]>
Commit | Line | Data |
---|---|---|
bc92c0cb | 1 | /************************************************************************* |
2 | * Copyright(c) 1998-2008, ALICE Experiment at CERN, All rights reserved. * | |
3 | * * | |
4 | * Author: The ALICE Off-line Project. * | |
5 | * Contributors are mentioned in the code where appropriate. * | |
6 | * * | |
7 | * Permission to use, copy, modify and distribute this software and its * | |
8 | * documentation strictly for non-commercial purposes is hereby granted * | |
9 | * without fee, provided that the above copyright notice appears in all * | |
10 | * copies and that both the copyright notice and this permission notice * | |
11 | * appear in the supporting documentation. The authors make no claims * | |
12 | * about the suitability of this software for any purpose. It is * | |
13 | * provided "as is" without express or implied warranty. * | |
14 | **************************************************************************/ | |
15 | ||
16 | /********************************** | |
17 | * flow analysis with Q-cumulants * | |
18 | * * | |
19 | * author: Ante Bilandzic * | |
20 | * (anteb@nikhef.nl) * | |
21 | *********************************/ | |
22 | ||
23 | #define AliFlowAnalysisWithQCumulants_cxx | |
24 | ||
25 | #include "Riostream.h" | |
26 | #include "AliFlowCommonConstants.h" | |
27 | #include "AliFlowCommonHist.h" | |
28 | #include "AliFlowCommonHistResults.h" | |
29 | #include "TChain.h" | |
30 | #include "TFile.h" | |
1315fe58 | 31 | #include "TList.h" |
e085f1a9 | 32 | #include "TGraph.h" |
bc92c0cb | 33 | #include "TParticle.h" |
34 | #include "TRandom3.h" | |
1315fe58 | 35 | #include "TStyle.h" |
bc92c0cb | 36 | #include "TProfile.h" |
37 | #include "TProfile2D.h" | |
38 | #include "TProfile3D.h" | |
1dfa3c16 | 39 | #include "TMath.h" |
e085f1a9 | 40 | #include "TArrow.h" |
41 | #include "TPaveLabel.h" | |
42 | #include "TCanvas.h" | |
bc92c0cb | 43 | #include "AliFlowEventSimple.h" |
44 | #include "AliFlowTrackSimple.h" | |
45 | #include "AliFlowAnalysisWithQCumulants.h" | |
3d824203 | 46 | #include "TArrayD.h" |
bc92c0cb | 47 | #include "TRandom.h" |
48 | ||
49 | class TH1; | |
50 | class TGraph; | |
51 | class TPave; | |
52 | class TLatex; | |
53 | class TMarker; | |
54 | class TRandom3; | |
55 | class TObjArray; | |
56 | class TList; | |
57 | class TCanvas; | |
58 | class TSystem; | |
59 | class TROOT; | |
60 | class AliFlowVector; | |
61 | class TVector; | |
62 | ||
63 | //================================================================================================================ | |
64 | ||
65 | ClassImp(AliFlowAnalysisWithQCumulants) | |
66 | ||
67 | AliFlowAnalysisWithQCumulants::AliFlowAnalysisWithQCumulants(): | |
68 | fTrack(NULL), | |
69 | fHistList(NULL), | |
ae733b3b | 70 | fDiffFlowList(NULL), |
03a02aca | 71 | fWeightsList(NULL), |
1315fe58 | 72 | fAvMultIntFlowQC(NULL), |
bc92c0cb | 73 | fQvectorComponents(NULL), |
1315fe58 | 74 | fIntFlowResultsQC(NULL), |
75 | fDiffFlowResults2ndOrderQC(NULL), | |
76 | fDiffFlowResults4thOrderQC(NULL), | |
77 | fCovariances(NULL), | |
e085f1a9 | 78 | fQvectorForEachEventX(NULL),//to be removed |
79 | fQvectorForEachEventY(NULL),//to be removed | |
bc92c0cb | 80 | fQCorrelations(NULL), |
77515452 | 81 | fWeightedQCorrelations(NULL), |
8842fb2b | 82 | fQProduct(NULL), |
bc92c0cb | 83 | fDirectCorrelations(NULL), |
1dfa3c16 | 84 | f2PerPtBin1n1nPOI(NULL), |
1dfa3c16 | 85 | f4PerPtBin1n1n1n1nPOI(NULL), |
1dfa3c16 | 86 | f2PerEtaBin1n1nPOI(NULL), |
1dfa3c16 | 87 | f4PerEtaBin1n1n1n1nPOI(NULL), |
3d824203 | 88 | f2WPerPtBin1n1nPOI(NULL), |
3d824203 | 89 | f4WPerPtBin1n1n1n1nPOI(NULL), |
3d824203 | 90 | f2WPerEtaBin1n1nPOI(NULL), |
91 | f4WPerEtaBin1n1n1n1nPOI(NULL), | |
77515452 | 92 | f2PerPtBin1n1nRP(NULL), |
93 | f4PerPtBin1n1n1n1nRP(NULL), | |
94 | f2PerEtaBin1n1nRP(NULL), | |
95 | f4PerEtaBin1n1n1n1nRP(NULL), | |
3d824203 | 96 | f2WPerPtBin1n1nRP(NULL), |
97 | f4WPerPtBin1n1n1n1nRP(NULL), | |
3d824203 | 98 | f2WPerEtaBin1n1nRP(NULL), |
99 | f4WPerEtaBin1n1n1n1nRP(NULL), | |
cb308e83 | 100 | fCommonHists2nd(NULL), |
101 | fCommonHists4th(NULL), | |
102 | fCommonHists6th(NULL), | |
103 | fCommonHists8th(NULL), | |
8842fb2b | 104 | fCommonHistsResults2nd(NULL), |
105 | fCommonHistsResults4th(NULL), | |
106 | fCommonHistsResults6th(NULL), | |
107 | fCommonHistsResults8th(NULL), | |
52021ae2 | 108 | f2pDistribution(NULL), |
109 | f4pDistribution(NULL), | |
110 | f6pDistribution(NULL), | |
5e838eeb | 111 | f8pDistribution(NULL), |
8842fb2b | 112 | fnBinsPt(0), |
113 | fPtMin(0), | |
1dfa3c16 | 114 | fPtMax(0), |
115 | fnBinsEta(0), | |
116 | fEtaMin(0), | |
e085f1a9 | 117 | fEtaMax(0), |
118 | fEventCounter(0), | |
119 | fUsePhiWeights(kFALSE), | |
120 | fUsePtWeights(kFALSE), | |
03a02aca | 121 | fUseEtaWeights(kFALSE) |
bc92c0cb | 122 | { |
123 | //constructor | |
ae733b3b | 124 | fHistList = new TList(); |
125 | fDiffFlowList = new TList(); | |
126 | fDiffFlowList->SetName("DifferentialFlow"); | |
03a02aca | 127 | fWeightsList = new TList(); |
ae733b3b | 128 | fWeightsList->SetName("Weights"); |
03a02aca | 129 | |
8842fb2b | 130 | fnBinsPt = AliFlowCommonConstants::GetNbinsPt(); |
131 | fPtMin = AliFlowCommonConstants::GetPtMin(); | |
132 | fPtMax = AliFlowCommonConstants::GetPtMax(); | |
133 | ||
1dfa3c16 | 134 | fnBinsEta = AliFlowCommonConstants::GetNbinsEta(); |
135 | fEtaMin = AliFlowCommonConstants::GetEtaMin(); | |
136 | fEtaMax = AliFlowCommonConstants::GetEtaMax(); | |
bc92c0cb | 137 | } |
138 | ||
139 | AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants() | |
140 | { | |
03a02aca | 141 | //destructor |
bc92c0cb | 142 | delete fHistList; |
ae733b3b | 143 | delete fDiffFlowList; |
144 | delete fWeightsList; | |
bc92c0cb | 145 | } |
146 | ||
147 | //================================================================================================================ | |
148 | ||
e085f1a9 | 149 | void AliFlowAnalysisWithQCumulants::Init() |
bc92c0cb | 150 | { |
151 | //various output histograms | |
bc92c0cb | 152 | //avarage multiplicity |
1315fe58 | 153 | fAvMultIntFlowQC = new TProfile("fAvMultIntFlowQC","Average Multiplicity",1,0,1,"s"); |
154 | fAvMultIntFlowQC->SetXTitle(""); | |
155 | fAvMultIntFlowQC->SetYTitle(""); | |
156 | fAvMultIntFlowQC->SetLabelSize(0.06); | |
157 | fAvMultIntFlowQC->SetMarkerStyle(25); | |
158 | fAvMultIntFlowQC->SetLabelOffset(0.01); | |
159 | (fAvMultIntFlowQC->GetXaxis())->SetBinLabel(1,"Average Multiplicity"); | |
160 | fHistList->Add(fAvMultIntFlowQC); | |
bc92c0cb | 161 | |
162 | //Q-vector stuff | |
163 | fQvectorComponents = new TProfile("fQvectorComponents","Avarage of Q-vector components",44,0.,44.,"s"); | |
164 | fQvectorComponents->SetXTitle(""); | |
165 | fQvectorComponents->SetYTitle(""); | |
166 | //fHistList->Add(fQvectorComponents); | |
167 | ||
168 | //final results for integrated flow from Q-cumulants | |
1315fe58 | 169 | fIntFlowResultsQC = new TH1D("fIntFlowResultsQC","Integrated Flow from Q-cumulants",4,0,4); |
170 | //fIntFlowResults->SetXTitle(""); | |
3d824203 | 171 | //fIntFlowResultsQC->SetYTitle("IntegFALSrated Flow"); |
1315fe58 | 172 | fIntFlowResultsQC->SetLabelSize(0.06); |
52021ae2 | 173 | //fIntFlowResultsQC->SetTickLength(1); |
1315fe58 | 174 | fIntFlowResultsQC->SetMarkerStyle(25); |
175 | (fIntFlowResultsQC->GetXaxis())->SetBinLabel(1,"v_{n}{2}"); | |
176 | (fIntFlowResultsQC->GetXaxis())->SetBinLabel(2,"v_{n}{4}"); | |
177 | (fIntFlowResultsQC->GetXaxis())->SetBinLabel(3,"v_{n}{6}"); | |
178 | (fIntFlowResultsQC->GetXaxis())->SetBinLabel(4,"v_{n}{8}"); | |
1315fe58 | 179 | fHistList->Add(fIntFlowResultsQC); |
180 | ||
bc92c0cb | 181 | //final results for differential flow from 2nd order Q-cumulant |
8842fb2b | 182 | fDiffFlowResults2ndOrderQC = new TH1D("fDiffFlowResults2ndOrderQC","Differential Flow from 2nd Order Q-cumulant",fnBinsPt,fPtMin,fPtMax); |
1315fe58 | 183 | fDiffFlowResults2ndOrderQC->SetXTitle("p_{t} [GeV]"); |
184 | //fDiffFlowResults2ndOrderQC->SetYTitle("Differential Flow"); | |
185 | fHistList->Add(fDiffFlowResults2ndOrderQC); | |
bc92c0cb | 186 | |
187 | //final results for differential flow from 4th order Q-cumulant | |
8842fb2b | 188 | fDiffFlowResults4thOrderQC = new TH1D("fDiffFlowResults4thOrderQC","Differential Flow from 4th Order Q-cumulant",fnBinsPt,fPtMin,fPtMax); |
1315fe58 | 189 | fDiffFlowResults4thOrderQC->SetXTitle("p_{t} [GeV]"); |
190 | //fDiffFlowResults4thOrderQC->SetYTitle("Differential Flow"); | |
191 | fHistList->Add(fDiffFlowResults4thOrderQC); | |
192 | ||
193 | //final results for covariances (1st bin: <2*4>-<2>*<4>, 2nd bin: <2*6>-<2>*<6>, ...) | |
194 | fCovariances = new TH1D("fCovariances","Covariances",6,0,6); | |
195 | //fCovariances->SetXTitle(""); | |
196 | //fCovariances->SetYTitle("<covariance>"); | |
197 | fCovariances->SetLabelSize(0.04); | |
198 | fCovariances->SetTickLength(1); | |
199 | fCovariances->SetMarkerStyle(25); | |
200 | (fCovariances->GetXaxis())->SetBinLabel(1,"Cov(2,4)"); | |
201 | (fCovariances->GetXaxis())->SetBinLabel(2,"Cov(2,6)"); | |
202 | (fCovariances->GetXaxis())->SetBinLabel(3,"Cov(2,8)"); | |
203 | (fCovariances->GetXaxis())->SetBinLabel(4,"Cov(4,6)"); | |
204 | (fCovariances->GetXaxis())->SetBinLabel(5,"Cov(4,8)"); | |
205 | (fCovariances->GetXaxis())->SetBinLabel(6,"Cov(6,8)"); | |
206 | fHistList->Add(fCovariances); | |
bc92c0cb | 207 | |
e085f1a9 | 208 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
209 | // !!!! to be removed !!!! | |
210 | //profile containing the x-components of Q-vectors from all events | |
211 | fQvectorForEachEventX = new TProfile("fQvectorForEachEventX","x-components of Q-vectors",44000,1,44000,"s"); | |
212 | fHistList->Add(fQvectorForEachEventX); | |
213 | ||
214 | //profile containing the y-components of Q-vectors from all events | |
215 | fQvectorForEachEventY = new TProfile("fQvectorForEachEventY","y-components of Q-vectors",44000,1,44000,"s"); | |
216 | fHistList->Add(fQvectorForEachEventY); | |
217 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx | |
218 | ||
bc92c0cb | 219 | //multi-particle correlations calculated from Q-vectors |
dee1e0e0 | 220 | fQCorrelations = new TProfile("fQCorrelations","multi-particle correlations from Q-vectors",32,0,32,"s"); |
1315fe58 | 221 | //fQCorrelations->SetXTitle("correlations"); |
222 | //fQCorrelations->SetYTitle(""); | |
223 | fQCorrelations->SetTickLength(-0.01,"Y"); | |
224 | fQCorrelations->SetMarkerStyle(25); | |
225 | fQCorrelations->SetLabelSize(0.03); | |
226 | fQCorrelations->SetLabelOffset(0.01,"Y"); | |
dee1e0e0 | 227 | |
1315fe58 | 228 | (fQCorrelations->GetXaxis())->SetBinLabel(1,"<<2>>_{n|n}"); |
229 | (fQCorrelations->GetXaxis())->SetBinLabel(2,"<<2>>_{2n|2n}"); | |
230 | (fQCorrelations->GetXaxis())->SetBinLabel(3,"<<2>>_{3n|3n}"); | |
231 | (fQCorrelations->GetXaxis())->SetBinLabel(4,"<<2>>_{4n|4n}"); | |
dee1e0e0 | 232 | |
1315fe58 | 233 | (fQCorrelations->GetXaxis())->SetBinLabel(6,"<<3>>_{2n|n,n}"); |
234 | (fQCorrelations->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}"); | |
235 | (fQCorrelations->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}"); | |
236 | (fQCorrelations->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}"); | |
dee1e0e0 | 237 | |
1315fe58 | 238 | (fQCorrelations->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}"); |
239 | (fQCorrelations->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}"); | |
dee1e0e0 | 240 | (fQCorrelations->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}"); |
241 | (fQCorrelations->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}"); | |
242 | (fQCorrelations->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}"); | |
243 | (fQCorrelations->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}"); | |
244 | (fQCorrelations->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}"); | |
245 | ||
246 | (fQCorrelations->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}"); | |
247 | (fQCorrelations->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}"); | |
248 | (fQCorrelations->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}"); | |
249 | (fQCorrelations->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}"); | |
250 | ||
251 | (fQCorrelations->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}"); | |
252 | (fQCorrelations->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}"); | |
253 | (fQCorrelations->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}"); | |
254 | (fQCorrelations->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}"); | |
255 | ||
256 | (fQCorrelations->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}"); | |
257 | ||
258 | (fQCorrelations->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}"); | |
259 | ||
bc92c0cb | 260 | fHistList->Add(fQCorrelations); |
261 | ||
3d824203 | 262 | |
263 | ||
264 | ||
265 | //weighted multi-particle correlations calculated from Q-vectors | |
77515452 | 266 | fWeightedQCorrelations = new TProfile("fWeightedQCorrelations","weighted multi-particle correlations from Q-vectors",100,0,100,"s"); |
267 | //fWeightedQCorrelations->SetXTitle("correlations"); | |
268 | //fWeightedQCorrelations->SetYTitle(""); | |
269 | fWeightedQCorrelations->SetTickLength(-0.01,"Y"); | |
270 | fWeightedQCorrelations->SetMarkerStyle(25); | |
271 | fWeightedQCorrelations->SetLabelSize(0.03); | |
272 | fWeightedQCorrelations->SetLabelOffset(0.01,"Y"); | |
3d824203 | 273 | |
77515452 | 274 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(1,"<w_{1}w_{2}cos(n(#phi_{1}-#phi_{2}))>"); |
275 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(2,"<w_{1}^{2}w_{2}^{2}cos(2n(#phi_{1}-#phi_{2}))>"); | |
276 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(3,"<w_{1}^{3}w_{2}^{3}cos(3n(#phi_{1}-#phi_{2}))>"); | |
277 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(4,"<w_{1}^{4}w_{2}^{4}cos(4n(#phi_{1}-#phi_{2}))>"); | |
278 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(5,"<w_{1}^{3}w_{2}cos(n(#phi_{1}-#phi_{2}))>"); | |
279 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(6,"<w_{1}^{2}w_{2}w_{3}cos(n(#phi_{1}-#phi_{2}))>"); | |
3d824203 | 280 | |
77515452 | 281 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(11,"<w_{1}w_{2}w_{3}^{2}cos(n(2#phi_{1}-#phi_{2}-#phi_{3}))>"); |
3d824203 | 282 | |
77515452 | 283 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(21,"<w_{1}w_{2}w_{3}w_{4}cos(n(#phi_{1}+#phi_{2}-#phi_{3}-#phi_{4}))>"); |
3d824203 | 284 | |
285 | /* | |
77515452 | 286 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}"); |
287 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}"); | |
288 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}"); | |
289 | ||
290 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}"); | |
291 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}"); | |
292 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}"); | |
293 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}"); | |
294 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}"); | |
295 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}"); | |
296 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}"); | |
297 | ||
298 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}"); | |
299 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}"); | |
300 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}"); | |
301 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}"); | |
302 | ||
303 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}"); | |
304 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}"); | |
305 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}"); | |
306 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}"); | |
307 | ||
308 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}"); | |
309 | ||
310 | (fWeightedQCorrelations->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}"); | |
3d824203 | 311 | */ |
312 | ||
77515452 | 313 | fHistList->Add(fWeightedQCorrelations); |
3d824203 | 314 | |
315 | ||
316 | ||
317 | ||
8842fb2b | 318 | //average products |
319 | fQProduct = new TProfile("fQProduct","average of products",6,0,6,"s"); | |
320 | fQProduct->SetTickLength(-0.01,"Y"); | |
321 | fQProduct->SetMarkerStyle(25); | |
322 | fQProduct->SetLabelSize(0.03); | |
323 | fQProduct->SetLabelOffset(0.01,"Y"); | |
324 | (fQProduct->GetXaxis())->SetBinLabel(1,"<<2*4>>"); | |
325 | (fQProduct->GetXaxis())->SetBinLabel(2,"<<2*6>>"); | |
326 | (fQProduct->GetXaxis())->SetBinLabel(3,"<<2*8>>"); | |
327 | (fQProduct->GetXaxis())->SetBinLabel(4,"<<4*6>>"); | |
328 | (fQProduct->GetXaxis())->SetBinLabel(5,"<<4*8>>"); | |
329 | (fQProduct->GetXaxis())->SetBinLabel(6,"<<6*8>>"); | |
330 | fQProduct->SetXTitle(""); | |
331 | fQProduct->SetYTitle(""); | |
332 | fHistList->Add(fQProduct); | |
bc92c0cb | 333 | |
3d824203 | 334 | //weighted multi-particle correlations calculated with nested loops (0..100 integrated flow; 100..200 differential flow) |
335 | fDirectCorrelations = new TProfile("fDirectCorrelations","multi-particle correlations with nested loops",200,0,200,"s"); | |
bc92c0cb | 336 | fDirectCorrelations->SetXTitle(""); |
337 | fDirectCorrelations->SetYTitle("correlations"); | |
338 | fHistList->Add(fDirectCorrelations); | |
339 | ||
1dfa3c16 | 340 | //f2PerPtBin1n1nRP |
341 | f2PerPtBin1n1nRP = new TProfile("f2PerPtBin1n1nRP","<2'>_{n|n}",fnBinsPt,fPtMin,fPtMax,"s"); | |
342 | f2PerPtBin1n1nRP->SetXTitle("p_{t} [GeV]"); | |
ae733b3b | 343 | fDiffFlowList->Add(f2PerPtBin1n1nRP); |
1dfa3c16 | 344 | |
1dfa3c16 | 345 | //f4PerPtBin1n1n1n1nRP |
346 | f4PerPtBin1n1n1n1nRP = new TProfile("f4PerPtBin1n1n1n1nRP","<4'>_{n,n|n,n}",fnBinsPt,fPtMin,fPtMax,"s"); | |
347 | f4PerPtBin1n1n1n1nRP->SetXTitle("p_{t} [GeV]"); | |
ae733b3b | 348 | fDiffFlowList->Add(f4PerPtBin1n1n1n1nRP); |
1dfa3c16 | 349 | |
1dfa3c16 | 350 | //f2PerEtaBin1n1nRP |
351 | f2PerEtaBin1n1nRP = new TProfile("f2PerEtaBin1n1nRP","<2'>_{n|n}",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
352 | f2PerEtaBin1n1nRP->SetXTitle("#eta"); | |
ae733b3b | 353 | fDiffFlowList->Add(f2PerEtaBin1n1nRP); |
1dfa3c16 | 354 | |
1dfa3c16 | 355 | //f4PerEtaBin1n1n1n1nRP |
356 | f4PerEtaBin1n1n1n1nRP = new TProfile("f4PerEtaBin1n1n1n1nRP","<4'>_{n,n|n,n}",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
357 | f4PerEtaBin1n1n1n1nRP->SetXTitle("#eta"); | |
ae733b3b | 358 | fDiffFlowList->Add(f4PerEtaBin1n1n1n1nRP); |
1dfa3c16 | 359 | |
1dfa3c16 | 360 | //f2PerPtBin1n1nPOI |
361 | f2PerPtBin1n1nPOI = new TProfile("f2PerPtBin1n1nPOI","<2'>_{n|n}",fnBinsPt,fPtMin,fPtMax,"s"); | |
4057ba99 | 362 | f2PerPtBin1n1nPOI->SetXTitle("#eta"); |
ae733b3b | 363 | fDiffFlowList->Add(f2PerPtBin1n1nPOI); |
1dfa3c16 | 364 | |
1dfa3c16 | 365 | //f4PerPtBin1n1n1n1nPOI |
366 | f4PerPtBin1n1n1n1nPOI = new TProfile("f4PerPtBin1n1n1n1nPOI","<4'>_{n,n|n,n}",fnBinsPt,fPtMin,fPtMax,"s"); | |
367 | f4PerPtBin1n1n1n1nPOI->SetXTitle("p_{t} [GeV]"); | |
ae733b3b | 368 | fDiffFlowList->Add(f4PerPtBin1n1n1n1nPOI); |
1dfa3c16 | 369 | |
1dfa3c16 | 370 | //f2PerEtaBin1n1nPOI |
371 | f2PerEtaBin1n1nPOI = new TProfile("f2PerEtaBin1n1nPOI","<2'>_{n|n}",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
372 | f2PerEtaBin1n1nPOI->SetXTitle("#eta"); | |
ae733b3b | 373 | fDiffFlowList->Add(f2PerEtaBin1n1nPOI); |
1dfa3c16 | 374 | |
1dfa3c16 | 375 | //f4PerEtaBin1n1n1n1nPOI |
376 | f4PerEtaBin1n1n1n1nPOI = new TProfile("f4PerEtaBin1n1n1n1nPOI","<4'>_{n,n|n,n}",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
377 | f4PerEtaBin1n1n1n1nPOI->SetXTitle("#eta"); | |
ae733b3b | 378 | fDiffFlowList->Add(f4PerEtaBin1n1n1n1nPOI); |
bc92c0cb | 379 | |
3d824203 | 380 | //f2WPerPtBin1n1nPOI |
381 | f2WPerPtBin1n1nPOI = new TProfile("f2WPerPtBin1n1nPOI","<2'>_{n|n}",fnBinsPt,fPtMin,fPtMax,"s"); | |
382 | f2WPerPtBin1n1nPOI->SetXTitle("#pt"); | |
383 | fDiffFlowList->Add(f2WPerPtBin1n1nPOI); | |
384 | ||
3d824203 | 385 | //f4WPerPtBin1n1n1n1nPOI |
386 | f4WPerPtBin1n1n1n1nPOI = new TProfile("f4WPerPtBin1n1n1n1nPOI","<4'>_{n,n|n,n}",fnBinsPt,fPtMin,fPtMax,"s"); | |
387 | f4WPerPtBin1n1n1n1nPOI->SetXTitle("#Pt"); | |
388 | fDiffFlowList->Add(f4WPerPtBin1n1n1n1nPOI); | |
389 | ||
3d824203 | 390 | //f2WPerEtaBin1n1nPOI |
391 | f2WPerEtaBin1n1nPOI = new TProfile("f2WPerEtaBin1n1nPOI","<2'>_{n|n}",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
392 | f2WPerEtaBin1n1nPOI->SetXTitle("#eta"); | |
393 | fDiffFlowList->Add(f2WPerEtaBin1n1nPOI); | |
394 | ||
395 | //f4WPerEtaBin1n1n1n1nPOI | |
396 | f4WPerEtaBin1n1n1n1nPOI = new TProfile("f4WPerEtaBin1n1n1n1nPOI","<4'>_{n,n|n,n}",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
397 | f4WPerEtaBin1n1n1n1nPOI->SetXTitle("#eta"); | |
398 | fDiffFlowList->Add(f4WPerEtaBin1n1n1n1nPOI); | |
399 | ||
3d824203 | 400 | //f2WPerPtBin1n1nRP |
401 | f2WPerPtBin1n1nRP = new TProfile("f2WPerPtBin1n1nRP","<2'>_{n|n}",fnBinsPt,fPtMin,fPtMax,"s"); | |
402 | f2WPerPtBin1n1nRP->SetXTitle("#pt"); | |
403 | fDiffFlowList->Add(f2WPerPtBin1n1nRP); | |
404 | ||
405 | //f4WPerPtBin1n1n1n1nRP | |
406 | f4WPerPtBin1n1n1n1nRP = new TProfile("f4WPerPtBin1n1n1n1nRP","<4'>_{n,n|n,n}",fnBinsPt,fPtMin,fPtMax,"s"); | |
407 | f4WPerPtBin1n1n1n1nRP->SetXTitle("#Pt"); | |
408 | fDiffFlowList->Add(f4WPerPtBin1n1n1n1nRP); | |
409 | ||
3d824203 | 410 | //f2WPerEtaBin1n1nRP |
411 | f2WPerEtaBin1n1nRP = new TProfile("f2WPerEtaBin1n1nRP","<2'>_{n|n}",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
412 | f2WPerEtaBin1n1nRP->SetXTitle("#eta"); | |
413 | fDiffFlowList->Add(f2WPerEtaBin1n1nRP); | |
414 | ||
415 | //f4WPerEtaBin1n1n1n1nRP | |
416 | f4WPerEtaBin1n1n1n1nRP = new TProfile("f4WPerEtaBin1n1n1n1nRP","<4'>_{n,n|n,n}",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
417 | f4WPerEtaBin1n1n1n1nRP->SetXTitle("#eta"); | |
418 | fDiffFlowList->Add(f4WPerEtaBin1n1n1n1nRP); | |
419 | ||
cb308e83 | 420 | //common control histogram (2nd order) |
421 | fCommonHists2nd = new AliFlowCommonHist("AliFlowCommonHist2ndOrderQC"); | |
422 | fHistList->Add(fCommonHists2nd); | |
1315fe58 | 423 | |
cb308e83 | 424 | //common control histogram (4th order) |
425 | fCommonHists4th = new AliFlowCommonHist("AliFlowCommonHist4thOrderQC"); | |
426 | fHistList->Add(fCommonHists4th); | |
427 | ||
428 | //common control histogram (6th order) | |
429 | fCommonHists6th = new AliFlowCommonHist("AliFlowCommonHist6thOrderQC"); | |
430 | fHistList->Add(fCommonHists6th); | |
431 | ||
432 | //common control histogram (8th order) | |
433 | fCommonHists8th = new AliFlowCommonHist("AliFlowCommonHist8thOrderQC"); | |
434 | fHistList->Add(fCommonHists8th); | |
4057ba99 | 435 | |
8842fb2b | 436 | //common histograms for final results (2nd order) |
1315fe58 | 437 | fCommonHistsResults2nd = new AliFlowCommonHistResults("AliFlowCommonHistResults2ndOrderQC"); |
438 | fHistList->Add(fCommonHistsResults2nd); | |
439 | ||
8842fb2b | 440 | //common histograms for final results (4th order) |
1315fe58 | 441 | fCommonHistsResults4th = new AliFlowCommonHistResults("AliFlowCommonHistResults4thOrderQC"); |
442 | fHistList->Add(fCommonHistsResults4th); | |
443 | ||
8842fb2b | 444 | //common histograms for final results (6th order) |
1315fe58 | 445 | fCommonHistsResults6th = new AliFlowCommonHistResults("AliFlowCommonHistResults6thOrderQC"); |
446 | fHistList->Add(fCommonHistsResults6th); | |
447 | ||
8842fb2b | 448 | //common histograms for final results (8th order) |
1315fe58 | 449 | fCommonHistsResults8th = new AliFlowCommonHistResults("AliFlowCommonHistResults8thOrderQC"); |
450 | fHistList->Add(fCommonHistsResults8th); | |
1315fe58 | 451 | |
452 | //weighted <2>_{n|n} distribution | |
52021ae2 | 453 | f2pDistribution = new TH1D("f2pDistribution","<2>_{n|n} distribution",100000,-0.02,0.1); |
454 | f2pDistribution->SetXTitle("<2>_{n|n}"); | |
455 | f2pDistribution->SetYTitle("Counts"); | |
456 | fHistList->Add(f2pDistribution); | |
1315fe58 | 457 | |
458 | //weighted <4>_{n,n|n,n} distribution | |
52021ae2 | 459 | f4pDistribution = new TH1D("f4pDistribution","<4>_{n,n|n,n} distribution",100000,-0.00025,0.002); |
460 | f4pDistribution->SetXTitle("<4>_{n,n|n,n}"); | |
461 | f4pDistribution->SetYTitle("Counts"); | |
462 | fHistList->Add(f4pDistribution); | |
1315fe58 | 463 | |
464 | //weighted <6>_{n,n,n|n,n,n} distribution | |
52021ae2 | 465 | f6pDistribution = new TH1D("f6pDistribution","<6>_{n,n,n|n,n,n} distribution",100000,-0.000005,0.000025); |
466 | f6pDistribution->SetXTitle("<6>_{n,n,n|n,n,n}"); | |
467 | f6pDistribution->SetYTitle("Counts"); | |
468 | fHistList->Add(f6pDistribution); | |
bc92c0cb | 469 | |
5e838eeb | 470 | //weighted <8>_{n,n,n,n|n,n,n,n} distribution |
471 | f8pDistribution = new TH1D("f8pDistribution","<8>_{n,n,n,n|n,n,n,n} distribution",100000,-0.000000001,0.00000001); | |
472 | f8pDistribution->SetXTitle("<8>_{n,n,n,n|n,n,n,n}"); | |
473 | f8pDistribution->SetYTitle("Counts"); | |
474 | fHistList->Add(f8pDistribution); | |
ae733b3b | 475 | |
476 | // add list fWeightsList with weights to the main list | |
477 | fHistList->Add(fWeightsList); | |
478 | ||
479 | // add list fDiffFlowList with histograms and profiles needed for differential flow to the main list | |
480 | fHistList->Add(fDiffFlowList); | |
e085f1a9 | 481 | }//end of Init() |
bc92c0cb | 482 | |
483 | //================================================================================================================ | |
484 | ||
485 | void AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent) | |
486 | { | |
ae733b3b | 487 | // running over data |
488 | ||
489 | Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = nRP + nPOI + rest | |
b7cb54d5 | 490 | Int_t nRP = anEvent->GetEventNSelTracksRP(); // nRP = number of particles used to determine the reaction plane |
03a02aca | 491 | |
ae733b3b | 492 | Int_t n = 2; // int flow harmonic (to be improved) |
493 | ||
4057ba99 | 494 | //needed for debugging: (to be improved - add explanation here) |
b7cb54d5 | 495 | //Bool_t bNestedLoops=kFALSE; |
4057ba99 | 496 | //if(!(bNestedLoops)||(nPrim>0&&nPrim<12)) |
497 | //{ | |
3d824203 | 498 | //if(nPrim>0&&nPrim<10) |
4057ba99 | 499 | //{ |
bc92c0cb | 500 | |
ae733b3b | 501 | |
ae733b3b | 502 | |
503 | //--------------------------------------------------------------------------------------------------------- | |
504 | // non-weighted and weighted Q-vectors of an event built-up from RP particles evaluated in harmonics n, 2n, 3n and 4n: | |
505 | AliFlowVector afvQvector1n, afvQvector2n, afvQvector3n, afvQvector4n; | |
ae733b3b | 506 | |
507 | // non-weighted Q-vector in harmonic n: | |
1dfa3c16 | 508 | afvQvector1n.Set(0.,0.); |
509 | afvQvector1n.SetMult(0); | |
ae733b3b | 510 | afvQvector1n = anEvent->GetQ(1*n); |
ae733b3b | 511 | |
512 | // non-weighted Q-vector in harmonic 2n: | |
1dfa3c16 | 513 | afvQvector2n.Set(0.,0.); |
514 | afvQvector2n.SetMult(0); | |
ae733b3b | 515 | afvQvector2n = anEvent->GetQ(2*n); // to be improved: weights |
3d824203 | 516 | |
ae733b3b | 517 | // non-weighted Q-vector in harmonic 3n: |
1dfa3c16 | 518 | afvQvector3n.Set(0.,0.); |
519 | afvQvector3n.SetMult(0); | |
ae733b3b | 520 | afvQvector3n = anEvent->GetQ(3*n); // to be improved: weights |
bc92c0cb | 521 | |
ae733b3b | 522 | // non-weighted Q-vector in harmonic 4n: |
1dfa3c16 | 523 | afvQvector4n.Set(0.,0.); |
524 | afvQvector4n.SetMult(0); | |
ae733b3b | 525 | afvQvector4n = anEvent->GetQ(4*n); // to be improved: weights |
03a02aca | 526 | |
e085f1a9 | 527 | |
528 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx | |
529 | // !!!! to be removed !!!! | |
530 | fQvectorForEachEventX->Fill(1.*(++fEventCounter),afvQvector1n.X()); | |
531 | fQvectorForEachEventY->Fill(1.*(fEventCounter),afvQvector1n.Y()); | |
532 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx | |
533 | ||
534 | ||
535 | ||
bc92c0cb | 536 | //--------------------------------------------------------------------------------------------------------- |
537 | ||
4057ba99 | 538 | //multiplicity of RP particles: |
ae733b3b | 539 | Double_t dMult = afvQvector1n.GetMult(); // to be improved (name, this is actually weighted multiplicity) |
bc92c0cb | 540 | |
ae733b3b | 541 | fAvMultIntFlowQC->Fill(0.,dMult,1.); // to be removed (this info is also stored in one of control histograms) |
bc92c0cb | 542 | |
543 | //--------------------------------------------------------------------------------------------------------- | |
dee1e0e0 | 544 | // |
545 | // ******************* | |
546 | // **** Q-vectors **** | |
547 | // ******************* | |
548 | // | |
1dfa3c16 | 549 | Double_t reQ2nQ1nstarQ1nstar = pow(afvQvector1n.X(),2.)*afvQvector2n.X()+2.*afvQvector1n.X()*afvQvector1n.Y()*afvQvector2n.Y()-pow(afvQvector1n.Y(),2.)*afvQvector2n.X();//Re[Q_{2n} Q_{n}^* Q_{n}^*] |
52021ae2 | 550 | //Double_t imQ2nQ1nstarQ1nstar = pow(Qvector1n.X(),2.)*Qvector2n.Y()-2.*Qvector1n.X()*Qvector1n.Y()*Qvector2n.X()-pow(Qvector1n.Y(),2.)*Qvector2n.Y();//Im[Q_{2n} Q_{n}^* Q_{n}^*] |
551 | Double_t reQ1nQ1nQ2nstar = reQ2nQ1nstarQ1nstar;//Re[Q_{n} Q_{n} Q_{2n}^*] = Re[Q_{2n} Q_{n}^* Q_{n}^*] | |
1dfa3c16 | 552 | Double_t reQ3nQ1nQ2nstarQ2nstar = (pow(afvQvector2n.X(),2.)-pow(afvQvector2n.Y(),2.))*(afvQvector3n.X()*afvQvector1n.X()-afvQvector3n.Y()*afvQvector1n.Y())+2.*afvQvector2n.X()*afvQvector2n.Y()*(afvQvector3n.X()*afvQvector1n.Y()+afvQvector3n.Y()*afvQvector1n.X()); |
52021ae2 | 553 | //Double_t imQ3nQ1nQ2nstarQ2nstar = calculate and implement this (deleteMe) |
554 | Double_t reQ2nQ2nQ3nstarQ1nstar = reQ3nQ1nQ2nstarQ2nstar; | |
1dfa3c16 | 555 | Double_t reQ4nQ2nstarQ2nstar = pow(afvQvector2n.X(),2.)*afvQvector4n.X()+2.*afvQvector2n.X()*afvQvector2n.Y()*afvQvector4n.Y()-pow(afvQvector2n.Y(),2.)*afvQvector4n.X();//Re[Q_{4n} Q_{2n}^* Q_{2n}^*] |
52021ae2 | 556 | //Double_t imQ4nQ2nstarQ2nstar = calculate and implement this (deleteMe) |
557 | Double_t reQ2nQ2nQ4nstar = reQ4nQ2nstarQ2nstar; | |
1dfa3c16 | 558 | Double_t reQ4nQ3nstarQ1nstar = afvQvector4n.X()*(afvQvector3n.X()*afvQvector1n.X()-afvQvector3n.Y()*afvQvector1n.Y())+afvQvector4n.Y()*(afvQvector3n.X()*afvQvector1n.Y()+afvQvector3n.Y()*afvQvector1n.X());//Re[Q_{4n} Q_{3n}^* Q_{n}^*] |
52021ae2 | 559 | Double_t reQ3nQ1nQ4nstar = reQ4nQ3nstarQ1nstar;//Re[Q_{3n} Q_{n} Q_{4n}^*] = Re[Q_{4n} Q_{3n}^* Q_{n}^*] |
560 | //Double_t imQ4nQ3nstarQ1nstar = calculate and implement this (deleteMe) | |
1dfa3c16 | 561 | Double_t reQ3nQ2nstarQ1nstar = afvQvector3n.X()*afvQvector2n.X()*afvQvector1n.X()-afvQvector3n.X()*afvQvector2n.Y()*afvQvector1n.Y()+afvQvector3n.Y()*afvQvector2n.X()*afvQvector1n.Y()+afvQvector3n.Y()*afvQvector2n.Y()*afvQvector1n.X();//Re[Q_{3n} Q_{2n}^* Q_{n}^*] |
52021ae2 | 562 | Double_t reQ2nQ1nQ3nstar = reQ3nQ2nstarQ1nstar;//Re[Q_{2n} Q_{n} Q_{3n}^*] = Re[Q_{3n} Q_{2n}^* Q_{n}^*] |
563 | //Double_t imQ3nQ2nstarQ1nstar; //calculate and implement this (deleteMe) | |
1dfa3c16 | 564 | Double_t reQ3nQ1nstarQ1nstarQ1nstar = afvQvector3n.X()*pow(afvQvector1n.X(),3)-3.*afvQvector1n.X()*afvQvector3n.X()*pow(afvQvector1n.Y(),2)+3.*afvQvector1n.Y()*afvQvector3n.Y()*pow(afvQvector1n.X(),2)-afvQvector3n.Y()*pow(afvQvector1n.Y(),3);//Re[Q_{3n} Q_{n}^* Q_{n}^* Q_{n}^*] |
52021ae2 | 565 | //Double_t imQ3nQ1nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe) |
1dfa3c16 | 566 | Double_t xQ2nQ1nQ2nstarQ1nstar = pow(afvQvector2n.Mod()*afvQvector1n.Mod(),2);//|Q_{2n}|^2 |Q_{n}|^2 |
567 | Double_t reQ4nQ2nstarQ1nstarQ1nstar = (afvQvector4n.X()*afvQvector2n.X()+afvQvector4n.Y()*afvQvector2n.Y())*(pow(afvQvector1n.X(),2)-pow(afvQvector1n.Y(),2))+2.*afvQvector1n.X()*afvQvector1n.Y()*(afvQvector4n.Y()*afvQvector2n.X()-afvQvector4n.X()*afvQvector2n.Y());//Re[Q_{4n} Q_{2n}^* Q_{n}^* Q_{n}^*] | |
52021ae2 | 568 | //Double_t imQ4nQ2nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe) |
1dfa3c16 | 569 | Double_t reQ2nQ1nQ1nstarQ1nstarQ1nstar = (afvQvector2n.X()*afvQvector1n.X()-afvQvector2n.Y()*afvQvector1n.Y())*(pow(afvQvector1n.X(),3)-3.*afvQvector1n.X()*pow(afvQvector1n.Y(),2))+(afvQvector2n.X()*afvQvector1n.Y()+afvQvector1n.X()*afvQvector2n.Y())*(3.*afvQvector1n.Y()*pow(afvQvector1n.X(),2)-pow(afvQvector1n.Y(),3));//Re[Q_{2n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^*] |
52021ae2 | 570 | //Double_t imQ2nQ1nQ1nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe) |
1dfa3c16 | 571 | Double_t reQ2nQ2nQ2nstarQ1nstarQ1nstar = pow(afvQvector2n.Mod(),2.)*(afvQvector2n.X()*(pow(afvQvector1n.X(),2.)-pow(afvQvector1n.Y(),2.))+2.*afvQvector2n.Y()*afvQvector1n.X()*afvQvector1n.Y());//Re[Q_{2n} Q_{2n} Q_{2n}^* Q_{n}^* Q_{n}^*] |
52021ae2 | 572 | //Double_t imQ2nQ2nQ2nstarQ1nstarQ1nstar = pow(Qvector2n.Mod(),2.)*(Qvector2n.Y()*(pow(Qvector1n.X(),2.)-pow(Qvector1n.Y(),2.))-2.*Qvector2n.X()*Qvector1n.X()*Qvector1n.Y());//Im[Q_{2n} Q_{2n} Q_{2n}^* Q_{n}^* Q_{n}^*] |
1dfa3c16 | 573 | Double_t reQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(afvQvector1n.X(),4.)*afvQvector4n.X()-6.*pow(afvQvector1n.X(),2.)*afvQvector4n.X()*pow(afvQvector1n.Y(),2.)+pow(afvQvector1n.Y(),4.)*afvQvector4n.X()+4.*pow(afvQvector1n.X(),3.)*afvQvector1n.Y()*afvQvector4n.Y()-4.*pow(afvQvector1n.Y(),3.)*afvQvector1n.X()*afvQvector4n.Y();//Re[Q_{4n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] |
dee1e0e0 | 574 | //Double_t imQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(Qvector1n.X(),4.)*Qvector4n.Y()-6.*pow(Qvector1n.X(),2.)*Qvector4n.Y()*pow(Qvector1n.Y(),2.)+pow(Qvector1n.Y(),4.)*Qvector4n.Y()+4.*pow(Qvector1n.Y(),3.)*Qvector1n.X()*Qvector4n.X()-4.*pow(Qvector1n.X(),3.)*Qvector1n.Y()*Qvector4n.X();//Im[Q_{4n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] |
1dfa3c16 | 575 | Double_t reQ3nQ1nQ2nstarQ1nstarQ1nstar = pow(afvQvector1n.Mod(),2.)*(afvQvector1n.X()*afvQvector2n.X()*afvQvector3n.X()-afvQvector3n.X()*afvQvector1n.Y()*afvQvector2n.Y()+afvQvector2n.X()*afvQvector1n.Y()*afvQvector3n.Y()+afvQvector1n.X()*afvQvector2n.Y()*afvQvector3n.Y());//Re[Q_{3n} Q_{n} Q_{2n}^* Q_{n}^* Q_{n}^*] |
576 | //Double_t imQ3nQ1nQ2nstarQ1nstarQ1nstar = pow(afvQvector1n.Mod(),2.)*(-afvQvector2n.X()*afvQvector3n.X()*afvQvector1n.Y()-afvQvector1n.X()*afvQvector3n.X()*afvQvector2n.Y()+afvQvector1n.X()*afvQvector2n.X()*afvQvector3n.Y()-afvQvector1n.Y()*afvQvector2n.Y()*afvQvector3n.Y());//Im[Q_{3n} Q_{n} Q_{2n}^* Q_{n}^* Q_{n}^*] | |
577 | Double_t reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(afvQvector1n.X(),2.)*afvQvector2n.X()-2.*afvQvector1n.X()*afvQvector2n.X()*afvQvector1n.Y()-afvQvector2n.X()*pow(afvQvector1n.Y(),2.)+afvQvector2n.Y()*pow(afvQvector1n.X(),2.)+2.*afvQvector1n.X()*afvQvector1n.Y()*afvQvector2n.Y()-pow(afvQvector1n.Y(),2.)*afvQvector2n.Y())*(pow(afvQvector1n.X(),2.)*afvQvector2n.X()+2.*afvQvector1n.X()*afvQvector2n.X()*afvQvector1n.Y()-afvQvector2n.X()*pow(afvQvector1n.Y(),2.)-afvQvector2n.Y()*pow(afvQvector1n.X(),2.)+2.*afvQvector1n.X()*afvQvector1n.Y()*afvQvector2n.Y()+pow(afvQvector1n.Y(),2.)*afvQvector2n.Y());//Re[Q_{2n} Q_{2n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
578 | //Double_t imQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = 2.*(pow(afvQvector1n.X(),2.)*afvQvector2n.X()-afvQvector2n.X()*pow(afvQvector1n.Y(),2.)+2.*afvQvector1n.X()*afvQvector1n.Y()*afvQvector2n.Y())*(pow(afvQvector1n.X(),2.)*afvQvector2n.Y()-2.*afvQvector1n.X()*afvQvector1n.Y()*afvQvector2n.X()-pow(afvQvector1n.Y(),2.)*afvQvector2n.Y());//Im[Q_{2n} Q_{2n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
579 | Double_t reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow(afvQvector1n.Mod(),2.)*(pow(afvQvector1n.X(),3.)*afvQvector3n.X()-3.*afvQvector1n.X()*afvQvector3n.X()*pow(afvQvector1n.Y(),2.)+3.*pow(afvQvector1n.X(),2.)*afvQvector1n.Y()*afvQvector3n.Y()-pow(afvQvector1n.Y(),3.)*afvQvector3n.Y());//Re[Q_{3n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
580 | //Double_t imQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow(afvQvector1n.Mod(),2.)*(pow(afvQvector1n.Y(),3.)*afvQvector3n.X()-3.*afvQvector1n.Y()*afvQvector3n.X()*pow(afvQvector1n.X(),2.)-3.*pow(afvQvector1n.Y(),2.)*afvQvector1n.X()*afvQvector3n.Y()+pow(afvQvector1n.X(),3.)*afvQvector3n.Y());//Im[Q_{3n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
581 | Double_t xQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar = pow(afvQvector2n.Mod(),2.)*pow(afvQvector1n.Mod(),4.);//|Q_{2n}|^2 |Q_{n}|^4 | |
582 | Double_t reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow(afvQvector1n.Mod(),4.)*(pow(afvQvector1n.X(),2.)*afvQvector2n.X()-afvQvector2n.X()*pow(afvQvector1n.Y(),2.)+2.*afvQvector1n.X()*afvQvector1n.Y()*afvQvector2n.Y());//Re[Q_{2n} Q_{n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
583 | //Double_t imQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow(afvQvector1n.Mod(),4.)*(pow(afvQvector1n.X(),2.)*afvQvector2n.Y()-afvQvector2n.Y()*pow(afvQvector1n.Y(),2.)-2.*afvQvector1n.X()*afvQvector2n.X()*afvQvector1n.Y());//Re[Q_{2n} Q_{n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
bc92c0cb | 584 | //--------------------------------------------------------------------------------------------------------- |
585 | ||
586 | //--------------------------------------------------------------------------------------------------------- | |
dee1e0e0 | 587 | // |
588 | // ************************************** | |
589 | // **** multi-particle correlations: **** | |
590 | // ************************************** | |
591 | // | |
592 | // Remark 1: multi-particle correlations calculated with Q-vectors are stored in fQCorrelations. | |
593 | // Remark 2: binning of fQCorrelations is organized as follows: | |
594 | // | |
595 | // 1st bin: <2>_{n|n} = two1n1n | |
596 | // 2nd bin: <2>_{2n|2n} = two2n2n | |
597 | // 3rd bin: <2>_{3n|3n} = two3n3n | |
598 | // 4th bin: <2>_{4n|4n} = two4n4n | |
599 | // 5th bin: -- EMPTY -- | |
600 | // 6th bin: <3>_{2n|n,n} = three2n1n1n | |
601 | // 7th bin: <3>_{3n|2n,n} = three3n2n1n | |
602 | // 8th bin: <3>_{4n|2n,2n} = three4n2n2n | |
603 | // 9th bin: <3>_{4n|3n,n} = three4n3n1n | |
604 | //10th bin: -- EMPTY -- | |
605 | //11th bin: <4>_{n,n|n,n} = four1n1n1n1n | |
606 | //12th bin: <4>_{2n,n|2n,n} = four2n1n2n1n | |
607 | //13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n | |
608 | //14th bin: <4>_{3n|n,n,n} = four3n1n1n1n | |
609 | //15th bin: <4>_{3n,n|3n,n} = four3n1n3n1n | |
610 | //16th bin: <4>_{3n,n|2n,2n} = four3n1n2n2n | |
611 | //17th bin: <4>_{4n|2n,n,n} = four4n2n1n1n | |
612 | //18th bin: -- EMPTY -- | |
613 | //19th bin: <5>_{2n|n,n,n,n} = five2n1n1n1n1n | |
614 | //20th bin: <5>_{2n,2n|2n,n,n} = five2n2n2n1n1n | |
615 | //21st bin: <5>_{3n,n|2n,n,n} = five3n1n2n1n1n | |
616 | //22nd bin: <5>_{4n|n,n,n,n} = five4n1n1n1n1n | |
617 | //23rd bin: -- EMPTY -- | |
618 | //24th bin: <6>_{n,n,n|n,n,n} = six1n1n1n1n1n1n | |
619 | //25th bin: <6>_{2n,n,n|2n,n,n} = six2n1n1n2n1n1n | |
620 | //26th bin: <6>_{2n,2n|n,n,n,n} = six2n2n1n1n1n1n | |
621 | //27th bin: <6>_{3n,n|n,n,n,n} = six3n1n1n1n1n1n | |
622 | //28th bin: -- EMPTY -- | |
623 | //29th bin: <7>_{2n,n,n|n,n,n,n} = seven2n1n1n1n1n1n1n | |
624 | //30th bin: -- EMPTY -- | |
625 | //31st bin: <8>_{n,n,n,n|n,n,n,n} = eight1n1n1n1n1n1n1n1n | |
626 | ||
1315fe58 | 627 | |
8842fb2b | 628 | // binning of fQProduct (all correlations are evaluated in harmonic n): |
629 | // 1st bin: <2>*<4> | |
630 | // 2nd bin: <2>*<6> | |
631 | // 3rd bin: <2>*<8> | |
632 | // 4th bin: <4>*<6> | |
633 | // 5th bin: <4>*<8> | |
634 | // 6th bin: <6>*<8> | |
635 | ||
ae733b3b | 636 | // 2-particle |
637 | Double_t two1n1n = 0., two2n2n = 0., two3n3n = 0., two4n4n = 0.; | |
638 | ||
3d824203 | 639 | if(dMult>1) |
bc92c0cb | 640 | { |
ae733b3b | 641 | //fill the common control histogram (2nd order): |
cb308e83 | 642 | fCommonHists2nd->FillControlHistograms(anEvent); |
ae733b3b | 643 | |
3d824203 | 644 | two1n1n = (pow(afvQvector1n.Mod(),2.)-dMult)/(dMult*(dMult-1.)); // <2>_{n|n} = <cos(n*(phi1-phi2))> |
ae733b3b | 645 | two2n2n = (pow(afvQvector2n.Mod(),2.)-dMult)/(dMult*(dMult-1.)); // <2>_{2n|2n} = <cos(2n*(phi1-phi2))> |
646 | two3n3n = (pow(afvQvector3n.Mod(),2.)-dMult)/(dMult*(dMult-1.)); // <2>_{3n|3n} = <cos(3n*(phi1-phi2))> | |
647 | two4n4n = (pow(afvQvector4n.Mod(),2.)-dMult)/(dMult*(dMult-1.)); // <2>_{4n|4n} = <cos(4n*(phi1-phi2))> | |
1315fe58 | 648 | |
3d824203 | 649 | fQCorrelations->Fill(0.,two1n1n,dMult*(dMult-1.)); |
650 | fQCorrelations->Fill(1.,two2n2n,dMult*(dMult-1.)); | |
651 | fQCorrelations->Fill(2.,two3n3n,dMult*(dMult-1.)); | |
652 | fQCorrelations->Fill(3.,two4n4n,dMult*(dMult-1.)); | |
1315fe58 | 653 | |
3d824203 | 654 | f2pDistribution->Fill(two1n1n,dMult*(dMult-1.)); |
bc92c0cb | 655 | } |
656 | ||
3d824203 | 657 | // 3-particle |
52021ae2 | 658 | Double_t three2n1n1n=0., three3n2n1n=0., three4n2n2n=0., three4n3n1n=0.; |
1dfa3c16 | 659 | if(dMult>2) |
bc92c0cb | 660 | { |
1dfa3c16 | 661 | three2n1n1n = (reQ2nQ1nstarQ1nstar-2.*pow(afvQvector1n.Mod(),2.)-pow(afvQvector2n.Mod(),2.)+2.*dMult)/(dMult*(dMult-1.)*(dMult-2.)); //Re[<3>_{2n|n,n}] = Re[<3>_{n,n|2n}] = <cos(n*(2.*phi1-phi2-phi3))> |
662 | three3n2n1n = (reQ3nQ2nstarQ1nstar-pow(afvQvector3n.Mod(),2.)-pow(afvQvector2n.Mod(),2.)-pow(afvQvector1n.Mod(),2.)+2.*dMult)/(dMult*(dMult-1.)*(dMult-2.)); //Re[<3>_{3n|2n,n}] = Re[<3>_{2n,n|3n}] = <cos(n*(3.*phi1-2.*phi2-phi3))> | |
663 | three4n2n2n = (reQ4nQ2nstarQ2nstar-2.*pow(afvQvector2n.Mod(),2.)-pow(afvQvector4n.Mod(),2.)+2.*dMult)/(dMult*(dMult-1.)*(dMult-2.)); //Re[<3>_{4n|2n,2n}] = Re[<3>_{2n,2n|4n}] = <cos(n*(4.*phi1-2.*phi2-2.*phi3))> | |
664 | three4n3n1n = (reQ4nQ3nstarQ1nstar-pow(afvQvector4n.Mod(),2.)-pow(afvQvector3n.Mod(),2.)-pow(afvQvector1n.Mod(),2.)+2.*dMult)/(dMult*(dMult-1.)*(dMult-2.)); //Re[<3>_{4n|3n,n}] = Re[<3>_{3n,n|4n}] = <cos(n*(4.*phi1-3.*phi2-phi3))> | |
665 | ||
666 | fQCorrelations->Fill(5.,three2n1n1n,dMult*(dMult-1.)*(dMult-2.)); | |
667 | fQCorrelations->Fill(6.,three3n2n1n,dMult*(dMult-1.)*(dMult-2.)); | |
668 | fQCorrelations->Fill(7.,three4n2n2n,dMult*(dMult-1.)*(dMult-2.)); | |
669 | fQCorrelations->Fill(8.,three4n3n1n,dMult*(dMult-1.)*(dMult-2.)); | |
bc92c0cb | 670 | } |
671 | ||
672 | //4-particle | |
52021ae2 | 673 | Double_t four1n1n1n1n=0., four2n2n2n2n=0., four2n1n2n1n=0., four3n1n1n1n=0., four4n2n1n1n=0., four3n1n2n2n=0., four3n1n3n1n=0.; |
1dfa3c16 | 674 | if(dMult>3) |
bc92c0cb | 675 | { |
cb308e83 | 676 | //fill the common control histogram (4th order): |
677 | fCommonHists4th->FillControlHistograms(anEvent); | |
678 | ||
1dfa3c16 | 679 | four1n1n1n1n = (2.*dMult*(dMult-3.)+pow(afvQvector1n.Mod(),4.)-4.*(dMult-2.)*pow(afvQvector1n.Mod(),2.)-2.*reQ2nQ1nstarQ1nstar+pow(afvQvector2n.Mod(),2.))/(dMult*(dMult-1)*(dMult-2.)*(dMult-3.));//<4>_{n,n|n,n} |
680 | four2n2n2n2n = (2.*dMult*(dMult-3.)+pow(afvQvector2n.Mod(),4.)-4.*(dMult-2.)*pow(afvQvector2n.Mod(),2.)-2.*reQ4nQ2nstarQ2nstar+pow(afvQvector4n.Mod(),2.))/(dMult*(dMult-1)*(dMult-2.)*(dMult-3.));//<4>_{2n,2n|2n,2n} | |
681 | four2n1n2n1n = (xQ2nQ1nQ2nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar-2.*reQ2nQ1nstarQ1nstar)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))-((dMult-5.)*pow(afvQvector1n.Mod(),2.)+(dMult-4.)*pow(afvQvector2n.Mod(),2.)-pow(afvQvector3n.Mod(),2.))/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))+(dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.));//Re[<4>_{2n,n|2n,n}] | |
682 | four3n1n1n1n = (reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar-3.*reQ2nQ1nstarQ1nstar)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))+(2.*pow(afvQvector3n.Mod(),2.)+3.*pow(afvQvector2n.Mod(),2.)+6.*pow(afvQvector1n.Mod(),2.)-6.*dMult)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));//Re[<4>_{3n|n,n,n}] | |
683 | four4n2n1n1n = (reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar-2.*reQ3nQ2nstarQ1nstar)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))-(reQ2nQ1nstarQ1nstar-2.*pow(afvQvector4n.Mod(),2.)-2.*pow(afvQvector3n.Mod(),2.)-3.*pow(afvQvector2n.Mod(),2.)-4.*pow(afvQvector1n.Mod(),2.))/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))-(6.)/((dMult-1.)*(dMult-2.)*(dMult-3.));//Re[<4>_{4n|2n,n,n}] | |
684 | four3n1n2n2n = (reQ3nQ1nQ2nstarQ2nstar-reQ4nQ2nstarQ2nstar-reQ3nQ1nQ4nstar-2.*reQ3nQ2nstarQ1nstar)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))-(2.*reQ1nQ1nQ2nstar-pow(afvQvector4n.Mod(),2.)-2.*pow(afvQvector3n.Mod(),2.)-4.*pow(afvQvector2n.Mod(),2.)-4.*pow(afvQvector1n.Mod(),2.))/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))-(6.)/((dMult-1.)*(dMult-2.)*(dMult-3.));//Re[<4>_{3n,n|2n,2n}] | |
685 | four3n1n3n1n = (pow(afvQvector3n.Mod(),2.)*pow(afvQvector1n.Mod(),2.)-2.*reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))+(pow(afvQvector4n.Mod(),2.)-(dMult-4.)*pow(afvQvector3n.Mod(),2.)+pow(afvQvector2n.Mod(),2.)-(dMult-4.)*pow(afvQvector1n.Mod(),2.))/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))+(dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.));//<4>_{3n,n|3n,n} | |
1315fe58 | 686 | //four_3n1n3n1n = Q3nQ1nQ3nstarQ1nstar/(M*(M-1.)*(M-2.)*(M-3.))-(2.*three_3n2n1n+2.*three_4n3n1n)/(M-3.)-(two_4n4n+M*two_3n3n+two_2n2n+M*two_1n1n)/((M-2.)*(M-3.))-M/((M-1.)*(M-2.)*(M-3.));//<4>_{3n,n|3n,n} |
687 | ||
1dfa3c16 | 688 | fQCorrelations->Fill(10.,four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
689 | fQCorrelations->Fill(11.,four2n1n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
690 | fQCorrelations->Fill(12.,four2n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
691 | fQCorrelations->Fill(13.,four3n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
692 | fQCorrelations->Fill(14.,four3n1n3n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
693 | fQCorrelations->Fill(15.,four3n1n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
694 | fQCorrelations->Fill(16.,four4n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
dee1e0e0 | 695 | |
1dfa3c16 | 696 | f4pDistribution->Fill(four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
bc92c0cb | 697 | |
1dfa3c16 | 698 | fQProduct->Fill(0.,two1n1n*four1n1n1n1n,dMult*(dMult-1.)*dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
bc92c0cb | 699 | } |
700 | ||
701 | //5-particle | |
52021ae2 | 702 | Double_t five2n1n1n1n1n=0., five2n2n2n1n1n=0., five3n1n2n1n1n=0., five4n1n1n1n1n=0.; |
1dfa3c16 | 703 | if(dMult>4) |
1315fe58 | 704 | { |
1dfa3c16 | 705 | five2n1n1n1n1n = (reQ2nQ1nQ1nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar+6.*reQ3nQ2nstarQ1nstar)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))-(reQ2nQ1nQ3nstar+3.*(dMult-6.)*reQ2nQ1nstarQ1nstar+3.*reQ1nQ1nQ2nstar)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))-(2.*pow(afvQvector3n.Mod(),2.)+3.*pow(afvQvector2n.Mod()*afvQvector1n.Mod(),2.)-3.*(dMult-4.)*pow(afvQvector2n.Mod(),2.))/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))-3.*(pow(afvQvector1n.Mod(),4.)-2.*(2*dMult-5.)*pow(afvQvector1n.Mod(),2.)+2.*dMult*(dMult-4.))/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));//Re[<5>_{2n,n|n,n,n}] |
1315fe58 | 706 | |
1dfa3c16 | 707 | five2n2n2n1n1n = (reQ2nQ2nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ2nQ2nQ3nstarQ1nstar)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))+2.*(reQ4nQ2nstarQ2nstar+4.*reQ3nQ2nstarQ1nstar+reQ3nQ1nQ4nstar)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))+(reQ2nQ2nQ4nstar-2.*(dMult-5.)*reQ2nQ1nstarQ1nstar+2.*reQ1nQ1nQ2nstar)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))-(2.*pow(afvQvector4n.Mod(),2.)+4.*pow(afvQvector3n.Mod(),2.)+1.*pow(afvQvector2n.Mod(),4.)-2.*(3.*dMult-10.)*pow(afvQvector2n.Mod(),2.))/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))-(4.*pow(afvQvector1n.Mod(),2.)*pow(afvQvector2n.Mod(),2.)-4.*(dMult-5.)*pow(afvQvector1n.Mod(),2.)+4.*dMult*(dMult-6.))/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));//Re[<5>_{2n,2n|2n,n,n}] |
1315fe58 | 708 | |
dee1e0e0 | 709 | //five_2n2n2n1n1n = reQ2nQ2nQ2nstarQ1nstarQ1nstar/(M*(M-1.)*(M-2.)*(M-3.)*(M-4.))-(4.*four_2n1n2n1n+2.*four_3n1n2n2n+1.*four_2n2n2n2n+four_4n2n1n1n)/(M-4.)-(2.*three_4n3n1n+three_4n2n2n+three_4n2n2n+2.*three_3n2n1n)/((M-3.)*(M-4.))-(4.*three_3n2n1n+(2.*M-1.)*three_2n1n1n+2.*three_2n1n1n)/((M-3.)*(M-4.))-(two_4n4n+2.*two_3n3n+4.*(M-1.)*two_2n2n+2.*(2.*M-1.)*two_1n1n)/((M-2.)*(M-3.)*(M-4.))-(2.*M-1.)/((M-1.)*(M-2.)*(M-3.)*(M-4.)); //OK! |
1315fe58 | 710 | |
1dfa3c16 | 711 | five4n1n1n1n1n = (reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ4nQ2nstarQ1nstarQ1nstar-4.*reQ3nQ1nstarQ1nstarQ1nstar)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))+(8.*reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar+12.*reQ3nQ2nstarQ1nstar+12.*reQ2nQ1nstarQ1nstar)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))-(6.*pow(afvQvector4n.Mod(),2.)+8.*pow(afvQvector3n.Mod(),2.)+12.*pow(afvQvector2n.Mod(),2.)+24.*pow(afvQvector1n.Mod(),2.)-24.*dMult)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));//Re[<5>_{4n|n,n,n,n}] |
1315fe58 | 712 | |
dee1e0e0 | 713 | //five_4n1n1n1n1n = reQ4nQ1nstarQ1nstarQ1nstarQ1nstar/(M*(M-1.)*(M-2.)*(M-3.)*(M-4.)) - (4.*four_3n1n1n1n+6.*four_4n2n1n1n)/(M-4.) - (6.*three_2n1n1n + 12.*three_3n2n1n + 4.*three_4n3n1n + 3.*three_4n2n2n)/((M-3.)*(M-4.)) - (4.*two_1n1n + 6.*two_2n2n + 4.*two_3n3n + 1.*two_4n4n)/((M-2.)*(M-3.)*(M-4.)) - 1./((M-1.)*(M-2.)*(M-3.)*(M-4.)); //OK! |
714 | ||
1dfa3c16 | 715 | five3n1n2n1n1n = (reQ3nQ1nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))-(reQ3nQ1nQ2nstarQ2nstar-3.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))-((2.*dMult-13.)*reQ3nQ2nstarQ1nstar-reQ3nQ1nQ4nstar-9.*reQ2nQ1nstarQ1nstar)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))-(2.*reQ1nQ1nQ2nstar+2.*pow(afvQvector4n.Mod(),2.)-2.*(dMult-5.)*pow(afvQvector3n.Mod(),2.)+2.*pow(afvQvector3n.Mod(),2.)*pow(afvQvector1n.Mod(),2.))/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))+(2.*(dMult-6.)*pow(afvQvector2n.Mod(),2.)-2.*pow(afvQvector2n.Mod(),2.)*pow(afvQvector1n.Mod(),2.)-pow(afvQvector1n.Mod(),4.)+2.*(3.*dMult-11.)*pow(afvQvector1n.Mod(),2.))/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))-4.*(dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));//Re[<5>_{3n,n|2n,n,n}] |
dee1e0e0 | 716 | |
1dfa3c16 | 717 | //five3n1n2n1n1n = reQ3nQ1nQ2nstarQ1nstarQ1nstar/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) - (four4n2n1n1n+four1n1n1n1n+four3n1n1n1n+2.*four2n1n2n1n+2.*three3n2n1n+2.*four3n1n3n1n+four3n1n2n2n)/(dMult-4.) - (2.*three4n3n1n+three4n2n2n+6.*three3n2n1n+three4n3n1n+2.*three3n2n1n+3.*three2n1n1n+2.*three2n1n1n+4.*two1n1n+2.*two2n2n+2.*two3n3n)/((dMult-3.)*(dMult-4.)) - (5.*two1n1n + 4.*two2n2n + 3.*two3n3n + 1.*two4n4n + 2.)/((dMult-2.)*(dMult-3.)*(dMult-4.)) - 1./((dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) ;//Re[<5>_{3n,n|2n,n,n}] //OK! |
1315fe58 | 718 | |
1dfa3c16 | 719 | //five3n1n2n1n1n = reQ3nQ1nQ2nstarQ1nstarQ1nstar/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) - (four4n2n1n1n+four1n1n1n1n+four3n1n1n1n+2.*four2n1n2n1n+2.*four3n1n3n1n+four3n1n2n2n)/(dMult-4.) - (2.*three4n3n1n+three4n2n2n+2.*dMult*three3n2n1n+three4n3n1n+2.*three3n2n1n+3.*three2n1n1n+2.*three2n1n1n)/((dMult-3.)*(dMult-4.)) - ((4.*dMult-3.)*two1n1n + 2.*dMult*two2n2n + (2.*dMult-1.)*two3n3n + two4n4n)/((dMult-2.)*(dMult-3.)*(dMult-4.)) - (2.*dMult-1.)/((dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) ;//Re[<5>_{3n,n|2n,n,n}] //OK! |
dee1e0e0 | 720 | |
1dfa3c16 | 721 | fQCorrelations->Fill(18.,five2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
722 | fQCorrelations->Fill(19.,five2n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
723 | fQCorrelations->Fill(20.,five3n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
724 | fQCorrelations->Fill(21.,five4n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
1315fe58 | 725 | } |
bc92c0cb | 726 | |
ae733b3b | 727 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
728 | // !!!! to be removed: temporary fix !!!! | |
307ed368 | 729 | if(dMult>1) |
730 | { | |
731 | two1n1n = (pow(afvQvector1n.Mod(),2.)-dMult)/(dMult*(dMult-1.)); | |
732 | } | |
ae733b3b | 733 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
734 | ||
bc92c0cb | 735 | //6-particle |
dee1e0e0 | 736 | Double_t six1n1n1n1n1n1n=0., six2n2n1n1n1n1n=0., six3n1n1n1n1n1n=0., six2n1n1n2n1n1n=0.; |
1dfa3c16 | 737 | if(dMult>5) |
bc92c0cb | 738 | { |
cb308e83 | 739 | //fill the common control histogram (6th order): |
740 | fCommonHists6th->FillControlHistograms(anEvent); | |
741 | ||
1dfa3c16 | 742 | six1n1n1n1n1n1n = (pow(afvQvector1n.Mod(),6.)+9.*xQ2nQ1nQ2nstarQ1nstar-6.*reQ2nQ1nQ1nstarQ1nstarQ1nstar)/(dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5))+4.*(reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar)/(dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5))+2.*(9.*(dMult-4.)*reQ2nQ1nstarQ1nstar+2.*pow(afvQvector3n.Mod(),2.))/(dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5))-9.*(pow(afvQvector1n.Mod(),4.)+pow(afvQvector2n.Mod(),2.))/(dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-5))+(18.*pow(afvQvector1n.Mod(),2.))/(dMult*(dMult-1)*(dMult-3)*(dMult-4))-(6.)/((dMult-1)*(dMult-2)*(dMult-3));//<6>_{n,n,n|n,n,n} |
1315fe58 | 743 | |
1dfa3c16 | 744 | six2n1n1n2n1n1n = (xQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(2.*five2n2n2n1n1n+4.*five2n1n1n1n1n+4.*five3n1n2n1n1n+4.*four2n1n2n1n+1.*four1n1n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four1n1n1n1n+4.*two1n1n+2.*three2n1n1n+2.*three2n1n1n+4.*four3n1n1n1n+8.*three2n1n1n+2.*four4n2n1n1n+4.*four2n1n2n1n+2.*two2n2n+8.*four2n1n2n1n+4.*four3n1n3n1n+8.*three3n2n1n+4.*four3n1n2n2n+4.*four1n1n1n1n+4.*four2n1n2n1n+1.*four2n2n2n2n)-dMult*(dMult-1.)*(dMult-2.)*(2.*three2n1n1n+8.*two1n1n+4.*two1n1n+2.+4.*two1n1n+4.*three2n1n1n+2.*two2n2n+4.*three2n1n1n+8.*three3n2n1n+8.*two2n2n+4.*three4n3n1n+4.*two3n3n+4.*three3n2n1n+4.*two1n1n+8.*three2n1n1n+4.*two1n1n+4.*three3n2n1n+4.*three2n1n1n+2.*two2n2n+4.*three3n2n1n+2.*three4n2n2n)-dMult*(dMult-1.)*(4.*two1n1n+4.+4.*two1n1n+2.*two2n2n+1.+4.*two1n1n+4.*two2n2n+4.*two3n3n+ 1.+2.*two2n2n+1.*two4n4n)-dMult)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.));//<6>_{2n,n,n|2n,n,n} |
dee1e0e0 | 745 | |
1dfa3c16 | 746 | six2n2n1n1n1n1n = (reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(five4n1n1n1n1n+8.*five2n1n1n1n1n+6.*five2n2n2n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four3n1n1n1n+6.*four4n2n1n1n+12.*three2n1n1n+12.*four1n1n1n1n+24.*four2n1n2n1n+4.*four3n1n2n2n+3.*four2n2n2n2n)-dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+12.*three3n2n1n+4.*three4n3n1n+3.*three4n2n2n+8.*three2n1n1n+24.*two1n1n+12.*two2n2n+12.*three2n1n1n+8.*three3n2n1n+1.*three4n2n2n)-dMult*(dMult-1.)*(4.*two1n1n+6.*two2n2n+4.*two3n3n+1.*two4n4n+2.*two2n2n+8.*two1n1n+6.)-dMult)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.));//<6>_{2n,2n,n|n,n,n} |
dee1e0e0 | 747 | |
1dfa3c16 | 748 | six3n1n1n1n1n1n = (reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(five4n1n1n1n1n+4.*five2n1n1n1n1n+6.*five3n1n2n1n1n+4.*four3n1n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four3n1n1n1n+6.*four4n2n1n1n+6.*four1n1n1n1n+12.*three2n1n1n+12.*four2n1n2n1n+6.*four3n1n1n1n+12.*three3n2n1n+4.*four3n1n3n1n+3.*four3n1n2n2n)-dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+12.*three3n2n1n+4.*three4n3n1n+3.*three4n2n2n+4.*two1n1n+12.*two1n1n+6.*three2n1n1n+12.*three2n1n1n+4.*three3n2n1n+12.*two2n2n+4.*three3n2n1n+4.*two3n3n+1.*three4n3n1n+6.*three3n2n1n)-dMult*(dMult-1.)*(4.*two1n1n+6.*two2n2n+4.*two3n3n+1.*two4n4n+1.*two1n1n+4.+6.*two1n1n+4.*two2n2n+1.*two3n3n)-dMult)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.));//<6>_{3n,n|n,n,n,n} |
dee1e0e0 | 749 | |
1dfa3c16 | 750 | fQCorrelations->Fill(23.,six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
751 | fQCorrelations->Fill(24.,six2n1n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
752 | fQCorrelations->Fill(25.,six2n2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
753 | fQCorrelations->Fill(26.,six3n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
dee1e0e0 | 754 | |
1dfa3c16 | 755 | f6pDistribution->Fill(six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
bc92c0cb | 756 | |
1dfa3c16 | 757 | fQProduct->Fill(1.,two1n1n*six1n1n1n1n1n1n,dMult*(dMult-1.)*dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
758 | fQProduct->Fill(3.,four1n1n1n1n*six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
bc92c0cb | 759 | } |
dee1e0e0 | 760 | |
761 | //7-particle | |
762 | Double_t seven2n1n1n1n1n1n1n=0.; | |
1dfa3c16 | 763 | if(dMult>6) |
dee1e0e0 | 764 | { |
1dfa3c16 | 765 | seven2n1n1n1n1n1n1n = (reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(2.*six3n1n1n1n1n1n+4.*six1n1n1n1n1n1n+1.*six2n2n1n1n1n1n+6.*six2n1n1n2n1n1n+8.*five2n1n1n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(1.*five4n1n1n1n1n +8.*five2n1n1n1n1n+8.*four3n1n1n1n+12.*five3n1n2n1n1n+4.*five2n1n1n1n1n+3.*five2n2n2n1n1n+6.*five2n2n2n1n1n+6.*four1n1n1n1n+24.*four1n1n1n1n+12.*five2n1n1n1n1n+12.*five2n1n1n1n1n+12.*three2n1n1n+24.*four2n1n2n1n+4.*five3n1n2n1n1n+4.*five2n1n1n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four3n1n1n1n+6.*four4n2n1n1n+12.*four1n1n1n1n+24.*three2n1n1n+24.*four2n1n2n1n+12.*four3n1n1n1n+24.*three3n2n1n+8.*four3n1n3n1n+6.*four3n1n2n2n+6.*three2n1n1n+12.*four1n1n1n1n+12.*four2n1n2n1n+6.*three2n1n1n+12.*four2n1n2n1n+4.*four3n1n2n2n+3.*four2n2n2n2n+4.*four1n1n1n1n+6.*three2n1n1n+24.*two1n1n+24.*four1n1n1n1n+4.*four3n1n1n1n+24.*two1n1n+24.*three2n1n1n+12.*two2n2n+24.*three2n1n1n+12.*four2n1n2n1n+8.*three3n2n1n+8.*four2n1n2n1n+1.*four4n2n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+1.*three2n1n1n+8.*two1n1n+12.*three3n2n1n+24.*two1n1n+12.*three2n1n1n+4.*three2n1n1n+8.*two1n1n+4.*three4n3n1n+24.*three2n1n1n+8.*three3n2n1n+12.*two1n1n+12.*two1n1n+3.*three4n2n2n+24.*two2n2n+6.*two2n2n+12.+12.*three3n2n1n+8.*two3n3n+12.*three2n1n1n+24.*two1n1n+4.*three3n2n1n+8.*three3n2n1n+2.*three4n3n1n+12.*two1n1n+8.*three2n1n1n+4.*three2n1n1n+2.*three3n2n1n+6.*two2n2n+8.*two2n2n+1.*three4n2n2n+4.*three3n2n1n+6.*three2n1n1n)-dMult*(dMult-1.)*(4.*two1n1n+2.*two1n1n+6.*two2n2n+8.+1.*two2n2n+4.*two3n3n+12.*two1n1n+4.*two1n1n+1.*two4n4n+8.*two2n2n+6.+2.*two3n3n+4.*two1n1n+1.*two2n2n)-dMult)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)); |
dee1e0e0 | 766 | |
1dfa3c16 | 767 | fQCorrelations->Fill(28.,seven2n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)); |
dee1e0e0 | 768 | } |
769 | ||
770 | //8-particle | |
771 | Double_t eight1n1n1n1n1n1n1n1n=0.; | |
1dfa3c16 | 772 | if(dMult>7) |
dee1e0e0 | 773 | { |
cb308e83 | 774 | //fill the common control histogram (8th order): |
775 | fCommonHists8th->FillControlHistograms(anEvent); | |
776 | ||
1dfa3c16 | 777 | eight1n1n1n1n1n1n1n1n = (pow(afvQvector1n.Mod(),8)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(12.*seven2n1n1n1n1n1n1n+16.*six1n1n1n1n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(8.*six3n1n1n1n1n1n+48.*six1n1n1n1n1n1n+6.*six2n2n1n1n1n1n+96.*five2n1n1n1n1n+72.*four1n1n1n1n+36.*six2n1n1n2n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(2.*five4n1n1n1n1n+32.*five2n1n1n1n1n+36.*four1n1n1n1n+32.*four3n1n1n1n+48.*five2n1n1n1n1n+48.*five3n1n2n1n1n+144.*five2n1n1n1n1n+288.*four1n1n1n1n+36.*five2n2n2n1n1n+144.*three2n1n1n+96.*two1n1n+144.*four2n1n2n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(8.*four3n1n1n1n+48.*four1n1n1n1n+12.*four4n2n1n1n+96.*four2n1n2n1n+96.*three2n1n1n+72.*three2n1n1n+144.*two1n1n+16.*four3n1n3n1n+48.*four3n1n1n1n+144.*four1n1n1n1n+72.*four1n1n1n1n+96.*three3n2n1n+24.*four3n1n2n2n+144.*four2n1n2n1n+288.*two1n1n+288.*three2n1n1n+9.*four2n2n2n2n+72.*two2n2n+24.)-dMult*(dMult-1.)*(dMult-2.)*(12.*three2n1n1n+16.*two1n1n+24.*three3n2n1n+48.*three2n1n1n+96.*two1n1n+8.*three4n3n1n+32.*three3n2n1n+96.*three2n1n1n+144.*two1n1n+6.*three4n2n2n+96.*two2n2n+36.*two2n2n+72.+48.*three3n2n1n+16.*two3n3n+72.*three2n1n1n+144.*two1n1n)-dMult*(dMult-1.)*(8.*two1n1n+12.*two2n2n+16.+8.*two3n3n+48.*two1n1n+1.*two4n4n+16.*two2n2n+18.)-dMult)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); |
dee1e0e0 | 778 | |
1dfa3c16 | 779 | fQCorrelations->Fill(30.,eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); |
5e838eeb | 780 | |
1dfa3c16 | 781 | f8pDistribution->Fill(eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); |
dee1e0e0 | 782 | } |
bc92c0cb | 783 | //--------------------------------------------------------------------------------------------------------- |
784 | ||
4057ba99 | 785 | |
786 | ||
787 | ||
3d824203 | 788 | //--------------------------------------------------------------------------------------------------------- |
789 | // weights: | |
790 | Bool_t useWeights = fUsePhiWeights||fUsePtWeights||fUseEtaWeights; | |
791 | ||
792 | TH1F *phiWeights = NULL; // histogram with phi weights | |
793 | TH1D *ptWeights = NULL; // histogram with pt weights | |
794 | TH1D *etaWeights = NULL; // histogram with eta weights | |
795 | ||
796 | if(useWeights) | |
797 | { | |
798 | if(!fWeightsList) | |
1315fe58 | 799 | { |
3d824203 | 800 | cout<<" WARNING: fWeightsList is NULL pointer. "<<endl; |
801 | exit(0); | |
802 | } | |
803 | if(fUsePhiWeights) | |
804 | { | |
805 | phiWeights = dynamic_cast<TH1F *>(fWeightsList->FindObject("phi_weights")); | |
806 | if(!phiWeights) | |
ae733b3b | 807 | { |
3d824203 | 808 | cout<<" WARNING: couldn't access the histogram with phi weights. "<<endl; |
809 | exit(0); | |
ae733b3b | 810 | } |
3d824203 | 811 | } |
812 | if(fUsePtWeights) | |
813 | { | |
814 | ptWeights = dynamic_cast<TH1D *>(fWeightsList->FindObject("pt_weights")); | |
815 | if(!ptWeights) | |
816 | { | |
817 | cout<<" WARNING: couldn't access the histogram with pt weights. "<<endl; | |
818 | exit(0); | |
819 | } | |
820 | } | |
821 | if(fUseEtaWeights) | |
822 | { | |
823 | etaWeights = dynamic_cast<TH1D *>(fWeightsList->FindObject("eta_weights")); | |
824 | if(!etaWeights) | |
825 | { | |
826 | cout<<" WARNING: couldn't access the histogram with eta weights. "<<endl; | |
827 | exit(0); | |
828 | } | |
829 | } | |
830 | } | |
831 | ||
77515452 | 832 | Int_t nBinsPhi = 0; |
3d824203 | 833 | Double_t dBinWidthPt=0.; |
3d824203 | 834 | Double_t dBinWidthEta=0.; |
77515452 | 835 | |
836 | if(fnBinsPt) | |
837 | { | |
838 | dBinWidthPt=(fPtMax-fPtMin)/fnBinsPt; | |
839 | } | |
840 | if(fnBinsEta) | |
841 | { | |
842 | dBinWidthEta=(fEtaMax-fEtaMin)/fnBinsEta; | |
843 | } | |
3d824203 | 844 | |
845 | if(fWeightsList) | |
846 | { | |
847 | if(fUsePhiWeights) | |
848 | { | |
3d824203 | 849 | if(phiWeights) nBinsPhi = phiWeights->GetNbinsX(); |
850 | } | |
851 | if(fUsePtWeights) | |
852 | { | |
3d824203 | 853 | if(ptWeights) |
854 | { | |
77515452 | 855 | Double_t dBinWidthPtW = ptWeights->GetBinWidth(1); // assuming that all bins have the same width |
856 | if(dBinWidthPtW != dBinWidthPt) | |
857 | { | |
858 | cout<<" WARNING: dBinWidthPtW != dBinWidthPt in AFAWQC::Make()"<<endl; | |
859 | exit(0); | |
860 | } | |
861 | Double_t dPtMinW = (ptWeights->GetXaxis())->GetXmin(); | |
862 | if(dPtMinW != fPtMin) | |
863 | { | |
864 | cout<<" WARNING: dPtMinW != fPtMin in AFAWQC::Make()"<<endl; | |
865 | exit(0); | |
866 | } | |
3d824203 | 867 | } |
868 | } | |
869 | if(fUseEtaWeights) | |
870 | { | |
3d824203 | 871 | if(etaWeights) |
872 | { | |
77515452 | 873 | Double_t dBinWidthEtaW = etaWeights->GetBinWidth(1); // assuming that all bins have the same width |
874 | if(dBinWidthEtaW != dBinWidthEta) | |
875 | { | |
876 | cout<<" WARNING: dBinWidthEtaW != dBinWidthEta in AFAWQC::Make()"<<endl; | |
877 | exit(0); | |
878 | } | |
879 | Double_t dEtaMinW = (etaWeights->GetXaxis())->GetXmin(); | |
880 | if(dEtaMinW != fEtaMin) | |
881 | { | |
882 | cout<<" WARNING: dEtaMinW != fEtaMin in AFAWQC::Make()"<<endl; | |
883 | exit(0); | |
884 | } | |
3d824203 | 885 | } |
886 | } | |
887 | } // end of if(weightsList) | |
888 | ||
889 | Double_t wPhi = 1.; // phi weight | |
890 | Double_t wPt = 1.; // pt weight | |
891 | Double_t wEta = 1.; // eta weight | |
892 | ||
893 | Double_t dPhi = 0.; | |
894 | Double_t dPt = 0.; | |
895 | Double_t dEta = 0.; | |
896 | ||
3d824203 | 897 | Double_t dQnkX[4][8] = {{0.}}; // sum_{i=1}^{M} w_i^k cos(n phi_i) |
898 | Double_t dQnkY[4][8] = {{0.}}; // sum_{i=1}^{M} w_i^k sin(n phi_i) | |
77515452 | 899 | Double_t dSnk[4][8] = {{0.}}; //(sum_{i=1}^{M} w_i^k)^n |
3d824203 | 900 | |
901 | for(Int_t i=0;i<nPrim;i++) // loop over all particles | |
902 | { | |
903 | fTrack=anEvent->GetTrack(i); | |
904 | if(fTrack) | |
905 | { | |
b7cb54d5 | 906 | if(fTrack->InRPSelection()) |
3d824203 | 907 | { |
908 | dPhi = fTrack->Phi(); | |
909 | dPt = fTrack->Pt(); | |
910 | dEta = fTrack->Eta(); | |
911 | ||
77515452 | 912 | // determine Phi weight: |
3d824203 | 913 | if(phiWeights && nBinsPhi) |
914 | { | |
915 | wPhi = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(dPhi*nBinsPhi/TMath::TwoPi()))); | |
916 | } | |
77515452 | 917 | // determine pt weight: |
3d824203 | 918 | if(ptWeights && dBinWidthPt) |
919 | { | |
77515452 | 920 | wPt = ptWeights->GetBinContent(1+(Int_t)(TMath::Floor((dPt-fPtMin)/dBinWidthPt))); |
3d824203 | 921 | } |
77515452 | 922 | // determine eta weight: |
3d824203 | 923 | if(etaWeights && dBinWidthEta) |
924 | { | |
77515452 | 925 | wEta = etaWeights->GetBinContent(1+(Int_t)(TMath::Floor((dEta-fEtaMin)/dBinWidthEta))); |
3d824203 | 926 | } |
927 | ||
77515452 | 928 | // (Q_{n,k})_x, (Q_{n,k})_y and S_{n,k} |
3d824203 | 929 | for(Int_t nn=0;nn<4;nn++) |
930 | { | |
931 | for(Int_t k=0;k<8;k++) | |
932 | { | |
933 | dQnkX[nn][k]+=pow(wPhi*wPt*wEta,k+1)*TMath::Cos(2*(nn+1)*dPhi); | |
934 | dQnkY[nn][k]+=pow(wPhi*wPt*wEta,k+1)*TMath::Sin(2*(nn+1)*dPhi); | |
935 | dSnk[nn][k]+=pow(wPhi*wPt*wEta,k+1); | |
936 | } | |
937 | } | |
938 | ||
b7cb54d5 | 939 | } // end of if (pTrack->InRPSelection()) |
3d824203 | 940 | } // end of if (pTrack) |
941 | else {cerr << "no particle!!!"<<endl;} | |
942 | } // loop over particles | |
943 | ||
944 | for(Int_t nn=0;nn<4;nn++) | |
945 | { | |
946 | for(Int_t k=0;k<8;k++) | |
947 | { | |
948 | dSnk[nn][k]=pow(dSnk[nn][k],nn+1); | |
949 | } | |
950 | } | |
951 | ||
77515452 | 952 | //.............................................................................................. |
953 | // Ms (introduced in order to simplify some Eqs. bellow) | |
3d824203 | 954 | Double_t dM11 = dSnk[1][0]-dSnk[0][1]; // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
955 | Double_t dM22 = dSnk[1][1]-dSnk[0][3]; // dM22 = sum_{i,j=1,i!=j}^M w_i^2 w_j^2 | |
956 | Double_t dM33 = dSnk[1][2]-dSnk[0][5]; // dM33 = sum_{i,j=1,i!=j}^M w_i^3 w_j^3 | |
957 | Double_t dM44 = dSnk[1][3]-dSnk[0][7]; // dM44 = sum_{i,j=1,i!=j}^M w_i^4 w_j^4 | |
958 | Double_t dM31 = dSnk[0][2]*dSnk[0][0]-dSnk[0][3]; // dM31 = sum_{i,j=1,i!=j}^M w_i^3 w_j | |
959 | Double_t dM211 = dSnk[0][1]*dSnk[1][0]-2.*dSnk[0][2]*dSnk[0][0]-dSnk[1][1]+2.*dSnk[0][3]; // dM211 = sum_{i,j,k=1,i!=j!=k}^M w_i^2 w_j w_k | |
960 | Double_t dM1111 = dSnk[3][0]-6.*dM211-4.*dM31-3.*dM22-dSnk[0][3]; // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l | |
77515452 | 961 | //.............................................................................................. |
3d824203 | 962 | |
3d824203 | 963 | //--------------------------------------------------------------------------------------------------------- |
964 | // | |
965 | // *********************************************** | |
966 | // **** weighted multi-particle correlations: **** | |
967 | // *********************************************** | |
968 | // | |
77515452 | 969 | // Remark 1: weighted multi-particle correlations calculated with Q-vectors are stored in fWeightedQCorrelations. |
970 | // Remark 2: binning of fWeightedQCorrelations is organized as follows: | |
3d824203 | 971 | |
972 | // binning | |
973 | //.............................................................................................. | |
974 | // 1st bin: weighted <2>_{n|n} = <w1 w2 cos( n*(phi1-phi2))> | |
975 | // 2nd bin: weighted <2>_{2n|2n} = <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
976 | // 3rd bin: weighted <2>_{3n|3n} = <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
977 | // 4th bin: weighted <2>_{4n|4n} = <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
978 | // 5th bin: weighted <2>_{n|n} = <w1^3 w2 cos(n*(phi1-phi2))> | |
979 | // 6th bin: weighted <2>_{n|n} = <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
980 | ||
981 | // 11th bin: weighted <3>_{2n|n,n} = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
982 | ||
983 | // 21st bin: weighted <4>_{n,n|n,n} = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
984 | //.............................................................................................. | |
985 | ||
3d824203 | 986 | //.............................................................................................. |
987 | // weighted 2-particle correlations: | |
988 | Double_t two1n1nW1W1=0., two2n2nW2W2=0., two3n3nW3W3=0., two4n4nW4W4=0., two1n1nW3W1=0., two1n1nW2W1W1=0.; | |
989 | ||
990 | if(nRP>1) // nRP = number of particles used to determine the reaction plane | |
991 | { | |
992 | if(dM11 != 0) | |
993 | { | |
994 | two1n1nW1W1 = (pow(dQnkX[0][0],2)+pow(dQnkY[0][0],2)-dSnk[0][1])/dM11; // <2>_{n|n}=<w1 w2 cos(n*(phi1-phi2))> | |
77515452 | 995 | fWeightedQCorrelations->Fill(0.,two1n1nW1W1,dM11); |
3d824203 | 996 | } |
997 | if(dM22 != 0) | |
998 | { | |
999 | two2n2nW2W2 = (pow(dQnkX[1][1],2)+pow(dQnkY[1][1],2)-dSnk[0][3])/dM22; // <2>_{2n|2n}=<w1^2 w2^2 cos(2n*(phi1-phi2))> | |
77515452 | 1000 | fWeightedQCorrelations->Fill(1.,two2n2nW2W2,dM22); |
3d824203 | 1001 | } |
1002 | if(dM33 != 0) | |
1003 | { | |
1004 | two3n3nW3W3 = (pow(dQnkX[2][2],2)+pow(dQnkY[2][2],2)-dSnk[0][5])/dM33; // <2>_{2n|2n}=<w1^3 w2^3 cos(3n*(phi1-phi2))> | |
77515452 | 1005 | fWeightedQCorrelations->Fill(2.,two3n3nW3W3,dM33); |
3d824203 | 1006 | } |
1007 | if(dM44 != 0) | |
1008 | { | |
1009 | two4n4nW4W4 = (pow(dQnkX[3][3],2)+pow(dQnkY[3][3],2)-dSnk[0][7])/dM44; // <2>_{2n|2n}=<w1^4 w2^4 cos(4n*(phi1-phi2))> | |
77515452 | 1010 | fWeightedQCorrelations->Fill(3.,two4n4nW4W4,dM44); |
3d824203 | 1011 | } |
1012 | if(dM31 != 0) | |
1013 | { | |
1014 | two1n1nW3W1 = (dQnkX[0][2]*dQnkX[0][0]+dQnkY[0][2]*dQnkY[0][0]-dSnk[0][3])/dM31; // <2>_{n|n}=<w1^3 w2 cos(n*(phi1-phi2))> | |
77515452 | 1015 | fWeightedQCorrelations->Fill(4.,two1n1nW3W1,dM31); |
3d824203 | 1016 | } |
1017 | if(dM211 != 0) | |
1018 | { | |
1019 | two1n1nW2W1W1 = (dSnk[0][1]*dM11*two1n1nW1W1-2.*dM31*two1n1nW3W1)/dM211; // <2>_{n|n}=<w1^2 w2 w3 cos(n*(phi1-phi2))> | |
77515452 | 1020 | fWeightedQCorrelations->Fill(5.,two1n1nW2W1W1,dM211); |
3d824203 | 1021 | } |
1022 | } // end of if(nRP>1) | |
1023 | //.............................................................................................. | |
1024 | ||
3d824203 | 1025 | //.............................................................................................. |
1026 | // weighted 3-particle correlations: | |
1027 | Double_t three2n1n1nW2W1W1=0.; | |
1028 | ||
1029 | if(nRP>2) // nRP = number of particles used to determine the reaction plane | |
1030 | { | |
1031 | if(dM211 != 0) | |
1032 | { | |
1033 | three2n1n1nW2W1W1 = (pow(dQnkX[0][0],2.)*dQnkX[1][1]+2.*dQnkX[0][0]*dQnkY[0][0]*dQnkY[1][1]-pow(dQnkY[0][0],2.)*dQnkX[1][1]-2.*dM31*two1n1nW3W1-dM22*two2n2nW2W2-dSnk[0][3])/dM211; | |
77515452 | 1034 | fWeightedQCorrelations->Fill(10.,three2n1n1nW2W1W1,dM211); |
3d824203 | 1035 | } |
1036 | } // end of if(nRP>2) | |
1037 | //.............................................................................................. | |
1038 | ||
3d824203 | 1039 | //.............................................................................................. |
1040 | // weighted 4-particle correlations: | |
1041 | Double_t four1n1n1n1nW1W1W1W1=0.; | |
1042 | ||
1043 | if(nRP>3) // nRP = number of particles used to determine the reaction plane | |
1044 | { | |
1045 | if(dM1111 != 0) | |
1046 | { | |
77515452 | 1047 | four1n1n1n1nW1W1W1W1 = (pow(pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.),2)-2.*dM211*three2n1n1nW2W1W1-4.*dM211*two1n1nW2W1W1-4.*dM31*two1n1nW3W1-dM22*two2n2nW2W2-2.*dM22-dSnk[0][3])/dM1111; |
1048 | fWeightedQCorrelations->Fill(20.,four1n1n1n1nW1W1W1W1,dM1111); | |
3d824203 | 1049 | } |
1050 | } // end of if(nRP>3) | |
1051 | //.............................................................................................. | |
1052 | ||
3d824203 | 1053 | |
1054 | ||
3d824203 | 1055 | |
77515452 | 1056 | //--------------------------------------------------------------------------------------------------------- |
1057 | // | |
1058 | // ******************************************************* | |
1059 | // **** weighted reduced multi-particle correlations: **** | |
1060 | // ******************************************************* | |
1061 | // | |
1062 | // pt POI | |
1063 | TProfile *ptReq1nPrime = new TProfile("ptReq1nPrime","Re[q_{n}^{''}]",fnBinsPt,fPtMin,fPtMax,"s"); | |
1064 | TProfile *ptImq1nPrime = new TProfile("ptImq1nPrime","Im[q_{n}^{''}]",fnBinsPt,fPtMin,fPtMax,"s"); | |
1065 | TProfile *ptReq2nPrime = new TProfile("ptReq2nPrime","Re[q_{2n}^{''}]",fnBinsPt,fPtMin,fPtMax,"s"); | |
1066 | TProfile *ptImq2nPrime = new TProfile("ptImq2nPrime","Im[q_{2n}^{''}]",fnBinsPt,fPtMin,fPtMax,"s"); | |
3d824203 | 1067 | |
77515452 | 1068 | TProfile *ptReq1nPrimePrime = new TProfile("ptReq1nPrimePrime","Re[q_{n}^{''}]",fnBinsPt,fPtMin,fPtMax,"s"); |
1069 | TProfile *ptImq1nPrimePrime = new TProfile("ptImq1nPrimePrime","Im[q_{n}^{''}]",fnBinsPt,fPtMin,fPtMax,"s"); | |
1070 | TProfile *ptReq2nPrimePrime = new TProfile("ptReq2nPrimePrime","Re[q_{2n}^{''}]",fnBinsPt,fPtMin,fPtMax,"s"); | |
1071 | TProfile *ptImq2nPrimePrime = new TProfile("ptImq2nPrimePrime","Im[q_{2n}^{''}]",fnBinsPt,fPtMin,fPtMax,"s"); | |
3d824203 | 1072 | |
77515452 | 1073 | TProfile *req1nW2PrimePrimePt = new TProfile("req1nW2PrimePrimePt","#sum_{i=1}^{m''} w_{i}^{2} cos(n(#phi_{i}))''",fnBinsPt,fPtMin,fPtMax,"s"); |
1074 | TProfile *imq1nW2PrimePrimePt = new TProfile("imq1nW2PrimePrimePt","#sum_{i=1}^{m''} w_{i}^{2} sin(n(#phi_{i}))''",fnBinsPt,fPtMin,fPtMax,"s"); | |
1075 | TProfile *req2nW1PrimePrimePt = new TProfile("req2nW1PrimePrimePt","#sum_{i=1}^{m''} w_{i} cos(2n(#phi_{i}))''",fnBinsPt,fPtMin,fPtMax,"s"); | |
1076 | TProfile *imq2nW1PrimePrimePt = new TProfile("imq2nW1PrimePrimePt","#sum_{i=1}^{m''} w_{i} sin(2n(#phi_{i}))''",fnBinsPt,fPtMin,fPtMax,"s"); | |
3d824203 | 1077 | |
77515452 | 1078 | TProfile *sumOfW1upTomPrimePrimePt = new TProfile("sumOfW1upTomPrimePrimePt","#sum_{i=1}^{m''} w_{i}''",fnBinsPt,fPtMin,fPtMax,"s"); |
1079 | TProfile *sumOfW2upTomPrimePrimePt = new TProfile("sumOfW2upTomPrimePrimePt","#sum_{i=1}^{m''} w_{i}^{2}''",fnBinsPt,fPtMin,fPtMax,"s"); | |
1080 | TProfile *sumOfW3upTomPrimePrimePt = new TProfile("sumOfW3upTomPrimePrimePt","#sum_{i=1}^{m''} w_{i}^{3}''",fnBinsPt,fPtMin,fPtMax,"s"); | |
3d824203 | 1081 | |
77515452 | 1082 | // eta POI |
1083 | TProfile *etaReq1nPrime = new TProfile("etaReq1nPrime","Re[q_{n}^{''}]",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1084 | TProfile *etaImq1nPrime = new TProfile("etaImq1nPrime","Im[q_{n}^{''}]",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1085 | TProfile *etaReq2nPrime = new TProfile("etaReq2nPrime","Re[q_{2n}^{''}]",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1086 | TProfile *etaImq2nPrime = new TProfile("etaImq2nPrime","Im[q_{2n}^{''}]",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1087 | ||
1088 | TProfile *etaReq1nPrimePrime = new TProfile("etaReq1nPrimePrime","Re[q_{n}^{''}]",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1089 | TProfile *etaImq1nPrimePrime = new TProfile("etaImq1nPrimePrime","Im[q_{n}^{''}]",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1090 | TProfile *etaReq2nPrimePrime = new TProfile("etaReq2nPrimePrime","Re[q_{2n}^{''}]",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1091 | TProfile *etaImq2nPrimePrime = new TProfile("etaImq2nPrimePrime","Im[q_{2n}^{''}]",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1092 | ||
1093 | TProfile *req1nW2PrimePrimeEta = new TProfile("req1nW2PrimePrimeEta","#sum_{i=1}^{m''} w_{i}^{2} cos(n(#phi_{i}))''",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1094 | TProfile *imq1nW2PrimePrimeEta = new TProfile("imq1nW2PrimePrimeEta","#sum_{i=1}^{m''} w_{i}^{2} sin(n(#phi_{i}))''",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1095 | TProfile *req2nW1PrimePrimeEta = new TProfile("req2nW1PrimePrimeEta","#sum_{i=1}^{m''} w_{i} cos(2n(#phi_{i}))''",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1096 | TProfile *imq2nW1PrimePrimeEta = new TProfile("imq2nW1PrimePrimeEta","#sum_{i=1}^{m''} w_{i} sin(2n(#phi_{i}))''",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1097 | ||
1098 | TProfile *sumOfW1upTomPrimePrimeEta = new TProfile("sumOfW1upTomPrimePrimeEta","#sum_{i=1}^{m''} w_{i}''",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1099 | TProfile *sumOfW2upTomPrimePrimeEta = new TProfile("sumOfW2upTomPrimePrimeEta","#sum_{i=1}^{m''} w_{i}^{2}''",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1100 | TProfile *sumOfW3upTomPrimePrimeEta = new TProfile("sumOfW3upTomPrimePrimeEta","#sum_{i=1}^{m''} w_{i}^{3}''",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1101 | ||
1102 | // pt RP | |
1103 | TProfile *ptReq1n = new TProfile("ptReq1n","Re[q_{n}]",fnBinsPt,fPtMin,fPtMax,"s"); | |
1104 | TProfile *ptImq1n = new TProfile("ptImq1n","Im[q_{n}]",fnBinsPt,fPtMin,fPtMax,"s"); | |
1105 | TProfile *ptReq2n = new TProfile("ptReq2n","Re[q_{2n}]",fnBinsPt,fPtMin,fPtMax,"s"); | |
1106 | TProfile *ptImq2n = new TProfile("ptImq2n","Im[q_{2n}]",fnBinsPt,fPtMin,fPtMax,"s"); | |
1107 | ||
1108 | TProfile *req1nW2Pt = new TProfile("req1nW2Pt","#sum_{i=1}^{m} w_{i}^{2} cos(n(#phi_{i}))''",fnBinsPt,fPtMin,fPtMax,"s"); | |
1109 | TProfile *imq1nW2Pt = new TProfile("imq1nW2Pt","#sum_{i=1}^{m} w_{i}^{2} sin(n(#phi_{i}))''",fnBinsPt,fPtMin,fPtMax,"s"); | |
1110 | TProfile *req2nW1Pt = new TProfile("req2nW1Pt","#sum_{i=1}^{m} w_{i} cos(2n(#phi_{i}))''",fnBinsPt,fPtMin,fPtMax,"s"); | |
1111 | TProfile *imq2nW1Pt = new TProfile("imq2nW1Pt","#sum_{i=1}^{m} w_{i} sin(2n(#phi_{i}))''",fnBinsPt,fPtMin,fPtMax,"s"); | |
1112 | ||
1113 | TProfile *sumOfW1upTomPt = new TProfile("sumOfW1upTomPt","#sum_{i=1}^{m} w_{i}''",fnBinsPt,fPtMin,fPtMax,"s"); | |
1114 | TProfile *sumOfW2upTomPt = new TProfile("sumOfW2upTomPt","#sum_{i=1}^{m} w_{i}^{2}''",fnBinsPt,fPtMin,fPtMax,"s"); | |
1115 | TProfile *sumOfW3upTomPt = new TProfile("sumOfW3upTomPt","#sum_{i=1}^{m} w_{i}^{3}''",fnBinsPt,fPtMin,fPtMax,"s"); | |
1116 | ||
1117 | // eta RP | |
1118 | TProfile *etaReq1n = new TProfile("etaReq1n","Re[q_{n}]",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1119 | TProfile *etaImq1n = new TProfile("etaImq1n","Im[q_{n}]",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1120 | TProfile *etaReq2n = new TProfile("etaReq2n","Re[q_{2n}]",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1121 | TProfile *etaImq2n = new TProfile("etaImq2n","Im[q_{2n}]",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1122 | ||
1123 | TProfile *req1nW2Eta = new TProfile("req1nW2Eta","#sum_{i=1}^{m} w_{i}^{2} cos(n(#phi_{i}))''",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1124 | TProfile *imq1nW2Eta = new TProfile("imq1nW2Eta","#sum_{i=1}^{m} w_{i}^{2} sin(n(#phi_{i}))''",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1125 | TProfile *req2nW1Eta = new TProfile("req2nW1Eta","#sum_{i=1}^{m} w_{i} cos(2n(#phi_{i}))''",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1126 | TProfile *imq2nW1Eta = new TProfile("imq2nW1Eta","#sum_{i=1}^{m} w_{i} sin(2n(#phi_{i}))''",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1127 | ||
1128 | TProfile *sumOfW1upTomEta = new TProfile("sumOfW1upTomEta","#sum_{i=1}^{m} w_{i}''",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1129 | TProfile *sumOfW2upTomEta = new TProfile("sumOfW2upTomEta","#sum_{i=1}^{m} w_{i}^{2}''",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1130 | TProfile *sumOfW3upTomEta = new TProfile("sumOfW3upTomEta","#sum_{i=1}^{m} w_{i}^{3}''",fnBinsEta,fEtaMin,fEtaMax,"s"); | |
1131 | ||
1132 | for(Int_t i=0;i<nPrim;i++) // loop over all particles | |
3d824203 | 1133 | { |
1134 | fTrack=anEvent->GetTrack(i); | |
77515452 | 1135 | if(fTrack) |
1136 | { | |
b7cb54d5 | 1137 | if(fTrack->InPOISelection()) // checking if particle is POI |
3d824203 | 1138 | { |
b7cb54d5 | 1139 | if(fTrack->InRPSelection()) // checking if particle is both POI and RP |
3d824203 | 1140 | { |
77515452 | 1141 | // get azimuthal angle, momentum and pseudorapidity of a particle: |
1142 | dPhi = fTrack->Phi(); | |
1143 | dPt = fTrack->Pt(); | |
1144 | dEta = fTrack->Eta(); | |
1145 | // phi weights: | |
1146 | if(fUsePhiWeights) | |
1147 | { | |
1148 | nBinsPhi = phiWeights->GetNbinsX(); | |
1149 | if(nBinsPhi) | |
1150 | { | |
1151 | wPhi = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(dPhi*nBinsPhi/TMath::TwoPi()))); | |
1152 | } | |
1153 | } | |
1154 | // pt weights: | |
1155 | if(fUsePtWeights) | |
1156 | { | |
1157 | if(dBinWidthPt) | |
1158 | { | |
1159 | wPt = ptWeights->GetBinContent(1+(Int_t)(TMath::Floor((dPt-fPtMin)/dBinWidthPt))); | |
1160 | } | |
1161 | } | |
1162 | // eta weights: | |
1163 | if(fUseEtaWeights) | |
1164 | { | |
1165 | if(dBinWidthEta) | |
1166 | { | |
1167 | wEta = etaWeights->GetBinContent(1+(Int_t)(TMath::Floor((dEta-fEtaMin)/dBinWidthEta))); | |
1168 | } | |
1169 | } | |
1170 | // pt: | |
1171 | ptReq1nPrimePrime->Fill(dPt,cos(n*dPhi),1.); | |
1172 | ptImq1nPrimePrime->Fill(dPt,sin(n*dPhi),1.); | |
1173 | ptReq2nPrimePrime->Fill(dPt,cos(2.*n*dPhi),1.); | |
1174 | ptImq2nPrimePrime->Fill(dPt,sin(2.*n*dPhi),1.); | |
1175 | // weighted pt: | |
1176 | req1nW2PrimePrimePt->Fill(dPt,cos(n*dPhi),pow(wPhi*wPt*wEta,2.)); | |
1177 | imq1nW2PrimePrimePt->Fill(dPt,sin(n*dPhi),pow(wPhi*wPt*wEta,2.)); | |
1178 | req2nW1PrimePrimePt->Fill(dPt,cos(2.*n*dPhi),wPhi*wPt*wEta); | |
1179 | imq2nW1PrimePrimePt->Fill(dPt,sin(2.*n*dPhi),wPhi*wPt*wEta); | |
1180 | sumOfW1upTomPrimePrimePt->Fill(dPt,wPhi*wPt*wEta,1.); | |
1181 | sumOfW2upTomPrimePrimePt->Fill(dPt,pow(wPhi*wPt*wEta,2),1.); | |
1182 | sumOfW3upTomPrimePrimePt->Fill(dPt,pow(wPhi*wPt*wEta,3),1.); | |
1183 | ||
1184 | // eta: | |
1185 | etaReq1nPrimePrime->Fill(dEta,cos(n*dPhi),1.); | |
1186 | etaImq1nPrimePrime->Fill(dEta,sin(n*dPhi),1.); | |
1187 | etaReq2nPrimePrime->Fill(dEta,cos(2.*n*dPhi),1.); | |
1188 | etaImq2nPrimePrime->Fill(dEta,sin(2.*n*dPhi),1.); | |
1189 | // weighted eta: | |
1190 | req1nW2PrimePrimeEta->Fill(dEta,cos(n*dPhi),pow(wPhi*wPt*wEta,2.)); | |
1191 | imq1nW2PrimePrimeEta->Fill(dEta,sin(n*dPhi),pow(wPhi*wPt*wEta,2.)); | |
1192 | req2nW1PrimePrimeEta->Fill(dEta,cos(2.*n*dPhi),wPhi*wPt*wEta); | |
1193 | imq2nW1PrimePrimeEta->Fill(dEta,sin(2.*n*dPhi),wPhi*wPt*wEta); | |
1194 | sumOfW1upTomPrimePrimeEta->Fill(dEta,wPhi*wPt*wEta,1.); | |
1195 | sumOfW2upTomPrimePrimeEta->Fill(dEta,pow(wPhi*wPt*wEta,2),1.); | |
1196 | sumOfW3upTomPrimePrimeEta->Fill(dEta,pow(wPhi*wPt*wEta,3),1.); | |
1197 | ||
b7cb54d5 | 1198 | }else if(!(fTrack->InRPSelection())) // checking if particles is POI and not RP |
77515452 | 1199 | { |
1200 | // get azimuthal angle, momentum and pseudorapidity of a particle: | |
1201 | dPhi = fTrack->Phi(); | |
1202 | dPt = fTrack->Pt(); | |
1203 | dEta = fTrack->Eta(); | |
1204 | // pt: | |
1205 | ptReq1nPrime->Fill(dPt,cos(n*dPhi),1.); | |
1206 | ptImq1nPrime->Fill(dPt,sin(n*dPhi),1.); | |
1207 | ptReq2nPrime->Fill(dPt,cos(2.*n*dPhi),1.); | |
1208 | ptImq2nPrime->Fill(dPt,sin(2.*n*dPhi),1.); | |
1209 | ||
1210 | // eta: | |
1211 | etaReq1nPrime->Fill(dEta,cos(n*dPhi),1.); | |
1212 | etaImq1nPrime->Fill(dEta,sin(n*dPhi),1.); | |
1213 | etaReq2nPrime->Fill(dEta,cos(2.*n*dPhi),1.); | |
1214 | etaImq2nPrime->Fill(dEta,sin(2.*n*dPhi),1.); | |
1215 | ||
b7cb54d5 | 1216 | } // end of else if(!(fTrack->InRPSelection())) // checking if particles is POI and not RP |
1217 | } // end of if(fTrack->InPOISelection()) // checking if particle is POI | |
77515452 | 1218 | |
b7cb54d5 | 1219 | if(fTrack->InRPSelection()) // checking if particles is only RP: |
77515452 | 1220 | { |
1221 | dPhi = fTrack->Phi(); | |
1222 | dPt = fTrack->Pt(); | |
1223 | dEta = fTrack->Eta(); | |
1224 | ||
1225 | // phi weights: | |
1226 | if(fUsePhiWeights) | |
3d824203 | 1227 | { |
77515452 | 1228 | nBinsPhi = phiWeights->GetNbinsX(); |
1229 | if(nBinsPhi) | |
1230 | { | |
1231 | wPhi = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(dPhi*nBinsPhi/TMath::TwoPi()))); | |
1232 | } | |
1233 | } | |
1234 | // pt weights: | |
1235 | if(fUsePtWeights) | |
1236 | { | |
1237 | if(dBinWidthPt) | |
1238 | { | |
1239 | wPt = ptWeights->GetBinContent(1+(Int_t)(TMath::Floor((dPt-fPtMin)/dBinWidthPt))); | |
1240 | } | |
1241 | } | |
1242 | // eta weights: | |
1243 | if(fUseEtaWeights) | |
1244 | { | |
1245 | if(dBinWidthEta) | |
1246 | { | |
1247 | wEta = etaWeights->GetBinContent(1+(Int_t)(TMath::Floor((dEta-fEtaMin)/dBinWidthEta))); | |
1248 | } | |
3d824203 | 1249 | } |
77515452 | 1250 | // pt: |
1251 | ptReq1n->Fill(dPt,cos(n*dPhi),1.); | |
1252 | ptImq1n->Fill(dPt,sin(n*dPhi),1.); | |
1253 | ptReq2n->Fill(dPt,cos(2.*n*dPhi),1.); | |
1254 | ptImq2n->Fill(dPt,sin(2.*n*dPhi),1.); | |
1255 | // weighted pt: | |
1256 | req1nW2Pt->Fill(dPt,cos(n*dPhi),pow(wPhi*wPt*wEta,2.)); | |
1257 | imq1nW2Pt->Fill(dPt,sin(n*dPhi),pow(wPhi*wPt*wEta,2.)); | |
1258 | req2nW1Pt->Fill(dPt,cos(2.*n*dPhi),wPhi*wPt*wEta); | |
1259 | imq2nW1Pt->Fill(dPt,sin(2.*n*dPhi),wPhi*wPt*wEta); | |
1260 | sumOfW1upTomPt->Fill(dPt,wPhi*wPt*wEta,1.); | |
1261 | sumOfW2upTomPt->Fill(dPt,pow(wPhi*wPt*wEta,2),1.); | |
1262 | sumOfW3upTomPt->Fill(dPt,pow(wPhi*wPt*wEta,3),1.); | |
1263 | ||
1264 | // eta: | |
1265 | etaReq1n->Fill(dEta,cos(n*dPhi),1.); | |
1266 | etaImq1n->Fill(dEta,sin(n*dPhi),1.); | |
1267 | etaReq2n->Fill(dEta,cos(2.*n*dPhi),1.); | |
1268 | etaImq2n->Fill(dEta,sin(2.*n*dPhi),1.); | |
1269 | // weighted eta: | |
1270 | req1nW2Eta->Fill(dEta,cos(n*dPhi),pow(wPhi*wPt*wEta,2.)); | |
1271 | imq1nW2Eta->Fill(dEta,sin(n*dPhi),pow(wPhi*wPt*wEta,2.)); | |
1272 | req2nW1Eta->Fill(dEta,cos(2.*n*dPhi),wPhi*wPt*wEta); | |
1273 | imq2nW1Eta->Fill(dEta,sin(2.*n*dPhi),wPhi*wPt*wEta); | |
1274 | sumOfW1upTomEta->Fill(dEta,wPhi*wPt*wEta,1.); | |
1275 | sumOfW2upTomEta->Fill(dEta,pow(wPhi*wPt*wEta,2),1.); | |
1276 | sumOfW3upTomEta->Fill(dEta,pow(wPhi*wPt*wEta,3),1.); | |
b7cb54d5 | 1277 | } // end of if(fTrack->InRPSelection()) // checking if particles is only RP: |
77515452 | 1278 | } // end of if(fTrack} |
1279 | } // end of for(Int_t i=0;i<nPrim;i++) | |
bc92c0cb | 1280 | |
77515452 | 1281 | //........................................................................................................... |
1282 | // PrimePrime Pt POI | |
1283 | Double_t qxPrimePrimePtPOI=0.,qyPrimePrimePtPOI=0.,q2xPrimePrimePtPOIHere=0.,q2yPrimePrimePtPOIHere=0.;//add comments for these variable | |
3d824203 | 1284 | Double_t qxW2PrimePrimePtPOI=0.,qyW2PrimePrimePtPOI=0.,q2xW1PrimePrimePtPOI=0.,q2yW1PrimePrimePtPOI=0.;//add comments for these variable |
1285 | Double_t dS11mPrimePrimePtPOI=0.; // to be improved (name) | |
1286 | Double_t dS12mPrimePrimePtPOI=0.; // to be improved (name) | |
1287 | Double_t dS13mPrimePrimePtPOI=0.; // to be improved (name) | |
77515452 | 1288 | Double_t mPrimePrimePtPOI=0.; // to be improved (name) |
3d824203 | 1289 | |
1290 | Double_t dM1pp11PtPOI=0.; // to be improved (name) | |
1291 | Double_t dM0pp111PtPOI=0.; // to be improved (name) | |
1292 | Double_t dM0pp12PtPOI=0.; | |
1293 | Double_t dM2pp1PtPOI=0.; | |
1294 | Double_t dM1pp2PtPOI=0.; | |
1295 | Double_t dM0pp3PtPOI=0.; | |
1296 | ||
77515452 | 1297 | // Prime Pt POI |
1298 | Double_t qxPrimePtPOI=0.,qyPrimePtPOI=0.; | |
1299 | Double_t mPrimePtPOI=0.; | |
3d824203 | 1300 | Double_t dM0p111PtPOI=0.; // to be improved (name) |
77515452 | 1301 | |
3d824203 | 1302 | for(Int_t bin=1;bin<(fnBinsPt+1);bin++) // loop over pt-bins |
1303 | { | |
1304 | // q'': | |
77515452 | 1305 | qxPrimePrimePtPOI = (ptReq1nPrimePrime->GetBinContent(bin))*(ptReq1nPrimePrime->GetBinEntries(bin)); |
1306 | qyPrimePrimePtPOI = (ptImq1nPrimePrime->GetBinContent(bin))*(ptImq1nPrimePrime->GetBinEntries(bin)); | |
1307 | q2xPrimePrimePtPOIHere = (ptReq2nPrimePrime->GetBinContent(bin))*(ptReq2nPrimePrime->GetBinEntries(bin)); | |
1308 | q2yPrimePrimePtPOIHere = (ptImq2nPrimePrime->GetBinContent(bin))*(ptImq2nPrimePrime->GetBinEntries(bin)); | |
3d824203 | 1309 | |
77515452 | 1310 | qxW2PrimePrimePtPOI = (req1nW2PrimePrimePt->GetBinContent(bin))*(req1nW2PrimePrimePt->GetBinEntries(bin)); |
1311 | qyW2PrimePrimePtPOI = (imq1nW2PrimePrimePt->GetBinContent(bin))*(imq1nW2PrimePrimePt->GetBinEntries(bin)); | |
3d824203 | 1312 | |
77515452 | 1313 | q2xW1PrimePrimePtPOI = (req2nW1PrimePrimePt->GetBinContent(bin))*(req2nW1PrimePrimePt->GetBinEntries(bin)); |
1314 | q2yW1PrimePrimePtPOI = (imq2nW1PrimePrimePt->GetBinContent(bin))*(imq2nW1PrimePrimePt->GetBinEntries(bin)); | |
3d824203 | 1315 | |
77515452 | 1316 | dS11mPrimePrimePtPOI = (sumOfW1upTomPrimePrimePt->GetBinContent(bin))*(sumOfW1upTomPrimePrimePt->GetBinEntries(bin)); |
1317 | dS12mPrimePrimePtPOI = (sumOfW2upTomPrimePrimePt->GetBinContent(bin))*(sumOfW2upTomPrimePrimePt->GetBinEntries(bin)); | |
1318 | dS13mPrimePrimePtPOI = (sumOfW3upTomPrimePrimePt->GetBinContent(bin))*(sumOfW3upTomPrimePrimePt->GetBinEntries(bin)); | |
3d824203 | 1319 | |
77515452 | 1320 | mPrimePrimePtPOI = sumOfW1upTomPrimePrimePt->GetBinEntries(bin); // to be improved |
3d824203 | 1321 | |
1322 | dM1pp11PtPOI=dS11mPrimePrimePtPOI*(dSnk[1][0]-dSnk[0][1])-2.*dS12mPrimePrimePtPOI*dSnk[0][0]+2.*dS13mPrimePrimePtPOI; | |
1323 | dM1pp2PtPOI=dS11mPrimePrimePtPOI*dSnk[0][1]-dS13mPrimePrimePtPOI; | |
1324 | dM2pp1PtPOI=dS12mPrimePrimePtPOI*dSnk[0][0]-dS13mPrimePrimePtPOI; | |
77515452 | 1325 | dM0pp3PtPOI=mPrimePrimePtPOI*dSnk[0][2]-dS13mPrimePrimePtPOI; |
1326 | dM0pp12PtPOI=mPrimePrimePtPOI*dSnk[0][0]*dSnk[0][1]-dM2pp1PtPOI-dM1pp2PtPOI-dM0pp3PtPOI-dS13mPrimePrimePtPOI; | |
b7cb54d5 | 1327 | |
1328 | // recursive formula (OK) | |
1329 | // dM0pp111PtPOI=mPrimePrimePtPOI*dSnk[2][0]-3.*dM1pp11PtPOI-3.*dM0pp12PtPOI-3.*dM2pp1PtPOI-3.*dM1pp2PtPOI-dM0pp3PtPOI-dS13mPrimePrimePtPOI; | |
3d824203 | 1330 | |
b7cb54d5 | 1331 | // direct formula (OK) |
1332 | dM0pp111PtPOI = mPrimePrimePtPOI*(dSnk[2][0]-3.*dSnk[0][0]*dSnk[0][1]+2.*dSnk[0][2])-3.*(dS11mPrimePrimePtPOI*(dSnk[1][0]-dSnk[0][1])+2.*(dS13mPrimePrimePtPOI-dS12mPrimePrimePtPOI*dSnk[0][0])); | |
1333 | ||
3d824203 | 1334 | // q': |
77515452 | 1335 | qxPrimePtPOI = (ptReq1nPrime->GetBinContent(bin))*(ptReq1nPrime->GetBinEntries(bin)); |
1336 | qyPrimePtPOI = (ptImq1nPrime->GetBinContent(bin))*(ptImq1nPrime->GetBinEntries(bin)); | |
3d824203 | 1337 | |
77515452 | 1338 | mPrimePtPOI = ptReq1nPrime->GetBinEntries(bin); // to be improved |
1339 | dM0p111PtPOI=mPrimePtPOI*(dSnk[2][0]-3.*dSnk[0][1]*dSnk[0][0]+2.*dSnk[0][2]); | |
3d824203 | 1340 | |
77515452 | 1341 | // 2-p the needed one |
1342 | Double_t two1n1nWPerPtBinPOI=0.; | |
1343 | if((mPrimePrimePtPOI+mPrimePtPOI)*dSnk[0][0]-dS11mPrimePrimePtPOI>0) | |
3d824203 | 1344 | { |
77515452 | 1345 | two1n1nWPerPtBinPOI = (qxPrimePrimePtPOI*dQnkX[0][0]+qyPrimePrimePtPOI*dQnkY[0][0]+qxPrimePtPOI*dQnkX[0][0]+qyPrimePtPOI*dQnkY[0][0]-dS11mPrimePrimePtPOI)/((mPrimePrimePtPOI+mPrimePtPOI)*dSnk[0][0]-dS11mPrimePrimePtPOI); |
3d824203 | 1346 | |
77515452 | 1347 | f2WPerPtBin1n1nPOI->Fill(fPtMin+(bin-1)*dBinWidthPt,two1n1nWPerPtBinPOI,(mPrimePrimePtPOI+mPrimePtPOI)*dSnk[0][0]-dS11mPrimePrimePtPOI); |
3d824203 | 1348 | } |
1349 | ||
77515452 | 1350 | // 2-p temporary one |
3d824203 | 1351 | Double_t two1n1nW1ppW1W1PtPOI=0.; // <w1 w2 w3 cos(n(phi2-phi3))> // OK!!! |
1352 | if(dM1pp11PtPOI) | |
1353 | { | |
1354 | two1n1nW1ppW1W1PtPOI = ((pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*dS11mPrimePrimePtPOI-2.*(qxW2PrimePrimePtPOI*dQnkX[0][0]+qyW2PrimePrimePtPOI*dQnkY[0][0]) - dS11mPrimePrimePtPOI*dSnk[0][1]+2.*dS13mPrimePrimePtPOI)/dM1pp11PtPOI; // CORRECT !!! <w1 w2 w3 cos(n(phi2-phi3))> | |
1355 | } | |
1356 | ||
77515452 | 1357 | // 2-p temporary one |
3d824203 | 1358 | Double_t two1npp1nW1W2PtPOI=0.; // <w2 w3^2 cos(n(psi1-phi2))> // OK !!! |
1359 | if(dM0pp12PtPOI) | |
1360 | { | |
77515452 | 1361 | two1npp1nW1W2PtPOI = (dSnk[0][1]*(qxPrimePrimePtPOI*dQnkX[0][0]+qyPrimePrimePtPOI*dQnkY[0][0])-(qxW2PrimePrimePtPOI*dQnkX[0][0]+qyW2PrimePrimePtPOI*dQnkY[0][0])-dM1pp2PtPOI-(qxPrimePrimePtPOI*dQnkX[0][2]+qyPrimePrimePtPOI*dQnkY[0][2])+dS13mPrimePrimePtPOI)/dM0pp12PtPOI; // CORRECT !!! <w2 w3^2 cos(n(psi1-phi2))> |
3d824203 | 1362 | } |
1363 | ||
77515452 | 1364 | // 2-p temporary one |
3d824203 | 1365 | Double_t two1npp1nW2ppW1PtPOI=0.; // <w1^2 w2 cos(n(psi1-phi2))> // OK !!! |
1366 | if(dM2pp1PtPOI) | |
1367 | { | |
1368 | two1npp1nW2ppW1PtPOI = ((qxW2PrimePrimePtPOI*dQnkX[0][0]+qyW2PrimePrimePtPOI*dQnkY[0][0])-dS13mPrimePrimePtPOI)/dM2pp1PtPOI; // CORRECT !!! <w1^2 w2 cos(n(psi1-phi2))> | |
1369 | } | |
1370 | ||
77515452 | 1371 | // 2-p temporary one |
3d824203 | 1372 | Double_t two2npp2nW1ppW2PtPOI=0.; // <w1 w2^2 cos(2n(psi1-phi2))> OK !!! |
1373 | if(dM1pp2PtPOI) | |
1374 | { | |
1375 | two2npp2nW1ppW2PtPOI = ((q2xW1PrimePrimePtPOI*dQnkX[1][1]+q2yW1PrimePrimePtPOI*dQnkY[1][1])-dS13mPrimePrimePtPOI)/dM1pp2PtPOI; // CORRECT !!! <w1 w2^2 cos(2n(psi1-phi2))> | |
1376 | } | |
1377 | ||
77515452 | 1378 | // 2-p temporary one |
3d824203 | 1379 | Double_t two1npp1nW3PtPOI=0.; // <w2^3 cos(n(psi1-phi2))> // OK !!! |
1380 | if(dM0pp3PtPOI) | |
1381 | { | |
77515452 | 1382 | two1npp1nW3PtPOI = (qxPrimePrimePtPOI*dQnkX[0][2]+qyPrimePrimePtPOI*dQnkY[0][2]-dS13mPrimePrimePtPOI)/dM0pp3PtPOI; // CORRECT !!! <w2^3 cos(n(psi1-phi2))> |
3d824203 | 1383 | } |
1384 | ||
77515452 | 1385 | // 3-p temporary one |
3d824203 | 1386 | Double_t three2npp1n1nW1ppW1W1PtPOI=0.; // <w1 w2 w3 cos(n(2psi1-phi2-phi3))> // OK!!! |
1387 | if(dM1pp11PtPOI) | |
1388 | { | |
1389 | three2npp1n1nW1ppW1W1PtPOI = (q2xW1PrimePrimePtPOI*(dQnkX[0][0]*dQnkX[0][0]-dQnkY[0][0]*dQnkY[0][0])+2.*q2yW1PrimePrimePtPOI*dQnkX[0][0]*dQnkY[0][0]-2.*(qxW2PrimePrimePtPOI*dQnkX[0][0]+qyW2PrimePrimePtPOI*dQnkY[0][0])-(q2xW1PrimePrimePtPOI*dQnkX[1][1]+q2yW1PrimePrimePtPOI*dQnkY[1][1])+2.*dS13mPrimePrimePtPOI)/dM1pp11PtPOI; // CORRECT !!! <w1 w2 w3 cos(n(2psi1-phi2-phi3))> | |
1390 | } | |
1391 | ||
77515452 | 1392 | // 3-p temporary one |
3d824203 | 1393 | Double_t three1npp1n2nW0ppW1W2PtPOI=0.; // <w2 w3^2 cos(n(psi1+phi2-2*phi3))> // OK!!! |
1394 | if(dM0pp12PtPOI) | |
1395 | { | |
77515452 | 1396 | three1npp1n2nW0ppW1W2PtPOI = (qxPrimePrimePtPOI*(dQnkX[0][0]*dQnkX[1][1]+dQnkY[0][0]*dQnkY[1][1])-qyPrimePrimePtPOI*(dQnkY[0][0]*dQnkX[1][1]-dQnkX[0][0]*dQnkY[1][1])-(qxW2PrimePrimePtPOI*dQnkX[0][0]+qyW2PrimePrimePtPOI*dQnkY[0][0])-(q2xW1PrimePrimePtPOI*dQnkX[1][1]+q2yW1PrimePrimePtPOI*dQnkY[1][1])-(qxPrimePrimePtPOI*dQnkX[0][2]+qyPrimePrimePtPOI*dQnkY[0][2])+2.*dS13mPrimePrimePtPOI)/dM0pp12PtPOI; // CORRECT !!! <w2 w3^2 cos(n(psi1+phi2-2.*phi3))> |
3d824203 | 1397 | } |
1398 | ||
3d824203 | 1399 | /* |
77515452 | 1400 | // 4-p RP part |
3d824203 | 1401 | Double_t four1npp1n1n1nW1W1W1=0.; // <w1 w2 w3 cos(n(psi1+phi1-phi2-phi3))> |
1402 | if(dM0pp111PtPOI) | |
1403 | { | |
77515452 | 1404 | four1npp1n1n1nW1W1W1 = ((pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*(qxPrimePrimePtPOI*dQnkX[0][0]+qyPrimePrimePtPOI*dQnkY[0][0])-2.*dM1pp11PtPOI*two1n1nW1ppW1W1PtPOI-dM1pp11PtPOI*three2npp1n1nW1ppW1W1PtPOI-dM0pp12PtPOI*three1npp1n2nW0ppW1W2PtPOI-2.*dM0pp12PtPOI*two1npp1nW1W2PtPOI-3.*dM2pp1PtPOI*two1npp1nW2ppW1PtPOI-2.*dM1pp2PtPOI-dM1pp2PtPOI*two2npp2nW1ppW2PtPOI-dM0pp3PtPOI*two1npp1nW3PtPOI-dS13mPrimePrimePtPOI)/(dM0pp111PtPOI); |
3d824203 | 1405 | } |
3d824203 | 1406 | */ |
3d824203 | 1407 | |
77515452 | 1408 | /* |
1409 | // 4-p POI part | |
1410 | Double_t four1npp1n1n1nW1W1W1POI=0.; | |
1411 | if(dM0p111PtPOI>0&&mPrimePtPOI>0&&nRP>0) | |
1412 | { | |
1413 | four1npp1n1n1nW1W1W1POI = ((pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*(qxPrimePtPOI*dQnkX[0][0]+qyPrimePtPOI*dQnkY[0][0])-2.*dSnk[0][1]* (qxPrimePtPOI*dQnkX[0][0]+qyPrimePtPOI*dQnkY[0][0])+2.*(qxPrimePtPOI*dQnkX[0][2]+qyPrimePtPOI*dQnkY[0][2])-qxPrimePtPOI*(dQnkX[0][0]*dQnkX[1][1]+dQnkY[0][0]*dQnkY[1][1])+qyPrimePtPOI*(dQnkY[0][0]*dQnkX[1][1]-dQnkX[0][0]*dQnkY[1][1]))/dM0p111PtPOI; | |
3d824203 | 1414 | } |
77515452 | 1415 | */ |
3d824203 | 1416 | |
b7cb54d5 | 1417 | // recursive formula for 4-p RP and POI in all combinations (full, partial and no overlap) (OK) |
77515452 | 1418 | Double_t four1npp1n1n1nW1W1W1PtPOI=0.; |
1419 | if(dM0pp111PtPOI+dM0p111PtPOI) | |
1420 | { | |
b7cb54d5 | 1421 | four1npp1n1n1nW1W1W1PtPOI = ((pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*(qxPrimePrimePtPOI*dQnkX[0][0]+qyPrimePrimePtPOI*dQnkY[0][0])-2.*dM1pp11PtPOI*two1n1nW1ppW1W1PtPOI-dM1pp11PtPOI*three2npp1n1nW1ppW1W1PtPOI-dM0pp12PtPOI*three1npp1n2nW0ppW1W2PtPOI-2.*dM0pp12PtPOI*two1npp1nW1W2PtPOI-3.*dM2pp1PtPOI*two1npp1nW2ppW1PtPOI-2.*dM1pp2PtPOI-dM1pp2PtPOI*two2npp2nW1ppW2PtPOI-dM0pp3PtPOI*two1npp1nW3PtPOI-dS13mPrimePrimePtPOI+(pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*(qxPrimePtPOI*dQnkX[0][0]+qyPrimePtPOI*dQnkY[0][0])-2.*dSnk[0][1]* (qxPrimePtPOI*dQnkX[0][0]+qyPrimePtPOI*dQnkY[0][0])+2.*(qxPrimePtPOI*dQnkX[0][2]+qyPrimePtPOI*dQnkY[0][2])-qxPrimePtPOI*(dQnkX[0][0]*dQnkX[1][1]+dQnkY[0][0]*dQnkY[1][1])+qyPrimePtPOI*(dQnkY[0][0]*dQnkX[1][1]-dQnkX[0][0]*dQnkY[1][1]))/(dM0pp111PtPOI+dM0p111PtPOI); |
1422 | ||
1423 | ||
1424 | ||
1425 | Double_t four1npp1n1n1nW1W1W1PtPOIb = | |
1426 | ((pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*(qxPrimePrimePtPOI*dQnkX[0][0]+qyPrimePrimePtPOI*dQnkY[0][0]) | |
1427 | - q2xW1PrimePrimePtPOI*(dQnkX[0][0]*dQnkX[0][0]-dQnkY[0][0]*dQnkY[0][0])+2.*q2yW1PrimePrimePtPOI*dQnkX[0][0]*dQnkY[0][0] | |
1428 | - qxPrimePrimePtPOI*(dQnkX[0][0]*dQnkX[1][1]+dQnkY[0][0]*dQnkY[1][1])-qyPrimePrimePtPOI*(dQnkY[0][0]*dQnkX[1][1]-dQnkX[0][0]*dQnkY[1][1]) | |
1429 | - 2.*dSnk[0][1]*(qxPrimePrimePtPOI*dQnkX[0][0]+qyPrimePrimePtPOI*dQnkY[0][0]) | |
1430 | - 2.*(pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*dS11mPrimePrimePtPOI | |
1431 | + 7.*(qxW2PrimePrimePtPOI*dQnkX[0][0]+qyW2PrimePrimePtPOI*dQnkY[0][0]) | |
1432 | - 1.*(qxW2PrimePrimePtPOI*dQnkX[0][0]+qyW2PrimePrimePtPOI*dQnkY[0][0]) | |
1433 | + 1.*(q2xW1PrimePrimePtPOI*dQnkX[1][1]+q2yW1PrimePrimePtPOI*dQnkY[1][1]) | |
1434 | + 2.*(qxPrimePrimePtPOI*dQnkX[0][2]+qyPrimePrimePtPOI*dQnkY[0][2]) | |
1435 | + 2.*dS11mPrimePrimePtPOI*dSnk[0][1] | |
1436 | - 6.*dS13mPrimePrimePtPOI | |
1437 | + (pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*(qxPrimePtPOI*dQnkX[0][0]+qyPrimePtPOI*dQnkY[0][0]) | |
1438 | - 2.*dSnk[0][1]*(qxPrimePtPOI*dQnkX[0][0]+qyPrimePtPOI*dQnkY[0][0]) | |
1439 | - qxPrimePtPOI*(dQnkX[0][0]*dQnkX[1][1]+dQnkY[0][0]*dQnkY[1][1])-qyPrimePtPOI*(dQnkY[0][0]*dQnkX[1][1]-dQnkX[0][0]*dQnkY[1][1]) | |
1440 | + 2.*(qxPrimePrimePtPOI*dQnkX[0][2]+qyPrimePrimePtPOI*dQnkY[0][2]))/(dM0pp111PtPOI+dM0p111PtPOI); | |
1441 | ||
1442 | ||
1443 | ||
1444 | ||
1445 | ||
1446 | ||
1447 | ||
1448 | cout<<endl; | |
1449 | cout<<"ab"<<endl; | |
1450 | cout<<four1npp1n1n1nW1W1W1PtPOI<<endl; | |
1451 | cout<<four1npp1n1n1nW1W1W1PtPOIb<<endl; | |
1452 | cout<<endl; | |
3d824203 | 1453 | |
77515452 | 1454 | f4WPerPtBin1n1n1n1nPOI->Fill(fPtMin+(bin-1)*dBinWidthPt,four1npp1n1n1nW1W1W1PtPOI,dM0pp111PtPOI+dM0p111PtPOI); |
1455 | } // end of if(dM0pp111PtPOI+dM0p111PtPOI) | |
1456 | } // for(Int_t bin=1;bin<(fnBinsPt+1);bin++) // loop over pt-bins | |
1457 | //........................................................................................................... | |
1458 | ||
1459 | //........................................................................................................... | |
1460 | // PrimePrime Eta POI | |
1461 | Double_t qxPrimePrimeEtaPOI=0.,qyPrimePrimeEtaPOI=0.,q2xPrimePrimeEtaPOIHere=0.,q2yPrimePrimeEtaPOIHere=0.;//add comments for these variable | |
3d824203 | 1462 | Double_t qxW2PrimePrimeEtaPOI=0.,qyW2PrimePrimeEtaPOI=0.,q2xW1PrimePrimeEtaPOI=0.,q2yW1PrimePrimeEtaPOI=0.;//add comments for these variable |
1463 | Double_t dS11mPrimePrimeEtaPOI=0.; // to be improved (name) | |
1464 | Double_t dS12mPrimePrimeEtaPOI=0.; // to be improved (name) | |
1465 | Double_t dS13mPrimePrimeEtaPOI=0.; // to be improved (name) | |
1466 | Double_t mPrimePrimeEtaPOIHere=0.; // to be improved (name) | |
1467 | ||
1468 | Double_t dM1pp11EtaPOI=0.; // to be improved (name) | |
1469 | Double_t dM0pp111EtaPOI=0.; // to be improved (name) | |
1470 | Double_t dM0pp12EtaPOI=0.; | |
1471 | Double_t dM2pp1EtaPOI=0.; | |
1472 | Double_t dM1pp2EtaPOI=0.; | |
1473 | Double_t dM0pp3EtaPOI=0.; | |
1474 | ||
77515452 | 1475 | // Prime Eta POI |
1476 | Double_t qxPrimeEtaPOI=0.,qyPrimeEtaPOI=0.; | |
1477 | Double_t mPrimeEtaPOI=0.; | |
3d824203 | 1478 | Double_t dM0p111EtaPOI=0.; // to be improved (name) |
1479 | ||
77515452 | 1480 | for(Int_t bin=1;bin<(fnBinsEta+1);bin++) // loop over eta-bins |
3d824203 | 1481 | { |
1482 | // q'': | |
77515452 | 1483 | qxPrimePrimeEtaPOI = (etaReq1nPrimePrime->GetBinContent(bin))*(etaReq1nPrimePrime->GetBinEntries(bin)); |
1484 | qyPrimePrimeEtaPOI = (etaImq1nPrimePrime->GetBinContent(bin))*(etaImq1nPrimePrime->GetBinEntries(bin)); | |
1485 | q2xPrimePrimeEtaPOIHere = (etaReq2nPrimePrime->GetBinContent(bin))*(etaReq2nPrimePrime->GetBinEntries(bin)); | |
1486 | q2yPrimePrimeEtaPOIHere = (etaImq2nPrimePrime->GetBinContent(bin))*(etaImq2nPrimePrime->GetBinEntries(bin)); | |
3d824203 | 1487 | |
77515452 | 1488 | qxW2PrimePrimeEtaPOI = (req1nW2PrimePrimeEta->GetBinContent(bin))*(req1nW2PrimePrimeEta->GetBinEntries(bin)); |
1489 | qyW2PrimePrimeEtaPOI = (imq1nW2PrimePrimeEta->GetBinContent(bin))*(imq1nW2PrimePrimeEta->GetBinEntries(bin)); | |
3d824203 | 1490 | |
77515452 | 1491 | q2xW1PrimePrimeEtaPOI = (req2nW1PrimePrimeEta->GetBinContent(bin))*(req2nW1PrimePrimeEta->GetBinEntries(bin)); |
1492 | q2yW1PrimePrimeEtaPOI = (imq2nW1PrimePrimeEta->GetBinContent(bin))*(imq2nW1PrimePrimeEta->GetBinEntries(bin)); | |
3d824203 | 1493 | |
77515452 | 1494 | dS11mPrimePrimeEtaPOI = (sumOfW1upTomPrimePrimeEta->GetBinContent(bin))*(sumOfW1upTomPrimePrimeEta->GetBinEntries(bin)); |
1495 | dS12mPrimePrimeEtaPOI = (sumOfW2upTomPrimePrimeEta->GetBinContent(bin))*(sumOfW2upTomPrimePrimeEta->GetBinEntries(bin)); | |
1496 | dS13mPrimePrimeEtaPOI = (sumOfW3upTomPrimePrimeEta->GetBinContent(bin))*(sumOfW3upTomPrimePrimeEta->GetBinEntries(bin)); | |
3d824203 | 1497 | |
77515452 | 1498 | mPrimePrimeEtaPOIHere = sumOfW1upTomPrimePrimeEta->GetBinEntries(bin); // to be improved |
3d824203 | 1499 | |
1500 | dM1pp11EtaPOI=dS11mPrimePrimeEtaPOI*(dSnk[1][0]-dSnk[0][1])-2.*dS12mPrimePrimeEtaPOI*dSnk[0][0]+2.*dS13mPrimePrimeEtaPOI; | |
1501 | dM1pp2EtaPOI=dS11mPrimePrimeEtaPOI*dSnk[0][1]-dS13mPrimePrimeEtaPOI; | |
1502 | dM2pp1EtaPOI=dS12mPrimePrimeEtaPOI*dSnk[0][0]-dS13mPrimePrimeEtaPOI; | |
1503 | dM0pp3EtaPOI=mPrimePrimeEtaPOIHere*dSnk[0][2]-dS13mPrimePrimeEtaPOI; | |
1504 | dM0pp12EtaPOI=mPrimePrimeEtaPOIHere*dSnk[0][0]*dSnk[0][1]-dM2pp1EtaPOI-dM1pp2EtaPOI-dM0pp3EtaPOI-dS13mPrimePrimeEtaPOI; | |
1505 | dM0pp111EtaPOI=mPrimePrimeEtaPOIHere*dSnk[2][0]-3.*dM1pp11EtaPOI-3.*dM0pp12EtaPOI-3.*dM2pp1EtaPOI-3.*dM1pp2EtaPOI-dM0pp3EtaPOI-dS13mPrimePrimeEtaPOI; | |
1506 | ||
1507 | // q': | |
77515452 | 1508 | qxPrimeEtaPOI = (etaReq1nPrime->GetBinContent(bin))*(etaReq1nPrime->GetBinEntries(bin)); |
1509 | qyPrimeEtaPOI = (etaImq1nPrime->GetBinContent(bin))*(etaImq1nPrime->GetBinEntries(bin)); | |
3d824203 | 1510 | |
77515452 | 1511 | mPrimeEtaPOI = etaReq1nPrime->GetBinEntries(bin); // to be improved |
1512 | dM0p111EtaPOI=mPrimeEtaPOI*(dSnk[2][0]-3.*dSnk[0][1]*dSnk[0][0]+2.*dSnk[0][2]); | |
3d824203 | 1513 | |
77515452 | 1514 | // 2-p the needed one |
1515 | Double_t two1n1nWPerEtaBinPOI=0.; | |
1516 | if((mPrimePrimeEtaPOIHere+mPrimeEtaPOI)*dSnk[0][0]-dS11mPrimePrimeEtaPOI>0) | |
3d824203 | 1517 | { |
77515452 | 1518 | two1n1nWPerEtaBinPOI = (qxPrimePrimeEtaPOI*dQnkX[0][0]+qyPrimePrimeEtaPOI*dQnkY[0][0]+qxPrimeEtaPOI*dQnkX[0][0]+qyPrimeEtaPOI*dQnkY[0][0]-dS11mPrimePrimeEtaPOI)/((mPrimePrimeEtaPOIHere+mPrimeEtaPOI)*dSnk[0][0]-dS11mPrimePrimeEtaPOI); |
3d824203 | 1519 | |
77515452 | 1520 | f2WPerEtaBin1n1nPOI->Fill(fEtaMin+(bin-1)*dBinWidthEta,two1n1nWPerEtaBinPOI,(mPrimePrimeEtaPOIHere+mPrimeEtaPOI)*dSnk[0][0]-dS11mPrimePrimeEtaPOI); // <2'>_{n|n} |
3d824203 | 1521 | } |
1522 | ||
77515452 | 1523 | // 2-p the temporary one |
3d824203 | 1524 | Double_t two1n1nW1ppW1W1EtaPOI=0.; // <w1 w2 w3 cos(n(phi2-phi3))> // OK!!! |
1525 | if(dM1pp11EtaPOI) | |
1526 | { | |
77515452 | 1527 | two1n1nW1ppW1W1EtaPOI = ((pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*dS11mPrimePrimeEtaPOI-2.*(qxW2PrimePrimeEtaPOI*dQnkX[0][0]+qyW2PrimePrimeEtaPOI*dQnkY[0][0])-dS11mPrimePrimeEtaPOI*dSnk[0][1]+2.*dS13mPrimePrimeEtaPOI)/dM1pp11EtaPOI; // CORRECT !!! <w1 w2 w3 cos(n(phi2-phi3))> |
3d824203 | 1528 | } |
1529 | ||
77515452 | 1530 | // 2-p the temporary one |
3d824203 | 1531 | Double_t two1npp1nW1W2EtaPOI=0.; // <w2 w3^2 cos(n(psi1-phi2))> // OK !!! |
1532 | if(dM0pp12EtaPOI) | |
1533 | { | |
77515452 | 1534 | two1npp1nW1W2EtaPOI = (dSnk[0][1]*(qxPrimePrimeEtaPOI*dQnkX[0][0]+qyPrimePrimeEtaPOI*dQnkY[0][0])-(qxW2PrimePrimeEtaPOI*dQnkX[0][0]+qyW2PrimePrimeEtaPOI*dQnkY[0][0])-dM1pp2EtaPOI-(qxPrimePrimeEtaPOI*dQnkX[0][2]+qyPrimePrimeEtaPOI*dQnkY[0][2])+dS13mPrimePrimeEtaPOI)/dM0pp12EtaPOI; // CORRECT !!! <w2 w3^2 cos(n(psi1-phi2))> |
3d824203 | 1535 | } |
1536 | ||
77515452 | 1537 | // 2-p the temporary one |
3d824203 | 1538 | Double_t two1npp1nW2ppW1EtaPOI=0.; // <w1^2 w2 cos(n(psi1-phi2))> // OK !!! |
1539 | if(dM2pp1EtaPOI) | |
1540 | { | |
1541 | two1npp1nW2ppW1EtaPOI = ((qxW2PrimePrimeEtaPOI*dQnkX[0][0]+qyW2PrimePrimeEtaPOI*dQnkY[0][0])-dS13mPrimePrimeEtaPOI)/dM2pp1EtaPOI; // CORRECT !!! <w1^2 w2 cos(n(psi1-phi2))> | |
1542 | } | |
1543 | ||
77515452 | 1544 | // 2-p the temporary one |
3d824203 | 1545 | Double_t two2npp2nW1ppW2EtaPOI=0.; // <w1 w2^2 cos(2n(psi1-phi2))> OK !!! |
1546 | if(dM1pp2EtaPOI) | |
1547 | { | |
1548 | two2npp2nW1ppW2EtaPOI = ((q2xW1PrimePrimeEtaPOI*dQnkX[1][1]+q2yW1PrimePrimeEtaPOI*dQnkY[1][1])-dS13mPrimePrimeEtaPOI)/dM1pp2EtaPOI; // CORRECT !!! <w1 w2^2 cos(2n(psi1-phi2))> | |
1549 | } | |
1550 | ||
77515452 | 1551 | // 2-p the temporary one |
3d824203 | 1552 | Double_t two1npp1nW3EtaPOI=0.; // <w2^3 cos(n(psi1-phi2))> // OK !!! |
1553 | if(dM0pp3EtaPOI) | |
1554 | { | |
77515452 | 1555 | two1npp1nW3EtaPOI = (qxPrimePrimeEtaPOI*dQnkX[0][2]+qyPrimePrimeEtaPOI*dQnkY[0][2]-dS13mPrimePrimeEtaPOI)/dM0pp3EtaPOI; // CORRECT !!! <w2^3 cos(n(psi1-phi2))> |
3d824203 | 1556 | } |
1557 | ||
77515452 | 1558 | // 3-p the temporary one |
3d824203 | 1559 | Double_t three2npp1n1nW1ppW1W1EtaPOI=0.; // <w1 w2 w3 cos(n(2psi1-phi2-phi3))> // OK!!! |
1560 | if(dM1pp11EtaPOI) | |
1561 | { | |
1562 | three2npp1n1nW1ppW1W1EtaPOI = (q2xW1PrimePrimeEtaPOI*(dQnkX[0][0]*dQnkX[0][0]-dQnkY[0][0]*dQnkY[0][0])+2.*q2yW1PrimePrimeEtaPOI*dQnkX[0][0]*dQnkY[0][0]-2.*(qxW2PrimePrimeEtaPOI*dQnkX[0][0]+qyW2PrimePrimeEtaPOI*dQnkY[0][0])-(q2xW1PrimePrimeEtaPOI*dQnkX[1][1]+q2yW1PrimePrimeEtaPOI*dQnkY[1][1])+2.*dS13mPrimePrimeEtaPOI)/dM1pp11EtaPOI; // CORRECT !!! <w1 w2 w3 cos(n(2psi1-phi2-phi3))> | |
1563 | } | |
1564 | ||
77515452 | 1565 | // 3-p the temporary one |
3d824203 | 1566 | Double_t three1npp1n2nW0ppW1W2EtaPOI=0.; // <w2 w3^2 cos(n(psi1+phi2-2*phi3))> // OK!!! |
1567 | if(dM0pp12EtaPOI) | |
1568 | { | |
77515452 | 1569 | three1npp1n2nW0ppW1W2EtaPOI = (qxPrimePrimeEtaPOI*(dQnkX[0][0]*dQnkX[1][1]+dQnkY[0][0]*dQnkY[1][1])-qyPrimePrimeEtaPOI*(dQnkY[0][0]*dQnkX[1][1]-dQnkX[0][0]*dQnkY[1][1])-(qxW2PrimePrimeEtaPOI*dQnkX[0][0]+qyW2PrimePrimeEtaPOI*dQnkY[0][0])-(q2xW1PrimePrimeEtaPOI*dQnkX[1][1]+q2yW1PrimePrimeEtaPOI*dQnkY[1][1])-(qxPrimePrimeEtaPOI*dQnkX[0][2]+qyPrimePrimeEtaPOI*dQnkY[0][2])+2.*dS13mPrimePrimeEtaPOI)/dM0pp12EtaPOI; // CORRECT !!! <w2 w3^2 cos(n(psi1+phi2-2.*phi3))> |
3d824203 | 1570 | } |
1571 | ||
3d824203 | 1572 | /* |
77515452 | 1573 | // 4-p RP part |
3d824203 | 1574 | Double_t four1npp1n1n1nW1W1W1=0.; // <w1 w2 w3 cos(n(psi1+phi1-phi2-phi3))> |
1575 | if(dM0pp111EtaPOI) | |
1576 | { | |
77515452 | 1577 | four1npp1n1n1nW1W1W1 = ((pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*(qxPrimePrimeEtaPOI*dQnkX[0][0]+qyPrimePrimeEtaPOI*dQnkY[0][0])-2.*dM1pp11EtaPOI*two1n1nW1ppW1W1EtaPOI-dM1pp11EtaPOI*three2npp1n1nW1ppW1W1EtaPOI-dM0pp12EtaPOI*three1npp1n2nW0ppW1W2EtaPOI-2.*dM0pp12EtaPOI*two1npp1nW1W2EtaPOI-3.*dM2pp1EtaPOI*two1npp1nW2ppW1EtaPOI-2.*dM1pp2EtaPOI-dM1pp2EtaPOI*two2npp2nW1ppW2EtaPOI-dM0pp3EtaPOI*two1npp1nW3EtaPOI-dS13mPrimePrimeEtaPOI)/(dM0pp111EtaPOI); |
1578 | } | |
1579 | */ | |
1580 | /* | |
1581 | // 4-p POI part | |
1582 | Double_t four1npp1n1n1nW1W1W1POI=0.; | |
1583 | if(dM0p111EtaPOI>0&&mPrimeEtaPOI>0&&nRP>0) | |
1584 | { | |
1585 | four1npp1n1n1nW1W1W1POI = ((pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*(qxPrimeEtaPOI*dQnkX[0][0]+qyPrimeEtaPOI*dQnkY[0][0])-2.*dSnk[0][1]* (qxPrimeEtaPOI*dQnkX[0][0]+qyPrimeEtaPOI*dQnkY[0][0])+2.*(qxPrimeEtaPOI*dQnkX[0][2]+qyPrimeEtaPOI*dQnkY[0][2])-qxPrimeEtaPOI*(dQnkX[0][0]*dQnkX[1][1]+dQnkY[0][0]*dQnkY[1][1])+qyPrimeEtaPOI*(dQnkY[0][0]*dQnkX[1][1]-dQnkX[0][0]*dQnkY[1][1]))/dM0p111EtaPOI; | |
3d824203 | 1586 | } |
3d824203 | 1587 | */ |
1588 | ||
77515452 | 1589 | // 4-p RP and POI in all combinations (full, partial and no overlap) |
1590 | Double_t four1npp1n1n1nW1W1W1EtaPOI=0.; | |
1591 | ||
1592 | if(dM0pp111EtaPOI+dM0p111EtaPOI) | |
1593 | { | |
1594 | four1npp1n1n1nW1W1W1EtaPOI = ((pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*(qxPrimePrimeEtaPOI*dQnkX[0][0]+qyPrimePrimeEtaPOI*dQnkY[0][0])-2.*dM1pp11EtaPOI*two1n1nW1ppW1W1EtaPOI-dM1pp11EtaPOI*three2npp1n1nW1ppW1W1EtaPOI-dM0pp12EtaPOI*three1npp1n2nW0ppW1W2EtaPOI-2.*dM0pp12EtaPOI*two1npp1nW1W2EtaPOI-3.*dM2pp1EtaPOI*two1npp1nW2ppW1EtaPOI-2.*dM1pp2EtaPOI-dM1pp2EtaPOI*two2npp2nW1ppW2EtaPOI-dM0pp3EtaPOI*two1npp1nW3EtaPOI-dS13mPrimePrimeEtaPOI+(pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*(qxPrimeEtaPOI*dQnkX[0][0]+qyPrimeEtaPOI*dQnkY[0][0])-2.*dSnk[0][1]*(qxPrimeEtaPOI*dQnkX[0][0]+qyPrimeEtaPOI*dQnkY[0][0])+2.*(qxPrimeEtaPOI*dQnkX[0][2]+qyPrimeEtaPOI*dQnkY[0][2])-qxPrimeEtaPOI*(dQnkX[0][0]*dQnkX[1][1]+dQnkY[0][0]*dQnkY[1][1])+qyPrimeEtaPOI*(dQnkY[0][0]*dQnkX[1][1]-dQnkX[0][0]*dQnkY[1][1]))/(dM0pp111EtaPOI+dM0p111EtaPOI); | |
1595 | ||
1596 | f4WPerEtaBin1n1n1n1nPOI->Fill(fEtaMin+(bin-1)*dBinWidthEta,four1npp1n1n1nW1W1W1EtaPOI,dM0pp111EtaPOI+dM0p111EtaPOI); | |
1597 | } | |
1598 | } | |
1599 | //........................................................................................................... | |
1600 | ||
3d824203 | 1601 | |
1602 | ||
77515452 | 1603 | |
1604 | ||
1605 | ||
1606 | ||
1607 | ||
1608 | ||
1609 | ||
1610 | ||
1611 | ||
1612 | ||
1613 | ||
1614 | // RPs | |
1615 | ptReq1nPrime->Reset(); // to be improved | |
1616 | ptImq1nPrime->Reset(); // to be improved | |
1617 | ptReq2nPrime->Reset(); // to be improved | |
1618 | ptImq2nPrime->Reset(); // to be improved | |
1619 | ||
1620 | etaReq1nPrime->Reset(); // to be improved | |
1621 | etaImq1nPrime->Reset(); // to be improved | |
1622 | etaReq2nPrime->Reset(); // to be improved | |
1623 | etaImq2nPrime->Reset(); // to be improved | |
1624 | ||
1625 | ||
1626 | //........................................................................................................... | |
1627 | // PrimePrime Pt RP | |
1628 | Double_t qxPtRP=0.,qyPtRP=0.,q2xPtRP=0.,q2yPtRP=0.;//add comments for these variable | |
1629 | Double_t qxW2PtRP=0.,qyW2PtRP=0.,q2xW1PtRP=0.,q2yW1PtRP=0.;//add comments for these variable | |
1630 | Double_t dS11mPtRP=0.; // to be improved (name) | |
1631 | Double_t dS12mPtRP=0.; // to be improved (name) | |
1632 | Double_t dS13mPtRP=0.; // to be improved (name) | |
1633 | Double_t mPtRP=0.; // to be improved (name) | |
1634 | ||
1635 | Double_t dM1pp11PtRP=0.; // to be improved (name) | |
1636 | Double_t dM0pp111PtRP=0.; // to be improved (name) | |
1637 | Double_t dM0pp12PtRP=0.; | |
1638 | Double_t dM2pp1PtRP=0.; | |
1639 | Double_t dM1pp2PtRP=0.; | |
1640 | Double_t dM0pp3PtRP=0.; | |
1641 | ||
1642 | // Prime Pt RP | |
1643 | Double_t qxPrimePtRP=0.,qyPrimePtRP=0.; | |
1644 | Double_t mPrimePtRP=0.; | |
1645 | Double_t dM0p111PtRP=0.; // to be improved (name) | |
1646 | ||
1647 | for(Int_t bin=1;bin<(fnBinsPt+1);bin++) // loop over pt-bins | |
1648 | { | |
1649 | // q'': | |
1650 | qxPtRP = (ptReq1n->GetBinContent(bin))*(ptReq1n->GetBinEntries(bin)); | |
1651 | qyPtRP = (ptImq1n->GetBinContent(bin))*(ptImq1n->GetBinEntries(bin)); | |
1652 | q2xPtRP = (ptReq2n->GetBinContent(bin))*(ptReq2n->GetBinEntries(bin)); | |
1653 | q2yPtRP = (ptImq2n->GetBinContent(bin))*(ptImq2n->GetBinEntries(bin)); | |
1654 | ||
1655 | qxW2PtRP = (req1nW2Pt->GetBinContent(bin))*(req1nW2Pt->GetBinEntries(bin)); | |
1656 | qyW2PtRP = (imq1nW2Pt->GetBinContent(bin))*(imq1nW2Pt->GetBinEntries(bin)); | |
1657 | ||
1658 | q2xW1PtRP = (req2nW1Pt->GetBinContent(bin))*(req2nW1Pt->GetBinEntries(bin)); | |
1659 | q2yW1PtRP = (imq2nW1Pt->GetBinContent(bin))*(imq2nW1Pt->GetBinEntries(bin)); | |
1660 | ||
1661 | dS11mPtRP = (sumOfW1upTomPt->GetBinContent(bin))*(sumOfW1upTomPt->GetBinEntries(bin)); | |
1662 | dS12mPtRP = (sumOfW2upTomPt->GetBinContent(bin))*(sumOfW2upTomPt->GetBinEntries(bin)); | |
1663 | dS13mPtRP = (sumOfW3upTomPt->GetBinContent(bin))*(sumOfW3upTomPt->GetBinEntries(bin)); | |
1664 | ||
1665 | mPtRP = sumOfW1upTomPt->GetBinEntries(bin); // to be improved | |
1666 | ||
1667 | dM1pp11PtRP=dS11mPtRP*(dSnk[1][0]-dSnk[0][1])-2.*dS12mPtRP*dSnk[0][0]+2.*dS13mPtRP; | |
1668 | dM1pp2PtRP=dS11mPtRP*dSnk[0][1]-dS13mPtRP; | |
1669 | dM2pp1PtRP=dS12mPtRP*dSnk[0][0]-dS13mPtRP; | |
1670 | dM0pp3PtRP=mPtRP*dSnk[0][2]-dS13mPtRP; | |
1671 | dM0pp12PtRP=mPtRP*dSnk[0][0]*dSnk[0][1]-dM2pp1PtRP-dM1pp2PtRP-dM0pp3PtRP-dS13mPtRP; | |
1672 | dM0pp111PtRP=mPtRP*dSnk[2][0]-3.*dM1pp11PtRP-3.*dM0pp12PtRP-3.*dM2pp1PtRP-3.*dM1pp2PtRP-dM0pp3PtRP-dS13mPtRP; | |
1673 | ||
1674 | // q': | |
1675 | qxPrimePtRP = (ptReq1nPrime->GetBinContent(bin))*(ptReq1nPrime->GetBinEntries(bin)); | |
1676 | qyPrimePtRP = (ptImq1nPrime->GetBinContent(bin))*(ptImq1nPrime->GetBinEntries(bin)); | |
3d824203 | 1677 | |
77515452 | 1678 | mPrimePtRP = ptReq1nPrime->GetBinEntries(bin); // to be improved |
1679 | dM0p111PtRP=mPrimePtRP*(dSnk[2][0]-3.*dSnk[0][1]*dSnk[0][0]+2.*dSnk[0][2]); | |
3d824203 | 1680 | |
77515452 | 1681 | // 2-p the needed one |
1682 | Double_t two1n1nWPerPtBinRP=0.; | |
1683 | if((mPtRP+mPrimePtRP)*dSnk[0][0]-dS11mPtRP>0) | |
1684 | { | |
1685 | two1n1nWPerPtBinRP = (qxPtRP*dQnkX[0][0]+qyPtRP*dQnkY[0][0]+qxPrimePtRP*dQnkX[0][0]+qyPrimePtRP*dQnkY[0][0]-dS11mPtRP)/((mPtRP+mPrimePtRP)*dSnk[0][0]-dS11mPtRP); | |
1686 | f2WPerPtBin1n1nRP->Fill(fPtMin+(bin-1)*dBinWidthPt,two1n1nWPerPtBinRP,(mPtRP+mPrimePtRP)*dSnk[0][0]-dS11mPtRP); | |
1687 | } | |
1688 | ||
1689 | // 2-p temporary one | |
1690 | Double_t two1n1nW1ppW1W1PtRP=0.; // <w1 w2 w3 cos(n(phi2-phi3))> // OK!!! | |
1691 | if(dM1pp11PtRP) | |
1692 | { | |
1693 | two1n1nW1ppW1W1PtRP = ((pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*dS11mPtRP-2.*(qxW2PtRP*dQnkX[0][0]+qyW2PtRP*dQnkY[0][0])-dS11mPtRP*dSnk[0][1]+2.*dS13mPtRP)/dM1pp11PtRP; // CORRECT !!! <w1 w2 w3 cos(n(phi2-phi3))> | |
1694 | } | |
1695 | ||
1696 | // 2-p temporary one | |
1697 | Double_t two1npp1nW1W2PtRP=0.; // <w2 w3^2 cos(n(psi1-phi2))> // OK !!! | |
1698 | if(dM0pp12PtRP) | |
1699 | { | |
1700 | two1npp1nW1W2PtRP = (dSnk[0][1]*(qxPtRP*dQnkX[0][0]+qyPtRP*dQnkY[0][0])-(qxW2PtRP*dQnkX[0][0]+qyW2PtRP*dQnkY[0][0])-dM1pp2PtRP-(qxPtRP*dQnkX[0][2]+qyPtRP*dQnkY[0][2])+dS13mPtRP)/dM0pp12PtRP; // CORRECT !!! <w2 w3^2 cos(n(psi1-phi2))> | |
1701 | } | |
3d824203 | 1702 | |
77515452 | 1703 | // 2-p temporary one |
1704 | Double_t two1npp1nW2ppW1PtRP=0.; // <w1^2 w2 cos(n(psi1-phi2))> // OK !!! | |
1705 | if(dM2pp1PtRP) | |
1706 | { | |
1707 | two1npp1nW2ppW1PtRP = ((qxW2PtRP*dQnkX[0][0]+qyW2PtRP*dQnkY[0][0])-dS13mPtRP)/dM2pp1PtRP; // CORRECT !!! <w1^2 w2 cos(n(psi1-phi2))> | |
1708 | } | |
3d824203 | 1709 | |
77515452 | 1710 | // 2-p temporary one |
1711 | Double_t two2npp2nW1ppW2PtRP=0.; // <w1 w2^2 cos(2n(psi1-phi2))> OK !!! | |
1712 | if(dM1pp2PtRP) | |
1713 | { | |
1714 | two2npp2nW1ppW2PtRP = ((q2xW1PtRP*dQnkX[1][1]+q2yW1PtRP*dQnkY[1][1])-dS13mPtRP)/dM1pp2PtRP; // CORRECT !!! <w1 w2^2 cos(2n(psi1-phi2))> | |
1715 | } | |
3d824203 | 1716 | |
77515452 | 1717 | // 2-p temporary one |
1718 | Double_t two1npp1nW3PtRP=0.; // <w2^3 cos(n(psi1-phi2))> // OK !!! | |
1719 | if(dM0pp3PtRP) | |
1720 | { | |
1721 | two1npp1nW3PtRP = (qxPtRP*dQnkX[0][2]+qyPtRP*dQnkY[0][2]-dS13mPtRP)/dM0pp3PtRP; // CORRECT !!! <w2^3 cos(n(psi1-phi2))> | |
1722 | } | |
3d824203 | 1723 | |
77515452 | 1724 | // 3-p temporary one |
1725 | Double_t three2npp1n1nW1ppW1W1PtRP=0.; // <w1 w2 w3 cos(n(2psi1-phi2-phi3))> // OK!!! | |
1726 | if(dM1pp11PtRP) | |
1727 | { | |
1728 | three2npp1n1nW1ppW1W1PtRP = (q2xW1PtRP*(dQnkX[0][0]*dQnkX[0][0]-dQnkY[0][0]*dQnkY[0][0])+2.*q2yW1PtRP*dQnkX[0][0]*dQnkY[0][0]-2.*(qxW2PtRP*dQnkX[0][0]+qyW2PtRP*dQnkY[0][0])-(q2xW1PtRP*dQnkX[1][1]+q2yW1PtRP*dQnkY[1][1])+2.*dS13mPtRP)/dM1pp11PtRP; // CORRECT !!! <w1 w2 w3 cos(n(2psi1-phi2-phi3))> | |
1729 | } | |
3d824203 | 1730 | |
77515452 | 1731 | // 3-p temporary one |
1732 | Double_t three1npp1n2nW0ppW1W2PtRP=0.; // <w2 w3^2 cos(n(psi1+phi2-2*phi3))> // OK!!! | |
1733 | if(dM0pp12PtRP) | |
1734 | { | |
1735 | three1npp1n2nW0ppW1W2PtRP = (qxPtRP*(dQnkX[0][0]*dQnkX[1][1]+dQnkY[0][0]*dQnkY[1][1])-qyPtRP*(dQnkY[0][0]*dQnkX[1][1]-dQnkX[0][0]*dQnkY[1][1])-(qxW2PtRP*dQnkX[0][0]+qyW2PtRP*dQnkY[0][0])-(q2xW1PtRP*dQnkX[1][1]+q2yW1PtRP*dQnkY[1][1])-(qxPtRP*dQnkX[0][2]+qyPtRP*dQnkY[0][2])+2.*dS13mPtRP)/dM0pp12PtRP; // CORRECT !!! <w2 w3^2 cos(n(psi1+phi2-2.*phi3))> | |
1736 | } | |
1737 | ||
1738 | /* | |
1739 | // 4-p RP part | |
1740 | Double_t four1npp1n1n1nW1W1W1=0.; // <w1 w2 w3 cos(n(psi1+phi1-phi2-phi3))> | |
1741 | if(dM0pp111PtRP) | |
1742 | { | |
1743 | four1npp1n1n1nW1W1W1 = ((pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*(qxPtRP*dQnkX[0][0]+qyPtRP*dQnkY[0][0])-2.*dM1pp11PtRP*two1n1nW1ppW1W1PtRP-dM1pp11PtRP*three2npp1n1nW1ppW1W1PtRP-dM0pp12PtRP*three1npp1n2nW0ppW1W2PtRP-2.*dM0pp12PtRP*two1npp1nW1W2PtRP-3.*dM2pp1PtRP*two1npp1nW2ppW1PtRP-2.*dM1pp2PtRP-dM1pp2PtRP*two2npp2nW1ppW2PtRP-dM0pp3PtRP*two1npp1nW3PtRP-dS13mPtRP)/(dM0pp111PtRP); | |
1744 | } | |
1745 | */ | |
1746 | ||
1747 | /* | |
1748 | // 4-p POI part | |
1749 | Double_t four1npp1n1n1nW1W1W1RP=0.; | |
1750 | if(dM0p111PtRP>0&&mPrimePtRP>0&&nRP>0) | |
1751 | { | |
1752 | four1npp1n1n1nW1W1W1RP = ((pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*(qxPrimePtRP*dQnkX[0][0]+qyPrimePtRP*dQnkY[0][0])-2.*dSnk[0][1]* (qxPrimePtRP*dQnkX[0][0]+qyPrimePtRP*dQnkY[0][0])+2.*(qxPrimePtRP*dQnkX[0][2]+qyPrimePtRP*dQnkY[0][2])-qxPrimePtRP*(dQnkX[0][0]*dQnkX[1][1]+dQnkY[0][0]*dQnkY[1][1])+qyPrimePtRP*(dQnkY[0][0]*dQnkX[1][1]-dQnkX[0][0]*dQnkY[1][1]))/dM0p111PtRP; | |
1753 | } | |
1754 | */ | |
3d824203 | 1755 | |
77515452 | 1756 | // 4-p RP and POI in all combinations (full, partial and no overlap) |
1757 | Double_t four1npp1n1n1nW1W1W1PtRP=0.; | |
1758 | if(dM0pp111PtRP+dM0p111PtRP) | |
1759 | { | |
1760 | four1npp1n1n1nW1W1W1PtRP = ((pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*(qxPtRP*dQnkX[0][0]+qyPtRP*dQnkY[0][0])-2.*dM1pp11PtRP*two1n1nW1ppW1W1PtRP-dM1pp11PtRP*three2npp1n1nW1ppW1W1PtRP-dM0pp12PtRP*three1npp1n2nW0ppW1W2PtRP-2.*dM0pp12PtRP*two1npp1nW1W2PtRP-3.*dM2pp1PtRP*two1npp1nW2ppW1PtRP-2.*dM1pp2PtRP-dM1pp2PtRP*two2npp2nW1ppW2PtRP-dM0pp3PtRP*two1npp1nW3PtRP-dS13mPtRP+(pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*(qxPrimePtRP*dQnkX[0][0]+qyPrimePtRP*dQnkY[0][0])-2.*dSnk[0][1]* (qxPrimePtRP*dQnkX[0][0]+qyPrimePtRP*dQnkY[0][0])+2.*(qxPrimePtRP*dQnkX[0][2]+qyPrimePtRP*dQnkY[0][2])-qxPrimePtRP*(dQnkX[0][0]*dQnkX[1][1]+dQnkY[0][0]*dQnkY[1][1])+qyPrimePtRP*(dQnkY[0][0]*dQnkX[1][1]-dQnkX[0][0]*dQnkY[1][1]))/(dM0pp111PtRP+dM0p111PtRP); | |
1761 | ||
1762 | f4WPerPtBin1n1n1n1nRP->Fill(fPtMin+(bin-1)*dBinWidthPt,four1npp1n1n1nW1W1W1PtRP,dM0pp111PtRP+dM0p111PtRP); | |
1763 | } // end of if(dM0pp111PtRP+dM0p111PtRP) | |
1764 | } // for(Int_t bin=1;bin<(fnBinsPt+1);bin++) // loop over pt-bins | |
1765 | ||
1766 | delete ptReq1nPrime; | |
1767 | delete ptImq1nPrime; | |
1768 | delete ptReq2nPrime; | |
1769 | delete ptImq2nPrime; | |
1770 | delete ptReq1n; | |
1771 | delete ptImq1n; | |
1772 | delete ptReq2n; | |
1773 | delete ptImq2n; | |
1774 | ||
1775 | delete req1nW2Pt; | |
1776 | delete imq1nW2Pt; | |
1777 | delete req2nW1Pt; | |
1778 | delete imq2nW1Pt; | |
1779 | delete sumOfW1upTomPt; | |
1780 | delete sumOfW2upTomPt; | |
1781 | delete sumOfW3upTomPt; | |
1782 | //........................................................................................................... | |
1783 | ||
1784 | //........................................................................................................... | |
1785 | // PrimePrime Eta RP | |
1786 | Double_t qxEtaRP=0.,qyEtaRP=0.,q2xEtaRP=0.,q2yEtaRP=0.;//add comments for these variable | |
1787 | Double_t qxW2EtaRP=0.,qyW2EtaRP=0.,q2xW1EtaRP=0.,q2yW1EtaRP=0.;//add comments for these variable | |
1788 | Double_t dS11mEtaRP=0.; // to be improved (name) | |
1789 | Double_t dS12mEtaRP=0.; // to be improved (name) | |
1790 | Double_t dS13mEtaRP=0.; // to be improved (name) | |
1791 | Double_t mEtaRPHere=0.; // to be improved (name) | |
1792 | ||
1793 | Double_t dM1pp11EtaRP=0.; // to be improved (name) | |
1794 | Double_t dM0pp111EtaRP=0.; // to be improved (name) | |
1795 | Double_t dM0pp12EtaRP=0.; | |
1796 | Double_t dM2pp1EtaRP=0.; | |
1797 | Double_t dM1pp2EtaRP=0.; | |
1798 | Double_t dM0pp3EtaRP=0.; | |
1799 | ||
1800 | // Prime Eta RP | |
1801 | Double_t qxPrimeEtaRPHere=0.,qyPrimeEtaRPHere=0.; | |
1802 | Double_t mPrimeEtaRPHere=0.; | |
1803 | Double_t dM0p111EtaRP=0.; // to be improved (name) | |
1804 | ||
1805 | for(Int_t bin=1;bin<(fnBinsEta+1);bin++) // loop over eta-bins | |
1806 | { | |
1807 | // q'': | |
1808 | qxEtaRP = (etaReq1n->GetBinContent(bin))*(etaReq1n->GetBinEntries(bin)); | |
1809 | qyEtaRP = (etaImq1n->GetBinContent(bin))*(etaImq1n->GetBinEntries(bin)); | |
1810 | q2xEtaRP = (etaReq2n->GetBinContent(bin))*(etaReq2n->GetBinEntries(bin)); | |
1811 | q2yEtaRP = (etaImq2n->GetBinContent(bin))*(etaImq2n->GetBinEntries(bin)); | |
1812 | ||
1813 | qxW2EtaRP = (req1nW2Eta->GetBinContent(bin))*(req1nW2Eta->GetBinEntries(bin)); | |
1814 | qyW2EtaRP = (imq1nW2Eta->GetBinContent(bin))*(imq1nW2Eta->GetBinEntries(bin)); | |
1815 | ||
1816 | q2xW1EtaRP = (req2nW1Eta->GetBinContent(bin))*(req2nW1Eta->GetBinEntries(bin)); | |
1817 | q2yW1EtaRP = (imq2nW1Eta->GetBinContent(bin))*(imq2nW1Eta->GetBinEntries(bin)); | |
1818 | ||
1819 | dS11mEtaRP = (sumOfW1upTomEta->GetBinContent(bin))*(sumOfW1upTomEta->GetBinEntries(bin)); | |
1820 | dS12mEtaRP = (sumOfW2upTomEta->GetBinContent(bin))*(sumOfW2upTomEta->GetBinEntries(bin)); | |
1821 | dS13mEtaRP = (sumOfW3upTomEta->GetBinContent(bin))*(sumOfW3upTomEta->GetBinEntries(bin)); | |
1822 | ||
1823 | mEtaRPHere = sumOfW1upTomEta->GetBinEntries(bin); // to be improved | |
1824 | ||
1825 | dM1pp11EtaRP=dS11mEtaRP*(dSnk[1][0]-dSnk[0][1])-2.*dS12mEtaRP*dSnk[0][0]+2.*dS13mEtaRP; | |
1826 | dM1pp2EtaRP=dS11mEtaRP*dSnk[0][1]-dS13mEtaRP; | |
1827 | dM2pp1EtaRP=dS12mEtaRP*dSnk[0][0]-dS13mEtaRP; | |
1828 | dM0pp3EtaRP=mEtaRPHere*dSnk[0][2]-dS13mEtaRP; | |
1829 | dM0pp12EtaRP=mEtaRPHere*dSnk[0][0]*dSnk[0][1]-dM2pp1EtaRP-dM1pp2EtaRP-dM0pp3EtaRP-dS13mEtaRP; | |
1830 | dM0pp111EtaRP=mEtaRPHere*dSnk[2][0]-3.*dM1pp11EtaRP-3.*dM0pp12EtaRP-3.*dM2pp1EtaRP-3.*dM1pp2EtaRP-dM0pp3EtaRP-dS13mEtaRP; | |
1831 | ||
1832 | // q': | |
1833 | qxPrimeEtaRPHere = (etaReq1nPrime->GetBinContent(bin))*(etaReq1nPrime->GetBinEntries(bin)); | |
1834 | qyPrimeEtaRPHere = (etaImq1nPrime->GetBinContent(bin))*(etaImq1nPrime->GetBinEntries(bin)); | |
1835 | ||
1836 | mPrimeEtaRPHere = etaReq1nPrime->GetBinEntries(bin); // to be improved | |
1837 | dM0p111EtaRP=mPrimeEtaRPHere*(dSnk[2][0]-3.*dSnk[0][1]*dSnk[0][0]+2.*dSnk[0][2]); | |
3d824203 | 1838 | |
77515452 | 1839 | // 2-p the needed one |
1840 | Double_t two1n1nWPerEtaBinRP=0.; | |
1841 | if((mEtaRPHere+mPrimeEtaRPHere)*dSnk[0][0]-dS11mEtaRP>0) | |
1842 | { | |
1843 | two1n1nWPerEtaBinRP = (qxEtaRP*dQnkX[0][0]+qyEtaRP*dQnkY[0][0]+qxPrimeEtaRPHere*dQnkX[0][0]+qyPrimeEtaRPHere*dQnkY[0][0]-dS11mEtaRP)/((mEtaRPHere+mPrimeEtaRPHere)*dSnk[0][0]-dS11mEtaRP); | |
1844 | ||
1845 | f2WPerEtaBin1n1nRP->Fill(fEtaMin+(bin-1)*dBinWidthEta,two1n1nWPerEtaBinRP,(mEtaRPHere+mPrimeEtaRPHere)*dSnk[0][0]-dS11mEtaRP); // <2'>_{n|n} | |
1846 | } | |
3d824203 | 1847 | |
77515452 | 1848 | // 2-p the temporary one |
1849 | Double_t two1n1nW1ppW1W1EtaRP=0.; // <w1 w2 w3 cos(n(phi2-phi3))> // OK!!! | |
1850 | if(dM1pp11EtaRP) | |
1851 | { | |
1852 | two1n1nW1ppW1W1EtaRP = ((pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*dS11mEtaRP-2.*(qxW2EtaRP*dQnkX[0][0]+qyW2EtaRP*dQnkY[0][0])-dS11mEtaRP*dSnk[0][1]+2.*dS13mEtaRP)/dM1pp11EtaRP; // CORRECT !!! <w1 w2 w3 cos(n(phi2-phi3))> | |
1853 | } | |
1854 | ||
1855 | // 2-p the temporary one | |
1856 | Double_t two1npp1nW1W2EtaRP=0.; // <w2 w3^2 cos(n(psi1-phi2))> // OK !!! | |
1857 | if(dM0pp12EtaRP) | |
1858 | { | |
1859 | two1npp1nW1W2EtaRP = (dSnk[0][1]*(qxEtaRP*dQnkX[0][0]+qyEtaRP*dQnkY[0][0])-(qxW2EtaRP*dQnkX[0][0]+qyW2EtaRP*dQnkY[0][0])-dM1pp2EtaRP-(qxEtaRP*dQnkX[0][2]+qyEtaRP*dQnkY[0][2])+dS13mEtaRP)/dM0pp12EtaRP; // CORRECT !!! <w2 w3^2 cos(n(psi1-phi2))> | |
1860 | } | |
3d824203 | 1861 | |
77515452 | 1862 | // 2-p the temporary one |
1863 | Double_t two1npp1nW2ppW1EtaRP=0.; // <w1^2 w2 cos(n(psi1-phi2))> // OK !!! | |
1864 | if(dM2pp1EtaRP) | |
1865 | { | |
1866 | two1npp1nW2ppW1EtaRP = ((qxW2EtaRP*dQnkX[0][0]+qyW2EtaRP*dQnkY[0][0])-dS13mEtaRP)/dM2pp1EtaRP; // CORRECT !!! <w1^2 w2 cos(n(psi1-phi2))> | |
1867 | } | |
1868 | ||
1869 | // 2-p the temporary one | |
1870 | Double_t two2npp2nW1ppW2EtaRP=0.; // <w1 w2^2 cos(2n(psi1-phi2))> OK !!! | |
1871 | if(dM1pp2EtaRP) | |
1872 | { | |
1873 | two2npp2nW1ppW2EtaRP = ((q2xW1EtaRP*dQnkX[1][1]+q2yW1EtaRP*dQnkY[1][1])-dS13mEtaRP)/dM1pp2EtaRP; // CORRECT !!! <w1 w2^2 cos(2n(psi1-phi2))> | |
1874 | } | |
3d824203 | 1875 | |
77515452 | 1876 | // 2-p the temporary one |
1877 | Double_t two1npp1nW3EtaRP=0.; // <w2^3 cos(n(psi1-phi2))> // OK !!! | |
1878 | if(dM0pp3EtaRP) | |
1879 | { | |
1880 | two1npp1nW3EtaRP = (qxEtaRP*dQnkX[0][2]+qyEtaRP*dQnkY[0][2]-dS13mEtaRP)/dM0pp3EtaRP; // CORRECT !!! <w2^3 cos(n(psi1-phi2))> | |
1881 | } | |
1882 | ||
1883 | // 3-p the temporary one | |
1884 | Double_t three2npp1n1nW1ppW1W1EtaRP=0.; // <w1 w2 w3 cos(n(2psi1-phi2-phi3))> // OK!!! | |
1885 | if(dM1pp11EtaRP) | |
1886 | { | |
1887 | three2npp1n1nW1ppW1W1EtaRP = (q2xW1EtaRP*(dQnkX[0][0]*dQnkX[0][0]-dQnkY[0][0]*dQnkY[0][0])+2.*q2yW1EtaRP*dQnkX[0][0]*dQnkY[0][0]-2.*(qxW2EtaRP*dQnkX[0][0]+qyW2EtaRP*dQnkY[0][0])-(q2xW1EtaRP*dQnkX[1][1]+q2yW1EtaRP*dQnkY[1][1])+2.*dS13mEtaRP)/dM1pp11EtaRP; // CORRECT !!! <w1 w2 w3 cos(n(2psi1-phi2-phi3))> | |
1888 | } | |
3d824203 | 1889 | |
77515452 | 1890 | // 3-p the temporary one |
1891 | Double_t three1npp1n2nW0ppW1W2EtaRP=0.; // <w2 w3^2 cos(n(psi1+phi2-2*phi3))> // OK!!! | |
1892 | if(dM0pp12EtaRP) | |
1893 | { | |
1894 | three1npp1n2nW0ppW1W2EtaRP = (qxEtaRP*(dQnkX[0][0]*dQnkX[1][1]+dQnkY[0][0]*dQnkY[1][1])-qyEtaRP*(dQnkY[0][0]*dQnkX[1][1]-dQnkX[0][0]*dQnkY[1][1])-(qxW2EtaRP*dQnkX[0][0]+qyW2EtaRP*dQnkY[0][0])-(q2xW1EtaRP*dQnkX[1][1]+q2yW1EtaRP*dQnkY[1][1])-(qxEtaRP*dQnkX[0][2]+qyEtaRP*dQnkY[0][2])+2.*dS13mEtaRP)/dM0pp12EtaRP; // CORRECT !!! <w2 w3^2 cos(n(psi1+phi2-2.*phi3))> | |
1895 | } | |
1896 | ||
1897 | /* | |
1898 | // 4-p RP part | |
1899 | Double_t four1npp1n1n1nW1W1W1=0.; // <w1 w2 w3 cos(n(psi1+phi1-phi2-phi3))> | |
1900 | if(dM0pp111EtaRP) | |
1901 | { | |
1902 | four1npp1n1n1nW1W1W1 = ((pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*(qxEtaRP*dQnkX[0][0]+qyEtaRP*dQnkY[0][0])-2.*dM1pp11EtaRP*two1n1nW1ppW1W1EtaRP-dM1pp11EtaRP*three2npp1n1nW1ppW1W1EtaRP-dM0pp12EtaRP*three1npp1n2nW0ppW1W2EtaRP-2.*dM0pp12EtaRP*two1npp1nW1W2EtaRP-3.*dM2pp1EtaRP*two1npp1nW2ppW1EtaRP-2.*dM1pp2EtaRP-dM1pp2EtaRP*two2npp2nW1ppW2EtaRP-dM0pp3EtaRP*two1npp1nW3EtaRP-dS13mEtaRP)/(dM0pp111EtaRP); | |
1903 | } | |
1904 | */ | |
1905 | /* | |
1906 | // 4-p POI part | |
1907 | Double_t four1npp1n1n1nW1W1W1RP=0.; | |
1908 | if(dM0p111EtaRP>0&&mPrimeEtaRPHere>0&&nRP>0) | |
1909 | { | |
1910 | four1npp1n1n1nW1W1W1RP = ((pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*(qxPrimeEtaRPHere*dQnkX[0][0]+qyPrimeEtaRPHere*dQnkY[0][0])-2.*dSnk[0][1]* (qxPrimeEtaRPHere*dQnkX[0][0]+qyPrimeEtaRPHere*dQnkY[0][0])+2.*(qxPrimeEtaRPHere*dQnkX[0][2]+qyPrimeEtaRPHere*dQnkY[0][2])-qxPrimeEtaRPHere*(dQnkX[0][0]*dQnkX[1][1]+dQnkY[0][0]*dQnkY[1][1])+qyPrimeEtaRPHere*(dQnkY[0][0]*dQnkX[1][1]-dQnkX[0][0]*dQnkY[1][1]))/dM0p111EtaRP; | |
1911 | } | |
1912 | */ | |
1913 | ||
1914 | // 4-p RP and POI in all combinations (full, partial and no overlap) | |
1915 | Double_t four1npp1n1n1nW1W1W1EtaRP=0.; | |
1916 | ||
1917 | if(dM0pp111EtaRP+dM0p111EtaRP) | |
1918 | { | |
1919 | four1npp1n1n1nW1W1W1EtaRP = ((pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*(qxEtaRP*dQnkX[0][0]+qyEtaRP*dQnkY[0][0])-2.*dM1pp11EtaRP*two1n1nW1ppW1W1EtaRP-dM1pp11EtaRP*three2npp1n1nW1ppW1W1EtaRP-dM0pp12EtaRP*three1npp1n2nW0ppW1W2EtaRP-2.*dM0pp12EtaRP*two1npp1nW1W2EtaRP-3.*dM2pp1EtaRP*two1npp1nW2ppW1EtaRP-2.*dM1pp2EtaRP-dM1pp2EtaRP*two2npp2nW1ppW2EtaRP-dM0pp3EtaRP*two1npp1nW3EtaRP-dS13mEtaRP+(pow(dQnkX[0][0],2.)+pow(dQnkY[0][0],2.))*(qxPrimeEtaRPHere*dQnkX[0][0]+qyPrimeEtaRPHere*dQnkY[0][0])-2.*dSnk[0][1]*(qxPrimeEtaRPHere*dQnkX[0][0]+qyPrimeEtaRPHere*dQnkY[0][0])+2.*(qxPrimeEtaRPHere*dQnkX[0][2]+qyPrimeEtaRPHere*dQnkY[0][2])-qxPrimeEtaRPHere*(dQnkX[0][0]*dQnkX[1][1]+dQnkY[0][0]*dQnkY[1][1])+qyPrimeEtaRPHere*(dQnkY[0][0]*dQnkX[1][1]-dQnkX[0][0]*dQnkY[1][1]))/(dM0pp111EtaRP+dM0p111EtaRP); | |
1920 | ||
1921 | f4WPerEtaBin1n1n1n1nRP->Fill(fEtaMin+(bin-1)*dBinWidthEta,four1npp1n1n1nW1W1W1EtaRP,dM0pp111EtaRP+dM0p111EtaRP); | |
1922 | } | |
1923 | } | |
1924 | ||
1925 | delete etaReq1nPrime; | |
1926 | delete etaImq1nPrime; | |
1927 | delete etaReq2nPrime; | |
1928 | delete etaImq2nPrime; | |
1929 | delete etaReq1n; | |
1930 | delete etaImq1n; | |
1931 | delete etaReq2n; | |
1932 | delete etaImq2n; | |
1933 | ||
1934 | delete req1nW2Eta; | |
1935 | delete imq1nW2Eta; | |
1936 | delete req2nW1Eta; | |
1937 | delete imq2nW1Eta; | |
1938 | delete sumOfW1upTomEta; | |
1939 | delete sumOfW2upTomEta; | |
1940 | delete sumOfW3upTomEta; | |
1941 | //........................................................................................................... | |
1942 | ||
1943 | ||
1944 | ||
1945 | ||
1946 | ||
1947 | ||
1948 | ||
1949 | ||
1950 | ||
1951 | ||
1952 | ||
1953 | ||
1954 | ||
1955 | ||
1956 | ||
1957 | ||
1958 | ||
1959 | ||
1960 | ||
1961 | ||
1962 | ||
1963 | ||
1964 | ||
1965 | ||
6f366058 | 1966 | delete ptReq1nPrimePrime; |
1967 | delete ptImq1nPrimePrime; | |
1968 | delete ptReq2nPrimePrime; | |
1969 | delete ptImq2nPrimePrime; | |
1970 | ||
1971 | delete req1nW2PrimePrimePt; | |
1972 | delete imq1nW2PrimePrimePt; | |
1973 | delete req2nW1PrimePrimePt; | |
1974 | delete imq2nW1PrimePrimePt; | |
1975 | ||
1976 | delete sumOfW1upTomPrimePrimePt; | |
1977 | delete sumOfW2upTomPrimePrimePt; | |
1978 | delete sumOfW3upTomPrimePrimePt; | |
1979 | ||
1980 | delete etaReq1nPrimePrime; | |
1981 | delete etaImq1nPrimePrime; | |
1982 | delete etaReq2nPrimePrime; | |
1983 | delete etaImq2nPrimePrime; | |
1984 | ||
1985 | delete req1nW2PrimePrimeEta; | |
1986 | delete imq1nW2PrimePrimeEta; | |
1987 | delete req2nW1PrimePrimeEta; | |
1988 | delete imq2nW1PrimePrimeEta; | |
1989 | ||
1990 | delete sumOfW1upTomPrimePrimeEta; | |
1991 | delete sumOfW2upTomPrimePrimeEta; | |
1992 | delete sumOfW3upTomPrimePrimeEta; | |
77515452 | 1993 | |
1994 | ||
1995 | ||
1996 | ||
1997 | ||
1998 | ||
1999 | ||
2000 | ||
2001 | ||
2002 | ||
2003 | ||
2004 | ||
2005 | ||
2006 | ||
2007 | ||
2008 | ||
2009 | ||
2010 | ||
2011 | ||
2012 | ||
2013 | ||
2014 | ||
2015 | ||
2016 | ||
2017 | ||
2018 | ||
2019 | ||
2020 | ||
2021 | ||
2022 | ||
3d824203 | 2023 | |
2024 | ||
3d824203 | 2025 | |
3d824203 | 2026 | |
2027 | ||
2028 | ||
2029 | ||
2030 | ||
2031 | ||
2032 | ||
2033 | ||
2034 | ||
2035 | ||
2036 | ||
2037 | ||
2038 | ||
2039 | ||
2040 | ||
2041 | ||
2042 | ||
2043 | ||
2044 | ||
2045 | ||
2046 | ||
2047 | ||
2048 | ||
2049 | ||
3d824203 | 2050 | |
2051 | ||
2052 | ||
2053 | ||
2054 | ||
2055 | ||
2056 | ||
2057 | ||
2058 | ||
2059 | ||
2060 | ||
2061 | ||
2062 | ||
2063 | ||
2064 | ||
2065 | ||
2066 | ||
2067 | ||
2068 | ||
2069 | ||
2070 | ||
2071 | ||
2072 | ||
2073 | ||
2074 | ||
2075 | ||
2076 | ||
2077 | ||
2078 | ||
2079 | ||
2080 | ||
2081 | ||
2082 | ||
2083 | ||
2084 | ||
2085 | ||
2086 | ||
2087 | ||
2088 | ||
2089 | ||
2090 | ||
2091 | ||
2092 | ||
2093 | ||
2094 | ||
2095 | ||
2096 | ||
2097 | ||
2098 | ||
2099 | ||
2100 | ||
2101 | ||
1dfa3c16 | 2102 | |
ae733b3b | 2103 | |
1dfa3c16 | 2104 | |
1dfa3c16 | 2105 | |
ae733b3b | 2106 | |
ae733b3b | 2107 | |
ae733b3b | 2108 | |
1dfa3c16 | 2109 | |
4057ba99 | 2110 | |
ae733b3b | 2111 | |
4057ba99 | 2112 | |
1dfa3c16 | 2113 | |
ae733b3b | 2114 | |
ae733b3b | 2115 | |
1dfa3c16 | 2116 | |
bc92c0cb | 2117 | |
2118 | ||
2119 | ||
2120 | ||
2121 | ||
2122 | ||
bc92c0cb | 2123 | |
2124 | ||
2125 | ||
bc92c0cb | 2126 | |
2127 | ||
bc92c0cb | 2128 | |
bc92c0cb | 2129 | |
2130 | ||
2131 | ||
bc92c0cb | 2132 | |
2133 | ||
2134 | ||
2135 | ||
2136 | ||
2137 | ||
b7cb54d5 | 2138 | Bool_t nestedLoops = kFALSE; |
bc92c0cb | 2139 | |
2140 | ||
bc92c0cb | 2141 | |
b7cb54d5 | 2142 | |
2143 | if(nestedLoops) // to be improved | |
2144 | { | |
dee1e0e0 | 2145 | //-------------------------------------------------------------------------------------------------------------------------------- |
2146 | // | |
2147 | // ********************** | |
2148 | // **** NESTED LOOPS **** | |
2149 | // ********************** | |
2150 | // | |
2151 | // Remark 1: multi-particle correlations calculated with nested loops are stored in fDirectCorrelations. | |
3d824203 | 2152 | // Remark 2: binning of fDirectCorrelations: bins 0..100 - correlations needed for integrated flow; bins 100..200 - correlations needed for differential flow (taking as an example bin 0.5 < pt < 0.6) |
dee1e0e0 | 2153 | // |
2154 | // binning details of fDirectCorrelations (integrated flow): | |
3d824203 | 2155 | //.......................................................................... |
2156 | // 1st bin: weighted <2>_{n|n} = <w1 w2 cos( n*(phi1-phi2))> | |
2157 | // 2nd bin: weighted <2>_{2n|2n} = <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
2158 | // 3rd bin: weighted <2>_{3n|3n} = <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
2159 | // 4th bin: weighted <2>_{4n|4n} = <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
2160 | // 5th bin: weighted <2>_{n|n} = <w1^3 w2 cos(n*(phi1-phi2))> | |
2161 | ||
2162 | // 11th bin: weighted <3>_{2n|n,n} = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
2163 | //.......................................................................... | |
dee1e0e0 | 2164 | |
77515452 | 2165 | |
b7cb54d5 | 2166 | Double_t phi1=0., phi2=0., phi3=0., phi4=0.; |
2167 | // phi5=0., phi6=0., phi7=0., phi8=0.; | |
2168 | Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1.; | |
2169 | // wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
3d824203 | 2170 | |
2171 | ||
77515452 | 2172 | |
3d824203 | 2173 | |
dee1e0e0 | 2174 | |
77515452 | 2175 | |
2176 | Double_t tempLoop = 0.; | |
2177 | Int_t tempCounter = 0; | |
2178 | ||
2179 | ||
2180 | ||
2181 | ||
2182 | ||
1dfa3c16 | 2183 | for(Int_t i1=0;i1<dMult;i1++) |
bc92c0cb | 2184 | { |
dee1e0e0 | 2185 | fTrack=anEvent->GetTrack(i1); |
bc92c0cb | 2186 | phi1=fTrack->Phi(); |
3d824203 | 2187 | if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2188 | for(Int_t i2=0;i2<dMult;i2++) |
bc92c0cb | 2189 | { |
dee1e0e0 | 2190 | if(i2==i1)continue; |
2191 | fTrack=anEvent->GetTrack(i2); | |
bc92c0cb | 2192 | phi2=fTrack->Phi(); |
3d824203 | 2193 | if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi()))); |
2194 | // 2-p | |
2195 | fDirectCorrelations->Fill(0.,cos(n*(phi1-phi2)),wPhi1*wPhi2); // <w1 w2 cos( n*(phi1-phi2))> | |
2196 | fDirectCorrelations->Fill(1.,cos(2.*n*(phi1-phi2)),pow(wPhi1,2)*pow(wPhi2,2)); // <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
2197 | fDirectCorrelations->Fill(2.,cos(3.*n*(phi1-phi2)),pow(wPhi1,3)*pow(wPhi2,3)); // <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
2198 | fDirectCorrelations->Fill(3.,cos(4.*n*(phi1-phi2)),pow(wPhi1,4)*pow(wPhi2,4)); // <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
2199 | fDirectCorrelations->Fill(4.,cos(n*(phi1-phi2)),pow(wPhi1,3)*wPhi2); // <w1^3 w2 cos(n*(phi1-phi2))> | |
bc92c0cb | 2200 | } |
2201 | } | |
3d824203 | 2202 | |
2203 | ||
3d824203 | 2204 | |
77515452 | 2205 | |
b7cb54d5 | 2206 | /* |
3d824203 | 2207 | |
1dfa3c16 | 2208 | for(Int_t i1=0;i1<dMult;i1++) |
bc92c0cb | 2209 | { |
dee1e0e0 | 2210 | fTrack=anEvent->GetTrack(i1); |
bc92c0cb | 2211 | phi1=fTrack->Phi(); |
3d824203 | 2212 | if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2213 | for(Int_t i2=0;i2<dMult;i2++) |
bc92c0cb | 2214 | { |
dee1e0e0 | 2215 | if(i2==i1)continue; |
2216 | fTrack=anEvent->GetTrack(i2); | |
bc92c0cb | 2217 | phi2=fTrack->Phi(); |
3d824203 | 2218 | if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2219 | for(Int_t i3=0;i3<dMult;i3++) |
bc92c0cb | 2220 | { |
dee1e0e0 | 2221 | if(i3==i1||i3==i2)continue; |
2222 | fTrack=anEvent->GetTrack(i3); | |
bc92c0cb | 2223 | phi3=fTrack->Phi(); |
3d824203 | 2224 | if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi()))); |
2225 | // 2-p | |
2226 | fDirectCorrelations->Fill(5.,cos(n*(phi1-phi2)),wPhi1*wPhi2*pow(wPhi3,2)); // <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
2227 | ||
2228 | // 3-p | |
2229 | fDirectCorrelations->Fill(10.,cos(2.*n*phi1-n*(phi2+phi3)),pow(wPhi1,2)*wPhi2*wPhi3); // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
2230 | ||
2231 | ||
2232 | fDirectCorrelations->Fill(6.,cos(3.*n*phi1-2.*n*phi2-n*phi3),pow(wPhi1,3)*pow(wPhi2,2)*wPhi3); //<3>_{3n|2n,n} | |
2233 | fDirectCorrelations->Fill(7.,cos(4.*n*phi1-2.*n*phi2-2.*n*phi3),pow(wPhi1,4)*pow(wPhi2,2)*pow(wPhi3,2)); //<3>_{4n|2n,2n} | |
2234 | fDirectCorrelations->Fill(8.,cos(4.*n*phi1-3.*n*phi2-n*phi3),pow(wPhi1,4)*pow(wPhi2,3)*wPhi3); //<3>_{4n|3n,n} | |
2235 | ||
2236 | ||
bc92c0cb | 2237 | } |
2238 | } | |
2239 | } | |
b7cb54d5 | 2240 | */ |
77515452 | 2241 | |
3d824203 | 2242 | |
2243 | ||
2244 | ||
77515452 | 2245 | |
bc92c0cb | 2246 | |
dee1e0e0 | 2247 | //<4>_{n,n|n,n}, <4>_{2n,n|2n,n}, <4>_{2n,2n|2n,2n}, <4>_{3n|n,n,n}, <4>_{3n,n|3n,n}, <4>_{3n,n|2n,2n} and <4>_{4n|2n,n,n} |
1dfa3c16 | 2248 | for(Int_t i1=0;i1<dMult;i1++) |
bc92c0cb | 2249 | { |
dee1e0e0 | 2250 | fTrack=anEvent->GetTrack(i1); |
bc92c0cb | 2251 | phi1=fTrack->Phi(); |
3d824203 | 2252 | if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2253 | for(Int_t i2=0;i2<dMult;i2++) |
bc92c0cb | 2254 | { |
dee1e0e0 | 2255 | if(i2==i1)continue; |
2256 | fTrack=anEvent->GetTrack(i2); | |
bc92c0cb | 2257 | phi2=fTrack->Phi(); |
3d824203 | 2258 | if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2259 | for(Int_t i3=0;i3<dMult;i3++) |
bc92c0cb | 2260 | { |
dee1e0e0 | 2261 | if(i3==i1||i3==i2)continue; |
2262 | fTrack=anEvent->GetTrack(i3); | |
bc92c0cb | 2263 | phi3=fTrack->Phi(); |
3d824203 | 2264 | if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2265 | for(Int_t i4=0;i4<dMult;i4++) |
bc92c0cb | 2266 | { |
dee1e0e0 | 2267 | if(i4==i1||i4==i2||i4==i3)continue; |
2268 | fTrack=anEvent->GetTrack(i4); | |
bc92c0cb | 2269 | phi4=fTrack->Phi(); |
3d824203 | 2270 | if(phiWeights) wPhi4 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*nBinsPhi/TMath::TwoPi()))); |
2271 | fDirectCorrelations->Fill(20.,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); // <4>_{n,n|n,n} = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
2272 | ||
2273 | ||
2274 | fDirectCorrelations->Fill(11.,cos(2.*n*phi1+n*phi2-2.*n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); //<4>_{2n,n|2n,n} | |
2275 | fDirectCorrelations->Fill(12.,cos(2.*n*phi1+2*n*phi2-2.*n*phi3-2.*n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); //<4>_{2n,2n|2n,2n} | |
2276 | fDirectCorrelations->Fill(13.,cos(3.*n*phi1-n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); //<4>_{3n|n,n,n} | |
2277 | fDirectCorrelations->Fill(14.,cos(3.*n*phi1+n*phi2-3.*n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); //<4>_{3n,n|3n,n} | |
2278 | fDirectCorrelations->Fill(15.,cos(3.*n*phi1+n*phi2-2.*n*phi3-2.*n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); //<4>_{3n,n|2n,2n} | |
2279 | fDirectCorrelations->Fill(16.,cos(4.*n*phi1-2.*n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); //<4>_{4n|2n,n,n} | |
2280 | ||
bc92c0cb | 2281 | } |
2282 | } | |
2283 | } | |
2284 | } | |
2285 | ||
3d824203 | 2286 | |
77515452 | 2287 | |
b7cb54d5 | 2288 | /* |
3d824203 | 2289 | |
dee1e0e0 | 2290 | //<5>_{2n,n,n,n,n}, //<5>_{2n,2n|2n,n,n}, <5>_{3n,n|2n,n,n} and <5>_{4n|n,n,n,n} |
1dfa3c16 | 2291 | for(Int_t i1=0;i1<dMult;i1++) |
bc92c0cb | 2292 | { |
dee1e0e0 | 2293 | //cout<<"i1 = "<<i1<<endl; |
2294 | fTrack=anEvent->GetTrack(i1); | |
bc92c0cb | 2295 | phi1=fTrack->Phi(); |
3d824203 | 2296 | if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2297 | for(Int_t i2=0;i2<dMult;i2++) |
bc92c0cb | 2298 | { |
dee1e0e0 | 2299 | if(i2==i1)continue; |
2300 | fTrack=anEvent->GetTrack(i2); | |
bc92c0cb | 2301 | phi2=fTrack->Phi(); |
3d824203 | 2302 | if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2303 | for(Int_t i3=0;i3<dMult;i3++) |
bc92c0cb | 2304 | { |
dee1e0e0 | 2305 | if(i3==i1||i3==i2)continue; |
2306 | fTrack=anEvent->GetTrack(i3); | |
bc92c0cb | 2307 | phi3=fTrack->Phi(); |
3d824203 | 2308 | if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2309 | for(Int_t i4=0;i4<dMult;i4++) |
bc92c0cb | 2310 | { |
dee1e0e0 | 2311 | if(i4==i1||i4==i2||i4==i3)continue; |
2312 | fTrack=anEvent->GetTrack(i4); | |
bc92c0cb | 2313 | phi4=fTrack->Phi(); |
3d824203 | 2314 | if(phiWeights) wPhi4 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2315 | for(Int_t i5=0;i5<dMult;i5++) |
bc92c0cb | 2316 | { |
dee1e0e0 | 2317 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; |
2318 | fTrack=anEvent->GetTrack(i5); | |
bc92c0cb | 2319 | phi5=fTrack->Phi(); |
3d824203 | 2320 | if(phiWeights) wPhi5 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi5*nBinsPhi/TMath::TwoPi()))); |
2321 | fDirectCorrelations->Fill(18.,cos(2.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5),wPhi1*wPhi2*wPhi3*wPhi4*wPhi5); //<5>_{2n,n|n,n,n} | |
2322 | fDirectCorrelations->Fill(19.,cos(2.*n*phi1+2.*n*phi2-2.*n*phi3-n*phi4-n*phi5),wPhi1*wPhi2*wPhi3*wPhi4*wPhi5); //<5>_{2n,2n|2n,n,n} | |
2323 | fDirectCorrelations->Fill(20.,cos(3.*n*phi1+n*phi2-2.*n*phi3-n*phi4-n*phi5),wPhi1*wPhi2*wPhi3*wPhi4*wPhi5); //<5>_{3n,n|2n,n,n} | |
2324 | fDirectCorrelations->Fill(21.,cos(4.*n*phi1-n*phi2-n*phi3-n*phi4-n*phi5),wPhi1*wPhi2*wPhi3*wPhi4*wPhi5); //<5>_{4n|n,n,n,n} | |
bc92c0cb | 2325 | } |
2326 | } | |
2327 | } | |
2328 | } | |
2329 | } | |
2330 | ||
3d824203 | 2331 | |
dee1e0e0 | 2332 | //<6>_{n,n,n,n,n,n}, <6>_{2n,n,n|2n,n,n}, <6>_{2n,2n|n,n,n,n} and <6>_{3n,n|n,n,n,n} |
1dfa3c16 | 2333 | for(Int_t i1=0;i1<dMult;i1++) |
dee1e0e0 | 2334 | { |
2335 | //cout<<"i1 = "<<i1<<endl; | |
2336 | fTrack=anEvent->GetTrack(i1); | |
2337 | phi1=fTrack->Phi(); | |
3d824203 | 2338 | if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2339 | for(Int_t i2=0;i2<dMult;i2++) |
dee1e0e0 | 2340 | { |
2341 | if(i2==i1)continue; | |
2342 | fTrack=anEvent->GetTrack(i2); | |
2343 | phi2=fTrack->Phi(); | |
3d824203 | 2344 | if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2345 | for(Int_t i3=0;i3<dMult;i3++) |
dee1e0e0 | 2346 | { |
2347 | if(i3==i1||i3==i2)continue; | |
2348 | fTrack=anEvent->GetTrack(i3); | |
2349 | phi3=fTrack->Phi(); | |
3d824203 | 2350 | if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2351 | for(Int_t i4=0;i4<dMult;i4++) |
dee1e0e0 | 2352 | { |
2353 | if(i4==i1||i4==i2||i4==i3)continue; | |
2354 | fTrack=anEvent->GetTrack(i4); | |
2355 | phi4=fTrack->Phi(); | |
3d824203 | 2356 | if(phiWeights) wPhi4 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2357 | for(Int_t i5=0;i5<dMult;i5++) |
dee1e0e0 | 2358 | { |
2359 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
2360 | fTrack=anEvent->GetTrack(i5); | |
2361 | phi5=fTrack->Phi(); | |
3d824203 | 2362 | if(phiWeights) wPhi5 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi5*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2363 | for(Int_t i6=0;i6<dMult;i6++) |
dee1e0e0 | 2364 | { |
2365 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
2366 | fTrack=anEvent->GetTrack(i6); | |
2367 | phi6=fTrack->Phi(); | |
3d824203 | 2368 | if(phiWeights) wPhi6 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi6*nBinsPhi/TMath::TwoPi()))); |
2369 | fDirectCorrelations->Fill(23.,cos(n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6),wPhi1*wPhi2*wPhi3*wPhi4*wPhi5*wPhi6); //<6>_{n,n,n|n,n,n} | |
2370 | fDirectCorrelations->Fill(24.,cos(2.*n*phi1+n*phi2+n*phi3-2.*n*phi4-n*phi5-n*phi6),wPhi1*wPhi2*wPhi3*wPhi4*wPhi5*wPhi6); //<6>_{2n,n,n|2n,n,n} | |
2371 | fDirectCorrelations->Fill(25.,cos(2.*n*phi1+2.*n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),wPhi1*wPhi2*wPhi3*wPhi4*wPhi5*wPhi6); //<6>_{2n,2n|n,n,n,n} | |
2372 | fDirectCorrelations->Fill(26.,cos(3.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),wPhi1*wPhi2*wPhi3*wPhi4*wPhi5*wPhi6); //<6>_{3n,n|n,n,n,n} | |
dee1e0e0 | 2373 | } |
2374 | } | |
2375 | } | |
2376 | } | |
2377 | } | |
2378 | } | |
52021ae2 | 2379 | |
77515452 | 2380 | |
3d824203 | 2381 | |
dee1e0e0 | 2382 | //<7>_{2n,n,n|n,n,n,n} |
1dfa3c16 | 2383 | for(Int_t i1=0;i1<dMult;i1++) |
bc92c0cb | 2384 | { |
dee1e0e0 | 2385 | //cout<<"i1 = "<<i1<<endl; |
2386 | fTrack=anEvent->GetTrack(i1); | |
bc92c0cb | 2387 | phi1=fTrack->Phi(); |
3d824203 | 2388 | if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2389 | for(Int_t i2=0;i2<dMult;i2++) |
bc92c0cb | 2390 | { |
dee1e0e0 | 2391 | if(i2==i1)continue; |
2392 | fTrack=anEvent->GetTrack(i2); | |
bc92c0cb | 2393 | phi2=fTrack->Phi(); |
3d824203 | 2394 | if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2395 | for(Int_t i3=0;i3<dMult;i3++) |
bc92c0cb | 2396 | { |
dee1e0e0 | 2397 | if(i3==i1||i3==i2)continue; |
2398 | fTrack=anEvent->GetTrack(i3); | |
bc92c0cb | 2399 | phi3=fTrack->Phi(); |
3d824203 | 2400 | if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2401 | for(Int_t i4=0;i4<dMult;i4++) |
bc92c0cb | 2402 | { |
dee1e0e0 | 2403 | if(i4==i1||i4==i2||i4==i3)continue; |
2404 | fTrack=anEvent->GetTrack(i4); | |
bc92c0cb | 2405 | phi4=fTrack->Phi(); |
3d824203 | 2406 | if(phiWeights) wPhi4 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2407 | for(Int_t i5=0;i5<dMult;i5++) |
bc92c0cb | 2408 | { |
dee1e0e0 | 2409 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; |
2410 | fTrack=anEvent->GetTrack(i5); | |
bc92c0cb | 2411 | phi5=fTrack->Phi(); |
3d824203 | 2412 | if(phiWeights) wPhi5 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi5*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2413 | for(Int_t i6=0;i6<dMult;i6++) |
bc92c0cb | 2414 | { |
dee1e0e0 | 2415 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; |
2416 | fTrack=anEvent->GetTrack(i6); | |
bc92c0cb | 2417 | phi6=fTrack->Phi(); |
3d824203 | 2418 | if(phiWeights) wPhi6 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi6*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2419 | for(Int_t i7=0;i7<dMult;i7++) |
dee1e0e0 | 2420 | { |
2421 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; | |
2422 | fTrack=anEvent->GetTrack(i7); | |
2423 | phi7=fTrack->Phi(); | |
3d824203 | 2424 | if(phiWeights) wPhi7 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi7*nBinsPhi/TMath::TwoPi()))); |
2425 | fDirectCorrelations->Fill(28.,cos(2.*n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6-n*phi7),wPhi1*wPhi2*wPhi3*wPhi4*wPhi5*wPhi6*wPhi7);//<7>_{2n,n,n|n,n,n,n} | |
dee1e0e0 | 2426 | } |
bc92c0cb | 2427 | } |
2428 | } | |
2429 | } | |
2430 | } | |
2431 | } | |
2432 | } | |
52021ae2 | 2433 | |
77515452 | 2434 | |
3d824203 | 2435 | |
dee1e0e0 | 2436 | //<8>_{n,n,n,n|n,n,n,n} |
1dfa3c16 | 2437 | for(Int_t i1=0;i1<dMult;i1++) |
dee1e0e0 | 2438 | { |
2439 | cout<<"i1 = "<<i1<<endl; | |
2440 | fTrack=anEvent->GetTrack(i1); | |
2441 | phi1=fTrack->Phi(); | |
3d824203 | 2442 | if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2443 | for(Int_t i2=0;i2<dMult;i2++) |
dee1e0e0 | 2444 | { |
2445 | if(i2==i1)continue; | |
2446 | fTrack=anEvent->GetTrack(i2); | |
2447 | phi2=fTrack->Phi(); | |
3d824203 | 2448 | if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2449 | for(Int_t i3=0;i3<dMult;i3++) |
dee1e0e0 | 2450 | { |
2451 | if(i3==i1||i3==i2)continue; | |
2452 | fTrack=anEvent->GetTrack(i3); | |
2453 | phi3=fTrack->Phi(); | |
3d824203 | 2454 | if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2455 | for(Int_t i4=0;i4<dMult;i4++) |
dee1e0e0 | 2456 | { |
2457 | if(i4==i1||i4==i2||i4==i3)continue; | |
2458 | fTrack=anEvent->GetTrack(i4); | |
2459 | phi4=fTrack->Phi(); | |
3d824203 | 2460 | if(phiWeights) wPhi4 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2461 | for(Int_t i5=0;i5<dMult;i5++) |
dee1e0e0 | 2462 | { |
2463 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
2464 | fTrack=anEvent->GetTrack(i5); | |
2465 | phi5=fTrack->Phi(); | |
3d824203 | 2466 | if(phiWeights) wPhi5 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi5*nBinsPhi/TMath::TwoPi()))); |
1dfa3c16 | 2467 | for(Int_t i6=0;i6<dMult;i6++) |
dee1e0e0 | 2468 | { |
2469 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
2470 | fTrack=anEvent->GetTrack(i6); | |
3d824203 | 2471 | phi6=fTrack->Phi(); |
2472 | if(phiWeights) wPhi6 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi6*nBinsPhi/TMath::TwoPi()))); | |
1dfa3c16 | 2473 | for(Int_t i7=0;i7<dMult;i7++) |
dee1e0e0 | 2474 | { |
2475 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; | |
2476 | fTrack=anEvent->GetTrack(i7); | |
3d824203 | 2477 | phi7=fTrack->Phi(); |
2478 | if(phiWeights) wPhi7 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi7*nBinsPhi/TMath::TwoPi()))); | |
1dfa3c16 | 2479 | for(Int_t i8=0;i8<dMult;i8++) |
dee1e0e0 | 2480 | { |
2481 | if(i8==i1||i8==i2||i8==i3||i8==i4||i8==i5||i8==i6||i8==i7)continue; | |
2482 | fTrack=anEvent->GetTrack(i8); | |
3d824203 | 2483 | phi8=fTrack->Phi(); |
2484 | if(phiWeights) wPhi8 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi8*nBinsPhi/TMath::TwoPi()))); | |
2485 | fDirectCorrelations->Fill(30.,cos(n*phi1+n*phi2+n*phi3+n*phi4-n*phi5-n*phi6-n*phi7-n*phi8),wPhi1*wPhi2*wPhi3*wPhi4*wPhi5*wPhi6*wPhi7*wPhi8);//<8>_{n,n,n,n|n,n,n,n} | |
dee1e0e0 | 2486 | } |
2487 | } | |
2488 | } | |
2489 | } | |
2490 | } | |
2491 | } | |
2492 | } | |
2493 | } | |
bc92c0cb | 2494 | |
3d824203 | 2495 | */ |
2496 | ||
77515452 | 2497 | |
3d824203 | 2498 | |
dee1e0e0 | 2499 | // binning details of fDirectCorrelations (differential flow): |
2500 | // | |
3d824203 | 2501 | //101st bin: <2'>_{n|n} |
4057ba99 | 2502 | |
bc92c0cb | 2503 | |
b7cb54d5 | 2504 | |
77515452 | 2505 | |
bc92c0cb | 2506 | //<2'>_{n|n} |
4057ba99 | 2507 | for(Int_t i1=0;i1<nPrim;i1++) |
bc92c0cb | 2508 | { |
dee1e0e0 | 2509 | fTrack=anEvent->GetTrack(i1); |
b7cb54d5 | 2510 | if(!((fTrack->Pt()>=0.5&&fTrack->Pt()<0.6)&&(fTrack->InPOISelection())))continue;//POI condition |
4057ba99 | 2511 | phi1=fTrack->Phi(); |
3d824203 | 2512 | if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi()))); |
4057ba99 | 2513 | for(Int_t i2=0;i2<nPrim;i2++) |
bc92c0cb | 2514 | { |
4057ba99 | 2515 | if(i2==i1)continue; |
2516 | fTrack=anEvent->GetTrack(i2); | |
b7cb54d5 | 2517 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2518 | phi2=fTrack->Phi(); |
3d824203 | 2519 | if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi()))); |
4057ba99 | 2520 | //cout<<"1st = "<<i1<<" "<< (anEvent->GetTrack(i1))->Eta() << " " << (anEvent->GetTrack(i1))->Pt()<<endl; |
2521 | //cout<<"2nd = "<<i2<<" "<< (anEvent->GetTrack(i2))->Eta() << " " << (anEvent->GetTrack(i2))->Pt()<<endl; | |
2522 | //fill the fDirectCorrelations: | |
3d824203 | 2523 | fDirectCorrelations->Fill(100.,cos(1.*n*(phi1-phi2)),wPhi2);//<2'>_{n,n} |
2524 | fDirectCorrelations->Fill(103.,cos(1.*n*(phi1-phi2)),pow(wPhi1,2)*wPhi2);//<2'>_{n,n} | |
2525 | fDirectCorrelations->Fill(104.,cos(2.*n*(phi1-phi2)),wPhi1*pow(wPhi2,2));//<2'>_{n,n} | |
2526 | fDirectCorrelations->Fill(105.,cos(1.*n*(phi1-phi2)),pow(wPhi2,3));//<2'>_{n,n} | |
2527 | ||
2528 | ||
2529 | ||
4057ba99 | 2530 | fDirectCorrelations->Fill(41.,cos(2.*n*(phi1-phi2)),1);//<2'>_{2n,2n} |
2531 | fDirectCorrelations->Fill(42.,cos(3.*n*(phi1-phi2)),1);//<2'>_{3n,3n} | |
3d824203 | 2532 | fDirectCorrelations->Fill(43.,cos(4.*n*(phi1-phi2)),1);//<2'>_{4n,4n} |
2533 | ||
4057ba99 | 2534 | }//end of for(Int_t i2=0;i2<nPrim;i2++) |
2535 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
77515452 | 2536 | |
b7cb54d5 | 2537 | |
3d824203 | 2538 | |
2539 | ||
2540 | ||
2541 | /* | |
2542 | ||
bc92c0cb | 2543 | //<3'>_{2n|n,n} |
4057ba99 | 2544 | for(Int_t i1=0;i1<nPrim;i1++) |
bc92c0cb | 2545 | { |
dee1e0e0 | 2546 | fTrack=anEvent->GetTrack(i1); |
b7cb54d5 | 2547 | if(!((fTrack->Pt()>=0.5&&fTrack->Pt()<0.6)&&(fTrack->InPOISelection())))continue;//POI condition |
4057ba99 | 2548 | phi1=fTrack->Phi(); |
3d824203 | 2549 | if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi()))); |
4057ba99 | 2550 | for(Int_t i2=0;i2<nPrim;i2++) |
bc92c0cb | 2551 | { |
4057ba99 | 2552 | if(i2==i1)continue; |
2553 | fTrack=anEvent->GetTrack(i2); | |
b7cb54d5 | 2554 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2555 | phi2=fTrack->Phi(); |
3d824203 | 2556 | if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi()))); |
4057ba99 | 2557 | for(Int_t i3=0;i3<nPrim;i3++) |
bc92c0cb | 2558 | { |
4057ba99 | 2559 | if(i3==i1||i3==i2)continue; |
2560 | fTrack=anEvent->GetTrack(i3); | |
b7cb54d5 | 2561 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2562 | phi3=fTrack->Phi(); |
3d824203 | 2563 | if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi()))); |
2564 | //fill the fDirectCorrelations: | |
2565 | ||
2566 | // 2-p | |
2567 | fDirectCorrelations->Fill(101.,cos(n*(phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 cos(n(phi2-phi3))> | |
2568 | fDirectCorrelations->Fill(102.,cos(n*(phi1-phi3)),pow(wPhi2,2.)*wPhi3); // <w2^2 w3 cos(n(psi1-phi2))> | |
2569 | ||
2570 | // 3-p | |
2571 | fDirectCorrelations->Fill(110.,cos(n*(2.*phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 cos(n(2psi1-phi2-phi3))> | |
2572 | fDirectCorrelations->Fill(111.,cos(n*(phi1+phi2-2.*phi3)),wPhi2*pow(wPhi3,2.)); // <w2 w3^2 cos(n(psi1+phi2-2.*phi3))> | |
2573 | ||
2574 | ||
2575 | //fDirectCorrelations->Fill(46.,cos(n*(phi1+phi2-2.*phi3)),1);//<3'>_{n,n|2n} | |
4057ba99 | 2576 | }//end of for(Int_t i3=0;i3<nPrim;i3++) |
2577 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
2578 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
3d824203 | 2579 | |
2580 | ||
2581 | */ | |
2582 | ||
2583 | ||
b7cb54d5 | 2584 | |
77515452 | 2585 | |
bc92c0cb | 2586 | //<4'>_{n,n|n,n} |
4057ba99 | 2587 | for(Int_t i1=0;i1<nPrim;i1++) |
bc92c0cb | 2588 | { |
dee1e0e0 | 2589 | fTrack=anEvent->GetTrack(i1); |
b7cb54d5 | 2590 | if(!((fTrack->Pt()>=0.5&&fTrack->Pt()<0.6)&&(fTrack->InPOISelection())))continue;//POI condition |
3d824203 | 2591 | tempCounter++; |
4057ba99 | 2592 | phi1=fTrack->Phi(); |
3d824203 | 2593 | if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi()))); |
4057ba99 | 2594 | for(Int_t i2=0;i2<nPrim;i2++) |
bc92c0cb | 2595 | { |
4057ba99 | 2596 | if(i2==i1)continue; |
2597 | fTrack=anEvent->GetTrack(i2); | |
b7cb54d5 | 2598 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2599 | phi2=fTrack->Phi(); |
3d824203 | 2600 | if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi()))); |
4057ba99 | 2601 | for(Int_t i3=0;i3<nPrim;i3++) |
2602 | { | |
2603 | if(i3==i1||i3==i2)continue; | |
2604 | fTrack=anEvent->GetTrack(i3); | |
b7cb54d5 | 2605 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2606 | phi3=fTrack->Phi(); |
3d824203 | 2607 | if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi()))); |
4057ba99 | 2608 | for(Int_t i4=0;i4<nPrim;i4++) |
bc92c0cb | 2609 | { |
4057ba99 | 2610 | if(i4==i1||i4==i2||i4==i3)continue; |
2611 | fTrack=anEvent->GetTrack(i4); | |
b7cb54d5 | 2612 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2613 | phi4=fTrack->Phi(); |
3d824203 | 2614 | if(phiWeights) wPhi4 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*nBinsPhi/TMath::TwoPi()))); |
4057ba99 | 2615 | //fill the fDirectCorrelations: |
3d824203 | 2616 | // 4-p |
2617 | fDirectCorrelations->Fill(120.,cos(n*(phi1+phi2-phi3-phi4)),wPhi2*wPhi3*wPhi4); // <w1 w2 w3 cos(n(psi1+phi1-phi2-phi3))> | |
2618 | ||
2619 | tempLoop+=wPhi2*wPhi3*wPhi4; | |
2620 | ||
4057ba99 | 2621 | }//end of for(Int_t i4=0;i4<nPrim;i4++) |
2622 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
2623 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
2624 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
3d824203 | 2625 | |
b7cb54d5 | 2626 | |
ae733b3b | 2627 | |
2628 | ||
2629 | ||
2630 | ||
2631 | ||
2632 | ||
2633 | ||
2634 | ||
2635 | ||
2636 | ||
2637 | ||
2638 | ||
2639 | ||
2640 | ||
2641 | ||
2642 | ||
3d824203 | 2643 | /* |
ae733b3b | 2644 | |
2645 | ||
2646 | ||
2647 | ||
ae733b3b | 2648 | |
2649 | ||
2650 | ||
4057ba99 | 2651 | //<5'>_{2n,n|n,n,n} |
2652 | for(Int_t i1=0;i1<nPrim;i1++) | |
2653 | { | |
2654 | fTrack=anEvent->GetTrack(i1); | |
b7cb54d5 | 2655 | if(!((fTrack->Pt()>=0.5&&fTrack->Pt()<0.6)&&(fTrack->InPOISelection())))continue;//POI condition |
4057ba99 | 2656 | phi1=fTrack->Phi(); |
2657 | for(Int_t i2=0;i2<nPrim;i2++) | |
2658 | { | |
2659 | if(i2==i1)continue; | |
2660 | fTrack=anEvent->GetTrack(i2); | |
b7cb54d5 | 2661 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2662 | phi2=fTrack->Phi(); |
2663 | for(Int_t i3=0;i3<nPrim;i3++) | |
2664 | { | |
2665 | if(i3==i1||i3==i2)continue; | |
2666 | fTrack=anEvent->GetTrack(i3); | |
b7cb54d5 | 2667 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2668 | phi3=fTrack->Phi(); |
2669 | for(Int_t i4=0;i4<nPrim;i4++) | |
2670 | { | |
2671 | if(i4==i1||i4==i2||i4==i3)continue; | |
2672 | fTrack=anEvent->GetTrack(i4); | |
b7cb54d5 | 2673 | if(!(fTrack->InRPSelection()))continue;//RP condition |
ae733b3b | 2674 | phi4=fTrack->Phi();// |
4057ba99 | 2675 | for(Int_t i5=0;i5<nPrim;i5++) |
bc92c0cb | 2676 | { |
4057ba99 | 2677 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; |
2678 | fTrack=anEvent->GetTrack(i5); | |
b7cb54d5 | 2679 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2680 | phi5=fTrack->Phi(); |
2681 | //fill the fDirectCorrelations:if(bNestedLoops) | |
2682 | fDirectCorrelations->Fill(55.,cos(2.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5),1);//<5'>_{2n,n|n,n,n} | |
2683 | }//end of for(Int_t i5=0;i5<nPrim;i5++) | |
2684 | }//end of for(Int_t i4=0;i4<nPrim;i4++) | |
2685 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
2686 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
2687 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
2688 | ||
2689 | //<6'>_{n,n,n|n,n,n} | |
2690 | for(Int_t i1=0;i1<nPrim;i1++) | |
2691 | { | |
2692 | fTrack=anEvent->GetTrack(i1); | |
b7cb54d5 | 2693 | if(!((fTrack->Pt()>=0.5&&fTrack->Pt()<0.6)&&(fTrack->InPOISelection())))continue;//POI condition |
4057ba99 | 2694 | phi1=fTrack->Phi(); |
2695 | for(Int_t i2=0;i2<nPrim;i2++) | |
2696 | { | |
2697 | if(i2==i1)continue; | |
2698 | fTrack=anEvent->GetTrack(i2); | |
b7cb54d5 | 2699 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2700 | phi2=fTrack->Phi(); |
2701 | for(Int_t i3=0;i3<nPrim;i3++) | |
2702 | { | |
2703 | if(i3==i1||i3==i2)continue; | |
2704 | fTrack=anEvent->GetTrack(i3); | |
b7cb54d5 | 2705 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2706 | phi3=fTrack->Phi(); |
2707 | for(Int_t i4=0;i4<nPrim;i4++) | |
2708 | { | |
2709 | if(i4==i1||i4==i2||i4==i3)continue; | |
2710 | fTrack=anEvent->GetTrack(i4); | |
b7cb54d5 | 2711 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2712 | phi4=fTrack->Phi(); |
2713 | for(Int_t i5=0;i5<nPrim;i5++) | |
2714 | { | |
2715 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
2716 | fTrack=anEvent->GetTrack(i5); | |
b7cb54d5 | 2717 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2718 | phi5=fTrack->Phi(); |
2719 | for(Int_t i6=0;i6<nPrim;i6++) | |
2720 | { | |
2721 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
2722 | fTrack=anEvent->GetTrack(i6); | |
b7cb54d5 | 2723 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2724 | phi6=fTrack->Phi(); |
2725 | //fill the fDirectCorrelations: | |
2726 | fDirectCorrelations->Fill(60.,cos(n*(phi1+phi2+phi3-phi4-phi5-phi6)),1);//<6'>_{n,n,n|n,n,n} | |
2727 | }//end of for(Int_t i6=0;i6<nPrim;i6++) | |
2728 | }//end of for(Int_t i5=0;i5<nPrim;i5++) | |
2729 | }//end of for(Int_t i4=0;i4<nPrim;i4++) | |
2730 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
2731 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
2732 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
2733 | ||
2734 | //<7'>_{2n,n,n|n,n,n,n} | |
2735 | for(Int_t i1=0;i1<nPrim;i1++) | |
2736 | { | |
2737 | fTrack=anEvent->GetTrack(i1); | |
b7cb54d5 | 2738 | if(!((fTrack->Pt()>=0.5&&fTrack->Pt()<0.6)&&(fTrack->InPOISelection())))continue;//POI condition |
4057ba99 | 2739 | phi1=fTrack->Phi(); |
2740 | for(Int_t i2=0;i2<nPrim;i2++) | |
2741 | { | |
2742 | if(i2==i1)continue; | |
2743 | fTrack=anEvent->GetTrack(i2); | |
b7cb54d5 | 2744 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2745 | phi2=fTrack->Phi(); |
2746 | for(Int_t i3=0;i3<nPrim;i3++) | |
2747 | { | |
2748 | if(i3==i1||i3==i2)continue; | |
2749 | fTrack=anEvent->GetTrack(i3); | |
b7cb54d5 | 2750 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2751 | phi3=fTrack->Phi(); |
2752 | for(Int_t i4=0;i4<nPrim;i4++) | |
2753 | { | |
2754 | if(i4==i1||i4==i2||i4==i3)continue; | |
2755 | fTrack=anEvent->GetTrack(i4); | |
b7cb54d5 | 2756 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2757 | phi4=fTrack->Phi(); |
2758 | for(Int_t i5=0;i5<nPrim;i5++) | |
2759 | { | |
2760 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
2761 | fTrack=anEvent->GetTrack(i5); | |
b7cb54d5 | 2762 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2763 | phi5=fTrack->Phi(); |
2764 | for(Int_t i6=0;i6<nPrim;i6++) | |
2765 | { | |
2766 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
2767 | fTrack=anEvent->GetTrack(i6); | |
b7cb54d5 | 2768 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2769 | phi6=fTrack->Phi(); |
2770 | for(Int_t i7=0;i7<nPrim;i7++) | |
2771 | { | |
2772 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; | |
2773 | fTrack=anEvent->GetTrack(i7); | |
b7cb54d5 | 2774 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2775 | phi7=fTrack->Phi(); |
2776 | //fill the fDirectCorrelations: | |
2777 | fDirectCorrelations->Fill(65.,cos(2.*n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6-n*phi7),1);//<7'>_{2n,n,n|n,n,n,n} | |
2778 | }//end of for(Int_t i7=0;i7<nPrim;i7++) | |
2779 | }//end of for(Int_t i6=0;i6<nPrim;i6++) | |
2780 | }//end of for(Int_t i5=0;i5<nPrim;i5++) | |
2781 | }//end of for(Int_t i4=0;i4<nPrim;i4++) | |
2782 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
2783 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
2784 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
2785 | ||
2786 | //<8'>_{n,n,n,n|n,n,n,n} | |
2787 | for(Int_t i1=0;i1<nPrim;i1++) | |
2788 | { | |
2789 | fTrack=anEvent->GetTrack(i1); | |
b7cb54d5 | 2790 | if(!((fTrack->Pt()>=0.5&&fTrack->Pt()<0.6)&&(fTrack->InPOISelection())))continue;//POI condition |
4057ba99 | 2791 | phi1=fTrack->Phi(); |
2792 | for(Int_t i2=0;i2<nPrim;i2++) | |
2793 | { | |
2794 | if(i2==i1)continue; | |
2795 | fTrack=anEvent->GetTrack(i2); | |
b7cb54d5 | 2796 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2797 | phi2=fTrack->Phi(); |
2798 | for(Int_t i3=0;i3<nPrim;i3++) | |
2799 | { | |
2800 | if(i3==i1||i3==i2)continue; | |
2801 | fTrack=anEvent->GetTrack(i3); | |
b7cb54d5 | 2802 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2803 | phi3=fTrack->Phi(); |
2804 | for(Int_t i4=0;i4<nPrim;i4++) | |
2805 | { | |
2806 | if(i4==i1||i4==i2||i4==i3)continue; | |
2807 | fTrack=anEvent->GetTrack(i4); | |
b7cb54d5 | 2808 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2809 | phi4=fTrack->Phi(); |
2810 | for(Int_t i5=0;i5<nPrim;i5++) | |
2811 | { | |
2812 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
2813 | fTrack=anEvent->GetTrack(i5); | |
b7cb54d5 | 2814 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2815 | phi5=fTrack->Phi(); |
2816 | for(Int_t i6=0;i6<nPrim;i6++) | |
2817 | { | |
2818 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
2819 | fTrack=anEvent->GetTrack(i6); | |
b7cb54d5 | 2820 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2821 | phi6=fTrack->Phi(); |
2822 | for(Int_t i7=0;i7<nPrim;i7++) | |
2823 | { | |
2824 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; | |
2825 | fTrack=anEvent->GetTrack(i7); | |
b7cb54d5 | 2826 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2827 | phi7=fTrack->Phi(); |
2828 | for(Int_t i8=0;i8<nPrim;i8++) | |
2829 | { | |
2830 | if(i8==i1||i8==i2||i8==i3||i8==i4||i8==i5||i8==i6||i8==i7)continue; | |
2831 | fTrack=anEvent->GetTrack(i8); | |
b7cb54d5 | 2832 | if(!(fTrack->InRPSelection()))continue;//RP condition |
4057ba99 | 2833 | phi8=fTrack->Phi(); |
2834 | //fill the fDirectCorrelations: | |
2835 | fDirectCorrelations->Fill(70.,cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)),1);//<8'>_{n,n,n,n|n,n,n,n} | |
2836 | }//end of for(Int_t i8=0;i8<nPrim;i8++) | |
2837 | }//end of for(Int_t i7=0;i7<nPrim;i7++) | |
2838 | }//end of for(Int_t i6=0;i6<nPrim;i6++) | |
2839 | }//end of for(Int_t i5=0;i5<nPrim;i5++) | |
2840 | }//end of for(Int_t i4=0;i4<nPrim;i4++) | |
2841 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
2842 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
2843 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
2844 | ||
2845 | ||
2846 | ||
3d824203 | 2847 | |
2848 | ||
2849 | ||
2850 | ||
2851 | ||
2852 | ||
2853 | ||
4057ba99 | 2854 | */ |
2855 | ||
2856 | ||
3d824203 | 2857 | |
b7cb54d5 | 2858 | }// end of if (nestedLoops) |
3d824203 | 2859 | |
2860 | ||
2861 | ||
2862 | ||
2863 | ||
2864 | ||
2865 | ||
2866 | ||
2867 | ||
2868 | ||
2869 | ||
2870 | ||
2871 | ||
2872 | ||
2873 | ||
2874 | ||
2875 | ||
2876 | ||
2877 | ||
2878 | ||
2879 | ||
2880 | ||
2881 | ||
2882 | ||
2883 | ||
2884 | ||
2885 | ||
2886 | ||
4057ba99 | 2887 | //-------------------------------------------------------------------------------------------------------------------------------- |
bc92c0cb | 2888 | |
4057ba99 | 2889 | //}//end of if(nPrim>0&&nPrim<12) |
bc92c0cb | 2890 | }//end of Make() |
2891 | ||
2892 | //================================================================================================================ | |
2893 | ||
2894 | void AliFlowAnalysisWithQCumulants::Finish() | |
2895 | { | |
1315fe58 | 2896 | //calculate the final results |
3d824203 | 2897 | |
77515452 | 2898 | // harmonics |
2899 | Int_t n = 2; // to be improved | |
2900 | ||
2901 | //--------------------------------------------------------------------------------------------------------- | |
2902 | // avarage multiplicity | |
b7cb54d5 | 2903 | Double_t AvMPOI = (fCommonHists2nd->GetHistMultPOI())->GetMean(); // to be improved |
2904 | Double_t AvMRP = (fCommonHists2nd->GetHistMultRP())->GetMean(); // to be improved | |
77515452 | 2905 | |
2906 | // number of events | |
b7cb54d5 | 2907 | Double_t nEvtsPOI = (fCommonHists2nd->GetHistMultPOI())->GetEntries(); // to be improved |
2908 | Double_t nEvtsRP = (fCommonHists2nd->GetHistMultRP())->GetEntries(); // to be improved | |
77515452 | 2909 | //--------------------------------------------------------------------------------------------------------- |
2910 | ||
2911 | //--------------------------------------------------------------------------------------------------------- | |
2912 | // 2-, 4-, 6- and 8-particle azimuthal correlation: | |
2913 | Double_t two = fQCorrelations->GetBinContent(1); //<<2>>_{n|n} | |
2914 | Double_t four = fQCorrelations->GetBinContent(11); //<<4>>_{n,n|n,n} | |
2915 | Double_t six = fQCorrelations->GetBinContent(24); //<<6>>_{n,n,n|n,n,n} | |
2916 | Double_t eight = fQCorrelations->GetBinContent(31); //<<8>>_{n,n,n,n|n,n,n,n} | |
2917 | ||
2918 | // 2nd, 4th, 6th and 8th order Q-cumulant: | |
2919 | Double_t secondOrderQCumulant = two; //c_n{2} | |
2920 | Double_t fourthOrderQCumulant = four-2.*pow(two,2.); //c_n{4} | |
2921 | Double_t sixthOrderQCumulant = six-9.*two*four+12.*pow(two,3.); //c_n{6} | |
2922 | Double_t eightOrderQCumulant = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.); //c_n{8} | |
2923 | ||
2924 | // "no-name" integrated flow estimates from Q-cumulants: | |
2925 | Double_t vn2=0.,vn4=0.,vn6=0.,vn8=0.; | |
2926 | // Double_t sd2=0.,sd4=0.,sd6=0.,sd8=0.; | |
2927 | Double_t sd6=0.,sd8=0.; // to be improved/removed | |
2928 | if(secondOrderQCumulant>0.) | |
2929 | { | |
2930 | vn2 = pow(secondOrderQCumulant,0.5); //v_n{2} | |
2931 | } | |
2932 | if(fourthOrderQCumulant<0.) | |
2933 | { | |
2934 | vn4 = pow(-fourthOrderQCumulant,1./4.); //v_n{4} | |
2935 | } | |
2936 | if(sixthOrderQCumulant>0.) | |
2937 | { | |
2938 | vn6 = pow((1./4.)*sixthOrderQCumulant,1./6.); //v_n{6} | |
2939 | } | |
2940 | if(eightOrderQCumulant<0.) | |
2941 | { | |
2942 | vn8 = pow((-1./33.)*eightOrderQCumulant,1./8.); //v_n{8} | |
2943 | } | |
2944 | //--------------------------------------------------------------------------------------------------------- | |
2945 | ||
2946 | //--------------------------------------------------------------------------------------------------------- | |
2947 | // weighted 2-, 4-, 6- and 8-particle azimuthal correlation: | |
2948 | Double_t twoW = fWeightedQCorrelations->GetBinContent(1); //<<2>>_{n|n} | |
2949 | Double_t fourW = fWeightedQCorrelations->GetBinContent(21); //<<4>>_{n,n|n,n} | |
2950 | // Double_t sixW = fWeightedQCorrelations->GetBinContent(24); //<<6>>_{n,n,n|n,n,n} | |
2951 | // Double_t eightW = fWeightedQCorrelations->GetBinContent(31); //<<8>>_{n,n,n,n|n,n,n,n} | |
2952 | ||
2953 | // 2nd, 4th, 6th and 8th order weighted Q-cumulant: | |
2954 | Double_t secondOrderQCumulantW = twoW; //c_n{2} | |
2955 | Double_t fourthOrderQCumulantW = fourW-2.*pow(twoW,2.); //c_n{4} | |
2956 | // Double_t sixthOrderQCumulantW = sixW-9.*twoW*fourW+12.*pow(twoW,3.); //c_n{6} | |
2957 | // Double_t eightOrderQCumulantW = eightW-16.*twoW*sixW-18.*pow(fourW,2.)+144.*pow(twoW,2.)*fourW-144.*pow(twoW,4.); //c_n{8} | |
2958 | ||
2959 | // "no-name" integrated flow estimates from weighted Q-cumulants: | |
2960 | cout<<endl; | |
2961 | cout<<"**************************************"<<endl; | |
2962 | cout<<"**************************************"<<endl; | |
2963 | cout<<"flow estimates from Q-cumulants :"<<endl; | |
2964 | cout<<endl; | |
2965 | ||
2966 | Double_t vn2W=0.,vn4W=0.; | |
2967 | Double_t sd2W=0.,sd4W=0.; | |
2968 | if(secondOrderQCumulantW>0.){ | |
2969 | vn2W = pow(secondOrderQCumulantW,0.5); // weighted v_n{2} | |
2970 | //sd2W = 0.5*pow(secondOrderQCumulantW,-0.5)*secondOrderQCumulantErrorW; // to be improved (correct treatment of errors needed) | |
2971 | cout<<" v_"<<n<<"{2} = "<<vn2W<<" +/- "<<sd2W<<endl; | |
2972 | fIntFlowResultsQC->SetBinContent(1,vn2W); | |
2973 | //fIntFlowResultsQC->SetBinError(1,sd2W); | |
2974 | //common histograms: | |
2975 | fCommonHistsResults2nd->FillIntegratedFlow(vn2W,sd2W); | |
2976 | //fCommonHistsResults2nd->FillChi(vn2W*pow(AvM,0.5)); // to be removed | |
2977 | }else{ | |
2978 | cout<<" v_"<<n<<"{2} = Im"<<endl; | |
2979 | } | |
2980 | if(fourW!=0. && fourthOrderQCumulantW<0.){ | |
2981 | vn4W = pow(-fourthOrderQCumulantW,1./4.); //v_n{4} | |
2982 | //sd4W = 0.25*pow(-fourthOrderQCumulantW,-3./4.)*fourthOrderQCumulantErrorW; // to be improved (correct treatment of errors needed) | |
2983 | cout<<" v_"<<n<<"{4} = "<<vn4W<<" +/- "<<sd4W<<endl; | |
2984 | fIntFlowResultsQC->SetBinContent(2,vn4W); | |
2985 | //fIntFlowResultsQC->SetBinError(2,sd4W); | |
2986 | //common histograms: | |
2987 | fCommonHistsResults4th->FillIntegratedFlow(vn4W,sd4W); | |
2988 | //fCommonHistsResults4th->FillChi(vn4W*pow(AvM,0.5)); // to be removed | |
2989 | }else{ | |
2990 | cout<<" v_"<<n<<"{4} = Im"<<endl; | |
2991 | } | |
2992 | // !!! to be improved (6th and 8th order are without weights) !!! | |
2993 | if(six!=0. && sixthOrderQCumulant>0.){ | |
2994 | vn6 = pow((1./4.)*sixthOrderQCumulant,1./6.); //v_n{6} | |
2995 | //sd6 = (1./6.)*pow(2.,-1./3.)*pow(sixthOrderQCumulant,-5./6.)*sixthOrderQCumulantError; | |
2996 | cout<<" v_"<<n<<"{6} = "<<vn6<<" +/- "<<sd6<<endl; | |
2997 | fIntFlowResultsQC->SetBinContent(3,vn6); | |
2998 | //fIntFlowResultsQC->SetBinError(3,sd6); | |
2999 | //common histograms: | |
3000 | fCommonHistsResults6th->FillIntegratedFlow(vn6,sd6); | |
3001 | //fCommonHistsResults6th->FillChi(vn6*pow(AvM,0.5));//to be removed | |
3002 | }else{ | |
3003 | cout<<" v_"<<n<<"{6} = Im"<<endl; | |
3004 | } | |
3005 | if(eight!=0. && eightOrderQCumulant<0.){ | |
3006 | vn8 = pow((-1./33.)*eightOrderQCumulant,1./8.); //v_n{8} | |
3007 | cout<<" v_"<<n<<"{8} = "<<vn8<<" +/- "<<sd8<<endl; | |
3008 | fIntFlowResultsQC->SetBinContent(4,vn8); | |
3009 | //fIntFlowResultsQC->SetBinError(4,sd8); | |
3010 | //common histograms: | |
3011 | fCommonHistsResults8th->FillIntegratedFlow(vn8,sd8); | |
3012 | //fCommonHistsResults8th->FillChi(vn8*pow(AvM,0.5));//to be removed | |
3013 | }else{ | |
3014 | cout<<" v_"<<n<<"{8} = Im"<<endl; | |
3015 | } | |
3016 | cout<<endl; | |
3017 | cout<<" nEvts = "<<nEvtsRP<<", AvM = "<<AvMRP<<endl; // to be improved | |
3018 | cout<<"**************************************"<<endl; | |
3019 | cout<<"**************************************"<<endl; | |
3020 | cout<<endl; | |
3021 | //--------------------------------------------------------------------------------------------------------- | |
3022 | ||
3023 | //--------------------------------------------------------------------------------------------------------- | |
3024 | // differential flow (POI) | |
3025 | Int_t nBinsPtPOI = f2WPerPtBin1n1nPOI->GetNbinsX(); | |
3026 | Int_t nBinsEtaPOI = f4WPerPtBin1n1n1n1nPOI->GetNbinsX(); | |
3027 | ||
3028 | // Pt: | |
3029 | Double_t secondOrderQCumulantDiffFlowPtPOIW = 0.; | |
3030 | Double_t fourthOrderQCumulantDiffFlowPtPOIW = 0.; | |
3031 | ||
3032 | Double_t dVn2ndPOIW=0.,dSd2ndPOIW=0.,dDiffvn2ndPOIW=0.,dYield2ndPOIW=0.,dSum2ndPOIW=0.; | |
3033 | Double_t dVn4thPOIW=0.,dSd4thPOIW=0.,dDiffvn4thPOIW=0.,dYield4thPOIW=0.,dSum4thPOIW=0.; | |
3034 | ||
3035 | for(Int_t bb=1;bb<nBinsPtPOI+1;bb++) | |
3036 | { | |
3037 | // QC{2} | |
3038 | if(f2WPerPtBin1n1nPOI->GetBinEntries(bb)>0.&&vn2W!=0) | |
3039 | { | |
3040 | secondOrderQCumulantDiffFlowPtPOIW = f2WPerPtBin1n1nPOI->GetBinContent(bb); // with weights | |
3041 | fDiffFlowResults2ndOrderQC->SetBinContent(bb,secondOrderQCumulantDiffFlowPtPOIW/vn2W); | |
3042 | // common histogram: | |
3043 | fCommonHistsResults2nd->FillDifferentialFlowPtPOI(bb,secondOrderQCumulantDiffFlowPtPOIW/vn2W, 0.); //to be improved (errors && bb or bb+1 ?) | |
3044 | // ------------------------------------------------------------------- | |
3045 | // integrated flow (weighted, POI, Pt, 2nd order): | |
3046 | dDiffvn2ndPOIW=(fCommonHistsResults2nd->GetHistDiffFlowPtPOI())->GetBinContent(bb); | |
b7cb54d5 | 3047 | dYield2ndPOIW=(fCommonHists2nd->GetHistPtPOI())->GetBinContent(bb); |
77515452 | 3048 | dVn2ndPOIW+=dDiffvn2ndPOIW*dYield2ndPOIW; |
3049 | dSum2ndPOIW+=dYield2ndPOIW; | |
3050 | // ------------------------------------------------------------------- | |
3051 | } | |
3052 | // QC{4] | |
3053 | if(f4WPerPtBin1n1n1n1nPOI->GetBinEntries(bb)>0.&&vn4W!=0.) | |
3054 | { | |
3055 | fourthOrderQCumulantDiffFlowPtPOIW = f4WPerPtBin1n1n1n1nPOI->GetBinContent(bb)-2.*f2WPerPtBin1n1nPOI->GetBinContent(bb)*pow(vn2W,2.); // with weights | |
3056 | fDiffFlowResults4thOrderQC->SetBinContent(bb,-1.*fourthOrderQCumulantDiffFlowPtPOIW/pow(vn4W,3.)); | |
3057 | //common histogram: | |
3058 | fCommonHistsResults4th->FillDifferentialFlowPtPOI(bb,-1.*fourthOrderQCumulantDiffFlowPtPOIW/pow(vn4W,3.), 0.); //to be improved (errors) | |
3059 | // ------------------------------------------------------------------- | |
3060 | //integrated flow (POI, Pt, 4th order): | |
3061 | dDiffvn4thPOIW=(fCommonHistsResults4th->GetHistDiffFlowPtPOI())->GetBinContent(bb); | |
b7cb54d5 | 3062 | dYield4thPOIW=(fCommonHists4th->GetHistPtPOI())->GetBinContent(bb); |
77515452 | 3063 | dVn4thPOIW+=dDiffvn4thPOIW*dYield4thPOIW; |
3064 | dSum4thPOIW+=dYield4thPOIW; | |
3065 | // ------------------------------------------------------------------- | |
3066 | } | |
3067 | } | |
3068 | ||
3069 | cout<<endl; | |
3070 | cout<<"**************************************"<<endl; | |
3071 | cout<<"**************************************"<<endl; | |
3072 | cout<<"flow estimates from Q-cumulants (POI):"<<endl; | |
3073 | cout<<endl; | |
3074 | //storing the final results for integrated flow (POI): | |
3075 | // QC{2} | |
3076 | if(dSum2ndPOIW && fCommonHistsResults2nd) | |
3077 | { | |
3078 | dVn2ndPOIW/=dSum2ndPOIW; | |
3079 | fCommonHistsResults2nd->FillIntegratedFlowPOI(dVn2ndPOIW,0.); // to be improved (errors) | |
3080 | cout<<" v_"<<n<<"{2} = "<<dVn2ndPOIW<<" +/- "<<dSd2ndPOIW<<endl; | |
3081 | }else | |
3082 | { | |
3083 | cout<<" v_"<<n<<"{2} = Im"<<endl; | |
3084 | } | |
3085 | ||
3086 | // QC{4} | |
3087 | if(dSum4thPOIW && fCommonHistsResults4th) | |
3088 | { | |
3089 | dVn4thPOIW/=dSum4thPOIW; | |
3090 | fCommonHistsResults4th->FillIntegratedFlowPOI(dVn4thPOIW,0.); // to be improved (errors) | |
3091 | cout<<" v_"<<n<<"{4} = "<<dVn4thPOIW<<" +/- "<<dSd4thPOIW<<endl; | |
3092 | }else | |
3093 | { | |
3094 | cout<<" v_"<<n<<"{4} = Im"<<endl; | |
3095 | } | |
3096 | ||
3097 | cout<<endl; | |
3098 | cout<<" nEvts = "<<nEvtsPOI<<", AvM = "<<AvMPOI<<endl; | |
3099 | cout<<"**************************************"<<endl; | |
3100 | cout<<"**************************************"<<endl; | |
3101 | cout<<endl; | |
3102 | ||
3103 | //Eta: | |
3104 | Double_t secondOrderQCumulantDiffFlowEtaPOIW = 0.; | |
3105 | Double_t fourthOrderQCumulantDiffFlowEtaPOIW = 0.; | |
3106 | ||
3107 | for(Int_t bb=1;bb<nBinsEtaPOI+1;bb++) | |
3108 | { | |
3109 | if(f2WPerEtaBin1n1nPOI->GetBinEntries(bb)>0.&&vn2W!=0) | |
3110 | { | |
3111 | secondOrderQCumulantDiffFlowEtaPOIW = f2WPerEtaBin1n1nPOI->GetBinContent(bb); // with weights | |
3112 | fDiffFlowResults2ndOrderQC->SetBinContent(bb,secondOrderQCumulantDiffFlowEtaPOIW/vn2W); | |
3113 | //common histogram: | |
3114 | fCommonHistsResults2nd->FillDifferentialFlowEtaPOI(bb,secondOrderQCumulantDiffFlowEtaPOIW/vn2W, 0.);//to be improved (errors) | |
3115 | } | |
3116 | if(f4WPerEtaBin1n1n1n1nPOI->GetBinEntries(bb)>0.&&vn4W!=0.) | |
3117 | { | |
3118 | fourthOrderQCumulantDiffFlowEtaPOIW = f4WPerEtaBin1n1n1n1nPOI->GetBinContent(bb)-2.*f2WPerEtaBin1n1nPOI->GetBinContent(bb)*pow(vn2W,2.); // with weights | |
3119 | fDiffFlowResults4thOrderQC->SetBinContent(bb,-1.*fourthOrderQCumulantDiffFlowEtaPOIW/pow(vn4W,3.)); | |
3120 | //common histogram: | |
3121 | fCommonHistsResults4th->FillDifferentialFlowEtaPOI(bb,-1.*fourthOrderQCumulantDiffFlowEtaPOIW/pow(vn4W,3.), 0.);//to be improved (errors) | |
3122 | } | |
3123 | } | |
3124 | //------------------------------------------------------------ | |
3125 | ||
3d824203 | 3126 | |
3127 | ||
3d824203 | 3128 | |
3129 | ||
77515452 | 3130 | //--------------------------------------------------------------------------------------------------------- |
3131 | // differential flow (RP) | |
3132 | Int_t nBinsPtRP = f2WPerPtBin1n1nRP->GetNbinsX(); | |
3133 | Int_t nBinsEtaRP = f4WPerPtBin1n1n1n1nRP->GetNbinsX(); | |
3134 | ||
3135 | // Pt: | |
3136 | Double_t secondOrderQCumulantDiffFlowPtRPW = 0.; | |
3137 | Double_t fourthOrderQCumulantDiffFlowPtRPW = 0.; | |
7e58a232 | 3138 | |
77515452 | 3139 | Double_t dVn2ndRPW=0.,dSd2ndRPW=0.,dDiffvn2ndRPW=0.,dYield2ndRPW=0.,dSum2ndRPW=0.; |
3140 | Double_t dVn4thRPW=0.,dSd4thRPW=0.,dDiffvn4thRPW=0.,dYield4thRPW=0.,dSum4thRPW=0.; | |
3141 | ||
3142 | for(Int_t bb=1;bb<nBinsPtRP+1;bb++) | |
3143 | { | |
3144 | // QC{2} | |
3145 | if(f2WPerPtBin1n1nRP->GetBinEntries(bb)>0.&&vn2W!=0) | |
3146 | { | |
3147 | secondOrderQCumulantDiffFlowPtRPW = f2WPerPtBin1n1nRP->GetBinContent(bb); // with weights | |
3148 | fDiffFlowResults2ndOrderQC->SetBinContent(bb,secondOrderQCumulantDiffFlowPtRPW/vn2W); | |
3149 | // common histogram: | |
3150 | fCommonHistsResults2nd->FillDifferentialFlowPtRP(bb,secondOrderQCumulantDiffFlowPtRPW/vn2W, 0.); //to be improved (errors && bb or bb+1 ?) | |
3151 | // ------------------------------------------------------------------- | |
3152 | // integrated flow (weighted, RP, Pt, 2nd order): | |
3153 | dDiffvn2ndRPW=(fCommonHistsResults2nd->GetHistDiffFlowPtRP())->GetBinContent(bb); | |
b7cb54d5 | 3154 | dYield2ndRPW=(fCommonHists2nd->GetHistPtRP())->GetBinContent(bb); |
77515452 | 3155 | dVn2ndRPW+=dDiffvn2ndRPW*dYield2ndRPW; |
3156 | dSum2ndRPW+=dYield2ndRPW; | |
3157 | // ------------------------------------------------------------------- | |
3158 | } | |
3159 | // QC{4] | |
3160 | if(f4WPerPtBin1n1n1n1nRP->GetBinEntries(bb)>0.&&vn4W!=0.) | |
3161 | { | |
3162 | fourthOrderQCumulantDiffFlowPtRPW = f4WPerPtBin1n1n1n1nRP->GetBinContent(bb)-2.*f2WPerPtBin1n1nRP->GetBinContent(bb)*pow(vn2W,2.); // with weights | |
3163 | fDiffFlowResults4thOrderQC->SetBinContent(bb,-1.*fourthOrderQCumulantDiffFlowPtRPW/pow(vn4W,3.)); | |
3164 | //common histogram: | |
3165 | fCommonHistsResults4th->FillDifferentialFlowPtRP(bb,-1.*fourthOrderQCumulantDiffFlowPtRPW/pow(vn4W,3.), 0.); //to be improved (errors) | |
3166 | // ------------------------------------------------------------------- | |
3167 | //integrated flow (RP, Pt, 4th order): | |
3168 | dDiffvn4thRPW=(fCommonHistsResults4th->GetHistDiffFlowPtRP())->GetBinContent(bb); | |
b7cb54d5 | 3169 | dYield4thRPW=(fCommonHists4th->GetHistPtRP())->GetBinContent(bb); |
77515452 | 3170 | dVn4thRPW+=dDiffvn4thRPW*dYield4thRPW; |
3171 | dSum4thRPW+=dYield4thRPW; | |
3172 | // ------------------------------------------------------------------- | |
3173 | } | |
3174 | } | |
3175 | ||
3176 | cout<<endl; | |
3177 | cout<<"**************************************"<<endl; | |
3178 | cout<<"**************************************"<<endl; | |
3179 | cout<<"flow estimates from Q-cumulants (RP):"<<endl; | |
3180 | cout<<endl; | |
3181 | //storing the final results for integrated flow (RP): | |
3182 | // QC{2} | |
3183 | if(dSum2ndRPW && fCommonHistsResults2nd) | |
3184 | { | |
3185 | dVn2ndRPW/=dSum2ndRPW; | |
3186 | fCommonHistsResults2nd->FillIntegratedFlowRP(dVn2ndRPW,0.); // to be improved (errors) | |
3187 | cout<<" v_"<<n<<"{2} = "<<dVn2ndRPW<<" +/- "<<dSd2ndRPW<<endl; | |
3188 | }else | |
3189 | { | |
3190 | cout<<" v_"<<n<<"{2} = Im"<<endl; | |
3191 | } | |
3192 | ||
3193 | // QC{4} | |
3194 | if(dSum4thRPW && fCommonHistsResults4th) | |
3195 | { | |
3196 | dVn4thRPW/=dSum4thRPW; | |
3197 | fCommonHistsResults4th->FillIntegratedFlowRP(dVn4thRPW,0.); // to be improved (errors) | |
3198 | cout<<" v_"<<n<<"{4} = "<<dVn4thRPW<<" +/- "<<dSd4thRPW<<endl; | |
3199 | }else | |
3200 | { | |
3201 | cout<<" v_"<<n<<"{4} = Im"<<endl; | |
3202 | } | |
3203 | ||
3204 | cout<<endl; | |
3205 | cout<<" nEvts = "<<nEvtsRP<<", AvM = "<<AvMRP<<endl; | |
3206 | cout<<"**************************************"<<endl; | |
3207 | cout<<"**************************************"<<endl; | |
3208 | cout<<endl; | |
3209 | ||
3210 | //Eta: | |
3211 | Double_t secondOrderQCumulantDiffFlowEtaRPW = 0.; | |
3212 | Double_t fourthOrderQCumulantDiffFlowEtaRPW = 0.; | |
3213 | ||
3214 | for(Int_t bb=1;bb<nBinsEtaRP+1;bb++) | |
3215 | { | |
3216 | if(f2WPerEtaBin1n1nRP->GetBinEntries(bb)>0.&&vn2W!=0) | |
3217 | { | |
3218 | secondOrderQCumulantDiffFlowEtaRPW = f2WPerEtaBin1n1nRP->GetBinContent(bb); // with weights | |
3219 | fDiffFlowResults2ndOrderQC->SetBinContent(bb,secondOrderQCumulantDiffFlowEtaRPW/vn2W); | |
3220 | //common histogram: | |
3221 | fCommonHistsResults2nd->FillDifferentialFlowEtaRP(bb,secondOrderQCumulantDiffFlowEtaRPW/vn2W, 0.);//to be improved (errors) | |
3222 | } | |
3223 | if(f4WPerEtaBin1n1n1n1nRP->GetBinEntries(bb)>0.&&vn4W!=0.) | |
3224 | { | |
3225 | fourthOrderQCumulantDiffFlowEtaRPW = f4WPerEtaBin1n1n1n1nRP->GetBinContent(bb)-2.*f2WPerEtaBin1n1nRP->GetBinContent(bb)*pow(vn2W,2.); // with weights | |
3226 | fDiffFlowResults4thOrderQC->SetBinContent(bb,-1.*fourthOrderQCumulantDiffFlowEtaRPW/pow(vn4W,3.)); | |
3227 | //common histogram: | |
3228 | fCommonHistsResults4th->FillDifferentialFlowEtaRP(bb,-1.*fourthOrderQCumulantDiffFlowEtaRPW/pow(vn4W,3.), 0.);//to be improved (errors) | |
3229 | } | |
3230 | } | |
3231 | //------------------------------------------------------------ | |
3232 | ||
3233 | ||
3234 | ||
b7cb54d5 | 3235 | |
3236 | ||
3237 | ||
3238 | ||
3239 | ||
3240 | ||
3241 | ||
3242 | Bool_t nestedLoops = kFALSE; | |
3243 | if(nestedLoops) | |
3244 | { | |
3245 | //needed for direct correlations (obtained from nested loops) | |
3246 | cout<<endl; | |
3247 | cout<<endl; | |
3248 | cout<<" **** cross-checking the formulas ****"<<endl; | |
3249 | cout<<" **** for integrated flow ****"<<endl; | |
3250 | cout<<"(selected only events for which 0 < M < 12 "<<endl; | |
3251 | cout<<" from dataset in /data/alice2/ante/AOD) "<<endl; | |
3252 | ||
3253 | cout<<endl; | |
3254 | //cout<<" nEvts = "<<nEvts<<", AvM = "<<AvM<<endl; | |
3255 | cout<<endl; | |
3256 | cout<<"<w1 w2 cos(n*(phi1-phi2))> from Q-vectors = "<<fWeightedQCorrelations->GetBinContent(1)<<endl; | |
3257 | cout<<"<w1 w2 cos(n*(phi1-phi2))> from nested loops = "<<fDirectCorrelations->GetBinContent(1)<<endl; | |
3258 | cout<<endl; | |
3259 | cout<<"<w1^2 w2^2 cos(2n*(phi1-phi2))> from Q-vectors = "<<fWeightedQCorrelations->GetBinContent(2)<<endl; | |
3260 | cout<<"<w1^2 w2^2 cos(2n*(phi1-phi2))> from nested loops = "<<fDirectCorrelations->GetBinContent(2)<<endl; | |
3261 | cout<<endl; | |
3262 | cout<<"<w1^3 w2^3 cos(3n*(phi1-phi2))> from Q-vectors = "<<fWeightedQCorrelations->GetBinContent(3)<<endl; | |
3263 | cout<<"<w1^3 w2^3 cos(3n*(phi1-phi2))> from nested loops = "<<fDirectCorrelations->GetBinContent(3)<<endl; | |
3264 | cout<<endl; | |
3265 | cout<<"<w1^4 w2^4 cos(4n*(phi1-phi2))> from Q-vectors = "<<fWeightedQCorrelations->GetBinContent(4)<<endl; | |
3266 | cout<<"<w1^4 w2^4 cos(4n*(phi1-phi2))> from nested loops = "<<fDirectCorrelations->GetBinContent(4)<<endl; | |
3267 | cout<<endl; | |
3268 | cout<<"<w1^3 w2 cos(n*(phi1-phi2))> from Q-vectors = "<<fWeightedQCorrelations->GetBinContent(5)<<endl; | |
3269 | cout<<"<w1^3 w2 cos(n*(phi1-phi2))> from nested loops = "<<fDirectCorrelations->GetBinContent(5)<<endl; | |
3270 | cout<<endl; | |
3271 | cout<<"<w1 w2 w3^2 cos(n*(phi1-phi2))> from Q-vectors = "<<fWeightedQCorrelations->GetBinContent(6)<<endl; | |
3272 | cout<<"<w1 w2 w3^2 cos(n*(phi1-phi2))> from nested loops = "<<fDirectCorrelations->GetBinContent(6)<<endl; | |
3273 | cout<<endl; | |
3274 | cout<<"<w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> from Q-vectors = "<<fWeightedQCorrelations->GetBinContent(11)<<endl; | |
3275 | cout<<"<w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> from nested loops = "<<fDirectCorrelations->GetBinContent(11)<<endl; | |
3276 | cout<<endl; | |
3277 | ||
3278 | cout<<"<w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> from Q-vectors = "<<fWeightedQCorrelations->GetBinContent(21)<<endl; | |
3279 | cout<<"<w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> from nested loops = "<<fDirectCorrelations->GetBinContent(21)<<endl; | |
3280 | cout<<endl;; | |
3281 | ||
3282 | ||
77515452 | 3283 | /* |
b7cb54d5 | 3284 | cout<<"<3>_{4n,2n,2n} from Q-vectors = "<<fQCorrelations->GetBinContent(8)<<endl; |
3285 | cout<<"<3>_{4n,2n,2n} from nested loops = "<<fDirectCorrelations->GetBinContent(8)<<endl; | |
3286 | cout<<endl; | |
3287 | cout<<"<3>_{4n,3n,n} from Q-vectors = "<<fQCorrelations->GetBinContent(9)<<endl; | |
3288 | cout<<"<3>_{4n,3n,n} from nested loops = "<<fDirectCorrelations->GetBinContent(9)<<endl; | |
3289 | cout<<endl; | |
3290 | ||
3291 | cout<<"<4>_{2n,n|2n,n} from Q-vectors = "<<fQCorrelations->GetBinContent(12)<<endl; | |
3292 | cout<<"<4>_{2n,n|2n,n} from nested loops = "<<fDirectCorrelations->GetBinContent(12)<<endl; | |
3293 | cout<<endl; | |
3294 | cout<<"<4>_{2n,2n|2n,2n} from Q-vectors = "<<fQCorrelations->GetBinContent(13)<<endl; | |
3295 | cout<<"<4>_{2n,2n|2n,2n} from nested loops = "<<fDirectCorrelations->GetBinContent(13)<<endl; | |
3296 | cout<<endl; | |
3297 | cout<<"<4>_{3n|n,n,n} from Q-vectors = "<<fQCorrelations->GetBinContent(14)<<endl; | |
3298 | cout<<"<4>_{3n|n,n,n} from nested loops = "<<fDirectCorrelations->GetBinContent(14)<<endl; | |
3299 | cout<<endl; | |
3300 | cout<<"<4>_{3n,n|3n,n} from Q-vectors = "<<fQCorrelations->GetBinContent(15)<<endl; | |
3301 | cout<<"<4>_{3n,n|3n,n} from nested loops = "<<fDirectCorrelations->GetBinContent(15)<<endl; | |
3302 | cout<<endl; | |
3303 | cout<<"<4>_{3n,n|2n,2n} from Q-vectors = "<<fQCorrelations->GetBinContent(16)<<endl; | |
3304 | cout<<"<4>_{3n,n|2n,2n} from nested loops = "<<fDirectCorrelations->GetBinContent(16)<<endl; | |
3305 | cout<<endl; | |
3306 | cout<<"<4>_{4n|2n,n,n} from Q-vectors = "<<fQCorrelations->GetBinContent(17)<<endl; | |
3307 | cout<<"<4>_{4n|2n,n,n} from nested loops = "<<fDirectCorrelations->GetBinContent(17)<<endl; | |
3308 | cout<<endl; | |
3309 | cout<<"<5>_{2n,n|n,n,n} from Q-vectors = "<<fQCorrelations->GetBinContent(19)<<endl; | |
3310 | cout<<"<5>_{2n,n|n,n,n} from nested loops = "<<fDirectCorrelations->GetBinContent(19)<<endl; | |
3311 | cout<<endl; | |
3312 | cout<<"<5>_{2n,2n|2n,n,n} from Q-vectors = "<<fQCorrelations->GetBinContent(20)<<endl; | |
3313 | cout<<"<5>_{2n,2n|2n,n,n} from nested loops = "<<fDirectCorrelations->GetBinContent(20)<<endl; | |
3314 | cout<<endl; | |
3315 | cout<<"<5>_{3n,n|2n,n,n} from Q-vectors = "<<fQCorrelations->GetBinContent(21)<<endl; | |
3316 | cout<<"<5>_{3n,n|2n,n,n} from nested loops = "<<fDirectCorrelations->GetBinContent(21)<<endl; | |
3317 | cout<<endl; | |
3318 | cout<<"<5>_{4n|n,n,n,n} from Q-vectors = "<<fQCorrelations->GetBinContent(22)<<endl; | |
3319 | cout<<"<5>_{4n|n,n,n,n} from nested loops = "<<fDirectCorrelations->GetBinContent(22)<<endl; | |
3320 | cout<<endl; | |
3321 | cout<<"<6>_{n,n,n|n,n,n} from Q-vectors = "<<fQCorrelations->GetBinContent(24)<<endl; | |
3322 | cout<<"<6>_{n,n,n|n,n,n} from nested loops = "<<fDirectCorrelations->GetBinContent(24)<<endl; | |
3323 | cout<<endl; | |
3324 | cout<<"<6>_{2n,n,n|2n,n,n} from Q-vectors = "<<fQCorrelations->GetBinContent(25)<<endl; | |
3325 | cout<<"<6>_{2n,n,n|2n,n,n} from nested loops = "<<fDirectCorrelations->GetBinContent(25)<<endl; | |
3326 | cout<<endl; | |
3327 | cout<<"<6>_{2n,2n|n,n,n,n} from Q-vectors = "<<fQCorrelations->GetBinContent(26)<<endl; | |
3328 | cout<<"<6>_{2n,2n|n,n,n,n} from nested loops = "<<fDirectCorrelations->GetBinContent(26)<<endl; | |
3329 | cout<<endl; | |
3330 | cout<<"<6>_{3n,n|n,n,n,n} from Q-vectors = "<<fQCorrelations->GetBinContent(27)<<endl; | |
3331 | cout<<"<6>_{3n,n|n,n,n,n} from nested loops = "<<fDirectCorrelations->GetBinContent(27)<<endl; | |
3332 | cout<<endl; | |
3333 | cout<<"<7>_{2n,n,n|n,n,n,n} from Q-vectors = "<<fQCorrelations->GetBinContent(29)<<endl; | |
3334 | cout<<"<7>_{2n,n,n|n,n,n,n} from nested loops = "<<fDirectCorrelations->GetBinContent(29)<<endl; | |
3335 | cout<<endl; | |
3336 | cout<<"<8>_{n,n,n,n|n,n,n,n} from Q-vectors = "<<fQCorrelations->GetBinContent(31)<<endl; | |
3337 | cout<<"<8>_{n,n,n,n|n,n,n,n} from nested loops = "<<fDirectCorrelations->GetBinContent(31)<<endl; | |
3338 | cout<<endl; | |
3339 | ||
3340 | */ | |
3341 | ||
3342 | ||
3343 | ||
3344 | ||
3345 | ||
3346 | ||
3347 | ||
3348 | ||
3349 | ||
3350 | ||
3351 | ||
3352 | ||
3353 | ||
3354 | ||
3355 | ||
77515452 | 3356 | cout<<"0.5 < Pt < 0.6 GeV"<<endl; |
3357 | cout<<endl; | |
3358 | cout<<"<w2 cos(n(psi1-phi2))> from Q-vectors = "<<f2WPerPtBin1n1nPOI->GetBinContent(6)<<endl; | |
3359 | //cout<<"<w2 cos(n(psi1-phi2))> from Q-vectors = "<<f2WPerPtBin1n1nRP->GetName()<<endl; | |
3360 | cout<<"<w2 cos(n(psi1-phi2))> from Q-vectors = "<<fDirectCorrelations->GetBinContent(101)<<endl; | |
3361 | cout<<endl; | |
3362 | cout<<"<w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))> from Q-vectors = "<<f4WPerPtBin1n1n1n1nPOI->GetBinContent(6)<<endl; | |
3363 | //cout<<"<w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))> from Q-vectors = "<<f4WPerPtBin1n1n1n1nRP->GetName()<<endl; | |
3364 | cout<<"<w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))> from nested loops = "<<fDirectCorrelations->GetBinContent(121)<<endl; | |
3365 | cout<<endl; | |
3366 | ||
b7cb54d5 | 3367 | }//end of if(nestedLoops) |
77515452 | 3368 | |
3369 | ||
3370 | ||
3371 | ||
77515452 | 3372 | |
e085f1a9 | 3373 | |
3374 | ||
b7cb54d5 | 3375 | |
3376 | /* | |
e085f1a9 | 3377 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
3378 | // !!!! to be removed !!!! | |
3379 | ||
3380 | TCanvas* qvectorPlot = new TCanvas("qvectorPlot","Q-vector Plot",1000,1000); | |
3381 | ||
3382 | qvectorPlot->cd(1); | |
3383 | ||
3384 | TH1D* style = new TH1D("style","Q-vectors",100,-244,244); | |
3385 | (style->GetYaxis())->SetRangeUser(-244,244); | |
3386 | ||
3387 | style->Draw(); | |
3388 | ||
3389 | Int_t nBins=fQvectorForEachEventX->GetNbinsX(); | |
3390 | Double_t qxxx=0.,qyyy=0.; | |
3391 | //cout<<"nBins = "<<nBins<<endl; | |
3392 | //cout<<fQvectorForEachEventX->GetBinEntries(4)<<endl; | |
3393 | //cout<<fQvectorForEachEventY->GetBinEntries(4)<<endl; | |
3394 | ||
3395 | for(Int_t b=1;b<nBins+1;b++) | |
3396 | { | |
3397 | if(fQvectorForEachEventX->GetBinEntries(b)==1 && fQvectorForEachEventY->GetBinEntries(b)==1) | |
3398 | { | |
3399 | qxxx=fQvectorForEachEventX->GetBinContent(b); | |
3400 | qyyy=fQvectorForEachEventY->GetBinContent(b); | |
3401 | //cout<<qxxx<<" "<<qyyy<<endl; | |
3402 | TArrow *qvector = new TArrow(0.0,0.0,qxxx,qyyy,0.0144,"|>"); | |
3403 | qvector->SetAngle(40); | |
3404 | qvector->SetLineWidth(2); | |
3405 | qvector->Draw(""); | |
3406 | } | |
3407 | } | |
3408 | ||
3409 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx | |
b7cb54d5 | 3410 | */ |
e085f1a9 | 3411 | |
bc92c0cb | 3412 | } |
3413 | ||
1315fe58 | 3414 | //================================================================================================================ |
bc92c0cb | 3415 | |
4057ba99 | 3416 | void AliFlowAnalysisWithQCumulants::WriteHistograms(TString outputFileName) |
1315fe58 | 3417 | { |
3418 | //store the final results in output .root file | |
4057ba99 | 3419 | TFile *output = new TFile(outputFileName.Data(),"RECREATE"); |
7a2c2652 | 3420 | output->WriteObject(fHistList, "cobjQC","SingleKey"); |
1315fe58 | 3421 | delete output; |
3422 | } | |
bc92c0cb | 3423 | |
1315fe58 | 3424 | //================================================================================================================ |
dee1e0e0 | 3425 | |
4057ba99 | 3426 | |
3427 |