowQcumulantsErrorSquaredRatio->SetMarkerStyle(25); | |
2067 | for(Int_t b=0;b<4;b++) | |
2068 | { | |
2069 | (fIntFlowQcumulantsErrorSquaredRatio->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data()); | |
2070 | } | |
2071 | fIntFlowResults->Add(fIntFlowQcumulantsErrorSquaredRatio); | |
ff70ca91 | 2072 | // final results for integrated Q-cumulants versus multiplicity: |
b3dacf6b | 2073 | if(fCalculateCumulantsVsM) |
2074 | { | |
2075 | TString intFlowQcumulantsVsMName = "fIntFlowQcumulantsVsM"; | |
2076 | intFlowQcumulantsVsMName += fAnalysisLabel->Data(); | |
2077 | for(Int_t co=0;co<4;co++) // cumulant order | |
2078 | { | |
2079 | fIntFlowQcumulantsVsM[co] = new TH1D(Form("%s, %s",intFlowQcumulantsVsMName.Data(),cumulantFlag[co].Data()), | |
2080 | Form("%s vs multipicity",cumulantFlag[co].Data()), | |
2081 | fnBinsMult,fMinMult,fMaxMult); | |
2082 | fIntFlowQcumulantsVsM[co]->GetXaxis()->SetTitle("M"); | |
2083 | fIntFlowQcumulantsVsM[co]->GetYaxis()->SetTitle(cumulantFlag[co].Data()); | |
2084 | fIntFlowResults->Add(fIntFlowQcumulantsVsM[co]); | |
2085 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
2086 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 2087 | // final integrated flow estimates from Q-cumulants: |
b3dacf6b | 2088 | TString flowFlag[4] = {Form("v_{%d}{2,QC}",fHarmonic),Form("v_{%d}{4,QC}",fHarmonic),Form("v_{%d}{6,QC}",fHarmonic),Form("v_{%d}{8,QC}",fHarmonic)}; |
489d5531 | 2089 | TString intFlowName = "fIntFlow"; |
2090 | intFlowName += fAnalysisLabel->Data(); | |
2091 | // integrated flow from Q-cumulants: | |
b3dacf6b | 2092 | fIntFlow = new TH1D(intFlowName.Data(),"Reference flow estimates from Q-cumulants",4,0,4); |
489d5531 | 2093 | fIntFlow->SetLabelSize(0.05); |
2094 | fIntFlow->SetMarkerStyle(25); | |
68a3b4b1 | 2095 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2096 | { |
68a3b4b1 | 2097 | (fIntFlow->GetXaxis())->SetBinLabel(b+1,flowFlag[b].Data()); |
b3dacf6b | 2098 | } |
ff70ca91 | 2099 | fIntFlowResults->Add(fIntFlow); |
b3dacf6b | 2100 | // Reference flow vs M rebinned in one huge bin: |
2101 | if(fCalculateCumulantsVsM) | |
2102 | { | |
2103 | TString intFlowRebinnedInMName = "fIntFlowRebinnedInM"; | |
2104 | intFlowRebinnedInMName += fAnalysisLabel->Data(); | |
2105 | fIntFlowRebinnedInM = new TH1D(intFlowRebinnedInMName.Data(),"Reference flow estimates from Q-cumulants (rebinned in M)",4,0,4); | |
2106 | fIntFlowRebinnedInM->SetLabelSize(0.05); | |
2107 | fIntFlowRebinnedInM->SetMarkerStyle(25); | |
68a3b4b1 | 2108 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2109 | { |
68a3b4b1 | 2110 | (fIntFlowRebinnedInM->GetXaxis())->SetBinLabel(b+1,flowFlag[b].Data()); |
b3dacf6b | 2111 | } |
2112 | fIntFlowResults->Add(fIntFlowRebinnedInM); | |
2113 | } | |
ff70ca91 | 2114 | // integrated flow from Q-cumulants: versus multiplicity: |
b3dacf6b | 2115 | if(fCalculateCumulantsVsM) |
2116 | { | |
2117 | TString intFlowVsMName = "fIntFlowVsM"; | |
2118 | intFlowVsMName += fAnalysisLabel->Data(); | |
2119 | for(Int_t co=0;co<4;co++) // cumulant order | |
2120 | { | |
2121 | fIntFlowVsM[co] = new TH1D(Form("%s, %s",intFlowVsMName.Data(),flowFlag[co].Data()), | |
2122 | Form("%s vs multipicity",flowFlag[co].Data()), | |
2123 | fnBinsMult,fMinMult,fMaxMult); | |
2124 | fIntFlowVsM[co]->GetXaxis()->SetTitle("M"); | |
2125 | fIntFlowVsM[co]->GetYaxis()->SetTitle(flowFlag[co].Data()); | |
2126 | fIntFlowResults->Add(fIntFlowVsM[co]); | |
2127 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
2128 | } // end of if(fCalculateCumulantsVsM) | |
2001bc3a | 2129 | // quantifying detector effects effects to correlations: |
2130 | TString intFlowDetectorBiasName = "fIntFlowDetectorBias"; | |
2131 | intFlowDetectorBiasName += fAnalysisLabel->Data(); | |
2132 | fIntFlowDetectorBias = new TH1D(intFlowDetectorBiasName.Data(),"Quantifying detector bias",4,0,4); | |
2133 | fIntFlowDetectorBias->SetLabelSize(0.05); | |
2134 | fIntFlowDetectorBias->SetMarkerStyle(25); | |
2135 | for(Int_t ci=0;ci<4;ci++) | |
2136 | { | |
2137 | (fIntFlowDetectorBias->GetXaxis())->SetBinLabel(ci+1,Form("#frac{corrected}{measured} %s",cumulantFlag[ci].Data())); | |
2138 | } | |
2139 | fIntFlowResults->Add(fIntFlowDetectorBias); | |
2140 | // quantifying detector effects to correlations versus multiplicity: | |
b3dacf6b | 2141 | if(fCalculateCumulantsVsM) |
2001bc3a | 2142 | { |
b3dacf6b | 2143 | TString intFlowDetectorBiasVsMName = "fIntFlowDetectorBiasVsM"; |
2144 | intFlowDetectorBiasVsMName += fAnalysisLabel->Data(); | |
2145 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2146 | { | |
2147 | fIntFlowDetectorBiasVsM[ci] = new TH1D(Form("%s for %s",intFlowDetectorBiasVsMName.Data(),cumulantFlag[ci].Data()), | |
2148 | Form("Quantifying detector bias for %s vs multipicity",cumulantFlag[ci].Data()), | |
2149 | fnBinsMult,fMinMult,fMaxMult); | |
2150 | fIntFlowDetectorBiasVsM[ci]->GetXaxis()->SetTitle("M"); | |
2151 | fIntFlowDetectorBiasVsM[ci]->GetYaxis()->SetTitle("#frac{corrected}{measured}"); | |
b77b6434 | 2152 | fIntFlowResults->Add(fIntFlowDetectorBiasVsM[ci]); |
b3dacf6b | 2153 | } // end of for(Int_t co=0;co<4;co++) // cumulant order |
2154 | } // end of if(fCalculateCumulantsVsM) | |
1268c371 | 2155 | |
489d5531 | 2156 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow() |
2157 | ||
489d5531 | 2158 | //================================================================================================================================ |
2159 | ||
489d5531 | 2160 | void AliFlowAnalysisWithQCumulants::InitializeArraysForNestedLoops() |
2161 | { | |
2162 | // Initialize arrays of all objects relevant for calculations with nested loops. | |
2163 | ||
2164 | // integrated flow: | |
2165 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2166 | { | |
2167 | fIntFlowDirectCorrectionTermsForNUA[sc] = NULL; | |
2168 | } | |
2169 | ||
2170 | // differential flow: | |
2171 | // correlations: | |
2172 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
2173 | { | |
2174 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2175 | { | |
2176 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2177 | { | |
2178 | fDiffFlowDirectCorrelations[t][pe][ci] = NULL; | |
2179 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
2180 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2181 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
2182 | // correction terms for non-uniform acceptance: | |
2183 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
2184 | { | |
2185 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2186 | { | |
2187 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2188 | { | |
2189 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
2190 | { | |
2191 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = NULL; | |
2192 | } | |
2193 | } | |
2194 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2195 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
2196 | ||
2197 | ||
2198 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForNestedLoops() | |
2199 | ||
2200 | ||
2201 | //================================================================================================================================ | |
2202 | ||
2203 | ||
2204 | void AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops() | |
2205 | { | |
2206 | // Book all objects relevant for calculations with nested loops. | |
2207 | ||
2208 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?) | |
2209 | TString typeFlag[2] = {"RP","POI"}; // to be improved (should I promote this to data members?) | |
2210 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; // to be improved (should I promote this to data members?) | |
2211 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; // to be improved (should I promote this to data members?) | |
2212 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
2213 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
2214 | ||
2215 | TString evaluateNestedLoopsName = "fEvaluateNestedLoops"; | |
2216 | evaluateNestedLoopsName += fAnalysisLabel->Data(); | |
2217 | fEvaluateNestedLoops = new TProfile(evaluateNestedLoopsName.Data(),"Flags for nested loops",4,0,4); | |
2218 | fEvaluateNestedLoops->SetLabelSize(0.03); | |
2219 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(1,"fEvaluateIntFlowNestedLoops"); | |
2220 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(2,"fEvaluateDiffFlowNestedLoops"); | |
2221 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(3,"fCrossCheckInPtBinNo"); | |
2222 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(4,"fCrossCheckInEtaBinNo"); | |
2223 | fEvaluateNestedLoops->Fill(0.5,(Int_t)fEvaluateIntFlowNestedLoops); | |
2224 | fEvaluateNestedLoops->Fill(1.5,(Int_t)fEvaluateDiffFlowNestedLoops); | |
2225 | fEvaluateNestedLoops->Fill(2.5,fCrossCheckInPtBinNo); | |
2226 | fEvaluateNestedLoops->Fill(3.5,fCrossCheckInEtaBinNo); | |
2227 | fNestedLoopsList->Add(fEvaluateNestedLoops); | |
2228 | // nested loops for integrated flow: | |
2229 | if(fEvaluateIntFlowNestedLoops) | |
2230 | { | |
2231 | // correlations: | |
2232 | TString intFlowDirectCorrelationsName = "fIntFlowDirectCorrelations"; | |
2233 | intFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
8ed4edc7 | 2234 | fIntFlowDirectCorrelations = new TProfile(intFlowDirectCorrelationsName.Data(),"Multiparticle correlations calculated with nested loops (for int. flow)",34,0,34,"s"); |
489d5531 | 2235 | fNestedLoopsList->Add(fIntFlowDirectCorrelations); |
2236 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
2237 | { | |
2238 | TString intFlowExtraDirectCorrelationsName = "fIntFlowExtraDirectCorrelations"; | |
2239 | intFlowExtraDirectCorrelationsName += fAnalysisLabel->Data(); | |
2240 | fIntFlowExtraDirectCorrelations = new TProfile(intFlowExtraDirectCorrelationsName.Data(),"Extra multiparticle correlations calculated with nested loops (for int. flow)",100,0,100,"s"); | |
2241 | fNestedLoopsList->Add(fIntFlowExtraDirectCorrelations); | |
2242 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
2243 | // correction terms for non-uniform acceptance: | |
2244 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2245 | { | |
2246 | TString intFlowDirectCorrectionTermsForNUAName = "fIntFlowDirectCorrectionTermsForNUA"; | |
2247 | intFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
2248 | fIntFlowDirectCorrectionTermsForNUA[sc] = new TProfile(Form("%s: %s terms",intFlowDirectCorrectionTermsForNUAName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),10,0,10,"s"); | |
2249 | fNestedLoopsList->Add(fIntFlowDirectCorrectionTermsForNUA[sc]); | |
2250 | } // end of for(Int_t sc=0;sc<2;sc++) | |
2251 | } // end of if(fEvaluateIntFlowNestedLoops) | |
2252 | ||
2253 | // nested loops for differential flow: | |
2254 | if(fEvaluateDiffFlowNestedLoops) | |
2255 | { | |
2256 | // reduced correlations: | |
2257 | TString diffFlowDirectCorrelationsName = "fDiffFlowDirectCorrelations"; | |
2258 | diffFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
2259 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
2260 | { | |
2261 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2262 | { | |
2263 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
2264 | { | |
2265 | // reduced correlations: | |
2266 | fDiffFlowDirectCorrelations[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe],"s"); | |
2267 | fDiffFlowDirectCorrelations[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data()); | |
2268 | fNestedLoopsList->Add(fDiffFlowDirectCorrelations[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations) | |
2269 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
2270 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2271 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
2272 | // correction terms for non-uniform acceptance: | |
2273 | TString diffFlowDirectCorrectionTermsForNUAName = "fDiffFlowDirectCorrectionTermsForNUA"; | |
2274 | diffFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
2275 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
2276 | { | |
2277 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2278 | { | |
2279 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
2280 | { | |
2281 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
2282 | { | |
2283 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = new TProfile(Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe],"s"); | |
2284 | fNestedLoopsList->Add(fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]); | |
2285 | } | |
2286 | } | |
2287 | } | |
3b552efe | 2288 | } |
2289 | // number of RPs and POIs in selected pt and eta bins for cross-checkings: | |
2290 | TString noOfParticlesInBinName = "fNoOfParticlesInBin"; | |
2291 | fNoOfParticlesInBin = new TH1D(noOfParticlesInBinName.Data(),"Number of RPs and POIs in selected p_{T} and #eta bin",4,0,4); | |
489d5531 | 2292 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(1,"# of RPs in p_{T} bin"); |
2293 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(2,"# of RPs in #eta bin"); | |
2294 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(3,"# of POIs in p_{T} bin"); | |
3b552efe | 2295 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(4,"# of POIs in #eta bin"); |
489d5531 | 2296 | fNestedLoopsList->Add(fNoOfParticlesInBin); |
2297 | } // end of if(fEvaluateDiffFlowNestedLoops) | |
2298 | ||
2299 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops() | |
2300 | ||
2301 | ||
2302 | //================================================================================================================================ | |
2303 | ||
2304 | ||
2305 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelations() | |
2306 | { | |
2307 | // calculate all correlations needed for integrated flow | |
57340a27 | 2308 | |
489d5531 | 2309 | // multiplicity: |
1268c371 | 2310 | Double_t dMult = (*fSpk)(0,0); |
57340a27 | 2311 | |
489d5531 | 2312 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: |
2313 | Double_t dReQ1n = (*fReQ)(0,0); | |
2314 | Double_t dReQ2n = (*fReQ)(1,0); | |
2315 | Double_t dReQ3n = (*fReQ)(2,0); | |
2316 | Double_t dReQ4n = (*fReQ)(3,0); | |
8ed4edc7 | 2317 | //Double_t dReQ5n = (*fReQ)(4,0); |
2318 | Double_t dReQ6n = (*fReQ)(5,0); | |
489d5531 | 2319 | Double_t dImQ1n = (*fImQ)(0,0); |
2320 | Double_t dImQ2n = (*fImQ)(1,0); | |
2321 | Double_t dImQ3n = (*fImQ)(2,0); | |
2322 | Double_t dImQ4n = (*fImQ)(3,0); | |
8ed4edc7 | 2323 | //Double_t dImQ5n = (*fImQ)(4,0); |
2324 | Double_t dImQ6n = (*fImQ)(5,0); | |
489d5531 | 2325 | |
2326 | // real and imaginary parts of some expressions involving various combinations of Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
2327 | // (these expression appear in the Eqs. for the multi-particle correlations bellow) | |
2328 | ||
2329 | // Re[Q_{2n} Q_{n}^* Q_{n}^*] | |
2330 | Double_t reQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dReQ2n + 2.*dReQ1n*dImQ1n*dImQ2n - pow(dImQ1n,2.)*dReQ2n; | |
2331 | ||
2332 | // Im[Q_{2n} Q_{n}^* Q_{n}^*] | |
2333 | //Double_t imQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dImQ2n-2.*dReQ1n*dImQ1n*dReQ2n-pow(dImQ1n,2.)*dImQ2n; | |
2334 | ||
2335 | // Re[Q_{n} Q_{n} Q_{2n}^*] = Re[Q_{2n} Q_{n}^* Q_{n}^*] | |
2336 | Double_t reQ1nQ1nQ2nstar = reQ2nQ1nstarQ1nstar; | |
2337 | ||
2338 | // Re[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*] | |
2339 | Double_t reQ3nQ1nQ2nstarQ2nstar = (pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n) | |
2340 | + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n); | |
2341 | ||
2342 | // Im[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*] | |
2343 | //Double_t imQ3nQ1nQ2nstarQ2nstar = calculate and implement this (deleteMe) | |
2344 | ||
2345 | // Re[Q_{2n} Q_{2n} Q_{3n}^* Q_{1n}^*] = Re[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*] | |
2346 | Double_t reQ2nQ2nQ3nstarQ1nstar = reQ3nQ1nQ2nstarQ2nstar; | |
2347 | ||
2348 | // Re[Q_{4n} Q_{2n}^* Q_{2n}^*] | |
2349 | Double_t reQ4nQ2nstarQ2nstar = pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n; | |
2350 | ||
2351 | // Im[Q_{4n} Q_{2n}^* Q_{2n}^*] | |
2352 | //Double_t imQ4nQ2nstarQ2nstar = calculate and implement this (deleteMe) | |
2353 | ||
2354 | // Re[Q_{2n} Q_{2n} Q_{4n}^*] = Re[Q_{4n} Q_{2n}^* Q_{2n}^*] | |
2355 | Double_t reQ2nQ2nQ4nstar = reQ4nQ2nstarQ2nstar; | |
2356 | ||
2357 | // Re[Q_{4n} Q_{3n}^* Q_{n}^*] | |
2358 | Double_t reQ4nQ3nstarQ1nstar = dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n); | |
2359 | ||
2360 | // Re[Q_{3n} Q_{n} Q_{4n}^*] = Re[Q_{4n} Q_{3n}^* Q_{n}^*] | |
2361 | Double_t reQ3nQ1nQ4nstar = reQ4nQ3nstarQ1nstar; | |
2362 | ||
2363 | // Im[Q_{4n} Q_{3n}^* Q_{n}^*] | |
2364 | //Double_t imQ4nQ3nstarQ1nstar = calculate and implement this (deleteMe) | |
2365 | ||
2366 | // Re[Q_{3n} Q_{2n}^* Q_{n}^*] | |
2367 | Double_t reQ3nQ2nstarQ1nstar = dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n | |
2368 | + dImQ3n*dImQ2n*dReQ1n; | |
2369 | ||
2370 | // Re[Q_{2n} Q_{n} Q_{3n}^*] = Re[Q_{3n} Q_{2n}^* Q_{n}^*] | |
2371 | Double_t reQ2nQ1nQ3nstar = reQ3nQ2nstarQ1nstar; | |
2372 | ||
2373 | // Im[Q_{3n} Q_{2n}^* Q_{n}^*] | |
2374 | //Double_t imQ3nQ2nstarQ1nstar; //calculate and implement this (deleteMe) | |
2375 | ||
2376 | // Re[Q_{3n} Q_{n}^* Q_{n}^* Q_{n}^*] | |
2377 | Double_t reQ3nQ1nstarQ1nstarQ1nstar = dReQ3n*pow(dReQ1n,3)-3.*dReQ1n*dReQ3n*pow(dImQ1n,2) | |
2378 | + 3.*dImQ1n*dImQ3n*pow(dReQ1n,2)-dImQ3n*pow(dImQ1n,3); | |
2379 | ||
2380 | // Im[Q_{3n} Q_{n}^* Q_{n}^* Q_{n}^*] | |
2381 | //Double_t imQ3nQ1nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe) | |
2382 | ||
2383 | // |Q_{2n}|^2 |Q_{n}|^2 | |
2384 | Double_t dQ2nQ1nQ2nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
2385 | ||
2386 | // Re[Q_{4n} Q_{2n}^* Q_{n}^* Q_{n}^*] | |
2387 | Double_t reQ4nQ2nstarQ1nstarQ1nstar = (dReQ4n*dReQ2n+dImQ4n*dImQ2n)*(pow(dReQ1n,2)-pow(dImQ1n,2)) | |
2388 | + 2.*dReQ1n*dImQ1n*(dImQ4n*dReQ2n-dReQ4n*dImQ2n); | |
2389 | ||
2390 | // Im[Q_{4n} Q_{2n}^* Q_{n}^* Q_{n}^*] | |
2391 | //Double_t imQ4nQ2nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe) | |
2392 | ||
2393 | // Re[Q_{2n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^*] | |
2394 | Double_t reQ2nQ1nQ1nstarQ1nstarQ1nstar = (dReQ2n*dReQ1n-dImQ2n*dImQ1n)*(pow(dReQ1n,3)-3.*dReQ1n*pow(dImQ1n,2)) | |
2395 | + (dReQ2n*dImQ1n+dReQ1n*dImQ2n)*(3.*dImQ1n*pow(dReQ1n,2)-pow(dImQ1n,3)); | |
2396 | ||
2397 | // Im[Q_{2n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^*] | |
2398 | //Double_t imQ2nQ1nQ1nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe) | |
2399 | ||
2400 | // Re[Q_{2n} Q_{2n} Q_{2n}^* Q_{n}^* Q_{n}^*] | |
2401 | Double_t reQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2402 | * (dReQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) + 2.*dImQ2n*dReQ1n*dImQ1n); | |
2403 | ||
2404 | // Im[Q_{2n} Q_{2n} Q_{2n}^* Q_{n}^* Q_{n}^*] | |
2405 | //Double_t imQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2406 | // * (dImQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) - 2.*dReQ2n*dReQ1n*dImQ1n); | |
2407 | ||
2408 | // Re[Q_{4n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2409 | Double_t reQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dReQ4n-6.*pow(dReQ1n,2.)*dReQ4n*pow(dImQ1n,2.) | |
2410 | + pow(dImQ1n,4.)*dReQ4n+4.*pow(dReQ1n,3.)*dImQ1n*dImQ4n | |
2411 | - 4.*pow(dImQ1n,3.)*dReQ1n*dImQ4n; | |
2412 | ||
2413 | // Im[Q_{4n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2414 | //Double_t imQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dImQ4n-6.*pow(dReQ1n,2.)*dImQ4n*pow(dImQ1n,2.) | |
2415 | // + pow(dImQ1n,4.)*dImQ4n+4.*pow(dImQ1n,3.)*dReQ1n*dReQ4n | |
2416 | // - 4.*pow(dReQ1n,3.)*dImQ1n*dReQ4n; | |
2417 | ||
2418 | // Re[Q_{3n} Q_{n} Q_{2n}^* Q_{n}^* Q_{n}^*] | |
2419 | Double_t reQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2420 | * (dReQ1n*dReQ2n*dReQ3n-dReQ3n*dImQ1n*dImQ2n+dReQ2n*dImQ1n*dImQ3n+dReQ1n*dImQ2n*dImQ3n); | |
2421 | ||
2422 | // Im[Q_{3n} Q_{n} Q_{2n}^* Q_{n}^* Q_{n}^*] | |
2423 | //Double_t imQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2424 | // * (-dReQ2n*dReQ3n*dImQ1n-dReQ1n*dReQ3n*dImQ2n+dReQ1n*dReQ2n*dImQ3n-dImQ1n*dImQ2n*dImQ3n); | |
2425 | ||
2426 | ||
2427 | // Re[Q_{2n} Q_{2n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2428 | Double_t reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)*dReQ2n-2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.) | |
2429 | + dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dImQ2n) | |
2430 | * (pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.) | |
2431 | - dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n+pow(dImQ1n,2.)*dImQ2n); | |
2432 | ||
2433 | // Im[Q_{2n} Q_{2n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2434 | //Double_t imQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = 2.*(pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.) | |
2435 | // + 2.*dReQ1n*dImQ1n*dImQ2n)*(pow(dReQ1n,2.)*dImQ2n | |
2436 | // - 2.*dReQ1n*dImQ1n*dReQ2n-pow(dImQ1n,2.)*dImQ2n); | |
2437 | ||
2438 | // Re[Q_{3n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2439 | Double_t reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2440 | * (pow(dReQ1n,3.)*dReQ3n-3.*dReQ1n*dReQ3n*pow(dImQ1n,2.) | |
2441 | + 3.*pow(dReQ1n,2.)*dImQ1n*dImQ3n-pow(dImQ1n,3.)*dImQ3n); | |
2442 | ||
2443 | // Im[Q_{3n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2444 | //Double_t imQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2445 | // * (pow(dImQ1n,3.)*dReQ3n-3.*dImQ1n*dReQ3n*pow(dReQ1n,2.) | |
2446 | // - 3.*pow(dImQ1n,2.)*dReQ1n*dImQ3n+pow(dReQ1n,3.)*dImQ3n); | |
2447 | ||
2448 | // |Q_{2n}|^2 |Q_{n}|^4 | |
2449 | Double_t dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.); | |
2450 | ||
2451 | // Re[Q_{2n} Q_{n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2452 | Double_t reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
2453 | * (pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.) | |
2454 | + 2.*dReQ1n*dImQ1n*dImQ2n); | |
2455 | ||
2456 | // Im[Q_{2n} Q_{n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2457 | //Double_t imQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
2458 | // * (pow(dReQ1n,2.)*dImQ2n-dImQ2n*pow(dImQ1n,2.) | |
2459 | // - 2.*dReQ1n*dReQ2n*dImQ1n); | |
2460 | ||
2461 | ||
2462 | ||
2463 | ||
2464 | // ************************************** | |
2465 | // **** multi-particle correlations: **** | |
2466 | // ************************************** | |
2467 | // | |
8ed4edc7 | 2468 | // Remark 1: All multi-particle correlations calculated with non-weighted Q-vectors are stored in 1D profile fIntFlowCorrelationsAllPro; |
2469 | // Remark 2: There is a special profile fIntFlowCorrelationsPro holding results ONLY for same harmonic's <<2>>, <<4>>, <<6>> and <<8>>; | |
2470 | // Remark 3: Binning of fIntFlowCorrelationsAllPro is organized as follows: | |
489d5531 | 2471 | // -------------------------------------------------------------------------------------------------------------------- |
2472 | // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))> | |
2473 | // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))> | |
2474 | // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))> | |
2475 | // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))> | |
2476 | // 5th bin: ---- EMPTY ---- | |
2477 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))> | |
2478 | // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))> | |
2479 | // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))> | |
2480 | // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))> | |
2481 | // 10th bin: ---- EMPTY ---- | |
2482 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))> | |
2483 | // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))> | |
2484 | // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))> | |
2485 | // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))> | |
2486 | // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))> | |
2487 | // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))> | |
2488 | // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> | |
2489 | // 18th bin: ---- EMPTY ---- | |
2490 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))> | |
2491 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))> | |
2492 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))> | |
2493 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))> | |
2494 | // 23rd bin: ---- EMPTY ---- | |
2495 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> | |
2496 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))> | |
2497 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))> | |
2498 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))> | |
2499 | // 28th bin: ---- EMPTY ---- | |
2500 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> | |
2501 | // 30th bin: ---- EMPTY ---- | |
2502 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> | |
8ed4edc7 | 2503 | // 32nd bin: ---- EMPTY ---- |
2504 | // 33rd bin: <4>_{4n,2n|3n,3n}= four4n2n3n3n = <cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4))> | |
2505 | // 34th bin: <5>_{2n,2n,2n|3n,3n} = five2n2n2n3n3n = <cos(n*(2.*phi1+2.*phi2+2.*phi3-3.*phi4-3.*phi5))> | |
489d5531 | 2506 | // -------------------------------------------------------------------------------------------------------------------- |
2507 | ||
2508 | // 2-particle: | |
2509 | Double_t two1n1n = 0.; // <cos(n*(phi1-phi2))> | |
2510 | Double_t two2n2n = 0.; // <cos(2n*(phi1-phi2))> | |
2511 | Double_t two3n3n = 0.; // <cos(3n*(phi1-phi2))> | |
2512 | Double_t two4n4n = 0.; // <cos(4n*(phi1-phi2))> | |
2513 | ||
2514 | if(dMult>1) | |
2515 | { | |
2516 | two1n1n = (pow(dReQ1n,2.)+pow(dImQ1n,2.)-dMult)/(dMult*(dMult-1.)); | |
2517 | two2n2n = (pow(dReQ2n,2.)+pow(dImQ2n,2.)-dMult)/(dMult*(dMult-1.)); | |
2518 | two3n3n = (pow(dReQ3n,2.)+pow(dImQ3n,2.)-dMult)/(dMult*(dMult-1.)); | |
2519 | two4n4n = (pow(dReQ4n,2.)+pow(dImQ4n,2.)-dMult)/(dMult*(dMult-1.)); | |
2520 | ||
2521 | // average 2-particle correlations for single event: | |
2522 | fIntFlowCorrelationsAllEBE->SetBinContent(1,two1n1n); | |
2523 | fIntFlowCorrelationsAllEBE->SetBinContent(2,two2n2n); | |
2524 | fIntFlowCorrelationsAllEBE->SetBinContent(3,two3n3n); | |
2525 | fIntFlowCorrelationsAllEBE->SetBinContent(4,two4n4n); | |
2526 | ||
2527 | // average 2-particle correlations for all events: | |
2528 | fIntFlowCorrelationsAllPro->Fill(0.5,two1n1n,dMult*(dMult-1.)); | |
2529 | fIntFlowCorrelationsAllPro->Fill(1.5,two2n2n,dMult*(dMult-1.)); | |
2530 | fIntFlowCorrelationsAllPro->Fill(2.5,two3n3n,dMult*(dMult-1.)); | |
2531 | fIntFlowCorrelationsAllPro->Fill(3.5,two4n4n,dMult*(dMult-1.)); | |
2532 | ||
2533 | // store separetately <2> (to be improved: do I really need this?) | |
2534 | fIntFlowCorrelationsEBE->SetBinContent(1,two1n1n); // <2> | |
2535 | ||
2536 | // to be improved (this can be implemented better): | |
2537 | Double_t mWeight2p = 0.; | |
2538 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
2539 | { | |
2540 | mWeight2p = dMult*(dMult-1.); | |
2541 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
2542 | { | |
2543 | mWeight2p = 1.; | |
2544 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
2545 | { | |
2546 | mWeight2p = dMult; | |
2547 | } | |
2548 | ||
2549 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(1,mWeight2p); // eW_<2> | |
2550 | fIntFlowCorrelationsPro->Fill(0.5,two1n1n,mWeight2p); | |
b40a910e | 2551 | fIntFlowSquaredCorrelationsPro->Fill(0.5,two1n1n*two1n1n,mWeight2p); |
2552 | if(fCalculateCumulantsVsM) | |
2553 | { | |
2554 | fIntFlowCorrelationsVsMPro[0]->Fill(dMult+0.5,two1n1n,mWeight2p); | |
2555 | fIntFlowSquaredCorrelationsVsMPro[0]->Fill(dMult+0.5,two1n1n*two1n1n,mWeight2p); | |
2556 | } | |
489d5531 | 2557 | // distribution of <cos(n*(phi1-phi2))>: |
2558 | //f2pDistribution->Fill(two1n1n,dMult*(dMult-1.)); | |
2559 | } // end of if(dMult>1) | |
2560 | ||
2561 | // 3-particle: | |
2562 | Double_t three2n1n1n = 0.; // <cos(n*(2.*phi1-phi2-phi3))> | |
2563 | Double_t three3n2n1n = 0.; // <cos(n*(3.*phi1-2.*phi2-phi3))> | |
2564 | Double_t three4n2n2n = 0.; // <cos(n*(4.*phi1-2.*phi2-2.*phi3))> | |
2565 | Double_t three4n3n1n = 0.; // <cos(n*(4.*phi1-3.*phi2-phi3))> | |
2566 | ||
2567 | if(dMult>2) | |
2568 | { | |
2569 | three2n1n1n = (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2570 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult) | |
2571 | / (dMult*(dMult-1.)*(dMult-2.)); | |
2572 | three3n2n1n = (reQ3nQ2nstarQ1nstar-(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2573 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2574 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
2575 | / (dMult*(dMult-1.)*(dMult-2.)); | |
2576 | three4n2n2n = (reQ4nQ2nstarQ2nstar-2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2577 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*dMult) | |
2578 | / (dMult*(dMult-1.)*(dMult-2.)); | |
2579 | three4n3n1n = (reQ4nQ3nstarQ1nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
2580 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2581 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
2582 | / (dMult*(dMult-1.)*(dMult-2.)); | |
2583 | ||
2584 | // average 3-particle correlations for single event: | |
2585 | fIntFlowCorrelationsAllEBE->SetBinContent(6,three2n1n1n); | |
2586 | fIntFlowCorrelationsAllEBE->SetBinContent(7,three3n2n1n); | |
2587 | fIntFlowCorrelationsAllEBE->SetBinContent(8,three4n2n2n); | |
2588 | fIntFlowCorrelationsAllEBE->SetBinContent(9,three4n3n1n); | |
2589 | ||
2590 | // average 3-particle correlations for all events: | |
2591 | fIntFlowCorrelationsAllPro->Fill(5.5,three2n1n1n,dMult*(dMult-1.)*(dMult-2.)); | |
2592 | fIntFlowCorrelationsAllPro->Fill(6.5,three3n2n1n,dMult*(dMult-1.)*(dMult-2.)); | |
2593 | fIntFlowCorrelationsAllPro->Fill(7.5,three4n2n2n,dMult*(dMult-1.)*(dMult-2.)); | |
2594 | fIntFlowCorrelationsAllPro->Fill(8.5,three4n3n1n,dMult*(dMult-1.)*(dMult-2.)); | |
2595 | } // end of if(dMult>2) | |
2596 | ||
2597 | // 4-particle: | |
2598 | Double_t four1n1n1n1n = 0.; // <cos(n*(phi1+phi2-phi3-phi4))> | |
2599 | Double_t four2n2n2n2n = 0.; // <cos(2.*n*(phi1+phi2-phi3-phi4))> | |
2600 | Double_t four2n1n2n1n = 0.; // <cos(n*(2.*phi1+phi2-2.*phi3-phi4))> | |
2601 | Double_t four3n1n1n1n = 0.; // <cos(n*(3.*phi1-phi2-phi3-phi4))> | |
2602 | Double_t four4n2n1n1n = 0.; // <cos(n*(4.*phi1-2.*phi2-phi3-phi4))> | |
2603 | Double_t four3n1n2n2n = 0.; // <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))> | |
2604 | Double_t four3n1n3n1n = 0.; // <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> | |
2605 | ||
2606 | if(dMult>3) | |
2607 | { | |
2608 | four1n1n1n1n = (2.*dMult*(dMult-3.)+pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ1n,2.) | |
2609 | + pow(dImQ1n,2.))-2.*reQ2nQ1nstarQ1nstar+(pow(dReQ2n,2.)+pow(dImQ2n,2.))) | |
2610 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
2611 | four2n2n2n2n = (2.*dMult*(dMult-3.)+pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ2n,2.) | |
2612 | + pow(dImQ2n,2.))-2.*reQ4nQ2nstarQ2nstar+(pow(dReQ4n,2.)+pow(dImQ4n,2.))) | |
2613 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
2614 | four2n1n2n1n = (dQ2nQ1nQ2nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar-2.*reQ2nQ1nstarQ1nstar) | |
2615 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2616 | - ((dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2617 | + (dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-(pow(dReQ3n,2.)+pow(dImQ3n,2.))) | |
2618 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2619 | + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2620 | four3n1n1n1n = (reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar-3.*reQ2nQ1nstarQ1nstar) | |
2621 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2622 | + (2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2623 | + 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
2624 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2625 | four4n2n1n1n = (reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar-2.*reQ3nQ2nstarQ1nstar) | |
2626 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2627 | - (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2628 | - 3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
2629 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2630 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2631 | four3n1n2n2n = (reQ3nQ1nQ2nstarQ2nstar-reQ4nQ2nstarQ2nstar-reQ3nQ1nQ4nstar-2.*reQ3nQ2nstarQ1nstar) | |
2632 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2633 | - (2.*reQ1nQ1nQ2nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2634 | - 4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
2635 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2636 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2637 | four3n1n3n1n = ((pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2638 | - 2.*reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar) | |
2639 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2640 | + ((pow(dReQ4n,2.)+pow(dImQ4n,2.))-(dMult-4.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2641 | + (pow(dReQ2n,2.)+pow(dImQ2n,2.))-(dMult-4.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
2642 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2643 | + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2644 | ||
2645 | // average 4-particle correlations for single event: | |
2646 | fIntFlowCorrelationsAllEBE->SetBinContent(11,four1n1n1n1n); | |
2647 | fIntFlowCorrelationsAllEBE->SetBinContent(12,four2n1n2n1n); | |
2648 | fIntFlowCorrelationsAllEBE->SetBinContent(13,four2n2n2n2n); | |
2649 | fIntFlowCorrelationsAllEBE->SetBinContent(14,four3n1n1n1n); | |
2650 | fIntFlowCorrelationsAllEBE->SetBinContent(15,four3n1n3n1n); | |
2651 | fIntFlowCorrelationsAllEBE->SetBinContent(16,four3n1n2n2n); | |
2652 | fIntFlowCorrelationsAllEBE->SetBinContent(17,four4n2n1n1n); | |
2653 | ||
2654 | // average 4-particle correlations for all events: | |
2655 | fIntFlowCorrelationsAllPro->Fill(10.5,four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2656 | fIntFlowCorrelationsAllPro->Fill(11.5,four2n1n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2657 | fIntFlowCorrelationsAllPro->Fill(12.5,four2n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2658 | fIntFlowCorrelationsAllPro->Fill(13.5,four3n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2659 | fIntFlowCorrelationsAllPro->Fill(14.5,four3n1n3n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2660 | fIntFlowCorrelationsAllPro->Fill(15.5,four3n1n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2661 | fIntFlowCorrelationsAllPro->Fill(16.5,four4n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2662 | ||
2663 | // store separetately <4> (to be improved: do I really need this?) | |
2664 | fIntFlowCorrelationsEBE->SetBinContent(2,four1n1n1n1n); // <4> | |
2665 | ||
2666 | // to be improved (this can be implemented better): | |
2667 | Double_t mWeight4p = 0.; | |
2668 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
2669 | { | |
2670 | mWeight4p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
2671 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
2672 | { | |
2673 | mWeight4p = 1.; | |
2674 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
2675 | { | |
2676 | mWeight4p = dMult; | |
2677 | } | |
2678 | ||
2679 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(2,mWeight4p); // eW_<4> | |
2680 | fIntFlowCorrelationsPro->Fill(1.5,four1n1n1n1n,mWeight4p); | |
b40a910e | 2681 | fIntFlowSquaredCorrelationsPro->Fill(1.5,four1n1n1n1n*four1n1n1n1n,mWeight4p); |
2682 | if(fCalculateCumulantsVsM) | |
2683 | { | |
2684 | fIntFlowCorrelationsVsMPro[1]->Fill(dMult+0.5,four1n1n1n1n,mWeight4p); | |
2685 | fIntFlowSquaredCorrelationsVsMPro[1]->Fill(dMult+0.5,four1n1n1n1n*four1n1n1n1n,mWeight4p); | |
2686 | } | |
489d5531 | 2687 | // distribution of <cos(n*(phi1+phi2-phi3-phi4))> |
2688 | //f4pDistribution->Fill(four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2689 | ||
2690 | } // end of if(dMult>3) | |
2691 | ||
2692 | // 5-particle: | |
2693 | Double_t five2n1n1n1n1n = 0.; // <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))> | |
2694 | Double_t five2n2n2n1n1n = 0.; // <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))> | |
2695 | Double_t five3n1n2n1n1n = 0.; // <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))> | |
2696 | Double_t five4n1n1n1n1n = 0.; // <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))> | |
2697 | ||
2698 | if(dMult>4) | |
2699 | { | |
2700 | five2n1n1n1n1n = (reQ2nQ1nQ1nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar+6.*reQ3nQ2nstarQ1nstar) | |
2701 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2702 | - (reQ2nQ1nQ3nstar+3.*(dMult-6.)*reQ2nQ1nstarQ1nstar+3.*reQ1nQ1nQ2nstar) | |
2703 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2704 | - (2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2705 | + 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2706 | - 3.*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))) | |
2707 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2708 | - 3.*(pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
2709 | - 2.*(2*dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult*(dMult-4.)) | |
2710 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2711 | ||
2712 | five2n2n2n1n1n = (reQ2nQ2nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ2nQ2nQ3nstarQ1nstar) | |
2713 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2714 | + 2.*(reQ4nQ2nstarQ2nstar+4.*reQ3nQ2nstarQ1nstar+reQ3nQ1nQ4nstar) | |
2715 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2716 | + (reQ2nQ2nQ4nstar-2.*(dMult-5.)*reQ2nQ1nstarQ1nstar+2.*reQ1nQ1nQ2nstar) | |
2717 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2718 | - (2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2719 | + 1.*pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.) | |
2720 | - 2.*(3.*dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))) | |
2721 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2722 | - (4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2723 | - 4.*(dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+4.*dMult*(dMult-6.)) | |
2724 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2725 | ||
2726 | five4n1n1n1n1n = (reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ4nQ2nstarQ1nstarQ1nstar-4.*reQ3nQ1nstarQ1nstarQ1nstar) | |
2727 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2728 | + (8.*reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar+12.*reQ3nQ2nstarQ1nstar+12.*reQ2nQ1nstarQ1nstar) | |
2729 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2730 | - (6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+8.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2731 | + 12.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+24.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-24.*dMult) | |
2732 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2733 | ||
2734 | five3n1n2n1n1n = (reQ3nQ1nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar) | |
2735 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2736 | - (reQ3nQ1nQ2nstarQ2nstar-3.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar) | |
2737 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2738 | - ((2.*dMult-13.)*reQ3nQ2nstarQ1nstar-reQ3nQ1nQ4nstar-9.*reQ2nQ1nstarQ1nstar) | |
2739 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2740 | - (2.*reQ1nQ1nQ2nstar+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
2741 | - 2.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+2.*(pow(dReQ3n,2.) | |
2742 | + pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
2743 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2744 | + (2.*(dMult-6.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2745 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2746 | - pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
2747 | + 2.*(3.*dMult-11.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
2748 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2749 | - 4.*(dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2750 | ||
2751 | // average 5-particle correlations for single event: | |
2752 | fIntFlowCorrelationsAllEBE->SetBinContent(19,five2n1n1n1n1n); | |
2753 | fIntFlowCorrelationsAllEBE->SetBinContent(20,five2n2n2n1n1n); | |
2754 | fIntFlowCorrelationsAllEBE->SetBinContent(21,five3n1n2n1n1n); | |
2755 | fIntFlowCorrelationsAllEBE->SetBinContent(22,five4n1n1n1n1n); | |
2756 | ||
2757 | // average 5-particle correlations for all events: | |
2758 | fIntFlowCorrelationsAllPro->Fill(18.5,five2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2759 | fIntFlowCorrelationsAllPro->Fill(19.5,five2n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2760 | fIntFlowCorrelationsAllPro->Fill(20.5,five3n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2761 | fIntFlowCorrelationsAllPro->Fill(21.5,five4n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2762 | } // end of if(dMult>4) | |
2763 | ||
2764 | // 6-particle: | |
2765 | Double_t six1n1n1n1n1n1n = 0.; // <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> | |
2766 | Double_t six2n2n1n1n1n1n = 0.; // <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))> | |
2767 | Double_t six3n1n1n1n1n1n = 0.; // <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))> | |
2768 | Double_t six2n1n1n2n1n1n = 0.; // <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))> | |
2769 | ||
2770 | if(dMult>5) | |
2771 | { | |
2772 | six1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),3.)+9.*dQ2nQ1nQ2nstarQ1nstar-6.*reQ2nQ1nQ1nstarQ1nstarQ1nstar) | |
2773 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)) | |
2774 | + 4.*(reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar) | |
2775 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)) | |
2776 | + 2.*(9.*(dMult-4.)*reQ2nQ1nstarQ1nstar+2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))) | |
2777 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)) | |
2778 | - 9.*(pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)+(pow(dReQ2n,2.)+pow(dImQ2n,2.))) | |
2779 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-5.)) | |
2780 | + (18.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
2781 | / (dMult*(dMult-1)*(dMult-3)*(dMult-4)) | |
2782 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2783 | ||
2784 | six2n1n1n2n1n1n = (dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.) | |
2785 | * (2.*five2n2n2n1n1n+4.*five2n1n1n1n1n+4.*five3n1n2n1n1n+4.*four2n1n2n1n+1.*four1n1n1n1n) | |
2786 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four1n1n1n1n+4.*two1n1n | |
2787 | + 2.*three2n1n1n+2.*three2n1n1n+4.*four3n1n1n1n+8.*three2n1n1n+2.*four4n2n1n1n | |
2788 | + 4.*four2n1n2n1n+2.*two2n2n+8.*four2n1n2n1n+4.*four3n1n3n1n+8.*three3n2n1n | |
2789 | + 4.*four3n1n2n2n+4.*four1n1n1n1n+4.*four2n1n2n1n+1.*four2n2n2n2n) | |
2790 | - dMult*(dMult-1.)*(dMult-2.)*(2.*three2n1n1n+8.*two1n1n+4.*two1n1n+2. | |
2791 | + 4.*two1n1n+4.*three2n1n1n+2.*two2n2n+4.*three2n1n1n+8.*three3n2n1n | |
2792 | + 8.*two2n2n+4.*three4n3n1n+4.*two3n3n+4.*three3n2n1n+4.*two1n1n | |
2793 | + 8.*three2n1n1n+4.*two1n1n+4.*three3n2n1n+4.*three2n1n1n+2.*two2n2n | |
2794 | + 4.*three3n2n1n+2.*three4n2n2n)-dMult*(dMult-1.) | |
2795 | * (4.*two1n1n+4.+4.*two1n1n+2.*two2n2n+1.+4.*two1n1n+4.*two2n2n+4.*two3n3n | |
2796 | + 1.+2.*two2n2n+1.*two4n4n)-dMult) | |
2797 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed) | |
2798 | ||
2799 | six2n2n1n1n1n1n = (reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.) | |
2800 | * (five4n1n1n1n1n+8.*five2n1n1n1n1n+6.*five2n2n2n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) | |
2801 | * (4.*four3n1n1n1n+6.*four4n2n1n1n+12.*three2n1n1n+12.*four1n1n1n1n+24.*four2n1n2n1n | |
2802 | + 4.*four3n1n2n2n+3.*four2n2n2n2n)-dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+12.*three3n2n1n | |
2803 | + 4.*three4n3n1n+3.*three4n2n2n+8.*three2n1n1n+24.*two1n1n+12.*two2n2n+12.*three2n1n1n+8.*three3n2n1n | |
2804 | + 1.*three4n2n2n)-dMult*(dMult-1.)*(4.*two1n1n+6.*two2n2n+4.*two3n3n+1.*two4n4n+2.*two2n2n+8.*two1n1n+6.)-dMult) | |
2805 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed) | |
2806 | ||
2807 | six3n1n1n1n1n1n = (reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.) | |
2808 | * (five4n1n1n1n1n+4.*five2n1n1n1n1n+6.*five3n1n2n1n1n+4.*four3n1n1n1n) | |
2809 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four3n1n1n1n+6.*four4n2n1n1n+6.*four1n1n1n1n | |
2810 | + 12.*three2n1n1n+12.*four2n1n2n1n+6.*four3n1n1n1n+12.*three3n2n1n+4.*four3n1n3n1n+3.*four3n1n2n2n) | |
2811 | - dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+12.*three3n2n1n+4.*three4n3n1n+3.*three4n2n2n+4.*two1n1n | |
2812 | + 12.*two1n1n+6.*three2n1n1n+12.*three2n1n1n+4.*three3n2n1n+12.*two2n2n+4.*three3n2n1n+4.*two3n3n+1.*three4n3n1n | |
2813 | + 6.*three3n2n1n)-dMult*(dMult-1.)*(4.*two1n1n+6.*two2n2n+4.*two3n3n+1.*two4n4n+1.*two1n1n+4.+6.*two1n1n+4.*two2n2n | |
2814 | + 1.*two3n3n)-dMult)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed) | |
2815 | ||
2816 | // average 6-particle correlations for single event: | |
2817 | fIntFlowCorrelationsAllEBE->SetBinContent(24,six1n1n1n1n1n1n); | |
2818 | fIntFlowCorrelationsAllEBE->SetBinContent(25,six2n1n1n2n1n1n); | |
2819 | fIntFlowCorrelationsAllEBE->SetBinContent(26,six2n2n1n1n1n1n); | |
2820 | fIntFlowCorrelationsAllEBE->SetBinContent(27,six3n1n1n1n1n1n); | |
2821 | ||
2822 | // average 6-particle correlations for all events: | |
2823 | fIntFlowCorrelationsAllPro->Fill(23.5,six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
2824 | fIntFlowCorrelationsAllPro->Fill(24.5,six2n1n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
2825 | fIntFlowCorrelationsAllPro->Fill(25.5,six2n2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
2826 | fIntFlowCorrelationsAllPro->Fill(26.5,six3n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
2827 | ||
2828 | // store separetately <6> (to be improved: do I really need this?) | |
2829 | fIntFlowCorrelationsEBE->SetBinContent(3,six1n1n1n1n1n1n); // <6> | |
2830 | ||
2831 | // to be improved (this can be implemented better): | |
2832 | Double_t mWeight6p = 0.; | |
2833 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
2834 | { | |
2835 | mWeight6p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.); | |
2836 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
2837 | { | |
2838 | mWeight6p = 1.; | |
2839 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
2840 | { | |
2841 | mWeight6p = dMult; | |
2842 | } | |
2843 | ||
2844 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(3,mWeight6p); // eW_<6> | |
2845 | fIntFlowCorrelationsPro->Fill(2.5,six1n1n1n1n1n1n,mWeight6p); | |
b40a910e | 2846 | fIntFlowSquaredCorrelationsPro->Fill(2.5,six1n1n1n1n1n1n*six1n1n1n1n1n1n,mWeight6p); |
2847 | if(fCalculateCumulantsVsM) | |
2848 | { | |
2849 | fIntFlowCorrelationsVsMPro[2]->Fill(dMult+0.5,six1n1n1n1n1n1n,mWeight6p); | |
2850 | fIntFlowSquaredCorrelationsVsMPro[2]->Fill(dMult+0.5,six1n1n1n1n1n1n*six1n1n1n1n1n1n,mWeight6p); | |
2851 | } | |
489d5531 | 2852 | // distribution of <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> |
2853 | //f6pDistribution->Fill(six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
2854 | } // end of if(dMult>5) | |
2855 | ||
2856 | // 7-particle: | |
2857 | Double_t seven2n1n1n1n1n1n1n = 0.; // <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> | |
2858 | ||
2859 | if(dMult>6) | |
2860 | { | |
2861 | seven2n1n1n1n1n1n1n = (reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.) | |
2862 | * (2.*six3n1n1n1n1n1n+4.*six1n1n1n1n1n1n+1.*six2n2n1n1n1n1n+6.*six2n1n1n2n1n1n+8.*five2n1n1n1n1n) | |
2863 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(1.*five4n1n1n1n1n +8.*five2n1n1n1n1n+8.*four3n1n1n1n | |
2864 | + 12.*five3n1n2n1n1n+4.*five2n1n1n1n1n+3.*five2n2n2n1n1n+6.*five2n2n2n1n1n+6.*four1n1n1n1n+24.*four1n1n1n1n | |
2865 | + 12.*five2n1n1n1n1n+12.*five2n1n1n1n1n+12.*three2n1n1n+24.*four2n1n2n1n+4.*five3n1n2n1n1n+4.*five2n1n1n1n1n) | |
2866 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four3n1n1n1n+6.*four4n2n1n1n+12.*four1n1n1n1n+24.*three2n1n1n | |
2867 | + 24.*four2n1n2n1n+12.*four3n1n1n1n+24.*three3n2n1n+8.*four3n1n3n1n+6.*four3n1n2n2n+6.*three2n1n1n+12.*four1n1n1n1n | |
2868 | + 12.*four2n1n2n1n+6.*three2n1n1n+12.*four2n1n2n1n+4.*four3n1n2n2n+3.*four2n2n2n2n+4.*four1n1n1n1n+6.*three2n1n1n | |
2869 | + 24.*two1n1n+24.*four1n1n1n1n+4.*four3n1n1n1n+24.*two1n1n+24.*three2n1n1n+12.*two2n2n+24.*three2n1n1n+12.*four2n1n2n1n | |
2870 | + 8.*three3n2n1n+8.*four2n1n2n1n+1.*four4n2n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+1.*three2n1n1n+8.*two1n1n | |
2871 | + 12.*three3n2n1n+24.*two1n1n+12.*three2n1n1n+4.*three2n1n1n+8.*two1n1n+4.*three4n3n1n+24.*three2n1n1n+8.*three3n2n1n | |
2872 | + 12.*two1n1n+12.*two1n1n+3.*three4n2n2n+24.*two2n2n+6.*two2n2n+12.+12.*three3n2n1n+8.*two3n3n+12.*three2n1n1n+24.*two1n1n | |
2873 | + 4.*three3n2n1n+8.*three3n2n1n+2.*three4n3n1n+12.*two1n1n+8.*three2n1n1n+4.*three2n1n1n+2.*three3n2n1n+6.*two2n2n+8.*two2n2n | |
2874 | + 1.*three4n2n2n+4.*three3n2n1n+6.*three2n1n1n)-dMult*(dMult-1.)*(4.*two1n1n+2.*two1n1n+6.*two2n2n+8.+1.*two2n2n+4.*two3n3n | |
2875 | + 12.*two1n1n+4.*two1n1n+1.*two4n4n+8.*two2n2n+6.+2.*two3n3n+4.*two1n1n+1.*two2n2n)-dMult) | |
2876 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)); // to be improved (direct formula needed) | |
2877 | ||
2878 | // average 7-particle correlations for single event: | |
2879 | fIntFlowCorrelationsAllEBE->SetBinContent(29,seven2n1n1n1n1n1n1n); | |
2880 | ||
2881 | // average 7-particle correlations for all events: | |
2882 | fIntFlowCorrelationsAllPro->Fill(28.5,seven2n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)); | |
2883 | } // end of if(dMult>6) | |
2884 | ||
2885 | // 8-particle: | |
2886 | Double_t eight1n1n1n1n1n1n1n1n = 0.; // <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> | |
2887 | if(dMult>7) | |
2888 | { | |
2889 | eight1n1n1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),4.)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.) | |
2890 | * (12.*seven2n1n1n1n1n1n1n+16.*six1n1n1n1n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.) | |
2891 | * (8.*six3n1n1n1n1n1n+48.*six1n1n1n1n1n1n+6.*six2n2n1n1n1n1n+96.*five2n1n1n1n1n+72.*four1n1n1n1n+36.*six2n1n1n2n1n1n) | |
2892 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(2.*five4n1n1n1n1n+32.*five2n1n1n1n1n+36.*four1n1n1n1n | |
2893 | + 32.*four3n1n1n1n+48.*five2n1n1n1n1n+48.*five3n1n2n1n1n+144.*five2n1n1n1n1n+288.*four1n1n1n1n+36.*five2n2n2n1n1n | |
2894 | + 144.*three2n1n1n+96.*two1n1n+144.*four2n1n2n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) | |
2895 | * (8.*four3n1n1n1n+48.*four1n1n1n1n+12.*four4n2n1n1n+96.*four2n1n2n1n+96.*three2n1n1n+72.*three2n1n1n+144.*two1n1n | |
2896 | + 16.*four3n1n3n1n+48.*four3n1n1n1n+144.*four1n1n1n1n+72.*four1n1n1n1n+96.*three3n2n1n+24.*four3n1n2n2n+144.*four2n1n2n1n | |
2897 | + 288.*two1n1n+288.*three2n1n1n+9.*four2n2n2n2n+72.*two2n2n+24.)-dMult*(dMult-1.)*(dMult-2.)*(12.*three2n1n1n+16.*two1n1n | |
2898 | + 24.*three3n2n1n+48.*three2n1n1n+96.*two1n1n+8.*three4n3n1n+32.*three3n2n1n+96.*three2n1n1n+144.*two1n1n+6.*three4n2n2n | |
2899 | + 96.*two2n2n+36.*two2n2n+72.+48.*three3n2n1n+16.*two3n3n+72.*three2n1n1n+144.*two1n1n)-dMult*(dMult-1.)*(8.*two1n1n | |
2900 | + 12.*two2n2n+16.+8.*two3n3n+48.*two1n1n+1.*two4n4n+16.*two2n2n+18.)-dMult) | |
2901 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); // to be improved (direct formula needed) | |
2902 | ||
2903 | // average 8-particle correlations for single event: | |
2904 | fIntFlowCorrelationsAllEBE->SetBinContent(31,eight1n1n1n1n1n1n1n1n); | |
2905 | ||
2906 | // average 8-particle correlations for all events: | |
2907 | fIntFlowCorrelationsAllPro->Fill(30.5,eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); | |
2908 | ||
2909 | // store separetately <8> (to be improved: do I really need this?) | |
2910 | fIntFlowCorrelationsEBE->SetBinContent(4,eight1n1n1n1n1n1n1n1n); // <8> | |
2911 | ||
2912 | // to be improved (this can be implemented better): | |
2913 | Double_t mWeight8p = 0.; | |
2914 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
2915 | { | |
2916 | mWeight8p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.); | |
2917 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
2918 | { | |
2919 | mWeight8p = 1.; | |
2920 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
2921 | { | |
2922 | mWeight8p = dMult; | |
2923 | } | |
2924 | ||
2925 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(4,mWeight8p); // eW_<8> | |
b40a910e | 2926 | fIntFlowCorrelationsPro->Fill(3.5,eight1n1n1n1n1n1n1n1n,mWeight8p); |
2927 | fIntFlowSquaredCorrelationsPro->Fill(3.5,eight1n1n1n1n1n1n1n1n*eight1n1n1n1n1n1n1n1n,mWeight8p); | |
2928 | if(fCalculateCumulantsVsM) | |
2929 | { | |
2930 | fIntFlowCorrelationsVsMPro[3]->Fill(dMult+0.5,eight1n1n1n1n1n1n1n1n,mWeight8p); | |
2931 | fIntFlowSquaredCorrelationsVsMPro[3]->Fill(dMult+0.5,eight1n1n1n1n1n1n1n1n*eight1n1n1n1n1n1n1n1n,mWeight8p); | |
2932 | } | |
489d5531 | 2933 | // distribution of <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> |
2934 | //f8pDistribution->Fill(eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); | |
2935 | } // end of if(dMult>7) | |
2936 | ||
11d3e40e | 2937 | // EXTRA: // to be improved (reorganized) |
8ed4edc7 | 2938 | |
2939 | // 33rd bin: <4>_{4n,2n|3n,3n}= four4n2n3n3n = <cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4))> | |
2940 | // 34th bin: <5>_{2n,2n,2n|3n,3n} = five2n2n2n3n3n = <cos(n*(2.*phi1+2.*phi2+2.*phi3-3.*phi4-3.*phi5))> | |
2941 | ||
2942 | // 4-particle: | |
2943 | Double_t four4n2n3n3n = 0.; // <cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4))> | |
2944 | Double_t reQ4nQ2nQ3nstarQ3nstar = (dReQ4n*dReQ2n-dImQ4n*dImQ2n)*(dReQ3n*dReQ3n-dImQ3n*dImQ3n) | |
2945 | + 2.*(dReQ4n*dImQ2n+dImQ4n*dReQ2n)*dReQ3n*dImQ3n; | |
8ed4edc7 | 2946 | Double_t reQ6nQ4nstarQ2nstar = dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n |
2947 | + dImQ6n*dImQ4n*dReQ2n; | |
11d3e40e | 2948 | Double_t reQ6nQ3nstarQ3nstar = pow(dReQ3n,2.)*dReQ6n + 2.*dReQ3n*dImQ3n*dImQ6n |
2949 | - pow(dImQ3n,2.)*dReQ6n; | |
8ed4edc7 | 2950 | if(dMult>3.) |
2951 | { | |
11d3e40e | 2952 | four4n2n3n3n = (reQ4nQ2nQ3nstarQ3nstar-reQ6nQ4nstarQ2nstar-reQ6nQ3nstarQ3nstar |
2953 | - 2.*reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar | |
2954 | + (pow(dReQ6n,2.)+pow(dImQ6n,2.))+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
2955 | + 2.*(2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2956 | + (pow(dReQ1n,2.)+pow(dImQ1n,2.))-3.*dMult)) | |
2957 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2958 | ||
8ed4edc7 | 2959 | fIntFlowCorrelationsAllPro->Fill(32.5,four4n2n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
11d3e40e | 2960 | } // end of if(dMult>3.) |
8ed4edc7 | 2961 | |
2962 | // 5-particle: | |
2963 | Double_t five2n2n2n3n3n = 0.; // <cos(n*(2.*phi1+2.*phi2+2.*phi3-3.*phi4-3.*phi5))> | |
2964 | Double_t reQ2nQ2nQ2nQ3nstarQ3nstar = pow(dReQ2n,3.)*pow(dReQ3n,2.) | |
11d3e40e | 2965 | - 3.*dReQ2n*pow(dReQ3n,2.)*pow(dImQ2n,2.) |
2966 | + 6.*pow(dReQ2n,2.)*dReQ3n*dImQ2n*dImQ3n | |
2967 | - 2.*dReQ3n*pow(dImQ2n,3.)*dImQ3n-pow(dReQ2n,3.)*pow(dImQ3n,2.) | |
2968 | + 3.*dReQ2n*pow(dImQ2n,2.)*pow(dImQ3n,2.); | |
2969 | Double_t reQ2nQ2nQ2nQ6nstar = dReQ6n*pow(dReQ2n,3)-3.*dReQ2n*dReQ6n*pow(dImQ2n,2) | |
2970 | + 3.*dImQ2n*dImQ6n*pow(dReQ2n,2)-dImQ6n*pow(dImQ2n,3); | |
2971 | Double_t reQ2nQ2nQ1nstarQ3nstar = reQ3nQ1nQ2nstarQ2nstar; | |
2972 | Double_t reQ4nQ2nQ6nstar = reQ6nQ4nstarQ2nstar; | |
2973 | Double_t reQ4nQ1nstarQ3nstar = reQ3nQ1nQ4nstar; | |
8ed4edc7 | 2974 | if(dMult>4.) |
2975 | { | |
11d3e40e | 2976 | five2n2n2n3n3n = (reQ2nQ2nQ2nQ3nstarQ3nstar-reQ2nQ2nQ2nQ6nstar-3.*reQ4nQ2nQ3nstarQ3nstar |
2977 | - 6.*reQ2nQ2nQ1nstarQ3nstar+2.*reQ6nQ3nstarQ3nstar+3.*reQ4nQ2nQ6nstar | |
2978 | + 6.*reQ4nQ1nstarQ3nstar+6.*reQ2nQ2nQ4nstar | |
2979 | + 12.*reQ2nQ1nQ3nstar+6.*reQ2nQ1nstarQ1nstar | |
2980 | - 2.*((pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
2981 | + 3.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
2982 | + 6.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2983 | + 9.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2984 | + 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-12.*dMult)) | |
2985 | /(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2986 | ||
8ed4edc7 | 2987 | fIntFlowCorrelationsAllPro->Fill(33.5,five2n2n2n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
11d3e40e | 2988 | } // end of if(dMult>4.) |
8ed4edc7 | 2989 | |
489d5531 | 2990 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelations() |
2991 | ||
489d5531 | 2992 | //================================================================================================================================ |
2993 | ||
e5834fcb | 2994 | void AliFlowAnalysisWithQCumulants::StorePhiDistributionForOneEvent(AliFlowEventSimple *anEvent) |
2995 | { | |
2996 | // Store phi distribution for one event to illustrate flow. | |
2997 | ||
2998 | if(fPhiDistributionForOneEvent->GetEntries()>0){return;} // store only phi distribution for one event | |
2999 | ||
3000 | Double_t vMin = fPhiDistributionForOneEventSettings[0]; | |
3001 | Double_t vMax = fPhiDistributionForOneEventSettings[1]; | |
3002 | Double_t refMultMin = fPhiDistributionForOneEventSettings[2]; | |
3003 | Double_t refMultMax = fPhiDistributionForOneEventSettings[3]; | |
3004 | ||
3005 | Double_t vEBE = 0.; | |
3006 | Double_t cumulant4thEBE = fIntFlowCorrelationsEBE->GetBinContent(2)-2.*pow(fIntFlowCorrelationsEBE->GetBinContent(1),2.); | |
3007 | if(cumulant4thEBE<0.) | |
3008 | { | |
3009 | vEBE = pow(-1.*cumulant4thEBE,0.25); | |
3010 | if((vEBE>vMin && vEBE<vMax) && (fReferenceMultiplicityEBE>refMultMin && fReferenceMultiplicityEBE<refMultMax)) | |
3011 | { | |
3958eee6 | 3012 | fPhiDistributionForOneEvent->SetTitle(Form("v_{%i} = %f",fHarmonic,vEBE)); |
e5834fcb | 3013 | for(Int_t p=0;p<anEvent->NumberOfTracks();p++) |
3014 | { | |
3015 | if(anEvent->GetTrack(p)->InRPSelection()) | |
3016 | { | |
3017 | fPhiDistributionForOneEvent->Fill(anEvent->GetTrack(p)->Phi()); | |
3018 | } | |
3019 | } // end of for(Int_t p=0;p<anEvent->NumberOfTracks();p++) | |
3958eee6 | 3020 | } else |
3021 | { | |
3022 | fPhiDistributionForOneEvent->SetTitle(Form("v_{%i} = %f, out of specified boundaries",fHarmonic,vEBE)); | |
3023 | } | |
3024 | ||
e5834fcb | 3025 | } // end of if(cumulant4thEBE<0.) |
3026 | ||
3027 | } // end of void AliFlowAnalysisWithQCumulants::StorePhiDistributionForOneEvent(AliFlowEventSimple *anEvent) | |
3028 | ||
3029 | //================================================================================================================================ | |
489d5531 | 3030 | |
3031 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrelations() | |
3032 | { | |
0328db2d | 3033 | // Calculate averages of products of correlations for integrated flow. |
489d5531 | 3034 | |
2001bc3a | 3035 | // multiplicity: |
1268c371 | 3036 | Double_t dMult = (*fSpk)(0,0); |
2001bc3a | 3037 | |
489d5531 | 3038 | Int_t counter = 0; |
3039 | ||
3040 | for(Int_t ci1=1;ci1<4;ci1++) | |
3041 | { | |
3042 | for(Int_t ci2=ci1+1;ci2<=4;ci2++) | |
3043 | { | |
ff70ca91 | 3044 | fIntFlowProductOfCorrelationsPro->Fill(0.5+counter, |
3045 | fIntFlowCorrelationsEBE->GetBinContent(ci1)* | |
3046 | fIntFlowCorrelationsEBE->GetBinContent(ci2), | |
3047 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
3048 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); | |
3049 | // products versus multiplicity: // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>] | |
b3dacf6b | 3050 | if(fCalculateCumulantsVsM) |
3051 | { | |
3052 | fIntFlowProductOfCorrelationsVsMPro[counter]->Fill(dMult+0.5, // to be improved: dMult => sum of weights ? | |
3053 | fIntFlowCorrelationsEBE->GetBinContent(ci1)* | |
3054 | fIntFlowCorrelationsEBE->GetBinContent(ci2), | |
3055 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
3056 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); | |
3057 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 3058 | counter++; |
489d5531 | 3059 | } |
3060 | } | |
3061 | ||
3062 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrelations() | |
3063 | ||
3064 | ||
3065 | //================================================================================================================================ | |
3066 | ||
3067 | ||
0328db2d | 3068 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrectionTermsForNUA() |
3069 | { | |
3070 | // Calculate averages of products of correction terms for NUA. | |
3071 | ||
3072 | // a) Binning of fIntFlowProductOfCorrectionTermsForNUAPro is organized as follows: | |
3073 | // 1st bin: <<2><cos(phi)>> | |
3074 | // 2nd bin: <<2><sin(phi)>> | |
3075 | // 3rd bin: <<cos(phi)><sin(phi)>> | |
3076 | // 4th bin: <<2><cos(phi1+phi2)>> | |
3077 | // 5th bin: <<2><sin(phi1+phi2)>> | |
3078 | // 6th bin: <<2><cos(phi1-phi2-phi3)>> | |
3079 | // 7th bin: <<2><sin(phi1-phi2-phi3)>> | |
3080 | // 8th bin: <<4><cos(phi1)>> | |
3081 | // 9th bin: <<4><sin(phi1)>> | |
3082 | // 10th bin: <<4><cos(phi1+phi2)>> | |
3083 | // 11th bin: <<4><sin(phi1+phi2)>> | |
3084 | // 12th bin: <<4><cos(phi1-phi2-phi3)>> | |
3085 | // 13th bin: <<4><sin(phi1-phi2-phi3)>> | |
3086 | // 14th bin: <<cos(phi1)><cos(phi1+phi2)>> | |
3087 | // 15th bin: <<cos(phi1)><sin(phi1+phi2)>> | |
3088 | // 16th bin: <<cos(phi1)><cos(phi1-phi2-phi3)>> | |
3089 | // 17th bin: <<cos(phi1)><sin(phi1-phi2-phi3)>> | |
3090 | // 18th bin: <<sin(phi1)><cos(phi1+phi2)>> | |
3091 | // 19th bin: <<sin(phi1)><sin(phi1+phi2)>> | |
3092 | // 20th bin: <<sin(phi1)><cos(phi1-phi2-phi3)>> | |
3093 | // 21st bin: <<sin(phi1)><sin(phi1-phi2-phi3)>> | |
3094 | // 22nd bin: <<cos(phi1+phi2)><sin(phi1+phi2)>> | |
3095 | // 23rd bin: <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
3096 | // 24th bin: <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
3097 | // 25th bin: <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
3098 | // 26th bin: <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
3099 | // 27th bin: <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>> | |
3100 | ||
3101 | // <<2><cos(phi)>>: | |
3102 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(0.5, | |
3103 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1), | |
3104 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3105 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
3106 | // <<2><sin(phi)>>: | |
3107 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(1.5, | |
3108 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1), | |
3109 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3110 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
3111 | // <<cos(phi)><sin(phi)>>: | |
3112 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(2.5, | |
3113 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1), | |
3114 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3115 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
3116 | // <<2><cos(phi1+phi2)>>: | |
3117 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(3.5, | |
3118 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3119 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3120 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3121 | // <<2><sin(phi1+phi2)>>: | |
3122 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(4.5, | |
3123 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3124 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3125 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3126 | // <<2><cos(phi1-phi2-phi3)>>: | |
3127 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(5.5, | |
3128 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3129 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3130 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3131 | // <<2><sin(phi1-phi2-phi3)>>: | |
3132 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(6.5, | |
3133 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3134 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3135 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3136 | // <<4><cos(phi1)>>: | |
3137 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(7.5, | |
3138 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1), | |
3139 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3140 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
3141 | // <<4><sin(phi1)>>: | |
3142 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(8.5, | |
3143 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1), | |
3144 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3145 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
3146 | // <<4><cos(phi1+phi2)>>: | |
3147 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(9.5, | |
3148 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3149 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3150 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3151 | // <<4><sin(phi1+phi2)>>: | |
3152 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(10.5, | |
3153 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3154 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3155 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3156 | // <<4><cos(phi1-phi2-phi3)>>: | |
3157 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(11.5, | |
3158 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3159 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3160 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3161 | // <<4><sin(phi1-phi2-phi3)>>: | |
3162 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(12.5, | |
3163 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3164 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3165 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3166 | // <<cos(phi1)><cos(phi1+phi2)>>: | |
3167 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(13.5, | |
3168 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3169 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3170 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3171 | // <<cos(phi1)><sin(phi1+phi2)>>: | |
3172 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(14.5, | |
3173 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3174 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3175 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3176 | // <<cos(phi1)><cos(phi1-phi2-phi3)>>: | |
3177 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(15.5, | |
3178 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3179 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3180 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3181 | // <<cos(phi1)><sin(phi1-phi2-phi3)>>: | |
3182 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(16.5, | |
3183 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3184 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3185 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3186 | // <<sin(phi1)><cos(phi1+phi2)>>: | |
3187 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(17.5, | |
3188 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3189 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3190 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3191 | // <<sin(phi1)><sin(phi1+phi2)>>: | |
3192 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(18.5, | |
3193 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3194 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3195 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3196 | // <<sin(phi1)><cos(phi1-phi2-phi3)>>: | |
3197 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(19.5, | |
3198 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3199 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3200 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3201 | // <<sin(phi1)><sin(phi1-phi2-phi3)>>: | |
3202 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(20.5, | |
3203 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3204 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3205 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3206 | // <<cos(phi1+phi2)><sin(phi1+phi2)>>: | |
3207 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(21.5, | |
3208 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3209 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2) | |
3210 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3211 | // <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>>: | |
3212 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(22.5, | |
3213 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3214 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2) | |
3215 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3216 | // <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>>: | |
3217 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(23.5, | |
3218 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3219 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2) | |
3220 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3221 | // <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>>: | |
3222 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(24.5, | |
3223 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3224 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2) | |
3225 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3226 | // <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>>: | |
3227 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(25.5, | |
3228 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3229 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2) | |
3230 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3231 | // <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>>: | |
3232 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(26.5, | |
3233 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3234 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3) | |
3235 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3236 | ||
3237 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrectionTermsForNUA() | |
3238 | ||
0328db2d | 3239 | //================================================================================================================================ |
3240 | ||
489d5531 | 3241 | void AliFlowAnalysisWithQCumulants::CalculateCovariancesIntFlow() |
3242 | { | |
3243 | // a) Calculate unbiased estimators Cov(<2>,<4>), Cov(<2>,<6>), Cov(<2>,<8>), Cov(<4>,<6>), Cov(<4>,<8>) and Cov(<6>,<8>) | |
3244 | // for covariances V_(<2>,<4>), V_(<2>,<6>), V_(<2>,<8>), V_(<4>,<6>), V_(<4>,<8>) and V_(<6>,<8>). | |
3245 | // b) Store in histogram fIntFlowCovariances for instance the following: | |
3246 | // | |
3247 | // Cov(<2>,<4>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4>}_j)] | |
3248 | // | |
3249 | // where N is the number of events, w_{<2>} is event weight for <2> and w_{<4>} is event weight for <4>. | |
3250 | // c) Binning of fIntFlowCovariances is organized as follows: | |
3251 | // | |
3252 | // 1st bin: Cov(<2>,<4>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4>}_j)] | |
3253 | // 2nd bin: Cov(<2>,<6>) * (sum_{i=1}^{N} w_{<2>}_i w_{<6>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<6>}_j)] | |
3254 | // 3rd bin: Cov(<2>,<8>) * (sum_{i=1}^{N} w_{<2>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<8>}_j)] | |
3255 | // 4th bin: Cov(<4>,<6>) * (sum_{i=1}^{N} w_{<4>}_i w_{<6>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<6>}_j)] | |
3256 | // 5th bin: Cov(<4>,<8>) * (sum_{i=1}^{N} w_{<4>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<8>}_j)] | |
3257 | // 6th bin: Cov(<6>,<8>) * (sum_{i=1}^{N} w_{<6>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<6>}_i) * (sum_{j=1}^{N} w_{<8>}_j)] | |
b3dacf6b | 3258 | // |
489d5531 | 3259 | |
b3dacf6b | 3260 | // Average 2-, 4-, 6- and 8-particle correlations for all events: |
489d5531 | 3261 | Double_t correlation[4] = {0.}; |
3262 | for(Int_t ci=0;ci<4;ci++) | |
3263 | { | |
3264 | correlation[ci] = fIntFlowCorrelationsPro->GetBinContent(ci+1); | |
3265 | } | |
b3dacf6b | 3266 | // Average products of 2-, 4-, 6- and 8-particle correlations: |
489d5531 | 3267 | Double_t productOfCorrelations[4][4] = {{0.}}; |
3268 | Int_t productOfCorrelationsLabel = 1; | |
b3dacf6b | 3269 | // Denominators in the expressions for the unbiased estimator for covariance: |
489d5531 | 3270 | Double_t denominator[4][4] = {{0.}}; |
3271 | Int_t sumOfProductOfEventWeightsLabel1 = 1; | |
b3dacf6b | 3272 | // Weight dependent prefactor which multiply unbiased estimators for covariances: |
489d5531 | 3273 | Double_t wPrefactor[4][4] = {{0.}}; |
3274 | Int_t sumOfProductOfEventWeightsLabel2 = 1; | |
3275 | for(Int_t c1=0;c1<4;c1++) | |
3276 | { | |
3277 | for(Int_t c2=c1+1;c2<4;c2++) | |
3278 | { | |
3279 | productOfCorrelations[c1][c2] = fIntFlowProductOfCorrelationsPro->GetBinContent(productOfCorrelationsLabel); | |
b3dacf6b | 3280 | if(TMath::Abs(fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1)) > 1.e-44 && TMath::Abs(fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)) > 1.e-44) |
3281 | { | |
3282 | denominator[c1][c2] = 1.-(fIntFlowSumOfProductOfEventWeights->GetBinContent(sumOfProductOfEventWeightsLabel1)) | |
3283 | / (fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1) | |
3284 | * fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)); | |
3285 | wPrefactor[c1][c2] = fIntFlowSumOfProductOfEventWeights->GetBinContent(sumOfProductOfEventWeightsLabel2) | |
3286 | / (fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1) | |
3287 | * fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)); | |
489d5531 | 3288 | } |
b3dacf6b | 3289 | productOfCorrelationsLabel++; // to be improved - do I need here all 3 counters? |
489d5531 | 3290 | sumOfProductOfEventWeightsLabel1++; |
3291 | sumOfProductOfEventWeightsLabel2++; | |
b3dacf6b | 3292 | } // end of for(Int_t c2=c1+1;c2<4;c2++) |
3293 | } // end of for(Int_t c1=0;c1<4;c1++) | |
489d5531 | 3294 | |
489d5531 | 3295 | Int_t covarianceLabel = 1; |
3296 | for(Int_t c1=0;c1<4;c1++) | |
3297 | { | |
3298 | for(Int_t c2=c1+1;c2<4;c2++) | |
3299 | { | |
b3dacf6b | 3300 | if(TMath::Abs(denominator[c1][c2]) > 1.e-44) |
489d5531 | 3301 | { |
b3dacf6b | 3302 | // Covariances: |
489d5531 | 3303 | Double_t cov = (productOfCorrelations[c1][c2]-correlation[c1]*correlation[c2])/denominator[c1][c2]; |
b3dacf6b | 3304 | // Covariances multiplied with weight dependent prefactor: |
489d5531 | 3305 | Double_t wCov = cov * wPrefactor[c1][c2]; |
3306 | fIntFlowCovariances->SetBinContent(covarianceLabel,wCov); | |
3307 | } | |
3308 | covarianceLabel++; | |
b3dacf6b | 3309 | } // end of for(Int_t c2=c1+1;c2<4;c2++) |
3310 | } // end of for(Int_t c1=0;c1<4;c1++) | |
489d5531 | 3311 | |
b3dacf6b | 3312 | // Versus multiplicity: |
3313 | if(!fCalculateCumulantsVsM){return;} | |
9da1a4f3 | 3314 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) |
3315 | for(Int_t b=1;b<=nBins;b++) | |
3316 | { | |
b3dacf6b | 3317 | // Average 2-, 4-, 6- and 8-particle correlations for all events: |
9da1a4f3 | 3318 | Double_t correlationVsM[4] = {0.}; |
3319 | for(Int_t ci=0;ci<4;ci++) | |
3320 | { | |
3321 | correlationVsM[ci] = fIntFlowCorrelationsVsMPro[ci]->GetBinContent(b); | |
3322 | } // end of for(Int_t ci=0;ci<4;ci++) | |
b3dacf6b | 3323 | // Average products of 2-, 4-, 6- and 8-particle correlations: |
9da1a4f3 | 3324 | Double_t productOfCorrelationsVsM[4][4] = {{0.}}; |
3325 | Int_t productOfCorrelationsLabelVsM = 1; | |
b3dacf6b | 3326 | // Denominators in the expressions for the unbiased estimator for covariance: |
9da1a4f3 | 3327 | Double_t denominatorVsM[4][4] = {{0.}}; |
3328 | Int_t sumOfProductOfEventWeightsLabel1VsM = 1; | |
b3dacf6b | 3329 | // Weight dependent prefactor which multiply unbiased estimators for covariances: |
9da1a4f3 | 3330 | Double_t wPrefactorVsM[4][4] = {{0.}}; |
3331 | Int_t sumOfProductOfEventWeightsLabel2VsM = 1; | |
3332 | for(Int_t c1=0;c1<4;c1++) | |
3333 | { | |
3334 | for(Int_t c2=c1+1;c2<4;c2++) | |
3335 | { | |
3336 | productOfCorrelationsVsM[c1][c2] = fIntFlowProductOfCorrelationsVsMPro[productOfCorrelationsLabelVsM-1]->GetBinContent(b); | |
b3dacf6b | 3337 | if(TMath::Abs(fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b)) > 1.e-44 && TMath::Abs(fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)) > 1.e-44) |
3338 | { | |
3339 | denominatorVsM[c1][c2] = 1.-(fIntFlowSumOfProductOfEventWeightsVsM[sumOfProductOfEventWeightsLabel1VsM-1]->GetBinContent(b)) | |
3340 | / (fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b) | |
3341 | * fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)); | |
3342 | wPrefactorVsM[c1][c2] = fIntFlowSumOfProductOfEventWeightsVsM[sumOfProductOfEventWeightsLabel2VsM-1]->GetBinContent(b) | |
3343 | / (fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b) | |
3344 | * fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)); | |
9da1a4f3 | 3345 | } |
3346 | productOfCorrelationsLabelVsM++; | |
3347 | sumOfProductOfEventWeightsLabel1VsM++; | |
3348 | sumOfProductOfEventWeightsLabel2VsM++; | |
3349 | } // end of for(Int_t c1=0;c1<4;c1++) | |
3350 | } // end of for(Int_t c2=c1+1;c2<4;c2++) | |
b3dacf6b | 3351 | |
9da1a4f3 | 3352 | Int_t covarianceLabelVsM = 1; |
3353 | for(Int_t c1=0;c1<4;c1++) | |
3354 | { | |
3355 | for(Int_t c2=c1+1;c2<4;c2++) | |
3356 | { | |
b3dacf6b | 3357 | if(TMath::Abs(denominatorVsM[c1][c2]) > 1.e-44) |
9da1a4f3 | 3358 | { |
b3dacf6b | 3359 | // Covariances: |
9da1a4f3 | 3360 | Double_t covVsM = (productOfCorrelationsVsM[c1][c2]-correlationVsM[c1]*correlationVsM[c2])/denominatorVsM[c1][c2]; |
b3dacf6b | 3361 | // Covariances multiplied with weight dependent prefactor: |
9da1a4f3 | 3362 | Double_t wCovVsM = covVsM * wPrefactorVsM[c1][c2]; |
3363 | fIntFlowCovariancesVsM[covarianceLabelVsM-1]->SetBinContent(b,wCovVsM); | |
3364 | } | |
3365 | covarianceLabelVsM++; | |
b3dacf6b | 3366 | } // end of for(Int_t c2=c1+1;c2<4;c2++) |
3367 | } // end of for(Int_t c1=0;c1<4;c1++) | |
9da1a4f3 | 3368 | } // end of for(Int_t b=1;b<=nBins;b++) |
3369 | ||
489d5531 | 3370 | } // end of AliFlowAnalysisWithQCumulants::CalculateCovariancesIntFlow() |
3371 | ||
489d5531 | 3372 | //================================================================================================================================ |
3373 | ||
0328db2d | 3374 | void AliFlowAnalysisWithQCumulants::CalculateCovariancesNUAIntFlow() |
3375 | { | |
3376 | // a) Calculate unbiased estimators Cov(*,*) for true covariances V_(*,*) for NUA terms. | |
3377 | // b) Store in histogram fIntFlowCovariancesNUA for instance the following: | |
3378 | // | |
3379 | // Cov(<2>,<cos(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<cos(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<cos(phi)>}_j)] | |
3380 | // | |
3381 | // where N is the number of events, w_{<2>} is event weight for <2> and w_{<cos(phi)>} is event weight for <cos(phi)>. | |
3382 | // c) Binning of fIntFlowCovariancesNUA is organized as follows: | |
3383 | // | |
3384 | // 1st bin: Cov(<2>,<cos(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<cos(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<cos(phi)>}_j)] | |
3385 | // 2nd bin: Cov(<2>,<sin(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<sin(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<sin(phi)>}_j)] | |
3386 | // 3rd bin: Cov(<cos(phi)>,<sin(phi)>) * (sum_{i=1}^{N} w_{<cos(phi)>}_i w_{<sin(phi)>}_i )/[(sum_{i=1}^{N} w_{<cos(phi)>}_i) * (sum_{j=1}^{N} w_{<sin(phi)>}_j)] | |
3387 | // ... | |
3388 | ||
3389 | // Cov(<2>,<cos(phi)>): | |
3390 | Double_t product1 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(1); // <<2><cos(phi)>> | |
3391 | Double_t term1st1 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
3392 | Double_t term2nd1 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi)>> | |
3393 | Double_t sumOfW1st1 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
3394 | Double_t sumOfW2nd1 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi)>} | |
3395 | Double_t sumOfWW1 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(1); // W_{<2>} * W_{<cos(phi)>} | |
3396 | // numerator in the expression for the the unbiased estimator for covariance: | |
3397 | Double_t numerator1 = product1 - term1st1*term2nd1; | |
3398 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3399 | Double_t denominator1 = 0.; |
3400 | if(TMath::Abs(sumOfW1st1*sumOfW2nd1)>0.) | |
3401 | { | |
3402 | denominator1 = 1.-sumOfWW1/(sumOfW1st1*sumOfW2nd1); | |
3403 | if(TMath::Abs(denominator1)>0.) | |
3404 | { | |
3405 | // covariance: | |
3406 | Double_t covariance1 = numerator1/denominator1; | |
3407 | // weight dependent prefactor for covariance: | |
3408 | Double_t wPrefactor1 = sumOfWW1/(sumOfW1st1*sumOfW2nd1); | |
3409 | // finally, store "weighted" covariance: | |
3410 | fIntFlowCovariancesNUA->SetBinContent(1,wPrefactor1*covariance1); | |
3411 | } // end of if(TMath::Abs(denominator)>0.) | |
3412 | } // end of if(TMath::Abs(sumOfW1st1*sumOfW2nd1)>0.) | |
3413 | ||
0328db2d | 3414 | // Cov(<2>,<sin(phi)>): |
3415 | Double_t product2 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(2); // <<2><sin(phi)>> | |
3416 | Double_t term1st2 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
3417 | Double_t term2nd2 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi)>> | |
3418 | Double_t sumOfW1st2 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
3419 | Double_t sumOfW2nd2 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi)>} | |
3420 | Double_t sumOfWW2 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(2); // W_{<2>} * W_{<sin(phi)>} | |
3421 | // numerator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3422 | Double_t numerator2 = product2 - term1st2*term2nd2; |
0328db2d | 3423 | // denominator in the expression for the the unbiased estimator for covariance: |
b92ea2b9 | 3424 | Double_t denominator2 = 0.; |
3425 | if(TMath::Abs(sumOfW1st2*sumOfW2nd2)>0.) | |
3426 | { | |
3427 | denominator2 = 1.-sumOfWW2/(sumOfW1st2*sumOfW2nd2); | |
3428 | if(TMath::Abs(denominator2)>0.) | |
3429 | { | |
3430 | // covariance: | |
3431 | Double_t covariance2 = numerator2/denominator2; | |
3432 | // weight dependent prefactor for covariance: | |
3433 | Double_t wPrefactor2 = sumOfWW2/(sumOfW1st2*sumOfW2nd2); | |
3434 | // finally, store "weighted" covariance: | |
3435 | fIntFlowCovariancesNUA->SetBinContent(2,wPrefactor2*covariance2); | |
3436 | } // end of if(TMath::Abs(denominator2)>0.) | |
3437 | } // end of if(TMath::Abs(sumOfW1st2*sumOfW2nd2)>0.) | |
0328db2d | 3438 | |
3439 | // Cov(<cos(phi)>,<sin(phi)>): | |
3440 | Double_t product3 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(3); // <<cos(phi)><sin(phi)>> | |
3441 | Double_t term1st3 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi)>> | |
3442 | Double_t term2nd3 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi)>> | |
3443 | Double_t sumOfW1st3 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi)>} | |
3444 | Double_t sumOfW2nd3 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi)>} | |
3445 | Double_t sumOfWW3 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(3); // W_{<cos(phi)>} * W_{<sin(phi)>} | |
3446 | // numerator in the expression for the the unbiased estimator for covariance: | |
3447 | Double_t numerator3 = product3 - term1st3*term2nd3; | |
3448 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3449 | Double_t denominator3 = 0; |
3450 | if(TMath::Abs(sumOfW1st3*sumOfW2nd3)>0.) | |
3451 | { | |
3452 | denominator3 = 1.-sumOfWW3/(sumOfW1st3*sumOfW2nd3); | |
3453 | if(TMath::Abs(denominator3)>0.) | |
3454 | { | |
3455 | // covariance: | |
3456 | Double_t covariance3 = numerator3/denominator3; | |
3457 | // weight dependent prefactor for covariance: | |
3458 | Double_t wPrefactor3 = sumOfWW3/(sumOfW1st3*sumOfW2nd3); | |
3459 | // finally, store "weighted" covariance: | |
3460 | fIntFlowCovariancesNUA->SetBinContent(3,wPrefactor3*covariance3); | |
3461 | } // end of if(TMath::Abs(denominator3)>0.) | |
3462 | } // end of if(TMath::Abs(sumOfW1st3*sumOfW2nd3)>0.) | |
0328db2d | 3463 | |
3464 | // Cov(<2>,<cos(phi1+phi2)>): | |
3465 | Double_t product4 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(4); // <<2><cos(phi1+phi2)>> | |
3466 | Double_t term1st4 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
3467 | Double_t term2nd4 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
3468 | Double_t sumOfW1st4 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
3469 | Double_t sumOfW2nd4 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
3470 | Double_t sumOfWW4 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(4); // W_{<2>} * W_{<cos(phi1+phi2)>} | |
3471 | // numerator in the expression for the the unbiased estimator for covariance: | |
3472 | Double_t numerator4 = product4 - term1st4*term2nd4; | |
3473 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3474 | Double_t denominator4 = 0.; |
3475 | if(TMath::Abs(sumOfW1st4*sumOfW2nd4)>0.) | |
3476 | { | |
3477 | denominator4 = 1.-sumOfWW4/(sumOfW1st4*sumOfW2nd4); | |
3478 | if(TMath::Abs(denominator4)>0.) | |
3479 | { | |
3480 | // covariance: | |
3481 | Double_t covariance4 = numerator4/denominator4; | |
3482 | // weight dependent prefactor for covariance: | |
3483 | Double_t wPrefactor4 = sumOfWW4/(sumOfW1st4*sumOfW2nd4); | |
3484 | // finally, store "weighted" covariance: | |
3485 | fIntFlowCovariancesNUA->SetBinContent(4,wPrefactor4*covariance4); | |
3486 | } // end of if(TMath::Abs(denominator4)>0.) | |
3487 | } // end of if(TMath::Abs(sumOfW1st4*sumOfW2nd4)>0.) | |
3488 | ||
0328db2d | 3489 | // Cov(<2>,<sin(phi1+phi2)>): |
3490 | Double_t product5 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(5); // <<2><sin(phi1+phi2)>> | |
3491 | Double_t term1st5 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
3492 | Double_t term2nd5 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
3493 | Double_t sumOfW1st5 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
3494 | Double_t sumOfW2nd5 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
3495 | Double_t sumOfWW5 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(5); // W_{<2>} * W_{<sin(phi1+phi2)>} | |
3496 | // numerator in the expression for the the unbiased estimator for covariance: | |
3497 | Double_t numerator5 = product5 - term1st5*term2nd5; | |
3498 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3499 | Double_t denominator5 = 0.; |
3500 | if(TMath::Abs(sumOfW1st5*sumOfW2nd5)>0.) | |
3501 | { | |
3502 | denominator5 = 1.-sumOfWW5/(sumOfW1st5*sumOfW2nd5); | |
3503 | if(TMath::Abs(denominator5)>0.) | |
3504 | { | |
3505 | // covariance: | |
3506 | Double_t covariance5 = numerator5/denominator5; | |
3507 | // weight dependent prefactor for covariance: | |
3508 | Double_t wPrefactor5 = sumOfWW5/(sumOfW1st5*sumOfW2nd5); | |
3509 | // finally, store "weighted" covariance: | |
3510 | fIntFlowCovariancesNUA->SetBinContent(5,wPrefactor5*covariance5); | |
3511 | } // end of if(TMath::Abs(denominator5)>0.) | |
3512 | } // end of if(TMath::Abs(sumOfW1st5*sumOfW2nd5)>0.) | |
3513 | ||
0328db2d | 3514 | // Cov(<2>,<cos(phi1-phi2-phi3)>): |
3515 | Double_t product6 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(6); // <<2><cos(phi1-phi2-phi3)>> | |
3516 | Double_t term1st6 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
3517 | Double_t term2nd6 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
3518 | Double_t sumOfW1st6 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
3519 | Double_t sumOfW2nd6 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
3520 | Double_t sumOfWW6 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(6); // W_{<2>} * W_{<cos(phi1-phi2-phi3)>} | |
3521 | // numerator in the expression for the the unbiased estimator for covariance: | |
3522 | Double_t numerator6 = product6 - term1st6*term2nd6; | |
3523 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3524 | Double_t denominator6 = 0.; |
3525 | if(TMath::Abs(sumOfW1st6*sumOfW2nd6)>0.) | |
3526 | { | |
3527 | denominator6 = 1.-sumOfWW6/(sumOfW1st6*sumOfW2nd6); | |
3528 | if(TMath::Abs(denominator6)>0.) | |
3529 | { | |
3530 | // covariance: | |
3531 | Double_t covariance6 = numerator6/denominator6; | |
3532 | // weight dependent prefactor for covariance: | |
3533 | Double_t wPrefactor6 = sumOfWW6/(sumOfW1st6*sumOfW2nd6); | |
3534 | // finally, store "weighted" covariance: | |
3535 | fIntFlowCovariancesNUA->SetBinContent(6,wPrefactor6*covariance6); | |
3536 | } // end of if(TMath::Abs(denominator6)>0.) | |
3537 | } // end of if(TMath::Abs(sumOfW1st6*sumOfW2nd6)>0.) | |
3538 | ||
0328db2d | 3539 | // Cov(<2>,<sin(phi1-phi2-phi3)>): |
3540 | Double_t product7 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(7); // <<2><sin(phi1-phi2-phi3)>> | |
3541 | Double_t term1st7 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
3542 | Double_t term2nd7 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
3543 | Double_t sumOfW1st7 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
3544 | Double_t sumOfW2nd7 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
3545 | Double_t sumOfWW7 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(7); // W_{<2>} * W_{<sin(phi1-phi2-phi3)>} | |
3546 | // numerator in the expression for the the unbiased estimator for covariance: | |
3547 | Double_t numerator7 = product7 - term1st7*term2nd7; | |
3548 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3549 | Double_t denominator7 = 0.; |
3550 | if(TMath::Abs(sumOfW1st7*sumOfW2nd7)>0.) | |
3551 | { | |
3552 | denominator7 = 1.-sumOfWW7/(sumOfW1st7*sumOfW2nd7); | |
3553 | if(TMath::Abs(denominator7)>0.) | |
3554 | { | |
3555 | // covariance: | |
3556 | Double_t covariance7 = numerator7/denominator7; | |
3557 | // weight dependent prefactor for covariance: | |
3558 | Double_t wPrefactor7 = sumOfWW7/(sumOfW1st7*sumOfW2nd7); | |
3559 | // finally, store "weighted" covariance: | |
3560 | fIntFlowCovariancesNUA->SetBinContent(7,wPrefactor7*covariance7); | |
3561 | } // end of if(TMath::Abs(denominator7)>0.) | |
3562 | } // end of if(TMath::Abs(sumOfW1st7*sumOfW2nd7)>0.) | |
3563 | ||
0328db2d | 3564 | // Cov(<4>,<cos(phi1>): |
3565 | Double_t product8 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(8); // <<4><cos(phi1)>> | |
3566 | Double_t term1st8 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
3567 | Double_t term2nd8 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
3568 | Double_t sumOfW1st8 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
3569 | Double_t sumOfW2nd8 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
3570 | Double_t sumOfWW8 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(8); // W_{<4>} * W_{<cos(phi1)>} | |
3571 | // numerator in the expression for the the unbiased estimator for covariance: | |
3572 | Double_t numerator8 = product8 - term1st8*term2nd8; | |
3573 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3574 | Double_t denominator8 = 0.; |
3575 | if(TMath::Abs(sumOfW1st8*sumOfW2nd8)>0.) | |
3576 | { | |
3577 | denominator8 = 1.-sumOfWW8/(sumOfW1st8*sumOfW2nd8); | |
3578 | if(TMath::Abs(denominator8)>0.) | |
3579 | { | |
3580 | // covariance: | |
3581 | Double_t covariance8 = numerator8/denominator8; | |
3582 | // weight dependent prefactor for covariance: | |
3583 | Double_t wPrefactor8 = sumOfWW8/(sumOfW1st8*sumOfW2nd8); | |
3584 | // finally, store "weighted" covariance: | |
3585 | fIntFlowCovariancesNUA->SetBinContent(8,wPrefactor8*covariance8); | |
3586 | } // end of if(TMath::Abs(denominator8)>0.) | |
3587 | } // end of if(TMath::Abs(sumOfW1st8*sumOfW2nd8)>0.) | |
3588 | ||
0328db2d | 3589 | // Cov(<4>,<sin(phi1)>): |
3590 | Double_t product9 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(9); // <<4><sin(phi1)>> | |
3591 | Double_t term1st9 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
3592 | Double_t term2nd9 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
3593 | Double_t sumOfW1st9 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
3594 | Double_t sumOfW2nd9 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
3595 | Double_t sumOfWW9 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(9); // W_{<4>} * W_{<sin(phi1)>} | |
3596 | // numerator in the expression for the the unbiased estimator for covariance: | |
3597 | Double_t numerator9 = product9 - term1st9*term2nd9; | |
3598 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3599 | Double_t denominator9 = 0.; |
3600 | if(TMath::Abs(sumOfW1st9*sumOfW2nd9)>0.) | |
3601 | { | |
3602 | denominator9 = 1.-sumOfWW9/(sumOfW1st9*sumOfW2nd9); | |
3603 | if(TMath::Abs(denominator9)>0.) | |
3604 | { | |
3605 | // covariance: | |
3606 | Double_t covariance9 = numerator9/denominator9; | |
3607 | // weight dependent prefactor for covariance: | |
3608 | Double_t wPrefactor9 = sumOfWW9/(sumOfW1st9*sumOfW2nd9); | |
3609 | // finally, store "weighted" covariance: | |
3610 | fIntFlowCovariancesNUA->SetBinContent(9,wPrefactor9*covariance9); | |
3611 | } | |
3612 | } // end of if(TMath::Abs(sumOfW1st9*sumOfW2nd9)>0.) | |
3613 | ||
0328db2d | 3614 | // Cov(<4>,<cos(phi1+phi2)>): |
3615 | Double_t product10 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(10); // <<4><cos(phi1+phi2)>> | |
3616 | Double_t term1st10 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
3617 | Double_t term2nd10 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
3618 | Double_t sumOfW1st10 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
3619 | Double_t sumOfW2nd10 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
3620 | Double_t sumOfWW10 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(10); // W_{<4>} * W_{<cos(phi1+phi2)>} | |
3621 | // numerator in the expression for the the unbiased estimator for covariance: | |
3622 | Double_t numerator10 = product10 - term1st10*term2nd10; | |
3623 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3624 | Double_t denominator10 = 0.; |
3625 | if(TMath::Abs(sumOfW1st10*sumOfW2nd10)>0.) | |
3626 | { | |
3627 | denominator10 = 1.-sumOfWW10/(sumOfW1st10*sumOfW2nd10); | |
3628 | if(TMath::Abs(denominator10)>0.) | |
3629 | { | |
3630 | // covariance: | |
3631 | Double_t covariance10 = numerator10/denominator10; | |
3632 | // weight dependent prefactor for covariance: | |
3633 | Double_t wPrefactor10 = sumOfWW10/(sumOfW1st10*sumOfW2nd10); | |
3634 | // finally, store "weighted" covariance: | |
3635 | fIntFlowCovariancesNUA->SetBinContent(10,wPrefactor10*covariance10); | |
3636 | } // end of if(TMath::Abs(denominator10)>0.) | |
3637 | } // end of if(TMath::Abs(sumOfW1st10*sumOfW2nd10)>0.) | |
3638 | ||
0328db2d | 3639 | // Cov(<4>,<sin(phi1+phi2)>): |
3640 | Double_t product11 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(11); // <<4><sin(phi1+phi2)>> | |
3641 | Double_t term1st11 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
3642 | Double_t term2nd11 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
3643 | Double_t sumOfW1st11 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
3644 | Double_t sumOfW2nd11 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
3645 | Double_t sumOfWW11 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(11); // W_{<4>} * W_{<sin(phi1+phi2)>} | |
3646 | // numerator in the expression for the the unbiased estimator for covariance: | |
3647 | Double_t numerator11 = product11 - term1st11*term2nd11; | |
3648 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3649 | Double_t denominator11 = 0.; |
3650 | if(TMath::Abs(sumOfW1st11*sumOfW2nd11)>0.) | |
3651 | { | |
3652 | denominator11 = 1.-sumOfWW11/(sumOfW1st11*sumOfW2nd11); | |
3653 | if(TMath::Abs(denominator11)>0.) | |
3654 | { | |
3655 | // covariance: | |
3656 | Double_t covariance11 = numerator11/denominator11; | |
3657 | // weight dependent prefactor for covariance: | |
3658 | Double_t wPrefactor11 = sumOfWW11/(sumOfW1st11*sumOfW2nd11); | |
3659 | // finally, store "weighted" covariance: | |
3660 | fIntFlowCovariancesNUA->SetBinContent(11,wPrefactor11*covariance11); | |
3661 | } // end of if(TMath::Abs(denominator11)>0.) | |
3662 | } // end of if(TMath::Abs(sumOfW1st11*sumOfW2nd11)>0.) | |
0328db2d | 3663 | |
3664 | // Cov(<4>,<cos(phi1-phi2-phi3)>): | |
3665 | Double_t product12 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(12); // <<4><cos(phi1-phi2-phi3)>> | |
3666 | Double_t term1st12 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
3667 | Double_t term2nd12 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
3668 | Double_t sumOfW1st12 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
3669 | Double_t sumOfW2nd12 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
3670 | Double_t sumOfWW12 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(12); // W_{<4>} * W_{<cos(phi1-phi2-phi3)>} | |
3671 | // numerator in the expression for the the unbiased estimator for covariance: | |
3672 | Double_t numerator12 = product12 - term1st12*term2nd12; | |
3673 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3674 | Double_t denominator12 = 0.; |
3675 | if(TMath::Abs(sumOfW1st12*sumOfW2nd12)>0.) | |
3676 | { | |
3677 | denominator12 = 1.-sumOfWW12/(sumOfW1st12*sumOfW2nd12); | |
3678 | if(TMath::Abs(denominator12)>0.) | |
3679 | { | |
3680 | // covariance: | |
3681 | Double_t covariance12 = numerator12/denominator12; | |
3682 | // weight dependent prefactor for covariance: | |
3683 | Double_t wPrefactor12 = sumOfWW12/(sumOfW1st12*sumOfW2nd12); | |
3684 | // finally, store "weighted" covariance: | |
3685 | fIntFlowCovariancesNUA->SetBinContent(12,wPrefactor12*covariance12); | |
3686 | } // end of if(TMath::Abs(denominator12)>0.) | |
3687 | } // end of if(TMath::Abs(sumOfW1st12*sumOfW2nd12)>0.) | |
0328db2d | 3688 | |
3689 | // Cov(<4>,<sin(phi1-phi2-phi3)>): | |
3690 | Double_t product13 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(13); // <<4><sin(phi1-phi2-phi3)>> | |
3691 | Double_t term1st13 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
3692 | Double_t term2nd13 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
3693 | Double_t sumOfW1st13 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
3694 | Double_t sumOfW2nd13 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
3695 | Double_t sumOfWW13 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(13); // W_{<4>} * W_{<sin(phi1-phi2-phi3)>} | |
3696 | // numerator in the expression for the the unbiased estimator for covariance: | |
3697 | Double_t numerator13 = product13 - term1st13*term2nd13; | |
3698 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3699 | Double_t denominator13 = 0.; |
3700 | if(TMath::Abs(sumOfW1st13*sumOfW2nd13)>0.) | |
3701 | { | |
3702 | denominator13 = 1.-sumOfWW13/(sumOfW1st13*sumOfW2nd13); | |
3703 | if(TMath::Abs(denominator13)>0.) | |
3704 | { | |
3705 | // covariance: | |
3706 | Double_t covariance13 = numerator13/denominator13; | |
3707 | // weight dependent prefactor for covariance: | |
3708 | Double_t wPrefactor13 = sumOfWW13/(sumOfW1st13*sumOfW2nd13); | |
3709 | // finally, store "weighted" covariance: | |
3710 | fIntFlowCovariancesNUA->SetBinContent(13,wPrefactor13*covariance13); | |
3711 | } // end of if(TMath::Abs(denominator13)>0.) | |
3712 | } // end of if(TMath::Abs(sumOfW1st13*sumOfW2nd13)>0.) | |
0328db2d | 3713 | |
3714 | // Cov(<cos(phi1)>,<cos(phi1+phi2)>): | |
3715 | Double_t product14 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(14); // <<cos(phi1)><cos(phi1+phi2)>> | |
3716 | Double_t term1st14 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
3717 | Double_t term2nd14 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
3718 | Double_t sumOfW1st14 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
3719 | Double_t sumOfW2nd14 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
3720 | Double_t sumOfWW14 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(14); // W_{<cos(phi1)>} * W_{<cos(phi1+phi2)>} | |
3721 | // numerator in the expression for the the unbiased estimator for covariance: | |
3722 | Double_t numerator14 = product14 - term1st14*term2nd14; | |
3723 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3724 | Double_t denominator14 = 0.; |
3725 | if(TMath::Abs(sumOfW1st14*sumOfW2nd14)>0.) | |
3726 | { | |
3727 | denominator14 = 1.-sumOfWW14/(sumOfW1st14*sumOfW2nd14); | |
3728 | if(TMath::Abs(denominator14)>0.) | |
3729 | { | |
3730 | // covariance: | |
3731 | Double_t covariance14 = numerator14/denominator14; | |
3732 | // weight dependent prefactor for covariance: | |
3733 | Double_t wPrefactor14 = sumOfWW14/(sumOfW1st14*sumOfW2nd14); | |
3734 | // finally, store "weighted" covariance: | |
3735 | fIntFlowCovariancesNUA->SetBinContent(14,wPrefactor14*covariance14); | |
3736 | } // end of if(TMath::Abs(denominator14)>0.) | |
3737 | } // end of if(TMath::Abs(sumOfW1st14*sumOfW2nd14)>0.) | |
0328db2d | 3738 | |
3739 | // Cov(<cos(phi1)>,<sin(phi1+phi2)>): | |
3740 | Double_t product15 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(15); // <<cos(phi1)><sin(phi1+phi2)>> | |
3741 | Double_t term1st15 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
3742 | Double_t term2nd15 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
3743 | Double_t sumOfW1st15 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
3744 | Double_t sumOfW2nd15 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
3745 | Double_t sumOfWW15 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(15); // W_{<cos(phi1)>} * W_{<sin(phi1+phi2)>} | |
3746 | // numerator in the expression for the the unbiased estimator for covariance: | |
3747 | Double_t numerator15 = product15 - term1st15*term2nd15; | |
3748 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3749 | Double_t denominator15 = 0.; |
3750 | if(TMath::Abs(sumOfW1st15*sumOfW2nd15)>0.) | |
3751 | { | |
3752 | denominator15 = 1.-sumOfWW15/(sumOfW1st15*sumOfW2nd15); | |
3753 | if(TMath::Abs(denominator15)>0.) | |
3754 | { | |
3755 | // covariance: | |
3756 | Double_t covariance15 = numerator15/denominator15; | |
3757 | // weight dependent prefactor for covariance: | |
3758 | Double_t wPrefactor15 = sumOfWW15/(sumOfW1st15*sumOfW2nd15); | |
3759 | // finally, store "weighted" covariance: | |
3760 | fIntFlowCovariancesNUA->SetBinContent(15,wPrefactor15*covariance15); | |
3761 | } // end of if(TMath::Abs(denominator15)>0.) | |
3762 | } // end of if(TMath::Abs(sumOfW1st15*sumOfW2nd15)>0.) | |
3763 | ||
0328db2d | 3764 | // Cov(<cos(phi1)>,<cos(phi1-phi2-phi3)>): |
3765 | Double_t product16 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(16); // <<cos(phi1)><cos(phi1-phi2-phi3)>> | |
3766 | Double_t term1st16 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
3767 | Double_t term2nd16 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
3768 | Double_t sumOfW1st16 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
3769 | Double_t sumOfW2nd16 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
3770 | Double_t sumOfWW16 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(16); // W_{<cos(phi1)>} * W_{<cos(phi1-phi2-phi3)>} | |
3771 | // numerator in the expression for the the unbiased estimator for covariance: | |
3772 | Double_t numerator16 = product16 - term1st16*term2nd16; | |
3773 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3774 | Double_t denominator16 = 0.; |
3775 | if(TMath::Abs(sumOfW1st16*sumOfW2nd16)>0.) | |
3776 | { | |
3777 | denominator16 = 1.-sumOfWW16/(sumOfW1st16*sumOfW2nd16); | |
3778 | if(TMath::Abs(denominator16)>0.) | |
3779 | { | |
3780 | // covariance: | |
3781 | Double_t covariance16 = numerator16/denominator16; | |
3782 | // weight dependent prefactor for covariance: | |
3783 | Double_t wPrefactor16 = sumOfWW16/(sumOfW1st16*sumOfW2nd16); | |
3784 | // finally, store "weighted" covariance: | |
3785 | fIntFlowCovariancesNUA->SetBinContent(16,wPrefactor16*covariance16); | |
3786 | } // end of if(TMath::Abs(denominator16)>0.) | |
3787 | } // end ofif(TMath::Abs(sumOfW1st16*sumOfW2nd16)>0.) | |
3788 | ||
0328db2d | 3789 | // Cov(<cos(phi1)>,<sin(phi1-phi2-phi3)>): |
3790 | Double_t product17 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(17); // <<cos(phi1)><sin(phi1-phi2-phi3)>> | |
3791 | Double_t term1st17 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
3792 | Double_t term2nd17 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
3793 | Double_t sumOfW1st17 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
3794 | Double_t sumOfW2nd17 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
3795 | Double_t sumOfWW17 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(17); // W_{<cos(phi1)>} * W_{<sin(phi1-phi2-phi3)>} | |
3796 | // numerator in the expression for the the unbiased estimator for covariance: | |
3797 | Double_t numerator17 = product17 - term1st17*term2nd17; | |
3798 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3799 | Double_t denominator17 = 0.; |
3800 | if(TMath::Abs(sumOfW1st17*sumOfW2nd17)>0.) | |
3801 | { | |
3802 | denominator17 = 1.-sumOfWW17/(sumOfW1st17*sumOfW2nd17); | |
3803 | if(TMath::Abs(denominator17)>0.) | |
3804 | { | |
3805 | // covariance: | |
3806 | Double_t covariance17 = numerator17/denominator17; | |
3807 | // weight dependent prefactor for covariance: | |
3808 | Double_t wPrefactor17 = sumOfWW17/(sumOfW1st17*sumOfW2nd17); | |
3809 | // finally, store "weighted" covariance: | |
3810 | fIntFlowCovariancesNUA->SetBinContent(17,wPrefactor17*covariance17); | |
3811 | } // end of if(TMath::Abs(denominator17)>0.) | |
3812 | } // end of if(TMath::Abs(sumOfW1st17*sumOfW2nd17)>0.) | |
0328db2d | 3813 | |
3814 | // Cov(<sin(phi1)>,<cos(phi1+phi2)>): | |
3815 | Double_t product18 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(18); // <<sin(phi1)><cos(phi1+phi2)>> | |
3816 | Double_t term1st18 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
3817 | Double_t term2nd18 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
3818 | Double_t sumOfW1st18 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
3819 | Double_t sumOfW2nd18 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
3820 | Double_t sumOfWW18 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(18); // W_{<sin(phi1)>} * W_{<cos(phi1+phi2)>} | |
3821 | // numerator in the expression for the the unbiased estimator for covariance: | |
3822 | Double_t numerator18 = product18 - term1st18*term2nd18; | |
3823 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3824 | Double_t denominator18 = 0.; |
3825 | if(TMath::Abs(sumOfW1st18*sumOfW2nd18)>0.) | |
3826 | { | |
3827 | denominator18 = 1.-sumOfWW18/(sumOfW1st18*sumOfW2nd18); | |
3828 | if(TMath::Abs(denominator18)>0.) | |
3829 | { | |
3830 | // covariance: | |
3831 | Double_t covariance18 = numerator18/denominator18; | |
3832 | // weight dependent prefactor for covariance: | |
3833 | Double_t wPrefactor18 = sumOfWW18/(sumOfW1st18*sumOfW2nd18); | |
3834 | // finally, store "weighted" covariance: | |
3835 | fIntFlowCovariancesNUA->SetBinContent(18,wPrefactor18*covariance18); | |
3836 | } // end of if(TMath::Abs(denominator18)>0.) | |
3837 | } // end of if(TMath::Abs(sumOfW1st18*sumOfW2nd18)>0.) | |
0328db2d | 3838 | |
3839 | // Cov(<sin(phi1)>,<sin(phi1+phi2)>): | |
3840 | Double_t product19 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(19); // <<sin(phi1)><sin(phi1+phi2)>> | |
3841 | Double_t term1st19 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
3842 | Double_t term2nd19 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
3843 | Double_t sumOfW1st19 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
3844 | Double_t sumOfW2nd19 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
3845 | Double_t sumOfWW19 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(19); // W_{<sin(phi1)>} * W_{<sin(phi1+phi2)>} | |
3846 | // numerator in the expression for the the unbiased estimator for covariance: | |
3847 | Double_t numerator19 = product19 - term1st19*term2nd19; | |
3848 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3849 | Double_t denominator19 = 0.; |
3850 | if(TMath::Abs(sumOfW1st19*sumOfW2nd19)>0.) | |
3851 | { | |
3852 | denominator19 = 1.-sumOfWW19/(sumOfW1st19*sumOfW2nd19); | |
3853 | if(TMath::Abs(denominator19)>0.) | |
3854 | { | |
3855 | // covariance: | |
3856 | Double_t covariance19 = numerator19/denominator19; | |
3857 | // weight dependent prefactor for covariance: | |
3858 | Double_t wPrefactor19 = sumOfWW19/(sumOfW1st19*sumOfW2nd19); | |
3859 | // finally, store "weighted" covariance: | |
3860 | fIntFlowCovariancesNUA->SetBinContent(19,wPrefactor19*covariance19); | |
3861 | } // end of if(TMath::Abs(denominator19)>0.) | |
3862 | } // end of if(TMath::Abs(sumOfW1st19*sumOfW2nd19)>0.) | |
3863 | ||
0328db2d | 3864 | // Cov(<sin(phi1)>,<cos(phi1-phi2-phi3)>): |
3865 | Double_t product20 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(20); // <<sin(phi1)><cos(phi1-phi2-phi3)>> | |
3866 | Double_t term1st20 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
3867 | Double_t term2nd20 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
3868 | Double_t sumOfW1st20 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
3869 | Double_t sumOfW2nd20 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
3870 | Double_t sumOfWW20 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(20); // W_{<sin(phi1)>} * W_{<cos(phi1-phi2-phi3)>} | |
3871 | // numerator in the expression for the the unbiased estimator for covariance: | |
3872 | Double_t numerator20 = product20 - term1st20*term2nd20; | |
3873 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3874 | Double_t denominator20 = 0.; |
3875 | if(TMath::Abs(sumOfW1st20*sumOfW2nd20)>0.) | |
3876 | { | |
3877 | denominator20 = 1.-sumOfWW20/(sumOfW1st20*sumOfW2nd20); | |
3878 | if(TMath::Abs(denominator20)>0.) | |
3879 | { | |
3880 | // covariance: | |
3881 | Double_t covariance20 = numerator20/denominator20; | |
3882 | // weight dependent prefactor for covariance: | |
3883 | Double_t wPrefactor20 = sumOfWW20/(sumOfW1st20*sumOfW2nd20); | |
3884 | // finally, store "weighted" covariance: | |
3885 | fIntFlowCovariancesNUA->SetBinContent(20,wPrefactor20*covariance20); | |
3886 | } // end of if(TMath::Abs(denominator20)>0.) | |
3887 | } // end of if(TMath::Abs(sumOfW1st20*sumOfW2nd20)>0.) | |
0328db2d | 3888 | |
3889 | // Cov(<sin(phi1)>,<sin(phi1-phi2-phi3)>): | |
3890 | Double_t product21 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(21); // <<sin(phi1)><sin(phi1-phi2-phi3)>> | |
3891 | Double_t term1st21 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
3892 | Double_t term2nd21 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
3893 | Double_t sumOfW1st21 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
3894 | Double_t sumOfW2nd21 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
3895 | Double_t sumOfWW21 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(21); // W_{<sin(phi1)>} * W_{<sin(phi1-phi2-phi3)>} | |
3896 | // numerator in the expression for the the unbiased estimator for covariance: | |
3897 | Double_t numerator21 = product21 - term1st21*term2nd21; | |
3898 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3899 | Double_t denominator21 = 0.; |
3900 | if(TMath::Abs(sumOfW1st21*sumOfW2nd21)>0.) | |
3901 | { | |
3902 | denominator21 = 1.-sumOfWW21/(sumOfW1st21*sumOfW2nd21); | |
3903 | if(TMath::Abs(denominator21)>0.) | |
3904 | { | |
3905 | // covariance: | |
3906 | Double_t covariance21 = numerator21/denominator21; | |
3907 | // weight dependent prefactor for covariance: | |
3908 | Double_t wPrefactor21 = sumOfWW21/(sumOfW1st21*sumOfW2nd21); | |
3909 | // finally, store "weighted" covariance: | |
3910 | fIntFlowCovariancesNUA->SetBinContent(21,wPrefactor21*covariance21); | |
3911 | } // end of if(TMath::Abs(denominator21)>0.) | |
3912 | } // end of if(TMath::Abs(sumOfW1st21*sumOfW2nd21)>0.) | |
0328db2d | 3913 | |
3914 | // Cov(<cos(phi1+phi2)>,<sin(phi1+phi2)>): | |
3915 | Double_t product22 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(22); // <<cos(phi1+phi2)><sin(phi1+phi2)>> | |
3916 | Double_t term1st22 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
3917 | Double_t term2nd22 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
3918 | Double_t sumOfW1st22 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
3919 | Double_t sumOfW2nd22 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
3920 | Double_t sumOfWW22 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(22); // W_{<cos(phi1+phi2)>} * W_{<sin(phi1+phi2)>} | |
3921 | // numerator in the expression for the the unbiased estimator for covariance: | |
3922 | Double_t numerator22 = product22 - term1st22*term2nd22; | |
3923 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3924 | Double_t denominator22 = 0.; |
3925 | if(TMath::Abs(sumOfW1st22*sumOfW2nd22)>0.) | |
3926 | { | |
3927 | denominator22 = 1.-sumOfWW22/(sumOfW1st22*sumOfW2nd22); | |
3928 | if(TMath::Abs(denominator22)>0.) | |
3929 | { | |
3930 | // covariance: | |
3931 | Double_t covariance22 = numerator22/denominator22; | |
3932 | // weight dependent prefactor for covariance: | |
3933 | Double_t wPrefactor22 = sumOfWW22/(sumOfW1st22*sumOfW2nd22); | |
3934 | // finally, store "weighted" covariance: | |
3935 | fIntFlowCovariancesNUA->SetBinContent(22,wPrefactor22*covariance22); | |
3936 | } // end of if(TMath::Abs(denominator22)>0.) | |
3937 | } // end of if(TMath::Abs(sumOfW1st22*sumOfW2nd22)>0.) | |
0328db2d | 3938 | |
3939 | // Cov(<cos(phi1+phi2)>,<cos(phi1-phi2-phi3)>): | |
3940 | Double_t product23 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(23); // <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
3941 | Double_t term1st23 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
3942 | Double_t term2nd23 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
3943 | Double_t sumOfW1st23 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
3944 | Double_t sumOfW2nd23 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
3945 | Double_t sumOfWW23 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(23); // W_{<cos(phi1+phi2)>} * W_{<cos(phi1-phi2-phi3)>} | |
3946 | // numerator in the expression for the the unbiased estimator for covariance: | |
3947 | Double_t numerator23 = product23 - term1st23*term2nd23; | |
3948 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3949 | Double_t denominator23 = 0.; |
3950 | if(TMath::Abs(sumOfW1st23*sumOfW2nd23)>0.) | |
3951 | { | |
3952 | denominator23 = 1.-sumOfWW23/(sumOfW1st23*sumOfW2nd23); | |
3953 | if(TMath::Abs(denominator23)>0.) | |
3954 | { | |
3955 | // covariance: | |
3956 | Double_t covariance23 = numerator23/denominator23; | |
3957 | // weight dependent prefactor for covariance: | |
3958 | Double_t wPrefactor23 = sumOfWW23/(sumOfW1st23*sumOfW2nd23); | |
3959 | // finally, store "weighted" covariance: | |
3960 | fIntFlowCovariancesNUA->SetBinContent(23,wPrefactor23*covariance23); | |
3961 | } // end of if(TMath::Abs(denominator23)>0.) | |
3962 | } // end of if(TMath::Abs(sumOfW1st23*sumOfW2nd23)>0.) | |
3963 | ||
0328db2d | 3964 | // Cov(<cos(phi1+phi2)>,<sin(phi1-phi2-phi3)>): |
3965 | Double_t product24 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(24); // <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
3966 | Double_t term1st24 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
3967 | Double_t term2nd24 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
3968 | Double_t sumOfW1st24 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
3969 | Double_t sumOfW2nd24 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
3970 | Double_t sumOfWW24 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(24); // W_{<cos(phi1+phi2)>} * W_{<sin(phi1-phi2-phi3)>} | |
3971 | // numerator in the expression for the the unbiased estimator for covariance: | |
3972 | Double_t numerator24 = product24 - term1st24*term2nd24; | |
3973 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3974 | Double_t denominator24 = 0.; |
3975 | if(TMath::Abs(sumOfW1st24*sumOfW2nd24)>0.) | |
3976 | { | |
3977 | denominator24 = 1.-sumOfWW24/(sumOfW1st24*sumOfW2nd24); | |
3978 | if(TMath::Abs(denominator24)>0.) | |
3979 | { | |
3980 | // covariance: | |
3981 | Double_t covariance24 = numerator24/denominator24; | |
3982 | // weight dependent prefactor for covariance: | |
3983 | Double_t wPrefactor24 = sumOfWW24/(sumOfW1st24*sumOfW2nd24); | |
3984 | // finally, store "weighted" covariance: | |
3985 | fIntFlowCovariancesNUA->SetBinContent(24,wPrefactor24*covariance24); | |
3986 | } // end of if(TMath::Abs(denominator24)>0.) | |
3987 | } // end of if(TMath::Abs(sumOfW1st24*sumOfW2nd24)>0.) | |
0328db2d | 3988 | |
3989 | // Cov(<sin(phi1+phi2)>,<cos(phi1-phi2-phi3)>): | |
3990 | Double_t product25 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(25); // <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
3991 | Double_t term1st25 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
3992 | Double_t term2nd25 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
3993 | Double_t sumOfW1st25 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
3994 | Double_t sumOfW2nd25 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
3995 | Double_t sumOfWW25 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(25); // W_{<sin(phi1+phi2)>} * W_{<cos(phi1-phi2-phi3)>} | |
3996 | // numerator in the expression for the the unbiased estimator for covariance: | |
3997 | Double_t numerator25 = product25 - term1st25*term2nd25; | |
3998 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3999 | Double_t denominator25 = 0.; |
4000 | if(TMath::Abs(sumOfW1st25*sumOfW2nd25)>0.) | |
4001 | { | |
4002 | denominator25 = 1.-sumOfWW25/(sumOfW1st25*sumOfW2nd25); | |
4003 | if(TMath::Abs(denominator25)>0.) | |
4004 | { | |
4005 | // covariance: | |
4006 | Double_t covariance25 = numerator25/denominator25; | |
4007 | // weight dependent prefactor for covariance: | |
4008 | Double_t wPrefactor25 = sumOfWW25/(sumOfW1st25*sumOfW2nd25); | |
4009 | // finally, store "weighted" covariance: | |
4010 | fIntFlowCovariancesNUA->SetBinContent(25,wPrefactor25*covariance25); | |
4011 | } // end of if(TMath::Abs(denominator25)>0.) | |
4012 | } // end of if(TMath::Abs(sumOfW1st25*sumOfW2nd25)>0.) | |
4013 | ||
0328db2d | 4014 | // Cov(<sin(phi1+phi2)>,<sin(phi1-phi2-phi3)>): |
4015 | Double_t product26 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(26); // <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
4016 | Double_t term1st26 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4017 | Double_t term2nd26 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
4018 | Double_t sumOfW1st26 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4019 | Double_t sumOfW2nd26 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
4020 | Double_t sumOfWW26 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(26); // W_{<sin(phi1+phi2)>} * W_{<sin(phi1-phi2-phi3)>} | |
4021 | // numerator in the expression for the the unbiased estimator for covariance: | |
4022 | Double_t numerator26 = product26 - term1st26*term2nd26; | |
4023 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4024 | Double_t denominator26 = 0.; |
4025 | if(TMath::Abs(sumOfW1st26*sumOfW2nd26)>0.) | |
4026 | { | |
4027 | denominator26 = 1.-sumOfWW26/(sumOfW1st26*sumOfW2nd26); | |
4028 | if(TMath::Abs(denominator26)>0.) | |
4029 | { | |
4030 | // covariance: | |
4031 | Double_t covariance26 = numerator26/denominator26; | |
4032 | // weight dependent prefactor for covariance: | |
4033 | Double_t wPrefactor26 = sumOfWW26/(sumOfW1st26*sumOfW2nd26); | |
4034 | // finally, store "weighted" covariance: | |
4035 | fIntFlowCovariancesNUA->SetBinContent(26,wPrefactor26*covariance26); | |
4036 | } // end of if(TMath::Abs(denominator26)>0.) | |
4037 | } // end of if(TMath::Abs(sumOfW1st26*sumOfW2nd26)>0.) | |
4038 | ||
0328db2d | 4039 | // Cov(<cos(phi1-phi2-phi3)>,<sin(phi1-phi2-phi3)>): |
4040 | Double_t product27 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(27); // <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>> | |
b92ea2b9 | 4041 | Double_t term1st27 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> |
0328db2d | 4042 | Double_t term2nd27 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> |
b92ea2b9 | 4043 | Double_t sumOfW1st27 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} |
0328db2d | 4044 | Double_t sumOfW2nd27 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} |
4045 | Double_t sumOfWW27 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(27); // W_{<cos(phi1-phi2-phi3)>} * W_{<sin(phi1-phi2-phi3)>} | |
4046 | // numerator in the expression for the the unbiased estimator for covariance: | |
4047 | Double_t numerator27 = product27 - term1st27*term2nd27; | |
4048 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4049 | Double_t denominator27 = 0.; |
4050 | if(TMath::Abs(sumOfW1st27*sumOfW2nd27)>0.) | |
4051 | { | |
4052 | denominator27 = 1.-sumOfWW27/(sumOfW1st27*sumOfW2nd27); | |
4053 | if(TMath::Abs(denominator27)>0.) | |
4054 | { | |
4055 | // covariance: | |
4056 | Double_t covariance27 = numerator27/denominator27; | |
4057 | // weight dependent prefactor for covariance: | |
4058 | Double_t wPrefactor27 = sumOfWW27/(sumOfW1st27*sumOfW2nd27); | |
4059 | // finally, store "weighted" covariance: | |
4060 | fIntFlowCovariancesNUA->SetBinContent(27,wPrefactor27*covariance27); | |
4061 | } // end of if(TMath::Abs(denominator27)>0.) | |
4062 | } // end of if(TMath::Abs(sumOfW1st27*sumOfW2nd27)>0.) | |
4063 | ||
0328db2d | 4064 | } // end of AliFlowAnalysisWithQCumulants::CalculateCovariancesNUAIntFlow() |
4065 | ||
0328db2d | 4066 | //================================================================================================================================ |
4067 | ||
489d5531 | 4068 | void AliFlowAnalysisWithQCumulants::FinalizeCorrelationsIntFlow() |
4069 | { | |
4070 | // From profile fIntFlowCorrelationsPro access measured correlations and spread, | |
4071 | // correctly calculate the statistical errors and store the final results and | |
4072 | // statistical errors for correlations in histogram fIntFlowCorrelationsHist. | |
4073 | // | |
4074 | // Remark: Statistical error of correlation is calculated as: | |
4075 | // | |
4076 | // statistical error = termA * spread * termB: | |
4077 | // termA = sqrt{sum_{i=1}^{N} w^2}/(sum_{i=1}^{N} w) | |
4078 | // termB = 1/sqrt(1-termA^2) | |
b3dacf6b | 4079 | // |
4080 | ||
489d5531 | 4081 | for(Int_t ci=1;ci<=4;ci++) // correlation index |
4082 | { | |
b40a910e | 4083 | if(fIntFlowCorrelationsPro->GetBinEffectiveEntries(ci) < 2 || fIntFlowSquaredCorrelationsPro->GetBinEffectiveEntries(ci) < 2) |
4084 | { | |
4085 | fIntFlowCorrelationsPro->SetBinError(ci,0.); | |
4086 | fIntFlowSquaredCorrelationsPro->SetBinError(ci,0.); | |
4087 | continue; | |
4088 | } | |
489d5531 | 4089 | Double_t correlation = fIntFlowCorrelationsPro->GetBinContent(ci); |
b40a910e | 4090 | Double_t squaredCorrelation = fIntFlowSquaredCorrelationsPro->GetBinContent(ci); |
4091 | Double_t spread = 0.; | |
4092 | if(squaredCorrelation-correlation*correlation >= 0.) | |
4093 | { | |
4094 | spread = pow(squaredCorrelation-correlation*correlation,0.5); | |
4095 | } else | |
4096 | { | |
4097 | cout<<endl; | |
4098 | cout<<Form(" WARNING: Imaginary 'spread' for %d-particle correlation!!!! ",2*ci)<<endl; | |
4099 | cout<<endl; | |
4100 | } | |
489d5531 | 4101 | Double_t sumOfLinearEventWeights = fIntFlowSumOfEventWeights[0]->GetBinContent(ci); |
4102 | Double_t sumOfQuadraticEventWeights = fIntFlowSumOfEventWeights[1]->GetBinContent(ci); | |
4103 | Double_t termA = 0.; | |
4104 | Double_t termB = 0.; | |
b3dacf6b | 4105 | if(TMath::Abs(sumOfLinearEventWeights) > 0.) // to be improved - shall I omitt here Abs() ? |
489d5531 | 4106 | { |
4107 | termA = pow(sumOfQuadraticEventWeights,0.5)/sumOfLinearEventWeights; | |
4108 | } else | |
4109 | { | |
b3dacf6b | 4110 | cout<<endl; |
4111 | cout<<" WARNING (QC): sumOfLinearEventWeights == 0 in method FinalizeCorrelationsIntFlow() !!!!"<<endl; | |
4112 | cout<<" (for "<<2*ci<<"-particle correlation)"<<endl; | |
4113 | cout<<endl; | |
489d5531 | 4114 | } |
4115 | if(1.-pow(termA,2.) > 0.) | |
4116 | { | |
4117 | termB = 1./pow(1-pow(termA,2.),0.5); | |
4118 | } else | |
4119 | { | |
b3dacf6b | 4120 | cout<<endl; |
4121 | cout<<" WARNING (QC): 1.-pow(termA,2.) <= 0 in method FinalizeCorrelationsIntFlow() !!!!"<<endl; | |
4122 | cout<<" (for "<<2*ci<<"-particle correlation)"<<endl; | |
4123 | cout<<endl; | |
489d5531 | 4124 | } |
4125 | Double_t statisticalError = termA * spread * termB; | |
4126 | fIntFlowCorrelationsHist->SetBinContent(ci,correlation); | |
4127 | fIntFlowCorrelationsHist->SetBinError(ci,statisticalError); | |
ff70ca91 | 4128 | } // end of for(Int_t ci=1;ci<=4;ci++) // correlation index |
4129 | ||
b3dacf6b | 4130 | // Versus multiplicity: |
4131 | if(!fCalculateCumulantsVsM){return;} | |
ff70ca91 | 4132 | for(Int_t ci=0;ci<=3;ci++) // correlation index |
4133 | { | |
4134 | Int_t nBins = fIntFlowCorrelationsVsMPro[ci]->GetNbinsX(); | |
4135 | for(Int_t b=1;b<=nBins;b++) // looping over multiplicity bins | |
4136 | { | |
b40a910e | 4137 | if(fIntFlowCorrelationsVsMPro[ci]->GetBinEffectiveEntries(b) < 2 || fIntFlowSquaredCorrelationsVsMPro[ci]->GetBinEffectiveEntries(b) < 2) |
4138 | { | |
4139 | fIntFlowCorrelationsVsMPro[ci]->SetBinError(b,0.); | |
4140 | fIntFlowSquaredCorrelationsVsMPro[ci]->SetBinError(b,0.); | |
4141 | continue; | |
4142 | } | |
ff70ca91 | 4143 | Double_t correlationVsM = fIntFlowCorrelationsVsMPro[ci]->GetBinContent(b); |
b40a910e | 4144 | Double_t squaredCorrelationVsM = fIntFlowSquaredCorrelationsVsMPro[ci]->GetBinContent(b); |
4145 | Double_t spreadVsM = 0.; | |
4146 | if(squaredCorrelationVsM-correlationVsM*correlationVsM >= 0.) | |
4147 | { | |
4148 | spreadVsM = pow(squaredCorrelationVsM-correlationVsM*correlationVsM,0.5); | |
4149 | } else | |
4150 | { | |
4151 | cout<<endl; | |
4152 | cout<<Form(" WARNING (QC): Imaginary 'spreadVsM' for ci = %d, bin = %d, entries = %f !!!!", | |
4153 | ci,b,fIntFlowCorrelationsVsMPro[ci]->GetBinEffectiveEntries(b))<<endl; | |
4154 | cout<<endl; | |
4155 | } | |
ff70ca91 | 4156 | Double_t sumOfLinearEventWeightsVsM = fIntFlowSumOfEventWeightsVsM[ci][0]->GetBinContent(b); |
4157 | Double_t sumOfQuadraticEventWeightsVsM = fIntFlowSumOfEventWeightsVsM[ci][1]->GetBinContent(b); | |
4158 | Double_t termAVsM = 0.; | |
4159 | Double_t termBVsM = 0.; | |
b40a910e | 4160 | if(sumOfLinearEventWeightsVsM > 0.) |
ff70ca91 | 4161 | { |
4162 | termAVsM = pow(sumOfQuadraticEventWeightsVsM,0.5)/sumOfLinearEventWeightsVsM; | |
b3dacf6b | 4163 | } |
ff70ca91 | 4164 | if(1.-pow(termAVsM,2.) > 0.) |
4165 | { | |
4166 | termBVsM = 1./pow(1-pow(termAVsM,2.),0.5); | |
b3dacf6b | 4167 | } |
ff70ca91 | 4168 | Double_t statisticalErrorVsM = termAVsM * spreadVsM * termBVsM; |
4169 | fIntFlowCorrelationsVsMHist[ci]->SetBinContent(b,correlationVsM); | |
4170 | fIntFlowCorrelationsVsMHist[ci]->SetBinError(b,statisticalErrorVsM); | |
4171 | } // end of for(Int_t b=1;b<=nBins;b++) | |
4172 | } // end of for(Int_t ci=1;ci<=4;ci++) // correlation index | |
4173 | ||
489d5531 | 4174 | } // end of AliFlowAnalysisWithQCumulants::FinalizeCorrelationsIntFlow() |
4175 | ||
489d5531 | 4176 | //================================================================================================================================ |
4177 | ||
489d5531 | 4178 | void AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(Int_t nRP) |
4179 | { | |
b77b6434 | 4180 | // Fill profile fAverageMultiplicity to hold average multiplicities and |
4181 | // number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8 | |
489d5531 | 4182 | |
4183 | // Binning of fAverageMultiplicity is organized as follows: | |
4184 | // 1st bin: all events (including the empty ones) | |
4185 | // 2nd bin: event with # of RPs greater or equal to 1 | |
4186 | // 3rd bin: event with # of RPs greater or equal to 2 | |
4187 | // 4th bin: event with # of RPs greater or equal to 3 | |
4188 | // 5th bin: event with # of RPs greater or equal to 4 | |
4189 | // 6th bin: event with # of RPs greater or equal to 5 | |
4190 | // 7th bin: event with # of RPs greater or equal to 6 | |
4191 | // 8th bin: event with # of RPs greater or equal to 7 | |
4192 | // 9th bin: event with # of RPs greater or equal to 8 | |
4193 | ||
489d5531 | 4194 | if(nRP<0) |
4195 | { | |
b77b6434 | 4196 | cout<<endl; |
4197 | cout<<" WARNING (QC): nRP<0 in in AFAWQC::FAM() !!!!"<<endl; | |
4198 | cout<<endl; | |
489d5531 | 4199 | exit(0); |
4200 | } | |
4201 | ||
4202 | for(Int_t i=0;i<9;i++) | |
4203 | { | |
b77b6434 | 4204 | if(nRP>=i){fAvMultiplicity->Fill(i+0.5,nRP,1);} |
489d5531 | 4205 | } |
4206 | ||
4207 | } // end of AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(nRP) | |
4208 | ||
489d5531 | 4209 | //================================================================================================================================ |
4210 | ||
489d5531 | 4211 | void AliFlowAnalysisWithQCumulants::CalculateCumulantsIntFlow() |
b3dacf6b | 4212 | { |
b92ea2b9 | 4213 | // a) Calculate Q-cumulants from the measured multiparticle correlations; |
4214 | // b) Propagate the statistical errors from measured multiparticle correlations to statistical errors of Q-cumulants; | |
4215 | // c) Remark: Q-cumulants calculated in this method are biased by non-uniform acceptance of detector !!!! | |
4216 | // Method CalculateQcumulantsCorrectedForNUAIntFlow() is called afterwards to correct for this bias; | |
4217 | // d) Store the results and statistical error of Q-cumulants in histogram fIntFlowQcumulants. | |
4218 | // Binning of fIntFlowQcumulants is organized as follows: | |
489d5531 | 4219 | // |
b3dacf6b | 4220 | // 1st bin: QC{2} |
4221 | // 2nd bin: QC{4} | |
4222 | // 3rd bin: QC{6} | |
4223 | // 4th bin: QC{8} | |
4224 | // | |
489d5531 | 4225 | |
b3dacf6b | 4226 | // Correlations: |
489d5531 | 4227 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> |
4228 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> | |
4229 | Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> | |
4230 | Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> | |
b3dacf6b | 4231 | // Statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations: |
489d5531 | 4232 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <2> |
4233 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <4> | |
4234 | Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <6> | |
4235 | Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <8> | |
b3dacf6b | 4236 | // Covariances (multiplied by prefactor depending on weights - see comments in CalculateCovariancesIntFlow()): |
8e1cefdd | 4237 | Double_t wCov24 = 0.; // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) |
4238 | Double_t wCov26 = 0.; // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>) | |
4239 | Double_t wCov28 = 0.; // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>) | |
4240 | Double_t wCov46 = 0.; // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>) | |
4241 | Double_t wCov48 = 0.; // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>) | |
4242 | Double_t wCov68 = 0.; // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>) | |
4243 | if(!fForgetAboutCovariances) | |
4244 | { | |
4245 | wCov24 = fIntFlowCovariances->GetBinContent(1); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) | |
4246 | wCov26 = fIntFlowCovariances->GetBinContent(2); // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>) | |
4247 | wCov28 = fIntFlowCovariances->GetBinContent(3); // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>) | |
4248 | wCov46 = fIntFlowCovariances->GetBinContent(4); // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>) | |
4249 | wCov48 = fIntFlowCovariances->GetBinContent(5); // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>) | |
4250 | wCov68 = fIntFlowCovariances->GetBinContent(6); // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>) | |
4251 | } | |
489d5531 | 4252 | // Q-cumulants: |
4253 | Double_t qc2 = 0.; // QC{2} | |
4254 | Double_t qc4 = 0.; // QC{4} | |
4255 | Double_t qc6 = 0.; // QC{6} | |
4256 | Double_t qc8 = 0.; // QC{8} | |
b3dacf6b | 4257 | if(TMath::Abs(two) > 0.){qc2 = two;} |
4258 | if(TMath::Abs(four) > 0.){qc4 = four-2.*pow(two,2.);} | |
4259 | if(TMath::Abs(six) > 0.){qc6 = six-9.*two*four+12.*pow(two,3.);} | |
4260 | if(TMath::Abs(eight) > 0.){qc8 = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.);} | |
4261 | // Statistical errors of Q-cumulants: | |
489d5531 | 4262 | Double_t qc2Error = 0.; |
4263 | Double_t qc4Error = 0.; | |
4264 | Double_t qc6Error = 0.; | |
b3dacf6b | 4265 | Double_t qc8Error = 0.; |
4266 | // Squared statistical errors of Q-cumulants: | |
489d5531 | 4267 | //Double_t qc2ErrorSquared = 0.; |
4268 | Double_t qc4ErrorSquared = 0.; | |
4269 | Double_t qc6ErrorSquared = 0.; | |
b3dacf6b | 4270 | Double_t qc8ErrorSquared = 0.; |
4271 | // Statistical error of QC{2}: | |
4272 | qc2Error = twoError; | |
4273 | // Statistical error of QC{4}: | |
489d5531 | 4274 | qc4ErrorSquared = 16.*pow(two,2.)*pow(twoError,2)+pow(fourError,2.) |
4275 | - 8.*two*wCov24; | |
4276 | if(qc4ErrorSquared>0.) | |
4277 | { | |
4278 | qc4Error = pow(qc4ErrorSquared,0.5); | |
4279 | } else | |
4280 | { | |
b3dacf6b | 4281 | cout<<" WARNING (QC): Statistical error of QC{4} is imaginary !!!!"<<endl; |
4282 | } | |
4283 | // Statistical error of QC{6}: | |
489d5531 | 4284 | qc6ErrorSquared = 81.*pow(4.*pow(two,2.)-four,2.)*pow(twoError,2.) |
4285 | + 81.*pow(two,2.)*pow(fourError,2.) | |
4286 | + pow(sixError,2.) | |
4287 | - 162.*two*(4.*pow(two,2.)-four)*wCov24 | |
4288 | + 18.*(4.*pow(two,2.)-four)*wCov26 | |
b3dacf6b | 4289 | - 18.*two*wCov46; |
489d5531 | 4290 | if(qc6ErrorSquared>0.) |
4291 | { | |
4292 | qc6Error = pow(qc6ErrorSquared,0.5); | |
4293 | } else | |
4294 | { | |
b3dacf6b | 4295 | cout<<" WARNING (QC): Statistical error of QC{6} is imaginary !!!!"<<endl; |
4296 | } | |
4297 | // Statistical error of QC{8}: | |
489d5531 | 4298 | qc8ErrorSquared = 256.*pow(36.*pow(two,3.)-18.*four*two+six,2.)*pow(twoError,2.) |
4299 | + 1296.*pow(4.*pow(two,2.)-four,2.)*pow(fourError,2.) | |
4300 | + 256.*pow(two,2.)*pow(sixError,2.) | |
4301 | + pow(eightError,2.) | |
4302 | - 1152.*(36.*pow(two,3.)-18.*four*two+six)*(4.*pow(two,2.)-four)*wCov24 | |
4303 | + 512.*two*(36.*pow(two,3.)-18.*four*two+six)*wCov26 | |
4304 | - 32.*(36.*pow(two,3.)-18.*four*two+six)*wCov28 | |
4305 | - 1152.*two*(4.*pow(two,2.)-four)*wCov46 | |
4306 | + 72.*(4.*pow(two,2.)-four)*wCov48 | |
4307 | - 32.*two*wCov68; | |
4308 | if(qc8ErrorSquared>0.) | |
4309 | { | |
4310 | qc8Error = pow(qc8ErrorSquared,0.5); | |
4311 | } else | |
4312 | { | |
b3dacf6b | 4313 | cout<<"WARNING (QC): Statistical error of QC{8} is imaginary !!!!"<<endl; |
489d5531 | 4314 | } |
b3dacf6b | 4315 | // Store the results and statistical errors for Q-cumulants: |
4316 | if(TMath::Abs(qc2)>0.) | |
4317 | { | |
4318 | fIntFlowQcumulants->SetBinContent(1,qc2); | |
4319 | fIntFlowQcumulants->SetBinError(1,qc2Error); | |
4320 | } | |
4321 | if(TMath::Abs(qc4)>0.) | |
4322 | { | |
4323 | fIntFlowQcumulants->SetBinContent(2,qc4); | |
4324 | fIntFlowQcumulants->SetBinError(2,qc4Error); | |
4325 | } | |
4326 | if(TMath::Abs(qc6)>0.) | |
4327 | { | |
4328 | fIntFlowQcumulants->SetBinContent(3,qc6); | |
4329 | fIntFlowQcumulants->SetBinError(3,qc6Error); | |
4330 | } | |
4331 | if(TMath::Abs(qc8)>0.) | |
4332 | { | |
4333 | fIntFlowQcumulants->SetBinContent(4,qc8); | |
4334 | fIntFlowQcumulants->SetBinError(4,qc8Error); | |
4335 | } | |
4336 | ||
4337 | // Versus multiplicity: | |
4338 | if(!fCalculateCumulantsVsM){return;} | |
9da1a4f3 | 4339 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) |
b3dacf6b | 4340 | Double_t value[4] = {0.}; // QCs vs M |
4341 | Double_t error[4] = {0.}; // error of QCs vs M | |
4342 | Double_t dSum1[4] = {0.}; // sum value_i/(error_i)^2 | |
4343 | Double_t dSum2[4] = {0.}; // sum 1/(error_i)^2 | |
9da1a4f3 | 4344 | for(Int_t b=1;b<=nBins;b++) |
4345 | { | |
b3dacf6b | 4346 | // Correlations: |
9da1a4f3 | 4347 | two = fIntFlowCorrelationsVsMHist[0]->GetBinContent(b); // <<2>> |
4348 | four = fIntFlowCorrelationsVsMHist[1]->GetBinContent(b); // <<4>> | |
4349 | six = fIntFlowCorrelationsVsMHist[2]->GetBinContent(b); // <<6>> | |
4350 | eight = fIntFlowCorrelationsVsMHist[3]->GetBinContent(b); // <<8>> | |
b3dacf6b | 4351 | // Statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations: |
9da1a4f3 | 4352 | twoError = fIntFlowCorrelationsVsMHist[0]->GetBinError(b); // statistical error of <2> |
4353 | fourError = fIntFlowCorrelationsVsMHist[1]->GetBinError(b); // statistical error of <4> | |
4354 | sixError = fIntFlowCorrelationsVsMHist[2]->GetBinError(b); // statistical error of <6> | |
4355 | eightError = fIntFlowCorrelationsVsMHist[3]->GetBinError(b); // statistical error of <8> | |
b3dacf6b | 4356 | // Covariances (multiplied by prefactor depending on weights - see comments in CalculateCovariancesIntFlow()): |
8e1cefdd | 4357 | if(!fForgetAboutCovariances) |
4358 | { | |
4359 | wCov24 = fIntFlowCovariancesVsM[0]->GetBinContent(b); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) | |
4360 | wCov26 = fIntFlowCovariancesVsM[1]->GetBinContent(b); // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>) | |
4361 | wCov28 = fIntFlowCovariancesVsM[2]->GetBinContent(b); // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>) | |
4362 | wCov46 = fIntFlowCovariancesVsM[3]->GetBinContent(b); // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>) | |
4363 | wCov48 = fIntFlowCovariancesVsM[4]->GetBinContent(b); // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>) | |
4364 | wCov68 = fIntFlowCovariancesVsM[5]->GetBinContent(b); // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>) | |
4365 | } | |
9da1a4f3 | 4366 | // Q-cumulants: |
4367 | qc2 = 0.; // QC{2} | |
4368 | qc4 = 0.; // QC{4} | |
4369 | qc6 = 0.; // QC{6} | |
4370 | qc8 = 0.; // QC{8} | |
b3dacf6b | 4371 | if(TMath::Abs(two) > 0.){qc2 = two;} |
4372 | if(TMath::Abs(four) > 0.){qc4 = four-2.*pow(two,2.);} | |
4373 | if(TMath::Abs(six) > 0.){qc6 = six-9.*two*four+12.*pow(two,3.);} | |
4374 | if(TMath::Abs(eight) > 0.){qc8 = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.);} | |
4375 | // Statistical errors of Q-cumulants: | |
9da1a4f3 | 4376 | qc2Error = 0.; |
4377 | qc4Error = 0.; | |
4378 | qc6Error = 0.; | |
b3dacf6b | 4379 | qc8Error = 0.; |
4380 | // Squared statistical errors of Q-cumulants: | |
9da1a4f3 | 4381 | //Double_t qc2ErrorSquared = 0.; |
4382 | qc4ErrorSquared = 0.; | |
4383 | qc6ErrorSquared = 0.; | |
b3dacf6b | 4384 | qc8ErrorSquared = 0.; |
4385 | // Statistical error of QC{2}: | |
4386 | qc2Error = twoError; | |
4387 | // Statistical error of QC{4}: | |
9da1a4f3 | 4388 | qc4ErrorSquared = 16.*pow(two,2.)*pow(twoError,2)+pow(fourError,2.) |
4389 | - 8.*two*wCov24; | |
4390 | if(qc4ErrorSquared>0.) | |
4391 | { | |
4392 | qc4Error = pow(qc4ErrorSquared,0.5); | |
4393 | } else | |
4394 | { | |
4395 | // cout<<"WARNING: Statistical error of QC{4} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl; | |
b3dacf6b | 4396 | } |
4397 | // Statistical error of QC{6}: | |
9da1a4f3 | 4398 | qc6ErrorSquared = 81.*pow(4.*pow(two,2.)-four,2.)*pow(twoError,2.) |
4399 | + 81.*pow(two,2.)*pow(fourError,2.) | |
4400 | + pow(sixError,2.) | |
4401 | - 162.*two*(4.*pow(two,2.)-four)*wCov24 | |
4402 | + 18.*(4.*pow(two,2.)-four)*wCov26 | |
b3dacf6b | 4403 | - 18.*two*wCov46; |
9da1a4f3 | 4404 | if(qc6ErrorSquared>0.) |
4405 | { | |
4406 | qc6Error = pow(qc6ErrorSquared,0.5); | |
4407 | } else | |
4408 | { | |
4409 | // cout<<"WARNING: Statistical error of QC{6} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl; | |
b3dacf6b | 4410 | } |
4411 | // Statistical error of QC{8}: | |
9da1a4f3 | 4412 | qc8ErrorSquared = 256.*pow(36.*pow(two,3.)-18.*four*two+six,2.)*pow(twoError,2.) |
4413 | + 1296.*pow(4.*pow(two,2.)-four,2.)*pow(fourError,2.) | |
4414 | + 256.*pow(two,2.)*pow(sixError,2.) | |
4415 | + pow(eightError,2.) | |
4416 | - 1152.*(36.*pow(two,3.)-18.*four*two+six)*(4.*pow(two,2.)-four)*wCov24 | |
4417 | + 512.*two*(36.*pow(two,3.)-18.*four*two+six)*wCov26 | |
4418 | - 32.*(36.*pow(two,3.)-18.*four*two+six)*wCov28 | |
4419 | - 1152.*two*(4.*pow(two,2.)-four)*wCov46 | |
4420 | + 72.*(4.*pow(two,2.)-four)*wCov48 | |
4421 | - 32.*two*wCov68; | |
4422 | if(qc8ErrorSquared>0.) | |
4423 | { | |
4424 | qc8Error = pow(qc8ErrorSquared,0.5); | |
4425 | } else | |
4426 | { | |
4427 | // cout<<"WARNING: Statistical error of QC{8} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl; | |
4428 | } | |
b3dacf6b | 4429 | // Store the results and statistical errors for Q-cumulants: |
4430 | if(TMath::Abs(qc2)>0.) | |
4431 | { | |
4432 | fIntFlowQcumulantsVsM[0]->SetBinContent(b,qc2); | |
4433 | fIntFlowQcumulantsVsM[0]->SetBinError(b,qc2Error); | |
4434 | } | |
4435 | if(TMath::Abs(qc4)>0.) | |
4436 | { | |
4437 | fIntFlowQcumulantsVsM[1]->SetBinContent(b,qc4); | |
4438 | fIntFlowQcumulantsVsM[1]->SetBinError(b,qc4Error); | |
4439 | } | |
4440 | if(TMath::Abs(qc6)>0.) | |
4441 | { | |
4442 | fIntFlowQcumulantsVsM[2]->SetBinContent(b,qc6); | |
4443 | fIntFlowQcumulantsVsM[2]->SetBinError(b,qc6Error); | |
4444 | } | |
4445 | if(TMath::Abs(qc8)>0.) | |
4446 | { | |
4447 | fIntFlowQcumulantsVsM[3]->SetBinContent(b,qc8); | |
4448 | fIntFlowQcumulantsVsM[3]->SetBinError(b,qc8Error); | |
4449 | } | |
4450 | // Rebin in M: | |
4451 | for(Int_t co=0;co<4;co++) | |
4452 | { | |
b40a910e | 4453 | if(fIntFlowCorrelationsVsMPro[co]->GetBinEffectiveEntries(b)<2){continue;} |
b3dacf6b | 4454 | value[co] = fIntFlowQcumulantsVsM[co]->GetBinContent(b); |
4455 | error[co] = fIntFlowQcumulantsVsM[co]->GetBinError(b); | |
4456 | if(error[co]>0.) | |
4457 | { | |
4458 | dSum1[co]+=value[co]/(error[co]*error[co]); | |
4459 | dSum2[co]+=1./(error[co]*error[co]); | |
4460 | } | |
4461 | } // end of for(Int_t co=0;co<4;co++) | |
9da1a4f3 | 4462 | } // end of for(Int_t b=1;b<=nBins;b++) |
b3dacf6b | 4463 | // Store rebinned Q-cumulants: |
4464 | for(Int_t co=0;co<4;co++) | |
4465 | { | |
4466 | if(dSum2[co]>0.) | |
4467 | { | |
4468 | fIntFlowQcumulantsRebinnedInM->SetBinContent(co+1,dSum1[co]/dSum2[co]); | |
4469 | fIntFlowQcumulantsRebinnedInM->SetBinError(co+1,pow(1./dSum2[co],0.5)); | |
4470 | } | |
4471 | } // end of for(Int_t co=0;co<4;co++) | |
4472 | ||
489d5531 | 4473 | } // end of AliFlowAnalysisWithQCumulants::CalculateCumulantsIntFlow() |
4474 | ||
489d5531 | 4475 | //================================================================================================================================ |
4476 | ||
b92ea2b9 | 4477 | void AliFlowAnalysisWithQCumulants::CalculateReferenceFlow() |
489d5531 | 4478 | { |
b92ea2b9 | 4479 | // a) Calculate the final results for reference flow estimates from Q-cumulants; |
4480 | // b) Propagate the statistical errors to reference flow estimates from statistical error of Q-cumulants; | |
0328db2d | 4481 | // c) Store the results and statistical errors of reference flow estimates in histogram fIntFlow. |
489d5531 | 4482 | // Binning of fIntFlow is organized as follows: |
4483 | // | |
b3dacf6b | 4484 | // 1st bin: v{2,QC} |
4485 | // 2nd bin: v{4,QC} | |
4486 | // 3rd bin: v{6,QC} | |
4487 | // 4th bin: v{8,QC} | |
4488 | // | |
489d5531 | 4489 | |
b3dacf6b | 4490 | // Reference flow estimates: |
489d5531 | 4491 | Double_t v2 = 0.; // v{2,QC} |
4492 | Double_t v4 = 0.; // v{4,QC} | |
4493 | Double_t v6 = 0.; // v{6,QC} | |
4494 | Double_t v8 = 0.; // v{8,QC} | |
b3dacf6b | 4495 | // Reference flow's statistical errors: |
4496 | Double_t v2Error = 0.; // v{2,QC} stat. error | |
4497 | Double_t v4Error = 0.; // v{4,QC} stat. error | |
4498 | Double_t v6Error = 0.; // v{6,QC} stat. error | |
4499 | Double_t v8Error = 0.; // v{8,QC} stat. error | |
4500 | ||
b92ea2b9 | 4501 | // Q-cumulants: |
4502 | Double_t qc2 = fIntFlowQcumulants->GetBinContent(1); // QC{2} | |
4503 | Double_t qc4 = fIntFlowQcumulants->GetBinContent(2); // QC{4} | |
4504 | Double_t qc6 = fIntFlowQcumulants->GetBinContent(3); // QC{6} | |
4505 | Double_t qc8 = fIntFlowQcumulants->GetBinContent(4); // QC{8} | |
4506 | // Q-cumulants's statistical errors: | |
4507 | Double_t qc2Error = fIntFlowQcumulants->GetBinError(1); // QC{2} stat. error | |
4508 | Double_t qc4Error = fIntFlowQcumulants->GetBinError(2); // QC{4} stat. error | |
4509 | Double_t qc6Error = fIntFlowQcumulants->GetBinError(3); // QC{6} stat. error | |
4510 | Double_t qc8Error = fIntFlowQcumulants->GetBinError(4); // QC{8} stat. error | |
4511 | // Calculate reference flow estimates from Q-cumulants: | |
1268c371 | 4512 | if(qc2>=0.){v2 = pow(qc2,0.5);} |
b92ea2b9 | 4513 | if(qc4<=0.){v4 = pow(-1.*qc4,1./4.);} |
4514 | if(qc6>=0.){v6 = pow((1./4.)*qc6,1./6.);} | |
4515 | if(qc8<=0.){v8 = pow((-1./33.)*qc8,1./8.);} | |
4516 | // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants: | |
1268c371 | 4517 | if(qc2>0.){v2Error = (1./2.)*pow(qc2,-0.5)*qc2Error;} |
b92ea2b9 | 4518 | if(qc4<0.){v4Error = (1./4.)*pow(-qc4,-3./4.)*qc4Error;} |
4519 | if(qc6>0.){v6Error = (1./6.)*pow(2.,-1./3.)*pow(qc6,-5./6.)*qc6Error;} | |
4520 | if(qc8<0.){v8Error = (1./8.)*pow(33.,-1./8.)*pow(-qc8,-7./8.)*qc8Error;} | |
4521 | // Print warnings for the 'wrong sign' cumulants: | |
4522 | if(TMath::Abs(v2) < 1.e-44) | |
4523 | { | |
4524 | cout<<" WARNING: Wrong sign QC{2}, couldn't calculate v{2,QC} !!!!"<<endl; | |
4525 | } | |
4526 | if(TMath::Abs(v4) < 1.e-44) | |
4527 | { | |
4528 | cout<<" WARNING: Wrong sign QC{4}, couldn't calculate v{4,QC} !!!!"<<endl; | |
4529 | } | |
4530 | if(TMath::Abs(v6) < 1.e-44) | |
4531 | { | |
4532 | cout<<" WARNING: Wrong sign QC{6}, couldn't calculate v{6,QC} !!!!"<<endl; | |
4533 | } | |
4534 | if(TMath::Abs(v8) < 1.e-44) | |
4535 | { | |
4536 | cout<<" WARNING: Wrong sign QC{8}, couldn't calculate v{8,QC} !!!!"<<endl; | |
4537 | } | |
4538 | // Store the results and statistical errors of integrated flow estimates: | |
4539 | fIntFlow->SetBinContent(1,v2); | |
4540 | fIntFlow->SetBinError(1,v2Error); | |
4541 | fIntFlow->SetBinContent(2,v4); | |
4542 | fIntFlow->SetBinError(2,v4Error); | |
4543 | fIntFlow->SetBinContent(3,v6); | |
4544 | fIntFlow->SetBinError(3,v6Error); | |
4545 | fIntFlow->SetBinContent(4,v8); | |
4546 | fIntFlow->SetBinError(4,v8Error); | |
4547 | ||
4548 | // Versus multiplicity: | |
4549 | if(!fCalculateCumulantsVsM){return;} | |
4550 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) | |
4551 | for(Int_t b=1;b<=nBins;b++) | |
9da1a4f3 | 4552 | { |
4553 | // Q-cumulants: | |
b92ea2b9 | 4554 | Double_t qc2VsM = fIntFlowQcumulantsVsM[0]->GetBinContent(b); // QC{2} |
4555 | Double_t qc4VsM = fIntFlowQcumulantsVsM[1]->GetBinContent(b); // QC{4} | |
4556 | Double_t qc6VsM = fIntFlowQcumulantsVsM[2]->GetBinContent(b); // QC{6} | |
4557 | Double_t qc8VsM = fIntFlowQcumulantsVsM[3]->GetBinContent(b); // QC{8} | |
b3dacf6b | 4558 | // Q-cumulants's statistical errors: |
b92ea2b9 | 4559 | Double_t qc2ErrorVsM = fIntFlowQcumulantsVsM[0]->GetBinError(b); // QC{2} stat. error |
4560 | Double_t qc4ErrorVsM = fIntFlowQcumulantsVsM[1]->GetBinError(b); // QC{4} stat. error | |
4561 | Double_t qc6ErrorVsM = fIntFlowQcumulantsVsM[2]->GetBinError(b); // QC{6} stat. error | |
4562 | Double_t qc8ErrorVsM = fIntFlowQcumulantsVsM[3]->GetBinError(b); // QC{8} stat. error | |
b3dacf6b | 4563 | // Reference flow estimates: |
b92ea2b9 | 4564 | Double_t v2VsM = 0.; // v{2,QC} |
4565 | Double_t v4VsM = 0.; // v{4,QC} | |
4566 | Double_t v6VsM = 0.; // v{6,QC} | |
4567 | Double_t v8VsM = 0.; // v{8,QC} | |
4568 | // Reference flow estimates errors: | |
4569 | Double_t v2ErrorVsM = 0.; // v{2,QC} stat. error | |
4570 | Double_t v4ErrorVsM = 0.; // v{4,QC} stat. error | |
4571 | Double_t v6ErrorVsM = 0.; // v{6,QC} stat. error | |
4572 | Double_t v8ErrorVsM = 0.; // v{8,QC} stat. error | |
b3dacf6b | 4573 | // Calculate reference flow estimates from Q-cumulants: |
1268c371 | 4574 | if(qc2VsM>=0.){v2VsM = pow(qc2VsM,0.5);} |
b92ea2b9 | 4575 | if(qc4VsM<=0.){v4VsM = pow(-1.*qc4VsM,1./4.);} |
4576 | if(qc6VsM>=0.){v6VsM = pow((1./4.)*qc6VsM,1./6.);} | |
4577 | if(qc8VsM<=0.){v8VsM = pow((-1./33.)*qc8VsM,1./8.);} | |
b3dacf6b | 4578 | // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants: |
1268c371 | 4579 | if(qc2VsM>0.){v2ErrorVsM = (1./2.)*pow(qc2VsM,-0.5)*qc2ErrorVsM;} |
b92ea2b9 | 4580 | if(qc4VsM<0.){v4ErrorVsM = (1./4.)*pow(-qc4VsM,-3./4.)*qc4ErrorVsM;} |
4581 | if(qc6VsM>0.){v6ErrorVsM = (1./6.)*pow(2.,-1./3.)*pow(qc6VsM,-5./6.)*qc6ErrorVsM;} | |
4582 | if(qc8VsM<0.){v8ErrorVsM = (1./8.)*pow(33.,-1./8.)*pow(-qc8VsM,-7./8.)*qc8ErrorVsM;} | |
b3dacf6b | 4583 | // Store the results and statistical errors of integrated flow estimates: |
b92ea2b9 | 4584 | fIntFlowVsM[0]->SetBinContent(b,v2VsM); |
4585 | fIntFlowVsM[0]->SetBinError(b,v2ErrorVsM); | |
4586 | fIntFlowVsM[1]->SetBinContent(b,v4VsM); | |
4587 | fIntFlowVsM[1]->SetBinError(b,v4ErrorVsM); | |
4588 | fIntFlowVsM[2]->SetBinContent(b,v6VsM); | |
4589 | fIntFlowVsM[2]->SetBinError(b,v6ErrorVsM); | |
4590 | fIntFlowVsM[3]->SetBinContent(b,v8VsM); | |
4591 | fIntFlowVsM[3]->SetBinError(b,v8ErrorVsM); | |
4592 | } // end of for(Int_t b=1;b<=nBins;b++) | |
4593 | ||
4594 | // 'Rebinned in M' calculation: // to be improved - this can be implemented better: | |
4595 | // Reference flow estimates: | |
4596 | Double_t v2RebinnedInM = 0.; // v{2,QC} | |
4597 | Double_t v4RebinnedInM = 0.; // v{4,QC} | |
4598 | Double_t v6RebinnedInM = 0.; // v{6,QC} | |
4599 | Double_t v8RebinnedInM = 0.; // v{8,QC} | |
4600 | // Reference flow's statistical errors: | |
4601 | Double_t v2ErrorRebinnedInM = 0.; // v{2,QC} stat. error | |
4602 | Double_t v4ErrorRebinnedInM = 0.; // v{4,QC} stat. error | |
4603 | Double_t v6ErrorRebinnedInM = 0.; // v{6,QC} stat. error | |
4604 | Double_t v8ErrorRebinnedInM = 0.; // v{8,QC} stat. error | |
4605 | // Q-cumulants: | |
4606 | Double_t qc2RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(1); // QC{2} | |
4607 | Double_t qc4RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(2); // QC{4} | |
4608 | Double_t qc6RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(3); // QC{6} | |
4609 | Double_t qc8RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(4); // QC{8} | |
4610 | // Q-cumulants's statistical errors: | |
4611 | Double_t qc2ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(1); // QC{2} stat. error | |
4612 | Double_t qc4ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(2); // QC{4} stat. error | |
4613 | Double_t qc6ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(3); // QC{6} stat. error | |
4614 | Double_t qc8ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(4); // QC{8} stat. error | |
4615 | // Calculate reference flow estimates from Q-cumulants: | |
1268c371 | 4616 | if(qc2RebinnedInM>=0.){v2RebinnedInM = pow(qc2RebinnedInM,0.5);} |
b92ea2b9 | 4617 | if(qc4RebinnedInM<=0.){v4RebinnedInM = pow(-1.*qc4RebinnedInM,1./4.);} |
4618 | if(qc6RebinnedInM>=0.){v6RebinnedInM = pow((1./4.)*qc6RebinnedInM,1./6.);} | |
4619 | if(qc8RebinnedInM<=0.){v8RebinnedInM = pow((-1./33.)*qc8RebinnedInM,1./8.);} | |
4620 | // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants: | |
1268c371 | 4621 | if(qc2RebinnedInM>0.){v2ErrorRebinnedInM = (1./2.)*pow(qc2RebinnedInM,-0.5)*qc2ErrorRebinnedInM;} |
b92ea2b9 | 4622 | if(qc4RebinnedInM<0.){v4ErrorRebinnedInM = (1./4.)*pow(-qc4RebinnedInM,-3./4.)*qc4ErrorRebinnedInM;} |
4623 | if(qc6RebinnedInM>0.){v6ErrorRebinnedInM = (1./6.)*pow(2.,-1./3.)*pow(qc6RebinnedInM,-5./6.)*qc6ErrorRebinnedInM;} | |
4624 | if(qc8RebinnedInM<0.){v8ErrorRebinnedInM = (1./8.)*pow(33.,-1./8.)*pow(-qc8RebinnedInM,-7./8.)*qc8ErrorRebinnedInM;} | |
4625 | // Print warnings for the 'wrong sign' cumulants: | |
4626 | if(TMath::Abs(v2RebinnedInM) < 1.e-44) | |
4627 | { | |
4628 | cout<<" WARNING: Wrong sign QC{2} rebinned in M, couldn't calculate v{2,QC} !!!!"<<endl; | |
4629 | } | |
4630 | if(TMath::Abs(v4RebinnedInM) < 1.e-44) | |
4631 | { | |
4632 | cout<<" WARNING: Wrong sign QC{4} rebinned in M, couldn't calculate v{4,QC} !!!!"<<endl; | |
4633 | } | |
4634 | if(TMath::Abs(v6RebinnedInM) < 1.e-44) | |
4635 | { | |
4636 | cout<<" WARNING: Wrong sign QC{6} rebinned in M, couldn't calculate v{6,QC} !!!!"<<endl; | |
4637 | } | |
4638 | if(TMath::Abs(v8RebinnedInM) < 1.e-44) | |
4639 | { | |
4640 | cout<<" WARNING: Wrong sign QC{8} rebinned in M, couldn't calculate v{8,QC} !!!!"<<endl; | |
4641 | } | |
4642 | // Store the results and statistical errors of integrated flow estimates: | |
4643 | fIntFlowRebinnedInM->SetBinContent(1,v2RebinnedInM); | |
4644 | fIntFlowRebinnedInM->SetBinError(1,v2ErrorRebinnedInM); | |
4645 | fIntFlowRebinnedInM->SetBinContent(2,v4RebinnedInM); | |
4646 | fIntFlowRebinnedInM->SetBinError(2,v4ErrorRebinnedInM); | |
4647 | fIntFlowRebinnedInM->SetBinContent(3,v6RebinnedInM); | |
4648 | fIntFlowRebinnedInM->SetBinError(3,v6ErrorRebinnedInM); | |
4649 | fIntFlowRebinnedInM->SetBinContent(4,v8RebinnedInM); | |
4650 | fIntFlowRebinnedInM->SetBinError(4,v8ErrorRebinnedInM); | |
4651 | ||
4652 | } // end of AliFlowAnalysisWithQCumulants::CalculateReferenceFlow() | |
489d5531 | 4653 | |
489d5531 | 4654 | //================================================================================================================================ |
4655 | ||
489d5531 | 4656 | void AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow() |
4657 | { | |
0dd3b008 | 4658 | // Fill in AliFlowCommonHistResults histograms relevant for reference flow. |
489d5531 | 4659 | |
0dd3b008 | 4660 | // There are two possibilities here: |
4661 | // a) Store minimum bias reference flow - use SetMinimumBiasReferenceFlow(kTRUE). This result is | |
4662 | // biased by the interplay between nonflow correlations and multiplicity fluctuations and is | |
4663 | // also stored in local histogram fIntFlow; | |
4664 | // b) Store reference flow obtained from flow analysis performed at fixed multiplicity and | |
4665 | // rebinned only at the end of the day - use SetMinimumBiasReferenceFlow(kFALSE). This result | |
4666 | // is also stored in local histogram fIntFlowRebinnedInM. | |
489d5531 | 4667 | |
0dd3b008 | 4668 | // Reference flow estimates: |
4669 | Double_t v[4] = {0.}; | |
4670 | // Statistical errors of reference flow estimates: | |
4671 | Double_t vError[4] = {0.}; | |
489d5531 | 4672 | |
0dd3b008 | 4673 | for(Int_t b=0;b<4;b++) |
4674 | { | |
4675 | if(fMinimumBiasReferenceFlow) | |
4676 | { | |
4677 | v[b] = fIntFlow->GetBinContent(b+1); | |
4678 | vError[b] = fIntFlow->GetBinError(b+1); | |
4679 | } else | |
4680 | { | |
4681 | v[b] = fIntFlowRebinnedInM->GetBinContent(b+1); | |
4682 | vError[b] = fIntFlowRebinnedInM->GetBinError(b+1); | |
4683 | } | |
4684 | } // end of for(Int_t b=0;b<4;b++) | |
4685 | ||
4686 | // Fill AliFlowCommonHistResults histogram: | |
4687 | fCommonHistsResults2nd->FillIntegratedFlow(v[0],vError[0]); // to be improved (hardwired 2nd in the name) | |
4688 | fCommonHistsResults4th->FillIntegratedFlow(v[1],vError[1]); // to be improved (hardwired 4th in the name) | |
489d5531 | 4689 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) // to be improved (calculate also 6th and 8th order) |
4690 | { | |
0dd3b008 | 4691 | fCommonHistsResults6th->FillIntegratedFlow(v[2],vError[2]); // to be improved (hardwired 6th in the name) |
4692 | fCommonHistsResults8th->FillIntegratedFlow(v[3],vError[3]); // to be improved (hardwired 8th in the name) | |
489d5531 | 4693 | } |
4694 | ||
4695 | } // end of AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow() | |
4696 | ||
489d5531 | 4697 | //================================================================================================================================ |
4698 | ||
489d5531 | 4699 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelationsUsingParticleWeights() |
4700 | { | |
4701 | // Calculate all correlations needed for integrated flow using particle weights. | |
4702 | ||
4703 | // Remark 1: When particle weights are used the binning of fIntFlowCorrelationAllPro is organized as follows: | |
4704 | // | |
4705 | // 1st bin: <2>_{1n|1n} = two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))> | |
4706 | // 2nd bin: <2>_{2n|2n} = two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
4707 | // 3rd bin: <2>_{3n|3n} = two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
4708 | // 4th bin: <2>_{4n|4n} = two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
4709 | // 5th bin: ---- EMPTY ---- | |
4710 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
4711 | // 7th bin: <3>_{3n|2n,1n} = ... | |
4712 | // 8th bin: <3>_{4n|2n,2n} = ... | |
4713 | // 9th bin: <3>_{4n|3n,1n} = ... | |
4714 | // 10th bin: ---- EMPTY ---- | |
4715 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
4716 | // 12th bin: <4>_{2n,1n|2n,1n} = ... | |
4717 | // 13th bin: <4>_{2n,2n|2n,2n} = ... | |
4718 | // 14th bin: <4>_{3n|1n,1n,1n} = ... | |
4719 | // 15th bin: <4>_{3n,1n|3n,1n} = ... | |
4720 | // 16th bin: <4>_{3n,1n|2n,2n} = ... | |
4721 | // 17th bin: <4>_{4n|2n,1n,1n} = ... | |
4722 | // 18th bin: ---- EMPTY ---- | |
4723 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = ... | |
4724 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = ... | |
4725 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = ... | |
4726 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = ... | |
4727 | // 23rd bin: ---- EMPTY ---- | |
4728 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = ... | |
4729 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = ... | |
4730 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = ... | |
4731 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = ... | |
4732 | // 28th bin: ---- EMPTY ---- | |
4733 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = ... | |
4734 | // 30th bin: ---- EMPTY ---- | |
4735 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = ... | |
4736 | ||
4737 | // Remark 2: When particle weights are used there are some extra correlations. They are stored in | |
4738 | // fIntFlowExtraCorrelationsPro binning of which is organized as follows: | |
4739 | ||
4740 | // 1st bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))> | |
4741 | // 2nd bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
4742 | ||
4743 | // multiplicity (number of particles used to determine the reaction plane) | |
1268c371 | 4744 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 4745 | |
4746 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
4747 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
4748 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
4749 | Double_t dReQ3n3k = (*fReQ)(2,3); | |
4750 | Double_t dReQ4n4k = (*fReQ)(3,4); | |
4751 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
4752 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
4753 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
4754 | Double_t dImQ3n3k = (*fImQ)(2,3); | |
4755 | Double_t dImQ4n4k = (*fImQ)(3,4); | |
4756 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
4757 | ||
4758 | // dMs are variables introduced in order to simplify some Eqs. bellow: | |
4759 | //.............................................................................................. | |
1268c371 | 4760 | Double_t dM11 = (*fSpk)(1,1)-(*fSpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
4761 | Double_t dM22 = (*fSpk)(1,2)-(*fSpk)(0,4); // dM22 = sum_{i,j=1,i!=j}^M w_i^2 w_j^2 | |
4762 | Double_t dM33 = (*fSpk)(1,3)-(*fSpk)(0,6); // dM33 = sum_{i,j=1,i!=j}^M w_i^3 w_j^3 | |
4763 | Double_t dM44 = (*fSpk)(1,4)-(*fSpk)(0,8); // dM44 = sum_{i,j=1,i!=j}^M w_i^4 w_j^4 | |
4764 | Double_t dM31 = (*fSpk)(0,3)*(*fSpk)(0,1)-(*fSpk)(0,4); // dM31 = sum_{i,j=1,i!=j}^M w_i^3 w_j | |
4765 | Double_t dM211 = (*fSpk)(0,2)*(*fSpk)(1,1)-2.*(*fSpk)(0,3)*(*fSpk)(0,1) | |
4766 | - (*fSpk)(1,2)+2.*(*fSpk)(0,4); // dM211 = sum_{i,j,k=1,i!=j!=k}^M w_i^2 w_j w_k | |
4767 | Double_t dM1111 = (*fSpk)(3,1)-6.*(*fSpk)(0,2)*(*fSpk)(1,1) | |
4768 | + 8.*(*fSpk)(0,3)*(*fSpk)(0,1) | |
4769 | + 3.*(*fSpk)(1,2)-6.*(*fSpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l | |
489d5531 | 4770 | //.............................................................................................. |
4771 | ||
4772 | // 2-particle correlations: | |
4773 | Double_t two1n1nW1W1 = 0.; // <w1 w2 cos(n*(phi1-phi2))> | |
4774 | Double_t two2n2nW2W2 = 0.; // <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
4775 | Double_t two3n3nW3W3 = 0.; // <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
4776 | Double_t two4n4nW4W4 = 0.; // <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
4777 | if(dMult>1) | |
4778 | { | |
4779 | if(dM11) | |
4780 | { | |
1268c371 | 4781 | two1n1nW1W1 = (pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSpk)(0,2))/dM11; |
489d5531 | 4782 | // average correlation <w1 w2 cos(n*(phi1-phi2))> for single event: |
4783 | fIntFlowCorrelationsEBE->SetBinContent(1,two1n1nW1W1); | |
4784 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(1,dM11); | |
4785 | // average correlation <w1 w2 cos(n*(phi1-phi2))> for all events: | |
b40a910e | 4786 | fIntFlowCorrelationsPro->Fill(0.5,two1n1nW1W1,dM11); |
4787 | // average squared correlation <w1 w2 cos(n*(phi1-phi2))> for all events: | |
4788 | fIntFlowSquaredCorrelationsPro->Fill(0.5,two1n1nW1W1*two1n1nW1W1,dM11); | |
489d5531 | 4789 | fIntFlowCorrelationsAllPro->Fill(0.5,two1n1nW1W1,dM11); |
4790 | } | |
4791 | if(dM22) | |
4792 | { | |
1268c371 | 4793 | two2n2nW2W2 = (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)-(*fSpk)(0,4))/dM22; |
489d5531 | 4794 | // ... |
4795 | // average correlation <w1^2 w2^2 cos(2n*(phi1-phi2))> for all events: | |
4796 | fIntFlowCorrelationsAllPro->Fill(1.5,two2n2nW2W2,dM22); | |
4797 | } | |
4798 | if(dM33) | |
4799 | { | |
1268c371 | 4800 | two3n3nW3W3 = (pow(dReQ3n3k,2)+pow(dImQ3n3k,2)-(*fSpk)(0,6))/dM33; |
489d5531 | 4801 | // ... |
4802 | // average correlation <w1^3 w2^3 cos(3n*(phi1-phi2))> for all events: | |
4803 | fIntFlowCorrelationsAllPro->Fill(2.5,two3n3nW3W3,dM33); | |
4804 | } | |
4805 | if(dM44) | |
4806 | { | |
1268c371 | 4807 | two4n4nW4W4 = (pow(dReQ4n4k,2)+pow(dImQ4n4k,2)-(*fSpk)(0,8))/dM44; |
489d5531 | 4808 | // ... |
4809 | // average correlation <w1^4 w2^4 cos(4n*(phi1-phi2))> for all events: | |
4810 | fIntFlowCorrelationsAllPro->Fill(3.5,two4n4nW4W4,dM44); | |
4811 | } | |
4812 | } // end of if(dMult>1) | |
4813 | ||
4814 | // extra 2-particle correlations: | |
4815 | Double_t two1n1nW3W1 = 0.; // <w1^3 w2 cos(n*(phi1-phi2))> | |
4816 | Double_t two1n1nW1W1W2 = 0.; // <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
4817 | if(dMult>1) | |
4818 | { | |
4819 | if(dM31) | |
4820 | { | |
1268c371 | 4821 | two1n1nW3W1 = (dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k-(*fSpk)(0,4))/dM31; |
489d5531 | 4822 | fIntFlowExtraCorrelationsPro->Fill(0.5,two1n1nW3W1,dM31); |
4823 | } | |
4824 | if(dM211) | |
4825 | { | |
1268c371 | 4826 | two1n1nW1W1W2 = ((*fSpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSpk)(0,2)) |
489d5531 | 4827 | - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k |
1268c371 | 4828 | - (*fSpk)(0,4)))/dM211; |
489d5531 | 4829 | fIntFlowExtraCorrelationsPro->Fill(1.5,two1n1nW1W1W2,dM211); |
4830 | } | |
4831 | } // end of if(dMult>1) | |
4832 | //.............................................................................................. | |
4833 | ||
4834 | //.............................................................................................. | |
4835 | // 3-particle correlations: | |
4836 | Double_t three2n1n1nW2W1W1 = 0.; // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
4837 | ||
4838 | if(dMult>2) | |
4839 | { | |
4840 | if(dM211) | |
4841 | { | |
4842 | three2n1n1nW2W1W1 = (pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k | |
4843 | - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k) | |
4844 | - pow(dReQ2n2k,2)-pow(dImQ2n2k,2) | |
1268c371 | 4845 | + 2.*(*fSpk)(0,4))/dM211; |
489d5531 | 4846 | fIntFlowCorrelationsAllPro->Fill(5.5,three2n1n1nW2W1W1,dM211); |
4847 | } | |
4848 | } // end of if(dMult>2) | |
4849 | //.............................................................................................. | |
4850 | ||
4851 | //.............................................................................................. | |
4852 | // 4-particle correlations: | |
4853 | Double_t four1n1n1n1nW1W1W1W1 = 0.; // <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
4854 | if(dMult>3) | |
4855 | { | |
4856 | if(dM1111) | |
4857 | { | |
4858 | four1n1n1n1nW1W1W1W1 = (pow(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.),2) | |
4859 | - 2.*(pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k) | |
4860 | + 8.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k) | |
4861 | + (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)) | |
1268c371 | 4862 | - 4.*(*fSpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
4863 | - 6.*(*fSpk)(0,4)+2.*(*fSpk)(1,2))/dM1111; | |
489d5531 | 4864 | |
4865 | // average correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for single event: | |
4866 | fIntFlowCorrelationsEBE->SetBinContent(2,four1n1n1n1nW1W1W1W1); | |
4867 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(2,dM1111); | |
4868 | // average correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for all events: | |
4869 | fIntFlowCorrelationsPro->Fill(1.5,four1n1n1n1nW1W1W1W1,dM1111); | |
b40a910e | 4870 | // average squared correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for all events: |
4871 | fIntFlowSquaredCorrelationsPro->Fill(1.5,four1n1n1n1nW1W1W1W1*four1n1n1n1nW1W1W1W1,dM1111); | |
489d5531 | 4872 | fIntFlowCorrelationsAllPro->Fill(10.5,four1n1n1n1nW1W1W1W1,dM1111); |
4873 | } | |
4874 | } // end of if(dMult>3) | |
4875 | //.............................................................................................. | |
4876 | ||
4877 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelationsUsingParticleWeights() | |
4878 | ||
489d5531 | 4879 | //================================================================================================================================ |
4880 | ||
489d5531 | 4881 | void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow() |
4882 | { | |
4883 | // Initialize all arrays used to calculate integrated flow. | |
4884 | ||
4885 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
4886 | { | |
4887 | fIntFlowCorrectionTermsForNUAEBE[sc] = NULL; | |
0328db2d | 4888 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc] = NULL; |
489d5531 | 4889 | fIntFlowCorrectionTermsForNUAPro[sc] = NULL; |
4890 | fIntFlowCorrectionTermsForNUAHist[sc] = NULL; | |
b92ea2b9 | 4891 | for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) |
2001bc3a | 4892 | { |
4893 | fIntFlowCorrectionTermsForNUAVsMPro[sc][ci] = NULL; | |
4894 | } | |
0328db2d | 4895 | for(Int_t power=0;power<2;power++) // linear or quadratic |
4896 | { | |
4897 | fIntFlowSumOfEventWeightsNUA[sc][power] = NULL; | |
4898 | } | |
489d5531 | 4899 | } |
4900 | for(Int_t power=0;power<2;power++) // linear or quadratic | |
4901 | { | |
4902 | fIntFlowSumOfEventWeights[power] = NULL; | |
4903 | } | |
b3dacf6b | 4904 | for(Int_t i=0;i<4;i++) // print on the screen the final results (0=RF, 1=RP, 2=POI, 3=RF (rebbined in M)) |
489d5531 | 4905 | { |
4906 | fPrintFinalResults[i] = kTRUE; | |
4907 | } | |
ff70ca91 | 4908 | for(Int_t ci=0;ci<4;ci++) // correlation index or cumulant order |
4909 | { | |
4910 | fIntFlowCorrelationsVsMPro[ci] = NULL; | |
b40a910e | 4911 | fIntFlowSquaredCorrelationsVsMPro[ci] = NULL; |
ff70ca91 | 4912 | fIntFlowCorrelationsVsMHist[ci] = NULL; |
4913 | fIntFlowQcumulantsVsM[ci] = NULL; | |
4914 | fIntFlowVsM[ci] = NULL; | |
2001bc3a | 4915 | fIntFlowDetectorBiasVsM[ci] = NULL; |
ff70ca91 | 4916 | for(Int_t lc=0;lc<2;lc++) |
4917 | { | |
4918 | fIntFlowSumOfEventWeightsVsM[ci][lc] = NULL; | |
4919 | } | |
4920 | } | |
4921 | for(Int_t pi=0;pi<6;pi++) // product or covariance index | |
4922 | { | |
4923 | fIntFlowProductOfCorrelationsVsMPro[pi] = NULL; | |
4924 | fIntFlowCovariancesVsM[pi] = NULL; | |
4925 | fIntFlowSumOfProductOfEventWeightsVsM[pi] = NULL; | |
4926 | } | |
e5834fcb | 4927 | |
489d5531 | 4928 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow() |
4929 | ||
489d5531 | 4930 | //================================================================================================================================ |
4931 | ||
489d5531 | 4932 | void AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow() |
4933 | { | |
4934 | // Initialize all arrays needed to calculate differential flow. | |
4935 | // a) Initialize lists holding profiles; | |
4936 | // b) Initialize lists holding histograms; | |
4937 | // c) Initialize event-by-event quantities; | |
4938 | // d) Initialize profiles; | |
4939 | // e) Initialize histograms holding final results. | |
4940 | ||
4941 | // a) Initialize lists holding profiles; | |
4942 | for(Int_t t=0;t<2;t++) // type (RP, POI) | |
4943 | { | |
4944 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
4945 | { | |
4946 | fDiffFlowCorrelationsProList[t][pe] = NULL; | |
4947 | fDiffFlowProductOfCorrelationsProList[t][pe] = NULL; | |
4948 | fDiffFlowCorrectionsProList[t][pe] = NULL; | |
4949 | } | |
1268c371 | 4950 | // 2D: |
4951 | f2DDiffFlowCorrelationsProList[t] = NULL; | |
489d5531 | 4952 | } |
4953 | ||
4954 | // b) Initialize lists holding histograms; | |
4955 | for(Int_t t=0;t<2;t++) // type (RP, POI) | |
4956 | { | |
4957 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
4958 | { | |
4959 | fDiffFlowCorrelationsHistList[t][pe] = NULL; | |
4960 | for(Int_t power=0;power<2;power++) | |
4961 | { | |
4962 | fDiffFlowSumOfEventWeightsHistList[t][pe][power] = NULL; | |
4963 | } // end of for(Int_t power=0;power<2;power++) | |
4964 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe] = NULL; | |
4965 | fDiffFlowCorrectionsHistList[t][pe] = NULL; | |
4966 | fDiffFlowCovariancesHistList[t][pe] = NULL; | |
4967 | fDiffFlowCumulantsHistList[t][pe] = NULL; | |
1268c371 | 4968 | fDiffFlowDetectorBiasHistList[t][pe] = NULL; |
489d5531 | 4969 | fDiffFlowHistList[t][pe] = NULL; |
4970 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
4971 | } // enf of for(Int_t t=0;t<2;t++) // type (RP, POI) | |
4972 | ||
4973 | // c) Initialize event-by-event quantities: | |
4974 | // 1D: | |
4975 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
4976 | { | |
4977 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
4978 | { | |
4979 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
4980 | { | |
4981 | for(Int_t k=0;k<9;k++) // power of weight | |
4982 | { | |
4983 | fReRPQ1dEBE[t][pe][m][k] = NULL; | |
4984 | fImRPQ1dEBE[t][pe][m][k] = NULL; | |
4985 | fs1dEBE[t][pe][k] = NULL; // to be improved (this doesn't need to be within loop over m) | |
4986 | } | |
4987 | } | |
4988 | } | |
4989 | } | |
4990 | // 1D: | |
4991 | for(Int_t t=0;t<2;t++) // type (RP or POI) | |
4992 | { | |
4993 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
4994 | { | |
4995 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
4996 | { | |
4997 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
4998 | { | |
4999 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti] = NULL; | |
5000 | } | |
5001 | } | |
5002 | } | |
5003 | } | |
5004 | // 2D: | |
5005 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
5006 | { | |
5007 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
5008 | { | |
5009 | for(Int_t k=0;k<9;k++) // power of weight | |
5010 | { | |
5011 | fReRPQ2dEBE[t][m][k] = NULL; | |
5012 | fImRPQ2dEBE[t][m][k] = NULL; | |
5013 | fs2dEBE[t][k] = NULL; // to be improved (this doesn't need to be within loop over m) | |
5014 | } | |
5015 | } | |
5016 | } | |
5017 | ||
5018 | // d) Initialize profiles: | |
5019 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
5020 | { | |
5021 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5022 | { | |
5023 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
5024 | { | |
5025 | fDiffFlowCorrelationsPro[t][pe][ci] = NULL; | |
b40a910e | 5026 | fDiffFlowSquaredCorrelationsPro[t][pe][ci] = NULL; |
489d5531 | 5027 | } // end of for(Int_t ci=0;ci<4;ci++) |
5028 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
5029 | { | |
5030 | for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index | |
5031 | { | |
5032 | fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = NULL; | |
5033 | } // end of for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index | |
5034 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
5035 | // correction terms for nua: | |
5036 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
5037 | { | |
5038 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
5039 | { | |
5040 | fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = NULL; | |
5041 | } | |
5042 | } | |
5043 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
1268c371 | 5044 | for(Int_t ci=0;ci<4;ci++) // correlation index |
5045 | { | |
5046 | f2DDiffFlowCorrelationsPro[t][ci] = NULL; | |
5047 | } | |
489d5531 | 5048 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI |
5049 | ||
5050 | // e) Initialize histograms holding final results. | |
5051 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
5052 | { | |
5053 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5054 | { | |
5055 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
5056 | { | |
5057 | fDiffFlowCorrelationsHist[t][pe][ci] = NULL; | |
5058 | fDiffFlowCumulants[t][pe][ci] = NULL; | |
1268c371 | 5059 | fDiffFlowDetectorBias[t][pe][ci] = NULL; |
489d5531 | 5060 | fDiffFlow[t][pe][ci] = NULL; |
5061 | } // end of for(Int_t ci=0;ci<4;ci++) | |
5062 | for(Int_t covarianceIndex=0;covarianceIndex<5;covarianceIndex++) | |
5063 | { | |
5064 | fDiffFlowCovariances[t][pe][covarianceIndex] = NULL; | |
5065 | } // end of for(Int_t covarianceIndex=0;covarianceIndex<5;covarianceIndex++) | |
5066 | // correction terms for nua: | |
5067 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
5068 | { | |
5069 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
5070 | { | |
5071 | fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = NULL; | |
5072 | } | |
5073 | } | |
5074 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
1268c371 | 5075 | for(Int_t ci=0;ci<4;ci++) // correlation index |
5076 | { | |
5077 | f2DDiffFlowCumulants[t][ci] = NULL; | |
5078 | f2DDiffFlow[t][ci] = NULL; | |
5079 | } | |
489d5531 | 5080 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI |
5081 | ||
5082 | // sum of event weights for reduced correlations: | |
5083 | for(Int_t t=0;t<2;t++) // type = RP or POI | |
5084 | { | |
5085 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5086 | { | |
5087 | for(Int_t p=0;p<2;p++) // power of weight is 1 or 2 | |
5088 | { | |
5089 | for(Int_t ew=0;ew<4;ew++) // event weight index for reduced correlations | |
5090 | { | |
5091 | fDiffFlowSumOfEventWeights[t][pe][p][ew] = NULL; | |
5092 | } | |
5093 | } | |
5094 | } | |
5095 | } | |
5096 | // product of event weights for both types of correlations: | |
5097 | for(Int_t t=0;t<2;t++) // type = RP or POI | |
5098 | { | |
5099 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5100 | { | |
5101 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
5102 | { | |
5103 | for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index | |
5104 | { | |
5105 | fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = NULL; | |
5106 | } | |
5107 | } | |
5108 | } | |
5109 | } | |
1268c371 | 5110 | |
5111 | } // end of AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow() | |
5112 | ||
5113 | //================================================================================================================================ | |
489d5531 | 5114 | |
1268c371 | 5115 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulants(TString type, TString ptOrEta) |
5116 | { | |
5117 | // Calculate differential flow cumulants from measured multiparticle correlations. | |
489d5531 | 5118 | |
1268c371 | 5119 | // REMARK: Cumulants calculated in this method are NOT corrected for non-uniform acceptance. |
5120 | // This correction, if enabled via setter SetApplyCorrectionForNUA(Bool_t), is applied | |
5121 | // in the method CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta) | |
489d5531 | 5122 | |
1268c371 | 5123 | Int_t t = 0; |
5124 | Int_t pe = 0; | |
5125 | ||
5126 | if(type == "RP") | |
5127 | { | |
5128 | t = 0; | |
5129 | } else if(type == "POI") | |
5130 | { | |
5131 | t = 1; | |
5132 | } | |
5133 | ||
5134 | if(ptOrEta == "Pt") | |
5135 | { | |
5136 | pe = 0; | |
5137 | } else if(ptOrEta == "Eta") | |
5138 | { | |
5139 | pe = 1; | |
5140 | } | |
5141 | ||
5142 | // Common: | |
5143 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
489d5531 | 5144 | |
1268c371 | 5145 | // Correlation <<2>>: |
5146 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); | |
5147 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); | |
489d5531 | 5148 | |
1268c371 | 5149 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) |
489d5531 | 5150 | { |
1268c371 | 5151 | // Reduced correlations: |
5152 | Double_t twoPrime = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); // <<2'>> | |
5153 | Double_t twoPrimeError = fDiffFlowCorrelationsHist[t][pe][0]->GetBinError(b); // stat. error of <<2'>> | |
5154 | Double_t fourPrime = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); // <<4'>> | |
5155 | Double_t fourPrimeError = fDiffFlowCorrelationsHist[t][pe][1]->GetBinError(b); // stat. error of <<4'>> | |
5156 | // Covariances: | |
5157 | Double_t wCovTwoTwoReduced = fDiffFlowCovariances[t][pe][0]->GetBinContent(b); // Cov(<2>,<2'>) * prefactor(<2>,<2'>) | |
5158 | Double_t wCovTwoFourReduced = fDiffFlowCovariances[t][pe][1]->GetBinContent(b); // Cov(<2>,<4'>) * prefactor(<2>,<4'>) | |
5159 | Double_t wCovTwoReducedFourReduced = fDiffFlowCovariances[t][pe][4]->GetBinContent(b); // Cov(<2'>,<4'>) * prefactor(<2'>,<4'>) | |
5160 | // QC{2'}: | |
5161 | Double_t qc2Prime = twoPrime; // QC{2'} | |
5162 | Double_t qc2PrimeError = twoPrimeError; // stat. error of QC{2'} | |
5163 | fDiffFlowCumulants[t][pe][0]->SetBinContent(b,qc2Prime); | |
5164 | fDiffFlowCumulants[t][pe][0]->SetBinError(b,qc2PrimeError); | |
5165 | // QC{4'}: | |
5166 | Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>> | |
5167 | Double_t qc4PrimeError = 0.; // stat. error of QC{4'} | |
5168 | Double_t qc4PrimeErrorSquared = 4.*pow(twoPrime,2.)*pow(twoError,2.) | |
5169 | + 4.*pow(two,2.)*pow(twoPrimeError,2.) | |
5170 | + pow(fourPrimeError,2.) | |
5171 | + 8.*two*twoPrime*wCovTwoTwoReduced | |
5172 | - 4.*twoPrime*wCovTwoFourReduced | |
5173 | - 4.*two*wCovTwoReducedFourReduced; | |
5174 | if(qc4PrimeErrorSquared>0.) | |
5175 | { | |
5176 | qc4PrimeError = pow(qc4PrimeErrorSquared,0.5); | |
489d5531 | 5177 | } |
1268c371 | 5178 | fDiffFlowCumulants[t][pe][1]->SetBinContent(b,qc4Prime); |
5179 | fDiffFlowCumulants[t][pe][1]->SetBinError(b,qc4PrimeError); | |
489d5531 | 5180 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
489d5531 | 5181 | |
1268c371 | 5182 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulants(TString type, Bool_t useParticleWeights, TString eventWeights); |
489d5531 | 5183 | |
5184 | //================================================================================================================================ | |
5185 | ||
1268c371 | 5186 | void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCumulants(TString type) |
489d5531 | 5187 | { |
1268c371 | 5188 | // Calculate 2D differential cumulants. |
489d5531 | 5189 | |
1268c371 | 5190 | // Remark: correction for detector effects and error propagation not implemented yet for 2D differential cumulants. |
489d5531 | 5191 | |
1268c371 | 5192 | Int_t t = 0; |
489d5531 | 5193 | |
5194 | if(type == "RP") | |
5195 | { | |
1268c371 | 5196 | t = 0; |
489d5531 | 5197 | } else if(type == "POI") |
5198 | { | |
1268c371 | 5199 | t = 1; |
5200 | } | |
5201 | ||
5202 | // Reference correlation <<2>>: | |
5203 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); | |
489d5531 | 5204 | |
1268c371 | 5205 | // Looping over all (pt,eta) bins and calculating differential flow cumulants: |
5206 | for(Int_t p=1;p<=fnBinsPt;p++) | |
489d5531 | 5207 | { |
5208 | for(Int_t e=1;e<=fnBinsEta;e++) | |
5209 | { | |
1268c371 | 5210 | // Reduced correlations: |
5211 | Double_t twoPrime = f2DDiffFlowCorrelationsPro[t][0]->GetBinContent(f2DDiffFlowCorrelationsPro[t][0]->GetBin(p,e)); // <<2'>>(pt,eta) | |
5212 | Double_t fourPrime = f2DDiffFlowCorrelationsPro[t][1]->GetBinContent(f2DDiffFlowCorrelationsPro[t][1]->GetBin(p,e)); // <<4'>>(pt,eta) | |
5213 | // Cumulants: | |
5214 | Double_t qc2Prime = twoPrime; // QC{2'} = <<2'>> | |
5215 | f2DDiffFlowCumulants[t][0]->SetBinContent(f2DDiffFlowCumulants[t][0]->GetBin(p,e),qc2Prime); | |
5216 | Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>> | |
5217 | f2DDiffFlowCumulants[t][1]->SetBinContent(f2DDiffFlowCumulants[t][1]->GetBin(p,e),qc4Prime); | |
489d5531 | 5218 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) |
489d5531 | 5219 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
5220 | ||
1268c371 | 5221 | } // end of void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCumulants(TString type) |
489d5531 | 5222 | |
489d5531 | 5223 | //================================================================================================================================ |
5224 | ||
489d5531 | 5225 | void AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type) |
5226 | { | |
1268c371 | 5227 | // Calculate final results for integrated flow of RPs and POIs. |
489d5531 | 5228 | |
1268c371 | 5229 | // to be improved - check if the integrated flow calculation here is actually correct |
5230 | ||
5231 | Int_t t = 0; // RP = 0, POI = 1 | |
489d5531 | 5232 | |
5233 | if(type == "RP") | |
5234 | { | |
1268c371 | 5235 | t = 0; |
489d5531 | 5236 | } else if(type == "POI") |
5237 | { | |
1268c371 | 5238 | t = 1; |
5239 | } | |
489d5531 | 5240 | |
489d5531 | 5241 | // pt yield: |
5242 | TH1F *yield2ndPt = NULL; | |
5243 | TH1F *yield4thPt = NULL; | |
5244 | TH1F *yield6thPt = NULL; | |
5245 | TH1F *yield8thPt = NULL; | |
5246 | ||
5247 | if(type == "POI") | |
5248 | { | |
dd442cd2 | 5249 | if(fFillMultipleControlHistograms) |
5250 | { | |
5251 | yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtPOI())->Clone(); | |
5252 | yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtPOI())->Clone(); | |
5253 | yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtPOI())->Clone(); | |
5254 | yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtPOI())->Clone(); | |
5255 | } else | |
5256 | { | |
5257 | yield2ndPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
5258 | yield4thPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
5259 | yield6thPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
5260 | yield8thPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
5261 | } | |
489d5531 | 5262 | } |
5263 | else if(type == "RP") | |
5264 | { | |
dd442cd2 | 5265 | if(fFillMultipleControlHistograms) |
5266 | { | |
5267 | yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtRP())->Clone(); | |
5268 | yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtRP())->Clone(); | |
5269 | yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtRP())->Clone(); | |
5270 | yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtRP())->Clone(); | |
5271 | } else | |
5272 | { | |
5273 | yield2ndPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
5274 | yield4thPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
5275 | yield6thPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
5276 | yield8thPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
5277 | } | |
489d5531 | 5278 | } |
5279 | ||
0d11c335 | 5280 | if(!yield2ndPt){return;} |
5281 | if(!yield4thPt){return;} | |
5282 | if(!yield6thPt){return;} | |
5283 | if(!yield8thPt){return;} | |
5284 | ||
489d5531 | 5285 | Int_t nBinsPt = yield2ndPt->GetNbinsX(); |
5286 | ||
5287 | TH1D *flow2ndPt = NULL; | |
5288 | TH1D *flow4thPt = NULL; | |
5289 | TH1D *flow6thPt = NULL; | |
5290 | TH1D *flow8thPt = NULL; | |
5291 | ||
5292 | // to be improved (hardwired pt index) | |
5293 | flow2ndPt = (TH1D*)fDiffFlow[t][0][0]->Clone(); | |
5294 | flow4thPt = (TH1D*)fDiffFlow[t][0][1]->Clone(); | |
5295 | flow6thPt = (TH1D*)fDiffFlow[t][0][2]->Clone(); | |
5296 | flow8thPt = (TH1D*)fDiffFlow[t][0][3]->Clone(); | |
0d11c335 | 5297 | |
5298 | if(!flow2ndPt){return;} | |
5299 | if(!flow4thPt){return;} | |
5300 | if(!flow6thPt){return;} | |
5301 | if(!flow8thPt){return;} | |
489d5531 | 5302 | |
5303 | Double_t dvn2nd = 0., dvn4th = 0., dvn6th = 0., dvn8th = 0.; // differential flow | |
5304 | Double_t dErrvn2nd = 0., dErrvn4th = 0., dErrvn6th = 0., dErrvn8th = 0.; // error on differential flow | |
5305 | ||
5306 | Double_t dVn2nd = 0., dVn4th = 0., dVn6th = 0., dVn8th = 0.; // integrated flow | |
5307 | Double_t dErrVn2nd = 0., dErrVn4th = 0., dErrVn6th = 0., dErrVn8th = 0.; // error on integrated flow | |
5308 | ||
5309 | Double_t dYield2nd = 0., dYield4th = 0., dYield6th = 0., dYield8th = 0.; // pt yield | |
5310 | Double_t dSum2nd = 0., dSum4th = 0., dSum6th = 0., dSum8th = 0.; // needed for normalizing integrated flow | |
5311 | ||
5312 | // looping over pt bins: | |
5313 | for(Int_t p=1;p<nBinsPt+1;p++) | |
5314 | { | |
5315 | dvn2nd = flow2ndPt->GetBinContent(p); | |
5316 | dvn4th = flow4thPt->GetBinContent(p); | |
5317 | dvn6th = flow6thPt->GetBinContent(p); | |
5318 | dvn8th = flow8thPt->GetBinContent(p); | |
5319 | ||
5320 | dErrvn2nd = flow2ndPt->GetBinError(p); | |
5321 | dErrvn4th = flow4thPt->GetBinError(p); | |
5322 | dErrvn6th = flow6thPt->GetBinError(p); | |
5323 | dErrvn8th = flow8thPt->GetBinError(p); | |
5324 | ||
5325 | dYield2nd = yield2ndPt->GetBinContent(p); | |
5326 | dYield4th = yield4thPt->GetBinContent(p); | |
5327 | dYield6th = yield6thPt->GetBinContent(p); | |
5328 | dYield8th = yield8thPt->GetBinContent(p); | |
5329 | ||
5330 | dVn2nd += dvn2nd*dYield2nd; | |
5331 | dVn4th += dvn4th*dYield4th; | |
5332 | dVn6th += dvn6th*dYield6th; | |
5333 | dVn8th += dvn8th*dYield8th; | |
5334 | ||
5335 | dSum2nd += dYield2nd; | |
5336 | dSum4th += dYield4th; | |
5337 | dSum6th += dYield6th; | |
5338 | dSum8th += dYield8th; | |
5339 | ||
5340 | dErrVn2nd += dYield2nd*dYield2nd*dErrvn2nd*dErrvn2nd; // ro be improved (check this relation) | |
5341 | dErrVn4th += dYield4th*dYield4th*dErrvn4th*dErrvn4th; | |
5342 | dErrVn6th += dYield6th*dYield6th*dErrvn6th*dErrvn6th; | |
5343 | dErrVn8th += dYield8th*dYield8th*dErrvn8th*dErrvn8th; | |
5344 | ||
5345 | } // end of for(Int_t p=1;p<nBinsPt+1;p++) | |
5346 | ||
5347 | // normalizing the results for integrated flow: | |
5348 | if(dSum2nd) | |
5349 | { | |
5350 | dVn2nd /= dSum2nd; | |
5351 | dErrVn2nd /= (dSum2nd*dSum2nd); | |
5352 | dErrVn2nd = TMath::Sqrt(dErrVn2nd); | |
5353 | } | |
5354 | if(dSum4th) | |
5355 | { | |
5356 | dVn4th /= dSum4th; | |
5357 | dErrVn4th /= (dSum4th*dSum4th); | |
5358 | dErrVn4th = TMath::Sqrt(dErrVn4th); | |
5359 | } | |
5360 | //if(dSum6th) dVn6th/=dSum6th; | |
5361 | //if(dSum8th) dVn8th/=dSum8th; | |
5362 | ||
5363 | // storing the results for integrated flow in common histos: (to be improved: new method for this?) | |
5364 | if(type == "POI") | |
5365 | { | |
5366 | fCommonHistsResults2nd->FillIntegratedFlowPOI(dVn2nd,dErrVn2nd); | |
5367 | fCommonHistsResults4th->FillIntegratedFlowPOI(dVn4th,dErrVn4th); | |
5368 | fCommonHistsResults6th->FillIntegratedFlowPOI(dVn6th,0.); // to be improved (errors) | |
5369 | fCommonHistsResults8th->FillIntegratedFlowPOI(dVn8th,0.); // to be improved (errors) | |
5370 | } | |
5371 | else if (type == "RP") | |
5372 | { | |
5373 | fCommonHistsResults2nd->FillIntegratedFlowRP(dVn2nd,dErrVn2nd); | |
5374 | fCommonHistsResults4th->FillIntegratedFlowRP(dVn4th,dErrVn4th); | |
5375 | fCommonHistsResults6th->FillIntegratedFlowRP(dVn6th,0.); // to be improved (errors) | |
5376 | fCommonHistsResults8th->FillIntegratedFlowRP(dVn8th,0.); // to be improved (errors) | |
5377 | } | |
5378 | ||
5379 | delete flow2ndPt; | |
5380 | delete flow4thPt; | |
5381 | //delete flow6thPt; | |
5382 | //delete flow8thPt; | |
5383 | ||
5384 | delete yield2ndPt; | |
5385 | delete yield4thPt; | |
5386 | delete yield6thPt; | |
5387 | delete yield8thPt; | |
5388 | ||
5389 | } // end of AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type) | |
5390 | ||
489d5531 | 5391 | //================================================================================================================================ |
5392 | ||
489d5531 | 5393 | void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions() |
5394 | { | |
5395 | // Initialize all arrays used for distributions. | |
5396 | ||
5397 | // a) Initialize arrays of histograms used to hold distributions of correlations; | |
5398 | // b) Initialize array to hold min and max values of correlations. | |
5399 | ||
5400 | // a) Initialize arrays of histograms used to hold distributions of correlations: | |
5401 | for(Int_t di=0;di<4;di++) // distribution index | |
5402 | { | |
5403 | fDistributions[di] = NULL; | |
5404 | } | |
5405 | ||
5406 | // b) Initialize default min and max values of correlations: | |
5407 | // (Remark: The default values bellow were chosen for v2=5% and M=500) | |
5408 | fMinValueOfCorrelation[0] = -0.01; // <2>_min | |
5409 | fMaxValueOfCorrelation[0] = 0.04; // <2>_max | |
5410 | fMinValueOfCorrelation[1] = -0.00002; // <4>_min | |
5411 | fMaxValueOfCorrelation[1] = 0.00015; // <4>_max | |
5412 | fMinValueOfCorrelation[2] = -0.0000003; // <6>_min | |
5413 | fMaxValueOfCorrelation[2] = 0.0000006; // <6>_max | |
5414 | fMinValueOfCorrelation[3] = -0.000000006; // <8>_min | |
5415 | fMaxValueOfCorrelation[3] = 0.000000003; // <8>_max | |
5416 | ||
5417 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions() | |
5418 | ||
489d5531 | 5419 | //================================================================================================================================ |
5420 | ||
e5834fcb | 5421 | void AliFlowAnalysisWithQCumulants::InitializeArraysForVarious() |
5422 | { | |
5423 | // Initialize all arrays used for various unclassified objects. | |
5424 | ||
5425 | for(Int_t p=0;p<4;p++) // [v_min,v_max,refMult_min,refMult_max] | |
5426 | { | |
5427 | fPhiDistributionForOneEventSettings[p] = 0.; | |
5428 | } | |
5429 | ||
5430 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForVarious() | |
5431 | ||
5432 | //================================================================================================================================ | |
489d5531 | 5433 | |
5434 | void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions() | |
5435 | { | |
5436 | // a) Book profile to hold all flags for distributions of correlations; | |
5437 | // b) Book all histograms to hold distributions of correlations. | |
5438 | ||
5439 | TString correlationIndex[4] = {"<2>","<4>","<6>","<8>"}; // to be improved (should I promote this to data members?) | |
5440 | ||
5441 | // a) Book profile to hold all flags for distributions of correlations: | |
5442 | TString distributionsFlagsName = "fDistributionsFlags"; | |
5443 | distributionsFlagsName += fAnalysisLabel->Data(); | |
5444 | fDistributionsFlags = new TProfile(distributionsFlagsName.Data(),"Flags for Distributions of Correlations",9,0,9); | |
5445 | fDistributionsFlags->SetTickLength(-0.01,"Y"); | |
5446 | fDistributionsFlags->SetMarkerStyle(25); | |
5447 | fDistributionsFlags->SetLabelSize(0.05); | |
5448 | fDistributionsFlags->SetLabelOffset(0.02,"Y"); | |
5449 | fDistributionsFlags->GetXaxis()->SetBinLabel(1,"Store or not?"); | |
5450 | fDistributionsFlags->GetXaxis()->SetBinLabel(2,"<2>_{min}"); | |
5451 | fDistributionsFlags->GetXaxis()->SetBinLabel(3,"<2>_{max}"); | |
5452 | fDistributionsFlags->GetXaxis()->SetBinLabel(4,"<4>_{min}"); | |
5453 | fDistributionsFlags->GetXaxis()->SetBinLabel(5,"<4>_{max}"); | |
5454 | fDistributionsFlags->GetXaxis()->SetBinLabel(6,"<6>_{min}"); | |
5455 | fDistributionsFlags->GetXaxis()->SetBinLabel(7,"<6>_{max}"); | |
5456 | fDistributionsFlags->GetXaxis()->SetBinLabel(8,"<8>_{min}"); | |
5457 | fDistributionsFlags->GetXaxis()->SetBinLabel(9,"<8>_{max}"); | |
5458 | fDistributionsList->Add(fDistributionsFlags); | |
5459 | ||
5460 | // b) Book all histograms to hold distributions of correlations. | |
5461 | if(fStoreDistributions) | |
5462 | { | |
5463 | TString distributionsName = "fDistributions"; | |
5464 | distributionsName += fAnalysisLabel->Data(); | |
5465 | for(Int_t di=0;di<4;di++) // distribution index | |
5466 | { | |
5467 | fDistributions[di] = new TH1D(Form("Distribution of %s",correlationIndex[di].Data()),Form("Distribution of %s",correlationIndex[di].Data()),10000,fMinValueOfCorrelation[di],fMaxValueOfCorrelation[di]); | |
5468 | fDistributions[di]->SetXTitle(correlationIndex[di].Data()); | |
5469 | fDistributionsList->Add(fDistributions[di]); | |
5470 | } // end of for(Int_t di=0;di<4;di++) // distribution index | |
5471 | } // end of if(fStoreDistributions) | |
5472 | ||
5473 | } // end of void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions() | |
5474 | ||
489d5531 | 5475 | //================================================================================================================================ |
5476 | ||
e5834fcb | 5477 | void AliFlowAnalysisWithQCumulants::BookEverythingForVarious() |
5478 | { | |
5479 | // Book all objects for various unclassified quantities. | |
5480 | ||
5481 | if(!fStorePhiDistributionForOneEvent){return;} | |
5482 | ||
5483 | // a) Book histogram holding phi distribution for single event to illustrate flow. | |
5484 | ||
5485 | // a) Book histogram holding phi distribution for single event to illustrate flow: | |
5486 | fPhiDistributionForOneEvent = new TH1D("fPhiDistributionForOneEvent","",360,0.,TMath::TwoPi()); | |
5487 | fPhiDistributionForOneEvent->GetXaxis()->SetTitle("#phi"); | |
5488 | fVariousList->Add(fPhiDistributionForOneEvent); | |
5489 | ||
5490 | } // end of void AliFlowAnalysisWithQCumulants::BookEverythingForVarious() | |
5491 | ||
5492 | //================================================================================================================================ | |
489d5531 | 5493 | |
5494 | void AliFlowAnalysisWithQCumulants::StoreFlagsForDistributions() | |
5495 | { | |
5496 | // Store all flags for distributiuons of correlations in profile fDistributionsFlags. | |
5497 | ||
5498 | if(!fDistributionsFlags) | |
5499 | { | |
5500 | cout<<"WARNING: fDistributionsFlags is NULL in AFAWQC::SDF() !!!!"<<endl; | |
5501 | exit(0); | |
5502 | } | |
5503 | ||
5504 | fDistributionsFlags->Fill(0.5,(Int_t)fStoreDistributions); // histos with distributions of correlations stored or not in the output file | |
5505 | // store min and max values of correlations: | |
5506 | for(Int_t di=0;di<4;di++) // distribution index | |
5507 | { | |
5508 | fDistributionsFlags->Fill(1.5+2.*(Double_t)di,fMinValueOfCorrelation[di]); | |
5509 | fDistributionsFlags->Fill(2.5+2.*(Double_t)di,fMaxValueOfCorrelation[di]); | |
5510 | } | |
5511 | ||
5512 | } // end of void AliFlowAnalysisWithQCumulants::StoreFlagsForDistributions() | |
5513 | ||
489d5531 | 5514 | //================================================================================================================================ |
5515 | ||
489d5531 | 5516 | void AliFlowAnalysisWithQCumulants::StoreDistributionsOfCorrelations() |
5517 | { | |
5518 | // Store distributions of correlations. | |
5519 | ||
5520 | if(!(fIntFlowCorrelationsEBE && fIntFlowEventWeightsForCorrelationsEBE)) | |
5521 | { | |
5522 | cout<<"WARNING: fIntFlowCorrelationsEBE && fIntFlowEventWeightsForCorrelationsEBE"<<endl; | |
5523 | cout<<" is NULL in AFAWQC::SDOC() !!!!"<<endl; | |
5524 | exit(0); | |
5525 | } | |
5526 | ||
5527 | for(Int_t di=0;di<4;di++) // distribution index | |
5528 | { | |
5529 | if(!fDistributions[di]) | |
5530 | { | |
5531 | cout<<"WARNING: fDistributions[di] is NULL in AFAWQC::SDOC() !!!!"<<endl; | |
5532 | cout<<"di = "<<di<<endl; | |
5533 | exit(0); | |
5534 | } else | |
5535 | { | |
5536 | fDistributions[di]->Fill(fIntFlowCorrelationsEBE->GetBinContent(di+1),fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(di+1)); | |
5537 | } | |
5538 | } // end of for(Int_t di=0;di<4;di++) // distribution index | |
5539 | ||
5540 | } // end of void AliFlowAnalysisWithQCumulants::StoreDistributionsOfCorrelations() | |
5541 | ||
489d5531 | 5542 | //================================================================================================================================ |
5543 | ||
489d5531 | 5544 | void AliFlowAnalysisWithQCumulants::BookAndNestAllLists() |
5545 | { | |
5546 | // Book and nest all lists nested in the base list fHistList. | |
5547 | // a) Book and nest lists for integrated flow; | |
5548 | // b) Book and nest lists for differential flow; | |
5549 | // c) Book and nest list for particle weights; | |
5550 | // d) Book and nest list for distributions; | |
e5834fcb | 5551 | // e) Book and nest list for various unclassified objects; |
5552 | // f) Book and nest list for nested loops. | |
489d5531 | 5553 | |
5554 | // a) Book and nest all lists for integrated flow: | |
1268c371 | 5555 | // Base list for integrated flow: |
489d5531 | 5556 | fIntFlowList = new TList(); |
5557 | fIntFlowList->SetName("Integrated Flow"); | |
5558 | fIntFlowList->SetOwner(kTRUE); | |
5559 | fHistList->Add(fIntFlowList); | |
1268c371 | 5560 | // List holding profiles: |
489d5531 | 5561 | fIntFlowProfiles = new TList(); |
5562 | fIntFlowProfiles->SetName("Profiles"); | |
5563 | fIntFlowProfiles->SetOwner(kTRUE); | |
5564 | fIntFlowList->Add(fIntFlowProfiles); | |
1268c371 | 5565 | // List holding histograms with results: |
489d5531 | 5566 | fIntFlowResults = new TList(); |
5567 | fIntFlowResults->SetName("Results"); | |
5568 | fIntFlowResults->SetOwner(kTRUE); | |
5569 | fIntFlowList->Add(fIntFlowResults); | |
5570 | ||
1268c371 | 5571 | // b) Book and nest lists for differential flow: |
5572 | this->BookAndNestListsForDifferentialFlow(); | |
5573 | ||
5574 | // c) Book and nest list for particle weights: | |
5575 | fWeightsList->SetName("Weights"); | |
5576 | fWeightsList->SetOwner(kTRUE); | |
5577 | fHistList->Add(fWeightsList); | |
5578 | ||
5579 | // d) Book and nest list for distributions: | |
5580 | fDistributionsList = new TList(); | |
5581 | fDistributionsList->SetName("Distributions"); | |
5582 | fDistributionsList->SetOwner(kTRUE); | |
5583 | fHistList->Add(fDistributionsList); | |
5584 | ||
5585 | // e) Book and nest list for various unclassified objects: | |
5586 | if(fStorePhiDistributionForOneEvent) | |
5587 | { | |
5588 | fVariousList = new TList(); | |
5589 | fVariousList->SetName("Various"); | |
5590 | fVariousList->SetOwner(kTRUE); | |
5591 | fHistList->Add(fVariousList); | |
5592 | } | |
5593 | ||
5594 | // f) Book and nest list for nested loops: | |
5595 | fNestedLoopsList = new TList(); | |
5596 | fNestedLoopsList->SetName("Nested Loops"); | |
5597 | fNestedLoopsList->SetOwner(kTRUE); | |
5598 | fHistList->Add(fNestedLoopsList); | |
5599 | ||
5600 | } // end of void AliFlowAnalysisWithQCumulants::BookAndNestAllLists() | |
5601 | ||
5602 | //================================================================================================================================ | |
5603 | ||
5604 | void AliFlowAnalysisWithQCumulants::BookAndNestListsForDifferentialFlow() | |
5605 | { | |
5606 | // Book and nest lists for differential flow. | |
5607 | ||
5608 | // Base list for differential flow objects: | |
489d5531 | 5609 | fDiffFlowList = new TList(); |
5610 | fDiffFlowList->SetName("Differential Flow"); | |
5611 | fDiffFlowList->SetOwner(kTRUE); | |
5612 | fHistList->Add(fDiffFlowList); | |
1268c371 | 5613 | |
5614 | // Local flags: | |
5615 | TString typeFlag[2] = {"RP","POI"}; | |
5616 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
5617 | TString powerFlag[2] = {"linear","quadratic"}; | |
5618 | ||
5619 | // 2D: | |
5620 | if(fCalculate2DDiffFlow) | |
5621 | { | |
5622 | fDiffFlow2D = new TList(); | |
5623 | fDiffFlow2D->SetName("2D"); | |
5624 | fDiffFlow2D->SetOwner(kTRUE); | |
5625 | fDiffFlowList->Add(fDiffFlow2D); | |
5626 | for(Int_t t=0;t<2;t++) | |
5627 | { | |
5628 | f2DDiffFlowCorrelationsProList[t] = new TList(); | |
5629 | f2DDiffFlowCorrelationsProList[t]->SetOwner(kTRUE); | |
5630 | f2DDiffFlowCorrelationsProList[t]->SetName(Form("Profiles with 2D correlations (%s)",typeFlag[t].Data())); | |
5631 | fDiffFlow2D->Add(f2DDiffFlowCorrelationsProList[t]); | |
5632 | } // end of for(Int_t t=0;t<2;t++) | |
5633 | } // end of if(fCalculate2DDiffFlow) | |
5634 | ||
5635 | // What follows bellow in this method is relevant only for 1D differential flow: | |
5636 | if(!fCalculateDiffFlow){return;} | |
5637 | ||
5638 | // List holding profiles: | |
489d5531 | 5639 | fDiffFlowProfiles = new TList(); |
5640 | fDiffFlowProfiles->SetName("Profiles"); | |
5641 | fDiffFlowProfiles->SetOwner(kTRUE); | |
5642 | fDiffFlowList->Add(fDiffFlowProfiles); | |
1268c371 | 5643 | // List holding histograms with results: |
489d5531 | 5644 | fDiffFlowResults = new TList(); |
5645 | fDiffFlowResults->SetName("Results"); | |
5646 | fDiffFlowResults->SetOwner(kTRUE); | |
5647 | fDiffFlowList->Add(fDiffFlowResults); | |
1268c371 | 5648 | // Flags used for naming nested lists in list fDiffFlowProfiles and fDiffFlowResults: |
489d5531 | 5649 | TList list; |
5650 | list.SetOwner(kTRUE); | |
1268c371 | 5651 | // Nested lists in fDiffFlowProfiles (~/Differential Flow/Profiles): |
489d5531 | 5652 | for(Int_t t=0;t<2;t++) // type: RP or POI |
5653 | { | |
5654 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5655 | { | |
5656 | // list holding profiles with correlations: | |
5657 | fDiffFlowCorrelationsProList[t][pe] = (TList*)list.Clone(); | |
5658 | fDiffFlowCorrelationsProList[t][pe]->SetName(Form("Profiles with correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5659 | fDiffFlowProfiles->Add(fDiffFlowCorrelationsProList[t][pe]); | |
5660 | // list holding profiles with products of correlations: | |
5661 | fDiffFlowProductOfCorrelationsProList[t][pe] = (TList*)list.Clone(); | |
5662 | fDiffFlowProductOfCorrelationsProList[t][pe]->SetName(Form("Profiles with products of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5663 | fDiffFlowProfiles->Add(fDiffFlowProductOfCorrelationsProList[t][pe]); | |
5664 | // list holding profiles with corrections: | |
5665 | fDiffFlowCorrectionsProList[t][pe] = (TList*)list.Clone(); | |
5666 | fDiffFlowCorrectionsProList[t][pe]->SetName(Form("Profiles with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5667 | fDiffFlowProfiles->Add(fDiffFlowCorrectionsProList[t][pe]); | |
5668 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5669 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
5670 | // nested lists in fDiffFlowResults (~/Differential Flow/Results): | |
5671 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
5672 | { | |
5673 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5674 | { | |
5675 | // list holding histograms with correlations: | |
5676 | fDiffFlowCorrelationsHistList[t][pe] = (TList*)list.Clone(); | |
5677 | fDiffFlowCorrelationsHistList[t][pe]->SetName(Form("Correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5678 | fDiffFlowResults->Add(fDiffFlowCorrelationsHistList[t][pe]); | |
5679 | // list holding histograms with corrections: | |
5680 | fDiffFlowCorrectionsHistList[t][pe] = (TList*)list.Clone(); | |
5681 | fDiffFlowCorrectionsHistList[t][pe]->SetName(Form("Histograms with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5682 | fDiffFlowResults->Add(fDiffFlowCorrectionsHistList[t][pe]); | |
5683 | for(Int_t power=0;power<2;power++) | |
5684 | { | |
5685 | // list holding histograms with sums of event weights: | |
5686 | fDiffFlowSumOfEventWeightsHistList[t][pe][power] = (TList*)list.Clone(); | |
5687 | fDiffFlowSumOfEventWeightsHistList[t][pe][power]->SetName(Form("Sum of %s event weights (%s, %s)",powerFlag[power].Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5688 | fDiffFlowResults->Add(fDiffFlowSumOfEventWeightsHistList[t][pe][power]); | |
5689 | } // end of for(Int_t power=0;power<2;power++) | |
5690 | // list holding histograms with sums of products of event weights: | |
5691 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe] = (TList*)list.Clone(); | |
5692 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]->SetName(Form("Sum of products of event weights (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5693 | fDiffFlowResults->Add(fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]); | |
5694 | // list holding histograms with covariances of correlations: | |
5695 | fDiffFlowCovariancesHistList[t][pe] = (TList*)list.Clone(); | |
5696 | fDiffFlowCovariancesHistList[t][pe]->SetName(Form("Covariances of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5697 | fDiffFlowResults->Add(fDiffFlowCovariancesHistList[t][pe]); | |
5698 | // list holding histograms with differential Q-cumulants: | |
5699 | fDiffFlowCumulantsHistList[t][pe] = (TList*)list.Clone(); | |
5700 | fDiffFlowCumulantsHistList[t][pe]->SetName(Form("Differential Q-cumulants (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5701 | fDiffFlowResults->Add(fDiffFlowCumulantsHistList[t][pe]); | |
1268c371 | 5702 | // list holding histograms which quantify detector bias to differential Q-cumulants: |
5703 | fDiffFlowDetectorBiasHistList[t][pe] = (TList*)list.Clone(); | |
5704 | fDiffFlowDetectorBiasHistList[t][pe]->SetName(Form("Detector bias (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5705 | fDiffFlowResults->Add(fDiffFlowDetectorBiasHistList[t][pe]); | |
489d5531 | 5706 | // list holding histograms with differential flow estimates from Q-cumulants: |
5707 | fDiffFlowHistList[t][pe] = (TList*)list.Clone(); | |
5708 | fDiffFlowHistList[t][pe]->SetName(Form("Differential flow (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5709 | fDiffFlowResults->Add(fDiffFlowHistList[t][pe]); | |
5710 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5711 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
5712 | ||
1268c371 | 5713 | } // end of void AliFlowAnalysisWithQCumulants::BookAndNestListsForDifferentialFlow() |
489d5531 | 5714 | |
5715 | //================================================================================================================================ | |
5716 | ||
489d5531 | 5717 | void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type) |
5718 | { | |
1268c371 | 5719 | // Fill common result histograms for differential flow. |
489d5531 | 5720 | |
1268c371 | 5721 | Int_t t = 0; |
489d5531 | 5722 | |
5723 | if(type == "RP") | |
5724 | { | |
1268c371 | 5725 | t = 0; |
489d5531 | 5726 | } else if(type == "POI") |
5727 | { | |
1268c371 | 5728 | t = 1; |
489d5531 | 5729 | } |
1268c371 | 5730 | |
5731 | // to be improved - check all pointers used in this method | |
489d5531 | 5732 | |
5733 | if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th)) | |
5734 | { | |
5735 | cout<<"WARNING: fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th"<<endl; | |
5736 | cout<<" is NULL in AFAWQC::FCHRIF() !!!!"<<endl; | |
5737 | exit(0); | |
5738 | } | |
5739 | ||
5740 | // pt: | |
5741 | for(Int_t p=1;p<=fnBinsPt;p++) | |
5742 | { | |
5743 | Double_t v2 = fDiffFlow[t][0][0]->GetBinContent(p); | |
5744 | Double_t v4 = fDiffFlow[t][0][1]->GetBinContent(p); | |
5745 | Double_t v6 = fDiffFlow[t][0][2]->GetBinContent(p); | |
5746 | Double_t v8 = fDiffFlow[t][0][3]->GetBinContent(p); | |
5747 | ||
5748 | Double_t v2Error = fDiffFlow[t][0][0]->GetBinError(p); | |
5749 | Double_t v4Error = fDiffFlow[t][0][1]->GetBinError(p); | |
5750 | //Double_t v6Error = fFinalFlow1D[t][pW][nua][0][2]->GetBinError(p); | |
5751 | //Double_t v8Error = fFinalFlow1D[t][pW][nua][0][3]->GetBinError(p); | |
5752 | ||
5753 | if(type == "RP") | |
5754 | { | |
5755 | fCommonHistsResults2nd->FillDifferentialFlowPtRP(p,v2,v2Error); | |
5756 | fCommonHistsResults4th->FillDifferentialFlowPtRP(p,v4,v4Error); | |
5757 | fCommonHistsResults6th->FillDifferentialFlowPtRP(p,v6,0.); | |
5758 | fCommonHistsResults8th->FillDifferentialFlowPtRP(p,v8,0.); | |
5759 | } else if(type == "POI") | |
5760 | { | |
5761 | fCommonHistsResults2nd->FillDifferentialFlowPtPOI(p,v2,v2Error); | |
5762 | fCommonHistsResults4th->FillDifferentialFlowPtPOI(p,v4,v4Error); | |
5763 | fCommonHistsResults6th->FillDifferentialFlowPtPOI(p,v6,0.); | |
5764 | fCommonHistsResults8th->FillDifferentialFlowPtPOI(p,v8,0.); | |
5765 | } | |
5766 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
5767 | ||
5768 | // eta: | |
5769 | for(Int_t e=1;e<=fnBinsEta;e++) | |
5770 | { | |
5771 | Double_t v2 = fDiffFlow[t][1][0]->GetBinContent(e); | |
5772 | Double_t v4 = fDiffFlow[t][1][1]->GetBinContent(e); | |
5773 | Double_t v6 = fDiffFlow[t][1][2]->GetBinContent(e); | |
5774 | Double_t v8 = fDiffFlow[t][1][3]->GetBinContent(e); | |
5775 | ||
5776 | Double_t v2Error = fDiffFlow[t][1][0]->GetBinError(e); | |
5777 | Double_t v4Error = fDiffFlow[t][1][1]->GetBinError(e); | |
5778 | //Double_t v6Error = fDiffFlow[t][1][2]->GetBinError(e); | |
5779 | //Double_t v8Error = fDiffFlow[t][1][3]->GetBinError(e); | |
5780 | ||
5781 | if(type == "RP") | |
5782 | { | |
5783 | fCommonHistsResults2nd->FillDifferentialFlowEtaRP(e,v2,v2Error); | |
5784 | fCommonHistsResults4th->FillDifferentialFlowEtaRP(e,v4,v4Error); | |
5785 | fCommonHistsResults6th->FillDifferentialFlowEtaRP(e,v6,0.); | |
5786 | fCommonHistsResults8th->FillDifferentialFlowEtaRP(e,v8,0.); | |
5787 | } else if(type == "POI") | |
5788 | { | |
5789 | fCommonHistsResults2nd->FillDifferentialFlowEtaPOI(e,v2,v2Error); | |
5790 | fCommonHistsResults4th->FillDifferentialFlowEtaPOI(e,v4,v4Error); | |
5791 | fCommonHistsResults6th->FillDifferentialFlowEtaPOI(e,v6,0.); | |
5792 | fCommonHistsResults8th->FillDifferentialFlowEtaPOI(e,v8,0.); | |
5793 | } | |
5794 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
5795 | ||
5796 | } // end of void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights, Bool_t correctedForNUA) | |
5797 | ||
489d5531 | 5798 | //================================================================================================================================ |
5799 | ||
1268c371 | 5800 | void AliFlowAnalysisWithQCumulants::CommonConstants(TString method) |
489d5531 | 5801 | { |
1268c371 | 5802 | // Access and store common constants. |
5803 | ||
5804 | // a) If this method was called in Init() access common constants from AliFlowCommonConstants; | |
5805 | // b) If this method was called in Init() book and fill TProfile to hold constants accessed in a); | |
5806 | // c) If this method was called in Finish() access common constants from TProfile booked and filled in b). | |
5807 | ||
5808 | if(method == "Init") | |
5809 | { | |
5810 | // a) If this method was called in Init() access common constants from AliFlowCommonConstants: | |
5811 | fnBinsPhi = AliFlowCommonConstants::GetMaster()->GetNbinsPhi(); | |
5812 | fPhiMin = AliFlowCommonConstants::GetMaster()->GetPhiMin(); | |
5813 | fPhiMax = AliFlowCommonConstants::GetMaster()->GetPhiMax(); | |
5814 | if(fnBinsPhi){fPhiBinWidth = (fPhiMax-fPhiMin)/fnBinsPhi;} | |
5815 | fnBinsPt = AliFlowCommonConstants::GetMaster()->GetNbinsPt(); | |
5816 | fPtMin = AliFlowCommonConstants::GetMaster()->GetPtMin(); | |
5817 | fPtMax = AliFlowCommonConstants::GetMaster()->GetPtMax(); | |
5818 | if(fnBinsPt){fPtBinWidth = (fPtMax-fPtMin)/fnBinsPt;} | |
5819 | fnBinsEta = AliFlowCommonConstants::GetMaster()->GetNbinsEta(); | |
5820 | fEtaMin = AliFlowCommonConstants::GetMaster()->GetEtaMin(); | |
5821 | fEtaMax = AliFlowCommonConstants::GetMaster()->GetEtaMax(); | |
5822 | if(fnBinsEta){fEtaBinWidth = (fEtaMax-fEtaMin)/fnBinsEta;} | |
5823 | ||
5824 | // b) If this method was called in Init() book and fill TProfile to hold constants accessed in a): | |
5825 | TString fCommonConstantsName = "fCommonConstants"; | |
5826 | fCommonConstantsName += fAnalysisLabel->Data(); | |
5827 | fCommonConstants = new TProfile(fCommonConstantsName.Data(),"Common constants",9,0.,9.); | |
5828 | fCommonConstants->SetLabelSize(0.05); | |
5829 | fCommonConstants->GetXaxis()->SetBinLabel(1,"nBins (#phi)"); | |
5830 | fCommonConstants->Fill(0.5,fnBinsPhi); | |
5831 | fCommonConstants->GetXaxis()->SetBinLabel(2,"#phi_{min}"); | |
5832 | fCommonConstants->Fill(1.5,fPhiMin); | |
5833 | fCommonConstants->GetXaxis()->SetBinLabel(3,"#phi_{max}"); | |
5834 | fCommonConstants->Fill(2.5,fPhiMax); | |
5835 | fCommonConstants->GetXaxis()->SetBinLabel(4,"nBins (p_{t})"); | |
5836 | fCommonConstants->Fill(3.5,fnBinsPt); | |
5837 | fCommonConstants->GetXaxis()->SetBinLabel(5,"(p_{t})_{min}"); | |
5838 | fCommonConstants->Fill(4.5,fPtMin); | |
5839 | fCommonConstants->GetXaxis()->SetBinLabel(6,"(p_{t})_{max}"); | |
5840 | fCommonConstants->Fill(5.5,fPtMax); | |
5841 | fCommonConstants->GetXaxis()->SetBinLabel(7,"nBins (#eta)"); | |
5842 | fCommonConstants->Fill(6.5,fnBinsEta); | |
5843 | fCommonConstants->GetXaxis()->SetBinLabel(8,"#eta_{min}"); | |
5844 | fCommonConstants->Fill(7.5,fEtaMin); | |
5845 | fCommonConstants->GetXaxis()->SetBinLabel(9,"#eta_{max}"); | |
5846 | fCommonConstants->Fill(8.5,fEtaMax); | |
5847 | fHistList->Add(fCommonConstants); | |
5848 | } // end of if(method == "Init") | |
5849 | else if(method == "Finish") | |
5850 | { | |
5851 | // c) If this method was called in Finish() access common constants from TProfile booked and filled in b): | |
5852 | if(!fCommonConstants) | |
5853 | { | |
5854 | printf("\n WARNING (QC): fCommonConstants is NULL in AFAWQC::AC(\"%s\") !!!!\n\n",method.Data()); | |
5855 | exit(0); | |
5856 | } | |
5857 | fnBinsPhi = (Int_t)fCommonConstants->GetBinContent(1); | |
5858 | fPhiMin = fCommonConstants->GetBinContent(2); | |
5859 | fPhiMax = fCommonConstants->GetBinContent(3); | |
5860 | if(fnBinsPhi){fPhiBinWidth = (fPhiMax-fPhiMin)/fnBinsPhi;} | |
5861 | fnBinsPt = (Int_t)fCommonConstants->GetBinContent(4); | |
5862 | fPtMin = fCommonConstants->GetBinContent(5); | |
5863 | fPtMax = fCommonConstants->GetBinContent(6); | |
5864 | if(fnBinsPt){fPtBinWidth = (fPtMax-fPtMin)/fnBinsPt;} | |
5865 | fnBinsEta = (Int_t)fCommonConstants->GetBinContent(7); | |
5866 | fEtaMin = fCommonConstants->GetBinContent(8); | |
5867 | fEtaMax = fCommonConstants->GetBinContent(9); | |
5868 | if(fnBinsEta){fEtaBinWidth = (fEtaMax-fEtaMin)/fnBinsEta;} | |
5869 | } // end of else if(method == "Finish") | |
5870 | ||
5871 | } // end of void AliFlowAnalysisWithQCumulants::CommonConstants(TString method) | |
489d5531 | 5872 | |
489d5531 | 5873 | //================================================================================================================================ |
5874 | ||
489d5531 | 5875 | void AliFlowAnalysisWithQCumulants::CrossCheckSettings() |
5876 | { | |
1268c371 | 5877 | // a) Cross check if the choice for multiplicity weights make sense. |
489d5531 | 5878 | |
5879 | // a) Cross check if the choice for multiplicity weights make sense: | |
5880 | if(strcmp(fMultiplicityWeight->Data(),"combinations") && | |
5881 | strcmp(fMultiplicityWeight->Data(),"unit") && | |
5882 | strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
5883 | { | |
5884 | cout<<"WARNING (QC): Multiplicity weight can be either \"combinations\", \"unit\""<<endl; | |
5885 | cout<<" or \"multiplicity\". Certainly not \""<<fMultiplicityWeight->Data()<<"\"."<<endl; | |
5886 | exit(0); | |
5887 | } | |
5888 | ||
5889 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckSettings() | |
5890 | ||
489d5531 | 5891 | //================================================================================================================================ |
5892 | ||
489d5531 | 5893 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeights() |
5894 | { | |
0328db2d | 5895 | // Calculate sum of linear and quadratic event weights for correlations. |
2001bc3a | 5896 | |
5897 | // multiplicity: | |
1268c371 | 5898 | Double_t dMult = (*fSpk)(0,0); |
9f33751d | 5899 | |
489d5531 | 5900 | for(Int_t p=0;p<2;p++) // power-1 |
5901 | { | |
5902 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
5903 | { | |
5904 | fIntFlowSumOfEventWeights[p]->Fill(ci+0.5,pow(fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci+1),p+1)); | |
b3dacf6b | 5905 | if(fCalculateCumulantsVsM) |
5906 | { | |
5907 | fIntFlowSumOfEventWeightsVsM[ci][p]->Fill(dMult+0.5,pow(fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci+1),p+1)); // to be improved: dMult => sum of weights? | |
5908 | } | |
489d5531 | 5909 | } |
5910 | } | |
5911 | ||
5912 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeights() | |
5913 | ||
489d5531 | 5914 | //================================================================================================================================ |
5915 | ||
0328db2d | 5916 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeightsNUA() |
489d5531 | 5917 | { |
0328db2d | 5918 | // Calculate sum of linear and quadratic event weights for NUA terms. |
5919 | ||
5920 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
489d5531 | 5921 | { |
0328db2d | 5922 | for(Int_t p=0;p<2;p++) // power-1 |
5923 | { | |
b92ea2b9 | 5924 | for(Int_t ci=0;ci<4;ci++) // nua term index |
0328db2d | 5925 | { |
5926 | fIntFlowSumOfEventWeightsNUA[sc][p]->Fill(ci+0.5,pow(fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc]->GetBinContent(ci+1),p+1)); | |
489d5531 | 5927 | } |
0328db2d | 5928 | } |
5929 | } | |
5930 | ||
5931 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeightsNUA() | |
489d5531 | 5932 | |
0328db2d | 5933 | //================================================================================================================================ |
5934 | ||
0328db2d | 5935 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeights() |
5936 | { | |
ff70ca91 | 5937 | // Calculate sum of product of event weights for correlations. |
2001bc3a | 5938 | |
5939 | // multiplicity: | |
1268c371 | 5940 | Double_t dMult = (*fSpk)(0,0); |
2001bc3a | 5941 | |
489d5531 | 5942 | Int_t counter = 0; |
5943 | ||
5944 | for(Int_t ci1=1;ci1<4;ci1++) | |
5945 | { | |
5946 | for(Int_t ci2=ci1+1;ci2<=4;ci2++) | |
5947 | { | |
ff70ca91 | 5948 | fIntFlowSumOfProductOfEventWeights->Fill(0.5+counter, |
5949 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
b3dacf6b | 5950 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); |
5951 | if(fCalculateCumulantsVsM) | |
5952 | { | |
5953 | fIntFlowSumOfProductOfEventWeightsVsM[counter]->Fill(dMult+0.5, // to be improved: dMult => sum of weights? | |
5954 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
5955 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); | |
5956 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 5957 | counter++; |
489d5531 | 5958 | } |
5959 | } | |
5960 | ||
0328db2d | 5961 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeights() |
5962 | ||
0328db2d | 5963 | //================================================================================================================================ |
5964 | ||
0328db2d | 5965 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeightsNUA() |
5966 | { | |
5967 | // Calculate sum of product of event weights for NUA terms. | |
5968 | ||
5969 | // w_{<2>} * w_{<cos(#phi)>}: | |
5970 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(0.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
5971 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
5972 | // w_{<2>} * w_{<sin(#phi)>}: | |
5973 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(1.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
5974 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
5975 | // w_{<cos(#phi)> * w_{<sin(#phi)>}: | |
5976 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(2.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
5977 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
5978 | // w_{<2>} * w{<cos(phi1+phi2)>} | |
5979 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(3.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
5980 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
5981 | // w_{<2>} * w{<sin(phi1+phi2)>} | |
5982 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(4.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
5983 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
5984 | // w_{<2>} * w{<cos(phi1-phi2-phi3)>} | |
5985 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(5.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
5986 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
5987 | // w_{<2>} * w{<sin(phi1-phi2-phi3)>} | |
5988 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(6.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
5989 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
5990 | // w_{<4>} * w{<cos(phi1)>} | |
5991 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(7.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
5992 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
5993 | // w_{<4>} * w{<sin(phi1)>} | |
5994 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(8.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
5995 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
5996 | // w_{<4>} * w{<cos(phi1+phi2)>} | |
5997 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(9.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
5998 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
5999 | // w_{<4>} * w{<sin(phi1+phi2)>} | |
6000 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(10.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6001 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6002 | // w_{<4>} * w{<cos(phi1-phi2-phi3)>} | |
6003 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(11.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6004 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6005 | // w_{<4>} * w{<sin(phi1-phi2-phi3)>} | |
6006 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(12.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6007 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6008 | // w_{<cos(phi1)>} * w{<cos(phi1+phi2)>} | |
6009 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(13.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6010 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6011 | // w_{<cos(phi1)>} * w{<sin(phi1+phi2)>} | |
6012 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(14.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6013 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6014 | // w_{<cos(phi1)>} * w{<cos(phi1-phi2-phi3)>} | |
6015 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(15.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6016 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6017 | // w_{<cos(phi1)>} * w{<sin(phi1-phi2-phi3)>} | |
6018 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(16.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6019 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6020 | // w_{<sin(phi1)>} * w{<cos(phi1+phi2)>} | |
6021 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(17.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6022 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6023 | // w_{<sin(phi1)>} * w{<sin(phi1+phi2)>} | |
6024 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(18.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6025 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6026 | // w_{<sin(phi1)>} * w{<cos(phi1-phi2-phi3)>} | |
6027 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(19.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6028 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6029 | // w_{<sin(phi1)>} * w{<sin(phi1-phi2-phi3)>} | |
6030 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(20.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6031 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6032 | // w_{<cos(phi1+phi2)>} * w{<sin(phi1+phi2))>} | |
6033 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(21.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)* | |
6034 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6035 | // w_{<cos(phi1+phi2)>} * w{<cos(phi1-phi2-phi3)>} | |
6036 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(22.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)* | |
6037 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6038 | // w_{<cos(phi1+phi2)>} * w{<sin(phi1-phi2-phi3)>} | |
6039 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(23.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)* | |
6040 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6041 | // w_{<sin(phi1+phi2)>} * w{<cos(phi1-phi2-phi3)>} | |
6042 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(24.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)* | |
6043 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6044 | // w_{<sin(phi1+phi2)>} * w{<sin(phi1-phi2-phi3)>} | |
6045 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(25.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)* | |
6046 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6047 | // w_{<cos(phi1-phi2-phi3)>} * w{<sin(phi1-phi2-phi3)>} | |
6048 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(26.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)* | |
6049 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6050 | ||
6051 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowIntFlowSumOfProductOfEventWeightsNUA() | |
489d5531 | 6052 | |
489d5531 | 6053 | //================================================================================================================================ |
6054 | ||
489d5531 | 6055 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelations(TString type, TString ptOrEta) |
6056 | { | |
1268c371 | 6057 | // Calculate reduced correlations for RPs or POIs for all pt and eta bins. |
489d5531 | 6058 | |
1268c371 | 6059 | // Multiplicity: |
6060 | Double_t dMult = (*fSpk)(0,0); | |
489d5531 | 6061 | |
6062 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
6063 | Double_t dReQ1n = (*fReQ)(0,0); | |
6064 | Double_t dReQ2n = (*fReQ)(1,0); | |
6065 | //Double_t dReQ3n = (*fReQ)(2,0); | |
6066 | //Double_t dReQ4n = (*fReQ)(3,0); | |
6067 | Double_t dImQ1n = (*fImQ)(0,0); | |
6068 | Double_t dImQ2n = (*fImQ)(1,0); | |
6069 | //Double_t dImQ3n = (*fImQ)(2,0); | |
6070 | //Double_t dImQ4n = (*fImQ)(3,0); | |
6071 | ||
6072 | // reduced correlations are stored in fDiffFlowCorrelationsPro[0=RP,1=POI][0=pt,1=eta][correlation index]. Correlation index runs as follows: | |
6073 | // | |
6074 | // 0: <<2'>> | |
6075 | // 1: <<4'>> | |
6076 | // 2: <<6'>> | |
6077 | // 3: <<8'>> | |
6078 | ||
2a98ceb8 | 6079 | Int_t t = 0; // type flag |
6080 | Int_t pe = 0; // ptEta flag | |
489d5531 | 6081 | |
6082 | if(type == "RP") | |
6083 | { | |
6084 | t = 0; | |
6085 | } else if(type == "POI") | |
6086 | { | |
6087 | t = 1; | |
6088 | } | |
6089 | ||
6090 | if(ptOrEta == "Pt") | |
6091 | { | |
6092 | pe = 0; | |
6093 | } else if(ptOrEta == "Eta") | |
6094 | { | |
6095 | pe = 1; | |
6096 | } | |
6097 | ||
6098 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
6099 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
6100 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
6101 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
6102 | ||
6103 | // looping over all bins and calculating reduced correlations: | |
6104 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6105 | { | |
6106 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
6107 | Double_t p1n0kRe = 0.; | |
6108 | Double_t p1n0kIm = 0.; | |
6109 | ||
6110 | // number of POIs in particular pt or eta bin: | |
6111 | Double_t mp = 0.; | |
6112 | ||
6113 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
6114 | Double_t q1n0kRe = 0.; | |
6115 | Double_t q1n0kIm = 0.; | |
6116 | Double_t q2n0kRe = 0.; | |
6117 | Double_t q2n0kIm = 0.; | |
6118 | ||
6119 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
6120 | Double_t mq = 0.; | |
6121 | ||
6122 | if(type == "POI") | |
6123 | { | |
6124 | // q_{m*n,0}: | |
6125 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
6126 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
6127 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
6128 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
6129 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
6130 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
6131 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
6132 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
6133 | ||
6134 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
6135 | } | |
6136 | else if(type == "RP") | |
6137 | { | |
6138 | // q_{m*n,0}: | |
6139 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
6140 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
6141 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
6142 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
6143 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
6144 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
6145 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
6146 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
6147 | ||
6148 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
6149 | } | |
6150 | ||
6151 | if(type == "POI") | |
6152 | { | |
6153 | // p_{m*n,0}: | |
6154 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
6155 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
6156 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
6157 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
6158 | ||
6159 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
6160 | ||
6161 | t = 1; // typeFlag = RP or POI | |
6162 | } | |
6163 | else if(type == "RP") | |
6164 | { | |
6165 | // p_{m*n,0} = q_{m*n,0}: | |
6166 | p1n0kRe = q1n0kRe; | |
6167 | p1n0kIm = q1n0kIm; | |
6168 | ||
6169 | mp = mq; | |
6170 | ||
6171 | t = 0; // typeFlag = RP or POI | |
6172 | } | |
6173 | ||
1268c371 | 6174 | // 2'-particle correlation for particular pt or eta bin: |
489d5531 | 6175 | Double_t two1n1nPtEta = 0.; |
b40a910e | 6176 | Double_t mWeight2pPrime = 0.; // multiplicity weight for <2'> |
489d5531 | 6177 | if(mp*dMult-mq) |
6178 | { | |
6179 | two1n1nPtEta = (p1n0kRe*dReQ1n+p1n0kIm*dImQ1n-mq) | |
6180 | / (mp*dMult-mq); | |
b40a910e | 6181 | // determine multiplicity weight: |
6182 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
6183 | { | |
6184 | mWeight2pPrime = mp*dMult-mq; | |
6185 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
6186 | { | |
6187 | mWeight2pPrime = 1.; | |
6188 | } | |
489d5531 | 6189 | if(type == "POI") // to be improved (I do not this if) |
6190 | { | |
6191 | // fill profile to get <<2'>> for POIs | |
b40a910e | 6192 | fDiffFlowCorrelationsPro[1][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta,mWeight2pPrime); |
6193 | // fill profile to get <<2'>^2> for POIs | |
6194 | fDiffFlowSquaredCorrelationsPro[1][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta*two1n1nPtEta,mWeight2pPrime); | |
489d5531 | 6195 | // histogram to store <2'> for POIs e-b-e (needed in some other methods): |
6196 | fDiffFlowCorrelationsEBE[1][pe][0]->SetBinContent(b,two1n1nPtEta); | |
b40a910e | 6197 | fDiffFlowEventWeightsForCorrelationsEBE[1][pe][0]->SetBinContent(b,mWeight2pPrime); |
489d5531 | 6198 | } |
6199 | else if(type == "RP") // to be improved (I do not this if) | |
6200 | { | |
6201 | // profile to get <<2'>> for RPs: | |
b40a910e | 6202 | fDiffFlowCorrelationsPro[0][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta,mWeight2pPrime); |
6203 | // profile to get <<2'>^2> for RPs: | |
6204 | fDiffFlowSquaredCorrelationsPro[0][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta*two1n1nPtEta,mWeight2pPrime); | |
489d5531 | 6205 | // histogram to store <2'> for RPs e-b-e (needed in some other methods): |
6206 | fDiffFlowCorrelationsEBE[0][pe][0]->SetBinContent(b,two1n1nPtEta); | |
b40a910e | 6207 | fDiffFlowEventWeightsForCorrelationsEBE[0][pe][0]->SetBinContent(b,mWeight2pPrime); |
489d5531 | 6208 | } |
6209 | } // end of if(mp*dMult-mq) | |
6210 | ||
6211 | // 4'-particle correlation: | |
6212 | Double_t four1n1n1n1nPtEta = 0.; | |
b40a910e | 6213 | Double_t mWeight4pPrime = 0.; // multiplicity weight for <4'> |
489d5531 | 6214 | if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) |
6215 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression) | |
6216 | { | |
6217 | four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
6218 | - q2n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) | |
6219 | - 2.*q2n0kIm*dReQ1n*dImQ1n | |
6220 | - p1n0kRe*(dReQ1n*dReQ2n+dImQ1n*dImQ2n) | |
6221 | + p1n0kIm*(dImQ1n*dReQ2n-dReQ1n*dImQ2n) | |
6222 | - 2.*dMult*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
6223 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*mq | |
6224 | + 6.*(q1n0kRe*dReQ1n+q1n0kIm*dImQ1n) | |
6225 | + 1.*(q2n0kRe*dReQ2n+q2n0kIm*dImQ2n) | |
6226 | + 2.*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
6227 | + 2.*mq*dMult | |
6228 | - 6.*mq) | |
6229 | / ((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6230 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b40a910e | 6231 | // determine multiplicity weight: |
6232 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
6233 | { | |
6234 | mWeight4pPrime = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
6235 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
6236 | { | |
6237 | mWeight4pPrime = 1.; | |
6238 | } | |
489d5531 | 6239 | if(type == "POI") |
6240 | { | |
6241 | // profile to get <<4'>> for POIs: | |
b40a910e | 6242 | fDiffFlowCorrelationsPro[1][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta,mWeight4pPrime); |
6243 | // profile to get <<4'>^2> for POIs: | |
6244 | fDiffFlowSquaredCorrelationsPro[1][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta*four1n1n1n1nPtEta,mWeight4pPrime); | |
489d5531 | 6245 | // histogram to store <4'> for POIs e-b-e (needed in some other methods): |
6246 | fDiffFlowCorrelationsEBE[1][pe][1]->SetBinContent(b,four1n1n1n1nPtEta); | |
b40a910e | 6247 | fDiffFlowEventWeightsForCorrelationsEBE[1][pe][1]->SetBinContent(b,mWeight4pPrime); |
489d5531 | 6248 | } |
6249 | else if(type == "RP") | |
6250 | { | |
6251 | // profile to get <<4'>> for RPs: | |
b40a910e | 6252 | fDiffFlowCorrelationsPro[0][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta,mWeight4pPrime); |
6253 | // profile to get <<4'>^2> for RPs: | |
6254 | fDiffFlowSquaredCorrelationsPro[0][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta*four1n1n1n1nPtEta,mWeight4pPrime); | |
489d5531 | 6255 | // histogram to store <4'> for RPs e-b-e (needed in some other methods): |
6256 | fDiffFlowCorrelationsEBE[0][pe][1]->SetBinContent(b,four1n1n1n1nPtEta); | |
b40a910e | 6257 | fDiffFlowEventWeightsForCorrelationsEBE[0][pe][1]->SetBinContent(b,mWeight4pPrime); |
489d5531 | 6258 | } |
6259 | } // end of if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6260 | // +mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
6261 | ||
6262 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6263 | ||
6264 | ||
6265 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelations(TString type, TString ptOrEta); | |
6266 | ||
489d5531 | 6267 | //================================================================================================================================ |
6268 | ||
1268c371 | 6269 | void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCorrelations(TString type) |
6270 | { | |
6271 | // Calculate all reduced correlations needed for 2D differential flow for each (pt,eta) bin. | |
6272 | ||
6273 | // Multiplicity: | |
6274 | Double_t dMult = (*fSpk)(0,0); | |
6275 | // Real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
6276 | Double_t dReQ1n = (*fReQ)(0,0); | |
6277 | Double_t dReQ2n = (*fReQ)(1,0); | |
6278 | //Double_t dReQ3n = (*fReQ)(2,0); | |
6279 | //Double_t dReQ4n = (*fReQ)(3,0); | |
6280 | Double_t dImQ1n = (*fImQ)(0,0); | |
6281 | Double_t dImQ2n = (*fImQ)(1,0); | |
6282 | //Double_t dImQ3n = (*fImQ)(2,0); | |
6283 | //Double_t dImQ4n = (*fImQ)(3,0); | |
6284 | ||
6285 | // 2D reduced correlations are stored in TProfile2D f2DDiffFlowCorrelationsPro[0=RP,1=POI][correlation index]. | |
6286 | // Correlation index runs as follows: | |
6287 | // 0: <<2'>> | |
6288 | // 1: <<4'>> | |
6289 | // 2: <<6'>> | |
6290 | // 3: <<8'>> | |
6291 | ||
6292 | Int_t t = 0; // type flag | |
6293 | if(type == "RP") | |
6294 | { | |
6295 | t = 0; | |
6296 | } else if(type == "POI") | |
6297 | { | |
6298 | t = 1; | |
6299 | } | |
6300 | ||
6301 | // Looping over all (pt,eta) bins and calculating correlations needed for differential flow: | |
6302 | for(Int_t p=1;p<=fnBinsPt;p++) | |
6303 | { | |
6304 | for(Int_t e=1;e<=fnBinsEta;e++) | |
6305 | { | |
6306 | // Real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): | |
6307 | Double_t p1n0kRe = 0.; | |
6308 | Double_t p1n0kIm = 0.; | |
6309 | // Number of POIs in particular pt or eta bin: | |
6310 | Double_t mp = 0.; | |
6311 | // Real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for 'RP && POI particles' in particular pt or eta bin): | |
6312 | Double_t q1n0kRe = 0.; | |
6313 | Double_t q1n0kIm = 0.; | |
6314 | Double_t q2n0kRe = 0.; | |
6315 | Double_t q2n0kIm = 0.; | |
6316 | // Number of 'RP && POI particles' in particular pt or eta bin: | |
6317 | Double_t mq = 0.; | |
6318 | if(type == "POI") | |
6319 | { | |
6320 | // q_{m*n,0}: | |
6321 | q1n0kRe = fReRPQ2dEBE[2][0][0]->GetBinContent(fReRPQ2dEBE[2][0][0]->GetBin(p,e)) | |
6322 | * fReRPQ2dEBE[2][0][0]->GetBinEntries(fReRPQ2dEBE[2][0][0]->GetBin(p,e)); | |
6323 | q1n0kIm = fImRPQ2dEBE[2][0][0]->GetBinContent(fImRPQ2dEBE[2][0][0]->GetBin(p,e)) | |
6324 | * fImRPQ2dEBE[2][0][0]->GetBinEntries(fImRPQ2dEBE[2][0][0]->GetBin(p,e)); | |
6325 | q2n0kRe = fReRPQ2dEBE[2][1][0]->GetBinContent(fReRPQ2dEBE[2][1][0]->GetBin(p,e)) | |
6326 | * fReRPQ2dEBE[2][1][0]->GetBinEntries(fReRPQ2dEBE[2][1][0]->GetBin(p,e)); | |
6327 | q2n0kIm = fImRPQ2dEBE[2][1][0]->GetBinContent(fImRPQ2dEBE[2][1][0]->GetBin(p,e)) | |
6328 | * fImRPQ2dEBE[2][1][0]->GetBinEntries(fImRPQ2dEBE[2][1][0]->GetBin(p,e)); | |
6329 | // m_{q}: | |
6330 | mq = fReRPQ2dEBE[2][0][0]->GetBinEntries(fReRPQ2dEBE[2][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) | |
6331 | } // end of if(type == "POI") | |
6332 | else if(type == "RP") | |
6333 | { | |
6334 | // q_{m*n,0}: | |
6335 | q1n0kRe = fReRPQ2dEBE[0][0][0]->GetBinContent(fReRPQ2dEBE[0][0][0]->GetBin(p,e)) | |
6336 | * fReRPQ2dEBE[0][0][0]->GetBinEntries(fReRPQ2dEBE[0][0][0]->GetBin(p,e)); | |
6337 | q1n0kIm = fImRPQ2dEBE[0][0][0]->GetBinContent(fImRPQ2dEBE[0][0][0]->GetBin(p,e)) | |
6338 | * fImRPQ2dEBE[0][0][0]->GetBinEntries(fImRPQ2dEBE[0][0][0]->GetBin(p,e)); | |
6339 | q2n0kRe = fReRPQ2dEBE[0][1][0]->GetBinContent(fReRPQ2dEBE[0][1][0]->GetBin(p,e)) | |
6340 | * fReRPQ2dEBE[0][1][0]->GetBinEntries(fReRPQ2dEBE[0][1][0]->GetBin(p,e)); | |
6341 | q2n0kIm = fImRPQ2dEBE[0][1][0]->GetBinContent(fImRPQ2dEBE[0][1][0]->GetBin(p,e)) | |
6342 | * fImRPQ2dEBE[0][1][0]->GetBinEntries(fImRPQ2dEBE[0][1][0]->GetBin(p,e)); | |
6343 | // m_{q}: | |
6344 | mq = fReRPQ2dEBE[0][0][0]->GetBinEntries(fReRPQ2dEBE[0][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) | |
6345 | } // end of else if(type == "RP") | |
6346 | if(type == "POI") | |
6347 | { | |
6348 | // p_{m*n,0}: | |
6349 | p1n0kRe = fReRPQ2dEBE[1][0][0]->GetBinContent(fReRPQ2dEBE[1][0][0]->GetBin(p,e)) | |
6350 | * fReRPQ2dEBE[1][0][0]->GetBinEntries(fReRPQ2dEBE[1][0][0]->GetBin(p,e)); | |
6351 | p1n0kIm = fImRPQ2dEBE[1][0][0]->GetBinContent(fImRPQ2dEBE[1][0][0]->GetBin(p,e)) | |
6352 | * fImRPQ2dEBE[1][0][0]->GetBinEntries(fImRPQ2dEBE[1][0][0]->GetBin(p,e)); | |
6353 | // m_{p} | |
6354 | mp = fReRPQ2dEBE[1][0][0]->GetBinEntries(fReRPQ2dEBE[1][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) | |
6355 | ||
6356 | t = 1; // typeFlag = RP or POI | |
6357 | } // end of if(type == "POI") | |
6358 | else if(type == "RP") | |
6359 | { | |
6360 | // p_{m*n,0} = q_{m*n,0}: | |
6361 | p1n0kRe = q1n0kRe; | |
6362 | p1n0kIm = q1n0kIm; | |
6363 | // m_{p} = m_{q}: | |
6364 | mp = mq; | |
6365 | ||
6366 | t = 0; // typeFlag = RP or POI | |
6367 | } // end of if(type == "RP") | |
6368 | ||
6369 | // 2'-particle correlation for particular (pt,eta) bin: | |
6370 | Double_t two1n1nPtEta = 0.; | |
6371 | Double_t mWeight2pPrime = 0.; // multiplicity weight for <2'> | |
6372 | if(mp*dMult-mq) | |
6373 | { | |
6374 | two1n1nPtEta = (p1n0kRe*dReQ1n+p1n0kIm*dImQ1n-mq) | |
6375 | / (mp*dMult-mq); | |
6376 | // Determine multiplicity weight: | |
6377 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
6378 | { | |
6379 | mWeight2pPrime = mp*dMult-mq; | |
6380 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
6381 | { | |
6382 | mWeight2pPrime = 1.; | |
6383 | } | |
6384 | // Fill 2D profile holding <<2'>>: | |
6385 | f2DDiffFlowCorrelationsPro[t][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mWeight2pPrime); | |
6386 | } // end of if(mp*dMult-mq) | |
6387 | ||
6388 | // 4'-particle correlation: | |
6389 | Double_t four1n1n1n1nPtEta = 0.; | |
6390 | Double_t mWeight4pPrime = 0.; // multiplicity weight for <4'> | |
6391 | if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6392 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression) | |
6393 | { | |
6394 | four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
6395 | - q2n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) | |
6396 | - 2.*q2n0kIm*dReQ1n*dImQ1n | |
6397 | - p1n0kRe*(dReQ1n*dReQ2n+dImQ1n*dImQ2n) | |
6398 | + p1n0kIm*(dImQ1n*dReQ2n-dReQ1n*dImQ2n) | |
6399 | - 2.*dMult*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
6400 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*mq | |
6401 | + 6.*(q1n0kRe*dReQ1n+q1n0kIm*dImQ1n) | |
6402 | + 1.*(q2n0kRe*dReQ2n+q2n0kIm*dImQ2n) | |
6403 | + 2.*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
6404 | + 2.*mq*dMult | |
6405 | - 6.*mq) | |
6406 | / ((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6407 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
6408 | // Determine multiplicity weight: | |
6409 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
6410 | { | |
6411 | mWeight4pPrime = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
6412 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
6413 | { | |
6414 | mWeight4pPrime = 1.; | |
6415 | } | |
6416 | // Fill 2D profile holding <<4'>>: | |
6417 | f2DDiffFlowCorrelationsPro[t][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta,mWeight4pPrime); | |
6418 | } // end of if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6419 | // +mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
6420 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
6421 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
6422 | ||
6423 | } // end of AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCorrelations(TString type) | |
6424 | ||
6425 | //================================================================================================================================ | |
6426 | ||
489d5531 | 6427 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfEventWeights(TString type, TString ptOrEta) |
6428 | { | |
6429 | // Calculate sums of various event weights for reduced correlations. | |
6430 | // (These quantitites are needed in expressions for unbiased estimators relevant for the statistical errors.) | |
6431 | ||
2a98ceb8 | 6432 | Int_t typeFlag = 0; |
6433 | Int_t ptEtaFlag = 0; | |
489d5531 | 6434 | |
6435 | if(type == "RP") | |
6436 | { | |
6437 | typeFlag = 0; | |
6438 | } else if(type == "POI") | |
6439 | { | |
6440 | typeFlag = 1; | |
6441 | } | |
6442 | ||
6443 | if(ptOrEta == "Pt") | |
6444 | { | |
6445 | ptEtaFlag = 0; | |
6446 | } else if(ptOrEta == "Eta") | |
6447 | { | |
6448 | ptEtaFlag = 1; | |
6449 | } | |
6450 | ||
6451 | // shortcuts: | |
6452 | Int_t t = typeFlag; | |
6453 | Int_t pe = ptEtaFlag; | |
6454 | ||
6455 | // binning: | |
6456 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
6457 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
6458 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
6459 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
6460 | ||
6461 | for(Int_t rpq=0;rpq<3;rpq++) | |
6462 | { | |
6463 | for(Int_t m=0;m<4;m++) | |
6464 | { | |
6465 | for(Int_t k=0;k<9;k++) | |
6466 | { | |
6467 | if(!fReRPQ1dEBE[rpq][pe][m][k]) | |
6468 | { | |
6469 | cout<<"WARNING: fReRPQ1dEBE[rpq][pe][m][k] is NULL in AFAWQC::CSAPOEWFDF() !!!!"<<endl; | |
6470 | cout<<"pe = "<<pe<<endl; | |
6471 | cout<<"rpq = "<<rpq<<endl; | |
6472 | cout<<"m = "<<m<<endl; | |
6473 | cout<<"k = "<<k<<endl; | |
6474 | exit(0); | |
6475 | } | |
6476 | } | |
6477 | } | |
6478 | } | |
6479 | ||
6480 | // multiplicities: | |
1268c371 | 6481 | Double_t dMult = (*fSpk)(0,0); // total event multiplicity |
489d5531 | 6482 | //Double_t mr = 0.; // number of RPs in particular pt or eta bin |
6483 | Double_t mp = 0.; // number of POIs in particular pt or eta bin | |
6484 | Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin | |
6485 | ||
6486 | // event weights for reduced correlations: | |
6487 | Double_t dw2 = 0.; // event weight for <2'> | |
6488 | Double_t dw4 = 0.; // event weight for <4'> | |
6489 | //Double_t dw6 = 0.; // event weight for <6'> | |
6490 | //Double_t dw8 = 0.; // event weight for <8'> | |
6491 | ||
6492 | // looping over bins: | |
6493 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6494 | { | |
6495 | if(type == "RP") | |
6496 | { | |
6497 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b); | |
6498 | mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow | |
6499 | } else if(type == "POI") | |
6500 | { | |
6501 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b); | |
6502 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); | |
6503 | } | |
6504 | ||
6505 | // event weight for <2'>: | |
6506 | dw2 = mp*dMult-mq; | |
6507 | fDiffFlowSumOfEventWeights[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2); | |
6508 | fDiffFlowSumOfEventWeights[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw2,2.)); | |
6509 | ||
6510 | // event weight for <4'>: | |
6511 | dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6512 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
6513 | fDiffFlowSumOfEventWeights[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4); | |
6514 | fDiffFlowSumOfEventWeights[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw4,2.)); | |
6515 | ||
6516 | // event weight for <6'>: | |
6517 | //dw6 = ...; | |
6518 | //fDiffFlowSumOfEventWeights[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6); | |
6519 | //fDiffFlowSumOfEventWeights[t][pe][t][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw6,2.)); | |
6520 | ||
6521 | // event weight for <8'>: | |
6522 | //dw8 = ...; | |
6523 | //fDiffFlowSumOfEventWeights[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw8); | |
6524 | //fDiffFlowSumOfEventWeights[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw8,2.)); | |
6525 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6526 | ||
6527 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfEventWeights() | |
6528 | ||
6529 | ||
6530 | //================================================================================================================================ | |
6531 | ||
6532 | ||
6533 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfProductOfEventWeights(TString type, TString ptOrEta) | |
6534 | { | |
6535 | // Calculate sum of products of various event weights for both types of correlations (the ones for int. and diff. flow). | |
6536 | // (These quantitites are needed in expressions for unbiased estimators relevant for the statistical errors.) | |
6537 | // | |
6538 | // Important: To fill fDiffFlowSumOfProductOfEventWeights[][][][] use bellow table (i,j) with following constraints: | |
6539 | // 1.) i<j | |
6540 | // 2.) do not store terms which DO NOT include reduced correlations; | |
6541 | // Table: | |
6542 | // [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] x [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] | |
6543 | ||
2a98ceb8 | 6544 | Int_t typeFlag = 0; |
6545 | Int_t ptEtaFlag = 0; | |
489d5531 | 6546 | |
6547 | if(type == "RP") | |
6548 | { | |
6549 | typeFlag = 0; | |
6550 | } else if(type == "POI") | |
6551 | { | |
6552 | typeFlag = 1; | |
6553 | } | |
6554 | ||
6555 | if(ptOrEta == "Pt") | |
6556 | { | |
6557 | ptEtaFlag = 0; | |
6558 | } else if(ptOrEta == "Eta") | |
6559 | { | |
6560 | ptEtaFlag = 1; | |
6561 | } | |
6562 | ||
6563 | // shortcuts: | |
6564 | Int_t t = typeFlag; | |
6565 | Int_t pe = ptEtaFlag; | |
6566 | ||
6567 | // binning: | |
6568 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
6569 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
6570 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
6571 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
6572 | ||
6573 | // protection: | |
6574 | for(Int_t rpq=0;rpq<3;rpq++) | |
6575 | { | |
6576 | for(Int_t m=0;m<4;m++) | |
6577 | { | |
6578 | for(Int_t k=0;k<9;k++) | |
6579 | { | |
6580 | if(!fReRPQ1dEBE[rpq][pe][m][k]) | |
6581 | { | |
6582 | cout<<"WARNING: fReRPQ1dEBE[rpq][pe][m][k] is NULL in AFAWQC::CSAPOEWFDF() !!!!"<<endl; | |
6583 | cout<<"pe = "<<pe<<endl; | |
6584 | cout<<"rpq = "<<rpq<<endl; | |
6585 | cout<<"m = "<<m<<endl; | |
6586 | cout<<"k = "<<k<<endl; | |
6587 | exit(0); | |
6588 | } | |
6589 | } | |
6590 | } | |
6591 | } | |
6592 | ||
6593 | // multiplicities: | |
1268c371 | 6594 | Double_t dMult = (*fSpk)(0,0); // total event multiplicity |
489d5531 | 6595 | //Double_t mr = 0.; // number of RPs in particular pt or eta bin |
6596 | Double_t mp = 0.; // number of POIs in particular pt or eta bin | |
6597 | Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin | |
6598 | ||
6599 | // event weights for correlations: | |
6600 | Double_t dW2 = dMult*(dMult-1); // event weight for <2> | |
6601 | Double_t dW4 = dMult*(dMult-1)*(dMult-2)*(dMult-3); // event weight for <4> | |
6602 | Double_t dW6 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5); // event weight for <6> | |
6603 | Double_t dW8 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)*(dMult-6)*(dMult-7); // event weight for <8> | |
6604 | ||
6605 | // event weights for reduced correlations: | |
6606 | Double_t dw2 = 0.; // event weight for <2'> | |
6607 | Double_t dw4 = 0.; // event weight for <4'> | |
6608 | //Double_t dw6 = 0.; // event weight for <6'> | |
6609 | //Double_t dw8 = 0.; // event weight for <8'> | |
6610 | ||
6611 | // looping over bins: | |
6612 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6613 | { | |
6614 | if(type == "RP") | |
6615 | { | |
6616 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b); | |
6617 | mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow | |
6618 | } else if(type == "POI") | |
6619 | { | |
6620 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b); | |
6621 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); | |
6622 | } | |
6623 | ||
6624 | // event weight for <2'>: | |
6625 | dw2 = mp*dMult-mq; | |
6626 | fDiffFlowSumOfProductOfEventWeights[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw2); // storing product of even weights for <2> and <2'> | |
6627 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW4); // storing product of even weights for <4> and <2'> | |
6628 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW6); // storing product of even weights for <6> and <2'> | |
6629 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW8); // storing product of even weights for <8> and <2'> | |
6630 | ||
6631 | // event weight for <4'>: | |
6632 | dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6633 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
6634 | fDiffFlowSumOfProductOfEventWeights[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw4); // storing product of even weights for <2> and <4'> | |
6635 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw4); // storing product of even weights for <2'> and <4'> | |
6636 | fDiffFlowSumOfProductOfEventWeights[t][pe][2][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw4); // storing product of even weights for <4> and <4'> | |
6637 | fDiffFlowSumOfProductOfEventWeights[t][pe][3][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dW6); // storing product of even weights for <6> and <4'> | |
6638 | fDiffFlowSumOfProductOfEventWeights[t][pe][3][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dW8); // storing product of even weights for <8> and <4'> | |
6639 | ||
6640 | // event weight for <6'>: | |
6641 | //dw6 = ...; | |
6642 | //fDiffFlowSumOfProductOfEventWeights[t][pe][0][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw6); // storing product of even weights for <2> and <6'> | |
6643 | //fDiffFlowSumOfProductOfEventWeights[t][pe][1][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw6); // storing product of even weights for <2'> and <6'> | |
6644 | //fDiffFlowSumOfProductOfEventWeights[t][pe][2][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw6); // storing product of even weights for <4> and <6'> | |
6645 | //fDiffFlowSumOfProductOfEventWeights[t][pe][3][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dw6); // storing product of even weights for <4'> and <6'> | |
6646 | //fDiffFlowSumOfProductOfEventWeights[t][pe][4][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW6*dw6); // storing product of even weights for <6> and <6'> | |
6647 | //fDiffFlowSumOfProductOfEventWeights[t][pe][5][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dW8); // storing product of even weights for <6'> and <8> | |
6648 | //fDiffFlowSumOfProductOfEventWeights[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dw8); // storing product of even weights for <6'> and <8'> | |
6649 | ||
6650 | // event weight for <8'>: | |
6651 | //dw8 = ...; | |
6652 | //fDiffFlowSumOfProductOfEventWeights[t][pe][0][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw8); // storing product of even weights for <2> and <8'> | |
6653 | //fDiffFlowSumOfProductOfEventWeights[t][pe][1][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw8); // storing product of even weights for <2'> and <8'> | |
6654 | //fDiffFlowSumOfProductOfEventWeights[t][pe][2][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw8); // storing product of even weights for <4> and <8'> | |
6655 | //fDiffFlowSumOfProductOfEventWeights[t][pe][3][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dw8); // storing product of even weights for <4'> and <8'> | |
6656 | //fDiffFlowSumOfProductOfEventWeights[t][pe][4][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW6*dw8); // storing product of even weights for <6> and <8'> | |
6657 | //fDiffFlowSumOfProductOfEventWeights[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dw8); // storing product of even weights for <6'> and <8'> | |
6658 | //fDiffFlowSumOfProductOfEventWeights[t][pe][6][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW8*dw8); // storing product of even weights for <8> and <8'> | |
6659 | ||
6660 | // Table: | |
6661 | // [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] x [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] | |
6662 | ||
6663 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6664 | ||
6665 | ||
6666 | ||
6667 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfProductOfEventWeights(TString type, TString ptOrEta) | |
6668 | ||
489d5531 | 6669 | //================================================================================================================================ |
6670 | ||
489d5531 | 6671 | void AliFlowAnalysisWithQCumulants::FinalizeReducedCorrelations(TString type, TString ptOrEta) |
6672 | { | |
6673 | // Transfer profiles into histograms and calculate statistical errors correctly. | |
6674 | ||
1268c371 | 6675 | Int_t t = 0; // RP or POI |
6676 | Int_t pe = 0; // pt or eta | |
489d5531 | 6677 | |
6678 | if(type == "RP") | |
6679 | { | |
1268c371 | 6680 | t = 0; |
489d5531 | 6681 | } else if(type == "POI") |
6682 | { | |
1268c371 | 6683 | t = 1; |
489d5531 | 6684 | } |
6685 | ||
6686 | if(ptOrEta == "Pt") | |
6687 | { | |
1268c371 | 6688 | pe = 0; |
489d5531 | 6689 | } else if(ptOrEta == "Eta") |
6690 | { | |
1268c371 | 6691 | pe = 1; |
489d5531 | 6692 | } |
1268c371 | 6693 | |
6694 | for(Int_t rci=0;rci<4;rci++) // to be improved - moved into the method CheckPointersUsedInFinish() | |
489d5531 | 6695 | { |
6696 | if(!fDiffFlowCorrelationsPro[t][pe][rci]) | |
6697 | { | |
6698 | cout<<"WARNING: fDiffFlowCorrelationsPro[t][pe][rci] is NULL in AFAWQC::FRC() !!!!"<<endl; | |
6699 | cout<<"t = "<<t<<endl; | |
6700 | cout<<"pe = "<<pe<<endl; | |
6701 | cout<<"rci = "<<rci<<endl; | |
6702 | exit(0); | |
6703 | } | |
b40a910e | 6704 | if(!fDiffFlowSquaredCorrelationsPro[t][pe][rci]) |
6705 | { | |
6706 | cout<<"WARNING: fDiffFlowSquaredCorrelationsPro[t][pe][rci] is NULL in AFAWQC::FRC() !!!!"<<endl; | |
6707 | cout<<"t = "<<t<<endl; | |
6708 | cout<<"pe = "<<pe<<endl; | |
6709 | cout<<"rci = "<<rci<<endl; | |
6710 | exit(0); | |
6711 | } | |
489d5531 | 6712 | for(Int_t power=0;power<2;power++) |
6713 | { | |
6714 | if(!fDiffFlowSumOfEventWeights[t][pe][power][rci]) | |
6715 | { | |
6716 | cout<<"WARNING: fDiffFlowSumOfEventWeights[t][pe][power][rci] is NULL in AFAWQC::FRC() !!!!"<<endl; | |
6717 | cout<<"t = "<<t<<endl; | |
6718 | cout<<"pe = "<<pe<<endl; | |
6719 | cout<<"power = "<<power<<endl; | |
6720 | cout<<"rci = "<<rci<<endl; | |
6721 | exit(0); | |
6722 | } | |
6723 | } // end of for(Int_t power=0;power<2;power++) | |
6724 | } // end of for(Int_t rci=0;rci<4;rci++) | |
6725 | ||
6726 | // common: | |
b40a910e | 6727 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
489d5531 | 6728 | // transfer 1D profile into 1D histogram: |
6729 | Double_t correlation = 0.; | |
b40a910e | 6730 | Double_t squaredCorrelation = 0.; |
489d5531 | 6731 | Double_t spread = 0.; |
6732 | Double_t sumOfWeights = 0.; // sum of weights for particular reduced correlations for particular pt or eta bin | |
6733 | Double_t sumOfSquaredWeights = 0.; // sum of squared weights for particular reduced correlations for particular pt or eta bin | |
6734 | Double_t error = 0.; // error = termA * spread * termB | |
6735 | // termA = (sqrt(sumOfSquaredWeights)/sumOfWeights) | |
6736 | // termB = 1/pow(1-termA^2,0.5) | |
6737 | Double_t termA = 0.; | |
6738 | Double_t termB = 0.; | |
6739 | for(Int_t rci=0;rci<4;rci++) // index of reduced correlation | |
6740 | { | |
6741 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) // number of pt or eta bins | |
6742 | { | |
b40a910e | 6743 | if(fDiffFlowCorrelationsPro[t][pe][rci]->GetBinEffectiveEntries(b) < 2 || |
6744 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->GetBinEffectiveEntries(b) < 2) | |
6745 | { | |
6746 | fDiffFlowCorrelationsPro[t][pe][rci]->SetBinError(b,0.); | |
6747 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->SetBinError(b,0.); | |
6748 | continue; // to be improved - should I ignore results in pt bins with one entry for reduced correlations or not? | |
6749 | } | |
489d5531 | 6750 | correlation = fDiffFlowCorrelationsPro[t][pe][rci]->GetBinContent(b); |
b40a910e | 6751 | squaredCorrelation = fDiffFlowSquaredCorrelationsPro[t][pe][rci]->GetBinContent(b); |
6752 | if(squaredCorrelation-correlation*correlation >= 0.) | |
6753 | { | |
6754 | spread = pow(squaredCorrelation-correlation*correlation,0.5); | |
6755 | } else | |
6756 | { | |
6757 | cout<<endl; | |
6758 | cout<<Form(" WARNING: Imaginary 'spread' for rci = %d, pe = %d, bin = %d !!!!",rci,pe,b)<<endl; | |
6759 | cout<<endl; | |
6760 | } | |
489d5531 | 6761 | sumOfWeights = fDiffFlowSumOfEventWeights[t][pe][0][rci]->GetBinContent(b); |
6762 | sumOfSquaredWeights = fDiffFlowSumOfEventWeights[t][pe][1][rci]->GetBinContent(b); | |
1268c371 | 6763 | if(TMath::Abs(sumOfWeights)>0.){termA = (pow(sumOfSquaredWeights,0.5)/sumOfWeights);} |
6764 | if(1.-pow(termA,2.)>0.){termB = 1./pow(1.-pow(termA,2.),0.5);} | |
489d5531 | 6765 | error = termA*spread*termB; // final error (unbiased estimator for standard deviation) |
6766 | fDiffFlowCorrelationsHist[t][pe][rci]->SetBinContent(b,correlation); | |
6767 | fDiffFlowCorrelationsHist[t][pe][rci]->SetBinError(b,error); | |
6768 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6769 | } // end of for(Int_t rci=0;rci<4;rci++) | |
6770 | ||
6771 | } // end of void AliFlowAnalysisWithQCumulants::FinalizeReducedCorrelations(TString type, TString ptOrEta) | |
6772 | ||
489d5531 | 6773 | //================================================================================================================================ |
6774 | ||
489d5531 | 6775 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowProductOfCorrelations(TString type, TString ptOrEta) |
6776 | { | |
6777 | // store products: <2><2'>, <2><4'>, <2><6'>, <2><8'>, <2'><4>, | |
6778 | // <2'><4'>, <2'><6>, <2'><6'>, <2'><8>, <2'><8'>, | |
6779 | // <4><4'>, <4><6'>, <4><8'>, <4'><6>, <4'><6'>, | |
6780 | // <4'><8>, <4'><8'>, <6><6'>, <6><8'>, <6'><8>, | |
6781 | // <6'><8'>, <8><8'>. | |
6782 | ||
2a98ceb8 | 6783 | Int_t typeFlag = 0; |
6784 | Int_t ptEtaFlag = 0; | |
489d5531 | 6785 | |
6786 | if(type == "RP") | |
6787 | { | |
6788 | typeFlag = 0; | |
6789 | } else if(type == "POI") | |
6790 | { | |
6791 | typeFlag = 1; | |
6792 | } | |
6793 | ||
6794 | if(ptOrEta == "Pt") | |
6795 | { | |
6796 | ptEtaFlag = 0; | |
6797 | } else if(ptOrEta == "Eta") | |
6798 | { | |
6799 | ptEtaFlag = 1; | |
6800 | } | |
6801 | ||
6802 | // shortcuts: | |
6803 | Int_t t = typeFlag; | |
6804 | Int_t pe = ptEtaFlag; | |
6805 | ||
6806 | // common: | |
6807 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
6808 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
6809 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
6810 | ||
6811 | // protections // to be improved (add protection for all pointers in this method) | |
6812 | if(!fIntFlowCorrelationsEBE) | |
6813 | { | |
6814 | cout<<"WARNING: fIntFlowCorrelationsEBE is NULL in AFAWQC::CDFPOC() !!!!"<<endl; | |
6815 | exit(0); | |
6816 | } | |
6817 | ||
6818 | /* | |
1268c371 | 6819 | Double_t dMult = (*fSpk)(0,0); // multiplicity (number of particles used to determine the reaction plane) |
489d5531 | 6820 | //Double_t mr = 0.; // number of RPs in particular pt or eta bin |
6821 | Double_t mp = 0.; // number of POIs in particular pt or eta bin | |
6822 | Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin | |
6823 | */ | |
6824 | ||
6825 | // e-b-e correlations: | |
6826 | Double_t twoEBE = fIntFlowCorrelationsEBE->GetBinContent(1); // <2> | |
6827 | Double_t fourEBE = fIntFlowCorrelationsEBE->GetBinContent(2); // <4> | |
6828 | Double_t sixEBE = fIntFlowCorrelationsEBE->GetBinContent(3); // <6> | |
6829 | Double_t eightEBE = fIntFlowCorrelationsEBE->GetBinContent(4); // <8> | |
6830 | ||
6831 | // event weights for correlations: | |
6832 | Double_t dW2 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1); // event weight for <2> | |
6833 | Double_t dW4 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2); // event weight for <4> | |
6834 | Double_t dW6 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(3); // event weight for <6> | |
6835 | Double_t dW8 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(4); // event weight for <8> | |
6836 | ||
6837 | // e-b-e reduced correlations: | |
6838 | Double_t twoReducedEBE = 0.; // <2'> | |
6839 | Double_t fourReducedEBE = 0.; // <4'> | |
6840 | Double_t sixReducedEBE = 0.; // <6'> | |
6841 | Double_t eightReducedEBE = 0.; // <8'> | |
6842 | ||
6843 | // event weights for reduced correlations: | |
6844 | Double_t dw2 = 0.; // event weight for <2'> | |
6845 | Double_t dw4 = 0.; // event weight for <4'> | |
6846 | //Double_t dw6 = 0.; // event weight for <6'> | |
6847 | //Double_t dw8 = 0.; // event weight for <8'> | |
6848 | ||
6849 | // looping over bins: | |
6850 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6851 | { | |
6852 | // e-b-e reduced correlations: | |
6853 | twoReducedEBE = fDiffFlowCorrelationsEBE[t][pe][0]->GetBinContent(b); | |
6854 | fourReducedEBE = fDiffFlowCorrelationsEBE[t][pe][1]->GetBinContent(b); | |
6855 | sixReducedEBE = fDiffFlowCorrelationsEBE[t][pe][2]->GetBinContent(b); | |
6856 | eightReducedEBE = fDiffFlowCorrelationsEBE[t][pe][3]->GetBinContent(b); | |
6857 | ||
6858 | /* | |
6859 | // to be improved (I should not do this here again) | |
6860 | if(type == "RP") | |
6861 | { | |
6862 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b); | |
6863 | mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow | |
6864 | } else if(type == "POI") | |
6865 | { | |
6866 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b); | |
6867 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); | |
6868 | } | |
6869 | ||
6870 | // event weights for reduced correlations: | |
6871 | dw2 = mp*dMult-mq; // weight for <2'> | |
6872 | dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6873 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); // weight for <4'> | |
6874 | //dw6 = ... | |
6875 | //dw8 = ... | |
6876 | ||
6877 | */ | |
6878 | ||
6879 | dw2 = fDiffFlowEventWeightsForCorrelationsEBE[t][pe][0]->GetBinContent(b); | |
6880 | dw4 = fDiffFlowEventWeightsForCorrelationsEBE[t][pe][1]->GetBinContent(b); | |
6881 | ||
6882 | // storing all products: | |
6883 | fDiffFlowProductOfCorrelationsPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*twoReducedEBE,dW2*dw2); // storing <2><2'> | |
6884 | fDiffFlowProductOfCorrelationsPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*twoReducedEBE,dW4*dw2); // storing <4><2'> | |
6885 | fDiffFlowProductOfCorrelationsPro[t][pe][1][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*twoReducedEBE,dW6*dw2); // storing <6><2'> | |
6886 | fDiffFlowProductOfCorrelationsPro[t][pe][1][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*twoReducedEBE,dW8*dw2); // storing <8><2'> | |
6887 | ||
6888 | // event weight for <4'>: | |
6889 | fDiffFlowProductOfCorrelationsPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*fourReducedEBE,dW2*dw4); // storing <2><4'> | |
6890 | fDiffFlowProductOfCorrelationsPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*fourReducedEBE,dw2*dw4); // storing <2'><4'> | |
6891 | fDiffFlowProductOfCorrelationsPro[t][pe][2][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*fourReducedEBE,dW4*dw4); // storing <4><4'> | |
6892 | fDiffFlowProductOfCorrelationsPro[t][pe][3][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*fourReducedEBE,dW6*dw4); // storing <6><4'> | |
6893 | fDiffFlowProductOfCorrelationsPro[t][pe][3][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*fourReducedEBE,dW8*dw4); // storing <8><4'> | |
6894 | ||
6895 | // event weight for <6'>: | |
6896 | //dw6 = ...; | |
6897 | //fDiffFlowProductOfCorrelationsPro[t][pe][0][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*sixReducedEBE,dW2*dw6); // storing <2><6'> | |
6898 | //fDiffFlowProductOfCorrelationsPro[t][pe][1][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*sixReducedEBE,dw2*dw6); // storing <2'><6'> | |
6899 | //fDiffFlowProductOfCorrelationsPro[t][pe][2][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*sixReducedEBE,dW4*dw6); // storing <4><6'> | |
6900 | //fDiffFlowProductOfCorrelationsPro[t][pe][3][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourReducedEBE*sixReducedEBE,dw4*dw6); // storing <4'><6'> | |
6901 | //fDiffFlowProductOfCorrelationsPro[t][pe][4][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*sixReducedEBE,dW6*dw6); // storing <6><6'> | |
6902 | //fDiffFlowProductOfCorrelationsPro[t][pe][5][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightEBE,dw6*dW8); // storing <6'><8> | |
6903 | //fDiffFlowProductOfCorrelationsPro[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightReducedEBE,dw6*dw8); // storing <6'><8'> | |
6904 | ||
6905 | // event weight for <8'>: | |
6906 | //dw8 = ...; | |
6907 | //fDiffFlowProductOfCorrelationsPro[t][pe][0][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*eightReducedEBE,dW2*dw8); // storing <2><8'> | |
6908 | //fDiffFlowProductOfCorrelationsPro[t][pe][1][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*eightReducedEBE,dw2*dw8); // storing <2'><8'> | |
6909 | //fDiffFlowProductOfCorrelationsPro[t][pe][2][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*eightReducedEBE,dW4*dw8); // storing <4><8'> | |
6910 | //fDiffFlowProductOfCorrelationsPro[t][pe][3][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourReducedEBE*eightReducedEBE,dw4*dw8); // storing <4'><8'> | |
6911 | //fDiffFlowProductOfCorrelationsPro[t][pe][4][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*eightReducedEBE,dW6*dw8); // storing <6><8'> | |
6912 | //fDiffFlowProductOfCorrelationsPro[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightReducedEBE,dw6*dw8); // storing <6'><8'> | |
6913 | //fDiffFlowProductOfCorrelationsPro[t][pe][6][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*eightReducedEBE,dW8*dw8); // storing <8><8'> | |
6914 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++ | |
6915 | ||
6916 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowProductOfCorrelations(TString type, TString ptOrEta) | |
6917 | ||
489d5531 | 6918 | //================================================================================================================================ |
6919 | ||
489d5531 | 6920 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCovariances(TString type, TString ptOrEta) // to be improved (reimplemented) |
6921 | { | |
6922 | // a) Calculate unbiased estimators Cov(<2>,<2'>), Cov(<2>,<4'>), Cov(<4>,<2'>), Cov(<4>,<4'>) and Cov(<2'>,<4'>) | |
6923 | // for covariances V(<2>,<2'>), V(<2>,<4'>), V(<4>,<2'>), V(<4>,<4'>) and V(<2'>,<4'>). | |
6924 | // b) Store in histogram fDiffFlowCovariances[t][pe][index] for instance the following: | |
6925 | // | |
6926 | // Cov(<2>,<2'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] | |
6927 | // | |
6928 | // where N is the number of events, w_{<2>} is event weight for <2> and w_{<2'>} is event weight for <2'>. | |
6929 | // c) Binning of fDiffFlowCovariances[t][pe][index] is organized as follows: | |
6930 | // | |
6931 | // 1st bin: Cov(<2>,<2'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] | |
6932 | // 2nd bin: Cov(<2>,<4'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] | |
6933 | // 3rd bin: Cov(<4>,<2'>) * (sum_{i=1}^{N} w_{<4>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] | |
6934 | // 4th bin: Cov(<4>,<4'>) * (sum_{i=1}^{N} w_{<4>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] | |
6935 | // 5th bin: Cov(<2'>,<4'>) * (sum_{i=1}^{N} w_{<2'>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<2'>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] | |
6936 | // ... | |
6937 | ||
2a98ceb8 | 6938 | Int_t typeFlag = 0; |
6939 | Int_t ptEtaFlag = 0; | |
489d5531 | 6940 | |
6941 | if(type == "RP") | |
6942 | { | |
6943 | typeFlag = 0; | |
6944 | } else if(type == "POI") | |
6945 | { | |
6946 | typeFlag = 1; | |
6947 | } | |
6948 | ||
6949 | if(ptOrEta == "Pt") | |
6950 | { | |
6951 | ptEtaFlag = 0; | |
6952 | } else if(ptOrEta == "Eta") | |
6953 | { | |
6954 | ptEtaFlag = 1; | |
6955 | } | |
6956 | ||
6957 | // shortcuts: | |
6958 | Int_t t = typeFlag; | |
6959 | Int_t pe = ptEtaFlag; | |
6960 | ||
6961 | // common: | |
6962 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
6963 | //Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
6964 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
6965 | //Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
6966 | ||
6967 | // average correlations: | |
6968 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> | |
6969 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> | |
6970 | //Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> | |
6971 | //Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> | |
6972 | ||
6973 | // sum of weights for correlation: | |
6974 | Double_t sumOfWeightsForTwo = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // sum_{i=1}^{N} w_{<2>} | |
6975 | Double_t sumOfWeightsForFour = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // sum_{i=1}^{N} w_{<4>} | |
6976 | //Double_t sumOfWeightsForSix = fIntFlowSumOfEventWeights[0]->GetBinContent(3); // sum_{i=1}^{N} w_{<6>} | |
6977 | //Double_t sumOfWeightsForEight = fIntFlowSumOfEventWeights[0]->GetBinContent(4); // sum_{i=1}^{N} w_{<8>} | |
6978 | ||
6979 | // average reduced correlations: | |
6980 | Double_t twoReduced = 0.; // <<2'>> | |
6981 | Double_t fourReduced = 0.; // <<4'>> | |
6982 | //Double_t sixReduced = 0.; // <<6'>> | |
6983 | //Double_t eightReduced = 0.; // <<8'>> | |
6984 | ||
6985 | // sum of weights for reduced correlation: | |
6986 | Double_t sumOfWeightsForTwoReduced = 0.; // sum_{i=1}^{N} w_{<2'>} | |
6987 | Double_t sumOfWeightsForFourReduced = 0.; // sum_{i=1}^{N} w_{<4'>} | |
6988 | //Double_t sumOfWeightsForSixReduced = 0.; // sum_{i=1}^{N} w_{<6'>} | |
6989 | //Double_t sumOfWeightsForEightReduced = 0.; // sum_{i=1}^{N} w_{<8'>} | |
6990 | ||
6991 | // product of weights for reduced correlation: | |
6992 | Double_t productOfWeightsForTwoTwoReduced = 0.; // sum_{i=1}^{N} w_{<2>}w_{<2'>} | |
6993 | Double_t productOfWeightsForTwoFourReduced = 0.; // sum_{i=1}^{N} w_{<2>}w_{<4'>} | |
6994 | Double_t productOfWeightsForFourTwoReduced = 0.; // sum_{i=1}^{N} w_{<4>}w_{<2'>} | |
6995 | Double_t productOfWeightsForFourFourReduced = 0.; // sum_{i=1}^{N} w_{<4>}w_{<4'>} | |
6996 | Double_t productOfWeightsForTwoReducedFourReduced = 0.; // sum_{i=1}^{N} w_{<2'>}w_{<4'>} | |
6997 | // ... | |
6998 | ||
6999 | // products for differential flow: | |
7000 | Double_t twoTwoReduced = 0; // <<2><2'>> | |
7001 | Double_t twoFourReduced = 0; // <<2><4'>> | |
7002 | Double_t fourTwoReduced = 0; // <<4><2'>> | |
7003 | Double_t fourFourReduced = 0; // <<4><4'>> | |
7004 | Double_t twoReducedFourReduced = 0; // <<2'><4'>> | |
7005 | ||
7006 | // denominators in the expressions for the unbiased estimators for covariances: | |
7007 | // denominator = 1 - term1/(term2*term3) | |
7008 | // prefactor = term1/(term2*term3) | |
7009 | Double_t denominator = 0.; | |
7010 | Double_t prefactor = 0.; | |
7011 | Double_t term1 = 0.; | |
7012 | Double_t term2 = 0.; | |
7013 | Double_t term3 = 0.; | |
7014 | ||
7015 | // unbiased estimators for covariances for differential flow: | |
7016 | Double_t covTwoTwoReduced = 0.; // Cov(<2>,<2'>) | |
7017 | Double_t wCovTwoTwoReduced = 0.; // Cov(<2>,<2'>) * prefactor(w_{<2>},w_{<2'>}) | |
7018 | Double_t covTwoFourReduced = 0.; // Cov(<2>,<4'>) | |
7019 | Double_t wCovTwoFourReduced = 0.; // Cov(<2>,<4'>) * prefactor(w_{<2>},w_{<4'>}) | |
7020 | Double_t covFourTwoReduced = 0.; // Cov(<4>,<2'>) | |
7021 | Double_t wCovFourTwoReduced = 0.; // Cov(<4>,<2'>) * prefactor(w_{<4>},w_{<2'>}) | |
7022 | Double_t covFourFourReduced = 0.; // Cov(<4>,<4'>) | |
7023 | Double_t wCovFourFourReduced = 0.; // Cov(<4>,<4'>) * prefactor(w_{<4>},w_{<4'>}) | |
7024 | Double_t covTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) | |
7025 | Double_t wCovTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) * prefactor(w_{<2'>},w_{<4'>}) | |
7026 | ||
7027 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7028 | { | |
7029 | // average reduced corelations: | |
7030 | twoReduced = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); | |
7031 | fourReduced = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); | |
7032 | // average products: | |
7033 | twoTwoReduced = fDiffFlowProductOfCorrelationsPro[t][pe][0][1]->GetBinContent(b); | |
7034 | twoFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][0][3]->GetBinContent(b); | |
7035 | fourTwoReduced = fDiffFlowProductOfCorrelationsPro[t][pe][1][2]->GetBinContent(b); | |
7036 | fourFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][2][3]->GetBinContent(b); | |
7037 | twoReducedFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][1][3]->GetBinContent(b); | |
7038 | // sum of weights for reduced correlations: | |
7039 | sumOfWeightsForTwoReduced = fDiffFlowSumOfEventWeights[t][pe][0][0]->GetBinContent(b); | |
7040 | sumOfWeightsForFourReduced = fDiffFlowSumOfEventWeights[t][pe][0][1]->GetBinContent(b); | |
7041 | // products of weights for correlations: | |
7042 | productOfWeightsForTwoTwoReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][0][1]->GetBinContent(b); | |
7043 | productOfWeightsForTwoFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][0][3]->GetBinContent(b); | |
7044 | productOfWeightsForFourTwoReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][1][2]->GetBinContent(b); | |
7045 | productOfWeightsForFourFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][2][3]->GetBinContent(b); | |
7046 | productOfWeightsForTwoReducedFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][1][3]->GetBinContent(b); | |
7047 | // denominator for the unbiased estimator for covariances: 1 - term1/(term2*term3) | |
7048 | // prefactor (multiplies Cov's) = term1/(term2*term3) | |
7049 | // <2>,<2'>: | |
7050 | term1 = productOfWeightsForTwoTwoReduced; | |
7051 | term2 = sumOfWeightsForTwo; | |
7052 | term3 = sumOfWeightsForTwoReduced; | |
7053 | if(term2*term3>0.) | |
7054 | { | |
7055 | denominator = 1.-term1/(term2*term3); | |
7056 | prefactor = term1/(term2*term3); | |
1268c371 | 7057 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 7058 | { |
7059 | covTwoTwoReduced = (twoTwoReduced-two*twoReduced)/denominator; | |
7060 | wCovTwoTwoReduced = covTwoTwoReduced*prefactor; | |
7061 | fDiffFlowCovariances[t][pe][0]->SetBinContent(b,wCovTwoTwoReduced); | |
7062 | } | |
7063 | } | |
7064 | // <2>,<4'>: | |
7065 | term1 = productOfWeightsForTwoFourReduced; | |
7066 | term2 = sumOfWeightsForTwo; | |
7067 | term3 = sumOfWeightsForFourReduced; | |
7068 | if(term2*term3>0.) | |
7069 | { | |
7070 | denominator = 1.-term1/(term2*term3); | |
7071 | prefactor = term1/(term2*term3); | |
1268c371 | 7072 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 7073 | { |
7074 | covTwoFourReduced = (twoFourReduced-two*fourReduced)/denominator; | |
7075 | wCovTwoFourReduced = covTwoFourReduced*prefactor; | |
7076 | fDiffFlowCovariances[t][pe][1]->SetBinContent(b,wCovTwoFourReduced); | |
7077 | } | |
7078 | } | |
7079 | // <4>,<2'>: | |
7080 | term1 = productOfWeightsForFourTwoReduced; | |
7081 | term2 = sumOfWeightsForFour; | |
7082 | term3 = sumOfWeightsForTwoReduced; | |
7083 | if(term2*term3>0.) | |
7084 | { | |
7085 | denominator = 1.-term1/(term2*term3); | |
7086 | prefactor = term1/(term2*term3); | |
1268c371 | 7087 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 7088 | { |
7089 | covFourTwoReduced = (fourTwoReduced-four*twoReduced)/denominator; | |
7090 | wCovFourTwoReduced = covFourTwoReduced*prefactor; | |
7091 | fDiffFlowCovariances[t][pe][2]->SetBinContent(b,wCovFourTwoReduced); | |
7092 | } | |
7093 | } | |
7094 | // <4>,<4'>: | |
7095 | term1 = productOfWeightsForFourFourReduced; | |
7096 | term2 = sumOfWeightsForFour; | |
7097 | term3 = sumOfWeightsForFourReduced; | |
7098 | if(term2*term3>0.) | |
7099 | { | |
7100 | denominator = 1.-term1/(term2*term3); | |
7101 | prefactor = term1/(term2*term3); | |
1268c371 | 7102 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 7103 | { |
7104 | covFourFourReduced = (fourFourReduced-four*fourReduced)/denominator; | |
7105 | wCovFourFourReduced = covFourFourReduced*prefactor; | |
7106 | fDiffFlowCovariances[t][pe][3]->SetBinContent(b,wCovFourFourReduced); | |
7107 | } | |
7108 | } | |
7109 | // <2'>,<4'>: | |
7110 | term1 = productOfWeightsForTwoReducedFourReduced; | |
7111 | term2 = sumOfWeightsForTwoReduced; | |
7112 | term3 = sumOfWeightsForFourReduced; | |
7113 | if(term2*term3>0.) | |
7114 | { | |
7115 | denominator = 1.-term1/(term2*term3); | |
7116 | prefactor = term1/(term2*term3); | |
1268c371 | 7117 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 7118 | { |
7119 | covTwoReducedFourReduced = (twoReducedFourReduced-twoReduced*fourReduced)/denominator; | |
7120 | wCovTwoReducedFourReduced = covTwoReducedFourReduced*prefactor; | |
7121 | fDiffFlowCovariances[t][pe][4]->SetBinContent(b,wCovTwoReducedFourReduced); | |
7122 | } | |
7123 | } | |
7124 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7125 | ||
7126 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCovariances(TString type, TString ptOrEta) | |
7127 | ||
489d5531 | 7128 | //================================================================================================================================ |
7129 | ||
489d5531 | 7130 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, TString ptOrEta) |
7131 | { | |
1268c371 | 7132 | // Calculate final results for differential flow. |
489d5531 | 7133 | |
1268c371 | 7134 | // REMARK: Differential flow calculated in this method is NOT corrected for non-uniform acceptance. |
7135 | // This correction, if enabled via setter SetApplyCorrectionForNUA(Bool_t), is applied in the method | |
7136 | // CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta) | |
7137 | ||
7138 | Int_t t = 0; // RP or POI | |
7139 | Int_t pe = 0; // pt or eta | |
489d5531 | 7140 | |
7141 | if(type == "RP") | |
7142 | { | |
1268c371 | 7143 | t = 0; |
489d5531 | 7144 | } else if(type == "POI") |
7145 | { | |
1268c371 | 7146 | t = 1; |
489d5531 | 7147 | } |
7148 | ||
7149 | if(ptOrEta == "Pt") | |
7150 | { | |
1268c371 | 7151 | pe = 0; |
489d5531 | 7152 | } else if(ptOrEta == "Eta") |
7153 | { | |
1268c371 | 7154 | pe = 1; |
489d5531 | 7155 | } |
1268c371 | 7156 | |
7157 | // Common: | |
489d5531 | 7158 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
1268c371 | 7159 | // Correlations: |
489d5531 | 7160 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> |
1268c371 | 7161 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> |
7162 | // Statistical errors of correlations: | |
489d5531 | 7163 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); |
7164 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); | |
1268c371 | 7165 | // Reduced correlations: |
489d5531 | 7166 | Double_t twoReduced = 0.; // <<2'>> |
7167 | Double_t fourReduced = 0.; // <<4'>> | |
1268c371 | 7168 | // Statistical errors of reduced correlations: |
489d5531 | 7169 | Double_t twoReducedError = 0.; |
7170 | Double_t fourReducedError = 0.; | |
1268c371 | 7171 | // Covariances: |
8e1cefdd | 7172 | Double_t wCovTwoFour = 0.; // Cov(<2>,<4>) * prefactor(<2>,<4>) |
7173 | if(!fForgetAboutCovariances) | |
7174 | { | |
7175 | wCovTwoFour = fIntFlowCovariances->GetBinContent(1); // Cov(<2>,<4>) * prefactor(<2>,<4>) | |
7176 | } | |
489d5531 | 7177 | Double_t wCovTwoTwoReduced = 0.; // Cov(<2>,<2'>) * prefactor(<2>,<2'>) |
7178 | Double_t wCovTwoFourReduced = 0.; // Cov(<2>,<4'>) * prefactor(<2>,<4'>) | |
7179 | Double_t wCovFourTwoReduced = 0.; // Cov(<4>,<2'>) * prefactor(<4>,<2'>) | |
7180 | Double_t wCovFourFourReduced = 0.; // Cov(<4>,<4'>) * prefactor(<4>,<4'>) | |
7181 | Double_t wCovTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) * prefactor(<2'>,<4'>) | |
1268c371 | 7182 | // Differential flow: |
489d5531 | 7183 | Double_t v2Prime = 0.; // v'{2} |
7184 | Double_t v4Prime = 0.; // v'{4} | |
1268c371 | 7185 | // Statistical error of differential flow: |
489d5531 | 7186 | Double_t v2PrimeError = 0.; |
7187 | Double_t v4PrimeError = 0.; | |
1268c371 | 7188 | // Squared statistical error of differential flow: |
489d5531 | 7189 | Double_t v2PrimeErrorSquared = 0.; |
7190 | Double_t v4PrimeErrorSquared = 0.; | |
1268c371 | 7191 | // Loop over pt or eta bins: |
489d5531 | 7192 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) |
7193 | { | |
1268c371 | 7194 | // Reduced correlations and statistical errors: |
489d5531 | 7195 | twoReduced = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); |
7196 | twoReducedError = fDiffFlowCorrelationsHist[t][pe][0]->GetBinError(b); | |
7197 | fourReduced = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); | |
7198 | fourReducedError = fDiffFlowCorrelationsHist[t][pe][1]->GetBinError(b); | |
1268c371 | 7199 | // Covariances: |
8e1cefdd | 7200 | if(!fForgetAboutCovariances) |
7201 | { | |
7202 | wCovTwoTwoReduced = fDiffFlowCovariances[t][pe][0]->GetBinContent(b); | |
7203 | wCovTwoFourReduced = fDiffFlowCovariances[t][pe][1]->GetBinContent(b); | |
7204 | wCovFourTwoReduced = fDiffFlowCovariances[t][pe][2]->GetBinContent(b); | |
7205 | wCovFourFourReduced = fDiffFlowCovariances[t][pe][3]->GetBinContent(b); | |
7206 | wCovTwoReducedFourReduced = fDiffFlowCovariances[t][pe][4]->GetBinContent(b); | |
7207 | } | |
1268c371 | 7208 | // Differential flow: |
489d5531 | 7209 | // v'{2}: |
7210 | if(two>0.) | |
7211 | { | |
7212 | v2Prime = twoReduced/pow(two,0.5); | |
1268c371 | 7213 | v2PrimeErrorSquared = (1./4.)*pow(two,-3.)*(pow(twoReduced,2.)*pow(twoError,2.) |
7214 | + 4.*pow(two,2.)*pow(twoReducedError,2.) | |
7215 | - 4.*two*twoReduced*wCovTwoTwoReduced); | |
7216 | if(v2PrimeErrorSquared>0.){v2PrimeError = pow(v2PrimeErrorSquared,0.5);} | |
7217 | if(TMath::Abs(v2Prime)>0.) | |
7218 | { | |
7219 | fDiffFlow[t][pe][0]->SetBinContent(b,v2Prime); | |
7220 | fDiffFlow[t][pe][0]->SetBinError(b,v2PrimeError); | |
7221 | } | |
7222 | } // end of if(two>0.) | |
489d5531 | 7223 | // differential flow: |
7224 | // v'{4} | |
7225 | if(2.*pow(two,2.)-four > 0.) | |
7226 | { | |
7227 | v4Prime = (2.*two*twoReduced-fourReduced)/pow(2.*pow(two,2.)-four,3./4.); | |
1268c371 | 7228 | v4PrimeErrorSquared = pow(2.*pow(two,2.)-four,-7./2.) |
7229 | * (pow(2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced,2.)*pow(twoError,2.) | |
7230 | + (9./16.)*pow(2.*two*twoReduced-fourReduced,2.)*pow(fourError,2.) | |
7231 | + 4.*pow(two,2.)*pow(2.*pow(two,2.)-four,2.)*pow(twoReducedError,2.) | |
7232 | + pow(2.*pow(two,2.)-four,2.)*pow(fourReducedError,2.) | |
7233 | - (3./2.)*(2.*two*twoReduced-fourReduced) | |
7234 | * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoFour | |
7235 | - 4.*two*(2.*pow(two,2.)-four) | |
7236 | * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoTwoReduced | |
7237 | + 2.*(2.*pow(two,2.)-four) | |
7238 | * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoFourReduced | |
7239 | + 3.*two*(2.*pow(two,2.)-four)*(2.*two*twoReduced-fourReduced)*wCovFourTwoReduced | |
7240 | - (3./2.)*(2.*pow(two,2.)-four)*(2.*two*twoReduced-fourReduced)*wCovFourFourReduced | |
7241 | - 4.*two*pow(2.*pow(two,2.)-four,2.)*wCovTwoReducedFourReduced); | |
7242 | if(v4PrimeErrorSquared>0.){v4PrimeError = pow(v4PrimeErrorSquared,0.5);} | |
7243 | if(TMath::Abs(v4Prime)>0.) | |
7244 | { | |
7245 | fDiffFlow[t][pe][1]->SetBinContent(b,v4Prime); | |
7246 | fDiffFlow[t][pe][1]->SetBinError(b,v4PrimeError); | |
7247 | } | |
7248 | } // end of if(2.*pow(two,2.)-four > 0.) | |
489d5531 | 7249 | } // end of for(Int_t b=1;b<=fnBinsPtEta[pe];b++) |
1268c371 | 7250 | |
7251 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, Bool_t useParticleWeights) | |
7252 | ||
7253 | //================================================================================================================================ | |
7254 | ||
7255 | void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlow(TString type) | |
7256 | { | |
7257 | // Calculate final results for 2D diferential flow. | |
7258 | ||
7259 | // to be improved - check pointers used in this method | |
7260 | ||
7261 | Int_t t = 0; // RP or POI | |
7262 | ||
7263 | if(type == "RP") | |
7264 | { | |
7265 | t = 0; | |
7266 | } else if(type == "POI") | |
7267 | { | |
7268 | t = 1; | |
7269 | } | |
489d5531 | 7270 | |
1268c371 | 7271 | // Differential flow: |
7272 | Double_t v2Prime = 0.; // v'{2} | |
7273 | Double_t v4Prime = 0.; // v'{4} | |
7274 | // Differential cumulants: | |
7275 | Double_t qc2Prime = 0.; // QC{2'} | |
7276 | Double_t qc4Prime = 0.; // QC{4'} | |
7277 | // Looping over all (pt,eta) bins and calculating differential flow: | |
7278 | for(Int_t p=1;p<=fnBinsPt;p++) | |
489d5531 | 7279 | { |
1268c371 | 7280 | for(Int_t e=1;e<=fnBinsEta;e++) |
489d5531 | 7281 | { |
1268c371 | 7282 | // QC{2'}: |
7283 | qc2Prime = f2DDiffFlowCumulants[t][0]->GetBinContent(f2DDiffFlowCumulants[t][0]->GetBin(p,e)); | |
7284 | if(qc2Prime>=0.) | |
7285 | { | |
7286 | v2Prime = pow(qc2Prime,0.5); | |
7287 | f2DDiffFlow[t][0]->SetBinContent(f2DDiffFlow[t][0]->GetBin(p,e),v2Prime); | |
7288 | } | |
7289 | // QC{4'}: | |
7290 | qc4Prime = f2DDiffFlowCumulants[t][1]->GetBinContent(f2DDiffFlowCumulants[t][1]->GetBin(p,e)); | |
7291 | if(qc4Prime<=0.) | |
7292 | { | |
7293 | v4Prime = pow(-1.*qc4Prime,1./4.); | |
7294 | f2DDiffFlow[t][1]->SetBinContent(f2DDiffFlow[t][1]->GetBin(p,e),v4Prime); | |
7295 | } | |
7296 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
7297 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
7298 | ||
7299 | } // end of void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlow(TString type) | |
489d5531 | 7300 | |
489d5531 | 7301 | //================================================================================================================================ |
7302 | ||
489d5531 | 7303 | void AliFlowAnalysisWithQCumulants::StoreIntFlowFlags() |
7304 | { | |
7305 | // a) Store all flags for integrated flow in profile fIntFlowFlags. | |
7306 | ||
7307 | if(!fIntFlowFlags) | |
7308 | { | |
7309 | cout<<"WARNING: fIntFlowFlags is NULL in AFAWQC::SFFIF() !!!!"<<endl; | |
7310 | exit(0); | |
7311 | } | |
7312 | ||
7313 | // particle weights used or not: | |
7314 | fIntFlowFlags->Fill(0.5,(Int_t)fUsePhiWeights||fUsePtWeights||fUseEtaWeights); | |
7315 | // which event weights were used: | |
7316 | if(strcmp(fMultiplicityWeight->Data(),"combinations")) | |
7317 | { | |
7318 | fIntFlowFlags->Fill(1.5,0); // 0 = "combinations" (default) | |
7319 | } else if(strcmp(fMultiplicityWeight->Data(),"unit")) | |
7320 | { | |
7321 | fIntFlowFlags->Fill(1.5,1); // 1 = "unit" | |
7322 | } else if(strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
7323 | { | |
7324 | fIntFlowFlags->Fill(1.5,2); // 2 = "multiplicity" | |
7325 | } | |
489d5531 | 7326 | fIntFlowFlags->Fill(2.5,(Int_t)fApplyCorrectionForNUA); |
7327 | fIntFlowFlags->Fill(3.5,(Int_t)fPrintFinalResults[0]); | |
7328 | fIntFlowFlags->Fill(4.5,(Int_t)fPrintFinalResults[1]); | |
7329 | fIntFlowFlags->Fill(5.5,(Int_t)fPrintFinalResults[2]); | |
b3dacf6b | 7330 | fIntFlowFlags->Fill(6.5,(Int_t)fPrintFinalResults[3]); |
7331 | fIntFlowFlags->Fill(7.5,(Int_t)fApplyCorrectionForNUAVsM); | |
b77b6434 | 7332 | fIntFlowFlags->Fill(8.5,(Int_t)fPropagateErrorAlsoFromNIT); |
b3dacf6b | 7333 | fIntFlowFlags->Fill(9.5,(Int_t)fCalculateCumulantsVsM); |
0dd3b008 | 7334 | fIntFlowFlags->Fill(10.5,(Int_t)fMinimumBiasReferenceFlow); |
8e1cefdd | 7335 | fIntFlowFlags->Fill(11.5,(Int_t)fForgetAboutCovariances); |
e5834fcb | 7336 | fIntFlowFlags->Fill(12.5,(Int_t)fStorePhiDistributionForOneEvent); |
dd442cd2 | 7337 | fIntFlowFlags->Fill(13.5,(Int_t)fFillMultipleControlHistograms); |
489d5531 | 7338 | } // end of void AliFlowAnalysisWithQCumulants::StoreIntFlowFlags() |
7339 | ||
489d5531 | 7340 | //================================================================================================================================ |
7341 | ||
489d5531 | 7342 | void AliFlowAnalysisWithQCumulants::StoreDiffFlowFlags() |
7343 | { | |
7344 | // Store all flags for differential flow in the profile fDiffFlowFlags. | |
7345 | ||
7346 | if(!fDiffFlowFlags) | |
7347 | { | |
1268c371 | 7348 | printf("\n WARNING (QC): fDiffFlowFlags is NULL in AFAWQC::SDFF() !!!!\n\n"); |
489d5531 | 7349 | exit(0); |
7350 | } | |
7351 | ||
1268c371 | 7352 | fDiffFlowFlags->Fill(0.5,fCalculateDiffFlow); // calculate differential flow |
7353 | fDiffFlowFlags->Fill(1.5,fUsePhiWeights||fUsePtWeights||fUseEtaWeights); // particle weights used or not? | |
7354 | //fDiffFlowFlags->Fill(2.5,""); // which event weight was used? ("combinations", "unit" or "multiplicity") to be improved - finalized | |
7355 | fDiffFlowFlags->Fill(3.5,fApplyCorrectionForNUA); // corrected for non-uniform acceptance or not | |
7356 | fDiffFlowFlags->Fill(4.5,fCalculate2DDiffFlow); // calculate also 2D differential flow vs (pt,eta) | |
7357 | ||
489d5531 | 7358 | } // end of void AliFlowAnalysisWithQCumulants::StoreDiffFlowFlags() |
7359 | ||
489d5531 | 7360 | //================================================================================================================================ |
7361 | ||
489d5531 | 7362 | void AliFlowAnalysisWithQCumulants::GetPointersForCommonHistograms() |
7363 | { | |
7364 | // Access all pointers to common control and common result histograms and profiles. | |
7365 | ||
1268c371 | 7366 | TString sCommonConstantsName = "fCommonConstants"; |
7367 | sCommonConstantsName += fAnalysisLabel->Data(); | |
7368 | fCommonConstants = dynamic_cast<TProfile*>(fHistList->FindObject(sCommonConstantsName.Data())); | |
7369 | if(!fCommonConstants) | |
7370 | { | |
7371 | printf("\n WARNING (QC): fCommonConstants is NULL in AFAWQC::GPFCH() !!!!\n\n"); | |
7372 | exit(0); | |
7373 | } | |
7374 | ||
7375 | // to be improved - lines bellow can be implemented better. | |
7376 | ||
489d5531 | 7377 | TString commonHistsName = "AliFlowCommonHistQC"; |
7378 | commonHistsName += fAnalysisLabel->Data(); | |
7379 | AliFlowCommonHist *commonHist = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHistsName.Data())); | |
b77b6434 | 7380 | if(commonHist) |
7381 | { | |
7382 | this->SetCommonHists(commonHist); | |
7383 | if(fCommonHists->GetHarmonic()) | |
7384 | { | |
7385 | fHarmonic = (Int_t)(fCommonHists->GetHarmonic())->GetBinContent(1); | |
7386 | } | |
7387 | } // end of if(commonHist) | |
489d5531 | 7388 | TString commonHists2ndOrderName = "AliFlowCommonHist2ndOrderQC"; |
7389 | commonHists2ndOrderName += fAnalysisLabel->Data(); | |
7390 | AliFlowCommonHist *commonHist2nd = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists2ndOrderName.Data())); | |
7391 | if(commonHist2nd) this->SetCommonHists2nd(commonHist2nd); | |
7392 | TString commonHists4thOrderName = "AliFlowCommonHist4thOrderQC"; | |
7393 | commonHists4thOrderName += fAnalysisLabel->Data(); | |
7394 | AliFlowCommonHist *commonHist4th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists4thOrderName.Data())); | |
7395 | if(commonHist4th) this->SetCommonHists4th(commonHist4th); | |
7396 | TString commonHists6thOrderName = "AliFlowCommonHist6thOrderQC"; | |
7397 | commonHists6thOrderName += fAnalysisLabel->Data(); | |
7398 | AliFlowCommonHist *commonHist6th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists6thOrderName.Data())); | |
7399 | if(commonHist6th) this->SetCommonHists6th(commonHist6th); | |
7400 | TString commonHists8thOrderName = "AliFlowCommonHist8thOrderQC"; | |
7401 | commonHists8thOrderName += fAnalysisLabel->Data(); | |
7402 | AliFlowCommonHist *commonHist8th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists8thOrderName.Data())); | |
dd442cd2 | 7403 | if(commonHist8th) this->SetCommonHists8th(commonHist8th); |
7404 | ||
489d5531 | 7405 | TString commonHistResults2ndOrderName = "AliFlowCommonHistResults2ndOrderQC"; |
7406 | commonHistResults2ndOrderName += fAnalysisLabel->Data(); | |
b77b6434 | 7407 | AliFlowCommonHistResults *commonHistRes2nd = dynamic_cast<AliFlowCommonHistResults*> |
7408 | (fHistList->FindObject(commonHistResults2ndOrderName.Data())); | |
489d5531 | 7409 | if(commonHistRes2nd) this->SetCommonHistsResults2nd(commonHistRes2nd); |
7410 | TString commonHistResults4thOrderName = "AliFlowCommonHistResults4thOrderQC"; | |
7411 | commonHistResults4thOrderName += fAnalysisLabel->Data(); | |
7412 | AliFlowCommonHistResults *commonHistRes4th = dynamic_cast<AliFlowCommonHistResults*> | |
7413 | (fHistList->FindObject(commonHistResults4thOrderName.Data())); | |
7414 | if(commonHistRes4th) this->SetCommonHistsResults4th(commonHistRes4th); | |
7415 | TString commonHistResults6thOrderName = "AliFlowCommonHistResults6thOrderQC"; | |
7416 | commonHistResults6thOrderName += fAnalysisLabel->Data(); | |
7417 | AliFlowCommonHistResults *commonHistRes6th = dynamic_cast<AliFlowCommonHistResults*> | |
7418 | (fHistList->FindObject(commonHistResults6thOrderName.Data())); | |
7419 | if(commonHistRes6th) this->SetCommonHistsResults6th(commonHistRes6th); | |
7420 | TString commonHistResults8thOrderName = "AliFlowCommonHistResults8thOrderQC"; | |
7421 | commonHistResults8thOrderName += fAnalysisLabel->Data(); | |
7422 | AliFlowCommonHistResults *commonHistRes8th = dynamic_cast<AliFlowCommonHistResults*> | |
7423 | (fHistList->FindObject(commonHistResults8thOrderName.Data())); | |
7424 | if(commonHistRes8th) this->SetCommonHistsResults8th(commonHistRes8th); | |
7425 | ||
7426 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForCommonHistograms() | |
7427 | ||
7428 | ||
7429 | //================================================================================================================================ | |
7430 | ||
7431 | ||
7432 | void AliFlowAnalysisWithQCumulants::GetPointersForParticleWeightsHistograms() | |
7433 | { | |
7434 | // Get pointers for histograms with particle weights. | |
7435 | ||
7436 | TList *weightsList = dynamic_cast<TList*>(fHistList->FindObject("Weights")); | |
ca5f47e7 | 7437 | if(!weightsList){printf("\n WARNING (QC): weightsList is NULL in AFAWQC::GPFPWH() !!!!\n");exit(0);} |
7438 | this->SetWeightsList(weightsList); | |
489d5531 | 7439 | TString fUseParticleWeightsName = "fUseParticleWeightsQC"; // to be improved (hirdwired label QC) |
7440 | fUseParticleWeightsName += fAnalysisLabel->Data(); | |
7441 | TProfile *useParticleWeights = dynamic_cast<TProfile*>(weightsList->FindObject(fUseParticleWeightsName.Data())); | |
7442 | if(useParticleWeights) | |
7443 | { | |
7444 | this->SetUseParticleWeights(useParticleWeights); | |
7445 | fUsePhiWeights = (Int_t)fUseParticleWeights->GetBinContent(1); | |
7446 | fUsePtWeights = (Int_t)fUseParticleWeights->GetBinContent(2); | |
7447 | fUseEtaWeights = (Int_t)fUseParticleWeights->GetBinContent(3); | |
7448 | } | |
7449 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForParticleWeightsHistograms(); | |
7450 | ||
7451 | ||
7452 | //================================================================================================================================ | |
7453 | ||
7454 | ||
7455 | void AliFlowAnalysisWithQCumulants::GetPointersForIntFlowHistograms() | |
7456 | { | |
7457 | // Get pointers for histograms and profiles relevant for integrated flow: | |
7458 | // a) Get pointer to base list for integrated flow holding profile fIntFlowFlags and lists fIntFlowProfiles and fIntFlowResults. | |
7459 | // b) Get pointer to profile fIntFlowFlags holding all flags for integrated flow. | |
7460 | // c) Get pointer to list fIntFlowProfiles and pointers to all objects that she holds. | |
7461 | // d) Get pointer to list fIntFlowResults and pointers to all objects that she holds. | |
7462 | ||
7463 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data member?) | |
7464 | TString powerFlag[2] = {"linear","quadratic"}; // to be improved (should I promote this to data member?) | |
b40a910e | 7465 | TString correlationFlag[4] = {"#LT#LT2#GT#GT","#LT#LT4#GT#GT","#LT#LT6#GT#GT","#LT#LT8#GT#GT"}; // to be improved (should I promote this to data member?) |
7466 | TString squaredCorrelationFlag[4] = {"#LT#LT2#GT^{2}#GT","#LT#LT4#GT^{2}#GT","#LT#LT6#GT^{2}#GT","#LT#LT8#GT^{2}#GT"}; // to be improved (should I promote this to data member?) | |
489d5531 | 7467 | |
7468 | // a) Get pointer to base list for integrated flow holding profile fIntFlowFlags and lists fIntFlowProfiles and fIntFlowResults: | |
7469 | TList *intFlowList = NULL; | |
7470 | intFlowList = dynamic_cast<TList*>(fHistList->FindObject("Integrated Flow")); | |
7471 | if(!intFlowList) | |
7472 | { | |
7473 | cout<<"WARNING: intFlowList is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7474 | exit(0); | |
7475 | } | |
7476 | ||
b92ea2b9 | 7477 | // b) Get pointer to profile fIntFlowFlags holding all flags for integrated flow: |
7478 | TString intFlowFlagsName = "fIntFlowFlags"; | |
7479 | intFlowFlagsName += fAnalysisLabel->Data(); | |
7480 | TProfile *intFlowFlags = dynamic_cast<TProfile*>(intFlowList->FindObject(intFlowFlagsName.Data())); | |
7481 | if(intFlowFlags) | |
7482 | { | |
7483 | this->SetIntFlowFlags(intFlowFlags); | |
7484 | fApplyCorrectionForNUA = (Bool_t)intFlowFlags->GetBinContent(3); | |
7485 | fApplyCorrectionForNUAVsM = (Bool_t)intFlowFlags->GetBinContent(8); | |
7486 | fCalculateCumulantsVsM = (Bool_t)intFlowFlags->GetBinContent(10); | |
7487 | } else | |
7488 | { | |
7489 | cout<<"WARNING: intFlowFlags is NULL in FAWQC::GPFIFH() !!!!"<<endl; | |
7490 | } | |
489d5531 | 7491 | |
7492 | // c) Get pointer to list fIntFlowProfiles and pointers to all objects that she holds: | |
7493 | TList *intFlowProfiles = NULL; | |
7494 | intFlowProfiles = dynamic_cast<TList*>(intFlowList->FindObject("Profiles")); | |
7495 | if(intFlowProfiles) | |
7496 | { | |
7497 | // average multiplicities: | |
7498 | TString avMultiplicityName = "fAvMultiplicity"; | |
7499 | avMultiplicityName += fAnalysisLabel->Data(); | |
7500 | TProfile *avMultiplicity = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(avMultiplicityName.Data())); | |
7501 | if(avMultiplicity) | |
7502 | { | |
7503 | this->SetAvMultiplicity(avMultiplicity); | |
7504 | } else | |
7505 | { | |
7506 | cout<<"WARNING: avMultiplicity is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7507 | } | |
7508 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with wrong errors!): | |
7509 | TString intFlowCorrelationsProName = "fIntFlowCorrelationsPro"; | |
7510 | intFlowCorrelationsProName += fAnalysisLabel->Data(); | |
7511 | TProfile *intFlowCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowCorrelationsProName.Data())); | |
7512 | if(intFlowCorrelationsPro) | |
7513 | { | |
7514 | this->SetIntFlowCorrelationsPro(intFlowCorrelationsPro); | |
7515 | } else | |
7516 | { | |
7517 | cout<<"WARNING: intFlowCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
ff70ca91 | 7518 | } |
b40a910e | 7519 | // average squared correlations <<2>^2>, <<4>^2>, <<6>^2> and <<8^2>>: |
7520 | TString intFlowSquaredCorrelationsProName = "fIntFlowSquaredCorrelationsPro"; | |
7521 | intFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
7522 | TProfile *intFlowSquaredCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowSquaredCorrelationsProName.Data())); | |
7523 | if(intFlowSquaredCorrelationsPro) | |
7524 | { | |
7525 | this->SetIntFlowSquaredCorrelationsPro(intFlowSquaredCorrelationsPro); | |
7526 | } else | |
7527 | { | |
7528 | cout<<"WARNING: intFlowSquaredCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7529 | } | |
b3dacf6b | 7530 | if(fCalculateCumulantsVsM) |
ff70ca91 | 7531 | { |
b40a910e | 7532 | // Average correlations <<2>>, <<4>>, <<6>> and <<8>> versus multiplicity for all events (error is wrong here): |
b3dacf6b | 7533 | TString intFlowCorrelationsVsMProName = "fIntFlowCorrelationsVsMPro"; |
7534 | intFlowCorrelationsVsMProName += fAnalysisLabel->Data(); | |
7535 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
ff70ca91 | 7536 | { |
b3dacf6b | 7537 | TProfile *intFlowCorrelationsVsMPro = dynamic_cast<TProfile*> |
7538 | (intFlowProfiles->FindObject(Form("%s, %s",intFlowCorrelationsVsMProName.Data(),correlationFlag[ci].Data()))); | |
7539 | if(intFlowCorrelationsVsMPro) | |
7540 | { | |
7541 | this->SetIntFlowCorrelationsVsMPro(intFlowCorrelationsVsMPro,ci); | |
7542 | } else | |
7543 | { | |
7544 | cout<<"WARNING: "<<Form("intFlowCorrelationsVsMPro[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7545 | } | |
7546 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
b40a910e | 7547 | // Average squared correlations <<2>^2>, <<4>^2>, <<6>^2> and <<8>^2> versus multiplicity for all events: |
7548 | TString intFlowSquaredCorrelationsVsMProName = "fIntFlowSquaredCorrelationsVsMPro"; | |
7549 | intFlowSquaredCorrelationsVsMProName += fAnalysisLabel->Data(); | |
7550 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
7551 | { | |
7552 | TProfile *intFlowSquaredCorrelationsVsMPro = dynamic_cast<TProfile*> | |
7553 | (intFlowProfiles->FindObject(Form("%s, %s",intFlowSquaredCorrelationsVsMProName.Data(),squaredCorrelationFlag[ci].Data()))); | |
7554 | if(intFlowSquaredCorrelationsVsMPro) | |
7555 | { | |
7556 | this->SetIntFlowSquaredCorrelationsVsMPro(intFlowSquaredCorrelationsVsMPro,ci); | |
7557 | } else | |
7558 | { | |
7559 | cout<<"WARNING: "<<Form("intFlowSquaredCorrelationsVsMPro[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7560 | } | |
7561 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
b3dacf6b | 7562 | } // end of if(fCalculateCumulantsVsM) |
489d5531 | 7563 | // average all correlations for integrated flow (with wrong errors!): |
7564 | TString intFlowCorrelationsAllProName = "fIntFlowCorrelationsAllPro"; | |
7565 | intFlowCorrelationsAllProName += fAnalysisLabel->Data(); | |
7566 | TProfile *intFlowCorrelationsAllPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowCorrelationsAllProName.Data())); | |
7567 | if(intFlowCorrelationsAllPro) | |
7568 | { | |
7569 | this->SetIntFlowCorrelationsAllPro(intFlowCorrelationsAllPro); | |
7570 | } else | |
7571 | { | |
7572 | cout<<"WARNING: intFlowCorrelationsAllPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7573 | } | |
7574 | // average extra correlations for integrated flow (which appear only when particle weights are used): | |
7575 | // (to be improved: Weak point in implementation, I am assuming here that method GetPointersForParticleWeightsHistograms() was called) | |
7576 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
7577 | { | |
7578 | TString intFlowExtraCorrelationsProName = "fIntFlowExtraCorrelationsPro"; | |
7579 | intFlowExtraCorrelationsProName += fAnalysisLabel->Data(); | |
7580 | TProfile *intFlowExtraCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowExtraCorrelationsProName.Data())); | |
7581 | if(intFlowExtraCorrelationsPro) | |
7582 | { | |
7583 | this->SetIntFlowExtraCorrelationsPro(intFlowExtraCorrelationsPro); | |
7584 | } else | |
7585 | { | |
7586 | cout<<"WARNING: intFlowExtraCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7587 | } | |
7588 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
7589 | // average products of correlations <2>, <4>, <6> and <8>: | |
7590 | TString intFlowProductOfCorrelationsProName = "fIntFlowProductOfCorrelationsPro"; | |
7591 | intFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
7592 | TProfile *intFlowProductOfCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowProductOfCorrelationsProName.Data())); | |
7593 | if(intFlowProductOfCorrelationsPro) | |
7594 | { | |
7595 | this->SetIntFlowProductOfCorrelationsPro(intFlowProductOfCorrelationsPro); | |
7596 | } else | |
7597 | { | |
7598 | cout<<"WARNING: intFlowProductOfCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
ff70ca91 | 7599 | } |
7600 | // average product of correlations <2>, <4>, <6> and <8> versus multiplicity | |
7601 | // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>] | |
b3dacf6b | 7602 | if(fCalculateCumulantsVsM) |
7603 | { | |
7604 | TString intFlowProductOfCorrelationsVsMProName = "fIntFlowProductOfCorrelationsVsMPro"; | |
7605 | intFlowProductOfCorrelationsVsMProName += fAnalysisLabel->Data(); | |
7606 | TString productFlag[6] = {"<<2><4>>","<<2><6>>","<<2><8>>","<<4><6>>","<<4><8>>","<<6><8>>"}; | |
7607 | for(Int_t pi=0;pi<6;pi++) | |
7608 | { | |
7609 | TProfile *intFlowProductOfCorrelationsVsMPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(Form("%s, %s",intFlowProductOfCorrelationsVsMProName.Data(),productFlag[pi].Data()))); | |
7610 | if(intFlowProductOfCorrelationsVsMPro) | |
7611 | { | |
7612 | this->SetIntFlowProductOfCorrelationsVsMPro(intFlowProductOfCorrelationsVsMPro,pi); | |
7613 | } else | |
7614 | { | |
7615 | cout<<"WARNING: "<<Form("intFlowProductOfCorrelationsVsMPro[%d]",pi)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7616 | } | |
7617 | } // end of for(Int_t pi=0;pi<6;pi++) | |
7618 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 7619 | // average correction terms for non-uniform acceptance (with wrong errors!): |
7620 | for(Int_t sc=0;sc<2;sc++) | |
7621 | { | |
7622 | TString intFlowCorrectionTermsForNUAProName = "fIntFlowCorrectionTermsForNUAPro"; | |
7623 | intFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
7624 | TProfile *intFlowCorrectionTermsForNUAPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject((Form("%s: %s terms",intFlowCorrectionTermsForNUAProName.Data(),sinCosFlag[sc].Data())))); | |
7625 | if(intFlowCorrectionTermsForNUAPro) | |
7626 | { | |
7627 | this->SetIntFlowCorrectionTermsForNUAPro(intFlowCorrectionTermsForNUAPro,sc); | |
7628 | } else | |
7629 | { | |
7630 | cout<<"WARNING: intFlowCorrectionTermsForNUAPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7631 | cout<<"sc = "<<sc<<endl; | |
7632 | } | |
2001bc3a | 7633 | // versus multiplicity: |
b3dacf6b | 7634 | if(fCalculateCumulantsVsM) |
2001bc3a | 7635 | { |
b3dacf6b | 7636 | TString correctionTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4 |
7637 | TString intFlowCorrectionTermsForNUAVsMProName = "fIntFlowCorrectionTermsForNUAVsMPro"; | |
7638 | intFlowCorrectionTermsForNUAVsMProName += fAnalysisLabel->Data(); | |
7639 | for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) | |
2001bc3a | 7640 | { |
b3dacf6b | 7641 | TProfile *intFlowCorrectionTermsForNUAVsMPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(Form("%s: #LT#LT%s%s#GT#GT",intFlowCorrectionTermsForNUAVsMProName.Data(),sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()))); |
7642 | if(intFlowCorrectionTermsForNUAVsMPro) | |
7643 | { | |
7644 | this->SetIntFlowCorrectionTermsForNUAVsMPro(intFlowCorrectionTermsForNUAVsMPro,sc,ci); | |
7645 | } else | |
7646 | { | |
7647 | cout<<"WARNING: intFlowCorrectionTermsForNUAVsMPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7648 | cout<<"sc = "<<sc<<endl; | |
7649 | cout<<"ci = "<<ci<<endl; | |
7650 | } | |
7651 | } // end of for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) | |
7652 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 7653 | } // end of for(Int_t sc=0;sc<2;sc++) |
0328db2d | 7654 | // average products of correction terms for NUA: |
7655 | TString intFlowProductOfCorrectionTermsForNUAProName = "fIntFlowProductOfCorrectionTermsForNUAPro"; | |
7656 | intFlowProductOfCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
7657 | TProfile *intFlowProductOfCorrectionTermsForNUAPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowProductOfCorrectionTermsForNUAProName.Data())); | |
7658 | if(intFlowProductOfCorrectionTermsForNUAPro) | |
7659 | { | |
7660 | this->SetIntFlowProductOfCorrectionTermsForNUAPro(intFlowProductOfCorrectionTermsForNUAPro); | |
7661 | } else | |
7662 | { | |
7663 | cout<<"WARNING: intFlowProductOfCorrectionTermsForNUAPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7664 | } | |
489d5531 | 7665 | } else // to if(intFlowProfiles) |
7666 | { | |
7667 | cout<<"WARNING: intFlowProfiles is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7668 | } | |
7669 | ||
7670 | // d) Get pointer to list fIntFlowResults and pointers to all objects that she holds. | |
7671 | TList *intFlowResults = NULL; | |
7672 | intFlowResults = dynamic_cast<TList*>(intFlowList->FindObject("Results")); | |
7673 | if(intFlowResults) | |
7674 | { | |
7675 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with correct errors!): | |
7676 | TString intFlowCorrelationsHistName = "fIntFlowCorrelationsHist"; | |
7677 | intFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
7678 | TH1D *intFlowCorrelationsHist = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCorrelationsHistName.Data())); | |
7679 | if(intFlowCorrelationsHist) | |
7680 | { | |
7681 | this->SetIntFlowCorrelationsHist(intFlowCorrelationsHist); | |
7682 | } else | |
7683 | { | |
7684 | cout<<"WARNING: intFlowCorrelationsHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7685 | } | |
ff70ca91 | 7686 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with correct errors!) vs M: |
b3dacf6b | 7687 | if(fCalculateCumulantsVsM) |
ff70ca91 | 7688 | { |
b3dacf6b | 7689 | TString intFlowCorrelationsVsMHistName = "fIntFlowCorrelationsVsMHist"; |
7690 | intFlowCorrelationsVsMHistName += fAnalysisLabel->Data(); | |
7691 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
ff70ca91 | 7692 | { |
b3dacf6b | 7693 | TH1D *intFlowCorrelationsVsMHist = dynamic_cast<TH1D*> |
7694 | (intFlowResults->FindObject(Form("%s, %s",intFlowCorrelationsVsMHistName.Data(),correlationFlag[ci].Data()))); | |
7695 | if(intFlowCorrelationsVsMHist) | |
7696 | { | |
7697 | this->SetIntFlowCorrelationsVsMHist(intFlowCorrelationsVsMHist,ci); | |
7698 | } else | |
7699 | { | |
7700 | cout<<"WARNING: "<<Form("intFlowCorrelationsVsMHist[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7701 | } | |
7702 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
7703 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 7704 | // average all correlations for integrated flow (with correct errors!): |
7705 | TString intFlowCorrelationsAllHistName = "fIntFlowCorrelationsAllHist"; | |
7706 | intFlowCorrelationsAllHistName += fAnalysisLabel->Data(); | |
7707 | TH1D *intFlowCorrelationsAllHist = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCorrelationsAllHistName.Data())); | |
7708 | if(intFlowCorrelationsAllHist) | |
7709 | { | |
7710 | this->SetIntFlowCorrelationsAllHist(intFlowCorrelationsAllHist); | |
7711 | } else | |
7712 | { | |
7713 | cout<<"WARNING: intFlowCorrelationsAllHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7714 | } | |
7715 | // average correction terms for non-uniform acceptance (with correct errors!): | |
7716 | TString intFlowCorrectionTermsForNUAHistName = "fIntFlowCorrectionTermsForNUAHist"; | |
7717 | intFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
7718 | for(Int_t sc=0;sc<2;sc++) | |
7719 | { | |
7720 | TH1D *intFlowCorrectionTermsForNUAHist = dynamic_cast<TH1D*>(intFlowResults->FindObject((Form("%s: %s terms",intFlowCorrectionTermsForNUAHistName.Data(),sinCosFlag[sc].Data())))); | |
7721 | if(intFlowCorrectionTermsForNUAHist) | |
7722 | { | |
7723 | this->SetIntFlowCorrectionTermsForNUAHist(intFlowCorrectionTermsForNUAHist,sc); | |
7724 | } else | |
7725 | { | |
7726 | cout<<"WARNING: intFlowCorrectionTermsForNUAHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7727 | cout<<"sc = "<<sc<<endl; | |
7728 | } | |
7729 | } // end of for(Int_t sc=0;sc<2;sc++) | |
7730 | // covariances (multiplied with weight dependent prefactor): | |
7731 | TString intFlowCovariancesName = "fIntFlowCovariances"; | |
7732 | intFlowCovariancesName += fAnalysisLabel->Data(); | |
7733 | TH1D *intFlowCovariances = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCovariancesName.Data())); | |
7734 | if(intFlowCovariances) | |
7735 | { | |
7736 | this->SetIntFlowCovariances(intFlowCovariances); | |
7737 | } else | |
7738 | { | |
7739 | cout<<"WARNING: intFlowCovariances is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7740 | } | |
7741 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8>: | |
7742 | TString intFlowSumOfEventWeightsName = "fIntFlowSumOfEventWeights"; | |
7743 | intFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
7744 | for(Int_t power=0;power<2;power++) | |
7745 | { | |
7746 | TH1D *intFlowSumOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s: %s",intFlowSumOfEventWeightsName.Data(),powerFlag[power].Data()))); | |
7747 | if(intFlowSumOfEventWeights) | |
7748 | { | |
7749 | this->SetIntFlowSumOfEventWeights(intFlowSumOfEventWeights,power); | |
7750 | } else | |
7751 | { | |
7752 | cout<<"WARNING: intFlowSumOfEventWeights is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7753 | cout<<"power = "<<power<<endl; | |
7754 | } | |
7755 | } // end of for(Int_t power=0;power<2;power++) | |
7756 | // sum of products of event weights for correlations <2>, <4>, <6> and <8>: | |
7757 | TString intFlowSumOfProductOfEventWeightsName = "fIntFlowSumOfProductOfEventWeights"; | |
7758 | intFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
7759 | TH1D *intFlowSumOfProductOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowSumOfProductOfEventWeightsName.Data())); | |
7760 | if(intFlowSumOfProductOfEventWeights) | |
7761 | { | |
7762 | this->SetIntFlowSumOfProductOfEventWeights(intFlowSumOfProductOfEventWeights); | |
7763 | } else | |
7764 | { | |
7765 | cout<<"WARNING: intFlowSumOfProductOfEventWeights is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7766 | } | |
ff70ca91 | 7767 | // final result for covariances of correlations (multiplied with weight dependent prefactor) versus M |
7768 | // [0=Cov(2,4),1=Cov(2,6),2=Cov(2,8),3=Cov(4,6),4=Cov(4,8),5=Cov(6,8)]: | |
b3dacf6b | 7769 | if(fCalculateCumulantsVsM) |
ff70ca91 | 7770 | { |
b3dacf6b | 7771 | TString intFlowCovariancesVsMName = "fIntFlowCovariancesVsM"; |
7772 | intFlowCovariancesVsMName += fAnalysisLabel->Data(); | |
7773 | TString covarianceFlag[6] = {"Cov(<2>,<4>)","Cov(<2>,<6>)","Cov(<2>,<8>)","Cov(<4>,<6>)","Cov(<4>,<8>)","Cov(<6>,<8>)"}; | |
7774 | for(Int_t ci=0;ci<6;ci++) | |
7775 | { | |
7776 | TH1D *intFlowCovariancesVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowCovariancesVsMName.Data(),covarianceFlag[ci].Data()))); | |
7777 | if(intFlowCovariancesVsM) | |
ff70ca91 | 7778 | { |
b3dacf6b | 7779 | this->SetIntFlowCovariancesVsM(intFlowCovariancesVsM,ci); |
ff70ca91 | 7780 | } else |
7781 | { | |
b3dacf6b | 7782 | cout<<"WARNING: "<<Form("intFlowCovariancesVsM[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; |
ff70ca91 | 7783 | } |
b3dacf6b | 7784 | } // end of for(Int_t ci=0;ci<6;ci++) |
7785 | } // end of if(fCalculateCumulantsVsM) | |
7786 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8> versus multiplicity | |
7787 | // [0=sum{w_{<2>}},1=sum{w_{<4>}},2=sum{w_{<6>}},3=sum{w_{<8>}}][0=linear 1,1=quadratic]: | |
7788 | if(fCalculateCumulantsVsM) | |
7789 | { | |
7790 | TString intFlowSumOfEventWeightsVsMName = "fIntFlowSumOfEventWeightsVsM"; | |
7791 | intFlowSumOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
7792 | TString sumFlag[2][4] = {{"#sum_{i=1}^{N} w_{<2>}","#sum_{i=1}^{N} w_{<4>}","#sum_{i=1}^{N} w_{<6>}","#sum_{i=1}^{N} w_{<8>}"}, | |
7793 | {"#sum_{i=1}^{N} w_{<2>}^{2}","#sum_{i=1}^{N} w_{<4>}^{2}","#sum_{i=1}^{N} w_{<6>}^{2}","#sum_{i=1}^{N} w_{<8>}^{2}"}}; | |
7794 | for(Int_t si=0;si<4;si++) | |
7795 | { | |
7796 | for(Int_t power=0;power<2;power++) | |
7797 | { | |
7798 | TH1D *intFlowSumOfEventWeightsVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowSumOfEventWeightsVsMName.Data(),sumFlag[power][si].Data()))); | |
7799 | if(intFlowSumOfEventWeightsVsM) | |
7800 | { | |
7801 | this->SetIntFlowSumOfEventWeightsVsM(intFlowSumOfEventWeightsVsM,si,power); | |
7802 | } else | |
7803 | { | |
7804 | cout<<"WARNING: "<<Form("intFlowSumOfEventWeightsVsM[%d][%d]",si,power)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7805 | } | |
7806 | } // end of for(Int_t power=0;power<2;power++) | |
7807 | } // end of for(Int_t si=0;si<4;si++) | |
7808 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 7809 | // sum of products of event weights for correlations <2>, <4>, <6> and <8> vs M |
7810 | // [0=sum{w_{<2>}w_{<4>}},1=sum{w_{<2>}w_{<6>}},2=sum{w_{<2>}w_{<8>}}, | |
7811 | // 3=sum{w_{<4>}w_{<6>}},4=sum{w_{<4>}w_{<8>}},5=sum{w_{<6>}w_{<8>}}]: | |
b3dacf6b | 7812 | if(fCalculateCumulantsVsM) |
ff70ca91 | 7813 | { |
b3dacf6b | 7814 | TString intFlowSumOfProductOfEventWeightsVsMName = "fIntFlowSumOfProductOfEventWeightsVsM"; |
7815 | intFlowSumOfProductOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
7816 | TString sopowFlag[6] = {"#sum_{i=1}^{N} w_{<2>} w_{<4>}","#sum_{i=1}^{N} w_{<2>} w_{<6>}","#sum_{i=1}^{N} w_{<2>} w_{<8>}", | |
7817 | "#sum_{i=1}^{N} w_{<4>} w_{<6>}","#sum_{i=1}^{N} w_{<4>} w_{<8>}","#sum_{i=1}^{N} w_{<6>} w_{<8>}"}; | |
7818 | for(Int_t pi=0;pi<6;pi++) | |
ff70ca91 | 7819 | { |
b3dacf6b | 7820 | TH1D *intFlowSumOfProductOfEventWeightsVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowSumOfProductOfEventWeightsVsMName.Data(),sopowFlag[pi].Data()))); |
7821 | if(intFlowSumOfProductOfEventWeightsVsM) | |
7822 | { | |
7823 | this->SetIntFlowSumOfProductOfEventWeightsVsM(intFlowSumOfProductOfEventWeightsVsM,pi); | |
7824 | } else | |
7825 | { | |
7826 | cout<<"WARNING: "<<Form("intFlowSumOfProductOfEventWeightsVsM[%d]",pi)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7827 | } | |
7828 | } // end of for(Int_t pi=0;pi<6;pi++) | |
7829 | } // end of if(fCalculateCumulantsVsM) | |
0328db2d | 7830 | // covariances for NUA (multiplied with weight dependent prefactor): |
7831 | TString intFlowCovariancesNUAName = "fIntFlowCovariancesNUA"; | |
7832 | intFlowCovariancesNUAName += fAnalysisLabel->Data(); | |
7833 | TH1D *intFlowCovariancesNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCovariancesNUAName.Data())); | |
7834 | if(intFlowCovariancesNUA) | |
7835 | { | |
7836 | this->SetIntFlowCovariancesNUA(intFlowCovariancesNUA); | |
7837 | } else | |
7838 | { | |
7839 | cout<<"WARNING: intFlowCovariancesNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7840 | } | |
7841 | // sum of linear and quadratic event weights NUA terms: | |
7842 | TString intFlowSumOfEventWeightsNUAName = "fIntFlowSumOfEventWeightsNUA"; | |
7843 | intFlowSumOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
7844 | for(Int_t sc=0;sc<2;sc++) | |
7845 | { | |
7846 | for(Int_t power=0;power<2;power++) | |
7847 | { | |
7848 | TH1D *intFlowSumOfEventWeightsNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s: %s, %s",intFlowSumOfEventWeightsNUAName.Data(),powerFlag[power].Data(),sinCosFlag[sc].Data()))); | |
7849 | if(intFlowSumOfEventWeightsNUA) | |
7850 | { | |
7851 | this->SetIntFlowSumOfEventWeightsNUA(intFlowSumOfEventWeightsNUA,sc,power); | |
7852 | } else | |
7853 | { | |
7854 | cout<<"WARNING: intFlowSumOfEventWeightsNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7855 | cout<<"sc = "<<sc<<endl; | |
7856 | cout<<"power = "<<power<<endl; | |
7857 | } | |
7858 | } // end of for(Int_t power=0;power<2;power++) | |
7859 | } // end of for(Int_t sc=0;sc<2;sc++) | |
7860 | // sum of products of event weights for NUA terms: | |
7861 | TString intFlowSumOfProductOfEventWeightsNUAName = "fIntFlowSumOfProductOfEventWeightsNUA"; | |
7862 | intFlowSumOfProductOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
7863 | TH1D *intFlowSumOfProductOfEventWeightsNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowSumOfProductOfEventWeightsNUAName.Data())); | |
7864 | if(intFlowSumOfProductOfEventWeightsNUA) | |
7865 | { | |
7866 | this->SetIntFlowSumOfProductOfEventWeightsNUA(intFlowSumOfProductOfEventWeightsNUA); | |
7867 | } else | |
7868 | { | |
7869 | cout<<"WARNING: intFlowSumOfProductOfEventWeightsNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7870 | } | |
b3dacf6b | 7871 | // Final results for reference Q-cumulants: |
489d5531 | 7872 | TString intFlowQcumulantsName = "fIntFlowQcumulants"; |
7873 | intFlowQcumulantsName += fAnalysisLabel->Data(); | |
7874 | TH1D *intFlowQcumulants = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsName.Data())); | |
7875 | if(intFlowQcumulants) | |
7876 | { | |
7877 | this->SetIntFlowQcumulants(intFlowQcumulants); | |
7878 | } else | |
7879 | { | |
7880 | cout<<"WARNING: intFlowQcumulants is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7881 | } | |
b3dacf6b | 7882 | // Final results for reference Q-cumulants rebinned in M: |
7883 | if(fCalculateCumulantsVsM) | |
7884 | { | |
7885 | TString intFlowQcumulantsRebinnedInMName = "fIntFlowQcumulantsRebinnedInM"; | |
7886 | intFlowQcumulantsRebinnedInMName += fAnalysisLabel->Data(); | |
7887 | TH1D *intFlowQcumulantsRebinnedInM = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsRebinnedInMName.Data())); | |
7888 | if(intFlowQcumulantsRebinnedInM) | |
7889 | { | |
7890 | this->SetIntFlowQcumulantsRebinnedInM(intFlowQcumulantsRebinnedInM); | |
7891 | } else | |
7892 | { | |
7893 | cout<<"WARNING: intFlowQcumulantsRebinnedInM is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7894 | } | |
7895 | } // end of if(fCalculateCumulantsVsM) | |
b92ea2b9 | 7896 | // Ratio between error squared: with/without non-isotropic terms: |
7897 | TString intFlowQcumulantsErrorSquaredRatioName = "fIntFlowQcumulantsErrorSquaredRatio"; | |
7898 | intFlowQcumulantsErrorSquaredRatioName += fAnalysisLabel->Data(); | |
7899 | TH1D *intFlowQcumulantsErrorSquaredRatio = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsErrorSquaredRatioName.Data())); | |
7900 | if(intFlowQcumulantsErrorSquaredRatio) | |
7901 | { | |
7902 | this->SetIntFlowQcumulantsErrorSquaredRatio(intFlowQcumulantsErrorSquaredRatio); | |
7903 | } else | |
7904 | { | |
7905 | cout<<" WARNING: intntFlowQcumulantsErrorSquaredRatio is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7906 | } | |
ff70ca91 | 7907 | // final results for integrated Q-cumulants versus multiplicity: |
ff70ca91 | 7908 | TString cumulantFlag[4] = {"QC{2}","QC{4}","QC{6}","QC{8}"}; |
b3dacf6b | 7909 | if(fCalculateCumulantsVsM) |
ff70ca91 | 7910 | { |
b3dacf6b | 7911 | TString intFlowQcumulantsVsMName = "fIntFlowQcumulantsVsM"; |
7912 | intFlowQcumulantsVsMName += fAnalysisLabel->Data(); | |
7913 | for(Int_t co=0;co<4;co++) // cumulant order | |
ff70ca91 | 7914 | { |
b3dacf6b | 7915 | TH1D *intFlowQcumulantsVsM = dynamic_cast<TH1D*> |
7916 | (intFlowResults->FindObject(Form("%s, %s",intFlowQcumulantsVsMName.Data(),cumulantFlag[co].Data()))); | |
7917 | if(intFlowQcumulantsVsM) | |
7918 | { | |
7919 | this->SetIntFlowQcumulantsVsM(intFlowQcumulantsVsM,co); | |
7920 | } else | |
7921 | { | |
7922 | cout<<"WARNING: "<<Form("intFlowQcumulantsVsM[%d]",co)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7923 | } | |
7924 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
7925 | } // end of if(fCalculateCumulantsVsM) | |
7926 | // Final reference flow estimates from Q-cumulants: | |
489d5531 | 7927 | TString intFlowName = "fIntFlow"; |
7928 | intFlowName += fAnalysisLabel->Data(); | |
7929 | TH1D *intFlow = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowName.Data())); | |
7930 | if(intFlow) | |
7931 | { | |
7932 | this->SetIntFlow(intFlow); | |
7933 | } else | |
7934 | { | |
7935 | cout<<"WARNING: intFlow is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
ff70ca91 | 7936 | } |
b3dacf6b | 7937 | // Final reference flow estimates from Q-cumulants vs M rebinned in M: |
7938 | if(fCalculateCumulantsVsM) | |
ff70ca91 | 7939 | { |
b3dacf6b | 7940 | TString intFlowRebinnedInMName = "fIntFlowRebinnedInM"; |
7941 | intFlowRebinnedInMName += fAnalysisLabel->Data(); | |
7942 | TH1D *intFlowRebinnedInM = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowRebinnedInMName.Data())); | |
7943 | if(intFlowRebinnedInM) | |
ff70ca91 | 7944 | { |
b3dacf6b | 7945 | this->SetIntFlowRebinnedInM(intFlowRebinnedInM); |
7946 | } else | |
ff70ca91 | 7947 | { |
b3dacf6b | 7948 | cout<<"WARNING: intFlowRebinnedInM is NULL in AFAWQC::GPFIFH() !!!!"<<endl; |
7949 | } | |
7950 | } // end of if(fCalculateCumulantsVsM) | |
7951 | // integrated flow from Q-cumulants versus multiplicity: | |
7952 | if(fCalculateCumulantsVsM) | |
7953 | { | |
7954 | TString intFlowVsMName = "fIntFlowVsM"; | |
7955 | intFlowVsMName += fAnalysisLabel->Data(); | |
b77b6434 | 7956 | TString flowFlag[4] = {Form("v_{%d}{2,QC}",fHarmonic),Form("v_{%d}{4,QC}",fHarmonic),Form("v_{%d}{6,QC}",fHarmonic),Form("v_{%d}{8,QC}",fHarmonic)}; |
b3dacf6b | 7957 | for(Int_t co=0;co<4;co++) // cumulant order |
7958 | { | |
7959 | TH1D *intFlowVsM = dynamic_cast<TH1D*> | |
b77b6434 | 7960 | (intFlowResults->FindObject(Form("%s, %s",intFlowVsMName.Data(),flowFlag[co].Data()))); |
b3dacf6b | 7961 | if(intFlowVsM) |
7962 | { | |
7963 | this->SetIntFlowVsM(intFlowVsM,co); | |
7964 | } else | |
7965 | { | |
7966 | cout<<"WARNING: "<<Form("intFlowVsM[%d]",co)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7967 | } | |
7968 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
7969 | } // end of if(fCalculateCumulantsVsM) | |
2001bc3a | 7970 | // quantifying detector effects effects to correlations: |
7971 | TString intFlowDetectorBiasName = "fIntFlowDetectorBias"; | |
7972 | intFlowDetectorBiasName += fAnalysisLabel->Data(); | |
7973 | TH1D *intFlowDetectorBias = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowDetectorBiasName.Data())); | |
7974 | if(intFlowDetectorBias) | |
7975 | { | |
7976 | this->SetIntFlowDetectorBias(intFlowDetectorBias); | |
7977 | } else | |
7978 | { | |
7979 | cout<<"WARNING: intFlowDetectorBias is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7980 | } | |
7981 | // quantifying detector effects effects to correlations vs multiplicity: | |
b77b6434 | 7982 | if(fCalculateCumulantsVsM) |
2001bc3a | 7983 | { |
3c5d5752 | 7984 | TString intFlowDetectorBiasVsMName = "fIntFlowDetectorBiasVsM"; |
7985 | intFlowDetectorBiasVsMName += fAnalysisLabel->Data(); | |
7986 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2001bc3a | 7987 | { |
3c5d5752 | 7988 | TH1D *intFlowDetectorBiasVsM = dynamic_cast<TH1D*> |
7989 | (intFlowResults->FindObject(Form("%s for %s",intFlowDetectorBiasVsMName.Data(),cumulantFlag[ci].Data()))); | |
7990 | if(intFlowDetectorBiasVsM) | |
7991 | { | |
7992 | this->SetIntFlowDetectorBiasVsM(intFlowDetectorBiasVsM,ci); | |
7993 | } else | |
7994 | { | |
7995 | cout<<"WARNING: "<<Form("intFlowDetectorBiasVsM[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7996 | } | |
7997 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
b77b6434 | 7998 | } // end of if(fCalculateCumulantsVsM) |
489d5531 | 7999 | } else // to if(intFlowResults) |
8000 | { | |
8001 | cout<<"WARNING: intFlowResults is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8002 | } | |
ff70ca91 | 8003 | |
489d5531 | 8004 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForIntFlowHistograms() |
8005 | ||
489d5531 | 8006 | //================================================================================================================================ |
8007 | ||
1268c371 | 8008 | void AliFlowAnalysisWithQCumulants::GetPointersFor2DDiffFlowHistograms() |
8009 | { | |
8010 | // Get pointers for 2D differential flow histograms. | |
8011 | // a) Check pointers used in this method; | |
8012 | // b) Get pointers to 2D differential flow lists; | |
8013 | // c) Get pointers to 2D differential flow profiles; | |
8014 | // d) Get pointers to 2D differential flow histograms. | |
8015 | ||
8016 | // a) Check pointers used in this method: | |
8017 | if(!fDiffFlowList) | |
8018 | { | |
8019 | printf("\n WARNING (QC): fDiffFlowList is NULL in AFAWQC::GPF2DDFH() !!!!\n"); | |
8020 | printf(" Call method GetPointersForDiffFlowHistograms() first.\n\n"); | |
8021 | exit(0); | |
8022 | } | |
8023 | if(!fDiffFlowFlags) | |
8024 | { | |
8025 | printf("\n WARNING (QC): fDiffFlowFlags is NULL in AFAWQC::GPF2DDFH() !!!!\n\n"); | |
8026 | printf(" Call method GetPointersForDiffFlowHistograms() first.\n\n"); | |
8027 | exit(0); | |
8028 | } | |
8029 | ||
8030 | // b) Get pointers to 2D differential flow lists: | |
8031 | this->SetCalculate2DDiffFlow((Bool_t)fDiffFlowFlags->GetBinContent(5)); // to be improved - hardwired 5 | |
8032 | if(!fCalculate2DDiffFlow){return;} | |
8033 | TString typeFlag[2] = {"RP","POI"}; | |
8034 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
8035 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
8036 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
8037 | // Base list: | |
8038 | TString diffFlow2DListName = "2D"; | |
8039 | diffFlow2DListName += fAnalysisLabel->Data(); | |
8040 | fDiffFlow2D = dynamic_cast<TList*>(fDiffFlowList->FindObject(diffFlow2DListName.Data())); | |
8041 | if(!fDiffFlow2D) | |
8042 | { | |
8043 | printf("\n WARNING (QC): fDiffFlow2D is NULL in AFAWQC::GPFDFH() !!!!\n\n"); | |
8044 | exit(0); | |
8045 | } | |
8046 | // Lists holding profiles with 2D correlations: | |
8047 | TString s2DDiffFlowCorrelationsProListName = "Profiles with 2D correlations"; | |
8048 | s2DDiffFlowCorrelationsProListName += fAnalysisLabel->Data(); // to be improved | |
8049 | for(Int_t t=0;t<2;t++) | |
8050 | { | |
8051 | f2DDiffFlowCorrelationsProList[t] = dynamic_cast<TList*>(fDiffFlow2D->FindObject(Form("Profiles with 2D correlations (%s)",typeFlag[t].Data()))); | |
8052 | if(!f2DDiffFlowCorrelationsProList[t]) | |
8053 | { | |
8054 | printf("\n WARNING (QC): f2DDiffFlowCorrelationsProList[%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t); | |
8055 | exit(0); | |
8056 | } | |
8057 | } // end of for(Int_t t=0;t<2;t++) | |
8058 | ||
8059 | // c) Get pointers to 2D differential flow profiles: | |
8060 | TString s2DDiffFlowCorrelationsProName = "f2DDiffFlowCorrelationsPro"; | |
8061 | s2DDiffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
8062 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8063 | { | |
8064 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8065 | { | |
8066 | f2DDiffFlowCorrelationsPro[t][rci] = dynamic_cast<TProfile2D*>(f2DDiffFlowCorrelationsProList[t]->FindObject(Form("%s, %s, %s",s2DDiffFlowCorrelationsProName.Data(),typeFlag[t].Data(),reducedCorrelationIndex[rci].Data()))); | |
8067 | if(!f2DDiffFlowCorrelationsPro[t][rci]) | |
8068 | { | |
8069 | printf("\n WARNING (QC): f2DDiffFlowCorrelationsPro[%i][%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t,rci); | |
8070 | exit(0); | |
8071 | } else | |
8072 | { | |
8073 | this->Set2DDiffFlowCorrelationsPro(f2DDiffFlowCorrelationsPro[t][rci],t,rci); | |
8074 | } | |
8075 | } // end of for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8076 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
8077 | ||
8078 | // d) Get pointers to 2D differential flow histograms: | |
8079 | TString s2DDiffFlowCumulantsName = "f2DDiffFlowCumulants"; | |
8080 | s2DDiffFlowCumulantsName += fAnalysisLabel->Data(); | |
8081 | TString s2DDiffFlowName = "f2DDiffFlow"; | |
8082 | s2DDiffFlowName += fAnalysisLabel->Data(); | |
8083 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8084 | { | |
8085 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8086 | { | |
8087 | // 2D differential cumulants: | |
8088 | f2DDiffFlowCumulants[t][rci] = dynamic_cast<TH2D*>(f2DDiffFlowCorrelationsProList[t]->FindObject(Form("%s, %s, %s",s2DDiffFlowCumulantsName.Data(),typeFlag[t].Data(),differentialCumulantIndex[rci].Data()))); | |
8089 | if(!f2DDiffFlowCumulants[t][rci]) | |
8090 | { | |
8091 | printf("\n WARNING (QC): f2DDiffFlowCumulants[%i][%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t,rci); | |
8092 | exit(0); | |
8093 | } else | |
8094 | { | |
8095 | this->Set2DDiffFlowCumulants(f2DDiffFlowCumulants[t][rci],t,rci); | |
8096 | } | |
8097 | // 2D differential flow: | |
8098 | f2DDiffFlow[t][rci] = dynamic_cast<TH2D*>(f2DDiffFlowCorrelationsProList[t]->FindObject(Form("%s, %s, %s",s2DDiffFlowName.Data(),typeFlag[t].Data(),differentialFlowIndex[rci].Data()))); | |
8099 | if(!f2DDiffFlow[t][rci]) | |
8100 | { | |
8101 | printf("\n WARNING (QC): f2DDiffFlow[%i][%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t,rci); | |
8102 | exit(0); | |
8103 | } else | |
8104 | { | |
8105 | this->Set2DDiffFlow(f2DDiffFlow[t][rci],t,rci); | |
8106 | } | |
8107 | } // end of for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8108 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
8109 | ||
8110 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersFor2DDiffFlowHistograms() | |
8111 | ||
8112 | //================================================================================================================================ | |
8113 | ||
489d5531 | 8114 | void AliFlowAnalysisWithQCumulants::GetPointersForDiffFlowHistograms() |
8115 | { | |
8116 | // Get pointer to all objects relevant for differential flow. | |
1268c371 | 8117 | // a) Get pointer to base list for differential flow fDiffFlowList; |
8118 | // b) Get pointer to profile fDiffFlowFlags holding all flags for differential flow. Access and set some flags; | |
8119 | // c) Get pointers to nested lists fDiffFlowListProfiles and fDiffFlowListResults; | |
8120 | // d) Define flags locally (to be improved: should I promote these flags to data members?); | |
8121 | // e) Get pointers to all nested lists in fDiffFlowListProfiles and to profiles which they hold; | |
8122 | // f) Get pointers to all nested lists in fDiffFlowListResults and to histograms which they hold. | |
8123 | ||
8124 | // a) Get pointer to base list for differential flow fDiffFlowList: | |
8125 | fDiffFlowList = dynamic_cast<TList*>(fHistList->FindObject("Differential Flow")); | |
8126 | if(!fDiffFlowList) | |
489d5531 | 8127 | { |
1268c371 | 8128 | printf("\n WARNING (QC): fDiffFlowList is NULL in AFAWQC::GPFDFH() !!!!\n\n"); |
489d5531 | 8129 | exit(0); |
8130 | } | |
1268c371 | 8131 | |
8132 | // b) Get pointer to profile fDiffFlowFlags holding all flags for differential flow. Access and set some flags: | |
8133 | TString diffFlowFlagsName = "fDiffFlowFlags"; | |
8134 | diffFlowFlagsName += fAnalysisLabel->Data(); | |
8135 | fDiffFlowFlags = dynamic_cast<TProfile*>(fDiffFlowList->FindObject(diffFlowFlagsName.Data())); | |
8136 | if(fDiffFlowFlags) | |
8137 | { | |
8138 | this->SetCalculateDiffFlow((Bool_t)fDiffFlowFlags->GetBinContent(1)); // to be improved - hardwired 5 | |
8139 | } else | |
8140 | { | |
8141 | printf("\n WARNING (QC): fDiffFlowFlags is NULL in AFAWQC::GPFDFH() !!!!\n\n"); | |
8142 | printf("\n Flags in method Finish() are wrong.\n\n"); | |
8143 | exit(0); | |
8144 | } | |
8145 | ||
8146 | if(!fCalculateDiffFlow){return;} // IMPORTANT: do not move this anywhere above in this method (to be improved) | |
8147 | ||
8148 | // c) Get pointers to nested lists fDiffFlowListProfiles and fDiffFlowListResults: | |
8149 | // List holding nested lists holding profiles: | |
489d5531 | 8150 | TList *diffFlowListProfiles = NULL; |
1268c371 | 8151 | diffFlowListProfiles = dynamic_cast<TList*>(fDiffFlowList->FindObject("Profiles")); |
489d5531 | 8152 | if(!diffFlowListProfiles) |
8153 | { | |
1268c371 | 8154 | printf("\n WARNING (QC): diffFlowListProfiles is NULL in AFAWQC::GPFDFH() !!!!\n\n"); |
489d5531 | 8155 | exit(0); |
8156 | } | |
1268c371 | 8157 | // List holding nested lists holding histograms with final results: |
489d5531 | 8158 | TList *diffFlowListResults = NULL; |
1268c371 | 8159 | diffFlowListResults = dynamic_cast<TList*>(fDiffFlowList->FindObject("Results")); |
489d5531 | 8160 | if(!diffFlowListResults) |
8161 | { | |
1268c371 | 8162 | printf("\n WARNING (QC): diffFlowListResults is NULL in AFAWQC::GPFDFH() !!!!\n\n"); |
489d5531 | 8163 | exit(0); |
8164 | } | |
8165 | ||
1268c371 | 8166 | // d) Define flags locally (to be improved: should I promote these flags to data members?): |
8167 | TString typeFlag[2] = {"RP","POI"}; | |
8168 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
8169 | TString powerFlag[2] = {"linear","quadratic"}; | |
8170 | TString sinCosFlag[2] = {"sin","cos"}; | |
8171 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
8172 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
8173 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
8174 | TString reducedSquaredCorrelationIndex[4] = {"<2'>^{2}","<4'>^{2}","<6'>^{2}","<8'>^{2}"}; | |
8175 | TString mixedCorrelationIndex[8] = {"<2>","<2'>","<4>","<4'>","<6>","<6'>","<8>","<8'>"}; | |
8176 | TString covarianceName[5] = {"Cov(<2>,<2'>)","Cov(<2>,<4'>)","Cov(<4>,<2'>)","Cov(<4>,<4'>)","Cov(<2'>,<4'>)"}; | |
489d5531 | 8177 | |
1268c371 | 8178 | // e) Get pointers to all nested lists in fDiffFlowListProfiles and to profiles which they hold: |
489d5531 | 8179 | // correlations: |
8180 | TList *diffFlowCorrelationsProList[2][2] = {{NULL}}; | |
8181 | TString diffFlowCorrelationsProName = "fDiffFlowCorrelationsPro"; | |
8182 | diffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
b40a910e | 8183 | TProfile *diffFlowCorrelationsPro[2][2][4] = {{{NULL}}}; |
8184 | // squared correlations: | |
8185 | TString diffFlowSquaredCorrelationsProName = "fDiffFlowSquaredCorrelationsPro"; | |
8186 | diffFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
8187 | TProfile *diffFlowSquaredCorrelationsPro[2][2][4] = {{{NULL}}}; | |
489d5531 | 8188 | // products of correlations: |
8189 | TList *diffFlowProductOfCorrelationsProList[2][2] = {{NULL}}; | |
8190 | TString diffFlowProductOfCorrelationsProName = "fDiffFlowProductOfCorrelationsPro"; | |
8191 | diffFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
8192 | TProfile *diffFlowProductOfCorrelationsPro[2][2][8][8] = {{{{NULL}}}}; | |
8193 | // corrections: | |
8194 | TList *diffFlowCorrectionsProList[2][2] = {{NULL}}; | |
8195 | TString diffFlowCorrectionTermsForNUAProName = "fDiffFlowCorrectionTermsForNUAPro"; | |
8196 | diffFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
8197 | TProfile *diffFlowCorrectionTermsForNUAPro[2][2][2][10] = {{{{NULL}}}}; | |
8198 | for(Int_t t=0;t<2;t++) | |
8199 | { | |
8200 | for(Int_t pe=0;pe<2;pe++) | |
8201 | { | |
8202 | diffFlowCorrelationsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8203 | if(!diffFlowCorrelationsProList[t][pe]) | |
8204 | { | |
8205 | cout<<"WARNING: diffFlowCorrelationsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8206 | cout<<"t = "<<t<<endl; | |
8207 | cout<<"pe = "<<pe<<endl; | |
8208 | exit(0); | |
8209 | } | |
8210 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
8211 | { | |
b40a910e | 8212 | // reduced correlations: |
489d5531 | 8213 | diffFlowCorrelationsPro[t][pe][ci] = dynamic_cast<TProfile*>(diffFlowCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[ci].Data()))); |
8214 | if(diffFlowCorrelationsPro[t][pe][ci]) | |
8215 | { | |
8216 | this->SetDiffFlowCorrelationsPro(diffFlowCorrelationsPro[t][pe][ci],t,pe,ci); | |
8217 | } else | |
8218 | { | |
8219 | cout<<"WARNING: diffFlowCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8220 | cout<<"t = "<<t<<endl; | |
8221 | cout<<"pe = "<<pe<<endl; | |
8222 | cout<<"ci = "<<ci<<endl; | |
8223 | } | |
b40a910e | 8224 | // reduced squared correlations: |
8225 | diffFlowSquaredCorrelationsPro[t][pe][ci] = dynamic_cast<TProfile*>(diffFlowCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowSquaredCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedSquaredCorrelationIndex[ci].Data()))); | |
8226 | if(diffFlowSquaredCorrelationsPro[t][pe][ci]) | |
8227 | { | |
8228 | this->SetDiffFlowSquaredCorrelationsPro(diffFlowSquaredCorrelationsPro[t][pe][ci],t,pe,ci); | |
8229 | } else | |
8230 | { | |
8231 | cout<<"WARNING: diffFlowSquaredCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8232 | cout<<"t = "<<t<<endl; | |
8233 | cout<<"pe = "<<pe<<endl; | |
8234 | cout<<"ci = "<<ci<<endl; | |
8235 | } | |
489d5531 | 8236 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index |
8237 | // products of correlations: | |
8238 | diffFlowProductOfCorrelationsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with products of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8239 | if(!diffFlowProductOfCorrelationsProList[t][pe]) | |
8240 | { | |
8241 | cout<<"WARNING: ddiffFlowProductOfCorrelationsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8242 | cout<<"t = "<<t<<endl; | |
8243 | cout<<"pe = "<<pe<<endl; | |
8244 | exit(0); | |
8245 | } | |
8246 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
8247 | { | |
8248 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
8249 | { | |
8250 | diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = dynamic_cast<TProfile*>(diffFlowProductOfCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()))); | |
8251 | if(diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]) | |
8252 | { | |
8253 | this->SetDiffFlowProductOfCorrelationsPro(diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2],t,pe,mci1,mci2); | |
8254 | } else | |
8255 | { | |
b40a910e | 8256 | cout<<"WARNING: diffFlowProductOfCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; |
489d5531 | 8257 | cout<<"t = "<<t<<endl; |
8258 | cout<<"pe = "<<pe<<endl; | |
8259 | cout<<"mci1 = "<<mci1<<endl; | |
8260 | cout<<"mci2 = "<<mci2<<endl; | |
8261 | } | |
8262 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
8263 | } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
8264 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
8265 | // corrections: | |
8266 | diffFlowCorrectionsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8267 | if(!diffFlowCorrectionsProList[t][pe]) | |
8268 | { | |
8269 | cout<<"WARNING: diffFlowCorrectionsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8270 | cout<<"t = "<<t<<endl; | |
8271 | cout<<"pe = "<<pe<<endl; | |
8272 | exit(0); | |
8273 | } | |
8274 | // correction terms for NUA: | |
8275 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
8276 | { | |
8277 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
8278 | { | |
8279 | diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = dynamic_cast<TProfile*>(diffFlowCorrectionsProList[t][pe]->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1))); | |
8280 | if(diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]) | |
8281 | { | |
8282 | this->SetDiffFlowCorrectionTermsForNUAPro(diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti],t,pe,sc,cti); | |
8283 | } else | |
8284 | { | |
8285 | cout<<"WARNING: diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8286 | cout<<"t = "<<t<<endl; | |
8287 | cout<<"pe = "<<pe<<endl; | |
8288 | cout<<"sc = "<<sc<<endl; | |
8289 | cout<<"cti = "<<cti<<endl; | |
8290 | } | |
8291 | } // end of for(Int_t cti=0;cti<9;cti++) // correction term index | |
8292 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
8293 | // ... | |
8294 | } // end of for(Int_t pe=0;pe<2;pe++) | |
8295 | } // end of for(Int_t t=0;t<2;t++) | |
8296 | ||
1268c371 | 8297 | // f) Get pointers to all nested lists in fDiffFlowListResults and to histograms which they hold: |
489d5531 | 8298 | // reduced correlations: |
8299 | TList *diffFlowCorrelationsHistList[2][2] = {{NULL}}; | |
8300 | TString diffFlowCorrelationsHistName = "fDiffFlowCorrelationsHist"; | |
8301 | diffFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
8302 | TH1D *diffFlowCorrelationsHist[2][2][4] = {{{NULL}}}; | |
8303 | // corrections for NUA: | |
8304 | TList *diffFlowCorrectionsHistList[2][2] = {{NULL}}; | |
8305 | TString diffFlowCorrectionTermsForNUAHistName = "fDiffFlowCorrectionTermsForNUAHist"; | |
8306 | diffFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
8307 | TH1D *diffFlowCorrectionTermsForNUAHist[2][2][2][10] = {{{{NULL}}}}; | |
8308 | // differential Q-cumulants: | |
8309 | TList *diffFlowCumulantsHistList[2][2] = {{NULL}}; | |
8310 | TString diffFlowCumulantsName = "fDiffFlowCumulants"; | |
8311 | diffFlowCumulantsName += fAnalysisLabel->Data(); | |
8312 | TH1D *diffFlowCumulants[2][2][4] = {{{NULL}}}; | |
1268c371 | 8313 | // detector bias to differential Q-cumulants: |
8314 | TList *diffFlowDetectorBiasHistList[2][2] = {{NULL}}; | |
8315 | TString diffFlowDetectorBiasName = "fDiffFlowDetectorBias"; | |
8316 | diffFlowDetectorBiasName += fAnalysisLabel->Data(); | |
8317 | TH1D *diffFlowDetectorBias[2][2][4] = {{{NULL}}}; | |
489d5531 | 8318 | // differential flow estimates from Q-cumulants: |
8319 | TList *diffFlowHistList[2][2] = {{NULL}}; | |
8320 | TString diffFlowName = "fDiffFlow"; | |
8321 | diffFlowName += fAnalysisLabel->Data(); | |
8322 | TH1D *diffFlow[2][2][4] = {{{NULL}}}; | |
8323 | // differential covariances: | |
8324 | TList *diffFlowCovariancesHistList[2][2] = {{NULL}}; | |
8325 | TString diffFlowCovariancesName = "fDiffFlowCovariances"; | |
8326 | diffFlowCovariancesName += fAnalysisLabel->Data(); | |
8327 | TH1D *diffFlowCovariances[2][2][5] = {{{NULL}}}; | |
8328 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8329 | { | |
8330 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8331 | { | |
8332 | // reduced correlations: | |
8333 | diffFlowCorrelationsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8334 | if(!diffFlowCorrelationsHistList[t][pe]) | |
8335 | { | |
8336 | cout<<"WARNING: diffFlowCorrelationsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8337 | cout<<"t = "<<t<<endl; | |
8338 | cout<<"pe = "<<pe<<endl; | |
8339 | exit(0); | |
8340 | } | |
8341 | for(Int_t index=0;index<4;index++) | |
8342 | { | |
8343 | diffFlowCorrelationsHist[t][pe][index] = dynamic_cast<TH1D*>(diffFlowCorrelationsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()))); | |
8344 | if(diffFlowCorrelationsHist[t][pe][index]) | |
8345 | { | |
8346 | this->SetDiffFlowCorrelationsHist(diffFlowCorrelationsHist[t][pe][index],t,pe,index); | |
8347 | } else | |
8348 | { | |
8349 | cout<<"WARNING: diffFlowCorrelationsHist[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8350 | cout<<"t = "<<t<<endl; | |
8351 | cout<<"pe = "<<pe<<endl; | |
8352 | cout<<"index = "<<index<<endl; | |
8353 | exit(0); | |
8354 | } | |
8355 | } // end of for(Int_t index=0;index<4;index++) | |
8356 | // corrections: | |
8357 | diffFlowCorrectionsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Histograms with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8358 | if(!diffFlowCorrectionsHistList[t][pe]) | |
8359 | { | |
8360 | cout<<"WARNING: diffFlowCorrectionsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8361 | cout<<"t = "<<t<<endl; | |
8362 | cout<<"pe = "<<pe<<endl; | |
8363 | exit(0); | |
8364 | } | |
8365 | // correction terms for NUA: | |
8366 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
8367 | { | |
8368 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
8369 | { | |
8370 | diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = dynamic_cast<TH1D*>(diffFlowCorrectionsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1))); | |
8371 | if(diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]) | |
8372 | { | |
8373 | this->SetDiffFlowCorrectionTermsForNUAHist(diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti],t,pe,sc,cti); | |
8374 | } else | |
8375 | { | |
8376 | cout<<"WARNING: diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8377 | cout<<"t = "<<t<<endl; | |
8378 | cout<<"pe = "<<pe<<endl; | |
8379 | cout<<"sc = "<<sc<<endl; | |
8380 | cout<<"cti = "<<cti<<endl; | |
8381 | } | |
8382 | } // end of for(Int_t cti=0;cti<9;cti++) // correction term index | |
8383 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
8384 | // ... | |
8385 | // differential Q-cumulants: | |
8386 | diffFlowCumulantsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Differential Q-cumulants (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8387 | if(!diffFlowCumulantsHistList[t][pe]) | |
8388 | { | |
8389 | cout<<"WARNING: diffFlowCumulantsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8390 | cout<<"t = "<<t<<endl; | |
8391 | cout<<"pe = "<<pe<<endl; | |
8392 | exit(0); | |
8393 | } | |
8394 | for(Int_t index=0;index<4;index++) | |
8395 | { | |
8396 | diffFlowCumulants[t][pe][index] = dynamic_cast<TH1D*>(diffFlowCumulantsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()))); | |
8397 | if(diffFlowCumulants[t][pe][index]) | |
8398 | { | |
8399 | this->SetDiffFlowCumulants(diffFlowCumulants[t][pe][index],t,pe,index); | |
8400 | } else | |
8401 | { | |
8402 | cout<<"WARNING: diffFlowCumulants[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8403 | cout<<"t = "<<t<<endl; | |
8404 | cout<<"pe = "<<pe<<endl; | |
8405 | cout<<"index = "<<index<<endl; | |
8406 | exit(0); | |
8407 | } | |
8408 | } // end of for(Int_t index=0;index<4;index++) | |
1268c371 | 8409 | // Detector bias to differential Q-cumulants: |
8410 | diffFlowDetectorBiasHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Detector bias (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8411 | if(!diffFlowDetectorBiasHistList[t][pe]) | |
8412 | { | |
8413 | cout<<"WARNING: diffFlowDetectorBiasHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8414 | cout<<"t = "<<t<<endl; | |
8415 | cout<<"pe = "<<pe<<endl; | |
8416 | exit(0); | |
8417 | } | |
8418 | for(Int_t index=0;index<4;index++) | |
8419 | { | |
8420 | diffFlowDetectorBias[t][pe][index] = dynamic_cast<TH1D*>(diffFlowDetectorBiasHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowDetectorBiasName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()))); | |
8421 | if(diffFlowDetectorBias[t][pe][index]) | |
8422 | { | |
8423 | this->SetDiffFlowDetectorBias(diffFlowDetectorBias[t][pe][index],t,pe,index); | |
8424 | } else | |
8425 | { | |
8426 | cout<<"WARNING: diffFlowDetectorBias[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8427 | cout<<"t = "<<t<<endl; | |
8428 | cout<<"pe = "<<pe<<endl; | |
8429 | cout<<"index = "<<index<<endl; | |
8430 | exit(0); | |
8431 | } | |
8432 | } // end of for(Int_t index=0;index<4;index++) | |
489d5531 | 8433 | // differential flow estimates from Q-cumulants: |
8434 | diffFlowHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Differential flow (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8435 | if(!diffFlowHistList[t][pe]) | |
8436 | { | |
8437 | cout<<"WARNING: diffFlowHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8438 | cout<<"t = "<<t<<endl; | |
8439 | cout<<"pe = "<<pe<<endl; | |
8440 | exit(0); | |
8441 | } | |
8442 | for(Int_t index=0;index<4;index++) | |
8443 | { | |
8444 | diffFlow[t][pe][index] = dynamic_cast<TH1D*>(diffFlowHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()))); | |
8445 | if(diffFlow[t][pe][index]) | |
8446 | { | |
8447 | this->SetDiffFlow(diffFlow[t][pe][index],t,pe,index); | |
8448 | } else | |
8449 | { | |
8450 | cout<<"WARNING: diffFlow[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8451 | cout<<"t = "<<t<<endl; | |
8452 | cout<<"pe = "<<pe<<endl; | |
8453 | cout<<"index = "<<index<<endl; | |
8454 | exit(0); | |
8455 | } | |
8456 | } // end of for(Int_t index=0;index<4;index++) | |
8457 | // differential covariances: | |
8458 | diffFlowCovariancesHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Covariances of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8459 | if(!diffFlowCovariancesHistList[t][pe]) | |
8460 | { | |
8461 | cout<<"WARNING: diffFlowCovariancesHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8462 | cout<<"t = "<<t<<endl; | |
8463 | cout<<"pe = "<<pe<<endl; | |
8464 | exit(0); | |
8465 | } | |
8466 | for(Int_t covIndex=0;covIndex<5;covIndex++) | |
8467 | { | |
8468 | diffFlowCovariances[t][pe][covIndex] = dynamic_cast<TH1D*>(diffFlowCovariancesHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()))); | |
8469 | if(diffFlowCovariances[t][pe][covIndex]) | |
8470 | { | |
8471 | this->SetDiffFlowCovariances(diffFlowCovariances[t][pe][covIndex],t,pe,covIndex); | |
8472 | } else | |
8473 | { | |
8474 | cout<<"WARNING: diffFlowCovariances[t][pe][covIndex] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8475 | cout<<"t = "<<t<<endl; | |
8476 | cout<<"pe = "<<pe<<endl; | |
8477 | cout<<"covIndex = "<<covIndex<<endl; | |
8478 | exit(0); | |
8479 | } | |
8480 | } // end of for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index | |
8481 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8482 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
8483 | // sum of event weights for reduced correlations: | |
8484 | TList *diffFlowSumOfEventWeightsHistList[2][2][2] = {{{NULL}}}; | |
8485 | TString diffFlowSumOfEventWeightsName = "fDiffFlowSumOfEventWeights"; | |
8486 | diffFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
8487 | TH1D *diffFlowSumOfEventWeights[2][2][2][4] = {{{{NULL}}}}; | |
8488 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
8489 | { | |
8490 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8491 | { | |
8492 | for(Int_t p=0;p<2;p++) // power of event weights is either 1 or 2 | |
8493 | { | |
8494 | diffFlowSumOfEventWeightsHistList[t][pe][p] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Sum of %s event weights (%s, %s)",powerFlag[p].Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8495 | if(!diffFlowSumOfEventWeightsHistList[t][pe][p]) | |
8496 | { | |
8497 | cout<<"WARNING: diffFlowSumOfEventWeightsHistList[t][pe][p] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8498 | cout<<"t = "<<t<<endl; | |
8499 | cout<<"pe = "<<pe<<endl; | |
8500 | cout<<"power = "<<p<<endl; | |
8501 | exit(0); | |
8502 | } | |
8503 | for(Int_t ew=0;ew<4;ew++) // index of reduced correlation | |
8504 | { | |
8505 | diffFlowSumOfEventWeights[t][pe][p][ew] = dynamic_cast<TH1D*>(diffFlowSumOfEventWeightsHistList[t][pe][p]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()))); | |
8506 | if(diffFlowSumOfEventWeights[t][pe][p][ew]) | |
8507 | { | |
8508 | this->SetDiffFlowSumOfEventWeights(diffFlowSumOfEventWeights[t][pe][p][ew],t,pe,p,ew); | |
8509 | } else | |
8510 | { | |
8511 | cout<<"WARNING: diffFlowSumOfEventWeights[t][pe][p][ew] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8512 | cout<<"t = "<<t<<endl; | |
8513 | cout<<"pe = "<<pe<<endl; | |
8514 | cout<<"power = "<<p<<endl; | |
8515 | cout<<"ew = "<<ew<<endl; | |
8516 | exit(0); | |
8517 | } | |
8518 | } | |
8519 | } // end of for(Int_t p=0;p<2;p++) // power of event weights is either 1 or 2 | |
8520 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8521 | } // end of for(Int_t t=0;t<2;t++) // type is RP or POI | |
8522 | // | |
8523 | TList *diffFlowSumOfProductOfEventWeightsHistList[2][2] = {{NULL}}; | |
8524 | TString diffFlowSumOfProductOfEventWeightsName = "fDiffFlowSumOfProductOfEventWeights"; | |
8525 | diffFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
8526 | TH1D *diffFlowSumOfProductOfEventWeights[2][2][8][8] = {{{{NULL}}}}; | |
8527 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
8528 | { | |
8529 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8530 | { | |
8531 | diffFlowSumOfProductOfEventWeightsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Sum of products of event weights (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8532 | if(!diffFlowSumOfProductOfEventWeightsHistList[t][pe]) | |
8533 | { | |
8534 | cout<<"WARNING: diffFlowSumOfProductOfEventWeightsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8535 | cout<<"t = "<<t<<endl; | |
8536 | cout<<"pe = "<<pe<<endl; | |
8537 | exit(0); | |
8538 | } | |
8539 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
8540 | { | |
8541 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
8542 | { | |
8543 | diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = dynamic_cast<TH1D*>(diffFlowSumOfProductOfEventWeightsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()))); | |
8544 | if(diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]) | |
8545 | { | |
8546 | this->SetDiffFlowSumOfProductOfEventWeights(diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2],t,pe,mci1,mci2); | |
8547 | } else | |
8548 | { | |
8549 | cout<<"WARNING: diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8550 | cout<<"t = "<<t<<endl; | |
8551 | cout<<"pe = "<<pe<<endl; | |
8552 | cout<<"mci1 = "<<mci1<<endl; | |
8553 | cout<<"mci2 = "<<mci2<<endl; | |
8554 | exit(0); | |
8555 | } | |
8556 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
8557 | } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
8558 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
8559 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8560 | } // end of for(Int_t t=0;t<2;t++) // type is RP or POI | |
8561 | ||
8562 | } // end void AliFlowAnalysisWithQCumulants::GetPointersForDiffFlowHistograms() | |
8563 | ||
489d5531 | 8564 | //================================================================================================================================ |
8565 | ||
1268c371 | 8566 | void AliFlowAnalysisWithQCumulants::BookEverythingFor2DDifferentialFlow() |
8567 | { | |
8568 | // Book all objects needed for 2D differential flow. | |
8569 | // a) Define flags locally (to be improved: should I promote flags to data members?); | |
8570 | // b) Book e-b-e quantities; | |
8571 | // c) Book 2D profiles; | |
8572 | // d) Book 2D histograms. | |
8573 | ||
8574 | if(!fCalculate2DDiffFlow){return;} | |
8575 | ||
8576 | // a) Define flags locally (to be improved: should I promote flags to data members?): | |
8577 | TString typeFlag[2] = {"RP","POI"}; | |
8578 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
8579 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
8580 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
8581 | ||
8582 | // b) Book e-b-e quantities: | |
8583 | TProfile2D styleRe("typeMultiplePowerRe","typeMultiplePowerRe",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
8584 | TProfile2D styleIm("typeMultiplePowerIm","typeMultiplePowerIm",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
8585 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) | |
8586 | { | |
8587 | for(Int_t m=0;m<4;m++) | |
8588 | { | |
8589 | for(Int_t k=0;k<9;k++) | |
8590 | { | |
8591 | fReRPQ2dEBE[t][m][k] = (TProfile2D*)styleRe.Clone(Form("typeFlag%dmultiple%dpower%dRe",t,m,k)); | |
8592 | fImRPQ2dEBE[t][m][k] = (TProfile2D*)styleIm.Clone(Form("typeFlag%dmultiple%dpower%dIm",t,m,k)); | |
8593 | } | |
8594 | } | |
8595 | } | |
8596 | TProfile2D styleS("typePower","typePower",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
8597 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) | |
8598 | { | |
8599 | for(Int_t k=0;k<9;k++) | |
8600 | { | |
8601 | fs2dEBE[t][k] = (TProfile2D*)styleS.Clone(Form("typeFlag%dpower%d",t,k)); | |
8602 | } | |
8603 | } | |
8604 | ||
8605 | // c) Book 2D profiles: | |
8606 | TString s2DDiffFlowCorrelationsProName = "f2DDiffFlowCorrelationsPro"; | |
8607 | s2DDiffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
8608 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8609 | { | |
8610 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8611 | { | |
8612 | f2DDiffFlowCorrelationsPro[t][rci] = new TProfile2D(Form("%s, %s, %s",s2DDiffFlowCorrelationsProName.Data(),typeFlag[t].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s",s2DDiffFlowCorrelationsProName.Data(),typeFlag[t].Data(),reducedCorrelationIndex[rci].Data()),fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,""); | |
8613 | f2DDiffFlowCorrelationsPro[t][rci]->Sumw2(); | |
8614 | f2DDiffFlowCorrelationsPro[t][rci]->SetXTitle("p_{t}"); | |
8615 | f2DDiffFlowCorrelationsPro[t][rci]->SetYTitle("#eta"); | |
8616 | f2DDiffFlowCorrelationsProList[t]->Add(f2DDiffFlowCorrelationsPro[t][rci]); | |
8617 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
8618 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POIs | |
8619 | ||
8620 | // d) Book 2D histograms: | |
8621 | TString s2DDiffFlowCumulantsName = "f2DDiffFlowCumulants"; | |
8622 | s2DDiffFlowCumulantsName += fAnalysisLabel->Data(); | |
8623 | TString s2DDiffFlowName = "f2DDiffFlow"; | |
8624 | s2DDiffFlowName += fAnalysisLabel->Data(); | |
8625 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8626 | { | |
8627 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8628 | { | |
8629 | // 2D diferential cumulants: | |
8630 | f2DDiffFlowCumulants[t][rci] = new TH2D(Form("%s, %s, %s",s2DDiffFlowCumulantsName.Data(),typeFlag[t].Data(),differentialCumulantIndex[rci].Data()),Form("%s, %s, %s",s2DDiffFlowCumulantsName.Data(),typeFlag[t].Data(),differentialCumulantIndex[rci].Data()),fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
8631 | f2DDiffFlowCumulants[t][rci]->SetXTitle("p_{t}"); | |
8632 | f2DDiffFlowCumulants[t][rci]->SetYTitle("#eta"); | |
8633 | f2DDiffFlowCorrelationsProList[t]->Add(f2DDiffFlowCumulants[t][rci]); // to be improved - moved to another list | |
8634 | // 2D differential flow: | |
8635 | f2DDiffFlow[t][rci] = new TH2D(Form("%s, %s, %s",s2DDiffFlowName.Data(),typeFlag[t].Data(),differentialFlowIndex[rci].Data()),Form("%s, %s, %s",s2DDiffFlowName.Data(),typeFlag[t].Data(),differentialFlowIndex[rci].Data()),fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
8636 | f2DDiffFlow[t][rci]->SetXTitle("p_{t}"); | |
8637 | f2DDiffFlow[t][rci]->SetYTitle("#eta"); | |
8638 | f2DDiffFlowCorrelationsProList[t]->Add(f2DDiffFlow[t][rci]); // to be improved - moved to another list | |
8639 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
8640 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POIs | |
8641 | ||
8642 | } // void AliFlowAnalysisWithQCumulants::BookEverythingFor2DDifferentialFlow() | |
8643 | ||
8644 | //================================================================================================================================ | |
489d5531 | 8645 | |
8646 | void AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow() | |
8647 | { | |
8648 | // Book all histograms and profiles needed for differential flow. | |
1268c371 | 8649 | // a) Book profile to hold all flags for differential flow; |
8650 | // b) Define flags locally (to be improved: should I promote flags to data members?); | |
489d5531 | 8651 | // c) Book e-b-e quantities; |
8652 | // d) Book profiles; | |
8653 | // e) Book histograms holding final results. | |
8654 | ||
1268c371 | 8655 | // a) Book profile to hold all flags for differential flow: |
8656 | TString diffFlowFlagsName = "fDiffFlowFlags"; | |
8657 | diffFlowFlagsName += fAnalysisLabel->Data(); | |
8658 | fDiffFlowFlags = new TProfile(diffFlowFlagsName.Data(),"Flags for differential flow",5,0,5); | |
8659 | fDiffFlowFlags->SetTickLength(-0.01,"Y"); | |
8660 | fDiffFlowFlags->SetMarkerStyle(25); | |
8661 | fDiffFlowFlags->SetLabelSize(0.04,"X"); | |
8662 | fDiffFlowFlags->SetLabelOffset(0.02,"Y"); | |
8663 | fDiffFlowFlags->GetXaxis()->SetBinLabel(1,"Calculate diff. flow"); | |
8664 | fDiffFlowFlags->GetXaxis()->SetBinLabel(2,"Particle weights"); | |
8665 | fDiffFlowFlags->GetXaxis()->SetBinLabel(3,"Event weights"); | |
8666 | fDiffFlowFlags->GetXaxis()->SetBinLabel(4,"Correct for NUA"); | |
8667 | fDiffFlowFlags->GetXaxis()->SetBinLabel(5,"Calculate 2D diff. flow"); | |
8668 | fDiffFlowList->Add(fDiffFlowFlags); | |
8669 | ||
8670 | if(!fCalculateDiffFlow){return;} | |
8671 | ||
8672 | // b) Define flags locally (to be improved: should I promote flags to data members?): | |
489d5531 | 8673 | TString typeFlag[2] = {"RP","POI"}; |
8674 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
8675 | TString powerFlag[2] = {"linear","quadratic"}; | |
8676 | TString sinCosFlag[2] = {"sin","cos"}; | |
8677 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
8678 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
8679 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
b40a910e | 8680 | TString reducedSquaredCorrelationIndex[4] = {"<2'>^{2}","<4'>^{2}","<6'>^{2}","<8'>^{2}"}; |
489d5531 | 8681 | TString mixedCorrelationIndex[8] = {"<2>","<2'>","<4>","<4'>","<6>","<6'>","<8>","<8'>"}; |
8682 | TString covarianceName[5] = {"Cov(<2>,<2'>)","Cov(<2>,<4'>)","Cov(<4>,<2'>)","Cov(<4>,<4'>)","Cov(<2'>,<4'>)"}; | |
8683 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
8684 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
8685 | Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
1268c371 | 8686 | |
489d5531 | 8687 | // c) Book e-b-e quantities: |
8688 | // Event-by-event r_{m*n,k}(pt,eta), p_{m*n,k}(pt,eta) and q_{m*n,k}(pt,eta) | |
8689 | // Explanantion of notation: | |
8690 | // 1.) n is harmonic, m is multiple of harmonic; | |
8691 | // 2.) k is power of particle weight; | |
8692 | // 3.) r_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for RPs in particular (pt,eta) bin (i-th RP is weighted with w_i^k); | |
8693 | // 4.) p_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for POIs in particular (pt,eta) bin | |
8694 | // (if i-th POI is also RP, than it is weighted with w_i^k); | |
8695 | // 5.) q_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for particles which are both RPs and POIs in particular (pt,eta) bin | |
8696 | // (i-th RP&&POI is weighted with w_i^k) | |
8697 | ||
8698 | // 1D: | |
8699 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP && POI ) | |
8700 | { | |
8701 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8702 | { | |
8703 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
8704 | { | |
8705 | for(Int_t k=0;k<9;k++) // power of particle weight | |
8706 | { | |
8707 | fReRPQ1dEBE[t][pe][m][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%dpower%dRe",t,pe,m,k), | |
8708 | Form("TypeFlag%dpteta%dmultiple%dpower%dRe",t,pe,m,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8709 | fImRPQ1dEBE[t][pe][m][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%dpower%dIm",t,pe,m,k), | |
8710 | Form("TypeFlag%dpteta%dmultiple%dpower%dIm",t,pe,m,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8711 | } | |
8712 | } | |
8713 | } | |
8714 | } | |
8715 | // to be improved (add explanation of fs1dEBE[t][pe][k]): | |
8716 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) | |
8717 | { | |
8718 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8719 | { | |
8720 | for(Int_t k=0;k<9;k++) // power of particle weight | |
8721 | { | |
8722 | fs1dEBE[t][pe][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%d",t,pe,k), | |
8723 | Form("TypeFlag%dpteta%dmultiple%d",t,pe,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8724 | } | |
8725 | } | |
8726 | } | |
8727 | // correction terms for nua: | |
8728 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
8729 | { | |
8730 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8731 | { | |
8732 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
8733 | { | |
8734 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
8735 | { | |
8736 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti] = new TH1D(Form("typeFlag%d pteta%d sincos%d cti%d",t,pe,sc,cti), | |
8737 | Form("typeFlag%d pteta%d sincos%d cti%d",t,pe,sc,cti),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8738 | } | |
8739 | } | |
8740 | } | |
8741 | } | |
489d5531 | 8742 | // reduced correlations e-b-e: |
8743 | TString diffFlowCorrelationsEBEName = "fDiffFlowCorrelationsEBE"; | |
8744 | diffFlowCorrelationsEBEName += fAnalysisLabel->Data(); | |
8745 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8746 | { | |
8747 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8748 | { | |
8749 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8750 | { | |
8751 | fDiffFlowCorrelationsEBE[t][pe][rci] = new TH1D(Form("%s, %s, %s, %s",diffFlowCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8752 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
8753 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8754 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
8755 | // event weights for reduced correlations e-b-e: | |
8756 | TString diffFlowEventWeightsForCorrelationsEBEName = "fDiffFlowEventWeightsForCorrelationsEBE"; | |
8757 | diffFlowEventWeightsForCorrelationsEBEName += fAnalysisLabel->Data(); | |
8758 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8759 | { | |
8760 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8761 | { | |
8762 | for(Int_t rci=0;rci<4;rci++) // event weight for reduced correlation index | |
8763 | { | |
8764 | fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci] = new TH1D(Form("%s, %s, %s, eW for %s",diffFlowEventWeightsForCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, eW for %s",diffFlowEventWeightsForCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8765 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
8766 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8767 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
8768 | ||
8769 | // d) Book profiles; | |
8770 | // reduced correlations: | |
8771 | TString diffFlowCorrelationsProName = "fDiffFlowCorrelationsPro"; | |
8772 | diffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
b40a910e | 8773 | // reduced squared correlations: |
8774 | TString diffFlowSquaredCorrelationsProName = "fDiffFlowSquaredCorrelationsPro"; | |
8775 | diffFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
489d5531 | 8776 | // corrections terms: |
8777 | TString diffFlowCorrectionTermsForNUAProName = "fDiffFlowCorrectionTermsForNUAPro"; | |
8778 | diffFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
b40a910e | 8779 | // reduced correlations: |
489d5531 | 8780 | for(Int_t t=0;t<2;t++) // type: RP or POI |
8781 | { | |
8782 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8783 | { | |
8784 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8785 | { | |
489d5531 | 8786 | fDiffFlowCorrelationsPro[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe],"s"); |
b40a910e | 8787 | fDiffFlowCorrelationsPro[t][pe][rci]->Sumw2(); |
489d5531 | 8788 | fDiffFlowCorrelationsPro[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data()); |
8789 | fDiffFlowCorrelationsProList[t][pe]->Add(fDiffFlowCorrelationsPro[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations) | |
8790 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
8791 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8792 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
b40a910e | 8793 | // reduced squared correlations: |
8794 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8795 | { | |
8796 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8797 | { | |
8798 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8799 | { | |
8800 | fDiffFlowSquaredCorrelationsPro[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowSquaredCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedSquaredCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowSquaredCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedSquaredCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe],"s"); | |
8801 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->Sumw2(); | |
8802 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data()); | |
8803 | fDiffFlowCorrelationsProList[t][pe]->Add(fDiffFlowSquaredCorrelationsPro[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations) | |
8804 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
8805 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8806 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
489d5531 | 8807 | // correction terms for nua: |
8808 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
8809 | { | |
8810 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8811 | { | |
8812 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
8813 | { | |
8814 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
8815 | { | |
8816 | fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = new TProfile(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8817 | fDiffFlowCorrectionsProList[t][pe]->Add(fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]); | |
8818 | } | |
8819 | } | |
8820 | } | |
8821 | } | |
8822 | // e) Book histograms holding final results. | |
8823 | // reduced correlations: | |
8824 | TString diffFlowCorrelationsHistName = "fDiffFlowCorrelationsHist"; | |
8825 | diffFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
8826 | // corrections terms: | |
8827 | TString diffFlowCorrectionTermsForNUAHistName = "fDiffFlowCorrectionTermsForNUAHist"; | |
8828 | diffFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
8829 | // differential covariances: | |
8830 | TString diffFlowCovariancesName = "fDiffFlowCovariances"; | |
8831 | diffFlowCovariancesName += fAnalysisLabel->Data(); | |
8832 | // differential Q-cumulants: | |
8833 | TString diffFlowCumulantsName = "fDiffFlowCumulants"; | |
8834 | diffFlowCumulantsName += fAnalysisLabel->Data(); | |
1268c371 | 8835 | // Detector bias to differential Q-cumulants: |
8836 | TString diffFlowDetectorBiasName = "fDiffFlowDetectorBias"; | |
8837 | diffFlowDetectorBiasName += fAnalysisLabel->Data(); | |
489d5531 | 8838 | // differential flow: |
8839 | TString diffFlowName = "fDiffFlow"; | |
8840 | diffFlowName += fAnalysisLabel->Data(); | |
8841 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8842 | { | |
8843 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8844 | { | |
8845 | for(Int_t index=0;index<4;index++) | |
8846 | { | |
8847 | // reduced correlations: | |
8848 | fDiffFlowCorrelationsHist[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8849 | fDiffFlowCorrelationsHist[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
8850 | fDiffFlowCorrelationsHistList[t][pe]->Add(fDiffFlowCorrelationsHist[t][pe][index]); | |
8851 | // differential Q-cumulants: | |
8852 | fDiffFlowCumulants[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8853 | fDiffFlowCumulants[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
8854 | fDiffFlowCumulantsHistList[t][pe]->Add(fDiffFlowCumulants[t][pe][index]); | |
1268c371 | 8855 | // Detector bias to differential Q-cumulants: |
8856 | fDiffFlowDetectorBias[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowDetectorBiasName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowDetectorBiasName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8857 | fDiffFlowDetectorBias[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
8858 | fDiffFlowDetectorBias[t][pe][index]->SetTitle(Form("#frac{corrected}{measured} %s",differentialCumulantIndex[index].Data())); | |
8859 | fDiffFlowDetectorBiasHistList[t][pe]->Add(fDiffFlowDetectorBias[t][pe][index]); | |
489d5531 | 8860 | // differential flow estimates from Q-cumulants: |
8861 | fDiffFlow[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8862 | fDiffFlow[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
8863 | fDiffFlowHistList[t][pe]->Add(fDiffFlow[t][pe][index]); | |
8864 | } // end of for(Int_t index=0;index<4;index++) | |
8865 | for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index | |
8866 | { | |
8867 | // differential covariances: | |
8868 | fDiffFlowCovariances[t][pe][covIndex] = new TH1D(Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()),Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8869 | fDiffFlowCovariances[t][pe][covIndex]->SetXTitle(ptEtaFlag[pe].Data()); | |
8870 | fDiffFlowCovariancesHistList[t][pe]->Add(fDiffFlowCovariances[t][pe][covIndex]); | |
8871 | } // end of for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index | |
8872 | // products of both types of correlations: | |
8873 | TString diffFlowProductOfCorrelationsProName = "fDiffFlowProductOfCorrelationsPro"; | |
8874 | diffFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
8875 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
8876 | { | |
8877 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
8878 | { | |
8879 | fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = new TProfile(Form("%s, %s, %s, %s, %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),Form("%s, %s, %s, %s #times %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8880 | fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]->SetXTitle(ptEtaFlag[pe].Data()); | |
8881 | fDiffFlowProductOfCorrelationsProList[t][pe]->Add(fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]); | |
8882 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
8883 | } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
8884 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
8885 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8886 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
8887 | // sums of event weights for reduced correlations: | |
8888 | TString diffFlowSumOfEventWeightsName = "fDiffFlowSumOfEventWeights"; | |
8889 | diffFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
8890 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
8891 | { | |
8892 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8893 | { | |
8894 | for(Int_t p=0;p<2;p++) // power of weights is either 1 or 2 | |
8895 | { | |
8896 | for(Int_t ew=0;ew<4;ew++) // index of reduced correlation | |
8897 | { | |
8898 | fDiffFlowSumOfEventWeights[t][pe][p][ew] = new TH1D(Form("%s, %s, %s, %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()),Form("%s, %s, %s, power = %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8899 | fDiffFlowSumOfEventWeights[t][pe][p][ew]->SetXTitle(ptEtaFlag[pe].Data()); | |
8900 | fDiffFlowSumOfEventWeightsHistList[t][pe][p]->Add(fDiffFlowSumOfEventWeights[t][pe][p][ew]); // to be improved (add dedicated list to hold all this) | |
8901 | } | |
8902 | } | |
8903 | } | |
8904 | } | |
8905 | // sum of products of event weights for both types of correlations: | |
8906 | TString diffFlowSumOfProductOfEventWeightsName = "fDiffFlowSumOfProductOfEventWeights"; | |
8907 | diffFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
8908 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
8909 | { | |
8910 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8911 | { | |
8912 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
8913 | { | |
8914 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
8915 | { | |
8916 | fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = new TH1D(Form("%s, %s, %s, %s, %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),Form("%s, %s, %s, %s #times %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8917 | fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]->SetXTitle(ptEtaFlag[pe].Data()); | |
8918 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]->Add(fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]); | |
8919 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
8920 | } | |
8921 | } | |
8922 | } | |
8923 | } | |
8924 | // correction terms for nua: | |
8925 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
8926 | { | |
8927 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8928 | { | |
8929 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
8930 | { | |
8931 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
8932 | { | |
8933 | fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = new TH1D(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8934 | fDiffFlowCorrectionsHistList[t][pe]->Add(fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]); | |
8935 | } | |
8936 | } | |
8937 | } | |
8938 | } | |
8939 | ||
8940 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow() | |
8941 | ||
489d5531 | 8942 | //================================================================================================================================ |
8943 | ||
489d5531 | 8944 | void AliFlowAnalysisWithQCumulants::CalculateQcumulantsCorrectedForNUAIntFlow() |
8945 | { | |
8946 | // Calculate generalized Q-cumulants (cumulants corrected for non-unifom acceptance). | |
8947 | ||
b92ea2b9 | 8948 | // Isotropic cumulants: |
8949 | Double_t QC2 = fIntFlowQcumulants->GetBinContent(1); | |
8950 | Double_t QC2Error = fIntFlowQcumulants->GetBinError(1); | |
8951 | Double_t QC4 = fIntFlowQcumulants->GetBinContent(2); | |
8952 | Double_t QC4Error = fIntFlowQcumulants->GetBinError(2); | |
8953 | //Double_t QC6 = fIntFlowQcumulants->GetBinContent(3); | |
8954 | //Double_t QC6Error = fIntFlowQcumulants->GetBinError(3); | |
8955 | //Double_t QC8 = fIntFlowQcumulants->GetBinContent(4); | |
8956 | //Double_t QC8Error = fIntFlowQcumulants->GetBinError(4); | |
8957 | ||
8958 | // Measured 2-, 4-, 6- and 8-particle correlations: | |
489d5531 | 8959 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> |
b92ea2b9 | 8960 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <<2>> |
489d5531 | 8961 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> |
b92ea2b9 | 8962 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <<4>> |
489d5531 | 8963 | //Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> |
489d5531 | 8964 | //Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <<6>> |
b92ea2b9 | 8965 | //Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> |
489d5531 | 8966 | //Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <<8>> |
b92ea2b9 | 8967 | |
8968 | // Non-isotropic terms: | |
8969 | Double_t c1 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1); // <<cos(n*phi1)>> | |
8970 | Double_t c1Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(1); // statistical error of <<cos(n*phi1)>> | |
8971 | Double_t c2 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2); // <<cos(n*(phi1+phi2))>> | |
8972 | Double_t c2Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(2); // statistical error of <<cos(n*(phi1+phi2))>> | |
8973 | Double_t c3 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(3); // <<cos(n*(phi1-phi2-phi3))>> | |
8974 | Double_t c3Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(3); // statistical error of <<cos(n*(phi1-phi2-phi3))>> | |
8975 | Double_t s1 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1); // <<sin(n*phi1)>> | |
8976 | Double_t s1Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(1); // statistical error of <<sin(n*phi1)>> | |
8977 | Double_t s2 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2); // <<sin(n*(phi1+phi2))>> | |
8978 | Double_t s2Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(2); // statistical error of <<sin(n*(phi1+phi2))>> | |
8979 | Double_t s3 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(3); // <<sin(n*(phi1-phi2-phi3))>> | |
8980 | Double_t s3Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(3); // statistical error of <<sin(n*(phi1-phi2-phi3))>> | |
8981 | ||
8982 | // Shortcuts: | |
8983 | Double_t a1 = 2.*pow(c1,2.)+2.*pow(s1,2.)-two; | |
8984 | Double_t a2 = 6.*pow(c1,3.)-2.*c1*c2+c3+6.*c1*pow(s1,2.)-2.*s1*s2-4.*c1*two; | |
8985 | Double_t a3 = 2.*pow(s1,2.)-2.*pow(c1,2.)+c2; | |
8986 | Double_t a4 = 6.*pow(s1,3.)+6.*pow(c1,2.)*s1+2.*c2*s1-2.*c1*s2-s3-4.*s1*two; | |
8987 | Double_t a5 = 4.*c1*s1-s2; | |
8988 | ||
8989 | // Covariances (including weight dependent prefactor): | |
8e1cefdd | 8990 | Double_t wCov1 = 0.; // w*Cov(<2>,<cos(phi)) |
8991 | Double_t wCov2 = 0.; // w*Cov(<2>,<sin(phi)) | |
8992 | Double_t wCov3 = 0.; // w*Cov(<cos(phi),<sin(phi)) | |
8993 | Double_t wCov4 = 0.; // w*Cov(<2>,<4>) | |
8994 | Double_t wCov5 = 0.; // w*Cov(<2>,<cos(#phi_{1}+#phi_{2})>) | |
8995 | Double_t wCov6 = 0.; // w*Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
8996 | Double_t wCov7 = 0.; // w*Cov(<2>,<sin(#phi_{1}+#phi_{2})>) | |
8997 | Double_t wCov8 = 0.; // w*Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
8998 | Double_t wCov9 = 0.; // w*Cov(<4>,<cos(#phi)> | |
8999 | Double_t wCov10 = 0.; // w*Cov(<4>,<cos(#phi_{1}+#phi_{2})>) | |
9000 | Double_t wCov11 = 0.; // w*Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9001 | Double_t wCov12 = 0.; // w*Cov(<4>,<sin(#phi)> | |
9002 | Double_t wCov13 = 0.; // w*Cov(<4>,<sin(#phi_{1}+#phi_{2})>) | |
9003 | Double_t wCov14 = 0.; // w*Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9004 | Double_t wCov15 = 0.; // w*Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
9005 | Double_t wCov16 = 0.; // w*Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9006 | Double_t wCov17 = 0.; // w*Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
9007 | Double_t wCov18 = 0.; // w*Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9008 | Double_t wCov19 = 0.; // w*Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9009 | Double_t wCov20 = 0.; // w*Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
9010 | Double_t wCov21 = 0.; // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>) | |
9011 | Double_t wCov22 = 0.; // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9012 | Double_t wCov23 = 0.; // w*Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9013 | Double_t wCov24 = 0.; // w*Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9014 | Double_t wCov25 = 0.; // w*Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>) | |
9015 | Double_t wCov26 = 0.; // w*Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
9016 | Double_t wCov27 = 0.; // w*Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9017 | Double_t wCov28 = 0.; // w*Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9018 | if(!fForgetAboutCovariances) | |
9019 | { | |
9020 | wCov1 = fIntFlowCovariancesNUA->GetBinContent(1); // w*Cov(<2>,<cos(phi)) | |
9021 | wCov2 = fIntFlowCovariancesNUA->GetBinContent(2); // w*Cov(<2>,<sin(phi)) | |
9022 | wCov3 = fIntFlowCovariancesNUA->GetBinContent(3); // w*Cov(<cos(phi),<sin(phi)) | |
9023 | wCov4 = fIntFlowCovariances->GetBinContent(1); // w*Cov(<2>,<4>) | |
9024 | wCov5 = fIntFlowCovariancesNUA->GetBinContent(4); // w*Cov(<2>,<cos(#phi_{1}+#phi_{2})>) | |
9025 | wCov6 = fIntFlowCovariancesNUA->GetBinContent(6); // w*Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9026 | wCov7 = fIntFlowCovariancesNUA->GetBinContent(5); // w*Cov(<2>,<sin(#phi_{1}+#phi_{2})>) | |
9027 | wCov8 = fIntFlowCovariancesNUA->GetBinContent(7); // w*Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9028 | wCov9 = fIntFlowCovariancesNUA->GetBinContent(8); // w*Cov(<4>,<cos(#phi)> | |
9029 | wCov10 = fIntFlowCovariancesNUA->GetBinContent(10); // w*Cov(<4>,<cos(#phi_{1}+#phi_{2})>) | |
9030 | wCov11 = fIntFlowCovariancesNUA->GetBinContent(12); // w*Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9031 | wCov12 = fIntFlowCovariancesNUA->GetBinContent(9); // w*Cov(<4>,<sin(#phi)> | |
9032 | wCov13 = fIntFlowCovariancesNUA->GetBinContent(11); // w*Cov(<4>,<sin(#phi_{1}+#phi_{2})>) | |
9033 | wCov14 = fIntFlowCovariancesNUA->GetBinContent(13); // w*Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9034 | wCov15 = fIntFlowCovariancesNUA->GetBinContent(14); // w*Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
9035 | wCov16 = fIntFlowCovariancesNUA->GetBinContent(16); // w*Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9036 | wCov17 = fIntFlowCovariancesNUA->GetBinContent(15); // w*Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
9037 | wCov18 = fIntFlowCovariancesNUA->GetBinContent(17); // w*Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9038 | wCov19 = fIntFlowCovariancesNUA->GetBinContent(23); // w*Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9039 | wCov20 = fIntFlowCovariancesNUA->GetBinContent(18); // w*Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
9040 | wCov21 = fIntFlowCovariancesNUA->GetBinContent(22); // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>) | |
9041 | wCov22 = fIntFlowCovariancesNUA->GetBinContent(24); // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9042 | wCov23 = fIntFlowCovariancesNUA->GetBinContent(20); // w*Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9043 | wCov24 = fIntFlowCovariancesNUA->GetBinContent(25); // w*Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9044 | wCov25 = fIntFlowCovariancesNUA->GetBinContent(27); // w*Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>) | |
9045 | wCov26 = fIntFlowCovariancesNUA->GetBinContent(19); // w*Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
9046 | wCov27 = fIntFlowCovariancesNUA->GetBinContent(21); // w*Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9047 | wCov28 = fIntFlowCovariancesNUA->GetBinContent(26); // w*Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9048 | } // end of if(!fForgetAboutCovariances) | |
9049 | ||
b92ea2b9 | 9050 | // Calculating generalized QC{2}: |
9051 | // Generalized QC{2}: | |
9052 | Double_t gQC2 = two - pow(c1,2.) - pow(s1,2.); | |
9053 | if(fApplyCorrectionForNUA){fIntFlowQcumulants->SetBinContent(1,gQC2);} | |
9054 | // Statistical error of generalized QC{2}: | |
9055 | Double_t gQC2ErrorSquared = pow(twoError,2.)+4.*pow(c1,2.)*pow(c1Error,2.) | |
9056 | + 4.*pow(s1,2.)*pow(s1Error,2.) | |
9057 | - 4*c1*wCov1-4*s1*wCov2 | |
9058 | + 8.*c1*s1*wCov3; | |
9059 | // Store ratio of error squared - with/without NUA terms: | |
9060 | Double_t ratioErrorSquaredQC2 = 0.; | |
9061 | if(fIntFlowQcumulants->GetBinError(1)>0.) | |
9062 | { | |
9063 | ratioErrorSquaredQC2 = (gQC2ErrorSquared/pow(fIntFlowQcumulants->GetBinError(1),2.)); | |
9064 | fIntFlowQcumulantsErrorSquaredRatio->SetBinContent(1,ratioErrorSquaredQC2); | |
9065 | } | |
9066 | // If enabled, store error by including non-isotropic terms: | |
b77b6434 | 9067 | if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 9068 | { |
9069 | if(gQC2ErrorSquared>=0.) | |
9070 | { | |
9071 | fIntFlowQcumulants->SetBinError(1,pow(gQC2ErrorSquared,0.5)); | |
9072 | } else | |
9073 | { | |
9074 | fIntFlowQcumulants->SetBinError(1,0.); | |
9075 | cout<<endl; | |
9076 | cout<<" WARNING (QC): Statistical error of generalized QC{2} is imaginary !!!!"<<endl; | |
9077 | cout<<endl; | |
9078 | } | |
b77b6434 | 9079 | } // end of if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 9080 | // Quantify detector bias to QC{2}: |
9081 | if(TMath::Abs(QC2)>0.) | |
9082 | { | |
9083 | fIntFlowDetectorBias->SetBinContent(1,gQC2/QC2); | |
9084 | if(QC2Error>0.) | |
9085 | { | |
9086 | Double_t errorSquared = gQC2ErrorSquared/pow(QC2,2.)+pow(gQC2,2.)*pow(QC2Error,2.)/pow(QC2,4.); | |
9087 | if(errorSquared>0.) | |
9088 | { | |
9089 | fIntFlowDetectorBias->SetBinError(1,pow(errorSquared,0.5)); | |
9090 | } | |
9091 | } | |
9092 | } // end of if(TMath::Abs(QC2)>0.) | |
9093 | ||
9094 | // Calculating generalized QC{4}: | |
9095 | // Generalized QC{4}: | |
9096 | Double_t gQC4 = four-2.*pow(two,2.) | |
9097 | - 4.*c1*c3+4.*s1*s3-pow(c2,2.)-pow(s2,2.) | |
9098 | + 4.*c2*(pow(c1,2.)-pow(s1,2.))+8.*s2*s1*c1 | |
9099 | + 8.*two*(pow(c1,2.)+pow(s1,2.))-6.*pow((pow(c1,2.)+pow(s1,2.)),2.); | |
9100 | if(fApplyCorrectionForNUA){fIntFlowQcumulants->SetBinContent(2,gQC4);} | |
9101 | // Statistical error of generalized QC{4}: | |
9102 | Double_t gQC4ErrorSquared = 16.*pow(a1,2.)*pow(twoError,2.)+pow(fourError,2.)+16.*pow(a2,2.)*pow(c1Error,2.) | |
9103 | + 4.*pow(a3,2.)*pow(c2Error,2.)+16.*pow(c1,2.)*pow(c3Error,2.) | |
9104 | + 16.*pow(a4,2.)*pow(s1Error,2.)+4.*pow(a5,2.)*pow(s2Error,2.) | |
9105 | + 16.*pow(s1,2.)*pow(s3Error,2.)+8.*a1*wCov4-32.*a1*a2*wCov1 | |
9106 | - 16.*a3*a1*wCov5-32.*c1*a1*wCov6-32.*a1*a4*wCov2+16.*a5*a1*wCov7 | |
9107 | + 32.*s1*a1*wCov8-8.*a2*wCov9-4.*a3*wCov10-8.*c1*wCov11-8.*a4*wCov12 | |
9108 | + 4.*a5*wCov13+8.*s1*wCov14+16.*a3*a2*wCov15+32.*c1*a2*wCov16+32.*a2*a4*wCov3 | |
9109 | - 16.*a5*a2*wCov17-32.*s1*a2*wCov18+16.*c1*a3*wCov19+16.*a3*a4*wCov20 | |
9110 | - 8.*a3*a5*wCov21-16.*s1*a3*wCov22+32.*c1*a4*wCov23-16.*c1*a5*wCov24 | |
9111 | - 32.*c1*s1*wCov25-16.*a5*a4*wCov26-32.*s1*a4*wCov27+16.*s1*a5*wCov28; | |
9112 | // Store ratio of error squared - with/without NUA terms: | |
9113 | Double_t ratioErrorSquaredQC4 = 0.; | |
9114 | if(fIntFlowQcumulants->GetBinError(2)>0.) | |
9115 | { | |
9116 | ratioErrorSquaredQC4 = (gQC4ErrorSquared/pow(fIntFlowQcumulants->GetBinError(2),2.)); | |
9117 | fIntFlowQcumulantsErrorSquaredRatio->SetBinContent(2,ratioErrorSquaredQC4); | |
9118 | } | |
b77b6434 | 9119 | if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 9120 | { |
9121 | if(gQC4ErrorSquared>=0.) | |
9122 | { | |
9123 | fIntFlowQcumulants->SetBinError(2,pow(gQC4ErrorSquared,0.5)); | |
9124 | } else | |
9125 | { | |
9126 | fIntFlowQcumulants->SetBinError(2,0.); | |
9127 | cout<<endl; | |
9128 | cout<<" WARNING (QC): Statistical error of generalized QC{4} is imaginary !!!!"<<endl; | |
9129 | cout<<endl; | |
9130 | } | |
b77b6434 | 9131 | } // end of if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 9132 | // Quantify detector bias to QC{4}: |
9133 | if(TMath::Abs(QC4)>0.) | |
9134 | { | |
9135 | fIntFlowDetectorBias->SetBinContent(2,gQC4/QC4); | |
9136 | if(QC4Error>0.) | |
9137 | { | |
9138 | Double_t errorSquared = gQC4ErrorSquared/pow(QC4,2.)+pow(gQC4,2.)*pow(QC4Error,2.)/pow(QC4,4.); | |
9139 | if(errorSquared>0.) | |
9140 | { | |
9141 | fIntFlowDetectorBias->SetBinError(2,pow(errorSquared,0.5)); | |
9142 | } | |
9143 | } | |
9144 | } // end of if(TMath::Abs(QC4)>0.) | |
489d5531 | 9145 | |
b92ea2b9 | 9146 | |
9147 | // .... to be improved (continued for 6th and 8th order) .... | |
9148 | ||
9149 | ||
2001bc3a | 9150 | // versus multiplicity: |
b77b6434 | 9151 | if(fCalculateCumulantsVsM) // to be improved - propagate error for nua terms vs M |
2001bc3a | 9152 | { |
9153 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) | |
b77b6434 | 9154 | Double_t value[4] = {0.}; // QCs vs M |
9155 | Double_t error[4] = {0.}; // error of QCs vs M | |
9156 | Double_t dSum1[4] = {0.}; // sum value_i/(error_i)^2 | |
9157 | Double_t dSum2[4] = {0.}; // sum 1/(error_i)^2 | |
2001bc3a | 9158 | for(Int_t b=1;b<=nBins;b++) |
9159 | { | |
b92ea2b9 | 9160 | // Measured correlations: |
2001bc3a | 9161 | two = fIntFlowCorrelationsVsMHist[0]->GetBinContent(b); // <<2>> vs M |
9162 | four = fIntFlowCorrelationsVsMHist[1]->GetBinContent(b); // <<4>> vs M | |
b92ea2b9 | 9163 | // Isotropic cumulants: |
9164 | QC2 = two; | |
9165 | QC4 = four-2.*pow(two,2.); | |
9166 | // Non-isotropic terms: | |
9167 | c1 = fIntFlowCorrectionTermsForNUAVsMPro[1][0]->GetBinContent(b); // <<cos(n*phi1)>> | |
9168 | c2 = fIntFlowCorrectionTermsForNUAVsMPro[1][1]->GetBinContent(b); // <<cos(n*(phi1+phi2))>> | |
9169 | c3 = fIntFlowCorrectionTermsForNUAVsMPro[1][2]->GetBinContent(b); // <<cos(n*(phi1-phi2-phi3))>> | |
9170 | s1 = fIntFlowCorrectionTermsForNUAVsMPro[0][0]->GetBinContent(b); // <<sin(n*phi1)>> | |
9171 | s2 = fIntFlowCorrectionTermsForNUAVsMPro[0][1]->GetBinContent(b); // <<sin(n*(phi1+phi2))>> | |
9172 | s3 = fIntFlowCorrectionTermsForNUAVsMPro[0][2]->GetBinContent(b); // <<sin(n*(phi1-phi2-phi3))>> | |
9173 | // Generalized QC{2} vs M: | |
9174 | gQC2 = two - pow(c1,2.) - pow(s1,2.); | |
b77b6434 | 9175 | if(fApplyCorrectionForNUAVsM){fIntFlowQcumulantsVsM[0]->SetBinContent(b,gQC2);} |
b92ea2b9 | 9176 | // Generalized QC{4} vs M: |
9177 | gQC4 = four-2.*pow(two,2.) | |
9178 | - 4.*c1*c3+4.*s1*s3-pow(c2,2.)-pow(s2,2.) | |
9179 | + 4.*c2*(pow(c1,2.)-pow(s1,2.))+8.*s2*s1*c1 | |
9180 | + 8.*two*(pow(c1,2.)+pow(s1,2.))-6.*pow((pow(c1,2.)+pow(s1,2.)),2.); | |
b77b6434 | 9181 | if(fApplyCorrectionForNUAVsM){fIntFlowQcumulantsVsM[1]->SetBinContent(b,gQC4);} |
b92ea2b9 | 9182 | // Detector bias vs M: |
9183 | if(TMath::Abs(QC2)>0.) | |
9184 | { | |
9185 | fIntFlowDetectorBiasVsM[0]->SetBinContent(b,gQC2/QC2); | |
9186 | } // end of if(TMath::Abs(QC2)>0.) | |
9187 | if(TMath::Abs(QC4)>0.) | |
9188 | { | |
9189 | fIntFlowDetectorBiasVsM[1]->SetBinContent(b,gQC4/QC4); | |
b77b6434 | 9190 | } // end of if(TMath::Abs(QC4)>0.) |
9191 | // Rebin in M: | |
9192 | for(Int_t co=0;co<4;co++) | |
9193 | { | |
9194 | value[co] = fIntFlowQcumulantsVsM[co]->GetBinContent(b); | |
9195 | error[co] = fIntFlowQcumulantsVsM[co]->GetBinError(b); | |
9196 | if(error[co]>0.) | |
9197 | { | |
9198 | dSum1[co]+=value[co]/(error[co]*error[co]); | |
9199 | dSum2[co]+=1./(error[co]*error[co]); | |
9200 | } | |
9201 | } // end of for(Int_t co=0;co<4;co++) | |
9202 | } // end of for(Int_t b=1;b<=nBins;b++) | |
9203 | // Store rebinned Q-cumulants: | |
9204 | if(fApplyCorrectionForNUAVsM) | |
9205 | { | |
9206 | for(Int_t co=0;co<4;co++) | |
9207 | { | |
9208 | if(dSum2[co]>0.) | |
9209 | { | |
9210 | fIntFlowQcumulantsRebinnedInM->SetBinContent(co+1,dSum1[co]/dSum2[co]); | |
9211 | fIntFlowQcumulantsRebinnedInM->SetBinError(co+1,pow(1./dSum2[co],0.5)); | |
9212 | } | |
9213 | } // end of for(Int_t co=0;co<4;co++) | |
9214 | } // end of if(fApplyCorrectionForNUAVsM) | |
9215 | } // end of if(fCalculateCumulantsVsM) | |
2001bc3a | 9216 | |
489d5531 | 9217 | } // end of void AliFlowAnalysisWithQCumulants::CalculateQcumulantsCorrectedForNUAIntFlow() |
0328db2d | 9218 | |
489d5531 | 9219 | //================================================================================================================================ |
9220 | ||
489d5531 | 9221 | void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUAIntFlow() |
9222 | { | |
0328db2d | 9223 | // From profile fIntFlowCorrectionTermsForNUAPro[sc] access measured correction terms for NUA |
489d5531 | 9224 | // and their spread, correctly calculate the statistical errors and store the final |
0328db2d | 9225 | // results and statistical errors for correction terms for NUA in histogram fIntFlowCorrectionTermsForNUAHist[sc]. |
489d5531 | 9226 | // |
9227 | // Remark: Statistical error of correction temrs is calculated as: | |
9228 | // | |
9229 | // statistical error = termA * spread * termB: | |
9230 | // termA = sqrt{sum_{i=1}^{N} w^2}/(sum_{i=1}^{N} w) | |
9231 | // termB = 1/sqrt(1-termA^2) | |
9232 | ||
b92ea2b9 | 9233 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved - promore this to data member? |
9234 | TString nonisotropicTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4 | |
9235 | ||
489d5531 | 9236 | for(Int_t sc=0;sc<2;sc++) // sin or cos correction terms |
9237 | { | |
b92ea2b9 | 9238 | for(Int_t ci=1;ci<=4;ci++) // correction term index (to be improved - hardwired 4) |
489d5531 | 9239 | { |
9240 | Double_t correction = fIntFlowCorrectionTermsForNUAPro[sc]->GetBinContent(ci); | |
0328db2d | 9241 | Double_t spread = fIntFlowCorrectionTermsForNUAPro[sc]->GetBinError(ci); |
9242 | Double_t sumOfLinearEventWeights = fIntFlowSumOfEventWeightsNUA[sc][0]->GetBinContent(ci); | |
9243 | Double_t sumOfQuadraticEventWeights = fIntFlowSumOfEventWeightsNUA[sc][1]->GetBinContent(ci); | |
9244 | Double_t termA = 0.; | |
9245 | Double_t termB = 0.; | |
b92ea2b9 | 9246 | if(TMath::Abs(sumOfLinearEventWeights)>1.e-44) |
0328db2d | 9247 | { |
9248 | termA = pow(sumOfQuadraticEventWeights,0.5)/sumOfLinearEventWeights; | |
9249 | } else | |
9250 | { | |
b92ea2b9 | 9251 | cout<<" WARNING (QC): sumOfLinearEventWeights == 0 in AFAWQC::FCTFNIF() !!!!"<<endl; |
9252 | cout<<Form(" (for <<%s[%s]>> non-isotropic term)",sinCosFlag[sc].Data(),nonisotropicTermFlag[ci-1].Data())<<endl; | |
0328db2d | 9253 | } |
489d5531 | 9254 | if(1.-pow(termA,2.) > 0.) |
9255 | { | |
9256 | termB = 1./pow(1-pow(termA,2.),0.5); | |
9257 | } else | |
9258 | { | |
b92ea2b9 | 9259 | cout<<" WARNING (QC): 1.-pow(termA,2.) <= 0 in AFAWQC::FCTFNIF() !!!!"<<endl; |
9260 | cout<<Form(" (for <<%s[%s]>> non-isotropic term)",sinCosFlag[sc].Data(),nonisotropicTermFlag[ci-1].Data())<<endl; | |
489d5531 | 9261 | } |
9262 | Double_t statisticalError = termA * spread * termB; | |
489d5531 | 9263 | fIntFlowCorrectionTermsForNUAHist[sc]->SetBinContent(ci,correction); |
0328db2d | 9264 | fIntFlowCorrectionTermsForNUAHist[sc]->SetBinError(ci,statisticalError); |
b92ea2b9 | 9265 | } // end of for(Int_t ci=1;ci<=4;ci++) // correction term index |
489d5531 | 9266 | } // end of for(Int sc=0;sc<2;sc++) // sin or cos correction terms |
9267 | ||
9268 | } // end of void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUAIntFlow() | |
9269 | ||
489d5531 | 9270 | //================================================================================================================================ |
9271 | ||
489d5531 | 9272 | void AliFlowAnalysisWithQCumulants::GetPointersForNestedLoopsHistograms() |
9273 | { | |
9274 | // Get pointers to all objects relevant for calculations with nested loops. | |
9275 | ||
9276 | TList *nestedLoopsList = dynamic_cast<TList*>(fHistList->FindObject("Nested Loops")); | |
9277 | if(nestedLoopsList) | |
9278 | { | |
9279 | this->SetNestedLoopsList(nestedLoopsList); | |
9280 | } else | |
9281 | { | |
9282 | cout<<"WARNING: nestedLoopsList is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
9283 | exit(0); | |
9284 | } | |
9285 | ||
9286 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?) | |
9287 | TString typeFlag[2] = {"RP","POI"}; // to be improved (should I promote this to data members?) | |
9288 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; // to be improved (should I promote this to data members?) | |
9289 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; // to be improved (should I promote this to data members?) | |
9290 | ||
9291 | TString evaluateNestedLoopsName = "fEvaluateNestedLoops"; | |
9292 | evaluateNestedLoopsName += fAnalysisLabel->Data(); | |
9293 | TProfile *evaluateNestedLoops = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(evaluateNestedLoopsName.Data())); | |
9294 | Bool_t bEvaluateIntFlowNestedLoops = kFALSE; | |
9295 | Bool_t bEvaluateDiffFlowNestedLoops = kFALSE; | |
9296 | if(evaluateNestedLoops) | |
9297 | { | |
9298 | this->SetEvaluateNestedLoops(evaluateNestedLoops); | |
9299 | bEvaluateIntFlowNestedLoops = (Int_t)evaluateNestedLoops->GetBinContent(1); | |
9300 | bEvaluateDiffFlowNestedLoops = (Int_t)evaluateNestedLoops->GetBinContent(2); | |
9301 | } | |
9302 | // nested loops relevant for integrated flow: | |
9303 | if(bEvaluateIntFlowNestedLoops) | |
9304 | { | |
9305 | // correlations: | |
9306 | TString intFlowDirectCorrelationsName = "fIntFlowDirectCorrelations"; | |
9307 | intFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
9308 | TProfile *intFlowDirectCorrelations = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(intFlowDirectCorrelationsName.Data())); | |
9309 | if(intFlowDirectCorrelations) | |
9310 | { | |
9311 | this->SetIntFlowDirectCorrelations(intFlowDirectCorrelations); | |
9312 | } else | |
9313 | { | |
9314 | cout<<"WARNING: intFlowDirectCorrelations is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
9315 | exit(0); | |
9316 | } | |
9317 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
9318 | { | |
9319 | TString intFlowExtraDirectCorrelationsName = "fIntFlowExtraDirectCorrelations"; | |
9320 | intFlowExtraDirectCorrelationsName += fAnalysisLabel->Data(); | |
9321 | TProfile *intFlowExtraDirectCorrelations = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(intFlowExtraDirectCorrelationsName.Data())); | |
9322 | if(intFlowExtraDirectCorrelations) | |
9323 | { | |
9324 | this->SetIntFlowExtraDirectCorrelations(intFlowExtraDirectCorrelations); | |
9325 | } else | |
9326 | { | |
9327 | cout<<"WARNING: intFlowExtraDirectCorrelations is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
9328 | exit(0); | |
9329 | } | |
9330 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
9331 | // correction terms for non-uniform acceptance: | |
9332 | TString intFlowDirectCorrectionTermsForNUAName = "fIntFlowDirectCorrectionTermsForNUA"; | |
9333 | intFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
9334 | TProfile *intFlowDirectCorrectionTermsForNUA[2] = {NULL}; | |
9335 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
9336 | { | |
9337 | intFlowDirectCorrectionTermsForNUA[sc] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s: %s terms",intFlowDirectCorrectionTermsForNUAName.Data(),sinCosFlag[sc].Data()))); | |
9338 | if(intFlowDirectCorrectionTermsForNUA[sc]) | |
9339 | { | |
9340 | this->SetIntFlowDirectCorrectionTermsForNUA(intFlowDirectCorrectionTermsForNUA[sc],sc); | |
9341 | } else | |
9342 | { | |
9343 | cout<<"WARNING: intFlowDirectCorrectionTermsForNUA[sc] is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
9344 | cout<<"sc = "<<sc<<endl; | |
9345 | exit(0); | |
9346 | } | |
9347 | } // end of for(Int_t sc=0;sc<2;sc++) | |
9348 | } // end of if(bEvaluateIntFlowNestedLoops) | |
9349 | ||
9350 | // nested loops relevant for differential flow: | |
9351 | if(bEvaluateDiffFlowNestedLoops) | |
9352 | { | |
9353 | // correlations: | |
9354 | TString diffFlowDirectCorrelationsName = "fDiffFlowDirectCorrelations"; | |
9355 | diffFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
9356 | TProfile *diffFlowDirectCorrelations[2][2][4] = {{{NULL}}}; | |
9357 | for(Int_t t=0;t<2;t++) | |
9358 | { | |
9359 | for(Int_t pe=0;pe<2;pe++) | |
9360 | { | |
9361 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
9362 | { | |
9363 | diffFlowDirectCorrelations[t][pe][ci] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[ci].Data()))); | |
9364 | if(diffFlowDirectCorrelations[t][pe][ci]) | |
9365 | { | |
9366 | this->SetDiffFlowDirectCorrelations(diffFlowDirectCorrelations[t][pe][ci],t,pe,ci); | |
9367 | } else | |
9368 | { | |
9369 | cout<<"WARNING: diffFlowDirectCorrelations[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9370 | cout<<"t = "<<t<<endl; | |
9371 | cout<<"pe = "<<pe<<endl; | |
9372 | cout<<"ci = "<<ci<<endl; | |
9373 | } | |
9374 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
9375 | } // end of for(Int_t pe=0;pe<2;pe++) | |
9376 | } // end of for(Int_t t=0;t<2;t++) | |
9377 | // correction terms for non-uniform acceptance: | |
9378 | TString diffFlowDirectCorrectionTermsForNUAName = "fDiffFlowDirectCorrectionTermsForNUA"; | |
9379 | diffFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
9380 | TProfile *diffFlowDirectCorrectionTermsForNUA[2][2][2][10] = {{{{NULL}}}}; | |
9381 | for(Int_t t=0;t<2;t++) | |
9382 | { | |
9383 | for(Int_t pe=0;pe<2;pe++) | |
9384 | { | |
9385 | // correction terms for NUA: | |
9386 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9387 | { | |
9388 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
9389 | { | |
9390 | diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1))); | |
9391 | if(diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]) | |
9392 | { | |
9393 | this->SetDiffFlowDirectCorrectionTermsForNUA(diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti],t,pe,sc,cti); | |
9394 | } else | |
9395 | { | |
9396 | cout<<"WARNING: diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9397 | cout<<"t = "<<t<<endl; | |
9398 | cout<<"pe = "<<pe<<endl; | |
9399 | cout<<"sc = "<<sc<<endl; | |
9400 | cout<<"cti = "<<cti<<endl; | |
9401 | } | |
9402 | } // end of for(Int_t cti=0;cti<9;cti++) // correction term index | |
9403 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9404 | } // end of for(Int_t pe=0;pe<2;pe++) | |
9405 | } // end of for(Int_t t=0;t<2;t++) | |
9406 | // number of RPs and POIs in selected pt and eta bins for cross-checkings: | |
9407 | TString noOfParticlesInBinName = "fNoOfParticlesInBin"; | |
9408 | TH1D *noOfParticlesInBin = NULL; | |
9409 | noOfParticlesInBin = dynamic_cast<TH1D*>(nestedLoopsList->FindObject(noOfParticlesInBinName.Data())); | |
9410 | if(noOfParticlesInBin) | |
9411 | { | |
9412 | this->SetNoOfParticlesInBin(noOfParticlesInBin); | |
9413 | } else | |
9414 | { | |
9415 | cout<<endl; | |
9416 | cout<<" WARNING (QC): noOfParticlesInBin is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9417 | cout<<endl; | |
9418 | } | |
9419 | } // end of if(bEvaluateDiffFlowNestedLoops) | |
9420 | ||
9421 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForNestedLoopsHistograms() | |
9422 | ||
489d5531 | 9423 | //================================================================================================================================ |
9424 | ||
489d5531 | 9425 | void AliFlowAnalysisWithQCumulants::StoreHarmonic() |
9426 | { | |
9427 | // Store flow harmonic in common control histograms. | |
9428 | ||
9429 | (fCommonHists->GetHarmonic())->Fill(0.5,fHarmonic); | |
dd442cd2 | 9430 | if(fFillMultipleControlHistograms) |
9431 | { | |
9432 | (fCommonHists2nd->GetHarmonic())->Fill(0.5,fHarmonic); | |
9433 | (fCommonHists4th->GetHarmonic())->Fill(0.5,fHarmonic); | |
9434 | (fCommonHists6th->GetHarmonic())->Fill(0.5,fHarmonic); | |
9435 | (fCommonHists8th->GetHarmonic())->Fill(0.5,fHarmonic); | |
9436 | } | |
9437 | ||
489d5531 | 9438 | } // end of void AliFlowAnalysisWithQCumulants::StoreHarmonic() |
9439 | ||
489d5531 | 9440 | //================================================================================================================================ |
9441 | ||
489d5531 | 9442 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelationsUsingParticleWeights(TString type, TString ptOrEta) // type = RP or POI |
9443 | { | |
9444 | // Calculate all correlations needed for differential flow using particle weights. | |
9445 | ||
2a98ceb8 | 9446 | Int_t t = 0; // type flag |
9447 | Int_t pe = 0; // ptEta flag | |
489d5531 | 9448 | |
9449 | if(type == "RP") | |
9450 | { | |
9451 | t = 0; | |
9452 | } else if(type == "POI") | |
9453 | { | |
9454 | t = 1; | |
9455 | } | |
9456 | ||
9457 | if(ptOrEta == "Pt") | |
9458 | { | |
9459 | pe = 0; | |
9460 | } else if(ptOrEta == "Eta") | |
9461 | { | |
9462 | pe = 1; | |
9463 | } | |
9464 | ||
9465 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
9466 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
9467 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
9468 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
9469 | ||
9470 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
9471 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
9472 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
9473 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
9474 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
9475 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
9476 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
9477 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
9478 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
9479 | ||
1268c371 | 9480 | // S^M_{p,k} (see .h file for the definition of fSpk): |
9481 | Double_t dSM1p1k = (*fSpk)(0,1); | |
9482 | Double_t dSM1p2k = (*fSpk)(0,2); | |
9483 | Double_t dSM1p3k = (*fSpk)(0,3); | |
9484 | Double_t dSM2p1k = (*fSpk)(1,1); | |
9485 | Double_t dSM3p1k = (*fSpk)(2,1); | |
489d5531 | 9486 | |
9487 | // looping over all bins and calculating reduced correlations: | |
9488 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
9489 | { | |
9490 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): | |
9491 | Double_t p1n0kRe = 0.; | |
9492 | Double_t p1n0kIm = 0.; | |
9493 | ||
9494 | // number of POIs in particular (pt,eta) bin): | |
9495 | Double_t mp = 0.; | |
9496 | ||
9497 | // real and imaginary parts of q_{m*n,k}: | |
9498 | // (weighted Q-vector evaluated for particles which are both RPs and POIs in particular (pt,eta) bin) | |
9499 | Double_t q1n2kRe = 0.; | |
9500 | Double_t q1n2kIm = 0.; | |
9501 | Double_t q2n1kRe = 0.; | |
9502 | Double_t q2n1kIm = 0.; | |
9503 | ||
9504 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
9505 | Double_t s1p1k = 0.; | |
9506 | Double_t s1p2k = 0.; | |
9507 | Double_t s1p3k = 0.; | |
9508 | ||
9509 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
9510 | Double_t dM0111 = 0.; | |
9511 | ||
9512 | if(type == "POI") | |
9513 | { | |
9514 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
9515 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
9516 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
9517 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
9518 | ||
9519 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
9520 | ||
9521 | t = 1; // typeFlag = RP or POI | |
9522 | ||
9523 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
9524 | q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
9525 | * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
9526 | q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
9527 | * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
9528 | q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
9529 | * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
9530 | q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
9531 | * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
9532 | ||
9533 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
9534 | s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); | |
9535 | s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); | |
9536 | s1p3k = pow(fs1dEBE[2][pe][3]->GetBinContent(b)*fs1dEBE[2][pe][3]->GetBinEntries(b),1.); | |
9537 | ||
9538 | // M0111 from Eq. (118) in QC2c (to be improved (notation)): | |
9539 | dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k) | |
9540 | - 3.*(s1p1k*(dSM2p1k-dSM1p2k) | |
9541 | + 2.*(s1p3k-s1p2k*dSM1p1k)); | |
9542 | } | |
9543 | else if(type == "RP") | |
9544 | { | |
9545 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
9546 | q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
9547 | * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
9548 | q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
9549 | * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
9550 | q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
9551 | * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
9552 | q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
9553 | * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
9554 | ||
9555 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
9556 | s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); | |
9557 | s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); | |
9558 | s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); | |
9559 | ||
9560 | // to be improved (cross-checked): | |
9561 | p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
9562 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
9563 | p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
9564 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
9565 | ||
9566 | mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
9567 | ||
9568 | t = 0; // typeFlag = RP or POI | |
9569 | ||
9570 | // M0111 from Eq. (118) in QC2c (to be improved (notation)): | |
9571 | dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k) | |
9572 | - 3.*(s1p1k*(dSM2p1k-dSM1p2k) | |
9573 | + 2.*(s1p3k-s1p2k*dSM1p1k)); | |
9574 | //............................................................................................... | |
9575 | } | |
9576 | ||
9577 | // 2'-particle correlation: | |
9578 | Double_t two1n1nW0W1 = 0.; | |
9579 | if(mp*dSM1p1k-s1p1k) | |
9580 | { | |
9581 | two1n1nW0W1 = (p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k-s1p1k) | |
9582 | / (mp*dSM1p1k-s1p1k); | |
9583 | ||
9584 | // fill profile to get <<2'>> | |
b40a910e | 9585 | fDiffFlowCorrelationsPro[t][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nW0W1,mp*dSM1p1k-s1p1k); |
9586 | // fill profile to get <<2'>^2> | |
9587 | fDiffFlowSquaredCorrelationsPro[t][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nW0W1*two1n1nW0W1,mp*dSM1p1k-s1p1k); | |
489d5531 | 9588 | // histogram to store <2'> e-b-e (needed in some other methods): |
9589 | fDiffFlowCorrelationsEBE[t][pe][0]->SetBinContent(b,two1n1nW0W1); | |
9590 | fDiffFlowEventWeightsForCorrelationsEBE[t][pe][0]->SetBinContent(b,mp*dSM1p1k-s1p1k); | |
9591 | } // end of if(mp*dSM1p1k-s1p1k) | |
9592 | ||
9593 | // 4'-particle correlation: | |
9594 | Double_t four1n1n1n1nW0W1W1W1 = 0.; | |
9595 | if(dM0111) | |
9596 | { | |
9597 | four1n1n1n1nW0W1W1W1 = ((pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k) | |
9598 | - q2n1kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.)) | |
9599 | - 2.*q2n1kIm*dReQ1n1k*dImQ1n1k | |
9600 | - p1n0kRe*(dReQ1n1k*dReQ2n2k+dImQ1n1k*dImQ2n2k) | |
9601 | + p1n0kIm*(dImQ1n1k*dReQ2n2k-dReQ1n1k*dImQ2n2k) | |
9602 | - 2.*dSM1p2k*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k) | |
9603 | - 2.*(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*s1p1k | |
9604 | + 6.*(q1n2kRe*dReQ1n1k+q1n2kIm*dImQ1n1k) | |
9605 | + 1.*(q2n1kRe*dReQ2n2k+q2n1kIm*dImQ2n2k) | |
9606 | + 2.*(p1n0kRe*dReQ1n3k+p1n0kIm*dImQ1n3k) | |
9607 | + 2.*s1p1k*dSM1p2k | |
9608 | - 6.*s1p3k) | |
9609 | / dM0111; // to be improved (notation of dM0111) | |
9610 | ||
9611 | // fill profile to get <<4'>> | |
b40a910e | 9612 | fDiffFlowCorrelationsPro[t][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nW0W1W1W1,dM0111); |
9613 | // fill profile to get <<4'>^2> | |
9614 | fDiffFlowSquaredCorrelationsPro[t][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nW0W1W1W1*four1n1n1n1nW0W1W1W1,dM0111); | |
489d5531 | 9615 | // histogram to store <4'> e-b-e (needed in some other methods): |
9616 | fDiffFlowCorrelationsEBE[t][pe][1]->SetBinContent(b,four1n1n1n1nW0W1W1W1); | |
9617 | fDiffFlowEventWeightsForCorrelationsEBE[t][pe][1]->SetBinContent(b,dM0111); | |
9618 | } // end of if(dM0111) | |
9619 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
9620 | ||
9621 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelationsUsingParticleWeights(TString type, TString ptOrEta); // type = RP or POI | |
9622 | ||
489d5531 | 9623 | //================================================================================================================================ |
9624 | ||
489d5531 | 9625 | void AliFlowAnalysisWithQCumulants::FillCommonControlHistograms(AliFlowEventSimple *anEvent) |
9626 | { | |
9627 | // Fill common control histograms. | |
9628 | ||
9629 | Int_t nRP = anEvent->GetEventNSelTracksRP(); // number of RPs (i.e. number of particles used to determine the reaction plane) | |
9630 | fCommonHists->FillControlHistograms(anEvent); | |
dd442cd2 | 9631 | if(fFillMultipleControlHistograms) |
489d5531 | 9632 | { |
dd442cd2 | 9633 | if(nRP>1) |
489d5531 | 9634 | { |
dd442cd2 | 9635 | fCommonHists2nd->FillControlHistograms(anEvent); |
9636 | if(nRP>3) | |
489d5531 | 9637 | { |
dd442cd2 | 9638 | fCommonHists4th->FillControlHistograms(anEvent); |
9639 | if(nRP>5) | |
489d5531 | 9640 | { |
dd442cd2 | 9641 | fCommonHists6th->FillControlHistograms(anEvent); |
9642 | if(nRP>7) | |
9643 | { | |
9644 | fCommonHists8th->FillControlHistograms(anEvent); | |
9645 | } // end of if(nRP>7) | |
9646 | } // end of if(nRP>5) | |
9647 | } // end of if(nRP>3) | |
9648 | } // end of if(nRP>1) | |
9649 | } // end of if(fFillMultipleControlHistograms) | |
489d5531 | 9650 | |
9651 | } // end of void AliFlowAnalysisWithQCumulants::FillCommonControlHistograms(AliFlowEventSimple *anEvent) | |
9652 | ||
489d5531 | 9653 | //================================================================================================================================ |
9654 | ||
489d5531 | 9655 | void AliFlowAnalysisWithQCumulants::ResetEventByEventQuantities() |
9656 | { | |
9657 | // Reset all event by event quantities. | |
9658 | ||
1268c371 | 9659 | // Reference flow: |
489d5531 | 9660 | fReQ->Zero(); |
9661 | fImQ->Zero(); | |
1268c371 | 9662 | fSpk->Zero(); |
489d5531 | 9663 | fIntFlowCorrelationsEBE->Reset(); |
9664 | fIntFlowEventWeightsForCorrelationsEBE->Reset(); | |
9665 | fIntFlowCorrelationsAllEBE->Reset(); | |
9666 | ||
b92ea2b9 | 9667 | for(Int_t sc=0;sc<2;sc++) |
489d5531 | 9668 | { |
b92ea2b9 | 9669 | fIntFlowCorrectionTermsForNUAEBE[sc]->Reset(); |
9670 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc]->Reset(); | |
489d5531 | 9671 | } |
9672 | ||
1268c371 | 9673 | // Differential flow: |
9674 | if(fCalculateDiffFlow) | |
489d5531 | 9675 | { |
1268c371 | 9676 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) |
489d5531 | 9677 | { |
1268c371 | 9678 | for(Int_t pe=0;pe<2;pe++) // 1D in pt or eta |
489d5531 | 9679 | { |
1268c371 | 9680 | for(Int_t m=0;m<4;m++) // multiple of harmonic |
489d5531 | 9681 | { |
1268c371 | 9682 | for(Int_t k=0;k<9;k++) // power of weight |
9683 | { | |
9684 | if(fReRPQ1dEBE[t][pe][m][k]) fReRPQ1dEBE[t][pe][m][k]->Reset(); | |
9685 | if(fImRPQ1dEBE[t][pe][m][k]) fImRPQ1dEBE[t][pe][m][k]->Reset(); | |
9686 | } | |
9687 | } | |
489d5531 | 9688 | } |
1268c371 | 9689 | } |
9690 | for(Int_t t=0;t<3;t++) // type (0 = RP, 1 = POI, 2 = RP&&POI ) | |
9691 | { | |
9692 | for(Int_t pe=0;pe<2;pe++) // 1D in pt or eta | |
489d5531 | 9693 | { |
1268c371 | 9694 | for(Int_t k=0;k<9;k++) |
9695 | { | |
9696 | if(fs1dEBE[t][pe][k]) fs1dEBE[t][pe][k]->Reset(); | |
9697 | } | |
489d5531 | 9698 | } |
9699 | } | |
1268c371 | 9700 | // e-b-e reduced correlations: |
9701 | for(Int_t t=0;t<2;t++) // type (0 = RP, 1 = POI) | |
9702 | { | |
9703 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
489d5531 | 9704 | { |
1268c371 | 9705 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index |
9706 | { | |
9707 | if(fDiffFlowCorrelationsEBE[t][pe][rci]) fDiffFlowCorrelationsEBE[t][pe][rci]->Reset(); | |
9708 | if(fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci]) fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci]->Reset(); | |
9709 | } | |
489d5531 | 9710 | } |
1268c371 | 9711 | } |
9712 | // correction terms for NUA: | |
9713 | for(Int_t t=0;t<2;t++) // type (0 = RP, 1 = POI) | |
9714 | { | |
9715 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
489d5531 | 9716 | { |
1268c371 | 9717 | for(Int_t sc=0;sc<2;sc++) // sin or cos |
489d5531 | 9718 | { |
1268c371 | 9719 | for(Int_t cti=0;cti<9;cti++) // correction term index |
9720 | { | |
489d5531 | 9721 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti]->Reset(); |
1268c371 | 9722 | } |
489d5531 | 9723 | } |
1268c371 | 9724 | } |
9725 | } | |
9726 | } // end of if(fCalculateDiffFlow) | |
9727 | ||
489d5531 | 9728 | // 2D (pt,eta) |
1268c371 | 9729 | if(fCalculate2DDiffFlow) |
489d5531 | 9730 | { |
9731 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
9732 | { | |
9733 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
9734 | { | |
9735 | for(Int_t k=0;k<9;k++) // power of weight | |
9736 | { | |
b77b6434 | 9737 | if(fReRPQ2dEBE[t][m][k]){fReRPQ2dEBE[t][m][k]->Reset();} |
9738 | if(fImRPQ2dEBE[t][m][k]){fImRPQ2dEBE[t][m][k]->Reset();} | |
489d5531 | 9739 | } |
9740 | } | |
9741 | } | |
9742 | for(Int_t t=0;t<3;t++) // type (0 = RP, 1 = POI, 2 = RP&&POI ) | |
9743 | { | |
9744 | for(Int_t k=0;k<9;k++) | |
9745 | { | |
b77b6434 | 9746 | if(fs2dEBE[t][k]){fs2dEBE[t][k]->Reset();} |
489d5531 | 9747 | } |
9748 | } | |
1268c371 | 9749 | } // end of if(fCalculate2DDiffFlow) |
489d5531 | 9750 | |
9751 | } // end of void AliFlowAnalysisWithQCumulants::ResetEventByEventQuantities(); | |
9752 | ||
489d5531 | 9753 | //================================================================================================================================ |
9754 | ||
489d5531 | 9755 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTerms(TString type, TString ptOrEta) |
9756 | { | |
9757 | // Calculate correction terms for non-uniform acceptance for differential flow (sin terms). | |
9758 | ||
9759 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][0][cti], where cti runs as follows: | |
9760 | // 0: <<sin n(psi1)>> | |
9761 | // 1: <<sin n(psi1+phi2)>> | |
9762 | // 2: <<sin n(psi1+phi2-phi3)>> | |
9763 | // 3: <<sin n(psi1-phi2-phi3)>>: | |
9764 | // 4: | |
9765 | // 5: | |
9766 | // 6: | |
9767 | ||
9768 | // multiplicity: | |
1268c371 | 9769 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 9770 | |
9771 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
9772 | Double_t dReQ1n = (*fReQ)(0,0); | |
9773 | Double_t dReQ2n = (*fReQ)(1,0); | |
9774 | //Double_t dReQ3n = (*fReQ)(2,0); | |
9775 | //Double_t dReQ4n = (*fReQ)(3,0); | |
9776 | Double_t dImQ1n = (*fImQ)(0,0); | |
9777 | Double_t dImQ2n = (*fImQ)(1,0); | |
9778 | //Double_t dImQ3n = (*fImQ)(2,0); | |
9779 | //Double_t dImQ4n = (*fImQ)(3,0); | |
9780 | ||
2a98ceb8 | 9781 | Int_t t = 0; // type flag |
9782 | Int_t pe = 0; // ptEta flag | |
489d5531 | 9783 | |
9784 | if(type == "RP") | |
9785 | { | |
9786 | t = 0; | |
9787 | } else if(type == "POI") | |
9788 | { | |
9789 | t = 1; | |
9790 | } | |
9791 | ||
9792 | if(ptOrEta == "Pt") | |
9793 | { | |
9794 | pe = 0; | |
9795 | } else if(ptOrEta == "Eta") | |
9796 | { | |
9797 | pe = 1; | |
9798 | } | |
9799 | ||
9800 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
9801 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
9802 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
9803 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
9804 | ||
9805 | // looping over all bins and calculating correction terms: | |
9806 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
9807 | { | |
9808 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
9809 | Double_t p1n0kRe = 0.; | |
9810 | Double_t p1n0kIm = 0.; | |
9811 | ||
9812 | // number of POIs in particular pt or eta bin: | |
9813 | Double_t mp = 0.; | |
9814 | ||
9815 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
9816 | Double_t q1n0kRe = 0.; | |
9817 | Double_t q1n0kIm = 0.; | |
9818 | Double_t q2n0kRe = 0.; | |
9819 | Double_t q2n0kIm = 0.; | |
9820 | ||
9821 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
9822 | Double_t mq = 0.; | |
9823 | ||
9824 | if(type == "POI") | |
9825 | { | |
9826 | // q_{m*n,0}: | |
9827 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
9828 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
9829 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
9830 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
9831 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
9832 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
9833 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
9834 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
9835 | ||
9836 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
9837 | } | |
9838 | else if(type == "RP") | |
9839 | { | |
9840 | // q_{m*n,0}: | |
9841 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
9842 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
9843 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
9844 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
9845 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
9846 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
9847 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
9848 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
9849 | ||
9850 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
9851 | } | |
9852 | if(type == "POI") | |
9853 | { | |
9854 | // p_{m*n,0}: | |
9855 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
9856 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
9857 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
9858 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
9859 | ||
9860 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
9861 | ||
9862 | t = 1; // typeFlag = RP or POI | |
9863 | } | |
9864 | else if(type == "RP") | |
9865 | { | |
9866 | // p_{m*n,0} = q_{m*n,0}: | |
9867 | p1n0kRe = q1n0kRe; | |
9868 | p1n0kIm = q1n0kIm; | |
9869 | ||
9870 | mp = mq; | |
9871 | ||
9872 | t = 0; // typeFlag = RP or POI | |
9873 | } | |
9874 | ||
9875 | // <<sin n(psi1)>>: | |
9876 | Double_t sinP1nPsi = 0.; | |
9877 | if(mp) | |
9878 | { | |
9879 | sinP1nPsi = p1n0kIm/mp; | |
9880 | // fill profile for <<sin n(psi1)>>: | |
9881 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi,mp); | |
9882 | // histogram to store <sin n(psi1)> e-b-e (needed in some other methods): | |
9883 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][0]->SetBinContent(b,sinP1nPsi); | |
9884 | } // end of if(mp) | |
9885 | ||
9886 | // <<sin n(psi1+phi2)>>: | |
9887 | Double_t sinP1nPsiP1nPhi = 0.; | |
9888 | if(mp*dMult-mq) | |
9889 | { | |
9890 | sinP1nPsiP1nPhi = (p1n0kRe*dImQ1n+p1n0kIm*dReQ1n-q2n0kIm)/(mp*dMult-mq); | |
9891 | // fill profile for <<sin n(psi1+phi2)>>: | |
9892 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsiP1nPhi,mp*dMult-mq); | |
9893 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
9894 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][1]->SetBinContent(b,sinP1nPsiP1nPhi); | |
9895 | } // end of if(mp*dMult-mq) | |
9896 | ||
9897 | // <<sin n(psi1+phi2-phi3)>>: | |
9898 | Double_t sinP1nPsi1P1nPhi2MPhi3 = 0.; | |
9899 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
9900 | { | |
9901 | sinP1nPsi1P1nPhi2MPhi3 = (p1n0kIm*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult) | |
9902 | - 1.*(q2n0kIm*dReQ1n-q2n0kRe*dImQ1n) | |
9903 | - mq*dImQ1n+2.*q1n0kIm) | |
9904 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
9905 | // fill profile for <<sin n(psi1+phi2)>>: | |
9906 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
9907 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
9908 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][2]->SetBinContent(b,sinP1nPsi1P1nPhi2MPhi3); | |
9909 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
9910 | ||
9911 | // <<sin n(psi1-phi2-phi3)>>: | |
9912 | Double_t sinP1nPsi1M1nPhi2MPhi3 = 0.; | |
9913 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
9914 | { | |
9915 | sinP1nPsi1M1nPhi2MPhi3 = (p1n0kIm*(pow(dReQ1n,2.)-pow(dImQ1n,2.))-2.*p1n0kRe*dReQ1n*dImQ1n | |
9916 | - 1.*(p1n0kIm*dReQ2n-p1n0kRe*dImQ2n) | |
9917 | + 2.*mq*dImQ1n-2.*q1n0kIm) | |
9918 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
9919 | // fill profile for <<sin n(psi1+phi2)>>: | |
9920 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
9921 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
9922 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][3]->SetBinContent(b,sinP1nPsi1M1nPhi2MPhi3); | |
9923 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
9924 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
9925 | ||
9926 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTerms(TString type, TString ptOrEta) | |
9927 | ||
9928 | ||
9929 | //================================================================================================================================ | |
9930 | ||
9931 | ||
9932 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTerms(TString type, TString ptOrEta) | |
9933 | { | |
9934 | // Calculate correction terms for non-uniform acceptance for differential flow (cos terms). | |
9935 | ||
9936 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][1][cti], where cti runs as follows: | |
9937 | // 0: <<cos n(psi)>> | |
9938 | // 1: <<cos n(psi1+phi2)>> | |
9939 | // 2: <<cos n(psi1+phi2-phi3)>> | |
9940 | // 3: <<cos n(psi1-phi2-phi3)>> | |
9941 | // 4: | |
9942 | // 5: | |
9943 | // 6: | |
9944 | ||
9945 | // multiplicity: | |
1268c371 | 9946 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 9947 | |
9948 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
9949 | Double_t dReQ1n = (*fReQ)(0,0); | |
9950 | Double_t dReQ2n = (*fReQ)(1,0); | |
9951 | //Double_t dReQ3n = (*fReQ)(2,0); | |
9952 | //Double_t dReQ4n = (*fReQ)(3,0); | |
9953 | Double_t dImQ1n = (*fImQ)(0,0); | |
9954 | Double_t dImQ2n = (*fImQ)(1,0); | |
9955 | //Double_t dImQ3n = (*fImQ)(2,0); | |
9956 | //Double_t dImQ4n = (*fImQ)(3,0); | |
9957 | ||
2a98ceb8 | 9958 | Int_t t = 0; // type flag |
9959 | Int_t pe = 0; // ptEta flag | |
489d5531 | 9960 | |
9961 | if(type == "RP") | |
9962 | { | |
9963 | t = 0; | |
9964 | } else if(type == "POI") | |
9965 | { | |
9966 | t = 1; | |
9967 | } | |
9968 | ||
9969 | if(ptOrEta == "Pt") | |
9970 | { | |
9971 | pe = 0; | |
9972 | } else if(ptOrEta == "Eta") | |
9973 | { | |
9974 | pe = 1; | |
9975 | } | |
9976 | ||
9977 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
9978 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
9979 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
9980 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
9981 | ||
9982 | // looping over all bins and calculating correction terms: | |
9983 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
9984 | { | |
9985 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
9986 | Double_t p1n0kRe = 0.; | |
9987 | Double_t p1n0kIm = 0.; | |
9988 | ||
9989 | // number of POIs in particular pt or eta bin: | |
9990 | Double_t mp = 0.; | |
9991 | ||
9992 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
9993 | Double_t q1n0kRe = 0.; | |
9994 | Double_t q1n0kIm = 0.; | |
9995 | Double_t q2n0kRe = 0.; | |
9996 | Double_t q2n0kIm = 0.; | |
9997 | ||
9998 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
9999 | Double_t mq = 0.; | |
10000 | ||
10001 | if(type == "POI") | |
10002 | { | |
10003 | // q_{m*n,0}: | |
10004 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
10005 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
10006 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
10007 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
10008 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
10009 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
10010 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
10011 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
10012 | ||
10013 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10014 | } | |
10015 | else if(type == "RP") | |
10016 | { | |
10017 | // q_{m*n,0}: | |
10018 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
10019 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
10020 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
10021 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
10022 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
10023 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
10024 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
10025 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
10026 | ||
10027 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10028 | } | |
10029 | if(type == "POI") | |
10030 | { | |
10031 | // p_{m*n,0}: | |
10032 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
10033 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
10034 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
10035 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
10036 | ||
10037 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10038 | ||
10039 | t = 1; // typeFlag = RP or POI | |
10040 | } | |
10041 | else if(type == "RP") | |
10042 | { | |
10043 | // p_{m*n,0} = q_{m*n,0}: | |
10044 | p1n0kRe = q1n0kRe; | |
10045 | p1n0kIm = q1n0kIm; | |
10046 | ||
10047 | mp = mq; | |
10048 | ||
10049 | t = 0; // typeFlag = RP or POI | |
10050 | } | |
10051 | ||
10052 | // <<cos n(psi1)>>: | |
10053 | Double_t cosP1nPsi = 0.; | |
10054 | if(mp) | |
10055 | { | |
10056 | cosP1nPsi = p1n0kRe/mp; | |
10057 | ||
10058 | // fill profile for <<cos n(psi1)>>: | |
10059 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi,mp); | |
10060 | // histogram to store <cos n(psi1)> e-b-e (needed in some other methods): | |
10061 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][0]->SetBinContent(b,cosP1nPsi); | |
10062 | } // end of if(mp) | |
10063 | ||
10064 | // <<cos n(psi1+phi2)>>: | |
10065 | Double_t cosP1nPsiP1nPhi = 0.; | |
10066 | if(mp*dMult-mq) | |
10067 | { | |
10068 | cosP1nPsiP1nPhi = (p1n0kRe*dReQ1n-p1n0kIm*dImQ1n-q2n0kRe)/(mp*dMult-mq); | |
10069 | // fill profile for <<sin n(psi1+phi2)>>: | |
10070 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsiP1nPhi,mp*dMult-mq); | |
10071 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
10072 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][1]->SetBinContent(b,cosP1nPsiP1nPhi); | |
10073 | } // end of if(mp*dMult-mq) | |
10074 | ||
10075 | // <<cos n(psi1+phi2-phi3)>>: | |
10076 | Double_t cosP1nPsi1P1nPhi2MPhi3 = 0.; | |
10077 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
10078 | { | |
10079 | cosP1nPsi1P1nPhi2MPhi3 = (p1n0kRe*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult) | |
10080 | - 1.*(q2n0kRe*dReQ1n+q2n0kIm*dImQ1n) | |
10081 | - mq*dReQ1n+2.*q1n0kRe) | |
10082 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
10083 | // fill profile for <<sin n(psi1+phi2)>>: | |
10084 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
10085 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
10086 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][2]->SetBinContent(b,cosP1nPsi1P1nPhi2MPhi3); | |
10087 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
10088 | ||
10089 | // <<cos n(psi1-phi2-phi3)>>: | |
10090 | Double_t cosP1nPsi1M1nPhi2MPhi3 = 0.; | |
10091 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
10092 | { | |
10093 | cosP1nPsi1M1nPhi2MPhi3 = (p1n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.))+2.*p1n0kIm*dReQ1n*dImQ1n | |
10094 | - 1.*(p1n0kRe*dReQ2n+p1n0kIm*dImQ2n) | |
10095 | - 2.*mq*dReQ1n+2.*q1n0kRe) | |
10096 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
10097 | // fill profile for <<sin n(psi1+phi2)>>: | |
10098 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
10099 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
10100 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][3]->SetBinContent(b,cosP1nPsi1M1nPhi2MPhi3); | |
10101 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
10102 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10103 | ||
10104 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTerms(TString type, TString ptOrEta) | |
10105 | ||
489d5531 | 10106 | //================================================================================================================================== |
10107 | ||
489d5531 | 10108 | void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUADiffFlow(TString type, TString ptOrEta) |
10109 | { | |
1268c371 | 10110 | // Transfer profiles into histogams and correctly propagate the error. |
489d5531 | 10111 | |
2a98ceb8 | 10112 | Int_t t = 0; // type flag |
10113 | Int_t pe = 0; // ptEta flag | |
489d5531 | 10114 | |
10115 | if(type == "RP") | |
10116 | { | |
10117 | t = 0; | |
10118 | } else if(type == "POI") | |
10119 | { | |
10120 | t = 1; | |
10121 | } | |
10122 | ||
10123 | if(ptOrEta == "Pt") | |
10124 | { | |
10125 | pe = 0; | |
10126 | } else if(ptOrEta == "Eta") | |
10127 | { | |
10128 | pe = 1; | |
10129 | } | |
10130 | ||
10131 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
10132 | //Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
10133 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
10134 | //Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
10135 | ||
10136 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
10137 | { | |
10138 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
10139 | { | |
10140 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10141 | { | |
10142 | Double_t correctionTerm = fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]->GetBinContent(b); | |
10143 | fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]->SetBinContent(b,correctionTerm); | |
10144 | // to be improved (propagate error correctly) | |
10145 | // ... | |
10146 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10147 | } // correction term index | |
10148 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
10149 | ||
10150 | }// end of void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUADiffFlow(TString type, TString ptOrEta) | |
10151 | ||
489d5531 | 10152 | //================================================================================================================================== |
10153 | ||
489d5531 | 10154 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta) |
10155 | { | |
1268c371 | 10156 | // Calculate generalized differential flow cumulants (corrected for non-uniform acceptance). |
10157 | ||
10158 | // to be improved - propagate error also from non-isotropic terms | |
489d5531 | 10159 | |
1268c371 | 10160 | Int_t t = 0; // RP = 0, POI = 1 |
10161 | Int_t pe = 0; // pt = 0, eta = 1 | |
489d5531 | 10162 | |
10163 | if(type == "RP") | |
10164 | { | |
1268c371 | 10165 | t = 0; |
489d5531 | 10166 | } else if(type == "POI") |
10167 | { | |
1268c371 | 10168 | t = 1; |
489d5531 | 10169 | } |
10170 | ||
10171 | if(ptOrEta == "Pt") | |
10172 | { | |
1268c371 | 10173 | pe = 0; |
489d5531 | 10174 | } else if(ptOrEta == "Eta") |
10175 | { | |
1268c371 | 10176 | pe = 1; |
489d5531 | 10177 | } |
1268c371 | 10178 | |
10179 | // Common: | |
489d5531 | 10180 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
489d5531 | 10181 | // 2-particle correlation: |
10182 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> | |
1268c371 | 10183 | // sinus terms coming from reference flow: |
489d5531 | 10184 | Double_t sinP1nPhi = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1); // <<sin(n*phi1)>> |
10185 | Double_t sinP1nPhi1P1nPhi2 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2); // <<sin(n*(phi1+phi2))>> | |
10186 | Double_t sinP1nPhi1M1nPhi2M1nPhi3 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(3); // <<sin(n*(phi1-phi2-phi3))>> | |
1268c371 | 10187 | // cosinus terms coming from reference flow: |
489d5531 | 10188 | Double_t cosP1nPhi = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1); // <<cos(n*phi1)>> |
10189 | Double_t cosP1nPhi1P1nPhi2 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2); // <<cos(n*(phi1+phi2))>> | |
10190 | Double_t cosP1nPhi1M1nPhi2M1nPhi3 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(3); // <<cos(n*(phi1-phi2-phi3))>> | |
10191 | ||
10192 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10193 | { | |
10194 | Double_t twoPrime = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); // <<2'>> | |
10195 | Double_t fourPrime = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); // <<4'>> | |
10196 | Double_t sinP1nPsi = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][0]->GetBinContent(b); // <<sin n(Psi)>> | |
10197 | Double_t cosP1nPsi = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][0]->GetBinContent(b); // <<cos n(Psi)>> | |
10198 | Double_t sinP1nPsi1P1nPhi2 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][1]->GetBinContent(b); // <<sin n(psi1+phi2)>> | |
10199 | Double_t cosP1nPsi1P1nPhi2 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][1]->GetBinContent(b); // <<cos n(psi1+phi2)>> | |
10200 | Double_t sinP1nPsi1P1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][2]->GetBinContent(b); // <<sin n(psi1+phi2-phi3)>> | |
10201 | Double_t cosP1nPsi1P1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][2]->GetBinContent(b); // <<cos n(psi1+phi2-phi3)>> | |
10202 | Double_t sinP1nPsi1M1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][3]->GetBinContent(b); // <<sin n(psi1-phi2-phi3)>> | |
10203 | Double_t cosP1nPsi1M1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][3]->GetBinContent(b); // <<cos n(psi1-phi2-phi3)>> | |
1268c371 | 10204 | // Generalized QC{2'}: |
489d5531 | 10205 | Double_t qc2Prime = twoPrime - sinP1nPsi*sinP1nPhi - cosP1nPsi*cosP1nPhi; |
1268c371 | 10206 | if(fApplyCorrectionForNUA) |
10207 | { | |
10208 | fDiffFlowCumulants[t][pe][0]->SetBinContent(b,qc2Prime); | |
10209 | } | |
10210 | if(TMath::Abs(twoPrime)>0.) | |
10211 | { | |
10212 | fDiffFlowDetectorBias[t][pe][0]->SetBinContent(b,qc2Prime/twoPrime); // detector bias = generalized/isotropic cumulant. | |
10213 | } | |
10214 | // Generalized QC{4'}: | |
489d5531 | 10215 | Double_t qc4Prime = fourPrime-2.*twoPrime*two |
10216 | - cosP1nPsi*cosP1nPhi1M1nPhi2M1nPhi3 | |
10217 | + sinP1nPsi*sinP1nPhi1M1nPhi2M1nPhi3 | |
10218 | - cosP1nPhi*cosP1nPsi1M1nPhi2M1nPhi3 | |
10219 | + sinP1nPhi*sinP1nPsi1M1nPhi2M1nPhi3 | |
10220 | - 2.*cosP1nPhi*cosP1nPsi1P1nPhi2M1nPhi3 | |
10221 | - 2.*sinP1nPhi*sinP1nPsi1P1nPhi2M1nPhi3 | |
10222 | - cosP1nPsi1P1nPhi2*cosP1nPhi1P1nPhi2 | |
10223 | - sinP1nPsi1P1nPhi2*sinP1nPhi1P1nPhi2 | |
10224 | + 2.*cosP1nPhi1P1nPhi2*(cosP1nPsi*cosP1nPhi-sinP1nPsi*sinP1nPhi) | |
10225 | + 2.*sinP1nPhi1P1nPhi2*(cosP1nPsi*sinP1nPhi+sinP1nPsi*cosP1nPhi) | |
10226 | + 4.*two*(cosP1nPsi*cosP1nPhi+sinP1nPsi*sinP1nPhi) | |
10227 | + 2.*cosP1nPsi1P1nPhi2*(pow(cosP1nPhi,2.)-pow(sinP1nPhi,2.)) | |
10228 | + 4.*sinP1nPsi1P1nPhi2*cosP1nPhi*sinP1nPhi | |
10229 | + 4.*twoPrime*(pow(cosP1nPhi,2.)+pow(sinP1nPhi,2.)) | |
10230 | - 6.*(pow(cosP1nPhi,2.)-pow(sinP1nPhi,2.)) | |
10231 | * (cosP1nPsi*cosP1nPhi-sinP1nPsi*sinP1nPhi) | |
10232 | - 12.*cosP1nPhi*sinP1nPhi | |
10233 | * (sinP1nPsi*cosP1nPhi+cosP1nPsi*sinP1nPhi); | |
1268c371 | 10234 | if(fApplyCorrectionForNUA) |
10235 | { | |
10236 | fDiffFlowCumulants[t][pe][1]->SetBinContent(b,qc4Prime); | |
10237 | } | |
10238 | if(TMath::Abs(fourPrime-2.*twoPrime*two)>0.) | |
10239 | { | |
10240 | fDiffFlowDetectorBias[t][pe][1]->SetBinContent(b,qc4Prime/(fourPrime-2.*twoPrime*two)); // detector bias = generalized/isotropic cumulant. | |
10241 | } | |
489d5531 | 10242 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
10243 | ||
10244 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta) | |
10245 | ||
1268c371 | 10246 | //================================================================================================================================== |
489d5531 | 10247 | |
10248 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta) | |
10249 | { | |
10250 | // Calculate differential flow corrected for non-uniform acceptance. | |
10251 | ||
1268c371 | 10252 | // to be improved: eventually I will have to access here masured correlations and NUA terms |
10253 | // instead of cumulants in order to propagate statistical error correctly also | |
10254 | // to NUA terms (propagating errors directly from cumulants is WRONG for | |
10255 | // differential flow becuase that doesn't account at all cross-covariance terms) | |
489d5531 | 10256 | |
1268c371 | 10257 | // REMARK: When NUA correction is apllied error for differential flow DOES NOT get corrected, |
10258 | // i.e. only value is being corrected, error is still the one relevant for isotropic | |
10259 | // case. This eventually will be resolved. | |
10260 | ||
10261 | ||
10262 | Int_t t = 0; // RP or POI | |
10263 | Int_t pe = 0; // pt or eta | |
489d5531 | 10264 | |
10265 | if(type == "RP") | |
10266 | { | |
1268c371 | 10267 | t = 0; |
489d5531 | 10268 | } else if(type == "POI") |
10269 | { | |
1268c371 | 10270 | t = 1; |
10271 | } | |
489d5531 | 10272 | if(ptOrEta == "Pt") |
10273 | { | |
1268c371 | 10274 | pe = 0; |
489d5531 | 10275 | } else if(ptOrEta == "Eta") |
10276 | { | |
1268c371 | 10277 | pe = 1; |
489d5531 | 10278 | } |
10279 | ||
1268c371 | 10280 | // Common: |
489d5531 | 10281 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
1268c371 | 10282 | // Reference Q-cumulants |
10283 | Double_t qc2 = fIntFlowQcumulants->GetBinContent(1); // QC{2} | |
10284 | Double_t qc4 = fIntFlowQcumulants->GetBinContent(2); // QC{4} | |
10285 | // Loop over pt or eta bins: | |
489d5531 | 10286 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) |
10287 | { | |
1268c371 | 10288 | // Differential Q-cumulants: |
10289 | Double_t qc2Prime = fDiffFlowCumulants[t][pe][0]->GetBinContent(b); // QC{2'} | |
10290 | Double_t qc4Prime = fDiffFlowCumulants[t][pe][1]->GetBinContent(b); // QC{4'} | |
489d5531 | 10291 | // v'{2}: |
1268c371 | 10292 | if(qc2>0.) |
489d5531 | 10293 | { |
1268c371 | 10294 | Double_t v2Prime = qc2Prime/pow(qc2,0.5); |
10295 | if(TMath::Abs(v2Prime)>0.){fDiffFlow[t][pe][0]->SetBinContent(b,v2Prime);} | |
489d5531 | 10296 | } |
489d5531 | 10297 | // v'{4}: |
1268c371 | 10298 | if(qc4<0.) |
489d5531 | 10299 | { |
1268c371 | 10300 | Double_t v4Prime = -qc4Prime/pow(-qc4,3./4.); |
10301 | if(TMath::Abs(v4Prime)>0.){fDiffFlow[t][pe][1]->SetBinContent(b,v4Prime);} | |
489d5531 | 10302 | } |
10303 | } // end of for(Int_t b=1;b<=fnBinsPtEta[pe];b++) | |
10304 | ||
10305 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta); | |
10306 | ||
489d5531 | 10307 | //================================================================================================================================== |
10308 | ||
0328db2d | 10309 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoops(AliFlowEventSimple * const anEvent) |
489d5531 | 10310 | { |
10311 | // Evaluate with nested loops multiparticle correlations for integrated flow (without using the particle weights). | |
10312 | ||
10313 | // Remark: Results are stored in profile fIntFlowDirectCorrelations whose binning is organized as follows: | |
10314 | // | |
10315 | // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))> | |
10316 | // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))> | |
10317 | // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))> | |
10318 | // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))> | |
10319 | // 5th bin: ---- EMPTY ---- | |
10320 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))> | |
10321 | // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))> | |
10322 | // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))> | |
10323 | // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))> | |
10324 | // 10th bin: ---- EMPTY ---- | |
10325 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))> | |
10326 | // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))> | |
10327 | // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))> | |
10328 | // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))> | |
10329 | // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))> | |
10330 | // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))> | |
10331 | // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> | |
10332 | // 18th bin: ---- EMPTY ---- | |
10333 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))> | |
10334 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))> | |
10335 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))> | |
10336 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))> | |
10337 | // 23rd bin: ---- EMPTY ---- | |
10338 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> | |
10339 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))> | |
10340 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))> | |
10341 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))> | |
10342 | // 28th bin: ---- EMPTY ---- | |
10343 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> | |
10344 | // 30th bin: ---- EMPTY ---- | |
10345 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> | |
8ed4edc7 | 10346 | // 32nd bin: ---- EMPTY ---- |
10347 | // 33rd bin: <4>_{4n,2n|3n,3n}= four4n2n3n3n = <cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4))> | |
10348 | // 34th bin: <5>_{2n,2n,2n|3n,3n} = five2n2n2n3n3n = <cos(n*(2.*phi1+2.*phi2+2.*phi3-3.*phi4-3.*phi5))> | |
10349 | ||
489d5531 | 10350 | Int_t nPrim = anEvent->NumberOfTracks(); |
10351 | AliFlowTrackSimple *aftsTrack = NULL; | |
10352 | Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; | |
10353 | Int_t n = fHarmonic; | |
10354 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 10355 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 10356 | cout<<endl; |
10357 | cout<<"Multiparticle correlations: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
10358 | if(dMult<2) | |
10359 | { | |
10360 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
10361 | } else if (dMult>fMaxAllowedMultiplicity) | |
10362 | { | |
10363 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
10364 | } else | |
10365 | { | |
10366 | cout<<"... evaluating nested loops (without using particle weights)..."<<endl; | |
10367 | } | |
10368 | ||
10369 | // 2-particle correlations: | |
10370 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
10371 | { | |
10372 | for(Int_t i1=0;i1<nPrim;i1++) | |
10373 | { | |
10374 | aftsTrack=anEvent->GetTrack(i1); | |
10375 | if(!(aftsTrack->InRPSelection())) continue; | |
10376 | phi1=aftsTrack->Phi(); | |
10377 | for(Int_t i2=0;i2<nPrim;i2++) | |
10378 | { | |
10379 | if(i2==i1)continue; | |
10380 | aftsTrack=anEvent->GetTrack(i2); | |
10381 | if(!(aftsTrack->InRPSelection())) continue; | |
10382 | phi2=aftsTrack->Phi(); | |
10383 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
10384 | // fill the profile with 2-p correlations: | |
10385 | fIntFlowDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),1.); // <cos(n*(phi1-phi2))> | |
10386 | fIntFlowDirectCorrelations->Fill(1.5,cos(2.*n*(phi1-phi2)),1.); // <cos(2n*(phi1-phi2))> | |
10387 | fIntFlowDirectCorrelations->Fill(2.5,cos(3.*n*(phi1-phi2)),1.); // <cos(3n*(phi1-phi2))> | |
10388 | fIntFlowDirectCorrelations->Fill(3.5,cos(4.*n*(phi1-phi2)),1.); // <cos(4n*(phi1-phi2))> | |
10389 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10390 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10391 | } // end of if(nPrim>=2) | |
10392 | ||
10393 | // 3-particle correlations: | |
10394 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
10395 | { | |
10396 | for(Int_t i1=0;i1<nPrim;i1++) | |
10397 | { | |
10398 | aftsTrack=anEvent->GetTrack(i1); | |
10399 | if(!(aftsTrack->InRPSelection())) continue; | |
10400 | phi1=aftsTrack->Phi(); | |
10401 | for(Int_t i2=0;i2<nPrim;i2++) | |
10402 | { | |
10403 | if(i2==i1)continue; | |
10404 | aftsTrack=anEvent->GetTrack(i2); | |
10405 | if(!(aftsTrack->InRPSelection())) continue; | |
10406 | phi2=aftsTrack->Phi(); | |
10407 | for(Int_t i3=0;i3<nPrim;i3++) | |
10408 | { | |
10409 | if(i3==i1||i3==i2)continue; | |
10410 | aftsTrack=anEvent->GetTrack(i3); | |
10411 | if(!(aftsTrack->InRPSelection())) continue; | |
10412 | phi3=aftsTrack->Phi(); | |
10413 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
10414 | // fill the profile with 3-p correlations: | |
10415 | fIntFlowDirectCorrelations->Fill(5.,cos(2.*n*phi1-n*(phi2+phi3)),1.); //<3>_{2n|nn,n} | |
10416 | fIntFlowDirectCorrelations->Fill(6.,cos(3.*n*phi1-2.*n*phi2-n*phi3),1.); //<3>_{3n|2n,n} | |
10417 | fIntFlowDirectCorrelations->Fill(7.,cos(4.*n*phi1-2.*n*phi2-2.*n*phi3),1.); //<3>_{4n|2n,2n} | |
10418 | fIntFlowDirectCorrelations->Fill(8.,cos(4.*n*phi1-3.*n*phi2-n*phi3),1.); //<3>_{4n|3n,n} | |
10419 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10420 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10421 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10422 | } // end of if(nPrim>=3) | |
10423 | ||
10424 | // 4-particle correlations: | |
10425 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) | |
10426 | { | |
10427 | for(Int_t i1=0;i1<nPrim;i1++) | |
10428 | { | |
10429 | aftsTrack=anEvent->GetTrack(i1); | |
10430 | if(!(aftsTrack->InRPSelection())) continue; | |
10431 | phi1=aftsTrack->Phi(); | |
10432 | for(Int_t i2=0;i2<nPrim;i2++) | |
10433 | { | |
10434 | if(i2==i1)continue; | |
10435 | aftsTrack=anEvent->GetTrack(i2); | |
10436 | if(!(aftsTrack->InRPSelection())) continue; | |
10437 | phi2=aftsTrack->Phi(); | |
10438 | for(Int_t i3=0;i3<nPrim;i3++) | |
10439 | { | |
10440 | if(i3==i1||i3==i2)continue; | |
10441 | aftsTrack=anEvent->GetTrack(i3); | |
10442 | if(!(aftsTrack->InRPSelection())) continue; | |
10443 | phi3=aftsTrack->Phi(); | |
10444 | for(Int_t i4=0;i4<nPrim;i4++) | |
10445 | { | |
10446 | if(i4==i1||i4==i2||i4==i3)continue; | |
10447 | aftsTrack=anEvent->GetTrack(i4); | |
10448 | if(!(aftsTrack->InRPSelection())) continue; | |
10449 | phi4=aftsTrack->Phi(); | |
10450 | if(nPrim==4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; | |
10451 | // fill the profile with 4-p correlations: | |
10452 | fIntFlowDirectCorrelations->Fill(10.,cos(n*phi1+n*phi2-n*phi3-n*phi4),1.); // <4>_{n,n|n,n} | |
10453 | fIntFlowDirectCorrelations->Fill(11.,cos(2.*n*phi1+n*phi2-2.*n*phi3-n*phi4),1.); // <4>_{2n,n|2n,n} | |
10454 | fIntFlowDirectCorrelations->Fill(12.,cos(2.*n*phi1+2*n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{2n,2n|2n,2n} | |
10455 | fIntFlowDirectCorrelations->Fill(13.,cos(3.*n*phi1-n*phi2-n*phi3-n*phi4),1.); // <4>_{3n|n,n,n} | |
10456 | fIntFlowDirectCorrelations->Fill(14.,cos(3.*n*phi1+n*phi2-3.*n*phi3-n*phi4),1.); // <4>_{3n,n|3n,n} | |
10457 | fIntFlowDirectCorrelations->Fill(15.,cos(3.*n*phi1+n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{3n,n|2n,2n} | |
10458 | fIntFlowDirectCorrelations->Fill(16.,cos(4.*n*phi1-2.*n*phi2-n*phi3-n*phi4),1.); // <4>_{4n|2n,n,n} | |
8ed4edc7 | 10459 | fIntFlowDirectCorrelations->Fill(32.,cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4)),1.); // <4>_{4n,2n|3n,3n} |
489d5531 | 10460 | } // end of for(Int_t i4=0;i4<nPrim;i4++) |
10461 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10462 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10463 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10464 | } // end of if(nPrim>=) | |
10465 | ||
10466 | // 5-particle correlations: | |
10467 | if(nPrim>=5 && nPrim<=fMaxAllowedMultiplicity) | |
10468 | { | |
10469 | for(Int_t i1=0;i1<nPrim;i1++) | |
10470 | { | |
10471 | aftsTrack=anEvent->GetTrack(i1); | |
10472 | if(!(aftsTrack->InRPSelection())) continue; | |
10473 | phi1=aftsTrack->Phi(); | |
10474 | for(Int_t i2=0;i2<nPrim;i2++) | |
10475 | { | |
10476 | if(i2==i1)continue; | |
10477 | aftsTrack=anEvent->GetTrack(i2); | |
10478 | if(!(aftsTrack->InRPSelection())) continue; | |
10479 | phi2=aftsTrack->Phi(); | |
10480 | for(Int_t i3=0;i3<nPrim;i3++) | |
10481 | { | |
10482 | if(i3==i1||i3==i2)continue; | |
10483 | aftsTrack=anEvent->GetTrack(i3); | |
10484 | if(!(aftsTrack->InRPSelection())) continue; | |
10485 | phi3=aftsTrack->Phi(); | |
10486 | for(Int_t i4=0;i4<nPrim;i4++) | |
10487 | { | |
10488 | if(i4==i1||i4==i2||i4==i3)continue; | |
10489 | aftsTrack=anEvent->GetTrack(i4); | |
10490 | if(!(aftsTrack->InRPSelection())) continue; | |
10491 | phi4=aftsTrack->Phi(); | |
10492 | for(Int_t i5=0;i5<nPrim;i5++) | |
10493 | { | |
10494 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
10495 | aftsTrack=anEvent->GetTrack(i5); | |
10496 | if(!(aftsTrack->InRPSelection())) continue; | |
10497 | phi5=aftsTrack->Phi(); | |
10498 | if(nPrim==5) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<"\r"<<flush; | |
10499 | // fill the profile with 5-p correlations: | |
10500 | fIntFlowDirectCorrelations->Fill(18.,cos(2.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5),1.); //<5>_{2n,n|n,n,n} | |
10501 | fIntFlowDirectCorrelations->Fill(19.,cos(2.*n*phi1+2.*n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); //<5>_{2n,2n|2n,n,n} | |
10502 | fIntFlowDirectCorrelations->Fill(20.,cos(3.*n*phi1+n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); //<5>_{3n,n|2n,n,n} | |
10503 | fIntFlowDirectCorrelations->Fill(21.,cos(4.*n*phi1-n*phi2-n*phi3-n*phi4-n*phi5),1.); //<5>_{4n|n,n,n,n} | |
8ed4edc7 | 10504 | fIntFlowDirectCorrelations->Fill(33.,cos(2.*n*phi1+2.*n*phi2+2.*n*phi3-3.*n*phi4-3.*n*phi5),1.); |
489d5531 | 10505 | } // end of for(Int_t i5=0;i5<nPrim;i5++) |
10506 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
10507 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10508 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10509 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10510 | } // end of if(nPrim>=5) | |
10511 | ||
10512 | // 6-particle correlations: | |
10513 | if(nPrim>=6 && nPrim<=fMaxAllowedMultiplicity) | |
10514 | { | |
10515 | for(Int_t i1=0;i1<nPrim;i1++) | |
10516 | { | |
10517 | aftsTrack=anEvent->GetTrack(i1); | |
10518 | if(!(aftsTrack->InRPSelection())) continue; | |
10519 | phi1=aftsTrack->Phi(); | |
10520 | for(Int_t i2=0;i2<nPrim;i2++) | |
10521 | { | |
10522 | if(i2==i1)continue; | |
10523 | aftsTrack=anEvent->GetTrack(i2); | |
10524 | if(!(aftsTrack->InRPSelection())) continue; | |
10525 | phi2=aftsTrack->Phi(); | |
10526 | for(Int_t i3=0;i3<nPrim;i3++) | |
10527 | { | |
10528 | if(i3==i1||i3==i2)continue; | |
10529 | aftsTrack=anEvent->GetTrack(i3); | |
10530 | if(!(aftsTrack->InRPSelection())) continue; | |
10531 | phi3=aftsTrack->Phi(); | |
10532 | for(Int_t i4=0;i4<nPrim;i4++) | |
10533 | { | |
10534 | if(i4==i1||i4==i2||i4==i3)continue; | |
10535 | aftsTrack=anEvent->GetTrack(i4); | |
10536 | if(!(aftsTrack->InRPSelection())) continue; | |
10537 | phi4=aftsTrack->Phi(); | |
10538 | for(Int_t i5=0;i5<nPrim;i5++) | |
10539 | { | |
10540 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
10541 | aftsTrack=anEvent->GetTrack(i5); | |
10542 | if(!(aftsTrack->InRPSelection())) continue; | |
10543 | phi5=aftsTrack->Phi(); | |
10544 | for(Int_t i6=0;i6<nPrim;i6++) | |
10545 | { | |
10546 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
10547 | aftsTrack=anEvent->GetTrack(i6); | |
10548 | if(!(aftsTrack->InRPSelection())) continue; | |
10549 | phi6=aftsTrack->Phi(); | |
10550 | if(nPrim==6) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<"\r"<<flush; | |
10551 | // fill the profile with 6-p correlations: | |
10552 | fIntFlowDirectCorrelations->Fill(23.,cos(n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{n,n,n|n,n,n} | |
10553 | fIntFlowDirectCorrelations->Fill(24.,cos(2.*n*phi1+n*phi2+n*phi3-2.*n*phi4-n*phi5-n*phi6),1.); //<6>_{2n,n,n|2n,n,n} | |
10554 | fIntFlowDirectCorrelations->Fill(25.,cos(2.*n*phi1+2.*n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{2n,2n|n,n,n,n} | |
10555 | fIntFlowDirectCorrelations->Fill(26.,cos(3.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{3n,n|n,n,n,n} | |
10556 | } // end of for(Int_t i6=0;i6<nPrim;i6++) | |
10557 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
10558 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
10559 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10560 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10561 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10562 | } // end of if(nPrim>=6) | |
10563 | ||
10564 | // 7-particle correlations: | |
10565 | if(nPrim>=7 && nPrim<=fMaxAllowedMultiplicity) | |
10566 | { | |
10567 | for(Int_t i1=0;i1<nPrim;i1++) | |
10568 | { | |
10569 | aftsTrack=anEvent->GetTrack(i1); | |
10570 | if(!(aftsTrack->InRPSelection())) continue; | |
10571 | phi1=aftsTrack->Phi(); | |
10572 | for(Int_t i2=0;i2<nPrim;i2++) | |
10573 | { | |
10574 | if(i2==i1)continue; | |
10575 | aftsTrack=anEvent->GetTrack(i2); | |
10576 | if(!(aftsTrack->InRPSelection())) continue; | |
10577 | phi2=aftsTrack->Phi(); | |
10578 | for(Int_t i3=0;i3<nPrim;i3++) | |
10579 | { | |
10580 | if(i3==i1||i3==i2)continue; | |
10581 | aftsTrack=anEvent->GetTrack(i3); | |
10582 | if(!(aftsTrack->InRPSelection())) continue; | |
10583 | phi3=aftsTrack->Phi(); | |
10584 | for(Int_t i4=0;i4<nPrim;i4++) | |
10585 | { | |
10586 | if(i4==i1||i4==i2||i4==i3)continue; | |
10587 | aftsTrack=anEvent->GetTrack(i4); | |
10588 | if(!(aftsTrack->InRPSelection())) continue; | |
10589 | phi4=aftsTrack->Phi(); | |
10590 | for(Int_t i5=0;i5<nPrim;i5++) | |
10591 | { | |
10592 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
10593 | aftsTrack=anEvent->GetTrack(i5); | |
10594 | if(!(aftsTrack->InRPSelection())) continue; | |
10595 | phi5=aftsTrack->Phi(); | |
10596 | for(Int_t i6=0;i6<nPrim;i6++) | |
10597 | { | |
10598 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
10599 | aftsTrack=anEvent->GetTrack(i6); | |
10600 | if(!(aftsTrack->InRPSelection())) continue; | |
10601 | phi6=aftsTrack->Phi(); | |
10602 | for(Int_t i7=0;i7<nPrim;i7++) | |
10603 | { | |
10604 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; | |
10605 | aftsTrack=anEvent->GetTrack(i7); | |
10606 | if(!(aftsTrack->InRPSelection())) continue; | |
10607 | phi7=aftsTrack->Phi(); | |
10608 | if(nPrim==7) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<" "<<i7<<"\r"<<flush; | |
10609 | // fill the profile with 7-p correlation: | |
10610 | fIntFlowDirectCorrelations->Fill(28.,cos(2.*n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6-n*phi7),1.); // <7>_{2n,n,n|n,n,n,n} | |
10611 | } // end of for(Int_t i7=0;i7<nPrim;i7++) | |
10612 | } // end of for(Int_t i6=0;i6<nPrim;i6++) | |
10613 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
10614 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
10615 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10616 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10617 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10618 | } // end of if(nPrim>=7) | |
10619 | ||
10620 | // 8-particle correlations: | |
10621 | if(nPrim>=8 && nPrim<=fMaxAllowedMultiplicity) | |
10622 | { | |
10623 | for(Int_t i1=0;i1<nPrim;i1++) | |
10624 | { | |
10625 | aftsTrack=anEvent->GetTrack(i1); | |
10626 | if(!(aftsTrack->InRPSelection())) continue; | |
10627 | phi1=aftsTrack->Phi(); | |
10628 | for(Int_t i2=0;i2<nPrim;i2++) | |
10629 | { | |
10630 | if(i2==i1)continue; | |
10631 | aftsTrack=anEvent->GetTrack(i2); | |
10632 | if(!(aftsTrack->InRPSelection())) continue; | |
10633 | phi2=aftsTrack->Phi(); | |
10634 | for(Int_t i3=0;i3<nPrim;i3++) | |
10635 | { | |
10636 | if(i3==i1||i3==i2)continue; | |
10637 | aftsTrack=anEvent->GetTrack(i3); | |
10638 | if(!(aftsTrack->InRPSelection())) continue; | |
10639 | phi3=aftsTrack->Phi(); | |
10640 | for(Int_t i4=0;i4<nPrim;i4++) | |
10641 | { | |
10642 | if(i4==i1||i4==i2||i4==i3)continue; | |
10643 | aftsTrack=anEvent->GetTrack(i4); | |
10644 | if(!(aftsTrack->InRPSelection())) continue; | |
10645 | phi4=aftsTrack->Phi(); | |
10646 | for(Int_t i5=0;i5<nPrim;i5++) | |
10647 | { | |
10648 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
10649 | aftsTrack=anEvent->GetTrack(i5); | |
10650 | if(!(aftsTrack->InRPSelection())) continue; | |
10651 | phi5=aftsTrack->Phi(); | |
10652 | for(Int_t i6=0;i6<nPrim;i6++) | |
10653 | { | |
10654 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
10655 | aftsTrack=anEvent->GetTrack(i6); | |
10656 | if(!(aftsTrack->InRPSelection())) continue; | |
10657 | phi6=aftsTrack->Phi(); | |
10658 | for(Int_t i7=0;i7<nPrim;i7++) | |
10659 | { | |
10660 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; | |
10661 | aftsTrack=anEvent->GetTrack(i7); | |
10662 | if(!(aftsTrack->InRPSelection())) continue; | |
10663 | phi7=aftsTrack->Phi(); | |
10664 | for(Int_t i8=0;i8<nPrim;i8++) | |
10665 | { | |
10666 | if(i8==i1||i8==i2||i8==i3||i8==i4||i8==i5||i8==i6||i8==i7)continue; | |
10667 | aftsTrack=anEvent->GetTrack(i8); | |
10668 | if(!(aftsTrack->InRPSelection())) continue; | |
10669 | phi8=aftsTrack->Phi(); | |
10670 | cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<" "<<i7<<" "<<i8<<"\r"<<flush; | |
10671 | // fill the profile with 8-p correlation: | |
10672 | fIntFlowDirectCorrelations->Fill(30.,cos(n*phi1+n*phi2+n*phi3+n*phi4-n*phi5-n*phi6-n*phi7-n*phi8),1.); // <8>_{n,n,n,n|n,n,n,n} | |
10673 | } // end of for(Int_t i8=0;i8<nPrim;i8++) | |
10674 | } // end of for(Int_t i7=0;i7<nPrim;i7++) | |
10675 | } // end of for(Int_t i6=0;i6<nPrim;i6++) | |
10676 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
10677 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
10678 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10679 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10680 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10681 | } // end of if(nPrim>=8) | |
10682 | ||
10683 | cout<<endl; | |
10684 | ||
10685 | } // end of AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent) | |
10686 | ||
10687 | ||
10688 | //================================================================================================================================== | |
10689 | ||
10690 | ||
10691 | void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrelations() | |
10692 | { | |
10693 | // Cross-check results for multiparticle correlations needed for int. flow: results from Q-vectors vs results from nested loops. | |
10694 | ||
10695 | cout<<endl; | |
10696 | cout<<endl; | |
10697 | cout<<" *****************************************"<<endl; | |
10698 | cout<<" **** cross-checking the correlations ****"<<endl; | |
10699 | cout<<" **** for integrated flow ****"<<endl; | |
10700 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
10701 | { | |
10702 | cout<<" **** (particle weights not used) ****"<<endl; | |
10703 | } else | |
10704 | { | |
10705 | cout<<" **** (particle weights used) ****"<<endl; | |
10706 | } | |
10707 | cout<<" *****************************************"<<endl; | |
10708 | cout<<endl; | |
10709 | cout<<endl; | |
10710 | ||
8ed4edc7 | 10711 | Int_t ciMax = 34; // to be improved (removed eventually when I calculate 6th and 8th order with particle weights) |
489d5531 | 10712 | |
10713 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
10714 | { | |
10715 | ciMax = 11; | |
10716 | } | |
10717 | ||
10718 | for(Int_t ci=1;ci<=ciMax;ci++) | |
10719 | { | |
10720 | if(strcmp((fIntFlowCorrelationsAllPro->GetXaxis())->GetBinLabel(ci), "") == 0) continue; // to be improved (access finalized histogram here) | |
10721 | cout<<(fIntFlowCorrelationsAllPro->GetXaxis())->GetBinLabel(ci)<<":"<<endl; // to be improved (access finalized histogram here) | |
10722 | cout<<"from Q-vectors = "<<fIntFlowCorrelationsAllPro->GetBinContent(ci)<<endl; // to be improved (access finalized histogram here) | |
10723 | cout<<"from nested loops = "<<fIntFlowDirectCorrelations->GetBinContent(ci)<<endl; | |
10724 | cout<<endl; | |
10725 | } | |
10726 | ||
10727 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrelations() | |
10728 | ||
10729 | ||
10730 | //================================================================================================================================ | |
10731 | ||
10732 | ||
10733 | void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrectionTermsForNUA() | |
10734 | { | |
10735 | // Cross-check results for corrections terms for non-uniform acceptance needed for int. flow: results from Q-vectors vs results from nested loops. | |
10736 | ||
10737 | cout<<endl; | |
10738 | cout<<endl; | |
10739 | cout<<" *********************************************"<<endl; | |
10740 | cout<<" **** cross-checking the correction terms ****"<<endl; | |
10741 | cout<<" **** for non-uniform acceptance relevant ****"<<endl; | |
10742 | cout<<" **** for integrated flow ****"<<endl; | |
10743 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
10744 | { | |
10745 | cout<<" **** (particle weights not used) ****"<<endl; | |
10746 | } else | |
10747 | { | |
10748 | cout<<" **** (particle weights used) ****"<<endl; | |
10749 | } | |
10750 | cout<<" *********************************************"<<endl; | |
10751 | cout<<endl; | |
10752 | cout<<endl; | |
10753 | ||
b92ea2b9 | 10754 | for(Int_t ci=1;ci<=4;ci++) // correction term index (to be improved - hardwired 4) |
489d5531 | 10755 | { |
10756 | for(Int_t sc=0;sc<2;sc++) // sin or cos term | |
10757 | { | |
10758 | if(strcmp((fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->GetBinLabel(ci), "") == 0) continue; // to be improved (access finalized histogram here) | |
10759 | cout<<(fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->GetBinLabel(ci)<<":"<<endl; // to be improved (access finalized histogram here) | |
10760 | cout<<"from Q-vectors = "<<fIntFlowCorrectionTermsForNUAPro[sc]->GetBinContent(ci)<<endl; // to be improved (access finalized histogram here) | |
10761 | cout<<"from nested loops = "<<fIntFlowDirectCorrectionTermsForNUA[sc]->GetBinContent(ci)<<endl; | |
10762 | cout<<endl; | |
10763 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos term | |
10764 | } // end of for(Int_t ci=1;ci<=10;ci++) // correction term index | |
10765 | ||
10766 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrectionTermsForNUA() | |
10767 | ||
10768 | ||
10769 | //================================================================================================================================ | |
10770 | ||
10771 | ||
0328db2d | 10772 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent) |
489d5531 | 10773 | { |
10774 | // Evaluate with nested loops multiparticle correlations for integrated flow (using the particle weights). | |
10775 | ||
10776 | // Results are stored in profile fIntFlowDirectCorrelations. | |
10777 | // Remark 1: When particle weights are used the binning of fIntFlowDirectCorrelations is organized as follows: | |
10778 | // | |
10779 | // 1st bin: <2>_{1n|1n} = two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))> | |
10780 | // 2nd bin: <2>_{2n|2n} = two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
10781 | // 3rd bin: <2>_{3n|3n} = two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
10782 | // 4th bin: <2>_{4n|4n} = two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
10783 | // 5th bin: ---- EMPTY ---- | |
10784 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
10785 | // 7th bin: <3>_{3n|2n,1n} = ... | |
10786 | // 8th bin: <3>_{4n|2n,2n} = ... | |
10787 | // 9th bin: <3>_{4n|3n,1n} = ... | |
10788 | // 10th bin: ---- EMPTY ---- | |
10789 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
10790 | // 12th bin: <4>_{2n,1n|2n,1n} = ... | |
10791 | // 13th bin: <4>_{2n,2n|2n,2n} = ... | |
10792 | // 14th bin: <4>_{3n|1n,1n,1n} = ... | |
10793 | // 15th bin: <4>_{3n,1n|3n,1n} = ... | |
10794 | // 16th bin: <4>_{3n,1n|2n,2n} = ... | |
10795 | // 17th bin: <4>_{4n|2n,1n,1n} = ... | |
10796 | // 18th bin: ---- EMPTY ---- | |
10797 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = ... | |
10798 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = ... | |
10799 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = ... | |
10800 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = ... | |
10801 | // 23rd bin: ---- EMPTY ---- | |
10802 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = ... | |
10803 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = ... | |
10804 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = ... | |
10805 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = ... | |
10806 | // 28th bin: ---- EMPTY ---- | |
10807 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = ... | |
10808 | // 30th bin: ---- EMPTY ---- | |
10809 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = ... | |
57340a27 | 10810 | |
489d5531 | 10811 | // Remark 2: When particle weights are used there are some extra correlations. They are stored in |
10812 | // fIntFlowExtraDirectCorrelations binning of which is organized as follows: | |
57340a27 | 10813 | |
489d5531 | 10814 | // 1st bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))> |
10815 | // 2nd bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
10816 | // ... | |
57340a27 | 10817 | |
489d5531 | 10818 | Int_t nPrim = anEvent->NumberOfTracks(); |
10819 | AliFlowTrackSimple *aftsTrack = NULL; | |
10820 | //Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; | |
10821 | //Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
10822 | Double_t phi1=0., phi2=0., phi3=0., phi4=0.; | |
10823 | Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1.; | |
10824 | Int_t n = fHarmonic; | |
10825 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 10826 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 10827 | cout<<endl; |
10828 | cout<<"Multiparticle correlations: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
10829 | if(dMult<2) | |
10830 | { | |
10831 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
10832 | } else if (dMult>fMaxAllowedMultiplicity) | |
10833 | { | |
10834 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
10835 | } else | |
10836 | { | |
10837 | cout<<"... evaluating nested loops (using particle weights) ..."<<endl; | |
10838 | } | |
10839 | ||
10840 | // 2-particle correlations: | |
10841 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
10842 | { | |
10843 | // 2 nested loops multiparticle correlations using particle weights: | |
10844 | for(Int_t i1=0;i1<nPrim;i1++) | |
10845 | { | |
10846 | aftsTrack=anEvent->GetTrack(i1); | |
10847 | if(!(aftsTrack->InRPSelection())) continue; | |
10848 | phi1=aftsTrack->Phi(); | |
10849 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
10850 | for(Int_t i2=0;i2<nPrim;i2++) | |
10851 | { | |
10852 | if(i2==i1)continue; | |
10853 | aftsTrack=anEvent->GetTrack(i2); | |
10854 | if(!(aftsTrack->InRPSelection())) continue; | |
10855 | phi2=aftsTrack->Phi(); | |
10856 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
10857 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
10858 | // 2-p correlations using particle weights: | |
10859 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),wPhi1*wPhi2); // <w1 w2 cos( n*(phi1-phi2))> | |
10860 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(1.5,cos(2.*n*(phi1-phi2)),pow(wPhi1,2)*pow(wPhi2,2)); // <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
10861 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(2.5,cos(3.*n*(phi1-phi2)),pow(wPhi1,3)*pow(wPhi2,3)); // <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
10862 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(3.5,cos(4.*n*(phi1-phi2)),pow(wPhi1,4)*pow(wPhi2,4)); // <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
10863 | // extra correlations: | |
10864 | // 2-p extra correlations (do not appear if particle weights are not used): | |
10865 | if(fUsePhiWeights) fIntFlowExtraDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),pow(wPhi1,3)*wPhi2); // <w1^3 w2 cos(n*(phi1-phi2))> | |
10866 | // ... | |
10867 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10868 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10869 | } // end of if(nPrim>=2) | |
10870 | ||
10871 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
57340a27 | 10872 | { |
489d5531 | 10873 | // 3 nested loops multiparticle correlations using particle weights: |
10874 | for(Int_t i1=0;i1<nPrim;i1++) | |
57340a27 | 10875 | { |
489d5531 | 10876 | aftsTrack=anEvent->GetTrack(i1); |
10877 | if(!(aftsTrack->InRPSelection())) continue; | |
10878 | phi1=aftsTrack->Phi(); | |
10879 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
10880 | for(Int_t i2=0;i2<nPrim;i2++) | |
10881 | { | |
10882 | if(i2==i1)continue; | |
10883 | aftsTrack=anEvent->GetTrack(i2); | |
10884 | if(!(aftsTrack->InRPSelection())) continue; | |
10885 | phi2=aftsTrack->Phi(); | |
10886 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
10887 | for(Int_t i3=0;i3<nPrim;i3++) | |
10888 | { | |
10889 | if(i3==i1||i3==i2)continue; | |
10890 | aftsTrack=anEvent->GetTrack(i3); | |
10891 | if(!(aftsTrack->InRPSelection())) continue; | |
10892 | phi3=aftsTrack->Phi(); | |
10893 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
10894 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
10895 | // 3-p correlations using particle weights: | |
10896 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(5.5,cos(2.*n*phi1-n*(phi2+phi3)),pow(wPhi1,2)*wPhi2*wPhi3); // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
10897 | // ... | |
10898 | // extra correlations: | |
10899 | // 2-p extra correlations (do not appear if particle weights are not used): | |
10900 | if(fUsePhiWeights) fIntFlowExtraDirectCorrelations->Fill(1.5,cos(n*(phi1-phi2)),wPhi1*wPhi2*pow(wPhi3,2)); // <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
10901 | // ... | |
10902 | // 3-p extra correlations (do not appear if particle weights are not used): | |
10903 | // ... | |
10904 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10905 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10906 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10907 | } // end of if(nPrim>=3) | |
57340a27 | 10908 | |
489d5531 | 10909 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) |
10910 | { | |
10911 | // 4 nested loops multiparticle correlations using particle weights: | |
10912 | for(Int_t i1=0;i1<nPrim;i1++) | |
10913 | { | |
10914 | aftsTrack=anEvent->GetTrack(i1); | |
10915 | if(!(aftsTrack->InRPSelection())) continue; | |
10916 | phi1=aftsTrack->Phi(); | |
10917 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
10918 | for(Int_t i2=0;i2<nPrim;i2++) | |
10919 | { | |
10920 | if(i2==i1)continue; | |
10921 | aftsTrack=anEvent->GetTrack(i2); | |
10922 | if(!(aftsTrack->InRPSelection())) continue; | |
10923 | phi2=aftsTrack->Phi(); | |
10924 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
10925 | for(Int_t i3=0;i3<nPrim;i3++) | |
10926 | { | |
10927 | if(i3==i1||i3==i2)continue; | |
10928 | aftsTrack=anEvent->GetTrack(i3); | |
10929 | if(!(aftsTrack->InRPSelection())) continue; | |
10930 | phi3=aftsTrack->Phi(); | |
10931 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
10932 | for(Int_t i4=0;i4<nPrim;i4++) | |
10933 | { | |
10934 | if(i4==i1||i4==i2||i4==i3)continue; | |
10935 | aftsTrack=anEvent->GetTrack(i4); | |
10936 | if(!(aftsTrack->InRPSelection())) continue; | |
10937 | phi4=aftsTrack->Phi(); | |
10938 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); | |
10939 | if(nPrim>=4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; // to be improved (replace eventually this if statement with if(nPrim==4)) | |
10940 | // 4-p correlations using particle weights: | |
10941 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(10.5,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); | |
10942 | // extra correlations: | |
10943 | // 2-p extra correlations (do not appear if particle weights are not used): | |
10944 | // ... | |
10945 | // 3-p extra correlations (do not appear if particle weights are not used): | |
10946 | // ... | |
10947 | // 4-p extra correlations (do not appear if particle weights are not used): | |
10948 | // ... | |
10949 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
10950 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10951 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10952 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10953 | } // end of if(nPrim>=4) | |
57340a27 | 10954 | |
489d5531 | 10955 | cout<<endl; |
57340a27 | 10956 | |
489d5531 | 10957 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent) |
57340a27 | 10958 | |
489d5531 | 10959 | |
10960 | //================================================================================================================================ | |
10961 | ||
10962 | ||
10963 | void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowExtraCorrelations() | |
57340a27 | 10964 | { |
489d5531 | 10965 | // Cross-check results for extra multiparticle correlations needed for int. flow |
10966 | // which appear only when particle weights are used: results from Q-vectors vs results from nested loops. | |
57340a27 | 10967 | |
489d5531 | 10968 | cout<<endl; |
10969 | cout<<endl; | |
10970 | cout<<" ***********************************************"<<endl; | |
10971 | cout<<" **** cross-checking the extra correlations ****"<<endl; | |
10972 | cout<<" **** for integrated flow ****"<<endl; | |
10973 | cout<<" ***********************************************"<<endl; | |
10974 | cout<<endl; | |
10975 | cout<<endl; | |
10976 | ||
10977 | for(Int_t eci=1;eci<=2;eci++) // to be improved (increased eciMax eventually when I calculate 6th and 8th) | |
57340a27 | 10978 | { |
489d5531 | 10979 | if(strcmp((fIntFlowExtraCorrelationsPro->GetXaxis())->GetBinLabel(eci), "") == 0) continue; |
10980 | cout<<(fIntFlowExtraCorrelationsPro->GetXaxis())->GetBinLabel(eci)<<":"<<endl; | |
10981 | cout<<"from Q-vectors = "<<fIntFlowExtraCorrelationsPro->GetBinContent(eci)<<endl; | |
10982 | cout<<"from nested loops = "<<fIntFlowExtraDirectCorrelations->GetBinContent(eci)<<endl; | |
10983 | cout<<endl; | |
10984 | } | |
57340a27 | 10985 | |
489d5531 | 10986 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowExtraCorrelations() |
57340a27 | 10987 | |
10988 | ||
489d5531 | 10989 | //================================================================================================================================ |
3b552efe | 10990 | |
10991 | ||
0328db2d | 10992 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoops(AliFlowEventSimple * const anEvent) |
489d5531 | 10993 | { |
10994 | // Evaluate with nested loops correction terms for non-uniform acceptance relevant for NONAME integrated flow (to be improved (name)). | |
10995 | // | |
10996 | // Remark: Both sin and cos correction terms are calculated in this method. Sin terms are stored in fIntFlowDirectCorrectionTermsForNUA[0], | |
10997 | // and cos terms in fIntFlowDirectCorrectionTermsForNUA[1]. Binning of fIntFlowDirectCorrectionTermsForNUA[sc] is organized as follows | |
10998 | // (sc stands for either sin or cos): | |
10999 | ||
11000 | // 1st bin: <<sc(n*(phi1))>> | |
11001 | // 2nd bin: <<sc(n*(phi1+phi2))>> | |
11002 | // 3rd bin: <<sc(n*(phi1-phi2-phi3))>> | |
11003 | // 4th bin: <<sc(n*(2phi1-phi2))>> | |
11004 | ||
11005 | Int_t nPrim = anEvent->NumberOfTracks(); | |
11006 | AliFlowTrackSimple *aftsTrack = NULL; | |
11007 | Double_t phi1=0., phi2=0., phi3=0.; | |
11008 | Int_t n = fHarmonic; | |
11009 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 11010 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 11011 | cout<<endl; |
11012 | cout<<"Correction terms for non-uniform acceptance: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
11013 | if(dMult<1) | |
3b552efe | 11014 | { |
489d5531 | 11015 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; |
11016 | } else if (dMult>fMaxAllowedMultiplicity) | |
3b552efe | 11017 | { |
489d5531 | 11018 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; |
11019 | } else | |
11020 | { | |
11021 | cout<<"... evaluating nested loops (without using particle weights)..."<<endl; | |
11022 | } | |
11023 | ||
11024 | if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity) | |
11025 | { | |
11026 | // 1-particle correction terms for non-uniform acceptance: | |
11027 | for(Int_t i1=0;i1<nPrim;i1++) | |
11028 | { | |
11029 | aftsTrack=anEvent->GetTrack(i1); | |
11030 | if(!(aftsTrack->InRPSelection())) continue; | |
11031 | phi1=aftsTrack->Phi(); | |
11032 | if(nPrim==1) cout<<i1<<"\r"<<flush; | |
11033 | // sin terms: | |
11034 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(0.5,sin(n*phi1),1.); // <sin(n*phi1)> | |
11035 | // cos terms: | |
11036 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(0.5,cos(n*phi1),1.); // <cos(n*phi1)> | |
11037 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11038 | } // end of if(nPrim>=1) | |
11039 | ||
11040 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
11041 | { | |
11042 | // 2-particle correction terms for non-uniform acceptance: | |
11043 | for(Int_t i1=0;i1<nPrim;i1++) | |
11044 | { | |
11045 | aftsTrack=anEvent->GetTrack(i1); | |
11046 | if(!(aftsTrack->InRPSelection())) continue; | |
11047 | phi1=aftsTrack->Phi(); | |
11048 | for(Int_t i2=0;i2<nPrim;i2++) | |
3b552efe | 11049 | { |
489d5531 | 11050 | if(i2==i1)continue; |
11051 | aftsTrack=anEvent->GetTrack(i2); | |
11052 | if(!(aftsTrack->InRPSelection())) continue; | |
11053 | phi2=aftsTrack->Phi(); | |
11054 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
11055 | // sin terms: | |
3b552efe | 11056 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(1.5,sin(n*(phi1+phi2)),1.); // <<sin(n*(phi1+phi2))>> |
489d5531 | 11057 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(3.5,sin(n*(2*phi1-phi2)),1.); // <<sin(n*(2*phi1-phi2))>> |
11058 | // cos terms: | |
3b552efe | 11059 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(1.5,cos(n*(phi1+phi2)),1.); // <<cos(n*(phi1+phi2))>> |
489d5531 | 11060 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(3.5,cos(n*(2*phi1-phi2)),1.); // <<cos(n*(2*phi1-phi2))>> |
11061 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11062 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11063 | } // end of if(nPrim>=2) | |
11064 | ||
11065 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
11066 | { | |
11067 | // 3-particle correction terms for non-uniform acceptance: | |
11068 | for(Int_t i1=0;i1<nPrim;i1++) | |
11069 | { | |
11070 | aftsTrack=anEvent->GetTrack(i1); | |
11071 | if(!(aftsTrack->InRPSelection())) continue; | |
11072 | phi1=aftsTrack->Phi(); | |
11073 | for(Int_t i2=0;i2<nPrim;i2++) | |
11074 | { | |
11075 | if(i2==i1)continue; | |
11076 | aftsTrack=anEvent->GetTrack(i2); | |
11077 | if(!(aftsTrack->InRPSelection())) continue; | |
11078 | phi2=aftsTrack->Phi(); | |
11079 | for(Int_t i3=0;i3<nPrim;i3++) | |
11080 | { | |
11081 | if(i3==i1||i3==i2)continue; | |
11082 | aftsTrack=anEvent->GetTrack(i3); | |
11083 | if(!(aftsTrack->InRPSelection())) continue; | |
11084 | phi3=aftsTrack->Phi(); | |
11085 | if(nPrim>=3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; // to be improved (eventually I will change this if statement) | |
11086 | // sin terms: | |
11087 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(2.5,sin(n*(phi1-phi2-phi3)),1.); // <<sin(n*(phi1-phi2-phi3))>> | |
11088 | // cos terms: | |
11089 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(2.5,cos(n*(phi1-phi2-phi3)),1.); // <<cos(n*(phi1-phi2-phi3))>> | |
11090 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11091 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11092 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11093 | } // end of if(nPrim>=3) | |
11094 | ||
11095 | cout<<endl; | |
11096 | } | |
11097 | //================================================================================================================================ | |
0328db2d | 11098 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 11099 | { |
11100 | // Evaluate reduced correlations with nested loops without using the particle weights. | |
11101 | ||
11102 | // Remark 1: Reduced correlations are evaluated in pt bin number fCrossCheckInPtBinNo and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
11103 | // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrelations[t][pe][ci], where indices runs as follows: | |
11104 | // [0=RP,1=POI][0=Pt,1=Eta][0=<2'>,1=<4'>,2=<6'>,3=<8'>] | |
11105 | // Remark 3: <2'> = <cos(n*(psi1-phi2))> | |
11106 | // <4'> = <cos(n*(psi1+phi2-phi3-phi4))> | |
11107 | // ... | |
11108 | ||
2a98ceb8 | 11109 | Int_t typeFlag = 0; |
11110 | Int_t ptEtaFlag = 0; | |
489d5531 | 11111 | if(type == "RP") |
11112 | { | |
11113 | typeFlag = 0; | |
11114 | } else if(type == "POI") | |
11115 | { | |
11116 | typeFlag = 1; | |
11117 | } | |
11118 | if(ptOrEta == "Pt") | |
11119 | { | |
11120 | ptEtaFlag = 0; | |
11121 | } else if(ptOrEta == "Eta") | |
11122 | { | |
11123 | ptEtaFlag = 1; | |
11124 | } | |
11125 | // shortcuts: | |
11126 | Int_t t = typeFlag; | |
11127 | Int_t pe = ptEtaFlag; | |
11128 | ||
11129 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
11130 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
11131 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
11132 | ||
11133 | Int_t nPrim = anEvent->NumberOfTracks(); | |
11134 | AliFlowTrackSimple *aftsTrack = NULL; | |
11135 | ||
11136 | Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
11137 | ||
3b552efe | 11138 | Int_t n = fHarmonic; |
489d5531 | 11139 | |
11140 | // 2'-particle correlations: | |
11141 | for(Int_t i1=0;i1<nPrim;i1++) | |
11142 | { | |
11143 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 11144 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
11145 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11146 | { |
11147 | if(ptOrEta == "Pt") | |
11148 | { | |
11149 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11150 | } else if (ptOrEta == "Eta") | |
11151 | { | |
11152 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11153 | } |
11154 | } else // this is diff flow of RPs | |
11155 | { | |
489d5531 | 11156 | if(ptOrEta == "Pt") |
11157 | { | |
11158 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11159 | } else if (ptOrEta == "Eta") | |
11160 | { | |
11161 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11162 | } |
11163 | } | |
489d5531 | 11164 | |
11165 | psi1=aftsTrack->Phi(); | |
11166 | for(Int_t i2=0;i2<nPrim;i2++) | |
11167 | { | |
11168 | if(i2==i1)continue; | |
11169 | aftsTrack=anEvent->GetTrack(i2); | |
11170 | // RP condition (!(first) particle in the correlator must be RP): | |
11171 | if(!(aftsTrack->InRPSelection()))continue; | |
11172 | phi2=aftsTrack->Phi(); | |
11173 | // 2'-particle correlations: | |
11174 | fDiffFlowDirectCorrelations[t][pe][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(1.*n*(psi1-phi2)),1.); // <cos(n*(psi1-phi2)) | |
11175 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
11176 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11177 | ||
11178 | /* | |
11179 | ||
11180 | // 3'-particle correlations: | |
11181 | for(Int_t i1=0;i1<nPrim;i1++) | |
11182 | { | |
11183 | aftsTrack=anEvent->GetTrack(i1); | |
11184 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
11185 | if(ptOrEta == "Pt") | |
11186 | { | |
11187 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11188 | } else if (ptOrEta == "Eta") | |
11189 | { | |
11190 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11191 | } | |
11192 | psi1=aftsTrack->Phi(); | |
11193 | for(Int_t i2=0;i2<nPrim;i2++) | |
11194 | { | |
11195 | if(i2==i1)continue; | |
11196 | aftsTrack=anEvent->GetTrack(i2); | |
11197 | // RP condition (!(first) particle in the correlator must be RP): | |
11198 | if(!(aftsTrack->InRPSelection())) continue; | |
11199 | phi2=aftsTrack->Phi(); | |
11200 | for(Int_t i3=0;i3<nPrim;i3++) | |
11201 | { | |
11202 | if(i3==i1||i3==i2)continue; | |
11203 | aftsTrack=anEvent->GetTrack(i3); | |
11204 | // RP condition (!(first) particle in the correlator must be RP): | |
11205 | if(!(aftsTrack->InRPSelection())) continue; | |
11206 | phi3=aftsTrack->Phi(); | |
11207 | // to be improved : where to store it? ->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(2.*phi1-phi2-phi3)),1.); // <w1 w2 w3 cos(n(2psi1-phi2-phi3))> | |
11208 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
11209 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
11210 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11211 | ||
11212 | */ | |
11213 | ||
11214 | // 4'-particle correlations: | |
11215 | for(Int_t i1=0;i1<nPrim;i1++) | |
11216 | { | |
11217 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 11218 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
11219 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11220 | { |
11221 | if(ptOrEta == "Pt") | |
11222 | { | |
11223 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11224 | } else if (ptOrEta == "Eta") | |
11225 | { | |
11226 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11227 | } |
11228 | } else // this is diff flow of RPs | |
11229 | { | |
489d5531 | 11230 | if(ptOrEta == "Pt") |
11231 | { | |
11232 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11233 | } else if (ptOrEta == "Eta") | |
11234 | { | |
11235 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11236 | } |
11237 | } | |
489d5531 | 11238 | |
11239 | psi1=aftsTrack->Phi(); | |
11240 | for(Int_t i2=0;i2<nPrim;i2++) | |
11241 | { | |
11242 | if(i2==i1) continue; | |
11243 | aftsTrack=anEvent->GetTrack(i2); | |
11244 | // RP condition (!(first) particle in the correlator must be RP): | |
11245 | if(!(aftsTrack->InRPSelection())) continue; | |
11246 | phi2=aftsTrack->Phi(); | |
11247 | for(Int_t i3=0;i3<nPrim;i3++) | |
11248 | { | |
11249 | if(i3==i1||i3==i2) continue; | |
11250 | aftsTrack=anEvent->GetTrack(i3); | |
11251 | // RP condition (!(first) particle in the correlator must be RP): | |
11252 | if(!(aftsTrack->InRPSelection())) continue; | |
11253 | phi3=aftsTrack->Phi(); | |
11254 | for(Int_t i4=0;i4<nPrim;i4++) | |
11255 | { | |
11256 | if(i4==i1||i4==i2||i4==i3) continue; | |
11257 | aftsTrack=anEvent->GetTrack(i4); | |
11258 | // RP condition (!(first) particle in the correlator must be RP): | |
11259 | if(!(aftsTrack->InRPSelection())) continue; | |
11260 | phi4=aftsTrack->Phi(); | |
11261 | // 4'-particle correlations: | |
11262 | fDiffFlowDirectCorrelations[t][pe][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3-phi4)),1.); // <cos(n(psi1+phi2-phi3-phi4))> | |
11263 | }//end of for(Int_t i4=0;i4<nPrim;i4++) | |
11264 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
11265 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
11266 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11267 | ||
11268 | // count # of RPs and POIs in selected pt and eta bins for cross-checkings: | |
3b552efe | 11269 | for(Int_t i=0;i<nPrim;i++) |
11270 | { | |
11271 | aftsTrack=anEvent->GetTrack(i); | |
11272 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
11273 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11274 | { |
11275 | if(ptOrEta == "Pt") | |
11276 | { | |
11277 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11278 | } else if (ptOrEta == "Eta") | |
11279 | { | |
11280 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11281 | } |
11282 | } else // this is diff flow of RPs | |
11283 | { | |
489d5531 | 11284 | if(ptOrEta == "Pt") |
11285 | { | |
11286 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11287 | } else if (ptOrEta == "Eta") | |
11288 | { | |
11289 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11290 | } |
11291 | } | |
11292 | if(t==1)t++; | |
11293 | fNoOfParticlesInBin->Fill(t+pe+0.5); | |
489d5531 | 11294 | } |
11295 | ||
11296 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
11297 | ||
11298 | ||
11299 | //================================================================================================================================ | |
11300 | ||
11301 | ||
11302 | void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrelations(TString type, TString ptOrEta) | |
11303 | { | |
11304 | // Compare correlations needed for diff. flow calculated with nested loops and those calculated from Q-vectors | |
11305 | ||
2a98ceb8 | 11306 | Int_t typeFlag = 0; |
11307 | Int_t ptEtaFlag = 0; | |
489d5531 | 11308 | if(type == "RP") |
11309 | { | |
11310 | typeFlag = 0; | |
11311 | } else if(type == "POI") | |
11312 | { | |
11313 | typeFlag = 1; | |
11314 | } | |
11315 | if(ptOrEta == "Pt") | |
11316 | { | |
11317 | ptEtaFlag = 0; | |
11318 | } else if(ptOrEta == "Eta") | |
11319 | { | |
11320 | ptEtaFlag = 1; | |
11321 | } | |
11322 | // shortcuts: | |
11323 | Int_t t = typeFlag; | |
11324 | Int_t pe = ptEtaFlag; | |
11325 | ||
11326 | TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
11327 | TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
11328 | TString reducedCorrelations[4] = {"<<cos(n(psi1-phi2))>>","<<cos(n(psi1+phi2-phi3-phi4))>>","",""}; // to be improved (access this from pro or hist) | |
11329 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
11330 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
11331 | ||
11332 | Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo}; | |
11333 | ||
11334 | ||
11335 | cout<<endl; | |
11336 | cout<<" *****************************************"<<endl; | |
11337 | cout<<" **** cross-checking the correlations ****"<<endl; | |
11338 | cout<<" **** for differential flow ("<<rpORpoiString[t]<<") ****"<<endl; | |
11339 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
11340 | { | |
11341 | cout<<" **** (particle weights not used) ****"<<endl; | |
11342 | } else | |
11343 | { | |
11344 | cout<<" **** (particle weights used) ****"<<endl; | |
11345 | } | |
11346 | cout<<" *****************************************"<<endl; | |
11347 | cout<<endl; | |
11348 | cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl; | |
11349 | cout<<endl; | |
11350 | ||
11351 | for(Int_t rci=0;rci<2;rci++) // to be improved (calculate 6th and 8th order) | |
11352 | { | |
11353 | cout<<" "<<reducedCorrelations[rci].Data()<<":"<<endl; | |
11354 | cout<<" from Q-vectors = "<<fDiffFlowCorrelationsPro[t][pe][rci]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl; | |
11355 | cout<<" from nested loops = "<<fDiffFlowDirectCorrelations[t][pe][rci]->GetBinContent(1)<<endl; | |
11356 | cout<<endl; | |
11357 | } // end of for(Int_t rci=0;rci<4;rci++) | |
11358 | ||
11359 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrelations(TString type, TString ptOrEta) | |
11360 | ||
3b552efe | 11361 | //================================================================================================================================ |
11362 | ||
489d5531 | 11363 | void AliFlowAnalysisWithQCumulants::PrintNumberOfParticlesInSelectedBin() |
3b552efe | 11364 | { |
11365 | // Print on the screen number of RPs and POIs in selected pt and eta bin for cross checkings. | |
11366 | ||
11367 | cout<<endl; | |
11368 | cout<<"Number of RPs in selected pt bin = "<<fNoOfParticlesInBin->GetBinContent(1)<<endl; | |
11369 | cout<<"Number of RPs in selected eta bin = "<<fNoOfParticlesInBin->GetBinContent(2)<<endl; | |
11370 | cout<<"Number of POIs in selected pt bin = "<<fNoOfParticlesInBin->GetBinContent(3)<<endl; | |
11371 | cout<<"Number of POIs in selected eta bin = "<<fNoOfParticlesInBin->GetBinContent(4)<<endl; | |
11372 | ||
489d5531 | 11373 | } // end of void AliFlowAnalysisWithQCumulants::PrintNumberOfParticlesInSelectedBin() |
11374 | ||
3b552efe | 11375 | //================================================================================================================================ |
11376 | ||
0328db2d | 11377 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 11378 | { |
11379 | // Evaluate reduced correlations with nested loops without using the particle weights. | |
11380 | ||
11381 | // Remark 1: Reduced correlations are evaluated in pt bin number fCrossCheckInPtBinNo and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
11382 | // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrelations[t][pe][ci], where indices runs as follows: | |
11383 | // [0=RP,1=POI][0=Pt,1=Eta][0=<2'>,1=<4'>,2=<6'>,3=<8'>] | |
11384 | // Remark 3: <2'> = <w2 cos(n*(psi1-phi2))> | |
11385 | // <4'> = <w2 w3 w4 cos(n*(psi1+phi2-phi3-phi4))> | |
11386 | // ... | |
11387 | ||
2a98ceb8 | 11388 | Int_t typeFlag = 0; |
11389 | Int_t ptEtaFlag = 0; | |
489d5531 | 11390 | if(type == "RP") |
11391 | { | |
11392 | typeFlag = 0; | |
11393 | } else if(type == "POI") | |
11394 | { | |
11395 | typeFlag = 1; | |
11396 | } | |
11397 | if(ptOrEta == "Pt") | |
11398 | { | |
11399 | ptEtaFlag = 0; | |
11400 | } else if(ptOrEta == "Eta") | |
11401 | { | |
11402 | ptEtaFlag = 1; | |
11403 | } | |
11404 | // shortcuts: | |
11405 | Int_t t = typeFlag; | |
11406 | Int_t pe = ptEtaFlag; | |
11407 | ||
11408 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
11409 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
11410 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
11411 | ||
11412 | Int_t nPrim = anEvent->NumberOfTracks(); | |
11413 | AliFlowTrackSimple *aftsTrack = NULL; | |
11414 | ||
11415 | Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
11416 | Double_t wPhi2=1., wPhi3=1., wPhi4=1.;// wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
11417 | ||
11418 | Int_t n = fHarmonic; | |
11419 | ||
11420 | // 2'-particle correlations: | |
11421 | for(Int_t i1=0;i1<nPrim;i1++) | |
11422 | { | |
11423 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 11424 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
11425 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11426 | { |
11427 | if(ptOrEta == "Pt") | |
11428 | { | |
11429 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11430 | } else if (ptOrEta == "Eta") | |
11431 | { | |
11432 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11433 | } |
11434 | } else // this is diff flow of RPs | |
11435 | { | |
489d5531 | 11436 | if(ptOrEta == "Pt") |
11437 | { | |
11438 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11439 | } else if (ptOrEta == "Eta") | |
11440 | { | |
11441 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11442 | } |
489d5531 | 11443 | } |
11444 | psi1=aftsTrack->Phi(); | |
11445 | for(Int_t i2=0;i2<nPrim;i2++) | |
11446 | { | |
11447 | if(i2==i1) continue; | |
11448 | aftsTrack=anEvent->GetTrack(i2); | |
11449 | // RP condition (!(first) particle in the correlator must be RP): | |
11450 | if(!(aftsTrack->InRPSelection())) continue; | |
11451 | phi2=aftsTrack->Phi(); | |
11452 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
11453 | // 2'-particle correlations: | |
11454 | fDiffFlowDirectCorrelations[t][pe][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(1.*n*(psi1-phi2)),wPhi2); // <w2 cos(n*(psi1-phi2)) | |
11455 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
11456 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11457 | ||
11458 | // 4'-particle correlations: | |
11459 | for(Int_t i1=0;i1<nPrim;i1++) | |
11460 | { | |
11461 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 11462 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
11463 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11464 | { |
11465 | if(ptOrEta == "Pt") | |
11466 | { | |
11467 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11468 | } else if (ptOrEta == "Eta") | |
11469 | { | |
11470 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11471 | } |
11472 | } else // this is diff flow of RPs | |
11473 | { | |
489d5531 | 11474 | if(ptOrEta == "Pt") |
11475 | { | |
11476 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11477 | } else if (ptOrEta == "Eta") | |
11478 | { | |
11479 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11480 | } |
489d5531 | 11481 | } |
11482 | psi1=aftsTrack->Phi(); | |
11483 | for(Int_t i2=0;i2<nPrim;i2++) | |
11484 | { | |
11485 | if(i2==i1) continue; | |
11486 | aftsTrack=anEvent->GetTrack(i2); | |
11487 | // RP condition (!(first) particle in the correlator must be RP): | |
11488 | if(!(aftsTrack->InRPSelection())) continue; | |
11489 | phi2=aftsTrack->Phi(); | |
11490 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
11491 | for(Int_t i3=0;i3<nPrim;i3++) | |
11492 | { | |
11493 | if(i3==i1||i3==i2) continue; | |
11494 | aftsTrack=anEvent->GetTrack(i3); | |
11495 | // RP condition (!(first) particle in the correlator must be RP): | |
11496 | if(!(aftsTrack->InRPSelection())) continue; | |
11497 | phi3=aftsTrack->Phi(); | |
11498 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
11499 | for(Int_t i4=0;i4<nPrim;i4++) | |
11500 | { | |
11501 | if(i4==i1||i4==i2||i4==i3) continue; | |
11502 | aftsTrack=anEvent->GetTrack(i4); | |
11503 | // RP condition (!(first) particle in the correlator must be RP): | |
11504 | if(!(aftsTrack->InRPSelection())) continue; | |
11505 | phi4=aftsTrack->Phi(); | |
11506 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); | |
11507 | // 4'-particle correlations <w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))>: | |
11508 | fDiffFlowDirectCorrelations[t][pe][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3-phi4)),wPhi2*wPhi3*wPhi4); | |
11509 | }//end of for(Int_t i4=0;i4<nPrim;i4++) | |
11510 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
11511 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
11512 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11513 | ||
11514 | // count # of RPs and POIs in selected pt and eta bins for cross-checkings: (to be improved - moved to dedicated method) | |
3b552efe | 11515 | for(Int_t i=0;i<nPrim;i++) |
11516 | { | |
489d5531 | 11517 | aftsTrack=anEvent->GetTrack(i); |
11518 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
11519 | if(typeFlag==1) // this is diff flow of POIs | |
11520 | { | |
11521 | if(ptOrEta == "Pt") | |
11522 | { | |
11523 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11524 | } else if (ptOrEta == "Eta") | |
11525 | { | |
11526 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11527 | } | |
11528 | } else // this is diff flow of RPs | |
11529 | { | |
11530 | if(ptOrEta == "Pt") | |
11531 | { | |
11532 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11533 | } else if (ptOrEta == "Eta") | |
11534 | { | |
11535 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11536 | } | |
11537 | } | |
11538 | if(t==1)t++; | |
11539 | fNoOfParticlesInBin->Fill(t+pe+0.5); | |
11540 | } | |
11541 | ||
11542 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
11543 | ||
11544 | ||
11545 | //================================================================================================================================ | |
11546 | ||
11547 | ||
0328db2d | 11548 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 11549 | { |
11550 | // Evaluate with nested loops correction terms for non-uniform acceptance (both sin and cos terms) relevant for differential flow. | |
11551 | ||
11552 | // Remark 1: Reduced correction terms for non-uniform acceptance are evaluated in pt bin number fCrossCheckInPtBinNo | |
11553 | // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
11554 | // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrections[t][pe][sc][cti], where first three indices runs as: | |
11555 | // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms], whilst the cti (correction term index) runs as follows: | |
11556 | // cti: | |
11557 | // 0: <<sc n(psi1)>> | |
11558 | // 1: <<sc n(psi1+phi2)>> | |
11559 | // 2: <<sc n(psi1+phi2-phi3)>> | |
11560 | // 3: <<sc n(psi1-phi2-phi3)>> | |
11561 | // 4: | |
11562 | // 5: | |
11563 | // 6: | |
11564 | ||
2a98ceb8 | 11565 | Int_t typeFlag = 0; |
11566 | Int_t ptEtaFlag = 0; | |
489d5531 | 11567 | if(type == "RP") |
11568 | { | |
11569 | typeFlag = 0; | |
11570 | } else if(type == "POI") | |
11571 | { | |
11572 | typeFlag = 1; | |
11573 | } | |
11574 | if(ptOrEta == "Pt") | |
11575 | { | |
11576 | ptEtaFlag = 0; | |
11577 | } else if(ptOrEta == "Eta") | |
11578 | { | |
11579 | ptEtaFlag = 1; | |
11580 | } | |
11581 | // shortcuts: | |
11582 | Int_t t = typeFlag; | |
11583 | Int_t pe = ptEtaFlag; | |
11584 | ||
11585 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
11586 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
11587 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
11588 | ||
11589 | Int_t nPrim = anEvent->NumberOfTracks(); | |
11590 | AliFlowTrackSimple *aftsTrack = NULL; | |
11591 | ||
11592 | Double_t psi1=0., phi2=0., phi3=0.;// phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
11593 | ||
11594 | Int_t n = fHarmonic; | |
11595 | ||
11596 | // 1-particle correction terms: | |
11597 | for(Int_t i1=0;i1<nPrim;i1++) | |
11598 | { | |
11599 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 11600 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
11601 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11602 | { |
11603 | if(ptOrEta == "Pt") | |
11604 | { | |
11605 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11606 | } else if (ptOrEta == "Eta") | |
11607 | { | |
11608 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11609 | } |
11610 | } else // this is diff flow of RPs | |
11611 | { | |
489d5531 | 11612 | if(ptOrEta == "Pt") |
11613 | { | |
11614 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11615 | } else if (ptOrEta == "Eta") | |
11616 | { | |
11617 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11618 | } |
11619 | } | |
489d5531 | 11620 | psi1=aftsTrack->Phi(); |
11621 | // sin terms: | |
11622 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*psi1),1.); // <<sin(n*(psi1))>> | |
11623 | // cos terms: | |
11624 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*psi1),1.); // <<cos(n*(psi1))>> | |
11625 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11626 | ||
11627 | // 2-particle correction terms: | |
11628 | for(Int_t i1=0;i1<nPrim;i1++) | |
11629 | { | |
11630 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 11631 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
11632 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11633 | { |
11634 | if(ptOrEta == "Pt") | |
11635 | { | |
11636 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11637 | } else if (ptOrEta == "Eta") | |
11638 | { | |
11639 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11640 | } |
11641 | } else // this is diff flow of RPs | |
11642 | { | |
489d5531 | 11643 | if(ptOrEta == "Pt") |
11644 | { | |
11645 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11646 | } else if (ptOrEta == "Eta") | |
11647 | { | |
11648 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11649 | } |
489d5531 | 11650 | } |
11651 | psi1=aftsTrack->Phi(); | |
11652 | for(Int_t i2=0;i2<nPrim;i2++) | |
11653 | { | |
11654 | if(i2==i1) continue; | |
11655 | aftsTrack=anEvent->GetTrack(i2); | |
11656 | // RP condition (!(first) particle in the correlator must be RP): | |
11657 | if(!(aftsTrack->InRPSelection())) continue; | |
11658 | phi2=aftsTrack->Phi(); | |
11659 | // sin terms: | |
11660 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2)),1.); // <<sin(n*(psi1+phi2))>> | |
11661 | // cos terms: | |
11662 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2)),1.); // <<cos(n*(psi1+phi2))>> | |
11663 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
11664 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11665 | ||
11666 | // 3-particle correction terms: | |
11667 | for(Int_t i1=0;i1<nPrim;i1++) | |
11668 | { | |
11669 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 11670 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
11671 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11672 | { |
11673 | if(ptOrEta == "Pt") | |
11674 | { | |
11675 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11676 | } else if (ptOrEta == "Eta") | |
11677 | { | |
11678 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11679 | } |
11680 | } else // this is diff flow of RPs | |
11681 | { | |
489d5531 | 11682 | if(ptOrEta == "Pt") |
11683 | { | |
11684 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11685 | } else if (ptOrEta == "Eta") | |
11686 | { | |
11687 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11688 | } |
489d5531 | 11689 | } |
11690 | psi1=aftsTrack->Phi(); | |
11691 | for(Int_t i2=0;i2<nPrim;i2++) | |
11692 | { | |
11693 | if(i2==i1) continue; | |
11694 | aftsTrack=anEvent->GetTrack(i2); | |
11695 | // RP condition (!(first) particle in the correlator must be RP): | |
11696 | if(!(aftsTrack->InRPSelection())) continue; | |
11697 | phi2=aftsTrack->Phi(); | |
11698 | for(Int_t i3=0;i3<nPrim;i3++) | |
11699 | { | |
11700 | if(i3==i1||i3==i2) continue; | |
11701 | aftsTrack=anEvent->GetTrack(i3); | |
11702 | // RP condition (!(first) particle in the correlator must be RP): | |
11703 | if(!(aftsTrack->InRPSelection())) continue; | |
11704 | phi3=aftsTrack->Phi(); | |
11705 | // sin terms: | |
11706 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2-phi3)),1.); // <<sin(n*(psi1+phi2-phi3))>> | |
11707 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1-phi2-phi3)),1.); // <<sin(n*(psi1-phi2-phi3))>> | |
11708 | // cos terms: | |
11709 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3)),1.); // <<cos(n*(psi1+phi2-phi3))>> | |
11710 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-phi2-phi3)),1.); // <<cos(n*(psi1-phi2-phi3))>> | |
11711 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
11712 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
11713 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11714 | ||
11715 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
11716 | ||
11717 | ||
11718 | //================================================================================================================================ | |
11719 | ||
11720 | ||
11721 | void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrectionTermsForNUA(TString type, TString ptOrEta) | |
11722 | { | |
11723 | // Compare corrections temrs for non-uniform acceptance needed for diff. flow calculated with nested loops and those calculated from Q-vectors | |
11724 | ||
2a98ceb8 | 11725 | Int_t typeFlag = 0; |
11726 | Int_t ptEtaFlag = 0; | |
489d5531 | 11727 | if(type == "RP") |
11728 | { | |
11729 | typeFlag = 0; | |
11730 | } else if(type == "POI") | |
11731 | { | |
11732 | typeFlag = 1; | |
11733 | } | |
11734 | if(ptOrEta == "Pt") | |
11735 | { | |
11736 | ptEtaFlag = 0; | |
11737 | } else if(ptOrEta == "Eta") | |
11738 | { | |
11739 | ptEtaFlag = 1; | |
11740 | } | |
11741 | // shortcuts: | |
11742 | Int_t t = typeFlag; | |
11743 | Int_t pe = ptEtaFlag; | |
11744 | ||
11745 | TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
11746 | TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
11747 | //TString sinCosFlag[2] = {"sin","cos"}; // to be improved (eventually promote to data member) | |
11748 | TString reducedCorrectionSinTerms[4] = {"<<sin(n(psi1))>>","<<sin(n(psi1+phi2))>>","<<sin(n*(psi1+phi2-phi3))>>","<<sin(n*(psi1-phi2-phi3))>>"}; // to be improved (access this from pro or hist) | |
11749 | TString reducedCorrectionCosTerms[4] = {"<<cos(n(psi1))>>","<<cos(n(psi1+phi2))>>","<<cos(n*(psi1+phi2-phi3))>>","<<cos(n*(psi1-phi2-phi3))>>"}; // to be improved (access this from pro or hist) | |
11750 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
11751 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
11752 | ||
11753 | Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo}; | |
11754 | ||
11755 | cout<<endl; | |
11756 | cout<<" ******************************************"<<endl; | |
11757 | cout<<" **** cross-checking the correction ****"<<endl; | |
46b94261 | 11758 | cout<<" **** terms for non-uniform acceptance ****"<<endl; |
489d5531 | 11759 | cout<<" **** for differential flow ("<<rpORpoiString[t]<<") ****"<<endl; |
11760 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
11761 | { | |
11762 | cout<<" **** (particle weights not used) ****"<<endl; | |
11763 | } else | |
11764 | { | |
11765 | cout<<" **** (particle weights used) ****"<<endl; | |
11766 | } | |
11767 | cout<<" ******************************************"<<endl; | |
11768 | cout<<endl; | |
11769 | cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl; | |
11770 | cout<<endl; | |
11771 | ||
11772 | for(Int_t cti=0;cti<4;cti++) // correction term index | |
11773 | { | |
11774 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
11775 | { | |
11776 | if(sc==0) // to be improved (this can be implemented better) | |
11777 | { | |
11778 | cout<<" "<<reducedCorrectionSinTerms[cti].Data()<<":"<<endl; | |
11779 | } else | |
11780 | { | |
11781 | cout<<" "<<reducedCorrectionCosTerms[cti].Data()<<":"<<endl; | |
11782 | } | |
11783 | cout<<" from Q-vectors = "<<fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl; | |
11784 | cout<<" from nested loops = "<<fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]->GetBinContent(1)<<endl; | |
11785 | cout<<endl; | |
11786 | } | |
11787 | } // end of for(Int_t rci=0;rci<4;rci++) | |
11788 | ||
11789 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrectionTermsForNUA(TString type, TString ptOrEta) | |
11790 | ||
11791 | ||
57340a27 | 11792 | //================================================================================================================================ |
11793 | ||
489d5531 | 11794 | |
11795 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights() | |
11796 | { | |
11797 | // Calculate corrections using particle weights for non-uniform acceptance of the detector for no-name integrated flow (cos terms). | |
11798 | ||
11799 | // ********************************************************************** | |
11800 | // **** weighted corrections for non-uniform acceptance (cos terms): **** | |
11801 | // ********************************************************************** | |
57340a27 | 11802 | |
489d5531 | 11803 | // Remark 1: When particle weights are used the binning of fIntFlowCorrectionTermsForNUAPro[1] is organized as follows: |
57340a27 | 11804 | // |
489d5531 | 11805 | // 1st bin: <<w1 cos(n*(phi1))>> = cosP1nW1 |
11806 | // 2nd bin: <<w1 w2 cos(n*(phi1+phi2))>> = cosP1nP1nW1W1 | |
11807 | // 3rd bin: <<w1 w2 w3 cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1nW1W1W1 | |
11808 | // ... | |
11809 | ||
11810 | // multiplicity (number of particles used to determine the reaction plane) | |
1268c371 | 11811 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 11812 | |
11813 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
11814 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
11815 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
11816 | //Double_t dReQ3n3k = (*fReQ)(2,3); | |
11817 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
11818 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
11819 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
11820 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
11821 | //Double_t dImQ3n3k = (*fImQ)(2,3); | |
11822 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
11823 | //Double_t dImQ1n3k = (*fImQ)(0,3); | |
11824 | ||
11825 | // dMs are variables introduced in order to simplify some Eqs. bellow: | |
11826 | //.............................................................................................. | |
1268c371 | 11827 | Double_t dM11 = (*fSpk)(1,1)-(*fSpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
11828 | Double_t dM111 = (*fSpk)(2,1)-3.*(*fSpk)(0,2)*(*fSpk)(0,1) | |
11829 | + 2.*(*fSpk)(0,3); // dM111 = sum_{i,j,k=1,i!=j!=k}^M w_i w_j w_k | |
489d5531 | 11830 | //.............................................................................................. |
ecac11c2 | 11831 | // 1-particle: |
489d5531 | 11832 | Double_t cosP1nW1 = 0.; // <<w1 cos(n*(phi1))>> |
11833 | ||
1268c371 | 11834 | if(dMult>0 && TMath::Abs((*fSpk)(0,1))>1.e-6) |
489d5531 | 11835 | { |
1268c371 | 11836 | cosP1nW1 = dReQ1n1k/(*fSpk)(0,1); |
489d5531 | 11837 | |
11838 | // average weighted 1-particle correction (cos terms) for non-uniform acceptance for single event: | |
11839 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(1,cosP1nW1); | |
11840 | ||
11841 | // final average weighted 1-particle correction (cos terms) for non-uniform acceptance for all events: | |
1268c371 | 11842 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(0.5,cosP1nW1,(*fSpk)(0,1)); |
489d5531 | 11843 | } |
11844 | ||
11845 | // 2-particle: | |
11846 | Double_t cosP1nP1nW1W1 = 0.; // <<w1 w2 cos(n*(phi1+phi2))>> | |
11847 | ||
1268c371 | 11848 | if(dMult>1 && TMath::Abs(dM11)>1.e-6) |
489d5531 | 11849 | { |
11850 | cosP1nP1nW1W1 = (pow(dReQ1n1k,2)-pow(dImQ1n1k,2)-dReQ2n2k)/dM11; | |
11851 | ||
11852 | // average weighted 2-particle correction (cos terms) for non-uniform acceptance for single event: | |
11853 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(2,cosP1nP1nW1W1); | |
11854 | ||
11855 | // final average weighted 2-particle correction (cos terms) for non-uniform acceptance for all events: | |
11856 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(1.5,cosP1nP1nW1W1,dM11); | |
11857 | } | |
11858 | ||
11859 | // 3-particle: | |
11860 | Double_t cosP1nM1nM1nW1W1W1 = 0.; // <<w1 w2 w3 cos(n*(phi1-phi2-phi3))>> | |
11861 | ||
1268c371 | 11862 | if(dMult>2 && TMath::Abs(dM111)>1.e-6) |
489d5531 | 11863 | { |
57340a27 | 11864 | cosP1nM1nM1nW1W1W1 = (dReQ1n1k*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
11865 | - dReQ1n1k*dReQ2n2k-dImQ1n1k*dImQ2n2k | |
1268c371 | 11866 | - 2.*((*fSpk)(0,2))*dReQ1n1k |
489d5531 | 11867 | + 2.*dReQ1n3k) |
11868 | / dM111; | |
11869 | ||
11870 | // average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for single event: | |
11871 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(3,cosP1nM1nM1nW1W1W1); | |
11872 | ||
11873 | // final average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for all events: | |
11874 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(2.5,cosP1nM1nM1nW1W1W1,dM111); | |
11875 | } | |
11876 | ||
11877 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights() | |
11878 | ||
11879 | ||
11880 | //================================================================================================================================ | |
11881 | ||
11882 | ||
11883 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights() | |
11884 | { | |
11885 | // calculate corrections using particle weights for non-uniform acceptance of the detector for no-name integrated flow (sin terms) | |
11886 | ||
11887 | // ********************************************************************** | |
11888 | // **** weighted corrections for non-uniform acceptance (sin terms): **** | |
11889 | // ********************************************************************** | |
11890 | ||
11891 | // Remark 1: When particle weights are used the binning of fIntFlowCorrectionTermsForNUAPro[0] is organized as follows: | |
57340a27 | 11892 | // |
489d5531 | 11893 | // 1st bin: <<w1 sin(n*(phi1))>> = sinP1nW1 |
11894 | // 2nd bin: <<w1 w2 sin(n*(phi1+phi2))>> = sinP1nP1nW1W1 | |
11895 | // 3rd bin: <<w1 w2 w3 sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1nW1W1W1 | |
11896 | // ... | |
11897 | ||
11898 | // multiplicity (number of particles used to determine the reaction plane) | |
1268c371 | 11899 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 11900 | |
11901 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
11902 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
11903 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
11904 | //Double_t dReQ3n3k = (*fReQ)(2,3); | |
11905 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
11906 | //Double_t dReQ1n3k = (*fReQ)(0,3); | |
11907 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
11908 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
11909 | //Double_t dImQ3n3k = (*fImQ)(2,3); | |
11910 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
11911 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
11912 | ||
11913 | // dMs are variables introduced in order to simplify some Eqs. bellow: | |
11914 | //.............................................................................................. | |
1268c371 | 11915 | Double_t dM11 = (*fSpk)(1,1)-(*fSpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
11916 | Double_t dM111 = (*fSpk)(2,1)-3.*(*fSpk)(0,2)*(*fSpk)(0,1) | |
11917 | + 2.*(*fSpk)(0,3); // dM111 = sum_{i,j,k=1,i!=j!=k}^M w_i w_j w_k | |
489d5531 | 11918 | //.............................................................................................. |
11919 | ||
11920 | // 1-particle: | |
11921 | Double_t sinP1nW1 = 0.; // <<w1 sin(n*(phi1))>> | |
11922 | ||
1268c371 | 11923 | if(dMult>0 && TMath::Abs((*fSpk)(0,1))>1.e-6) |
489d5531 | 11924 | { |
1268c371 | 11925 | sinP1nW1 = dImQ1n1k/((*fSpk)(0,1)); |
489d5531 | 11926 | |
11927 | // average weighted 1-particle correction (sin terms) for non-uniform acceptance for single event: | |
11928 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(1,sinP1nW1); | |
11929 | ||
11930 | // final average weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
1268c371 | 11931 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(0.5,sinP1nW1,(*fSpk)(0,1)); |
489d5531 | 11932 | } |
11933 | ||
11934 | // 2-particle: | |
11935 | Double_t sinP1nP1nW1W1 = 0.; // <<w1 w2 sin(n*(phi1+phi2))>> | |
11936 | ||
1268c371 | 11937 | if(dMult>1 && TMath::Abs(dM11)>1.e-6) |
489d5531 | 11938 | { |
11939 | sinP1nP1nW1W1 = (2.*dReQ1n1k*dImQ1n1k-dImQ2n2k)/dM11; | |
11940 | ||
11941 | // average weighted 2-particle correction (sin terms) for non-uniform acceptance for single event: | |
11942 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(2,sinP1nP1nW1W1); | |
11943 | ||
11944 | // final average weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
11945 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(1.5,sinP1nP1nW1W1,dM11); | |
11946 | } | |
11947 | ||
11948 | // 3-particle: | |
11949 | Double_t sinP1nM1nM1nW1W1W1 = 0.; // <<w1 w2 w3 sin(n*(phi1-phi2-phi3))>> | |
11950 | ||
1268c371 | 11951 | if(dMult>2 && TMath::Abs(dM111)>1.e-6) |
489d5531 | 11952 | { |
57340a27 | 11953 | sinP1nM1nM1nW1W1W1 = (-dImQ1n1k*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
11954 | + dReQ1n1k*dImQ2n2k-dImQ1n1k*dReQ2n2k | |
1268c371 | 11955 | + 2.*((*fSpk)(0,2))*dImQ1n1k |
489d5531 | 11956 | - 2.*dImQ1n3k) |
11957 | / dM111; | |
11958 | ||
11959 | // average weighted 3-particle correction (sin terms) for non-uniform acceptance for single event: | |
11960 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(3,sinP1nM1nM1nW1W1W1); | |
11961 | ||
11962 | // final average weighted 3-particle correction (sin terms) for non-uniform acceptance for all events: | |
11963 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(2.5,sinP1nM1nM1nW1W1W1,dM111); | |
11964 | } | |
11965 | ||
11966 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights() | |
11967 | ||
57340a27 | 11968 | //================================================================================================================================ |
489d5531 | 11969 | |
0328db2d | 11970 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent) |
489d5531 | 11971 | { |
11972 | // Evaluate with nested loops correction terms for non-uniform acceptance for integrated flow (using the particle weights). | |
11973 | ||
57340a27 | 11974 | // Results are stored in profiles fIntFlowDirectCorrectionTermsForNUA[0] (sin terms) and |
11975 | // fIntFlowDirectCorrectionTermsForNUA[1] (cos terms). | |
489d5531 | 11976 | |
57340a27 | 11977 | // Remark 1: When particle weights are used the binning of fIntFlowDirectCorrectionTermsForNUA[sc] is |
489d5531 | 11978 | // organized as follows (sc stands for either sin or cos): |
11979 | // | |
11980 | // 1st bin: <<w1 sc(n*(phi1))>> = scP1nW1 | |
11981 | // 2nd bin: <<w1 w2 sc(n*(phi1+phi2))>> = scP1nP1nW1W1 | |
11982 | // 3rd bin: <<w1 w2 w3 sc(n*(phi1-phi2-phi3))>> = scP1nM1nM1nW1W1W1 | |
3b552efe | 11983 | // ... |
489d5531 | 11984 | |
11985 | Int_t nPrim = anEvent->NumberOfTracks(); | |
11986 | AliFlowTrackSimple *aftsTrack = NULL; | |
11987 | //Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; | |
11988 | //Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
11989 | Double_t phi1=0., phi2=0., phi3=0.; | |
11990 | Double_t wPhi1=1., wPhi2=1., wPhi3=1.; | |
11991 | Int_t n = fHarmonic; | |
11992 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 11993 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 11994 | cout<<endl; |
11995 | cout<<"Correction terms for non-uniform acceptance: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
11996 | if(dMult<1) | |
11997 | { | |
11998 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
11999 | } else if (dMult>fMaxAllowedMultiplicity) | |
12000 | { | |
12001 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
12002 | } else | |
12003 | { | |
12004 | cout<<"... evaluating nested loops (using particle weights) ..."<<endl; | |
12005 | } | |
12006 | ||
12007 | // 1-particle correction terms using particle weights: | |
12008 | if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity) | |
12009 | { | |
12010 | for(Int_t i1=0;i1<nPrim;i1++) | |
12011 | { | |
12012 | aftsTrack=anEvent->GetTrack(i1); | |
12013 | if(!(aftsTrack->InRPSelection())) continue; | |
12014 | phi1=aftsTrack->Phi(); | |
12015 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
57340a27 | 12016 | // 1-particle correction terms using particle weights: |
489d5531 | 12017 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(0.5,sin(n*phi1),wPhi1); // <w1 sin(n*phi1)> |
12018 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(0.5,cos(n*phi1),wPhi1); // <w1 cos(n*phi1)> | |
57340a27 | 12019 | } // end of for(Int_t i1=0;i1<nPrim;i1++) |
12020 | } // end of if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity) | |
12021 | ||
489d5531 | 12022 | // 2-particle correction terms using particle weights: |
12023 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
12024 | { | |
12025 | for(Int_t i1=0;i1<nPrim;i1++) | |
12026 | { | |
12027 | aftsTrack=anEvent->GetTrack(i1); | |
12028 | if(!(aftsTrack->InRPSelection())) continue; | |
12029 | phi1=aftsTrack->Phi(); | |
12030 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
12031 | for(Int_t i2=0;i2<nPrim;i2++) | |
12032 | { | |
12033 | if(i2==i1)continue; | |
12034 | aftsTrack=anEvent->GetTrack(i2); | |
12035 | if(!(aftsTrack->InRPSelection())) continue; | |
12036 | phi2=aftsTrack->Phi(); | |
12037 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
12038 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
57340a27 | 12039 | // 2-p correction terms using particle weights: |
489d5531 | 12040 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(1.5,sin(n*(phi1+phi2)),wPhi1*wPhi2); // <w1 w2 sin(n*(phi1+phi2))> |
12041 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(1.5,cos(n*(phi1+phi2)),wPhi1*wPhi2); // <w1 w2 cos(n*(phi1+phi2))> | |
12042 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
12043 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
12044 | } // end of if(nPrim>=2) | |
12045 | ||
12046 | // 3-particle correction terms using particle weights: | |
12047 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
12048 | { | |
12049 | for(Int_t i1=0;i1<nPrim;i1++) | |
12050 | { | |
12051 | aftsTrack=anEvent->GetTrack(i1); | |
12052 | if(!(aftsTrack->InRPSelection())) continue; | |
12053 | phi1=aftsTrack->Phi(); | |
12054 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
12055 | for(Int_t i2=0;i2<nPrim;i2++) | |
12056 | { | |
12057 | if(i2==i1)continue; | |
12058 | aftsTrack=anEvent->GetTrack(i2); | |
12059 | if(!(aftsTrack->InRPSelection())) continue; | |
12060 | phi2=aftsTrack->Phi(); | |
12061 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
12062 | for(Int_t i3=0;i3<nPrim;i3++) | |
12063 | { | |
12064 | if(i3==i1||i3==i2)continue; | |
12065 | aftsTrack=anEvent->GetTrack(i3); | |
12066 | if(!(aftsTrack->InRPSelection())) continue; | |
12067 | phi3=aftsTrack->Phi(); | |
12068 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
12069 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
57340a27 | 12070 | // 3-p correction terms using particle weights: |
489d5531 | 12071 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(2.5,sin(n*(phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 sin(n*(phi1-phi2-phi3))> |
12072 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(2.5,cos(n*(phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 cos(n*(phi1-phi2-phi3))> | |
12073 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
12074 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
12075 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
12076 | } // end of if(nPrim>=3) | |
12077 | ||
57340a27 | 12078 | /* |
12079 | ||
489d5531 | 12080 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) |
12081 | { | |
12082 | // 4 nested loops multiparticle correlations using particle weights: | |
12083 | for(Int_t i1=0;i1<nPrim;i1++) | |
12084 | { | |
12085 | aftsTrack=anEvent->GetTrack(i1); | |
12086 | if(!(aftsTrack->InRPSelection())) continue; | |
12087 | phi1=aftsTrack->Phi(); | |
12088 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
12089 | for(Int_t i2=0;i2<nPrim;i2++) | |
12090 | { | |
12091 | if(i2==i1)continue; | |
12092 | aftsTrack=anEvent->GetTrack(i2); | |
12093 | if(!(aftsTrack->InRPSelection())) continue; | |
12094 | phi2=aftsTrack->Phi(); | |
12095 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
12096 | for(Int_t i3=0;i3<nPrim;i3++) | |
12097 | { | |
12098 | if(i3==i1||i3==i2)continue; | |
12099 | aftsTrack=anEvent->GetTrack(i3); | |
12100 | if(!(aftsTrack->InRPSelection())) continue; | |
12101 | phi3=aftsTrack->Phi(); | |
12102 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
12103 | for(Int_t i4=0;i4<nPrim;i4++) | |
12104 | { | |
12105 | if(i4==i1||i4==i2||i4==i3)continue; | |
12106 | aftsTrack=anEvent->GetTrack(i4); | |
12107 | if(!(aftsTrack->InRPSelection())) continue; | |
12108 | phi4=aftsTrack->Phi(); | |
12109 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); | |
12110 | if(nPrim>=4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; // to be improved (replace eventually this if statement with if(nPrim==4)) | |
12111 | // 4-p correlations using particle weights: | |
12112 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(10.5,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); | |
12113 | // extra correlations: | |
12114 | // 2-p extra correlations (do not appear if particle weights are not used): | |
12115 | // ... | |
12116 | // 3-p extra correlations (do not appear if particle weights are not used): | |
12117 | // ... | |
12118 | // 4-p extra correlations (do not appear if particle weights are not used): | |
12119 | // ... | |
12120 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
12121 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
12122 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
12123 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
12124 | } // end of if(nPrim>=4) | |
12125 | ||
12126 | */ | |
12127 | ||
12128 | cout<<endl; | |
12129 | ||
12130 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent) | |
12131 | ||
57340a27 | 12132 | //================================================================================================================================ |
489d5531 | 12133 | |
489d5531 | 12134 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights(TString type, TString ptOrEta) |
12135 | { | |
12136 | // Calculate correction terms for non-uniform acceptance for differential flow (cos terms) using particle weights. | |
57340a27 | 12137 | |
489d5531 | 12138 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][1][cti], where cti runs as follows: |
57340a27 | 12139 | // |
489d5531 | 12140 | // 0: <<cos n(psi)>> |
12141 | // 1: <<w2 cos n(psi1+phi2)>> | |
12142 | // 2: <<w2 w3 cos n(psi1+phi2-phi3)>> | |
12143 | // 3: <<w2 w3 cos n(psi1-phi2-phi3)>> | |
12144 | // 4: | |
12145 | // 5: | |
12146 | // 6: | |
12147 | ||
12148 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
12149 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
12150 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
12151 | //Double_t dReQ1n3k = (*fReQ)(0,3); | |
12152 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
12153 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
12154 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
12155 | //Double_t dImQ1n3k = (*fImQ)(0,3); | |
12156 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
12157 | ||
1268c371 | 12158 | // S^M_{p,k} (see .h file for the definition of fSpk): |
12159 | Double_t dSM1p1k = (*fSpk)(0,1); | |
12160 | Double_t dSM1p2k = (*fSpk)(0,2); | |
12161 | Double_t dSM2p1k = (*fSpk)(1,1); | |
489d5531 | 12162 | |
2a98ceb8 | 12163 | Int_t t = 0; // type flag |
12164 | Int_t pe = 0; // ptEta flag | |
489d5531 | 12165 | |
12166 | if(type == "RP") | |
12167 | { | |
12168 | t = 0; | |
12169 | } else if(type == "POI") | |
12170 | { | |
12171 | t = 1; | |
12172 | } | |
12173 | ||
12174 | if(ptOrEta == "Pt") | |
12175 | { | |
12176 | pe = 0; | |
12177 | } else if(ptOrEta == "Eta") | |
12178 | { | |
12179 | pe = 1; | |
12180 | } | |
12181 | ||
12182 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
12183 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
12184 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
12185 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
12186 | ||
12187 | // looping over all bins and calculating correction terms: | |
12188 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
12189 | { | |
12190 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
12191 | Double_t p1n0kRe = 0.; | |
12192 | Double_t p1n0kIm = 0.; | |
12193 | ||
12194 | // number of POIs in particular pt or eta bin: | |
12195 | Double_t mp = 0.; | |
12196 | ||
12197 | // real and imaginary parts of q_{m*n,0} (weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
12198 | Double_t q1n2kRe = 0.; | |
12199 | Double_t q1n2kIm = 0.; | |
12200 | Double_t q2n1kRe = 0.; | |
12201 | Double_t q2n1kIm = 0.; | |
46b94261 | 12202 | |
489d5531 | 12203 | // s_{1,1}, s_{1,2} // to be improved (add explanation) |
12204 | Double_t s1p1k = 0.; | |
12205 | Double_t s1p2k = 0.; | |
46b94261 | 12206 | |
489d5531 | 12207 | // number of particles which are both RPs and POIs in particular pt or eta bin: |
46b94261 | 12208 | Double_t mq = 0.; |
489d5531 | 12209 | |
12210 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
12211 | Double_t dM01 = 0.; | |
12212 | Double_t dM011 = 0.; | |
12213 | ||
12214 | if(type == "POI") | |
12215 | { | |
12216 | // q_{m*n,k}: | |
12217 | q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
12218 | * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
12219 | q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
12220 | * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
12221 | q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
12222 | * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
12223 | q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
12224 | * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
12225 | mq = fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
46b94261 | 12226 | |
489d5531 | 12227 | s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); |
12228 | s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); | |
12229 | }else if(type == "RP") | |
12230 | { | |
12231 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
12232 | q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
12233 | * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
12234 | q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
12235 | * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
12236 | q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
12237 | * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
12238 | q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
12239 | * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
12240 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
12241 | s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); | |
12242 | s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); | |
3b552efe | 12243 | //s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); |
12244 | ||
489d5531 | 12245 | mq = fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) |
12246 | } | |
3b552efe | 12247 | |
489d5531 | 12248 | if(type == "POI") |
3b552efe | 12249 | { |
12250 | // p_{m*n,k}: | |
489d5531 | 12251 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) |
12252 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
12253 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
3b552efe | 12254 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); |
12255 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
489d5531 | 12256 | // M01 from Eq. (118) in QC2c (to be improved (notation)): |
3b552efe | 12257 | dM01 = mp*dSM1p1k-s1p1k; |
12258 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
12259 | - 2.*(s1p1k*dSM1p1k-s1p2k); | |
12260 | ||
12261 | // typeFlag = RP (0) or POI (1): | |
12262 | t = 1; | |
12263 | } else if(type == "RP") | |
489d5531 | 12264 | { |
12265 | // to be improved (cross-checked): | |
12266 | p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
12267 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
12268 | p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
12269 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
12270 | mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
12271 | // M01 from Eq. (118) in QC2c (to be improved (notation)): | |
3b552efe | 12272 | dM01 = mp*dSM1p1k-s1p1k; |
12273 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
12274 | - 2.*(s1p1k*dSM1p1k-s1p2k); | |
489d5531 | 12275 | // typeFlag = RP (0) or POI (1): |
3b552efe | 12276 | t = 0; |
12277 | } | |
489d5531 | 12278 | |
12279 | // <<cos n(psi1)>>: | |
12280 | Double_t cosP1nPsi = 0.; | |
12281 | if(mp) | |
12282 | { | |
12283 | cosP1nPsi = p1n0kRe/mp; | |
12284 | ||
12285 | // fill profile for <<cos n(psi1)>>: | |
12286 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi,mp); | |
12287 | // histogram to store <cos n(psi1)> e-b-e (needed in some other methods): | |
12288 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][0]->SetBinContent(b,cosP1nPsi); | |
46b94261 | 12289 | } // end of if(mp) |
57340a27 | 12290 | |
489d5531 | 12291 | // <<w2 cos n(psi1+phi2)>>: |
12292 | Double_t cosP1nPsiP1nPhiW2 = 0.; | |
12293 | if(dM01) | |
12294 | { | |
12295 | cosP1nPsiP1nPhiW2 = (p1n0kRe*dReQ1n1k-p1n0kIm*dImQ1n1k-q2n1kRe)/(dM01); | |
12296 | // fill profile for <<w2 cos n(psi1+phi2)>>: | |
12297 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsiP1nPhiW2,dM01); | |
12298 | // histogram to store <w2 cos n(psi1+phi2)> e-b-e (needed in some other methods): | |
12299 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][1]->SetBinContent(b,cosP1nPsiP1nPhiW2); | |
12300 | } // end of if(dM01) | |
12301 | ||
12302 | // <<w2 w3 cos n(psi1+phi2-phi3)>>: | |
12303 | Double_t cosP1nPsi1P1nPhi2MPhi3W2W3 = 0.; | |
12304 | if(dM011) | |
12305 | { | |
46b94261 | 12306 | cosP1nPsi1P1nPhi2MPhi3W2W3 = (p1n0kRe*(pow(dImQ1n1k,2.)+pow(dReQ1n1k,2.)) |
12307 | - p1n0kRe*dSM1p2k | |
12308 | - q2n1kRe*dReQ1n1k-q2n1kIm*dImQ1n1k | |
12309 | - s1p1k*dReQ1n1k | |
12310 | + 2.*q1n2kRe) | |
12311 | / dM011; | |
489d5531 | 12312 | // fill profile for <<w1 w2 w3 cos n(psi1+phi2)>>: |
12313 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1P1nPhi2MPhi3W2W3,dM011); | |
12314 | // histogram to store <w1 w2 w3 cos n(psi1+phi2)> e-b-e (needed in some other methods): | |
12315 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][2]->SetBinContent(b,cosP1nPsi1P1nPhi2MPhi3W2W3); | |
12316 | } // end of if(dM011) | |
12317 | ||
12318 | // <<w2 w3 cos n(psi1-phi2-phi3)>>: | |
12319 | Double_t cosP1nPsi1M1nPhi2MPhi3W2W3 = 0.; | |
12320 | if(dM011) | |
12321 | { | |
12322 | cosP1nPsi1M1nPhi2MPhi3W2W3 = (p1n0kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))+2.*p1n0kIm*dReQ1n1k*dImQ1n1k | |
12323 | - 1.*(p1n0kRe*dReQ2n2k+p1n0kIm*dImQ2n2k) | |
46b94261 | 12324 | - 2.*s1p1k*dReQ1n1k |
489d5531 | 12325 | + 2.*q1n2kRe) |
12326 | / dM011; | |
12327 | // fill profile for <<w1 w2 w3 cos n(psi1+phi2)>>: | |
12328 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1M1nPhi2MPhi3W2W3,dM011); | |
12329 | // histogram to store <w1 w2 w3 cos n(psi1+phi2)> e-b-e (needed in some other methods): | |
12330 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][3]->SetBinContent(b,cosP1nPsi1M1nPhi2MPhi3W2W3); | |
12331 | } // end of if(dM011) | |
12332 | ||
12333 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
46b94261 | 12334 | |
57340a27 | 12335 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights(TString type, TString ptOrEta) |
12336 | ||
489d5531 | 12337 | |
12338 | //================================================================================================================================ | |
12339 | ||
12340 | ||
12341 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights(TString type, TString ptOrEta) | |
12342 | { | |
12343 | // Calculate correction terms for non-uniform acceptance for differential flow (sin terms). | |
12344 | ||
12345 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][0][cti], where cti runs as follows: | |
12346 | // 0: <<sin n(psi1)>> | |
12347 | // 1: <<w2 sin n(psi1+phi2)>> | |
12348 | // 2: <<w2 w3 sin n(psi1+phi2-phi3)>> | |
12349 | // 3: <<w2 w3 sin n(psi1-phi2-phi3)>>: | |
12350 | // 4: | |
12351 | // 5: | |
12352 | // 6: | |
12353 | ||
12354 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
12355 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
12356 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
12357 | //Double_t dReQ1n3k = (*fReQ)(0,3); | |
12358 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
12359 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
12360 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
12361 | //Double_t dImQ1n3k = (*fImQ)(0,3); | |
12362 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
12363 | ||
1268c371 | 12364 | // S^M_{p,k} (see .h file for the definition of fSpk): |
12365 | Double_t dSM1p1k = (*fSpk)(0,1); | |
12366 | Double_t dSM1p2k = (*fSpk)(0,2); | |
12367 | Double_t dSM2p1k = (*fSpk)(1,1); | |
489d5531 | 12368 | |
2a98ceb8 | 12369 | Int_t t = 0; // type flag |
12370 | Int_t pe = 0; // ptEta flag | |
489d5531 | 12371 | |
12372 | if(type == "RP") | |
12373 | { | |
12374 | t = 0; | |
12375 | } else if(type == "POI") | |
12376 | { | |
12377 | t = 1; | |
12378 | } | |
12379 | ||
12380 | if(ptOrEta == "Pt") | |
12381 | { | |
12382 | pe = 0; | |
12383 | } else if(ptOrEta == "Eta") | |
12384 | { | |
12385 | pe = 1; | |
12386 | } | |
12387 | ||
12388 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
12389 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
12390 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
12391 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
12392 | ||
12393 | // looping over all bins and calculating correction terms: | |
12394 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
12395 | { | |
12396 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
12397 | Double_t p1n0kRe = 0.; | |
12398 | Double_t p1n0kIm = 0.; | |
12399 | ||
12400 | // number of POIs in particular pt or eta bin: | |
12401 | Double_t mp = 0.; | |
12402 | ||
12403 | // real and imaginary parts of q_{m*n,0} (weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
12404 | Double_t q1n2kRe = 0.; | |
12405 | Double_t q1n2kIm = 0.; | |
12406 | Double_t q2n1kRe = 0.; | |
12407 | Double_t q2n1kIm = 0.; | |
46b94261 | 12408 | |
489d5531 | 12409 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) |
12410 | Double_t s1p1k = 0.; | |
12411 | Double_t s1p2k = 0.; | |
46b94261 | 12412 | |
489d5531 | 12413 | // number of particles which are both RPs and POIs in particular pt or eta bin: |
46b94261 | 12414 | Double_t mq = 0.; |
489d5531 | 12415 | |
12416 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
12417 | Double_t dM01 = 0.; | |
12418 | Double_t dM011 = 0.; | |
12419 | ||
12420 | if(type == "POI") | |
12421 | { | |
12422 | // q_{m*n,k}: | |
12423 | q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
12424 | * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
12425 | q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
12426 | * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
12427 | q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
12428 | * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
12429 | q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
12430 | * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
12431 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
46b94261 | 12432 | |
489d5531 | 12433 | s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); |
12434 | s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); | |
12435 | }else if(type == "RP") | |
12436 | { | |
12437 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
12438 | q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
12439 | * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
12440 | q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
12441 | * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
12442 | q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
12443 | * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
12444 | q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
12445 | * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
12446 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
12447 | s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); | |
12448 | s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); | |
12449 | //s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); | |
3b552efe | 12450 | } |
12451 | ||
12452 | if(type == "POI") | |
12453 | { | |
12454 | // p_{m*n,k}: | |
489d5531 | 12455 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) |
12456 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
12457 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
3b552efe | 12458 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); |
12459 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
489d5531 | 12460 | // M01 from Eq. (118) in QC2c (to be improved (notation)): |
3b552efe | 12461 | dM01 = mp*dSM1p1k-s1p1k; |
12462 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
12463 | - 2.*(s1p1k*dSM1p1k-s1p2k); | |
12464 | // typeFlag = RP (0) or POI (1): | |
12465 | t = 1; | |
489d5531 | 12466 | } else if(type == "RP") |
3b552efe | 12467 | { |
489d5531 | 12468 | // to be improved (cross-checked): |
12469 | p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
12470 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
12471 | p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
12472 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
12473 | mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
12474 | // M01 from Eq. (118) in QC2c (to be improved (notation)): | |
3b552efe | 12475 | dM01 = mp*dSM1p1k-s1p1k; |
12476 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
489d5531 | 12477 | - 2.*(s1p1k*dSM1p1k-s1p2k); |
12478 | // typeFlag = RP (0) or POI (1): | |
3b552efe | 12479 | t = 0; |
12480 | } | |
12481 | ||
489d5531 | 12482 | // <<sin n(psi1)>>: |
12483 | Double_t sinP1nPsi = 0.; | |
12484 | if(mp) | |
12485 | { | |
12486 | sinP1nPsi = p1n0kIm/mp; | |
12487 | ||
12488 | // fill profile for <<sin n(psi1)>>: | |
12489 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi,mp); | |
12490 | // histogram to store <sin n(psi1)> e-b-e (needed in some other methods): | |
12491 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][0]->SetBinContent(b,sinP1nPsi); | |
46b94261 | 12492 | } // end of if(mp) |
12493 | ||
489d5531 | 12494 | // <<w2 sin n(psi1+phi2)>>: |
12495 | Double_t sinP1nPsiP1nPhiW2 = 0.; | |
12496 | if(dM01) | |
12497 | { | |
12498 | sinP1nPsiP1nPhiW2 = (p1n0kRe*dImQ1n1k+p1n0kIm*dReQ1n1k-q2n1kIm)/(dM01); | |
12499 | // fill profile for <<w2 sin n(psi1+phi2)>>: | |
12500 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsiP1nPhiW2,dM01); | |
12501 | // histogram to store <w2 sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
12502 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][1]->SetBinContent(b,sinP1nPsiP1nPhiW2); | |
12503 | } // end of if(mp*dMult-mq) | |
12504 | ||
12505 | // <<w2 w3 sin n(psi1+phi2-phi3)>>: | |
12506 | Double_t sinP1nPsi1P1nPhi2MPhi3W2W3 = 0.; | |
12507 | if(dM011) | |
12508 | { | |
46b94261 | 12509 | sinP1nPsi1P1nPhi2MPhi3W2W3 = (p1n0kIm*(pow(dImQ1n1k,2.)+pow(dReQ1n1k,2.)) |
12510 | - p1n0kIm*dSM1p2k | |
12511 | + q2n1kRe*dImQ1n1k-q2n1kIm*dReQ1n1k | |
12512 | - s1p1k*dImQ1n1k | |
12513 | + 2.*q1n2kIm) | |
12514 | / dM011; | |
489d5531 | 12515 | // fill profile for <<w2 w3 sin n(psi1+phi2-phi3)>>: |
12516 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1P1nPhi2MPhi3W2W3,dM011); | |
12517 | // histogram to store <w2 w3 sin n(psi1+phi2-phi3)> e-b-e (needed in some other methods): | |
12518 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][2]->SetBinContent(b,sinP1nPsi1P1nPhi2MPhi3W2W3); | |
12519 | } // end of if(dM011) | |
12520 | ||
12521 | // <<w2 w3 sin n(psi1-phi2-phi3)>>: | |
12522 | Double_t sinP1nPsi1M1nPhi2MPhi3W2W3 = 0.; | |
12523 | if(dM011) | |
12524 | { | |
12525 | sinP1nPsi1M1nPhi2MPhi3W2W3 = (p1n0kIm*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))-2.*p1n0kRe*dReQ1n1k*dImQ1n1k | |
12526 | + 1.*(p1n0kRe*dImQ2n2k-p1n0kIm*dReQ2n2k) | |
46b94261 | 12527 | + 2.*s1p1k*dImQ1n1k |
489d5531 | 12528 | - 2.*q1n2kIm) |
12529 | / dM011; | |
12530 | // fill profile for <<w2 w3 sin n(psi1-phi2-phi3)>>: | |
12531 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1M1nPhi2MPhi3W2W3,dM011); | |
12532 | // histogram to store <w2 w3 sin n(psi1-phi2-phi3)> e-b-e (needed in some other methods): | |
12533 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][3]->SetBinContent(b,sinP1nPsi1M1nPhi2MPhi3W2W3); | |
12534 | } // end of if(dM011) | |
12535 | ||
12536 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
12537 | ||
12538 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights(TString type, TString ptOrEta) | |
12539 | ||
12540 | ||
12541 | //================================================================================================================================ | |
12542 | ||
12543 | ||
0328db2d | 12544 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 12545 | { |
57340a27 | 12546 | // Evaluate with nested loops correction terms for non-uniform acceptance |
489d5531 | 12547 | // with using particle weights (both sin and cos terms) relevant for differential flow. |
12548 | ||
57340a27 | 12549 | // Remark 1: "w1" in expressions bellow is a particle weight used only for particles which were |
12550 | // flagged both as POI and RP. | |
489d5531 | 12551 | // Remark 2: Reduced correction terms for non-uniform acceptance are evaluated in pt bin number fCrossCheckInPtBinNo |
12552 | // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
12553 | // Remark 3: Results are stored in 1 bin profiles fDiffFlowDirectCorrections[t][pe][sc][cti], where first three indices runs as: | |
12554 | // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms], whilst the cti (correction term index) runs as follows: | |
12555 | // cti: | |
12556 | // 0: <<sc n(psi1)>> | |
12557 | // 1: <<w2 sc n(psi1+phi2)>> | |
12558 | // 2: <<w2 w3 sc n(psi1+phi2-phi3)>> | |
12559 | // 3: <<w2 w3 sc n(psi1-phi2-phi3)>> | |
12560 | // 4: | |
12561 | // 5: | |
12562 | // 6: | |
46b94261 | 12563 | |
2a98ceb8 | 12564 | Int_t typeFlag = 0; |
12565 | Int_t ptEtaFlag = 0; | |
489d5531 | 12566 | if(type == "RP") |
12567 | { | |
12568 | typeFlag = 0; | |
12569 | } else if(type == "POI") | |
12570 | { | |
12571 | typeFlag = 1; | |
12572 | } | |
12573 | if(ptOrEta == "Pt") | |
12574 | { | |
12575 | ptEtaFlag = 0; | |
12576 | } else if(ptOrEta == "Eta") | |
12577 | { | |
12578 | ptEtaFlag = 1; | |
12579 | } | |
12580 | // shortcuts: | |
12581 | Int_t t = typeFlag; | |
12582 | Int_t pe = ptEtaFlag; | |
12583 | ||
12584 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12585 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12586 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
12587 | ||
12588 | Int_t nPrim = anEvent->NumberOfTracks(); | |
12589 | AliFlowTrackSimple *aftsTrack = NULL; | |
12590 | ||
12591 | Double_t psi1=0., phi2=0., phi3=0.;// phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
12592 | Double_t wPhi2=1., wPhi3=1.; | |
12593 | ||
12594 | Int_t n = fHarmonic; | |
12595 | ||
12596 | // 1'-particle correction terms: | |
12597 | for(Int_t i1=0;i1<nPrim;i1++) | |
12598 | { | |
12599 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12600 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12601 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12602 | { |
12603 | if(ptOrEta == "Pt") | |
12604 | { | |
12605 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12606 | } else if (ptOrEta == "Eta") | |
12607 | { | |
12608 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12609 | } |
12610 | } else // this is diff flow of RPs | |
12611 | { | |
489d5531 | 12612 | if(ptOrEta == "Pt") |
12613 | { | |
12614 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12615 | } else if (ptOrEta == "Eta") | |
12616 | { | |
12617 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12618 | } |
489d5531 | 12619 | } |
12620 | psi1=aftsTrack->Phi(); | |
12621 | // sin terms: | |
12622 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*psi1),1.); // <<sin(n*(psi1))>> | |
12623 | // cos terms: | |
12624 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*psi1),1.); // <<cos(n*(psi1))>> | |
12625 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12626 | ||
12627 | // 2'-particle correction terms: | |
12628 | for(Int_t i1=0;i1<nPrim;i1++) | |
12629 | { | |
12630 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12631 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12632 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12633 | { |
12634 | if(ptOrEta == "Pt") | |
12635 | { | |
12636 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12637 | } else if (ptOrEta == "Eta") | |
12638 | { | |
12639 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12640 | } |
12641 | } else // this is diff flow of RPs | |
12642 | { | |
489d5531 | 12643 | if(ptOrEta == "Pt") |
12644 | { | |
12645 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12646 | } else if (ptOrEta == "Eta") | |
12647 | { | |
12648 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12649 | } |
489d5531 | 12650 | } |
12651 | psi1=aftsTrack->Phi(); | |
12652 | for(Int_t i2=0;i2<nPrim;i2++) | |
12653 | { | |
12654 | if(i2==i1) continue; | |
12655 | aftsTrack=anEvent->GetTrack(i2); | |
12656 | // RP condition (!(first) particle in the correlator must be RP): | |
12657 | if(!(aftsTrack->InRPSelection())) continue; | |
46b94261 | 12658 | phi2=aftsTrack->Phi(); |
489d5531 | 12659 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); |
12660 | // sin terms: | |
12661 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2)),wPhi2); // <<w2 sin(n*(psi1+phi2))>> | |
12662 | // cos terms: | |
12663 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2)),wPhi2); // <<w2 cos(n*(psi1+phi2))>> | |
12664 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12665 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12666 | ||
12667 | // 3'-particle correction terms: | |
12668 | for(Int_t i1=0;i1<nPrim;i1++) | |
12669 | { | |
12670 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12671 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12672 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12673 | { |
12674 | if(ptOrEta == "Pt") | |
12675 | { | |
12676 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12677 | } else if (ptOrEta == "Eta") | |
12678 | { | |
12679 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12680 | } |
12681 | } else // this is diff flow of RPs | |
12682 | { | |
489d5531 | 12683 | if(ptOrEta == "Pt") |
12684 | { | |
12685 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12686 | } else if (ptOrEta == "Eta") | |
12687 | { | |
12688 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12689 | } |
489d5531 | 12690 | } |
12691 | psi1=aftsTrack->Phi(); | |
12692 | for(Int_t i2=0;i2<nPrim;i2++) | |
12693 | { | |
12694 | if(i2==i1) continue; | |
12695 | aftsTrack=anEvent->GetTrack(i2); | |
12696 | // RP condition (!(first) particle in the correlator must be RP): | |
12697 | if(!(aftsTrack->InRPSelection())) continue; | |
12698 | phi2=aftsTrack->Phi(); | |
12699 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
12700 | for(Int_t i3=0;i3<nPrim;i3++) | |
12701 | { | |
12702 | if(i3==i1||i3==i2) continue; | |
12703 | aftsTrack=anEvent->GetTrack(i3); | |
12704 | // RP condition (!(first) particle in the correlator must be RP): | |
12705 | if(!(aftsTrack->InRPSelection())) continue; | |
12706 | phi3=aftsTrack->Phi(); | |
12707 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
12708 | // sin terms: | |
12709 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 sin(n*(psi1+phi2-phi3))>> | |
12710 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1-phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 sin(n*(psi1-phi2-phi3))>> | |
12711 | // cos terms: | |
12712 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 cos(n*(psi1+phi2-phi3))>> | |
12713 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 cos(n*(psi1-phi2-phi3))>> | |
12714 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
12715 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
46b94261 | 12716 | }//end of for(Int_t i1=0;i1<nPrim;i1++) |
489d5531 | 12717 | |
12718 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
12719 | ||
2001bc3a | 12720 | //================================================================================================================================ |
12721 | ||
b3dacf6b | 12722 | void AliFlowAnalysisWithQCumulants::CheckPointersUsedInFinish() |
12723 | { | |
12724 | // Check all pointers used in method Finish(). | |
12725 | ||
b77b6434 | 12726 | if(!fAvMultiplicity) |
12727 | { | |
12728 | cout<<endl; | |
12729 | cout<<" WARNING (QC): fAvMultiplicity is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12730 | cout<<endl; | |
12731 | exit(0); | |
12732 | } | |
b3dacf6b | 12733 | if(!fIntFlowCorrelationsPro) |
12734 | { | |
12735 | cout<<endl; | |
12736 | cout<<" WARNING (QC): fIntFlowCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12737 | cout<<endl; | |
12738 | exit(0); | |
12739 | } | |
b40a910e | 12740 | if(!fIntFlowSquaredCorrelationsPro) |
12741 | { | |
12742 | cout<<endl; | |
12743 | cout<<" WARNING (QC): fIntFlowSquaredCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12744 | cout<<endl; | |
12745 | exit(0); | |
12746 | } | |
b3dacf6b | 12747 | if(!fIntFlowCorrelationsHist) |
12748 | { | |
12749 | cout<<endl; | |
12750 | cout<<" WARNING (QC): fIntFlowCorrelationsHist is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12751 | cout<<endl; | |
12752 | exit(0); | |
12753 | } | |
b77b6434 | 12754 | if((fUsePhiWeights||fUsePtWeights||fUseEtaWeights) && !fIntFlowExtraCorrelationsPro) |
12755 | { | |
12756 | cout<<endl; | |
12757 | cout<<" WARNING (QC): fIntFlowExtraCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12758 | cout<<endl; | |
12759 | exit(0); | |
12760 | } | |
b3dacf6b | 12761 | for(Int_t power=0;power<2;power++) |
12762 | { | |
12763 | if(!fIntFlowSumOfEventWeights[power]) | |
12764 | { | |
12765 | cout<<endl; | |
12766 | cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeights[%d] is NULL in CheckPointersUsedInFinish() !!!!",power)<<endl; | |
12767 | cout<<endl; | |
12768 | exit(0); | |
12769 | } | |
12770 | } // end of for(Int_t power=0;power<2;power++) | |
12771 | if(!fIntFlowProductOfCorrelationsPro) | |
12772 | { | |
12773 | cout<<endl; | |
12774 | cout<<" WARNING (QC): fIntFlowProductOfCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12775 | cout<<endl; | |
12776 | exit(0); | |
12777 | } | |
12778 | if(!fIntFlowSumOfProductOfEventWeights) | |
12779 | { | |
12780 | cout<<endl; | |
12781 | cout<<" WARNING (QC): fIntFlowSumOfProductOfEventWeights is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12782 | cout<<endl; | |
12783 | exit(0); | |
12784 | } | |
12785 | if(!fIntFlowCovariances) | |
12786 | { | |
12787 | cout<<endl; | |
12788 | cout<<" WARNING (QC): fIntFlowCovariances is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12789 | cout<<endl; | |
12790 | exit(0); | |
12791 | } | |
12792 | if(!fIntFlowQcumulants) | |
12793 | { | |
12794 | cout<<endl; | |
12795 | cout<<" WARNING (QC): fIntFlowQcumulants is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12796 | cout<<endl; | |
12797 | exit(0); | |
12798 | } | |
0dd3b008 | 12799 | if(!fIntFlow) |
12800 | { | |
12801 | cout<<endl; | |
12802 | cout<<" WARNING (QC): fIntFlow is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12803 | cout<<endl; | |
12804 | exit(0); | |
12805 | } | |
12806 | if(!fCommonHists) | |
12807 | { | |
12808 | cout<<endl; | |
12809 | cout<<" WARNING (QC): fCommonHists is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12810 | cout<<endl; | |
12811 | exit(0); | |
12812 | } | |
12813 | if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th)) | |
12814 | { | |
12815 | cout<<endl; | |
12816 | cout<<" WARNING (QC): fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th"<<endl; | |
12817 | cout<<" && fCommonHistsResults8th is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12818 | cout<<endl; | |
12819 | exit(0); | |
12820 | } | |
b3dacf6b | 12821 | |
b92ea2b9 | 12822 | // NUA stuff: |
12823 | for(Int_t sc=0;sc<2;sc++) // sin/cos | |
12824 | { | |
12825 | if(!fIntFlowCorrectionTermsForNUAPro[sc]) | |
12826 | { | |
12827 | cout<<endl; | |
12828 | cout<<Form(" WARNING (QC): fIntFlowCorrectionTermsForNUAPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",sc)<<endl; | |
12829 | cout<<endl; | |
12830 | exit(0); | |
12831 | } | |
12832 | if(!fIntFlowCorrectionTermsForNUAHist[sc]) | |
12833 | { | |
12834 | cout<<endl; | |
12835 | cout<<Form(" WARNING (QC): fIntFlowCorrectionTermsForNUAHist[%d] is NULL in CheckPointersUsedInFinish() !!!!",sc)<<endl; | |
12836 | cout<<endl; | |
12837 | exit(0); | |
12838 | } | |
12839 | for(Int_t lq=0;lq<2;lq++) // linear/quadratic | |
12840 | { | |
12841 | if(!fIntFlowSumOfEventWeightsNUA[sc][lq]) | |
12842 | { | |
12843 | cout<<endl; | |
12844 | cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeightsNUA[%d][%d] is NULL in CheckPointersUsedInFinish() !!!!",sc,lq)<<endl; | |
12845 | cout<<endl; | |
12846 | exit(0); | |
12847 | } | |
12848 | } // end of for(Int_t lq=0;lq<2;lq++) // linear/quadratic | |
12849 | } // end of for(Int_t power=0;power<2;power++) | |
12850 | if(!fIntFlowProductOfCorrectionTermsForNUAPro) | |
12851 | { | |
12852 | cout<<endl; | |
12853 | cout<<" WARNING (QC): fIntFlowProductOfCorrectionTermsForNUAPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12854 | cout<<endl; | |
12855 | exit(0); | |
12856 | } | |
12857 | if(!fIntFlowSumOfProductOfEventWeightsNUA) | |
12858 | { | |
12859 | cout<<endl; | |
12860 | cout<<" WARNING (QC): fIntFlowSumOfProductOfEventWeightsNUA is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12861 | cout<<endl; | |
12862 | exit(0); | |
12863 | } | |
12864 | if(!fIntFlowCovariancesNUA) | |
12865 | { | |
12866 | cout<<endl; | |
12867 | cout<<" WARNING (QC): fIntFlowCovariancesNUA is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12868 | cout<<endl; | |
12869 | exit(0); | |
12870 | } | |
12871 | if(!fIntFlowQcumulantsErrorSquaredRatio) | |
12872 | { | |
12873 | cout<<endl; | |
12874 | cout<<" WARNING (QC): fIntFlowQcumulantsErrorSquaredRatio is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12875 | cout<<endl; | |
12876 | exit(0); | |
12877 | } | |
12878 | if(!fIntFlowDetectorBias) | |
12879 | { | |
12880 | cout<<endl; | |
12881 | cout<<" WARNING (QC): fIntFlowDetectorBias is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12882 | cout<<endl; | |
12883 | exit(0); | |
12884 | } | |
12885 | ||
b3dacf6b | 12886 | // Versus multiplicity: |
12887 | if(!fCalculateCumulantsVsM){return;} | |
b77b6434 | 12888 | for(Int_t co=0;co<=3;co++) // cumulant order |
b3dacf6b | 12889 | { |
b77b6434 | 12890 | if(!fIntFlowQcumulantsVsM[co]) |
b3dacf6b | 12891 | { |
12892 | cout<<endl; | |
b77b6434 | 12893 | cout<<Form(" WARNING (QC): fIntFlowQcumulantsVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",co)<<endl; |
b3dacf6b | 12894 | cout<<endl; |
12895 | exit(0); | |
12896 | } | |
b77b6434 | 12897 | if(!fIntFlowVsM[co]) |
b3dacf6b | 12898 | { |
12899 | cout<<endl; | |
b77b6434 | 12900 | cout<<Form(" WARNING (QC): fIntFlowVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",co)<<endl; |
12901 | cout<<endl; | |
12902 | exit(0); | |
12903 | } | |
12904 | if(!fIntFlowDetectorBiasVsM[co]) | |
12905 | { | |
12906 | cout<<endl; | |
12907 | cout<<Form(" WARNING (QC): fIntFlowDetectorBiasVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",co)<<endl; | |
12908 | cout<<endl; | |
12909 | exit(0); | |
12910 | } | |
12911 | } // end of for(Int_t c0=0;c0<=3;c0++) // cumulant order | |
12912 | for(Int_t ci=0;ci<=3;ci++) // correlation index | |
12913 | { | |
12914 | if(!fIntFlowCorrelationsVsMPro[ci]) | |
12915 | { | |
12916 | cout<<endl; | |
12917 | cout<<Form(" WARNING (QC): fIntFlowCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl; | |
b3dacf6b | 12918 | cout<<endl; |
12919 | exit(0); | |
12920 | } | |
b40a910e | 12921 | if(!fIntFlowSquaredCorrelationsVsMPro[ci]) |
12922 | { | |
12923 | cout<<endl; | |
12924 | cout<<Form(" WARNING (QC): fIntFlowSquaredCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl; | |
12925 | cout<<endl; | |
12926 | exit(0); | |
12927 | } | |
b77b6434 | 12928 | if(!fIntFlowCorrelationsVsMHist[ci]) |
b92ea2b9 | 12929 | { |
12930 | cout<<endl; | |
b77b6434 | 12931 | cout<<Form(" WARNING (QC): fIntFlowCorrelationsVsMHist[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl; |
b92ea2b9 | 12932 | cout<<endl; |
12933 | exit(0); | |
12934 | } | |
b3dacf6b | 12935 | for(Int_t power=0;power<2;power++) |
12936 | { | |
12937 | if(!fIntFlowSumOfEventWeightsVsM[ci][power]) | |
12938 | { | |
12939 | cout<<endl; | |
12940 | cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeightsVsM[%d][%d] is NULL in CheckPointersUsedInFinish() !!!!",ci,power)<<endl; | |
12941 | cout<<endl; | |
12942 | exit(0); | |
12943 | } | |
12944 | } // end of for(Int_t power=0;power<2;power++) | |
12945 | } // end of for(Int_t ci=0;ci<=3;ci++) // correlation index | |
12946 | for(Int_t i=0;i<6;i++) | |
12947 | { | |
12948 | if(!fIntFlowProductOfCorrelationsVsMPro[i]) | |
12949 | { | |
12950 | cout<<endl; | |
12951 | cout<<Form(" WARNING (QC): fIntFlowProductOfCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl; | |
12952 | cout<<endl; | |
12953 | exit(0); | |
12954 | } | |
12955 | if(!fIntFlowSumOfProductOfEventWeightsVsM[i]) | |
12956 | { | |
12957 | cout<<endl; | |
12958 | cout<<Form(" WARNING (QC): fIntFlowSumOfProductOfEventWeightsVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl; | |
12959 | cout<<endl; | |
12960 | exit(0); | |
12961 | } | |
12962 | if(!fIntFlowCovariancesVsM[i]) | |
12963 | { | |
12964 | cout<<endl; | |
12965 | cout<<Form(" WARNING (QC): fIntFlowCovariancesVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl; | |
12966 | cout<<endl; | |
12967 | exit(0); | |
12968 | } | |
12969 | } // end of for(Int_t i=0;i<6;i++) | |
12970 | if(!fIntFlowRebinnedInM) | |
12971 | { | |
12972 | cout<<endl; | |
12973 | cout<<" WARNING (QC): fIntFlowRebinnedInM is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12974 | cout<<endl; | |
12975 | exit(0); | |
12976 | } | |
12977 | if(!fIntFlowQcumulantsRebinnedInM) | |
12978 | { | |
12979 | cout<<endl; | |
12980 | cout<<" WARNING (QC): fIntFlowQcumulantsRebinnedInM is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12981 | cout<<endl; | |
12982 | exit(0); | |
12983 | } | |
12984 | ||
12985 | } // end of void AliFlowAnalysisWithQCumulants::CheckPointersUsedInFinish() | |
12986 | ||
12987 | //================================================================================================================================ | |
12988 | ||
12989 | void AliFlowAnalysisWithQCumulants::CheckPointersUsedInMake() | |
12990 | { | |
1268c371 | 12991 | // Check all pointers used in method Make(). // to be improved - check other pointers as well |
b3dacf6b | 12992 | |
b77b6434 | 12993 | if(!fAvMultiplicity) |
12994 | { | |
1268c371 | 12995 | printf("\n WARNING (QC): fAvMultiplicity is NULL in CheckPointersUsedInMake() !!!!\n\n"); |
b77b6434 | 12996 | exit(0); |
12997 | } | |
12998 | if((fUsePhiWeights||fUsePtWeights||fUseEtaWeights) && !fIntFlowExtraCorrelationsPro) | |
12999 | { | |
1268c371 | 13000 | printf("\n WARNING (QC): fIntFlowExtraCorrelationsPro is NULL in CheckPointersUsedInMake() !!!!\n\n"); |
b77b6434 | 13001 | exit(0); |
13002 | } | |
1268c371 | 13003 | // 2D: |
13004 | if(fCalculate2DDiffFlow) | |
13005 | { | |
13006 | for(Int_t t=0;t<2;t++) // type = RP or POI | |
13007 | { | |
13008 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
13009 | { | |
13010 | if(!f2DDiffFlowCorrelationsPro[t][rci]) | |
13011 | { | |
13012 | printf("\n WARNING (QC): f2DDiffFlowCorrelationsPro[%i][%i] is NULL in CheckPointersUsedInMake() !!!!\n\n",t,rci); | |
13013 | exit(0); | |
13014 | } // end of if(!f2DDiffFlowCorrelationsPro[t][rci]) | |
13015 | } // end of for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
13016 | } // end of for(Int_t t=0;t<2;t++) | |
13017 | } // end of if(fCalculate2DDiffFlow) | |
b3dacf6b | 13018 | |
13019 | } // end of void AliFlowAnalysisWithQCumulants::CheckPointersUsedInMake() | |
13020 | ||
57340a27 | 13021 |