]>
Commit | Line | Data |
---|---|---|
489d5531 | 1 | /************************************************************************* |
2 | * Copyright(c) 1998-2008, ALICE Experiment at CERN, All rights reserved. * | |
3 | * * | |
4 | * Author: The ALICE Off-line Project. * | |
5 | * Contributors are mentioned in the code where appropriate. * | |
6 | * * | |
7 | * Permission to use, copy, modify and distribute this software and its * | |
8 | * documentation strictly for non-commercial purposes is hereby granted * | |
9 | * without fee, provided that the above copyright notice appears in all * | |
10 | * copies and that both the copyright notice and this permission notice * | |
11 | * appear in the supporting documentation. The authors make no claims * | |
12 | * about the suitability of this software for any purpose. It is * | |
13 | * provided "as is" without express or implied warranty. * | |
14 | **************************************************************************/ | |
15 | ||
16 | /********************************** | |
17 | * flow analysis with Q-cumulants * | |
18 | * * | |
ff70ca91 | 19 | * author: Ante Bilandzic * |
20 | * (abilandzic@gmail.com) * | |
489d5531 | 21 | *********************************/ |
22 | ||
23 | #define AliFlowAnalysisWithQCumulants_cxx | |
24 | ||
25 | #include "Riostream.h" | |
26 | #include "AliFlowCommonConstants.h" | |
27 | #include "AliFlowCommonHist.h" | |
28 | #include "AliFlowCommonHistResults.h" | |
29 | #include "TChain.h" | |
30 | ||
31 | #include "TFile.h" | |
32 | #include "TList.h" | |
33 | #include "TGraph.h" | |
34 | #include "TParticle.h" | |
35 | #include "TRandom3.h" | |
36 | #include "TStyle.h" | |
37 | #include "TProfile.h" | |
38 | #include "TProfile2D.h" | |
39 | #include "TProfile3D.h" | |
40 | #include "TMath.h" | |
41 | #include "TArrow.h" | |
42 | #include "TPaveLabel.h" | |
43 | #include "TCanvas.h" | |
44 | #include "AliFlowEventSimple.h" | |
45 | #include "AliFlowTrackSimple.h" | |
46 | #include "AliFlowAnalysisWithQCumulants.h" | |
47 | #include "TArrayD.h" | |
48 | #include "TRandom.h" | |
49 | #include "TF1.h" | |
50 | ||
51 | class TH1; | |
52 | class TH2; | |
53 | class TGraph; | |
54 | class TPave; | |
55 | class TLatex; | |
56 | class TMarker; | |
57 | class TRandom3; | |
58 | class TObjArray; | |
59 | class TList; | |
60 | class TCanvas; | |
61 | class TSystem; | |
62 | class TROOT; | |
63 | class AliFlowVector; | |
64 | class TVector; | |
65 | ||
66 | ||
67 | //================================================================================================================ | |
68 | ||
69 | ||
70 | ClassImp(AliFlowAnalysisWithQCumulants) | |
71 | ||
72 | AliFlowAnalysisWithQCumulants::AliFlowAnalysisWithQCumulants(): | |
73 | // 0.) base: | |
74 | fHistList(NULL), | |
75 | // 1.) common: | |
76 | fCommonHists(NULL), | |
77 | fCommonHists2nd(NULL), | |
78 | fCommonHists4th(NULL), | |
79 | fCommonHists6th(NULL), | |
80 | fCommonHists8th(NULL), | |
81 | fCommonHistsResults2nd(NULL), | |
82 | fCommonHistsResults4th(NULL), | |
83 | fCommonHistsResults6th(NULL), | |
84 | fCommonHistsResults8th(NULL), | |
85 | fnBinsPhi(0), | |
86 | fPhiMin(0), | |
87 | fPhiMax(0), | |
88 | fPhiBinWidth(0), | |
89 | fnBinsPt(0), | |
90 | fPtMin(0), | |
91 | fPtMax(0), | |
92 | fPtBinWidth(0), | |
93 | fnBinsEta(0), | |
94 | fEtaMin(0), | |
95 | fEtaMax(0), | |
96 | fEtaBinWidth(0), | |
97 | fHarmonic(2), | |
98 | fAnalysisLabel(NULL), | |
99 | // 2a.) particle weights: | |
100 | fWeightsList(NULL), | |
101 | fUsePhiWeights(kFALSE), | |
102 | fUsePtWeights(kFALSE), | |
103 | fUseEtaWeights(kFALSE), | |
104 | fUseParticleWeights(NULL), | |
105 | fPhiWeights(NULL), | |
106 | fPtWeights(NULL), | |
107 | fEtaWeights(NULL), | |
108 | // 2b.) event weights: | |
109 | fMultiplicityWeight(NULL), | |
110 | // 3.) integrated flow: | |
111 | fIntFlowList(NULL), | |
112 | fIntFlowProfiles(NULL), | |
113 | fIntFlowResults(NULL), | |
114 | fIntFlowFlags(NULL), | |
9da1a4f3 | 115 | fApplyCorrectionForNUA(kTRUE), |
2001bc3a | 116 | fApplyCorrectionForNUAVsM(kFALSE), |
9da1a4f3 | 117 | fnBinsMult(10000), |
067e9bc8 | 118 | fMinMult(0.), |
119 | fMaxMult(10000.), | |
b3dacf6b | 120 | fPropagateErrorFromCorrelations(kFALSE), |
121 | fCalculateCumulantsVsM(kTRUE), | |
0dd3b008 | 122 | fMinimumBiasReferenceFlow(kTRUE), |
489d5531 | 123 | fReQ(NULL), |
124 | fImQ(NULL), | |
125 | fSMpk(NULL), | |
126 | fIntFlowCorrelationsEBE(NULL), | |
127 | fIntFlowEventWeightsForCorrelationsEBE(NULL), | |
128 | fIntFlowCorrelationsAllEBE(NULL), | |
129 | fAvMultiplicity(NULL), | |
130 | fIntFlowCorrelationsPro(NULL), | |
131 | fIntFlowCorrelationsAllPro(NULL), | |
132 | fIntFlowExtraCorrelationsPro(NULL), | |
133 | fIntFlowProductOfCorrelationsPro(NULL), | |
0328db2d | 134 | fIntFlowProductOfCorrectionTermsForNUAPro(NULL), |
489d5531 | 135 | fIntFlowCorrelationsHist(NULL), |
136 | fIntFlowCorrelationsAllHist(NULL), | |
137 | fIntFlowCovariances(NULL), | |
138 | fIntFlowSumOfProductOfEventWeights(NULL), | |
0328db2d | 139 | fIntFlowCovariancesNUA(NULL), |
140 | fIntFlowSumOfProductOfEventWeightsNUA(NULL), | |
489d5531 | 141 | fIntFlowQcumulants(NULL), |
b3dacf6b | 142 | fIntFlowQcumulantsRebinnedInM(NULL), |
489d5531 | 143 | fIntFlow(NULL), |
b3dacf6b | 144 | fIntFlowRebinnedInM(NULL), |
2001bc3a | 145 | fIntFlowDetectorBias(NULL), |
489d5531 | 146 | // 4.) differential flow: |
147 | fDiffFlowList(NULL), | |
148 | fDiffFlowProfiles(NULL), | |
149 | fDiffFlowResults(NULL), | |
150 | fDiffFlowFlags(NULL), | |
151 | fCalculate2DFlow(kFALSE), | |
152 | // 5.) distributions: | |
57340a27 | 153 | fDistributionsList(NULL), |
154 | fDistributionsFlags(NULL), | |
489d5531 | 155 | fStoreDistributions(kFALSE), |
156 | // x.) debugging and cross-checking: | |
157 | fNestedLoopsList(NULL), | |
158 | fEvaluateIntFlowNestedLoops(kFALSE), | |
159 | fEvaluateDiffFlowNestedLoops(kFALSE), | |
160 | fMaxAllowedMultiplicity(10), | |
161 | fEvaluateNestedLoops(NULL), | |
162 | fIntFlowDirectCorrelations(NULL), | |
163 | fIntFlowExtraDirectCorrelations(NULL), | |
164 | fCrossCheckInPtBinNo(10), | |
3b552efe | 165 | fCrossCheckInEtaBinNo(20), |
489d5531 | 166 | fNoOfParticlesInBin(NULL) |
167 | { | |
168 | // constructor | |
169 | ||
170 | // base list to hold all output objects: | |
171 | fHistList = new TList(); | |
172 | fHistList->SetName("cobjQC"); | |
173 | fHistList->SetOwner(kTRUE); | |
174 | ||
175 | // list to hold histograms with phi, pt and eta weights: | |
176 | fWeightsList = new TList(); | |
177 | ||
178 | // multiplicity weight: | |
179 | fMultiplicityWeight = new TString("combinations"); | |
180 | ||
181 | // analysis label; | |
182 | fAnalysisLabel = new TString(); | |
183 | ||
184 | // initialize all arrays: | |
185 | this->InitializeArraysForIntFlow(); | |
186 | this->InitializeArraysForDiffFlow(); | |
187 | this->InitializeArraysForDistributions(); | |
188 | this->InitializeArraysForNestedLoops(); | |
189 | ||
190 | } // end of constructor | |
191 | ||
192 | ||
193 | //================================================================================================================ | |
194 | ||
195 | ||
196 | AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants() | |
197 | { | |
198 | // destructor | |
199 | ||
200 | delete fHistList; | |
201 | ||
202 | } // end of AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants() | |
203 | ||
204 | ||
205 | //================================================================================================================ | |
206 | ||
207 | ||
208 | void AliFlowAnalysisWithQCumulants::Init() | |
209 | { | |
3b552efe | 210 | // a) Cross check if the settings make sense before starting the QC adventure; |
489d5531 | 211 | // b) Access all common constants; |
212 | // c) Book all objects; | |
3b552efe | 213 | // d) Store flags for integrated and differential flow; |
489d5531 | 214 | // e) Store flags for distributions of corelations; |
215 | // f) Store harmonic which will be estimated. | |
3b552efe | 216 | |
489d5531 | 217 | //save old value and prevent histograms from being added to directory |
218 | //to avoid name clashes in case multiple analaysis objects are used | |
219 | //in an analysis | |
220 | Bool_t oldHistAddStatus = TH1::AddDirectoryStatus(); | |
221 | TH1::AddDirectory(kFALSE); | |
222 | ||
3b552efe | 223 | // a) Cross check if the settings make sense before starting the QC adventure; |
489d5531 | 224 | this->CrossCheckSettings(); |
225 | // b) Access all common constants: | |
226 | this->AccessConstants(); | |
227 | // c) Book all objects: | |
228 | this->BookAndFillWeightsHistograms(); | |
229 | this->BookAndNestAllLists(); | |
230 | this->BookCommonHistograms(); | |
231 | this->BookEverythingForIntegratedFlow(); | |
232 | this->BookEverythingForDifferentialFlow(); | |
233 | this->BookEverythingForDistributions(); | |
234 | this->BookEverythingForNestedLoops(); | |
235 | // d) Store flags for integrated and differential flow: | |
236 | this->StoreIntFlowFlags(); | |
3b552efe | 237 | this->StoreDiffFlowFlags(); |
489d5531 | 238 | // e) Store flags for distributions of corelations: |
239 | this->StoreFlagsForDistributions(); | |
240 | // f) Store harmonic which will be estimated: | |
241 | this->StoreHarmonic(); | |
242 | ||
243 | TH1::AddDirectory(oldHistAddStatus); | |
244 | } // end of void AliFlowAnalysisWithQCumulants::Init() | |
245 | ||
246 | ||
247 | //================================================================================================================ | |
248 | ||
249 | ||
250 | void AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent) | |
251 | { | |
252 | // Running over data only in this method. | |
253 | ||
b3dacf6b | 254 | // a) Check all pointers used in this method; |
255 | // b) Define local variables; | |
256 | // c) Fill the common control histograms and call the method to fill fAvMultiplicity; | |
257 | // d) Loop over data and calculate e-b-e quantities; | |
258 | // e) Call all the methods which calculate correlations for reference flow; | |
259 | // f) Call all the methods which calculate correlations for differential flow; | |
260 | // g) Distributions of correlations; | |
261 | // h) Debugging and cross-checking (evaluate nested loops); | |
262 | // i) Reset all event-by-event quantities. | |
489d5531 | 263 | |
b3dacf6b | 264 | // a) Check all pointers used in this method: |
265 | this->CheckPointersUsedInMake(); | |
266 | ||
267 | // b) Define local variables: | |
489d5531 | 268 | Double_t dPhi = 0.; // azimuthal angle in the laboratory frame |
269 | Double_t dPt = 0.; // transverse momentum | |
270 | Double_t dEta = 0.; // pseudorapidity | |
489d5531 | 271 | Double_t wPhi = 1.; // phi weight |
272 | Double_t wPt = 1.; // pt weight | |
273 | Double_t wEta = 1.; // eta weight | |
489d5531 | 274 | Int_t nRP = anEvent->GetEventNSelTracksRP(); // number of RPs (i.e. number of particles used to determine the reaction plane) |
9f33751d | 275 | |
b3dacf6b | 276 | // c) Fill the common control histograms and call the method to fill fAvMultiplicity: |
489d5531 | 277 | this->FillCommonControlHistograms(anEvent); |
278 | this->FillAverageMultiplicities(nRP); | |
279 | ||
b3dacf6b | 280 | // d) Loop over data and calculate e-b-e quantities: |
9f33751d | 281 | Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = total number of primary tracks, i.e. nPrim = nRP + nPOI where: |
489d5531 | 282 | // nRP = # of particles used to determine the reaction plane; |
283 | // nPOI = # of particles of interest for a detailed flow analysis; | |
489d5531 | 284 | |
285 | AliFlowTrackSimple *aftsTrack = NULL; | |
286 | ||
287 | for(Int_t i=0;i<nPrim;i++) | |
288 | { | |
289 | aftsTrack=anEvent->GetTrack(i); | |
290 | if(aftsTrack) | |
291 | { | |
292 | if(!(aftsTrack->InRPSelection() || aftsTrack->InPOISelection())) continue; // consider only tracks which are RPs or POIs | |
293 | Int_t n = fHarmonic; // shortcut for the harmonic | |
294 | if(aftsTrack->InRPSelection()) // RP condition: | |
295 | { | |
296 | dPhi = aftsTrack->Phi(); | |
297 | dPt = aftsTrack->Pt(); | |
298 | dEta = aftsTrack->Eta(); | |
299 | if(fUsePhiWeights && fPhiWeights && fnBinsPhi) // determine phi weight for this particle: | |
300 | { | |
301 | wPhi = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(dPhi*fnBinsPhi/TMath::TwoPi()))); | |
302 | } | |
303 | if(fUsePtWeights && fPtWeights && fnBinsPt) // determine pt weight for this particle: | |
304 | { | |
305 | wPt = fPtWeights->GetBinContent(1+(Int_t)(TMath::Floor((dPt-fPtMin)/fPtBinWidth))); | |
306 | } | |
307 | if(fUseEtaWeights && fEtaWeights && fEtaBinWidth) // determine eta weight for this particle: | |
308 | { | |
309 | wEta = fEtaWeights->GetBinContent(1+(Int_t)(TMath::Floor((dEta-fEtaMin)/fEtaBinWidth))); | |
310 | } | |
311 | ||
312 | // integrated flow: | |
313 | // calculate Re[Q_{m*n,k}] and Im[Q_{m*n,k}], m = 1,2,3,4, for this event: | |
314 | for(Int_t m=0;m<4;m++) | |
315 | { | |
316 | for(Int_t k=0;k<9;k++) | |
317 | { | |
318 | (*fReQ)(m,k)+=pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1)*n*dPhi); | |
319 | (*fImQ)(m,k)+=pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1)*n*dPhi); | |
320 | } | |
321 | } | |
322 | // calculate S^{M}_{p,k} for this event | |
323 | // Remark: final calculation of S^{M}_{p,k} follows after the loop over data bellow: | |
324 | for(Int_t p=0;p<8;p++) | |
325 | { | |
326 | for(Int_t k=0;k<9;k++) | |
327 | { | |
328 | (*fSMpk)(p,k)+=pow(wPhi*wPt*wEta,k); | |
329 | } | |
330 | } | |
331 | ||
332 | // differential flow: | |
333 | // 1D (pt): | |
334 | // (r_{m*m,k}(pt)): | |
335 | for(Int_t m=0;m<4;m++) | |
336 | { | |
337 | for(Int_t k=0;k<9;k++) | |
338 | { | |
339 | fReRPQ1dEBE[0][0][m][k]->Fill(dPt,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.); | |
340 | fImRPQ1dEBE[0][0][m][k]->Fill(dPt,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
341 | } | |
342 | } | |
343 | ||
344 | // s_{k}(pt) for RPs // to be improved (clarified) | |
345 | // Remark: final calculation of s_{p,k}(pt) follows after the loop over data bellow: | |
346 | for(Int_t k=0;k<9;k++) | |
347 | { | |
348 | fs1dEBE[0][0][k]->Fill(dPt,pow(wPhi*wPt*wEta,k),1.); | |
349 | } | |
350 | // 1D (eta): | |
351 | // (r_{m*m,k}(eta)): | |
352 | for(Int_t m=0;m<4;m++) | |
353 | { | |
354 | for(Int_t k=0;k<9;k++) | |
355 | { | |
356 | fReRPQ1dEBE[0][1][m][k]->Fill(dEta,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.); | |
357 | fImRPQ1dEBE[0][1][m][k]->Fill(dEta,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
358 | } | |
359 | } | |
360 | // s_{k}(eta) for RPs // to be improved (clarified) | |
361 | // Remark: final calculation of s_{p,k}(eta) follows after the loop over data bellow: | |
362 | for(Int_t k=0;k<9;k++) | |
363 | { | |
364 | fs1dEBE[0][1][k]->Fill(dEta,pow(wPhi*wPt*wEta,k),1.); | |
365 | } | |
366 | ||
367 | ||
368 | ||
369 | /* | |
370 | // 2D (pt,eta): | |
371 | if(fCalculate2DFlow) | |
372 | { | |
373 | // (r_{m*m,k}(pt,eta)): | |
374 | for(Int_t m=0;m<4;m++) | |
375 | { | |
376 | for(Int_t k=0;k<9;k++) | |
377 | { | |
378 | fReRPQ2dEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.); | |
379 | fImRPQ2dEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
380 | } | |
381 | } | |
382 | // s_{k}(pt,eta) for RPs // to be improved (clarified) | |
383 | // Remark: final calculation of s_{p,k}(pt,eta) follows after the loop over data bellow: | |
384 | for(Int_t k=0;k<9;k++) | |
385 | { | |
386 | fs2dEBE[0][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k),1.); | |
387 | } | |
388 | } // end of if(fCalculate2DFlow) | |
389 | */ | |
390 | ||
391 | ||
392 | ||
393 | if(aftsTrack->InPOISelection()) | |
394 | { | |
395 | // 1D (pt): | |
396 | // (q_{m*m,k}(pt)): | |
397 | for(Int_t m=0;m<4;m++) | |
398 | { | |
399 | for(Int_t k=0;k<9;k++) | |
400 | { | |
401 | fReRPQ1dEBE[2][0][m][k]->Fill(dPt,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.); | |
402 | fImRPQ1dEBE[2][0][m][k]->Fill(dPt,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
403 | } | |
404 | } | |
405 | // s_{k}(pt) for RP&&POIs // to be improved (clarified) | |
406 | // Remark: final calculation of s_{p,k}(pt,eta) follows after the loop over data bellow: | |
407 | for(Int_t k=0;k<9;k++) | |
408 | { | |
409 | fs1dEBE[2][0][k]->Fill(dPt,pow(wPhi*wPt*wEta,k),1.); | |
410 | } | |
411 | // 1D (eta): | |
412 | // (q_{m*m,k}(eta)): | |
413 | for(Int_t m=0;m<4;m++) | |
414 | { | |
415 | for(Int_t k=0;k<9;k++) | |
416 | { | |
417 | fReRPQ1dEBE[2][1][m][k]->Fill(dEta,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.); | |
418 | fImRPQ1dEBE[2][1][m][k]->Fill(dEta,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
419 | } | |
420 | } | |
421 | // s_{k}(eta) for RP&&POIs // to be improved (clarified) | |
422 | // Remark: final calculation of s_{p,k}(pt,eta) follows after the loop over data bellow: | |
423 | for(Int_t k=0;k<9;k++) | |
424 | { | |
425 | fs1dEBE[2][1][k]->Fill(dEta,pow(wPhi*wPt*wEta,k),1.); | |
426 | } | |
427 | ||
428 | /* | |
429 | // 2D (pt,eta) | |
430 | if(fCalculate2DFlow) | |
431 | { | |
432 | // (q_{m*m,k}(pt,eta)): | |
433 | for(Int_t m=0;m<4;m++) | |
434 | { | |
435 | for(Int_t k=0;k<9;k++) | |
436 | { | |
437 | fReRPQ2dEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.); | |
438 | fImRPQ2dEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
439 | } | |
440 | } | |
441 | // s_{k}(pt,eta) for RP&&POIs // to be improved (clarified) | |
442 | // Remark: final calculation of s_{p,k}(pt,eta) follows after the loop over data bellow: | |
443 | for(Int_t k=0;k<9;k++) | |
444 | { | |
445 | fs2dEBE[2][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k),1.); | |
446 | } | |
447 | } // end of if(fCalculate2DFlow) | |
448 | */ | |
449 | ||
450 | } // end of if(aftsTrack->InPOISelection()) | |
451 | ||
452 | ||
453 | ||
454 | } // end of if(pTrack->InRPSelection()) | |
455 | ||
456 | ||
457 | ||
458 | if(aftsTrack->InPOISelection()) | |
459 | { | |
460 | dPhi = aftsTrack->Phi(); | |
461 | dPt = aftsTrack->Pt(); | |
462 | dEta = aftsTrack->Eta(); | |
463 | ||
464 | // 1D (pt) | |
465 | // p_n(m*n,0): | |
466 | for(Int_t m=0;m<4;m++) | |
467 | { | |
468 | fReRPQ1dEBE[1][0][m][0]->Fill(dPt,TMath::Cos((m+1.)*n*dPhi),1.); | |
469 | fImRPQ1dEBE[1][0][m][0]->Fill(dPt,TMath::Sin((m+1.)*n*dPhi),1.); | |
470 | } | |
471 | // 1D (eta) | |
472 | // p_n(m*n,0): | |
473 | for(Int_t m=0;m<4;m++) | |
474 | { | |
475 | fReRPQ1dEBE[1][1][m][0]->Fill(dEta,TMath::Cos((m+1.)*n*dPhi),1.); | |
476 | fImRPQ1dEBE[1][1][m][0]->Fill(dEta,TMath::Sin((m+1.)*n*dPhi),1.); | |
477 | } | |
478 | ||
479 | ||
480 | /* | |
481 | // 2D (pt,eta): | |
482 | if(fCalculate2DFlow) | |
483 | { | |
484 | // p_n(m*n,0): | |
485 | for(Int_t m=0;m<4;m++) | |
486 | { | |
487 | fReRPQ2dEBE[1][m][0]->Fill(dPt,dEta,TMath::Cos((m+1.)*n*dPhi),1.); | |
488 | fImRPQ2dEBE[1][m][0]->Fill(dPt,dEta,TMath::Sin((m+1.)*n*dPhi),1.); | |
489 | } | |
490 | } // end of if(fCalculate2DFlow) | |
491 | */ | |
492 | ||
493 | ||
494 | } // end of if(pTrack->InPOISelection() ) | |
495 | ||
496 | ||
497 | } else // to if(aftsTrack) | |
498 | { | |
499 | cout<<endl; | |
500 | cout<<" WARNING: no particle! (i.e. aftsTrack is a NULL pointer in AFAWQC::Make().)"<<endl; | |
501 | cout<<endl; | |
502 | } | |
503 | } // end of for(Int_t i=0;i<nPrim;i++) | |
504 | ||
505 | // calculate the final expressions for S^{M}_{p,k}: | |
506 | for(Int_t p=0;p<8;p++) | |
507 | { | |
508 | for(Int_t k=0;k<9;k++) | |
509 | { | |
510 | (*fSMpk)(p,k)=pow((*fSMpk)(p,k),p+1); | |
511 | } | |
512 | } | |
513 | ||
b3dacf6b | 514 | // e) Call all the methods which calculate correlations for reference flow: |
489d5531 | 515 | if(!fEvaluateIntFlowNestedLoops) |
516 | { | |
517 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
518 | { | |
519 | if(nRP>1) this->CalculateIntFlowCorrelations(); // without using particle weights | |
0328db2d | 520 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) |
489d5531 | 521 | { |
522 | if(nRP>1) this->CalculateIntFlowCorrelationsUsingParticleWeights(); // with using particle weights | |
523 | } | |
524 | ||
525 | if(nRP>3) this->CalculateIntFlowProductOfCorrelations(); | |
526 | if(nRP>1) this->CalculateIntFlowSumOfEventWeights(); | |
527 | if(nRP>1) this->CalculateIntFlowSumOfProductOfEventWeights(); | |
528 | if(fApplyCorrectionForNUA) | |
529 | { | |
57340a27 | 530 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) |
531 | { | |
489d5531 | 532 | if(nRP>0) this->CalculateIntFlowCorrectionsForNUASinTerms(); |
533 | if(nRP>0) this->CalculateIntFlowCorrectionsForNUACosTerms(); | |
57340a27 | 534 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) |
535 | { | |
489d5531 | 536 | if(nRP>0) this->CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights(); |
57340a27 | 537 | if(nRP>0) this->CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights(); |
538 | } | |
0328db2d | 539 | |
540 | if(nRP>0) this->CalculateIntFlowProductOfCorrectionTermsForNUA(); | |
541 | if(nRP>0) this->CalculateIntFlowSumOfEventWeightsNUA(); | |
542 | if(nRP>0) this->CalculateIntFlowSumOfProductOfEventWeightsNUA(); | |
489d5531 | 543 | } // end of if(fApplyCorrectionForNUA) |
544 | } // end of if(!fEvaluateIntFlowNestedLoops) | |
545 | ||
b3dacf6b | 546 | // f) Call all the methods which calculate correlations for differential flow: |
489d5531 | 547 | if(!fEvaluateDiffFlowNestedLoops) |
548 | { | |
549 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
550 | { | |
551 | // without using particle weights: | |
552 | this->CalculateDiffFlowCorrelations("RP","Pt"); | |
553 | this->CalculateDiffFlowCorrelations("RP","Eta"); | |
554 | this->CalculateDiffFlowCorrelations("POI","Pt"); | |
57340a27 | 555 | this->CalculateDiffFlowCorrelations("POI","Eta"); |
556 | if(fApplyCorrectionForNUA) | |
557 | { | |
489d5531 | 558 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Pt"); |
559 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Eta"); | |
560 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Pt"); | |
561 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Eta"); | |
562 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Pt"); | |
563 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Eta"); | |
564 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Pt"); | |
57340a27 | 565 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Eta"); |
489d5531 | 566 | } // end of if(fApplyCorrectionForNUA) |
567 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
568 | { | |
569 | // with using particle weights: | |
570 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Pt"); | |
571 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Eta"); | |
572 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Pt"); | |
573 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Eta"); | |
57340a27 | 574 | if(fApplyCorrectionForNUA) |
575 | { | |
489d5531 | 576 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Pt"); |
577 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Eta"); | |
578 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Pt"); | |
579 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Eta"); | |
580 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Pt"); | |
581 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Eta"); | |
582 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Pt"); | |
57340a27 | 583 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Eta"); |
489d5531 | 584 | } // end of if(fApplyCorrectionForNUA) |
585 | } | |
57340a27 | 586 | |
489d5531 | 587 | // whether or not using particle weights the following is calculated in the same way: |
588 | this->CalculateDiffFlowProductOfCorrelations("RP","Pt"); | |
589 | this->CalculateDiffFlowProductOfCorrelations("RP","Eta"); | |
590 | this->CalculateDiffFlowProductOfCorrelations("POI","Pt"); | |
591 | this->CalculateDiffFlowProductOfCorrelations("POI","Eta"); | |
592 | this->CalculateDiffFlowSumOfEventWeights("RP","Pt"); | |
593 | this->CalculateDiffFlowSumOfEventWeights("RP","Eta"); | |
594 | this->CalculateDiffFlowSumOfEventWeights("POI","Pt"); | |
595 | this->CalculateDiffFlowSumOfEventWeights("POI","Eta"); | |
596 | this->CalculateDiffFlowSumOfProductOfEventWeights("RP","Pt"); | |
597 | this->CalculateDiffFlowSumOfProductOfEventWeights("RP","Eta"); | |
598 | this->CalculateDiffFlowSumOfProductOfEventWeights("POI","Pt"); | |
599 | this->CalculateDiffFlowSumOfProductOfEventWeights("POI","Eta"); | |
600 | } // end of if(!fEvaluateDiffFlowNestedLoops) | |
601 | ||
602 | ||
603 | ||
604 | // with weights: | |
605 | // ... | |
606 | ||
607 | /* | |
608 | // 2D differential flow | |
609 | if(fCalculate2DFlow) | |
610 | { | |
611 | // without weights: | |
612 | if(nRP>1) this->CalculateCorrelationsForDifferentialFlow2D("RP"); | |
613 | if(nRP>1) this->CalculateCorrelationsForDifferentialFlow2D("POI"); | |
614 | ||
615 | // with weights: | |
616 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
617 | { | |
618 | if(nRP>1) this->CalculateWeightedCorrelationsForDifferentialFlow2D("RP"); | |
619 | if(nRP>1) this->CalculateWeightedCorrelationsForDifferentialFlow2D("POI"); | |
620 | } | |
621 | } // end of if(fCalculate2DFlow) | |
622 | */ | |
57340a27 | 623 | |
b3dacf6b | 624 | // g) Distributions of correlations; |
57340a27 | 625 | if(fStoreDistributions) |
626 | { | |
627 | this->StoreDistributionsOfCorrelations(); | |
628 | } | |
489d5531 | 629 | |
b3dacf6b | 630 | // h) Debugging and cross-checking (evaluate nested loops): |
631 | // h1) cross-checking results for integrated flow: | |
489d5531 | 632 | if(fEvaluateIntFlowNestedLoops) |
633 | { | |
634 | if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 | |
635 | { | |
636 | // without using particle weights: | |
637 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
638 | { | |
639 | // correlations: | |
640 | this->CalculateIntFlowCorrelations(); // from Q-vectors | |
641 | this->EvaluateIntFlowCorrelationsWithNestedLoops(anEvent); // from nested loops (to be improved: do I have to pass here anEvent or not?) | |
642 | // correction for non-uniform acceptance: | |
643 | this->CalculateIntFlowCorrectionsForNUASinTerms(); // from Q-vectors (sin terms) | |
644 | this->CalculateIntFlowCorrectionsForNUACosTerms(); // from Q-vectors (cos terms) | |
645 | this->EvaluateIntFlowCorrectionsForNUAWithNestedLoops(anEvent); // from nested loops (both sin and cos terms) | |
646 | } | |
647 | // using particle weights: | |
648 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
649 | { | |
650 | // correlations: | |
651 | this->CalculateIntFlowCorrelationsUsingParticleWeights(); // from Q-vectors | |
652 | this->EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent); // from nested loops (to be improved: do I have to pass here anEvent or not?) | |
653 | // correction for non-uniform acceptance: | |
654 | this->CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights(); // from Q-vectors (sin terms) | |
655 | this->CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights(); // from Q-vectors (cos terms) | |
57340a27 | 656 | this->EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(anEvent); // from nested loops (both sin and cos terms) |
489d5531 | 657 | } |
658 | } else if (nPrim>fMaxAllowedMultiplicity) // to if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) | |
659 | { | |
660 | cout<<endl; | |
661 | cout<<"Skipping the event because multiplicity is "<<nPrim<<". Too high to evaluate nested loops!"<<endl; | |
662 | } else | |
663 | { | |
664 | cout<<endl; | |
665 | cout<<"Skipping the event because multiplicity is "<<nPrim<<"."<<endl; | |
666 | } | |
667 | } // end of if(fEvaluateIntFlowNestedLoops) | |
668 | ||
b3dacf6b | 669 | // h2) cross-checking results for differential flow: |
489d5531 | 670 | if(fEvaluateDiffFlowNestedLoops) |
671 | { | |
672 | if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 | |
673 | { | |
674 | // without using particle weights: | |
675 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
676 | { | |
677 | // reduced correlations: | |
678 | // Q-vectors: | |
679 | this->CalculateDiffFlowCorrelations("RP","Pt"); | |
680 | this->CalculateDiffFlowCorrelations("RP","Eta"); | |
681 | this->CalculateDiffFlowCorrelations("POI","Pt"); | |
682 | this->CalculateDiffFlowCorrelations("POI","Eta"); | |
683 | // nested loops: | |
684 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"RP","Pt"); | |
685 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"RP","Eta"); | |
686 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"POI","Pt"); | |
687 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"POI","Eta"); | |
688 | // reduced corrections for non-uniform acceptance: | |
689 | // Q-vectors: | |
690 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Pt"); | |
691 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Eta"); | |
692 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Pt"); | |
693 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Eta"); | |
694 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Pt"); | |
695 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Eta"); | |
696 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Pt"); | |
697 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Eta"); | |
698 | // nested loops: | |
699 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"RP","Pt"); | |
700 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"RP","Eta"); | |
701 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"POI","Pt"); | |
702 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"POI","Eta"); | |
703 | } // end of if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
704 | // using particle weights: | |
705 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
706 | { | |
707 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Pt"); | |
708 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Eta"); | |
709 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Pt"); | |
710 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Eta"); | |
711 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Pt"); | |
712 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Eta"); | |
713 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Pt"); | |
714 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Eta"); | |
715 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Pt"); | |
716 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Eta"); | |
717 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Pt"); | |
718 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Eta"); | |
719 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"RP","Pt"); | |
720 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"RP","Eta"); | |
721 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"POI","Pt"); | |
3b552efe | 722 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"POI","Eta"); |
489d5531 | 723 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"RP","Pt"); |
724 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"RP","Eta"); | |
725 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"POI","Pt"); | |
726 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"POI","Eta"); | |
727 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
728 | } // end of if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 | |
729 | } // end of if(fEvaluateDiffFlowNestedLoops) | |
730 | ||
b3dacf6b | 731 | // i) Reset all event-by-event quantities. |
489d5531 | 732 | this->ResetEventByEventQuantities(); |
733 | ||
734 | } // end of AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent) | |
735 | ||
489d5531 | 736 | //================================================================================================================================ |
737 | ||
489d5531 | 738 | void AliFlowAnalysisWithQCumulants::Finish() |
739 | { | |
740 | // Calculate the final results. | |
489d5531 | 741 | |
b3dacf6b | 742 | // a) Check all pointers used in this method; |
743 | // b) Acces the constants; | |
744 | // c) Access the flags; | |
745 | // d) Calculate the final results for reference flow (without/with weights); | |
746 | // e) Correct the results for reference flow (without/with weights) for effects of non-uniform acceptance (NUA); | |
747 | // f) Store results for reference flow in AliFlowCommonHistResults and print them on the screen; | |
748 | // g) Calculate the final results for differential flow (without/with weights); | |
749 | // h) Correct the results for differential flow (without/with weights) for effects of non-uniform acceptance (NUA); | |
750 | // i) Calculate the final results for integrated flow (RP/POI) and store in AliFlowCommonHistResults; | |
751 | // j) Store results for differential flow in AliFlowCommonHistResults; | |
752 | // k) Print the final results for integrated flow (RP/POI) on the screen; | |
753 | // l) Cross-checking: Results from Q-vectors vs results from nested loops. | |
754 | ||
755 | // a) Check all pointers used in this method: | |
756 | this->CheckPointersUsedInFinish(); | |
757 | ||
758 | // b) Acces the constants: | |
489d5531 | 759 | this->AccessConstants(); |
760 | ||
b3dacf6b | 761 | if(fCommonHists && fCommonHists->GetHarmonic()) // to be improved (moved somewhere else) |
489d5531 | 762 | { |
b3dacf6b | 763 | fHarmonic = (Int_t)(fCommonHists->GetHarmonic())->GetBinContent(1); |
489d5531 | 764 | } |
b3dacf6b | 765 | |
766 | // c) Access the flags: // to be improved (implement a method for this) | |
767 | fUsePhiWeights = (Bool_t)fUseParticleWeights->GetBinContent(1); | |
768 | fUsePtWeights = (Bool_t)fUseParticleWeights->GetBinContent(2); | |
769 | fUseEtaWeights = (Bool_t)fUseParticleWeights->GetBinContent(3); | |
770 | fApplyCorrectionForNUA = (Bool_t)fIntFlowFlags->GetBinContent(3); | |
771 | fPrintFinalResults[0] = (Bool_t)fIntFlowFlags->GetBinContent(4); | |
772 | fPrintFinalResults[1] = (Bool_t)fIntFlowFlags->GetBinContent(5); | |
773 | fPrintFinalResults[2] = (Bool_t)fIntFlowFlags->GetBinContent(6); | |
774 | fPrintFinalResults[3] = (Bool_t)fIntFlowFlags->GetBinContent(7); | |
775 | fApplyCorrectionForNUAVsM = (Bool_t)fIntFlowFlags->GetBinContent(8); | |
776 | fPropagateErrorFromCorrelations = (Bool_t)fIntFlowFlags->GetBinContent(9); | |
0dd3b008 | 777 | fCalculateCumulantsVsM = (Bool_t)fIntFlowFlags->GetBinContent(10); |
778 | fMinimumBiasReferenceFlow = (Bool_t)fIntFlowFlags->GetBinContent(11); | |
b3dacf6b | 779 | fEvaluateIntFlowNestedLoops = (Bool_t)fEvaluateNestedLoops->GetBinContent(1); |
780 | fEvaluateDiffFlowNestedLoops = (Bool_t)fEvaluateNestedLoops->GetBinContent(2); | |
489d5531 | 781 | fCrossCheckInPtBinNo = (Int_t)fEvaluateNestedLoops->GetBinContent(3); |
782 | fCrossCheckInEtaBinNo = (Int_t)fEvaluateNestedLoops->GetBinContent(4); | |
783 | ||
b3dacf6b | 784 | // d) Calculate the final results for reference flow (without/with weights): |
489d5531 | 785 | this->FinalizeCorrelationsIntFlow(); |
786 | this->CalculateCovariancesIntFlow(); | |
787 | this->CalculateCumulantsIntFlow(); | |
788 | this->CalculateIntFlow(); | |
789 | ||
b3dacf6b | 790 | // e) Correct the results for reference flow (without/with weights) for effects of non-uniform acceptance (NUA): |
791 | if(fApplyCorrectionForNUA) | |
489d5531 | 792 | { |
793 | this->FinalizeCorrectionTermsForNUAIntFlow(); | |
067e9bc8 | 794 | // this->CalculateCovariancesNUAIntFlow(); // to be improved (enabled eventually) |
489d5531 | 795 | this->CalculateQcumulantsCorrectedForNUAIntFlow(); |
796 | this->CalculateIntFlowCorrectedForNUA(); | |
2001bc3a | 797 | this->CalculateDetectorEffectsForTrueCorrelations(); |
489d5531 | 798 | } |
799 | ||
b3dacf6b | 800 | // f) Store results for reference flow in AliFlowCommonHistResults and print them on the screen: |
489d5531 | 801 | this->FillCommonHistResultsIntFlow(); |
b3dacf6b | 802 | if(fPrintFinalResults[0]){this->PrintFinalResultsForIntegratedFlow("RF");} |
803 | if(fPrintFinalResults[3] && fCalculateCumulantsVsM){this->PrintFinalResultsForIntegratedFlow("RF, rebinned in M");} | |
489d5531 | 804 | |
b3dacf6b | 805 | // g) Calculate the final results for differential flow (without/with weights): |
489d5531 | 806 | this->FinalizeReducedCorrelations("RP","Pt"); |
807 | this->FinalizeReducedCorrelations("RP","Eta"); | |
808 | this->FinalizeReducedCorrelations("POI","Pt"); | |
809 | this->FinalizeReducedCorrelations("POI","Eta"); | |
810 | this->CalculateDiffFlowCovariances("RP","Pt"); | |
811 | this->CalculateDiffFlowCovariances("RP","Eta"); | |
812 | this->CalculateDiffFlowCovariances("POI","Pt"); | |
813 | this->CalculateDiffFlowCovariances("POI","Eta"); | |
814 | this->CalculateDiffFlowCumulants("RP","Pt"); | |
815 | this->CalculateDiffFlowCumulants("RP","Eta"); | |
816 | this->CalculateDiffFlowCumulants("POI","Pt"); | |
817 | this->CalculateDiffFlowCumulants("POI","Eta"); | |
818 | this->CalculateDiffFlow("RP","Pt"); | |
819 | this->CalculateDiffFlow("RP","Eta"); | |
820 | this->CalculateDiffFlow("POI","Pt"); | |
821 | this->CalculateDiffFlow("POI","Eta"); | |
822 | ||
b3dacf6b | 823 | // h) Correct the results for differential flow (without/with weights) for effects of non-uniform acceptance (NUA): |
824 | if(fApplyCorrectionForNUA) | |
489d5531 | 825 | { |
826 | this->FinalizeCorrectionTermsForNUADiffFlow("RP","Pt"); | |
827 | this->FinalizeCorrectionTermsForNUADiffFlow("RP","Eta"); | |
828 | this->FinalizeCorrectionTermsForNUADiffFlow("POI","Pt"); | |
829 | this->FinalizeCorrectionTermsForNUADiffFlow("POI","Eta"); | |
830 | this->CalculateDiffFlowCumulantsCorrectedForNUA("RP","Pt"); | |
831 | this->CalculateDiffFlowCumulantsCorrectedForNUA("RP","Eta"); | |
832 | this->CalculateDiffFlowCumulantsCorrectedForNUA("POI","Pt"); | |
833 | this->CalculateDiffFlowCumulantsCorrectedForNUA("POI","Eta"); | |
834 | this->CalculateDiffFlowCorrectedForNUA("RP","Pt"); | |
835 | this->CalculateDiffFlowCorrectedForNUA("RP","Eta"); | |
836 | this->CalculateDiffFlowCorrectedForNUA("POI","Pt"); | |
837 | this->CalculateDiffFlowCorrectedForNUA("POI","Eta"); | |
3b552efe | 838 | } |
489d5531 | 839 | |
b3dacf6b | 840 | // i) Calculate the final results for integrated flow (RP/POI) and store in AliFlowCommonHistResults: |
489d5531 | 841 | this->CalculateFinalResultsForRPandPOIIntegratedFlow("RP"); |
842 | this->CalculateFinalResultsForRPandPOIIntegratedFlow("POI"); | |
843 | ||
b3dacf6b | 844 | // j) Store results for differential flow in AliFlowCommonHistResults: |
489d5531 | 845 | this->FillCommonHistResultsDiffFlow("RP"); |
846 | this->FillCommonHistResultsDiffFlow("POI"); | |
847 | ||
b3dacf6b | 848 | // k) Print the final results for integrated flow (RP/POI) on the screen: |
849 | if(fPrintFinalResults[1]){this->PrintFinalResultsForIntegratedFlow("RP");} | |
850 | if(fPrintFinalResults[2]){this->PrintFinalResultsForIntegratedFlow("POI");} | |
851 | ||
852 | // l) Cross-checking: Results from Q-vectors vs results from nested loops: | |
853 | // l1) Reference flow: | |
489d5531 | 854 | if(fEvaluateIntFlowNestedLoops) |
855 | { | |
856 | this->CrossCheckIntFlowCorrelations(); | |
857 | this->CrossCheckIntFlowCorrectionTermsForNUA(); | |
858 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) this->CrossCheckIntFlowExtraCorrelations(); | |
859 | } // end of if(fEvaluateIntFlowNestedLoops) | |
860 | ||
b3dacf6b | 861 | // l2) Differential flow: |
489d5531 | 862 | if(fEvaluateDiffFlowNestedLoops) |
863 | { | |
b3dacf6b | 864 | // Correlations: |
489d5531 | 865 | this->PrintNumberOfParticlesInSelectedBin(); |
866 | this->CrossCheckDiffFlowCorrelations("RP","Pt"); | |
867 | this->CrossCheckDiffFlowCorrelations("RP","Eta"); | |
868 | this->CrossCheckDiffFlowCorrelations("POI","Pt"); | |
869 | this->CrossCheckDiffFlowCorrelations("POI","Eta"); | |
b3dacf6b | 870 | // Correction terms for non-uniform acceptance: |
489d5531 | 871 | this->CrossCheckDiffFlowCorrectionTermsForNUA("RP","Pt"); |
872 | this->CrossCheckDiffFlowCorrectionTermsForNUA("RP","Eta"); | |
873 | this->CrossCheckDiffFlowCorrectionTermsForNUA("POI","Pt"); | |
874 | this->CrossCheckDiffFlowCorrectionTermsForNUA("POI","Eta"); | |
875 | } // end of if(fEvaluateDiffFlowNestedLoops) | |
876 | ||
877 | } // end of AliFlowAnalysisWithQCumulants::Finish() | |
878 | ||
489d5531 | 879 | //================================================================================================================================ |
880 | ||
489d5531 | 881 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTerms() |
882 | { | |
883 | // calculate corrections for non-uniform acceptance of the detector for no-name integrated flow (cos terms) | |
884 | ||
885 | // multiplicity: | |
886 | Double_t dMult = (*fSMpk)(0,0); | |
887 | ||
888 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
889 | Double_t dReQ1n = (*fReQ)(0,0); | |
890 | Double_t dReQ2n = (*fReQ)(1,0); | |
891 | //Double_t dReQ3n = (*fReQ)(2,0); | |
892 | //Double_t dReQ4n = (*fReQ)(3,0); | |
893 | Double_t dImQ1n = (*fImQ)(0,0); | |
894 | Double_t dImQ2n = (*fImQ)(1,0); | |
895 | //Double_t dImQ3n = (*fImQ)(2,0); | |
896 | //Double_t dImQ4n = (*fImQ)(3,0); | |
897 | ||
898 | // ************************************************************* | |
899 | // **** corrections for non-uniform acceptance (cos terms): **** | |
900 | // ************************************************************* | |
901 | // | |
902 | // Remark 1: corrections for non-uniform acceptance (cos terms) calculated with non-weighted Q-vectors | |
903 | // are stored in 1D profile fQCorrectionsCos. | |
904 | // Remark 2: binning of fIntFlowCorrectionTermsForNUAPro[1] is organized as follows: | |
905 | // -------------------------------------------------------------------------------------------------------------------- | |
906 | // 1st bin: <<cos(n*(phi1))>> = cosP1n | |
907 | // 2nd bin: <<cos(n*(phi1+phi2))>> = cosP1nP1n | |
908 | // 3rd bin: <<cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1n | |
909 | // 4th bin: <<cos(n*(2phi1-phi2))>> = cosP2nM1n | |
910 | // -------------------------------------------------------------------------------------------------------------------- | |
911 | ||
912 | // 1-particle: | |
913 | Double_t cosP1n = 0.; // <<cos(n*(phi1))>> | |
914 | ||
915 | if(dMult>0) | |
916 | { | |
917 | cosP1n = dReQ1n/dMult; | |
918 | ||
919 | // average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for single event: | |
920 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(1,cosP1n); | |
0328db2d | 921 | // event weights for NUA terms: |
922 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(1,dMult); | |
489d5531 | 923 | |
924 | // final average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for all events: | |
925 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(0.5,cosP1n,dMult); | |
b3dacf6b | 926 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[1][0]->Fill(dMult+0.5,cosP1n,dMult);} |
489d5531 | 927 | } |
928 | ||
929 | // 2-particle: | |
3b552efe | 930 | Double_t cosP1nP1n = 0.; // <<cos(n*(phi1+phi2))>> |
489d5531 | 931 | Double_t cosP2nM1n = 0.; // <<cos(n*(2phi1-phi2))>> |
932 | ||
933 | if(dMult>1) | |
934 | { | |
935 | cosP1nP1n = (pow(dReQ1n,2)-pow(dImQ1n,2)-dReQ2n)/(dMult*(dMult-1)); | |
936 | cosP2nM1n = (dReQ2n*dReQ1n+dImQ2n*dImQ1n-dReQ1n)/(dMult*(dMult-1)); | |
937 | ||
938 | // average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for single event: | |
3b552efe | 939 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(2,cosP1nP1n); |
489d5531 | 940 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(4,cosP2nM1n); |
0328db2d | 941 | // event weights for NUA terms: |
942 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(2,dMult*(dMult-1)); | |
943 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(4,dMult*(dMult-1)); | |
944 | ||
489d5531 | 945 | // final average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for all events: |
3b552efe | 946 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(1.5,cosP1nP1n,dMult*(dMult-1)); |
489d5531 | 947 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(3.5,cosP2nM1n,dMult*(dMult-1)); |
b3dacf6b | 948 | if(fCalculateCumulantsVsM) |
949 | { | |
950 | fIntFlowCorrectionTermsForNUAVsMPro[1][1]->Fill(dMult+0.5,cosP1nP1n,dMult*(dMult-1)); | |
951 | fIntFlowCorrectionTermsForNUAVsMPro[1][3]->Fill(dMult+0.5,cosP2nM1n,dMult*(dMult-1)); | |
952 | } | |
489d5531 | 953 | } |
954 | ||
955 | // 3-particle: | |
956 | Double_t cosP1nM1nM1n = 0.; // <<cos(n*(phi1-phi2-phi3))>> | |
957 | ||
958 | if(dMult>2) | |
959 | { | |
960 | cosP1nM1nM1n = (dReQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))-dReQ1n*dReQ2n-dImQ1n*dImQ2n-2.*(dMult-1)*dReQ1n) | |
961 | / (dMult*(dMult-1)*(dMult-2)); | |
962 | ||
963 | // average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for single event: | |
964 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(3,cosP1nM1nM1n); | |
0328db2d | 965 | // event weights for NUA terms: |
966 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(3,dMult*(dMult-1)*(dMult-2)); | |
489d5531 | 967 | |
968 | // final average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for all events: | |
2001bc3a | 969 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(2.5,cosP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); |
b3dacf6b | 970 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[1][2]->Fill(dMult+0.5,cosP1nM1nM1n,dMult*(dMult-1)*(dMult-2));} |
489d5531 | 971 | } |
972 | ||
973 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTerms() | |
974 | ||
975 | ||
976 | //================================================================================================================================ | |
977 | ||
978 | ||
979 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTerms() | |
980 | { | |
981 | // calculate corrections for non-uniform acceptance of the detector for no-name integrated flow (sin terms) | |
982 | ||
983 | // multiplicity: | |
984 | Double_t dMult = (*fSMpk)(0,0); | |
985 | ||
986 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
987 | Double_t dReQ1n = (*fReQ)(0,0); | |
988 | Double_t dReQ2n = (*fReQ)(1,0); | |
989 | //Double_t dReQ3n = (*fReQ)(2,0); | |
990 | //Double_t dReQ4n = (*fReQ)(3,0); | |
991 | Double_t dImQ1n = (*fImQ)(0,0); | |
992 | Double_t dImQ2n = (*fImQ)(1,0); | |
993 | //Double_t dImQ3n = (*fImQ)(2,0); | |
994 | //Double_t dImQ4n = (*fImQ)(3,0); | |
995 | ||
996 | // ************************************************************* | |
997 | // **** corrections for non-uniform acceptance (sin terms): **** | |
998 | // ************************************************************* | |
999 | // | |
1000 | // Remark 1: corrections for non-uniform acceptance (sin terms) calculated with non-weighted Q-vectors | |
1001 | // are stored in 1D profile fQCorrectionsSin. | |
1002 | // Remark 2: binning of fIntFlowCorrectionTermsForNUAPro[0] is organized as follows: | |
1003 | // -------------------------------------------------------------------------------------------------------------------- | |
1004 | // 1st bin: <<sin(n*(phi1))>> = sinP1n | |
1005 | // 2nd bin: <<sin(n*(phi1+phi2))>> = sinP1nP1n | |
1006 | // 3rd bin: <<sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1n | |
1007 | // 4th bin: <<sin(n*(2phi1-phi2))>> = sinP2nM1n | |
1008 | // -------------------------------------------------------------------------------------------------------------------- | |
1009 | ||
1010 | // 1-particle: | |
1011 | Double_t sinP1n = 0.; // <sin(n*(phi1))> | |
1012 | ||
1013 | if(dMult>0) | |
1014 | { | |
1015 | sinP1n = dImQ1n/dMult; | |
1016 | ||
1017 | // average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for single event: | |
0328db2d | 1018 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(1,sinP1n); |
1019 | // event weights for NUA terms: | |
1020 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(1,dMult); | |
489d5531 | 1021 | |
1022 | // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
1023 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(0.5,sinP1n,dMult); | |
b3dacf6b | 1024 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[0][0]->Fill(dMult+0.5,sinP1n,dMult);} |
489d5531 | 1025 | } |
1026 | ||
1027 | // 2-particle: | |
1028 | Double_t sinP1nP1n = 0.; // <<sin(n*(phi1+phi2))>> | |
1029 | Double_t sinP2nM1n = 0.; // <<sin(n*(2phi1-phi2))>> | |
1030 | if(dMult>1) | |
1031 | { | |
3b552efe | 1032 | sinP1nP1n = (2.*dReQ1n*dImQ1n-dImQ2n)/(dMult*(dMult-1)); |
489d5531 | 1033 | sinP2nM1n = (dImQ2n*dReQ1n-dReQ2n*dImQ1n-dImQ1n)/(dMult*(dMult-1)); |
1034 | ||
1035 | // average non-weighted 2-particle correction (sin terms) for non-uniform acceptance for single event: | |
1036 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(2,sinP1nP1n); | |
3b552efe | 1037 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(4,sinP2nM1n); |
0328db2d | 1038 | // event weights for NUA terms: |
1039 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(2,dMult*(dMult-1)); | |
1040 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(4,dMult*(dMult-1)); | |
489d5531 | 1041 | |
1042 | // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
1043 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(1.5,sinP1nP1n,dMult*(dMult-1)); | |
1044 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(3.5,sinP2nM1n,dMult*(dMult-1)); | |
b3dacf6b | 1045 | if(fCalculateCumulantsVsM) |
1046 | { | |
1047 | fIntFlowCorrectionTermsForNUAVsMPro[0][1]->Fill(dMult+0.5,sinP1nP1n,dMult*(dMult-1)); | |
1048 | fIntFlowCorrectionTermsForNUAVsMPro[0][3]->Fill(dMult+0.5,sinP2nM1n,dMult*(dMult-1)); | |
1049 | } | |
489d5531 | 1050 | } |
1051 | ||
1052 | // 3-particle: | |
1053 | Double_t sinP1nM1nM1n = 0.; // <<sin(n*(phi1-phi2-phi3))>> | |
1054 | ||
1055 | if(dMult>2) | |
1056 | { | |
1057 | sinP1nM1nM1n = (-dImQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))+dReQ1n*dImQ2n-dImQ1n*dReQ2n+2.*(dMult-1)*dImQ1n) | |
1058 | / (dMult*(dMult-1)*(dMult-2)); | |
1059 | ||
1060 | // average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for single event: | |
1061 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(3,sinP1nM1nM1n); | |
0328db2d | 1062 | // event weights for NUA terms: |
1063 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(3,dMult*(dMult-1)*(dMult-2)); | |
489d5531 | 1064 | |
1065 | // final average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for all events: | |
2001bc3a | 1066 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(2.5,sinP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); |
b3dacf6b | 1067 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[0][2]->Fill(dMult+0.5,sinP1nM1nM1n,dMult*(dMult-1)*(dMult-2));} |
489d5531 | 1068 | } |
1069 | ||
1070 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTerms() | |
1071 | ||
1072 | ||
1073 | //================================================================================================================================ | |
1074 | ||
1075 | ||
1076 | void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos) | |
1077 | { | |
1078 | // a) Get pointers for common control and common result histograms and profiles. | |
1079 | // b) Get pointers for histograms with particle weights. | |
1080 | // c) Get pointers for histograms and profiles relevant for integrated flow. | |
1081 | // d) Get pointers for histograms and profiles relevant for differental flow. | |
1082 | // e) Get pointers for histograms and profiles holding results obtained with nested loops. | |
1083 | ||
1084 | if(outputListHistos) | |
3b552efe | 1085 | { |
1086 | this->SetHistList(outputListHistos); | |
1087 | if(!fHistList) | |
1088 | { | |
1089 | cout<<endl; | |
1090 | cout<<" WARNING (QC): fHistList is NULL in AFAWQC::GOH() !!!!"<<endl; | |
1091 | cout<<endl; | |
1092 | exit(0); | |
489d5531 | 1093 | } |
1094 | this->GetPointersForCommonHistograms(); | |
1095 | this->GetPointersForParticleWeightsHistograms(); | |
1096 | this->GetPointersForIntFlowHistograms(); | |
1097 | this->GetPointersForDiffFlowHistograms(); | |
1098 | this->GetPointersForNestedLoopsHistograms(); | |
3b552efe | 1099 | } else |
1100 | { | |
1101 | cout<<endl; | |
1102 | cout<<" WARNING (QC): outputListHistos is NULL in AFAWQC::GOH() !!!!"<<endl; | |
1103 | cout<<endl; | |
1104 | exit(0); | |
489d5531 | 1105 | } |
1106 | ||
1107 | } // end of void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos) | |
ad87ae62 | 1108 | |
1109 | ||
489d5531 | 1110 | //================================================================================================================================ |
1111 | ||
1112 | ||
1113 | TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) const | |
ad87ae62 | 1114 | { |
489d5531 | 1115 | // project 2D profile onto pt axis to get 1D profile |
1116 | ||
1117 | Int_t nBinsPt = profilePtEta->GetNbinsX(); | |
1118 | Double_t dPtMin = (profilePtEta->GetXaxis())->GetXmin(); | |
1119 | Double_t dPtMax = (profilePtEta->GetXaxis())->GetXmax(); | |
1120 | ||
1121 | Int_t nBinsEta = profilePtEta->GetNbinsY(); | |
1122 | ||
1123 | TProfile *profilePt = new TProfile("","",nBinsPt,dPtMin,dPtMax); | |
1124 | ||
1125 | for(Int_t p=1;p<=nBinsPt;p++) | |
1126 | { | |
1127 | Double_t contentPt = 0.; | |
1128 | Double_t entryPt = 0.; | |
1129 | Double_t spreadPt = 0.; | |
1130 | Double_t sum1 = 0.; | |
1131 | Double_t sum2 = 0.; | |
1132 | Double_t sum3 = 0.; | |
1133 | for(Int_t e=1;e<=nBinsEta;e++) | |
1134 | { | |
1135 | contentPt += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))) | |
1136 | * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1137 | entryPt += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1138 | ||
1139 | sum1 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))) | |
1140 | * (pow(profilePtEta->GetBinError(profilePtEta->GetBin(p,e)),2.) | |
1141 | + pow(profilePtEta->GetBinContent(profilePtEta->GetBin(p,e)),2.)); | |
1142 | sum2 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1143 | sum3 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))) | |
1144 | * (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))); | |
1145 | } | |
1146 | if(sum2>0. && sum1/sum2-pow(sum3/sum2,2.) > 0.) | |
1147 | { | |
1148 | spreadPt = pow(sum1/sum2-pow(sum3/sum2,2.),0.5); | |
1149 | } | |
1150 | profilePt->SetBinContent(p,contentPt); | |
1151 | profilePt->SetBinEntries(p,entryPt); | |
1152 | { | |
1153 | profilePt->SetBinError(p,spreadPt); | |
1154 | } | |
1155 | ||
1156 | } | |
1157 | ||
1158 | return profilePt; | |
1159 | ||
1160 | } // end of TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) | |
1161 | ||
1162 | ||
1163 | //================================================================================================================================ | |
1164 | ||
1165 | ||
1166 | TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) const | |
1167 | { | |
1168 | // project 2D profile onto eta axis to get 1D profile | |
1169 | ||
1170 | Int_t nBinsEta = profilePtEta->GetNbinsY(); | |
1171 | Double_t dEtaMin = (profilePtEta->GetYaxis())->GetXmin(); | |
1172 | Double_t dEtaMax = (profilePtEta->GetYaxis())->GetXmax(); | |
1173 | ||
1174 | Int_t nBinsPt = profilePtEta->GetNbinsX(); | |
1175 | ||
1176 | TProfile *profileEta = new TProfile("","",nBinsEta,dEtaMin,dEtaMax); | |
1177 | ||
1178 | for(Int_t e=1;e<=nBinsEta;e++) | |
1179 | { | |
1180 | Double_t contentEta = 0.; | |
1181 | Double_t entryEta = 0.; | |
1182 | for(Int_t p=1;p<=nBinsPt;p++) | |
1183 | { | |
1184 | contentEta += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))) | |
1185 | * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1186 | entryEta += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1187 | } | |
1188 | profileEta->SetBinContent(e,contentEta); | |
1189 | profileEta->SetBinEntries(e,entryEta); | |
1190 | } | |
1191 | ||
1192 | return profileEta; | |
1193 | ||
1194 | } // end of TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) | |
1195 | ||
489d5531 | 1196 | //================================================================================================================================ |
1197 | ||
489d5531 | 1198 | void AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type) |
1199 | { | |
2001bc3a | 1200 | // Printing on the screen the final results for integrated flow (RF, POI and RP). |
489d5531 | 1201 | |
1202 | Int_t n = fHarmonic; | |
1203 | ||
489d5531 | 1204 | Double_t dVn[4] = {0.}; // array to hold Vn{2}, Vn{4}, Vn{6} and Vn{8} |
1205 | Double_t dVnErr[4] = {0.}; // array to hold errors of Vn{2}, Vn{4}, Vn{6} and Vn{8} | |
1206 | ||
2001bc3a | 1207 | if(type == "RF") |
489d5531 | 1208 | { |
0dd3b008 | 1209 | for(Int_t b=0;b<4;b++) |
1210 | { | |
1211 | dVn[b] = fIntFlow->GetBinContent(b+1); | |
1212 | dVnErr[b] = fIntFlow->GetBinError(b+1); | |
1213 | } | |
489d5531 | 1214 | } else if(type == "RP") |
1215 | { | |
1216 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinContent(1); | |
1217 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinError(1); | |
1218 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinContent(1); | |
1219 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinError(1); | |
1220 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinContent(1); | |
1221 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinError(1); | |
1222 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinContent(1); | |
1223 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinError(1); | |
1224 | } else if(type == "POI") | |
1225 | { | |
1226 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinContent(1); | |
1227 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinError(1); | |
1228 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinContent(1); | |
1229 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinError(1); | |
1230 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinContent(1); | |
1231 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinError(1); | |
1232 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinContent(1); | |
1233 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinError(1); | |
b3dacf6b | 1234 | } else if(type == "RF, rebinned in M") |
1235 | { | |
0dd3b008 | 1236 | for(Int_t b=0;b<4;b++) |
1237 | { | |
1238 | dVn[b] = fIntFlowRebinnedInM->GetBinContent(b+1); | |
1239 | dVnErr[b] = fIntFlowRebinnedInM->GetBinError(b+1); | |
1240 | } | |
b3dacf6b | 1241 | } |
489d5531 | 1242 | |
1243 | TString title = " flow estimates from Q-cumulants"; | |
1244 | TString subtitle = " ("; | |
b3dacf6b | 1245 | TString subtitle2 = " (rebinned in M)"; |
489d5531 | 1246 | |
b3dacf6b | 1247 | if(type != "RF, rebinned in M") |
489d5531 | 1248 | { |
b3dacf6b | 1249 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) |
1250 | { | |
1251 | subtitle.Append(type); | |
1252 | subtitle.Append(", without weights)"); | |
1253 | } else | |
1254 | { | |
1255 | subtitle.Append(type); | |
1256 | subtitle.Append(", with weights)"); | |
1257 | } | |
1258 | } else | |
489d5531 | 1259 | { |
b3dacf6b | 1260 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) |
1261 | { | |
1262 | subtitle.Append("RF"); | |
1263 | subtitle.Append(", without weights)"); | |
1264 | } else | |
1265 | { | |
1266 | subtitle.Append("RF"); | |
1267 | subtitle.Append(", with weights)"); | |
1268 | } | |
1269 | } | |
1270 | ||
489d5531 | 1271 | cout<<endl; |
1272 | cout<<"*************************************"<<endl; | |
1273 | cout<<"*************************************"<<endl; | |
1274 | cout<<title.Data()<<endl; | |
1275 | cout<<subtitle.Data()<<endl; | |
b3dacf6b | 1276 | if(type == "RF, rebinned in M"){cout<<subtitle2.Data()<<endl;} |
489d5531 | 1277 | cout<<endl; |
1278 | ||
1279 | for(Int_t i=0;i<4;i++) | |
1280 | { | |
2001bc3a | 1281 | cout<<" v_"<<n<<"{"<<2*(i+1)<<"} = "<<dVn[i]<<" +/- "<<dVnErr[i]<<endl; |
489d5531 | 1282 | } |
2001bc3a | 1283 | |
489d5531 | 1284 | cout<<endl; |
2001bc3a | 1285 | |
b3dacf6b | 1286 | if(type == "RF" || type == "RF, rebinned in M") |
489d5531 | 1287 | { |
2001bc3a | 1288 | cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultRP()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultRP()->GetMean()<<endl; |
489d5531 | 1289 | } |
1290 | else if (type == "RP") | |
1291 | { | |
2001bc3a | 1292 | cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultRP()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultRP()->GetMean()<<endl; |
489d5531 | 1293 | } |
1294 | else if (type == "POI") | |
1295 | { | |
2001bc3a | 1296 | cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultPOI()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultPOI()->GetMean()<<endl; |
1297 | } | |
1298 | ||
489d5531 | 1299 | cout<<"*************************************"<<endl; |
1300 | cout<<"*************************************"<<endl; | |
1301 | cout<<endl; | |
1302 | ||
2001bc3a | 1303 | }// end of AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type="RF"); |
489d5531 | 1304 | |
1305 | //================================================================================================================================ | |
1306 | ||
489d5531 | 1307 | void AliFlowAnalysisWithQCumulants::WriteHistograms(TString outputFileName) |
1308 | { | |
1309 | //store the final results in output .root file | |
1310 | TFile *output = new TFile(outputFileName.Data(),"RECREATE"); | |
1311 | //output->WriteObject(fHistList, "cobjQC","SingleKey"); | |
1312 | fHistList->Write(fHistList->GetName(), TObject::kSingleKey); | |
1313 | delete output; | |
1314 | } | |
1315 | ||
1316 | ||
1317 | //================================================================================================================================ | |
1318 | ||
1319 | ||
1320 | void AliFlowAnalysisWithQCumulants::WriteHistograms(TDirectoryFile *outputFileName) | |
1321 | { | |
1322 | //store the final results in output .root file | |
1323 | fHistList->SetName("cobjQC"); | |
1324 | fHistList->SetOwner(kTRUE); | |
1325 | outputFileName->Add(fHistList); | |
1326 | outputFileName->Write(outputFileName->GetName(), TObject::kSingleKey); | |
1327 | } | |
1328 | ||
1329 | ||
1330 | //================================================================================================================================ | |
1331 | ||
1332 | ||
1333 | void AliFlowAnalysisWithQCumulants::BookCommonHistograms() | |
1334 | { | |
1335 | // Book common control histograms and common histograms for final results. | |
1336 | // common control histogram (ALL events) | |
1337 | TString commonHistsName = "AliFlowCommonHistQC"; | |
1338 | commonHistsName += fAnalysisLabel->Data(); | |
1339 | fCommonHists = new AliFlowCommonHist(commonHistsName.Data()); | |
1340 | fHistList->Add(fCommonHists); | |
1341 | // common control histogram (for events with 2 and more particles) | |
1342 | TString commonHists2ndOrderName = "AliFlowCommonHist2ndOrderQC"; | |
1343 | commonHists2ndOrderName += fAnalysisLabel->Data(); | |
1344 | fCommonHists2nd = new AliFlowCommonHist(commonHists2ndOrderName.Data()); | |
1345 | fHistList->Add(fCommonHists2nd); | |
1346 | // common control histogram (for events with 4 and more particles) | |
1347 | TString commonHists4thOrderName = "AliFlowCommonHist4thOrderQC"; | |
1348 | commonHists4thOrderName += fAnalysisLabel->Data(); | |
1349 | fCommonHists4th = new AliFlowCommonHist(commonHists4thOrderName.Data()); | |
1350 | fHistList->Add(fCommonHists4th); | |
1351 | // common control histogram (for events with 6 and more particles) | |
1352 | TString commonHists6thOrderName = "AliFlowCommonHist6thOrderQC"; | |
1353 | commonHists6thOrderName += fAnalysisLabel->Data(); | |
1354 | fCommonHists6th = new AliFlowCommonHist(commonHists6thOrderName.Data()); | |
1355 | fHistList->Add(fCommonHists6th); | |
1356 | // common control histogram (for events with 8 and more particles) | |
1357 | TString commonHists8thOrderName = "AliFlowCommonHist8thOrderQC"; | |
1358 | commonHists8thOrderName += fAnalysisLabel->Data(); | |
1359 | fCommonHists8th = new AliFlowCommonHist(commonHists8thOrderName.Data()); | |
1360 | fHistList->Add(fCommonHists8th); | |
1361 | // common histograms for final results (calculated for events with 2 and more particles) | |
1362 | TString commonHistResults2ndOrderName = "AliFlowCommonHistResults2ndOrderQC"; | |
1363 | commonHistResults2ndOrderName += fAnalysisLabel->Data(); | |
1364 | fCommonHistsResults2nd = new AliFlowCommonHistResults(commonHistResults2ndOrderName.Data()); | |
1365 | fHistList->Add(fCommonHistsResults2nd); | |
1366 | // common histograms for final results (calculated for events with 4 and more particles) | |
1367 | TString commonHistResults4thOrderName = "AliFlowCommonHistResults4thOrderQC"; | |
1368 | commonHistResults4thOrderName += fAnalysisLabel->Data(); | |
1369 | fCommonHistsResults4th = new AliFlowCommonHistResults(commonHistResults4thOrderName.Data()); | |
1370 | fHistList->Add(fCommonHistsResults4th); | |
1371 | // common histograms for final results (calculated for events with 6 and more particles) | |
1372 | TString commonHistResults6thOrderName = "AliFlowCommonHistResults6thOrderQC"; | |
1373 | commonHistResults6thOrderName += fAnalysisLabel->Data(); | |
1374 | fCommonHistsResults6th = new AliFlowCommonHistResults(commonHistResults6thOrderName.Data()); | |
1375 | fHistList->Add(fCommonHistsResults6th); | |
1376 | // common histograms for final results (calculated for events with 8 and more particles) | |
1377 | TString commonHistResults8thOrderName = "AliFlowCommonHistResults8thOrderQC"; | |
1378 | commonHistResults8thOrderName += fAnalysisLabel->Data(); | |
1379 | fCommonHistsResults8th = new AliFlowCommonHistResults(commonHistResults8thOrderName.Data()); | |
1380 | fHistList->Add(fCommonHistsResults8th); | |
1381 | ||
1382 | } // end of void AliFlowAnalysisWithQCumulants::BookCommonHistograms() | |
1383 | ||
1384 | ||
1385 | //================================================================================================================================ | |
1386 | ||
1387 | ||
1388 | void AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms() | |
1389 | { | |
1390 | // book and fill histograms which hold phi, pt and eta weights | |
1391 | ||
1392 | if(!fWeightsList) | |
1393 | { | |
1394 | cout<<"WARNING: fWeightsList is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1395 | exit(0); | |
1396 | } | |
1397 | ||
1398 | TString fUseParticleWeightsName = "fUseParticleWeightsQC"; | |
1399 | fUseParticleWeightsName += fAnalysisLabel->Data(); | |
1400 | fUseParticleWeights = new TProfile(fUseParticleWeightsName.Data(),"0 = particle weight not used, 1 = particle weight used ",3,0,3); | |
1401 | fUseParticleWeights->SetLabelSize(0.06); | |
1402 | (fUseParticleWeights->GetXaxis())->SetBinLabel(1,"w_{#phi}"); | |
1403 | (fUseParticleWeights->GetXaxis())->SetBinLabel(2,"w_{p_{T}}"); | |
1404 | (fUseParticleWeights->GetXaxis())->SetBinLabel(3,"w_{#eta}"); | |
1405 | fUseParticleWeights->Fill(0.5,(Int_t)fUsePhiWeights); | |
1406 | fUseParticleWeights->Fill(1.5,(Int_t)fUsePtWeights); | |
1407 | fUseParticleWeights->Fill(2.5,(Int_t)fUseEtaWeights); | |
1408 | fWeightsList->Add(fUseParticleWeights); | |
1409 | ||
1410 | if(fUsePhiWeights) | |
1411 | { | |
1412 | if(fWeightsList->FindObject("phi_weights")) | |
1413 | { | |
1414 | fPhiWeights = dynamic_cast<TH1F*>(fWeightsList->FindObject("phi_weights")); | |
1415 | if(TMath::Abs(fPhiWeights->GetBinWidth(1)-fPhiBinWidth)>pow(10.,-6.)) | |
1416 | { | |
1417 | cout<<endl; | |
1418 | cout<<"WARNING (QC): Inconsistent binning in histograms for phi-weights throughout the code."<<endl; | |
1419 | cout<<endl; | |
6fbbbbf1 | 1420 | //exit(0); |
489d5531 | 1421 | } |
1422 | } else | |
1423 | { | |
1424 | cout<<"WARNING: fWeightsList->FindObject(\"phi_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1425 | exit(0); | |
1426 | } | |
1427 | } // end of if(fUsePhiWeights) | |
1428 | ||
1429 | if(fUsePtWeights) | |
1430 | { | |
1431 | if(fWeightsList->FindObject("pt_weights")) | |
1432 | { | |
1433 | fPtWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("pt_weights")); | |
1434 | if(TMath::Abs(fPtWeights->GetBinWidth(1)-fPtBinWidth)>pow(10.,-6.)) | |
1435 | { | |
1436 | cout<<endl; | |
1437 | cout<<"WARNING (QC): Inconsistent binning in histograms for pt-weights throughout the code."<<endl; | |
1438 | cout<<endl; | |
6fbbbbf1 | 1439 | //exit(0); |
489d5531 | 1440 | } |
1441 | } else | |
1442 | { | |
1443 | cout<<"WARNING: fWeightsList->FindObject(\"pt_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1444 | exit(0); | |
1445 | } | |
1446 | } // end of if(fUsePtWeights) | |
1447 | ||
1448 | if(fUseEtaWeights) | |
1449 | { | |
1450 | if(fWeightsList->FindObject("eta_weights")) | |
1451 | { | |
1452 | fEtaWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("eta_weights")); | |
1453 | if(TMath::Abs(fEtaWeights->GetBinWidth(1)-fEtaBinWidth)>pow(10.,-6.)) | |
1454 | { | |
1455 | cout<<endl; | |
1456 | cout<<"WARNING (QC): Inconsistent binning in histograms for eta-weights throughout the code."<<endl; | |
1457 | cout<<endl; | |
6fbbbbf1 | 1458 | //exit(0); |
489d5531 | 1459 | } |
1460 | } else | |
1461 | { | |
1462 | cout<<"WARNING: fUseEtaWeights && fWeightsList->FindObject(\"eta_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1463 | exit(0); | |
1464 | } | |
1465 | } // end of if(fUseEtaWeights) | |
1466 | ||
1467 | } // end of AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms() | |
1468 | ||
1469 | ||
1470 | //================================================================================================================================ | |
1471 | ||
1472 | ||
1473 | void AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow() | |
1474 | { | |
1475 | // Book all objects for integrated flow: | |
1476 | // a) Book profile to hold all flags for integrated flow. | |
1477 | // b) Book event-by-event quantities. | |
1478 | // c) Book profiles. // to be improved (comment) | |
1479 | // d) Book histograms holding the final results. | |
1480 | ||
1481 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?) | |
1482 | TString powerFlag[2] = {"linear","quadratic"}; // to be improved (should I promote this to data members?) | |
1483 | ||
1484 | // a) Book profile to hold all flags for integrated flow: | |
1485 | TString intFlowFlagsName = "fIntFlowFlags"; | |
1486 | intFlowFlagsName += fAnalysisLabel->Data(); | |
0dd3b008 | 1487 | fIntFlowFlags = new TProfile(intFlowFlagsName.Data(),"Flags for Integrated Flow",11,0,11); |
489d5531 | 1488 | fIntFlowFlags->SetTickLength(-0.01,"Y"); |
1489 | fIntFlowFlags->SetMarkerStyle(25); | |
1490 | fIntFlowFlags->SetLabelSize(0.05); | |
1491 | fIntFlowFlags->SetLabelOffset(0.02,"Y"); | |
1492 | fIntFlowFlags->GetXaxis()->SetBinLabel(1,"Particle Weights"); | |
1493 | fIntFlowFlags->GetXaxis()->SetBinLabel(2,"Event Weights"); | |
1494 | fIntFlowFlags->GetXaxis()->SetBinLabel(3,"Corrected for NUA?"); | |
b3dacf6b | 1495 | fIntFlowFlags->GetXaxis()->SetBinLabel(4,"Print RF results"); |
489d5531 | 1496 | fIntFlowFlags->GetXaxis()->SetBinLabel(5,"Print RP results"); |
3b552efe | 1497 | fIntFlowFlags->GetXaxis()->SetBinLabel(6,"Print POI results"); |
b3dacf6b | 1498 | fIntFlowFlags->GetXaxis()->SetBinLabel(7,"Print RF (rebinned in M) results"); |
1499 | fIntFlowFlags->GetXaxis()->SetBinLabel(8,"Corrected for NUA vs M?"); | |
1500 | fIntFlowFlags->GetXaxis()->SetBinLabel(9,"Propagate errors to v_{n} from correlations?"); | |
1501 | fIntFlowFlags->GetXaxis()->SetBinLabel(10,"Calculate cumulants vs M"); | |
0dd3b008 | 1502 | fIntFlowFlags->GetXaxis()->SetBinLabel(11,"fMinimumBiasReferenceFlow"); |
489d5531 | 1503 | fIntFlowList->Add(fIntFlowFlags); |
1504 | ||
1505 | // b) Book event-by-event quantities: | |
1506 | // Re[Q_{m*n,k}], Im[Q_{m*n,k}] and S_{p,k}^M: | |
1507 | fReQ = new TMatrixD(4,9); | |
1508 | fImQ = new TMatrixD(4,9); | |
1509 | fSMpk = new TMatrixD(8,9); | |
1510 | // average correlations <2>, <4>, <6> and <8> for single event (bining is the same as in fIntFlowCorrelationsPro and fIntFlowCorrelationsHist): | |
1511 | TString intFlowCorrelationsEBEName = "fIntFlowCorrelationsEBE"; | |
1512 | intFlowCorrelationsEBEName += fAnalysisLabel->Data(); | |
1513 | fIntFlowCorrelationsEBE = new TH1D(intFlowCorrelationsEBEName.Data(),intFlowCorrelationsEBEName.Data(),4,0,4); | |
1514 | // weights for average correlations <2>, <4>, <6> and <8> for single event: | |
1515 | TString intFlowEventWeightsForCorrelationsEBEName = "fIntFlowEventWeightsForCorrelationsEBE"; | |
1516 | intFlowEventWeightsForCorrelationsEBEName += fAnalysisLabel->Data(); | |
1517 | fIntFlowEventWeightsForCorrelationsEBE = new TH1D(intFlowEventWeightsForCorrelationsEBEName.Data(),intFlowEventWeightsForCorrelationsEBEName.Data(),4,0,4); | |
1518 | // average all correlations for single event (bining is the same as in fIntFlowCorrelationsAllPro and fIntFlowCorrelationsAllHist): | |
1519 | TString intFlowCorrelationsAllEBEName = "fIntFlowCorrelationsAllEBE"; | |
1520 | intFlowCorrelationsAllEBEName += fAnalysisLabel->Data(); | |
1521 | fIntFlowCorrelationsAllEBE = new TH1D(intFlowCorrelationsAllEBEName.Data(),intFlowCorrelationsAllEBEName.Data(),32,0,32); | |
1522 | // average correction terms for non-uniform acceptance for single event | |
1523 | // (binning is the same as in fIntFlowCorrectionTermsForNUAPro[2] and fIntFlowCorrectionTermsForNUAHist[2]): | |
1524 | TString fIntFlowCorrectionTermsForNUAEBEName = "fIntFlowCorrectionTermsForNUAEBE"; | |
1525 | fIntFlowCorrectionTermsForNUAEBEName += fAnalysisLabel->Data(); | |
1526 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
1527 | { | |
1528 | fIntFlowCorrectionTermsForNUAEBE[sc] = new TH1D(Form("%s: %s terms",fIntFlowCorrectionTermsForNUAEBEName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),10,0,10); | |
1529 | } | |
0328db2d | 1530 | // event weights for terms for non-uniform acceptance: |
1531 | TString fIntFlowEventWeightForCorrectionTermsForNUAEBEName = "fIntFlowEventWeightForCorrectionTermsForNUAEBE"; | |
1532 | fIntFlowEventWeightForCorrectionTermsForNUAEBEName += fAnalysisLabel->Data(); | |
1533 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
1534 | { | |
1535 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc] = new TH1D(Form("%s: %s terms",fIntFlowEventWeightForCorrectionTermsForNUAEBEName.Data(),sinCosFlag[sc].Data()),Form("Event weights for terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),10,0,10); | |
1536 | } | |
489d5531 | 1537 | // c) Book profiles: // to be improved (comment) |
1538 | // profile to hold average multiplicities and number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8: | |
1539 | TString avMultiplicityName = "fAvMultiplicity"; | |
1540 | avMultiplicityName += fAnalysisLabel->Data(); | |
1541 | fAvMultiplicity = new TProfile(avMultiplicityName.Data(),"Average Multiplicities of RPs",9,0,9); | |
1542 | fAvMultiplicity->SetTickLength(-0.01,"Y"); | |
1543 | fAvMultiplicity->SetMarkerStyle(25); | |
1544 | fAvMultiplicity->SetLabelSize(0.05); | |
1545 | fAvMultiplicity->SetLabelOffset(0.02,"Y"); | |
1546 | fAvMultiplicity->SetYTitle("Average Multiplicity"); | |
1547 | (fAvMultiplicity->GetXaxis())->SetBinLabel(1,"all evts"); | |
1548 | (fAvMultiplicity->GetXaxis())->SetBinLabel(2,"n_{RP} #geq 1"); | |
1549 | (fAvMultiplicity->GetXaxis())->SetBinLabel(3,"n_{RP} #geq 2"); | |
1550 | (fAvMultiplicity->GetXaxis())->SetBinLabel(4,"n_{RP} #geq 3"); | |
1551 | (fAvMultiplicity->GetXaxis())->SetBinLabel(5,"n_{RP} #geq 4"); | |
1552 | (fAvMultiplicity->GetXaxis())->SetBinLabel(6,"n_{RP} #geq 5"); | |
1553 | (fAvMultiplicity->GetXaxis())->SetBinLabel(7,"n_{RP} #geq 6"); | |
1554 | (fAvMultiplicity->GetXaxis())->SetBinLabel(8,"n_{RP} #geq 7"); | |
1555 | (fAvMultiplicity->GetXaxis())->SetBinLabel(9,"n_{RP} #geq 8"); | |
1556 | fIntFlowProfiles->Add(fAvMultiplicity); | |
1557 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with wrong errors!): | |
b3dacf6b | 1558 | TString correlationFlag[4] = {"<<2>>","<<4>>","<<6>>","<<8>>"}; |
489d5531 | 1559 | TString intFlowCorrelationsProName = "fIntFlowCorrelationsPro"; |
1560 | intFlowCorrelationsProName += fAnalysisLabel->Data(); | |
1561 | fIntFlowCorrelationsPro = new TProfile(intFlowCorrelationsProName.Data(),"Average correlations for all events",4,0,4,"s"); | |
1562 | fIntFlowCorrelationsPro->SetTickLength(-0.01,"Y"); | |
1563 | fIntFlowCorrelationsPro->SetMarkerStyle(25); | |
1564 | fIntFlowCorrelationsPro->SetLabelSize(0.06); | |
1565 | fIntFlowCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
68a3b4b1 | 1566 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 1567 | { |
68a3b4b1 | 1568 | (fIntFlowCorrelationsPro->GetXaxis())->SetBinLabel(b+1,correlationFlag[b].Data()); |
b3dacf6b | 1569 | } |
489d5531 | 1570 | fIntFlowProfiles->Add(fIntFlowCorrelationsPro); |
b3dacf6b | 1571 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> versus multiplicity for all events (with wrong errors): |
1572 | if(fCalculateCumulantsVsM) | |
1573 | { | |
1574 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
1575 | { | |
1576 | TString intFlowCorrelationsVsMProName = "fIntFlowCorrelationsVsMPro"; | |
1577 | intFlowCorrelationsVsMProName += fAnalysisLabel->Data(); | |
1578 | fIntFlowCorrelationsVsMPro[ci] = new TProfile(Form("%s, %s",intFlowCorrelationsVsMProName.Data(),correlationFlag[ci].Data()), | |
1579 | Form("%s vs multiplicity",correlationFlag[ci].Data()), | |
1580 | fnBinsMult,fMinMult,fMaxMult,"s"); | |
1581 | fIntFlowCorrelationsVsMPro[ci]->GetYaxis()->SetTitle(correlationFlag[ci].Data()); | |
1582 | fIntFlowCorrelationsVsMPro[ci]->GetXaxis()->SetTitle("M"); | |
1583 | fIntFlowProfiles->Add(fIntFlowCorrelationsVsMPro[ci]); | |
1584 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
1585 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 1586 | // averaged all correlations for all events (with wrong errors!): |
1587 | TString intFlowCorrelationsAllProName = "fIntFlowCorrelationsAllPro"; | |
1588 | intFlowCorrelationsAllProName += fAnalysisLabel->Data(); | |
1589 | fIntFlowCorrelationsAllPro = new TProfile(intFlowCorrelationsAllProName.Data(),"Average correlations for all events",32,0,32,"s"); | |
1590 | fIntFlowCorrelationsAllPro->SetTickLength(-0.01,"Y"); | |
1591 | fIntFlowCorrelationsAllPro->SetMarkerStyle(25); | |
1592 | fIntFlowCorrelationsAllPro->SetLabelSize(0.03); | |
1593 | fIntFlowCorrelationsAllPro->SetLabelOffset(0.01,"Y"); | |
1594 | // 2-p correlations: | |
1595 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(1,"<<2>>_{n|n}"); | |
1596 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(2,"<<2>>_{2n|2n}"); | |
1597 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(3,"<<2>>_{3n|3n}"); | |
1598 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(4,"<<2>>_{4n|4n}"); | |
1599 | // 3-p correlations: | |
1600 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(6,"<<3>>_{2n|n,n}"); | |
1601 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}"); | |
1602 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}"); | |
1603 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}"); | |
1604 | // 4-p correlations: | |
1605 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}"); | |
1606 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}"); | |
1607 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}"); | |
1608 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}"); | |
1609 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}"); | |
1610 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}"); | |
1611 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}"); | |
1612 | // 5-p correlations: | |
1613 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}"); | |
1614 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}"); | |
1615 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}"); | |
1616 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}"); | |
1617 | // 6-p correlations: | |
1618 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}"); | |
1619 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}"); | |
1620 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}"); | |
1621 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}"); | |
1622 | // 7-p correlations: | |
1623 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}"); | |
1624 | // 8-p correlations: | |
1625 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}"); | |
1626 | fIntFlowProfiles->Add(fIntFlowCorrelationsAllPro); | |
1627 | // when particle weights are used some extra correlations appear: | |
1628 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
1629 | { | |
1630 | TString intFlowExtraCorrelationsProName = "fIntFlowExtraCorrelationsPro"; | |
1631 | intFlowExtraCorrelationsProName += fAnalysisLabel->Data(); | |
1632 | fIntFlowExtraCorrelationsPro = new TProfile(intFlowExtraCorrelationsProName.Data(),"Average extra correlations for all events",100,0,100,"s"); | |
1633 | fIntFlowExtraCorrelationsPro->SetTickLength(-0.01,"Y"); | |
1634 | fIntFlowExtraCorrelationsPro->SetMarkerStyle(25); | |
1635 | fIntFlowExtraCorrelationsPro->SetLabelSize(0.03); | |
1636 | fIntFlowExtraCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
1637 | // extra 2-p correlations: | |
1638 | (fIntFlowExtraCorrelationsPro->GetXaxis())->SetBinLabel(1,"<<w1^3 w2 cos(n*(phi1-phi2))>>"); | |
1639 | (fIntFlowExtraCorrelationsPro->GetXaxis())->SetBinLabel(2,"<<w1 w2 w3^2 cos(n*(phi1-phi2))>>"); | |
1640 | fIntFlowProfiles->Add(fIntFlowExtraCorrelationsPro); | |
1641 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
1642 | // average product of correlations <2>, <4>, <6> and <8>: | |
b3dacf6b | 1643 | TString productFlag[6] = {"<<2><4>>","<<2><6>>","<<2><8>>","<<4><6>>","<<4><8>>","<<6><8>>"}; |
489d5531 | 1644 | TString intFlowProductOfCorrelationsProName = "fIntFlowProductOfCorrelationsPro"; |
1645 | intFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
1646 | fIntFlowProductOfCorrelationsPro = new TProfile(intFlowProductOfCorrelationsProName.Data(),"Average products of correlations",6,0,6); | |
1647 | fIntFlowProductOfCorrelationsPro->SetTickLength(-0.01,"Y"); | |
1648 | fIntFlowProductOfCorrelationsPro->SetMarkerStyle(25); | |
1649 | fIntFlowProductOfCorrelationsPro->SetLabelSize(0.05); | |
1650 | fIntFlowProductOfCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
68a3b4b1 | 1651 | for(Int_t b=0;b<6;b++) |
b3dacf6b | 1652 | { |
68a3b4b1 | 1653 | (fIntFlowProductOfCorrelationsPro->GetXaxis())->SetBinLabel(b+1,productFlag[b].Data()); |
b3dacf6b | 1654 | } |
1655 | fIntFlowProfiles->Add(fIntFlowProductOfCorrelationsPro); | |
ff70ca91 | 1656 | // average product of correlations <2>, <4>, <6> and <8> versus multiplicity |
1657 | // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>] | |
b3dacf6b | 1658 | if(fCalculateCumulantsVsM) |
1659 | { | |
1660 | TString intFlowProductOfCorrelationsVsMProName = "fIntFlowProductOfCorrelationsVsMPro"; | |
1661 | intFlowProductOfCorrelationsVsMProName += fAnalysisLabel->Data(); | |
1662 | for(Int_t pi=0;pi<6;pi++) | |
1663 | { | |
1664 | fIntFlowProductOfCorrelationsVsMPro[pi] = new TProfile(Form("%s, %s",intFlowProductOfCorrelationsVsMProName.Data(),productFlag[pi].Data()), | |
1665 | Form("%s versus multiplicity",productFlag[pi].Data()), | |
1666 | fnBinsMult,fMinMult,fMaxMult); | |
1667 | fIntFlowProductOfCorrelationsVsMPro[pi]->GetXaxis()->SetTitle("M"); | |
1668 | fIntFlowProfiles->Add(fIntFlowProductOfCorrelationsVsMPro[pi]); | |
1669 | } // end of for(Int_t pi=0;pi<6;pi++) | |
1670 | } // end of if(fCalculateCumulantsVsM) | |
0328db2d | 1671 | // average product of correction terms for NUA: |
1672 | TString intFlowProductOfCorrectionTermsForNUAProName = "fIntFlowProductOfCorrectionTermsForNUAPro"; | |
1673 | intFlowProductOfCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
1674 | fIntFlowProductOfCorrectionTermsForNUAPro = new TProfile(intFlowProductOfCorrectionTermsForNUAProName.Data(),"Average products of correction terms for NUA",27,0,27); | |
1675 | fIntFlowProductOfCorrectionTermsForNUAPro->SetTickLength(-0.01,"Y"); | |
1676 | fIntFlowProductOfCorrectionTermsForNUAPro->SetMarkerStyle(25); | |
1677 | fIntFlowProductOfCorrectionTermsForNUAPro->SetLabelSize(0.05); | |
1678 | fIntFlowProductOfCorrectionTermsForNUAPro->SetLabelOffset(0.01,"Y"); | |
1679 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(1,"<<2><cos(#phi)>>"); | |
1680 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(2,"<<2><sin(#phi)>>"); | |
1681 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(3,"<<cos(#phi)><sin(#phi)>>"); | |
1682 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(4,"Cov(<2>,<cos(#phi_{1}+#phi_{2})>)"); | |
1683 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(5,"Cov(<2>,<sin(#phi_{1}+#phi_{2})>)"); | |
1684 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(6,"Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1685 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(7,"Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1686 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(8,"Cov(<4>,<cos(#phi)>)"); | |
1687 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(9,"Cov(<4>,<sin(#phi)>)"); | |
1688 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(10,"Cov(<4>,<cos(#phi_{1}+#phi_{2})>)"); | |
1689 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(11,"Cov(<4>,<sin(#phi_{1}+#phi_{2})>)"); | |
1690 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(12,"Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
1691 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(13,"Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
1692 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(14,"Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
1693 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(15,"Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
1694 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(16,"Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1695 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(17,"Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1696 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(18,"Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
1697 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(19,"Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
1698 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(20,"Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1699 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(21,"Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1700 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(22,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>)"); | |
1701 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(23,"Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1702 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(24,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1703 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(25,"Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1704 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(26,"Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1705 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(27,"Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>)"); | |
1706 | fIntFlowProfiles->Add(fIntFlowProductOfCorrectionTermsForNUAPro); | |
489d5531 | 1707 | // average correction terms for non-uniform acceptance (with wrong errors!): |
1708 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
1709 | { | |
1710 | TString intFlowCorrectionTermsForNUAProName = "fIntFlowCorrectionTermsForNUAPro"; | |
1711 | intFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
1712 | fIntFlowCorrectionTermsForNUAPro[sc] = new TProfile(Form("%s: %s terms",intFlowCorrectionTermsForNUAProName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),10,0,10,"s"); | |
1713 | fIntFlowCorrectionTermsForNUAPro[sc]->SetTickLength(-0.01,"Y"); | |
1714 | fIntFlowCorrectionTermsForNUAPro[sc]->SetMarkerStyle(25); | |
1715 | fIntFlowCorrectionTermsForNUAPro[sc]->SetLabelSize(0.03); | |
1716 | fIntFlowCorrectionTermsForNUAPro[sc]->SetLabelOffset(0.01,"Y"); | |
1717 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(1,Form("<<%s(n(phi1))>>",sinCosFlag[sc].Data())); | |
1718 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(2,Form("<<%s(n(phi1+phi2))>>",sinCosFlag[sc].Data())); | |
1719 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(3,Form("<<%s(n(phi1-phi2-phi3))>>",sinCosFlag[sc].Data())); | |
1720 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(4,Form("<<%s(n(2phi1-phi2))>>",sinCosFlag[sc].Data())); | |
1721 | fIntFlowProfiles->Add(fIntFlowCorrectionTermsForNUAPro[sc]); | |
2001bc3a | 1722 | // versus multiplicity: |
b3dacf6b | 1723 | if(fCalculateCumulantsVsM) |
1724 | { | |
1725 | TString correctionTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4 | |
1726 | for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) | |
1727 | { | |
1728 | TString intFlowCorrectionTermsForNUAVsMProName = "fIntFlowCorrectionTermsForNUAVsMPro"; | |
1729 | intFlowCorrectionTermsForNUAVsMProName += fAnalysisLabel->Data(); | |
1730 | fIntFlowCorrectionTermsForNUAVsMPro[sc][ci] = new TProfile(Form("%s: #LT#LT%s%s#GT#GT",intFlowCorrectionTermsForNUAVsMProName.Data(),sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()),Form("#LT#LT%s%s#GT#GT vs M",sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()),fnBinsMult,fMinMult,fMaxMult,"s"); | |
1731 | fIntFlowProfiles->Add(fIntFlowCorrectionTermsForNUAVsMPro[sc][ci]); | |
1732 | } | |
1733 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 1734 | } // end of for(Int_t sc=0;sc<2;sc++) |
1735 | ||
1736 | // d) Book histograms holding the final results: | |
1737 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with correct errors!): | |
1738 | TString intFlowCorrelationsHistName = "fIntFlowCorrelationsHist"; | |
1739 | intFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
1740 | fIntFlowCorrelationsHist = new TH1D(intFlowCorrelationsHistName.Data(),"Average correlations for all events",4,0,4); | |
1741 | fIntFlowCorrelationsHist->SetTickLength(-0.01,"Y"); | |
1742 | fIntFlowCorrelationsHist->SetMarkerStyle(25); | |
1743 | fIntFlowCorrelationsHist->SetLabelSize(0.06); | |
1744 | fIntFlowCorrelationsHist->SetLabelOffset(0.01,"Y"); | |
1745 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(1,"<<2>>"); | |
1746 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(2,"<<4>>"); | |
1747 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(3,"<<6>>"); | |
1748 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(4,"<<8>>"); | |
1749 | fIntFlowResults->Add(fIntFlowCorrelationsHist); | |
ff70ca91 | 1750 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with correct errors!) vs M: |
b3dacf6b | 1751 | if(fCalculateCumulantsVsM) |
1752 | { | |
1753 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
1754 | { | |
1755 | TString intFlowCorrelationsVsMHistName = "fIntFlowCorrelationsVsMHist"; | |
1756 | intFlowCorrelationsVsMHistName += fAnalysisLabel->Data(); | |
1757 | fIntFlowCorrelationsVsMHist[ci] = new TH1D(Form("%s, %s",intFlowCorrelationsVsMHistName.Data(),correlationFlag[ci].Data()), | |
1758 | Form("%s vs multiplicity",correlationFlag[ci].Data()), | |
1759 | fnBinsMult,fMinMult,fMaxMult); | |
1760 | fIntFlowCorrelationsVsMHist[ci]->GetYaxis()->SetTitle(correlationFlag[ci].Data()); | |
1761 | fIntFlowCorrelationsVsMHist[ci]->GetXaxis()->SetTitle("M"); | |
1762 | fIntFlowResults->Add(fIntFlowCorrelationsVsMHist[ci]); | |
1763 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
1764 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 1765 | // average all correlations for all events (with correct errors!): |
1766 | TString intFlowCorrelationsAllHistName = "fIntFlowCorrelationsAllHist"; | |
1767 | intFlowCorrelationsAllHistName += fAnalysisLabel->Data(); | |
1768 | fIntFlowCorrelationsAllHist = new TH1D(intFlowCorrelationsAllHistName.Data(),"Average correlations for all events",32,0,32); | |
1769 | fIntFlowCorrelationsAllHist->SetTickLength(-0.01,"Y"); | |
1770 | fIntFlowCorrelationsAllHist->SetMarkerStyle(25); | |
1771 | fIntFlowCorrelationsAllHist->SetLabelSize(0.03); | |
1772 | fIntFlowCorrelationsAllHist->SetLabelOffset(0.01,"Y"); | |
1773 | // 2-p correlations: | |
1774 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(1,"<<2>>_{n|n}"); | |
1775 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(2,"<<2>>_{2n|2n}"); | |
1776 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(3,"<<2>>_{3n|3n}"); | |
1777 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(4,"<<2>>_{4n|4n}"); | |
1778 | // 3-p correlations: | |
1779 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(6,"<<3>>_{2n|n,n}"); | |
1780 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}"); | |
1781 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}"); | |
1782 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}"); | |
1783 | // 4-p correlations: | |
1784 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}"); | |
1785 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}"); | |
1786 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}"); | |
1787 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}"); | |
1788 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}"); | |
1789 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}"); | |
1790 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}"); | |
1791 | // 5-p correlations: | |
1792 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}"); | |
1793 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}"); | |
1794 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}"); | |
1795 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}"); | |
1796 | // 6-p correlations: | |
1797 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}"); | |
1798 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}"); | |
1799 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}"); | |
1800 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}"); | |
1801 | // 7-p correlations: | |
1802 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}"); | |
1803 | // 8-p correlations: | |
1804 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}"); | |
1805 | fIntFlowResults->Add(fIntFlowCorrelationsAllHist); | |
1806 | // average correction terms for non-uniform acceptance (with correct errors!): | |
1807 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
1808 | { | |
1809 | TString intFlowCorrectionTermsForNUAHistName = "fIntFlowCorrectionTermsForNUAHist"; | |
1810 | intFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
1811 | fIntFlowCorrectionTermsForNUAHist[sc] = new TH1D(Form("%s: %s terms",intFlowCorrectionTermsForNUAHistName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),10,0,10); | |
1812 | fIntFlowCorrectionTermsForNUAHist[sc]->SetTickLength(-0.01,"Y"); | |
1813 | fIntFlowCorrectionTermsForNUAHist[sc]->SetMarkerStyle(25); | |
1814 | fIntFlowCorrectionTermsForNUAHist[sc]->SetLabelSize(0.03); | |
1815 | fIntFlowCorrectionTermsForNUAHist[sc]->SetLabelOffset(0.01,"Y"); | |
1816 | // ......................................................................... | |
1817 | // 1-p terms: | |
1818 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(1,Form("%s(n(#phi_{1}))>",sinCosFlag[sc].Data())); | |
1819 | // 2-p terms: | |
1820 | // 3-p terms: | |
1821 | // ... | |
1822 | // ......................................................................... | |
1823 | fIntFlowResults->Add(fIntFlowCorrectionTermsForNUAHist[sc]); | |
1824 | } // end of for(Int_t sc=0;sc<2;sc++) | |
1825 | // covariances (multiplied with weight dependent prefactor): | |
1826 | TString intFlowCovariancesName = "fIntFlowCovariances"; | |
1827 | intFlowCovariancesName += fAnalysisLabel->Data(); | |
1828 | fIntFlowCovariances = new TH1D(intFlowCovariancesName.Data(),"Covariances (multiplied with weight dependent prefactor)",6,0,6); | |
1829 | fIntFlowCovariances->SetLabelSize(0.04); | |
1830 | fIntFlowCovariances->SetMarkerStyle(25); | |
1831 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(1,"Cov(<2>,<4>)"); | |
1832 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(2,"Cov(<2>,<6>)"); | |
1833 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(3,"Cov(<2>,<8>)"); | |
1834 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(4,"Cov(<4>,<6>)"); | |
1835 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(5,"Cov(<4>,<8>)"); | |
1836 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(6,"Cov(<6>,<8>)"); | |
1837 | fIntFlowResults->Add(fIntFlowCovariances); | |
1838 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8>: | |
1839 | TString intFlowSumOfEventWeightsName = "fIntFlowSumOfEventWeights"; | |
1840 | intFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
1841 | for(Int_t power=0;power<2;power++) | |
1842 | { | |
1843 | fIntFlowSumOfEventWeights[power] = new TH1D(Form("%s: %s",intFlowSumOfEventWeightsName.Data(),powerFlag[power].Data()),Form("Sum of %s event weights for correlations",powerFlag[power].Data()),4,0,4); | |
1844 | fIntFlowSumOfEventWeights[power]->SetLabelSize(0.05); | |
1845 | fIntFlowSumOfEventWeights[power]->SetMarkerStyle(25); | |
1846 | if(power == 0) | |
1847 | { | |
1848 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>}"); | |
1849 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<4>}"); | |
1850 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<6>}"); | |
1851 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{<8>}"); | |
1852 | } else if (power == 1) | |
1853 | { | |
1854 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>}^{2}"); | |
1855 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<4>}^{2}"); | |
1856 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<6>}^{2}"); | |
1857 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{<8>}^{2}"); | |
1858 | } | |
1859 | fIntFlowResults->Add(fIntFlowSumOfEventWeights[power]); | |
1860 | } | |
1861 | // sum of products of event weights for correlations <2>, <4>, <6> and <8>: | |
1862 | TString intFlowSumOfProductOfEventWeightsName = "fIntFlowSumOfProductOfEventWeights"; | |
1863 | intFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
1864 | fIntFlowSumOfProductOfEventWeights = new TH1D(intFlowSumOfProductOfEventWeightsName.Data(),"Sum of product of event weights for correlations",6,0,6); | |
1865 | fIntFlowSumOfProductOfEventWeights->SetLabelSize(0.05); | |
1866 | fIntFlowSumOfProductOfEventWeights->SetMarkerStyle(25); | |
1867 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>} w_{<4>}"); | |
1868 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<2>} w_{<6>}"); | |
1869 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<2>} w_{<8>}"); | |
1870 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{<4>} w_{<6>}"); | |
1871 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(5,"#sum_{i=1}^{N} w_{<4>} w_{<8>}"); | |
1872 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(6,"#sum_{i=1}^{N} w_{<6>} w_{<8>}"); | |
1873 | fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeights); | |
ff70ca91 | 1874 | // final result for covariances of correlations (multiplied with weight dependent prefactor) versus M |
1875 | // [0=Cov(2,4),1=Cov(2,6),2=Cov(2,8),3=Cov(4,6),4=Cov(4,8),5=Cov(6,8)]: | |
b3dacf6b | 1876 | if(fCalculateCumulantsVsM) |
ff70ca91 | 1877 | { |
b3dacf6b | 1878 | TString intFlowCovariancesVsMName = "fIntFlowCovariancesVsM"; |
1879 | intFlowCovariancesVsMName += fAnalysisLabel->Data(); | |
1880 | TString covarianceFlag[6] = {"Cov(<2>,<4>)","Cov(<2>,<6>)","Cov(<2>,<8>)","Cov(<4>,<6>)","Cov(<4>,<8>)","Cov(<6>,<8>)"}; | |
1881 | for(Int_t ci=0;ci<6;ci++) | |
1882 | { | |
1883 | fIntFlowCovariancesVsM[ci] = new TH1D(Form("%s, %s",intFlowCovariancesVsMName.Data(),covarianceFlag[ci].Data()), | |
1884 | Form("%s vs multiplicity",covarianceFlag[ci].Data()), | |
1885 | fnBinsMult,fMinMult,fMaxMult); | |
1886 | fIntFlowCovariancesVsM[ci]->GetYaxis()->SetTitle(covarianceFlag[ci].Data()); | |
1887 | fIntFlowCovariancesVsM[ci]->GetXaxis()->SetTitle("M"); | |
1888 | fIntFlowResults->Add(fIntFlowCovariancesVsM[ci]); | |
1889 | } | |
1890 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 1891 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8> versus multiplicity |
1892 | // [0=sum{w_{<2>}},1=sum{w_{<4>}},2=sum{w_{<6>}},3=sum{w_{<8>}}][0=linear 1,1=quadratic]: | |
b3dacf6b | 1893 | if(fCalculateCumulantsVsM) |
ff70ca91 | 1894 | { |
b3dacf6b | 1895 | TString intFlowSumOfEventWeightsVsMName = "fIntFlowSumOfEventWeightsVsM"; |
1896 | intFlowSumOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
1897 | TString sumFlag[2][4] = {{"#sum_{i=1}^{N} w_{<2>}","#sum_{i=1}^{N} w_{<4>}","#sum_{i=1}^{N} w_{<6>}","#sum_{i=1}^{N} w_{<8>}"}, | |
1898 | {"#sum_{i=1}^{N} w_{<2>}^{2}","#sum_{i=1}^{N} w_{<4>}^{2}","#sum_{i=1}^{N} w_{<6>}^{2}","#sum_{i=1}^{N} w_{<8>}^{2}"}}; | |
1899 | for(Int_t si=0;si<4;si++) | |
ff70ca91 | 1900 | { |
b3dacf6b | 1901 | for(Int_t power=0;power<2;power++) |
1902 | { | |
1903 | fIntFlowSumOfEventWeightsVsM[si][power] = new TH1D(Form("%s, %s",intFlowSumOfEventWeightsVsMName.Data(),sumFlag[power][si].Data()), | |
1904 | Form("%s vs multiplicity",sumFlag[power][si].Data()), | |
1905 | fnBinsMult,fMinMult,fMaxMult); | |
1906 | fIntFlowSumOfEventWeightsVsM[si][power]->GetYaxis()->SetTitle(sumFlag[power][si].Data()); | |
1907 | fIntFlowSumOfEventWeightsVsM[si][power]->GetXaxis()->SetTitle("M"); | |
1908 | fIntFlowResults->Add(fIntFlowSumOfEventWeightsVsM[si][power]); | |
1909 | } // end of for(Int_t power=0;power<2;power++) | |
1910 | } // end of for(Int_t si=0;si<4;si++) | |
1911 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 1912 | // sum of products of event weights for correlations <2>, <4>, <6> and <8> vs M |
1913 | // [0=sum{w_{<2>}w_{<4>}},1=sum{w_{<2>}w_{<6>}},2=sum{w_{<2>}w_{<8>}}, | |
1914 | // 3=sum{w_{<4>}w_{<6>}},4=sum{w_{<4>}w_{<8>}},5=sum{w_{<6>}w_{<8>}}]: | |
b3dacf6b | 1915 | if(fCalculateCumulantsVsM) |
1916 | { | |
1917 | TString intFlowSumOfProductOfEventWeightsVsMName = "fIntFlowSumOfProductOfEventWeightsVsM"; | |
1918 | intFlowSumOfProductOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
1919 | TString sopowFlag[6] = {"#sum_{i=1}^{N} w_{<2>} w_{<4>}","#sum_{i=1}^{N} w_{<2>} w_{<6>}","#sum_{i=1}^{N} w_{<2>} w_{<8>}", | |
1920 | "#sum_{i=1}^{N} w_{<4>} w_{<6>}","#sum_{i=1}^{N} w_{<4>} w_{<8>}","#sum_{i=1}^{N} w_{<6>} w_{<8>}"}; | |
1921 | for(Int_t pi=0;pi<6;pi++) | |
1922 | { | |
1923 | fIntFlowSumOfProductOfEventWeightsVsM[pi] = new TH1D(Form("%s, %s",intFlowSumOfProductOfEventWeightsVsMName.Data(),sopowFlag[pi].Data()), | |
1924 | Form("%s versus multiplicity",sopowFlag[pi].Data()), | |
1925 | fnBinsMult,fMinMult,fMaxMult); | |
1926 | fIntFlowSumOfProductOfEventWeightsVsM[pi]->GetXaxis()->SetTitle("M"); | |
1927 | fIntFlowSumOfProductOfEventWeightsVsM[pi]->GetYaxis()->SetTitle(sopowFlag[pi].Data()); | |
1928 | fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeightsVsM[pi]); | |
1929 | } // end of for(Int_t pi=0;pi<6;pi++) | |
1930 | } // end of if(fCalculateCumulantsVsM) | |
0328db2d | 1931 | // covariances of NUA terms (multiplied with weight dependent prefactor): |
1932 | TString intFlowCovariancesNUAName = "fIntFlowCovariancesNUA"; | |
1933 | intFlowCovariancesNUAName += fAnalysisLabel->Data(); | |
1934 | fIntFlowCovariancesNUA = new TH1D(intFlowCovariancesNUAName.Data(),"Covariances for NUA (multiplied with weight dependent prefactor)",27,0,27); | |
1935 | fIntFlowCovariancesNUA->SetLabelSize(0.04); | |
1936 | fIntFlowCovariancesNUA->SetMarkerStyle(25); | |
1937 | fIntFlowCovariancesNUA->GetXaxis()->SetLabelSize(0.02); | |
1938 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(1,"Cov(<2>,<cos(#phi)>"); | |
1939 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(2,"Cov(<2>,<sin(#phi)>)"); | |
1940 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(3,"Cov(<cos(#phi)>,<sin(#phi)>)"); | |
1941 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(4,"Cov(<2>,<cos(#phi_{1}+#phi_{2})>)"); | |
1942 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(5,"Cov(<2>,<sin(#phi_{1}+#phi_{2})>)"); | |
1943 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(6,"Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1944 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(7,"Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1945 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(8,"Cov(<4>,<cos(#phi)>)"); | |
1946 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(9,"Cov(<4>,<sin(#phi)>)"); | |
1947 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(10,"Cov(<4>,<cos(#phi_{1}+#phi_{2})>)"); | |
1948 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(11,"Cov(<4>,<sin(#phi_{1}+#phi_{2})>)"); | |
1949 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(12,"Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
1950 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(13,"Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
1951 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(14,"Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
1952 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(15,"Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
1953 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(16,"Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1954 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(17,"Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1955 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(18,"Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
1956 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(19,"Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
1957 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(20,"Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1958 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(21,"Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1959 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(22,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>)"); | |
1960 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(23,"Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1961 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(24,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1962 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(25,"Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1963 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(26,"Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
1964 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(27,"Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>)"); | |
1965 | fIntFlowResults->Add(fIntFlowCovariancesNUA); | |
1966 | // sum of linear and quadratic event weights for NUA terms: | |
1967 | TString intFlowSumOfEventWeightsNUAName = "fIntFlowSumOfEventWeightsNUA"; | |
1968 | intFlowSumOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
1969 | for(Int_t sc=0;sc<2;sc++) | |
1970 | { | |
1971 | for(Int_t power=0;power<2;power++) | |
1972 | { | |
1973 | fIntFlowSumOfEventWeightsNUA[sc][power] = new TH1D(Form("%s: %s, %s",intFlowSumOfEventWeightsNUAName.Data(),powerFlag[power].Data(),sinCosFlag[sc].Data()),Form("Sum of %s event weights for NUA %s terms",powerFlag[power].Data(),sinCosFlag[sc].Data()),3,0,3); | |
1974 | fIntFlowSumOfEventWeightsNUA[sc][power]->SetLabelSize(0.05); | |
1975 | fIntFlowSumOfEventWeightsNUA[sc][power]->SetMarkerStyle(25); | |
1976 | if(power == 0) | |
1977 | { | |
1978 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(1,Form("#sum_{i=1}^{N} w_{<%s(#phi)>}",sinCosFlag[sc].Data())); | |
1979 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(2,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}+#phi_{2})>}",sinCosFlag[sc].Data())); | |
1980 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(3,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}-#phi_{2}-#phi_{3})>}",sinCosFlag[sc].Data())); | |
1981 | } else if(power == 1) | |
1982 | { | |
1983 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(1,Form("#sum_{i=1}^{N} w_{<%s(#phi)>}^{2}",sinCosFlag[sc].Data())); | |
1984 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(2,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}+#phi_{2})>}^{2}",sinCosFlag[sc].Data())); | |
1985 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(3,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}-#phi_{2}-#phi_{3})>}^{2}",sinCosFlag[sc].Data())); | |
1986 | } | |
1987 | fIntFlowResults->Add(fIntFlowSumOfEventWeightsNUA[sc][power]); | |
1988 | } | |
1989 | } | |
1990 | // sum of products of event weights for NUA terms: | |
1991 | TString intFlowSumOfProductOfEventWeightsNUAName = "fIntFlowSumOfProductOfEventWeightsNUA"; | |
1992 | intFlowSumOfProductOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
1993 | fIntFlowSumOfProductOfEventWeightsNUA = new TH1D(intFlowSumOfProductOfEventWeightsNUAName.Data(),"Sum of product of event weights for NUA terms",27,0,27); | |
1994 | fIntFlowSumOfProductOfEventWeightsNUA->SetLabelSize(0.05); | |
1995 | fIntFlowSumOfProductOfEventWeightsNUA->SetMarkerStyle(25); | |
1996 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>} w_{<cos(#phi)>}"); | |
1997 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<2>} w_{<sin(#phi)>}"); | |
1998 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<cos(#phi)>} w_{<sin(#phi)>}"); | |
1999 | // .... | |
2000 | // to be improved - add labels for remaining bins | |
2001 | // .... | |
2002 | fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeightsNUA); | |
b3dacf6b | 2003 | // Final results for reference Q-cumulants: |
2004 | TString cumulantFlag[4] = {"QC{2}","QC{4}","QC{6}","QC{8}"}; | |
489d5531 | 2005 | TString intFlowQcumulantsName = "fIntFlowQcumulants"; |
2006 | intFlowQcumulantsName += fAnalysisLabel->Data(); | |
2007 | fIntFlowQcumulants = new TH1D(intFlowQcumulantsName.Data(),"Integrated Q-cumulants",4,0,4); | |
2008 | fIntFlowQcumulants->SetLabelSize(0.05); | |
2009 | fIntFlowQcumulants->SetMarkerStyle(25); | |
68a3b4b1 | 2010 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2011 | { |
68a3b4b1 | 2012 | (fIntFlowQcumulants->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data()); |
b3dacf6b | 2013 | } |
489d5531 | 2014 | fIntFlowResults->Add(fIntFlowQcumulants); |
b3dacf6b | 2015 | // Final results for reference Q-cumulants rebinned in M: |
2016 | if(fCalculateCumulantsVsM) | |
2017 | { | |
2018 | TString intFlowQcumulantsRebinnedInMName = "fIntFlowQcumulantsRebinnedInM"; | |
2019 | intFlowQcumulantsRebinnedInMName += fAnalysisLabel->Data(); | |
2020 | fIntFlowQcumulantsRebinnedInM = new TH1D(intFlowQcumulantsRebinnedInMName.Data(),"Reference Q-cumulants rebinned in M",4,0,4); | |
2021 | fIntFlowQcumulantsRebinnedInM->SetLabelSize(0.05); | |
2022 | fIntFlowQcumulantsRebinnedInM->SetMarkerStyle(25); | |
68a3b4b1 | 2023 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2024 | { |
68a3b4b1 | 2025 | (fIntFlowQcumulantsRebinnedInM->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data()); |
b3dacf6b | 2026 | } |
2027 | fIntFlowResults->Add(fIntFlowQcumulantsRebinnedInM); | |
2028 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 2029 | // final results for integrated Q-cumulants versus multiplicity: |
b3dacf6b | 2030 | if(fCalculateCumulantsVsM) |
2031 | { | |
2032 | TString intFlowQcumulantsVsMName = "fIntFlowQcumulantsVsM"; | |
2033 | intFlowQcumulantsVsMName += fAnalysisLabel->Data(); | |
2034 | for(Int_t co=0;co<4;co++) // cumulant order | |
2035 | { | |
2036 | fIntFlowQcumulantsVsM[co] = new TH1D(Form("%s, %s",intFlowQcumulantsVsMName.Data(),cumulantFlag[co].Data()), | |
2037 | Form("%s vs multipicity",cumulantFlag[co].Data()), | |
2038 | fnBinsMult,fMinMult,fMaxMult); | |
2039 | fIntFlowQcumulantsVsM[co]->GetXaxis()->SetTitle("M"); | |
2040 | fIntFlowQcumulantsVsM[co]->GetYaxis()->SetTitle(cumulantFlag[co].Data()); | |
2041 | fIntFlowResults->Add(fIntFlowQcumulantsVsM[co]); | |
2042 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
2043 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 2044 | // final integrated flow estimates from Q-cumulants: |
b3dacf6b | 2045 | TString flowFlag[4] = {Form("v_{%d}{2,QC}",fHarmonic),Form("v_{%d}{4,QC}",fHarmonic),Form("v_{%d}{6,QC}",fHarmonic),Form("v_{%d}{8,QC}",fHarmonic)}; |
489d5531 | 2046 | TString intFlowName = "fIntFlow"; |
2047 | intFlowName += fAnalysisLabel->Data(); | |
2048 | // integrated flow from Q-cumulants: | |
b3dacf6b | 2049 | fIntFlow = new TH1D(intFlowName.Data(),"Reference flow estimates from Q-cumulants",4,0,4); |
489d5531 | 2050 | fIntFlow->SetLabelSize(0.05); |
2051 | fIntFlow->SetMarkerStyle(25); | |
68a3b4b1 | 2052 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2053 | { |
68a3b4b1 | 2054 | (fIntFlow->GetXaxis())->SetBinLabel(b+1,flowFlag[b].Data()); |
b3dacf6b | 2055 | } |
ff70ca91 | 2056 | fIntFlowResults->Add(fIntFlow); |
b3dacf6b | 2057 | // Reference flow vs M rebinned in one huge bin: |
2058 | if(fCalculateCumulantsVsM) | |
2059 | { | |
2060 | TString intFlowRebinnedInMName = "fIntFlowRebinnedInM"; | |
2061 | intFlowRebinnedInMName += fAnalysisLabel->Data(); | |
2062 | fIntFlowRebinnedInM = new TH1D(intFlowRebinnedInMName.Data(),"Reference flow estimates from Q-cumulants (rebinned in M)",4,0,4); | |
2063 | fIntFlowRebinnedInM->SetLabelSize(0.05); | |
2064 | fIntFlowRebinnedInM->SetMarkerStyle(25); | |
68a3b4b1 | 2065 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2066 | { |
68a3b4b1 | 2067 | (fIntFlowRebinnedInM->GetXaxis())->SetBinLabel(b+1,flowFlag[b].Data()); |
b3dacf6b | 2068 | } |
2069 | fIntFlowResults->Add(fIntFlowRebinnedInM); | |
2070 | } | |
ff70ca91 | 2071 | // integrated flow from Q-cumulants: versus multiplicity: |
b3dacf6b | 2072 | if(fCalculateCumulantsVsM) |
2073 | { | |
2074 | TString intFlowVsMName = "fIntFlowVsM"; | |
2075 | intFlowVsMName += fAnalysisLabel->Data(); | |
2076 | for(Int_t co=0;co<4;co++) // cumulant order | |
2077 | { | |
2078 | fIntFlowVsM[co] = new TH1D(Form("%s, %s",intFlowVsMName.Data(),flowFlag[co].Data()), | |
2079 | Form("%s vs multipicity",flowFlag[co].Data()), | |
2080 | fnBinsMult,fMinMult,fMaxMult); | |
2081 | fIntFlowVsM[co]->GetXaxis()->SetTitle("M"); | |
2082 | fIntFlowVsM[co]->GetYaxis()->SetTitle(flowFlag[co].Data()); | |
2083 | fIntFlowResults->Add(fIntFlowVsM[co]); | |
2084 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
2085 | } // end of if(fCalculateCumulantsVsM) | |
2001bc3a | 2086 | // quantifying detector effects effects to correlations: |
2087 | TString intFlowDetectorBiasName = "fIntFlowDetectorBias"; | |
2088 | intFlowDetectorBiasName += fAnalysisLabel->Data(); | |
2089 | fIntFlowDetectorBias = new TH1D(intFlowDetectorBiasName.Data(),"Quantifying detector bias",4,0,4); | |
2090 | fIntFlowDetectorBias->SetLabelSize(0.05); | |
2091 | fIntFlowDetectorBias->SetMarkerStyle(25); | |
2092 | for(Int_t ci=0;ci<4;ci++) | |
2093 | { | |
2094 | (fIntFlowDetectorBias->GetXaxis())->SetBinLabel(ci+1,Form("#frac{corrected}{measured} %s",cumulantFlag[ci].Data())); | |
2095 | } | |
2096 | fIntFlowResults->Add(fIntFlowDetectorBias); | |
2097 | // quantifying detector effects to correlations versus multiplicity: | |
b3dacf6b | 2098 | if(fCalculateCumulantsVsM) |
2001bc3a | 2099 | { |
b3dacf6b | 2100 | TString intFlowDetectorBiasVsMName = "fIntFlowDetectorBiasVsM"; |
2101 | intFlowDetectorBiasVsMName += fAnalysisLabel->Data(); | |
2102 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2103 | { | |
2104 | fIntFlowDetectorBiasVsM[ci] = new TH1D(Form("%s for %s",intFlowDetectorBiasVsMName.Data(),cumulantFlag[ci].Data()), | |
2105 | Form("Quantifying detector bias for %s vs multipicity",cumulantFlag[ci].Data()), | |
2106 | fnBinsMult,fMinMult,fMaxMult); | |
2107 | fIntFlowDetectorBiasVsM[ci]->GetXaxis()->SetTitle("M"); | |
2108 | fIntFlowDetectorBiasVsM[ci]->GetYaxis()->SetTitle("#frac{corrected}{measured}"); | |
2109 | if(fApplyCorrectionForNUAVsM){fIntFlowResults->Add(fIntFlowDetectorBiasVsM[ci]);} | |
2110 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
2111 | } // end of if(fCalculateCumulantsVsM) | |
2112 | ||
489d5531 | 2113 | /* // to be improved (removed): |
2114 | // final average weighted multi-particle correlations for all events calculated from Q-vectors | |
2115 | fQCorrelations[1] = new TProfile("Weighted correlations","final average multi-particle correlations from weighted Q-vectors",200,0,200,"s"); | |
2116 | fQCorrelations[1]->SetTickLength(-0.01,"Y"); | |
2117 | fQCorrelations[1]->SetMarkerStyle(25); | |
2118 | fQCorrelations[1]->SetLabelSize(0.03); | |
2119 | fQCorrelations[1]->SetLabelOffset(0.01,"Y"); | |
2120 | // 2-particle correlations: | |
2121 | (fQCorrelations[1]->GetXaxis())->SetBinLabel(1,"<w_{1}w_{2}cos(n(#phi_{1}-#phi_{2}))>"); | |
2122 | (fQCorrelations[1]->GetXaxis())->SetBinLabel(2,"<w_{1}^{2}w_{2}^{2}cos(2n(#phi_{1}-#phi_{2}))>"); | |
2123 | (fQCorrelations[1]->GetXaxis())->SetBinLabel(3,"<w_{1}^{3}w_{2}^{3}cos(3n(#phi_{1}-#phi_{2}))>"); | |
2124 | (fQCorrelations[1]->GetXaxis())->SetBinLabel(4,"<w_{1}^{4}w_{2}^{4}cos(4n(#phi_{1}-#phi_{2}))>"); | |
2125 | (fQCorrelations[1]->GetXaxis())->SetBinLabel(5,"<w_{1}^{3}w_{2}cos(n(#phi_{1}-#phi_{2}))>"); | |
2126 | (fQCorrelations[1]->GetXaxis())->SetBinLabel(6,"<w_{1}^{2}w_{2}w_{3}cos(n(#phi_{1}-#phi_{2}))>"); | |
2127 | // 3-particle correlations: | |
2128 | (fQCorrelations[1]->GetXaxis())->SetBinLabel(21,"<w_{1}w_{2}w_{3}^{2}cos(n(2#phi_{1}-#phi_{2}-#phi_{3}))>"); | |
2129 | // 4-particle correlations: | |
2130 | (fQCorrelations[1]->GetXaxis())->SetBinLabel(41,"<w_{1}w_{2}w_{3}w_{4}cos(n(#phi_{1}+#phi_{2}-#phi_{3}-#phi_{4}))>"); | |
2131 | // add fQCorrelations[1] to the list fIntFlowList: | |
2132 | fIntFlowList->Add(fQCorrelations[1]); | |
2133 | */ | |
2134 | ||
2135 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow() | |
2136 | ||
2137 | ||
2138 | //================================================================================================================================ | |
2139 | ||
2140 | ||
2141 | void AliFlowAnalysisWithQCumulants::InitializeArraysForNestedLoops() | |
2142 | { | |
2143 | // Initialize arrays of all objects relevant for calculations with nested loops. | |
2144 | ||
2145 | // integrated flow: | |
2146 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2147 | { | |
2148 | fIntFlowDirectCorrectionTermsForNUA[sc] = NULL; | |
2149 | } | |
2150 | ||
2151 | // differential flow: | |
2152 | // correlations: | |
2153 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
2154 | { | |
2155 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2156 | { | |
2157 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2158 | { | |
2159 | fDiffFlowDirectCorrelations[t][pe][ci] = NULL; | |
2160 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
2161 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2162 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
2163 | // correction terms for non-uniform acceptance: | |
2164 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
2165 | { | |
2166 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2167 | { | |
2168 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2169 | { | |
2170 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
2171 | { | |
2172 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = NULL; | |
2173 | } | |
2174 | } | |
2175 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2176 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
2177 | ||
2178 | ||
2179 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForNestedLoops() | |
2180 | ||
2181 | ||
2182 | //================================================================================================================================ | |
2183 | ||
2184 | ||
2185 | void AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops() | |
2186 | { | |
2187 | // Book all objects relevant for calculations with nested loops. | |
2188 | ||
2189 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?) | |
2190 | TString typeFlag[2] = {"RP","POI"}; // to be improved (should I promote this to data members?) | |
2191 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; // to be improved (should I promote this to data members?) | |
2192 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; // to be improved (should I promote this to data members?) | |
2193 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
2194 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
2195 | ||
2196 | TString evaluateNestedLoopsName = "fEvaluateNestedLoops"; | |
2197 | evaluateNestedLoopsName += fAnalysisLabel->Data(); | |
2198 | fEvaluateNestedLoops = new TProfile(evaluateNestedLoopsName.Data(),"Flags for nested loops",4,0,4); | |
2199 | fEvaluateNestedLoops->SetLabelSize(0.03); | |
2200 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(1,"fEvaluateIntFlowNestedLoops"); | |
2201 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(2,"fEvaluateDiffFlowNestedLoops"); | |
2202 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(3,"fCrossCheckInPtBinNo"); | |
2203 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(4,"fCrossCheckInEtaBinNo"); | |
2204 | fEvaluateNestedLoops->Fill(0.5,(Int_t)fEvaluateIntFlowNestedLoops); | |
2205 | fEvaluateNestedLoops->Fill(1.5,(Int_t)fEvaluateDiffFlowNestedLoops); | |
2206 | fEvaluateNestedLoops->Fill(2.5,fCrossCheckInPtBinNo); | |
2207 | fEvaluateNestedLoops->Fill(3.5,fCrossCheckInEtaBinNo); | |
2208 | fNestedLoopsList->Add(fEvaluateNestedLoops); | |
2209 | // nested loops for integrated flow: | |
2210 | if(fEvaluateIntFlowNestedLoops) | |
2211 | { | |
2212 | // correlations: | |
2213 | TString intFlowDirectCorrelationsName = "fIntFlowDirectCorrelations"; | |
2214 | intFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
2215 | fIntFlowDirectCorrelations = new TProfile(intFlowDirectCorrelationsName.Data(),"Multiparticle correlations calculated with nested loops (for int. flow)",32,0,32,"s"); | |
2216 | fNestedLoopsList->Add(fIntFlowDirectCorrelations); | |
2217 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
2218 | { | |
2219 | TString intFlowExtraDirectCorrelationsName = "fIntFlowExtraDirectCorrelations"; | |
2220 | intFlowExtraDirectCorrelationsName += fAnalysisLabel->Data(); | |
2221 | fIntFlowExtraDirectCorrelations = new TProfile(intFlowExtraDirectCorrelationsName.Data(),"Extra multiparticle correlations calculated with nested loops (for int. flow)",100,0,100,"s"); | |
2222 | fNestedLoopsList->Add(fIntFlowExtraDirectCorrelations); | |
2223 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
2224 | // correction terms for non-uniform acceptance: | |
2225 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2226 | { | |
2227 | TString intFlowDirectCorrectionTermsForNUAName = "fIntFlowDirectCorrectionTermsForNUA"; | |
2228 | intFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
2229 | fIntFlowDirectCorrectionTermsForNUA[sc] = new TProfile(Form("%s: %s terms",intFlowDirectCorrectionTermsForNUAName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),10,0,10,"s"); | |
2230 | fNestedLoopsList->Add(fIntFlowDirectCorrectionTermsForNUA[sc]); | |
2231 | } // end of for(Int_t sc=0;sc<2;sc++) | |
2232 | } // end of if(fEvaluateIntFlowNestedLoops) | |
2233 | ||
2234 | // nested loops for differential flow: | |
2235 | if(fEvaluateDiffFlowNestedLoops) | |
2236 | { | |
2237 | // reduced correlations: | |
2238 | TString diffFlowDirectCorrelationsName = "fDiffFlowDirectCorrelations"; | |
2239 | diffFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
2240 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
2241 | { | |
2242 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2243 | { | |
2244 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
2245 | { | |
2246 | // reduced correlations: | |
2247 | fDiffFlowDirectCorrelations[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe],"s"); | |
2248 | fDiffFlowDirectCorrelations[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data()); | |
2249 | fNestedLoopsList->Add(fDiffFlowDirectCorrelations[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations) | |
2250 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
2251 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2252 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
2253 | // correction terms for non-uniform acceptance: | |
2254 | TString diffFlowDirectCorrectionTermsForNUAName = "fDiffFlowDirectCorrectionTermsForNUA"; | |
2255 | diffFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
2256 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
2257 | { | |
2258 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2259 | { | |
2260 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
2261 | { | |
2262 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
2263 | { | |
2264 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = new TProfile(Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe],"s"); | |
2265 | fNestedLoopsList->Add(fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]); | |
2266 | } | |
2267 | } | |
2268 | } | |
3b552efe | 2269 | } |
2270 | // number of RPs and POIs in selected pt and eta bins for cross-checkings: | |
2271 | TString noOfParticlesInBinName = "fNoOfParticlesInBin"; | |
2272 | fNoOfParticlesInBin = new TH1D(noOfParticlesInBinName.Data(),"Number of RPs and POIs in selected p_{T} and #eta bin",4,0,4); | |
489d5531 | 2273 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(1,"# of RPs in p_{T} bin"); |
2274 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(2,"# of RPs in #eta bin"); | |
2275 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(3,"# of POIs in p_{T} bin"); | |
3b552efe | 2276 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(4,"# of POIs in #eta bin"); |
489d5531 | 2277 | fNestedLoopsList->Add(fNoOfParticlesInBin); |
2278 | } // end of if(fEvaluateDiffFlowNestedLoops) | |
2279 | ||
2280 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops() | |
2281 | ||
2282 | ||
2283 | //================================================================================================================================ | |
2284 | ||
2285 | ||
2286 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelations() | |
2287 | { | |
2288 | // calculate all correlations needed for integrated flow | |
57340a27 | 2289 | |
489d5531 | 2290 | // multiplicity: |
2291 | Double_t dMult = (*fSMpk)(0,0); | |
57340a27 | 2292 | |
489d5531 | 2293 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: |
2294 | Double_t dReQ1n = (*fReQ)(0,0); | |
2295 | Double_t dReQ2n = (*fReQ)(1,0); | |
2296 | Double_t dReQ3n = (*fReQ)(2,0); | |
2297 | Double_t dReQ4n = (*fReQ)(3,0); | |
2298 | Double_t dImQ1n = (*fImQ)(0,0); | |
2299 | Double_t dImQ2n = (*fImQ)(1,0); | |
2300 | Double_t dImQ3n = (*fImQ)(2,0); | |
2301 | Double_t dImQ4n = (*fImQ)(3,0); | |
2302 | ||
2303 | // real and imaginary parts of some expressions involving various combinations of Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
2304 | // (these expression appear in the Eqs. for the multi-particle correlations bellow) | |
2305 | ||
2306 | // Re[Q_{2n} Q_{n}^* Q_{n}^*] | |
2307 | Double_t reQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dReQ2n + 2.*dReQ1n*dImQ1n*dImQ2n - pow(dImQ1n,2.)*dReQ2n; | |
2308 | ||
2309 | // Im[Q_{2n} Q_{n}^* Q_{n}^*] | |
2310 | //Double_t imQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dImQ2n-2.*dReQ1n*dImQ1n*dReQ2n-pow(dImQ1n,2.)*dImQ2n; | |
2311 | ||
2312 | // Re[Q_{n} Q_{n} Q_{2n}^*] = Re[Q_{2n} Q_{n}^* Q_{n}^*] | |
2313 | Double_t reQ1nQ1nQ2nstar = reQ2nQ1nstarQ1nstar; | |
2314 | ||
2315 | // Re[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*] | |
2316 | Double_t reQ3nQ1nQ2nstarQ2nstar = (pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n) | |
2317 | + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n); | |
2318 | ||
2319 | // Im[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*] | |
2320 | //Double_t imQ3nQ1nQ2nstarQ2nstar = calculate and implement this (deleteMe) | |
2321 | ||
2322 | // Re[Q_{2n} Q_{2n} Q_{3n}^* Q_{1n}^*] = Re[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*] | |
2323 | Double_t reQ2nQ2nQ3nstarQ1nstar = reQ3nQ1nQ2nstarQ2nstar; | |
2324 | ||
2325 | // Re[Q_{4n} Q_{2n}^* Q_{2n}^*] | |
2326 | Double_t reQ4nQ2nstarQ2nstar = pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n; | |
2327 | ||
2328 | // Im[Q_{4n} Q_{2n}^* Q_{2n}^*] | |
2329 | //Double_t imQ4nQ2nstarQ2nstar = calculate and implement this (deleteMe) | |
2330 | ||
2331 | // Re[Q_{2n} Q_{2n} Q_{4n}^*] = Re[Q_{4n} Q_{2n}^* Q_{2n}^*] | |
2332 | Double_t reQ2nQ2nQ4nstar = reQ4nQ2nstarQ2nstar; | |
2333 | ||
2334 | // Re[Q_{4n} Q_{3n}^* Q_{n}^*] | |
2335 | Double_t reQ4nQ3nstarQ1nstar = dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n); | |
2336 | ||
2337 | // Re[Q_{3n} Q_{n} Q_{4n}^*] = Re[Q_{4n} Q_{3n}^* Q_{n}^*] | |
2338 | Double_t reQ3nQ1nQ4nstar = reQ4nQ3nstarQ1nstar; | |
2339 | ||
2340 | // Im[Q_{4n} Q_{3n}^* Q_{n}^*] | |
2341 | //Double_t imQ4nQ3nstarQ1nstar = calculate and implement this (deleteMe) | |
2342 | ||
2343 | // Re[Q_{3n} Q_{2n}^* Q_{n}^*] | |
2344 | Double_t reQ3nQ2nstarQ1nstar = dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n | |
2345 | + dImQ3n*dImQ2n*dReQ1n; | |
2346 | ||
2347 | // Re[Q_{2n} Q_{n} Q_{3n}^*] = Re[Q_{3n} Q_{2n}^* Q_{n}^*] | |
2348 | Double_t reQ2nQ1nQ3nstar = reQ3nQ2nstarQ1nstar; | |
2349 | ||
2350 | // Im[Q_{3n} Q_{2n}^* Q_{n}^*] | |
2351 | //Double_t imQ3nQ2nstarQ1nstar; //calculate and implement this (deleteMe) | |
2352 | ||
2353 | // Re[Q_{3n} Q_{n}^* Q_{n}^* Q_{n}^*] | |
2354 | Double_t reQ3nQ1nstarQ1nstarQ1nstar = dReQ3n*pow(dReQ1n,3)-3.*dReQ1n*dReQ3n*pow(dImQ1n,2) | |
2355 | + 3.*dImQ1n*dImQ3n*pow(dReQ1n,2)-dImQ3n*pow(dImQ1n,3); | |
2356 | ||
2357 | // Im[Q_{3n} Q_{n}^* Q_{n}^* Q_{n}^*] | |
2358 | //Double_t imQ3nQ1nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe) | |
2359 | ||
2360 | // |Q_{2n}|^2 |Q_{n}|^2 | |
2361 | Double_t dQ2nQ1nQ2nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
2362 | ||
2363 | // Re[Q_{4n} Q_{2n}^* Q_{n}^* Q_{n}^*] | |
2364 | Double_t reQ4nQ2nstarQ1nstarQ1nstar = (dReQ4n*dReQ2n+dImQ4n*dImQ2n)*(pow(dReQ1n,2)-pow(dImQ1n,2)) | |
2365 | + 2.*dReQ1n*dImQ1n*(dImQ4n*dReQ2n-dReQ4n*dImQ2n); | |
2366 | ||
2367 | // Im[Q_{4n} Q_{2n}^* Q_{n}^* Q_{n}^*] | |
2368 | //Double_t imQ4nQ2nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe) | |
2369 | ||
2370 | // Re[Q_{2n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^*] | |
2371 | Double_t reQ2nQ1nQ1nstarQ1nstarQ1nstar = (dReQ2n*dReQ1n-dImQ2n*dImQ1n)*(pow(dReQ1n,3)-3.*dReQ1n*pow(dImQ1n,2)) | |
2372 | + (dReQ2n*dImQ1n+dReQ1n*dImQ2n)*(3.*dImQ1n*pow(dReQ1n,2)-pow(dImQ1n,3)); | |
2373 | ||
2374 | // Im[Q_{2n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^*] | |
2375 | //Double_t imQ2nQ1nQ1nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe) | |
2376 | ||
2377 | // Re[Q_{2n} Q_{2n} Q_{2n}^* Q_{n}^* Q_{n}^*] | |
2378 | Double_t reQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2379 | * (dReQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) + 2.*dImQ2n*dReQ1n*dImQ1n); | |
2380 | ||
2381 | // Im[Q_{2n} Q_{2n} Q_{2n}^* Q_{n}^* Q_{n}^*] | |
2382 | //Double_t imQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2383 | // * (dImQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) - 2.*dReQ2n*dReQ1n*dImQ1n); | |
2384 | ||
2385 | // Re[Q_{4n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2386 | Double_t reQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dReQ4n-6.*pow(dReQ1n,2.)*dReQ4n*pow(dImQ1n,2.) | |
2387 | + pow(dImQ1n,4.)*dReQ4n+4.*pow(dReQ1n,3.)*dImQ1n*dImQ4n | |
2388 | - 4.*pow(dImQ1n,3.)*dReQ1n*dImQ4n; | |
2389 | ||
2390 | // Im[Q_{4n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2391 | //Double_t imQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dImQ4n-6.*pow(dReQ1n,2.)*dImQ4n*pow(dImQ1n,2.) | |
2392 | // + pow(dImQ1n,4.)*dImQ4n+4.*pow(dImQ1n,3.)*dReQ1n*dReQ4n | |
2393 | // - 4.*pow(dReQ1n,3.)*dImQ1n*dReQ4n; | |
2394 | ||
2395 | // Re[Q_{3n} Q_{n} Q_{2n}^* Q_{n}^* Q_{n}^*] | |
2396 | Double_t reQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2397 | * (dReQ1n*dReQ2n*dReQ3n-dReQ3n*dImQ1n*dImQ2n+dReQ2n*dImQ1n*dImQ3n+dReQ1n*dImQ2n*dImQ3n); | |
2398 | ||
2399 | // Im[Q_{3n} Q_{n} Q_{2n}^* Q_{n}^* Q_{n}^*] | |
2400 | //Double_t imQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2401 | // * (-dReQ2n*dReQ3n*dImQ1n-dReQ1n*dReQ3n*dImQ2n+dReQ1n*dReQ2n*dImQ3n-dImQ1n*dImQ2n*dImQ3n); | |
2402 | ||
2403 | ||
2404 | // Re[Q_{2n} Q_{2n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2405 | Double_t reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)*dReQ2n-2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.) | |
2406 | + dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dImQ2n) | |
2407 | * (pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.) | |
2408 | - dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n+pow(dImQ1n,2.)*dImQ2n); | |
2409 | ||
2410 | // Im[Q_{2n} Q_{2n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2411 | //Double_t imQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = 2.*(pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.) | |
2412 | // + 2.*dReQ1n*dImQ1n*dImQ2n)*(pow(dReQ1n,2.)*dImQ2n | |
2413 | // - 2.*dReQ1n*dImQ1n*dReQ2n-pow(dImQ1n,2.)*dImQ2n); | |
2414 | ||
2415 | // Re[Q_{3n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2416 | Double_t reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2417 | * (pow(dReQ1n,3.)*dReQ3n-3.*dReQ1n*dReQ3n*pow(dImQ1n,2.) | |
2418 | + 3.*pow(dReQ1n,2.)*dImQ1n*dImQ3n-pow(dImQ1n,3.)*dImQ3n); | |
2419 | ||
2420 | // Im[Q_{3n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2421 | //Double_t imQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2422 | // * (pow(dImQ1n,3.)*dReQ3n-3.*dImQ1n*dReQ3n*pow(dReQ1n,2.) | |
2423 | // - 3.*pow(dImQ1n,2.)*dReQ1n*dImQ3n+pow(dReQ1n,3.)*dImQ3n); | |
2424 | ||
2425 | // |Q_{2n}|^2 |Q_{n}|^4 | |
2426 | Double_t dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.); | |
2427 | ||
2428 | // Re[Q_{2n} Q_{n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2429 | Double_t reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
2430 | * (pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.) | |
2431 | + 2.*dReQ1n*dImQ1n*dImQ2n); | |
2432 | ||
2433 | // Im[Q_{2n} Q_{n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] | |
2434 | //Double_t imQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
2435 | // * (pow(dReQ1n,2.)*dImQ2n-dImQ2n*pow(dImQ1n,2.) | |
2436 | // - 2.*dReQ1n*dReQ2n*dImQ1n); | |
2437 | ||
2438 | ||
2439 | ||
2440 | ||
2441 | // ************************************** | |
2442 | // **** multi-particle correlations: **** | |
2443 | // ************************************** | |
2444 | // | |
2445 | // Remark 1: multi-particle correlations calculated with non-weighted Q-vectors are stored in 1D profile fQCorrelations[0]. // to be improved (wrong profiles) | |
2446 | // Remark 2: binning of fQCorrelations[0] is organized as follows: // to be improved (wrong profiles) | |
2447 | // -------------------------------------------------------------------------------------------------------------------- | |
2448 | // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))> | |
2449 | // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))> | |
2450 | // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))> | |
2451 | // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))> | |
2452 | // 5th bin: ---- EMPTY ---- | |
2453 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))> | |
2454 | // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))> | |
2455 | // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))> | |
2456 | // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))> | |
2457 | // 10th bin: ---- EMPTY ---- | |
2458 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))> | |
2459 | // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))> | |
2460 | // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))> | |
2461 | // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))> | |
2462 | // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))> | |
2463 | // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))> | |
2464 | // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> | |
2465 | // 18th bin: ---- EMPTY ---- | |
2466 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))> | |
2467 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))> | |
2468 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))> | |
2469 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))> | |
2470 | // 23rd bin: ---- EMPTY ---- | |
2471 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> | |
2472 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))> | |
2473 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))> | |
2474 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))> | |
2475 | // 28th bin: ---- EMPTY ---- | |
2476 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> | |
2477 | // 30th bin: ---- EMPTY ---- | |
2478 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> | |
2479 | // -------------------------------------------------------------------------------------------------------------------- | |
2480 | ||
2481 | // 2-particle: | |
2482 | Double_t two1n1n = 0.; // <cos(n*(phi1-phi2))> | |
2483 | Double_t two2n2n = 0.; // <cos(2n*(phi1-phi2))> | |
2484 | Double_t two3n3n = 0.; // <cos(3n*(phi1-phi2))> | |
2485 | Double_t two4n4n = 0.; // <cos(4n*(phi1-phi2))> | |
2486 | ||
2487 | if(dMult>1) | |
2488 | { | |
2489 | two1n1n = (pow(dReQ1n,2.)+pow(dImQ1n,2.)-dMult)/(dMult*(dMult-1.)); | |
2490 | two2n2n = (pow(dReQ2n,2.)+pow(dImQ2n,2.)-dMult)/(dMult*(dMult-1.)); | |
2491 | two3n3n = (pow(dReQ3n,2.)+pow(dImQ3n,2.)-dMult)/(dMult*(dMult-1.)); | |
2492 | two4n4n = (pow(dReQ4n,2.)+pow(dImQ4n,2.)-dMult)/(dMult*(dMult-1.)); | |
2493 | ||
2494 | // average 2-particle correlations for single event: | |
2495 | fIntFlowCorrelationsAllEBE->SetBinContent(1,two1n1n); | |
2496 | fIntFlowCorrelationsAllEBE->SetBinContent(2,two2n2n); | |
2497 | fIntFlowCorrelationsAllEBE->SetBinContent(3,two3n3n); | |
2498 | fIntFlowCorrelationsAllEBE->SetBinContent(4,two4n4n); | |
2499 | ||
2500 | // average 2-particle correlations for all events: | |
2501 | fIntFlowCorrelationsAllPro->Fill(0.5,two1n1n,dMult*(dMult-1.)); | |
2502 | fIntFlowCorrelationsAllPro->Fill(1.5,two2n2n,dMult*(dMult-1.)); | |
2503 | fIntFlowCorrelationsAllPro->Fill(2.5,two3n3n,dMult*(dMult-1.)); | |
2504 | fIntFlowCorrelationsAllPro->Fill(3.5,two4n4n,dMult*(dMult-1.)); | |
2505 | ||
2506 | // store separetately <2> (to be improved: do I really need this?) | |
2507 | fIntFlowCorrelationsEBE->SetBinContent(1,two1n1n); // <2> | |
2508 | ||
2509 | // to be improved (this can be implemented better): | |
2510 | Double_t mWeight2p = 0.; | |
2511 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
2512 | { | |
2513 | mWeight2p = dMult*(dMult-1.); | |
2514 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
2515 | { | |
2516 | mWeight2p = 1.; | |
2517 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
2518 | { | |
2519 | mWeight2p = dMult; | |
2520 | } | |
2521 | ||
2522 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(1,mWeight2p); // eW_<2> | |
2523 | fIntFlowCorrelationsPro->Fill(0.5,two1n1n,mWeight2p); | |
b3dacf6b | 2524 | if(fCalculateCumulantsVsM){fIntFlowCorrelationsVsMPro[0]->Fill(dMult+0.5,two1n1n,mWeight2p);} |
489d5531 | 2525 | |
2526 | // distribution of <cos(n*(phi1-phi2))>: | |
2527 | //f2pDistribution->Fill(two1n1n,dMult*(dMult-1.)); | |
2528 | } // end of if(dMult>1) | |
2529 | ||
2530 | // 3-particle: | |
2531 | Double_t three2n1n1n = 0.; // <cos(n*(2.*phi1-phi2-phi3))> | |
2532 | Double_t three3n2n1n = 0.; // <cos(n*(3.*phi1-2.*phi2-phi3))> | |
2533 | Double_t three4n2n2n = 0.; // <cos(n*(4.*phi1-2.*phi2-2.*phi3))> | |
2534 | Double_t three4n3n1n = 0.; // <cos(n*(4.*phi1-3.*phi2-phi3))> | |
2535 | ||
2536 | if(dMult>2) | |
2537 | { | |
2538 | three2n1n1n = (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2539 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult) | |
2540 | / (dMult*(dMult-1.)*(dMult-2.)); | |
2541 | three3n2n1n = (reQ3nQ2nstarQ1nstar-(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2542 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2543 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
2544 | / (dMult*(dMult-1.)*(dMult-2.)); | |
2545 | three4n2n2n = (reQ4nQ2nstarQ2nstar-2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2546 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*dMult) | |
2547 | / (dMult*(dMult-1.)*(dMult-2.)); | |
2548 | three4n3n1n = (reQ4nQ3nstarQ1nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
2549 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2550 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
2551 | / (dMult*(dMult-1.)*(dMult-2.)); | |
2552 | ||
2553 | // average 3-particle correlations for single event: | |
2554 | fIntFlowCorrelationsAllEBE->SetBinContent(6,three2n1n1n); | |
2555 | fIntFlowCorrelationsAllEBE->SetBinContent(7,three3n2n1n); | |
2556 | fIntFlowCorrelationsAllEBE->SetBinContent(8,three4n2n2n); | |
2557 | fIntFlowCorrelationsAllEBE->SetBinContent(9,three4n3n1n); | |
2558 | ||
2559 | // average 3-particle correlations for all events: | |
2560 | fIntFlowCorrelationsAllPro->Fill(5.5,three2n1n1n,dMult*(dMult-1.)*(dMult-2.)); | |
2561 | fIntFlowCorrelationsAllPro->Fill(6.5,three3n2n1n,dMult*(dMult-1.)*(dMult-2.)); | |
2562 | fIntFlowCorrelationsAllPro->Fill(7.5,three4n2n2n,dMult*(dMult-1.)*(dMult-2.)); | |
2563 | fIntFlowCorrelationsAllPro->Fill(8.5,three4n3n1n,dMult*(dMult-1.)*(dMult-2.)); | |
2564 | } // end of if(dMult>2) | |
2565 | ||
2566 | // 4-particle: | |
2567 | Double_t four1n1n1n1n = 0.; // <cos(n*(phi1+phi2-phi3-phi4))> | |
2568 | Double_t four2n2n2n2n = 0.; // <cos(2.*n*(phi1+phi2-phi3-phi4))> | |
2569 | Double_t four2n1n2n1n = 0.; // <cos(n*(2.*phi1+phi2-2.*phi3-phi4))> | |
2570 | Double_t four3n1n1n1n = 0.; // <cos(n*(3.*phi1-phi2-phi3-phi4))> | |
2571 | Double_t four4n2n1n1n = 0.; // <cos(n*(4.*phi1-2.*phi2-phi3-phi4))> | |
2572 | Double_t four3n1n2n2n = 0.; // <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))> | |
2573 | Double_t four3n1n3n1n = 0.; // <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> | |
2574 | ||
2575 | if(dMult>3) | |
2576 | { | |
2577 | four1n1n1n1n = (2.*dMult*(dMult-3.)+pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ1n,2.) | |
2578 | + pow(dImQ1n,2.))-2.*reQ2nQ1nstarQ1nstar+(pow(dReQ2n,2.)+pow(dImQ2n,2.))) | |
2579 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
2580 | four2n2n2n2n = (2.*dMult*(dMult-3.)+pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ2n,2.) | |
2581 | + pow(dImQ2n,2.))-2.*reQ4nQ2nstarQ2nstar+(pow(dReQ4n,2.)+pow(dImQ4n,2.))) | |
2582 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
2583 | four2n1n2n1n = (dQ2nQ1nQ2nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar-2.*reQ2nQ1nstarQ1nstar) | |
2584 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2585 | - ((dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2586 | + (dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-(pow(dReQ3n,2.)+pow(dImQ3n,2.))) | |
2587 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2588 | + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2589 | four3n1n1n1n = (reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar-3.*reQ2nQ1nstarQ1nstar) | |
2590 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2591 | + (2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2592 | + 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
2593 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2594 | four4n2n1n1n = (reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar-2.*reQ3nQ2nstarQ1nstar) | |
2595 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2596 | - (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2597 | - 3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
2598 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2599 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2600 | four3n1n2n2n = (reQ3nQ1nQ2nstarQ2nstar-reQ4nQ2nstarQ2nstar-reQ3nQ1nQ4nstar-2.*reQ3nQ2nstarQ1nstar) | |
2601 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2602 | - (2.*reQ1nQ1nQ2nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2603 | - 4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
2604 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2605 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2606 | four3n1n3n1n = ((pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2607 | - 2.*reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar) | |
2608 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2609 | + ((pow(dReQ4n,2.)+pow(dImQ4n,2.))-(dMult-4.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2610 | + (pow(dReQ2n,2.)+pow(dImQ2n,2.))-(dMult-4.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
2611 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
2612 | + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2613 | ||
2614 | // average 4-particle correlations for single event: | |
2615 | fIntFlowCorrelationsAllEBE->SetBinContent(11,four1n1n1n1n); | |
2616 | fIntFlowCorrelationsAllEBE->SetBinContent(12,four2n1n2n1n); | |
2617 | fIntFlowCorrelationsAllEBE->SetBinContent(13,four2n2n2n2n); | |
2618 | fIntFlowCorrelationsAllEBE->SetBinContent(14,four3n1n1n1n); | |
2619 | fIntFlowCorrelationsAllEBE->SetBinContent(15,four3n1n3n1n); | |
2620 | fIntFlowCorrelationsAllEBE->SetBinContent(16,four3n1n2n2n); | |
2621 | fIntFlowCorrelationsAllEBE->SetBinContent(17,four4n2n1n1n); | |
2622 | ||
2623 | // average 4-particle correlations for all events: | |
2624 | fIntFlowCorrelationsAllPro->Fill(10.5,four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2625 | fIntFlowCorrelationsAllPro->Fill(11.5,four2n1n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2626 | fIntFlowCorrelationsAllPro->Fill(12.5,four2n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2627 | fIntFlowCorrelationsAllPro->Fill(13.5,four3n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2628 | fIntFlowCorrelationsAllPro->Fill(14.5,four3n1n3n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2629 | fIntFlowCorrelationsAllPro->Fill(15.5,four3n1n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2630 | fIntFlowCorrelationsAllPro->Fill(16.5,four4n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2631 | ||
2632 | // store separetately <4> (to be improved: do I really need this?) | |
2633 | fIntFlowCorrelationsEBE->SetBinContent(2,four1n1n1n1n); // <4> | |
2634 | ||
2635 | // to be improved (this can be implemented better): | |
2636 | Double_t mWeight4p = 0.; | |
2637 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
2638 | { | |
2639 | mWeight4p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
2640 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
2641 | { | |
2642 | mWeight4p = 1.; | |
2643 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
2644 | { | |
2645 | mWeight4p = dMult; | |
2646 | } | |
2647 | ||
2648 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(2,mWeight4p); // eW_<4> | |
2649 | fIntFlowCorrelationsPro->Fill(1.5,four1n1n1n1n,mWeight4p); | |
b3dacf6b | 2650 | if(fCalculateCumulantsVsM){fIntFlowCorrelationsVsMPro[1]->Fill(dMult+0.5,four1n1n1n1n,mWeight4p);} |
489d5531 | 2651 | |
2652 | // distribution of <cos(n*(phi1+phi2-phi3-phi4))> | |
2653 | //f4pDistribution->Fill(four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2654 | ||
2655 | } // end of if(dMult>3) | |
2656 | ||
2657 | // 5-particle: | |
2658 | Double_t five2n1n1n1n1n = 0.; // <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))> | |
2659 | Double_t five2n2n2n1n1n = 0.; // <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))> | |
2660 | Double_t five3n1n2n1n1n = 0.; // <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))> | |
2661 | Double_t five4n1n1n1n1n = 0.; // <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))> | |
2662 | ||
2663 | if(dMult>4) | |
2664 | { | |
2665 | five2n1n1n1n1n = (reQ2nQ1nQ1nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar+6.*reQ3nQ2nstarQ1nstar) | |
2666 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2667 | - (reQ2nQ1nQ3nstar+3.*(dMult-6.)*reQ2nQ1nstarQ1nstar+3.*reQ1nQ1nQ2nstar) | |
2668 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2669 | - (2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2670 | + 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2671 | - 3.*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))) | |
2672 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2673 | - 3.*(pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
2674 | - 2.*(2*dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult*(dMult-4.)) | |
2675 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2676 | ||
2677 | five2n2n2n1n1n = (reQ2nQ2nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ2nQ2nQ3nstarQ1nstar) | |
2678 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2679 | + 2.*(reQ4nQ2nstarQ2nstar+4.*reQ3nQ2nstarQ1nstar+reQ3nQ1nQ4nstar) | |
2680 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2681 | + (reQ2nQ2nQ4nstar-2.*(dMult-5.)*reQ2nQ1nstarQ1nstar+2.*reQ1nQ1nQ2nstar) | |
2682 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2683 | - (2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2684 | + 1.*pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.) | |
2685 | - 2.*(3.*dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))) | |
2686 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2687 | - (4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2688 | - 4.*(dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+4.*dMult*(dMult-6.)) | |
2689 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2690 | ||
2691 | five4n1n1n1n1n = (reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ4nQ2nstarQ1nstarQ1nstar-4.*reQ3nQ1nstarQ1nstarQ1nstar) | |
2692 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2693 | + (8.*reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar+12.*reQ3nQ2nstarQ1nstar+12.*reQ2nQ1nstarQ1nstar) | |
2694 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2695 | - (6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+8.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2696 | + 12.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+24.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-24.*dMult) | |
2697 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2698 | ||
2699 | five3n1n2n1n1n = (reQ3nQ1nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar) | |
2700 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2701 | - (reQ3nQ1nQ2nstarQ2nstar-3.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar) | |
2702 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2703 | - ((2.*dMult-13.)*reQ3nQ2nstarQ1nstar-reQ3nQ1nQ4nstar-9.*reQ2nQ1nstarQ1nstar) | |
2704 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2705 | - (2.*reQ1nQ1nQ2nstar+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
2706 | - 2.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+2.*(pow(dReQ3n,2.) | |
2707 | + pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
2708 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2709 | + (2.*(dMult-6.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2710 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2711 | - pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
2712 | + 2.*(3.*dMult-11.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
2713 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)) | |
2714 | - 4.*(dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2715 | ||
2716 | // average 5-particle correlations for single event: | |
2717 | fIntFlowCorrelationsAllEBE->SetBinContent(19,five2n1n1n1n1n); | |
2718 | fIntFlowCorrelationsAllEBE->SetBinContent(20,five2n2n2n1n1n); | |
2719 | fIntFlowCorrelationsAllEBE->SetBinContent(21,five3n1n2n1n1n); | |
2720 | fIntFlowCorrelationsAllEBE->SetBinContent(22,five4n1n1n1n1n); | |
2721 | ||
2722 | // average 5-particle correlations for all events: | |
2723 | fIntFlowCorrelationsAllPro->Fill(18.5,five2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2724 | fIntFlowCorrelationsAllPro->Fill(19.5,five2n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2725 | fIntFlowCorrelationsAllPro->Fill(20.5,five3n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2726 | fIntFlowCorrelationsAllPro->Fill(21.5,five4n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
2727 | } // end of if(dMult>4) | |
2728 | ||
2729 | // 6-particle: | |
2730 | Double_t six1n1n1n1n1n1n = 0.; // <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> | |
2731 | Double_t six2n2n1n1n1n1n = 0.; // <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))> | |
2732 | Double_t six3n1n1n1n1n1n = 0.; // <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))> | |
2733 | Double_t six2n1n1n2n1n1n = 0.; // <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))> | |
2734 | ||
2735 | if(dMult>5) | |
2736 | { | |
2737 | six1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),3.)+9.*dQ2nQ1nQ2nstarQ1nstar-6.*reQ2nQ1nQ1nstarQ1nstarQ1nstar) | |
2738 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)) | |
2739 | + 4.*(reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar) | |
2740 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)) | |
2741 | + 2.*(9.*(dMult-4.)*reQ2nQ1nstarQ1nstar+2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))) | |
2742 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)) | |
2743 | - 9.*(pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)+(pow(dReQ2n,2.)+pow(dImQ2n,2.))) | |
2744 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-5.)) | |
2745 | + (18.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
2746 | / (dMult*(dMult-1)*(dMult-3)*(dMult-4)) | |
2747 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
2748 | ||
2749 | six2n1n1n2n1n1n = (dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.) | |
2750 | * (2.*five2n2n2n1n1n+4.*five2n1n1n1n1n+4.*five3n1n2n1n1n+4.*four2n1n2n1n+1.*four1n1n1n1n) | |
2751 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four1n1n1n1n+4.*two1n1n | |
2752 | + 2.*three2n1n1n+2.*three2n1n1n+4.*four3n1n1n1n+8.*three2n1n1n+2.*four4n2n1n1n | |
2753 | + 4.*four2n1n2n1n+2.*two2n2n+8.*four2n1n2n1n+4.*four3n1n3n1n+8.*three3n2n1n | |
2754 | + 4.*four3n1n2n2n+4.*four1n1n1n1n+4.*four2n1n2n1n+1.*four2n2n2n2n) | |
2755 | - dMult*(dMult-1.)*(dMult-2.)*(2.*three2n1n1n+8.*two1n1n+4.*two1n1n+2. | |
2756 | + 4.*two1n1n+4.*three2n1n1n+2.*two2n2n+4.*three2n1n1n+8.*three3n2n1n | |
2757 | + 8.*two2n2n+4.*three4n3n1n+4.*two3n3n+4.*three3n2n1n+4.*two1n1n | |
2758 | + 8.*three2n1n1n+4.*two1n1n+4.*three3n2n1n+4.*three2n1n1n+2.*two2n2n | |
2759 | + 4.*three3n2n1n+2.*three4n2n2n)-dMult*(dMult-1.) | |
2760 | * (4.*two1n1n+4.+4.*two1n1n+2.*two2n2n+1.+4.*two1n1n+4.*two2n2n+4.*two3n3n | |
2761 | + 1.+2.*two2n2n+1.*two4n4n)-dMult) | |
2762 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed) | |
2763 | ||
2764 | six2n2n1n1n1n1n = (reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.) | |
2765 | * (five4n1n1n1n1n+8.*five2n1n1n1n1n+6.*five2n2n2n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) | |
2766 | * (4.*four3n1n1n1n+6.*four4n2n1n1n+12.*three2n1n1n+12.*four1n1n1n1n+24.*four2n1n2n1n | |
2767 | + 4.*four3n1n2n2n+3.*four2n2n2n2n)-dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+12.*three3n2n1n | |
2768 | + 4.*three4n3n1n+3.*three4n2n2n+8.*three2n1n1n+24.*two1n1n+12.*two2n2n+12.*three2n1n1n+8.*three3n2n1n | |
2769 | + 1.*three4n2n2n)-dMult*(dMult-1.)*(4.*two1n1n+6.*two2n2n+4.*two3n3n+1.*two4n4n+2.*two2n2n+8.*two1n1n+6.)-dMult) | |
2770 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed) | |
2771 | ||
2772 | six3n1n1n1n1n1n = (reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.) | |
2773 | * (five4n1n1n1n1n+4.*five2n1n1n1n1n+6.*five3n1n2n1n1n+4.*four3n1n1n1n) | |
2774 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four3n1n1n1n+6.*four4n2n1n1n+6.*four1n1n1n1n | |
2775 | + 12.*three2n1n1n+12.*four2n1n2n1n+6.*four3n1n1n1n+12.*three3n2n1n+4.*four3n1n3n1n+3.*four3n1n2n2n) | |
2776 | - dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+12.*three3n2n1n+4.*three4n3n1n+3.*three4n2n2n+4.*two1n1n | |
2777 | + 12.*two1n1n+6.*three2n1n1n+12.*three2n1n1n+4.*three3n2n1n+12.*two2n2n+4.*three3n2n1n+4.*two3n3n+1.*three4n3n1n | |
2778 | + 6.*three3n2n1n)-dMult*(dMult-1.)*(4.*two1n1n+6.*two2n2n+4.*two3n3n+1.*two4n4n+1.*two1n1n+4.+6.*two1n1n+4.*two2n2n | |
2779 | + 1.*two3n3n)-dMult)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed) | |
2780 | ||
2781 | // average 6-particle correlations for single event: | |
2782 | fIntFlowCorrelationsAllEBE->SetBinContent(24,six1n1n1n1n1n1n); | |
2783 | fIntFlowCorrelationsAllEBE->SetBinContent(25,six2n1n1n2n1n1n); | |
2784 | fIntFlowCorrelationsAllEBE->SetBinContent(26,six2n2n1n1n1n1n); | |
2785 | fIntFlowCorrelationsAllEBE->SetBinContent(27,six3n1n1n1n1n1n); | |
2786 | ||
2787 | // average 6-particle correlations for all events: | |
2788 | fIntFlowCorrelationsAllPro->Fill(23.5,six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
2789 | fIntFlowCorrelationsAllPro->Fill(24.5,six2n1n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
2790 | fIntFlowCorrelationsAllPro->Fill(25.5,six2n2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
2791 | fIntFlowCorrelationsAllPro->Fill(26.5,six3n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
2792 | ||
2793 | // store separetately <6> (to be improved: do I really need this?) | |
2794 | fIntFlowCorrelationsEBE->SetBinContent(3,six1n1n1n1n1n1n); // <6> | |
2795 | ||
2796 | // to be improved (this can be implemented better): | |
2797 | Double_t mWeight6p = 0.; | |
2798 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
2799 | { | |
2800 | mWeight6p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.); | |
2801 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
2802 | { | |
2803 | mWeight6p = 1.; | |
2804 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
2805 | { | |
2806 | mWeight6p = dMult; | |
2807 | } | |
2808 | ||
2809 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(3,mWeight6p); // eW_<6> | |
2810 | fIntFlowCorrelationsPro->Fill(2.5,six1n1n1n1n1n1n,mWeight6p); | |
b3dacf6b | 2811 | if(fCalculateCumulantsVsM){fIntFlowCorrelationsVsMPro[2]->Fill(dMult+0.5,six1n1n1n1n1n1n,mWeight6p);} |
489d5531 | 2812 | |
2813 | // distribution of <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> | |
2814 | //f6pDistribution->Fill(six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
2815 | } // end of if(dMult>5) | |
2816 | ||
2817 | // 7-particle: | |
2818 | Double_t seven2n1n1n1n1n1n1n = 0.; // <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> | |
2819 | ||
2820 | if(dMult>6) | |
2821 | { | |
2822 | seven2n1n1n1n1n1n1n = (reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.) | |
2823 | * (2.*six3n1n1n1n1n1n+4.*six1n1n1n1n1n1n+1.*six2n2n1n1n1n1n+6.*six2n1n1n2n1n1n+8.*five2n1n1n1n1n) | |
2824 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(1.*five4n1n1n1n1n +8.*five2n1n1n1n1n+8.*four3n1n1n1n | |
2825 | + 12.*five3n1n2n1n1n+4.*five2n1n1n1n1n+3.*five2n2n2n1n1n+6.*five2n2n2n1n1n+6.*four1n1n1n1n+24.*four1n1n1n1n | |
2826 | + 12.*five2n1n1n1n1n+12.*five2n1n1n1n1n+12.*three2n1n1n+24.*four2n1n2n1n+4.*five3n1n2n1n1n+4.*five2n1n1n1n1n) | |
2827 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four3n1n1n1n+6.*four4n2n1n1n+12.*four1n1n1n1n+24.*three2n1n1n | |
2828 | + 24.*four2n1n2n1n+12.*four3n1n1n1n+24.*three3n2n1n+8.*four3n1n3n1n+6.*four3n1n2n2n+6.*three2n1n1n+12.*four1n1n1n1n | |
2829 | + 12.*four2n1n2n1n+6.*three2n1n1n+12.*four2n1n2n1n+4.*four3n1n2n2n+3.*four2n2n2n2n+4.*four1n1n1n1n+6.*three2n1n1n | |
2830 | + 24.*two1n1n+24.*four1n1n1n1n+4.*four3n1n1n1n+24.*two1n1n+24.*three2n1n1n+12.*two2n2n+24.*three2n1n1n+12.*four2n1n2n1n | |
2831 | + 8.*three3n2n1n+8.*four2n1n2n1n+1.*four4n2n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+1.*three2n1n1n+8.*two1n1n | |
2832 | + 12.*three3n2n1n+24.*two1n1n+12.*three2n1n1n+4.*three2n1n1n+8.*two1n1n+4.*three4n3n1n+24.*three2n1n1n+8.*three3n2n1n | |
2833 | + 12.*two1n1n+12.*two1n1n+3.*three4n2n2n+24.*two2n2n+6.*two2n2n+12.+12.*three3n2n1n+8.*two3n3n+12.*three2n1n1n+24.*two1n1n | |
2834 | + 4.*three3n2n1n+8.*three3n2n1n+2.*three4n3n1n+12.*two1n1n+8.*three2n1n1n+4.*three2n1n1n+2.*three3n2n1n+6.*two2n2n+8.*two2n2n | |
2835 | + 1.*three4n2n2n+4.*three3n2n1n+6.*three2n1n1n)-dMult*(dMult-1.)*(4.*two1n1n+2.*two1n1n+6.*two2n2n+8.+1.*two2n2n+4.*two3n3n | |
2836 | + 12.*two1n1n+4.*two1n1n+1.*two4n4n+8.*two2n2n+6.+2.*two3n3n+4.*two1n1n+1.*two2n2n)-dMult) | |
2837 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)); // to be improved (direct formula needed) | |
2838 | ||
2839 | // average 7-particle correlations for single event: | |
2840 | fIntFlowCorrelationsAllEBE->SetBinContent(29,seven2n1n1n1n1n1n1n); | |
2841 | ||
2842 | // average 7-particle correlations for all events: | |
2843 | fIntFlowCorrelationsAllPro->Fill(28.5,seven2n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)); | |
2844 | } // end of if(dMult>6) | |
2845 | ||
2846 | // 8-particle: | |
2847 | Double_t eight1n1n1n1n1n1n1n1n = 0.; // <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> | |
2848 | if(dMult>7) | |
2849 | { | |
2850 | eight1n1n1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),4.)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.) | |
2851 | * (12.*seven2n1n1n1n1n1n1n+16.*six1n1n1n1n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.) | |
2852 | * (8.*six3n1n1n1n1n1n+48.*six1n1n1n1n1n1n+6.*six2n2n1n1n1n1n+96.*five2n1n1n1n1n+72.*four1n1n1n1n+36.*six2n1n1n2n1n1n) | |
2853 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(2.*five4n1n1n1n1n+32.*five2n1n1n1n1n+36.*four1n1n1n1n | |
2854 | + 32.*four3n1n1n1n+48.*five2n1n1n1n1n+48.*five3n1n2n1n1n+144.*five2n1n1n1n1n+288.*four1n1n1n1n+36.*five2n2n2n1n1n | |
2855 | + 144.*three2n1n1n+96.*two1n1n+144.*four2n1n2n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) | |
2856 | * (8.*four3n1n1n1n+48.*four1n1n1n1n+12.*four4n2n1n1n+96.*four2n1n2n1n+96.*three2n1n1n+72.*three2n1n1n+144.*two1n1n | |
2857 | + 16.*four3n1n3n1n+48.*four3n1n1n1n+144.*four1n1n1n1n+72.*four1n1n1n1n+96.*three3n2n1n+24.*four3n1n2n2n+144.*four2n1n2n1n | |
2858 | + 288.*two1n1n+288.*three2n1n1n+9.*four2n2n2n2n+72.*two2n2n+24.)-dMult*(dMult-1.)*(dMult-2.)*(12.*three2n1n1n+16.*two1n1n | |
2859 | + 24.*three3n2n1n+48.*three2n1n1n+96.*two1n1n+8.*three4n3n1n+32.*three3n2n1n+96.*three2n1n1n+144.*two1n1n+6.*three4n2n2n | |
2860 | + 96.*two2n2n+36.*two2n2n+72.+48.*three3n2n1n+16.*two3n3n+72.*three2n1n1n+144.*two1n1n)-dMult*(dMult-1.)*(8.*two1n1n | |
2861 | + 12.*two2n2n+16.+8.*two3n3n+48.*two1n1n+1.*two4n4n+16.*two2n2n+18.)-dMult) | |
2862 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); // to be improved (direct formula needed) | |
2863 | ||
2864 | // average 8-particle correlations for single event: | |
2865 | fIntFlowCorrelationsAllEBE->SetBinContent(31,eight1n1n1n1n1n1n1n1n); | |
2866 | ||
2867 | // average 8-particle correlations for all events: | |
2868 | fIntFlowCorrelationsAllPro->Fill(30.5,eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); | |
2869 | ||
2870 | // store separetately <8> (to be improved: do I really need this?) | |
2871 | fIntFlowCorrelationsEBE->SetBinContent(4,eight1n1n1n1n1n1n1n1n); // <8> | |
2872 | ||
2873 | // to be improved (this can be implemented better): | |
2874 | Double_t mWeight8p = 0.; | |
2875 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
2876 | { | |
2877 | mWeight8p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.); | |
2878 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
2879 | { | |
2880 | mWeight8p = 1.; | |
2881 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
2882 | { | |
2883 | mWeight8p = dMult; | |
2884 | } | |
2885 | ||
2886 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(4,mWeight8p); // eW_<8> | |
2887 | fIntFlowCorrelationsPro->Fill(3.5,eight1n1n1n1n1n1n1n1n,mWeight8p); | |
b3dacf6b | 2888 | if(fCalculateCumulantsVsM){fIntFlowCorrelationsVsMPro[3]->Fill(dMult+0.5,eight1n1n1n1n1n1n1n1n,mWeight8p);} |
489d5531 | 2889 | |
2890 | // distribution of <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> | |
2891 | //f8pDistribution->Fill(eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); | |
2892 | } // end of if(dMult>7) | |
2893 | ||
2894 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelations() | |
2895 | ||
2896 | ||
2897 | //================================================================================================================================ | |
2898 | ||
2899 | ||
2900 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrelations() | |
2901 | { | |
0328db2d | 2902 | // Calculate averages of products of correlations for integrated flow. |
489d5531 | 2903 | |
2001bc3a | 2904 | // multiplicity: |
2905 | Double_t dMult = (*fSMpk)(0,0); | |
2906 | ||
489d5531 | 2907 | Int_t counter = 0; |
2908 | ||
2909 | for(Int_t ci1=1;ci1<4;ci1++) | |
2910 | { | |
2911 | for(Int_t ci2=ci1+1;ci2<=4;ci2++) | |
2912 | { | |
ff70ca91 | 2913 | fIntFlowProductOfCorrelationsPro->Fill(0.5+counter, |
2914 | fIntFlowCorrelationsEBE->GetBinContent(ci1)* | |
2915 | fIntFlowCorrelationsEBE->GetBinContent(ci2), | |
2916 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
2917 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); | |
2918 | // products versus multiplicity: // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>] | |
b3dacf6b | 2919 | if(fCalculateCumulantsVsM) |
2920 | { | |
2921 | fIntFlowProductOfCorrelationsVsMPro[counter]->Fill(dMult+0.5, // to be improved: dMult => sum of weights ? | |
2922 | fIntFlowCorrelationsEBE->GetBinContent(ci1)* | |
2923 | fIntFlowCorrelationsEBE->GetBinContent(ci2), | |
2924 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
2925 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); | |
2926 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 2927 | counter++; |
489d5531 | 2928 | } |
2929 | } | |
2930 | ||
2931 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrelations() | |
2932 | ||
2933 | ||
2934 | //================================================================================================================================ | |
2935 | ||
2936 | ||
0328db2d | 2937 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrectionTermsForNUA() |
2938 | { | |
2939 | // Calculate averages of products of correction terms for NUA. | |
2940 | ||
2941 | // a) Binning of fIntFlowProductOfCorrectionTermsForNUAPro is organized as follows: | |
2942 | // 1st bin: <<2><cos(phi)>> | |
2943 | // 2nd bin: <<2><sin(phi)>> | |
2944 | // 3rd bin: <<cos(phi)><sin(phi)>> | |
2945 | // 4th bin: <<2><cos(phi1+phi2)>> | |
2946 | // 5th bin: <<2><sin(phi1+phi2)>> | |
2947 | // 6th bin: <<2><cos(phi1-phi2-phi3)>> | |
2948 | // 7th bin: <<2><sin(phi1-phi2-phi3)>> | |
2949 | // 8th bin: <<4><cos(phi1)>> | |
2950 | // 9th bin: <<4><sin(phi1)>> | |
2951 | // 10th bin: <<4><cos(phi1+phi2)>> | |
2952 | // 11th bin: <<4><sin(phi1+phi2)>> | |
2953 | // 12th bin: <<4><cos(phi1-phi2-phi3)>> | |
2954 | // 13th bin: <<4><sin(phi1-phi2-phi3)>> | |
2955 | // 14th bin: <<cos(phi1)><cos(phi1+phi2)>> | |
2956 | // 15th bin: <<cos(phi1)><sin(phi1+phi2)>> | |
2957 | // 16th bin: <<cos(phi1)><cos(phi1-phi2-phi3)>> | |
2958 | // 17th bin: <<cos(phi1)><sin(phi1-phi2-phi3)>> | |
2959 | // 18th bin: <<sin(phi1)><cos(phi1+phi2)>> | |
2960 | // 19th bin: <<sin(phi1)><sin(phi1+phi2)>> | |
2961 | // 20th bin: <<sin(phi1)><cos(phi1-phi2-phi3)>> | |
2962 | // 21st bin: <<sin(phi1)><sin(phi1-phi2-phi3)>> | |
2963 | // 22nd bin: <<cos(phi1+phi2)><sin(phi1+phi2)>> | |
2964 | // 23rd bin: <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
2965 | // 24th bin: <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
2966 | // 25th bin: <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
2967 | // 26th bin: <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
2968 | // 27th bin: <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>> | |
2969 | ||
2970 | // <<2><cos(phi)>>: | |
2971 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(0.5, | |
2972 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1), | |
2973 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
2974 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
2975 | // <<2><sin(phi)>>: | |
2976 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(1.5, | |
2977 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1), | |
2978 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
2979 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
2980 | // <<cos(phi)><sin(phi)>>: | |
2981 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(2.5, | |
2982 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1), | |
2983 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
2984 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
2985 | // <<2><cos(phi1+phi2)>>: | |
2986 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(3.5, | |
2987 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
2988 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
2989 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
2990 | // <<2><sin(phi1+phi2)>>: | |
2991 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(4.5, | |
2992 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
2993 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
2994 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
2995 | // <<2><cos(phi1-phi2-phi3)>>: | |
2996 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(5.5, | |
2997 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
2998 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
2999 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3000 | // <<2><sin(phi1-phi2-phi3)>>: | |
3001 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(6.5, | |
3002 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3003 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3004 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3005 | // <<4><cos(phi1)>>: | |
3006 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(7.5, | |
3007 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1), | |
3008 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3009 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
3010 | // <<4><sin(phi1)>>: | |
3011 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(8.5, | |
3012 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1), | |
3013 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3014 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
3015 | // <<4><cos(phi1+phi2)>>: | |
3016 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(9.5, | |
3017 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3018 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3019 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3020 | // <<4><sin(phi1+phi2)>>: | |
3021 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(10.5, | |
3022 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3023 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3024 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3025 | // <<4><cos(phi1-phi2-phi3)>>: | |
3026 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(11.5, | |
3027 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3028 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3029 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3030 | // <<4><sin(phi1-phi2-phi3)>>: | |
3031 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(12.5, | |
3032 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3033 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3034 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3035 | // <<cos(phi1)><cos(phi1+phi2)>>: | |
3036 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(13.5, | |
3037 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3038 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3039 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3040 | // <<cos(phi1)><sin(phi1+phi2)>>: | |
3041 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(14.5, | |
3042 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3043 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3044 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3045 | // <<cos(phi1)><cos(phi1-phi2-phi3)>>: | |
3046 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(15.5, | |
3047 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3048 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3049 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3050 | // <<cos(phi1)><sin(phi1-phi2-phi3)>>: | |
3051 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(16.5, | |
3052 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3053 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3054 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3055 | // <<sin(phi1)><cos(phi1+phi2)>>: | |
3056 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(17.5, | |
3057 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3058 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3059 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3060 | // <<sin(phi1)><sin(phi1+phi2)>>: | |
3061 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(18.5, | |
3062 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3063 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3064 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3065 | // <<sin(phi1)><cos(phi1-phi2-phi3)>>: | |
3066 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(19.5, | |
3067 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3068 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3069 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3070 | // <<sin(phi1)><sin(phi1-phi2-phi3)>>: | |
3071 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(20.5, | |
3072 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3073 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3074 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3075 | // <<cos(phi1+phi2)><sin(phi1+phi2)>>: | |
3076 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(21.5, | |
3077 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3078 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2) | |
3079 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3080 | // <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>>: | |
3081 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(22.5, | |
3082 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3083 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2) | |
3084 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3085 | // <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>>: | |
3086 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(23.5, | |
3087 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3088 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2) | |
3089 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3090 | // <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>>: | |
3091 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(24.5, | |
3092 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3093 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2) | |
3094 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3095 | // <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>>: | |
3096 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(25.5, | |
3097 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3098 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2) | |
3099 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3100 | // <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>>: | |
3101 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(26.5, | |
3102 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3103 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3) | |
3104 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3105 | ||
3106 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrectionTermsForNUA() | |
3107 | ||
0328db2d | 3108 | //================================================================================================================================ |
3109 | ||
489d5531 | 3110 | void AliFlowAnalysisWithQCumulants::CalculateCovariancesIntFlow() |
3111 | { | |
3112 | // a) Calculate unbiased estimators Cov(<2>,<4>), Cov(<2>,<6>), Cov(<2>,<8>), Cov(<4>,<6>), Cov(<4>,<8>) and Cov(<6>,<8>) | |
3113 | // for covariances V_(<2>,<4>), V_(<2>,<6>), V_(<2>,<8>), V_(<4>,<6>), V_(<4>,<8>) and V_(<6>,<8>). | |
3114 | // b) Store in histogram fIntFlowCovariances for instance the following: | |
3115 | // | |
3116 | // Cov(<2>,<4>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4>}_j)] | |
3117 | // | |
3118 | // where N is the number of events, w_{<2>} is event weight for <2> and w_{<4>} is event weight for <4>. | |
3119 | // c) Binning of fIntFlowCovariances is organized as follows: | |
3120 | // | |
3121 | // 1st bin: Cov(<2>,<4>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4>}_j)] | |
3122 | // 2nd bin: Cov(<2>,<6>) * (sum_{i=1}^{N} w_{<2>}_i w_{<6>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<6>}_j)] | |
3123 | // 3rd bin: Cov(<2>,<8>) * (sum_{i=1}^{N} w_{<2>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<8>}_j)] | |
3124 | // 4th bin: Cov(<4>,<6>) * (sum_{i=1}^{N} w_{<4>}_i w_{<6>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<6>}_j)] | |
3125 | // 5th bin: Cov(<4>,<8>) * (sum_{i=1}^{N} w_{<4>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<8>}_j)] | |
3126 | // 6th bin: Cov(<6>,<8>) * (sum_{i=1}^{N} w_{<6>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<6>}_i) * (sum_{j=1}^{N} w_{<8>}_j)] | |
b3dacf6b | 3127 | // |
489d5531 | 3128 | |
b3dacf6b | 3129 | // Average 2-, 4-, 6- and 8-particle correlations for all events: |
489d5531 | 3130 | Double_t correlation[4] = {0.}; |
3131 | for(Int_t ci=0;ci<4;ci++) | |
3132 | { | |
3133 | correlation[ci] = fIntFlowCorrelationsPro->GetBinContent(ci+1); | |
3134 | } | |
b3dacf6b | 3135 | // Average products of 2-, 4-, 6- and 8-particle correlations: |
489d5531 | 3136 | Double_t productOfCorrelations[4][4] = {{0.}}; |
3137 | Int_t productOfCorrelationsLabel = 1; | |
b3dacf6b | 3138 | // Denominators in the expressions for the unbiased estimator for covariance: |
489d5531 | 3139 | Double_t denominator[4][4] = {{0.}}; |
3140 | Int_t sumOfProductOfEventWeightsLabel1 = 1; | |
b3dacf6b | 3141 | // Weight dependent prefactor which multiply unbiased estimators for covariances: |
489d5531 | 3142 | Double_t wPrefactor[4][4] = {{0.}}; |
3143 | Int_t sumOfProductOfEventWeightsLabel2 = 1; | |
3144 | for(Int_t c1=0;c1<4;c1++) | |
3145 | { | |
3146 | for(Int_t c2=c1+1;c2<4;c2++) | |
3147 | { | |
3148 | productOfCorrelations[c1][c2] = fIntFlowProductOfCorrelationsPro->GetBinContent(productOfCorrelationsLabel); | |
b3dacf6b | 3149 | if(TMath::Abs(fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1)) > 1.e-44 && TMath::Abs(fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)) > 1.e-44) |
3150 | { | |
3151 | denominator[c1][c2] = 1.-(fIntFlowSumOfProductOfEventWeights->GetBinContent(sumOfProductOfEventWeightsLabel1)) | |
3152 | / (fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1) | |
3153 | * fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)); | |
3154 | wPrefactor[c1][c2] = fIntFlowSumOfProductOfEventWeights->GetBinContent(sumOfProductOfEventWeightsLabel2) | |
3155 | / (fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1) | |
3156 | * fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)); | |
489d5531 | 3157 | } |
b3dacf6b | 3158 | productOfCorrelationsLabel++; // to be improved - do I need here all 3 counters? |
489d5531 | 3159 | sumOfProductOfEventWeightsLabel1++; |
3160 | sumOfProductOfEventWeightsLabel2++; | |
b3dacf6b | 3161 | } // end of for(Int_t c2=c1+1;c2<4;c2++) |
3162 | } // end of for(Int_t c1=0;c1<4;c1++) | |
489d5531 | 3163 | |
489d5531 | 3164 | Int_t covarianceLabel = 1; |
3165 | for(Int_t c1=0;c1<4;c1++) | |
3166 | { | |
3167 | for(Int_t c2=c1+1;c2<4;c2++) | |
3168 | { | |
b3dacf6b | 3169 | if(TMath::Abs(denominator[c1][c2]) > 1.e-44) |
489d5531 | 3170 | { |
b3dacf6b | 3171 | // Covariances: |
489d5531 | 3172 | Double_t cov = (productOfCorrelations[c1][c2]-correlation[c1]*correlation[c2])/denominator[c1][c2]; |
b3dacf6b | 3173 | // Covariances multiplied with weight dependent prefactor: |
489d5531 | 3174 | Double_t wCov = cov * wPrefactor[c1][c2]; |
3175 | fIntFlowCovariances->SetBinContent(covarianceLabel,wCov); | |
3176 | } | |
3177 | covarianceLabel++; | |
b3dacf6b | 3178 | } // end of for(Int_t c2=c1+1;c2<4;c2++) |
3179 | } // end of for(Int_t c1=0;c1<4;c1++) | |
489d5531 | 3180 | |
b3dacf6b | 3181 | // Versus multiplicity: |
3182 | if(!fCalculateCumulantsVsM){return;} | |
9da1a4f3 | 3183 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) |
3184 | for(Int_t b=1;b<=nBins;b++) | |
3185 | { | |
b3dacf6b | 3186 | // Average 2-, 4-, 6- and 8-particle correlations for all events: |
9da1a4f3 | 3187 | Double_t correlationVsM[4] = {0.}; |
3188 | for(Int_t ci=0;ci<4;ci++) | |
3189 | { | |
3190 | correlationVsM[ci] = fIntFlowCorrelationsVsMPro[ci]->GetBinContent(b); | |
3191 | } // end of for(Int_t ci=0;ci<4;ci++) | |
b3dacf6b | 3192 | // Average products of 2-, 4-, 6- and 8-particle correlations: |
9da1a4f3 | 3193 | Double_t productOfCorrelationsVsM[4][4] = {{0.}}; |
3194 | Int_t productOfCorrelationsLabelVsM = 1; | |
b3dacf6b | 3195 | // Denominators in the expressions for the unbiased estimator for covariance: |
9da1a4f3 | 3196 | Double_t denominatorVsM[4][4] = {{0.}}; |
3197 | Int_t sumOfProductOfEventWeightsLabel1VsM = 1; | |
b3dacf6b | 3198 | // Weight dependent prefactor which multiply unbiased estimators for covariances: |
9da1a4f3 | 3199 | Double_t wPrefactorVsM[4][4] = {{0.}}; |
3200 | Int_t sumOfProductOfEventWeightsLabel2VsM = 1; | |
3201 | for(Int_t c1=0;c1<4;c1++) | |
3202 | { | |
3203 | for(Int_t c2=c1+1;c2<4;c2++) | |
3204 | { | |
3205 | productOfCorrelationsVsM[c1][c2] = fIntFlowProductOfCorrelationsVsMPro[productOfCorrelationsLabelVsM-1]->GetBinContent(b); | |
b3dacf6b | 3206 | if(TMath::Abs(fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b)) > 1.e-44 && TMath::Abs(fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)) > 1.e-44) |
3207 | { | |
3208 | denominatorVsM[c1][c2] = 1.-(fIntFlowSumOfProductOfEventWeightsVsM[sumOfProductOfEventWeightsLabel1VsM-1]->GetBinContent(b)) | |
3209 | / (fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b) | |
3210 | * fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)); | |
3211 | wPrefactorVsM[c1][c2] = fIntFlowSumOfProductOfEventWeightsVsM[sumOfProductOfEventWeightsLabel2VsM-1]->GetBinContent(b) | |
3212 | / (fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b) | |
3213 | * fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)); | |
9da1a4f3 | 3214 | } |
3215 | productOfCorrelationsLabelVsM++; | |
3216 | sumOfProductOfEventWeightsLabel1VsM++; | |
3217 | sumOfProductOfEventWeightsLabel2VsM++; | |
3218 | } // end of for(Int_t c1=0;c1<4;c1++) | |
3219 | } // end of for(Int_t c2=c1+1;c2<4;c2++) | |
b3dacf6b | 3220 | |
9da1a4f3 | 3221 | Int_t covarianceLabelVsM = 1; |
3222 | for(Int_t c1=0;c1<4;c1++) | |
3223 | { | |
3224 | for(Int_t c2=c1+1;c2<4;c2++) | |
3225 | { | |
b3dacf6b | 3226 | if(TMath::Abs(denominatorVsM[c1][c2]) > 1.e-44) |
9da1a4f3 | 3227 | { |
b3dacf6b | 3228 | // Covariances: |
9da1a4f3 | 3229 | Double_t covVsM = (productOfCorrelationsVsM[c1][c2]-correlationVsM[c1]*correlationVsM[c2])/denominatorVsM[c1][c2]; |
b3dacf6b | 3230 | // Covariances multiplied with weight dependent prefactor: |
9da1a4f3 | 3231 | Double_t wCovVsM = covVsM * wPrefactorVsM[c1][c2]; |
3232 | fIntFlowCovariancesVsM[covarianceLabelVsM-1]->SetBinContent(b,wCovVsM); | |
3233 | } | |
3234 | covarianceLabelVsM++; | |
b3dacf6b | 3235 | } // end of for(Int_t c2=c1+1;c2<4;c2++) |
3236 | } // end of for(Int_t c1=0;c1<4;c1++) | |
9da1a4f3 | 3237 | } // end of for(Int_t b=1;b<=nBins;b++) |
3238 | ||
489d5531 | 3239 | } // end of AliFlowAnalysisWithQCumulants::CalculateCovariancesIntFlow() |
3240 | ||
489d5531 | 3241 | //================================================================================================================================ |
3242 | ||
0328db2d | 3243 | void AliFlowAnalysisWithQCumulants::CalculateCovariancesNUAIntFlow() |
3244 | { | |
3245 | // a) Calculate unbiased estimators Cov(*,*) for true covariances V_(*,*) for NUA terms. | |
3246 | // b) Store in histogram fIntFlowCovariancesNUA for instance the following: | |
3247 | // | |
3248 | // Cov(<2>,<cos(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<cos(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<cos(phi)>}_j)] | |
3249 | // | |
3250 | // where N is the number of events, w_{<2>} is event weight for <2> and w_{<cos(phi)>} is event weight for <cos(phi)>. | |
3251 | // c) Binning of fIntFlowCovariancesNUA is organized as follows: | |
3252 | // | |
3253 | // 1st bin: Cov(<2>,<cos(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<cos(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<cos(phi)>}_j)] | |
3254 | // 2nd bin: Cov(<2>,<sin(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<sin(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<sin(phi)>}_j)] | |
3255 | // 3rd bin: Cov(<cos(phi)>,<sin(phi)>) * (sum_{i=1}^{N} w_{<cos(phi)>}_i w_{<sin(phi)>}_i )/[(sum_{i=1}^{N} w_{<cos(phi)>}_i) * (sum_{j=1}^{N} w_{<sin(phi)>}_j)] | |
3256 | // ... | |
3257 | ||
3258 | // Cov(<2>,<cos(phi)>): | |
3259 | Double_t product1 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(1); // <<2><cos(phi)>> | |
3260 | Double_t term1st1 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
3261 | Double_t term2nd1 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi)>> | |
3262 | Double_t sumOfW1st1 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
3263 | Double_t sumOfW2nd1 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi)>} | |
3264 | Double_t sumOfWW1 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(1); // W_{<2>} * W_{<cos(phi)>} | |
3265 | // numerator in the expression for the the unbiased estimator for covariance: | |
3266 | Double_t numerator1 = product1 - term1st1*term2nd1; | |
3267 | // denominator in the expression for the the unbiased estimator for covariance: | |
3268 | Double_t denominator1 = 1.-sumOfWW1/(sumOfW1st1*sumOfW2nd1); | |
3269 | // covariance: | |
3270 | Double_t covariance1 = numerator1/denominator1; | |
3271 | // weight dependent prefactor for covariance: | |
3272 | Double_t wPrefactor1 = sumOfWW1/(sumOfW1st1*sumOfW2nd1); | |
3273 | // finally, store "weighted" covariance: | |
3274 | fIntFlowCovariancesNUA->SetBinContent(1,wPrefactor1*covariance1); | |
3275 | ||
3276 | // Cov(<2>,<sin(phi)>): | |
3277 | Double_t product2 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(2); // <<2><sin(phi)>> | |
3278 | Double_t term1st2 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
3279 | Double_t term2nd2 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi)>> | |
3280 | Double_t sumOfW1st2 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
3281 | Double_t sumOfW2nd2 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi)>} | |
3282 | Double_t sumOfWW2 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(2); // W_{<2>} * W_{<sin(phi)>} | |
3283 | // numerator in the expression for the the unbiased estimator for covariance: | |
3284 | Double_t numerator2 = product2 - term1st2*term2nd2; | |
3285 | // denominator in the expression for the the unbiased estimator for covariance: | |
3286 | Double_t denominator2 = 1.-sumOfWW2/(sumOfW1st2*sumOfW2nd2); | |
3287 | // covariance: | |
3288 | Double_t covariance2 = numerator2/denominator2; | |
3289 | // weight dependent prefactor for covariance: | |
3290 | Double_t wPrefactor2 = sumOfWW2/(sumOfW1st2*sumOfW2nd2); | |
3291 | // finally, store "weighted" covariance: | |
3292 | fIntFlowCovariancesNUA->SetBinContent(2,wPrefactor2*covariance2); | |
3293 | ||
3294 | // Cov(<cos(phi)>,<sin(phi)>): | |
3295 | Double_t product3 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(3); // <<cos(phi)><sin(phi)>> | |
3296 | Double_t term1st3 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi)>> | |
3297 | Double_t term2nd3 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi)>> | |
3298 | Double_t sumOfW1st3 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi)>} | |
3299 | Double_t sumOfW2nd3 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi)>} | |
3300 | Double_t sumOfWW3 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(3); // W_{<cos(phi)>} * W_{<sin(phi)>} | |
3301 | // numerator in the expression for the the unbiased estimator for covariance: | |
3302 | Double_t numerator3 = product3 - term1st3*term2nd3; | |
3303 | // denominator in the expression for the the unbiased estimator for covariance: | |
3304 | Double_t denominator3 = 1.-sumOfWW3/(sumOfW1st3*sumOfW2nd3); | |
3305 | // covariance: | |
3306 | Double_t covariance3 = numerator3/denominator3; | |
3307 | // weight dependent prefactor for covariance: | |
3308 | Double_t wPrefactor3 = sumOfWW3/(sumOfW1st3*sumOfW2nd3); | |
3309 | // finally, store "weighted" covariance: | |
3310 | fIntFlowCovariancesNUA->SetBinContent(3,wPrefactor3*covariance3); | |
3311 | ||
3312 | // Cov(<2>,<cos(phi1+phi2)>): | |
3313 | Double_t product4 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(4); // <<2><cos(phi1+phi2)>> | |
3314 | Double_t term1st4 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
3315 | Double_t term2nd4 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
3316 | Double_t sumOfW1st4 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
3317 | Double_t sumOfW2nd4 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
3318 | Double_t sumOfWW4 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(4); // W_{<2>} * W_{<cos(phi1+phi2)>} | |
3319 | // numerator in the expression for the the unbiased estimator for covariance: | |
3320 | Double_t numerator4 = product4 - term1st4*term2nd4; | |
3321 | // denominator in the expression for the the unbiased estimator for covariance: | |
3322 | Double_t denominator4 = 1.-sumOfWW4/(sumOfW1st4*sumOfW2nd4); | |
3323 | // covariance: | |
3324 | Double_t covariance4 = numerator4/denominator4; | |
3325 | // weight dependent prefactor for covariance: | |
3326 | Double_t wPrefactor4 = sumOfWW4/(sumOfW1st4*sumOfW2nd4); | |
3327 | // finally, store "weighted" covariance: | |
3328 | fIntFlowCovariancesNUA->SetBinContent(4,wPrefactor4*covariance4); | |
3329 | ||
3330 | // Cov(<2>,<sin(phi1+phi2)>): | |
3331 | Double_t product5 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(5); // <<2><sin(phi1+phi2)>> | |
3332 | Double_t term1st5 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
3333 | Double_t term2nd5 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
3334 | Double_t sumOfW1st5 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
3335 | Double_t sumOfW2nd5 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
3336 | Double_t sumOfWW5 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(5); // W_{<2>} * W_{<sin(phi1+phi2)>} | |
3337 | // numerator in the expression for the the unbiased estimator for covariance: | |
3338 | Double_t numerator5 = product5 - term1st5*term2nd5; | |
3339 | // denominator in the expression for the the unbiased estimator for covariance: | |
3340 | Double_t denominator5 = 1.-sumOfWW5/(sumOfW1st5*sumOfW2nd5); | |
3341 | // covariance: | |
3342 | Double_t covariance5 = numerator5/denominator5; | |
3343 | // weight dependent prefactor for covariance: | |
3344 | Double_t wPrefactor5 = sumOfWW5/(sumOfW1st5*sumOfW2nd5); | |
3345 | // finally, store "weighted" covariance: | |
3346 | fIntFlowCovariancesNUA->SetBinContent(5,wPrefactor5*covariance5); | |
3347 | ||
3348 | // Cov(<2>,<cos(phi1-phi2-phi3)>): | |
3349 | Double_t product6 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(6); // <<2><cos(phi1-phi2-phi3)>> | |
3350 | Double_t term1st6 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
3351 | Double_t term2nd6 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
3352 | Double_t sumOfW1st6 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
3353 | Double_t sumOfW2nd6 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
3354 | Double_t sumOfWW6 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(6); // W_{<2>} * W_{<cos(phi1-phi2-phi3)>} | |
3355 | // numerator in the expression for the the unbiased estimator for covariance: | |
3356 | Double_t numerator6 = product6 - term1st6*term2nd6; | |
3357 | // denominator in the expression for the the unbiased estimator for covariance: | |
3358 | Double_t denominator6 = 1.-sumOfWW6/(sumOfW1st6*sumOfW2nd6); | |
3359 | // covariance: | |
3360 | Double_t covariance6 = numerator6/denominator6; | |
3361 | // weight dependent prefactor for covariance: | |
3362 | Double_t wPrefactor6 = sumOfWW6/(sumOfW1st6*sumOfW2nd6); | |
3363 | // finally, store "weighted" covariance: | |
3364 | fIntFlowCovariancesNUA->SetBinContent(6,wPrefactor6*covariance6); | |
3365 | ||
3366 | // Cov(<2>,<sin(phi1-phi2-phi3)>): | |
3367 | Double_t product7 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(7); // <<2><sin(phi1-phi2-phi3)>> | |
3368 | Double_t term1st7 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
3369 | Double_t term2nd7 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
3370 | Double_t sumOfW1st7 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
3371 | Double_t sumOfW2nd7 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
3372 | Double_t sumOfWW7 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(7); // W_{<2>} * W_{<sin(phi1-phi2-phi3)>} | |
3373 | // numerator in the expression for the the unbiased estimator for covariance: | |
3374 | Double_t numerator7 = product7 - term1st7*term2nd7; | |
3375 | // denominator in the expression for the the unbiased estimator for covariance: | |
3376 | Double_t denominator7 = 1.-sumOfWW7/(sumOfW1st7*sumOfW2nd7); | |
3377 | // covariance: | |
3378 | Double_t covariance7 = numerator7/denominator7; | |
3379 | // weight dependent prefactor for covariance: | |
3380 | Double_t wPrefactor7 = sumOfWW7/(sumOfW1st7*sumOfW2nd7); | |
3381 | // finally, store "weighted" covariance: | |
3382 | fIntFlowCovariancesNUA->SetBinContent(7,wPrefactor7*covariance7); | |
3383 | ||
3384 | // Cov(<4>,<cos(phi1>): | |
3385 | Double_t product8 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(8); // <<4><cos(phi1)>> | |
3386 | Double_t term1st8 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
3387 | Double_t term2nd8 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
3388 | Double_t sumOfW1st8 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
3389 | Double_t sumOfW2nd8 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
3390 | Double_t sumOfWW8 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(8); // W_{<4>} * W_{<cos(phi1)>} | |
3391 | // numerator in the expression for the the unbiased estimator for covariance: | |
3392 | Double_t numerator8 = product8 - term1st8*term2nd8; | |
3393 | // denominator in the expression for the the unbiased estimator for covariance: | |
3394 | Double_t denominator8 = 1.-sumOfWW8/(sumOfW1st8*sumOfW2nd8); | |
3395 | // covariance: | |
3396 | Double_t covariance8 = numerator8/denominator8; | |
3397 | // weight dependent prefactor for covariance: | |
3398 | Double_t wPrefactor8 = sumOfWW8/(sumOfW1st8*sumOfW2nd8); | |
3399 | // finally, store "weighted" covariance: | |
3400 | fIntFlowCovariancesNUA->SetBinContent(8,wPrefactor8*covariance8); | |
3401 | ||
3402 | // Cov(<4>,<sin(phi1)>): | |
3403 | Double_t product9 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(9); // <<4><sin(phi1)>> | |
3404 | Double_t term1st9 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
3405 | Double_t term2nd9 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
3406 | Double_t sumOfW1st9 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
3407 | Double_t sumOfW2nd9 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
3408 | Double_t sumOfWW9 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(9); // W_{<4>} * W_{<sin(phi1)>} | |
3409 | // numerator in the expression for the the unbiased estimator for covariance: | |
3410 | Double_t numerator9 = product9 - term1st9*term2nd9; | |
3411 | // denominator in the expression for the the unbiased estimator for covariance: | |
3412 | Double_t denominator9 = 1.-sumOfWW9/(sumOfW1st9*sumOfW2nd9); | |
3413 | // covariance: | |
3414 | Double_t covariance9 = numerator9/denominator9; | |
3415 | // weight dependent prefactor for covariance: | |
3416 | Double_t wPrefactor9 = sumOfWW9/(sumOfW1st9*sumOfW2nd9); | |
3417 | // finally, store "weighted" covariance: | |
3418 | fIntFlowCovariancesNUA->SetBinContent(9,wPrefactor9*covariance9); | |
3419 | ||
3420 | // Cov(<4>,<cos(phi1+phi2)>): | |
3421 | Double_t product10 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(10); // <<4><cos(phi1+phi2)>> | |
3422 | Double_t term1st10 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
3423 | Double_t term2nd10 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
3424 | Double_t sumOfW1st10 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
3425 | Double_t sumOfW2nd10 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
3426 | Double_t sumOfWW10 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(10); // W_{<4>} * W_{<cos(phi1+phi2)>} | |
3427 | // numerator in the expression for the the unbiased estimator for covariance: | |
3428 | Double_t numerator10 = product10 - term1st10*term2nd10; | |
3429 | // denominator in the expression for the the unbiased estimator for covariance: | |
3430 | Double_t denominator10 = 1.-sumOfWW10/(sumOfW1st10*sumOfW2nd10); | |
3431 | // covariance: | |
3432 | Double_t covariance10 = numerator10/denominator10; | |
3433 | // weight dependent prefactor for covariance: | |
3434 | Double_t wPrefactor10 = sumOfWW10/(sumOfW1st10*sumOfW2nd10); | |
3435 | // finally, store "weighted" covariance: | |
3436 | fIntFlowCovariancesNUA->SetBinContent(10,wPrefactor10*covariance10); | |
3437 | ||
3438 | // Cov(<4>,<sin(phi1+phi2)>): | |
3439 | Double_t product11 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(11); // <<4><sin(phi1+phi2)>> | |
3440 | Double_t term1st11 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
3441 | Double_t term2nd11 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
3442 | Double_t sumOfW1st11 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
3443 | Double_t sumOfW2nd11 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
3444 | Double_t sumOfWW11 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(11); // W_{<4>} * W_{<sin(phi1+phi2)>} | |
3445 | // numerator in the expression for the the unbiased estimator for covariance: | |
3446 | Double_t numerator11 = product11 - term1st11*term2nd11; | |
3447 | // denominator in the expression for the the unbiased estimator for covariance: | |
3448 | Double_t denominator11 = 1.-sumOfWW11/(sumOfW1st11*sumOfW2nd11); | |
3449 | // covariance: | |
3450 | Double_t covariance11 = numerator11/denominator11; | |
3451 | // weight dependent prefactor for covariance: | |
3452 | Double_t wPrefactor11 = sumOfWW11/(sumOfW1st11*sumOfW2nd11); | |
3453 | // finally, store "weighted" covariance: | |
3454 | fIntFlowCovariancesNUA->SetBinContent(11,wPrefactor11*covariance11); | |
3455 | ||
3456 | // Cov(<4>,<cos(phi1-phi2-phi3)>): | |
3457 | Double_t product12 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(12); // <<4><cos(phi1-phi2-phi3)>> | |
3458 | Double_t term1st12 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
3459 | Double_t term2nd12 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
3460 | Double_t sumOfW1st12 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
3461 | Double_t sumOfW2nd12 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
3462 | Double_t sumOfWW12 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(12); // W_{<4>} * W_{<cos(phi1-phi2-phi3)>} | |
3463 | // numerator in the expression for the the unbiased estimator for covariance: | |
3464 | Double_t numerator12 = product12 - term1st12*term2nd12; | |
3465 | // denominator in the expression for the the unbiased estimator for covariance: | |
3466 | Double_t denominator12 = 1.-sumOfWW12/(sumOfW1st12*sumOfW2nd12); | |
3467 | // covariance: | |
3468 | Double_t covariance12 = numerator12/denominator12; | |
3469 | // weight dependent prefactor for covariance: | |
3470 | Double_t wPrefactor12 = sumOfWW12/(sumOfW1st12*sumOfW2nd12); | |
3471 | // finally, store "weighted" covariance: | |
3472 | fIntFlowCovariancesNUA->SetBinContent(12,wPrefactor12*covariance12); | |
3473 | ||
3474 | // Cov(<4>,<sin(phi1-phi2-phi3)>): | |
3475 | Double_t product13 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(13); // <<4><sin(phi1-phi2-phi3)>> | |
3476 | Double_t term1st13 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
3477 | Double_t term2nd13 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
3478 | Double_t sumOfW1st13 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
3479 | Double_t sumOfW2nd13 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
3480 | Double_t sumOfWW13 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(13); // W_{<4>} * W_{<sin(phi1-phi2-phi3)>} | |
3481 | // numerator in the expression for the the unbiased estimator for covariance: | |
3482 | Double_t numerator13 = product13 - term1st13*term2nd13; | |
3483 | // denominator in the expression for the the unbiased estimator for covariance: | |
3484 | Double_t denominator13 = 1.-sumOfWW13/(sumOfW1st13*sumOfW2nd13); | |
3485 | // covariance: | |
3486 | Double_t covariance13 = numerator13/denominator13; | |
3487 | // weight dependent prefactor for covariance: | |
3488 | Double_t wPrefactor13 = sumOfWW13/(sumOfW1st13*sumOfW2nd13); | |
3489 | // finally, store "weighted" covariance: | |
3490 | fIntFlowCovariancesNUA->SetBinContent(13,wPrefactor13*covariance13); | |
3491 | ||
3492 | // Cov(<cos(phi1)>,<cos(phi1+phi2)>): | |
3493 | Double_t product14 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(14); // <<cos(phi1)><cos(phi1+phi2)>> | |
3494 | Double_t term1st14 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
3495 | Double_t term2nd14 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
3496 | Double_t sumOfW1st14 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
3497 | Double_t sumOfW2nd14 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
3498 | Double_t sumOfWW14 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(14); // W_{<cos(phi1)>} * W_{<cos(phi1+phi2)>} | |
3499 | // numerator in the expression for the the unbiased estimator for covariance: | |
3500 | Double_t numerator14 = product14 - term1st14*term2nd14; | |
3501 | // denominator in the expression for the the unbiased estimator for covariance: | |
3502 | Double_t denominator14 = 1.-sumOfWW14/(sumOfW1st14*sumOfW2nd14); | |
3503 | // covariance: | |
3504 | Double_t covariance14 = numerator14/denominator14; | |
3505 | // weight dependent prefactor for covariance: | |
3506 | Double_t wPrefactor14 = sumOfWW14/(sumOfW1st14*sumOfW2nd14); | |
3507 | // finally, store "weighted" covariance: | |
3508 | fIntFlowCovariancesNUA->SetBinContent(14,wPrefactor14*covariance14); | |
3509 | ||
3510 | // Cov(<cos(phi1)>,<sin(phi1+phi2)>): | |
3511 | Double_t product15 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(15); // <<cos(phi1)><sin(phi1+phi2)>> | |
3512 | Double_t term1st15 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
3513 | Double_t term2nd15 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
3514 | Double_t sumOfW1st15 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
3515 | Double_t sumOfW2nd15 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
3516 | Double_t sumOfWW15 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(15); // W_{<cos(phi1)>} * W_{<sin(phi1+phi2)>} | |
3517 | // numerator in the expression for the the unbiased estimator for covariance: | |
3518 | Double_t numerator15 = product15 - term1st15*term2nd15; | |
3519 | // denominator in the expression for the the unbiased estimator for covariance: | |
3520 | Double_t denominator15 = 1.-sumOfWW15/(sumOfW1st15*sumOfW2nd15); | |
3521 | // covariance: | |
3522 | Double_t covariance15 = numerator15/denominator15; | |
3523 | // weight dependent prefactor for covariance: | |
3524 | Double_t wPrefactor15 = sumOfWW15/(sumOfW1st15*sumOfW2nd15); | |
3525 | // finally, store "weighted" covariance: | |
3526 | fIntFlowCovariancesNUA->SetBinContent(15,wPrefactor15*covariance15); | |
3527 | ||
3528 | // Cov(<cos(phi1)>,<cos(phi1-phi2-phi3)>): | |
3529 | Double_t product16 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(16); // <<cos(phi1)><cos(phi1-phi2-phi3)>> | |
3530 | Double_t term1st16 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
3531 | Double_t term2nd16 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
3532 | Double_t sumOfW1st16 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
3533 | Double_t sumOfW2nd16 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
3534 | Double_t sumOfWW16 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(16); // W_{<cos(phi1)>} * W_{<cos(phi1-phi2-phi3)>} | |
3535 | // numerator in the expression for the the unbiased estimator for covariance: | |
3536 | Double_t numerator16 = product16 - term1st16*term2nd16; | |
3537 | // denominator in the expression for the the unbiased estimator for covariance: | |
3538 | Double_t denominator16 = 1.-sumOfWW16/(sumOfW1st16*sumOfW2nd16); | |
3539 | // covariance: | |
3540 | Double_t covariance16 = numerator16/denominator16; | |
3541 | // weight dependent prefactor for covariance: | |
3542 | Double_t wPrefactor16 = sumOfWW16/(sumOfW1st16*sumOfW2nd16); | |
3543 | // finally, store "weighted" covariance: | |
3544 | fIntFlowCovariancesNUA->SetBinContent(16,wPrefactor16*covariance16); | |
3545 | ||
3546 | // Cov(<cos(phi1)>,<sin(phi1-phi2-phi3)>): | |
3547 | Double_t product17 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(17); // <<cos(phi1)><sin(phi1-phi2-phi3)>> | |
3548 | Double_t term1st17 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
3549 | Double_t term2nd17 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
3550 | Double_t sumOfW1st17 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
3551 | Double_t sumOfW2nd17 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
3552 | Double_t sumOfWW17 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(17); // W_{<cos(phi1)>} * W_{<sin(phi1-phi2-phi3)>} | |
3553 | // numerator in the expression for the the unbiased estimator for covariance: | |
3554 | Double_t numerator17 = product17 - term1st17*term2nd17; | |
3555 | // denominator in the expression for the the unbiased estimator for covariance: | |
3556 | Double_t denominator17 = 1.-sumOfWW17/(sumOfW1st17*sumOfW2nd17); | |
3557 | // covariance: | |
3558 | Double_t covariance17 = numerator17/denominator17; | |
3559 | // weight dependent prefactor for covariance: | |
3560 | Double_t wPrefactor17 = sumOfWW17/(sumOfW1st17*sumOfW2nd17); | |
3561 | // finally, store "weighted" covariance: | |
3562 | fIntFlowCovariancesNUA->SetBinContent(17,wPrefactor17*covariance17); | |
3563 | ||
3564 | // Cov(<sin(phi1)>,<cos(phi1+phi2)>): | |
3565 | Double_t product18 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(18); // <<sin(phi1)><cos(phi1+phi2)>> | |
3566 | Double_t term1st18 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
3567 | Double_t term2nd18 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
3568 | Double_t sumOfW1st18 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
3569 | Double_t sumOfW2nd18 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
3570 | Double_t sumOfWW18 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(18); // W_{<sin(phi1)>} * W_{<cos(phi1+phi2)>} | |
3571 | // numerator in the expression for the the unbiased estimator for covariance: | |
3572 | Double_t numerator18 = product18 - term1st18*term2nd18; | |
3573 | // denominator in the expression for the the unbiased estimator for covariance: | |
3574 | Double_t denominator18 = 1.-sumOfWW18/(sumOfW1st18*sumOfW2nd18); | |
3575 | // covariance: | |
3576 | Double_t covariance18 = numerator18/denominator18; | |
3577 | // weight dependent prefactor for covariance: | |
3578 | Double_t wPrefactor18 = sumOfWW18/(sumOfW1st18*sumOfW2nd18); | |
3579 | // finally, store "weighted" covariance: | |
3580 | fIntFlowCovariancesNUA->SetBinContent(18,wPrefactor18*covariance18); | |
3581 | ||
3582 | // Cov(<sin(phi1)>,<sin(phi1+phi2)>): | |
3583 | Double_t product19 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(19); // <<sin(phi1)><sin(phi1+phi2)>> | |
3584 | Double_t term1st19 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
3585 | Double_t term2nd19 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
3586 | Double_t sumOfW1st19 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
3587 | Double_t sumOfW2nd19 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
3588 | Double_t sumOfWW19 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(19); // W_{<sin(phi1)>} * W_{<sin(phi1+phi2)>} | |
3589 | // numerator in the expression for the the unbiased estimator for covariance: | |
3590 | Double_t numerator19 = product19 - term1st19*term2nd19; | |
3591 | // denominator in the expression for the the unbiased estimator for covariance: | |
3592 | Double_t denominator19 = 1.-sumOfWW19/(sumOfW1st19*sumOfW2nd19); | |
3593 | // covariance: | |
3594 | Double_t covariance19 = numerator19/denominator19; | |
3595 | // weight dependent prefactor for covariance: | |
3596 | Double_t wPrefactor19 = sumOfWW19/(sumOfW1st19*sumOfW2nd19); | |
3597 | // finally, store "weighted" covariance: | |
3598 | fIntFlowCovariancesNUA->SetBinContent(19,wPrefactor19*covariance19); | |
3599 | ||
3600 | // Cov(<sin(phi1)>,<cos(phi1-phi2-phi3)>): | |
3601 | Double_t product20 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(20); // <<sin(phi1)><cos(phi1-phi2-phi3)>> | |
3602 | Double_t term1st20 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
3603 | Double_t term2nd20 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
3604 | Double_t sumOfW1st20 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
3605 | Double_t sumOfW2nd20 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
3606 | Double_t sumOfWW20 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(20); // W_{<sin(phi1)>} * W_{<cos(phi1-phi2-phi3)>} | |
3607 | // numerator in the expression for the the unbiased estimator for covariance: | |
3608 | Double_t numerator20 = product20 - term1st20*term2nd20; | |
3609 | // denominator in the expression for the the unbiased estimator for covariance: | |
3610 | Double_t denominator20 = 1.-sumOfWW20/(sumOfW1st20*sumOfW2nd20); | |
3611 | // covariance: | |
3612 | Double_t covariance20 = numerator20/denominator20; | |
3613 | // weight dependent prefactor for covariance: | |
3614 | Double_t wPrefactor20 = sumOfWW20/(sumOfW1st20*sumOfW2nd20); | |
3615 | // finally, store "weighted" covariance: | |
3616 | fIntFlowCovariancesNUA->SetBinContent(20,wPrefactor20*covariance20); | |
3617 | ||
3618 | // Cov(<sin(phi1)>,<sin(phi1-phi2-phi3)>): | |
3619 | Double_t product21 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(21); // <<sin(phi1)><sin(phi1-phi2-phi3)>> | |
3620 | Double_t term1st21 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
3621 | Double_t term2nd21 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
3622 | Double_t sumOfW1st21 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
3623 | Double_t sumOfW2nd21 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
3624 | Double_t sumOfWW21 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(21); // W_{<sin(phi1)>} * W_{<sin(phi1-phi2-phi3)>} | |
3625 | // numerator in the expression for the the unbiased estimator for covariance: | |
3626 | Double_t numerator21 = product21 - term1st21*term2nd21; | |
3627 | // denominator in the expression for the the unbiased estimator for covariance: | |
3628 | Double_t denominator21 = 1.-sumOfWW21/(sumOfW1st21*sumOfW2nd21); | |
3629 | // covariance: | |
3630 | Double_t covariance21 = numerator21/denominator21; | |
3631 | // weight dependent prefactor for covariance: | |
3632 | Double_t wPrefactor21 = sumOfWW21/(sumOfW1st21*sumOfW2nd21); | |
3633 | // finally, store "weighted" covariance: | |
3634 | fIntFlowCovariancesNUA->SetBinContent(21,wPrefactor21*covariance21); | |
3635 | ||
3636 | // Cov(<cos(phi1+phi2)>,<sin(phi1+phi2)>): | |
3637 | Double_t product22 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(22); // <<cos(phi1+phi2)><sin(phi1+phi2)>> | |
3638 | Double_t term1st22 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
3639 | Double_t term2nd22 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
3640 | Double_t sumOfW1st22 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
3641 | Double_t sumOfW2nd22 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
3642 | Double_t sumOfWW22 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(22); // W_{<cos(phi1+phi2)>} * W_{<sin(phi1+phi2)>} | |
3643 | // numerator in the expression for the the unbiased estimator for covariance: | |
3644 | Double_t numerator22 = product22 - term1st22*term2nd22; | |
3645 | // denominator in the expression for the the unbiased estimator for covariance: | |
3646 | Double_t denominator22 = 1.-sumOfWW22/(sumOfW1st22*sumOfW2nd22); | |
3647 | // covariance: | |
3648 | Double_t covariance22 = numerator22/denominator22; | |
3649 | // weight dependent prefactor for covariance: | |
3650 | Double_t wPrefactor22 = sumOfWW22/(sumOfW1st22*sumOfW2nd22); | |
3651 | // finally, store "weighted" covariance: | |
3652 | fIntFlowCovariancesNUA->SetBinContent(22,wPrefactor22*covariance22); | |
3653 | ||
3654 | // Cov(<cos(phi1+phi2)>,<cos(phi1-phi2-phi3)>): | |
3655 | Double_t product23 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(23); // <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
3656 | Double_t term1st23 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
3657 | Double_t term2nd23 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
3658 | Double_t sumOfW1st23 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
3659 | Double_t sumOfW2nd23 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
3660 | Double_t sumOfWW23 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(23); // W_{<cos(phi1+phi2)>} * W_{<cos(phi1-phi2-phi3)>} | |
3661 | // numerator in the expression for the the unbiased estimator for covariance: | |
3662 | Double_t numerator23 = product23 - term1st23*term2nd23; | |
3663 | // denominator in the expression for the the unbiased estimator for covariance: | |
3664 | Double_t denominator23 = 1.-sumOfWW23/(sumOfW1st23*sumOfW2nd23); | |
3665 | // covariance: | |
3666 | Double_t covariance23 = numerator23/denominator23; | |
3667 | // weight dependent prefactor for covariance: | |
3668 | Double_t wPrefactor23 = sumOfWW23/(sumOfW1st23*sumOfW2nd23); | |
3669 | // finally, store "weighted" covariance: | |
3670 | fIntFlowCovariancesNUA->SetBinContent(23,wPrefactor23*covariance23); | |
3671 | ||
3672 | // Cov(<cos(phi1+phi2)>,<sin(phi1-phi2-phi3)>): | |
3673 | Double_t product24 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(24); // <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
3674 | Double_t term1st24 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
3675 | Double_t term2nd24 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
3676 | Double_t sumOfW1st24 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
3677 | Double_t sumOfW2nd24 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
3678 | Double_t sumOfWW24 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(24); // W_{<cos(phi1+phi2)>} * W_{<sin(phi1-phi2-phi3)>} | |
3679 | // numerator in the expression for the the unbiased estimator for covariance: | |
3680 | Double_t numerator24 = product24 - term1st24*term2nd24; | |
3681 | // denominator in the expression for the the unbiased estimator for covariance: | |
3682 | Double_t denominator24 = 1.-sumOfWW24/(sumOfW1st24*sumOfW2nd24); | |
3683 | // covariance: | |
3684 | Double_t covariance24 = numerator24/denominator24; | |
3685 | // weight dependent prefactor for covariance: | |
3686 | Double_t wPrefactor24 = sumOfWW24/(sumOfW1st24*sumOfW2nd24); | |
3687 | // finally, store "weighted" covariance: | |
3688 | fIntFlowCovariancesNUA->SetBinContent(24,wPrefactor24*covariance24); | |
3689 | ||
3690 | // Cov(<sin(phi1+phi2)>,<cos(phi1-phi2-phi3)>): | |
3691 | Double_t product25 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(25); // <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
3692 | Double_t term1st25 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
3693 | Double_t term2nd25 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
3694 | Double_t sumOfW1st25 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
3695 | Double_t sumOfW2nd25 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
3696 | Double_t sumOfWW25 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(25); // W_{<sin(phi1+phi2)>} * W_{<cos(phi1-phi2-phi3)>} | |
3697 | // numerator in the expression for the the unbiased estimator for covariance: | |
3698 | Double_t numerator25 = product25 - term1st25*term2nd25; | |
3699 | // denominator in the expression for the the unbiased estimator for covariance: | |
3700 | Double_t denominator25 = 1.-sumOfWW25/(sumOfW1st25*sumOfW2nd25); | |
3701 | // covariance: | |
3702 | Double_t covariance25 = numerator25/denominator25; | |
3703 | // weight dependent prefactor for covariance: | |
3704 | Double_t wPrefactor25 = sumOfWW25/(sumOfW1st25*sumOfW2nd25); | |
3705 | // finally, store "weighted" covariance: | |
3706 | fIntFlowCovariancesNUA->SetBinContent(25,wPrefactor25*covariance25); | |
3707 | ||
3708 | // Cov(<sin(phi1+phi2)>,<sin(phi1-phi2-phi3)>): | |
3709 | Double_t product26 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(26); // <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
3710 | Double_t term1st26 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
3711 | Double_t term2nd26 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
3712 | Double_t sumOfW1st26 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
3713 | Double_t sumOfW2nd26 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
3714 | Double_t sumOfWW26 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(26); // W_{<sin(phi1+phi2)>} * W_{<sin(phi1-phi2-phi3)>} | |
3715 | // numerator in the expression for the the unbiased estimator for covariance: | |
3716 | Double_t numerator26 = product26 - term1st26*term2nd26; | |
3717 | // denominator in the expression for the the unbiased estimator for covariance: | |
3718 | Double_t denominator26 = 1.-sumOfWW26/(sumOfW1st26*sumOfW2nd26); | |
3719 | // covariance: | |
3720 | Double_t covariance26 = numerator26/denominator26; | |
3721 | // weight dependent prefactor for covariance: | |
3722 | Double_t wPrefactor26 = sumOfWW26/(sumOfW1st26*sumOfW2nd26); | |
3723 | // finally, store "weighted" covariance: | |
3724 | fIntFlowCovariancesNUA->SetBinContent(26,wPrefactor26*covariance26); | |
3725 | ||
3726 | // Cov(<cos(phi1-phi2-phi3)>,<sin(phi1-phi2-phi3)>): | |
3727 | Double_t product27 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(27); // <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>> | |
3728 | Double_t term1st27 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1-phi2-phi3)>> | |
3729 | Double_t term2nd27 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
3730 | Double_t sumOfW1st27 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1-phi2-phi3)>} | |
3731 | Double_t sumOfW2nd27 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
3732 | Double_t sumOfWW27 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(27); // W_{<cos(phi1-phi2-phi3)>} * W_{<sin(phi1-phi2-phi3)>} | |
3733 | // numerator in the expression for the the unbiased estimator for covariance: | |
3734 | Double_t numerator27 = product27 - term1st27*term2nd27; | |
3735 | // denominator in the expression for the the unbiased estimator for covariance: | |
3736 | Double_t denominator27 = 1.-sumOfWW27/(sumOfW1st27*sumOfW2nd27); | |
3737 | // covariance: | |
3738 | Double_t covariance27 = numerator27/denominator27; | |
3739 | // weight dependent prefactor for covariance: | |
3740 | Double_t wPrefactor27 = sumOfWW27/(sumOfW1st27*sumOfW2nd27); | |
3741 | // finally, store "weighted" covariance: | |
3742 | fIntFlowCovariancesNUA->SetBinContent(27,wPrefactor27*covariance27); | |
3743 | ||
3744 | } // end of AliFlowAnalysisWithQCumulants::CalculateCovariancesNUAIntFlow() | |
3745 | ||
3746 | ||
3747 | //================================================================================================================================ | |
3748 | ||
3749 | ||
489d5531 | 3750 | void AliFlowAnalysisWithQCumulants::FinalizeCorrelationsIntFlow() |
3751 | { | |
3752 | // From profile fIntFlowCorrelationsPro access measured correlations and spread, | |
3753 | // correctly calculate the statistical errors and store the final results and | |
3754 | // statistical errors for correlations in histogram fIntFlowCorrelationsHist. | |
3755 | // | |
3756 | // Remark: Statistical error of correlation is calculated as: | |
3757 | // | |
3758 | // statistical error = termA * spread * termB: | |
3759 | // termA = sqrt{sum_{i=1}^{N} w^2}/(sum_{i=1}^{N} w) | |
3760 | // termB = 1/sqrt(1-termA^2) | |
b3dacf6b | 3761 | // |
3762 | ||
489d5531 | 3763 | for(Int_t ci=1;ci<=4;ci++) // correlation index |
3764 | { | |
3765 | Double_t correlation = fIntFlowCorrelationsPro->GetBinContent(ci); | |
3766 | Double_t spread = fIntFlowCorrelationsPro->GetBinError(ci); | |
3767 | Double_t sumOfLinearEventWeights = fIntFlowSumOfEventWeights[0]->GetBinContent(ci); | |
3768 | Double_t sumOfQuadraticEventWeights = fIntFlowSumOfEventWeights[1]->GetBinContent(ci); | |
3769 | Double_t termA = 0.; | |
3770 | Double_t termB = 0.; | |
b3dacf6b | 3771 | if(TMath::Abs(sumOfLinearEventWeights) > 0.) // to be improved - shall I omitt here Abs() ? |
489d5531 | 3772 | { |
3773 | termA = pow(sumOfQuadraticEventWeights,0.5)/sumOfLinearEventWeights; | |
3774 | } else | |
3775 | { | |
b3dacf6b | 3776 | cout<<endl; |
3777 | cout<<" WARNING (QC): sumOfLinearEventWeights == 0 in method FinalizeCorrelationsIntFlow() !!!!"<<endl; | |
3778 | cout<<" (for "<<2*ci<<"-particle correlation)"<<endl; | |
3779 | cout<<endl; | |
489d5531 | 3780 | } |
3781 | if(1.-pow(termA,2.) > 0.) | |
3782 | { | |
3783 | termB = 1./pow(1-pow(termA,2.),0.5); | |
3784 | } else | |
3785 | { | |
b3dacf6b | 3786 | cout<<endl; |
3787 | cout<<" WARNING (QC): 1.-pow(termA,2.) <= 0 in method FinalizeCorrelationsIntFlow() !!!!"<<endl; | |
3788 | cout<<" (for "<<2*ci<<"-particle correlation)"<<endl; | |
3789 | cout<<endl; | |
489d5531 | 3790 | } |
3791 | Double_t statisticalError = termA * spread * termB; | |
3792 | fIntFlowCorrelationsHist->SetBinContent(ci,correlation); | |
3793 | fIntFlowCorrelationsHist->SetBinError(ci,statisticalError); | |
ff70ca91 | 3794 | } // end of for(Int_t ci=1;ci<=4;ci++) // correlation index |
3795 | ||
b3dacf6b | 3796 | // Versus multiplicity: |
3797 | if(!fCalculateCumulantsVsM){return;} | |
ff70ca91 | 3798 | for(Int_t ci=0;ci<=3;ci++) // correlation index |
3799 | { | |
3800 | Int_t nBins = fIntFlowCorrelationsVsMPro[ci]->GetNbinsX(); | |
3801 | for(Int_t b=1;b<=nBins;b++) // looping over multiplicity bins | |
3802 | { | |
3803 | Double_t correlationVsM = fIntFlowCorrelationsVsMPro[ci]->GetBinContent(b); | |
3804 | Double_t spreadVsM = fIntFlowCorrelationsVsMPro[ci]->GetBinError(b); | |
3805 | Double_t sumOfLinearEventWeightsVsM = fIntFlowSumOfEventWeightsVsM[ci][0]->GetBinContent(b); | |
3806 | Double_t sumOfQuadraticEventWeightsVsM = fIntFlowSumOfEventWeightsVsM[ci][1]->GetBinContent(b); | |
3807 | Double_t termAVsM = 0.; | |
3808 | Double_t termBVsM = 0.; | |
b3dacf6b | 3809 | if(TMath::Abs(sumOfLinearEventWeightsVsM) > 0.) // to be improved - shall I omitt here Abs() ? |
ff70ca91 | 3810 | { |
3811 | termAVsM = pow(sumOfQuadraticEventWeightsVsM,0.5)/sumOfLinearEventWeightsVsM; | |
b3dacf6b | 3812 | } |
ff70ca91 | 3813 | if(1.-pow(termAVsM,2.) > 0.) |
3814 | { | |
3815 | termBVsM = 1./pow(1-pow(termAVsM,2.),0.5); | |
b3dacf6b | 3816 | } |
ff70ca91 | 3817 | Double_t statisticalErrorVsM = termAVsM * spreadVsM * termBVsM; |
3818 | fIntFlowCorrelationsVsMHist[ci]->SetBinContent(b,correlationVsM); | |
3819 | fIntFlowCorrelationsVsMHist[ci]->SetBinError(b,statisticalErrorVsM); | |
3820 | } // end of for(Int_t b=1;b<=nBins;b++) | |
3821 | } // end of for(Int_t ci=1;ci<=4;ci++) // correlation index | |
3822 | ||
489d5531 | 3823 | } // end of AliFlowAnalysisWithQCumulants::FinalizeCorrelationsIntFlow() |
3824 | ||
489d5531 | 3825 | //================================================================================================================================ |
3826 | ||
489d5531 | 3827 | void AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(Int_t nRP) |
3828 | { | |
3829 | // Fill profile fAverageMultiplicity to hold average multiplicities and number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8 | |
3830 | ||
3831 | // Binning of fAverageMultiplicity is organized as follows: | |
3832 | // 1st bin: all events (including the empty ones) | |
3833 | // 2nd bin: event with # of RPs greater or equal to 1 | |
3834 | // 3rd bin: event with # of RPs greater or equal to 2 | |
3835 | // 4th bin: event with # of RPs greater or equal to 3 | |
3836 | // 5th bin: event with # of RPs greater or equal to 4 | |
3837 | // 6th bin: event with # of RPs greater or equal to 5 | |
3838 | // 7th bin: event with # of RPs greater or equal to 6 | |
3839 | // 8th bin: event with # of RPs greater or equal to 7 | |
3840 | // 9th bin: event with # of RPs greater or equal to 8 | |
3841 | ||
3842 | if(!fAvMultiplicity) | |
3843 | { | |
3844 | cout<<"WARNING: fAvMultiplicity is NULL in AFAWQC::FAM() !!!!"<<endl; | |
3845 | exit(0); | |
3846 | } | |
3847 | ||
3848 | if(nRP<0) | |
3849 | { | |
3850 | cout<<"WARNING: nRP<0 in in AFAWQC::FAM() !!!!"<<endl; | |
3851 | exit(0); | |
3852 | } | |
3853 | ||
3854 | for(Int_t i=0;i<9;i++) | |
3855 | { | |
3856 | if(nRP>=i) fAvMultiplicity->Fill(i+0.5,nRP,1); | |
3857 | } | |
3858 | ||
3859 | } // end of AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(nRP) | |
3860 | ||
3861 | ||
3862 | //================================================================================================================================ | |
3863 | ||
3864 | ||
3865 | void AliFlowAnalysisWithQCumulants::CalculateCumulantsIntFlow() | |
b3dacf6b | 3866 | { |
489d5531 | 3867 | // a) Calculate Q-cumulants from the measured multiparticle correlations. |
3868 | // b) Propagate the statistical errors of measured multiparticle correlations to statistical errors of Q-cumulants. | |
3869 | // c) REMARK: Q-cumulants calculated in this method are biased by non-uniform acceptance of detector !!!! | |
3870 | // Method ApplyCorrectionForNonUniformAcceptance* (to be improved: finalize the name here) | |
3871 | // is called afterwards to correct for this bias. | |
3872 | // d) Store the results and statistical error of Q-cumulants in histogram fCumulants. | |
3873 | // Binning of fCumulants is organized as follows: | |
3874 | // | |
b3dacf6b | 3875 | // 1st bin: QC{2} |
3876 | // 2nd bin: QC{4} | |
3877 | // 3rd bin: QC{6} | |
3878 | // 4th bin: QC{8} | |
3879 | // | |
489d5531 | 3880 | |
b3dacf6b | 3881 | // to be improved: revise the names and check the pointers used in this method |
489d5531 | 3882 | |
b3dacf6b | 3883 | // Correlations: |
489d5531 | 3884 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> |
3885 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> | |
3886 | Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> | |
3887 | Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> | |
b3dacf6b | 3888 | // Statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations: |
489d5531 | 3889 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <2> |
3890 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <4> | |
3891 | Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <6> | |
3892 | Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <8> | |
b3dacf6b | 3893 | // Covariances (multiplied by prefactor depending on weights - see comments in CalculateCovariancesIntFlow()): |
489d5531 | 3894 | Double_t wCov24 = fIntFlowCovariances->GetBinContent(1); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) |
3895 | Double_t wCov26 = fIntFlowCovariances->GetBinContent(2); // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>) | |
3896 | Double_t wCov28 = fIntFlowCovariances->GetBinContent(3); // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>) | |
3897 | Double_t wCov46 = fIntFlowCovariances->GetBinContent(4); // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>) | |
3898 | Double_t wCov48 = fIntFlowCovariances->GetBinContent(5); // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>) | |
b3dacf6b | 3899 | Double_t wCov68 = fIntFlowCovariances->GetBinContent(6); // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>) |
489d5531 | 3900 | // Q-cumulants: |
3901 | Double_t qc2 = 0.; // QC{2} | |
3902 | Double_t qc4 = 0.; // QC{4} | |
3903 | Double_t qc6 = 0.; // QC{6} | |
3904 | Double_t qc8 = 0.; // QC{8} | |
b3dacf6b | 3905 | if(TMath::Abs(two) > 0.){qc2 = two;} |
3906 | if(TMath::Abs(four) > 0.){qc4 = four-2.*pow(two,2.);} | |
3907 | if(TMath::Abs(six) > 0.){qc6 = six-9.*two*four+12.*pow(two,3.);} | |
3908 | if(TMath::Abs(eight) > 0.){qc8 = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.);} | |
3909 | // Statistical errors of Q-cumulants: | |
489d5531 | 3910 | Double_t qc2Error = 0.; |
3911 | Double_t qc4Error = 0.; | |
3912 | Double_t qc6Error = 0.; | |
b3dacf6b | 3913 | Double_t qc8Error = 0.; |
3914 | // Squared statistical errors of Q-cumulants: | |
489d5531 | 3915 | //Double_t qc2ErrorSquared = 0.; |
3916 | Double_t qc4ErrorSquared = 0.; | |
3917 | Double_t qc6ErrorSquared = 0.; | |
b3dacf6b | 3918 | Double_t qc8ErrorSquared = 0.; |
3919 | // Statistical error of QC{2}: | |
3920 | qc2Error = twoError; | |
3921 | // Statistical error of QC{4}: | |
489d5531 | 3922 | qc4ErrorSquared = 16.*pow(two,2.)*pow(twoError,2)+pow(fourError,2.) |
3923 | - 8.*two*wCov24; | |
3924 | if(qc4ErrorSquared>0.) | |
3925 | { | |
3926 | qc4Error = pow(qc4ErrorSquared,0.5); | |
3927 | } else | |
3928 | { | |
b3dacf6b | 3929 | cout<<" WARNING (QC): Statistical error of QC{4} is imaginary !!!!"<<endl; |
3930 | } | |
3931 | // Statistical error of QC{6}: | |
489d5531 | 3932 | qc6ErrorSquared = 81.*pow(4.*pow(two,2.)-four,2.)*pow(twoError,2.) |
3933 | + 81.*pow(two,2.)*pow(fourError,2.) | |
3934 | + pow(sixError,2.) | |
3935 | - 162.*two*(4.*pow(two,2.)-four)*wCov24 | |
3936 | + 18.*(4.*pow(two,2.)-four)*wCov26 | |
b3dacf6b | 3937 | - 18.*two*wCov46; |
489d5531 | 3938 | if(qc6ErrorSquared>0.) |
3939 | { | |
3940 | qc6Error = pow(qc6ErrorSquared,0.5); | |
3941 | } else | |
3942 | { | |
b3dacf6b | 3943 | cout<<" WARNING (QC): Statistical error of QC{6} is imaginary !!!!"<<endl; |
3944 | } | |
3945 | // Statistical error of QC{8}: | |
489d5531 | 3946 | qc8ErrorSquared = 256.*pow(36.*pow(two,3.)-18.*four*two+six,2.)*pow(twoError,2.) |
3947 | + 1296.*pow(4.*pow(two,2.)-four,2.)*pow(fourError,2.) | |
3948 | + 256.*pow(two,2.)*pow(sixError,2.) | |
3949 | + pow(eightError,2.) | |
3950 | - 1152.*(36.*pow(two,3.)-18.*four*two+six)*(4.*pow(two,2.)-four)*wCov24 | |
3951 | + 512.*two*(36.*pow(two,3.)-18.*four*two+six)*wCov26 | |
3952 | - 32.*(36.*pow(two,3.)-18.*four*two+six)*wCov28 | |
3953 | - 1152.*two*(4.*pow(two,2.)-four)*wCov46 | |
3954 | + 72.*(4.*pow(two,2.)-four)*wCov48 | |
3955 | - 32.*two*wCov68; | |
3956 | if(qc8ErrorSquared>0.) | |
3957 | { | |
3958 | qc8Error = pow(qc8ErrorSquared,0.5); | |
3959 | } else | |
3960 | { | |
b3dacf6b | 3961 | cout<<"WARNING (QC): Statistical error of QC{8} is imaginary !!!!"<<endl; |
489d5531 | 3962 | } |
b3dacf6b | 3963 | // Store the results and statistical errors for Q-cumulants: |
3964 | if(TMath::Abs(qc2)>0.) | |
3965 | { | |
3966 | fIntFlowQcumulants->SetBinContent(1,qc2); | |
3967 | fIntFlowQcumulants->SetBinError(1,qc2Error); | |
3968 | } | |
3969 | if(TMath::Abs(qc4)>0.) | |
3970 | { | |
3971 | fIntFlowQcumulants->SetBinContent(2,qc4); | |
3972 | fIntFlowQcumulants->SetBinError(2,qc4Error); | |
3973 | } | |
3974 | if(TMath::Abs(qc6)>0.) | |
3975 | { | |
3976 | fIntFlowQcumulants->SetBinContent(3,qc6); | |
3977 | fIntFlowQcumulants->SetBinError(3,qc6Error); | |
3978 | } | |
3979 | if(TMath::Abs(qc8)>0.) | |
3980 | { | |
3981 | fIntFlowQcumulants->SetBinContent(4,qc8); | |
3982 | fIntFlowQcumulants->SetBinError(4,qc8Error); | |
3983 | } | |
3984 | ||
3985 | // Versus multiplicity: | |
3986 | if(!fCalculateCumulantsVsM){return;} | |
9da1a4f3 | 3987 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) |
b3dacf6b | 3988 | Double_t value[4] = {0.}; // QCs vs M |
3989 | Double_t error[4] = {0.}; // error of QCs vs M | |
3990 | Double_t dSum1[4] = {0.}; // sum value_i/(error_i)^2 | |
3991 | Double_t dSum2[4] = {0.}; // sum 1/(error_i)^2 | |
9da1a4f3 | 3992 | for(Int_t b=1;b<=nBins;b++) |
3993 | { | |
b3dacf6b | 3994 | // Correlations: |
9da1a4f3 | 3995 | two = fIntFlowCorrelationsVsMHist[0]->GetBinContent(b); // <<2>> |
3996 | four = fIntFlowCorrelationsVsMHist[1]->GetBinContent(b); // <<4>> | |
3997 | six = fIntFlowCorrelationsVsMHist[2]->GetBinContent(b); // <<6>> | |
3998 | eight = fIntFlowCorrelationsVsMHist[3]->GetBinContent(b); // <<8>> | |
b3dacf6b | 3999 | // Statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations: |
9da1a4f3 | 4000 | twoError = fIntFlowCorrelationsVsMHist[0]->GetBinError(b); // statistical error of <2> |
4001 | fourError = fIntFlowCorrelationsVsMHist[1]->GetBinError(b); // statistical error of <4> | |
4002 | sixError = fIntFlowCorrelationsVsMHist[2]->GetBinError(b); // statistical error of <6> | |
4003 | eightError = fIntFlowCorrelationsVsMHist[3]->GetBinError(b); // statistical error of <8> | |
b3dacf6b | 4004 | // Covariances (multiplied by prefactor depending on weights - see comments in CalculateCovariancesIntFlow()): |
9da1a4f3 | 4005 | wCov24 = fIntFlowCovariancesVsM[0]->GetBinContent(b); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) |
4006 | wCov26 = fIntFlowCovariancesVsM[1]->GetBinContent(b); // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>) | |
4007 | wCov28 = fIntFlowCovariancesVsM[2]->GetBinContent(b); // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>) | |
4008 | wCov46 = fIntFlowCovariancesVsM[3]->GetBinContent(b); // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>) | |
4009 | wCov48 = fIntFlowCovariancesVsM[4]->GetBinContent(b); // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>) | |
b3dacf6b | 4010 | wCov68 = fIntFlowCovariancesVsM[5]->GetBinContent(b); // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>) |
9da1a4f3 | 4011 | // Q-cumulants: |
4012 | qc2 = 0.; // QC{2} | |
4013 | qc4 = 0.; // QC{4} | |
4014 | qc6 = 0.; // QC{6} | |
4015 | qc8 = 0.; // QC{8} | |
b3dacf6b | 4016 | if(TMath::Abs(two) > 0.){qc2 = two;} |
4017 | if(TMath::Abs(four) > 0.){qc4 = four-2.*pow(two,2.);} | |
4018 | if(TMath::Abs(six) > 0.){qc6 = six-9.*two*four+12.*pow(two,3.);} | |
4019 | if(TMath::Abs(eight) > 0.){qc8 = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.);} | |
4020 | // Statistical errors of Q-cumulants: | |
9da1a4f3 | 4021 | qc2Error = 0.; |
4022 | qc4Error = 0.; | |
4023 | qc6Error = 0.; | |
b3dacf6b | 4024 | qc8Error = 0.; |
4025 | // Squared statistical errors of Q-cumulants: | |
9da1a4f3 | 4026 | //Double_t qc2ErrorSquared = 0.; |
4027 | qc4ErrorSquared = 0.; | |
4028 | qc6ErrorSquared = 0.; | |
b3dacf6b | 4029 | qc8ErrorSquared = 0.; |
4030 | // Statistical error of QC{2}: | |
4031 | qc2Error = twoError; | |
4032 | // Statistical error of QC{4}: | |
9da1a4f3 | 4033 | qc4ErrorSquared = 16.*pow(two,2.)*pow(twoError,2)+pow(fourError,2.) |
4034 | - 8.*two*wCov24; | |
4035 | if(qc4ErrorSquared>0.) | |
4036 | { | |
4037 | qc4Error = pow(qc4ErrorSquared,0.5); | |
4038 | } else | |
4039 | { | |
4040 | // cout<<"WARNING: Statistical error of QC{4} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl; | |
b3dacf6b | 4041 | } |
4042 | // Statistical error of QC{6}: | |
9da1a4f3 | 4043 | qc6ErrorSquared = 81.*pow(4.*pow(two,2.)-four,2.)*pow(twoError,2.) |
4044 | + 81.*pow(two,2.)*pow(fourError,2.) | |
4045 | + pow(sixError,2.) | |
4046 | - 162.*two*(4.*pow(two,2.)-four)*wCov24 | |
4047 | + 18.*(4.*pow(two,2.)-four)*wCov26 | |
b3dacf6b | 4048 | - 18.*two*wCov46; |
9da1a4f3 | 4049 | if(qc6ErrorSquared>0.) |
4050 | { | |
4051 | qc6Error = pow(qc6ErrorSquared,0.5); | |
4052 | } else | |
4053 | { | |
4054 | // cout<<"WARNING: Statistical error of QC{6} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl; | |
b3dacf6b | 4055 | } |
4056 | // Statistical error of QC{8}: | |
9da1a4f3 | 4057 | qc8ErrorSquared = 256.*pow(36.*pow(two,3.)-18.*four*two+six,2.)*pow(twoError,2.) |
4058 | + 1296.*pow(4.*pow(two,2.)-four,2.)*pow(fourError,2.) | |
4059 | + 256.*pow(two,2.)*pow(sixError,2.) | |
4060 | + pow(eightError,2.) | |
4061 | - 1152.*(36.*pow(two,3.)-18.*four*two+six)*(4.*pow(two,2.)-four)*wCov24 | |
4062 | + 512.*two*(36.*pow(two,3.)-18.*four*two+six)*wCov26 | |
4063 | - 32.*(36.*pow(two,3.)-18.*four*two+six)*wCov28 | |
4064 | - 1152.*two*(4.*pow(two,2.)-four)*wCov46 | |
4065 | + 72.*(4.*pow(two,2.)-four)*wCov48 | |
4066 | - 32.*two*wCov68; | |
4067 | if(qc8ErrorSquared>0.) | |
4068 | { | |
4069 | qc8Error = pow(qc8ErrorSquared,0.5); | |
4070 | } else | |
4071 | { | |
4072 | // cout<<"WARNING: Statistical error of QC{8} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl; | |
4073 | } | |
b3dacf6b | 4074 | // Store the results and statistical errors for Q-cumulants: |
4075 | if(TMath::Abs(qc2)>0.) | |
4076 | { | |
4077 | fIntFlowQcumulantsVsM[0]->SetBinContent(b,qc2); | |
4078 | fIntFlowQcumulantsVsM[0]->SetBinError(b,qc2Error); | |
4079 | } | |
4080 | if(TMath::Abs(qc4)>0.) | |
4081 | { | |
4082 | fIntFlowQcumulantsVsM[1]->SetBinContent(b,qc4); | |
4083 | fIntFlowQcumulantsVsM[1]->SetBinError(b,qc4Error); | |
4084 | } | |
4085 | if(TMath::Abs(qc6)>0.) | |
4086 | { | |
4087 | fIntFlowQcumulantsVsM[2]->SetBinContent(b,qc6); | |
4088 | fIntFlowQcumulantsVsM[2]->SetBinError(b,qc6Error); | |
4089 | } | |
4090 | if(TMath::Abs(qc8)>0.) | |
4091 | { | |
4092 | fIntFlowQcumulantsVsM[3]->SetBinContent(b,qc8); | |
4093 | fIntFlowQcumulantsVsM[3]->SetBinError(b,qc8Error); | |
4094 | } | |
4095 | // Rebin in M: | |
4096 | for(Int_t co=0;co<4;co++) | |
4097 | { | |
4098 | value[co] = fIntFlowQcumulantsVsM[co]->GetBinContent(b); | |
4099 | error[co] = fIntFlowQcumulantsVsM[co]->GetBinError(b); | |
4100 | if(error[co]>0.) | |
4101 | { | |
4102 | dSum1[co]+=value[co]/(error[co]*error[co]); | |
4103 | dSum2[co]+=1./(error[co]*error[co]); | |
4104 | } | |
4105 | } // end of for(Int_t co=0;co<4;co++) | |
9da1a4f3 | 4106 | } // end of for(Int_t b=1;b<=nBins;b++) |
b3dacf6b | 4107 | // Store rebinned Q-cumulants: |
4108 | for(Int_t co=0;co<4;co++) | |
4109 | { | |
4110 | if(dSum2[co]>0.) | |
4111 | { | |
4112 | fIntFlowQcumulantsRebinnedInM->SetBinContent(co+1,dSum1[co]/dSum2[co]); | |
4113 | fIntFlowQcumulantsRebinnedInM->SetBinError(co+1,pow(1./dSum2[co],0.5)); | |
4114 | } | |
4115 | } // end of for(Int_t co=0;co<4;co++) | |
4116 | ||
489d5531 | 4117 | } // end of AliFlowAnalysisWithQCumulants::CalculateCumulantsIntFlow() |
4118 | ||
489d5531 | 4119 | //================================================================================================================================ |
4120 | ||
489d5531 | 4121 | void AliFlowAnalysisWithQCumulants::CalculateIntFlow() |
4122 | { | |
0328db2d | 4123 | // a) Calculate the final results for reference flow estimates from Q-cumulants. |
b3dacf6b | 4124 | // b) Propagate the statistical errors to reference flow estimates from |
4125 | // - measured multiparticle correlations (set kTRUE for fPropagateErrorFromCorrelations), or | |
4126 | // - cumulants (set kFALSE for fPropagateErrorFromCorrelations). | |
0328db2d | 4127 | // c) Store the results and statistical errors of reference flow estimates in histogram fIntFlow. |
489d5531 | 4128 | // Binning of fIntFlow is organized as follows: |
4129 | // | |
b3dacf6b | 4130 | // 1st bin: v{2,QC} |
4131 | // 2nd bin: v{4,QC} | |
4132 | // 3rd bin: v{6,QC} | |
4133 | // 4th bin: v{8,QC} | |
4134 | // | |
489d5531 | 4135 | |
b3dacf6b | 4136 | // to be improved: revise the names and check the pointers used in this method, add something about calculation vs M |
4137 | ||
489d5531 | 4138 | if(!(fIntFlowCorrelationsHist && fIntFlowCovariances && fIntFlowQcumulants && fIntFlow)) |
4139 | { | |
4140 | cout<<"WARNING: fIntFlowCorrelationsHist && fIntFlowCovariances && fIntFlowQcumulants && fIntFlow is NULL in AFAWQC::CCIF() !!!!"<<endl; | |
4141 | exit(0); | |
4142 | } | |
4143 | ||
b3dacf6b | 4144 | // Reference flow estimates: |
489d5531 | 4145 | Double_t v2 = 0.; // v{2,QC} |
4146 | Double_t v4 = 0.; // v{4,QC} | |
4147 | Double_t v6 = 0.; // v{6,QC} | |
4148 | Double_t v8 = 0.; // v{8,QC} | |
b3dacf6b | 4149 | // Reference flow's statistical errors: |
4150 | Double_t v2Error = 0.; // v{2,QC} stat. error | |
4151 | Double_t v4Error = 0.; // v{4,QC} stat. error | |
4152 | Double_t v6Error = 0.; // v{6,QC} stat. error | |
4153 | Double_t v8Error = 0.; // v{8,QC} stat. error | |
4154 | ||
4155 | if(!fPropagateErrorFromCorrelations) | |
9da1a4f3 | 4156 | { |
4157 | // Q-cumulants: | |
b3dacf6b | 4158 | Double_t qc2 = fIntFlowQcumulants->GetBinContent(1); // QC{2} |
4159 | Double_t qc4 = fIntFlowQcumulants->GetBinContent(2); // QC{4} | |
4160 | Double_t qc6 = fIntFlowQcumulants->GetBinContent(3); // QC{6} | |
4161 | Double_t qc8 = fIntFlowQcumulants->GetBinContent(4); // QC{8} | |
4162 | // Q-cumulants's statistical errors: | |
4163 | Double_t qc2Error = fIntFlowQcumulants->GetBinError(1); // QC{2} stat. error | |
4164 | Double_t qc4Error = fIntFlowQcumulants->GetBinError(2); // QC{4} stat. error | |
4165 | Double_t qc6Error = fIntFlowQcumulants->GetBinError(3); // QC{6} stat. error | |
4166 | Double_t qc8Error = fIntFlowQcumulants->GetBinError(4); // QC{8} stat. error | |
4167 | // Calculate reference flow estimates from Q-cumulants: | |
4168 | if(qc2>=0.){v2 = pow(qc2,1./2.);} | |
4169 | if(qc4<=0.){v4 = pow(-1.*qc4,1./4.);} | |
4170 | if(qc6>=0.){v6 = pow((1./4.)*qc6,1./6.);} | |
4171 | if(qc8<=0.){v8 = pow((-1./33.)*qc8,1./8.);} | |
4172 | // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants: | |
4173 | if(qc2>0.){v2Error = (1./2.)*pow(qc2,-1./2.)*qc2Error;} | |
4174 | if(qc4<0.){v4Error = (1./4.)*pow(-qc4,-3./4.)*qc4Error;} | |
4175 | if(qc6>0.){v6Error = (1./6.)*pow(2.,-1./3.)*pow(qc6,-5./6.)*qc6Error;} | |
4176 | if(qc8<0.){v8Error = (1./8.)*pow(33.,-1./8.)*pow(-qc8,-7./8.)*qc8Error;} | |
4177 | // Print warnings for the 'wrong sign' cumulants: | |
4178 | if(TMath::Abs(v2) < 1.e-44) | |
4179 | { | |
4180 | cout<<" WARNING: Wrong sign QC{2}, couldn't calculate v{2,QC} !!!!"<<endl; | |
4181 | } | |
4182 | if(TMath::Abs(v4) < 1.e-44) | |
4183 | { | |
4184 | cout<<" WARNING: Wrong sign QC{4}, couldn't calculate v{4,QC} !!!!"<<endl; | |
4185 | } | |
4186 | if(TMath::Abs(v6) < 1.e-44) | |
4187 | { | |
4188 | cout<<" WARNING: Wrong sign QC{6}, couldn't calculate v{6,QC} !!!!"<<endl; | |
4189 | } | |
4190 | if(TMath::Abs(v8) < 1.e-44) | |
4191 | { | |
4192 | cout<<" WARNING: Wrong sign QC{8}, couldn't calculate v{8,QC} !!!!"<<endl; | |
4193 | } | |
4194 | // Store the results and statistical errors of integrated flow estimates: | |
4195 | fIntFlow->SetBinContent(1,v2); | |
4196 | fIntFlow->SetBinError(1,v2Error); | |
4197 | fIntFlow->SetBinContent(2,v4); | |
4198 | fIntFlow->SetBinError(2,v4Error); | |
4199 | fIntFlow->SetBinContent(3,v6); | |
4200 | fIntFlow->SetBinError(3,v6Error); | |
4201 | fIntFlow->SetBinContent(4,v8); | |
4202 | fIntFlow->SetBinError(4,v8Error); | |
4203 | ||
4204 | // Versus multiplicity: | |
4205 | if(!fCalculateCumulantsVsM){return;} // to be improved - not compatible with if(fPropagateErrorFromCorrelations) bellow | |
4206 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) | |
4207 | for(Int_t b=1;b<=nBins;b++) | |
4208 | { | |
4209 | // Q-cumulants: | |
4210 | Double_t qc2VsM = fIntFlowQcumulantsVsM[0]->GetBinContent(b); // QC{2} | |
4211 | Double_t qc4VsM = fIntFlowQcumulantsVsM[1]->GetBinContent(b); // QC{4} | |
4212 | Double_t qc6VsM = fIntFlowQcumulantsVsM[2]->GetBinContent(b); // QC{6} | |
4213 | Double_t qc8VsM = fIntFlowQcumulantsVsM[3]->GetBinContent(b); // QC{8} | |
4214 | // Q-cumulants's statistical errors: | |
4215 | Double_t qc2ErrorVsM = fIntFlowQcumulantsVsM[0]->GetBinError(b); // QC{2} stat. error | |
4216 | Double_t qc4ErrorVsM = fIntFlowQcumulantsVsM[1]->GetBinError(b); // QC{4} stat. error | |
4217 | Double_t qc6ErrorVsM = fIntFlowQcumulantsVsM[2]->GetBinError(b); // QC{6} stat. error | |
4218 | Double_t qc8ErrorVsM = fIntFlowQcumulantsVsM[3]->GetBinError(b); // QC{8} stat. error | |
4219 | // Reference flow estimates: | |
4220 | Double_t v2VsM = 0.; // v{2,QC} | |
4221 | Double_t v4VsM = 0.; // v{4,QC} | |
4222 | Double_t v6VsM = 0.; // v{6,QC} | |
4223 | Double_t v8VsM = 0.; // v{8,QC} | |
4224 | // Reference flow estimates errors: | |
4225 | Double_t v2ErrorVsM = 0.; // v{2,QC} stat. error | |
4226 | Double_t v4ErrorVsM = 0.; // v{4,QC} stat. error | |
4227 | Double_t v6ErrorVsM = 0.; // v{6,QC} stat. error | |
4228 | Double_t v8ErrorVsM = 0.; // v{8,QC} stat. error | |
4229 | // Calculate reference flow estimates from Q-cumulants: | |
4230 | if(qc2VsM>=0.){v2VsM = pow(qc2VsM,1./2.);} | |
4231 | if(qc4VsM<=0.){v4VsM = pow(-1.*qc4VsM,1./4.);} | |
4232 | if(qc6VsM>=0.){v6VsM = pow((1./4.)*qc6VsM,1./6.);} | |
4233 | if(qc8VsM<=0.){v8VsM = pow((-1./33.)*qc8VsM,1./8.);} | |
4234 | // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants: | |
4235 | if(qc2VsM>0.){v2ErrorVsM = (1./2.)*pow(qc2VsM,-1./2.)*qc2ErrorVsM;} | |
4236 | if(qc4VsM<0.){v4ErrorVsM = (1./4.)*pow(-qc4VsM,-3./4.)*qc4ErrorVsM;} | |
4237 | if(qc6VsM>0.){v6ErrorVsM = (1./6.)*pow(2.,-1./3.)*pow(qc6VsM,-5./6.)*qc6ErrorVsM;} | |
4238 | if(qc8VsM<0.){v8ErrorVsM = (1./8.)*pow(33.,-1./8.)*pow(-qc8VsM,-7./8.)*qc8ErrorVsM;} | |
4239 | // Store the results and statistical errors of integrated flow estimates: | |
4240 | fIntFlowVsM[0]->SetBinContent(b,v2VsM); | |
4241 | fIntFlowVsM[0]->SetBinError(b,v2ErrorVsM); | |
4242 | fIntFlowVsM[1]->SetBinContent(b,v4VsM); | |
4243 | fIntFlowVsM[1]->SetBinError(b,v4ErrorVsM); | |
4244 | fIntFlowVsM[2]->SetBinContent(b,v6VsM); | |
4245 | fIntFlowVsM[2]->SetBinError(b,v6ErrorVsM); | |
4246 | fIntFlowVsM[3]->SetBinContent(b,v8VsM); | |
4247 | fIntFlowVsM[3]->SetBinError(b,v8ErrorVsM); | |
4248 | } // end of for(Int_t b=1;b<=nBins;b++) | |
9da1a4f3 | 4249 | |
b3dacf6b | 4250 | // 'Rebinned in M' calculation: // to be improved - this can be implemented better: |
4251 | // Reference flow estimates: | |
4252 | Double_t v2RebinnedInM = 0.; // v{2,QC} | |
4253 | Double_t v4RebinnedInM = 0.; // v{4,QC} | |
4254 | Double_t v6RebinnedInM = 0.; // v{6,QC} | |
4255 | Double_t v8RebinnedInM = 0.; // v{8,QC} | |
4256 | // Reference flow's statistical errors: | |
4257 | Double_t v2ErrorRebinnedInM = 0.; // v{2,QC} stat. error | |
4258 | Double_t v4ErrorRebinnedInM = 0.; // v{4,QC} stat. error | |
4259 | Double_t v6ErrorRebinnedInM = 0.; // v{6,QC} stat. error | |
4260 | Double_t v8ErrorRebinnedInM = 0.; // v{8,QC} stat. error | |
4261 | // Q-cumulants: | |
4262 | Double_t qc2RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(1); // QC{2} | |
4263 | Double_t qc4RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(2); // QC{4} | |
4264 | Double_t qc6RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(3); // QC{6} | |
4265 | Double_t qc8RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(4); // QC{8} | |
4266 | // Q-cumulants's statistical errors: | |
4267 | Double_t qc2ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(1); // QC{2} stat. error | |
4268 | Double_t qc4ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(2); // QC{4} stat. error | |
4269 | Double_t qc6ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(3); // QC{6} stat. error | |
4270 | Double_t qc8ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(4); // QC{8} stat. error | |
4271 | // Calculate reference flow estimates from Q-cumulants: | |
4272 | if(qc2RebinnedInM>=0.){v2RebinnedInM = pow(qc2RebinnedInM,1./2.);} | |
4273 | if(qc4RebinnedInM<=0.){v4RebinnedInM = pow(-1.*qc4RebinnedInM,1./4.);} | |
4274 | if(qc6RebinnedInM>=0.){v6RebinnedInM = pow((1./4.)*qc6RebinnedInM,1./6.);} | |
4275 | if(qc8RebinnedInM<=0.){v8RebinnedInM = pow((-1./33.)*qc8RebinnedInM,1./8.);} | |
4276 | // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants: | |
4277 | if(qc2RebinnedInM>0.){v2ErrorRebinnedInM = (1./2.)*pow(qc2RebinnedInM,-1./2.)*qc2ErrorRebinnedInM;} | |
4278 | if(qc4RebinnedInM<0.){v4ErrorRebinnedInM = (1./4.)*pow(-qc4RebinnedInM,-3./4.)*qc4ErrorRebinnedInM;} | |
4279 | if(qc6RebinnedInM>0.){v6ErrorRebinnedInM = (1./6.)*pow(2.,-1./3.)*pow(qc6RebinnedInM,-5./6.)*qc6ErrorRebinnedInM;} | |
4280 | if(qc8RebinnedInM<0.){v8ErrorRebinnedInM = (1./8.)*pow(33.,-1./8.)*pow(-qc8RebinnedInM,-7./8.)*qc8ErrorRebinnedInM;} | |
4281 | // Print warnings for the 'wrong sign' cumulants: | |
4282 | if(TMath::Abs(v2RebinnedInM) < 1.e-44) | |
4283 | { | |
4284 | cout<<" WARNING: Wrong sign QC{2} rebinned in M, couldn't calculate v{2,QC} !!!!"<<endl; | |
4285 | } | |
4286 | if(TMath::Abs(v4RebinnedInM) < 1.e-44) | |
4287 | { | |
4288 | cout<<" WARNING: Wrong sign QC{4} rebinned in M, couldn't calculate v{4,QC} !!!!"<<endl; | |
4289 | } | |
4290 | if(TMath::Abs(v6RebinnedInM) < 1.e-44) | |
4291 | { | |
4292 | cout<<" WARNING: Wrong sign QC{6} rebinned in M, couldn't calculate v{6,QC} !!!!"<<endl; | |
4293 | } | |
4294 | if(TMath::Abs(v8RebinnedInM) < 1.e-44) | |
4295 | { | |
4296 | cout<<" WARNING: Wrong sign QC{8} rebinned in M, couldn't calculate v{8,QC} !!!!"<<endl; | |
4297 | } | |
4298 | // Store the results and statistical errors of integrated flow estimates: | |
4299 | fIntFlowRebinnedInM->SetBinContent(1,v2RebinnedInM); | |
4300 | fIntFlowRebinnedInM->SetBinError(1,v2ErrorRebinnedInM); | |
4301 | fIntFlowRebinnedInM->SetBinContent(2,v4RebinnedInM); | |
4302 | fIntFlowRebinnedInM->SetBinError(2,v4ErrorRebinnedInM); | |
4303 | fIntFlowRebinnedInM->SetBinContent(3,v6RebinnedInM); | |
4304 | fIntFlowRebinnedInM->SetBinError(3,v6ErrorRebinnedInM); | |
4305 | fIntFlowRebinnedInM->SetBinContent(4,v8RebinnedInM); | |
4306 | fIntFlowRebinnedInM->SetBinError(4,v8ErrorRebinnedInM); | |
4307 | } // end of if(!fPropagateErrorFromCorrelations) | |
4308 | ||
4309 | // Used only for debugging/cross-checking: | |
4310 | if(fPropagateErrorFromCorrelations) | |
4311 | { | |
4312 | // Measured azimuthal correlations: | |
4313 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> | |
4314 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> | |
4315 | Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> | |
4316 | Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> | |
4317 | // Statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations: | |
4318 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <2> | |
4319 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <4> | |
4320 | Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <6> | |
4321 | Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <8> | |
4322 | // Covariances (multiplied by prefactor depending on weights - see comments in CalculateCovariancesIntFlow()): | |
4323 | Double_t wCov24 = fIntFlowCovariances->GetBinContent(1); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) | |
4324 | Double_t wCov26 = fIntFlowCovariances->GetBinContent(2); // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>) | |
4325 | Double_t wCov28 = fIntFlowCovariances->GetBinContent(3); // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>) | |
4326 | Double_t wCov46 = fIntFlowCovariances->GetBinContent(4); // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>) | |
4327 | Double_t wCov48 = fIntFlowCovariances->GetBinContent(5); // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>) | |
4328 | Double_t wCov68 = fIntFlowCovariances->GetBinContent(6); // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>) | |
4329 | // Calculate reference flow estimates: | |
4330 | if(two>=0.){v2 = pow(two,1./2.);} | |
4331 | if(TMath::Abs(four)>0. && four-2.*pow(two,2.) < 0.){v4 = pow(-1.*(four-2.*pow(two,2.)),1./4.);} | |
4332 | if(TMath::Abs(six)>0. && six-9.*two*four+12.*pow(two,3.) > 0.){v6 = pow((1./4.)*(six-9.*two*four+12.*pow(two,3.)),1./6.);} | |
4333 | if(TMath::Abs(eight)>0. && eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.) < 0.) | |
4334 | {v8 = pow((-1./33.)*(eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.)),1./8.);} | |
4335 | // Squares of statistical errors of reference flow estimates: | |
4336 | Double_t v2ErrorSquared = 0.; // squared statistical error of v{2,QC} | |
4337 | Double_t v4ErrorSquared = 0.; // squared statistical error of v{4,QC} | |
4338 | Double_t v6ErrorSquared = 0.; // squared statistical error of v{6,QC} | |
4339 | Double_t v8ErrorSquared = 0.; // squared statistical error of v{8,QC} | |
4340 | // Calculate squared statistical errors of reference flow estimates: | |
9da1a4f3 | 4341 | if(two > 0.) |
4342 | { | |
4343 | v2ErrorSquared = (1./(4.*two))*pow(twoError,2.); | |
4344 | } | |
4345 | if(2.*pow(two,2.)-four > 0.) | |
4346 | { | |
b3dacf6b | 4347 | v4ErrorSquared = (1./pow(2.*pow(two,2.)-four,3./2.)) |
4348 | * (pow(two,2.)*pow(twoError,2.)+(1./16.)*pow(fourError,2.)-(1./2.)*two*wCov24); | |
9da1a4f3 | 4349 | } |
4350 | if(six-9.*four*two+12.*pow(two,3.) > 0.) | |
4351 | { | |
b3dacf6b | 4352 | v6ErrorSquared = ((1./2.)*(1./pow(2.,2./3.))*(1./pow(six-9.*four*two+12.*pow(two,3.),5./3.))) |
4353 | * ((9./2.)*pow(4.*pow(two,2.)-four,2.)*pow(twoError,2.) | |
4354 | + (9./2.)*pow(two,2.)*pow(fourError,2.)+(1./18.)*pow(sixError,2.) | |
4355 | - 9.*two*(4.*pow(two,2.)-four)*wCov24+(4.*pow(two,2.)-four)*wCov26-two*wCov46); | |
9da1a4f3 | 4356 | } |
4357 | if(-1.*eight+16.*six*two+18.*pow(four,2.)-144.*four*pow(two,2.)+144.*pow(two,4.) > 0.) | |
4358 | { | |
b3dacf6b | 4359 | v8ErrorSquared = (4./pow(33,1./4.)) |
4360 | * (1./pow(-1.*eight+16.*six*two+18.*pow(four,2.)-144.*four*pow(two,2.)+144.*pow(two,4.),7./4.)) | |
4361 | * (pow(36.*pow(two,3.)-18.*four*two+six,2.)*pow(twoError,2.) | |
4362 | + (81./16.)*pow(4.*pow(two,2.)-four,2.)*pow(fourError,2.) | |
4363 | + pow(two,2.)*pow(sixError,2.) | |
4364 | + (1./256.)*pow(eightError,2.) | |
4365 | - (9./2.)*(36.*pow(two,3.)-18.*four*two+six)*(4.*pow(two,2.)-four)*wCov24 | |
4366 | + 2.*two*(36.*pow(two,3.)-18.*four*two+six)*wCov26 | |
4367 | - (1./8.)*(36.*pow(two,3.)-18.*four*two+six)*wCov28 | |
4368 | - (9./2.)*two*(4.*pow(two,2.)-four)*wCov46 | |
4369 | + (9./32.)*(4.*pow(two,2.)-four)*wCov48 | |
4370 | - (1./8.)*two*wCov68); | |
9da1a4f3 | 4371 | } |
b3dacf6b | 4372 | // Calculate statistical errors of reference flow estimates: |
9da1a4f3 | 4373 | if(v2ErrorSquared > 0.) |
4374 | { | |
4375 | v2Error = pow(v2ErrorSquared,0.5); | |
b3dacf6b | 4376 | } |
9da1a4f3 | 4377 | if(v4ErrorSquared > 0.) |
4378 | { | |
4379 | v4Error = pow(v4ErrorSquared,0.5); | |
b3dacf6b | 4380 | } |
9da1a4f3 | 4381 | if(v6ErrorSquared > 0.) |
4382 | { | |
4383 | v6Error = pow(v6ErrorSquared,0.5); | |
b3dacf6b | 4384 | } |
9da1a4f3 | 4385 | if(v8ErrorSquared > 0.) |
4386 | { | |
4387 | v8Error = pow(v8ErrorSquared,0.5); | |
b3dacf6b | 4388 | } |
4389 | // Store the results and statistical errors of integrated flow estimates: | |
4390 | fIntFlow->SetBinContent(1,v2); | |
4391 | fIntFlow->SetBinError(1,v2Error); | |
4392 | fIntFlow->SetBinContent(2,v4); | |
4393 | fIntFlow->SetBinError(2,v4Error); | |
4394 | fIntFlow->SetBinContent(3,v6); | |
4395 | fIntFlow->SetBinError(3,v6Error); | |
4396 | fIntFlow->SetBinContent(4,v8); | |
4397 | fIntFlow->SetBinError(4,v8Error); | |
4398 | } // end of if(fPropagateErrorFromCorrelations) | |
4399 | ||
489d5531 | 4400 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlow() |
4401 | ||
489d5531 | 4402 | //================================================================================================================================ |
4403 | ||
489d5531 | 4404 | void AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow() |
4405 | { | |
0dd3b008 | 4406 | // Fill in AliFlowCommonHistResults histograms relevant for reference flow. |
489d5531 | 4407 | |
0dd3b008 | 4408 | // There are two possibilities here: |
4409 | // a) Store minimum bias reference flow - use SetMinimumBiasReferenceFlow(kTRUE). This result is | |
4410 | // biased by the interplay between nonflow correlations and multiplicity fluctuations and is | |
4411 | // also stored in local histogram fIntFlow; | |
4412 | // b) Store reference flow obtained from flow analysis performed at fixed multiplicity and | |
4413 | // rebinned only at the end of the day - use SetMinimumBiasReferenceFlow(kFALSE). This result | |
4414 | // is also stored in local histogram fIntFlowRebinnedInM. | |
489d5531 | 4415 | |
0dd3b008 | 4416 | // Reference flow estimates: |
4417 | Double_t v[4] = {0.}; | |
4418 | // Statistical errors of reference flow estimates: | |
4419 | Double_t vError[4] = {0.}; | |
489d5531 | 4420 | |
0dd3b008 | 4421 | for(Int_t b=0;b<4;b++) |
4422 | { | |
4423 | if(fMinimumBiasReferenceFlow) | |
4424 | { | |
4425 | v[b] = fIntFlow->GetBinContent(b+1); | |
4426 | vError[b] = fIntFlow->GetBinError(b+1); | |
4427 | } else | |
4428 | { | |
4429 | v[b] = fIntFlowRebinnedInM->GetBinContent(b+1); | |
4430 | vError[b] = fIntFlowRebinnedInM->GetBinError(b+1); | |
4431 | } | |
4432 | } // end of for(Int_t b=0;b<4;b++) | |
4433 | ||
4434 | // Fill AliFlowCommonHistResults histogram: | |
4435 | fCommonHistsResults2nd->FillIntegratedFlow(v[0],vError[0]); // to be improved (hardwired 2nd in the name) | |
4436 | fCommonHistsResults4th->FillIntegratedFlow(v[1],vError[1]); // to be improved (hardwired 4th in the name) | |
489d5531 | 4437 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) // to be improved (calculate also 6th and 8th order) |
4438 | { | |
0dd3b008 | 4439 | fCommonHistsResults6th->FillIntegratedFlow(v[2],vError[2]); // to be improved (hardwired 6th in the name) |
4440 | fCommonHistsResults8th->FillIntegratedFlow(v[3],vError[3]); // to be improved (hardwired 8th in the name) | |
489d5531 | 4441 | } |
4442 | ||
4443 | } // end of AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow() | |
4444 | ||
489d5531 | 4445 | //================================================================================================================================ |
4446 | ||
489d5531 | 4447 | /* |
4448 | void AliFlowAnalysisWithQCumulants::ApplyCorrectionForNonUniformAcceptanceToCumulantsForIntFlow(Bool_t useParticleWeights, TString eventWeights) | |
4449 | { | |
4450 | // apply correction for non-uniform acceptance to cumulants for integrated flow | |
4451 | // (Remark: non-corrected cumulants are accessed from fCumulants[pW][0], corrected cumulants are stored in fCumulants[pW][1]) | |
4452 | ||
4453 | // shortcuts for the flags: | |
4454 | Int_t pW = (Int_t)(useParticleWeights); // 0=pWeights not used, 1=pWeights used | |
4455 | Int_t eW = -1; | |
4456 | ||
4457 | if(eventWeights == "exact") | |
4458 | { | |
4459 | eW = 0; | |
4460 | } | |
4461 | ||
4462 | if(!(fCumulants[pW][eW][0] && fCumulants[pW][eW][1] && fCorrections[pW][eW])) | |
4463 | { | |
4464 | cout<<"WARNING: fCumulants[pW][eW][0] && fCumulants[pW][eW][1] && fCorrections[pW][eW] is NULL in AFAWQC::ACFNUATCFIF() !!!!"<<endl; | |
4465 | cout<<"pW = "<<pW<<endl; | |
4466 | cout<<"eW = "<<eW<<endl; | |
4467 | exit(0); | |
4468 | } | |
4469 | ||
4470 | // non-corrected cumulants: | |
4471 | Double_t qc2 = fCumulants[pW][eW][0]->GetBinContent(1); | |
4472 | Double_t qc4 = fCumulants[pW][eW][0]->GetBinContent(2); | |
4473 | Double_t qc6 = fCumulants[pW][eW][0]->GetBinContent(3); | |
4474 | Double_t qc8 = fCumulants[pW][eW][0]->GetBinContent(4); | |
4475 | // statistical error of non-corrected cumulants: | |
4476 | Double_t qc2Error = fCumulants[pW][eW][0]->GetBinError(1); | |
4477 | Double_t qc4Error = fCumulants[pW][eW][0]->GetBinError(2); | |
4478 | Double_t qc6Error = fCumulants[pW][eW][0]->GetBinError(3); | |
4479 | Double_t qc8Error = fCumulants[pW][eW][0]->GetBinError(4); | |
4480 | // corrections for non-uniform acceptance: | |
4481 | Double_t qc2Correction = fCorrections[pW][eW]->GetBinContent(1); | |
4482 | Double_t qc4Correction = fCorrections[pW][eW]->GetBinContent(2); | |
4483 | Double_t qc6Correction = fCorrections[pW][eW]->GetBinContent(3); | |
4484 | Double_t qc8Correction = fCorrections[pW][eW]->GetBinContent(4); | |
4485 | // corrected cumulants: | |
4486 | Double_t qc2Corrected = qc2 + qc2Correction; | |
4487 | Double_t qc4Corrected = qc4 + qc4Correction; | |
4488 | Double_t qc6Corrected = qc6 + qc6Correction; | |
4489 | Double_t qc8Corrected = qc8 + qc8Correction; | |
4490 | ||
4491 | // ... to be improved (I need here also to correct error of QCs for NUA. | |
4492 | // For simplicity sake I assume at the moment that this correction is negliglible, but it will be added eventually...) | |
4493 | ||
4494 | // store corrected results and statistical errors for cumulants: | |
4495 | fCumulants[pW][eW][1]->SetBinContent(1,qc2Corrected); | |
4496 | fCumulants[pW][eW][1]->SetBinContent(2,qc4Corrected); | |
4497 | fCumulants[pW][eW][1]->SetBinContent(3,qc6Corrected); | |
4498 | fCumulants[pW][eW][1]->SetBinContent(4,qc8Corrected); | |
4499 | fCumulants[pW][eW][1]->SetBinError(1,qc2Error); // to be improved (correct also qc2Error for NUA) | |
4500 | fCumulants[pW][eW][1]->SetBinError(2,qc4Error); // to be improved (correct also qc4Error for NUA) | |
4501 | fCumulants[pW][eW][1]->SetBinError(3,qc6Error); // to be improved (correct also qc6Error for NUA) | |
4502 | fCumulants[pW][eW][1]->SetBinError(4,qc8Error); // to be improved (correct also qc8Error for NUA) | |
4503 | ||
4504 | } // end of AliFlowAnalysisWithQCumulants::ApplyCorrectionForNonUniformAcceptanceToCumulantsForIntFlow(Bool_t useParticleWeights, TString eventWeights) | |
4505 | */ | |
4506 | ||
4507 | ||
4508 | //================================================================================================================================ | |
4509 | ||
4510 | ||
4511 | /* | |
4512 | void AliFlowAnalysisWithQCumulants::PrintQuantifyingCorrectionsForNonUniformAcceptance(Bool_t useParticleWeights, TString eventWeights) | |
4513 | { | |
4514 | // print on the screen QC{n,biased}/QC{n,corrected} | |
4515 | ||
4516 | // shortcuts for the flags: | |
4517 | Int_t pW = (Int_t)(useParticleWeights); // 0=pWeights not used, 1=pWeights used | |
4518 | ||
4519 | Int_t eW = -1; | |
4520 | ||
4521 | if(eventWeights == "exact") | |
4522 | { | |
4523 | eW = 0; | |
4524 | } | |
4525 | ||
4526 | if(!(fCumulants[pW][eW][0] && fCumulants[pW][eW][1])) | |
4527 | { | |
4528 | cout<<"WARNING: fCumulants[pW][eW][0] && fCumulants[pW][eW][1] is NULL in AFAWQC::PQCFNUA() !!!!"<<endl; | |
4529 | cout<<"pW = "<<pW<<endl; | |
4530 | cout<<"eW = "<<eW<<endl; | |
4531 | exit(0); | |
4532 | } | |
4533 | ||
4534 | cout<<endl; | |
4535 | cout<<" Quantifying the bias to Q-cumulants from"<<endl; | |
4536 | cout<<" non-uniform acceptance of the detector:"<<endl; | |
4537 | cout<<endl; | |
4538 | ||
4539 | if(fCumulants[pW][eW][1]->GetBinContent(1)) | |
4540 | { | |
4541 | cout<<" QC{2,biased}/QC{2,corrected} = "<<(fCumulants[pW][eW][0]->GetBinContent(1))/(fCumulants[pW][eW][1]->GetBinContent(1))<<endl; | |
4542 | } | |
4543 | if(fCumulants[pW][eW][1]->GetBinContent(2)) | |
4544 | { | |
4545 | cout<<" QC{4,biased}/QC{4,corrected} = "<<fCumulants[pW][eW][0]->GetBinContent(2)/fCumulants[pW][eW][1]->GetBinContent(2)<<endl; | |
4546 | } | |
4547 | ||
4548 | cout<<endl; | |
4549 | ||
4550 | } // end of AliFlowAnalysisWithQCumulants::PrintQuantifyingCorrectionsForNonUniformAcceptance(Bool_t useParticleWeights, TString eventWeights) | |
4551 | */ | |
4552 | ||
4553 | ||
4554 | //================================================================================================================================ | |
4555 | ||
4556 | ||
4557 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelationsUsingParticleWeights() | |
4558 | { | |
4559 | // Calculate all correlations needed for integrated flow using particle weights. | |
4560 | ||
4561 | // Remark 1: When particle weights are used the binning of fIntFlowCorrelationAllPro is organized as follows: | |
4562 | // | |
4563 | // 1st bin: <2>_{1n|1n} = two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))> | |
4564 | // 2nd bin: <2>_{2n|2n} = two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
4565 | // 3rd bin: <2>_{3n|3n} = two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
4566 | // 4th bin: <2>_{4n|4n} = two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
4567 | // 5th bin: ---- EMPTY ---- | |
4568 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
4569 | // 7th bin: <3>_{3n|2n,1n} = ... | |
4570 | // 8th bin: <3>_{4n|2n,2n} = ... | |
4571 | // 9th bin: <3>_{4n|3n,1n} = ... | |
4572 | // 10th bin: ---- EMPTY ---- | |
4573 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
4574 | // 12th bin: <4>_{2n,1n|2n,1n} = ... | |
4575 | // 13th bin: <4>_{2n,2n|2n,2n} = ... | |
4576 | // 14th bin: <4>_{3n|1n,1n,1n} = ... | |
4577 | // 15th bin: <4>_{3n,1n|3n,1n} = ... | |
4578 | // 16th bin: <4>_{3n,1n|2n,2n} = ... | |
4579 | // 17th bin: <4>_{4n|2n,1n,1n} = ... | |
4580 | // 18th bin: ---- EMPTY ---- | |
4581 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = ... | |
4582 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = ... | |
4583 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = ... | |
4584 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = ... | |
4585 | // 23rd bin: ---- EMPTY ---- | |
4586 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = ... | |
4587 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = ... | |
4588 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = ... | |
4589 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = ... | |
4590 | // 28th bin: ---- EMPTY ---- | |
4591 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = ... | |
4592 | // 30th bin: ---- EMPTY ---- | |
4593 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = ... | |
4594 | ||
4595 | // Remark 2: When particle weights are used there are some extra correlations. They are stored in | |
4596 | // fIntFlowExtraCorrelationsPro binning of which is organized as follows: | |
4597 | ||
4598 | // 1st bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))> | |
4599 | // 2nd bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
4600 | ||
4601 | // multiplicity (number of particles used to determine the reaction plane) | |
4602 | Double_t dMult = (*fSMpk)(0,0); | |
4603 | ||
4604 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
4605 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
4606 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
4607 | Double_t dReQ3n3k = (*fReQ)(2,3); | |
4608 | Double_t dReQ4n4k = (*fReQ)(3,4); | |
4609 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
4610 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
4611 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
4612 | Double_t dImQ3n3k = (*fImQ)(2,3); | |
4613 | Double_t dImQ4n4k = (*fImQ)(3,4); | |
4614 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
4615 | ||
4616 | // dMs are variables introduced in order to simplify some Eqs. bellow: | |
4617 | //.............................................................................................. | |
4618 | Double_t dM11 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j | |
4619 | Double_t dM22 = (*fSMpk)(1,2)-(*fSMpk)(0,4); // dM22 = sum_{i,j=1,i!=j}^M w_i^2 w_j^2 | |
4620 | Double_t dM33 = (*fSMpk)(1,3)-(*fSMpk)(0,6); // dM33 = sum_{i,j=1,i!=j}^M w_i^3 w_j^3 | |
4621 | Double_t dM44 = (*fSMpk)(1,4)-(*fSMpk)(0,8); // dM44 = sum_{i,j=1,i!=j}^M w_i^4 w_j^4 | |
4622 | Double_t dM31 = (*fSMpk)(0,3)*(*fSMpk)(0,1)-(*fSMpk)(0,4); // dM31 = sum_{i,j=1,i!=j}^M w_i^3 w_j | |
4623 | Double_t dM211 = (*fSMpk)(0,2)*(*fSMpk)(1,1)-2.*(*fSMpk)(0,3)*(*fSMpk)(0,1) | |
4624 | - (*fSMpk)(1,2)+2.*(*fSMpk)(0,4); // dM211 = sum_{i,j,k=1,i!=j!=k}^M w_i^2 w_j w_k | |
4625 | Double_t dM1111 = (*fSMpk)(3,1)-6.*(*fSMpk)(0,2)*(*fSMpk)(1,1) | |
4626 | + 8.*(*fSMpk)(0,3)*(*fSMpk)(0,1) | |
4627 | + 3.*(*fSMpk)(1,2)-6.*(*fSMpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l | |
4628 | //.............................................................................................. | |
4629 | ||
4630 | // 2-particle correlations: | |
4631 | Double_t two1n1nW1W1 = 0.; // <w1 w2 cos(n*(phi1-phi2))> | |
4632 | Double_t two2n2nW2W2 = 0.; // <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
4633 | Double_t two3n3nW3W3 = 0.; // <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
4634 | Double_t two4n4nW4W4 = 0.; // <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
4635 | if(dMult>1) | |
4636 | { | |
4637 | if(dM11) | |
4638 | { | |
4639 | two1n1nW1W1 = (pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSMpk)(0,2))/dM11; | |
4640 | // average correlation <w1 w2 cos(n*(phi1-phi2))> for single event: | |
4641 | fIntFlowCorrelationsEBE->SetBinContent(1,two1n1nW1W1); | |
4642 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(1,dM11); | |
4643 | // average correlation <w1 w2 cos(n*(phi1-phi2))> for all events: | |
4644 | fIntFlowCorrelationsPro->Fill(0.5,two1n1nW1W1,dM11); | |
4645 | fIntFlowCorrelationsAllPro->Fill(0.5,two1n1nW1W1,dM11); | |
4646 | } | |
4647 | if(dM22) | |
4648 | { | |
4649 | two2n2nW2W2 = (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)-(*fSMpk)(0,4))/dM22; | |
4650 | // ... | |
4651 | // average correlation <w1^2 w2^2 cos(2n*(phi1-phi2))> for all events: | |
4652 | fIntFlowCorrelationsAllPro->Fill(1.5,two2n2nW2W2,dM22); | |
4653 | } | |
4654 | if(dM33) | |
4655 | { | |
4656 | two3n3nW3W3 = (pow(dReQ3n3k,2)+pow(dImQ3n3k,2)-(*fSMpk)(0,6))/dM33; | |
4657 | // ... | |
4658 | // average correlation <w1^3 w2^3 cos(3n*(phi1-phi2))> for all events: | |
4659 | fIntFlowCorrelationsAllPro->Fill(2.5,two3n3nW3W3,dM33); | |
4660 | } | |
4661 | if(dM44) | |
4662 | { | |
4663 | two4n4nW4W4 = (pow(dReQ4n4k,2)+pow(dImQ4n4k,2)-(*fSMpk)(0,8))/dM44; | |
4664 | // ... | |
4665 | // average correlation <w1^4 w2^4 cos(4n*(phi1-phi2))> for all events: | |
4666 | fIntFlowCorrelationsAllPro->Fill(3.5,two4n4nW4W4,dM44); | |
4667 | } | |
4668 | } // end of if(dMult>1) | |
4669 | ||
4670 | // extra 2-particle correlations: | |
4671 | Double_t two1n1nW3W1 = 0.; // <w1^3 w2 cos(n*(phi1-phi2))> | |
4672 | Double_t two1n1nW1W1W2 = 0.; // <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
4673 | if(dMult>1) | |
4674 | { | |
4675 | if(dM31) | |
4676 | { | |
4677 | two1n1nW3W1 = (dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k-(*fSMpk)(0,4))/dM31; | |
4678 | fIntFlowExtraCorrelationsPro->Fill(0.5,two1n1nW3W1,dM31); | |
4679 | } | |
4680 | if(dM211) | |
4681 | { | |
4682 | two1n1nW1W1W2 = ((*fSMpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSMpk)(0,2)) | |
4683 | - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k | |
4684 | - (*fSMpk)(0,4)))/dM211; | |
4685 | fIntFlowExtraCorrelationsPro->Fill(1.5,two1n1nW1W1W2,dM211); | |
4686 | } | |
4687 | } // end of if(dMult>1) | |
4688 | //.............................................................................................. | |
4689 | ||
4690 | //.............................................................................................. | |
4691 | // 3-particle correlations: | |
4692 | Double_t three2n1n1nW2W1W1 = 0.; // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
4693 | ||
4694 | if(dMult>2) | |
4695 | { | |
4696 | if(dM211) | |
4697 | { | |
4698 | three2n1n1nW2W1W1 = (pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k | |
4699 | - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k) | |
4700 | - pow(dReQ2n2k,2)-pow(dImQ2n2k,2) | |
4701 | + 2.*(*fSMpk)(0,4))/dM211; | |
4702 | fIntFlowCorrelationsAllPro->Fill(5.5,three2n1n1nW2W1W1,dM211); | |
4703 | } | |
4704 | } // end of if(dMult>2) | |
4705 | //.............................................................................................. | |
4706 | ||
4707 | //.............................................................................................. | |
4708 | // 4-particle correlations: | |
4709 | Double_t four1n1n1n1nW1W1W1W1 = 0.; // <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
4710 | if(dMult>3) | |
4711 | { | |
4712 | if(dM1111) | |
4713 | { | |
4714 | four1n1n1n1nW1W1W1W1 = (pow(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.),2) | |
4715 | - 2.*(pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k) | |
4716 | + 8.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k) | |
4717 | + (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)) | |
4718 | - 4.*(*fSMpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) | |
4719 | - 6.*(*fSMpk)(0,4)+2.*(*fSMpk)(1,2))/dM1111; | |
4720 | ||
4721 | // average correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for single event: | |
4722 | fIntFlowCorrelationsEBE->SetBinContent(2,four1n1n1n1nW1W1W1W1); | |
4723 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(2,dM1111); | |
4724 | // average correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for all events: | |
4725 | fIntFlowCorrelationsPro->Fill(1.5,four1n1n1n1nW1W1W1W1,dM1111); | |
4726 | fIntFlowCorrelationsAllPro->Fill(10.5,four1n1n1n1nW1W1W1W1,dM1111); | |
4727 | } | |
4728 | } // end of if(dMult>3) | |
4729 | //.............................................................................................. | |
4730 | ||
4731 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelationsUsingParticleWeights() | |
4732 | ||
4733 | ||
4734 | //================================================================================================================================ | |
4735 | ||
4736 | ||
4737 | void AliFlowAnalysisWithQCumulants::CalculateWeightedQProductsForIntFlow() // to be improved (completed) | |
4738 | { | |
4739 | // calculate averages like <<2><4>>, <<2><6>>, <<4><6>>, etc. which are needed to calculate covariances | |
4740 | // Remark: here we take weighted correlations! | |
4741 | ||
4742 | /* | |
4743 | ||
4744 | // binning of fQProductsW is organized as follows: | |
4745 | // | |
4746 | // 1st bin: <2><4> | |
4747 | // 2nd bin: <2><6> | |
4748 | // 3rd bin: <2><8> | |
4749 | // 4th bin: <4><6> | |
4750 | // 5th bin: <4><8> | |
4751 | // 6th bin: <6><8> | |
4752 | ||
4753 | Double_t dMult = (*fSMpk)(0,0); // multiplicity (number of particles used to determine the reaction plane) | |
4754 | ||
4755 | Double_t dM11 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j | |
4756 | Double_t dM1111 = (*fSMpk)(3,1)-6.*(*fSMpk)(0,2)*(*fSMpk)(1,1) | |
4757 | + 8.*(*fSMpk)(0,3)*(*fSMpk)(0,1) | |
4758 | + 3.*(*fSMpk)(1,2)-6.*(*fSMpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l | |
4759 | ||
4760 | Double_t twoEBEW = 0.; // <2> | |
4761 | Double_t fourEBEW = 0.; // <4> | |
4762 | ||
4763 | twoEBEW = fQCorrelationsEBE[1]->GetBinContent(1); | |
4764 | fourEBEW = fQCorrelationsEBE[1]->GetBinContent(11); | |
4765 | ||
4766 | // <2><4> | |
4767 | if(dMult>3) | |
4768 | { | |
4769 | fQProducts[1][0]->Fill(0.5,twoEBEW*fourEBEW,dM11*dM1111); | |
4770 | } | |
4771 | ||
4772 | */ | |
4773 | ||
4774 | } // end of AliFlowAnalysisWithQCumulants::CalculateWeightedQProductsForIntFlow() | |
4775 | ||
4776 | ||
4777 | //================================================================================================================================ | |
4778 | ||
4779 | ||
4780 | void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow() | |
4781 | { | |
4782 | // Initialize all arrays used to calculate integrated flow. | |
4783 | ||
4784 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
4785 | { | |
4786 | fIntFlowCorrectionTermsForNUAEBE[sc] = NULL; | |
0328db2d | 4787 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc] = NULL; |
489d5531 | 4788 | fIntFlowCorrectionTermsForNUAPro[sc] = NULL; |
4789 | fIntFlowCorrectionTermsForNUAHist[sc] = NULL; | |
2001bc3a | 4790 | for(Int_t ci=0;ci<4;ci++) // correction term index |
4791 | { | |
4792 | fIntFlowCorrectionTermsForNUAVsMPro[sc][ci] = NULL; | |
4793 | } | |
0328db2d | 4794 | for(Int_t power=0;power<2;power++) // linear or quadratic |
4795 | { | |
4796 | fIntFlowSumOfEventWeightsNUA[sc][power] = NULL; | |
4797 | } | |
489d5531 | 4798 | } |
4799 | for(Int_t power=0;power<2;power++) // linear or quadratic | |
4800 | { | |
4801 | fIntFlowSumOfEventWeights[power] = NULL; | |
4802 | } | |
b3dacf6b | 4803 | for(Int_t i=0;i<4;i++) // print on the screen the final results (0=RF, 1=RP, 2=POI, 3=RF (rebbined in M)) |
489d5531 | 4804 | { |
4805 | fPrintFinalResults[i] = kTRUE; | |
4806 | } | |
ff70ca91 | 4807 | for(Int_t ci=0;ci<4;ci++) // correlation index or cumulant order |
4808 | { | |
4809 | fIntFlowCorrelationsVsMPro[ci] = NULL; | |
4810 | fIntFlowCorrelationsVsMHist[ci] = NULL; | |
4811 | fIntFlowQcumulantsVsM[ci] = NULL; | |
4812 | fIntFlowVsM[ci] = NULL; | |
2001bc3a | 4813 | fIntFlowDetectorBiasVsM[ci] = NULL; |
ff70ca91 | 4814 | for(Int_t lc=0;lc<2;lc++) |
4815 | { | |
4816 | fIntFlowSumOfEventWeightsVsM[ci][lc] = NULL; | |
4817 | } | |
4818 | } | |
4819 | for(Int_t pi=0;pi<6;pi++) // product or covariance index | |
4820 | { | |
4821 | fIntFlowProductOfCorrelationsVsMPro[pi] = NULL; | |
4822 | fIntFlowCovariancesVsM[pi] = NULL; | |
4823 | fIntFlowSumOfProductOfEventWeightsVsM[pi] = NULL; | |
4824 | } | |
4825 | ||
489d5531 | 4826 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow() |
4827 | ||
489d5531 | 4828 | //================================================================================================================================ |
4829 | ||
489d5531 | 4830 | void AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow() |
4831 | { | |
4832 | // Initialize all arrays needed to calculate differential flow. | |
4833 | // a) Initialize lists holding profiles; | |
4834 | // b) Initialize lists holding histograms; | |
4835 | // c) Initialize event-by-event quantities; | |
4836 | // d) Initialize profiles; | |
4837 | // e) Initialize histograms holding final results. | |
4838 | ||
4839 | // a) Initialize lists holding profiles; | |
4840 | for(Int_t t=0;t<2;t++) // type (RP, POI) | |
4841 | { | |
4842 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
4843 | { | |
4844 | fDiffFlowCorrelationsProList[t][pe] = NULL; | |
4845 | fDiffFlowProductOfCorrelationsProList[t][pe] = NULL; | |
4846 | fDiffFlowCorrectionsProList[t][pe] = NULL; | |
4847 | } | |
4848 | } | |
4849 | ||
4850 | // b) Initialize lists holding histograms; | |
4851 | for(Int_t t=0;t<2;t++) // type (RP, POI) | |
4852 | { | |
4853 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
4854 | { | |
4855 | fDiffFlowCorrelationsHistList[t][pe] = NULL; | |
4856 | for(Int_t power=0;power<2;power++) | |
4857 | { | |
4858 | fDiffFlowSumOfEventWeightsHistList[t][pe][power] = NULL; | |
4859 | } // end of for(Int_t power=0;power<2;power++) | |
4860 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe] = NULL; | |
4861 | fDiffFlowCorrectionsHistList[t][pe] = NULL; | |
4862 | fDiffFlowCovariancesHistList[t][pe] = NULL; | |
4863 | fDiffFlowCumulantsHistList[t][pe] = NULL; | |
4864 | fDiffFlowHistList[t][pe] = NULL; | |
4865 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
4866 | } // enf of for(Int_t t=0;t<2;t++) // type (RP, POI) | |
4867 | ||
4868 | // c) Initialize event-by-event quantities: | |
4869 | // 1D: | |
4870 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
4871 | { | |
4872 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
4873 | { | |
4874 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
4875 | { | |
4876 | for(Int_t k=0;k<9;k++) // power of weight | |
4877 | { | |
4878 | fReRPQ1dEBE[t][pe][m][k] = NULL; | |
4879 | fImRPQ1dEBE[t][pe][m][k] = NULL; | |
4880 | fs1dEBE[t][pe][k] = NULL; // to be improved (this doesn't need to be within loop over m) | |
4881 | } | |
4882 | } | |
4883 | } | |
4884 | } | |
4885 | // 1D: | |
4886 | for(Int_t t=0;t<2;t++) // type (RP or POI) | |
4887 | { | |
4888 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
4889 | { | |
4890 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
4891 | { | |
4892 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
4893 | { | |
4894 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti] = NULL; | |
4895 | } | |
4896 | } | |
4897 | } | |
4898 | } | |
4899 | // 2D: | |
4900 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
4901 | { | |
4902 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
4903 | { | |
4904 | for(Int_t k=0;k<9;k++) // power of weight | |
4905 | { | |
4906 | fReRPQ2dEBE[t][m][k] = NULL; | |
4907 | fImRPQ2dEBE[t][m][k] = NULL; | |
4908 | fs2dEBE[t][k] = NULL; // to be improved (this doesn't need to be within loop over m) | |
4909 | } | |
4910 | } | |
4911 | } | |
4912 | ||
4913 | // d) Initialize profiles: | |
4914 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
4915 | { | |
4916 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
4917 | { | |
4918 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
4919 | { | |
4920 | fDiffFlowCorrelationsPro[t][pe][ci] = NULL; | |
4921 | } // end of for(Int_t ci=0;ci<4;ci++) | |
4922 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
4923 | { | |
4924 | for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index | |
4925 | { | |
4926 | fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = NULL; | |
4927 | } // end of for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index | |
4928 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
4929 | // correction terms for nua: | |
4930 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
4931 | { | |
4932 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
4933 | { | |
4934 | fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = NULL; | |
4935 | } | |
4936 | } | |
4937 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
4938 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
4939 | ||
4940 | // e) Initialize histograms holding final results. | |
4941 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
4942 | { | |
4943 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
4944 | { | |
4945 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
4946 | { | |
4947 | fDiffFlowCorrelationsHist[t][pe][ci] = NULL; | |
4948 | fDiffFlowCumulants[t][pe][ci] = NULL; | |
4949 | fDiffFlow[t][pe][ci] = NULL; | |
4950 | } // end of for(Int_t ci=0;ci<4;ci++) | |
4951 | for(Int_t covarianceIndex=0;covarianceIndex<5;covarianceIndex++) | |
4952 | { | |
4953 | fDiffFlowCovariances[t][pe][covarianceIndex] = NULL; | |
4954 | } // end of for(Int_t covarianceIndex=0;covarianceIndex<5;covarianceIndex++) | |
4955 | // correction terms for nua: | |
4956 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
4957 | { | |
4958 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
4959 | { | |
4960 | fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = NULL; | |
4961 | } | |
4962 | } | |
4963 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
4964 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
4965 | ||
4966 | // sum of event weights for reduced correlations: | |
4967 | for(Int_t t=0;t<2;t++) // type = RP or POI | |
4968 | { | |
4969 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
4970 | { | |
4971 | for(Int_t p=0;p<2;p++) // power of weight is 1 or 2 | |
4972 | { | |
4973 | for(Int_t ew=0;ew<4;ew++) // event weight index for reduced correlations | |
4974 | { | |
4975 | fDiffFlowSumOfEventWeights[t][pe][p][ew] = NULL; | |
4976 | } | |
4977 | } | |
4978 | } | |
4979 | } | |
4980 | // product of event weights for both types of correlations: | |
4981 | for(Int_t t=0;t<2;t++) // type = RP or POI | |
4982 | { | |
4983 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
4984 | { | |
4985 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
4986 | { | |
4987 | for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index | |
4988 | { | |
4989 | fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = NULL; | |
4990 | } | |
4991 | } | |
4992 | } | |
4993 | } | |
4994 | ||
4995 | ||
4996 | ||
4997 | ||
4998 | /* | |
4999 | ||
5000 | // nested lists in fDiffFlowProfiles: | |
5001 | for(Int_t t=0;t<2;t++) | |
5002 | { | |
5003 | fDFPType[t] = NULL; | |
5004 | for(Int_t pW=0;pW<2;pW++) // particle weights not used (0) or used (1) | |
5005 | { | |
5006 | fDFPParticleWeights[t][pW] = NULL; | |
5007 | for(Int_t eW=0;eW<2;eW++) | |
5008 | { | |
5009 | fDFPEventWeights[t][pW][eW] = NULL; | |
5010 | fDiffFlowCorrelations[t][pW][eW] = NULL; | |
5011 | fDiffFlowProductsOfCorrelations[t][pW][eW] = NULL; | |
5012 | for(Int_t sc=0;sc<2;sc++) | |
5013 | { | |
5014 | fDiffFlowCorrectionTerms[t][pW][eW][sc] = NULL; | |
5015 | } | |
5016 | } | |
5017 | } | |
5018 | } | |
5019 | ||
5020 | ||
5021 | */ | |
5022 | ||
5023 | ||
5024 | ||
5025 | /* | |
5026 | for(Int_t pW=0;pW<2;pW++) // particle weights not used (0) or used (1) | |
5027 | { | |
5028 | for(Int_t eW=0;eW<2;eW++) | |
5029 | { | |
5030 | // correlations: | |
5031 | for(Int_t correlationIndex=0;correlationIndex<4;correlationIndex++) | |
5032 | { | |
5033 | fCorrelationsPro[t][pW][eW][correlationIndex] = NULL; | |
5034 | } | |
5035 | // products of correlations: | |
5036 | for(Int_t productOfCorrelationsIndex=0;productOfCorrelationsIndex<6;productOfCorrelationsIndex++) | |
5037 | { | |
5038 | fProductsOfCorrelationsPro[t][pW][eW][productOfCorrelationsIndex] = NULL; | |
5039 | } | |
5040 | // correction terms: | |
5041 | for(Int_t sc=0;sc<2;sc++) | |
5042 | { | |
5043 | for(Int_t correctionsIndex=0;correctionsIndex<2;correctionsIndex++) | |
5044 | { | |
5045 | fCorrectionTermsPro[t][pW][eW][sc][correctionsIndex] = NULL; | |
5046 | } | |
5047 | } | |
5048 | } | |
5049 | } | |
5050 | */ | |
5051 | ||
5052 | } // end of AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow() | |
5053 | ||
5054 | ||
5055 | //================================================================================================================================ | |
5056 | /* | |
5057 | ||
5058 | ||
5059 | void AliFlowAnalysisWithQCumulants::CalculateCorrelationsForDifferentialFlow2D(TString type) | |
5060 | { | |
5061 | // calculate all reduced correlations needed for differential flow for each (pt,eta) bin: | |
5062 | ||
5063 | if(type == "RP") // to be improved (removed) | |
5064 | { | |
5065 | cout<<endl; | |
5066 | } | |
5067 | // ... | |
5068 | ||
5069 | ||
5070 | Int_t typeFlag = -1; | |
5071 | ||
5072 | // reduced correlations ares stored in fCorrelationsPro[t][pW][index] and are indexed as follows: | |
5073 | // index: | |
5074 | // 0: <2'> | |
5075 | // 1: <4'> | |
5076 | ||
5077 | // multiplicity: | |
5078 | Double_t dMult = (*fSMpk)(0,0); | |
5079 | ||
5080 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
5081 | Double_t dReQ1n = (*fReQ)(0,0); | |
5082 | Double_t dReQ2n = (*fReQ)(1,0); | |
5083 | //Double_t dReQ3n = (*fReQ)(2,0); | |
5084 | //Double_t dReQ4n = (*fReQ)(3,0); | |
5085 | Double_t dImQ1n = (*fImQ)(0,0); | |
5086 | Double_t dImQ2n = (*fImQ)(1,0); | |
5087 | //Double_t dImQ3n = (*fImQ)(2,0); | |
5088 | //Double_t dImQ4n = (*fImQ)(3,0); | |
5089 | ||
5090 | // looping over all (pt,eta) bins and calculating correlations needed for differential flow: | |
5091 | for(Int_t p=1;p<=fnBinsPt;p++) | |
5092 | { | |
5093 | for(Int_t e=1;e<=fnBinsEta;e++) | |
5094 | { | |
5095 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): | |
5096 | Double_t p1n0kRe = 0.; | |
5097 | Double_t p1n0kIm = 0.; | |
5098 | ||
5099 | // number of POIs in particular (pt,eta) bin: | |
5100 | Double_t mp = 0.; | |
5101 | ||
5102 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular (pt,eta) bin): | |
5103 | Double_t q1n0kRe = 0.; | |
5104 | Double_t q1n0kIm = 0.; | |
5105 | Double_t q2n0kRe = 0.; | |
5106 | Double_t q2n0kIm = 0.; | |
5107 | ||
5108 | // number of particles which are both RPs and POIs in particular (pt,eta) bin: | |
5109 | Double_t mq = 0.; | |
5110 | ||
5111 | // q_{m*n,0}: | |
5112 | q1n0kRe = fReEBE2D[2][0][0]->GetBinContent(fReEBE2D[2][0][0]->GetBin(p,e)) | |
5113 | * fReEBE2D[2][0][0]->GetBinEntries(fReEBE2D[2][0][0]->GetBin(p,e)); | |
5114 | q1n0kIm = fImEBE2D[2][0][0]->GetBinContent(fImEBE2D[2][0][0]->GetBin(p,e)) | |
5115 | * fImEBE2D[2][0][0]->GetBinEntries(fImEBE2D[2][0][0]->GetBin(p,e)); | |
5116 | q2n0kRe = fReEBE2D[2][1][0]->GetBinContent(fReEBE2D[2][1][0]->GetBin(p,e)) | |
5117 | * fReEBE2D[2][1][0]->GetBinEntries(fReEBE2D[2][1][0]->GetBin(p,e)); | |
5118 | q2n0kIm = fImEBE2D[2][1][0]->GetBinContent(fImEBE2D[2][1][0]->GetBin(p,e)) | |
5119 | * fImEBE2D[2][1][0]->GetBinEntries(fImEBE2D[2][1][0]->GetBin(p,e)); | |
5120 | ||
5121 | mq = fReEBE2D[2][0][0]->GetBinEntries(fReEBE2D[2][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) | |
5122 | ||
5123 | if(type == "POI") | |
5124 | { | |
5125 | // p_{m*n,0}: | |
5126 | p1n0kRe = fReEBE2D[1][0][0]->GetBinContent(fReEBE2D[1][0][0]->GetBin(p,e)) | |
5127 | * fReEBE2D[1][0][0]->GetBinEntries(fReEBE2D[1][0][0]->GetBin(p,e)); | |
5128 | p1n0kIm = fImEBE2D[1][0][0]->GetBinContent(fImEBE2D[1][0][0]->GetBin(p,e)) | |
5129 | * fImEBE2D[1][0][0]->GetBinEntries(fImEBE2D[1][0][0]->GetBin(p,e)); | |
5130 | ||
5131 | mp = fReEBE2D[1][0][0]->GetBinEntries(fReEBE2D[1][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) | |
5132 | ||
5133 | typeFlag = 1; | |
5134 | } | |
5135 | else if(type == "RP") | |
5136 | { | |
5137 | // p_{m*n,0} = q_{m*n,0}: | |
5138 | p1n0kRe = q1n0kRe; | |
5139 | p1n0kIm = q1n0kIm; | |
5140 | mp = mq; | |
5141 | ||
5142 | typeFlag = 0; | |
5143 | } | |
5144 | ||
5145 | // count events with non-empty (pt,eta) bin: | |
5146 | if(mp>0) | |
5147 | { | |
5148 | fNonEmptyBins2D[typeFlag]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,1); | |
5149 | } | |
5150 | ||
5151 | // 2'-particle correlation for particular (pt,eta) bin: | |
5152 | Double_t two1n1nPtEta = 0.; | |
5153 | if(mp*dMult-mq) | |
5154 | { | |
5155 | two1n1nPtEta = (p1n0kRe*dReQ1n+p1n0kIm*dImQ1n-mq) | |
5156 | / (mp*dMult-mq); | |
5157 | ||
5158 | // fill the 2D profile to get the average correlation for each (pt,eta) bin: | |
5159 | if(type == "POI") | |
5160 | { | |
5161 | //f2pPtEtaPOI->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mp*dMult-mq); | |
5162 | ||
5163 | fCorrelationsPro[1][0][0][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mp*dMult-mq); | |
5164 | } | |
5165 | else if(type == "RP") | |
5166 | { | |
5167 | //f2pPtEtaRP->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mp*dMult-mq); | |
5168 | fCorrelationsPro[0][0][0][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mp*dMult-mq); | |
5169 | } | |
5170 | } // end of if(mp*dMult-mq) | |
5171 | ||
5172 | // 4'-particle correlation: | |
5173 | Double_t four1n1n1n1nPtEta = 0.; | |
5174 | if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
5175 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression) | |
5176 | { | |
5177 | four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
5178 | - q2n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) | |
5179 | - 2.*q2n0kIm*dReQ1n*dImQ1n | |
5180 | - p1n0kRe*(dReQ1n*dReQ2n+dImQ1n*dImQ2n) | |
5181 | + p1n0kIm*(dImQ1n*dReQ2n-dReQ1n*dImQ2n) | |
5182 | - 2.*dMult*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
5183 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*mq | |
5184 | + 6.*(q1n0kRe*dReQ1n+q1n0kIm*dImQ1n) | |
5185 | + 1.*(q2n0kRe*dReQ2n+q2n0kIm*dImQ2n) | |
5186 | + 2.*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
5187 | + 2.*mq*dMult | |
5188 | - 6.*mq) | |
5189 | / ((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
5190 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5191 | ||
5192 | // fill the 2D profile to get the average correlation for each (pt, eta) bin: | |
5193 | if(type == "POI") | |
5194 | { | |
5195 | //f4pPtEtaPOI->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta, | |
5196 | // (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
5197 | // + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5198 | ||
5199 | fCorrelationsPro[1][0][0][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta, | |
5200 | (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
5201 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5202 | } | |
5203 | else if(type == "RP") | |
5204 | { | |
5205 | //f4pPtEtaRP->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta, | |
5206 | // (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
5207 | // + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5208 | ||
5209 | fCorrelationsPro[0][0][0][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta, | |
5210 | (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
5211 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5212 | } | |
5213 | } // end of if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
5214 | // +mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
5215 | ||
5216 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
5217 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
5218 | ||
5219 | ||
5220 | ||
5221 | ||
5222 | ||
5223 | } // end of AliFlowAnalysisWithQCumulants::CalculateCorrelationsForDifferentialFlow2D() | |
5224 | ||
5225 | ||
5226 | ||
5227 | ||
5228 | ||
5229 | ||
5230 | //================================================================================================================================ | |
5231 | ||
5232 | ||
5233 | void AliFlowAnalysisWithQCumulants::CalculateWeightedCorrelationsForDifferentialFlow2D(TString type) | |
5234 | { | |
5235 | // calculate all weighted correlations needed for differential flow | |
5236 | ||
5237 | if(type == "RP") // to be improved (removed) | |
5238 | { | |
5239 | cout<<endl; | |
5240 | } | |
5241 | // ... | |
5242 | ||
5243 | ||
5244 | ||
5245 | ||
5246 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
5247 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
5248 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
5249 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
5250 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
5251 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
5252 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
5253 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
5254 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
5255 | ||
5256 | // S^M_{p,k} (see .h file for the definition of fSMpk): | |
5257 | Double_t dSM1p1k = (*fSMpk)(0,1); | |
5258 | Double_t dSM1p2k = (*fSMpk)(0,2); | |
5259 | Double_t dSM1p3k = (*fSMpk)(0,3); | |
5260 | Double_t dSM2p1k = (*fSMpk)(1,1); | |
5261 | Double_t dSM3p1k = (*fSMpk)(2,1); | |
5262 | ||
5263 | // looping over all (pt,eta) bins and calculating weighted correlations needed for differential flow: | |
5264 | for(Int_t p=1;p<=fnBinsPt;p++) | |
5265 | { | |
5266 | for(Int_t e=1;e<=fnBinsEta;e++) | |
5267 | { | |
5268 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): | |
5269 | Double_t p1n0kRe = 0.; | |
5270 | Double_t p1n0kIm = 0.; | |
5271 | ||
5272 | // number of POIs in particular (pt,eta) bin): | |
5273 | Double_t mp = 0.; | |
5274 | ||
5275 | // real and imaginary parts of q_{m*n,k}: | |
5276 | // (weighted Q-vector evaluated for particles which are both RPs and POIs in particular (pt,eta) bin) | |
5277 | Double_t q1n2kRe = 0.; | |
5278 | Double_t q1n2kIm = 0.; | |
5279 | Double_t q2n1kRe = 0.; | |
5280 | Double_t q2n1kIm = 0.; | |
5281 | ||
5282 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
5283 | Double_t s1p1k = 0.; | |
5284 | Double_t s1p2k = 0.; | |
5285 | Double_t s1p3k = 0.; | |
5286 | ||
5287 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
5288 | Double_t dM0111 = 0.; | |
5289 | ||
5290 | if(type == "POI") | |
5291 | { | |
5292 | // p_{m*n,0}: | |
5293 | p1n0kRe = fReEBE2D[1][0][0]->GetBinContent(fReEBE2D[1][0][0]->GetBin(p,e)) | |
5294 | * fReEBE2D[1][0][0]->GetBinEntries(fReEBE2D[1][0][0]->GetBin(p,e)); | |
5295 | p1n0kIm = fImEBE2D[1][0][0]->GetBinContent(fImEBE2D[1][0][0]->GetBin(p,e)) | |
5296 | * fImEBE2D[1][0][0]->GetBinEntries(fImEBE2D[1][0][0]->GetBin(p,e)); | |
5297 | ||
5298 | mp = fReEBE2D[1][0][0]->GetBinEntries(fReEBE2D[1][0][0]->GetBin(p,e)); | |
5299 | ||
5300 | // q_{m*n,k}: | |
5301 | q1n2kRe = fReEBE2D[2][0][2]->GetBinContent(fReEBE2D[2][0][2]->GetBin(p,e)) | |
5302 | * fReEBE2D[2][0][2]->GetBinEntries(fReEBE2D[2][0][2]->GetBin(p,e)); | |
5303 | q1n2kIm = fImEBE2D[2][0][2]->GetBinContent(fImEBE2D[2][0][2]->GetBin(p,e)) | |
5304 | * fImEBE2D[2][0][2]->GetBinEntries(fImEBE2D[2][0][2]->GetBin(p,e)); | |
5305 | q2n1kRe = fReEBE2D[2][1][1]->GetBinContent(fReEBE2D[2][1][1]->GetBin(p,e)) | |
5306 | * fReEBE2D[2][1][1]->GetBinEntries(fReEBE2D[2][1][1]->GetBin(p,e)); | |
5307 | q2n1kIm = fImEBE2D[2][1][1]->GetBinContent(fImEBE2D[2][1][1]->GetBin(p,e)) | |
5308 | * fImEBE2D[2][1][1]->GetBinEntries(fImEBE2D[2][1][1]->GetBin(p,e)); | |
5309 | ||
5310 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
5311 | s1p1k = pow(fs2D[2][1]->GetBinContent(fs2D[2][1]->GetBin(p,e)),1.); | |
5312 | s1p2k = pow(fs2D[2][2]->GetBinContent(fs2D[2][2]->GetBin(p,e)),1.); | |
5313 | s1p3k = pow(fs2D[2][3]->GetBinContent(fs2D[2][3]->GetBin(p,e)),1.); | |
5314 | ||
5315 | // M0111 from Eq. (118) in QC2c (to be improved (notation)): | |
5316 | dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k) | |
5317 | - 3.*(s1p1k*(dSM2p1k-dSM1p2k) | |
5318 | + 2.*(s1p3k-s1p2k*dSM1p1k)); | |
5319 | } | |
5320 | else if(type == "RP") | |
5321 | { | |
5322 | p1n0kRe = fReEBE2D[0][0][0]->GetBinContent(fReEBE2D[0][0][0]->GetBin(p,e)) | |
5323 | * fReEBE2D[0][0][0]->GetBinEntries(fReEBE2D[0][0][0]->GetBin(p,e)); | |
5324 | p1n0kIm = fImEBE2D[0][0][0]->GetBinContent(fImEBE2D[0][0][0]->GetBin(p,e)) | |
5325 | * fImEBE2D[0][0][0]->GetBinEntries(fImEBE2D[0][0][0]->GetBin(p,e)); | |
5326 | ||
5327 | mp = fReEBE2D[0][0][0]->GetBinEntries(fReEBE2D[0][0][0]->GetBin(p,e)); | |
5328 | ||
5329 | // q_{m*n,k}: | |
5330 | q1n2kRe = fReEBE2D[0][0][2]->GetBinContent(fReEBE2D[0][0][2]->GetBin(p,e)) | |
5331 | * fReEBE2D[0][0][2]->GetBinEntries(fReEBE2D[0][0][2]->GetBin(p,e)); | |
5332 | q1n2kIm = fImEBE2D[0][0][2]->GetBinContent(fImEBE2D[0][0][2]->GetBin(p,e)) | |
5333 | * fImEBE2D[0][0][2]->GetBinEntries(fImEBE2D[0][0][2]->GetBin(p,e)); | |
5334 | q2n1kRe = fReEBE2D[0][1][1]->GetBinContent(fReEBE2D[0][1][1]->GetBin(p,e)) | |
5335 | * fReEBE2D[0][1][1]->GetBinEntries(fReEBE2D[0][1][1]->GetBin(p,e)); | |
5336 | q2n1kIm = fImEBE2D[0][1][1]->GetBinContent(fImEBE2D[0][1][1]->GetBin(p,e)) | |
5337 | * fImEBE2D[0][1][1]->GetBinEntries(fImEBE2D[0][1][1]->GetBin(p,e)); | |
5338 | ||
5339 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
5340 | s1p1k = pow(fs2D[0][1]->GetBinContent(fs2D[0][1]->GetBin(p,e)),1.); | |
5341 | s1p2k = pow(fs2D[0][2]->GetBinContent(fs2D[0][2]->GetBin(p,e)),1.); | |
5342 | s1p3k = pow(fs2D[0][3]->GetBinContent(fs2D[0][3]->GetBin(p,e)),1.); | |
5343 | ||
5344 | // M0111 from Eq. (118) in QC2c (to be improved (notation)): | |
5345 | dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k) | |
5346 | - 3.*(s1p1k*(dSM2p1k-dSM1p2k) | |
5347 | + 2.*(s1p3k-s1p2k*dSM1p1k)); | |
5348 | //............................................................................................... | |
5349 | } | |
5350 | ||
5351 | // 2'-particle correlation: | |
5352 | Double_t two1n1nW0W1PtEta = 0.; | |
5353 | if(mp*dSM1p1k-s1p1k) | |
5354 | { | |
5355 | two1n1nW0W1PtEta = (p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k-s1p1k) | |
5356 | / (mp*dSM1p1k-s1p1k); | |
5357 | ||
5358 | // fill the 2D profile to get the average correlation for each (pt, eta) bin: | |
5359 | if(type == "POI") | |
5360 | { | |
5361 | //f2pPtEtaPOIW->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nW0W1PtEta, | |
5362 | // mp*dSM1p1k-s1p1k); | |
5363 | fCorrelationsPro[1][1][0][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nW0W1PtEta,mp*dSM1p1k-s1p1k); | |
5364 | } | |
5365 | else if(type == "RP") | |
5366 | { | |
5367 | //f2pPtEtaRPW->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nW0W1PtEta, | |
5368 | // mp*dSM1p1k-s1p1k); | |
5369 | fCorrelationsPro[0][1][0][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nW0W1PtEta,mp*dSM1p1k-s1p1k); | |
5370 | } | |
5371 | } // end of if(mp*dMult-dmPrimePrimePtEta) | |
5372 | ||
5373 | // 4'-particle correlation: | |
5374 | Double_t four1n1n1n1nW0W1W1W1PtEta = 0.; | |
5375 | if(dM0111) | |
5376 | { | |
5377 | four1n1n1n1nW0W1W1W1PtEta = ((pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k) | |
5378 | - q2n1kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.)) | |
5379 | - 2.*q2n1kIm*dReQ1n1k*dImQ1n1k | |
5380 | - p1n0kRe*(dReQ1n1k*dReQ2n2k+dImQ1n1k*dImQ2n2k) | |
5381 | + p1n0kIm*(dImQ1n1k*dReQ2n2k-dReQ1n1k*dImQ2n2k) | |
5382 | - 2.*dSM1p2k*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k) | |
5383 | - 2.*(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*s1p1k | |
5384 | + 6.*(q1n2kRe*dReQ1n1k+q1n2kIm*dImQ1n1k) | |
5385 | + 1.*(q2n1kRe*dReQ2n2k+q2n1kIm*dImQ2n2k) | |
5386 | + 2.*(p1n0kRe*dReQ1n3k+p1n0kIm*dImQ1n3k) | |
5387 | + 2.*s1p1k*dSM1p2k | |
5388 | - 6.*s1p3k) | |
5389 | / dM0111; // to be imropoved (notation of dM0111) | |
5390 | ||
5391 | // fill the 2D profile to get the average correlation for each (pt, eta) bin: | |
5392 | if(type == "POI") | |
5393 | { | |
5394 | //f4pPtEtaPOIW->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nW0W1W1W1PtEta,dM0111); | |
5395 | fCorrelationsPro[1][1][0][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nW0W1W1W1PtEta,dM0111); | |
5396 | } | |
5397 | else if(type == "RP") | |
5398 | { | |
5399 | //f4pPtEtaRPW->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nW0W1W1W1PtEta,dM0111); | |
5400 | fCorrelationsPro[0][1][0][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nW0W1W1W1PtEta,dM0111); | |
5401 | } | |
5402 | } // end of if(dM0111) | |
5403 | ||
5404 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
5405 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
5406 | ||
5407 | ||
5408 | ||
5409 | ||
5410 | } // end of AliFlowAnalysisWithQCumulants::CalculateWeightedCorrelationsForDifferentialFlow2D(TString type) | |
5411 | ||
5412 | ||
5413 | //================================================================================================================================ | |
5414 | ||
5415 | */ | |
5416 | ||
5417 | /* | |
5418 | void AliFlowAnalysisWithQCumulants::FinalizeCorrelationsForDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights) | |
5419 | { | |
5420 | // 1.) Access average for 2D correlations from profiles and store them in 2D final results histograms; | |
5421 | // 2.) Access spread for 2D correlations from profiles, calculate error and store it in 2D final results histograms; | |
5422 | // 3.) Make projections along pt and eta axis and store results and errors in 1D final results histograms. | |
5423 | ||
5424 | Int_t typeFlag = -1; | |
5425 | Int_t pWeightsFlag = -1; | |
5426 | Int_t eWeightsFlag = -1; | |
5427 | ||
5428 | if(type == "RP") | |
5429 | { | |
5430 | typeFlag = 0; | |
5431 | } else if(type == "POI") | |
5432 | { | |
5433 | typeFlag = 1; | |
5434 | } else | |
5435 | { | |
5436 | cout<<"WARNING: type must be either RP or POI in AFAWQC::FCFDF() !!!!"<<endl; | |
5437 | exit(0); | |
5438 | } | |
5439 | ||
5440 | if(!useParticleWeights) | |
5441 | { | |
5442 | pWeightsFlag = 0; | |
5443 | } else | |
5444 | { | |
5445 | pWeightsFlag = 1; | |
5446 | } | |
5447 | ||
5448 | if(eventWeights == "exact") | |
5449 | { | |
5450 | eWeightsFlag = 0; | |
5451 | } | |
5452 | ||
5453 | // shortcuts: | |
5454 | Int_t t = typeFlag; | |
5455 | Int_t pW = pWeightsFlag; | |
5456 | Int_t eW = eWeightsFlag; | |
5457 | ||
5458 | // from 2D histogram fNonEmptyBins2D make two 1D histograms fNonEmptyBins1D in pt and eta (to be improved (i.e. moved somewhere else)) | |
5459 | // pt: | |
5460 | for(Int_t p=1;p<fnBinsPt;p++) | |
5461 | { | |
5462 | Double_t contentPt = 0.; | |
5463 | for(Int_t e=1;e<=fnBinsEta;e++) | |
5464 | { | |
5465 | contentPt += (fNonEmptyBins2D[t]->GetBinContent(fNonEmptyBins2D[t]->GetBin(p,e))); | |
5466 | } | |
5467 | fNonEmptyBins1D[t][0]->SetBinContent(p,contentPt); | |
5468 | } | |
5469 | // eta: | |
5470 | for(Int_t e=1;e<fnBinsEta;e++) | |
5471 | { | |
5472 | Double_t contentEta = 0.; | |
5473 | for(Int_t p=1;p<=fnBinsPt;p++) | |
5474 | { | |
5475 | contentEta += (fNonEmptyBins2D[t]->GetBinContent(fNonEmptyBins2D[t]->GetBin(p,e))); | |
5476 | } | |
5477 | fNonEmptyBins1D[t][1]->SetBinContent(e,contentEta); | |
5478 | } | |
5479 | ||
5480 | // from 2D profile in (pt,eta) make two 1D profiles in (pt) and (eta): | |
5481 | TProfile *profile[2][4]; // [0=pt,1=eta][correlation index] // to be improved (do not hardwire the correlation index) | |
5482 | ||
5483 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5484 | { | |
5485 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
5486 | { | |
5487 | if(pe==0) profile[pe][ci] = this->MakePtProjection(fCorrelationsPro[t][pW][eW][ci]); | |
5488 | if(pe==1) profile[pe][ci] = this->MakeEtaProjection(fCorrelationsPro[t][pW][eW][ci]); | |
5489 | } | |
5490 | } | |
5491 | ||
5492 | // transfer 2D profile into 2D histogram: | |
5493 | // to be improved (see in documentation if there is a method to transfer values from 2D profile into 2D histogram) | |
5494 | for(Int_t ci=0;ci<4;ci++) | |
5495 | { | |
5496 | for(Int_t p=1;p<=fnBinsPt;p++) | |
5497 | { | |
5498 | for(Int_t e=1;e<=fnBinsEta;e++) | |
5499 | { | |
5500 | Double_t correlation = fCorrelationsPro[t][pW][eW][ci]->GetBinContent(fCorrelationsPro[t][pW][eW][ci]->GetBin(p,e)); | |
5501 | Double_t spread = fCorrelationsPro[t][pW][eW][ci]->GetBinError(fCorrelationsPro[t][pW][eW][ci]->GetBin(p,e)); | |
5502 | Double_t nEvts = fNonEmptyBins2D[t]->GetBinContent(fNonEmptyBins2D[t]->GetBin(p,e)); | |
5503 | Double_t error = 0.; | |
5504 | fFinalCorrelations2D[t][pW][eW][ci]->SetBinContent(fFinalCorrelations2D[t][pW][eW][ci]->GetBin(p,e),correlation); | |
5505 | if(nEvts>0) | |
5506 | { | |
5507 | error = spread/pow(nEvts,0.5); | |
5508 | fFinalCorrelations2D[t][pW][eW][ci]->SetBinError(fFinalCorrelations2D[t][pW][eW][ci]->GetBin(p,e),error); | |
5509 | } | |
5510 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
5511 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
5512 | } // end of for(Int_t ci=0;ci<4;ci++) | |
5513 | ||
5514 | // transfer 1D profile into 1D histogram (pt): | |
5515 | // to be improved (see in documentation if there is a method to transfer values from 1D profile into 1D histogram) | |
5516 | for(Int_t ci=0;ci<4;ci++) | |
5517 | { | |
5518 | for(Int_t p=1;p<=fnBinsPt;p++) | |
5519 | { | |
5520 | if(profile[0][ci]) | |
5521 | { | |
5522 | Double_t correlation = profile[0][ci]->GetBinContent(p); | |
5523 | Double_t spread = profile[0][ci]->GetBinError(p); | |
5524 | Double_t nEvts = fNonEmptyBins1D[t][0]->GetBinContent(p); | |
5525 | Double_t error = 0.; | |
5526 | fFinalCorrelations1D[t][pW][eW][0][ci]->SetBinContent(p,correlation); | |
5527 | if(nEvts>0) | |
5528 | { | |
5529 | error = spread/pow(nEvts,0.5); | |
5530 | fFinalCorrelations1D[t][pW][eW][0][ci]->SetBinError(p,error); | |
5531 | } | |
5532 | } | |
5533 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
5534 | } // end of for(Int_t ci=0;ci<4;ci++) | |
5535 | ||
5536 | // transfer 1D profile into 1D histogram (eta): | |
5537 | // to be improved (see in documentation if there is a method to transfer values from 1D profile into 1D histogram) | |
5538 | for(Int_t ci=0;ci<4;ci++) | |
5539 | { | |
5540 | for(Int_t e=1;e<=fnBinsEta;e++) | |
5541 | { | |
5542 | if(profile[1][ci]) | |
5543 | { | |
5544 | Double_t correlation = profile[1][ci]->GetBinContent(e); | |
5545 | fFinalCorrelations1D[t][pW][eW][1][ci]->SetBinContent(e,correlation); | |
5546 | } | |
5547 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
5548 | } // end of for(Int_t ci=0;ci<4;ci++) | |
5549 | ||
5550 | } // end of void AliFlowAnalysisWithQCumulants::FinalizeCorrelationsForDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights) | |
5551 | */ | |
5552 | ||
5553 | ||
5554 | //================================================================================================================================ | |
5555 | ||
5556 | ||
5557 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulants(TString type, TString ptOrEta) | |
5558 | { | |
5559 | // calcualate cumulants for differential flow from measured correlations | |
5560 | // Remark: cumulants calculated here are NOT corrected for non-uniform acceptance. This correction is applied in the method ... | |
5561 | // to be improved (description) | |
5562 | ||
5563 | Int_t typeFlag = -1; | |
5564 | Int_t ptEtaFlag = -1; | |
5565 | ||
5566 | if(type == "RP") | |
5567 | { | |
5568 | typeFlag = 0; | |
5569 | } else if(type == "POI") | |
5570 | { | |
5571 | typeFlag = 1; | |
5572 | } | |
5573 | ||
5574 | if(ptOrEta == "Pt") | |
5575 | { | |
5576 | ptEtaFlag = 0; | |
5577 | } else if(ptOrEta == "Eta") | |
5578 | { | |
5579 | ptEtaFlag = 1; | |
5580 | } | |
5581 | ||
5582 | // shortcuts: | |
5583 | Int_t t = typeFlag; | |
5584 | Int_t pe = ptEtaFlag; | |
5585 | ||
5586 | // common: | |
5587 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
5588 | ||
5589 | // correlation <<2>>: | |
5590 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); | |
5591 | ||
5592 | // 1D: | |
5593 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
5594 | { | |
5595 | // reduced correlations: | |
5596 | Double_t twoPrime = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); // <<2'>>(pt) | |
5597 | Double_t fourPrime = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); // <<4'>>(pt) | |
5598 | // final statistical error of reduced correlations: | |
5599 | //Double_t twoPrimeError = fFinalCorrelations1D[t][pW][eW][0][0]->GetBinError(p); | |
5600 | // QC{2'}: | |
5601 | Double_t qc2Prime = twoPrime; // QC{2'} | |
5602 | //Double_t qc2PrimeError = twoPrimeError; // final stat. error of QC{2'} | |
5603 | fDiffFlowCumulants[t][pe][0]->SetBinContent(b,qc2Prime); | |
5604 | //fFinalCumulantsPt[t][pW][eW][nua][0]->SetBinError(p,qc2PrimeError); | |
5605 | // QC{4'}: | |
5606 | Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>> | |
5607 | fDiffFlowCumulants[t][pe][1]->SetBinContent(b,qc4Prime); | |
5608 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
5609 | ||
5610 | ||
5611 | /* | |
5612 | // 2D (pt,eta): | |
5613 | // to be improved (see documentation if I can do all this without looping) | |
5614 | for(Int_t p=1;p<=fnBinsPt;p++) | |
5615 | { | |
5616 | for(Int_t e=1;e<=fnBinsEta;e++) | |
5617 | { | |
5618 | // reduced correlations: | |
5619 | Double_t twoPrime = fFinalCorrelations2D[t][pW][eW][0]->GetBinContent(fFinalCorrelations2D[t][pW][eW][0]->GetBin(p,e)); // <<2'>>(pt,eta) | |
5620 | Double_t fourPrime = fFinalCorrelations2D[t][pW][eW][1]->GetBinContent(fFinalCorrelations2D[t][pW][eW][1]->GetBin(p,e)); // <<4'>>(pt,eta) | |
5621 | for(Int_t nua=0;nua<2;nua++) | |
5622 | { | |
5623 | // QC{2'}: | |
5624 | Double_t qc2Prime = twoPrime; // QC{2'} = <<2'>> | |
5625 | fFinalCumulants2D[t][pW][eW][nua][0]->SetBinContent(fFinalCumulants2D[t][pW][eW][nua][0]->GetBin(p,e),qc2Prime); | |
5626 | // QC{4'}: | |
5627 | Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>> | |
5628 | fFinalCumulants2D[t][pW][eW][nua][1]->SetBinContent(fFinalCumulants2D[t][pW][eW][nua][1]->GetBin(p,e),qc4Prime); | |
5629 | } // end of for(Int_t nua=0;nua<2;nua++) | |
5630 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
5631 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
5632 | */ | |
5633 | ||
5634 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulants(TString type, Bool_t useParticleWeights, TString eventWeights); | |
5635 | ||
5636 | ||
5637 | //================================================================================================================================ | |
5638 | ||
5639 | ||
5640 | void AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type) | |
5641 | { | |
5642 | // calculate final results for integrated flow of RPs and POIs | |
5643 | ||
5644 | Int_t typeFlag = -1; | |
5645 | ||
5646 | if(type == "RP") | |
5647 | { | |
5648 | typeFlag = 0; | |
5649 | } else if(type == "POI") | |
5650 | { | |
5651 | typeFlag = 1; | |
5652 | } else | |
5653 | { | |
5654 | cout<<"WARNING: type must be either RP or POI in AFAWQC::CDF() !!!!"<<endl; | |
5655 | exit(0); | |
5656 | } | |
5657 | ||
5658 | // shortcuts: | |
5659 | Int_t t = typeFlag; | |
5660 | ||
5661 | // pt yield: | |
5662 | TH1F *yield2ndPt = NULL; | |
5663 | TH1F *yield4thPt = NULL; | |
5664 | TH1F *yield6thPt = NULL; | |
5665 | TH1F *yield8thPt = NULL; | |
5666 | ||
5667 | if(type == "POI") | |
5668 | { | |
5669 | yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtPOI())->Clone(); | |
5670 | yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtPOI())->Clone(); | |
5671 | yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtPOI())->Clone(); | |
5672 | yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtPOI())->Clone(); | |
5673 | } | |
5674 | else if(type == "RP") | |
5675 | { | |
5676 | yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtRP())->Clone(); | |
5677 | yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtRP())->Clone(); | |
5678 | yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtRP())->Clone(); | |
5679 | yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtRP())->Clone(); | |
5680 | } | |
5681 | ||
5682 | Int_t nBinsPt = yield2ndPt->GetNbinsX(); | |
5683 | ||
5684 | TH1D *flow2ndPt = NULL; | |
5685 | TH1D *flow4thPt = NULL; | |
5686 | TH1D *flow6thPt = NULL; | |
5687 | TH1D *flow8thPt = NULL; | |
5688 | ||
5689 | // to be improved (hardwired pt index) | |
5690 | flow2ndPt = (TH1D*)fDiffFlow[t][0][0]->Clone(); | |
5691 | flow4thPt = (TH1D*)fDiffFlow[t][0][1]->Clone(); | |
5692 | flow6thPt = (TH1D*)fDiffFlow[t][0][2]->Clone(); | |
5693 | flow8thPt = (TH1D*)fDiffFlow[t][0][3]->Clone(); | |
5694 | ||
5695 | Double_t dvn2nd = 0., dvn4th = 0., dvn6th = 0., dvn8th = 0.; // differential flow | |
5696 | Double_t dErrvn2nd = 0., dErrvn4th = 0., dErrvn6th = 0., dErrvn8th = 0.; // error on differential flow | |
5697 | ||
5698 | Double_t dVn2nd = 0., dVn4th = 0., dVn6th = 0., dVn8th = 0.; // integrated flow | |
5699 | Double_t dErrVn2nd = 0., dErrVn4th = 0., dErrVn6th = 0., dErrVn8th = 0.; // error on integrated flow | |
5700 | ||
5701 | Double_t dYield2nd = 0., dYield4th = 0., dYield6th = 0., dYield8th = 0.; // pt yield | |
5702 | Double_t dSum2nd = 0., dSum4th = 0., dSum6th = 0., dSum8th = 0.; // needed for normalizing integrated flow | |
5703 | ||
5704 | // looping over pt bins: | |
5705 | for(Int_t p=1;p<nBinsPt+1;p++) | |
5706 | { | |
5707 | dvn2nd = flow2ndPt->GetBinContent(p); | |
5708 | dvn4th = flow4thPt->GetBinContent(p); | |
5709 | dvn6th = flow6thPt->GetBinContent(p); | |
5710 | dvn8th = flow8thPt->GetBinContent(p); | |
5711 | ||
5712 | dErrvn2nd = flow2ndPt->GetBinError(p); | |
5713 | dErrvn4th = flow4thPt->GetBinError(p); | |
5714 | dErrvn6th = flow6thPt->GetBinError(p); | |
5715 | dErrvn8th = flow8thPt->GetBinError(p); | |
5716 | ||
5717 | dYield2nd = yield2ndPt->GetBinContent(p); | |
5718 | dYield4th = yield4thPt->GetBinContent(p); | |
5719 | dYield6th = yield6thPt->GetBinContent(p); | |
5720 | dYield8th = yield8thPt->GetBinContent(p); | |
5721 | ||
5722 | dVn2nd += dvn2nd*dYield2nd; | |
5723 | dVn4th += dvn4th*dYield4th; | |
5724 | dVn6th += dvn6th*dYield6th; | |
5725 | dVn8th += dvn8th*dYield8th; | |
5726 | ||
5727 | dSum2nd += dYield2nd; | |
5728 | dSum4th += dYield4th; | |
5729 | dSum6th += dYield6th; | |
5730 | dSum8th += dYield8th; | |
5731 | ||
5732 | dErrVn2nd += dYield2nd*dYield2nd*dErrvn2nd*dErrvn2nd; // ro be improved (check this relation) | |
5733 | dErrVn4th += dYield4th*dYield4th*dErrvn4th*dErrvn4th; | |
5734 | dErrVn6th += dYield6th*dYield6th*dErrvn6th*dErrvn6th; | |
5735 | dErrVn8th += dYield8th*dYield8th*dErrvn8th*dErrvn8th; | |
5736 | ||
5737 | } // end of for(Int_t p=1;p<nBinsPt+1;p++) | |
5738 | ||
5739 | // normalizing the results for integrated flow: | |
5740 | if(dSum2nd) | |
5741 | { | |
5742 | dVn2nd /= dSum2nd; | |
5743 | dErrVn2nd /= (dSum2nd*dSum2nd); | |
5744 | dErrVn2nd = TMath::Sqrt(dErrVn2nd); | |
5745 | } | |
5746 | if(dSum4th) | |
5747 | { | |
5748 | dVn4th /= dSum4th; | |
5749 | dErrVn4th /= (dSum4th*dSum4th); | |
5750 | dErrVn4th = TMath::Sqrt(dErrVn4th); | |
5751 | } | |
5752 | //if(dSum6th) dVn6th/=dSum6th; | |
5753 | //if(dSum8th) dVn8th/=dSum8th; | |
5754 | ||
5755 | // storing the results for integrated flow in common histos: (to be improved: new method for this?) | |
5756 | if(type == "POI") | |
5757 | { | |
5758 | fCommonHistsResults2nd->FillIntegratedFlowPOI(dVn2nd,dErrVn2nd); | |
5759 | fCommonHistsResults4th->FillIntegratedFlowPOI(dVn4th,dErrVn4th); | |
5760 | fCommonHistsResults6th->FillIntegratedFlowPOI(dVn6th,0.); // to be improved (errors) | |
5761 | fCommonHistsResults8th->FillIntegratedFlowPOI(dVn8th,0.); // to be improved (errors) | |
5762 | } | |
5763 | else if (type == "RP") | |
5764 | { | |
5765 | fCommonHistsResults2nd->FillIntegratedFlowRP(dVn2nd,dErrVn2nd); | |
5766 | fCommonHistsResults4th->FillIntegratedFlowRP(dVn4th,dErrVn4th); | |
5767 | fCommonHistsResults6th->FillIntegratedFlowRP(dVn6th,0.); // to be improved (errors) | |
5768 | fCommonHistsResults8th->FillIntegratedFlowRP(dVn8th,0.); // to be improved (errors) | |
5769 | } | |
5770 | ||
5771 | delete flow2ndPt; | |
5772 | delete flow4thPt; | |
5773 | //delete flow6thPt; | |
5774 | //delete flow8thPt; | |
5775 | ||
5776 | delete yield2ndPt; | |
5777 | delete yield4thPt; | |
5778 | delete yield6thPt; | |
5779 | delete yield8thPt; | |
5780 | ||
5781 | } // end of AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type) | |
5782 | ||
5783 | ||
5784 | //================================================================================================================================ | |
5785 | ||
5786 | ||
5787 | void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions() | |
5788 | { | |
5789 | // Initialize all arrays used for distributions. | |
5790 | ||
5791 | // a) Initialize arrays of histograms used to hold distributions of correlations; | |
5792 | // b) Initialize array to hold min and max values of correlations. | |
5793 | ||
5794 | // a) Initialize arrays of histograms used to hold distributions of correlations: | |
5795 | for(Int_t di=0;di<4;di++) // distribution index | |
5796 | { | |
5797 | fDistributions[di] = NULL; | |
5798 | } | |
5799 | ||
5800 | // b) Initialize default min and max values of correlations: | |
5801 | // (Remark: The default values bellow were chosen for v2=5% and M=500) | |
5802 | fMinValueOfCorrelation[0] = -0.01; // <2>_min | |
5803 | fMaxValueOfCorrelation[0] = 0.04; // <2>_max | |
5804 | fMinValueOfCorrelation[1] = -0.00002; // <4>_min | |
5805 | fMaxValueOfCorrelation[1] = 0.00015; // <4>_max | |
5806 | fMinValueOfCorrelation[2] = -0.0000003; // <6>_min | |
5807 | fMaxValueOfCorrelation[2] = 0.0000006; // <6>_max | |
5808 | fMinValueOfCorrelation[3] = -0.000000006; // <8>_min | |
5809 | fMaxValueOfCorrelation[3] = 0.000000003; // <8>_max | |
5810 | ||
5811 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions() | |
5812 | ||
5813 | ||
5814 | //================================================================================================================================ | |
5815 | ||
5816 | ||
5817 | void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions() | |
5818 | { | |
5819 | // a) Book profile to hold all flags for distributions of correlations; | |
5820 | // b) Book all histograms to hold distributions of correlations. | |
5821 | ||
5822 | TString correlationIndex[4] = {"<2>","<4>","<6>","<8>"}; // to be improved (should I promote this to data members?) | |
5823 | ||
5824 | // a) Book profile to hold all flags for distributions of correlations: | |
5825 | TString distributionsFlagsName = "fDistributionsFlags"; | |
5826 | distributionsFlagsName += fAnalysisLabel->Data(); | |
5827 | fDistributionsFlags = new TProfile(distributionsFlagsName.Data(),"Flags for Distributions of Correlations",9,0,9); | |
5828 | fDistributionsFlags->SetTickLength(-0.01,"Y"); | |
5829 | fDistributionsFlags->SetMarkerStyle(25); | |
5830 | fDistributionsFlags->SetLabelSize(0.05); | |
5831 | fDistributionsFlags->SetLabelOffset(0.02,"Y"); | |
5832 | fDistributionsFlags->GetXaxis()->SetBinLabel(1,"Store or not?"); | |
5833 | fDistributionsFlags->GetXaxis()->SetBinLabel(2,"<2>_{min}"); | |
5834 | fDistributionsFlags->GetXaxis()->SetBinLabel(3,"<2>_{max}"); | |
5835 | fDistributionsFlags->GetXaxis()->SetBinLabel(4,"<4>_{min}"); | |
5836 | fDistributionsFlags->GetXaxis()->SetBinLabel(5,"<4>_{max}"); | |
5837 | fDistributionsFlags->GetXaxis()->SetBinLabel(6,"<6>_{min}"); | |
5838 | fDistributionsFlags->GetXaxis()->SetBinLabel(7,"<6>_{max}"); | |
5839 | fDistributionsFlags->GetXaxis()->SetBinLabel(8,"<8>_{min}"); | |
5840 | fDistributionsFlags->GetXaxis()->SetBinLabel(9,"<8>_{max}"); | |
5841 | fDistributionsList->Add(fDistributionsFlags); | |
5842 | ||
5843 | // b) Book all histograms to hold distributions of correlations. | |
5844 | if(fStoreDistributions) | |
5845 | { | |
5846 | TString distributionsName = "fDistributions"; | |
5847 | distributionsName += fAnalysisLabel->Data(); | |
5848 | for(Int_t di=0;di<4;di++) // distribution index | |
5849 | { | |
5850 | fDistributions[di] = new TH1D(Form("Distribution of %s",correlationIndex[di].Data()),Form("Distribution of %s",correlationIndex[di].Data()),10000,fMinValueOfCorrelation[di],fMaxValueOfCorrelation[di]); | |
5851 | fDistributions[di]->SetXTitle(correlationIndex[di].Data()); | |
5852 | fDistributionsList->Add(fDistributions[di]); | |
5853 | } // end of for(Int_t di=0;di<4;di++) // distribution index | |
5854 | } // end of if(fStoreDistributions) | |
5855 | ||
5856 | } // end of void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions() | |
5857 | ||
5858 | ||
5859 | //================================================================================================================================ | |
5860 | ||
5861 | ||
5862 | void AliFlowAnalysisWithQCumulants::StoreFlagsForDistributions() | |
5863 | { | |
5864 | // Store all flags for distributiuons of correlations in profile fDistributionsFlags. | |
5865 | ||
5866 | if(!fDistributionsFlags) | |
5867 | { | |
5868 | cout<<"WARNING: fDistributionsFlags is NULL in AFAWQC::SDF() !!!!"<<endl; | |
5869 | exit(0); | |
5870 | } | |
5871 | ||
5872 | fDistributionsFlags->Fill(0.5,(Int_t)fStoreDistributions); // histos with distributions of correlations stored or not in the output file | |
5873 | // store min and max values of correlations: | |
5874 | for(Int_t di=0;di<4;di++) // distribution index | |
5875 | { | |
5876 | fDistributionsFlags->Fill(1.5+2.*(Double_t)di,fMinValueOfCorrelation[di]); | |
5877 | fDistributionsFlags->Fill(2.5+2.*(Double_t)di,fMaxValueOfCorrelation[di]); | |
5878 | } | |
5879 | ||
5880 | } // end of void AliFlowAnalysisWithQCumulants::StoreFlagsForDistributions() | |
5881 | ||
5882 | ||
5883 | //================================================================================================================================ | |
5884 | ||
5885 | ||
5886 | void AliFlowAnalysisWithQCumulants::StoreDistributionsOfCorrelations() | |
5887 | { | |
5888 | // Store distributions of correlations. | |
5889 | ||
5890 | if(!(fIntFlowCorrelationsEBE && fIntFlowEventWeightsForCorrelationsEBE)) | |
5891 | { | |
5892 | cout<<"WARNING: fIntFlowCorrelationsEBE && fIntFlowEventWeightsForCorrelationsEBE"<<endl; | |
5893 | cout<<" is NULL in AFAWQC::SDOC() !!!!"<<endl; | |
5894 | exit(0); | |
5895 | } | |
5896 | ||
5897 | for(Int_t di=0;di<4;di++) // distribution index | |
5898 | { | |
5899 | if(!fDistributions[di]) | |
5900 | { | |
5901 | cout<<"WARNING: fDistributions[di] is NULL in AFAWQC::SDOC() !!!!"<<endl; | |
5902 | cout<<"di = "<<di<<endl; | |
5903 | exit(0); | |
5904 | } else | |
5905 | { | |
5906 | fDistributions[di]->Fill(fIntFlowCorrelationsEBE->GetBinContent(di+1),fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(di+1)); | |
5907 | } | |
5908 | } // end of for(Int_t di=0;di<4;di++) // distribution index | |
5909 | ||
5910 | } // end of void AliFlowAnalysisWithQCumulants::StoreDistributionsOfCorrelations() | |
5911 | ||
5912 | ||
5913 | //================================================================================================================================ | |
5914 | ||
5915 | ||
5916 | void AliFlowAnalysisWithQCumulants::BookAndNestAllLists() | |
5917 | { | |
5918 | // Book and nest all lists nested in the base list fHistList. | |
5919 | // a) Book and nest lists for integrated flow; | |
5920 | // b) Book and nest lists for differential flow; | |
5921 | // c) Book and nest list for particle weights; | |
5922 | // d) Book and nest list for distributions; | |
5923 | // e) Book and nest list for nested loops; | |
5924 | ||
5925 | // a) Book and nest all lists for integrated flow: | |
5926 | // base list for integrated flow: | |
5927 | fIntFlowList = new TList(); | |
5928 | fIntFlowList->SetName("Integrated Flow"); | |
5929 | fIntFlowList->SetOwner(kTRUE); | |
5930 | fHistList->Add(fIntFlowList); | |
5931 | // list holding profiles: | |
5932 | fIntFlowProfiles = new TList(); | |
5933 | fIntFlowProfiles->SetName("Profiles"); | |
5934 | fIntFlowProfiles->SetOwner(kTRUE); | |
5935 | fIntFlowList->Add(fIntFlowProfiles); | |
5936 | // list holding histograms with results: | |
5937 | fIntFlowResults = new TList(); | |
5938 | fIntFlowResults->SetName("Results"); | |
5939 | fIntFlowResults->SetOwner(kTRUE); | |
5940 | fIntFlowList->Add(fIntFlowResults); | |
5941 | ||
5942 | // b) Book and nest lists for differential flow; | |
5943 | fDiffFlowList = new TList(); | |
5944 | fDiffFlowList->SetName("Differential Flow"); | |
5945 | fDiffFlowList->SetOwner(kTRUE); | |
5946 | fHistList->Add(fDiffFlowList); | |
5947 | // list holding profiles: | |
5948 | fDiffFlowProfiles = new TList(); | |
5949 | fDiffFlowProfiles->SetName("Profiles"); | |
5950 | fDiffFlowProfiles->SetOwner(kTRUE); | |
5951 | fDiffFlowList->Add(fDiffFlowProfiles); | |
5952 | // list holding histograms with results: | |
5953 | fDiffFlowResults = new TList(); | |
5954 | fDiffFlowResults->SetName("Results"); | |
5955 | fDiffFlowResults->SetOwner(kTRUE); | |
5956 | fDiffFlowList->Add(fDiffFlowResults); | |
5957 | // flags used for naming nested lists in list fDiffFlowProfiles and fDiffFlowResults: | |
5958 | TList list; | |
5959 | list.SetOwner(kTRUE); | |
5960 | TString typeFlag[2] = {"RP","POI"}; | |
5961 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
5962 | TString powerFlag[2] = {"linear","quadratic"}; | |
5963 | // nested lists in fDiffFlowProfiles (~/Differential Flow/Profiles): | |
5964 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
5965 | { | |
5966 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5967 | { | |
5968 | // list holding profiles with correlations: | |
5969 | fDiffFlowCorrelationsProList[t][pe] = (TList*)list.Clone(); | |
5970 | fDiffFlowCorrelationsProList[t][pe]->SetName(Form("Profiles with correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5971 | fDiffFlowProfiles->Add(fDiffFlowCorrelationsProList[t][pe]); | |
5972 | // list holding profiles with products of correlations: | |
5973 | fDiffFlowProductOfCorrelationsProList[t][pe] = (TList*)list.Clone(); | |
5974 | fDiffFlowProductOfCorrelationsProList[t][pe]->SetName(Form("Profiles with products of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5975 | fDiffFlowProfiles->Add(fDiffFlowProductOfCorrelationsProList[t][pe]); | |
5976 | // list holding profiles with corrections: | |
5977 | fDiffFlowCorrectionsProList[t][pe] = (TList*)list.Clone(); | |
5978 | fDiffFlowCorrectionsProList[t][pe]->SetName(Form("Profiles with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5979 | fDiffFlowProfiles->Add(fDiffFlowCorrectionsProList[t][pe]); | |
5980 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5981 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
5982 | // nested lists in fDiffFlowResults (~/Differential Flow/Results): | |
5983 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
5984 | { | |
5985 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5986 | { | |
5987 | // list holding histograms with correlations: | |
5988 | fDiffFlowCorrelationsHistList[t][pe] = (TList*)list.Clone(); | |
5989 | fDiffFlowCorrelationsHistList[t][pe]->SetName(Form("Correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5990 | fDiffFlowResults->Add(fDiffFlowCorrelationsHistList[t][pe]); | |
5991 | // list holding histograms with corrections: | |
5992 | fDiffFlowCorrectionsHistList[t][pe] = (TList*)list.Clone(); | |
5993 | fDiffFlowCorrectionsHistList[t][pe]->SetName(Form("Histograms with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
5994 | fDiffFlowResults->Add(fDiffFlowCorrectionsHistList[t][pe]); | |
5995 | for(Int_t power=0;power<2;power++) | |
5996 | { | |
5997 | // list holding histograms with sums of event weights: | |
5998 | fDiffFlowSumOfEventWeightsHistList[t][pe][power] = (TList*)list.Clone(); | |
5999 | fDiffFlowSumOfEventWeightsHistList[t][pe][power]->SetName(Form("Sum of %s event weights (%s, %s)",powerFlag[power].Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6000 | fDiffFlowResults->Add(fDiffFlowSumOfEventWeightsHistList[t][pe][power]); | |
6001 | } // end of for(Int_t power=0;power<2;power++) | |
6002 | // list holding histograms with sums of products of event weights: | |
6003 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe] = (TList*)list.Clone(); | |
6004 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]->SetName(Form("Sum of products of event weights (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6005 | fDiffFlowResults->Add(fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]); | |
6006 | // list holding histograms with covariances of correlations: | |
6007 | fDiffFlowCovariancesHistList[t][pe] = (TList*)list.Clone(); | |
6008 | fDiffFlowCovariancesHistList[t][pe]->SetName(Form("Covariances of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6009 | fDiffFlowResults->Add(fDiffFlowCovariancesHistList[t][pe]); | |
6010 | // list holding histograms with differential Q-cumulants: | |
6011 | fDiffFlowCumulantsHistList[t][pe] = (TList*)list.Clone(); | |
6012 | fDiffFlowCumulantsHistList[t][pe]->SetName(Form("Differential Q-cumulants (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6013 | fDiffFlowResults->Add(fDiffFlowCumulantsHistList[t][pe]); | |
6014 | // list holding histograms with differential flow estimates from Q-cumulants: | |
6015 | fDiffFlowHistList[t][pe] = (TList*)list.Clone(); | |
6016 | fDiffFlowHistList[t][pe]->SetName(Form("Differential flow (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6017 | fDiffFlowResults->Add(fDiffFlowHistList[t][pe]); | |
6018 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
6019 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
6020 | ||
6021 | // c) Book and nest list for particle weights: | |
6022 | fWeightsList->SetName("Weights"); | |
6023 | fWeightsList->SetOwner(kTRUE); | |
6024 | fHistList->Add(fWeightsList); | |
6025 | ||
6026 | // d) Book and nest list for distributions: | |
6027 | fDistributionsList = new TList(); | |
6028 | fDistributionsList->SetName("Distributions"); | |
6029 | fDistributionsList->SetOwner(kTRUE); | |
6030 | fHistList->Add(fDistributionsList); | |
6031 | ||
6032 | // e) Book and nest list for nested loops: | |
6033 | fNestedLoopsList = new TList(); | |
6034 | fNestedLoopsList->SetName("Nested Loops"); | |
6035 | fNestedLoopsList->SetOwner(kTRUE); | |
6036 | fHistList->Add(fNestedLoopsList); | |
6037 | ||
6038 | } // end of void AliFlowAnalysisWithQCumulants::BookAndNestAllLists() | |
6039 | ||
6040 | ||
6041 | //================================================================================================================================ | |
6042 | ||
6043 | ||
6044 | void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type) | |
6045 | { | |
6046 | // fill common result histograms for differential flow | |
6047 | ||
6048 | Int_t typeFlag = -1; | |
6049 | //Int_t ptEtaFlag = -1; | |
6050 | ||
6051 | if(type == "RP") | |
6052 | { | |
6053 | typeFlag = 0; | |
6054 | } else if(type == "POI") | |
6055 | { | |
6056 | typeFlag = 1; | |
6057 | } | |
6058 | ||
6059 | // shortcuts: | |
6060 | Int_t t = typeFlag; | |
6061 | //Int_t pe = ptEtaFlag; | |
6062 | ||
6063 | // to be improved (implement protection here) | |
6064 | ||
6065 | if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th)) | |
6066 | { | |
6067 | cout<<"WARNING: fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th"<<endl; | |
6068 | cout<<" is NULL in AFAWQC::FCHRIF() !!!!"<<endl; | |
6069 | exit(0); | |
6070 | } | |
6071 | ||
6072 | // pt: | |
6073 | for(Int_t p=1;p<=fnBinsPt;p++) | |
6074 | { | |
6075 | Double_t v2 = fDiffFlow[t][0][0]->GetBinContent(p); | |
6076 | Double_t v4 = fDiffFlow[t][0][1]->GetBinContent(p); | |
6077 | Double_t v6 = fDiffFlow[t][0][2]->GetBinContent(p); | |
6078 | Double_t v8 = fDiffFlow[t][0][3]->GetBinContent(p); | |
6079 | ||
6080 | Double_t v2Error = fDiffFlow[t][0][0]->GetBinError(p); | |
6081 | Double_t v4Error = fDiffFlow[t][0][1]->GetBinError(p); | |
6082 | //Double_t v6Error = fFinalFlow1D[t][pW][nua][0][2]->GetBinError(p); | |
6083 | //Double_t v8Error = fFinalFlow1D[t][pW][nua][0][3]->GetBinError(p); | |
6084 | ||
6085 | if(type == "RP") | |
6086 | { | |
6087 | fCommonHistsResults2nd->FillDifferentialFlowPtRP(p,v2,v2Error); | |
6088 | fCommonHistsResults4th->FillDifferentialFlowPtRP(p,v4,v4Error); | |
6089 | fCommonHistsResults6th->FillDifferentialFlowPtRP(p,v6,0.); | |
6090 | fCommonHistsResults8th->FillDifferentialFlowPtRP(p,v8,0.); | |
6091 | } else if(type == "POI") | |
6092 | { | |
6093 | fCommonHistsResults2nd->FillDifferentialFlowPtPOI(p,v2,v2Error); | |
6094 | fCommonHistsResults4th->FillDifferentialFlowPtPOI(p,v4,v4Error); | |
6095 | fCommonHistsResults6th->FillDifferentialFlowPtPOI(p,v6,0.); | |
6096 | fCommonHistsResults8th->FillDifferentialFlowPtPOI(p,v8,0.); | |
6097 | } | |
6098 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
6099 | ||
6100 | // eta: | |
6101 | for(Int_t e=1;e<=fnBinsEta;e++) | |
6102 | { | |
6103 | Double_t v2 = fDiffFlow[t][1][0]->GetBinContent(e); | |
6104 | Double_t v4 = fDiffFlow[t][1][1]->GetBinContent(e); | |
6105 | Double_t v6 = fDiffFlow[t][1][2]->GetBinContent(e); | |
6106 | Double_t v8 = fDiffFlow[t][1][3]->GetBinContent(e); | |
6107 | ||
6108 | Double_t v2Error = fDiffFlow[t][1][0]->GetBinError(e); | |
6109 | Double_t v4Error = fDiffFlow[t][1][1]->GetBinError(e); | |
6110 | //Double_t v6Error = fDiffFlow[t][1][2]->GetBinError(e); | |
6111 | //Double_t v8Error = fDiffFlow[t][1][3]->GetBinError(e); | |
6112 | ||
6113 | if(type == "RP") | |
6114 | { | |
6115 | fCommonHistsResults2nd->FillDifferentialFlowEtaRP(e,v2,v2Error); | |
6116 | fCommonHistsResults4th->FillDifferentialFlowEtaRP(e,v4,v4Error); | |
6117 | fCommonHistsResults6th->FillDifferentialFlowEtaRP(e,v6,0.); | |
6118 | fCommonHistsResults8th->FillDifferentialFlowEtaRP(e,v8,0.); | |
6119 | } else if(type == "POI") | |
6120 | { | |
6121 | fCommonHistsResults2nd->FillDifferentialFlowEtaPOI(e,v2,v2Error); | |
6122 | fCommonHistsResults4th->FillDifferentialFlowEtaPOI(e,v4,v4Error); | |
6123 | fCommonHistsResults6th->FillDifferentialFlowEtaPOI(e,v6,0.); | |
6124 | fCommonHistsResults8th->FillDifferentialFlowEtaPOI(e,v8,0.); | |
6125 | } | |
6126 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
6127 | ||
6128 | } // end of void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights, Bool_t correctedForNUA) | |
6129 | ||
489d5531 | 6130 | //================================================================================================================================ |
6131 | ||
489d5531 | 6132 | void AliFlowAnalysisWithQCumulants::AccessConstants() |
6133 | { | |
b3dacf6b | 6134 | // Access needed common constants from AliFlowCommonConstants. |
489d5531 | 6135 | |
6136 | fnBinsPhi = AliFlowCommonConstants::GetMaster()->GetNbinsPhi(); | |
6137 | fPhiMin = AliFlowCommonConstants::GetMaster()->GetPhiMin(); | |
6138 | fPhiMax = AliFlowCommonConstants::GetMaster()->GetPhiMax(); | |
6139 | if(fnBinsPhi) fPhiBinWidth = (fPhiMax-fPhiMin)/fnBinsPhi; | |
6140 | fnBinsPt = AliFlowCommonConstants::GetMaster()->GetNbinsPt(); | |
6141 | fPtMin = AliFlowCommonConstants::GetMaster()->GetPtMin(); | |
6142 | fPtMax = AliFlowCommonConstants::GetMaster()->GetPtMax(); | |
6143 | if(fnBinsPt) fPtBinWidth = (fPtMax-fPtMin)/fnBinsPt; | |
6144 | fnBinsEta = AliFlowCommonConstants::GetMaster()->GetNbinsEta(); | |
6145 | fEtaMin = AliFlowCommonConstants::GetMaster()->GetEtaMin(); | |
6146 | fEtaMax = AliFlowCommonConstants::GetMaster()->GetEtaMax(); | |
6147 | if(fnBinsEta) fEtaBinWidth = (fEtaMax-fEtaMin)/fnBinsEta; | |
6148 | ||
6149 | } // end of void AliFlowAnalysisWithQCumulants::AccessConstants() | |
6150 | ||
489d5531 | 6151 | //================================================================================================================================ |
6152 | ||
489d5531 | 6153 | void AliFlowAnalysisWithQCumulants::CrossCheckSettings() |
6154 | { | |
6155 | // a) Cross check if the choice for multiplicity weights make sense; | |
6156 | ||
6157 | // a) Cross check if the choice for multiplicity weights make sense: | |
6158 | if(strcmp(fMultiplicityWeight->Data(),"combinations") && | |
6159 | strcmp(fMultiplicityWeight->Data(),"unit") && | |
6160 | strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
6161 | { | |
6162 | cout<<"WARNING (QC): Multiplicity weight can be either \"combinations\", \"unit\""<<endl; | |
6163 | cout<<" or \"multiplicity\". Certainly not \""<<fMultiplicityWeight->Data()<<"\"."<<endl; | |
6164 | exit(0); | |
6165 | } | |
6166 | ||
6167 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckSettings() | |
6168 | ||
489d5531 | 6169 | //================================================================================================================================ |
6170 | ||
489d5531 | 6171 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeights() |
6172 | { | |
0328db2d | 6173 | // Calculate sum of linear and quadratic event weights for correlations. |
2001bc3a | 6174 | |
6175 | // multiplicity: | |
6176 | Double_t dMult = (*fSMpk)(0,0); | |
9f33751d | 6177 | |
489d5531 | 6178 | for(Int_t p=0;p<2;p++) // power-1 |
6179 | { | |
6180 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
6181 | { | |
6182 | fIntFlowSumOfEventWeights[p]->Fill(ci+0.5,pow(fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci+1),p+1)); | |
b3dacf6b | 6183 | if(fCalculateCumulantsVsM) |
6184 | { | |
6185 | fIntFlowSumOfEventWeightsVsM[ci][p]->Fill(dMult+0.5,pow(fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci+1),p+1)); // to be improved: dMult => sum of weights? | |
6186 | } | |
489d5531 | 6187 | } |
6188 | } | |
6189 | ||
6190 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeights() | |
6191 | ||
489d5531 | 6192 | //================================================================================================================================ |
6193 | ||
0328db2d | 6194 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeightsNUA() |
489d5531 | 6195 | { |
0328db2d | 6196 | // Calculate sum of linear and quadratic event weights for NUA terms. |
6197 | ||
6198 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
489d5531 | 6199 | { |
0328db2d | 6200 | for(Int_t p=0;p<2;p++) // power-1 |
6201 | { | |
6202 | for(Int_t ci=0;ci<3;ci++) // nua term index | |
6203 | { | |
6204 | fIntFlowSumOfEventWeightsNUA[sc][p]->Fill(ci+0.5,pow(fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc]->GetBinContent(ci+1),p+1)); | |
489d5531 | 6205 | } |
0328db2d | 6206 | } |
6207 | } | |
6208 | ||
6209 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeightsNUA() | |
489d5531 | 6210 | |
0328db2d | 6211 | //================================================================================================================================ |
6212 | ||
0328db2d | 6213 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeights() |
6214 | { | |
ff70ca91 | 6215 | // Calculate sum of product of event weights for correlations. |
2001bc3a | 6216 | |
6217 | // multiplicity: | |
6218 | Double_t dMult = (*fSMpk)(0,0); | |
6219 | ||
489d5531 | 6220 | Int_t counter = 0; |
6221 | ||
6222 | for(Int_t ci1=1;ci1<4;ci1++) | |
6223 | { | |
6224 | for(Int_t ci2=ci1+1;ci2<=4;ci2++) | |
6225 | { | |
ff70ca91 | 6226 | fIntFlowSumOfProductOfEventWeights->Fill(0.5+counter, |
6227 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
b3dacf6b | 6228 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); |
6229 | if(fCalculateCumulantsVsM) | |
6230 | { | |
6231 | fIntFlowSumOfProductOfEventWeightsVsM[counter]->Fill(dMult+0.5, // to be improved: dMult => sum of weights? | |
6232 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
6233 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); | |
6234 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 6235 | counter++; |
489d5531 | 6236 | } |
6237 | } | |
6238 | ||
0328db2d | 6239 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeights() |
6240 | ||
0328db2d | 6241 | //================================================================================================================================ |
6242 | ||
0328db2d | 6243 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeightsNUA() |
6244 | { | |
6245 | // Calculate sum of product of event weights for NUA terms. | |
6246 | ||
6247 | // w_{<2>} * w_{<cos(#phi)>}: | |
6248 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(0.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6249 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
6250 | // w_{<2>} * w_{<sin(#phi)>}: | |
6251 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(1.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6252 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
6253 | // w_{<cos(#phi)> * w_{<sin(#phi)>}: | |
6254 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(2.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6255 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
6256 | // w_{<2>} * w{<cos(phi1+phi2)>} | |
6257 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(3.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6258 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6259 | // w_{<2>} * w{<sin(phi1+phi2)>} | |
6260 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(4.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6261 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6262 | // w_{<2>} * w{<cos(phi1-phi2-phi3)>} | |
6263 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(5.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6264 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6265 | // w_{<2>} * w{<sin(phi1-phi2-phi3)>} | |
6266 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(6.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6267 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6268 | // w_{<4>} * w{<cos(phi1)>} | |
6269 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(7.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6270 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
6271 | // w_{<4>} * w{<sin(phi1)>} | |
6272 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(8.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6273 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
6274 | // w_{<4>} * w{<cos(phi1+phi2)>} | |
6275 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(9.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6276 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6277 | // w_{<4>} * w{<sin(phi1+phi2)>} | |
6278 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(10.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6279 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6280 | // w_{<4>} * w{<cos(phi1-phi2-phi3)>} | |
6281 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(11.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6282 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6283 | // w_{<4>} * w{<sin(phi1-phi2-phi3)>} | |
6284 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(12.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6285 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6286 | // w_{<cos(phi1)>} * w{<cos(phi1+phi2)>} | |
6287 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(13.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6288 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6289 | // w_{<cos(phi1)>} * w{<sin(phi1+phi2)>} | |
6290 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(14.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6291 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6292 | // w_{<cos(phi1)>} * w{<cos(phi1-phi2-phi3)>} | |
6293 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(15.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6294 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6295 | // w_{<cos(phi1)>} * w{<sin(phi1-phi2-phi3)>} | |
6296 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(16.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6297 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6298 | // w_{<sin(phi1)>} * w{<cos(phi1+phi2)>} | |
6299 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(17.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6300 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6301 | // w_{<sin(phi1)>} * w{<sin(phi1+phi2)>} | |
6302 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(18.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6303 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6304 | // w_{<sin(phi1)>} * w{<cos(phi1-phi2-phi3)>} | |
6305 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(19.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6306 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6307 | // w_{<sin(phi1)>} * w{<sin(phi1-phi2-phi3)>} | |
6308 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(20.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6309 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6310 | // w_{<cos(phi1+phi2)>} * w{<sin(phi1+phi2))>} | |
6311 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(21.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)* | |
6312 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6313 | // w_{<cos(phi1+phi2)>} * w{<cos(phi1-phi2-phi3)>} | |
6314 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(22.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)* | |
6315 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6316 | // w_{<cos(phi1+phi2)>} * w{<sin(phi1-phi2-phi3)>} | |
6317 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(23.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)* | |
6318 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6319 | // w_{<sin(phi1+phi2)>} * w{<cos(phi1-phi2-phi3)>} | |
6320 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(24.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)* | |
6321 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6322 | // w_{<sin(phi1+phi2)>} * w{<sin(phi1-phi2-phi3)>} | |
6323 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(25.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)* | |
6324 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6325 | // w_{<cos(phi1-phi2-phi3)>} * w{<sin(phi1-phi2-phi3)>} | |
6326 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(26.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)* | |
6327 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6328 | ||
6329 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowIntFlowSumOfProductOfEventWeightsNUA() | |
489d5531 | 6330 | |
6331 | ||
6332 | //================================================================================================================================ | |
6333 | ||
6334 | ||
6335 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelations(TString type, TString ptOrEta) | |
6336 | { | |
6337 | // calculate reduced correlations for RPs or POIs in pt or eta bins | |
6338 | ||
6339 | // multiplicity: | |
6340 | Double_t dMult = (*fSMpk)(0,0); | |
6341 | ||
6342 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
6343 | Double_t dReQ1n = (*fReQ)(0,0); | |
6344 | Double_t dReQ2n = (*fReQ)(1,0); | |
6345 | //Double_t dReQ3n = (*fReQ)(2,0); | |
6346 | //Double_t dReQ4n = (*fReQ)(3,0); | |
6347 | Double_t dImQ1n = (*fImQ)(0,0); | |
6348 | Double_t dImQ2n = (*fImQ)(1,0); | |
6349 | //Double_t dImQ3n = (*fImQ)(2,0); | |
6350 | //Double_t dImQ4n = (*fImQ)(3,0); | |
6351 | ||
6352 | // reduced correlations are stored in fDiffFlowCorrelationsPro[0=RP,1=POI][0=pt,1=eta][correlation index]. Correlation index runs as follows: | |
6353 | // | |
6354 | // 0: <<2'>> | |
6355 | // 1: <<4'>> | |
6356 | // 2: <<6'>> | |
6357 | // 3: <<8'>> | |
6358 | ||
6359 | Int_t t = -1; // type flag | |
6360 | Int_t pe = -1; // ptEta flag | |
6361 | ||
6362 | if(type == "RP") | |
6363 | { | |
6364 | t = 0; | |
6365 | } else if(type == "POI") | |
6366 | { | |
6367 | t = 1; | |
6368 | } | |
6369 | ||
6370 | if(ptOrEta == "Pt") | |
6371 | { | |
6372 | pe = 0; | |
6373 | } else if(ptOrEta == "Eta") | |
6374 | { | |
6375 | pe = 1; | |
6376 | } | |
6377 | ||
6378 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
6379 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
6380 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
6381 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
6382 | ||
6383 | // looping over all bins and calculating reduced correlations: | |
6384 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6385 | { | |
6386 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
6387 | Double_t p1n0kRe = 0.; | |
6388 | Double_t p1n0kIm = 0.; | |
6389 | ||
6390 | // number of POIs in particular pt or eta bin: | |
6391 | Double_t mp = 0.; | |
6392 | ||
6393 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
6394 | Double_t q1n0kRe = 0.; | |
6395 | Double_t q1n0kIm = 0.; | |
6396 | Double_t q2n0kRe = 0.; | |
6397 | Double_t q2n0kIm = 0.; | |
6398 | ||
6399 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
6400 | Double_t mq = 0.; | |
6401 | ||
6402 | if(type == "POI") | |
6403 | { | |
6404 | // q_{m*n,0}: | |
6405 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
6406 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
6407 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
6408 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
6409 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
6410 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
6411 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
6412 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
6413 | ||
6414 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
6415 | } | |
6416 | else if(type == "RP") | |
6417 | { | |
6418 | // q_{m*n,0}: | |
6419 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
6420 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
6421 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
6422 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
6423 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
6424 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
6425 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
6426 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
6427 | ||
6428 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
6429 | } | |
6430 | ||
6431 | if(type == "POI") | |
6432 | { | |
6433 | // p_{m*n,0}: | |
6434 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
6435 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
6436 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
6437 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
6438 | ||
6439 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
6440 | ||
6441 | t = 1; // typeFlag = RP or POI | |
6442 | } | |
6443 | else if(type == "RP") | |
6444 | { | |
6445 | // p_{m*n,0} = q_{m*n,0}: | |
6446 | p1n0kRe = q1n0kRe; | |
6447 | p1n0kIm = q1n0kIm; | |
6448 | ||
6449 | mp = mq; | |
6450 | ||
6451 | t = 0; // typeFlag = RP or POI | |
6452 | } | |
6453 | ||
6454 | // 2'-particle correlation for particular (pt,eta) bin: | |
6455 | Double_t two1n1nPtEta = 0.; | |
6456 | if(mp*dMult-mq) | |
6457 | { | |
6458 | two1n1nPtEta = (p1n0kRe*dReQ1n+p1n0kIm*dImQ1n-mq) | |
6459 | / (mp*dMult-mq); | |
6460 | ||
6461 | if(type == "POI") // to be improved (I do not this if) | |
6462 | { | |
6463 | // fill profile to get <<2'>> for POIs | |
6464 | fDiffFlowCorrelationsPro[1][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta,mp*dMult-mq); | |
6465 | // histogram to store <2'> for POIs e-b-e (needed in some other methods): | |
6466 | fDiffFlowCorrelationsEBE[1][pe][0]->SetBinContent(b,two1n1nPtEta); | |
6467 | fDiffFlowEventWeightsForCorrelationsEBE[1][pe][0]->SetBinContent(b,mp*dMult-mq); | |
6468 | } | |
6469 | else if(type == "RP") // to be improved (I do not this if) | |
6470 | { | |
6471 | // profile to get <<2'>> for RPs: | |
6472 | fDiffFlowCorrelationsPro[0][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta,mp*dMult-mq); | |
6473 | // histogram to store <2'> for RPs e-b-e (needed in some other methods): | |
6474 | fDiffFlowCorrelationsEBE[0][pe][0]->SetBinContent(b,two1n1nPtEta); | |
6475 | fDiffFlowEventWeightsForCorrelationsEBE[0][pe][0]->SetBinContent(b,mp*dMult-mq); | |
6476 | } | |
6477 | } // end of if(mp*dMult-mq) | |
6478 | ||
6479 | // 4'-particle correlation: | |
6480 | Double_t four1n1n1n1nPtEta = 0.; | |
6481 | if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6482 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression) | |
6483 | { | |
6484 | four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
6485 | - q2n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) | |
6486 | - 2.*q2n0kIm*dReQ1n*dImQ1n | |
6487 | - p1n0kRe*(dReQ1n*dReQ2n+dImQ1n*dImQ2n) | |
6488 | + p1n0kIm*(dImQ1n*dReQ2n-dReQ1n*dImQ2n) | |
6489 | - 2.*dMult*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
6490 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*mq | |
6491 | + 6.*(q1n0kRe*dReQ1n+q1n0kIm*dImQ1n) | |
6492 | + 1.*(q2n0kRe*dReQ2n+q2n0kIm*dImQ2n) | |
6493 | + 2.*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
6494 | + 2.*mq*dMult | |
6495 | - 6.*mq) | |
6496 | / ((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6497 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
6498 | ||
6499 | if(type == "POI") | |
6500 | { | |
6501 | // profile to get <<4'>> for POIs: | |
6502 | fDiffFlowCorrelationsPro[1][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta, | |
6503 | (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6504 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
6505 | // histogram to store <4'> for POIs e-b-e (needed in some other methods): | |
6506 | fDiffFlowCorrelationsEBE[1][pe][1]->SetBinContent(b,four1n1n1n1nPtEta); | |
6507 | fDiffFlowEventWeightsForCorrelationsEBE[1][pe][1]->SetBinContent(b,(mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6508 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
6509 | } | |
6510 | else if(type == "RP") | |
6511 | { | |
6512 | // profile to get <<4'>> for RPs: | |
6513 | fDiffFlowCorrelationsPro[0][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta, | |
6514 | (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6515 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
6516 | // histogram to store <4'> for RPs e-b-e (needed in some other methods): | |
6517 | fDiffFlowCorrelationsEBE[0][pe][1]->SetBinContent(b,four1n1n1n1nPtEta); | |
6518 | fDiffFlowEventWeightsForCorrelationsEBE[0][pe][1]->SetBinContent(b,(mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6519 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
6520 | } | |
6521 | } // end of if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6522 | // +mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
6523 | ||
6524 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6525 | ||
6526 | ||
6527 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelations(TString type, TString ptOrEta); | |
6528 | ||
6529 | ||
6530 | //================================================================================================================================ | |
6531 | ||
6532 | ||
6533 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfEventWeights(TString type, TString ptOrEta) | |
6534 | { | |
6535 | // Calculate sums of various event weights for reduced correlations. | |
6536 | // (These quantitites are needed in expressions for unbiased estimators relevant for the statistical errors.) | |
6537 | ||
6538 | Int_t typeFlag = -1; | |
6539 | Int_t ptEtaFlag = -1; | |
6540 | ||
6541 | if(type == "RP") | |
6542 | { | |
6543 | typeFlag = 0; | |
6544 | } else if(type == "POI") | |
6545 | { | |
6546 | typeFlag = 1; | |
6547 | } | |
6548 | ||
6549 | if(ptOrEta == "Pt") | |
6550 | { | |
6551 | ptEtaFlag = 0; | |
6552 | } else if(ptOrEta == "Eta") | |
6553 | { | |
6554 | ptEtaFlag = 1; | |
6555 | } | |
6556 | ||
6557 | // shortcuts: | |
6558 | Int_t t = typeFlag; | |
6559 | Int_t pe = ptEtaFlag; | |
6560 | ||
6561 | // binning: | |
6562 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
6563 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
6564 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
6565 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
6566 | ||
6567 | for(Int_t rpq=0;rpq<3;rpq++) | |
6568 | { | |
6569 | for(Int_t m=0;m<4;m++) | |
6570 | { | |
6571 | for(Int_t k=0;k<9;k++) | |
6572 | { | |
6573 | if(!fReRPQ1dEBE[rpq][pe][m][k]) | |
6574 | { | |
6575 | cout<<"WARNING: fReRPQ1dEBE[rpq][pe][m][k] is NULL in AFAWQC::CSAPOEWFDF() !!!!"<<endl; | |
6576 | cout<<"pe = "<<pe<<endl; | |
6577 | cout<<"rpq = "<<rpq<<endl; | |
6578 | cout<<"m = "<<m<<endl; | |
6579 | cout<<"k = "<<k<<endl; | |
6580 | exit(0); | |
6581 | } | |
6582 | } | |
6583 | } | |
6584 | } | |
6585 | ||
6586 | // multiplicities: | |
6587 | Double_t dMult = (*fSMpk)(0,0); // total event multiplicity | |
6588 | //Double_t mr = 0.; // number of RPs in particular pt or eta bin | |
6589 | Double_t mp = 0.; // number of POIs in particular pt or eta bin | |
6590 | Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin | |
6591 | ||
6592 | // event weights for reduced correlations: | |
6593 | Double_t dw2 = 0.; // event weight for <2'> | |
6594 | Double_t dw4 = 0.; // event weight for <4'> | |
6595 | //Double_t dw6 = 0.; // event weight for <6'> | |
6596 | //Double_t dw8 = 0.; // event weight for <8'> | |
6597 | ||
6598 | // looping over bins: | |
6599 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6600 | { | |
6601 | if(type == "RP") | |
6602 | { | |
6603 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b); | |
6604 | mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow | |
6605 | } else if(type == "POI") | |
6606 | { | |
6607 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b); | |
6608 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); | |
6609 | } | |
6610 | ||
6611 | // event weight for <2'>: | |
6612 | dw2 = mp*dMult-mq; | |
6613 | fDiffFlowSumOfEventWeights[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2); | |
6614 | fDiffFlowSumOfEventWeights[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw2,2.)); | |
6615 | ||
6616 | // event weight for <4'>: | |
6617 | dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6618 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
6619 | fDiffFlowSumOfEventWeights[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4); | |
6620 | fDiffFlowSumOfEventWeights[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw4,2.)); | |
6621 | ||
6622 | // event weight for <6'>: | |
6623 | //dw6 = ...; | |
6624 | //fDiffFlowSumOfEventWeights[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6); | |
6625 | //fDiffFlowSumOfEventWeights[t][pe][t][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw6,2.)); | |
6626 | ||
6627 | // event weight for <8'>: | |
6628 | //dw8 = ...; | |
6629 | //fDiffFlowSumOfEventWeights[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw8); | |
6630 | //fDiffFlowSumOfEventWeights[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw8,2.)); | |
6631 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6632 | ||
6633 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfEventWeights() | |
6634 | ||
6635 | ||
6636 | //================================================================================================================================ | |
6637 | ||
6638 | ||
6639 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfProductOfEventWeights(TString type, TString ptOrEta) | |
6640 | { | |
6641 | // Calculate sum of products of various event weights for both types of correlations (the ones for int. and diff. flow). | |
6642 | // (These quantitites are needed in expressions for unbiased estimators relevant for the statistical errors.) | |
6643 | // | |
6644 | // Important: To fill fDiffFlowSumOfProductOfEventWeights[][][][] use bellow table (i,j) with following constraints: | |
6645 | // 1.) i<j | |
6646 | // 2.) do not store terms which DO NOT include reduced correlations; | |
6647 | // Table: | |
6648 | // [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] x [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] | |
6649 | ||
6650 | Int_t typeFlag = -1; | |
6651 | Int_t ptEtaFlag = -1; | |
6652 | ||
6653 | if(type == "RP") | |
6654 | { | |
6655 | typeFlag = 0; | |
6656 | } else if(type == "POI") | |
6657 | { | |
6658 | typeFlag = 1; | |
6659 | } | |
6660 | ||
6661 | if(ptOrEta == "Pt") | |
6662 | { | |
6663 | ptEtaFlag = 0; | |
6664 | } else if(ptOrEta == "Eta") | |
6665 | { | |
6666 | ptEtaFlag = 1; | |
6667 | } | |
6668 | ||
6669 | // shortcuts: | |
6670 | Int_t t = typeFlag; | |
6671 | Int_t pe = ptEtaFlag; | |
6672 | ||
6673 | // binning: | |
6674 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
6675 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
6676 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
6677 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
6678 | ||
6679 | // protection: | |
6680 | for(Int_t rpq=0;rpq<3;rpq++) | |
6681 | { | |
6682 | for(Int_t m=0;m<4;m++) | |
6683 | { | |
6684 | for(Int_t k=0;k<9;k++) | |
6685 | { | |
6686 | if(!fReRPQ1dEBE[rpq][pe][m][k]) | |
6687 | { | |
6688 | cout<<"WARNING: fReRPQ1dEBE[rpq][pe][m][k] is NULL in AFAWQC::CSAPOEWFDF() !!!!"<<endl; | |
6689 | cout<<"pe = "<<pe<<endl; | |
6690 | cout<<"rpq = "<<rpq<<endl; | |
6691 | cout<<"m = "<<m<<endl; | |
6692 | cout<<"k = "<<k<<endl; | |
6693 | exit(0); | |
6694 | } | |
6695 | } | |
6696 | } | |
6697 | } | |
6698 | ||
6699 | // multiplicities: | |
6700 | Double_t dMult = (*fSMpk)(0,0); // total event multiplicity | |
6701 | //Double_t mr = 0.; // number of RPs in particular pt or eta bin | |
6702 | Double_t mp = 0.; // number of POIs in particular pt or eta bin | |
6703 | Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin | |
6704 | ||
6705 | // event weights for correlations: | |
6706 | Double_t dW2 = dMult*(dMult-1); // event weight for <2> | |
6707 | Double_t dW4 = dMult*(dMult-1)*(dMult-2)*(dMult-3); // event weight for <4> | |
6708 | Double_t dW6 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5); // event weight for <6> | |
6709 | Double_t dW8 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)*(dMult-6)*(dMult-7); // event weight for <8> | |
6710 | ||
6711 | // event weights for reduced correlations: | |
6712 | Double_t dw2 = 0.; // event weight for <2'> | |
6713 | Double_t dw4 = 0.; // event weight for <4'> | |
6714 | //Double_t dw6 = 0.; // event weight for <6'> | |
6715 | //Double_t dw8 = 0.; // event weight for <8'> | |
6716 | ||
6717 | // looping over bins: | |
6718 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6719 | { | |
6720 | if(type == "RP") | |
6721 | { | |
6722 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b); | |
6723 | mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow | |
6724 | } else if(type == "POI") | |
6725 | { | |
6726 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b); | |
6727 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); | |
6728 | } | |
6729 | ||
6730 | // event weight for <2'>: | |
6731 | dw2 = mp*dMult-mq; | |
6732 | fDiffFlowSumOfProductOfEventWeights[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw2); // storing product of even weights for <2> and <2'> | |
6733 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW4); // storing product of even weights for <4> and <2'> | |
6734 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW6); // storing product of even weights for <6> and <2'> | |
6735 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW8); // storing product of even weights for <8> and <2'> | |
6736 | ||
6737 | // event weight for <4'>: | |
6738 | dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6739 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
6740 | fDiffFlowSumOfProductOfEventWeights[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw4); // storing product of even weights for <2> and <4'> | |
6741 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw4); // storing product of even weights for <2'> and <4'> | |
6742 | fDiffFlowSumOfProductOfEventWeights[t][pe][2][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw4); // storing product of even weights for <4> and <4'> | |
6743 | fDiffFlowSumOfProductOfEventWeights[t][pe][3][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dW6); // storing product of even weights for <6> and <4'> | |
6744 | fDiffFlowSumOfProductOfEventWeights[t][pe][3][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dW8); // storing product of even weights for <8> and <4'> | |
6745 | ||
6746 | // event weight for <6'>: | |
6747 | //dw6 = ...; | |
6748 | //fDiffFlowSumOfProductOfEventWeights[t][pe][0][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw6); // storing product of even weights for <2> and <6'> | |
6749 | //fDiffFlowSumOfProductOfEventWeights[t][pe][1][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw6); // storing product of even weights for <2'> and <6'> | |
6750 | //fDiffFlowSumOfProductOfEventWeights[t][pe][2][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw6); // storing product of even weights for <4> and <6'> | |
6751 | //fDiffFlowSumOfProductOfEventWeights[t][pe][3][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dw6); // storing product of even weights for <4'> and <6'> | |
6752 | //fDiffFlowSumOfProductOfEventWeights[t][pe][4][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW6*dw6); // storing product of even weights for <6> and <6'> | |
6753 | //fDiffFlowSumOfProductOfEventWeights[t][pe][5][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dW8); // storing product of even weights for <6'> and <8> | |
6754 | //fDiffFlowSumOfProductOfEventWeights[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dw8); // storing product of even weights for <6'> and <8'> | |
6755 | ||
6756 | // event weight for <8'>: | |
6757 | //dw8 = ...; | |
6758 | //fDiffFlowSumOfProductOfEventWeights[t][pe][0][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw8); // storing product of even weights for <2> and <8'> | |
6759 | //fDiffFlowSumOfProductOfEventWeights[t][pe][1][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw8); // storing product of even weights for <2'> and <8'> | |
6760 | //fDiffFlowSumOfProductOfEventWeights[t][pe][2][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw8); // storing product of even weights for <4> and <8'> | |
6761 | //fDiffFlowSumOfProductOfEventWeights[t][pe][3][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dw8); // storing product of even weights for <4'> and <8'> | |
6762 | //fDiffFlowSumOfProductOfEventWeights[t][pe][4][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW6*dw8); // storing product of even weights for <6> and <8'> | |
6763 | //fDiffFlowSumOfProductOfEventWeights[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dw8); // storing product of even weights for <6'> and <8'> | |
6764 | //fDiffFlowSumOfProductOfEventWeights[t][pe][6][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW8*dw8); // storing product of even weights for <8> and <8'> | |
6765 | ||
6766 | // Table: | |
6767 | // [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] x [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] | |
6768 | ||
6769 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6770 | ||
6771 | ||
6772 | ||
6773 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfProductOfEventWeights(TString type, TString ptOrEta) | |
6774 | ||
6775 | ||
6776 | //================================================================================================================================ | |
6777 | ||
6778 | ||
6779 | void AliFlowAnalysisWithQCumulants::FinalizeReducedCorrelations(TString type, TString ptOrEta) | |
6780 | { | |
6781 | // Transfer profiles into histograms and calculate statistical errors correctly. | |
6782 | ||
6783 | Int_t typeFlag = -1; | |
6784 | Int_t ptEtaFlag = -1; | |
6785 | ||
6786 | if(type == "RP") | |
6787 | { | |
6788 | typeFlag = 0; | |
6789 | } else if(type == "POI") | |
6790 | { | |
6791 | typeFlag = 1; | |
6792 | } | |
6793 | ||
6794 | if(ptOrEta == "Pt") | |
6795 | { | |
6796 | ptEtaFlag = 0; | |
6797 | } else if(ptOrEta == "Eta") | |
6798 | { | |
6799 | ptEtaFlag = 1; | |
6800 | } | |
6801 | ||
6802 | // shortcuts: | |
6803 | Int_t t = typeFlag; | |
6804 | Int_t pe = ptEtaFlag; | |
6805 | ||
6806 | for(Int_t rci=0;rci<4;rci++) | |
6807 | { | |
6808 | if(!fDiffFlowCorrelationsPro[t][pe][rci]) | |
6809 | { | |
6810 | cout<<"WARNING: fDiffFlowCorrelationsPro[t][pe][rci] is NULL in AFAWQC::FRC() !!!!"<<endl; | |
6811 | cout<<"t = "<<t<<endl; | |
6812 | cout<<"pe = "<<pe<<endl; | |
6813 | cout<<"rci = "<<rci<<endl; | |
6814 | exit(0); | |
6815 | } | |
6816 | for(Int_t power=0;power<2;power++) | |
6817 | { | |
6818 | if(!fDiffFlowSumOfEventWeights[t][pe][power][rci]) | |
6819 | { | |
6820 | cout<<"WARNING: fDiffFlowSumOfEventWeights[t][pe][power][rci] is NULL in AFAWQC::FRC() !!!!"<<endl; | |
6821 | cout<<"t = "<<t<<endl; | |
6822 | cout<<"pe = "<<pe<<endl; | |
6823 | cout<<"power = "<<power<<endl; | |
6824 | cout<<"rci = "<<rci<<endl; | |
6825 | exit(0); | |
6826 | } | |
6827 | } // end of for(Int_t power=0;power<2;power++) | |
6828 | } // end of for(Int_t rci=0;rci<4;rci++) | |
6829 | ||
6830 | // common: | |
6831 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
6832 | ||
6833 | // transfer 1D profile into 1D histogram: | |
6834 | Double_t correlation = 0.; | |
6835 | Double_t spread = 0.; | |
6836 | Double_t sumOfWeights = 0.; // sum of weights for particular reduced correlations for particular pt or eta bin | |
6837 | Double_t sumOfSquaredWeights = 0.; // sum of squared weights for particular reduced correlations for particular pt or eta bin | |
6838 | Double_t error = 0.; // error = termA * spread * termB | |
6839 | // termA = (sqrt(sumOfSquaredWeights)/sumOfWeights) | |
6840 | // termB = 1/pow(1-termA^2,0.5) | |
6841 | Double_t termA = 0.; | |
6842 | Double_t termB = 0.; | |
6843 | for(Int_t rci=0;rci<4;rci++) // index of reduced correlation | |
6844 | { | |
6845 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) // number of pt or eta bins | |
6846 | { | |
6847 | correlation = fDiffFlowCorrelationsPro[t][pe][rci]->GetBinContent(b); | |
6848 | spread = fDiffFlowCorrelationsPro[t][pe][rci]->GetBinError(b); | |
6849 | sumOfWeights = fDiffFlowSumOfEventWeights[t][pe][0][rci]->GetBinContent(b); | |
6850 | sumOfSquaredWeights = fDiffFlowSumOfEventWeights[t][pe][1][rci]->GetBinContent(b); | |
6851 | if(sumOfWeights) termA = (pow(sumOfSquaredWeights,0.5)/sumOfWeights); | |
6852 | if(1.-pow(termA,2.)>0.) termB = 1./pow(1.-pow(termA,2.),0.5); | |
6853 | error = termA*spread*termB; // final error (unbiased estimator for standard deviation) | |
6854 | fDiffFlowCorrelationsHist[t][pe][rci]->SetBinContent(b,correlation); | |
6855 | fDiffFlowCorrelationsHist[t][pe][rci]->SetBinError(b,error); | |
6856 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6857 | } // end of for(Int_t rci=0;rci<4;rci++) | |
6858 | ||
6859 | } // end of void AliFlowAnalysisWithQCumulants::FinalizeReducedCorrelations(TString type, TString ptOrEta) | |
6860 | ||
6861 | ||
6862 | //================================================================================================================================ | |
6863 | ||
6864 | ||
6865 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowProductOfCorrelations(TString type, TString ptOrEta) | |
6866 | { | |
6867 | // store products: <2><2'>, <2><4'>, <2><6'>, <2><8'>, <2'><4>, | |
6868 | // <2'><4'>, <2'><6>, <2'><6'>, <2'><8>, <2'><8'>, | |
6869 | // <4><4'>, <4><6'>, <4><8'>, <4'><6>, <4'><6'>, | |
6870 | // <4'><8>, <4'><8'>, <6><6'>, <6><8'>, <6'><8>, | |
6871 | // <6'><8'>, <8><8'>. | |
6872 | ||
6873 | Int_t typeFlag = -1; | |
6874 | Int_t ptEtaFlag = -1; | |
6875 | ||
6876 | if(type == "RP") | |
6877 | { | |
6878 | typeFlag = 0; | |
6879 | } else if(type == "POI") | |
6880 | { | |
6881 | typeFlag = 1; | |
6882 | } | |
6883 | ||
6884 | if(ptOrEta == "Pt") | |
6885 | { | |
6886 | ptEtaFlag = 0; | |
6887 | } else if(ptOrEta == "Eta") | |
6888 | { | |
6889 | ptEtaFlag = 1; | |
6890 | } | |
6891 | ||
6892 | // shortcuts: | |
6893 | Int_t t = typeFlag; | |
6894 | Int_t pe = ptEtaFlag; | |
6895 | ||
6896 | // common: | |
6897 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
6898 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
6899 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
6900 | ||
6901 | // protections // to be improved (add protection for all pointers in this method) | |
6902 | if(!fIntFlowCorrelationsEBE) | |
6903 | { | |
6904 | cout<<"WARNING: fIntFlowCorrelationsEBE is NULL in AFAWQC::CDFPOC() !!!!"<<endl; | |
6905 | exit(0); | |
6906 | } | |
6907 | ||
6908 | /* | |
6909 | Double_t dMult = (*fSMpk)(0,0); // multiplicity (number of particles used to determine the reaction plane) | |
6910 | //Double_t mr = 0.; // number of RPs in particular pt or eta bin | |
6911 | Double_t mp = 0.; // number of POIs in particular pt or eta bin | |
6912 | Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin | |
6913 | */ | |
6914 | ||
6915 | // e-b-e correlations: | |
6916 | Double_t twoEBE = fIntFlowCorrelationsEBE->GetBinContent(1); // <2> | |
6917 | Double_t fourEBE = fIntFlowCorrelationsEBE->GetBinContent(2); // <4> | |
6918 | Double_t sixEBE = fIntFlowCorrelationsEBE->GetBinContent(3); // <6> | |
6919 | Double_t eightEBE = fIntFlowCorrelationsEBE->GetBinContent(4); // <8> | |
6920 | ||
6921 | // event weights for correlations: | |
6922 | Double_t dW2 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1); // event weight for <2> | |
6923 | Double_t dW4 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2); // event weight for <4> | |
6924 | Double_t dW6 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(3); // event weight for <6> | |
6925 | Double_t dW8 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(4); // event weight for <8> | |
6926 | ||
6927 | // e-b-e reduced correlations: | |
6928 | Double_t twoReducedEBE = 0.; // <2'> | |
6929 | Double_t fourReducedEBE = 0.; // <4'> | |
6930 | Double_t sixReducedEBE = 0.; // <6'> | |
6931 | Double_t eightReducedEBE = 0.; // <8'> | |
6932 | ||
6933 | // event weights for reduced correlations: | |
6934 | Double_t dw2 = 0.; // event weight for <2'> | |
6935 | Double_t dw4 = 0.; // event weight for <4'> | |
6936 | //Double_t dw6 = 0.; // event weight for <6'> | |
6937 | //Double_t dw8 = 0.; // event weight for <8'> | |
6938 | ||
6939 | // looping over bins: | |
6940 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6941 | { | |
6942 | // e-b-e reduced correlations: | |
6943 | twoReducedEBE = fDiffFlowCorrelationsEBE[t][pe][0]->GetBinContent(b); | |
6944 | fourReducedEBE = fDiffFlowCorrelationsEBE[t][pe][1]->GetBinContent(b); | |
6945 | sixReducedEBE = fDiffFlowCorrelationsEBE[t][pe][2]->GetBinContent(b); | |
6946 | eightReducedEBE = fDiffFlowCorrelationsEBE[t][pe][3]->GetBinContent(b); | |
6947 | ||
6948 | /* | |
6949 | // to be improved (I should not do this here again) | |
6950 | if(type == "RP") | |
6951 | { | |
6952 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b); | |
6953 | mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow | |
6954 | } else if(type == "POI") | |
6955 | { | |
6956 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b); | |
6957 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); | |
6958 | } | |
6959 | ||
6960 | // event weights for reduced correlations: | |
6961 | dw2 = mp*dMult-mq; // weight for <2'> | |
6962 | dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6963 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); // weight for <4'> | |
6964 | //dw6 = ... | |
6965 | //dw8 = ... | |
6966 | ||
6967 | */ | |
6968 | ||
6969 | dw2 = fDiffFlowEventWeightsForCorrelationsEBE[t][pe][0]->GetBinContent(b); | |
6970 | dw4 = fDiffFlowEventWeightsForCorrelationsEBE[t][pe][1]->GetBinContent(b); | |
6971 | ||
6972 | // storing all products: | |
6973 | fDiffFlowProductOfCorrelationsPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*twoReducedEBE,dW2*dw2); // storing <2><2'> | |
6974 | fDiffFlowProductOfCorrelationsPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*twoReducedEBE,dW4*dw2); // storing <4><2'> | |
6975 | fDiffFlowProductOfCorrelationsPro[t][pe][1][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*twoReducedEBE,dW6*dw2); // storing <6><2'> | |
6976 | fDiffFlowProductOfCorrelationsPro[t][pe][1][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*twoReducedEBE,dW8*dw2); // storing <8><2'> | |
6977 | ||
6978 | // event weight for <4'>: | |
6979 | fDiffFlowProductOfCorrelationsPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*fourReducedEBE,dW2*dw4); // storing <2><4'> | |
6980 | fDiffFlowProductOfCorrelationsPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*fourReducedEBE,dw2*dw4); // storing <2'><4'> | |
6981 | fDiffFlowProductOfCorrelationsPro[t][pe][2][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*fourReducedEBE,dW4*dw4); // storing <4><4'> | |
6982 | fDiffFlowProductOfCorrelationsPro[t][pe][3][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*fourReducedEBE,dW6*dw4); // storing <6><4'> | |
6983 | fDiffFlowProductOfCorrelationsPro[t][pe][3][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*fourReducedEBE,dW8*dw4); // storing <8><4'> | |
6984 | ||
6985 | // event weight for <6'>: | |
6986 | //dw6 = ...; | |
6987 | //fDiffFlowProductOfCorrelationsPro[t][pe][0][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*sixReducedEBE,dW2*dw6); // storing <2><6'> | |
6988 | //fDiffFlowProductOfCorrelationsPro[t][pe][1][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*sixReducedEBE,dw2*dw6); // storing <2'><6'> | |
6989 | //fDiffFlowProductOfCorrelationsPro[t][pe][2][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*sixReducedEBE,dW4*dw6); // storing <4><6'> | |
6990 | //fDiffFlowProductOfCorrelationsPro[t][pe][3][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourReducedEBE*sixReducedEBE,dw4*dw6); // storing <4'><6'> | |
6991 | //fDiffFlowProductOfCorrelationsPro[t][pe][4][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*sixReducedEBE,dW6*dw6); // storing <6><6'> | |
6992 | //fDiffFlowProductOfCorrelationsPro[t][pe][5][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightEBE,dw6*dW8); // storing <6'><8> | |
6993 | //fDiffFlowProductOfCorrelationsPro[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightReducedEBE,dw6*dw8); // storing <6'><8'> | |
6994 | ||
6995 | // event weight for <8'>: | |
6996 | //dw8 = ...; | |
6997 | //fDiffFlowProductOfCorrelationsPro[t][pe][0][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*eightReducedEBE,dW2*dw8); // storing <2><8'> | |
6998 | //fDiffFlowProductOfCorrelationsPro[t][pe][1][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*eightReducedEBE,dw2*dw8); // storing <2'><8'> | |
6999 | //fDiffFlowProductOfCorrelationsPro[t][pe][2][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*eightReducedEBE,dW4*dw8); // storing <4><8'> | |
7000 | //fDiffFlowProductOfCorrelationsPro[t][pe][3][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourReducedEBE*eightReducedEBE,dw4*dw8); // storing <4'><8'> | |
7001 | //fDiffFlowProductOfCorrelationsPro[t][pe][4][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*eightReducedEBE,dW6*dw8); // storing <6><8'> | |
7002 | //fDiffFlowProductOfCorrelationsPro[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightReducedEBE,dw6*dw8); // storing <6'><8'> | |
7003 | //fDiffFlowProductOfCorrelationsPro[t][pe][6][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*eightReducedEBE,dW8*dw8); // storing <8><8'> | |
7004 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++ | |
7005 | ||
7006 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowProductOfCorrelations(TString type, TString ptOrEta) | |
7007 | ||
7008 | ||
7009 | //================================================================================================================================ | |
7010 | ||
7011 | ||
7012 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCovariances(TString type, TString ptOrEta) // to be improved (reimplemented) | |
7013 | { | |
7014 | // a) Calculate unbiased estimators Cov(<2>,<2'>), Cov(<2>,<4'>), Cov(<4>,<2'>), Cov(<4>,<4'>) and Cov(<2'>,<4'>) | |
7015 | // for covariances V(<2>,<2'>), V(<2>,<4'>), V(<4>,<2'>), V(<4>,<4'>) and V(<2'>,<4'>). | |
7016 | // b) Store in histogram fDiffFlowCovariances[t][pe][index] for instance the following: | |
7017 | // | |
7018 | // Cov(<2>,<2'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] | |
7019 | // | |
7020 | // where N is the number of events, w_{<2>} is event weight for <2> and w_{<2'>} is event weight for <2'>. | |
7021 | // c) Binning of fDiffFlowCovariances[t][pe][index] is organized as follows: | |
7022 | // | |
7023 | // 1st bin: Cov(<2>,<2'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] | |
7024 | // 2nd bin: Cov(<2>,<4'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] | |
7025 | // 3rd bin: Cov(<4>,<2'>) * (sum_{i=1}^{N} w_{<4>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] | |
7026 | // 4th bin: Cov(<4>,<4'>) * (sum_{i=1}^{N} w_{<4>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] | |
7027 | // 5th bin: Cov(<2'>,<4'>) * (sum_{i=1}^{N} w_{<2'>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<2'>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] | |
7028 | // ... | |
7029 | ||
7030 | Int_t typeFlag = -1; | |
7031 | Int_t ptEtaFlag = -1; | |
7032 | ||
7033 | if(type == "RP") | |
7034 | { | |
7035 | typeFlag = 0; | |
7036 | } else if(type == "POI") | |
7037 | { | |
7038 | typeFlag = 1; | |
7039 | } | |
7040 | ||
7041 | if(ptOrEta == "Pt") | |
7042 | { | |
7043 | ptEtaFlag = 0; | |
7044 | } else if(ptOrEta == "Eta") | |
7045 | { | |
7046 | ptEtaFlag = 1; | |
7047 | } | |
7048 | ||
7049 | // shortcuts: | |
7050 | Int_t t = typeFlag; | |
7051 | Int_t pe = ptEtaFlag; | |
7052 | ||
7053 | // common: | |
7054 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
7055 | //Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
7056 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
7057 | //Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
7058 | ||
7059 | // average correlations: | |
7060 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> | |
7061 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> | |
7062 | //Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> | |
7063 | //Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> | |
7064 | ||
7065 | // sum of weights for correlation: | |
7066 | Double_t sumOfWeightsForTwo = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // sum_{i=1}^{N} w_{<2>} | |
7067 | Double_t sumOfWeightsForFour = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // sum_{i=1}^{N} w_{<4>} | |
7068 | //Double_t sumOfWeightsForSix = fIntFlowSumOfEventWeights[0]->GetBinContent(3); // sum_{i=1}^{N} w_{<6>} | |
7069 | //Double_t sumOfWeightsForEight = fIntFlowSumOfEventWeights[0]->GetBinContent(4); // sum_{i=1}^{N} w_{<8>} | |
7070 | ||
7071 | // average reduced correlations: | |
7072 | Double_t twoReduced = 0.; // <<2'>> | |
7073 | Double_t fourReduced = 0.; // <<4'>> | |
7074 | //Double_t sixReduced = 0.; // <<6'>> | |
7075 | //Double_t eightReduced = 0.; // <<8'>> | |
7076 | ||
7077 | // sum of weights for reduced correlation: | |
7078 | Double_t sumOfWeightsForTwoReduced = 0.; // sum_{i=1}^{N} w_{<2'>} | |
7079 | Double_t sumOfWeightsForFourReduced = 0.; // sum_{i=1}^{N} w_{<4'>} | |
7080 | //Double_t sumOfWeightsForSixReduced = 0.; // sum_{i=1}^{N} w_{<6'>} | |
7081 | //Double_t sumOfWeightsForEightReduced = 0.; // sum_{i=1}^{N} w_{<8'>} | |
7082 | ||
7083 | // product of weights for reduced correlation: | |
7084 | Double_t productOfWeightsForTwoTwoReduced = 0.; // sum_{i=1}^{N} w_{<2>}w_{<2'>} | |
7085 | Double_t productOfWeightsForTwoFourReduced = 0.; // sum_{i=1}^{N} w_{<2>}w_{<4'>} | |
7086 | Double_t productOfWeightsForFourTwoReduced = 0.; // sum_{i=1}^{N} w_{<4>}w_{<2'>} | |
7087 | Double_t productOfWeightsForFourFourReduced = 0.; // sum_{i=1}^{N} w_{<4>}w_{<4'>} | |
7088 | Double_t productOfWeightsForTwoReducedFourReduced = 0.; // sum_{i=1}^{N} w_{<2'>}w_{<4'>} | |
7089 | // ... | |
7090 | ||
7091 | // products for differential flow: | |
7092 | Double_t twoTwoReduced = 0; // <<2><2'>> | |
7093 | Double_t twoFourReduced = 0; // <<2><4'>> | |
7094 | Double_t fourTwoReduced = 0; // <<4><2'>> | |
7095 | Double_t fourFourReduced = 0; // <<4><4'>> | |
7096 | Double_t twoReducedFourReduced = 0; // <<2'><4'>> | |
7097 | ||
7098 | // denominators in the expressions for the unbiased estimators for covariances: | |
7099 | // denominator = 1 - term1/(term2*term3) | |
7100 | // prefactor = term1/(term2*term3) | |
7101 | Double_t denominator = 0.; | |
7102 | Double_t prefactor = 0.; | |
7103 | Double_t term1 = 0.; | |
7104 | Double_t term2 = 0.; | |
7105 | Double_t term3 = 0.; | |
7106 | ||
7107 | // unbiased estimators for covariances for differential flow: | |
7108 | Double_t covTwoTwoReduced = 0.; // Cov(<2>,<2'>) | |
7109 | Double_t wCovTwoTwoReduced = 0.; // Cov(<2>,<2'>) * prefactor(w_{<2>},w_{<2'>}) | |
7110 | Double_t covTwoFourReduced = 0.; // Cov(<2>,<4'>) | |
7111 | Double_t wCovTwoFourReduced = 0.; // Cov(<2>,<4'>) * prefactor(w_{<2>},w_{<4'>}) | |
7112 | Double_t covFourTwoReduced = 0.; // Cov(<4>,<2'>) | |
7113 | Double_t wCovFourTwoReduced = 0.; // Cov(<4>,<2'>) * prefactor(w_{<4>},w_{<2'>}) | |
7114 | Double_t covFourFourReduced = 0.; // Cov(<4>,<4'>) | |
7115 | Double_t wCovFourFourReduced = 0.; // Cov(<4>,<4'>) * prefactor(w_{<4>},w_{<4'>}) | |
7116 | Double_t covTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) | |
7117 | Double_t wCovTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) * prefactor(w_{<2'>},w_{<4'>}) | |
7118 | ||
7119 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7120 | { | |
7121 | // average reduced corelations: | |
7122 | twoReduced = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); | |
7123 | fourReduced = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); | |
7124 | // average products: | |
7125 | twoTwoReduced = fDiffFlowProductOfCorrelationsPro[t][pe][0][1]->GetBinContent(b); | |
7126 | twoFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][0][3]->GetBinContent(b); | |
7127 | fourTwoReduced = fDiffFlowProductOfCorrelationsPro[t][pe][1][2]->GetBinContent(b); | |
7128 | fourFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][2][3]->GetBinContent(b); | |
7129 | twoReducedFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][1][3]->GetBinContent(b); | |
7130 | // sum of weights for reduced correlations: | |
7131 | sumOfWeightsForTwoReduced = fDiffFlowSumOfEventWeights[t][pe][0][0]->GetBinContent(b); | |
7132 | sumOfWeightsForFourReduced = fDiffFlowSumOfEventWeights[t][pe][0][1]->GetBinContent(b); | |
7133 | // products of weights for correlations: | |
7134 | productOfWeightsForTwoTwoReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][0][1]->GetBinContent(b); | |
7135 | productOfWeightsForTwoFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][0][3]->GetBinContent(b); | |
7136 | productOfWeightsForFourTwoReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][1][2]->GetBinContent(b); | |
7137 | productOfWeightsForFourFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][2][3]->GetBinContent(b); | |
7138 | productOfWeightsForTwoReducedFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][1][3]->GetBinContent(b); | |
7139 | // denominator for the unbiased estimator for covariances: 1 - term1/(term2*term3) | |
7140 | // prefactor (multiplies Cov's) = term1/(term2*term3) | |
7141 | // <2>,<2'>: | |
7142 | term1 = productOfWeightsForTwoTwoReduced; | |
7143 | term2 = sumOfWeightsForTwo; | |
7144 | term3 = sumOfWeightsForTwoReduced; | |
7145 | if(term2*term3>0.) | |
7146 | { | |
7147 | denominator = 1.-term1/(term2*term3); | |
7148 | prefactor = term1/(term2*term3); | |
0328db2d | 7149 | if(TMath::Abs(denominator)>1e-6) |
489d5531 | 7150 | { |
7151 | covTwoTwoReduced = (twoTwoReduced-two*twoReduced)/denominator; | |
7152 | wCovTwoTwoReduced = covTwoTwoReduced*prefactor; | |
7153 | fDiffFlowCovariances[t][pe][0]->SetBinContent(b,wCovTwoTwoReduced); | |
7154 | } | |
7155 | } | |
7156 | // <2>,<4'>: | |
7157 | term1 = productOfWeightsForTwoFourReduced; | |
7158 | term2 = sumOfWeightsForTwo; | |
7159 | term3 = sumOfWeightsForFourReduced; | |
7160 | if(term2*term3>0.) | |
7161 | { | |
7162 | denominator = 1.-term1/(term2*term3); | |
7163 | prefactor = term1/(term2*term3); | |
0328db2d | 7164 | if(TMath::Abs(denominator)>1e-6) |
489d5531 | 7165 | { |
7166 | covTwoFourReduced = (twoFourReduced-two*fourReduced)/denominator; | |
7167 | wCovTwoFourReduced = covTwoFourReduced*prefactor; | |
7168 | fDiffFlowCovariances[t][pe][1]->SetBinContent(b,wCovTwoFourReduced); | |
7169 | } | |
7170 | } | |
7171 | // <4>,<2'>: | |
7172 | term1 = productOfWeightsForFourTwoReduced; | |
7173 | term2 = sumOfWeightsForFour; | |
7174 | term3 = sumOfWeightsForTwoReduced; | |
7175 | if(term2*term3>0.) | |
7176 | { | |
7177 | denominator = 1.-term1/(term2*term3); | |
7178 | prefactor = term1/(term2*term3); | |
0328db2d | 7179 | if(TMath::Abs(denominator)>1e-6) |
489d5531 | 7180 | { |
7181 | covFourTwoReduced = (fourTwoReduced-four*twoReduced)/denominator; | |
7182 | wCovFourTwoReduced = covFourTwoReduced*prefactor; | |
7183 | fDiffFlowCovariances[t][pe][2]->SetBinContent(b,wCovFourTwoReduced); | |
7184 | } | |
7185 | } | |
7186 | // <4>,<4'>: | |
7187 | term1 = productOfWeightsForFourFourReduced; | |
7188 | term2 = sumOfWeightsForFour; | |
7189 | term3 = sumOfWeightsForFourReduced; | |
7190 | if(term2*term3>0.) | |
7191 | { | |
7192 | denominator = 1.-term1/(term2*term3); | |
7193 | prefactor = term1/(term2*term3); | |
0328db2d | 7194 | if(TMath::Abs(denominator)>1e-6) |
489d5531 | 7195 | { |
7196 | covFourFourReduced = (fourFourReduced-four*fourReduced)/denominator; | |
7197 | wCovFourFourReduced = covFourFourReduced*prefactor; | |
7198 | fDiffFlowCovariances[t][pe][3]->SetBinContent(b,wCovFourFourReduced); | |
7199 | } | |
7200 | } | |
7201 | // <2'>,<4'>: | |
7202 | term1 = productOfWeightsForTwoReducedFourReduced; | |
7203 | term2 = sumOfWeightsForTwoReduced; | |
7204 | term3 = sumOfWeightsForFourReduced; | |
7205 | if(term2*term3>0.) | |
7206 | { | |
7207 | denominator = 1.-term1/(term2*term3); | |
7208 | prefactor = term1/(term2*term3); | |
0328db2d | 7209 | if(TMath::Abs(denominator)>1e-6) |
489d5531 | 7210 | { |
7211 | covTwoReducedFourReduced = (twoReducedFourReduced-twoReduced*fourReduced)/denominator; | |
7212 | wCovTwoReducedFourReduced = covTwoReducedFourReduced*prefactor; | |
7213 | fDiffFlowCovariances[t][pe][4]->SetBinContent(b,wCovTwoReducedFourReduced); | |
7214 | } | |
7215 | } | |
7216 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7217 | ||
7218 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCovariances(TString type, TString ptOrEta) | |
7219 | ||
7220 | ||
7221 | //================================================================================================================================ | |
7222 | ||
7223 | ||
7224 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, TString ptOrEta) | |
7225 | { | |
7226 | // calculate differential flow from differential cumulants and previously obtained integrated flow: (to be improved: description) | |
7227 | ||
7228 | Int_t typeFlag = -1; | |
7229 | Int_t ptEtaFlag = -1; | |
7230 | ||
7231 | if(type == "RP") | |
7232 | { | |
7233 | typeFlag = 0; | |
7234 | } else if(type == "POI") | |
7235 | { | |
7236 | typeFlag = 1; | |
7237 | } | |
7238 | ||
7239 | if(ptOrEta == "Pt") | |
7240 | { | |
7241 | ptEtaFlag = 0; | |
7242 | } else if(ptOrEta == "Eta") | |
7243 | { | |
7244 | ptEtaFlag = 1; | |
7245 | } | |
7246 | ||
7247 | // shortcuts: | |
7248 | Int_t t = typeFlag; | |
7249 | Int_t pe = ptEtaFlag; | |
7250 | ||
7251 | // common: | |
7252 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
7253 | ||
7254 | // correlations: | |
7255 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> | |
7256 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> | |
7257 | ||
7258 | // statistical errors of correlations: | |
7259 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); | |
7260 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); | |
7261 | ||
7262 | // reduced correlations: | |
7263 | Double_t twoReduced = 0.; // <<2'>> | |
7264 | Double_t fourReduced = 0.; // <<4'>> | |
7265 | ||
7266 | // statistical errors of reduced correlations: | |
7267 | Double_t twoReducedError = 0.; | |
7268 | Double_t fourReducedError = 0.; | |
7269 | ||
7270 | // covariances: | |
7271 | Double_t wCovTwoFour = fIntFlowCovariances->GetBinContent(1);// // Cov(<2>,<4>) * prefactor(<2>,<4>) | |
7272 | Double_t wCovTwoTwoReduced = 0.; // Cov(<2>,<2'>) * prefactor(<2>,<2'>) | |
7273 | Double_t wCovTwoFourReduced = 0.; // Cov(<2>,<4'>) * prefactor(<2>,<4'>) | |
7274 | Double_t wCovFourTwoReduced = 0.; // Cov(<4>,<2'>) * prefactor(<4>,<2'>) | |
7275 | Double_t wCovFourFourReduced = 0.; // Cov(<4>,<4'>) * prefactor(<4>,<4'>) | |
7276 | Double_t wCovTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) * prefactor(<2'>,<4'>) | |
7277 | ||
7278 | // differential flow: | |
7279 | Double_t v2Prime = 0.; // v'{2} | |
7280 | Double_t v4Prime = 0.; // v'{4} | |
7281 | ||
7282 | // statistical error of differential flow: | |
7283 | Double_t v2PrimeError = 0.; | |
7284 | Double_t v4PrimeError = 0.; | |
7285 | ||
7286 | // squared statistical error of differential flow: | |
7287 | Double_t v2PrimeErrorSquared = 0.; | |
7288 | Double_t v4PrimeErrorSquared = 0.; | |
7289 | ||
7290 | // loop over pt or eta bins: | |
7291 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7292 | { | |
7293 | // reduced correlations and statistical errors: | |
7294 | twoReduced = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); | |
7295 | twoReducedError = fDiffFlowCorrelationsHist[t][pe][0]->GetBinError(b); | |
7296 | fourReduced = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); | |
7297 | fourReducedError = fDiffFlowCorrelationsHist[t][pe][1]->GetBinError(b); | |
7298 | // covariances: | |
7299 | wCovTwoTwoReduced = fDiffFlowCovariances[t][pe][0]->GetBinContent(b); | |
7300 | wCovTwoFourReduced = fDiffFlowCovariances[t][pe][1]->GetBinContent(b); | |
7301 | wCovFourTwoReduced = fDiffFlowCovariances[t][pe][2]->GetBinContent(b); | |
7302 | wCovFourFourReduced = fDiffFlowCovariances[t][pe][3]->GetBinContent(b); | |
7303 | wCovTwoReducedFourReduced = fDiffFlowCovariances[t][pe][4]->GetBinContent(b); | |
7304 | // differential flow: | |
7305 | // v'{2}: | |
7306 | if(two>0.) | |
7307 | { | |
7308 | v2Prime = twoReduced/pow(two,0.5); | |
7309 | v2PrimeErrorSquared = (1./4.)*pow(two,-3.)* | |
7310 | (pow(twoReduced,2.)*pow(twoError,2.) | |
7311 | + 4.*pow(two,2.)*pow(twoReducedError,2.) | |
7312 | - 4.*two*twoReduced*wCovTwoTwoReduced); | |
7313 | ||
7314 | ||
7315 | if(v2PrimeErrorSquared>0.) v2PrimeError = pow(v2PrimeErrorSquared,0.5); | |
7316 | fDiffFlow[t][pe][0]->SetBinContent(b,v2Prime); | |
60694576 | 7317 | if(TMath::Abs(v2Prime)>1.e-44)fDiffFlow[t][pe][0]->SetBinError(b,v2PrimeError); |
489d5531 | 7318 | } |
7319 | // differential flow: | |
7320 | // v'{4} | |
7321 | if(2.*pow(two,2.)-four > 0.) | |
7322 | { | |
7323 | v4Prime = (2.*two*twoReduced-fourReduced)/pow(2.*pow(two,2.)-four,3./4.); | |
7324 | v4PrimeErrorSquared = pow(2.*pow(two,2.)-four,-7./2.)* | |
7325 | (pow(2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced,2.)*pow(twoError,2.) | |
7326 | + (9./16.)*pow(2.*two*twoReduced-fourReduced,2.)*pow(fourError,2.) | |
7327 | + 4.*pow(two,2.)*pow(2.*pow(two,2.)-four,2.)*pow(twoReducedError,2.) | |
7328 | + pow(2.*pow(two,2.)-four,2.)*pow(fourReducedError,2.) | |
7329 | - (3./2.)*(2.*two*twoReduced-fourReduced) | |
7330 | * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoFour | |
7331 | - 4.*two*(2.*pow(two,2.)-four) | |
7332 | * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoTwoReduced | |
7333 | + 2.*(2.*pow(two,2.)-four) | |
7334 | * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoFourReduced | |
7335 | + 3.*two*(2.*pow(two,2.)-four)*(2.*two*twoReduced-fourReduced)*wCovFourTwoReduced | |
7336 | - (3./2.)*(2.*pow(two,2.)-four)*(2.*two*twoReduced-fourReduced)*wCovFourFourReduced | |
7337 | - 4.*two*pow(2.*pow(two,2.)-four,2.)*wCovTwoReducedFourReduced); | |
7338 | if(v4PrimeErrorSquared>0.) v4PrimeError = pow(v4PrimeErrorSquared,0.5); | |
7339 | fDiffFlow[t][pe][1]->SetBinContent(b,v4Prime); | |
60694576 | 7340 | if(TMath::Abs(v4Prime)>1.e-44)fDiffFlow[t][pe][1]->SetBinError(b,v4PrimeError); |
489d5531 | 7341 | } |
7342 | ||
7343 | } // end of for(Int_t b=1;b<=fnBinsPtEta[pe];b++) | |
7344 | ||
7345 | ||
7346 | ||
7347 | ||
7348 | /* | |
7349 | // 2D: | |
7350 | for(Int_t nua=0;nua<2;nua++) | |
7351 | { | |
7352 | for(Int_t p=1;p<=fnBinsPt;p++) | |
7353 | { | |
7354 | for(Int_t e=1;e<=fnBinsEta;e++) | |
7355 | { | |
7356 | // differential cumulants: | |
7357 | Double_t qc2Prime = fFinalCumulants2D[t][pW][eW][nua][0]->GetBinContent(fFinalCumulants2D[t][pW][eW][nua][0]->GetBin(p,e)); // QC{2'} | |
7358 | Double_t qc4Prime = fFinalCumulants2D[t][pW][eW][nua][1]->GetBinContent(fFinalCumulants2D[t][pW][eW][nua][1]->GetBin(p,e)); // QC{4'} | |
7359 | // differential flow: | |
7360 | Double_t v2Prime = 0.; | |
7361 | Double_t v4Prime = 0.; | |
7362 | if(v2) | |
7363 | { | |
7364 | v2Prime = qc2Prime/v2; | |
7365 | fFinalFlow2D[t][pW][eW][nua][0]->SetBinContent(fFinalFlow2D[t][pW][eW][nua][0]->GetBin(p,e),v2Prime); | |
7366 | } | |
7367 | if(v4) | |
7368 | { | |
7369 | v4Prime = -qc4Prime/pow(v4,3.); | |
7370 | fFinalFlow2D[t][pW][eW][nua][1]->SetBinContent(fFinalFlow2D[t][pW][eW][nua][1]->GetBin(p,e),v4Prime); | |
7371 | } | |
7372 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
7373 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
7374 | } // end of for(Int_t nua=0;nua<2;nua++) | |
7375 | */ | |
7376 | ||
7377 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, Bool_t useParticleWeights) | |
7378 | ||
489d5531 | 7379 | //================================================================================================================================ |
7380 | ||
489d5531 | 7381 | void AliFlowAnalysisWithQCumulants::StoreIntFlowFlags() |
7382 | { | |
7383 | // a) Store all flags for integrated flow in profile fIntFlowFlags. | |
7384 | ||
7385 | if(!fIntFlowFlags) | |
7386 | { | |
7387 | cout<<"WARNING: fIntFlowFlags is NULL in AFAWQC::SFFIF() !!!!"<<endl; | |
7388 | exit(0); | |
7389 | } | |
7390 | ||
7391 | // particle weights used or not: | |
7392 | fIntFlowFlags->Fill(0.5,(Int_t)fUsePhiWeights||fUsePtWeights||fUseEtaWeights); | |
7393 | // which event weights were used: | |
7394 | if(strcmp(fMultiplicityWeight->Data(),"combinations")) | |
7395 | { | |
7396 | fIntFlowFlags->Fill(1.5,0); // 0 = "combinations" (default) | |
7397 | } else if(strcmp(fMultiplicityWeight->Data(),"unit")) | |
7398 | { | |
7399 | fIntFlowFlags->Fill(1.5,1); // 1 = "unit" | |
7400 | } else if(strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
7401 | { | |
7402 | fIntFlowFlags->Fill(1.5,2); // 2 = "multiplicity" | |
7403 | } | |
7404 | // corrected for non-uniform acceptance or not: | |
7405 | fIntFlowFlags->Fill(2.5,(Int_t)fApplyCorrectionForNUA); | |
7406 | fIntFlowFlags->Fill(3.5,(Int_t)fPrintFinalResults[0]); | |
7407 | fIntFlowFlags->Fill(4.5,(Int_t)fPrintFinalResults[1]); | |
7408 | fIntFlowFlags->Fill(5.5,(Int_t)fPrintFinalResults[2]); | |
b3dacf6b | 7409 | fIntFlowFlags->Fill(6.5,(Int_t)fPrintFinalResults[3]); |
7410 | fIntFlowFlags->Fill(7.5,(Int_t)fApplyCorrectionForNUAVsM); | |
7411 | fIntFlowFlags->Fill(8.5,(Int_t)fPropagateErrorFromCorrelations); | |
7412 | fIntFlowFlags->Fill(9.5,(Int_t)fCalculateCumulantsVsM); | |
0dd3b008 | 7413 | fIntFlowFlags->Fill(10.5,(Int_t)fMinimumBiasReferenceFlow); |
2001bc3a | 7414 | |
489d5531 | 7415 | } // end of void AliFlowAnalysisWithQCumulants::StoreIntFlowFlags() |
7416 | ||
489d5531 | 7417 | //================================================================================================================================ |
7418 | ||
489d5531 | 7419 | void AliFlowAnalysisWithQCumulants::StoreDiffFlowFlags() |
7420 | { | |
7421 | // Store all flags for differential flow in the profile fDiffFlowFlags. | |
7422 | ||
7423 | if(!fDiffFlowFlags) | |
7424 | { | |
7425 | cout<<"WARNING: fDiffFlowFlags is NULL in AFAWQC::SFFDF() !!!!"<<endl; | |
7426 | exit(0); | |
7427 | } | |
7428 | ||
7429 | fDiffFlowFlags->Fill(0.5,fUsePhiWeights||fUsePtWeights||fUseEtaWeights); // particle weights used or not | |
7430 | //fDiffFlowFlags->Fill(1.5,""); // which event weight was used? // to be improved | |
7431 | fDiffFlowFlags->Fill(2.5,fApplyCorrectionForNUA); // corrected for non-uniform acceptance or not | |
7432 | fDiffFlowFlags->Fill(3.5,fCalculate2DFlow); // calculate also 2D differential flow in (pt,eta) or not | |
7433 | ||
7434 | } // end of void AliFlowAnalysisWithQCumulants::StoreDiffFlowFlags() | |
7435 | ||
7436 | ||
7437 | //================================================================================================================================ | |
7438 | ||
7439 | ||
7440 | void AliFlowAnalysisWithQCumulants::GetPointersForCommonHistograms() | |
7441 | { | |
7442 | // Access all pointers to common control and common result histograms and profiles. | |
7443 | ||
7444 | TString commonHistsName = "AliFlowCommonHistQC"; | |
7445 | commonHistsName += fAnalysisLabel->Data(); | |
7446 | AliFlowCommonHist *commonHist = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHistsName.Data())); | |
7447 | if(commonHist) this->SetCommonHists(commonHist); | |
7448 | TString commonHists2ndOrderName = "AliFlowCommonHist2ndOrderQC"; | |
7449 | commonHists2ndOrderName += fAnalysisLabel->Data(); | |
7450 | AliFlowCommonHist *commonHist2nd = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists2ndOrderName.Data())); | |
7451 | if(commonHist2nd) this->SetCommonHists2nd(commonHist2nd); | |
7452 | TString commonHists4thOrderName = "AliFlowCommonHist4thOrderQC"; | |
7453 | commonHists4thOrderName += fAnalysisLabel->Data(); | |
7454 | AliFlowCommonHist *commonHist4th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists4thOrderName.Data())); | |
7455 | if(commonHist4th) this->SetCommonHists4th(commonHist4th); | |
7456 | TString commonHists6thOrderName = "AliFlowCommonHist6thOrderQC"; | |
7457 | commonHists6thOrderName += fAnalysisLabel->Data(); | |
7458 | AliFlowCommonHist *commonHist6th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists6thOrderName.Data())); | |
7459 | if(commonHist6th) this->SetCommonHists6th(commonHist6th); | |
7460 | TString commonHists8thOrderName = "AliFlowCommonHist8thOrderQC"; | |
7461 | commonHists8thOrderName += fAnalysisLabel->Data(); | |
7462 | AliFlowCommonHist *commonHist8th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists8thOrderName.Data())); | |
7463 | if(commonHist8th) this->SetCommonHists8th(commonHist8th); | |
7464 | TString commonHistResults2ndOrderName = "AliFlowCommonHistResults2ndOrderQC"; | |
7465 | commonHistResults2ndOrderName += fAnalysisLabel->Data(); | |
ecac11c2 | 7466 | AliFlowCommonHistResults *commonHistRes2nd = dynamic_cast<AliFlowCommonHistResults*> (fHistList->FindObject(commonHistResults2ndOrderName.Data())); |
489d5531 | 7467 | if(commonHistRes2nd) this->SetCommonHistsResults2nd(commonHistRes2nd); |
7468 | TString commonHistResults4thOrderName = "AliFlowCommonHistResults4thOrderQC"; | |
7469 | commonHistResults4thOrderName += fAnalysisLabel->Data(); | |
7470 | AliFlowCommonHistResults *commonHistRes4th = dynamic_cast<AliFlowCommonHistResults*> | |
7471 | (fHistList->FindObject(commonHistResults4thOrderName.Data())); | |
7472 | if(commonHistRes4th) this->SetCommonHistsResults4th(commonHistRes4th); | |
7473 | TString commonHistResults6thOrderName = "AliFlowCommonHistResults6thOrderQC"; | |
7474 | commonHistResults6thOrderName += fAnalysisLabel->Data(); | |
7475 | AliFlowCommonHistResults *commonHistRes6th = dynamic_cast<AliFlowCommonHistResults*> | |
7476 | (fHistList->FindObject(commonHistResults6thOrderName.Data())); | |
7477 | if(commonHistRes6th) this->SetCommonHistsResults6th(commonHistRes6th); | |
7478 | TString commonHistResults8thOrderName = "AliFlowCommonHistResults8thOrderQC"; | |
7479 | commonHistResults8thOrderName += fAnalysisLabel->Data(); | |
7480 | AliFlowCommonHistResults *commonHistRes8th = dynamic_cast<AliFlowCommonHistResults*> | |
7481 | (fHistList->FindObject(commonHistResults8thOrderName.Data())); | |
7482 | if(commonHistRes8th) this->SetCommonHistsResults8th(commonHistRes8th); | |
7483 | ||
7484 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForCommonHistograms() | |
7485 | ||
7486 | ||
7487 | //================================================================================================================================ | |
7488 | ||
7489 | ||
7490 | void AliFlowAnalysisWithQCumulants::GetPointersForParticleWeightsHistograms() | |
7491 | { | |
7492 | // Get pointers for histograms with particle weights. | |
7493 | ||
7494 | TList *weightsList = dynamic_cast<TList*>(fHistList->FindObject("Weights")); | |
7495 | if(weightsList) this->SetWeightsList(weightsList); | |
7496 | TString fUseParticleWeightsName = "fUseParticleWeightsQC"; // to be improved (hirdwired label QC) | |
7497 | fUseParticleWeightsName += fAnalysisLabel->Data(); | |
7498 | TProfile *useParticleWeights = dynamic_cast<TProfile*>(weightsList->FindObject(fUseParticleWeightsName.Data())); | |
7499 | if(useParticleWeights) | |
7500 | { | |
7501 | this->SetUseParticleWeights(useParticleWeights); | |
7502 | fUsePhiWeights = (Int_t)fUseParticleWeights->GetBinContent(1); | |
7503 | fUsePtWeights = (Int_t)fUseParticleWeights->GetBinContent(2); | |
7504 | fUseEtaWeights = (Int_t)fUseParticleWeights->GetBinContent(3); | |
7505 | } | |
7506 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForParticleWeightsHistograms(); | |
7507 | ||
7508 | ||
7509 | //================================================================================================================================ | |
7510 | ||
7511 | ||
7512 | void AliFlowAnalysisWithQCumulants::GetPointersForIntFlowHistograms() | |
7513 | { | |
7514 | // Get pointers for histograms and profiles relevant for integrated flow: | |
7515 | // a) Get pointer to base list for integrated flow holding profile fIntFlowFlags and lists fIntFlowProfiles and fIntFlowResults. | |
7516 | // b) Get pointer to profile fIntFlowFlags holding all flags for integrated flow. | |
7517 | // c) Get pointer to list fIntFlowProfiles and pointers to all objects that she holds. | |
7518 | // d) Get pointer to list fIntFlowResults and pointers to all objects that she holds. | |
7519 | ||
7520 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data member?) | |
7521 | TString powerFlag[2] = {"linear","quadratic"}; // to be improved (should I promote this to data member?) | |
ff70ca91 | 7522 | TString correlationFlag[4] = {"<<2>>","<<4>>","<<6>>","<<8>>"}; // to be improved (should I promote this to data member?) |
489d5531 | 7523 | |
7524 | // a) Get pointer to base list for integrated flow holding profile fIntFlowFlags and lists fIntFlowProfiles and fIntFlowResults: | |
7525 | TList *intFlowList = NULL; | |
7526 | intFlowList = dynamic_cast<TList*>(fHistList->FindObject("Integrated Flow")); | |
7527 | if(!intFlowList) | |
7528 | { | |
7529 | cout<<"WARNING: intFlowList is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7530 | exit(0); | |
7531 | } | |
7532 | ||
7533 | // b) Get pointer to profile fIntFlowFlags holding all flags for integrated flow: | |
7534 | TString intFlowFlagsName = "fIntFlowFlags"; | |
7535 | intFlowFlagsName += fAnalysisLabel->Data(); | |
7536 | TProfile *intFlowFlags = dynamic_cast<TProfile*>(intFlowList->FindObject(intFlowFlagsName.Data())); | |
489d5531 | 7537 | if(intFlowFlags) |
7538 | { | |
7539 | this->SetIntFlowFlags(intFlowFlags); | |
b3dacf6b | 7540 | fApplyCorrectionForNUA = (Bool_t)intFlowFlags->GetBinContent(3); // to be improved (hardwired 3) |
7541 | fCalculateCumulantsVsM = (Bool_t)intFlowFlags->GetBinContent(10); // to be improved (hardwired 9) | |
489d5531 | 7542 | } else |
7543 | { | |
7544 | cout<<"WARNING: intFlowFlags is NULL in FAWQC::GPFIFH() !!!!"<<endl; | |
7545 | } | |
7546 | ||
7547 | // c) Get pointer to list fIntFlowProfiles and pointers to all objects that she holds: | |
7548 | TList *intFlowProfiles = NULL; | |
7549 | intFlowProfiles = dynamic_cast<TList*>(intFlowList->FindObject("Profiles")); | |
7550 | if(intFlowProfiles) | |
7551 | { | |
7552 | // average multiplicities: | |
7553 | TString avMultiplicityName = "fAvMultiplicity"; | |
7554 | avMultiplicityName += fAnalysisLabel->Data(); | |
7555 | TProfile *avMultiplicity = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(avMultiplicityName.Data())); | |
7556 | if(avMultiplicity) | |
7557 | { | |
7558 | this->SetAvMultiplicity(avMultiplicity); | |
7559 | } else | |
7560 | { | |
7561 | cout<<"WARNING: avMultiplicity is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7562 | } | |
7563 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with wrong errors!): | |
7564 | TString intFlowCorrelationsProName = "fIntFlowCorrelationsPro"; | |
7565 | intFlowCorrelationsProName += fAnalysisLabel->Data(); | |
7566 | TProfile *intFlowCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowCorrelationsProName.Data())); | |
7567 | if(intFlowCorrelationsPro) | |
7568 | { | |
7569 | this->SetIntFlowCorrelationsPro(intFlowCorrelationsPro); | |
7570 | } else | |
7571 | { | |
7572 | cout<<"WARNING: intFlowCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
ff70ca91 | 7573 | } |
7574 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> versus multiplicity for all events (error is wrong here): | |
b3dacf6b | 7575 | if(fCalculateCumulantsVsM) |
ff70ca91 | 7576 | { |
b3dacf6b | 7577 | TString intFlowCorrelationsVsMProName = "fIntFlowCorrelationsVsMPro"; |
7578 | intFlowCorrelationsVsMProName += fAnalysisLabel->Data(); | |
7579 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
ff70ca91 | 7580 | { |
b3dacf6b | 7581 | TProfile *intFlowCorrelationsVsMPro = dynamic_cast<TProfile*> |
7582 | (intFlowProfiles->FindObject(Form("%s, %s",intFlowCorrelationsVsMProName.Data(),correlationFlag[ci].Data()))); | |
7583 | if(intFlowCorrelationsVsMPro) | |
7584 | { | |
7585 | this->SetIntFlowCorrelationsVsMPro(intFlowCorrelationsVsMPro,ci); | |
7586 | } else | |
7587 | { | |
7588 | cout<<"WARNING: "<<Form("intFlowCorrelationsVsMPro[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7589 | } | |
7590 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
7591 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 7592 | // average all correlations for integrated flow (with wrong errors!): |
7593 | TString intFlowCorrelationsAllProName = "fIntFlowCorrelationsAllPro"; | |
7594 | intFlowCorrelationsAllProName += fAnalysisLabel->Data(); | |
7595 | TProfile *intFlowCorrelationsAllPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowCorrelationsAllProName.Data())); | |
7596 | if(intFlowCorrelationsAllPro) | |
7597 | { | |
7598 | this->SetIntFlowCorrelationsAllPro(intFlowCorrelationsAllPro); | |
7599 | } else | |
7600 | { | |
7601 | cout<<"WARNING: intFlowCorrelationsAllPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7602 | } | |
7603 | // average extra correlations for integrated flow (which appear only when particle weights are used): | |
7604 | // (to be improved: Weak point in implementation, I am assuming here that method GetPointersForParticleWeightsHistograms() was called) | |
7605 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
7606 | { | |
7607 | TString intFlowExtraCorrelationsProName = "fIntFlowExtraCorrelationsPro"; | |
7608 | intFlowExtraCorrelationsProName += fAnalysisLabel->Data(); | |
7609 | TProfile *intFlowExtraCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowExtraCorrelationsProName.Data())); | |
7610 | if(intFlowExtraCorrelationsPro) | |
7611 | { | |
7612 | this->SetIntFlowExtraCorrelationsPro(intFlowExtraCorrelationsPro); | |
7613 | } else | |
7614 | { | |
7615 | cout<<"WARNING: intFlowExtraCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7616 | } | |
7617 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
7618 | // average products of correlations <2>, <4>, <6> and <8>: | |
7619 | TString intFlowProductOfCorrelationsProName = "fIntFlowProductOfCorrelationsPro"; | |
7620 | intFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
7621 | TProfile *intFlowProductOfCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowProductOfCorrelationsProName.Data())); | |
7622 | if(intFlowProductOfCorrelationsPro) | |
7623 | { | |
7624 | this->SetIntFlowProductOfCorrelationsPro(intFlowProductOfCorrelationsPro); | |
7625 | } else | |
7626 | { | |
7627 | cout<<"WARNING: intFlowProductOfCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
ff70ca91 | 7628 | } |
7629 | // average product of correlations <2>, <4>, <6> and <8> versus multiplicity | |
7630 | // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>] | |
b3dacf6b | 7631 | if(fCalculateCumulantsVsM) |
7632 | { | |
7633 | TString intFlowProductOfCorrelationsVsMProName = "fIntFlowProductOfCorrelationsVsMPro"; | |
7634 | intFlowProductOfCorrelationsVsMProName += fAnalysisLabel->Data(); | |
7635 | TString productFlag[6] = {"<<2><4>>","<<2><6>>","<<2><8>>","<<4><6>>","<<4><8>>","<<6><8>>"}; | |
7636 | for(Int_t pi=0;pi<6;pi++) | |
7637 | { | |
7638 | TProfile *intFlowProductOfCorrelationsVsMPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(Form("%s, %s",intFlowProductOfCorrelationsVsMProName.Data(),productFlag[pi].Data()))); | |
7639 | if(intFlowProductOfCorrelationsVsMPro) | |
7640 | { | |
7641 | this->SetIntFlowProductOfCorrelationsVsMPro(intFlowProductOfCorrelationsVsMPro,pi); | |
7642 | } else | |
7643 | { | |
7644 | cout<<"WARNING: "<<Form("intFlowProductOfCorrelationsVsMPro[%d]",pi)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7645 | } | |
7646 | } // end of for(Int_t pi=0;pi<6;pi++) | |
7647 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 7648 | // average correction terms for non-uniform acceptance (with wrong errors!): |
7649 | for(Int_t sc=0;sc<2;sc++) | |
7650 | { | |
7651 | TString intFlowCorrectionTermsForNUAProName = "fIntFlowCorrectionTermsForNUAPro"; | |
7652 | intFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
7653 | TProfile *intFlowCorrectionTermsForNUAPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject((Form("%s: %s terms",intFlowCorrectionTermsForNUAProName.Data(),sinCosFlag[sc].Data())))); | |
7654 | if(intFlowCorrectionTermsForNUAPro) | |
7655 | { | |
7656 | this->SetIntFlowCorrectionTermsForNUAPro(intFlowCorrectionTermsForNUAPro,sc); | |
7657 | } else | |
7658 | { | |
7659 | cout<<"WARNING: intFlowCorrectionTermsForNUAPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7660 | cout<<"sc = "<<sc<<endl; | |
7661 | } | |
2001bc3a | 7662 | // versus multiplicity: |
b3dacf6b | 7663 | if(fCalculateCumulantsVsM) |
2001bc3a | 7664 | { |
b3dacf6b | 7665 | TString correctionTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4 |
7666 | TString intFlowCorrectionTermsForNUAVsMProName = "fIntFlowCorrectionTermsForNUAVsMPro"; | |
7667 | intFlowCorrectionTermsForNUAVsMProName += fAnalysisLabel->Data(); | |
7668 | for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) | |
2001bc3a | 7669 | { |
b3dacf6b | 7670 | TProfile *intFlowCorrectionTermsForNUAVsMPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(Form("%s: #LT#LT%s%s#GT#GT",intFlowCorrectionTermsForNUAVsMProName.Data(),sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()))); |
7671 | if(intFlowCorrectionTermsForNUAVsMPro) | |
7672 | { | |
7673 | this->SetIntFlowCorrectionTermsForNUAVsMPro(intFlowCorrectionTermsForNUAVsMPro,sc,ci); | |
7674 | } else | |
7675 | { | |
7676 | cout<<"WARNING: intFlowCorrectionTermsForNUAVsMPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7677 | cout<<"sc = "<<sc<<endl; | |
7678 | cout<<"ci = "<<ci<<endl; | |
7679 | } | |
7680 | } // end of for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) | |
7681 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 7682 | } // end of for(Int_t sc=0;sc<2;sc++) |
0328db2d | 7683 | // average products of correction terms for NUA: |
7684 | TString intFlowProductOfCorrectionTermsForNUAProName = "fIntFlowProductOfCorrectionTermsForNUAPro"; | |
7685 | intFlowProductOfCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
7686 | TProfile *intFlowProductOfCorrectionTermsForNUAPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowProductOfCorrectionTermsForNUAProName.Data())); | |
7687 | if(intFlowProductOfCorrectionTermsForNUAPro) | |
7688 | { | |
7689 | this->SetIntFlowProductOfCorrectionTermsForNUAPro(intFlowProductOfCorrectionTermsForNUAPro); | |
7690 | } else | |
7691 | { | |
7692 | cout<<"WARNING: intFlowProductOfCorrectionTermsForNUAPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7693 | } | |
489d5531 | 7694 | } else // to if(intFlowProfiles) |
7695 | { | |
7696 | cout<<"WARNING: intFlowProfiles is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7697 | } | |
7698 | ||
7699 | // d) Get pointer to list fIntFlowResults and pointers to all objects that she holds. | |
7700 | TList *intFlowResults = NULL; | |
7701 | intFlowResults = dynamic_cast<TList*>(intFlowList->FindObject("Results")); | |
7702 | if(intFlowResults) | |
7703 | { | |
7704 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with correct errors!): | |
7705 | TString intFlowCorrelationsHistName = "fIntFlowCorrelationsHist"; | |
7706 | intFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
7707 | TH1D *intFlowCorrelationsHist = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCorrelationsHistName.Data())); | |
7708 | if(intFlowCorrelationsHist) | |
7709 | { | |
7710 | this->SetIntFlowCorrelationsHist(intFlowCorrelationsHist); | |
7711 | } else | |
7712 | { | |
7713 | cout<<"WARNING: intFlowCorrelationsHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7714 | } | |
ff70ca91 | 7715 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with correct errors!) vs M: |
b3dacf6b | 7716 | if(fCalculateCumulantsVsM) |
ff70ca91 | 7717 | { |
b3dacf6b | 7718 | TString intFlowCorrelationsVsMHistName = "fIntFlowCorrelationsVsMHist"; |
7719 | intFlowCorrelationsVsMHistName += fAnalysisLabel->Data(); | |
7720 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
ff70ca91 | 7721 | { |
b3dacf6b | 7722 | TH1D *intFlowCorrelationsVsMHist = dynamic_cast<TH1D*> |
7723 | (intFlowResults->FindObject(Form("%s, %s",intFlowCorrelationsVsMHistName.Data(),correlationFlag[ci].Data()))); | |
7724 | if(intFlowCorrelationsVsMHist) | |
7725 | { | |
7726 | this->SetIntFlowCorrelationsVsMHist(intFlowCorrelationsVsMHist,ci); | |
7727 | } else | |
7728 | { | |
7729 | cout<<"WARNING: "<<Form("intFlowCorrelationsVsMHist[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7730 | } | |
7731 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
7732 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 7733 | // average all correlations for integrated flow (with correct errors!): |
7734 | TString intFlowCorrelationsAllHistName = "fIntFlowCorrelationsAllHist"; | |
7735 | intFlowCorrelationsAllHistName += fAnalysisLabel->Data(); | |
7736 | TH1D *intFlowCorrelationsAllHist = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCorrelationsAllHistName.Data())); | |
7737 | if(intFlowCorrelationsAllHist) | |
7738 | { | |
7739 | this->SetIntFlowCorrelationsAllHist(intFlowCorrelationsAllHist); | |
7740 | } else | |
7741 | { | |
7742 | cout<<"WARNING: intFlowCorrelationsAllHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7743 | } | |
7744 | // average correction terms for non-uniform acceptance (with correct errors!): | |
7745 | TString intFlowCorrectionTermsForNUAHistName = "fIntFlowCorrectionTermsForNUAHist"; | |
7746 | intFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
7747 | for(Int_t sc=0;sc<2;sc++) | |
7748 | { | |
7749 | TH1D *intFlowCorrectionTermsForNUAHist = dynamic_cast<TH1D*>(intFlowResults->FindObject((Form("%s: %s terms",intFlowCorrectionTermsForNUAHistName.Data(),sinCosFlag[sc].Data())))); | |
7750 | if(intFlowCorrectionTermsForNUAHist) | |
7751 | { | |
7752 | this->SetIntFlowCorrectionTermsForNUAHist(intFlowCorrectionTermsForNUAHist,sc); | |
7753 | } else | |
7754 | { | |
7755 | cout<<"WARNING: intFlowCorrectionTermsForNUAHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7756 | cout<<"sc = "<<sc<<endl; | |
7757 | } | |
7758 | } // end of for(Int_t sc=0;sc<2;sc++) | |
7759 | // covariances (multiplied with weight dependent prefactor): | |
7760 | TString intFlowCovariancesName = "fIntFlowCovariances"; | |
7761 | intFlowCovariancesName += fAnalysisLabel->Data(); | |
7762 | TH1D *intFlowCovariances = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCovariancesName.Data())); | |
7763 | if(intFlowCovariances) | |
7764 | { | |
7765 | this->SetIntFlowCovariances(intFlowCovariances); | |
7766 | } else | |
7767 | { | |
7768 | cout<<"WARNING: intFlowCovariances is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7769 | } | |
7770 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8>: | |
7771 | TString intFlowSumOfEventWeightsName = "fIntFlowSumOfEventWeights"; | |
7772 | intFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
7773 | for(Int_t power=0;power<2;power++) | |
7774 | { | |
7775 | TH1D *intFlowSumOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s: %s",intFlowSumOfEventWeightsName.Data(),powerFlag[power].Data()))); | |
7776 | if(intFlowSumOfEventWeights) | |
7777 | { | |
7778 | this->SetIntFlowSumOfEventWeights(intFlowSumOfEventWeights,power); | |
7779 | } else | |
7780 | { | |
7781 | cout<<"WARNING: intFlowSumOfEventWeights is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7782 | cout<<"power = "<<power<<endl; | |
7783 | } | |
7784 | } // end of for(Int_t power=0;power<2;power++) | |
7785 | // sum of products of event weights for correlations <2>, <4>, <6> and <8>: | |
7786 | TString intFlowSumOfProductOfEventWeightsName = "fIntFlowSumOfProductOfEventWeights"; | |
7787 | intFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
7788 | TH1D *intFlowSumOfProductOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowSumOfProductOfEventWeightsName.Data())); | |
7789 | if(intFlowSumOfProductOfEventWeights) | |
7790 | { | |
7791 | this->SetIntFlowSumOfProductOfEventWeights(intFlowSumOfProductOfEventWeights); | |
7792 | } else | |
7793 | { | |
7794 | cout<<"WARNING: intFlowSumOfProductOfEventWeights is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7795 | } | |
ff70ca91 | 7796 | // final result for covariances of correlations (multiplied with weight dependent prefactor) versus M |
7797 | // [0=Cov(2,4),1=Cov(2,6),2=Cov(2,8),3=Cov(4,6),4=Cov(4,8),5=Cov(6,8)]: | |
b3dacf6b | 7798 | if(fCalculateCumulantsVsM) |
ff70ca91 | 7799 | { |
b3dacf6b | 7800 | TString intFlowCovariancesVsMName = "fIntFlowCovariancesVsM"; |
7801 | intFlowCovariancesVsMName += fAnalysisLabel->Data(); | |
7802 | TString covarianceFlag[6] = {"Cov(<2>,<4>)","Cov(<2>,<6>)","Cov(<2>,<8>)","Cov(<4>,<6>)","Cov(<4>,<8>)","Cov(<6>,<8>)"}; | |
7803 | for(Int_t ci=0;ci<6;ci++) | |
7804 | { | |
7805 | TH1D *intFlowCovariancesVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowCovariancesVsMName.Data(),covarianceFlag[ci].Data()))); | |
7806 | if(intFlowCovariancesVsM) | |
ff70ca91 | 7807 | { |
b3dacf6b | 7808 | this->SetIntFlowCovariancesVsM(intFlowCovariancesVsM,ci); |
ff70ca91 | 7809 | } else |
7810 | { | |
b3dacf6b | 7811 | cout<<"WARNING: "<<Form("intFlowCovariancesVsM[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; |
ff70ca91 | 7812 | } |
b3dacf6b | 7813 | } // end of for(Int_t ci=0;ci<6;ci++) |
7814 | } // end of if(fCalculateCumulantsVsM) | |
7815 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8> versus multiplicity | |
7816 | // [0=sum{w_{<2>}},1=sum{w_{<4>}},2=sum{w_{<6>}},3=sum{w_{<8>}}][0=linear 1,1=quadratic]: | |
7817 | if(fCalculateCumulantsVsM) | |
7818 | { | |
7819 | TString intFlowSumOfEventWeightsVsMName = "fIntFlowSumOfEventWeightsVsM"; | |
7820 | intFlowSumOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
7821 | TString sumFlag[2][4] = {{"#sum_{i=1}^{N} w_{<2>}","#sum_{i=1}^{N} w_{<4>}","#sum_{i=1}^{N} w_{<6>}","#sum_{i=1}^{N} w_{<8>}"}, | |
7822 | {"#sum_{i=1}^{N} w_{<2>}^{2}","#sum_{i=1}^{N} w_{<4>}^{2}","#sum_{i=1}^{N} w_{<6>}^{2}","#sum_{i=1}^{N} w_{<8>}^{2}"}}; | |
7823 | for(Int_t si=0;si<4;si++) | |
7824 | { | |
7825 | for(Int_t power=0;power<2;power++) | |
7826 | { | |
7827 | TH1D *intFlowSumOfEventWeightsVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowSumOfEventWeightsVsMName.Data(),sumFlag[power][si].Data()))); | |
7828 | if(intFlowSumOfEventWeightsVsM) | |
7829 | { | |
7830 | this->SetIntFlowSumOfEventWeightsVsM(intFlowSumOfEventWeightsVsM,si,power); | |
7831 | } else | |
7832 | { | |
7833 | cout<<"WARNING: "<<Form("intFlowSumOfEventWeightsVsM[%d][%d]",si,power)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7834 | } | |
7835 | } // end of for(Int_t power=0;power<2;power++) | |
7836 | } // end of for(Int_t si=0;si<4;si++) | |
7837 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 7838 | // sum of products of event weights for correlations <2>, <4>, <6> and <8> vs M |
7839 | // [0=sum{w_{<2>}w_{<4>}},1=sum{w_{<2>}w_{<6>}},2=sum{w_{<2>}w_{<8>}}, | |
7840 | // 3=sum{w_{<4>}w_{<6>}},4=sum{w_{<4>}w_{<8>}},5=sum{w_{<6>}w_{<8>}}]: | |
b3dacf6b | 7841 | if(fCalculateCumulantsVsM) |
ff70ca91 | 7842 | { |
b3dacf6b | 7843 | TString intFlowSumOfProductOfEventWeightsVsMName = "fIntFlowSumOfProductOfEventWeightsVsM"; |
7844 | intFlowSumOfProductOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
7845 | TString sopowFlag[6] = {"#sum_{i=1}^{N} w_{<2>} w_{<4>}","#sum_{i=1}^{N} w_{<2>} w_{<6>}","#sum_{i=1}^{N} w_{<2>} w_{<8>}", | |
7846 | "#sum_{i=1}^{N} w_{<4>} w_{<6>}","#sum_{i=1}^{N} w_{<4>} w_{<8>}","#sum_{i=1}^{N} w_{<6>} w_{<8>}"}; | |
7847 | for(Int_t pi=0;pi<6;pi++) | |
ff70ca91 | 7848 | { |
b3dacf6b | 7849 | TH1D *intFlowSumOfProductOfEventWeightsVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowSumOfProductOfEventWeightsVsMName.Data(),sopowFlag[pi].Data()))); |
7850 | if(intFlowSumOfProductOfEventWeightsVsM) | |
7851 | { | |
7852 | this->SetIntFlowSumOfProductOfEventWeightsVsM(intFlowSumOfProductOfEventWeightsVsM,pi); | |
7853 | } else | |
7854 | { | |
7855 | cout<<"WARNING: "<<Form("intFlowSumOfProductOfEventWeightsVsM[%d]",pi)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7856 | } | |
7857 | } // end of for(Int_t pi=0;pi<6;pi++) | |
7858 | } // end of if(fCalculateCumulantsVsM) | |
0328db2d | 7859 | // covariances for NUA (multiplied with weight dependent prefactor): |
7860 | TString intFlowCovariancesNUAName = "fIntFlowCovariancesNUA"; | |
7861 | intFlowCovariancesNUAName += fAnalysisLabel->Data(); | |
7862 | TH1D *intFlowCovariancesNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCovariancesNUAName.Data())); | |
7863 | if(intFlowCovariancesNUA) | |
7864 | { | |
7865 | this->SetIntFlowCovariancesNUA(intFlowCovariancesNUA); | |
7866 | } else | |
7867 | { | |
7868 | cout<<"WARNING: intFlowCovariancesNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7869 | } | |
7870 | // sum of linear and quadratic event weights NUA terms: | |
7871 | TString intFlowSumOfEventWeightsNUAName = "fIntFlowSumOfEventWeightsNUA"; | |
7872 | intFlowSumOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
7873 | for(Int_t sc=0;sc<2;sc++) | |
7874 | { | |
7875 | for(Int_t power=0;power<2;power++) | |
7876 | { | |
7877 | TH1D *intFlowSumOfEventWeightsNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s: %s, %s",intFlowSumOfEventWeightsNUAName.Data(),powerFlag[power].Data(),sinCosFlag[sc].Data()))); | |
7878 | if(intFlowSumOfEventWeightsNUA) | |
7879 | { | |
7880 | this->SetIntFlowSumOfEventWeightsNUA(intFlowSumOfEventWeightsNUA,sc,power); | |
7881 | } else | |
7882 | { | |
7883 | cout<<"WARNING: intFlowSumOfEventWeightsNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7884 | cout<<"sc = "<<sc<<endl; | |
7885 | cout<<"power = "<<power<<endl; | |
7886 | } | |
7887 | } // end of for(Int_t power=0;power<2;power++) | |
7888 | } // end of for(Int_t sc=0;sc<2;sc++) | |
7889 | // sum of products of event weights for NUA terms: | |
7890 | TString intFlowSumOfProductOfEventWeightsNUAName = "fIntFlowSumOfProductOfEventWeightsNUA"; | |
7891 | intFlowSumOfProductOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
7892 | TH1D *intFlowSumOfProductOfEventWeightsNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowSumOfProductOfEventWeightsNUAName.Data())); | |
7893 | if(intFlowSumOfProductOfEventWeightsNUA) | |
7894 | { | |
7895 | this->SetIntFlowSumOfProductOfEventWeightsNUA(intFlowSumOfProductOfEventWeightsNUA); | |
7896 | } else | |
7897 | { | |
7898 | cout<<"WARNING: intFlowSumOfProductOfEventWeightsNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7899 | } | |
b3dacf6b | 7900 | // Final results for reference Q-cumulants: |
489d5531 | 7901 | TString intFlowQcumulantsName = "fIntFlowQcumulants"; |
7902 | intFlowQcumulantsName += fAnalysisLabel->Data(); | |
7903 | TH1D *intFlowQcumulants = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsName.Data())); | |
7904 | if(intFlowQcumulants) | |
7905 | { | |
7906 | this->SetIntFlowQcumulants(intFlowQcumulants); | |
7907 | } else | |
7908 | { | |
7909 | cout<<"WARNING: intFlowQcumulants is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7910 | } | |
b3dacf6b | 7911 | // Final results for reference Q-cumulants rebinned in M: |
7912 | if(fCalculateCumulantsVsM) | |
7913 | { | |
7914 | TString intFlowQcumulantsRebinnedInMName = "fIntFlowQcumulantsRebinnedInM"; | |
7915 | intFlowQcumulantsRebinnedInMName += fAnalysisLabel->Data(); | |
7916 | TH1D *intFlowQcumulantsRebinnedInM = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsRebinnedInMName.Data())); | |
7917 | if(intFlowQcumulantsRebinnedInM) | |
7918 | { | |
7919 | this->SetIntFlowQcumulantsRebinnedInM(intFlowQcumulantsRebinnedInM); | |
7920 | } else | |
7921 | { | |
7922 | cout<<"WARNING: intFlowQcumulantsRebinnedInM is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7923 | } | |
7924 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 7925 | // final results for integrated Q-cumulants versus multiplicity: |
ff70ca91 | 7926 | TString cumulantFlag[4] = {"QC{2}","QC{4}","QC{6}","QC{8}"}; |
b3dacf6b | 7927 | if(fCalculateCumulantsVsM) |
ff70ca91 | 7928 | { |
b3dacf6b | 7929 | TString intFlowQcumulantsVsMName = "fIntFlowQcumulantsVsM"; |
7930 | intFlowQcumulantsVsMName += fAnalysisLabel->Data(); | |
7931 | for(Int_t co=0;co<4;co++) // cumulant order | |
ff70ca91 | 7932 | { |
b3dacf6b | 7933 | TH1D *intFlowQcumulantsVsM = dynamic_cast<TH1D*> |
7934 | (intFlowResults->FindObject(Form("%s, %s",intFlowQcumulantsVsMName.Data(),cumulantFlag[co].Data()))); | |
7935 | if(intFlowQcumulantsVsM) | |
7936 | { | |
7937 | this->SetIntFlowQcumulantsVsM(intFlowQcumulantsVsM,co); | |
7938 | } else | |
7939 | { | |
7940 | cout<<"WARNING: "<<Form("intFlowQcumulantsVsM[%d]",co)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7941 | } | |
7942 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
7943 | } // end of if(fCalculateCumulantsVsM) | |
7944 | // Final reference flow estimates from Q-cumulants: | |
489d5531 | 7945 | TString intFlowName = "fIntFlow"; |
7946 | intFlowName += fAnalysisLabel->Data(); | |
7947 | TH1D *intFlow = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowName.Data())); | |
7948 | if(intFlow) | |
7949 | { | |
7950 | this->SetIntFlow(intFlow); | |
7951 | } else | |
7952 | { | |
7953 | cout<<"WARNING: intFlow is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
ff70ca91 | 7954 | } |
b3dacf6b | 7955 | // Final reference flow estimates from Q-cumulants vs M rebinned in M: |
7956 | if(fCalculateCumulantsVsM) | |
ff70ca91 | 7957 | { |
b3dacf6b | 7958 | TString intFlowRebinnedInMName = "fIntFlowRebinnedInM"; |
7959 | intFlowRebinnedInMName += fAnalysisLabel->Data(); | |
7960 | TH1D *intFlowRebinnedInM = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowRebinnedInMName.Data())); | |
7961 | if(intFlowRebinnedInM) | |
ff70ca91 | 7962 | { |
b3dacf6b | 7963 | this->SetIntFlowRebinnedInM(intFlowRebinnedInM); |
7964 | } else | |
ff70ca91 | 7965 | { |
b3dacf6b | 7966 | cout<<"WARNING: intFlowRebinnedInM is NULL in AFAWQC::GPFIFH() !!!!"<<endl; |
7967 | } | |
7968 | } // end of if(fCalculateCumulantsVsM) | |
7969 | // integrated flow from Q-cumulants versus multiplicity: | |
7970 | if(fCalculateCumulantsVsM) | |
7971 | { | |
7972 | TString intFlowVsMName = "fIntFlowVsM"; | |
7973 | intFlowVsMName += fAnalysisLabel->Data(); | |
7974 | TString flowFlag[4] = {"v_{2}{2,QC}","v_{2}{4,QC}","v_{2}{6,QC}","v_{2}{8,QC}"}; // to be improved (harwired harmonic) | |
7975 | for(Int_t co=0;co<4;co++) // cumulant order | |
7976 | { | |
7977 | TH1D *intFlowVsM = dynamic_cast<TH1D*> | |
7978 | (intFlowResults->FindObject(Form("%s, %s",intFlowVsMName.Data(),flowFlag[co].Data()))); | |
7979 | if(intFlowVsM) | |
7980 | { | |
7981 | this->SetIntFlowVsM(intFlowVsM,co); | |
7982 | } else | |
7983 | { | |
7984 | cout<<"WARNING: "<<Form("intFlowVsM[%d]",co)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7985 | } | |
7986 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
7987 | } // end of if(fCalculateCumulantsVsM) | |
2001bc3a | 7988 | // quantifying detector effects effects to correlations: |
7989 | TString intFlowDetectorBiasName = "fIntFlowDetectorBias"; | |
7990 | intFlowDetectorBiasName += fAnalysisLabel->Data(); | |
7991 | TH1D *intFlowDetectorBias = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowDetectorBiasName.Data())); | |
7992 | if(intFlowDetectorBias) | |
7993 | { | |
7994 | this->SetIntFlowDetectorBias(intFlowDetectorBias); | |
7995 | } else | |
7996 | { | |
7997 | cout<<"WARNING: intFlowDetectorBias is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
7998 | } | |
7999 | // quantifying detector effects effects to correlations vs multiplicity: | |
b3dacf6b | 8000 | if(fApplyCorrectionForNUAVsM && fCalculateCumulantsVsM) |
2001bc3a | 8001 | { |
3c5d5752 | 8002 | TString intFlowDetectorBiasVsMName = "fIntFlowDetectorBiasVsM"; |
8003 | intFlowDetectorBiasVsMName += fAnalysisLabel->Data(); | |
8004 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2001bc3a | 8005 | { |
3c5d5752 | 8006 | TH1D *intFlowDetectorBiasVsM = dynamic_cast<TH1D*> |
8007 | (intFlowResults->FindObject(Form("%s for %s",intFlowDetectorBiasVsMName.Data(),cumulantFlag[ci].Data()))); | |
8008 | if(intFlowDetectorBiasVsM) | |
8009 | { | |
8010 | this->SetIntFlowDetectorBiasVsM(intFlowDetectorBiasVsM,ci); | |
8011 | } else | |
8012 | { | |
8013 | cout<<"WARNING: "<<Form("intFlowDetectorBiasVsM[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8014 | } | |
8015 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
8016 | } // end of if(ApplyCorrectionForNUAVsM) | |
489d5531 | 8017 | } else // to if(intFlowResults) |
8018 | { | |
8019 | cout<<"WARNING: intFlowResults is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8020 | } | |
ff70ca91 | 8021 | |
489d5531 | 8022 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForIntFlowHistograms() |
8023 | ||
489d5531 | 8024 | //================================================================================================================================ |
8025 | ||
489d5531 | 8026 | void AliFlowAnalysisWithQCumulants::GetPointersForDiffFlowHistograms() |
8027 | { | |
8028 | // Get pointer to all objects relevant for differential flow. | |
8029 | // a) Define flags locally (to be improved: should I promote flags to data members?); | |
8030 | // b) Get pointer to base list for differential flow fDiffFlowList and nested lists fDiffFlowListProfiles and fDiffFlowListResults; | |
8031 | // c) Get pointer to profile fDiffFlowFlags holding all flags for differential flow; | |
8032 | // d) Get pointers to all nested lists in fDiffFlowListProfiles and to profiles which they hold; | |
8033 | // e) Get pointers to all nested lists in fDiffFlowListResults and to histograms which they hold. | |
8034 | ||
8035 | // a) Define flags locally (to be improved: should I promote flags to data members?): | |
8036 | TString typeFlag[2] = {"RP","POI"}; | |
8037 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
8038 | TString powerFlag[2] = {"linear","quadratic"}; | |
8039 | TString sinCosFlag[2] = {"sin","cos"}; | |
8040 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
8041 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
8042 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
8043 | TString mixedCorrelationIndex[8] = {"<2>","<2'>","<4>","<4'>","<6>","<6'>","<8>","<8'>"}; | |
8044 | TString covarianceName[5] = {"Cov(<2>,<2'>)","Cov(<2>,<4'>)","Cov(<4>,<2'>)","Cov(<4>,<4'>)","Cov(<2'>,<4'>)"}; | |
8045 | ||
8046 | // b) Get pointer to base list for differential flow fDiffFlowList and nested lists fDiffFlowListProfiles and fDiffFlowListResults: | |
8047 | TList *diffFlowList = NULL; | |
8048 | diffFlowList = dynamic_cast<TList*>(fHistList->FindObject("Differential Flow")); | |
8049 | if(!diffFlowList) | |
8050 | { | |
8051 | cout<<"WARNING: diffFlowList is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8052 | exit(0); | |
8053 | } | |
8054 | // list holding nested lists containing profiles: | |
8055 | TList *diffFlowListProfiles = NULL; | |
8056 | diffFlowListProfiles = dynamic_cast<TList*>(diffFlowList->FindObject("Profiles")); | |
8057 | if(!diffFlowListProfiles) | |
8058 | { | |
8059 | cout<<"WARNING: diffFlowListProfiles is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8060 | exit(0); | |
8061 | } | |
8062 | // list holding nested lists containing 2D and 1D histograms with final results: | |
8063 | TList *diffFlowListResults = NULL; | |
8064 | diffFlowListResults = dynamic_cast<TList*>(diffFlowList->FindObject("Results")); | |
8065 | if(!diffFlowListResults) | |
8066 | { | |
8067 | cout<<"WARNING: diffFlowListResults is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8068 | exit(0); | |
8069 | } | |
8070 | ||
8071 | // c) Get pointer to profile holding all flags for differential flow; | |
8072 | TString diffFlowFlagsName = "fDiffFlowFlags"; | |
8073 | diffFlowFlagsName += fAnalysisLabel->Data(); | |
8074 | TProfile *diffFlowFlags = dynamic_cast<TProfile*>(diffFlowList->FindObject(diffFlowFlagsName.Data())); | |
8075 | Bool_t bCalculate2DFlow = kFALSE; | |
8076 | if(diffFlowFlags) | |
8077 | { | |
8078 | this->SetDiffFlowFlags(diffFlowFlags); | |
8079 | bCalculate2DFlow = (Int_t)diffFlowFlags->GetBinContent(4); | |
8080 | this->SetCalculate2DFlow(bCalculate2DFlow); // to be improved (shoul I call this setter somewhere else?) | |
8081 | } | |
8082 | ||
8083 | // d) Get pointers to all nested lists in fDiffFlowListProfiles and to profiles which they hold; | |
8084 | // correlations: | |
8085 | TList *diffFlowCorrelationsProList[2][2] = {{NULL}}; | |
8086 | TString diffFlowCorrelationsProName = "fDiffFlowCorrelationsPro"; | |
8087 | diffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
8088 | TProfile *diffFlowCorrelationsPro[2][2][4] = {{{NULL}}}; | |
8089 | // products of correlations: | |
8090 | TList *diffFlowProductOfCorrelationsProList[2][2] = {{NULL}}; | |
8091 | TString diffFlowProductOfCorrelationsProName = "fDiffFlowProductOfCorrelationsPro"; | |
8092 | diffFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
8093 | TProfile *diffFlowProductOfCorrelationsPro[2][2][8][8] = {{{{NULL}}}}; | |
8094 | // corrections: | |
8095 | TList *diffFlowCorrectionsProList[2][2] = {{NULL}}; | |
8096 | TString diffFlowCorrectionTermsForNUAProName = "fDiffFlowCorrectionTermsForNUAPro"; | |
8097 | diffFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
8098 | TProfile *diffFlowCorrectionTermsForNUAPro[2][2][2][10] = {{{{NULL}}}}; | |
8099 | for(Int_t t=0;t<2;t++) | |
8100 | { | |
8101 | for(Int_t pe=0;pe<2;pe++) | |
8102 | { | |
8103 | diffFlowCorrelationsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8104 | if(!diffFlowCorrelationsProList[t][pe]) | |
8105 | { | |
8106 | cout<<"WARNING: diffFlowCorrelationsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8107 | cout<<"t = "<<t<<endl; | |
8108 | cout<<"pe = "<<pe<<endl; | |
8109 | exit(0); | |
8110 | } | |
8111 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
8112 | { | |
8113 | diffFlowCorrelationsPro[t][pe][ci] = dynamic_cast<TProfile*>(diffFlowCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[ci].Data()))); | |
8114 | if(diffFlowCorrelationsPro[t][pe][ci]) | |
8115 | { | |
8116 | this->SetDiffFlowCorrelationsPro(diffFlowCorrelationsPro[t][pe][ci],t,pe,ci); | |
8117 | } else | |
8118 | { | |
8119 | cout<<"WARNING: diffFlowCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8120 | cout<<"t = "<<t<<endl; | |
8121 | cout<<"pe = "<<pe<<endl; | |
8122 | cout<<"ci = "<<ci<<endl; | |
8123 | } | |
8124 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
8125 | // products of correlations: | |
8126 | diffFlowProductOfCorrelationsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with products of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8127 | if(!diffFlowProductOfCorrelationsProList[t][pe]) | |
8128 | { | |
8129 | cout<<"WARNING: ddiffFlowProductOfCorrelationsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8130 | cout<<"t = "<<t<<endl; | |
8131 | cout<<"pe = "<<pe<<endl; | |
8132 | exit(0); | |
8133 | } | |
8134 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
8135 | { | |
8136 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
8137 | { | |
8138 | diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = dynamic_cast<TProfile*>(diffFlowProductOfCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()))); | |
8139 | if(diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]) | |
8140 | { | |
8141 | this->SetDiffFlowProductOfCorrelationsPro(diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2],t,pe,mci1,mci2); | |
8142 | } else | |
8143 | { | |
8144 | cout<<"WARNING: diffFlowCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8145 | cout<<"t = "<<t<<endl; | |
8146 | cout<<"pe = "<<pe<<endl; | |
8147 | cout<<"mci1 = "<<mci1<<endl; | |
8148 | cout<<"mci2 = "<<mci2<<endl; | |
8149 | } | |
8150 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
8151 | } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
8152 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
8153 | // corrections: | |
8154 | diffFlowCorrectionsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8155 | if(!diffFlowCorrectionsProList[t][pe]) | |
8156 | { | |
8157 | cout<<"WARNING: diffFlowCorrectionsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8158 | cout<<"t = "<<t<<endl; | |
8159 | cout<<"pe = "<<pe<<endl; | |
8160 | exit(0); | |
8161 | } | |
8162 | // correction terms for NUA: | |
8163 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
8164 | { | |
8165 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
8166 | { | |
8167 | diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = dynamic_cast<TProfile*>(diffFlowCorrectionsProList[t][pe]->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1))); | |
8168 | if(diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]) | |
8169 | { | |
8170 | this->SetDiffFlowCorrectionTermsForNUAPro(diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti],t,pe,sc,cti); | |
8171 | } else | |
8172 | { | |
8173 | cout<<"WARNING: diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8174 | cout<<"t = "<<t<<endl; | |
8175 | cout<<"pe = "<<pe<<endl; | |
8176 | cout<<"sc = "<<sc<<endl; | |
8177 | cout<<"cti = "<<cti<<endl; | |
8178 | } | |
8179 | } // end of for(Int_t cti=0;cti<9;cti++) // correction term index | |
8180 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
8181 | // ... | |
8182 | } // end of for(Int_t pe=0;pe<2;pe++) | |
8183 | } // end of for(Int_t t=0;t<2;t++) | |
8184 | ||
8185 | // e) Get pointers to all nested lists in fDiffFlowListResults and to histograms which they hold. | |
8186 | // reduced correlations: | |
8187 | TList *diffFlowCorrelationsHistList[2][2] = {{NULL}}; | |
8188 | TString diffFlowCorrelationsHistName = "fDiffFlowCorrelationsHist"; | |
8189 | diffFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
8190 | TH1D *diffFlowCorrelationsHist[2][2][4] = {{{NULL}}}; | |
8191 | // corrections for NUA: | |
8192 | TList *diffFlowCorrectionsHistList[2][2] = {{NULL}}; | |
8193 | TString diffFlowCorrectionTermsForNUAHistName = "fDiffFlowCorrectionTermsForNUAHist"; | |
8194 | diffFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
8195 | TH1D *diffFlowCorrectionTermsForNUAHist[2][2][2][10] = {{{{NULL}}}}; | |
8196 | // differential Q-cumulants: | |
8197 | TList *diffFlowCumulantsHistList[2][2] = {{NULL}}; | |
8198 | TString diffFlowCumulantsName = "fDiffFlowCumulants"; | |
8199 | diffFlowCumulantsName += fAnalysisLabel->Data(); | |
8200 | TH1D *diffFlowCumulants[2][2][4] = {{{NULL}}}; | |
8201 | // differential flow estimates from Q-cumulants: | |
8202 | TList *diffFlowHistList[2][2] = {{NULL}}; | |
8203 | TString diffFlowName = "fDiffFlow"; | |
8204 | diffFlowName += fAnalysisLabel->Data(); | |
8205 | TH1D *diffFlow[2][2][4] = {{{NULL}}}; | |
8206 | // differential covariances: | |
8207 | TList *diffFlowCovariancesHistList[2][2] = {{NULL}}; | |
8208 | TString diffFlowCovariancesName = "fDiffFlowCovariances"; | |
8209 | diffFlowCovariancesName += fAnalysisLabel->Data(); | |
8210 | TH1D *diffFlowCovariances[2][2][5] = {{{NULL}}}; | |
8211 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8212 | { | |
8213 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8214 | { | |
8215 | // reduced correlations: | |
8216 | diffFlowCorrelationsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8217 | if(!diffFlowCorrelationsHistList[t][pe]) | |
8218 | { | |
8219 | cout<<"WARNING: diffFlowCorrelationsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8220 | cout<<"t = "<<t<<endl; | |
8221 | cout<<"pe = "<<pe<<endl; | |
8222 | exit(0); | |
8223 | } | |
8224 | for(Int_t index=0;index<4;index++) | |
8225 | { | |
8226 | diffFlowCorrelationsHist[t][pe][index] = dynamic_cast<TH1D*>(diffFlowCorrelationsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()))); | |
8227 | if(diffFlowCorrelationsHist[t][pe][index]) | |
8228 | { | |
8229 | this->SetDiffFlowCorrelationsHist(diffFlowCorrelationsHist[t][pe][index],t,pe,index); | |
8230 | } else | |
8231 | { | |
8232 | cout<<"WARNING: diffFlowCorrelationsHist[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8233 | cout<<"t = "<<t<<endl; | |
8234 | cout<<"pe = "<<pe<<endl; | |
8235 | cout<<"index = "<<index<<endl; | |
8236 | exit(0); | |
8237 | } | |
8238 | } // end of for(Int_t index=0;index<4;index++) | |
8239 | // corrections: | |
8240 | diffFlowCorrectionsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Histograms with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8241 | if(!diffFlowCorrectionsHistList[t][pe]) | |
8242 | { | |
8243 | cout<<"WARNING: diffFlowCorrectionsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8244 | cout<<"t = "<<t<<endl; | |
8245 | cout<<"pe = "<<pe<<endl; | |
8246 | exit(0); | |
8247 | } | |
8248 | // correction terms for NUA: | |
8249 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
8250 | { | |
8251 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
8252 | { | |
8253 | diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = dynamic_cast<TH1D*>(diffFlowCorrectionsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1))); | |
8254 | if(diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]) | |
8255 | { | |
8256 | this->SetDiffFlowCorrectionTermsForNUAHist(diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti],t,pe,sc,cti); | |
8257 | } else | |
8258 | { | |
8259 | cout<<"WARNING: diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8260 | cout<<"t = "<<t<<endl; | |
8261 | cout<<"pe = "<<pe<<endl; | |
8262 | cout<<"sc = "<<sc<<endl; | |
8263 | cout<<"cti = "<<cti<<endl; | |
8264 | } | |
8265 | } // end of for(Int_t cti=0;cti<9;cti++) // correction term index | |
8266 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
8267 | // ... | |
8268 | // differential Q-cumulants: | |
8269 | diffFlowCumulantsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Differential Q-cumulants (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8270 | if(!diffFlowCumulantsHistList[t][pe]) | |
8271 | { | |
8272 | cout<<"WARNING: diffFlowCumulantsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8273 | cout<<"t = "<<t<<endl; | |
8274 | cout<<"pe = "<<pe<<endl; | |
8275 | exit(0); | |
8276 | } | |
8277 | for(Int_t index=0;index<4;index++) | |
8278 | { | |
8279 | diffFlowCumulants[t][pe][index] = dynamic_cast<TH1D*>(diffFlowCumulantsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()))); | |
8280 | if(diffFlowCumulants[t][pe][index]) | |
8281 | { | |
8282 | this->SetDiffFlowCumulants(diffFlowCumulants[t][pe][index],t,pe,index); | |
8283 | } else | |
8284 | { | |
8285 | cout<<"WARNING: diffFlowCumulants[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8286 | cout<<"t = "<<t<<endl; | |
8287 | cout<<"pe = "<<pe<<endl; | |
8288 | cout<<"index = "<<index<<endl; | |
8289 | exit(0); | |
8290 | } | |
8291 | } // end of for(Int_t index=0;index<4;index++) | |
8292 | // differential flow estimates from Q-cumulants: | |
8293 | diffFlowHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Differential flow (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8294 | if(!diffFlowHistList[t][pe]) | |
8295 | { | |
8296 | cout<<"WARNING: diffFlowHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8297 | cout<<"t = "<<t<<endl; | |
8298 | cout<<"pe = "<<pe<<endl; | |
8299 | exit(0); | |
8300 | } | |
8301 | for(Int_t index=0;index<4;index++) | |
8302 | { | |
8303 | diffFlow[t][pe][index] = dynamic_cast<TH1D*>(diffFlowHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()))); | |
8304 | if(diffFlow[t][pe][index]) | |
8305 | { | |
8306 | this->SetDiffFlow(diffFlow[t][pe][index],t,pe,index); | |
8307 | } else | |
8308 | { | |
8309 | cout<<"WARNING: diffFlow[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8310 | cout<<"t = "<<t<<endl; | |
8311 | cout<<"pe = "<<pe<<endl; | |
8312 | cout<<"index = "<<index<<endl; | |
8313 | exit(0); | |
8314 | } | |
8315 | } // end of for(Int_t index=0;index<4;index++) | |
8316 | // differential covariances: | |
8317 | diffFlowCovariancesHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Covariances of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8318 | if(!diffFlowCovariancesHistList[t][pe]) | |
8319 | { | |
8320 | cout<<"WARNING: diffFlowCovariancesHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8321 | cout<<"t = "<<t<<endl; | |
8322 | cout<<"pe = "<<pe<<endl; | |
8323 | exit(0); | |
8324 | } | |
8325 | for(Int_t covIndex=0;covIndex<5;covIndex++) | |
8326 | { | |
8327 | diffFlowCovariances[t][pe][covIndex] = dynamic_cast<TH1D*>(diffFlowCovariancesHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()))); | |
8328 | if(diffFlowCovariances[t][pe][covIndex]) | |
8329 | { | |
8330 | this->SetDiffFlowCovariances(diffFlowCovariances[t][pe][covIndex],t,pe,covIndex); | |
8331 | } else | |
8332 | { | |
8333 | cout<<"WARNING: diffFlowCovariances[t][pe][covIndex] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8334 | cout<<"t = "<<t<<endl; | |
8335 | cout<<"pe = "<<pe<<endl; | |
8336 | cout<<"covIndex = "<<covIndex<<endl; | |
8337 | exit(0); | |
8338 | } | |
8339 | } // end of for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index | |
8340 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8341 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
8342 | // sum of event weights for reduced correlations: | |
8343 | TList *diffFlowSumOfEventWeightsHistList[2][2][2] = {{{NULL}}}; | |
8344 | TString diffFlowSumOfEventWeightsName = "fDiffFlowSumOfEventWeights"; | |
8345 | diffFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
8346 | TH1D *diffFlowSumOfEventWeights[2][2][2][4] = {{{{NULL}}}}; | |
8347 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
8348 | { | |
8349 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8350 | { | |
8351 | for(Int_t p=0;p<2;p++) // power of event weights is either 1 or 2 | |
8352 | { | |
8353 | diffFlowSumOfEventWeightsHistList[t][pe][p] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Sum of %s event weights (%s, %s)",powerFlag[p].Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8354 | if(!diffFlowSumOfEventWeightsHistList[t][pe][p]) | |
8355 | { | |
8356 | cout<<"WARNING: diffFlowSumOfEventWeightsHistList[t][pe][p] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8357 | cout<<"t = "<<t<<endl; | |
8358 | cout<<"pe = "<<pe<<endl; | |
8359 | cout<<"power = "<<p<<endl; | |
8360 | exit(0); | |
8361 | } | |
8362 | for(Int_t ew=0;ew<4;ew++) // index of reduced correlation | |
8363 | { | |
8364 | diffFlowSumOfEventWeights[t][pe][p][ew] = dynamic_cast<TH1D*>(diffFlowSumOfEventWeightsHistList[t][pe][p]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()))); | |
8365 | if(diffFlowSumOfEventWeights[t][pe][p][ew]) | |
8366 | { | |
8367 | this->SetDiffFlowSumOfEventWeights(diffFlowSumOfEventWeights[t][pe][p][ew],t,pe,p,ew); | |
8368 | } else | |
8369 | { | |
8370 | cout<<"WARNING: diffFlowSumOfEventWeights[t][pe][p][ew] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8371 | cout<<"t = "<<t<<endl; | |
8372 | cout<<"pe = "<<pe<<endl; | |
8373 | cout<<"power = "<<p<<endl; | |
8374 | cout<<"ew = "<<ew<<endl; | |
8375 | exit(0); | |
8376 | } | |
8377 | } | |
8378 | } // end of for(Int_t p=0;p<2;p++) // power of event weights is either 1 or 2 | |
8379 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8380 | } // end of for(Int_t t=0;t<2;t++) // type is RP or POI | |
8381 | // | |
8382 | TList *diffFlowSumOfProductOfEventWeightsHistList[2][2] = {{NULL}}; | |
8383 | TString diffFlowSumOfProductOfEventWeightsName = "fDiffFlowSumOfProductOfEventWeights"; | |
8384 | diffFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
8385 | TH1D *diffFlowSumOfProductOfEventWeights[2][2][8][8] = {{{{NULL}}}}; | |
8386 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
8387 | { | |
8388 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8389 | { | |
8390 | diffFlowSumOfProductOfEventWeightsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Sum of products of event weights (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
8391 | if(!diffFlowSumOfProductOfEventWeightsHistList[t][pe]) | |
8392 | { | |
8393 | cout<<"WARNING: diffFlowSumOfProductOfEventWeightsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8394 | cout<<"t = "<<t<<endl; | |
8395 | cout<<"pe = "<<pe<<endl; | |
8396 | exit(0); | |
8397 | } | |
8398 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
8399 | { | |
8400 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
8401 | { | |
8402 | diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = dynamic_cast<TH1D*>(diffFlowSumOfProductOfEventWeightsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()))); | |
8403 | if(diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]) | |
8404 | { | |
8405 | this->SetDiffFlowSumOfProductOfEventWeights(diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2],t,pe,mci1,mci2); | |
8406 | } else | |
8407 | { | |
8408 | cout<<"WARNING: diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
8409 | cout<<"t = "<<t<<endl; | |
8410 | cout<<"pe = "<<pe<<endl; | |
8411 | cout<<"mci1 = "<<mci1<<endl; | |
8412 | cout<<"mci2 = "<<mci2<<endl; | |
8413 | exit(0); | |
8414 | } | |
8415 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
8416 | } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
8417 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
8418 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8419 | } // end of for(Int_t t=0;t<2;t++) // type is RP or POI | |
8420 | ||
8421 | } // end void AliFlowAnalysisWithQCumulants::GetPointersForDiffFlowHistograms() | |
8422 | ||
8423 | ||
8424 | //================================================================================================================================ | |
8425 | ||
8426 | ||
8427 | void AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow() | |
8428 | { | |
8429 | // Book all histograms and profiles needed for differential flow. | |
8430 | // a) Define flags locally (to be improved: should I promote flags to data members?); | |
8431 | // b) Book profile to hold all flags for differential flow; | |
8432 | // c) Book e-b-e quantities; | |
8433 | // d) Book profiles; | |
8434 | // e) Book histograms holding final results. | |
8435 | ||
8436 | // a) Define flags locally (to be improved: should I promote flags to data members?): | |
8437 | TString typeFlag[2] = {"RP","POI"}; | |
8438 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
8439 | TString powerFlag[2] = {"linear","quadratic"}; | |
8440 | TString sinCosFlag[2] = {"sin","cos"}; | |
8441 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
8442 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
8443 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
8444 | TString mixedCorrelationIndex[8] = {"<2>","<2'>","<4>","<4'>","<6>","<6'>","<8>","<8'>"}; | |
8445 | TString covarianceName[5] = {"Cov(<2>,<2'>)","Cov(<2>,<4'>)","Cov(<4>,<2'>)","Cov(<4>,<4'>)","Cov(<2'>,<4'>)"}; | |
8446 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
8447 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
8448 | Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
8449 | ||
8450 | // b) Book profile to hold all flags for differential flow: | |
8451 | TString diffFlowFlagsName = "fDiffFlowFlags"; | |
8452 | diffFlowFlagsName += fAnalysisLabel->Data(); | |
8453 | fDiffFlowFlags = new TProfile(diffFlowFlagsName.Data(),"Flags for Differential Flow",4,0,4); | |
8454 | fDiffFlowFlags->SetTickLength(-0.01,"Y"); | |
8455 | fDiffFlowFlags->SetMarkerStyle(25); | |
8456 | fDiffFlowFlags->SetLabelSize(0.05); | |
8457 | fDiffFlowFlags->SetLabelOffset(0.02,"Y"); | |
8458 | (fDiffFlowFlags->GetXaxis())->SetBinLabel(1,"Particle Weights"); | |
8459 | (fDiffFlowFlags->GetXaxis())->SetBinLabel(2,"Event Weights"); | |
8460 | (fDiffFlowFlags->GetXaxis())->SetBinLabel(3,"Corrected for NUA?"); | |
8461 | (fDiffFlowFlags->GetXaxis())->SetBinLabel(4,"Calculated 2D flow?"); | |
8462 | fDiffFlowList->Add(fDiffFlowFlags); | |
8463 | ||
8464 | // c) Book e-b-e quantities: | |
8465 | // Event-by-event r_{m*n,k}(pt,eta), p_{m*n,k}(pt,eta) and q_{m*n,k}(pt,eta) | |
8466 | // Explanantion of notation: | |
8467 | // 1.) n is harmonic, m is multiple of harmonic; | |
8468 | // 2.) k is power of particle weight; | |
8469 | // 3.) r_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for RPs in particular (pt,eta) bin (i-th RP is weighted with w_i^k); | |
8470 | // 4.) p_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for POIs in particular (pt,eta) bin | |
8471 | // (if i-th POI is also RP, than it is weighted with w_i^k); | |
8472 | // 5.) q_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for particles which are both RPs and POIs in particular (pt,eta) bin | |
8473 | // (i-th RP&&POI is weighted with w_i^k) | |
8474 | ||
8475 | // 1D: | |
8476 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP && POI ) | |
8477 | { | |
8478 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8479 | { | |
8480 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
8481 | { | |
8482 | for(Int_t k=0;k<9;k++) // power of particle weight | |
8483 | { | |
8484 | fReRPQ1dEBE[t][pe][m][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%dpower%dRe",t,pe,m,k), | |
8485 | Form("TypeFlag%dpteta%dmultiple%dpower%dRe",t,pe,m,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8486 | fImRPQ1dEBE[t][pe][m][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%dpower%dIm",t,pe,m,k), | |
8487 | Form("TypeFlag%dpteta%dmultiple%dpower%dIm",t,pe,m,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8488 | } | |
8489 | } | |
8490 | } | |
8491 | } | |
8492 | // to be improved (add explanation of fs1dEBE[t][pe][k]): | |
8493 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) | |
8494 | { | |
8495 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8496 | { | |
8497 | for(Int_t k=0;k<9;k++) // power of particle weight | |
8498 | { | |
8499 | fs1dEBE[t][pe][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%d",t,pe,k), | |
8500 | Form("TypeFlag%dpteta%dmultiple%d",t,pe,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8501 | } | |
8502 | } | |
8503 | } | |
8504 | // correction terms for nua: | |
8505 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
8506 | { | |
8507 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8508 | { | |
8509 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
8510 | { | |
8511 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
8512 | { | |
8513 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti] = new TH1D(Form("typeFlag%d pteta%d sincos%d cti%d",t,pe,sc,cti), | |
8514 | Form("typeFlag%d pteta%d sincos%d cti%d",t,pe,sc,cti),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8515 | } | |
8516 | } | |
8517 | } | |
8518 | } | |
8519 | // 2D: | |
8520 | TProfile2D styleRe("typeMultiplePowerRe","typeMultiplePowerRe",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
8521 | TProfile2D styleIm("typeMultiplePowerIm","typeMultiplePowerIm",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
8522 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) | |
8523 | { | |
8524 | for(Int_t m=0;m<4;m++) | |
8525 | { | |
8526 | for(Int_t k=0;k<9;k++) | |
8527 | { | |
8528 | fReRPQ2dEBE[t][m][k] = (TProfile2D*)styleRe.Clone(Form("typeFlag%dmultiple%dpower%dRe",t,m,k)); | |
8529 | fImRPQ2dEBE[t][m][k] = (TProfile2D*)styleIm.Clone(Form("typeFlag%dmultiple%dpower%dIm",t,m,k)); | |
8530 | } | |
8531 | } | |
8532 | } | |
8533 | TProfile2D styleS("typePower","typePower",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
8534 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) | |
8535 | { | |
8536 | for(Int_t k=0;k<9;k++) | |
8537 | { | |
8538 | fs2dEBE[t][k] = (TProfile2D*)styleS.Clone(Form("typeFlag%dpower%d",t,k)); | |
8539 | } | |
8540 | } | |
8541 | // reduced correlations e-b-e: | |
8542 | TString diffFlowCorrelationsEBEName = "fDiffFlowCorrelationsEBE"; | |
8543 | diffFlowCorrelationsEBEName += fAnalysisLabel->Data(); | |
8544 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8545 | { | |
8546 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8547 | { | |
8548 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8549 | { | |
8550 | fDiffFlowCorrelationsEBE[t][pe][rci] = new TH1D(Form("%s, %s, %s, %s",diffFlowCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8551 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
8552 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8553 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
8554 | // event weights for reduced correlations e-b-e: | |
8555 | TString diffFlowEventWeightsForCorrelationsEBEName = "fDiffFlowEventWeightsForCorrelationsEBE"; | |
8556 | diffFlowEventWeightsForCorrelationsEBEName += fAnalysisLabel->Data(); | |
8557 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8558 | { | |
8559 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8560 | { | |
8561 | for(Int_t rci=0;rci<4;rci++) // event weight for reduced correlation index | |
8562 | { | |
8563 | fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci] = new TH1D(Form("%s, %s, %s, eW for %s",diffFlowEventWeightsForCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, eW for %s",diffFlowEventWeightsForCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8564 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
8565 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8566 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
8567 | ||
8568 | // d) Book profiles; | |
8569 | // reduced correlations: | |
8570 | TString diffFlowCorrelationsProName = "fDiffFlowCorrelationsPro"; | |
8571 | diffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
8572 | // corrections terms: | |
8573 | TString diffFlowCorrectionTermsForNUAProName = "fDiffFlowCorrectionTermsForNUAPro"; | |
8574 | diffFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
8575 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8576 | { | |
8577 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8578 | { | |
8579 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8580 | { | |
8581 | // reduced correlations: | |
8582 | fDiffFlowCorrelationsPro[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe],"s"); | |
8583 | fDiffFlowCorrelationsPro[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data()); | |
8584 | fDiffFlowCorrelationsProList[t][pe]->Add(fDiffFlowCorrelationsPro[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations) | |
8585 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
8586 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8587 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
8588 | // correction terms for nua: | |
8589 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
8590 | { | |
8591 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8592 | { | |
8593 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
8594 | { | |
8595 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
8596 | { | |
8597 | fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = new TProfile(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8598 | fDiffFlowCorrectionsProList[t][pe]->Add(fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]); | |
8599 | } | |
8600 | } | |
8601 | } | |
8602 | } | |
8603 | // e) Book histograms holding final results. | |
8604 | // reduced correlations: | |
8605 | TString diffFlowCorrelationsHistName = "fDiffFlowCorrelationsHist"; | |
8606 | diffFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
8607 | // corrections terms: | |
8608 | TString diffFlowCorrectionTermsForNUAHistName = "fDiffFlowCorrectionTermsForNUAHist"; | |
8609 | diffFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
8610 | // differential covariances: | |
8611 | TString diffFlowCovariancesName = "fDiffFlowCovariances"; | |
8612 | diffFlowCovariancesName += fAnalysisLabel->Data(); | |
8613 | // differential Q-cumulants: | |
8614 | TString diffFlowCumulantsName = "fDiffFlowCumulants"; | |
8615 | diffFlowCumulantsName += fAnalysisLabel->Data(); | |
8616 | // differential flow: | |
8617 | TString diffFlowName = "fDiffFlow"; | |
8618 | diffFlowName += fAnalysisLabel->Data(); | |
8619 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8620 | { | |
8621 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8622 | { | |
8623 | for(Int_t index=0;index<4;index++) | |
8624 | { | |
8625 | // reduced correlations: | |
8626 | fDiffFlowCorrelationsHist[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8627 | fDiffFlowCorrelationsHist[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
8628 | fDiffFlowCorrelationsHistList[t][pe]->Add(fDiffFlowCorrelationsHist[t][pe][index]); | |
8629 | // differential Q-cumulants: | |
8630 | fDiffFlowCumulants[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8631 | fDiffFlowCumulants[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
8632 | fDiffFlowCumulantsHistList[t][pe]->Add(fDiffFlowCumulants[t][pe][index]); | |
8633 | // differential flow estimates from Q-cumulants: | |
8634 | fDiffFlow[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8635 | fDiffFlow[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
8636 | fDiffFlowHistList[t][pe]->Add(fDiffFlow[t][pe][index]); | |
8637 | } // end of for(Int_t index=0;index<4;index++) | |
8638 | for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index | |
8639 | { | |
8640 | // differential covariances: | |
8641 | fDiffFlowCovariances[t][pe][covIndex] = new TH1D(Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()),Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8642 | fDiffFlowCovariances[t][pe][covIndex]->SetXTitle(ptEtaFlag[pe].Data()); | |
8643 | fDiffFlowCovariancesHistList[t][pe]->Add(fDiffFlowCovariances[t][pe][covIndex]); | |
8644 | } // end of for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index | |
8645 | // products of both types of correlations: | |
8646 | TString diffFlowProductOfCorrelationsProName = "fDiffFlowProductOfCorrelationsPro"; | |
8647 | diffFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
8648 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
8649 | { | |
8650 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
8651 | { | |
8652 | fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = new TProfile(Form("%s, %s, %s, %s, %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),Form("%s, %s, %s, %s #times %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8653 | fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]->SetXTitle(ptEtaFlag[pe].Data()); | |
8654 | fDiffFlowProductOfCorrelationsProList[t][pe]->Add(fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]); | |
8655 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
8656 | } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
8657 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
8658 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8659 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
8660 | // sums of event weights for reduced correlations: | |
8661 | TString diffFlowSumOfEventWeightsName = "fDiffFlowSumOfEventWeights"; | |
8662 | diffFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
8663 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
8664 | { | |
8665 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8666 | { | |
8667 | for(Int_t p=0;p<2;p++) // power of weights is either 1 or 2 | |
8668 | { | |
8669 | for(Int_t ew=0;ew<4;ew++) // index of reduced correlation | |
8670 | { | |
8671 | fDiffFlowSumOfEventWeights[t][pe][p][ew] = new TH1D(Form("%s, %s, %s, %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()),Form("%s, %s, %s, power = %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8672 | fDiffFlowSumOfEventWeights[t][pe][p][ew]->SetXTitle(ptEtaFlag[pe].Data()); | |
8673 | fDiffFlowSumOfEventWeightsHistList[t][pe][p]->Add(fDiffFlowSumOfEventWeights[t][pe][p][ew]); // to be improved (add dedicated list to hold all this) | |
8674 | } | |
8675 | } | |
8676 | } | |
8677 | } | |
8678 | // sum of products of event weights for both types of correlations: | |
8679 | TString diffFlowSumOfProductOfEventWeightsName = "fDiffFlowSumOfProductOfEventWeights"; | |
8680 | diffFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
8681 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
8682 | { | |
8683 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8684 | { | |
8685 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
8686 | { | |
8687 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
8688 | { | |
8689 | fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = new TH1D(Form("%s, %s, %s, %s, %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),Form("%s, %s, %s, %s #times %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8690 | fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]->SetXTitle(ptEtaFlag[pe].Data()); | |
8691 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]->Add(fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]); | |
8692 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
8693 | } | |
8694 | } | |
8695 | } | |
8696 | } | |
8697 | // correction terms for nua: | |
8698 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
8699 | { | |
8700 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
8701 | { | |
8702 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
8703 | { | |
8704 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
8705 | { | |
8706 | fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = new TH1D(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
8707 | fDiffFlowCorrectionsHistList[t][pe]->Add(fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]); | |
8708 | } | |
8709 | } | |
8710 | } | |
8711 | } | |
8712 | ||
8713 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow() | |
8714 | ||
8715 | ||
8716 | //================================================================================================================================ | |
8717 | ||
8718 | /* | |
8719 | void AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNUAForIntQcumulants() // to be improved (do I really need this method?) | |
8720 | { | |
8721 | // Calculate final corrections for non-uniform acceptance for Q-cumulants. | |
8722 | ||
8723 | // Corrections for non-uniform acceptance are stored in histogram fCorrectionsForNUA, | |
8724 | // binning of fCorrectionsForNUA is organized as follows: | |
8725 | // | |
8726 | // 1st bin: correction to QC{2} | |
8727 | // 2nd bin: correction to QC{4} | |
8728 | // 3rd bin: correction to QC{6} | |
8729 | // 4th bin: correction to QC{8} | |
8730 | ||
8731 | // shortcuts flags: | |
8732 | Int_t pW = (Int_t)(useParticleWeights); | |
8733 | ||
8734 | Int_t eW = -1; | |
8735 | ||
8736 | if(eventWeights == "exact") | |
8737 | { | |
8738 | eW = 0; | |
8739 | } | |
8740 | ||
8741 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms flag | |
8742 | { | |
8743 | if(!(fQCorrelations[pW][eW] && fQCorrections[pW][eW][sc] && fCorrections[pW][eW])) | |
8744 | { | |
8745 | cout<<"WARNING: fQCorrelations[pW][eW] && fQCorrections[pW][eW][sc] && fCorrections[pW][eW] is NULL in AFAWQC::CFCFNUAFIF() !!!!"<<endl; | |
8746 | cout<<"pW = "<<pW<<endl; | |
8747 | cout<<"eW = "<<eW<<endl; | |
8748 | cout<<"sc = "<<sc<<endl; | |
8749 | exit(0); | |
8750 | } | |
8751 | } | |
8752 | ||
8753 | // measured 2-, 4-, 6- and 8-particle azimuthal correlations (biased with non-uniform acceptance!): | |
8754 | Double_t two = fQCorrelations[pW][eW]->GetBinContent(1); // <<2>> | |
8755 | //Double_t four = fQCorrelations[pW][eW]->GetBinContent(11); // <<4>> | |
8756 | //Double_t six = fQCorrelations[pW][eW]->GetBinContent(24); // <<6>> | |
8757 | //Double_t eight = fQCorrelations[pW][eW]->GetBinContent(31); // <<8>> | |
8758 | ||
8759 | // correction terms to QC{2}: | |
8760 | // <<cos(n*phi1)>>^2 | |
8761 | Double_t two1stTerm = pow(fQCorrections[pW][eW][1]->GetBinContent(1),2); | |
8762 | // <<sin(n*phi1)>>^2 | |
8763 | Double_t two2ndTerm = pow(fQCorrections[pW][eW][0]->GetBinContent(1),2); | |
8764 | // final corrections for non-uniform acceptance to QC{2}: | |
8765 | Double_t correctionQC2 = -1.*two1stTerm-1.*two2ndTerm; | |
8766 | fCorrections[pW][eW]->SetBinContent(1,correctionQC2); | |
8767 | ||
8768 | // correction terms to QC{4}: | |
8769 | // <<cos(n*phi1)>> <<cos(n*(phi1-phi2-phi3))>> | |
8770 | Double_t four1stTerm = fQCorrections[pW][eW][1]->GetBinContent(1)*fQCorrections[pW][eW][1]->GetBinContent(3); | |
8771 | // <<sin(n*phi1)>> <<sin(n*(phi1-phi2-phi3))>> | |
8772 | Double_t four2ndTerm = fQCorrections[pW][eW][0]->GetBinContent(1)*fQCorrections[pW][eW][0]->GetBinContent(3); | |
8773 | // <<cos(n*(phi1+phi2))>>^2 | |
8774 | Double_t four3rdTerm = pow(fQCorrections[pW][eW][1]->GetBinContent(2),2); | |
8775 | // <<sin(n*(phi1+phi2))>>^2 | |
8776 | Double_t four4thTerm = pow(fQCorrections[pW][eW][0]->GetBinContent(2),2); | |
8777 | // <<cos(n*(phi1+phi2))>> (<<cos(n*phi1)>>^2 - <<sin(n*phi1)>>^2) | |
8778 | Double_t four5thTerm = fQCorrections[pW][eW][1]->GetBinContent(2) | |
8779 | * (pow(fQCorrections[pW][eW][1]->GetBinContent(1),2)-pow(fQCorrections[pW][eW][0]->GetBinContent(1),2)); | |
8780 | // <<sin(n*(phi1+phi2))>> <<cos(n*phi1)>> <<sin(n*phi1)>> | |
8781 | Double_t four6thTerm = fQCorrections[pW][eW][0]->GetBinContent(2) | |
8782 | * fQCorrections[pW][eW][1]->GetBinContent(1) | |
8783 | * fQCorrections[pW][eW][0]->GetBinContent(1); | |
8784 | // <<cos(n*(phi1-phi2))>> (<<cos(n*phi1)>>^2 + <<sin(n*phi1)>>^2) | |
8785 | Double_t four7thTerm = two*(pow(fQCorrections[pW][eW][1]->GetBinContent(1),2)+pow(fQCorrections[pW][eW][0]->GetBinContent(1),2)); | |
8786 | // (<<cos(n*phi1)>>^2 + <<sin(n*phi1)>>^2)^2 | |
8787 | Double_t four8thTerm = pow(pow(fQCorrections[pW][eW][1]->GetBinContent(1),2)+pow(fQCorrections[pW][eW][0]->GetBinContent(1),2),2); | |
8788 | // final correction to QC{4}: | |
8789 | Double_t correctionQC4 = -4.*four1stTerm+4.*four2ndTerm-four3rdTerm-four4thTerm | |
8790 | + 4.*four5thTerm+8.*four6thTerm+8.*four7thTerm-6.*four8thTerm; | |
8791 | fCorrections[pW][eW]->SetBinContent(2,correctionQC4); | |
8792 | ||
8793 | // ... to be improved (continued for 6th and 8th order) | |
8794 | ||
8795 | ||
8796 | } // end of AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNUAForIntQcumulants() | |
8797 | */ | |
8798 | ||
8799 | //================================================================================================================================ | |
8800 | ||
8801 | ||
8802 | void AliFlowAnalysisWithQCumulants::CalculateQcumulantsCorrectedForNUAIntFlow() | |
8803 | { | |
8804 | // Calculate generalized Q-cumulants (cumulants corrected for non-unifom acceptance). | |
8805 | ||
8806 | // measured 2-, 4-, 6- and 8-particle correlations (biased by non-uniform acceptance!): | |
8807 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> | |
8808 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> | |
8809 | //Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> | |
8810 | //Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> | |
8811 | ||
8812 | // statistical error of measured 2-, 4-, 6- and 8-particle correlations: | |
8813 | //Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <<2>> | |
8814 | //Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <<4>> | |
8815 | //Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <<6>> | |
8816 | //Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <<8>> | |
8817 | ||
8818 | // QC{2}: | |
8819 | // <<cos(n*phi1)>>^2 | |
8820 | Double_t two1stTerm = pow(fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1),2); | |
8821 | //Double_t two1stTermErrorSquared = pow(fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(1),2); | |
8822 | // <<sin(n*phi1)>>^2 | |
8823 | Double_t two2ndTerm = pow(fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1),2); | |
8824 | //Double_t two2ndTermErrorSquared = pow(fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(1),2); | |
8825 | // generalized QC{2}: | |
8826 | Double_t gQC2 = two - two1stTerm - two2ndTerm; // to be improved (terminology, notation) | |
8827 | fIntFlowQcumulants->SetBinContent(1,gQC2); | |
8828 | //fIntFlowQcumulants->SetBinError(1,0.); // to be improved (propagate error) | |
8829 | ||
8830 | // QC{4}: | |
8831 | // <<cos(n*phi1)>> <<cos(n*(phi1-phi2-phi3))>> | |
8832 | Double_t four1stTerm = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1) | |
8833 | * fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(3); | |
8834 | // <<sin(n*phi1)>> <<sin(n*(phi1-phi2-phi3))>> | |
8835 | Double_t four2ndTerm = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1) | |
8836 | * fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(3); | |
8837 | // <<cos(n*(phi1+phi2))>>^2 | |
8838 | Double_t four3rdTerm = pow(fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2),2); | |
8839 | // <<sin(n*(phi1+phi2))>>^2 | |
8840 | Double_t four4thTerm = pow(fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2),2); | |
8841 | // <<cos(n*(phi1+phi2))>> (<<cos(n*phi1)>>^2 - <<sin(n*phi1)>>^2) | |
8842 | Double_t four5thTerm = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2) | |
8843 | * (pow(fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1),2) | |
8844 | - pow(fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1),2)); | |
8845 | // <<sin(n*(phi1+phi2))>> <<cos(n*phi1)>> <<sin(n*phi1)>> | |
8846 | Double_t four6thTerm = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2) | |
8847 | * fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1) | |
8848 | * fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1); | |
8849 | // <<cos(n*(phi1-phi2))>> (<<cos(n*phi1)>>^2 + <<sin(n*phi1)>>^2) | |
8850 | Double_t four7thTerm = two*(pow(fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1),2) | |
8851 | + pow(fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1),2)); | |
8852 | // (<<cos(n*phi1)>>^2 + <<sin(n*phi1)>>^2)^2 | |
8853 | Double_t four8thTerm = pow(pow(fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1),2) | |
8854 | + pow(fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1),2),2); | |
8855 | // generalized QC{4}: | |
8856 | Double_t gQC4 = four-2.*pow(two,2.)-4.*four1stTerm+4.*four2ndTerm-four3rdTerm | |
8857 | - four4thTerm+4.*four5thTerm+8.*four6thTerm+8.*four7thTerm-6.*four8thTerm; | |
8858 | fIntFlowQcumulants->SetBinContent(2,gQC4); | |
8859 | //fIntFlowQcumulants->SetBinError(2,0.); // to be improved (propagate error) | |
8860 | ||
8861 | // ... to be improved (continued for 6th and 8th order) | |
8862 | ||
2001bc3a | 8863 | // versus multiplicity: |
b3dacf6b | 8864 | if(fApplyCorrectionForNUAVsM && fCalculateCumulantsVsM) |
2001bc3a | 8865 | { |
8866 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) | |
8867 | for(Int_t b=1;b<=nBins;b++) | |
8868 | { | |
8869 | two = fIntFlowCorrelationsVsMHist[0]->GetBinContent(b); // <<2>> vs M | |
8870 | four = fIntFlowCorrelationsVsMHist[1]->GetBinContent(b); // <<4>> vs M | |
8871 | // generalized QC{2} vs M: | |
8872 | two1stTerm = pow(fIntFlowCorrectionTermsForNUAVsMPro[1][0]->GetBinContent(b),2); // <<cos(n*phi1)>>^2 vs M | |
8873 | two2ndTerm = pow(fIntFlowCorrectionTermsForNUAVsMPro[0][0]->GetBinContent(b),2); // <<sin(n*phi1)>>^2 vs M | |
8874 | gQC2 = two - two1stTerm - two2ndTerm; | |
8875 | fIntFlowQcumulantsVsM[0]->SetBinContent(b,gQC2); | |
8876 | // generalized QC{4} vs M: | |
8877 | four1stTerm = fIntFlowCorrectionTermsForNUAVsMPro[1][0]->GetBinContent(b) | |
8878 | * fIntFlowCorrectionTermsForNUAVsMPro[1][2]->GetBinContent(b); // <<cos(n*phi1)>> <<cos(n*(phi1-phi2-phi3))>> vs M | |
8879 | four2ndTerm = fIntFlowCorrectionTermsForNUAVsMPro[0][0]->GetBinContent(b) | |
8880 | * fIntFlowCorrectionTermsForNUAVsMPro[0][2]->GetBinContent(b); // <<sin(n*phi1)>> <<sin(n*(phi1-phi2-phi3))>> vs M | |
8881 | four3rdTerm = pow(fIntFlowCorrectionTermsForNUAVsMPro[1][1]->GetBinContent(b),2); // <<cos(n*(phi1+phi2))>>^2 vs M | |
8882 | four4thTerm = pow(fIntFlowCorrectionTermsForNUAVsMPro[0][1]->GetBinContent(b),2); // <<sin(n*(phi1+phi2))>>^2 vs M | |
8883 | four5thTerm = fIntFlowCorrectionTermsForNUAVsMPro[1][1]->GetBinContent(b) | |
8884 | * (pow(fIntFlowCorrectionTermsForNUAVsMPro[1][0]->GetBinContent(b),2) | |
8885 | - pow(fIntFlowCorrectionTermsForNUAVsMPro[0][0]->GetBinContent(b),2)); //<<cos(n*(phi1+phi2))>> (<<cos(n*phi1)>>^2-<<sin(n*phi1)>>^2) vs M | |
8886 | four6thTerm = fIntFlowCorrectionTermsForNUAVsMPro[0][1]->GetBinContent(b) | |
8887 | * fIntFlowCorrectionTermsForNUAVsMPro[1][0]->GetBinContent(b) | |
8888 | * fIntFlowCorrectionTermsForNUAVsMPro[0][0]->GetBinContent(b); // <<sin(n*(phi1+phi2))>> <<cos(n*phi1)>> <<sin(n*phi1)>> vs M | |
8889 | four7thTerm = two*(pow(fIntFlowCorrectionTermsForNUAVsMPro[1][0]->GetBinContent(b),2) | |
8890 | + pow(fIntFlowCorrectionTermsForNUAVsMPro[0][0]->GetBinContent(b),2)); // <<cos(n*(phi1-phi2))>> (<<cos(n*phi1)>>^2 + <<sin(n*phi1)>>^2) vs M | |
8891 | four8thTerm = pow(pow(fIntFlowCorrectionTermsForNUAVsMPro[1][0]->GetBinContent(b),2) | |
8892 | + pow(fIntFlowCorrectionTermsForNUAVsMPro[0][0]->GetBinContent(b),2),2); // (<<cos(n*phi1)>>^2 + <<sin(n*phi1)>>^2)^2 | |
8893 | gQC4 = four-2.*pow(two,2.)-4.*four1stTerm+4.*four2ndTerm-four3rdTerm | |
8894 | - four4thTerm+4.*four5thTerm+8.*four6thTerm+8.*four7thTerm-6.*four8thTerm; | |
8895 | fIntFlowQcumulantsVsM[1]->SetBinContent(b,gQC4); | |
8896 | } // end of for(Int_t b=1;b<=nBins;b++) | |
b3dacf6b | 8897 | } // end of if(fApplyCorrectionForNUAVsM && fCalculateCumulantsVsM) |
2001bc3a | 8898 | |
489d5531 | 8899 | } // end of void AliFlowAnalysisWithQCumulants::CalculateQcumulantsCorrectedForNUAIntFlow() |
8900 | ||
489d5531 | 8901 | //================================================================================================================================ |
8902 | ||
489d5531 | 8903 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectedForNUA() |
8904 | { | |
8905 | // Calculate integrated flow from generalized Q-cumulants (corrected for non-uniform acceptance). | |
8906 | ||
8907 | // to be improved: add protection for NULL pointers, propagate statistical errors from | |
8908 | // measured correlations and correction terms | |
8909 | ||
8910 | // generalized Q-cumulants: | |
8911 | Double_t qc2 = fIntFlowQcumulants->GetBinContent(1); // QC{2} | |
8912 | Double_t qc4 = fIntFlowQcumulants->GetBinContent(2); // QC{4} | |
8913 | //Double_t qc6 = fIntFlowQcumulants->GetBinContent(3); // QC{6} | |
8914 | //Double_t qc8 = fIntFlowQcumulants->GetBinContent(4); // QC{8} | |
8915 | ||
8916 | // integrated flow estimates: | |
8917 | Double_t v2 = 0.; // v{2,QC} | |
8918 | Double_t v4 = 0.; // v{4,QC} | |
8919 | //Double_t v6 = 0.; // v{6,QC} | |
8920 | //Double_t v8 = 0.; // v{8,QC} | |
8921 | ||
8922 | // calculate integrated flow estimates from generalized Q-cumulants: | |
8923 | if(qc2>=0.) v2 = pow(qc2,1./2.); | |
8924 | if(qc4<=0.) v4 = pow(-1.*qc4,1./4.); | |
8925 | //if(qc6>=0.) v6 = pow((1./4.)*qc6,1./6.); | |
8926 | //if(qc8<=0.) v8 = pow((-1./33.)*qc8,1./8.); | |
8927 | ||
8928 | // store integrated flow estimates from generalized Q-cumulants: | |
8929 | fIntFlow->SetBinContent(1,v2); | |
8930 | fIntFlow->SetBinContent(2,v4); | |
8931 | //fIntFlow->SetBinContent(3,v6); | |
8932 | //fIntFlow->SetBinContent(4,v8); | |
0328db2d | 8933 | |
8934 | /* | |
8935 | // propagate correctly error by including non-isotropic terms (to be improved - moved somewhere else): | |
8936 | // correlations: | |
8937 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> | |
8938 | //Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> | |
8939 | //Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> | |
8940 | //Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> | |
8941 | // statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations: | |
8942 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <2> | |
8943 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <4> | |
8944 | //Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <6> | |
8945 | //Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <8> | |
8946 | // nua terms: | |
8947 | Double_t c1 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1); // <<cos(phi1)>> | |
8948 | Double_t c2 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
8949 | Double_t c3 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
8950 | Double_t s1 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1); // <<sin(phi1)>> | |
8951 | Double_t s2 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
8952 | Double_t s3 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
8953 | // statistical errors of nua terms: | |
8954 | Double_t c1Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(1); // statistical error of <cos(phi1)> | |
8955 | Double_t c2Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(2); // statistical error of <cos(phi1+phi2)> | |
8956 | Double_t c3Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(3); // statistical error of <cos(phi1-phi2-phi3)> | |
8957 | Double_t s1Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(1); // statistical error of <sin(phi1)> | |
8958 | Double_t s2Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(2); // statistical error of <sin(phi1+phi2)> | |
8959 | Double_t s3Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(3); // statistical error of <sin(phi1-phi2-phi3)> | |
8960 | ||
8961 | // covariances for nua: | |
8962 | Double_t wCov24 = fIntFlowCovariances->GetBinContent(1); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) | |
8963 | Double_t wCov2c1 = fIntFlowCovariancesNUA->GetBinContent(1); | |
8964 | Double_t wCov2s1 = fIntFlowCovariancesNUA->GetBinContent(2); | |
8965 | Double_t wCovc1s1 = fIntFlowCovariancesNUA->GetBinContent(3); | |
8966 | Double_t wCov2c2 = fIntFlowCovariancesNUA->GetBinContent(4); | |
8967 | Double_t wCov2s2 = fIntFlowCovariancesNUA->GetBinContent(5); | |
8968 | Double_t wCov2c3 = fIntFlowCovariancesNUA->GetBinContent(6); | |
8969 | Double_t wCov2s3 = fIntFlowCovariancesNUA->GetBinContent(7); | |
8970 | Double_t wCov4c1 = fIntFlowCovariancesNUA->GetBinContent(8); | |
8971 | Double_t wCov4s1 = fIntFlowCovariancesNUA->GetBinContent(9); | |
8972 | Double_t wCov4c2 = fIntFlowCovariancesNUA->GetBinContent(10); | |
8973 | Double_t wCov4s2 = fIntFlowCovariancesNUA->GetBinContent(11); | |
8974 | Double_t wCov4c3 = fIntFlowCovariancesNUA->GetBinContent(12); | |
8975 | Double_t wCov4s3 = fIntFlowCovariancesNUA->GetBinContent(13); | |
8976 | Double_t wCovc1c2 = fIntFlowCovariancesNUA->GetBinContent(14); | |
8977 | Double_t wCovc1s2 = fIntFlowCovariancesNUA->GetBinContent(15); | |
8978 | Double_t wCovc1c3 = fIntFlowCovariancesNUA->GetBinContent(16); | |
8979 | Double_t wCovc1s3 = fIntFlowCovariancesNUA->GetBinContent(17); | |
8980 | Double_t wCovs1c2 = fIntFlowCovariancesNUA->GetBinContent(18); | |
8981 | Double_t wCovs1s2 = fIntFlowCovariancesNUA->GetBinContent(19); | |
8982 | Double_t wCovs1c3 = fIntFlowCovariancesNUA->GetBinContent(20); | |
8983 | Double_t wCovs1s3 = fIntFlowCovariancesNUA->GetBinContent(21); | |
8984 | Double_t wCovc2s2 = fIntFlowCovariancesNUA->GetBinContent(22); | |
8985 | Double_t wCovc2c3 = fIntFlowCovariancesNUA->GetBinContent(23); | |
8986 | Double_t wCovc2s3 = fIntFlowCovariancesNUA->GetBinContent(24); | |
8987 | Double_t wCovs2c3 = fIntFlowCovariancesNUA->GetBinContent(25); | |
8988 | Double_t wCovs2s3 = fIntFlowCovariancesNUA->GetBinContent(26); | |
8989 | Double_t wCovc3s3 = fIntFlowCovariancesNUA->GetBinContent(27); | |
8990 | */ | |
8991 | ||
8992 | /* | |
8993 | // 2nd order: | |
8994 | Double_t err2ndSquared = (1./(4.*pow(v2,2.))) | |
8995 | * (pow(twoError,2.)+4.*pow(s1*s1Error,2.)+4.*pow(c1*c1Error,2.) | |
8996 | // to be improved (add eventually also covariance terms) | |
8997 | //- 4.*c1*wCov2c1-4.*s1*wCov2s1+8.*c1*s1*wCovc1s1 | |
8998 | ); | |
8999 | if(err2ndSquared>=0.) | |
9000 | { | |
9001 | fIntFlow->SetBinError(1,pow(err2ndSquared,0.5)); // to be improved (enabled eventually) | |
9002 | } else | |
9003 | { | |
9004 | cout<<"WARNING: Statistical error of v{2,QC} (with non-isotropic terms included) is imaginary !!!! "<<endl; | |
9005 | } | |
9006 | // 4th order: | |
9007 | Double_t err4thSquared = (1./(16.*pow(v4,6.))) | |
9008 | * (pow(4.*pow(two,2.)-8.*(pow(c1,2.)+pow(s1,2.)),2.)*pow(twoError,2.) | |
9009 | + pow(fourError,2.) | |
9010 | + 16.*pow(6.*pow(c1,3.)-2.*c1*c2+c3+6.*c1*pow(s1,2.)-2.*s1*s2-4.*c1*two,2.)*pow(c1Error,2.) | |
9011 | + 16.*pow(6.*pow(c1,2.)*s1+2.*c2*s1+6.*pow(s1,3.)-2.*c1*s2-s3-4.*s1*two,2.)*pow(s1Error,2.) | |
9012 | + 4.*pow(c2-2.*(pow(c1,2.)-pow(s1,2.)),2.)*pow(c2Error,2.) | |
9013 | + 4.*pow(4*c1*s1-s2,2.)*pow(s2Error,2.) | |
9014 | + 16.*pow(c1,2.)*pow(c3Error,2.) | |
9015 | + 16.*pow(s1,2.)*pow(s3Error,2.) | |
9016 | // to be improved (add eventually also covariance terms) | |
9017 | // ... | |
9018 | ); | |
9019 | if(err4thSquared>=0.) | |
9020 | { | |
9021 | fIntFlow->SetBinError(2,pow(err4thSquared,0.5)); // to be improved (enabled eventually) | |
9022 | } else | |
9023 | { | |
9024 | cout<<"WARNING: Statistical error of v{4,QC} (with non-isotropic terms included) is imaginary !!!! "<<endl; | |
9025 | } | |
9026 | */ | |
9027 | ||
489d5531 | 9028 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectedForNUA() |
9029 | ||
9030 | ||
9031 | //================================================================================================================================ | |
9032 | ||
9033 | ||
9034 | void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUAIntFlow() | |
9035 | { | |
0328db2d | 9036 | // From profile fIntFlowCorrectionTermsForNUAPro[sc] access measured correction terms for NUA |
489d5531 | 9037 | // and their spread, correctly calculate the statistical errors and store the final |
0328db2d | 9038 | // results and statistical errors for correction terms for NUA in histogram fIntFlowCorrectionTermsForNUAHist[sc]. |
489d5531 | 9039 | // |
9040 | // Remark: Statistical error of correction temrs is calculated as: | |
9041 | // | |
9042 | // statistical error = termA * spread * termB: | |
9043 | // termA = sqrt{sum_{i=1}^{N} w^2}/(sum_{i=1}^{N} w) | |
9044 | // termB = 1/sqrt(1-termA^2) | |
9045 | ||
489d5531 | 9046 | for(Int_t sc=0;sc<2;sc++) // sin or cos correction terms |
9047 | { | |
0328db2d | 9048 | for(Int_t ci=1;ci<=3;ci++) // correction term index |
489d5531 | 9049 | { |
9050 | Double_t correction = fIntFlowCorrectionTermsForNUAPro[sc]->GetBinContent(ci); | |
0328db2d | 9051 | Double_t spread = fIntFlowCorrectionTermsForNUAPro[sc]->GetBinError(ci); |
9052 | Double_t sumOfLinearEventWeights = fIntFlowSumOfEventWeightsNUA[sc][0]->GetBinContent(ci); | |
9053 | Double_t sumOfQuadraticEventWeights = fIntFlowSumOfEventWeightsNUA[sc][1]->GetBinContent(ci); | |
9054 | Double_t termA = 0.; | |
9055 | Double_t termB = 0.; | |
9056 | if(sumOfLinearEventWeights) | |
9057 | { | |
9058 | termA = pow(sumOfQuadraticEventWeights,0.5)/sumOfLinearEventWeights; | |
9059 | } else | |
9060 | { | |
9061 | cout<<"WARNING: sumOfLinearEventWeights == 0 in AFAWQC::FCTFNIF() !!!!"<<endl; | |
9062 | cout<<" (for "<<ci<<"-th correction term)"<<endl; | |
9063 | } | |
489d5531 | 9064 | if(1.-pow(termA,2.) > 0.) |
9065 | { | |
9066 | termB = 1./pow(1-pow(termA,2.),0.5); | |
9067 | } else | |
9068 | { | |
0328db2d | 9069 | cout<<"WARNING: 1.-pow(termA,2.) <= 0 in AFAWQC::FCTFNIF() !!!!"<<endl; |
9070 | cout<<" (for "<<ci<<"-th correction term)"<<endl; | |
489d5531 | 9071 | } |
9072 | Double_t statisticalError = termA * spread * termB; | |
489d5531 | 9073 | fIntFlowCorrectionTermsForNUAHist[sc]->SetBinContent(ci,correction); |
0328db2d | 9074 | fIntFlowCorrectionTermsForNUAHist[sc]->SetBinError(ci,statisticalError); |
489d5531 | 9075 | } // end of for(Int_t ci=1;ci<=10;ci++) // correction term index |
9076 | } // end of for(Int sc=0;sc<2;sc++) // sin or cos correction terms | |
9077 | ||
9078 | } // end of void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUAIntFlow() | |
9079 | ||
9080 | ||
9081 | //================================================================================================================================ | |
9082 | ||
9083 | ||
9084 | void AliFlowAnalysisWithQCumulants::GetPointersForNestedLoopsHistograms() | |
9085 | { | |
9086 | // Get pointers to all objects relevant for calculations with nested loops. | |
9087 | ||
9088 | TList *nestedLoopsList = dynamic_cast<TList*>(fHistList->FindObject("Nested Loops")); | |
9089 | if(nestedLoopsList) | |
9090 | { | |
9091 | this->SetNestedLoopsList(nestedLoopsList); | |
9092 | } else | |
9093 | { | |
9094 | cout<<"WARNING: nestedLoopsList is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
9095 | exit(0); | |
9096 | } | |
9097 | ||
9098 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?) | |
9099 | TString typeFlag[2] = {"RP","POI"}; // to be improved (should I promote this to data members?) | |
9100 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; // to be improved (should I promote this to data members?) | |
9101 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; // to be improved (should I promote this to data members?) | |
9102 | ||
9103 | TString evaluateNestedLoopsName = "fEvaluateNestedLoops"; | |
9104 | evaluateNestedLoopsName += fAnalysisLabel->Data(); | |
9105 | TProfile *evaluateNestedLoops = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(evaluateNestedLoopsName.Data())); | |
9106 | Bool_t bEvaluateIntFlowNestedLoops = kFALSE; | |
9107 | Bool_t bEvaluateDiffFlowNestedLoops = kFALSE; | |
9108 | if(evaluateNestedLoops) | |
9109 | { | |
9110 | this->SetEvaluateNestedLoops(evaluateNestedLoops); | |
9111 | bEvaluateIntFlowNestedLoops = (Int_t)evaluateNestedLoops->GetBinContent(1); | |
9112 | bEvaluateDiffFlowNestedLoops = (Int_t)evaluateNestedLoops->GetBinContent(2); | |
9113 | } | |
9114 | // nested loops relevant for integrated flow: | |
9115 | if(bEvaluateIntFlowNestedLoops) | |
9116 | { | |
9117 | // correlations: | |
9118 | TString intFlowDirectCorrelationsName = "fIntFlowDirectCorrelations"; | |
9119 | intFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
9120 | TProfile *intFlowDirectCorrelations = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(intFlowDirectCorrelationsName.Data())); | |
9121 | if(intFlowDirectCorrelations) | |
9122 | { | |
9123 | this->SetIntFlowDirectCorrelations(intFlowDirectCorrelations); | |
9124 | } else | |
9125 | { | |
9126 | cout<<"WARNING: intFlowDirectCorrelations is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
9127 | exit(0); | |
9128 | } | |
9129 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
9130 | { | |
9131 | TString intFlowExtraDirectCorrelationsName = "fIntFlowExtraDirectCorrelations"; | |
9132 | intFlowExtraDirectCorrelationsName += fAnalysisLabel->Data(); | |
9133 | TProfile *intFlowExtraDirectCorrelations = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(intFlowExtraDirectCorrelationsName.Data())); | |
9134 | if(intFlowExtraDirectCorrelations) | |
9135 | { | |
9136 | this->SetIntFlowExtraDirectCorrelations(intFlowExtraDirectCorrelations); | |
9137 | } else | |
9138 | { | |
9139 | cout<<"WARNING: intFlowExtraDirectCorrelations is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
9140 | exit(0); | |
9141 | } | |
9142 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
9143 | // correction terms for non-uniform acceptance: | |
9144 | TString intFlowDirectCorrectionTermsForNUAName = "fIntFlowDirectCorrectionTermsForNUA"; | |
9145 | intFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
9146 | TProfile *intFlowDirectCorrectionTermsForNUA[2] = {NULL}; | |
9147 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
9148 | { | |
9149 | intFlowDirectCorrectionTermsForNUA[sc] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s: %s terms",intFlowDirectCorrectionTermsForNUAName.Data(),sinCosFlag[sc].Data()))); | |
9150 | if(intFlowDirectCorrectionTermsForNUA[sc]) | |
9151 | { | |
9152 | this->SetIntFlowDirectCorrectionTermsForNUA(intFlowDirectCorrectionTermsForNUA[sc],sc); | |
9153 | } else | |
9154 | { | |
9155 | cout<<"WARNING: intFlowDirectCorrectionTermsForNUA[sc] is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
9156 | cout<<"sc = "<<sc<<endl; | |
9157 | exit(0); | |
9158 | } | |
9159 | } // end of for(Int_t sc=0;sc<2;sc++) | |
9160 | } // end of if(bEvaluateIntFlowNestedLoops) | |
9161 | ||
9162 | // nested loops relevant for differential flow: | |
9163 | if(bEvaluateDiffFlowNestedLoops) | |
9164 | { | |
9165 | // correlations: | |
9166 | TString diffFlowDirectCorrelationsName = "fDiffFlowDirectCorrelations"; | |
9167 | diffFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
9168 | TProfile *diffFlowDirectCorrelations[2][2][4] = {{{NULL}}}; | |
9169 | for(Int_t t=0;t<2;t++) | |
9170 | { | |
9171 | for(Int_t pe=0;pe<2;pe++) | |
9172 | { | |
9173 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
9174 | { | |
9175 | diffFlowDirectCorrelations[t][pe][ci] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[ci].Data()))); | |
9176 | if(diffFlowDirectCorrelations[t][pe][ci]) | |
9177 | { | |
9178 | this->SetDiffFlowDirectCorrelations(diffFlowDirectCorrelations[t][pe][ci],t,pe,ci); | |
9179 | } else | |
9180 | { | |
9181 | cout<<"WARNING: diffFlowDirectCorrelations[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9182 | cout<<"t = "<<t<<endl; | |
9183 | cout<<"pe = "<<pe<<endl; | |
9184 | cout<<"ci = "<<ci<<endl; | |
9185 | } | |
9186 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
9187 | } // end of for(Int_t pe=0;pe<2;pe++) | |
9188 | } // end of for(Int_t t=0;t<2;t++) | |
9189 | // correction terms for non-uniform acceptance: | |
9190 | TString diffFlowDirectCorrectionTermsForNUAName = "fDiffFlowDirectCorrectionTermsForNUA"; | |
9191 | diffFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
9192 | TProfile *diffFlowDirectCorrectionTermsForNUA[2][2][2][10] = {{{{NULL}}}}; | |
9193 | for(Int_t t=0;t<2;t++) | |
9194 | { | |
9195 | for(Int_t pe=0;pe<2;pe++) | |
9196 | { | |
9197 | // correction terms for NUA: | |
9198 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9199 | { | |
9200 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
9201 | { | |
9202 | diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1))); | |
9203 | if(diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]) | |
9204 | { | |
9205 | this->SetDiffFlowDirectCorrectionTermsForNUA(diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti],t,pe,sc,cti); | |
9206 | } else | |
9207 | { | |
9208 | cout<<"WARNING: diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9209 | cout<<"t = "<<t<<endl; | |
9210 | cout<<"pe = "<<pe<<endl; | |
9211 | cout<<"sc = "<<sc<<endl; | |
9212 | cout<<"cti = "<<cti<<endl; | |
9213 | } | |
9214 | } // end of for(Int_t cti=0;cti<9;cti++) // correction term index | |
9215 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9216 | } // end of for(Int_t pe=0;pe<2;pe++) | |
9217 | } // end of for(Int_t t=0;t<2;t++) | |
9218 | // number of RPs and POIs in selected pt and eta bins for cross-checkings: | |
9219 | TString noOfParticlesInBinName = "fNoOfParticlesInBin"; | |
9220 | TH1D *noOfParticlesInBin = NULL; | |
9221 | noOfParticlesInBin = dynamic_cast<TH1D*>(nestedLoopsList->FindObject(noOfParticlesInBinName.Data())); | |
9222 | if(noOfParticlesInBin) | |
9223 | { | |
9224 | this->SetNoOfParticlesInBin(noOfParticlesInBin); | |
9225 | } else | |
9226 | { | |
9227 | cout<<endl; | |
9228 | cout<<" WARNING (QC): noOfParticlesInBin is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9229 | cout<<endl; | |
9230 | } | |
9231 | } // end of if(bEvaluateDiffFlowNestedLoops) | |
9232 | ||
9233 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForNestedLoopsHistograms() | |
9234 | ||
9235 | ||
9236 | //================================================================================================================================ | |
9237 | ||
9238 | ||
9239 | void AliFlowAnalysisWithQCumulants::StoreHarmonic() | |
9240 | { | |
9241 | // Store flow harmonic in common control histograms. | |
9242 | ||
9243 | (fCommonHists->GetHarmonic())->Fill(0.5,fHarmonic); | |
9244 | (fCommonHists2nd->GetHarmonic())->Fill(0.5,fHarmonic); | |
9245 | (fCommonHists4th->GetHarmonic())->Fill(0.5,fHarmonic); | |
9246 | (fCommonHists6th->GetHarmonic())->Fill(0.5,fHarmonic); | |
9247 | (fCommonHists8th->GetHarmonic())->Fill(0.5,fHarmonic); | |
9248 | ||
9249 | } // end of void AliFlowAnalysisWithQCumulants::StoreHarmonic() | |
9250 | ||
9251 | ||
9252 | //================================================================================================================================ | |
9253 | ||
9254 | ||
9255 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelationsUsingParticleWeights(TString type, TString ptOrEta) // type = RP or POI | |
9256 | { | |
9257 | // Calculate all correlations needed for differential flow using particle weights. | |
9258 | ||
9259 | Int_t t = -1; // type flag | |
9260 | Int_t pe = -1; // ptEta flag | |
9261 | ||
9262 | if(type == "RP") | |
9263 | { | |
9264 | t = 0; | |
9265 | } else if(type == "POI") | |
9266 | { | |
9267 | t = 1; | |
9268 | } | |
9269 | ||
9270 | if(ptOrEta == "Pt") | |
9271 | { | |
9272 | pe = 0; | |
9273 | } else if(ptOrEta == "Eta") | |
9274 | { | |
9275 | pe = 1; | |
9276 | } | |
9277 | ||
9278 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
9279 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
9280 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
9281 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
9282 | ||
9283 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
9284 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
9285 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
9286 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
9287 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
9288 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
9289 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
9290 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
9291 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
9292 | ||
9293 | // S^M_{p,k} (see .h file for the definition of fSMpk): | |
9294 | Double_t dSM1p1k = (*fSMpk)(0,1); | |
9295 | Double_t dSM1p2k = (*fSMpk)(0,2); | |
9296 | Double_t dSM1p3k = (*fSMpk)(0,3); | |
9297 | Double_t dSM2p1k = (*fSMpk)(1,1); | |
9298 | Double_t dSM3p1k = (*fSMpk)(2,1); | |
9299 | ||
9300 | // looping over all bins and calculating reduced correlations: | |
9301 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
9302 | { | |
9303 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): | |
9304 | Double_t p1n0kRe = 0.; | |
9305 | Double_t p1n0kIm = 0.; | |
9306 | ||
9307 | // number of POIs in particular (pt,eta) bin): | |
9308 | Double_t mp = 0.; | |
9309 | ||
9310 | // real and imaginary parts of q_{m*n,k}: | |
9311 | // (weighted Q-vector evaluated for particles which are both RPs and POIs in particular (pt,eta) bin) | |
9312 | Double_t q1n2kRe = 0.; | |
9313 | Double_t q1n2kIm = 0.; | |
9314 | Double_t q2n1kRe = 0.; | |
9315 | Double_t q2n1kIm = 0.; | |
9316 | ||
9317 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
9318 | Double_t s1p1k = 0.; | |
9319 | Double_t s1p2k = 0.; | |
9320 | Double_t s1p3k = 0.; | |
9321 | ||
9322 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
9323 | Double_t dM0111 = 0.; | |
9324 | ||
9325 | if(type == "POI") | |
9326 | { | |
9327 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
9328 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
9329 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
9330 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
9331 | ||
9332 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
9333 | ||
9334 | t = 1; // typeFlag = RP or POI | |
9335 | ||
9336 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
9337 | q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
9338 | * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
9339 | q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
9340 | * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
9341 | q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
9342 | * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
9343 | q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
9344 | * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
9345 | ||
9346 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
9347 | s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); | |
9348 | s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); | |
9349 | s1p3k = pow(fs1dEBE[2][pe][3]->GetBinContent(b)*fs1dEBE[2][pe][3]->GetBinEntries(b),1.); | |
9350 | ||
9351 | // M0111 from Eq. (118) in QC2c (to be improved (notation)): | |
9352 | dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k) | |
9353 | - 3.*(s1p1k*(dSM2p1k-dSM1p2k) | |
9354 | + 2.*(s1p3k-s1p2k*dSM1p1k)); | |
9355 | } | |
9356 | else if(type == "RP") | |
9357 | { | |
9358 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
9359 | q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
9360 | * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
9361 | q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
9362 | * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
9363 | q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
9364 | * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
9365 | q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
9366 | * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
9367 | ||
9368 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
9369 | s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); | |
9370 | s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); | |
9371 | s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); | |
9372 | ||
9373 | // to be improved (cross-checked): | |
9374 | p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
9375 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
9376 | p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
9377 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
9378 | ||
9379 | mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
9380 | ||
9381 | t = 0; // typeFlag = RP or POI | |
9382 | ||
9383 | // M0111 from Eq. (118) in QC2c (to be improved (notation)): | |
9384 | dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k) | |
9385 | - 3.*(s1p1k*(dSM2p1k-dSM1p2k) | |
9386 | + 2.*(s1p3k-s1p2k*dSM1p1k)); | |
9387 | //............................................................................................... | |
9388 | } | |
9389 | ||
9390 | // 2'-particle correlation: | |
9391 | Double_t two1n1nW0W1 = 0.; | |
9392 | if(mp*dSM1p1k-s1p1k) | |
9393 | { | |
9394 | two1n1nW0W1 = (p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k-s1p1k) | |
9395 | / (mp*dSM1p1k-s1p1k); | |
9396 | ||
9397 | // fill profile to get <<2'>> | |
9398 | fDiffFlowCorrelationsPro[t][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nW0W1,mp*dSM1p1k-s1p1k); | |
9399 | // histogram to store <2'> e-b-e (needed in some other methods): | |
9400 | fDiffFlowCorrelationsEBE[t][pe][0]->SetBinContent(b,two1n1nW0W1); | |
9401 | fDiffFlowEventWeightsForCorrelationsEBE[t][pe][0]->SetBinContent(b,mp*dSM1p1k-s1p1k); | |
9402 | } // end of if(mp*dSM1p1k-s1p1k) | |
9403 | ||
9404 | // 4'-particle correlation: | |
9405 | Double_t four1n1n1n1nW0W1W1W1 = 0.; | |
9406 | if(dM0111) | |
9407 | { | |
9408 | four1n1n1n1nW0W1W1W1 = ((pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k) | |
9409 | - q2n1kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.)) | |
9410 | - 2.*q2n1kIm*dReQ1n1k*dImQ1n1k | |
9411 | - p1n0kRe*(dReQ1n1k*dReQ2n2k+dImQ1n1k*dImQ2n2k) | |
9412 | + p1n0kIm*(dImQ1n1k*dReQ2n2k-dReQ1n1k*dImQ2n2k) | |
9413 | - 2.*dSM1p2k*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k) | |
9414 | - 2.*(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*s1p1k | |
9415 | + 6.*(q1n2kRe*dReQ1n1k+q1n2kIm*dImQ1n1k) | |
9416 | + 1.*(q2n1kRe*dReQ2n2k+q2n1kIm*dImQ2n2k) | |
9417 | + 2.*(p1n0kRe*dReQ1n3k+p1n0kIm*dImQ1n3k) | |
9418 | + 2.*s1p1k*dSM1p2k | |
9419 | - 6.*s1p3k) | |
9420 | / dM0111; // to be improved (notation of dM0111) | |
9421 | ||
9422 | // fill profile to get <<4'>> | |
9423 | fDiffFlowCorrelationsPro[t][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nW0W1W1W1,dM0111); | |
9424 | // histogram to store <4'> e-b-e (needed in some other methods): | |
9425 | fDiffFlowCorrelationsEBE[t][pe][1]->SetBinContent(b,four1n1n1n1nW0W1W1W1); | |
9426 | fDiffFlowEventWeightsForCorrelationsEBE[t][pe][1]->SetBinContent(b,dM0111); | |
9427 | } // end of if(dM0111) | |
9428 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
9429 | ||
9430 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelationsUsingParticleWeights(TString type, TString ptOrEta); // type = RP or POI | |
9431 | ||
9432 | ||
9433 | //================================================================================================================================ | |
9434 | ||
9435 | ||
9436 | void AliFlowAnalysisWithQCumulants::FillCommonControlHistograms(AliFlowEventSimple *anEvent) | |
9437 | { | |
9438 | // Fill common control histograms. | |
9439 | ||
9440 | Int_t nRP = anEvent->GetEventNSelTracksRP(); // number of RPs (i.e. number of particles used to determine the reaction plane) | |
9441 | fCommonHists->FillControlHistograms(anEvent); | |
9442 | if(nRP>1) | |
9443 | { | |
9444 | fCommonHists2nd->FillControlHistograms(anEvent); | |
9445 | if(nRP>3) | |
9446 | { | |
9447 | fCommonHists4th->FillControlHistograms(anEvent); | |
9448 | if(nRP>5) | |
9449 | { | |
9450 | fCommonHists6th->FillControlHistograms(anEvent); | |
9451 | if(nRP>7) | |
9452 | { | |
9453 | fCommonHists8th->FillControlHistograms(anEvent); | |
9454 | } // end of if(nRP>7) | |
9455 | } // end of if(nRP>5) | |
9456 | } // end of if(nRP>3) | |
9457 | } // end of if(nRP>1) | |
9458 | ||
9459 | } // end of void AliFlowAnalysisWithQCumulants::FillCommonControlHistograms(AliFlowEventSimple *anEvent) | |
9460 | ||
9461 | ||
9462 | //================================================================================================================================ | |
9463 | ||
9464 | ||
9465 | void AliFlowAnalysisWithQCumulants::ResetEventByEventQuantities() | |
9466 | { | |
9467 | // Reset all event by event quantities. | |
9468 | ||
9469 | // integrated flow: | |
9470 | fReQ->Zero(); | |
9471 | fImQ->Zero(); | |
9472 | fSMpk->Zero(); | |
9473 | fIntFlowCorrelationsEBE->Reset(); | |
9474 | fIntFlowEventWeightsForCorrelationsEBE->Reset(); | |
9475 | fIntFlowCorrelationsAllEBE->Reset(); | |
9476 | ||
9477 | if(fApplyCorrectionForNUA) | |
9478 | { | |
9479 | for(Int_t sc=0;sc<2;sc++) | |
9480 | { | |
9481 | fIntFlowCorrectionTermsForNUAEBE[sc]->Reset(); | |
0328db2d | 9482 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc]->Reset(); |
489d5531 | 9483 | } |
9484 | } | |
9485 | ||
9486 | // differential flow: | |
9487 | // 1D: | |
9488 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
9489 | { | |
9490 | for(Int_t pe=0;pe<2;pe++) // 1D in pt or eta | |
9491 | { | |
9492 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
9493 | { | |
9494 | for(Int_t k=0;k<9;k++) // power of weight | |
9495 | { | |
9496 | if(fReRPQ1dEBE[t][pe][m][k]) fReRPQ1dEBE[t][pe][m][k]->Reset(); | |
9497 | if(fImRPQ1dEBE[t][pe][m][k]) fImRPQ1dEBE[t][pe][m][k]->Reset(); | |
9498 | } | |
9499 | } | |
9500 | } | |
9501 | } | |
9502 | ||
9503 | for(Int_t t=0;t<3;t++) // type (0 = RP, 1 = POI, 2 = RP&&POI ) | |
9504 | { | |
9505 | for(Int_t pe=0;pe<2;pe++) // 1D in pt or eta | |
9506 | { | |
9507 | for(Int_t k=0;k<9;k++) | |
9508 | { | |
9509 | if(fs1dEBE[t][pe][k]) fs1dEBE[t][pe][k]->Reset(); | |
9510 | } | |
9511 | } | |
9512 | } | |
9513 | ||
9514 | // e-b-e reduced correlations: | |
9515 | for(Int_t t=0;t<2;t++) // type (0 = RP, 1 = POI) | |
9516 | { | |
9517 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9518 | { | |
9519 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
9520 | { | |
9521 | if(fDiffFlowCorrelationsEBE[t][pe][rci]) fDiffFlowCorrelationsEBE[t][pe][rci]->Reset(); | |
9522 | if(fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci]) fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci]->Reset(); | |
9523 | } | |
9524 | } | |
9525 | } | |
9526 | ||
9527 | // correction terms for NUA: | |
9528 | for(Int_t t=0;t<2;t++) // type (0 = RP, 1 = POI) | |
9529 | { | |
9530 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9531 | { | |
9532 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9533 | { | |
9534 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
9535 | { | |
9536 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti]->Reset(); | |
9537 | } | |
9538 | } | |
9539 | } | |
9540 | } | |
9541 | ||
9542 | // 2D (pt,eta) | |
9543 | if(fCalculate2DFlow) | |
9544 | { | |
9545 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
9546 | { | |
9547 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
9548 | { | |
9549 | for(Int_t k=0;k<9;k++) // power of weight | |
9550 | { | |
9551 | if(fReRPQ2dEBE[t][m][k]) fReRPQ2dEBE[t][m][k]->Reset(); | |
9552 | if(fImRPQ2dEBE[t][m][k]) fImRPQ2dEBE[t][m][k]->Reset(); | |
9553 | } | |
9554 | } | |
9555 | } | |
9556 | for(Int_t t=0;t<3;t++) // type (0 = RP, 1 = POI, 2 = RP&&POI ) | |
9557 | { | |
9558 | for(Int_t k=0;k<9;k++) | |
9559 | { | |
9560 | if(fs2dEBE[t][k]) fs2dEBE[t][k]->Reset(); | |
9561 | } | |
9562 | } | |
9563 | } // end of if(fCalculate2DFlow) | |
9564 | ||
9565 | } // end of void AliFlowAnalysisWithQCumulants::ResetEventByEventQuantities(); | |
9566 | ||
9567 | ||
9568 | //================================================================================================================================ | |
9569 | ||
9570 | ||
9571 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTerms(TString type, TString ptOrEta) | |
9572 | { | |
9573 | // Calculate correction terms for non-uniform acceptance for differential flow (sin terms). | |
9574 | ||
9575 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][0][cti], where cti runs as follows: | |
9576 | // 0: <<sin n(psi1)>> | |
9577 | // 1: <<sin n(psi1+phi2)>> | |
9578 | // 2: <<sin n(psi1+phi2-phi3)>> | |
9579 | // 3: <<sin n(psi1-phi2-phi3)>>: | |
9580 | // 4: | |
9581 | // 5: | |
9582 | // 6: | |
9583 | ||
9584 | // multiplicity: | |
9585 | Double_t dMult = (*fSMpk)(0,0); | |
9586 | ||
9587 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
9588 | Double_t dReQ1n = (*fReQ)(0,0); | |
9589 | Double_t dReQ2n = (*fReQ)(1,0); | |
9590 | //Double_t dReQ3n = (*fReQ)(2,0); | |
9591 | //Double_t dReQ4n = (*fReQ)(3,0); | |
9592 | Double_t dImQ1n = (*fImQ)(0,0); | |
9593 | Double_t dImQ2n = (*fImQ)(1,0); | |
9594 | //Double_t dImQ3n = (*fImQ)(2,0); | |
9595 | //Double_t dImQ4n = (*fImQ)(3,0); | |
9596 | ||
9597 | Int_t t = -1; // type flag | |
9598 | Int_t pe = -1; // ptEta flag | |
9599 | ||
9600 | if(type == "RP") | |
9601 | { | |
9602 | t = 0; | |
9603 | } else if(type == "POI") | |
9604 | { | |
9605 | t = 1; | |
9606 | } | |
9607 | ||
9608 | if(ptOrEta == "Pt") | |
9609 | { | |
9610 | pe = 0; | |
9611 | } else if(ptOrEta == "Eta") | |
9612 | { | |
9613 | pe = 1; | |
9614 | } | |
9615 | ||
9616 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
9617 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
9618 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
9619 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
9620 | ||
9621 | // looping over all bins and calculating correction terms: | |
9622 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
9623 | { | |
9624 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
9625 | Double_t p1n0kRe = 0.; | |
9626 | Double_t p1n0kIm = 0.; | |
9627 | ||
9628 | // number of POIs in particular pt or eta bin: | |
9629 | Double_t mp = 0.; | |
9630 | ||
9631 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
9632 | Double_t q1n0kRe = 0.; | |
9633 | Double_t q1n0kIm = 0.; | |
9634 | Double_t q2n0kRe = 0.; | |
9635 | Double_t q2n0kIm = 0.; | |
9636 | ||
9637 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
9638 | Double_t mq = 0.; | |
9639 | ||
9640 | if(type == "POI") | |
9641 | { | |
9642 | // q_{m*n,0}: | |
9643 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
9644 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
9645 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
9646 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
9647 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
9648 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
9649 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
9650 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
9651 | ||
9652 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
9653 | } | |
9654 | else if(type == "RP") | |
9655 | { | |
9656 | // q_{m*n,0}: | |
9657 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
9658 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
9659 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
9660 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
9661 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
9662 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
9663 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
9664 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
9665 | ||
9666 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
9667 | } | |
9668 | if(type == "POI") | |
9669 | { | |
9670 | // p_{m*n,0}: | |
9671 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
9672 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
9673 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
9674 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
9675 | ||
9676 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
9677 | ||
9678 | t = 1; // typeFlag = RP or POI | |
9679 | } | |
9680 | else if(type == "RP") | |
9681 | { | |
9682 | // p_{m*n,0} = q_{m*n,0}: | |
9683 | p1n0kRe = q1n0kRe; | |
9684 | p1n0kIm = q1n0kIm; | |
9685 | ||
9686 | mp = mq; | |
9687 | ||
9688 | t = 0; // typeFlag = RP or POI | |
9689 | } | |
9690 | ||
9691 | // <<sin n(psi1)>>: | |
9692 | Double_t sinP1nPsi = 0.; | |
9693 | if(mp) | |
9694 | { | |
9695 | sinP1nPsi = p1n0kIm/mp; | |
9696 | // fill profile for <<sin n(psi1)>>: | |
9697 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi,mp); | |
9698 | // histogram to store <sin n(psi1)> e-b-e (needed in some other methods): | |
9699 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][0]->SetBinContent(b,sinP1nPsi); | |
9700 | } // end of if(mp) | |
9701 | ||
9702 | // <<sin n(psi1+phi2)>>: | |
9703 | Double_t sinP1nPsiP1nPhi = 0.; | |
9704 | if(mp*dMult-mq) | |
9705 | { | |
9706 | sinP1nPsiP1nPhi = (p1n0kRe*dImQ1n+p1n0kIm*dReQ1n-q2n0kIm)/(mp*dMult-mq); | |
9707 | // fill profile for <<sin n(psi1+phi2)>>: | |
9708 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsiP1nPhi,mp*dMult-mq); | |
9709 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
9710 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][1]->SetBinContent(b,sinP1nPsiP1nPhi); | |
9711 | } // end of if(mp*dMult-mq) | |
9712 | ||
9713 | // <<sin n(psi1+phi2-phi3)>>: | |
9714 | Double_t sinP1nPsi1P1nPhi2MPhi3 = 0.; | |
9715 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
9716 | { | |
9717 | sinP1nPsi1P1nPhi2MPhi3 = (p1n0kIm*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult) | |
9718 | - 1.*(q2n0kIm*dReQ1n-q2n0kRe*dImQ1n) | |
9719 | - mq*dImQ1n+2.*q1n0kIm) | |
9720 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
9721 | // fill profile for <<sin n(psi1+phi2)>>: | |
9722 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
9723 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
9724 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][2]->SetBinContent(b,sinP1nPsi1P1nPhi2MPhi3); | |
9725 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
9726 | ||
9727 | // <<sin n(psi1-phi2-phi3)>>: | |
9728 | Double_t sinP1nPsi1M1nPhi2MPhi3 = 0.; | |
9729 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
9730 | { | |
9731 | sinP1nPsi1M1nPhi2MPhi3 = (p1n0kIm*(pow(dReQ1n,2.)-pow(dImQ1n,2.))-2.*p1n0kRe*dReQ1n*dImQ1n | |
9732 | - 1.*(p1n0kIm*dReQ2n-p1n0kRe*dImQ2n) | |
9733 | + 2.*mq*dImQ1n-2.*q1n0kIm) | |
9734 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
9735 | // fill profile for <<sin n(psi1+phi2)>>: | |
9736 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
9737 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
9738 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][3]->SetBinContent(b,sinP1nPsi1M1nPhi2MPhi3); | |
9739 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
9740 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
9741 | ||
9742 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTerms(TString type, TString ptOrEta) | |
9743 | ||
9744 | ||
9745 | //================================================================================================================================ | |
9746 | ||
9747 | ||
9748 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTerms(TString type, TString ptOrEta) | |
9749 | { | |
9750 | // Calculate correction terms for non-uniform acceptance for differential flow (cos terms). | |
9751 | ||
9752 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][1][cti], where cti runs as follows: | |
9753 | // 0: <<cos n(psi)>> | |
9754 | // 1: <<cos n(psi1+phi2)>> | |
9755 | // 2: <<cos n(psi1+phi2-phi3)>> | |
9756 | // 3: <<cos n(psi1-phi2-phi3)>> | |
9757 | // 4: | |
9758 | // 5: | |
9759 | // 6: | |
9760 | ||
9761 | // multiplicity: | |
9762 | Double_t dMult = (*fSMpk)(0,0); | |
9763 | ||
9764 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
9765 | Double_t dReQ1n = (*fReQ)(0,0); | |
9766 | Double_t dReQ2n = (*fReQ)(1,0); | |
9767 | //Double_t dReQ3n = (*fReQ)(2,0); | |
9768 | //Double_t dReQ4n = (*fReQ)(3,0); | |
9769 | Double_t dImQ1n = (*fImQ)(0,0); | |
9770 | Double_t dImQ2n = (*fImQ)(1,0); | |
9771 | //Double_t dImQ3n = (*fImQ)(2,0); | |
9772 | //Double_t dImQ4n = (*fImQ)(3,0); | |
9773 | ||
9774 | Int_t t = -1; // type flag | |
9775 | Int_t pe = -1; // ptEta flag | |
9776 | ||
9777 | if(type == "RP") | |
9778 | { | |
9779 | t = 0; | |
9780 | } else if(type == "POI") | |
9781 | { | |
9782 | t = 1; | |
9783 | } | |
9784 | ||
9785 | if(ptOrEta == "Pt") | |
9786 | { | |
9787 | pe = 0; | |
9788 | } else if(ptOrEta == "Eta") | |
9789 | { | |
9790 | pe = 1; | |
9791 | } | |
9792 | ||
9793 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
9794 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
9795 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
9796 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
9797 | ||
9798 | // looping over all bins and calculating correction terms: | |
9799 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
9800 | { | |
9801 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
9802 | Double_t p1n0kRe = 0.; | |
9803 | Double_t p1n0kIm = 0.; | |
9804 | ||
9805 | // number of POIs in particular pt or eta bin: | |
9806 | Double_t mp = 0.; | |
9807 | ||
9808 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
9809 | Double_t q1n0kRe = 0.; | |
9810 | Double_t q1n0kIm = 0.; | |
9811 | Double_t q2n0kRe = 0.; | |
9812 | Double_t q2n0kIm = 0.; | |
9813 | ||
9814 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
9815 | Double_t mq = 0.; | |
9816 | ||
9817 | if(type == "POI") | |
9818 | { | |
9819 | // q_{m*n,0}: | |
9820 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
9821 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
9822 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
9823 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
9824 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
9825 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
9826 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
9827 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
9828 | ||
9829 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
9830 | } | |
9831 | else if(type == "RP") | |
9832 | { | |
9833 | // q_{m*n,0}: | |
9834 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
9835 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
9836 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
9837 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
9838 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
9839 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
9840 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
9841 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
9842 | ||
9843 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
9844 | } | |
9845 | if(type == "POI") | |
9846 | { | |
9847 | // p_{m*n,0}: | |
9848 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
9849 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
9850 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
9851 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
9852 | ||
9853 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
9854 | ||
9855 | t = 1; // typeFlag = RP or POI | |
9856 | } | |
9857 | else if(type == "RP") | |
9858 | { | |
9859 | // p_{m*n,0} = q_{m*n,0}: | |
9860 | p1n0kRe = q1n0kRe; | |
9861 | p1n0kIm = q1n0kIm; | |
9862 | ||
9863 | mp = mq; | |
9864 | ||
9865 | t = 0; // typeFlag = RP or POI | |
9866 | } | |
9867 | ||
9868 | // <<cos n(psi1)>>: | |
9869 | Double_t cosP1nPsi = 0.; | |
9870 | if(mp) | |
9871 | { | |
9872 | cosP1nPsi = p1n0kRe/mp; | |
9873 | ||
9874 | // fill profile for <<cos n(psi1)>>: | |
9875 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi,mp); | |
9876 | // histogram to store <cos n(psi1)> e-b-e (needed in some other methods): | |
9877 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][0]->SetBinContent(b,cosP1nPsi); | |
9878 | } // end of if(mp) | |
9879 | ||
9880 | // <<cos n(psi1+phi2)>>: | |
9881 | Double_t cosP1nPsiP1nPhi = 0.; | |
9882 | if(mp*dMult-mq) | |
9883 | { | |
9884 | cosP1nPsiP1nPhi = (p1n0kRe*dReQ1n-p1n0kIm*dImQ1n-q2n0kRe)/(mp*dMult-mq); | |
9885 | // fill profile for <<sin n(psi1+phi2)>>: | |
9886 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsiP1nPhi,mp*dMult-mq); | |
9887 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
9888 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][1]->SetBinContent(b,cosP1nPsiP1nPhi); | |
9889 | } // end of if(mp*dMult-mq) | |
9890 | ||
9891 | // <<cos n(psi1+phi2-phi3)>>: | |
9892 | Double_t cosP1nPsi1P1nPhi2MPhi3 = 0.; | |
9893 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
9894 | { | |
9895 | cosP1nPsi1P1nPhi2MPhi3 = (p1n0kRe*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult) | |
9896 | - 1.*(q2n0kRe*dReQ1n+q2n0kIm*dImQ1n) | |
9897 | - mq*dReQ1n+2.*q1n0kRe) | |
9898 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
9899 | // fill profile for <<sin n(psi1+phi2)>>: | |
9900 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
9901 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
9902 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][2]->SetBinContent(b,cosP1nPsi1P1nPhi2MPhi3); | |
9903 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
9904 | ||
9905 | // <<cos n(psi1-phi2-phi3)>>: | |
9906 | Double_t cosP1nPsi1M1nPhi2MPhi3 = 0.; | |
9907 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
9908 | { | |
9909 | cosP1nPsi1M1nPhi2MPhi3 = (p1n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.))+2.*p1n0kIm*dReQ1n*dImQ1n | |
9910 | - 1.*(p1n0kRe*dReQ2n+p1n0kIm*dImQ2n) | |
9911 | - 2.*mq*dReQ1n+2.*q1n0kRe) | |
9912 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
9913 | // fill profile for <<sin n(psi1+phi2)>>: | |
9914 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
9915 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
9916 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][3]->SetBinContent(b,cosP1nPsi1M1nPhi2MPhi3); | |
9917 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
9918 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
9919 | ||
9920 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTerms(TString type, TString ptOrEta) | |
9921 | ||
9922 | ||
9923 | //================================================================================================================================== | |
9924 | ||
9925 | ||
9926 | void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUADiffFlow(TString type, TString ptOrEta) | |
9927 | { | |
9928 | // Transfer prolfiles into histogams and correctly propagate the error (to be improved: description) | |
9929 | ||
9930 | // to be improved: debugged - I do not correctly transfer all profiles into histos (bug appears only after merging) | |
9931 | ||
9932 | Int_t t = -1; // type flag | |
9933 | Int_t pe = -1; // ptEta flag | |
9934 | ||
9935 | if(type == "RP") | |
9936 | { | |
9937 | t = 0; | |
9938 | } else if(type == "POI") | |
9939 | { | |
9940 | t = 1; | |
9941 | } | |
9942 | ||
9943 | if(ptOrEta == "Pt") | |
9944 | { | |
9945 | pe = 0; | |
9946 | } else if(ptOrEta == "Eta") | |
9947 | { | |
9948 | pe = 1; | |
9949 | } | |
9950 | ||
9951 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
9952 | //Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
9953 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
9954 | //Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
9955 | ||
9956 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9957 | { | |
9958 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
9959 | { | |
9960 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
9961 | { | |
9962 | Double_t correctionTerm = fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]->GetBinContent(b); | |
9963 | fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]->SetBinContent(b,correctionTerm); | |
9964 | // to be improved (propagate error correctly) | |
9965 | // ... | |
9966 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
9967 | } // correction term index | |
9968 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9969 | ||
9970 | }// end of void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUADiffFlow(TString type, TString ptOrEta) | |
9971 | ||
9972 | ||
9973 | //================================================================================================================================== | |
9974 | ||
9975 | ||
9976 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta) | |
9977 | { | |
9978 | // Calculate generalized differential flow Q-cumulants (corrected for non-uniform acceptance) | |
9979 | ||
9980 | Int_t typeFlag = -1; | |
9981 | Int_t ptEtaFlag = -1; | |
9982 | ||
9983 | if(type == "RP") | |
9984 | { | |
9985 | typeFlag = 0; | |
9986 | } else if(type == "POI") | |
9987 | { | |
9988 | typeFlag = 1; | |
9989 | } | |
9990 | ||
9991 | if(ptOrEta == "Pt") | |
9992 | { | |
9993 | ptEtaFlag = 0; | |
9994 | } else if(ptOrEta == "Eta") | |
9995 | { | |
9996 | ptEtaFlag = 1; | |
9997 | } | |
9998 | ||
9999 | // shortcuts: | |
10000 | Int_t t = typeFlag; | |
10001 | Int_t pe = ptEtaFlag; | |
10002 | ||
10003 | // common: | |
10004 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
10005 | ||
10006 | // 2-particle correlation: | |
10007 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> | |
10008 | // sin term coming from integrated flow: | |
10009 | Double_t sinP1nPhi = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1); // <<sin(n*phi1)>> | |
10010 | Double_t sinP1nPhi1P1nPhi2 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2); // <<sin(n*(phi1+phi2))>> | |
10011 | Double_t sinP1nPhi1M1nPhi2M1nPhi3 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(3); // <<sin(n*(phi1-phi2-phi3))>> | |
10012 | // cos term coming from integrated flow: | |
10013 | Double_t cosP1nPhi = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1); // <<cos(n*phi1)>> | |
10014 | Double_t cosP1nPhi1P1nPhi2 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2); // <<cos(n*(phi1+phi2))>> | |
10015 | Double_t cosP1nPhi1M1nPhi2M1nPhi3 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(3); // <<cos(n*(phi1-phi2-phi3))>> | |
10016 | ||
10017 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10018 | { | |
10019 | Double_t twoPrime = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); // <<2'>> | |
10020 | Double_t fourPrime = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); // <<4'>> | |
10021 | Double_t sinP1nPsi = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][0]->GetBinContent(b); // <<sin n(Psi)>> | |
10022 | Double_t cosP1nPsi = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][0]->GetBinContent(b); // <<cos n(Psi)>> | |
10023 | Double_t sinP1nPsi1P1nPhi2 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][1]->GetBinContent(b); // <<sin n(psi1+phi2)>> | |
10024 | Double_t cosP1nPsi1P1nPhi2 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][1]->GetBinContent(b); // <<cos n(psi1+phi2)>> | |
10025 | Double_t sinP1nPsi1P1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][2]->GetBinContent(b); // <<sin n(psi1+phi2-phi3)>> | |
10026 | Double_t cosP1nPsi1P1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][2]->GetBinContent(b); // <<cos n(psi1+phi2-phi3)>> | |
10027 | Double_t sinP1nPsi1M1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][3]->GetBinContent(b); // <<sin n(psi1-phi2-phi3)>> | |
10028 | Double_t cosP1nPsi1M1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][3]->GetBinContent(b); // <<cos n(psi1-phi2-phi3)>> | |
10029 | // generalized QC{2'}: | |
10030 | Double_t qc2Prime = twoPrime - sinP1nPsi*sinP1nPhi - cosP1nPsi*cosP1nPhi; | |
10031 | fDiffFlowCumulants[t][pe][0]->SetBinContent(b,qc2Prime); | |
10032 | // generalized QC{4'}: | |
10033 | Double_t qc4Prime = fourPrime-2.*twoPrime*two | |
10034 | - cosP1nPsi*cosP1nPhi1M1nPhi2M1nPhi3 | |
10035 | + sinP1nPsi*sinP1nPhi1M1nPhi2M1nPhi3 | |
10036 | - cosP1nPhi*cosP1nPsi1M1nPhi2M1nPhi3 | |
10037 | + sinP1nPhi*sinP1nPsi1M1nPhi2M1nPhi3 | |
10038 | - 2.*cosP1nPhi*cosP1nPsi1P1nPhi2M1nPhi3 | |
10039 | - 2.*sinP1nPhi*sinP1nPsi1P1nPhi2M1nPhi3 | |
10040 | - cosP1nPsi1P1nPhi2*cosP1nPhi1P1nPhi2 | |
10041 | - sinP1nPsi1P1nPhi2*sinP1nPhi1P1nPhi2 | |
10042 | + 2.*cosP1nPhi1P1nPhi2*(cosP1nPsi*cosP1nPhi-sinP1nPsi*sinP1nPhi) | |
10043 | + 2.*sinP1nPhi1P1nPhi2*(cosP1nPsi*sinP1nPhi+sinP1nPsi*cosP1nPhi) | |
10044 | + 4.*two*(cosP1nPsi*cosP1nPhi+sinP1nPsi*sinP1nPhi) | |
10045 | + 2.*cosP1nPsi1P1nPhi2*(pow(cosP1nPhi,2.)-pow(sinP1nPhi,2.)) | |
10046 | + 4.*sinP1nPsi1P1nPhi2*cosP1nPhi*sinP1nPhi | |
10047 | + 4.*twoPrime*(pow(cosP1nPhi,2.)+pow(sinP1nPhi,2.)) | |
10048 | - 6.*(pow(cosP1nPhi,2.)-pow(sinP1nPhi,2.)) | |
10049 | * (cosP1nPsi*cosP1nPhi-sinP1nPsi*sinP1nPhi) | |
10050 | - 12.*cosP1nPhi*sinP1nPhi | |
10051 | * (sinP1nPsi*cosP1nPhi+cosP1nPsi*sinP1nPhi); | |
10052 | fDiffFlowCumulants[t][pe][1]->SetBinContent(b,qc4Prime); | |
10053 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
10054 | ||
10055 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta) | |
10056 | ||
10057 | ||
10058 | //================================================================================================================================== | |
10059 | ||
10060 | ||
10061 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta) | |
10062 | { | |
10063 | // Calculate differential flow corrected for non-uniform acceptance. | |
10064 | ||
10065 | // to be improved (rewritten completely) | |
10066 | ||
10067 | Int_t typeFlag = -1; | |
10068 | Int_t ptEtaFlag = -1; | |
10069 | ||
10070 | if(type == "RP") | |
10071 | { | |
10072 | typeFlag = 0; | |
10073 | } else if(type == "POI") | |
10074 | { | |
10075 | typeFlag = 1; | |
10076 | } | |
10077 | ||
10078 | if(ptOrEta == "Pt") | |
10079 | { | |
10080 | ptEtaFlag = 0; | |
10081 | } else if(ptOrEta == "Eta") | |
10082 | { | |
10083 | ptEtaFlag = 1; | |
10084 | } | |
10085 | ||
10086 | // shortcuts: | |
10087 | Int_t t = typeFlag; | |
10088 | Int_t pe = ptEtaFlag; | |
10089 | ||
10090 | // common: | |
10091 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
10092 | ||
10093 | // to be improved: access here generalized QC{2} and QC{4} instead: | |
10094 | Double_t dV2 = fIntFlow->GetBinContent(1); | |
10095 | Double_t dV4 = fIntFlow->GetBinContent(2); | |
10096 | ||
10097 | // loop over pt or eta bins: | |
10098 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10099 | { | |
10100 | // generalized QC{2'}: | |
10101 | Double_t gQC2Prime = fDiffFlowCumulants[t][pe][0]->GetBinContent(b); | |
10102 | // v'{2}: | |
10103 | if(dV2>0) | |
10104 | { | |
10105 | Double_t v2Prime = gQC2Prime/dV2; | |
10106 | fDiffFlow[t][pe][0]->SetBinContent(b,v2Prime); | |
10107 | } | |
10108 | // generalized QC{4'}: | |
10109 | Double_t gQC4Prime = fDiffFlowCumulants[t][pe][1]->GetBinContent(b); | |
10110 | // v'{4}: | |
10111 | if(dV4>0) | |
10112 | { | |
10113 | Double_t v4Prime = -gQC4Prime/pow(dV4,3.); | |
10114 | fDiffFlow[t][pe][1]->SetBinContent(b,v4Prime); | |
10115 | } | |
10116 | } // end of for(Int_t b=1;b<=fnBinsPtEta[pe];b++) | |
10117 | ||
10118 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta); | |
10119 | ||
10120 | ||
10121 | //================================================================================================================================== | |
10122 | ||
10123 | ||
0328db2d | 10124 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoops(AliFlowEventSimple * const anEvent) |
489d5531 | 10125 | { |
10126 | // Evaluate with nested loops multiparticle correlations for integrated flow (without using the particle weights). | |
10127 | ||
10128 | // Remark: Results are stored in profile fIntFlowDirectCorrelations whose binning is organized as follows: | |
10129 | // | |
10130 | // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))> | |
10131 | // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))> | |
10132 | // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))> | |
10133 | // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))> | |
10134 | // 5th bin: ---- EMPTY ---- | |
10135 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))> | |
10136 | // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))> | |
10137 | // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))> | |
10138 | // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))> | |
10139 | // 10th bin: ---- EMPTY ---- | |
10140 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))> | |
10141 | // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))> | |
10142 | // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))> | |
10143 | // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))> | |
10144 | // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))> | |
10145 | // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))> | |
10146 | // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> | |
10147 | // 18th bin: ---- EMPTY ---- | |
10148 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))> | |
10149 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))> | |
10150 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))> | |
10151 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))> | |
10152 | // 23rd bin: ---- EMPTY ---- | |
10153 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> | |
10154 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))> | |
10155 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))> | |
10156 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))> | |
10157 | // 28th bin: ---- EMPTY ---- | |
10158 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> | |
10159 | // 30th bin: ---- EMPTY ---- | |
10160 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> | |
10161 | ||
10162 | Int_t nPrim = anEvent->NumberOfTracks(); | |
10163 | AliFlowTrackSimple *aftsTrack = NULL; | |
10164 | Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; | |
10165 | Int_t n = fHarmonic; | |
10166 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
10167 | Double_t dMult = (*fSMpk)(0,0); | |
10168 | cout<<endl; | |
10169 | cout<<"Multiparticle correlations: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
10170 | if(dMult<2) | |
10171 | { | |
10172 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
10173 | } else if (dMult>fMaxAllowedMultiplicity) | |
10174 | { | |
10175 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
10176 | } else | |
10177 | { | |
10178 | cout<<"... evaluating nested loops (without using particle weights)..."<<endl; | |
10179 | } | |
10180 | ||
10181 | // 2-particle correlations: | |
10182 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
10183 | { | |
10184 | for(Int_t i1=0;i1<nPrim;i1++) | |
10185 | { | |
10186 | aftsTrack=anEvent->GetTrack(i1); | |
10187 | if(!(aftsTrack->InRPSelection())) continue; | |
10188 | phi1=aftsTrack->Phi(); | |
10189 | for(Int_t i2=0;i2<nPrim;i2++) | |
10190 | { | |
10191 | if(i2==i1)continue; | |
10192 | aftsTrack=anEvent->GetTrack(i2); | |
10193 | if(!(aftsTrack->InRPSelection())) continue; | |
10194 | phi2=aftsTrack->Phi(); | |
10195 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
10196 | // fill the profile with 2-p correlations: | |
10197 | fIntFlowDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),1.); // <cos(n*(phi1-phi2))> | |
10198 | fIntFlowDirectCorrelations->Fill(1.5,cos(2.*n*(phi1-phi2)),1.); // <cos(2n*(phi1-phi2))> | |
10199 | fIntFlowDirectCorrelations->Fill(2.5,cos(3.*n*(phi1-phi2)),1.); // <cos(3n*(phi1-phi2))> | |
10200 | fIntFlowDirectCorrelations->Fill(3.5,cos(4.*n*(phi1-phi2)),1.); // <cos(4n*(phi1-phi2))> | |
10201 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10202 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10203 | } // end of if(nPrim>=2) | |
10204 | ||
10205 | // 3-particle correlations: | |
10206 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
10207 | { | |
10208 | for(Int_t i1=0;i1<nPrim;i1++) | |
10209 | { | |
10210 | aftsTrack=anEvent->GetTrack(i1); | |
10211 | if(!(aftsTrack->InRPSelection())) continue; | |
10212 | phi1=aftsTrack->Phi(); | |
10213 | for(Int_t i2=0;i2<nPrim;i2++) | |
10214 | { | |
10215 | if(i2==i1)continue; | |
10216 | aftsTrack=anEvent->GetTrack(i2); | |
10217 | if(!(aftsTrack->InRPSelection())) continue; | |
10218 | phi2=aftsTrack->Phi(); | |
10219 | for(Int_t i3=0;i3<nPrim;i3++) | |
10220 | { | |
10221 | if(i3==i1||i3==i2)continue; | |
10222 | aftsTrack=anEvent->GetTrack(i3); | |
10223 | if(!(aftsTrack->InRPSelection())) continue; | |
10224 | phi3=aftsTrack->Phi(); | |
10225 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
10226 | // fill the profile with 3-p correlations: | |
10227 | fIntFlowDirectCorrelations->Fill(5.,cos(2.*n*phi1-n*(phi2+phi3)),1.); //<3>_{2n|nn,n} | |
10228 | fIntFlowDirectCorrelations->Fill(6.,cos(3.*n*phi1-2.*n*phi2-n*phi3),1.); //<3>_{3n|2n,n} | |
10229 | fIntFlowDirectCorrelations->Fill(7.,cos(4.*n*phi1-2.*n*phi2-2.*n*phi3),1.); //<3>_{4n|2n,2n} | |
10230 | fIntFlowDirectCorrelations->Fill(8.,cos(4.*n*phi1-3.*n*phi2-n*phi3),1.); //<3>_{4n|3n,n} | |
10231 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10232 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10233 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10234 | } // end of if(nPrim>=3) | |
10235 | ||
10236 | // 4-particle correlations: | |
10237 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) | |
10238 | { | |
10239 | for(Int_t i1=0;i1<nPrim;i1++) | |
10240 | { | |
10241 | aftsTrack=anEvent->GetTrack(i1); | |
10242 | if(!(aftsTrack->InRPSelection())) continue; | |
10243 | phi1=aftsTrack->Phi(); | |
10244 | for(Int_t i2=0;i2<nPrim;i2++) | |
10245 | { | |
10246 | if(i2==i1)continue; | |
10247 | aftsTrack=anEvent->GetTrack(i2); | |
10248 | if(!(aftsTrack->InRPSelection())) continue; | |
10249 | phi2=aftsTrack->Phi(); | |
10250 | for(Int_t i3=0;i3<nPrim;i3++) | |
10251 | { | |
10252 | if(i3==i1||i3==i2)continue; | |
10253 | aftsTrack=anEvent->GetTrack(i3); | |
10254 | if(!(aftsTrack->InRPSelection())) continue; | |
10255 | phi3=aftsTrack->Phi(); | |
10256 | for(Int_t i4=0;i4<nPrim;i4++) | |
10257 | { | |
10258 | if(i4==i1||i4==i2||i4==i3)continue; | |
10259 | aftsTrack=anEvent->GetTrack(i4); | |
10260 | if(!(aftsTrack->InRPSelection())) continue; | |
10261 | phi4=aftsTrack->Phi(); | |
10262 | if(nPrim==4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; | |
10263 | // fill the profile with 4-p correlations: | |
10264 | fIntFlowDirectCorrelations->Fill(10.,cos(n*phi1+n*phi2-n*phi3-n*phi4),1.); // <4>_{n,n|n,n} | |
10265 | fIntFlowDirectCorrelations->Fill(11.,cos(2.*n*phi1+n*phi2-2.*n*phi3-n*phi4),1.); // <4>_{2n,n|2n,n} | |
10266 | fIntFlowDirectCorrelations->Fill(12.,cos(2.*n*phi1+2*n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{2n,2n|2n,2n} | |
10267 | fIntFlowDirectCorrelations->Fill(13.,cos(3.*n*phi1-n*phi2-n*phi3-n*phi4),1.); // <4>_{3n|n,n,n} | |
10268 | fIntFlowDirectCorrelations->Fill(14.,cos(3.*n*phi1+n*phi2-3.*n*phi3-n*phi4),1.); // <4>_{3n,n|3n,n} | |
10269 | fIntFlowDirectCorrelations->Fill(15.,cos(3.*n*phi1+n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{3n,n|2n,2n} | |
10270 | fIntFlowDirectCorrelations->Fill(16.,cos(4.*n*phi1-2.*n*phi2-n*phi3-n*phi4),1.); // <4>_{4n|2n,n,n} | |
10271 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
10272 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10273 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10274 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10275 | } // end of if(nPrim>=) | |
10276 | ||
10277 | // 5-particle correlations: | |
10278 | if(nPrim>=5 && nPrim<=fMaxAllowedMultiplicity) | |
10279 | { | |
10280 | for(Int_t i1=0;i1<nPrim;i1++) | |
10281 | { | |
10282 | aftsTrack=anEvent->GetTrack(i1); | |
10283 | if(!(aftsTrack->InRPSelection())) continue; | |
10284 | phi1=aftsTrack->Phi(); | |
10285 | for(Int_t i2=0;i2<nPrim;i2++) | |
10286 | { | |
10287 | if(i2==i1)continue; | |
10288 | aftsTrack=anEvent->GetTrack(i2); | |
10289 | if(!(aftsTrack->InRPSelection())) continue; | |
10290 | phi2=aftsTrack->Phi(); | |
10291 | for(Int_t i3=0;i3<nPrim;i3++) | |
10292 | { | |
10293 | if(i3==i1||i3==i2)continue; | |
10294 | aftsTrack=anEvent->GetTrack(i3); | |
10295 | if(!(aftsTrack->InRPSelection())) continue; | |
10296 | phi3=aftsTrack->Phi(); | |
10297 | for(Int_t i4=0;i4<nPrim;i4++) | |
10298 | { | |
10299 | if(i4==i1||i4==i2||i4==i3)continue; | |
10300 | aftsTrack=anEvent->GetTrack(i4); | |
10301 | if(!(aftsTrack->InRPSelection())) continue; | |
10302 | phi4=aftsTrack->Phi(); | |
10303 | for(Int_t i5=0;i5<nPrim;i5++) | |
10304 | { | |
10305 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
10306 | aftsTrack=anEvent->GetTrack(i5); | |
10307 | if(!(aftsTrack->InRPSelection())) continue; | |
10308 | phi5=aftsTrack->Phi(); | |
10309 | if(nPrim==5) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<"\r"<<flush; | |
10310 | // fill the profile with 5-p correlations: | |
10311 | fIntFlowDirectCorrelations->Fill(18.,cos(2.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5),1.); //<5>_{2n,n|n,n,n} | |
10312 | fIntFlowDirectCorrelations->Fill(19.,cos(2.*n*phi1+2.*n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); //<5>_{2n,2n|2n,n,n} | |
10313 | fIntFlowDirectCorrelations->Fill(20.,cos(3.*n*phi1+n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); //<5>_{3n,n|2n,n,n} | |
10314 | fIntFlowDirectCorrelations->Fill(21.,cos(4.*n*phi1-n*phi2-n*phi3-n*phi4-n*phi5),1.); //<5>_{4n|n,n,n,n} | |
10315 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
10316 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
10317 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10318 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10319 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10320 | } // end of if(nPrim>=5) | |
10321 | ||
10322 | // 6-particle correlations: | |
10323 | if(nPrim>=6 && nPrim<=fMaxAllowedMultiplicity) | |
10324 | { | |
10325 | for(Int_t i1=0;i1<nPrim;i1++) | |
10326 | { | |
10327 | aftsTrack=anEvent->GetTrack(i1); | |
10328 | if(!(aftsTrack->InRPSelection())) continue; | |
10329 | phi1=aftsTrack->Phi(); | |
10330 | for(Int_t i2=0;i2<nPrim;i2++) | |
10331 | { | |
10332 | if(i2==i1)continue; | |
10333 | aftsTrack=anEvent->GetTrack(i2); | |
10334 | if(!(aftsTrack->InRPSelection())) continue; | |
10335 | phi2=aftsTrack->Phi(); | |
10336 | for(Int_t i3=0;i3<nPrim;i3++) | |
10337 | { | |
10338 | if(i3==i1||i3==i2)continue; | |
10339 | aftsTrack=anEvent->GetTrack(i3); | |
10340 | if(!(aftsTrack->InRPSelection())) continue; | |
10341 | phi3=aftsTrack->Phi(); | |
10342 | for(Int_t i4=0;i4<nPrim;i4++) | |
10343 | { | |
10344 | if(i4==i1||i4==i2||i4==i3)continue; | |
10345 | aftsTrack=anEvent->GetTrack(i4); | |
10346 | if(!(aftsTrack->InRPSelection())) continue; | |
10347 | phi4=aftsTrack->Phi(); | |
10348 | for(Int_t i5=0;i5<nPrim;i5++) | |
10349 | { | |
10350 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
10351 | aftsTrack=anEvent->GetTrack(i5); | |
10352 | if(!(aftsTrack->InRPSelection())) continue; | |
10353 | phi5=aftsTrack->Phi(); | |
10354 | for(Int_t i6=0;i6<nPrim;i6++) | |
10355 | { | |
10356 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
10357 | aftsTrack=anEvent->GetTrack(i6); | |
10358 | if(!(aftsTrack->InRPSelection())) continue; | |
10359 | phi6=aftsTrack->Phi(); | |
10360 | if(nPrim==6) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<"\r"<<flush; | |
10361 | // fill the profile with 6-p correlations: | |
10362 | fIntFlowDirectCorrelations->Fill(23.,cos(n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{n,n,n|n,n,n} | |
10363 | fIntFlowDirectCorrelations->Fill(24.,cos(2.*n*phi1+n*phi2+n*phi3-2.*n*phi4-n*phi5-n*phi6),1.); //<6>_{2n,n,n|2n,n,n} | |
10364 | fIntFlowDirectCorrelations->Fill(25.,cos(2.*n*phi1+2.*n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{2n,2n|n,n,n,n} | |
10365 | fIntFlowDirectCorrelations->Fill(26.,cos(3.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{3n,n|n,n,n,n} | |
10366 | } // end of for(Int_t i6=0;i6<nPrim;i6++) | |
10367 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
10368 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
10369 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10370 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10371 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10372 | } // end of if(nPrim>=6) | |
10373 | ||
10374 | // 7-particle correlations: | |
10375 | if(nPrim>=7 && nPrim<=fMaxAllowedMultiplicity) | |
10376 | { | |
10377 | for(Int_t i1=0;i1<nPrim;i1++) | |
10378 | { | |
10379 | aftsTrack=anEvent->GetTrack(i1); | |
10380 | if(!(aftsTrack->InRPSelection())) continue; | |
10381 | phi1=aftsTrack->Phi(); | |
10382 | for(Int_t i2=0;i2<nPrim;i2++) | |
10383 | { | |
10384 | if(i2==i1)continue; | |
10385 | aftsTrack=anEvent->GetTrack(i2); | |
10386 | if(!(aftsTrack->InRPSelection())) continue; | |
10387 | phi2=aftsTrack->Phi(); | |
10388 | for(Int_t i3=0;i3<nPrim;i3++) | |
10389 | { | |
10390 | if(i3==i1||i3==i2)continue; | |
10391 | aftsTrack=anEvent->GetTrack(i3); | |
10392 | if(!(aftsTrack->InRPSelection())) continue; | |
10393 | phi3=aftsTrack->Phi(); | |
10394 | for(Int_t i4=0;i4<nPrim;i4++) | |
10395 | { | |
10396 | if(i4==i1||i4==i2||i4==i3)continue; | |
10397 | aftsTrack=anEvent->GetTrack(i4); | |
10398 | if(!(aftsTrack->InRPSelection())) continue; | |
10399 | phi4=aftsTrack->Phi(); | |
10400 | for(Int_t i5=0;i5<nPrim;i5++) | |
10401 | { | |
10402 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
10403 | aftsTrack=anEvent->GetTrack(i5); | |
10404 | if(!(aftsTrack->InRPSelection())) continue; | |
10405 | phi5=aftsTrack->Phi(); | |
10406 | for(Int_t i6=0;i6<nPrim;i6++) | |
10407 | { | |
10408 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
10409 | aftsTrack=anEvent->GetTrack(i6); | |
10410 | if(!(aftsTrack->InRPSelection())) continue; | |
10411 | phi6=aftsTrack->Phi(); | |
10412 | for(Int_t i7=0;i7<nPrim;i7++) | |
10413 | { | |
10414 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; | |
10415 | aftsTrack=anEvent->GetTrack(i7); | |
10416 | if(!(aftsTrack->InRPSelection())) continue; | |
10417 | phi7=aftsTrack->Phi(); | |
10418 | if(nPrim==7) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<" "<<i7<<"\r"<<flush; | |
10419 | // fill the profile with 7-p correlation: | |
10420 | fIntFlowDirectCorrelations->Fill(28.,cos(2.*n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6-n*phi7),1.); // <7>_{2n,n,n|n,n,n,n} | |
10421 | } // end of for(Int_t i7=0;i7<nPrim;i7++) | |
10422 | } // end of for(Int_t i6=0;i6<nPrim;i6++) | |
10423 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
10424 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
10425 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10426 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10427 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10428 | } // end of if(nPrim>=7) | |
10429 | ||
10430 | // 8-particle correlations: | |
10431 | if(nPrim>=8 && nPrim<=fMaxAllowedMultiplicity) | |
10432 | { | |
10433 | for(Int_t i1=0;i1<nPrim;i1++) | |
10434 | { | |
10435 | aftsTrack=anEvent->GetTrack(i1); | |
10436 | if(!(aftsTrack->InRPSelection())) continue; | |
10437 | phi1=aftsTrack->Phi(); | |
10438 | for(Int_t i2=0;i2<nPrim;i2++) | |
10439 | { | |
10440 | if(i2==i1)continue; | |
10441 | aftsTrack=anEvent->GetTrack(i2); | |
10442 | if(!(aftsTrack->InRPSelection())) continue; | |
10443 | phi2=aftsTrack->Phi(); | |
10444 | for(Int_t i3=0;i3<nPrim;i3++) | |
10445 | { | |
10446 | if(i3==i1||i3==i2)continue; | |
10447 | aftsTrack=anEvent->GetTrack(i3); | |
10448 | if(!(aftsTrack->InRPSelection())) continue; | |
10449 | phi3=aftsTrack->Phi(); | |
10450 | for(Int_t i4=0;i4<nPrim;i4++) | |
10451 | { | |
10452 | if(i4==i1||i4==i2||i4==i3)continue; | |
10453 | aftsTrack=anEvent->GetTrack(i4); | |
10454 | if(!(aftsTrack->InRPSelection())) continue; | |
10455 | phi4=aftsTrack->Phi(); | |
10456 | for(Int_t i5=0;i5<nPrim;i5++) | |
10457 | { | |
10458 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
10459 | aftsTrack=anEvent->GetTrack(i5); | |
10460 | if(!(aftsTrack->InRPSelection())) continue; | |
10461 | phi5=aftsTrack->Phi(); | |
10462 | for(Int_t i6=0;i6<nPrim;i6++) | |
10463 | { | |
10464 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
10465 | aftsTrack=anEvent->GetTrack(i6); | |
10466 | if(!(aftsTrack->InRPSelection())) continue; | |
10467 | phi6=aftsTrack->Phi(); | |
10468 | for(Int_t i7=0;i7<nPrim;i7++) | |
10469 | { | |
10470 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; | |
10471 | aftsTrack=anEvent->GetTrack(i7); | |
10472 | if(!(aftsTrack->InRPSelection())) continue; | |
10473 | phi7=aftsTrack->Phi(); | |
10474 | for(Int_t i8=0;i8<nPrim;i8++) | |
10475 | { | |
10476 | if(i8==i1||i8==i2||i8==i3||i8==i4||i8==i5||i8==i6||i8==i7)continue; | |
10477 | aftsTrack=anEvent->GetTrack(i8); | |
10478 | if(!(aftsTrack->InRPSelection())) continue; | |
10479 | phi8=aftsTrack->Phi(); | |
10480 | cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<" "<<i7<<" "<<i8<<"\r"<<flush; | |
10481 | // fill the profile with 8-p correlation: | |
10482 | fIntFlowDirectCorrelations->Fill(30.,cos(n*phi1+n*phi2+n*phi3+n*phi4-n*phi5-n*phi6-n*phi7-n*phi8),1.); // <8>_{n,n,n,n|n,n,n,n} | |
10483 | } // end of for(Int_t i8=0;i8<nPrim;i8++) | |
10484 | } // end of for(Int_t i7=0;i7<nPrim;i7++) | |
10485 | } // end of for(Int_t i6=0;i6<nPrim;i6++) | |
10486 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
10487 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
10488 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10489 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10490 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10491 | } // end of if(nPrim>=8) | |
10492 | ||
10493 | cout<<endl; | |
10494 | ||
10495 | } // end of AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent) | |
10496 | ||
10497 | ||
10498 | //================================================================================================================================== | |
10499 | ||
10500 | ||
10501 | void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrelations() | |
10502 | { | |
10503 | // Cross-check results for multiparticle correlations needed for int. flow: results from Q-vectors vs results from nested loops. | |
10504 | ||
10505 | cout<<endl; | |
10506 | cout<<endl; | |
10507 | cout<<" *****************************************"<<endl; | |
10508 | cout<<" **** cross-checking the correlations ****"<<endl; | |
10509 | cout<<" **** for integrated flow ****"<<endl; | |
10510 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
10511 | { | |
10512 | cout<<" **** (particle weights not used) ****"<<endl; | |
10513 | } else | |
10514 | { | |
10515 | cout<<" **** (particle weights used) ****"<<endl; | |
10516 | } | |
10517 | cout<<" *****************************************"<<endl; | |
10518 | cout<<endl; | |
10519 | cout<<endl; | |
10520 | ||
10521 | Int_t ciMax = 32; // to be improved (removed eventually when I calculate 6th and 8th order with particle weights) | |
10522 | ||
10523 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) | |
10524 | { | |
10525 | ciMax = 11; | |
10526 | } | |
10527 | ||
10528 | for(Int_t ci=1;ci<=ciMax;ci++) | |
10529 | { | |
10530 | if(strcmp((fIntFlowCorrelationsAllPro->GetXaxis())->GetBinLabel(ci), "") == 0) continue; // to be improved (access finalized histogram here) | |
10531 | cout<<(fIntFlowCorrelationsAllPro->GetXaxis())->GetBinLabel(ci)<<":"<<endl; // to be improved (access finalized histogram here) | |
10532 | cout<<"from Q-vectors = "<<fIntFlowCorrelationsAllPro->GetBinContent(ci)<<endl; // to be improved (access finalized histogram here) | |
10533 | cout<<"from nested loops = "<<fIntFlowDirectCorrelations->GetBinContent(ci)<<endl; | |
10534 | cout<<endl; | |
10535 | } | |
10536 | ||
10537 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrelations() | |
10538 | ||
10539 | ||
10540 | //================================================================================================================================ | |
10541 | ||
10542 | ||
10543 | void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrectionTermsForNUA() | |
10544 | { | |
10545 | // Cross-check results for corrections terms for non-uniform acceptance needed for int. flow: results from Q-vectors vs results from nested loops. | |
10546 | ||
10547 | cout<<endl; | |
10548 | cout<<endl; | |
10549 | cout<<" *********************************************"<<endl; | |
10550 | cout<<" **** cross-checking the correction terms ****"<<endl; | |
10551 | cout<<" **** for non-uniform acceptance relevant ****"<<endl; | |
10552 | cout<<" **** for integrated flow ****"<<endl; | |
10553 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
10554 | { | |
10555 | cout<<" **** (particle weights not used) ****"<<endl; | |
10556 | } else | |
10557 | { | |
10558 | cout<<" **** (particle weights used) ****"<<endl; | |
10559 | } | |
10560 | cout<<" *********************************************"<<endl; | |
10561 | cout<<endl; | |
10562 | cout<<endl; | |
10563 | ||
10564 | for(Int_t ci=1;ci<=10;ci++) // correction term index | |
10565 | { | |
10566 | for(Int_t sc=0;sc<2;sc++) // sin or cos term | |
10567 | { | |
10568 | if(strcmp((fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->GetBinLabel(ci), "") == 0) continue; // to be improved (access finalized histogram here) | |
10569 | cout<<(fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->GetBinLabel(ci)<<":"<<endl; // to be improved (access finalized histogram here) | |
10570 | cout<<"from Q-vectors = "<<fIntFlowCorrectionTermsForNUAPro[sc]->GetBinContent(ci)<<endl; // to be improved (access finalized histogram here) | |
10571 | cout<<"from nested loops = "<<fIntFlowDirectCorrectionTermsForNUA[sc]->GetBinContent(ci)<<endl; | |
10572 | cout<<endl; | |
10573 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos term | |
10574 | } // end of for(Int_t ci=1;ci<=10;ci++) // correction term index | |
10575 | ||
10576 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrectionTermsForNUA() | |
10577 | ||
10578 | ||
10579 | //================================================================================================================================ | |
10580 | ||
10581 | ||
0328db2d | 10582 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent) |
489d5531 | 10583 | { |
10584 | // Evaluate with nested loops multiparticle correlations for integrated flow (using the particle weights). | |
10585 | ||
10586 | // Results are stored in profile fIntFlowDirectCorrelations. | |
10587 | // Remark 1: When particle weights are used the binning of fIntFlowDirectCorrelations is organized as follows: | |
10588 | // | |
10589 | // 1st bin: <2>_{1n|1n} = two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))> | |
10590 | // 2nd bin: <2>_{2n|2n} = two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
10591 | // 3rd bin: <2>_{3n|3n} = two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
10592 | // 4th bin: <2>_{4n|4n} = two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
10593 | // 5th bin: ---- EMPTY ---- | |
10594 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
10595 | // 7th bin: <3>_{3n|2n,1n} = ... | |
10596 | // 8th bin: <3>_{4n|2n,2n} = ... | |
10597 | // 9th bin: <3>_{4n|3n,1n} = ... | |
10598 | // 10th bin: ---- EMPTY ---- | |
10599 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
10600 | // 12th bin: <4>_{2n,1n|2n,1n} = ... | |
10601 | // 13th bin: <4>_{2n,2n|2n,2n} = ... | |
10602 | // 14th bin: <4>_{3n|1n,1n,1n} = ... | |
10603 | // 15th bin: <4>_{3n,1n|3n,1n} = ... | |
10604 | // 16th bin: <4>_{3n,1n|2n,2n} = ... | |
10605 | // 17th bin: <4>_{4n|2n,1n,1n} = ... | |
10606 | // 18th bin: ---- EMPTY ---- | |
10607 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = ... | |
10608 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = ... | |
10609 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = ... | |
10610 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = ... | |
10611 | // 23rd bin: ---- EMPTY ---- | |
10612 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = ... | |
10613 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = ... | |
10614 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = ... | |
10615 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = ... | |
10616 | // 28th bin: ---- EMPTY ---- | |
10617 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = ... | |
10618 | // 30th bin: ---- EMPTY ---- | |
10619 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = ... | |
57340a27 | 10620 | |
489d5531 | 10621 | // Remark 2: When particle weights are used there are some extra correlations. They are stored in |
10622 | // fIntFlowExtraDirectCorrelations binning of which is organized as follows: | |
57340a27 | 10623 | |
489d5531 | 10624 | // 1st bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))> |
10625 | // 2nd bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
10626 | // ... | |
57340a27 | 10627 | |
489d5531 | 10628 | Int_t nPrim = anEvent->NumberOfTracks(); |
10629 | AliFlowTrackSimple *aftsTrack = NULL; | |
10630 | //Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; | |
10631 | //Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
10632 | Double_t phi1=0., phi2=0., phi3=0., phi4=0.; | |
10633 | Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1.; | |
10634 | Int_t n = fHarmonic; | |
10635 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
10636 | Double_t dMult = (*fSMpk)(0,0); | |
10637 | cout<<endl; | |
10638 | cout<<"Multiparticle correlations: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
10639 | if(dMult<2) | |
10640 | { | |
10641 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
10642 | } else if (dMult>fMaxAllowedMultiplicity) | |
10643 | { | |
10644 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
10645 | } else | |
10646 | { | |
10647 | cout<<"... evaluating nested loops (using particle weights) ..."<<endl; | |
10648 | } | |
10649 | ||
10650 | // 2-particle correlations: | |
10651 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
10652 | { | |
10653 | // 2 nested loops multiparticle correlations using particle weights: | |
10654 | for(Int_t i1=0;i1<nPrim;i1++) | |
10655 | { | |
10656 | aftsTrack=anEvent->GetTrack(i1); | |
10657 | if(!(aftsTrack->InRPSelection())) continue; | |
10658 | phi1=aftsTrack->Phi(); | |
10659 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
10660 | for(Int_t i2=0;i2<nPrim;i2++) | |
10661 | { | |
10662 | if(i2==i1)continue; | |
10663 | aftsTrack=anEvent->GetTrack(i2); | |
10664 | if(!(aftsTrack->InRPSelection())) continue; | |
10665 | phi2=aftsTrack->Phi(); | |
10666 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
10667 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
10668 | // 2-p correlations using particle weights: | |
10669 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),wPhi1*wPhi2); // <w1 w2 cos( n*(phi1-phi2))> | |
10670 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(1.5,cos(2.*n*(phi1-phi2)),pow(wPhi1,2)*pow(wPhi2,2)); // <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
10671 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(2.5,cos(3.*n*(phi1-phi2)),pow(wPhi1,3)*pow(wPhi2,3)); // <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
10672 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(3.5,cos(4.*n*(phi1-phi2)),pow(wPhi1,4)*pow(wPhi2,4)); // <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
10673 | // extra correlations: | |
10674 | // 2-p extra correlations (do not appear if particle weights are not used): | |
10675 | if(fUsePhiWeights) fIntFlowExtraDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),pow(wPhi1,3)*wPhi2); // <w1^3 w2 cos(n*(phi1-phi2))> | |
10676 | // ... | |
10677 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10678 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10679 | } // end of if(nPrim>=2) | |
10680 | ||
10681 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
57340a27 | 10682 | { |
489d5531 | 10683 | // 3 nested loops multiparticle correlations using particle weights: |
10684 | for(Int_t i1=0;i1<nPrim;i1++) | |
57340a27 | 10685 | { |
489d5531 | 10686 | aftsTrack=anEvent->GetTrack(i1); |
10687 | if(!(aftsTrack->InRPSelection())) continue; | |
10688 | phi1=aftsTrack->Phi(); | |
10689 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
10690 | for(Int_t i2=0;i2<nPrim;i2++) | |
10691 | { | |
10692 | if(i2==i1)continue; | |
10693 | aftsTrack=anEvent->GetTrack(i2); | |
10694 | if(!(aftsTrack->InRPSelection())) continue; | |
10695 | phi2=aftsTrack->Phi(); | |
10696 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
10697 | for(Int_t i3=0;i3<nPrim;i3++) | |
10698 | { | |
10699 | if(i3==i1||i3==i2)continue; | |
10700 | aftsTrack=anEvent->GetTrack(i3); | |
10701 | if(!(aftsTrack->InRPSelection())) continue; | |
10702 | phi3=aftsTrack->Phi(); | |
10703 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
10704 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
10705 | // 3-p correlations using particle weights: | |
10706 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(5.5,cos(2.*n*phi1-n*(phi2+phi3)),pow(wPhi1,2)*wPhi2*wPhi3); // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
10707 | // ... | |
10708 | // extra correlations: | |
10709 | // 2-p extra correlations (do not appear if particle weights are not used): | |
10710 | if(fUsePhiWeights) fIntFlowExtraDirectCorrelations->Fill(1.5,cos(n*(phi1-phi2)),wPhi1*wPhi2*pow(wPhi3,2)); // <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
10711 | // ... | |
10712 | // 3-p extra correlations (do not appear if particle weights are not used): | |
10713 | // ... | |
10714 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10715 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10716 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10717 | } // end of if(nPrim>=3) | |
57340a27 | 10718 | |
489d5531 | 10719 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) |
10720 | { | |
10721 | // 4 nested loops multiparticle correlations using particle weights: | |
10722 | for(Int_t i1=0;i1<nPrim;i1++) | |
10723 | { | |
10724 | aftsTrack=anEvent->GetTrack(i1); | |
10725 | if(!(aftsTrack->InRPSelection())) continue; | |
10726 | phi1=aftsTrack->Phi(); | |
10727 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
10728 | for(Int_t i2=0;i2<nPrim;i2++) | |
10729 | { | |
10730 | if(i2==i1)continue; | |
10731 | aftsTrack=anEvent->GetTrack(i2); | |
10732 | if(!(aftsTrack->InRPSelection())) continue; | |
10733 | phi2=aftsTrack->Phi(); | |
10734 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
10735 | for(Int_t i3=0;i3<nPrim;i3++) | |
10736 | { | |
10737 | if(i3==i1||i3==i2)continue; | |
10738 | aftsTrack=anEvent->GetTrack(i3); | |
10739 | if(!(aftsTrack->InRPSelection())) continue; | |
10740 | phi3=aftsTrack->Phi(); | |
10741 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
10742 | for(Int_t i4=0;i4<nPrim;i4++) | |
10743 | { | |
10744 | if(i4==i1||i4==i2||i4==i3)continue; | |
10745 | aftsTrack=anEvent->GetTrack(i4); | |
10746 | if(!(aftsTrack->InRPSelection())) continue; | |
10747 | phi4=aftsTrack->Phi(); | |
10748 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); | |
10749 | if(nPrim>=4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; // to be improved (replace eventually this if statement with if(nPrim==4)) | |
10750 | // 4-p correlations using particle weights: | |
10751 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(10.5,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); | |
10752 | // extra correlations: | |
10753 | // 2-p extra correlations (do not appear if particle weights are not used): | |
10754 | // ... | |
10755 | // 3-p extra correlations (do not appear if particle weights are not used): | |
10756 | // ... | |
10757 | // 4-p extra correlations (do not appear if particle weights are not used): | |
10758 | // ... | |
10759 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
10760 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10761 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10762 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10763 | } // end of if(nPrim>=4) | |
57340a27 | 10764 | |
489d5531 | 10765 | cout<<endl; |
57340a27 | 10766 | |
489d5531 | 10767 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent) |
57340a27 | 10768 | |
489d5531 | 10769 | |
10770 | //================================================================================================================================ | |
10771 | ||
10772 | ||
10773 | void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowExtraCorrelations() | |
57340a27 | 10774 | { |
489d5531 | 10775 | // Cross-check results for extra multiparticle correlations needed for int. flow |
10776 | // which appear only when particle weights are used: results from Q-vectors vs results from nested loops. | |
57340a27 | 10777 | |
489d5531 | 10778 | cout<<endl; |
10779 | cout<<endl; | |
10780 | cout<<" ***********************************************"<<endl; | |
10781 | cout<<" **** cross-checking the extra correlations ****"<<endl; | |
10782 | cout<<" **** for integrated flow ****"<<endl; | |
10783 | cout<<" ***********************************************"<<endl; | |
10784 | cout<<endl; | |
10785 | cout<<endl; | |
10786 | ||
10787 | for(Int_t eci=1;eci<=2;eci++) // to be improved (increased eciMax eventually when I calculate 6th and 8th) | |
57340a27 | 10788 | { |
489d5531 | 10789 | if(strcmp((fIntFlowExtraCorrelationsPro->GetXaxis())->GetBinLabel(eci), "") == 0) continue; |
10790 | cout<<(fIntFlowExtraCorrelationsPro->GetXaxis())->GetBinLabel(eci)<<":"<<endl; | |
10791 | cout<<"from Q-vectors = "<<fIntFlowExtraCorrelationsPro->GetBinContent(eci)<<endl; | |
10792 | cout<<"from nested loops = "<<fIntFlowExtraDirectCorrelations->GetBinContent(eci)<<endl; | |
10793 | cout<<endl; | |
10794 | } | |
57340a27 | 10795 | |
489d5531 | 10796 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowExtraCorrelations() |
57340a27 | 10797 | |
10798 | ||
489d5531 | 10799 | //================================================================================================================================ |
3b552efe | 10800 | |
10801 | ||
0328db2d | 10802 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoops(AliFlowEventSimple * const anEvent) |
489d5531 | 10803 | { |
10804 | // Evaluate with nested loops correction terms for non-uniform acceptance relevant for NONAME integrated flow (to be improved (name)). | |
10805 | // | |
10806 | // Remark: Both sin and cos correction terms are calculated in this method. Sin terms are stored in fIntFlowDirectCorrectionTermsForNUA[0], | |
10807 | // and cos terms in fIntFlowDirectCorrectionTermsForNUA[1]. Binning of fIntFlowDirectCorrectionTermsForNUA[sc] is organized as follows | |
10808 | // (sc stands for either sin or cos): | |
10809 | ||
10810 | // 1st bin: <<sc(n*(phi1))>> | |
10811 | // 2nd bin: <<sc(n*(phi1+phi2))>> | |
10812 | // 3rd bin: <<sc(n*(phi1-phi2-phi3))>> | |
10813 | // 4th bin: <<sc(n*(2phi1-phi2))>> | |
10814 | ||
10815 | Int_t nPrim = anEvent->NumberOfTracks(); | |
10816 | AliFlowTrackSimple *aftsTrack = NULL; | |
10817 | Double_t phi1=0., phi2=0., phi3=0.; | |
10818 | Int_t n = fHarmonic; | |
10819 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
10820 | Double_t dMult = (*fSMpk)(0,0); | |
10821 | cout<<endl; | |
10822 | cout<<"Correction terms for non-uniform acceptance: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
10823 | if(dMult<1) | |
3b552efe | 10824 | { |
489d5531 | 10825 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; |
10826 | } else if (dMult>fMaxAllowedMultiplicity) | |
3b552efe | 10827 | { |
489d5531 | 10828 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; |
10829 | } else | |
10830 | { | |
10831 | cout<<"... evaluating nested loops (without using particle weights)..."<<endl; | |
10832 | } | |
10833 | ||
10834 | if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity) | |
10835 | { | |
10836 | // 1-particle correction terms for non-uniform acceptance: | |
10837 | for(Int_t i1=0;i1<nPrim;i1++) | |
10838 | { | |
10839 | aftsTrack=anEvent->GetTrack(i1); | |
10840 | if(!(aftsTrack->InRPSelection())) continue; | |
10841 | phi1=aftsTrack->Phi(); | |
10842 | if(nPrim==1) cout<<i1<<"\r"<<flush; | |
10843 | // sin terms: | |
10844 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(0.5,sin(n*phi1),1.); // <sin(n*phi1)> | |
10845 | // cos terms: | |
10846 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(0.5,cos(n*phi1),1.); // <cos(n*phi1)> | |
10847 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10848 | } // end of if(nPrim>=1) | |
10849 | ||
10850 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
10851 | { | |
10852 | // 2-particle correction terms for non-uniform acceptance: | |
10853 | for(Int_t i1=0;i1<nPrim;i1++) | |
10854 | { | |
10855 | aftsTrack=anEvent->GetTrack(i1); | |
10856 | if(!(aftsTrack->InRPSelection())) continue; | |
10857 | phi1=aftsTrack->Phi(); | |
10858 | for(Int_t i2=0;i2<nPrim;i2++) | |
3b552efe | 10859 | { |
489d5531 | 10860 | if(i2==i1)continue; |
10861 | aftsTrack=anEvent->GetTrack(i2); | |
10862 | if(!(aftsTrack->InRPSelection())) continue; | |
10863 | phi2=aftsTrack->Phi(); | |
10864 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
10865 | // sin terms: | |
3b552efe | 10866 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(1.5,sin(n*(phi1+phi2)),1.); // <<sin(n*(phi1+phi2))>> |
489d5531 | 10867 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(3.5,sin(n*(2*phi1-phi2)),1.); // <<sin(n*(2*phi1-phi2))>> |
10868 | // cos terms: | |
3b552efe | 10869 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(1.5,cos(n*(phi1+phi2)),1.); // <<cos(n*(phi1+phi2))>> |
489d5531 | 10870 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(3.5,cos(n*(2*phi1-phi2)),1.); // <<cos(n*(2*phi1-phi2))>> |
10871 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10872 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10873 | } // end of if(nPrim>=2) | |
10874 | ||
10875 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
10876 | { | |
10877 | // 3-particle correction terms for non-uniform acceptance: | |
10878 | for(Int_t i1=0;i1<nPrim;i1++) | |
10879 | { | |
10880 | aftsTrack=anEvent->GetTrack(i1); | |
10881 | if(!(aftsTrack->InRPSelection())) continue; | |
10882 | phi1=aftsTrack->Phi(); | |
10883 | for(Int_t i2=0;i2<nPrim;i2++) | |
10884 | { | |
10885 | if(i2==i1)continue; | |
10886 | aftsTrack=anEvent->GetTrack(i2); | |
10887 | if(!(aftsTrack->InRPSelection())) continue; | |
10888 | phi2=aftsTrack->Phi(); | |
10889 | for(Int_t i3=0;i3<nPrim;i3++) | |
10890 | { | |
10891 | if(i3==i1||i3==i2)continue; | |
10892 | aftsTrack=anEvent->GetTrack(i3); | |
10893 | if(!(aftsTrack->InRPSelection())) continue; | |
10894 | phi3=aftsTrack->Phi(); | |
10895 | if(nPrim>=3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; // to be improved (eventually I will change this if statement) | |
10896 | // sin terms: | |
10897 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(2.5,sin(n*(phi1-phi2-phi3)),1.); // <<sin(n*(phi1-phi2-phi3))>> | |
10898 | // cos terms: | |
10899 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(2.5,cos(n*(phi1-phi2-phi3)),1.); // <<cos(n*(phi1-phi2-phi3))>> | |
10900 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
10901 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
10902 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
10903 | } // end of if(nPrim>=3) | |
10904 | ||
10905 | cout<<endl; | |
10906 | } | |
10907 | //================================================================================================================================ | |
0328db2d | 10908 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 10909 | { |
10910 | // Evaluate reduced correlations with nested loops without using the particle weights. | |
10911 | ||
10912 | // Remark 1: Reduced correlations are evaluated in pt bin number fCrossCheckInPtBinNo and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
10913 | // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrelations[t][pe][ci], where indices runs as follows: | |
10914 | // [0=RP,1=POI][0=Pt,1=Eta][0=<2'>,1=<4'>,2=<6'>,3=<8'>] | |
10915 | // Remark 3: <2'> = <cos(n*(psi1-phi2))> | |
10916 | // <4'> = <cos(n*(psi1+phi2-phi3-phi4))> | |
10917 | // ... | |
10918 | ||
10919 | Int_t typeFlag = -1; | |
10920 | Int_t ptEtaFlag = -1; | |
10921 | if(type == "RP") | |
10922 | { | |
10923 | typeFlag = 0; | |
10924 | } else if(type == "POI") | |
10925 | { | |
10926 | typeFlag = 1; | |
10927 | } | |
10928 | if(ptOrEta == "Pt") | |
10929 | { | |
10930 | ptEtaFlag = 0; | |
10931 | } else if(ptOrEta == "Eta") | |
10932 | { | |
10933 | ptEtaFlag = 1; | |
10934 | } | |
10935 | // shortcuts: | |
10936 | Int_t t = typeFlag; | |
10937 | Int_t pe = ptEtaFlag; | |
10938 | ||
10939 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
10940 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
10941 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
10942 | ||
10943 | Int_t nPrim = anEvent->NumberOfTracks(); | |
10944 | AliFlowTrackSimple *aftsTrack = NULL; | |
10945 | ||
10946 | Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
10947 | ||
3b552efe | 10948 | Int_t n = fHarmonic; |
489d5531 | 10949 | |
10950 | // 2'-particle correlations: | |
10951 | for(Int_t i1=0;i1<nPrim;i1++) | |
10952 | { | |
10953 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 10954 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
10955 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 10956 | { |
10957 | if(ptOrEta == "Pt") | |
10958 | { | |
10959 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
10960 | } else if (ptOrEta == "Eta") | |
10961 | { | |
10962 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 10963 | } |
10964 | } else // this is diff flow of RPs | |
10965 | { | |
489d5531 | 10966 | if(ptOrEta == "Pt") |
10967 | { | |
10968 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
10969 | } else if (ptOrEta == "Eta") | |
10970 | { | |
10971 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 10972 | } |
10973 | } | |
489d5531 | 10974 | |
10975 | psi1=aftsTrack->Phi(); | |
10976 | for(Int_t i2=0;i2<nPrim;i2++) | |
10977 | { | |
10978 | if(i2==i1)continue; | |
10979 | aftsTrack=anEvent->GetTrack(i2); | |
10980 | // RP condition (!(first) particle in the correlator must be RP): | |
10981 | if(!(aftsTrack->InRPSelection()))continue; | |
10982 | phi2=aftsTrack->Phi(); | |
10983 | // 2'-particle correlations: | |
10984 | fDiffFlowDirectCorrelations[t][pe][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(1.*n*(psi1-phi2)),1.); // <cos(n*(psi1-phi2)) | |
10985 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
10986 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
10987 | ||
10988 | /* | |
10989 | ||
10990 | // 3'-particle correlations: | |
10991 | for(Int_t i1=0;i1<nPrim;i1++) | |
10992 | { | |
10993 | aftsTrack=anEvent->GetTrack(i1); | |
10994 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
10995 | if(ptOrEta == "Pt") | |
10996 | { | |
10997 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
10998 | } else if (ptOrEta == "Eta") | |
10999 | { | |
11000 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11001 | } | |
11002 | psi1=aftsTrack->Phi(); | |
11003 | for(Int_t i2=0;i2<nPrim;i2++) | |
11004 | { | |
11005 | if(i2==i1)continue; | |
11006 | aftsTrack=anEvent->GetTrack(i2); | |
11007 | // RP condition (!(first) particle in the correlator must be RP): | |
11008 | if(!(aftsTrack->InRPSelection())) continue; | |
11009 | phi2=aftsTrack->Phi(); | |
11010 | for(Int_t i3=0;i3<nPrim;i3++) | |
11011 | { | |
11012 | if(i3==i1||i3==i2)continue; | |
11013 | aftsTrack=anEvent->GetTrack(i3); | |
11014 | // RP condition (!(first) particle in the correlator must be RP): | |
11015 | if(!(aftsTrack->InRPSelection())) continue; | |
11016 | phi3=aftsTrack->Phi(); | |
11017 | // to be improved : where to store it? ->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(2.*phi1-phi2-phi3)),1.); // <w1 w2 w3 cos(n(2psi1-phi2-phi3))> | |
11018 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
11019 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
11020 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11021 | ||
11022 | */ | |
11023 | ||
11024 | // 4'-particle correlations: | |
11025 | for(Int_t i1=0;i1<nPrim;i1++) | |
11026 | { | |
11027 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 11028 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
11029 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11030 | { |
11031 | if(ptOrEta == "Pt") | |
11032 | { | |
11033 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11034 | } else if (ptOrEta == "Eta") | |
11035 | { | |
11036 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11037 | } |
11038 | } else // this is diff flow of RPs | |
11039 | { | |
489d5531 | 11040 | if(ptOrEta == "Pt") |
11041 | { | |
11042 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11043 | } else if (ptOrEta == "Eta") | |
11044 | { | |
11045 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11046 | } |
11047 | } | |
489d5531 | 11048 | |
11049 | psi1=aftsTrack->Phi(); | |
11050 | for(Int_t i2=0;i2<nPrim;i2++) | |
11051 | { | |
11052 | if(i2==i1) continue; | |
11053 | aftsTrack=anEvent->GetTrack(i2); | |
11054 | // RP condition (!(first) particle in the correlator must be RP): | |
11055 | if(!(aftsTrack->InRPSelection())) continue; | |
11056 | phi2=aftsTrack->Phi(); | |
11057 | for(Int_t i3=0;i3<nPrim;i3++) | |
11058 | { | |
11059 | if(i3==i1||i3==i2) continue; | |
11060 | aftsTrack=anEvent->GetTrack(i3); | |
11061 | // RP condition (!(first) particle in the correlator must be RP): | |
11062 | if(!(aftsTrack->InRPSelection())) continue; | |
11063 | phi3=aftsTrack->Phi(); | |
11064 | for(Int_t i4=0;i4<nPrim;i4++) | |
11065 | { | |
11066 | if(i4==i1||i4==i2||i4==i3) continue; | |
11067 | aftsTrack=anEvent->GetTrack(i4); | |
11068 | // RP condition (!(first) particle in the correlator must be RP): | |
11069 | if(!(aftsTrack->InRPSelection())) continue; | |
11070 | phi4=aftsTrack->Phi(); | |
11071 | // 4'-particle correlations: | |
11072 | fDiffFlowDirectCorrelations[t][pe][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3-phi4)),1.); // <cos(n(psi1+phi2-phi3-phi4))> | |
11073 | }//end of for(Int_t i4=0;i4<nPrim;i4++) | |
11074 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
11075 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
11076 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11077 | ||
11078 | // count # of RPs and POIs in selected pt and eta bins for cross-checkings: | |
3b552efe | 11079 | for(Int_t i=0;i<nPrim;i++) |
11080 | { | |
11081 | aftsTrack=anEvent->GetTrack(i); | |
11082 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
11083 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11084 | { |
11085 | if(ptOrEta == "Pt") | |
11086 | { | |
11087 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11088 | } else if (ptOrEta == "Eta") | |
11089 | { | |
11090 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11091 | } |
11092 | } else // this is diff flow of RPs | |
11093 | { | |
489d5531 | 11094 | if(ptOrEta == "Pt") |
11095 | { | |
11096 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11097 | } else if (ptOrEta == "Eta") | |
11098 | { | |
11099 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11100 | } |
11101 | } | |
11102 | if(t==1)t++; | |
11103 | fNoOfParticlesInBin->Fill(t+pe+0.5); | |
489d5531 | 11104 | } |
11105 | ||
11106 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
11107 | ||
11108 | ||
11109 | //================================================================================================================================ | |
11110 | ||
11111 | ||
11112 | void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrelations(TString type, TString ptOrEta) | |
11113 | { | |
11114 | // Compare correlations needed for diff. flow calculated with nested loops and those calculated from Q-vectors | |
11115 | ||
11116 | Int_t typeFlag = -1; | |
11117 | Int_t ptEtaFlag = -1; | |
11118 | if(type == "RP") | |
11119 | { | |
11120 | typeFlag = 0; | |
11121 | } else if(type == "POI") | |
11122 | { | |
11123 | typeFlag = 1; | |
11124 | } | |
11125 | if(ptOrEta == "Pt") | |
11126 | { | |
11127 | ptEtaFlag = 0; | |
11128 | } else if(ptOrEta == "Eta") | |
11129 | { | |
11130 | ptEtaFlag = 1; | |
11131 | } | |
11132 | // shortcuts: | |
11133 | Int_t t = typeFlag; | |
11134 | Int_t pe = ptEtaFlag; | |
11135 | ||
11136 | TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
11137 | TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
11138 | TString reducedCorrelations[4] = {"<<cos(n(psi1-phi2))>>","<<cos(n(psi1+phi2-phi3-phi4))>>","",""}; // to be improved (access this from pro or hist) | |
11139 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
11140 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
11141 | ||
11142 | Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo}; | |
11143 | ||
11144 | ||
11145 | cout<<endl; | |
11146 | cout<<" *****************************************"<<endl; | |
11147 | cout<<" **** cross-checking the correlations ****"<<endl; | |
11148 | cout<<" **** for differential flow ("<<rpORpoiString[t]<<") ****"<<endl; | |
11149 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
11150 | { | |
11151 | cout<<" **** (particle weights not used) ****"<<endl; | |
11152 | } else | |
11153 | { | |
11154 | cout<<" **** (particle weights used) ****"<<endl; | |
11155 | } | |
11156 | cout<<" *****************************************"<<endl; | |
11157 | cout<<endl; | |
11158 | cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl; | |
11159 | cout<<endl; | |
11160 | ||
11161 | for(Int_t rci=0;rci<2;rci++) // to be improved (calculate 6th and 8th order) | |
11162 | { | |
11163 | cout<<" "<<reducedCorrelations[rci].Data()<<":"<<endl; | |
11164 | cout<<" from Q-vectors = "<<fDiffFlowCorrelationsPro[t][pe][rci]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl; | |
11165 | cout<<" from nested loops = "<<fDiffFlowDirectCorrelations[t][pe][rci]->GetBinContent(1)<<endl; | |
11166 | cout<<endl; | |
11167 | } // end of for(Int_t rci=0;rci<4;rci++) | |
11168 | ||
11169 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrelations(TString type, TString ptOrEta) | |
11170 | ||
3b552efe | 11171 | //================================================================================================================================ |
11172 | ||
489d5531 | 11173 | void AliFlowAnalysisWithQCumulants::PrintNumberOfParticlesInSelectedBin() |
3b552efe | 11174 | { |
11175 | // Print on the screen number of RPs and POIs in selected pt and eta bin for cross checkings. | |
11176 | ||
11177 | cout<<endl; | |
11178 | cout<<"Number of RPs in selected pt bin = "<<fNoOfParticlesInBin->GetBinContent(1)<<endl; | |
11179 | cout<<"Number of RPs in selected eta bin = "<<fNoOfParticlesInBin->GetBinContent(2)<<endl; | |
11180 | cout<<"Number of POIs in selected pt bin = "<<fNoOfParticlesInBin->GetBinContent(3)<<endl; | |
11181 | cout<<"Number of POIs in selected eta bin = "<<fNoOfParticlesInBin->GetBinContent(4)<<endl; | |
11182 | ||
489d5531 | 11183 | } // end of void AliFlowAnalysisWithQCumulants::PrintNumberOfParticlesInSelectedBin() |
11184 | ||
3b552efe | 11185 | //================================================================================================================================ |
11186 | ||
0328db2d | 11187 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 11188 | { |
11189 | // Evaluate reduced correlations with nested loops without using the particle weights. | |
11190 | ||
11191 | // Remark 1: Reduced correlations are evaluated in pt bin number fCrossCheckInPtBinNo and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
11192 | // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrelations[t][pe][ci], where indices runs as follows: | |
11193 | // [0=RP,1=POI][0=Pt,1=Eta][0=<2'>,1=<4'>,2=<6'>,3=<8'>] | |
11194 | // Remark 3: <2'> = <w2 cos(n*(psi1-phi2))> | |
11195 | // <4'> = <w2 w3 w4 cos(n*(psi1+phi2-phi3-phi4))> | |
11196 | // ... | |
11197 | ||
11198 | Int_t typeFlag = -1; | |
11199 | Int_t ptEtaFlag = -1; | |
11200 | if(type == "RP") | |
11201 | { | |
11202 | typeFlag = 0; | |
11203 | } else if(type == "POI") | |
11204 | { | |
11205 | typeFlag = 1; | |
11206 | } | |
11207 | if(ptOrEta == "Pt") | |
11208 | { | |
11209 | ptEtaFlag = 0; | |
11210 | } else if(ptOrEta == "Eta") | |
11211 | { | |
11212 | ptEtaFlag = 1; | |
11213 | } | |
11214 | // shortcuts: | |
11215 | Int_t t = typeFlag; | |
11216 | Int_t pe = ptEtaFlag; | |
11217 | ||
11218 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
11219 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
11220 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
11221 | ||
11222 | Int_t nPrim = anEvent->NumberOfTracks(); | |
11223 | AliFlowTrackSimple *aftsTrack = NULL; | |
11224 | ||
11225 | Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
11226 | Double_t wPhi2=1., wPhi3=1., wPhi4=1.;// wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
11227 | ||
11228 | Int_t n = fHarmonic; | |
11229 | ||
11230 | // 2'-particle correlations: | |
11231 | for(Int_t i1=0;i1<nPrim;i1++) | |
11232 | { | |
11233 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 11234 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
11235 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11236 | { |
11237 | if(ptOrEta == "Pt") | |
11238 | { | |
11239 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11240 | } else if (ptOrEta == "Eta") | |
11241 | { | |
11242 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11243 | } |
11244 | } else // this is diff flow of RPs | |
11245 | { | |
489d5531 | 11246 | if(ptOrEta == "Pt") |
11247 | { | |
11248 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11249 | } else if (ptOrEta == "Eta") | |
11250 | { | |
11251 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11252 | } |
489d5531 | 11253 | } |
11254 | psi1=aftsTrack->Phi(); | |
11255 | for(Int_t i2=0;i2<nPrim;i2++) | |
11256 | { | |
11257 | if(i2==i1) continue; | |
11258 | aftsTrack=anEvent->GetTrack(i2); | |
11259 | // RP condition (!(first) particle in the correlator must be RP): | |
11260 | if(!(aftsTrack->InRPSelection())) continue; | |
11261 | phi2=aftsTrack->Phi(); | |
11262 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
11263 | // 2'-particle correlations: | |
11264 | fDiffFlowDirectCorrelations[t][pe][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(1.*n*(psi1-phi2)),wPhi2); // <w2 cos(n*(psi1-phi2)) | |
11265 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
11266 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11267 | ||
11268 | // 4'-particle correlations: | |
11269 | for(Int_t i1=0;i1<nPrim;i1++) | |
11270 | { | |
11271 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 11272 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
11273 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11274 | { |
11275 | if(ptOrEta == "Pt") | |
11276 | { | |
11277 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11278 | } else if (ptOrEta == "Eta") | |
11279 | { | |
11280 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11281 | } |
11282 | } else // this is diff flow of RPs | |
11283 | { | |
489d5531 | 11284 | if(ptOrEta == "Pt") |
11285 | { | |
11286 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11287 | } else if (ptOrEta == "Eta") | |
11288 | { | |
11289 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11290 | } |
489d5531 | 11291 | } |
11292 | psi1=aftsTrack->Phi(); | |
11293 | for(Int_t i2=0;i2<nPrim;i2++) | |
11294 | { | |
11295 | if(i2==i1) continue; | |
11296 | aftsTrack=anEvent->GetTrack(i2); | |
11297 | // RP condition (!(first) particle in the correlator must be RP): | |
11298 | if(!(aftsTrack->InRPSelection())) continue; | |
11299 | phi2=aftsTrack->Phi(); | |
11300 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
11301 | for(Int_t i3=0;i3<nPrim;i3++) | |
11302 | { | |
11303 | if(i3==i1||i3==i2) continue; | |
11304 | aftsTrack=anEvent->GetTrack(i3); | |
11305 | // RP condition (!(first) particle in the correlator must be RP): | |
11306 | if(!(aftsTrack->InRPSelection())) continue; | |
11307 | phi3=aftsTrack->Phi(); | |
11308 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
11309 | for(Int_t i4=0;i4<nPrim;i4++) | |
11310 | { | |
11311 | if(i4==i1||i4==i2||i4==i3) continue; | |
11312 | aftsTrack=anEvent->GetTrack(i4); | |
11313 | // RP condition (!(first) particle in the correlator must be RP): | |
11314 | if(!(aftsTrack->InRPSelection())) continue; | |
11315 | phi4=aftsTrack->Phi(); | |
11316 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); | |
11317 | // 4'-particle correlations <w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))>: | |
11318 | fDiffFlowDirectCorrelations[t][pe][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3-phi4)),wPhi2*wPhi3*wPhi4); | |
11319 | }//end of for(Int_t i4=0;i4<nPrim;i4++) | |
11320 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
11321 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
11322 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11323 | ||
11324 | // count # of RPs and POIs in selected pt and eta bins for cross-checkings: (to be improved - moved to dedicated method) | |
3b552efe | 11325 | for(Int_t i=0;i<nPrim;i++) |
11326 | { | |
489d5531 | 11327 | aftsTrack=anEvent->GetTrack(i); |
11328 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
11329 | if(typeFlag==1) // this is diff flow of POIs | |
11330 | { | |
11331 | if(ptOrEta == "Pt") | |
11332 | { | |
11333 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11334 | } else if (ptOrEta == "Eta") | |
11335 | { | |
11336 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11337 | } | |
11338 | } else // this is diff flow of RPs | |
11339 | { | |
11340 | if(ptOrEta == "Pt") | |
11341 | { | |
11342 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11343 | } else if (ptOrEta == "Eta") | |
11344 | { | |
11345 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11346 | } | |
11347 | } | |
11348 | if(t==1)t++; | |
11349 | fNoOfParticlesInBin->Fill(t+pe+0.5); | |
11350 | } | |
11351 | ||
11352 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
11353 | ||
11354 | ||
11355 | //================================================================================================================================ | |
11356 | ||
11357 | ||
0328db2d | 11358 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 11359 | { |
11360 | // Evaluate with nested loops correction terms for non-uniform acceptance (both sin and cos terms) relevant for differential flow. | |
11361 | ||
11362 | // Remark 1: Reduced correction terms for non-uniform acceptance are evaluated in pt bin number fCrossCheckInPtBinNo | |
11363 | // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
11364 | // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrections[t][pe][sc][cti], where first three indices runs as: | |
11365 | // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms], whilst the cti (correction term index) runs as follows: | |
11366 | // cti: | |
11367 | // 0: <<sc n(psi1)>> | |
11368 | // 1: <<sc n(psi1+phi2)>> | |
11369 | // 2: <<sc n(psi1+phi2-phi3)>> | |
11370 | // 3: <<sc n(psi1-phi2-phi3)>> | |
11371 | // 4: | |
11372 | // 5: | |
11373 | // 6: | |
11374 | ||
11375 | Int_t typeFlag = -1; | |
11376 | Int_t ptEtaFlag = -1; | |
11377 | if(type == "RP") | |
11378 | { | |
11379 | typeFlag = 0; | |
11380 | } else if(type == "POI") | |
11381 | { | |
11382 | typeFlag = 1; | |
11383 | } | |
11384 | if(ptOrEta == "Pt") | |
11385 | { | |
11386 | ptEtaFlag = 0; | |
11387 | } else if(ptOrEta == "Eta") | |
11388 | { | |
11389 | ptEtaFlag = 1; | |
11390 | } | |
11391 | // shortcuts: | |
11392 | Int_t t = typeFlag; | |
11393 | Int_t pe = ptEtaFlag; | |
11394 | ||
11395 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
11396 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
11397 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
11398 | ||
11399 | Int_t nPrim = anEvent->NumberOfTracks(); | |
11400 | AliFlowTrackSimple *aftsTrack = NULL; | |
11401 | ||
11402 | Double_t psi1=0., phi2=0., phi3=0.;// phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
11403 | ||
11404 | Int_t n = fHarmonic; | |
11405 | ||
11406 | // 1-particle correction terms: | |
11407 | for(Int_t i1=0;i1<nPrim;i1++) | |
11408 | { | |
11409 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 11410 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
11411 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11412 | { |
11413 | if(ptOrEta == "Pt") | |
11414 | { | |
11415 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11416 | } else if (ptOrEta == "Eta") | |
11417 | { | |
11418 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11419 | } |
11420 | } else // this is diff flow of RPs | |
11421 | { | |
489d5531 | 11422 | if(ptOrEta == "Pt") |
11423 | { | |
11424 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11425 | } else if (ptOrEta == "Eta") | |
11426 | { | |
11427 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11428 | } |
11429 | } | |
489d5531 | 11430 | psi1=aftsTrack->Phi(); |
11431 | // sin terms: | |
11432 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*psi1),1.); // <<sin(n*(psi1))>> | |
11433 | // cos terms: | |
11434 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*psi1),1.); // <<cos(n*(psi1))>> | |
11435 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11436 | ||
11437 | // 2-particle correction terms: | |
11438 | for(Int_t i1=0;i1<nPrim;i1++) | |
11439 | { | |
11440 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 11441 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
11442 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11443 | { |
11444 | if(ptOrEta == "Pt") | |
11445 | { | |
11446 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11447 | } else if (ptOrEta == "Eta") | |
11448 | { | |
11449 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11450 | } |
11451 | } else // this is diff flow of RPs | |
11452 | { | |
489d5531 | 11453 | if(ptOrEta == "Pt") |
11454 | { | |
11455 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11456 | } else if (ptOrEta == "Eta") | |
11457 | { | |
11458 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11459 | } |
489d5531 | 11460 | } |
11461 | psi1=aftsTrack->Phi(); | |
11462 | for(Int_t i2=0;i2<nPrim;i2++) | |
11463 | { | |
11464 | if(i2==i1) continue; | |
11465 | aftsTrack=anEvent->GetTrack(i2); | |
11466 | // RP condition (!(first) particle in the correlator must be RP): | |
11467 | if(!(aftsTrack->InRPSelection())) continue; | |
11468 | phi2=aftsTrack->Phi(); | |
11469 | // sin terms: | |
11470 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2)),1.); // <<sin(n*(psi1+phi2))>> | |
11471 | // cos terms: | |
11472 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2)),1.); // <<cos(n*(psi1+phi2))>> | |
11473 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
11474 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11475 | ||
11476 | // 3-particle correction terms: | |
11477 | for(Int_t i1=0;i1<nPrim;i1++) | |
11478 | { | |
11479 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 11480 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
11481 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 11482 | { |
11483 | if(ptOrEta == "Pt") | |
11484 | { | |
11485 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
11486 | } else if (ptOrEta == "Eta") | |
11487 | { | |
11488 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 11489 | } |
11490 | } else // this is diff flow of RPs | |
11491 | { | |
489d5531 | 11492 | if(ptOrEta == "Pt") |
11493 | { | |
11494 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
11495 | } else if (ptOrEta == "Eta") | |
11496 | { | |
11497 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 11498 | } |
489d5531 | 11499 | } |
11500 | psi1=aftsTrack->Phi(); | |
11501 | for(Int_t i2=0;i2<nPrim;i2++) | |
11502 | { | |
11503 | if(i2==i1) continue; | |
11504 | aftsTrack=anEvent->GetTrack(i2); | |
11505 | // RP condition (!(first) particle in the correlator must be RP): | |
11506 | if(!(aftsTrack->InRPSelection())) continue; | |
11507 | phi2=aftsTrack->Phi(); | |
11508 | for(Int_t i3=0;i3<nPrim;i3++) | |
11509 | { | |
11510 | if(i3==i1||i3==i2) continue; | |
11511 | aftsTrack=anEvent->GetTrack(i3); | |
11512 | // RP condition (!(first) particle in the correlator must be RP): | |
11513 | if(!(aftsTrack->InRPSelection())) continue; | |
11514 | phi3=aftsTrack->Phi(); | |
11515 | // sin terms: | |
11516 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2-phi3)),1.); // <<sin(n*(psi1+phi2-phi3))>> | |
11517 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1-phi2-phi3)),1.); // <<sin(n*(psi1-phi2-phi3))>> | |
11518 | // cos terms: | |
11519 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3)),1.); // <<cos(n*(psi1+phi2-phi3))>> | |
11520 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-phi2-phi3)),1.); // <<cos(n*(psi1-phi2-phi3))>> | |
11521 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
11522 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
11523 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
11524 | ||
11525 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
11526 | ||
11527 | ||
11528 | //================================================================================================================================ | |
11529 | ||
11530 | ||
11531 | void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrectionTermsForNUA(TString type, TString ptOrEta) | |
11532 | { | |
11533 | // Compare corrections temrs for non-uniform acceptance needed for diff. flow calculated with nested loops and those calculated from Q-vectors | |
11534 | ||
11535 | Int_t typeFlag = -1; | |
11536 | Int_t ptEtaFlag = -1; | |
11537 | if(type == "RP") | |
11538 | { | |
11539 | typeFlag = 0; | |
11540 | } else if(type == "POI") | |
11541 | { | |
11542 | typeFlag = 1; | |
11543 | } | |
11544 | if(ptOrEta == "Pt") | |
11545 | { | |
11546 | ptEtaFlag = 0; | |
11547 | } else if(ptOrEta == "Eta") | |
11548 | { | |
11549 | ptEtaFlag = 1; | |
11550 | } | |
11551 | // shortcuts: | |
11552 | Int_t t = typeFlag; | |
11553 | Int_t pe = ptEtaFlag; | |
11554 | ||
11555 | TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
11556 | TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
11557 | //TString sinCosFlag[2] = {"sin","cos"}; // to be improved (eventually promote to data member) | |
11558 | TString reducedCorrectionSinTerms[4] = {"<<sin(n(psi1))>>","<<sin(n(psi1+phi2))>>","<<sin(n*(psi1+phi2-phi3))>>","<<sin(n*(psi1-phi2-phi3))>>"}; // to be improved (access this from pro or hist) | |
11559 | TString reducedCorrectionCosTerms[4] = {"<<cos(n(psi1))>>","<<cos(n(psi1+phi2))>>","<<cos(n*(psi1+phi2-phi3))>>","<<cos(n*(psi1-phi2-phi3))>>"}; // to be improved (access this from pro or hist) | |
11560 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
11561 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
11562 | ||
11563 | Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo}; | |
11564 | ||
11565 | cout<<endl; | |
11566 | cout<<" ******************************************"<<endl; | |
11567 | cout<<" **** cross-checking the correction ****"<<endl; | |
46b94261 | 11568 | cout<<" **** terms for non-uniform acceptance ****"<<endl; |
489d5531 | 11569 | cout<<" **** for differential flow ("<<rpORpoiString[t]<<") ****"<<endl; |
11570 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) | |
11571 | { | |
11572 | cout<<" **** (particle weights not used) ****"<<endl; | |
11573 | } else | |
11574 | { | |
11575 | cout<<" **** (particle weights used) ****"<<endl; | |
11576 | } | |
11577 | cout<<" ******************************************"<<endl; | |
11578 | cout<<endl; | |
11579 | cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl; | |
11580 | cout<<endl; | |
11581 | ||
11582 | for(Int_t cti=0;cti<4;cti++) // correction term index | |
11583 | { | |
11584 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
11585 | { | |
11586 | if(sc==0) // to be improved (this can be implemented better) | |
11587 | { | |
11588 | cout<<" "<<reducedCorrectionSinTerms[cti].Data()<<":"<<endl; | |
11589 | } else | |
11590 | { | |
11591 | cout<<" "<<reducedCorrectionCosTerms[cti].Data()<<":"<<endl; | |
11592 | } | |
11593 | cout<<" from Q-vectors = "<<fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl; | |
11594 | cout<<" from nested loops = "<<fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]->GetBinContent(1)<<endl; | |
11595 | cout<<endl; | |
11596 | } | |
11597 | } // end of for(Int_t rci=0;rci<4;rci++) | |
11598 | ||
11599 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrectionTermsForNUA(TString type, TString ptOrEta) | |
11600 | ||
11601 | ||
57340a27 | 11602 | //================================================================================================================================ |
11603 | ||
489d5531 | 11604 | |
11605 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights() | |
11606 | { | |
11607 | // Calculate corrections using particle weights for non-uniform acceptance of the detector for no-name integrated flow (cos terms). | |
11608 | ||
11609 | // ********************************************************************** | |
11610 | // **** weighted corrections for non-uniform acceptance (cos terms): **** | |
11611 | // ********************************************************************** | |
57340a27 | 11612 | |
489d5531 | 11613 | // Remark 1: When particle weights are used the binning of fIntFlowCorrectionTermsForNUAPro[1] is organized as follows: |
57340a27 | 11614 | // |
489d5531 | 11615 | // 1st bin: <<w1 cos(n*(phi1))>> = cosP1nW1 |
11616 | // 2nd bin: <<w1 w2 cos(n*(phi1+phi2))>> = cosP1nP1nW1W1 | |
11617 | // 3rd bin: <<w1 w2 w3 cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1nW1W1W1 | |
11618 | // ... | |
11619 | ||
11620 | // multiplicity (number of particles used to determine the reaction plane) | |
11621 | Double_t dMult = (*fSMpk)(0,0); | |
11622 | ||
11623 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
11624 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
11625 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
11626 | //Double_t dReQ3n3k = (*fReQ)(2,3); | |
11627 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
11628 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
11629 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
11630 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
11631 | //Double_t dImQ3n3k = (*fImQ)(2,3); | |
11632 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
11633 | //Double_t dImQ1n3k = (*fImQ)(0,3); | |
11634 | ||
11635 | // dMs are variables introduced in order to simplify some Eqs. bellow: | |
11636 | //.............................................................................................. | |
11637 | Double_t dM11 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j | |
57340a27 | 11638 | Double_t dM111 = (*fSMpk)(2,1)-3.*(*fSMpk)(0,2)*(*fSMpk)(0,1) |
489d5531 | 11639 | + 2.*(*fSMpk)(0,3); // dM111 = sum_{i,j,k=1,i!=j!=k}^M w_i w_j w_k |
11640 | //.............................................................................................. | |
ecac11c2 | 11641 | // 1-particle: |
489d5531 | 11642 | Double_t cosP1nW1 = 0.; // <<w1 cos(n*(phi1))>> |
11643 | ||
0328db2d | 11644 | if(dMult>0 && TMath::Abs((*fSMpk)(0,1))>1e-6) |
489d5531 | 11645 | { |
11646 | cosP1nW1 = dReQ1n1k/(*fSMpk)(0,1); | |
11647 | ||
11648 | // average weighted 1-particle correction (cos terms) for non-uniform acceptance for single event: | |
11649 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(1,cosP1nW1); | |
11650 | ||
11651 | // final average weighted 1-particle correction (cos terms) for non-uniform acceptance for all events: | |
11652 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(0.5,cosP1nW1,(*fSMpk)(0,1)); | |
11653 | } | |
11654 | ||
11655 | // 2-particle: | |
11656 | Double_t cosP1nP1nW1W1 = 0.; // <<w1 w2 cos(n*(phi1+phi2))>> | |
11657 | ||
0328db2d | 11658 | if(dMult>1 && TMath::Abs(dM11)>1e-6) |
489d5531 | 11659 | { |
11660 | cosP1nP1nW1W1 = (pow(dReQ1n1k,2)-pow(dImQ1n1k,2)-dReQ2n2k)/dM11; | |
11661 | ||
11662 | // average weighted 2-particle correction (cos terms) for non-uniform acceptance for single event: | |
11663 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(2,cosP1nP1nW1W1); | |
11664 | ||
11665 | // final average weighted 2-particle correction (cos terms) for non-uniform acceptance for all events: | |
11666 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(1.5,cosP1nP1nW1W1,dM11); | |
11667 | } | |
11668 | ||
11669 | // 3-particle: | |
11670 | Double_t cosP1nM1nM1nW1W1W1 = 0.; // <<w1 w2 w3 cos(n*(phi1-phi2-phi3))>> | |
11671 | ||
0328db2d | 11672 | if(dMult>2 && TMath::Abs(dM111)>1e-6) |
489d5531 | 11673 | { |
57340a27 | 11674 | cosP1nM1nM1nW1W1W1 = (dReQ1n1k*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
11675 | - dReQ1n1k*dReQ2n2k-dImQ1n1k*dImQ2n2k | |
11676 | - 2.*((*fSMpk)(0,2))*dReQ1n1k | |
489d5531 | 11677 | + 2.*dReQ1n3k) |
11678 | / dM111; | |
11679 | ||
11680 | // average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for single event: | |
11681 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(3,cosP1nM1nM1nW1W1W1); | |
11682 | ||
11683 | // final average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for all events: | |
11684 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(2.5,cosP1nM1nM1nW1W1W1,dM111); | |
11685 | } | |
11686 | ||
11687 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights() | |
11688 | ||
11689 | ||
11690 | //================================================================================================================================ | |
11691 | ||
11692 | ||
11693 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights() | |
11694 | { | |
11695 | // calculate corrections using particle weights for non-uniform acceptance of the detector for no-name integrated flow (sin terms) | |
11696 | ||
11697 | // ********************************************************************** | |
11698 | // **** weighted corrections for non-uniform acceptance (sin terms): **** | |
11699 | // ********************************************************************** | |
11700 | ||
11701 | // Remark 1: When particle weights are used the binning of fIntFlowCorrectionTermsForNUAPro[0] is organized as follows: | |
57340a27 | 11702 | // |
489d5531 | 11703 | // 1st bin: <<w1 sin(n*(phi1))>> = sinP1nW1 |
11704 | // 2nd bin: <<w1 w2 sin(n*(phi1+phi2))>> = sinP1nP1nW1W1 | |
11705 | // 3rd bin: <<w1 w2 w3 sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1nW1W1W1 | |
11706 | // ... | |
11707 | ||
11708 | // multiplicity (number of particles used to determine the reaction plane) | |
11709 | Double_t dMult = (*fSMpk)(0,0); | |
11710 | ||
11711 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
11712 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
11713 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
11714 | //Double_t dReQ3n3k = (*fReQ)(2,3); | |
11715 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
11716 | //Double_t dReQ1n3k = (*fReQ)(0,3); | |
11717 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
11718 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
11719 | //Double_t dImQ3n3k = (*fImQ)(2,3); | |
11720 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
11721 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
11722 | ||
11723 | // dMs are variables introduced in order to simplify some Eqs. bellow: | |
11724 | //.............................................................................................. | |
11725 | Double_t dM11 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j | |
57340a27 | 11726 | Double_t dM111 = (*fSMpk)(2,1)-3.*(*fSMpk)(0,2)*(*fSMpk)(0,1) |
489d5531 | 11727 | + 2.*(*fSMpk)(0,3); // dM111 = sum_{i,j,k=1,i!=j!=k}^M w_i w_j w_k |
11728 | //.............................................................................................. | |
11729 | ||
11730 | // 1-particle: | |
11731 | Double_t sinP1nW1 = 0.; // <<w1 sin(n*(phi1))>> | |
11732 | ||
0328db2d | 11733 | if(dMult>0 && TMath::Abs((*fSMpk)(0,1))>1e-6) |
489d5531 | 11734 | { |
11735 | sinP1nW1 = dImQ1n1k/((*fSMpk)(0,1)); | |
11736 | ||
11737 | // average weighted 1-particle correction (sin terms) for non-uniform acceptance for single event: | |
11738 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(1,sinP1nW1); | |
11739 | ||
11740 | // final average weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
11741 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(0.5,sinP1nW1,(*fSMpk)(0,1)); | |
11742 | } | |
11743 | ||
11744 | // 2-particle: | |
11745 | Double_t sinP1nP1nW1W1 = 0.; // <<w1 w2 sin(n*(phi1+phi2))>> | |
11746 | ||
0328db2d | 11747 | if(dMult>1 && TMath::Abs(dM11)>1e-6) |
489d5531 | 11748 | { |
11749 | sinP1nP1nW1W1 = (2.*dReQ1n1k*dImQ1n1k-dImQ2n2k)/dM11; | |
11750 | ||
11751 | // average weighted 2-particle correction (sin terms) for non-uniform acceptance for single event: | |
11752 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(2,sinP1nP1nW1W1); | |
11753 | ||
11754 | // final average weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
11755 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(1.5,sinP1nP1nW1W1,dM11); | |
11756 | } | |
11757 | ||
11758 | // 3-particle: | |
11759 | Double_t sinP1nM1nM1nW1W1W1 = 0.; // <<w1 w2 w3 sin(n*(phi1-phi2-phi3))>> | |
11760 | ||
0328db2d | 11761 | if(dMult>2 && TMath::Abs(dM111)>1e-6) |
489d5531 | 11762 | { |
57340a27 | 11763 | sinP1nM1nM1nW1W1W1 = (-dImQ1n1k*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
11764 | + dReQ1n1k*dImQ2n2k-dImQ1n1k*dReQ2n2k | |
11765 | + 2.*((*fSMpk)(0,2))*dImQ1n1k | |
489d5531 | 11766 | - 2.*dImQ1n3k) |
11767 | / dM111; | |
11768 | ||
11769 | // average weighted 3-particle correction (sin terms) for non-uniform acceptance for single event: | |
11770 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(3,sinP1nM1nM1nW1W1W1); | |
11771 | ||
11772 | // final average weighted 3-particle correction (sin terms) for non-uniform acceptance for all events: | |
11773 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(2.5,sinP1nM1nM1nW1W1W1,dM111); | |
11774 | } | |
11775 | ||
11776 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights() | |
11777 | ||
11778 | ||
57340a27 | 11779 | //================================================================================================================================ |
489d5531 | 11780 | |
11781 | ||
0328db2d | 11782 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent) |
489d5531 | 11783 | { |
11784 | // Evaluate with nested loops correction terms for non-uniform acceptance for integrated flow (using the particle weights). | |
11785 | ||
57340a27 | 11786 | // Results are stored in profiles fIntFlowDirectCorrectionTermsForNUA[0] (sin terms) and |
11787 | // fIntFlowDirectCorrectionTermsForNUA[1] (cos terms). | |
489d5531 | 11788 | |
57340a27 | 11789 | // Remark 1: When particle weights are used the binning of fIntFlowDirectCorrectionTermsForNUA[sc] is |
489d5531 | 11790 | // organized as follows (sc stands for either sin or cos): |
11791 | // | |
11792 | // 1st bin: <<w1 sc(n*(phi1))>> = scP1nW1 | |
11793 | // 2nd bin: <<w1 w2 sc(n*(phi1+phi2))>> = scP1nP1nW1W1 | |
11794 | // 3rd bin: <<w1 w2 w3 sc(n*(phi1-phi2-phi3))>> = scP1nM1nM1nW1W1W1 | |
3b552efe | 11795 | // ... |
489d5531 | 11796 | |
11797 | Int_t nPrim = anEvent->NumberOfTracks(); | |
11798 | AliFlowTrackSimple *aftsTrack = NULL; | |
11799 | //Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; | |
11800 | //Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
11801 | Double_t phi1=0., phi2=0., phi3=0.; | |
11802 | Double_t wPhi1=1., wPhi2=1., wPhi3=1.; | |
11803 | Int_t n = fHarmonic; | |
11804 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
11805 | Double_t dMult = (*fSMpk)(0,0); | |
11806 | cout<<endl; | |
11807 | cout<<"Correction terms for non-uniform acceptance: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
11808 | if(dMult<1) | |
11809 | { | |
11810 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
11811 | } else if (dMult>fMaxAllowedMultiplicity) | |
11812 | { | |
11813 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
11814 | } else | |
11815 | { | |
11816 | cout<<"... evaluating nested loops (using particle weights) ..."<<endl; | |
11817 | } | |
11818 | ||
11819 | // 1-particle correction terms using particle weights: | |
11820 | if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity) | |
11821 | { | |
11822 | for(Int_t i1=0;i1<nPrim;i1++) | |
11823 | { | |
11824 | aftsTrack=anEvent->GetTrack(i1); | |
11825 | if(!(aftsTrack->InRPSelection())) continue; | |
11826 | phi1=aftsTrack->Phi(); | |
11827 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
57340a27 | 11828 | // 1-particle correction terms using particle weights: |
489d5531 | 11829 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(0.5,sin(n*phi1),wPhi1); // <w1 sin(n*phi1)> |
11830 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(0.5,cos(n*phi1),wPhi1); // <w1 cos(n*phi1)> | |
57340a27 | 11831 | } // end of for(Int_t i1=0;i1<nPrim;i1++) |
11832 | } // end of if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity) | |
11833 | ||
489d5531 | 11834 | // 2-particle correction terms using particle weights: |
11835 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
11836 | { | |
11837 | for(Int_t i1=0;i1<nPrim;i1++) | |
11838 | { | |
11839 | aftsTrack=anEvent->GetTrack(i1); | |
11840 | if(!(aftsTrack->InRPSelection())) continue; | |
11841 | phi1=aftsTrack->Phi(); | |
11842 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
11843 | for(Int_t i2=0;i2<nPrim;i2++) | |
11844 | { | |
11845 | if(i2==i1)continue; | |
11846 | aftsTrack=anEvent->GetTrack(i2); | |
11847 | if(!(aftsTrack->InRPSelection())) continue; | |
11848 | phi2=aftsTrack->Phi(); | |
11849 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
11850 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
57340a27 | 11851 | // 2-p correction terms using particle weights: |
489d5531 | 11852 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(1.5,sin(n*(phi1+phi2)),wPhi1*wPhi2); // <w1 w2 sin(n*(phi1+phi2))> |
11853 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(1.5,cos(n*(phi1+phi2)),wPhi1*wPhi2); // <w1 w2 cos(n*(phi1+phi2))> | |
11854 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11855 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11856 | } // end of if(nPrim>=2) | |
11857 | ||
11858 | // 3-particle correction terms using particle weights: | |
11859 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
11860 | { | |
11861 | for(Int_t i1=0;i1<nPrim;i1++) | |
11862 | { | |
11863 | aftsTrack=anEvent->GetTrack(i1); | |
11864 | if(!(aftsTrack->InRPSelection())) continue; | |
11865 | phi1=aftsTrack->Phi(); | |
11866 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
11867 | for(Int_t i2=0;i2<nPrim;i2++) | |
11868 | { | |
11869 | if(i2==i1)continue; | |
11870 | aftsTrack=anEvent->GetTrack(i2); | |
11871 | if(!(aftsTrack->InRPSelection())) continue; | |
11872 | phi2=aftsTrack->Phi(); | |
11873 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
11874 | for(Int_t i3=0;i3<nPrim;i3++) | |
11875 | { | |
11876 | if(i3==i1||i3==i2)continue; | |
11877 | aftsTrack=anEvent->GetTrack(i3); | |
11878 | if(!(aftsTrack->InRPSelection())) continue; | |
11879 | phi3=aftsTrack->Phi(); | |
11880 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
11881 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
57340a27 | 11882 | // 3-p correction terms using particle weights: |
489d5531 | 11883 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(2.5,sin(n*(phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 sin(n*(phi1-phi2-phi3))> |
11884 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(2.5,cos(n*(phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 cos(n*(phi1-phi2-phi3))> | |
11885 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11886 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11887 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11888 | } // end of if(nPrim>=3) | |
11889 | ||
57340a27 | 11890 | /* |
11891 | ||
489d5531 | 11892 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) |
11893 | { | |
11894 | // 4 nested loops multiparticle correlations using particle weights: | |
11895 | for(Int_t i1=0;i1<nPrim;i1++) | |
11896 | { | |
11897 | aftsTrack=anEvent->GetTrack(i1); | |
11898 | if(!(aftsTrack->InRPSelection())) continue; | |
11899 | phi1=aftsTrack->Phi(); | |
11900 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
11901 | for(Int_t i2=0;i2<nPrim;i2++) | |
11902 | { | |
11903 | if(i2==i1)continue; | |
11904 | aftsTrack=anEvent->GetTrack(i2); | |
11905 | if(!(aftsTrack->InRPSelection())) continue; | |
11906 | phi2=aftsTrack->Phi(); | |
11907 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
11908 | for(Int_t i3=0;i3<nPrim;i3++) | |
11909 | { | |
11910 | if(i3==i1||i3==i2)continue; | |
11911 | aftsTrack=anEvent->GetTrack(i3); | |
11912 | if(!(aftsTrack->InRPSelection())) continue; | |
11913 | phi3=aftsTrack->Phi(); | |
11914 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
11915 | for(Int_t i4=0;i4<nPrim;i4++) | |
11916 | { | |
11917 | if(i4==i1||i4==i2||i4==i3)continue; | |
11918 | aftsTrack=anEvent->GetTrack(i4); | |
11919 | if(!(aftsTrack->InRPSelection())) continue; | |
11920 | phi4=aftsTrack->Phi(); | |
11921 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); | |
11922 | if(nPrim>=4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; // to be improved (replace eventually this if statement with if(nPrim==4)) | |
11923 | // 4-p correlations using particle weights: | |
11924 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(10.5,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); | |
11925 | // extra correlations: | |
11926 | // 2-p extra correlations (do not appear if particle weights are not used): | |
11927 | // ... | |
11928 | // 3-p extra correlations (do not appear if particle weights are not used): | |
11929 | // ... | |
11930 | // 4-p extra correlations (do not appear if particle weights are not used): | |
11931 | // ... | |
11932 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
11933 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11934 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11935 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11936 | } // end of if(nPrim>=4) | |
11937 | ||
11938 | */ | |
11939 | ||
11940 | cout<<endl; | |
11941 | ||
11942 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent) | |
11943 | ||
11944 | ||
57340a27 | 11945 | //================================================================================================================================ |
489d5531 | 11946 | |
11947 | ||
11948 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights(TString type, TString ptOrEta) | |
11949 | { | |
11950 | // Calculate correction terms for non-uniform acceptance for differential flow (cos terms) using particle weights. | |
57340a27 | 11951 | |
489d5531 | 11952 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][1][cti], where cti runs as follows: |
57340a27 | 11953 | // |
489d5531 | 11954 | // 0: <<cos n(psi)>> |
11955 | // 1: <<w2 cos n(psi1+phi2)>> | |
11956 | // 2: <<w2 w3 cos n(psi1+phi2-phi3)>> | |
11957 | // 3: <<w2 w3 cos n(psi1-phi2-phi3)>> | |
11958 | // 4: | |
11959 | // 5: | |
11960 | // 6: | |
11961 | ||
11962 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
11963 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
11964 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
11965 | //Double_t dReQ1n3k = (*fReQ)(0,3); | |
11966 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
11967 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
11968 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
11969 | //Double_t dImQ1n3k = (*fImQ)(0,3); | |
11970 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
11971 | ||
11972 | // S^M_{p,k} (see .h file for the definition of fSMpk): | |
11973 | Double_t dSM1p1k = (*fSMpk)(0,1); | |
11974 | Double_t dSM1p2k = (*fSMpk)(0,2); | |
11975 | Double_t dSM2p1k = (*fSMpk)(1,1); | |
11976 | ||
11977 | Int_t t = -1; // type flag | |
11978 | Int_t pe = -1; // ptEta flag | |
11979 | ||
11980 | if(type == "RP") | |
11981 | { | |
11982 | t = 0; | |
11983 | } else if(type == "POI") | |
11984 | { | |
11985 | t = 1; | |
11986 | } | |
11987 | ||
11988 | if(ptOrEta == "Pt") | |
11989 | { | |
11990 | pe = 0; | |
11991 | } else if(ptOrEta == "Eta") | |
11992 | { | |
11993 | pe = 1; | |
11994 | } | |
11995 | ||
11996 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
11997 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
11998 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
11999 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
12000 | ||
12001 | // looping over all bins and calculating correction terms: | |
12002 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
12003 | { | |
12004 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
12005 | Double_t p1n0kRe = 0.; | |
12006 | Double_t p1n0kIm = 0.; | |
12007 | ||
12008 | // number of POIs in particular pt or eta bin: | |
12009 | Double_t mp = 0.; | |
12010 | ||
12011 | // real and imaginary parts of q_{m*n,0} (weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
12012 | Double_t q1n2kRe = 0.; | |
12013 | Double_t q1n2kIm = 0.; | |
12014 | Double_t q2n1kRe = 0.; | |
12015 | Double_t q2n1kIm = 0.; | |
46b94261 | 12016 | |
489d5531 | 12017 | // s_{1,1}, s_{1,2} // to be improved (add explanation) |
12018 | Double_t s1p1k = 0.; | |
12019 | Double_t s1p2k = 0.; | |
46b94261 | 12020 | |
489d5531 | 12021 | // number of particles which are both RPs and POIs in particular pt or eta bin: |
46b94261 | 12022 | Double_t mq = 0.; |
489d5531 | 12023 | |
12024 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
12025 | Double_t dM01 = 0.; | |
12026 | Double_t dM011 = 0.; | |
12027 | ||
12028 | if(type == "POI") | |
12029 | { | |
12030 | // q_{m*n,k}: | |
12031 | q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
12032 | * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
12033 | q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
12034 | * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
12035 | q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
12036 | * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
12037 | q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
12038 | * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
12039 | mq = fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
46b94261 | 12040 | |
489d5531 | 12041 | s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); |
12042 | s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); | |
12043 | }else if(type == "RP") | |
12044 | { | |
12045 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
12046 | q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
12047 | * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
12048 | q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
12049 | * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
12050 | q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
12051 | * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
12052 | q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
12053 | * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
12054 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
12055 | s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); | |
12056 | s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); | |
3b552efe | 12057 | //s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); |
12058 | ||
489d5531 | 12059 | mq = fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) |
12060 | } | |
3b552efe | 12061 | |
489d5531 | 12062 | if(type == "POI") |
3b552efe | 12063 | { |
12064 | // p_{m*n,k}: | |
489d5531 | 12065 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) |
12066 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
12067 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
3b552efe | 12068 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); |
12069 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
489d5531 | 12070 | // M01 from Eq. (118) in QC2c (to be improved (notation)): |
3b552efe | 12071 | dM01 = mp*dSM1p1k-s1p1k; |
12072 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
12073 | - 2.*(s1p1k*dSM1p1k-s1p2k); | |
12074 | ||
12075 | // typeFlag = RP (0) or POI (1): | |
12076 | t = 1; | |
12077 | } else if(type == "RP") | |
489d5531 | 12078 | { |
12079 | // to be improved (cross-checked): | |
12080 | p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
12081 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
12082 | p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
12083 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
12084 | mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
12085 | // M01 from Eq. (118) in QC2c (to be improved (notation)): | |
3b552efe | 12086 | dM01 = mp*dSM1p1k-s1p1k; |
12087 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
12088 | - 2.*(s1p1k*dSM1p1k-s1p2k); | |
489d5531 | 12089 | // typeFlag = RP (0) or POI (1): |
3b552efe | 12090 | t = 0; |
12091 | } | |
489d5531 | 12092 | |
12093 | // <<cos n(psi1)>>: | |
12094 | Double_t cosP1nPsi = 0.; | |
12095 | if(mp) | |
12096 | { | |
12097 | cosP1nPsi = p1n0kRe/mp; | |
12098 | ||
12099 | // fill profile for <<cos n(psi1)>>: | |
12100 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi,mp); | |
12101 | // histogram to store <cos n(psi1)> e-b-e (needed in some other methods): | |
12102 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][0]->SetBinContent(b,cosP1nPsi); | |
46b94261 | 12103 | } // end of if(mp) |
57340a27 | 12104 | |
489d5531 | 12105 | // <<w2 cos n(psi1+phi2)>>: |
12106 | Double_t cosP1nPsiP1nPhiW2 = 0.; | |
12107 | if(dM01) | |
12108 | { | |
12109 | cosP1nPsiP1nPhiW2 = (p1n0kRe*dReQ1n1k-p1n0kIm*dImQ1n1k-q2n1kRe)/(dM01); | |
12110 | // fill profile for <<w2 cos n(psi1+phi2)>>: | |
12111 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsiP1nPhiW2,dM01); | |
12112 | // histogram to store <w2 cos n(psi1+phi2)> e-b-e (needed in some other methods): | |
12113 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][1]->SetBinContent(b,cosP1nPsiP1nPhiW2); | |
12114 | } // end of if(dM01) | |
12115 | ||
12116 | // <<w2 w3 cos n(psi1+phi2-phi3)>>: | |
12117 | Double_t cosP1nPsi1P1nPhi2MPhi3W2W3 = 0.; | |
12118 | if(dM011) | |
12119 | { | |
46b94261 | 12120 | cosP1nPsi1P1nPhi2MPhi3W2W3 = (p1n0kRe*(pow(dImQ1n1k,2.)+pow(dReQ1n1k,2.)) |
12121 | - p1n0kRe*dSM1p2k | |
12122 | - q2n1kRe*dReQ1n1k-q2n1kIm*dImQ1n1k | |
12123 | - s1p1k*dReQ1n1k | |
12124 | + 2.*q1n2kRe) | |
12125 | / dM011; | |
489d5531 | 12126 | // fill profile for <<w1 w2 w3 cos n(psi1+phi2)>>: |
12127 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1P1nPhi2MPhi3W2W3,dM011); | |
12128 | // histogram to store <w1 w2 w3 cos n(psi1+phi2)> e-b-e (needed in some other methods): | |
12129 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][2]->SetBinContent(b,cosP1nPsi1P1nPhi2MPhi3W2W3); | |
12130 | } // end of if(dM011) | |
12131 | ||
12132 | // <<w2 w3 cos n(psi1-phi2-phi3)>>: | |
12133 | Double_t cosP1nPsi1M1nPhi2MPhi3W2W3 = 0.; | |
12134 | if(dM011) | |
12135 | { | |
12136 | cosP1nPsi1M1nPhi2MPhi3W2W3 = (p1n0kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))+2.*p1n0kIm*dReQ1n1k*dImQ1n1k | |
12137 | - 1.*(p1n0kRe*dReQ2n2k+p1n0kIm*dImQ2n2k) | |
46b94261 | 12138 | - 2.*s1p1k*dReQ1n1k |
489d5531 | 12139 | + 2.*q1n2kRe) |
12140 | / dM011; | |
12141 | // fill profile for <<w1 w2 w3 cos n(psi1+phi2)>>: | |
12142 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1M1nPhi2MPhi3W2W3,dM011); | |
12143 | // histogram to store <w1 w2 w3 cos n(psi1+phi2)> e-b-e (needed in some other methods): | |
12144 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][3]->SetBinContent(b,cosP1nPsi1M1nPhi2MPhi3W2W3); | |
12145 | } // end of if(dM011) | |
12146 | ||
12147 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
46b94261 | 12148 | |
57340a27 | 12149 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights(TString type, TString ptOrEta) |
12150 | ||
489d5531 | 12151 | |
12152 | //================================================================================================================================ | |
12153 | ||
12154 | ||
12155 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights(TString type, TString ptOrEta) | |
12156 | { | |
12157 | // Calculate correction terms for non-uniform acceptance for differential flow (sin terms). | |
12158 | ||
12159 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][0][cti], where cti runs as follows: | |
12160 | // 0: <<sin n(psi1)>> | |
12161 | // 1: <<w2 sin n(psi1+phi2)>> | |
12162 | // 2: <<w2 w3 sin n(psi1+phi2-phi3)>> | |
12163 | // 3: <<w2 w3 sin n(psi1-phi2-phi3)>>: | |
12164 | // 4: | |
12165 | // 5: | |
12166 | // 6: | |
12167 | ||
12168 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
12169 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
12170 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
12171 | //Double_t dReQ1n3k = (*fReQ)(0,3); | |
12172 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
12173 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
12174 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
12175 | //Double_t dImQ1n3k = (*fImQ)(0,3); | |
12176 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
12177 | ||
12178 | // S^M_{p,k} (see .h file for the definition of fSMpk): | |
12179 | Double_t dSM1p1k = (*fSMpk)(0,1); | |
12180 | Double_t dSM1p2k = (*fSMpk)(0,2); | |
12181 | Double_t dSM2p1k = (*fSMpk)(1,1); | |
12182 | ||
12183 | Int_t t = -1; // type flag | |
12184 | Int_t pe = -1; // ptEta flag | |
12185 | ||
12186 | if(type == "RP") | |
12187 | { | |
12188 | t = 0; | |
12189 | } else if(type == "POI") | |
12190 | { | |
12191 | t = 1; | |
12192 | } | |
12193 | ||
12194 | if(ptOrEta == "Pt") | |
12195 | { | |
12196 | pe = 0; | |
12197 | } else if(ptOrEta == "Eta") | |
12198 | { | |
12199 | pe = 1; | |
12200 | } | |
12201 | ||
12202 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
12203 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
12204 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
12205 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
12206 | ||
12207 | // looping over all bins and calculating correction terms: | |
12208 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
12209 | { | |
12210 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
12211 | Double_t p1n0kRe = 0.; | |
12212 | Double_t p1n0kIm = 0.; | |
12213 | ||
12214 | // number of POIs in particular pt or eta bin: | |
12215 | Double_t mp = 0.; | |
12216 | ||
12217 | // real and imaginary parts of q_{m*n,0} (weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
12218 | Double_t q1n2kRe = 0.; | |
12219 | Double_t q1n2kIm = 0.; | |
12220 | Double_t q2n1kRe = 0.; | |
12221 | Double_t q2n1kIm = 0.; | |
46b94261 | 12222 | |
489d5531 | 12223 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) |
12224 | Double_t s1p1k = 0.; | |
12225 | Double_t s1p2k = 0.; | |
46b94261 | 12226 | |
489d5531 | 12227 | // number of particles which are both RPs and POIs in particular pt or eta bin: |
46b94261 | 12228 | Double_t mq = 0.; |
489d5531 | 12229 | |
12230 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
12231 | Double_t dM01 = 0.; | |
12232 | Double_t dM011 = 0.; | |
12233 | ||
12234 | if(type == "POI") | |
12235 | { | |
12236 | // q_{m*n,k}: | |
12237 | q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
12238 | * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
12239 | q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
12240 | * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
12241 | q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
12242 | * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
12243 | q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
12244 | * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
12245 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
46b94261 | 12246 | |
489d5531 | 12247 | s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); |
12248 | s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); | |
12249 | }else if(type == "RP") | |
12250 | { | |
12251 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
12252 | q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
12253 | * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
12254 | q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
12255 | * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
12256 | q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
12257 | * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
12258 | q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
12259 | * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
12260 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
12261 | s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); | |
12262 | s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); | |
12263 | //s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); | |
3b552efe | 12264 | } |
12265 | ||
12266 | if(type == "POI") | |
12267 | { | |
12268 | // p_{m*n,k}: | |
489d5531 | 12269 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) |
12270 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
12271 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
3b552efe | 12272 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); |
12273 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
489d5531 | 12274 | // M01 from Eq. (118) in QC2c (to be improved (notation)): |
3b552efe | 12275 | dM01 = mp*dSM1p1k-s1p1k; |
12276 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
12277 | - 2.*(s1p1k*dSM1p1k-s1p2k); | |
12278 | // typeFlag = RP (0) or POI (1): | |
12279 | t = 1; | |
489d5531 | 12280 | } else if(type == "RP") |
3b552efe | 12281 | { |
489d5531 | 12282 | // to be improved (cross-checked): |
12283 | p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
12284 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
12285 | p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
12286 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
12287 | mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
12288 | // M01 from Eq. (118) in QC2c (to be improved (notation)): | |
3b552efe | 12289 | dM01 = mp*dSM1p1k-s1p1k; |
12290 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
489d5531 | 12291 | - 2.*(s1p1k*dSM1p1k-s1p2k); |
12292 | // typeFlag = RP (0) or POI (1): | |
3b552efe | 12293 | t = 0; |
12294 | } | |
12295 | ||
489d5531 | 12296 | // <<sin n(psi1)>>: |
12297 | Double_t sinP1nPsi = 0.; | |
12298 | if(mp) | |
12299 | { | |
12300 | sinP1nPsi = p1n0kIm/mp; | |
12301 | ||
12302 | // fill profile for <<sin n(psi1)>>: | |
12303 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi,mp); | |
12304 | // histogram to store <sin n(psi1)> e-b-e (needed in some other methods): | |
12305 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][0]->SetBinContent(b,sinP1nPsi); | |
46b94261 | 12306 | } // end of if(mp) |
12307 | ||
489d5531 | 12308 | // <<w2 sin n(psi1+phi2)>>: |
12309 | Double_t sinP1nPsiP1nPhiW2 = 0.; | |
12310 | if(dM01) | |
12311 | { | |
12312 | sinP1nPsiP1nPhiW2 = (p1n0kRe*dImQ1n1k+p1n0kIm*dReQ1n1k-q2n1kIm)/(dM01); | |
12313 | // fill profile for <<w2 sin n(psi1+phi2)>>: | |
12314 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsiP1nPhiW2,dM01); | |
12315 | // histogram to store <w2 sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
12316 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][1]->SetBinContent(b,sinP1nPsiP1nPhiW2); | |
12317 | } // end of if(mp*dMult-mq) | |
12318 | ||
12319 | // <<w2 w3 sin n(psi1+phi2-phi3)>>: | |
12320 | Double_t sinP1nPsi1P1nPhi2MPhi3W2W3 = 0.; | |
12321 | if(dM011) | |
12322 | { | |
46b94261 | 12323 | sinP1nPsi1P1nPhi2MPhi3W2W3 = (p1n0kIm*(pow(dImQ1n1k,2.)+pow(dReQ1n1k,2.)) |
12324 | - p1n0kIm*dSM1p2k | |
12325 | + q2n1kRe*dImQ1n1k-q2n1kIm*dReQ1n1k | |
12326 | - s1p1k*dImQ1n1k | |
12327 | + 2.*q1n2kIm) | |
12328 | / dM011; | |
489d5531 | 12329 | // fill profile for <<w2 w3 sin n(psi1+phi2-phi3)>>: |
12330 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1P1nPhi2MPhi3W2W3,dM011); | |
12331 | // histogram to store <w2 w3 sin n(psi1+phi2-phi3)> e-b-e (needed in some other methods): | |
12332 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][2]->SetBinContent(b,sinP1nPsi1P1nPhi2MPhi3W2W3); | |
12333 | } // end of if(dM011) | |
12334 | ||
12335 | // <<w2 w3 sin n(psi1-phi2-phi3)>>: | |
12336 | Double_t sinP1nPsi1M1nPhi2MPhi3W2W3 = 0.; | |
12337 | if(dM011) | |
12338 | { | |
12339 | sinP1nPsi1M1nPhi2MPhi3W2W3 = (p1n0kIm*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))-2.*p1n0kRe*dReQ1n1k*dImQ1n1k | |
12340 | + 1.*(p1n0kRe*dImQ2n2k-p1n0kIm*dReQ2n2k) | |
46b94261 | 12341 | + 2.*s1p1k*dImQ1n1k |
489d5531 | 12342 | - 2.*q1n2kIm) |
12343 | / dM011; | |
12344 | // fill profile for <<w2 w3 sin n(psi1-phi2-phi3)>>: | |
12345 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1M1nPhi2MPhi3W2W3,dM011); | |
12346 | // histogram to store <w2 w3 sin n(psi1-phi2-phi3)> e-b-e (needed in some other methods): | |
12347 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][3]->SetBinContent(b,sinP1nPsi1M1nPhi2MPhi3W2W3); | |
12348 | } // end of if(dM011) | |
12349 | ||
12350 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
12351 | ||
12352 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights(TString type, TString ptOrEta) | |
12353 | ||
12354 | ||
12355 | //================================================================================================================================ | |
12356 | ||
12357 | ||
0328db2d | 12358 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 12359 | { |
57340a27 | 12360 | // Evaluate with nested loops correction terms for non-uniform acceptance |
489d5531 | 12361 | // with using particle weights (both sin and cos terms) relevant for differential flow. |
12362 | ||
57340a27 | 12363 | // Remark 1: "w1" in expressions bellow is a particle weight used only for particles which were |
12364 | // flagged both as POI and RP. | |
489d5531 | 12365 | // Remark 2: Reduced correction terms for non-uniform acceptance are evaluated in pt bin number fCrossCheckInPtBinNo |
12366 | // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
12367 | // Remark 3: Results are stored in 1 bin profiles fDiffFlowDirectCorrections[t][pe][sc][cti], where first three indices runs as: | |
12368 | // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms], whilst the cti (correction term index) runs as follows: | |
12369 | // cti: | |
12370 | // 0: <<sc n(psi1)>> | |
12371 | // 1: <<w2 sc n(psi1+phi2)>> | |
12372 | // 2: <<w2 w3 sc n(psi1+phi2-phi3)>> | |
12373 | // 3: <<w2 w3 sc n(psi1-phi2-phi3)>> | |
12374 | // 4: | |
12375 | // 5: | |
12376 | // 6: | |
46b94261 | 12377 | |
489d5531 | 12378 | Int_t typeFlag = -1; |
12379 | Int_t ptEtaFlag = -1; | |
12380 | if(type == "RP") | |
12381 | { | |
12382 | typeFlag = 0; | |
12383 | } else if(type == "POI") | |
12384 | { | |
12385 | typeFlag = 1; | |
12386 | } | |
12387 | if(ptOrEta == "Pt") | |
12388 | { | |
12389 | ptEtaFlag = 0; | |
12390 | } else if(ptOrEta == "Eta") | |
12391 | { | |
12392 | ptEtaFlag = 1; | |
12393 | } | |
12394 | // shortcuts: | |
12395 | Int_t t = typeFlag; | |
12396 | Int_t pe = ptEtaFlag; | |
12397 | ||
12398 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12399 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12400 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
12401 | ||
12402 | Int_t nPrim = anEvent->NumberOfTracks(); | |
12403 | AliFlowTrackSimple *aftsTrack = NULL; | |
12404 | ||
12405 | Double_t psi1=0., phi2=0., phi3=0.;// phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
12406 | Double_t wPhi2=1., wPhi3=1.; | |
12407 | ||
12408 | Int_t n = fHarmonic; | |
12409 | ||
12410 | // 1'-particle correction terms: | |
12411 | for(Int_t i1=0;i1<nPrim;i1++) | |
12412 | { | |
12413 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12414 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12415 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12416 | { |
12417 | if(ptOrEta == "Pt") | |
12418 | { | |
12419 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12420 | } else if (ptOrEta == "Eta") | |
12421 | { | |
12422 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12423 | } |
12424 | } else // this is diff flow of RPs | |
12425 | { | |
489d5531 | 12426 | if(ptOrEta == "Pt") |
12427 | { | |
12428 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12429 | } else if (ptOrEta == "Eta") | |
12430 | { | |
12431 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12432 | } |
489d5531 | 12433 | } |
12434 | psi1=aftsTrack->Phi(); | |
12435 | // sin terms: | |
12436 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*psi1),1.); // <<sin(n*(psi1))>> | |
12437 | // cos terms: | |
12438 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*psi1),1.); // <<cos(n*(psi1))>> | |
12439 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12440 | ||
12441 | // 2'-particle correction terms: | |
12442 | for(Int_t i1=0;i1<nPrim;i1++) | |
12443 | { | |
12444 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12445 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12446 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12447 | { |
12448 | if(ptOrEta == "Pt") | |
12449 | { | |
12450 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12451 | } else if (ptOrEta == "Eta") | |
12452 | { | |
12453 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12454 | } |
12455 | } else // this is diff flow of RPs | |
12456 | { | |
489d5531 | 12457 | if(ptOrEta == "Pt") |
12458 | { | |
12459 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12460 | } else if (ptOrEta == "Eta") | |
12461 | { | |
12462 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12463 | } |
489d5531 | 12464 | } |
12465 | psi1=aftsTrack->Phi(); | |
12466 | for(Int_t i2=0;i2<nPrim;i2++) | |
12467 | { | |
12468 | if(i2==i1) continue; | |
12469 | aftsTrack=anEvent->GetTrack(i2); | |
12470 | // RP condition (!(first) particle in the correlator must be RP): | |
12471 | if(!(aftsTrack->InRPSelection())) continue; | |
46b94261 | 12472 | phi2=aftsTrack->Phi(); |
489d5531 | 12473 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); |
12474 | // sin terms: | |
12475 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2)),wPhi2); // <<w2 sin(n*(psi1+phi2))>> | |
12476 | // cos terms: | |
12477 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2)),wPhi2); // <<w2 cos(n*(psi1+phi2))>> | |
12478 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12479 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12480 | ||
12481 | // 3'-particle correction terms: | |
12482 | for(Int_t i1=0;i1<nPrim;i1++) | |
12483 | { | |
12484 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12485 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12486 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12487 | { |
12488 | if(ptOrEta == "Pt") | |
12489 | { | |
12490 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12491 | } else if (ptOrEta == "Eta") | |
12492 | { | |
12493 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12494 | } |
12495 | } else // this is diff flow of RPs | |
12496 | { | |
489d5531 | 12497 | if(ptOrEta == "Pt") |
12498 | { | |
12499 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12500 | } else if (ptOrEta == "Eta") | |
12501 | { | |
12502 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12503 | } |
489d5531 | 12504 | } |
12505 | psi1=aftsTrack->Phi(); | |
12506 | for(Int_t i2=0;i2<nPrim;i2++) | |
12507 | { | |
12508 | if(i2==i1) continue; | |
12509 | aftsTrack=anEvent->GetTrack(i2); | |
12510 | // RP condition (!(first) particle in the correlator must be RP): | |
12511 | if(!(aftsTrack->InRPSelection())) continue; | |
12512 | phi2=aftsTrack->Phi(); | |
12513 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
12514 | for(Int_t i3=0;i3<nPrim;i3++) | |
12515 | { | |
12516 | if(i3==i1||i3==i2) continue; | |
12517 | aftsTrack=anEvent->GetTrack(i3); | |
12518 | // RP condition (!(first) particle in the correlator must be RP): | |
12519 | if(!(aftsTrack->InRPSelection())) continue; | |
12520 | phi3=aftsTrack->Phi(); | |
12521 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
12522 | // sin terms: | |
12523 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 sin(n*(psi1+phi2-phi3))>> | |
12524 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1-phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 sin(n*(psi1-phi2-phi3))>> | |
12525 | // cos terms: | |
12526 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 cos(n*(psi1+phi2-phi3))>> | |
12527 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 cos(n*(psi1-phi2-phi3))>> | |
12528 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
12529 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
46b94261 | 12530 | }//end of for(Int_t i1=0;i1<nPrim;i1++) |
489d5531 | 12531 | |
12532 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
12533 | ||
2001bc3a | 12534 | //================================================================================================================================ |
12535 | ||
12536 | void AliFlowAnalysisWithQCumulants::CalculateDetectorEffectsForTrueCorrelations() | |
12537 | { | |
12538 | // Quantify detector effects for true correlations. | |
12539 | ||
12540 | // to be improved: add protection for the pointers used in this method | |
12541 | ||
12542 | Double_t measured[4] = {0.}; // measured true correlation (a.k.a. cumulant) | |
12543 | Double_t corrected[4] = {0.}; // true correlation corrected for detector effects (a.k.a. generalized cumulant) | |
12544 | ||
12545 | // measured correlations: | |
12546 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> | |
12547 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> | |
12548 | Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> | |
12549 | Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> | |
12550 | // measured true correlations (a.k.a. cumulants): | |
12551 | if(two) measured[0] = two; | |
12552 | if(four) measured[1] = four-2.*pow(two,2.); | |
12553 | if(six) measured[2] = six-9.*two*four+12.*pow(two,3.); | |
12554 | if(eight) measured[3] = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.); | |
12555 | ||
12556 | for(Int_t ci=0;ci<=1;ci++) // correlation index // to be improved (enabled also for QC{6} and QC{8} eventually) | |
12557 | { | |
12558 | corrected[ci] = fIntFlowQcumulants->GetBinContent(ci+1); | |
12559 | if(TMath::Abs(measured[ci])>1.e-44) | |
12560 | { | |
12561 | fIntFlowDetectorBias->SetBinContent(ci+1,corrected[ci]/measured[ci]); | |
12562 | } | |
12563 | } // end of for(Int_t ci=1;ci<=4;ci++) // correlation index | |
12564 | ||
b3dacf6b | 12565 | // Versus multiplicity: |
12566 | if(!fCalculateCumulantsVsM){return;} | |
12567 | if(!fApplyCorrectionForNUAVsM){return;} | |
2001bc3a | 12568 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) |
12569 | for(Int_t b=1;b<=nBins;b++) | |
12570 | { | |
12571 | // measured correlations vs M: | |
12572 | two = fIntFlowCorrelationsVsMHist[0]->GetBinContent(b); // <<2>> | |
12573 | four = fIntFlowCorrelationsVsMHist[1]->GetBinContent(b); // <<4>> | |
12574 | six = fIntFlowCorrelationsVsMHist[2]->GetBinContent(b); // <<6>> | |
12575 | eight = fIntFlowCorrelationsVsMHist[3]->GetBinContent(b); // <<8>> | |
12576 | // measured true correlations (a.k.a. cumulants) vs M: | |
12577 | measured[0] = 0.; // QC{2} vs M | |
12578 | measured[1] = 0.; // QC{4} vs M | |
12579 | measured[2] = 0.; // QC{6} vs M | |
12580 | measured[3] = 0.; // QC{8} vs M | |
12581 | if(two) measured[0] = two; | |
12582 | if(four) measured[1] = four-2.*pow(two,2.); | |
12583 | if(six) measured[2] = six-9.*two*four+12.*pow(two,3.); | |
12584 | if(eight) measured[3] = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.); | |
12585 | corrected[0] = 0.; // generalized QC{2} vs M | |
12586 | corrected[1] = 0.; // generalized QC{4} vs M | |
12587 | corrected[2] = 0.; // generalized QC{6} vs M | |
12588 | corrected[3] = 0.; // generalized QC{8} vs M | |
12589 | for(Int_t ci=0;ci<=1;ci++) // correlation index // to be improved (enabled also for QC{6} and QC{8} eventually) | |
12590 | { | |
12591 | corrected[ci] = fIntFlowQcumulantsVsM[ci]->GetBinContent(b); | |
12592 | if(TMath::Abs(measured[ci])>1.e-44) | |
12593 | { | |
12594 | fIntFlowDetectorBiasVsM[ci]->SetBinContent(b,corrected[ci]/measured[ci]); | |
12595 | } | |
12596 | } // end of for(Int_t ci=1;ci<=4;ci++) // correlation index | |
12597 | } // end of for(Int_t b=1;b<=nBins;b++) | |
489d5531 | 12598 | |
2001bc3a | 12599 | } // end of AliFlowAnalysisWithQCumulants::CalculateDetectorEffectsForTrueCorrelations() |
57340a27 | 12600 | |
b3dacf6b | 12601 | //================================================================================================================================ |
57340a27 | 12602 | |
b3dacf6b | 12603 | void AliFlowAnalysisWithQCumulants::CheckPointersUsedInFinish() |
12604 | { | |
12605 | // Check all pointers used in method Finish(). | |
12606 | ||
12607 | if(!fIntFlowCorrelationsPro) | |
12608 | { | |
12609 | cout<<endl; | |
12610 | cout<<" WARNING (QC): fIntFlowCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12611 | cout<<endl; | |
12612 | exit(0); | |
12613 | } | |
12614 | if(!fIntFlowCorrelationsHist) | |
12615 | { | |
12616 | cout<<endl; | |
12617 | cout<<" WARNING (QC): fIntFlowCorrelationsHist is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12618 | cout<<endl; | |
12619 | exit(0); | |
12620 | } | |
12621 | for(Int_t power=0;power<2;power++) | |
12622 | { | |
12623 | if(!fIntFlowSumOfEventWeights[power]) | |
12624 | { | |
12625 | cout<<endl; | |
12626 | cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeights[%d] is NULL in CheckPointersUsedInFinish() !!!!",power)<<endl; | |
12627 | cout<<endl; | |
12628 | exit(0); | |
12629 | } | |
12630 | } // end of for(Int_t power=0;power<2;power++) | |
12631 | if(!fIntFlowProductOfCorrelationsPro) | |
12632 | { | |
12633 | cout<<endl; | |
12634 | cout<<" WARNING (QC): fIntFlowProductOfCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12635 | cout<<endl; | |
12636 | exit(0); | |
12637 | } | |
12638 | if(!fIntFlowSumOfProductOfEventWeights) | |
12639 | { | |
12640 | cout<<endl; | |
12641 | cout<<" WARNING (QC): fIntFlowSumOfProductOfEventWeights is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12642 | cout<<endl; | |
12643 | exit(0); | |
12644 | } | |
12645 | if(!fIntFlowCovariances) | |
12646 | { | |
12647 | cout<<endl; | |
12648 | cout<<" WARNING (QC): fIntFlowCovariances is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12649 | cout<<endl; | |
12650 | exit(0); | |
12651 | } | |
12652 | if(!fIntFlowQcumulants) | |
12653 | { | |
12654 | cout<<endl; | |
12655 | cout<<" WARNING (QC): fIntFlowQcumulants is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12656 | cout<<endl; | |
12657 | exit(0); | |
12658 | } | |
0dd3b008 | 12659 | if(!fIntFlow) |
12660 | { | |
12661 | cout<<endl; | |
12662 | cout<<" WARNING (QC): fIntFlow is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12663 | cout<<endl; | |
12664 | exit(0); | |
12665 | } | |
12666 | if(!fCommonHists) | |
12667 | { | |
12668 | cout<<endl; | |
12669 | cout<<" WARNING (QC): fCommonHists is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12670 | cout<<endl; | |
12671 | exit(0); | |
12672 | } | |
12673 | if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th)) | |
12674 | { | |
12675 | cout<<endl; | |
12676 | cout<<" WARNING (QC): fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th"<<endl; | |
12677 | cout<<" && fCommonHistsResults8th is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12678 | cout<<endl; | |
12679 | exit(0); | |
12680 | } | |
b3dacf6b | 12681 | |
12682 | // Versus multiplicity: | |
12683 | if(!fCalculateCumulantsVsM){return;} | |
12684 | for(Int_t ci=0;ci<=3;ci++) // correlation index | |
12685 | { | |
12686 | if(!fIntFlowCorrelationsVsMPro[ci]) | |
12687 | { | |
12688 | cout<<endl; | |
12689 | cout<<Form(" WARNING (QC): fIntFlowCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl; | |
12690 | cout<<endl; | |
12691 | exit(0); | |
12692 | } | |
12693 | if(!fIntFlowCorrelationsVsMHist[ci]) | |
12694 | { | |
12695 | cout<<endl; | |
12696 | cout<<Form(" WARNING (QC): fIntFlowCorrelationsVsMHist[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl; | |
12697 | cout<<endl; | |
12698 | exit(0); | |
12699 | } | |
12700 | for(Int_t power=0;power<2;power++) | |
12701 | { | |
12702 | if(!fIntFlowSumOfEventWeightsVsM[ci][power]) | |
12703 | { | |
12704 | cout<<endl; | |
12705 | cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeightsVsM[%d][%d] is NULL in CheckPointersUsedInFinish() !!!!",ci,power)<<endl; | |
12706 | cout<<endl; | |
12707 | exit(0); | |
12708 | } | |
12709 | } // end of for(Int_t power=0;power<2;power++) | |
12710 | } // end of for(Int_t ci=0;ci<=3;ci++) // correlation index | |
12711 | for(Int_t i=0;i<6;i++) | |
12712 | { | |
12713 | if(!fIntFlowProductOfCorrelationsVsMPro[i]) | |
12714 | { | |
12715 | cout<<endl; | |
12716 | cout<<Form(" WARNING (QC): fIntFlowProductOfCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl; | |
12717 | cout<<endl; | |
12718 | exit(0); | |
12719 | } | |
12720 | if(!fIntFlowSumOfProductOfEventWeightsVsM[i]) | |
12721 | { | |
12722 | cout<<endl; | |
12723 | cout<<Form(" WARNING (QC): fIntFlowSumOfProductOfEventWeightsVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl; | |
12724 | cout<<endl; | |
12725 | exit(0); | |
12726 | } | |
12727 | if(!fIntFlowCovariancesVsM[i]) | |
12728 | { | |
12729 | cout<<endl; | |
12730 | cout<<Form(" WARNING (QC): fIntFlowCovariancesVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl; | |
12731 | cout<<endl; | |
12732 | exit(0); | |
12733 | } | |
12734 | } // end of for(Int_t i=0;i<6;i++) | |
12735 | if(!fIntFlowRebinnedInM) | |
12736 | { | |
12737 | cout<<endl; | |
12738 | cout<<" WARNING (QC): fIntFlowRebinnedInM is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12739 | cout<<endl; | |
12740 | exit(0); | |
12741 | } | |
12742 | if(!fIntFlowQcumulantsRebinnedInM) | |
12743 | { | |
12744 | cout<<endl; | |
12745 | cout<<" WARNING (QC): fIntFlowQcumulantsRebinnedInM is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
12746 | cout<<endl; | |
12747 | exit(0); | |
12748 | } | |
12749 | ||
12750 | } // end of void AliFlowAnalysisWithQCumulants::CheckPointersUsedInFinish() | |
12751 | ||
12752 | //================================================================================================================================ | |
12753 | ||
12754 | void AliFlowAnalysisWithQCumulants::CheckPointersUsedInMake() | |
12755 | { | |
12756 | // Check all pointers used in method Make(). | |
12757 | ||
12758 | ||
12759 | } // end of void AliFlowAnalysisWithQCumulants::CheckPointersUsedInMake() | |
12760 | ||
57340a27 | 12761 |