| bc92c0cb |
1 | /************************************************************************* |
| 2 | * Copyright(c) 1998-2008, ALICE Experiment at CERN, All rights reserved. * |
| 3 | * * |
| 4 | * Author: The ALICE Off-line Project. * |
| 5 | * Contributors are mentioned in the code where appropriate. * |
| 6 | * * |
| 7 | * Permission to use, copy, modify and distribute this software and its * |
| 8 | * documentation strictly for non-commercial purposes is hereby granted * |
| 9 | * without fee, provided that the above copyright notice appears in all * |
| 10 | * copies and that both the copyright notice and this permission notice * |
| 11 | * appear in the supporting documentation. The authors make no claims * |
| 12 | * about the suitability of this software for any purpose. It is * |
| 13 | * provided "as is" without express or implied warranty. * |
| 14 | **************************************************************************/ |
| 15 | |
| 16 | /********************************** |
| 17 | * flow analysis with Q-cumulants * |
| 18 | * * |
| 19 | * author: Ante Bilandzic * |
| 20 | * (anteb@nikhef.nl) * |
| 21 | *********************************/ |
| 22 | |
| 23 | #define AliFlowAnalysisWithQCumulants_cxx |
| 24 | |
| 25 | #include "Riostream.h" |
| 26 | #include "AliFlowCommonConstants.h" |
| 27 | #include "AliFlowCommonHist.h" |
| 28 | #include "AliFlowCommonHistResults.h" |
| 29 | #include "TChain.h" |
| 30 | #include "TFile.h" |
| 1315fe58 |
31 | #include "TList.h" |
| e085f1a9 |
32 | #include "TGraph.h" |
| bc92c0cb |
33 | #include "TParticle.h" |
| 34 | #include "TRandom3.h" |
| 1315fe58 |
35 | #include "TStyle.h" |
| bc92c0cb |
36 | #include "TProfile.h" |
| 37 | #include "TProfile2D.h" |
| 38 | #include "TProfile3D.h" |
| 1dfa3c16 |
39 | #include "TMath.h" |
| e085f1a9 |
40 | #include "TArrow.h" |
| 41 | #include "TPaveLabel.h" |
| 42 | #include "TCanvas.h" |
| bc92c0cb |
43 | #include "AliFlowEventSimple.h" |
| 44 | #include "AliFlowTrackSimple.h" |
| 45 | #include "AliFlowAnalysisWithQCumulants.h" |
| 3d824203 |
46 | #include "TArrayD.h" |
| bc92c0cb |
47 | #include "TRandom.h" |
| 2bdc5281 |
48 | #include "TF1.h" |
| bc92c0cb |
49 | |
| 50 | class TH1; |
| 9c1a9547 |
51 | class TH2; |
| bc92c0cb |
52 | class TGraph; |
| 53 | class TPave; |
| 54 | class TLatex; |
| 55 | class TMarker; |
| 56 | class TRandom3; |
| 57 | class TObjArray; |
| 58 | class TList; |
| 59 | class TCanvas; |
| 60 | class TSystem; |
| 61 | class TROOT; |
| 62 | class AliFlowVector; |
| 63 | class TVector; |
| 64 | |
| 2aa4ebcd |
65 | |
| bc92c0cb |
66 | //================================================================================================================ |
| 67 | |
| 2aa4ebcd |
68 | |
| bc92c0cb |
69 | ClassImp(AliFlowAnalysisWithQCumulants) |
| 70 | |
| 2aa4ebcd |
71 | AliFlowAnalysisWithQCumulants::AliFlowAnalysisWithQCumulants(): |
| 72 | // 0.) base: |
| bc92c0cb |
73 | fHistList(NULL), |
| 2aa4ebcd |
74 | // 1.) common: |
| 75 | fCommonHists(NULL), |
| 76 | fCommonHists2nd(NULL), |
| cb308e83 |
77 | fCommonHists4th(NULL), |
| 78 | fCommonHists6th(NULL), |
| 79 | fCommonHists8th(NULL), |
| 8842fb2b |
80 | fCommonHistsResults2nd(NULL), |
| 81 | fCommonHistsResults4th(NULL), |
| 82 | fCommonHistsResults6th(NULL), |
| 83 | fCommonHistsResults8th(NULL), |
| 2aa4ebcd |
84 | fnBinsPhi(0), |
| 85 | fPhiMin(0), |
| 86 | fPhiMax(0), |
| 87 | fPhiBinWidth(0), |
| 8842fb2b |
88 | fnBinsPt(0), |
| 89 | fPtMin(0), |
| 1dfa3c16 |
90 | fPtMax(0), |
| 2aa4ebcd |
91 | fPtBinWidth(0), |
| 1dfa3c16 |
92 | fnBinsEta(0), |
| 93 | fEtaMin(0), |
| e085f1a9 |
94 | fEtaMax(0), |
| 2aa4ebcd |
95 | fEtaBinWidth(0), |
| 96 | fHarmonic(2), |
| 97 | // 2.) weights: |
| 98 | fWeightsList(NULL), |
| e085f1a9 |
99 | fUsePhiWeights(kFALSE), |
| 100 | fUsePtWeights(kFALSE), |
| 9c1a9547 |
101 | fUseEtaWeights(kFALSE), |
| 2aa4ebcd |
102 | fUseParticleWeights(NULL), |
| 103 | fPhiWeights(NULL), |
| 104 | fPtWeights(NULL), |
| 105 | fEtaWeights(NULL), |
| 106 | // 3.) integrated flow: |
| 107 | fIntFlowList(NULL), |
| 108 | fIntFlowProfiles(NULL), |
| 109 | fIntFlowResults(NULL), |
| 9c1a9547 |
110 | fReQ(NULL), |
| 111 | fImQ(NULL), |
| 112 | fSMpk(NULL), |
| 2aa4ebcd |
113 | fAvMultiplicity(NULL), |
| 114 | // 4.) differential flow: |
| 115 | fDiffFlowList(NULL), |
| 116 | fDiffFlowProfiles(NULL), |
| 117 | fDiffFlowResults(NULL), |
| 118 | // 5.) distributions: |
| 119 | fDistributionsList(NULL), |
| 120 | // x.) debugging and cross-checking: |
| 121 | fNestedLoopsList(NULL), |
| 122 | fEvaluateNestedLoopsForIntFlow(kFALSE), |
| 123 | fEvaluateNestedLoopsForDiffFlow(kFALSE), |
| 124 | fEvaluateNestedLoops(NULL), |
| 125 | fDirectCorrelations(NULL), |
| 126 | fDirectCorrectionsCos(NULL), |
| 127 | fDirectCorrectionsSin(NULL), |
| 128 | fDirectCorrelationsDiffFlow(NULL), |
| 129 | fDirectCorrectionsDiffFlowCos(NULL), |
| 130 | fDirectCorrectionsDiffFlowSin(NULL), |
| 131 | fDirectCorrelationsW(NULL), |
| 132 | fDirectCorrectionsCosW(NULL), |
| 133 | fDirectCorrectionsSinW(NULL), |
| 134 | fDirectCorrelationsDiffFlowW(NULL), |
| 135 | fDirectCorrectionsDiffFlowCosW(NULL), |
| 136 | fDirectCorrectionsDiffFlowSinW(NULL) |
| 137 | { |
| 138 | // constructor |
| 9c1a9547 |
139 | |
| 2aa4ebcd |
140 | // base list to hold all output objects: |
| 141 | fHistList = new TList(); |
| 142 | fHistList->SetName("cobjQC"); |
| 143 | fHistList->SetOwner(kTRUE); |
| 9c1a9547 |
144 | |
| 2aa4ebcd |
145 | // list to hold histograms with phi, pt and eta weights: |
| 146 | fWeightsList = new TList(); |
| 147 | fWeightsList->SetName("Weights"); |
| 148 | fWeightsList->SetOwner(kTRUE); |
| 149 | |
| 150 | // initialize all arrays: |
| 151 | this->InitializeArraysForIntFlow(); |
| 152 | this->InitializeArraysForDiffFlow(); |
| 153 | this->InitializeArraysForDistributions(); |
| 03a02aca |
154 | |
| 2aa4ebcd |
155 | } // end of constructor |
| 8842fb2b |
156 | |
| 2aa4ebcd |
157 | |
| 158 | //================================================================================================================ |
| 159 | |
| bc92c0cb |
160 | |
| 161 | AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants() |
| 162 | { |
| 2aa4ebcd |
163 | // destructor |
| 164 | |
| 165 | delete fHistList; |
| 166 | |
| 167 | } // end of AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants() |
| 168 | |
| bc92c0cb |
169 | |
| 170 | //================================================================================================================ |
| 171 | |
| 2aa4ebcd |
172 | |
| e085f1a9 |
173 | void AliFlowAnalysisWithQCumulants::Init() |
| bc92c0cb |
174 | { |
| 2aa4ebcd |
175 | // initialize all constants and book everything |
| ae733b3b |
176 | |
| 2aa4ebcd |
177 | // access constants: |
| 178 | this->AccessConstants(); |
| ae733b3b |
179 | |
| 2aa4ebcd |
180 | // booking: |
| 181 | this->BookAndNestAllLists(); |
| 182 | this->BookCommonHistograms(); |
| 183 | this->BookAndFillWeightsHistograms(); |
| 184 | this->BookEverythingForIntegratedFlow(); |
| 185 | this->BookEverythingForDifferentialFlow(); |
| 186 | this->BookEverythingForDistributions(); |
| 187 | this->BookEverythingForNestedLoops(); |
| 5e838eeb |
188 | |
| 2aa4ebcd |
189 | // set harmonic in common control histograms (to be improved (should I do this somewhere else?)): |
| 190 | (fCommonHists->GetHarmonic())->Fill(0.5,fHarmonic); |
| 191 | (fCommonHists2nd->GetHarmonic())->Fill(0.5,fHarmonic); |
| 192 | (fCommonHists4th->GetHarmonic())->Fill(0.5,fHarmonic); |
| 193 | (fCommonHists6th->GetHarmonic())->Fill(0.5,fHarmonic); |
| 194 | (fCommonHists8th->GetHarmonic())->Fill(0.5,fHarmonic); |
| 9c1a9547 |
195 | |
| 2aa4ebcd |
196 | } // end of void AliFlowAnalysisWithQCumulants::Init() |
| 3d824203 |
197 | |
| 9c1a9547 |
198 | |
| 199 | //================================================================================================================ |
| 200 | |
| 201 | |
| 202 | void AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent) |
| 203 | { |
| 204 | // running over data only in this method |
| 205 | |
| 2aa4ebcd |
206 | // a) fill the common control histograms and call method to fill fAvMultiplicity; |
| 207 | // b) loop over data to calculate e-b-e quantities; |
| 208 | // c) call the methods; |
| 209 | // d) debugging and cross-checking (evaluate nested loops); |
| 210 | // e) reset e-b-e quantities. |
| 9c1a9547 |
211 | |
| 2aa4ebcd |
212 | Double_t dPhi = 0.; // azimuthal angle in the laboratory frame |
| 9c1a9547 |
213 | Double_t dPt = 0.; // transverse momentum |
| 214 | Double_t dEta = 0.; // pseudorapidity |
| 215 | |
| 3d824203 |
216 | Double_t wPhi = 1.; // phi weight |
| 217 | Double_t wPt = 1.; // pt weight |
| 218 | Double_t wEta = 1.; // eta weight |
| 2aa4ebcd |
219 | |
| 220 | // ******************************************** |
| 221 | // **** FILL THE COMMON CONTROL HISTOGRAMS **** |
| 222 | // ******************************************** |
| 9c1a9547 |
223 | |
| 2aa4ebcd |
224 | Int_t nRP = anEvent->GetEventNSelTracksRP(); // number of RPs (i.e. number of particles used to determine the reaction plane) |
| 225 | |
| 226 | fCommonHists->FillControlHistograms(anEvent); |
| 227 | |
| 9c1a9547 |
228 | if(nRP>1) |
| 229 | { |
| 230 | fCommonHists2nd->FillControlHistograms(anEvent); |
| 231 | if(nRP>3) |
| 232 | { |
| 233 | fCommonHists4th->FillControlHistograms(anEvent); |
| 234 | if(nRP>5) |
| 3d824203 |
235 | { |
| 9c1a9547 |
236 | fCommonHists6th->FillControlHistograms(anEvent); |
| 237 | if(nRP>7) |
| 3d824203 |
238 | { |
| 9c1a9547 |
239 | fCommonHists8th->FillControlHistograms(anEvent); |
| 240 | } // end of if(nRP>7) |
| 241 | } // end of if(nRP>5) |
| 242 | } // end of if(nRP>3) |
| 243 | } // end of if(nRP>1) |
| 2aa4ebcd |
244 | |
| 245 | this->FillAverageMultiplicities(nRP); |
| 246 | |
| 247 | // ******************************************************* |
| 248 | // **** LOOP OVER DATA AND CALCULATE E-B-E QUANTITIES **** |
| 249 | // ******************************************************* |
| 3d824203 |
250 | |
| 2aa4ebcd |
251 | Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = total number of primary tracks, i.e. nPrim = nRP + nPOI + rest, where: |
| 252 | // nRP = # of particles used to determine the reaction plane; |
| 253 | // nPOI = # of particles of interest for a detailed flow analysis; |
| 254 | // rest = # of particles which are not niether RPs nor POIs. |
| 3d824203 |
255 | |
| 2aa4ebcd |
256 | AliFlowTrackSimple *aftsTrack = NULL; |
| 3d824203 |
257 | |
| 9c1a9547 |
258 | for(Int_t i=0;i<nPrim;i++) |
| 3d824203 |
259 | { |
| 2aa4ebcd |
260 | aftsTrack=anEvent->GetTrack(i); |
| 261 | if(aftsTrack) |
| 77515452 |
262 | { |
| 2aa4ebcd |
263 | if(!(aftsTrack->InRPSelection() || aftsTrack->InPOISelection())) continue; // consider only tracks which are RPs or POIs |
| 264 | |
| 265 | Int_t n = fHarmonic; // shortcut for the harmonic |
| 9c1a9547 |
266 | |
| 2aa4ebcd |
267 | if(aftsTrack->InRPSelection()) // RP condition: |
| 9c1a9547 |
268 | { |
| 2aa4ebcd |
269 | dPhi = aftsTrack->Phi(); |
| 270 | dPt = aftsTrack->Pt(); |
| 271 | dEta = aftsTrack->Eta(); |
| 9c1a9547 |
272 | |
| 2aa4ebcd |
273 | if(fUsePhiWeights && fPhiWeights && fnBinsPhi) // determine phi weight for this particle: |
| 3d824203 |
274 | { |
| 2aa4ebcd |
275 | wPhi = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(dPhi*fnBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
276 | } |
| 2aa4ebcd |
277 | if(fUsePtWeights && fPtWeights && fnBinsPt) // determine pt weight for this particle: |
| 9c1a9547 |
278 | { |
| 2aa4ebcd |
279 | wPt = fPtWeights->GetBinContent(1+(Int_t)(TMath::Floor((dPt-fPtMin)/fPtBinWidth))); |
| 9c1a9547 |
280 | } |
| 2aa4ebcd |
281 | if(fUseEtaWeights && fEtaWeights && fEtaBinWidth) // determine eta weight for this particle: |
| 9c1a9547 |
282 | { |
| 2aa4ebcd |
283 | wEta = fEtaWeights->GetBinContent(1+(Int_t)(TMath::Floor((dEta-fEtaMin)/fEtaBinWidth))); |
| 9c1a9547 |
284 | } |
| 2aa4ebcd |
285 | |
| 286 | // integrated flow: |
| 287 | // calculate Re[Q_{m*n,k}] and Im[Q_{m*n,k}], m = 1,2,3,4, for this event: |
| 288 | for(Int_t m=0;m<4;m++) |
| 9c1a9547 |
289 | { |
| 290 | for(Int_t k=0;k<9;k++) |
| 77515452 |
291 | { |
| 2aa4ebcd |
292 | (*fReQ)(m,k)+=pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1)*n*dPhi); |
| 293 | (*fImQ)(m,k)+=pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1)*n*dPhi); |
| 77515452 |
294 | } |
| 9c1a9547 |
295 | } |
| 2aa4ebcd |
296 | // calculate S^{M}_{p,k} for this event |
| 297 | // Remark: final calculation of S^{M}_{p,k} follows after the loop over data bellow: |
| 9c1a9547 |
298 | for(Int_t p=0;p<8;p++) |
| 299 | { |
| 300 | for(Int_t k=0;k<9;k++) |
| 301 | { |
| 302 | (*fSMpk)(p,k)+=pow(wPhi*wPt*wEta,k); |
| 77515452 |
303 | } |
| 9c1a9547 |
304 | } |
| 2aa4ebcd |
305 | |
| 306 | // differential flow: |
| 307 | // (r_{m*m,k}(pt,eta)): |
| 308 | for(Int_t m=0;m<4;m++) |
| 3d824203 |
309 | { |
| 2aa4ebcd |
310 | for(Int_t k=0;k<9;k++) |
| 311 | { |
| 312 | fReEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
| 313 | fImEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.); |
| 314 | } |
| 315 | } |
| 316 | // s_{k}(pt,eta) for RPs // to be improved (clarified) |
| 317 | // Remark: final calculation of s_{p,k}(pt,eta) follows after the loop over data bellow: |
| 318 | for(Int_t k=0;k<9;k++) |
| 319 | { |
| 320 | fs[0][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k),1.); |
| 9c1a9547 |
321 | } |
| 9c1a9547 |
322 | |
| 2aa4ebcd |
323 | if(aftsTrack->InPOISelection()) |
| 324 | { |
| 325 | // (q_{m*m,k}(pt,eta)): |
| 326 | for(Int_t m=0;m<4;m++) |
| 9c1a9547 |
327 | { |
| 2aa4ebcd |
328 | for(Int_t k=0;k<9;k++) |
| 329 | { |
| 330 | fReEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
| 331 | fImEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.); |
| 332 | } |
| 333 | } |
| 334 | // s_{k}(pt,eta) for RP&&POIs // to be improved (clarified) |
| 335 | // Remark: final calculation of s_{p,k}(pt,eta) follows after the loop over data bellow: |
| 336 | for(Int_t k=0;k<9;k++) |
| 337 | { |
| 338 | fs[2][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k),1.); |
| 339 | } |
| 340 | |
| 341 | } // end of if(aftsTrack->InPOISelection()) |
| 9c1a9547 |
342 | } // end of if(pTrack->InRPSelection()) |
| 2aa4ebcd |
343 | |
| 344 | if(aftsTrack->InPOISelection()) |
| 9c1a9547 |
345 | { |
| 2aa4ebcd |
346 | dPhi = aftsTrack->Phi(); |
| 347 | dPt = aftsTrack->Pt(); |
| 348 | dEta = aftsTrack->Eta(); |
| 349 | |
| 350 | // p_n(m*n,0): |
| 351 | for(Int_t m=0;m<4;m++) |
| 352 | { |
| 353 | fReEBE[1][m][0]->Fill(dPt,dEta,TMath::Cos((m+1.)*n*dPhi),1.); |
| 354 | fImEBE[1][m][0]->Fill(dPt,dEta,TMath::Sin((m+1.)*n*dPhi),1.); |
| 355 | } |
| 9c1a9547 |
356 | |
| 2aa4ebcd |
357 | } // end of if(pTrack->InPOISelection() ) |
| 358 | |
| 359 | } else // to if(aftsTrack) |
| 360 | { |
| 361 | cout<<endl; |
| 362 | cout<<" WARNING: no particle! (i.e. aftsTrack is a NULL pointer in AFAWQC::Make().)"<<endl; |
| 363 | cout<<endl; |
| 364 | } |
| 9c1a9547 |
365 | } // end of for(Int_t i=0;i<nPrim;i++) |
| 2aa4ebcd |
366 | |
| 367 | // calculate the final expressions for S^{M}_{p,k}: |
| 9c1a9547 |
368 | for(Int_t p=0;p<8;p++) |
| 369 | { |
| 370 | for(Int_t k=0;k<9;k++) |
| 77515452 |
371 | { |
| 9c1a9547 |
372 | (*fSMpk)(p,k)=pow((*fSMpk)(p,k),p+1); |
| 373 | } |
| 374 | } |
| 77515452 |
375 | |
| 2aa4ebcd |
376 | // ***************************** |
| 377 | // **** CALL THE METHODS ******* |
| 378 | // ***************************** |
| 77515452 |
379 | |
| 2aa4ebcd |
380 | if(!fEvaluateNestedLoopsForIntFlow) |
| 9c1a9547 |
381 | { |
| 2aa4ebcd |
382 | // without weights: |
| 383 | if(nRP>1) this->CalculateCorrelationsForIntegratedFlow(); |
| 384 | if(nRP>0) this->CalculateCorrectionsForNonUniformAcceptanceForIntFlowCosTerms(); |
| 385 | if(nRP>0) this->CalculateCorrectionsForNonUniformAcceptanceForIntFlowSinTerms(); |
| 386 | if(nRP>3) this->CalculateQProductsForIntFlow(); |
| c2a42ea2 |
387 | if(nRP>1) this->CalculateSumAndProductOfEventWeights(); |
| 2aa4ebcd |
388 | // with weights: |
| 389 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) |
| c365fe76 |
390 | { |
| 2aa4ebcd |
391 | if(nRP>1) this->CalculateWeightedCorrelationsForIntegratedFlow(); |
| 392 | if(nRP>3) this->CalculateWeightedQProductsForIntFlow(); |
| 393 | } |
| 9c1a9547 |
394 | } |
| 77515452 |
395 | |
| 2aa4ebcd |
396 | if(!fEvaluateNestedLoopsForDiffFlow) |
| 9c1a9547 |
397 | { |
| 2aa4ebcd |
398 | // without weights: |
| 399 | if(nRP>1) this->CalculateCorrelationsForDifferentialFlow("RP"); |
| 400 | if(nRP>1) this->CalculateCorrelationsForDifferentialFlow("POI"); |
| 401 | |
| 402 | // with weights: |
| 403 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) |
| 77515452 |
404 | { |
| 2aa4ebcd |
405 | if(nRP>1) this->CalculateWeightedCorrelationsForDifferentialFlow("RP"); |
| 406 | if(nRP>1) this->CalculateWeightedCorrelationsForDifferentialFlow("POI"); |
| 9c1a9547 |
407 | } |
| 408 | } |
| 2aa4ebcd |
409 | |
| 410 | // ************************************************************** |
| 411 | // **** DEBUGGING AND CROSS-CHECKING (EVALUATE NESTED LOOPS) **** |
| 412 | // ************************************************************** |
| 413 | |
| 414 | if(fEvaluateNestedLoopsForIntFlow) |
| 415 | { |
| 416 | if(nPrim>0 && nPrim<15) // only for these multiplicities it is feasible to evaluate 8 nested loops in short time |
| 77515452 |
417 | { |
| 2aa4ebcd |
418 | // without weights: |
| 419 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) |
| 420 | { |
| 421 | this->CalculateCorrelationsForIntegratedFlow(); |
| 422 | this->CalculateCorrectionsForNonUniformAcceptanceForIntFlowCosTerms(); |
| 423 | this->CalculateCorrectionsForNonUniformAcceptanceForIntFlowSinTerms(); |
| 424 | } |
| 425 | // with weights: |
| 426 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) |
| 427 | { |
| 428 | this->CalculateWeightedCorrelationsForIntegratedFlow(); |
| 429 | } |
| 430 | |
| 431 | this->EvaluateNestedLoopsForIntegratedFlow(anEvent); |
| 77515452 |
432 | } |
| 9c1a9547 |
433 | } |
| 77515452 |
434 | |
| 2aa4ebcd |
435 | if(fEvaluateNestedLoopsForDiffFlow) |
| 9c1a9547 |
436 | { |
| 2aa4ebcd |
437 | if(nPrim>0 && nPrim<15) // only for these multiplicities it is feasible to evaluate 8 nested loops in short time |
| 438 | { |
| 439 | // without weights: |
| 440 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) |
| 441 | { |
| 442 | this->CalculateCorrelationsForDifferentialFlow("RP"); |
| 443 | this->CalculateCorrelationsForDifferentialFlow("POI"); |
| 444 | } |
| 445 | // with weights: |
| 446 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) |
| 447 | { |
| 448 | this->CalculateWeightedCorrelationsForDifferentialFlow("RP"); |
| 449 | this->CalculateWeightedCorrelationsForDifferentialFlow("POI"); |
| 450 | } |
| 451 | |
| 452 | this->EvaluateNestedLoopsForDifferentialFlow(anEvent); |
| 453 | } |
| 454 | } |
| 9c1a9547 |
455 | |
| 2aa4ebcd |
456 | // ******************************** |
| 457 | // **** RESET E-B-E QUANTITIES **** |
| 458 | // ******************************** |
| 9c1a9547 |
459 | |
| 2aa4ebcd |
460 | // integrated flow: |
| 9c1a9547 |
461 | fReQ->Zero(); |
| 462 | fImQ->Zero(); |
| 463 | fSMpk->Zero(); |
| 2aa4ebcd |
464 | for(Int_t pW=0;pW<1+(Int_t)(fUsePhiWeights||fUsePtWeights||fUseEtaWeights);pW++) |
| 465 | { |
| 466 | fQCorrelationsEBE[pW]->Reset(); |
| 467 | for(Int_t sc=0;sc<2;sc++) |
| 468 | { |
| 469 | fQCorrectionsEBE[pW][sc]->Reset(); |
| 470 | } |
| 471 | } |
| 472 | |
| 473 | // differential flow: |
| 474 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) |
| 475 | { |
| 476 | for(Int_t m=0;m<4;m++) // multiple of harmonic |
| 477 | { |
| 478 | for(Int_t k=0;k<9;k++) // power of weight |
| 479 | { |
| 480 | if(fReEBE[t][m][k]) fReEBE[t][m][k]->Reset(); |
| 481 | if(fImEBE[t][m][k]) fImEBE[t][m][k]->Reset(); |
| 482 | } |
| 483 | } |
| 484 | } |
| 485 | |
| 486 | for(Int_t t=0;t<3;t++) // type (0 = RP, 1 = POI, 2 = RP&&POI ) |
| 487 | { |
| 488 | for(Int_t k=0;k<9;k++) |
| 489 | { |
| 490 | if(fs[t][k]) fs[t][k]->Reset(); |
| 491 | } |
| 492 | } |
| 9c1a9547 |
493 | |
| 494 | } // end of AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent) |
| 495 | |
| 496 | |
| 497 | //================================================================================================================================ |
| 498 | |
| 499 | |
| 2aa4ebcd |
500 | void AliFlowAnalysisWithQCumulants::Finish() |
| 501 | { |
| 502 | // calculate the final results |
| 503 | |
| 504 | // a) acces the constants; |
| 505 | // b) access the flags; |
| 506 | // c) calculate the final results for integrated flow (without and with weights); |
| 507 | // d) store in AliFlowCommonHistResults and print the final results for integrated flow; |
| 508 | // e) calculate the final results for differential flow (without and with weights); |
| 509 | // f) print the final results for integrated flow obtained from differential flow (to be improved (terminology)); |
| 510 | // g) COMPARE RESULTS FROM NESTED LOOPS vs RESULTS FROM Q-VECTORS FOR INTEGRATED FLOW |
| 511 | |
| 512 | // ****************************** |
| 513 | // **** ACCESS THE CONSTANTS **** |
| 514 | // ****************************** |
| 515 | |
| 516 | this->AccessConstants(); |
| 517 | |
| 518 | // ************************** |
| 519 | // **** ACCESS THE FLAGS **** |
| 520 | // ************************** |
| 521 | |
| 522 | fUsePhiWeights = (Int_t)fUseParticleWeights->GetBinContent(1); |
| 523 | fUsePtWeights = (Int_t)fUseParticleWeights->GetBinContent(2); |
| 524 | fUseEtaWeights = (Int_t)fUseParticleWeights->GetBinContent(3); |
| 525 | fEvaluateNestedLoopsForIntFlow = (Int_t)fEvaluateNestedLoops->GetBinContent(1); |
| 526 | fEvaluateNestedLoopsForDiffFlow = (Int_t)fEvaluateNestedLoops->GetBinContent(2); |
| 527 | |
| 528 | // ********************************************************* |
| 529 | // **** CALCULATE THE FINAL RESULTS FOR INTEGRATED FLOW **** |
| 530 | // ********************************************************* |
| 531 | |
| 532 | // without weights: |
| 533 | this->FinalizeCorrelationsForIntFlow(kFALSE,"exact"); |
| 534 | this->CalculateFinalCorrectionsForNonUniformAcceptanceForCumulantsForIntFlow(kFALSE,"exact"); |
| 535 | this->CalculateCovariancesForIntFlow(kFALSE,"exact"); |
| 536 | this->CalculateCumulantsForIntFlow(kFALSE,"exact"); |
| 537 | this->ApplyCorrectionForNonUniformAcceptanceToCumulantsForIntFlow(kFALSE,"exact"); |
| 538 | this->CalculateIntFlow(kFALSE,"exact",kFALSE); // pW = 0, eW = 0, not corrected for non-uniform acceptance |
| 539 | this->CalculateIntFlow(kFALSE,"exact",kTRUE); // pW = 0, eW = 0, corrected for non-uniform acceptance |
| 540 | |
| 541 | // with weights: |
| 542 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) |
| 543 | { |
| 544 | this->FinalizeCorrelationsForIntFlow(kTRUE,"exact"); |
| 545 | // this->CalculateFinalCorrectionsForNonUniformAcceptanceForCumulantsForIntFlow(kTRUE,"exact"); |
| 546 | this->CalculateCovariancesForIntFlow(kTRUE,"exact"); |
| 547 | this->CalculateCumulantsForIntFlow(kTRUE,"exact"); |
| 548 | // this->ApplyCorrectionForNonUniformAcceptanceToCumulantsForIntFlow(kTRUE,"exact"); |
| 549 | this->CalculateIntFlow(kTRUE,"exact",kFALSE); // weighted and not corrected for non-uniform acceptance |
| 550 | // this->CalculateIntFlow(kTRUE,"exact",kTRUE); // weighted and corrected for non-uniform acceptance |
| 551 | } |
| 552 | |
| 553 | // *************************************************************** |
| 554 | // **** STORE AND PRINT THE FINAL RESULTS FOR INTEGRATED FLOW **** |
| 555 | // *************************************************************** |
| 556 | |
| 557 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) |
| 558 | { |
| 559 | this->FillCommonHistResultsIntFlow(kTRUE,"exact",kFALSE); // weighted and not corrected for non-uniform acceptance |
| 560 | // this->FillCommonHistResultsIntFlow(kTRUE,kTRUE); // weighted and corrected for non-uniform acceptance (to be improved (enabled)) |
| 561 | // this->PrintQuantifyingCorrectionsForNonUniformAcceptance(kTRUE,"exact"); // (to be improved (enabled)) |
| 562 | } else |
| 563 | { |
| 564 | this->FillCommonHistResultsIntFlow(kFALSE,"exact",kTRUE); // non-weighted and corrected for non-uniform acceptance |
| 565 | this->PrintQuantifyingCorrectionsForNonUniformAcceptance(kFALSE,"exact"); |
| 566 | } |
| 567 | |
| 568 | this->PrintFinalResultsForIntegratedFlow("NONAME"); // to be improved (name) |
| 569 | |
| 570 | // *********************************************************** |
| 571 | // **** CALCULATE THE FINAL RESULTS FOR DIFFERENTIAL FLOW **** |
| 572 | // *********************************************************** |
| 573 | |
| 574 | // without weights: |
| 575 | this->FinalizeCorrelationsForDiffFlow("RP",kFALSE,"exact"); |
| 576 | this->FinalizeCorrelationsForDiffFlow("POI",kFALSE,"exact"); |
| 577 | this->CalculateCumulantsForDiffFlow("RP",kFALSE,"exact"); |
| 578 | this->CalculateCumulantsForDiffFlow("POI",kFALSE,"exact"); |
| 579 | this->CalculateDiffFlow("RP",kFALSE,"exact"); |
| 580 | this->CalculateDiffFlow("POI",kFALSE,"exact"); |
| 581 | this->CalculateFinalResultsForRPandPOIIntegratedFlow("RP",kFALSE,"exact"); |
| 582 | this->CalculateFinalResultsForRPandPOIIntegratedFlow("POI",kFALSE,"exact"); |
| 583 | |
| 584 | // with weights: |
| 585 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) |
| 586 | { |
| 587 | this->FinalizeCorrelationsForDiffFlow("RP",kTRUE,"exact"); |
| 588 | this->FinalizeCorrelationsForDiffFlow("POI",kTRUE,"exact"); |
| 589 | this->CalculateCumulantsForDiffFlow("RP",kTRUE,"exact"); |
| 590 | this->CalculateCumulantsForDiffFlow("POI",kTRUE,"exact"); |
| 591 | this->CalculateDiffFlow("RP",kTRUE,"exact"); |
| 592 | this->CalculateDiffFlow("POI",kTRUE,"exact"); |
| 593 | this->CalculateFinalResultsForRPandPOIIntegratedFlow("RP",kTRUE,"exact"); |
| 594 | this->CalculateFinalResultsForRPandPOIIntegratedFlow("POI",kTRUE,"exact"); |
| 595 | } |
| 596 | |
| 597 | |
| 598 | //this->CalculateFinalCorrectionsForNonUniformAcceptanceForDifferentialFlow(kFALSE,"POI"); // to be improved (to calculate also when weights are used) |
| 599 | //this->CalculateFinalCorrectionsForNonUniformAcceptanceForDifferentialFlow(kFALSE,"RP"); // to be improved (to calculate also when weights are used) |
| 600 | |
| 601 | |
| 602 | // ***************************************************************** |
| 603 | // **** STORE AND PRINT THE FINAL RESULTS FOR DIFFERENTIAL FLOW **** |
| 604 | // ***************************************************************** |
| 605 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) |
| 606 | { |
| 607 | this->FillCommonHistResultsDiffFlow("RP",kTRUE,"exact",kFALSE); |
| 608 | this->FillCommonHistResultsDiffFlow("POI",kTRUE,"exact",kFALSE); |
| 609 | } else |
| 610 | { |
| 611 | this->FillCommonHistResultsDiffFlow("RP",kFALSE,"exact",kFALSE); |
| 612 | this->FillCommonHistResultsDiffFlow("POI",kFALSE,"exact",kFALSE); |
| 613 | } |
| 614 | |
| 615 | this->PrintFinalResultsForIntegratedFlow("RP"); |
| 616 | this->PrintFinalResultsForIntegratedFlow("POI"); |
| 617 | |
| 618 | // ***************************************************************************************** |
| 619 | // **** COMPARE RESULTS FROM NESTED LOOPS vs RESULTS FROM Q-VECTORS FOR INTEGRATED FLOW **** |
| 620 | // ***************************************************************************************** |
| 621 | |
| 622 | if(fEvaluateNestedLoopsForIntFlow) |
| 623 | { |
| 624 | this->CompareResultsFromNestedLoopsAndFromQVectorsForIntFlow(fUsePhiWeights||fUsePtWeights||fUseEtaWeights); |
| 625 | } |
| 626 | |
| 627 | if(fEvaluateNestedLoopsForDiffFlow) |
| 628 | { |
| 629 | this->CompareResultsFromNestedLoopsAndFromQVectorsForDiffFlow(fUsePhiWeights||fUsePtWeights||fUseEtaWeights); |
| 630 | } |
| 631 | |
| 632 | } // end of AliFlowAnalysisWithQCumulants::Finish() |
| 633 | |
| 634 | |
| 635 | //================================================================================================================================ |
| 636 | |
| 637 | |
| 638 | void AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNonUniformAcceptanceForIntFlowCosTerms() |
| 9c1a9547 |
639 | { |
| 2aa4ebcd |
640 | // calculate corrections for non-uniform acceptance of the detector for no-name integrated flow (cos terms) |
| 9c1a9547 |
641 | |
| 642 | // multiplicity: |
| 643 | Double_t dMult = (*fSMpk)(0,0); |
| 644 | |
| 645 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: |
| 646 | Double_t dReQ1n = (*fReQ)(0,0); |
| 647 | Double_t dReQ2n = (*fReQ)(1,0); |
| 2aa4ebcd |
648 | //Double_t dReQ3n = (*fReQ)(2,0); |
| 649 | //Double_t dReQ4n = (*fReQ)(3,0); |
| 9c1a9547 |
650 | Double_t dImQ1n = (*fImQ)(0,0); |
| 651 | Double_t dImQ2n = (*fImQ)(1,0); |
| 2aa4ebcd |
652 | //Double_t dImQ3n = (*fImQ)(2,0); |
| 653 | //Double_t dImQ4n = (*fImQ)(3,0); |
| 654 | |
| 655 | // ************************************************************* |
| 656 | // **** corrections for non-uniform acceptance (cos terms): **** |
| 657 | // ************************************************************* |
| 658 | // |
| 659 | // Remark 1: corrections for non-uniform acceptance (cos terms) calculated with non-weighted Q-vectors |
| 660 | // are stored in 1D profile fQCorrectionsCos. |
| 661 | // Remark 2: binning of fQCorrectionsCos is organized as follows: |
| 662 | // -------------------------------------------------------------------------------------------------------------------- |
| 663 | // 1st bin: <<cos(n*(phi1))>> = cosP1n |
| 664 | // 2nd bin: <<cos(n*(phi1+phi2))>> = cosP1nP1n |
| 665 | // 3rd bin: <<cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1n |
| 666 | // ... |
| 667 | // -------------------------------------------------------------------------------------------------------------------- |
| 3d824203 |
668 | |
| 2aa4ebcd |
669 | // 1-particle: |
| 670 | Double_t cosP1n = 0.; // <<cos(n*(phi1))>> |
| 671 | |
| 672 | if(dMult>0) |
| 673 | { |
| 674 | cosP1n = dReQ1n/dMult; |
| 675 | |
| 676 | // average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for single event: |
| 677 | fQCorrectionsEBE[0][1]->SetBinContent(1,cosP1n); |
| 678 | |
| 679 | // final average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for all events: |
| 680 | fQCorrections[0][0][1]->Fill(0.5,cosP1n,dMult); |
| 681 | } |
| 77515452 |
682 | |
| 2aa4ebcd |
683 | // 2-particle: |
| 684 | Double_t cosP1nP1n = 0.; // <<cos(n*(phi1+phi2))>> |
| 77515452 |
685 | |
| 2aa4ebcd |
686 | if(dMult>1) |
| 687 | { |
| 688 | cosP1nP1n = (pow(dReQ1n,2)-pow(dImQ1n,2)-dReQ2n)/(dMult*(dMult-1)); |
| 9c1a9547 |
689 | |
| 2aa4ebcd |
690 | // average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for single event: |
| 691 | fQCorrectionsEBE[0][1]->SetBinContent(2,cosP1nP1n); |
| 9c1a9547 |
692 | |
| 2aa4ebcd |
693 | // final average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for all events: |
| 694 | fQCorrections[0][0][1]->Fill(1.5,cosP1nP1n,dMult*(dMult-1)); |
| 695 | } |
| 77515452 |
696 | |
| 2aa4ebcd |
697 | // 3-particle: |
| 698 | Double_t cosP1nM1nM1n = 0.; // <<cos(n*(phi1-phi2-phi3))>> |
| 77515452 |
699 | |
| 2aa4ebcd |
700 | if(dMult>2) |
| 701 | { |
| 702 | cosP1nM1nM1n = (dReQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))-dReQ1n*dReQ2n-dImQ1n*dImQ2n-2.*(dMult-1)*dReQ1n) |
| 703 | / (dMult*(dMult-1)*(dMult-2)); |
| 704 | |
| 705 | // average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for single event: |
| 706 | fQCorrectionsEBE[0][1]->SetBinContent(3,cosP1nM1nM1n); |
| 707 | |
| 708 | // final average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for all events: |
| 709 | fQCorrections[0][0][1]->Fill(2.5,cosP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); |
| 710 | } |
| 77515452 |
711 | |
| 2aa4ebcd |
712 | } // end of AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNonUniformAcceptanceForIntFlowCosTerms() |
| 6f366058 |
713 | |
| 9c1a9547 |
714 | |
| 2aa4ebcd |
715 | //================================================================================================================================ |
| 9c1a9547 |
716 | |
| 9c1a9547 |
717 | |
| 2aa4ebcd |
718 | void AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNonUniformAcceptanceForIntFlowSinTerms() |
| 719 | { |
| 720 | // calculate corrections for non-uniform acceptance of the detector for no-name integrated flow (sin terms) |
| 9c1a9547 |
721 | |
| 2aa4ebcd |
722 | // multiplicity: |
| 723 | Double_t dMult = (*fSMpk)(0,0); |
| 9c1a9547 |
724 | |
| 2aa4ebcd |
725 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: |
| 726 | Double_t dReQ1n = (*fReQ)(0,0); |
| 727 | Double_t dReQ2n = (*fReQ)(1,0); |
| 728 | //Double_t dReQ3n = (*fReQ)(2,0); |
| 729 | //Double_t dReQ4n = (*fReQ)(3,0); |
| 730 | Double_t dImQ1n = (*fImQ)(0,0); |
| 731 | Double_t dImQ2n = (*fImQ)(1,0); |
| 732 | //Double_t dImQ3n = (*fImQ)(2,0); |
| 733 | //Double_t dImQ4n = (*fImQ)(3,0); |
| 734 | |
| 735 | // ************************************************************* |
| 736 | // **** corrections for non-uniform acceptance (sin terms): **** |
| 737 | // ************************************************************* |
| 738 | // |
| 739 | // Remark 1: corrections for non-uniform acceptance (sin terms) calculated with non-weighted Q-vectors |
| 740 | // are stored in 1D profile fQCorrectionsSin. |
| 741 | // Remark 2: binning of fQCorrectionsSin is organized as follows: |
| 742 | // -------------------------------------------------------------------------------------------------------------------- |
| 743 | // 1st bin: <<sin(n*(phi1))>> = sinP1n |
| 744 | // 2nd bin: <<sin(n*(phi1+phi2))>> = sinP1nP1n |
| 745 | // 3rd bin: <<sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1n |
| 746 | // ... |
| 747 | // -------------------------------------------------------------------------------------------------------------------- |
| 9c1a9547 |
748 | |
| 2aa4ebcd |
749 | // 1-particle: |
| 750 | Double_t sinP1n = 0.; // <sin(n*(phi1))> |
| 9c1a9547 |
751 | |
| 2aa4ebcd |
752 | if(dMult>0) |
| 753 | { |
| 754 | sinP1n = dImQ1n/dMult; |
| 755 | |
| 756 | // average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for single event: |
| 757 | fQCorrectionsEBE[0][0]->SetBinContent(1,sinP1n); |
| 758 | |
| 759 | // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: |
| 760 | fQCorrections[0][0][0]->Fill(0.5,sinP1n,dMult); |
| 761 | } |
| 9c1a9547 |
762 | |
| 2aa4ebcd |
763 | // 2-particle: |
| 764 | Double_t sinP1nP1n = 0.; // <<sin(n*(phi1+phi2))>> |
| 9c1a9547 |
765 | |
| 2aa4ebcd |
766 | if(dMult>1) |
| 767 | { |
| 768 | sinP1nP1n = (2.*dReQ1n*dImQ1n-dImQ2n)/(dMult*(dMult-1)); |
| 769 | |
| 770 | // average non-weighted 2-particle correction (sin terms) for non-uniform acceptance for single event: |
| 771 | fQCorrectionsEBE[0][0]->SetBinContent(2,sinP1nP1n); |
| 9c1a9547 |
772 | |
| 2aa4ebcd |
773 | // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: |
| 774 | fQCorrections[0][0][0]->Fill(1.5,sinP1nP1n,dMult*(dMult-1)); |
| 775 | } |
| 9c1a9547 |
776 | |
| 2aa4ebcd |
777 | // 3-particle: |
| 778 | Double_t sinP1nM1nM1n = 0.; // <<sin(n*(phi1-phi2-phi3))>> |
| ae733b3b |
779 | |
| 2aa4ebcd |
780 | if(dMult>2) |
| 781 | { |
| 782 | sinP1nM1nM1n = (-dImQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))+dReQ1n*dImQ2n-dImQ1n*dReQ2n+2.*(dMult-1)*dImQ1n) |
| 783 | / (dMult*(dMult-1)*(dMult-2)); |
| 784 | |
| 785 | // average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for single event: |
| 786 | fQCorrectionsEBE[0][0]->SetBinContent(3,sinP1nM1nM1n); |
| 9c1a9547 |
787 | |
| 2aa4ebcd |
788 | // final average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for all events: |
| 789 | fQCorrections[0][0][0]->Fill(2.5,sinP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); |
| 790 | } |
| 1dfa3c16 |
791 | |
| 2aa4ebcd |
792 | } // end of AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNonUniformAcceptanceForIntFlowSinTerms() |
| 793 | |
| 794 | |
| 795 | //================================================================================================================================ |
| 796 | |
| 797 | |
| 798 | void AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNonUniformAcceptanceForDifferentialFlowCosTerms(TString type) |
| 799 | { |
| 800 | // calculate corrections for non-uniform acceptance of the detector for differential flow (cos terms) |
| 801 | |
| 802 | // multiplicity: |
| 803 | //Double_t dMult = (*fSMpk)(0,0); |
| 804 | |
| 805 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: |
| 806 | //Double_t dReQ1n = (*fReQ)(0,0); |
| 807 | //Double_t dReQ2n = (*fReQ)(1,0); |
| 808 | //Double_t dReQ3n = (*fReQ)(2,0); |
| 809 | //Double_t dReQ4n = (*fReQ)(3,0); |
| 810 | //Double_t dImQ1n = (*fImQ)(0,0); |
| 811 | //Double_t dImQ2n = (*fImQ)(1,0); |
| 812 | //Double_t dImQ3n = (*fImQ)(2,0); |
| 813 | //Double_t dImQ4n = (*fImQ)(3,0); |
| 814 | |
| 815 | // looping over all (pt,eta) bins and calculating correlations needed for differential flow: |
| 816 | for(Int_t p=1;p<=fnBinsPt;p++) |
| 817 | { |
| 818 | for(Int_t e=1;e<=fnBinsEta;e++) |
| 819 | { |
| 820 | // real and imaginary parts of q_n (non-weighted Q-vector evaluated only for POIs in harmonic n for each (pt,eta) bin): |
| 821 | //Double_t dReqnPtEta = 0.; |
| 822 | //Double_t dImqnPtEta = 0.; |
| 823 | |
| 824 | // number of POIs in each (pt,eta) bin: |
| 825 | Double_t dmPtEta = 0.; |
| 826 | |
| 827 | // real and imaginary parts of q''_{n}, q''_{2n}, ... |
| 828 | // (non-weighted Q-vectors evaluated only for particles which are both RPs and POIs in harmonic n, 2n, ... for each (pt,eta) bin): |
| 829 | //Double_t dReqPrimePrime1nPtEta = 0.; |
| 830 | //Double_t dImqPrimePrime1nPtEta = 0.; |
| 831 | //Double_t dReqPrimePrime2nPtEta = 0.; |
| 832 | //Double_t dImqPrimePrime2nPtEta = 0.; |
| 833 | |
| 834 | // number of particles which are both RPs and POIs in each (pt,eta) bin: |
| 835 | //Double_t dmPrimePrimePtEta = 0.; |
| 836 | |
| 837 | if(type == "POI") |
| 838 | { |
| 839 | // q''_{n}, q''_{2n}: |
| 840 | //............................................................................................... |
| 841 | //dReqPrimePrime1nPtEta = fReqPrimePrime1nPtEta->GetBinContent(fReqPrimePrime1nPtEta->GetBin(p,e)); |
| 842 | //dImqPrimePrime1nPtEta = fImqPrimePrime1nPtEta->GetBinContent(fImqPrimePrime1nPtEta->GetBin(p,e)); |
| 843 | //dReqPrimePrime2nPtEta = fReqPrimePrime2nPtEta->GetBinContent(fReqPrimePrime2nPtEta->GetBin(p,e)); |
| 844 | //dImqPrimePrime2nPtEta = fImqPrimePrime2nPtEta->GetBinContent(fImqPrimePrime2nPtEta->GetBin(p,e)); |
| 845 | //............................................................................................... |
| 846 | |
| 847 | // m'': |
| 848 | //dmPrimePrimePtEta = fmPrimePrimePtEta->GetBinContent(fmPrimePrimePtEta->GetBin(p,e)); |
| 849 | |
| 850 | // q'_{n}: |
| 851 | //dReqnPtEta = fReqnPtEta->GetBinContent(fReqnPtEta->GetBin(p,e)); |
| 852 | //dImqnPtEta = fImqnPtEta->GetBinContent(fImqnPtEta->GetBin(p,e)); |
| 853 | //dmPtEta = fmPtEta->GetBinContent(fmPtEta->GetBin(p,e)); |
| 854 | } |
| 855 | else if(type == "RP") |
| 856 | { |
| 857 | // q_RP{n}, q_RP{2n}: |
| 858 | //............................................................................................... |
| 859 | //dReqPrimePrime1nPtEta = fReqRP1nPtEta->GetBinContent(fReqRP1nPtEta->GetBin(p,e)); |
| 860 | //dImqPrimePrime1nPtEta = fImqRP1nPtEta->GetBinContent(fImqRP1nPtEta->GetBin(p,e)); |
| 861 | //dReqPrimePrime2nPtEta = fReqRP2nPtEta->GetBinContent(fReqRP2nPtEta->GetBin(p,e)); |
| 862 | //dImqPrimePrime2nPtEta = fImqRP2nPtEta->GetBinContent(fImqRP2nPtEta->GetBin(p,e)); |
| 863 | //............................................................................................... |
| 864 | |
| 865 | // m'': |
| 866 | //dmPrimePrimePtEta = fmRPPtEta->GetBinContent(fmRPPtEta->GetBin(p,e)); |
| 867 | |
| 868 | //dReqnPtEta = fReqRP1nPtEta->GetBinContent(fReqRP1nPtEta->GetBin(p,e)); // not a bug ;-) |
| 869 | //dImqnPtEta = fImqRP1nPtEta->GetBinContent(fImqRP1nPtEta->GetBin(p,e)); // not a bug ;-) |
| 870 | //dmPtEta = fmRPPtEta->GetBinContent(fmRPPtEta->GetBin(p,e)); // not a bug ;-) |
| 871 | } |
| 872 | |
| 873 | // 1'-p correction: |
| 874 | //Double_t oneCosP1nPsiPtEta = 0.; |
| 875 | |
| 876 | if(dmPtEta) |
| 877 | { |
| 878 | //oneCosP1nPsiPtEta = dReqnPtEta/dmPtEta; |
| 879 | |
| 880 | // fill the 2D profile to get the average 1'-p correction for each (pt, eta) bin: |
| 881 | if(type == "POI") |
| 882 | { |
| 883 | //fCorrectionsCosP1nPsiPtEtaPOI->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth, |
| 884 | // oneCosP1nPsiPtEta,dmPtEta); |
| 885 | } |
| 886 | else if(type == "RP") |
| 887 | { |
| 888 | //fCorrectionsCosP1nPsiPtEtaRP->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth, |
| 889 | // oneCosP1nPsiPtEta,dmPtEta); |
| 890 | } |
| 891 | } // end of if(dmPtEta*dMult-dmPrimePrimePtEta) |
| 892 | |
| 893 | /* |
| 894 | |
| 895 | // 4'-particle correlation: |
| 896 | Double_t four1n1n1n1nPtEta = 0.; |
| 897 | if((dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 898 | + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression) |
| 899 | { |
| 900 | four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(dReqnPtEta*dReQ1n+dImqnPtEta*dImQ1n) |
| 901 | - dReqPrimePrime2nPtEta*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) |
| 902 | - 2.*dImqPrimePrime2nPtEta*dReQ1n*dImQ1n |
| 903 | - dReqnPtEta*(dReQ1n*dReQ2n+dImQ1n*dImQ2n) |
| 904 | + dImqnPtEta*(dImQ1n*dReQ2n-dReQ1n*dImQ2n) |
| 905 | - 2.*dMult*(dReqnPtEta*dReQ1n+dImqnPtEta*dImQ1n) |
| 906 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*dmPrimePrimePtEta |
| 907 | + 6.*(dReqPrimePrime1nPtEta*dReQ1n+dImqPrimePrime1nPtEta*dImQ1n) |
| 908 | + 1.*(dReqPrimePrime2nPtEta*dReQ2n+dImqPrimePrime2nPtEta*dImQ2n) |
| 909 | + 2.*(dReqnPtEta*dReQ1n+dImqnPtEta*dImQ1n) |
| 910 | + 2.*dmPrimePrimePtEta*dMult |
| 911 | - 6.*dmPrimePrimePtEta) |
| 912 | / ((dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 913 | + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 9c1a9547 |
914 | |
| 2aa4ebcd |
915 | // fill the 2D profile to get the average correlation for each (pt, eta) bin: |
| 916 | if(type == "POI") |
| 917 | { |
| 918 | f4pPtEtaPOI->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta, |
| 919 | (dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 920 | + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 921 | } |
| 922 | else if(type == "RP") |
| 923 | { |
| 924 | f4pPtEtaRP->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta, |
| 925 | (dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 926 | + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 927 | } |
| 928 | } // end of if((dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 929 | // +dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 930 | |
| 931 | */ |
| 932 | |
| 933 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) |
| 934 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
| 935 | |
| 936 | } // end of AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNonUniformAcceptanceForDifferentialFlowCosTerms(TString type) |
| 937 | |
| 938 | |
| 939 | //================================================================================================================================ |
| 940 | |
| 941 | |
| 942 | void AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNonUniformAcceptanceForDifferentialFlowSinTerms(TString type) |
| 943 | { |
| 944 | // calculate corrections for non-uniform acceptance of the detector for differential flow (sin terms) |
| 945 | |
| 946 | // multiplicity: |
| 947 | //Double_t dMult = (*fSMpk)(0,0); |
| 948 | |
| 949 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: |
| 950 | //Double_t dReQ1n = (*fReQ)(0,0); |
| 951 | //Double_t dReQ2n = (*fReQ)(1,0); |
| 952 | //Double_t dReQ3n = (*fReQ)(2,0); |
| 953 | //Double_t dReQ4n = (*fReQ)(3,0); |
| 954 | //Double_t dImQ1n = (*fImQ)(0,0); |
| 955 | //Double_t dImQ2n = (*fImQ)(1,0); |
| 956 | //Double_t dImQ3n = (*fImQ)(2,0); |
| 957 | //Double_t dImQ4n = (*fImQ)(3,0); |
| 958 | |
| 959 | // looping over all (pt,eta) bins and calculating correlations needed for differential flow: |
| 960 | for(Int_t p=1;p<=fnBinsPt;p++) |
| 961 | { |
| 962 | for(Int_t e=1;e<=fnBinsEta;e++) |
| 963 | { |
| 964 | // real and imaginary parts of q_n (non-weighted Q-vector evaluated only for POIs in harmonic n for each (pt,eta) bin): |
| 965 | //Double_t dReqnPtEta = 0.; |
| 966 | //Double_t dImqnPtEta = 0.; |
| 967 | |
| 968 | // number of POIs in each (pt,eta) bin: |
| 969 | Double_t dmPtEta = 0.; |
| 970 | |
| 971 | // real and imaginary parts of q''_{n}, q''_{2n}, ... |
| 972 | // (non-weighted Q-vectors evaluated only for particles which are both RPs and POIs in harmonic n, 2n, ... for each (pt,eta) bin): |
| 973 | //Double_t dReqPrimePrime1nPtEta = 0.; |
| 974 | //Double_t dImqPrimePrime1nPtEta = 0.; |
| 975 | //Double_t dReqPrimePrime2nPtEta = 0.; |
| 976 | //Double_t dImqPrimePrime2nPtEta = 0.; |
| 977 | |
| 978 | // number of particles which are both RPs and POIs in each (pt,eta) bin: |
| 979 | //Double_t dmPrimePrimePtEta = 0.; |
| 980 | |
| 981 | if(type == "POI") |
| 982 | { |
| 983 | // q''_{n}, q''_{2n}: |
| 984 | //............................................................................................... |
| 985 | //dReqPrimePrime1nPtEta = fReqPrimePrime1nPtEta->GetBinContent(fReqPrimePrime1nPtEta->GetBin(p,e)); |
| 986 | //dImqPrimePrime1nPtEta = fImqPrimePrime1nPtEta->GetBinContent(fImqPrimePrime1nPtEta->GetBin(p,e)); |
| 987 | //dReqPrimePrime2nPtEta = fReqPrimePrime2nPtEta->GetBinContent(fReqPrimePrime2nPtEta->GetBin(p,e)); |
| 988 | //dImqPrimePrime2nPtEta = fImqPrimePrime2nPtEta->GetBinContent(fImqPrimePrime2nPtEta->GetBin(p,e)); |
| 989 | //............................................................................................... |
| 990 | |
| 991 | // m'': |
| 992 | //dmPrimePrimePtEta = fmPrimePrimePtEta->GetBinContent(fmPrimePrimePtEta->GetBin(p,e)); |
| 993 | |
| 994 | // q'_{n}: |
| 995 | //dReqnPtEta = fReqnPtEta->GetBinContent(fReqnPtEta->GetBin(p,e)); |
| 996 | //dImqnPtEta = fImqnPtEta->GetBinContent(fImqnPtEta->GetBin(p,e)); |
| 997 | //dmPtEta = fmPtEta->GetBinContent(fmPtEta->GetBin(p,e)); |
| 998 | } |
| 999 | else if(type == "RP") |
| 1000 | { |
| 1001 | // q_RP{n}, q_RP{2n}: |
| 1002 | //............................................................................................... |
| 1003 | //dReqPrimePrime1nPtEta = fReqRP1nPtEta->GetBinContent(fReqRP1nPtEta->GetBin(p,e)); |
| 1004 | //dImqPrimePrime1nPtEta = fImqRP1nPtEta->GetBinContent(fImqRP1nPtEta->GetBin(p,e)); |
| 1005 | //dReqPrimePrime2nPtEta = fReqRP2nPtEta->GetBinContent(fReqRP2nPtEta->GetBin(p,e)); |
| 1006 | //dImqPrimePrime2nPtEta = fImqRP2nPtEta->GetBinContent(fImqRP2nPtEta->GetBin(p,e)); |
| 1007 | //............................................................................................... |
| 1008 | |
| 1009 | // m'': |
| 1010 | //dmPrimePrimePtEta = fmRPPtEta->GetBinContent(fmRPPtEta->GetBin(p,e)); |
| 1011 | |
| 1012 | //dReqnPtEta = fReqRP1nPtEta->GetBinContent(fReqRP1nPtEta->GetBin(p,e)); // not a bug ;-) |
| 1013 | //dImqnPtEta = fImqRP1nPtEta->GetBinContent(fImqRP1nPtEta->GetBin(p,e)); // not a bug ;-) |
| 1014 | //dmPtEta = fmRPPtEta->GetBinContent(fmRPPtEta->GetBin(p,e)); // not a bug ;-) |
| 1015 | } |
| 1016 | |
| 1017 | // 1'-p correction: |
| 1018 | //Double_t oneSinP1nPsiPtEta = 0.; |
| 1019 | |
| 1020 | if(dmPtEta) |
| 1021 | { |
| 1022 | //oneSinP1nPsiPtEta = dImqnPtEta/dmPtEta; |
| 1023 | |
| 1024 | // fill the 2D profile to get the average 1'-p correction for each (pt, eta) bin: |
| 1025 | if(type == "POI") |
| 1026 | { |
| 1027 | //fCorrectionsSinP1nPsiPtEtaPOI->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth, |
| 1028 | // oneSinP1nPsiPtEta,dmPtEta); |
| 1029 | } |
| 1030 | else if(type == "RP") |
| 1031 | { |
| 1032 | //fCorrectionsSinP1nPsiPtEtaRP->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth, |
| 1033 | // oneSinP1nPsiPtEta,dmPtEta); |
| 1034 | } |
| 1035 | } // end of if(dmPtEta*dMult-dmPrimePrimePtEta) |
| 1036 | |
| 1037 | /* |
| 1038 | |
| 1039 | // 4'-particle correlation: |
| 1040 | Double_t four1n1n1n1nPtEta = 0.; |
| 1041 | if((dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 1042 | + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression) |
| 1043 | { |
| 1044 | four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(dReqnPtEta*dReQ1n+dImqnPtEta*dImQ1n) |
| 1045 | - dReqPrimePrime2nPtEta*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) |
| 1046 | - 2.*dImqPrimePrime2nPtEta*dReQ1n*dImQ1n |
| 1047 | - dReqnPtEta*(dReQ1n*dReQ2n+dImQ1n*dImQ2n) |
| 1048 | + dImqnPtEta*(dImQ1n*dReQ2n-dReQ1n*dImQ2n) |
| 1049 | - 2.*dMult*(dReqnPtEta*dReQ1n+dImqnPtEta*dImQ1n) |
| 1050 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*dmPrimePrimePtEta |
| 1051 | + 6.*(dReqPrimePrime1nPtEta*dReQ1n+dImqPrimePrime1nPtEta*dImQ1n) |
| 1052 | + 1.*(dReqPrimePrime2nPtEta*dReQ2n+dImqPrimePrime2nPtEta*dImQ2n) |
| 1053 | + 2.*(dReqnPtEta*dReQ1n+dImqnPtEta*dImQ1n) |
| 1054 | + 2.*dmPrimePrimePtEta*dMult |
| 1055 | - 6.*dmPrimePrimePtEta) |
| 1056 | / ((dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 1057 | + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 1058 | |
| 1059 | // fill the 2D profile to get the average correlation for each (pt, eta) bin: |
| 1060 | if(type == "POI") |
| 1061 | { |
| 1062 | f4pPtEtaPOI->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta, |
| 1063 | (dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 1064 | + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 1065 | } |
| 1066 | else if(type == "RP") |
| 1067 | { |
| 1068 | f4pPtEtaRP->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta, |
| 1069 | (dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 1070 | + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 1071 | } |
| 1072 | } // end of if((dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.) |
| 1073 | // +dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 1074 | |
| 1075 | */ |
| 1076 | |
| 1077 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) |
| 1078 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
| 1079 | |
| 1080 | } // end of AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNonUniformAcceptanceForDifferentialFlowSinTerms(TString type) |
| 1081 | |
| 1082 | |
| 1083 | //================================================================================================================================ |
| 1084 | |
| 1085 | |
| 1086 | void AliFlowAnalysisWithQCumulants::EvaluateNestedLoopsForDifferentialFlow(AliFlowEventSimple* anEvent) |
| 1087 | { |
| 1088 | // evaluate the nested loops relevant for differential flow (needed for cross-checking the results) |
| 1dfa3c16 |
1089 | |
| 2aa4ebcd |
1090 | Int_t nPrim = anEvent->NumberOfTracks(); |
| 1091 | AliFlowTrackSimple *aftsTrack = NULL; |
| ae733b3b |
1092 | |
| 2aa4ebcd |
1093 | Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; |
| 1094 | Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1.;// wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; |
| ae733b3b |
1095 | |
| 2aa4ebcd |
1096 | Int_t n = fHarmonic; // to be improved |
| ae733b3b |
1097 | |
| 2aa4ebcd |
1098 | // ******************************************** |
| 1099 | // **** NESTED LOOPS FOR DIFFERENTIAL FLOW **** |
| 1100 | // ******************************************** |
| 1dfa3c16 |
1101 | |
| 2aa4ebcd |
1102 | // Remark 1: (pt,eta) bin in which the cross-checking will be performed is given by 1.1 < pt < 1.2 GeV and -0.55 < eta < -0.525 |
| 1103 | |
| 1104 | // Remark 2: multi-particle correlations needed for diff. flow calculated with nested loops without weights are stored in 1D profile |
| 1105 | // fDirectCorrelationsDiffFlow |
| 1106 | |
| 1107 | // Remark 3: multi-particle correlations needed for diff. flow calculated with nested loops with weights are stored in 1D profile |
| 1108 | // fDirectCorrelationsDiffFlowW; |
| 1109 | |
| 1110 | // Remark 4: binning of fDirectCorrelationsDiffFlow is organized as follows: |
| 1111 | //...................................................................................... |
| 1112 | // ---- bins 1-20: 2-particle correlations ---- |
| 1113 | // 1st bin: <2'>_{1n|1n} = twoPrime1n1n = <cos(n*(psi1-phi2))> |
| 1114 | // ---- bins 21-40: 3-particle correlations ---- |
| 1115 | // ---- bins 41-60: 4-particle correlations ---- |
| 1116 | // 41st bin: <4'>_{1n,1n|1n,1n} = fourPrime1n1n1n1n = <cos(n*(psi1+phi2-phi3-phi4))> |
| 1117 | //...................................................................................... |
| 1118 | |
| 1119 | // Remark 5: binning of fDirectCorrelationsDiffFlow is organized as follows: |
| 1120 | //...................................................................................... |
| 1121 | // ---- bins 1-20: 2-particle correlations ---- |
| 1122 | // 1st bin: twoPrime1n1nW0W1 = <w2 cos(n*(psi1-phi2))> |
| 1123 | // ---- bins 21-40: 3-particle correlations ---- |
| 1124 | // ---- bins 41-60: 4-particle correlations ---- |
| 1125 | // 41st bin: fourPrime1n1n1n1nW0W1W1W1 = <w2 w3 w4 cos(n*(psi1+phi2-phi3-phi4))> |
| 1126 | //...................................................................................... |
| 1127 | |
| 1128 | // 2'-particle: |
| 1129 | for(Int_t i1=0;i1<nPrim;i1++) |
| 9c1a9547 |
1130 | { |
| 2aa4ebcd |
1131 | aftsTrack=anEvent->GetTrack(i1); |
| 1132 | // POI condition (first particle in the correlator must be POI): |
| 1133 | if(!((aftsTrack->Pt()>=1.1 && aftsTrack->Pt()<1.2) && (aftsTrack->Eta()>=-0.55 && aftsTrack->Eta()<-0.525) && (aftsTrack->InPOISelection())))continue; |
| 1134 | psi1=aftsTrack->Phi(); |
| 1135 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(psi1*fnBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
1136 | |
| 2aa4ebcd |
1137 | fDirectCorrectionsDiffFlowCos->Fill(0.,cos(1.*n*(psi1)),1.); // <<cos(n*(psi1))>> |
| 1138 | fDirectCorrectionsDiffFlowSin->Fill(0.,sin(1.*n*(psi1)),1.); // <<sin(n*(psi1))>> |
| 9c1a9547 |
1139 | |
| 2aa4ebcd |
1140 | for(Int_t i2=0;i2<nPrim;i2++) |
| 1141 | { |
| 1142 | if(i2==i1)continue; |
| 1143 | aftsTrack=anEvent->GetTrack(i2); |
| 1144 | // RP condition (!(first) particle in the correlator must be RP): |
| 1145 | if(!(aftsTrack->InRPSelection()))continue; |
| 1146 | phi2=aftsTrack->Phi(); |
| 1147 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); |
| 1148 | |
| 1149 | // non-weighted: |
| 1150 | //..................................................................................... |
| 1151 | fDirectCorrelationsDiffFlow->Fill(0.,cos(1.*n*(psi1-phi2)),1.); // <cos(n*(psi1-phi2))> |
| 1152 | //..................................................................................... |
| 1153 | // weighted: |
| 1154 | //..................................................................................... |
| 1155 | if(fUsePhiWeights) fDirectCorrelationsDiffFlowW->Fill(0.,cos(1.*n*(psi1-phi2)),wPhi2); // <w2 cos(n*(psi1-phi2))> |
| 1156 | //..................................................................................... |
| 1157 | |
| 1158 | //fDirectCorrelations->Fill(103.,cos(1.*n*(phi1-phi2)),pow(wPhi1,2)*wPhi2);//<2'>_{n,n} |
| 1159 | //fDirectCorrelations->Fill(104.,cos(2.*n*(phi1-phi2)),wPhi1*pow(wPhi2,2));//<2'>_{n,n} |
| 1160 | //fDirectCorrelations->Fill(105.,cos(1.*n*(phi1-phi2)),pow(wPhi2,3));//<2'>_{n,n} |
| 1161 | //fDirectCorrelations->Fill(41.,cos(2.*n*(phi1-phi2)),1);//<2'>_{2n,2n} |
| 1162 | //fDirectCorrelations->Fill(42.,cos(3.*n*(phi1-phi2)),1);//<2'>_{3n,3n} |
| 1163 | //fDirectCorrelations->Fill(43.,cos(4.*n*(phi1-phi2)),1);//<2'>_{4n,4n} |
| 1164 | |
| 1165 | }//end of for(Int_t i2=0;i2<nPrim;i2++) |
| 1166 | }//end of for(Int_t i1=0;i1<nPrim;i1++) |
| 4057ba99 |
1167 | |
| 2aa4ebcd |
1168 | |
| 1169 | |
| 1170 | /* |
| 1171 | |
| 1172 | //<3'>_{2n|n,n} |
| 1173 | for(Int_t i1=0;i1<nPrim;i1++) |
| 9c1a9547 |
1174 | { |
| 2aa4ebcd |
1175 | aftsTrack=anEvent->GetTrack(i1); |
| 1176 | if(!((aftsTrack->Pt()>=0.5&&aftsTrack->Pt()<0.6)&&(aftsTrack->InPOISelection())))continue;//POI condition |
| 1177 | psi1=aftsTrack->Phi(); |
| 1178 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(psi1*fnBinsPhi/TMath::TwoPi()))); |
| 1179 | for(Int_t i2=0;i2<nPrim;i2++) |
| 1180 | { |
| 1181 | if(i2==i1)continue; |
| 1182 | aftsTrack=anEvent->GetTrack(i2); |
| 1183 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1184 | phi2=aftsTrack->Phi(); |
| 1185 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); |
| 1186 | for(Int_t i3=0;i3<nPrim;i3++) |
| 1187 | { |
| 1188 | if(i3==i1||i3==i2)continue; |
| 1189 | aftsTrack=anEvent->GetTrack(i3); |
| 1190 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1191 | phi3=aftsTrack->Phi(); |
| 1192 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); |
| 1193 | //fill the fDirectCorrelations: |
| 1194 | |
| 1195 | // 2-p |
| 1196 | //fDirectCorrelations->Fill(101.,cos(n*(phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 cos(n(phi2-phi3))> |
| 1197 | //fDirectCorrelations->Fill(102.,cos(n*(phi1-phi3)),pow(wPhi2,2.)*wPhi3); // <w2^2 w3 cos(n(psi1-phi2))> |
| 1198 | |
| 1199 | // 3-p |
| 1200 | //fDirectCorrelations->Fill(110.,cos(n*(2.*phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 cos(n(2psi1-phi2-phi3))> |
| 1201 | //fDirectCorrelations->Fill(111.,cos(n*(phi1+phi2-2.*phi3)),wPhi2*pow(wPhi3,2.)); // <w2 w3^2 cos(n(psi1+phi2-2.*phi3))> |
| 1202 | |
| 1203 | |
| 1204 | //fDirectCorrelations->Fill(46.,cos(n*(phi1+phi2-2.*phi3)),1);//<3'>_{n,n|2n} |
| 1205 | }//end of for(Int_t i3=0;i3<nPrim;i3++) |
| 1206 | }//end of for(Int_t i2=0;i2<nPrim;i2++) |
| 1207 | }//end of for(Int_t i1=0;i1<nPrim;i1++) |
| 1208 | */ |
| 1209 | |
| 1210 | // 4'-particle: |
| 1211 | for(Int_t i1=0;i1<nPrim;i1++) |
| 1212 | { |
| 1213 | aftsTrack=anEvent->GetTrack(i1); |
| 1214 | // POI condition (first particle in the correlator must be POI): |
| 1215 | if(!((aftsTrack->Pt()>=1.1 && aftsTrack->Pt()<1.2) && (aftsTrack->Eta()>=-0.55 && aftsTrack->Eta()<-0.525) && (aftsTrack->InPOISelection())))continue; |
| 1216 | psi1=aftsTrack->Phi(); |
| 1217 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(psi1*fnBinsPhi/TMath::TwoPi()))); |
| 1218 | for(Int_t i2=0;i2<nPrim;i2++) |
| 1219 | { |
| 1220 | if(i2==i1)continue; |
| 1221 | aftsTrack=anEvent->GetTrack(i2); |
| 1222 | // RP condition (!(first) particle in the correlator must be RP): |
| 1223 | if(!(aftsTrack->InRPSelection()))continue; |
| 1224 | phi2=aftsTrack->Phi(); |
| 1225 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); |
| 1226 | for(Int_t i3=0;i3<nPrim;i3++) |
| 1227 | { |
| 1228 | if(i3==i1||i3==i2)continue; |
| 1229 | aftsTrack=anEvent->GetTrack(i3); |
| 1230 | // RP condition (!(first) particle in the correlator must be RP): |
| 1231 | if(!(aftsTrack->InRPSelection()))continue; |
| 1232 | phi3=aftsTrack->Phi(); |
| 1233 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); |
| 1234 | for(Int_t i4=0;i4<nPrim;i4++) |
| 1235 | { |
| 1236 | if(i4==i1||i4==i2||i4==i3)continue; |
| 1237 | aftsTrack=anEvent->GetTrack(i4); |
| 1238 | // RP condition (!(first) particle in the correlator must be RP): |
| 1239 | if(!(aftsTrack->InRPSelection()))continue; |
| 1240 | phi4=aftsTrack->Phi(); |
| 1241 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); |
| 1242 | |
| 1243 | // non-weighted: |
| 1244 | //......................................................................................................................... |
| 1245 | fDirectCorrelationsDiffFlow->Fill(40.,cos(n*(psi1+phi2-phi3-phi4)),1.); // <cos(n(psi1+phi1-phi2-phi3))> |
| 1246 | //......................................................................................................................... |
| 1247 | // weighted: |
| 1248 | //............................................................................................................................... |
| 1249 | if(fUsePhiWeights) fDirectCorrelationsDiffFlowW->Fill(40.,cos(n*(psi1+phi2-phi3-phi4)),wPhi2*wPhi3*wPhi4); // <w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))> |
| 1250 | //............................................................................................................................... |
| 1251 | |
| 1252 | }//end of for(Int_t i4=0;i4<nPrim;i4++) |
| 1253 | }//end of for(Int_t i3=0;i3<nPrim;i3++) |
| 1254 | }//end of for(Int_t i2=0;i2<nPrim;i2++) |
| 1255 | }//end of for(Int_t i1=0;i1<nPrim;i1++) |
| 1256 | |
| 1257 | /* |
| 1258 | //<5'>_{2n,n|n,n,n} |
| 1259 | for(Int_t i1=0;i1<nPrim;i1++) |
| 1260 | { |
| 1261 | aftsTrack=anEvent->GetTrack(i1); |
| 1262 | if(!((aftsTrack->Pt()>=0.5&&aftsTrack->Pt()<0.6)&&(aftsTrack->InPOISelection())))continue;//POI condition |
| 1263 | phi1=aftsTrack->Phi(); |
| 1264 | for(Int_t i2=0;i2<nPrim;i2++) |
| 1265 | { |
| 1266 | if(i2==i1)continue; |
| 1267 | aftsTrack=anEvent->GetTrack(i2); |
| 1268 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1269 | phi2=aftsTrack->Phi(); |
| 1270 | for(Int_t i3=0;i3<nPrim;i3++) |
| 1271 | { |
| 1272 | if(i3==i1||i3==i2)continue; |
| 1273 | aftsTrack=anEvent->GetTrack(i3); |
| 1274 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1275 | phi3=aftsTrack->Phi(); |
| 1276 | for(Int_t i4=0;i4<nPrim;i4++) |
| 1277 | { |
| 1278 | if(i4==i1||i4==i2||i4==i3)continue; |
| 1279 | aftsTrack=anEvent->GetTrack(i4); |
| 1280 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1281 | phi4=aftsTrack->Phi();// |
| 1282 | for(Int_t i5=0;i5<nPrim;i5++) |
| 1283 | { |
| 1284 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; |
| 1285 | aftsTrack=anEvent->GetTrack(i5); |
| 1286 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1287 | phi5=aftsTrack->Phi(); |
| 1288 | //fill the fDirectCorrelations:if(bNestedLoops) |
| 1289 | //fDirectCorrelations->Fill(55.,cos(2.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5),1);//<5'>_{2n,n|n,n,n} |
| 1290 | }//end of for(Int_t i5=0;i5<nPrim;i5++) |
| 1291 | }//end of for(Int_t i4=0;i4<nPrim;i4++) |
| 1292 | }//end of for(Int_t i3=0;i3<nPrim;i3++) |
| 1293 | }//end of for(Int_t i2=0;i2<nPrim;i2++) |
| 1294 | }//end of for(Int_t i1=0;i1<nPrim;i1++) |
| 1295 | |
| 9c1a9547 |
1296 | |
| 9c1a9547 |
1297 | |
| 2aa4ebcd |
1298 | */ |
| 1299 | /* |
| ae733b3b |
1300 | |
| 2aa4ebcd |
1301 | |
| 1302 | |
| 1303 | //<6'>_{n,n,n|n,n,n} |
| 1304 | for(Int_t i1=0;i1<nPrim;i1++) |
| 9c1a9547 |
1305 | { |
| 2aa4ebcd |
1306 | aftsTrack=anEvent->GetTrack(i1); |
| 1307 | if(!((aftsTrack->Pt()>=0.5&&aftsTrack->Pt()<0.6)&&(aftsTrack->InPOISelection())))continue;//POI condition |
| 1308 | phi1=aftsTrack->Phi(); |
| 1309 | for(Int_t i2=0;i2<nPrim;i2++) |
| 1310 | { |
| 1311 | if(i2==i1)continue; |
| 1312 | aftsTrack=anEvent->GetTrack(i2); |
| 1313 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1314 | phi2=aftsTrack->Phi(); |
| 1315 | for(Int_t i3=0;i3<nPrim;i3++) |
| 1316 | { |
| 1317 | if(i3==i1||i3==i2)continue; |
| 1318 | aftsTrack=anEvent->GetTrack(i3); |
| 1319 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1320 | phi3=aftsTrack->Phi(); |
| 1321 | for(Int_t i4=0;i4<nPrim;i4++) |
| 1322 | { |
| 1323 | if(i4==i1||i4==i2||i4==i3)continue; |
| 1324 | aftsTrack=anEvent->GetTrack(i4); |
| 1325 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1326 | phi4=aftsTrack->Phi(); |
| 1327 | for(Int_t i5=0;i5<nPrim;i5++) |
| 1328 | { |
| 1329 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; |
| 1330 | aftsTrack=anEvent->GetTrack(i5); |
| 1331 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1332 | phi5=aftsTrack->Phi(); |
| 1333 | for(Int_t i6=0;i6<nPrim;i6++) |
| 1334 | { |
| 1335 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; |
| 1336 | aftsTrack=anEvent->GetTrack(i6); |
| 1337 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1338 | phi6=aftsTrack->Phi(); |
| 1339 | //fill the fDirectCorrelations: |
| 1340 | //fDirectCorrelations->Fill(60.,cos(n*(phi1+phi2+phi3-phi4-phi5-phi6)),1);//<6'>_{n,n,n|n,n,n} |
| 1341 | }//end of for(Int_t i6=0;i6<nPrim;i6++) |
| 1342 | }//end of for(Int_t i5=0;i5<nPrim;i5++) |
| 1343 | }//end of for(Int_t i4=0;i4<nPrim;i4++) |
| 1344 | }//end of for(Int_t i3=0;i3<nPrim;i3++) |
| 1345 | }//end of for(Int_t i2=0;i2<nPrim;i2++) |
| 1346 | }//end of for(Int_t i1=0;i1<nPrim;i1++) |
| 1347 | |
| 9c1a9547 |
1348 | |
| 2aa4ebcd |
1349 | */ |
| 1350 | /* |
| 9c1a9547 |
1351 | |
| 2aa4ebcd |
1352 | |
| 1353 | //<7'>_{2n,n,n|n,n,n,n} |
| 1354 | for(Int_t i1=0;i1<nPrim;i1++) |
| 1355 | { |
| 1356 | aftsTrack=anEvent->GetTrack(i1); |
| 1357 | if(!((aftsTrack->Pt()>=0.5&&aftsTrack->Pt()<0.6)&&(aftsTrack->InPOISelection())))continue;//POI condition |
| 1358 | phi1=aftsTrack->Phi(); |
| 1359 | for(Int_t i2=0;i2<nPrim;i2++) |
| 1360 | { |
| 1361 | if(i2==i1)continue; |
| 1362 | aftsTrack=anEvent->GetTrack(i2); |
| 1363 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1364 | phi2=aftsTrack->Phi(); |
| 1365 | for(Int_t i3=0;i3<nPrim;i3++) |
| 1366 | { |
| 1367 | if(i3==i1||i3==i2)continue; |
| 1368 | aftsTrack=anEvent->GetTrack(i3); |
| 1369 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1370 | phi3=aftsTrack->Phi(); |
| 1371 | for(Int_t i4=0;i4<nPrim;i4++) |
| 1372 | { |
| 1373 | if(i4==i1||i4==i2||i4==i3)continue; |
| 1374 | aftsTrack=anEvent->GetTrack(i4); |
| 1375 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1376 | phi4=aftsTrack->Phi(); |
| 1377 | for(Int_t i5=0;i5<nPrim;i5++) |
| 1378 | { |
| 1379 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; |
| 1380 | aftsTrack=anEvent->GetTrack(i5); |
| 1381 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1382 | phi5=aftsTrack->Phi(); |
| 1383 | for(Int_t i6=0;i6<nPrim;i6++) |
| 1384 | { |
| 1385 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; |
| 1386 | aftsTrack=anEvent->GetTrack(i6); |
| 1387 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1388 | phi6=aftsTrack->Phi(); |
| 1389 | for(Int_t i7=0;i7<nPrim;i7++) |
| 1390 | { |
| 1391 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; |
| 1392 | aftsTrack=anEvent->GetTrack(i7); |
| 1393 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1394 | phi7=aftsTrack->Phi(); |
| 1395 | //fill the fDirectCorrelations: |
| 1396 | //fDirectCorrelations->Fill(65.,cos(2.*n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6-n*phi7),1);//<7'>_{2n,n,n|n,n,n,n} |
| 1397 | }//end of for(Int_t i7=0;i7<nPrim;i7++) |
| 1398 | }//end of for(Int_t i6=0;i6<nPrim;i6++) |
| 1399 | }//end of for(Int_t i5=0;i5<nPrim;i5++) |
| 1400 | }//end of for(Int_t i4=0;i4<nPrim;i4++) |
| 1401 | }//end of for(Int_t i3=0;i3<nPrim;i3++) |
| 1402 | }//end of for(Int_t i2=0;i2<nPrim;i2++) |
| 1403 | }//end of for(Int_t i1=0;i1<nPrim;i1++) |
| 9c1a9547 |
1404 | |
| 2aa4ebcd |
1405 | |
| 9c1a9547 |
1406 | |
| 2aa4ebcd |
1407 | */ |
| 1408 | /* |
| 1409 | |
| 1410 | |
| 1411 | |
| 1412 | //<8'>_{n,n,n,n|n,n,n,n} |
| 1413 | for(Int_t i1=0;i1<nPrim;i1++) |
| 1414 | { |
| 1415 | aftsTrack=anEvent->GetTrack(i1); |
| 1416 | if(!((aftsTrack->Pt()>=0.5&&aftsTrack->Pt()<0.6)&&(aftsTrack->InPOISelection())))continue;//POI condition |
| 1417 | phi1=aftsTrack->Phi(); |
| 1418 | for(Int_t i2=0;i2<nPrim;i2++) |
| 1419 | { |
| 1420 | if(i2==i1)continue; |
| 1421 | aftsTrack=anEvent->GetTrack(i2); |
| 1422 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1423 | phi2=aftsTrack->Phi(); |
| 1424 | for(Int_t i3=0;i3<nPrim;i3++) |
| 1425 | { |
| 1426 | if(i3==i1||i3==i2)continue; |
| 1427 | aftsTrack=anEvent->GetTrack(i3); |
| 1428 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1429 | phi3=aftsTrack->Phi(); |
| 1430 | for(Int_t i4=0;i4<nPrim;i4++) |
| 1431 | { |
| 1432 | if(i4==i1||i4==i2||i4==i3)continue; |
| 1433 | aftsTrack=anEvent->GetTrack(i4); |
| 1434 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1435 | phi4=aftsTrack->Phi(); |
| 1436 | for(Int_t i5=0;i5<nPrim;i5++) |
| 1437 | { |
| 1438 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; |
| 1439 | aftsTrack=anEvent->GetTrack(i5); |
| 1440 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1441 | phi5=aftsTrack->Phi(); |
| 1442 | for(Int_t i6=0;i6<nPrim;i6++) |
| 1443 | { |
| 1444 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; |
| 1445 | aftsTrack=anEvent->GetTrack(i6); |
| 1446 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1447 | phi6=aftsTrack->Phi(); |
| 1448 | for(Int_t i7=0;i7<nPrim;i7++) |
| 1449 | { |
| 1450 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; |
| 1451 | aftsTrack=anEvent->GetTrack(i7); |
| 1452 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1453 | phi7=aftsTrack->Phi(); |
| 1454 | for(Int_t i8=0;i8<nPrim;i8++) |
| 1455 | { |
| 1456 | if(i8==i1||i8==i2||i8==i3||i8==i4||i8==i5||i8==i6||i8==i7)continue; |
| 1457 | aftsTrack=anEvent->GetTrack(i8); |
| 1458 | if(!(aftsTrack->InRPSelection()))continue;//RP condition |
| 1459 | phi8=aftsTrack->Phi(); |
| 1460 | //fill the fDirectCorrelations: |
| 1461 | //fDirectCorrelations->Fill(70.,cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)),1);//<8'>_{n,n,n,n|n,n,n,n} |
| 1462 | }//end of for(Int_t i8=0;i8<nPrim;i8++) |
| 1463 | }//end of for(Int_t i7=0;i7<nPrim;i7++) |
| 1464 | }//end of for(Int_t i6=0;i6<nPrim;i6++) |
| 1465 | }//end of for(Int_t i5=0;i5<nPrim;i5++) |
| 1466 | }//end of for(Int_t i4=0;i4<nPrim;i4++) |
| 1467 | }//end of for(Int_t i3=0;i3<nPrim;i3++) |
| 1468 | }//end of for(Int_t i2=0;i2<nPrim;i2++) |
| 1469 | }//end of for(Int_t i1=0;i1<nPrim;i1++) |
| 4057ba99 |
1470 | |
| 1dfa3c16 |
1471 | |
| 2aa4ebcd |
1472 | |
| 1473 | */ |
| 1474 | |
| 1475 | |
| 1476 | |
| 1477 | |
| 1478 | } // end of AliFlowAnalysisWithQCumulants::EvaluateNestedLoopsForDifferentialFlow(AliFlowEventSimple* anEvent) |
| 1479 | |
| 1480 | |
| 1481 | //================================================================================================================================ |
| 1482 | |
| 1483 | |
| 1484 | void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos) |
| 1485 | { |
| 1486 | // get pointers to all output histograms (called before Finish()) |
| 1487 | if(outputListHistos) |
| 1488 | { |
| 1489 | // 1.) common control histograms and common histograms for final results: |
| 1490 | AliFlowCommonHist *commonHist = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject("AliFlowCommonHistQC")); |
| 1491 | if(commonHist) this->SetCommonHists(commonHist); |
| 1492 | AliFlowCommonHist *commonHist2nd = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject("AliFlowCommonHist2ndOrderQC")); |
| 1493 | if(commonHist2nd) this->SetCommonHists2nd(commonHist2nd); |
| 1494 | AliFlowCommonHist *commonHist4th = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject("AliFlowCommonHist4thOrderQC")); |
| 1495 | if(commonHist4th) this->SetCommonHists4th(commonHist4th); |
| 1496 | AliFlowCommonHist *commonHist6th = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject("AliFlowCommonHist6thOrderQC")); |
| 1497 | if(commonHist6th) this->SetCommonHists6th(commonHist6th); |
| 1498 | AliFlowCommonHist *commonHist8th = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject("AliFlowCommonHist8thOrderQC")); |
| 1499 | if(commonHist8th) this->SetCommonHists8th(commonHist8th); |
| 1500 | AliFlowCommonHistResults *commonHistRes2nd = dynamic_cast<AliFlowCommonHistResults*> |
| 1501 | (outputListHistos->FindObject("AliFlowCommonHistResults2ndOrderQC")); |
| 1502 | if(commonHistRes2nd) this->SetCommonHistsResults2nd(commonHistRes2nd); |
| 1503 | AliFlowCommonHistResults *commonHistRes4th = dynamic_cast<AliFlowCommonHistResults*> |
| 1504 | (outputListHistos->FindObject("AliFlowCommonHistResults4thOrderQC")); |
| 1505 | if(commonHistRes4th) this->SetCommonHistsResults4th(commonHistRes4th); |
| 1506 | AliFlowCommonHistResults *commonHistRes6th = dynamic_cast<AliFlowCommonHistResults*> |
| 1507 | (outputListHistos->FindObject("AliFlowCommonHistResults6thOrderQC")); |
| 1508 | if(commonHistRes6th) this->SetCommonHistsResults6th(commonHistRes6th); |
| 1509 | AliFlowCommonHistResults *commonHistRes8th = dynamic_cast<AliFlowCommonHistResults*> |
| 1510 | (outputListHistos->FindObject("AliFlowCommonHistResults8thOrderQC")); |
| 1511 | if(commonHistRes8th) this->SetCommonHistsResults8th(commonHistRes8th); |
| 1512 | |
| 1513 | // 2.) weights: |
| 1514 | TList *weightsList = dynamic_cast<TList*>(outputListHistos->FindObject("Weights")); |
| 1515 | if(weightsList) this->SetWeightsList(weightsList); |
| 1516 | Bool_t bUsePhiWeights = kFALSE; |
| 1517 | Bool_t bUsePtWeights = kFALSE; |
| 1518 | Bool_t bUseEtaWeights = kFALSE; |
| 1519 | TProfile *useParticleWeights = dynamic_cast<TProfile*>(weightsList->FindObject("fUseParticleWeights")); |
| 1520 | if(useParticleWeights) |
| 1521 | { |
| 1522 | this->SetUseParticleWeights(useParticleWeights); |
| 1523 | bUsePhiWeights = (Int_t)useParticleWeights->GetBinContent(1); |
| 1524 | bUsePtWeights = (Int_t)useParticleWeights->GetBinContent(2); |
| 1525 | bUseEtaWeights = (Int_t)useParticleWeights->GetBinContent(3); |
| 1526 | } |
| 1527 | |
| 1528 | // 3.) integrated flow: |
| 1529 | TList *intFlowList = NULL; |
| 1530 | TList *intFlowProfiles = NULL; |
| 1531 | TList *intFlowResults = NULL; |
| 1532 | |
| 1533 | intFlowList = dynamic_cast<TList*>(outputListHistos->FindObject("Integrated Flow")); |
| 1534 | if(intFlowList) |
| 1535 | { |
| 1536 | intFlowProfiles = dynamic_cast<TList*>(intFlowList->FindObject("Profiles")); |
| 1537 | intFlowResults = dynamic_cast<TList*>(intFlowList->FindObject("Results")); |
| 1538 | } else |
| 1539 | { |
| 1540 | cout<<"WARNING: intFlowList is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1541 | } |
| 1542 | |
| 1543 | // profiles: |
| 1544 | if(intFlowProfiles) |
| 1545 | { |
| 1546 | // average multiplicities: |
| 1547 | TProfile *avMultiplicity = dynamic_cast<TProfile*>(intFlowProfiles->FindObject("fAvMultiplicity")); |
| 1548 | if(avMultiplicity) |
| 1549 | { |
| 1550 | this->SetAvMultiplicity(avMultiplicity); |
| 1551 | } else |
| 1552 | { |
| 1553 | cout<<"WARNING: avMultiplicity is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1554 | } |
| 1555 | |
| 1556 | // flags: (to be improved (united with other flags in this method)) |
| 1557 | TString pWeightsFlag[2] = {"pWeights not used","pWeights used"}; |
| 1558 | TString eWeightsFlag[2] = {"exact eWeights","non-exact eWeights"}; |
| 1559 | //TString nuaFlag[2] = {"not corrected","corrected"}; |
| 1560 | TString sinCosFlag[2] = {"sin","cos"}; |
| 1561 | |
| 1562 | for(Int_t pW=0;pW<1+(Int_t)(bUsePhiWeights||bUsePtWeights||bUseEtaWeights);pW++) |
| 1563 | { |
| 1564 | for(Int_t eW=0;eW<1;eW++) |
| 1565 | { |
| 1566 | // correlations (profiles): |
| 1567 | TProfile *qCorrelations = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(Form("fQCorrelations: %s, %s",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()))); |
| 1568 | if(qCorrelations) |
| 1569 | { |
| 1570 | this->SetQCorrelations(qCorrelations,pW,eW); |
| 1571 | } else |
| 1572 | { |
| 1573 | cout<<"WARNING: qCorrelations is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1574 | cout<<"pW = "<<pW<<endl; |
| 1575 | cout<<"eW = "<<eW<<endl; |
| 1576 | } |
| 1577 | // products (profiles): |
| 1578 | TProfile *qProducts = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(Form("fQProducts: %s, %s",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()))); |
| 1579 | if(qProducts) |
| 1580 | { |
| 1581 | this->SetQProducts(qProducts,pW,eW); |
| 1582 | } else |
| 1583 | { |
| 1584 | cout<<"WARNING: qProducts is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1585 | cout<<"pW = "<<pW<<endl; |
| 1586 | cout<<"eW = "<<eW<<endl; |
| 1587 | } |
| 1588 | // corrections (profiles): |
| 1589 | for(Int_t sc=0;sc<2;sc++) |
| 1590 | { |
| 1591 | TProfile *qCorrections = dynamic_cast<TProfile*>(intFlowProfiles->FindObject((Form("fQCorrections: %s, %s, %s terms",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),sinCosFlag[sc].Data())))); |
| 1592 | if(qCorrections) |
| 1593 | { |
| 1594 | this->SetQCorrections(qCorrections,pW,eW,sc); |
| 1595 | } else |
| 1596 | { |
| 1597 | cout<<"WARNING: qCorrections is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1598 | cout<<"pW = "<<pW<<endl; |
| 1599 | cout<<"eW = "<<eW<<endl; |
| 1600 | cout<<"sc = "<<sc<<endl; |
| 1601 | } |
| 1602 | } // end of for(Int_t sc=0;sc<2;sc++) |
| 1603 | } // end of for(Int_t eW=0;eW<1;eW++) |
| 1604 | } // end of for(Int_t pW=0;pW<1+(Int_t)(bUsePhiWeights||bUsePtWeights||bUseEtaWeights);pW++) |
| 1605 | } else // to if(intFlowProfiles) |
| 1606 | { |
| 1607 | cout<<"WARNING: intFlowProfiles is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1608 | } |
| 1609 | |
| 1610 | // results: |
| 1611 | if(intFlowResults) |
| 1612 | { |
| 1613 | for(Int_t pW=0;pW<1+(Int_t)(bUsePhiWeights||bUsePtWeights||bUseEtaWeights);pW++) |
| 1614 | { |
| 1615 | for(Int_t eW=0;eW<2;eW++) |
| 1616 | { |
| 1617 | // flags: (to be improved (united with other flags in this method)) |
| 1618 | TString pWeightsFlag[2] = {"pWeights not used","pWeights used"}; |
| 1619 | TString eWeightsFlag[2] = {"exact eWeights","non-exact eWeights"}; |
| 1620 | TString nuaFlag[2] = {"not corrected","corrected"}; |
| c2a42ea2 |
1621 | TString powerFlag[2] = {"linear","quadratic"}; |
| 2aa4ebcd |
1622 | //TString sinCosFlag[2] = {"sin","cos"}; |
| 1623 | // correlations (results): |
| 1624 | TH1D *correlations = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("fCorrelations: %s, %s",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()))); |
| 1625 | if(correlations) |
| 1626 | { |
| 1627 | this->SetCorrelations(correlations,pW,eW); |
| 1628 | } else |
| 1629 | { |
| 1630 | cout<<"WARNING: correlations is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1631 | cout<<"pW = "<<pW<<endl; |
| 1632 | cout<<"eW = "<<eW<<endl; |
| 1633 | } |
| 1634 | // corrections (results): |
| 1635 | TH1D *corrections = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("fCorrections: %s, %s",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()))); |
| 1636 | if(corrections) |
| 1637 | { |
| 1638 | this->SetCorrections(corrections,pW,eW); |
| 1639 | } else |
| 1640 | { |
| 1641 | cout<<"WARNING: corrections is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1642 | cout<<"pW = "<<pW<<endl; |
| 1643 | cout<<"eW = "<<eW<<endl; |
| 1644 | } |
| 1645 | // covariances (results): |
| 1646 | TH1D *covariances = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("fCovariances: %s, %s",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()))); |
| 1647 | if(covariances) |
| 1648 | { |
| 1649 | this->SetCovariances(covariances,pW,eW); |
| 1650 | } else |
| 1651 | { |
| 1652 | cout<<"WARNING: covariances is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1653 | cout<<"pW = "<<pW<<endl; |
| 1654 | cout<<"eW = "<<eW<<endl; |
| c2a42ea2 |
1655 | } |
| 1656 | // sum of linear and quadratic event weights (results): |
| 1657 | for(Int_t power=0;power<2;power++) |
| 1658 | { |
| 1659 | TH1D *sumOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("fSumOfEventWeights: %s, %s, %s",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),powerFlag[power].Data()))); |
| 1660 | if(sumOfEventWeights) |
| 1661 | { |
| 1662 | this->SetSumOfEventWeights(sumOfEventWeights,pW,eW,power); |
| 1663 | } else |
| 1664 | { |
| 1665 | cout<<"WARNING: sumOfEventWeights is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1666 | cout<<"pW = "<<pW<<endl; |
| 1667 | cout<<"eW = "<<eW<<endl; |
| 1668 | cout<<"power = "<<power<<endl; |
| 1669 | } |
| 1670 | } // end of for(Int_t power=0;power<2;power++) |
| 1671 | // products of event weights (results): |
| 1672 | TH1D *productOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("fProductOfEventWeights: %s, %s",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()))); |
| 1673 | if(productOfEventWeights) |
| 1674 | { |
| 1675 | this->SetProductOfEventWeights(productOfEventWeights,pW,eW); |
| 1676 | } else |
| 1677 | { |
| 1678 | cout<<"WARNING: productOfEventWeights is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1679 | cout<<"pW = "<<pW<<endl; |
| 1680 | cout<<"eW = "<<eW<<endl; |
| 1681 | } |
| 1682 | |
| 2aa4ebcd |
1683 | for(Int_t nua=0;nua<2;nua++) |
| 1684 | { |
| 1685 | // integrated Q-cumulants: |
| 1686 | TH1D *cumulants = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("fCumulants: %s, %s, %s",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),nuaFlag[nua].Data()))); |
| 1687 | if(cumulants) |
| 1688 | { |
| 1689 | this->SetCumulants(cumulants,pW,eW,nua); |
| 1690 | } else |
| 1691 | { |
| 1692 | cout<<"WARNING: cumulants is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1693 | cout<<"pW = "<<pW<<endl; |
| 1694 | cout<<"eW = "<<eW<<endl; |
| 1695 | cout<<"nua = "<<nua<<endl; |
| 1696 | } |
| 1697 | // integrated flow estimates from Q-cumulants: |
| 1698 | TH1D *intFlow = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("fIntFlow: %s, %s, %s",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),nuaFlag[nua].Data()))); |
| 1699 | if(intFlow) |
| 1700 | { |
| 1701 | this->SetIntFlow(intFlow,pW,eW,nua); |
| 1702 | } else |
| 1703 | { |
| 1704 | cout<<"WARNING: intFlow is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1705 | cout<<"pW = "<<pW<<endl; |
| 1706 | cout<<"eW = "<<eW<<endl; |
| 1707 | cout<<"nua = "<<nua<<endl; |
| 1708 | } |
| 1709 | } // end of for(Int_t nua=0;nua<2;nua++) |
| 1710 | } // end of for(Int_t eW=0;eW<1;eW++) |
| 1711 | } // end of for(Int_t pW=0;pW<1+(Int_t)(bUsePhiWeights||bUsePtWeights||bUseEtaWeights);pW++) |
| 1712 | } else // to if(intFlowResults) |
| 1713 | { |
| 1714 | cout<<"WARNING: intFlowResults is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1715 | } |
| 1716 | |
| 1717 | // differential flow: |
| 1718 | TString typeFlag[2] = {"RP","POI"}; |
| 1719 | TString pWeightsFlag[2] = {"not used","used"}; |
| 1720 | TString eWeightsFlag[2] = {"exact","non-exact"}; |
| 1721 | TString sinCosFlag[2] = {"sin","cos"}; |
| 1722 | TString nuaFlag[2] = {"not corrected","corrected"}; // nua = non-uniform acceptance |
| 1723 | TString ptEtaFlag[2] = {"p_{t}","#eta"}; |
| 1724 | // base list fDiffFlowList "Differential Flow": |
| 1725 | TList *diffFlowList = NULL; |
| 1726 | diffFlowList = dynamic_cast<TList*>(outputListHistos->FindObject("Differential Flow")); |
| 1727 | // list holding nested lists containing profiles: |
| 1728 | TList *diffFlowListProfiles = NULL; |
| 1729 | // list holding nested lists containing 2D and 1D histograms with final results: |
| 1730 | TList *diffFlowListResults = NULL; |
| 1731 | if(diffFlowList) |
| 1732 | { |
| 1733 | diffFlowListProfiles = dynamic_cast<TList*>(diffFlowList->FindObject("Profiles")); |
| 1734 | diffFlowListResults = dynamic_cast<TList*>(diffFlowList->FindObject("Results")); |
| 1735 | } else |
| 1736 | { |
| 1737 | cout<<"WARNING: diffFlowList is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1738 | } |
| 1739 | |
| 1740 | // nested list in the list of profiles fDiffFlowListProfiles "Profiles": |
| 1741 | TList *dfpType[2] = {NULL}; |
| 1742 | TList *dfpParticleWeights[2][2] = {NULL}; |
| 1743 | TList *dfpEventWeights[2][2][2] = {NULL}; |
| 1744 | TList *diffFlowCorrelations[2][2][2] = {NULL}; |
| 1745 | TList *diffFlowProductsOfCorrelations[2][2][2] = {NULL}; |
| 1746 | TList *diffFlowCorrectionTerms[2][2][2][2] = {NULL}; |
| 1747 | |
| 1748 | if(diffFlowListProfiles) |
| 1749 | { |
| 1750 | for(Int_t t=0;t<2;t++) |
| 1751 | { |
| 1752 | dfpType[t] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(typeFlag[t].Data())); |
| 1753 | if(dfpType[t]) |
| 1754 | { |
| 1755 | for(Int_t pW=0;pW<(1+(Int_t)(bUsePhiWeights||bUsePtWeights||bUseEtaWeights));pW++) |
| 1756 | { |
| 1757 | dfpParticleWeights[t][pW] = dynamic_cast<TList*>(dfpType[t]->FindObject(Form("%s, pWeights %s",typeFlag[t].Data(),pWeightsFlag[pW].Data()))); |
| 1758 | if(dfpParticleWeights[t][pW]) |
| 1759 | { |
| 1760 | for(Int_t eW=0;eW<2;eW++) |
| 1761 | { |
| 1762 | dfpEventWeights[t][pW][eW] = dynamic_cast<TList*>(dfpParticleWeights[t][pW]->FindObject(Form("%s, pWeights %s, eWeights %s",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()))); |
| 1763 | if(dfpEventWeights[t][pW][eW]) |
| 1764 | { |
| 1765 | // correlations: |
| 1766 | diffFlowCorrelations[t][pW][eW] = dynamic_cast<TList*>(dfpEventWeights[t][pW][eW]->FindObject(Form("Correlations (%s, pWeights %s, eWeights %s)",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()))); |
| 1767 | // products of correlations: |
| 1768 | diffFlowProductsOfCorrelations[t][pW][eW] = dynamic_cast<TList*>(dfpEventWeights[t][pW][eW]->FindObject(Form("Products of correlations (%s, pWeights %s, eWeights %s)",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()))); |
| 1769 | // correction terms: |
| 1770 | for(Int_t sc=0;sc<2;sc++) |
| 1771 | { |
| 1772 | diffFlowCorrectionTerms[t][pW][eW][sc] = dynamic_cast<TList*>(dfpEventWeights[t][pW][eW]->FindObject(Form("Corrections for NUA (%s, pWeights %s, eWeights %s, %s terms)",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),sinCosFlag[sc].Data()))); |
| 1773 | //this->SetDiffFlowCorrectionTerms(diffFlowCorrectionTerms[t][pW][sc],t,pW,sc); |
| 1774 | } |
| 1775 | } else // to if(dfpEventWeights[t][pW][eW]) |
| 1776 | { |
| 1777 | cout<<"WARNING: dfpEventWeights[t][pW][eW] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1778 | cout<<"t = "<<t<<endl; |
| 1779 | cout<<"pW = "<<pW<<endl; |
| 1780 | cout<<"eW = "<<eW<<endl; |
| 1781 | } |
| 1782 | } // end of for(Int_t eW=0;eW<2;eW++) |
| 1783 | } else // to if(dfpParticleWeights[t][pW]) |
| 1784 | { |
| 1785 | cout<<"WARNING: dfpParticleWeights[t][pW] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1786 | cout<<"t = "<<t<<endl; |
| 1787 | cout<<"pW = "<<pW<<endl; |
| 1788 | } |
| 1789 | } // end of for(Int_t pW=0;pW<(1+(Int_t)(bUsePhiWeights||bUsePtWeights||bUseEtaWeights));pW++) |
| 1790 | } else // if(dfpType[t]) |
| 1791 | { |
| 1792 | cout<<"WARNING: dfpType[t] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1793 | cout<<"t = "<<t<<endl; |
| 1794 | } |
| 1795 | } // end of for(Int_t t=0;t<2;t++) |
| 1796 | } else // to if(diffFlowListProfiles) |
| 1797 | { |
| 1798 | cout<<"WARNING: diffFlowListProfiles is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1799 | } |
| 1800 | |
| 1801 | TProfile2D *correlationsPro[2][2][2][4] = {NULL}; |
| 1802 | TProfile2D *productsOfCorrelationsPro[2][2][2][5] = {NULL}; |
| 1803 | TProfile2D *correctionTermsPro[2][2][2][2][2] = {NULL}; |
| 1804 | |
| 1805 | TString correlationName[4] = {"<2'>","<4'>","<6'>","<8'>"}; |
| 1806 | TString cumulantName[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; |
| 1807 | TString productOfCorrelationsName[5] = {"<2><2'>","<2><4'>","<4><2'>","<4><4'>","<2'><4'>"}; |
| 1808 | TString correctionsSinTermsName[2] = {"sin(1)","sin(2)"}; |
| 1809 | TString correctionsCosTermsName[2] = {"cos(1)","cos(2)"}; |
| 1810 | TString correctionName[4] = {"corr. to QC{2'}","corr. to QC{4'}","corr. to QC{6'}","corr. to QC{8'}"}; |
| 1811 | TString covarianceName[4] = {"Cov(2,2')","Cov(2,4')","Cov(2',4')","Cov(4,2')"}; // to be improved (reorganized) |
| 1812 | TString flowName[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; |
| 1813 | |
| 1814 | for(Int_t t=0;t<2;t++) |
| 1815 | { |
| 1816 | for(Int_t pW=0;pW<(1+(Int_t)(bUsePhiWeights||bUsePtWeights||bUseEtaWeights));pW++) |
| 1817 | { |
| 1818 | for(Int_t eW=0;eW<2;eW++) |
| 1819 | { |
| 1820 | // correlations: |
| 1821 | if(diffFlowCorrelations[t][pW][eW]) |
| 1822 | { |
| 1823 | for(Int_t correlationIndex=0;correlationIndex<4;correlationIndex++) |
| 1824 | { |
| 1825 | correlationsPro[t][pW][eW][correlationIndex] = dynamic_cast<TProfile2D*>(diffFlowCorrelations[t][pW][eW]->FindObject(correlationName[correlationIndex].Data())); |
| 1826 | if(correlationsPro[t][pW][eW][correlationIndex]) |
| 1827 | { |
| 1828 | this->SetCorrelationsPro(correlationsPro[t][pW][eW][correlationIndex],t,pW,eW,correlationIndex); |
| 1829 | } else // to if(correlationsPro[t][pW][ew][correlationIndex]) |
| 1830 | { |
| 1831 | cout<<"WARNING: correlationsPro[t][pW][eW][correlationIndex] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1832 | cout<<"t = "<<t<<endl; |
| 1833 | cout<<"pW = "<<pW<<endl; |
| 1834 | cout<<"eW = "<<eW<<endl; |
| 1835 | cout<<"ci = "<<correlationIndex<<endl; |
| 1836 | } |
| 1837 | } |
| 1838 | } else // to if(diffFlowCorrelations[t][pW][eW]) |
| 1839 | { |
| 1840 | cout<<"WARNING: diffFlowCorrelations[t][pW][eW] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1841 | cout<<"t = "<<t<<endl; |
| 1842 | cout<<"pW = "<<pW<<endl; |
| 1843 | cout<<"eW = "<<eW<<endl; |
| 1844 | } |
| 1845 | // products of correlations: |
| 1846 | if(diffFlowProductsOfCorrelations[t][pW][eW]) |
| 1847 | { |
| 1848 | for(Int_t productOfCorrelationsIndex=0;productOfCorrelationsIndex<5;productOfCorrelationsIndex++) |
| 1849 | { |
| 1850 | productsOfCorrelationsPro[t][pW][eW][productOfCorrelationsIndex] = dynamic_cast<TProfile2D*>(diffFlowProductsOfCorrelations[t][pW][eW]->FindObject(productOfCorrelationsName[productOfCorrelationsIndex].Data())); |
| 1851 | if(productsOfCorrelationsPro[t][pW][eW][productOfCorrelationsIndex]) |
| 1852 | { |
| 1853 | this->SetProductsOfCorrelationsPro(productsOfCorrelationsPro[t][pW][eW][productOfCorrelationsIndex],t,pW,eW,productOfCorrelationsIndex); |
| 1854 | } else // to if(productsOfCorrelationsPro[t][pW][eW][productOfCorrelationsIndex]) |
| 1855 | { |
| 1856 | cout<<"WARNING: productsOfCorrelationsPro[t][pW][eW][productOfCorrelationsIndex] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1857 | cout<<"t = "<<t<<endl; |
| 1858 | cout<<"pW = "<<pW<<endl; |
| 1859 | cout<<"eW = "<<eW<<endl; |
| 1860 | cout<<"ci = "<<productOfCorrelationsIndex<<endl; |
| 1861 | } |
| 1862 | } |
| 1863 | } else // to if(diffFlowProductsOfCorrelations[t][pW][eW]) |
| 1864 | { |
| 1865 | cout<<"WARNING: diffFlowProductsOfCorrelations[t][pW][eW] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1866 | cout<<"t = "<<t<<endl; |
| 1867 | cout<<"pW = "<<pW<<endl; |
| 1868 | cout<<"eW = "<<eW<<endl; |
| 1869 | } |
| 1870 | // correction terms: |
| 1871 | for(Int_t sc=0;sc<2;sc++) |
| 1872 | { |
| 1873 | if(diffFlowCorrectionTerms[t][pW][eW][sc]) |
| 1874 | { |
| 1875 | for(Int_t correctionIndex=0;correctionIndex<2;correctionIndex++) |
| 1876 | { |
| 1877 | if(sc==0) |
| 1878 | { |
| 1879 | correctionTermsPro[t][pW][eW][sc][correctionIndex] = dynamic_cast<TProfile2D*>(diffFlowCorrectionTerms[t][pW][eW][sc]->FindObject(correctionsSinTermsName[correctionIndex].Data())); |
| 1880 | if(correctionTermsPro[t][pW][eW][sc][correctionIndex]) |
| 1881 | { |
| 1882 | this->SetCorrectionTermsPro(correctionTermsPro[t][pW][eW][sc][correctionIndex],t,pW,eW,sc,correctionIndex); |
| 1883 | } else |
| 1884 | { |
| 1885 | cout<<"WARNING: correctionTermsPro[t][pW][eW][sc][correctionIndex] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1886 | cout<<"t = "<<t<<endl; |
| 1887 | cout<<"pW = "<<pW<<endl; |
| 1888 | cout<<"eW = "<<eW<<endl; |
| 1889 | cout<<"sc = "<<sc<<endl; |
| 1890 | cout<<"ci = "<<correctionIndex<<endl; |
| 1891 | } |
| 1892 | } |
| 1893 | if(sc==1) |
| 1894 | { |
| 1895 | correctionTermsPro[t][pW][eW][sc][correctionIndex] = dynamic_cast<TProfile2D*>(diffFlowCorrectionTerms[t][pW][eW][sc]->FindObject(correctionsCosTermsName[correctionIndex].Data())); |
| 1896 | if(correctionTermsPro[t][pW][eW][sc][correctionIndex]) |
| 1897 | { |
| 1898 | this->SetCorrectionTermsPro(correctionTermsPro[t][pW][eW][sc][correctionIndex],t,pW,eW,sc,correctionIndex); |
| 1899 | } else |
| 1900 | { |
| 1901 | cout<<"WARNING: correctionTermsPro[t][pW][eW][sc][correctionIndex] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1902 | cout<<"t = "<<t<<endl; |
| 1903 | cout<<"pW = "<<pW<<endl; |
| 1904 | cout<<"eW = "<<eW<<endl; |
| 1905 | cout<<"sc = "<<sc<<endl; |
| 1906 | cout<<"ci = "<<correctionIndex<<endl; |
| 1907 | } |
| 1908 | } |
| 1909 | } // end of for(Int_t correctionIndex=0;correctionIndex<2;correctionIndex++) |
| 1910 | } else // to if(diffFlowCorrectionTerms[t][pW][eW][sc]) |
| 1911 | { |
| 1912 | cout<<"WARNING: diffFlowCorrectionTerms[t][pW][eW][sc] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1913 | cout<<"t = "<<t<<endl; |
| 1914 | cout<<"pW = "<<pW<<endl; |
| 1915 | cout<<"eW = "<<eW<<endl; |
| 1916 | cout<<"sc = "<<sc<<endl; |
| 1917 | } |
| 1918 | } // end of for(Int_t sc=0;sc<2;sc++) |
| 1919 | } // end of for(Int_t eW=0;eW<2;eW++) |
| 1920 | } // end of for(Int_t pW=0;pW<(1+(Int_t)(bUsePhiWeights||bUsePtWeights||bUseEtaWeights));pW++) |
| 1921 | } // end of for(Int_t t=0;t<2;t++) |
| 1922 | |
| 1923 | // nested list in the list of results fDiffFlowListResults "Results": |
| 1924 | TList *dfrType[2] = {NULL}; |
| 1925 | TList *dfrParticleWeights[2][2] = {NULL}; |
| 1926 | TList *dfrEventWeights[2][2][2] = {NULL}; |
| 1927 | TList *dfrCorrections[2][2][2][2] = {NULL}; |
| 1928 | TList *diffFlowFinalCorrelations[2][2][2] = {NULL}; |
| 1929 | TList *diffFlowFinalCorrections[2][2][2] = {NULL}; |
| 1930 | TList *diffFlowFinalCovariances[2][2][2] = {NULL}; |
| 1931 | TList *diffFlowFinalCumulants[2][2][2][2] = {NULL}; |
| 1932 | TList *diffFlowFinalFlow[2][2][2][2] = {NULL}; |
| 1933 | |
| 1934 | if(diffFlowListResults) |
| 1935 | { |
| 1936 | for(Int_t t=0;t<2;t++) |
| 1937 | { |
| 1938 | dfrType[t] = dynamic_cast<TList*>(diffFlowListResults->FindObject(typeFlag[t].Data())); |
| 1939 | if(dfrType[t]) |
| 1940 | { |
| 1941 | for(Int_t pW=0;pW<(1+(Int_t)(bUsePhiWeights||bUsePtWeights||bUseEtaWeights));pW++) |
| 1942 | { |
| 1943 | dfrParticleWeights[t][pW] = dynamic_cast<TList*>(dfrType[t]->FindObject(Form("%s, pWeights %s",typeFlag[t].Data(),pWeightsFlag[pW].Data()))); |
| 1944 | if(dfrParticleWeights[t][pW]) |
| 1945 | { |
| 1946 | for(Int_t eW=0;eW<2;eW++) |
| 1947 | { |
| 1948 | dfrEventWeights[t][pW][eW] = dynamic_cast<TList*>(dfrParticleWeights[t][pW]->FindObject(Form("%s, pWeights %s, eWeights %s",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()))); |
| 1949 | if(dfrEventWeights[t][pW][eW]) |
| 1950 | { |
| 1951 | diffFlowFinalCorrelations[t][pW][eW] = dynamic_cast<TList*>(dfrEventWeights[t][pW][eW]->FindObject(Form("Correlations (%s, pWeights %s, eWeights %s)",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()))); |
| 1952 | diffFlowFinalCorrections[t][pW][eW] = dynamic_cast<TList*>(dfrEventWeights[t][pW][eW]->FindObject(Form("Corrections (%s, pWeights %s, eWeights %s)",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()))); |
| 1953 | diffFlowFinalCovariances[t][pW][eW] = dynamic_cast<TList*>(dfrEventWeights[t][pW][eW]->FindObject(Form("Covariances (%s, pWeights %s, eWeights %s)",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()))); |
| 1954 | for(Int_t nua=0;nua<2;nua++) |
| 1955 | { |
| 1956 | dfrCorrections[t][pW][eW][nua] = dynamic_cast<TList*>(dfrEventWeights[t][pW][eW]->FindObject(Form("%s, pWeights %s, eWeights %s, %s for NUA",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),nuaFlag[nua].Data()))); |
| 1957 | if(dfrCorrections[t][pW][eW][nua]) |
| 1958 | { |
| 1959 | diffFlowFinalCumulants[t][pW][eW][nua] = dynamic_cast<TList*>(dfrCorrections[t][pW][eW][nua]->FindObject(Form("Cumulants (%s, pWeights %s, eWeights %s, %s for NUA)",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),nuaFlag[nua].Data()))); |
| 1960 | diffFlowFinalFlow[t][pW][eW][nua] = dynamic_cast<TList*>(dfrCorrections[t][pW][eW][nua]->FindObject(Form("Differential Flow (%s, pWeights %s, eWeights %s, %s for NUA)",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),nuaFlag[nua].Data()))); |
| 1961 | } else // to if(dfrCorrections[t][pW][eW][nua]) |
| 1962 | { |
| 1963 | cout<<"WARNING: dfrCorrections[t][pW][eW][nua] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1964 | cout<<"t = "<<t<<endl; |
| 1965 | cout<<"pW = "<<pW<<endl; |
| 1966 | cout<<"eW = "<<eW<<endl; |
| 1967 | cout<<"nua = "<<nua<<endl; |
| 1968 | } |
| 1969 | } // end of for(Int_t nua=0;nua<2;nua++) |
| 1970 | } else // to if(dfrEventWeights[t][pW][eW]) |
| 1971 | { |
| 1972 | cout<<"WARNING: dfrEventWeights[t][pW][eW] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1973 | cout<<"t = "<<t<<endl; |
| 1974 | cout<<"pW = "<<pW<<endl; |
| 1975 | cout<<"eW = "<<eW<<endl; |
| 1976 | } |
| 1977 | } // end of for(Int_t eW=0;eW<2;eW++) |
| 1978 | } else // to if(dfrParticleWeights[t][pW]) |
| 1979 | { |
| 1980 | cout<<"WARNING: dfrParticleWeights[t][pW] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1981 | cout<<"t = "<<t<<endl; |
| 1982 | cout<<"pW = "<<pW<<endl; |
| 1983 | } |
| 1984 | } // end of for(Int_t pW=0;pW<(1+(Int_t)(bUsePhiWeights||bUsePtWeights||bUseEtaWeights));pW++) |
| 1985 | } else // to if(dfrType[t]) |
| 1986 | { |
| 1987 | cout<<"WARNING: dfrType[t] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1988 | cout<<"t = "<<t<<endl; |
| 1989 | } |
| 1990 | } // end of for(Int_t t=0;t<2;t++) |
| 1991 | } else // to if(diffFlowListResults) |
| 1992 | { |
| 1993 | cout<<"WARNING: diffFlowListResults is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 1994 | } |
| ae733b3b |
1995 | |
| 2aa4ebcd |
1996 | TH2D *finalCorrelations2D[2][2][2][4] = {NULL}; |
| 1997 | TH1D *finalCorrelations1D[2][2][2][2][4] = {NULL}; |
| 1998 | TH2D *finalCumulants2D[2][2][2][2][4] = {NULL}; |
| 1999 | TH1D *finalCumulantsPt[2][2][2][2][4] = {NULL}; |
| 2000 | TH1D *finalCumulantsEta[2][2][2][2][4] = {NULL}; |
| 2001 | TH2D *finalCorrections2D[2][2][2][4] = {NULL}; |
| 2002 | TH1D *finalCorrections1D[2][2][2][2][4] = {NULL}; |
| 2003 | TH2D *finalCovariances2D[2][2][2][4] = {NULL}; |
| 2004 | TH1D *finalCovariances1D[2][2][2][2][4] = {NULL}; |
| 2005 | TH2D *finalFlow2D[2][2][2][2][4] = {NULL}; |
| 2006 | TH1D *finalFlowPt[2][2][2][2][4] = {NULL}; |
| 2007 | TH1D *finalFlowEta[2][2][2][2][4] = {NULL}; |
| 2008 | TH2D *nonEmptyBins2D[2] = {NULL}; |
| 2009 | TH1D *nonEmptyBins1D[2][2] = {NULL}; |
| 2010 | |
| 2011 | for(Int_t t=0;t<2;t++) |
| 9c1a9547 |
2012 | { |
| 2aa4ebcd |
2013 | // 2D: |
| 2014 | nonEmptyBins2D[t] = dynamic_cast<TH2D*>(dfrType[t]->FindObject(Form("%s, (p_{t},#eta)",typeFlag[t].Data()))); |
| 2015 | if(nonEmptyBins2D[t]) |
| 2016 | { |
| 2017 | this->SetNonEmptyBins2D(nonEmptyBins2D[t],t); |
| 2018 | } else |
| 2019 | { |
| 2020 | cout<<"WARNING: nonEmptyBins2D[t] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 2021 | cout<<"t = "<<t<<endl; |
| 2022 | } |
| 2023 | // 1D: |
| 2024 | for(Int_t pe=0;pe<2;pe++) |
| 2025 | { |
| 2026 | nonEmptyBins1D[t][pe] = dynamic_cast<TH1D*>(dfrType[t]->FindObject(Form("%s, %s",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); |
| 2027 | if(nonEmptyBins1D[t][pe]) |
| 2028 | { |
| 2029 | this->SetNonEmptyBins1D(nonEmptyBins1D[t][pe],t,pe); |
| 2030 | } else |
| 2031 | { |
| 2032 | cout<<"WARNING: nonEmptyBins1D[t][pe] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 2033 | cout<<"t = "<<t<<endl; |
| 2034 | cout<<"pe = "<<pe<<endl; |
| 2035 | } |
| 2036 | } |
| 9c1a9547 |
2037 | |
| 2aa4ebcd |
2038 | for(Int_t pW=0;pW<(1+(Int_t)(bUsePhiWeights||bUsePtWeights||bUseEtaWeights));pW++) |
| 2039 | { |
| 2040 | for(Int_t eW=0;eW<2;eW++) |
| 2041 | { |
| 2042 | // correlations: |
| 2043 | if(diffFlowFinalCorrelations[t][pW][eW]) |
| 2044 | { |
| 2045 | for(Int_t correlationIndex=0;correlationIndex<4;correlationIndex++) |
| 2046 | { |
| 2047 | // 2D: |
| 2048 | finalCorrelations2D[t][pW][eW][correlationIndex] = dynamic_cast<TH2D*>(diffFlowFinalCorrelations[t][pW][eW]->FindObject(Form("%s, (p_{t},#eta)",correlationName[correlationIndex].Data()))); |
| 2049 | if(finalCorrelations2D[t][pW][eW][correlationIndex]) |
| 2050 | { |
| 2051 | this->SetFinalCorrelations2D(finalCorrelations2D[t][pW][eW][correlationIndex],t,pW,eW,correlationIndex); |
| 2052 | } else |
| 2053 | { |
| 2054 | cout<<"WARNING: finalCorrelations2D[t][pW][eW][correlationIndex] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 2055 | cout<<"t = "<<t<<endl; |
| 2056 | cout<<"pW = "<<pW<<endl; |
| 2057 | cout<<"eW = "<<eW<<endl; |
| 2058 | cout<<"ci = "<<correlationIndex<<endl; |
| 2059 | } |
| 2060 | // 1D |
| 2061 | for(Int_t pe=0;pe<2;pe++) |
| 2062 | { |
| 2063 | if(pe==0) |
| 2064 | { |
| 2065 | finalCorrelations1D[t][pW][eW][pe][correlationIndex] = dynamic_cast<TH1D*>(diffFlowFinalCorrelations[t][pW][eW]->FindObject(Form("%s, (p_{t})",correlationName[correlationIndex].Data()))); |
| 2066 | } |
| 2067 | if(pe==1) |
| 2068 | { |
| 2069 | finalCorrelations1D[t][pW][eW][pe][correlationIndex] = dynamic_cast<TH1D*>(diffFlowFinalCorrelations[t][pW][eW]->FindObject(Form("%s, (#eta)",correlationName[correlationIndex].Data()))); |
| 2070 | } |
| 2071 | if(finalCorrelations1D[t][pW][eW][pe][correlationIndex]) |
| 2072 | { |
| 2073 | this->SetFinalCorrelations1D(finalCorrelations1D[t][pW][eW][pe][correlationIndex],t,pW,eW,pe,correlationIndex); |
| 2074 | } else |
| 2075 | { |
| 2076 | cout<<"WARNING: finalCorrelations1D[t][pW][eW][pe][correlationIndex] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 2077 | cout<<"t = "<<t<<endl; |
| 2078 | cout<<"pW = "<<pW<<endl; |
| 2079 | cout<<"eW = "<<eW<<endl; |
| 2080 | cout<<"pe = "<<pe<<endl; |
| 2081 | cout<<"ci = "<<correlationIndex<<endl; |
| 2082 | } |
| 2083 | } // end of for(Int_t pe=0;pe<2;pe++) |
| 2084 | } // end of for(Int_t correlationIndex=0;correlationIndex<4;correlationIndex++) |
| 2085 | } else // to if(diffFlowFinalCorrelations[t][pW][eW]) |
| 2086 | { |
| 2087 | cout<<"WARNING: diffFlowFinalCorrelations[t][pW] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 2088 | cout<<"t = "<<t<<endl; |
| 2089 | cout<<"pW = "<<pW<<endl; |
| 2090 | cout<<"eW = "<<eW<<endl; |
| 2091 | } |
| 2092 | // corrections: |
| 2093 | if(diffFlowFinalCorrections[t][pW][eW]) |
| 2094 | { |
| 2095 | for(Int_t correctionIndex=0;correctionIndex<4;correctionIndex++) |
| 2096 | { |
| 2097 | // 2D: |
| 2098 | finalCorrections2D[t][pW][eW][correctionIndex] = dynamic_cast<TH2D*>(diffFlowFinalCorrections[t][pW][eW]->FindObject(Form("%s, (p_{t},#eta)",correctionName[correctionIndex].Data()))); |
| 2099 | if(finalCorrections2D[t][pW][eW][correctionIndex]) |
| 2100 | { |
| 2101 | this->SetFinalCorrections2D(finalCorrections2D[t][pW][eW][correctionIndex],t,pW,eW,correctionIndex); |
| 2102 | } else |
| 2103 | { |
| 2104 | cout<<"WARNING: finalCorrections2D[t][pW][eW][correctionIndex] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 2105 | cout<<"t = "<<t<<endl; |
| 2106 | cout<<"pW = "<<pW<<endl; |
| 2107 | cout<<"eW = "<<eW<<endl; |
| 2108 | cout<<"ci = "<<correctionIndex<<endl; |
| 2109 | } |
| 2110 | // 1D |
| 2111 | for(Int_t pe=0;pe<2;pe++) |
| 2112 | { |
| 2113 | if(pe==0) |
| 2114 | { |
| 2115 | finalCorrections1D[t][pW][eW][pe][correctionIndex] = dynamic_cast<TH1D*>(diffFlowFinalCorrections[t][pW][eW]->FindObject(Form("%s, (p_{t})",correctionName[correctionIndex].Data()))); |
| 2116 | } |
| 2117 | if(pe==1) |
| 2118 | { |
| 2119 | finalCorrections1D[t][pW][eW][pe][correctionIndex] = dynamic_cast<TH1D*>(diffFlowFinalCorrections[t][pW][eW]->FindObject(Form("%s, (#eta)",correctionName[correctionIndex].Data()))); |
| 2120 | } |
| 2121 | if(finalCorrections1D[t][pW][eW][pe][correctionIndex]) |
| 2122 | { |
| 2123 | this->SetFinalCorrections1D(finalCorrections1D[t][pW][eW][pe][correctionIndex],t,pW,eW,pe,correctionIndex); |
| 2124 | } else |
| 2125 | { |
| 2126 | cout<<"WARNING: finalCorrections1D[t][pW][eW][pe][correctionIndex] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 2127 | cout<<"t = "<<t<<endl; |
| 2128 | cout<<"pW = "<<pW<<endl; |
| 2129 | cout<<"eW = "<<eW<<endl; |
| 2130 | cout<<"pe = "<<pe<<endl; |
| 2131 | cout<<"ci = "<<correctionIndex<<endl; |
| 2132 | } |
| 2133 | } // end of for(Int_t pe=0;pe<2;pe++) |
| 2134 | } // end of for(Int_t correctionIndex=0;correctionIndex<4;correctionIndex++) |
| 2135 | } else // to if(diffFlowFinalCorrections[t][pW][eW]) |
| 2136 | { |
| 2137 | cout<<"WARNING: diffFlowFinalCorrections[t][pW][eW] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 2138 | cout<<"t = "<<t<<endl; |
| 2139 | cout<<"pW = "<<pW<<endl; |
| 2140 | cout<<"eW = "<<eW<<endl; |
| 2141 | } |
| 2142 | // covariances: |
| 2143 | if(diffFlowFinalCovariances[t][pW][eW]) |
| 2144 | { |
| 2145 | for(Int_t covarianceIndex=0;covarianceIndex<4;covarianceIndex++) |
| 2146 | { |
| 2147 | // 2D: |
| 2148 | finalCovariances2D[t][pW][eW][covarianceIndex] = dynamic_cast<TH2D*>(diffFlowFinalCovariances[t][pW][eW]->FindObject(Form("%s, (p_{t},#eta)",covarianceName[covarianceIndex].Data()))); |
| 2149 | if(finalCovariances2D[t][pW][eW][covarianceIndex]) |
| 2150 | { |
| 2151 | this->SetFinalCovariances2D(finalCovariances2D[t][pW][eW][covarianceIndex],t,pW,eW,covarianceIndex); |
| 2152 | } else |
| 2153 | { |
| 2154 | cout<<"WARNING: finalCovariances2D[t][pW][eW][nua][covarianceIndex] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 2155 | cout<<"t = "<<t<<endl; |
| 2156 | cout<<"pW = "<<pW<<endl; |
| 2157 | cout<<"eW = "<<eW<<endl; |
| 2158 | cout<<"ci = "<<covarianceIndex<<endl; |
| 2159 | } |
| 2160 | // 1D: |
| 2161 | for(Int_t pe=0;pe<2;pe++) |
| 2162 | { |
| 2163 | if(pe==0) |
| 2164 | { |
| 2165 | finalCovariances1D[t][pW][eW][pe][covarianceIndex] = dynamic_cast<TH1D*>(diffFlowFinalCovariances[t][pW][eW]->FindObject(Form("%s, (p_{t})",covarianceName[covarianceIndex].Data()))); |
| 2166 | } |
| 2167 | if(pe==1) |
| 2168 | { |
| 2169 | finalCovariances1D[t][pW][eW][pe][covarianceIndex] = dynamic_cast<TH1D*>(diffFlowFinalCovariances[t][pW][eW]->FindObject(Form("%s, (#eta)",covarianceName[covarianceIndex].Data()))); |
| 2170 | } |
| 2171 | if(finalCovariances1D[t][pW][eW][pe][covarianceIndex]) |
| 2172 | { |
| 2173 | this->SetFinalCovariances1D(finalCovariances1D[t][pW][eW][pe][covarianceIndex],t,pW,eW,pe,covarianceIndex); |
| 2174 | } else |
| 2175 | { |
| 2176 | cout<<"WARNING: finalCovariances1D[t][pW][eW][pe][covarianceIndex] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 2177 | cout<<"t = "<<t<<endl; |
| 2178 | cout<<"pW = "<<pW<<endl; |
| 2179 | cout<<"eW = "<<eW<<endl; |
| 2180 | cout<<"pe = "<<pe<<endl; |
| 2181 | cout<<"ci = "<<covarianceIndex<<endl; |
| 2182 | } |
| 2183 | } // end of for(Int_t pe=0;pe<2;pe++) |
| 2184 | } // end of for(Int_t covarianceIndex=0;covarianceIndex<4;covarianceIndex++) |
| 2185 | } else // to if(diffFlowFinalCovariances[t][pW][eW]) |
| 2186 | { |
| 2187 | cout<<"WARNING: diffFlowFinalCovariances[t][pW][eW] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 2188 | cout<<"t = "<<t<<endl; |
| 2189 | cout<<"pW = "<<pW<<endl; |
| 2190 | cout<<"eW = "<<eW<<endl; |
| 2191 | } |
| 2192 | |
| 2193 | for(Int_t nua=0;nua<2;nua++) |
| 2194 | { |
| 2195 | // cumulants: |
| 2196 | if(diffFlowFinalCumulants[t][pW][eW][nua]) |
| 2197 | { |
| 2198 | for(Int_t cumulantIndex=0;cumulantIndex<4;cumulantIndex++) |
| 2199 | { |
| 2200 | // 2D: |
| 2201 | finalCumulants2D[t][pW][eW][nua][cumulantIndex] = dynamic_cast<TH2D*>(diffFlowFinalCumulants[t][pW][eW][nua]->FindObject(Form("%s, (p_{t},#eta)",cumulantName[cumulantIndex].Data()))); |
| 2202 | if(finalCumulants2D[t][pW][eW][nua][cumulantIndex]) |
| 2203 | { |
| 2204 | this->SetFinalCumulants2D(finalCumulants2D[t][pW][eW][nua][cumulantIndex],t,pW,eW,nua,cumulantIndex); |
| 2205 | } else |
| 2206 | { |
| 2207 | cout<<"WARNING: finalCumulants2D[t][pW][eW][nua][cumulantIndex] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 2208 | cout<<"t = "<<t<<endl; |
| 2209 | cout<<"pW = "<<pW<<endl; |
| 2210 | cout<<"eW = "<<eW<<endl; |
| 2211 | cout<<"nua = "<<nua<<endl; |
| 2212 | cout<<"ci = "<<cumulantIndex<<endl; |
| 2213 | } |
| 2214 | // pt: |
| 2215 | finalCumulantsPt[t][pW][eW][nua][cumulantIndex] = dynamic_cast<TH1D*>(diffFlowFinalCumulants[t][pW][eW][nua]->FindObject(Form("%s, (p_{t})",cumulantName[cumulantIndex].Data()))); |
| 2216 | if(finalCumulantsPt[t][pW][eW][nua][cumulantIndex]) |
| 2217 | { |
| 2218 | this->SetFinalCumulantsPt(finalCumulantsPt[t][pW][eW][nua][cumulantIndex],t,pW,eW,nua,cumulantIndex); |
| 2219 | } else |
| 2220 | { |
| 2221 | cout<<"WARNING: finalCumulantsPt[t][pW][eW][nua][cumulantIndex] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 2222 | cout<<"t = "<<t<<endl; |
| 2223 | cout<<"pW = "<<pW<<endl; |
| 2224 | cout<<"eW = "<<eW<<endl; |
| 2225 | cout<<"nua = "<<nua<<endl; |
| 2226 | cout<<"ci = "<<cumulantIndex<<endl; |
| 2227 | } |
| 2228 | // eta: |
| 2229 | finalCumulantsEta[t][pW][eW][nua][cumulantIndex] = dynamic_cast<TH1D*>(diffFlowFinalCumulants[t][pW][eW][nua]->FindObject(Form("%s, (#eta)",cumulantName[cumulantIndex].Data()))); |
| 2230 | if(finalCumulantsEta[t][pW][eW][nua][cumulantIndex]) |
| 2231 | { |
| 2232 | this->SetFinalCumulantsEta(finalCumulantsEta[t][pW][eW][nua][cumulantIndex],t,pW,eW,nua,cumulantIndex); |
| 2233 | } else |
| 2234 | { |
| 2235 | cout<<"WARNING: finalCumulantsEta[t][pW][eW][nua][cumulantIndex] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 2236 | cout<<"t = "<<t<<endl; |
| 2237 | cout<<"pW = "<<pW<<endl; |
| 2238 | cout<<"eW = "<<eW<<endl; |
| 2239 | cout<<"nua = "<<nua<<endl; |
| 2240 | cout<<"ci = "<<cumulantIndex<<endl; |
| 2241 | } |
| 2242 | } // end of for(Int_t cumulantIndex=0;cumulantIndex<4;cumulantIndex++) |
| 2243 | } else // to if(diffFlowFinalCumulants[t][pW][eW][nua]) |
| 2244 | { |
| 2245 | cout<<"WARNING: diffFlowFinalCumulants[t][pW][eW][nua] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 2246 | cout<<"t = "<<t<<endl; |
| 2247 | cout<<"pW = "<<pW<<endl; |
| 2248 | cout<<"eW = "<<eW<<endl; |
| 2249 | cout<<"nua = "<<nua<<endl; |
| 2250 | } |
| 2251 | // flow: |
| 2252 | if(diffFlowFinalFlow[t][pW][eW][nua]) |
| 2253 | { |
| 2254 | for(Int_t flowIndex=0;flowIndex<4;flowIndex++) |
| 2255 | { |
| 2256 | // 2D: |
| 2257 | finalFlow2D[t][pW][eW][nua][flowIndex] = dynamic_cast<TH2D*>(diffFlowFinalFlow[t][pW][eW][nua]->FindObject(Form("%s, (p_{t},#eta)",flowName[flowIndex].Data()))); |
| 2258 | if(finalFlow2D[t][pW][eW][nua][flowIndex]) |
| 2259 | { |
| 2260 | this->SetFinalFlow2D(finalFlow2D[t][pW][eW][nua][flowIndex],t,pW,eW,nua,flowIndex); |
| 2261 | } else |
| 2262 | { |
| 2263 | cout<<"WARNING: finalFlow2D[t][pW][eW][nua][flowIndex] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 2264 | cout<<"t = "<<t<<endl; |
| 2265 | cout<<"pW = "<<pW<<endl; |
| 2266 | cout<<"eW = "<<eW<<endl; |
| 2267 | cout<<"nua = "<<nua<<endl; |
| 2268 | cout<<"ci = "<<flowIndex<<endl; |
| 2269 | } |
| 2270 | // pt: |
| 2271 | finalFlowPt[t][pW][eW][nua][flowIndex] = dynamic_cast<TH1D*>(diffFlowFinalFlow[t][pW][eW][nua]->FindObject(Form("%s, (p_{t})",flowName[flowIndex].Data()))); |
| 2272 | if(finalFlowPt[t][pW][eW][nua][flowIndex]) |
| 2273 | { |
| 2274 | this->SetFinalFlowPt(finalFlowPt[t][pW][eW][nua][flowIndex],t,pW,eW,nua,flowIndex); |
| 2275 | } else |
| 2276 | { |
| 2277 | cout<<"WARNING: finalFlow1D[t][pW][nua][flowIndex] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 2278 | cout<<"t = "<<t<<endl; |
| 2279 | cout<<"pW = "<<pW<<endl; |
| 2280 | cout<<"eW = "<<eW<<endl; |
| 2281 | cout<<"nua = "<<nua<<endl; |
| 2282 | cout<<"ci = "<<flowIndex<<endl; |
| 2283 | } |
| 2284 | // eta: |
| 2285 | finalFlowEta[t][pW][eW][nua][flowIndex] = dynamic_cast<TH1D*>(diffFlowFinalFlow[t][pW][eW][nua]->FindObject(Form("%s, (#eta)",flowName[flowIndex].Data()))); |
| 2286 | if(finalFlowEta[t][pW][eW][nua][flowIndex]) |
| 2287 | { |
| 2288 | this->SetFinalFlowEta(finalFlowEta[t][pW][eW][nua][flowIndex],t,pW,eW,nua,flowIndex); |
| 2289 | } else |
| 2290 | { |
| 2291 | cout<<"WARNING: finalFlow1D[t][pW][nua][flowIndex] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 2292 | cout<<"t = "<<t<<endl; |
| 2293 | cout<<"pW = "<<pW<<endl; |
| 2294 | cout<<"eW = "<<eW<<endl; |
| 2295 | cout<<"nua = "<<nua<<endl; |
| 2296 | cout<<"ci = "<<flowIndex<<endl; |
| 2297 | } |
| 2298 | } // end of for(Int_t flowIndex=0;flowIndex<4;flowIndex++) |
| 2299 | } else // to if(diffFlowFinalFlow[t][pW][eW][nua]) |
| 2300 | { |
| 2301 | cout<<"WARNING: diffFlowFinalFlow[t][pW][eW][nua] is NULL in AFAWQC::GOH() !!!!"<<endl; |
| 2302 | cout<<"t = "<<t<<endl; |
| 2303 | cout<<"pW = "<<pW<<endl; |
| 2304 | cout<<"eW = "<<eW<<endl; |
| 2305 | cout<<"nua = "<<nua<<endl; |
| 2306 | } |
| 2307 | } // end of for(Int_t nua=0;nua<2;nua++) |
| 2308 | } // end of for(Int_t eW=0;eW<2;eW++) |
| 2309 | } // end of for(Int_t pW=0;pW<(1+(Int_t)(bUsePhiWeights||bUsePtWeights||bUseEtaWeights));pW++) |
| 2310 | } // end of for(Int_t t=0;t<2;t++) |
| 2311 | |
| 2312 | // x.) nested loops: |
| 2313 | TList *nestedLoopsList = dynamic_cast<TList*>(outputListHistos->FindObject("Nested Loops")); |
| 2314 | if(nestedLoopsList) this->SetNestedLoopsList(nestedLoopsList); |
| 2315 | TProfile *evaluateNestedLoops = dynamic_cast<TProfile*>(nestedLoopsList->FindObject("fEvaluateNestedLoops")); |
| 2316 | Bool_t bEvaluateNestedLoopsForIntFlow = kFALSE; |
| 2317 | Bool_t bEvaluateNestedLoopsForDiffFlow = kFALSE; |
| 2318 | if(evaluateNestedLoops) |
| 2319 | { |
| 2320 | this->SetEvaluateNestedLoops(evaluateNestedLoops); |
| 2321 | bEvaluateNestedLoopsForIntFlow = (Int_t)evaluateNestedLoops->GetBinContent(1); |
| 2322 | bEvaluateNestedLoopsForDiffFlow = (Int_t)evaluateNestedLoops->GetBinContent(2); |
| 2323 | } |
| 9c1a9547 |
2324 | |
| 2aa4ebcd |
2325 | if(bEvaluateNestedLoopsForIntFlow) |
| 2326 | { |
| 2327 | TProfile *directCorrelations = dynamic_cast<TProfile*>(nestedLoopsList->FindObject("fDirectCorrelation")); |
| 2328 | if(directCorrelations) this->SetDirectCorrelations(directCorrelations); |
| 2329 | TProfile *directCorrectionsCos = dynamic_cast<TProfile*>(nestedLoopsList->FindObject("fDirectCorrectionsCos")); |
| 2330 | if(directCorrectionsCos) this->SetDirectCorrectionsCos(directCorrectionsCos); |
| 2331 | TProfile *directCorrectionsSin = dynamic_cast<TProfile*>(nestedLoopsList->FindObject("fDirectCorrectionsSin")); |
| 2332 | if(directCorrectionsSin) this->SetDirectCorrectionsSin(directCorrectionsSin); |
| 2333 | if(bUsePhiWeights||bUsePtWeights||bUseEtaWeights) |
| 2334 | { |
| 2335 | TProfile *directCorrelationsW = dynamic_cast<TProfile*>(nestedLoopsList->FindObject("fDirectCorrelationW")); |
| 2336 | if(directCorrelationsW) this->SetDirectCorrelationsW(directCorrelationsW); |
| 2337 | TProfile *directCorrectionsCosW = dynamic_cast<TProfile*>(nestedLoopsList->FindObject("fDirectCorrectionsCosW")); |
| 2338 | if(directCorrectionsCosW) this->SetDirectCorrectionsCosW(directCorrectionsCosW); |
| 2339 | TProfile *directCorrectionsSinW = dynamic_cast<TProfile*>(nestedLoopsList->FindObject("fDirectCorrectionsSinW")); |
| 2340 | if(directCorrectionsSinW) this->SetDirectCorrectionsSinW(directCorrectionsSinW); |
| 2341 | } |
| 2342 | } |
| 2343 | |
| 2344 | if(bEvaluateNestedLoopsForDiffFlow) |
| 2345 | { |
| 2346 | TProfile *directCorrelationsDiffFlow = dynamic_cast<TProfile*>(nestedLoopsList->FindObject("fDirectCorrelationsDiffFlow")); |
| 2347 | if(directCorrelationsDiffFlow) this->SetDirectCorrelationsDiffFlow(directCorrelationsDiffFlow); |
| 2348 | TProfile *directCorrectionsDiffFlowCos = dynamic_cast<TProfile*>(nestedLoopsList->FindObject("fDirectCorrectionsDiffFlowCos")); |
| 2349 | if(directCorrectionsDiffFlowCos) this->SetDirectCorrectionsDiffFlowCos(directCorrectionsDiffFlowCos); |
| 2350 | TProfile *directCorrectionsDiffFlowSin = dynamic_cast<TProfile*>(nestedLoopsList->FindObject("fDirectCorrectionsDiffFlowSin")); |
| 2351 | if(directCorrectionsDiffFlowSin) this->SetDirectCorrectionsDiffFlowSin(directCorrectionsDiffFlowSin); |
| 2352 | if(bUsePhiWeights||bUsePtWeights||bUseEtaWeights) |
| 2353 | { |
| 2354 | TProfile *directCorrelationsDiffFlowW = dynamic_cast<TProfile*>(nestedLoopsList->FindObject("fDirectCorrelationsDiffFlowW")); |
| 2355 | if(directCorrelationsDiffFlowW) this->SetDirectCorrelationsDiffFlowW(directCorrelationsDiffFlowW); |
| 2356 | TProfile *directCorrectionsDiffFlowCosW = dynamic_cast<TProfile*>(nestedLoopsList->FindObject("fDirectCorrectionsDiffFlowCosW")); |
| 2357 | if(directCorrectionsDiffFlowCosW) this->SetDirectCorrectionsDiffFlowCosW(directCorrectionsDiffFlowCosW); |
| 2358 | TProfile *directCorrectionsDiffFlowSinW = dynamic_cast<TProfile*>(nestedLoopsList->FindObject("fDirectCorrectionsDiffFlowSinW")); |
| 2359 | if(directCorrectionsDiffFlowSinW) this->SetDirectCorrectionsDiffFlowSinW(directCorrectionsDiffFlowSinW); |
| 2360 | } |
| 2361 | } |
| 2362 | |
| 2363 | } |
| 2364 | } |
| bc92c0cb |
2365 | |
| 2366 | |
| 9c1a9547 |
2367 | //================================================================================================================================ |
| bc92c0cb |
2368 | |
| 2369 | |
| 2aa4ebcd |
2370 | TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) const |
| 9c1a9547 |
2371 | { |
| 2aa4ebcd |
2372 | // project 2D profile onto pt axis to get 1D profile |
| 9c1a9547 |
2373 | |
| 2aa4ebcd |
2374 | Int_t nBinsPt = profilePtEta->GetNbinsX(); |
| 2375 | Double_t dPtMin = (profilePtEta->GetXaxis())->GetXmin(); |
| 2376 | Double_t dPtMax = (profilePtEta->GetXaxis())->GetXmax(); |
| 9c1a9547 |
2377 | |
| 2aa4ebcd |
2378 | Int_t nBinsEta = profilePtEta->GetNbinsY(); |
| 9c1a9547 |
2379 | |
| 2aa4ebcd |
2380 | TProfile *profilePt = new TProfile("","",nBinsPt,dPtMin,dPtMax); |
| 9c1a9547 |
2381 | |
| 2aa4ebcd |
2382 | for(Int_t p=1;p<=nBinsPt;p++) |
| 2383 | { |
| 2384 | Double_t contentPt = 0.; |
| 2385 | Double_t entryPt = 0.; |
| 2386 | Double_t spreadPt = 0.; |
| 2387 | Double_t sum1 = 0.; |
| 2388 | Double_t sum2 = 0.; |
| 2389 | Double_t sum3 = 0.; |
| 2390 | for(Int_t e=1;e<=nBinsEta;e++) |
| 9c1a9547 |
2391 | { |
| 2aa4ebcd |
2392 | contentPt += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))) |
| 2393 | * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); |
| 2394 | entryPt += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); |
| 2395 | |
| 2396 | sum1 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))) |
| 2397 | * (pow(profilePtEta->GetBinError(profilePtEta->GetBin(p,e)),2.) |
| 2398 | + pow(profilePtEta->GetBinContent(profilePtEta->GetBin(p,e)),2.)); |
| 2399 | sum2 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); |
| 2400 | sum3 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))) |
| 2401 | * (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))); |
| 9c1a9547 |
2402 | } |
| 2aa4ebcd |
2403 | if(sum2>0. && sum1/sum2-pow(sum3/sum2,2.) > 0.) |
| 9c1a9547 |
2404 | { |
| 2aa4ebcd |
2405 | spreadPt = pow(sum1/sum2-pow(sum3/sum2,2.),0.5); |
| 9c1a9547 |
2406 | } |
| 2aa4ebcd |
2407 | profilePt->SetBinContent(p,contentPt); |
| 2408 | profilePt->SetBinEntries(p,entryPt); |
| 2409 | { |
| 2410 | profilePt->SetBinError(p,spreadPt); |
| 2411 | } |
| 2412 | |
| 2413 | } |
| 2414 | |
| 2415 | return profilePt; |
| 2416 | |
| 2417 | } // end of TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) |
| 2418 | |
| 2419 | |
| 2420 | //================================================================================================================================ |
| 2421 | |
| 2422 | |
| 2423 | TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) const |
| 2424 | { |
| 2425 | // project 2D profile onto eta axis to get 1D profile |
| 2426 | |
| 2427 | Int_t nBinsEta = profilePtEta->GetNbinsY(); |
| 2428 | Double_t dEtaMin = (profilePtEta->GetYaxis())->GetXmin(); |
| 2429 | Double_t dEtaMax = (profilePtEta->GetYaxis())->GetXmax(); |
| 2430 | |
| 2431 | Int_t nBinsPt = profilePtEta->GetNbinsX(); |
| 2432 | |
| 2433 | TProfile *profileEta = new TProfile("","",nBinsEta,dEtaMin,dEtaMax); |
| 2434 | |
| 2435 | for(Int_t e=1;e<=nBinsEta;e++) |
| 2436 | { |
| 2437 | Double_t contentEta = 0.; |
| 2438 | Double_t entryEta = 0.; |
| 2439 | for(Int_t p=1;p<=nBinsPt;p++) |
| 9c1a9547 |
2440 | { |
| 2aa4ebcd |
2441 | contentEta += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))) |
| 2442 | * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); |
| 2443 | entryEta += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); |
| 9c1a9547 |
2444 | } |
| 2aa4ebcd |
2445 | profileEta->SetBinContent(e,contentEta); |
| 2446 | profileEta->SetBinEntries(e,entryEta); |
| 2447 | } |
| 9c1a9547 |
2448 | |
| 2aa4ebcd |
2449 | return profileEta; |
| 9c1a9547 |
2450 | |
| 2aa4ebcd |
2451 | } // end of TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) |
| 2452 | |
| 2453 | |
| 2454 | //================================================================================================================================ |
| 2455 | |
| 2456 | |
| 2457 | void AliFlowAnalysisWithQCumulants::CalculateFinalCorrectionsForNonUniformAcceptanceForCumulantsForIntFlow(Bool_t useParticleWeights, TString eventWeights) |
| 2458 | { |
| 2459 | // calculate final corrections for non-uniform acceptance for QC{2}, QC{4}, QC{6} and QC{8} |
| 9c1a9547 |
2460 | |
| 2aa4ebcd |
2461 | // corrections for non-uniform acceptance (NUA) are stored in histogram fCorrectionsForNUA, |
| 2462 | // binning of fCorrectionsForNUA is organized as follows: |
| 2463 | // |
| 2464 | // 1st bin: correction to QC{2} |
| 2465 | // 2nd bin: correction to QC{4} |
| 2466 | // 3rd bin: correction to QC{6} |
| 2467 | // 4th bin: correction to QC{8} |
| 9c1a9547 |
2468 | |
| 2aa4ebcd |
2469 | // shortcuts flags: |
| 2470 | Int_t pW = (Int_t)(useParticleWeights); |
| 2471 | |
| 2472 | Int_t eW = -1; |
| 2473 | |
| 2474 | if(eventWeights == "exact") |
| 2475 | { |
| 2476 | eW = 0; |
| 2477 | } |
| 2478 | |
| 2479 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms flag |
| 2480 | { |
| 2481 | if(!(fQCorrelations[pW][eW] && fQCorrections[pW][eW][sc] && fCorrections[pW][eW])) |
| 2482 | { |
| 2483 | cout<<"WARNING: fQCorrelations[pW][eW] && fQCorrections[pW][eW][sc] && fCorrections[pW][eW] is NULL in AFAWQC::CFCFNUAFIF() !!!!"<<endl; |
| 2484 | cout<<"pW = "<<pW<<endl; |
| 2485 | cout<<"eW = "<<eW<<endl; |
| 2486 | cout<<"sc = "<<sc<<endl; |
| 2487 | exit(0); |
| 2488 | } |
| 2489 | } |
| 2490 | |
| 2491 | // measured 2-, 4-, 6- and 8-particle azimuthal correlations (biased with non-uniform acceptance!): |
| 2492 | Double_t two = fQCorrelations[pW][eW]->GetBinContent(1); // <<2>> |
| 2493 | //Double_t four = fQCorrelations[pW][eW]->GetBinContent(11); // <<4>> |
| 2494 | //Double_t six = fQCorrelations[pW][eW]->GetBinContent(24); // <<6>> |
| 2495 | //Double_t eight = fQCorrelations[pW][eW]->GetBinContent(31); // <<8>> |
| 2496 | |
| 2497 | // correction terms to QC{2}: |
| 2498 | // <<cos(n*phi1)>>^2 |
| 2499 | Double_t two1stTerm = pow(fQCorrections[pW][eW][1]->GetBinContent(1),2); |
| 2500 | // <<sin(n*phi1)>>^2 |
| 2501 | Double_t two2ndTerm = pow(fQCorrections[pW][eW][0]->GetBinContent(1),2); |
| 2502 | // final corrections for non-uniform acceptance to QC{2}: |
| 2503 | Double_t correctionQC2 = -1.*two1stTerm-1.*two2ndTerm; |
| 2504 | fCorrections[pW][eW]->SetBinContent(1,correctionQC2); |
| 2505 | |
| 2506 | // correction terms to QC{4}: |
| 2507 | // <<cos(n*phi1)>> <<cos(n*(phi1-phi2-phi3))>> |
| 2508 | Double_t four1stTerm = fQCorrections[pW][eW][1]->GetBinContent(1)*fQCorrections[pW][eW][1]->GetBinContent(3); |
| 2509 | // <<sin(n*phi1)>> <<sin(n*(phi1-phi2-phi3))>> |
| 2510 | Double_t four2ndTerm = fQCorrections[pW][eW][0]->GetBinContent(1)*fQCorrections[pW][eW][0]->GetBinContent(3); |
| 2511 | // <<cos(n*(phi1+phi2))>>^2 |
| 2512 | Double_t four3rdTerm = pow(fQCorrections[pW][eW][1]->GetBinContent(2),2); |
| 2513 | // <<sin(n*(phi1+phi2))>>^2 |
| 2514 | Double_t four4thTerm = pow(fQCorrections[pW][eW][0]->GetBinContent(2),2); |
| 2515 | // <<cos(n*(phi1+phi2))>> (<<cos(n*phi1)>>^2 - <<sin(n*phi1)>>^2) |
| 2516 | Double_t four5thTerm = fQCorrections[pW][eW][1]->GetBinContent(2) |
| 2517 | * (pow(fQCorrections[pW][eW][1]->GetBinContent(1),2)-pow(fQCorrections[pW][eW][0]->GetBinContent(1),2)); |
| 2518 | // <<sin(n*(phi1+phi2))>> <<cos(n*phi1)>> <<sin(n*phi1)>> |
| 2519 | Double_t four6thTerm = fQCorrections[pW][eW][0]->GetBinContent(2) |
| 2520 | * fQCorrections[pW][eW][1]->GetBinContent(1) |
| 2521 | * fQCorrections[pW][eW][0]->GetBinContent(1); |
| 2522 | // <<cos(n*(phi1-phi2))>> (<<cos(n*phi1)>>^2 + <<sin(n*phi1)>>^2) |
| 2523 | Double_t four7thTerm = two*(pow(fQCorrections[pW][eW][1]->GetBinContent(1),2)+pow(fQCorrections[pW][eW][0]->GetBinContent(1),2)); |
| 2524 | // (<<cos(n*phi1)>>^2 + <<sin(n*phi1)>>^2)^2 |
| 2525 | Double_t four8thTerm = pow(pow(fQCorrections[pW][eW][1]->GetBinContent(1),2)+pow(fQCorrections[pW][eW][0]->GetBinContent(1),2),2); |
| 2526 | // final correction to QC{4}: |
| 2527 | Double_t correctionQC4 = -4.*four1stTerm+4.*four2ndTerm-four3rdTerm-four4thTerm |
| 2528 | + 4.*four5thTerm+8.*four6thTerm+8.*four7thTerm-6.*four8thTerm; |
| 2529 | fCorrections[pW][eW]->SetBinContent(2,correctionQC4); |
| 2530 | |
| 2531 | // ... to be improved (continued for 6th and 8th order) |
| 2532 | |
| 2533 | } // end of AliFlowAnalysisWithQCumulants::CalculateFinalCorrectionsForNonUniformAcceptanceForCumulantsForIntFlow(Bool_t useParticleWeights, TString eventWeights) |
| bc92c0cb |
2534 | |
| 2535 | |
| 9c1a9547 |
2536 | //================================================================================================================================ |
| bc92c0cb |
2537 | |
| 2538 | |
| 2aa4ebcd |
2539 | void AliFlowAnalysisWithQCumulants::CalculateFinalCorrectionsForNonUniformAcceptanceForDifferentialFlow(Bool_t useParticleWeights,TString type) |
| 2540 | { |
| 2541 | |
| 2542 | useParticleWeights=kFALSE; |
| 2543 | type="ac"; |
| 2544 | |
| 2545 | // calculate final corrections due to non-uniform acceptance of the detector to reduced multi-particle correlations |
| 2546 | /* |
| 2547 | if(!(useParticleWeights)) |
| 2548 | { |
| 2549 | if(type == "POI") |
| 2550 | { |
| 2551 | // **** corrections for non-uniform acceptance for 2nd order QC' for POI's **** |
| 2552 | |
| 2553 | // 1st term: <<cos(n*psi)>><<cos(n*phi)>>: |
| 2554 | if(fCorrectionsCosP1nPsiPtEtaPOI && fQCorrectionsCos) |
| 2555 | { |
| 2556 | // pt,eta: |
| 2557 | if(f2pFinalCorrectionsForNUAPtEtaPOI) f2pFinalCorrectionsForNUAPtEtaPOI->Reset(); // to be improved |
| 2558 | TH2D *correctionPtEta1stTerm = new TH2D(*(fCorrectionsCosP1nPsiPtEtaPOI->ProjectionXY("","e"))); |
| 2559 | correctionPtEta1stTerm->Scale(fQCorrectionsCos->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 2560 | if(f2pFinalCorrectionsForNUAPtEtaPOI) f2pFinalCorrectionsForNUAPtEtaPOI->Add(correctionPtEta1stTerm); // to be improved (if condition goes somewhere else) |
| 2561 | delete correctionPtEta1stTerm; |
| 2562 | // pt: |
| 2563 | if(f2pFinalCorrectionsForNUAPtPOI) f2pFinalCorrectionsForNUAPtPOI->Reset(); // to be improved |
| 2564 | TH1D *correctionPt1stTerm = new TH1D(*((this->MakePtProjection(fCorrectionsCosP1nPsiPtEtaPOI))->ProjectionX("","e"))); // to be improved: are errors propagated correctly here? |
| 2565 | correctionPt1stTerm->Scale(fQCorrectionsCos->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 2566 | if(f2pFinalCorrectionsForNUAPtPOI) f2pFinalCorrectionsForNUAPtPOI->Add(correctionPt1stTerm); // to be improved (if condition goes somewhere else) |
| 2567 | delete correctionPt1stTerm; |
| 2568 | // eta: |
| 2569 | if(f2pFinalCorrectionsForNUAEtaPOI) f2pFinalCorrectionsForNUAEtaPOI->Reset(); // to be improved |
| 2570 | TH1D *correctionEta1stTerm = new TH1D(*((this->MakeEtaProjection(fCorrectionsCosP1nPsiPtEtaPOI))->ProjectionX("","e"))); // to be improved: are errors propagated correctly here? |
| 2571 | correctionEta1stTerm->Scale(fQCorrectionsCos->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 2572 | if(f2pFinalCorrectionsForNUAEtaPOI) f2pFinalCorrectionsForNUAEtaPOI->Add(correctionEta1stTerm); // to be improved (if condition goes somewhere else) |
| 2573 | delete correctionEta1stTerm; |
| 2574 | } else |
| 2575 | { |
| 2576 | cout<<"WARNING: (fCorrectionsCosP1nPsiPtEtaPOI && fQCorrectionsCos && f2pFinalCorrectionsForNUAPtEtaPOI) is NULL in QC::CFCFNUAFDF() !!!! "<<endl; |
| 2577 | cout<<" Corrections for non-uniform acceptance for differential flow are not correct."<<endl; |
| 2578 | } |
| 2579 | |
| 2580 | // 2nd term: <<sin(n*psi)>><<sin(n*phi)>>: |
| 2581 | if(fCorrectionsSinP1nPsiPtEtaPOI && fQCorrectionsSin) |
| 2582 | { |
| 2583 | // pt,eta: |
| 2584 | TH2D *correctionPtEta2ndTerm = new TH2D(*(fCorrectionsSinP1nPsiPtEtaPOI->ProjectionXY("","e"))); |
| 2585 | correctionPtEta2ndTerm->Scale(fQCorrectionsSin->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 2586 | if(f2pFinalCorrectionsForNUAPtEtaPOI) f2pFinalCorrectionsForNUAPtEtaPOI->Add(correctionPtEta2ndTerm); // to be improved (if condition goes somewhere else) |
| 2587 | delete correctionPtEta2ndTerm; |
| 2588 | // pt: |
| 2589 | TH1D *correctionPt2ndTerm = new TH1D(*((this->MakePtProjection(fCorrectionsSinP1nPsiPtEtaPOI))->ProjectionX("","e"))); // to be improved: are errors propagated correctly here? |
| 2590 | correctionPt2ndTerm->Scale(fQCorrectionsSin->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 2591 | if(f2pFinalCorrectionsForNUAPtPOI) f2pFinalCorrectionsForNUAPtPOI->Add(correctionPt2ndTerm); // to be improved (if condition goes somewhere else) |
| 2592 | delete correctionPt2ndTerm; |
| 2593 | // eta: |
| 2594 | TH1D *correctionEta2ndTerm = new TH1D(*((this->MakeEtaProjection(fCorrectionsSinP1nPsiPtEtaPOI))->ProjectionX("","e"))); // to be improved: are errors propagated correctly here? |
| 2595 | correctionEta2ndTerm->Scale(fQCorrectionsSin->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 2596 | if(f2pFinalCorrectionsForNUAEtaPOI) f2pFinalCorrectionsForNUAEtaPOI->Add(correctionEta2ndTerm); // to be improved (if condition goes somewhere else) |
| 2597 | delete correctionEta2ndTerm; |
| 2598 | } else |
| 2599 | { |
| 2600 | cout<<"WARNING: (fCorrectionsSinP1nPsiPtEtaPOI && fQCorrectionsSin) is NULL in QC::CFCFNUAFDF() !!!! "<<endl; |
| 2601 | cout<<" Corrections for non-uniform acceptance for differential flow are not correct."<<endl; |
| 2602 | } |
| 2603 | } else if(type == "RP") |
| 2604 | { |
| 2605 | // **** corrections for non-uniform acceptance for 2nd order QC' for RP's **** |
| 2606 | |
| 2607 | // 1st term: <<cos(n*psi)>><<cos(n*phi)>>: |
| 2608 | if(fCorrectionsCosP1nPsiPtEtaRP && fQCorrectionsCos) |
| 2609 | { |
| 2610 | // pt,eta: |
| 2611 | if(f2pFinalCorrectionsForNUAPtEtaRP) f2pFinalCorrectionsForNUAPtEtaRP->Reset(); // to be improved |
| 2612 | TH2D *correctionPtEta1stTerm = new TH2D(*(fCorrectionsCosP1nPsiPtEtaRP->ProjectionXY("","e"))); |
| 2613 | correctionPtEta1stTerm->Scale(fQCorrectionsCos->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 2614 | if(f2pFinalCorrectionsForNUAPtEtaRP) f2pFinalCorrectionsForNUAPtEtaRP->Add(correctionPtEta1stTerm); // to be improved (if condition goes somewhere else) |
| 2615 | delete correctionPtEta1stTerm; |
| 2616 | // pt: |
| 2617 | if(f2pFinalCorrectionsForNUAPtRP) f2pFinalCorrectionsForNUAPtRP->Reset(); // to be improved |
| 2618 | TH1D *correctionPt1stTerm = new TH1D(*((this->MakePtProjection(fCorrectionsCosP1nPsiPtEtaRP))->ProjectionX("","e"))); // to be improved: are errors propagated correctly here? |
| 2619 | correctionPt1stTerm->Scale(fQCorrectionsCos->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 2620 | if(f2pFinalCorrectionsForNUAPtRP) f2pFinalCorrectionsForNUAPtRP->Add(correctionPt1stTerm); // to be improved (if condition goes somewhere else) |
| 2621 | delete correctionPt1stTerm; |
| 2622 | // eta: |
| 2623 | if(f2pFinalCorrectionsForNUAEtaRP) f2pFinalCorrectionsForNUAEtaRP->Reset(); // to be improved |
| 2624 | TH1D *correctionEta1stTerm = new TH1D(*((this->MakeEtaProjection(fCorrectionsCosP1nPsiPtEtaRP))->ProjectionX("","e"))); // to be improved: are errors propagated correctly here? |
| 2625 | correctionEta1stTerm->Scale(fQCorrectionsCos->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 2626 | if(f2pFinalCorrectionsForNUAEtaRP) f2pFinalCorrectionsForNUAEtaRP->Add(correctionEta1stTerm); // to be improved (if condition goes somewhere else) |
| 2627 | delete correctionEta1stTerm; |
| 2628 | } else |
| 2629 | { |
| 2630 | cout<<"WARNING: (fCorrectionsCosP1nPsiPtEtaRP && fQCorrectionsCos) is NULL in QC::CFCFNUAFDF() !!!! "<<endl; |
| 2631 | cout<<" Corrections for non-uniform acceptance for differential flow are not correct."<<endl; |
| 2632 | } |
| 2633 | // 2nd term: <<sin(n*psi)>><<sin(n*phi)>>: |
| 2634 | if(fCorrectionsSinP1nPsiPtEtaRP && fQCorrectionsSin) |
| 2635 | { |
| 2636 | // pt,eta: |
| 2637 | TH2D *correctionPtEta2ndTerm = new TH2D(*(fCorrectionsSinP1nPsiPtEtaRP->ProjectionXY("","e"))); |
| 2638 | correctionPtEta2ndTerm->Scale(fQCorrectionsSin->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 2639 | if(f2pFinalCorrectionsForNUAPtEtaRP) f2pFinalCorrectionsForNUAPtEtaRP->Add(correctionPtEta2ndTerm); // to be improved (if condition goes somewhere else) |
| 2640 | delete correctionPtEta2ndTerm; |
| 2641 | // pt: |
| 2642 | TH1D *correctionPt2ndTerm = new TH1D(*((this->MakePtProjection(fCorrectionsSinP1nPsiPtEtaRP))->ProjectionX("","e"))); // to be improved: are errors propagated correctly here? |
| 2643 | correctionPt2ndTerm->Scale(fQCorrectionsSin->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 2644 | if(f2pFinalCorrectionsForNUAPtRP) f2pFinalCorrectionsForNUAPtRP->Add(correctionPt2ndTerm); // to be improved (if condition goes somewhere else) |
| 2645 | delete correctionPt2ndTerm; |
| 2646 | // eta: |
| 2647 | TH1D *correctionEta2ndTerm = new TH1D(*((this->MakeEtaProjection(fCorrectionsSinP1nPsiPtEtaRP))->ProjectionX("","e"))); // to be improved: are errors propagated correctly here? |
| 2648 | correctionEta2ndTerm->Scale(fQCorrectionsSin->GetBinContent(1)); // to be improved: are errors propagated correctly here? |
| 2649 | if(f2pFinalCorrectionsForNUAEtaRP) f2pFinalCorrectionsForNUAEtaRP->Add(correctionEta2ndTerm); // to be improved (if condition goes somewhere else) |
| 2650 | delete correctionEta2ndTerm; |
| 2651 | } else |
| 2652 | { |
| 2653 | cout<<"WARNING: (fCorrectionsSinP1nPsiPtEtaRP && fQCorrectionsSin) is NULL in QC::CFCFNUAFDF() !!!! "<<endl; |
| 2654 | cout<<" Corrections for non-uniform acceptance for differential flow are not correct."<<endl; |
| 2655 | } |
| 2656 | } else // to else if(type == "RP") |
| 2657 | { |
| 2658 | cout<<"WARNING: Type must be either POI or RP in QC::CFCFNUAFDF() !!!! "<<endl; |
| 2659 | cout<<" Corrections for non-uniform acceptance for differential flow were not calculated."<<endl; |
| 2660 | } |
| 2661 | } else // to if(!(useParticleWeights)) |
| 2662 | { |
| 2663 | // ... |
| 2664 | } |
| 2665 | */ |
| 2666 | } // end of AliFlowAnalysisWithQCumulants::CalculateFinalCorrectionsForNonUniformAcceptanceForDifferentialFlow(Bool_t useParticleWeights,TString type) |
| 2667 | |
| 2668 | |
| 2669 | //================================================================================================================================== |
| 2670 | |
| 2671 | /* |
| 2672 | void AliFlowAnalysisWithQCumulants::CalculateFinalResultsForDifferentialFlow( |
| 2673 | TH2D *flowPtEta, TH1D *flowPt, TH1D *flowEta, |
| 2674 | TProfile2D *profile2ndPtEta, TProfile2D *profile4thPtEta, |
| 2675 | TProfile2D *profile6thPtEta, TProfile2D *profile8thPtEta) |
| 9c1a9547 |
2676 | { |
| 2aa4ebcd |
2677 | // calculate and store the final results for integrated flow |
| 2678 | |
| 2679 | TString *namePtEta = new TString(); |
| 2680 | TString *type = new TString(); |
| 2681 | TString *order2nd = new TString(); |
| 2682 | TString *order4th = new TString(); |
| 2683 | TString *order6th = new TString(); |
| 2684 | TString *order8th = new TString(); |
| 2685 | TString *pW = new TString(); |
| 2686 | |
| 2687 | if(profile2ndPtEta) *namePtEta = profile2ndPtEta->GetName(); |
| 2688 | if(namePtEta->Contains("POI")) *type = "POI"; |
| 2689 | if(namePtEta->Contains("RP")) *type = "RP"; |
| 2690 | if(namePtEta->Contains("W")) *pW = "W"; |
| 2691 | if(namePtEta->Contains("2")) *order2nd = "2"; |
| 2692 | if(profile4thPtEta) *namePtEta = profile4thPtEta->GetName(); |
| 2693 | if(namePtEta->Contains("4")) *order4th = "4"; |
| 2694 | |
| 2695 | if(profile6thPtEta) *namePtEta = profile6thPtEta->GetName(); |
| 2696 | if(namePtEta->Contains("6")) *order6th = "6"; |
| 9c1a9547 |
2697 | |
| 2aa4ebcd |
2698 | if(profile8thPtEta) *namePtEta = profile8thPtEta->GetName(); |
| 2699 | if(namePtEta->Contains("8")) *order8th = "8"; |
| 2700 | |
| 2701 | TProfile *profile2ndPt = NULL; |
| 2702 | TProfile *profile4thPt = NULL; |
| 2703 | TProfile *profile6thPt = NULL; |
| 2704 | TProfile *profile8thPt = NULL; |
| 2705 | |
| 2706 | TProfile *profile2ndEta = NULL; |
| 2707 | TProfile *profile4thEta = NULL; |
| 2708 | TProfile *profile6thEta = NULL; |
| 2709 | TProfile *profile8thEta = NULL; |
| 2710 | |
| 2711 | if(*order2nd == "2") |
| 2712 | { |
| 2713 | profile2ndPt = new TProfile(*(this->MakePtProjection(profile2ndPtEta))); |
| 2714 | profile2ndEta = new TProfile(*(this->MakeEtaProjection(profile2ndPtEta))); |
| 2715 | if(*order4th == "4") |
| 2716 | { |
| 2717 | profile4thPt = new TProfile(*(this->MakePtProjection(profile4thPtEta))); |
| 2718 | profile4thEta = new TProfile(*(this->MakeEtaProjection(profile4thPtEta))); |
| 2719 | if(*order6th == "6") |
| 2720 | { |
| 2721 | profile6thPt = new TProfile(*(this->MakePtProjection(profile6thPtEta))); |
| 2722 | profile6thEta = new TProfile(*(this->MakeEtaProjection(profile6thPtEta))); |
| 2723 | if(*order8th == "8") |
| 2724 | { |
| 2725 | profile8thPt = new TProfile(*(this->MakePtProjection(profile8thPtEta))); |
| 2726 | profile8thEta = new TProfile(*(this->MakeEtaProjection(profile8thPtEta))); |
| 2727 | } |
| 2728 | } |
| 2729 | } |
| 2730 | } |
| 9c1a9547 |
2731 | |
| 2aa4ebcd |
2732 | Int_t nBinsPt = profile2ndPt->GetNbinsX(); |
| 2733 | Int_t nBinsEta = profile2ndEta->GetNbinsX(); |
| 9c1a9547 |
2734 | |
| 2aa4ebcd |
2735 | Double_t dV2 = 0.; |
| 2736 | Double_t dV4 = 0.; |
| 2737 | Double_t dV6 = 0.; |
| 2738 | Double_t dV8 = 0.; |
| 9c1a9547 |
2739 | |
| 2aa4ebcd |
2740 | if(!(*pW == "W")) |
| 9c1a9547 |
2741 | { |
| 2aa4ebcd |
2742 | dV2 = fIntFlowResultsQC->GetBinContent(1); |
| 2743 | dV4 = fIntFlowResultsQC->GetBinContent(2); |
| 2744 | dV6 = fIntFlowResultsQC->GetBinContent(3); |
| 2745 | dV8 = fIntFlowResultsQC->GetBinContent(4); |
| 2746 | } |
| 2747 | else if(*pW == "W") |
| 2748 | { |
| 2749 | dV2 = fIntFlowResultsQCW->GetBinContent(1); |
| 2750 | dV4 = fIntFlowResultsQCW->GetBinContent(2); |
| 2751 | dV6 = fIntFlowResultsQCW->GetBinContent(3); |
| 2752 | dV8 = fIntFlowResultsQCW->GetBinContent(4); |
| 2753 | } |
| 2754 | |
| 2755 | // 3D (pt,eta): |
| 2756 | Double_t twoPrimePtEta = 0.; // <<2'>> (pt,eta) |
| 2757 | Double_t fourPrimePtEta = 0.; // <<4'>> (pt,eta) |
| 2758 | //Double_t sixPrimePtEta = 0.; // <<6'>> (pt,eta) |
| 2759 | //Double_t eightPrimePtEta = 0.; // <<8'>> (pt,eta) |
| 2760 | Double_t secondOrderDiffFlowCumulantPtEta = 0.; // d_n{2,Q} (pt,eta) |
| 2761 | Double_t fourthOrderDiffFlowCumulantPtEta = 0.; // d_n{4,Q} (pt,eta) |
| 2762 | //Double_t sixthOrderDiffFlowCumulantPtEta = 0.; // d_n{6,Q} (pt,eta) |
| 2763 | //Double_t eightOrderDiffFlowCumulantPtEta = 0.; // d_n{8,Q} (pt,eta)2nd |
| 2764 | Double_t dv2PtEta = 0.; // v'_n{2} (pt,eta) |
| 2765 | Double_t dv4PtEta = 0.; // v'_n{4} (pt,eta) |
| 2766 | //Double_t dv6PtEta = 0.; // v'_n{6} (pt,eta) |
| 2767 | //Double_t dv8PtEta = 0.; // v'_n{8} (pt,eta) |
| 9c1a9547 |
2768 | |
| 2aa4ebcd |
2769 | // 2D (pt): |
| 2770 | Double_t twoPrimePt = 0.; // <<2'>> (pt) |
| 2771 | Double_t fourPrimePt = 0.; // <<4'>> (pt) |
| 2772 | //Double_t sixPrimePt = 0.; // <<6'>> (pt) |
| 2773 | //Double_t eightPrimePt = 0.; // <<8'>> (pt) |
| 2774 | Double_t secondOrderDiffFlowCumulantPt = 0.; // d_n{2,Q} (pt) |
| 2775 | Double_t fourthOrderDiffFlowCumulantPt = 0.; // d_n{4,Q} (pt) |
| 2776 | //Double_t sixthOrderDiffFlowCumulantPt = 0.; // d_n{6,Q} (pt) |
| 2777 | //Double_t eightOrderDiffFlowCumulantPt = 0.; // d_n{8,Q} (pt) |
| 2778 | Double_t dv2Pt = 0.; // v'_n{2} (pt) |
| 2779 | Double_t dv4Pt = 0.; // v'_n{4} (pt) |
| 2780 | //Double_t dv6Pt = 0.; // v'_n{6} (pt) |
| 2781 | //Double_t dv8Pt = 0.; // v'_n{8} (pt) |
| 9c1a9547 |
2782 | |
| 2aa4ebcd |
2783 | // 2D (eta): |
| 2784 | Double_t twoPrimeEta = 0.; // <<2'>> (eta) |
| 2785 | Double_t fourPrimeEta = 0.; // <<4>> (eta) |
| 2786 | //Double_t sixPrimeEta = 0.; // <<6>> (eta) |
| 2787 | //Double_t eightPrimeEta = 0.; // <<8'>> (eta) |
| 2788 | Double_t secondOrderDiffFlowCumulantEta = 0.; // d_n{2,Q} (eta) |
| 2789 | Double_t fourthOrderDiffFlowCumulantEta = 0.; // d_n{4,Q} (eta) |
| 2790 | //Double_t sixthOrderDiffFlowCumulantEta = 0.; // d_n{6,Q} (eta) |
| 2791 | //Double_t eightOrderDiffFlowCumulantEta = 0.; // d_n{8,Q} (eta) |
| 2792 | Double_t dv2Eta = 0.; // v'_n{2} (eta) |
| 2793 | Double_t dv4Eta = 0.; // v'_n{4} (eta) |
| 2794 | //Double_t dv6Eta = 0.; // v'_n{6} (eta) |
| 2795 | //Double_t dv8Eta = 0.; // v'_n{8} (eta) |
| 2796 | |
| 9c1a9547 |
2797 | |
| 2aa4ebcd |
2798 | // looping over (pt,eta) bins to calculate v'(pt,eta) |
| 2799 | for(Int_t p=1;p<nBinsPt+1;p++) |
| 2800 | { |
| 2801 | for(Int_t e=1;e<nBinsEta+1;e++) |
| 2802 | { |
| 2803 | |
| 2804 | // 2nd order: |
| 2805 | twoPrimePtEta = profile2ndPtEta->GetBinContent(profile2ndPtEta->GetBin(p,e)); |
| 2806 | secondOrderDiffFlowCumulantPtEta = twoPrimePtEta; |
| 9c1a9547 |
2807 | |
| 2aa4ebcd |
2808 | |
| 2809 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| 2810 | // to be improved (applying correction for NUA): |
| 2811 | if(namePtEta->Contains("POI")) |
| 9c1a9547 |
2812 | { |
| 2aa4ebcd |
2813 | if(f2pFinalCorrectionsForNUAPtEtaPOI) secondOrderDiffFlowCumulantPtEta = twoPrimePtEta |
| 2814 | - f2pFinalCorrectionsForNUAPtEtaPOI->GetBinContent(f2pFinalCorrectionsForNUAPtEtaPOI->GetBin(p,e)) ; |
| 2815 | } else if (namePtEta->Contains("RP")) |
| 2816 | { |
| 2817 | if(f2pFinalCorrectionsForNUAPtEtaRP) secondOrderDiffFlowCumulantPtEta = twoPrimePtEta |
| 2818 | - f2pFinalCorrectionsForNUAPtEtaRP->GetBinContent(f2pFinalCorrectionsForNUAPtEtaRP->GetBin(p,e)); |
| 2819 | } |
| 2820 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| 9c1a9547 |
2821 | |
| 9c1a9547 |
2822 | |
| 2aa4ebcd |
2823 | if(dV2) |
| 9c1a9547 |
2824 | { |
| 2aa4ebcd |
2825 | dv2PtEta = secondOrderDiffFlowCumulantPtEta/dV2; |
| 2826 | if(*order2nd == "2") |
| 2827 | { |
| 2828 | flowPtEta->SetBinContent(p,e,dv2PtEta); |
| 2829 | } |
| 9c1a9547 |
2830 | } |
| 2831 | |
| 2aa4ebcd |
2832 | // 4th order: |
| 2833 | if(*order4th == "4" || *order6th == "6" || *order8th == "8") |
| 9c1a9547 |
2834 | { |
| 2aa4ebcd |
2835 | fourPrimePtEta = profile4thPtEta->GetBinContent(profile4thPtEta->GetBin(p,e)); |
| 2836 | fourthOrderDiffFlowCumulantPtEta = fourPrimePtEta - 2.*twoPrimePtEta*pow(dV2,2.); // to be improved (correlations instead of pow(dV2,2.)) |
| 2837 | if(dV4) |
| 9c1a9547 |
2838 | { |
| 2aa4ebcd |
2839 | dv4PtEta = -fourthOrderDiffFlowCumulantPtEta/pow(dV4,3); |
| 2840 | if(*order4th == "4") |
| 2841 | { |
| 2842 | flowPtEta->SetBinContent(p,e,dv4PtEta); |
| 2843 | } |
| 9c1a9547 |
2844 | } |
| 2aa4ebcd |
2845 | } |
| 9c1a9547 |
2846 | |
| 2aa4ebcd |
2847 | } // end of for(Int_t e=1;e<nBinsEta+1;e++) |
| 2848 | } // end of for(Int_t p=1;p<nBinsPt+1;p++) |
| 9c1a9547 |
2849 | |
| 9c1a9547 |
2850 | |
| 2aa4ebcd |
2851 | // looping over (pt) bins to calcualate v'(pt) |
| 2852 | for(Int_t p=1;p<nBinsPt+1;p++) |
| 2853 | { |
| 2854 | |
| 2855 | // 2nd order: |
| 2856 | twoPrimePt = profile2ndPt->GetBinContent(p); |
| 2857 | secondOrderDiffFlowCumulantPt = twoPrimePt; |
| 2858 | |
| 2859 | |
| 2860 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| 2861 | // to be improved (applying correction for NUA): |
| 2862 | if(namePtEta->Contains("POI")) |
| 2863 | { |
| 2864 | if(f2pFinalCorrectionsForNUAPtPOI) secondOrderDiffFlowCumulantPt = twoPrimePt |
| 2865 | - f2pFinalCorrectionsForNUAPtPOI->GetBinContent(p) ; |
| 2866 | } else if (namePtEta->Contains("RP")) |
| 2867 | { |
| 2868 | if(f2pFinalCorrectionsForNUAPtRP) secondOrderDiffFlowCumulantPt = twoPrimePt |
| 2869 | - f2pFinalCorrectionsForNUAPtRP->GetBinContent(p); |
| 2870 | } |
| 2871 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| 2872 | |
| 2873 | |
| 2874 | if(dV2) |
| 2875 | { |
| 2876 | dv2Pt = secondOrderDiffFlowCumulantPt/dV2; |
| 2877 | if(*order2nd == "2") |
| 9c1a9547 |
2878 | { |
| 2aa4ebcd |
2879 | flowPt->SetBinContent(p,dv2Pt); |
| 9c1a9547 |
2880 | } |
| 2881 | |
| 2aa4ebcd |
2882 | // common control histos: (to be improved fill only once. now they are filled first without weights and then with weights): |
| 2883 | if(namePtEta->Contains("POI") && *order2nd == "2") |
| 2884 | { |
| 2885 | fCommonHistsResults2nd->FillDifferentialFlowPtPOI(p,dv2Pt,0.); //to be improved (errors && bb or bb+1 ?) |
| 2886 | } |
| 2887 | else if(namePtEta->Contains("RP") && *order2nd == "2") |
| 9c1a9547 |
2888 | { |
| 2aa4ebcd |
2889 | fCommonHistsResults2nd->FillDifferentialFlowPtRP(p,dv2Pt,0.); //to be improved (errors && bb or bb+1 ?) |
| 2890 | } |
| 9c1a9547 |
2891 | |
| 2aa4ebcd |
2892 | } |
| 2893 | |
| 2894 | // 4th order: |
| 2895 | if(*order4th == "4" || *order6th == "6" || *order8th == "8") |
| 2896 | { |
| 2897 | fourPrimePt = profile4thPt->GetBinContent(profile4thPt->GetBin(p)); |
| 2898 | fourthOrderDiffFlowCumulantPt = fourPrimePt - 2.*twoPrimePt*pow(dV2,2.); // to be improved (correlations instead of pow(dV2,2.)) |
| 2899 | if(dV4) |
| 2900 | { |
| 2901 | dv4Pt = -fourthOrderDiffFlowCumulantPt/pow(dV4,3); |
| 2902 | if(*order4th == "4") |
| 9c1a9547 |
2903 | { |
| 2aa4ebcd |
2904 | flowPt->SetBinContent(p,dv4Pt); |
| 9c1a9547 |
2905 | } |
| 2aa4ebcd |
2906 | |
| 2907 | // common control histos: (to be improved): |
| 2908 | if(namePtEta->Contains("POI") && *order4th == "4") |
| 2909 | { |
| 2910 | fCommonHistsResults4th->FillDifferentialFlowPtPOI(p,dv4Pt,0.); //to be improved (errors && bb or bb+1 ?) |
| 2911 | } |
| 2912 | else if(namePtEta->Contains("RP") && *order4th == "4" ) |
| 9c1a9547 |
2913 | { |
| 2aa4ebcd |
2914 | fCommonHistsResults4th->FillDifferentialFlowPtRP(p,dv4Pt,0.); //to be improved (errors && bb or bb+1 ?) |
| 9c1a9547 |
2915 | } |
| 2aa4ebcd |
2916 | |
| 2917 | } |
| 2918 | } |
| 2919 | |
| 2920 | } // end of for(Int_t p=1;p<nBinsPt+1;p++) |
| 2921 | |
| 2922 | |
| 2923 | // looping over (eta) bins to calcualate v'(eta) |
| 2924 | for(Int_t e=1;e<nBinsEta+1;e++) |
| 2925 | { |
| 2926 | |
| 2927 | // 2nd order: |
| 2928 | twoPrimeEta = profile2ndEta->GetBinContent(e); |
| 2929 | secondOrderDiffFlowCumulantEta = twoPrimeEta; |
| 2930 | |
| 2931 | |
| 2932 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| 2933 | // to be improved (applying correction for NUA): |
| 2934 | if(namePtEta->Contains("POI")) |
| 2935 | { |
| 2936 | if(f2pFinalCorrectionsForNUAEtaPOI) secondOrderDiffFlowCumulantEta = twoPrimeEta |
| 2937 | - f2pFinalCorrectionsForNUAEtaPOI->GetBinContent(e) ; |
| 2938 | } else if (namePtEta->Contains("RP")) |
| 2939 | { |
| 2940 | if(f2pFinalCorrectionsForNUAEtaRP) secondOrderDiffFlowCumulantEta = twoPrimeEta |
| 2941 | - f2pFinalCorrectionsForNUAEtaRP->GetBinContent(e); |
| 2942 | } |
| 2943 | //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx |
| 2944 | |
| 2945 | |
| 2946 | if(dV2) |
| 2947 | { |
| 2948 | dv2Eta = secondOrderDiffFlowCumulantEta/dV2; |
| 2949 | if(*order2nd == "2") |
| 9c1a9547 |
2950 | { |
| 2aa4ebcd |
2951 | flowEta->SetBinContent(e,dv2Eta); |
| 2952 | } |
| 9c1a9547 |
2953 | |
| 2aa4ebcd |
2954 | // common control histos: (to be improved): |
| 2955 | if(namePtEta->Contains("POI") && *order2nd == "2") |
| 2956 | { |
| 2957 | fCommonHistsResults2nd->FillDifferentialFlowEtaPOI(e,dv2Eta,0.); //to be improved (errors && bb or bb+1 ?) |
| 2958 | } |
| 2959 | else if(namePtEta->Contains("RP") && *order2nd == "2") |
| 2960 | { |
| 2961 | fCommonHistsResults2nd->FillDifferentialFlowEtaRP(e,dv2Eta,0.); //to be improved (errors && bb or bb+1 ?) |
| 2962 | } |
| 2963 | |
| 2964 | |
| 2965 | } |
| 2966 | |
| 2967 | // 4th order: |
| 2968 | if(*order4th == "4" || *order6th == "6" || *order8th == "8") |
| 2969 | { |
| 2970 | fourPrimeEta = profile4thEta->GetBinContent(profile4thEta->GetBin(e)); |
| 2971 | fourthOrderDiffFlowCumulantEta = fourPrimeEta - 2.*twoPrimeEta*pow(dV2,2.); // to be improved (correlations instead of pow(dV2,2.)) |
| 2972 | if(dV4) |
| 2973 | { |
| 2974 | dv4Eta = -fourthOrderDiffFlowCumulantEta/pow(dV4,3); |
| 2975 | if(*order4th == "4") |
| 9c1a9547 |
2976 | { |
| 2aa4ebcd |
2977 | flowEta->SetBinContent(e,dv4Eta); |
| 9c1a9547 |
2978 | } |
| 2aa4ebcd |
2979 | |
| 2980 | // common control histos: (to be improved): |
| 2981 | if(namePtEta->Contains("POI") && *order4th == "4") |
| 2982 | { |
| 2983 | fCommonHistsResults4th->FillDifferentialFlowEtaPOI(e,dv4Eta,0.); //to be improved (errors && bb or bb+1 ?) |
| 2984 | } |
| 2985 | else if(namePtEta->Contains("RP") && *order4th == "4") |
| 9c1a9547 |
2986 | { |
| 2aa4ebcd |
2987 | fCommonHistsResults4th->FillDifferentialFlowEtaRP(e,dv4Eta,0.); //to be improved (errors && bb or bb+1 ?) |
| 9c1a9547 |
2988 | } |
| 2aa4ebcd |
2989 | |
| 2990 | } |
| 2991 | } |
| 9c1a9547 |
2992 | |
| 2aa4ebcd |
2993 | } // end of for(Int_t e=1;e<nBinsEta+1;e++) |
| 2994 | |
| 2995 | delete namePtEta; |
| 2996 | delete type; |
| 2997 | delete order2nd; |
| 2998 | delete order4th; |
| 2999 | delete order6th; |
| 3000 | delete order8th; |
| 3001 | delete pW; |
| 3002 | delete profile2ndPt; |
| 3003 | delete profile4thPt; |
| 3004 | delete profile6thPt; |
| 3005 | delete profile8thPt; |
| 3006 | delete profile2ndEta; |
| 3007 | delete profile4thEta; |
| 3008 | delete profile6thEta; |
| 3009 | delete profile8thEta; |
| bc92c0cb |
3010 | |
| 2aa4ebcd |
3011 | } // end of AliFlowAnalysisWithQCumulants::CalculateFinalResultsForDifferentialFlow(Bool_t useParticleWeights, TString type) |
| 3012 | */ |
| bc92c0cb |
3013 | |
| 9c1a9547 |
3014 | //================================================================================================================================ |
| bc92c0cb |
3015 | |
| 3016 | |
| 2aa4ebcd |
3017 | void AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type) |
| c365fe76 |
3018 | { |
| 2aa4ebcd |
3019 | // printing on the screen the final results for integrated flow (NONAME, POI and RP) // to be improved (NONAME) |
| c365fe76 |
3020 | |
| 2aa4ebcd |
3021 | Int_t n = fHarmonic; |
| c365fe76 |
3022 | |
| 2aa4ebcd |
3023 | if(type == "NONAME" || type == "RP" || type == "POI") |
| c365fe76 |
3024 | { |
| 2aa4ebcd |
3025 | if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th)) |
| 3026 | { |
| 3027 | cout<<"WARNING: fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th"<<endl; |
| 3028 | cout<<" is NULL in AFAWQC::PFRFIF() !!!!"<<endl; |
| 3029 | } |
| 3030 | } else |
| 3031 | { |
| 3032 | cout<<"WARNING: type in not from {NONAME, RP, POI} in AFAWQC::PFRFIF() !!!!"<<endl; |
| 3033 | exit(0); |
| 3034 | } |
| c365fe76 |
3035 | |
| 2aa4ebcd |
3036 | Double_t dVn[4] = {0.}; // array to hold Vn{2}, Vn{4}, Vn{6} and Vn{8} |
| 3037 | Double_t dVnErr[4] = {0.}; // array to hold errors of Vn{2}, Vn{4}, Vn{6} and Vn{8} |
| c365fe76 |
3038 | |
| 2aa4ebcd |
3039 | if(type == "NONAME") |
| c365fe76 |
3040 | { |
| 2aa4ebcd |
3041 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlow())->GetBinContent(1); |
| 3042 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlow())->GetBinError(1); |
| 3043 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlow())->GetBinContent(1); |
| 3044 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlow())->GetBinError(1); |
| 3045 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlow())->GetBinContent(1); |
| 3046 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlow())->GetBinError(1); |
| 3047 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlow())->GetBinContent(1); |
| 3048 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlow())->GetBinError(1); |
| 3049 | } else if(type == "RP") |
| 3050 | { |
| 3051 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinContent(1); |
| 3052 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinError(1); |
| 3053 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinContent(1); |
| 3054 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinError(1); |
| 3055 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinContent(1); |
| 3056 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinError(1); |
| 3057 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinContent(1); |
| 3058 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinError(1); |
| 3059 | } else if(type == "POI") |
| 3060 | { |
| 3061 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinContent(1); |
| 3062 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinError(1); |
| 3063 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinContent(1); |
| 3064 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinError(1); |
| 3065 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinContent(1); |
| 3066 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinError(1); |
| 3067 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinContent(1); |
| 3068 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinError(1); |
| 3069 | } |
| 3070 | |
| 3071 | TString title = " flow estimates from Q-cumulants"; |
| 3072 | TString subtitle = " ("; |
| 3073 | |
| 3074 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) |
| 3075 | { |
| 3076 | subtitle.Append(type); |
| 3077 | subtitle.Append(", without weights)"); |
| 3078 | } else |
| 3079 | { |
| 3080 | subtitle.Append(type); |
| 3081 | subtitle.Append(", with weights)"); |
| 3082 | } |
| 3083 | |
| 3084 | cout<<endl; |
| 3085 | cout<<"*************************************"<<endl; |
| 3086 | cout<<"*************************************"<<endl; |
| 3087 | cout<<title.Data()<<endl; |
| 3088 | cout<<subtitle.Data()<<endl; |
| 3089 | cout<<endl; |
| c365fe76 |
3090 | |
| 2aa4ebcd |
3091 | for(Int_t i=0;i<4;i++) |
| 3092 | { |
| 3093 | if(dVn[i]>=0.) |
| 3094 | { |
| 3095 | cout<<" v_"<<n<<"{"<<2*(i+1)<<"} = "<<dVn[i]<<" +/- "<<dVnErr[i]<<endl; |
| 3096 | } |
| 3097 | else |
| 3098 | { |
| 3099 | cout<<" v_"<<n<<"{"<<2*(i+1)<<"} = Im"<<endl; |
| 3100 | } |
| 3101 | } |
| 3102 | |
| 3103 | cout<<endl; |
| 3104 | /* |
| 3105 | if(type == "NONAME") |
| 3106 | { |
| 3107 | cout<<" nEvts = "<<nEvtsNoName<<", AvM = "<<dMultNoName<<endl; // to be improved |
| 3108 | } |
| 3109 | else if (type == "RP") |
| 3110 | { |
| 3111 | cout<<" nEvts = "<<nEvtsRP<<", AvM = "<<dMultRP<<endl; // to be improved |
| c365fe76 |
3112 | } |
| 2aa4ebcd |
3113 | else if (type == "POI") |
| 3114 | { |
| 3115 | cout<<" nEvts = "<<nEvtsPOI<<", AvM = "<<dMultPOI<<endl; // to be improved |
| 3116 | } |
| 3117 | */ |
| 3118 | cout<<"*************************************"<<endl; |
| 3119 | cout<<"*************************************"<<endl; |
| 3120 | cout<<endl; |
| 3121 | |
| 3122 | }// end of AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type="NONAME"); |
| 3123 | |
| 3124 | |
| 3125 | //================================================================================================================================ |
| 3126 | |
| 3127 | |
| 3128 | void AliFlowAnalysisWithQCumulants::CompareResultsFromNestedLoopsAndFromQVectorsForDiffFlow(Bool_t useParticleWeights) |
| 3129 | { |
| 3130 | // compare correlations needed for diff. flow calculated with nested loops and those calculated from Q-vectors |
| 3131 | |
| 3132 | cout<<endl; |
| 3133 | cout<<" *************************************"<<endl; |
| 3134 | cout<<" **** cross-checking the formulas ****"<<endl; |
| 3135 | cout<<" **** for differential flow ****"<<endl; |
| 3136 | cout<<" **** ****"<<endl; |
| 3137 | cout<<" **** (pt,eta) bin: ****"<<endl; |
| 3138 | cout<<" **** 1.1 < pt < 1.2 GeV ****"<<endl; |
| 3139 | cout<<" **** -0.55 < eta < -0.525 ****"<<endl; |
| 3140 | cout<<" *************************************"<<endl; |
| 3141 | cout<<endl; |
| c365fe76 |
3142 | |
| 2aa4ebcd |
3143 | if(!useParticleWeights) |
| 3144 | { |
| 3145 | cout<<"<cos(n(psi1-phi2))> from Q-vectors = "<<fCorrelationsPro[0][0][0][0]->GetBinContent(fCorrelationsPro[0][0][0][0]->GetBin(12,19))<<endl; |
| 3146 | cout<<"<cos(n(psi1-phi2))> from nested loops = "<<fDirectCorrelationsDiffFlow->GetBinContent(1)<<endl; |
| 3147 | cout<<endl; |
| 3148 | cout<<"<cos(n(psi1+phi2-phi3-phi4))> from Q-vectors = "<<fCorrelationsPro[0][0][0][1]->GetBinContent(fCorrelationsPro[0][0][0][1]->GetBin(12,19))<<endl; |
| 3149 | cout<<"<cos(n(psi1+phi2-phi3-phi4))> from nested loops = "<<fDirectCorrelationsDiffFlow->GetBinContent(41)<<endl; |
| 3150 | cout<<endl; |
| 3151 | cout<<"****************************************************"<<endl; |
| 3152 | cout<<"****************************************************"<<endl; |
| 3153 | cout<<endl; |
| 3154 | /* |
| 3155 | cout<<"<cos(n(psi1))> from Q-vectors = "<<fCorrectionsCosP1nPsiPtEtaPOI->GetBinContent(fCorrectionsCosP1nPsiPtEtaPOI->GetBin(12,19))<<endl; |
| 3156 | cout<<"<cos(n(psi1))> from nested loops = "<<fDirectCorrectionsDiffFlowCos->GetBinContent(1)<<endl; |
| 3157 | cout<<endl; |
| 3158 | cout<<"<sin(n(psi1))> from Q-vectors = "<<fCorrectionsSinP1nPsiPtEtaPOI->GetBinContent(fCorrectionsSinP1nPsiPtEtaPOI->GetBin(12,19))<<endl; |
| 3159 | cout<<"<sin(n(psi1))> from nested loops = "<<fDirectCorrectionsDiffFlowSin->GetBinContent(1)<<endl; |
| 3160 | cout<<endl; |
| 3161 | */ |
| 3162 | } |
| 3163 | |
| 3164 | if(useParticleWeights) |
| c365fe76 |
3165 | { |
| 2aa4ebcd |
3166 | cout<<"<w2 cos(n(psi1-phi2))> from Q-vectors (RP) = "<<fCorrelationsPro[0][1][0][0]->GetBinContent(fCorrelationsPro[0][1][0][0]->GetBin(12,19))<<endl; |
| 3167 | cout<<"<w2 cos(n(psi1-phi2))> from Q-vectors (POI) = "<<fCorrelationsPro[1][1][0][0]->GetBinContent(fCorrelationsPro[1][1][0][0]->GetBin(12,19))<<endl; |
| 3168 | cout<<"<w2 cos(n(psi1-phi2))> from nested loops = "<<fDirectCorrelationsDiffFlowW->GetBinContent(1)<<endl; |
| 3169 | cout<<endl; |
| 3170 | cout<<"<w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))> from Q-vectors (RP) = "<<fCorrelationsPro[0][1][0][1]->GetBinContent(fCorrelationsPro[0][1][0][1]->GetBin(12,19))<<endl; |
| 3171 | cout<<"<w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))> from Q-vectors (POI) = "<<fCorrelationsPro[1][1][0][1]->GetBinContent(fCorrelationsPro[1][1][0][1]->GetBin(12,19))<<endl; |
| 3172 | cout<<"<w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))> from nested loops = "<<fDirectCorrelationsDiffFlowW->GetBinContent(41)<<endl; |
| 3173 | cout<<endl; |
| 3174 | } |
| c365fe76 |
3175 | |
| 2aa4ebcd |
3176 | } // end of void AliFlowAnalysisWithQCumulants::CompareResultsFromNestedLoopsAndFromQVectorsForDiffFlow() |
| c365fe76 |
3177 | |
| 3178 | |
| 3179 | //================================================================================================================================ |
| 3180 | |
| 3181 | |
| 2aa4ebcd |
3182 | void AliFlowAnalysisWithQCumulants::WriteHistograms(TString outputFileName) |
| c365fe76 |
3183 | { |
| 2aa4ebcd |
3184 | //store the final results in output .root file |
| 3185 | TFile *output = new TFile(outputFileName.Data(),"RECREATE"); |
| 3186 | //output->WriteObject(fHistList, "cobjQC","SingleKey"); |
| 3187 | fHistList->Write(fHistList->GetName(), TObject::kSingleKey); |
| 3188 | delete output; |
| 3189 | } |
| 3190 | |
| 3191 | |
| 3192 | //================================================================================================================================ |
| 3193 | |
| 3194 | |
| 3195 | void AliFlowAnalysisWithQCumulants::BookCommonHistograms() |
| 3196 | { |
| 3197 | // book common control histograms and common histograms for final results |
| c365fe76 |
3198 | |
| 2aa4ebcd |
3199 | // common control histogram (ALL events) |
| 3200 | fCommonHists = new AliFlowCommonHist("AliFlowCommonHistQC"); |
| 3201 | fHistList->Add(fCommonHists); |
| c365fe76 |
3202 | |
| 2aa4ebcd |
3203 | // common control histogram (for events with 2 and more particles) |
| 3204 | fCommonHists2nd = new AliFlowCommonHist("AliFlowCommonHist2ndOrderQC"); |
| 3205 | fHistList->Add(fCommonHists2nd); |
| c365fe76 |
3206 | |
| 2aa4ebcd |
3207 | // common control histogram (for events with 4 and more particles) |
| 3208 | fCommonHists4th = new AliFlowCommonHist("AliFlowCommonHist4thOrderQC"); |
| 3209 | fHistList->Add(fCommonHists4th); |
| c365fe76 |
3210 | |
| 2aa4ebcd |
3211 | // common control histogram (for events with 6 and more particles) |
| 3212 | fCommonHists6th = new AliFlowCommonHist("AliFlowCommonHist6thOrderQC"); |
| 3213 | fHistList->Add(fCommonHists6th); |
| c365fe76 |
3214 | |
| 2aa4ebcd |
3215 | // common control histogram (for events with 8 and more particles) |
| 3216 | fCommonHists8th = new AliFlowCommonHist("AliFlowCommonHist8thOrderQC"); |
| 3217 | fHistList->Add(fCommonHists8th); |
| 3218 | |
| 3219 | // common histograms for final results (calculated for events with 2 and more particles) |
| 3220 | fCommonHistsResults2nd = new AliFlowCommonHistResults("AliFlowCommonHistResults2ndOrderQC"); |
| 3221 | fHistList->Add(fCommonHistsResults2nd); |
| c365fe76 |
3222 | |
| 2aa4ebcd |
3223 | // common histograms for final results (calculated for events with 4 and more particles) |
| 3224 | fCommonHistsResults4th = new AliFlowCommonHistResults("AliFlowCommonHistResults4thOrderQC"); |
| 3225 | fHistList->Add(fCommonHistsResults4th); |
| c365fe76 |
3226 | |
| 2aa4ebcd |
3227 | // common histograms for final results (calculated for events with 6 and more particles) |
| 3228 | fCommonHistsResults6th = new AliFlowCommonHistResults("AliFlowCommonHistResults6thOrderQC"); |
| 3229 | fHistList->Add(fCommonHistsResults6th); |
| c365fe76 |
3230 | |
| 2aa4ebcd |
3231 | // common histograms for final results (calculated for events with 8 and more particles) |
| 3232 | fCommonHistsResults8th = new AliFlowCommonHistResults("AliFlowCommonHistResults8thOrderQC"); |
| 3233 | fHistList->Add(fCommonHistsResults8th); |
| c365fe76 |
3234 | |
| 2aa4ebcd |
3235 | } // end of void AliFlowAnalysisWithQCumulants::BookCommonHistograms() |
| 2bdc5281 |
3236 | |
| 3237 | |
| 3238 | //================================================================================================================================ |
| 3239 | |
| 3240 | |
| 2aa4ebcd |
3241 | void AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms() |
| 2bdc5281 |
3242 | { |
| 2aa4ebcd |
3243 | // book and fill histograms which hold phi, pt and eta weights |
| 2bdc5281 |
3244 | |
| 2aa4ebcd |
3245 | if(!fWeightsList) |
| 2bdc5281 |
3246 | { |
| 2aa4ebcd |
3247 | cout<<"WARNING: fWeightsList is NULL in AFAWQC::BAFWH() !!!!"<<endl; |
| 3248 | exit(0); |
| 3249 | } |
| 3250 | |
| 3251 | fUseParticleWeights = new TProfile("fUseParticleWeights","1 = weight used, 0 = weight not used",3,0,3); |
| 3252 | fUseParticleWeights->SetLabelSize(0.06); |
| 3253 | (fUseParticleWeights->GetXaxis())->SetBinLabel(1,"w_{#phi}"); |
| 3254 | (fUseParticleWeights->GetXaxis())->SetBinLabel(2,"w_{p_{T}}"); |
| 3255 | (fUseParticleWeights->GetXaxis())->SetBinLabel(3,"w_{#eta}"); |
| 3256 | fUseParticleWeights->Fill(0.5,(Int_t)fUsePhiWeights); |
| 3257 | fUseParticleWeights->Fill(1.5,(Int_t)fUsePtWeights); |
| 3258 | fUseParticleWeights->Fill(2.5,(Int_t)fUseEtaWeights); |
| 3259 | fWeightsList->Add(fUseParticleWeights); |
| 3260 | |
| 3261 | if(fUsePhiWeights) |
| 3262 | { |
| 3263 | if(fWeightsList->FindObject("phi_weights")) |
| 2bdc5281 |
3264 | { |
| 2aa4ebcd |
3265 | fPhiWeights = dynamic_cast<TH1F*>(fWeightsList->FindObject("phi_weights")); |
| 3266 | if(fPhiWeights->GetBinWidth(1) != fPhiBinWidth) |
| 2bdc5281 |
3267 | { |
| 2aa4ebcd |
3268 | cout<<"WARNING: fPhiWeights->GetBinWidth(1) != fPhiBinWidth in AFAWQC::BAFWH() !!!! "<<endl; |
| 3269 | cout<<" This indicates inconsistent binning in phi histograms throughout the code."<<endl; |
| 3270 | exit(0); |
| 2bdc5281 |
3271 | } |
| 2aa4ebcd |
3272 | } else |
| 2bdc5281 |
3273 | { |
| 2aa4ebcd |
3274 | cout<<"WARNING: fWeightsList->FindObject(\"phi_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; |
| 3275 | exit(0); |
| 2bdc5281 |
3276 | } |
| 2aa4ebcd |
3277 | } // end of if(fUsePhiWeights) |
| 3278 | |
| 3279 | if(fUsePtWeights) |
| 3280 | { |
| 3281 | if(fWeightsList->FindObject("pt_weights")) |
| 3282 | { |
| 3283 | fPtWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("pt_weights")); |
| 3284 | if(fPtWeights->GetBinWidth(1) != fPtBinWidth) |
| 2bdc5281 |
3285 | { |
| 2aa4ebcd |
3286 | cout<<"WARNING: fPtWeights->GetBinWidth(1) != fPtBinWidth in AFAWQC::BAFWH() !!!! "<<endl; |
| 3287 | cout<<" This indicates insconsistent binning in pt histograms throughout the code."<<endl; |
| 3288 | exit(0); |
| 3289 | } |
| 3290 | } else |
| 2bdc5281 |
3291 | { |
| 2aa4ebcd |
3292 | cout<<"WARNING: fWeightsList->FindObject(\"pt_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; |
| 3293 | exit(0); |
| 2bdc5281 |
3294 | } |
| 2aa4ebcd |
3295 | } // end of if(fUsePtWeights) |
| 3296 | |
| 3297 | if(fUseEtaWeights) |
| 3298 | { |
| 3299 | if(fWeightsList->FindObject("eta_weights")) |
| 3300 | { |
| 3301 | fEtaWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("eta_weights")); |
| 3302 | if(fEtaWeights->GetBinWidth(1) != fEtaBinWidth) |
| 3303 | { |
| 3304 | cout<<"WARNING: fEtaWeights->GetBinWidth(1) != fEtaBinWidth in AFAWQC::BAFWH() !!!! "<<endl; |
| 3305 | cout<<" This indicates insconsistent binning in eta histograms throughout the code."<<endl; |
| 3306 | exit(0); |
| 3307 | } |
| 3308 | } else |
| 2bdc5281 |
3309 | { |
| 2aa4ebcd |
3310 | cout<<"WARNING: fUseEtaWeights && fWeightsList->FindObject(\"eta_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; |
| 3311 | exit(0); |
| 2bdc5281 |
3312 | } |
| 2aa4ebcd |
3313 | } // end of if(fUseEtaWeights) |
| 3314 | |
| 3315 | } // end of AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms() |
| 3316 | |
| 3317 | |
| 3318 | //================================================================================================================================ |
| 3319 | |
| 3320 | |
| 3321 | void AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow() |
| 3322 | { |
| 3323 | // book all objects for integrated flow |
| 3324 | |
| 3325 | // a) common; |
| 3326 | // b) profiles; |
| 3327 | // c) results; |
| 3328 | |
| 3329 | // **************** |
| 3330 | // **** COMMON **** |
| 3331 | // **************** |
| 3332 | |
| 3333 | // Re[Q_{m*n,k}], Im[Q_{m*n,k}] and S_{p,k}^M: |
| 3334 | fReQ = new TMatrixD(4,9); |
| 3335 | fImQ = new TMatrixD(4,9); |
| 3336 | fSMpk = new TMatrixD(8,9); |
| 3337 | |
| 3338 | // profile to hold average multiplicities and number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8 |
| 3339 | fAvMultiplicity = new TProfile("fAvMultiplicity","Average Multiplicities of RPs",9,0,9); |
| 3340 | fAvMultiplicity->SetTickLength(-0.01,"Y"); |
| 3341 | fAvMultiplicity->SetMarkerStyle(25); |
| 3342 | fAvMultiplicity->SetLabelSize(0.05); |
| 3343 | fAvMultiplicity->SetLabelOffset(0.02,"Y"); |
| 3344 | fAvMultiplicity->SetYTitle("Average Multiplicity"); |
| 3345 | (fAvMultiplicity->GetXaxis())->SetBinLabel(1,"all evts"); |
| 3346 | (fAvMultiplicity->GetXaxis())->SetBinLabel(2,"n_{RP} #geq 1"); |
| 3347 | (fAvMultiplicity->GetXaxis())->SetBinLabel(3,"n_{RP} #geq 2"); |
| 3348 | (fAvMultiplicity->GetXaxis())->SetBinLabel(4,"n_{RP} #geq 3"); |
| 3349 | (fAvMultiplicity->GetXaxis())->SetBinLabel(5,"n_{RP} #geq 4"); |
| 3350 | (fAvMultiplicity->GetXaxis())->SetBinLabel(6,"n_{RP} #geq 5"); |
| 3351 | (fAvMultiplicity->GetXaxis())->SetBinLabel(7,"n_{RP} #geq 6"); |
| 3352 | (fAvMultiplicity->GetXaxis())->SetBinLabel(8,"n_{RP} #geq 7"); |
| 3353 | (fAvMultiplicity->GetXaxis())->SetBinLabel(9,"n_{RP} #geq 8"); |
| 3354 | fIntFlowProfiles->Add(fAvMultiplicity); |
| 3355 | |
| 3356 | TString pWeightsFlag[2] = {"pWeights not used","pWeights used"}; |
| 3357 | TString eWeightsFlag[2] = {"exact eWeights","non-exact eWeights"}; |
| 3358 | TString nuaFlag[2] = {"not corrected","corrected"}; |
| 3359 | TString sinCosFlag[2] = {"sin","cos"}; |
| c2a42ea2 |
3360 | TString powerFlag[2] = {"linear","quadratic"}; |
| 2aa4ebcd |
3361 | |
| 3362 | for(Int_t pW=0;pW<1+(Int_t)(fUsePhiWeights||fUsePtWeights||fUseEtaWeights);pW++) |
| 3363 | { |
| 3364 | // *************** |
| 3365 | // **** E-B-E **** |
| 3366 | // *************** |
| 3367 | |
| 3368 | // average multiparticle correlations for single event calculated from Q-vectors |
| 3369 | // (Remark: binning is organized in the same way as in fQCorrelations[pW][eW] bellow): |
| 3370 | fQCorrelationsEBE[pW] = new TH1D(Form("fQCorrelationsEBE: %s",pWeightsFlag[pW].Data()),Form("Average multi-particle correlations for single event calculated from Q-vectors (%s)",pWeightsFlag[pW].Data()),32,0,32); |
| 3371 | |
| 3372 | for(Int_t sc=0;sc<2;sc++) |
| 3373 | { |
| 3374 | // correction terms for non-uniform acceptance for single event calculated from Q-vectors |
| 3375 | // (Remark: binning is organized in the same way as in fQCorrections[pW][sc]): |
| 3376 | fQCorrectionsEBE[pW][sc] = new TH1D(Form("fQCorrectionsEBE: %s, %s terms",pWeightsFlag[pW].Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance for single event (%s, %s terms)",pWeightsFlag[pW].Data(),sinCosFlag[sc].Data()),10,0,10); |
| 3377 | } |
| 3378 | |
| 3379 | for(Int_t eW=0;eW<2;eW++) |
| 3380 | { |
| 3381 | // ****************** |
| 3382 | // **** PROFILES **** |
| 3383 | // ****************** |
| 3384 | |
| 3385 | // final average multiparticle correlations for all events calculated from Q-vectors: |
| 3386 | fQCorrelations[pW][eW] = new TProfile(Form("fQCorrelations: %s, %s",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()),Form("Final average multi-particle correlations calculated from Q-vectors (%s, %s)",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()),32,0,32,"s"); |
| 3387 | fQCorrelations[pW][eW]->SetTickLength(-0.01,"Y"); |
| 3388 | fQCorrelations[pW][eW]->SetMarkerStyle(25); |
| 3389 | fQCorrelations[pW][eW]->SetLabelSize(0.03); |
| 3390 | fQCorrelations[pW][eW]->SetLabelOffset(0.01,"Y"); |
| 3391 | // 2-p correlations: |
| 3392 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(1,"<<2>>_{n|n}"); |
| 3393 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(2,"<<2>>_{2n|2n}"); |
| 3394 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(3,"<<2>>_{3n|3n}"); |
| 3395 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(4,"<<2>>_{4n|4n}"); |
| 3396 | // 3-p correlations: |
| 3397 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(6,"<<3>>_{2n|n,n}"); |
| 3398 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}"); |
| 3399 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}"); |
| 3400 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}"); |
| 3401 | // 4-p correlations: |
| 3402 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}"); |
| 3403 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}"); |
| 3404 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}"); |
| 3405 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}"); |
| 3406 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}"); |
| 3407 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}"); |
| 3408 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}"); |
| 3409 | // 5-p correlations: |
| 3410 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}"); |
| 3411 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}"); |
| 3412 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}"); |
| 3413 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}"); |
| 3414 | // 6-p correlations: |
| 3415 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}"); |
| 3416 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}"); |
| 3417 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}"); |
| 3418 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}"); |
| 3419 | // 7-p correlations: |
| 3420 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}"); |
| 3421 | // 8-p correlations: |
| 3422 | (fQCorrelations[pW][eW]->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}"); |
| 3423 | // add fQCorrelations[0] to the list fIntFlowList: |
| 3424 | fIntFlowProfiles->Add(fQCorrelations[pW][eW]); |
| 3425 | |
| 3426 | // averages <<2><4>>, <<2><6>>, <<4><6>>, etc, needed to calculate covariances: |
| 3427 | fQProducts[pW][eW] = new TProfile(Form("fQProducts: %s, %s",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()),Form("Averages of products (%s, %s)",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()),6,0,6); |
| 3428 | fQProducts[pW][eW]->SetTickLength(-0.01,"Y"); |
| 3429 | fQProducts[pW][eW]->SetMarkerStyle(25); |
| 3430 | fQProducts[pW][eW]->SetLabelSize(0.05); |
| 3431 | fQProducts[pW][eW]->SetLabelOffset(0.01,"Y"); |
| 3432 | (fQProducts[pW][eW]->GetXaxis())->SetBinLabel(1,"<<2><4>>"); |
| 3433 | (fQProducts[pW][eW]->GetXaxis())->SetBinLabel(2,"<<2><6>>"); |
| 3434 | (fQProducts[pW][eW]->GetXaxis())->SetBinLabel(3,"<<2><8>>"); |
| 3435 | (fQProducts[pW][eW]->GetXaxis())->SetBinLabel(4,"<<4><6>>"); |
| 3436 | (fQProducts[pW][eW]->GetXaxis())->SetBinLabel(5,"<<4><8>>"); |
| 3437 | (fQProducts[pW][eW]->GetXaxis())->SetBinLabel(6,"<<6><8>>"); |
| 3438 | fIntFlowProfiles->Add(fQProducts[pW][eW]); |
| 3439 | |
| 3440 | for(Int_t sc=0;sc<2;sc++) |
| 3441 | { |
| 3442 | // final average correction terms for non-uniform acceptance calculated from Q-vectors: |
| 3443 | fQCorrections[pW][eW][sc] = new TProfile(Form("fQCorrections: %s, %s, %s terms",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s, %s, %s terms)",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),sinCosFlag[sc].Data()),10,0,10,"s"); |
| 3444 | fQCorrections[pW][eW][sc]->SetTickLength(-0.01,"Y"); |
| 3445 | fQCorrections[pW][eW][sc]->SetMarkerStyle(25); |
| 3446 | fQCorrections[pW][eW][sc]->SetLabelSize(0.03); |
| 3447 | fQCorrections[pW][eW][sc]->SetLabelOffset(0.01,"Y"); |
| 3448 | // ......................................................................... |
| 3449 | // 1-p terms: |
| 3450 | (fQCorrections[pW][eW][sc]->GetXaxis())->SetBinLabel(1,Form("%s(n(#phi_{1}))>",sinCosFlag[sc].Data())); |
| 3451 | // 2-p terms: |
| 3452 | // 3-p terms: |
| 3453 | // ... |
| 3454 | // ......................................................................... |
| 3455 | // add fQCorrectionsCos to the list fIntFlowList: |
| 3456 | fIntFlowProfiles->Add(fQCorrections[pW][eW][sc]); |
| 3457 | } // end of for(Int_t sc=0;sc<2;sc++) |
| 3458 | |
| 3459 | // ***************** |
| 3460 | // **** RESULTS **** |
| 3461 | // ***************** |
| 3462 | |
| 3463 | // final results for average multi-particle correlations with correct statistical errors: |
| 3464 | fCorrelations[pW][eW] = new TH1D(Form("fCorrelations: %s, %s",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()),Form("Average multi-particle correlations (%s, %s)",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()),32,0,32); |
| 3465 | fCorrelations[pW][eW]->SetTickLength(-0.01,"Y"); |
| 3466 | fCorrelations[pW][eW]->SetMarkerStyle(25); |
| 3467 | fCorrelations[pW][eW]->SetLabelSize(0.03); |
| 3468 | fCorrelations[pW][eW]->SetLabelOffset(0.01,"Y"); |
| 3469 | // 2-p correlations: |
| 3470 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(1,"<<2>>_{n|n}"); |
| 3471 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(2,"<<2>>_{2n|2n}"); |
| 3472 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(3,"<<2>>_{3n|3n}"); |
| 3473 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(4,"<<2>>_{4n|4n}"); |
| 3474 | // 3-p correlations: |
| 3475 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(6,"<<3>>_{2n|n,n}"); |
| 3476 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}"); |
| 3477 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}"); |
| 3478 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}"); |
| 3479 | // 4-p correlations: |
| 3480 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}"); |
| 3481 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}"); |
| 3482 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}"); |
| 3483 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}"); |
| 3484 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}"); |
| 3485 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}"); |
| 3486 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}"); |
| 3487 | // 5-p correlations: |
| 3488 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}"); |
| 3489 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}"); |
| 3490 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}"); |
| 3491 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}"); |
| 3492 | // 6-p correlations: |
| 3493 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}"); |
| 3494 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}"); |
| 3495 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}"); |
| 3496 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}"); |
| 3497 | // 7-p correlations: |
| 3498 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}"); |
| 3499 | // 8-p correlations: |
| 3500 | (fCorrelations[pW][eW]->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}"); |
| 3501 | // add fCorrelations to the list fIntFlowList: |
| 3502 | fIntFlowResults->Add(fCorrelations[pW][eW]); |
| 3503 | |
| 3504 | // final corrections for non-uniform acceptance for QC{2}, QC{4}, QC{6} and QC{8}: |
| 3505 | fCorrections[pW][eW] = new TH1D(Form("fCorrections: %s, %s",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()),Form("Corrections for non-uniform acceptance for Q-cumulants (%s, %s)",eWeightsFlag[eW].Data()),4,0,4); |
| 3506 | fCorrections[pW][eW]->SetLabelSize(0.05); |
| 3507 | fCorrections[pW][eW]->SetMarkerStyle(25); |
| 3508 | (fCorrections[pW][eW]->GetXaxis())->SetBinLabel(1,"corr. for QC{2}"); |
| 3509 | (fCorrections[pW][eW]->GetXaxis())->SetBinLabel(2,"corr. for QC{4}"); |
| 3510 | (fCorrections[pW][eW]->GetXaxis())->SetBinLabel(3,"corr. for QC{6}"); |
| 3511 | (fCorrections[pW][eW]->GetXaxis())->SetBinLabel(4,"corr. for QC{8}"); |
| 3512 | // add fCorrections[pW] to list fIntFlowResults: |
| 3513 | fIntFlowResults->Add(fCorrections[pW][eW]); |
| 3514 | |
| 3515 | // final results for covariances: |
| 3516 | fCovariances[pW][eW] = new TH1D(Form("fCovariances: %s, %s",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()),Form("Covariances (%s, %s)",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()),6,0,6); |
| 3517 | fCovariances[pW][eW]->SetLabelSize(0.05); |
| 3518 | fCovariances[pW][eW]->SetMarkerStyle(25); |
| 3519 | (fCovariances[pW][eW]->GetXaxis())->SetBinLabel(1,"Cov(2,4)"); |
| 3520 | (fCovariances[pW][eW]->GetXaxis())->SetBinLabel(2,"Cov(2,6)"); |
| 3521 | (fCovariances[pW][eW]->GetXaxis())->SetBinLabel(3,"Cov(2,8)"); |
| 3522 | (fCovariances[pW][eW]->GetXaxis())->SetBinLabel(4,"Cov(4,6)"); |
| 3523 | (fCovariances[pW][eW]->GetXaxis())->SetBinLabel(5,"Cov(4,8)"); |
| 3524 | (fCovariances[pW][eW]->GetXaxis())->SetBinLabel(6,"Cov(6,8)"); |
| 3525 | // add fCovariances[pW][eW] to list fIntFlowResults: |
| 3526 | fIntFlowResults->Add(fCovariances[pW][eW]); |
| 3527 | |
| c2a42ea2 |
3528 | // final results for sum of event weights: |
| 3529 | for(Int_t power=0;power<2;power++) |
| 3530 | { |
| 3531 | fSumOfEventWeights[pW][eW][power] = new TH1D(Form("fSumOfEventWeights: %s, %s, %s",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),powerFlag[power].Data()),Form("SumOfEventWeights (%s, %s, %s)",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),powerFlag[power].Data()),4,0,4); |
| 3532 | fSumOfEventWeights[pW][eW][power]->SetLabelSize(0.05); |
| 3533 | fSumOfEventWeights[pW][eW][power]->SetMarkerStyle(25); |
| 3534 | (fSumOfEventWeights[pW][eW][power]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>}"); |
| 3535 | (fSumOfEventWeights[pW][eW][power]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<4>}"); |
| 3536 | (fSumOfEventWeights[pW][eW][power]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<6>}"); |
| 3537 | (fSumOfEventWeights[pW][eW][power]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{<8>}"); |
| 3538 | // add fSumOfEventWeights[pW][eW] to list fIntFlowResults: |
| 3539 | fIntFlowResults->Add(fSumOfEventWeights[pW][eW][power]); |
| 3540 | } |
| 3541 | |
| 3542 | // final results for sum of product of event weights: |
| 3543 | fProductOfEventWeights[pW][eW] = new TH1D(Form("fProductOfEventWeights: %s, %s",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()),Form("ProductOfEventWeights (%s, %s)",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data()),6,0,6); |
| 3544 | fProductOfEventWeights[pW][eW]->SetLabelSize(0.05); |
| 3545 | fProductOfEventWeights[pW][eW]->SetMarkerStyle(25); |
| 3546 | (fProductOfEventWeights[pW][eW]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>} w_{<4>}"); |
| 3547 | (fProductOfEventWeights[pW][eW]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<2>} w_{<6>}"); |
| 3548 | (fProductOfEventWeights[pW][eW]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<2>} w_{<8>}"); |
| 3549 | (fProductOfEventWeights[pW][eW]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{<4>} w_{<6>}"); |
| 3550 | (fProductOfEventWeights[pW][eW]->GetXaxis())->SetBinLabel(5,"#sum_{i=1}^{N} w_{<4>} w_{<8>}"); |
| 3551 | (fProductOfEventWeights[pW][eW]->GetXaxis())->SetBinLabel(6,"#sum_{i=1}^{N} w_{<6>} w_{<8>}"); |
| 3552 | // add fProductOfEventWeights[pW][eW] to list fIntFlowResults: |
| 3553 | fIntFlowResults->Add(fProductOfEventWeights[pW][eW]); |
| 3554 | |
| 2aa4ebcd |
3555 | for(Int_t nua=0;nua<2;nua++) |
| 3556 | { |
| 3557 | // integrated Q-cumulants: |
| 3558 | fCumulants[pW][eW][nua] = new TH1D(Form("fCumulants: %s, %s, %s",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),nuaFlag[nua].Data()),Form("Q-cumulants (%s, %s, %s)",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),nuaFlag[nua].Data()),4,0,4); |
| 3559 | fCumulants[pW][eW][nua]->SetLabelSize(0.05); |
| 3560 | fCumulants[pW][eW][nua]->SetMarkerStyle(25); |
| 3561 | (fCumulants[pW][eW][nua]->GetXaxis())->SetBinLabel(1,"QC{2}"); |
| 3562 | (fCumulants[pW][eW][nua]->GetXaxis())->SetBinLabel(2,"QC{4}"); |
| 3563 | (fCumulants[pW][eW][nua]->GetXaxis())->SetBinLabel(3,"QC{6}"); |
| 3564 | (fCumulants[pW][eW][nua]->GetXaxis())->SetBinLabel(4,"QC{8}"); |
| 3565 | // add fCumulants[pW][nua] to list fIntFlowResults: |
| 3566 | fIntFlowResults->Add(fCumulants[pW][eW][nua]); |
| 2bdc5281 |
3567 | |
| 2aa4ebcd |
3568 | // integrated flow from Q-cumulants: |
| 3569 | fIntFlow[pW][eW][nua] = new TH1D(Form("fIntFlow: %s, %s, %s",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),nuaFlag[nua].Data()),Form("Integrated flow from Q-cumulants (%s, %s, %s)",pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),nuaFlag[nua].Data()),4,0,4); |
| 3570 | fIntFlow[pW][eW][nua]->SetLabelSize(0.05); |
| 3571 | fIntFlow[pW][eW][nua]->SetMarkerStyle(25); |
| 3572 | (fIntFlow[pW][eW][nua]->GetXaxis())->SetBinLabel(1,"v_{2}{2,QC}"); |
| 3573 | (fIntFlow[pW][eW][nua]->GetXaxis())->SetBinLabel(2,"v_{2}{4,QC}"); |
| 3574 | (fIntFlow[pW][eW][nua]->GetXaxis())->SetBinLabel(3,"v_{2}{6,QC}"); |
| 3575 | (fIntFlow[pW][eW][nua]->GetXaxis())->SetBinLabel(4,"v_{2}{8,QC}"); |
| 3576 | // add fIntFlow[pW][nua] to list fIntFlowResults: |
| 3577 | fIntFlowResults->Add(fIntFlow[pW][eW][nua]); |
| 2bdc5281 |
3578 | |
| 2aa4ebcd |
3579 | } // end of for(Int_t nua=0;nua<2;nua++) |
| 3580 | } // end of for(Int_t eW=0;eW<2;eW++) |
| 3581 | } // end of for(Int_t pW=0;pW<1+(Int_t)(fUsePhiWeights||fUsePtWeights||fUseEtaWeights);pW++) |
| 3582 | |
| 3583 | |
| 3584 | |
| 3585 | /* |
| 3586 | // final average weighted multi-particle correlations for all events calculated from Q-vectors |
| 3587 | fQCorrelations[1] = new TProfile("Weighted correlations","final average multi-particle correlations from weighted Q-vectors",200,0,200,"s"); |
| 3588 | fQCorrelations[1]->SetTickLength(-0.01,"Y"); |
| 3589 | fQCorrelations[1]->SetMarkerStyle(25); |
| 3590 | fQCorrelations[1]->SetLabelSize(0.03); |
| 3591 | fQCorrelations[1]->SetLabelOffset(0.01,"Y"); |
| 3592 | // 2-particle correlations: |
| 3593 | (fQCorrelations[1]->GetXaxis())->SetBinLabel(1,"<w_{1}w_{2}cos(n(#phi_{1}-#phi_{2}))>"); |
| 3594 | (fQCorrelations[1]->GetXaxis())->SetBinLabel(2,"<w_{1}^{2}w_{2}^{2}cos(2n(#phi_{1}-#phi_{2}))>"); |
| 3595 | (fQCorrelations[1]->GetXaxis())->SetBinLabel(3,"<w_{1}^{3}w_{2}^{3}cos(3n(#phi_{1}-#phi_{2}))>"); |
| 3596 | (fQCorrelations[1]->GetXaxis())->SetBinLabel(4,"<w_{1}^{4}w_{2}^{4}cos(4n(#phi_{1}-#phi_{2}))>"); |
| 3597 | (fQCorrelations[1]->GetXaxis())->SetBinLabel(5,"<w_{1}^{3}w_{2}cos(n(#phi_{1}-#phi_{2}))>"); |
| 3598 | (fQCorrelations[1]->GetXaxis())->SetBinLabel(6,"<w_{1}^{2}w_{2}w_{3}cos(n(#phi_{1}-#phi_{2}))>"); |
| 3599 | // 3-particle correlations: |
| 3600 | (fQCorrelations[1]->GetXaxis())->SetBinLabel(21,"<w_{1}w_{2}w_{3}^{2}cos(n(2#phi_{1}-#phi_{2}-#phi_{3}))>"); |
| 3601 | // 4-particle correlations: |
| 3602 | (fQCorrelations[1]->GetXaxis())->SetBinLabel(41,"<w_{1}w_{2}w_{3}w_{4}cos(n(#phi_{1}+#phi_{2}-#phi_{3}-#phi_{4}))>"); |
| 3603 | // add fQCorrelations[1] to the list fIntFlowList: |
| 3604 | fIntFlowList->Add(fQCorrelations[1]); |
| 3605 | */ |
| 3606 | |
| 2bdc5281 |
3607 | |
| 2aa4ebcd |
3608 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow() |
| 2bdc5281 |
3609 | |
| 3610 | |
| 3611 | //================================================================================================================================ |
| 3612 | |
| 3613 | |
| 2aa4ebcd |
3614 | void AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops() |
| 2bdc5281 |
3615 | { |
| 2aa4ebcd |
3616 | // book all profiles relevant for calculations with nested loops |
| 3617 | |
| 3618 | fEvaluateNestedLoops = new TProfile("fEvaluateNestedLoops","1 = evaluate, 0 = do not evaluate",2,0,2); |
| 3619 | fEvaluateNestedLoops->SetLabelSize(0.05); |
| 3620 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(1,"Nested Loops (Int. Flow)"); |
| 3621 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(2,"Nested Loops (Diff. Flow)"); |
| 3622 | fEvaluateNestedLoops->Fill(0.5,(Int_t)fEvaluateNestedLoopsForIntFlow); |
| 3623 | fEvaluateNestedLoops->Fill(1.5,(Int_t)fEvaluateNestedLoopsForDiffFlow); |
| 3624 | // add fEvaluateNestedLoops to the list fNestedLoopsList: |
| 3625 | fNestedLoopsList->Add(fEvaluateNestedLoops); |
| 3626 | |
| 3627 | if(fEvaluateNestedLoopsForIntFlow) |
| 3628 | { |
| 3629 | fDirectCorrelations = new TProfile("fDirectCorrelations","multi-particle correlations with nested loops",100,0,100,"s"); |
| 3630 | fNestedLoopsList->Add(fDirectCorrelations); |
| 3631 | fDirectCorrectionsCos = new TProfile("fDirectCorrectionsCos"," corrections for non-uniform acceptance (cos terms)",100,0,100,"s"); |
| 3632 | fNestedLoopsList->Add(fDirectCorrectionsCos); |
| 3633 | fDirectCorrectionsSin = new TProfile("fDirectCorrectionsSin"," corrections for non-uniform acceptance (sin terms)",100,0,100,"s"); |
| 3634 | fNestedLoopsList->Add(fDirectCorrectionsSin); |
| 3635 | if(fUsePhiWeights) // Remark: cross-checking performed only with phi-weights (this is sufficient) |
| 3636 | { |
| 3637 | fDirectCorrelationsW = new TProfile("fDirectCorrelationsW","multi-particle correlations with nested loops",200,0,200,"s"); |
| 3638 | fNestedLoopsList->Add(fDirectCorrelationsW); |
| 3639 | fDirectCorrectionsCosW = new TProfile("fDirectCorrectionsCosW"," corrections for non-uniform acceptance (cos terms)",100,0,100,"s"); |
| 3640 | fNestedLoopsList->Add(fDirectCorrectionsCosW); |
| 3641 | fDirectCorrectionsSinW = new TProfile("fDirectCorrectionsSinW"," corrections for non-uniform acceptance (sin terms)",100,0,100,"s"); |
| 3642 | fNestedLoopsList->Add(fDirectCorrectionsSinW); |
| 3643 | } |
| 3644 | } |
| 2bdc5281 |
3645 | |
| 2aa4ebcd |
3646 | if(fEvaluateNestedLoopsForDiffFlow) |
| 3647 | { |
| 3648 | fDirectCorrelationsDiffFlow = new TProfile("fDirectCorrelationsDiffFlow","multi-particle correlations with nested loops",200,0,200,"s"); |
| 3649 | fNestedLoopsList->Add(fDirectCorrelationsDiffFlow); |
| 3650 | fDirectCorrectionsDiffFlowCos = new TProfile("fDirectCorrectionsDiffFlowCos", |
| 3651 | "corrections for non-uniform acceptance (cos terms) with nested loops",200,0,200,"s"); |
| 3652 | fNestedLoopsList->Add(fDirectCorrectionsDiffFlowCos); |
| 3653 | fDirectCorrectionsDiffFlowSin = new TProfile("fDirectCorrectionsDiffFlowSin", |
| 3654 | "corrections for non-uniform acceptance (sin terms) with nested loops",200,0,200,"s"); |
| 3655 | fNestedLoopsList->Add(fDirectCorrectionsDiffFlowSin); |
| 3656 | if(fUsePhiWeights) // Remark: cross-checking performed only with phi-weights (this is sufficient) |
| 3657 | { |
| 3658 | fDirectCorrelationsDiffFlowW = new TProfile("fDirectCorrelationsDiffFlowW","multi-particle correlations with nested loops",200,0,200,"s"); |
| 3659 | fNestedLoopsList->Add(fDirectCorrelationsDiffFlowW); |
| 3660 | fDirectCorrectionsDiffFlowCosW = new TProfile("fDirectCorrectionsDiffFlowCosW", |
| 3661 | "corrections for non-uniform acceptance (cos terms) with nested loops",200,0,200,"s"); |
| 3662 | fNestedLoopsList->Add(fDirectCorrectionsDiffFlowCosW); |
| 3663 | fDirectCorrectionsDiffFlowSinW = new TProfile("fDirectCorrectionsDiffFlowSinW", |
| 3664 | "corrections for non-uniform acceptance (sin terms) with nested loops",200,0,200,"s"); |
| 3665 | fNestedLoopsList->Add(fDirectCorrectionsDiffFlowSinW); |
| 3666 | } |
| 3667 | } |
| 2bdc5281 |
3668 | |
| 2aa4ebcd |
3669 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops() |
| 3670 | |
| 3671 | |
| 3672 | //================================================================================================================================ |
| 3673 | |
| 3674 | |
| 3675 | void AliFlowAnalysisWithQCumulants::CalculateCorrelationsForIntegratedFlow() |
| 3676 | { |
| 3677 | // calculate all correlations needed for integrated flow |
| 2bdc5281 |
3678 | |
| 3679 | // multiplicity: |
| 2aa4ebcd |
3680 | Double_t dMult = (*fSMpk)(0,0); |
| 2bdc5281 |
3681 | |
| 3682 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: |
| 2aa4ebcd |
3683 | Double_t dReQ1n = (*fReQ)(0,0); |
| 3684 | Double_t dReQ2n = (*fReQ)(1,0); |
| 3685 | Double_t dReQ3n = (*fReQ)(2,0); |
| 3686 | Double_t dReQ4n = (*fReQ)(3,0); |
| 3687 | Double_t dImQ1n = (*fImQ)(0,0); |
| 3688 | Double_t dImQ2n = (*fImQ)(1,0); |
| 3689 | Double_t dImQ3n = (*fImQ)(2,0); |
| 3690 | Double_t dImQ4n = (*fImQ)(3,0); |
| 3691 | |
| 3692 | // real and imaginary parts of some expressions involving various combinations of Q-vectors evaluated in harmonics n, 2n, 3n and 4n: |
| 3693 | // (these expression appear in the Eqs. for the multi-particle correlations bellow) |
| 3694 | |
| 3695 | // Re[Q_{2n} Q_{n}^* Q_{n}^*] |
| 3696 | Double_t reQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dReQ2n + 2.*dReQ1n*dImQ1n*dImQ2n - pow(dImQ1n,2.)*dReQ2n; |
| 3697 | |
| 3698 | // Im[Q_{2n} Q_{n}^* Q_{n}^*] |
| 3699 | //Double_t imQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dImQ2n-2.*dReQ1n*dImQ1n*dReQ2n-pow(dImQ1n,2.)*dImQ2n; |
| 3700 | |
| 3701 | // Re[Q_{n} Q_{n} Q_{2n}^*] = Re[Q_{2n} Q_{n}^* Q_{n}^*] |
| 3702 | Double_t reQ1nQ1nQ2nstar = reQ2nQ1nstarQ1nstar; |
| 3703 | |
| 3704 | // Re[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*] |
| 3705 | Double_t reQ3nQ1nQ2nstarQ2nstar = (pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n) |
| 3706 | + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n); |
| 2bdc5281 |
3707 | |
| 2aa4ebcd |
3708 | // Im[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*] |
| 3709 | //Double_t imQ3nQ1nQ2nstarQ2nstar = calculate and implement this (deleteMe) |
| 3710 | |
| 3711 | // Re[Q_{2n} Q_{2n} Q_{3n}^* Q_{1n}^*] = Re[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*] |
| 3712 | Double_t reQ2nQ2nQ3nstarQ1nstar = reQ3nQ1nQ2nstarQ2nstar; |
| 3713 | |
| 3714 | // Re[Q_{4n} Q_{2n}^* Q_{2n}^*] |
| 3715 | Double_t reQ4nQ2nstarQ2nstar = pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n; |
| 2bdc5281 |
3716 | |
| 2aa4ebcd |
3717 | // Im[Q_{4n} Q_{2n}^* Q_{2n}^*] |
| 3718 | //Double_t imQ4nQ2nstarQ2nstar = calculate and implement this (deleteMe) |
| 2bdc5281 |
3719 | |
| 2aa4ebcd |
3720 | // Re[Q_{2n} Q_{2n} Q_{4n}^*] = Re[Q_{4n} Q_{2n}^* Q_{2n}^*] |
| 3721 | Double_t reQ2nQ2nQ4nstar = reQ4nQ2nstarQ2nstar; |
| 3722 | |
| 3723 | // Re[Q_{4n} Q_{3n}^* Q_{n}^*] |
| 3724 | Double_t reQ4nQ3nstarQ1nstar = dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n); |
| 3725 | |
| 3726 | // Re[Q_{3n} Q_{n} Q_{4n}^*] = Re[Q_{4n} Q_{3n}^* Q_{n}^*] |
| 3727 | Double_t reQ3nQ1nQ4nstar = reQ4nQ3nstarQ1nstar; |
| 3728 | |
| 3729 | // Im[Q_{4n} Q_{3n}^* Q_{n}^*] |
| 3730 | //Double_t imQ4nQ3nstarQ1nstar = calculate and implement this (deleteMe) |
| c365fe76 |
3731 | |
| 2aa4ebcd |
3732 | // Re[Q_{3n} Q_{2n}^* Q_{n}^*] |
| 3733 | Double_t reQ3nQ2nstarQ1nstar = dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n |
| 3734 | + dImQ3n*dImQ2n*dReQ1n; |
| 3735 | |
| 3736 | // Re[Q_{2n} Q_{n} Q_{3n}^*] = Re[Q_{3n} Q_{2n}^* Q_{n}^*] |
| 3737 | Double_t reQ2nQ1nQ3nstar = reQ3nQ2nstarQ1nstar; |
| 3738 | |
| 3739 | // Im[Q_{3n} Q_{2n}^* Q_{n}^*] |
| 3740 | //Double_t imQ3nQ2nstarQ1nstar; //calculate and implement this (deleteMe) |
| 3741 | |
| 3742 | // Re[Q_{3n} Q_{n}^* Q_{n}^* Q_{n}^*] |
| 3743 | Double_t reQ3nQ1nstarQ1nstarQ1nstar = dReQ3n*pow(dReQ1n,3)-3.*dReQ1n*dReQ3n*pow(dImQ1n,2) |
| 3744 | + 3.*dImQ1n*dImQ3n*pow(dReQ1n,2)-dImQ3n*pow(dImQ1n,3); |
| c365fe76 |
3745 | |
| 2aa4ebcd |
3746 | // Im[Q_{3n} Q_{n}^* Q_{n}^* Q_{n}^*] |
| 3747 | //Double_t imQ3nQ1nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe) |
| 3748 | |
| 3749 | // |Q_{2n}|^2 |Q_{n}|^2 |
| 3750 | Double_t dQ2nQ1nQ2nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)); |
| 3751 | |
| 3752 | // Re[Q_{4n} Q_{2n}^* Q_{n}^* Q_{n}^*] |
| 3753 | Double_t reQ4nQ2nstarQ1nstarQ1nstar = (dReQ4n*dReQ2n+dImQ4n*dImQ2n)*(pow(dReQ1n,2)-pow(dImQ1n,2)) |
| 3754 | + 2.*dReQ1n*dImQ1n*(dImQ4n*dReQ2n-dReQ4n*dImQ2n); |
| 3755 | |
| 3756 | // Im[Q_{4n} Q_{2n}^* Q_{n}^* Q_{n}^*] |
| 3757 | //Double_t imQ4nQ2nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe) |
| 3758 | |
| 3759 | // Re[Q_{2n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^*] |
| 3760 | Double_t reQ2nQ1nQ1nstarQ1nstarQ1nstar = (dReQ2n*dReQ1n-dImQ2n*dImQ1n)*(pow(dReQ1n,3)-3.*dReQ1n*pow(dImQ1n,2)) |
| 3761 | + (dReQ2n*dImQ1n+dReQ1n*dImQ2n)*(3.*dImQ1n*pow(dReQ1n,2)-pow(dImQ1n,3)); |
| c365fe76 |
3762 | |
| 2aa4ebcd |
3763 | // Im[Q_{2n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^*] |
| 3764 | //Double_t imQ2nQ1nQ1nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe) |
| 3765 | |
| 3766 | // Re[Q_{2n} Q_{2n} Q_{2n}^* Q_{n}^* Q_{n}^*] |
| 3767 | Double_t reQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.)) |
| 3768 | * (dReQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) + 2.*dImQ2n*dReQ1n*dImQ1n); |
| c365fe76 |
3769 | |
| 2aa4ebcd |
3770 | // Im[Q_{2n} Q_{2n} Q_{2n}^* Q_{n}^* Q_{n}^*] |
| 3771 | //Double_t imQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.)) |
| 3772 | // * (dImQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) - 2.*dReQ2n*dReQ1n*dImQ1n); |
| 3773 | |
| 3774 | // Re[Q_{4n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] |
| 3775 | Double_t reQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dReQ4n-6.*pow(dReQ1n,2.)*dReQ4n*pow(dImQ1n,2.) |
| 3776 | + pow(dImQ1n,4.)*dReQ4n+4.*pow(dReQ1n,3.)*dImQ1n*dImQ4n |
| 3777 | - 4.*pow(dImQ1n,3.)*dReQ1n*dImQ4n; |
| 3778 | |
| 3779 | // Im[Q_{4n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] |
| 3780 | //Double_t imQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dImQ4n-6.*pow(dReQ1n,2.)*dImQ4n*pow(dImQ1n,2.) |
| 3781 | // + pow(dImQ1n,4.)*dImQ4n+4.*pow(dImQ1n,3.)*dReQ1n*dReQ4n |
| 3782 | // - 4.*pow(dReQ1n,3.)*dImQ1n*dReQ4n; |
| 3783 | |
| 3784 | // Re[Q_{3n} Q_{n} Q_{2n}^* Q_{n}^* Q_{n}^*] |
| 3785 | Double_t reQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
| 3786 | * (dReQ1n*dReQ2n*dReQ3n-dReQ3n*dImQ1n*dImQ2n+dReQ2n*dImQ1n*dImQ3n+dReQ1n*dImQ2n*dImQ3n); |
| 3787 | |
| 3788 | // Im[Q_{3n} Q_{n} Q_{2n}^* Q_{n}^* Q_{n}^*] |
| 3789 | //Double_t imQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
| 3790 | // * (-dReQ2n*dReQ3n*dImQ1n-dReQ1n*dReQ3n*dImQ2n+dReQ1n*dReQ2n*dImQ3n-dImQ1n*dImQ2n*dImQ3n); |
| 3d824203 |
3791 | |
| dee1e0e0 |
3792 | |
| 2aa4ebcd |
3793 | // Re[Q_{2n} Q_{2n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] |
| 3794 | Double_t reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)*dReQ2n-2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.) |
| 3795 | + dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dImQ2n) |
| 3796 | * (pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.) |
| 3797 | - dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n+pow(dImQ1n,2.)*dImQ2n); |
| 3798 | |
| 3799 | // Im[Q_{2n} Q_{2n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] |
| 3800 | //Double_t imQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = 2.*(pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.) |
| 3801 | // + 2.*dReQ1n*dImQ1n*dImQ2n)*(pow(dReQ1n,2.)*dImQ2n |
| 3802 | // - 2.*dReQ1n*dImQ1n*dReQ2n-pow(dImQ1n,2.)*dImQ2n); |
| 3803 | |
| 3804 | // Re[Q_{3n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] |
| 3805 | Double_t reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
| 3806 | * (pow(dReQ1n,3.)*dReQ3n-3.*dReQ1n*dReQ3n*pow(dImQ1n,2.) |
| 3807 | + 3.*pow(dReQ1n,2.)*dImQ1n*dImQ3n-pow(dImQ1n,3.)*dImQ3n); |
| 3808 | |
| 3809 | // Im[Q_{3n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] |
| 3810 | //Double_t imQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
| 3811 | // * (pow(dImQ1n,3.)*dReQ3n-3.*dImQ1n*dReQ3n*pow(dReQ1n,2.) |
| 3812 | // - 3.*pow(dImQ1n,2.)*dReQ1n*dImQ3n+pow(dReQ1n,3.)*dImQ3n); |
| 3d824203 |
3813 | |
| 2aa4ebcd |
3814 | // |Q_{2n}|^2 |Q_{n}|^4 |
| 3815 | Double_t dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.); |
| 77515452 |
3816 | |
| 2aa4ebcd |
3817 | // Re[Q_{2n} Q_{n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] |
| 3818 | Double_t reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) |
| 3819 | * (pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.) |
| 3820 | + 2.*dReQ1n*dImQ1n*dImQ2n); |
| 3821 | |
| 3822 | // Im[Q_{2n} Q_{n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] |
| 3823 | //Double_t imQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) |
| 3824 | // * (pow(dReQ1n,2.)*dImQ2n-dImQ2n*pow(dImQ1n,2.) |
| 3825 | // - 2.*dReQ1n*dReQ2n*dImQ1n); |
| 77515452 |
3826 | |
| 2aa4ebcd |
3827 | |
| 77515452 |
3828 | |
| 2aa4ebcd |
3829 | |
| 3830 | // ************************************** |
| 3831 | // **** multi-particle correlations: **** |
| 3832 | // ************************************** |
| 9c1a9547 |
3833 | // |
| 2aa4ebcd |
3834 | // Remark 1: multi-particle correlations calculated with non-weighted Q-vectors are stored in 1D profile fQCorrelations[0]. |
| 3835 | // Remark 2: binning of fQCorrelations[0] is organized as follows: |
| 9c1a9547 |
3836 | // -------------------------------------------------------------------------------------------------------------------- |
| 3837 | // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))> |
| 3838 | // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))> |
| 3839 | // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))> |
| 3840 | // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))> |
| 3841 | // 5th bin: ---- EMPTY ---- |
| 3842 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))> |
| 3843 | // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))> |
| 3844 | // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))> |
| 3845 | // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))> |
| 3846 | // 10th bin: ---- EMPTY ---- |
| 3847 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))> |
| 3848 | // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))> |
| 3849 | // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))> |
| 3850 | // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))> |
| 3851 | // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))> |
| 3852 | // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))> |
| 3853 | // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> |
| 3854 | // 18th bin: ---- EMPTY ---- |
| 3855 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))> |
| 3856 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))> |
| 3857 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))> |
| 3858 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))> |
| 3859 | // 23rd bin: ---- EMPTY ---- |
| 3860 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> |
| 3861 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))> |
| 3862 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))> |
| 3863 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))> |
| 3864 | // 28th bin: ---- EMPTY ---- |
| 3865 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> |
| 3866 | // 30th bin: ---- EMPTY ---- |
| 3867 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> |
| 3868 | // -------------------------------------------------------------------------------------------------------------------- |
| 9c1a9547 |
3869 | |
| 2aa4ebcd |
3870 | // 2-particle: |
| 3871 | Double_t two1n1n = 0.; // <cos(n*(phi1-phi2))> |
| 3872 | Double_t two2n2n = 0.; // <cos(2n*(phi1-phi2))> |
| 3873 | Double_t two3n3n = 0.; // <cos(3n*(phi1-phi2))> |
| 3874 | Double_t two4n4n = 0.; // <cos(4n*(phi1-phi2))> |
| c365fe76 |
3875 | |
| 2aa4ebcd |
3876 | if(dMult>1) |
| bc92c0cb |
3877 | { |
| 2aa4ebcd |
3878 | two1n1n = (pow(dReQ1n,2.)+pow(dImQ1n,2.)-dMult)/(dMult*(dMult-1.)); |
| 3879 | two2n2n = (pow(dReQ2n,2.)+pow(dImQ2n,2.)-dMult)/(dMult*(dMult-1.)); |
| 3880 | two3n3n = (pow(dReQ3n,2.)+pow(dImQ3n,2.)-dMult)/(dMult*(dMult-1.)); |
| 3881 | two4n4n = (pow(dReQ4n,2.)+pow(dImQ4n,2.)-dMult)/(dMult*(dMult-1.)); |
| c365fe76 |
3882 | |
| 2aa4ebcd |
3883 | // average non-weighted 2-particle correlations for single event: |
| 3884 | fQCorrelationsEBE[0]->SetBinContent(1,two1n1n); |
| 3885 | fQCorrelationsEBE[0]->SetBinContent(2,two2n2n); |
| 3886 | fQCorrelationsEBE[0]->SetBinContent(3,two3n3n); |
| 3887 | fQCorrelationsEBE[0]->SetBinContent(4,two4n4n); |
| 3888 | |
| 3889 | // final average non-weighted 2-particle correlations for all events: |
| 3890 | fQCorrelations[0][0]->Fill(0.5,two1n1n,dMult*(dMult-1.)); |
| 3891 | fQCorrelations[0][0]->Fill(1.5,two2n2n,dMult*(dMult-1.)); |
| 3892 | fQCorrelations[0][0]->Fill(2.5,two3n3n,dMult*(dMult-1.)); |
| 3893 | fQCorrelations[0][0]->Fill(3.5,two4n4n,dMult*(dMult-1.)); |
| 3894 | |
| 3895 | // distribution of <cos(n*(phi1-phi2))>: |
| 3896 | //f2pDistribution->Fill(two1n1n,dMult*(dMult-1.)); |
| 3897 | } // end of if(dMult>1) |
| 3898 | |
| 3899 | // 3-particle: |
| 3900 | Double_t three2n1n1n = 0.; // <cos(n*(2.*phi1-phi2-phi3))> |
| 3901 | Double_t three3n2n1n = 0.; // <cos(n*(3.*phi1-2.*phi2-phi3))> |
| 3902 | Double_t three4n2n2n = 0.; // <cos(n*(4.*phi1-2.*phi2-2.*phi3))> |
| 3903 | Double_t three4n3n1n = 0.; // <cos(n*(4.*phi1-3.*phi2-phi3))> |
| 3904 | |
| 3905 | if(dMult>2) |
| bc92c0cb |
3906 | { |
| 2aa4ebcd |
3907 | three2n1n1n = (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
| 3908 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult) |
| 3909 | / (dMult*(dMult-1.)*(dMult-2.)); |
| 3910 | three3n2n1n = (reQ3nQ2nstarQ1nstar-(pow(dReQ3n,2.)+pow(dImQ3n,2.)) |
| 3911 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.)) |
| 3912 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) |
| 3913 | / (dMult*(dMult-1.)*(dMult-2.)); |
| 3914 | three4n2n2n = (reQ4nQ2nstarQ2nstar-2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) |
| 3915 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*dMult) |
| 3916 | / (dMult*(dMult-1.)*(dMult-2.)); |
| 3917 | three4n3n1n = (reQ4nQ3nstarQ1nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.)) |
| 3918 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.)) |
| 3919 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) |
| 3920 | / (dMult*(dMult-1.)*(dMult-2.)); |
| 3921 | |
| 3922 | // average non-weighted 3-particle correlations for single event: |
| 3923 | fQCorrelationsEBE[0]->SetBinContent(6,three2n1n1n); |
| 3924 | fQCorrelationsEBE[0]->SetBinContent(7,three3n2n1n); |
| 3925 | fQCorrelationsEBE[0]->SetBinContent(8,three4n2n2n); |
| 3926 | fQCorrelationsEBE[0]->SetBinContent(9,three4n3n1n); |
| 3927 | |
| 3928 | // final average non-weighted 3-particle correlations for all events: |
| 3929 | fQCorrelations[0][0]->Fill(5.5,three2n1n1n,dMult*(dMult-1.)*(dMult-2.)); |
| 3930 | fQCorrelations[0][0]->Fill(6.5,three3n2n1n,dMult*(dMult-1.)*(dMult-2.)); |
| 3931 | fQCorrelations[0][0]->Fill(7.5,three4n2n2n,dMult*(dMult-1.)*(dMult-2.)); |
| 3932 | fQCorrelations[0][0]->Fill(8.5,three4n3n1n,dMult*(dMult-1.)*(dMult-2.)); |
| 3933 | } // end of if(dMult>2) |
| bc92c0cb |
3934 | |
| 2aa4ebcd |
3935 | // 4-particle: |
| 3936 | Double_t four1n1n1n1n = 0.; // <cos(n*(phi1+phi2-phi3-phi4))> |
| 3937 | Double_t four2n2n2n2n = 0.; // <cos(2.*n*(phi1+phi2-phi3-phi4))> |
| 3938 | Double_t four2n1n2n1n = 0.; // <cos(n*(2.*phi1+phi2-2.*phi3-phi4))> |
| 3939 | Double_t four3n1n1n1n = 0.; // <cos(n*(3.*phi1-phi2-phi3-phi4))> |
| 3940 | Double_t four4n2n1n1n = 0.; // <cos(n*(4.*phi1-2.*phi2-phi3-phi4))> |
| 3941 | Double_t four3n1n2n2n = 0.; // <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))> |
| 3942 | Double_t four3n1n3n1n = 0.; // <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> |
| 3943 | |
| 3944 | if(dMult>3) |
| dee1e0e0 |
3945 | { |
| 2aa4ebcd |
3946 | four1n1n1n1n = (2.*dMult*(dMult-3.)+pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ1n,2.) |
| 3947 | + pow(dImQ1n,2.))-2.*reQ2nQ1nstarQ1nstar+(pow(dReQ2n,2.)+pow(dImQ2n,2.))) |
| 3948 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); |
| 3949 | four2n2n2n2n = (2.*dMult*(dMult-3.)+pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ2n,2.) |
| 3950 | + pow(dImQ2n,2.))-2.*reQ4nQ2nstarQ2nstar+(pow(dReQ4n,2.)+pow(dImQ4n,2.))) |
| 3951 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); |
| 3952 | four2n1n2n1n = (dQ2nQ1nQ2nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar-2.*reQ2nQ1nstarQ1nstar) |
| 3953 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 3954 | - ((dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
| 3955 | + (dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-(pow(dReQ3n,2.)+pow(dImQ3n,2.))) |
| 3956 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 3957 | + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 3958 | four3n1n1n1n = (reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar-3.*reQ2nQ1nstarQ1nstar) |
| 3959 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 3960 | + (2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) |
| 3961 | + 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) |
| 3962 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 3963 | four4n2n1n1n = (reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar-2.*reQ3nQ2nstarQ1nstar) |
| 3964 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 3965 | - (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) |
| 3966 | - 3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) |
| 3967 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 3968 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 3969 | four3n1n2n2n = (reQ3nQ1nQ2nstarQ2nstar-reQ4nQ2nstarQ2nstar-reQ3nQ1nQ4nstar-2.*reQ3nQ2nstarQ1nstar) |
| 3970 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 3971 | - (2.*reQ1nQ1nQ2nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) |
| 3972 | - 4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) |
| 3973 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 3974 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 3975 | four3n1n3n1n = ((pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
| 3976 | - 2.*reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar) |
| 3977 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 3978 | + ((pow(dReQ4n,2.)+pow(dImQ4n,2.))-(dMult-4.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) |
| 3979 | + (pow(dReQ2n,2.)+pow(dImQ2n,2.))-(dMult-4.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) |
| 3980 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 3981 | + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 3982 | |
| 3983 | // average non-weighted 4-particle correlations for single event: |
| 3984 | fQCorrelationsEBE[0]->SetBinContent(11,four1n1n1n1n); |
| 3985 | fQCorrelationsEBE[0]->SetBinContent(12,four2n1n2n1n); |
| 3986 | fQCorrelationsEBE[0]->SetBinContent(13,four2n2n2n2n); |
| 3987 | fQCorrelationsEBE[0]->SetBinContent(14,four3n1n1n1n); |
| 3988 | fQCorrelationsEBE[0]->SetBinContent(15,four3n1n3n1n); |
| 3989 | fQCorrelationsEBE[0]->SetBinContent(16,four3n1n2n2n); |
| 3990 | fQCorrelationsEBE[0]->SetBinContent(17,four4n2n1n1n); |
| 3991 | |
| 3992 | // final average non-weighted 4-particle correlations for all events: |
| 3993 | fQCorrelations[0][0]->Fill(10.5,four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 3994 | fQCorrelations[0][0]->Fill(11.5,four2n1n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 3995 | fQCorrelations[0][0]->Fill(12.5,four2n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 3996 | fQCorrelations[0][0]->Fill(13.5,four3n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 3997 | fQCorrelations[0][0]->Fill(14.5,four3n1n3n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 3998 | fQCorrelations[0][0]->Fill(15.5,four3n1n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 3999 | fQCorrelations[0][0]->Fill(16.5,four4n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 4000 | |
| 4001 | // distribution of <cos(n*(phi1+phi2-phi3-phi4))> |
| 4002 | //f4pDistribution->Fill(four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 4003 | |
| 4004 | } // end of if(dMult>3) |
| 9c1a9547 |
4005 | |
| 2aa4ebcd |
4006 | // 5-particle: |
| 4007 | Double_t five2n1n1n1n1n = 0.; // <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))> |
| 4008 | Double_t five2n2n2n1n1n = 0.; // <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))> |
| 4009 | Double_t five3n1n2n1n1n = 0.; // <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))> |
| 4010 | Double_t five4n1n1n1n1n = 0.; // <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))> |
| 3d824203 |
4011 | |
| 2aa4ebcd |
4012 | if(dMult>4) |
| bc92c0cb |
4013 | { |
| 2aa4ebcd |
4014 | five2n1n1n1n1n = (reQ2nQ1nQ1nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar+6.*reQ3nQ2nstarQ1nstar) |
| 4015 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 4016 | - (reQ2nQ1nQ3nstar+3.*(dMult-6.)*reQ2nQ1nstarQ1nstar+3.*reQ1nQ1nQ2nstar) |
| 4017 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 4018 | - (2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) |
| 4019 | + 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) |
| 4020 | - 3.*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))) |
| 4021 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 4022 | - 3.*(pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) |
| 4023 | - 2.*(2*dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult*(dMult-4.)) |
| 4024 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
| 4025 | |
| 4026 | five2n2n2n1n1n = (reQ2nQ2nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ2nQ2nQ3nstarQ1nstar) |
| 4027 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 4028 | + 2.*(reQ4nQ2nstarQ2nstar+4.*reQ3nQ2nstarQ1nstar+reQ3nQ1nQ4nstar) |
| 4029 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 4030 | + (reQ2nQ2nQ4nstar-2.*(dMult-5.)*reQ2nQ1nstarQ1nstar+2.*reQ1nQ1nQ2nstar) |
| 4031 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 4032 | - (2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) |
| 4033 | + 1.*pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.) |
| 4034 | - 2.*(3.*dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))) |
| 4035 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 4036 | - (4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) |
| 4037 | - 4.*(dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+4.*dMult*(dMult-6.)) |
| 4038 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
| 4039 | |
| 4040 | five4n1n1n1n1n = (reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ4nQ2nstarQ1nstarQ1nstar-4.*reQ3nQ1nstarQ1nstarQ1nstar) |
| 4041 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 4042 | + (8.*reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar+12.*reQ3nQ2nstarQ1nstar+12.*reQ2nQ1nstarQ1nstar) |
| 4043 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 4044 | - (6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+8.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) |
| 4045 | + 12.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+24.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-24.*dMult) |
| 4046 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
| 4047 | |
| 4048 | five3n1n2n1n1n = (reQ3nQ1nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar) |
| 4049 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 4050 | - (reQ3nQ1nQ2nstarQ2nstar-3.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar) |
| 4051 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 4052 | - ((2.*dMult-13.)*reQ3nQ2nstarQ1nstar-reQ3nQ1nQ4nstar-9.*reQ2nQ1nstarQ1nstar) |
| 4053 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 4054 | - (2.*reQ1nQ1nQ2nstar+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) |
| 4055 | - 2.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+2.*(pow(dReQ3n,2.) |
| 4056 | + pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) |
| 4057 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 4058 | + (2.*(dMult-6.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) |
| 4059 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
| 4060 | - pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) |
| 4061 | + 2.*(3.*dMult-11.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) |
| 4062 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) |
| 4063 | - 4.*(dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
| 4064 | |
| 4065 | // average non-weighted 5-particle correlations for single event: |
| 4066 | fQCorrelationsEBE[0]->SetBinContent(19,five2n1n1n1n1n); |
| 4067 | fQCorrelationsEBE[0]->SetBinContent(20,five2n2n2n1n1n); |
| 4068 | fQCorrelationsEBE[0]->SetBinContent(21,five3n1n2n1n1n); |
| 4069 | fQCorrelationsEBE[0]->SetBinContent(22,five4n1n1n1n1n); |
| 9c1a9547 |
4070 | |
| 2aa4ebcd |
4071 | // final average non-weighted 5-particle correlations for all events: |
| 4072 | fQCorrelations[0][0]->Fill(18.5,five2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
| 4073 | fQCorrelations[0][0]->Fill(19.5,five2n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
| 4074 | fQCorrelations[0][0]->Fill(20.5,five3n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
| 4075 | fQCorrelations[0][0]->Fill(21.5,five4n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
| 4076 | } // end of if(dMult>4) |
| 4077 | |
| 4078 | // 6-particle: |
| 4079 | Double_t six1n1n1n1n1n1n = 0.; // <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> |
| 4080 | Double_t six2n2n1n1n1n1n = 0.; // <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))> |
| 4081 | Double_t six3n1n1n1n1n1n = 0.; // <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))> |
| 4082 | Double_t six2n1n1n2n1n1n = 0.; // <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))> |
| 4083 | |
| 4084 | if(dMult>5) |
| 4085 | { |
| 4086 | six1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),3.)+9.*dQ2nQ1nQ2nstarQ1nstar-6.*reQ2nQ1nQ1nstarQ1nstarQ1nstar) |
| 4087 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)) |
| 4088 | + 4.*(reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar) |
| 4089 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)) |
| 4090 | + 2.*(9.*(dMult-4.)*reQ2nQ1nstarQ1nstar+2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))) |
| 4091 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)) |
| 4092 | - 9.*(pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)+(pow(dReQ2n,2.)+pow(dImQ2n,2.))) |
| 4093 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-5.)) |
| 4094 | + (18.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) |
| 4095 | / (dMult*(dMult-1)*(dMult-3)*(dMult-4)) |
| 4096 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 4097 | |
| 4098 | six2n1n1n2n1n1n = (dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.) |
| 4099 | * (2.*five2n2n2n1n1n+4.*five2n1n1n1n1n+4.*five3n1n2n1n1n+4.*four2n1n2n1n+1.*four1n1n1n1n) |
| 4100 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four1n1n1n1n+4.*two1n1n |
| 4101 | + 2.*three2n1n1n+2.*three2n1n1n+4.*four3n1n1n1n+8.*three2n1n1n+2.*four4n2n1n1n |
| 4102 | + 4.*four2n1n2n1n+2.*two2n2n+8.*four2n1n2n1n+4.*four3n1n3n1n+8.*three3n2n1n |
| 4103 | + 4.*four3n1n2n2n+4.*four1n1n1n1n+4.*four2n1n2n1n+1.*four2n2n2n2n) |
| 4104 | - dMult*(dMult-1.)*(dMult-2.)*(2.*three2n1n1n+8.*two1n1n+4.*two1n1n+2. |
| 4105 | + 4.*two1n1n+4.*three2n1n1n+2.*two2n2n+4.*three2n1n1n+8.*three3n2n1n |
| 4106 | + 8.*two2n2n+4.*three4n3n1n+4.*two3n3n+4.*three3n2n1n+4.*two1n1n |
| 4107 | + 8.*three2n1n1n+4.*two1n1n+4.*three3n2n1n+4.*three2n1n1n+2.*two2n2n |
| 4108 | + 4.*three3n2n1n+2.*three4n2n2n)-dMult*(dMult-1.) |
| 4109 | * (4.*two1n1n+4.+4.*two1n1n+2.*two2n2n+1.+4.*two1n1n+4.*two2n2n+4.*two3n3n |
| 4110 | + 1.+2.*two2n2n+1.*two4n4n)-dMult) |
| 4111 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed) |
| 4112 | |
| 4113 | six2n2n1n1n1n1n = (reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.) |
| 4114 | * (five4n1n1n1n1n+8.*five2n1n1n1n1n+6.*five2n2n2n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) |
| 4115 | * (4.*four3n1n1n1n+6.*four4n2n1n1n+12.*three2n1n1n+12.*four1n1n1n1n+24.*four2n1n2n1n |
| 4116 | + 4.*four3n1n2n2n+3.*four2n2n2n2n)-dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+12.*three3n2n1n |
| 4117 | + 4.*three4n3n1n+3.*three4n2n2n+8.*three2n1n1n+24.*two1n1n+12.*two2n2n+12.*three2n1n1n+8.*three3n2n1n |
| 4118 | + 1.*three4n2n2n)-dMult*(dMult-1.)*(4.*two1n1n+6.*two2n2n+4.*two3n3n+1.*two4n4n+2.*two2n2n+8.*two1n1n+6.)-dMult) |
| 4119 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed) |
| 4120 | |
| 4121 | six3n1n1n1n1n1n = (reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.) |
| 4122 | * (five4n1n1n1n1n+4.*five2n1n1n1n1n+6.*five3n1n2n1n1n+4.*four3n1n1n1n) |
| 4123 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four3n1n1n1n+6.*four4n2n1n1n+6.*four1n1n1n1n |
| 4124 | + 12.*three2n1n1n+12.*four2n1n2n1n+6.*four3n1n1n1n+12.*three3n2n1n+4.*four3n1n3n1n+3.*four3n1n2n2n) |
| 4125 | - dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+12.*three3n2n1n+4.*three4n3n1n+3.*three4n2n2n+4.*two1n1n |
| 4126 | + 12.*two1n1n+6.*three2n1n1n+12.*three2n1n1n+4.*three3n2n1n+12.*two2n2n+4.*three3n2n1n+4.*two3n3n+1.*three4n3n1n |
| 4127 | + 6.*three3n2n1n)-dMult*(dMult-1.)*(4.*two1n1n+6.*two2n2n+4.*two3n3n+1.*two4n4n+1.*two1n1n+4.+6.*two1n1n+4.*two2n2n |
| 4128 | + 1.*two3n3n)-dMult)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed) |
| 4129 | |
| 4130 | // average non-weighted 6-particle correlations for single event: |
| 4131 | fQCorrelationsEBE[0]->SetBinContent(24,six1n1n1n1n1n1n); |
| 4132 | fQCorrelationsEBE[0]->SetBinContent(25,six2n1n1n2n1n1n); |
| 4133 | fQCorrelationsEBE[0]->SetBinContent(26,six2n2n1n1n1n1n); |
| 4134 | fQCorrelationsEBE[0]->SetBinContent(27,six3n1n1n1n1n1n); |
| 9c1a9547 |
4135 | |
| 2aa4ebcd |
4136 | // final average non-weighted 6-particle correlations for all events: |
| 4137 | fQCorrelations[0][0]->Fill(23.5,six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
| 4138 | fQCorrelations[0][0]->Fill(24.5,six2n1n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
| 4139 | fQCorrelations[0][0]->Fill(25.5,six2n2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
| 4140 | fQCorrelations[0][0]->Fill(26.5,six3n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
| 4141 | |
| 4142 | // distribution of <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> |
| 4143 | //f6pDistribution->Fill(six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
| 4144 | } // end of if(dMult>5) |
| 4145 | |
| 4146 | // 7-particle: |
| 4147 | Double_t seven2n1n1n1n1n1n1n = 0.; // <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> |
| 4148 | |
| 4149 | if(dMult>6) |
| 4150 | { |
| 4151 | seven2n1n1n1n1n1n1n = (reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.) |
| 4152 | * (2.*six3n1n1n1n1n1n+4.*six1n1n1n1n1n1n+1.*six2n2n1n1n1n1n+6.*six2n1n1n2n1n1n+8.*five2n1n1n1n1n) |
| 4153 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(1.*five4n1n1n1n1n +8.*five2n1n1n1n1n+8.*four3n1n1n1n |
| 4154 | + 12.*five3n1n2n1n1n+4.*five2n1n1n1n1n+3.*five2n2n2n1n1n+6.*five2n2n2n1n1n+6.*four1n1n1n1n+24.*four1n1n1n1n |
| 4155 | + 12.*five2n1n1n1n1n+12.*five2n1n1n1n1n+12.*three2n1n1n+24.*four2n1n2n1n+4.*five3n1n2n1n1n+4.*five2n1n1n1n1n) |
| 4156 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four3n1n1n1n+6.*four4n2n1n1n+12.*four1n1n1n1n+24.*three2n1n1n |
| 4157 | + 24.*four2n1n2n1n+12.*four3n1n1n1n+24.*three3n2n1n+8.*four3n1n3n1n+6.*four3n1n2n2n+6.*three2n1n1n+12.*four1n1n1n1n |
| 4158 | + 12.*four2n1n2n1n+6.*three2n1n1n+12.*four2n1n2n1n+4.*four3n1n2n2n+3.*four2n2n2n2n+4.*four1n1n1n1n+6.*three2n1n1n |
| 4159 | + 24.*two1n1n+24.*four1n1n1n1n+4.*four3n1n1n1n+24.*two1n1n+24.*three2n1n1n+12.*two2n2n+24.*three2n1n1n+12.*four2n1n2n1n |
| 4160 | + 8.*three3n2n1n+8.*four2n1n2n1n+1.*four4n2n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+1.*three2n1n1n+8.*two1n1n |
| 4161 | + 12.*three3n2n1n+24.*two1n1n+12.*three2n1n1n+4.*three2n1n1n+8.*two1n1n+4.*three4n3n1n+24.*three2n1n1n+8.*three3n2n1n |
| 4162 | + 12.*two1n1n+12.*two1n1n+3.*three4n2n2n+24.*two2n2n+6.*two2n2n+12.+12.*three3n2n1n+8.*two3n3n+12.*three2n1n1n+24.*two1n1n |
| 4163 | + 4.*three3n2n1n+8.*three3n2n1n+2.*three4n3n1n+12.*two1n1n+8.*three2n1n1n+4.*three2n1n1n+2.*three3n2n1n+6.*two2n2n+8.*two2n2n |
| 4164 | + 1.*three4n2n2n+4.*three3n2n1n+6.*three2n1n1n)-dMult*(dMult-1.)*(4.*two1n1n+2.*two1n1n+6.*two2n2n+8.+1.*two2n2n+4.*two3n3n |
| 4165 | + 12.*two1n1n+4.*two1n1n+1.*two4n4n+8.*two2n2n+6.+2.*two3n3n+4.*two1n1n+1.*two2n2n)-dMult) |
| 4166 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)); // to be improved (direct formula needed) |
| 9c1a9547 |
4167 | |
| 2aa4ebcd |
4168 | // average non-weighted 7-particle correlations for single event: |
| 4169 | fQCorrelationsEBE[0]->SetBinContent(29,seven2n1n1n1n1n1n1n); |
| 4170 | |
| 4171 | // final average non-weighted 7-particle correlations for all events: |
| 4172 | fQCorrelations[0][0]->Fill(28.5,seven2n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)); |
| 4173 | } // end of if(dMult>6) |
| 52021ae2 |
4174 | |
| 2aa4ebcd |
4175 | // 8-particle: |
| 4176 | Double_t eight1n1n1n1n1n1n1n1n = 0.; // <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> |
| 4177 | if(dMult>7) |
| dee1e0e0 |
4178 | { |
| 2aa4ebcd |
4179 | eight1n1n1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),4.)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.) |
| 4180 | * (12.*seven2n1n1n1n1n1n1n+16.*six1n1n1n1n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.) |
| 4181 | * (8.*six3n1n1n1n1n1n+48.*six1n1n1n1n1n1n+6.*six2n2n1n1n1n1n+96.*five2n1n1n1n1n+72.*four1n1n1n1n+36.*six2n1n1n2n1n1n) |
| 4182 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(2.*five4n1n1n1n1n+32.*five2n1n1n1n1n+36.*four1n1n1n1n |
| 4183 | + 32.*four3n1n1n1n+48.*five2n1n1n1n1n+48.*five3n1n2n1n1n+144.*five2n1n1n1n1n+288.*four1n1n1n1n+36.*five2n2n2n1n1n |
| 4184 | + 144.*three2n1n1n+96.*two1n1n+144.*four2n1n2n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) |
| 4185 | * (8.*four3n1n1n1n+48.*four1n1n1n1n+12.*four4n2n1n1n+96.*four2n1n2n1n+96.*three2n1n1n+72.*three2n1n1n+144.*two1n1n |
| 4186 | + 16.*four3n1n3n1n+48.*four3n1n1n1n+144.*four1n1n1n1n+72.*four1n1n1n1n+96.*three3n2n1n+24.*four3n1n2n2n+144.*four2n1n2n1n |
| 4187 | + 288.*two1n1n+288.*three2n1n1n+9.*four2n2n2n2n+72.*two2n2n+24.)-dMult*(dMult-1.)*(dMult-2.)*(12.*three2n1n1n+16.*two1n1n |
| 4188 | + 24.*three3n2n1n+48.*three2n1n1n+96.*two1n1n+8.*three4n3n1n+32.*three3n2n1n+96.*three2n1n1n+144.*two1n1n+6.*three4n2n2n |
| 4189 | + 96.*two2n2n+36.*two2n2n+72.+48.*three3n2n1n+16.*two3n3n+72.*three2n1n1n+144.*two1n1n)-dMult*(dMult-1.)*(8.*two1n1n |
| 4190 | + 12.*two2n2n+16.+8.*two3n3n+48.*two1n1n+1.*two4n4n+16.*two2n2n+18.)-dMult) |
| 4191 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); // to be improved (direct formula needed) |
| 4192 | |
| 4193 | // average non-weighted 8-particle correlations for single event: |
| 4194 | fQCorrelationsEBE[0]->SetBinContent(31,eight1n1n1n1n1n1n1n1n); |
| 4195 | |
| 4196 | // final average non-weighted 8-particle correlations for all events: |
| 4197 | fQCorrelations[0][0]->Fill(30.5,eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); |
| 9c1a9547 |
4198 | |
| 2aa4ebcd |
4199 | // distribution of <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> |
| 4200 | //f8pDistribution->Fill(eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); |
| 4201 | } // end of if(dMult>7) |
| 4202 | |
| 4203 | } // end of AliFlowAnalysisWithQCumulants::CalculateCorrelationsForIntegratedFlow() |
| 4204 | |
| 4205 | |
| 4206 | |
| 4207 | |
| 4208 | |
| 4209 | |
| 4210 | |
| 4211 | |
| 4212 | |
| 4213 | |
| 4214 | |
| 4215 | |
| 4216 | |
| 4217 | |
| 4218 | |
| 4219 | |
| 4220 | |
| 4221 | |
| 4222 | |
| 4223 | |
| 4224 | |
| 4225 | |
| 4226 | |
| 4227 | |
| 4228 | |
| 4229 | |
| 4230 | |
| 4231 | |
| 4232 | |
| 4233 | |
| 4234 | |
| 4235 | |
| 4236 | |
| 4237 | |
| 4238 | |
| 4239 | |
| 4240 | |
| 4241 | |
| 4242 | |
| 4243 | |
| 4244 | |
| 9c1a9547 |
4245 | |
| 4246 | |
| 4247 | //================================================================================================================================ |
| 4248 | |
| 4249 | |
| 2aa4ebcd |
4250 | void AliFlowAnalysisWithQCumulants::EvaluateNestedLoopsForIntegratedFlow(AliFlowEventSimple* anEvent) |
| 9c1a9547 |
4251 | { |
| 2aa4ebcd |
4252 | // 1.) Evaluate with nested loops the relevant correlations for integrated flow without and with using the particle weights. |
| 4253 | // Results are stored in profiles fDirectCorrelations and fDirectCorrelationsW, respectively. |
| bc92c0cb |
4254 | |
| 2aa4ebcd |
4255 | // 2.) Evaluate with nested loops corrections for non-uniform acceptance relevant for integrated flow, |
| 4256 | // without and with using the particle weights. |
| 4257 | // Without weights: cos terms are stored in profile fDirectCorrectionsCos, and sin terms in profile fDirectCorrectionsSin. |
| 4258 | // With weights: cos terms are stored in profile fDirectCorrectionsCosW, and sin terms in profile fDirectCorrectionsSinW. |
| 77515452 |
4259 | |
| 2aa4ebcd |
4260 | // 3.) Binning of fDirectCorrelations is organized as follows: |
| 4261 | // |
| 4262 | // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))> |
| 4263 | // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))> |
| 4264 | // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))> |
| 4265 | // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))> |
| 4266 | // 5th bin: ---- EMPTY ---- |
| 4267 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))> |
| 4268 | // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))> |
| 4269 | // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))> |
| 4270 | // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))> |
| 4271 | // 10th bin: ---- EMPTY ---- |
| 4272 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))> |
| 4273 | // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))> |
| 4274 | // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))> |
| 4275 | // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))> |
| 4276 | // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))> |
| 4277 | // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))> |
| 4278 | // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> |
| 4279 | // 18th bin: ---- EMPTY ---- |
| 4280 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))> |
| 4281 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))> |
| 4282 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))> |
| 4283 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))> |
| 4284 | // 23rd bin: ---- EMPTY ---- |
| 4285 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> |
| 4286 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))> |
| 4287 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))> |
| 4288 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))> |
| 4289 | // 28th bin: ---- EMPTY ---- |
| 4290 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> |
| 4291 | // 30th bin: ---- EMPTY ---- |
| 4292 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> |
| 9c1a9547 |
4293 | |
| 2aa4ebcd |
4294 | // 4.) Binning of fDirectCorrelationsW is organized as follows: |
| 4295 | // .............................................................................................. |
| 4296 | // ---- bins 1-20: 2-particle correlations ---- |
| 4297 | // 1st bin: two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))> |
| 4298 | // 2nd bin: two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))> |
| 4299 | // 3rd bin: two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> |
| 4300 | // 4th bin: two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))> |
| 4301 | // 5th bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))> |
| 4302 | // 6th bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> |
| 4303 | // ---- bins 21-40: 3-particle correlations ---- |
| 4304 | // 21st bin: three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> |
| 4305 | // ---- bins 41-60: 4-particle correlations ---- |
| 4306 | // 41st bin: four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> |
| 4307 | // ---- bins 61-80: 5-particle correlations ---- |
| 4308 | // ---- bins 81-100: 6-particle correlations ---- |
| 4309 | // ---- bins 101-120: 7-particle correlations ---- |
| 4310 | // ---- bins 121-140: 8-particle correlations ---- |
| 4311 | // .............................................................................................. |
| 9c1a9547 |
4312 | |
| 2aa4ebcd |
4313 | // 5.) Binning of fDirectCorrectionsCos is organized as follows: |
| 4314 | // .............................................................................................. |
| 4315 | // 1st bin: <<cos(n*(phi1))>> = cosP1n |
| 4316 | // 2nd bin: <<cos(n*(phi1+phi2))>> = cosP1nP1n |
| 4317 | // 3rd bin: <<cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1n |
| 4318 | // ... |
| 4319 | // .............................................................................................. |
| 4320 | |
| 4321 | // 6.) Binning of fDirectCorrectionsSin is organized as follows: |
| 4322 | // .............................................................................................. |
| 4323 | // 1st bin: <<sin(n*(phi1))>> = sinP1n |
| 4324 | // 2nd bin: <<sin(n*(phi1+phi2))>> = sinP1nP1n |
| 4325 | // 3rd bin: <<sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1n |
| 4326 | // ... |
| 4327 | // .............................................................................................. |
| 4328 | |
| 4329 | // 7.) Binning of fDirectCorrectionsCosW is organized as follows: |
| 4330 | // .............................................................................................. |
| 4331 | // ... |
| 4332 | // .............................................................................................. |
| 9c1a9547 |
4333 | |
| 2aa4ebcd |
4334 | // 8.) Binning of fDirectCorrectionsSinW is organized as follows: |
| 4335 | // .............................................................................................. |
| 4336 | // ... |
| 4337 | // .............................................................................................. |
| 4057ba99 |
4338 | |
| 2aa4ebcd |
4339 | Int_t nPrim = anEvent->NumberOfTracks(); |
| 4340 | AliFlowTrackSimple *aftsTrack = NULL; |
| bc92c0cb |
4341 | |
| 2aa4ebcd |
4342 | Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; |
| 4343 | Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; |
| b7cb54d5 |
4344 | |
| 2aa4ebcd |
4345 | Int_t n = fHarmonic; |
| 77515452 |
4346 | |
| 2aa4ebcd |
4347 | // 2-particle correlations and 1- and 2-particle correction terms: |
| 4057ba99 |
4348 | for(Int_t i1=0;i1<nPrim;i1++) |
| bc92c0cb |
4349 | { |
| 2aa4ebcd |
4350 | aftsTrack=anEvent->GetTrack(i1); |
| 4351 | if(!(aftsTrack->InRPSelection())) continue; |
| 4352 | phi1=aftsTrack->Phi(); |
| 4353 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); |
| 4354 | |
| 4355 | // corrections for non-uniform acceptance: |
| 4356 | // non-weighted: |
| 4357 | fDirectCorrectionsCos->Fill(0.5,cos(n*phi1),1.); // <cos(n*phi1)> |
| 4358 | fDirectCorrectionsSin->Fill(0.5,sin(n*phi1),1.); // <sin(n*phi1)> |
| 4359 | // weighted: |
| 4360 | // fDirectCorrectionsCosW->Fill(0.5,???,1); // to be improved (continued) |
| 4361 | // fDirectCorrectionsSinW->Fill(0.5,???,1); // to be improved (continued) |
| 2bdc5281 |
4362 | |
| 4057ba99 |
4363 | for(Int_t i2=0;i2<nPrim;i2++) |
| bc92c0cb |
4364 | { |
| 4057ba99 |
4365 | if(i2==i1)continue; |
| 2aa4ebcd |
4366 | aftsTrack=anEvent->GetTrack(i2); |
| 4367 | if(!(aftsTrack->InRPSelection())) continue; |
| 4368 | phi2=aftsTrack->Phi(); |
| 4369 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); |
| 9c1a9547 |
4370 | |
| 2aa4ebcd |
4371 | // non-weighted correlations: |
| 4372 | fDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),1.); // <cos(n*(phi1-phi2))> |
| 4373 | fDirectCorrelations->Fill(1.5,cos(2.*n*(phi1-phi2)),1.); // <cos(2n*(phi1-phi2))> |
| 4374 | fDirectCorrelations->Fill(2.5,cos(3.*n*(phi1-phi2)),1.); // <cos(3n*(phi1-phi2))> |
| 4375 | fDirectCorrelations->Fill(3.5,cos(4.*n*(phi1-phi2)),1.); // <cos(4n*(phi1-phi2))> |
| 3d824203 |
4376 | |
| 2aa4ebcd |
4377 | // weighted correlations: |
| 4378 | // ................................................................................................................ |
| 4379 | if(fUsePhiWeights) fDirectCorrelationsW->Fill(0.5,cos(n*(phi1-phi2)),wPhi1*wPhi2); // <w1 w2 cos( n*(phi1-phi2))> |
| 4380 | if(fUsePhiWeights) fDirectCorrelationsW->Fill(1.5,cos(2.*n*(phi1-phi2)),pow(wPhi1,2)*pow(wPhi2,2)); // <w1^2 w2^2 cos(2n*(phi1-phi2))> |
| 4381 | if(fUsePhiWeights) fDirectCorrelationsW->Fill(2.5,cos(3.*n*(phi1-phi2)),pow(wPhi1,3)*pow(wPhi2,3)); // <w1^3 w2^3 cos(3n*(phi1-phi2))> |
| 4382 | if(fUsePhiWeights) fDirectCorrelationsW->Fill(3.5,cos(4.*n*(phi1-phi2)),pow(wPhi1,4)*pow(wPhi2,4)); // <w1^4 w2^4 cos(4n*(phi1-phi2))> |
| 4383 | if(fUsePhiWeights) fDirectCorrelationsW->Fill(4.5,cos(n*(phi1-phi2)),pow(wPhi1,3)*wPhi2); // <w1^3 w2 cos(n*(phi1-phi2))> |
| 4384 | // ... |
| 4385 | // ................................................................................................................ |
| 4386 | |
| 4387 | // non-weighted corrections for non-uniform acceptance (cos terms) |
| 4388 | // ................................................................................................................ |
| 4389 | fDirectCorrectionsCos->Fill(1.5,cos(n*(phi1+phi2)),1.); // <<cos(n*(phi1+phi2))>> |
| 4390 | // ... |
| 4391 | // ................................................................................................................ |
| 4392 | |
| 4393 | // non-weighted corrections for non-uniform acceptance (sin terms) |
| 4394 | // ................................................................................................................ |
| 4395 | fDirectCorrectionsSin->Fill(1.5,sin(n*(phi1+phi2)),1.); // <<sin(n*(phi1+phi2))>> |
| 4396 | // ... |
| 4397 | // ................................................................................................................ |
| 3d824203 |
4398 | |
| 2aa4ebcd |
4399 | // weighted corrections for non-uniform acceptance (cos terms) |
| 4400 | // ................................................................................................................ |
| 4401 | // fDirectCorrectionsCosW->Fill(1.5,???,1.); // to be improved (continued) |
| 4402 | // ... |
| 4403 | // ................................................................................................................ |
| 4404 | |
| 4405 | // non-weighted corrections for non-uniform acceptance (sin terms) |
| 4406 | // ................................................................................................................ |
| 4407 | // fDirectCorrectionsSinW->Fill(1.5,???,1.); // to be improved (continued) |
| 4408 | // ... |
| 4409 | // ................................................................................................................ |
| 4410 | |
| 4411 | } // end of for(Int_t i2=0;i2<nPrim;i2++) |
| 4412 | } // end of for(Int_t i1=0;i1<nPrim;i1++) |
| 3d824203 |
4413 | |
| 2aa4ebcd |
4414 | // 3-particle correlations: |
| 4057ba99 |
4415 | for(Int_t i1=0;i1<nPrim;i1++) |
| bc92c0cb |
4416 | { |
| 2aa4ebcd |
4417 | aftsTrack=anEvent->GetTrack(i1); |
| 4418 | if(!(aftsTrack->InRPSelection())) continue; |
| 4419 | phi1=aftsTrack->Phi(); |
| 4420 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4421 | for(Int_t i2=0;i2<nPrim;i2++) |
| bc92c0cb |
4422 | { |
| 4057ba99 |
4423 | if(i2==i1)continue; |
| 2aa4ebcd |
4424 | aftsTrack=anEvent->GetTrack(i2); |
| 4425 | if(!(aftsTrack->InRPSelection())) continue; |
| 4426 | phi2=aftsTrack->Phi(); |
| 4427 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4428 | for(Int_t i3=0;i3<nPrim;i3++) |
| bc92c0cb |
4429 | { |
| 4057ba99 |
4430 | if(i3==i1||i3==i2)continue; |
| 2aa4ebcd |
4431 | aftsTrack=anEvent->GetTrack(i3); |
| 4432 | if(!(aftsTrack->InRPSelection())) continue; |
| 4433 | phi3=aftsTrack->Phi(); |
| 4434 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); |
| 3d824203 |
4435 | |
| 2aa4ebcd |
4436 | // non-weighted correlations: |
| 4437 | fDirectCorrelations->Fill(5.,cos(2.*n*phi1-n*(phi2+phi3)),1.); //<3>_{2n|nn,n} |
| 4438 | fDirectCorrelations->Fill(6.,cos(3.*n*phi1-2.*n*phi2-n*phi3),1.); //<3>_{3n|2n,n} |
| 4439 | fDirectCorrelations->Fill(7.,cos(4.*n*phi1-2.*n*phi2-2.*n*phi3),1.); //<3>_{4n|2n,2n} |
| 4440 | fDirectCorrelations->Fill(8.,cos(4.*n*phi1-3.*n*phi2-n*phi3),1.); //<3>_{4n|3n,n} |
| 3d824203 |
4441 | |
| 2aa4ebcd |
4442 | // weighted correlations: |
| 4443 | // .............................................................................................................................. |
| 4444 | // 2-p: |
| 4445 | if(fUsePhiWeights) fDirectCorrelationsW->Fill(5.,cos(n*(phi1-phi2)),wPhi1*wPhi2*pow(wPhi3,2)); // <w1 w2 w3^2 cos(n*(phi1-phi2))> |
| 4446 | // 3-p: |
| 4447 | if(fUsePhiWeights) fDirectCorrelationsW->Fill(20.,cos(2.*n*phi1-n*(phi2+phi3)),pow(wPhi1,2)*wPhi2*wPhi3); // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> |
| 4448 | // ... |
| 4449 | // .............................................................................................................................. |
| 3d824203 |
4450 | |
| 2aa4ebcd |
4451 | // non-weighted corrections for non-uniform acceptance (cos terms) |
| 4452 | // ................................................................................................................ |
| 4453 | fDirectCorrectionsCos->Fill(2.,cos(n*(phi1-phi2-phi3)),1.); // <<cos(n*(phi1-phi2-phi3))>> |
| 4454 | // ... |
| 4455 | // ................................................................................................................ |
| 4456 | |
| 4457 | // non-weighted corrections for non-uniform acceptance (sin terms) |
| 4458 | // ................................................................................................................ |
| 4459 | fDirectCorrectionsSin->Fill(2.,sin(n*(phi1-phi2-phi3)),1.); // <<sin(n*(phi1-phi2-phi3))>> |
| 4460 | // ... |
| 4461 | // ................................................................................................................ |
| 3d824203 |
4462 | |
| 2aa4ebcd |
4463 | // weighted corrections for non-uniform acceptance (cos terms) |
| 4464 | // ................................................................................................................ |
| 4465 | // ... |
| 4466 | // ................................................................................................................ |
| 4467 | |
| 4468 | // weighted corrections for non-uniform acceptance (sin terms) |
| 4469 | // ................................................................................................................ |
| 4470 | // ... |
| 4471 | // ................................................................................................................ |
| 4472 | |
| 4473 | } // end of for(Int_t i3=0;i3<nPrim;i3++) |
| 4474 | } // end of for(Int_t i2=0;i2<nPrim;i2++) |
| 4475 | } // end of for(Int_t i1=0;i1<nPrim;i1++) |
| 4476 | |
| 4477 | // 4-particle correlations: |
| 4057ba99 |
4478 | for(Int_t i1=0;i1<nPrim;i1++) |
| bc92c0cb |
4479 | { |
| 2aa4ebcd |
4480 | aftsTrack=anEvent->GetTrack(i1); |
| 4481 | if(!(aftsTrack->InRPSelection())) continue; |
| 4482 | phi1=aftsTrack->Phi(); |
| 4483 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4484 | for(Int_t i2=0;i2<nPrim;i2++) |
| bc92c0cb |
4485 | { |
| 4057ba99 |
4486 | if(i2==i1)continue; |
| 2aa4ebcd |
4487 | aftsTrack=anEvent->GetTrack(i2); |
| 4488 | if(!(aftsTrack->InRPSelection())) continue; |
| 4489 | phi2=aftsTrack->Phi(); |
| 4490 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4491 | for(Int_t i3=0;i3<nPrim;i3++) |
| 2aa4ebcd |
4492 | { |
| 4057ba99 |
4493 | if(i3==i1||i3==i2)continue; |
| 2aa4ebcd |
4494 | aftsTrack=anEvent->GetTrack(i3); |
| 4495 | if(!(aftsTrack->InRPSelection())) continue; |
| 4496 | phi3=aftsTrack->Phi(); |
| 4497 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4498 | for(Int_t i4=0;i4<nPrim;i4++) |
| bc92c0cb |
4499 | { |
| 4057ba99 |
4500 | if(i4==i1||i4==i2||i4==i3)continue; |
| 2aa4ebcd |
4501 | aftsTrack=anEvent->GetTrack(i4); |
| 4502 | if(!(aftsTrack->InRPSelection())) continue; |
| 4503 | phi4=aftsTrack->Phi(); |
| 4504 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); |
| 3d824203 |
4505 | |
| 9c1a9547 |
4506 | // non-weighted: |
| 2aa4ebcd |
4507 | fDirectCorrelations->Fill(10.,cos(n*phi1+n*phi2-n*phi3-n*phi4),1.); // <4>_{n,n|n,n} |
| 4508 | fDirectCorrelations->Fill(11.,cos(2.*n*phi1+n*phi2-2.*n*phi3-n*phi4),1.); // <4>_{2n,n|2n,n} |
| 4509 | fDirectCorrelations->Fill(12.,cos(2.*n*phi1+2*n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{2n,2n|2n,2n} |
| 4510 | fDirectCorrelations->Fill(13.,cos(3.*n*phi1-n*phi2-n*phi3-n*phi4),1.); // <4>_{3n|n,n,n} |
| 4511 | fDirectCorrelations->Fill(14.,cos(3.*n*phi1+n*phi2-3.*n*phi3-n*phi4),1.); // <4>_{3n,n|3n,n} |
| 4512 | fDirectCorrelations->Fill(15.,cos(3.*n*phi1+n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{3n,n|2n,2n} |
| 4513 | fDirectCorrelations->Fill(16.,cos(4.*n*phi1-2.*n*phi2-n*phi3-n*phi4),1.); // <4>_{4n|2n,n,n} |
| 4514 | |
| 9c1a9547 |
4515 | // weighted: |
| 2aa4ebcd |
4516 | //....................................................................................... |
| 4517 | // 4-p: |
| 4518 | if(fUsePhiWeights) fDirectCorrelationsW->Fill(40.,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); |
| 4519 | // ... |
| 4520 | //....................................................................................... |
| 4521 | |
| 4522 | } |
| 4523 | } |
| 4524 | } |
| 4525 | } |
| 4526 | |
| 4527 | // 5-particle correlations: |
| 4057ba99 |
4528 | for(Int_t i1=0;i1<nPrim;i1++) |
| 4529 | { |
| 2aa4ebcd |
4530 | //cout<<"i1 = "<<i1<<endl; |
| 4531 | aftsTrack=anEvent->GetTrack(i1); |
| 4532 | if(!(aftsTrack->InRPSelection())) continue; |
| 4533 | phi1=aftsTrack->Phi(); |
| 4534 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4535 | for(Int_t i2=0;i2<nPrim;i2++) |
| 4536 | { |
| 4537 | if(i2==i1)continue; |
| 2aa4ebcd |
4538 | aftsTrack=anEvent->GetTrack(i2); |
| 4539 | if(!(aftsTrack->InRPSelection())) continue; |
| 4540 | phi2=aftsTrack->Phi(); |
| 4541 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4542 | for(Int_t i3=0;i3<nPrim;i3++) |
| 2aa4ebcd |
4543 | { |
| 4057ba99 |
4544 | if(i3==i1||i3==i2)continue; |
| 2aa4ebcd |
4545 | aftsTrack=anEvent->GetTrack(i3); |
| 4546 | if(!(aftsTrack->InRPSelection())) continue; |
| 4547 | phi3=aftsTrack->Phi(); |
| 4548 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4549 | for(Int_t i4=0;i4<nPrim;i4++) |
| 4550 | { |
| 4551 | if(i4==i1||i4==i2||i4==i3)continue; |
| 2aa4ebcd |
4552 | aftsTrack=anEvent->GetTrack(i4); |
| 4553 | if(!(aftsTrack->InRPSelection())) continue; |
| 4554 | phi4=aftsTrack->Phi(); |
| 4555 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4556 | for(Int_t i5=0;i5<nPrim;i5++) |
| bc92c0cb |
4557 | { |
| 4057ba99 |
4558 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; |
| 2aa4ebcd |
4559 | aftsTrack=anEvent->GetTrack(i5); |
| 4560 | if(!(aftsTrack->InRPSelection())) continue; |
| 4561 | phi5=aftsTrack->Phi(); |
| 4562 | if(fUsePhiWeights && fPhiWeights) wPhi5 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi5*fnBinsPhi/TMath::TwoPi()))); |
| 4563 | |
| 4564 | // non-weighted: |
| 4565 | //------------------------------------------------------------------------------------------------------ |
| 4566 | fDirectCorrelations->Fill(18.,cos(2.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5),1.); //<5>_{2n,n|n,n,n} |
| 4567 | fDirectCorrelations->Fill(19.,cos(2.*n*phi1+2.*n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); //<5>_{2n,2n|2n,n,n} |
| 4568 | fDirectCorrelations->Fill(20.,cos(3.*n*phi1+n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); //<5>_{3n,n|2n,n,n} |
| 4569 | fDirectCorrelations->Fill(21.,cos(4.*n*phi1-n*phi2-n*phi3-n*phi4-n*phi5),1.); //<5>_{4n|n,n,n,n} |
| 4570 | //------------------------------------------------------------------------------------------------------ |
| 4571 | |
| 4572 | // weighted: |
| 4573 | //.............................................................................................................. |
| 4574 | // 5-p: |
| 4575 | if(fUsePhiWeights) fDirectCorrelationsW->Fill(60.,cos(2.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5),pow(wPhi1,2)*wPhi2*wPhi3*wPhi4*wPhi5); |
| 4576 | //.............................................................................................................. |
| 4577 | |
| 4578 | } |
| 4579 | } |
| 4580 | } |
| 4581 | } |
| 4582 | } |
| 9c1a9547 |
4583 | |
| 2aa4ebcd |
4584 | // 6-particle correlations: |
| 4057ba99 |
4585 | for(Int_t i1=0;i1<nPrim;i1++) |
| 4586 | { |
| 2aa4ebcd |
4587 | //cout<<"i1 = "<<i1<<endl; |
| 4588 | aftsTrack=anEvent->GetTrack(i1); |
| 4589 | if(!(aftsTrack->InRPSelection())) continue; |
| 4590 | phi1=aftsTrack->Phi(); |
| 4591 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4592 | for(Int_t i2=0;i2<nPrim;i2++) |
| 4593 | { |
| 4594 | if(i2==i1)continue; |
| 2aa4ebcd |
4595 | aftsTrack=anEvent->GetTrack(i2); |
| 4596 | if(!(aftsTrack->InRPSelection())) continue; |
| 4597 | phi2=aftsTrack->Phi(); |
| 4598 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4599 | for(Int_t i3=0;i3<nPrim;i3++) |
| 2aa4ebcd |
4600 | { |
| 4057ba99 |
4601 | if(i3==i1||i3==i2)continue; |
| 2aa4ebcd |
4602 | aftsTrack=anEvent->GetTrack(i3); |
| 4603 | if(!(aftsTrack->InRPSelection())) continue; |
| 4604 | phi3=aftsTrack->Phi(); |
| 4605 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4606 | for(Int_t i4=0;i4<nPrim;i4++) |
| 4607 | { |
| 4608 | if(i4==i1||i4==i2||i4==i3)continue; |
| 2aa4ebcd |
4609 | aftsTrack=anEvent->GetTrack(i4); |
| 4610 | if(!(aftsTrack->InRPSelection())) continue; |
| 4611 | phi4=aftsTrack->Phi(); |
| 4612 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4613 | for(Int_t i5=0;i5<nPrim;i5++) |
| 4614 | { |
| 4615 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; |
| 2aa4ebcd |
4616 | aftsTrack=anEvent->GetTrack(i5); |
| 4617 | if(!(aftsTrack->InRPSelection())) continue; |
| 4618 | phi5=aftsTrack->Phi(); |
| 4619 | if(fUsePhiWeights && fPhiWeights) wPhi5 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi5*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4620 | for(Int_t i6=0;i6<nPrim;i6++) |
| 4621 | { |
| 4622 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; |
| 2aa4ebcd |
4623 | aftsTrack=anEvent->GetTrack(i6); |
| 4624 | if(!(aftsTrack->InRPSelection())) continue; |
| 4625 | phi6=aftsTrack->Phi(); |
| 4626 | if(fUsePhiWeights && fPhiWeights) wPhi6 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi6*fnBinsPhi/TMath::TwoPi()))); |
| 4627 | |
| 4628 | // non-weighted: |
| 4629 | //----------------------------------------------------------------------------------------------------------- |
| 4630 | fDirectCorrelations->Fill(23.,cos(n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{n,n,n|n,n,n} |
| 4631 | fDirectCorrelations->Fill(24.,cos(2.*n*phi1+n*phi2+n*phi3-2.*n*phi4-n*phi5-n*phi6),1.); //<6>_{2n,n,n|2n,n,n} |
| 4632 | fDirectCorrelations->Fill(25.,cos(2.*n*phi1+2.*n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{2n,2n|n,n,n,n} |
| 4633 | fDirectCorrelations->Fill(26.,cos(3.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{3n,n|n,n,n,n} |
| 4634 | //----------------------------------------------------------------------------------------------------------- |
| 9c1a9547 |
4635 | |
| 2aa4ebcd |
4636 | // weighted: |
| 4637 | //................................................................................................................. |
| 4638 | // 6-p: |
| 4639 | if(fUsePhiWeights) fDirectCorrelationsW->Fill(80.,cos(n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6),wPhi1*wPhi2*wPhi3*wPhi4*wPhi5*wPhi6); |
| 4640 | //................................................................................................................. |
| 4641 | |
| 4642 | } |
| 4643 | } |
| 4644 | } |
| 4645 | } |
| 4646 | } |
| 4647 | } |
| 4057ba99 |
4648 | |
| 2aa4ebcd |
4649 | // 7-particle correlations: |
| 4057ba99 |
4650 | for(Int_t i1=0;i1<nPrim;i1++) |
| 4651 | { |
| 2aa4ebcd |
4652 | //cout<<"i1 = "<<i1<<endl; |
| 4653 | aftsTrack=anEvent->GetTrack(i1); |
| 4654 | if(!(aftsTrack->InRPSelection())) continue; |
| 4655 | phi1=aftsTrack->Phi(); |
| 4656 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4657 | for(Int_t i2=0;i2<nPrim;i2++) |
| 4658 | { |
| 4659 | if(i2==i1)continue; |
| 2aa4ebcd |
4660 | aftsTrack=anEvent->GetTrack(i2); |
| 4661 | if(!(aftsTrack->InRPSelection())) continue; |
| 4662 | phi2=aftsTrack->Phi(); |
| 4663 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4664 | for(Int_t i3=0;i3<nPrim;i3++) |
| 2aa4ebcd |
4665 | { |
| 4057ba99 |
4666 | if(i3==i1||i3==i2)continue; |
| 2aa4ebcd |
4667 | aftsTrack=anEvent->GetTrack(i3); |
| 4668 | if(!(aftsTrack->InRPSelection())) continue; |
| 4669 | phi3=aftsTrack->Phi(); |
| 4670 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4671 | for(Int_t i4=0;i4<nPrim;i4++) |
| 4672 | { |
| 4673 | if(i4==i1||i4==i2||i4==i3)continue; |
| 2aa4ebcd |
4674 | aftsTrack=anEvent->GetTrack(i4); |
| 4675 | if(!(aftsTrack->InRPSelection())) continue; |
| 4676 | phi4=aftsTrack->Phi(); |
| 4677 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4678 | for(Int_t i5=0;i5<nPrim;i5++) |
| 4679 | { |
| 4680 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; |
| 2aa4ebcd |
4681 | aftsTrack=anEvent->GetTrack(i5); |
| 4682 | if(!(aftsTrack->InRPSelection())) continue; |
| 4683 | phi5=aftsTrack->Phi(); |
| 4684 | if(fUsePhiWeights && fPhiWeights) wPhi5 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi5*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4685 | for(Int_t i6=0;i6<nPrim;i6++) |
| 4686 | { |
| 4687 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; |
| 2aa4ebcd |
4688 | aftsTrack=anEvent->GetTrack(i6); |
| 4689 | if(!(aftsTrack->InRPSelection())) continue; |
| 4690 | phi6=aftsTrack->Phi(); |
| 4691 | if(fUsePhiWeights && fPhiWeights) wPhi6 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi6*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4692 | for(Int_t i7=0;i7<nPrim;i7++) |
| 4693 | { |
| 4694 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; |
| 2aa4ebcd |
4695 | aftsTrack=anEvent->GetTrack(i7); |
| 4696 | if(!(aftsTrack->InRPSelection())) continue; |
| 4697 | phi7=aftsTrack->Phi(); |
| 4698 | if(fUsePhiWeights && fPhiWeights) wPhi7 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi7*fnBinsPhi/TMath::TwoPi()))); |
| 4699 | |
| 4700 | // non-weighted: |
| 4701 | //--------------------------------------------------------------------------------------------------------------- |
| 4702 | fDirectCorrelations->Fill(28.,cos(2.*n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6-n*phi7),1.);//<7>_{2n,n,n|n,n,n,n} |
| 4703 | //--------------------------------------------------------------------------------------------------------------- |
| 4704 | |
| 4705 | // weighted: |
| 4706 | //.......................................................................................................................................... |
| 4707 | if(fUsePhiWeights) fDirectCorrelationsW->Fill(100.,cos(2.*n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6-n*phi7), |
| 4708 | pow(wPhi1,2.)*wPhi2*wPhi3*wPhi4*wPhi5*wPhi6*wPhi7); |
| 4709 | //.......................................................................................................................................... |
| 4710 | |
| 4711 | } |
| 4712 | } |
| 4713 | } |
| 4714 | } |
| 4715 | } |
| 4716 | } |
| 4717 | } |
| 4057ba99 |
4718 | |
| 2aa4ebcd |
4719 | cout<<endl; |
| 4720 | |
| 4721 | // 8-particle correlations: |
| 4057ba99 |
4722 | for(Int_t i1=0;i1<nPrim;i1++) |
| 4723 | { |
| 2aa4ebcd |
4724 | cout<<"i1 = "<<i1<<endl; |
| 4725 | aftsTrack=anEvent->GetTrack(i1); |
| 4726 | if(!(aftsTrack->InRPSelection())) continue; |
| 4727 | phi1=aftsTrack->Phi(); |
| 4728 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4729 | for(Int_t i2=0;i2<nPrim;i2++) |
| 4730 | { |
| 4731 | if(i2==i1)continue; |
| 2aa4ebcd |
4732 | aftsTrack=anEvent->GetTrack(i2); |
| 4733 | if(!(aftsTrack->InRPSelection())) continue; |
| 4734 | phi2=aftsTrack->Phi(); |
| 4735 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4736 | for(Int_t i3=0;i3<nPrim;i3++) |
| 2aa4ebcd |
4737 | { |
| 4057ba99 |
4738 | if(i3==i1||i3==i2)continue; |
| 2aa4ebcd |
4739 | aftsTrack=anEvent->GetTrack(i3); |
| 4740 | if(!(aftsTrack->InRPSelection())) continue; |
| 4741 | phi3=aftsTrack->Phi(); |
| 4742 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4743 | for(Int_t i4=0;i4<nPrim;i4++) |
| 4744 | { |
| 4745 | if(i4==i1||i4==i2||i4==i3)continue; |
| 2aa4ebcd |
4746 | aftsTrack=anEvent->GetTrack(i4); |
| 4747 | if(!(aftsTrack->InRPSelection())) continue; |
| 4748 | phi4=aftsTrack->Phi(); |
| 4749 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4750 | for(Int_t i5=0;i5<nPrim;i5++) |
| 4751 | { |
| 4752 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; |
| 2aa4ebcd |
4753 | aftsTrack=anEvent->GetTrack(i5); |
| 4754 | if(!(aftsTrack->InRPSelection())) continue; |
| 4755 | phi5=aftsTrack->Phi(); |
| 4756 | if(fUsePhiWeights && fPhiWeights) wPhi5 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi5*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4757 | for(Int_t i6=0;i6<nPrim;i6++) |
| 4758 | { |
| 4759 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; |
| 2aa4ebcd |
4760 | aftsTrack=anEvent->GetTrack(i6); |
| 4761 | if(!(aftsTrack->InRPSelection())) continue; |
| 4762 | phi6=aftsTrack->Phi(); |
| 4763 | if(fUsePhiWeights && fPhiWeights) wPhi6 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi6*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4764 | for(Int_t i7=0;i7<nPrim;i7++) |
| 4765 | { |
| 4766 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; |
| 2aa4ebcd |
4767 | aftsTrack=anEvent->GetTrack(i7); |
| 4768 | if(!(aftsTrack->InRPSelection())) continue; |
| 4769 | phi7=aftsTrack->Phi(); |
| 4770 | if(fUsePhiWeights && fPhiWeights) wPhi7 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi7*fnBinsPhi/TMath::TwoPi()))); |
| 4057ba99 |
4771 | for(Int_t i8=0;i8<nPrim;i8++) |
| 4772 | { |
| 4773 | if(i8==i1||i8==i2||i8==i3||i8==i4||i8==i5||i8==i6||i8==i7)continue; |
| 2aa4ebcd |
4774 | aftsTrack=anEvent->GetTrack(i8); |
| 4775 | if(!(aftsTrack->InRPSelection())) continue; |
| 4776 | phi8=aftsTrack->Phi(); |
| 4777 | if(fUsePhiWeights && fPhiWeights) wPhi8 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi8*fnBinsPhi/TMath::TwoPi()))); |
| 4778 | |
| 4779 | // non-weighted: |
| 4780 | //-------------------------------------------------------------------------------------------------------------------- |
| 4781 | fDirectCorrelations->Fill(30.,cos(n*phi1+n*phi2+n*phi3+n*phi4-n*phi5-n*phi6-n*phi7-n*phi8),1.);//<8>_{n,n,n,n|n,n,n,n} |
| 4782 | //-------------------------------------------------------------------------------------------------------------------- |
| 4783 | |
| 4784 | // weighted: |
| 4785 | //........................................................................................................................................... |
| 4786 | if(fUsePhiWeights) fDirectCorrelationsW->Fill(120.,cos(n*phi1+n*phi2+n*phi3+n*phi4-n*phi5-n*phi6-n*phi7-n*phi8), |
| 4787 | wPhi1*wPhi2*wPhi3*wPhi4*wPhi5*wPhi6*wPhi7*wPhi8); |
| 4788 | //........................................................................................................................................... |
| 4789 | |
| 4790 | } |
| 4791 | } |
| 4792 | } |
| 4793 | } |
| 4794 | } |
| 4795 | } |
| 4796 | } |
| 4797 | } |
| 4798 | |
| 4799 | } // end of AliFlowAnalysisWithQCumulants::EvaluateNestedLoopsForIntegratedFlow(AliFlowEventSimple* anEvent) |
| 4800 | |
| 4801 | |
| 4802 | //================================================================================================================================ |
| 4803 | |
| 4804 | |
| 4805 | void AliFlowAnalysisWithQCumulants::CompareResultsFromNestedLoopsAndFromQVectorsForIntFlow(Bool_t useParticleWeights) |
| 4806 | { |
| 4807 | // compare results needed for int. flow calculated with nested loops and with those calculated from Q-vectors |
| 4808 | |
| 4809 | cout<<endl; |
| 4810 | cout<<endl; |
| 4811 | cout<<" *************************************"<<endl; |
| 4812 | cout<<" **** cross-checking the formulas ****"<<endl; |
| 4813 | cout<<" **** for integrated flow ****"<<endl; |
| 4814 | cout<<" *************************************"<<endl; |
| 4815 | cout<<endl; |
| 4816 | cout<<endl; |
| 4817 | |
| 4818 | if(!(useParticleWeights)) |
| 4819 | { |
| 4820 | cout<<" **** results for non-weighted correlations: ****"<<endl; |
| 4821 | cout<<endl; |
| 4822 | cout<<"<2>_{1n,1n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(1)<<endl; |
| 4823 | cout<<"<2>_{1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(1)<<endl; |
| 4824 | cout<<endl; |
| 4825 | cout<<"<2>_{2n,2n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(2)<<endl; |
| 4826 | cout<<"<2>_{2n,2n} from nested loops = "<<fDirectCorrelations->GetBinContent(2)<<endl; |
| 4827 | cout<<endl; |
| 4828 | cout<<"<2>_{3n,3n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(3)<<endl; |
| 4829 | cout<<"<2>_{3n,3n} from nested loops = "<<fDirectCorrelations->GetBinContent(3)<<endl; |
| 4830 | cout<<endl; |
| 4831 | cout<<"<2>_{4n,4n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(4)<<endl; |
| 4832 | cout<<"<2>_{4n,4n} from nested loops = "<<fDirectCorrelations->GetBinContent(4)<<endl; |
| 4833 | cout<<endl; |
| 4834 | cout<<"<3>_{2n|1n,1n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(6)<<endl; |
| 4835 | cout<<"<3>_{2n|1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(6)<<endl; |
| 4836 | cout<<endl; |
| 4837 | cout<<"<3>_{3n|2n,1n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(7)<<endl; |
| 4838 | cout<<"<3>_{3n|2n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(7)<<endl; |
| 4839 | cout<<endl; |
| 4840 | cout<<"<3>_{4n,2n,2n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(8)<<endl; |
| 4841 | cout<<"<3>_{4n,2n,2n} from nested loops = "<<fDirectCorrelations->GetBinContent(8)<<endl; |
| 4842 | cout<<endl; |
| 4843 | cout<<"<3>_{4n,3n,1n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(9)<<endl; |
| 4844 | cout<<"<3>_{4n,3n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(9)<<endl; |
| 4845 | cout<<endl; |
| 4846 | cout<<"<4>_{1n,1n|1n,1n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(11)<<endl; |
| 4847 | cout<<"<4>_{1n,1n|1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(11)<<endl; |
| 4848 | cout<<endl; |
| 4849 | cout<<"<4>_{2n,1n|2n,1n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(12)<<endl; |
| 4850 | cout<<"<4>_{2n,1n|2n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(12)<<endl; |
| 4851 | cout<<endl; |
| 4852 | cout<<"<4>_{2n,2n|2n,2n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(13)<<endl; |
| 4853 | cout<<"<4>_{2n,2n|2n,2n} from nested loops = "<<fDirectCorrelations->GetBinContent(13)<<endl; |
| 4854 | cout<<endl; |
| 4855 | cout<<"<4>_{3n|1n,1n,1n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(14)<<endl; |
| 4856 | cout<<"<4>_{3n|1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(14)<<endl; |
| 4857 | cout<<endl; |
| 4858 | cout<<"<4>_{3n,1n|3n,1n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(15)<<endl; |
| 4859 | cout<<"<4>_{3n,1n|3n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(15)<<endl; |
| 4860 | cout<<endl; |
| 4861 | cout<<"<4>_{3n,1n|2n,2n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(16)<<endl; |
| 4862 | cout<<"<4>_{3n,1n|2n,2n} from nested loops = "<<fDirectCorrelations->GetBinContent(16)<<endl; |
| 4863 | cout<<endl; |
| 4864 | cout<<"<4>_{4n|2n,1n,1n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(17)<<endl; |
| 4865 | cout<<"<4>_{4n|2n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(17)<<endl; |
| 4866 | cout<<endl; |
| 4867 | cout<<"<5>_{2n,1n|1n,1n,1n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(19)<<endl; |
| 4868 | cout<<"<5>_{2n,1n|1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(19)<<endl; |
| 4869 | cout<<endl; |
| 4870 | cout<<"<5>_{2n,2n|2n,1n,1n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(20)<<endl; |
| 4871 | cout<<"<5>_{2n,2n|2n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(20)<<endl; |
| 4872 | cout<<endl; |
| 4873 | cout<<"<5>_{3n,1n|2n,1n,1n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(21)<<endl; |
| 4874 | cout<<"<5>_{3n,1n|2n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(21)<<endl; |
| 4875 | cout<<endl; |
| 4876 | cout<<"<5>_{4n|1n,1n,1n,1n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(22)<<endl; |
| 4877 | cout<<"<5>_{4n|1n,1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(22)<<endl; |
| 4878 | cout<<endl; |
| 4879 | cout<<"<6>_{1n,1n,1n|1n,1n,1n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(24)<<endl; |
| 4880 | cout<<"<6>_{1n,1n,1n|1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(24)<<endl; |
| 4881 | cout<<endl; |
| 4882 | cout<<"<6>_{2n,1n,1n|2n,1n,1n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(25)<<endl; |
| 4883 | cout<<"<6>_{2n,1n,1n|2n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(25)<<endl; |
| 4884 | cout<<endl; |
| 4885 | cout<<"<6>_{2n,2n|1n,1n,1n,1n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(26)<<endl; |
| 4886 | cout<<"<6>_{2n,2n|1n,1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(26)<<endl; |
| 4887 | cout<<endl; |
| 4888 | cout<<"<6>_{3n,1n|1n,1n,1n,1n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(27)<<endl; |
| 4889 | cout<<"<6>_{3n,1n|1n,1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(27)<<endl; |
| 4890 | cout<<endl; |
| 4891 | cout<<"<7>_{2n,1n,1n|1n,1n,1n,1n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(29)<<endl; |
| 4892 | cout<<"<7>_{2n,1n,1n|1n,1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(29)<<endl; |
| 4893 | cout<<endl; |
| 4894 | cout<<"<8>_{1n,1n,1n,1n|1n,1n,1n,1n} from Q-vectors = "<<fQCorrelations[0][0]->GetBinContent(31)<<endl; |
| 4895 | cout<<"<8>_{1n,1n,1n,1n|1n,1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(31)<<endl; |
| 4896 | cout<<endl; |
| 4897 | cout<<endl; |
| 4898 | cout<<" **** results for non-weighted correction terms: ****"<<endl; |
| 4899 | cout<<endl; |
| 4900 | //......................................................................................... |
| 4901 | cout<<"<cos(n*phi1)> from Q-vectors = "<<fQCorrections[0][0][1]->GetBinContent(1)<<endl; |
| 4902 | cout<<"<cos(n*phi1)> from nested loops = "<<fDirectCorrectionsCos->GetBinContent(1)<<endl; |
| 4903 | cout<<endl; |
| 4904 | cout<<"<sin(n*phi1)> from Q-vectors = "<<fQCorrections[0][0][0]->GetBinContent(1)<<endl; |
| 4905 | cout<<"<sin(n*phi1)> from nested loops = "<<fDirectCorrectionsSin->GetBinContent(1)<<endl; |
| 4906 | cout<<endl; |
| 4907 | cout<<"<cos(n*(phi1+phi2))> from Q-vectors = "<<fQCorrections[0][0][1]->GetBinContent(2)<<endl; |
| 4908 | cout<<"<cos(n*(phi1+phi2))> from nested loops = "<<fDirectCorrectionsCos->GetBinContent(2)<<endl; |
| 4909 | cout<<endl; |
| 4910 | cout<<"<sin(n*(phi1+phi2))> from Q-vectors = "<<fQCorrections[0][0][0]->GetBinContent(2)<<endl; |
| 4911 | cout<<"<sin(n*(phi1+phi2))> from nested loops = "<<fDirectCorrectionsSin->GetBinContent(2)<<endl; |
| 4912 | cout<<endl; |
| 4913 | cout<<"<cos(n*(phi1-phi2-phi3))> from Q-vectors = "<<fQCorrections[0][0][1]->GetBinContent(3)<<endl; |
| 4914 | cout<<"<cos(n*(phi1-phi2-phi3))> from nested loops = "<<fDirectCorrectionsCos->GetBinContent(3)<<endl; |
| 4915 | cout<<endl; |
| 4916 | cout<<"<sin(n*(phi1-phi2-phi3))> from Q-vectors = "<<fQCorrections[0][0][0]->GetBinContent(3)<<endl; |
| 4917 | cout<<"<sin(n*(phi1-phi2-phi3))> from nested loops = "<<fDirectCorrectionsSin->GetBinContent(3)<<endl; |
| 4918 | cout<<endl; |
| 4919 | //......................................................................................... |
| 4920 | } |
| 4921 | |
| 4922 | if(useParticleWeights) |
| 4923 | { |
| 4924 | cout<<" **** results for weighted correlations: ****"<<endl; |
| 4925 | cout<<endl; |
| 4926 | //......................................................................................... |
| 4927 | cout<<"<w1 w2 cos(n*(phi1-phi2))> from Q-vectors = "<<fQCorrelations[1][0]->GetBinContent(1)<<endl; |
| 4928 | cout<<"<<w1 w2 cos(n*(phi1-phi2))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(1)<<endl; |
| 4929 | cout<<endl; |
| 4930 | cout<<"<w1^2 w2^2 cos(2n*(phi1-phi2))> from Q-vectors = "<<fQCorrelations[1][0]->GetBinContent(2)<<endl; |
| 4931 | cout<<"<w1^2 w2^2 cos(2n*(phi1-phi2))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(2)<<endl; |
| 4932 | cout<<endl; |
| 4933 | cout<<"<w1^3 w2^3 cos(3n*(phi1-phi2))> from Q-vectors = "<<fQCorrelations[1][0]->GetBinContent(3)<<endl; |
| 4934 | cout<<"<w1^3 w2^3 cos(3n*(phi1-phi2))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(3)<<endl; |
| 4935 | cout<<endl; |
| 4936 | cout<<"<w1^4 w2^4 cos(4n*(phi1-phi2))> from Q-vectors = "<<fQCorrelations[1][0]->GetBinContent(4)<<endl; |
| 4937 | cout<<"<w1^4 w2^4 cos(4n*(phi1-phi2))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(4)<<endl; |
| 4938 | cout<<endl; |
| 4939 | /* |
| 4940 | cout<<"<w1^3 w2 cos(n*(phi1-phi2))> from Q-vectors = "<<fQCorrelationsW->GetBinContent(5)<<endl; |
| 4941 | cout<<"<w1^3 w2 cos(n*(phi1-phi2))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(5)<<endl; |
| 4942 | cout<<endl; |
| 4943 | cout<<"<w1 w2 w3^2 cos(n*(phi1-phi2))> from Q-vectors = "<<fQCorrelationsW->GetBinContent(6)<<endl; |
| 4944 | cout<<"<w1 w2 w3^2 cos(n*(phi1-phi2))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(6)<<endl; |
| 4945 | cout<<endl; |
| 4946 | cout<<"<w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> from Q-vectors = "<<fQCorrelationsW->GetBinContent(21)<<endl; |
| 4947 | cout<<"<w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(21)<<endl; |
| 4948 | cout<<endl; |
| 4949 | */ |
| 4950 | cout<<"<w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> from Q-vectors = "<<fQCorrelations[1][0]->GetBinContent(11)<<endl; |
| 4951 | cout<<"<w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(41)<<endl; |
| 4952 | cout<<endl; |
| 4953 | //......................................................................................... |
| 4954 | //cout<<endl; |
| 4955 | //cout<<endl; |
| 4956 | //cout<<" **** results for weighted correction terms: ****"<<endl; |
| 4957 | //cout<<endl; |
| 4958 | //......................................................................................... |
| 4959 | } |
| 4057ba99 |
4960 | |
| 2aa4ebcd |
4961 | } // end of AliFlowAnalysisWithQCumulants::CompareResultsFromNestedLoopsAndFromQVectorsForIntFlow(Bool_t useParticleWeights) |
| 4962 | |
| 4963 | |
| 4964 | //================================================================================================================================ |
| 4965 | |
| 4966 | |
| 4967 | void AliFlowAnalysisWithQCumulants::CalculateQProductsForIntFlow() |
| 4968 | { |
| 4969 | // calculate averages like <<2><4>>, <<2><6>>, <<4><6>>, etc. which are needed to calculate covariances |
| 4970 | |
| 4971 | // binning of fQProducts is organized as follows: |
| 4972 | // |
| 4973 | // 1st bin: <2><4> |
| 4974 | // 2nd bin: <2><6> |
| 4975 | // 3rd bin: <2><8> |
| 4976 | // 4th bin: <4><6> |
| 4977 | // 5th bin: <4><8> |
| 4978 | // 6th bin: <6><8> |
| 4979 | |
| 4980 | Double_t dMult = (*fSMpk)(0,0); // multiplicity (number of particles used to determine the reaction plane) |
| 4981 | |
| 4982 | Double_t twoEBE = 0.; // <2> |
| 4983 | Double_t fourEBE = 0.; // <4> |
| 4984 | Double_t sixEBE = 0.; // <6> |
| 4985 | Double_t eightEBE = 0.; // <8> |
| 4986 | |
| 4987 | twoEBE = fQCorrelationsEBE[0]->GetBinContent(1); |
| 4988 | fourEBE = fQCorrelationsEBE[0]->GetBinContent(11); |
| 4989 | if(dMult>5) |
| 4990 | { |
| 4991 | sixEBE = fQCorrelationsEBE[0]->GetBinContent(24); |
| 4992 | if(dMult>7) |
| 4993 | { |
| 4994 | eightEBE = fQCorrelationsEBE[0]->GetBinContent(31); |
| 4995 | } |
| 4996 | } |
| 4057ba99 |
4997 | |
| 2aa4ebcd |
4998 | // <2><4> |
| 4999 | if(dMult>3) |
| 5000 | { |
| 5001 | fQProducts[0][0]->Fill(0.5,twoEBE*fourEBE,dMult*(dMult-1)*dMult*(dMult-1)*(dMult-2)*(dMult-3)); |
| 5002 | } |
| 4057ba99 |
5003 | |
| 2aa4ebcd |
5004 | // <2><6> |
| 5005 | if(dMult>5) |
| 5006 | { |
| 5007 | fQProducts[0][0]->Fill(1.5,twoEBE*sixEBE,dMult*(dMult-1)*dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)); |
| 5008 | } |
| 5009 | |
| 5010 | // <2><8> |
| 5011 | if(dMult>7) |
| 5012 | { |
| 5013 | fQProducts[0][0]->Fill(2.5,twoEBE*eightEBE,dMult*(dMult-1)*dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)*(dMult-6)*(dMult-7)); |
| 5014 | } |
| 9c1a9547 |
5015 | |
| 2aa4ebcd |
5016 | // <4><6> |
| 5017 | if(dMult>5) |
| 5018 | { |
| 5019 | fQProducts[0][0]->Fill(3.5,fourEBE*sixEBE,dMult*(dMult-1)*(dMult-2)*(dMult-3)*dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)); |
| 5020 | } |
| 9c1a9547 |
5021 | |
| 2aa4ebcd |
5022 | // <4><8> |
| 5023 | if(dMult>7) |
| 5024 | { |
| 5025 | fQProducts[0][0]->Fill(4.5,fourEBE*eightEBE,dMult*(dMult-1)*(dMult-2)*(dMult-3)* |
| 5026 | dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)*(dMult-6)*(dMult-7)); |
| 5027 | } |
| 9c1a9547 |
5028 | |
| 2aa4ebcd |
5029 | // <6><8> |
| 5030 | if(dMult>7) |
| 5031 | { |
| 5032 | fQProducts[0][0]->Fill(5.5,sixEBE*eightEBE,dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)* |
| 5033 | dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)*(dMult-6)*(dMult-7)); |
| 5034 | } |
| 3d824203 |
5035 | |
| 2aa4ebcd |
5036 | } // end of AliFlowAnalysisWithQCumulants::CalculateQProductsForIntFlow() |
| 9c1a9547 |
5037 | |
| 5038 | |
| 5039 | //================================================================================================================================ |
| 5040 | |
| 5041 | |
| 2aa4ebcd |
5042 | void AliFlowAnalysisWithQCumulants::CalculateCovariancesForIntFlow(Bool_t useParticleWeights, TString eventWeights) |
| fd46c3dd |
5043 | { |
| 2aa4ebcd |
5044 | // calculate covariances Cov(2,4), Cov(2,6), etc (needed to propagate errors for integrated flow) |
| 5045 | |
| 5046 | // binning of fCovariances[pW] is organized as follows: |
| 5047 | // |
| 5048 | // 1st bin: <<2><4>>-<<2>><<4>> |
| 5049 | // 2nd bin: <<2><6>>-<<2>><<6>> |
| 5050 | // 3rd bin: <<2><8>>-<<2>><<8>> |
| 5051 | // 4th bin: <<4><6>>-<<4>><<6>> |
| 5052 | // 5th bin: <<4><8>>-<<4>><<8>> |
| 5053 | // 6th bin: <<6><8>>-<<6>><<8>> |
| 5054 | |
| 5055 | // shortcuts for flags: |
| 5056 | Int_t pW = (Int_t)(useParticleWeights); |
| 5057 | Int_t eW = -1; |
| 5058 | |
| 5059 | if(eventWeights == "exact") |
| 5060 | { |
| 5061 | eW = 0; |
| 5062 | } |
| fd46c3dd |
5063 | |
| c2a42ea2 |
5064 | for(Int_t power=0;power<2;power++) |
| 5065 | { |
| 5066 | if(!(fQCorrelations[pW][eW] && fQProducts[pW][eW] && fCovariances[pW][eW] && fSumOfEventWeights[pW][eW][power] && fProductOfEventWeights[pW][eW])) |
| 5067 | { |
| 5068 | cout<<"WARNING: fQCorrelations[pW][eW] && fQProducts[pW][eW] && fCovariances[pW][eW] && fSumOfEventWeights[pW][eW][power] && fProductOfEventWeights[pW][eW] is NULL in AFAWQC::CCFIF() !!!!"<<endl; |
| 5069 | cout<<"pW = "<<pW<<endl; |
| 5070 | cout<<"eW = "<<eW<<endl; |
| 5071 | cout<<"power = "<<power<<endl; |
| 5072 | exit(0); |
| 5073 | } |
| 5074 | } |
| fd46c3dd |
5075 | |
| 2aa4ebcd |
5076 | // average 2-, 4-, 6- and 8-particle azimuthal correlations for all events: |
| c2a42ea2 |
5077 | Double_t two = fCorrelations[pW][eW]->GetBinContent(1); // <<2>> |
| 5078 | Double_t four = fCorrelations[pW][eW]->GetBinContent(11); // <<4>> |
| 5079 | Double_t six = fCorrelations[pW][eW]->GetBinContent(24); // <<6>> |
| 5080 | Double_t eight = fCorrelations[pW][eW]->GetBinContent(31); // <<8>> |
| 2aa4ebcd |
5081 | // average products of 2-, 4-, 6- and 8-particle azimuthal correlations: |
| 5082 | Double_t product24 = fQProducts[pW][eW]->GetBinContent(1); // <<2><4>> |
| 5083 | Double_t product26 = fQProducts[pW][eW]->GetBinContent(2); // <<2><6>> |
| 5084 | Double_t product28 = fQProducts[pW][eW]->GetBinContent(3); // <<2><8>> |
| 5085 | Double_t product46 = fQProducts[pW][eW]->GetBinContent(4); // <<4><6>> |
| 5086 | Double_t product48 = fQProducts[pW][eW]->GetBinContent(5); // <<4><8>> |
| 5087 | Double_t product68 = fQProducts[pW][eW]->GetBinContent(6); // <<6><8>> |
| c2a42ea2 |
5088 | // denominator in the expression for the unbiased estimator for covariance: |
| 5089 | Double_t denom24 = 0.; |
| 5090 | if(fSumOfEventWeights[pW][eW][0]->GetBinContent(1) && fSumOfEventWeights[pW][eW][0]->GetBinContent(2)) |
| 5091 | { |
| 5092 | denom24 = 1-(fProductOfEventWeights[pW][eW]->GetBinContent(1))/ |
| 5093 | (fSumOfEventWeights[pW][eW][0]->GetBinContent(1) * fSumOfEventWeights[pW][eW][0]->GetBinContent(2)); |
| 5094 | } |
| 5095 | Double_t denom26 = 0.; |
| 5096 | if(fSumOfEventWeights[pW][eW][0]->GetBinContent(1) && fSumOfEventWeights[pW][eW][0]->GetBinContent(3)) |
| 5097 | { |
| 5098 | denom26 = 1-(fProductOfEventWeights[pW][eW]->GetBinContent(2))/ |
| 5099 | (fSumOfEventWeights[pW][eW][0]->GetBinContent(1) * fSumOfEventWeights[pW][eW][0]->GetBinContent(3)); |
| 5100 | } |
| 5101 | Double_t denom28 = 0.; |
| 5102 | if(fSumOfEventWeights[pW][eW][0]->GetBinContent(1) && fSumOfEventWeights[pW][eW][0]->GetBinContent(4)) |
| 5103 | { |
| 5104 | denom28 = 1-(fProductOfEventWeights[pW][eW]->GetBinContent(3))/ |
| 5105 | (fSumOfEventWeights[pW][eW][0]->GetBinContent(1) * fSumOfEventWeights[pW][eW][0]->GetBinContent(4)); |
| 5106 | } |
| 5107 | Double_t denom46 = 0.; |
| 5108 | if(fSumOfEventWeights[pW][eW][0]->GetBinContent(2) && fSumOfEventWeights[pW][eW][0]->GetBinContent(3)) |
| 5109 | { |
| 5110 | denom46 = 1-(fProductOfEventWeights[pW][eW]->GetBinContent(4))/ |
| 5111 | (fSumOfEventWeights[pW][eW][0]->GetBinContent(2) * fSumOfEventWeights[pW][eW][0]->GetBinContent(3)); |
| 5112 | } |
| 5113 | Double_t denom48 = 0.; |
| 5114 | if(fSumOfEventWeights[pW][eW][0]->GetBinContent(2) && fSumOfEventWeights[pW][eW][0]->GetBinContent(4)) |
| 5115 | { |
| 5116 | denom48 = 1-(fProductOfEventWeights[pW][eW]->GetBinContent(5))/ |
| 5117 | (fSumOfEventWeights[pW][eW][0]->GetBinContent(2) * fSumOfEventWeights[pW][eW][0]->GetBinContent(4)); |
| 5118 | } |
| 5119 | Double_t denom68 = 0.; |
| 5120 | if(fSumOfEventWeights[pW][eW][0]->GetBinContent(3) && fSumOfEventWeights[pW][eW][0]->GetBinContent(4)) |
| 5121 | { |
| 5122 | denom68 = 1-(fProductOfEventWeights[pW][eW]->GetBinContent(6))/ |
| 5123 | (fSumOfEventWeights[pW][eW][0]->GetBinContent(3) * fSumOfEventWeights[pW][eW][0]->GetBinContent(4)); |
| 5124 | } |
| 5125 | |
| 5126 | // final covariances: |
| 5127 | Double_t cov24 = 0.; |
| 5128 | if(denom24) |
| 5129 | { |
| 5130 | cov24 = (product24-two*four)/denom24; // Cov(<2>,<4>) |
| 5131 | fCovariances[pW][eW]->SetBinContent(1,cov24); |
| 5132 | } |
| 5133 | Double_t cov26 = 0.; |
| 5134 | if(denom26) |
| 5135 | { |
| 5136 | cov26 = (product26-two*six)/denom26; // Cov(<2>,<6>) |
| 5137 | fCovariances[pW][eW]->SetBinContent(2,cov26); |
| 5138 | } |
| 5139 | Double_t cov28 = 0.; |
| 5140 | if(denom28) |
| 5141 | { |
| 5142 | cov28 = (product28-two*eight)/denom28; // Cov(<2>,<8>) |
| 5143 | fCovariances[pW][eW]->SetBinContent(3,cov28); |
| 5144 | } |
| 5145 | Double_t cov46 = 0.; |
| 5146 | if(denom46) |
| 5147 | { |
| 5148 | cov46 = (product46-four*six)/denom46; // Cov(<4>,<6>) |
| 5149 | fCovariances[pW][eW]->SetBinContent(4,cov46); |
| 5150 | } |
| 5151 | Double_t cov48 = 0.; |
| 5152 | if(denom48) |
| 5153 | { |
| 5154 | cov48 = (product48-four*eight)/denom48; // Cov(<4>,<8>) |
| 5155 | fCovariances[pW][eW]->SetBinContent(5,cov48); |
| 5156 | } |
| 5157 | Double_t cov68 = 0.; |
| 5158 | if(denom68) |
| 5159 | { |
| 5160 | cov68 = (product68-six*eight)/denom68; // Cov(<6>,<8>) |
| 5161 | fCovariances[pW][eW]->SetBinContent(6,cov68); |
| 5162 | } |
| 2aa4ebcd |
5163 | |
| 5164 | } // end of AliFlowAnalysisWithQCumulants::CalculateCovariancesForIntFlow(Bool_t useParticleWeights, TString eventWeights) |
| fd46c3dd |
5165 | |
| 5166 | |
| 5167 | //================================================================================================================================ |
| 5168 | |
| 5169 | |
| 2aa4ebcd |
5170 | void AliFlowAnalysisWithQCumulants::FinalizeCorrelationsForIntFlow(Bool_t useParticleWeights, TString eventWeights) // to be improved (there is better way to implement this method) |
| 9c1a9547 |
5171 | { |
| 2aa4ebcd |
5172 | // From fQCorrelations[pW][eW] access measured correlations and spread, calculate statistical errors and store the |
| 5173 | // final results and statistical errors for correlations in fCorrelations[pW][eW] (binning is the same as in fQCorrelations[pW][eW]). |
| 3d824203 |
5174 | |
| 2aa4ebcd |
5175 | // shortcuts for flags: |
| 5176 | Int_t pW = (Int_t)(useParticleWeights); |
| 3d824203 |
5177 | |
| 2aa4ebcd |
5178 | Int_t eW = -1; |
| 5179 | |
| 5180 | if(eventWeights == "exact") |
| 9c1a9547 |
5181 | { |
| 2aa4ebcd |
5182 | eW = 0; |
| 5183 | } |
| 5184 | |
| c2a42ea2 |
5185 | for(Int_t power=0;power<2;power++) |
| 9c1a9547 |
5186 | { |
| c2a42ea2 |
5187 | if(!(fQCorrelations[pW][eW] && fCorrelations[pW][eW] && fSumOfEventWeights[pW][eW][power])) |
| 5188 | { |
| 5189 | cout<<"WARNING: fQCorrelations[pW][eW] && fCorrelations[pW][eW] && fSumOfEventWeights[pW][eW][power] is NULL in AFAWQC::FCFIF() !!!!"<<endl; |
| 5190 | cout<<"pW = "<<pW<<endl; |
| 5191 | cout<<"eW = "<<eW<<endl; |
| 5192 | cout<<"power = "<<power<<endl; |
| 5193 | exit(0); |
| 5194 | } |
| 2aa4ebcd |
5195 | } |
| 3d824203 |
5196 | |
| c2a42ea2 |
5197 | // <<2>>: |
| 5198 | Double_t correlation2p = fQCorrelations[pW][eW]->GetBinContent(1); |
| 5199 | Double_t spread2p = fQCorrelations[pW][eW]->GetBinError(1); |
| 5200 | Double_t sumOfEventWeightsLinear2p = fSumOfEventWeights[pW][eW][0]->GetBinContent(1); |
| 5201 | Double_t sumOfEventWeightsQuadratic2p = fSumOfEventWeights[pW][eW][1]->GetBinContent(1); |
| 5202 | // stat.error = termA * spread * termB: |
| 5203 | // termB = 1/sqrt(1-termA^2) |
| 5204 | Double_t termA2p = 0.; |
| 5205 | Double_t termB2p = 0.; |
| 5206 | Double_t statError2p = 0.; |
| 5207 | if(sumOfEventWeightsLinear2p) |
| 5208 | { |
| 5209 | termA2p = pow(sumOfEventWeightsQuadratic2p,0.5)/sumOfEventWeightsLinear2p; |
| 5210 | } else |
| 5211 | { |
| 5212 | cout<<"WARNING: sumOfEventWeightsLinear2p == 0 in in AFAWQC::FCFIF() !!!!"<<endl; |
| 5213 | } |
| 5214 | |
| 5215 | if(1-pow(termA2p,2.) > 0) |
| 2bdc5281 |
5216 | { |
| c2a42ea2 |
5217 | termB2p = 1./pow(1-pow(termA2p,2.),0.5); |
| 5218 | } else |
| 5219 | { |
| 5220 | cout<<"WARNING: 1-pow(termA2p,2.) <= 0 in in AFAWQC::FCFIF() !!!!"<<endl; |
| 5221 | } |
| 9c1a9547 |
5222 | |
| c2a42ea2 |
5223 | statError2p = termA2p*spread2p*termB2p; |
| 5224 | fCorrelations[pW][eW]->SetBinContent(1,correlation2p); |
| 5225 | fCorrelations[pW][eW]->SetBinError(1,statError2p); |
| 5226 | |
| 5227 | // <<4>>: |
| 5228 | Double_t correlation4p = fQCorrelations[pW][eW]->GetBinContent(11); |
| 5229 | Double_t spread4p = fQCorrelations[pW][eW]->GetBinError(11); |
| 5230 | Double_t sumOfEventWeightsLinear4p = fSumOfEventWeights[pW][eW][0]->GetBinContent(2); |
| 5231 | Double_t sumOfEventWeightsQuadratic4p = fSumOfEventWeights[pW][eW][1]->GetBinContent(2); |
| 5232 | Double_t termA4p = 0.; |
| 5233 | Double_t termB4p = 0.; |
| 5234 | Double_t statError4p = 0.; |
| 5235 | if(sumOfEventWeightsLinear4p) |
| 5236 | { |
| 5237 | termA4p = pow(sumOfEventWeightsQuadratic4p,0.5)/sumOfEventWeightsLinear4p; |
| 5238 | } else |
| 5239 | { |
| 5240 | cout<<"WARNING: sumOfEventWeightsLinear4p == 0 in in AFAWQC::FCFIF() !!!!"<<endl; |
| 5241 | } |
| 5242 | if(1-pow(termA4p,2.) > 0) |
| 5243 | { |
| 5244 | termB4p = 1./pow(1-pow(termA4p,2.),0.5); |
| 5245 | } else |
| 5246 | { |
| 5247 | cout<<"WARNING: 1-pow(termA4p,2.) <= 0 in in AFAWQC::FCFIF() !!!!"<<endl; |
| 5248 | } |
| 5249 | |
| 5250 | statError4p = termA4p*spread4p*termB4p; |
| 5251 | fCorrelations[pW][eW]->SetBinContent(11,correlation4p); |
| 5252 | fCorrelations[pW][eW]->SetBinError(11,statError4p); |
| 5253 | |
| 5254 | // <<6>>: |
| 5255 | Double_t correlation6p = fQCorrelations[pW][eW]->GetBinContent(24); |
| 5256 | Double_t spread6p = fQCorrelations[pW][eW]->GetBinError(24); |
| 5257 | Double_t sumOfEventWeightsLinear6p = fSumOfEventWeights[pW][eW][0]->GetBinContent(3); |
| 5258 | Double_t sumOfEventWeightsQuadratic6p = fSumOfEventWeights[pW][eW][1]->GetBinContent(3); |
| 5259 | Double_t termA6p = 0.; |
| 5260 | Double_t termB6p = 0.; |
| 5261 | Double_t statError6p = 0.; |
| 5262 | if(sumOfEventWeightsLinear6p) |
| 5263 | { |
| 5264 | termA6p = pow(sumOfEventWeightsQuadratic6p,0.5)/sumOfEventWeightsLinear6p; |
| 5265 | } else |
| 5266 | { |
| 5267 | cout<<"WARNING: sumOfEventWeightsLinear6p == 0 in in AFAWQC::FCFIF() !!!!"<<endl; |
| 5268 | } |
| 5269 | if(1-pow(termA6p,2.) > 0) |
| 5270 | { |
| 5271 | termB6p = 1./pow(1-pow(termA6p,2.),0.5); |
| 5272 | } else |
| 5273 | { |
| 5274 | cout<<"WARNING: 1-pow(termA6p,2.) <= 0 in in AFAWQC::FCFIF() !!!!"<<endl; |
| 5275 | } |
| 5276 | |
| 5277 | statError6p = termA6p*spread6p*termB6p; |
| 5278 | fCorrelations[pW][eW]->SetBinContent(24,correlation6p); |
| 5279 | fCorrelations[pW][eW]->SetBinError(24,statError6p); |
| 5280 | |
| 5281 | // <<8>> |
| 5282 | Double_t correlation8p = fQCorrelations[pW][eW]->GetBinContent(31); |
| 5283 | // ... |
| 5284 | fCorrelations[pW][eW]->SetBinContent(31,correlation8p); |
| 5285 | // ... |
| 5286 | |
| 2aa4ebcd |
5287 | } // end of AliFlowAnalysisWithQCumulants::FinalizeCorrelationsForIntFlow(Bool_t useParticleWeights, TString eventWeights) |
| 9c1a9547 |
5288 | |
| 9c1a9547 |
5289 | |
| 2aa4ebcd |
5290 | //================================================================================================================================ |
| 5291 | |
| 5292 | |
| 5293 | void AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(Int_t nRP) |
| 5294 | { |
| 5295 | // Fill profile fAverageMultiplicity to hold average multiplicities and number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8 |
| 5296 | |
| 5297 | // Binning of fAverageMultiplicity is organized as follows: |
| 5298 | // 1st bin: all events (including the empty ones) |
| 5299 | // 2nd bin: event with # of RPs greater or equal to 1 |
| 5300 | // 3rd bin: event with # of RPs greater or equal to 2 |
| 5301 | // 4th bin: event with # of RPs greater or equal to 3 |
| 5302 | // 5th bin: event with # of RPs greater or equal to 4 |
| 5303 | // 6th bin: event with # of RPs greater or equal to 5 |
| 5304 | // 7th bin: event with # of RPs greater or equal to 6 |
| 5305 | // 8th bin: event with # of RPs greater or equal to 7 |
| 5306 | // 9th bin: event with # of RPs greater or equal to 8 |
| 5307 | |
| 5308 | if(!fAvMultiplicity) |
| 5309 | { |
| 5310 | cout<<"WARNING: fAvMultiplicity is NULL in AFAWQC::FAM() !!!!"<<endl; |
| 5311 | exit(0); |
| 5312 | } |
| 9c1a9547 |
5313 | |
| 2aa4ebcd |
5314 | if(nRP<0) |
| 5315 | { |
| 5316 | cout<<"WARNING: nRP<0 in in AFAWQC::FAM() !!!!"<<endl; |
| 5317 | exit(0); |
| 5318 | } |
| 9c1a9547 |
5319 | |
| 2aa4ebcd |
5320 | for(Int_t i=0;i<9;i++) |
| 5321 | { |
| 5322 | if(nRP>=i) fAvMultiplicity->Fill(i+0.5,nRP,1); |
| 5323 | } |
| 9c1a9547 |
5324 | |
| 2aa4ebcd |
5325 | } // end of AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(nRP) |
| 9c1a9547 |
5326 | |
| 5327 | |
| 5328 | //================================================================================================================================ |
| 5329 | |
| 5330 | |
| 2aa4ebcd |
5331 | void AliFlowAnalysisWithQCumulants::CalculateCumulantsForIntFlow(Bool_t useParticleWeights, TString eventWeights) |
| 9c1a9547 |
5332 | { |
| 2aa4ebcd |
5333 | // calculate cumulants from measured correlations and store results in fCumulants[pW][eW][0]. |
| 5334 | // (Remark: these cumulants are biased by non-uniform acceptance, corrected cumulants are stored in fCumulants[pW][eW][1].) |
| 9c1a9547 |
5335 | |
| 2aa4ebcd |
5336 | // Binning of fCumulants[pW][nua] is organized as follows: |
| 5337 | // 1st bin: QC{2} |
| 5338 | // 2nd bin: QC{4} |
| 5339 | // 3rd bin: QC{6} |
| 5340 | // 4th bin: QC{8} |
| 9c1a9547 |
5341 | |
| 2aa4ebcd |
5342 | // shortcuts for the flags: |
| 5343 | Int_t pW = (Int_t)(useParticleWeights); // (0=weights not used, 1=weights used) |
| 9c1a9547 |
5344 | |
| 2aa4ebcd |
5345 | Int_t eW = -1; |
| 9c1a9547 |
5346 | |
| 2aa4ebcd |
5347 | if(eventWeights == "exact") |
| 9c1a9547 |
5348 | { |
| 2aa4ebcd |
5349 | eW = 0; |
| 9c1a9547 |
5350 | } |
| 5351 | |
| c2a42ea2 |
5352 | if(!(fCorrelations[pW][eW] && fCovariances[pW][eW] && fCumulants[pW][eW][0] && fAvMultiplicity)) |
| 2aa4ebcd |
5353 | { |
| c2a42ea2 |
5354 | cout<<"WARNING: fCorrelations[pW][eW] && fCovariances[pW][eW] && fCumulants[pW][eW][0] && fAvMultiplicity is NULL in AFAWQC::CCFIF() !!!!"<<endl; |
| 2aa4ebcd |
5355 | cout<<"pW = "<<pW<<endl; |
| 5356 | cout<<"eW = "<<eW<<endl; |
| 5357 | exit(0); |
| 5358 | } |
| 9c1a9547 |
5359 | |
| 2aa4ebcd |
5360 | // correlations: |
| c2a42ea2 |
5361 | Double_t two = fCorrelations[pW][eW]->GetBinContent(1); // <<2>> |
| 5362 | Double_t four = fCorrelations[pW][eW]->GetBinContent(11); // <<4>> |
| 5363 | Double_t six = fCorrelations[pW][eW]->GetBinContent(24); // <<6>> |
| 5364 | Double_t eight = fCorrelations[pW][eW]->GetBinContent(31); // <<8>> |
| 5365 | // stat. error of correlations: |
| 5366 | Double_t twoError = fCorrelations[pW][eW]->GetBinError(1); // stat. error of <<2>> |
| 5367 | Double_t fourError = fCorrelations[pW][eW]->GetBinError(11); // stat. error of <<4>> |
| 5368 | Double_t sixError = fCorrelations[pW][eW]->GetBinError(24); // stat. error of <<6>> |
| 5369 | //Double_t eightError = fQCorrelations[pW]->GetBinError(31); // stat. error of <<8>> |
| 2aa4ebcd |
5370 | // spread of correlations: |
| c2a42ea2 |
5371 | Double_t twoSpread = 0.; // spread of <<2>> |
| 5372 | Double_t fourSpread = 0.; // spread of <<6>> |
| 5373 | Double_t sixSpread = 0.; // spread of <<8>> |
| 5374 | //Double_t eightSpread = 0.; |
| 5375 | // stat. error = prefactor * spread: |
| 5376 | Double_t twoPrefactor = 0; |
| 5377 | if(fSumOfEventWeights[pW][eW][0]->GetBinContent(1)) |
| 5378 | { |
| 5379 | twoPrefactor = pow(fSumOfEventWeights[pW][eW][1]->GetBinContent(1),0.5)/fSumOfEventWeights[pW][eW][0]->GetBinContent(1); |
| 5380 | if(twoPrefactor) twoSpread = twoError/twoPrefactor; |
| 5381 | } |
| 5382 | Double_t fourPrefactor = 0; |
| 5383 | if(fSumOfEventWeights[pW][eW][0]->GetBinContent(2)) |
| 5384 | { |
| 5385 | fourPrefactor = pow(fSumOfEventWeights[pW][eW][1]->GetBinContent(2),0.5)/fSumOfEventWeights[pW][eW][0]->GetBinContent(2); |
| 5386 | if(fourPrefactor) fourSpread = fourError/fourPrefactor; |
| 5387 | } |
| 5388 | Double_t sixPrefactor = 0; |
| 5389 | if(fSumOfEventWeights[pW][eW][0]->GetBinContent(3)) |
| 5390 | { |
| 5391 | sixPrefactor = pow(fSumOfEventWeights[pW][eW][1]->GetBinContent(3),0.5)/fSumOfEventWeights[pW][eW][0]->GetBinContent(3); |
| 5392 | if(sixPrefactor) sixSpread = sixError/sixPrefactor; |
| 5393 | } |
| 5394 | // ... 8th |
| 2aa4ebcd |
5395 | // covariances: |
| c2a42ea2 |
5396 | Double_t cov24 = fCovariances[pW][eW]->GetBinContent(1); // Cov(<2>,<4>) |
| 5397 | Double_t cov26 = fCovariances[pW][eW]->GetBinContent(2); // Cov(<2>,<6>) |
| 5398 | //Double_t cov28 = fCovariances[pW]->GetBinContent(3); // Cov(<2>,<8>) |
| 5399 | Double_t cov46 = fCovariances[pW][eW]->GetBinContent(4); // Cov(<4>,<6>) |
| 5400 | //Double_t cov48 = fCovariances[pW]->GetBinContent(5); // Cov(<4>,<8>) |
| 5401 | //Double_t cov68 = fCovariances[pW]->GetBinContent(6); // Cov(<6>,<8>) |
| 2aa4ebcd |
5402 | // cumulants: |
| 5403 | Double_t qc2 = 0.; // QC{2} |
| 5404 | Double_t qc4 = 0.; // QC{4} |
| 5405 | Double_t qc6 = 0.; // QC{6} |
| 5406 | Double_t qc8 = 0.; // QC{8} |
| 5407 | |
| 5408 | if(two) qc2 = two; |
| 5409 | if(four) qc4 = four-2.*pow(two,2.); |
| 5410 | if(six) qc6 = six-9.*two*four+12.*pow(two,3.); |
| 5411 | if(eight) qc8 = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.); |
| 5412 | |
| c2a42ea2 |
5413 | // stat. error of cumulants: |
| 5414 | Double_t qc2Error = 0; // stat. error of QC{2} |
| 5415 | Double_t qc4Error = 0; // stat. error of QC{4} |
| 5416 | Double_t qc6Error = 0; // stat. error of QC{6} |
| 5417 | // Double_t qc8Error = 0; // stat. error of QC{8} // to be improved (calculated) |
| 2aa4ebcd |
5418 | // spread of cumulants: |
| c2a42ea2 |
5419 | //Double_t qc2Spread = 0; // spread of QC{2} |
| 2aa4ebcd |
5420 | Double_t qc4Spread = 0; // spread of QC{4} |
| 5421 | Double_t qc6Spread = 0; // spread of QC{6} |
| 5422 | // Double_t qc8Spread = 0; // spread of QC{8} // to be improved (calculated) |
| 5423 | |
| c2a42ea2 |
5424 | qc2Error = twoError; // final stat. error of QC{2} |
| 2aa4ebcd |
5425 | |
| 5426 | if(16.*pow(two,2.)*pow(twoSpread,2.)+pow(fourSpread,2.)-8.*two*cov24 >= 0.) |
| 5427 | { |
| 5428 | qc4Spread = pow(16.*pow(two,2.)*pow(twoSpread,2.)+pow(fourSpread,2.)-8.*two*cov24,0.5); |
| 5429 | } else |
| 5430 | { |
| 5431 | cout<<"WARNING: spread of QC{4} is imaginary !!!!"<<endl; |
| 5432 | } |
| c2a42ea2 |
5433 | |
| 5434 | qc4Error = fourPrefactor*qc4Spread; // final stat. error of QC{4} |
| 5435 | |
| 2aa4ebcd |
5436 | if(81.*pow(4.*pow(two,2.)-four,2.)*pow(twoSpread,2.) |
| 5437 | + 81.*pow(two,2.)*pow(fourSpread,2.)+pow(sixSpread,2.) |
| 5438 | - 162.*(4.*pow(two,2.)-four)*two*cov24 |
| 5439 | + 18.*(4.*pow(two,2.)-four)*cov26 |
| 5440 | - 18.*two*cov46 >= 0.) |
| 5441 | { |
| 5442 | qc6Spread = pow(81.*pow(4.*pow(two,2.)-four,2.)*pow(twoSpread,2.) |
| 5443 | + 81.*pow(two,2.)*pow(fourSpread,2.)+pow(sixSpread,2.) |
| 5444 | - 162.*(4.*pow(two,2.)-four)*two*cov24 |
| 5445 | + 18.*(4.*pow(two,2.)-four)*cov26 |
| 5446 | - 18.*two*cov46,0.5); |
| 5447 | } else |
| 5448 | { |
| c2a42ea2 |
5449 | cout<<"WARNING: stat. error of QC{6} is imaginary !!!!"<<endl; |
| 5450 | } |
| 5451 | |
| 5452 | qc6Error = sixPrefactor*qc6Spread; // final stat. error of QC{6} |
| 2aa4ebcd |
5453 | |
| 2aa4ebcd |
5454 | // store the results and statistical errors for cumulants: |
| 5455 | fCumulants[pW][eW][0]->SetBinContent(1,qc2); |
| 5456 | fCumulants[pW][eW][0]->SetBinError(1,qc2Error); |
| 5457 | fCumulants[pW][eW][0]->SetBinContent(2,qc4); |
| 5458 | fCumulants[pW][eW][0]->SetBinError(2,qc4Error); |
| 5459 | fCumulants[pW][eW][0]->SetBinContent(3,qc6); |
| 5460 | fCumulants[pW][eW][0]->SetBinError(3,qc6Error); |
| 5461 | fCumulants[pW][eW][0]->SetBinContent(4,qc8); |
| 5462 | // fCumulants[pW]->SetBinError(4,qc8Error); // to be improved (calculated) |
| 5463 | |
| 5464 | } // end of AliFlowAnalysisWithQCumulants::CalculateCumulantsForIntFlow(Bool_t useParticleWeights, TString eventWeights) |
| 9c1a9547 |
5465 | |
| 5466 | |
| 2aa4ebcd |
5467 | //================================================================================================================================ |
| 9c1a9547 |
5468 | |
| 5469 | |
| 2aa4ebcd |
5470 | void AliFlowAnalysisWithQCumulants::CalculateIntFlow(Bool_t useParticleWeights, TString eventWeights, Bool_t correctedForNUA) |
| 9c1a9547 |
5471 | { |
| 2aa4ebcd |
5472 | // calculate final results for integrated flow |
| 9c1a9547 |
5473 | |
| 2aa4ebcd |
5474 | // Results for integrated flow are stored in fInfFlow[pW][nua]. Binning of fIntFlow[pW][nua] is organized as follows: |
| 5475 | // 1st bin: v{2} |
| 5476 | // 2nd bin: v{4} |
| 5477 | // 3rd bin: v{6} |
| 5478 | // 4th bin: v{8} |
| 9c1a9547 |
5479 | |
| 2aa4ebcd |
5480 | // shortcuts for the flags: |
| 5481 | Int_t pW = (Int_t)(useParticleWeights); // 0=pWeights not useed, 1=pWeights used |
| 5482 | Int_t nua = (Int_t)(correctedForNUA); // 0=not corrected for NUA, 1=corrected for NUA |
| 5483 | Int_t eW = -1; |
| 9c1a9547 |
5484 | |
| 2aa4ebcd |
5485 | if(eventWeights = "exact") |
| 5486 | { |
| 5487 | eW = 0; |
| 5488 | } |
| 5489 | |
| 5490 | if(!(fCumulants[pW][eW][nua] && fIntFlow[pW][eW][nua])) |
| 5491 | { |
| 5492 | cout<<"WARNING: fCumulants[pW][eW][nua] && fIntFlow[pW][eW][nua] is NULL in AFAWQC::CIF() !!!!"<<endl; |
| 5493 | cout<<"pW = "<<pW<<endl; |
| 5494 | cout<<"eW = "<<eW<<endl; |
| 5495 | cout<<"nua = "<<nua<<endl; |
| 5496 | exit(0); |
| 5497 | } |
| 5498 | |
| 5499 | // cumulants: |
| 5500 | Double_t qc2 = fCumulants[pW][eW][nua]->GetBinContent(1); // QC{2} |
| 5501 | Double_t qc4 = fCumulants[pW][eW][nua]->GetBinContent(2); // QC{4} |
| 5502 | Double_t qc6 = fCumulants[pW][eW][nua]->GetBinContent(3); // QC{6} |
| 5503 | Double_t qc8 = fCumulants[pW][eW][nua]->GetBinContent(4); // QC{8} |
| 5504 | |
| 5505 | // cumulants' statistical errors: |
| 5506 | Double_t qc2Error = fCumulants[pW][eW][nua]->GetBinError(1); // error of QC{2} |
| 5507 | Double_t qc4Error = fCumulants[pW][eW][nua]->GetBinError(2); // error of QC{4} |
| 5508 | Double_t qc6Error = fCumulants[pW][eW][nua]->GetBinError(3); // error of QC{6} |
| 5509 | //Double_t qc8Error = fCumulants[pW][nua]->GetBinError(4); // error of QC{8} |
| 5510 | |
| 5511 | // integrated flow estimates: |
| 5512 | Double_t v2 = 0.; // v{2} |
| 5513 | Double_t v4 = 0.; // v{4} |
| 5514 | Double_t v6 = 0.; // v{6} |
| 5515 | Double_t v8 = 0.; // v{8} |
| 5516 | |
| 5517 | // calculate integrated flow estimates from cumulants: |
| 5518 | if(qc2>=0.) v2 = pow(qc2,1./2.); |
| 5519 | if(qc4<=0.) v4 = pow(-1.*qc4,1./4.); |
| 5520 | if(qc6>=0.) v6 = pow((1./4.)*qc6,1./6.); |
| 5521 | if(qc8<=0.) v8 = pow((-1./33.)*qc8,1./8.); |
| 5522 | |
| 5523 | // statistical errors of integrated flow estimates: |
| 5524 | Double_t v2Error = 0.; // error of v{2} |
| 5525 | Double_t v4Error = 0.; // error of v{4} |
| 5526 | Double_t v6Error = 0.; // error of v{6} |
| 5527 | Double_t v8Error = 0.; // error of v{8} |
| 5528 | |
| 5529 | // calculate statistical errors for integrated flow estimates: |
| 5530 | if(qc2>0.) v2Error = (1./(2.*pow(qc2,0.5)))*qc2Error; |
| 5531 | if(qc4<0.) v4Error = (1./(4.*pow(-1.*qc4,3./4.)))*qc4Error; |
| 5532 | if(qc6>0.) v6Error = (1./(6.*pow(2.,1./3.)*pow(qc6,5./6.)))*qc6Error; |
| 5533 | if(qc8<0.) v8Error = 0.; // to be improved (calculated) |
| 5534 | |
| 5535 | // store final results and statistical errors for integrated flow: |
| 5536 | fIntFlow[pW][eW][nua]->SetBinContent(1,v2); |
| 5537 | fIntFlow[pW][eW][nua]->SetBinError(1,v2Error); |
| 5538 | fIntFlow[pW][eW][nua]->SetBinContent(2,v4); |
| 5539 | fIntFlow[pW][eW][nua]->SetBinError(2,v4Error); |
| 5540 | fIntFlow[pW][eW][nua]->SetBinContent(3,v6); |
| 5541 | fIntFlow[pW][eW][nua]->SetBinError(3,v6Error); |
| 5542 | fIntFlow[pW][eW][nua]->SetBinContent(4,v8); |
| 5543 | fIntFlow[pW][eW][nua]->SetBinError(4,v8Error); |
| 5544 | |
| 5545 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlow(Bool_t useParticleWeights, TString eventWeights, Bool_t correctedForNUA) |
| 5546 | |
| 5547 | |
| 5548 | //================================================================================================================================ |
| 5549 | |
| 5550 | |
| 5551 | void AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow(Bool_t useParticleWeights, TString eventWeights, Bool_t correctedForNUA) |
| 5552 | { |
| 5553 | // fill in AliFlowCommonHistResults histograms relevant for 'NONAME' integrated flow (to be improved (name)) |
| 9c1a9547 |
5554 | |
| 2aa4ebcd |
5555 | // shortcuts for the flags: |
| 5556 | Int_t pW = (Int_t)(useParticleWeights); // 0=pWeights not useed, 1=pWeights used |
| 5557 | Int_t nua = (Int_t)(correctedForNUA); // 0=not corrected for NUA, 1=corrected for NUA |
| 5558 | Int_t eW = -1; |
| 5559 | |
| 5560 | if(eventWeights == "exact") |
| 9c1a9547 |
5561 | { |
| 2aa4ebcd |
5562 | eW = 0; |
| 5563 | } |
| 5564 | |
| 5565 | if(!fIntFlow[pW][eW][nua]) |
| 5566 | { |
| 5567 | cout<<"WARNING: fIntFlow[pW][eW][nua] is NULL in AFAWQC::FCHRIF() !!!!"<<endl; |
| 5568 | cout<<"pW = "<<pW<<endl; |
| 5569 | cout<<"eW = "<<eW<<endl; |
| 5570 | cout<<"nua = "<<nua<<endl; |
| 5571 | exit(0); |
| 5572 | } |
| 5573 | |
| 5574 | if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th)) |
| 5575 | { |
| 5576 | cout<<"WARNING: fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th"<<endl; |
| 5577 | cout<<" is NULL in AFAWQC::FCHRIF() !!!!"<<endl; |
| 5578 | exit(0); |
| 5579 | } |
| 5580 | |
| 5581 | Double_t v2 = fIntFlow[pW][eW][nua]->GetBinContent(1); |
| 5582 | Double_t v4 = fIntFlow[pW][eW][nua]->GetBinContent(2); |
| 5583 | Double_t v6 = fIntFlow[pW][eW][nua]->GetBinContent(3); |
| 5584 | Double_t v8 = fIntFlow[pW][eW][nua]->GetBinContent(4); |
| 5585 | |
| 5586 | Double_t v2Error = fIntFlow[pW][eW][nua]->GetBinError(1); |
| 5587 | Double_t v4Error = fIntFlow[pW][eW][nua]->GetBinError(2); |
| 5588 | Double_t v6Error = fIntFlow[pW][eW][nua]->GetBinError(3); |
| 5589 | Double_t v8Error = fIntFlow[pW][eW][nua]->GetBinError(4); |
| 5590 | |
| 5591 | fCommonHistsResults2nd->FillIntegratedFlow(v2,v2Error); |
| 5592 | fCommonHistsResults4th->FillIntegratedFlow(v4,v4Error); |
| 5593 | fCommonHistsResults6th->FillIntegratedFlow(v6,v6Error); |
| 5594 | fCommonHistsResults8th->FillIntegratedFlow(v8,v8Error); |
| 5595 | |
| 5596 | } // end of AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow(Bool_t useParticleWeights, TString eventWeights, Bool_t correctedForNUA) |
| 5597 | |
| 5598 | |
| 5599 | //================================================================================================================================ |
| 5600 | |
| 5601 | |
| 5602 | void AliFlowAnalysisWithQCumulants::ApplyCorrectionForNonUniformAcceptanceToCumulantsForIntFlow(Bool_t useParticleWeights, TString eventWeights) |
| 5603 | { |
| 5604 | // apply correction for non-uniform acceptance to cumulants for integrated flow |
| 5605 | // (Remark: non-corrected cumulants are accessed from fCumulants[pW][0], corrected cumulants are stored in fCumulants[pW][1]) |
| 5606 | |
| 5607 | // shortcuts for the flags: |
| 5608 | Int_t pW = (Int_t)(useParticleWeights); // 0=pWeights not used, 1=pWeights used |
| 5609 | Int_t eW = -1; |
| 5610 | |
| 5611 | if(eventWeights == "exact") |
| 5612 | { |
| 5613 | eW = 0; |
| 9c1a9547 |
5614 | } |
| 5615 | |
| 2aa4ebcd |
5616 | if(!(fCumulants[pW][eW][0] && fCumulants[pW][eW][1] && fCorrections[pW][eW])) |
| 5617 | { |
| 5618 | cout<<"WARNING: fCumulants[pW][eW][0] && fCumulants[pW][eW][1] && fCorrections[pW][eW] is NULL in AFAWQC::ACFNUATCFIF() !!!!"<<endl; |
| 5619 | cout<<"pW = "<<pW<<endl; |
| 5620 | cout<<"eW = "<<eW<<endl; |
| 5621 | exit(0); |
| 5622 | } |
| 9c1a9547 |
5623 | |
| 2aa4ebcd |
5624 | // non-corrected cumulants: |
| 5625 | Double_t qc2 = fCumulants[pW][eW][0]->GetBinContent(1); |
| 5626 | Double_t qc4 = fCumulants[pW][eW][0]->GetBinContent(2); |
| 5627 | Double_t qc6 = fCumulants[pW][eW][0]->GetBinContent(3); |
| 5628 | Double_t qc8 = fCumulants[pW][eW][0]->GetBinContent(4); |
| 5629 | // statistical error of non-corrected cumulants: |
| 5630 | Double_t qc2Error = fCumulants[pW][eW][0]->GetBinError(1); |
| 5631 | Double_t qc4Error = fCumulants[pW][eW][0]->GetBinError(2); |
| 5632 | Double_t qc6Error = fCumulants[pW][eW][0]->GetBinError(3); |
| 5633 | Double_t qc8Error = fCumulants[pW][eW][0]->GetBinError(4); |
| 5634 | // corrections for non-uniform acceptance: |
| 5635 | Double_t qc2Correction = fCorrections[pW][eW]->GetBinContent(1); |
| 5636 | Double_t qc4Correction = fCorrections[pW][eW]->GetBinContent(2); |
| 5637 | Double_t qc6Correction = fCorrections[pW][eW]->GetBinContent(3); |
| 5638 | Double_t qc8Correction = fCorrections[pW][eW]->GetBinContent(4); |
| 5639 | // corrected cumulants: |
| 5640 | Double_t qc2Corrected = qc2 + qc2Correction; |
| 5641 | Double_t qc4Corrected = qc4 + qc4Correction; |
| 5642 | Double_t qc6Corrected = qc6 + qc6Correction; |
| 5643 | Double_t qc8Corrected = qc8 + qc8Correction; |
| 5644 | |
| 5645 | // ... to be improved (I need here also to correct error of QCs for NUA. |
| 5646 | // For simplicity sake I assume at the moment that this correction is negliglible, but it will be added eventually...) |
| 5647 | |
| 5648 | // store corrected results and statistical errors for cumulants: |
| 5649 | fCumulants[pW][eW][1]->SetBinContent(1,qc2Corrected); |
| 5650 | fCumulants[pW][eW][1]->SetBinContent(2,qc4Corrected); |
| 5651 | fCumulants[pW][eW][1]->SetBinContent(3,qc6Corrected); |
| 5652 | fCumulants[pW][eW][1]->SetBinContent(4,qc8Corrected); |
| 5653 | fCumulants[pW][eW][1]->SetBinError(1,qc2Error); // to be improved (correct also qc2Error for NUA) |
| 5654 | fCumulants[pW][eW][1]->SetBinError(2,qc4Error); // to be improved (correct also qc4Error for NUA) |
| 5655 | fCumulants[pW][eW][1]->SetBinError(3,qc6Error); // to be improved (correct also qc6Error for NUA) |
| 5656 | fCumulants[pW][eW][1]->SetBinError(4,qc8Error); // to be improved (correct also qc8Error for NUA) |
| 5657 | |
| 5658 | } // end of AliFlowAnalysisWithQCumulants::ApplyCorrectionForNonUniformAcceptanceToCumulantsForIntFlow(Bool_t useParticleWeights, TString eventWeights) |
| 9c1a9547 |
5659 | |
| 5660 | |
| 5661 | //================================================================================================================================ |
| 5662 | |
| 2aa4ebcd |
5663 | |
| 5664 | void AliFlowAnalysisWithQCumulants::PrintQuantifyingCorrectionsForNonUniformAcceptance(Bool_t useParticleWeights, TString eventWeights) |
| c365fe76 |
5665 | { |
| 2aa4ebcd |
5666 | // print on the screen QC{n,biased}/QC{n,corrected} |
| c365fe76 |
5667 | |
| 2aa4ebcd |
5668 | // shortcuts for the flags: |
| 5669 | Int_t pW = (Int_t)(useParticleWeights); // 0=pWeights not used, 1=pWeights used |
| c365fe76 |
5670 | |
| 2aa4ebcd |
5671 | Int_t eW = -1; |
| c365fe76 |
5672 | |
| 2aa4ebcd |
5673 | if(eventWeights == "exact") |
| 5674 | { |
| 5675 | eW = 0; |
| 5676 | } |
| c365fe76 |
5677 | |
| 2aa4ebcd |
5678 | if(!(fCumulants[pW][eW][0] && fCumulants[pW][eW][1])) |
| 5679 | { |
| 5680 | cout<<"WARNING: fCumulants[pW][eW][0] && fCumulants[pW][eW][1] is NULL in AFAWQC::PQCFNUA() !!!!"<<endl; |
| 5681 | cout<<"pW = "<<pW<<endl; |
| 5682 | cout<<"eW = "<<eW<<endl; |
| 5683 | exit(0); |
| 5684 | } |
| 5685 | |
| 5686 | cout<<endl; |
| 5687 | cout<<" Quantifying the bias to Q-cumulants from"<<endl; |
| 5688 | cout<<" non-uniform acceptance of the detector:"<<endl; |
| 5689 | cout<<endl; |
| c365fe76 |
5690 | |
| 2aa4ebcd |
5691 | if(fCumulants[pW][eW][1]->GetBinContent(1)) |
| 5692 | { |
| 5693 | cout<<" QC{2,biased}/QC{2,corrected} = "<<(fCumulants[pW][eW][0]->GetBinContent(1))/(fCumulants[pW][eW][1]->GetBinContent(1))<<endl; |
| 5694 | } |
| 5695 | if(fCumulants[pW][eW][1]->GetBinContent(2)) |
| 5696 | { |
| 5697 | cout<<" QC{4,biased}/QC{4,corrected} = "<<fCumulants[pW][eW][0]->GetBinContent(2)/fCumulants[pW][eW][1]->GetBinContent(2)<<endl; |
| 5698 | } |
| 5699 | |
| 5700 | cout<<endl; |
| 5701 | |
| 5702 | } // end of AliFlowAnalysisWithQCumulants::PrintQuantifyingCorrectionsForNonUniformAcceptance(Bool_t useParticleWeights, TString eventWeights) |
| 2bdc5281 |
5703 | |
| 5704 | |
| 5705 | //================================================================================================================================ |
| 5706 | |
| 5707 | |
| 2aa4ebcd |
5708 | void AliFlowAnalysisWithQCumulants::CalculateWeightedCorrelationsForIntegratedFlow() |
| 2bdc5281 |
5709 | { |
| 2aa4ebcd |
5710 | // calculate all weighted correlations needed for integrated flow and store them in 1D profile fQCorrelations[1][eW] and fQExtraCorrelations[1][eW] |
| 5711 | |
| 5712 | for(Int_t eW=0;eW<2;eW++) |
| 2bdc5281 |
5713 | { |
| 2aa4ebcd |
5714 | if(!(fQCorrelationsEBE[1] && fQCorrelations[1][eW])) |
| 5715 | { |
| 5716 | cout<<"WARNING: fQCorrelationsEBE[1] && fQCorrelations[1][eW] is NULL in AFAWQC::CWCFIF() !!!!"<<endl; |
| 5717 | cout<<"eW = "<<eW<<endl; |
| 5718 | exit(0); |
| 5719 | } |
| 5720 | } |
| 5721 | |
| 5722 | // Remark 1: binning of fQCorrelations[W] is organized as follows: |
| 5723 | //.............................................................................................. |
| 5724 | // ---- bins 1-20: 2-particle correlations ---- |
| 5725 | // 1st bin: two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))> |
| 5726 | // 2nd bin: two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))> |
| 5727 | // 3rd bin: two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> |
| 5728 | // 4th bin: two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))> |
| 5729 | // 5th bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))> |
| 5730 | // 6th bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> |
| 5731 | // ---- bins 21-40: 3-particle correlations ---- |
| 5732 | // 21st bin: three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> |
| 5733 | // ---- bins 41-60: 4-particle correlations ---- |
| 5734 | // 41st bin: four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> |
| 5735 | // ---- bins 61-80: 5-particle correlations ---- |
| 5736 | // ---- bins 81-100: 6-particle correlations ---- |
| 5737 | // ---- bins 101-120: 7-particle correlations ---- |
| 5738 | // ---- bins 121-140: 8-particle correlations ---- |
| 5739 | //.............................................................................................. |
| 5740 | |
| 5741 | // multiplicity (number of particles used to determine the reaction plane) |
| 5742 | Double_t dMult = (*fSMpk)(0,0); |
| 5743 | |
| 5744 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: |
| 5745 | Double_t dReQ1n1k = (*fReQ)(0,1); |
| 5746 | Double_t dReQ2n2k = (*fReQ)(1,2); |
| 5747 | Double_t dReQ3n3k = (*fReQ)(2,3); |
| 5748 | Double_t dReQ4n4k = (*fReQ)(3,4); |
| 5749 | Double_t dReQ1n3k = (*fReQ)(0,3); |
| 5750 | Double_t dImQ1n1k = (*fImQ)(0,1); |
| 5751 | Double_t dImQ2n2k = (*fImQ)(1,2); |
| 5752 | Double_t dImQ3n3k = (*fImQ)(2,3); |
| 5753 | Double_t dImQ4n4k = (*fImQ)(3,4); |
| 5754 | Double_t dImQ1n3k = (*fImQ)(0,3); |
| 5755 | |
| 5756 | // dMs are variables introduced in order to simplify some Eqs. bellow: |
| 5757 | //.............................................................................................. |
| 5758 | Double_t dM11 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
| 5759 | Double_t dM22 = (*fSMpk)(1,2)-(*fSMpk)(0,4); // dM22 = sum_{i,j=1,i!=j}^M w_i^2 w_j^2 |
| 5760 | Double_t dM33 = (*fSMpk)(1,3)-(*fSMpk)(0,6); // dM33 = sum_{i,j=1,i!=j}^M w_i^3 w_j^3 |
| 5761 | Double_t dM44 = (*fSMpk)(1,4)-(*fSMpk)(0,8); // dM44 = sum_{i,j=1,i!=j}^M w_i^4 w_j^4 |
| 5762 | Double_t dM31 = (*fSMpk)(0,3)*(*fSMpk)(0,1)-(*fSMpk)(0,4); // dM31 = sum_{i,j=1,i!=j}^M w_i^3 w_j |
| 5763 | Double_t dM211 = (*fSMpk)(0,2)*(*fSMpk)(1,1)-2.*(*fSMpk)(0,3)*(*fSMpk)(0,1) |
| 5764 | - (*fSMpk)(1,2)+2.*(*fSMpk)(0,4); // dM211 = sum_{i,j,k=1,i!=j!=k}^M w_i^2 w_j w_k |
| 5765 | Double_t dM1111 = (*fSMpk)(3,1)-6.*(*fSMpk)(0,2)*(*fSMpk)(1,1) |
| 5766 | + 8.*(*fSMpk)(0,3)*(*fSMpk)(0,1) |
| 5767 | + 3.*(*fSMpk)(1,2)-6.*(*fSMpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l |
| 5768 | //.............................................................................................. |
| 5769 | |
| 5770 | // *********************************************** |
| 5771 | // **** weighted multi-particle correlations: **** |
| 5772 | // *********************************************** |
| 5773 | //.............................................................................................. |
| 5774 | // weighted 2-particle correlations: |
| 5775 | Double_t two1n1nW1W1 = 0.; // <w1 w2 cos(n*(phi1-phi2))> |
| 5776 | Double_t two2n2nW2W2 = 0.; // <w1^2 w2^2 cos(2n*(phi1-phi2))> |
| 5777 | Double_t two3n3nW3W3 = 0.; // <w1^3 w2^3 cos(3n*(phi1-phi2))> |
| 5778 | Double_t two4n4nW4W4 = 0.; // <w1^4 w2^4 cos(4n*(phi1-phi2))> |
| 5779 | Double_t two1n1nW3W1 = 0.; // <w1^3 w2 cos(n*(phi1-phi2))> |
| 5780 | Double_t two1n1nW1W1W2 = 0.; // <w1 w2 w3^2 cos(n*(phi1-phi2))> |
| 5781 | |
| 5782 | if(dMult>1) |
| 5783 | { |
| 5784 | if(dM11) |
| 5785 | { |
| 5786 | two1n1nW1W1 = (pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSMpk)(0,2))/dM11; |
| 2bdc5281 |
5787 | |
| 2aa4ebcd |
5788 | // average weighted correlation <w1 w2 cos(n*(phi1-phi2))> for single event: |
| 5789 | fQCorrelationsEBE[1]->SetBinContent(1,two1n1nW1W1); |
| 5790 | |
| 5791 | // average weighted correlation <w1 w2 cos(n*(phi1-phi2))> for all events: |
| 5792 | //fQCorrelationsW->Fill(0.,two1n1nW1W1,dM11); |
| 5793 | fQCorrelations[1][0]->Fill(0.5,two1n1nW1W1,dM11); |
| 5794 | } |
| 5795 | if(dM22) |
| 5796 | { |
| 5797 | two2n2nW2W2 = (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)-(*fSMpk)(0,4))/dM22; |
| 5798 | //fQCorrelationsW->Fill(1.,two2n2nW2W2,dM22); |
| 5799 | fQCorrelations[1][0]->Fill(1.5,two2n2nW2W2,dM22); |
| 5800 | } |
| 5801 | if(dM33) |
| 5802 | { |
| 5803 | two3n3nW3W3 = (pow(dReQ3n3k,2)+pow(dImQ3n3k,2)-(*fSMpk)(0,6))/dM33; |
| 5804 | //fQCorrelationsW->Fill(2.,two3n3nW3W3,dM33); |
| 5805 | fQCorrelations[1][0]->Fill(2.5,two3n3nW3W3,dM33); |
| 5806 | } |
| 5807 | if(dM44) |
| 5808 | { |
| 5809 | two4n4nW4W4 = (pow(dReQ4n4k,2)+pow(dImQ4n4k,2)-(*fSMpk)(0,8))/dM44; |
| 5810 | //fQCorrelationsW->Fill(3.,two4n4nW4W4,dM44); |
| 5811 | fQCorrelations[1][0]->Fill(3.5,two4n4nW4W4,dM44); |
| 5812 | } |
| 5813 | if(dM31) |
| 5814 | { |
| 5815 | two1n1nW3W1 = (dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k-(*fSMpk)(0,4))/dM31; |
| 5816 | //fQCorrelationsW->Fill(4.,two1n1nW3W1,dM31); |
| 5817 | } |
| 5818 | if(dM211) |
| 5819 | { |
| 5820 | two1n1nW1W1W2 = ((*fSMpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSMpk)(0,2)) |
| 5821 | - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k |
| 5822 | - (*fSMpk)(0,4)))/dM211; |
| 5823 | //fQCorrelationsW->Fill(5.,two1n1nW1W1W2,dM211); |
| 5824 | } |
| 5825 | } // end of if(dMult>1) |
| 5826 | //.............................................................................................. |
| 5827 | |
| 5828 | //.............................................................................................. |
| 5829 | // weighted 3-particle correlations: |
| 5830 | Double_t three2n1n1nW2W1W1 = 0.; // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> |
| 5831 | |
| 5832 | if(dMult>2) |
| 5833 | { |
| 5834 | if(dM211) |
| 5835 | { |
| 5836 | three2n1n1nW2W1W1 = (pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k |
| 5837 | - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k) |
| 5838 | - pow(dReQ2n2k,2)-pow(dImQ2n2k,2) |
| 5839 | + 2.*(*fSMpk)(0,4))/dM211; |
| 5840 | //fQCorrelationsW->Fill(20.,three2n1n1nW2W1W1,dM211); |
| 5841 | } |
| 5842 | } // end of if(dMult>2) |
| 5843 | //.............................................................................................. |
| 5844 | |
| 5845 | //.............................................................................................. |
| 5846 | // weighted 4-particle correlations: |
| 5847 | Double_t four1n1n1n1nW1W1W1W1 = 0.; // <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> |
| 5848 | if(dMult>3) |
| 5849 | { |
| 5850 | if(dM1111) |
| 5851 | { |
| 5852 | four1n1n1n1nW1W1W1W1 = (pow(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.),2) |
| 5853 | - 2.*(pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k) |
| 5854 | + 8.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k) |
| 5855 | + (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)) |
| 5856 | - 4.*(*fSMpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
| 5857 | - 6.*(*fSMpk)(0,4)+2.*(*fSMpk)(1,2))/dM1111; |
| 5858 | |
| 5859 | // average weighted correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for single event: |
| 5860 | fQCorrelationsEBE[1]->SetBinContent(11,four1n1n1n1nW1W1W1W1); |
| 5861 | |
| 5862 | // average weighted correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for all events: |
| 5863 | //fQCorrelationsW->Fill(40.,four1n1n1n1nW1W1W1W1,dM1111); |
| 5864 | |
| 5865 | fQCorrelations[1][0]->Fill(10.5,four1n1n1n1nW1W1W1W1,dM1111); |
| 5866 | } |
| 5867 | } // end of if(dMult>3) |
| 5868 | //.............................................................................................. |
| 2bdc5281 |
5869 | |
| 2aa4ebcd |
5870 | } // end of AliFlowAnalysisWithQCumulants::CalculateWeightedCorrelationsForIntegratedFlow() |
| c365fe76 |
5871 | |
| 5872 | |
| 5873 | //================================================================================================================================ |
| 5874 | |
| 5875 | |
| 2aa4ebcd |
5876 | void AliFlowAnalysisWithQCumulants::CalculateWeightedQProductsForIntFlow() // to be improved (completed) |
| 9c1a9547 |
5877 | { |
| 2aa4ebcd |
5878 | // calculate averages like <<2><4>>, <<2><6>>, <<4><6>>, etc. which are needed to calculate covariances |
| 5879 | // Remark: here we take weighted correlations! |
| 9c1a9547 |
5880 | |
| 2aa4ebcd |
5881 | // binning of fQProductsW is organized as follows: |
| 5882 | // |
| 5883 | // 1st bin: <2><4> |
| 5884 | // 2nd bin: <2><6> |
| 5885 | // 3rd bin: <2><8> |
| 5886 | // 4th bin: <4><6> |
| 5887 | // 5th bin: <4><8> |
| 5888 | // 6th bin: <6><8> |
| 9c1a9547 |
5889 | |
| 2aa4ebcd |
5890 | Double_t dMult = (*fSMpk)(0,0); // multiplicity (number of particles used to determine the reaction plane) |
| 9c1a9547 |
5891 | |
| 2aa4ebcd |
5892 | Double_t dM11 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
| 5893 | Double_t dM1111 = (*fSMpk)(3,1)-6.*(*fSMpk)(0,2)*(*fSMpk)(1,1) |
| 5894 | + 8.*(*fSMpk)(0,3)*(*fSMpk)(0,1) |
| 5895 | + 3.*(*fSMpk)(1,2)-6.*(*fSMpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l |
| 5896 | |
| 5897 | Double_t twoEBEW = 0.; // <2> |
| 5898 | Double_t fourEBEW = 0.; // <4> |
| c365fe76 |
5899 | |
| 2aa4ebcd |
5900 | twoEBEW = fQCorrelationsEBE[1]->GetBinContent(1); |
| 5901 | fourEBEW = fQCorrelationsEBE[1]->GetBinContent(11); |
| c365fe76 |
5902 | |
| 2aa4ebcd |
5903 | // <2><4> |
| 5904 | if(dMult>3) |
| 5905 | { |
| 5906 | fQProducts[1][0]->Fill(0.5,twoEBEW*fourEBEW,dM11*dM1111); |
| cad7c05a |
5907 | } |
| 5908 | |
| 2aa4ebcd |
5909 | } // end of AliFlowAnalysisWithQCumulants::CalculateWeightedQProductsForIntFlow() |
| 5910 | |
| 5911 | |
| 5912 | //================================================================================================================================ |
| 5913 | |
| 5914 | |
| 5915 | void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow() |
| 5916 | { |
| 5917 | // initialize all arrays needed to calculate the integrated flow |
| 9c1a9547 |
5918 | |
| 2aa4ebcd |
5919 | for(Int_t pW=0;pW<1+(Int_t)(fUsePhiWeights||fUsePtWeights||fUseEtaWeights);pW++) // not weighted or weighted |
| 9c1a9547 |
5920 | { |
| 2aa4ebcd |
5921 | fQCorrelationsEBE[pW] = NULL; |
| 5922 | for(Int_t sc=0;sc<2;sc++) |
| 9c1a9547 |
5923 | { |
| 2aa4ebcd |
5924 | fQCorrectionsEBE[pW][sc] = NULL; |
| 9c1a9547 |
5925 | } |
| 2aa4ebcd |
5926 | for(Int_t eW=0;eW<2;eW++) |
| 9c1a9547 |
5927 | { |
| 2aa4ebcd |
5928 | // profiles: |
| 5929 | fQCorrelations[pW][eW] = NULL; |
| 5930 | fQProducts[pW][eW] = NULL; |
| 5931 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms |
| 5932 | { |
| 5933 | fQCorrections[pW][eW][sc] = NULL; |
| 5934 | } |
| 5935 | // histograms with results: |
| 5936 | fCorrelations[pW][eW] = NULL; |
| 5937 | fCovariances[pW][eW] = NULL; |
| 5938 | fCorrections[pW][eW] = NULL; |
| c2a42ea2 |
5939 | fProductOfEventWeights[pW][eW] = NULL; |
| 5940 | for(Int_t power=0;power<2;power++) |
| 5941 | { |
| 5942 | fSumOfEventWeights[pW][eW][power] = NULL; |
| 5943 | } |
| 2aa4ebcd |
5944 | for(Int_t nua=0;nua<2;nua++) // not corrected or corrected |
| 5945 | { |
| 5946 | fCumulants[pW][eW][nua] = NULL; |
| 5947 | fIntFlow[pW][eW][nua] = NULL; |
| 5948 | } |
| 9c1a9547 |
5949 | } |
| 9c1a9547 |
5950 | } |
| 4057ba99 |
5951 | |
| 2aa4ebcd |
5952 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow() |
| 9c1a9547 |
5953 | |
| 5954 | |
| 5955 | //================================================================================================================================ |
| 5956 | |
| 5957 | |
| 2aa4ebcd |
5958 | void AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow() |
| 9c1a9547 |
5959 | { |
| 2aa4ebcd |
5960 | // initialize all arrays needed to calcualted differential flow |
| 4057ba99 |
5961 | |
| 2aa4ebcd |
5962 | // nested lists in fDiffFlowProfiles: |
| 5963 | for(Int_t t=0;t<2;t++) |
| 9c1a9547 |
5964 | { |
| 2aa4ebcd |
5965 | fDFPType[t] = NULL; |
| 5966 | for(Int_t pW=0;pW<1+(Int_t)(fUsePhiWeights||fUsePtWeights||fUseEtaWeights);pW++) |
| 5967 | { |
| 5968 | fDFPParticleWeights[t][pW] = NULL; |
| 5969 | for(Int_t eW=0;eW<2;eW++) |
| 5970 | { |
| 5971 | fDFPEventWeights[t][pW][eW] = NULL; |
| 5972 | fDiffFlowCorrelations[t][pW][eW] = NULL; |
| 5973 | fDiffFlowProductsOfCorrelations[t][pW][eW] = NULL; |
| 5974 | for(Int_t sc=0;sc<2;sc++) |
| 5975 | { |
| 5976 | fDiffFlowCorrectionTerms[t][pW][eW][sc] = NULL; |
| 5977 | } |
| 5978 | } |
| 5979 | } |
| 5980 | } |
| 3d824203 |
5981 | |
| 2aa4ebcd |
5982 | // profiles in nested lists in fDiffFlowProfiles: |
| 5983 | for(Int_t t=0;t<2;t++) // type: RP or POI |
| 9c1a9547 |
5984 | { |
| 2aa4ebcd |
5985 | for(Int_t pW=0;pW<1+(Int_t)(fUsePhiWeights||fUsePtWeights||fUseEtaWeights);pW++) // particle weights: not used or used |
| 9c1a9547 |
5986 | { |
| 2aa4ebcd |
5987 | for(Int_t eW=0;eW<2;eW++) |
| 5988 | { |
| 5989 | // correlations: |
| 5990 | for(Int_t correlationIndex=0;correlationIndex<4;correlationIndex++) |
| 5991 | { |
| 5992 | fCorrelationsPro[t][pW][eW][correlationIndex] = NULL; |
| 5993 | } |
| 5994 | // products of correlations: |
| 5995 | for(Int_t productOfCorrelationsIndex=0;productOfCorrelationsIndex<6;productOfCorrelationsIndex++) |
| 5996 | { |
| 5997 | fProductsOfCorrelationsPro[t][pW][eW][productOfCorrelationsIndex] = NULL; |
| 5998 | } |
| 5999 | // correction terms: |
| 6000 | for(Int_t sc=0;sc<2;sc++) |
| 6001 | { |
| 6002 | for(Int_t correctionsIndex=0;correctionsIndex<2;correctionsIndex++) |
| 6003 | { |
| 6004 | fCorrectionTermsPro[t][pW][eW][sc][correctionsIndex] = NULL; |
| 6005 | } |
| 6006 | } |
| 6007 | } |
| 9c1a9547 |
6008 | } |
| 2aa4ebcd |
6009 | } |
| 6010 | |
| 6011 | // nested lists in fDiffFlowResults: |
| 6012 | for(Int_t t=0;t<2;t++) |
| 6013 | { |
| 6014 | fDFRType[t] = NULL; |
| 6015 | for(Int_t pW=0;pW<1+(Int_t)(fUsePhiWeights||fUsePtWeights||fUseEtaWeights);pW++) |
| 9c1a9547 |
6016 | { |
| 2aa4ebcd |
6017 | fDFRParticleWeights[t][pW] = NULL; |
| 6018 | for(Int_t eW=0;eW<2;eW++) |
| 6019 | { |
| 6020 | fDFREventWeights[t][pW][eW] = NULL; |
| 6021 | fDiffFlowFinalCorrelations[t][pW][eW] = NULL; |
| 6022 | fDiffFlowFinalCorrections[t][pW][eW] = NULL; |
| 6023 | fDiffFlowFinalCovariances[t][pW][eW] = NULL; |
| 6024 | for(Int_t nua=0;nua<2;nua++) |
| 6025 | { |
| 6026 | fDFRCorrections[t][pW][eW][nua] = NULL; |
| 6027 | fDiffFlowFinalCumulants[t][pW][eW][nua] = NULL; |
| 6028 | fDiffFlowFinalFlow[t][pW][eW][nua] = NULL; |
| 6029 | } |
| 6030 | } |
| 9c1a9547 |
6031 | } |
| 6032 | } |
| 2aa4ebcd |
6033 | |
| 6034 | // 2D and 1D histograms in nested lists in fDiffFlowResults: |
| 6035 | for(Int_t t=0;t<2;t++) |
| 9c1a9547 |
6036 | { |
| 2aa4ebcd |
6037 | fNonEmptyBins2D[t] = NULL; |
| 6038 | for(Int_t pe=0;pe<2;pe++) |
| 9c1a9547 |
6039 | { |
| 2aa4ebcd |
6040 | fNonEmptyBins1D[t][pe] = NULL; |
| 9c1a9547 |
6041 | } |
| 2aa4ebcd |
6042 | for(Int_t pW=0;pW<1+(Int_t)(fUsePhiWeights||fUsePtWeights||fUseEtaWeights);pW++) |
| 9c1a9547 |
6043 | { |
| 2aa4ebcd |
6044 | for(Int_t eW=0;eW<2;eW++) |
| 6045 | { |
| 6046 | // correlations: |
| 6047 | for(Int_t correlationIndex=0;correlationIndex<4;correlationIndex++) |
| 6048 | { |
| 6049 | fFinalCorrelations2D[t][pW][eW][correlationIndex] = NULL; |
| 6050 | for(Int_t pe=0;pe<2;pe++) |
| 6051 | { |
| 6052 | fFinalCorrelations1D[t][pW][eW][pe][correlationIndex] = NULL; |
| 6053 | } |
| 6054 | } |
| 6055 | // corrections: |
| 6056 | for(Int_t correctionIndex=0;correctionIndex<4;correctionIndex++) |
| 6057 | { |
| 6058 | fFinalCorrections2D[t][pW][eW][correctionIndex] = NULL; |
| 6059 | for(Int_t pe=0;pe<2;pe++) |
| 6060 | { |
| 6061 | fFinalCorrections1D[t][pW][eW][pe][correctionIndex] = NULL; |
| 6062 | } |
| 6063 | } |
| 6064 | // covariances: |
| 6065 | for(Int_t covarianceIndex=0;covarianceIndex<4;covarianceIndex++) |
| 6066 | { |
| 6067 | fFinalCovariances2D[t][pW][eW][covarianceIndex] = NULL; |
| 6068 | for(Int_t pe=0;pe<2;pe++) |
| 6069 | { |
| 6070 | fFinalCovariances1D[t][pW][eW][pe][covarianceIndex] = NULL; |
| 6071 | } |
| 6072 | } |
| 6073 | for(Int_t nua=0;nua<2;nua++) |
| 6074 | { |
| 6075 | // cumulants: |
| 6076 | for(Int_t cumulantIndex=0;cumulantIndex<4;cumulantIndex++) |
| 6077 | { |
| 6078 | fFinalCumulants2D[t][pW][eW][nua][cumulantIndex] = NULL; |
| 6079 | fFinalCumulantsPt[t][pW][eW][nua][cumulantIndex] = NULL; |
| 6080 | fFinalCumulantsEta[t][pW][eW][nua][cumulantIndex] = NULL; |
| 6081 | } |
| 6082 | // final flow: |
| 6083 | for(Int_t finalFlowIndex=0;finalFlowIndex<4;finalFlowIndex++) |
| 6084 | { |
| 6085 | fFinalFlow2D[t][pW][eW][nua][finalFlowIndex] = NULL; |
| 6086 | fFinalFlowPt[t][pW][eW][nua][finalFlowIndex] = NULL; |
| 6087 | fFinalFlowEta[t][pW][eW][nua][finalFlowIndex] = NULL; |
| 6088 | } |
| 6089 | } |
| 6090 | } |
| 6091 | } |
| 6092 | } |
| 3d824203 |
6093 | |
| 2aa4ebcd |
6094 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) |
| 9c1a9547 |
6095 | { |
| 2aa4ebcd |
6096 | for(Int_t m=0;m<4;m++) // multiple of harmonic |
| 6097 | { |
| 6098 | for(Int_t k=0;k<9;k++) // power of weight |
| 6099 | { |
| 6100 | fReEBE[t][m][k] = NULL; |
| 6101 | fImEBE[t][m][k] = NULL; |
| 6102 | fs[t][k] = NULL; // to be improved (this doesn't need to be within loop over m) |
| 6103 | } |
| 6104 | } |
| 6105 | } |
| 9c1a9547 |
6106 | |
| 2aa4ebcd |
6107 | } // end of AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow() |
| 9c1a9547 |
6108 | |
| 2aa4ebcd |
6109 | |
| 6110 | //================================================================================================================================ |
| 6111 | |
| 6112 | |
| 6113 | void AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow() |
| 6114 | { |
| 6115 | // organize and book everything needed for differential flow |
| 6116 | |
| 6117 | // book and nest all lists belonging to the list fDiffFlowProfiles "Profiles": |
| 6118 | TList list; // to be improved (do I need this here?) |
| 6119 | list.SetOwner(kTRUE); // to be improved (do I need this here?) |
| 6120 | TString typeFlag[2] = {"RP","POI"}; // to be improved (do I need this here?) |
| 6121 | TString pWeightsFlag[2] = {"not used","used"}; // to be improved (do I need this here?) |
| 6122 | TString eWeightsFlag[2] = {"exact","non-exact"}; // to be improved (do I need this here?) |
| 6123 | //TString sinCosFlag[2] = {"sin","cos"}; // to be improved (do I need this here?) |
| 6124 | TString nuaFlag[2] = {"not corrected","corrected"}; // nua = non-uniform acceptance // to be improved (do I need this here?) |
| 6125 | |
| 6126 | // book all 2D profiles and add to appropriate lists: |
| 6127 | TProfile2D styleProfile("","",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 6128 | styleProfile.SetXTitle("p_{t}"); |
| 6129 | styleProfile.SetYTitle("#eta"); |
| 6130 | TString correlationName[4] = {"<2'>","<4'>","<6'>","<8'>"}; |
| 6131 | TString cumulantName[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; |
| 6132 | TString productOfCorrelationsName[5] = {"<2><2'>","<2><4'>","<4><2'>","<4><4'>","<2'><4'>"}; |
| 6133 | TString correctionsSinTermsName[2] = {"sin(1)","sin(2)"}; |
| 6134 | TString correctionsCosTermsName[2] = {"cos(1)","cos(2)"}; |
| 6135 | TString correctionName[4] = {"corr. to QC{2'}","corr. to QC{4'}","corr. to QC{6'}","corr. to QC{8'}"}; |
| 6136 | TString covarianceName[4] = {"Cov(2,2')","Cov(2,4')","Cov(2',4')","Cov(4,2')"}; // to be improved (reorganized) |
| 6137 | TString flowName[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; |
| 6138 | |
| 6139 | for(Int_t t=0;t<2;t++) // type: RP or POI |
| 6140 | { |
| 6141 | for(Int_t pW=0;pW<1+(Int_t)(fUsePhiWeights||fUsePtWeights||fUseEtaWeights);pW++) // weights: not used or used |
| 9c1a9547 |
6142 | { |
| 2aa4ebcd |
6143 | for(Int_t eW=0;eW<2;eW++) |
| 6144 | { |
| 6145 | // correlations: |
| 6146 | for(Int_t correlationIndex=0;correlationIndex<4;correlationIndex++) |
| 6147 | { |
| 6148 | fCorrelationsPro[t][pW][eW][correlationIndex] = (TProfile2D*)styleProfile.Clone(correlationName[correlationIndex].Data()); |
| 6149 | fCorrelationsPro[t][pW][eW][correlationIndex]->SetTitle(correlationName[correlationIndex].Data()); |
| 6150 | fDiffFlowCorrelations[t][pW][eW]->Add(fCorrelationsPro[t][pW][eW][correlationIndex]); |
| 6151 | } |
| 6152 | // products of correlations: |
| 6153 | for(Int_t productOfCorrelationsIndex=0;productOfCorrelationsIndex<5;productOfCorrelationsIndex++) |
| 6154 | { |
| 6155 | fProductsOfCorrelationsPro[t][pW][eW][productOfCorrelationsIndex] = (TProfile2D*)styleProfile.Clone(productOfCorrelationsName[productOfCorrelationsIndex].Data()); |
| 6156 | fProductsOfCorrelationsPro[t][pW][eW][productOfCorrelationsIndex]->SetTitle(productOfCorrelationsName[productOfCorrelationsIndex].Data()); |
| 6157 | fDiffFlowProductsOfCorrelations[t][pW][eW]->Add(fProductsOfCorrelationsPro[t][pW][eW][productOfCorrelationsIndex]); |
| 6158 | } |
| 6159 | // correction terms: |
| 6160 | for(Int_t sc=0;sc<2;sc++) |
| 6161 | { |
| 6162 | for(Int_t correctionsIndex=0;correctionsIndex<2;correctionsIndex++) |
| 6163 | { |
| 6164 | if(sc==0) |
| 6165 | { |
| 6166 | fCorrectionTermsPro[t][pW][eW][sc][correctionsIndex] = (TProfile2D*)styleProfile.Clone(correctionsSinTermsName[correctionsIndex].Data()); |
| 6167 | fCorrectionTermsPro[t][pW][eW][sc][correctionsIndex]->SetTitle(correctionsSinTermsName[correctionsIndex].Data()); |
| 6168 | fDiffFlowCorrectionTerms[t][pW][eW][sc]->Add(fCorrectionTermsPro[t][pW][eW][sc][correctionsIndex]); |
| 6169 | } |
| 6170 | if(sc==1) |
| 6171 | { |
| 6172 | fCorrectionTermsPro[t][pW][eW][sc][correctionsIndex] = (TProfile2D*)styleProfile.Clone(correctionsCosTermsName[correctionsIndex].Data()); |
| 6173 | fCorrectionTermsPro[t][pW][eW][sc][correctionsIndex]->SetTitle(correctionsCosTermsName[correctionsIndex].Data()); |
| 6174 | fDiffFlowCorrectionTerms[t][pW][eW][sc]->Add(fCorrectionTermsPro[t][pW][eW][sc][correctionsIndex]); |
| 6175 | } |
| 6176 | } |
| 6177 | } |
| 6178 | } |
| 6179 | } |
| 6180 | } |
| 6181 | |
| 6182 | // book all 2D and 1D histograms for final results and store them in appropriate lists: |
| 6183 | TH2D styleHistPtEta("","",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 6184 | styleHistPtEta.SetXTitle("p_{t}"); |
| 6185 | styleHistPtEta.SetYTitle("#eta"); |
| 6186 | TH1D styleHistPt("","",fnBinsPt,fPtMin,fPtMax); |
| 6187 | styleHistPt.SetXTitle("p_{t}"); |
| 6188 | TH1D styleHistEta("","",fnBinsEta,fEtaMin,fEtaMax); |
| 6189 | styleHistEta.SetXTitle("#eta"); |
| 6190 | for(Int_t t=0;t<2;t++) // RP or POI |
| 6191 | { |
| 6192 | // 2D: |
| 6193 | fNonEmptyBins2D[t] = (TH2D*)styleHistPtEta.Clone(Form("%s, (p_{t},#eta)",typeFlag[t].Data())); |
| 6194 | fNonEmptyBins2D[t]->SetTitle(Form("Non-empty bins: %s (p_{t},#eta)",typeFlag[t].Data())); |
| 6195 | fDFRType[t]->Add(fNonEmptyBins2D[t]); |
| 6196 | // 1D: |
| 6197 | fNonEmptyBins1D[t][0] = (TH1D*)styleHistPt.Clone(Form("%s, p_{t}",typeFlag[t].Data())); |
| 6198 | fNonEmptyBins1D[t][0]->SetTitle(Form("Non-empty bins: %s (p_{t})",typeFlag[t].Data())); |
| 6199 | fDFRType[t]->Add(fNonEmptyBins1D[t][0]); |
| 6200 | fNonEmptyBins1D[t][1] = (TH1D*)styleHistEta.Clone(Form("%s, #eta",typeFlag[t].Data())); |
| 6201 | fNonEmptyBins1D[t][1]->SetTitle(Form("Non-empty bins: %s (#eta)",typeFlag[t].Data())); |
| 6202 | fDFRType[t]->Add(fNonEmptyBins1D[t][1]); |
| 6203 | |
| 6204 | for(Int_t pW=0;pW<1+(Int_t)(fUsePhiWeights||fUsePtWeights||fUseEtaWeights);pW++) // particle weights not used or used |
| 9c1a9547 |
6205 | { |
| 2aa4ebcd |
6206 | for(Int_t eW=0;eW<2;eW++) |
| 6207 | { |
| 6208 | // correlations: |
| 6209 | for(Int_t correlationIndex=0;correlationIndex<4;correlationIndex++) |
| 6210 | { |
| 6211 | // 2D: |
| 6212 | fFinalCorrelations2D[t][pW][eW][correlationIndex] = (TH2D*)styleHistPtEta.Clone(Form("%s, (p_{t},#eta)",correlationName[correlationIndex].Data())); |
| 6213 | fFinalCorrelations2D[t][pW][eW][correlationIndex]->SetTitle(Form("%s (p_{t},#eta): %s, pWeights %s, eWeights %s",correlationName[correlationIndex].Data(),typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data())); |
| 6214 | fDiffFlowFinalCorrelations[t][pW][eW]->Add(fFinalCorrelations2D[t][pW][eW][correlationIndex]); |
| 6215 | // 1D: |
| 6216 | for(Int_t pe=0;pe<2;pe++) // pt or eta: |
| 6217 | { |
| 6218 | if(pe==0) |
| 6219 | { |
| 6220 | fFinalCorrelations1D[t][pW][eW][pe][correlationIndex] = (TH1D*)styleHistPt.Clone(Form("%s, (p_{t})",correlationName[correlationIndex].Data())); |
| 6221 | fFinalCorrelations1D[t][pW][eW][pe][correlationIndex]->SetTitle(Form("%s (p_{t}): %s, pWeights %s, eWeights %s",correlationName[correlationIndex].Data(),typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data())); |
| 6222 | fDiffFlowFinalCorrelations[t][pW][eW]->Add(fFinalCorrelations1D[t][pW][eW][pe][correlationIndex]); |
| 6223 | } |
| 6224 | if(pe==1) |
| 6225 | { |
| 6226 | fFinalCorrelations1D[t][pW][eW][pe][correlationIndex] = (TH1D*)styleHistEta.Clone(Form("%s, (#eta)",correlationName[correlationIndex].Data())); |
| 6227 | fFinalCorrelations1D[t][pW][eW][pe][correlationIndex]->SetTitle(Form("%s (#eta): %s, pWeights %s, eWeights %s",correlationName[correlationIndex].Data(),typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data())); |
| 6228 | fDiffFlowFinalCorrelations[t][pW][eW]->Add(fFinalCorrelations1D[t][pW][eW][pe][correlationIndex]); |
| 6229 | } |
| 6230 | } |
| 6231 | } |
| 6232 | // corrections: |
| 6233 | for(Int_t correctionIndex=0;correctionIndex<4;correctionIndex++) |
| 6234 | { |
| 6235 | // 2D: |
| 6236 | fFinalCorrections2D[t][pW][eW][correctionIndex] = (TH2D*)styleHistPtEta.Clone(Form("%s, (p_{t},#eta)",correctionName[correctionIndex].Data())); |
| 6237 | fFinalCorrections2D[t][pW][eW][correctionIndex]->SetTitle(Form("%s (p_{t},#eta): %s, pWeights %s, eWeights %s",correctionName[correctionIndex].Data(),typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data())); |
| 6238 | fDiffFlowFinalCorrections[t][pW][eW]->Add(fFinalCorrections2D[t][pW][eW][correctionIndex]); |
| 6239 | // 1D: |
| 6240 | for(Int_t pe=0;pe<2;pe++) // pt or eta: |
| 6241 | { |
| 6242 | if(pe==0) |
| 6243 | { |
| 6244 | fFinalCorrections1D[t][pW][eW][pe][correctionIndex] = (TH1D*)styleHistPt.Clone(Form("%s, (p_{t})",correctionName[correctionIndex].Data())); |
| 6245 | fFinalCorrections1D[t][pW][eW][pe][correctionIndex]->SetTitle(Form("%s (p_{t}): %s, pWeights %s, eWeights %s",correctionName[correctionIndex].Data(),typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data())); |
| 6246 | fDiffFlowFinalCorrections[t][pW][eW]->Add(fFinalCorrections1D[t][pW][eW][pe][correctionIndex]); |
| 6247 | } |
| 6248 | if(pe==1) |
| 6249 | { |
| 6250 | fFinalCorrections1D[t][pW][eW][pe][correctionIndex] = (TH1D*)styleHistEta.Clone(Form("%s, (#eta)",correctionName[correctionIndex].Data())); |
| 6251 | fFinalCorrections1D[t][pW][eW][pe][correctionIndex]->SetTitle(Form("%s (#eta): %s, pWeights %s, eWeights %s",correctionName[correctionIndex].Data(),typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data())); |
| 6252 | fDiffFlowFinalCorrections[t][pW][eW]->Add(fFinalCorrections1D[t][pW][eW][pe][correctionIndex]); |
| 6253 | } |
| 6254 | } |
| 6255 | } |
| 6256 | // covariances: |
| 6257 | for(Int_t covarianceIndex=0;covarianceIndex<4;covarianceIndex++) |
| 6258 | { |
| 6259 | // 2D: |
| 6260 | fFinalCovariances2D[t][pW][eW][covarianceIndex] = (TH2D*)styleHistPtEta.Clone(Form("%s, (p_{t},#eta)",covarianceName[covarianceIndex].Data())); |
| 6261 | fFinalCovariances2D[t][pW][eW][covarianceIndex]->SetTitle(Form("%s (p_{t},#eta): %s, pWeights %s, eWeights %s",covarianceName[covarianceIndex].Data(),typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data())); |
| 6262 | fDiffFlowFinalCovariances[t][pW][eW]->Add(fFinalCovariances2D[t][pW][eW][covarianceIndex]); |
| 6263 | // 1D: |
| 6264 | for(Int_t pe=0;pe<2;pe++) // pt or eta: |
| 6265 | { |
| 6266 | if(pe==0) |
| 6267 | { |
| 6268 | fFinalCovariances1D[t][pW][eW][pe][covarianceIndex] = (TH1D*)styleHistPt.Clone(Form("%s, (p_{t})",covarianceName[covarianceIndex].Data())); |
| 6269 | fFinalCovariances1D[t][pW][eW][pe][covarianceIndex]->SetTitle(Form("%s (p_{t}): %s, pWeights %s, eWeights %s",covarianceName[covarianceIndex].Data(),typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data())); |
| 6270 | fDiffFlowFinalCovariances[t][pW][eW]->Add(fFinalCovariances1D[t][pW][eW][pe][covarianceIndex]); |
| 6271 | } |
| 6272 | if(pe==1) |
| 6273 | { |
| 6274 | fFinalCovariances1D[t][pW][eW][pe][covarianceIndex] = (TH1D*)styleHistEta.Clone(Form("%s, (#eta)",covarianceName[covarianceIndex].Data())); |
| 6275 | fFinalCovariances1D[t][pW][eW][pe][covarianceIndex]->SetTitle(Form("%s (#eta): %s, pWeights %s, eWeights %s",covarianceName[covarianceIndex].Data(),typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data())); |
| 6276 | fDiffFlowFinalCovariances[t][pW][eW]->Add(fFinalCovariances1D[t][pW][eW][pe][covarianceIndex]); |
| 6277 | } |
| 6278 | } |
| 6279 | } |
| 6280 | for(Int_t nua=0;nua<2;nua++) // corrected or not |
| 6281 | { |
| 6282 | // cumulants: |
| 6283 | for(Int_t cumulantIndex=0;cumulantIndex<4;cumulantIndex++) |
| 6284 | { |
| 6285 | // 2D: |
| 6286 | fFinalCumulants2D[t][pW][eW][nua][cumulantIndex] = (TH2D*)styleHistPtEta.Clone(Form("%s, (p_{t},#eta)",cumulantName[cumulantIndex].Data())); |
| 6287 | fFinalCumulants2D[t][pW][eW][nua][cumulantIndex]->SetTitle(Form("%s (p_{t},#eta): %s, pWeights %s, eWeights %s, %s for NUA",cumulantName[cumulantIndex].Data(),typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),nuaFlag[nua].Data())); |
| 6288 | fDiffFlowFinalCumulants[t][pW][eW][nua]->Add(fFinalCumulants2D[t][pW][eW][nua][cumulantIndex]); |
| 6289 | // pt: |
| 6290 | fFinalCumulantsPt[t][pW][eW][nua][cumulantIndex] = (TH1D*)styleHistPt.Clone(Form("%s, (p_{t})",cumulantName[cumulantIndex].Data())); |
| 6291 | fFinalCumulantsPt[t][pW][eW][nua][cumulantIndex]->SetTitle(Form("%s (p_{t}): %s, pWeights %s, eWeights %s, %s for NUA",cumulantName[cumulantIndex].Data(),typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),nuaFlag[nua].Data())); |
| 6292 | fDiffFlowFinalCumulants[t][pW][eW][nua]->Add(fFinalCumulantsPt[t][pW][eW][nua][cumulantIndex]); |
| 6293 | // eta: |
| 6294 | fFinalCumulantsEta[t][pW][eW][nua][cumulantIndex] = (TH1D*)styleHistEta.Clone(Form("%s, (#eta)",cumulantName[cumulantIndex].Data())); |
| 6295 | fFinalCumulantsEta[t][pW][eW][nua][cumulantIndex]->SetTitle(Form("%s (#eta): %s, pWeights %s, eWeights %s, %s for NUA",cumulantName[cumulantIndex].Data(),typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),nuaFlag[nua].Data())); |
| 6296 | fDiffFlowFinalCumulants[t][pW][eW][nua]->Add(fFinalCumulantsEta[t][pW][eW][nua][cumulantIndex]); |
| 6297 | } |
| 6298 | // flow: |
| 6299 | for(Int_t flowIndex=0;flowIndex<4;flowIndex++) |
| 6300 | { |
| 6301 | // 2D: |
| 6302 | fFinalFlow2D[t][pW][eW][nua][flowIndex] = (TH2D*)styleHistPtEta.Clone(Form("%s, (p_{t},#eta)",flowName[flowIndex].Data())); |
| 6303 | fFinalFlow2D[t][pW][eW][nua][flowIndex]->SetTitle(Form("%s (p_{t},#eta): %s, pWeights %s, eWeights %s, %s for NUA",flowName[flowIndex].Data(),typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),nuaFlag[nua].Data())); |
| 6304 | fDiffFlowFinalFlow[t][pW][eW][nua]->Add(fFinalFlow2D[t][pW][eW][nua][flowIndex]); |
| 6305 | // pt: |
| 6306 | fFinalFlowPt[t][pW][eW][nua][flowIndex] = (TH1D*)styleHistPt.Clone(Form("%s, (p_{t})",flowName[flowIndex].Data())); |
| 6307 | fFinalFlowPt[t][pW][eW][nua][flowIndex]->SetTitle(Form("%s (p_{t}): %s, pWeights %s, eWeights %s, %s for NUA",flowName[flowIndex].Data(),typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),nuaFlag[nua].Data())); |
| 6308 | fDiffFlowFinalFlow[t][pW][eW][nua]->Add(fFinalFlowPt[t][pW][eW][nua][flowIndex]); |
| 6309 | // eta: |
| 6310 | fFinalFlowEta[t][pW][eW][nua][flowIndex] = (TH1D*)styleHistEta.Clone(Form("%s, (#eta)",flowName[flowIndex].Data())); |
| 6311 | fFinalFlowEta[t][pW][eW][nua][flowIndex]->SetTitle(Form("%s (#eta): %s, pWeights %s, eWeights %s, %s for NUA",flowName[flowIndex].Data(),typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),nuaFlag[nua].Data())); |
| 6312 | fDiffFlowFinalFlow[t][pW][eW][nua]->Add(fFinalFlowEta[t][pW][eW][nua][flowIndex]); |
| 6313 | } |
| 6314 | } |
| 6315 | } |
| 6316 | } |
| 9c1a9547 |
6317 | } |
| 2aa4ebcd |
6318 | |
| 6319 | // Event-by-event r_{m*n,k}(pt,eta), p_{m*n,k}(pt,eta) and q_{m*n,k}(pt,eta) |
| 6320 | // Explanantion of notation: |
| 6321 | // 1.) n is harmonic, m is multiple of harmonic; |
| 6322 | // 2.) k is power of weight; |
| 6323 | // 3.) r_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for RPs in particular (pt,eta) bin (i-th RP is weighted with w_i^k); |
| 6324 | // 4.) p_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for POIs in particular (pt,eta) bin |
| 6325 | // (if i-th POI is also RP, than it is weighted with w_i^k); |
| 6326 | // 5.) q_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for particles which are both RPs and POIs in particular (pt,eta) bin |
| 6327 | // (i-th RP&&POI is weighted with w_i^k) |
| 6328 | |
| 6329 | TProfile2D styleRe("typeMultiplePowerRe","typeMultiplePowerRe",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 6330 | TProfile2D styleIm("typeMultiplePowerIm","typeMultiplePowerIm",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 6331 | |
| 6332 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) |
| 6333 | { |
| 6334 | for(Int_t m=0;m<4;m++) |
| 9c1a9547 |
6335 | { |
| 2aa4ebcd |
6336 | for(Int_t k=0;k<9;k++) |
| 6337 | { |
| 6338 | fReEBE[t][m][k] = (TProfile2D*)styleRe.Clone(Form("typeFlag%dmultiple%dpower%dRe",t,m,k)); |
| 6339 | fImEBE[t][m][k] = (TProfile2D*)styleIm.Clone(Form("typeFlag%dmultiple%dpower%dIm",t,m,k)); |
| 6340 | } |
| 6341 | } |
| 6342 | } |
| 6343 | |
| 6344 | TProfile2D styleS("typePower","typePower",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); |
| 6345 | |
| 6346 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) |
| 6347 | { |
| 6348 | for(Int_t k=0;k<9;k++) |
| 9c1a9547 |
6349 | { |
| 2aa4ebcd |
6350 | fs[t][k] = (TProfile2D*)styleS.Clone(Form("typeFlag%dpower%d",t,k)); |
| 9c1a9547 |
6351 | } |
| 6352 | } |
| 2aa4ebcd |
6353 | |
| 6354 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow() |
| 9c1a9547 |
6355 | |
| 6356 | |
| 2aa4ebcd |
6357 | //================================================================================================================================ |
| 9c1a9547 |
6358 | |
| 6359 | |
| 2aa4ebcd |
6360 | void AliFlowAnalysisWithQCumulants::CalculateCorrelationsForDifferentialFlow(TString type) |
| 9c1a9547 |
6361 | { |
| 2aa4ebcd |
6362 | // calculate all reduced correlations needed for differential flow for each (pt,eta) bin: |
| 3d824203 |
6363 | |
| 2aa4ebcd |
6364 | Int_t typeFlag = -1; |
| 6365 | |
| 6366 | // reduced correlations ares stored in fCorrelationsPro[t][pW][index] and are indexed as follows: |
| 6367 | // index: |
| 6368 | // 0: <2'> |
| 6369 | // 1: <4'> |
| 3c16adde |
6370 | |
| 2aa4ebcd |
6371 | // multiplicity: |
| 6372 | Double_t dMult = (*fSMpk)(0,0); |
| 3c16adde |
6373 | |
| 2aa4ebcd |
6374 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: |
| 6375 | Double_t dReQ1n = (*fReQ)(0,0); |
| 6376 | Double_t dReQ2n = (*fReQ)(1,0); |
| 6377 | //Double_t dReQ3n = (*fReQ)(2,0); |
| 6378 | //Double_t dReQ4n = (*fReQ)(3,0); |
| 6379 | Double_t dImQ1n = (*fImQ)(0,0); |
| 6380 | Double_t dImQ2n = (*fImQ)(1,0); |
| 6381 | //Double_t dImQ3n = (*fImQ)(2,0); |
| 6382 | //Double_t dImQ4n = (*fImQ)(3,0); |
| 3c16adde |
6383 | |
| 2aa4ebcd |
6384 | // looping over all (pt,eta) bins and calculating correlations needed for differential flow: |
| 6385 | for(Int_t p=1;p<=fnBinsPt;p++) |
| 3c16adde |
6386 | { |
| 2aa4ebcd |
6387 | for(Int_t e=1;e<=fnBinsEta;e++) |
| 3c16adde |
6388 | { |
| 2aa4ebcd |
6389 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): |
| 6390 | Double_t p1n0kRe = 0.; |
| 6391 | Double_t p1n0kIm = 0.; |
| 6392 | |
| 6393 | // number of POIs in particular (pt,eta) bin: |
| 6394 | Double_t mp = 0.; |
| 6395 | |
| 6396 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular (pt,eta) bin): |
| 6397 | Double_t q1n0kRe = 0.; |
| 6398 | Double_t q1n0kIm = 0.; |
| 6399 | Double_t q2n0kRe = 0.; |
| 6400 | Double_t q2n0kIm = 0.; |
| 6401 | |
| 6402 | // number of particles which are both RPs and POIs in particular (pt,eta) bin: |
| 6403 | Double_t mq = 0.; |
| 6404 | |
| 6405 | // q_{m*n,0}: |
| 6406 | q1n0kRe = fReEBE[2][0][0]->GetBinContent(fReEBE[2][0][0]->GetBin(p,e)) |
| 6407 | * fReEBE[2][0][0]->GetBinEntries(fReEBE[2][0][0]->GetBin(p,e)); |
| 6408 | q1n0kIm = fImEBE[2][0][0]->GetBinContent(fImEBE[2][0][0]->GetBin(p,e)) |
| 6409 | * fImEBE[2][0][0]->GetBinEntries(fImEBE[2][0][0]->GetBin(p,e)); |
| 6410 | q2n0kRe = fReEBE[2][1][0]->GetBinContent(fReEBE[2][1][0]->GetBin(p,e)) |
| 6411 | * fReEBE[2][1][0]->GetBinEntries(fReEBE[2][1][0]->GetBin(p,e)); |
| 6412 | q2n0kIm = fImEBE[2][1][0]->GetBinContent(fImEBE[2][1][0]->GetBin(p,e)) |
| 6413 | * fImEBE[2][1][0]->GetBinEntries(fImEBE[2][1][0]->GetBin(p,e)); |
| 6414 | |
| 6415 | mq = fReEBE[2][0][0]->GetBinEntries(fReEBE[2][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) |
| 6416 | |
| 6417 | if(type == "POI") |
| 3c16adde |
6418 | { |
| 2aa4ebcd |
6419 | // p_{m*n,0}: |
| 6420 | p1n0kRe = fReEBE[1][0][0]->GetBinContent(fReEBE[1][0][0]->GetBin(p,e)) |
| 6421 | * fReEBE[1][0][0]->GetBinEntries(fReEBE[1][0][0]->GetBin(p,e)); |
| 6422 | p1n0kIm = fImEBE[1][0][0]->GetBinContent(fImEBE[1][0][0]->GetBin(p,e)) |
| 6423 | * fImEBE[1][0][0]->GetBinEntries(fImEBE[1][0][0]->GetBin(p,e)); |
| 6424 | |
| 6425 | mp = fReEBE[1][0][0]->GetBinEntries(fReEBE[1][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) |
| 6426 | |
| 6427 | typeFlag = 1; |
| 6428 | } |
| 6429 | else if(type == "RP") |
| 6430 | { |
| 6431 | // p_{m*n,0} = q_{m*n,0}: |
| 6432 | p1n0kRe = q1n0kRe; |
| 6433 | p1n0kIm = q1n0kIm; |
| 6434 | mp = mq; |
| 6435 | |
| 6436 | typeFlag = 0; |
| 6437 | } |
| 6438 | |
| 6439 | // count events with non-empty (pt,eta) bin: |
| 6440 | if(mp>0) |
| 6441 | { |
| 6442 | fNonEmptyBins2D[typeFlag]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,1); |
| 6443 | } |
| 6444 | |
| 6445 | // 2'-particle correlation for particular (pt,eta) bin: |
| 6446 | Double_t two1n1nPtEta = 0.; |
| 6447 | if(mp*dMult-mq) |
| 6448 | { |
| 6449 | two1n1nPtEta = (p1n0kRe*dReQ1n+p1n0kIm*dImQ1n-mq) |
| 6450 | / (mp*dMult-mq); |
| 6451 | |
| 6452 | // fill the 2D profile to get the average correlation for each (pt,eta) bin: |
| 6453 | if(type == "POI") |
| 6454 | { |
| 6455 | //f2pPtEtaPOI->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mp*dMult-mq); |
| 6456 | |
| 6457 | fCorrelationsPro[1][0][0][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mp*dMult-mq); |
| 6458 | } |
| 6459 | else if(type == "RP") |
| 3c16adde |
6460 | { |
| 2aa4ebcd |
6461 | //f2pPtEtaRP->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mp*dMult-mq); |
| 6462 | fCorrelationsPro[0][0][0][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mp*dMult-mq); |
| 6463 | } |
| 6464 | } // end of if(mp*dMult-mq) |
| 6465 | |
| 6466 | // 4'-particle correlation: |
| 6467 | Double_t four1n1n1n1nPtEta = 0.; |
| 6468 | if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) |
| 6469 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression) |
| 6470 | { |
| 6471 | four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) |
| 6472 | - q2n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) |
| 6473 | - 2.*q2n0kIm*dReQ1n*dImQ1n |
| 6474 | - p1n0kRe*(dReQ1n*dReQ2n+dImQ1n*dImQ2n) |
| 6475 | + p1n0kIm*(dImQ1n*dReQ2n-dReQ1n*dImQ2n) |
| 6476 | - 2.*dMult*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) |
| 6477 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*mq |
| 6478 | + 6.*(q1n0kRe*dReQ1n+q1n0kIm*dImQ1n) |
| 6479 | + 1.*(q2n0kRe*dReQ2n+q2n0kIm*dImQ2n) |
| 6480 | + 2.*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) |
| 6481 | + 2.*mq*dMult |
| 6482 | - 6.*mq) |
| 6483 | / ((mp-mq)*dMult*(dMult-1.)*(dMult-2.) |
| 6484 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 6485 | |
| 6486 | // fill the 2D profile to get the average correlation for each (pt, eta) bin: |
| 6487 | if(type == "POI") |
| 6488 | { |
| 6489 | //f4pPtEtaPOI->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta, |
| 6490 | // (mp-mq)*dMult*(dMult-1.)*(dMult-2.) |
| 6491 | // + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 6492 | |
| 6493 | fCorrelationsPro[1][0][0][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta, |
| 6494 | (mp-mq)*dMult*(dMult-1.)*(dMult-2.) |
| 6495 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 6496 | } |
| 6497 | else if(type == "RP") |
| 6498 | { |
| 6499 | //f4pPtEtaRP->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta, |
| 6500 | // (mp-mq)*dMult*(dMult-1.)*(dMult-2.) |
| 6501 | // + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 6502 | |
| 6503 | fCorrelationsPro[0][0][0][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta, |
| 6504 | (mp-mq)*dMult*(dMult-1.)*(dMult-2.) |
| 6505 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
| 6506 | } |
| 6507 | } // end of if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) |
| 6508 | // +mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
| 6509 | |
| 6510 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) |
| 6511 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
| 9c1a9547 |
6512 | |
| 2aa4ebcd |
6513 | } // end of AliFlowAnalysisWithQCumulants::CalculateCorrelationsForDifferentialFlow() |
| 9c1a9547 |
6514 | |
| 9c1a9547 |
6515 | |
| 2aa4ebcd |
6516 | //================================================================================================================================ |
| 6517 | |
| 6518 | |
| 6519 | void AliFlowAnalysisWithQCumulants::CalculateWeightedCorrelationsForDifferentialFlow(TString type) |
| 6520 | { |
| 6521 | // calculate all weighted correlations needed for differential flow |
| 6522 | |
| 6523 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: |
| 6524 | Double_t dReQ1n1k = (*fReQ)(0,1); |
| 6525 | Double_t dReQ2n2k = (*fReQ)(1,2); |
| 6526 | Double_t dReQ1n3k = (*fReQ)(0,3); |
| 6527 | //Double_t dReQ4n4k = (*fReQ)(3,4); |
| 6528 | Double_t dImQ1n1k = (*fImQ)(0,1); |
| 6529 | Double_t dImQ2n2k = (*fImQ)(1,2); |
| 6530 | Double_t dImQ1n3k = (*fImQ)(0,3); |
| 6531 | //Double_t dImQ4n4k = (*fImQ)(3,4); |
| 9c1a9547 |
6532 | |
| 2aa4ebcd |
6533 | // S^M_{p,k} (see .h file for the definition of fSMpk): |
| 6534 | Double_t dSM1p1k = (*fSMpk)(0,1); |
| 6535 | Double_t dSM1p2k = (*fSMpk)(0,2); |
| 6536 | Double_t dSM1p3k = (*fSMpk)(0,3); |
| 6537 | Double_t dSM2p1k = (*fSMpk)(1,1); |
| 6538 | Double_t dSM3p1k = (*fSMpk)(2,1); |
| 6539 | |
| 6540 | // looping over all (pt,eta) bins and calculating weighted correlations needed for differential flow: |
| 6541 | for(Int_t p=1;p<=fnBinsPt;p++) |
| 9c1a9547 |
6542 | { |
| 2aa4ebcd |
6543 | for(Int_t e=1;e<=fnBinsEta;e++) |
| 9c1a9547 |
6544 | { |
| 2aa4ebcd |
6545 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): |
| 6546 | Double_t p1n0kRe = 0.; |
| 6547 | Double_t p1n0kIm = 0.; |
| 6548 | |
| 6549 | // number of POIs in particular (pt,eta) bin): |
| 6550 | Double_t mp = 0.; |
| 6551 | |
| 6552 | // real and imaginary parts of q_{m*n,k}: |
| 6553 | // (weighted Q-vector evaluated for particles which are both RPs and POIs in particular (pt,eta) bin) |
| 6554 | Double_t q1n2kRe = 0.; |
| 6555 | Double_t q1n2kIm = 0.; |
| 6556 | Double_t q2n1kRe = 0.; |
| 6557 | Double_t q2n1kIm = 0.; |
| 6558 | |
| 6559 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) |
| 6560 | Double_t s1p1k = 0.; |
| 6561 | Double_t s1p2k = 0.; |
| 6562 | Double_t s1p3k = 0.; |
| 2bdc5281 |
6563 | |
| 2aa4ebcd |
6564 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) |
| 6565 | Double_t dM0111 = 0.; |
| 6566 | |
| 6567 | if(type == "POI") |
| 2bdc5281 |
6568 | { |
| 2aa4ebcd |
6569 | // p_{m*n,0}: |
| 6570 | p1n0kRe = fReEBE[1][0][0]->GetBinContent(fReEBE[1][0][0]->GetBin(p,e)) |
| 6571 | * fReEBE[1][0][0]->GetBinEntries(fReEBE[1][0][0]->GetBin(p,e)); |
| 6572 | p1n0kIm = fImEBE[1][0][0]->GetBinContent(fImEBE[1][0][0]->GetBin(p,e)) |
| 6573 | * fImEBE[1][0][0]->GetBinEntries(fImEBE[1][0][0]->GetBin(p,e)); |
| 6574 | |
| 6575 | mp = fReEBE[1][0][0]->GetBinEntries(fReEBE[1][0][0]->GetBin(p,e)); |
| 6576 | |
| 6577 | // q_{m*n,k}: |
| 6578 | q1n2kRe = fReEBE[2][0][2]->GetBinContent(fReEBE[2][0][2]->GetBin(p,e)) |
| 6579 | * fReEBE[2][0][2]->GetBinEntries(fReEBE[2][0][2]->GetBin(p,e)); |
| 6580 | q1n2kIm = fImEBE[2][0][2]->GetBinContent(fImEBE[2][0][2]->GetBin(p,e)) |
| 6581 | * fImEBE[2][0][2]->GetBinEntries(fImEBE[2][0][2]->GetBin(p,e)); |
| 6582 | q2n1kRe = fReEBE[2][1][1]->GetBinContent(fReEBE[2][1][1]->GetBin(p,e)) |
| 6583 | * fReEBE[2][1][1]->GetBinEntries(fReEBE[2][1][1]->GetBin(p,e)); |
| 6584 | q2n1kIm = fImEBE[2][1][1]->GetBinContent(fImEBE[2][1][1]->GetBin(p,e)) |
| 6585 | * fImEBE[2][1][1]->GetBinEntries(fImEBE[2][1][1]->GetBin(p,e)); |
| 6586 | |
| 6587 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) |
| 6588 | s1p1k = pow(fs[2][1]->GetBinContent(fs[2][1]->GetBin(p,e)),1.); |
| 6589 | s1p2k = pow(fs[2][2]->GetBinContent(fs[2][2]->GetBin(p,e)),1.); |
| 6590 | s1p3k = pow(fs[2][3]->GetBinContent(fs[2][3]->GetBin(p,e)),1.); |
| 2bdc5281 |
6591 | |
| 2aa4ebcd |
6592 | // M0111 from Eq. (118) in QC2c (to be improved (notation)): |
| 6593 | dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k) |
| 6594 | - 3.*(s1p1k*(dSM2p1k-dSM1p2k) |
| 6595 | + 2.*(s1p3k-s1p2k*dSM1p1k)); |
| 6596 | } |
| 6597 | else if(type == "RP") |
| 9c1a9547 |
6598 | { |
| 2aa4ebcd |
6599 | p1n0kRe = fReEBE[0][0][0]->GetBinContent(fReEBE[0][0][0]->GetBin(p,e)) |
| 6600 | * fReEBE[0][0][0]->GetBinEntries(fReEBE[0][0][0]->GetBin(p,e)); |
| 6601 | p1n0kIm = fImEBE[0][0][0]->GetBinContent(fImEBE[0][0][0]->GetBin(p,e)) |
| 6602 | * fImEBE[0][0][0]->GetBinEntries(fImEBE[0][0][0]->GetBin(p,e)); |
| 6603 | |
| 6604 | mp = fReEBE[0][0][0]->GetBinEntries(fReEBE[0][0][0]->GetBin(p,e)); |
| 6605 | |
| 6606 | // q_{m*n,k}: |
| 6607 | q1n2kRe = fReEBE[0][0][2]->GetBinContent(fReEBE[0][0][2]->GetBin(p,e)) |
| 6608 | * fReEBE[0][0][2]->GetBinEntries(fReEBE[0][0][2]->GetBin(p,e)); |
| 6609 | q1n2kIm = fImEBE[0][0][2]->GetBinContent(fImEBE[0][0][2]->GetBin(p,e)) |
| 6610 | * fImEBE[0][0][2]->GetBinEntries(fImEBE[0][0][2]->GetBin(p,e)); |
| 6611 | q2n1kRe = fReEBE[0][1][1]->GetBinContent(fReEBE[0][1][1]->GetBin(p,e)) |
| 6612 | * fReEBE[0][1][1]->GetBinEntries(fReEBE[0][1][1]->GetBin(p,e)); |
| 6613 | q2n1kIm = fImEBE[0][1][1]->GetBinContent(fImEBE[0][1][1]->GetBin(p,e)) |
| 6614 | * fImEBE[0][1][1]->GetBinEntries(fImEBE[0][1][1]->GetBin(p,e)); |
| 6615 | |
| 6616 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) |
| 6617 | s1p1k = pow(fs[0][1]->GetBinContent(fs[0][1]->GetBin(p,e)),1.); |
| 6618 | s1p2k = pow(fs[0][2]->GetBinContent(fs[0][2]->GetBin(p,e)),1.); |
| 6619 | s1p3k = pow(fs[0][3]->GetBinContent(fs[0][3]->GetBin(p,e)),1.); |
| 6620 | |
| 6621 | // M0111 from Eq. (118) in QC2c (to be improved (notation)): |
| 6622 | dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k) |
| 6623 | - 3.*(s1p1k*(dSM2p1k-dSM1p2k) |
| 6624 | + 2.*(s1p3k-s1p2k*dSM1p1k)); |
| 6625 | //............................................................................................... |
| 9c1a9547 |
6626 | } |
| 6627 | |
| 2aa4ebcd |
6628 | // 2'-particle correlation: |
| 6629 | Double_t two1n1nW0W1PtEta = 0.; |
| 6630 | if(mp*dSM1p1k-s1p1k) |
| 9c1a9547 |
6631 | { |
| 2aa4ebcd |
6632 | two1n1nW0W1PtEta = (p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k-s1p1k) |
| 6633 | / (mp*dSM1p1k-s1p1k); |
| 6634 | |
| 6635 | // fill the 2D profile to get the average correlation for each (pt, eta) bin: |
| 6636 | if(type == "POI") |
| 9c1a9547 |
6637 | { |
| 2aa4ebcd |
6638 | //f2pPtEtaPOIW->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nW0W1PtEta, |
| 6639 | // mp*dSM1p1k-s1p1k); |
| 6640 | fCorrelationsPro[1][1][0][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nW0W1PtEta,mp*dSM1p1k-s1p1k); |
| 9c1a9547 |
6641 | } |
| 2aa4ebcd |
6642 | else if(type == "RP") |
| 6643 | { |
| 6644 | //f2pPtEtaRPW->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nW0W1PtEta, |
| 6645 | // mp*dSM1p1k-s1p1k); |
| 6646 | fCorrelationsPro[0][1][0][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nW0W1PtEta,mp*dSM1p1k-s1p1k); |
| 6647 | } |
| 6648 | } // end of if(mp*dMult-dmPrimePrimePtEta) |
| 9c1a9547 |
6649 | |
| 2aa4ebcd |
6650 | // 4'-particle correlation: |
| 6651 | Double_t four1n1n1n1nW0W1W1W1PtEta = 0.; |
| 6652 | if(dM0111) |
| 6653 | { |
| 6654 | four1n1n1n1nW0W1W1W1PtEta = ((pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k) |
| 6655 | - q2n1kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.)) |
| 6656 | - 2.*q2n1kIm*dReQ1n1k*dImQ1n1k |
| 6657 | - p1n0kRe*(dReQ1n1k*dReQ2n2k+dImQ1n1k*dImQ2n2k) |
| 6658 | + p1n0kIm*(dImQ1n1k*dReQ2n2k-dReQ1n1k*dImQ2n2k) |
| 6659 | - 2.*dSM1p2k*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k) |
| 6660 | - 2.*(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*s1p1k |
| 6661 | + 6.*(q1n2kRe*dReQ1n1k+q1n2kIm*dImQ1n1k) |
| 6662 | + 1.*(q2n1kRe*dReQ2n2k+q2n1kIm*dImQ2n2k) |
| 6663 | + 2.*(p1n0kRe*dReQ1n3k+p1n0kIm*dImQ1n3k) |
| 6664 | + 2.*s1p1k*dSM1p2k |
| 6665 | - 6.*s1p3k) |
| 6666 | / dM0111; // to be imropoved (notation of dM0111) |
| 9c1a9547 |
6667 | |
| 2aa4ebcd |
6668 | // fill the 2D profile to get the average correlation for each (pt, eta) bin: |
| 6669 | if(type == "POI") |
| 2bdc5281 |
6670 | { |
| 2aa4ebcd |
6671 | //f4pPtEtaPOIW->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nW0W1W1W1PtEta,dM0111); |
| 6672 | fCorrelationsPro[1][1][0][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nW0W1W1W1PtEta,dM0111); |
| 2bdc5281 |
6673 | } |
| 2aa4ebcd |
6674 | else if(type == "RP") |
| 6675 | { |
| 6676 | //f4pPtEtaRPW->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nW0W1W1W1PtEta,dM0111); |
| 6677 | fCorrelationsPro[0][1][0][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nW0W1W1W1PtEta,dM0111); |
| 6678 | } |
| 6679 | } // end of if(dM0111) |
| 2bdc5281 |
6680 | |
| 2aa4ebcd |
6681 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) |
| 6682 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
| 2bdc5281 |
6683 | |
| 2aa4ebcd |
6684 | } // end of AliFlowAnalysisWithQCumulants::CalculateWeightedCorrelationsForDifferentialFlow(TString type) |
| 6685 | |
| 6686 | |
| 6687 | //================================================================================================================================ |
| 6688 | |
| 6689 | |
| 6690 | void AliFlowAnalysisWithQCumulants::FinalizeCorrelationsForDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights) |
| 6691 | { |
| 6692 | // 1.) Access average for 2D correlations from profiles and store them in 2D final results histograms; |
| 6693 | // 2.) Access spread for 2D correlations from profiles, calculate error and store it in 2D final results histograms; |
| 6694 | // 3.) Make projections along pt and eta axis and store results and errors in 1D final results histograms. |
| 6695 | |
| 6696 | Int_t typeFlag = -1; |
| 6697 | Int_t pWeightsFlag = -1; |
| 6698 | Int_t eWeightsFlag = -1; |
| 6699 | |
| 6700 | if(type == "RP") |
| 6701 | { |
| 6702 | typeFlag = 0; |
| 6703 | } else if(type == "POI") |
| 9c1a9547 |
6704 | { |
| 2aa4ebcd |
6705 | typeFlag = 1; |
| 6706 | } else |
| 6707 | { |
| 6708 | cout<<"WARNING: type must be either RP or POI in AFAWQC::FCFDF() !!!!"<<endl; |
| 6709 | exit(0); |
| 6710 | } |
| 6711 | |
| 6712 | if(!useParticleWeights) |
| 6713 | { |
| 6714 | pWeightsFlag = 0; |
| 6715 | } else |
| 9c1a9547 |
6716 | { |
| 2aa4ebcd |
6717 | pWeightsFlag = 1; |
| 6718 | } |
| 9c1a9547 |
6719 | |
| 2aa4ebcd |
6720 | if(eventWeights == "exact") |
| 6721 | { |
| 6722 | eWeightsFlag = 0; |
| 6723 | } |
| 6724 | |
| 6725 | // shortcuts: |
| 6726 | Int_t t = typeFlag; |
| 6727 | Int_t pW = pWeightsFlag; |
| 6728 | Int_t eW = eWeightsFlag; |
| 6729 | |
| 6730 | // from 2D histogram fNonEmptyBins2D make two 1D histograms fNonEmptyBins1D in pt and eta (to be improved (i.e. moved somewhere else)) |
| 6731 | // pt: |
| 6732 | for(Int_t p=1;p<fnBinsPt;p++) |
| 6733 | { |
| 6734 | Double_t contentPt = 0.; |
| 6735 | for(Int_t e=1;e<=fnBinsEta;e++) |
| 6736 | { |
| 6737 | contentPt += (fNonEmptyBins2D[t]->GetBinContent(fNonEmptyBins2D[t]->GetBin(p,e))); |
| 6738 | } |
| 6739 | fNonEmptyBins1D[t][0]->SetBinContent(p,contentPt); |
| 6740 | } |
| 6741 | // eta: |
| 6742 | for(Int_t e=1;e<fnBinsEta;e++) |
| 6743 | { |
| 6744 | Double_t contentEta = 0.; |
| 6745 | for(Int_t p=1;p<=fnBinsPt;p++) |
| 6746 | { |
| 6747 | contentEta += (fNonEmptyBins2D[t]->GetBinContent(fNonEmptyBins2D[t]->GetBin(p,e))); |
| 9c1a9547 |
6748 | } |
| 2aa4ebcd |
6749 | fNonEmptyBins1D[t][1]->SetBinContent(e,contentEta); |
| 6750 | } |
| 6751 | |
| 6752 | // from 2D profile in (pt,eta) make two 1D profiles in (pt) and (eta): |
| 6753 | TProfile *profile[2][4]; // [0=pt,1=eta][correlation index] // to be improved (do not hardwire the correlation index) |
| 6754 | |
| 6755 | for(Int_t pe=0;pe<2;pe++) // pt or eta |
| 6756 | { |
| 6757 | for(Int_t ci=0;ci<4;ci++) // correlation index |
| 6758 | { |
| 6759 | if(pe==0) profile[pe][ci] = this->MakePtProjection(fCorrelationsPro[t][pW][eW][ci]); |
| 6760 | if(pe==1) profile[pe][ci] = this->MakeEtaProjection(fCorrelationsPro[t][pW][eW][ci]); |
| 6761 | } |
| 6762 | } |
| 9c1a9547 |
6763 | |
| 2aa4ebcd |
6764 | // transfer 2D profile into 2D histogram: |
| 6765 | // to be improved (see in documentation if there is a method to transfer values from 2D profile into 2D histogram) |
| 6766 | for(Int_t ci=0;ci<4;ci++) |
| 6767 | { |
| 6768 | for(Int_t p=1;p<=fnBinsPt;p++) |
| 9c1a9547 |
6769 | { |
| 2aa4ebcd |
6770 | for(Int_t e=1;e<=fnBinsEta;e++) |
| 9c1a9547 |
6771 | { |
| 2aa4ebcd |
6772 | Double_t correlation = fCorrelationsPro[t][pW][eW][ci]->GetBinContent(fCorrelationsPro[t][pW][eW][ci]->GetBin(p,e)); |
| 6773 | Double_t spread = fCorrelationsPro[t][pW][eW][ci]->GetBinError(fCorrelationsPro[t][pW][eW][ci]->GetBin(p,e)); |
| 6774 | Double_t nEvts = fNonEmptyBins2D[t]->GetBinContent(fNonEmptyBins2D[t]->GetBin(p,e)); |
| 6775 | Double_t error = 0.; |
| 6776 | fFinalCorrelations2D[t][pW][eW][ci]->SetBinContent(fFinalCorrelations2D[t][pW][eW][ci]->GetBin(p,e),correlation); |
| 6777 | if(nEvts>0) |
| 3c16adde |
6778 | { |
| 2aa4ebcd |
6779 | error = spread/pow(nEvts,0.5); |
| 6780 | fFinalCorrelations2D[t][pW][eW][ci]->SetBinError(fFinalCorrelations2D[t][pW][eW][ci]->GetBin(p,e),error); |
| 3c16adde |
6781 | } |
| 2aa4ebcd |
6782 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) |
| 6783 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
| 6784 | } // end of for(Int_t ci=0;ci<4;ci++) |
| 6785 | |
| 6786 | // transfer 1D profile into 1D histogram (pt): |
| 6787 | // to be improved (see in documentation if there is a method to transfer values from 1D profile into 1D histogram) |
| 6788 | for(Int_t ci=0;ci<4;ci++) |
| 6789 | { |
| 6790 | for(Int_t p=1;p<=fnBinsPt;p++) |
| 6791 | { |
| 6792 | if(profile[0][ci]) |
| 6793 | { |
| 6794 | Double_t correlation = profile[0][ci]->GetBinContent(p); |
| 6795 | Double_t spread = profile[0][ci]->GetBinError(p); |
| 6796 | Double_t nEvts = fNonEmptyBins1D[t][0]->GetBinContent(p); |
| 6797 | Double_t error = 0.; |
| 6798 | fFinalCorrelations1D[t][pW][eW][0][ci]->SetBinContent(p,correlation); |
| 6799 | if(nEvts>0) |
| 9c1a9547 |
6800 | { |
| 2aa4ebcd |
6801 | error = spread/pow(nEvts,0.5); |
| 6802 | fFinalCorrelations1D[t][pW][eW][0][ci]->SetBinError(p,error); |
| 6803 | } |
| 6804 | } |
| 6805 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
| 6806 | } // end of for(Int_t ci=0;ci<4;ci++) |
| 6807 | |
| 6808 | // transfer 1D profile into 1D histogram (eta): |
| 6809 | // to be improved (see in documentation if there is a method to transfer values from 1D profile into 1D histogram) |
| 6810 | for(Int_t ci=0;ci<4;ci++) |
| 6811 | { |
| 6812 | for(Int_t e=1;e<=fnBinsEta;e++) |
| 6813 | { |
| 6814 | if(profile[1][ci]) |
| 6815 | { |
| 6816 | Double_t correlation = profile[1][ci]->GetBinContent(e); |
| 6817 | fFinalCorrelations1D[t][pW][eW][1][ci]->SetBinContent(e,correlation); |
| 6818 | } |
| 6819 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) |
| 6820 | } // end of for(Int_t ci=0;ci<4;ci++) |
| 9c1a9547 |
6821 | |
| 2aa4ebcd |
6822 | } // end of void AliFlowAnalysisWithQCumulants::FinalizeCorrelationsForDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights) |
| 6823 | |
| 6824 | |
| 6825 | //================================================================================================================================ |
| 6826 | |
| 6827 | |
| 6828 | void AliFlowAnalysisWithQCumulants::CalculateCumulantsForDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights) |
| 6829 | { |
| 6830 | // calcualate cumulants for differential flow from measured correlations |
| 6831 | // Remark: cumulants calculated here are NOT corrected for non-uniform acceptance. This correction is applied in the method ... |
| 6832 | |
| 6833 | Int_t typeFlag = -1; |
| 6834 | Int_t pWeightsFlag = -1; |
| 6835 | Int_t eWeightsFlag = -1; |
| 6836 | |
| 6837 | if(type == "RP") |
| 6838 | { |
| 6839 | typeFlag = 0; |
| 6840 | } else if(type == "POI") |
| 6841 | { |
| 6842 | typeFlag = 1; |
| 6843 | } else |
| 6844 | { |
| 6845 | cout<<"WARNING: type must be either RP or POI in AFAWQC::CCFDF() !!!!"<<endl; |
| 6846 | exit(0); |
| 6847 | } |
| 6848 | |
| 6849 | if(!useParticleWeights) |
| 6850 | { |
| 6851 | pWeightsFlag = 0; |
| 6852 | } else |
| 6853 | { |
| 6854 | pWeightsFlag = 1; |
| 6855 | } |
| 6856 | |
| 6857 | if(eventWeights == "exact") |
| 6858 | { |
| 6859 | eWeightsFlag = 0; |
| 6860 | } |
| 6861 | |
| 6862 | // shortcuts: |
| 6863 | Int_t t = typeFlag; |
| 6864 | Int_t pW = pWeightsFlag; |
| 6865 | Int_t eW = eWeightsFlag; |
| 3d824203 |
6866 | |
| 2aa4ebcd |
6867 | // correlation <<2>>: |
| 6868 | Double_t two = fQCorrelations[pW][eW]->GetBinContent(1); |
| 6869 | |
| 6870 | // 2D (pt,eta): |
| 6871 | // to be improved (see documentation if I can do all this without looping) |
| 6872 | for(Int_t p=1;p<=fnBinsPt;p++) |
| 6873 | { |
| 6874 | for(Int_t e=1;e<=fnBinsEta;e++) |
| 6875 | { |
| 6876 | // reduced correlations: |
| 6877 | Double_t twoPrime = fFinalCorrelations2D[t][pW][eW][0]->GetBinContent(fFinalCorrelations2D[t][pW][eW][0]->GetBin(p,e)); // <<2'>>(pt,eta) |
| 6878 | Double_t fourPrime = fFinalCorrelations2D[t][pW][eW][1]->GetBinContent(fFinalCorrelations2D[t][pW][eW][1]->GetBin(p,e)); // <<4'>>(pt,eta) |
| 6879 | for(Int_t nua=0;nua<2;nua++) |
| 6880 | { |
| 6881 | // QC{2'}: |
| 6882 | Double_t qc2Prime = twoPrime; // QC{2'} = <<2'>> |
| 6883 | fFinalCumulants2D[t][pW][eW][nua][0]->SetBinContent(fFinalCumulants2D[t][pW][eW][nua][0]->GetBin(p,e),qc2Prime); |
| 6884 | // QC{4'}: |
| 6885 | Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>> |
| 6886 | fFinalCumulants2D[t][pW][eW][nua][1]->SetBinContent(fFinalCumulants2D[t][pW][eW][nua][1]->GetBin(p,e),qc4Prime); |
| 6887 | } // end of for(Int_t nua=0;nua<2;nua++) |
| 6888 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) |
| 6889 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
| 3d824203 |
6890 | |
| 2aa4ebcd |
6891 | // 1D (pt): |
| 6892 | // to be improved (see documentation if I can do all this without looping) |
| 6893 | // to be improved (treat pt and eta in one go) |
| 6894 | // to be improved (combine loops over nua for 2D and 1D) |
| 6895 | for(Int_t p=1;p<=fnBinsPt;p++) |
| 6896 | { |
| 6897 | // reduced correlations: |
| 6898 | Double_t twoPrime = fFinalCorrelations1D[t][pW][eW][0][0]->GetBinContent(p); // <<2'>>(pt) |
| 6899 | Double_t fourPrime = fFinalCorrelations1D[t][pW][eW][0][1]->GetBinContent(p); // <<4'>>(pt) |
| 6900 | // spread of reduced correlations: |
| 6901 | Double_t twoPrimeError = fFinalCorrelations1D[t][pW][eW][0][0]->GetBinError(p); // sigma_2'/sqrt{N_2'}(pt) |
| 6902 | for(Int_t nua=0;nua<2;nua++) |
| 6903 | { |
| 6904 | // QC{2'}: |
| 6905 | Double_t qc2Prime = twoPrime; // QC{2'} |
| 6906 | Double_t qc2PrimeError = twoPrimeError; // sigma_{d_n{2}}/sqrt{N_2'} // to be improved |
| 6907 | fFinalCumulantsPt[t][pW][eW][nua][0]->SetBinContent(p,qc2Prime); |
| 6908 | fFinalCumulantsPt[t][pW][eW][nua][0]->SetBinError(p,qc2PrimeError); |
| 6909 | // QC{4'}: |
| 6910 | Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>> |
| 6911 | fFinalCumulantsPt[t][pW][eW][nua][1]->SetBinContent(p,qc4Prime); |
| 6912 | } // end of for(Int_t nua=0;nua<2;nua++) |
| 6913 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
| 6914 | |
| 6915 | |
| 6916 | // 1D (eta): |
| 6917 | // to be improved (see documentation if I can do all this without looping) |
| 6918 | // to be improved (treat pt and eta in one go) |
| 6919 | // to be improved (combine loops over nua for 2D and 1D) |
| 6920 | for(Int_t e=1;e<=fnBinsEta;e++) |
| 6921 | { |
| 6922 | // reduced correlations: |
| 6923 | Double_t twoPrime = fFinalCorrelations1D[t][pW][eW][1][0]->GetBinContent(e); // <<2'>>(eta) |
| 6924 | Double_t fourPrime = fFinalCorrelations1D[t][pW][eW][1][1]->GetBinContent(e); // <<4'>>(eta) |
| 6925 | for(Int_t nua=0;nua<2;nua++) |
| 6926 | { |
| 6927 | // QC{2'}: |
| 6928 | Double_t qc2Prime = twoPrime; // QC{2'} |
| 6929 | fFinalCumulantsEta[t][pW][eW][nua][0]->SetBinContent(e,qc2Prime); |
| 6930 | // QC{4'}: |
| 6931 | Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>> |
| 6932 | fFinalCumulantsEta[t][pW][eW][nua][1]->SetBinContent(e,qc4Prime); |
| 6933 | } // end of for(Int_t nua=0;nua<2;nua++) |
| 6934 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) |
| 6935 | |
| 6936 | |
| 6937 | } // end of void AliFlowAnalysisWithQCumulants::CalculateCumulantsForDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights); |
| 6938 | |
| 6939 | |
| 6940 | //================================================================================================================================ |
| 6941 | |
| 6942 | |
| 6943 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights) |
| 6944 | { |
| 6945 | // calculate differential flow from differential cumulants and previously obtained integrated flow: |
| 6946 | |
| 6947 | Int_t typeFlag = -1; |
| 6948 | Int_t pWeightsFlag = -1; |
| 6949 | Int_t eWeightsFlag = -1; |
| 6950 | |
| 6951 | if(type == "RP") |
| 6952 | { |
| 6953 | typeFlag = 0; |
| 6954 | } else if(type == "POI") |
| 6955 | { |
| 6956 | typeFlag = 1; |
| 6957 | } else |
| 6958 | { |
| 6959 | cout<<"WARNING: type must be either RP or POI in AFAWQC::CDF() !!!!"<<endl; |
| 6960 | exit(0); |
| 6961 | } |
| 6962 | |
| 6963 | if(!useParticleWeights) |
| 6964 | { |
| 6965 | pWeightsFlag = 0; |
| 6966 | } else |
| 6967 | { |
| 6968 | pWeightsFlag = 1; |
| 6969 | } |
| 6970 | |
| 6971 | if(eventWeights == "exact") |
| 6972 | { |
| 6973 | eWeightsFlag = 0; |
| 6974 | } |
| 6975 | |
| 6976 | // shortcuts: |
| 6977 | Int_t t = typeFlag; |
| 6978 | Int_t pW = pWeightsFlag; |
| 6979 | Int_t eW = eWeightsFlag; |
| 6980 | |
| 6981 | // integrated flow: |
| 6982 | Double_t v2 = 0.; |
| 6983 | Double_t v4 = 0.; |
| 6984 | |
| 6985 | if(pW == 0) |
| 6986 | { |
| 6987 | v2 = fIntFlow[pW][eW][1]->GetBinContent(1); |
| 6988 | v4 = fIntFlow[pW][eW][1]->GetBinContent(2); |
| 6989 | } |
| 6990 | |
| 6991 | if(pW == 1) |
| 9c1a9547 |
6992 | { |
| 2aa4ebcd |
6993 | v2 = fIntFlow[pW][eW][0]->GetBinContent(1); |
| 6994 | v4 = fIntFlow[pW][eW][0]->GetBinContent(2); |
| 6995 | } |
| 3d824203 |
6996 | |
| 2aa4ebcd |
6997 | // 2D: |
| 6998 | for(Int_t nua=0;nua<2;nua++) |
| 6999 | { |
| 7000 | for(Int_t p=1;p<=fnBinsPt;p++) |
| 2bdc5281 |
7001 | { |
| 2aa4ebcd |
7002 | for(Int_t e=1;e<=fnBinsEta;e++) |
| 7003 | { |
| 7004 | // differential cumulants: |
| 7005 | Double_t qc2Prime = fFinalCumulants2D[t][pW][eW][nua][0]->GetBinContent(fFinalCumulants2D[t][pW][eW][nua][0]->GetBin(p,e)); // QC{2'} |
| 7006 | Double_t qc4Prime = fFinalCumulants2D[t][pW][eW][nua][1]->GetBinContent(fFinalCumulants2D[t][pW][eW][nua][1]->GetBin(p,e)); // QC{4'} |
| 7007 | // differential flow: |
| 7008 | Double_t v2Prime = 0.; |
| 7009 | Double_t v4Prime = 0.; |
| 7010 | if(v2) |
| 2bdc5281 |
7011 | { |
| 2aa4ebcd |
7012 | v2Prime = qc2Prime/v2; |
| 7013 | fFinalFlow2D[t][pW][eW][nua][0]->SetBinContent(fFinalFlow2D[t][pW][eW][nua][0]->GetBin(p,e),v2Prime); |
| 7014 | } |
| 7015 | if(v4) |
| 7016 | { |
| 7017 | v4Prime = -qc4Prime/pow(v4,3.); |
| 7018 | fFinalFlow2D[t][pW][eW][nua][1]->SetBinContent(fFinalFlow2D[t][pW][eW][nua][1]->GetBin(p,e),v4Prime); |
| 7019 | } |
| 7020 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) |
| 7021 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
| 7022 | } // end of for(Int_t nua=0;nua<2;nua++) |
| 7023 | |
| 7024 | // 1D (pt): // to be improved (combined with eta, combined nua loop with 2D) |
| 7025 | for(Int_t nua=0;nua<2;nua++) |
| 7026 | { |
| 7027 | for(Int_t p=1;p<=fnBinsPt;p++) |
| 9c1a9547 |
7028 | { |
| 2aa4ebcd |
7029 | // differential cumulants: |
| 7030 | Double_t qc2Prime = fFinalCumulantsPt[t][pW][eW][nua][0]->GetBinContent(p); // QC{2'} |
| 7031 | Double_t qc4Prime = fFinalCumulantsPt[t][pW][eW][nua][1]->GetBinContent(p); // QC{4'} |
| 7032 | // differential flow: |
| 7033 | Double_t v2Prime = 0.; |
| 7034 | Double_t v4Prime = 0.; |
| 7035 | if(v2) |
| 9c1a9547 |
7036 | { |
| 2aa4ebcd |
7037 | v2Prime = qc2Prime/v2; |
| 7038 | fFinalFlowPt[t][pW][eW][nua][0]->SetBinContent(p,v2Prime); |
| 7039 | } |
| 7040 | if(v4) |
| 9c1a9547 |
7041 | { |
| 2aa4ebcd |
7042 | v4Prime = -qc4Prime/pow(v4,3.); |
| 7043 | fFinalFlowPt[t][pW][eW][nua][1]->SetBinContent(p,v4Prime); |
| 7044 | } |
| 7045 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
| 7046 | } // end of for(Int_t nua=0;nua<2;nua++) |
| 7047 | |
| 7048 | // 1D (eta): // to be improved (combined with pt, combined nua loop with 2D) |
| 7049 | for(Int_t nua=0;nua<2;nua++) |
| 7050 | { |
| 7051 | for(Int_t e=1;e<=fnBinsEta;e++) |
| 9c1a9547 |
7052 | { |
| 2aa4ebcd |
7053 | // differential cumulants: |
| 7054 | Double_t qc2Prime = fFinalCumulantsEta[t][pW][eW][nua][0]->GetBinContent(e); // QC{2'} |
| 7055 | Double_t qc4Prime = fFinalCumulantsEta[t][pW][eW][nua][1]->GetBinContent(e); // QC{4'} |
| 7056 | // differential flow: |
| 7057 | Double_t v2Prime = 0.; |
| 7058 | Double_t v4Prime = 0.; |
| 7059 | if(v2) |
| 9c1a9547 |
7060 | { |
| 2aa4ebcd |
7061 | v2Prime = qc2Prime/v2; |
| 7062 | fFinalFlowEta[t][pW][eW][nua][0]->SetBinContent(e,v2Prime); |
| 7063 | } |
| 7064 | if(v4) |
| 7065 | { |
| 7066 | v4Prime = -qc4Prime/pow(v4,3.); |
| 7067 | fFinalFlowEta[t][pW][eW][nua][1]->SetBinContent(e,v4Prime); |
| 7068 | } |
| 7069 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) |
| 7070 | } // end of for(Int_t nua=0;nua<2;nua++) |
| 3d824203 |
7071 | |
| 2aa4ebcd |
7072 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, Bool_t useParticleWeights) |
| bc92c0cb |
7073 | |
| bc92c0cb |
7074 | |
| 9c1a9547 |
7075 | //================================================================================================================================ |
| bc92c0cb |
7076 | |
| 9c1a9547 |
7077 | |
| 2aa4ebcd |
7078 | void AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type, Bool_t useParticleWeights, TString eventWeights) |
| bc92c0cb |
7079 | { |
| 2aa4ebcd |
7080 | // calculate final results for integrated flow of RPs and POIs |
| 77515452 |
7081 | |
| 2aa4ebcd |
7082 | Int_t typeFlag = -1; |
| 7083 | Int_t pWeightsFlag = -1; |
| 7084 | Int_t eWeightsFlag = -1; |
| 7085 | |
| 7086 | if(type == "RP") |
| 9c1a9547 |
7087 | { |
| 2aa4ebcd |
7088 | typeFlag = 0; |
| 7089 | } else if(type == "POI") |
| 7090 | { |
| 7091 | typeFlag = 1; |
| 7092 | } else |
| 7093 | { |
| 7094 | cout<<"WARNING: type must be either RP or POI in AFAWQC::CDF() !!!!"<<endl; |
| 7095 | exit(0); |
| 7096 | } |
| 7097 | |
| 7098 | if(!useParticleWeights) |
| 77515452 |
7099 | { |
| 2aa4ebcd |
7100 | pWeightsFlag = 0; |
| 7101 | } else |
| 7102 | { |
| 7103 | pWeightsFlag = 1; |
| 7104 | } |
| 9c1a9547 |
7105 | |
| 2aa4ebcd |
7106 | if(eventWeights == "exact") |
| 77515452 |
7107 | { |
| 2aa4ebcd |
7108 | eWeightsFlag = 0; |
| 7109 | } |
| 9c1a9547 |
7110 | |
| 2aa4ebcd |
7111 | // shortcuts: |
| 7112 | Int_t t = typeFlag; |
| 7113 | Int_t pW = pWeightsFlag; |
| 7114 | Int_t eW = eWeightsFlag; |
| 7115 | |
| 7116 | // pt yield: |
| 7117 | TH1F *yield2ndPt = NULL; |
| 7118 | TH1F *yield4thPt = NULL; |
| 7119 | TH1F *yield6thPt = NULL; |
| 7120 | TH1F *yield8thPt = NULL; |
| 9c1a9547 |
7121 | |
| 2aa4ebcd |
7122 | if(type == "POI") |
| 77515452 |
7123 | { |
| 2aa4ebcd |
7124 | yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtPOI())->Clone(); |
| 7125 | yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtPOI())->Clone(); |
| 7126 | yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtPOI())->Clone(); |
| 7127 | yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtPOI())->Clone(); |
| 7128 | } |
| 7129 | else if(type == "RP") |
| 7130 | { |
| 7131 | yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtRP())->Clone(); |
| 7132 | yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtRP())->Clone(); |
| 7133 | yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtRP())->Clone(); |
| 7134 | yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtRP())->Clone(); |
| 7135 | } |
| 7136 | |
| 7137 | Int_t nBinsPt = yield2ndPt->GetNbinsX(); |
| 7138 | |
| 7139 | TH1D *flow2ndPt = NULL; |
| 7140 | TH1D *flow4thPt = NULL; |
| 7141 | TH1D *flow6thPt = NULL; |
| 7142 | TH1D *flow8thPt = NULL; |
| 7143 | |
| 7144 | // to be improve (nua = 0 is hardwired) |
| 7145 | flow2ndPt = (TH1D*)fFinalFlowPt[t][pW][eW][0][0]->Clone(); |
| 7146 | flow4thPt = (TH1D*)fFinalFlowPt[t][pW][eW][0][1]->Clone(); |
| 7147 | flow6thPt = (TH1D*)fFinalFlowPt[t][pW][eW][0][2]->Clone(); |
| 7148 | flow8thPt = (TH1D*)fFinalFlowPt[t][pW][eW][0][3]->Clone(); |
| 7149 | |
| 7150 | Double_t dvn2nd = 0., dvn4th = 0., dvn6th = 0., dvn8th = 0.; // differential flow |
| 7151 | Double_t dVn2nd = 0., dVn4th = 0., dVn6th = 0., dVn8th = 0.; // integrated flow |
| 7152 | //Double_t dSd2nd = 0., dSd4th = 0., dSd6th = 0., dSd8th = 0.; // error on integrated flow (to be improved - calculation needed) |
| 7153 | |
| 7154 | Double_t dYield2nd = 0., dYield4th = 0., dYield6th = 0., dYield8th = 0.; // pt yield |
| 7155 | Double_t dSum2nd = 0., dSum4th = 0., dSum6th = 0., dSum8th = 0.; // needed for normalizing integrated flow |
| 9c1a9547 |
7156 | |
| 2aa4ebcd |
7157 | // looping over pt bins: |
| 7158 | for(Int_t p=1;p<nBinsPt+1;p++) |
| 77515452 |
7159 | { |
| 2aa4ebcd |
7160 | dvn2nd = flow2ndPt->GetBinContent(p); |
| 7161 | dvn4th = flow4thPt->GetBinContent(p); |
| 7162 | dvn6th = flow6thPt->GetBinContent(p); |
| 7163 | dvn8th = flow8thPt->GetBinContent(p); |
| 7164 | |
| 7165 | dYield2nd = yield2ndPt->GetBinContent(p); |
| 7166 | dYield4th = yield4thPt->GetBinContent(p); |
| 7167 | dYield6th = yield6thPt->GetBinContent(p); |
| 7168 | dYield8th = yield8thPt->GetBinContent(p); |
| 9c1a9547 |
7169 | |
| 2aa4ebcd |
7170 | dVn2nd += dvn2nd*dYield2nd; |
| 7171 | dVn4th += dvn4th*dYield4th; |
| 7172 | dVn6th += dvn6th*dYield6th; |
| 7173 | dVn8th += dvn8th*dYield8th; |
| 9c1a9547 |
7174 | |
| 2aa4ebcd |
7175 | dSum2nd += dYield2nd; |
| 7176 | dSum4th += dYield4th; |
| 7177 | dSum6th += dYield6th; |
| 7178 | dSum8th += dYield8th; |
| 7179 | |
| 7180 | // ... to be improved - errors needed to be calculated |
| 7181 | |
| 7182 | } // end of for(Int_t p=1;p<nBinsPt+1;p++) |
| 7183 | |
| 7184 | // normalizing the results for integrated flow: |
| 7185 | |
| 7186 | |
| 7187 | |
| 7188 | |
| 7189 | |
| 7190 | if(dSum2nd) dVn2nd/=dSum2nd; |
| 7191 | if(dSum4th) dVn4th/=dSum4th; |
| 7192 | //if(dSum6th) dVn6th/=dSum6th; |
| 7193 | //if(dSum8th) dVn8th/=dSum8th; |
| 7194 | |
| 7195 | /* |
| 7196 | // storing the results for integrated flow: |
| 7197 | if(!(useParticleWeights)) |
| 9c1a9547 |
7198 | { |
| 2aa4ebcd |
7199 | if(type == "POI") |
| 9c1a9547 |
7200 | { |
| 2aa4ebcd |
7201 | // 2nd: |
| 7202 | fIntFlowResultsPOIQC->SetBinContent(1,dVn2nd); |
| 7203 | fIntFlowResultsPOIQC->SetBinError(1,dSd2nd); |
| 7204 | // 4th: |
| 7205 | fIntFlowResultsPOIQC->SetBinContent(2,dVn4th); |
| 7206 | fIntFlowResultsPOIQC->SetBinError(2,dSd4th); |
| 7207 | // 6th: |
| 7208 | fIntFlowResultsPOIQC->SetBinContent(3,dVn6th); |
| 7209 | fIntFlowResultsPOIQC->SetBinError(3,dSd6th); |
| 7210 | // 8th: |
| 7211 | fIntFlowResultsPOIQC->SetBinContent(4,dVn8th); |
| 7212 | fIntFlowResultsPOIQC->SetBinError(4,dSd8th); |
| 9c1a9547 |
7213 | } |
| 2aa4ebcd |
7214 | else if (type == "RP") |
| 9c1a9547 |
7215 | { |
| 2aa4ebcd |
7216 | // 2nd: |
| 7217 | fIntFlowResultsRPQC->SetBinContent(1,dVn2nd); |
| 7218 | fIntFlowResultsRPQC->SetBinError(1,dSd2nd); |
| 7219 | // 4th: |
| 7220 | fIntFlowResultsRPQC->SetBinContent(2,dVn4th); |
| 7221 | fIntFlowResultsRPQC->SetBinError(2,dSd4th); |
| 7222 | // 6th: |
| 7223 | fIntFlowResultsRPQC->SetBinContent(3,dVn6th); |
| 7224 | fIntFlowResultsRPQC->SetBinError(3,dSd6th); |
| 7225 | // 8th: |
| 7226 | fIntFlowResultsRPQC->SetBinContent(4,dVn8th); |
| 7227 | fIntFlowResultsRPQC->SetBinError(4,dSd8th); |
| 7228 | } |
| 7229 | } |
| 7230 | else if (useParticleWeights) |
| 9c1a9547 |
7231 | { |
| 2aa4ebcd |
7232 | if(type == "POI") |
| 7233 | { |
| 7234 | // 2nd: |
| 7235 | fIntFlowResultsPOIQCW->SetBinContent(1,dVn2nd); |
| 7236 | fIntFlowResultsPOIQCW->SetBinError(1,dSd2nd); |
| 7237 | // 4th: |
| 7238 | fIntFlowResultsPOIQCW->SetBinContent(2,dVn4th); |
| 7239 | fIntFlowResultsPOIQCW->SetBinError(2,dSd4th); |
| 7240 | // 6th: |
| 7241 | fIntFlowResultsPOIQCW->SetBinContent(3,dVn6th); |
| 7242 | fIntFlowResultsPOIQCW->SetBinError(3,dSd6th); |
| 7243 | // 8th: |
| 7244 | fIntFlowResultsPOIQCW->SetBinContent(4,dVn8th); |
| 7245 | fIntFlowResultsPOIQCW->SetBinError(4,dSd8th); |
| 7246 | } |
| 7247 | else if (type == "RP") |
| 7248 | { |
| 7249 | // 2nd: |
| 7250 | fIntFlowResultsRPQCW->SetBinContent(1,dVn2nd); |
| 7251 | fIntFlowResultsRPQCW->SetBinError(1,dSd2nd); |
| 7252 | // 4th: |
| 7253 | fIntFlowResultsRPQCW->SetBinContent(2,dVn4th); |
| 7254 | fIntFlowResultsRPQCW->SetBinError(2,dSd4th); |
| 7255 | // 6th: |
| 7256 | fIntFlowResultsRPQCW->SetBinContent(3,dVn6th); |
| 7257 | fIntFlowResultsRPQCW->SetBinError(3,dSd6th); |
| 7258 | // 8th: |
| 7259 | fIntFlowResultsRPQCW->SetBinContent(4,dVn8th); |
| 7260 | fIntFlowResultsRPQCW->SetBinError(4,dSd8th); |
| 7261 | } |
| 9c1a9547 |
7262 | } |
| 2aa4ebcd |
7263 | */ |
| 7264 | |
| 7265 | // storing the results for integrated flow in common histos: |
| 7266 | // to be improved - now they are being filled twice ... |
| 7267 | if(type == "POI") |
| 9c1a9547 |
7268 | { |
| 2aa4ebcd |
7269 | fCommonHistsResults2nd->FillIntegratedFlowPOI(dVn2nd,0.); // to be improved (errors) |
| 7270 | fCommonHistsResults4th->FillIntegratedFlowPOI(dVn4th,0.); // to be improved (errors) |
| 7271 | fCommonHistsResults6th->FillIntegratedFlowPOI(dVn6th,0.); // to be improved (errors) |
| 7272 | fCommonHistsResults8th->FillIntegratedFlowPOI(dVn8th,0.); // to be improved (errors) |
| 7273 | } |
| 7274 | else if (type == "RP") |
| 9c1a9547 |
7275 | { |
| 2aa4ebcd |
7276 | fCommonHistsResults2nd->FillIntegratedFlowRP(dVn2nd,0.); // to be improved (errors) |
| 7277 | fCommonHistsResults4th->FillIntegratedFlowRP(dVn4th,0.); // to be improved (errors) |
| 7278 | fCommonHistsResults6th->FillIntegratedFlowRP(dVn6th,0.); // to be improved (errors) |
| 7279 | fCommonHistsResults8th->FillIntegratedFlowRP(dVn8th,0.); // to be improved (errors) |
| 7280 | } |
| 7281 | |
| 7282 | delete flow2ndPt; |
| 7283 | delete flow4thPt; |
| 7284 | //delete flow6thPt; |
| 7285 | //delete flow8thPt; |
| 7286 | |
| 7287 | delete yield2ndPt; |
| 7288 | delete yield4thPt; |
| 7289 | delete yield6thPt; |
| 7290 | delete yield8thPt; |
| 9c1a9547 |
7291 | |
| 2aa4ebcd |
7292 | } // end of AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type, Bool_t useParticleWeights, TString eventWeights) |
| 77515452 |
7293 | |
| 77515452 |
7294 | |
| 9c1a9547 |
7295 | //================================================================================================================================ |
| 77515452 |
7296 | |
| 9c1a9547 |
7297 | |
| 2aa4ebcd |
7298 | void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions() |
| 77515452 |
7299 | { |
| 2aa4ebcd |
7300 | // initialize arrays used for distributions: |
| 9c1a9547 |
7301 | |
| 2aa4ebcd |
7302 | for(Int_t pW=0;pW<1+(Int_t)(fUsePhiWeights||fUsePtWeights||fUseEtaWeights);pW++) // non-weighted or weighted |
| 77515452 |
7303 | { |
| 2aa4ebcd |
7304 | for(Int_t eW=0;eW<2;eW++) |
| 7305 | { |
| 7306 | for(Int_t di=0;di<4;di++) // distribution index |
| 7307 | { |
| 7308 | fDistributions[pW][eW][di] = NULL; |
| 7309 | } |
| 7310 | } |
| 77515452 |
7311 | } |
| 9c1a9547 |
7312 | |
| 2aa4ebcd |
7313 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions() |
| 9c1a9547 |
7314 | |
| 77515452 |
7315 | |
| 9c1a9547 |
7316 | //================================================================================================================================ |
| 77515452 |
7317 | |
| 77515452 |
7318 | |
| 2aa4ebcd |
7319 | void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions() |
| 77515452 |
7320 | { |
| 2aa4ebcd |
7321 | // book all histograms for distributions |
| 7322 | |
| 7323 | /* |
| 7324 | //weighted <2>_{n|n} distribution |
| 7325 | f2pDistribution = new TH1D("f2pDistribution","<2>_{n|n} distribution",100000,-0.02,0.1); |
| 7326 | f2pDistribution->SetXTitle("<2>_{n|n}"); |
| 7327 | f2pDistribution->SetYTitle("Counts"); |
| 7328 | fHistList->Add(f2pDistribution); |
| 9c1a9547 |
7329 | |
| 2aa4ebcd |
7330 | //weighted <4>_{n,n|n,n} distribution |
| 7331 | f4pDistribution = new TH1D("f4pDistribution","<4>_{n,n|n,n} distribution",100000,-0.00025,0.002); |
| 7332 | f4pDistribution->SetXTitle("<4>_{n,n|n,n}"); |
| 7333 | f4pDistribution->SetYTitle("Counts"); |
| 7334 | fHistList->Add(f4pDistribution); |
| 9c1a9547 |
7335 | |
| 2aa4ebcd |
7336 | //weighted <6>_{n,n,n|n,n,n} distribution |
| 7337 | f6pDistribution = new TH1D("f6pDistribution","<6>_{n,n,n|n,n,n} distribution",100000,-0.000005,0.000025); |
| 7338 | f6pDistribution->SetXTitle("<6>_{n,n,n|n,n,n}"); |
| 7339 | f6pDistribution->SetYTitle("Counts"); |
| 7340 | fHistList->Add(f6pDistribution); |
| 9c1a9547 |
7341 | |
| 2aa4ebcd |
7342 | //weighted <8>_{n,n,n,n|n,n,n,n} distribution |
| 7343 | f8pDistribution = new TH1D("f8pDistribution","<8>_{n,n,n,n|n,n,n,n} distribution",100000,-0.000000001,0.00000001); |
| 7344 | f8pDistribution->SetXTitle("<8>_{n,n,n,n|n,n,n,n}"); |
| 7345 | f8pDistribution->SetYTitle("Counts"); |
| 7346 | fHistList->Add(f8pDistribution); |
| 7347 | */ |
| 3d824203 |
7348 | |
| 2aa4ebcd |
7349 | } // end of void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions() |
| 77515452 |
7350 | |
| 7e58a232 |
7351 | |
| 9c1a9547 |
7352 | //================================================================================================================================ |
| 77515452 |
7353 | |
| 77515452 |
7354 | |
| 2aa4ebcd |
7355 | void AliFlowAnalysisWithQCumulants::BookAndNestAllLists() |
| 77515452 |
7356 | { |
| 2aa4ebcd |
7357 | // book and nest all lists in fHistList |
| 7358 | |
| 7359 | // booking and nesting: |
| 7360 | fHistList->Add(fWeightsList); |
| 7361 | |
| 7362 | fIntFlowList = new TList(); |
| 7363 | fIntFlowList->SetName("Integrated Flow"); |
| 7364 | fIntFlowList->SetOwner(kTRUE); |
| 7365 | fHistList->Add(fIntFlowList); |
| 7366 | |
| 7367 | fIntFlowResults = new TList(); |
| 7368 | fIntFlowResults->SetName("Results"); |
| 7369 | fIntFlowResults->SetOwner(kTRUE); |
| 7370 | fIntFlowList->Add(fIntFlowResults); |
| 7371 | |
| 7372 | fIntFlowProfiles = new TList(); |
| 7373 | fIntFlowProfiles->SetName("Profiles"); |
| 7374 | fIntFlowProfiles->SetOwner(kTRUE); |
| 7375 | fIntFlowList->Add(fIntFlowProfiles); |
| 7376 | |
| 7377 | fDiffFlowList = new TList(); |
| 7378 | fDiffFlowList->SetName("Differential Flow"); |
| 7379 | fDiffFlowList->SetOwner(kTRUE); |
| 7380 | fHistList->Add(fDiffFlowList); |
| 7381 | |
| 7382 | fDiffFlowProfiles = new TList(); |
| 7383 | fDiffFlowProfiles->SetName("Profiles"); |
| 7384 | fDiffFlowProfiles->SetOwner(kTRUE); |
| 7385 | fDiffFlowList->Add(fDiffFlowProfiles); |
| 7386 | |
| 7387 | fDiffFlowResults = new TList(); |
| 7388 | fDiffFlowResults->SetName("Results"); |
| 7389 | fDiffFlowResults->SetOwner(kTRUE); |
| 7390 | fDiffFlowList->Add(fDiffFlowResults); |
| 7391 | |
| 7392 | fDistributionsList = new TList(); |
| 7393 | fDistributionsList->SetName("Distributions"); |
| 7394 | fDistributionsList->SetOwner(kTRUE); |
| 7395 | fHistList->Add(fDistributionsList); |
| 7396 | |
| 7397 | fNestedLoopsList = new TList(); |
| 7398 | fNestedLoopsList->SetName("Nested Loops"); |
| 7399 | fNestedLoopsList->SetOwner(kTRUE); |
| 7400 | fHistList->Add(fNestedLoopsList); |
| 7401 | |
| 7402 | // flags for naming nested lists: |
| 7403 | TList list; |
| 7404 | list.SetOwner(kTRUE); |
| 7405 | TString typeFlag[2] = {"RP","POI"}; |
| 7406 | TString pWeightsFlag[2] = {"not used","used"}; |
| 7407 | TString eWeightsFlag[2] = {"exact","non-exact"}; |
| 7408 | TString nuaFlag[2] = {"not corrected","corrected"}; // nua = non-uniform acceptance |
| 7409 | TString sinCosFlag[2] = {"sin","cos"}; |
| 7410 | |
| 7411 | // nested lists in fDiffFlowProfiles (Differential Flow/Profiles): |
| 7412 | for(Int_t t=0;t<2;t++) // type: RP or POI |
| 7413 | { |
| 7414 | fDFPType[t] = (TList*)list.Clone(); |
| 7415 | fDFPType[t]->SetName(Form("%s",typeFlag[t].Data())); |
| 7416 | fDiffFlowProfiles->Add(fDFPType[t]); |
| 7417 | for(Int_t pW=0;pW<1+(Int_t)(fUsePhiWeights||fUsePtWeights||fUseEtaWeights);pW++) // weights: not used or used |
| 7418 | { |
| 7419 | fDFPParticleWeights[t][pW] = (TList*)list.Clone(); |
| 7420 | fDFPParticleWeights[t][pW]->SetName(Form("%s, pWeights %s",typeFlag[t].Data(),pWeightsFlag[pW].Data())); |
| 7421 | fDFPType[t]->Add(fDFPParticleWeights[t][pW]); |
| 7422 | for(Int_t eW=0;eW<2;eW++) |
| 7423 | { |
| 7424 | fDFPEventWeights[t][pW][eW] = (TList*)list.Clone(); |
| 7425 | fDFPEventWeights[t][pW][eW]->SetName(Form("%s, pWeights %s, eWeights %s",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data())); |
| 7426 | fDFPParticleWeights[t][pW]->Add(fDFPEventWeights[t][pW][eW]); |
| 7427 | // correlations: |
| 7428 | fDiffFlowCorrelations[t][pW][eW] = (TList*)list.Clone(); |
| 7429 | fDiffFlowCorrelations[t][pW][eW]->SetName(Form("Correlations (%s, pWeights %s, eWeights %s)",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data())); |
| 7430 | fDFPEventWeights[t][pW][eW]->Add(fDiffFlowCorrelations[t][pW][eW]); |
| 7431 | // products of correlations: |
| 7432 | fDiffFlowProductsOfCorrelations[t][pW][eW] = (TList*)list.Clone(); |
| 7433 | fDiffFlowProductsOfCorrelations[t][pW][eW]->SetName(Form("Products of correlations (%s, pWeights %s, eWeights %s)",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data())); |
| 7434 | fDFPEventWeights[t][pW][eW]->Add(fDiffFlowProductsOfCorrelations[t][pW][eW]); |
| 7435 | // correction terms: |
| 7436 | for(Int_t sc=0;sc<2;sc++) // corrections for NUA: sin or cos terms |
| 7437 | { |
| 7438 | fDiffFlowCorrectionTerms[t][pW][eW][sc] = (TList*)list.Clone(); |
| 7439 | fDiffFlowCorrectionTerms[t][pW][eW][sc]->SetName(Form("Corrections for NUA (%s, pWeights %s, eWeights %s, %s terms)",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),sinCosFlag[sc].Data())); |
| 7440 | fDFPEventWeights[t][pW][eW]->Add(fDiffFlowCorrectionTerms[t][pW][eW][sc]); |
| 7441 | } |
| 7442 | } |
| 7443 | } |
| 7444 | } |
| 7445 | |
| 7446 | // nested lists in fDiffFlowResults (Differential Flow/Results): |
| 7447 | for(Int_t t=0;t<2;t++) // RP or POI |
| 7448 | { |
| 7449 | fDFRType[t] = (TList*)list.Clone(); |
| 7450 | fDFRType[t]->SetName(Form("%s",typeFlag[t].Data())); |
| 7451 | fDiffFlowResults->Add(fDFRType[t]); |
| 7452 | for(Int_t pW=0;pW<1+(Int_t)(fUsePhiWeights||fUsePtWeights||fUseEtaWeights);pW++) // particle weights not used or used |
| 7453 | { |
| 7454 | fDFRParticleWeights[t][pW] = (TList*)list.Clone(); |
| 7455 | fDFRParticleWeights[t][pW]->SetName(Form("%s, pWeights %s",typeFlag[t].Data(),pWeightsFlag[pW].Data())); |
| 7456 | fDFRType[t]->Add(fDFRParticleWeights[t][pW]); |
| 7457 | for(Int_t eW=0;eW<2;eW++) // event weights: exact ot non-exact // to be improved (terminology) |
| 7458 | { |
| 7459 | fDFREventWeights[t][pW][eW] = (TList*)list.Clone(); |
| 7460 | fDFREventWeights[t][pW][eW]->SetName(Form("%s, pWeights %s, eWeights %s",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data())); |
| 7461 | fDFRParticleWeights[t][pW]->Add(fDFREventWeights[t][pW][eW]); |
| 7462 | // final correlations: |
| 7463 | fDiffFlowFinalCorrelations[t][pW][eW] = (TList*)list.Clone(); |
| 7464 | fDiffFlowFinalCorrelations[t][pW][eW]->SetName(Form("Correlations (%s, pWeights %s, eWeights %s)",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data())); |
| 7465 | fDFREventWeights[t][pW][eW]->Add(fDiffFlowFinalCorrelations[t][pW][eW]); |
| 7466 | // final covariances: |
| 7467 | fDiffFlowFinalCovariances[t][pW][eW] = (TList*)list.Clone(); |
| 7468 | fDiffFlowFinalCovariances[t][pW][eW]->SetName(Form("Covariances (%s, pWeights %s, eWeights %s)",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data())); |
| 7469 | fDFREventWeights[t][pW][eW]->Add(fDiffFlowFinalCovariances[t][pW][eW]); |
| 7470 | // final corrections: |
| 7471 | fDiffFlowFinalCorrections[t][pW][eW] = (TList*)list.Clone(); |
| 7472 | fDiffFlowFinalCorrections[t][pW][eW]->SetName(Form("Corrections (%s, pWeights %s, eWeights %s)",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data())); |
| 7473 | fDFREventWeights[t][pW][eW]->Add(fDiffFlowFinalCorrections[t][pW][eW]); |
| 7474 | for(Int_t nua=0;nua<2;nua++) |
| 7475 | { |
| 7476 | fDFRCorrections[t][pW][eW][nua] = (TList*)list.Clone(); |
| 7477 | fDFRCorrections[t][pW][eW][nua]->SetName(Form("%s, pWeights %s, eWeights %s, %s for NUA",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),nuaFlag[nua].Data())); |
| 7478 | fDFREventWeights[t][pW][eW]->Add(fDFRCorrections[t][pW][eW][nua]); |
| 7479 | // final cumulants: |
| 7480 | fDiffFlowFinalCumulants[t][pW][eW][nua] = (TList*)list.Clone(); |
| 7481 | fDiffFlowFinalCumulants[t][pW][eW][nua]->SetName(Form("Cumulants (%s, pWeights %s, eWeights %s, %s for NUA)",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),nuaFlag[nua].Data())); |
| 7482 | fDFRCorrections[t][pW][eW][nua]->Add(fDiffFlowFinalCumulants[t][pW][eW][nua]); |
| 7483 | // final differential flow: |
| 7484 | fDiffFlowFinalFlow[t][pW][eW][nua] = (TList*)list.Clone(); |
| 7485 | fDiffFlowFinalFlow[t][pW][eW][nua]->SetName(Form("Differential Flow (%s, pWeights %s, eWeights %s, %s for NUA)",typeFlag[t].Data(),pWeightsFlag[pW].Data(),eWeightsFlag[eW].Data(),nuaFlag[nua].Data())); |
| 7486 | fDFRCorrections[t][pW][eW][nua]->Add(fDiffFlowFinalFlow[t][pW][eW][nua]); |
| 7487 | } |
| 7488 | } |
| 7489 | } |
| 7490 | } |
| 7491 | |
| 7492 | } // end of void AliFlowAnalysisWithQCumulants::BookAndNestAllLists() |
| 77515452 |
7493 | |
| 77515452 |
7494 | |
| 9c1a9547 |
7495 | //================================================================================================================================ |
| 77515452 |
7496 | |
| b7cb54d5 |
7497 | |
| 2aa4ebcd |
7498 | void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights, Bool_t correctedForNUA) |
| 9c1a9547 |
7499 | { |
| 2aa4ebcd |
7500 | // fill common result histograms for differential flow |
| 2bdc5281 |
7501 | |
| 2aa4ebcd |
7502 | // shortcuts for the flags: |
| 7503 | Int_t t = 0; // 0=RP, 1=POI |
| 7504 | Int_t pW = (Int_t)(useParticleWeights); // 0=weights not useed, 1=weights used |
| 7505 | Int_t eW = -1; |
| 7506 | Int_t nua = (Int_t)(correctedForNUA); // 0=not corrected for NUA, 1=corrected for NUA |
| 2bdc5281 |
7507 | |
| 2aa4ebcd |
7508 | if(type == "POI") |
| 7509 | { |
| 7510 | t = 1; |
| 7511 | } |
| 2bdc5281 |
7512 | |
| 2aa4ebcd |
7513 | if(eventWeights == "exact") |
| 7514 | { |
| 7515 | eW = 0; |
| 7516 | } |
| e085f1a9 |
7517 | |
| 2aa4ebcd |
7518 | for(Int_t o=0;o<4;o++) // order |
| e085f1a9 |
7519 | { |
| 2aa4ebcd |
7520 | if(!fFinalFlowPt[t][pW][eW][nua][o]) |
| e085f1a9 |
7521 | { |
| 2aa4ebcd |
7522 | cout<<"WARNING: fFinalFlowPt[t][pW][eW][nua][o] is NULL in AFAWQC::FCHRIF() !!!!"<<endl; |
| 7523 | cout<<"t = "<<t<<endl; |
| 7524 | cout<<"pW = "<<pW<<endl; |
| 7525 | cout<<"eW = "<<eW<<endl; |
| 7526 | cout<<"nua = "<<nua<<endl; |
| 7527 | cout<<"o = "<<o<<endl; |
| 7528 | exit(0); |
| e085f1a9 |
7529 | } |
| 2aa4ebcd |
7530 | if(!fFinalFlowEta[t][pW][eW][nua][o]) |
| 7531 | { |
| 7532 | cout<<"WARNING: fFinalFlowEta[t][pW][eW][nua][o] is NULL in AFAWQC::FCHRIF() !!!!"<<endl; |
| 7533 | cout<<"t = "<<t<<endl; |
| 7534 | cout<<"pW = "<<pW<<endl; |
| 7535 | cout<<"eW = "<<eW<<endl; |
| 7536 | cout<<"nua = "<<nua<<endl; |
| 7537 | cout<<"o = "<<o<<endl; |
| 7538 | exit(0); |
| 7539 | } |
| 7540 | } |
| 7541 | |
| 7542 | if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th)) |
| 7543 | { |
| 7544 | cout<<"WARNING: fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th"<<endl; |
| 7545 | cout<<" is NULL in AFAWQC::FCHRIF() !!!!"<<endl; |
| 7546 | exit(0); |
| 7547 | } |
| 9c1a9547 |
7548 | |
| 2aa4ebcd |
7549 | // pt: |
| 7550 | for(Int_t p=1;p<=fnBinsPt;p++) |
| 7551 | { |
| 7552 | Double_t v2 = fFinalFlowPt[t][pW][eW][nua][0]->GetBinContent(p); |
| 7553 | Double_t v4 = fFinalFlowPt[t][pW][eW][nua][1]->GetBinContent(p); |
| 7554 | Double_t v6 = fFinalFlowPt[t][pW][eW][nua][2]->GetBinContent(p); |
| 7555 | Double_t v8 = fFinalFlowPt[t][pW][eW][nua][3]->GetBinContent(p); |
| 9c1a9547 |
7556 | |
| 2aa4ebcd |
7557 | //Double_t v2Error = fFinalFlow1D[t][pW][nua][0][0]->GetBinError(p); |
| 7558 | //Double_t v4Error = fFinalFlow1D[t][pW][nua][0][1]->GetBinError(p); |
| 7559 | //Double_t v6Error = fFinalFlow1D[t][pW][nua][0][2]->GetBinError(p); |
| 7560 | //Double_t v8Error = fFinalFlow1D[t][pW][nua][0][3]->GetBinError(p); |
| 9c1a9547 |
7561 | |
| 2aa4ebcd |
7562 | if(type == "RP") |
| 7563 | { |
| 7564 | fCommonHistsResults2nd->FillDifferentialFlowPtRP(p,v2,0.); |
| 7565 | fCommonHistsResults4th->FillDifferentialFlowPtRP(p,v4,0.); |
| 7566 | fCommonHistsResults6th->FillDifferentialFlowPtRP(p,v6,0.); |
| 7567 | fCommonHistsResults8th->FillDifferentialFlowPtRP(p,v8,0.); |
| 7568 | } else if(type == "POI") |
| 7569 | { |
| 7570 | fCommonHistsResults2nd->FillDifferentialFlowPtPOI(p,v2,0.); |
| 7571 | fCommonHistsResults4th->FillDifferentialFlowPtPOI(p,v4,0.); |
| 7572 | fCommonHistsResults6th->FillDifferentialFlowPtPOI(p,v6,0.); |
| 7573 | fCommonHistsResults8th->FillDifferentialFlowPtPOI(p,v8,0.); |
| 7574 | } |
| 7575 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
| 9c1a9547 |
7576 | |
| 2aa4ebcd |
7577 | // eta: |
| 7578 | for(Int_t e=1;e<=fnBinsEta;e++) |
| 7579 | { |
| 7580 | Double_t v2 = fFinalFlowEta[t][pW][eW][nua][0]->GetBinContent(e); |
| 7581 | Double_t v4 = fFinalFlowEta[t][pW][eW][nua][1]->GetBinContent(e); |
| 7582 | Double_t v6 = fFinalFlowEta[t][pW][eW][nua][2]->GetBinContent(e); |
| 7583 | Double_t v8 = fFinalFlowEta[t][pW][eW][nua][3]->GetBinContent(e); |
| 7584 | |
| 7585 | //Double_t v2Error = fFinalFlow1D[t][pW][nua][1][0]->GetBinError(e); |
| 7586 | //Double_t v4Error = fFinalFlow1D[t][pW][nua][1][1]->GetBinError(e); |
| 7587 | //Double_t v6Error = fFinalFlow1D[t][pW][nua][1][2]->GetBinError(e); |
| 7588 | //Double_t v8Error = fFinalFlow1D[t][pW][nua][1][3]->GetBinError(e); |
| 9c1a9547 |
7589 | |
| 2aa4ebcd |
7590 | if(type == "RP") |
| 7591 | { |
| 7592 | fCommonHistsResults2nd->FillDifferentialFlowEtaRP(e,v2,0.); |
| 7593 | fCommonHistsResults4th->FillDifferentialFlowEtaRP(e,v4,0.); |
| 7594 | fCommonHistsResults6th->FillDifferentialFlowEtaRP(e,v6,0.); |
| 7595 | fCommonHistsResults8th->FillDifferentialFlowEtaRP(e,v8,0.); |
| 7596 | } else if(type == "POI") |
| 7597 | { |
| 7598 | fCommonHistsResults2nd->FillDifferentialFlowEtaPOI(e,v2,0.); |
| 7599 | fCommonHistsResults4th->FillDifferentialFlowEtaPOI(e,v4,0.); |
| 7600 | fCommonHistsResults6th->FillDifferentialFlowEtaPOI(e,v6,0.); |
| 7601 | fCommonHistsResults8th->FillDifferentialFlowEtaPOI(e,v8,0.); |
| 7602 | } |
| 7603 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) |
| 9c1a9547 |
7604 | |
| 2aa4ebcd |
7605 | } // end of void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights, Bool_t correctedForNUA) |
| bc92c0cb |
7606 | |
| 7607 | |
| 2aa4ebcd |
7608 | //================================================================================================================================ |
| bc92c0cb |
7609 | |
| dee1e0e0 |
7610 | |
| 2aa4ebcd |
7611 | void AliFlowAnalysisWithQCumulants::AccessConstants() |
| 7612 | { |
| 7613 | // access needed common constants from AliFlowCommonConstants |
| 7614 | |
| 7615 | fnBinsPhi = AliFlowCommonConstants::GetNbinsPhi(); |
| 7616 | fPhiMin = AliFlowCommonConstants::GetPhiMin(); |
| 7617 | fPhiMax = AliFlowCommonConstants::GetPhiMax(); |
| 7618 | if(fnBinsPhi) fPhiBinWidth = (fPhiMax-fPhiMin)/fnBinsPhi; |
| 7619 | fnBinsPt = AliFlowCommonConstants::GetNbinsPt(); |
| 7620 | fPtMin = AliFlowCommonConstants::GetPtMin(); |
| 7621 | fPtMax = AliFlowCommonConstants::GetPtMax(); |
| 7622 | if(fnBinsPt) fPtBinWidth = (fPtMax-fPtMin)/fnBinsPt; |
| 7623 | fnBinsEta = AliFlowCommonConstants::GetNbinsEta(); |
| 7624 | fEtaMin = AliFlowCommonConstants::GetEtaMin(); |
| 7625 | fEtaMax = AliFlowCommonConstants::GetEtaMax(); |
| 7626 | if(fnBinsEta) fEtaBinWidth = (fEtaMax-fEtaMin)/fnBinsEta; |
| 7627 | |
| 7628 | } // end of void AliFlowAnalysisWithQCumulants::AccessConstants() |
| 7629 | |
| 4057ba99 |
7630 | |
| c2a42ea2 |
7631 | //================================================================================================================================ |
| 7632 | |
| 7633 | |
| 7634 | void AliFlowAnalysisWithQCumulants::CalculateSumAndProductOfEventWeights() |
| 7635 | { |
| 7636 | // 1.) calculate sum of linear and quadratic event weights; |
| 7637 | // 2.) calculate products of event weights |
| 7638 | |
| 7639 | Double_t dMult = (*fSMpk)(0,0); // multiplicity (number of particles used to determine the reaction plane) |
| 7640 | |
| 7641 | Double_t eventWeight[4] = {0}; |
| 7642 | eventWeight[0] = dMult*(dMult-1); // event weight for <2> |
| 7643 | eventWeight[1] = dMult*(dMult-1)*(dMult-2)*(dMult-3); // event weight for <4> |
| 7644 | eventWeight[2] = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5); // event weight for <6> |
| 7645 | eventWeight[3] = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)*(dMult-6)*(dMult-7); // event weight for <8> |
| 7646 | |
| 7647 | for(Int_t p=0;p<2;p++) |
| 7648 | { |
| 7649 | for(Int_t c=0;c<4;c++) |
| 7650 | { |
| 7651 | fSumOfEventWeights[0][0][p]->Fill(c+0.5,pow(eventWeight[c],p+1)); |
| 7652 | } |
| 7653 | } |
| 7654 | |
| 7655 | // to be improved (hardwired pW and eW): |
| 7656 | fProductOfEventWeights[0][0]->Fill(0.5,eventWeight[0]*eventWeight[1]); |
| 7657 | fProductOfEventWeights[0][0]->Fill(1.5,eventWeight[0]*eventWeight[2]); |
| 7658 | fProductOfEventWeights[0][0]->Fill(2.5,eventWeight[0]*eventWeight[3]); |
| 7659 | fProductOfEventWeights[0][0]->Fill(3.5,eventWeight[1]*eventWeight[2]); |
| 7660 | fProductOfEventWeights[0][0]->Fill(4.5,eventWeight[1]*eventWeight[3]); |
| 7661 | fProductOfEventWeights[0][0]->Fill(5.5,eventWeight[2]*eventWeight[3]); |
| 7662 | |
| 7663 | } // end of void AliFlowAnalysisWithQCumulants::CalculateSumAndProductOfEventWeights() |
| 7664 | |
| 7665 | |
| 7666 | //================================================================================================================================ |
| 4057ba99 |
7667 | |
git://git.uio.no / u / mrichter / AliRoot.git / blame