]>
Commit | Line | Data |
---|---|---|
489d5531 | 1 | /************************************************************************* |
2 | * Copyright(c) 1998-2008, ALICE Experiment at CERN, All rights reserved. * | |
3 | * * | |
4 | * Author: The ALICE Off-line Project. * | |
5 | * Contributors are mentioned in the code where appropriate. * | |
6 | * * | |
7 | * Permission to use, copy, modify and distribute this software and its * | |
8 | * documentation strictly for non-commercial purposes is hereby granted * | |
9 | * without fee, provided that the above copyright notice appears in all * | |
10 | * copies and that both the copyright notice and this permission notice * | |
11 | * appear in the supporting documentation. The authors make no claims * | |
12 | * about the suitability of this software for any purpose. It is * | |
13 | * provided "as is" without express or implied warranty. * | |
14 | **************************************************************************/ | |
15 | ||
16 | /********************************** | |
17 | * flow analysis with Q-cumulants * | |
18 | * * | |
ff70ca91 | 19 | * author: Ante Bilandzic * |
20 | * (abilandzic@gmail.com) * | |
489d5531 | 21 | *********************************/ |
22 | ||
23 | #define AliFlowAnalysisWithQCumulants_cxx | |
24 | ||
25 | #include "Riostream.h" | |
26 | #include "AliFlowCommonConstants.h" | |
27 | #include "AliFlowCommonHist.h" | |
28 | #include "AliFlowCommonHistResults.h" | |
29 | #include "TChain.h" | |
30 | ||
31 | #include "TFile.h" | |
32 | #include "TList.h" | |
33 | #include "TGraph.h" | |
34 | #include "TParticle.h" | |
35 | #include "TRandom3.h" | |
36 | #include "TStyle.h" | |
37 | #include "TProfile.h" | |
38 | #include "TProfile2D.h" | |
489d5531 | 39 | #include "TMath.h" |
40 | #include "TArrow.h" | |
41 | #include "TPaveLabel.h" | |
42 | #include "TCanvas.h" | |
43 | #include "AliFlowEventSimple.h" | |
44 | #include "AliFlowTrackSimple.h" | |
45 | #include "AliFlowAnalysisWithQCumulants.h" | |
46 | #include "TArrayD.h" | |
47 | #include "TRandom.h" | |
48 | #include "TF1.h" | |
49 | ||
50 | class TH1; | |
51 | class TH2; | |
52 | class TGraph; | |
53 | class TPave; | |
54 | class TLatex; | |
55 | class TMarker; | |
56 | class TRandom3; | |
57 | class TObjArray; | |
58 | class TList; | |
59 | class TCanvas; | |
60 | class TSystem; | |
61 | class TROOT; | |
62 | class AliFlowVector; | |
63 | class TVector; | |
64 | ||
489d5531 | 65 | //================================================================================================================ |
66 | ||
489d5531 | 67 | ClassImp(AliFlowAnalysisWithQCumulants) |
68 | ||
69 | AliFlowAnalysisWithQCumulants::AliFlowAnalysisWithQCumulants(): | |
70 | // 0.) base: | |
71 | fHistList(NULL), | |
72 | // 1.) common: | |
73 | fCommonHists(NULL), | |
74 | fCommonHists2nd(NULL), | |
75 | fCommonHists4th(NULL), | |
76 | fCommonHists6th(NULL), | |
77 | fCommonHists8th(NULL), | |
78 | fCommonHistsResults2nd(NULL), | |
79 | fCommonHistsResults4th(NULL), | |
80 | fCommonHistsResults6th(NULL), | |
81 | fCommonHistsResults8th(NULL), | |
82 | fnBinsPhi(0), | |
83 | fPhiMin(0), | |
84 | fPhiMax(0), | |
85 | fPhiBinWidth(0), | |
86 | fnBinsPt(0), | |
87 | fPtMin(0), | |
88 | fPtMax(0), | |
89 | fPtBinWidth(0), | |
90 | fnBinsEta(0), | |
91 | fEtaMin(0), | |
92 | fEtaMax(0), | |
93 | fEtaBinWidth(0), | |
1268c371 | 94 | fCommonConstants(NULL), |
dd442cd2 | 95 | fFillMultipleControlHistograms(kFALSE), |
489d5531 | 96 | fHarmonic(2), |
97 | fAnalysisLabel(NULL), | |
98 | // 2a.) particle weights: | |
99 | fWeightsList(NULL), | |
100 | fUsePhiWeights(kFALSE), | |
101 | fUsePtWeights(kFALSE), | |
102 | fUseEtaWeights(kFALSE), | |
103 | fUseParticleWeights(NULL), | |
104 | fPhiWeights(NULL), | |
105 | fPtWeights(NULL), | |
106 | fEtaWeights(NULL), | |
107 | // 2b.) event weights: | |
108 | fMultiplicityWeight(NULL), | |
109 | // 3.) integrated flow: | |
110 | fIntFlowList(NULL), | |
111 | fIntFlowProfiles(NULL), | |
112 | fIntFlowResults(NULL), | |
113 | fIntFlowFlags(NULL), | |
b92ea2b9 | 114 | fApplyCorrectionForNUA(kFALSE), |
2001bc3a | 115 | fApplyCorrectionForNUAVsM(kFALSE), |
9da1a4f3 | 116 | fnBinsMult(10000), |
067e9bc8 | 117 | fMinMult(0.), |
118 | fMaxMult(10000.), | |
b77b6434 | 119 | fPropagateErrorAlsoFromNIT(kFALSE), |
8ed4edc7 | 120 | fCalculateCumulantsVsM(kFALSE), |
0dd3b008 | 121 | fMinimumBiasReferenceFlow(kTRUE), |
e5834fcb | 122 | fForgetAboutCovariances(kFALSE), |
123 | fStorePhiDistributionForOneEvent(kFALSE), | |
489d5531 | 124 | fReQ(NULL), |
125 | fImQ(NULL), | |
1268c371 | 126 | fSpk(NULL), |
489d5531 | 127 | fIntFlowCorrelationsEBE(NULL), |
128 | fIntFlowEventWeightsForCorrelationsEBE(NULL), | |
129 | fIntFlowCorrelationsAllEBE(NULL), | |
e5834fcb | 130 | fReferenceMultiplicityEBE(0.), |
489d5531 | 131 | fAvMultiplicity(NULL), |
132 | fIntFlowCorrelationsPro(NULL), | |
b40a910e | 133 | fIntFlowSquaredCorrelationsPro(NULL), |
489d5531 | 134 | fIntFlowCorrelationsAllPro(NULL), |
135 | fIntFlowExtraCorrelationsPro(NULL), | |
136 | fIntFlowProductOfCorrelationsPro(NULL), | |
0328db2d | 137 | fIntFlowProductOfCorrectionTermsForNUAPro(NULL), |
489d5531 | 138 | fIntFlowCorrelationsHist(NULL), |
139 | fIntFlowCorrelationsAllHist(NULL), | |
140 | fIntFlowCovariances(NULL), | |
141 | fIntFlowSumOfProductOfEventWeights(NULL), | |
0328db2d | 142 | fIntFlowCovariancesNUA(NULL), |
143 | fIntFlowSumOfProductOfEventWeightsNUA(NULL), | |
489d5531 | 144 | fIntFlowQcumulants(NULL), |
b92ea2b9 | 145 | fIntFlowQcumulantsRebinnedInM(NULL), |
146 | fIntFlowQcumulantsErrorSquaredRatio(NULL), | |
489d5531 | 147 | fIntFlow(NULL), |
b3dacf6b | 148 | fIntFlowRebinnedInM(NULL), |
2001bc3a | 149 | fIntFlowDetectorBias(NULL), |
489d5531 | 150 | // 4.) differential flow: |
151 | fDiffFlowList(NULL), | |
152 | fDiffFlowProfiles(NULL), | |
153 | fDiffFlowResults(NULL), | |
1268c371 | 154 | fDiffFlow2D(NULL), |
489d5531 | 155 | fDiffFlowFlags(NULL), |
1268c371 | 156 | fCalculateDiffFlow(kTRUE), |
157 | fCalculate2DDiffFlow(kFALSE), | |
489d5531 | 158 | // 5.) distributions: |
57340a27 | 159 | fDistributionsList(NULL), |
160 | fDistributionsFlags(NULL), | |
489d5531 | 161 | fStoreDistributions(kFALSE), |
e5834fcb | 162 | // 6.) various: |
163 | fVariousList(NULL), | |
164 | fPhiDistributionForOneEvent(NULL), | |
489d5531 | 165 | // x.) debugging and cross-checking: |
166 | fNestedLoopsList(NULL), | |
167 | fEvaluateIntFlowNestedLoops(kFALSE), | |
168 | fEvaluateDiffFlowNestedLoops(kFALSE), | |
169 | fMaxAllowedMultiplicity(10), | |
170 | fEvaluateNestedLoops(NULL), | |
171 | fIntFlowDirectCorrelations(NULL), | |
172 | fIntFlowExtraDirectCorrelations(NULL), | |
173 | fCrossCheckInPtBinNo(10), | |
3b552efe | 174 | fCrossCheckInEtaBinNo(20), |
489d5531 | 175 | fNoOfParticlesInBin(NULL) |
176 | { | |
177 | // constructor | |
178 | ||
179 | // base list to hold all output objects: | |
180 | fHistList = new TList(); | |
181 | fHistList->SetName("cobjQC"); | |
182 | fHistList->SetOwner(kTRUE); | |
183 | ||
184 | // list to hold histograms with phi, pt and eta weights: | |
185 | fWeightsList = new TList(); | |
186 | ||
187 | // multiplicity weight: | |
188 | fMultiplicityWeight = new TString("combinations"); | |
189 | ||
190 | // analysis label; | |
191 | fAnalysisLabel = new TString(); | |
192 | ||
193 | // initialize all arrays: | |
194 | this->InitializeArraysForIntFlow(); | |
195 | this->InitializeArraysForDiffFlow(); | |
196 | this->InitializeArraysForDistributions(); | |
e5834fcb | 197 | this->InitializeArraysForVarious(); |
489d5531 | 198 | this->InitializeArraysForNestedLoops(); |
199 | ||
200 | } // end of constructor | |
201 | ||
489d5531 | 202 | //================================================================================================================ |
203 | ||
489d5531 | 204 | AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants() |
205 | { | |
206 | // destructor | |
207 | ||
208 | delete fHistList; | |
209 | ||
210 | } // end of AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants() | |
211 | ||
489d5531 | 212 | //================================================================================================================ |
213 | ||
489d5531 | 214 | void AliFlowAnalysisWithQCumulants::Init() |
215 | { | |
3b552efe | 216 | // a) Cross check if the settings make sense before starting the QC adventure; |
489d5531 | 217 | // b) Access all common constants; |
218 | // c) Book all objects; | |
3b552efe | 219 | // d) Store flags for integrated and differential flow; |
489d5531 | 220 | // e) Store flags for distributions of corelations; |
221 | // f) Store harmonic which will be estimated. | |
3b552efe | 222 | |
489d5531 | 223 | //save old value and prevent histograms from being added to directory |
224 | //to avoid name clashes in case multiple analaysis objects are used | |
225 | //in an analysis | |
226 | Bool_t oldHistAddStatus = TH1::AddDirectoryStatus(); | |
227 | TH1::AddDirectory(kFALSE); | |
228 | ||
3b552efe | 229 | // a) Cross check if the settings make sense before starting the QC adventure; |
489d5531 | 230 | this->CrossCheckSettings(); |
1268c371 | 231 | // b) Access all common constants and book a profile to hold them: |
232 | this->CommonConstants("Init"); | |
489d5531 | 233 | // c) Book all objects: |
1268c371 | 234 | this->BookAndFillWeightsHistograms(); |
489d5531 | 235 | this->BookAndNestAllLists(); |
236 | this->BookCommonHistograms(); | |
237 | this->BookEverythingForIntegratedFlow(); | |
238 | this->BookEverythingForDifferentialFlow(); | |
1268c371 | 239 | this->BookEverythingFor2DDifferentialFlow(); |
489d5531 | 240 | this->BookEverythingForDistributions(); |
e5834fcb | 241 | this->BookEverythingForVarious(); |
489d5531 | 242 | this->BookEverythingForNestedLoops(); |
243 | // d) Store flags for integrated and differential flow: | |
244 | this->StoreIntFlowFlags(); | |
3b552efe | 245 | this->StoreDiffFlowFlags(); |
489d5531 | 246 | // e) Store flags for distributions of corelations: |
247 | this->StoreFlagsForDistributions(); | |
248 | // f) Store harmonic which will be estimated: | |
249 | this->StoreHarmonic(); | |
250 | ||
251 | TH1::AddDirectory(oldHistAddStatus); | |
252 | } // end of void AliFlowAnalysisWithQCumulants::Init() | |
253 | ||
489d5531 | 254 | //================================================================================================================ |
255 | ||
489d5531 | 256 | void AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent) |
257 | { | |
258 | // Running over data only in this method. | |
259 | ||
b3dacf6b | 260 | // a) Check all pointers used in this method; |
261 | // b) Define local variables; | |
262 | // c) Fill the common control histograms and call the method to fill fAvMultiplicity; | |
1268c371 | 263 | // d) Loop over data and calculate e-b-e quantities Q_{n,k}, S_{p,k} and s_{p,k}; |
264 | // e) Calculate the final expressions for S_{p,k} and s_{p,k} (important !!!!); | |
265 | // f) Call the methods which calculate correlations for reference flow; | |
266 | // g) Call the methods which calculate correlations for differential flow; | |
267 | // h) Call the methods which calculate correlations for 2D differential flow; | |
268 | // i) Distributions of correlations; | |
269 | // j) Store phi distribution for one event to illustrate flow; | |
270 | // k) Cross-check with nested loops correlators for reference flow; | |
271 | // l) Cross-check with nested loops correlators for differential flow; | |
272 | // m) Reset all event-by-event quantities (very important !!!!). | |
489d5531 | 273 | |
b3dacf6b | 274 | // a) Check all pointers used in this method: |
275 | this->CheckPointersUsedInMake(); | |
276 | ||
277 | // b) Define local variables: | |
489d5531 | 278 | Double_t dPhi = 0.; // azimuthal angle in the laboratory frame |
279 | Double_t dPt = 0.; // transverse momentum | |
280 | Double_t dEta = 0.; // pseudorapidity | |
489d5531 | 281 | Double_t wPhi = 1.; // phi weight |
282 | Double_t wPt = 1.; // pt weight | |
283 | Double_t wEta = 1.; // eta weight | |
38a1e8b3 | 284 | Double_t wTrack = 1.; // track weight |
1268c371 | 285 | Int_t nRP = anEvent->GetEventNSelTracksRP(); // number of RPs (i.e. number of reference particles) |
e5834fcb | 286 | fReferenceMultiplicityEBE = anEvent->GetReferenceMultiplicity(); // reference multiplicity for current event |
1268c371 | 287 | Double_t ptEta[2] = {0.,0.}; // 0 = dPt, 1 = dEta |
9f33751d | 288 | |
b3dacf6b | 289 | // c) Fill the common control histograms and call the method to fill fAvMultiplicity: |
489d5531 | 290 | this->FillCommonControlHistograms(anEvent); |
291 | this->FillAverageMultiplicities(nRP); | |
292 | ||
1268c371 | 293 | // d) Loop over data and calculate e-b-e quantities Q_{n,k}, S_{p,k} and s_{p,k}: |
9f33751d | 294 | Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = total number of primary tracks, i.e. nPrim = nRP + nPOI where: |
1268c371 | 295 | // nRP = # of reference particles; |
296 | // nPOI = # of particles of interest. | |
489d5531 | 297 | AliFlowTrackSimple *aftsTrack = NULL; |
1268c371 | 298 | Int_t n = fHarmonic; // shortcut for the harmonic |
489d5531 | 299 | for(Int_t i=0;i<nPrim;i++) |
300 | { | |
301 | aftsTrack=anEvent->GetTrack(i); | |
302 | if(aftsTrack) | |
303 | { | |
1268c371 | 304 | if(!(aftsTrack->InRPSelection() || aftsTrack->InPOISelection())){continue;} // safety measure: consider only tracks which are RPs or POIs |
489d5531 | 305 | if(aftsTrack->InRPSelection()) // RP condition: |
306 | { | |
307 | dPhi = aftsTrack->Phi(); | |
308 | dPt = aftsTrack->Pt(); | |
309 | dEta = aftsTrack->Eta(); | |
310 | if(fUsePhiWeights && fPhiWeights && fnBinsPhi) // determine phi weight for this particle: | |
311 | { | |
312 | wPhi = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(dPhi*fnBinsPhi/TMath::TwoPi()))); | |
313 | } | |
314 | if(fUsePtWeights && fPtWeights && fnBinsPt) // determine pt weight for this particle: | |
315 | { | |
316 | wPt = fPtWeights->GetBinContent(1+(Int_t)(TMath::Floor((dPt-fPtMin)/fPtBinWidth))); | |
317 | } | |
318 | if(fUseEtaWeights && fEtaWeights && fEtaBinWidth) // determine eta weight for this particle: | |
319 | { | |
320 | wEta = fEtaWeights->GetBinContent(1+(Int_t)(TMath::Floor((dEta-fEtaMin)/fEtaBinWidth))); | |
38a1e8b3 | 321 | } |
322 | // Access track weight: | |
323 | wTrack = aftsTrack->Weight(); | |
1268c371 | 324 | // Calculate Re[Q_{m*n,k}] and Im[Q_{m*n,k}] for this event (m = 1,2,...,6, k = 0,1,...,8): |
325 | for(Int_t m=0;m<6;m++) // to be improved - hardwired 6 | |
489d5531 | 326 | { |
1268c371 | 327 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 |
489d5531 | 328 | { |
38a1e8b3 | 329 | (*fReQ)(m,k)+=pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1)*n*dPhi); |
330 | (*fImQ)(m,k)+=pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1)*n*dPhi); | |
489d5531 | 331 | } |
332 | } | |
1268c371 | 333 | // Calculate S_{p,k} for this event (Remark: final calculation of S_{p,k} follows after the loop over data bellow): |
489d5531 | 334 | for(Int_t p=0;p<8;p++) |
335 | { | |
336 | for(Int_t k=0;k<9;k++) | |
337 | { | |
38a1e8b3 | 338 | (*fSpk)(p,k)+=pow(wPhi*wPt*wEta*wTrack,k); |
489d5531 | 339 | } |
340 | } | |
1268c371 | 341 | // Differential flow: |
342 | if(fCalculateDiffFlow || fCalculate2DDiffFlow) | |
489d5531 | 343 | { |
1268c371 | 344 | ptEta[0] = dPt; |
345 | ptEta[1] = dEta; | |
346 | // Calculate r_{m*n,k} and s_{p,k} (r_{m,k} is 'p-vector' for RPs): | |
347 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
489d5531 | 348 | { |
1268c371 | 349 | for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 |
489d5531 | 350 | { |
1268c371 | 351 | if(fCalculateDiffFlow) |
352 | { | |
353 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
354 | { | |
38a1e8b3 | 355 | fReRPQ1dEBE[0][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
356 | fImRPQ1dEBE[0][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 357 | if(m==0) // s_{p,k} does not depend on index m |
358 | { | |
38a1e8b3 | 359 | fs1dEBE[0][pe][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k),1.); |
1268c371 | 360 | } // end of if(m==0) // s_{p,k} does not depend on index m |
361 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
362 | } // end of if(fCalculateDiffFlow) | |
363 | if(fCalculate2DDiffFlow) | |
364 | { | |
38a1e8b3 | 365 | fReRPQ2dEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
366 | fImRPQ2dEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 367 | if(m==0) // s_{p,k} does not depend on index m |
368 | { | |
38a1e8b3 | 369 | fs2dEBE[0][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k),1.); |
1268c371 | 370 | } // end of if(m==0) // s_{p,k} does not depend on index m |
371 | } // end of if(fCalculate2DDiffFlow) | |
372 | } // end of for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 | |
373 | } // end of for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
374 | // Checking if RP particle is also POI particle: | |
375 | if(aftsTrack->InPOISelection()) | |
489d5531 | 376 | { |
1268c371 | 377 | // Calculate q_{m*n,k} and s_{p,k} ('q-vector' and 's' for RPs && POIs): |
378 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
489d5531 | 379 | { |
1268c371 | 380 | for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 |
489d5531 | 381 | { |
1268c371 | 382 | if(fCalculateDiffFlow) |
383 | { | |
384 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
385 | { | |
38a1e8b3 | 386 | fReRPQ1dEBE[2][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
387 | fImRPQ1dEBE[2][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 388 | if(m==0) // s_{p,k} does not depend on index m |
389 | { | |
38a1e8b3 | 390 | fs1dEBE[2][pe][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k),1.); |
1268c371 | 391 | } // end of if(m==0) // s_{p,k} does not depend on index m |
392 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
393 | } // end of if(fCalculateDiffFlow) | |
394 | if(fCalculate2DDiffFlow) | |
395 | { | |
38a1e8b3 | 396 | fReRPQ2dEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
397 | fImRPQ2dEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 398 | if(m==0) // s_{p,k} does not depend on index m |
399 | { | |
38a1e8b3 | 400 | fs2dEBE[2][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k),1.); |
1268c371 | 401 | } // end of if(m==0) // s_{p,k} does not depend on index m |
402 | } // end of if(fCalculate2DDiffFlow) | |
403 | } // end of for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 | |
404 | } // end of for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
405 | } // end of if(aftsTrack->InPOISelection()) | |
406 | } // end of if(fCalculateDiffFlow || fCalculate2DDiffFlow) | |
489d5531 | 407 | } // end of if(pTrack->InRPSelection()) |
489d5531 | 408 | if(aftsTrack->InPOISelection()) |
409 | { | |
410 | dPhi = aftsTrack->Phi(); | |
411 | dPt = aftsTrack->Pt(); | |
412 | dEta = aftsTrack->Eta(); | |
38a1e8b3 | 413 | wPhi = 1.; |
414 | wPt = 1.; | |
415 | wEta = 1.; | |
416 | wTrack = 1.; | |
417 | if(fUsePhiWeights && fPhiWeights && fnBinsPhi && aftsTrack->InRPSelection()) // determine phi weight for POI && RP particle: | |
418 | { | |
419 | wPhi = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(dPhi*fnBinsPhi/TMath::TwoPi()))); | |
420 | } | |
421 | if(fUsePtWeights && fPtWeights && fnBinsPt && aftsTrack->InRPSelection()) // determine pt weight for POI && RP particle: | |
422 | { | |
423 | wPt = fPtWeights->GetBinContent(1+(Int_t)(TMath::Floor((dPt-fPtMin)/fPtBinWidth))); | |
424 | } | |
425 | if(fUseEtaWeights && fEtaWeights && fEtaBinWidth && aftsTrack->InRPSelection()) // determine eta weight for POI && RP particle: | |
426 | { | |
427 | wEta = fEtaWeights->GetBinContent(1+(Int_t)(TMath::Floor((dEta-fEtaMin)/fEtaBinWidth))); | |
428 | } | |
429 | // Access track weight for POI && RP particle: | |
430 | if(aftsTrack->InRPSelection()) | |
431 | { | |
432 | wTrack = aftsTrack->Weight(); | |
433 | } | |
1268c371 | 434 | ptEta[0] = dPt; |
435 | ptEta[1] = dEta; | |
436 | // Calculate p_{m*n,k} ('p-vector' for POIs): | |
437 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
489d5531 | 438 | { |
1268c371 | 439 | for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 |
489d5531 | 440 | { |
1268c371 | 441 | if(fCalculateDiffFlow) |
442 | { | |
443 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
444 | { | |
38a1e8b3 | 445 | fReRPQ1dEBE[1][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
446 | fImRPQ1dEBE[1][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 447 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta |
448 | } // end of if(fCalculateDiffFlow) | |
449 | if(fCalculate2DDiffFlow) | |
450 | { | |
38a1e8b3 | 451 | fReRPQ2dEBE[1][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
452 | fImRPQ2dEBE[1][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 453 | } // end of if(fCalculate2DDiffFlow) |
454 | } // end of for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 | |
455 | } // end of for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
b77b6434 | 456 | } // end of if(pTrack->InPOISelection()) |
489d5531 | 457 | } else // to if(aftsTrack) |
458 | { | |
38a1e8b3 | 459 | printf("\n WARNING (QC): No particle (i.e. aftsTrack is a NULL pointer in AFAWQC::Make())!!!!\n\n"); |
489d5531 | 460 | } |
461 | } // end of for(Int_t i=0;i<nPrim;i++) | |
462 | ||
1268c371 | 463 | // e) Calculate the final expressions for S_{p,k} and s_{p,k} (important !!!!): |
489d5531 | 464 | for(Int_t p=0;p<8;p++) |
465 | { | |
466 | for(Int_t k=0;k<9;k++) | |
467 | { | |
1268c371 | 468 | (*fSpk)(p,k)=pow((*fSpk)(p,k),p+1); |
469 | // ... for the time being s_{p,k} dosn't need higher powers, so no need to finalize it here ... | |
470 | } // end of for(Int_t k=0;k<9;k++) | |
471 | } // end of for(Int_t p=0;p<8;p++) | |
489d5531 | 472 | |
1268c371 | 473 | // f) Call the methods which calculate correlations for reference flow: |
489d5531 | 474 | if(!fEvaluateIntFlowNestedLoops) |
475 | { | |
476 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
477 | { | |
1268c371 | 478 | if(nRP>1){this->CalculateIntFlowCorrelations();} // without using particle weights |
0328db2d | 479 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) |
489d5531 | 480 | { |
1268c371 | 481 | if(nRP>1){this->CalculateIntFlowCorrelationsUsingParticleWeights();} // with using particle weights |
482 | } | |
483 | // Whether or not using particle weights the following is calculated in the same way: | |
484 | if(nRP>3){this->CalculateIntFlowProductOfCorrelations();} | |
485 | if(nRP>1){this->CalculateIntFlowSumOfEventWeights();} | |
486 | if(nRP>1){this->CalculateIntFlowSumOfProductOfEventWeights();} | |
487 | // Non-isotropic terms: | |
b92ea2b9 | 488 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) |
489d5531 | 489 | { |
1268c371 | 490 | if(nRP>0){this->CalculateIntFlowCorrectionsForNUASinTerms();} |
491 | if(nRP>0){this->CalculateIntFlowCorrectionsForNUACosTerms();} | |
b92ea2b9 | 492 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) |
493 | { | |
1268c371 | 494 | if(nRP>0){this->CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights();} |
495 | if(nRP>0){this->CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights();} | |
496 | } | |
497 | // Whether or not using particle weights the following is calculated in the same way: | |
498 | if(nRP>0){this->CalculateIntFlowProductOfCorrectionTermsForNUA();} | |
499 | if(nRP>0){this->CalculateIntFlowSumOfEventWeightsNUA();} | |
500 | if(nRP>0){this->CalculateIntFlowSumOfProductOfEventWeightsNUA();} | |
489d5531 | 501 | } // end of if(!fEvaluateIntFlowNestedLoops) |
502 | ||
1268c371 | 503 | // g) Call the methods which calculate correlations for differential flow: |
504 | if(!fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) | |
489d5531 | 505 | { |
506 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
507 | { | |
1268c371 | 508 | // Without using particle weights: |
489d5531 | 509 | this->CalculateDiffFlowCorrelations("RP","Pt"); |
510 | this->CalculateDiffFlowCorrelations("RP","Eta"); | |
511 | this->CalculateDiffFlowCorrelations("POI","Pt"); | |
57340a27 | 512 | this->CalculateDiffFlowCorrelations("POI","Eta"); |
1268c371 | 513 | // Non-isotropic terms: |
b92ea2b9 | 514 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Pt"); |
515 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Eta"); | |
516 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Pt"); | |
517 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Eta"); | |
518 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Pt"); | |
519 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Eta"); | |
520 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Pt"); | |
521 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Eta"); | |
489d5531 | 522 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) |
523 | { | |
1268c371 | 524 | // With using particle weights: |
489d5531 | 525 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Pt"); |
526 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Eta"); | |
527 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Pt"); | |
528 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Eta"); | |
1268c371 | 529 | // Non-isotropic terms: |
b92ea2b9 | 530 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Pt"); |
531 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Eta"); | |
532 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Pt"); | |
533 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Eta"); | |
534 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Pt"); | |
535 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Eta"); | |
536 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Pt"); | |
537 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Eta"); | |
1268c371 | 538 | } |
539 | // Whether or not using particle weights the following is calculated in the same way: | |
489d5531 | 540 | this->CalculateDiffFlowProductOfCorrelations("RP","Pt"); |
541 | this->CalculateDiffFlowProductOfCorrelations("RP","Eta"); | |
542 | this->CalculateDiffFlowProductOfCorrelations("POI","Pt"); | |
543 | this->CalculateDiffFlowProductOfCorrelations("POI","Eta"); | |
544 | this->CalculateDiffFlowSumOfEventWeights("RP","Pt"); | |
545 | this->CalculateDiffFlowSumOfEventWeights("RP","Eta"); | |
546 | this->CalculateDiffFlowSumOfEventWeights("POI","Pt"); | |
547 | this->CalculateDiffFlowSumOfEventWeights("POI","Eta"); | |
548 | this->CalculateDiffFlowSumOfProductOfEventWeights("RP","Pt"); | |
549 | this->CalculateDiffFlowSumOfProductOfEventWeights("RP","Eta"); | |
550 | this->CalculateDiffFlowSumOfProductOfEventWeights("POI","Pt"); | |
551 | this->CalculateDiffFlowSumOfProductOfEventWeights("POI","Eta"); | |
1268c371 | 552 | } // end of if(!fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) |
489d5531 | 553 | |
1268c371 | 554 | // h) Call the methods which calculate correlations for 2D differential flow: |
555 | if(!fEvaluateDiffFlowNestedLoops && fCalculate2DDiffFlow) | |
556 | { | |
557 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
489d5531 | 558 | { |
1268c371 | 559 | // Without using particle weights: |
560 | this->Calculate2DDiffFlowCorrelations("RP"); | |
561 | this->Calculate2DDiffFlowCorrelations("POI"); | |
562 | // Non-isotropic terms: | |
563 | // ... to be ctd ... | |
564 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
565 | { | |
566 | // With using particle weights: | |
567 | // ... to be ctd ... | |
568 | // Non-isotropic terms: | |
569 | // ... to be ctd ... | |
570 | } | |
571 | // Whether or not using particle weights the following is calculated in the same way: | |
572 | // ... to be ctd ... | |
573 | } // end of if(!fEvaluateDiffFlowNestedLoops && fCalculate2DDiffFlow) | |
574 | ||
575 | // i) Distributions of correlations: | |
e5834fcb | 576 | if(fStoreDistributions){this->StoreDistributionsOfCorrelations();} |
577 | ||
1268c371 | 578 | // j) Store phi distribution for one event to illustrate flow: |
e5834fcb | 579 | if(fStorePhiDistributionForOneEvent){this->StorePhiDistributionForOneEvent(anEvent);} |
1268c371 | 580 | |
581 | // k) Cross-check with nested loops correlators for reference flow: | |
582 | if(fEvaluateIntFlowNestedLoops){this->EvaluateIntFlowNestedLoops(anEvent);} | |
583 | ||
584 | // l) Cross-check with nested loops correlators for differential flow: | |
585 | if(fEvaluateDiffFlowNestedLoops){this->EvaluateDiffFlowNestedLoops(anEvent);} | |
489d5531 | 586 | |
1268c371 | 587 | // m) Reset all event-by-event quantities (very important !!!!): |
489d5531 | 588 | this->ResetEventByEventQuantities(); |
589 | ||
590 | } // end of AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent) | |
591 | ||
489d5531 | 592 | //================================================================================================================================ |
593 | ||
489d5531 | 594 | void AliFlowAnalysisWithQCumulants::Finish() |
595 | { | |
596 | // Calculate the final results. | |
489d5531 | 597 | |
b3dacf6b | 598 | // a) Check all pointers used in this method; |
599 | // b) Acces the constants; | |
600 | // c) Access the flags; | |
b92ea2b9 | 601 | // d) Calculate reference cumulants (not corrected for detector effects); |
602 | // e) Correct reference cumulants for detector effects; | |
603 | // f) Calculate reference flow; | |
b77b6434 | 604 | // g) Store results for reference flow in AliFlowCommonHistResults and print them on the screen; |
b92ea2b9 | 605 | // h) Calculate the final results for differential flow (without/with weights); |
606 | // i) Correct the results for differential flow (without/with weights) for effects of non-uniform acceptance (NUA); | |
607 | // j) Calculate the final results for integrated flow (RP/POI) and store in AliFlowCommonHistResults; | |
608 | // k) Store results for differential flow in AliFlowCommonHistResults; | |
609 | // l) Print the final results for integrated flow (RP/POI) on the screen; | |
610 | // m) Cross-checking: Results from Q-vectors vs results from nested loops. | |
b3dacf6b | 611 | |
612 | // a) Check all pointers used in this method: | |
613 | this->CheckPointersUsedInFinish(); | |
614 | ||
615 | // b) Acces the constants: | |
1268c371 | 616 | this->CommonConstants("Finish"); |
489d5531 | 617 | |
b3dacf6b | 618 | if(fCommonHists && fCommonHists->GetHarmonic()) // to be improved (moved somewhere else) |
489d5531 | 619 | { |
b3dacf6b | 620 | fHarmonic = (Int_t)(fCommonHists->GetHarmonic())->GetBinContent(1); |
489d5531 | 621 | } |
b3dacf6b | 622 | |
1268c371 | 623 | // c) Access the flags: // to be improved (implement a method for this? should I store again the flags becose they can get modified with redoFinish?) |
b3dacf6b | 624 | fUsePhiWeights = (Bool_t)fUseParticleWeights->GetBinContent(1); |
625 | fUsePtWeights = (Bool_t)fUseParticleWeights->GetBinContent(2); | |
626 | fUseEtaWeights = (Bool_t)fUseParticleWeights->GetBinContent(3); | |
627 | fApplyCorrectionForNUA = (Bool_t)fIntFlowFlags->GetBinContent(3); | |
628 | fPrintFinalResults[0] = (Bool_t)fIntFlowFlags->GetBinContent(4); | |
629 | fPrintFinalResults[1] = (Bool_t)fIntFlowFlags->GetBinContent(5); | |
630 | fPrintFinalResults[2] = (Bool_t)fIntFlowFlags->GetBinContent(6); | |
631 | fPrintFinalResults[3] = (Bool_t)fIntFlowFlags->GetBinContent(7); | |
632 | fApplyCorrectionForNUAVsM = (Bool_t)fIntFlowFlags->GetBinContent(8); | |
b77b6434 | 633 | fPropagateErrorAlsoFromNIT = (Bool_t)fIntFlowFlags->GetBinContent(9); |
0dd3b008 | 634 | fCalculateCumulantsVsM = (Bool_t)fIntFlowFlags->GetBinContent(10); |
635 | fMinimumBiasReferenceFlow = (Bool_t)fIntFlowFlags->GetBinContent(11); | |
e5834fcb | 636 | fForgetAboutCovariances = (Bool_t)fIntFlowFlags->GetBinContent(12); |
637 | fStorePhiDistributionForOneEvent = (Bool_t)fIntFlowFlags->GetBinContent(13); | |
dd442cd2 | 638 | fFillMultipleControlHistograms = (Bool_t)fIntFlowFlags->GetBinContent(14); |
b3dacf6b | 639 | fEvaluateIntFlowNestedLoops = (Bool_t)fEvaluateNestedLoops->GetBinContent(1); |
640 | fEvaluateDiffFlowNestedLoops = (Bool_t)fEvaluateNestedLoops->GetBinContent(2); | |
489d5531 | 641 | fCrossCheckInPtBinNo = (Int_t)fEvaluateNestedLoops->GetBinContent(3); |
642 | fCrossCheckInEtaBinNo = (Int_t)fEvaluateNestedLoops->GetBinContent(4); | |
1268c371 | 643 | |
b92ea2b9 | 644 | // d) Calculate reference cumulants (not corrected for detector effects): |
489d5531 | 645 | this->FinalizeCorrelationsIntFlow(); |
646 | this->CalculateCovariancesIntFlow(); | |
647 | this->CalculateCumulantsIntFlow(); | |
489d5531 | 648 | |
b92ea2b9 | 649 | // e) Correct reference cumulants for detector effects: |
650 | this->FinalizeCorrectionTermsForNUAIntFlow(); | |
651 | this->CalculateCovariancesNUAIntFlow(); | |
652 | this->CalculateQcumulantsCorrectedForNUAIntFlow(); | |
653 | ||
654 | // f) Calculate reference flow: | |
655 | this->CalculateReferenceFlow(); | |
489d5531 | 656 | |
b77b6434 | 657 | // g) Store results for reference flow in AliFlowCommonHistResults and print them on the screen: |
489d5531 | 658 | this->FillCommonHistResultsIntFlow(); |
b3dacf6b | 659 | if(fPrintFinalResults[0]){this->PrintFinalResultsForIntegratedFlow("RF");} |
660 | if(fPrintFinalResults[3] && fCalculateCumulantsVsM){this->PrintFinalResultsForIntegratedFlow("RF, rebinned in M");} | |
489d5531 | 661 | |
1268c371 | 662 | // h) Calculate the final results for differential flow (without/with weights): |
663 | if(fCalculateDiffFlow) | |
664 | { | |
665 | this->FinalizeReducedCorrelations("RP","Pt"); | |
666 | this->FinalizeReducedCorrelations("RP","Eta"); | |
667 | this->FinalizeReducedCorrelations("POI","Pt"); | |
668 | this->FinalizeReducedCorrelations("POI","Eta"); | |
669 | this->CalculateDiffFlowCovariances("RP","Pt"); | |
670 | this->CalculateDiffFlowCovariances("RP","Eta"); | |
671 | this->CalculateDiffFlowCovariances("POI","Pt"); | |
672 | this->CalculateDiffFlowCovariances("POI","Eta"); | |
673 | this->CalculateDiffFlowCumulants("RP","Pt"); | |
674 | this->CalculateDiffFlowCumulants("RP","Eta"); | |
675 | this->CalculateDiffFlowCumulants("POI","Pt"); | |
676 | this->CalculateDiffFlowCumulants("POI","Eta"); | |
677 | this->CalculateDiffFlow("RP","Pt"); | |
678 | this->CalculateDiffFlow("RP","Eta"); | |
679 | this->CalculateDiffFlow("POI","Pt"); | |
680 | this->CalculateDiffFlow("POI","Eta"); | |
681 | } // if(fCalculateDiffFlow) | |
682 | ||
683 | // i) Correct the results for differential flow (without/with weights) for effects of non-uniform acceptance (NUA): | |
684 | if(fCalculateDiffFlow) | |
489d5531 | 685 | { |
686 | this->FinalizeCorrectionTermsForNUADiffFlow("RP","Pt"); | |
687 | this->FinalizeCorrectionTermsForNUADiffFlow("RP","Eta"); | |
688 | this->FinalizeCorrectionTermsForNUADiffFlow("POI","Pt"); | |
689 | this->FinalizeCorrectionTermsForNUADiffFlow("POI","Eta"); | |
690 | this->CalculateDiffFlowCumulantsCorrectedForNUA("RP","Pt"); | |
691 | this->CalculateDiffFlowCumulantsCorrectedForNUA("RP","Eta"); | |
692 | this->CalculateDiffFlowCumulantsCorrectedForNUA("POI","Pt"); | |
693 | this->CalculateDiffFlowCumulantsCorrectedForNUA("POI","Eta"); | |
1268c371 | 694 | if(fApplyCorrectionForNUA) |
695 | { | |
696 | this->CalculateDiffFlowCorrectedForNUA("RP","Pt"); | |
697 | this->CalculateDiffFlowCorrectedForNUA("RP","Eta"); | |
698 | this->CalculateDiffFlowCorrectedForNUA("POI","Pt"); | |
699 | this->CalculateDiffFlowCorrectedForNUA("POI","Eta"); | |
700 | } | |
701 | } // end of if(fCalculateDiffFlow && fApplyCorrectionForNUA) | |
702 | ||
703 | // i) Calcualate final results for 2D differential flow: | |
704 | if(fCalculate2DDiffFlow) | |
705 | { | |
706 | this->Calculate2DDiffFlowCumulants("RP"); | |
707 | this->Calculate2DDiffFlowCumulants("POI"); | |
708 | this->Calculate2DDiffFlow("RP"); | |
709 | this->Calculate2DDiffFlow("POI"); | |
710 | } // end of if(fCalculate2DDiffFlow) | |
711 | ||
712 | // j) Calculate the final results for integrated flow (RP/POI) and store in AliFlowCommonHistResults: | |
713 | if(fCalculateDiffFlow) | |
714 | { | |
715 | this->CalculateFinalResultsForRPandPOIIntegratedFlow("RP"); | |
716 | this->CalculateFinalResultsForRPandPOIIntegratedFlow("POI"); | |
3b552efe | 717 | } |
489d5531 | 718 | |
1268c371 | 719 | // k) Store results for differential flow in AliFlowCommonHistResults: |
720 | if(fCalculateDiffFlow) | |
721 | { | |
722 | this->FillCommonHistResultsDiffFlow("RP"); | |
723 | this->FillCommonHistResultsDiffFlow("POI"); | |
724 | } | |
725 | ||
726 | // l) Print the final results for integrated flow (RP/POI) on the screen: | |
727 | if(fPrintFinalResults[1] && fCalculateDiffFlow){this->PrintFinalResultsForIntegratedFlow("RP");} | |
728 | if(fPrintFinalResults[2] && fCalculateDiffFlow){this->PrintFinalResultsForIntegratedFlow("POI");} | |
729 | ||
730 | // m) Cross-checking: Results from Q-vectors vs results from nested loops: | |
731 | // m1) Reference flow: | |
489d5531 | 732 | if(fEvaluateIntFlowNestedLoops) |
733 | { | |
734 | this->CrossCheckIntFlowCorrelations(); | |
735 | this->CrossCheckIntFlowCorrectionTermsForNUA(); | |
1268c371 | 736 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights){this->CrossCheckIntFlowExtraCorrelations();} |
489d5531 | 737 | } // end of if(fEvaluateIntFlowNestedLoops) |
1268c371 | 738 | // m2) Differential flow: |
739 | if(fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) | |
489d5531 | 740 | { |
b3dacf6b | 741 | // Correlations: |
489d5531 | 742 | this->PrintNumberOfParticlesInSelectedBin(); |
743 | this->CrossCheckDiffFlowCorrelations("RP","Pt"); | |
744 | this->CrossCheckDiffFlowCorrelations("RP","Eta"); | |
745 | this->CrossCheckDiffFlowCorrelations("POI","Pt"); | |
746 | this->CrossCheckDiffFlowCorrelations("POI","Eta"); | |
b3dacf6b | 747 | // Correction terms for non-uniform acceptance: |
489d5531 | 748 | this->CrossCheckDiffFlowCorrectionTermsForNUA("RP","Pt"); |
749 | this->CrossCheckDiffFlowCorrectionTermsForNUA("RP","Eta"); | |
750 | this->CrossCheckDiffFlowCorrectionTermsForNUA("POI","Pt"); | |
751 | this->CrossCheckDiffFlowCorrectionTermsForNUA("POI","Eta"); | |
752 | } // end of if(fEvaluateDiffFlowNestedLoops) | |
753 | ||
754 | } // end of AliFlowAnalysisWithQCumulants::Finish() | |
755 | ||
489d5531 | 756 | //================================================================================================================================ |
757 | ||
1268c371 | 758 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowNestedLoops(AliFlowEventSimple* anEvent) |
759 | { | |
760 | // Evalauted all correlators for reference flow with nested loops. | |
761 | ||
762 | Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = nRP + nPOI | |
763 | if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 | |
764 | { | |
765 | // Without using particle weights: | |
766 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
767 | { | |
768 | // Correlations: | |
769 | this->CalculateIntFlowCorrelations(); // from Q-vectors | |
770 | this->EvaluateIntFlowCorrelationsWithNestedLoops(anEvent); // from nested loops (to be improved: do I have to pass here anEvent or not?) | |
771 | // Correction for non-uniform acceptance: | |
772 | this->CalculateIntFlowCorrectionsForNUASinTerms(); // from Q-vectors (sin terms) | |
773 | this->CalculateIntFlowCorrectionsForNUACosTerms(); // from Q-vectors (cos terms) | |
774 | this->EvaluateIntFlowCorrectionsForNUAWithNestedLoops(anEvent); // from nested loops (both sin and cos terms) | |
775 | } | |
776 | // Using particle weights: | |
777 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
778 | { | |
779 | // Correlations | |
780 | this->CalculateIntFlowCorrelationsUsingParticleWeights(); // from Q-vectors | |
781 | this->EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent); // from nested loops (to be improved: do I have to pass here anEvent or not?) | |
782 | // Correction for non-uniform acceptance: | |
783 | this->CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights(); // from Q-vectors (sin terms) | |
784 | this->CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights(); // from Q-vectors (cos terms) | |
785 | this->EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(anEvent); // from nested loops (both sin and cos terms) | |
786 | } | |
787 | } else if(nPrim>fMaxAllowedMultiplicity) // to if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) | |
788 | { | |
789 | cout<<endl; | |
790 | cout<<"Skipping the event because multiplicity is "<<nPrim<<". Too high to evaluate nested loops!"<<endl; | |
791 | } else | |
792 | { | |
793 | cout<<endl; | |
794 | cout<<"Skipping the event because multiplicity is "<<nPrim<<"."<<endl; | |
795 | } | |
796 | ||
797 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowNestedLoops(AliFlowEventSimple* anEvent) | |
798 | ||
799 | //================================================================================================================================ | |
800 | ||
801 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowNestedLoops(AliFlowEventSimple* anEvent) | |
802 | { | |
803 | // Evalauted all correlators for differential flow with nested loops. | |
804 | ||
805 | if(!fCalculateDiffFlow){return;} | |
806 | ||
807 | Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = nRP + nPOI | |
808 | if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 | |
809 | { | |
810 | // Without using particle weights: | |
811 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
812 | { | |
813 | // Reduced correlations: | |
814 | // Q-vectors: | |
815 | this->CalculateDiffFlowCorrelations("RP","Pt"); | |
816 | this->CalculateDiffFlowCorrelations("RP","Eta"); | |
817 | this->CalculateDiffFlowCorrelations("POI","Pt"); | |
818 | this->CalculateDiffFlowCorrelations("POI","Eta"); | |
819 | // Nested loops: | |
820 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"RP","Pt"); | |
821 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"RP","Eta"); | |
822 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"POI","Pt"); | |
823 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"POI","Eta"); | |
824 | // Reduced corrections for non-uniform acceptance: | |
825 | // Q-vectors: | |
826 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Pt"); | |
827 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Eta"); | |
828 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Pt"); | |
829 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Eta"); | |
830 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Pt"); | |
831 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Eta"); | |
832 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Pt"); | |
833 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Eta"); | |
834 | // Nested loops: | |
835 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"RP","Pt"); | |
836 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"RP","Eta"); | |
837 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"POI","Pt"); | |
838 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"POI","Eta"); | |
839 | } // end of if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
840 | // Using particle weights: | |
841 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
842 | { | |
843 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Pt"); | |
844 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Eta"); | |
845 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Pt"); | |
846 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Eta"); | |
847 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Pt"); | |
848 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Eta"); | |
849 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Pt"); | |
850 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Eta"); | |
851 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Pt"); | |
852 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Eta"); | |
853 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Pt"); | |
854 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Eta"); | |
855 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"RP","Pt"); | |
856 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"RP","Eta"); | |
857 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"POI","Pt"); | |
858 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"POI","Eta"); | |
859 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"RP","Pt"); | |
860 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"RP","Eta"); | |
861 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"POI","Pt"); | |
862 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"POI","Eta"); | |
863 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
864 | } // end of if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 | |
865 | ||
866 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowNestedLoops(AliFlowEventSimple* anEvent) | |
867 | ||
868 | //================================================================================================================================ | |
869 | ||
489d5531 | 870 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTerms() |
871 | { | |
b92ea2b9 | 872 | // Calculate correction terms for non-uniform acceptance of the detector for reference flow (cos terms). |
489d5531 | 873 | |
874 | // multiplicity: | |
1268c371 | 875 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 876 | |
877 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
878 | Double_t dReQ1n = (*fReQ)(0,0); | |
879 | Double_t dReQ2n = (*fReQ)(1,0); | |
880 | //Double_t dReQ3n = (*fReQ)(2,0); | |
881 | //Double_t dReQ4n = (*fReQ)(3,0); | |
882 | Double_t dImQ1n = (*fImQ)(0,0); | |
883 | Double_t dImQ2n = (*fImQ)(1,0); | |
884 | //Double_t dImQ3n = (*fImQ)(2,0); | |
885 | //Double_t dImQ4n = (*fImQ)(3,0); | |
886 | ||
887 | // ************************************************************* | |
888 | // **** corrections for non-uniform acceptance (cos terms): **** | |
889 | // ************************************************************* | |
890 | // | |
891 | // Remark 1: corrections for non-uniform acceptance (cos terms) calculated with non-weighted Q-vectors | |
892 | // are stored in 1D profile fQCorrectionsCos. | |
893 | // Remark 2: binning of fIntFlowCorrectionTermsForNUAPro[1] is organized as follows: | |
894 | // -------------------------------------------------------------------------------------------------------------------- | |
895 | // 1st bin: <<cos(n*(phi1))>> = cosP1n | |
896 | // 2nd bin: <<cos(n*(phi1+phi2))>> = cosP1nP1n | |
897 | // 3rd bin: <<cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1n | |
898 | // 4th bin: <<cos(n*(2phi1-phi2))>> = cosP2nM1n | |
899 | // -------------------------------------------------------------------------------------------------------------------- | |
900 | ||
901 | // 1-particle: | |
902 | Double_t cosP1n = 0.; // <<cos(n*(phi1))>> | |
903 | ||
904 | if(dMult>0) | |
905 | { | |
906 | cosP1n = dReQ1n/dMult; | |
907 | ||
908 | // average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for single event: | |
909 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(1,cosP1n); | |
0328db2d | 910 | // event weights for NUA terms: |
911 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(1,dMult); | |
489d5531 | 912 | |
913 | // final average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for all events: | |
914 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(0.5,cosP1n,dMult); | |
b3dacf6b | 915 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[1][0]->Fill(dMult+0.5,cosP1n,dMult);} |
489d5531 | 916 | } |
917 | ||
918 | // 2-particle: | |
3b552efe | 919 | Double_t cosP1nP1n = 0.; // <<cos(n*(phi1+phi2))>> |
489d5531 | 920 | Double_t cosP2nM1n = 0.; // <<cos(n*(2phi1-phi2))>> |
921 | ||
922 | if(dMult>1) | |
923 | { | |
924 | cosP1nP1n = (pow(dReQ1n,2)-pow(dImQ1n,2)-dReQ2n)/(dMult*(dMult-1)); | |
925 | cosP2nM1n = (dReQ2n*dReQ1n+dImQ2n*dImQ1n-dReQ1n)/(dMult*(dMult-1)); | |
926 | ||
927 | // average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for single event: | |
3b552efe | 928 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(2,cosP1nP1n); |
489d5531 | 929 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(4,cosP2nM1n); |
0328db2d | 930 | // event weights for NUA terms: |
931 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(2,dMult*(dMult-1)); | |
932 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(4,dMult*(dMult-1)); | |
933 | ||
489d5531 | 934 | // final average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for all events: |
3b552efe | 935 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(1.5,cosP1nP1n,dMult*(dMult-1)); |
489d5531 | 936 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(3.5,cosP2nM1n,dMult*(dMult-1)); |
b3dacf6b | 937 | if(fCalculateCumulantsVsM) |
938 | { | |
939 | fIntFlowCorrectionTermsForNUAVsMPro[1][1]->Fill(dMult+0.5,cosP1nP1n,dMult*(dMult-1)); | |
940 | fIntFlowCorrectionTermsForNUAVsMPro[1][3]->Fill(dMult+0.5,cosP2nM1n,dMult*(dMult-1)); | |
941 | } | |
489d5531 | 942 | } |
943 | ||
944 | // 3-particle: | |
945 | Double_t cosP1nM1nM1n = 0.; // <<cos(n*(phi1-phi2-phi3))>> | |
946 | ||
947 | if(dMult>2) | |
948 | { | |
949 | cosP1nM1nM1n = (dReQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))-dReQ1n*dReQ2n-dImQ1n*dImQ2n-2.*(dMult-1)*dReQ1n) | |
950 | / (dMult*(dMult-1)*(dMult-2)); | |
951 | ||
952 | // average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for single event: | |
953 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(3,cosP1nM1nM1n); | |
0328db2d | 954 | // event weights for NUA terms: |
955 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(3,dMult*(dMult-1)*(dMult-2)); | |
489d5531 | 956 | |
957 | // final average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for all events: | |
2001bc3a | 958 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(2.5,cosP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); |
b3dacf6b | 959 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[1][2]->Fill(dMult+0.5,cosP1nM1nM1n,dMult*(dMult-1)*(dMult-2));} |
489d5531 | 960 | } |
961 | ||
962 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTerms() | |
963 | ||
964 | ||
965 | //================================================================================================================================ | |
966 | ||
967 | ||
968 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTerms() | |
969 | { | |
970 | // calculate corrections for non-uniform acceptance of the detector for no-name integrated flow (sin terms) | |
971 | ||
972 | // multiplicity: | |
1268c371 | 973 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 974 | |
975 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
976 | Double_t dReQ1n = (*fReQ)(0,0); | |
977 | Double_t dReQ2n = (*fReQ)(1,0); | |
978 | //Double_t dReQ3n = (*fReQ)(2,0); | |
979 | //Double_t dReQ4n = (*fReQ)(3,0); | |
980 | Double_t dImQ1n = (*fImQ)(0,0); | |
981 | Double_t dImQ2n = (*fImQ)(1,0); | |
982 | //Double_t dImQ3n = (*fImQ)(2,0); | |
983 | //Double_t dImQ4n = (*fImQ)(3,0); | |
984 | ||
985 | // ************************************************************* | |
986 | // **** corrections for non-uniform acceptance (sin terms): **** | |
987 | // ************************************************************* | |
988 | // | |
989 | // Remark 1: corrections for non-uniform acceptance (sin terms) calculated with non-weighted Q-vectors | |
990 | // are stored in 1D profile fQCorrectionsSin. | |
991 | // Remark 2: binning of fIntFlowCorrectionTermsForNUAPro[0] is organized as follows: | |
992 | // -------------------------------------------------------------------------------------------------------------------- | |
993 | // 1st bin: <<sin(n*(phi1))>> = sinP1n | |
994 | // 2nd bin: <<sin(n*(phi1+phi2))>> = sinP1nP1n | |
995 | // 3rd bin: <<sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1n | |
996 | // 4th bin: <<sin(n*(2phi1-phi2))>> = sinP2nM1n | |
997 | // -------------------------------------------------------------------------------------------------------------------- | |
998 | ||
999 | // 1-particle: | |
1000 | Double_t sinP1n = 0.; // <sin(n*(phi1))> | |
1001 | ||
1002 | if(dMult>0) | |
1003 | { | |
1004 | sinP1n = dImQ1n/dMult; | |
1005 | ||
1006 | // average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for single event: | |
0328db2d | 1007 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(1,sinP1n); |
1008 | // event weights for NUA terms: | |
1009 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(1,dMult); | |
489d5531 | 1010 | |
1011 | // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
1012 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(0.5,sinP1n,dMult); | |
b3dacf6b | 1013 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[0][0]->Fill(dMult+0.5,sinP1n,dMult);} |
489d5531 | 1014 | } |
1015 | ||
1016 | // 2-particle: | |
1017 | Double_t sinP1nP1n = 0.; // <<sin(n*(phi1+phi2))>> | |
1018 | Double_t sinP2nM1n = 0.; // <<sin(n*(2phi1-phi2))>> | |
1019 | if(dMult>1) | |
1020 | { | |
3b552efe | 1021 | sinP1nP1n = (2.*dReQ1n*dImQ1n-dImQ2n)/(dMult*(dMult-1)); |
489d5531 | 1022 | sinP2nM1n = (dImQ2n*dReQ1n-dReQ2n*dImQ1n-dImQ1n)/(dMult*(dMult-1)); |
1023 | ||
1024 | // average non-weighted 2-particle correction (sin terms) for non-uniform acceptance for single event: | |
1025 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(2,sinP1nP1n); | |
3b552efe | 1026 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(4,sinP2nM1n); |
0328db2d | 1027 | // event weights for NUA terms: |
1028 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(2,dMult*(dMult-1)); | |
1029 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(4,dMult*(dMult-1)); | |
489d5531 | 1030 | |
1031 | // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
1032 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(1.5,sinP1nP1n,dMult*(dMult-1)); | |
1033 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(3.5,sinP2nM1n,dMult*(dMult-1)); | |
b3dacf6b | 1034 | if(fCalculateCumulantsVsM) |
1035 | { | |
1036 | fIntFlowCorrectionTermsForNUAVsMPro[0][1]->Fill(dMult+0.5,sinP1nP1n,dMult*(dMult-1)); | |
1037 | fIntFlowCorrectionTermsForNUAVsMPro[0][3]->Fill(dMult+0.5,sinP2nM1n,dMult*(dMult-1)); | |
1038 | } | |
489d5531 | 1039 | } |
1040 | ||
1041 | // 3-particle: | |
1042 | Double_t sinP1nM1nM1n = 0.; // <<sin(n*(phi1-phi2-phi3))>> | |
1043 | ||
1044 | if(dMult>2) | |
1045 | { | |
1046 | sinP1nM1nM1n = (-dImQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))+dReQ1n*dImQ2n-dImQ1n*dReQ2n+2.*(dMult-1)*dImQ1n) | |
1047 | / (dMult*(dMult-1)*(dMult-2)); | |
1048 | ||
1049 | // average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for single event: | |
1050 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(3,sinP1nM1nM1n); | |
0328db2d | 1051 | // event weights for NUA terms: |
1052 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(3,dMult*(dMult-1)*(dMult-2)); | |
489d5531 | 1053 | |
1054 | // final average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for all events: | |
2001bc3a | 1055 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(2.5,sinP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); |
b3dacf6b | 1056 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[0][2]->Fill(dMult+0.5,sinP1nM1nM1n,dMult*(dMult-1)*(dMult-2));} |
489d5531 | 1057 | } |
1058 | ||
1059 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTerms() | |
1060 | ||
489d5531 | 1061 | //================================================================================================================================ |
1062 | ||
489d5531 | 1063 | void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos) |
1064 | { | |
1268c371 | 1065 | // a) Get pointers for common control and common result histograms; |
1066 | // b) Get pointers for histograms holding particle weights; | |
1067 | // c) Get pointers for reference flow histograms; | |
1068 | // d) Get pointers for differential flow histograms; | |
1069 | // e) Get pointers for 2D differential flow histograms; | |
1070 | // f) Get pointers for nested loops' histograms. | |
489d5531 | 1071 | |
1072 | if(outputListHistos) | |
3b552efe | 1073 | { |
1074 | this->SetHistList(outputListHistos); | |
1075 | if(!fHistList) | |
1076 | { | |
1268c371 | 1077 | printf("\n WARNING (QC): fHistList is NULL in AFAWQC::GOH() !!!!\n\n"); |
3b552efe | 1078 | exit(0); |
489d5531 | 1079 | } |
1080 | this->GetPointersForCommonHistograms(); | |
1081 | this->GetPointersForParticleWeightsHistograms(); | |
1082 | this->GetPointersForIntFlowHistograms(); | |
1083 | this->GetPointersForDiffFlowHistograms(); | |
1268c371 | 1084 | this->GetPointersFor2DDiffFlowHistograms(); |
489d5531 | 1085 | this->GetPointersForNestedLoopsHistograms(); |
3b552efe | 1086 | } else |
1087 | { | |
1268c371 | 1088 | printf("\n WARNING (QC): outputListHistos is NULL in AFAWQC::GOH() !!!!\n\n"); |
3b552efe | 1089 | exit(0); |
489d5531 | 1090 | } |
1091 | ||
1092 | } // end of void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos) | |
ad87ae62 | 1093 | |
489d5531 | 1094 | //================================================================================================================================ |
1095 | ||
489d5531 | 1096 | TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) const |
ad87ae62 | 1097 | { |
489d5531 | 1098 | // project 2D profile onto pt axis to get 1D profile |
1099 | ||
1100 | Int_t nBinsPt = profilePtEta->GetNbinsX(); | |
1101 | Double_t dPtMin = (profilePtEta->GetXaxis())->GetXmin(); | |
1102 | Double_t dPtMax = (profilePtEta->GetXaxis())->GetXmax(); | |
1103 | ||
1104 | Int_t nBinsEta = profilePtEta->GetNbinsY(); | |
1105 | ||
1106 | TProfile *profilePt = new TProfile("","",nBinsPt,dPtMin,dPtMax); | |
1107 | ||
1108 | for(Int_t p=1;p<=nBinsPt;p++) | |
1109 | { | |
1110 | Double_t contentPt = 0.; | |
1111 | Double_t entryPt = 0.; | |
1112 | Double_t spreadPt = 0.; | |
1113 | Double_t sum1 = 0.; | |
1114 | Double_t sum2 = 0.; | |
1115 | Double_t sum3 = 0.; | |
1116 | for(Int_t e=1;e<=nBinsEta;e++) | |
1117 | { | |
1118 | contentPt += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))) | |
1119 | * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1120 | entryPt += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1121 | ||
1122 | sum1 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))) | |
1123 | * (pow(profilePtEta->GetBinError(profilePtEta->GetBin(p,e)),2.) | |
1124 | + pow(profilePtEta->GetBinContent(profilePtEta->GetBin(p,e)),2.)); | |
1125 | sum2 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1126 | sum3 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))) | |
1127 | * (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))); | |
1128 | } | |
1129 | if(sum2>0. && sum1/sum2-pow(sum3/sum2,2.) > 0.) | |
1130 | { | |
1131 | spreadPt = pow(sum1/sum2-pow(sum3/sum2,2.),0.5); | |
1132 | } | |
1133 | profilePt->SetBinContent(p,contentPt); | |
1134 | profilePt->SetBinEntries(p,entryPt); | |
1135 | { | |
1136 | profilePt->SetBinError(p,spreadPt); | |
1137 | } | |
1138 | ||
1139 | } | |
1140 | ||
1141 | return profilePt; | |
1142 | ||
1143 | } // end of TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) | |
1144 | ||
1145 | ||
1146 | //================================================================================================================================ | |
1147 | ||
1148 | ||
1149 | TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) const | |
1150 | { | |
1151 | // project 2D profile onto eta axis to get 1D profile | |
1152 | ||
1153 | Int_t nBinsEta = profilePtEta->GetNbinsY(); | |
1154 | Double_t dEtaMin = (profilePtEta->GetYaxis())->GetXmin(); | |
1155 | Double_t dEtaMax = (profilePtEta->GetYaxis())->GetXmax(); | |
1156 | ||
1157 | Int_t nBinsPt = profilePtEta->GetNbinsX(); | |
1158 | ||
1159 | TProfile *profileEta = new TProfile("","",nBinsEta,dEtaMin,dEtaMax); | |
1160 | ||
1161 | for(Int_t e=1;e<=nBinsEta;e++) | |
1162 | { | |
1163 | Double_t contentEta = 0.; | |
1164 | Double_t entryEta = 0.; | |
1165 | for(Int_t p=1;p<=nBinsPt;p++) | |
1166 | { | |
1167 | contentEta += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))) | |
1168 | * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1169 | entryEta += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1170 | } | |
1171 | profileEta->SetBinContent(e,contentEta); | |
1172 | profileEta->SetBinEntries(e,entryEta); | |
1173 | } | |
1174 | ||
1175 | return profileEta; | |
1176 | ||
1177 | } // end of TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) | |
1178 | ||
489d5531 | 1179 | //================================================================================================================================ |
1180 | ||
489d5531 | 1181 | void AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type) |
1182 | { | |
2001bc3a | 1183 | // Printing on the screen the final results for integrated flow (RF, POI and RP). |
489d5531 | 1184 | |
1185 | Int_t n = fHarmonic; | |
1186 | ||
489d5531 | 1187 | Double_t dVn[4] = {0.}; // array to hold Vn{2}, Vn{4}, Vn{6} and Vn{8} |
1188 | Double_t dVnErr[4] = {0.}; // array to hold errors of Vn{2}, Vn{4}, Vn{6} and Vn{8} | |
1189 | ||
2001bc3a | 1190 | if(type == "RF") |
489d5531 | 1191 | { |
0dd3b008 | 1192 | for(Int_t b=0;b<4;b++) |
1193 | { | |
b77b6434 | 1194 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlow())->GetBinContent(1); |
1195 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlow())->GetBinError(1); | |
1196 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlow())->GetBinContent(1); | |
1197 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlow())->GetBinError(1); | |
1198 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlow())->GetBinContent(1); | |
1199 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlow())->GetBinError(1); | |
1200 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlow())->GetBinContent(1); | |
1201 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlow())->GetBinError(1); | |
0dd3b008 | 1202 | } |
489d5531 | 1203 | } else if(type == "RP") |
1204 | { | |
1205 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinContent(1); | |
1206 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinError(1); | |
1207 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinContent(1); | |
1208 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinError(1); | |
1209 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinContent(1); | |
1210 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinError(1); | |
1211 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinContent(1); | |
1212 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinError(1); | |
1213 | } else if(type == "POI") | |
1214 | { | |
1215 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinContent(1); | |
1216 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinError(1); | |
1217 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinContent(1); | |
1218 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinError(1); | |
1219 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinContent(1); | |
1220 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinError(1); | |
1221 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinContent(1); | |
1222 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinError(1); | |
b77b6434 | 1223 | } else if(type == "RF, rebinned in M" && fCalculateCumulantsVsM) |
b3dacf6b | 1224 | { |
0dd3b008 | 1225 | for(Int_t b=0;b<4;b++) |
1226 | { | |
1227 | dVn[b] = fIntFlowRebinnedInM->GetBinContent(b+1); | |
1228 | dVnErr[b] = fIntFlowRebinnedInM->GetBinError(b+1); | |
1229 | } | |
b3dacf6b | 1230 | } |
489d5531 | 1231 | |
1232 | TString title = " flow estimates from Q-cumulants"; | |
1233 | TString subtitle = " ("; | |
b3dacf6b | 1234 | TString subtitle2 = " (rebinned in M)"; |
489d5531 | 1235 | |
b3dacf6b | 1236 | if(type != "RF, rebinned in M") |
489d5531 | 1237 | { |
b3dacf6b | 1238 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) |
1239 | { | |
1240 | subtitle.Append(type); | |
1241 | subtitle.Append(", without weights)"); | |
1242 | } else | |
1243 | { | |
1244 | subtitle.Append(type); | |
1245 | subtitle.Append(", with weights)"); | |
1246 | } | |
1247 | } else | |
489d5531 | 1248 | { |
b3dacf6b | 1249 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) |
1250 | { | |
1251 | subtitle.Append("RF"); | |
1252 | subtitle.Append(", without weights)"); | |
1253 | } else | |
1254 | { | |
1255 | subtitle.Append("RF"); | |
1256 | subtitle.Append(", with weights)"); | |
1257 | } | |
1258 | } | |
1259 | ||
489d5531 | 1260 | cout<<endl; |
1261 | cout<<"*************************************"<<endl; | |
1262 | cout<<"*************************************"<<endl; | |
1263 | cout<<title.Data()<<endl; | |
1264 | cout<<subtitle.Data()<<endl; | |
b3dacf6b | 1265 | if(type == "RF, rebinned in M"){cout<<subtitle2.Data()<<endl;} |
489d5531 | 1266 | cout<<endl; |
1267 | ||
1268 | for(Int_t i=0;i<4;i++) | |
1269 | { | |
2001bc3a | 1270 | cout<<" v_"<<n<<"{"<<2*(i+1)<<"} = "<<dVn[i]<<" +/- "<<dVnErr[i]<<endl; |
489d5531 | 1271 | } |
2001bc3a | 1272 | |
489d5531 | 1273 | cout<<endl; |
b92ea2b9 | 1274 | if(type == "RF") |
1275 | { | |
b77b6434 | 1276 | if(fApplyCorrectionForNUA) |
1277 | { | |
1278 | cout<<" detector bias (corrected for): "<<endl; | |
1279 | } else | |
1280 | { | |
1281 | cout<<" detector bias (not corrected for):"<<endl; | |
1282 | } | |
b92ea2b9 | 1283 | cout<<" to QC{2}: "<<fIntFlowDetectorBias->GetBinContent(1)<<" +/- "<<fIntFlowDetectorBias->GetBinError(1)<<endl; |
1284 | cout<<" to QC{4}: "<<fIntFlowDetectorBias->GetBinContent(2)<<" +/- "<<fIntFlowDetectorBias->GetBinError(2)<<endl; | |
1285 | cout<<endl; | |
1286 | } | |
b3dacf6b | 1287 | if(type == "RF" || type == "RF, rebinned in M") |
489d5531 | 1288 | { |
2001bc3a | 1289 | cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultRP()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultRP()->GetMean()<<endl; |
489d5531 | 1290 | } |
1291 | else if (type == "RP") | |
1292 | { | |
2001bc3a | 1293 | cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultRP()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultRP()->GetMean()<<endl; |
489d5531 | 1294 | } |
1295 | else if (type == "POI") | |
1296 | { | |
2001bc3a | 1297 | cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultPOI()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultPOI()->GetMean()<<endl; |
1298 | } | |
1299 | ||
489d5531 | 1300 | cout<<"*************************************"<<endl; |
1301 | cout<<"*************************************"<<endl; | |
1302 | cout<<endl; | |
1303 | ||
2001bc3a | 1304 | }// end of AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type="RF"); |
489d5531 | 1305 | |
1306 | //================================================================================================================================ | |
1307 | ||
489d5531 | 1308 | void AliFlowAnalysisWithQCumulants::WriteHistograms(TString outputFileName) |
1309 | { | |
1310 | //store the final results in output .root file | |
1311 | TFile *output = new TFile(outputFileName.Data(),"RECREATE"); | |
1312 | //output->WriteObject(fHistList, "cobjQC","SingleKey"); | |
1313 | fHistList->Write(fHistList->GetName(), TObject::kSingleKey); | |
1314 | delete output; | |
1315 | } | |
1316 | ||
1317 | ||
1318 | //================================================================================================================================ | |
1319 | ||
1320 | ||
1321 | void AliFlowAnalysisWithQCumulants::WriteHistograms(TDirectoryFile *outputFileName) | |
1322 | { | |
1323 | //store the final results in output .root file | |
1324 | fHistList->SetName("cobjQC"); | |
1325 | fHistList->SetOwner(kTRUE); | |
1326 | outputFileName->Add(fHistList); | |
1327 | outputFileName->Write(outputFileName->GetName(), TObject::kSingleKey); | |
1328 | } | |
1329 | ||
489d5531 | 1330 | //================================================================================================================================ |
1331 | ||
489d5531 | 1332 | void AliFlowAnalysisWithQCumulants::BookCommonHistograms() |
1333 | { | |
1334 | // Book common control histograms and common histograms for final results. | |
1268c371 | 1335 | // a) Book common control histograms; |
1336 | // b) Book common result histograms. | |
1337 | ||
1338 | // a) Book common control histograms: | |
1339 | // Common control histograms (all events): | |
489d5531 | 1340 | TString commonHistsName = "AliFlowCommonHistQC"; |
1341 | commonHistsName += fAnalysisLabel->Data(); | |
1342 | fCommonHists = new AliFlowCommonHist(commonHistsName.Data()); | |
1343 | fHistList->Add(fCommonHists); | |
1268c371 | 1344 | // Common control histograms (selected events): |
dd442cd2 | 1345 | if(fFillMultipleControlHistograms) |
1346 | { | |
1268c371 | 1347 | // Common control histogram filled for events with 2 and more reference particles: |
dd442cd2 | 1348 | TString commonHists2ndOrderName = "AliFlowCommonHist2ndOrderQC"; |
1349 | commonHists2ndOrderName += fAnalysisLabel->Data(); | |
1350 | fCommonHists2nd = new AliFlowCommonHist(commonHists2ndOrderName.Data()); | |
1351 | fHistList->Add(fCommonHists2nd); | |
1268c371 | 1352 | // Common control histogram filled for events with 2 and more reference particles: |
dd442cd2 | 1353 | TString commonHists4thOrderName = "AliFlowCommonHist4thOrderQC"; |
1354 | commonHists4thOrderName += fAnalysisLabel->Data(); | |
1355 | fCommonHists4th = new AliFlowCommonHist(commonHists4thOrderName.Data()); | |
1356 | fHistList->Add(fCommonHists4th); | |
1268c371 | 1357 | // Common control histogram filled for events with 6 and more reference particles: |
dd442cd2 | 1358 | TString commonHists6thOrderName = "AliFlowCommonHist6thOrderQC"; |
1359 | commonHists6thOrderName += fAnalysisLabel->Data(); | |
1360 | fCommonHists6th = new AliFlowCommonHist(commonHists6thOrderName.Data()); | |
1361 | fHistList->Add(fCommonHists6th); | |
1268c371 | 1362 | // Common control histogram filled for events with 8 and more reference particles: |
dd442cd2 | 1363 | TString commonHists8thOrderName = "AliFlowCommonHist8thOrderQC"; |
1364 | commonHists8thOrderName += fAnalysisLabel->Data(); | |
1365 | fCommonHists8th = new AliFlowCommonHist(commonHists8thOrderName.Data()); | |
1366 | fHistList->Add(fCommonHists8th); | |
1367 | } // end of if(fFillMultipleControlHistograms) | |
1368 | ||
1268c371 | 1369 | // b) Book common result histograms: |
1370 | // Common result histograms for QC{2}: | |
489d5531 | 1371 | TString commonHistResults2ndOrderName = "AliFlowCommonHistResults2ndOrderQC"; |
1372 | commonHistResults2ndOrderName += fAnalysisLabel->Data(); | |
1373 | fCommonHistsResults2nd = new AliFlowCommonHistResults(commonHistResults2ndOrderName.Data()); | |
1374 | fHistList->Add(fCommonHistsResults2nd); | |
1268c371 | 1375 | // Common result histograms for QC{4}: |
489d5531 | 1376 | TString commonHistResults4thOrderName = "AliFlowCommonHistResults4thOrderQC"; |
1377 | commonHistResults4thOrderName += fAnalysisLabel->Data(); | |
1378 | fCommonHistsResults4th = new AliFlowCommonHistResults(commonHistResults4thOrderName.Data()); | |
1379 | fHistList->Add(fCommonHistsResults4th); | |
1268c371 | 1380 | // Common result histograms for QC{6}: |
489d5531 | 1381 | TString commonHistResults6thOrderName = "AliFlowCommonHistResults6thOrderQC"; |
1382 | commonHistResults6thOrderName += fAnalysisLabel->Data(); | |
1383 | fCommonHistsResults6th = new AliFlowCommonHistResults(commonHistResults6thOrderName.Data()); | |
1384 | fHistList->Add(fCommonHistsResults6th); | |
1268c371 | 1385 | // Common result histograms for QC{8}: |
489d5531 | 1386 | TString commonHistResults8thOrderName = "AliFlowCommonHistResults8thOrderQC"; |
1387 | commonHistResults8thOrderName += fAnalysisLabel->Data(); | |
1388 | fCommonHistsResults8th = new AliFlowCommonHistResults(commonHistResults8thOrderName.Data()); | |
1389 | fHistList->Add(fCommonHistsResults8th); | |
1390 | ||
1391 | } // end of void AliFlowAnalysisWithQCumulants::BookCommonHistograms() | |
1392 | ||
489d5531 | 1393 | //================================================================================================================================ |
1394 | ||
489d5531 | 1395 | void AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms() |
1396 | { | |
1268c371 | 1397 | // Book and fill histograms which hold phi, pt and eta weights. |
489d5531 | 1398 | |
1399 | if(!fWeightsList) | |
1400 | { | |
1268c371 | 1401 | printf("\n WARNING (QC): fWeightsList is NULL in AFAWQC::BAFWH() !!!! \n\n"); |
489d5531 | 1402 | exit(0); |
1403 | } | |
1404 | ||
1405 | TString fUseParticleWeightsName = "fUseParticleWeightsQC"; | |
1406 | fUseParticleWeightsName += fAnalysisLabel->Data(); | |
1407 | fUseParticleWeights = new TProfile(fUseParticleWeightsName.Data(),"0 = particle weight not used, 1 = particle weight used ",3,0,3); | |
1408 | fUseParticleWeights->SetLabelSize(0.06); | |
1409 | (fUseParticleWeights->GetXaxis())->SetBinLabel(1,"w_{#phi}"); | |
1410 | (fUseParticleWeights->GetXaxis())->SetBinLabel(2,"w_{p_{T}}"); | |
1411 | (fUseParticleWeights->GetXaxis())->SetBinLabel(3,"w_{#eta}"); | |
1412 | fUseParticleWeights->Fill(0.5,(Int_t)fUsePhiWeights); | |
1413 | fUseParticleWeights->Fill(1.5,(Int_t)fUsePtWeights); | |
1414 | fUseParticleWeights->Fill(2.5,(Int_t)fUseEtaWeights); | |
1415 | fWeightsList->Add(fUseParticleWeights); | |
1416 | ||
1417 | if(fUsePhiWeights) | |
1418 | { | |
1419 | if(fWeightsList->FindObject("phi_weights")) | |
1420 | { | |
1421 | fPhiWeights = dynamic_cast<TH1F*>(fWeightsList->FindObject("phi_weights")); | |
1268c371 | 1422 | if(!fPhiWeights) |
1423 | { | |
1424 | printf("\n WARNING (QC): fPhiWeights is NULL in AFAWQC::BAFWH() !!!!\n\n"); | |
1425 | exit(0); | |
1426 | } | |
489d5531 | 1427 | if(TMath::Abs(fPhiWeights->GetBinWidth(1)-fPhiBinWidth)>pow(10.,-6.)) |
1428 | { | |
1429 | cout<<endl; | |
1430 | cout<<"WARNING (QC): Inconsistent binning in histograms for phi-weights throughout the code."<<endl; | |
1431 | cout<<endl; | |
6fbbbbf1 | 1432 | //exit(0); |
489d5531 | 1433 | } |
1434 | } else | |
1435 | { | |
1436 | cout<<"WARNING: fWeightsList->FindObject(\"phi_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1437 | exit(0); | |
1438 | } | |
1439 | } // end of if(fUsePhiWeights) | |
1440 | ||
1441 | if(fUsePtWeights) | |
1442 | { | |
1443 | if(fWeightsList->FindObject("pt_weights")) | |
1444 | { | |
1445 | fPtWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("pt_weights")); | |
1268c371 | 1446 | if(!fPtWeights) |
1447 | { | |
1448 | printf("\n WARNING (QC): fPtWeights is NULL in AFAWQC::BAFWH() !!!!\n\n"); | |
1449 | exit(0); | |
1450 | } | |
489d5531 | 1451 | if(TMath::Abs(fPtWeights->GetBinWidth(1)-fPtBinWidth)>pow(10.,-6.)) |
1452 | { | |
1453 | cout<<endl; | |
1454 | cout<<"WARNING (QC): Inconsistent binning in histograms for pt-weights throughout the code."<<endl; | |
1455 | cout<<endl; | |
6fbbbbf1 | 1456 | //exit(0); |
489d5531 | 1457 | } |
1458 | } else | |
1459 | { | |
1460 | cout<<"WARNING: fWeightsList->FindObject(\"pt_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1461 | exit(0); | |
1462 | } | |
1463 | } // end of if(fUsePtWeights) | |
1464 | ||
1465 | if(fUseEtaWeights) | |
1466 | { | |
1467 | if(fWeightsList->FindObject("eta_weights")) | |
1468 | { | |
1469 | fEtaWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("eta_weights")); | |
1268c371 | 1470 | if(!fEtaWeights) |
1471 | { | |
1472 | printf("\n WARNING (QC): fEtaWeights is NULL in AFAWQC::BAFWH() !!!!\n\n"); | |
1473 | exit(0); | |
1474 | } | |
489d5531 | 1475 | if(TMath::Abs(fEtaWeights->GetBinWidth(1)-fEtaBinWidth)>pow(10.,-6.)) |
1476 | { | |
1477 | cout<<endl; | |
1478 | cout<<"WARNING (QC): Inconsistent binning in histograms for eta-weights throughout the code."<<endl; | |
1479 | cout<<endl; | |
6fbbbbf1 | 1480 | //exit(0); |
489d5531 | 1481 | } |
1482 | } else | |
1483 | { | |
1484 | cout<<"WARNING: fUseEtaWeights && fWeightsList->FindObject(\"eta_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1485 | exit(0); | |
1486 | } | |
1487 | } // end of if(fUseEtaWeights) | |
1488 | ||
1489 | } // end of AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms() | |
1490 | ||
489d5531 | 1491 | //================================================================================================================================ |
1492 | ||
489d5531 | 1493 | void AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow() |
1494 | { | |
1495 | // Book all objects for integrated flow: | |
e5834fcb | 1496 | // a) Book profile to hold all flags for integrated flow; |
1497 | // b) Book event-by-event quantities; | |
1498 | // c) Book profiles; // to be improved (comment) | |
489d5531 | 1499 | // d) Book histograms holding the final results. |
1500 | ||
1501 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?) | |
1502 | TString powerFlag[2] = {"linear","quadratic"}; // to be improved (should I promote this to data members?) | |
1503 | ||
1504 | // a) Book profile to hold all flags for integrated flow: | |
1505 | TString intFlowFlagsName = "fIntFlowFlags"; | |
1506 | intFlowFlagsName += fAnalysisLabel->Data(); | |
dd442cd2 | 1507 | fIntFlowFlags = new TProfile(intFlowFlagsName.Data(),"Flags for Integrated Flow",14,0,14); |
489d5531 | 1508 | fIntFlowFlags->SetTickLength(-0.01,"Y"); |
1509 | fIntFlowFlags->SetMarkerStyle(25); | |
1510 | fIntFlowFlags->SetLabelSize(0.05); | |
1511 | fIntFlowFlags->SetLabelOffset(0.02,"Y"); | |
1512 | fIntFlowFlags->GetXaxis()->SetBinLabel(1,"Particle Weights"); | |
1513 | fIntFlowFlags->GetXaxis()->SetBinLabel(2,"Event Weights"); | |
1514 | fIntFlowFlags->GetXaxis()->SetBinLabel(3,"Corrected for NUA?"); | |
b3dacf6b | 1515 | fIntFlowFlags->GetXaxis()->SetBinLabel(4,"Print RF results"); |
489d5531 | 1516 | fIntFlowFlags->GetXaxis()->SetBinLabel(5,"Print RP results"); |
3b552efe | 1517 | fIntFlowFlags->GetXaxis()->SetBinLabel(6,"Print POI results"); |
b3dacf6b | 1518 | fIntFlowFlags->GetXaxis()->SetBinLabel(7,"Print RF (rebinned in M) results"); |
1519 | fIntFlowFlags->GetXaxis()->SetBinLabel(8,"Corrected for NUA vs M?"); | |
1520 | fIntFlowFlags->GetXaxis()->SetBinLabel(9,"Propagate errors to v_{n} from correlations?"); | |
1521 | fIntFlowFlags->GetXaxis()->SetBinLabel(10,"Calculate cumulants vs M"); | |
0dd3b008 | 1522 | fIntFlowFlags->GetXaxis()->SetBinLabel(11,"fMinimumBiasReferenceFlow"); |
8e1cefdd | 1523 | fIntFlowFlags->GetXaxis()->SetBinLabel(12,"fForgetAboutCovariances"); |
e5834fcb | 1524 | fIntFlowFlags->GetXaxis()->SetBinLabel(13,"fStorePhiDistributionForOneEvent"); |
dd442cd2 | 1525 | fIntFlowFlags->GetXaxis()->SetBinLabel(14,"fFillMultipleControlHistograms"); |
489d5531 | 1526 | fIntFlowList->Add(fIntFlowFlags); |
1527 | ||
1528 | // b) Book event-by-event quantities: | |
1529 | // Re[Q_{m*n,k}], Im[Q_{m*n,k}] and S_{p,k}^M: | |
8ed4edc7 | 1530 | fReQ = new TMatrixD(6,9); |
1531 | fImQ = new TMatrixD(6,9); | |
1268c371 | 1532 | fSpk = new TMatrixD(8,9); |
489d5531 | 1533 | // average correlations <2>, <4>, <6> and <8> for single event (bining is the same as in fIntFlowCorrelationsPro and fIntFlowCorrelationsHist): |
1534 | TString intFlowCorrelationsEBEName = "fIntFlowCorrelationsEBE"; | |
1535 | intFlowCorrelationsEBEName += fAnalysisLabel->Data(); | |
1536 | fIntFlowCorrelationsEBE = new TH1D(intFlowCorrelationsEBEName.Data(),intFlowCorrelationsEBEName.Data(),4,0,4); | |
1537 | // weights for average correlations <2>, <4>, <6> and <8> for single event: | |
1538 | TString intFlowEventWeightsForCorrelationsEBEName = "fIntFlowEventWeightsForCorrelationsEBE"; | |
1539 | intFlowEventWeightsForCorrelationsEBEName += fAnalysisLabel->Data(); | |
1540 | fIntFlowEventWeightsForCorrelationsEBE = new TH1D(intFlowEventWeightsForCorrelationsEBEName.Data(),intFlowEventWeightsForCorrelationsEBEName.Data(),4,0,4); | |
1541 | // average all correlations for single event (bining is the same as in fIntFlowCorrelationsAllPro and fIntFlowCorrelationsAllHist): | |
1542 | TString intFlowCorrelationsAllEBEName = "fIntFlowCorrelationsAllEBE"; | |
1543 | intFlowCorrelationsAllEBEName += fAnalysisLabel->Data(); | |
8ed4edc7 | 1544 | fIntFlowCorrelationsAllEBE = new TH1D(intFlowCorrelationsAllEBEName.Data(),intFlowCorrelationsAllEBEName.Data(),34,0,34); |
489d5531 | 1545 | // average correction terms for non-uniform acceptance for single event |
1546 | // (binning is the same as in fIntFlowCorrectionTermsForNUAPro[2] and fIntFlowCorrectionTermsForNUAHist[2]): | |
1547 | TString fIntFlowCorrectionTermsForNUAEBEName = "fIntFlowCorrectionTermsForNUAEBE"; | |
1548 | fIntFlowCorrectionTermsForNUAEBEName += fAnalysisLabel->Data(); | |
1549 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
1550 | { | |
b92ea2b9 | 1551 | fIntFlowCorrectionTermsForNUAEBE[sc] = new TH1D(Form("%s: %s terms",fIntFlowCorrectionTermsForNUAEBEName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4); |
489d5531 | 1552 | } |
0328db2d | 1553 | // event weights for terms for non-uniform acceptance: |
1554 | TString fIntFlowEventWeightForCorrectionTermsForNUAEBEName = "fIntFlowEventWeightForCorrectionTermsForNUAEBE"; | |
1555 | fIntFlowEventWeightForCorrectionTermsForNUAEBEName += fAnalysisLabel->Data(); | |
1556 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
1557 | { | |
b92ea2b9 | 1558 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc] = new TH1D(Form("%s: %s terms",fIntFlowEventWeightForCorrectionTermsForNUAEBEName.Data(),sinCosFlag[sc].Data()),Form("Event weights for terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4); // to be improved - 4 |
0328db2d | 1559 | } |
489d5531 | 1560 | // c) Book profiles: // to be improved (comment) |
1561 | // profile to hold average multiplicities and number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8: | |
1562 | TString avMultiplicityName = "fAvMultiplicity"; | |
1563 | avMultiplicityName += fAnalysisLabel->Data(); | |
1564 | fAvMultiplicity = new TProfile(avMultiplicityName.Data(),"Average Multiplicities of RPs",9,0,9); | |
1565 | fAvMultiplicity->SetTickLength(-0.01,"Y"); | |
1566 | fAvMultiplicity->SetMarkerStyle(25); | |
1567 | fAvMultiplicity->SetLabelSize(0.05); | |
1568 | fAvMultiplicity->SetLabelOffset(0.02,"Y"); | |
1569 | fAvMultiplicity->SetYTitle("Average Multiplicity"); | |
1570 | (fAvMultiplicity->GetXaxis())->SetBinLabel(1,"all evts"); | |
1571 | (fAvMultiplicity->GetXaxis())->SetBinLabel(2,"n_{RP} #geq 1"); | |
1572 | (fAvMultiplicity->GetXaxis())->SetBinLabel(3,"n_{RP} #geq 2"); | |
1573 | (fAvMultiplicity->GetXaxis())->SetBinLabel(4,"n_{RP} #geq 3"); | |
1574 | (fAvMultiplicity->GetXaxis())->SetBinLabel(5,"n_{RP} #geq 4"); | |
1575 | (fAvMultiplicity->GetXaxis())->SetBinLabel(6,"n_{RP} #geq 5"); | |
1576 | (fAvMultiplicity->GetXaxis())->SetBinLabel(7,"n_{RP} #geq 6"); | |
1577 | (fAvMultiplicity->GetXaxis())->SetBinLabel(8,"n_{RP} #geq 7"); | |
1578 | (fAvMultiplicity->GetXaxis())->SetBinLabel(9,"n_{RP} #geq 8"); | |
1579 | fIntFlowProfiles->Add(fAvMultiplicity); | |
b40a910e | 1580 | // Average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with wrong errors!): |
1581 | TString correlationFlag[4] = {"#LT#LT2#GT#GT","#LT#LT4#GT#GT","#LT#LT6#GT#GT","#LT#LT8#GT#GT"}; | |
489d5531 | 1582 | TString intFlowCorrelationsProName = "fIntFlowCorrelationsPro"; |
1583 | intFlowCorrelationsProName += fAnalysisLabel->Data(); | |
1584 | fIntFlowCorrelationsPro = new TProfile(intFlowCorrelationsProName.Data(),"Average correlations for all events",4,0,4,"s"); | |
b40a910e | 1585 | fIntFlowCorrelationsPro->Sumw2(); |
489d5531 | 1586 | fIntFlowCorrelationsPro->SetTickLength(-0.01,"Y"); |
1587 | fIntFlowCorrelationsPro->SetMarkerStyle(25); | |
1588 | fIntFlowCorrelationsPro->SetLabelSize(0.06); | |
1589 | fIntFlowCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
68a3b4b1 | 1590 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 1591 | { |
68a3b4b1 | 1592 | (fIntFlowCorrelationsPro->GetXaxis())->SetBinLabel(b+1,correlationFlag[b].Data()); |
b3dacf6b | 1593 | } |
489d5531 | 1594 | fIntFlowProfiles->Add(fIntFlowCorrelationsPro); |
b40a910e | 1595 | // Average correlations squared <<2>^2>, <<4>^2>, <<6>^2> and <<8>^2> for all events: |
1596 | TString squaredCorrelationFlag[4] = {"#LT#LT2#GT^{2}#GT","#LT#LT4#GT^{2}#GT","#LT#LT6#GT^{2}#GT","#LT#LT8#GT^{2}#GT"}; | |
1597 | TString intFlowSquaredCorrelationsProName = "fIntFlowSquaredCorrelationsPro"; | |
1598 | intFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
1599 | fIntFlowSquaredCorrelationsPro = new TProfile(intFlowSquaredCorrelationsProName.Data(),"Average squared correlations for all events",4,0,4,"s"); | |
1600 | fIntFlowSquaredCorrelationsPro->Sumw2(); | |
1601 | fIntFlowSquaredCorrelationsPro->SetTickLength(-0.01,"Y"); | |
1602 | fIntFlowSquaredCorrelationsPro->SetMarkerStyle(25); | |
1603 | fIntFlowSquaredCorrelationsPro->SetLabelSize(0.06); | |
1604 | fIntFlowSquaredCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
1605 | for(Int_t b=0;b<4;b++) | |
1606 | { | |
1607 | (fIntFlowSquaredCorrelationsPro->GetXaxis())->SetBinLabel(b+1,squaredCorrelationFlag[b].Data()); | |
1608 | } | |
1609 | fIntFlowProfiles->Add(fIntFlowSquaredCorrelationsPro); | |
b3dacf6b | 1610 | if(fCalculateCumulantsVsM) |
1611 | { | |
1612 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
1613 | { | |
b40a910e | 1614 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> versus multiplicity for all events (with wrong errors): |
b3dacf6b | 1615 | TString intFlowCorrelationsVsMProName = "fIntFlowCorrelationsVsMPro"; |
1616 | intFlowCorrelationsVsMProName += fAnalysisLabel->Data(); | |
1617 | fIntFlowCorrelationsVsMPro[ci] = new TProfile(Form("%s, %s",intFlowCorrelationsVsMProName.Data(),correlationFlag[ci].Data()), | |
1618 | Form("%s vs multiplicity",correlationFlag[ci].Data()), | |
b40a910e | 1619 | fnBinsMult,fMinMult,fMaxMult,"s"); |
1620 | fIntFlowCorrelationsVsMPro[ci]->Sumw2(); | |
b3dacf6b | 1621 | fIntFlowCorrelationsVsMPro[ci]->GetYaxis()->SetTitle(correlationFlag[ci].Data()); |
1622 | fIntFlowCorrelationsVsMPro[ci]->GetXaxis()->SetTitle("M"); | |
1623 | fIntFlowProfiles->Add(fIntFlowCorrelationsVsMPro[ci]); | |
b40a910e | 1624 | // average squared correlations <<2>^2>, <<4>^2>, <<6>^2> and <<8>^2> versus multiplicity for all events: |
1625 | TString intFlowSquaredCorrelationsVsMProName = "fIntFlowSquaredCorrelationsVsMPro"; | |
1626 | intFlowSquaredCorrelationsVsMProName += fAnalysisLabel->Data(); | |
1627 | fIntFlowSquaredCorrelationsVsMPro[ci] = new TProfile(Form("%s, %s",intFlowSquaredCorrelationsVsMProName.Data(),squaredCorrelationFlag[ci].Data()), | |
1628 | Form("%s vs multiplicity",squaredCorrelationFlag[ci].Data()), | |
1629 | fnBinsMult,fMinMult,fMaxMult,"s"); | |
1630 | fIntFlowSquaredCorrelationsVsMPro[ci]->Sumw2(); | |
1631 | fIntFlowSquaredCorrelationsVsMPro[ci]->GetYaxis()->SetTitle(squaredCorrelationFlag[ci].Data()); | |
1632 | fIntFlowSquaredCorrelationsVsMPro[ci]->GetXaxis()->SetTitle("M"); | |
1633 | fIntFlowProfiles->Add(fIntFlowSquaredCorrelationsVsMPro[ci]); | |
b3dacf6b | 1634 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index |
1635 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 1636 | // averaged all correlations for all events (with wrong errors!): |
1637 | TString intFlowCorrelationsAllProName = "fIntFlowCorrelationsAllPro"; | |
1638 | intFlowCorrelationsAllProName += fAnalysisLabel->Data(); | |
8ed4edc7 | 1639 | fIntFlowCorrelationsAllPro = new TProfile(intFlowCorrelationsAllProName.Data(),"Average correlations for all events",34,0,34,"s"); |
489d5531 | 1640 | fIntFlowCorrelationsAllPro->SetTickLength(-0.01,"Y"); |
1641 | fIntFlowCorrelationsAllPro->SetMarkerStyle(25); | |
1642 | fIntFlowCorrelationsAllPro->SetLabelSize(0.03); | |
1643 | fIntFlowCorrelationsAllPro->SetLabelOffset(0.01,"Y"); | |
1644 | // 2-p correlations: | |
1645 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(1,"<<2>>_{n|n}"); | |
1646 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(2,"<<2>>_{2n|2n}"); | |
1647 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(3,"<<2>>_{3n|3n}"); | |
1648 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(4,"<<2>>_{4n|4n}"); | |
1649 | // 3-p correlations: | |
1650 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(6,"<<3>>_{2n|n,n}"); | |
1651 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}"); | |
1652 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}"); | |
1653 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}"); | |
1654 | // 4-p correlations: | |
1655 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}"); | |
1656 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}"); | |
1657 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}"); | |
1658 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}"); | |
1659 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}"); | |
1660 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}"); | |
1661 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}"); | |
1662 | // 5-p correlations: | |
1663 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}"); | |
1664 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}"); | |
1665 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}"); | |
1666 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}"); | |
1667 | // 6-p correlations: | |
1668 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}"); | |
1669 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}"); | |
1670 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}"); | |
1671 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}"); | |
1672 | // 7-p correlations: | |
1673 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}"); | |
1674 | // 8-p correlations: | |
1675 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}"); | |
8ed4edc7 | 1676 | // EXTRA correlations: |
1677 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(33,"<<4>>_{4n,2n|3n,3n}"); | |
1678 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(34,"<<5>>_{2n,2n,2n|3n,3n}"); | |
489d5531 | 1679 | fIntFlowProfiles->Add(fIntFlowCorrelationsAllPro); |
1680 | // when particle weights are used some extra correlations appear: | |
1681 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
1682 | { | |
1683 | TString intFlowExtraCorrelationsProName = "fIntFlowExtraCorrelationsPro"; | |
1684 | intFlowExtraCorrelationsProName += fAnalysisLabel->Data(); | |
1685 | fIntFlowExtraCorrelationsPro = new TProfile(intFlowExtraCorrelationsProName.Data(),"Average extra correlations for all events",100,0,100,"s"); | |
1686 | fIntFlowExtraCorrelationsPro->SetTickLength(-0.01,"Y"); | |
1687 | fIntFlowExtraCorrelationsPro->SetMarkerStyle(25); | |
1688 | fIntFlowExtraCorrelationsPro->SetLabelSize(0.03); | |
1689 | fIntFlowExtraCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
1690 | // extra 2-p correlations: | |
1691 | (fIntFlowExtraCorrelationsPro->GetXaxis())->SetBinLabel(1,"<<w1^3 w2 cos(n*(phi1-phi2))>>"); | |
1692 | (fIntFlowExtraCorrelationsPro->GetXaxis())->SetBinLabel(2,"<<w1 w2 w3^2 cos(n*(phi1-phi2))>>"); | |
1693 | fIntFlowProfiles->Add(fIntFlowExtraCorrelationsPro); | |
1694 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
1695 | // average product of correlations <2>, <4>, <6> and <8>: | |
b3dacf6b | 1696 | TString productFlag[6] = {"<<2><4>>","<<2><6>>","<<2><8>>","<<4><6>>","<<4><8>>","<<6><8>>"}; |
489d5531 | 1697 | TString intFlowProductOfCorrelationsProName = "fIntFlowProductOfCorrelationsPro"; |
1698 | intFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
1699 | fIntFlowProductOfCorrelationsPro = new TProfile(intFlowProductOfCorrelationsProName.Data(),"Average products of correlations",6,0,6); | |
1700 | fIntFlowProductOfCorrelationsPro->SetTickLength(-0.01,"Y"); | |
1701 | fIntFlowProductOfCorrelationsPro->SetMarkerStyle(25); | |
1702 | fIntFlowProductOfCorrelationsPro->SetLabelSize(0.05); | |
1703 | fIntFlowProductOfCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
68a3b4b1 | 1704 | for(Int_t b=0;b<6;b++) |
b3dacf6b | 1705 | { |
68a3b4b1 | 1706 | (fIntFlowProductOfCorrelationsPro->GetXaxis())->SetBinLabel(b+1,productFlag[b].Data()); |
b3dacf6b | 1707 | } |
1708 | fIntFlowProfiles->Add(fIntFlowProductOfCorrelationsPro); | |
ff70ca91 | 1709 | // average product of correlations <2>, <4>, <6> and <8> versus multiplicity |
1710 | // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>] | |
b3dacf6b | 1711 | if(fCalculateCumulantsVsM) |
1712 | { | |
1713 | TString intFlowProductOfCorrelationsVsMProName = "fIntFlowProductOfCorrelationsVsMPro"; | |
1714 | intFlowProductOfCorrelationsVsMProName += fAnalysisLabel->Data(); | |
1715 | for(Int_t pi=0;pi<6;pi++) | |
1716 | { | |
1717 | fIntFlowProductOfCorrelationsVsMPro[pi] = new TProfile(Form("%s, %s",intFlowProductOfCorrelationsVsMProName.Data(),productFlag[pi].Data()), | |
1718 | Form("%s versus multiplicity",productFlag[pi].Data()), | |
1719 | fnBinsMult,fMinMult,fMaxMult); | |
1720 | fIntFlowProductOfCorrelationsVsMPro[pi]->GetXaxis()->SetTitle("M"); | |
1721 | fIntFlowProfiles->Add(fIntFlowProductOfCorrelationsVsMPro[pi]); | |
1722 | } // end of for(Int_t pi=0;pi<6;pi++) | |
1723 | } // end of if(fCalculateCumulantsVsM) | |
0328db2d | 1724 | // average product of correction terms for NUA: |
1725 | TString intFlowProductOfCorrectionTermsForNUAProName = "fIntFlowProductOfCorrectionTermsForNUAPro"; | |
1726 | intFlowProductOfCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
1727 | fIntFlowProductOfCorrectionTermsForNUAPro = new TProfile(intFlowProductOfCorrectionTermsForNUAProName.Data(),"Average products of correction terms for NUA",27,0,27); | |
1728 | fIntFlowProductOfCorrectionTermsForNUAPro->SetTickLength(-0.01,"Y"); | |
1729 | fIntFlowProductOfCorrectionTermsForNUAPro->SetMarkerStyle(25); | |
1730 | fIntFlowProductOfCorrectionTermsForNUAPro->SetLabelSize(0.05); | |
1731 | fIntFlowProductOfCorrectionTermsForNUAPro->SetLabelOffset(0.01,"Y"); | |
1732 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(1,"<<2><cos(#phi)>>"); | |
1733 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(2,"<<2><sin(#phi)>>"); | |
1734 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(3,"<<cos(#phi)><sin(#phi)>>"); | |
1735 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(4,"Cov(<2>,<cos(#phi_{1}+#phi_{2})>)"); | |
1736 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(5,"Cov(<2>,<sin(#phi_{1}+#phi_{2})>)"); | |
1737 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(6,"Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1738 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(7,"Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1739 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(8,"Cov(<4>,<cos(#phi)>)"); | |
1740 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(9,"Cov(<4>,<sin(#phi)>)"); | |
1741 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(10,"Cov(<4>,<cos(#phi_{1}+#phi_{2})>)"); | |
1742 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(11,"Cov(<4>,<sin(#phi_{1}+#phi_{2})>)"); | |
1743 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(12,"Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
1744 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(13,"Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
1745 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(14,"Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
1746 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(15,"Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
1747 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(16,"Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1748 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(17,"Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1749 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(18,"Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
1750 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(19,"Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
1751 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(20,"Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1752 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(21,"Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1753 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(22,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>)"); | |
1754 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(23,"Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1755 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(24,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1756 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(25,"Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1757 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(26,"Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1758 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(27,"Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>)"); | |
1759 | fIntFlowProfiles->Add(fIntFlowProductOfCorrectionTermsForNUAPro); | |
489d5531 | 1760 | // average correction terms for non-uniform acceptance (with wrong errors!): |
1761 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
1762 | { | |
1763 | TString intFlowCorrectionTermsForNUAProName = "fIntFlowCorrectionTermsForNUAPro"; | |
1764 | intFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
b92ea2b9 | 1765 | fIntFlowCorrectionTermsForNUAPro[sc] = new TProfile(Form("%s: %s terms",intFlowCorrectionTermsForNUAProName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4,"s"); |
489d5531 | 1766 | fIntFlowCorrectionTermsForNUAPro[sc]->SetTickLength(-0.01,"Y"); |
1767 | fIntFlowCorrectionTermsForNUAPro[sc]->SetMarkerStyle(25); | |
1768 | fIntFlowCorrectionTermsForNUAPro[sc]->SetLabelSize(0.03); | |
1769 | fIntFlowCorrectionTermsForNUAPro[sc]->SetLabelOffset(0.01,"Y"); | |
b92ea2b9 | 1770 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(1,Form("#LT#LT%s(n(phi1))#GT#GT",sinCosFlag[sc].Data())); |
1771 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(2,Form("#LT#LT%s(n(phi1+phi2))#GT#GT",sinCosFlag[sc].Data())); | |
1772 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(3,Form("#LT#LT%s(n(phi1-phi2-phi3))#GT#GT",sinCosFlag[sc].Data())); | |
1773 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(4,Form("#LT#LT%s(n(2phi1-phi2))#GT#GT",sinCosFlag[sc].Data())); | |
489d5531 | 1774 | fIntFlowProfiles->Add(fIntFlowCorrectionTermsForNUAPro[sc]); |
2001bc3a | 1775 | // versus multiplicity: |
b3dacf6b | 1776 | if(fCalculateCumulantsVsM) |
1777 | { | |
1778 | TString correctionTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4 | |
1779 | for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) | |
1780 | { | |
1781 | TString intFlowCorrectionTermsForNUAVsMProName = "fIntFlowCorrectionTermsForNUAVsMPro"; | |
1782 | intFlowCorrectionTermsForNUAVsMProName += fAnalysisLabel->Data(); | |
1783 | fIntFlowCorrectionTermsForNUAVsMPro[sc][ci] = new TProfile(Form("%s: #LT#LT%s%s#GT#GT",intFlowCorrectionTermsForNUAVsMProName.Data(),sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()),Form("#LT#LT%s%s#GT#GT vs M",sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()),fnBinsMult,fMinMult,fMaxMult,"s"); | |
1784 | fIntFlowProfiles->Add(fIntFlowCorrectionTermsForNUAVsMPro[sc][ci]); | |
1785 | } | |
1786 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 1787 | } // end of for(Int_t sc=0;sc<2;sc++) |
1788 | ||
1789 | // d) Book histograms holding the final results: | |
1790 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with correct errors!): | |
1791 | TString intFlowCorrelationsHistName = "fIntFlowCorrelationsHist"; | |
1792 | intFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
1793 | fIntFlowCorrelationsHist = new TH1D(intFlowCorrelationsHistName.Data(),"Average correlations for all events",4,0,4); | |
1794 | fIntFlowCorrelationsHist->SetTickLength(-0.01,"Y"); | |
1795 | fIntFlowCorrelationsHist->SetMarkerStyle(25); | |
1796 | fIntFlowCorrelationsHist->SetLabelSize(0.06); | |
1797 | fIntFlowCorrelationsHist->SetLabelOffset(0.01,"Y"); | |
1798 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(1,"<<2>>"); | |
1799 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(2,"<<4>>"); | |
1800 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(3,"<<6>>"); | |
1801 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(4,"<<8>>"); | |
1802 | fIntFlowResults->Add(fIntFlowCorrelationsHist); | |
ff70ca91 | 1803 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with correct errors!) vs M: |
b3dacf6b | 1804 | if(fCalculateCumulantsVsM) |
1805 | { | |
1806 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
1807 | { | |
1808 | TString intFlowCorrelationsVsMHistName = "fIntFlowCorrelationsVsMHist"; | |
1809 | intFlowCorrelationsVsMHistName += fAnalysisLabel->Data(); | |
1810 | fIntFlowCorrelationsVsMHist[ci] = new TH1D(Form("%s, %s",intFlowCorrelationsVsMHistName.Data(),correlationFlag[ci].Data()), | |
1811 | Form("%s vs multiplicity",correlationFlag[ci].Data()), | |
1812 | fnBinsMult,fMinMult,fMaxMult); | |
1813 | fIntFlowCorrelationsVsMHist[ci]->GetYaxis()->SetTitle(correlationFlag[ci].Data()); | |
1814 | fIntFlowCorrelationsVsMHist[ci]->GetXaxis()->SetTitle("M"); | |
1815 | fIntFlowResults->Add(fIntFlowCorrelationsVsMHist[ci]); | |
1816 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
1817 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 1818 | // average all correlations for all events (with correct errors!): |
1819 | TString intFlowCorrelationsAllHistName = "fIntFlowCorrelationsAllHist"; | |
1820 | intFlowCorrelationsAllHistName += fAnalysisLabel->Data(); | |
8ed4edc7 | 1821 | fIntFlowCorrelationsAllHist = new TH1D(intFlowCorrelationsAllHistName.Data(),"Average correlations for all events",34,0,34); |
489d5531 | 1822 | fIntFlowCorrelationsAllHist->SetTickLength(-0.01,"Y"); |
1823 | fIntFlowCorrelationsAllHist->SetMarkerStyle(25); | |
1824 | fIntFlowCorrelationsAllHist->SetLabelSize(0.03); | |
1825 | fIntFlowCorrelationsAllHist->SetLabelOffset(0.01,"Y"); | |
1826 | // 2-p correlations: | |
1827 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(1,"<<2>>_{n|n}"); | |
1828 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(2,"<<2>>_{2n|2n}"); | |
1829 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(3,"<<2>>_{3n|3n}"); | |
1830 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(4,"<<2>>_{4n|4n}"); | |
1831 | // 3-p correlations: | |
1832 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(6,"<<3>>_{2n|n,n}"); | |
1833 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}"); | |
1834 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}"); | |
1835 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}"); | |
1836 | // 4-p correlations: | |
1837 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}"); | |
1838 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}"); | |
1839 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}"); | |
1840 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}"); | |
1841 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}"); | |
1842 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}"); | |
1843 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}"); | |
1844 | // 5-p correlations: | |
1845 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}"); | |
1846 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}"); | |
1847 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}"); | |
1848 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}"); | |
1849 | // 6-p correlations: | |
1850 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}"); | |
1851 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}"); | |
1852 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}"); | |
1853 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}"); | |
1854 | // 7-p correlations: | |
1855 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}"); | |
1856 | // 8-p correlations: | |
1857 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}"); | |
1858 | fIntFlowResults->Add(fIntFlowCorrelationsAllHist); | |
1859 | // average correction terms for non-uniform acceptance (with correct errors!): | |
1860 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
1861 | { | |
1862 | TString intFlowCorrectionTermsForNUAHistName = "fIntFlowCorrectionTermsForNUAHist"; | |
1863 | intFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
b92ea2b9 | 1864 | fIntFlowCorrectionTermsForNUAHist[sc] = new TH1D(Form("%s: %s terms",intFlowCorrectionTermsForNUAHistName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4); |
489d5531 | 1865 | fIntFlowCorrectionTermsForNUAHist[sc]->SetTickLength(-0.01,"Y"); |
1866 | fIntFlowCorrectionTermsForNUAHist[sc]->SetMarkerStyle(25); | |
1867 | fIntFlowCorrectionTermsForNUAHist[sc]->SetLabelSize(0.03); | |
1868 | fIntFlowCorrectionTermsForNUAHist[sc]->SetLabelOffset(0.01,"Y"); | |
b92ea2b9 | 1869 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(1,Form("#LT#LT%s(n(#phi_{1}))#GT#GT",sinCosFlag[sc].Data())); |
1870 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(2,Form("#LT#LT%s(n(phi1+phi2))#GT#GT",sinCosFlag[sc].Data())); | |
1871 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(3,Form("#LT#LT%s(n(phi1-phi2-phi3))#GT#GT",sinCosFlag[sc].Data())); | |
1872 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(4,Form("#LT#LT%s(n(2phi1-phi2))#GT#GT",sinCosFlag[sc].Data())); | |
489d5531 | 1873 | fIntFlowResults->Add(fIntFlowCorrectionTermsForNUAHist[sc]); |
1874 | } // end of for(Int_t sc=0;sc<2;sc++) | |
1875 | // covariances (multiplied with weight dependent prefactor): | |
1876 | TString intFlowCovariancesName = "fIntFlowCovariances"; | |
1877 | intFlowCovariancesName += fAnalysisLabel->Data(); | |
1878 | fIntFlowCovariances = new TH1D(intFlowCovariancesName.Data(),"Covariances (multiplied with weight dependent prefactor)",6,0,6); | |
1879 | fIntFlowCovariances->SetLabelSize(0.04); | |
1880 | fIntFlowCovariances->SetMarkerStyle(25); | |
1881 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(1,"Cov(<2>,<4>)"); | |
1882 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(2,"Cov(<2>,<6>)"); | |
1883 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(3,"Cov(<2>,<8>)"); | |
1884 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(4,"Cov(<4>,<6>)"); | |
1885 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(5,"Cov(<4>,<8>)"); | |
1886 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(6,"Cov(<6>,<8>)"); | |
1887 | fIntFlowResults->Add(fIntFlowCovariances); | |
1888 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8>: | |
1889 | TString intFlowSumOfEventWeightsName = "fIntFlowSumOfEventWeights"; | |
1890 | intFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
1891 | for(Int_t power=0;power<2;power++) | |
1892 | { | |
1893 | fIntFlowSumOfEventWeights[power] = new TH1D(Form("%s: %s",intFlowSumOfEventWeightsName.Data(),powerFlag[power].Data()),Form("Sum of %s event weights for correlations",powerFlag[power].Data()),4,0,4); | |
1894 | fIntFlowSumOfEventWeights[power]->SetLabelSize(0.05); | |
1895 | fIntFlowSumOfEventWeights[power]->SetMarkerStyle(25); | |
1896 | if(power == 0) | |
1897 | { | |
1898 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>}"); | |
1899 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<4>}"); | |
1900 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<6>}"); | |
1901 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{<8>}"); | |
1902 | } else if (power == 1) | |
1903 | { | |
1904 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>}^{2}"); | |
1905 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<4>}^{2}"); | |
1906 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<6>}^{2}"); | |
1907 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{<8>}^{2}"); | |
1908 | } | |
1909 | fIntFlowResults->Add(fIntFlowSumOfEventWeights[power]); | |
1910 | } | |
1911 | // sum of products of event weights for correlations <2>, <4>, <6> and <8>: | |
1912 | TString intFlowSumOfProductOfEventWeightsName = "fIntFlowSumOfProductOfEventWeights"; | |
1913 | intFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
1914 | fIntFlowSumOfProductOfEventWeights = new TH1D(intFlowSumOfProductOfEventWeightsName.Data(),"Sum of product of event weights for correlations",6,0,6); | |
1915 | fIntFlowSumOfProductOfEventWeights->SetLabelSize(0.05); | |
1916 | fIntFlowSumOfProductOfEventWeights->SetMarkerStyle(25); | |
1917 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>} w_{<4>}"); | |
1918 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<2>} w_{<6>}"); | |
1919 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<2>} w_{<8>}"); | |
1920 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{<4>} w_{<6>}"); | |
1921 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(5,"#sum_{i=1}^{N} w_{<4>} w_{<8>}"); | |
1922 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(6,"#sum_{i=1}^{N} w_{<6>} w_{<8>}"); | |
1923 | fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeights); | |
ff70ca91 | 1924 | // final result for covariances of correlations (multiplied with weight dependent prefactor) versus M |
1925 | // [0=Cov(2,4),1=Cov(2,6),2=Cov(2,8),3=Cov(4,6),4=Cov(4,8),5=Cov(6,8)]: | |
b3dacf6b | 1926 | if(fCalculateCumulantsVsM) |
ff70ca91 | 1927 | { |
b3dacf6b | 1928 | TString intFlowCovariancesVsMName = "fIntFlowCovariancesVsM"; |
1929 | intFlowCovariancesVsMName += fAnalysisLabel->Data(); | |
1930 | TString covarianceFlag[6] = {"Cov(<2>,<4>)","Cov(<2>,<6>)","Cov(<2>,<8>)","Cov(<4>,<6>)","Cov(<4>,<8>)","Cov(<6>,<8>)"}; | |
1931 | for(Int_t ci=0;ci<6;ci++) | |
1932 | { | |
1933 | fIntFlowCovariancesVsM[ci] = new TH1D(Form("%s, %s",intFlowCovariancesVsMName.Data(),covarianceFlag[ci].Data()), | |
1934 | Form("%s vs multiplicity",covarianceFlag[ci].Data()), | |
1935 | fnBinsMult,fMinMult,fMaxMult); | |
1936 | fIntFlowCovariancesVsM[ci]->GetYaxis()->SetTitle(covarianceFlag[ci].Data()); | |
1937 | fIntFlowCovariancesVsM[ci]->GetXaxis()->SetTitle("M"); | |
1938 | fIntFlowResults->Add(fIntFlowCovariancesVsM[ci]); | |
1939 | } | |
1940 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 1941 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8> versus multiplicity |
1942 | // [0=sum{w_{<2>}},1=sum{w_{<4>}},2=sum{w_{<6>}},3=sum{w_{<8>}}][0=linear 1,1=quadratic]: | |
b3dacf6b | 1943 | if(fCalculateCumulantsVsM) |
ff70ca91 | 1944 | { |
b3dacf6b | 1945 | TString intFlowSumOfEventWeightsVsMName = "fIntFlowSumOfEventWeightsVsM"; |
1946 | intFlowSumOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
1947 | TString sumFlag[2][4] = {{"#sum_{i=1}^{N} w_{<2>}","#sum_{i=1}^{N} w_{<4>}","#sum_{i=1}^{N} w_{<6>}","#sum_{i=1}^{N} w_{<8>}"}, | |
1948 | {"#sum_{i=1}^{N} w_{<2>}^{2}","#sum_{i=1}^{N} w_{<4>}^{2}","#sum_{i=1}^{N} w_{<6>}^{2}","#sum_{i=1}^{N} w_{<8>}^{2}"}}; | |
1949 | for(Int_t si=0;si<4;si++) | |
ff70ca91 | 1950 | { |
b3dacf6b | 1951 | for(Int_t power=0;power<2;power++) |
1952 | { | |
1953 | fIntFlowSumOfEventWeightsVsM[si][power] = new TH1D(Form("%s, %s",intFlowSumOfEventWeightsVsMName.Data(),sumFlag[power][si].Data()), | |
1954 | Form("%s vs multiplicity",sumFlag[power][si].Data()), | |
1955 | fnBinsMult,fMinMult,fMaxMult); | |
1956 | fIntFlowSumOfEventWeightsVsM[si][power]->GetYaxis()->SetTitle(sumFlag[power][si].Data()); | |
1957 | fIntFlowSumOfEventWeightsVsM[si][power]->GetXaxis()->SetTitle("M"); | |
1958 | fIntFlowResults->Add(fIntFlowSumOfEventWeightsVsM[si][power]); | |
1959 | } // end of for(Int_t power=0;power<2;power++) | |
1960 | } // end of for(Int_t si=0;si<4;si++) | |
1961 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 1962 | // sum of products of event weights for correlations <2>, <4>, <6> and <8> vs M |
1963 | // [0=sum{w_{<2>}w_{<4>}},1=sum{w_{<2>}w_{<6>}},2=sum{w_{<2>}w_{<8>}}, | |
1964 | // 3=sum{w_{<4>}w_{<6>}},4=sum{w_{<4>}w_{<8>}},5=sum{w_{<6>}w_{<8>}}]: | |
b3dacf6b | 1965 | if(fCalculateCumulantsVsM) |
1966 | { | |
1967 | TString intFlowSumOfProductOfEventWeightsVsMName = "fIntFlowSumOfProductOfEventWeightsVsM"; | |
1968 | intFlowSumOfProductOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
1969 | TString sopowFlag[6] = {"#sum_{i=1}^{N} w_{<2>} w_{<4>}","#sum_{i=1}^{N} w_{<2>} w_{<6>}","#sum_{i=1}^{N} w_{<2>} w_{<8>}", | |
1970 | "#sum_{i=1}^{N} w_{<4>} w_{<6>}","#sum_{i=1}^{N} w_{<4>} w_{<8>}","#sum_{i=1}^{N} w_{<6>} w_{<8>}"}; | |
1971 | for(Int_t pi=0;pi<6;pi++) | |
1972 | { | |
1973 | fIntFlowSumOfProductOfEventWeightsVsM[pi] = new TH1D(Form("%s, %s",intFlowSumOfProductOfEventWeightsVsMName.Data(),sopowFlag[pi].Data()), | |
1974 | Form("%s versus multiplicity",sopowFlag[pi].Data()), | |
1975 | fnBinsMult,fMinMult,fMaxMult); | |
1976 | fIntFlowSumOfProductOfEventWeightsVsM[pi]->GetXaxis()->SetTitle("M"); | |
1977 | fIntFlowSumOfProductOfEventWeightsVsM[pi]->GetYaxis()->SetTitle(sopowFlag[pi].Data()); | |
1978 | fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeightsVsM[pi]); | |
1979 | } // end of for(Int_t pi=0;pi<6;pi++) | |
1980 | } // end of if(fCalculateCumulantsVsM) | |
0328db2d | 1981 | // covariances of NUA terms (multiplied with weight dependent prefactor): |
1982 | TString intFlowCovariancesNUAName = "fIntFlowCovariancesNUA"; | |
1983 | intFlowCovariancesNUAName += fAnalysisLabel->Data(); | |
1984 | fIntFlowCovariancesNUA = new TH1D(intFlowCovariancesNUAName.Data(),"Covariances for NUA (multiplied with weight dependent prefactor)",27,0,27); | |
1985 | fIntFlowCovariancesNUA->SetLabelSize(0.04); | |
1986 | fIntFlowCovariancesNUA->SetMarkerStyle(25); | |
1987 | fIntFlowCovariancesNUA->GetXaxis()->SetLabelSize(0.02); | |
1988 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(1,"Cov(<2>,<cos(#phi)>"); | |
1989 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(2,"Cov(<2>,<sin(#phi)>)"); | |
1990 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(3,"Cov(<cos(#phi)>,<sin(#phi)>)"); | |
1991 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(4,"Cov(<2>,<cos(#phi_{1}+#phi_{2})>)"); | |
1992 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(5,"Cov(<2>,<sin(#phi_{1}+#phi_{2})>)"); | |
1993 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(6,"Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1994 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(7,"Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1995 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(8,"Cov(<4>,<cos(#phi)>)"); | |
1996 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(9,"Cov(<4>,<sin(#phi)>)"); | |
1997 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(10,"Cov(<4>,<cos(#phi_{1}+#phi_{2})>)"); | |
1998 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(11,"Cov(<4>,<sin(#phi_{1}+#phi_{2})>)"); | |
1999 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(12,"Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
2000 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(13,"Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
2001 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(14,"Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
2002 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(15,"Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
2003 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(16,"Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2004 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(17,"Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2005 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(18,"Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
2006 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(19,"Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
2007 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(20,"Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2008 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(21,"Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2009 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(22,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>)"); | |
2010 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(23,"Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2011 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(24,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2012 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(25,"Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2013 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(26,"Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2014 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(27,"Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>)"); | |
2015 | fIntFlowResults->Add(fIntFlowCovariancesNUA); | |
2016 | // sum of linear and quadratic event weights for NUA terms: | |
2017 | TString intFlowSumOfEventWeightsNUAName = "fIntFlowSumOfEventWeightsNUA"; | |
2018 | intFlowSumOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
2019 | for(Int_t sc=0;sc<2;sc++) | |
2020 | { | |
2021 | for(Int_t power=0;power<2;power++) | |
2022 | { | |
b92ea2b9 | 2023 | fIntFlowSumOfEventWeightsNUA[sc][power] = new TH1D(Form("%s: %s, %s",intFlowSumOfEventWeightsNUAName.Data(),powerFlag[power].Data(),sinCosFlag[sc].Data()),Form("Sum of %s event weights for NUA %s terms",powerFlag[power].Data(),sinCosFlag[sc].Data()),4,0,4); // to be improved - 4 |
0328db2d | 2024 | fIntFlowSumOfEventWeightsNUA[sc][power]->SetLabelSize(0.05); |
2025 | fIntFlowSumOfEventWeightsNUA[sc][power]->SetMarkerStyle(25); | |
2026 | if(power == 0) | |
2027 | { | |
2028 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(1,Form("#sum_{i=1}^{N} w_{<%s(#phi)>}",sinCosFlag[sc].Data())); | |
2029 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(2,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}+#phi_{2})>}",sinCosFlag[sc].Data())); | |
b92ea2b9 | 2030 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(3,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}-#phi_{2}-#phi_{3})>}",sinCosFlag[sc].Data())); |
2031 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(4,Form("#sum_{i=1}^{N} w_{<%s(2#phi_{1}-#phi_{2})>}",sinCosFlag[sc].Data())); | |
0328db2d | 2032 | } else if(power == 1) |
2033 | { | |
2034 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(1,Form("#sum_{i=1}^{N} w_{<%s(#phi)>}^{2}",sinCosFlag[sc].Data())); | |
2035 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(2,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}+#phi_{2})>}^{2}",sinCosFlag[sc].Data())); | |
2036 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(3,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}-#phi_{2}-#phi_{3})>}^{2}",sinCosFlag[sc].Data())); | |
b92ea2b9 | 2037 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(4,Form("#sum_{i=1}^{N} w_{<%s(2#phi_{1}-#phi_{2})>}^{2}",sinCosFlag[sc].Data())); |
0328db2d | 2038 | } |
2039 | fIntFlowResults->Add(fIntFlowSumOfEventWeightsNUA[sc][power]); | |
2040 | } | |
2041 | } | |
2042 | // sum of products of event weights for NUA terms: | |
2043 | TString intFlowSumOfProductOfEventWeightsNUAName = "fIntFlowSumOfProductOfEventWeightsNUA"; | |
2044 | intFlowSumOfProductOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
2045 | fIntFlowSumOfProductOfEventWeightsNUA = new TH1D(intFlowSumOfProductOfEventWeightsNUAName.Data(),"Sum of product of event weights for NUA terms",27,0,27); | |
2046 | fIntFlowSumOfProductOfEventWeightsNUA->SetLabelSize(0.05); | |
2047 | fIntFlowSumOfProductOfEventWeightsNUA->SetMarkerStyle(25); | |
2048 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>} w_{<cos(#phi)>}"); | |
2049 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<2>} w_{<sin(#phi)>}"); | |
2050 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<cos(#phi)>} w_{<sin(#phi)>}"); | |
2051 | // .... | |
2052 | // to be improved - add labels for remaining bins | |
2053 | // .... | |
2054 | fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeightsNUA); | |
b3dacf6b | 2055 | // Final results for reference Q-cumulants: |
2056 | TString cumulantFlag[4] = {"QC{2}","QC{4}","QC{6}","QC{8}"}; | |
489d5531 | 2057 | TString intFlowQcumulantsName = "fIntFlowQcumulants"; |
2058 | intFlowQcumulantsName += fAnalysisLabel->Data(); | |
b92ea2b9 | 2059 | fIntFlowQcumulants = new TH1D(intFlowQcumulantsName.Data(),"Reference Q-cumulants",4,0,4); |
b77b6434 | 2060 | if(fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 2061 | { |
b77b6434 | 2062 | fIntFlowQcumulants->SetTitle("Reference Q-cumulants (error from non-isotropic terms also propagated)"); |
b92ea2b9 | 2063 | } |
489d5531 | 2064 | fIntFlowQcumulants->SetLabelSize(0.05); |
2065 | fIntFlowQcumulants->SetMarkerStyle(25); | |
68a3b4b1 | 2066 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2067 | { |
68a3b4b1 | 2068 | (fIntFlowQcumulants->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data()); |
b3dacf6b | 2069 | } |
489d5531 | 2070 | fIntFlowResults->Add(fIntFlowQcumulants); |
b3dacf6b | 2071 | // Final results for reference Q-cumulants rebinned in M: |
2072 | if(fCalculateCumulantsVsM) | |
2073 | { | |
2074 | TString intFlowQcumulantsRebinnedInMName = "fIntFlowQcumulantsRebinnedInM"; | |
2075 | intFlowQcumulantsRebinnedInMName += fAnalysisLabel->Data(); | |
2076 | fIntFlowQcumulantsRebinnedInM = new TH1D(intFlowQcumulantsRebinnedInMName.Data(),"Reference Q-cumulants rebinned in M",4,0,4); | |
2077 | fIntFlowQcumulantsRebinnedInM->SetLabelSize(0.05); | |
2078 | fIntFlowQcumulantsRebinnedInM->SetMarkerStyle(25); | |
68a3b4b1 | 2079 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2080 | { |
68a3b4b1 | 2081 | (fIntFlowQcumulantsRebinnedInM->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data()); |
b3dacf6b | 2082 | } |
2083 | fIntFlowResults->Add(fIntFlowQcumulantsRebinnedInM); | |
2084 | } // end of if(fCalculateCumulantsVsM) | |
b92ea2b9 | 2085 | // Ratio between error squared: with/without non-isotropic terms: |
2086 | TString intFlowQcumulantsErrorSquaredRatioName = "fIntFlowQcumulantsErrorSquaredRatio"; | |
2087 | intFlowQcumulantsErrorSquaredRatioName += fAnalysisLabel->Data(); | |
2088 | fIntFlowQcumulantsErrorSquaredRatio = new TH1D(intFlowQcumulantsErrorSquaredRatioName.Data(),"Error squared of reference Q-cumulants: #frac{with NUA terms}{without NUA terms}",4,0,4); | |
2089 | fIntFlowQcumulantsErrorSquaredRatio->SetLabelSize(0.05); | |
2090 | fIntFlowQcumulantsErrorSquaredRatio->SetMarkerStyle(25); | |
2091 | for(Int_t b=0;b<4;b++) | |
2092 | { | |
2093 | (fIntFlowQcumulantsErrorSquaredRatio->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data()); | |
2094 | } | |
2095 | fIntFlowResults->Add(fIntFlowQcumulantsErrorSquaredRatio); | |
ff70ca91 | 2096 | // final results for integrated Q-cumulants versus multiplicity: |
b3dacf6b | 2097 | if(fCalculateCumulantsVsM) |
2098 | { | |
2099 | TString intFlowQcumulantsVsMName = "fIntFlowQcumulantsVsM"; | |
2100 | intFlowQcumulantsVsMName += fAnalysisLabel->Data(); | |
2101 | for(Int_t co=0;co<4;co++) // cumulant order | |
2102 | { | |
2103 | fIntFlowQcumulantsVsM[co] = new TH1D(Form("%s, %s",intFlowQcumulantsVsMName.Data(),cumulantFlag[co].Data()), | |
2104 | Form("%s vs multipicity",cumulantFlag[co].Data()), | |
2105 | fnBinsMult,fMinMult,fMaxMult); | |
2106 | fIntFlowQcumulantsVsM[co]->GetXaxis()->SetTitle("M"); | |
2107 | fIntFlowQcumulantsVsM[co]->GetYaxis()->SetTitle(cumulantFlag[co].Data()); | |
2108 | fIntFlowResults->Add(fIntFlowQcumulantsVsM[co]); | |
2109 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
2110 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 2111 | // final integrated flow estimates from Q-cumulants: |
b3dacf6b | 2112 | TString flowFlag[4] = {Form("v_{%d}{2,QC}",fHarmonic),Form("v_{%d}{4,QC}",fHarmonic),Form("v_{%d}{6,QC}",fHarmonic),Form("v_{%d}{8,QC}",fHarmonic)}; |
489d5531 | 2113 | TString intFlowName = "fIntFlow"; |
2114 | intFlowName += fAnalysisLabel->Data(); | |
2115 | // integrated flow from Q-cumulants: | |
b3dacf6b | 2116 | fIntFlow = new TH1D(intFlowName.Data(),"Reference flow estimates from Q-cumulants",4,0,4); |
489d5531 | 2117 | fIntFlow->SetLabelSize(0.05); |
2118 | fIntFlow->SetMarkerStyle(25); | |
68a3b4b1 | 2119 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2120 | { |
68a3b4b1 | 2121 | (fIntFlow->GetXaxis())->SetBinLabel(b+1,flowFlag[b].Data()); |
b3dacf6b | 2122 | } |
ff70ca91 | 2123 | fIntFlowResults->Add(fIntFlow); |
b3dacf6b | 2124 | // Reference flow vs M rebinned in one huge bin: |
2125 | if(fCalculateCumulantsVsM) | |
2126 | { | |
2127 | TString intFlowRebinnedInMName = "fIntFlowRebinnedInM"; | |
2128 | intFlowRebinnedInMName += fAnalysisLabel->Data(); | |
2129 | fIntFlowRebinnedInM = new TH1D(intFlowRebinnedInMName.Data(),"Reference flow estimates from Q-cumulants (rebinned in M)",4,0,4); | |
2130 | fIntFlowRebinnedInM->SetLabelSize(0.05); | |
2131 | fIntFlowRebinnedInM->SetMarkerStyle(25); | |
68a3b4b1 | 2132 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2133 | { |
68a3b4b1 | 2134 | (fIntFlowRebinnedInM->GetXaxis())->SetBinLabel(b+1,flowFlag[b].Data()); |
b3dacf6b | 2135 | } |
2136 | fIntFlowResults->Add(fIntFlowRebinnedInM); | |
2137 | } | |
ff70ca91 | 2138 | // integrated flow from Q-cumulants: versus multiplicity: |
b3dacf6b | 2139 | if(fCalculateCumulantsVsM) |
2140 | { | |
2141 | TString intFlowVsMName = "fIntFlowVsM"; | |
2142 | intFlowVsMName += fAnalysisLabel->Data(); | |
2143 | for(Int_t co=0;co<4;co++) // cumulant order | |
2144 | { | |
2145 | fIntFlowVsM[co] = new TH1D(Form("%s, %s",intFlowVsMName.Data(),flowFlag[co].Data()), | |
2146 | Form("%s vs multipicity",flowFlag[co].Data()), | |
2147 | fnBinsMult,fMinMult,fMaxMult); | |
2148 | fIntFlowVsM[co]->GetXaxis()->SetTitle("M"); | |
2149 | fIntFlowVsM[co]->GetYaxis()->SetTitle(flowFlag[co].Data()); | |
2150 | fIntFlowResults->Add(fIntFlowVsM[co]); | |
2151 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
2152 | } // end of if(fCalculateCumulantsVsM) | |
2001bc3a | 2153 | // quantifying detector effects effects to correlations: |
2154 | TString intFlowDetectorBiasName = "fIntFlowDetectorBias"; | |
2155 | intFlowDetectorBiasName += fAnalysisLabel->Data(); | |
2156 | fIntFlowDetectorBias = new TH1D(intFlowDetectorBiasName.Data(),"Quantifying detector bias",4,0,4); | |
2157 | fIntFlowDetectorBias->SetLabelSize(0.05); | |
2158 | fIntFlowDetectorBias->SetMarkerStyle(25); | |
2159 | for(Int_t ci=0;ci<4;ci++) | |
2160 | { | |
2161 | (fIntFlowDetectorBias->GetXaxis())->SetBinLabel(ci+1,Form("#frac{corrected}{measured} %s",cumulantFlag[ci].Data())); | |
2162 | } | |
2163 | fIntFlowResults->Add(fIntFlowDetectorBias); | |
2164 | // quantifying detector effects to correlations versus multiplicity: | |
b3dacf6b | 2165 | if(fCalculateCumulantsVsM) |
2001bc3a | 2166 | { |
b3dacf6b | 2167 | TString intFlowDetectorBiasVsMName = "fIntFlowDetectorBiasVsM"; |
2168 | intFlowDetectorBiasVsMName += fAnalysisLabel->Data(); | |
2169 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2170 | { | |
2171 | fIntFlowDetectorBiasVsM[ci] = new TH1D(Form("%s for %s",intFlowDetectorBiasVsMName.Data(),cumulantFlag[ci].Data()), | |
2172 | Form("Quantifying detector bias for %s vs multipicity",cumulantFlag[ci].Data()), | |
2173 | fnBinsMult,fMinMult,fMaxMult); | |
2174 | fIntFlowDetectorBiasVsM[ci]->GetXaxis()->SetTitle("M"); | |
2175 | fIntFlowDetectorBiasVsM[ci]->GetYaxis()->SetTitle("#frac{corrected}{measured}"); | |
b77b6434 | 2176 | fIntFlowResults->Add(fIntFlowDetectorBiasVsM[ci]); |
b3dacf6b | 2177 | } // end of for(Int_t co=0;co<4;co++) // cumulant order |
2178 | } // end of if(fCalculateCumulantsVsM) | |
1268c371 | 2179 | |
489d5531 | 2180 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow() |
2181 | ||
489d5531 | 2182 | //================================================================================================================================ |
2183 | ||
489d5531 | 2184 | void AliFlowAnalysisWithQCumulants::InitializeArraysForNestedLoops() |
2185 | { | |
2186 | // Initialize arrays of all objects relevant for calculations with nested loops. | |
2187 | ||
2188 | // integrated flow: | |
2189 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2190 | { | |
2191 | fIntFlowDirectCorrectionTermsForNUA[sc] = NULL; | |
2192 | } | |
2193 | ||
2194 | // differential flow: | |
2195 | // correlations: | |
2196 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
2197 | { | |
2198 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2199 | { | |
2200 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2201 | { | |
2202 | fDiffFlowDirectCorrelations[t][pe][ci] = NULL; | |
2203 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
2204 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2205 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
2206 | // correction terms for non-uniform acceptance: | |
2207 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
2208 | { | |
2209 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2210 | { | |
2211 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2212 | { | |
2213 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
2214 | { | |
2215 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = NULL; | |
2216 | } | |
2217 | } | |
2218 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2219 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
2220 | ||
2221 | ||
2222 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForNestedLoops() | |
2223 | ||
2224 | ||
2225 | //================================================================================================================================ | |
2226 | ||
2227 | ||
2228 | void AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops() | |
2229 | { | |
2230 | // Book all objects relevant for calculations with nested loops. | |
2231 | ||
2232 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?) | |
2233 | TString typeFlag[2] = {"RP","POI"}; // to be improved (should I promote this to data members?) | |
2234 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; // to be improved (should I promote this to data members?) | |
2235 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; // to be improved (should I promote this to data members?) | |
2236 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
2237 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
2238 | ||
2239 | TString evaluateNestedLoopsName = "fEvaluateNestedLoops"; | |
2240 | evaluateNestedLoopsName += fAnalysisLabel->Data(); | |
2241 | fEvaluateNestedLoops = new TProfile(evaluateNestedLoopsName.Data(),"Flags for nested loops",4,0,4); | |
2242 | fEvaluateNestedLoops->SetLabelSize(0.03); | |
2243 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(1,"fEvaluateIntFlowNestedLoops"); | |
2244 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(2,"fEvaluateDiffFlowNestedLoops"); | |
2245 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(3,"fCrossCheckInPtBinNo"); | |
2246 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(4,"fCrossCheckInEtaBinNo"); | |
2247 | fEvaluateNestedLoops->Fill(0.5,(Int_t)fEvaluateIntFlowNestedLoops); | |
2248 | fEvaluateNestedLoops->Fill(1.5,(Int_t)fEvaluateDiffFlowNestedLoops); | |
2249 | fEvaluateNestedLoops->Fill(2.5,fCrossCheckInPtBinNo); | |
2250 | fEvaluateNestedLoops->Fill(3.5,fCrossCheckInEtaBinNo); | |
2251 | fNestedLoopsList->Add(fEvaluateNestedLoops); | |
2252 | // nested loops for integrated flow: | |
2253 | if(fEvaluateIntFlowNestedLoops) | |
2254 | { | |
2255 | // correlations: | |
2256 | TString intFlowDirectCorrelationsName = "fIntFlowDirectCorrelations"; | |
2257 | intFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
8ed4edc7 | 2258 | fIntFlowDirectCorrelations = new TProfile(intFlowDirectCorrelationsName.Data(),"Multiparticle correlations calculated with nested loops (for int. flow)",34,0,34,"s"); |
489d5531 | 2259 | fNestedLoopsList->Add(fIntFlowDirectCorrelations); |
2260 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
2261 | { | |
2262 | TString intFlowExtraDirectCorrelationsName = "fIntFlowExtraDirectCorrelations"; | |
2263 | intFlowExtraDirectCorrelationsName += fAnalysisLabel->Data(); | |
2264 | fIntFlowExtraDirectCorrelations = new TProfile(intFlowExtraDirectCorrelationsName.Data(),"Extra multiparticle correlations calculated with nested loops (for int. flow)",100,0,100,"s"); | |
2265 | fNestedLoopsList->Add(fIntFlowExtraDirectCorrelations); | |
2266 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
2267 | // correction terms for non-uniform acceptance: | |
2268 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2269 | { | |
2270 | TString intFlowDirectCorrectionTermsForNUAName = "fIntFlowDirectCorrectionTermsForNUA"; | |
2271 | intFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
2272 | fIntFlowDirectCorrectionTermsForNUA[sc] = new TProfile(Form("%s: %s terms",intFlowDirectCorrectionTermsForNUAName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),10,0,10,"s"); | |
2273 | fNestedLoopsList->Add(fIntFlowDirectCorrectionTermsForNUA[sc]); | |
2274 | } // end of for(Int_t sc=0;sc<2;sc++) | |
2275 | } // end of if(fEvaluateIntFlowNestedLoops) | |
2276 | ||
2277 | // nested loops for differential flow: | |
2278 | if(fEvaluateDiffFlowNestedLoops) | |
2279 | { | |
2280 | // reduced correlations: | |
2281 | TString diffFlowDirectCorrelationsName = "fDiffFlowDirectCorrelations"; | |
2282 | diffFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
2283 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
2284 | { | |
2285 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2286 | { | |
2287 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
2288 | { | |
2289 | // reduced correlations: | |
2290 | fDiffFlowDirectCorrelations[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe],"s"); | |
2291 | fDiffFlowDirectCorrelations[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data()); | |
2292 | fNestedLoopsList->Add(fDiffFlowDirectCorrelations[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations) | |
2293 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
2294 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2295 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
2296 | // correction terms for non-uniform acceptance: | |
2297 | TString diffFlowDirectCorrectionTermsForNUAName = "fDiffFlowDirectCorrectionTermsForNUA"; | |
2298 | diffFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
2299 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
2300 | { | |
2301 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2302 | { | |
2303 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
2304 | { | |
2305 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
2306 | { | |
2307 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = new TProfile(Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe],"s"); | |
2308 | fNestedLoopsList->Add(fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]); | |
2309 | } | |
2310 | } | |
2311 | } | |
3b552efe | 2312 | } |
2313 | // number of RPs and POIs in selected pt and eta bins for cross-checkings: | |
2314 | TString noOfParticlesInBinName = "fNoOfParticlesInBin"; | |
2315 | fNoOfParticlesInBin = new TH1D(noOfParticlesInBinName.Data(),"Number of RPs and POIs in selected p_{T} and #eta bin",4,0,4); | |
489d5531 | 2316 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(1,"# of RPs in p_{T} bin"); |
2317 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(2,"# of RPs in #eta bin"); | |
2318 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(3,"# of POIs in p_{T} bin"); | |
3b552efe | 2319 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(4,"# of POIs in #eta bin"); |
489d5531 | 2320 | fNestedLoopsList->Add(fNoOfParticlesInBin); |
2321 | } // end of if(fEvaluateDiffFlowNestedLoops) | |
2322 | ||
2323 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops() | |
2324 | ||
2325 | ||
2326 | //================================================================================================================================ | |
2327 | ||
2328 | ||
2329 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelations() | |
2330 | { | |
2331 | // calculate all correlations needed for integrated flow | |
57340a27 | 2332 | |
489d5531 | 2333 | // multiplicity: |
1268c371 | 2334 | Double_t dMult = (*fSpk)(0,0); |
57340a27 | 2335 | |
489d5531 | 2336 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: |
2337 | Double_t dReQ1n = (*fReQ)(0,0); | |
2338 | Double_t dReQ2n = (*fReQ)(1,0); | |
2339 | Double_t dReQ3n = (*fReQ)(2,0); | |
2340 | Double_t dReQ4n = (*fReQ)(3,0); | |
8ed4edc7 | 2341 | //Double_t dReQ5n = (*fReQ)(4,0); |
2342 | Double_t dReQ6n = (*fReQ)(5,0); | |
489d5531 | 2343 | Double_t dImQ1n = (*fImQ)(0,0); |
2344 | Double_t dImQ2n = (*fImQ)(1,0); | |
2345 | Double_t dImQ3n = (*fImQ)(2,0); | |
2346 | Double_t dImQ4n = (*fImQ)(3,0); | |
8ed4edc7 | 2347 | //Double_t dImQ5n = (*fImQ)(4,0); |
2348 | Double_t dImQ6n = (*fImQ)(5,0); | |
489d5531 | 2349 | |
2350 | // real and imaginary parts of some expressions involving various combinations of Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
2351 | // (these expression appear in the Eqs. for the multi-particle correlations bellow) | |
2352 | ||
2353 | // Re[Q_{2n} Q_{n}^* Q_{n}^*] | |
2354 | Double_t reQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dReQ2n + 2.*dReQ1n*dImQ1n*dImQ2n - pow(dImQ1n,2.)*dReQ2n; | |
2355 | ||
2356 | // Im[Q_{2n} Q_{n}^* Q_{n}^*] | |
2357 | //Double_t imQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dImQ2n-2.*dReQ1n*dImQ1n*dReQ2n-pow(dImQ1n,2.)*dImQ2n; | |
2358 | ||
2359 | // Re[Q_{n} Q_{n} Q_{2n}^*] = Re[Q_{2n} Q_{n}^* Q_{n}^*] | |
2360 | Double_t reQ1nQ1nQ2nstar = reQ2nQ1nstarQ1nstar; | |
2361 | ||
2362 | // Re[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*] | |
2363 | Double_t reQ3nQ1nQ2nstarQ2nstar = (pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n) | |
2364 | + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n); | |
2365 | ||
2366 | // Im[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*] | |
2367 | //Double_t imQ3nQ1nQ2nstarQ2nstar = calculate and implement this (deleteMe) | |
2368 | ||
2369 | // Re[Q_{2n} Q_{2n} Q_{3n}^* Q_{1n}^*] = Re[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*] | |
2370 | Double_t reQ2nQ2nQ3nstarQ1nstar = reQ3nQ1nQ2nstarQ2nstar; | |
2371 | ||
2372 | // Re[Q_{4n} Q_{2n}^* Q_{2n}^*] | |
2373 | Double_t reQ4nQ2nstarQ2nstar = pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n; | |
2374 | ||
2375 | // Im[Q_{4n} Q_{2n}^* Q_{2n}^*] | |
2376 | //Double_t imQ4nQ2nstarQ2nstar = calculate and implement this (deleteMe) | |
2377 | ||
2378 | // Re[Q_{2n} Q_{2n} Q_{4n}^*] = Re[Q_{4n} Q_{2n}^* Q_{2n}^*] | |
2379 | Double_t reQ2nQ2nQ4nstar = reQ4nQ2nstarQ2nstar; | |
2380 | ||
2381 | // Re[Q_{4n} Q_{3n}^* Q_{n}^*] | |
2382 | Double_t reQ4nQ3nstarQ1nstar = dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n); | |
2383 | ||
2384 | // Re[Q_{3n} Q_{n} Q_{4n}^*] = Re[Q_{4n} Q_{3n}^* Q_{n}^*] | |
2385 | Double_t reQ3nQ1nQ4nstar = reQ4nQ3nstarQ1nstar; | |
2386 | ||
2387 | // Im[Q_{4n} Q_{3n}^* Q_{n}^*] | |
2388 | //Double_t imQ4nQ3nstarQ1nstar = calculate and implement this (deleteMe) | |
2389 | ||
2390 | // Re[Q_{3n} Q_{2n}^* Q_{n}^*] | |
2391 | Double_t reQ3nQ2nstarQ1nstar = dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n | |
2392 | + dImQ3n*dImQ2n*dReQ1n; | |
2393 | ||
2394 | // Re[Q_{2n} Q_{n} Q_{3n}^*] = Re[Q_{3n} Q_{2n}^* Q_{n}^*] | |
2395 | Double_t reQ2nQ1nQ3nstar = reQ3nQ2nstarQ1nstar; | |
2396 | ||
2397 | // Im[Q_{3n} Q_{2n}^* Q_{n}^*] | |
2398 | //Double_t imQ3nQ2nstarQ1nstar; //calculate and implement this (deleteMe) | |
2399 | ||
2400 | // Re[Q_{3n} Q_{n}^* Q_{n}^* Q_{n}^*] | |
2401 | Double_t reQ3nQ1nstarQ1nstarQ1nstar = dReQ3n*pow(dReQ1n,3)-3.*dReQ1n*dReQ3n*pow(dImQ1n,2) | |
2402 | + 3.*dImQ1n*dImQ3n*pow(dReQ1n,2)-dImQ3n*pow(dImQ1n,3); | |
2403 | ||
2404 | // Im[Q_{3n} Q_{n}^* Q_{n}^* Q_{n}^*] | |
2405 | //Double_t imQ3nQ1nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe) | |
2406 | ||
2407 | // |Q_{2n}|^2 |Q_{n}|^2 | |
2408 | Double_t dQ2nQ1nQ2nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
2409 | ||
2410 | // Re[Q_{4n} Q_{2n}^* Q_{n}^* Q_{n}^*] | |
2411 | Double_t reQ4nQ2nstarQ1nstarQ1nstar = (dReQ4n*dReQ2n+dImQ4n*dImQ2n)*(pow(dReQ1n,2)-pow(dImQ1n,2)) | |
2412 | + 2.*dReQ1n*dImQ1n*(dImQ4n*dReQ2n-dReQ4n*dImQ2n); | |
2413 | ||
2414 | // Im[Q_{4n} Q_{2n}^* Q_{n}^* Q_{n}^*] | |
2415 | //Double_t imQ4nQ2nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe) | |
2416 | ||
2417 | // Re[Q_{2n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^*] | |
2418 | Double_t reQ2nQ1nQ1nstarQ1nstarQ1nstar = (dReQ2n*dReQ1n-dImQ2n*dImQ1n)*(pow(dReQ1n,3)-3.*dReQ1n*pow(dImQ1n,2)) | |
2419 | + (dReQ2n*dImQ1n+dReQ1n*dImQ2n)*(3.*dImQ1n*pow(dReQ1n,2)-pow(dImQ1n,3)); | |
2420 | ||
2421 | // Im[Q_{2n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^*] | |
2422 | //Double_t imQ2nQ1nQ1nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe) | |
2423 | ||
2424 | // Re[Q_{2n} Q_{2n} Q_{2n}^* Q_{n}^* Q_{n}^*] | |
2425 | Double_t reQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2426 | * (dReQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) + 2.*dImQ2n*dReQ1n*dImQ1n); | |
2427 | ||
2428 | // Im[Q_{2n} Q_{2n} Q_{2n}^* Q_{n}^* Q_{n}^*] | |
2429 | //Double_t imQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2430 | // * (dImQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) - 2.*dReQ2n*dReQ1n*dImQ1n); | |
2431 | ||
2432 | // Re[Q_{4n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2433 | Double_t reQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dReQ4n-6.*pow(dReQ1n,2.)*dReQ4n*pow(dImQ1n,2.) | |
2434 | + pow(dImQ1n,4.)*dReQ4n+4.*pow(dReQ1n,3.)*dImQ1n*dImQ4n | |
2435 | - 4.*pow(dImQ1n,3.)*dReQ1n*dImQ4n; | |
2436 | ||
2437 | // Im[Q_{4n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2438 | //Double_t imQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dImQ4n-6.*pow(dReQ1n,2.)*dImQ4n*pow(dImQ1n,2.) | |
2439 | // + pow(dImQ1n,4.)*dImQ4n+4.*pow(dImQ1n,3.)*dReQ1n*dReQ4n | |
2440 | // - 4.*pow(dReQ1n,3.)*dImQ1n*dReQ4n; | |
2441 | ||
2442 | // Re[Q_{3n} Q_{n} Q_{2n}^* Q_{n}^* Q_{n}^*] | |
2443 | Double_t reQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2444 | * (dReQ1n*dReQ2n*dReQ3n-dReQ3n*dImQ1n*dImQ2n+dReQ2n*dImQ1n*dImQ3n+dReQ1n*dImQ2n*dImQ3n); | |
2445 | ||
2446 | // Im[Q_{3n} Q_{n} Q_{2n}^* Q_{n}^* Q_{n}^*] | |
2447 | //Double_t imQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2448 | // * (-dReQ2n*dReQ3n*dImQ1n-dReQ1n*dReQ3n*dImQ2n+dReQ1n*dReQ2n*dImQ3n-dImQ1n*dImQ2n*dImQ3n); | |
2449 | ||
2450 | ||
2451 | // Re[Q_{2n} Q_{2n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2452 | Double_t reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)*dReQ2n-2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.) | |
2453 | + dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dImQ2n) | |
2454 | * (pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.) | |
2455 | - dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n+pow(dImQ1n,2.)*dImQ2n); | |
2456 | ||
2457 | // Im[Q_{2n} Q_{2n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2458 | //Double_t imQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = 2.*(pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.) | |
2459 | // + 2.*dReQ1n*dImQ1n*dImQ2n)*(pow(dReQ1n,2.)*dImQ2n | |
2460 | // - 2.*dReQ1n*dImQ1n*dReQ2n-pow(dImQ1n,2.)*dImQ2n); | |
2461 | ||
2462 | // Re[Q_{3n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2463 | Double_t reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2464 | * (pow(dReQ1n,3.)*dReQ3n-3.*dReQ1n*dReQ3n*pow(dImQ1n,2.) | |
2465 | + 3.*pow(dReQ1n,2.)*dImQ1n*dImQ3n-pow(dImQ1n,3.)*dImQ3n); | |
2466 | ||
2467 | // Im[Q_{3n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2468 | //Double_t imQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2469 | // * (pow(dImQ1n,3.)*dReQ3n-3.*dImQ1n*dReQ3n*pow(dReQ1n,2.) | |
2470 | // - 3.*pow(dImQ1n,2.)*dReQ1n*dImQ3n+pow(dReQ1n,3.)*dImQ3n); | |
2471 | ||
2472 | // |Q_{2n}|^2 |Q_{n}|^4 | |
2473 | Double_t dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.); | |
2474 | ||
2475 | // Re[Q_{2n} Q_{n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2476 | Double_t reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
2477 | * (pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.) | |
2478 | + 2.*dReQ1n*dImQ1n*dImQ2n); | |
2479 | ||
2480 | // Im[Q_{2n} Q_{n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2481 | //Double_t imQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
2482 | // * (pow(dReQ1n,2.)*dImQ2n-dImQ2n*pow(dImQ1n,2.) | |
2483 | // - 2.*dReQ1n*dReQ2n*dImQ1n); | |
2484 | ||
2485 | ||
2486 | ||
2487 | ||
2488 | // ************************************** | |
2489 | // **** multi-particle correlations: **** | |
2490 | // ************************************** | |
2491 | // | |
8ed4edc7 | 2492 | // Remark 1: All multi-particle correlations calculated with non-weighted Q-vectors are stored in 1D profile fIntFlowCorrelationsAllPro; |
2493 | // Remark 2: There is a special profile fIntFlowCorrelationsPro holding results ONLY for same harmonic's <<2>>, <<4>>, <<6>> and <<8>>; | |
2494 | // Remark 3: Binning of fIntFlowCorrelationsAllPro is organized as follows: | |
489d5531 | 2495 | // -------------------------------------------------------------------------------------------------------------------- |
2496 | // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))> | |
2497 | // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))> | |
2498 | // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))> | |
2499 | // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))> | |
2500 | // 5th bin: ---- EMPTY ---- | |
2501 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))> | |
2502 | // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))> | |
2503 | // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))> | |
2504 | // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))> | |
2505 | // 10th bin: ---- EMPTY ---- | |
2506 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))> | |
2507 | // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))> | |
2508 | // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))> | |
2509 | // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))> | |
2510 | // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))> | |
2511 | // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))> | |
2512 | // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> | |
2513 | // 18th bin: ---- EMPTY ---- | |
2514 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))> | |
2515 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))> | |
2516 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))> | |
2517 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))> | |
2518 | // 23rd bin: ---- EMPTY ---- | |
2519 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> | |
2520 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))> | |
2521 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))> | |
2522 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))> | |
2523 | // 28th bin: ---- EMPTY ---- | |
2524 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> | |
2525 | // 30th bin: ---- EMPTY ---- | |
2526 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> | |
8ed4edc7 | 2527 | // 32nd bin: ---- EMPTY ---- |
2528 | // 33rd bin: <4>_{4n,2n|3n,3n}= four4n2n3n3n = <cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4))> | |
2529 | // 34th bin: <5>_{2n,2n,2n|3n,3n} = five2n2n2n3n3n = <cos(n*(2.*phi1+2.*phi2+2.*phi3-3.*phi4-3.*phi5))> | |
489d5531 | 2530 | // -------------------------------------------------------------------------------------------------------------------- |
2531 | ||
2532 | // 2-particle: | |
2533 | Double_t two1n1n = 0.; // <cos(n*(phi1-phi2))> | |
2534 | Double_t two2n2n = 0.; // <cos(2n*(phi1-phi2))> | |
2535 | Double_t two3n3n = 0.; // <cos(3n*(phi1-phi2))> | |
2536 | Double_t two4n4n = 0.; // <cos(4n*(phi1-phi2))> | |
2537 | ||
2538 | if(dMult>1) | |
2539 | { | |
2540 | two1n1n = (pow(dReQ1n,2.)+pow(dImQ1n,2.)-dMult)/(dMult*(dMult-1.)); | |
2541 | two2n2n = (pow(dReQ2n,2.)+pow(dImQ2n,2.)-dMult)/(dMult*(dMult-1.)); | |
2542 | two3n3n = (pow(dReQ3n,2.)+pow(dImQ3n,2.)-dMult)/(dMult*(dMult-1.)); | |
2543 | two4n4n = (pow(dReQ4n,2.)+pow(dImQ4n,2.)-dMult)/(dMult*(dMult-1.)); | |
2544 | ||
2545 | // average 2-particle correlations for single event: | |
2546 | fIntFlowCorrelationsAllEBE->SetBinContent(1,two1n1n); | |
2547 | fIntFlowCorrelationsAllEBE->SetBinContent(2,two2n2n); | |
2548 | fIntFlowCorrelationsAllEBE->SetBinContent(3,two3n3n); | |
2549 | fIntFlowCorrelationsAllEBE->SetBinContent(4,two4n4n); | |
2550 | ||
2551 | // average 2-particle correlations for all events: | |
2552 | fIntFlowCorrelationsAllPro->Fill(0.5,two1n1n,dMult*(dMult-1.)); | |
2553 | fIntFlowCorrelationsAllPro->Fill(1.5,two2n2n,dMult*(dMult-1.)); | |
2554 | fIntFlowCorrelationsAllPro->Fill(2.5,two3n3n,dMult*(dMult-1.)); | |
2555 | fIntFlowCorrelationsAllPro->Fill(3.5,two4n4n,dMult*(dMult-1.)); | |
2556 | ||
2557 | // store separetately <2> (to be improved: do I really need this?) | |
2558 | fIntFlowCorrelationsEBE->SetBinContent(1,two1n1n); // <2> | |
2559 | ||
2560 | // to be improved (this can be implemented better): | |
2561 | Double_t mWeight2p = 0.; | |
2562 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
2563 | { | |
2564 | mWeight2p = dMult*(dMult-1.); | |
2565 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
2566 | { | |
2567 | mWeight2p = 1.; | |
2568 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
2569 | { | |
2570 | mWeight2p = dMult; | |
2571 | } | |
2572 | ||
2573 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(1,mWeight2p); // eW_<2> | |
2574 | fIntFlowCorrelationsPro->Fill(0.5,two1n1n,mWeight2p); | |
b40a910e | 2575 | fIntFlowSquaredCorrelationsPro->Fill(0.5,two1n1n*two1n1n,mWeight2p); |
2576 | if(fCalculateCumulantsVsM) | |
2577 | { | |
2578 | fIntFlowCorrelationsVsMPro[0]->Fill(dMult+0.5,two1n1n,mWeight2p); | |
2579 | fIntFlowSquaredCorrelationsVsMPro[0]->Fill(dMult+0.5,two1n1n*two1n1n,mWeight2p); | |
2580 | } | |
489d5531 | 2581 | // distribution of <cos(n*(phi1-phi2))>: |
2582 | //f2pDistribution->Fill(two1n1n,dMult*(dMult-1.)); | |
2583 | } // end of if(dMult>1) | |
2584 | ||
2585 | // 3-particle: | |
2586 | Double_t three2n1n1n = 0.; // <cos(n*(2.*phi1-phi2-phi3))> | |
2587 | Double_t three3n2n1n = 0.; // <cos(n*(3.*phi1-2.*phi2-phi3))> | |
2588 | Double_t three4n2n2n = 0.; // <cos(n*(4.*phi1-2.*phi2-2.*phi3))> | |
2589 | Double_t three4n3n1n = 0.; // <cos(n*(4.*phi1-3.*phi2-phi3))> | |
2590 | ||
2591 | if(dMult>2) | |
2592 | { | |
2593 | three2n1n1n = (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2594 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult) | |
2595 | / (dMult*(dMult-1.)*(dMult-2.)); | |
2596 | three3n2n1n = (reQ3nQ2nstarQ1nstar-(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2597 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2598 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
2599 | / (dMult*(dMult-1.)*(dMult-2.)); | |
2600 | three4n2n2n = (reQ4nQ2nstarQ2nstar-2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2601 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*dMult) | |
2602 | / (dMult*(dMult-1.)*(dMult-2.)); | |
2603 | three4n3n1n = (reQ4nQ3nstarQ1nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
2604 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2605 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
2606 | / (dMult*(dMult-1.)*(dMult-2.)); | |
2607 | ||
2608 | // average 3-particle correlations for single event: | |
2609 | fIntFlowCorrelationsAllEBE->SetBinContent(6,three2n1n1n); | |
2610 | fIntFlowCorrelationsAllEBE->SetBinContent(7,three3n2n1n); | |
2611 | fIntFlowCorrelationsAllEBE->SetBinContent(8,three4n2n2n); | |
2612 | fIntFlowCorrelationsAllEBE->SetBinContent(9,three4n3n1n); | |
2613 | ||
2614 | // average 3-particle correlations for all events: | |
2615 | fIntFlowCorrelationsAllPro->Fill(5.5,three2n1n1n,dMult*(dMult-1.)*(dMult-2.)); | |
2616 | fIntFlowCorrelationsAllPro->Fill(6.5,three3n2n1n,dMult*(dMult-1.)*(dMult-2.)); | |
2617 | fIntFlowCorrelationsAllPro->Fill(7.5,three4n2n2n,dMult*(dMult-1.)*(dMult-2.)); | |
2618 | fIntFlowCorrelationsAllPro->Fill(8.5,three4n3n1n,dMult*(dMult-1.)*(dMult-2.)); | |
2619 | } // end of if(dMult>2) | |
2620 | ||
2621 | // 4-particle: | |
2622 | Double_t four1n1n1n1n = 0.; // <cos(n*(phi1+phi2-phi3-phi4))> | |
2623 | Double_t four2n2n2n2n = 0.; // <cos(2.*n*(phi1+phi2-phi3-phi4))> | |
2624 | Double_t four2n1n2n1n = 0.; // <cos(n*(2.*phi1+phi2-2.*phi3-phi4))> | |
2625 | Double_t four3n1n1n1n = 0.; // <cos(n*(3.*phi1-phi2-phi3-phi4))> | |
2626 | Double_t four4n2n1n1n = 0.; // <cos(n*(4.*phi1-2.*phi2-phi3-phi4))> | |
2627 | Double_t four3n1n2n2n = 0.; // <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))> | |
2628 | Double_t four3n1n3n1n = 0.; // <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> | |
2629 | ||
2630 | if(dMult>3) | |
2631 | { | |
2632 | four1n1n1n1n = (2.*dMult*(dMult-3.)+pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ1n,2.) | |
2633 | + pow(dImQ1n,2.))-2.*reQ2nQ1nstarQ1nstar+(pow(dReQ2n,2.)+pow(dImQ2n,2.))) | |
2634 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
2635 | four2n2n2n2n = (2.*dMult*(dMult-3.)+pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ2n,2.) | |
2636 | + pow(dImQ2n,2.))-2.*reQ4nQ2nstarQ2nstar+(pow(dReQ4n,2.)+pow(dImQ4n,2.))) | |
2637 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
2638 | four2n1n2n1n = (dQ2nQ1nQ2nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar-2.*reQ2nQ1nstarQ1nstar) | |
2639 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2640 | - ((dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2641 | + (dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-(pow(dReQ3n,2.)+pow(dImQ3n,2.))) | |
2642 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2643 | + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2644 | four3n1n1n1n = (reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar-3.*reQ2nQ1nstarQ1nstar) | |
2645 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2646 | + (2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2647 | + 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
2648 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2649 | four4n2n1n1n = (reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar-2.*reQ3nQ2nstarQ1nstar) | |
2650 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2651 | - (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2652 | - 3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
2653 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2654 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2655 | four3n1n2n2n = (reQ3nQ1nQ2nstarQ2nstar-reQ4nQ2nstarQ2nstar-reQ3nQ1nQ4nstar-2.*reQ3nQ2nstarQ1nstar) | |
2656 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2657 | - (2.*reQ1nQ1nQ2nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2658 | - 4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
2659 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2660 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2661 | four3n1n3n1n = ((pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2662 | - 2.*reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar) | |
2663 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2664 | + ((pow(dReQ4n,2.)+pow(dImQ4n,2.))-(dMult-4.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2665 | + (pow(dReQ2n,2.)+pow(dImQ2n,2.))-(dMult-4.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
2666 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2667 | + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2668 | ||
2669 | // average 4-particle correlations for single event: | |
2670 | fIntFlowCorrelationsAllEBE->SetBinContent(11,four1n1n1n1n); | |
2671 | fIntFlowCorrelationsAllEBE->SetBinContent(12,four2n1n2n1n); | |
2672 | fIntFlowCorrelationsAllEBE->SetBinContent(13,four2n2n2n2n); | |
2673 | fIntFlowCorrelationsAllEBE->SetBinContent(14,four3n1n1n1n); | |
2674 | fIntFlowCorrelationsAllEBE->SetBinContent(15,four3n1n3n1n); | |
2675 | fIntFlowCorrelationsAllEBE->SetBinContent(16,four3n1n2n2n); | |
2676 | fIntFlowCorrelationsAllEBE->SetBinContent(17,four4n2n1n1n); | |
2677 | ||
2678 | // average 4-particle correlations for all events: | |
2679 | fIntFlowCorrelationsAllPro->Fill(10.5,four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2680 | fIntFlowCorrelationsAllPro->Fill(11.5,four2n1n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2681 | fIntFlowCorrelationsAllPro->Fill(12.5,four2n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2682 | fIntFlowCorrelationsAllPro->Fill(13.5,four3n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2683 | fIntFlowCorrelationsAllPro->Fill(14.5,four3n1n3n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2684 | fIntFlowCorrelationsAllPro->Fill(15.5,four3n1n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2685 | fIntFlowCorrelationsAllPro->Fill(16.5,four4n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2686 | ||
2687 | // store separetately <4> (to be improved: do I really need this?) | |
2688 | fIntFlowCorrelationsEBE->SetBinContent(2,four1n1n1n1n); // <4> | |
2689 | ||
2690 | // to be improved (this can be implemented better): | |
2691 | Double_t mWeight4p = 0.; | |
2692 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
2693 | { | |
2694 | mWeight4p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
2695 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
2696 | { | |
2697 | mWeight4p = 1.; | |
2698 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
2699 | { | |
2700 | mWeight4p = dMult; | |
2701 | } | |
2702 | ||
2703 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(2,mWeight4p); // eW_<4> | |
2704 | fIntFlowCorrelationsPro->Fill(1.5,four1n1n1n1n,mWeight4p); | |
b40a910e | 2705 | fIntFlowSquaredCorrelationsPro->Fill(1.5,four1n1n1n1n*four1n1n1n1n,mWeight4p); |
2706 | if(fCalculateCumulantsVsM) | |
2707 | { | |
2708 | fIntFlowCorrelationsVsMPro[1]->Fill(dMult+0.5,four1n1n1n1n,mWeight4p); | |
2709 | fIntFlowSquaredCorrelationsVsMPro[1]->Fill(dMult+0.5,four1n1n1n1n*four1n1n1n1n,mWeight4p); | |
2710 | } | |
489d5531 | 2711 | // distribution of <cos(n*(phi1+phi2-phi3-phi4))> |
2712 | //f4pDistribution->Fill(four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2713 | ||
2714 | } // end of if(dMult>3) | |
2715 | ||
2716 | // 5-particle: | |
2717 | Double_t five2n1n1n1n1n = 0.; // <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))> | |
2718 | Double_t five2n2n2n1n1n = 0.; // <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))> | |
2719 | Double_t five3n1n2n1n1n = 0.; // <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))> | |
2720 | Double_t five4n1n1n1n1n = 0.; // <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))> | |
2721 | ||
2722 | if(dMult>4) | |
2723 | { | |
2724 | five2n1n1n1n1n = (reQ2nQ1nQ1nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar+6.*reQ3nQ2nstarQ1nstar) | |
2725 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2726 | - (reQ2nQ1nQ3nstar+3.*(dMult-6.)*reQ2nQ1nstarQ1nstar+3.*reQ1nQ1nQ2nstar) | |
2727 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2728 | - (2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2729 | + 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2730 | - 3.*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))) | |
2731 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2732 | - 3.*(pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
2733 | - 2.*(2*dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult*(dMult-4.)) | |
2734 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2735 | ||
2736 | five2n2n2n1n1n = (reQ2nQ2nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ2nQ2nQ3nstarQ1nstar) | |
2737 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2738 | + 2.*(reQ4nQ2nstarQ2nstar+4.*reQ3nQ2nstarQ1nstar+reQ3nQ1nQ4nstar) | |
2739 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2740 | + (reQ2nQ2nQ4nstar-2.*(dMult-5.)*reQ2nQ1nstarQ1nstar+2.*reQ1nQ1nQ2nstar) | |
2741 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2742 | - (2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2743 | + 1.*pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.) | |
2744 | - 2.*(3.*dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))) | |
2745 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2746 | - (4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2747 | - 4.*(dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+4.*dMult*(dMult-6.)) | |
2748 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2749 | ||
2750 | five4n1n1n1n1n = (reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ4nQ2nstarQ1nstarQ1nstar-4.*reQ3nQ1nstarQ1nstarQ1nstar) | |
2751 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2752 | + (8.*reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar+12.*reQ3nQ2nstarQ1nstar+12.*reQ2nQ1nstarQ1nstar) | |
2753 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2754 | - (6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+8.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2755 | + 12.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+24.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-24.*dMult) | |
2756 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2757 | ||
2758 | five3n1n2n1n1n = (reQ3nQ1nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar) | |
2759 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2760 | - (reQ3nQ1nQ2nstarQ2nstar-3.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar) | |
2761 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2762 | - ((2.*dMult-13.)*reQ3nQ2nstarQ1nstar-reQ3nQ1nQ4nstar-9.*reQ2nQ1nstarQ1nstar) | |
2763 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2764 | - (2.*reQ1nQ1nQ2nstar+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
2765 | - 2.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+2.*(pow(dReQ3n,2.) | |
2766 | + pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
2767 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2768 | + (2.*(dMult-6.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2769 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2770 | - pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
2771 | + 2.*(3.*dMult-11.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
2772 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2773 | - 4.*(dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2774 | ||
2775 | // average 5-particle correlations for single event: | |
2776 | fIntFlowCorrelationsAllEBE->SetBinContent(19,five2n1n1n1n1n); | |
2777 | fIntFlowCorrelationsAllEBE->SetBinContent(20,five2n2n2n1n1n); | |
2778 | fIntFlowCorrelationsAllEBE->SetBinContent(21,five3n1n2n1n1n); | |
2779 | fIntFlowCorrelationsAllEBE->SetBinContent(22,five4n1n1n1n1n); | |
2780 | ||
2781 | // average 5-particle correlations for all events: | |
2782 | fIntFlowCorrelationsAllPro->Fill(18.5,five2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2783 | fIntFlowCorrelationsAllPro->Fill(19.5,five2n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2784 | fIntFlowCorrelationsAllPro->Fill(20.5,five3n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2785 | fIntFlowCorrelationsAllPro->Fill(21.5,five4n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2786 | } // end of if(dMult>4) | |
2787 | ||
2788 | // 6-particle: | |
2789 | Double_t six1n1n1n1n1n1n = 0.; // <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> | |
2790 | Double_t six2n2n1n1n1n1n = 0.; // <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))> | |
2791 | Double_t six3n1n1n1n1n1n = 0.; // <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))> | |
2792 | Double_t six2n1n1n2n1n1n = 0.; // <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))> | |
2793 | ||
2794 | if(dMult>5) | |
2795 | { | |
2796 | six1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),3.)+9.*dQ2nQ1nQ2nstarQ1nstar-6.*reQ2nQ1nQ1nstarQ1nstarQ1nstar) | |
2797 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)) | |
2798 | + 4.*(reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar) | |
2799 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)) | |
2800 | + 2.*(9.*(dMult-4.)*reQ2nQ1nstarQ1nstar+2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))) | |
2801 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)) | |
2802 | - 9.*(pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)+(pow(dReQ2n,2.)+pow(dImQ2n,2.))) | |
2803 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-5.)) | |
2804 | + (18.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
2805 | / (dMult*(dMult-1)*(dMult-3)*(dMult-4)) | |
2806 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2807 | ||
2808 | six2n1n1n2n1n1n = (dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.) | |
2809 | * (2.*five2n2n2n1n1n+4.*five2n1n1n1n1n+4.*five3n1n2n1n1n+4.*four2n1n2n1n+1.*four1n1n1n1n) | |
2810 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four1n1n1n1n+4.*two1n1n | |
2811 | + 2.*three2n1n1n+2.*three2n1n1n+4.*four3n1n1n1n+8.*three2n1n1n+2.*four4n2n1n1n | |
2812 | + 4.*four2n1n2n1n+2.*two2n2n+8.*four2n1n2n1n+4.*four3n1n3n1n+8.*three3n2n1n | |
2813 | + 4.*four3n1n2n2n+4.*four1n1n1n1n+4.*four2n1n2n1n+1.*four2n2n2n2n) | |
2814 | - dMult*(dMult-1.)*(dMult-2.)*(2.*three2n1n1n+8.*two1n1n+4.*two1n1n+2. | |
2815 | + 4.*two1n1n+4.*three2n1n1n+2.*two2n2n+4.*three2n1n1n+8.*three3n2n1n | |
2816 | + 8.*two2n2n+4.*three4n3n1n+4.*two3n3n+4.*three3n2n1n+4.*two1n1n | |
2817 | + 8.*three2n1n1n+4.*two1n1n+4.*three3n2n1n+4.*three2n1n1n+2.*two2n2n | |
2818 | + 4.*three3n2n1n+2.*three4n2n2n)-dMult*(dMult-1.) | |
2819 | * (4.*two1n1n+4.+4.*two1n1n+2.*two2n2n+1.+4.*two1n1n+4.*two2n2n+4.*two3n3n | |
2820 | + 1.+2.*two2n2n+1.*two4n4n)-dMult) | |
2821 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed) | |
2822 | ||
2823 | six2n2n1n1n1n1n = (reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.) | |
2824 | * (five4n1n1n1n1n+8.*five2n1n1n1n1n+6.*five2n2n2n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) | |
2825 | * (4.*four3n1n1n1n+6.*four4n2n1n1n+12.*three2n1n1n+12.*four1n1n1n1n+24.*four2n1n2n1n | |
2826 | + 4.*four3n1n2n2n+3.*four2n2n2n2n)-dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+12.*three3n2n1n | |
2827 | + 4.*three4n3n1n+3.*three4n2n2n+8.*three2n1n1n+24.*two1n1n+12.*two2n2n+12.*three2n1n1n+8.*three3n2n1n | |
2828 | + 1.*three4n2n2n)-dMult*(dMult-1.)*(4.*two1n1n+6.*two2n2n+4.*two3n3n+1.*two4n4n+2.*two2n2n+8.*two1n1n+6.)-dMult) | |
2829 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed) | |
2830 | ||
2831 | six3n1n1n1n1n1n = (reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.) | |
2832 | * (five4n1n1n1n1n+4.*five2n1n1n1n1n+6.*five3n1n2n1n1n+4.*four3n1n1n1n) | |
2833 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four3n1n1n1n+6.*four4n2n1n1n+6.*four1n1n1n1n | |
2834 | + 12.*three2n1n1n+12.*four2n1n2n1n+6.*four3n1n1n1n+12.*three3n2n1n+4.*four3n1n3n1n+3.*four3n1n2n2n) | |
2835 | - dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+12.*three3n2n1n+4.*three4n3n1n+3.*three4n2n2n+4.*two1n1n | |
2836 | + 12.*two1n1n+6.*three2n1n1n+12.*three2n1n1n+4.*three3n2n1n+12.*two2n2n+4.*three3n2n1n+4.*two3n3n+1.*three4n3n1n | |
2837 | + 6.*three3n2n1n)-dMult*(dMult-1.)*(4.*two1n1n+6.*two2n2n+4.*two3n3n+1.*two4n4n+1.*two1n1n+4.+6.*two1n1n+4.*two2n2n | |
2838 | + 1.*two3n3n)-dMult)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed) | |
2839 | ||
2840 | // average 6-particle correlations for single event: | |
2841 | fIntFlowCorrelationsAllEBE->SetBinContent(24,six1n1n1n1n1n1n); | |
2842 | fIntFlowCorrelationsAllEBE->SetBinContent(25,six2n1n1n2n1n1n); | |
2843 | fIntFlowCorrelationsAllEBE->SetBinContent(26,six2n2n1n1n1n1n); | |
2844 | fIntFlowCorrelationsAllEBE->SetBinContent(27,six3n1n1n1n1n1n); | |
2845 | ||
2846 | // average 6-particle correlations for all events: | |
2847 | fIntFlowCorrelationsAllPro->Fill(23.5,six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
2848 | fIntFlowCorrelationsAllPro->Fill(24.5,six2n1n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
2849 | fIntFlowCorrelationsAllPro->Fill(25.5,six2n2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
2850 | fIntFlowCorrelationsAllPro->Fill(26.5,six3n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
2851 | ||
2852 | // store separetately <6> (to be improved: do I really need this?) | |
2853 | fIntFlowCorrelationsEBE->SetBinContent(3,six1n1n1n1n1n1n); // <6> | |
2854 | ||
2855 | // to be improved (this can be implemented better): | |
2856 | Double_t mWeight6p = 0.; | |
2857 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
2858 | { | |
2859 | mWeight6p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.); | |
2860 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
2861 | { | |
2862 | mWeight6p = 1.; | |
2863 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
2864 | { | |
2865 | mWeight6p = dMult; | |
2866 | } | |
2867 | ||
2868 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(3,mWeight6p); // eW_<6> | |
2869 | fIntFlowCorrelationsPro->Fill(2.5,six1n1n1n1n1n1n,mWeight6p); | |
b40a910e | 2870 | fIntFlowSquaredCorrelationsPro->Fill(2.5,six1n1n1n1n1n1n*six1n1n1n1n1n1n,mWeight6p); |
2871 | if(fCalculateCumulantsVsM) | |
2872 | { | |
2873 | fIntFlowCorrelationsVsMPro[2]->Fill(dMult+0.5,six1n1n1n1n1n1n,mWeight6p); | |
2874 | fIntFlowSquaredCorrelationsVsMPro[2]->Fill(dMult+0.5,six1n1n1n1n1n1n*six1n1n1n1n1n1n,mWeight6p); | |
2875 | } | |
489d5531 | 2876 | // distribution of <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> |
2877 | //f6pDistribution->Fill(six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
2878 | } // end of if(dMult>5) | |
2879 | ||
2880 | // 7-particle: | |
2881 | Double_t seven2n1n1n1n1n1n1n = 0.; // <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> | |
2882 | ||
2883 | if(dMult>6) | |
2884 | { | |
2885 | seven2n1n1n1n1n1n1n = (reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.) | |
2886 | * (2.*six3n1n1n1n1n1n+4.*six1n1n1n1n1n1n+1.*six2n2n1n1n1n1n+6.*six2n1n1n2n1n1n+8.*five2n1n1n1n1n) | |
2887 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(1.*five4n1n1n1n1n +8.*five2n1n1n1n1n+8.*four3n1n1n1n | |
2888 | + 12.*five3n1n2n1n1n+4.*five2n1n1n1n1n+3.*five2n2n2n1n1n+6.*five2n2n2n1n1n+6.*four1n1n1n1n+24.*four1n1n1n1n | |
2889 | + 12.*five2n1n1n1n1n+12.*five2n1n1n1n1n+12.*three2n1n1n+24.*four2n1n2n1n+4.*five3n1n2n1n1n+4.*five2n1n1n1n1n) | |
2890 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four3n1n1n1n+6.*four4n2n1n1n+12.*four1n1n1n1n+24.*three2n1n1n | |
2891 | + 24.*four2n1n2n1n+12.*four3n1n1n1n+24.*three3n2n1n+8.*four3n1n3n1n+6.*four3n1n2n2n+6.*three2n1n1n+12.*four1n1n1n1n | |
2892 | + 12.*four2n1n2n1n+6.*three2n1n1n+12.*four2n1n2n1n+4.*four3n1n2n2n+3.*four2n2n2n2n+4.*four1n1n1n1n+6.*three2n1n1n | |
2893 | + 24.*two1n1n+24.*four1n1n1n1n+4.*four3n1n1n1n+24.*two1n1n+24.*three2n1n1n+12.*two2n2n+24.*three2n1n1n+12.*four2n1n2n1n | |
2894 | + 8.*three3n2n1n+8.*four2n1n2n1n+1.*four4n2n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+1.*three2n1n1n+8.*two1n1n | |
2895 | + 12.*three3n2n1n+24.*two1n1n+12.*three2n1n1n+4.*three2n1n1n+8.*two1n1n+4.*three4n3n1n+24.*three2n1n1n+8.*three3n2n1n | |
2896 | + 12.*two1n1n+12.*two1n1n+3.*three4n2n2n+24.*two2n2n+6.*two2n2n+12.+12.*three3n2n1n+8.*two3n3n+12.*three2n1n1n+24.*two1n1n | |
2897 | + 4.*three3n2n1n+8.*three3n2n1n+2.*three4n3n1n+12.*two1n1n+8.*three2n1n1n+4.*three2n1n1n+2.*three3n2n1n+6.*two2n2n+8.*two2n2n | |
2898 | + 1.*three4n2n2n+4.*three3n2n1n+6.*three2n1n1n)-dMult*(dMult-1.)*(4.*two1n1n+2.*two1n1n+6.*two2n2n+8.+1.*two2n2n+4.*two3n3n | |
2899 | + 12.*two1n1n+4.*two1n1n+1.*two4n4n+8.*two2n2n+6.+2.*two3n3n+4.*two1n1n+1.*two2n2n)-dMult) | |
2900 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)); // to be improved (direct formula needed) | |
2901 | ||
2902 | // average 7-particle correlations for single event: | |
2903 | fIntFlowCorrelationsAllEBE->SetBinContent(29,seven2n1n1n1n1n1n1n); | |
2904 | ||
2905 | // average 7-particle correlations for all events: | |
2906 | fIntFlowCorrelationsAllPro->Fill(28.5,seven2n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)); | |
2907 | } // end of if(dMult>6) | |
2908 | ||
2909 | // 8-particle: | |
2910 | Double_t eight1n1n1n1n1n1n1n1n = 0.; // <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> | |
2911 | if(dMult>7) | |
2912 | { | |
2913 | eight1n1n1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),4.)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.) | |
2914 | * (12.*seven2n1n1n1n1n1n1n+16.*six1n1n1n1n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.) | |
2915 | * (8.*six3n1n1n1n1n1n+48.*six1n1n1n1n1n1n+6.*six2n2n1n1n1n1n+96.*five2n1n1n1n1n+72.*four1n1n1n1n+36.*six2n1n1n2n1n1n) | |
2916 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(2.*five4n1n1n1n1n+32.*five2n1n1n1n1n+36.*four1n1n1n1n | |
2917 | + 32.*four3n1n1n1n+48.*five2n1n1n1n1n+48.*five3n1n2n1n1n+144.*five2n1n1n1n1n+288.*four1n1n1n1n+36.*five2n2n2n1n1n | |
2918 | + 144.*three2n1n1n+96.*two1n1n+144.*four2n1n2n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) | |
2919 | * (8.*four3n1n1n1n+48.*four1n1n1n1n+12.*four4n2n1n1n+96.*four2n1n2n1n+96.*three2n1n1n+72.*three2n1n1n+144.*two1n1n | |
2920 | + 16.*four3n1n3n1n+48.*four3n1n1n1n+144.*four1n1n1n1n+72.*four1n1n1n1n+96.*three3n2n1n+24.*four3n1n2n2n+144.*four2n1n2n1n | |
2921 | + 288.*two1n1n+288.*three2n1n1n+9.*four2n2n2n2n+72.*two2n2n+24.)-dMult*(dMult-1.)*(dMult-2.)*(12.*three2n1n1n+16.*two1n1n | |
2922 | + 24.*three3n2n1n+48.*three2n1n1n+96.*two1n1n+8.*three4n3n1n+32.*three3n2n1n+96.*three2n1n1n+144.*two1n1n+6.*three4n2n2n | |
2923 | + 96.*two2n2n+36.*two2n2n+72.+48.*three3n2n1n+16.*two3n3n+72.*three2n1n1n+144.*two1n1n)-dMult*(dMult-1.)*(8.*two1n1n | |
2924 | + 12.*two2n2n+16.+8.*two3n3n+48.*two1n1n+1.*two4n4n+16.*two2n2n+18.)-dMult) | |
2925 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); // to be improved (direct formula needed) | |
2926 | ||
2927 | // average 8-particle correlations for single event: | |
2928 | fIntFlowCorrelationsAllEBE->SetBinContent(31,eight1n1n1n1n1n1n1n1n); | |
2929 | ||
2930 | // average 8-particle correlations for all events: | |
2931 | fIntFlowCorrelationsAllPro->Fill(30.5,eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); | |
2932 | ||
2933 | // store separetately <8> (to be improved: do I really need this?) | |
2934 | fIntFlowCorrelationsEBE->SetBinContent(4,eight1n1n1n1n1n1n1n1n); // <8> | |
2935 | ||
2936 | // to be improved (this can be implemented better): | |
2937 | Double_t mWeight8p = 0.; | |
2938 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
2939 | { | |
2940 | mWeight8p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.); | |
2941 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
2942 | { | |
2943 | mWeight8p = 1.; | |
2944 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
2945 | { | |
2946 | mWeight8p = dMult; | |
2947 | } | |
2948 | ||
2949 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(4,mWeight8p); // eW_<8> | |
b40a910e | 2950 | fIntFlowCorrelationsPro->Fill(3.5,eight1n1n1n1n1n1n1n1n,mWeight8p); |
2951 | fIntFlowSquaredCorrelationsPro->Fill(3.5,eight1n1n1n1n1n1n1n1n*eight1n1n1n1n1n1n1n1n,mWeight8p); | |
2952 | if(fCalculateCumulantsVsM) | |
2953 | { | |
2954 | fIntFlowCorrelationsVsMPro[3]->Fill(dMult+0.5,eight1n1n1n1n1n1n1n1n,mWeight8p); | |
2955 | fIntFlowSquaredCorrelationsVsMPro[3]->Fill(dMult+0.5,eight1n1n1n1n1n1n1n1n*eight1n1n1n1n1n1n1n1n,mWeight8p); | |
2956 | } | |
489d5531 | 2957 | // distribution of <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> |
2958 | //f8pDistribution->Fill(eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); | |
2959 | } // end of if(dMult>7) | |
2960 | ||
11d3e40e | 2961 | // EXTRA: // to be improved (reorganized) |
8ed4edc7 | 2962 | |
2963 | // 33rd bin: <4>_{4n,2n|3n,3n}= four4n2n3n3n = <cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4))> | |
2964 | // 34th bin: <5>_{2n,2n,2n|3n,3n} = five2n2n2n3n3n = <cos(n*(2.*phi1+2.*phi2+2.*phi3-3.*phi4-3.*phi5))> | |
2965 | ||
2966 | // 4-particle: | |
2967 | Double_t four4n2n3n3n = 0.; // <cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4))> | |
2968 | Double_t reQ4nQ2nQ3nstarQ3nstar = (dReQ4n*dReQ2n-dImQ4n*dImQ2n)*(dReQ3n*dReQ3n-dImQ3n*dImQ3n) | |
2969 | + 2.*(dReQ4n*dImQ2n+dImQ4n*dReQ2n)*dReQ3n*dImQ3n; | |
8ed4edc7 | 2970 | Double_t reQ6nQ4nstarQ2nstar = dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n |
2971 | + dImQ6n*dImQ4n*dReQ2n; | |
11d3e40e | 2972 | Double_t reQ6nQ3nstarQ3nstar = pow(dReQ3n,2.)*dReQ6n + 2.*dReQ3n*dImQ3n*dImQ6n |
2973 | - pow(dImQ3n,2.)*dReQ6n; | |
8ed4edc7 | 2974 | if(dMult>3.) |
2975 | { | |
11d3e40e | 2976 | four4n2n3n3n = (reQ4nQ2nQ3nstarQ3nstar-reQ6nQ4nstarQ2nstar-reQ6nQ3nstarQ3nstar |
2977 | - 2.*reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar | |
2978 | + (pow(dReQ6n,2.)+pow(dImQ6n,2.))+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
2979 | + 2.*(2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2980 | + (pow(dReQ1n,2.)+pow(dImQ1n,2.))-3.*dMult)) | |
2981 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2982 | ||
8ed4edc7 | 2983 | fIntFlowCorrelationsAllPro->Fill(32.5,four4n2n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
11d3e40e | 2984 | } // end of if(dMult>3.) |
8ed4edc7 | 2985 | |
2986 | // 5-particle: | |
2987 | Double_t five2n2n2n3n3n = 0.; // <cos(n*(2.*phi1+2.*phi2+2.*phi3-3.*phi4-3.*phi5))> | |
2988 | Double_t reQ2nQ2nQ2nQ3nstarQ3nstar = pow(dReQ2n,3.)*pow(dReQ3n,2.) | |
11d3e40e | 2989 | - 3.*dReQ2n*pow(dReQ3n,2.)*pow(dImQ2n,2.) |
2990 | + 6.*pow(dReQ2n,2.)*dReQ3n*dImQ2n*dImQ3n | |
2991 | - 2.*dReQ3n*pow(dImQ2n,3.)*dImQ3n-pow(dReQ2n,3.)*pow(dImQ3n,2.) | |
2992 | + 3.*dReQ2n*pow(dImQ2n,2.)*pow(dImQ3n,2.); | |
2993 | Double_t reQ2nQ2nQ2nQ6nstar = dReQ6n*pow(dReQ2n,3)-3.*dReQ2n*dReQ6n*pow(dImQ2n,2) | |
2994 | + 3.*dImQ2n*dImQ6n*pow(dReQ2n,2)-dImQ6n*pow(dImQ2n,3); | |
2995 | Double_t reQ2nQ2nQ1nstarQ3nstar = reQ3nQ1nQ2nstarQ2nstar; | |
2996 | Double_t reQ4nQ2nQ6nstar = reQ6nQ4nstarQ2nstar; | |
2997 | Double_t reQ4nQ1nstarQ3nstar = reQ3nQ1nQ4nstar; | |
8ed4edc7 | 2998 | if(dMult>4.) |
2999 | { | |
11d3e40e | 3000 | five2n2n2n3n3n = (reQ2nQ2nQ2nQ3nstarQ3nstar-reQ2nQ2nQ2nQ6nstar-3.*reQ4nQ2nQ3nstarQ3nstar |
3001 | - 6.*reQ2nQ2nQ1nstarQ3nstar+2.*reQ6nQ3nstarQ3nstar+3.*reQ4nQ2nQ6nstar | |
3002 | + 6.*reQ4nQ1nstarQ3nstar+6.*reQ2nQ2nQ4nstar | |
3003 | + 12.*reQ2nQ1nQ3nstar+6.*reQ2nQ1nstarQ1nstar | |
3004 | - 2.*((pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
3005 | + 3.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3006 | + 6.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3007 | + 9.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3008 | + 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-12.*dMult)) | |
3009 | /(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3010 | ||
8ed4edc7 | 3011 | fIntFlowCorrelationsAllPro->Fill(33.5,five2n2n2n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
11d3e40e | 3012 | } // end of if(dMult>4.) |
8ed4edc7 | 3013 | |
489d5531 | 3014 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelations() |
3015 | ||
489d5531 | 3016 | //================================================================================================================================ |
3017 | ||
e5834fcb | 3018 | void AliFlowAnalysisWithQCumulants::StorePhiDistributionForOneEvent(AliFlowEventSimple *anEvent) |
3019 | { | |
3020 | // Store phi distribution for one event to illustrate flow. | |
3021 | ||
3022 | if(fPhiDistributionForOneEvent->GetEntries()>0){return;} // store only phi distribution for one event | |
3023 | ||
3024 | Double_t vMin = fPhiDistributionForOneEventSettings[0]; | |
3025 | Double_t vMax = fPhiDistributionForOneEventSettings[1]; | |
3026 | Double_t refMultMin = fPhiDistributionForOneEventSettings[2]; | |
3027 | Double_t refMultMax = fPhiDistributionForOneEventSettings[3]; | |
3028 | ||
3029 | Double_t vEBE = 0.; | |
3030 | Double_t cumulant4thEBE = fIntFlowCorrelationsEBE->GetBinContent(2)-2.*pow(fIntFlowCorrelationsEBE->GetBinContent(1),2.); | |
3031 | if(cumulant4thEBE<0.) | |
3032 | { | |
3033 | vEBE = pow(-1.*cumulant4thEBE,0.25); | |
3034 | if((vEBE>vMin && vEBE<vMax) && (fReferenceMultiplicityEBE>refMultMin && fReferenceMultiplicityEBE<refMultMax)) | |
3035 | { | |
3958eee6 | 3036 | fPhiDistributionForOneEvent->SetTitle(Form("v_{%i} = %f",fHarmonic,vEBE)); |
e5834fcb | 3037 | for(Int_t p=0;p<anEvent->NumberOfTracks();p++) |
3038 | { | |
3039 | if(anEvent->GetTrack(p)->InRPSelection()) | |
3040 | { | |
3041 | fPhiDistributionForOneEvent->Fill(anEvent->GetTrack(p)->Phi()); | |
3042 | } | |
3043 | } // end of for(Int_t p=0;p<anEvent->NumberOfTracks();p++) | |
3958eee6 | 3044 | } else |
3045 | { | |
3046 | fPhiDistributionForOneEvent->SetTitle(Form("v_{%i} = %f, out of specified boundaries",fHarmonic,vEBE)); | |
3047 | } | |
3048 | ||
e5834fcb | 3049 | } // end of if(cumulant4thEBE<0.) |
3050 | ||
3051 | } // end of void AliFlowAnalysisWithQCumulants::StorePhiDistributionForOneEvent(AliFlowEventSimple *anEvent) | |
3052 | ||
3053 | //================================================================================================================================ | |
489d5531 | 3054 | |
3055 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrelations() | |
3056 | { | |
0328db2d | 3057 | // Calculate averages of products of correlations for integrated flow. |
489d5531 | 3058 | |
2001bc3a | 3059 | // multiplicity: |
1268c371 | 3060 | Double_t dMult = (*fSpk)(0,0); |
2001bc3a | 3061 | |
489d5531 | 3062 | Int_t counter = 0; |
3063 | ||
3064 | for(Int_t ci1=1;ci1<4;ci1++) | |
3065 | { | |
3066 | for(Int_t ci2=ci1+1;ci2<=4;ci2++) | |
3067 | { | |
ff70ca91 | 3068 | fIntFlowProductOfCorrelationsPro->Fill(0.5+counter, |
3069 | fIntFlowCorrelationsEBE->GetBinContent(ci1)* | |
3070 | fIntFlowCorrelationsEBE->GetBinContent(ci2), | |
3071 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
3072 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); | |
3073 | // products versus multiplicity: // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>] | |
b3dacf6b | 3074 | if(fCalculateCumulantsVsM) |
3075 | { | |
3076 | fIntFlowProductOfCorrelationsVsMPro[counter]->Fill(dMult+0.5, // to be improved: dMult => sum of weights ? | |
3077 | fIntFlowCorrelationsEBE->GetBinContent(ci1)* | |
3078 | fIntFlowCorrelationsEBE->GetBinContent(ci2), | |
3079 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
3080 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); | |
3081 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 3082 | counter++; |
489d5531 | 3083 | } |
3084 | } | |
3085 | ||
3086 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrelations() | |
3087 | ||
3088 | ||
3089 | //================================================================================================================================ | |
3090 | ||
3091 | ||
0328db2d | 3092 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrectionTermsForNUA() |
3093 | { | |
3094 | // Calculate averages of products of correction terms for NUA. | |
3095 | ||
3096 | // a) Binning of fIntFlowProductOfCorrectionTermsForNUAPro is organized as follows: | |
3097 | // 1st bin: <<2><cos(phi)>> | |
3098 | // 2nd bin: <<2><sin(phi)>> | |
3099 | // 3rd bin: <<cos(phi)><sin(phi)>> | |
3100 | // 4th bin: <<2><cos(phi1+phi2)>> | |
3101 | // 5th bin: <<2><sin(phi1+phi2)>> | |
3102 | // 6th bin: <<2><cos(phi1-phi2-phi3)>> | |
3103 | // 7th bin: <<2><sin(phi1-phi2-phi3)>> | |
3104 | // 8th bin: <<4><cos(phi1)>> | |
3105 | // 9th bin: <<4><sin(phi1)>> | |
3106 | // 10th bin: <<4><cos(phi1+phi2)>> | |
3107 | // 11th bin: <<4><sin(phi1+phi2)>> | |
3108 | // 12th bin: <<4><cos(phi1-phi2-phi3)>> | |
3109 | // 13th bin: <<4><sin(phi1-phi2-phi3)>> | |
3110 | // 14th bin: <<cos(phi1)><cos(phi1+phi2)>> | |
3111 | // 15th bin: <<cos(phi1)><sin(phi1+phi2)>> | |
3112 | // 16th bin: <<cos(phi1)><cos(phi1-phi2-phi3)>> | |
3113 | // 17th bin: <<cos(phi1)><sin(phi1-phi2-phi3)>> | |
3114 | // 18th bin: <<sin(phi1)><cos(phi1+phi2)>> | |
3115 | // 19th bin: <<sin(phi1)><sin(phi1+phi2)>> | |
3116 | // 20th bin: <<sin(phi1)><cos(phi1-phi2-phi3)>> | |
3117 | // 21st bin: <<sin(phi1)><sin(phi1-phi2-phi3)>> | |
3118 | // 22nd bin: <<cos(phi1+phi2)><sin(phi1+phi2)>> | |
3119 | // 23rd bin: <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
3120 | // 24th bin: <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
3121 | // 25th bin: <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
3122 | // 26th bin: <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
3123 | // 27th bin: <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>> | |
3124 | ||
3125 | // <<2><cos(phi)>>: | |
3126 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(0.5, | |
3127 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1), | |
3128 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3129 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
3130 | // <<2><sin(phi)>>: | |
3131 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(1.5, | |
3132 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1), | |
3133 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3134 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
3135 | // <<cos(phi)><sin(phi)>>: | |
3136 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(2.5, | |
3137 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1), | |
3138 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3139 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
3140 | // <<2><cos(phi1+phi2)>>: | |
3141 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(3.5, | |
3142 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3143 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3144 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3145 | // <<2><sin(phi1+phi2)>>: | |
3146 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(4.5, | |
3147 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3148 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3149 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3150 | // <<2><cos(phi1-phi2-phi3)>>: | |
3151 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(5.5, | |
3152 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3153 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3154 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3155 | // <<2><sin(phi1-phi2-phi3)>>: | |
3156 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(6.5, | |
3157 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3158 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3159 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3160 | // <<4><cos(phi1)>>: | |
3161 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(7.5, | |
3162 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1), | |
3163 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3164 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
3165 | // <<4><sin(phi1)>>: | |
3166 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(8.5, | |
3167 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1), | |
3168 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3169 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
3170 | // <<4><cos(phi1+phi2)>>: | |
3171 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(9.5, | |
3172 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3173 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3174 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3175 | // <<4><sin(phi1+phi2)>>: | |
3176 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(10.5, | |
3177 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3178 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3179 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3180 | // <<4><cos(phi1-phi2-phi3)>>: | |
3181 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(11.5, | |
3182 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3183 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3184 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3185 | // <<4><sin(phi1-phi2-phi3)>>: | |
3186 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(12.5, | |
3187 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3188 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3189 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3190 | // <<cos(phi1)><cos(phi1+phi2)>>: | |
3191 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(13.5, | |
3192 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3193 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3194 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3195 | // <<cos(phi1)><sin(phi1+phi2)>>: | |
3196 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(14.5, | |
3197 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3198 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3199 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3200 | // <<cos(phi1)><cos(phi1-phi2-phi3)>>: | |
3201 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(15.5, | |
3202 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3203 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3204 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3205 | // <<cos(phi1)><sin(phi1-phi2-phi3)>>: | |
3206 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(16.5, | |
3207 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3208 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3209 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3210 | // <<sin(phi1)><cos(phi1+phi2)>>: | |
3211 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(17.5, | |
3212 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3213 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3214 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3215 | // <<sin(phi1)><sin(phi1+phi2)>>: | |
3216 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(18.5, | |
3217 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3218 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3219 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3220 | // <<sin(phi1)><cos(phi1-phi2-phi3)>>: | |
3221 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(19.5, | |
3222 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3223 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3224 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3225 | // <<sin(phi1)><sin(phi1-phi2-phi3)>>: | |
3226 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(20.5, | |
3227 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3228 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3229 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3230 | // <<cos(phi1+phi2)><sin(phi1+phi2)>>: | |
3231 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(21.5, | |
3232 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3233 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2) | |
3234 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3235 | // <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>>: | |
3236 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(22.5, | |
3237 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3238 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2) | |
3239 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3240 | // <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>>: | |
3241 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(23.5, | |
3242 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3243 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2) | |
3244 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3245 | // <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>>: | |
3246 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(24.5, | |
3247 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3248 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2) | |
3249 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3250 | // <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>>: | |
3251 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(25.5, | |
3252 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3253 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2) | |
3254 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3255 | // <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>>: | |
3256 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(26.5, | |
3257 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3258 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3) | |
3259 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3260 | ||
3261 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrectionTermsForNUA() | |
3262 | ||
0328db2d | 3263 | //================================================================================================================================ |
3264 | ||
489d5531 | 3265 | void AliFlowAnalysisWithQCumulants::CalculateCovariancesIntFlow() |
3266 | { | |
3267 | // a) Calculate unbiased estimators Cov(<2>,<4>), Cov(<2>,<6>), Cov(<2>,<8>), Cov(<4>,<6>), Cov(<4>,<8>) and Cov(<6>,<8>) | |
3268 | // for covariances V_(<2>,<4>), V_(<2>,<6>), V_(<2>,<8>), V_(<4>,<6>), V_(<4>,<8>) and V_(<6>,<8>). | |
3269 | // b) Store in histogram fIntFlowCovariances for instance the following: | |
3270 | // | |
3271 | // Cov(<2>,<4>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4>}_j)] | |
3272 | // | |
3273 | // where N is the number of events, w_{<2>} is event weight for <2> and w_{<4>} is event weight for <4>. | |
3274 | // c) Binning of fIntFlowCovariances is organized as follows: | |
3275 | // | |
3276 | // 1st bin: Cov(<2>,<4>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4>}_j)] | |
3277 | // 2nd bin: Cov(<2>,<6>) * (sum_{i=1}^{N} w_{<2>}_i w_{<6>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<6>}_j)] | |
3278 | // 3rd bin: Cov(<2>,<8>) * (sum_{i=1}^{N} w_{<2>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<8>}_j)] | |
3279 | // 4th bin: Cov(<4>,<6>) * (sum_{i=1}^{N} w_{<4>}_i w_{<6>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<6>}_j)] | |
3280 | // 5th bin: Cov(<4>,<8>) * (sum_{i=1}^{N} w_{<4>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<8>}_j)] | |
3281 | // 6th bin: Cov(<6>,<8>) * (sum_{i=1}^{N} w_{<6>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<6>}_i) * (sum_{j=1}^{N} w_{<8>}_j)] | |
b3dacf6b | 3282 | // |
489d5531 | 3283 | |
b3dacf6b | 3284 | // Average 2-, 4-, 6- and 8-particle correlations for all events: |
489d5531 | 3285 | Double_t correlation[4] = {0.}; |
3286 | for(Int_t ci=0;ci<4;ci++) | |
3287 | { | |
3288 | correlation[ci] = fIntFlowCorrelationsPro->GetBinContent(ci+1); | |
3289 | } | |
b3dacf6b | 3290 | // Average products of 2-, 4-, 6- and 8-particle correlations: |
489d5531 | 3291 | Double_t productOfCorrelations[4][4] = {{0.}}; |
3292 | Int_t productOfCorrelationsLabel = 1; | |
b3dacf6b | 3293 | // Denominators in the expressions for the unbiased estimator for covariance: |
489d5531 | 3294 | Double_t denominator[4][4] = {{0.}}; |
3295 | Int_t sumOfProductOfEventWeightsLabel1 = 1; | |
b3dacf6b | 3296 | // Weight dependent prefactor which multiply unbiased estimators for covariances: |
489d5531 | 3297 | Double_t wPrefactor[4][4] = {{0.}}; |
3298 | Int_t sumOfProductOfEventWeightsLabel2 = 1; | |
3299 | for(Int_t c1=0;c1<4;c1++) | |
3300 | { | |
3301 | for(Int_t c2=c1+1;c2<4;c2++) | |
3302 | { | |
3303 | productOfCorrelations[c1][c2] = fIntFlowProductOfCorrelationsPro->GetBinContent(productOfCorrelationsLabel); | |
b3dacf6b | 3304 | if(TMath::Abs(fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1)) > 1.e-44 && TMath::Abs(fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)) > 1.e-44) |
3305 | { | |
3306 | denominator[c1][c2] = 1.-(fIntFlowSumOfProductOfEventWeights->GetBinContent(sumOfProductOfEventWeightsLabel1)) | |
3307 | / (fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1) | |
3308 | * fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)); | |
3309 | wPrefactor[c1][c2] = fIntFlowSumOfProductOfEventWeights->GetBinContent(sumOfProductOfEventWeightsLabel2) | |
3310 | / (fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1) | |
3311 | * fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)); | |
489d5531 | 3312 | } |
b3dacf6b | 3313 | productOfCorrelationsLabel++; // to be improved - do I need here all 3 counters? |
489d5531 | 3314 | sumOfProductOfEventWeightsLabel1++; |
3315 | sumOfProductOfEventWeightsLabel2++; | |
b3dacf6b | 3316 | } // end of for(Int_t c2=c1+1;c2<4;c2++) |
3317 | } // end of for(Int_t c1=0;c1<4;c1++) | |
489d5531 | 3318 | |
489d5531 | 3319 | Int_t covarianceLabel = 1; |
3320 | for(Int_t c1=0;c1<4;c1++) | |
3321 | { | |
3322 | for(Int_t c2=c1+1;c2<4;c2++) | |
3323 | { | |
b3dacf6b | 3324 | if(TMath::Abs(denominator[c1][c2]) > 1.e-44) |
489d5531 | 3325 | { |
b3dacf6b | 3326 | // Covariances: |
489d5531 | 3327 | Double_t cov = (productOfCorrelations[c1][c2]-correlation[c1]*correlation[c2])/denominator[c1][c2]; |
b3dacf6b | 3328 | // Covariances multiplied with weight dependent prefactor: |
489d5531 | 3329 | Double_t wCov = cov * wPrefactor[c1][c2]; |
3330 | fIntFlowCovariances->SetBinContent(covarianceLabel,wCov); | |
3331 | } | |
3332 | covarianceLabel++; | |
b3dacf6b | 3333 | } // end of for(Int_t c2=c1+1;c2<4;c2++) |
3334 | } // end of for(Int_t c1=0;c1<4;c1++) | |
489d5531 | 3335 | |
b3dacf6b | 3336 | // Versus multiplicity: |
3337 | if(!fCalculateCumulantsVsM){return;} | |
9da1a4f3 | 3338 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) |
3339 | for(Int_t b=1;b<=nBins;b++) | |
3340 | { | |
b3dacf6b | 3341 | // Average 2-, 4-, 6- and 8-particle correlations for all events: |
9da1a4f3 | 3342 | Double_t correlationVsM[4] = {0.}; |
3343 | for(Int_t ci=0;ci<4;ci++) | |
3344 | { | |
3345 | correlationVsM[ci] = fIntFlowCorrelationsVsMPro[ci]->GetBinContent(b); | |
3346 | } // end of for(Int_t ci=0;ci<4;ci++) | |
b3dacf6b | 3347 | // Average products of 2-, 4-, 6- and 8-particle correlations: |
9da1a4f3 | 3348 | Double_t productOfCorrelationsVsM[4][4] = {{0.}}; |
3349 | Int_t productOfCorrelationsLabelVsM = 1; | |
b3dacf6b | 3350 | // Denominators in the expressions for the unbiased estimator for covariance: |
9da1a4f3 | 3351 | Double_t denominatorVsM[4][4] = {{0.}}; |
3352 | Int_t sumOfProductOfEventWeightsLabel1VsM = 1; | |
b3dacf6b | 3353 | // Weight dependent prefactor which multiply unbiased estimators for covariances: |
9da1a4f3 | 3354 | Double_t wPrefactorVsM[4][4] = {{0.}}; |
3355 | Int_t sumOfProductOfEventWeightsLabel2VsM = 1; | |
3356 | for(Int_t c1=0;c1<4;c1++) | |
3357 | { | |
3358 | for(Int_t c2=c1+1;c2<4;c2++) | |
3359 | { | |
3360 | productOfCorrelationsVsM[c1][c2] = fIntFlowProductOfCorrelationsVsMPro[productOfCorrelationsLabelVsM-1]->GetBinContent(b); | |
b3dacf6b | 3361 | if(TMath::Abs(fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b)) > 1.e-44 && TMath::Abs(fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)) > 1.e-44) |
3362 | { | |
3363 | denominatorVsM[c1][c2] = 1.-(fIntFlowSumOfProductOfEventWeightsVsM[sumOfProductOfEventWeightsLabel1VsM-1]->GetBinContent(b)) | |
3364 | / (fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b) | |
3365 | * fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)); | |
3366 | wPrefactorVsM[c1][c2] = fIntFlowSumOfProductOfEventWeightsVsM[sumOfProductOfEventWeightsLabel2VsM-1]->GetBinContent(b) | |
3367 | / (fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b) | |
3368 | * fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)); | |
9da1a4f3 | 3369 | } |
3370 | productOfCorrelationsLabelVsM++; | |
3371 | sumOfProductOfEventWeightsLabel1VsM++; | |
3372 | sumOfProductOfEventWeightsLabel2VsM++; | |
3373 | } // end of for(Int_t c1=0;c1<4;c1++) | |
3374 | } // end of for(Int_t c2=c1+1;c2<4;c2++) | |
b3dacf6b | 3375 | |
9da1a4f3 | 3376 | Int_t covarianceLabelVsM = 1; |
3377 | for(Int_t c1=0;c1<4;c1++) | |
3378 | { | |
3379 | for(Int_t c2=c1+1;c2<4;c2++) | |
3380 | { | |
b3dacf6b | 3381 | if(TMath::Abs(denominatorVsM[c1][c2]) > 1.e-44) |
9da1a4f3 | 3382 | { |
b3dacf6b | 3383 | // Covariances: |
9da1a4f3 | 3384 | Double_t covVsM = (productOfCorrelationsVsM[c1][c2]-correlationVsM[c1]*correlationVsM[c2])/denominatorVsM[c1][c2]; |
b3dacf6b | 3385 | // Covariances multiplied with weight dependent prefactor: |
9da1a4f3 | 3386 | Double_t wCovVsM = covVsM * wPrefactorVsM[c1][c2]; |
3387 | fIntFlowCovariancesVsM[covarianceLabelVsM-1]->SetBinContent(b,wCovVsM); | |
3388 | } | |
3389 | covarianceLabelVsM++; | |
b3dacf6b | 3390 | } // end of for(Int_t c2=c1+1;c2<4;c2++) |
3391 | } // end of for(Int_t c1=0;c1<4;c1++) | |
9da1a4f3 | 3392 | } // end of for(Int_t b=1;b<=nBins;b++) |
3393 | ||
489d5531 | 3394 | } // end of AliFlowAnalysisWithQCumulants::CalculateCovariancesIntFlow() |
3395 | ||
489d5531 | 3396 | //================================================================================================================================ |
3397 | ||
0328db2d | 3398 | void AliFlowAnalysisWithQCumulants::CalculateCovariancesNUAIntFlow() |
3399 | { | |
3400 | // a) Calculate unbiased estimators Cov(*,*) for true covariances V_(*,*) for NUA terms. | |
3401 | // b) Store in histogram fIntFlowCovariancesNUA for instance the following: | |
3402 | // | |
3403 | // Cov(<2>,<cos(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<cos(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<cos(phi)>}_j)] | |
3404 | // | |
3405 | // where N is the number of events, w_{<2>} is event weight for <2> and w_{<cos(phi)>} is event weight for <cos(phi)>. | |
3406 | // c) Binning of fIntFlowCovariancesNUA is organized as follows: | |
3407 | // | |
3408 | // 1st bin: Cov(<2>,<cos(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<cos(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<cos(phi)>}_j)] | |
3409 | // 2nd bin: Cov(<2>,<sin(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<sin(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<sin(phi)>}_j)] | |
3410 | // 3rd bin: Cov(<cos(phi)>,<sin(phi)>) * (sum_{i=1}^{N} w_{<cos(phi)>}_i w_{<sin(phi)>}_i )/[(sum_{i=1}^{N} w_{<cos(phi)>}_i) * (sum_{j=1}^{N} w_{<sin(phi)>}_j)] | |
3411 | // ... | |
3412 | ||
3413 | // Cov(<2>,<cos(phi)>): | |
3414 | Double_t product1 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(1); // <<2><cos(phi)>> | |
3415 | Double_t term1st1 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
3416 | Double_t term2nd1 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi)>> | |
3417 | Double_t sumOfW1st1 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
3418 | Double_t sumOfW2nd1 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi)>} | |
3419 | Double_t sumOfWW1 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(1); // W_{<2>} * W_{<cos(phi)>} | |
3420 | // numerator in the expression for the the unbiased estimator for covariance: | |
3421 | Double_t numerator1 = product1 - term1st1*term2nd1; | |
3422 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3423 | Double_t denominator1 = 0.; |
3424 | if(TMath::Abs(sumOfW1st1*sumOfW2nd1)>0.) | |
3425 | { | |
3426 | denominator1 = 1.-sumOfWW1/(sumOfW1st1*sumOfW2nd1); | |
3427 | if(TMath::Abs(denominator1)>0.) | |
3428 | { | |
3429 | // covariance: | |
3430 | Double_t covariance1 = numerator1/denominator1; | |
3431 | // weight dependent prefactor for covariance: | |
3432 | Double_t wPrefactor1 = sumOfWW1/(sumOfW1st1*sumOfW2nd1); | |
3433 | // finally, store "weighted" covariance: | |
3434 | fIntFlowCovariancesNUA->SetBinContent(1,wPrefactor1*covariance1); | |
3435 | } // end of if(TMath::Abs(denominator)>0.) | |
3436 | } // end of if(TMath::Abs(sumOfW1st1*sumOfW2nd1)>0.) | |
3437 | ||
0328db2d | 3438 | // Cov(<2>,<sin(phi)>): |
3439 | Double_t product2 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(2); // <<2><sin(phi)>> | |
3440 | Double_t term1st2 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
3441 | Double_t term2nd2 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi)>> | |
3442 | Double_t sumOfW1st2 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
3443 | Double_t sumOfW2nd2 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi)>} | |
3444 | Double_t sumOfWW2 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(2); // W_{<2>} * W_{<sin(phi)>} | |
3445 | // numerator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3446 | Double_t numerator2 = product2 - term1st2*term2nd2; |
0328db2d | 3447 | // denominator in the expression for the the unbiased estimator for covariance: |
b92ea2b9 | 3448 | Double_t denominator2 = 0.; |
3449 | if(TMath::Abs(sumOfW1st2*sumOfW2nd2)>0.) | |
3450 | { | |
3451 | denominator2 = 1.-sumOfWW2/(sumOfW1st2*sumOfW2nd2); | |
3452 | if(TMath::Abs(denominator2)>0.) | |
3453 | { | |
3454 | // covariance: | |
3455 | Double_t covariance2 = numerator2/denominator2; | |
3456 | // weight dependent prefactor for covariance: | |
3457 | Double_t wPrefactor2 = sumOfWW2/(sumOfW1st2*sumOfW2nd2); | |
3458 | // finally, store "weighted" covariance: | |
3459 | fIntFlowCovariancesNUA->SetBinContent(2,wPrefactor2*covariance2); | |
3460 | } // end of if(TMath::Abs(denominator2)>0.) | |
3461 | } // end of if(TMath::Abs(sumOfW1st2*sumOfW2nd2)>0.) | |
0328db2d | 3462 | |
3463 | // Cov(<cos(phi)>,<sin(phi)>): | |
3464 | Double_t product3 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(3); // <<cos(phi)><sin(phi)>> | |
3465 | Double_t term1st3 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi)>> | |
3466 | Double_t term2nd3 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi)>> | |
3467 | Double_t sumOfW1st3 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi)>} | |
3468 | Double_t sumOfW2nd3 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi)>} | |
3469 | Double_t sumOfWW3 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(3); // W_{<cos(phi)>} * W_{<sin(phi)>} | |
3470 | // numerator in the expression for the the unbiased estimator for covariance: | |
3471 | Double_t numerator3 = product3 - term1st3*term2nd3; | |
3472 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3473 | Double_t denominator3 = 0; |
3474 | if(TMath::Abs(sumOfW1st3*sumOfW2nd3)>0.) | |
3475 | { | |
3476 | denominator3 = 1.-sumOfWW3/(sumOfW1st3*sumOfW2nd3); | |
3477 | if(TMath::Abs(denominator3)>0.) | |
3478 | { | |
3479 | // covariance: | |
3480 | Double_t covariance3 = numerator3/denominator3; | |
3481 | // weight dependent prefactor for covariance: | |
3482 | Double_t wPrefactor3 = sumOfWW3/(sumOfW1st3*sumOfW2nd3); | |
3483 | // finally, store "weighted" covariance: | |
3484 | fIntFlowCovariancesNUA->SetBinContent(3,wPrefactor3*covariance3); | |
3485 | } // end of if(TMath::Abs(denominator3)>0.) | |
3486 | } // end of if(TMath::Abs(sumOfW1st3*sumOfW2nd3)>0.) | |
0328db2d | 3487 | |
3488 | // Cov(<2>,<cos(phi1+phi2)>): | |
3489 | Double_t product4 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(4); // <<2><cos(phi1+phi2)>> | |
3490 | Double_t term1st4 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
3491 | Double_t term2nd4 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
3492 | Double_t sumOfW1st4 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
3493 | Double_t sumOfW2nd4 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
3494 | Double_t sumOfWW4 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(4); // W_{<2>} * W_{<cos(phi1+phi2)>} | |
3495 | // numerator in the expression for the the unbiased estimator for covariance: | |
3496 | Double_t numerator4 = product4 - term1st4*term2nd4; | |
3497 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3498 | Double_t denominator4 = 0.; |
3499 | if(TMath::Abs(sumOfW1st4*sumOfW2nd4)>0.) | |
3500 | { | |
3501 | denominator4 = 1.-sumOfWW4/(sumOfW1st4*sumOfW2nd4); | |
3502 | if(TMath::Abs(denominator4)>0.) | |
3503 | { | |
3504 | // covariance: | |
3505 | Double_t covariance4 = numerator4/denominator4; | |
3506 | // weight dependent prefactor for covariance: | |
3507 | Double_t wPrefactor4 = sumOfWW4/(sumOfW1st4*sumOfW2nd4); | |
3508 | // finally, store "weighted" covariance: | |
3509 | fIntFlowCovariancesNUA->SetBinContent(4,wPrefactor4*covariance4); | |
3510 | } // end of if(TMath::Abs(denominator4)>0.) | |
3511 | } // end of if(TMath::Abs(sumOfW1st4*sumOfW2nd4)>0.) | |
3512 | ||
0328db2d | 3513 | // Cov(<2>,<sin(phi1+phi2)>): |
3514 | Double_t product5 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(5); // <<2><sin(phi1+phi2)>> | |
3515 | Double_t term1st5 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
3516 | Double_t term2nd5 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
3517 | Double_t sumOfW1st5 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
3518 | Double_t sumOfW2nd5 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
3519 | Double_t sumOfWW5 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(5); // W_{<2>} * W_{<sin(phi1+phi2)>} | |
3520 | // numerator in the expression for the the unbiased estimator for covariance: | |
3521 | Double_t numerator5 = product5 - term1st5*term2nd5; | |
3522 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3523 | Double_t denominator5 = 0.; |
3524 | if(TMath::Abs(sumOfW1st5*sumOfW2nd5)>0.) | |
3525 | { | |
3526 | denominator5 = 1.-sumOfWW5/(sumOfW1st5*sumOfW2nd5); | |
3527 | if(TMath::Abs(denominator5)>0.) | |
3528 | { | |
3529 | // covariance: | |
3530 | Double_t covariance5 = numerator5/denominator5; | |
3531 | // weight dependent prefactor for covariance: | |
3532 | Double_t wPrefactor5 = sumOfWW5/(sumOfW1st5*sumOfW2nd5); | |
3533 | // finally, store "weighted" covariance: | |
3534 | fIntFlowCovariancesNUA->SetBinContent(5,wPrefactor5*covariance5); | |
3535 | } // end of if(TMath::Abs(denominator5)>0.) | |
3536 | } // end of if(TMath::Abs(sumOfW1st5*sumOfW2nd5)>0.) | |
3537 | ||
0328db2d | 3538 | // Cov(<2>,<cos(phi1-phi2-phi3)>): |
3539 | Double_t product6 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(6); // <<2><cos(phi1-phi2-phi3)>> | |
3540 | Double_t term1st6 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
3541 | Double_t term2nd6 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
3542 | Double_t sumOfW1st6 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
3543 | Double_t sumOfW2nd6 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
3544 | Double_t sumOfWW6 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(6); // W_{<2>} * W_{<cos(phi1-phi2-phi3)>} | |
3545 | // numerator in the expression for the the unbiased estimator for covariance: | |
3546 | Double_t numerator6 = product6 - term1st6*term2nd6; | |
3547 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3548 | Double_t denominator6 = 0.; |
3549 | if(TMath::Abs(sumOfW1st6*sumOfW2nd6)>0.) | |
3550 | { | |
3551 | denominator6 = 1.-sumOfWW6/(sumOfW1st6*sumOfW2nd6); | |
3552 | if(TMath::Abs(denominator6)>0.) | |
3553 | { | |
3554 | // covariance: | |
3555 | Double_t covariance6 = numerator6/denominator6; | |
3556 | // weight dependent prefactor for covariance: | |
3557 | Double_t wPrefactor6 = sumOfWW6/(sumOfW1st6*sumOfW2nd6); | |
3558 | // finally, store "weighted" covariance: | |
3559 | fIntFlowCovariancesNUA->SetBinContent(6,wPrefactor6*covariance6); | |
3560 | } // end of if(TMath::Abs(denominator6)>0.) | |
3561 | } // end of if(TMath::Abs(sumOfW1st6*sumOfW2nd6)>0.) | |
3562 | ||
0328db2d | 3563 | // Cov(<2>,<sin(phi1-phi2-phi3)>): |
3564 | Double_t product7 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(7); // <<2><sin(phi1-phi2-phi3)>> | |
3565 | Double_t term1st7 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
3566 | Double_t term2nd7 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
3567 | Double_t sumOfW1st7 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
3568 | Double_t sumOfW2nd7 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
3569 | Double_t sumOfWW7 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(7); // W_{<2>} * W_{<sin(phi1-phi2-phi3)>} | |
3570 | // numerator in the expression for the the unbiased estimator for covariance: | |
3571 | Double_t numerator7 = product7 - term1st7*term2nd7; | |
3572 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3573 | Double_t denominator7 = 0.; |
3574 | if(TMath::Abs(sumOfW1st7*sumOfW2nd7)>0.) | |
3575 | { | |
3576 | denominator7 = 1.-sumOfWW7/(sumOfW1st7*sumOfW2nd7); | |
3577 | if(TMath::Abs(denominator7)>0.) | |
3578 | { | |
3579 | // covariance: | |
3580 | Double_t covariance7 = numerator7/denominator7; | |
3581 | // weight dependent prefactor for covariance: | |
3582 | Double_t wPrefactor7 = sumOfWW7/(sumOfW1st7*sumOfW2nd7); | |
3583 | // finally, store "weighted" covariance: | |
3584 | fIntFlowCovariancesNUA->SetBinContent(7,wPrefactor7*covariance7); | |
3585 | } // end of if(TMath::Abs(denominator7)>0.) | |
3586 | } // end of if(TMath::Abs(sumOfW1st7*sumOfW2nd7)>0.) | |
3587 | ||
0328db2d | 3588 | // Cov(<4>,<cos(phi1>): |
3589 | Double_t product8 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(8); // <<4><cos(phi1)>> | |
3590 | Double_t term1st8 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
3591 | Double_t term2nd8 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
3592 | Double_t sumOfW1st8 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
3593 | Double_t sumOfW2nd8 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
3594 | Double_t sumOfWW8 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(8); // W_{<4>} * W_{<cos(phi1)>} | |
3595 | // numerator in the expression for the the unbiased estimator for covariance: | |
3596 | Double_t numerator8 = product8 - term1st8*term2nd8; | |
3597 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3598 | Double_t denominator8 = 0.; |
3599 | if(TMath::Abs(sumOfW1st8*sumOfW2nd8)>0.) | |
3600 | { | |
3601 | denominator8 = 1.-sumOfWW8/(sumOfW1st8*sumOfW2nd8); | |
3602 | if(TMath::Abs(denominator8)>0.) | |
3603 | { | |
3604 | // covariance: | |
3605 | Double_t covariance8 = numerator8/denominator8; | |
3606 | // weight dependent prefactor for covariance: | |
3607 | Double_t wPrefactor8 = sumOfWW8/(sumOfW1st8*sumOfW2nd8); | |
3608 | // finally, store "weighted" covariance: | |
3609 | fIntFlowCovariancesNUA->SetBinContent(8,wPrefactor8*covariance8); | |
3610 | } // end of if(TMath::Abs(denominator8)>0.) | |
3611 | } // end of if(TMath::Abs(sumOfW1st8*sumOfW2nd8)>0.) | |
3612 | ||
0328db2d | 3613 | // Cov(<4>,<sin(phi1)>): |
3614 | Double_t product9 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(9); // <<4><sin(phi1)>> | |
3615 | Double_t term1st9 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
3616 | Double_t term2nd9 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
3617 | Double_t sumOfW1st9 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
3618 | Double_t sumOfW2nd9 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
3619 | Double_t sumOfWW9 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(9); // W_{<4>} * W_{<sin(phi1)>} | |
3620 | // numerator in the expression for the the unbiased estimator for covariance: | |
3621 | Double_t numerator9 = product9 - term1st9*term2nd9; | |
3622 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3623 | Double_t denominator9 = 0.; |
3624 | if(TMath::Abs(sumOfW1st9*sumOfW2nd9)>0.) | |
3625 | { | |
3626 | denominator9 = 1.-sumOfWW9/(sumOfW1st9*sumOfW2nd9); | |
3627 | if(TMath::Abs(denominator9)>0.) | |
3628 | { | |
3629 | // covariance: | |
3630 | Double_t covariance9 = numerator9/denominator9; | |
3631 | // weight dependent prefactor for covariance: | |
3632 | Double_t wPrefactor9 = sumOfWW9/(sumOfW1st9*sumOfW2nd9); | |
3633 | // finally, store "weighted" covariance: | |
3634 | fIntFlowCovariancesNUA->SetBinContent(9,wPrefactor9*covariance9); | |
3635 | } | |
3636 | } // end of if(TMath::Abs(sumOfW1st9*sumOfW2nd9)>0.) | |
3637 | ||
0328db2d | 3638 | // Cov(<4>,<cos(phi1+phi2)>): |
3639 | Double_t product10 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(10); // <<4><cos(phi1+phi2)>> | |
3640 | Double_t term1st10 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
3641 | Double_t term2nd10 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
3642 | Double_t sumOfW1st10 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
3643 | Double_t sumOfW2nd10 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
3644 | Double_t sumOfWW10 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(10); // W_{<4>} * W_{<cos(phi1+phi2)>} | |
3645 | // numerator in the expression for the the unbiased estimator for covariance: | |
3646 | Double_t numerator10 = product10 - term1st10*term2nd10; | |
3647 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3648 | Double_t denominator10 = 0.; |
3649 | if(TMath::Abs(sumOfW1st10*sumOfW2nd10)>0.) | |
3650 | { | |
3651 | denominator10 = 1.-sumOfWW10/(sumOfW1st10*sumOfW2nd10); | |
3652 | if(TMath::Abs(denominator10)>0.) | |
3653 | { | |
3654 | // covariance: | |
3655 | Double_t covariance10 = numerator10/denominator10; | |
3656 | // weight dependent prefactor for covariance: | |
3657 | Double_t wPrefactor10 = sumOfWW10/(sumOfW1st10*sumOfW2nd10); | |
3658 | // finally, store "weighted" covariance: | |
3659 | fIntFlowCovariancesNUA->SetBinContent(10,wPrefactor10*covariance10); | |
3660 | } // end of if(TMath::Abs(denominator10)>0.) | |
3661 | } // end of if(TMath::Abs(sumOfW1st10*sumOfW2nd10)>0.) | |
3662 | ||
0328db2d | 3663 | // Cov(<4>,<sin(phi1+phi2)>): |
3664 | Double_t product11 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(11); // <<4><sin(phi1+phi2)>> | |
3665 | Double_t term1st11 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
3666 | Double_t term2nd11 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
3667 | Double_t sumOfW1st11 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
3668 | Double_t sumOfW2nd11 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
3669 | Double_t sumOfWW11 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(11); // W_{<4>} * W_{<sin(phi1+phi2)>} | |
3670 | // numerator in the expression for the the unbiased estimator for covariance: | |
3671 | Double_t numerator11 = product11 - term1st11*term2nd11; | |
3672 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3673 | Double_t denominator11 = 0.; |
3674 | if(TMath::Abs(sumOfW1st11*sumOfW2nd11)>0.) | |
3675 | { | |
3676 | denominator11 = 1.-sumOfWW11/(sumOfW1st11*sumOfW2nd11); | |
3677 | if(TMath::Abs(denominator11)>0.) | |
3678 | { | |
3679 | // covariance: | |
3680 | Double_t covariance11 = numerator11/denominator11; | |
3681 | // weight dependent prefactor for covariance: | |
3682 | Double_t wPrefactor11 = sumOfWW11/(sumOfW1st11*sumOfW2nd11); | |
3683 | // finally, store "weighted" covariance: | |
3684 | fIntFlowCovariancesNUA->SetBinContent(11,wPrefactor11*covariance11); | |
3685 | } // end of if(TMath::Abs(denominator11)>0.) | |
3686 | } // end of if(TMath::Abs(sumOfW1st11*sumOfW2nd11)>0.) | |
0328db2d | 3687 | |
3688 | // Cov(<4>,<cos(phi1-phi2-phi3)>): | |
3689 | Double_t product12 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(12); // <<4><cos(phi1-phi2-phi3)>> | |
3690 | Double_t term1st12 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
3691 | Double_t term2nd12 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
3692 | Double_t sumOfW1st12 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
3693 | Double_t sumOfW2nd12 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
3694 | Double_t sumOfWW12 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(12); // W_{<4>} * W_{<cos(phi1-phi2-phi3)>} | |
3695 | // numerator in the expression for the the unbiased estimator for covariance: | |
3696 | Double_t numerator12 = product12 - term1st12*term2nd12; | |
3697 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3698 | Double_t denominator12 = 0.; |
3699 | if(TMath::Abs(sumOfW1st12*sumOfW2nd12)>0.) | |
3700 | { | |
3701 | denominator12 = 1.-sumOfWW12/(sumOfW1st12*sumOfW2nd12); | |
3702 | if(TMath::Abs(denominator12)>0.) | |
3703 | { | |
3704 | // covariance: | |
3705 | Double_t covariance12 = numerator12/denominator12; | |
3706 | // weight dependent prefactor for covariance: | |
3707 | Double_t wPrefactor12 = sumOfWW12/(sumOfW1st12*sumOfW2nd12); | |
3708 | // finally, store "weighted" covariance: | |
3709 | fIntFlowCovariancesNUA->SetBinContent(12,wPrefactor12*covariance12); | |
3710 | } // end of if(TMath::Abs(denominator12)>0.) | |
3711 | } // end of if(TMath::Abs(sumOfW1st12*sumOfW2nd12)>0.) | |
0328db2d | 3712 | |
3713 | // Cov(<4>,<sin(phi1-phi2-phi3)>): | |
3714 | Double_t product13 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(13); // <<4><sin(phi1-phi2-phi3)>> | |
3715 | Double_t term1st13 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
3716 | Double_t term2nd13 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
3717 | Double_t sumOfW1st13 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
3718 | Double_t sumOfW2nd13 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
3719 | Double_t sumOfWW13 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(13); // W_{<4>} * W_{<sin(phi1-phi2-phi3)>} | |
3720 | // numerator in the expression for the the unbiased estimator for covariance: | |
3721 | Double_t numerator13 = product13 - term1st13*term2nd13; | |
3722 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3723 | Double_t denominator13 = 0.; |
3724 | if(TMath::Abs(sumOfW1st13*sumOfW2nd13)>0.) | |
3725 | { | |
3726 | denominator13 = 1.-sumOfWW13/(sumOfW1st13*sumOfW2nd13); | |
3727 | if(TMath::Abs(denominator13)>0.) | |
3728 | { | |
3729 | // covariance: | |
3730 | Double_t covariance13 = numerator13/denominator13; | |
3731 | // weight dependent prefactor for covariance: | |
3732 | Double_t wPrefactor13 = sumOfWW13/(sumOfW1st13*sumOfW2nd13); | |
3733 | // finally, store "weighted" covariance: | |
3734 | fIntFlowCovariancesNUA->SetBinContent(13,wPrefactor13*covariance13); | |
3735 | } // end of if(TMath::Abs(denominator13)>0.) | |
3736 | } // end of if(TMath::Abs(sumOfW1st13*sumOfW2nd13)>0.) | |
0328db2d | 3737 | |
3738 | // Cov(<cos(phi1)>,<cos(phi1+phi2)>): | |
3739 | Double_t product14 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(14); // <<cos(phi1)><cos(phi1+phi2)>> | |
3740 | Double_t term1st14 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
3741 | Double_t term2nd14 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
3742 | Double_t sumOfW1st14 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
3743 | Double_t sumOfW2nd14 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
3744 | Double_t sumOfWW14 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(14); // W_{<cos(phi1)>} * W_{<cos(phi1+phi2)>} | |
3745 | // numerator in the expression for the the unbiased estimator for covariance: | |
3746 | Double_t numerator14 = product14 - term1st14*term2nd14; | |
3747 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3748 | Double_t denominator14 = 0.; |
3749 | if(TMath::Abs(sumOfW1st14*sumOfW2nd14)>0.) | |
3750 | { | |
3751 | denominator14 = 1.-sumOfWW14/(sumOfW1st14*sumOfW2nd14); | |
3752 | if(TMath::Abs(denominator14)>0.) | |
3753 | { | |
3754 | // covariance: | |
3755 | Double_t covariance14 = numerator14/denominator14; | |
3756 | // weight dependent prefactor for covariance: | |
3757 | Double_t wPrefactor14 = sumOfWW14/(sumOfW1st14*sumOfW2nd14); | |
3758 | // finally, store "weighted" covariance: | |
3759 | fIntFlowCovariancesNUA->SetBinContent(14,wPrefactor14*covariance14); | |
3760 | } // end of if(TMath::Abs(denominator14)>0.) | |
3761 | } // end of if(TMath::Abs(sumOfW1st14*sumOfW2nd14)>0.) | |
0328db2d | 3762 | |
3763 | // Cov(<cos(phi1)>,<sin(phi1+phi2)>): | |
3764 | Double_t product15 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(15); // <<cos(phi1)><sin(phi1+phi2)>> | |
3765 | Double_t term1st15 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
3766 | Double_t term2nd15 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
3767 | Double_t sumOfW1st15 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
3768 | Double_t sumOfW2nd15 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
3769 | Double_t sumOfWW15 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(15); // W_{<cos(phi1)>} * W_{<sin(phi1+phi2)>} | |
3770 | // numerator in the expression for the the unbiased estimator for covariance: | |
3771 | Double_t numerator15 = product15 - term1st15*term2nd15; | |
3772 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3773 | Double_t denominator15 = 0.; |
3774 | if(TMath::Abs(sumOfW1st15*sumOfW2nd15)>0.) | |
3775 | { | |
3776 | denominator15 = 1.-sumOfWW15/(sumOfW1st15*sumOfW2nd15); | |
3777 | if(TMath::Abs(denominator15)>0.) | |
3778 | { | |
3779 | // covariance: | |
3780 | Double_t covariance15 = numerator15/denominator15; | |
3781 | // weight dependent prefactor for covariance: | |
3782 | Double_t wPrefactor15 = sumOfWW15/(sumOfW1st15*sumOfW2nd15); | |
3783 | // finally, store "weighted" covariance: | |
3784 | fIntFlowCovariancesNUA->SetBinContent(15,wPrefactor15*covariance15); | |
3785 | } // end of if(TMath::Abs(denominator15)>0.) | |
3786 | } // end of if(TMath::Abs(sumOfW1st15*sumOfW2nd15)>0.) | |
3787 | ||
0328db2d | 3788 | // Cov(<cos(phi1)>,<cos(phi1-phi2-phi3)>): |
3789 | Double_t product16 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(16); // <<cos(phi1)><cos(phi1-phi2-phi3)>> | |
3790 | Double_t term1st16 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
3791 | Double_t term2nd16 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
3792 | Double_t sumOfW1st16 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
3793 | Double_t sumOfW2nd16 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
3794 | Double_t sumOfWW16 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(16); // W_{<cos(phi1)>} * W_{<cos(phi1-phi2-phi3)>} | |
3795 | // numerator in the expression for the the unbiased estimator for covariance: | |
3796 | Double_t numerator16 = product16 - term1st16*term2nd16; | |
3797 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3798 | Double_t denominator16 = 0.; |
3799 | if(TMath::Abs(sumOfW1st16*sumOfW2nd16)>0.) | |
3800 | { | |
3801 | denominator16 = 1.-sumOfWW16/(sumOfW1st16*sumOfW2nd16); | |
3802 | if(TMath::Abs(denominator16)>0.) | |
3803 | { | |
3804 | // covariance: | |
3805 | Double_t covariance16 = numerator16/denominator16; | |
3806 | // weight dependent prefactor for covariance: | |
3807 | Double_t wPrefactor16 = sumOfWW16/(sumOfW1st16*sumOfW2nd16); | |
3808 | // finally, store "weighted" covariance: | |
3809 | fIntFlowCovariancesNUA->SetBinContent(16,wPrefactor16*covariance16); | |
3810 | } // end of if(TMath::Abs(denominator16)>0.) | |
3811 | } // end ofif(TMath::Abs(sumOfW1st16*sumOfW2nd16)>0.) | |
3812 | ||
0328db2d | 3813 | // Cov(<cos(phi1)>,<sin(phi1-phi2-phi3)>): |
3814 | Double_t product17 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(17); // <<cos(phi1)><sin(phi1-phi2-phi3)>> | |
3815 | Double_t term1st17 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
3816 | Double_t term2nd17 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
3817 | Double_t sumOfW1st17 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
3818 | Double_t sumOfW2nd17 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
3819 | Double_t sumOfWW17 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(17); // W_{<cos(phi1)>} * W_{<sin(phi1-phi2-phi3)>} | |
3820 | // numerator in the expression for the the unbiased estimator for covariance: | |
3821 | Double_t numerator17 = product17 - term1st17*term2nd17; | |
3822 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3823 | Double_t denominator17 = 0.; |
3824 | if(TMath::Abs(sumOfW1st17*sumOfW2nd17)>0.) | |
3825 | { | |
3826 | denominator17 = 1.-sumOfWW17/(sumOfW1st17*sumOfW2nd17); | |
3827 | if(TMath::Abs(denominator17)>0.) | |
3828 | { | |
3829 | // covariance: | |
3830 | Double_t covariance17 = numerator17/denominator17; | |
3831 | // weight dependent prefactor for covariance: | |
3832 | Double_t wPrefactor17 = sumOfWW17/(sumOfW1st17*sumOfW2nd17); | |
3833 | // finally, store "weighted" covariance: | |
3834 | fIntFlowCovariancesNUA->SetBinContent(17,wPrefactor17*covariance17); | |
3835 | } // end of if(TMath::Abs(denominator17)>0.) | |
3836 | } // end of if(TMath::Abs(sumOfW1st17*sumOfW2nd17)>0.) | |
0328db2d | 3837 | |
3838 | // Cov(<sin(phi1)>,<cos(phi1+phi2)>): | |
3839 | Double_t product18 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(18); // <<sin(phi1)><cos(phi1+phi2)>> | |
3840 | Double_t term1st18 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
3841 | Double_t term2nd18 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
3842 | Double_t sumOfW1st18 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
3843 | Double_t sumOfW2nd18 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
3844 | Double_t sumOfWW18 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(18); // W_{<sin(phi1)>} * W_{<cos(phi1+phi2)>} | |
3845 | // numerator in the expression for the the unbiased estimator for covariance: | |
3846 | Double_t numerator18 = product18 - term1st18*term2nd18; | |
3847 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3848 | Double_t denominator18 = 0.; |
3849 | if(TMath::Abs(sumOfW1st18*sumOfW2nd18)>0.) | |
3850 | { | |
3851 | denominator18 = 1.-sumOfWW18/(sumOfW1st18*sumOfW2nd18); | |
3852 | if(TMath::Abs(denominator18)>0.) | |
3853 | { | |
3854 | // covariance: | |
3855 | Double_t covariance18 = numerator18/denominator18; | |
3856 | // weight dependent prefactor for covariance: | |
3857 | Double_t wPrefactor18 = sumOfWW18/(sumOfW1st18*sumOfW2nd18); | |
3858 | // finally, store "weighted" covariance: | |
3859 | fIntFlowCovariancesNUA->SetBinContent(18,wPrefactor18*covariance18); | |
3860 | } // end of if(TMath::Abs(denominator18)>0.) | |
3861 | } // end of if(TMath::Abs(sumOfW1st18*sumOfW2nd18)>0.) | |
0328db2d | 3862 | |
3863 | // Cov(<sin(phi1)>,<sin(phi1+phi2)>): | |
3864 | Double_t product19 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(19); // <<sin(phi1)><sin(phi1+phi2)>> | |
3865 | Double_t term1st19 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
3866 | Double_t term2nd19 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
3867 | Double_t sumOfW1st19 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
3868 | Double_t sumOfW2nd19 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
3869 | Double_t sumOfWW19 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(19); // W_{<sin(phi1)>} * W_{<sin(phi1+phi2)>} | |
3870 | // numerator in the expression for the the unbiased estimator for covariance: | |
3871 | Double_t numerator19 = product19 - term1st19*term2nd19; | |
3872 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3873 | Double_t denominator19 = 0.; |
3874 | if(TMath::Abs(sumOfW1st19*sumOfW2nd19)>0.) | |
3875 | { | |
3876 | denominator19 = 1.-sumOfWW19/(sumOfW1st19*sumOfW2nd19); | |
3877 | if(TMath::Abs(denominator19)>0.) | |
3878 | { | |
3879 | // covariance: | |
3880 | Double_t covariance19 = numerator19/denominator19; | |
3881 | // weight dependent prefactor for covariance: | |
3882 | Double_t wPrefactor19 = sumOfWW19/(sumOfW1st19*sumOfW2nd19); | |
3883 | // finally, store "weighted" covariance: | |
3884 | fIntFlowCovariancesNUA->SetBinContent(19,wPrefactor19*covariance19); | |
3885 | } // end of if(TMath::Abs(denominator19)>0.) | |
3886 | } // end of if(TMath::Abs(sumOfW1st19*sumOfW2nd19)>0.) | |
3887 | ||
0328db2d | 3888 | // Cov(<sin(phi1)>,<cos(phi1-phi2-phi3)>): |
3889 | Double_t product20 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(20); // <<sin(phi1)><cos(phi1-phi2-phi3)>> | |
3890 | Double_t term1st20 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
3891 | Double_t term2nd20 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
3892 | Double_t sumOfW1st20 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
3893 | Double_t sumOfW2nd20 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
3894 | Double_t sumOfWW20 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(20); // W_{<sin(phi1)>} * W_{<cos(phi1-phi2-phi3)>} | |
3895 | // numerator in the expression for the the unbiased estimator for covariance: | |
3896 | Double_t numerator20 = product20 - term1st20*term2nd20; | |
3897 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3898 | Double_t denominator20 = 0.; |
3899 | if(TMath::Abs(sumOfW1st20*sumOfW2nd20)>0.) | |
3900 | { | |
3901 | denominator20 = 1.-sumOfWW20/(sumOfW1st20*sumOfW2nd20); | |
3902 | if(TMath::Abs(denominator20)>0.) | |
3903 | { | |
3904 | // covariance: | |
3905 | Double_t covariance20 = numerator20/denominator20; | |
3906 | // weight dependent prefactor for covariance: | |
3907 | Double_t wPrefactor20 = sumOfWW20/(sumOfW1st20*sumOfW2nd20); | |
3908 | // finally, store "weighted" covariance: | |
3909 | fIntFlowCovariancesNUA->SetBinContent(20,wPrefactor20*covariance20); | |
3910 | } // end of if(TMath::Abs(denominator20)>0.) | |
3911 | } // end of if(TMath::Abs(sumOfW1st20*sumOfW2nd20)>0.) | |
0328db2d | 3912 | |
3913 | // Cov(<sin(phi1)>,<sin(phi1-phi2-phi3)>): | |
3914 | Double_t product21 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(21); // <<sin(phi1)><sin(phi1-phi2-phi3)>> | |
3915 | Double_t term1st21 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
3916 | Double_t term2nd21 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
3917 | Double_t sumOfW1st21 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
3918 | Double_t sumOfW2nd21 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
3919 | Double_t sumOfWW21 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(21); // W_{<sin(phi1)>} * W_{<sin(phi1-phi2-phi3)>} | |
3920 | // numerator in the expression for the the unbiased estimator for covariance: | |
3921 | Double_t numerator21 = product21 - term1st21*term2nd21; | |
3922 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3923 | Double_t denominator21 = 0.; |
3924 | if(TMath::Abs(sumOfW1st21*sumOfW2nd21)>0.) | |
3925 | { | |
3926 | denominator21 = 1.-sumOfWW21/(sumOfW1st21*sumOfW2nd21); | |
3927 | if(TMath::Abs(denominator21)>0.) | |
3928 | { | |
3929 | // covariance: | |
3930 | Double_t covariance21 = numerator21/denominator21; | |
3931 | // weight dependent prefactor for covariance: | |
3932 | Double_t wPrefactor21 = sumOfWW21/(sumOfW1st21*sumOfW2nd21); | |
3933 | // finally, store "weighted" covariance: | |
3934 | fIntFlowCovariancesNUA->SetBinContent(21,wPrefactor21*covariance21); | |
3935 | } // end of if(TMath::Abs(denominator21)>0.) | |
3936 | } // end of if(TMath::Abs(sumOfW1st21*sumOfW2nd21)>0.) | |
0328db2d | 3937 | |
3938 | // Cov(<cos(phi1+phi2)>,<sin(phi1+phi2)>): | |
3939 | Double_t product22 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(22); // <<cos(phi1+phi2)><sin(phi1+phi2)>> | |
3940 | Double_t term1st22 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
3941 | Double_t term2nd22 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
3942 | Double_t sumOfW1st22 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
3943 | Double_t sumOfW2nd22 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
3944 | Double_t sumOfWW22 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(22); // W_{<cos(phi1+phi2)>} * W_{<sin(phi1+phi2)>} | |
3945 | // numerator in the expression for the the unbiased estimator for covariance: | |
3946 | Double_t numerator22 = product22 - term1st22*term2nd22; | |
3947 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3948 | Double_t denominator22 = 0.; |
3949 | if(TMath::Abs(sumOfW1st22*sumOfW2nd22)>0.) | |
3950 | { | |
3951 | denominator22 = 1.-sumOfWW22/(sumOfW1st22*sumOfW2nd22); | |
3952 | if(TMath::Abs(denominator22)>0.) | |
3953 | { | |
3954 | // covariance: | |
3955 | Double_t covariance22 = numerator22/denominator22; | |
3956 | // weight dependent prefactor for covariance: | |
3957 | Double_t wPrefactor22 = sumOfWW22/(sumOfW1st22*sumOfW2nd22); | |
3958 | // finally, store "weighted" covariance: | |
3959 | fIntFlowCovariancesNUA->SetBinContent(22,wPrefactor22*covariance22); | |
3960 | } // end of if(TMath::Abs(denominator22)>0.) | |
3961 | } // end of if(TMath::Abs(sumOfW1st22*sumOfW2nd22)>0.) | |
0328db2d | 3962 | |
3963 | // Cov(<cos(phi1+phi2)>,<cos(phi1-phi2-phi3)>): | |
3964 | Double_t product23 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(23); // <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
3965 | Double_t term1st23 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
3966 | Double_t term2nd23 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
3967 | Double_t sumOfW1st23 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
3968 | Double_t sumOfW2nd23 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
3969 | Double_t sumOfWW23 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(23); // W_{<cos(phi1+phi2)>} * W_{<cos(phi1-phi2-phi3)>} | |
3970 | // numerator in the expression for the the unbiased estimator for covariance: | |
3971 | Double_t numerator23 = product23 - term1st23*term2nd23; | |
3972 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3973 | Double_t denominator23 = 0.; |
3974 | if(TMath::Abs(sumOfW1st23*sumOfW2nd23)>0.) | |
3975 | { | |
3976 | denominator23 = 1.-sumOfWW23/(sumOfW1st23*sumOfW2nd23); | |
3977 | if(TMath::Abs(denominator23)>0.) | |
3978 | { | |
3979 | // covariance: | |
3980 | Double_t covariance23 = numerator23/denominator23; | |
3981 | // weight dependent prefactor for covariance: | |
3982 | Double_t wPrefactor23 = sumOfWW23/(sumOfW1st23*sumOfW2nd23); | |
3983 | // finally, store "weighted" covariance: | |
3984 | fIntFlowCovariancesNUA->SetBinContent(23,wPrefactor23*covariance23); | |
3985 | } // end of if(TMath::Abs(denominator23)>0.) | |
3986 | } // end of if(TMath::Abs(sumOfW1st23*sumOfW2nd23)>0.) | |
3987 | ||
0328db2d | 3988 | // Cov(<cos(phi1+phi2)>,<sin(phi1-phi2-phi3)>): |
3989 | Double_t product24 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(24); // <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
3990 | Double_t term1st24 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
3991 | Double_t term2nd24 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
3992 | Double_t sumOfW1st24 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
3993 | Double_t sumOfW2nd24 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
3994 | Double_t sumOfWW24 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(24); // W_{<cos(phi1+phi2)>} * W_{<sin(phi1-phi2-phi3)>} | |
3995 | // numerator in the expression for the the unbiased estimator for covariance: | |
3996 | Double_t numerator24 = product24 - term1st24*term2nd24; | |
3997 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 3998 | Double_t denominator24 = 0.; |
3999 | if(TMath::Abs(sumOfW1st24*sumOfW2nd24)>0.) | |
4000 | { | |
4001 | denominator24 = 1.-sumOfWW24/(sumOfW1st24*sumOfW2nd24); | |
4002 | if(TMath::Abs(denominator24)>0.) | |
4003 | { | |
4004 | // covariance: | |
4005 | Double_t covariance24 = numerator24/denominator24; | |
4006 | // weight dependent prefactor for covariance: | |
4007 | Double_t wPrefactor24 = sumOfWW24/(sumOfW1st24*sumOfW2nd24); | |
4008 | // finally, store "weighted" covariance: | |
4009 | fIntFlowCovariancesNUA->SetBinContent(24,wPrefactor24*covariance24); | |
4010 | } // end of if(TMath::Abs(denominator24)>0.) | |
4011 | } // end of if(TMath::Abs(sumOfW1st24*sumOfW2nd24)>0.) | |
0328db2d | 4012 | |
4013 | // Cov(<sin(phi1+phi2)>,<cos(phi1-phi2-phi3)>): | |
4014 | Double_t product25 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(25); // <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
4015 | Double_t term1st25 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4016 | Double_t term2nd25 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
4017 | Double_t sumOfW1st25 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4018 | Double_t sumOfW2nd25 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
4019 | Double_t sumOfWW25 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(25); // W_{<sin(phi1+phi2)>} * W_{<cos(phi1-phi2-phi3)>} | |
4020 | // numerator in the expression for the the unbiased estimator for covariance: | |
4021 | Double_t numerator25 = product25 - term1st25*term2nd25; | |
4022 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4023 | Double_t denominator25 = 0.; |
4024 | if(TMath::Abs(sumOfW1st25*sumOfW2nd25)>0.) | |
4025 | { | |
4026 | denominator25 = 1.-sumOfWW25/(sumOfW1st25*sumOfW2nd25); | |
4027 | if(TMath::Abs(denominator25)>0.) | |
4028 | { | |
4029 | // covariance: | |
4030 | Double_t covariance25 = numerator25/denominator25; | |
4031 | // weight dependent prefactor for covariance: | |
4032 | Double_t wPrefactor25 = sumOfWW25/(sumOfW1st25*sumOfW2nd25); | |
4033 | // finally, store "weighted" covariance: | |
4034 | fIntFlowCovariancesNUA->SetBinContent(25,wPrefactor25*covariance25); | |
4035 | } // end of if(TMath::Abs(denominator25)>0.) | |
4036 | } // end of if(TMath::Abs(sumOfW1st25*sumOfW2nd25)>0.) | |
4037 | ||
0328db2d | 4038 | // Cov(<sin(phi1+phi2)>,<sin(phi1-phi2-phi3)>): |
4039 | Double_t product26 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(26); // <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
4040 | Double_t term1st26 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4041 | Double_t term2nd26 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
4042 | Double_t sumOfW1st26 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4043 | Double_t sumOfW2nd26 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
4044 | Double_t sumOfWW26 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(26); // W_{<sin(phi1+phi2)>} * W_{<sin(phi1-phi2-phi3)>} | |
4045 | // numerator in the expression for the the unbiased estimator for covariance: | |
4046 | Double_t numerator26 = product26 - term1st26*term2nd26; | |
4047 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4048 | Double_t denominator26 = 0.; |
4049 | if(TMath::Abs(sumOfW1st26*sumOfW2nd26)>0.) | |
4050 | { | |
4051 | denominator26 = 1.-sumOfWW26/(sumOfW1st26*sumOfW2nd26); | |
4052 | if(TMath::Abs(denominator26)>0.) | |
4053 | { | |
4054 | // covariance: | |
4055 | Double_t covariance26 = numerator26/denominator26; | |
4056 | // weight dependent prefactor for covariance: | |
4057 | Double_t wPrefactor26 = sumOfWW26/(sumOfW1st26*sumOfW2nd26); | |
4058 | // finally, store "weighted" covariance: | |
4059 | fIntFlowCovariancesNUA->SetBinContent(26,wPrefactor26*covariance26); | |
4060 | } // end of if(TMath::Abs(denominator26)>0.) | |
4061 | } // end of if(TMath::Abs(sumOfW1st26*sumOfW2nd26)>0.) | |
4062 | ||
0328db2d | 4063 | // Cov(<cos(phi1-phi2-phi3)>,<sin(phi1-phi2-phi3)>): |
4064 | Double_t product27 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(27); // <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>> | |
b92ea2b9 | 4065 | Double_t term1st27 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> |
0328db2d | 4066 | Double_t term2nd27 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> |
b92ea2b9 | 4067 | Double_t sumOfW1st27 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} |
0328db2d | 4068 | Double_t sumOfW2nd27 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} |
4069 | Double_t sumOfWW27 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(27); // W_{<cos(phi1-phi2-phi3)>} * W_{<sin(phi1-phi2-phi3)>} | |
4070 | // numerator in the expression for the the unbiased estimator for covariance: | |
4071 | Double_t numerator27 = product27 - term1st27*term2nd27; | |
4072 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4073 | Double_t denominator27 = 0.; |
4074 | if(TMath::Abs(sumOfW1st27*sumOfW2nd27)>0.) | |
4075 | { | |
4076 | denominator27 = 1.-sumOfWW27/(sumOfW1st27*sumOfW2nd27); | |
4077 | if(TMath::Abs(denominator27)>0.) | |
4078 | { | |
4079 | // covariance: | |
4080 | Double_t covariance27 = numerator27/denominator27; | |
4081 | // weight dependent prefactor for covariance: | |
4082 | Double_t wPrefactor27 = sumOfWW27/(sumOfW1st27*sumOfW2nd27); | |
4083 | // finally, store "weighted" covariance: | |
4084 | fIntFlowCovariancesNUA->SetBinContent(27,wPrefactor27*covariance27); | |
4085 | } // end of if(TMath::Abs(denominator27)>0.) | |
4086 | } // end of if(TMath::Abs(sumOfW1st27*sumOfW2nd27)>0.) | |
4087 | ||
0328db2d | 4088 | } // end of AliFlowAnalysisWithQCumulants::CalculateCovariancesNUAIntFlow() |
4089 | ||
0328db2d | 4090 | //================================================================================================================================ |
4091 | ||
489d5531 | 4092 | void AliFlowAnalysisWithQCumulants::FinalizeCorrelationsIntFlow() |
4093 | { | |
4094 | // From profile fIntFlowCorrelationsPro access measured correlations and spread, | |
4095 | // correctly calculate the statistical errors and store the final results and | |
4096 | // statistical errors for correlations in histogram fIntFlowCorrelationsHist. | |
4097 | // | |
4098 | // Remark: Statistical error of correlation is calculated as: | |
4099 | // | |
4100 | // statistical error = termA * spread * termB: | |
4101 | // termA = sqrt{sum_{i=1}^{N} w^2}/(sum_{i=1}^{N} w) | |
4102 | // termB = 1/sqrt(1-termA^2) | |
b3dacf6b | 4103 | // |
4104 | ||
489d5531 | 4105 | for(Int_t ci=1;ci<=4;ci++) // correlation index |
4106 | { | |
b40a910e | 4107 | if(fIntFlowCorrelationsPro->GetBinEffectiveEntries(ci) < 2 || fIntFlowSquaredCorrelationsPro->GetBinEffectiveEntries(ci) < 2) |
4108 | { | |
4109 | fIntFlowCorrelationsPro->SetBinError(ci,0.); | |
4110 | fIntFlowSquaredCorrelationsPro->SetBinError(ci,0.); | |
4111 | continue; | |
4112 | } | |
489d5531 | 4113 | Double_t correlation = fIntFlowCorrelationsPro->GetBinContent(ci); |
b40a910e | 4114 | Double_t squaredCorrelation = fIntFlowSquaredCorrelationsPro->GetBinContent(ci); |
4115 | Double_t spread = 0.; | |
4116 | if(squaredCorrelation-correlation*correlation >= 0.) | |
4117 | { | |
4118 | spread = pow(squaredCorrelation-correlation*correlation,0.5); | |
4119 | } else | |
4120 | { | |
4121 | cout<<endl; | |
4122 | cout<<Form(" WARNING: Imaginary 'spread' for %d-particle correlation!!!! ",2*ci)<<endl; | |
4123 | cout<<endl; | |
4124 | } | |
489d5531 | 4125 | Double_t sumOfLinearEventWeights = fIntFlowSumOfEventWeights[0]->GetBinContent(ci); |
4126 | Double_t sumOfQuadraticEventWeights = fIntFlowSumOfEventWeights[1]->GetBinContent(ci); | |
4127 | Double_t termA = 0.; | |
4128 | Double_t termB = 0.; | |
b3dacf6b | 4129 | if(TMath::Abs(sumOfLinearEventWeights) > 0.) // to be improved - shall I omitt here Abs() ? |
489d5531 | 4130 | { |
4131 | termA = pow(sumOfQuadraticEventWeights,0.5)/sumOfLinearEventWeights; | |
4132 | } else | |
4133 | { | |
b3dacf6b | 4134 | cout<<endl; |
4135 | cout<<" WARNING (QC): sumOfLinearEventWeights == 0 in method FinalizeCorrelationsIntFlow() !!!!"<<endl; | |
4136 | cout<<" (for "<<2*ci<<"-particle correlation)"<<endl; | |
4137 | cout<<endl; | |
489d5531 | 4138 | } |
4139 | if(1.-pow(termA,2.) > 0.) | |
4140 | { | |
4141 | termB = 1./pow(1-pow(termA,2.),0.5); | |
4142 | } else | |
4143 | { | |
b3dacf6b | 4144 | cout<<endl; |
4145 | cout<<" WARNING (QC): 1.-pow(termA,2.) <= 0 in method FinalizeCorrelationsIntFlow() !!!!"<<endl; | |
4146 | cout<<" (for "<<2*ci<<"-particle correlation)"<<endl; | |
4147 | cout<<endl; | |
489d5531 | 4148 | } |
4149 | Double_t statisticalError = termA * spread * termB; | |
4150 | fIntFlowCorrelationsHist->SetBinContent(ci,correlation); | |
4151 | fIntFlowCorrelationsHist->SetBinError(ci,statisticalError); | |
ff70ca91 | 4152 | } // end of for(Int_t ci=1;ci<=4;ci++) // correlation index |
4153 | ||
b3dacf6b | 4154 | // Versus multiplicity: |
4155 | if(!fCalculateCumulantsVsM){return;} | |
ff70ca91 | 4156 | for(Int_t ci=0;ci<=3;ci++) // correlation index |
4157 | { | |
4158 | Int_t nBins = fIntFlowCorrelationsVsMPro[ci]->GetNbinsX(); | |
4159 | for(Int_t b=1;b<=nBins;b++) // looping over multiplicity bins | |
4160 | { | |
b40a910e | 4161 | if(fIntFlowCorrelationsVsMPro[ci]->GetBinEffectiveEntries(b) < 2 || fIntFlowSquaredCorrelationsVsMPro[ci]->GetBinEffectiveEntries(b) < 2) |
4162 | { | |
4163 | fIntFlowCorrelationsVsMPro[ci]->SetBinError(b,0.); | |
4164 | fIntFlowSquaredCorrelationsVsMPro[ci]->SetBinError(b,0.); | |
4165 | continue; | |
4166 | } | |
ff70ca91 | 4167 | Double_t correlationVsM = fIntFlowCorrelationsVsMPro[ci]->GetBinContent(b); |
b40a910e | 4168 | Double_t squaredCorrelationVsM = fIntFlowSquaredCorrelationsVsMPro[ci]->GetBinContent(b); |
4169 | Double_t spreadVsM = 0.; | |
4170 | if(squaredCorrelationVsM-correlationVsM*correlationVsM >= 0.) | |
4171 | { | |
4172 | spreadVsM = pow(squaredCorrelationVsM-correlationVsM*correlationVsM,0.5); | |
4173 | } else | |
4174 | { | |
4175 | cout<<endl; | |
4176 | cout<<Form(" WARNING (QC): Imaginary 'spreadVsM' for ci = %d, bin = %d, entries = %f !!!!", | |
4177 | ci,b,fIntFlowCorrelationsVsMPro[ci]->GetBinEffectiveEntries(b))<<endl; | |
4178 | cout<<endl; | |
4179 | } | |
ff70ca91 | 4180 | Double_t sumOfLinearEventWeightsVsM = fIntFlowSumOfEventWeightsVsM[ci][0]->GetBinContent(b); |
4181 | Double_t sumOfQuadraticEventWeightsVsM = fIntFlowSumOfEventWeightsVsM[ci][1]->GetBinContent(b); | |
4182 | Double_t termAVsM = 0.; | |
4183 | Double_t termBVsM = 0.; | |
b40a910e | 4184 | if(sumOfLinearEventWeightsVsM > 0.) |
ff70ca91 | 4185 | { |
4186 | termAVsM = pow(sumOfQuadraticEventWeightsVsM,0.5)/sumOfLinearEventWeightsVsM; | |
b3dacf6b | 4187 | } |
ff70ca91 | 4188 | if(1.-pow(termAVsM,2.) > 0.) |
4189 | { | |
4190 | termBVsM = 1./pow(1-pow(termAVsM,2.),0.5); | |
b3dacf6b | 4191 | } |
ff70ca91 | 4192 | Double_t statisticalErrorVsM = termAVsM * spreadVsM * termBVsM; |
4193 | fIntFlowCorrelationsVsMHist[ci]->SetBinContent(b,correlationVsM); | |
4194 | fIntFlowCorrelationsVsMHist[ci]->SetBinError(b,statisticalErrorVsM); | |
4195 | } // end of for(Int_t b=1;b<=nBins;b++) | |
4196 | } // end of for(Int_t ci=1;ci<=4;ci++) // correlation index | |
4197 | ||
489d5531 | 4198 | } // end of AliFlowAnalysisWithQCumulants::FinalizeCorrelationsIntFlow() |
4199 | ||
489d5531 | 4200 | //================================================================================================================================ |
4201 | ||
489d5531 | 4202 | void AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(Int_t nRP) |
4203 | { | |
b77b6434 | 4204 | // Fill profile fAverageMultiplicity to hold average multiplicities and |
4205 | // number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8 | |
489d5531 | 4206 | |
4207 | // Binning of fAverageMultiplicity is organized as follows: | |
4208 | // 1st bin: all events (including the empty ones) | |
4209 | // 2nd bin: event with # of RPs greater or equal to 1 | |
4210 | // 3rd bin: event with # of RPs greater or equal to 2 | |
4211 | // 4th bin: event with # of RPs greater or equal to 3 | |
4212 | // 5th bin: event with # of RPs greater or equal to 4 | |
4213 | // 6th bin: event with # of RPs greater or equal to 5 | |
4214 | // 7th bin: event with # of RPs greater or equal to 6 | |
4215 | // 8th bin: event with # of RPs greater or equal to 7 | |
4216 | // 9th bin: event with # of RPs greater or equal to 8 | |
4217 | ||
489d5531 | 4218 | if(nRP<0) |
4219 | { | |
b77b6434 | 4220 | cout<<endl; |
4221 | cout<<" WARNING (QC): nRP<0 in in AFAWQC::FAM() !!!!"<<endl; | |
4222 | cout<<endl; | |
489d5531 | 4223 | exit(0); |
4224 | } | |
4225 | ||
4226 | for(Int_t i=0;i<9;i++) | |
4227 | { | |
b77b6434 | 4228 | if(nRP>=i){fAvMultiplicity->Fill(i+0.5,nRP,1);} |
489d5531 | 4229 | } |
4230 | ||
4231 | } // end of AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(nRP) | |
4232 | ||
489d5531 | 4233 | //================================================================================================================================ |
4234 | ||
489d5531 | 4235 | void AliFlowAnalysisWithQCumulants::CalculateCumulantsIntFlow() |
b3dacf6b | 4236 | { |
b92ea2b9 | 4237 | // a) Calculate Q-cumulants from the measured multiparticle correlations; |
4238 | // b) Propagate the statistical errors from measured multiparticle correlations to statistical errors of Q-cumulants; | |
4239 | // c) Remark: Q-cumulants calculated in this method are biased by non-uniform acceptance of detector !!!! | |
4240 | // Method CalculateQcumulantsCorrectedForNUAIntFlow() is called afterwards to correct for this bias; | |
4241 | // d) Store the results and statistical error of Q-cumulants in histogram fIntFlowQcumulants. | |
4242 | // Binning of fIntFlowQcumulants is organized as follows: | |
489d5531 | 4243 | // |
b3dacf6b | 4244 | // 1st bin: QC{2} |
4245 | // 2nd bin: QC{4} | |
4246 | // 3rd bin: QC{6} | |
4247 | // 4th bin: QC{8} | |
4248 | // | |
489d5531 | 4249 | |
b3dacf6b | 4250 | // Correlations: |
489d5531 | 4251 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> |
4252 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> | |
4253 | Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> | |
4254 | Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> | |
b3dacf6b | 4255 | // Statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations: |
489d5531 | 4256 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <2> |
4257 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <4> | |
4258 | Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <6> | |
4259 | Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <8> | |
b3dacf6b | 4260 | // Covariances (multiplied by prefactor depending on weights - see comments in CalculateCovariancesIntFlow()): |
8e1cefdd | 4261 | Double_t wCov24 = 0.; // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) |
4262 | Double_t wCov26 = 0.; // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>) | |
4263 | Double_t wCov28 = 0.; // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>) | |
4264 | Double_t wCov46 = 0.; // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>) | |
4265 | Double_t wCov48 = 0.; // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>) | |
4266 | Double_t wCov68 = 0.; // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>) | |
4267 | if(!fForgetAboutCovariances) | |
4268 | { | |
4269 | wCov24 = fIntFlowCovariances->GetBinContent(1); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) | |
4270 | wCov26 = fIntFlowCovariances->GetBinContent(2); // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>) | |
4271 | wCov28 = fIntFlowCovariances->GetBinContent(3); // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>) | |
4272 | wCov46 = fIntFlowCovariances->GetBinContent(4); // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>) | |
4273 | wCov48 = fIntFlowCovariances->GetBinContent(5); // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>) | |
4274 | wCov68 = fIntFlowCovariances->GetBinContent(6); // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>) | |
4275 | } | |
489d5531 | 4276 | // Q-cumulants: |
4277 | Double_t qc2 = 0.; // QC{2} | |
4278 | Double_t qc4 = 0.; // QC{4} | |
4279 | Double_t qc6 = 0.; // QC{6} | |
4280 | Double_t qc8 = 0.; // QC{8} | |
b3dacf6b | 4281 | if(TMath::Abs(two) > 0.){qc2 = two;} |
4282 | if(TMath::Abs(four) > 0.){qc4 = four-2.*pow(two,2.);} | |
4283 | if(TMath::Abs(six) > 0.){qc6 = six-9.*two*four+12.*pow(two,3.);} | |
4284 | if(TMath::Abs(eight) > 0.){qc8 = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.);} | |
4285 | // Statistical errors of Q-cumulants: | |
489d5531 | 4286 | Double_t qc2Error = 0.; |
4287 | Double_t qc4Error = 0.; | |
4288 | Double_t qc6Error = 0.; | |
b3dacf6b | 4289 | Double_t qc8Error = 0.; |
4290 | // Squared statistical errors of Q-cumulants: | |
489d5531 | 4291 | //Double_t qc2ErrorSquared = 0.; |
4292 | Double_t qc4ErrorSquared = 0.; | |
4293 | Double_t qc6ErrorSquared = 0.; | |
b3dacf6b | 4294 | Double_t qc8ErrorSquared = 0.; |
4295 | // Statistical error of QC{2}: | |
4296 | qc2Error = twoError; | |
4297 | // Statistical error of QC{4}: | |
489d5531 | 4298 | qc4ErrorSquared = 16.*pow(two,2.)*pow(twoError,2)+pow(fourError,2.) |
4299 | - 8.*two*wCov24; | |
4300 | if(qc4ErrorSquared>0.) | |
4301 | { | |
4302 | qc4Error = pow(qc4ErrorSquared,0.5); | |
4303 | } else | |
4304 | { | |
b3dacf6b | 4305 | cout<<" WARNING (QC): Statistical error of QC{4} is imaginary !!!!"<<endl; |
4306 | } | |
4307 | // Statistical error of QC{6}: | |
489d5531 | 4308 | qc6ErrorSquared = 81.*pow(4.*pow(two,2.)-four,2.)*pow(twoError,2.) |
4309 | + 81.*pow(two,2.)*pow(fourError,2.) | |
4310 | + pow(sixError,2.) | |
4311 | - 162.*two*(4.*pow(two,2.)-four)*wCov24 | |
4312 | + 18.*(4.*pow(two,2.)-four)*wCov26 | |
b3dacf6b | 4313 | - 18.*two*wCov46; |
489d5531 | 4314 | if(qc6ErrorSquared>0.) |
4315 | { | |
4316 | qc6Error = pow(qc6ErrorSquared,0.5); | |
4317 | } else | |
4318 | { | |
b3dacf6b | 4319 | cout<<" WARNING (QC): Statistical error of QC{6} is imaginary !!!!"<<endl; |
4320 | } | |
4321 | // Statistical error of QC{8}: | |
489d5531 | 4322 | qc8ErrorSquared = 256.*pow(36.*pow(two,3.)-18.*four*two+six,2.)*pow(twoError,2.) |
4323 | + 1296.*pow(4.*pow(two,2.)-four,2.)*pow(fourError,2.) | |
4324 | + 256.*pow(two,2.)*pow(sixError,2.) | |
4325 | + pow(eightError,2.) | |
4326 | - 1152.*(36.*pow(two,3.)-18.*four*two+six)*(4.*pow(two,2.)-four)*wCov24 | |
4327 | + 512.*two*(36.*pow(two,3.)-18.*four*two+six)*wCov26 | |
4328 | - 32.*(36.*pow(two,3.)-18.*four*two+six)*wCov28 | |
4329 | - 1152.*two*(4.*pow(two,2.)-four)*wCov46 | |
4330 | + 72.*(4.*pow(two,2.)-four)*wCov48 | |
4331 | - 32.*two*wCov68; | |
4332 | if(qc8ErrorSquared>0.) | |
4333 | { | |
4334 | qc8Error = pow(qc8ErrorSquared,0.5); | |
4335 | } else | |
4336 | { | |
b3dacf6b | 4337 | cout<<"WARNING (QC): Statistical error of QC{8} is imaginary !!!!"<<endl; |
489d5531 | 4338 | } |
b3dacf6b | 4339 | // Store the results and statistical errors for Q-cumulants: |
4340 | if(TMath::Abs(qc2)>0.) | |
4341 | { | |
4342 | fIntFlowQcumulants->SetBinContent(1,qc2); | |
4343 | fIntFlowQcumulants->SetBinError(1,qc2Error); | |
4344 | } | |
4345 | if(TMath::Abs(qc4)>0.) | |
4346 | { | |
4347 | fIntFlowQcumulants->SetBinContent(2,qc4); | |
4348 | fIntFlowQcumulants->SetBinError(2,qc4Error); | |
4349 | } | |
4350 | if(TMath::Abs(qc6)>0.) | |
4351 | { | |
4352 | fIntFlowQcumulants->SetBinContent(3,qc6); | |
4353 | fIntFlowQcumulants->SetBinError(3,qc6Error); | |
4354 | } | |
4355 | if(TMath::Abs(qc8)>0.) | |
4356 | { | |
4357 | fIntFlowQcumulants->SetBinContent(4,qc8); | |
4358 | fIntFlowQcumulants->SetBinError(4,qc8Error); | |
4359 | } | |
4360 | ||
4361 | // Versus multiplicity: | |
4362 | if(!fCalculateCumulantsVsM){return;} | |
9da1a4f3 | 4363 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) |
b3dacf6b | 4364 | Double_t value[4] = {0.}; // QCs vs M |
4365 | Double_t error[4] = {0.}; // error of QCs vs M | |
4366 | Double_t dSum1[4] = {0.}; // sum value_i/(error_i)^2 | |
4367 | Double_t dSum2[4] = {0.}; // sum 1/(error_i)^2 | |
9da1a4f3 | 4368 | for(Int_t b=1;b<=nBins;b++) |
4369 | { | |
b3dacf6b | 4370 | // Correlations: |
9da1a4f3 | 4371 | two = fIntFlowCorrelationsVsMHist[0]->GetBinContent(b); // <<2>> |
4372 | four = fIntFlowCorrelationsVsMHist[1]->GetBinContent(b); // <<4>> | |
4373 | six = fIntFlowCorrelationsVsMHist[2]->GetBinContent(b); // <<6>> | |
4374 | eight = fIntFlowCorrelationsVsMHist[3]->GetBinContent(b); // <<8>> | |
b3dacf6b | 4375 | // Statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations: |
9da1a4f3 | 4376 | twoError = fIntFlowCorrelationsVsMHist[0]->GetBinError(b); // statistical error of <2> |
4377 | fourError = fIntFlowCorrelationsVsMHist[1]->GetBinError(b); // statistical error of <4> | |
4378 | sixError = fIntFlowCorrelationsVsMHist[2]->GetBinError(b); // statistical error of <6> | |
4379 | eightError = fIntFlowCorrelationsVsMHist[3]->GetBinError(b); // statistical error of <8> | |
b3dacf6b | 4380 | // Covariances (multiplied by prefactor depending on weights - see comments in CalculateCovariancesIntFlow()): |
8e1cefdd | 4381 | if(!fForgetAboutCovariances) |
4382 | { | |
4383 | wCov24 = fIntFlowCovariancesVsM[0]->GetBinContent(b); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) | |
4384 | wCov26 = fIntFlowCovariancesVsM[1]->GetBinContent(b); // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>) | |
4385 | wCov28 = fIntFlowCovariancesVsM[2]->GetBinContent(b); // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>) | |
4386 | wCov46 = fIntFlowCovariancesVsM[3]->GetBinContent(b); // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>) | |
4387 | wCov48 = fIntFlowCovariancesVsM[4]->GetBinContent(b); // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>) | |
4388 | wCov68 = fIntFlowCovariancesVsM[5]->GetBinContent(b); // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>) | |
4389 | } | |
9da1a4f3 | 4390 | // Q-cumulants: |
4391 | qc2 = 0.; // QC{2} | |
4392 | qc4 = 0.; // QC{4} | |
4393 | qc6 = 0.; // QC{6} | |
4394 | qc8 = 0.; // QC{8} | |
b3dacf6b | 4395 | if(TMath::Abs(two) > 0.){qc2 = two;} |
4396 | if(TMath::Abs(four) > 0.){qc4 = four-2.*pow(two,2.);} | |
4397 | if(TMath::Abs(six) > 0.){qc6 = six-9.*two*four+12.*pow(two,3.);} | |
4398 | if(TMath::Abs(eight) > 0.){qc8 = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.);} | |
4399 | // Statistical errors of Q-cumulants: | |
9da1a4f3 | 4400 | qc2Error = 0.; |
4401 | qc4Error = 0.; | |
4402 | qc6Error = 0.; | |
b3dacf6b | 4403 | qc8Error = 0.; |
4404 | // Squared statistical errors of Q-cumulants: | |
9da1a4f3 | 4405 | //Double_t qc2ErrorSquared = 0.; |
4406 | qc4ErrorSquared = 0.; | |
4407 | qc6ErrorSquared = 0.; | |
b3dacf6b | 4408 | qc8ErrorSquared = 0.; |
4409 | // Statistical error of QC{2}: | |
4410 | qc2Error = twoError; | |
4411 | // Statistical error of QC{4}: | |
9da1a4f3 | 4412 | qc4ErrorSquared = 16.*pow(two,2.)*pow(twoError,2)+pow(fourError,2.) |
4413 | - 8.*two*wCov24; | |
4414 | if(qc4ErrorSquared>0.) | |
4415 | { | |
4416 | qc4Error = pow(qc4ErrorSquared,0.5); | |
4417 | } else | |
4418 | { | |
4419 | // cout<<"WARNING: Statistical error of QC{4} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl; | |
b3dacf6b | 4420 | } |
4421 | // Statistical error of QC{6}: | |
9da1a4f3 | 4422 | qc6ErrorSquared = 81.*pow(4.*pow(two,2.)-four,2.)*pow(twoError,2.) |
4423 | + 81.*pow(two,2.)*pow(fourError,2.) | |
4424 | + pow(sixError,2.) | |
4425 | - 162.*two*(4.*pow(two,2.)-four)*wCov24 | |
4426 | + 18.*(4.*pow(two,2.)-four)*wCov26 | |
b3dacf6b | 4427 | - 18.*two*wCov46; |
9da1a4f3 | 4428 | if(qc6ErrorSquared>0.) |
4429 | { | |
4430 | qc6Error = pow(qc6ErrorSquared,0.5); | |
4431 | } else | |
4432 | { | |
4433 | // cout<<"WARNING: Statistical error of QC{6} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl; | |
b3dacf6b | 4434 | } |
4435 | // Statistical error of QC{8}: | |
9da1a4f3 | 4436 | qc8ErrorSquared = 256.*pow(36.*pow(two,3.)-18.*four*two+six,2.)*pow(twoError,2.) |
4437 | + 1296.*pow(4.*pow(two,2.)-four,2.)*pow(fourError,2.) | |
4438 | + 256.*pow(two,2.)*pow(sixError,2.) | |
4439 | + pow(eightError,2.) | |
4440 | - 1152.*(36.*pow(two,3.)-18.*four*two+six)*(4.*pow(two,2.)-four)*wCov24 | |
4441 | + 512.*two*(36.*pow(two,3.)-18.*four*two+six)*wCov26 | |
4442 | - 32.*(36.*pow(two,3.)-18.*four*two+six)*wCov28 | |
4443 | - 1152.*two*(4.*pow(two,2.)-four)*wCov46 | |
4444 | + 72.*(4.*pow(two,2.)-four)*wCov48 | |
4445 | - 32.*two*wCov68; | |
4446 | if(qc8ErrorSquared>0.) | |
4447 | { | |
4448 | qc8Error = pow(qc8ErrorSquared,0.5); | |
4449 | } else | |
4450 | { | |
4451 | // cout<<"WARNING: Statistical error of QC{8} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl; | |
4452 | } | |
b3dacf6b | 4453 | // Store the results and statistical errors for Q-cumulants: |
4454 | if(TMath::Abs(qc2)>0.) | |
4455 | { | |
4456 | fIntFlowQcumulantsVsM[0]->SetBinContent(b,qc2); | |
4457 | fIntFlowQcumulantsVsM[0]->SetBinError(b,qc2Error); | |
4458 | } | |
4459 | if(TMath::Abs(qc4)>0.) | |
4460 | { | |
4461 | fIntFlowQcumulantsVsM[1]->SetBinContent(b,qc4); | |
4462 | fIntFlowQcumulantsVsM[1]->SetBinError(b,qc4Error); | |
4463 | } | |
4464 | if(TMath::Abs(qc6)>0.) | |
4465 | { | |
4466 | fIntFlowQcumulantsVsM[2]->SetBinContent(b,qc6); | |
4467 | fIntFlowQcumulantsVsM[2]->SetBinError(b,qc6Error); | |
4468 | } | |
4469 | if(TMath::Abs(qc8)>0.) | |
4470 | { | |
4471 | fIntFlowQcumulantsVsM[3]->SetBinContent(b,qc8); | |
4472 | fIntFlowQcumulantsVsM[3]->SetBinError(b,qc8Error); | |
4473 | } | |
4474 | // Rebin in M: | |
4475 | for(Int_t co=0;co<4;co++) | |
4476 | { | |
b40a910e | 4477 | if(fIntFlowCorrelationsVsMPro[co]->GetBinEffectiveEntries(b)<2){continue;} |
b3dacf6b | 4478 | value[co] = fIntFlowQcumulantsVsM[co]->GetBinContent(b); |
4479 | error[co] = fIntFlowQcumulantsVsM[co]->GetBinError(b); | |
4480 | if(error[co]>0.) | |
4481 | { | |
4482 | dSum1[co]+=value[co]/(error[co]*error[co]); | |
4483 | dSum2[co]+=1./(error[co]*error[co]); | |
4484 | } | |
4485 | } // end of for(Int_t co=0;co<4;co++) | |
9da1a4f3 | 4486 | } // end of for(Int_t b=1;b<=nBins;b++) |
b3dacf6b | 4487 | // Store rebinned Q-cumulants: |
4488 | for(Int_t co=0;co<4;co++) | |
4489 | { | |
4490 | if(dSum2[co]>0.) | |
4491 | { | |
4492 | fIntFlowQcumulantsRebinnedInM->SetBinContent(co+1,dSum1[co]/dSum2[co]); | |
4493 | fIntFlowQcumulantsRebinnedInM->SetBinError(co+1,pow(1./dSum2[co],0.5)); | |
4494 | } | |
4495 | } // end of for(Int_t co=0;co<4;co++) | |
4496 | ||
489d5531 | 4497 | } // end of AliFlowAnalysisWithQCumulants::CalculateCumulantsIntFlow() |
4498 | ||
489d5531 | 4499 | //================================================================================================================================ |
4500 | ||
b92ea2b9 | 4501 | void AliFlowAnalysisWithQCumulants::CalculateReferenceFlow() |
489d5531 | 4502 | { |
b92ea2b9 | 4503 | // a) Calculate the final results for reference flow estimates from Q-cumulants; |
4504 | // b) Propagate the statistical errors to reference flow estimates from statistical error of Q-cumulants; | |
0328db2d | 4505 | // c) Store the results and statistical errors of reference flow estimates in histogram fIntFlow. |
489d5531 | 4506 | // Binning of fIntFlow is organized as follows: |
4507 | // | |
b3dacf6b | 4508 | // 1st bin: v{2,QC} |
4509 | // 2nd bin: v{4,QC} | |
4510 | // 3rd bin: v{6,QC} | |
4511 | // 4th bin: v{8,QC} | |
4512 | // | |
489d5531 | 4513 | |
b3dacf6b | 4514 | // Reference flow estimates: |
489d5531 | 4515 | Double_t v2 = 0.; // v{2,QC} |
4516 | Double_t v4 = 0.; // v{4,QC} | |
4517 | Double_t v6 = 0.; // v{6,QC} | |
4518 | Double_t v8 = 0.; // v{8,QC} | |
b3dacf6b | 4519 | // Reference flow's statistical errors: |
4520 | Double_t v2Error = 0.; // v{2,QC} stat. error | |
4521 | Double_t v4Error = 0.; // v{4,QC} stat. error | |
4522 | Double_t v6Error = 0.; // v{6,QC} stat. error | |
4523 | Double_t v8Error = 0.; // v{8,QC} stat. error | |
4524 | ||
b92ea2b9 | 4525 | // Q-cumulants: |
4526 | Double_t qc2 = fIntFlowQcumulants->GetBinContent(1); // QC{2} | |
4527 | Double_t qc4 = fIntFlowQcumulants->GetBinContent(2); // QC{4} | |
4528 | Double_t qc6 = fIntFlowQcumulants->GetBinContent(3); // QC{6} | |
4529 | Double_t qc8 = fIntFlowQcumulants->GetBinContent(4); // QC{8} | |
4530 | // Q-cumulants's statistical errors: | |
4531 | Double_t qc2Error = fIntFlowQcumulants->GetBinError(1); // QC{2} stat. error | |
4532 | Double_t qc4Error = fIntFlowQcumulants->GetBinError(2); // QC{4} stat. error | |
4533 | Double_t qc6Error = fIntFlowQcumulants->GetBinError(3); // QC{6} stat. error | |
4534 | Double_t qc8Error = fIntFlowQcumulants->GetBinError(4); // QC{8} stat. error | |
4535 | // Calculate reference flow estimates from Q-cumulants: | |
1268c371 | 4536 | if(qc2>=0.){v2 = pow(qc2,0.5);} |
b92ea2b9 | 4537 | if(qc4<=0.){v4 = pow(-1.*qc4,1./4.);} |
4538 | if(qc6>=0.){v6 = pow((1./4.)*qc6,1./6.);} | |
4539 | if(qc8<=0.){v8 = pow((-1./33.)*qc8,1./8.);} | |
4540 | // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants: | |
1268c371 | 4541 | if(qc2>0.){v2Error = (1./2.)*pow(qc2,-0.5)*qc2Error;} |
b92ea2b9 | 4542 | if(qc4<0.){v4Error = (1./4.)*pow(-qc4,-3./4.)*qc4Error;} |
4543 | if(qc6>0.){v6Error = (1./6.)*pow(2.,-1./3.)*pow(qc6,-5./6.)*qc6Error;} | |
4544 | if(qc8<0.){v8Error = (1./8.)*pow(33.,-1./8.)*pow(-qc8,-7./8.)*qc8Error;} | |
4545 | // Print warnings for the 'wrong sign' cumulants: | |
4546 | if(TMath::Abs(v2) < 1.e-44) | |
4547 | { | |
4548 | cout<<" WARNING: Wrong sign QC{2}, couldn't calculate v{2,QC} !!!!"<<endl; | |
4549 | } | |
4550 | if(TMath::Abs(v4) < 1.e-44) | |
4551 | { | |
4552 | cout<<" WARNING: Wrong sign QC{4}, couldn't calculate v{4,QC} !!!!"<<endl; | |
4553 | } | |
4554 | if(TMath::Abs(v6) < 1.e-44) | |
4555 | { | |
4556 | cout<<" WARNING: Wrong sign QC{6}, couldn't calculate v{6,QC} !!!!"<<endl; | |
4557 | } | |
4558 | if(TMath::Abs(v8) < 1.e-44) | |
4559 | { | |
4560 | cout<<" WARNING: Wrong sign QC{8}, couldn't calculate v{8,QC} !!!!"<<endl; | |
4561 | } | |
4562 | // Store the results and statistical errors of integrated flow estimates: | |
4563 | fIntFlow->SetBinContent(1,v2); | |
4564 | fIntFlow->SetBinError(1,v2Error); | |
4565 | fIntFlow->SetBinContent(2,v4); | |
4566 | fIntFlow->SetBinError(2,v4Error); | |
4567 | fIntFlow->SetBinContent(3,v6); | |
4568 | fIntFlow->SetBinError(3,v6Error); | |
4569 | fIntFlow->SetBinContent(4,v8); | |
4570 | fIntFlow->SetBinError(4,v8Error); | |
4571 | ||
4572 | // Versus multiplicity: | |
4573 | if(!fCalculateCumulantsVsM){return;} | |
4574 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) | |
4575 | for(Int_t b=1;b<=nBins;b++) | |
9da1a4f3 | 4576 | { |
4577 | // Q-cumulants: | |
b92ea2b9 | 4578 | Double_t qc2VsM = fIntFlowQcumulantsVsM[0]->GetBinContent(b); // QC{2} |
4579 | Double_t qc4VsM = fIntFlowQcumulantsVsM[1]->GetBinContent(b); // QC{4} | |
4580 | Double_t qc6VsM = fIntFlowQcumulantsVsM[2]->GetBinContent(b); // QC{6} | |
4581 | Double_t qc8VsM = fIntFlowQcumulantsVsM[3]->GetBinContent(b); // QC{8} | |
b3dacf6b | 4582 | // Q-cumulants's statistical errors: |
b92ea2b9 | 4583 | Double_t qc2ErrorVsM = fIntFlowQcumulantsVsM[0]->GetBinError(b); // QC{2} stat. error |
4584 | Double_t qc4ErrorVsM = fIntFlowQcumulantsVsM[1]->GetBinError(b); // QC{4} stat. error | |
4585 | Double_t qc6ErrorVsM = fIntFlowQcumulantsVsM[2]->GetBinError(b); // QC{6} stat. error | |
4586 | Double_t qc8ErrorVsM = fIntFlowQcumulantsVsM[3]->GetBinError(b); // QC{8} stat. error | |
b3dacf6b | 4587 | // Reference flow estimates: |
b92ea2b9 | 4588 | Double_t v2VsM = 0.; // v{2,QC} |
4589 | Double_t v4VsM = 0.; // v{4,QC} | |
4590 | Double_t v6VsM = 0.; // v{6,QC} | |
4591 | Double_t v8VsM = 0.; // v{8,QC} | |
4592 | // Reference flow estimates errors: | |
4593 | Double_t v2ErrorVsM = 0.; // v{2,QC} stat. error | |
4594 | Double_t v4ErrorVsM = 0.; // v{4,QC} stat. error | |
4595 | Double_t v6ErrorVsM = 0.; // v{6,QC} stat. error | |
4596 | Double_t v8ErrorVsM = 0.; // v{8,QC} stat. error | |
b3dacf6b | 4597 | // Calculate reference flow estimates from Q-cumulants: |
1268c371 | 4598 | if(qc2VsM>=0.){v2VsM = pow(qc2VsM,0.5);} |
b92ea2b9 | 4599 | if(qc4VsM<=0.){v4VsM = pow(-1.*qc4VsM,1./4.);} |
4600 | if(qc6VsM>=0.){v6VsM = pow((1./4.)*qc6VsM,1./6.);} | |
4601 | if(qc8VsM<=0.){v8VsM = pow((-1./33.)*qc8VsM,1./8.);} | |
b3dacf6b | 4602 | // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants: |
1268c371 | 4603 | if(qc2VsM>0.){v2ErrorVsM = (1./2.)*pow(qc2VsM,-0.5)*qc2ErrorVsM;} |
b92ea2b9 | 4604 | if(qc4VsM<0.){v4ErrorVsM = (1./4.)*pow(-qc4VsM,-3./4.)*qc4ErrorVsM;} |
4605 | if(qc6VsM>0.){v6ErrorVsM = (1./6.)*pow(2.,-1./3.)*pow(qc6VsM,-5./6.)*qc6ErrorVsM;} | |
4606 | if(qc8VsM<0.){v8ErrorVsM = (1./8.)*pow(33.,-1./8.)*pow(-qc8VsM,-7./8.)*qc8ErrorVsM;} | |
b3dacf6b | 4607 | // Store the results and statistical errors of integrated flow estimates: |
b92ea2b9 | 4608 | fIntFlowVsM[0]->SetBinContent(b,v2VsM); |
4609 | fIntFlowVsM[0]->SetBinError(b,v2ErrorVsM); | |
4610 | fIntFlowVsM[1]->SetBinContent(b,v4VsM); | |
4611 | fIntFlowVsM[1]->SetBinError(b,v4ErrorVsM); | |
4612 | fIntFlowVsM[2]->SetBinContent(b,v6VsM); | |
4613 | fIntFlowVsM[2]->SetBinError(b,v6ErrorVsM); | |
4614 | fIntFlowVsM[3]->SetBinContent(b,v8VsM); | |
4615 | fIntFlowVsM[3]->SetBinError(b,v8ErrorVsM); | |
4616 | } // end of for(Int_t b=1;b<=nBins;b++) | |
4617 | ||
4618 | // 'Rebinned in M' calculation: // to be improved - this can be implemented better: | |
4619 | // Reference flow estimates: | |
4620 | Double_t v2RebinnedInM = 0.; // v{2,QC} | |
4621 | Double_t v4RebinnedInM = 0.; // v{4,QC} | |
4622 | Double_t v6RebinnedInM = 0.; // v{6,QC} | |
4623 | Double_t v8RebinnedInM = 0.; // v{8,QC} | |
4624 | // Reference flow's statistical errors: | |
4625 | Double_t v2ErrorRebinnedInM = 0.; // v{2,QC} stat. error | |
4626 | Double_t v4ErrorRebinnedInM = 0.; // v{4,QC} stat. error | |
4627 | Double_t v6ErrorRebinnedInM = 0.; // v{6,QC} stat. error | |
4628 | Double_t v8ErrorRebinnedInM = 0.; // v{8,QC} stat. error | |
4629 | // Q-cumulants: | |
4630 | Double_t qc2RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(1); // QC{2} | |
4631 | Double_t qc4RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(2); // QC{4} | |
4632 | Double_t qc6RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(3); // QC{6} | |
4633 | Double_t qc8RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(4); // QC{8} | |
4634 | // Q-cumulants's statistical errors: | |
4635 | Double_t qc2ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(1); // QC{2} stat. error | |
4636 | Double_t qc4ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(2); // QC{4} stat. error | |
4637 | Double_t qc6ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(3); // QC{6} stat. error | |
4638 | Double_t qc8ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(4); // QC{8} stat. error | |
4639 | // Calculate reference flow estimates from Q-cumulants: | |
1268c371 | 4640 | if(qc2RebinnedInM>=0.){v2RebinnedInM = pow(qc2RebinnedInM,0.5);} |
b92ea2b9 | 4641 | if(qc4RebinnedInM<=0.){v4RebinnedInM = pow(-1.*qc4RebinnedInM,1./4.);} |
4642 | if(qc6RebinnedInM>=0.){v6RebinnedInM = pow((1./4.)*qc6RebinnedInM,1./6.);} | |
4643 | if(qc8RebinnedInM<=0.){v8RebinnedInM = pow((-1./33.)*qc8RebinnedInM,1./8.);} | |
4644 | // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants: | |
1268c371 | 4645 | if(qc2RebinnedInM>0.){v2ErrorRebinnedInM = (1./2.)*pow(qc2RebinnedInM,-0.5)*qc2ErrorRebinnedInM;} |
b92ea2b9 | 4646 | if(qc4RebinnedInM<0.){v4ErrorRebinnedInM = (1./4.)*pow(-qc4RebinnedInM,-3./4.)*qc4ErrorRebinnedInM;} |
4647 | if(qc6RebinnedInM>0.){v6ErrorRebinnedInM = (1./6.)*pow(2.,-1./3.)*pow(qc6RebinnedInM,-5./6.)*qc6ErrorRebinnedInM;} | |
4648 | if(qc8RebinnedInM<0.){v8ErrorRebinnedInM = (1./8.)*pow(33.,-1./8.)*pow(-qc8RebinnedInM,-7./8.)*qc8ErrorRebinnedInM;} | |
4649 | // Print warnings for the 'wrong sign' cumulants: | |
4650 | if(TMath::Abs(v2RebinnedInM) < 1.e-44) | |
4651 | { | |
4652 | cout<<" WARNING: Wrong sign QC{2} rebinned in M, couldn't calculate v{2,QC} !!!!"<<endl; | |
4653 | } | |
4654 | if(TMath::Abs(v4RebinnedInM) < 1.e-44) | |
4655 | { | |
4656 | cout<<" WARNING: Wrong sign QC{4} rebinned in M, couldn't calculate v{4,QC} !!!!"<<endl; | |
4657 | } | |
4658 | if(TMath::Abs(v6RebinnedInM) < 1.e-44) | |
4659 | { | |
4660 | cout<<" WARNING: Wrong sign QC{6} rebinned in M, couldn't calculate v{6,QC} !!!!"<<endl; | |
4661 | } | |
4662 | if(TMath::Abs(v8RebinnedInM) < 1.e-44) | |
4663 | { | |
4664 | cout<<" WARNING: Wrong sign QC{8} rebinned in M, couldn't calculate v{8,QC} !!!!"<<endl; | |
4665 | } | |
4666 | // Store the results and statistical errors of integrated flow estimates: | |
4667 | fIntFlowRebinnedInM->SetBinContent(1,v2RebinnedInM); | |
4668 | fIntFlowRebinnedInM->SetBinError(1,v2ErrorRebinnedInM); | |
4669 | fIntFlowRebinnedInM->SetBinContent(2,v4RebinnedInM); | |
4670 | fIntFlowRebinnedInM->SetBinError(2,v4ErrorRebinnedInM); | |
4671 | fIntFlowRebinnedInM->SetBinContent(3,v6RebinnedInM); | |
4672 | fIntFlowRebinnedInM->SetBinError(3,v6ErrorRebinnedInM); | |
4673 | fIntFlowRebinnedInM->SetBinContent(4,v8RebinnedInM); | |
4674 | fIntFlowRebinnedInM->SetBinError(4,v8ErrorRebinnedInM); | |
4675 | ||
4676 | } // end of AliFlowAnalysisWithQCumulants::CalculateReferenceFlow() | |
489d5531 | 4677 | |
489d5531 | 4678 | //================================================================================================================================ |
4679 | ||
489d5531 | 4680 | void AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow() |
4681 | { | |
0dd3b008 | 4682 | // Fill in AliFlowCommonHistResults histograms relevant for reference flow. |
489d5531 | 4683 | |
0dd3b008 | 4684 | // There are two possibilities here: |
4685 | // a) Store minimum bias reference flow - use SetMinimumBiasReferenceFlow(kTRUE). This result is | |
4686 | // biased by the interplay between nonflow correlations and multiplicity fluctuations and is | |
4687 | // also stored in local histogram fIntFlow; | |
4688 | // b) Store reference flow obtained from flow analysis performed at fixed multiplicity and | |
4689 | // rebinned only at the end of the day - use SetMinimumBiasReferenceFlow(kFALSE). This result | |
4690 | // is also stored in local histogram fIntFlowRebinnedInM. | |
489d5531 | 4691 | |
0dd3b008 | 4692 | // Reference flow estimates: |
4693 | Double_t v[4] = {0.}; | |
4694 | // Statistical errors of reference flow estimates: | |
4695 | Double_t vError[4] = {0.}; | |
489d5531 | 4696 | |
0dd3b008 | 4697 | for(Int_t b=0;b<4;b++) |
4698 | { | |
4699 | if(fMinimumBiasReferenceFlow) | |
4700 | { | |
4701 | v[b] = fIntFlow->GetBinContent(b+1); | |
4702 | vError[b] = fIntFlow->GetBinError(b+1); | |
4703 | } else | |
4704 | { | |
4705 | v[b] = fIntFlowRebinnedInM->GetBinContent(b+1); | |
4706 | vError[b] = fIntFlowRebinnedInM->GetBinError(b+1); | |
4707 | } | |
4708 | } // end of for(Int_t b=0;b<4;b++) | |
4709 | ||
4710 | // Fill AliFlowCommonHistResults histogram: | |
4711 | fCommonHistsResults2nd->FillIntegratedFlow(v[0],vError[0]); // to be improved (hardwired 2nd in the name) | |
4712 | fCommonHistsResults4th->FillIntegratedFlow(v[1],vError[1]); // to be improved (hardwired 4th in the name) | |
489d5531 | 4713 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) // to be improved (calculate also 6th and 8th order) |
4714 | { | |
0dd3b008 | 4715 | fCommonHistsResults6th->FillIntegratedFlow(v[2],vError[2]); // to be improved (hardwired 6th in the name) |
4716 | fCommonHistsResults8th->FillIntegratedFlow(v[3],vError[3]); // to be improved (hardwired 8th in the name) | |
489d5531 | 4717 | } |
4718 | ||
4719 | } // end of AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow() | |
4720 | ||
489d5531 | 4721 | //================================================================================================================================ |
4722 | ||
489d5531 | 4723 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelationsUsingParticleWeights() |
4724 | { | |
4725 | // Calculate all correlations needed for integrated flow using particle weights. | |
4726 | ||
4727 | // Remark 1: When particle weights are used the binning of fIntFlowCorrelationAllPro is organized as follows: | |
4728 | // | |
4729 | // 1st bin: <2>_{1n|1n} = two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))> | |
4730 | // 2nd bin: <2>_{2n|2n} = two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
4731 | // 3rd bin: <2>_{3n|3n} = two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
4732 | // 4th bin: <2>_{4n|4n} = two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
4733 | // 5th bin: ---- EMPTY ---- | |
4734 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
4735 | // 7th bin: <3>_{3n|2n,1n} = ... | |
4736 | // 8th bin: <3>_{4n|2n,2n} = ... | |
4737 | // 9th bin: <3>_{4n|3n,1n} = ... | |
4738 | // 10th bin: ---- EMPTY ---- | |
4739 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
4740 | // 12th bin: <4>_{2n,1n|2n,1n} = ... | |
4741 | // 13th bin: <4>_{2n,2n|2n,2n} = ... | |
4742 | // 14th bin: <4>_{3n|1n,1n,1n} = ... | |
4743 | // 15th bin: <4>_{3n,1n|3n,1n} = ... | |
4744 | // 16th bin: <4>_{3n,1n|2n,2n} = ... | |
4745 | // 17th bin: <4>_{4n|2n,1n,1n} = ... | |
4746 | // 18th bin: ---- EMPTY ---- | |
4747 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = ... | |
4748 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = ... | |
4749 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = ... | |
4750 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = ... | |
4751 | // 23rd bin: ---- EMPTY ---- | |
4752 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = ... | |
4753 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = ... | |
4754 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = ... | |
4755 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = ... | |
4756 | // 28th bin: ---- EMPTY ---- | |
4757 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = ... | |
4758 | // 30th bin: ---- EMPTY ---- | |
4759 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = ... | |
4760 | ||
4761 | // Remark 2: When particle weights are used there are some extra correlations. They are stored in | |
4762 | // fIntFlowExtraCorrelationsPro binning of which is organized as follows: | |
4763 | ||
4764 | // 1st bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))> | |
4765 | // 2nd bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
4766 | ||
4767 | // multiplicity (number of particles used to determine the reaction plane) | |
1268c371 | 4768 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 4769 | |
4770 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
4771 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
4772 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
4773 | Double_t dReQ3n3k = (*fReQ)(2,3); | |
4774 | Double_t dReQ4n4k = (*fReQ)(3,4); | |
4775 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
4776 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
4777 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
4778 | Double_t dImQ3n3k = (*fImQ)(2,3); | |
4779 | Double_t dImQ4n4k = (*fImQ)(3,4); | |
4780 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
4781 | ||
4782 | // dMs are variables introduced in order to simplify some Eqs. bellow: | |
4783 | //.............................................................................................. | |
1268c371 | 4784 | Double_t dM11 = (*fSpk)(1,1)-(*fSpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
4785 | Double_t dM22 = (*fSpk)(1,2)-(*fSpk)(0,4); // dM22 = sum_{i,j=1,i!=j}^M w_i^2 w_j^2 | |
4786 | Double_t dM33 = (*fSpk)(1,3)-(*fSpk)(0,6); // dM33 = sum_{i,j=1,i!=j}^M w_i^3 w_j^3 | |
4787 | Double_t dM44 = (*fSpk)(1,4)-(*fSpk)(0,8); // dM44 = sum_{i,j=1,i!=j}^M w_i^4 w_j^4 | |
4788 | Double_t dM31 = (*fSpk)(0,3)*(*fSpk)(0,1)-(*fSpk)(0,4); // dM31 = sum_{i,j=1,i!=j}^M w_i^3 w_j | |
4789 | Double_t dM211 = (*fSpk)(0,2)*(*fSpk)(1,1)-2.*(*fSpk)(0,3)*(*fSpk)(0,1) | |
4790 | - (*fSpk)(1,2)+2.*(*fSpk)(0,4); // dM211 = sum_{i,j,k=1,i!=j!=k}^M w_i^2 w_j w_k | |
4791 | Double_t dM1111 = (*fSpk)(3,1)-6.*(*fSpk)(0,2)*(*fSpk)(1,1) | |
4792 | + 8.*(*fSpk)(0,3)*(*fSpk)(0,1) | |
4793 | + 3.*(*fSpk)(1,2)-6.*(*fSpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l | |
489d5531 | 4794 | //.............................................................................................. |
4795 | ||
4796 | // 2-particle correlations: | |
4797 | Double_t two1n1nW1W1 = 0.; // <w1 w2 cos(n*(phi1-phi2))> | |
4798 | Double_t two2n2nW2W2 = 0.; // <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
4799 | Double_t two3n3nW3W3 = 0.; // <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
4800 | Double_t two4n4nW4W4 = 0.; // <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
4801 | if(dMult>1) | |
4802 | { | |
4803 | if(dM11) | |
4804 | { | |
1268c371 | 4805 | two1n1nW1W1 = (pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSpk)(0,2))/dM11; |
489d5531 | 4806 | // average correlation <w1 w2 cos(n*(phi1-phi2))> for single event: |
4807 | fIntFlowCorrelationsEBE->SetBinContent(1,two1n1nW1W1); | |
4808 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(1,dM11); | |
4809 | // average correlation <w1 w2 cos(n*(phi1-phi2))> for all events: | |
b40a910e | 4810 | fIntFlowCorrelationsPro->Fill(0.5,two1n1nW1W1,dM11); |
4811 | // average squared correlation <w1 w2 cos(n*(phi1-phi2))> for all events: | |
4812 | fIntFlowSquaredCorrelationsPro->Fill(0.5,two1n1nW1W1*two1n1nW1W1,dM11); | |
489d5531 | 4813 | fIntFlowCorrelationsAllPro->Fill(0.5,two1n1nW1W1,dM11); |
4814 | } | |
4815 | if(dM22) | |
4816 | { | |
1268c371 | 4817 | two2n2nW2W2 = (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)-(*fSpk)(0,4))/dM22; |
489d5531 | 4818 | // ... |
4819 | // average correlation <w1^2 w2^2 cos(2n*(phi1-phi2))> for all events: | |
4820 | fIntFlowCorrelationsAllPro->Fill(1.5,two2n2nW2W2,dM22); | |
4821 | } | |
4822 | if(dM33) | |
4823 | { | |
1268c371 | 4824 | two3n3nW3W3 = (pow(dReQ3n3k,2)+pow(dImQ3n3k,2)-(*fSpk)(0,6))/dM33; |
489d5531 | 4825 | // ... |
4826 | // average correlation <w1^3 w2^3 cos(3n*(phi1-phi2))> for all events: | |
4827 | fIntFlowCorrelationsAllPro->Fill(2.5,two3n3nW3W3,dM33); | |
4828 | } | |
4829 | if(dM44) | |
4830 | { | |
1268c371 | 4831 | two4n4nW4W4 = (pow(dReQ4n4k,2)+pow(dImQ4n4k,2)-(*fSpk)(0,8))/dM44; |
489d5531 | 4832 | // ... |
4833 | // average correlation <w1^4 w2^4 cos(4n*(phi1-phi2))> for all events: | |
4834 | fIntFlowCorrelationsAllPro->Fill(3.5,two4n4nW4W4,dM44); | |
4835 | } | |
4836 | } // end of if(dMult>1) | |
4837 | ||
4838 | // extra 2-particle correlations: | |
4839 | Double_t two1n1nW3W1 = 0.; // <w1^3 w2 cos(n*(phi1-phi2))> | |
4840 | Double_t two1n1nW1W1W2 = 0.; // <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
4841 | if(dMult>1) | |
4842 | { | |
4843 | if(dM31) | |
4844 | { | |
1268c371 | 4845 | two1n1nW3W1 = (dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k-(*fSpk)(0,4))/dM31; |
489d5531 | 4846 | fIntFlowExtraCorrelationsPro->Fill(0.5,two1n1nW3W1,dM31); |
4847 | } | |
4848 | if(dM211) | |
4849 | { | |
1268c371 | 4850 | two1n1nW1W1W2 = ((*fSpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSpk)(0,2)) |
489d5531 | 4851 | - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k |
1268c371 | 4852 | - (*fSpk)(0,4)))/dM211; |
489d5531 | 4853 | fIntFlowExtraCorrelationsPro->Fill(1.5,two1n1nW1W1W2,dM211); |
4854 | } | |
4855 | } // end of if(dMult>1) | |
4856 | //.............................................................................................. | |
4857 | ||
4858 | //.............................................................................................. | |
4859 | // 3-particle correlations: | |
4860 | Double_t three2n1n1nW2W1W1 = 0.; // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
4861 | ||
4862 | if(dMult>2) | |
4863 | { | |
4864 | if(dM211) | |
4865 | { | |
4866 | three2n1n1nW2W1W1 = (pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k | |
4867 | - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k) | |
4868 | - pow(dReQ2n2k,2)-pow(dImQ2n2k,2) | |
1268c371 | 4869 | + 2.*(*fSpk)(0,4))/dM211; |
489d5531 | 4870 | fIntFlowCorrelationsAllPro->Fill(5.5,three2n1n1nW2W1W1,dM211); |
4871 | } | |
4872 | } // end of if(dMult>2) | |
4873 | //.............................................................................................. | |
4874 | ||
4875 | //.............................................................................................. | |
4876 | // 4-particle correlations: | |
4877 | Double_t four1n1n1n1nW1W1W1W1 = 0.; // <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
4878 | if(dMult>3) | |
4879 | { | |
4880 | if(dM1111) | |
4881 | { | |
4882 | four1n1n1n1nW1W1W1W1 = (pow(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.),2) | |
4883 | - 2.*(pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k) | |
4884 | + 8.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k) | |
4885 | + (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)) | |
1268c371 | 4886 | - 4.*(*fSpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
4887 | - 6.*(*fSpk)(0,4)+2.*(*fSpk)(1,2))/dM1111; | |
489d5531 | 4888 | |
4889 | // average correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for single event: | |
4890 | fIntFlowCorrelationsEBE->SetBinContent(2,four1n1n1n1nW1W1W1W1); | |
4891 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(2,dM1111); | |
4892 | // average correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for all events: | |
4893 | fIntFlowCorrelationsPro->Fill(1.5,four1n1n1n1nW1W1W1W1,dM1111); | |
b40a910e | 4894 | // average squared correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for all events: |
4895 | fIntFlowSquaredCorrelationsPro->Fill(1.5,four1n1n1n1nW1W1W1W1*four1n1n1n1nW1W1W1W1,dM1111); | |
489d5531 | 4896 | fIntFlowCorrelationsAllPro->Fill(10.5,four1n1n1n1nW1W1W1W1,dM1111); |
4897 | } | |
4898 | } // end of if(dMult>3) | |
4899 | //.............................................................................................. | |
4900 | ||
4901 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelationsUsingParticleWeights() | |
4902 | ||
489d5531 | 4903 | //================================================================================================================================ |
4904 | ||
489d5531 | 4905 | void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow() |
4906 | { | |
4907 | // Initialize all arrays used to calculate integrated flow. | |
4908 | ||
4909 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
4910 | { | |
4911 | fIntFlowCorrectionTermsForNUAEBE[sc] = NULL; | |
0328db2d | 4912 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc] = NULL; |
489d5531 | 4913 | fIntFlowCorrectionTermsForNUAPro[sc] = NULL; |
4914 | fIntFlowCorrectionTermsForNUAHist[sc] = NULL; | |
b92ea2b9 | 4915 | for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) |
2001bc3a | 4916 | { |
4917 | fIntFlowCorrectionTermsForNUAVsMPro[sc][ci] = NULL; | |
4918 | } | |
0328db2d | 4919 | for(Int_t power=0;power<2;power++) // linear or quadratic |
4920 | { | |
4921 | fIntFlowSumOfEventWeightsNUA[sc][power] = NULL; | |
4922 | } | |
489d5531 | 4923 | } |
4924 | for(Int_t power=0;power<2;power++) // linear or quadratic | |
4925 | { | |
4926 | fIntFlowSumOfEventWeights[power] = NULL; | |
4927 | } | |
b3dacf6b | 4928 | for(Int_t i=0;i<4;i++) // print on the screen the final results (0=RF, 1=RP, 2=POI, 3=RF (rebbined in M)) |
489d5531 | 4929 | { |
4930 | fPrintFinalResults[i] = kTRUE; | |
4931 | } | |
ff70ca91 | 4932 | for(Int_t ci=0;ci<4;ci++) // correlation index or cumulant order |
4933 | { | |
4934 | fIntFlowCorrelationsVsMPro[ci] = NULL; | |
b40a910e | 4935 | fIntFlowSquaredCorrelationsVsMPro[ci] = NULL; |
ff70ca91 | 4936 | fIntFlowCorrelationsVsMHist[ci] = NULL; |
4937 | fIntFlowQcumulantsVsM[ci] = NULL; | |
4938 | fIntFlowVsM[ci] = NULL; | |
2001bc3a | 4939 | fIntFlowDetectorBiasVsM[ci] = NULL; |
ff70ca91 | 4940 | for(Int_t lc=0;lc<2;lc++) |
4941 | { | |
4942 | fIntFlowSumOfEventWeightsVsM[ci][lc] = NULL; | |
4943 | } | |
4944 | } | |
4945 | for(Int_t pi=0;pi<6;pi++) // product or covariance index | |
4946 | { | |
4947 | fIntFlowProductOfCorrelationsVsMPro[pi] = NULL; | |
4948 | fIntFlowCovariancesVsM[pi] = NULL; | |
4949 | fIntFlowSumOfProductOfEventWeightsVsM[pi] = NULL; | |
4950 | } | |
e5834fcb | 4951 | |
489d5531 | 4952 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow() |
4953 | ||
489d5531 | 4954 | //================================================================================================================================ |
4955 | ||
489d5531 | 4956 | void AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow() |
4957 | { | |
4958 | // Initialize all arrays needed to calculate differential flow. | |
4959 | // a) Initialize lists holding profiles; | |
4960 | // b) Initialize lists holding histograms; | |
4961 | // c) Initialize event-by-event quantities; | |
4962 | // d) Initialize profiles; | |
4963 | // e) Initialize histograms holding final results. | |
4964 | ||
4965 | // a) Initialize lists holding profiles; | |
4966 | for(Int_t t=0;t<2;t++) // type (RP, POI) | |
4967 | { | |
4968 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
4969 | { | |
4970 | fDiffFlowCorrelationsProList[t][pe] = NULL; | |
4971 | fDiffFlowProductOfCorrelationsProList[t][pe] = NULL; | |
4972 | fDiffFlowCorrectionsProList[t][pe] = NULL; | |
4973 | } | |
1268c371 | 4974 | // 2D: |
4975 | f2DDiffFlowCorrelationsProList[t] = NULL; | |
489d5531 | 4976 | } |
4977 | ||
4978 | // b) Initialize lists holding histograms; | |
4979 | for(Int_t t=0;t<2;t++) // type (RP, POI) | |
4980 | { | |
4981 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
4982 | { | |
4983 | fDiffFlowCorrelationsHistList[t][pe] = NULL; | |
4984 | for(Int_t power=0;power<2;power++) | |
4985 | { | |
4986 | fDiffFlowSumOfEventWeightsHistList[t][pe][power] = NULL; | |
4987 | } // end of for(Int_t power=0;power<2;power++) | |
4988 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe] = NULL; | |
4989 | fDiffFlowCorrectionsHistList[t][pe] = NULL; | |
4990 | fDiffFlowCovariancesHistList[t][pe] = NULL; | |
4991 | fDiffFlowCumulantsHistList[t][pe] = NULL; | |
1268c371 | 4992 | fDiffFlowDetectorBiasHistList[t][pe] = NULL; |
489d5531 | 4993 | fDiffFlowHistList[t][pe] = NULL; |
4994 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
4995 | } // enf of for(Int_t t=0;t<2;t++) // type (RP, POI) | |
4996 | ||
4997 | // c) Initialize event-by-event quantities: | |
4998 | // 1D: | |
4999 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
5000 | { | |
5001 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5002 | { | |
5003 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
5004 | { | |
5005 | for(Int_t k=0;k<9;k++) // power of weight | |
5006 | { | |
5007 | fReRPQ1dEBE[t][pe][m][k] = NULL; | |
5008 | fImRPQ1dEBE[t][pe][m][k] = NULL; | |
5009 | fs1dEBE[t][pe][k] = NULL; // to be improved (this doesn't need to be within loop over m) | |
5010 | } | |
5011 | } | |
5012 | } | |
5013 | } | |
5014 | // 1D: | |
5015 | for(Int_t t=0;t<2;t++) // type (RP or POI) | |
5016 | { | |
5017 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5018 | { | |
5019 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
5020 | { | |
5021 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
5022 | { | |
5023 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti] = NULL; | |
5024 | } | |
5025 | } | |
5026 | } | |
5027 | } | |
5028 | // 2D: | |
5029 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
5030 | { | |
5031 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
5032 | { | |
5033 | for(Int_t k=0;k<9;k++) // power of weight | |
5034 | { | |
5035 | fReRPQ2dEBE[t][m][k] = NULL; | |
5036 | fImRPQ2dEBE[t][m][k] = NULL; | |
5037 | fs2dEBE[t][k] = NULL; // to be improved (this doesn't need to be within loop over m) | |
5038 | } | |
5039 | } | |
5040 | } | |
5041 | ||
5042 | // d) Initialize profiles: | |
5043 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
5044 | { | |
5045 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5046 | { | |
5047 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
5048 | { | |
5049 | fDiffFlowCorrelationsPro[t][pe][ci] = NULL; | |
b40a910e | 5050 | fDiffFlowSquaredCorrelationsPro[t][pe][ci] = NULL; |
489d5531 | 5051 | } // end of for(Int_t ci=0;ci<4;ci++) |
5052 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
5053 | { | |
5054 | for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index | |
5055 | { | |
5056 | fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = NULL; | |
5057 | } // end of for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index | |
5058 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
5059 | // correction terms for nua: | |
5060 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
5061 | { | |
5062 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
5063 | { | |
5064 | fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = NULL; | |
5065 | } | |
5066 | } | |
5067 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
1268c371 | 5068 | for(Int_t ci=0;ci<4;ci++) // correlation index |
5069 | { | |
5070 | f2DDiffFlowCorrelationsPro[t][ci] = NULL; | |
5071 | } | |
489d5531 | 5072 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI |
5073 | ||
5074 | // e) Initialize histograms holding final results. | |
5075 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
5076 | { | |
5077 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5078 | { | |
5079 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
5080 | { | |
5081 | fDiffFlowCorrelationsHist[t][pe][ci] = NULL; | |
5082 | fDiffFlowCumulants[t][pe][ci] = NULL; | |
1268c371 | 5083 | fDiffFlowDetectorBias[t][pe][ci] = NULL; |
489d5531 | 5084 | fDiffFlow[t][pe][ci] = NULL; |
5085 | } // end of for(Int_t ci=0;ci<4;ci++) | |
5086 | for(Int_t covarianceIndex=0;covarianceIndex<5;covarianceIndex++) | |
5087 | { | |
5088 | fDiffFlowCovariances[t][pe][covarianceIndex] = NULL; | |
5089 | } // end of for(Int_t covarianceIndex=0;covarianceIndex<5;covarianceIndex++) | |
5090 | // correction terms for nua: | |
5091 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
5092 | { | |
5093 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
5094 | { | |
5095 | fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = NULL; | |
5096 | } | |
5097 | } | |
5098 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
1268c371 | 5099 | for(Int_t ci=0;ci<4;ci++) // correlation index |
5100 | { | |
5101 | f2DDiffFlowCumulants[t][ci] = NULL; | |
5102 | f2DDiffFlow[t][ci] = NULL; | |
5103 | } | |
489d5531 | 5104 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI |
5105 | ||
5106 | // sum of event weights for reduced correlations: | |
5107 | for(Int_t t=0;t<2;t++) // type = RP or POI | |
5108 | { | |
5109 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5110 | { | |
5111 | for(Int_t p=0;p<2;p++) // power of weight is 1 or 2 | |
5112 | { | |
5113 | for(Int_t ew=0;ew<4;ew++) // event weight index for reduced correlations | |
5114 | { | |
5115 | fDiffFlowSumOfEventWeights[t][pe][p][ew] = NULL; | |
5116 | } | |
5117 | } | |
5118 | } | |
5119 | } | |
5120 | // product of event weights for both types of correlations: | |
5121 | for(Int_t t=0;t<2;t++) // type = RP or POI | |
5122 | { | |
5123 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5124 | { | |
5125 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
5126 | { | |
5127 | for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index | |
5128 | { | |
5129 | fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = NULL; | |
5130 | } | |
5131 | } | |
5132 | } | |
5133 | } | |
1268c371 | 5134 | |
5135 | } // end of AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow() | |
5136 | ||
5137 | //================================================================================================================================ | |
489d5531 | 5138 | |
1268c371 | 5139 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulants(TString type, TString ptOrEta) |
5140 | { | |
5141 | // Calculate differential flow cumulants from measured multiparticle correlations. | |
489d5531 | 5142 | |
1268c371 | 5143 | // REMARK: Cumulants calculated in this method are NOT corrected for non-uniform acceptance. |
5144 | // This correction, if enabled via setter SetApplyCorrectionForNUA(Bool_t), is applied | |
5145 | // in the method CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta) | |
489d5531 | 5146 | |
1268c371 | 5147 | Int_t t = 0; |
5148 | Int_t pe = 0; | |
5149 | ||
5150 | if(type == "RP") | |
5151 | { | |
5152 | t = 0; | |
5153 | } else if(type == "POI") | |
5154 | { | |
5155 | t = 1; | |
5156 | } | |
5157 | ||
5158 | if(ptOrEta == "Pt") | |
5159 | { | |
5160 | pe = 0; | |
5161 | } else if(ptOrEta == "Eta") | |
5162 | { | |
5163 | pe = 1; | |
5164 | } | |
5165 | ||
5166 | // Common: | |
5167 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
489d5531 | 5168 | |
1268c371 | 5169 | // Correlation <<2>>: |
5170 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); | |
5171 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); | |
489d5531 | 5172 | |
1268c371 | 5173 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) |
489d5531 | 5174 | { |
1268c371 | 5175 | // Reduced correlations: |
5176 | Double_t twoPrime = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); // <<2'>> | |
5177 | Double_t twoPrimeError = fDiffFlowCorrelationsHist[t][pe][0]->GetBinError(b); // stat. error of <<2'>> | |
5178 | Double_t fourPrime = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); // <<4'>> | |
5179 | Double_t fourPrimeError = fDiffFlowCorrelationsHist[t][pe][1]->GetBinError(b); // stat. error of <<4'>> | |
5180 | // Covariances: | |
5181 | Double_t wCovTwoTwoReduced = fDiffFlowCovariances[t][pe][0]->GetBinContent(b); // Cov(<2>,<2'>) * prefactor(<2>,<2'>) | |
5182 | Double_t wCovTwoFourReduced = fDiffFlowCovariances[t][pe][1]->GetBinContent(b); // Cov(<2>,<4'>) * prefactor(<2>,<4'>) | |
5183 | Double_t wCovTwoReducedFourReduced = fDiffFlowCovariances[t][pe][4]->GetBinContent(b); // Cov(<2'>,<4'>) * prefactor(<2'>,<4'>) | |
5184 | // QC{2'}: | |
5185 | Double_t qc2Prime = twoPrime; // QC{2'} | |
5186 | Double_t qc2PrimeError = twoPrimeError; // stat. error of QC{2'} | |
5187 | fDiffFlowCumulants[t][pe][0]->SetBinContent(b,qc2Prime); | |
5188 | fDiffFlowCumulants[t][pe][0]->SetBinError(b,qc2PrimeError); | |
5189 | // QC{4'}: | |
5190 | Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>> | |
5191 | Double_t qc4PrimeError = 0.; // stat. error of QC{4'} | |
5192 | Double_t qc4PrimeErrorSquared = 4.*pow(twoPrime,2.)*pow(twoError,2.) | |
5193 | + 4.*pow(two,2.)*pow(twoPrimeError,2.) | |
5194 | + pow(fourPrimeError,2.) | |
5195 | + 8.*two*twoPrime*wCovTwoTwoReduced | |
5196 | - 4.*twoPrime*wCovTwoFourReduced | |
5197 | - 4.*two*wCovTwoReducedFourReduced; | |
5198 | if(qc4PrimeErrorSquared>0.) | |
5199 | { | |
5200 | qc4PrimeError = pow(qc4PrimeErrorSquared,0.5); | |
489d5531 | 5201 | } |
1268c371 | 5202 | fDiffFlowCumulants[t][pe][1]->SetBinContent(b,qc4Prime); |
5203 | fDiffFlowCumulants[t][pe][1]->SetBinError(b,qc4PrimeError); | |
489d5531 | 5204 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
489d5531 | 5205 | |
1268c371 | 5206 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulants(TString type, Bool_t useParticleWeights, TString eventWeights); |
489d5531 | 5207 | |
5208 | //================================================================================================================================ | |
5209 | ||
1268c371 | 5210 | void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCumulants(TString type) |
489d5531 | 5211 | { |
1268c371 | 5212 | // Calculate 2D differential cumulants. |
489d5531 | 5213 | |
1268c371 | 5214 | // Remark: correction for detector effects and error propagation not implemented yet for 2D differential cumulants. |
489d5531 | 5215 | |
1268c371 | 5216 | Int_t t = 0; |
489d5531 | 5217 | |
5218 | if(type == "RP") | |
5219 | { | |
1268c371 | 5220 | t = 0; |
489d5531 | 5221 | } else if(type == "POI") |
5222 | { | |
1268c371 | 5223 | t = 1; |
5224 | } | |
5225 | ||
5226 | // Reference correlation <<2>>: | |
5227 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); | |
489d5531 | 5228 | |
1268c371 | 5229 | // Looping over all (pt,eta) bins and calculating differential flow cumulants: |
5230 | for(Int_t p=1;p<=fnBinsPt;p++) | |
489d5531 | 5231 | { |
5232 | for(Int_t e=1;e<=fnBinsEta;e++) | |
5233 | { | |
1268c371 | 5234 | // Reduced correlations: |
5235 | Double_t twoPrime = f2DDiffFlowCorrelationsPro[t][0]->GetBinContent(f2DDiffFlowCorrelationsPro[t][0]->GetBin(p,e)); // <<2'>>(pt,eta) | |
5236 | Double_t fourPrime = f2DDiffFlowCorrelationsPro[t][1]->GetBinContent(f2DDiffFlowCorrelationsPro[t][1]->GetBin(p,e)); // <<4'>>(pt,eta) | |
5237 | // Cumulants: | |
5238 | Double_t qc2Prime = twoPrime; // QC{2'} = <<2'>> | |
5239 | f2DDiffFlowCumulants[t][0]->SetBinContent(f2DDiffFlowCumulants[t][0]->GetBin(p,e),qc2Prime); | |
5240 | Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>> | |
5241 | f2DDiffFlowCumulants[t][1]->SetBinContent(f2DDiffFlowCumulants[t][1]->GetBin(p,e),qc4Prime); | |
489d5531 | 5242 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) |
489d5531 | 5243 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
5244 | ||
1268c371 | 5245 | } // end of void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCumulants(TString type) |
489d5531 | 5246 | |
489d5531 | 5247 | //================================================================================================================================ |
5248 | ||
489d5531 | 5249 | void AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type) |
5250 | { | |
1268c371 | 5251 | // Calculate final results for integrated flow of RPs and POIs. |
489d5531 | 5252 | |
1268c371 | 5253 | // to be improved - check if the integrated flow calculation here is actually correct |
5254 | ||
5255 | Int_t t = 0; // RP = 0, POI = 1 | |
489d5531 | 5256 | |
5257 | if(type == "RP") | |
5258 | { | |
1268c371 | 5259 | t = 0; |
489d5531 | 5260 | } else if(type == "POI") |
5261 | { | |
1268c371 | 5262 | t = 1; |
5263 | } | |
489d5531 | 5264 | |
489d5531 | 5265 | // pt yield: |
5266 | TH1F *yield2ndPt = NULL; | |
5267 | TH1F *yield4thPt = NULL; | |
5268 | TH1F *yield6thPt = NULL; | |
5269 | TH1F *yield8thPt = NULL; | |
5270 | ||
5271 | if(type == "POI") | |
5272 | { | |
dd442cd2 | 5273 | if(fFillMultipleControlHistograms) |
5274 | { | |
5275 | yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtPOI())->Clone(); | |
5276 | yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtPOI())->Clone(); | |
5277 | yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtPOI())->Clone(); | |
5278 | yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtPOI())->Clone(); | |
5279 | } else | |
5280 | { | |
5281 | yield2ndPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
5282 | yield4thPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
5283 | yield6thPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
5284 | yield8thPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
5285 | } | |
489d5531 | 5286 | } |
5287 | else if(type == "RP") | |
5288 | { | |
dd442cd2 | 5289 | if(fFillMultipleControlHistograms) |
5290 | { | |
5291 | yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtRP())->Clone(); | |
5292 | yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtRP())->Clone(); | |
5293 | yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtRP())->Clone(); | |
5294 | yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtRP())->Clone(); | |
5295 | } else | |
5296 | { | |
5297 | yield2ndPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
5298 | yield4thPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
5299 | yield6thPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
5300 | yield8thPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
5301 | } | |
489d5531 | 5302 | } |
5303 | ||
0d11c335 | 5304 | if(!yield2ndPt){return;} |
5305 | if(!yield4thPt){return;} | |
5306 | if(!yield6thPt){return;} | |
5307 | if(!yield8thPt){return;} | |
5308 | ||
489d5531 | 5309 | Int_t nBinsPt = yield2ndPt->GetNbinsX(); |
5310 | ||
5311 | TH1D *flow2ndPt = NULL; | |
5312 | TH1D *flow4thPt = NULL; | |
5313 | TH1D *flow6thPt = NULL; | |
5314 | TH1D *flow8thPt = NULL; | |
5315 | ||
5316 | // to be improved (hardwired pt index) | |
5317 | flow2ndPt = (TH1D*)fDiffFlow[t][0][0]->Clone(); | |
5318 | flow4thPt = (TH1D*)fDiffFlow[t][0][1]->Clone(); | |
5319 | flow6thPt = (TH1D*)fDiffFlow[t][0][2]->Clone(); | |
5320 | flow8thPt = (TH1D*)fDiffFlow[t][0][3]->Clone(); | |
0d11c335 | 5321 | |
5322 | if(!flow2ndPt){return;} | |
5323 | if(!flow4thPt){return;} | |
5324 | if(!flow6thPt){return;} | |
5325 | if(!flow8thPt){return;} | |
489d5531 | 5326 | |
5327 | Double_t dvn2nd = 0., dvn4th = 0., dvn6th = 0., dvn8th = 0.; // differential flow | |
5328 | Double_t dErrvn2nd = 0., dErrvn4th = 0., dErrvn6th = 0., dErrvn8th = 0.; // error on differential flow | |
5329 | ||
5330 | Double_t dVn2nd = 0., dVn4th = 0., dVn6th = 0., dVn8th = 0.; // integrated flow | |
5331 | Double_t dErrVn2nd = 0., dErrVn4th = 0., dErrVn6th = 0., dErrVn8th = 0.; // error on integrated flow | |
5332 | ||
5333 | Double_t dYield2nd = 0., dYield4th = 0., dYield6th = 0., dYield8th = 0.; // pt yield | |
5334 | Double_t dSum2nd = 0., dSum4th = 0., dSum6th = 0., dSum8th = 0.; // needed for normalizing integrated flow | |
5335 | ||
5336 | // looping over pt bins: | |
5337 | for(Int_t p=1;p<nBinsPt+1;p++) | |
5338 | { | |
5339 | dvn2nd = flow2ndPt->GetBinContent(p); | |
5340 | dvn4th = flow4thPt->GetBinContent(p); | |
5341 | dvn6th = flow6thPt->GetBinContent(p); | |
5342 | dvn8th = flow8thPt->GetBinContent(p); | |
5343 | ||
5344 | dErrvn2nd = flow2ndPt->GetBinError(p); | |
5345 | dErrvn4th = flow4thPt->GetBinError(p); | |
5346 | dErrvn6th = flow6thPt->GetBinError(p); | |
5347 | dErrvn8th = flow8thPt->GetBinError(p); | |
5348 | ||
5349 | dYield2nd = yield2ndPt->GetBinContent(p); | |
5350 | dYield4th = yield4thPt->GetBinContent(p); | |
5351 | dYield6th = yield6thPt->GetBinContent(p); | |
5352 | dYield8th = yield8thPt->GetBinContent(p); | |
5353 | ||
5354 | dVn2nd += dvn2nd*dYield2nd; | |
5355 | dVn4th += dvn4th*dYield4th; | |
5356 | dVn6th += dvn6th*dYield6th; | |
5357 | dVn8th += dvn8th*dYield8th; | |
5358 | ||
5359 | dSum2nd += dYield2nd; | |
5360 | dSum4th += dYield4th; | |
5361 | dSum6th += dYield6th; | |
5362 | dSum8th += dYield8th; | |
5363 | ||
5364 | dErrVn2nd += dYield2nd*dYield2nd*dErrvn2nd*dErrvn2nd; // ro be improved (check this relation) | |
5365 | dErrVn4th += dYield4th*dYield4th*dErrvn4th*dErrvn4th; | |
5366 | dErrVn6th += dYield6th*dYield6th*dErrvn6th*dErrvn6th; | |
5367 | dErrVn8th += dYield8th*dYield8th*dErrvn8th*dErrvn8th; | |
5368 | ||
5369 | } // end of for(Int_t p=1;p<nBinsPt+1;p++) | |
5370 | ||
5371 | // normalizing the results for integrated flow: | |
5372 | if(dSum2nd) | |
5373 | { | |
5374 | dVn2nd /= dSum2nd; | |
5375 | dErrVn2nd /= (dSum2nd*dSum2nd); | |
5376 | dErrVn2nd = TMath::Sqrt(dErrVn2nd); | |
5377 | } | |
5378 | if(dSum4th) | |
5379 | { | |
5380 | dVn4th /= dSum4th; | |
5381 | dErrVn4th /= (dSum4th*dSum4th); | |
5382 | dErrVn4th = TMath::Sqrt(dErrVn4th); | |
5383 | } | |
5384 | //if(dSum6th) dVn6th/=dSum6th; | |
5385 | //if(dSum8th) dVn8th/=dSum8th; | |
5386 | ||
5387 | // storing the results for integrated flow in common histos: (to be improved: new method for this?) | |
5388 | if(type == "POI") | |
5389 | { | |
5390 | fCommonHistsResults2nd->FillIntegratedFlowPOI(dVn2nd,dErrVn2nd); | |
5391 | fCommonHistsResults4th->FillIntegratedFlowPOI(dVn4th,dErrVn4th); | |
5392 | fCommonHistsResults6th->FillIntegratedFlowPOI(dVn6th,0.); // to be improved (errors) | |
5393 | fCommonHistsResults8th->FillIntegratedFlowPOI(dVn8th,0.); // to be improved (errors) | |
5394 | } | |
5395 | else if (type == "RP") | |
5396 | { | |
5397 | fCommonHistsResults2nd->FillIntegratedFlowRP(dVn2nd,dErrVn2nd); | |
5398 | fCommonHistsResults4th->FillIntegratedFlowRP(dVn4th,dErrVn4th); | |
5399 | fCommonHistsResults6th->FillIntegratedFlowRP(dVn6th,0.); // to be improved (errors) | |
5400 | fCommonHistsResults8th->FillIntegratedFlowRP(dVn8th,0.); // to be improved (errors) | |
5401 | } | |
5402 | ||
5403 | delete flow2ndPt; | |
5404 | delete flow4thPt; | |
5405 | //delete flow6thPt; | |
5406 | //delete flow8thPt; | |
5407 | ||
5408 | delete yield2ndPt; | |
5409 | delete yield4thPt; | |
5410 | delete yield6thPt; | |
5411 | delete yield8thPt; | |
5412 | ||
5413 | } // end of AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type) | |
5414 | ||
489d5531 | 5415 | //================================================================================================================================ |
5416 | ||
489d5531 | 5417 | void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions() |
5418 | { | |
5419 | // Initialize all arrays used for distributions. | |
5420 | ||
5421 | // a) Initialize arrays of histograms used to hold distributions of correlations; | |
5422 | // b) Initialize array to hold min and max values of correlations. | |
5423 | ||
5424 | // a) Initialize arrays of histograms used to hold distributions of correlations: | |
5425 | for(Int_t di=0;di<4;di++) // distribution index | |
5426 | { | |
5427 | fDistributions[di] = NULL; | |
5428 | } | |
5429 | ||
5430 | // b) Initialize default min and max values of correlations: | |
5431 | // (Remark: The default values bellow were chosen for v2=5% and M=500) | |
5432 | fMinValueOfCorrelation[0] = -0.01; // <2>_min | |
5433 | fMaxValueOfCorrelation[0] = 0.04; // <2>_max | |
5434 | fMinValueOfCorrelation[1] = -0.00002; // <4>_min | |
5435 | fMaxValueOfCorrelation[1] = 0.00015; // <4>_max | |
5436 | fMinValueOfCorrelation[2] = -0.0000003; // <6>_min | |
5437 | fMaxValueOfCorrelation[2] = 0.0000006; // <6>_max | |
5438 | fMinValueOfCorrelation[3] = -0.000000006; // <8>_min | |
5439 | fMaxValueOfCorrelation[3] = 0.000000003; // <8>_max | |
5440 | ||
5441 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions() | |
5442 | ||
489d5531 | 5443 | //================================================================================================================================ |
5444 | ||
e5834fcb | 5445 | void AliFlowAnalysisWithQCumulants::InitializeArraysForVarious() |
5446 | { | |
5447 | // Initialize all arrays used for various unclassified objects. | |
5448 | ||
5449 | for(Int_t p=0;p<4;p++) // [v_min,v_max,refMult_min,refMult_max] | |
5450 | { | |
5451 | fPhiDistributionForOneEventSettings[p] = 0.; | |
5452 | } | |
5453 | ||
5454 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForVarious() | |
5455 | ||
5456 | //================================================================================================================================ | |
489d5531 | 5457 | |
5458 | void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions() | |
5459 | { | |
5460 | // a) Book profile to hold all flags for distributions of correlations; | |
5461 | // b) Book all histograms to hold distributions of correlations. | |
5462 | ||
5463 | TString correlationIndex[4] = {"<2>","<4>","<6>","<8>"}; // to be improved (should I promote this to data members?) | |
5464 | ||
5465 | // a) Book profile to hold all flags for distributions of correlations: | |
5466 | TString distributionsFlagsName = "fDistributionsFlags"; | |
5467 | distributionsFlagsName += fAnalysisLabel->Data(); | |
5468 | fDistributionsFlags = new TProfile(distributionsFlagsName.Data(),"Flags for Distributions of Correlations",9,0,9); | |
5469 | fDistributionsFlags->SetTickLength(-0.01,"Y"); | |
5470 | fDistributionsFlags->SetMarkerStyle(25); | |
5471 | fDistributionsFlags->SetLabelSize(0.05); | |
5472 | fDistributionsFlags->SetLabelOffset(0.02,"Y"); | |
5473 | fDistributionsFlags->GetXaxis()->SetBinLabel(1,"Store or not?"); | |
5474 | fDistributionsFlags->GetXaxis()->SetBinLabel(2,"<2>_{min}"); | |
5475 | fDistributionsFlags->GetXaxis()->SetBinLabel(3,"<2>_{max}"); | |
5476 | fDistributionsFlags->GetXaxis()->SetBinLabel(4,"<4>_{min}"); | |
5477 | fDistributionsFlags->GetXaxis()->SetBinLabel(5,"<4>_{max}"); | |
5478 | fDistributionsFlags->GetXaxis()->SetBinLabel(6,"<6>_{min}"); | |
5479 | fDistributionsFlags->GetXaxis()->SetBinLabel(7,"<6>_{max}"); | |
5480 | fDistributionsFlags->GetXaxis()->SetBinLabel(8,"<8>_{min}"); | |
5481 | fDistributionsFlags->GetXaxis()->SetBinLabel(9,"<8>_{max}"); | |
5482 | fDistributionsList->Add(fDistributionsFlags); | |
5483 | ||
5484 | // b) Book all histograms to hold distributions of correlations. | |
5485 | if(fStoreDistributions) | |
5486 | { | |
5487 | TString distributionsName = "fDistributions"; | |
5488 | distributionsName += fAnalysisLabel->Data(); | |
5489 | for(Int_t di=0;di<4;di++) // distribution index | |
5490 | { | |
5491 | fDistributions[di] = new TH1D(Form("Distribution of %s",correlationIndex[di].Data()),Form("Distribution of %s",correlationIndex[di].Data()),10000,fMinValueOfCorrelation[di],fMaxValueOfCorrelation[di]); | |
5492 | fDistributions[di]->SetXTitle(correlationIndex[di].Data()); | |
5493 | fDistributionsList->Add(fDistributions[di]); | |
5494 | } // end of for(Int_t di=0;di<4;di++) // distribution index | |
5495 | } // end of if(fStoreDistributions) | |
5496 | ||
5497 | } // end of void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions() | |
5498 | ||
489d5531 | 5499 | //================================================================================================================================ |
5500 | ||
e5834fcb | 5501 | void AliFlowAnalysisWithQCumulants::BookEverythingForVarious() |
5502 | { | |
5503 | // Book all objects for various unclassified quantities. | |
5504 | ||
5505 | if(!fStorePhiDistributionForOneEvent){return;} | |
5506 | ||
5507 | // a) Book histogram holding phi distribution for single event to illustrate flow. | |
5508 | ||
5509 | // a) Book histogram holding phi distribution for single event to illustrate flow: | |
5510 | fPhiDistributionForOneEvent = new TH1D("fPhiDistributionForOneEvent","",360,0.,TMath::TwoPi()); | |
5511 | fPhiDistributionForOneEvent->GetXaxis()->SetTitle("#phi"); | |
5512 | fVariousList->Add(fPhiDistributionForOneEvent); | |
5513 | ||
5514 | } // end of void AliFlowAnalysisWithQCumulants::BookEverythingForVarious() | |
5515 | ||
5516 | //================================================================================================================================ | |
489d5531 | 5517 | |
5518 | void AliFlowAnalysisWithQCumulants::StoreFlagsForDistributions() | |
5519 | { | |
5520 | // Store all flags for distributiuons of correlations in profile fDistributionsFlags. | |
5521 | ||
5522 | if(!fDistributionsFlags) | |
5523 | { | |
5524 | cout<<"WARNING: fDistributionsFlags is NULL in AFAWQC::SDF() !!!!"<<endl; | |
5525 | exit(0); | |
5526 | } | |
5527 | ||
5528 | fDistributionsFlags->Fill(0.5,(Int_t)fStoreDistributions); // histos with distributions of correlations stored or not in the output file | |
5529 | // store min and max values of correlations: | |
5530 | for(Int_t di=0;di<4;di++) // distribution index | |
5531 | { | |
5532 | fDistributionsFlags->Fill(1.5+2.*(Double_t)di,fMinValueOfCorrelation[di]); | |
5533 | fDistributionsFlags->Fill(2.5+2.*(Double_t)di,fMaxValueOfCorrelation[di]); | |
5534 | } | |
5535 | ||
5536 | } // end of void AliFlowAnalysisWithQCumulants::StoreFlagsForDistributions() | |
5537 | ||
489d5531 | 5538 | //================================================================================================================================ |
5539 | ||
489d5531 | 5540 | void AliFlowAnalysisWithQCumulants::StoreDistributionsOfCorrelations() |
5541 | { | |
5542 | // Store distributions of correlations. | |
5543 | ||
5544 | if(!(fIntFlowCorrelationsEBE && fIntFlowEventWeightsForCorrelationsEBE)) | |
5545 | { | |
5546 | cout<<"WARNING: fIntFlowCorrelationsEBE && fIntFlowEventWeightsForCorrelationsEBE"<<endl; | |
5547 | cout<<" is NULL in AFAWQC::SDOC() !!!!"<<endl; | |
5548 | exit(0); | |
5549 | } | |
5550 | ||
5551 | for(Int_t di=0;di<4;di++) // distribution index | |
5552 | { | |
5553 | if(!fDistributions[di]) | |
5554 | { | |
5555 | cout<<"WARNING: fDistributions[di] is NULL in AFAWQC::SDOC() !!!!"<<endl; | |
5556 | cout<<"di = "<<di<<endl; | |
5557 | exit(0); | |
5558 | } else | |
5559 | { | |
5560 | fDistributions[di]->Fill(fIntFlowCorrelationsEBE->GetBinContent(di+1),fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(di+1)); | |
5561 | } | |
5562 | } // end of for(Int_t di=0;di<4;di++) // distribution index | |
5563 | ||
5564 | } // end of void AliFlowAnalysisWithQCumulants::StoreDistributionsOfCorrelations() | |
5565 | ||
489d5531 | 5566 | //================================================================================================================================ |
5567 | ||
489d5531 | 5568 | void AliFlowAnalysisWithQCumulants::BookAndNestAllLists() |
5569 | { | |
5570 | // Book and nest all lists nested in the base list fHistList. | |
5571 | // a) Book and nest lists for integrated flow; | |
5572 | // b) Book and nest lists for differential flow; | |
5573 | // c) Book and nest list for particle weights; | |
5574 | // d) Book and nest list for distributions; | |
e5834fcb | 5575 | // e) Book and nest list for various unclassified objects; |
5576 | // f) Book and nest list for nested loops. | |
489d5531 | 5577 | |
5578 | // a) Book and nest all lists for integrated flow: | |
1268c371 | 5579 | // Base list for integrated flow: |
489d5531 | 5580 | fIntFlowList = new TList(); |
5581 | fIntFlowList->SetName("Integrated Flow"); | |
5582 | fIntFlowList->SetOwner(kTRUE); | |
5583 | fHistList->Add(fIntFlowList); | |
1268c371 | 5584 | // List holding profiles: |
489d5531 | 5585 | fIntFlowProfiles = new TList(); |
5586 | fIntFlowProfiles->SetName("Profiles"); | |
5587 | fIntFlowProfiles->SetOwner(kTRUE); | |
5588 | fIntFlowList->Add(fIntFlowProfiles); | |
1268c371 | 5589 | // List holding histograms with results: |
489d5531 | 5590 | fIntFlowResults = new TList(); |
5591 | fIntFlowResults->SetName("Results"); | |
5592 | fIntFlowResults->SetOwner(kTRUE); | |
5593 | fIntFlowList->Add(fIntFlowResults); | |
5594 | ||
1268c371 | 5595 | // b) Book and nest lists for differential flow: |
5596 | this->BookAndNestListsForDifferentialFlow(); | |
5597 | ||
5598 | // c) Book and nest list for particle weights: | |
5599 | fWeightsList->SetName("Weights"); | |
5600 | fWeightsList->SetOwner(kTRUE); | |
5601 | fHistList->Add(fWeightsList); | |
5602 | ||
5603 | // d) Book and nest list for distributions: | |
5604 | fDistributionsList = new TList(); | |
5605 | fDistributionsList->SetName("Distributions"); | |
5606 | fDistributionsList->SetOwner(kTRUE); | |
5607 | fHistList->Add(fDistributionsList); | |
5608 | ||
5609 | // e) Book and nest list for various unclassified objects: | |
5610 | if(fStorePhiDistributionForOneEvent) | |
5611 | { | |
5612 | fVariousList = new TList(); | |
5613 | fVariousList->SetName("Various"); | |
5614 | fVariousList->SetOwner(kTRUE); | |
5615 | fHistList->Add(fVariousList); | |
5616 | } | |
5617 | ||
5618 | // f) Book and nest list for nested loops: | |
5619 | fNestedLoopsList = new TList(); | |
5620 | fNestedLoopsList->SetName("Nested Loops"); | |
5621 | fNestedLoopsList->SetOwner(kTRUE); | |
5622 | fHistList->Add(fNestedLoopsList); | |
5623 | ||
5624 | } // end of void AliFlowAnalysisWithQCumulants::BookAndNestAllLists() | |
5625 | ||
5626 | //================================================================================================================================ | |
5627 | ||
5628 | void AliFlowAnalysisWithQCumulants::BookAndNestListsForDifferentialFlow() | |
5629 | { | |
5630 | // Book and nest lists for differential flow. | |
5631 | ||
5632 | // Base list for differential flow objects: | |
489d5531 | 5633 | fDiffFlowList = new TList(); |
5634 | fDiffFlowList->SetName("Differential Flow"); | |
5635 | fDiffFlowList->SetOwner(kTRUE); | |
5636 | fHistList->Add(fDiffFlowList); | |
1268c371 | 5637 | |
5638 | // Local flags: | |
5639 | TString typeFlag[2] = {"RP","POI"}; | |
5640 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
5641 | TString powerFlag[2] = {"linear","quadratic"}; | |
5642 | ||
5643 | // 2D: | |
5644 | if(fCalculate2DDiffFlow) | |
5645 | { | |
5646 | fDiffFlow2D = new TList(); | |
5647 | fDiffFlow2D->SetName("2D"); | |
5648 | fDiffFlow2D->SetOwner(kTRUE); | |
5649 | fDiffFlowList->Add(fDiffFlow2D); | |
5650 | for(Int_t t=0;t<2;t++) | |
5651 | { | |
5652 | f2DDiffFlowCorrelationsProList[t] = new TList(); | |
5653 | f2DDiffFlowCorrelationsProList[t]->SetOwner(kTRUE); | |
5654 | f2DDiffFlowCorrelationsProList[t]->SetName(Form("Profiles with 2D correlations (%s)",typeFlag[t].Data())); | |
5655 | fDiffFlow2D->Add(f2DDiffFlowCorrelationsProList[t]); | |
5656 | } // end of for(Int_t t=0;t<2;t++) | |
5657 | } // end of if(fCalculate2DDiffFlow) | |
5658 | ||
5659 | // What follows bellow in this method is relevant only for 1D differential flow: | |
5660 | if(!fCalculateDiffFlow){return;} | |
5661 | ||
5662 | // List holding profiles: | |
489d5531 | 5663 | fDiffFlowProfiles = new TList(); |
5664 | fDiffFlowProfiles->SetName("Profiles"); | |
5665 | fDiffFlowProfiles->SetOwner(kTRUE); | |
5666 | fDiffFlowList->Add(fDiffFlowProfiles); | |
1268c371 | 5667 | // List holding histograms with results: |
489d5531 | 5668 | fDiffFlowResults = new TList(); |
5669 | fDiffFlowResults->SetName("Results"); | |
5670 | fDiffFlowResults->SetOwner(kTRUE); | |
5671 | fDiffFlowList->Add(fDiffFlowResults); | |
1268c371 | 5672 | // Flags used for naming nested lists in list fDiffFlowProfiles and fDiffFlowResults: |
489d5531 | 5673 | TList list; |
5674 | list.SetOwner(kTRUE); | |
1268c371 | 5675 | // Nested lists in fDiffFlowProfiles (~/Differential Flow/Profiles): |
489d5531 | 5676 | for(Int_t t=0;t<2;t++) // type: RP or POI |
5677 | { | |
5678 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5679 | { | |
5680 | // list holding profiles with correlations: | |
5681 | fDiffFlowCorrelationsProList[t][pe] = (TList*)list.Clone(); | |
5682 | fDiffFlowCorrelationsProList[t][pe]->SetName(Form("Profiles with correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5683 | fDiffFlowProfiles->Add(fDiffFlowCorrelationsProList[t][pe]); | |
5684 | // list holding profiles with products of correlations: | |
5685 | fDiffFlowProductOfCorrelationsProList[t][pe] = (TList*)list.Clone(); | |
5686 | fDiffFlowProductOfCorrelationsProList[t][pe]->SetName(Form("Profiles with products of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5687 | fDiffFlowProfiles->Add(fDiffFlowProductOfCorrelationsProList[t][pe]); | |
5688 | // list holding profiles with corrections: | |
5689 | fDiffFlowCorrectionsProList[t][pe] = (TList*)list.Clone(); | |
5690 | fDiffFlowCorrectionsProList[t][pe]->SetName(Form("Profiles with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5691 | fDiffFlowProfiles->Add(fDiffFlowCorrectionsProList[t][pe]); | |
5692 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5693 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
5694 | // nested lists in fDiffFlowResults (~/Differential Flow/Results): | |
5695 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
5696 | { | |
5697 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5698 | { | |
5699 | // list holding histograms with correlations: | |
5700 | fDiffFlowCorrelationsHistList[t][pe] = (TList*)list.Clone(); | |
5701 | fDiffFlowCorrelationsHistList[t][pe]->SetName(Form("Correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5702 | fDiffFlowResults->Add(fDiffFlowCorrelationsHistList[t][pe]); | |
5703 | // list holding histograms with corrections: | |
5704 | fDiffFlowCorrectionsHistList[t][pe] = (TList*)list.Clone(); | |
5705 | fDiffFlowCorrectionsHistList[t][pe]->SetName(Form("Histograms with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5706 | fDiffFlowResults->Add(fDiffFlowCorrectionsHistList[t][pe]); | |
5707 | for(Int_t power=0;power<2;power++) | |
5708 | { | |
5709 | // list holding histograms with sums of event weights: | |
5710 | fDiffFlowSumOfEventWeightsHistList[t][pe][power] = (TList*)list.Clone(); | |
5711 | fDiffFlowSumOfEventWeightsHistList[t][pe][power]->SetName(Form("Sum of %s event weights (%s, %s)",powerFlag[power].Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5712 | fDiffFlowResults->Add(fDiffFlowSumOfEventWeightsHistList[t][pe][power]); | |
5713 | } // end of for(Int_t power=0;power<2;power++) | |
5714 | // list holding histograms with sums of products of event weights: | |
5715 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe] = (TList*)list.Clone(); | |
5716 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]->SetName(Form("Sum of products of event weights (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5717 | fDiffFlowResults->Add(fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]); | |
5718 | // list holding histograms with covariances of correlations: | |
5719 | fDiffFlowCovariancesHistList[t][pe] = (TList*)list.Clone(); | |
5720 | fDiffFlowCovariancesHistList[t][pe]->SetName(Form("Covariances of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5721 | fDiffFlowResults->Add(fDiffFlowCovariancesHistList[t][pe]); | |
5722 | // list holding histograms with differential Q-cumulants: | |
5723 | fDiffFlowCumulantsHistList[t][pe] = (TList*)list.Clone(); | |
5724 | fDiffFlowCumulantsHistList[t][pe]->SetName(Form("Differential Q-cumulants (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5725 | fDiffFlowResults->Add(fDiffFlowCumulantsHistList[t][pe]); | |
1268c371 | 5726 | // list holding histograms which quantify detector bias to differential Q-cumulants: |
5727 | fDiffFlowDetectorBiasHistList[t][pe] = (TList*)list.Clone(); | |
5728 | fDiffFlowDetectorBiasHistList[t][pe]->SetName(Form("Detector bias (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5729 | fDiffFlowResults->Add(fDiffFlowDetectorBiasHistList[t][pe]); | |
489d5531 | 5730 | // list holding histograms with differential flow estimates from Q-cumulants: |
5731 | fDiffFlowHistList[t][pe] = (TList*)list.Clone(); | |
5732 | fDiffFlowHistList[t][pe]->SetName(Form("Differential flow (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5733 | fDiffFlowResults->Add(fDiffFlowHistList[t][pe]); | |
5734 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5735 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
5736 | ||
1268c371 | 5737 | } // end of void AliFlowAnalysisWithQCumulants::BookAndNestListsForDifferentialFlow() |
489d5531 | 5738 | |
5739 | //================================================================================================================================ | |
5740 | ||
489d5531 | 5741 | void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type) |
5742 | { | |
1268c371 | 5743 | // Fill common result histograms for differential flow. |
489d5531 | 5744 | |
1268c371 | 5745 | Int_t t = 0; |
489d5531 | 5746 | |
5747 | if(type == "RP") | |
5748 | { | |
1268c371 | 5749 | t = 0; |
489d5531 | 5750 | } else if(type == "POI") |
5751 | { | |
1268c371 | 5752 | t = 1; |
489d5531 | 5753 | } |
1268c371 | 5754 | |
5755 | // to be improved - check all pointers used in this method | |
489d5531 | 5756 | |
5757 | if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th)) | |
5758 | { | |
5759 | cout<<"WARNING: fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th"<<endl; | |
5760 | cout<<" is NULL in AFAWQC::FCHRIF() !!!!"<<endl; | |
5761 | exit(0); | |
5762 | } | |
5763 | ||
5764 | // pt: | |
5765 | for(Int_t p=1;p<=fnBinsPt;p++) | |
5766 | { | |
5767 | Double_t v2 = fDiffFlow[t][0][0]->GetBinContent(p); | |
5768 | Double_t v4 = fDiffFlow[t][0][1]->GetBinContent(p); | |
5769 | Double_t v6 = fDiffFlow[t][0][2]->GetBinContent(p); | |
5770 | Double_t v8 = fDiffFlow[t][0][3]->GetBinContent(p); | |
5771 | ||
5772 | Double_t v2Error = fDiffFlow[t][0][0]->GetBinError(p); | |
5773 | Double_t v4Error = fDiffFlow[t][0][1]->GetBinError(p); | |
5774 | //Double_t v6Error = fFinalFlow1D[t][pW][nua][0][2]->GetBinError(p); | |
5775 | //Double_t v8Error = fFinalFlow1D[t][pW][nua][0][3]->GetBinError(p); | |
5776 | ||
5777 | if(type == "RP") | |
5778 | { | |
5779 | fCommonHistsResults2nd->FillDifferentialFlowPtRP(p,v2,v2Error); | |
5780 | fCommonHistsResults4th->FillDifferentialFlowPtRP(p,v4,v4Error); | |
5781 | fCommonHistsResults6th->FillDifferentialFlowPtRP(p,v6,0.); | |
5782 | fCommonHistsResults8th->FillDifferentialFlowPtRP(p,v8,0.); | |
5783 | } else if(type == "POI") | |
5784 | { | |
5785 | fCommonHistsResults2nd->FillDifferentialFlowPtPOI(p,v2,v2Error); | |
5786 | fCommonHistsResults4th->FillDifferentialFlowPtPOI(p,v4,v4Error); | |
5787 | fCommonHistsResults6th->FillDifferentialFlowPtPOI(p,v6,0.); | |
5788 | fCommonHistsResults8th->FillDifferentialFlowPtPOI(p,v8,0.); | |
5789 | } | |
5790 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
5791 | ||
5792 | // eta: | |
5793 | for(Int_t e=1;e<=fnBinsEta;e++) | |
5794 | { | |
5795 | Double_t v2 = fDiffFlow[t][1][0]->GetBinContent(e); | |
5796 | Double_t v4 = fDiffFlow[t][1][1]->GetBinContent(e); | |
5797 | Double_t v6 = fDiffFlow[t][1][2]->GetBinContent(e); | |
5798 | Double_t v8 = fDiffFlow[t][1][3]->GetBinContent(e); | |
5799 | ||
5800 | Double_t v2Error = fDiffFlow[t][1][0]->GetBinError(e); | |
5801 | Double_t v4Error = fDiffFlow[t][1][1]->GetBinError(e); | |
5802 | //Double_t v6Error = fDiffFlow[t][1][2]->GetBinError(e); | |
5803 | //Double_t v8Error = fDiffFlow[t][1][3]->GetBinError(e); | |
5804 | ||
5805 | if(type == "RP") | |
5806 | { | |
5807 | fCommonHistsResults2nd->FillDifferentialFlowEtaRP(e,v2,v2Error); | |
5808 | fCommonHistsResults4th->FillDifferentialFlowEtaRP(e,v4,v4Error); | |
5809 | fCommonHistsResults6th->FillDifferentialFlowEtaRP(e,v6,0.); | |
5810 | fCommonHistsResults8th->FillDifferentialFlowEtaRP(e,v8,0.); | |
5811 | } else if(type == "POI") | |
5812 | { | |
5813 | fCommonHistsResults2nd->FillDifferentialFlowEtaPOI(e,v2,v2Error); | |
5814 | fCommonHistsResults4th->FillDifferentialFlowEtaPOI(e,v4,v4Error); | |
5815 | fCommonHistsResults6th->FillDifferentialFlowEtaPOI(e,v6,0.); | |
5816 | fCommonHistsResults8th->FillDifferentialFlowEtaPOI(e,v8,0.); | |
5817 | } | |
5818 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
5819 | ||
5820 | } // end of void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights, Bool_t correctedForNUA) | |
5821 | ||
489d5531 | 5822 | //================================================================================================================================ |
5823 | ||
1268c371 | 5824 | void AliFlowAnalysisWithQCumulants::CommonConstants(TString method) |
489d5531 | 5825 | { |
1268c371 | 5826 | // Access and store common constants. |
5827 | ||
5828 | // a) If this method was called in Init() access common constants from AliFlowCommonConstants; | |
5829 | // b) If this method was called in Init() book and fill TProfile to hold constants accessed in a); | |
5830 | // c) If this method was called in Finish() access common constants from TProfile booked and filled in b). | |
5831 | ||
5832 | if(method == "Init") | |
5833 | { | |
5834 | // a) If this method was called in Init() access common constants from AliFlowCommonConstants: | |
5835 | fnBinsPhi = AliFlowCommonConstants::GetMaster()->GetNbinsPhi(); | |
5836 | fPhiMin = AliFlowCommonConstants::GetMaster()->GetPhiMin(); | |
5837 | fPhiMax = AliFlowCommonConstants::GetMaster()->GetPhiMax(); | |
5838 | if(fnBinsPhi){fPhiBinWidth = (fPhiMax-fPhiMin)/fnBinsPhi;} | |
5839 | fnBinsPt = AliFlowCommonConstants::GetMaster()->GetNbinsPt(); | |
5840 | fPtMin = AliFlowCommonConstants::GetMaster()->GetPtMin(); | |
5841 | fPtMax = AliFlowCommonConstants::GetMaster()->GetPtMax(); | |
5842 | if(fnBinsPt){fPtBinWidth = (fPtMax-fPtMin)/fnBinsPt;} | |
5843 | fnBinsEta = AliFlowCommonConstants::GetMaster()->GetNbinsEta(); | |
5844 | fEtaMin = AliFlowCommonConstants::GetMaster()->GetEtaMin(); | |
5845 | fEtaMax = AliFlowCommonConstants::GetMaster()->GetEtaMax(); | |
5846 | if(fnBinsEta){fEtaBinWidth = (fEtaMax-fEtaMin)/fnBinsEta;} | |
5847 | ||
5848 | // b) If this method was called in Init() book and fill TProfile to hold constants accessed in a): | |
5849 | TString fCommonConstantsName = "fCommonConstants"; | |
5850 | fCommonConstantsName += fAnalysisLabel->Data(); | |
5851 | fCommonConstants = new TProfile(fCommonConstantsName.Data(),"Common constants",9,0.,9.); | |
5852 | fCommonConstants->SetLabelSize(0.05); | |
5853 | fCommonConstants->GetXaxis()->SetBinLabel(1,"nBins (#phi)"); | |
5854 | fCommonConstants->Fill(0.5,fnBinsPhi); | |
5855 | fCommonConstants->GetXaxis()->SetBinLabel(2,"#phi_{min}"); | |
5856 | fCommonConstants->Fill(1.5,fPhiMin); | |
5857 | fCommonConstants->GetXaxis()->SetBinLabel(3,"#phi_{max}"); | |
5858 | fCommonConstants->Fill(2.5,fPhiMax); | |
5859 | fCommonConstants->GetXaxis()->SetBinLabel(4,"nBins (p_{t})"); | |
5860 | fCommonConstants->Fill(3.5,fnBinsPt); | |
5861 | fCommonConstants->GetXaxis()->SetBinLabel(5,"(p_{t})_{min}"); | |
5862 | fCommonConstants->Fill(4.5,fPtMin); | |
5863 | fCommonConstants->GetXaxis()->SetBinLabel(6,"(p_{t})_{max}"); | |
5864 | fCommonConstants->Fill(5.5,fPtMax); | |
5865 | fCommonConstants->GetXaxis()->SetBinLabel(7,"nBins (#eta)"); | |
5866 | fCommonConstants->Fill(6.5,fnBinsEta); | |
5867 | fCommonConstants->GetXaxis()->SetBinLabel(8,"#eta_{min}"); | |
5868 | fCommonConstants->Fill(7.5,fEtaMin); | |
5869 | fCommonConstants->GetXaxis()->SetBinLabel(9,"#eta_{max}"); | |
5870 | fCommonConstants->Fill(8.5,fEtaMax); | |
5871 | fHistList->Add(fCommonConstants); | |
5872 | } // end of if(method == "Init") | |
5873 | else if(method == "Finish") | |
5874 | { | |
5875 | // c) If this method was called in Finish() access common constants from TProfile booked and filled in b): | |
5876 | if(!fCommonConstants) | |
5877 | { | |
5878 | printf("\n WARNING (QC): fCommonConstants is NULL in AFAWQC::AC(\"%s\") !!!!\n\n",method.Data()); | |
5879 | exit(0); | |
5880 | } | |
5881 | fnBinsPhi = (Int_t)fCommonConstants->GetBinContent(1); | |
5882 | fPhiMin = fCommonConstants->GetBinContent(2); | |
5883 | fPhiMax = fCommonConstants->GetBinContent(3); | |
5884 | if(fnBinsPhi){fPhiBinWidth = (fPhiMax-fPhiMin)/fnBinsPhi;} | |
5885 | fnBinsPt = (Int_t)fCommonConstants->GetBinContent(4); | |
5886 | fPtMin = fCommonConstants->GetBinContent(5); | |
5887 | fPtMax = fCommonConstants->GetBinContent(6); | |
5888 | if(fnBinsPt){fPtBinWidth = (fPtMax-fPtMin)/fnBinsPt;} | |
5889 | fnBinsEta = (Int_t)fCommonConstants->GetBinContent(7); | |
5890 | fEtaMin = fCommonConstants->GetBinContent(8); | |
5891 | fEtaMax = fCommonConstants->GetBinContent(9); | |
5892 | if(fnBinsEta){fEtaBinWidth = (fEtaMax-fEtaMin)/fnBinsEta;} | |
5893 | } // end of else if(method == "Finish") | |
5894 | ||
5895 | } // end of void AliFlowAnalysisWithQCumulants::CommonConstants(TString method) | |
489d5531 | 5896 | |
489d5531 | 5897 | //================================================================================================================================ |
5898 | ||
489d5531 | 5899 | void AliFlowAnalysisWithQCumulants::CrossCheckSettings() |
5900 | { | |
1268c371 | 5901 | // a) Cross check if the choice for multiplicity weights make sense. |
489d5531 | 5902 | |
5903 | // a) Cross check if the choice for multiplicity weights make sense: | |
5904 | if(strcmp(fMultiplicityWeight->Data(),"combinations") && | |
5905 | strcmp(fMultiplicityWeight->Data(),"unit") && | |
5906 | strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
5907 | { | |
5908 | cout<<"WARNING (QC): Multiplicity weight can be either \"combinations\", \"unit\""<<endl; | |
5909 | cout<<" or \"multiplicity\". Certainly not \""<<fMultiplicityWeight->Data()<<"\"."<<endl; | |
5910 | exit(0); | |
5911 | } | |
5912 | ||
5913 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckSettings() | |
5914 | ||
489d5531 | 5915 | //================================================================================================================================ |
5916 | ||
489d5531 | 5917 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeights() |
5918 | { | |
0328db2d | 5919 | // Calculate sum of linear and quadratic event weights for correlations. |
2001bc3a | 5920 | |
5921 | // multiplicity: | |
1268c371 | 5922 | Double_t dMult = (*fSpk)(0,0); |
9f33751d | 5923 | |
489d5531 | 5924 | for(Int_t p=0;p<2;p++) // power-1 |
5925 | { | |
5926 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
5927 | { | |
5928 | fIntFlowSumOfEventWeights[p]->Fill(ci+0.5,pow(fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci+1),p+1)); | |
b3dacf6b | 5929 | if(fCalculateCumulantsVsM) |
5930 | { | |
5931 | fIntFlowSumOfEventWeightsVsM[ci][p]->Fill(dMult+0.5,pow(fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci+1),p+1)); // to be improved: dMult => sum of weights? | |
5932 | } | |
489d5531 | 5933 | } |
5934 | } | |
5935 | ||
5936 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeights() | |
5937 | ||
489d5531 | 5938 | //================================================================================================================================ |
5939 | ||
0328db2d | 5940 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeightsNUA() |
489d5531 | 5941 | { |
0328db2d | 5942 | // Calculate sum of linear and quadratic event weights for NUA terms. |
5943 | ||
5944 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
489d5531 | 5945 | { |
0328db2d | 5946 | for(Int_t p=0;p<2;p++) // power-1 |
5947 | { | |
b92ea2b9 | 5948 | for(Int_t ci=0;ci<4;ci++) // nua term index |
0328db2d | 5949 | { |
5950 | fIntFlowSumOfEventWeightsNUA[sc][p]->Fill(ci+0.5,pow(fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc]->GetBinContent(ci+1),p+1)); | |
489d5531 | 5951 | } |
0328db2d | 5952 | } |
5953 | } | |
5954 | ||
5955 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeightsNUA() | |
489d5531 | 5956 | |
0328db2d | 5957 | //================================================================================================================================ |
5958 | ||
0328db2d | 5959 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeights() |
5960 | { | |
ff70ca91 | 5961 | // Calculate sum of product of event weights for correlations. |
2001bc3a | 5962 | |
5963 | // multiplicity: | |
1268c371 | 5964 | Double_t dMult = (*fSpk)(0,0); |
2001bc3a | 5965 | |
489d5531 | 5966 | Int_t counter = 0; |
5967 | ||
5968 | for(Int_t ci1=1;ci1<4;ci1++) | |
5969 | { | |
5970 | for(Int_t ci2=ci1+1;ci2<=4;ci2++) | |
5971 | { | |
ff70ca91 | 5972 | fIntFlowSumOfProductOfEventWeights->Fill(0.5+counter, |
5973 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
b3dacf6b | 5974 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); |
5975 | if(fCalculateCumulantsVsM) | |
5976 | { | |
5977 | fIntFlowSumOfProductOfEventWeightsVsM[counter]->Fill(dMult+0.5, // to be improved: dMult => sum of weights? | |
5978 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
5979 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); | |
5980 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 5981 | counter++; |
489d5531 | 5982 | } |
5983 | } | |
5984 | ||
0328db2d | 5985 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeights() |
5986 | ||
0328db2d | 5987 | //================================================================================================================================ |
5988 | ||
0328db2d | 5989 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeightsNUA() |
5990 | { | |
5991 | // Calculate sum of product of event weights for NUA terms. | |
5992 | ||
5993 | // w_{<2>} * w_{<cos(#phi)>}: | |
5994 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(0.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
5995 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
5996 | // w_{<2>} * w_{<sin(#phi)>}: | |
5997 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(1.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
5998 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
5999 | // w_{<cos(#phi)> * w_{<sin(#phi)>}: | |
6000 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(2.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6001 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
6002 | // w_{<2>} * w{<cos(phi1+phi2)>} | |
6003 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(3.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6004 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6005 | // w_{<2>} * w{<sin(phi1+phi2)>} | |
6006 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(4.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6007 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6008 | // w_{<2>} * w{<cos(phi1-phi2-phi3)>} | |
6009 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(5.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6010 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6011 | // w_{<2>} * w{<sin(phi1-phi2-phi3)>} | |
6012 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(6.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6013 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6014 | // w_{<4>} * w{<cos(phi1)>} | |
6015 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(7.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6016 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
6017 | // w_{<4>} * w{<sin(phi1)>} | |
6018 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(8.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6019 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
6020 | // w_{<4>} * w{<cos(phi1+phi2)>} | |
6021 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(9.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6022 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6023 | // w_{<4>} * w{<sin(phi1+phi2)>} | |
6024 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(10.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6025 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6026 | // w_{<4>} * w{<cos(phi1-phi2-phi3)>} | |
6027 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(11.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6028 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6029 | // w_{<4>} * w{<sin(phi1-phi2-phi3)>} | |
6030 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(12.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6031 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6032 | // w_{<cos(phi1)>} * w{<cos(phi1+phi2)>} | |
6033 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(13.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6034 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6035 | // w_{<cos(phi1)>} * w{<sin(phi1+phi2)>} | |
6036 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(14.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6037 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6038 | // w_{<cos(phi1)>} * w{<cos(phi1-phi2-phi3)>} | |
6039 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(15.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6040 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6041 | // w_{<cos(phi1)>} * w{<sin(phi1-phi2-phi3)>} | |
6042 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(16.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6043 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6044 | // w_{<sin(phi1)>} * w{<cos(phi1+phi2)>} | |
6045 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(17.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6046 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6047 | // w_{<sin(phi1)>} * w{<sin(phi1+phi2)>} | |
6048 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(18.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6049 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6050 | // w_{<sin(phi1)>} * w{<cos(phi1-phi2-phi3)>} | |
6051 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(19.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6052 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6053 | // w_{<sin(phi1)>} * w{<sin(phi1-phi2-phi3)>} | |
6054 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(20.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6055 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6056 | // w_{<cos(phi1+phi2)>} * w{<sin(phi1+phi2))>} | |
6057 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(21.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)* | |
6058 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6059 | // w_{<cos(phi1+phi2)>} * w{<cos(phi1-phi2-phi3)>} | |
6060 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(22.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)* | |
6061 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6062 | // w_{<cos(phi1+phi2)>} * w{<sin(phi1-phi2-phi3)>} | |
6063 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(23.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)* | |
6064 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6065 | // w_{<sin(phi1+phi2)>} * w{<cos(phi1-phi2-phi3)>} | |
6066 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(24.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)* | |
6067 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6068 | // w_{<sin(phi1+phi2)>} * w{<sin(phi1-phi2-phi3)>} | |
6069 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(25.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)* | |
6070 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6071 | // w_{<cos(phi1-phi2-phi3)>} * w{<sin(phi1-phi2-phi3)>} | |
6072 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(26.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)* | |
6073 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6074 | ||
6075 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowIntFlowSumOfProductOfEventWeightsNUA() | |
489d5531 | 6076 | |
489d5531 | 6077 | //================================================================================================================================ |
6078 | ||
489d5531 | 6079 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelations(TString type, TString ptOrEta) |
6080 | { | |
1268c371 | 6081 | // Calculate reduced correlations for RPs or POIs for all pt and eta bins. |
489d5531 | 6082 | |
1268c371 | 6083 | // Multiplicity: |
6084 | Double_t dMult = (*fSpk)(0,0); | |
489d5531 | 6085 | |
6086 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
6087 | Double_t dReQ1n = (*fReQ)(0,0); | |
6088 | Double_t dReQ2n = (*fReQ)(1,0); | |
6089 | //Double_t dReQ3n = (*fReQ)(2,0); | |
6090 | //Double_t dReQ4n = (*fReQ)(3,0); | |
6091 | Double_t dImQ1n = (*fImQ)(0,0); | |
6092 | Double_t dImQ2n = (*fImQ)(1,0); | |
6093 | //Double_t dImQ3n = (*fImQ)(2,0); | |
6094 | //Double_t dImQ4n = (*fImQ)(3,0); | |
6095 | ||
6096 | // reduced correlations are stored in fDiffFlowCorrelationsPro[0=RP,1=POI][0=pt,1=eta][correlation index]. Correlation index runs as follows: | |
6097 | // | |
6098 | // 0: <<2'>> | |
6099 | // 1: <<4'>> | |
6100 | // 2: <<6'>> | |
6101 | // 3: <<8'>> | |
6102 | ||
2a98ceb8 | 6103 | Int_t t = 0; // type flag |
6104 | Int_t pe = 0; // ptEta flag | |
489d5531 | 6105 | |
6106 | if(type == "RP") | |
6107 | { | |
6108 | t = 0; | |
6109 | } else if(type == "POI") | |
6110 | { | |
6111 | t = 1; | |
6112 | } | |
6113 | ||
6114 | if(ptOrEta == "Pt") | |
6115 | { | |
6116 | pe = 0; | |
6117 | } else if(ptOrEta == "Eta") | |
6118 | { | |
6119 | pe = 1; | |
6120 | } | |
6121 | ||
6122 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
6123 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
6124 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
6125 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
6126 | ||
6127 | // looping over all bins and calculating reduced correlations: | |
6128 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6129 | { | |
6130 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
6131 | Double_t p1n0kRe = 0.; | |
6132 | Double_t p1n0kIm = 0.; | |
6133 | ||
6134 | // number of POIs in particular pt or eta bin: | |
6135 | Double_t mp = 0.; | |
6136 | ||
6137 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
6138 | Double_t q1n0kRe = 0.; | |
6139 | Double_t q1n0kIm = 0.; | |
6140 | Double_t q2n0kRe = 0.; | |
6141 | Double_t q2n0kIm = 0.; | |
6142 | ||
6143 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
6144 | Double_t mq = 0.; | |
6145 | ||
6146 | if(type == "POI") | |
6147 | { | |
6148 | // q_{m*n,0}: | |
6149 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
6150 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
6151 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
6152 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
6153 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
6154 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
6155 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
6156 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
6157 | ||
6158 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
6159 | } | |
6160 | else if(type == "RP") | |
6161 | { | |
6162 | // q_{m*n,0}: | |
6163 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
6164 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
6165 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
6166 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
6167 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
6168 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
6169 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
6170 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
6171 | ||
6172 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
6173 | } | |
6174 | ||
6175 | if(type == "POI") | |
6176 | { | |
6177 | // p_{m*n,0}: | |
6178 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
6179 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
6180 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
6181 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
6182 | ||
6183 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
6184 | ||
6185 | t = 1; // typeFlag = RP or POI | |
6186 | } | |
6187 | else if(type == "RP") | |
6188 | { | |
6189 | // p_{m*n,0} = q_{m*n,0}: | |
6190 | p1n0kRe = q1n0kRe; | |
6191 | p1n0kIm = q1n0kIm; | |
6192 | ||
6193 | mp = mq; | |
6194 | ||
6195 | t = 0; // typeFlag = RP or POI | |
6196 | } | |
6197 | ||
1268c371 | 6198 | // 2'-particle correlation for particular pt or eta bin: |
489d5531 | 6199 | Double_t two1n1nPtEta = 0.; |
b40a910e | 6200 | Double_t mWeight2pPrime = 0.; // multiplicity weight for <2'> |
489d5531 | 6201 | if(mp*dMult-mq) |
6202 | { | |
6203 | two1n1nPtEta = (p1n0kRe*dReQ1n+p1n0kIm*dImQ1n-mq) | |
6204 | / (mp*dMult-mq); | |
b40a910e | 6205 | // determine multiplicity weight: |
6206 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
6207 | { | |
6208 | mWeight2pPrime = mp*dMult-mq; | |
6209 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
6210 | { | |
6211 | mWeight2pPrime = 1.; | |
6212 | } | |
489d5531 | 6213 | if(type == "POI") // to be improved (I do not this if) |
6214 | { | |
6215 | // fill profile to get <<2'>> for POIs | |
b40a910e | 6216 | fDiffFlowCorrelationsPro[1][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta,mWeight2pPrime); |
6217 | // fill profile to get <<2'>^2> for POIs | |
6218 | fDiffFlowSquaredCorrelationsPro[1][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta*two1n1nPtEta,mWeight2pPrime); | |
489d5531 | 6219 | // histogram to store <2'> for POIs e-b-e (needed in some other methods): |
6220 | fDiffFlowCorrelationsEBE[1][pe][0]->SetBinContent(b,two1n1nPtEta); | |
b40a910e | 6221 | fDiffFlowEventWeightsForCorrelationsEBE[1][pe][0]->SetBinContent(b,mWeight2pPrime); |
489d5531 | 6222 | } |
6223 | else if(type == "RP") // to be improved (I do not this if) | |
6224 | { | |
6225 | // profile to get <<2'>> for RPs: | |
b40a910e | 6226 | fDiffFlowCorrelationsPro[0][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta,mWeight2pPrime); |
6227 | // profile to get <<2'>^2> for RPs: | |
6228 | fDiffFlowSquaredCorrelationsPro[0][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta*two1n1nPtEta,mWeight2pPrime); | |
489d5531 | 6229 | // histogram to store <2'> for RPs e-b-e (needed in some other methods): |
6230 | fDiffFlowCorrelationsEBE[0][pe][0]->SetBinContent(b,two1n1nPtEta); | |
b40a910e | 6231 | fDiffFlowEventWeightsForCorrelationsEBE[0][pe][0]->SetBinContent(b,mWeight2pPrime); |
489d5531 | 6232 | } |
6233 | } // end of if(mp*dMult-mq) | |
6234 | ||
6235 | // 4'-particle correlation: | |
6236 | Double_t four1n1n1n1nPtEta = 0.; | |
b40a910e | 6237 | Double_t mWeight4pPrime = 0.; // multiplicity weight for <4'> |
489d5531 | 6238 | if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) |
6239 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression) | |
6240 | { | |
6241 | four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
6242 | - q2n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) | |
6243 | - 2.*q2n0kIm*dReQ1n*dImQ1n | |
6244 | - p1n0kRe*(dReQ1n*dReQ2n+dImQ1n*dImQ2n) | |
6245 | + p1n0kIm*(dImQ1n*dReQ2n-dReQ1n*dImQ2n) | |
6246 | - 2.*dMult*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
6247 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*mq | |
6248 | + 6.*(q1n0kRe*dReQ1n+q1n0kIm*dImQ1n) | |
6249 | + 1.*(q2n0kRe*dReQ2n+q2n0kIm*dImQ2n) | |
6250 | + 2.*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
6251 | + 2.*mq*dMult | |
6252 | - 6.*mq) | |
6253 | / ((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6254 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b40a910e | 6255 | // determine multiplicity weight: |
6256 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
6257 | { | |
6258 | mWeight4pPrime = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
6259 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
6260 | { | |
6261 | mWeight4pPrime = 1.; | |
6262 | } | |
489d5531 | 6263 | if(type == "POI") |
6264 | { | |
6265 | // profile to get <<4'>> for POIs: | |
b40a910e | 6266 | fDiffFlowCorrelationsPro[1][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta,mWeight4pPrime); |
6267 | // profile to get <<4'>^2> for POIs: | |
6268 | fDiffFlowSquaredCorrelationsPro[1][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta*four1n1n1n1nPtEta,mWeight4pPrime); | |
489d5531 | 6269 | // histogram to store <4'> for POIs e-b-e (needed in some other methods): |
6270 | fDiffFlowCorrelationsEBE[1][pe][1]->SetBinContent(b,four1n1n1n1nPtEta); | |
b40a910e | 6271 | fDiffFlowEventWeightsForCorrelationsEBE[1][pe][1]->SetBinContent(b,mWeight4pPrime); |
489d5531 | 6272 | } |
6273 | else if(type == "RP") | |
6274 | { | |
6275 | // profile to get <<4'>> for RPs: | |
b40a910e | 6276 | fDiffFlowCorrelationsPro[0][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta,mWeight4pPrime); |
6277 | // profile to get <<4'>^2> for RPs: | |
6278 | fDiffFlowSquaredCorrelationsPro[0][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta*four1n1n1n1nPtEta,mWeight4pPrime); | |
489d5531 | 6279 | // histogram to store <4'> for RPs e-b-e (needed in some other methods): |
6280 | fDiffFlowCorrelationsEBE[0][pe][1]->SetBinContent(b,four1n1n1n1nPtEta); | |
b40a910e | 6281 | fDiffFlowEventWeightsForCorrelationsEBE[0][pe][1]->SetBinContent(b,mWeight4pPrime); |
489d5531 | 6282 | } |
6283 | } // end of if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6284 | // +mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
6285 | ||
6286 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6287 | ||
6288 | ||
6289 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelations(TString type, TString ptOrEta); | |
6290 | ||
489d5531 | 6291 | //================================================================================================================================ |
6292 | ||
1268c371 | 6293 | void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCorrelations(TString type) |
6294 | { | |
6295 | // Calculate all reduced correlations needed for 2D differential flow for each (pt,eta) bin. | |
6296 | ||
6297 | // Multiplicity: | |
6298 | Double_t dMult = (*fSpk)(0,0); | |
6299 | // Real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
6300 | Double_t dReQ1n = (*fReQ)(0,0); | |
6301 | Double_t dReQ2n = (*fReQ)(1,0); | |
6302 | //Double_t dReQ3n = (*fReQ)(2,0); | |
6303 | //Double_t dReQ4n = (*fReQ)(3,0); | |
6304 | Double_t dImQ1n = (*fImQ)(0,0); | |
6305 | Double_t dImQ2n = (*fImQ)(1,0); | |
6306 | //Double_t dImQ3n = (*fImQ)(2,0); | |
6307 | //Double_t dImQ4n = (*fImQ)(3,0); | |
6308 | ||
6309 | // 2D reduced correlations are stored in TProfile2D f2DDiffFlowCorrelationsPro[0=RP,1=POI][correlation index]. | |
6310 | // Correlation index runs as follows: | |
6311 | // 0: <<2'>> | |
6312 | // 1: <<4'>> | |
6313 | // 2: <<6'>> | |
6314 | // 3: <<8'>> | |
6315 | ||
6316 | Int_t t = 0; // type flag | |
6317 | if(type == "RP") | |
6318 | { | |
6319 | t = 0; | |
6320 | } else if(type == "POI") | |
6321 | { | |
6322 | t = 1; | |
6323 | } | |
6324 | ||
6325 | // Looping over all (pt,eta) bins and calculating correlations needed for differential flow: | |
6326 | for(Int_t p=1;p<=fnBinsPt;p++) | |
6327 | { | |
6328 | for(Int_t e=1;e<=fnBinsEta;e++) | |
6329 | { | |
6330 | // Real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): | |
6331 | Double_t p1n0kRe = 0.; | |
6332 | Double_t p1n0kIm = 0.; | |
6333 | // Number of POIs in particular pt or eta bin: | |
6334 | Double_t mp = 0.; | |
6335 | // Real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for 'RP && POI particles' in particular pt or eta bin): | |
6336 | Double_t q1n0kRe = 0.; | |
6337 | Double_t q1n0kIm = 0.; | |
6338 | Double_t q2n0kRe = 0.; | |
6339 | Double_t q2n0kIm = 0.; | |
6340 | // Number of 'RP && POI particles' in particular pt or eta bin: | |
6341 | Double_t mq = 0.; | |
6342 | if(type == "POI") | |
6343 | { | |
6344 | // q_{m*n,0}: | |
6345 | q1n0kRe = fReRPQ2dEBE[2][0][0]->GetBinContent(fReRPQ2dEBE[2][0][0]->GetBin(p,e)) | |
6346 | * fReRPQ2dEBE[2][0][0]->GetBinEntries(fReRPQ2dEBE[2][0][0]->GetBin(p,e)); | |
6347 | q1n0kIm = fImRPQ2dEBE[2][0][0]->GetBinContent(fImRPQ2dEBE[2][0][0]->GetBin(p,e)) | |
6348 | * fImRPQ2dEBE[2][0][0]->GetBinEntries(fImRPQ2dEBE[2][0][0]->GetBin(p,e)); | |
6349 | q2n0kRe = fReRPQ2dEBE[2][1][0]->GetBinContent(fReRPQ2dEBE[2][1][0]->GetBin(p,e)) | |
6350 | * fReRPQ2dEBE[2][1][0]->GetBinEntries(fReRPQ2dEBE[2][1][0]->GetBin(p,e)); | |
6351 | q2n0kIm = fImRPQ2dEBE[2][1][0]->GetBinContent(fImRPQ2dEBE[2][1][0]->GetBin(p,e)) | |
6352 | * fImRPQ2dEBE[2][1][0]->GetBinEntries(fImRPQ2dEBE[2][1][0]->GetBin(p,e)); | |
6353 | // m_{q}: | |
6354 | mq = fReRPQ2dEBE[2][0][0]->GetBinEntries(fReRPQ2dEBE[2][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) | |
6355 | } // end of if(type == "POI") | |
6356 | else if(type == "RP") | |
6357 | { | |
6358 | // q_{m*n,0}: | |
6359 | q1n0kRe = fReRPQ2dEBE[0][0][0]->GetBinContent(fReRPQ2dEBE[0][0][0]->GetBin(p,e)) | |
6360 | * fReRPQ2dEBE[0][0][0]->GetBinEntries(fReRPQ2dEBE[0][0][0]->GetBin(p,e)); | |
6361 | q1n0kIm = fImRPQ2dEBE[0][0][0]->GetBinContent(fImRPQ2dEBE[0][0][0]->GetBin(p,e)) | |
6362 | * fImRPQ2dEBE[0][0][0]->GetBinEntries(fImRPQ2dEBE[0][0][0]->GetBin(p,e)); | |
6363 | q2n0kRe = fReRPQ2dEBE[0][1][0]->GetBinContent(fReRPQ2dEBE[0][1][0]->GetBin(p,e)) | |
6364 | * fReRPQ2dEBE[0][1][0]->GetBinEntries(fReRPQ2dEBE[0][1][0]->GetBin(p,e)); | |
6365 | q2n0kIm = fImRPQ2dEBE[0][1][0]->GetBinContent(fImRPQ2dEBE[0][1][0]->GetBin(p,e)) | |
6366 | * fImRPQ2dEBE[0][1][0]->GetBinEntries(fImRPQ2dEBE[0][1][0]->GetBin(p,e)); | |
6367 | // m_{q}: | |
6368 | mq = fReRPQ2dEBE[0][0][0]->GetBinEntries(fReRPQ2dEBE[0][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) | |
6369 | } // end of else if(type == "RP") | |
6370 | if(type == "POI") | |
6371 | { | |
6372 | // p_{m*n,0}: | |
6373 | p1n0kRe = fReRPQ2dEBE[1][0][0]->GetBinContent(fReRPQ2dEBE[1][0][0]->GetBin(p,e)) | |
6374 | * fReRPQ2dEBE[1][0][0]->GetBinEntries(fReRPQ2dEBE[1][0][0]->GetBin(p,e)); | |
6375 | p1n0kIm = fImRPQ2dEBE[1][0][0]->GetBinContent(fImRPQ2dEBE[1][0][0]->GetBin(p,e)) | |
6376 | * fImRPQ2dEBE[1][0][0]->GetBinEntries(fImRPQ2dEBE[1][0][0]->GetBin(p,e)); | |
6377 | // m_{p} | |
6378 | mp = fReRPQ2dEBE[1][0][0]->GetBinEntries(fReRPQ2dEBE[1][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) | |
6379 | ||
6380 | t = 1; // typeFlag = RP or POI | |
6381 | } // end of if(type == "POI") | |
6382 | else if(type == "RP") | |
6383 | { | |
6384 | // p_{m*n,0} = q_{m*n,0}: | |
6385 | p1n0kRe = q1n0kRe; | |
6386 | p1n0kIm = q1n0kIm; | |
6387 | // m_{p} = m_{q}: | |
6388 | mp = mq; | |
6389 | ||
6390 | t = 0; // typeFlag = RP or POI | |
6391 | } // end of if(type == "RP") | |
6392 | ||
6393 | // 2'-particle correlation for particular (pt,eta) bin: | |
6394 | Double_t two1n1nPtEta = 0.; | |
6395 | Double_t mWeight2pPrime = 0.; // multiplicity weight for <2'> | |
6396 | if(mp*dMult-mq) | |
6397 | { | |
6398 | two1n1nPtEta = (p1n0kRe*dReQ1n+p1n0kIm*dImQ1n-mq) | |
6399 | / (mp*dMult-mq); | |
6400 | // Determine multiplicity weight: | |
6401 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
6402 | { | |
6403 | mWeight2pPrime = mp*dMult-mq; | |
6404 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
6405 | { | |
6406 | mWeight2pPrime = 1.; | |
6407 | } | |
6408 | // Fill 2D profile holding <<2'>>: | |
6409 | f2DDiffFlowCorrelationsPro[t][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mWeight2pPrime); | |
6410 | } // end of if(mp*dMult-mq) | |
6411 | ||
6412 | // 4'-particle correlation: | |
6413 | Double_t four1n1n1n1nPtEta = 0.; | |
6414 | Double_t mWeight4pPrime = 0.; // multiplicity weight for <4'> | |
6415 | if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6416 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression) | |
6417 | { | |
6418 | four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
6419 | - q2n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) | |
6420 | - 2.*q2n0kIm*dReQ1n*dImQ1n | |
6421 | - p1n0kRe*(dReQ1n*dReQ2n+dImQ1n*dImQ2n) | |
6422 | + p1n0kIm*(dImQ1n*dReQ2n-dReQ1n*dImQ2n) | |
6423 | - 2.*dMult*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
6424 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*mq | |
6425 | + 6.*(q1n0kRe*dReQ1n+q1n0kIm*dImQ1n) | |
6426 | + 1.*(q2n0kRe*dReQ2n+q2n0kIm*dImQ2n) | |
6427 | + 2.*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
6428 | + 2.*mq*dMult | |
6429 | - 6.*mq) | |
6430 | / ((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6431 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
6432 | // Determine multiplicity weight: | |
6433 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
6434 | { | |
6435 | mWeight4pPrime = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
6436 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
6437 | { | |
6438 | mWeight4pPrime = 1.; | |
6439 | } | |
6440 | // Fill 2D profile holding <<4'>>: | |
6441 | f2DDiffFlowCorrelationsPro[t][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta,mWeight4pPrime); | |
6442 | } // end of if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6443 | // +mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
6444 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
6445 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
6446 | ||
6447 | } // end of AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCorrelations(TString type) | |
6448 | ||
6449 | //================================================================================================================================ | |
6450 | ||
489d5531 | 6451 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfEventWeights(TString type, TString ptOrEta) |
6452 | { | |
6453 | // Calculate sums of various event weights for reduced correlations. | |
6454 | // (These quantitites are needed in expressions for unbiased estimators relevant for the statistical errors.) | |
6455 | ||
2a98ceb8 | 6456 | Int_t typeFlag = 0; |
6457 | Int_t ptEtaFlag = 0; | |
489d5531 | 6458 | |
6459 | if(type == "RP") | |
6460 | { | |
6461 | typeFlag = 0; | |
6462 | } else if(type == "POI") | |
6463 | { | |
6464 | typeFlag = 1; | |
6465 | } | |
6466 | ||
6467 | if(ptOrEta == "Pt") | |
6468 | { | |
6469 | ptEtaFlag = 0; | |
6470 | } else if(ptOrEta == "Eta") | |
6471 | { | |
6472 | ptEtaFlag = 1; | |
6473 | } | |
6474 | ||
6475 | // shortcuts: | |
6476 | Int_t t = typeFlag; | |
6477 | Int_t pe = ptEtaFlag; | |
6478 | ||
6479 | // binning: | |
6480 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
6481 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
6482 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
6483 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
6484 | ||
6485 | for(Int_t rpq=0;rpq<3;rpq++) | |
6486 | { | |
6487 | for(Int_t m=0;m<4;m++) | |
6488 | { | |
6489 | for(Int_t k=0;k<9;k++) | |
6490 | { | |
6491 | if(!fReRPQ1dEBE[rpq][pe][m][k]) | |
6492 | { | |
6493 | cout<<"WARNING: fReRPQ1dEBE[rpq][pe][m][k] is NULL in AFAWQC::CSAPOEWFDF() !!!!"<<endl; | |
6494 | cout<<"pe = "<<pe<<endl; | |
6495 | cout<<"rpq = "<<rpq<<endl; | |
6496 | cout<<"m = "<<m<<endl; | |
6497 | cout<<"k = "<<k<<endl; | |
6498 | exit(0); | |
6499 | } | |
6500 | } | |
6501 | } | |
6502 | } | |
6503 | ||
6504 | // multiplicities: | |
1268c371 | 6505 | Double_t dMult = (*fSpk)(0,0); // total event multiplicity |
489d5531 | 6506 | //Double_t mr = 0.; // number of RPs in particular pt or eta bin |
6507 | Double_t mp = 0.; // number of POIs in particular pt or eta bin | |
6508 | Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin | |
6509 | ||
6510 | // event weights for reduced correlations: | |
6511 | Double_t dw2 = 0.; // event weight for <2'> | |
6512 | Double_t dw4 = 0.; // event weight for <4'> | |
6513 | //Double_t dw6 = 0.; // event weight for <6'> | |
6514 | //Double_t dw8 = 0.; // event weight for <8'> | |
6515 | ||
6516 | // looping over bins: | |
6517 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6518 | { | |
6519 | if(type == "RP") | |
6520 | { | |
6521 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b); | |
6522 | mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow | |
6523 | } else if(type == "POI") | |
6524 | { | |
6525 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b); | |
6526 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); | |
6527 | } | |
6528 | ||
6529 | // event weight for <2'>: | |
6530 | dw2 = mp*dMult-mq; | |
6531 | fDiffFlowSumOfEventWeights[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2); | |
6532 | fDiffFlowSumOfEventWeights[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw2,2.)); | |
6533 | ||
6534 | // event weight for <4'>: | |
6535 | dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6536 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
6537 | fDiffFlowSumOfEventWeights[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4); | |
6538 | fDiffFlowSumOfEventWeights[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw4,2.)); | |
6539 | ||
6540 | // event weight for <6'>: | |
6541 | //dw6 = ...; | |
6542 | //fDiffFlowSumOfEventWeights[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6); | |
6543 | //fDiffFlowSumOfEventWeights[t][pe][t][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw6,2.)); | |
6544 | ||
6545 | // event weight for <8'>: | |
6546 | //dw8 = ...; | |
6547 | //fDiffFlowSumOfEventWeights[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw8); | |
6548 | //fDiffFlowSumOfEventWeights[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw8,2.)); | |
6549 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6550 | ||
6551 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfEventWeights() | |
6552 | ||
6553 | ||
6554 | //================================================================================================================================ | |
6555 | ||
6556 | ||
6557 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfProductOfEventWeights(TString type, TString ptOrEta) | |
6558 | { | |
6559 | // Calculate sum of products of various event weights for both types of correlations (the ones for int. and diff. flow). | |
6560 | // (These quantitites are needed in expressions for unbiased estimators relevant for the statistical errors.) | |
6561 | // | |
6562 | // Important: To fill fDiffFlowSumOfProductOfEventWeights[][][][] use bellow table (i,j) with following constraints: | |
6563 | // 1.) i<j | |
6564 | // 2.) do not store terms which DO NOT include reduced correlations; | |
6565 | // Table: | |
6566 | // [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] x [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] | |
6567 | ||
2a98ceb8 | 6568 | Int_t typeFlag = 0; |
6569 | Int_t ptEtaFlag = 0; | |
489d5531 | 6570 | |
6571 | if(type == "RP") | |
6572 | { | |
6573 | typeFlag = 0; | |
6574 | } else if(type == "POI") | |
6575 | { | |
6576 | typeFlag = 1; | |
6577 | } | |
6578 | ||
6579 | if(ptOrEta == "Pt") | |
6580 | { | |
6581 | ptEtaFlag = 0; | |
6582 | } else if(ptOrEta == "Eta") | |
6583 | { | |
6584 | ptEtaFlag = 1; | |
6585 | } | |
6586 | ||
6587 | // shortcuts: | |
6588 | Int_t t = typeFlag; | |
6589 | Int_t pe = ptEtaFlag; | |
6590 | ||
6591 | // binning: | |
6592 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
6593 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
6594 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
6595 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
6596 | ||
6597 | // protection: | |
6598 | for(Int_t rpq=0;rpq<3;rpq++) | |
6599 | { | |
6600 | for(Int_t m=0;m<4;m++) | |
6601 | { | |
6602 | for(Int_t k=0;k<9;k++) | |
6603 | { | |
6604 | if(!fReRPQ1dEBE[rpq][pe][m][k]) | |
6605 | { | |
6606 | cout<<"WARNING: fReRPQ1dEBE[rpq][pe][m][k] is NULL in AFAWQC::CSAPOEWFDF() !!!!"<<endl; | |
6607 | cout<<"pe = "<<pe<<endl; | |
6608 | cout<<"rpq = "<<rpq<<endl; | |
6609 | cout<<"m = "<<m<<endl; | |
6610 | cout<<"k = "<<k<<endl; | |
6611 | exit(0); | |
6612 | } | |
6613 | } | |
6614 | } | |
6615 | } | |
6616 | ||
6617 | // multiplicities: | |
1268c371 | 6618 | Double_t dMult = (*fSpk)(0,0); // total event multiplicity |
489d5531 | 6619 | //Double_t mr = 0.; // number of RPs in particular pt or eta bin |
6620 | Double_t mp = 0.; // number of POIs in particular pt or eta bin | |
6621 | Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin | |
6622 | ||
6623 | // event weights for correlations: | |
6624 | Double_t dW2 = dMult*(dMult-1); // event weight for <2> | |
6625 | Double_t dW4 = dMult*(dMult-1)*(dMult-2)*(dMult-3); // event weight for <4> | |
6626 | Double_t dW6 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5); // event weight for <6> | |
6627 | Double_t dW8 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)*(dMult-6)*(dMult-7); // event weight for <8> | |
6628 | ||
6629 | // event weights for reduced correlations: | |
6630 | Double_t dw2 = 0.; // event weight for <2'> | |
6631 | Double_t dw4 = 0.; // event weight for <4'> | |
6632 | //Double_t dw6 = 0.; // event weight for <6'> | |
6633 | //Double_t dw8 = 0.; // event weight for <8'> | |
6634 | ||
6635 | // looping over bins: | |
6636 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6637 | { | |
6638 | if(type == "RP") | |
6639 | { | |
6640 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b); | |
6641 | mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow | |
6642 | } else if(type == "POI") | |
6643 | { | |
6644 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b); | |
6645 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); | |
6646 | } | |
6647 | ||
6648 | // event weight for <2'>: | |
6649 | dw2 = mp*dMult-mq; | |
6650 | fDiffFlowSumOfProductOfEventWeights[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw2); // storing product of even weights for <2> and <2'> | |
6651 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW4); // storing product of even weights for <4> and <2'> | |
6652 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW6); // storing product of even weights for <6> and <2'> | |
6653 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW8); // storing product of even weights for <8> and <2'> | |
6654 | ||
6655 | // event weight for <4'>: | |
6656 | dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6657 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
6658 | fDiffFlowSumOfProductOfEventWeights[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw4); // storing product of even weights for <2> and <4'> | |
6659 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw4); // storing product of even weights for <2'> and <4'> | |
6660 | fDiffFlowSumOfProductOfEventWeights[t][pe][2][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw4); // storing product of even weights for <4> and <4'> | |
6661 | fDiffFlowSumOfProductOfEventWeights[t][pe][3][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dW6); // storing product of even weights for <6> and <4'> | |
6662 | fDiffFlowSumOfProductOfEventWeights[t][pe][3][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dW8); // storing product of even weights for <8> and <4'> | |
6663 | ||
6664 | // event weight for <6'>: | |
6665 | //dw6 = ...; | |
6666 | //fDiffFlowSumOfProductOfEventWeights[t][pe][0][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw6); // storing product of even weights for <2> and <6'> | |
6667 | //fDiffFlowSumOfProductOfEventWeights[t][pe][1][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw6); // storing product of even weights for <2'> and <6'> | |
6668 | //fDiffFlowSumOfProductOfEventWeights[t][pe][2][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw6); // storing product of even weights for <4> and <6'> | |
6669 | //fDiffFlowSumOfProductOfEventWeights[t][pe][3][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dw6); // storing product of even weights for <4'> and <6'> | |
6670 | //fDiffFlowSumOfProductOfEventWeights[t][pe][4][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW6*dw6); // storing product of even weights for <6> and <6'> | |
6671 | //fDiffFlowSumOfProductOfEventWeights[t][pe][5][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dW8); // storing product of even weights for <6'> and <8> | |
6672 | //fDiffFlowSumOfProductOfEventWeights[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dw8); // storing product of even weights for <6'> and <8'> | |
6673 | ||
6674 | // event weight for <8'>: | |
6675 | //dw8 = ...; | |
6676 | //fDiffFlowSumOfProductOfEventWeights[t][pe][0][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw8); // storing product of even weights for <2> and <8'> | |
6677 | //fDiffFlowSumOfProductOfEventWeights[t][pe][1][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw8); // storing product of even weights for <2'> and <8'> | |
6678 | //fDiffFlowSumOfProductOfEventWeights[t][pe][2][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw8); // storing product of even weights for <4> and <8'> | |
6679 | //fDiffFlowSumOfProductOfEventWeights[t][pe][3][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dw8); // storing product of even weights for <4'> and <8'> | |
6680 | //fDiffFlowSumOfProductOfEventWeights[t][pe][4][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW6*dw8); // storing product of even weights for <6> and <8'> | |
6681 | //fDiffFlowSumOfProductOfEventWeights[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dw8); // storing product of even weights for <6'> and <8'> | |
6682 | //fDiffFlowSumOfProductOfEventWeights[t][pe][6][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW8*dw8); // storing product of even weights for <8> and <8'> | |
6683 | ||
6684 | // Table: | |
6685 | // [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] x [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] | |
6686 | ||
6687 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6688 | ||
6689 | ||
6690 | ||
6691 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfProductOfEventWeights(TString type, TString ptOrEta) | |
6692 | ||
489d5531 | 6693 | //================================================================================================================================ |
6694 | ||
489d5531 | 6695 | void AliFlowAnalysisWithQCumulants::FinalizeReducedCorrelations(TString type, TString ptOrEta) |
6696 | { | |
6697 | // Transfer profiles into histograms and calculate statistical errors correctly. | |
6698 | ||
1268c371 | 6699 | Int_t t = 0; // RP or POI |
6700 | Int_t pe = 0; // pt or eta | |
489d5531 | 6701 | |
6702 | if(type == "RP") | |
6703 | { | |
1268c371 | 6704 | t = 0; |
489d5531 | 6705 | } else if(type == "POI") |
6706 | { | |
1268c371 | 6707 | t = 1; |
489d5531 | 6708 | } |
6709 | ||
6710 | if(ptOrEta == "Pt") | |
6711 | { | |
1268c371 | 6712 | pe = 0; |
489d5531 | 6713 | } else if(ptOrEta == "Eta") |
6714 | { | |
1268c371 | 6715 | pe = 1; |
489d5531 | 6716 | } |
1268c371 | 6717 | |
6718 | for(Int_t rci=0;rci<4;rci++) // to be improved - moved into the method CheckPointersUsedInFinish() | |
489d5531 | 6719 | { |
6720 | if(!fDiffFlowCorrelationsPro[t][pe][rci]) | |
6721 | { | |
6722 | cout<<"WARNING: fDiffFlowCorrelationsPro[t][pe][rci] is NULL in AFAWQC::FRC() !!!!"<<endl; | |
6723 | cout<<"t = "<<t<<endl; | |
6724 | cout<<"pe = "<<pe<<endl; | |
6725 | cout<<"rci = "<<rci<<endl; | |
6726 | exit(0); | |
6727 | } | |
b40a910e | 6728 | if(!fDiffFlowSquaredCorrelationsPro[t][pe][rci]) |
6729 | { | |
6730 | cout<<"WARNING: fDiffFlowSquaredCorrelationsPro[t][pe][rci] is NULL in AFAWQC::FRC() !!!!"<<endl; | |
6731 | cout<<"t = "<<t<<endl; | |
6732 | cout<<"pe = "<<pe<<endl; | |
6733 | cout<<"rci = "<<rci<<endl; | |
6734 | exit(0); | |
6735 | } | |
489d5531 | 6736 | for(Int_t power=0;power<2;power++) |
6737 | { | |
6738 | if(!fDiffFlowSumOfEventWeights[t][pe][power][rci]) | |
6739 | { | |
6740 | cout<<"WARNING: fDiffFlowSumOfEventWeights[t][pe][power][rci] is NULL in AFAWQC::FRC() !!!!"<<endl; | |
6741 | cout<<"t = "<<t<<endl; | |
6742 | cout<<"pe = "<<pe<<endl; | |
6743 | cout<<"power = "<<power<<endl; | |
6744 | cout<<"rci = "<<rci<<endl; | |
6745 | exit(0); | |
6746 | } | |
6747 | } // end of for(Int_t power=0;power<2;power++) | |
6748 | } // end of for(Int_t rci=0;rci<4;rci++) | |
6749 | ||
6750 | // common: | |
b40a910e | 6751 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
489d5531 | 6752 | // transfer 1D profile into 1D histogram: |
6753 | Double_t correlation = 0.; | |
b40a910e | 6754 | Double_t squaredCorrelation = 0.; |
489d5531 | 6755 | Double_t spread = 0.; |
6756 | Double_t sumOfWeights = 0.; // sum of weights for particular reduced correlations for particular pt or eta bin | |
6757 | Double_t sumOfSquaredWeights = 0.; // sum of squared weights for particular reduced correlations for particular pt or eta bin | |
6758 | Double_t error = 0.; // error = termA * spread * termB | |
6759 | // termA = (sqrt(sumOfSquaredWeights)/sumOfWeights) | |
6760 | // termB = 1/pow(1-termA^2,0.5) | |
6761 | Double_t termA = 0.; | |
6762 | Double_t termB = 0.; | |
6763 | for(Int_t rci=0;rci<4;rci++) // index of reduced correlation | |
6764 | { | |
6765 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) // number of pt or eta bins | |
6766 | { | |
b40a910e | 6767 | if(fDiffFlowCorrelationsPro[t][pe][rci]->GetBinEffectiveEntries(b) < 2 || |
6768 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->GetBinEffectiveEntries(b) < 2) | |
6769 | { | |
6770 | fDiffFlowCorrelationsPro[t][pe][rci]->SetBinError(b,0.); | |
6771 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->SetBinError(b,0.); | |
6772 | continue; // to be improved - should I ignore results in pt bins with one entry for reduced correlations or not? | |
6773 | } | |
489d5531 | 6774 | correlation = fDiffFlowCorrelationsPro[t][pe][rci]->GetBinContent(b); |
b40a910e | 6775 | squaredCorrelation = fDiffFlowSquaredCorrelationsPro[t][pe][rci]->GetBinContent(b); |
6776 | if(squaredCorrelation-correlation*correlation >= 0.) | |
6777 | { | |
6778 | spread = pow(squaredCorrelation-correlation*correlation,0.5); | |
6779 | } else | |
6780 | { | |
6781 | cout<<endl; | |
6782 | cout<<Form(" WARNING: Imaginary 'spread' for rci = %d, pe = %d, bin = %d !!!!",rci,pe,b)<<endl; | |
6783 | cout<<endl; | |
6784 | } | |
489d5531 | 6785 | sumOfWeights = fDiffFlowSumOfEventWeights[t][pe][0][rci]->GetBinContent(b); |
6786 | sumOfSquaredWeights = fDiffFlowSumOfEventWeights[t][pe][1][rci]->GetBinContent(b); | |
1268c371 | 6787 | if(TMath::Abs(sumOfWeights)>0.){termA = (pow(sumOfSquaredWeights,0.5)/sumOfWeights);} |
6788 | if(1.-pow(termA,2.)>0.){termB = 1./pow(1.-pow(termA,2.),0.5);} | |
489d5531 | 6789 | error = termA*spread*termB; // final error (unbiased estimator for standard deviation) |
6790 | fDiffFlowCorrelationsHist[t][pe][rci]->SetBinContent(b,correlation); | |
6791 | fDiffFlowCorrelationsHist[t][pe][rci]->SetBinError(b,error); | |
6792 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6793 | } // end of for(Int_t rci=0;rci<4;rci++) | |
6794 | ||
6795 | } // end of void AliFlowAnalysisWithQCumulants::FinalizeReducedCorrelations(TString type, TString ptOrEta) | |
6796 | ||
489d5531 | 6797 | //================================================================================================================================ |
6798 | ||
489d5531 | 6799 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowProductOfCorrelations(TString type, TString ptOrEta) |
6800 | { | |
6801 | // store products: <2><2'>, <2><4'>, <2><6'>, <2><8'>, <2'><4>, | |
6802 | // <2'><4'>, <2'><6>, <2'><6'>, <2'><8>, <2'><8'>, | |
6803 | // <4><4'>, <4><6'>, <4><8'>, <4'><6>, <4'><6'>, | |
6804 | // <4'><8>, <4'><8'>, <6><6'>, <6><8'>, <6'><8>, | |
6805 | // <6'><8'>, <8><8'>. | |
6806 | ||
2a98ceb8 | 6807 | Int_t typeFlag = 0; |
6808 | Int_t ptEtaFlag = 0; | |
489d5531 | 6809 | |
6810 | if(type == "RP") | |
6811 | { | |
6812 | typeFlag = 0; | |
6813 | } else if(type == "POI") | |
6814 | { | |
6815 | typeFlag = 1; | |
6816 | } | |
6817 | ||
6818 | if(ptOrEta == "Pt") | |
6819 | { | |
6820 | ptEtaFlag = 0; | |
6821 | } else if(ptOrEta == "Eta") | |
6822 | { | |
6823 | ptEtaFlag = 1; | |
6824 | } | |
6825 | ||
6826 | // shortcuts: | |
6827 | Int_t t = typeFlag; | |
6828 | Int_t pe = ptEtaFlag; | |
6829 | ||
6830 | // common: | |
6831 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
6832 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
6833 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
6834 | ||
6835 | // protections // to be improved (add protection for all pointers in this method) | |
6836 | if(!fIntFlowCorrelationsEBE) | |
6837 | { | |
6838 | cout<<"WARNING: fIntFlowCorrelationsEBE is NULL in AFAWQC::CDFPOC() !!!!"<<endl; | |
6839 | exit(0); | |
6840 | } | |
6841 | ||
6842 | /* | |
1268c371 | 6843 | Double_t dMult = (*fSpk)(0,0); // multiplicity (number of particles used to determine the reaction plane) |
489d5531 | 6844 | //Double_t mr = 0.; // number of RPs in particular pt or eta bin |
6845 | Double_t mp = 0.; // number of POIs in particular pt or eta bin | |
6846 | Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin | |
6847 | */ | |
6848 | ||
6849 | // e-b-e correlations: | |
6850 | Double_t twoEBE = fIntFlowCorrelationsEBE->GetBinContent(1); // <2> | |
6851 | Double_t fourEBE = fIntFlowCorrelationsEBE->GetBinContent(2); // <4> | |
6852 | Double_t sixEBE = fIntFlowCorrelationsEBE->GetBinContent(3); // <6> | |
6853 | Double_t eightEBE = fIntFlowCorrelationsEBE->GetBinContent(4); // <8> | |
6854 | ||
6855 | // event weights for correlations: | |
6856 | Double_t dW2 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1); // event weight for <2> | |
6857 | Double_t dW4 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2); // event weight for <4> | |
6858 | Double_t dW6 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(3); // event weight for <6> | |
6859 | Double_t dW8 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(4); // event weight for <8> | |
6860 | ||
6861 | // e-b-e reduced correlations: | |
6862 | Double_t twoReducedEBE = 0.; // <2'> | |
6863 | Double_t fourReducedEBE = 0.; // <4'> | |
6864 | Double_t sixReducedEBE = 0.; // <6'> | |
6865 | Double_t eightReducedEBE = 0.; // <8'> | |
6866 | ||
6867 | // event weights for reduced correlations: | |
6868 | Double_t dw2 = 0.; // event weight for <2'> | |
6869 | Double_t dw4 = 0.; // event weight for <4'> | |
6870 | //Double_t dw6 = 0.; // event weight for <6'> | |
6871 | //Double_t dw8 = 0.; // event weight for <8'> | |
6872 | ||
6873 | // looping over bins: | |
6874 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6875 | { | |
6876 | // e-b-e reduced correlations: | |
6877 | twoReducedEBE = fDiffFlowCorrelationsEBE[t][pe][0]->GetBinContent(b); | |
6878 | fourReducedEBE = fDiffFlowCorrelationsEBE[t][pe][1]->GetBinContent(b); | |
6879 | sixReducedEBE = fDiffFlowCorrelationsEBE[t][pe][2]->GetBinContent(b); | |
6880 | eightReducedEBE = fDiffFlowCorrelationsEBE[t][pe][3]->GetBinContent(b); | |
6881 | ||
6882 | /* | |
6883 | // to be improved (I should not do this here again) | |
6884 | if(type == "RP") | |
6885 | { | |
6886 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b); | |
6887 | mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow | |
6888 | } else if(type == "POI") | |
6889 | { | |
6890 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b); | |
6891 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); | |
6892 | } | |
6893 | ||
6894 | // event weights for reduced correlations: | |
6895 | dw2 = mp*dMult-mq; // weight for <2'> | |
6896 | dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6897 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); // weight for <4'> | |
6898 | //dw6 = ... | |
6899 | //dw8 = ... | |
6900 | ||
6901 | */ | |
6902 | ||
6903 | dw2 = fDiffFlowEventWeightsForCorrelationsEBE[t][pe][0]->GetBinContent(b); | |
6904 | dw4 = fDiffFlowEventWeightsForCorrelationsEBE[t][pe][1]->GetBinContent(b); | |
6905 | ||
6906 | // storing all products: | |
6907 | fDiffFlowProductOfCorrelationsPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*twoReducedEBE,dW2*dw2); // storing <2><2'> | |
6908 | fDiffFlowProductOfCorrelationsPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*twoReducedEBE,dW4*dw2); // storing <4><2'> | |
6909 | fDiffFlowProductOfCorrelationsPro[t][pe][1][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*twoReducedEBE,dW6*dw2); // storing <6><2'> | |
6910 | fDiffFlowProductOfCorrelationsPro[t][pe][1][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*twoReducedEBE,dW8*dw2); // storing <8><2'> | |
6911 | ||
6912 | // event weight for <4'>: | |
6913 | fDiffFlowProductOfCorrelationsPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*fourReducedEBE,dW2*dw4); // storing <2><4'> | |
6914 | fDiffFlowProductOfCorrelationsPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*fourReducedEBE,dw2*dw4); // storing <2'><4'> | |
6915 | fDiffFlowProductOfCorrelationsPro[t][pe][2][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*fourReducedEBE,dW4*dw4); // storing <4><4'> | |
6916 | fDiffFlowProductOfCorrelationsPro[t][pe][3][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*fourReducedEBE,dW6*dw4); // storing <6><4'> | |
6917 | fDiffFlowProductOfCorrelationsPro[t][pe][3][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*fourReducedEBE,dW8*dw4); // storing <8><4'> | |
6918 | ||
6919 | // event weight for <6'>: | |
6920 | //dw6 = ...; | |
6921 | //fDiffFlowProductOfCorrelationsPro[t][pe][0][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*sixReducedEBE,dW2*dw6); // storing <2><6'> | |
6922 | //fDiffFlowProductOfCorrelationsPro[t][pe][1][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*sixReducedEBE,dw2*dw6); // storing <2'><6'> | |
6923 | //fDiffFlowProductOfCorrelationsPro[t][pe][2][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*sixReducedEBE,dW4*dw6); // storing <4><6'> | |
6924 | //fDiffFlowProductOfCorrelationsPro[t][pe][3][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourReducedEBE*sixReducedEBE,dw4*dw6); // storing <4'><6'> | |
6925 | //fDiffFlowProductOfCorrelationsPro[t][pe][4][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*sixReducedEBE,dW6*dw6); // storing <6><6'> | |
6926 | //fDiffFlowProductOfCorrelationsPro[t][pe][5][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightEBE,dw6*dW8); // storing <6'><8> | |
6927 | //fDiffFlowProductOfCorrelationsPro[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightReducedEBE,dw6*dw8); // storing <6'><8'> | |
6928 | ||
6929 | // event weight for <8'>: | |
6930 | //dw8 = ...; | |
6931 | //fDiffFlowProductOfCorrelationsPro[t][pe][0][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*eightReducedEBE,dW2*dw8); // storing <2><8'> | |
6932 | //fDiffFlowProductOfCorrelationsPro[t][pe][1][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*eightReducedEBE,dw2*dw8); // storing <2'><8'> | |
6933 | //fDiffFlowProductOfCorrelationsPro[t][pe][2][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*eightReducedEBE,dW4*dw8); // storing <4><8'> | |
6934 | //fDiffFlowProductOfCorrelationsPro[t][pe][3][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourReducedEBE*eightReducedEBE,dw4*dw8); // storing <4'><8'> | |
6935 | //fDiffFlowProductOfCorrelationsPro[t][pe][4][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*eightReducedEBE,dW6*dw8); // storing <6><8'> | |
6936 | //fDiffFlowProductOfCorrelationsPro[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightReducedEBE,dw6*dw8); // storing <6'><8'> | |
6937 | //fDiffFlowProductOfCorrelationsPro[t][pe][6][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*eightReducedEBE,dW8*dw8); // storing <8><8'> | |
6938 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++ | |
6939 | ||
6940 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowProductOfCorrelations(TString type, TString ptOrEta) | |
6941 | ||
489d5531 | 6942 | //================================================================================================================================ |
6943 | ||
489d5531 | 6944 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCovariances(TString type, TString ptOrEta) // to be improved (reimplemented) |
6945 | { | |
6946 | // a) Calculate unbiased estimators Cov(<2>,<2'>), Cov(<2>,<4'>), Cov(<4>,<2'>), Cov(<4>,<4'>) and Cov(<2'>,<4'>) | |
6947 | // for covariances V(<2>,<2'>), V(<2>,<4'>), V(<4>,<2'>), V(<4>,<4'>) and V(<2'>,<4'>). | |
6948 | // b) Store in histogram fDiffFlowCovariances[t][pe][index] for instance the following: | |
6949 | // | |
6950 | // Cov(<2>,<2'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] | |
6951 | // | |
6952 | // where N is the number of events, w_{<2>} is event weight for <2> and w_{<2'>} is event weight for <2'>. | |
6953 | // c) Binning of fDiffFlowCovariances[t][pe][index] is organized as follows: | |
6954 | // | |
6955 | // 1st bin: Cov(<2>,<2'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] | |
6956 | // 2nd bin: Cov(<2>,<4'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] | |
6957 | // 3rd bin: Cov(<4>,<2'>) * (sum_{i=1}^{N} w_{<4>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] | |
6958 | // 4th bin: Cov(<4>,<4'>) * (sum_{i=1}^{N} w_{<4>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] | |
6959 | // 5th bin: Cov(<2'>,<4'>) * (sum_{i=1}^{N} w_{<2'>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<2'>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] | |
6960 | // ... | |
6961 | ||
2a98ceb8 | 6962 | Int_t typeFlag = 0; |
6963 | Int_t ptEtaFlag = 0; | |
489d5531 | 6964 | |
6965 | if(type == "RP") | |
6966 | { | |
6967 | typeFlag = 0; | |
6968 | } else if(type == "POI") | |
6969 | { | |
6970 | typeFlag = 1; | |
6971 | } | |
6972 | ||
6973 | if(ptOrEta == "Pt") | |
6974 | { | |
6975 | ptEtaFlag = 0; | |
6976 | } else if(ptOrEta == "Eta") | |
6977 | { | |
6978 | ptEtaFlag = 1; | |
6979 | } | |
6980 | ||
6981 | // shortcuts: | |
6982 | Int_t t = typeFlag; | |
6983 | Int_t pe = ptEtaFlag; | |
6984 | ||
6985 | // common: | |
6986 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
6987 | //Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
6988 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
6989 | //Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
6990 | ||
6991 | // average correlations: | |
6992 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> | |
6993 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> | |
6994 | //Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> | |
6995 | //Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> | |
6996 | ||
6997 | // sum of weights for correlation: | |
6998 | Double_t sumOfWeightsForTwo = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // sum_{i=1}^{N} w_{<2>} | |
6999 | Double_t sumOfWeightsForFour = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // sum_{i=1}^{N} w_{<4>} | |
7000 | //Double_t sumOfWeightsForSix = fIntFlowSumOfEventWeights[0]->GetBinContent(3); // sum_{i=1}^{N} w_{<6>} | |
7001 | //Double_t sumOfWeightsForEight = fIntFlowSumOfEventWeights[0]->GetBinContent(4); // sum_{i=1}^{N} w_{<8>} | |
7002 | ||
7003 | // average reduced correlations: | |
7004 | Double_t twoReduced = 0.; // <<2'>> | |
7005 | Double_t fourReduced = 0.; // <<4'>> | |
7006 | //Double_t sixReduced = 0.; // <<6'>> | |
7007 | //Double_t eightReduced = 0.; // <<8'>> | |
7008 | ||
7009 | // sum of weights for reduced correlation: | |
7010 | Double_t sumOfWeightsForTwoReduced = 0.; // sum_{i=1}^{N} w_{<2'>} | |
7011 | Double_t sumOfWeightsForFourReduced = 0.; // sum_{i=1}^{N} w_{<4'>} | |
7012 | //Double_t sumOfWeightsForSixReduced = 0.; // sum_{i=1}^{N} w_{<6'>} | |
7013 | //Double_t sumOfWeightsForEightReduced = 0.; // sum_{i=1}^{N} w_{<8'>} | |
7014 | ||
7015 | // product of weights for reduced correlation: | |
7016 | Double_t productOfWeightsForTwoTwoReduced = 0.; // sum_{i=1}^{N} w_{<2>}w_{<2'>} | |
7017 | Double_t productOfWeightsForTwoFourReduced = 0.; // sum_{i=1}^{N} w_{<2>}w_{<4'>} | |
7018 | Double_t productOfWeightsForFourTwoReduced = 0.; // sum_{i=1}^{N} w_{<4>}w_{<2'>} | |
7019 | Double_t productOfWeightsForFourFourReduced = 0.; // sum_{i=1}^{N} w_{<4>}w_{<4'>} | |
7020 | Double_t productOfWeightsForTwoReducedFourReduced = 0.; // sum_{i=1}^{N} w_{<2'>}w_{<4'>} | |
7021 | // ... | |
7022 | ||
7023 | // products for differential flow: | |
7024 | Double_t twoTwoReduced = 0; // <<2><2'>> | |
7025 | Double_t twoFourReduced = 0; // <<2><4'>> | |
7026 | Double_t fourTwoReduced = 0; // <<4><2'>> | |
7027 | Double_t fourFourReduced = 0; // <<4><4'>> | |
7028 | Double_t twoReducedFourReduced = 0; // <<2'><4'>> | |
7029 | ||
7030 | // denominators in the expressions for the unbiased estimators for covariances: | |
7031 | // denominator = 1 - term1/(term2*term3) | |
7032 | // prefactor = term1/(term2*term3) | |
7033 | Double_t denominator = 0.; | |
7034 | Double_t prefactor = 0.; | |
7035 | Double_t term1 = 0.; | |
7036 | Double_t term2 = 0.; | |
7037 | Double_t term3 = 0.; | |
7038 | ||
7039 | // unbiased estimators for covariances for differential flow: | |
7040 | Double_t covTwoTwoReduced = 0.; // Cov(<2>,<2'>) | |
7041 | Double_t wCovTwoTwoReduced = 0.; // Cov(<2>,<2'>) * prefactor(w_{<2>},w_{<2'>}) | |
7042 | Double_t covTwoFourReduced = 0.; // Cov(<2>,<4'>) | |
7043 | Double_t wCovTwoFourReduced = 0.; // Cov(<2>,<4'>) * prefactor(w_{<2>},w_{<4'>}) | |
7044 | Double_t covFourTwoReduced = 0.; // Cov(<4>,<2'>) | |
7045 | Double_t wCovFourTwoReduced = 0.; // Cov(<4>,<2'>) * prefactor(w_{<4>},w_{<2'>}) | |
7046 | Double_t covFourFourReduced = 0.; // Cov(<4>,<4'>) | |
7047 | Double_t wCovFourFourReduced = 0.; // Cov(<4>,<4'>) * prefactor(w_{<4>},w_{<4'>}) | |
7048 | Double_t covTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) | |
7049 | Double_t wCovTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) * prefactor(w_{<2'>},w_{<4'>}) | |
7050 | ||
7051 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7052 | { | |
7053 | // average reduced corelations: | |
7054 | twoReduced = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); | |
7055 | fourReduced = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); | |
7056 | // average products: | |
7057 | twoTwoReduced = fDiffFlowProductOfCorrelationsPro[t][pe][0][1]->GetBinContent(b); | |
7058 | twoFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][0][3]->GetBinContent(b); | |
7059 | fourTwoReduced = fDiffFlowProductOfCorrelationsPro[t][pe][1][2]->GetBinContent(b); | |
7060 | fourFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][2][3]->GetBinContent(b); | |
7061 | twoReducedFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][1][3]->GetBinContent(b); | |
7062 | // sum of weights for reduced correlations: | |
7063 | sumOfWeightsForTwoReduced = fDiffFlowSumOfEventWeights[t][pe][0][0]->GetBinContent(b); | |
7064 | sumOfWeightsForFourReduced = fDiffFlowSumOfEventWeights[t][pe][0][1]->GetBinContent(b); | |
7065 | // products of weights for correlations: | |
7066 | productOfWeightsForTwoTwoReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][0][1]->GetBinContent(b); | |
7067 | productOfWeightsForTwoFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][0][3]->GetBinContent(b); | |
7068 | productOfWeightsForFourTwoReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][1][2]->GetBinContent(b); | |
7069 | productOfWeightsForFourFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][2][3]->GetBinContent(b); | |
7070 | productOfWeightsForTwoReducedFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][1][3]->GetBinContent(b); | |
7071 | // denominator for the unbiased estimator for covariances: 1 - term1/(term2*term3) | |
7072 | // prefactor (multiplies Cov's) = term1/(term2*term3) | |
7073 | // <2>,<2'>: | |
7074 | term1 = productOfWeightsForTwoTwoReduced; | |
7075 | term2 = sumOfWeightsForTwo; | |
7076 | term3 = sumOfWeightsForTwoReduced; | |
7077 | if(term2*term3>0.) | |
7078 | { | |
7079 | denominator = 1.-term1/(term2*term3); | |
7080 | prefactor = term1/(term2*term3); | |
1268c371 | 7081 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 7082 | { |
7083 | covTwoTwoReduced = (twoTwoReduced-two*twoReduced)/denominator; | |
7084 | wCovTwoTwoReduced = covTwoTwoReduced*prefactor; | |
7085 | fDiffFlowCovariances[t][pe][0]->SetBinContent(b,wCovTwoTwoReduced); | |
7086 | } | |
7087 | } | |
7088 | // <2>,<4'>: | |
7089 | term1 = productOfWeightsForTwoFourReduced; | |
7090 | term2 = sumOfWeightsForTwo; | |
7091 | term3 = sumOfWeightsForFourReduced; | |
7092 | if(term2*term3>0.) | |
7093 | { | |
7094 | denominator = 1.-term1/(term2*term3); | |
7095 | prefactor = term1/(term2*term3); | |
1268c371 | 7096 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 7097 | { |
7098 | covTwoFourReduced = (twoFourReduced-two*fourReduced)/denominator; | |
7099 | wCovTwoFourReduced = covTwoFourReduced*prefactor; | |
7100 | fDiffFlowCovariances[t][pe][1]->SetBinContent(b,wCovTwoFourReduced); | |
7101 | } | |
7102 | } | |
7103 | // <4>,<2'>: | |
7104 | term1 = productOfWeightsForFourTwoReduced; | |
7105 | term2 = sumOfWeightsForFour; | |
7106 | term3 = sumOfWeightsForTwoReduced; | |
7107 | if(term2*term3>0.) | |
7108 | { | |
7109 | denominator = 1.-term1/(term2*term3); | |
7110 | prefactor = term1/(term2*term3); | |
1268c371 | 7111 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 7112 | { |
7113 | covFourTwoReduced = (fourTwoReduced-four*twoReduced)/denominator; | |
7114 | wCovFourTwoReduced = covFourTwoReduced*prefactor; | |
7115 | fDiffFlowCovariances[t][pe][2]->SetBinContent(b,wCovFourTwoReduced); | |
7116 | } | |
7117 | } | |
7118 | // <4>,<4'>: | |
7119 | term1 = productOfWeightsForFourFourReduced; | |
7120 | term2 = sumOfWeightsForFour; | |
7121 | term3 = sumOfWeightsForFourReduced; | |
7122 | if(term2*term3>0.) | |
7123 | { | |
7124 | denominator = 1.-term1/(term2*term3); | |
7125 | prefactor = term1/(term2*term3); | |
1268c371 | 7126 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 7127 | { |
7128 | covFourFourReduced = (fourFourReduced-four*fourReduced)/denominator; | |
7129 | wCovFourFourReduced = covFourFourReduced*prefactor; | |
7130 | fDiffFlowCovariances[t][pe][3]->SetBinContent(b,wCovFourFourReduced); | |
7131 | } | |
7132 | } | |
7133 | // <2'>,<4'>: | |
7134 | term1 = productOfWeightsForTwoReducedFourReduced; | |
7135 | term2 = sumOfWeightsForTwoReduced; | |
7136 | term3 = sumOfWeightsForFourReduced; | |
7137 | if(term2*term3>0.) | |
7138 | { | |
7139 | denominator = 1.-term1/(term2*term3); | |
7140 | prefactor = term1/(term2*term3); | |
1268c371 | 7141 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 7142 | { |
7143 | covTwoReducedFourReduced = (twoReducedFourReduced-twoReduced*fourReduced)/denominator; | |
7144 | wCovTwoReducedFourReduced = covTwoReducedFourReduced*prefactor; | |
7145 | fDiffFlowCovariances[t][pe][4]->SetBinContent(b,wCovTwoReducedFourReduced); | |
7146 | } | |
7147 | } | |
7148 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7149 | ||
7150 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCovariances(TString type, TString ptOrEta) | |
7151 | ||
489d5531 | 7152 | //================================================================================================================================ |
7153 | ||
489d5531 | 7154 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, TString ptOrEta) |
7155 | { | |
1268c371 | 7156 | // Calculate final results for differential flow. |
489d5531 | 7157 | |
1268c371 | 7158 | // REMARK: Differential flow calculated in this method is NOT corrected for non-uniform acceptance. |
7159 | // This correction, if enabled via setter SetApplyCorrectionForNUA(Bool_t), is applied in the method | |
7160 | // CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta) | |
7161 | ||
7162 | Int_t t = 0; // RP or POI | |
7163 | Int_t pe = 0; // pt or eta | |
489d5531 | 7164 | |
7165 | if(type == "RP") | |
7166 | { | |
1268c371 | 7167 | t = 0; |
489d5531 | 7168 | } else if(type == "POI") |
7169 | { | |
1268c371 | 7170 | t = 1; |
489d5531 | 7171 | } |
7172 | ||
7173 | if(ptOrEta == "Pt") | |
7174 | { | |
1268c371 | 7175 | pe = 0; |
489d5531 | 7176 | } else if(ptOrEta == "Eta") |
7177 | { | |
1268c371 | 7178 | pe = 1; |
489d5531 | 7179 | } |
1268c371 | 7180 | |
7181 | // Common: | |
489d5531 | 7182 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
1268c371 | 7183 | // Correlations: |
489d5531 | 7184 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> |
1268c371 | 7185 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> |
7186 | // Statistical errors of correlations: | |
489d5531 | 7187 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); |
7188 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); | |
1268c371 | 7189 | // Reduced correlations: |
489d5531 | 7190 | Double_t twoReduced = 0.; // <<2'>> |
7191 | Double_t fourReduced = 0.; // <<4'>> | |
1268c371 | 7192 | // Statistical errors of reduced correlations: |
489d5531 | 7193 | Double_t twoReducedError = 0.; |
7194 | Double_t fourReducedError = 0.; | |
1268c371 | 7195 | // Covariances: |
8e1cefdd | 7196 | Double_t wCovTwoFour = 0.; // Cov(<2>,<4>) * prefactor(<2>,<4>) |
7197 | if(!fForgetAboutCovariances) | |
7198 | { | |
7199 | wCovTwoFour = fIntFlowCovariances->GetBinContent(1); // Cov(<2>,<4>) * prefactor(<2>,<4>) | |
7200 | } | |
489d5531 | 7201 | Double_t wCovTwoTwoReduced = 0.; // Cov(<2>,<2'>) * prefactor(<2>,<2'>) |
7202 | Double_t wCovTwoFourReduced = 0.; // Cov(<2>,<4'>) * prefactor(<2>,<4'>) | |
7203 | Double_t wCovFourTwoReduced = 0.; // Cov(<4>,<2'>) * prefactor(<4>,<2'>) | |
7204 | Double_t wCovFourFourReduced = 0.; // Cov(<4>,<4'>) * prefactor(<4>,<4'>) | |
7205 | Double_t wCovTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) * prefactor(<2'>,<4'>) | |
1268c371 | 7206 | // Differential flow: |
489d5531 | 7207 | Double_t v2Prime = 0.; // v'{2} |
7208 | Double_t v4Prime = 0.; // v'{4} | |
1268c371 | 7209 | // Statistical error of differential flow: |
489d5531 | 7210 | Double_t v2PrimeError = 0.; |
7211 | Double_t v4PrimeError = 0.; | |
1268c371 | 7212 | // Squared statistical error of differential flow: |
489d5531 | 7213 | Double_t v2PrimeErrorSquared = 0.; |
7214 | Double_t v4PrimeErrorSquared = 0.; | |
1268c371 | 7215 | // Loop over pt or eta bins: |
489d5531 | 7216 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) |
7217 | { | |
1268c371 | 7218 | // Reduced correlations and statistical errors: |
489d5531 | 7219 | twoReduced = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); |
7220 | twoReducedError = fDiffFlowCorrelationsHist[t][pe][0]->GetBinError(b); | |
7221 | fourReduced = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); | |
7222 | fourReducedError = fDiffFlowCorrelationsHist[t][pe][1]->GetBinError(b); | |
1268c371 | 7223 | // Covariances: |
8e1cefdd | 7224 | if(!fForgetAboutCovariances) |
7225 | { | |
7226 | wCovTwoTwoReduced = fDiffFlowCovariances[t][pe][0]->GetBinContent(b); | |
7227 | wCovTwoFourReduced = fDiffFlowCovariances[t][pe][1]->GetBinContent(b); | |
7228 | wCovFourTwoReduced = fDiffFlowCovariances[t][pe][2]->GetBinContent(b); | |
7229 | wCovFourFourReduced = fDiffFlowCovariances[t][pe][3]->GetBinContent(b); | |
7230 | wCovTwoReducedFourReduced = fDiffFlowCovariances[t][pe][4]->GetBinContent(b); | |
7231 | } | |
1268c371 | 7232 | // Differential flow: |
489d5531 | 7233 | // v'{2}: |
7234 | if(two>0.) | |
7235 | { | |
7236 | v2Prime = twoReduced/pow(two,0.5); | |
1268c371 | 7237 | v2PrimeErrorSquared = (1./4.)*pow(two,-3.)*(pow(twoReduced,2.)*pow(twoError,2.) |
7238 | + 4.*pow(two,2.)*pow(twoReducedError,2.) | |
7239 | - 4.*two*twoReduced*wCovTwoTwoReduced); | |
7240 | if(v2PrimeErrorSquared>0.){v2PrimeError = pow(v2PrimeErrorSquared,0.5);} | |
7241 | if(TMath::Abs(v2Prime)>0.) | |
7242 | { | |
7243 | fDiffFlow[t][pe][0]->SetBinContent(b,v2Prime); | |
7244 | fDiffFlow[t][pe][0]->SetBinError(b,v2PrimeError); | |
7245 | } | |
7246 | } // end of if(two>0.) | |
489d5531 | 7247 | // differential flow: |
7248 | // v'{4} | |
7249 | if(2.*pow(two,2.)-four > 0.) | |
7250 | { | |
7251 | v4Prime = (2.*two*twoReduced-fourReduced)/pow(2.*pow(two,2.)-four,3./4.); | |
1268c371 | 7252 | v4PrimeErrorSquared = pow(2.*pow(two,2.)-four,-7./2.) |
7253 | * (pow(2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced,2.)*pow(twoError,2.) | |
7254 | + (9./16.)*pow(2.*two*twoReduced-fourReduced,2.)*pow(fourError,2.) | |
7255 | + 4.*pow(two,2.)*pow(2.*pow(two,2.)-four,2.)*pow(twoReducedError,2.) | |
7256 | + pow(2.*pow(two,2.)-four,2.)*pow(fourReducedError,2.) | |
7257 | - (3./2.)*(2.*two*twoReduced-fourReduced) | |
7258 | * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoFour | |
7259 | - 4.*two*(2.*pow(two,2.)-four) | |
7260 | * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoTwoReduced | |
7261 | + 2.*(2.*pow(two,2.)-four) | |
7262 | * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoFourReduced | |
7263 | + 3.*two*(2.*pow(two,2.)-four)*(2.*two*twoReduced-fourReduced)*wCovFourTwoReduced | |
7264 | - (3./2.)*(2.*pow(two,2.)-four)*(2.*two*twoReduced-fourReduced)*wCovFourFourReduced | |
7265 | - 4.*two*pow(2.*pow(two,2.)-four,2.)*wCovTwoReducedFourReduced); | |
7266 | if(v4PrimeErrorSquared>0.){v4PrimeError = pow(v4PrimeErrorSquared,0.5);} | |
7267 | if(TMath::Abs(v4Prime)>0.) | |
7268 | { | |
7269 | fDiffFlow[t][pe][1]->SetBinContent(b,v4Prime); | |
7270 | fDiffFlow[t][pe][1]->SetBinError(b,v4PrimeError); | |
7271 | } | |
7272 | } // end of if(2.*pow(two,2.)-four > 0.) | |
489d5531 | 7273 | } // end of for(Int_t b=1;b<=fnBinsPtEta[pe];b++) |
1268c371 | 7274 | |
7275 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, Bool_t useParticleWeights) | |
7276 | ||
7277 | //================================================================================================================================ | |
7278 | ||
7279 | void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlow(TString type) | |
7280 | { | |
7281 | // Calculate final results for 2D diferential flow. | |
7282 | ||
7283 | // to be improved - check pointers used in this method | |
7284 | ||
7285 | Int_t t = 0; // RP or POI | |
7286 | ||
7287 | if(type == "RP") | |
7288 | { | |
7289 | t = 0; | |
7290 | } else if(type == "POI") | |
7291 | { | |
7292 | t = 1; | |
7293 | } | |
489d5531 | 7294 | |
1268c371 | 7295 | // Differential flow: |
7296 | Double_t v2Prime = 0.; // v'{2} | |
7297 | Double_t v4Prime = 0.; // v'{4} | |
7298 | // Differential cumulants: | |
7299 | Double_t qc2Prime = 0.; // QC{2'} | |
7300 | Double_t qc4Prime = 0.; // QC{4'} | |
7301 | // Looping over all (pt,eta) bins and calculating differential flow: | |
7302 | for(Int_t p=1;p<=fnBinsPt;p++) | |
489d5531 | 7303 | { |
1268c371 | 7304 | for(Int_t e=1;e<=fnBinsEta;e++) |
489d5531 | 7305 | { |
1268c371 | 7306 | // QC{2'}: |
7307 | qc2Prime = f2DDiffFlowCumulants[t][0]->GetBinContent(f2DDiffFlowCumulants[t][0]->GetBin(p,e)); | |
7308 | if(qc2Prime>=0.) | |
7309 | { | |
7310 | v2Prime = pow(qc2Prime,0.5); | |
7311 | f2DDiffFlow[t][0]->SetBinContent(f2DDiffFlow[t][0]->GetBin(p,e),v2Prime); | |
7312 | } | |
7313 | // QC{4'}: | |
7314 | qc4Prime = f2DDiffFlowCumulants[t][1]->GetBinContent(f2DDiffFlowCumulants[t][1]->GetBin(p,e)); | |
7315 | if(qc4Prime<=0.) | |
7316 | { | |
7317 | v4Prime = pow(-1.*qc4Prime,1./4.); | |
7318 | f2DDiffFlow[t][1]->SetBinContent(f2DDiffFlow[t][1]->GetBin(p,e),v4Prime); | |
7319 | } | |
7320 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
7321 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
7322 | ||
7323 | } // end of void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlow(TString type) | |
489d5531 | 7324 | |
489d5531 | 7325 | //================================================================================================================================ |
7326 | ||
489d5531 | 7327 | void AliFlowAnalysisWithQCumulants::StoreIntFlowFlags() |
7328 | { | |
7329 | // a) Store all flags for integrated flow in profile fIntFlowFlags. | |
7330 | ||
7331 | if(!fIntFlowFlags) | |
7332 | { | |
7333 | cout<<"WARNING: fIntFlowFlags is NULL in AFAWQC::SFFIF() !!!!"<<endl; | |
7334 | exit(0); | |
7335 | } | |
7336 | ||
7337 | // particle weights used or not: | |
7338 | fIntFlowFlags->Fill(0.5,(Int_t)fUsePhiWeights||fUsePtWeights||fUseEtaWeights); | |
7339 | // which event weights were used: | |
7340 | if(strcmp(fMultiplicityWeight->Data(),"combinations")) | |
7341 | { | |
7342 | fIntFlowFlags->Fill(1.5,0); // 0 = "combinations" (default) | |
7343 | } else if(strcmp(fMultiplicityWeight->Data(),"unit")) | |
7344 | { | |
7345 | fIntFlowFlags->Fill(1.5,1); // 1 = "unit" | |
7346 | } else if(strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
7347 | { | |
7348 | fIntFlowFlags->Fill(1.5,2); // 2 = "multiplicity" | |
7349 | } | |
489d5531 | 7350 | fIntFlowFlags->Fill(2.5,(Int_t)fApplyCorrectionForNUA); |
7351 | fIntFlowFlags->Fill(3.5,(Int_t)fPrintFinalResults[0]); | |
7352 | fIntFlowFlags->Fill(4.5,(Int_t)fPrintFinalResults[1]); | |
7353 | fIntFlowFlags->Fill(5.5,(Int_t)fPrintFinalResults[2]); | |
b3dacf6b | 7354 | fIntFlowFlags->Fill(6.5,(Int_t)fPrintFinalResults[3]); |
7355 | fIntFlowFlags->Fill(7.5,(Int_t)fApplyCorrectionForNUAVsM); | |
b77b6434 | 7356 | fIntFlowFlags->Fill(8.5,(Int_t)fPropagateErrorAlsoFromNIT); |
b3dacf6b | 7357 | fIntFlowFlags->Fill(9.5,(Int_t)fCalculateCumulantsVsM); |
0dd3b008 | 7358 | fIntFlowFlags->Fill(10.5,(Int_t)fMinimumBiasReferenceFlow); |
8e1cefdd | 7359 | fIntFlowFlags->Fill(11.5,(Int_t)fForgetAboutCovariances); |
e5834fcb | 7360 | fIntFlowFlags->Fill(12.5,(Int_t)fStorePhiDistributionForOneEvent); |
dd442cd2 | 7361 | fIntFlowFlags->Fill(13.5,(Int_t)fFillMultipleControlHistograms); |
489d5531 | 7362 | } // end of void AliFlowAnalysisWithQCumulants::StoreIntFlowFlags() |
7363 | ||
489d5531 | 7364 | //================================================================================================================================ |
7365 | ||
489d5531 | 7366 | void AliFlowAnalysisWithQCumulants::StoreDiffFlowFlags() |
7367 | { | |
7368 | // Store all flags for differential flow in the profile fDiffFlowFlags. | |
7369 | ||
7370 | if(!fDiffFlowFlags) | |
7371 | { | |
1268c371 | 7372 | printf("\n WARNING (QC): fDiffFlowFlags is NULL in AFAWQC::SDFF() !!!!\n\n"); |
489d5531 | 7373 | exit(0); |
7374 | } | |
7375 | ||
1268c371 | 7376 | fDiffFlowFlags->Fill(0.5,fCalculateDiffFlow); // calculate differential flow |
7377 | fDiffFlowFlags->Fill(1.5,fUsePhiWeights||fUsePtWeights||fUseEtaWeights); // particle weights used or not? | |
7378 | //fDiffFlowFlags->Fill(2.5,""); // which event weight was used? ("combinations", "unit" or "multiplicity") to be improved - finalized | |
7379 | fDiffFlowFlags->Fill(3.5,fApplyCorrectionForNUA); // corrected for non-uniform acceptance or not | |
7380 | fDiffFlowFlags->Fill(4.5,fCalculate2DDiffFlow); // calculate also 2D differential flow vs (pt,eta) | |
7381 | ||
489d5531 | 7382 | } // end of void AliFlowAnalysisWithQCumulants::StoreDiffFlowFlags() |
7383 | ||
489d5531 | 7384 | //================================================================================================================================ |
7385 | ||
489d5531 | 7386 | void AliFlowAnalysisWithQCumulants::GetPointersForCommonHistograms() |
7387 | { | |
7388 | // Access all pointers to common control and common result histograms and profiles. | |
7389 | ||
1268c371 | 7390 | TString sCommonConstantsName = "fCommonConstants"; |
7391 | sCommonConstantsName += fAnalysisLabel->Data(); | |
7392 | fCommonConstants = dynamic_cast<TProfile*>(fHistList->FindObject(sCommonConstantsName.Data())); | |
7393 | if(!fCommonConstants) | |
7394 | { | |
7395 | printf("\n WARNING (QC): fCommonConstants is NULL in AFAWQC::GPFCH() !!!!\n\n"); | |
7396 | exit(0); | |
7397 | } | |
7398 | ||
7399 | // to be improved - lines bellow can be implemented better. | |
7400 | ||
489d5531 | 7401 | TString commonHistsName = "AliFlowCommonHistQC"; |
7402 | commonHistsName += fAnalysisLabel->Data(); | |
7403 | AliFlowCommonHist *commonHist = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHistsName.Data())); | |
b77b6434 | 7404 | if(commonHist) |
7405 | { | |
7406 | this->SetCommonHists(commonHist); | |
7407 | if(fCommonHists->GetHarmonic()) | |
7408 | { | |
7409 | fHarmonic = (Int_t)(fCommonHists->GetHarmonic())->GetBinContent(1); | |
7410 | } | |
7411 | } // end of if(commonHist) | |
489d5531 | 7412 | TString commonHists2ndOrderName = "AliFlowCommonHist2ndOrderQC"; |
7413 | commonHists2ndOrderName += fAnalysisLabel->Data(); | |
7414 | AliFlowCommonHist *commonHist2nd = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists2ndOrderName.Data())); | |
7415 | if(commonHist2nd) this->SetCommonHists2nd(commonHist2nd); | |
7416 | TString commonHists4thOrderName = "AliFlowCommonHist4thOrderQC"; | |
7417 | commonHists4thOrderName += fAnalysisLabel->Data(); | |
7418 | AliFlowCommonHist *commonHist4th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists4thOrderName.Data())); | |
7419 | if(commonHist4th) this->SetCommonHists4th(commonHist4th); | |
7420 | TString commonHists6thOrderName = "AliFlowCommonHist6thOrderQC"; | |
7421 | commonHists6thOrderName += fAnalysisLabel->Data(); | |
7422 | AliFlowCommonHist *commonHist6th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists6thOrderName.Data())); | |
7423 | if(commonHist6th) this->SetCommonHists6th(commonHist6th); | |
7424 | TString commonHists8thOrderName = "AliFlowCommonHist8thOrderQC"; | |
7425 | commonHists8thOrderName += fAnalysisLabel->Data(); | |
7426 | AliFlowCommonHist *commonHist8th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists8thOrderName.Data())); | |
dd442cd2 | 7427 | if(commonHist8th) this->SetCommonHists8th(commonHist8th); |
7428 | ||
489d5531 | 7429 | TString commonHistResults2ndOrderName = "AliFlowCommonHistResults2ndOrderQC"; |
7430 | commonHistResults2ndOrderName += fAnalysisLabel->Data(); | |
b77b6434 | 7431 | AliFlowCommonHistResults *commonHistRes2nd = dynamic_cast<AliFlowCommonHistResults*> |
7432 | (fHistList->FindObject(commonHistResults2ndOrderName.Data())); | |
489d5531 | 7433 | if(commonHistRes2nd) this->SetCommonHistsResults2nd(commonHistRes2nd); |
7434 | TString commonHistResults4thOrderName = "AliFlowCommonHistResults4thOrderQC"; | |
7435 | commonHistResults4thOrderName += fAnalysisLabel->Data(); | |
7436 | AliFlowCommonHistResults *commonHistRes4th = dynamic_cast<AliFlowCommonHistResults*> | |
7437 | (fHistList->FindObject(commonHistResults4thOrderName.Data())); | |
7438 | if(commonHistRes4th) this->SetCommonHistsResults4th(commonHistRes4th); | |
7439 | TString commonHistResults6thOrderName = "AliFlowCommonHistResults6thOrderQC"; | |
7440 | commonHistResults6thOrderName += fAnalysisLabel->Data(); | |
7441 | AliFlowCommonHistResults *commonHistRes6th = dynamic_cast<AliFlowCommonHistResults*> | |
7442 | (fHistList->FindObject(commonHistResults6thOrderName.Data())); | |
7443 | if(commonHistRes6th) this->SetCommonHistsResults6th(commonHistRes6th); | |
7444 | TString commonHistResults8thOrderName = "AliFlowCommonHistResults8thOrderQC"; | |
7445 | commonHistResults8thOrderName += fAnalysisLabel->Data(); | |
7446 | AliFlowCommonHistResults *commonHistRes8th = dynamic_cast<AliFlowCommonHistResults*> | |
7447 | (fHistList->FindObject(commonHistResults8thOrderName.Data())); | |
7448 | if(commonHistRes8th) this->SetCommonHistsResults8th(commonHistRes8th); | |
7449 | ||
7450 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForCommonHistograms() | |
7451 | ||
7452 | ||
7453 | //================================================================================================================================ | |
7454 | ||
7455 | ||
7456 | void AliFlowAnalysisWithQCumulants::GetPointersForParticleWeightsHistograms() | |
7457 | { | |
7458 | // Get pointers for histograms with particle weights. | |
7459 | ||
7460 | TList *weightsList = dynamic_cast<TList*>(fHistList->FindObject("Weights")); | |
ca5f47e7 | 7461 | if(!weightsList){printf("\n WARNING (QC): weightsList is NULL in AFAWQC::GPFPWH() !!!!\n");exit(0);} |
7462 | this->SetWeightsList(weightsList); | |
489d5531 | 7463 | TString fUseParticleWeightsName = "fUseParticleWeightsQC"; // to be improved (hirdwired label QC) |
7464 | fUseParticleWeightsName += fAnalysisLabel->Data(); | |
7465 | TProfile *useParticleWeights = dynamic_cast<TProfile*>(weightsList->FindObject(fUseParticleWeightsName.Data())); | |
7466 | if(useParticleWeights) | |
7467 | { | |
7468 | this->SetUseParticleWeights(useParticleWeights); | |
7469 | fUsePhiWeights = (Int_t)fUseParticleWeights->GetBinContent(1); | |
7470 | fUsePtWeights = (Int_t)fUseParticleWeights->GetBinContent(2); | |
7471 | fUseEtaWeights = (Int_t)fUseParticleWeights->GetBinContent(3); | |
7472 | } | |
7473 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForParticleWeightsHistograms(); | |
7474 | ||
7475 | ||
7476 | //================================================================================================================================ | |
7477 | ||
7478 | ||
7479 | void AliFlowAnalysisWithQCumulants::GetPointersForIntFlowHistograms() | |
7480 | { | |
7481 | // Get pointers for histograms and profiles relevant for integrated flow: | |
7482 | // a) Get pointer to base list for integrated flow holding profile fIntFlowFlags and lists fIntFlowProfiles and fIntFlowResults. | |
7483 | // b) Get pointer to profile fIntFlowFlags holding all flags for integrated flow. | |
7484 | // c) Get pointer to list fIntFlowProfiles and pointers to all objects that she holds. | |
7485 | // d) Get pointer to list fIntFlowResults and pointers to all objects that she holds. | |
7486 | ||
7487 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data member?) | |
7488 | TString powerFlag[2] = {"linear","quadratic"}; // to be improved (should I promote this to data member?) | |
b40a910e | 7489 | TString correlationFlag[4] = {"#LT#LT2#GT#GT","#LT#LT4#GT#GT","#LT#LT6#GT#GT","#LT#LT8#GT#GT"}; // to be improved (should I promote this to data member?) |
7490 | TString squaredCorrelationFlag[4] = {"#LT#LT2#GT^{2}#GT","#LT#LT4#GT^{2}#GT","#LT#LT6#GT^{2}#GT","#LT#LT8#GT^{2}#GT"}; // to be improved (should I promote this to data member?) | |
489d5531 | 7491 | |
7492 | // a) Get pointer to base list for integrated flow holding profile fIntFlowFlags and lists fIntFlowProfiles and fIntFlowResults: | |
7493 | TList *intFlowList = NULL; | |
7494 | intFlowList = dynamic_cast<TList*>(fHistList->FindObject("Integrated Flow")); | |
7495 | if(!intFlowList) | |
7496 | { | |
7497 | cout<<"WARNING: intFlowList is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7498 | exit(0); | |
7499 | } | |
7500 | ||
b92ea2b9 | 7501 | // b) Get pointer to profile fIntFlowFlags holding all flags for integrated flow: |
7502 | TString intFlowFlagsName = "fIntFlowFlags"; | |
7503 | intFlowFlagsName += fAnalysisLabel->Data(); | |
7504 | TProfile *intFlowFlags = dynamic_cast<TProfile*>(intFlowList->FindObject(intFlowFlagsName.Data())); | |
7505 | if(intFlowFlags) | |
7506 | { | |
7507 | this->SetIntFlowFlags(intFlowFlags); | |
7508 | fApplyCorrectionForNUA = (Bool_t)intFlowFlags->GetBinContent(3); | |
7509 | fApplyCorrectionForNUAVsM = (Bool_t)intFlowFlags->GetBinContent(8); | |
7510 | fCalculateCumulantsVsM = (Bool_t)intFlowFlags->GetBinContent(10); | |
7511 | } else | |
7512 | { | |
7513 | cout<<"WARNING: intFlowFlags is NULL in FAWQC::GPFIFH() !!!!"<<endl; | |
7514 | } | |
489d5531 | 7515 | |
7516 | // c) Get pointer to list fIntFlowProfiles and pointers to all objects that she holds: | |
7517 | TList *intFlowProfiles = NULL; | |
7518 | intFlowProfiles = dynamic_cast<TList*>(intFlowList->FindObject("Profiles")); | |
7519 | if(intFlowProfiles) | |
7520 | { | |
7521 | // average multiplicities: | |
7522 | TString avMultiplicityName = "fAvMultiplicity"; | |
7523 | avMultiplicityName += fAnalysisLabel->Data(); | |
7524 | TProfile *avMultiplicity = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(avMultiplicityName.Data())); | |
7525 | if(avMultiplicity) | |
7526 | { | |
7527 | this->SetAvMultiplicity(avMultiplicity); | |
7528 | } else | |
7529 | { | |
7530 | cout<<"WARNING: avMultiplicity is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7531 | } | |
7532 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with wrong errors!): | |
7533 | TString intFlowCorrelationsProName = "fIntFlowCorrelationsPro"; | |
7534 | intFlowCorrelationsProName += fAnalysisLabel->Data(); | |
7535 | TProfile *intFlowCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowCorrelationsProName.Data())); | |
7536 | if(intFlowCorrelationsPro) | |
7537 | { | |
7538 | this->SetIntFlowCorrelationsPro(intFlowCorrelationsPro); | |
7539 | } else | |
7540 | { | |
7541 | cout<<"WARNING: intFlowCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
ff70ca91 | 7542 | } |
b40a910e | 7543 | // average squared correlations <<2>^2>, <<4>^2>, <<6>^2> and <<8^2>>: |
7544 | TString intFlowSquaredCorrelationsProName = "fIntFlowSquaredCorrelationsPro"; | |
7545 | intFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
7546 | TProfile *intFlowSquaredCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowSquaredCorrelationsProName.Data())); | |
7547 | if(intFlowSquaredCorrelationsPro) | |
7548 | { | |
7549 | this->SetIntFlowSquaredCorrelationsPro(intFlowSquaredCorrelationsPro); | |
7550 | } else | |
7551 | { | |
7552 | cout<<"WARNING: intFlowSquaredCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7553 | } | |
b3dacf6b | 7554 | if(fCalculateCumulantsVsM) |
ff70ca91 | 7555 | { |
b40a910e | 7556 | // Average correlations <<2>>, <<4>>, <<6>> and <<8>> versus multiplicity for all events (error is wrong here): |
b3dacf6b | 7557 | TString intFlowCorrelationsVsMProName = "fIntFlowCorrelationsVsMPro"; |
7558 | intFlowCorrelationsVsMProName += fAnalysisLabel->Data(); | |
7559 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
ff70ca91 | 7560 | { |
b3dacf6b | 7561 | TProfile *intFlowCorrelationsVsMPro = dynamic_cast<TProfile*> |
7562 | (intFlowProfiles->FindObject(Form("%s, %s",intFlowCorrelationsVsMProName.Data(),correlationFlag[ci].Data()))); | |
7563 | if(intFlowCorrelationsVsMPro) | |
7564 | { | |
7565 | this->SetIntFlowCorrelationsVsMPro(intFlowCorrelationsVsMPro,ci); | |
7566 | } else | |
7567 | { | |
7568 | cout<<"WARNING: "<<Form("intFlowCorrelationsVsMPro[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7569 | } | |
7570 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
b40a910e | 7571 | // Average squared correlations <<2>^2>, <<4>^2>, <<6>^2> and <<8>^2> versus multiplicity for all events: |
7572 | TString intFlowSquaredCorrelationsVsMProName = "fIntFlowSquaredCorrelationsVsMPro"; | |
7573 | intFlowSquaredCorrelationsVsMProName += fAnalysisLabel->Data(); | |
7574 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
7575 | { | |
7576 | TProfile *intFlowSquaredCorrelationsVsMPro = dynamic_cast<TProfile*> | |
7577 | (intFlowProfiles->FindObject(Form("%s, %s",intFlowSquaredCorrelationsVsMProName.Data(),squaredCorrelationFlag[ci].Data()))); | |
7578 | if(intFlowSquaredCorrelationsVsMPro) | |
7579 | { | |
7580 | this->SetIntFlowSquaredCorrelationsVsMPro(intFlowSquaredCorrelationsVsMPro,ci); | |
7581 | } else | |
7582 | { | |
7583 | cout<<"WARNING: "<<Form("intFlowSquaredCorrelationsVsMPro[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7584 | } | |
7585 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
b3dacf6b | 7586 | } // end of if(fCalculateCumulantsVsM) |
489d5531 | 7587 | // average all correlations for integrated flow (with wrong errors!): |
7588 | TString intFlowCorrelationsAllProName = "fIntFlowCorrelationsAllPro"; | |
7589 | intFlowCorrelationsAllProName += fAnalysisLabel->Data(); | |
7590 | TProfile *intFlowCorrelationsAllPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowCorrelationsAllProName.Data())); | |
7591 | if(intFlowCorrelationsAllPro) | |
7592 | { | |
7593 | this->SetIntFlowCorrelationsAllPro(intFlowCorrelationsAllPro); | |
7594 | } else | |
7595 | { | |
7596 | cout<<"WARNING: intFlowCorrelationsAllPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7597 | } | |
7598 | // average extra correlations for integrated flow (which appear only when particle weights are used): | |
7599 | // (to be improved: Weak point in implementation, I am assuming here that method GetPointersForParticleWeightsHistograms() was called) | |
7600 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
7601 | { | |
7602 | TString intFlowExtraCorrelationsProName = "fIntFlowExtraCorrelationsPro"; | |
7603 | intFlowExtraCorrelationsProName += fAnalysisLabel->Data(); | |
7604 | TProfile *intFlowExtraCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowExtraCorrelationsProName.Data())); | |
7605 | if(intFlowExtraCorrelationsPro) | |
7606 | { | |
7607 | this->SetIntFlowExtraCorrelationsPro(intFlowExtraCorrelationsPro); | |
7608 | } else | |
7609 | { | |
7610 | cout<<"WARNING: intFlowExtraCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7611 | } | |
7612 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
7613 | // average products of correlations <2>, <4>, <6> and <8>: | |
7614 | TString intFlowProductOfCorrelationsProName = "fIntFlowProductOfCorrelationsPro"; | |
7615 | intFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
7616 | TProfile *intFlowProductOfCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowProductOfCorrelationsProName.Data())); | |
7617 | if(intFlowProductOfCorrelationsPro) | |
7618 | { | |
7619 | this->SetIntFlowProductOfCorrelationsPro(intFlowProductOfCorrelationsPro); | |
7620 | } else | |
7621 | { | |
7622 | cout<<"WARNING: intFlowProductOfCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
ff70ca91 | 7623 | } |
7624 | // average product of correlations <2>, <4>, <6> and <8> versus multiplicity | |
7625 | // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>] | |
b3dacf6b | 7626 | if(fCalculateCumulantsVsM) |
7627 | { | |
7628 | TString intFlowProductOfCorrelationsVsMProName = "fIntFlowProductOfCorrelationsVsMPro"; | |
7629 | intFlowProductOfCorrelationsVsMProName += fAnalysisLabel->Data(); | |
7630 | TString productFlag[6] = {"<<2><4>>","<<2><6>>","<<2><8>>","<<4><6>>","<<4><8>>","<<6><8>>"}; | |
7631 | for(Int_t pi=0;pi<6;pi++) | |
7632 | { | |
7633 | TProfile *intFlowProductOfCorrelationsVsMPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(Form("%s, %s",intFlowProductOfCorrelationsVsMProName.Data(),productFlag[pi].Data()))); | |
7634 | if(intFlowProductOfCorrelationsVsMPro) | |
7635 | { | |
7636 | this->SetIntFlowProductOfCorrelationsVsMPro(intFlowProductOfCorrelationsVsMPro,pi); | |
7637 | } else | |
7638 | { | |
7639 | cout<<"WARNING: "<<Form("intFlowProductOfCorrelationsVsMPro[%d]",pi)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7640 | } | |
7641 | } // end of for(Int_t pi=0;pi<6;pi++) | |
7642 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 7643 | // average correction terms for non-uniform acceptance (with wrong errors!): |
7644 | for(Int_t sc=0;sc<2;sc++) | |
7645 | { | |
7646 | TString intFlowCorrectionTermsForNUAProName = "fIntFlowCorrectionTermsForNUAPro"; | |
7647 | intFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
7648 | TProfile *intFlowCorrectionTermsForNUAPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject((Form("%s: %s terms",intFlowCorrectionTermsForNUAProName.Data(),sinCosFlag[sc].Data())))); | |
7649 | if(intFlowCorrectionTermsForNUAPro) | |
7650 | { | |
7651 | this->SetIntFlowCorrectionTermsForNUAPro(intFlowCorrectionTermsForNUAPro,sc); | |
7652 | } else | |
7653 | { | |
7654 | cout<<"WARNING: intFlowCorrectionTermsForNUAPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7655 | cout<<"sc = "<<sc<<endl; | |
7656 | } | |
2001bc3a | 7657 | // versus multiplicity: |
b3dacf6b | 7658 | if(fCalculateCumulantsVsM) |
2001bc3a | 7659 | { |
b3dacf6b | 7660 | TString correctionTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4 |
7661 | TString intFlowCorrectionTermsForNUAVsMProName = "fIntFlowCorrectionTermsForNUAVsMPro"; | |
7662 | intFlowCorrectionTermsForNUAVsMProName += fAnalysisLabel->Data(); | |
7663 | for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) | |
2001bc3a | 7664 | { |
b3dacf6b | 7665 | TProfile *intFlowCorrectionTermsForNUAVsMPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(Form("%s: #LT#LT%s%s#GT#GT",intFlowCorrectionTermsForNUAVsMProName.Data(),sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()))); |
7666 | if(intFlowCorrectionTermsForNUAVsMPro) | |
7667 | { | |
7668 | this->SetIntFlowCorrectionTermsForNUAVsMPro(intFlowCorrectionTermsForNUAVsMPro,sc,ci); | |
7669 | } else | |
7670 | { | |
7671 | cout<<"WARNING: intFlowCorrectionTermsForNUAVsMPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7672 | cout<<"sc = "<<sc<<endl; | |
7673 | cout<<"ci = "<<ci<<endl; | |
7674 | } | |
7675 | } // end of for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) | |
7676 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 7677 | } // end of for(Int_t sc=0;sc<2;sc++) |
0328db2d | 7678 | // average products of correction terms for NUA: |
7679 | TString intFlowProductOfCorrectionTermsForNUAProName = "fIntFlowProductOfCorrectionTermsForNUAPro"; | |
7680 | intFlowProductOfCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
7681 | TProfile *intFlowProductOfCorrectionTermsForNUAPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowProductOfCorrectionTermsForNUAProName.Data())); | |
7682 | if(intFlowProductOfCorrectionTermsForNUAPro) | |
7683 | { | |
7684 | this->SetIntFlowProductOfCorrectionTermsForNUAPro(intFlowProductOfCorrectionTermsForNUAPro); | |
7685 | } else | |
7686 | { | |
7687 | cout<<"WARNING: intFlowProductOfCorrectionTermsForNUAPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7688 | } | |
489d5531 | 7689 | } else // to if(intFlowProfiles) |
7690 | { | |
7691 | cout<<"WARNING: intFlowProfiles is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7692 | } | |
7693 | ||
7694 | // d) Get pointer to list fIntFlowResults and pointers to all objects that she holds. | |
7695 | TList *intFlowResults = NULL; | |
7696 | intFlowResults = dynamic_cast<TList*>(intFlowList->FindObject("Results")); | |
7697 | if(intFlowResults) | |
7698 | { | |
7699 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with correct errors!): | |
7700 | TString intFlowCorrelationsHistName = "fIntFlowCorrelationsHist"; | |
7701 | intFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
7702 | TH1D *intFlowCorrelationsHist = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCorrelationsHistName.Data())); | |
7703 | if(intFlowCorrelationsHist) | |
7704 | { | |
7705 | this->SetIntFlowCorrelationsHist(intFlowCorrelationsHist); | |
7706 | } else | |
7707 | { | |
7708 | cout<<"WARNING: intFlowCorrelationsHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7709 | } | |
ff70ca91 | 7710 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with correct errors!) vs M: |
b3dacf6b | 7711 | if(fCalculateCumulantsVsM) |
ff70ca91 | 7712 | { |
b3dacf6b | 7713 | TString intFlowCorrelationsVsMHistName = "fIntFlowCorrelationsVsMHist"; |
7714 | intFlowCorrelationsVsMHistName += fAnalysisLabel->Data(); | |
7715 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
ff70ca91 | 7716 | { |
b3dacf6b | 7717 | TH1D *intFlowCorrelationsVsMHist = dynamic_cast<TH1D*> |
7718 | (intFlowResults->FindObject(Form("%s, %s",intFlowCorrelationsVsMHistName.Data(),correlationFlag[ci].Data()))); | |
7719 | if(intFlowCorrelationsVsMHist) | |
7720 | { | |
7721 | this->SetIntFlowCorrelationsVsMHist(intFlowCorrelationsVsMHist,ci); | |
7722 | } else | |
7723 | { | |
7724 | cout<<"WARNING: "<<Form("intFlowCorrelationsVsMHist[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7725 | } | |
7726 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
7727 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 7728 | // average all correlations for integrated flow (with correct errors!): |
7729 | TString intFlowCorrelationsAllHistName = "fIntFlowCorrelationsAllHist"; | |
7730 | intFlowCorrelationsAllHistName += fAnalysisLabel->Data(); | |
7731 | TH1D *intFlowCorrelationsAllHist = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCorrelationsAllHistName.Data())); | |
7732 | if(intFlowCorrelationsAllHist) | |
7733 | { | |
7734 | this->SetIntFlowCorrelationsAllHist(intFlowCorrelationsAllHist); | |
7735 | } else | |
7736 | { | |
7737 | cout<<"WARNING: intFlowCorrelationsAllHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7738 | } | |
7739 | // average correction terms for non-uniform acceptance (with correct errors!): | |
7740 | TString intFlowCorrectionTermsForNUAHistName = "fIntFlowCorrectionTermsForNUAHist"; | |
7741 | intFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
7742 | for(Int_t sc=0;sc<2;sc++) | |
7743 | { | |
7744 | TH1D *intFlowCorrectionTermsForNUAHist = dynamic_cast<TH1D*>(intFlowResults->FindObject((Form("%s: %s terms",intFlowCorrectionTermsForNUAHistName.Data(),sinCosFlag[sc].Data())))); | |
7745 | if(intFlowCorrectionTermsForNUAHist) | |
7746 | { | |
7747 | this->SetIntFlowCorrectionTermsForNUAHist(intFlowCorrectionTermsForNUAHist,sc); | |
7748 | } else | |
7749 | { | |
7750 | cout<<"WARNING: intFlowCorrectionTermsForNUAHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7751 | cout<<"sc = "<<sc<<endl; | |
7752 | } | |
7753 | } // end of for(Int_t sc=0;sc<2;sc++) | |
7754 | // covariances (multiplied with weight dependent prefactor): | |
7755 | TString intFlowCovariancesName = "fIntFlowCovariances"; | |
7756 | intFlowCovariancesName += fAnalysisLabel->Data(); | |
7757 | TH1D *intFlowCovariances = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCovariancesName.Data())); | |
7758 | if(intFlowCovariances) | |
7759 | { | |
7760 | this->SetIntFlowCovariances(intFlowCovariances); | |
7761 | } else | |
7762 | { | |
7763 | cout<<"WARNING: intFlowCovariances is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7764 | } | |
7765 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8>: | |
7766 | TString intFlowSumOfEventWeightsName = "fIntFlowSumOfEventWeights"; | |
7767 | intFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
7768 | for(Int_t power=0;power<2;power++) | |
7769 | { | |
7770 | TH1D *intFlowSumOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s: %s",intFlowSumOfEventWeightsName.Data(),powerFlag[power].Data()))); | |
7771 | if(intFlowSumOfEventWeights) | |
7772 | { | |
7773 | this->SetIntFlowSumOfEventWeights(intFlowSumOfEventWeights,power); | |
7774 | } else | |
7775 | { | |
7776 | cout<<"WARNING: intFlowSumOfEventWeights is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7777 | cout<<"power = "<<power<<endl; | |
7778 | } | |
7779 | } // end of for(Int_t power=0;power<2;power++) | |
7780 | // sum of products of event weights for correlations <2>, <4>, <6> and <8>: | |
7781 | TString intFlowSumOfProductOfEventWeightsName = "fIntFlowSumOfProductOfEventWeights"; | |
7782 | intFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
7783 | TH1D *intFlowSumOfProductOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowSumOfProductOfEventWeightsName.Data())); | |
7784 | if(intFlowSumOfProductOfEventWeights) | |
7785 | { | |
7786 | this->SetIntFlowSumOfProductOfEventWeights(intFlowSumOfProductOfEventWeights); | |
7787 | } else | |
7788 | { | |
7789 | cout<<"WARNING: intFlowSumOfProductOfEventWeights is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7790 | } | |
ff70ca91 | 7791 | // final result for covariances of correlations (multiplied with weight dependent prefactor) versus M |
7792 | // [0=Cov(2,4),1=Cov(2,6),2=Cov(2,8),3=Cov(4,6),4=Cov(4,8),5=Cov(6,8)]: | |
b3dacf6b | 7793 | if(fCalculateCumulantsVsM) |
ff70ca91 | 7794 | { |
b3dacf6b | 7795 | TString intFlowCovariancesVsMName = "fIntFlowCovariancesVsM"; |
7796 | intFlowCovariancesVsMName += fAnalysisLabel->Data(); | |
7797 | TString covarianceFlag[6] = {"Cov(<2>,<4>)","Cov(<2>,<6>)","Cov(<2>,<8>)","Cov(<4>,<6>)","Cov(<4>,<8>)","Cov(<6>,<8>)"}; | |
7798 | for(Int_t ci=0;ci<6;ci++) | |
7799 | { | |
7800 | TH1D *intFlowCovariancesVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowCovariancesVsMName.Data(),covarianceFlag[ci].Data()))); | |
7801 | if(intFlowCovariancesVsM) | |
ff70ca91 | 7802 | { |
b3dacf6b | 7803 | this->SetIntFlowCovariancesVsM(intFlowCovariancesVsM,ci); |
ff70ca91 | 7804 | } else |
7805 | { | |
b3dacf6b | 7806 | cout<<"WARNING: "<<Form("intFlowCovariancesVsM[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; |
ff70ca91 | 7807 | } |
b3dacf6b | 7808 | } // end of for(Int_t ci=0;ci<6;ci++) |
7809 | } // end of if(fCalculateCumulantsVsM) | |
7810 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8> versus multiplicity | |
7811 | // [0=sum{w_{<2>}},1=sum{w_{<4>}},2=sum{w_{<6>}},3=sum{w_{<8>}}][0=linear 1,1=quadratic]: | |
7812 | if(fCalculateCumulantsVsM) | |
7813 | { | |
7814 | TString intFlowSumOfEventWeightsVsMName = "fIntFlowSumOfEventWeightsVsM"; | |
7815 | intFlowSumOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
7816 | TString sumFlag[2][4] = {{"#sum_{i=1}^{N} w_{<2>}","#sum_{i=1}^{N} w_{<4>}","#sum_{i=1}^{N} w_{<6>}","#sum_{i=1}^{N} w_{<8>}"}, | |
7817 | {"#sum_{i=1}^{N} w_{<2>}^{2}","#sum_{i=1}^{N} w_{<4>}^{2}","#sum_{i=1}^{N} w_{<6>}^{2}","#sum_{i=1}^{N} w_{<8>}^{2}"}}; | |
7818 | for(Int_t si=0;si<4;si++) | |
7819 | { | |
7820 | for(Int_t power=0;power<2;power++) | |
7821 | { | |
7822 | TH1D *intFlowSumOfEventWeightsVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowSumOfEventWeightsVsMName.Data(),sumFlag[power][si].Data()))); | |
7823 | if(intFlowSumOfEventWeightsVsM) | |
7824 | { | |
7825 | this->SetIntFlowSumOfEventWeightsVsM(intFlowSumOfEventWeightsVsM,si,power); | |
7826 | } else | |
7827 | { | |
7828 | cout<<"WARNING: "<<Form("intFlowSumOfEventWeightsVsM[%d][%d]",si,power)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7829 | } | |
7830 | } // end of for(Int_t power=0;power<2;power++) | |
7831 | } // end of for(Int_t si=0;si<4;si++) | |
7832 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 7833 | // sum of products of event weights for correlations <2>, <4>, <6> and <8> vs M |
7834 | // [0=sum{w_{<2>}w_{<4>}},1=sum{w_{<2>}w_{<6>}},2=sum{w_{<2>}w_{<8>}}, | |
7835 | // 3=sum{w_{<4>}w_{<6>}},4=sum{w_{<4>}w_{<8>}},5=sum{w_{<6>}w_{<8>}}]: | |
b3dacf6b | 7836 | if(fCalculateCumulantsVsM) |
ff70ca91 | 7837 | { |
b3dacf6b | 7838 | TString intFlowSumOfProductOfEventWeightsVsMName = "fIntFlowSumOfProductOfEventWeightsVsM"; |
7839 | intFlowSumOfProductOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
7840 | TString sopowFlag[6] = {"#sum_{i=1}^{N} w_{<2>} w_{<4>}","#sum_{i=1}^{N} w_{<2>} w_{<6>}","#sum_{i=1}^{N} w_{<2>} w_{<8>}", | |
7841 | "#sum_{i=1}^{N} w_{<4>} w_{<6>}","#sum_{i=1}^{N} w_{<4>} w_{<8>}","#sum_{i=1}^{N} w_{<6>} w_{<8>}"}; | |
7842 | for(Int_t pi=0;pi<6;pi++) | |
ff70ca91 | 7843 | { |
b3dacf6b | 7844 | TH1D *intFlowSumOfProductOfEventWeightsVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowSumOfProductOfEventWeightsVsMName.Data(),sopowFlag[pi].Data()))); |
7845 | if(intFlowSumOfProductOfEventWeightsVsM) | |
7846 | { | |
7847 | this->SetIntFlowSumOfProductOfEventWeightsVsM(intFlowSumOfProductOfEventWeightsVsM,pi); | |
7848 | } else | |
7849 | { | |
7850 | cout<<"WARNING: "<<Form("intFlowSumOfProductOfEventWeightsVsM[%d]",pi)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7851 | } | |
7852 | } // end of for(Int_t pi=0;pi<6;pi++) | |
7853 | } // end of if(fCalculateCumulantsVsM) | |
0328db2d | 7854 | // covariances for NUA (multiplied with weight dependent prefactor): |
7855 | TString intFlowCovariancesNUAName = "fIntFlowCovariancesNUA"; | |
7856 | intFlowCovariancesNUAName += fAnalysisLabel->Data(); | |
7857 | TH1D *intFlowCovariancesNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCovariancesNUAName.Data())); | |
7858 | if(intFlowCovariancesNUA) | |
7859 | { | |
7860 | this->SetIntFlowCovariancesNUA(intFlowCovariancesNUA); | |
7861 | } else | |
7862 | { | |
7863 | cout<<"WARNING: intFlowCovariancesNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7864 | } | |
7865 | // sum of linear and quadratic event weights NUA terms: | |
7866 | TString intFlowSumOfEventWeightsNUAName = "fIntFlowSumOfEventWeightsNUA"; | |
7867 | intFlowSumOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
7868 | for(Int_t sc=0;sc<2;sc++) | |
7869 | { | |
7870 | for(Int_t power=0;power<2;power++) | |
7871 | { | |
7872 | TH1D *intFlowSumOfEventWeightsNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s: %s, %s",intFlowSumOfEventWeightsNUAName.Data(),powerFlag[power].Data(),sinCosFlag[sc].Data()))); | |
7873 | if(intFlowSumOfEventWeightsNUA) | |
7874 | { | |
7875 | this->SetIntFlowSumOfEventWeightsNUA(intFlowSumOfEventWeightsNUA,sc,power); | |
7876 | } else | |
7877 | { | |
7878 | cout<<"WARNING: intFlowSumOfEventWeightsNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7879 | cout<<"sc = "<<sc<<endl; | |
7880 | cout<<"power = "<<power<<endl; | |
7881 | } | |
7882 | } // end of for(Int_t power=0;power<2;power++) | |
7883 | } // end of for(Int_t sc=0;sc<2;sc++) | |
7884 | // sum of products of event weights for NUA terms: | |
7885 | TString intFlowSumOfProductOfEventWeightsNUAName = "fIntFlowSumOfProductOfEventWeightsNUA"; | |
7886 | intFlowSumOfProductOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
7887 | TH1D *intFlowSumOfProductOfEventWeightsNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowSumOfProductOfEventWeightsNUAName.Data())); | |
7888 | if(intFlowSumOfProductOfEventWeightsNUA) | |
7889 | { | |
7890 | this->SetIntFlowSumOfProductOfEventWeightsNUA(intFlowSumOfProductOfEventWeightsNUA); | |
7891 | } else | |
7892 | { | |
7893 | cout<<"WARNING: intFlowSumOfProductOfEventWeightsNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7894 | } | |
b3dacf6b | 7895 | // Final results for reference Q-cumulants: |
489d5531 | 7896 | TString intFlowQcumulantsName = "fIntFlowQcumulants"; |
7897 | intFlowQcumulantsName += fAnalysisLabel->Data(); | |
7898 | TH1D *intFlowQcumulants = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsName.Data())); | |
7899 | if(intFlowQcumulants) | |
7900 | { | |
7901 | this->SetIntFlowQcumulants(intFlowQcumulants); | |
7902 | } else | |
7903 | { | |
7904 | cout<<"WARNING: intFlowQcumulants is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7905 | } | |
b3dacf6b | 7906 | // Final results for reference Q-cumulants rebinned in M: |
7907 | if(fCalculateCumulantsVsM) | |
7908 | { | |
7909 | TString intFlowQcumulantsRebinnedInMName = "fIntFlowQcumulantsRebinnedInM"; | |
7910 | intFlowQcumulantsRebinnedInMName += fAnalysisLabel->Data(); | |
7911 | TH1D *intFlowQcumulantsRebinnedInM = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsRebinnedInMName.Data())); | |
7912 | if(intFlowQcumulantsRebinnedInM) | |
7913 | { | |
7914 | this->SetIntFlowQcumulantsRebinnedInM(intFlowQcumulantsRebinnedInM); | |
7915 | } else | |
7916 | { | |
7917 | cout<<"WARNING: intFlowQcumulantsRebinnedInM is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7918 | } | |
7919 | } // end of if(fCalculateCumulantsVsM) | |
b92ea2b9 | 7920 | // Ratio between error squared: with/without non-isotropic terms: |
7921 | TString intFlowQcumulantsErrorSquaredRatioName = "fIntFlowQcumulantsErrorSquaredRatio"; | |
7922 | intFlowQcumulantsErrorSquaredRatioName += fAnalysisLabel->Data(); | |
7923 | TH1D *intFlowQcumulantsErrorSquaredRatio = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsErrorSquaredRatioName.Data())); | |
7924 | if(intFlowQcumulantsErrorSquaredRatio) | |
7925 | { | |
7926 | this->SetIntFlowQcumulantsErrorSquaredRatio(intFlowQcumulantsErrorSquaredRatio); | |
7927 | } else | |
7928 | { | |
7929 | cout<<" WARNING: intntFlowQcumulantsErrorSquaredRatio is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7930 | } | |
ff70ca91 | 7931 | // final results for integrated Q-cumulants versus multiplicity: |
ff70ca91 | 7932 | TString cumulantFlag[4] = {"QC{2}","QC{4}","QC{6}","QC{8}"}; |
b3dacf6b | 7933 | if(fCalculateCumulantsVsM) |
ff70ca91 | 7934 | { |
b3dacf6b | 7935 | TString intFlowQcumulantsVsMName = "fIntFlowQcumulantsVsM"; |
7936 | intFlowQcumulantsVsMName += fAnalysisLabel->Data(); | |
7937 | for(Int_t co=0;co<4;co++) // cumulant order | |
ff70ca91 | 7938 | { |
b3dacf6b | 7939 | TH1D *intFlowQcumulantsVsM = dynamic_cast<TH1D*> |
7940 | (intFlowResults->FindObject(Form("%s, %s",intFlowQcumulantsVsMName.Data(),cumulantFlag[co].Data()))); | |
7941 | if(intFlowQcumulantsVsM) | |
7942 | { | |
7943 | this->SetIntFlowQcumulantsVsM(intFlowQcumulantsVsM,co); | |
7944 | } else | |
7945 | { | |
7946 | cout<<"WARNING: "<<Form("intFlowQcumulantsVsM[%d]",co)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7947 | } | |
7948 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
7949 | } // end of if(fCalculateCumulantsVsM) | |
7950 | // Final reference flow estimates from Q-cumulants: | |
489d5531 | 7951 | TString intFlowName = "fIntFlow"; |
7952 | intFlowName += fAnalysisLabel->Data(); | |
7953 | TH1D *intFlow = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowName.Data())); | |
7954 | if(intFlow) | |
7955 | { | |
7956 | this->SetIntFlow(intFlow); | |
7957 | } else | |
7958 | { | |
7959 | cout<<"WARNING: intFlow is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
ff70ca91 | 7960 | } |
b3dacf6b | 7961 | // Final reference flow estimates from Q-cumulants vs M rebinned in M: |
7962 | if(fCalculateCumulantsVsM) | |
ff70ca91 | 7963 | { |
b3dacf6b | 7964 | TString intFlowRebinnedInMName = "fIntFlowRebinnedInM"; |
7965 | intFlowRebinnedInMName += fAnalysisLabel->Data(); | |
7966 | TH1D *intFlowRebinnedInM = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowRebinnedInMName.Data())); | |
7967 | if(intFlowRebinnedInM) | |
ff70ca91 | 7968 | { |
b3dacf6b | 7969 | this->SetIntFlowRebinnedInM(intFlowRebinnedInM); |
7970 | } else | |
ff70ca91 | 7971 | { |
b3dacf6b | 7972 | cout<<"WARNING: intFlowRebinnedInM is NULL in AFAWQC::GPFIFH() !!!!"<<endl; |
7973 | } | |
7974 | } // end of if(fCalculateCumulantsVsM) | |
7975 | // integrated flow from Q-cumulants versus multiplicity: | |
7976 | if(fCalculateCumulantsVsM) | |
7977 | { | |
7978 | TString intFlowVsMName = "fIntFlowVsM"; | |
7979 | intFlowVsMName += fAnalysisLabel->Data(); | |
b77b6434 | 7980 | TString flowFlag[4] = {Form("v_{%d}{2,QC}",fHarmonic),Form("v_{%d}{4,QC}",fHarmonic),Form("v_{%d}{6,QC}",fHarmonic),Form("v_{%d}{8,QC}",fHarmonic)}; |
b3dacf6b | 7981 | for(Int_t co=0;co<4;co++) // cumulant order |
7982 | { | |
7983 | TH1D *intFlowVsM = dynamic_cast<TH1D*> | |
b77b6434 | 7984 | (intFlowResults->FindObject(Form("%s, %s",intFlowVsMName.Data(),flowFlag[co].Data()))); |
b3dacf6b | 7985 | if(intFlowVsM) |
7986 | { | |
7987 | this->SetIntFlowVsM(intFlowVsM,co); | |
7988 | } else | |
7989 | { | |
7990 | cout<<"WARNING: "<<Form("intFlowVsM[%d]",co)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7991 | } | |
7992 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
7993 | } // end of if(fCalculateCumulantsVsM) | |
2001bc3a | 7994 | // quantifying detector effects effects to correlations: |
7995 | TString intFlowDetectorBiasName = "fIntFlowDetectorBias"; | |
7996 | intFlowDetectorBiasName += fAnalysisLabel->Data(); | |
7997 | TH1D *intFlowDetectorBias = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowDetectorBiasName.Data())); | |
7998 | if(intFlowDetectorBias) | |
7999 | { | |
8000 | this->SetIntFlowDetectorBias(intFlowDetectorBias); | |
8001 | } else | |
8002 | { | |
8003 | cout<<"WARNING: intFlowDetectorBias is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8004 | } | |
8005 | // quantifying detector effects effects to correlations vs multiplicity: | |
b77b6434 | 8006 | if(fCalculateCumulantsVsM) |
2001bc3a | 8007 | { |
3c5d5752 | 8008 | TString intFlowDetectorBiasVsMName = "fIntFlowDetectorBiasVsM"; |
8009 | intFlowDetectorBiasVsMName += fAnalysisLabel->Data(); | |
8010 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2001bc3a | 8011 | { |
3c5d5752 | 8012 | TH1D *intFlowDetectorBiasVsM = dynamic_cast<TH1D*> |
8013 | (intFlowResults->FindObject(Form("%s for %s",intFlowDetectorBiasVsMName.Data(),cumulantFlag[ci].Data()))); | |
8014 | if(intFlowDetectorBiasVsM) | |
8015 | { | |
8016 | this->SetIntFlowDetectorBiasVsM(intFlowDetectorBiasVsM,ci); | |
8017 | } else | |
8018 | { | |
8019 | cout<<"WARNING: "<<Form("intFlowDetectorBiasVsM[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8020 | } | |
8021 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
b77b6434 | 8022 | } // end of if(fCalculateCumulantsVsM) |
489d5531 | 8023 | } else // to if(intFlowResults) |
8024 | { | |
8025 | cout<<"WARNING: intFlowResults is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8026 | } | |
ff70ca91 | 8027 | |
489d5531 | 8028 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForIntFlowHistograms() |
8029 | ||
489d5531 | 8030 | //================================================================================================================================ |
8031 | ||
1268c371 | 8032 | void AliFlowAnalysisWithQCumulants::GetPointersFor2DDiffFlowHistograms() |
8033 | { | |
8034 | // Get pointers for 2D differential flow histograms. | |
8035 | // a) Check pointers used in this method; | |
8036 | // b) Get pointers to 2D differential flow lists; | |
8037 | // c) Get pointers to 2D differential flow profiles; | |
8038 | // d) Get pointers to 2D differential flow histograms. | |
8039 | ||
8040 | // a) Check pointers used in this method: | |
8041 | if(!fDiffFlowList) | |
8042 | { | |
8043 | printf("\n WARNING (QC): fDiffFlowList is NULL in AFAWQC::GPF2DDFH() !!!!\n"); | |
8044 | printf(" Call method GetPointersForDiffFlowHistograms() first.\n\n"); | |
8045 | exit(0); | |
8046 | } | |
8047 | if(!fDiffFlowFlags) | |
8048 | { | |
8049 | printf("\n WARNING (QC): fDiffFlowFlags is NULL in AFAWQC::GPF2DDFH() !!!!\n\n"); | |
8050 | printf(" Call method GetPointersForDiffFlowHistograms() first.\n\n"); | |
8051 | exit(0); | |
8052 | } | |
8053 | ||
8054 | // b) Get pointers to 2D differential flow lists: | |
8055 | this->SetCalculate2DDiffFlow((Bool_t)fDiffFlowFlags->GetBinContent(5)); // to be improved - hardwired 5 | |
8056 | if(!fCalculate2DDiffFlow){return;} | |
8057 | TString typeFlag[2] = {"RP","POI"}; | |
8058 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
8059 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
8060 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
8061 | // Base list: | |
8062 | TString diffFlow2DListName = "2D"; | |
8063 | diffFlow2DListName += fAnalysisLabel->Data(); | |
8064 | fDiffFlow2D = dynamic_cast<TList*>(fDiffFlowList->FindObject(diffFlow2DListName.Data())); | |
8065 | if(!fDiffFlow2D) | |
8066 | { | |
8067 | printf("\n WARNING (QC): fDiffFlow2D is NULL in AFAWQC::GPFDFH() !!!!\n\n"); | |
8068 | exit(0); | |
8069 | } | |
8070 | // Lists holding profiles with 2D correlations: | |
8071 | TString s2DDiffFlowCorrelationsProListName = "Profiles with 2D correlations"; | |
8072 | s2DDiffFlowCorrelationsProListName += fAnalysisLabel->Data(); // to be improved | |
8073 | for(Int_t t=0;t<2;t++) | |
8074 | { | |
8075 | f2DDiffFlowCorrelationsProList[t] = dynamic_cast<TList*>(fDiffFlow2D->FindObject(Form("Profiles with 2D correlations (%s)",typeFlag[t].Data()))); | |
8076 | if(!f2DDiffFlowCorrelationsProList[t]) | |
8077 | { | |
8078 | printf("\n WARNING (QC): f2DDiffFlowCorrelationsProList[%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t); | |
8079 | exit(0); | |
8080 | } | |
8081 | } // end of for(Int_t t=0;t<2;t++) | |
8082 | ||
8083 | // c) Get pointers to 2D differential flow profiles: | |
8084 | TString s2DDiffFlowCorrelationsProName = "f2DDiffFlowCorrelationsPro"; | |
8085 | s2DDiffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
8086 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8087 | { | |
8088 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8089 | { | |
8090 | f2DDiffFlowCorrelationsPro[t][rci] = dynamic_cast<TProfile2D*>(f2DDiffFlowCorrelationsProList[t]->FindObject(Form("%s, %s, %s",s2DDiffFlowCorrelationsProName.Data(),typeFlag[t].Data(),reducedCorrelationIndex[rci].Data()))); | |
8091 | if(!f2DDiffFlowCorrelationsPro[t][rci]) | |
8092 | { | |
8093 | printf("\n WARNING (QC): f2DDiffFlowCorrelationsPro[%i][%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t,rci); | |
8094 | exit(0); | |
8095 | } else | |
8096 | { | |
8097 | this->Set2DDiffFlowCorrelationsPro(f2DDiffFlowCorrelationsPro[t][rci],t,rci); | |
8098 | } | |
8099 | } // end of for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8100 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
8101 | ||
8102 | // d) Get pointers to 2D differential flow histograms: | |
8103 | TString s2DDiffFlowCumulantsName = "f2DDiffFlowCumulants"; | |
8104 | s2DDiffFlowCumulantsName += fAnalysisLabel->Data(); | |
8105 | TString s2DDiffFlowName = "f2DDiffFlow"; | |
8106 | s2DDiffFlowName += fAnalysisLabel->Data(); | |
8107 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8108 | { | |
8109 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8110 | { | |
8111 | // 2D differential cumulants: | |
8112 | f2DDiffFlowCumulants[t][rci] = dynamic_cast<TH2D*>(f2DDiffFlowCorrelationsProList[t]->FindObject(Form("%s, %s, %s",s2DDiffFlowCumulantsName.Data(),typeFlag[t].Data(),differentialCumulantIndex[rci].Data()))); | |
8113 | if(!f2DDiffFlowCumulants[t][rci]) | |
8114 | { | |
8115 | printf("\n WARNING (QC): f2DDiffFlowCumulants[%i][%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t,rci); | |
8116 | exit(0); | |
8117 | } else | |
8118 | { | |
8119 | this->Set2DDiffFlowCumulants(f2DDiffFlowCumulants[t][rci],t,rci); | |
8120 | } | |
8121 | // 2D differential flow: | |
8122 | f2DDiffFlow[t][rci] = dynamic_cast<TH2D*>(f2DDiffFlowCorrelationsProList[t]->FindObject(Form("%s, %s, %s",s2DDiffFlowName.Data(),typeFlag[t].Data(),differentialFlowIndex[rci].Data()))); | |
8123 | if(!f2DDiffFlow[t][rci]) | |
8124 | { | |
8125 | printf("\n WARNING (QC): f2DDiffFlow[%i][%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t,rci); | |
8126 | exit(0); | |
8127 | } else | |
8128 | { | |
8129 | this->Set2DDiffFlow(f2DDiffFlow[t][rci],t,rci); | |
8130 | } | |
8131 | } // end of for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8132 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
8133 | ||
8134 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersFor2DDiffFlowHistograms() | |
8135 | ||
8136 | //================================================================================================================================ | |
8137 | ||
489d5531 | 8138 | void AliFlowAnalysisWithQCumulants::GetPointersForDiffFlowHistograms() |
8139 | { | |
8140 | // Get pointer to all objects relevant for differential flow. | |
1268c371 | 8141 | // a) Get pointer to base list for differential flow fDiffFlowList; |
8142 | // b) Get pointer to profile fDiffFlowFlags holding all flags for differential flow. Access and set some flags; | |
8143 | // c) Get pointers to nested lists fDiffFlowListProfiles and fDiffFlowListResults; | |
8144 | // d) Define flags locally (to be improved: should I promote these flags to data members?); | |
8145 | // e) Get pointers to all nested lists in fDiffFlowListProfiles and to profiles which they hold; | |
8146 | // f) Get pointers to all nested lists in fDiffFlowListResults and to histograms which they hold. | |
8147 | ||
8148 | // a) Get pointer to base list for differential flow fDiffFlowList: | |
8149 | fDiffFlowList = dynamic_cast<TList*>(fHistList->FindObject("Differential Flow")); | |
8150 | if(!fDiffFlowList) | |
489d5531 | 8151 | { |
1268c371 | 8152 | printf("\n WARNING (QC): fDiffFlowList is NULL in AFAWQC::GPFDFH() !!!!\n\n"); |
489d5531 | 8153 | exit(0); |
8154 | } | |
1268c371 | 8155 | |
8156 | // b) Get pointer to profile fDiffFlowFlags holding all flags for differential flow. Access and set some flags: | |
8157 | TString diffFlowFlagsName = "fDiffFlowFlags"; | |
8158 | diffFlowFlagsName += fAnalysisLabel->Data(); | |
8159 | fDiffFlowFlags = dynamic_cast<TProfile*>(fDiffFlowList->FindObject(diffFlowFlagsName.Data())); | |
8160 | if(fDiffFlowFlags) | |
8161 | { | |
8162 | this->SetCalculateDiffFlow((Bool_t)fDiffFlowFlags->GetBinContent(1)); // to be improved - hardwired 5 | |
8163 | } else | |
8164 | { | |
8165 | printf("\n WARNING (QC): fDiffFlowFlags is NULL in AFAWQC::GPFDFH() !!!!\n\n"); | |
8166 | printf("\n Flags in method Finish() are wrong.\n\n"); | |
8167 | exit(0); | |
8168 | } | |
8169 | ||
8170 | if(!fCalculateDiffFlow){return;} // IMPORTANT: do not move this anywhere above in this method (to be improved) | |
8171 | ||
8172 | // c) Get pointers to nested lists fDiffFlowListProfiles and fDiffFlowListResults: | |
8173 | // List holding nested lists holding profiles: | |
489d5531 | 8174 | TList *diffFlowListProfiles = NULL; |
1268c371 | 8175 | diffFlowListProfiles = dynamic_cast<TList*>(fDiffFlowList->FindObject("Profiles")); |
489d5531 | 8176 | if(!diffFlowListProfiles) |
8177 | { | |
1268c371 | 8178 | printf("\n WARNING (QC): diffFlowListProfiles is NULL in AFAWQC::GPFDFH() !!!!\n\n"); |
489d5531 | 8179 | exit(0); |
8180 | } | |
1268c371 | 8181 | // List holding nested lists holding histograms with final results: |
489d5531 | 8182 | TList *diffFlowListResults = NULL; |
1268c371 | 8183 | diffFlowListResults = dynamic_cast<TList*>(fDiffFlowList->FindObject("Results")); |
489d5531 | 8184 | if(!diffFlowListResults) |
8185 | { | |
1268c371 | 8186 | printf("\n WARNING (QC): diffFlowListResults is NULL in AFAWQC::GPFDFH() !!!!\n\n"); |
489d5531 | 8187 | exit(0); |
8188 | } | |
8189 | ||
1268c371 | 8190 | // d) Define flags locally (to be improved: should I promote these flags to data members?): |
8191 | TString typeFlag[2] = {"RP","POI"}; | |
8192 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
8193 | TString powerFlag[2] = {"linear","quadratic"}; | |
8194 | TString sinCosFlag[2] = {"sin","cos"}; | |
8195 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
8196 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
8197 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
8198 | TString reducedSquaredCorrelationIndex[4] = {"<2'>^{2}","<4'>^{2}","<6'>^{2}","<8'>^{2}"}; | |
8199 | TString mixedCorrelationIndex[8] = {"<2>","<2'>","<4>","<4'>","<6>","<6'>","<8>","<8'>"}; | |
8200 | TString covarianceName[5] = {"Cov(<2>,<2'>)","Cov(<2>,<4'>)","Cov(<4>,<2'>)","Cov(<4>,<4'>)","Cov(<2'>,<4'>)"}; | |
489d5531 | 8201 | |
1268c371 | 8202 | // e) Get pointers to all nested lists in fDiffFlowListProfiles and to profiles which they hold: |
489d5531 | 8203 | // correlations: |
8204 | TList *diffFlowCorrelationsProList[2][2] = {{NULL}}; | |
8205 | TString diffFlowCorrelationsProName = "fDiffFlowCorrelationsPro"; | |
8206 | diffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
b40a910e | 8207 | TProfile *diffFlowCorrelationsPro[2][2][4] = {{{NULL}}}; |
8208 | // squared correlations: | |
8209 | TString diffFlowSquaredCorrelationsProName = "fDiffFlowSquaredCorrelationsPro"; | |
8210 | diffFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
8211 | TProfile *diffFlowSquaredCorrelationsPro[2][2][4] = {{{NULL}}}; | |
489d5531 | 8212 | // products of correlations: |
8213 | TList *diffFlowProductOfCorrelationsProList[2][2] = {{NULL}}; | |
8214 | TString diffFlowProductOfCorrelationsProName = "fDiffFlowProductOfCorrelationsPro"; | |
8215 | diffFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
8216 | TProfile *diffFlowProductOfCorrelationsPro[2][2][8][8] = {{{{NULL}}}}; | |
8217 | // corrections: | |
8218 | TList *diffFlowCorrectionsProList[2][2] = {{NULL}}; | |
8219 | TString diffFlowCorrectionTermsForNUAProName = "fDiffFlowCorrectionTermsForNUAPro"; | |
8220 | diffFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
8221 | TProfile *diffFlowCorrectionTermsForNUAPro[2][2][2][10] = {{{{NULL}}}}; | |
8222 | for(Int_t t=0;t<2;t++) | |
8223 | { | |
8224 | for(Int_t pe=0;pe<2;pe++) | |
8225 | { | |
8226 | diffFlowCorrelationsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8227 | if(!diffFlowCorrelationsProList[t][pe]) | |
8228 | { | |
8229 | cout<<"WARNING: diffFlowCorrelationsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8230 | cout<<"t = "<<t<<endl; | |
8231 | cout<<"pe = "<<pe<<endl; | |
8232 | exit(0); | |
8233 | } | |
8234 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
8235 | { | |
b40a910e | 8236 | // reduced correlations: |
489d5531 | 8237 | diffFlowCorrelationsPro[t][pe][ci] = dynamic_cast<TProfile*>(diffFlowCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[ci].Data()))); |
8238 | if(diffFlowCorrelationsPro[t][pe][ci]) | |
8239 | { | |
8240 | this->SetDiffFlowCorrelationsPro(diffFlowCorrelationsPro[t][pe][ci],t,pe,ci); | |
8241 | } else | |
8242 | { | |
8243 | cout<<"WARNING: diffFlowCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8244 | cout<<"t = "<<t<<endl; | |
8245 | cout<<"pe = "<<pe<<endl; | |
8246 | cout<<"ci = "<<ci<<endl; | |
8247 | } | |
b40a910e | 8248 | // reduced squared correlations: |
8249 | diffFlowSquaredCorrelationsPro[t][pe][ci] = dynamic_cast<TProfile*>(diffFlowCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowSquaredCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedSquaredCorrelationIndex[ci].Data()))); | |
8250 | if(diffFlowSquaredCorrelationsPro[t][pe][ci]) | |
8251 | { | |
8252 | this->SetDiffFlowSquaredCorrelationsPro(diffFlowSquaredCorrelationsPro[t][pe][ci],t,pe,ci); | |
8253 | } else | |
8254 | { | |
8255 | cout<<"WARNING: diffFlowSquaredCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8256 | cout<<"t = "<<t<<endl; | |
8257 | cout<<"pe = "<<pe<<endl; | |
8258 | cout<<"ci = "<<ci<<endl; | |
8259 | } | |
489d5531 | 8260 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index |
8261 | // products of correlations: | |
8262 | diffFlowProductOfCorrelationsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with products of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8263 | if(!diffFlowProductOfCorrelationsProList[t][pe]) | |
8264 | { | |
8265 | cout<<"WARNING: ddiffFlowProductOfCorrelationsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8266 | cout<<"t = "<<t<<endl; | |
8267 | cout<<"pe = "<<pe<<endl; | |
8268 | exit(0); | |
8269 | } | |
8270 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
8271 | { | |
8272 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
8273 | { | |
8274 | diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = dynamic_cast<TProfile*>(diffFlowProductOfCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()))); | |
8275 | if(diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]) | |
8276 | { | |
8277 | this->SetDiffFlowProductOfCorrelationsPro(diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2],t,pe,mci1,mci2); | |
8278 | } else | |
8279 | { | |
b40a910e | 8280 | cout<<"WARNING: diffFlowProductOfCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; |
489d5531 | 8281 | cout<<"t = "<<t<<endl; |
8282 | cout<<"pe = "<<pe<<endl; | |
8283 | cout<<"mci1 = "<<mci1<<endl; | |
8284 | cout<<"mci2 = "<<mci2<<endl; | |
8285 | } | |
8286 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
8287 | } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
8288 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
8289 | // corrections: | |
8290 | diffFlowCorrectionsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8291 | if(!diffFlowCorrectionsProList[t][pe]) | |
8292 | { | |
8293 | cout<<"WARNING: diffFlowCorrectionsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8294 | cout<<"t = "<<t<<endl; | |
8295 | cout<<"pe = "<<pe<<endl; | |
8296 | exit(0); | |
8297 | } | |
8298 | // correction terms for NUA: | |
8299 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
8300 | { | |
8301 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
8302 | { | |
8303 | diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = dynamic_cast<TProfile*>(diffFlowCorrectionsProList[t][pe]->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1))); | |
8304 | if(diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]) | |
8305 | { | |
8306 | this->SetDiffFlowCorrectionTermsForNUAPro(diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti],t,pe,sc,cti); | |
8307 | } else | |
8308 | { | |
8309 | cout<<"WARNING: diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8310 | cout<<"t = "<<t<<endl; | |
8311 | cout<<"pe = "<<pe<<endl; | |
8312 | cout<<"sc = "<<sc<<endl; | |
8313 | cout<<"cti = "<<cti<<endl; | |
8314 | } | |
8315 | } // end of for(Int_t cti=0;cti<9;cti++) // correction term index | |
8316 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
8317 | // ... | |
8318 | } // end of for(Int_t pe=0;pe<2;pe++) | |
8319 | } // end of for(Int_t t=0;t<2;t++) | |
8320 | ||
1268c371 | 8321 | // f) Get pointers to all nested lists in fDiffFlowListResults and to histograms which they hold: |
489d5531 | 8322 | // reduced correlations: |
8323 | TList *diffFlowCorrelationsHistList[2][2] = {{NULL}}; | |
8324 | TString diffFlowCorrelationsHistName = "fDiffFlowCorrelationsHist"; | |
8325 | diffFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
8326 | TH1D *diffFlowCorrelationsHist[2][2][4] = {{{NULL}}}; | |
8327 | // corrections for NUA: | |
8328 | TList *diffFlowCorrectionsHistList[2][2] = {{NULL}}; | |
8329 | TString diffFlowCorrectionTermsForNUAHistName = "fDiffFlowCorrectionTermsForNUAHist"; | |
8330 | diffFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
8331 | TH1D *diffFlowCorrectionTermsForNUAHist[2][2][2][10] = {{{{NULL}}}}; | |
8332 | // differential Q-cumulants: | |
8333 | TList *diffFlowCumulantsHistList[2][2] = {{NULL}}; | |
8334 | TString diffFlowCumulantsName = "fDiffFlowCumulants"; | |
8335 | diffFlowCumulantsName += fAnalysisLabel->Data(); | |
8336 | TH1D *diffFlowCumulants[2][2][4] = {{{NULL}}}; | |
1268c371 | 8337 | // detector bias to differential Q-cumulants: |
8338 | TList *diffFlowDetectorBiasHistList[2][2] = {{NULL}}; | |
8339 | TString diffFlowDetectorBiasName = "fDiffFlowDetectorBias"; | |
8340 | diffFlowDetectorBiasName += fAnalysisLabel->Data(); | |
8341 | TH1D *diffFlowDetectorBias[2][2][4] = {{{NULL}}}; | |
489d5531 | 8342 | // differential flow estimates from Q-cumulants: |
8343 | TList *diffFlowHistList[2][2] = {{NULL}}; | |
8344 | TString diffFlowName = "fDiffFlow"; | |
8345 | diffFlowName += fAnalysisLabel->Data(); | |
8346 | TH1D *diffFlow[2][2][4] = {{{NULL}}}; | |
8347 | // differential covariances: | |
8348 | TList *diffFlowCovariancesHistList[2][2] = {{NULL}}; | |
8349 | TString diffFlowCovariancesName = "fDiffFlowCovariances"; | |
8350 | diffFlowCovariancesName += fAnalysisLabel->Data(); | |
8351 | TH1D *diffFlowCovariances[2][2][5] = {{{NULL}}}; | |
8352 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8353 | { | |
8354 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8355 | { | |
8356 | // reduced correlations: | |
8357 | diffFlowCorrelationsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8358 | if(!diffFlowCorrelationsHistList[t][pe]) | |
8359 | { | |
8360 | cout<<"WARNING: diffFlowCorrelationsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8361 | cout<<"t = "<<t<<endl; | |
8362 | cout<<"pe = "<<pe<<endl; | |
8363 | exit(0); | |
8364 | } | |
8365 | for(Int_t index=0;index<4;index++) | |
8366 | { | |
8367 | diffFlowCorrelationsHist[t][pe][index] = dynamic_cast<TH1D*>(diffFlowCorrelationsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()))); | |
8368 | if(diffFlowCorrelationsHist[t][pe][index]) | |
8369 | { | |
8370 | this->SetDiffFlowCorrelationsHist(diffFlowCorrelationsHist[t][pe][index],t,pe,index); | |
8371 | } else | |
8372 | { | |
8373 | cout<<"WARNING: diffFlowCorrelationsHist[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8374 | cout<<"t = "<<t<<endl; | |
8375 | cout<<"pe = "<<pe<<endl; | |
8376 | cout<<"index = "<<index<<endl; | |
8377 | exit(0); | |
8378 | } | |
8379 | } // end of for(Int_t index=0;index<4;index++) | |
8380 | // corrections: | |
8381 | diffFlowCorrectionsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Histograms with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8382 | if(!diffFlowCorrectionsHistList[t][pe]) | |
8383 | { | |
8384 | cout<<"WARNING: diffFlowCorrectionsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8385 | cout<<"t = "<<t<<endl; | |
8386 | cout<<"pe = "<<pe<<endl; | |
8387 | exit(0); | |
8388 | } | |
8389 | // correction terms for NUA: | |
8390 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
8391 | { | |
8392 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
8393 | { | |
8394 | diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = dynamic_cast<TH1D*>(diffFlowCorrectionsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1))); | |
8395 | if(diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]) | |
8396 | { | |
8397 | this->SetDiffFlowCorrectionTermsForNUAHist(diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti],t,pe,sc,cti); | |
8398 | } else | |
8399 | { | |
8400 | cout<<"WARNING: diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8401 | cout<<"t = "<<t<<endl; | |
8402 | cout<<"pe = "<<pe<<endl; | |
8403 | cout<<"sc = "<<sc<<endl; | |
8404 | cout<<"cti = "<<cti<<endl; | |
8405 | } | |
8406 | } // end of for(Int_t cti=0;cti<9;cti++) // correction term index | |
8407 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
8408 | // ... | |
8409 | // differential Q-cumulants: | |
8410 | diffFlowCumulantsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Differential Q-cumulants (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8411 | if(!diffFlowCumulantsHistList[t][pe]) | |
8412 | { | |
8413 | cout<<"WARNING: diffFlowCumulantsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8414 | cout<<"t = "<<t<<endl; | |
8415 | cout<<"pe = "<<pe<<endl; | |
8416 | exit(0); | |
8417 | } | |
8418 | for(Int_t index=0;index<4;index++) | |
8419 | { | |
8420 | diffFlowCumulants[t][pe][index] = dynamic_cast<TH1D*>(diffFlowCumulantsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()))); | |
8421 | if(diffFlowCumulants[t][pe][index]) | |
8422 | { | |
8423 | this->SetDiffFlowCumulants(diffFlowCumulants[t][pe][index],t,pe,index); | |
8424 | } else | |
8425 | { | |
8426 | cout<<"WARNING: diffFlowCumulants[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8427 | cout<<"t = "<<t<<endl; | |
8428 | cout<<"pe = "<<pe<<endl; | |
8429 | cout<<"index = "<<index<<endl; | |
8430 | exit(0); | |
8431 | } | |
8432 | } // end of for(Int_t index=0;index<4;index++) | |
1268c371 | 8433 | // Detector bias to differential Q-cumulants: |
8434 | diffFlowDetectorBiasHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Detector bias (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8435 | if(!diffFlowDetectorBiasHistList[t][pe]) | |
8436 | { | |
8437 | cout<<"WARNING: diffFlowDetectorBiasHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8438 | cout<<"t = "<<t<<endl; | |
8439 | cout<<"pe = "<<pe<<endl; | |
8440 | exit(0); | |
8441 | } | |
8442 | for(Int_t index=0;index<4;index++) | |
8443 | { | |
8444 | diffFlowDetectorBias[t][pe][index] = dynamic_cast<TH1D*>(diffFlowDetectorBiasHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowDetectorBiasName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()))); | |
8445 | if(diffFlowDetectorBias[t][pe][index]) | |
8446 | { | |
8447 | this->SetDiffFlowDetectorBias(diffFlowDetectorBias[t][pe][index],t,pe,index); | |
8448 | } else | |
8449 | { | |
8450 | cout<<"WARNING: diffFlowDetectorBias[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8451 | cout<<"t = "<<t<<endl; | |
8452 | cout<<"pe = "<<pe<<endl; | |
8453 | cout<<"index = "<<index<<endl; | |
8454 | exit(0); | |
8455 | } | |
8456 | } // end of for(Int_t index=0;index<4;index++) | |
489d5531 | 8457 | // differential flow estimates from Q-cumulants: |
8458 | diffFlowHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Differential flow (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8459 | if(!diffFlowHistList[t][pe]) | |
8460 | { | |
8461 | cout<<"WARNING: diffFlowHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8462 | cout<<"t = "<<t<<endl; | |
8463 | cout<<"pe = "<<pe<<endl; | |
8464 | exit(0); | |
8465 | } | |
8466 | for(Int_t index=0;index<4;index++) | |
8467 | { | |
8468 | diffFlow[t][pe][index] = dynamic_cast<TH1D*>(diffFlowHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()))); | |
8469 | if(diffFlow[t][pe][index]) | |
8470 | { | |
8471 | this->SetDiffFlow(diffFlow[t][pe][index],t,pe,index); | |
8472 | } else | |
8473 | { | |
8474 | cout<<"WARNING: diffFlow[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8475 | cout<<"t = "<<t<<endl; | |
8476 | cout<<"pe = "<<pe<<endl; | |
8477 | cout<<"index = "<<index<<endl; | |
8478 | exit(0); | |
8479 | } | |
8480 | } // end of for(Int_t index=0;index<4;index++) | |
8481 | // differential covariances: | |
8482 | diffFlowCovariancesHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Covariances of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8483 | if(!diffFlowCovariancesHistList[t][pe]) | |
8484 | { | |
8485 | cout<<"WARNING: diffFlowCovariancesHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8486 | cout<<"t = "<<t<<endl; | |
8487 | cout<<"pe = "<<pe<<endl; | |
8488 | exit(0); | |
8489 | } | |
8490 | for(Int_t covIndex=0;covIndex<5;covIndex++) | |
8491 | { | |
8492 | diffFlowCovariances[t][pe][covIndex] = dynamic_cast<TH1D*>(diffFlowCovariancesHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()))); | |
8493 | if(diffFlowCovariances[t][pe][covIndex]) | |
8494 | { | |
8495 | this->SetDiffFlowCovariances(diffFlowCovariances[t][pe][covIndex],t,pe,covIndex); | |
8496 | } else | |
8497 | { | |
8498 | cout<<"WARNING: diffFlowCovariances[t][pe][covIndex] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8499 | cout<<"t = "<<t<<endl; | |
8500 | cout<<"pe = "<<pe<<endl; | |
8501 | cout<<"covIndex = "<<covIndex<<endl; | |
8502 | exit(0); | |
8503 | } | |
8504 | } // end of for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index | |
8505 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8506 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
8507 | // sum of event weights for reduced correlations: | |
8508 | TList *diffFlowSumOfEventWeightsHistList[2][2][2] = {{{NULL}}}; | |
8509 | TString diffFlowSumOfEventWeightsName = "fDiffFlowSumOfEventWeights"; | |
8510 | diffFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
8511 | TH1D *diffFlowSumOfEventWeights[2][2][2][4] = {{{{NULL}}}}; | |
8512 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
8513 | { | |
8514 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8515 | { | |
8516 | for(Int_t p=0;p<2;p++) // power of event weights is either 1 or 2 | |
8517 | { | |
8518 | diffFlowSumOfEventWeightsHistList[t][pe][p] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Sum of %s event weights (%s, %s)",powerFlag[p].Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8519 | if(!diffFlowSumOfEventWeightsHistList[t][pe][p]) | |
8520 | { | |
8521 | cout<<"WARNING: diffFlowSumOfEventWeightsHistList[t][pe][p] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8522 | cout<<"t = "<<t<<endl; | |
8523 | cout<<"pe = "<<pe<<endl; | |
8524 | cout<<"power = "<<p<<endl; | |
8525 | exit(0); | |
8526 | } | |
8527 | for(Int_t ew=0;ew<4;ew++) // index of reduced correlation | |
8528 | { | |
8529 | diffFlowSumOfEventWeights[t][pe][p][ew] = dynamic_cast<TH1D*>(diffFlowSumOfEventWeightsHistList[t][pe][p]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()))); | |
8530 | if(diffFlowSumOfEventWeights[t][pe][p][ew]) | |
8531 | { | |
8532 | this->SetDiffFlowSumOfEventWeights(diffFlowSumOfEventWeights[t][pe][p][ew],t,pe,p,ew); | |
8533 | } else | |
8534 | { | |
8535 | cout<<"WARNING: diffFlowSumOfEventWeights[t][pe][p][ew] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8536 | cout<<"t = "<<t<<endl; | |
8537 | cout<<"pe = "<<pe<<endl; | |
8538 | cout<<"power = "<<p<<endl; | |
8539 | cout<<"ew = "<<ew<<endl; | |
8540 | exit(0); | |
8541 | } | |
8542 | } | |
8543 | } // end of for(Int_t p=0;p<2;p++) // power of event weights is either 1 or 2 | |
8544 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8545 | } // end of for(Int_t t=0;t<2;t++) // type is RP or POI | |
8546 | // | |
8547 | TList *diffFlowSumOfProductOfEventWeightsHistList[2][2] = {{NULL}}; | |
8548 | TString diffFlowSumOfProductOfEventWeightsName = "fDiffFlowSumOfProductOfEventWeights"; | |
8549 | diffFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
8550 | TH1D *diffFlowSumOfProductOfEventWeights[2][2][8][8] = {{{{NULL}}}}; | |
8551 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
8552 | { | |
8553 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8554 | { | |
8555 | diffFlowSumOfProductOfEventWeightsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Sum of products of event weights (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8556 | if(!diffFlowSumOfProductOfEventWeightsHistList[t][pe]) | |
8557 | { | |
8558 | cout<<"WARNING: diffFlowSumOfProductOfEventWeightsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8559 | cout<<"t = "<<t<<endl; | |
8560 | cout<<"pe = "<<pe<<endl; | |
8561 | exit(0); | |
8562 | } | |
8563 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
8564 | { | |
8565 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
8566 | { | |
8567 | diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = dynamic_cast<TH1D*>(diffFlowSumOfProductOfEventWeightsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()))); | |
8568 | if(diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]) | |
8569 | { | |
8570 | this->SetDiffFlowSumOfProductOfEventWeights(diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2],t,pe,mci1,mci2); | |
8571 | } else | |
8572 | { | |
8573 | cout<<"WARNING: diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8574 | cout<<"t = "<<t<<endl; | |
8575 | cout<<"pe = "<<pe<<endl; | |
8576 | cout<<"mci1 = "<<mci1<<endl; | |
8577 | cout<<"mci2 = "<<mci2<<endl; | |
8578 | exit(0); | |
8579 | } | |
8580 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
8581 | } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
8582 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
8583 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8584 | } // end of for(Int_t t=0;t<2;t++) // type is RP or POI | |
8585 | ||
8586 | } // end void AliFlowAnalysisWithQCumulants::GetPointersForDiffFlowHistograms() | |
8587 | ||
489d5531 | 8588 | //================================================================================================================================ |
8589 | ||
1268c371 | 8590 | void AliFlowAnalysisWithQCumulants::BookEverythingFor2DDifferentialFlow() |
8591 | { | |
8592 | // Book all objects needed for 2D differential flow. | |
8593 | // a) Define flags locally (to be improved: should I promote flags to data members?); | |
8594 | // b) Book e-b-e quantities; | |
8595 | // c) Book 2D profiles; | |
8596 | // d) Book 2D histograms. | |
8597 | ||
8598 | if(!fCalculate2DDiffFlow){return;} | |
8599 | ||
8600 | // a) Define flags locally (to be improved: should I promote flags to data members?): | |
8601 | TString typeFlag[2] = {"RP","POI"}; | |
8602 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
8603 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
8604 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
8605 | ||
8606 | // b) Book e-b-e quantities: | |
8607 | TProfile2D styleRe("typeMultiplePowerRe","typeMultiplePowerRe",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
8608 | TProfile2D styleIm("typeMultiplePowerIm","typeMultiplePowerIm",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
8609 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) | |
8610 | { | |
8611 | for(Int_t m=0;m<4;m++) | |
8612 | { | |
8613 | for(Int_t k=0;k<9;k++) | |
8614 | { | |
8615 | fReRPQ2dEBE[t][m][k] = (TProfile2D*)styleRe.Clone(Form("typeFlag%dmultiple%dpower%dRe",t,m,k)); | |
8616 | fImRPQ2dEBE[t][m][k] = (TProfile2D*)styleIm.Clone(Form("typeFlag%dmultiple%dpower%dIm",t,m,k)); | |
8617 | } | |
8618 | } | |
8619 | } | |
8620 | TProfile2D styleS("typePower","typePower",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
8621 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) | |
8622 | { | |
8623 | for(Int_t k=0;k<9;k++) | |
8624 | { | |
8625 | fs2dEBE[t][k] = (TProfile2D*)styleS.Clone(Form("typeFlag%dpower%d",t,k)); | |
8626 | } | |
8627 | } | |
8628 | ||
8629 | // c) Book 2D profiles: | |
8630 | TString s2DDiffFlowCorrelationsProName = "f2DDiffFlowCorrelationsPro"; | |
8631 | s2DDiffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
8632 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8633 | { | |
8634 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8635 | { | |
8636 | f2DDiffFlowCorrelationsPro[t][rci] = new TProfile2D(Form("%s, %s, %s",s2DDiffFlowCorrelationsProName.Data(),typeFlag[t].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s",s2DDiffFlowCorrelationsProName.Data(),typeFlag[t].Data(),reducedCorrelationIndex[rci].Data()),fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,""); | |
8637 | f2DDiffFlowCorrelationsPro[t][rci]->Sumw2(); | |
8638 | f2DDiffFlowCorrelationsPro[t][rci]->SetXTitle("p_{t}"); | |
8639 | f2DDiffFlowCorrelationsPro[t][rci]->SetYTitle("#eta"); | |
8640 | f2DDiffFlowCorrelationsProList[t]->Add(f2DDiffFlowCorrelationsPro[t][rci]); | |
8641 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
8642 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POIs | |
8643 | ||
8644 | // d) Book 2D histograms: | |
8645 | TString s2DDiffFlowCumulantsName = "f2DDiffFlowCumulants"; | |
8646 | s2DDiffFlowCumulantsName += fAnalysisLabel->Data(); | |
8647 | TString s2DDiffFlowName = "f2DDiffFlow"; | |
8648 | s2DDiffFlowName += fAnalysisLabel->Data(); | |
8649 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8650 | { | |
8651 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8652 | { | |
8653 | // 2D diferential cumulants: | |
8654 | f2DDiffFlowCumulants[t][rci] = new TH2D(Form("%s, %s, %s",s2DDiffFlowCumulantsName.Data(),typeFlag[t].Data(),differentialCumulantIndex[rci].Data()),Form("%s, %s, %s",s2DDiffFlowCumulantsName.Data(),typeFlag[t].Data(),differentialCumulantIndex[rci].Data()),fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
8655 | f2DDiffFlowCumulants[t][rci]->SetXTitle("p_{t}"); | |
8656 | f2DDiffFlowCumulants[t][rci]->SetYTitle("#eta"); | |
8657 | f2DDiffFlowCorrelationsProList[t]->Add(f2DDiffFlowCumulants[t][rci]); // to be improved - moved to another list | |
8658 | // 2D differential flow: | |
8659 | f2DDiffFlow[t][rci] = new TH2D(Form("%s, %s, %s",s2DDiffFlowName.Data(),typeFlag[t].Data(),differentialFlowIndex[rci].Data()),Form("%s, %s, %s",s2DDiffFlowName.Data(),typeFlag[t].Data(),differentialFlowIndex[rci].Data()),fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
8660 | f2DDiffFlow[t][rci]->SetXTitle("p_{t}"); | |
8661 | f2DDiffFlow[t][rci]->SetYTitle("#eta"); | |
8662 | f2DDiffFlowCorrelationsProList[t]->Add(f2DDiffFlow[t][rci]); // to be improved - moved to another list | |
8663 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
8664 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POIs | |
8665 | ||
8666 | } // void AliFlowAnalysisWithQCumulants::BookEverythingFor2DDifferentialFlow() | |
8667 | ||
8668 | //================================================================================================================================ | |
489d5531 | 8669 | |
8670 | void AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow() | |
8671 | { | |
8672 | // Book all histograms and profiles needed for differential flow. | |
1268c371 | 8673 | // a) Book profile to hold all flags for differential flow; |
8674 | // b) Define flags locally (to be improved: should I promote flags to data members?); | |
489d5531 | 8675 | // c) Book e-b-e quantities; |
8676 | // d) Book profiles; | |
8677 | // e) Book histograms holding final results. | |
8678 | ||
1268c371 | 8679 | // a) Book profile to hold all flags for differential flow: |
8680 | TString diffFlowFlagsName = "fDiffFlowFlags"; | |
8681 | diffFlowFlagsName += fAnalysisLabel->Data(); | |
8682 | fDiffFlowFlags = new TProfile(diffFlowFlagsName.Data(),"Flags for differential flow",5,0,5); | |
8683 | fDiffFlowFlags->SetTickLength(-0.01,"Y"); | |
8684 | fDiffFlowFlags->SetMarkerStyle(25); | |
8685 | fDiffFlowFlags->SetLabelSize(0.04,"X"); | |
8686 | fDiffFlowFlags->SetLabelOffset(0.02,"Y"); | |
8687 | fDiffFlowFlags->GetXaxis()->SetBinLabel(1,"Calculate diff. flow"); | |
8688 | fDiffFlowFlags->GetXaxis()->SetBinLabel(2,"Particle weights"); | |
8689 | fDiffFlowFlags->GetXaxis()->SetBinLabel(3,"Event weights"); | |
8690 | fDiffFlowFlags->GetXaxis()->SetBinLabel(4,"Correct for NUA"); | |
8691 | fDiffFlowFlags->GetXaxis()->SetBinLabel(5,"Calculate 2D diff. flow"); | |
8692 | fDiffFlowList->Add(fDiffFlowFlags); | |
8693 | ||
8694 | if(!fCalculateDiffFlow){return;} | |
8695 | ||
8696 | // b) Define flags locally (to be improved: should I promote flags to data members?): | |
489d5531 | 8697 | TString typeFlag[2] = {"RP","POI"}; |
8698 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
8699 | TString powerFlag[2] = {"linear","quadratic"}; | |
8700 | TString sinCosFlag[2] = {"sin","cos"}; | |
8701 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
8702 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
8703 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
b40a910e | 8704 | TString reducedSquaredCorrelationIndex[4] = {"<2'>^{2}","<4'>^{2}","<6'>^{2}","<8'>^{2}"}; |
489d5531 | 8705 | TString mixedCorrelationIndex[8] = {"<2>","<2'>","<4>","<4'>","<6>","<6'>","<8>","<8'>"}; |
8706 | TString covarianceName[5] = {"Cov(<2>,<2'>)","Cov(<2>,<4'>)","Cov(<4>,<2'>)","Cov(<4>,<4'>)","Cov(<2'>,<4'>)"}; | |
8707 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
8708 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
8709 | Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
1268c371 | 8710 | |
489d5531 | 8711 | // c) Book e-b-e quantities: |
8712 | // Event-by-event r_{m*n,k}(pt,eta), p_{m*n,k}(pt,eta) and q_{m*n,k}(pt,eta) | |
8713 | // Explanantion of notation: | |
8714 | // 1.) n is harmonic, m is multiple of harmonic; | |
8715 | // 2.) k is power of particle weight; | |
8716 | // 3.) r_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for RPs in particular (pt,eta) bin (i-th RP is weighted with w_i^k); | |
8717 | // 4.) p_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for POIs in particular (pt,eta) bin | |
8718 | // (if i-th POI is also RP, than it is weighted with w_i^k); | |
8719 | // 5.) q_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for particles which are both RPs and POIs in particular (pt,eta) bin | |
8720 | // (i-th RP&&POI is weighted with w_i^k) | |
8721 | ||
8722 | // 1D: | |
8723 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP && POI ) | |
8724 | { | |
8725 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8726 | { | |
8727 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
8728 | { | |
8729 | for(Int_t k=0;k<9;k++) // power of particle weight | |
8730 | { | |
8731 | fReRPQ1dEBE[t][pe][m][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%dpower%dRe",t,pe,m,k), | |
8732 | Form("TypeFlag%dpteta%dmultiple%dpower%dRe",t,pe,m,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8733 | fImRPQ1dEBE[t][pe][m][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%dpower%dIm",t,pe,m,k), | |
8734 | Form("TypeFlag%dpteta%dmultiple%dpower%dIm",t,pe,m,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8735 | } | |
8736 | } | |
8737 | } | |
8738 | } | |
8739 | // to be improved (add explanation of fs1dEBE[t][pe][k]): | |
8740 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) | |
8741 | { | |
8742 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8743 | { | |
8744 | for(Int_t k=0;k<9;k++) // power of particle weight | |
8745 | { | |
8746 | fs1dEBE[t][pe][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%d",t,pe,k), | |
8747 | Form("TypeFlag%dpteta%dmultiple%d",t,pe,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8748 | } | |
8749 | } | |
8750 | } | |
8751 | // correction terms for nua: | |
8752 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
8753 | { | |
8754 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8755 | { | |
8756 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
8757 | { | |
8758 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
8759 | { | |
8760 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti] = new TH1D(Form("typeFlag%d pteta%d sincos%d cti%d",t,pe,sc,cti), | |
8761 | Form("typeFlag%d pteta%d sincos%d cti%d",t,pe,sc,cti),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8762 | } | |
8763 | } | |
8764 | } | |
8765 | } | |
489d5531 | 8766 | // reduced correlations e-b-e: |
8767 | TString diffFlowCorrelationsEBEName = "fDiffFlowCorrelationsEBE"; | |
8768 | diffFlowCorrelationsEBEName += fAnalysisLabel->Data(); | |
8769 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8770 | { | |
8771 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8772 | { | |
8773 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8774 | { | |
8775 | fDiffFlowCorrelationsEBE[t][pe][rci] = new TH1D(Form("%s, %s, %s, %s",diffFlowCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8776 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
8777 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8778 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
8779 | // event weights for reduced correlations e-b-e: | |
8780 | TString diffFlowEventWeightsForCorrelationsEBEName = "fDiffFlowEventWeightsForCorrelationsEBE"; | |
8781 | diffFlowEventWeightsForCorrelationsEBEName += fAnalysisLabel->Data(); | |
8782 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8783 | { | |
8784 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8785 | { | |
8786 | for(Int_t rci=0;rci<4;rci++) // event weight for reduced correlation index | |
8787 | { | |
8788 | fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci] = new TH1D(Form("%s, %s, %s, eW for %s",diffFlowEventWeightsForCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, eW for %s",diffFlowEventWeightsForCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8789 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
8790 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8791 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
8792 | ||
8793 | // d) Book profiles; | |
8794 | // reduced correlations: | |
8795 | TString diffFlowCorrelationsProName = "fDiffFlowCorrelationsPro"; | |
8796 | diffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
b40a910e | 8797 | // reduced squared correlations: |
8798 | TString diffFlowSquaredCorrelationsProName = "fDiffFlowSquaredCorrelationsPro"; | |
8799 | diffFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
489d5531 | 8800 | // corrections terms: |
8801 | TString diffFlowCorrectionTermsForNUAProName = "fDiffFlowCorrectionTermsForNUAPro"; | |
8802 | diffFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
b40a910e | 8803 | // reduced correlations: |
489d5531 | 8804 | for(Int_t t=0;t<2;t++) // type: RP or POI |
8805 | { | |
8806 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8807 | { | |
8808 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8809 | { | |
489d5531 | 8810 | fDiffFlowCorrelationsPro[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe],"s"); |
b40a910e | 8811 | fDiffFlowCorrelationsPro[t][pe][rci]->Sumw2(); |
489d5531 | 8812 | fDiffFlowCorrelationsPro[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data()); |
8813 | fDiffFlowCorrelationsProList[t][pe]->Add(fDiffFlowCorrelationsPro[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations) | |
8814 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
8815 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8816 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
b40a910e | 8817 | // reduced squared correlations: |
8818 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8819 | { | |
8820 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8821 | { | |
8822 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8823 | { | |
8824 | fDiffFlowSquaredCorrelationsPro[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowSquaredCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedSquaredCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowSquaredCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedSquaredCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe],"s"); | |
8825 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->Sumw2(); | |
8826 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data()); | |
8827 | fDiffFlowCorrelationsProList[t][pe]->Add(fDiffFlowSquaredCorrelationsPro[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations) | |
8828 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
8829 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8830 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
489d5531 | 8831 | // correction terms for nua: |
8832 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
8833 | { | |
8834 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8835 | { | |
8836 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
8837 | { | |
8838 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
8839 | { | |
8840 | fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = new TProfile(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8841 | fDiffFlowCorrectionsProList[t][pe]->Add(fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]); | |
8842 | } | |
8843 | } | |
8844 | } | |
8845 | } | |
8846 | // e) Book histograms holding final results. | |
8847 | // reduced correlations: | |
8848 | TString diffFlowCorrelationsHistName = "fDiffFlowCorrelationsHist"; | |
8849 | diffFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
8850 | // corrections terms: | |
8851 | TString diffFlowCorrectionTermsForNUAHistName = "fDiffFlowCorrectionTermsForNUAHist"; | |
8852 | diffFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
8853 | // differential covariances: | |
8854 | TString diffFlowCovariancesName = "fDiffFlowCovariances"; | |
8855 | diffFlowCovariancesName += fAnalysisLabel->Data(); | |
8856 | // differential Q-cumulants: | |
8857 | TString diffFlowCumulantsName = "fDiffFlowCumulants"; | |
8858 | diffFlowCumulantsName += fAnalysisLabel->Data(); | |
1268c371 | 8859 | // Detector bias to differential Q-cumulants: |
8860 | TString diffFlowDetectorBiasName = "fDiffFlowDetectorBias"; | |
8861 | diffFlowDetectorBiasName += fAnalysisLabel->Data(); | |
489d5531 | 8862 | // differential flow: |
8863 | TString diffFlowName = "fDiffFlow"; | |
8864 | diffFlowName += fAnalysisLabel->Data(); | |
8865 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8866 | { | |
8867 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8868 | { | |
8869 | for(Int_t index=0;index<4;index++) | |
8870 | { | |
8871 | // reduced correlations: | |
8872 | fDiffFlowCorrelationsHist[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8873 | fDiffFlowCorrelationsHist[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
8874 | fDiffFlowCorrelationsHistList[t][pe]->Add(fDiffFlowCorrelationsHist[t][pe][index]); | |
8875 | // differential Q-cumulants: | |
8876 | fDiffFlowCumulants[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8877 | fDiffFlowCumulants[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
8878 | fDiffFlowCumulantsHistList[t][pe]->Add(fDiffFlowCumulants[t][pe][index]); | |
1268c371 | 8879 | // Detector bias to differential Q-cumulants: |
8880 | fDiffFlowDetectorBias[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowDetectorBiasName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowDetectorBiasName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8881 | fDiffFlowDetectorBias[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
8882 | fDiffFlowDetectorBias[t][pe][index]->SetTitle(Form("#frac{corrected}{measured} %s",differentialCumulantIndex[index].Data())); | |
8883 | fDiffFlowDetectorBiasHistList[t][pe]->Add(fDiffFlowDetectorBias[t][pe][index]); | |
489d5531 | 8884 | // differential flow estimates from Q-cumulants: |
8885 | fDiffFlow[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8886 | fDiffFlow[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
8887 | fDiffFlowHistList[t][pe]->Add(fDiffFlow[t][pe][index]); | |
8888 | } // end of for(Int_t index=0;index<4;index++) | |
8889 | for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index | |
8890 | { | |
8891 | // differential covariances: | |
8892 | fDiffFlowCovariances[t][pe][covIndex] = new TH1D(Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()),Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8893 | fDiffFlowCovariances[t][pe][covIndex]->SetXTitle(ptEtaFlag[pe].Data()); | |
8894 | fDiffFlowCovariancesHistList[t][pe]->Add(fDiffFlowCovariances[t][pe][covIndex]); | |
8895 | } // end of for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index | |
8896 | // products of both types of correlations: | |
8897 | TString diffFlowProductOfCorrelationsProName = "fDiffFlowProductOfCorrelationsPro"; | |
8898 | diffFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
8899 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
8900 | { | |
8901 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
8902 | { | |
8903 | fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = new TProfile(Form("%s, %s, %s, %s, %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),Form("%s, %s, %s, %s #times %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8904 | fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]->SetXTitle(ptEtaFlag[pe].Data()); | |
8905 | fDiffFlowProductOfCorrelationsProList[t][pe]->Add(fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]); | |
8906 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
8907 | } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
8908 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
8909 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8910 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
8911 | // sums of event weights for reduced correlations: | |
8912 | TString diffFlowSumOfEventWeightsName = "fDiffFlowSumOfEventWeights"; | |
8913 | diffFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
8914 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
8915 | { | |
8916 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8917 | { | |
8918 | for(Int_t p=0;p<2;p++) // power of weights is either 1 or 2 | |
8919 | { | |
8920 | for(Int_t ew=0;ew<4;ew++) // index of reduced correlation | |
8921 | { | |
8922 | fDiffFlowSumOfEventWeights[t][pe][p][ew] = new TH1D(Form("%s, %s, %s, %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()),Form("%s, %s, %s, power = %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8923 | fDiffFlowSumOfEventWeights[t][pe][p][ew]->SetXTitle(ptEtaFlag[pe].Data()); | |
8924 | fDiffFlowSumOfEventWeightsHistList[t][pe][p]->Add(fDiffFlowSumOfEventWeights[t][pe][p][ew]); // to be improved (add dedicated list to hold all this) | |
8925 | } | |
8926 | } | |
8927 | } | |
8928 | } | |
8929 | // sum of products of event weights for both types of correlations: | |
8930 | TString diffFlowSumOfProductOfEventWeightsName = "fDiffFlowSumOfProductOfEventWeights"; | |
8931 | diffFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
8932 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
8933 | { | |
8934 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8935 | { | |
8936 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
8937 | { | |
8938 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
8939 | { | |
8940 | fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = new TH1D(Form("%s, %s, %s, %s, %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),Form("%s, %s, %s, %s #times %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8941 | fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]->SetXTitle(ptEtaFlag[pe].Data()); | |
8942 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]->Add(fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]); | |
8943 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
8944 | } | |
8945 | } | |
8946 | } | |
8947 | } | |
8948 | // correction terms for nua: | |
8949 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
8950 | { | |
8951 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8952 | { | |
8953 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
8954 | { | |
8955 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
8956 | { | |
8957 | fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = new TH1D(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8958 | fDiffFlowCorrectionsHistList[t][pe]->Add(fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]); | |
8959 | } | |
8960 | } | |
8961 | } | |
8962 | } | |
8963 | ||
8964 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow() | |
8965 | ||
489d5531 | 8966 | //================================================================================================================================ |
8967 | ||
489d5531 | 8968 | void AliFlowAnalysisWithQCumulants::CalculateQcumulantsCorrectedForNUAIntFlow() |
8969 | { | |
8970 | // Calculate generalized Q-cumulants (cumulants corrected for non-unifom acceptance). | |
8971 | ||
b92ea2b9 | 8972 | // Isotropic cumulants: |
8973 | Double_t QC2 = fIntFlowQcumulants->GetBinContent(1); | |
8974 | Double_t QC2Error = fIntFlowQcumulants->GetBinError(1); | |
8975 | Double_t QC4 = fIntFlowQcumulants->GetBinContent(2); | |
8976 | Double_t QC4Error = fIntFlowQcumulants->GetBinError(2); | |
8977 | //Double_t QC6 = fIntFlowQcumulants->GetBinContent(3); | |
8978 | //Double_t QC6Error = fIntFlowQcumulants->GetBinError(3); | |
8979 | //Double_t QC8 = fIntFlowQcumulants->GetBinContent(4); | |
8980 | //Double_t QC8Error = fIntFlowQcumulants->GetBinError(4); | |
8981 | ||
8982 | // Measured 2-, 4-, 6- and 8-particle correlations: | |
489d5531 | 8983 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> |
b92ea2b9 | 8984 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <<2>> |
489d5531 | 8985 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> |
b92ea2b9 | 8986 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <<4>> |
489d5531 | 8987 | //Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> |
489d5531 | 8988 | //Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <<6>> |
b92ea2b9 | 8989 | //Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> |
489d5531 | 8990 | //Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <<8>> |
b92ea2b9 | 8991 | |
8992 | // Non-isotropic terms: | |
8993 | Double_t c1 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1); // <<cos(n*phi1)>> | |
8994 | Double_t c1Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(1); // statistical error of <<cos(n*phi1)>> | |
8995 | Double_t c2 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2); // <<cos(n*(phi1+phi2))>> | |
8996 | Double_t c2Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(2); // statistical error of <<cos(n*(phi1+phi2))>> | |
8997 | Double_t c3 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(3); // <<cos(n*(phi1-phi2-phi3))>> | |
8998 | Double_t c3Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(3); // statistical error of <<cos(n*(phi1-phi2-phi3))>> | |
8999 | Double_t s1 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1); // <<sin(n*phi1)>> | |
9000 | Double_t s1Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(1); // statistical error of <<sin(n*phi1)>> | |
9001 | Double_t s2 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2); // <<sin(n*(phi1+phi2))>> | |
9002 | Double_t s2Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(2); // statistical error of <<sin(n*(phi1+phi2))>> | |
9003 | Double_t s3 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(3); // <<sin(n*(phi1-phi2-phi3))>> | |
9004 | Double_t s3Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(3); // statistical error of <<sin(n*(phi1-phi2-phi3))>> | |
9005 | ||
9006 | // Shortcuts: | |
9007 | Double_t a1 = 2.*pow(c1,2.)+2.*pow(s1,2.)-two; | |
9008 | Double_t a2 = 6.*pow(c1,3.)-2.*c1*c2+c3+6.*c1*pow(s1,2.)-2.*s1*s2-4.*c1*two; | |
9009 | Double_t a3 = 2.*pow(s1,2.)-2.*pow(c1,2.)+c2; | |
9010 | Double_t a4 = 6.*pow(s1,3.)+6.*pow(c1,2.)*s1+2.*c2*s1-2.*c1*s2-s3-4.*s1*two; | |
9011 | Double_t a5 = 4.*c1*s1-s2; | |
9012 | ||
9013 | // Covariances (including weight dependent prefactor): | |
8e1cefdd | 9014 | Double_t wCov1 = 0.; // w*Cov(<2>,<cos(phi)) |
9015 | Double_t wCov2 = 0.; // w*Cov(<2>,<sin(phi)) | |
9016 | Double_t wCov3 = 0.; // w*Cov(<cos(phi),<sin(phi)) | |
9017 | Double_t wCov4 = 0.; // w*Cov(<2>,<4>) | |
9018 | Double_t wCov5 = 0.; // w*Cov(<2>,<cos(#phi_{1}+#phi_{2})>) | |
9019 | Double_t wCov6 = 0.; // w*Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9020 | Double_t wCov7 = 0.; // w*Cov(<2>,<sin(#phi_{1}+#phi_{2})>) | |
9021 | Double_t wCov8 = 0.; // w*Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9022 | Double_t wCov9 = 0.; // w*Cov(<4>,<cos(#phi)> | |
9023 | Double_t wCov10 = 0.; // w*Cov(<4>,<cos(#phi_{1}+#phi_{2})>) | |
9024 | Double_t wCov11 = 0.; // w*Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9025 | Double_t wCov12 = 0.; // w*Cov(<4>,<sin(#phi)> | |
9026 | Double_t wCov13 = 0.; // w*Cov(<4>,<sin(#phi_{1}+#phi_{2})>) | |
9027 | Double_t wCov14 = 0.; // w*Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9028 | Double_t wCov15 = 0.; // w*Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
9029 | Double_t wCov16 = 0.; // w*Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9030 | Double_t wCov17 = 0.; // w*Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
9031 | Double_t wCov18 = 0.; // w*Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9032 | Double_t wCov19 = 0.; // w*Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9033 | Double_t wCov20 = 0.; // w*Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
9034 | Double_t wCov21 = 0.; // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>) | |
9035 | Double_t wCov22 = 0.; // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9036 | Double_t wCov23 = 0.; // w*Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9037 | Double_t wCov24 = 0.; // w*Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9038 | Double_t wCov25 = 0.; // w*Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>) | |
9039 | Double_t wCov26 = 0.; // w*Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
9040 | Double_t wCov27 = 0.; // w*Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9041 | Double_t wCov28 = 0.; // w*Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9042 | if(!fForgetAboutCovariances) | |
9043 | { | |
9044 | wCov1 = fIntFlowCovariancesNUA->GetBinContent(1); // w*Cov(<2>,<cos(phi)) | |
9045 | wCov2 = fIntFlowCovariancesNUA->GetBinContent(2); // w*Cov(<2>,<sin(phi)) | |
9046 | wCov3 = fIntFlowCovariancesNUA->GetBinContent(3); // w*Cov(<cos(phi),<sin(phi)) | |
9047 | wCov4 = fIntFlowCovariances->GetBinContent(1); // w*Cov(<2>,<4>) | |
9048 | wCov5 = fIntFlowCovariancesNUA->GetBinContent(4); // w*Cov(<2>,<cos(#phi_{1}+#phi_{2})>) | |
9049 | wCov6 = fIntFlowCovariancesNUA->GetBinContent(6); // w*Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9050 | wCov7 = fIntFlowCovariancesNUA->GetBinContent(5); // w*Cov(<2>,<sin(#phi_{1}+#phi_{2})>) | |
9051 | wCov8 = fIntFlowCovariancesNUA->GetBinContent(7); // w*Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9052 | wCov9 = fIntFlowCovariancesNUA->GetBinContent(8); // w*Cov(<4>,<cos(#phi)> | |
9053 | wCov10 = fIntFlowCovariancesNUA->GetBinContent(10); // w*Cov(<4>,<cos(#phi_{1}+#phi_{2})>) | |
9054 | wCov11 = fIntFlowCovariancesNUA->GetBinContent(12); // w*Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9055 | wCov12 = fIntFlowCovariancesNUA->GetBinContent(9); // w*Cov(<4>,<sin(#phi)> | |
9056 | wCov13 = fIntFlowCovariancesNUA->GetBinContent(11); // w*Cov(<4>,<sin(#phi_{1}+#phi_{2})>) | |
9057 | wCov14 = fIntFlowCovariancesNUA->GetBinContent(13); // w*Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9058 | wCov15 = fIntFlowCovariancesNUA->GetBinContent(14); // w*Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
9059 | wCov16 = fIntFlowCovariancesNUA->GetBinContent(16); // w*Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9060 | wCov17 = fIntFlowCovariancesNUA->GetBinContent(15); // w*Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
9061 | wCov18 = fIntFlowCovariancesNUA->GetBinContent(17); // w*Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9062 | wCov19 = fIntFlowCovariancesNUA->GetBinContent(23); // w*Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9063 | wCov20 = fIntFlowCovariancesNUA->GetBinContent(18); // w*Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
9064 | wCov21 = fIntFlowCovariancesNUA->GetBinContent(22); // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>) | |
9065 | wCov22 = fIntFlowCovariancesNUA->GetBinContent(24); // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9066 | wCov23 = fIntFlowCovariancesNUA->GetBinContent(20); // w*Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9067 | wCov24 = fIntFlowCovariancesNUA->GetBinContent(25); // w*Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9068 | wCov25 = fIntFlowCovariancesNUA->GetBinContent(27); // w*Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>) | |
9069 | wCov26 = fIntFlowCovariancesNUA->GetBinContent(19); // w*Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
9070 | wCov27 = fIntFlowCovariancesNUA->GetBinContent(21); // w*Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9071 | wCov28 = fIntFlowCovariancesNUA->GetBinContent(26); // w*Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9072 | } // end of if(!fForgetAboutCovariances) | |
9073 | ||
b92ea2b9 | 9074 | // Calculating generalized QC{2}: |
9075 | // Generalized QC{2}: | |
9076 | Double_t gQC2 = two - pow(c1,2.) - pow(s1,2.); | |
9077 | if(fApplyCorrectionForNUA){fIntFlowQcumulants->SetBinContent(1,gQC2);} | |
9078 | // Statistical error of generalized QC{2}: | |
9079 | Double_t gQC2ErrorSquared = pow(twoError,2.)+4.*pow(c1,2.)*pow(c1Error,2.) | |
9080 | + 4.*pow(s1,2.)*pow(s1Error,2.) | |
9081 | - 4*c1*wCov1-4*s1*wCov2 | |
9082 | + 8.*c1*s1*wCov3; | |
9083 | // Store ratio of error squared - with/without NUA terms: | |
9084 | Double_t ratioErrorSquaredQC2 = 0.; | |
9085 | if(fIntFlowQcumulants->GetBinError(1)>0.) | |
9086 | { | |
9087 | ratioErrorSquaredQC2 = (gQC2ErrorSquared/pow(fIntFlowQcumulants->GetBinError(1),2.)); | |
9088 | fIntFlowQcumulantsErrorSquaredRatio->SetBinContent(1,ratioErrorSquaredQC2); | |
9089 | } | |
9090 | // If enabled, store error by including non-isotropic terms: | |
b77b6434 | 9091 | if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 9092 | { |
9093 | if(gQC2ErrorSquared>=0.) | |
9094 | { | |
9095 | fIntFlowQcumulants->SetBinError(1,pow(gQC2ErrorSquared,0.5)); | |
9096 | } else | |
9097 | { | |
9098 | fIntFlowQcumulants->SetBinError(1,0.); | |
9099 | cout<<endl; | |
9100 | cout<<" WARNING (QC): Statistical error of generalized QC{2} is imaginary !!!!"<<endl; | |
9101 | cout<<endl; | |
9102 | } | |
b77b6434 | 9103 | } // end of if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 9104 | // Quantify detector bias to QC{2}: |
9105 | if(TMath::Abs(QC2)>0.) | |
9106 | { | |
9107 | fIntFlowDetectorBias->SetBinContent(1,gQC2/QC2); | |
9108 | if(QC2Error>0.) | |
9109 | { | |
9110 | Double_t errorSquared = gQC2ErrorSquared/pow(QC2,2.)+pow(gQC2,2.)*pow(QC2Error,2.)/pow(QC2,4.); | |
9111 | if(errorSquared>0.) | |
9112 | { | |
9113 | fIntFlowDetectorBias->SetBinError(1,pow(errorSquared,0.5)); | |
9114 | } | |
9115 | } | |
9116 | } // end of if(TMath::Abs(QC2)>0.) | |
9117 | ||
9118 | // Calculating generalized QC{4}: | |
9119 | // Generalized QC{4}: | |
9120 | Double_t gQC4 = four-2.*pow(two,2.) | |
9121 | - 4.*c1*c3+4.*s1*s3-pow(c2,2.)-pow(s2,2.) | |
9122 | + 4.*c2*(pow(c1,2.)-pow(s1,2.))+8.*s2*s1*c1 | |
9123 | + 8.*two*(pow(c1,2.)+pow(s1,2.))-6.*pow((pow(c1,2.)+pow(s1,2.)),2.); | |
9124 | if(fApplyCorrectionForNUA){fIntFlowQcumulants->SetBinContent(2,gQC4);} | |
9125 | // Statistical error of generalized QC{4}: | |
9126 | Double_t gQC4ErrorSquared = 16.*pow(a1,2.)*pow(twoError,2.)+pow(fourError,2.)+16.*pow(a2,2.)*pow(c1Error,2.) | |
9127 | + 4.*pow(a3,2.)*pow(c2Error,2.)+16.*pow(c1,2.)*pow(c3Error,2.) | |
9128 | + 16.*pow(a4,2.)*pow(s1Error,2.)+4.*pow(a5,2.)*pow(s2Error,2.) | |
9129 | + 16.*pow(s1,2.)*pow(s3Error,2.)+8.*a1*wCov4-32.*a1*a2*wCov1 | |
9130 | - 16.*a3*a1*wCov5-32.*c1*a1*wCov6-32.*a1*a4*wCov2+16.*a5*a1*wCov7 | |
9131 | + 32.*s1*a1*wCov8-8.*a2*wCov9-4.*a3*wCov10-8.*c1*wCov11-8.*a4*wCov12 | |
9132 | + 4.*a5*wCov13+8.*s1*wCov14+16.*a3*a2*wCov15+32.*c1*a2*wCov16+32.*a2*a4*wCov3 | |
9133 | - 16.*a5*a2*wCov17-32.*s1*a2*wCov18+16.*c1*a3*wCov19+16.*a3*a4*wCov20 | |
9134 | - 8.*a3*a5*wCov21-16.*s1*a3*wCov22+32.*c1*a4*wCov23-16.*c1*a5*wCov24 | |
9135 | - 32.*c1*s1*wCov25-16.*a5*a4*wCov26-32.*s1*a4*wCov27+16.*s1*a5*wCov28; | |
9136 | // Store ratio of error squared - with/without NUA terms: | |
9137 | Double_t ratioErrorSquaredQC4 = 0.; | |
9138 | if(fIntFlowQcumulants->GetBinError(2)>0.) | |
9139 | { | |
9140 | ratioErrorSquaredQC4 = (gQC4ErrorSquared/pow(fIntFlowQcumulants->GetBinError(2),2.)); | |
9141 | fIntFlowQcumulantsErrorSquaredRatio->SetBinContent(2,ratioErrorSquaredQC4); | |
9142 | } | |
b77b6434 | 9143 | if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 9144 | { |
9145 | if(gQC4ErrorSquared>=0.) | |
9146 | { | |
9147 | fIntFlowQcumulants->SetBinError(2,pow(gQC4ErrorSquared,0.5)); | |
9148 | } else | |
9149 | { | |
9150 | fIntFlowQcumulants->SetBinError(2,0.); | |
9151 | cout<<endl; | |
9152 | cout<<" WARNING (QC): Statistical error of generalized QC{4} is imaginary !!!!"<<endl; | |
9153 | cout<<endl; | |
9154 | } | |
b77b6434 | 9155 | } // end of if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 9156 | // Quantify detector bias to QC{4}: |
9157 | if(TMath::Abs(QC4)>0.) | |
9158 | { | |
9159 | fIntFlowDetectorBias->SetBinContent(2,gQC4/QC4); | |
9160 | if(QC4Error>0.) | |
9161 | { | |
9162 | Double_t errorSquared = gQC4ErrorSquared/pow(QC4,2.)+pow(gQC4,2.)*pow(QC4Error,2.)/pow(QC4,4.); | |
9163 | if(errorSquared>0.) | |
9164 | { | |
9165 | fIntFlowDetectorBias->SetBinError(2,pow(errorSquared,0.5)); | |
9166 | } | |
9167 | } | |
9168 | } // end of if(TMath::Abs(QC4)>0.) | |
489d5531 | 9169 | |
b92ea2b9 | 9170 | |
9171 | // .... to be improved (continued for 6th and 8th order) .... | |
9172 | ||
9173 | ||
2001bc3a | 9174 | // versus multiplicity: |
b77b6434 | 9175 | if(fCalculateCumulantsVsM) // to be improved - propagate error for nua terms vs M |
2001bc3a | 9176 | { |
9177 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) | |
b77b6434 | 9178 | Double_t value[4] = {0.}; // QCs vs M |
9179 | Double_t error[4] = {0.}; // error of QCs vs M | |
9180 | Double_t dSum1[4] = {0.}; // sum value_i/(error_i)^2 | |
9181 | Double_t dSum2[4] = {0.}; // sum 1/(error_i)^2 | |
2001bc3a | 9182 | for(Int_t b=1;b<=nBins;b++) |
9183 | { | |
b92ea2b9 | 9184 | // Measured correlations: |
2001bc3a | 9185 | two = fIntFlowCorrelationsVsMHist[0]->GetBinContent(b); // <<2>> vs M |
9186 | four = fIntFlowCorrelationsVsMHist[1]->GetBinContent(b); // <<4>> vs M | |
b92ea2b9 | 9187 | // Isotropic cumulants: |
9188 | QC2 = two; | |
9189 | QC4 = four-2.*pow(two,2.); | |
9190 | // Non-isotropic terms: | |
9191 | c1 = fIntFlowCorrectionTermsForNUAVsMPro[1][0]->GetBinContent(b); // <<cos(n*phi1)>> | |
9192 | c2 = fIntFlowCorrectionTermsForNUAVsMPro[1][1]->GetBinContent(b); // <<cos(n*(phi1+phi2))>> | |
9193 | c3 = fIntFlowCorrectionTermsForNUAVsMPro[1][2]->GetBinContent(b); // <<cos(n*(phi1-phi2-phi3))>> | |
9194 | s1 = fIntFlowCorrectionTermsForNUAVsMPro[0][0]->GetBinContent(b); // <<sin(n*phi1)>> | |
9195 | s2 = fIntFlowCorrectionTermsForNUAVsMPro[0][1]->GetBinContent(b); // <<sin(n*(phi1+phi2))>> | |
9196 | s3 = fIntFlowCorrectionTermsForNUAVsMPro[0][2]->GetBinContent(b); // <<sin(n*(phi1-phi2-phi3))>> | |
9197 | // Generalized QC{2} vs M: | |
9198 | gQC2 = two - pow(c1,2.) - pow(s1,2.); | |
b77b6434 | 9199 | if(fApplyCorrectionForNUAVsM){fIntFlowQcumulantsVsM[0]->SetBinContent(b,gQC2);} |
b92ea2b9 | 9200 | // Generalized QC{4} vs M: |
9201 | gQC4 = four-2.*pow(two,2.) | |
9202 | - 4.*c1*c3+4.*s1*s3-pow(c2,2.)-pow(s2,2.) | |
9203 | + 4.*c2*(pow(c1,2.)-pow(s1,2.))+8.*s2*s1*c1 | |
9204 | + 8.*two*(pow(c1,2.)+pow(s1,2.))-6.*pow((pow(c1,2.)+pow(s1,2.)),2.); | |
b77b6434 | 9205 | if(fApplyCorrectionForNUAVsM){fIntFlowQcumulantsVsM[1]->SetBinContent(b,gQC4);} |
b92ea2b9 | 9206 | // Detector bias vs M: |
9207 | if(TMath::Abs(QC2)>0.) | |
9208 | { | |
9209 | fIntFlowDetectorBiasVsM[0]->SetBinContent(b,gQC2/QC2); | |
9210 | } // end of if(TMath::Abs(QC2)>0.) | |
9211 | if(TMath::Abs(QC4)>0.) | |
9212 | { | |
9213 | fIntFlowDetectorBiasVsM[1]->SetBinContent(b,gQC4/QC4); | |
b77b6434 | 9214 | } // end of if(TMath::Abs(QC4)>0.) |
9215 | // Rebin in M: | |
9216 | for(Int_t co=0;co<4;co++) | |
9217 | { | |
9218 | value[co] = fIntFlowQcumulantsVsM[co]->GetBinContent(b); | |
9219 | error[co] = fIntFlowQcumulantsVsM[co]->GetBinError(b); | |
9220 | if(error[co]>0.) | |
9221 | { | |
9222 | dSum1[co]+=value[co]/(error[co]*error[co]); | |
9223 | dSum2[co]+=1./(error[co]*error[co]); | |
9224 | } | |
9225 | } // end of for(Int_t co=0;co<4;co++) | |
9226 | } // end of for(Int_t b=1;b<=nBins;b++) | |
9227 | // Store rebinned Q-cumulants: | |
9228 | if(fApplyCorrectionForNUAVsM) | |
9229 | { | |
9230 | for(Int_t co=0;co<4;co++) | |
9231 | { | |
9232 | if(dSum2[co]>0.) | |
9233 | { | |
9234 | fIntFlowQcumulantsRebinnedInM->SetBinContent(co+1,dSum1[co]/dSum2[co]); | |
9235 | fIntFlowQcumulantsRebinnedInM->SetBinError(co+1,pow(1./dSum2[co],0.5)); | |
9236 | } | |
9237 | } // end of for(Int_t co=0;co<4;co++) | |
9238 | } // end of if(fApplyCorrectionForNUAVsM) | |
9239 | } // end of if(fCalculateCumulantsVsM) | |
2001bc3a | 9240 | |
489d5531 | 9241 | } // end of void AliFlowAnalysisWithQCumulants::CalculateQcumulantsCorrectedForNUAIntFlow() |
0328db2d | 9242 | |
489d5531 | 9243 | //================================================================================================================================ |
9244 | ||
489d5531 | 9245 | void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUAIntFlow() |
9246 | { | |
0328db2d | 9247 | // From profile fIntFlowCorrectionTermsForNUAPro[sc] access measured correction terms for NUA |
489d5531 | 9248 | // and their spread, correctly calculate the statistical errors and store the final |
0328db2d | 9249 | // results and statistical errors for correction terms for NUA in histogram fIntFlowCorrectionTermsForNUAHist[sc]. |
489d5531 | 9250 | // |
9251 | // Remark: Statistical error of correction temrs is calculated as: | |
9252 | // | |
9253 | // statistical error = termA * spread * termB: | |
9254 | // termA = sqrt{sum_{i=1}^{N} w^2}/(sum_{i=1}^{N} w) | |
9255 | // termB = 1/sqrt(1-termA^2) | |
9256 | ||
b92ea2b9 | 9257 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved - promore this to data member? |
9258 | TString nonisotropicTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4 | |
9259 | ||
489d5531 | 9260 | for(Int_t sc=0;sc<2;sc++) // sin or cos correction terms |
9261 | { | |
b92ea2b9 | 9262 | for(Int_t ci=1;ci<=4;ci++) // correction term index (to be improved - hardwired 4) |
489d5531 | 9263 | { |
9264 | Double_t correction = fIntFlowCorrectionTermsForNUAPro[sc]->GetBinContent(ci); | |
0328db2d | 9265 | Double_t spread = fIntFlowCorrectionTermsForNUAPro[sc]->GetBinError(ci); |
9266 | Double_t sumOfLinearEventWeights = fIntFlowSumOfEventWeightsNUA[sc][0]->GetBinContent(ci); | |
9267 | Double_t sumOfQuadraticEventWeights = fIntFlowSumOfEventWeightsNUA[sc][1]->GetBinContent(ci); | |
9268 | Double_t termA = 0.; | |
9269 | Double_t termB = 0.; | |
b92ea2b9 | 9270 | if(TMath::Abs(sumOfLinearEventWeights)>1.e-44) |
0328db2d | 9271 | { |
9272 | termA = pow(sumOfQuadraticEventWeights,0.5)/sumOfLinearEventWeights; | |
9273 | } else | |
9274 | { | |
b92ea2b9 | 9275 | cout<<" WARNING (QC): sumOfLinearEventWeights == 0 in AFAWQC::FCTFNIF() !!!!"<<endl; |
9276 | cout<<Form(" (for <<%s[%s]>> non-isotropic term)",sinCosFlag[sc].Data(),nonisotropicTermFlag[ci-1].Data())<<endl; | |
0328db2d | 9277 | } |
489d5531 | 9278 | if(1.-pow(termA,2.) > 0.) |
9279 | { | |
9280 | termB = 1./pow(1-pow(termA,2.),0.5); | |
9281 | } else | |
9282 | { | |
b92ea2b9 | 9283 | cout<<" WARNING (QC): 1.-pow(termA,2.) <= 0 in AFAWQC::FCTFNIF() !!!!"<<endl; |
9284 | cout<<Form(" (for <<%s[%s]>> non-isotropic term)",sinCosFlag[sc].Data(),nonisotropicTermFlag[ci-1].Data())<<endl; | |
489d5531 | 9285 | } |
9286 | Double_t statisticalError = termA * spread * termB; | |
489d5531 | 9287 | fIntFlowCorrectionTermsForNUAHist[sc]->SetBinContent(ci,correction); |
0328db2d | 9288 | fIntFlowCorrectionTermsForNUAHist[sc]->SetBinError(ci,statisticalError); |
b92ea2b9 | 9289 | } // end of for(Int_t ci=1;ci<=4;ci++) // correction term index |
489d5531 | 9290 | } // end of for(Int sc=0;sc<2;sc++) // sin or cos correction terms |
9291 | ||
9292 | } // end of void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUAIntFlow() | |
9293 | ||
489d5531 | 9294 | //================================================================================================================================ |
9295 | ||
489d5531 | 9296 | void AliFlowAnalysisWithQCumulants::GetPointersForNestedLoopsHistograms() |
9297 | { | |
9298 | // Get pointers to all objects relevant for calculations with nested loops. | |
9299 | ||
9300 | TList *nestedLoopsList = dynamic_cast<TList*>(fHistList->FindObject("Nested Loops")); | |
9301 | if(nestedLoopsList) | |
9302 | { | |
9303 | this->SetNestedLoopsList(nestedLoopsList); | |
9304 | } else | |
9305 | { | |
9306 | cout<<"WARNING: nestedLoopsList is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
9307 | exit(0); | |
9308 | } | |
9309 | ||
9310 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?) | |
9311 | TString typeFlag[2] = {"RP","POI"}; // to be improved (should I promote this to data members?) | |
9312 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; // to be improved (should I promote this to data members?) | |
9313 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; // to be improved (should I promote this to data members?) | |
9314 | ||
9315 | TString evaluateNestedLoopsName = "fEvaluateNestedLoops"; | |
9316 | evaluateNestedLoopsName += fAnalysisLabel->Data(); | |
9317 | TProfile *evaluateNestedLoops = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(evaluateNestedLoopsName.Data())); | |
9318 | Bool_t bEvaluateIntFlowNestedLoops = kFALSE; | |
9319 | Bool_t bEvaluateDiffFlowNestedLoops = kFALSE; | |
9320 | if(evaluateNestedLoops) | |
9321 | { | |
9322 | this->SetEvaluateNestedLoops(evaluateNestedLoops); | |
9323 | bEvaluateIntFlowNestedLoops = (Int_t)evaluateNestedLoops->GetBinContent(1); | |
9324 | bEvaluateDiffFlowNestedLoops = (Int_t)evaluateNestedLoops->GetBinContent(2); | |
9325 | } | |
9326 | // nested loops relevant for integrated flow: | |
9327 | if(bEvaluateIntFlowNestedLoops) | |
9328 | { | |
9329 | // correlations: | |
9330 | TString intFlowDirectCorrelationsName = "fIntFlowDirectCorrelations"; | |
9331 | intFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
9332 | TProfile *intFlowDirectCorrelations = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(intFlowDirectCorrelationsName.Data())); | |
9333 | if(intFlowDirectCorrelations) | |
9334 | { | |
9335 | this->SetIntFlowDirectCorrelations(intFlowDirectCorrelations); | |
9336 | } else | |
9337 | { | |
9338 | cout<<"WARNING: intFlowDirectCorrelations is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
9339 | exit(0); | |
9340 | } | |
9341 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
9342 | { | |
9343 | TString intFlowExtraDirectCorrelationsName = "fIntFlowExtraDirectCorrelations"; | |
9344 | intFlowExtraDirectCorrelationsName += fAnalysisLabel->Data(); | |
9345 | TProfile *intFlowExtraDirectCorrelations = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(intFlowExtraDirectCorrelationsName.Data())); | |
9346 | if(intFlowExtraDirectCorrelations) | |
9347 | { | |
9348 | this->SetIntFlowExtraDirectCorrelations(intFlowExtraDirectCorrelations); | |
9349 | } else | |
9350 | { | |
9351 | cout<<"WARNING: intFlowExtraDirectCorrelations is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
9352 | exit(0); | |
9353 | } | |
9354 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
9355 | // correction terms for non-uniform acceptance: | |
9356 | TString intFlowDirectCorrectionTermsForNUAName = "fIntFlowDirectCorrectionTermsForNUA"; | |
9357 | intFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
9358 | TProfile *intFlowDirectCorrectionTermsForNUA[2] = {NULL}; | |
9359 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
9360 | { | |
9361 | intFlowDirectCorrectionTermsForNUA[sc] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s: %s terms",intFlowDirectCorrectionTermsForNUAName.Data(),sinCosFlag[sc].Data()))); | |
9362 | if(intFlowDirectCorrectionTermsForNUA[sc]) | |
9363 | { | |
9364 | this->SetIntFlowDirectCorrectionTermsForNUA(intFlowDirectCorrectionTermsForNUA[sc],sc); | |
9365 | } else | |
9366 | { | |
9367 | cout<<"WARNING: intFlowDirectCorrectionTermsForNUA[sc] is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
9368 | cout<<"sc = "<<sc<<endl; | |
9369 | exit(0); | |
9370 | } | |
9371 | } // end of for(Int_t sc=0;sc<2;sc++) | |
9372 | } // end of if(bEvaluateIntFlowNestedLoops) | |
9373 | ||
9374 | // nested loops relevant for differential flow: | |
9375 | if(bEvaluateDiffFlowNestedLoops) | |
9376 | { | |
9377 | // correlations: | |
9378 | TString diffFlowDirectCorrelationsName = "fDiffFlowDirectCorrelations"; | |
9379 | diffFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
9380 | TProfile *diffFlowDirectCorrelations[2][2][4] = {{{NULL}}}; | |
9381 | for(Int_t t=0;t<2;t++) | |
9382 | { | |
9383 | for(Int_t pe=0;pe<2;pe++) | |
9384 | { | |
9385 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
9386 | { | |
9387 | diffFlowDirectCorrelations[t][pe][ci] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[ci].Data()))); | |
9388 | if(diffFlowDirectCorrelations[t][pe][ci]) | |
9389 | { | |
9390 | this->SetDiffFlowDirectCorrelations(diffFlowDirectCorrelations[t][pe][ci],t,pe,ci); | |
9391 | } else | |
9392 | { | |
9393 | cout<<"WARNING: diffFlowDirectCorrelations[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9394 | cout<<"t = "<<t<<endl; | |
9395 | cout<<"pe = "<<pe<<endl; | |
9396 | cout<<"ci = "<<ci<<endl; | |
9397 | } | |
9398 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
9399 | } // end of for(Int_t pe=0;pe<2;pe++) | |
9400 | } // end of for(Int_t t=0;t<2;t++) | |
9401 | // correction terms for non-uniform acceptance: | |
9402 | TString diffFlowDirectCorrectionTermsForNUAName = "fDiffFlowDirectCorrectionTermsForNUA"; | |
9403 | diffFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
9404 | TProfile *diffFlowDirectCorrectionTermsForNUA[2][2][2][10] = {{{{NULL}}}}; | |
9405 | for(Int_t t=0;t<2;t++) | |
9406 | { | |
9407 | for(Int_t pe=0;pe<2;pe++) | |
9408 | { | |
9409 | // correction terms for NUA: | |
9410 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9411 | { | |
9412 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
9413 | { | |
9414 | diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1))); | |
9415 | if(diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]) | |
9416 | { | |
9417 | this->SetDiffFlowDirectCorrectionTermsForNUA(diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti],t,pe,sc,cti); | |
9418 | } else | |
9419 | { | |
9420 | cout<<"WARNING: diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9421 | cout<<"t = "<<t<<endl; | |
9422 | cout<<"pe = "<<pe<<endl; | |
9423 | cout<<"sc = "<<sc<<endl; | |
9424 | cout<<"cti = "<<cti<<endl; | |
9425 | } | |
9426 | } // end of for(Int_t cti=0;cti<9;cti++) // correction term index | |
9427 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9428 | } // end of for(Int_t pe=0;pe<2;pe++) | |
9429 | } // end of for(Int_t t=0;t<2;t++) | |
9430 | // number of RPs and POIs in selected pt and eta bins for cross-checkings: | |
9431 | TString noOfParticlesInBinName = "fNoOfParticlesInBin"; | |
9432 | TH1D *noOfParticlesInBin = NULL; | |
9433 | noOfParticlesInBin = dynamic_cast<TH1D*>(nestedLoopsList->FindObject(noOfParticlesInBinName.Data())); | |
9434 | if(noOfParticlesInBin) | |
9435 | { | |
9436 | this->SetNoOfParticlesInBin(noOfParticlesInBin); | |
9437 | } else | |
9438 | { | |
9439 | cout<<endl; | |
9440 | cout<<" WARNING (QC): noOfParticlesInBin is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9441 | cout<<endl; | |
9442 | } | |
9443 | } // end of if(bEvaluateDiffFlowNestedLoops) | |
9444 | ||
9445 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForNestedLoopsHistograms() | |
9446 | ||
489d5531 | 9447 | //================================================================================================================================ |
9448 | ||
489d5531 | 9449 | void AliFlowAnalysisWithQCumulants::StoreHarmonic() |
9450 | { | |
9451 | // Store flow harmonic in common control histograms. | |
9452 | ||
9453 | (fCommonHists->GetHarmonic())->Fill(0.5,fHarmonic); | |
dd442cd2 | 9454 | if(fFillMultipleControlHistograms) |
9455 | { | |
9456 | (fCommonHists2nd->GetHarmonic())->Fill(0.5,fHarmonic); | |
9457 | (fCommonHists4th->GetHarmonic())->Fill(0.5,fHarmonic); | |
9458 | (fCommonHists6th->GetHarmonic())->Fill(0.5,fHarmonic); | |
9459 | (fCommonHists8th->GetHarmonic())->Fill(0.5,fHarmonic); | |
9460 | } | |
9461 | ||
489d5531 | 9462 | } // end of void AliFlowAnalysisWithQCumulants::StoreHarmonic() |
9463 | ||
489d5531 | 9464 | //================================================================================================================================ |
9465 | ||
489d5531 | 9466 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelationsUsingParticleWeights(TString type, TString ptOrEta) // type = RP or POI |
9467 | { | |
9468 | // Calculate all correlations needed for differential flow using particle weights. | |
9469 | ||
2a98ceb8 | 9470 | Int_t t = 0; // type flag |
9471 | Int_t pe = 0; // ptEta flag | |
489d5531 | 9472 | |
9473 | if(type == "RP") | |
9474 | { | |
9475 | t = 0; | |
9476 | } else if(type == "POI") | |
9477 | { | |
9478 | t = 1; | |
9479 | } | |
9480 | ||
9481 | if(ptOrEta == "Pt") | |
9482 | { | |
9483 | pe = 0; | |
9484 | } else if(ptOrEta == "Eta") | |
9485 | { | |
9486 | pe = 1; | |
9487 | } | |
9488 | ||
9489 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
9490 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
9491 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
9492 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
9493 | ||
9494 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
9495 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
9496 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
9497 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
9498 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
9499 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
9500 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
9501 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
9502 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
9503 | ||
1268c371 | 9504 | // S^M_{p,k} (see .h file for the definition of fSpk): |
9505 | Double_t dSM1p1k = (*fSpk)(0,1); | |
9506 | Double_t dSM1p2k = (*fSpk)(0,2); | |
9507 | Double_t dSM1p3k = (*fSpk)(0,3); | |
9508 | Double_t dSM2p1k = (*fSpk)(1,1); | |
9509 | Double_t dSM3p1k = (*fSpk)(2,1); | |
489d5531 | 9510 | |
9511 | // looping over all bins and calculating reduced correlations: | |
9512 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
9513 | { | |
9514 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): | |
9515 | Double_t p1n0kRe = 0.; | |
9516 | Double_t p1n0kIm = 0.; | |
9517 | ||
9518 | // number of POIs in particular (pt,eta) bin): | |
9519 | Double_t mp = 0.; | |
9520 | ||
9521 | // real and imaginary parts of q_{m*n,k}: | |
9522 | // (weighted Q-vector evaluated for particles which are both RPs and POIs in particular (pt,eta) bin) | |
9523 | Double_t q1n2kRe = 0.; | |
9524 | Double_t q1n2kIm = 0.; | |
9525 | Double_t q2n1kRe = 0.; | |
9526 | Double_t q2n1kIm = 0.; | |
9527 | ||
9528 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
9529 | Double_t s1p1k = 0.; | |
9530 | Double_t s1p2k = 0.; | |
9531 | Double_t s1p3k = 0.; | |
9532 | ||
9533 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
9534 | Double_t dM0111 = 0.; | |
9535 | ||
9536 | if(type == "POI") | |
9537 | { | |
9538 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
9539 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
9540 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
9541 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
9542 | ||
9543 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
9544 | ||
9545 | t = 1; // typeFlag = RP or POI | |
9546 | ||
9547 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
9548 | q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
9549 | * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
9550 | q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
9551 | * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
9552 | q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
9553 | * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
9554 | q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
9555 | * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
9556 | ||
9557 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
9558 | s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); | |
9559 | s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); | |
9560 | s1p3k = pow(fs1dEBE[2][pe][3]->GetBinContent(b)*fs1dEBE[2][pe][3]->GetBinEntries(b),1.); | |
9561 | ||
9562 | // M0111 from Eq. (118) in QC2c (to be improved (notation)): | |
9563 | dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k) | |
9564 | - 3.*(s1p1k*(dSM2p1k-dSM1p2k) | |
9565 | + 2.*(s1p3k-s1p2k*dSM1p1k)); | |
9566 | } | |
9567 | else if(type == "RP") | |
9568 | { | |
9569 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
9570 | q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
9571 | * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
9572 | q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
9573 | * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
9574 | q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
9575 | * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
9576 | q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
9577 | * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
9578 | ||
9579 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
9580 | s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); | |
9581 | s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); | |
9582 | s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); | |
9583 | ||
9584 | // to be improved (cross-checked): | |
9585 | p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
9586 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
9587 | p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
9588 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
9589 | ||
9590 | mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
9591 | ||
9592 | t = 0; // typeFlag = RP or POI | |
9593 | ||
9594 | // M0111 from Eq. (118) in QC2c (to be improved (notation)): | |
9595 | dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k) | |
9596 | - 3.*(s1p1k*(dSM2p1k-dSM1p2k) | |
9597 | + 2.*(s1p3k-s1p2k*dSM1p1k)); | |
9598 | //............................................................................................... | |
9599 | } | |
9600 | ||
9601 | // 2'-particle correlation: | |
9602 | Double_t two1n1nW0W1 = 0.; | |
9603 | if(mp*dSM1p1k-s1p1k) | |
9604 | { | |
9605 | two1n1nW0W1 = (p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k-s1p1k) | |
9606 | / (mp*dSM1p1k-s1p1k); | |
9607 | ||
9608 | // fill profile to get <<2'>> | |
b40a910e | 9609 | fDiffFlowCorrelationsPro[t][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nW0W1,mp*dSM1p1k-s1p1k); |
9610 | // fill profile to get <<2'>^2> | |
9611 | fDiffFlowSquaredCorrelationsPro[t][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nW0W1*two1n1nW0W1,mp*dSM1p1k-s1p1k); | |
489d5531 | 9612 | // histogram to store <2'> e-b-e (needed in some other methods): |
9613 | fDiffFlowCorrelationsEBE[t][pe][0]->SetBinContent(b,two1n1nW0W1); | |
9614 | fDiffFlowEventWeightsForCorrelationsEBE[t][pe][0]->SetBinContent(b,mp*dSM1p1k-s1p1k); | |
9615 | } // end of if(mp*dSM1p1k-s1p1k) | |
9616 | ||
9617 | // 4'-particle correlation: | |
9618 | Double_t four1n1n1n1nW0W1W1W1 = 0.; | |
9619 | if(dM0111) | |
9620 | { | |
9621 | four1n1n1n1nW0W1W1W1 = ((pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k) | |
9622 | - q2n1kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.)) | |
9623 | - 2.*q2n1kIm*dReQ1n1k*dImQ1n1k | |
9624 | - p1n0kRe*(dReQ1n1k*dReQ2n2k+dImQ1n1k*dImQ2n2k) | |
9625 | + p1n0kIm*(dImQ1n1k*dReQ2n2k-dReQ1n1k*dImQ2n2k) | |
9626 | - 2.*dSM1p2k*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k) | |
9627 | - 2.*(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*s1p1k | |
9628 | + 6.*(q1n2kRe*dReQ1n1k+q1n2kIm*dImQ1n1k) | |
9629 | + 1.*(q2n1kRe*dReQ2n2k+q2n1kIm*dImQ2n2k) | |
9630 | + 2.*(p1n0kRe*dReQ1n3k+p1n0kIm*dImQ1n3k) | |
9631 | + 2.*s1p1k*dSM1p2k | |
9632 | - 6.*s1p3k) | |
9633 | / dM0111; // to be improved (notation of dM0111) | |
9634 | ||
9635 | // fill profile to get <<4'>> | |
b40a910e | 9636 | fDiffFlowCorrelationsPro[t][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nW0W1W1W1,dM0111); |
9637 | // fill profile to get <<4'>^2> | |
9638 | fDiffFlowSquaredCorrelationsPro[t][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nW0W1W1W1*four1n1n1n1nW0W1W1W1,dM0111); | |
489d5531 | 9639 | // histogram to store <4'> e-b-e (needed in some other methods): |
9640 | fDiffFlowCorrelationsEBE[t][pe][1]->SetBinContent(b,four1n1n1n1nW0W1W1W1); | |
9641 | fDiffFlowEventWeightsForCorrelationsEBE[t][pe][1]->SetBinContent(b,dM0111); | |
9642 | } // end of if(dM0111) | |
9643 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
9644 | ||
9645 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelationsUsingParticleWeights(TString type, TString ptOrEta); // type = RP or POI | |
9646 | ||
489d5531 | 9647 | //================================================================================================================================ |
9648 | ||
489d5531 | 9649 | void AliFlowAnalysisWithQCumulants::FillCommonControlHistograms(AliFlowEventSimple *anEvent) |
9650 | { | |
9651 | // Fill common control histograms. | |
9652 | ||
9653 | Int_t nRP = anEvent->GetEventNSelTracksRP(); // number of RPs (i.e. number of particles used to determine the reaction plane) | |
9654 | fCommonHists->FillControlHistograms(anEvent); | |
dd442cd2 | 9655 | if(fFillMultipleControlHistograms) |
489d5531 | 9656 | { |
dd442cd2 | 9657 | if(nRP>1) |
489d5531 | 9658 | { |
dd442cd2 | 9659 | fCommonHists2nd->FillControlHistograms(anEvent); |
9660 | if(nRP>3) | |
489d5531 | 9661 | { |
dd442cd2 | 9662 | fCommonHists4th->FillControlHistograms(anEvent); |
9663 | if(nRP>5) | |
489d5531 | 9664 | { |
dd442cd2 | 9665 | fCommonHists6th->FillControlHistograms(anEvent); |
9666 | if(nRP>7) | |
9667 | { | |
9668 | fCommonHists8th->FillControlHistograms(anEvent); | |
9669 | } // end of if(nRP>7) | |
9670 | } // end of if(nRP>5) | |
9671 | } // end of if(nRP>3) | |
9672 | } // end of if(nRP>1) | |
9673 | } // end of if(fFillMultipleControlHistograms) | |
489d5531 | 9674 | |
9675 | } // end of void AliFlowAnalysisWithQCumulants::FillCommonControlHistograms(AliFlowEventSimple *anEvent) | |
9676 | ||
489d5531 | 9677 | //================================================================================================================================ |
9678 | ||
489d5531 | 9679 | void AliFlowAnalysisWithQCumulants::ResetEventByEventQuantities() |
9680 | { | |
9681 | // Reset all event by event quantities. | |
9682 | ||
1268c371 | 9683 | // Reference flow: |
489d5531 | 9684 | fReQ->Zero(); |
9685 | fImQ->Zero(); | |
1268c371 | 9686 | fSpk->Zero(); |
489d5531 | 9687 | fIntFlowCorrelationsEBE->Reset(); |
9688 | fIntFlowEventWeightsForCorrelationsEBE->Reset(); | |
9689 | fIntFlowCorrelationsAllEBE->Reset(); | |
9690 | ||
b92ea2b9 | 9691 | for(Int_t sc=0;sc<2;sc++) |
489d5531 | 9692 | { |
b92ea2b9 | 9693 | fIntFlowCorrectionTermsForNUAEBE[sc]->Reset(); |
9694 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc]->Reset(); | |
489d5531 | 9695 | } |
9696 | ||
1268c371 | 9697 | // Differential flow: |
9698 | if(fCalculateDiffFlow) | |
489d5531 | 9699 | { |
1268c371 | 9700 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) |
489d5531 | 9701 | { |
1268c371 | 9702 | for(Int_t pe=0;pe<2;pe++) // 1D in pt or eta |
489d5531 | 9703 | { |
1268c371 | 9704 | for(Int_t m=0;m<4;m++) // multiple of harmonic |
489d5531 | 9705 | { |
1268c371 | 9706 | for(Int_t k=0;k<9;k++) // power of weight |
9707 | { | |
9708 | if(fReRPQ1dEBE[t][pe][m][k]) fReRPQ1dEBE[t][pe][m][k]->Reset(); | |
9709 | if(fImRPQ1dEBE[t][pe][m][k]) fImRPQ1dEBE[t][pe][m][k]->Reset(); | |
9710 | } | |
9711 | } | |
489d5531 | 9712 | } |
1268c371 | 9713 | } |
9714 | for(Int_t t=0;t<3;t++) // type (0 = RP, 1 = POI, 2 = RP&&POI ) | |
9715 | { | |
9716 | for(Int_t pe=0;pe<2;pe++) // 1D in pt or eta | |
489d5531 | 9717 | { |
1268c371 | 9718 | for(Int_t k=0;k<9;k++) |
9719 | { | |
9720 | if(fs1dEBE[t][pe][k]) fs1dEBE[t][pe][k]->Reset(); | |
9721 | } | |
489d5531 | 9722 | } |
9723 | } | |
1268c371 | 9724 | // e-b-e reduced correlations: |
9725 | for(Int_t t=0;t<2;t++) // type (0 = RP, 1 = POI) | |
9726 | { | |
9727 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
489d5531 | 9728 | { |
1268c371 | 9729 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index |
9730 | { | |
9731 | if(fDiffFlowCorrelationsEBE[t][pe][rci]) fDiffFlowCorrelationsEBE[t][pe][rci]->Reset(); | |
9732 | if(fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci]) fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci]->Reset(); | |
9733 | } | |
489d5531 | 9734 | } |
1268c371 | 9735 | } |
9736 | // correction terms for NUA: | |
9737 | for(Int_t t=0;t<2;t++) // type (0 = RP, 1 = POI) | |
9738 | { | |
9739 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
489d5531 | 9740 | { |
1268c371 | 9741 | for(Int_t sc=0;sc<2;sc++) // sin or cos |
489d5531 | 9742 | { |
1268c371 | 9743 | for(Int_t cti=0;cti<9;cti++) // correction term index |
9744 | { | |
489d5531 | 9745 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti]->Reset(); |
1268c371 | 9746 | } |
489d5531 | 9747 | } |
1268c371 | 9748 | } |
9749 | } | |
9750 | } // end of if(fCalculateDiffFlow) | |
9751 | ||
489d5531 | 9752 | // 2D (pt,eta) |
1268c371 | 9753 | if(fCalculate2DDiffFlow) |
489d5531 | 9754 | { |
9755 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
9756 | { | |
9757 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
9758 | { | |
9759 | for(Int_t k=0;k<9;k++) // power of weight | |
9760 | { | |
b77b6434 | 9761 | if(fReRPQ2dEBE[t][m][k]){fReRPQ2dEBE[t][m][k]->Reset();} |
9762 | if(fImRPQ2dEBE[t][m][k]){fImRPQ2dEBE[t][m][k]->Reset();} | |
489d5531 | 9763 | } |
9764 | } | |
9765 | } | |
9766 | for(Int_t t=0;t<3;t++) // type (0 = RP, 1 = POI, 2 = RP&&POI ) | |
9767 | { | |
9768 | for(Int_t k=0;k<9;k++) | |
9769 | { | |
b77b6434 | 9770 | if(fs2dEBE[t][k]){fs2dEBE[t][k]->Reset();} |
489d5531 | 9771 | } |
9772 | } | |
1268c371 | 9773 | } // end of if(fCalculate2DDiffFlow) |
489d5531 | 9774 | |
9775 | } // end of void AliFlowAnalysisWithQCumulants::ResetEventByEventQuantities(); | |
9776 | ||
489d5531 | 9777 | //================================================================================================================================ |
9778 | ||
489d5531 | 9779 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTerms(TString type, TString ptOrEta) |
9780 | { | |
9781 | // Calculate correction terms for non-uniform acceptance for differential flow (sin terms). | |
9782 | ||
9783 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][0][cti], where cti runs as follows: | |
9784 | // 0: <<sin n(psi1)>> | |
9785 | // 1: <<sin n(psi1+phi2)>> | |
9786 | // 2: <<sin n(psi1+phi2-phi3)>> | |
9787 | // 3: <<sin n(psi1-phi2-phi3)>>: | |
9788 | // 4: | |
9789 | // 5: | |
9790 | // 6: | |
9791 | ||
9792 | // multiplicity: | |
1268c371 | 9793 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 9794 | |
9795 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
9796 | Double_t dReQ1n = (*fReQ)(0,0); | |
9797 | Double_t dReQ2n = (*fReQ)(1,0); | |
9798 | //Double_t dReQ3n = (*fReQ)(2,0); | |
9799 | //Double_t dReQ4n = (*fReQ)(3,0); | |
9800 | Double_t dImQ1n = (*fImQ)(0,0); | |
9801 | Double_t dImQ2n = (*fImQ)(1,0); | |
9802 | //Double_t dImQ3n = (*fImQ)(2,0); | |
9803 | //Double_t dImQ4n = (*fImQ)(3,0); | |
9804 | ||
2a98ceb8 | 9805 | Int_t t = 0; // type flag |
9806 | Int_t pe = 0; // ptEta flag | |
489d5531 | 9807 | |
9808 | if(type == "RP") | |
9809 | { | |
9810 | t = 0; | |
9811 | } else if(type == "POI") | |
9812 | { | |
9813 | t = 1; | |
9814 | } | |
9815 | ||
9816 | if(ptOrEta == "Pt") | |
9817 | { | |
9818 | pe = 0; | |
9819 | } else if(ptOrEta == "Eta") | |
9820 | { | |
9821 | pe = 1; | |
9822 | } | |
9823 | ||
9824 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
9825 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
9826 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
9827 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
9828 | ||
9829 | // looping over all bins and calculating correction terms: | |
9830 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
9831 | { | |
9832 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
9833 | Double_t p1n0kRe = 0.; | |
9834 | Double_t p1n0kIm = 0.; | |
9835 | ||
9836 | // number of POIs in particular pt or eta bin: | |
9837 | Double_t mp = 0.; | |
9838 | ||
9839 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
9840 | Double_t q1n0kRe = 0.; | |
9841 | Double_t q1n0kIm = 0.; | |
9842 | Double_t q2n0kRe = 0.; | |
9843 | Double_t q2n0kIm = 0.; | |
9844 | ||
9845 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
9846 | Double_t mq = 0.; | |
9847 | ||
9848 | if(type == "POI") | |
9849 | { | |
9850 | // q_{m*n,0}: | |
9851 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
9852 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
9853 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
9854 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
9855 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
9856 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
9857 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
9858 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
9859 | ||
9860 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
9861 | } | |
9862 | else if(type == "RP") | |
9863 | { | |
9864 | // q_{m*n,0}: | |
9865 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
9866 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
9867 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
9868 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
9869 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
9870 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
9871 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
9872 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
9873 | ||
9874 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
9875 | } | |
9876 | if(type == "POI") | |
9877 | { | |
9878 | // p_{m*n,0}: | |
9879 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
9880 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
9881 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
9882 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
9883 | ||
9884 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
9885 | ||
9886 | t = 1; // typeFlag = RP or POI | |
9887 | } | |
9888 | else if(type == "RP") | |
9889 | { | |
9890 | // p_{m*n,0} = q_{m*n,0}: | |
9891 | p1n0kRe = q1n0kRe; | |
9892 | p1n0kIm = q1n0kIm; | |
9893 | ||
9894 | mp = mq; | |
9895 | ||
9896 | t = 0; // typeFlag = RP or POI | |
9897 | } | |
9898 | ||
9899 | // <<sin n(psi1)>>: | |
9900 | Double_t sinP1nPsi = 0.; | |
9901 | if(mp) | |
9902 | { | |
9903 | sinP1nPsi = p1n0kIm/mp; | |
9904 | // fill profile for <<sin n(psi1)>>: | |
9905 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi,mp); | |
9906 | // histogram to store <sin n(psi1)> e-b-e (needed in some other methods): | |
9907 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][0]->SetBinContent(b,sinP1nPsi); | |
9908 | } // end of if(mp) | |
9909 | ||
9910 | // <<sin n(psi1+phi2)>>: | |
9911 | Double_t sinP1nPsiP1nPhi = 0.; | |
9912 | if(mp*dMult-mq) | |
9913 | { | |
9914 | sinP1nPsiP1nPhi = (p1n0kRe*dImQ1n+p1n0kIm*dReQ1n-q2n0kIm)/(mp*dMult-mq); | |
9915 | // fill profile for <<sin n(psi1+phi2)>>: | |
9916 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsiP1nPhi,mp*dMult-mq); | |
9917 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
9918 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][1]->SetBinContent(b,sinP1nPsiP1nPhi); | |
9919 | } // end of if(mp*dMult-mq) | |
9920 | ||
9921 | // <<sin n(psi1+phi2-phi3)>>: | |
9922 | Double_t sinP1nPsi1P1nPhi2MPhi3 = 0.; | |
9923 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
9924 | { | |
9925 | sinP1nPsi1P1nPhi2MPhi3 = (p1n0kIm*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult) | |
9926 | - 1.*(q2n0kIm*dReQ1n-q2n0kRe*dImQ1n) | |
9927 | - mq*dImQ1n+2.*q1n0kIm) | |
9928 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
9929 | // fill profile for <<sin n(psi1+phi2)>>: | |
9930 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
9931 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
9932 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][2]->SetBinContent(b,sinP1nPsi1P1nPhi2MPhi3); | |
9933 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
9934 | ||
9935 | // <<sin n(psi1-phi2-phi3)>>: | |
9936 | Double_t sinP1nPsi1M1nPhi2MPhi3 = 0.; | |
9937 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
9938 | { | |
9939 | sinP1nPsi1M1nPhi2MPhi3 = (p1n0kIm*(pow(dReQ1n,2.)-pow(dImQ1n,2.))-2.*p1n0kRe*dReQ1n*dImQ1n | |
9940 | - 1.*(p1n0kIm*dReQ2n-p1n0kRe*dImQ2n) | |
9941 | + 2.*mq*dImQ1n-2.*q1n0kIm) | |
9942 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
9943 | // fill profile for <<sin n(psi1+phi2)>>: | |
9944 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
9945 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
9946 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][3]->SetBinContent(b,sinP1nPsi1M1nPhi2MPhi3); | |
9947 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
9948 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
9949 | ||
9950 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTerms(TString type, TString ptOrEta) | |
9951 | ||
9952 | ||
9953 | //================================================================================================================================ | |
9954 | ||
9955 | ||
9956 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTerms(TString type, TString ptOrEta) | |
9957 | { | |
9958 | // Calculate correction terms for non-uniform acceptance for differential flow (cos terms). | |
9959 | ||
9960 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][1][cti], where cti runs as follows: | |
9961 | // 0: <<cos n(psi)>> | |
9962 | // 1: <<cos n(psi1+phi2)>> | |
9963 | // 2: <<cos n(psi1+phi2-phi3)>> | |
9964 | // 3: <<cos n(psi1-phi2-phi3)>> | |
9965 | // 4: | |
9966 | // 5: | |
9967 | // 6: | |
9968 | ||
9969 | // multiplicity: | |
1268c371 | 9970 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 9971 | |
9972 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
9973 | Double_t dReQ1n = (*fReQ)(0,0); | |
9974 | Double_t dReQ2n = (*fReQ)(1,0); | |
9975 | //Double_t dReQ3n = (*fReQ)(2,0); | |
9976 | //Double_t dReQ4n = (*fReQ)(3,0); | |
9977 | Double_t dImQ1n = (*fImQ)(0,0); | |
9978 | Double_t dImQ2n = (*fImQ)(1,0); | |
9979 | //Double_t dImQ3n = (*fImQ)(2,0); | |
9980 | //Double_t dImQ4n = (*fImQ)(3,0); | |
9981 | ||
2a98ceb8 | 9982 | Int_t t = 0; // type flag |
9983 | Int_t pe = 0; // ptEta flag | |
489d5531 | 9984 | |
9985 | if(type == "RP") | |
9986 | { | |
9987 | t = 0; | |
9988 | } else if(type == "POI") | |
9989 | { | |
9990 | t = 1; | |
9991 | } | |
9992 | ||
9993 | if(ptOrEta == "Pt") | |
9994 | { | |
9995 | pe = 0; | |
9996 | } else if(ptOrEta == "Eta") | |
9997 | { | |
9998 | pe = 1; | |
9999 | } | |
10000 | ||
10001 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
10002 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
10003 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
10004 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
10005 | ||
10006 | // looping over all bins and calculating correction terms: | |
10007 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10008 | { | |
10009 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
10010 | Double_t p1n0kRe = 0.; | |
10011 | Double_t p1n0kIm = 0.; | |
10012 | ||
10013 | // number of POIs in particular pt or eta bin: | |
10014 | Double_t mp = 0.; | |
10015 | ||
10016 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
10017 | Double_t q1n0kRe = 0.; | |
10018 | Double_t q1n0kIm = 0.; | |
10019 | Double_t q2n0kRe = 0.; | |
10020 | Double_t q2n0kIm = 0.; | |
10021 | ||
10022 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
10023 | Double_t mq = 0.; | |
10024 | ||
10025 | if(type == "POI") | |
10026 | { | |
10027 | // q_{m*n,0}: | |
10028 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
10029 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
10030 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
10031 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
10032 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
10033 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
10034 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
10035 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
10036 | ||
10037 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10038 | } | |
10039 | else if(type == "RP") | |
10040 | { | |
10041 | // q_{m*n,0}: | |
10042 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
10043 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
10044 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
10045 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
10046 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
10047 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
10048 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
10049 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
10050 | ||
10051 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10052 | } | |
10053 | if(type == "POI") | |
10054 | { | |
10055 | // p_{m*n,0}: | |
10056 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
10057 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
10058 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
10059 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
10060 | ||
10061 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10062 | ||
10063 | t = 1; // typeFlag = RP or POI | |
10064 | } | |
10065 | else if(type == "RP") | |
10066 | { | |
10067 | // p_{m*n,0} = q_{m*n,0}: | |
10068 | p1n0kRe = q1n0kRe; | |
10069 | p1n0kIm = q1n0kIm; | |
10070 | ||
10071 | mp = mq; | |
10072 | ||
10073 | t = 0; // typeFlag = RP or POI | |
10074 | } | |
10075 | ||
10076 | // <<cos n(psi1)>>: | |
10077 | Double_t cosP1nPsi = 0.; | |
10078 | if(mp) | |
10079 | { | |
10080 | cosP1nPsi = p1n0kRe/mp; | |
10081 | ||
10082 | // fill profile for <<cos n(psi1)>>: | |
10083 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi,mp); | |
10084 | // histogram to store <cos n(psi1)> e-b-e (needed in some other methods): | |
10085 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][0]->SetBinContent(b,cosP1nPsi); | |
10086 | } // end of if(mp) | |
10087 | ||
10088 | // <<cos n(psi1+phi2)>>: | |
10089 | Double_t cosP1nPsiP1nPhi = 0.; | |
10090 | if(mp*dMult-mq) | |
10091 | { | |
10092 | cosP1nPsiP1nPhi = (p1n0kRe*dReQ1n-p1n0kIm*dImQ1n-q2n0kRe)/(mp*dMult-mq); | |
10093 | // fill profile for <<sin n(psi1+phi2)>>: | |
10094 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsiP1nPhi,mp*dMult-mq); | |
10095 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
10096 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][1]->SetBinContent(b,cosP1nPsiP1nPhi); | |
10097 | } // end of if(mp*dMult-mq) | |
10098 | ||
10099 | // <<cos n(psi1+phi2-phi3)>>: | |
10100 | Double_t cosP1nPsi1P1nPhi2MPhi3 = 0.; | |
10101 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
10102 | { | |
10103 | cosP1nPsi1P1nPhi2MPhi3 = (p1n0kRe*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult) | |
10104 | - 1.*(q2n0kRe*dReQ1n+q2n0kIm*dImQ1n) | |
10105 | - mq*dReQ1n+2.*q1n0kRe) | |
10106 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
10107 | // fill profile for <<sin n(psi1+phi2)>>: | |
10108 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
10109 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
10110 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][2]->SetBinContent(b,cosP1nPsi1P1nPhi2MPhi3); | |
10111 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
10112 | ||
10113 | // <<cos n(psi1-phi2-phi3)>>: | |
10114 | Double_t cosP1nPsi1M1nPhi2MPhi3 = 0.; | |
10115 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
10116 | { | |
10117 | cosP1nPsi1M1nPhi2MPhi3 = (p1n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.))+2.*p1n0kIm*dReQ1n*dImQ1n | |
10118 | - 1.*(p1n0kRe*dReQ2n+p1n0kIm*dImQ2n) | |
10119 | - 2.*mq*dReQ1n+2.*q1n0kRe) | |
10120 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
10121 | // fill profile for <<sin n(psi1+phi2)>>: | |
10122 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
10123 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
10124 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][3]->SetBinContent(b,cosP1nPsi1M1nPhi2MPhi3); | |
10125 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
10126 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10127 | ||
10128 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTerms(TString type, TString ptOrEta) | |
10129 | ||
489d5531 | 10130 | //================================================================================================================================== |
10131 | ||
489d5531 | 10132 | void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUADiffFlow(TString type, TString ptOrEta) |
10133 | { | |
1268c371 | 10134 | // Transfer profiles into histogams and correctly propagate the error. |
489d5531 | 10135 | |
2a98ceb8 | 10136 | Int_t t = 0; // type flag |
10137 | Int_t pe = 0; // ptEta flag | |
489d5531 | 10138 | |
10139 | if(type == "RP") | |
10140 | { | |
10141 | t = 0; | |
10142 | } else if(type == "POI") | |
10143 | { | |
10144 | t = 1; | |
10145 | } | |
10146 | ||
10147 | if(ptOrEta == "Pt") | |
10148 | { | |
10149 | pe = 0; | |
10150 | } else if(ptOrEta == "Eta") | |
10151 | { | |
10152 | pe = 1; | |
10153 | } | |
10154 | ||
10155 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
10156 | //Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
10157 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
10158 | //Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
10159 | ||
10160 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
10161 | { | |
10162 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
10163 | { | |
10164 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10165 | { | |
10166 | Double_t correctionTerm = fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]->GetBinContent(b); | |
10167 | fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]->SetBinContent(b,correctionTerm); | |
10168 | // to be improved (propagate error correctly) | |
10169 | // ... | |
10170 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10171 | } // correction term index | |
10172 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
10173 | ||
10174 | }// end of void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUADiffFlow(TString type, TString ptOrEta) | |
10175 | ||
489d5531 | 10176 | //================================================================================================================================== |
10177 | ||
489d5531 | 10178 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta) |
10179 | { | |
1268c371 | 10180 | // Calculate generalized differential flow cumulants (corrected for non-uniform acceptance). |
10181 | ||
10182 | // to be improved - propagate error also from non-isotropic terms | |
489d5531 | 10183 | |
1268c371 | 10184 | Int_t t = 0; // RP = 0, POI = 1 |
10185 | Int_t pe = 0; // pt = 0, eta = 1 | |
489d5531 | 10186 | |
10187 | if(type == "RP") | |
10188 | { | |
1268c371 | 10189 | t = 0; |
489d5531 | 10190 | } else if(type == "POI") |
10191 | { | |
1268c371 | 10192 | t = 1; |
489d5531 | 10193 | } |
10194 | ||
10195 | if(ptOrEta == "Pt") | |
10196 | { | |
1268c371 | 10197 | pe = 0; |
489d5531 | 10198 | } else if(ptOrEta == "Eta") |
10199 | { | |
1268c371 | 10200 | pe = 1; |
489d5531 | 10201 | } |
1268c371 | 10202 | |
10203 | // Common: | |
489d5531 | 10204 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
489d5531 | 10205 | // 2-particle correlation: |
10206 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> | |
1268c371 | 10207 | // sinus terms coming from reference flow: |
489d5531 | 10208 | Double_t sinP1nPhi = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1); // <<sin(n*phi1)>> |
10209 | Double_t sinP1nPhi1P1nPhi2 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2); // <<sin(n*(phi1+phi2))>> | |
10210 | Double_t sinP1nPhi1M1nPhi2M1nPhi3 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(3); // <<sin(n*(phi1-phi2-phi3))>> | |
1268c371 | 10211 | // cosinus terms coming from reference flow: |
489d5531 | 10212 | Double_t cosP1nPhi = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1); // <<cos(n*phi1)>> |
10213 | Double_t cosP1nPhi1P1nPhi2 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2); // <<cos(n*(phi1+phi2))>> | |
10214 | Double_t cosP1nPhi1M1nPhi2M1nPhi3 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(3); // <<cos(n*(phi1-phi2-phi3))>> | |
10215 | ||
10216 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10217 | { | |
10218 | Double_t twoPrime = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); // <<2'>> | |
10219 | Double_t fourPrime = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); // <<4'>> | |
10220 | Double_t sinP1nPsi = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][0]->GetBinContent(b); // <<sin n(Psi)>> | |
10221 | Double_t cosP1nPsi = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][0]->GetBinContent(b); // <<cos n(Psi)>> | |
10222 | Double_t sinP1nPsi1P1nPhi2 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][1]->GetBinContent(b); // <<sin n(psi1+phi2)>> | |
10223 | Double_t cosP1nPsi1P1nPhi2 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][1]->GetBinContent(b); // <<cos n(psi1+phi2)>> | |
10224 | Double_t sinP1nPsi1P1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][2]->GetBinContent(b); // <<sin n(psi1+phi2-phi3)>> | |
10225 | Double_t cosP1nPsi1P1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][2]->GetBinContent(b); // <<cos n(psi1+phi2-phi3)>> | |
10226 | Double_t sinP1nPsi1M1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][3]->GetBinContent(b); // <<sin n(psi1-phi2-phi3)>> | |
10227 | Double_t cosP1nPsi1M1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][3]->GetBinContent(b); // <<cos n(psi1-phi2-phi3)>> | |
1268c371 | 10228 | // Generalized QC{2'}: |
489d5531 | 10229 | Double_t qc2Prime = twoPrime - sinP1nPsi*sinP1nPhi - cosP1nPsi*cosP1nPhi; |
1268c371 | 10230 | if(fApplyCorrectionForNUA) |
10231 | { | |
10232 | fDiffFlowCumulants[t][pe][0]->SetBinContent(b,qc2Prime); | |
10233 | } | |
10234 | if(TMath::Abs(twoPrime)>0.) | |
10235 | { | |
10236 | fDiffFlowDetectorBias[t][pe][0]->SetBinContent(b,qc2Prime/twoPrime); // detector bias = generalized/isotropic cumulant. | |
10237 | } | |
10238 | // Generalized QC{4'}: | |
489d5531 | 10239 | Double_t qc4Prime = fourPrime-2.*twoPrime*two |
10240 | - cosP1nPsi*cosP1nPhi1M1nPhi2M1nPhi3 | |
10241 | + sinP1nPsi*sinP1nPhi1M1nPhi2M1nPhi3 | |
10242 | - cosP1nPhi*cosP1nPsi1M1nPhi2M1nPhi3 | |
10243 | + sinP1nPhi*sinP1nPsi1M1nPhi2M1nPhi3 | |
10244 | - 2.*cosP1nPhi*cosP1nPsi1P1nPhi2M1nPhi3 | |
10245 | - 2.*sinP1nPhi*sinP1nPsi1P1nPhi2M1nPhi3 | |
10246 | - cosP1nPsi1P1nPhi2*cosP1nPhi1P1nPhi2 | |
10247 | - sinP1nPsi1P1nPhi2*sinP1nPhi1P1nPhi2 | |
10248 | + 2.*cosP1nPhi1P1nPhi2*(cosP1nPsi*cosP1nPhi-sinP1nPsi*sinP1nPhi) | |
10249 | + 2.*sinP1nPhi1P1nPhi2*(cosP1nPsi*sinP1nPhi+sinP1nPsi*cosP1nPhi) | |
10250 | + 4.*two*(cosP1nPsi*cosP1nPhi+sinP1nPsi*sinP1nPhi) | |
10251 | + 2.*cosP1nPsi1P1nPhi2*(pow(cosP1nPhi,2.)-pow(sinP1nPhi,2.)) | |
10252 | + 4.*sinP1nPsi1P1nPhi2*cosP1nPhi*sinP1nPhi | |
10253 | + 4.*twoPrime*(pow(cosP1nPhi,2.)+pow(sinP1nPhi,2.)) | |
10254 | - 6.*(pow(cosP1nPhi,2.)-pow(sinP1nPhi,2.)) | |
10255 | * (cosP1nPsi*cosP1nPhi-sinP1nPsi*sinP1nPhi) | |
10256 | - 12.*cosP1nPhi*sinP1nPhi | |
10257 | * (sinP1nPsi*cosP1nPhi+cosP1nPsi*sinP1nPhi); | |
1268c371 | 10258 | if(fApplyCorrectionForNUA) |
10259 | { | |
10260 | fDiffFlowCumulants[t][pe][1]->SetBinContent(b,qc4Prime); | |
10261 | } | |
10262 | if(TMath::Abs(fourPrime-2.*twoPrime*two)>0.) | |
10263 | { | |
10264 | fDiffFlowDetectorBias[t][pe][1]->SetBinContent(b,qc4Prime/(fourPrime-2.*twoPrime*two)); // detector bias = generalized/isotropic cumulant. | |
10265 | } | |
489d5531 | 10266 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
10267 | ||
10268 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta) | |
10269 | ||
1268c371 | 10270 | //================================================================================================================================== |
489d5531 | 10271 | |
10272 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta) | |
10273 | { | |
10274 | // Calculate differential flow corrected for non-uniform acceptance. | |
10275 | ||
1268c371 | 10276 | // to be improved: eventually I will have to access here masured correlations and NUA terms |
10277 | // instead of cumulants in order to propagate statistical error correctly also | |
10278 | // to NUA terms (propagating errors directly from cumulants is WRONG for | |
10279 | // differential flow becuase that doesn't account at all cross-covariance terms) | |
489d5531 | 10280 | |
1268c371 | 10281 | // REMARK: When NUA correction is apllied error for differential flow DOES NOT get corrected, |
10282 | // i.e. only value is being corrected, error is still the one relevant for isotropic | |
10283 | // case. This eventually will be resolved. | |
10284 | ||
10285 | ||
10286 | Int_t t = 0; // RP or POI | |
10287 | Int_t pe = 0; // pt or eta | |
489d5531 | 10288 | |
10289 | if(type == "RP") | |
10290 | { | |
1268c371 | 10291 | t = 0; |
489d5531 | 10292 | } else if(type == "POI") |
10293 | { | |
1268c371 | 10294 | t = 1; |
10295 | } | |
489d5531 | 10296 | if(ptOrEta == "Pt") |
10297 | { | |
1268c371 | 10298 | pe = 0; |
489d5531 | 10299 | } else if(ptOrEta == "Eta") |
10300 | { | |
1268c371 | 10301 | pe = 1; |
489d5531 | 10302 | } |
10303 | ||
1268c371 | 10304 | // Common: |
489d5531 | 10305 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
1268c371 | 10306 | // Reference Q-cumulants |
10307 | Double_t qc2 = fIntFlowQcumulants->GetBinContent(1); // QC{2} | |
10308 | Double_t qc4 = fIntFlowQcumulants->GetBinContent(2); // QC{4} | |
10309 | // Loop over pt or eta bins: | |
489d5531 | 10310 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) |
10311 | { | |
1268c371 | 10312 | // Differential Q-cumulants: |
10313 | Double_t qc2Prime = fDiffFlowCumulants[t][pe][0]->GetBinContent(b); // QC{2'} | |
10314 | Double_t qc4Prime = fDiffFlowCumulants[t][pe][1]->GetBinContent(b); // QC{4'} | |
489d5531 | 10315 | // v'{2}: |
1268c371 | 10316 | if(qc2>0.) |
489d5531 | 10317 | { |
1268c371 | 10318 | Double_t v2Prime = qc2Prime/pow(qc2,0.5); |
10319 | if(TMath::Abs(v2Prime)>0.){fDiffFlow[t][pe][0]->SetBinContent(b,v2Prime);} | |
489d5531 | 10320 | } |
489d5531 | 10321 | // v'{4}: |
1268c371 | 10322 | if(qc4<0.) |
489d5531 | 10323 | { |
1268c371 | 10324 | Double_t v4Prime = -qc4Prime/pow(-qc4,3./4.); |
10325 | if(TMath::Abs(v4Prime)>0.){fDiffFlow[t][pe][1]->SetBinContent(b,v4Prime);} | |
489d5531 | 10326 | } |
10327 | } // end of for(Int_t b=1;b<=fnBinsPtEta[pe];b++) | |
10328 | ||
10329 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta); | |
10330 | ||
489d5531 | 10331 | //================================================================================================================================== |
10332 | ||
0328db2d | 10333 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoops(AliFlowEventSimple * const anEvent) |
489d5531 | 10334 | { |
10335 | // Evaluate with nested loops multiparticle correlations for integrated flow (without using the particle weights). | |
10336 | ||
10337 | // Remark: Results are stored in profile fIntFlowDirectCorrelations whose binning is organized as follows: | |
10338 | // | |
10339 | // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))> | |
10340 | // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))> | |
10341 | // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))> | |
10342 | // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))> | |
10343 | // 5th bin: ---- EMPTY ---- | |
10344 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))> | |
10345 | // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))> | |
10346 | // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))> | |
10347 | // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))> | |
10348 | // 10th bin: ---- EMPTY ---- | |
10349 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))> | |
10350 | // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))> | |
10351 | // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))> | |
10352 | // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))> | |
10353 | // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))> | |
10354 | // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))> | |
10355 | // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> | |
10356 | // 18th bin: ---- EMPTY ---- | |
10357 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))> | |
10358 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))> | |
10359 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))> | |
10360 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))> | |
10361 | // 23rd bin: ---- EMPTY ---- | |
10362 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> | |
10363 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))> | |
10364 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))> | |
10365 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))> | |
10366 | // 28th bin: ---- EMPTY ---- | |
10367 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> | |
10368 | // 30th bin: ---- EMPTY ---- | |
10369 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> | |
8ed4edc7 | 10370 | // 32nd bin: ---- EMPTY ---- |
10371 | // 33rd bin: <4>_{4n,2n|3n,3n}= four4n2n3n3n = <cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4))> | |
10372 | // 34th bin: <5>_{2n,2n,2n|3n,3n} = five2n2n2n3n3n = <cos(n*(2.*phi1+2.*phi2+2.*phi3-3.*phi4-3.*phi5))> | |
10373 | ||
489d5531 | 10374 | Int_t nPrim = anEvent->NumberOfTracks(); |
10375 | AliFlowTrackSimple *aftsTrack = NULL; | |
10376 | Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; | |
10377 | Int_t n = fHarmonic; | |
10378 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 10379 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 10380 | cout<<endl; |
10381 | cout<<"Multiparticle correlations: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
10382 | if(dMult<2) | |
10383 | { | |
10384 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
10385 | } else if (dMult>fMaxAllowedMultiplicity) | |
10386 | { | |
10387 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
10388 | } else | |
10389 | { | |
10390 | cout<<"... evaluating nested loops (without using particle weights)..."<<endl; | |
10391 | } | |
10392 | ||
10393 | // 2-particle correlations: | |
10394 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
10395 | { | |
10396 | for(Int_t i1=0;i1<nPrim;i1++) | |
10397 | { | |
10398 | aftsTrack=anEvent->GetTrack(i1); | |
10399 | if(!(aftsTrack->InRPSelection())) continue; | |
10400 | phi1=aftsTrack->Phi(); | |
10401 | for(Int_t i2=0;i2<nPrim;i2++) | |
10402 | { | |
10403 | if(i2==i1)continue; | |
10404 | aftsTrack=anEvent->GetTrack(i2); | |
10405 | if(!(aftsTrack->InRPSelection())) continue; | |
10406 | phi2=aftsTrack->Phi(); | |
10407 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
10408 | // fill the profile with 2-p correlations: | |
10409 | fIntFlowDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),1.); // <cos(n*(phi1-phi2))> | |
10410 | fIntFlowDirectCorrelations->Fill(1.5,cos(2.*n*(phi1-phi2)),1.); // <cos(2n*(phi1-phi2))> | |
10411 | fIntFlowDirectCorrelations->Fill(2.5,cos(3.*n*(phi1-phi2)),1.); // <cos(3n*(phi1-phi2))> | |
10412 | fIntFlowDirectCorrelations->Fill(3.5,cos(4.*n*(phi1-phi2)),1.); // <cos(4n*(phi1-phi2))> | |
10413 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10414 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10415 | } // end of if(nPrim>=2) | |
10416 | ||
10417 | // 3-particle correlations: | |
10418 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
10419 | { | |
10420 | for(Int_t i1=0;i1<nPrim;i1++) | |
10421 | { | |
10422 | aftsTrack=anEvent->GetTrack(i1); | |
10423 | if(!(aftsTrack->InRPSelection())) continue; | |
10424 | phi1=aftsTrack->Phi(); | |
10425 | for(Int_t i2=0;i2<nPrim;i2++) | |
10426 | { | |
10427 | if(i2==i1)continue; | |
10428 | aftsTrack=anEvent->GetTrack(i2); | |
10429 | if(!(aftsTrack->InRPSelection())) continue; | |
10430 | phi2=aftsTrack->Phi(); | |
10431 | for(Int_t i3=0;i3<nPrim;i3++) | |
10432 | { | |
10433 | if(i3==i1||i3==i2)continue; | |
10434 | aftsTrack=anEvent->GetTrack(i3); | |
10435 | if(!(aftsTrack->InRPSelection())) continue; | |
10436 | phi3=aftsTrack->Phi(); | |
10437 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
10438 | // fill the profile with 3-p correlations: | |
10439 | fIntFlowDirectCorrelations->Fill(5.,cos(2.*n*phi1-n*(phi2+phi3)),1.); //<3>_{2n|nn,n} | |
10440 | fIntFlowDirectCorrelations->Fill(6.,cos(3.*n*phi1-2.*n*phi2-n*phi3),1.); //<3>_{3n|2n,n} | |
10441 | fIntFlowDirectCorrelations->Fill(7.,cos(4.*n*phi1-2.*n*phi2-2.*n*phi3),1.); //<3>_{4n|2n,2n} | |
10442 | fIntFlowDirectCorrelations->Fill(8.,cos(4.*n*phi1-3.*n*phi2-n*phi3),1.); //<3>_{4n|3n,n} | |
10443 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10444 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10445 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10446 | } // end of if(nPrim>=3) | |
10447 | ||
10448 | // 4-particle correlations: | |
10449 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) | |
10450 | { | |
10451 | for(Int_t i1=0;i1<nPrim;i1++) | |
10452 | { | |
10453 | aftsTrack=anEvent->GetTrack(i1); | |
10454 | if(!(aftsTrack->InRPSelection())) continue; | |
10455 | phi1=aftsTrack->Phi(); | |
10456 | for(Int_t i2=0;i2<nPrim;i2++) | |
10457 | { | |
10458 | if(i2==i1)continue; | |
10459 | aftsTrack=anEvent->GetTrack(i2); | |
10460 | if(!(aftsTrack->InRPSelection())) continue; | |
10461 | phi2=aftsTrack->Phi(); | |
10462 | for(Int_t i3=0;i3<nPrim;i3++) | |
10463 | { | |
10464 | if(i3==i1||i3==i2)continue; | |
10465 | aftsTrack=anEvent->GetTrack(i3); | |
10466 | if(!(aftsTrack->InRPSelection())) continue; | |
10467 | phi3=aftsTrack->Phi(); | |
10468 | for(Int_t i4=0;i4<nPrim;i4++) | |
10469 | { | |
10470 | if(i4==i1||i4==i2||i4==i3)continue; | |
10471 | aftsTrack=anEvent->GetTrack(i4); | |
10472 | if(!(aftsTrack->InRPSelection())) continue; | |
10473 | phi4=aftsTrack->Phi(); | |
10474 | if(nPrim==4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; | |
10475 | // fill the profile with 4-p correlations: | |
10476 | fIntFlowDirectCorrelations->Fill(10.,cos(n*phi1+n*phi2-n*phi3-n*phi4),1.); // <4>_{n,n|n,n} | |
10477 | fIntFlowDirectCorrelations->Fill(11.,cos(2.*n*phi1+n*phi2-2.*n*phi3-n*phi4),1.); // <4>_{2n,n|2n,n} | |
10478 | fIntFlowDirectCorrelations->Fill(12.,cos(2.*n*phi1+2*n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{2n,2n|2n,2n} | |
10479 | fIntFlowDirectCorrelations->Fill(13.,cos(3.*n*phi1-n*phi2-n*phi3-n*phi4),1.); // <4>_{3n|n,n,n} | |
10480 | fIntFlowDirectCorrelations->Fill(14.,cos(3.*n*phi1+n*phi2-3.*n*phi3-n*phi4),1.); // <4>_{3n,n|3n,n} | |
10481 | fIntFlowDirectCorrelations->Fill(15.,cos(3.*n*phi1+n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{3n,n|2n,2n} | |
10482 | fIntFlowDirectCorrelations->Fill(16.,cos(4.*n*phi1-2.*n*phi2-n*phi3-n*phi4),1.); // <4>_{4n|2n,n,n} | |
8ed4edc7 | 10483 | fIntFlowDirectCorrelations->Fill(32.,cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4)),1.); // <4>_{4n,2n|3n,3n} |
489d5531 | 10484 | } // end of for(Int_t i4=0;i4<nPrim;i4++) |
10485 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10486 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10487 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10488 | } // end of if(nPrim>=) | |
10489 | ||
10490 | // 5-particle correlations: | |
10491 | if(nPrim>=5 && nPrim<=fMaxAllowedMultiplicity) | |
10492 | { | |
10493 | for(Int_t i1=0;i1<nPrim;i1++) | |
10494 | { | |
10495 | aftsTrack=anEvent->GetTrack(i1); | |
10496 | if(!(aftsTrack->InRPSelection())) continue; | |
10497 | phi1=aftsTrack->Phi(); | |
10498 | for(Int_t i2=0;i2<nPrim;i2++) | |
10499 | { | |
10500 | if(i2==i1)continue; | |
10501 | aftsTrack=anEvent->GetTrack(i2); | |
10502 | if(!(aftsTrack->InRPSelection())) continue; | |
10503 | phi2=aftsTrack->Phi(); | |
10504 | for(Int_t i3=0;i3<nPrim;i3++) | |
10505 | { | |
10506 | if(i3==i1||i3==i2)continue; | |
10507 | aftsTrack=anEvent->GetTrack(i3); | |
10508 | if(!(aftsTrack->InRPSelection())) continue; | |
10509 | phi3=aftsTrack->Phi(); | |
10510 | for(Int_t i4=0;i4<nPrim;i4++) | |
10511 | { | |
10512 | if(i4==i1||i4==i2||i4==i3)continue; | |
10513 | aftsTrack=anEvent->GetTrack(i4); | |
10514 | if(!(aftsTrack->InRPSelection())) continue; | |
10515 | phi4=aftsTrack->Phi(); | |
10516 | for(Int_t i5=0;i5<nPrim;i5++) | |
10517 | { | |
10518 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
10519 | aftsTrack=anEvent->GetTrack(i5); | |
10520 | if(!(aftsTrack->InRPSelection())) continue; | |
10521 | phi5=aftsTrack->Phi(); | |
10522 | if(nPrim==5) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<"\r"<<flush; | |
10523 | // fill the profile with 5-p correlations: | |
10524 | fIntFlowDirectCorrelations->Fill(18.,cos(2.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5),1.); //<5>_{2n,n|n,n,n} | |
10525 | fIntFlowDirectCorrelations->Fill(19.,cos(2.*n*phi1+2.*n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); //<5>_{2n,2n|2n,n,n} | |
10526 | fIntFlowDirectCorrelations->Fill(20.,cos(3.*n*phi1+n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); //<5>_{3n,n|2n,n,n} | |
10527 | fIntFlowDirectCorrelations->Fill(21.,cos(4.*n*phi1-n*phi2-n*phi3-n*phi4-n*phi5),1.); //<5>_{4n|n,n,n,n} | |
8ed4edc7 | 10528 | fIntFlowDirectCorrelations->Fill(33.,cos(2.*n*phi1+2.*n*phi2+2.*n*phi3-3.*n*phi4-3.*n*phi5),1.); |
489d5531 | 10529 | } // end of for(Int_t i5=0;i5<nPrim;i5++) |
10530 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
10531 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10532 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10533 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10534 | } // end of if(nPrim>=5) | |
10535 | ||
10536 | // 6-particle correlations: | |
10537 | if(nPrim>=6 && nPrim<=fMaxAllowedMultiplicity) | |
10538 | { | |
10539 | for(Int_t i1=0;i1<nPrim;i1++) | |
10540 | { | |
10541 | aftsTrack=anEvent->GetTrack(i1); | |
10542 | if(!(aftsTrack->InRPSelection())) continue; | |
10543 | phi1=aftsTrack->Phi(); | |
10544 | for(Int_t i2=0;i2<nPrim;i2++) | |
10545 | { | |
10546 | if(i2==i1)continue; | |
10547 | aftsTrack=anEvent->GetTrack(i2); | |
10548 | if(!(aftsTrack->InRPSelection())) continue; | |
10549 | phi2=aftsTrack->Phi(); | |
10550 | for(Int_t i3=0;i3<nPrim;i3++) | |
10551 | { | |
10552 | if(i3==i1||i3==i2)continue; | |
10553 | aftsTrack=anEvent->GetTrack(i3); | |
10554 | if(!(aftsTrack->InRPSelection())) continue; | |
10555 | phi3=aftsTrack->Phi(); | |
10556 | for(Int_t i4=0;i4<nPrim;i4++) | |
10557 | { | |
10558 | if(i4==i1||i4==i2||i4==i3)continue; | |
10559 | aftsTrack=anEvent->GetTrack(i4); | |
10560 | if(!(aftsTrack->InRPSelection())) continue; | |
10561 | phi4=aftsTrack->Phi(); | |
10562 | for(Int_t i5=0;i5<nPrim;i5++) | |
10563 | { | |
10564 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
10565 | aftsTrack=anEvent->GetTrack(i5); | |
10566 | if(!(aftsTrack->InRPSelection())) continue; | |
10567 | phi5=aftsTrack->Phi(); | |
10568 | for(Int_t i6=0;i6<nPrim;i6++) | |
10569 | { | |
10570 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
10571 | aftsTrack=anEvent->GetTrack(i6); | |
10572 | if(!(aftsTrack->InRPSelection())) continue; | |
10573 | phi6=aftsTrack->Phi(); | |
10574 | if(nPrim==6) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<"\r"<<flush; | |
10575 | // fill the profile with 6-p correlations: | |
10576 | fIntFlowDirectCorrelations->Fill(23.,cos(n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{n,n,n|n,n,n} | |
10577 | fIntFlowDirectCorrelations->Fill(24.,cos(2.*n*phi1+n*phi2+n*phi3-2.*n*phi4-n*phi5-n*phi6),1.); //<6>_{2n,n,n|2n,n,n} | |
10578 | fIntFlowDirectCorrelations->Fill(25.,cos(2.*n*phi1+2.*n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{2n,2n|n,n,n,n} | |
10579 | fIntFlowDirectCorrelations->Fill(26.,cos(3.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{3n,n|n,n,n,n} | |
10580 | } // end of for(Int_t i6=0;i6<nPrim;i6++) | |
10581 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
10582 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
10583 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10584 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10585 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10586 | } // end of if(nPrim>=6) | |
10587 | ||
10588 | // 7-particle correlations: | |
10589 | if(nPrim>=7 && nPrim<=fMaxAllowedMultiplicity) | |
10590 | { | |
10591 | for(Int_t i1=0;i1<nPrim;i1++) | |
10592 | { | |
10593 | aftsTrack=anEvent->GetTrack(i1); | |
10594 | if(!(aftsTrack->InRPSelection())) continue; | |
10595 | phi1=aftsTrack->Phi(); | |
10596 | for(Int_t i2=0;i2<nPrim;i2++) | |
10597 | { | |
10598 | if(i2==i1)continue; | |
10599 | aftsTrack=anEvent->GetTrack(i2); | |
10600 | if(!(aftsTrack->InRPSelection())) continue; | |
10601 | phi2=aftsTrack->Phi(); | |
10602 | for(Int_t i3=0;i3<nPrim;i3++) | |
10603 | { | |
10604 | if(i3==i1||i3==i2)continue; | |
10605 | aftsTrack=anEvent->GetTrack(i3); | |
10606 | if(!(aftsTrack->InRPSelection())) continue; | |
10607 | phi3=aftsTrack->Phi(); | |
10608 | for(Int_t i4=0;i4<nPrim;i4++) | |
10609 | { | |
10610 | if(i4==i1||i4==i2||i4==i3)continue; | |
10611 | aftsTrack=anEvent->GetTrack(i4); | |
10612 | if(!(aftsTrack->InRPSelection())) continue; | |
10613 | phi4=aftsTrack->Phi(); | |
10614 | for(Int_t i5=0;i5<nPrim;i5++) | |
10615 | { | |
10616 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
10617 | aftsTrack=anEvent->GetTrack(i5); | |
10618 | if(!(aftsTrack->InRPSelection())) continue; | |
10619 | phi5=aftsTrack->Phi(); | |
10620 | for(Int_t i6=0;i6<nPrim;i6++) | |
10621 | { | |
10622 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
10623 | aftsTrack=anEvent->GetTrack(i6); | |
10624 | if(!(aftsTrack->InRPSelection())) continue; | |
10625 | phi6=aftsTrack->Phi(); | |
10626 | for(Int_t i7=0;i7<nPrim;i7++) | |
10627 | { | |
10628 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; | |
10629 | aftsTrack=anEvent->GetTrack(i7); | |
10630 | if(!(aftsTrack->InRPSelection())) continue; | |
10631 | phi7=aftsTrack->Phi(); | |
10632 | if(nPrim==7) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<" "<<i7<<"\r"<<flush; | |
10633 | // fill the profile with 7-p correlation: | |
10634 | fIntFlowDirectCorrelations->Fill(28.,cos(2.*n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6-n*phi7),1.); // <7>_{2n,n,n|n,n,n,n} | |
10635 | } // end of for(Int_t i7=0;i7<nPrim;i7++) | |
10636 | } // end of for(Int_t i6=0;i6<nPrim;i6++) | |
10637 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
10638 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
10639 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10640 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10641 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10642 | } // end of if(nPrim>=7) | |
10643 | ||
10644 | // 8-particle correlations: | |
10645 | if(nPrim>=8 && nPrim<=fMaxAllowedMultiplicity) | |
10646 | { | |
10647 | for(Int_t i1=0;i1<nPrim;i1++) | |
10648 | { | |
10649 | aftsTrack=anEvent->GetTrack(i1); | |
10650 | if(!(aftsTrack->InRPSelection())) continue; | |
10651 | phi1=aftsTrack->Phi(); | |
10652 | for(Int_t i2=0;i2<nPrim;i2++) | |
10653 | { | |
10654 | if(i2==i1)continue; | |
10655 | aftsTrack=anEvent->GetTrack(i2); | |
10656 | if(!(aftsTrack->InRPSelection())) continue; | |
10657 | phi2=aftsTrack->Phi(); | |
10658 | for(Int_t i3=0;i3<nPrim;i3++) | |
10659 | { | |
10660 | if(i3==i1||i3==i2)continue; | |
10661 | aftsTrack=anEvent->GetTrack(i3); | |
10662 | if(!(aftsTrack->InRPSelection())) continue; | |
10663 | phi3=aftsTrack->Phi(); | |
10664 | for(Int_t i4=0;i4<nPrim;i4++) | |
10665 | { | |
10666 | if(i4==i1||i4==i2||i4==i3)continue; | |
10667 | aftsTrack=anEvent->GetTrack(i4); | |
10668 | if(!(aftsTrack->InRPSelection())) continue; | |
10669 | phi4=aftsTrack->Phi(); | |
10670 | for(Int_t i5=0;i5<nPrim;i5++) | |
10671 | { | |
10672 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
10673 | aftsTrack=anEvent->GetTrack(i5); | |
10674 | if(!(aftsTrack->InRPSelection())) continue; | |
10675 | phi5=aftsTrack->Phi(); | |
10676 | for(Int_t i6=0;i6<nPrim;i6++) | |
10677 | { | |
10678 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
10679 | aftsTrack=anEvent->GetTrack(i6); | |
10680 | if(!(aftsTrack->InRPSelection())) continue; | |
10681 | phi6=aftsTrack->Phi(); | |
10682 | for(Int_t i7=0;i7<nPrim;i7++) | |
10683 | { | |
10684 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; | |
10685 | aftsTrack=anEvent->GetTrack(i7); | |
10686 | if(!(aftsTrack->InRPSelection())) continue; | |
10687 | phi7=aftsTrack->Phi(); | |
10688 | for(Int_t i8=0;i8<nPrim;i8++) | |
10689 | { | |
10690 | if(i8==i1||i8==i2||i8==i3||i8==i4||i8==i5||i8==i6||i8==i7)continue; | |
10691 | aftsTrack=anEvent->GetTrack(i8); | |
10692 | if(!(aftsTrack->InRPSelection())) continue; | |
10693 | phi8=aftsTrack->Phi(); | |
10694 | cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<" "<<i7<<" "<<i8<<"\r"<<flush; | |
10695 | // fill the profile with 8-p correlation: | |
10696 | fIntFlowDirectCorrelations->Fill(30.,cos(n*phi1+n*phi2+n*phi3+n*phi4-n*phi5-n*phi6-n*phi7-n*phi8),1.); // <8>_{n,n,n,n|n,n,n,n} | |
10697 | } // end of for(Int_t i8=0;i8<nPrim;i8++) | |
10698 | } // end of for(Int_t i7=0;i7<nPrim;i7++) | |
10699 | } // end of for(Int_t i6=0;i6<nPrim;i6++) | |
10700 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
10701 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
10702 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10703 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10704 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10705 | } // end of if(nPrim>=8) | |
10706 | ||
10707 | cout<<endl; | |
10708 | ||
10709 | } // end of AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent) | |
10710 | ||
10711 | ||
10712 | //================================================================================================================================== | |
10713 | ||
10714 | ||
10715 | void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrelations() | |
10716 | { | |
10717 | // Cross-check results for multiparticle correlations needed for int. flow: results from Q-vectors vs results from nested loops. | |
10718 | ||
10719 | cout<<endl; | |
10720 | cout<<endl; | |
10721 | cout<<" *****************************************"<<endl; | |
10722 | cout<<" **** cross-checking the correlations ****"<<endl; | |
10723 | cout<<" **** for integrated flow ****"<<endl; | |
10724 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
10725 | { | |
10726 | cout<<" **** (particle weights not used) ****"<<endl; | |
10727 | } else | |
10728 | { | |
10729 | cout<<" **** (particle weights used) ****"<<endl; | |
10730 | } | |
10731 | cout<<" *****************************************"<<endl; | |
10732 | cout<<endl; | |
10733 | cout<<endl; | |
10734 | ||
8ed4edc7 | 10735 | Int_t ciMax = 34; // to be improved (removed eventually when I calculate 6th and 8th order with particle weights) |
489d5531 | 10736 | |
10737 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
10738 | { | |
10739 | ciMax = 11; | |
10740 | } | |
10741 | ||
10742 | for(Int_t ci=1;ci<=ciMax;ci++) | |
10743 | { | |
10744 | if(strcmp((fIntFlowCorrelationsAllPro->GetXaxis())->GetBinLabel(ci), "") == 0) continue; // to be improved (access finalized histogram here) | |
10745 | cout<<(fIntFlowCorrelationsAllPro->GetXaxis())->GetBinLabel(ci)<<":"<<endl; // to be improved (access finalized histogram here) | |
10746 | cout<<"from Q-vectors = "<<fIntFlowCorrelationsAllPro->GetBinContent(ci)<<endl; // to be improved (access finalized histogram here) | |
10747 | cout<<"from nested loops = "<<fIntFlowDirectCorrelations->GetBinContent(ci)<<endl; | |
10748 | cout<<endl; | |
10749 | } | |
10750 | ||
10751 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrelations() | |
10752 | ||
10753 | ||
10754 | //================================================================================================================================ | |
10755 | ||
10756 | ||
10757 | void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrectionTermsForNUA() | |
10758 | { | |
10759 | // Cross-check results for corrections terms for non-uniform acceptance needed for int. flow: results from Q-vectors vs results from nested loops. | |
10760 | ||
10761 | cout<<endl; | |
10762 | cout<<endl; | |
10763 | cout<<" *********************************************"<<endl; | |
10764 | cout<<" **** cross-checking the correction terms ****"<<endl; | |
10765 | cout<<" **** for non-uniform acceptance relevant ****"<<endl; | |
10766 | cout<<" **** for integrated flow ****"<<endl; | |
10767 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
10768 | { | |
10769 | cout<<" **** (particle weights not used) ****"<<endl; | |
10770 | } else | |
10771 | { | |
10772 | cout<<" **** (particle weights used) ****"<<endl; | |
10773 | } | |
10774 | cout<<" *********************************************"<<endl; | |
10775 | cout<<endl; | |
10776 | cout<<endl; | |
10777 | ||
b92ea2b9 | 10778 | for(Int_t ci=1;ci<=4;ci++) // correction term index (to be improved - hardwired 4) |
489d5531 | 10779 | { |
10780 | for(Int_t sc=0;sc<2;sc++) // sin or cos term | |
10781 | { | |
10782 | if(strcmp((fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->GetBinLabel(ci), "") == 0) continue; // to be improved (access finalized histogram here) | |
10783 | cout<<(fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->GetBinLabel(ci)<<":"<<endl; // to be improved (access finalized histogram here) | |
10784 | cout<<"from Q-vectors = "<<fIntFlowCorrectionTermsForNUAPro[sc]->GetBinContent(ci)<<endl; // to be improved (access finalized histogram here) | |
10785 | cout<<"from nested loops = "<<fIntFlowDirectCorrectionTermsForNUA[sc]->GetBinContent(ci)<<endl; | |
10786 | cout<<endl; | |
10787 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos term | |
10788 | } // end of for(Int_t ci=1;ci<=10;ci++) // correction term index | |
10789 | ||
10790 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrectionTermsForNUA() | |
10791 | ||
10792 | ||
10793 | //================================================================================================================================ | |
10794 | ||
10795 | ||
0328db2d | 10796 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent) |
489d5531 | 10797 | { |
10798 | // Evaluate with nested loops multiparticle correlations for integrated flow (using the particle weights). | |
10799 | ||
10800 | // Results are stored in profile fIntFlowDirectCorrelations. | |
10801 | // Remark 1: When particle weights are used the binning of fIntFlowDirectCorrelations is organized as follows: | |
10802 | // | |
10803 | // 1st bin: <2>_{1n|1n} = two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))> | |
10804 | // 2nd bin: <2>_{2n|2n} = two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
10805 | // 3rd bin: <2>_{3n|3n} = two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
10806 | // 4th bin: <2>_{4n|4n} = two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
10807 | // 5th bin: ---- EMPTY ---- | |
10808 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
10809 | // 7th bin: <3>_{3n|2n,1n} = ... | |
10810 | // 8th bin: <3>_{4n|2n,2n} = ... | |
10811 | // 9th bin: <3>_{4n|3n,1n} = ... | |
10812 | // 10th bin: ---- EMPTY ---- | |
10813 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
10814 | // 12th bin: <4>_{2n,1n|2n,1n} = ... | |
10815 | // 13th bin: <4>_{2n,2n|2n,2n} = ... | |
10816 | // 14th bin: <4>_{3n|1n,1n,1n} = ... | |
10817 | // 15th bin: <4>_{3n,1n|3n,1n} = ... | |
10818 | // 16th bin: <4>_{3n,1n|2n,2n} = ... | |
10819 | // 17th bin: <4>_{4n|2n,1n,1n} = ... | |
10820 | // 18th bin: ---- EMPTY ---- | |
10821 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = ... | |
10822 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = ... | |
10823 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = ... | |
10824 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = ... | |
10825 | // 23rd bin: ---- EMPTY ---- | |
10826 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = ... | |
10827 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = ... | |
10828 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = ... | |
10829 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = ... | |
10830 | // 28th bin: ---- EMPTY ---- | |
10831 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = ... | |
10832 | // 30th bin: ---- EMPTY ---- | |
10833 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = ... | |
57340a27 | 10834 | |
489d5531 | 10835 | // Remark 2: When particle weights are used there are some extra correlations. They are stored in |
10836 | // fIntFlowExtraDirectCorrelations binning of which is organized as follows: | |
57340a27 | 10837 | |
489d5531 | 10838 | // 1st bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))> |
10839 | // 2nd bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
10840 | // ... | |
57340a27 | 10841 | |
489d5531 | 10842 | Int_t nPrim = anEvent->NumberOfTracks(); |
10843 | AliFlowTrackSimple *aftsTrack = NULL; | |
10844 | //Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; | |
10845 | //Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
10846 | Double_t phi1=0., phi2=0., phi3=0., phi4=0.; | |
10847 | Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1.; | |
10848 | Int_t n = fHarmonic; | |
10849 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 10850 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 10851 | cout<<endl; |
10852 | cout<<"Multiparticle correlations: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
10853 | if(dMult<2) | |
10854 | { | |
10855 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
10856 | } else if (dMult>fMaxAllowedMultiplicity) | |
10857 | { | |
10858 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
10859 | } else | |
10860 | { | |
10861 | cout<<"... evaluating nested loops (using particle weights) ..."<<endl; | |
10862 | } | |
10863 | ||
10864 | // 2-particle correlations: | |
10865 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
10866 | { | |
10867 | // 2 nested loops multiparticle correlations using particle weights: | |
10868 | for(Int_t i1=0;i1<nPrim;i1++) | |
10869 | { | |
10870 | aftsTrack=anEvent->GetTrack(i1); | |
10871 | if(!(aftsTrack->InRPSelection())) continue; | |
10872 | phi1=aftsTrack->Phi(); | |
10873 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
10874 | for(Int_t i2=0;i2<nPrim;i2++) | |
10875 | { | |
10876 | if(i2==i1)continue; | |
10877 | aftsTrack=anEvent->GetTrack(i2); | |
10878 | if(!(aftsTrack->InRPSelection())) continue; | |
10879 | phi2=aftsTrack->Phi(); | |
10880 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
10881 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
10882 | // 2-p correlations using particle weights: | |
10883 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),wPhi1*wPhi2); // <w1 w2 cos( n*(phi1-phi2))> | |
10884 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(1.5,cos(2.*n*(phi1-phi2)),pow(wPhi1,2)*pow(wPhi2,2)); // <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
10885 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(2.5,cos(3.*n*(phi1-phi2)),pow(wPhi1,3)*pow(wPhi2,3)); // <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
10886 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(3.5,cos(4.*n*(phi1-phi2)),pow(wPhi1,4)*pow(wPhi2,4)); // <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
10887 | // extra correlations: | |
10888 | // 2-p extra correlations (do not appear if particle weights are not used): | |
10889 | if(fUsePhiWeights) fIntFlowExtraDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),pow(wPhi1,3)*wPhi2); // <w1^3 w2 cos(n*(phi1-phi2))> | |
10890 | // ... | |
10891 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10892 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10893 | } // end of if(nPrim>=2) | |
10894 | ||
10895 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
57340a27 | 10896 | { |
489d5531 | 10897 | // 3 nested loops multiparticle correlations using particle weights: |
10898 | for(Int_t i1=0;i1<nPrim;i1++) | |
57340a27 | 10899 | { |
489d5531 | 10900 | aftsTrack=anEvent->GetTrack(i1); |
10901 | if(!(aftsTrack->InRPSelection())) continue; | |
10902 | phi1=aftsTrack->Phi(); | |
10903 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
10904 | for(Int_t i2=0;i2<nPrim;i2++) | |
10905 | { | |
10906 | if(i2==i1)continue; | |
10907 | aftsTrack=anEvent->GetTrack(i2); | |
10908 | if(!(aftsTrack->InRPSelection())) continue; | |
10909 | phi2=aftsTrack->Phi(); | |
10910 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
10911 | for(Int_t i3=0;i3<nPrim;i3++) | |
10912 | { | |
10913 | if(i3==i1||i3==i2)continue; | |
10914 | aftsTrack=anEvent->GetTrack(i3); | |
10915 | if(!(aftsTrack->InRPSelection())) continue; | |
10916 | phi3=aftsTrack->Phi(); | |
10917 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
10918 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
10919 | // 3-p correlations using particle weights: | |
10920 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(5.5,cos(2.*n*phi1-n*(phi2+phi3)),pow(wPhi1,2)*wPhi2*wPhi3); // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
10921 | // ... | |
10922 | // extra correlations: | |
10923 | // 2-p extra correlations (do not appear if particle weights are not used): | |
10924 | if(fUsePhiWeights) fIntFlowExtraDirectCorrelations->Fill(1.5,cos(n*(phi1-phi2)),wPhi1*wPhi2*pow(wPhi3,2)); // <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
10925 | // ... | |
10926 | // 3-p extra correlations (do not appear if particle weights are not used): | |
10927 | // ... | |
10928 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10929 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10930 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10931 | } // end of if(nPrim>=3) | |
57340a27 | 10932 | |
489d5531 | 10933 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) |
10934 | { | |
10935 | // 4 nested loops multiparticle correlations using particle weights: | |
10936 | for(Int_t i1=0;i1<nPrim;i1++) | |
10937 | { | |
10938 | aftsTrack=anEvent->GetTrack(i1); | |
10939 | if(!(aftsTrack->InRPSelection())) continue; | |
10940 | phi1=aftsTrack->Phi(); | |
10941 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
10942 | for(Int_t i2=0;i2<nPrim;i2++) | |
10943 | { | |
10944 | if(i2==i1)continue; | |
10945 | aftsTrack=anEvent->GetTrack(i2); | |
10946 | if(!(aftsTrack->InRPSelection())) continue; | |
10947 | phi2=aftsTrack->Phi(); | |
10948 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
10949 | for(Int_t i3=0;i3<nPrim;i3++) | |
10950 | { | |
10951 | if(i3==i1||i3==i2)continue; | |
10952 | aftsTrack=anEvent->GetTrack(i3); | |
10953 | if(!(aftsTrack->InRPSelection())) continue; | |
10954 | phi3=aftsTrack->Phi(); | |
10955 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
10956 | for(Int_t i4=0;i4<nPrim;i4++) | |
10957 | { | |
10958 | if(i4==i1||i4==i2||i4==i3)continue; | |
10959 | aftsTrack=anEvent->GetTrack(i4); | |
10960 | if(!(aftsTrack->InRPSelection())) continue; | |
10961 | phi4=aftsTrack->Phi(); | |
10962 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); | |
10963 | if(nPrim>=4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; // to be improved (replace eventually this if statement with if(nPrim==4)) | |
10964 | // 4-p correlations using particle weights: | |
10965 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(10.5,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); | |
10966 | // extra correlations: | |
10967 | // 2-p extra correlations (do not appear if particle weights are not used): | |
10968 | // ... | |
10969 | // 3-p extra correlations (do not appear if particle weights are not used): | |
10970 | // ... | |
10971 | // 4-p extra correlations (do not appear if particle weights are not used): | |
10972 | // ... | |
10973 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
10974 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10975 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10976 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10977 | } // end of if(nPrim>=4) | |
57340a27 | 10978 | |
489d5531 | 10979 | cout<<endl; |
57340a27 | 10980 | |
489d5531 | 10981 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent) |
57340a27 | 10982 | |
489d5531 | 10983 | |
10984 | //================================================================================================================================ | |
10985 | ||
10986 | ||
10987 | void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowExtraCorrelations() | |
57340a27 | 10988 | { |
489d5531 | 10989 | // Cross-check results for extra multiparticle correlations needed for int. flow |
10990 | // which appear only when particle weights are used: results from Q-vectors vs results from nested loops. | |
57340a27 | 10991 | |
489d5531 | 10992 | cout<<endl; |
10993 | cout<<endl; | |
10994 | cout<<" ***********************************************"<<endl; | |
10995 | cout<<" **** cross-checking the extra correlations ****"<<endl; | |
10996 | cout<<" **** for integrated flow ****"<<endl; | |
10997 | cout<<" ***********************************************"<<endl; | |
10998 | cout<<endl; | |
10999 | cout<<endl; | |
11000 | ||
11001 | for(Int_t eci=1;eci<=2;eci++) // to be improved (increased eciMax eventually when I calculate 6th and 8th) | |
57340a27 | 11002 | { |
489d5531 | 11003 | if(strcmp((fIntFlowExtraCorrelationsPro->GetXaxis())->GetBinLabel(eci), "") == 0) continue; |
11004 | cout<<(fIntFlowExtraCorrelationsPro->GetXaxis())->GetBinLabel(eci)<<":"<<endl; | |
11005 | cout<<"from Q-vectors = "<<fIntFlowExtraCorrelationsPro->GetBinContent(eci)<<endl; | |
11006 | cout<<"from nested loops = "<<fIntFlowExtraDirectCorrelations->GetBinContent(eci)<<endl; | |
11007 | cout<<endl; | |
11008 | } | |
57340a27 | 11009 | |
489d5531 | 11010 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowExtraCorrelations() |
57340a27 | 11011 | |
11012 | ||
489d5531 | 11013 | //================================================================================================================================ |
3b552efe | 11014 | |
11015 | ||
0328db2d | 11016 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoops(AliFlowEventSimple * const anEvent) |
489d5531 | 11017 | { |
11018 | // Evaluate with nested loops correction terms for non-uniform acceptance relevant for NONAME integrated flow (to be improved (name)). | |
11019 | // | |
11020 | // Remark: Both sin and cos correction terms are calculated in this method. Sin terms are stored in fIntFlowDirectCorrectionTermsForNUA[0], | |
11021 | // and cos terms in fIntFlowDirectCorrectionTermsForNUA[1]. Binning of fIntFlowDirectCorrectionTermsForNUA[sc] is organized as follows | |
11022 | // (sc stands for either sin or cos): | |
11023 | ||
11024 | // 1st bin: <<sc(n*(phi1))>> | |
11025 | // 2nd bin: <<sc(n*(phi1+phi2))>> | |
11026 | // 3rd bin: <<sc(n*(phi1-phi2-phi3))>> | |
11027 | // 4th bin: <<sc(n*(2phi1-phi2))>> | |
11028 | ||
11029 | Int_t nPrim = anEvent->NumberOfTracks(); | |
11030 | AliFlowTrackSimple *aftsTrack = NULL; | |
11031 | Double_t phi1=0., phi2=0., phi3=0.; | |
11032 | Int_t n = fHarmonic; | |
11033 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 11034 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 11035 | cout<<endl; |
11036 | cout<<"Correction terms for non-uniform acceptance: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
11037 | if(dMult<1) | |
3b552efe | 11038 | { |
489d5531 | 11039 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; |
11040 | } else if (dMult>fMaxAllowedMultiplicity) | |
3b552efe | 11041 | { |
489d5531 | 11042 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; |
11043 | } else | |
11044 | { | |
11045 | cout<<"... evaluating nested loops (without using particle weights)..."<<endl; | |
11046 | } | |
11047 | ||
11048 | if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity) | |
11049 | { | |
11050 | // 1-particle correction terms for non-uniform acceptance: | |
11051 | for(Int_t i1=0;i1<nPrim;i1++) | |
11052 | { | |
11053 | aftsTrack=anEvent->GetTrack(i1); | |
11054 | if(!(aftsTrack->InRPSelection())) continue; | |
11055 | phi1=aftsTrack->Phi(); | |
11056 | if(nPrim==1) cout<<i1<<"\r"<<flush; | |
11057 | // sin terms: | |
11058 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(0.5,sin(n*phi1),1.); // <sin(n*phi1)> | |
11059 | // cos terms: | |
11060 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(0.5,cos(n*phi1),1.); // <cos(n*phi1)> | |
11061 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11062 | } // end of if(nPrim>=1) | |
11063 | ||
11064 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
11065 | { | |
11066 | // 2-particle correction terms for non-uniform acceptance: | |
11067 | for(Int_t i1=0;i1<nPrim;i1++) | |
11068 | { | |
11069 | aftsTrack=anEvent->GetTrack(i1); | |
11070 | if(!(aftsTrack->InRPSelection())) continue; | |
11071 | phi1=aftsTrack->Phi(); | |
11072 | for(Int_t i2=0;i2<nPrim;i2++) | |
3b552efe | 11073 | { |
489d5531 | 11074 | if(i2==i1)continue; |
11075 | aftsTrack=anEvent->GetTrack(i2); | |
11076 | if(!(aftsTrack->InRPSelection())) continue; | |
11077 | phi2=aftsTrack->Phi(); | |
11078 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
11079 | // sin terms: | |
3b552efe | 11080 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(1.5,sin(n*(phi1+phi2)),1.); // <<sin(n*(phi1+phi2))>> |
489d5531 | 11081 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(3.5,sin(n*(2*phi1-phi2)),1.); // <<sin(n*(2*phi1-phi2))>> |
11082 | // cos terms: | |
3b552efe | 11083 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(1.5,cos(n*(phi1+phi2)),1.); // <<cos(n*(phi1+phi2))>> |
489d5531 | 11084 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(3.5,cos(n*(2*phi1-phi2)),1.); // <<cos(n*(2*phi1-phi2))>> |
11085 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11086 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11087 | } // end of if(nPrim>=2) | |
11088 | ||
11089 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
11090 | { | |
11091 | // 3-particle correction terms for non-uniform acceptance: | |
11092 | for(Int_t i1=0;i1<nPrim;i1++) | |
11093 | { | |
11094 | aftsTrack=anEvent->GetTrack(i1); | |
11095 | if(!(aftsTrack->InRPSelection())) continue; | |
11096 | phi1=aftsTrack->Phi(); | |
11097 | for(Int_t i2=0;i2<nPrim;i2++) | |
11098 | { | |
11099 | if(i2==i1)continue; | |
11100 | aftsTrack=anEvent->GetTrack(i2); | |
11101 | if(!(aftsTrack->InRPSelection())) continue; | |
11102 | phi2=aftsTrack->Phi(); | |
11103 | for(Int_t i3=0;i3<nPrim;i3++) | |
11104 | { | |
11105 | if(i3==i1||i3==i2)continue; | |
11106 | aftsTrack=anEvent->GetTrack(i3); | |
11107 | if(!(aftsTrack->InRPSelection())) continue; | |
11108 | phi3=aftsTrack->Phi(); | |
11109 | if(nPrim>=3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; // to be improved (eventually I will change this if statement) | |
11110 | // sin terms: | |
11111 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(2.5,sin(n*(phi1-phi2-phi3)),1.); // <<sin(n*(phi1-phi2-phi3))>> | |
11112 | // cos terms: | |
11113 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(2.5,cos(n*(phi1-phi2-phi3)),1.); // <<cos(n*(phi1-phi2-phi3))>> | |
11114 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11115 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11116 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11117 | } // end of if(nPrim>=3) | |
11118 | ||
11119 | cout<<endl; | |
11120 | } | |
11121 | //================================================================================================================================ | |
0328db2d | 11122 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 11123 | { |
11124 | // Evaluate reduced correlations with nested loops without using the particle weights. | |
11125 | ||
11126 | // Remark 1: Reduced correlations are evaluated in pt bin number fCrossCheckInPtBinNo and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
11127 | // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrelations[t][pe][ci], where indices runs as follows: | |
11128 | // [0=RP,1=POI][0=Pt,1=Eta][0=<2'>,1=<4'>,2=<6'>,3=<8'>] | |
11129 | // Remark 3: <2'> = <cos(n*(psi1-phi2))> | |
11130 | // <4'> = <cos(n*(psi1+phi2-phi3-phi4))> | |
11131 | // ... | |
11132 | ||
2a98ceb8 | 11133 | Int_t typeFlag = 0; |
11134 | Int_t ptEtaFlag = 0; | |
489d5531 | 11135 | if(type == "RP") |
11136 | { | |
11137 | typeFlag = 0; | |
11138 | } else if(type == "POI") | |
11139 | { | |
11140 | typeFlag = 1; | |
11141 | } | |
11142 | if(ptOrEta == "Pt") | |
11143 | { | |
11144 | ptEtaFlag = 0; | |
11145 | } else if(ptOrEta == "Eta") | |
11146 | { | |
11147 | ptEtaFlag = 1; | |
11148 | } | |
11149 | // shortcuts: | |
11150 | Int_t t = typeFlag; | |
11151 | Int_t pe = ptEtaFlag; | |
11152 | ||
11153 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
11154 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
11155 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
11156 | ||
11157 | Int_t nPrim = anEvent->NumberOfTracks(); | |
11158 | AliFlowTrackSimple *aftsTrack = NULL; | |
11159 | ||
11160 | Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
11161 | ||
3b552efe | 11162 | Int_t n = fHarmonic; |
489d5531 | 11163 | |
11164 | // 2'-particle correlations: | |
11165 | for(Int_t i1=0;i1<nPrim;i1++) | |
11166 | { | |
11167 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 11168 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
11169 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11170 | { |
11171 | if(ptOrEta == "Pt") | |
11172 | { | |
11173 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11174 | } else if (ptOrEta == "Eta") | |
11175 | { | |
11176 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11177 | } |
11178 | } else // this is diff flow of RPs | |
11179 | { | |
489d5531 | 11180 | if(ptOrEta == "Pt") |
11181 | { | |
11182 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11183 | } else if (ptOrEta == "Eta") | |
11184 | { | |
11185 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11186 | } |
11187 | } | |
489d5531 | 11188 | |
11189 | psi1=aftsTrack->Phi(); | |
11190 | for(Int_t i2=0;i2<nPrim;i2++) | |
11191 | { | |
11192 | if(i2==i1)continue; | |
11193 | aftsTrack=anEvent->GetTrack(i2); | |
11194 | // RP condition (!(first) particle in the correlator must be RP): | |
11195 | if(!(aftsTrack->InRPSelection()))continue; | |
11196 | phi2=aftsTrack->Phi(); | |
11197 | // 2'-particle correlations: | |
11198 | fDiffFlowDirectCorrelations[t][pe][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(1.*n*(psi1-phi2)),1.); // <cos(n*(psi1-phi2)) | |
11199 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
11200 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11201 | ||
11202 | /* | |
11203 | ||
11204 | // 3'-particle correlations: | |
11205 | for(Int_t i1=0;i1<nPrim;i1++) | |
11206 | { | |
11207 | aftsTrack=anEvent->GetTrack(i1); | |
11208 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
11209 | if(ptOrEta == "Pt") | |
11210 | { | |
11211 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11212 | } else if (ptOrEta == "Eta") | |
11213 | { | |
11214 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11215 | } | |
11216 | psi1=aftsTrack->Phi(); | |
11217 | for(Int_t i2=0;i2<nPrim;i2++) | |
11218 | { | |
11219 | if(i2==i1)continue; | |
11220 | aftsTrack=anEvent->GetTrack(i2); | |
11221 | // RP condition (!(first) particle in the correlator must be RP): | |
11222 | if(!(aftsTrack->InRPSelection())) continue; | |
11223 | phi2=aftsTrack->Phi(); | |
11224 | for(Int_t i3=0;i3<nPrim;i3++) | |
11225 | { | |
11226 | if(i3==i1||i3==i2)continue; | |
11227 | aftsTrack=anEvent->GetTrack(i3); | |
11228 | // RP condition (!(first) particle in the correlator must be RP): | |
11229 | if(!(aftsTrack->InRPSelection())) continue; | |
11230 | phi3=aftsTrack->Phi(); | |
11231 | // to be improved : where to store it? ->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(2.*phi1-phi2-phi3)),1.); // <w1 w2 w3 cos(n(2psi1-phi2-phi3))> | |
11232 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
11233 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
11234 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11235 | ||
11236 | */ | |
11237 | ||
11238 | // 4'-particle correlations: | |
11239 | for(Int_t i1=0;i1<nPrim;i1++) | |
11240 | { | |
11241 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 11242 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
11243 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11244 | { |
11245 | if(ptOrEta == "Pt") | |
11246 | { | |
11247 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11248 | } else if (ptOrEta == "Eta") | |
11249 | { | |
11250 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11251 | } |
11252 | } else // this is diff flow of RPs | |
11253 | { | |
489d5531 | 11254 | if(ptOrEta == "Pt") |
11255 | { | |
11256 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11257 | } else if (ptOrEta == "Eta") | |
11258 | { | |
11259 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11260 | } |
11261 | } | |
489d5531 | 11262 | |
11263 | psi1=aftsTrack->Phi(); | |
11264 | for(Int_t i2=0;i2<nPrim;i2++) | |
11265 | { | |
11266 | if(i2==i1) continue; | |
11267 | aftsTrack=anEvent->GetTrack(i2); | |
11268 | // RP condition (!(first) particle in the correlator must be RP): | |
11269 | if(!(aftsTrack->InRPSelection())) continue; | |
11270 | phi2=aftsTrack->Phi(); | |
11271 | for(Int_t i3=0;i3<nPrim;i3++) | |
11272 | { | |
11273 | if(i3==i1||i3==i2) continue; | |
11274 | aftsTrack=anEvent->GetTrack(i3); | |
11275 | // RP condition (!(first) particle in the correlator must be RP): | |
11276 | if(!(aftsTrack->InRPSelection())) continue; | |
11277 | phi3=aftsTrack->Phi(); | |
11278 | for(Int_t i4=0;i4<nPrim;i4++) | |
11279 | { | |
11280 | if(i4==i1||i4==i2||i4==i3) continue; | |
11281 | aftsTrack=anEvent->GetTrack(i4); | |
11282 | // RP condition (!(first) particle in the correlator must be RP): | |
11283 | if(!(aftsTrack->InRPSelection())) continue; | |
11284 | phi4=aftsTrack->Phi(); | |
11285 | // 4'-particle correlations: | |
11286 | fDiffFlowDirectCorrelations[t][pe][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3-phi4)),1.); // <cos(n(psi1+phi2-phi3-phi4))> | |
11287 | }//end of for(Int_t i4=0;i4<nPrim;i4++) | |
11288 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
11289 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
11290 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11291 | ||
11292 | // count # of RPs and POIs in selected pt and eta bins for cross-checkings: | |
3b552efe | 11293 | for(Int_t i=0;i<nPrim;i++) |
11294 | { | |
11295 | aftsTrack=anEvent->GetTrack(i); | |
11296 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
11297 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11298 | { |
11299 | if(ptOrEta == "Pt") | |
11300 | { | |
11301 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11302 | } else if (ptOrEta == "Eta") | |
11303 | { | |
11304 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11305 | } |
11306 | } else // this is diff flow of RPs | |
11307 | { | |
489d5531 | 11308 | if(ptOrEta == "Pt") |
11309 | { | |
11310 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11311 | } else if (ptOrEta == "Eta") | |
11312 | { | |
11313 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11314 | } |
11315 | } | |
11316 | if(t==1)t++; | |
11317 | fNoOfParticlesInBin->Fill(t+pe+0.5); | |
489d5531 | 11318 | } |
11319 | ||
11320 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
11321 | ||
11322 | ||
11323 | //================================================================================================================================ | |
11324 | ||
11325 | ||
11326 | void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrelations(TString type, TString ptOrEta) | |
11327 | { | |
11328 | // Compare correlations needed for diff. flow calculated with nested loops and those calculated from Q-vectors | |
11329 | ||
2a98ceb8 | 11330 | Int_t typeFlag = 0; |
11331 | Int_t ptEtaFlag = 0; | |
489d5531 | 11332 | if(type == "RP") |
11333 | { | |
11334 | typeFlag = 0; | |
11335 | } else if(type == "POI") | |
11336 | { | |
11337 | typeFlag = 1; | |
11338 | } | |
11339 | if(ptOrEta == "Pt") | |
11340 | { | |
11341 | ptEtaFlag = 0; | |
11342 | } else if(ptOrEta == "Eta") | |
11343 | { | |
11344 | ptEtaFlag = 1; | |
11345 | } | |
11346 | // shortcuts: | |
11347 | Int_t t = typeFlag; | |
11348 | Int_t pe = ptEtaFlag; | |
11349 | ||
11350 | TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
11351 | TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
11352 | TString reducedCorrelations[4] = {"<<cos(n(psi1-phi2))>>","<<cos(n(psi1+phi2-phi3-phi4))>>","",""}; // to be improved (access this from pro or hist) | |
11353 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
11354 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
11355 | ||
11356 | Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo}; | |
11357 | ||
11358 | ||
11359 | cout<<endl; | |
11360 | cout<<" *****************************************"<<endl; | |
11361 | cout<<" **** cross-checking the correlations ****"<<endl; | |
11362 | cout<<" **** for differential flow ("<<rpORpoiString[t]<<") ****"<<endl; | |
11363 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
11364 | { | |
11365 | cout<<" **** (particle weights not used) ****"<<endl; | |
11366 | } else | |
11367 | { | |
11368 | cout<<" **** (particle weights used) ****"<<endl; | |
11369 | } | |
11370 | cout<<" *****************************************"<<endl; | |
11371 | cout<<endl; | |
11372 | cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl; | |
11373 | cout<<endl; | |
11374 | ||
11375 | for(Int_t rci=0;rci<2;rci++) // to be improved (calculate 6th and 8th order) | |
11376 | { | |
11377 | cout<<" "<<reducedCorrelations[rci].Data()<<":"<<endl; | |
11378 | cout<<" from Q-vectors = "<<fDiffFlowCorrelationsPro[t][pe][rci]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl; | |
11379 | cout<<" from nested loops = "<<fDiffFlowDirectCorrelations[t][pe][rci]->GetBinContent(1)<<endl; | |
11380 | cout<<endl; | |
11381 | } // end of for(Int_t rci=0;rci<4;rci++) | |
11382 | ||
11383 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrelations(TString type, TString ptOrEta) | |
11384 | ||
3b552efe | 11385 | //================================================================================================================================ |
11386 | ||
489d5531 | 11387 | void AliFlowAnalysisWithQCumulants::PrintNumberOfParticlesInSelectedBin() |
3b552efe | 11388 | { |
11389 | // Print on the screen number of RPs and POIs in selected pt and eta bin for cross checkings. | |
11390 | ||
11391 | cout<<endl; | |
11392 | cout<<"Number of RPs in selected pt bin = "<<fNoOfParticlesInBin->GetBinContent(1)<<endl; | |
11393 | cout<<"Number of RPs in selected eta bin = "<<fNoOfParticlesInBin->GetBinContent(2)<<endl; | |
11394 | cout<<"Number of POIs in selected pt bin = "<<fNoOfParticlesInBin->GetBinContent(3)<<endl; | |
11395 | cout<<"Number of POIs in selected eta bin = "<<fNoOfParticlesInBin->GetBinContent(4)<<endl; | |
11396 | ||
489d5531 | 11397 | } // end of void AliFlowAnalysisWithQCumulants::PrintNumberOfParticlesInSelectedBin() |
11398 | ||
3b552efe | 11399 | //================================================================================================================================ |
11400 | ||
0328db2d | 11401 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 11402 | { |
11403 | // Evaluate reduced correlations with nested loops without using the particle weights. | |
11404 | ||
11405 | // Remark 1: Reduced correlations are evaluated in pt bin number fCrossCheckInPtBinNo and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
11406 | // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrelations[t][pe][ci], where indices runs as follows: | |
11407 | // [0=RP,1=POI][0=Pt,1=Eta][0=<2'>,1=<4'>,2=<6'>,3=<8'>] | |
11408 | // Remark 3: <2'> = <w2 cos(n*(psi1-phi2))> | |
11409 | // <4'> = <w2 w3 w4 cos(n*(psi1+phi2-phi3-phi4))> | |
11410 | // ... | |
11411 | ||
2a98ceb8 | 11412 | Int_t typeFlag = 0; |
11413 | Int_t ptEtaFlag = 0; | |
489d5531 | 11414 | if(type == "RP") |
11415 | { | |
11416 | typeFlag = 0; | |
11417 | } else if(type == "POI") | |
11418 | { | |
11419 | typeFlag = 1; | |
11420 | } | |
11421 | if(ptOrEta == "Pt") | |
11422 | { | |
11423 | ptEtaFlag = 0; | |
11424 | } else if(ptOrEta == "Eta") | |
11425 | { | |
11426 | ptEtaFlag = 1; | |
11427 | } | |
11428 | // shortcuts: | |
11429 | Int_t t = typeFlag; | |
11430 | Int_t pe = ptEtaFlag; | |
11431 | ||
11432 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
11433 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
11434 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
11435 | ||
11436 | Int_t nPrim = anEvent->NumberOfTracks(); | |
11437 | AliFlowTrackSimple *aftsTrack = NULL; | |
11438 | ||
11439 | Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
11440 | Double_t wPhi2=1., wPhi3=1., wPhi4=1.;// wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
11441 | ||
11442 | Int_t n = fHarmonic; | |
11443 | ||
11444 | // 2'-particle correlations: | |
11445 | for(Int_t i1=0;i1<nPrim;i1++) | |
11446 | { | |
11447 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 11448 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
11449 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11450 | { |
11451 | if(ptOrEta == "Pt") | |
11452 | { | |
11453 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11454 | } else if (ptOrEta == "Eta") | |
11455 | { | |
11456 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11457 | } |
11458 | } else // this is diff flow of RPs | |
11459 | { | |
489d5531 | 11460 | if(ptOrEta == "Pt") |
11461 | { | |
11462 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11463 | } else if (ptOrEta == "Eta") | |
11464 | { | |
11465 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11466 | } |
489d5531 | 11467 | } |
11468 | psi1=aftsTrack->Phi(); | |
11469 | for(Int_t i2=0;i2<nPrim;i2++) | |
11470 | { | |
11471 | if(i2==i1) continue; | |
11472 | aftsTrack=anEvent->GetTrack(i2); | |
11473 | // RP condition (!(first) particle in the correlator must be RP): | |
11474 | if(!(aftsTrack->InRPSelection())) continue; | |
11475 | phi2=aftsTrack->Phi(); | |
11476 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
11477 | // 2'-particle correlations: | |
11478 | fDiffFlowDirectCorrelations[t][pe][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(1.*n*(psi1-phi2)),wPhi2); // <w2 cos(n*(psi1-phi2)) | |
11479 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
11480 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11481 | ||
11482 | // 4'-particle correlations: | |
11483 | for(Int_t i1=0;i1<nPrim;i1++) | |
11484 | { | |
11485 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 11486 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
11487 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11488 | { |
11489 | if(ptOrEta == "Pt") | |
11490 | { | |
11491 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11492 | } else if (ptOrEta == "Eta") | |
11493 | { | |
11494 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11495 | } |
11496 | } else // this is diff flow of RPs | |
11497 | { | |
489d5531 | 11498 | if(ptOrEta == "Pt") |
11499 | { | |
11500 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11501 | } else if (ptOrEta == "Eta") | |
11502 | { | |
11503 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11504 | } |
489d5531 | 11505 | } |
11506 | psi1=aftsTrack->Phi(); | |
11507 | for(Int_t i2=0;i2<nPrim;i2++) | |
11508 | { | |
11509 | if(i2==i1) continue; | |
11510 | aftsTrack=anEvent->GetTrack(i2); | |
11511 | // RP condition (!(first) particle in the correlator must be RP): | |
11512 | if(!(aftsTrack->InRPSelection())) continue; | |
11513 | phi2=aftsTrack->Phi(); | |
11514 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
11515 | for(Int_t i3=0;i3<nPrim;i3++) | |
11516 | { | |
11517 | if(i3==i1||i3==i2) continue; | |
11518 | aftsTrack=anEvent->GetTrack(i3); | |
11519 | // RP condition (!(first) particle in the correlator must be RP): | |
11520 | if(!(aftsTrack->InRPSelection())) continue; | |
11521 | phi3=aftsTrack->Phi(); | |
11522 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
11523 | for(Int_t i4=0;i4<nPrim;i4++) | |
11524 | { | |
11525 | if(i4==i1||i4==i2||i4==i3) continue; | |
11526 | aftsTrack=anEvent->GetTrack(i4); | |
11527 | // RP condition (!(first) particle in the correlator must be RP): | |
11528 | if(!(aftsTrack->InRPSelection())) continue; | |
11529 | phi4=aftsTrack->Phi(); | |
11530 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); | |
11531 | // 4'-particle correlations <w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))>: | |
11532 | fDiffFlowDirectCorrelations[t][pe][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3-phi4)),wPhi2*wPhi3*wPhi4); | |
11533 | }//end of for(Int_t i4=0;i4<nPrim;i4++) | |
11534 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
11535 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
11536 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11537 | ||
11538 | // count # of RPs and POIs in selected pt and eta bins for cross-checkings: (to be improved - moved to dedicated method) | |
3b552efe | 11539 | for(Int_t i=0;i<nPrim;i++) |
11540 | { | |
489d5531 | 11541 | aftsTrack=anEvent->GetTrack(i); |
11542 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
11543 | if(typeFlag==1) // this is diff flow of POIs | |
11544 | { | |
11545 | if(ptOrEta == "Pt") | |
11546 | { | |
11547 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11548 | } else if (ptOrEta == "Eta") | |
11549 | { | |
11550 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11551 | } | |
11552 | } else // this is diff flow of RPs | |
11553 | { | |
11554 | if(ptOrEta == "Pt") | |
11555 | { | |
11556 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11557 | } else if (ptOrEta == "Eta") | |
11558 | { | |
11559 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11560 | } | |
11561 | } | |
11562 | if(t==1)t++; | |
11563 | fNoOfParticlesInBin->Fill(t+pe+0.5); | |
11564 | } | |
11565 | ||
11566 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
11567 | ||
11568 | ||
11569 | //================================================================================================================================ | |
11570 | ||
11571 | ||
0328db2d | 11572 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 11573 | { |
11574 | // Evaluate with nested loops correction terms for non-uniform acceptance (both sin and cos terms) relevant for differential flow. | |
11575 | ||
11576 | // Remark 1: Reduced correction terms for non-uniform acceptance are evaluated in pt bin number fCrossCheckInPtBinNo | |
11577 | // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
11578 | // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrections[t][pe][sc][cti], where first three indices runs as: | |
11579 | // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms], whilst the cti (correction term index) runs as follows: | |
11580 | // cti: | |
11581 | // 0: <<sc n(psi1)>> | |
11582 | // 1: <<sc n(psi1+phi2)>> | |
11583 | // 2: <<sc n(psi1+phi2-phi3)>> | |
11584 | // 3: <<sc n(psi1-phi2-phi3)>> | |
11585 | // 4: | |
11586 | // 5: | |
11587 | // 6: | |
11588 | ||
2a98ceb8 | 11589 | Int_t typeFlag = 0; |
11590 | Int_t ptEtaFlag = 0; | |
489d5531 | 11591 | if(type == "RP") |
11592 | { | |
11593 | typeFlag = 0; | |
11594 | } else if(type == "POI") | |
11595 | { | |
11596 | typeFlag = 1; | |
11597 | } | |
11598 | if(ptOrEta == "Pt") | |
11599 | { | |
11600 | ptEtaFlag = 0; | |
11601 | } else if(ptOrEta == "Eta") | |
11602 | { | |
11603 | ptEtaFlag = 1; | |
11604 | } | |
11605 | // shortcuts: | |
11606 | Int_t t = typeFlag; | |
11607 | Int_t pe = ptEtaFlag; | |
11608 | ||
11609 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
11610 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
11611 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
11612 | ||
11613 | Int_t nPrim = anEvent->NumberOfTracks(); | |
11614 | AliFlowTrackSimple *aftsTrack = NULL; | |
11615 | ||
11616 | Double_t psi1=0., phi2=0., phi3=0.;// phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
11617 | ||
11618 | Int_t n = fHarmonic; | |
11619 | ||
11620 | // 1-particle correction terms: | |
11621 | for(Int_t i1=0;i1<nPrim;i1++) | |
11622 | { | |
11623 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 11624 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
11625 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11626 | { |
11627 | if(ptOrEta == "Pt") | |
11628 | { | |
11629 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11630 | } else if (ptOrEta == "Eta") | |
11631 | { | |
11632 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11633 | } |
11634 | } else // this is diff flow of RPs | |
11635 | { | |
489d5531 | 11636 | if(ptOrEta == "Pt") |
11637 | { | |
11638 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11639 | } else if (ptOrEta == "Eta") | |
11640 | { | |
11641 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11642 | } |
11643 | } | |
489d5531 | 11644 | psi1=aftsTrack->Phi(); |
11645 | // sin terms: | |
11646 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*psi1),1.); // <<sin(n*(psi1))>> | |
11647 | // cos terms: | |
11648 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*psi1),1.); // <<cos(n*(psi1))>> | |
11649 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11650 | ||
11651 | // 2-particle correction terms: | |
11652 | for(Int_t i1=0;i1<nPrim;i1++) | |
11653 | { | |
11654 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 11655 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
11656 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11657 | { |
11658 | if(ptOrEta == "Pt") | |
11659 | { | |
11660 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11661 | } else if (ptOrEta == "Eta") | |
11662 | { | |
11663 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11664 | } |
11665 | } else // this is diff flow of RPs | |
11666 | { | |
489d5531 | 11667 | if(ptOrEta == "Pt") |
11668 | { | |
11669 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11670 | } else if (ptOrEta == "Eta") | |
11671 | { | |
11672 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11673 | } |
489d5531 | 11674 | } |
11675 | psi1=aftsTrack->Phi(); | |
11676 | for(Int_t i2=0;i2<nPrim;i2++) | |
11677 | { | |
11678 | if(i2==i1) continue; | |
11679 | aftsTrack=anEvent->GetTrack(i2); | |
11680 | // RP condition (!(first) particle in the correlator must be RP): | |
11681 | if(!(aftsTrack->InRPSelection())) continue; | |
11682 | phi2=aftsTrack->Phi(); | |
11683 | // sin terms: | |
11684 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2)),1.); // <<sin(n*(psi1+phi2))>> | |
11685 | // cos terms: | |
11686 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2)),1.); // <<cos(n*(psi1+phi2))>> | |
11687 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
11688 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11689 | ||
11690 | // 3-particle correction terms: | |
11691 | for(Int_t i1=0;i1<nPrim;i1++) | |
11692 | { | |
11693 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 11694 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
11695 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11696 | { |
11697 | if(ptOrEta == "Pt") | |
11698 | { | |
11699 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11700 | } else if (ptOrEta == "Eta") | |
11701 | { | |
11702 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11703 | } |
11704 | } else // this is diff flow of RPs | |
11705 | { | |
489d5531 | 11706 | if(ptOrEta == "Pt") |
11707 | { | |
11708 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11709 | } else if (ptOrEta == "Eta") | |
11710 | { | |
11711 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11712 | } |
489d5531 | 11713 | } |
11714 | psi1=aftsTrack->Phi(); | |
11715 | for(Int_t i2=0;i2<nPrim;i2++) | |
11716 | { | |
11717 | if(i2==i1) continue; | |
11718 | aftsTrack=anEvent->GetTrack(i2); | |
11719 | // RP condition (!(first) particle in the correlator must be RP): | |
11720 | if(!(aftsTrack->InRPSelection())) continue; | |
11721 | phi2=aftsTrack->Phi(); | |
11722 | for(Int_t i3=0;i3<nPrim;i3++) | |
11723 | { | |
11724 | if(i3==i1||i3==i2) continue; | |
11725 | aftsTrack=anEvent->GetTrack(i3); | |
11726 | // RP condition (!(first) particle in the correlator must be RP): | |
11727 | if(!(aftsTrack->InRPSelection())) continue; | |
11728 | phi3=aftsTrack->Phi(); | |
11729 | // sin terms: | |
11730 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2-phi3)),1.); // <<sin(n*(psi1+phi2-phi3))>> | |
11731 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1-phi2-phi3)),1.); // <<sin(n*(psi1-phi2-phi3))>> | |
11732 | // cos terms: | |
11733 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3)),1.); // <<cos(n*(psi1+phi2-phi3))>> | |
11734 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-phi2-phi3)),1.); // <<cos(n*(psi1-phi2-phi3))>> | |
11735 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
11736 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
11737 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11738 | ||
11739 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
11740 | ||
11741 | ||
11742 | //================================================================================================================================ | |
11743 | ||
11744 | ||
11745 | void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrectionTermsForNUA(TString type, TString ptOrEta) | |
11746 | { | |
11747 | // Compare corrections temrs for non-uniform acceptance needed for diff. flow calculated with nested loops and those calculated from Q-vectors | |
11748 | ||
2a98ceb8 | 11749 | Int_t typeFlag = 0; |
11750 | Int_t ptEtaFlag = 0; | |
489d5531 | 11751 | if(type == "RP") |
11752 | { | |
11753 | typeFlag = 0; | |
11754 | } else if(type == "POI") | |
11755 | { | |
11756 | typeFlag = 1; | |
11757 | } | |
11758 | if(ptOrEta == "Pt") | |
11759 | { | |
11760 | ptEtaFlag = 0; | |
11761 | } else if(ptOrEta == "Eta") | |
11762 | { | |
11763 | ptEtaFlag = 1; | |
11764 | } | |
11765 | // shortcuts: | |
11766 | Int_t t = typeFlag; | |
11767 | Int_t pe = ptEtaFlag; | |
11768 | ||
11769 | TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
11770 | TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
11771 | //TString sinCosFlag[2] = {"sin","cos"}; // to be improved (eventually promote to data member) | |
11772 | TString reducedCorrectionSinTerms[4] = {"<<sin(n(psi1))>>","<<sin(n(psi1+phi2))>>","<<sin(n*(psi1+phi2-phi3))>>","<<sin(n*(psi1-phi2-phi3))>>"}; // to be improved (access this from pro or hist) | |
11773 | TString reducedCorrectionCosTerms[4] = {"<<cos(n(psi1))>>","<<cos(n(psi1+phi2))>>","<<cos(n*(psi1+phi2-phi3))>>","<<cos(n*(psi1-phi2-phi3))>>"}; // to be improved (access this from pro or hist) | |
11774 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
11775 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
11776 | ||
11777 | Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo}; | |
11778 | ||
11779 | cout<<endl; | |
11780 | cout<<" ******************************************"<<endl; | |
11781 | cout<<" **** cross-checking the correction ****"<<endl; | |
46b94261 | 11782 | cout<<" **** terms for non-uniform acceptance ****"<<endl; |
489d5531 | 11783 | cout<<" **** for differential flow ("<<rpORpoiString[t]<<") ****"<<endl; |
11784 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
11785 | { | |
11786 | cout<<" **** (particle weights not used) ****"<<endl; | |
11787 | } else | |
11788 | { | |
11789 | cout<<" **** (particle weights used) ****"<<endl; | |
11790 | } | |
11791 | cout<<" ******************************************"<<endl; | |
11792 | cout<<endl; | |
11793 | cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl; | |
11794 | cout<<endl; | |
11795 | ||
11796 | for(Int_t cti=0;cti<4;cti++) // correction term index | |
11797 | { | |
11798 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
11799 | { | |
11800 | if(sc==0) // to be improved (this can be implemented better) | |
11801 | { | |
11802 | cout<<" "<<reducedCorrectionSinTerms[cti].Data()<<":"<<endl; | |
11803 | } else | |
11804 | { | |
11805 | cout<<" "<<reducedCorrectionCosTerms[cti].Data()<<":"<<endl; | |
11806 | } | |
11807 | cout<<" from Q-vectors = "<<fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl; | |
11808 | cout<<" from nested loops = "<<fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]->GetBinContent(1)<<endl; | |
11809 | cout<<endl; | |
11810 | } | |
11811 | } // end of for(Int_t rci=0;rci<4;rci++) | |
11812 | ||
11813 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrectionTermsForNUA(TString type, TString ptOrEta) | |
11814 | ||
11815 | ||
57340a27 | 11816 | //================================================================================================================================ |
11817 | ||
489d5531 | 11818 | |
11819 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights() | |
11820 | { | |
11821 | // Calculate corrections using particle weights for non-uniform acceptance of the detector for no-name integrated flow (cos terms). | |
11822 | ||
11823 | // ********************************************************************** | |
11824 | // **** weighted corrections for non-uniform acceptance (cos terms): **** | |
11825 | // ********************************************************************** | |
57340a27 | 11826 | |
489d5531 | 11827 | // Remark 1: When particle weights are used the binning of fIntFlowCorrectionTermsForNUAPro[1] is organized as follows: |
57340a27 | 11828 | // |
489d5531 | 11829 | // 1st bin: <<w1 cos(n*(phi1))>> = cosP1nW1 |
11830 | // 2nd bin: <<w1 w2 cos(n*(phi1+phi2))>> = cosP1nP1nW1W1 | |
11831 | // 3rd bin: <<w1 w2 w3 cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1nW1W1W1 | |
11832 | // ... | |
11833 | ||
11834 | // multiplicity (number of particles used to determine the reaction plane) | |
1268c371 | 11835 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 11836 | |
11837 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
11838 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
11839 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
11840 | //Double_t dReQ3n3k = (*fReQ)(2,3); | |
11841 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
11842 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
11843 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
11844 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
11845 | //Double_t dImQ3n3k = (*fImQ)(2,3); | |
11846 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
11847 | //Double_t dImQ1n3k = (*fImQ)(0,3); | |
11848 | ||
11849 | // dMs are variables introduced in order to simplify some Eqs. bellow: | |
11850 | //.............................................................................................. | |
1268c371 | 11851 | Double_t dM11 = (*fSpk)(1,1)-(*fSpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
11852 | Double_t dM111 = (*fSpk)(2,1)-3.*(*fSpk)(0,2)*(*fSpk)(0,1) | |
11853 | + 2.*(*fSpk)(0,3); // dM111 = sum_{i,j,k=1,i!=j!=k}^M w_i w_j w_k | |
489d5531 | 11854 | //.............................................................................................. |
ecac11c2 | 11855 | // 1-particle: |
489d5531 | 11856 | Double_t cosP1nW1 = 0.; // <<w1 cos(n*(phi1))>> |
11857 | ||
1268c371 | 11858 | if(dMult>0 && TMath::Abs((*fSpk)(0,1))>1.e-6) |
489d5531 | 11859 | { |
1268c371 | 11860 | cosP1nW1 = dReQ1n1k/(*fSpk)(0,1); |
489d5531 | 11861 | |
11862 | // average weighted 1-particle correction (cos terms) for non-uniform acceptance for single event: | |
11863 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(1,cosP1nW1); | |
11864 | ||
11865 | // final average weighted 1-particle correction (cos terms) for non-uniform acceptance for all events: | |
1268c371 | 11866 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(0.5,cosP1nW1,(*fSpk)(0,1)); |
489d5531 | 11867 | } |
11868 | ||
11869 | // 2-particle: | |
11870 | Double_t cosP1nP1nW1W1 = 0.; // <<w1 w2 cos(n*(phi1+phi2))>> | |
11871 | ||
1268c371 | 11872 | if(dMult>1 && TMath::Abs(dM11)>1.e-6) |
489d5531 | 11873 | { |
11874 | cosP1nP1nW1W1 = (pow(dReQ1n1k,2)-pow(dImQ1n1k,2)-dReQ2n2k)/dM11; | |
11875 | ||
11876 | // average weighted 2-particle correction (cos terms) for non-uniform acceptance for single event: | |
11877 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(2,cosP1nP1nW1W1); | |
11878 | ||
11879 | // final average weighted 2-particle correction (cos terms) for non-uniform acceptance for all events: | |
11880 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(1.5,cosP1nP1nW1W1,dM11); | |
11881 | } | |
11882 | ||
11883 | // 3-particle: | |
11884 | Double_t cosP1nM1nM1nW1W1W1 = 0.; // <<w1 w2 w3 cos(n*(phi1-phi2-phi3))>> | |
11885 | ||
1268c371 | 11886 | if(dMult>2 && TMath::Abs(dM111)>1.e-6) |
489d5531 | 11887 | { |
57340a27 | 11888 | cosP1nM1nM1nW1W1W1 = (dReQ1n1k*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
11889 | - dReQ1n1k*dReQ2n2k-dImQ1n1k*dImQ2n2k | |
1268c371 | 11890 | - 2.*((*fSpk)(0,2))*dReQ1n1k |
489d5531 | 11891 | + 2.*dReQ1n3k) |
11892 | / dM111; | |
11893 | ||
11894 | // average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for single event: | |
11895 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(3,cosP1nM1nM1nW1W1W1); | |
11896 | ||
11897 | // final average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for all events: | |
11898 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(2.5,cosP1nM1nM1nW1W1W1,dM111); | |
11899 | } | |
11900 | ||
11901 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights() | |
11902 | ||
11903 | ||
11904 | //================================================================================================================================ | |
11905 | ||
11906 | ||
11907 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights() | |
11908 | { | |
11909 | // calculate corrections using particle weights for non-uniform acceptance of the detector for no-name integrated flow (sin terms) | |
11910 | ||
11911 | // ********************************************************************** | |
11912 | // **** weighted corrections for non-uniform acceptance (sin terms): **** | |
11913 | // ********************************************************************** | |
11914 | ||
11915 | // Remark 1: When particle weights are used the binning of fIntFlowCorrectionTermsForNUAPro[0] is organized as follows: | |
57340a27 | 11916 | // |
489d5531 | 11917 | // 1st bin: <<w1 sin(n*(phi1))>> = sinP1nW1 |
11918 | // 2nd bin: <<w1 w2 sin(n*(phi1+phi2))>> = sinP1nP1nW1W1 | |
11919 | // 3rd bin: <<w1 w2 w3 sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1nW1W1W1 | |
11920 | // ... | |
11921 | ||
11922 | // multiplicity (number of particles used to determine the reaction plane) | |
1268c371 | 11923 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 11924 | |
11925 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
11926 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
11927 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
11928 | //Double_t dReQ3n3k = (*fReQ)(2,3); | |
11929 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
11930 | //Double_t dReQ1n3k = (*fReQ)(0,3); | |
11931 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
11932 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
11933 | //Double_t dImQ3n3k = (*fImQ)(2,3); | |
11934 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
11935 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
11936 | ||
11937 | // dMs are variables introduced in order to simplify some Eqs. bellow: | |
11938 | //.............................................................................................. | |
1268c371 | 11939 | Double_t dM11 = (*fSpk)(1,1)-(*fSpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
11940 | Double_t dM111 = (*fSpk)(2,1)-3.*(*fSpk)(0,2)*(*fSpk)(0,1) | |
11941 | + 2.*(*fSpk)(0,3); // dM111 = sum_{i,j,k=1,i!=j!=k}^M w_i w_j w_k | |
489d5531 | 11942 | //.............................................................................................. |
11943 | ||
11944 | // 1-particle: | |
11945 | Double_t sinP1nW1 = 0.; // <<w1 sin(n*(phi1))>> | |
11946 | ||
1268c371 | 11947 | if(dMult>0 && TMath::Abs((*fSpk)(0,1))>1.e-6) |
489d5531 | 11948 | { |
1268c371 | 11949 | sinP1nW1 = dImQ1n1k/((*fSpk)(0,1)); |
489d5531 | 11950 | |
11951 | // average weighted 1-particle correction (sin terms) for non-uniform acceptance for single event: | |
11952 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(1,sinP1nW1); | |
11953 | ||
11954 | // final average weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
1268c371 | 11955 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(0.5,sinP1nW1,(*fSpk)(0,1)); |
489d5531 | 11956 | } |
11957 | ||
11958 | // 2-particle: | |
11959 | Double_t sinP1nP1nW1W1 = 0.; // <<w1 w2 sin(n*(phi1+phi2))>> | |
11960 | ||
1268c371 | 11961 | if(dMult>1 && TMath::Abs(dM11)>1.e-6) |
489d5531 | 11962 | { |
11963 | sinP1nP1nW1W1 = (2.*dReQ1n1k*dImQ1n1k-dImQ2n2k)/dM11; | |
11964 | ||
11965 | // average weighted 2-particle correction (sin terms) for non-uniform acceptance for single event: | |
11966 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(2,sinP1nP1nW1W1); | |
11967 | ||
11968 | // final average weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
11969 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(1.5,sinP1nP1nW1W1,dM11); | |
11970 | } | |
11971 | ||
11972 | // 3-particle: | |
11973 | Double_t sinP1nM1nM1nW1W1W1 = 0.; // <<w1 w2 w3 sin(n*(phi1-phi2-phi3))>> | |
11974 | ||
1268c371 | 11975 | if(dMult>2 && TMath::Abs(dM111)>1.e-6) |
489d5531 | 11976 | { |
57340a27 | 11977 | sinP1nM1nM1nW1W1W1 = (-dImQ1n1k*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
11978 | + dReQ1n1k*dImQ2n2k-dImQ1n1k*dReQ2n2k | |
1268c371 | 11979 | + 2.*((*fSpk)(0,2))*dImQ1n1k |
489d5531 | 11980 | - 2.*dImQ1n3k) |
11981 | / dM111; | |
11982 | ||
11983 | // average weighted 3-particle correction (sin terms) for non-uniform acceptance for single event: | |
11984 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(3,sinP1nM1nM1nW1W1W1); | |
11985 | ||
11986 | // final average weighted 3-particle correction (sin terms) for non-uniform acceptance for all events: | |
11987 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(2.5,sinP1nM1nM1nW1W1W1,dM111); | |
11988 | } | |
11989 | ||
11990 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights() | |
11991 | ||
57340a27 | 11992 | //================================================================================================================================ |
489d5531 | 11993 | |
0328db2d | 11994 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent) |
489d5531 | 11995 | { |
11996 | // Evaluate with nested loops correction terms for non-uniform acceptance for integrated flow (using the particle weights). | |
11997 | ||
57340a27 | 11998 | // Results are stored in profiles fIntFlowDirectCorrectionTermsForNUA[0] (sin terms) and |
11999 | // fIntFlowDirectCorrectionTermsForNUA[1] (cos terms). | |
489d5531 | 12000 | |
57340a27 | 12001 | // Remark 1: When particle weights are used the binning of fIntFlowDirectCorrectionTermsForNUA[sc] is |
489d5531 | 12002 | // organized as follows (sc stands for either sin or cos): |
12003 | // | |
12004 | // 1st bin: <<w1 sc(n*(phi1))>> = scP1nW1 | |
12005 | // 2nd bin: <<w1 w2 sc(n*(phi1+phi2))>> = scP1nP1nW1W1 | |
12006 | // 3rd bin: <<w1 w2 w3 sc(n*(phi1-phi2-phi3))>> = scP1nM1nM1nW1W1W1 | |
3b552efe | 12007 | // ... |
489d5531 | 12008 | |
12009 | Int_t nPrim = anEvent->NumberOfTracks(); | |
12010 | AliFlowTrackSimple *aftsTrack = NULL; | |
12011 | //Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; | |
12012 | //Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
12013 | Double_t phi1=0., phi2=0., phi3=0.; | |
12014 | Double_t wPhi1=1., wPhi2=1., wPhi3=1.; | |
12015 | Int_t n = fHarmonic; | |
12016 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 12017 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 12018 | cout<<endl; |
12019 | cout<<"Correction terms for non-uniform acceptance: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
12020 | if(dMult<1) | |
12021 | { | |
12022 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
12023 | } else if (dMult>fMaxAllowedMultiplicity) | |
12024 | { | |
12025 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
12026 | } else | |
12027 | { | |
12028 | cout<<"... evaluating nested loops (using particle weights) ..."<<endl; | |
12029 | } | |
12030 | ||
12031 | // 1-particle correction terms using particle weights: | |
12032 | if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity) | |
12033 | { | |
12034 | for(Int_t i1=0;i1<nPrim;i1++) | |
12035 | { | |
12036 | aftsTrack=anEvent->GetTrack(i1); | |
12037 | if(!(aftsTrack->InRPSelection())) continue; | |
12038 | phi1=aftsTrack->Phi(); | |
12039 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
57340a27 | 12040 | // 1-particle correction terms using particle weights: |
489d5531 | 12041 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(0.5,sin(n*phi1),wPhi1); // <w1 sin(n*phi1)> |
12042 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(0.5,cos(n*phi1),wPhi1); // <w1 cos(n*phi1)> | |
57340a27 | 12043 | } // end of for(Int_t i1=0;i1<nPrim;i1++) |
12044 | } // end of if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity) | |
12045 | ||
489d5531 | 12046 | // 2-particle correction terms using particle weights: |
12047 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
12048 | { | |
12049 | for(Int_t i1=0;i1<nPrim;i1++) | |
12050 | { | |
12051 | aftsTrack=anEvent->GetTrack(i1); | |
12052 | if(!(aftsTrack->InRPSelection())) continue; | |
12053 | phi1=aftsTrack->Phi(); | |
12054 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
12055 | for(Int_t i2=0;i2<nPrim;i2++) | |
12056 | { | |
12057 | if(i2==i1)continue; | |
12058 | aftsTrack=anEvent->GetTrack(i2); | |
12059 | if(!(aftsTrack->InRPSelection())) continue; | |
12060 | phi2=aftsTrack->Phi(); | |
12061 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
12062 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
57340a27 | 12063 | // 2-p correction terms using particle weights: |
489d5531 | 12064 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(1.5,sin(n*(phi1+phi2)),wPhi1*wPhi2); // <w1 w2 sin(n*(phi1+phi2))> |
12065 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(1.5,cos(n*(phi1+phi2)),wPhi1*wPhi2); // <w1 w2 cos(n*(phi1+phi2))> | |
12066 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
12067 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
12068 | } // end of if(nPrim>=2) | |
12069 | ||
12070 | // 3-particle correction terms using particle weights: | |
12071 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
12072 | { | |
12073 | for(Int_t i1=0;i1<nPrim;i1++) | |
12074 | { | |
12075 | aftsTrack=anEvent->GetTrack(i1); | |
12076 | if(!(aftsTrack->InRPSelection())) continue; | |
12077 | phi1=aftsTrack->Phi(); | |
12078 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
12079 | for(Int_t i2=0;i2<nPrim;i2++) | |
12080 | { | |
12081 | if(i2==i1)continue; | |
12082 | aftsTrack=anEvent->GetTrack(i2); | |
12083 | if(!(aftsTrack->InRPSelection())) continue; | |
12084 | phi2=aftsTrack->Phi(); | |
12085 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
12086 | for(Int_t i3=0;i3<nPrim;i3++) | |
12087 | { | |
12088 | if(i3==i1||i3==i2)continue; | |
12089 | aftsTrack=anEvent->GetTrack(i3); | |
12090 | if(!(aftsTrack->InRPSelection())) continue; | |
12091 | phi3=aftsTrack->Phi(); | |
12092 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
12093 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
57340a27 | 12094 | // 3-p correction terms using particle weights: |
489d5531 | 12095 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(2.5,sin(n*(phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 sin(n*(phi1-phi2-phi3))> |
12096 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(2.5,cos(n*(phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 cos(n*(phi1-phi2-phi3))> | |
12097 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
12098 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
12099 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
12100 | } // end of if(nPrim>=3) | |
12101 | ||
57340a27 | 12102 | /* |
12103 | ||
489d5531 | 12104 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) |
12105 | { | |
12106 | // 4 nested loops multiparticle correlations using particle weights: | |
12107 | for(Int_t i1=0;i1<nPrim;i1++) | |
12108 | { | |
12109 | aftsTrack=anEvent->GetTrack(i1); | |
12110 | if(!(aftsTrack->InRPSelection())) continue; | |
12111 | phi1=aftsTrack->Phi(); | |
12112 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
12113 | for(Int_t i2=0;i2<nPrim;i2++) | |
12114 | { | |
12115 | if(i2==i1)continue; | |
12116 | aftsTrack=anEvent->GetTrack(i2); | |
12117 | if(!(aftsTrack->InRPSelection())) continue; | |
12118 | phi2=aftsTrack->Phi(); | |
12119 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
12120 | for(Int_t i3=0;i3<nPrim;i3++) | |
12121 | { | |
12122 | if(i3==i1||i3==i2)continue; | |
12123 | aftsTrack=anEvent->GetTrack(i3); | |
12124 | if(!(aftsTrack->InRPSelection())) continue; | |
12125 | phi3=aftsTrack->Phi(); | |
12126 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
12127 | for(Int_t i4=0;i4<nPrim;i4++) | |
12128 | { | |
12129 | if(i4==i1||i4==i2||i4==i3)continue; | |
12130 | aftsTrack=anEvent->GetTrack(i4); | |
12131 | if(!(aftsTrack->InRPSelection())) continue; | |
12132 | phi4=aftsTrack->Phi(); | |
12133 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); | |
12134 | if(nPrim>=4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; // to be improved (replace eventually this if statement with if(nPrim==4)) | |
12135 | // 4-p correlations using particle weights: | |
12136 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(10.5,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); | |
12137 | // extra correlations: | |
12138 | // 2-p extra correlations (do not appear if particle weights are not used): | |
12139 | // ... | |
12140 | // 3-p extra correlations (do not appear if particle weights are not used): | |
12141 | // ... | |
12142 | // 4-p extra correlations (do not appear if particle weights are not used): | |
12143 | // ... | |
12144 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
12145 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
12146 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
12147 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
12148 | } // end of if(nPrim>=4) | |
12149 | ||
12150 | */ | |
12151 | ||
12152 | cout<<endl; | |
12153 | ||
12154 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent) | |
12155 | ||
57340a27 | 12156 | //================================================================================================================================ |
489d5531 | 12157 | |
489d5531 | 12158 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights(TString type, TString ptOrEta) |
12159 | { | |
12160 | // Calculate correction terms for non-uniform acceptance for differential flow (cos terms) using particle weights. | |
57340a27 | 12161 | |
489d5531 | 12162 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][1][cti], where cti runs as follows: |
57340a27 | 12163 | // |
489d5531 | 12164 | // 0: <<cos n(psi)>> |
12165 | // 1: <<w2 cos n(psi1+phi2)>> | |
12166 | // 2: <<w2 w3 cos n(psi1+phi2-phi3)>> | |
12167 | // 3: <<w2 w3 cos n(psi1-phi2-phi3)>> | |
12168 | // 4: | |
12169 | // 5: | |
12170 | // 6: | |
12171 | ||
12172 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
12173 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
12174 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
12175 | //Double_t dReQ1n3k = (*fReQ)(0,3); | |
12176 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
12177 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
12178 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
12179 | //Double_t dImQ1n3k = (*fImQ)(0,3); | |
12180 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
12181 | ||
1268c371 | 12182 | // S^M_{p,k} (see .h file for the definition of fSpk): |
12183 | Double_t dSM1p1k = (*fSpk)(0,1); | |
12184 | Double_t dSM1p2k = (*fSpk)(0,2); | |
12185 | Double_t dSM2p1k = (*fSpk)(1,1); | |
489d5531 | 12186 | |
2a98ceb8 | 12187 | Int_t t = 0; // type flag |
12188 | Int_t pe = 0; // ptEta flag | |
489d5531 | 12189 | |
12190 | if(type == "RP") | |
12191 | { | |
12192 | t = 0; | |
12193 | } else if(type == "POI") | |
12194 | { | |
12195 | t = 1; | |
12196 | } | |
12197 | ||
12198 | if(ptOrEta == "Pt") | |
12199 | { | |
12200 | pe = 0; | |
12201 | } else if(ptOrEta == "Eta") | |
12202 | { | |
12203 | pe = 1; | |
12204 | } | |
12205 | ||
12206 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
12207 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
12208 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
12209 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
12210 | ||
12211 | // looping over all bins and calculating correction terms: | |
12212 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
12213 | { | |
12214 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
12215 | Double_t p1n0kRe = 0.; | |
12216 | Double_t p1n0kIm = 0.; | |
12217 | ||
12218 | // number of POIs in particular pt or eta bin: | |
12219 | Double_t mp = 0.; | |
12220 | ||
12221 | // real and imaginary parts of q_{m*n,0} (weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
12222 | Double_t q1n2kRe = 0.; | |
12223 | Double_t q1n2kIm = 0.; | |
12224 | Double_t q2n1kRe = 0.; | |
12225 | Double_t q2n1kIm = 0.; | |
46b94261 | 12226 | |
489d5531 | 12227 | // s_{1,1}, s_{1,2} // to be improved (add explanation) |
12228 | Double_t s1p1k = 0.; | |
12229 | Double_t s1p2k = 0.; | |
46b94261 | 12230 | |
489d5531 | 12231 | // number of particles which are both RPs and POIs in particular pt or eta bin: |
46b94261 | 12232 | Double_t mq = 0.; |
489d5531 | 12233 | |
12234 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
12235 | Double_t dM01 = 0.; | |
12236 | Double_t dM011 = 0.; | |
12237 | ||
12238 | if(type == "POI") | |
12239 | { | |
12240 | // q_{m*n,k}: | |
12241 | q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
12242 | * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
12243 | q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
12244 | * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
12245 | q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
12246 | * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
12247 | q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
12248 | * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
12249 | mq = fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
46b94261 | 12250 | |
489d5531 | 12251 | s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); |
12252 | s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); | |
12253 | }else if(type == "RP") | |
12254 | { | |
12255 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
12256 | q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
12257 | * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
12258 | q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
12259 | * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
12260 | q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
12261 | * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
12262 | q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
12263 | * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
12264 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
12265 | s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); | |
12266 | s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); | |
3b552efe | 12267 | //s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); |
12268 | ||
489d5531 | 12269 | mq = fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) |
12270 | } | |
3b552efe | 12271 | |
489d5531 | 12272 | if(type == "POI") |
3b552efe | 12273 | { |
12274 | // p_{m*n,k}: | |
489d5531 | 12275 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) |
12276 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
12277 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
3b552efe | 12278 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); |
12279 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
489d5531 | 12280 | // M01 from Eq. (118) in QC2c (to be improved (notation)): |
3b552efe | 12281 | dM01 = mp*dSM1p1k-s1p1k; |
12282 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
12283 | - 2.*(s1p1k*dSM1p1k-s1p2k); | |
12284 | ||
12285 | // typeFlag = RP (0) or POI (1): | |
12286 | t = 1; | |
12287 | } else if(type == "RP") | |
489d5531 | 12288 | { |
12289 | // to be improved (cross-checked): | |
12290 | p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
12291 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
12292 | p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
12293 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
12294 | mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
12295 | // M01 from Eq. (118) in QC2c (to be improved (notation)): | |
3b552efe | 12296 | dM01 = mp*dSM1p1k-s1p1k; |
12297 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
12298 | - 2.*(s1p1k*dSM1p1k-s1p2k); | |
489d5531 | 12299 | // typeFlag = RP (0) or POI (1): |
3b552efe | 12300 | t = 0; |
12301 | } | |
489d5531 | 12302 | |
12303 | // <<cos n(psi1)>>: | |
12304 | Double_t cosP1nPsi = 0.; | |
12305 | if(mp) | |
12306 | { | |
12307 | cosP1nPsi = p1n0kRe/mp; | |
12308 | ||
12309 | // fill profile for <<cos n(psi1)>>: | |
12310 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi,mp); | |
12311 | // histogram to store <cos n(psi1)> e-b-e (needed in some other methods): | |
12312 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][0]->SetBinContent(b,cosP1nPsi); | |
46b94261 | 12313 | } // end of if(mp) |
57340a27 | 12314 | |
489d5531 | 12315 | // <<w2 cos n(psi1+phi2)>>: |
12316 | Double_t cosP1nPsiP1nPhiW2 = 0.; | |
12317 | if(dM01) | |
12318 | { | |
12319 | cosP1nPsiP1nPhiW2 = (p1n0kRe*dReQ1n1k-p1n0kIm*dImQ1n1k-q2n1kRe)/(dM01); | |
12320 | // fill profile for <<w2 cos n(psi1+phi2)>>: | |
12321 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsiP1nPhiW2,dM01); | |
12322 | // histogram to store <w2 cos n(psi1+phi2)> e-b-e (needed in some other methods): | |
12323 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][1]->SetBinContent(b,cosP1nPsiP1nPhiW2); | |
12324 | } // end of if(dM01) | |
12325 | ||
12326 | // <<w2 w3 cos n(psi1+phi2-phi3)>>: | |
12327 | Double_t cosP1nPsi1P1nPhi2MPhi3W2W3 = 0.; | |
12328 | if(dM011) | |
12329 | { | |
46b94261 | 12330 | cosP1nPsi1P1nPhi2MPhi3W2W3 = (p1n0kRe*(pow(dImQ1n1k,2.)+pow(dReQ1n1k,2.)) |
12331 | - p1n0kRe*dSM1p2k | |
12332 | - q2n1kRe*dReQ1n1k-q2n1kIm*dImQ1n1k | |
12333 | - s1p1k*dReQ1n1k | |
12334 | + 2.*q1n2kRe) | |
12335 | / dM011; | |
489d5531 | 12336 | // fill profile for <<w1 w2 w3 cos n(psi1+phi2)>>: |
12337 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1P1nPhi2MPhi3W2W3,dM011); | |
12338 | // histogram to store <w1 w2 w3 cos n(psi1+phi2)> e-b-e (needed in some other methods): | |
12339 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][2]->SetBinContent(b,cosP1nPsi1P1nPhi2MPhi3W2W3); | |
12340 | } // end of if(dM011) | |
12341 | ||
12342 | // <<w2 w3 cos n(psi1-phi2-phi3)>>: | |
12343 | Double_t cosP1nPsi1M1nPhi2MPhi3W2W3 = 0.; | |
12344 | if(dM011) | |
12345 | { | |
12346 | cosP1nPsi1M1nPhi2MPhi3W2W3 = (p1n0kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))+2.*p1n0kIm*dReQ1n1k*dImQ1n1k | |
12347 | - 1.*(p1n0kRe*dReQ2n2k+p1n0kIm*dImQ2n2k) | |
46b94261 | 12348 | - 2.*s1p1k*dReQ1n1k |
489d5531 | 12349 | + 2.*q1n2kRe) |
12350 | / dM011; | |
12351 | // fill profile for <<w1 w2 w3 cos n(psi1+phi2)>>: | |
12352 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1M1nPhi2MPhi3W2W3,dM011); | |
12353 | // histogram to store <w1 w2 w3 cos n(psi1+phi2)> e-b-e (needed in some other methods): | |
12354 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][3]->SetBinContent(b,cosP1nPsi1M1nPhi2MPhi3W2W3); | |
12355 | } // end of if(dM011) | |
12356 | ||
12357 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
46b94261 | 12358 | |
57340a27 | 12359 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights(TString type, TString ptOrEta) |
12360 | ||
489d5531 | 12361 | |
12362 | //================================================================================================================================ | |
12363 | ||
12364 | ||
12365 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights(TString type, TString ptOrEta) | |
12366 | { | |
12367 | // Calculate correction terms for non-uniform acceptance for differential flow (sin terms). | |
12368 | ||
12369 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][0][cti], where cti runs as follows: | |
12370 | // 0: <<sin n(psi1)>> | |
12371 | // 1: <<w2 sin n(psi1+phi2)>> | |
12372 | // 2: <<w2 w3 sin n(psi1+phi2-phi3)>> | |
12373 | // 3: <<w2 w3 sin n(psi1-phi2-phi3)>>: | |
12374 | // 4: | |
12375 | // 5: | |
12376 | // 6: | |
12377 | ||
12378 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
12379 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
12380 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
12381 | //Double_t dReQ1n3k = (*fReQ)(0,3); | |
12382 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
12383 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
12384 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
12385 | //Double_t dImQ1n3k = (*fImQ)(0,3); | |
12386 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
12387 | ||
1268c371 | 12388 | // S^M_{p,k} (see .h file for the definition of fSpk): |
12389 | Double_t dSM1p1k = (*fSpk)(0,1); | |
12390 | Double_t dSM1p2k = (*fSpk)(0,2); | |
12391 | Double_t dSM2p1k = (*fSpk)(1,1); | |
489d5531 | 12392 | |
2a98ceb8 | 12393 | Int_t t = 0; // type flag |
12394 | Int_t pe = 0; // ptEta flag | |
489d5531 | 12395 | |
12396 | if(type == "RP") | |
12397 | { | |
12398 | t = 0; | |
12399 | } else if(type == "POI") | |
12400 | { | |
12401 | t = 1; | |
12402 | } | |
12403 | ||
12404 | if(ptOrEta == "Pt") | |
12405 | { | |
12406 | pe = 0; | |
12407 | } else if(ptOrEta == "Eta") | |
12408 | { | |
12409 | pe = 1; | |
12410 | } | |
12411 | ||
12412 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
12413 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
12414 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
12415 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
12416 | ||
12417 | // looping over all bins and calculating correction terms: | |
12418 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
12419 | { | |
12420 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
12421 | Double_t p1n0kRe = 0.; | |
12422 | Double_t p1n0kIm = 0.; | |
12423 | ||
12424 | // number of POIs in particular pt or eta bin: | |
12425 | Double_t mp = 0.; | |
12426 | ||
12427 | // real and imaginary parts of q_{m*n,0} (weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
12428 | Double_t q1n2kRe = 0.; | |
12429 | Double_t q1n2kIm = 0.; | |
12430 | Double_t q2n1kRe = 0.; | |
12431 | Double_t q2n1kIm = 0.; | |
46b94261 | 12432 | |
489d5531 | 12433 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) |
12434 | Double_t s1p1k = 0.; | |
12435 | Double_t s1p2k = 0.; | |
46b94261 | 12436 | |
489d5531 | 12437 | // number of particles which are both RPs and POIs in particular pt or eta bin: |
46b94261 | 12438 | Double_t mq = 0.; |
489d5531 | 12439 | |
12440 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
12441 | Double_t dM01 = 0.; | |
12442 | Double_t dM011 = 0.; | |
12443 | ||
12444 | if(type == "POI") | |
12445 | { | |
12446 | // q_{m*n,k}: | |
12447 | q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
12448 | * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
12449 | q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
12450 | * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
12451 | q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
12452 | * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
12453 | q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
12454 | * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
12455 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
46b94261 | 12456 | |
489d5531 | 12457 | s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); |
12458 | s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); | |
12459 | }else if(type == "RP") | |
12460 | { | |
12461 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
12462 | q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
12463 | * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
12464 | q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
12465 | * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
12466 | q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
12467 | * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
12468 | q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
12469 | * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
12470 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
12471 | s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); | |
12472 | s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); | |
12473 | //s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); | |
3b552efe | 12474 | } |
12475 | ||
12476 | if(type == "POI") | |
12477 | { | |
12478 | // p_{m*n,k}: | |
489d5531 | 12479 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) |
12480 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
12481 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
3b552efe | 12482 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); |
12483 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
489d5531 | 12484 | // M01 from Eq. (118) in QC2c (to be improved (notation)): |
3b552efe | 12485 | dM01 = mp*dSM1p1k-s1p1k; |
12486 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
12487 | - 2.*(s1p1k*dSM1p1k-s1p2k); | |
12488 | // typeFlag = RP (0) or POI (1): | |
12489 | t = 1; | |
489d5531 | 12490 | } else if(type == "RP") |
3b552efe | 12491 | { |
489d5531 | 12492 | // to be improved (cross-checked): |
12493 | p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
12494 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
12495 | p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
12496 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
12497 | mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
12498 | // M01 from Eq. (118) in QC2c (to be improved (notation)): | |
3b552efe | 12499 | dM01 = mp*dSM1p1k-s1p1k; |
12500 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
489d5531 | 12501 | - 2.*(s1p1k*dSM1p1k-s1p2k); |
12502 | // typeFlag = RP (0) or POI (1): | |
3b552efe | 12503 | t = 0; |
12504 | } | |
12505 | ||
489d5531 | 12506 | // <<sin n(psi1)>>: |
12507 | Double_t sinP1nPsi = 0.; | |
12508 | if(mp) | |
12509 | { | |
12510 | sinP1nPsi = p1n0kIm/mp; | |
12511 | ||
12512 | // fill profile for <<sin n(psi1)>>: | |
12513 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi,mp); | |
12514 | // histogram to store <sin n(psi1)> e-b-e (needed in some other methods): | |
12515 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][0]->SetBinContent(b,sinP1nPsi); | |
46b94261 | 12516 | } // end of if(mp) |
12517 | ||
489d5531 | 12518 | // <<w2 sin n(psi1+phi2)>>: |
12519 | Double_t sinP1nPsiP1nPhiW2 = 0.; | |
12520 | if(dM01) | |
12521 | { | |
12522 | sinP1nPsiP1nPhiW2 = (p1n0kRe*dImQ1n1k+p1n0kIm*dReQ1n1k-q2n1kIm)/(dM01); | |
12523 | // fill profile for <<w2 sin n(psi1+phi2)>>: | |
12524 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsiP1nPhiW2,dM01); | |
12525 | // histogram to store <w2 sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
12526 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][1]->SetBinContent(b,sinP1nPsiP1nPhiW2); | |
12527 | } // end of if(mp*dMult-mq) | |
12528 | ||
12529 | // <<w2 w3 sin n(psi1+phi2-phi3)>>: | |
12530 | Double_t sinP1nPsi1P1nPhi2MPhi3W2W3 = 0.; | |
12531 | if(dM011) | |
12532 | { | |
46b94261 | 12533 | sinP1nPsi1P1nPhi2MPhi3W2W3 = (p1n0kIm*(pow(dImQ1n1k,2.)+pow(dReQ1n1k,2.)) |
12534 | - p1n0kIm*dSM1p2k | |
12535 | + q2n1kRe*dImQ1n1k-q2n1kIm*dReQ1n1k | |
12536 | - s1p1k*dImQ1n1k | |
12537 | + 2.*q1n2kIm) | |
12538 | / dM011; | |
489d5531 | 12539 | // fill profile for <<w2 w3 sin n(psi1+phi2-phi3)>>: |
12540 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1P1nPhi2MPhi3W2W3,dM011); | |
12541 | // histogram to store <w2 w3 sin n(psi1+phi2-phi3)> e-b-e (needed in some other methods): | |
12542 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][2]->SetBinContent(b,sinP1nPsi1P1nPhi2MPhi3W2W3); | |
12543 | } // end of if(dM011) | |
12544 | ||
12545 | // <<w2 w3 sin n(psi1-phi2-phi3)>>: | |
12546 | Double_t sinP1nPsi1M1nPhi2MPhi3W2W3 = 0.; | |
12547 | if(dM011) | |
12548 | { | |
12549 | sinP1nPsi1M1nPhi2MPhi3W2W3 = (p1n0kIm*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))-2.*p1n0kRe*dReQ1n1k*dImQ1n1k | |
12550 | + 1.*(p1n0kRe*dImQ2n2k-p1n0kIm*dReQ2n2k) | |
46b94261 | 12551 | + 2.*s1p1k*dImQ1n1k |
489d5531 | 12552 | - 2.*q1n2kIm) |
12553 | / dM011; | |
12554 | // fill profile for <<w2 w3 sin n(psi1-phi2-phi3)>>: | |
12555 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1M1nPhi2MPhi3W2W3,dM011); | |
12556 | // histogram to store <w2 w3 sin n(psi1-phi2-phi3)> e-b-e (needed in some other methods): | |
12557 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][3]->SetBinContent(b,sinP1nPsi1M1nPhi2MPhi3W2W3); | |
12558 | } // end of if(dM011) | |
12559 | ||
12560 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
12561 | ||
12562 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights(TString type, TString ptOrEta) | |
12563 | ||
12564 | ||
12565 | //================================================================================================================================ | |
12566 | ||
12567 | ||
0328db2d | 12568 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 12569 | { |
57340a27 | 12570 | // Evaluate with nested loops correction terms for non-uniform acceptance |
489d5531 | 12571 | // with using particle weights (both sin and cos terms) relevant for differential flow. |
12572 | ||
57340a27 | 12573 | // Remark 1: "w1" in expressions bellow is a particle weight used only for particles which were |
12574 | // flagged both as POI and RP. | |
489d5531 | 12575 | // Remark 2: Reduced correction terms for non-uniform acceptance are evaluated in pt bin number fCrossCheckInPtBinNo |
12576 | // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
12577 | // Remark 3: Results are stored in 1 bin profiles fDiffFlowDirectCorrections[t][pe][sc][cti], where first three indices runs as: | |
12578 | // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms], whilst the cti (correction term index) runs as follows: | |
12579 | // cti: | |
12580 | // 0: <<sc n(psi1)>> | |
12581 | // 1: <<w2 sc n(psi1+phi2)>> | |
12582 | // 2: <<w2 w3 sc n(psi1+phi2-phi3)>> | |
12583 | // 3: <<w2 w3 sc n(psi1-phi2-phi3)>> | |
12584 | // 4: | |
12585 | // 5: | |
12586 | // 6: | |
46b94261 | 12587 | |
2a98ceb8 | 12588 | Int_t typeFlag = 0; |
12589 | Int_t ptEtaFlag = 0; | |
489d5531 | 12590 | if(type == "RP") |
12591 | { | |
12592 | typeFlag = 0; | |
12593 | } else if(type == "POI") | |
12594 | { | |
12595 | typeFlag = 1; | |
12596 | } | |
12597 | if(ptOrEta == "Pt") | |
12598 | { | |
12599 | ptEtaFlag = 0; | |
12600 | } else if(ptOrEta == "Eta") | |
12601 | { | |
12602 | ptEtaFlag = 1; | |
12603 | } | |
12604 | // shortcuts: | |
12605 | Int_t t = typeFlag; | |
12606 | Int_t pe = ptEtaFlag; | |
12607 | ||
12608 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12609 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12610 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
12611 | ||
12612 | Int_t nPrim = anEvent->NumberOfTracks(); | |
12613 | AliFlowTrackSimple *aftsTrack = NULL; | |
12614 | ||
12615 | Double_t psi1=0., phi2=0., phi3=0.;// phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
12616 | Double_t wPhi2=1., wPhi3=1.; | |
12617 | ||
12618 | Int_t n = fHarmonic; | |
12619 | ||
12620 | // 1'-particle correction terms: | |
12621 | for(Int_t i1=0;i1<nPrim;i1++) | |
12622 | { | |
12623 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12624 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12625 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12626 | { |
12627 | if(ptOrEta == "Pt") | |
12628 | { | |
12629 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12630 | } else if (ptOrEta == "Eta") | |
12631 | { | |
12632 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12633 | } |
12634 | } else // this is diff flow of RPs | |
12635 | { | |
489d5531 | 12636 | if(ptOrEta == "Pt") |
12637 | { | |
12638 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12639 | } else if (ptOrEta == "Eta") | |
12640 | { | |
12641 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12642 | } |
489d5531 | 12643 | } |
12644 | psi1=aftsTrack->Phi(); | |
12645 | // sin terms: | |
12646 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*psi1),1.); // <<sin(n*(psi1))>> | |
12647 | // cos terms: | |
12648 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*psi1),1.); // <<cos(n*(psi1))>> | |
12649 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12650 | ||
12651 | // 2'-particle correction terms: | |
12652 | for(Int_t i1=0;i1<nPrim;i1++) | |
12653 | { | |
12654 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12655 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12656 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12657 | { |
12658 | if(ptOrEta == "Pt") | |
12659 | { | |
12660 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12661 | } else if (ptOrEta == "Eta") | |
12662 | { | |
12663 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12664 | } |
12665 | } else // this is diff flow of RPs | |
12666 | { | |
489d5531 | 12667 | if(ptOrEta == "Pt") |
12668 | { | |
12669 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12670 | } else if (ptOrEta == "Eta") | |
12671 | { | |
12672 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12673 | } |
489d5531 | 12674 | } |
12675 | psi1=aftsTrack->Phi(); | |
12676 | for(Int_t i2=0;i2<nPrim;i2++) | |
12677 | { | |
12678 | if(i2==i1) continue; | |
12679 | aftsTrack=anEvent->GetTrack(i2); | |
12680 | // RP condition (!(first) particle in the correlator must be RP): | |
12681 | if(!(aftsTrack->InRPSelection())) continue; | |
46b94261 | 12682 | phi2=aftsTrack->Phi(); |
489d5531 | 12683 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); |
12684 | // sin terms: | |
12685 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2)),wPhi2); // <<w2 sin(n*(psi1+phi2))>> | |
12686 | // cos terms: | |
12687 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2)),wPhi2); // <<w2 cos(n*(psi1+phi2))>> | |
12688 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12689 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12690 | ||
12691 | // 3'-particle correction terms: | |
12692 | for(Int_t i1=0;i1<nPrim;i1++) | |
12693 | { | |
12694 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12695 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12696 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12697 | { |
12698 | if(ptOrEta == "Pt") | |
12699 | { | |
12700 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12701 | } else if (ptOrEta == "Eta") | |
12702 | { | |
12703 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12704 | } |
12705 | } else // this is diff flow of RPs | |
12706 | { | |
489d5531 | 12707 | if(ptOrEta == "Pt") |
12708 | { | |
12709 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12710 | } else if (ptOrEta == "Eta") | |
12711 | { | |
12712 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12713 | } |
489d5531 | 12714 | } |
12715 | psi1=aftsTrack->Phi(); | |
12716 | for(Int_t i2=0;i2<nPrim;i2++) | |
12717 | { | |
12718 | if(i2==i1) continue; | |
12719 | aftsTrack=anEvent->GetTrack(i2); | |
12720 | // RP condition (!(first) particle in the correlator must be RP): | |
12721 | if(!(aftsTrack->InRPSelection())) continue; | |
12722 | phi2=aftsTrack->Phi(); | |
12723 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
12724 | for(Int_t i3=0;i3<nPrim;i3++) | |
12725 | { | |
12726 | if(i3==i1||i3==i2) continue; | |
12727 | aftsTrack=anEvent->GetTrack(i3); | |
12728 | // RP condition (!(first) particle in the correlator must be RP): | |
12729 | if(!(aftsTrack->InRPSelection())) continue; | |
12730 | phi3=aftsTrack->Phi(); | |
12731 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
12732 | // sin terms: | |
12733 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 sin(n*(psi1+phi2-phi3))>> | |
12734 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1-phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 sin(n*(psi1-phi2-phi3))>> | |
12735 | // cos terms: | |
12736 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 cos(n*(psi1+phi2-phi3))>> | |
12737 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 cos(n*(psi1-phi2-phi3))>> | |
12738 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
12739 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
46b94261 | 12740 | }//end of for(Int_t i1=0;i1<nPrim;i1++) |
489d5531 | 12741 | |
12742 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
12743 | ||
2001bc3a | 12744 | //================================================================================================================================ |
12745 | ||
b3dacf6b | 12746 | void AliFlowAnalysisWithQCumulants::CheckPointersUsedInFinish() |
12747 | { | |
12748 | // Check all pointers used in method Finish(). | |
12749 | ||
b77b6434 | 12750 | if(!fAvMultiplicity) |
12751 | { | |
12752 | cout<<endl; | |
12753 | cout<<" WARNING (QC): fAvMultiplicity is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12754 | cout<<endl; | |
12755 | exit(0); | |
12756 | } | |
b3dacf6b | 12757 | if(!fIntFlowCorrelationsPro) |
12758 | { | |
12759 | cout<<endl; | |
12760 | cout<<" WARNING (QC): fIntFlowCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12761 | cout<<endl; | |
12762 | exit(0); | |
12763 | } | |
b40a910e | 12764 | if(!fIntFlowSquaredCorrelationsPro) |
12765 | { | |
12766 | cout<<endl; | |
12767 | cout<<" WARNING (QC): fIntFlowSquaredCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12768 | cout<<endl; | |
12769 | exit(0); | |
12770 | } | |
b3dacf6b | 12771 | if(!fIntFlowCorrelationsHist) |
12772 | { | |
12773 | cout<<endl; | |
12774 | cout<<" WARNING (QC): fIntFlowCorrelationsHist is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12775 | cout<<endl; | |
12776 | exit(0); | |
12777 | } | |
b77b6434 | 12778 | if((fUsePhiWeights||fUsePtWeights||fUseEtaWeights) && !fIntFlowExtraCorrelationsPro) |
12779 | { | |
12780 | cout<<endl; | |
12781 | cout<<" WARNING (QC): fIntFlowExtraCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12782 | cout<<endl; | |
12783 | exit(0); | |
12784 | } | |
b3dacf6b | 12785 | for(Int_t power=0;power<2;power++) |
12786 | { | |
12787 | if(!fIntFlowSumOfEventWeights[power]) | |
12788 | { | |
12789 | cout<<endl; | |
12790 | cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeights[%d] is NULL in CheckPointersUsedInFinish() !!!!",power)<<endl; | |
12791 | cout<<endl; | |
12792 | exit(0); | |
12793 | } | |
12794 | } // end of for(Int_t power=0;power<2;power++) | |
12795 | if(!fIntFlowProductOfCorrelationsPro) | |
12796 | { | |
12797 | cout<<endl; | |
12798 | cout<<" WARNING (QC): fIntFlowProductOfCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12799 | cout<<endl; | |
12800 | exit(0); | |
12801 | } | |
12802 | if(!fIntFlowSumOfProductOfEventWeights) | |
12803 | { | |
12804 | cout<<endl; | |
12805 | cout<<" WARNING (QC): fIntFlowSumOfProductOfEventWeights is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12806 | cout<<endl; | |
12807 | exit(0); | |
12808 | } | |
12809 | if(!fIntFlowCovariances) | |
12810 | { | |
12811 | cout<<endl; | |
12812 | cout<<" WARNING (QC): fIntFlowCovariances is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12813 | cout<<endl; | |
12814 | exit(0); | |
12815 | } | |
12816 | if(!fIntFlowQcumulants) | |
12817 | { | |
12818 | cout<<endl; | |
12819 | cout<<" WARNING (QC): fIntFlowQcumulants is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12820 | cout<<endl; | |
12821 | exit(0); | |
12822 | } | |
0dd3b008 | 12823 | if(!fIntFlow) |
12824 | { | |
12825 | cout<<endl; | |
12826 | cout<<" WARNING (QC): fIntFlow is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12827 | cout<<endl; | |
12828 | exit(0); | |
12829 | } | |
12830 | if(!fCommonHists) | |
12831 | { | |
12832 | cout<<endl; | |
12833 | cout<<" WARNING (QC): fCommonHists is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12834 | cout<<endl; | |
12835 | exit(0); | |
12836 | } | |
12837 | if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th)) | |
12838 | { | |
12839 | cout<<endl; | |
12840 | cout<<" WARNING (QC): fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th"<<endl; | |
12841 | cout<<" && fCommonHistsResults8th is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12842 | cout<<endl; | |
12843 | exit(0); | |
12844 | } | |
b3dacf6b | 12845 | |
b92ea2b9 | 12846 | // NUA stuff: |
12847 | for(Int_t sc=0;sc<2;sc++) // sin/cos | |
12848 | { | |
12849 | if(!fIntFlowCorrectionTermsForNUAPro[sc]) | |
12850 | { | |
12851 | cout<<endl; | |
12852 | cout<<Form(" WARNING (QC): fIntFlowCorrectionTermsForNUAPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",sc)<<endl; | |
12853 | cout<<endl; | |
12854 | exit(0); | |
12855 | } | |
12856 | if(!fIntFlowCorrectionTermsForNUAHist[sc]) | |
12857 | { | |
12858 | cout<<endl; | |
12859 | cout<<Form(" WARNING (QC): fIntFlowCorrectionTermsForNUAHist[%d] is NULL in CheckPointersUsedInFinish() !!!!",sc)<<endl; | |
12860 | cout<<endl; | |
12861 | exit(0); | |
12862 | } | |
12863 | for(Int_t lq=0;lq<2;lq++) // linear/quadratic | |
12864 | { | |
12865 | if(!fIntFlowSumOfEventWeightsNUA[sc][lq]) | |
12866 | { | |
12867 | cout<<endl; | |
12868 | cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeightsNUA[%d][%d] is NULL in CheckPointersUsedInFinish() !!!!",sc,lq)<<endl; | |
12869 | cout<<endl; | |
12870 | exit(0); | |
12871 | } | |
12872 | } // end of for(Int_t lq=0;lq<2;lq++) // linear/quadratic | |
12873 | } // end of for(Int_t power=0;power<2;power++) | |
12874 | if(!fIntFlowProductOfCorrectionTermsForNUAPro) | |
12875 | { | |
12876 | cout<<endl; | |
12877 | cout<<" WARNING (QC): fIntFlowProductOfCorrectionTermsForNUAPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12878 | cout<<endl; | |
12879 | exit(0); | |
12880 | } | |
12881 | if(!fIntFlowSumOfProductOfEventWeightsNUA) | |
12882 | { | |
12883 | cout<<endl; | |
12884 | cout<<" WARNING (QC): fIntFlowSumOfProductOfEventWeightsNUA is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12885 | cout<<endl; | |
12886 | exit(0); | |
12887 | } | |
12888 | if(!fIntFlowCovariancesNUA) | |
12889 | { | |
12890 | cout<<endl; | |
12891 | cout<<" WARNING (QC): fIntFlowCovariancesNUA is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12892 | cout<<endl; | |
12893 | exit(0); | |
12894 | } | |
12895 | if(!fIntFlowQcumulantsErrorSquaredRatio) | |
12896 | { | |
12897 | cout<<endl; | |
12898 | cout<<" WARNING (QC): fIntFlowQcumulantsErrorSquaredRatio is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12899 | cout<<endl; | |
12900 | exit(0); | |
12901 | } | |
12902 | if(!fIntFlowDetectorBias) | |
12903 | { | |
12904 | cout<<endl; | |
12905 | cout<<" WARNING (QC): fIntFlowDetectorBias is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12906 | cout<<endl; | |
12907 | exit(0); | |
12908 | } | |
12909 | ||
b3dacf6b | 12910 | // Versus multiplicity: |
12911 | if(!fCalculateCumulantsVsM){return;} | |
b77b6434 | 12912 | for(Int_t co=0;co<=3;co++) // cumulant order |
b3dacf6b | 12913 | { |
b77b6434 | 12914 | if(!fIntFlowQcumulantsVsM[co]) |
b3dacf6b | 12915 | { |
12916 | cout<<endl; | |
b77b6434 | 12917 | cout<<Form(" WARNING (QC): fIntFlowQcumulantsVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",co)<<endl; |
b3dacf6b | 12918 | cout<<endl; |
12919 | exit(0); | |
12920 | } | |
b77b6434 | 12921 | if(!fIntFlowVsM[co]) |
b3dacf6b | 12922 | { |
12923 | cout<<endl; | |
b77b6434 | 12924 | cout<<Form(" WARNING (QC): fIntFlowVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",co)<<endl; |
12925 | cout<<endl; | |
12926 | exit(0); | |
12927 | } | |
12928 | if(!fIntFlowDetectorBiasVsM[co]) | |
12929 | { | |
12930 | cout<<endl; | |
12931 | cout<<Form(" WARNING (QC): fIntFlowDetectorBiasVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",co)<<endl; | |
12932 | cout<<endl; | |
12933 | exit(0); | |
12934 | } | |
12935 | } // end of for(Int_t c0=0;c0<=3;c0++) // cumulant order | |
12936 | for(Int_t ci=0;ci<=3;ci++) // correlation index | |
12937 | { | |
12938 | if(!fIntFlowCorrelationsVsMPro[ci]) | |
12939 | { | |
12940 | cout<<endl; | |
12941 | cout<<Form(" WARNING (QC): fIntFlowCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl; | |
b3dacf6b | 12942 | cout<<endl; |
12943 | exit(0); | |
12944 | } | |
b40a910e | 12945 | if(!fIntFlowSquaredCorrelationsVsMPro[ci]) |
12946 | { | |
12947 | cout<<endl; | |
12948 | cout<<Form(" WARNING (QC): fIntFlowSquaredCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl; | |
12949 | cout<<endl; | |
12950 | exit(0); | |
12951 | } | |
b77b6434 | 12952 | if(!fIntFlowCorrelationsVsMHist[ci]) |
b92ea2b9 | 12953 | { |
12954 | cout<<endl; | |
b77b6434 | 12955 | cout<<Form(" WARNING (QC): fIntFlowCorrelationsVsMHist[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl; |
b92ea2b9 | 12956 | cout<<endl; |
12957 | exit(0); | |
12958 | } | |
b3dacf6b | 12959 | for(Int_t power=0;power<2;power++) |
12960 | { | |
12961 | if(!fIntFlowSumOfEventWeightsVsM[ci][power]) | |
12962 | { | |
12963 | cout<<endl; | |
12964 | cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeightsVsM[%d][%d] is NULL in CheckPointersUsedInFinish() !!!!",ci,power)<<endl; | |
12965 | cout<<endl; | |
12966 | exit(0); | |
12967 | } | |
12968 | } // end of for(Int_t power=0;power<2;power++) | |
12969 | } // end of for(Int_t ci=0;ci<=3;ci++) // correlation index | |
12970 | for(Int_t i=0;i<6;i++) | |
12971 | { | |
12972 | if(!fIntFlowProductOfCorrelationsVsMPro[i]) | |
12973 | { | |
12974 | cout<<endl; | |
12975 | cout<<Form(" WARNING (QC): fIntFlowProductOfCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl; | |
12976 | cout<<endl; | |
12977 | exit(0); | |
12978 | } | |
12979 | if(!fIntFlowSumOfProductOfEventWeightsVsM[i]) | |
12980 | { | |
12981 | cout<<endl; | |
12982 | cout<<Form(" WARNING (QC): fIntFlowSumOfProductOfEventWeightsVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl; | |
12983 | cout<<endl; | |
12984 | exit(0); | |
12985 | } | |
12986 | if(!fIntFlowCovariancesVsM[i]) | |
12987 | { | |
12988 | cout<<endl; | |
12989 | cout<<Form(" WARNING (QC): fIntFlowCovariancesVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl; | |
12990 | cout<<endl; | |
12991 | exit(0); | |
12992 | } | |
12993 | } // end of for(Int_t i=0;i<6;i++) | |
12994 | if(!fIntFlowRebinnedInM) | |
12995 | { | |
12996 | cout<<endl; | |
12997 | cout<<" WARNING (QC): fIntFlowRebinnedInM is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12998 | cout<<endl; | |
12999 | exit(0); | |
13000 | } | |
13001 | if(!fIntFlowQcumulantsRebinnedInM) | |
13002 | { | |
13003 | cout<<endl; | |
13004 | cout<<" WARNING (QC): fIntFlowQcumulantsRebinnedInM is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13005 | cout<<endl; | |
13006 | exit(0); | |
13007 | } | |
13008 | ||
13009 | } // end of void AliFlowAnalysisWithQCumulants::CheckPointersUsedInFinish() | |
13010 | ||
13011 | //================================================================================================================================ | |
13012 | ||
13013 | void AliFlowAnalysisWithQCumulants::CheckPointersUsedInMake() | |
13014 | { | |
1268c371 | 13015 | // Check all pointers used in method Make(). // to be improved - check other pointers as well |
b3dacf6b | 13016 | |
b77b6434 | 13017 | if(!fAvMultiplicity) |
13018 | { | |
1268c371 | 13019 | printf("\n WARNING (QC): fAvMultiplicity is NULL in CheckPointersUsedInMake() !!!!\n\n"); |
b77b6434 | 13020 | exit(0); |
13021 | } | |
13022 | if((fUsePhiWeights||fUsePtWeights||fUseEtaWeights) && !fIntFlowExtraCorrelationsPro) | |
13023 | { | |
1268c371 | 13024 | printf("\n WARNING (QC): fIntFlowExtraCorrelationsPro is NULL in CheckPointersUsedInMake() !!!!\n\n"); |
b77b6434 | 13025 | exit(0); |
13026 | } | |
1268c371 | 13027 | // 2D: |
13028 | if(fCalculate2DDiffFlow) | |
13029 | { | |
13030 | for(Int_t t=0;t<2;t++) // type = RP or POI | |
13031 | { | |
13032 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
13033 | { | |
13034 | if(!f2DDiffFlowCorrelationsPro[t][rci]) | |
13035 | { | |
13036 | printf("\n WARNING (QC): f2DDiffFlowCorrelationsPro[%i][%i] is NULL in CheckPointersUsedInMake() !!!!\n\n",t,rci); | |
13037 | exit(0); | |
13038 | } // end of if(!f2DDiffFlowCorrelationsPro[t][rci]) | |
13039 | } // end of for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
13040 | } // end of for(Int_t t=0;t<2;t++) | |
13041 | } // end of if(fCalculate2DDiffFlow) | |
b3dacf6b | 13042 | |
13043 | } // end of void AliFlowAnalysisWithQCumulants::CheckPointersUsedInMake() | |
13044 | ||
57340a27 | 13045 |