]>
Commit | Line | Data |
---|---|---|
489d5531 | 1 | /************************************************************************* |
2 | * Copyright(c) 1998-2008, ALICE Experiment at CERN, All rights reserved. * | |
3 | * * | |
4 | * Author: The ALICE Off-line Project. * | |
5 | * Contributors are mentioned in the code where appropriate. * | |
6 | * * | |
7 | * Permission to use, copy, modify and distribute this software and its * | |
8 | * documentation strictly for non-commercial purposes is hereby granted * | |
9 | * without fee, provided that the above copyright notice appears in all * | |
10 | * copies and that both the copyright notice and this permission notice * | |
11 | * appear in the supporting documentation. The authors make no claims * | |
12 | * about the suitability of this software for any purpose. It is * | |
13 | * provided "as is" without express or implied warranty. * | |
14 | **************************************************************************/ | |
15 | ||
16 | /********************************** | |
17 | * flow analysis with Q-cumulants * | |
18 | * * | |
ff70ca91 | 19 | * author: Ante Bilandzic * |
20 | * (abilandzic@gmail.com) * | |
489d5531 | 21 | *********************************/ |
22 | ||
23 | #define AliFlowAnalysisWithQCumulants_cxx | |
24 | ||
25 | #include "Riostream.h" | |
26 | #include "AliFlowCommonConstants.h" | |
27 | #include "AliFlowCommonHist.h" | |
28 | #include "AliFlowCommonHistResults.h" | |
29 | #include "TChain.h" | |
30 | ||
31 | #include "TFile.h" | |
32 | #include "TList.h" | |
33 | #include "TGraph.h" | |
34 | #include "TParticle.h" | |
35 | #include "TRandom3.h" | |
36 | #include "TStyle.h" | |
37 | #include "TProfile.h" | |
38 | #include "TProfile2D.h" | |
489d5531 | 39 | #include "TMath.h" |
40 | #include "TArrow.h" | |
41 | #include "TPaveLabel.h" | |
42 | #include "TCanvas.h" | |
43 | #include "AliFlowEventSimple.h" | |
44 | #include "AliFlowTrackSimple.h" | |
45 | #include "AliFlowAnalysisWithQCumulants.h" | |
46 | #include "TArrayD.h" | |
47 | #include "TRandom.h" | |
48 | #include "TF1.h" | |
49 | ||
50 | class TH1; | |
51 | class TH2; | |
52 | class TGraph; | |
53 | class TPave; | |
54 | class TLatex; | |
55 | class TMarker; | |
56 | class TRandom3; | |
57 | class TObjArray; | |
58 | class TList; | |
59 | class TCanvas; | |
60 | class TSystem; | |
61 | class TROOT; | |
62 | class AliFlowVector; | |
63 | class TVector; | |
64 | ||
489d5531 | 65 | //================================================================================================================ |
66 | ||
489d5531 | 67 | ClassImp(AliFlowAnalysisWithQCumulants) |
68 | ||
69 | AliFlowAnalysisWithQCumulants::AliFlowAnalysisWithQCumulants(): | |
70 | // 0.) base: | |
71 | fHistList(NULL), | |
72 | // 1.) common: | |
73 | fCommonHists(NULL), | |
74 | fCommonHists2nd(NULL), | |
75 | fCommonHists4th(NULL), | |
76 | fCommonHists6th(NULL), | |
77 | fCommonHists8th(NULL), | |
78 | fCommonHistsResults2nd(NULL), | |
79 | fCommonHistsResults4th(NULL), | |
80 | fCommonHistsResults6th(NULL), | |
81 | fCommonHistsResults8th(NULL), | |
82 | fnBinsPhi(0), | |
83 | fPhiMin(0), | |
84 | fPhiMax(0), | |
85 | fPhiBinWidth(0), | |
86 | fnBinsPt(0), | |
87 | fPtMin(0), | |
88 | fPtMax(0), | |
89 | fPtBinWidth(0), | |
90 | fnBinsEta(0), | |
91 | fEtaMin(0), | |
92 | fEtaMax(0), | |
93 | fEtaBinWidth(0), | |
1268c371 | 94 | fCommonConstants(NULL), |
dd442cd2 | 95 | fFillMultipleControlHistograms(kFALSE), |
489d5531 | 96 | fHarmonic(2), |
97 | fAnalysisLabel(NULL), | |
98 | // 2a.) particle weights: | |
99 | fWeightsList(NULL), | |
100 | fUsePhiWeights(kFALSE), | |
101 | fUsePtWeights(kFALSE), | |
102 | fUseEtaWeights(kFALSE), | |
403e3389 | 103 | fUseTrackWeights(kFALSE), |
489d5531 | 104 | fUseParticleWeights(NULL), |
105 | fPhiWeights(NULL), | |
106 | fPtWeights(NULL), | |
107 | fEtaWeights(NULL), | |
108 | // 2b.) event weights: | |
109 | fMultiplicityWeight(NULL), | |
110 | // 3.) integrated flow: | |
111 | fIntFlowList(NULL), | |
112 | fIntFlowProfiles(NULL), | |
113 | fIntFlowResults(NULL), | |
3435cacb | 114 | fIntFlowAllCorrelationsVsM(NULL), |
489d5531 | 115 | fIntFlowFlags(NULL), |
b92ea2b9 | 116 | fApplyCorrectionForNUA(kFALSE), |
2001bc3a | 117 | fApplyCorrectionForNUAVsM(kFALSE), |
9da1a4f3 | 118 | fnBinsMult(10000), |
067e9bc8 | 119 | fMinMult(0.), |
120 | fMaxMult(10000.), | |
b77b6434 | 121 | fPropagateErrorAlsoFromNIT(kFALSE), |
8ed4edc7 | 122 | fCalculateCumulantsVsM(kFALSE), |
3435cacb | 123 | fCalculateAllCorrelationsVsM(kFALSE), |
0dd3b008 | 124 | fMinimumBiasReferenceFlow(kTRUE), |
e5834fcb | 125 | fForgetAboutCovariances(kFALSE), |
126 | fStorePhiDistributionForOneEvent(kFALSE), | |
489d5531 | 127 | fReQ(NULL), |
128 | fImQ(NULL), | |
1268c371 | 129 | fSpk(NULL), |
489d5531 | 130 | fIntFlowCorrelationsEBE(NULL), |
131 | fIntFlowEventWeightsForCorrelationsEBE(NULL), | |
132 | fIntFlowCorrelationsAllEBE(NULL), | |
e5834fcb | 133 | fReferenceMultiplicityEBE(0.), |
489d5531 | 134 | fAvMultiplicity(NULL), |
135 | fIntFlowCorrelationsPro(NULL), | |
b40a910e | 136 | fIntFlowSquaredCorrelationsPro(NULL), |
489d5531 | 137 | fIntFlowCorrelationsAllPro(NULL), |
138 | fIntFlowExtraCorrelationsPro(NULL), | |
139 | fIntFlowProductOfCorrelationsPro(NULL), | |
0328db2d | 140 | fIntFlowProductOfCorrectionTermsForNUAPro(NULL), |
489d5531 | 141 | fIntFlowCorrelationsHist(NULL), |
142 | fIntFlowCorrelationsAllHist(NULL), | |
143 | fIntFlowCovariances(NULL), | |
144 | fIntFlowSumOfProductOfEventWeights(NULL), | |
0328db2d | 145 | fIntFlowCovariancesNUA(NULL), |
146 | fIntFlowSumOfProductOfEventWeightsNUA(NULL), | |
489d5531 | 147 | fIntFlowQcumulants(NULL), |
b92ea2b9 | 148 | fIntFlowQcumulantsRebinnedInM(NULL), |
149 | fIntFlowQcumulantsErrorSquaredRatio(NULL), | |
489d5531 | 150 | fIntFlow(NULL), |
b3dacf6b | 151 | fIntFlowRebinnedInM(NULL), |
2001bc3a | 152 | fIntFlowDetectorBias(NULL), |
489d5531 | 153 | // 4.) differential flow: |
154 | fDiffFlowList(NULL), | |
155 | fDiffFlowProfiles(NULL), | |
156 | fDiffFlowResults(NULL), | |
1268c371 | 157 | fDiffFlow2D(NULL), |
489d5531 | 158 | fDiffFlowFlags(NULL), |
1268c371 | 159 | fCalculateDiffFlow(kTRUE), |
160 | fCalculate2DDiffFlow(kFALSE), | |
64e500e3 | 161 | // 5.) other differential correlators: |
162 | fOtherDiffCorrelatorsList(NULL), | |
163 | // 6.) distributions: | |
57340a27 | 164 | fDistributionsList(NULL), |
165 | fDistributionsFlags(NULL), | |
489d5531 | 166 | fStoreDistributions(kFALSE), |
64e500e3 | 167 | // 7.) various: |
e5834fcb | 168 | fVariousList(NULL), |
169 | fPhiDistributionForOneEvent(NULL), | |
489d5531 | 170 | // x.) debugging and cross-checking: |
171 | fNestedLoopsList(NULL), | |
172 | fEvaluateIntFlowNestedLoops(kFALSE), | |
173 | fEvaluateDiffFlowNestedLoops(kFALSE), | |
174 | fMaxAllowedMultiplicity(10), | |
175 | fEvaluateNestedLoops(NULL), | |
176 | fIntFlowDirectCorrelations(NULL), | |
177 | fIntFlowExtraDirectCorrelations(NULL), | |
178 | fCrossCheckInPtBinNo(10), | |
3b552efe | 179 | fCrossCheckInEtaBinNo(20), |
489d5531 | 180 | fNoOfParticlesInBin(NULL) |
181 | { | |
182 | // constructor | |
183 | ||
184 | // base list to hold all output objects: | |
185 | fHistList = new TList(); | |
186 | fHistList->SetName("cobjQC"); | |
187 | fHistList->SetOwner(kTRUE); | |
188 | ||
189 | // list to hold histograms with phi, pt and eta weights: | |
190 | fWeightsList = new TList(); | |
191 | ||
192 | // multiplicity weight: | |
193 | fMultiplicityWeight = new TString("combinations"); | |
194 | ||
195 | // analysis label; | |
196 | fAnalysisLabel = new TString(); | |
197 | ||
198 | // initialize all arrays: | |
199 | this->InitializeArraysForIntFlow(); | |
200 | this->InitializeArraysForDiffFlow(); | |
201 | this->InitializeArraysForDistributions(); | |
e5834fcb | 202 | this->InitializeArraysForVarious(); |
489d5531 | 203 | this->InitializeArraysForNestedLoops(); |
204 | ||
205 | } // end of constructor | |
206 | ||
489d5531 | 207 | //================================================================================================================ |
208 | ||
489d5531 | 209 | AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants() |
210 | { | |
211 | // destructor | |
212 | ||
213 | delete fHistList; | |
214 | ||
215 | } // end of AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants() | |
216 | ||
489d5531 | 217 | //================================================================================================================ |
218 | ||
489d5531 | 219 | void AliFlowAnalysisWithQCumulants::Init() |
220 | { | |
3b552efe | 221 | // a) Cross check if the settings make sense before starting the QC adventure; |
489d5531 | 222 | // b) Access all common constants; |
223 | // c) Book all objects; | |
3b552efe | 224 | // d) Store flags for integrated and differential flow; |
489d5531 | 225 | // e) Store flags for distributions of corelations; |
226 | // f) Store harmonic which will be estimated. | |
3b552efe | 227 | |
489d5531 | 228 | //save old value and prevent histograms from being added to directory |
229 | //to avoid name clashes in case multiple analaysis objects are used | |
230 | //in an analysis | |
231 | Bool_t oldHistAddStatus = TH1::AddDirectoryStatus(); | |
232 | TH1::AddDirectory(kFALSE); | |
233 | ||
3b552efe | 234 | // a) Cross check if the settings make sense before starting the QC adventure; |
489d5531 | 235 | this->CrossCheckSettings(); |
1268c371 | 236 | // b) Access all common constants and book a profile to hold them: |
237 | this->CommonConstants("Init"); | |
489d5531 | 238 | // c) Book all objects: |
1268c371 | 239 | this->BookAndFillWeightsHistograms(); |
489d5531 | 240 | this->BookAndNestAllLists(); |
241 | this->BookCommonHistograms(); | |
242 | this->BookEverythingForIntegratedFlow(); | |
243 | this->BookEverythingForDifferentialFlow(); | |
1268c371 | 244 | this->BookEverythingFor2DDifferentialFlow(); |
489d5531 | 245 | this->BookEverythingForDistributions(); |
e5834fcb | 246 | this->BookEverythingForVarious(); |
489d5531 | 247 | this->BookEverythingForNestedLoops(); |
248 | // d) Store flags for integrated and differential flow: | |
249 | this->StoreIntFlowFlags(); | |
3b552efe | 250 | this->StoreDiffFlowFlags(); |
489d5531 | 251 | // e) Store flags for distributions of corelations: |
252 | this->StoreFlagsForDistributions(); | |
253 | // f) Store harmonic which will be estimated: | |
254 | this->StoreHarmonic(); | |
255 | ||
256 | TH1::AddDirectory(oldHistAddStatus); | |
257 | } // end of void AliFlowAnalysisWithQCumulants::Init() | |
258 | ||
489d5531 | 259 | //================================================================================================================ |
260 | ||
489d5531 | 261 | void AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent) |
262 | { | |
263 | // Running over data only in this method. | |
264 | ||
b3dacf6b | 265 | // a) Check all pointers used in this method; |
266 | // b) Define local variables; | |
267 | // c) Fill the common control histograms and call the method to fill fAvMultiplicity; | |
1268c371 | 268 | // d) Loop over data and calculate e-b-e quantities Q_{n,k}, S_{p,k} and s_{p,k}; |
269 | // e) Calculate the final expressions for S_{p,k} and s_{p,k} (important !!!!); | |
270 | // f) Call the methods which calculate correlations for reference flow; | |
271 | // g) Call the methods which calculate correlations for differential flow; | |
272 | // h) Call the methods which calculate correlations for 2D differential flow; | |
64e500e3 | 273 | // i) Call the methods which calculate other differential correlators; |
274 | // j) Distributions of correlations; | |
275 | // k) Store phi distribution for one event to illustrate flow; | |
276 | // l) Cross-check with nested loops correlators for reference flow; | |
277 | // m) Cross-check with nested loops correlators for differential flow; | |
278 | // n) Reset all event-by-event quantities (very important !!!!). | |
489d5531 | 279 | |
b3dacf6b | 280 | // a) Check all pointers used in this method: |
281 | this->CheckPointersUsedInMake(); | |
282 | ||
283 | // b) Define local variables: | |
489d5531 | 284 | Double_t dPhi = 0.; // azimuthal angle in the laboratory frame |
285 | Double_t dPt = 0.; // transverse momentum | |
286 | Double_t dEta = 0.; // pseudorapidity | |
489d5531 | 287 | Double_t wPhi = 1.; // phi weight |
288 | Double_t wPt = 1.; // pt weight | |
289 | Double_t wEta = 1.; // eta weight | |
38a1e8b3 | 290 | Double_t wTrack = 1.; // track weight |
1268c371 | 291 | Int_t nRP = anEvent->GetEventNSelTracksRP(); // number of RPs (i.e. number of reference particles) |
e5834fcb | 292 | fReferenceMultiplicityEBE = anEvent->GetReferenceMultiplicity(); // reference multiplicity for current event |
1268c371 | 293 | Double_t ptEta[2] = {0.,0.}; // 0 = dPt, 1 = dEta |
9f33751d | 294 | |
b3dacf6b | 295 | // c) Fill the common control histograms and call the method to fill fAvMultiplicity: |
489d5531 | 296 | this->FillCommonControlHistograms(anEvent); |
297 | this->FillAverageMultiplicities(nRP); | |
298 | ||
1268c371 | 299 | // d) Loop over data and calculate e-b-e quantities Q_{n,k}, S_{p,k} and s_{p,k}: |
9f33751d | 300 | Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = total number of primary tracks, i.e. nPrim = nRP + nPOI where: |
1268c371 | 301 | // nRP = # of reference particles; |
302 | // nPOI = # of particles of interest. | |
489d5531 | 303 | AliFlowTrackSimple *aftsTrack = NULL; |
1268c371 | 304 | Int_t n = fHarmonic; // shortcut for the harmonic |
489d5531 | 305 | for(Int_t i=0;i<nPrim;i++) |
306 | { | |
307 | aftsTrack=anEvent->GetTrack(i); | |
308 | if(aftsTrack) | |
309 | { | |
1268c371 | 310 | if(!(aftsTrack->InRPSelection() || aftsTrack->InPOISelection())){continue;} // safety measure: consider only tracks which are RPs or POIs |
489d5531 | 311 | if(aftsTrack->InRPSelection()) // RP condition: |
312 | { | |
313 | dPhi = aftsTrack->Phi(); | |
314 | dPt = aftsTrack->Pt(); | |
315 | dEta = aftsTrack->Eta(); | |
316 | if(fUsePhiWeights && fPhiWeights && fnBinsPhi) // determine phi weight for this particle: | |
317 | { | |
318 | wPhi = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(dPhi*fnBinsPhi/TMath::TwoPi()))); | |
319 | } | |
320 | if(fUsePtWeights && fPtWeights && fnBinsPt) // determine pt weight for this particle: | |
321 | { | |
322 | wPt = fPtWeights->GetBinContent(1+(Int_t)(TMath::Floor((dPt-fPtMin)/fPtBinWidth))); | |
323 | } | |
324 | if(fUseEtaWeights && fEtaWeights && fEtaBinWidth) // determine eta weight for this particle: | |
325 | { | |
326 | wEta = fEtaWeights->GetBinContent(1+(Int_t)(TMath::Floor((dEta-fEtaMin)/fEtaBinWidth))); | |
38a1e8b3 | 327 | } |
328 | // Access track weight: | |
403e3389 | 329 | if(fUseTrackWeights) |
330 | { | |
331 | wTrack = aftsTrack->Weight(); | |
332 | } | |
1268c371 | 333 | // Calculate Re[Q_{m*n,k}] and Im[Q_{m*n,k}] for this event (m = 1,2,...,6, k = 0,1,...,8): |
334 | for(Int_t m=0;m<6;m++) // to be improved - hardwired 6 | |
489d5531 | 335 | { |
1268c371 | 336 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 |
489d5531 | 337 | { |
38a1e8b3 | 338 | (*fReQ)(m,k)+=pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1)*n*dPhi); |
339 | (*fImQ)(m,k)+=pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1)*n*dPhi); | |
489d5531 | 340 | } |
341 | } | |
1268c371 | 342 | // Calculate S_{p,k} for this event (Remark: final calculation of S_{p,k} follows after the loop over data bellow): |
489d5531 | 343 | for(Int_t p=0;p<8;p++) |
344 | { | |
345 | for(Int_t k=0;k<9;k++) | |
346 | { | |
38a1e8b3 | 347 | (*fSpk)(p,k)+=pow(wPhi*wPt*wEta*wTrack,k); |
489d5531 | 348 | } |
349 | } | |
1268c371 | 350 | // Differential flow: |
351 | if(fCalculateDiffFlow || fCalculate2DDiffFlow) | |
489d5531 | 352 | { |
1268c371 | 353 | ptEta[0] = dPt; |
354 | ptEta[1] = dEta; | |
355 | // Calculate r_{m*n,k} and s_{p,k} (r_{m,k} is 'p-vector' for RPs): | |
356 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
489d5531 | 357 | { |
1268c371 | 358 | for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 |
489d5531 | 359 | { |
1268c371 | 360 | if(fCalculateDiffFlow) |
361 | { | |
362 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
363 | { | |
38a1e8b3 | 364 | fReRPQ1dEBE[0][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
365 | fImRPQ1dEBE[0][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 366 | if(m==0) // s_{p,k} does not depend on index m |
367 | { | |
38a1e8b3 | 368 | fs1dEBE[0][pe][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k),1.); |
1268c371 | 369 | } // end of if(m==0) // s_{p,k} does not depend on index m |
370 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
371 | } // end of if(fCalculateDiffFlow) | |
372 | if(fCalculate2DDiffFlow) | |
373 | { | |
38a1e8b3 | 374 | fReRPQ2dEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
375 | fImRPQ2dEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 376 | if(m==0) // s_{p,k} does not depend on index m |
377 | { | |
38a1e8b3 | 378 | fs2dEBE[0][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k),1.); |
1268c371 | 379 | } // end of if(m==0) // s_{p,k} does not depend on index m |
380 | } // end of if(fCalculate2DDiffFlow) | |
381 | } // end of for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 | |
382 | } // end of for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
383 | // Checking if RP particle is also POI particle: | |
384 | if(aftsTrack->InPOISelection()) | |
489d5531 | 385 | { |
1268c371 | 386 | // Calculate q_{m*n,k} and s_{p,k} ('q-vector' and 's' for RPs && POIs): |
387 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
489d5531 | 388 | { |
1268c371 | 389 | for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 |
489d5531 | 390 | { |
1268c371 | 391 | if(fCalculateDiffFlow) |
392 | { | |
393 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
394 | { | |
38a1e8b3 | 395 | fReRPQ1dEBE[2][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
396 | fImRPQ1dEBE[2][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 397 | if(m==0) // s_{p,k} does not depend on index m |
398 | { | |
38a1e8b3 | 399 | fs1dEBE[2][pe][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k),1.); |
1268c371 | 400 | } // end of if(m==0) // s_{p,k} does not depend on index m |
401 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
402 | } // end of if(fCalculateDiffFlow) | |
403 | if(fCalculate2DDiffFlow) | |
404 | { | |
38a1e8b3 | 405 | fReRPQ2dEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
406 | fImRPQ2dEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 407 | if(m==0) // s_{p,k} does not depend on index m |
408 | { | |
38a1e8b3 | 409 | fs2dEBE[2][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k),1.); |
1268c371 | 410 | } // end of if(m==0) // s_{p,k} does not depend on index m |
411 | } // end of if(fCalculate2DDiffFlow) | |
412 | } // end of for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 | |
413 | } // end of for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
414 | } // end of if(aftsTrack->InPOISelection()) | |
415 | } // end of if(fCalculateDiffFlow || fCalculate2DDiffFlow) | |
489d5531 | 416 | } // end of if(pTrack->InRPSelection()) |
489d5531 | 417 | if(aftsTrack->InPOISelection()) |
418 | { | |
419 | dPhi = aftsTrack->Phi(); | |
420 | dPt = aftsTrack->Pt(); | |
421 | dEta = aftsTrack->Eta(); | |
38a1e8b3 | 422 | wPhi = 1.; |
423 | wPt = 1.; | |
424 | wEta = 1.; | |
425 | wTrack = 1.; | |
426 | if(fUsePhiWeights && fPhiWeights && fnBinsPhi && aftsTrack->InRPSelection()) // determine phi weight for POI && RP particle: | |
427 | { | |
428 | wPhi = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(dPhi*fnBinsPhi/TMath::TwoPi()))); | |
429 | } | |
430 | if(fUsePtWeights && fPtWeights && fnBinsPt && aftsTrack->InRPSelection()) // determine pt weight for POI && RP particle: | |
431 | { | |
432 | wPt = fPtWeights->GetBinContent(1+(Int_t)(TMath::Floor((dPt-fPtMin)/fPtBinWidth))); | |
433 | } | |
434 | if(fUseEtaWeights && fEtaWeights && fEtaBinWidth && aftsTrack->InRPSelection()) // determine eta weight for POI && RP particle: | |
435 | { | |
436 | wEta = fEtaWeights->GetBinContent(1+(Int_t)(TMath::Floor((dEta-fEtaMin)/fEtaBinWidth))); | |
437 | } | |
438 | // Access track weight for POI && RP particle: | |
403e3389 | 439 | if(aftsTrack->InRPSelection() && fUseTrackWeights) |
38a1e8b3 | 440 | { |
441 | wTrack = aftsTrack->Weight(); | |
442 | } | |
1268c371 | 443 | ptEta[0] = dPt; |
444 | ptEta[1] = dEta; | |
445 | // Calculate p_{m*n,k} ('p-vector' for POIs): | |
446 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
489d5531 | 447 | { |
1268c371 | 448 | for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 |
489d5531 | 449 | { |
1268c371 | 450 | if(fCalculateDiffFlow) |
451 | { | |
452 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
453 | { | |
38a1e8b3 | 454 | fReRPQ1dEBE[1][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
455 | fImRPQ1dEBE[1][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 456 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta |
457 | } // end of if(fCalculateDiffFlow) | |
458 | if(fCalculate2DDiffFlow) | |
459 | { | |
38a1e8b3 | 460 | fReRPQ2dEBE[1][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
461 | fImRPQ2dEBE[1][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 462 | } // end of if(fCalculate2DDiffFlow) |
463 | } // end of for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 | |
464 | } // end of for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
b77b6434 | 465 | } // end of if(pTrack->InPOISelection()) |
489d5531 | 466 | } else // to if(aftsTrack) |
467 | { | |
38a1e8b3 | 468 | printf("\n WARNING (QC): No particle (i.e. aftsTrack is a NULL pointer in AFAWQC::Make())!!!!\n\n"); |
489d5531 | 469 | } |
470 | } // end of for(Int_t i=0;i<nPrim;i++) | |
471 | ||
1268c371 | 472 | // e) Calculate the final expressions for S_{p,k} and s_{p,k} (important !!!!): |
489d5531 | 473 | for(Int_t p=0;p<8;p++) |
474 | { | |
475 | for(Int_t k=0;k<9;k++) | |
476 | { | |
1268c371 | 477 | (*fSpk)(p,k)=pow((*fSpk)(p,k),p+1); |
478 | // ... for the time being s_{p,k} dosn't need higher powers, so no need to finalize it here ... | |
479 | } // end of for(Int_t k=0;k<9;k++) | |
480 | } // end of for(Int_t p=0;p<8;p++) | |
489d5531 | 481 | |
1268c371 | 482 | // f) Call the methods which calculate correlations for reference flow: |
489d5531 | 483 | if(!fEvaluateIntFlowNestedLoops) |
484 | { | |
403e3389 | 485 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 486 | { |
1268c371 | 487 | if(nRP>1){this->CalculateIntFlowCorrelations();} // without using particle weights |
403e3389 | 488 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 489 | { |
1268c371 | 490 | if(nRP>1){this->CalculateIntFlowCorrelationsUsingParticleWeights();} // with using particle weights |
491 | } | |
492 | // Whether or not using particle weights the following is calculated in the same way: | |
493 | if(nRP>3){this->CalculateIntFlowProductOfCorrelations();} | |
494 | if(nRP>1){this->CalculateIntFlowSumOfEventWeights();} | |
495 | if(nRP>1){this->CalculateIntFlowSumOfProductOfEventWeights();} | |
496 | // Non-isotropic terms: | |
403e3389 | 497 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 498 | { |
1268c371 | 499 | if(nRP>0){this->CalculateIntFlowCorrectionsForNUASinTerms();} |
500 | if(nRP>0){this->CalculateIntFlowCorrectionsForNUACosTerms();} | |
403e3389 | 501 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
b92ea2b9 | 502 | { |
1268c371 | 503 | if(nRP>0){this->CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights();} |
504 | if(nRP>0){this->CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights();} | |
505 | } | |
506 | // Whether or not using particle weights the following is calculated in the same way: | |
507 | if(nRP>0){this->CalculateIntFlowProductOfCorrectionTermsForNUA();} | |
508 | if(nRP>0){this->CalculateIntFlowSumOfEventWeightsNUA();} | |
509 | if(nRP>0){this->CalculateIntFlowSumOfProductOfEventWeightsNUA();} | |
489d5531 | 510 | } // end of if(!fEvaluateIntFlowNestedLoops) |
511 | ||
1268c371 | 512 | // g) Call the methods which calculate correlations for differential flow: |
513 | if(!fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) | |
489d5531 | 514 | { |
403e3389 | 515 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 516 | { |
1268c371 | 517 | // Without using particle weights: |
489d5531 | 518 | this->CalculateDiffFlowCorrelations("RP","Pt"); |
519 | this->CalculateDiffFlowCorrelations("RP","Eta"); | |
520 | this->CalculateDiffFlowCorrelations("POI","Pt"); | |
57340a27 | 521 | this->CalculateDiffFlowCorrelations("POI","Eta"); |
1268c371 | 522 | // Non-isotropic terms: |
b92ea2b9 | 523 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Pt"); |
524 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Eta"); | |
525 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Pt"); | |
526 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Eta"); | |
527 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Pt"); | |
528 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Eta"); | |
529 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Pt"); | |
530 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Eta"); | |
403e3389 | 531 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 532 | { |
1268c371 | 533 | // With using particle weights: |
489d5531 | 534 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Pt"); |
535 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Eta"); | |
536 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Pt"); | |
537 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Eta"); | |
1268c371 | 538 | // Non-isotropic terms: |
b92ea2b9 | 539 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Pt"); |
540 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Eta"); | |
541 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Pt"); | |
542 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Eta"); | |
543 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Pt"); | |
544 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Eta"); | |
545 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Pt"); | |
546 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Eta"); | |
1268c371 | 547 | } |
548 | // Whether or not using particle weights the following is calculated in the same way: | |
489d5531 | 549 | this->CalculateDiffFlowProductOfCorrelations("RP","Pt"); |
550 | this->CalculateDiffFlowProductOfCorrelations("RP","Eta"); | |
551 | this->CalculateDiffFlowProductOfCorrelations("POI","Pt"); | |
552 | this->CalculateDiffFlowProductOfCorrelations("POI","Eta"); | |
553 | this->CalculateDiffFlowSumOfEventWeights("RP","Pt"); | |
554 | this->CalculateDiffFlowSumOfEventWeights("RP","Eta"); | |
555 | this->CalculateDiffFlowSumOfEventWeights("POI","Pt"); | |
556 | this->CalculateDiffFlowSumOfEventWeights("POI","Eta"); | |
557 | this->CalculateDiffFlowSumOfProductOfEventWeights("RP","Pt"); | |
558 | this->CalculateDiffFlowSumOfProductOfEventWeights("RP","Eta"); | |
559 | this->CalculateDiffFlowSumOfProductOfEventWeights("POI","Pt"); | |
560 | this->CalculateDiffFlowSumOfProductOfEventWeights("POI","Eta"); | |
1268c371 | 561 | } // end of if(!fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) |
489d5531 | 562 | |
1268c371 | 563 | // h) Call the methods which calculate correlations for 2D differential flow: |
564 | if(!fEvaluateDiffFlowNestedLoops && fCalculate2DDiffFlow) | |
565 | { | |
403e3389 | 566 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 567 | { |
1268c371 | 568 | // Without using particle weights: |
569 | this->Calculate2DDiffFlowCorrelations("RP"); | |
570 | this->Calculate2DDiffFlowCorrelations("POI"); | |
571 | // Non-isotropic terms: | |
572 | // ... to be ctd ... | |
403e3389 | 573 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
1268c371 | 574 | { |
575 | // With using particle weights: | |
576 | // ... to be ctd ... | |
577 | // Non-isotropic terms: | |
578 | // ... to be ctd ... | |
579 | } | |
580 | // Whether or not using particle weights the following is calculated in the same way: | |
581 | // ... to be ctd ... | |
582 | } // end of if(!fEvaluateDiffFlowNestedLoops && fCalculate2DDiffFlow) | |
64e500e3 | 583 | |
584 | // i) Call the methods which calculate other differential correlators: | |
b84464d3 | 585 | if(!fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) |
64e500e3 | 586 | { |
403e3389 | 587 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
64e500e3 | 588 | { |
589 | // Without using particle weights: | |
590 | this->CalculateOtherDiffCorrelators("RP","Pt"); | |
591 | this->CalculateOtherDiffCorrelators("RP","Eta"); | |
592 | this->CalculateOtherDiffCorrelators("POI","Pt"); | |
593 | this->CalculateOtherDiffCorrelators("POI","Eta"); | |
403e3389 | 594 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
64e500e3 | 595 | { |
596 | // With using particle weights: | |
597 | // ... to be ctd ... | |
598 | } | |
599 | // Whether or not using particle weights the following is calculated in the same way: | |
600 | // ... to be ctd ... | |
601 | } // end of if(!fEvaluateDiffFlowNestedLoops) | |
602 | ||
603 | // j) Distributions of correlations: | |
e5834fcb | 604 | if(fStoreDistributions){this->StoreDistributionsOfCorrelations();} |
605 | ||
64e500e3 | 606 | // k) Store phi distribution for one event to illustrate flow: |
e5834fcb | 607 | if(fStorePhiDistributionForOneEvent){this->StorePhiDistributionForOneEvent(anEvent);} |
1268c371 | 608 | |
64e500e3 | 609 | // l) Cross-check with nested loops correlators for reference flow: |
1268c371 | 610 | if(fEvaluateIntFlowNestedLoops){this->EvaluateIntFlowNestedLoops(anEvent);} |
611 | ||
64e500e3 | 612 | // m) Cross-check with nested loops correlators for differential flow: |
1268c371 | 613 | if(fEvaluateDiffFlowNestedLoops){this->EvaluateDiffFlowNestedLoops(anEvent);} |
489d5531 | 614 | |
64e500e3 | 615 | // n) Reset all event-by-event quantities (very important !!!!): |
489d5531 | 616 | this->ResetEventByEventQuantities(); |
617 | ||
618 | } // end of AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent) | |
619 | ||
489d5531 | 620 | //================================================================================================================================ |
621 | ||
489d5531 | 622 | void AliFlowAnalysisWithQCumulants::Finish() |
623 | { | |
624 | // Calculate the final results. | |
489d5531 | 625 | |
b3dacf6b | 626 | // a) Check all pointers used in this method; |
627 | // b) Acces the constants; | |
628 | // c) Access the flags; | |
b92ea2b9 | 629 | // d) Calculate reference cumulants (not corrected for detector effects); |
630 | // e) Correct reference cumulants for detector effects; | |
631 | // f) Calculate reference flow; | |
b77b6434 | 632 | // g) Store results for reference flow in AliFlowCommonHistResults and print them on the screen; |
b92ea2b9 | 633 | // h) Calculate the final results for differential flow (without/with weights); |
634 | // i) Correct the results for differential flow (without/with weights) for effects of non-uniform acceptance (NUA); | |
635 | // j) Calculate the final results for integrated flow (RP/POI) and store in AliFlowCommonHistResults; | |
636 | // k) Store results for differential flow in AliFlowCommonHistResults; | |
637 | // l) Print the final results for integrated flow (RP/POI) on the screen; | |
638 | // m) Cross-checking: Results from Q-vectors vs results from nested loops. | |
b3dacf6b | 639 | |
640 | // a) Check all pointers used in this method: | |
641 | this->CheckPointersUsedInFinish(); | |
642 | ||
643 | // b) Acces the constants: | |
1268c371 | 644 | this->CommonConstants("Finish"); |
489d5531 | 645 | |
b3dacf6b | 646 | if(fCommonHists && fCommonHists->GetHarmonic()) // to be improved (moved somewhere else) |
489d5531 | 647 | { |
b3dacf6b | 648 | fHarmonic = (Int_t)(fCommonHists->GetHarmonic())->GetBinContent(1); |
489d5531 | 649 | } |
b3dacf6b | 650 | |
1268c371 | 651 | // c) Access the flags: // to be improved (implement a method for this? should I store again the flags becose they can get modified with redoFinish?) |
b3dacf6b | 652 | fUsePhiWeights = (Bool_t)fUseParticleWeights->GetBinContent(1); |
653 | fUsePtWeights = (Bool_t)fUseParticleWeights->GetBinContent(2); | |
654 | fUseEtaWeights = (Bool_t)fUseParticleWeights->GetBinContent(3); | |
403e3389 | 655 | fUseTrackWeights = (Bool_t)fUseParticleWeights->GetBinContent(4); |
b3dacf6b | 656 | fApplyCorrectionForNUA = (Bool_t)fIntFlowFlags->GetBinContent(3); |
657 | fPrintFinalResults[0] = (Bool_t)fIntFlowFlags->GetBinContent(4); | |
658 | fPrintFinalResults[1] = (Bool_t)fIntFlowFlags->GetBinContent(5); | |
659 | fPrintFinalResults[2] = (Bool_t)fIntFlowFlags->GetBinContent(6); | |
660 | fPrintFinalResults[3] = (Bool_t)fIntFlowFlags->GetBinContent(7); | |
661 | fApplyCorrectionForNUAVsM = (Bool_t)fIntFlowFlags->GetBinContent(8); | |
b77b6434 | 662 | fPropagateErrorAlsoFromNIT = (Bool_t)fIntFlowFlags->GetBinContent(9); |
0dd3b008 | 663 | fCalculateCumulantsVsM = (Bool_t)fIntFlowFlags->GetBinContent(10); |
664 | fMinimumBiasReferenceFlow = (Bool_t)fIntFlowFlags->GetBinContent(11); | |
e5834fcb | 665 | fForgetAboutCovariances = (Bool_t)fIntFlowFlags->GetBinContent(12); |
666 | fStorePhiDistributionForOneEvent = (Bool_t)fIntFlowFlags->GetBinContent(13); | |
3435cacb | 667 | fFillMultipleControlHistograms = (Bool_t)fIntFlowFlags->GetBinContent(14); |
668 | fCalculateAllCorrelationsVsM = (Bool_t)fIntFlowFlags->GetBinContent(15); | |
b3dacf6b | 669 | fEvaluateIntFlowNestedLoops = (Bool_t)fEvaluateNestedLoops->GetBinContent(1); |
670 | fEvaluateDiffFlowNestedLoops = (Bool_t)fEvaluateNestedLoops->GetBinContent(2); | |
489d5531 | 671 | fCrossCheckInPtBinNo = (Int_t)fEvaluateNestedLoops->GetBinContent(3); |
672 | fCrossCheckInEtaBinNo = (Int_t)fEvaluateNestedLoops->GetBinContent(4); | |
1268c371 | 673 | |
b92ea2b9 | 674 | // d) Calculate reference cumulants (not corrected for detector effects): |
489d5531 | 675 | this->FinalizeCorrelationsIntFlow(); |
676 | this->CalculateCovariancesIntFlow(); | |
677 | this->CalculateCumulantsIntFlow(); | |
489d5531 | 678 | |
b92ea2b9 | 679 | // e) Correct reference cumulants for detector effects: |
680 | this->FinalizeCorrectionTermsForNUAIntFlow(); | |
681 | this->CalculateCovariancesNUAIntFlow(); | |
682 | this->CalculateQcumulantsCorrectedForNUAIntFlow(); | |
683 | ||
684 | // f) Calculate reference flow: | |
685 | this->CalculateReferenceFlow(); | |
489d5531 | 686 | |
b77b6434 | 687 | // g) Store results for reference flow in AliFlowCommonHistResults and print them on the screen: |
489d5531 | 688 | this->FillCommonHistResultsIntFlow(); |
b3dacf6b | 689 | if(fPrintFinalResults[0]){this->PrintFinalResultsForIntegratedFlow("RF");} |
690 | if(fPrintFinalResults[3] && fCalculateCumulantsVsM){this->PrintFinalResultsForIntegratedFlow("RF, rebinned in M");} | |
489d5531 | 691 | |
1268c371 | 692 | // h) Calculate the final results for differential flow (without/with weights): |
693 | if(fCalculateDiffFlow) | |
694 | { | |
695 | this->FinalizeReducedCorrelations("RP","Pt"); | |
696 | this->FinalizeReducedCorrelations("RP","Eta"); | |
697 | this->FinalizeReducedCorrelations("POI","Pt"); | |
698 | this->FinalizeReducedCorrelations("POI","Eta"); | |
699 | this->CalculateDiffFlowCovariances("RP","Pt"); | |
700 | this->CalculateDiffFlowCovariances("RP","Eta"); | |
701 | this->CalculateDiffFlowCovariances("POI","Pt"); | |
702 | this->CalculateDiffFlowCovariances("POI","Eta"); | |
703 | this->CalculateDiffFlowCumulants("RP","Pt"); | |
704 | this->CalculateDiffFlowCumulants("RP","Eta"); | |
705 | this->CalculateDiffFlowCumulants("POI","Pt"); | |
706 | this->CalculateDiffFlowCumulants("POI","Eta"); | |
707 | this->CalculateDiffFlow("RP","Pt"); | |
708 | this->CalculateDiffFlow("RP","Eta"); | |
709 | this->CalculateDiffFlow("POI","Pt"); | |
710 | this->CalculateDiffFlow("POI","Eta"); | |
711 | } // if(fCalculateDiffFlow) | |
712 | ||
713 | // i) Correct the results for differential flow (without/with weights) for effects of non-uniform acceptance (NUA): | |
714 | if(fCalculateDiffFlow) | |
489d5531 | 715 | { |
716 | this->FinalizeCorrectionTermsForNUADiffFlow("RP","Pt"); | |
717 | this->FinalizeCorrectionTermsForNUADiffFlow("RP","Eta"); | |
718 | this->FinalizeCorrectionTermsForNUADiffFlow("POI","Pt"); | |
719 | this->FinalizeCorrectionTermsForNUADiffFlow("POI","Eta"); | |
720 | this->CalculateDiffFlowCumulantsCorrectedForNUA("RP","Pt"); | |
721 | this->CalculateDiffFlowCumulantsCorrectedForNUA("RP","Eta"); | |
722 | this->CalculateDiffFlowCumulantsCorrectedForNUA("POI","Pt"); | |
723 | this->CalculateDiffFlowCumulantsCorrectedForNUA("POI","Eta"); | |
1268c371 | 724 | if(fApplyCorrectionForNUA) |
725 | { | |
726 | this->CalculateDiffFlowCorrectedForNUA("RP","Pt"); | |
727 | this->CalculateDiffFlowCorrectedForNUA("RP","Eta"); | |
728 | this->CalculateDiffFlowCorrectedForNUA("POI","Pt"); | |
729 | this->CalculateDiffFlowCorrectedForNUA("POI","Eta"); | |
730 | } | |
731 | } // end of if(fCalculateDiffFlow && fApplyCorrectionForNUA) | |
732 | ||
733 | // i) Calcualate final results for 2D differential flow: | |
734 | if(fCalculate2DDiffFlow) | |
735 | { | |
736 | this->Calculate2DDiffFlowCumulants("RP"); | |
737 | this->Calculate2DDiffFlowCumulants("POI"); | |
738 | this->Calculate2DDiffFlow("RP"); | |
739 | this->Calculate2DDiffFlow("POI"); | |
740 | } // end of if(fCalculate2DDiffFlow) | |
741 | ||
742 | // j) Calculate the final results for integrated flow (RP/POI) and store in AliFlowCommonHistResults: | |
743 | if(fCalculateDiffFlow) | |
744 | { | |
745 | this->CalculateFinalResultsForRPandPOIIntegratedFlow("RP"); | |
746 | this->CalculateFinalResultsForRPandPOIIntegratedFlow("POI"); | |
3b552efe | 747 | } |
489d5531 | 748 | |
1268c371 | 749 | // k) Store results for differential flow in AliFlowCommonHistResults: |
750 | if(fCalculateDiffFlow) | |
751 | { | |
752 | this->FillCommonHistResultsDiffFlow("RP"); | |
753 | this->FillCommonHistResultsDiffFlow("POI"); | |
754 | } | |
755 | ||
756 | // l) Print the final results for integrated flow (RP/POI) on the screen: | |
757 | if(fPrintFinalResults[1] && fCalculateDiffFlow){this->PrintFinalResultsForIntegratedFlow("RP");} | |
758 | if(fPrintFinalResults[2] && fCalculateDiffFlow){this->PrintFinalResultsForIntegratedFlow("POI");} | |
759 | ||
760 | // m) Cross-checking: Results from Q-vectors vs results from nested loops: | |
761 | // m1) Reference flow: | |
489d5531 | 762 | if(fEvaluateIntFlowNestedLoops) |
763 | { | |
764 | this->CrossCheckIntFlowCorrelations(); | |
765 | this->CrossCheckIntFlowCorrectionTermsForNUA(); | |
403e3389 | 766 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights){this->CrossCheckIntFlowExtraCorrelations();} |
489d5531 | 767 | } // end of if(fEvaluateIntFlowNestedLoops) |
1268c371 | 768 | // m2) Differential flow: |
769 | if(fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) | |
489d5531 | 770 | { |
b3dacf6b | 771 | // Correlations: |
489d5531 | 772 | this->PrintNumberOfParticlesInSelectedBin(); |
773 | this->CrossCheckDiffFlowCorrelations("RP","Pt"); | |
774 | this->CrossCheckDiffFlowCorrelations("RP","Eta"); | |
775 | this->CrossCheckDiffFlowCorrelations("POI","Pt"); | |
776 | this->CrossCheckDiffFlowCorrelations("POI","Eta"); | |
b3dacf6b | 777 | // Correction terms for non-uniform acceptance: |
489d5531 | 778 | this->CrossCheckDiffFlowCorrectionTermsForNUA("RP","Pt"); |
779 | this->CrossCheckDiffFlowCorrectionTermsForNUA("RP","Eta"); | |
780 | this->CrossCheckDiffFlowCorrectionTermsForNUA("POI","Pt"); | |
64e500e3 | 781 | this->CrossCheckDiffFlowCorrectionTermsForNUA("POI","Eta"); |
782 | // Other differential correlators: | |
783 | this->CrossCheckOtherDiffCorrelators("RP","Pt"); | |
784 | this->CrossCheckOtherDiffCorrelators("RP","Eta"); | |
785 | this->CrossCheckOtherDiffCorrelators("POI","Pt"); | |
786 | this->CrossCheckOtherDiffCorrelators("POI","Eta"); | |
489d5531 | 787 | } // end of if(fEvaluateDiffFlowNestedLoops) |
788 | ||
789 | } // end of AliFlowAnalysisWithQCumulants::Finish() | |
790 | ||
489d5531 | 791 | //================================================================================================================================ |
792 | ||
1268c371 | 793 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowNestedLoops(AliFlowEventSimple* anEvent) |
794 | { | |
795 | // Evalauted all correlators for reference flow with nested loops. | |
796 | ||
797 | Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = nRP + nPOI | |
798 | if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 | |
799 | { | |
800 | // Without using particle weights: | |
403e3389 | 801 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
1268c371 | 802 | { |
803 | // Correlations: | |
804 | this->CalculateIntFlowCorrelations(); // from Q-vectors | |
805 | this->EvaluateIntFlowCorrelationsWithNestedLoops(anEvent); // from nested loops (to be improved: do I have to pass here anEvent or not?) | |
806 | // Correction for non-uniform acceptance: | |
807 | this->CalculateIntFlowCorrectionsForNUASinTerms(); // from Q-vectors (sin terms) | |
808 | this->CalculateIntFlowCorrectionsForNUACosTerms(); // from Q-vectors (cos terms) | |
809 | this->EvaluateIntFlowCorrectionsForNUAWithNestedLoops(anEvent); // from nested loops (both sin and cos terms) | |
810 | } | |
811 | // Using particle weights: | |
403e3389 | 812 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
1268c371 | 813 | { |
814 | // Correlations | |
815 | this->CalculateIntFlowCorrelationsUsingParticleWeights(); // from Q-vectors | |
816 | this->EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent); // from nested loops (to be improved: do I have to pass here anEvent or not?) | |
817 | // Correction for non-uniform acceptance: | |
818 | this->CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights(); // from Q-vectors (sin terms) | |
819 | this->CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights(); // from Q-vectors (cos terms) | |
820 | this->EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(anEvent); // from nested loops (both sin and cos terms) | |
821 | } | |
822 | } else if(nPrim>fMaxAllowedMultiplicity) // to if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) | |
823 | { | |
824 | cout<<endl; | |
825 | cout<<"Skipping the event because multiplicity is "<<nPrim<<". Too high to evaluate nested loops!"<<endl; | |
826 | } else | |
827 | { | |
828 | cout<<endl; | |
829 | cout<<"Skipping the event because multiplicity is "<<nPrim<<"."<<endl; | |
830 | } | |
831 | ||
832 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowNestedLoops(AliFlowEventSimple* anEvent) | |
833 | ||
834 | //================================================================================================================================ | |
835 | ||
836 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowNestedLoops(AliFlowEventSimple* anEvent) | |
837 | { | |
838 | // Evalauted all correlators for differential flow with nested loops. | |
839 | ||
840 | if(!fCalculateDiffFlow){return;} | |
841 | ||
842 | Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = nRP + nPOI | |
843 | if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 | |
844 | { | |
845 | // Without using particle weights: | |
403e3389 | 846 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
1268c371 | 847 | { |
64e500e3 | 848 | // 1.) Reduced correlations: |
1268c371 | 849 | // Q-vectors: |
850 | this->CalculateDiffFlowCorrelations("RP","Pt"); | |
851 | this->CalculateDiffFlowCorrelations("RP","Eta"); | |
852 | this->CalculateDiffFlowCorrelations("POI","Pt"); | |
853 | this->CalculateDiffFlowCorrelations("POI","Eta"); | |
854 | // Nested loops: | |
855 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"RP","Pt"); | |
856 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"RP","Eta"); | |
857 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"POI","Pt"); | |
858 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"POI","Eta"); | |
64e500e3 | 859 | // 2.) Reduced corrections for non-uniform acceptance: |
1268c371 | 860 | // Q-vectors: |
861 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Pt"); | |
862 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Eta"); | |
863 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Pt"); | |
864 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Eta"); | |
865 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Pt"); | |
866 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Eta"); | |
867 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Pt"); | |
868 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Eta"); | |
869 | // Nested loops: | |
870 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"RP","Pt"); | |
871 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"RP","Eta"); | |
872 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"POI","Pt"); | |
873 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"POI","Eta"); | |
64e500e3 | 874 | // 3.) Other differential correlators: |
875 | // Q-vectors: | |
876 | this->CalculateOtherDiffCorrelators("RP","Pt"); | |
877 | this->CalculateOtherDiffCorrelators("RP","Eta"); | |
878 | this->CalculateOtherDiffCorrelators("POI","Pt"); | |
879 | this->CalculateOtherDiffCorrelators("POI","Eta"); | |
880 | // Nested loops: | |
881 | this->EvaluateOtherDiffCorrelatorsWithNestedLoops(anEvent,"RP","Pt"); | |
882 | this->EvaluateOtherDiffCorrelatorsWithNestedLoops(anEvent,"RP","Eta"); | |
883 | this->EvaluateOtherDiffCorrelatorsWithNestedLoops(anEvent,"POI","Pt"); | |
884 | this->EvaluateOtherDiffCorrelatorsWithNestedLoops(anEvent,"POI","Eta"); | |
403e3389 | 885 | } // end of if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
1268c371 | 886 | // Using particle weights: |
403e3389 | 887 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
1268c371 | 888 | { |
889 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Pt"); | |
890 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Eta"); | |
891 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Pt"); | |
892 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Eta"); | |
893 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Pt"); | |
894 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Eta"); | |
895 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Pt"); | |
896 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Eta"); | |
897 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Pt"); | |
898 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Eta"); | |
899 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Pt"); | |
900 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Eta"); | |
901 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"RP","Pt"); | |
902 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"RP","Eta"); | |
903 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"POI","Pt"); | |
904 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"POI","Eta"); | |
905 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"RP","Pt"); | |
906 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"RP","Eta"); | |
907 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"POI","Pt"); | |
908 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"POI","Eta"); | |
403e3389 | 909 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
1268c371 | 910 | } // end of if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 |
911 | ||
912 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowNestedLoops(AliFlowEventSimple* anEvent) | |
913 | ||
914 | //================================================================================================================================ | |
915 | ||
489d5531 | 916 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTerms() |
917 | { | |
b92ea2b9 | 918 | // Calculate correction terms for non-uniform acceptance of the detector for reference flow (cos terms). |
489d5531 | 919 | |
920 | // multiplicity: | |
1268c371 | 921 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 922 | |
923 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
924 | Double_t dReQ1n = (*fReQ)(0,0); | |
925 | Double_t dReQ2n = (*fReQ)(1,0); | |
926 | //Double_t dReQ3n = (*fReQ)(2,0); | |
927 | //Double_t dReQ4n = (*fReQ)(3,0); | |
928 | Double_t dImQ1n = (*fImQ)(0,0); | |
929 | Double_t dImQ2n = (*fImQ)(1,0); | |
930 | //Double_t dImQ3n = (*fImQ)(2,0); | |
931 | //Double_t dImQ4n = (*fImQ)(3,0); | |
932 | ||
933 | // ************************************************************* | |
934 | // **** corrections for non-uniform acceptance (cos terms): **** | |
935 | // ************************************************************* | |
936 | // | |
937 | // Remark 1: corrections for non-uniform acceptance (cos terms) calculated with non-weighted Q-vectors | |
938 | // are stored in 1D profile fQCorrectionsCos. | |
939 | // Remark 2: binning of fIntFlowCorrectionTermsForNUAPro[1] is organized as follows: | |
940 | // -------------------------------------------------------------------------------------------------------------------- | |
941 | // 1st bin: <<cos(n*(phi1))>> = cosP1n | |
942 | // 2nd bin: <<cos(n*(phi1+phi2))>> = cosP1nP1n | |
943 | // 3rd bin: <<cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1n | |
944 | // 4th bin: <<cos(n*(2phi1-phi2))>> = cosP2nM1n | |
945 | // -------------------------------------------------------------------------------------------------------------------- | |
946 | ||
947 | // 1-particle: | |
948 | Double_t cosP1n = 0.; // <<cos(n*(phi1))>> | |
949 | ||
950 | if(dMult>0) | |
951 | { | |
952 | cosP1n = dReQ1n/dMult; | |
953 | ||
954 | // average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for single event: | |
955 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(1,cosP1n); | |
0328db2d | 956 | // event weights for NUA terms: |
957 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(1,dMult); | |
489d5531 | 958 | |
959 | // final average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for all events: | |
960 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(0.5,cosP1n,dMult); | |
b3dacf6b | 961 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[1][0]->Fill(dMult+0.5,cosP1n,dMult);} |
489d5531 | 962 | } |
963 | ||
964 | // 2-particle: | |
3b552efe | 965 | Double_t cosP1nP1n = 0.; // <<cos(n*(phi1+phi2))>> |
489d5531 | 966 | Double_t cosP2nM1n = 0.; // <<cos(n*(2phi1-phi2))>> |
967 | ||
968 | if(dMult>1) | |
969 | { | |
970 | cosP1nP1n = (pow(dReQ1n,2)-pow(dImQ1n,2)-dReQ2n)/(dMult*(dMult-1)); | |
971 | cosP2nM1n = (dReQ2n*dReQ1n+dImQ2n*dImQ1n-dReQ1n)/(dMult*(dMult-1)); | |
972 | ||
973 | // average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for single event: | |
3b552efe | 974 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(2,cosP1nP1n); |
489d5531 | 975 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(4,cosP2nM1n); |
0328db2d | 976 | // event weights for NUA terms: |
977 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(2,dMult*(dMult-1)); | |
978 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(4,dMult*(dMult-1)); | |
979 | ||
489d5531 | 980 | // final average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for all events: |
3b552efe | 981 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(1.5,cosP1nP1n,dMult*(dMult-1)); |
489d5531 | 982 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(3.5,cosP2nM1n,dMult*(dMult-1)); |
b3dacf6b | 983 | if(fCalculateCumulantsVsM) |
984 | { | |
985 | fIntFlowCorrectionTermsForNUAVsMPro[1][1]->Fill(dMult+0.5,cosP1nP1n,dMult*(dMult-1)); | |
986 | fIntFlowCorrectionTermsForNUAVsMPro[1][3]->Fill(dMult+0.5,cosP2nM1n,dMult*(dMult-1)); | |
987 | } | |
489d5531 | 988 | } |
989 | ||
990 | // 3-particle: | |
991 | Double_t cosP1nM1nM1n = 0.; // <<cos(n*(phi1-phi2-phi3))>> | |
992 | ||
993 | if(dMult>2) | |
994 | { | |
995 | cosP1nM1nM1n = (dReQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))-dReQ1n*dReQ2n-dImQ1n*dImQ2n-2.*(dMult-1)*dReQ1n) | |
996 | / (dMult*(dMult-1)*(dMult-2)); | |
997 | ||
998 | // average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for single event: | |
999 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(3,cosP1nM1nM1n); | |
0328db2d | 1000 | // event weights for NUA terms: |
1001 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(3,dMult*(dMult-1)*(dMult-2)); | |
489d5531 | 1002 | |
1003 | // final average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for all events: | |
2001bc3a | 1004 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(2.5,cosP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); |
b3dacf6b | 1005 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[1][2]->Fill(dMult+0.5,cosP1nM1nM1n,dMult*(dMult-1)*(dMult-2));} |
489d5531 | 1006 | } |
1007 | ||
1008 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTerms() | |
1009 | ||
1010 | ||
1011 | //================================================================================================================================ | |
1012 | ||
1013 | ||
1014 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTerms() | |
1015 | { | |
1016 | // calculate corrections for non-uniform acceptance of the detector for no-name integrated flow (sin terms) | |
1017 | ||
1018 | // multiplicity: | |
1268c371 | 1019 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 1020 | |
1021 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
1022 | Double_t dReQ1n = (*fReQ)(0,0); | |
1023 | Double_t dReQ2n = (*fReQ)(1,0); | |
1024 | //Double_t dReQ3n = (*fReQ)(2,0); | |
1025 | //Double_t dReQ4n = (*fReQ)(3,0); | |
1026 | Double_t dImQ1n = (*fImQ)(0,0); | |
1027 | Double_t dImQ2n = (*fImQ)(1,0); | |
1028 | //Double_t dImQ3n = (*fImQ)(2,0); | |
1029 | //Double_t dImQ4n = (*fImQ)(3,0); | |
1030 | ||
1031 | // ************************************************************* | |
1032 | // **** corrections for non-uniform acceptance (sin terms): **** | |
1033 | // ************************************************************* | |
1034 | // | |
1035 | // Remark 1: corrections for non-uniform acceptance (sin terms) calculated with non-weighted Q-vectors | |
1036 | // are stored in 1D profile fQCorrectionsSin. | |
1037 | // Remark 2: binning of fIntFlowCorrectionTermsForNUAPro[0] is organized as follows: | |
1038 | // -------------------------------------------------------------------------------------------------------------------- | |
1039 | // 1st bin: <<sin(n*(phi1))>> = sinP1n | |
1040 | // 2nd bin: <<sin(n*(phi1+phi2))>> = sinP1nP1n | |
1041 | // 3rd bin: <<sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1n | |
1042 | // 4th bin: <<sin(n*(2phi1-phi2))>> = sinP2nM1n | |
1043 | // -------------------------------------------------------------------------------------------------------------------- | |
1044 | ||
1045 | // 1-particle: | |
1046 | Double_t sinP1n = 0.; // <sin(n*(phi1))> | |
1047 | ||
1048 | if(dMult>0) | |
1049 | { | |
1050 | sinP1n = dImQ1n/dMult; | |
1051 | ||
1052 | // average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for single event: | |
0328db2d | 1053 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(1,sinP1n); |
1054 | // event weights for NUA terms: | |
1055 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(1,dMult); | |
489d5531 | 1056 | |
1057 | // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
1058 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(0.5,sinP1n,dMult); | |
b3dacf6b | 1059 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[0][0]->Fill(dMult+0.5,sinP1n,dMult);} |
489d5531 | 1060 | } |
1061 | ||
1062 | // 2-particle: | |
1063 | Double_t sinP1nP1n = 0.; // <<sin(n*(phi1+phi2))>> | |
1064 | Double_t sinP2nM1n = 0.; // <<sin(n*(2phi1-phi2))>> | |
1065 | if(dMult>1) | |
1066 | { | |
3b552efe | 1067 | sinP1nP1n = (2.*dReQ1n*dImQ1n-dImQ2n)/(dMult*(dMult-1)); |
489d5531 | 1068 | sinP2nM1n = (dImQ2n*dReQ1n-dReQ2n*dImQ1n-dImQ1n)/(dMult*(dMult-1)); |
1069 | ||
1070 | // average non-weighted 2-particle correction (sin terms) for non-uniform acceptance for single event: | |
1071 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(2,sinP1nP1n); | |
3b552efe | 1072 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(4,sinP2nM1n); |
0328db2d | 1073 | // event weights for NUA terms: |
1074 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(2,dMult*(dMult-1)); | |
1075 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(4,dMult*(dMult-1)); | |
489d5531 | 1076 | |
1077 | // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
1078 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(1.5,sinP1nP1n,dMult*(dMult-1)); | |
1079 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(3.5,sinP2nM1n,dMult*(dMult-1)); | |
b3dacf6b | 1080 | if(fCalculateCumulantsVsM) |
1081 | { | |
1082 | fIntFlowCorrectionTermsForNUAVsMPro[0][1]->Fill(dMult+0.5,sinP1nP1n,dMult*(dMult-1)); | |
1083 | fIntFlowCorrectionTermsForNUAVsMPro[0][3]->Fill(dMult+0.5,sinP2nM1n,dMult*(dMult-1)); | |
1084 | } | |
489d5531 | 1085 | } |
1086 | ||
1087 | // 3-particle: | |
1088 | Double_t sinP1nM1nM1n = 0.; // <<sin(n*(phi1-phi2-phi3))>> | |
1089 | ||
1090 | if(dMult>2) | |
1091 | { | |
1092 | sinP1nM1nM1n = (-dImQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))+dReQ1n*dImQ2n-dImQ1n*dReQ2n+2.*(dMult-1)*dImQ1n) | |
1093 | / (dMult*(dMult-1)*(dMult-2)); | |
1094 | ||
1095 | // average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for single event: | |
1096 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(3,sinP1nM1nM1n); | |
0328db2d | 1097 | // event weights for NUA terms: |
1098 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(3,dMult*(dMult-1)*(dMult-2)); | |
489d5531 | 1099 | |
1100 | // final average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for all events: | |
2001bc3a | 1101 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(2.5,sinP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); |
b3dacf6b | 1102 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[0][2]->Fill(dMult+0.5,sinP1nM1nM1n,dMult*(dMult-1)*(dMult-2));} |
489d5531 | 1103 | } |
1104 | ||
1105 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTerms() | |
1106 | ||
489d5531 | 1107 | //================================================================================================================================ |
1108 | ||
489d5531 | 1109 | void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos) |
1110 | { | |
1268c371 | 1111 | // a) Get pointers for common control and common result histograms; |
1112 | // b) Get pointers for histograms holding particle weights; | |
1113 | // c) Get pointers for reference flow histograms; | |
1114 | // d) Get pointers for differential flow histograms; | |
1115 | // e) Get pointers for 2D differential flow histograms; | |
64e500e3 | 1116 | // f) Get pointers for other differential correlators; |
1117 | // g) Get pointers for nested loops' histograms. | |
489d5531 | 1118 | |
1119 | if(outputListHistos) | |
3b552efe | 1120 | { |
1121 | this->SetHistList(outputListHistos); | |
1122 | if(!fHistList) | |
1123 | { | |
1268c371 | 1124 | printf("\n WARNING (QC): fHistList is NULL in AFAWQC::GOH() !!!!\n\n"); |
3b552efe | 1125 | exit(0); |
489d5531 | 1126 | } |
1127 | this->GetPointersForCommonHistograms(); | |
1128 | this->GetPointersForParticleWeightsHistograms(); | |
1129 | this->GetPointersForIntFlowHistograms(); | |
1130 | this->GetPointersForDiffFlowHistograms(); | |
1268c371 | 1131 | this->GetPointersFor2DDiffFlowHistograms(); |
64e500e3 | 1132 | this->GetPointersForOtherDiffCorrelators(); |
489d5531 | 1133 | this->GetPointersForNestedLoopsHistograms(); |
3b552efe | 1134 | } else |
1135 | { | |
1268c371 | 1136 | printf("\n WARNING (QC): outputListHistos is NULL in AFAWQC::GOH() !!!!\n\n"); |
3b552efe | 1137 | exit(0); |
489d5531 | 1138 | } |
1139 | ||
1140 | } // end of void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos) | |
ad87ae62 | 1141 | |
489d5531 | 1142 | //================================================================================================================================ |
1143 | ||
489d5531 | 1144 | TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) const |
ad87ae62 | 1145 | { |
489d5531 | 1146 | // project 2D profile onto pt axis to get 1D profile |
1147 | ||
1148 | Int_t nBinsPt = profilePtEta->GetNbinsX(); | |
1149 | Double_t dPtMin = (profilePtEta->GetXaxis())->GetXmin(); | |
1150 | Double_t dPtMax = (profilePtEta->GetXaxis())->GetXmax(); | |
1151 | ||
1152 | Int_t nBinsEta = profilePtEta->GetNbinsY(); | |
1153 | ||
1154 | TProfile *profilePt = new TProfile("","",nBinsPt,dPtMin,dPtMax); | |
1155 | ||
1156 | for(Int_t p=1;p<=nBinsPt;p++) | |
1157 | { | |
1158 | Double_t contentPt = 0.; | |
1159 | Double_t entryPt = 0.; | |
1160 | Double_t spreadPt = 0.; | |
1161 | Double_t sum1 = 0.; | |
1162 | Double_t sum2 = 0.; | |
1163 | Double_t sum3 = 0.; | |
1164 | for(Int_t e=1;e<=nBinsEta;e++) | |
1165 | { | |
1166 | contentPt += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))) | |
1167 | * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1168 | entryPt += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1169 | ||
1170 | sum1 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))) | |
1171 | * (pow(profilePtEta->GetBinError(profilePtEta->GetBin(p,e)),2.) | |
1172 | + pow(profilePtEta->GetBinContent(profilePtEta->GetBin(p,e)),2.)); | |
1173 | sum2 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1174 | sum3 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))) | |
1175 | * (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))); | |
1176 | } | |
1177 | if(sum2>0. && sum1/sum2-pow(sum3/sum2,2.) > 0.) | |
1178 | { | |
1179 | spreadPt = pow(sum1/sum2-pow(sum3/sum2,2.),0.5); | |
1180 | } | |
1181 | profilePt->SetBinContent(p,contentPt); | |
1182 | profilePt->SetBinEntries(p,entryPt); | |
1183 | { | |
1184 | profilePt->SetBinError(p,spreadPt); | |
1185 | } | |
1186 | ||
1187 | } | |
1188 | ||
1189 | return profilePt; | |
1190 | ||
1191 | } // end of TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) | |
1192 | ||
1193 | ||
1194 | //================================================================================================================================ | |
1195 | ||
1196 | ||
1197 | TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) const | |
1198 | { | |
1199 | // project 2D profile onto eta axis to get 1D profile | |
1200 | ||
1201 | Int_t nBinsEta = profilePtEta->GetNbinsY(); | |
1202 | Double_t dEtaMin = (profilePtEta->GetYaxis())->GetXmin(); | |
1203 | Double_t dEtaMax = (profilePtEta->GetYaxis())->GetXmax(); | |
1204 | ||
1205 | Int_t nBinsPt = profilePtEta->GetNbinsX(); | |
1206 | ||
1207 | TProfile *profileEta = new TProfile("","",nBinsEta,dEtaMin,dEtaMax); | |
1208 | ||
1209 | for(Int_t e=1;e<=nBinsEta;e++) | |
1210 | { | |
1211 | Double_t contentEta = 0.; | |
1212 | Double_t entryEta = 0.; | |
1213 | for(Int_t p=1;p<=nBinsPt;p++) | |
1214 | { | |
1215 | contentEta += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))) | |
1216 | * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1217 | entryEta += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1218 | } | |
1219 | profileEta->SetBinContent(e,contentEta); | |
1220 | profileEta->SetBinEntries(e,entryEta); | |
1221 | } | |
1222 | ||
1223 | return profileEta; | |
1224 | ||
1225 | } // end of TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) | |
1226 | ||
489d5531 | 1227 | //================================================================================================================================ |
1228 | ||
489d5531 | 1229 | void AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type) |
1230 | { | |
2001bc3a | 1231 | // Printing on the screen the final results for integrated flow (RF, POI and RP). |
489d5531 | 1232 | |
1233 | Int_t n = fHarmonic; | |
1234 | ||
489d5531 | 1235 | Double_t dVn[4] = {0.}; // array to hold Vn{2}, Vn{4}, Vn{6} and Vn{8} |
1236 | Double_t dVnErr[4] = {0.}; // array to hold errors of Vn{2}, Vn{4}, Vn{6} and Vn{8} | |
1237 | ||
2001bc3a | 1238 | if(type == "RF") |
489d5531 | 1239 | { |
0dd3b008 | 1240 | for(Int_t b=0;b<4;b++) |
1241 | { | |
b77b6434 | 1242 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlow())->GetBinContent(1); |
1243 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlow())->GetBinError(1); | |
1244 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlow())->GetBinContent(1); | |
1245 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlow())->GetBinError(1); | |
1246 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlow())->GetBinContent(1); | |
1247 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlow())->GetBinError(1); | |
1248 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlow())->GetBinContent(1); | |
1249 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlow())->GetBinError(1); | |
0dd3b008 | 1250 | } |
489d5531 | 1251 | } else if(type == "RP") |
1252 | { | |
1253 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinContent(1); | |
1254 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinError(1); | |
1255 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinContent(1); | |
1256 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinError(1); | |
1257 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinContent(1); | |
1258 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinError(1); | |
1259 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinContent(1); | |
1260 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinError(1); | |
1261 | } else if(type == "POI") | |
1262 | { | |
1263 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinContent(1); | |
1264 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinError(1); | |
1265 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinContent(1); | |
1266 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinError(1); | |
1267 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinContent(1); | |
1268 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinError(1); | |
1269 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinContent(1); | |
1270 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinError(1); | |
b77b6434 | 1271 | } else if(type == "RF, rebinned in M" && fCalculateCumulantsVsM) |
b3dacf6b | 1272 | { |
0dd3b008 | 1273 | for(Int_t b=0;b<4;b++) |
1274 | { | |
1275 | dVn[b] = fIntFlowRebinnedInM->GetBinContent(b+1); | |
1276 | dVnErr[b] = fIntFlowRebinnedInM->GetBinError(b+1); | |
1277 | } | |
b3dacf6b | 1278 | } |
489d5531 | 1279 | |
1280 | TString title = " flow estimates from Q-cumulants"; | |
1281 | TString subtitle = " ("; | |
b3dacf6b | 1282 | TString subtitle2 = " (rebinned in M)"; |
489d5531 | 1283 | |
b3dacf6b | 1284 | if(type != "RF, rebinned in M") |
489d5531 | 1285 | { |
403e3389 | 1286 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
b3dacf6b | 1287 | { |
1288 | subtitle.Append(type); | |
1289 | subtitle.Append(", without weights)"); | |
1290 | } else | |
1291 | { | |
1292 | subtitle.Append(type); | |
1293 | subtitle.Append(", with weights)"); | |
1294 | } | |
1295 | } else | |
489d5531 | 1296 | { |
403e3389 | 1297 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
b3dacf6b | 1298 | { |
1299 | subtitle.Append("RF"); | |
1300 | subtitle.Append(", without weights)"); | |
1301 | } else | |
1302 | { | |
1303 | subtitle.Append("RF"); | |
1304 | subtitle.Append(", with weights)"); | |
1305 | } | |
1306 | } | |
1307 | ||
489d5531 | 1308 | cout<<endl; |
1309 | cout<<"*************************************"<<endl; | |
1310 | cout<<"*************************************"<<endl; | |
1311 | cout<<title.Data()<<endl; | |
1312 | cout<<subtitle.Data()<<endl; | |
b3dacf6b | 1313 | if(type == "RF, rebinned in M"){cout<<subtitle2.Data()<<endl;} |
489d5531 | 1314 | cout<<endl; |
1315 | ||
1316 | for(Int_t i=0;i<4;i++) | |
1317 | { | |
2001bc3a | 1318 | cout<<" v_"<<n<<"{"<<2*(i+1)<<"} = "<<dVn[i]<<" +/- "<<dVnErr[i]<<endl; |
489d5531 | 1319 | } |
2001bc3a | 1320 | |
489d5531 | 1321 | cout<<endl; |
b92ea2b9 | 1322 | if(type == "RF") |
1323 | { | |
b77b6434 | 1324 | if(fApplyCorrectionForNUA) |
1325 | { | |
1326 | cout<<" detector bias (corrected for): "<<endl; | |
1327 | } else | |
1328 | { | |
1329 | cout<<" detector bias (not corrected for):"<<endl; | |
1330 | } | |
b92ea2b9 | 1331 | cout<<" to QC{2}: "<<fIntFlowDetectorBias->GetBinContent(1)<<" +/- "<<fIntFlowDetectorBias->GetBinError(1)<<endl; |
1332 | cout<<" to QC{4}: "<<fIntFlowDetectorBias->GetBinContent(2)<<" +/- "<<fIntFlowDetectorBias->GetBinError(2)<<endl; | |
1333 | cout<<endl; | |
1334 | } | |
b3dacf6b | 1335 | if(type == "RF" || type == "RF, rebinned in M") |
489d5531 | 1336 | { |
2001bc3a | 1337 | cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultRP()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultRP()->GetMean()<<endl; |
489d5531 | 1338 | } |
1339 | else if (type == "RP") | |
1340 | { | |
2001bc3a | 1341 | cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultRP()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultRP()->GetMean()<<endl; |
489d5531 | 1342 | } |
1343 | else if (type == "POI") | |
1344 | { | |
2001bc3a | 1345 | cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultPOI()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultPOI()->GetMean()<<endl; |
1346 | } | |
1347 | ||
489d5531 | 1348 | cout<<"*************************************"<<endl; |
1349 | cout<<"*************************************"<<endl; | |
1350 | cout<<endl; | |
1351 | ||
2001bc3a | 1352 | }// end of AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type="RF"); |
489d5531 | 1353 | |
1354 | //================================================================================================================================ | |
1355 | ||
489d5531 | 1356 | void AliFlowAnalysisWithQCumulants::WriteHistograms(TString outputFileName) |
1357 | { | |
1358 | //store the final results in output .root file | |
1359 | TFile *output = new TFile(outputFileName.Data(),"RECREATE"); | |
1360 | //output->WriteObject(fHistList, "cobjQC","SingleKey"); | |
1361 | fHistList->Write(fHistList->GetName(), TObject::kSingleKey); | |
1362 | delete output; | |
1363 | } | |
1364 | ||
1365 | ||
1366 | //================================================================================================================================ | |
1367 | ||
1368 | ||
1369 | void AliFlowAnalysisWithQCumulants::WriteHistograms(TDirectoryFile *outputFileName) | |
1370 | { | |
1371 | //store the final results in output .root file | |
1372 | fHistList->SetName("cobjQC"); | |
1373 | fHistList->SetOwner(kTRUE); | |
1374 | outputFileName->Add(fHistList); | |
1375 | outputFileName->Write(outputFileName->GetName(), TObject::kSingleKey); | |
1376 | } | |
1377 | ||
489d5531 | 1378 | //================================================================================================================================ |
1379 | ||
489d5531 | 1380 | void AliFlowAnalysisWithQCumulants::BookCommonHistograms() |
1381 | { | |
1382 | // Book common control histograms and common histograms for final results. | |
1268c371 | 1383 | // a) Book common control histograms; |
1384 | // b) Book common result histograms. | |
1385 | ||
1386 | // a) Book common control histograms: | |
1387 | // Common control histograms (all events): | |
489d5531 | 1388 | TString commonHistsName = "AliFlowCommonHistQC"; |
1389 | commonHistsName += fAnalysisLabel->Data(); | |
1390 | fCommonHists = new AliFlowCommonHist(commonHistsName.Data()); | |
1391 | fHistList->Add(fCommonHists); | |
1268c371 | 1392 | // Common control histograms (selected events): |
dd442cd2 | 1393 | if(fFillMultipleControlHistograms) |
1394 | { | |
1268c371 | 1395 | // Common control histogram filled for events with 2 and more reference particles: |
dd442cd2 | 1396 | TString commonHists2ndOrderName = "AliFlowCommonHist2ndOrderQC"; |
1397 | commonHists2ndOrderName += fAnalysisLabel->Data(); | |
1398 | fCommonHists2nd = new AliFlowCommonHist(commonHists2ndOrderName.Data()); | |
1399 | fHistList->Add(fCommonHists2nd); | |
1268c371 | 1400 | // Common control histogram filled for events with 2 and more reference particles: |
dd442cd2 | 1401 | TString commonHists4thOrderName = "AliFlowCommonHist4thOrderQC"; |
1402 | commonHists4thOrderName += fAnalysisLabel->Data(); | |
1403 | fCommonHists4th = new AliFlowCommonHist(commonHists4thOrderName.Data()); | |
1404 | fHistList->Add(fCommonHists4th); | |
1268c371 | 1405 | // Common control histogram filled for events with 6 and more reference particles: |
dd442cd2 | 1406 | TString commonHists6thOrderName = "AliFlowCommonHist6thOrderQC"; |
1407 | commonHists6thOrderName += fAnalysisLabel->Data(); | |
1408 | fCommonHists6th = new AliFlowCommonHist(commonHists6thOrderName.Data()); | |
1409 | fHistList->Add(fCommonHists6th); | |
1268c371 | 1410 | // Common control histogram filled for events with 8 and more reference particles: |
dd442cd2 | 1411 | TString commonHists8thOrderName = "AliFlowCommonHist8thOrderQC"; |
1412 | commonHists8thOrderName += fAnalysisLabel->Data(); | |
1413 | fCommonHists8th = new AliFlowCommonHist(commonHists8thOrderName.Data()); | |
1414 | fHistList->Add(fCommonHists8th); | |
1415 | } // end of if(fFillMultipleControlHistograms) | |
1416 | ||
1268c371 | 1417 | // b) Book common result histograms: |
1418 | // Common result histograms for QC{2}: | |
489d5531 | 1419 | TString commonHistResults2ndOrderName = "AliFlowCommonHistResults2ndOrderQC"; |
1420 | commonHistResults2ndOrderName += fAnalysisLabel->Data(); | |
1421 | fCommonHistsResults2nd = new AliFlowCommonHistResults(commonHistResults2ndOrderName.Data()); | |
1422 | fHistList->Add(fCommonHistsResults2nd); | |
1268c371 | 1423 | // Common result histograms for QC{4}: |
489d5531 | 1424 | TString commonHistResults4thOrderName = "AliFlowCommonHistResults4thOrderQC"; |
1425 | commonHistResults4thOrderName += fAnalysisLabel->Data(); | |
1426 | fCommonHistsResults4th = new AliFlowCommonHistResults(commonHistResults4thOrderName.Data()); | |
1427 | fHistList->Add(fCommonHistsResults4th); | |
1268c371 | 1428 | // Common result histograms for QC{6}: |
489d5531 | 1429 | TString commonHistResults6thOrderName = "AliFlowCommonHistResults6thOrderQC"; |
1430 | commonHistResults6thOrderName += fAnalysisLabel->Data(); | |
1431 | fCommonHistsResults6th = new AliFlowCommonHistResults(commonHistResults6thOrderName.Data()); | |
1432 | fHistList->Add(fCommonHistsResults6th); | |
1268c371 | 1433 | // Common result histograms for QC{8}: |
489d5531 | 1434 | TString commonHistResults8thOrderName = "AliFlowCommonHistResults8thOrderQC"; |
1435 | commonHistResults8thOrderName += fAnalysisLabel->Data(); | |
1436 | fCommonHistsResults8th = new AliFlowCommonHistResults(commonHistResults8thOrderName.Data()); | |
1437 | fHistList->Add(fCommonHistsResults8th); | |
1438 | ||
1439 | } // end of void AliFlowAnalysisWithQCumulants::BookCommonHistograms() | |
1440 | ||
489d5531 | 1441 | //================================================================================================================================ |
1442 | ||
489d5531 | 1443 | void AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms() |
1444 | { | |
1268c371 | 1445 | // Book and fill histograms which hold phi, pt and eta weights. |
489d5531 | 1446 | |
1447 | if(!fWeightsList) | |
1448 | { | |
1268c371 | 1449 | printf("\n WARNING (QC): fWeightsList is NULL in AFAWQC::BAFWH() !!!! \n\n"); |
489d5531 | 1450 | exit(0); |
1451 | } | |
1452 | ||
1453 | TString fUseParticleWeightsName = "fUseParticleWeightsQC"; | |
1454 | fUseParticleWeightsName += fAnalysisLabel->Data(); | |
403e3389 | 1455 | fUseParticleWeights = new TProfile(fUseParticleWeightsName.Data(),"0 = particle weight not used, 1 = particle weight used ",4,0,4); |
489d5531 | 1456 | fUseParticleWeights->SetLabelSize(0.06); |
1457 | (fUseParticleWeights->GetXaxis())->SetBinLabel(1,"w_{#phi}"); | |
1458 | (fUseParticleWeights->GetXaxis())->SetBinLabel(2,"w_{p_{T}}"); | |
1459 | (fUseParticleWeights->GetXaxis())->SetBinLabel(3,"w_{#eta}"); | |
403e3389 | 1460 | (fUseParticleWeights->GetXaxis())->SetBinLabel(4,"w_{track}"); |
489d5531 | 1461 | fUseParticleWeights->Fill(0.5,(Int_t)fUsePhiWeights); |
1462 | fUseParticleWeights->Fill(1.5,(Int_t)fUsePtWeights); | |
1463 | fUseParticleWeights->Fill(2.5,(Int_t)fUseEtaWeights); | |
403e3389 | 1464 | fUseParticleWeights->Fill(3.5,(Int_t)fUseTrackWeights); |
489d5531 | 1465 | fWeightsList->Add(fUseParticleWeights); |
1466 | ||
1467 | if(fUsePhiWeights) | |
1468 | { | |
1469 | if(fWeightsList->FindObject("phi_weights")) | |
1470 | { | |
1471 | fPhiWeights = dynamic_cast<TH1F*>(fWeightsList->FindObject("phi_weights")); | |
1268c371 | 1472 | if(!fPhiWeights) |
1473 | { | |
1474 | printf("\n WARNING (QC): fPhiWeights is NULL in AFAWQC::BAFWH() !!!!\n\n"); | |
1475 | exit(0); | |
1476 | } | |
489d5531 | 1477 | if(TMath::Abs(fPhiWeights->GetBinWidth(1)-fPhiBinWidth)>pow(10.,-6.)) |
1478 | { | |
1479 | cout<<endl; | |
1480 | cout<<"WARNING (QC): Inconsistent binning in histograms for phi-weights throughout the code."<<endl; | |
1481 | cout<<endl; | |
6fbbbbf1 | 1482 | //exit(0); |
489d5531 | 1483 | } |
1484 | } else | |
1485 | { | |
1486 | cout<<"WARNING: fWeightsList->FindObject(\"phi_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1487 | exit(0); | |
1488 | } | |
1489 | } // end of if(fUsePhiWeights) | |
1490 | ||
1491 | if(fUsePtWeights) | |
1492 | { | |
1493 | if(fWeightsList->FindObject("pt_weights")) | |
1494 | { | |
1495 | fPtWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("pt_weights")); | |
1268c371 | 1496 | if(!fPtWeights) |
1497 | { | |
1498 | printf("\n WARNING (QC): fPtWeights is NULL in AFAWQC::BAFWH() !!!!\n\n"); | |
1499 | exit(0); | |
1500 | } | |
489d5531 | 1501 | if(TMath::Abs(fPtWeights->GetBinWidth(1)-fPtBinWidth)>pow(10.,-6.)) |
1502 | { | |
1503 | cout<<endl; | |
1504 | cout<<"WARNING (QC): Inconsistent binning in histograms for pt-weights throughout the code."<<endl; | |
1505 | cout<<endl; | |
6fbbbbf1 | 1506 | //exit(0); |
489d5531 | 1507 | } |
1508 | } else | |
1509 | { | |
1510 | cout<<"WARNING: fWeightsList->FindObject(\"pt_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1511 | exit(0); | |
1512 | } | |
1513 | } // end of if(fUsePtWeights) | |
1514 | ||
1515 | if(fUseEtaWeights) | |
1516 | { | |
1517 | if(fWeightsList->FindObject("eta_weights")) | |
1518 | { | |
1519 | fEtaWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("eta_weights")); | |
1268c371 | 1520 | if(!fEtaWeights) |
1521 | { | |
1522 | printf("\n WARNING (QC): fEtaWeights is NULL in AFAWQC::BAFWH() !!!!\n\n"); | |
1523 | exit(0); | |
1524 | } | |
489d5531 | 1525 | if(TMath::Abs(fEtaWeights->GetBinWidth(1)-fEtaBinWidth)>pow(10.,-6.)) |
1526 | { | |
1527 | cout<<endl; | |
1528 | cout<<"WARNING (QC): Inconsistent binning in histograms for eta-weights throughout the code."<<endl; | |
1529 | cout<<endl; | |
6fbbbbf1 | 1530 | //exit(0); |
489d5531 | 1531 | } |
1532 | } else | |
1533 | { | |
1534 | cout<<"WARNING: fUseEtaWeights && fWeightsList->FindObject(\"eta_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1535 | exit(0); | |
1536 | } | |
1537 | } // end of if(fUseEtaWeights) | |
1538 | ||
1539 | } // end of AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms() | |
1540 | ||
489d5531 | 1541 | //================================================================================================================================ |
1542 | ||
489d5531 | 1543 | void AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow() |
1544 | { | |
1545 | // Book all objects for integrated flow: | |
e5834fcb | 1546 | // a) Book profile to hold all flags for integrated flow; |
1547 | // b) Book event-by-event quantities; | |
1548 | // c) Book profiles; // to be improved (comment) | |
489d5531 | 1549 | // d) Book histograms holding the final results. |
1550 | ||
1551 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?) | |
1552 | TString powerFlag[2] = {"linear","quadratic"}; // to be improved (should I promote this to data members?) | |
1553 | ||
1554 | // a) Book profile to hold all flags for integrated flow: | |
1555 | TString intFlowFlagsName = "fIntFlowFlags"; | |
1556 | intFlowFlagsName += fAnalysisLabel->Data(); | |
3435cacb | 1557 | fIntFlowFlags = new TProfile(intFlowFlagsName.Data(),"Flags for Integrated Flow",15,0,15); |
489d5531 | 1558 | fIntFlowFlags->SetTickLength(-0.01,"Y"); |
1559 | fIntFlowFlags->SetMarkerStyle(25); | |
403e3389 | 1560 | fIntFlowFlags->SetLabelSize(0.04); |
489d5531 | 1561 | fIntFlowFlags->SetLabelOffset(0.02,"Y"); |
1562 | fIntFlowFlags->GetXaxis()->SetBinLabel(1,"Particle Weights"); | |
1563 | fIntFlowFlags->GetXaxis()->SetBinLabel(2,"Event Weights"); | |
1564 | fIntFlowFlags->GetXaxis()->SetBinLabel(3,"Corrected for NUA?"); | |
b3dacf6b | 1565 | fIntFlowFlags->GetXaxis()->SetBinLabel(4,"Print RF results"); |
489d5531 | 1566 | fIntFlowFlags->GetXaxis()->SetBinLabel(5,"Print RP results"); |
3b552efe | 1567 | fIntFlowFlags->GetXaxis()->SetBinLabel(6,"Print POI results"); |
b3dacf6b | 1568 | fIntFlowFlags->GetXaxis()->SetBinLabel(7,"Print RF (rebinned in M) results"); |
1569 | fIntFlowFlags->GetXaxis()->SetBinLabel(8,"Corrected for NUA vs M?"); | |
1570 | fIntFlowFlags->GetXaxis()->SetBinLabel(9,"Propagate errors to v_{n} from correlations?"); | |
1571 | fIntFlowFlags->GetXaxis()->SetBinLabel(10,"Calculate cumulants vs M"); | |
0dd3b008 | 1572 | fIntFlowFlags->GetXaxis()->SetBinLabel(11,"fMinimumBiasReferenceFlow"); |
8e1cefdd | 1573 | fIntFlowFlags->GetXaxis()->SetBinLabel(12,"fForgetAboutCovariances"); |
e5834fcb | 1574 | fIntFlowFlags->GetXaxis()->SetBinLabel(13,"fStorePhiDistributionForOneEvent"); |
dd442cd2 | 1575 | fIntFlowFlags->GetXaxis()->SetBinLabel(14,"fFillMultipleControlHistograms"); |
3435cacb | 1576 | fIntFlowFlags->GetXaxis()->SetBinLabel(15,"Calculate all correlations vs M"); |
489d5531 | 1577 | fIntFlowList->Add(fIntFlowFlags); |
1578 | ||
1579 | // b) Book event-by-event quantities: | |
1580 | // Re[Q_{m*n,k}], Im[Q_{m*n,k}] and S_{p,k}^M: | |
8ed4edc7 | 1581 | fReQ = new TMatrixD(6,9); |
1582 | fImQ = new TMatrixD(6,9); | |
1268c371 | 1583 | fSpk = new TMatrixD(8,9); |
489d5531 | 1584 | // average correlations <2>, <4>, <6> and <8> for single event (bining is the same as in fIntFlowCorrelationsPro and fIntFlowCorrelationsHist): |
1585 | TString intFlowCorrelationsEBEName = "fIntFlowCorrelationsEBE"; | |
1586 | intFlowCorrelationsEBEName += fAnalysisLabel->Data(); | |
1587 | fIntFlowCorrelationsEBE = new TH1D(intFlowCorrelationsEBEName.Data(),intFlowCorrelationsEBEName.Data(),4,0,4); | |
1588 | // weights for average correlations <2>, <4>, <6> and <8> for single event: | |
1589 | TString intFlowEventWeightsForCorrelationsEBEName = "fIntFlowEventWeightsForCorrelationsEBE"; | |
1590 | intFlowEventWeightsForCorrelationsEBEName += fAnalysisLabel->Data(); | |
1591 | fIntFlowEventWeightsForCorrelationsEBE = new TH1D(intFlowEventWeightsForCorrelationsEBEName.Data(),intFlowEventWeightsForCorrelationsEBEName.Data(),4,0,4); | |
1592 | // average all correlations for single event (bining is the same as in fIntFlowCorrelationsAllPro and fIntFlowCorrelationsAllHist): | |
1593 | TString intFlowCorrelationsAllEBEName = "fIntFlowCorrelationsAllEBE"; | |
1594 | intFlowCorrelationsAllEBEName += fAnalysisLabel->Data(); | |
403e3389 | 1595 | fIntFlowCorrelationsAllEBE = new TH1D(intFlowCorrelationsAllEBEName.Data(),intFlowCorrelationsAllEBEName.Data(),64,0,64); |
489d5531 | 1596 | // average correction terms for non-uniform acceptance for single event |
1597 | // (binning is the same as in fIntFlowCorrectionTermsForNUAPro[2] and fIntFlowCorrectionTermsForNUAHist[2]): | |
1598 | TString fIntFlowCorrectionTermsForNUAEBEName = "fIntFlowCorrectionTermsForNUAEBE"; | |
1599 | fIntFlowCorrectionTermsForNUAEBEName += fAnalysisLabel->Data(); | |
1600 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
1601 | { | |
b92ea2b9 | 1602 | fIntFlowCorrectionTermsForNUAEBE[sc] = new TH1D(Form("%s: %s terms",fIntFlowCorrectionTermsForNUAEBEName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4); |
489d5531 | 1603 | } |
0328db2d | 1604 | // event weights for terms for non-uniform acceptance: |
1605 | TString fIntFlowEventWeightForCorrectionTermsForNUAEBEName = "fIntFlowEventWeightForCorrectionTermsForNUAEBE"; | |
1606 | fIntFlowEventWeightForCorrectionTermsForNUAEBEName += fAnalysisLabel->Data(); | |
1607 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
1608 | { | |
b92ea2b9 | 1609 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc] = new TH1D(Form("%s: %s terms",fIntFlowEventWeightForCorrectionTermsForNUAEBEName.Data(),sinCosFlag[sc].Data()),Form("Event weights for terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4); // to be improved - 4 |
0328db2d | 1610 | } |
489d5531 | 1611 | // c) Book profiles: // to be improved (comment) |
1612 | // profile to hold average multiplicities and number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8: | |
1613 | TString avMultiplicityName = "fAvMultiplicity"; | |
1614 | avMultiplicityName += fAnalysisLabel->Data(); | |
403e3389 | 1615 | fAvMultiplicity = new TProfile(avMultiplicityName.Data(),"Average multiplicities of reference particles (RPs)",9,0,9); |
489d5531 | 1616 | fAvMultiplicity->SetTickLength(-0.01,"Y"); |
1617 | fAvMultiplicity->SetMarkerStyle(25); | |
1618 | fAvMultiplicity->SetLabelSize(0.05); | |
1619 | fAvMultiplicity->SetLabelOffset(0.02,"Y"); | |
403e3389 | 1620 | fAvMultiplicity->SetYTitle("Average multiplicity"); |
489d5531 | 1621 | (fAvMultiplicity->GetXaxis())->SetBinLabel(1,"all evts"); |
1622 | (fAvMultiplicity->GetXaxis())->SetBinLabel(2,"n_{RP} #geq 1"); | |
1623 | (fAvMultiplicity->GetXaxis())->SetBinLabel(3,"n_{RP} #geq 2"); | |
1624 | (fAvMultiplicity->GetXaxis())->SetBinLabel(4,"n_{RP} #geq 3"); | |
1625 | (fAvMultiplicity->GetXaxis())->SetBinLabel(5,"n_{RP} #geq 4"); | |
1626 | (fAvMultiplicity->GetXaxis())->SetBinLabel(6,"n_{RP} #geq 5"); | |
1627 | (fAvMultiplicity->GetXaxis())->SetBinLabel(7,"n_{RP} #geq 6"); | |
1628 | (fAvMultiplicity->GetXaxis())->SetBinLabel(8,"n_{RP} #geq 7"); | |
1629 | (fAvMultiplicity->GetXaxis())->SetBinLabel(9,"n_{RP} #geq 8"); | |
1630 | fIntFlowProfiles->Add(fAvMultiplicity); | |
b40a910e | 1631 | // Average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with wrong errors!): |
1632 | TString correlationFlag[4] = {"#LT#LT2#GT#GT","#LT#LT4#GT#GT","#LT#LT6#GT#GT","#LT#LT8#GT#GT"}; | |
489d5531 | 1633 | TString intFlowCorrelationsProName = "fIntFlowCorrelationsPro"; |
1634 | intFlowCorrelationsProName += fAnalysisLabel->Data(); | |
1635 | fIntFlowCorrelationsPro = new TProfile(intFlowCorrelationsProName.Data(),"Average correlations for all events",4,0,4,"s"); | |
b40a910e | 1636 | fIntFlowCorrelationsPro->Sumw2(); |
489d5531 | 1637 | fIntFlowCorrelationsPro->SetTickLength(-0.01,"Y"); |
1638 | fIntFlowCorrelationsPro->SetMarkerStyle(25); | |
1639 | fIntFlowCorrelationsPro->SetLabelSize(0.06); | |
1640 | fIntFlowCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
68a3b4b1 | 1641 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 1642 | { |
68a3b4b1 | 1643 | (fIntFlowCorrelationsPro->GetXaxis())->SetBinLabel(b+1,correlationFlag[b].Data()); |
b3dacf6b | 1644 | } |
489d5531 | 1645 | fIntFlowProfiles->Add(fIntFlowCorrelationsPro); |
b40a910e | 1646 | // Average correlations squared <<2>^2>, <<4>^2>, <<6>^2> and <<8>^2> for all events: |
1647 | TString squaredCorrelationFlag[4] = {"#LT#LT2#GT^{2}#GT","#LT#LT4#GT^{2}#GT","#LT#LT6#GT^{2}#GT","#LT#LT8#GT^{2}#GT"}; | |
1648 | TString intFlowSquaredCorrelationsProName = "fIntFlowSquaredCorrelationsPro"; | |
1649 | intFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
1650 | fIntFlowSquaredCorrelationsPro = new TProfile(intFlowSquaredCorrelationsProName.Data(),"Average squared correlations for all events",4,0,4,"s"); | |
1651 | fIntFlowSquaredCorrelationsPro->Sumw2(); | |
1652 | fIntFlowSquaredCorrelationsPro->SetTickLength(-0.01,"Y"); | |
1653 | fIntFlowSquaredCorrelationsPro->SetMarkerStyle(25); | |
1654 | fIntFlowSquaredCorrelationsPro->SetLabelSize(0.06); | |
1655 | fIntFlowSquaredCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
1656 | for(Int_t b=0;b<4;b++) | |
1657 | { | |
1658 | (fIntFlowSquaredCorrelationsPro->GetXaxis())->SetBinLabel(b+1,squaredCorrelationFlag[b].Data()); | |
1659 | } | |
1660 | fIntFlowProfiles->Add(fIntFlowSquaredCorrelationsPro); | |
b3dacf6b | 1661 | if(fCalculateCumulantsVsM) |
1662 | { | |
1663 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
1664 | { | |
b40a910e | 1665 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> versus multiplicity for all events (with wrong errors): |
b3dacf6b | 1666 | TString intFlowCorrelationsVsMProName = "fIntFlowCorrelationsVsMPro"; |
1667 | intFlowCorrelationsVsMProName += fAnalysisLabel->Data(); | |
1668 | fIntFlowCorrelationsVsMPro[ci] = new TProfile(Form("%s, %s",intFlowCorrelationsVsMProName.Data(),correlationFlag[ci].Data()), | |
1669 | Form("%s vs multiplicity",correlationFlag[ci].Data()), | |
b40a910e | 1670 | fnBinsMult,fMinMult,fMaxMult,"s"); |
1671 | fIntFlowCorrelationsVsMPro[ci]->Sumw2(); | |
b3dacf6b | 1672 | fIntFlowCorrelationsVsMPro[ci]->GetYaxis()->SetTitle(correlationFlag[ci].Data()); |
1673 | fIntFlowCorrelationsVsMPro[ci]->GetXaxis()->SetTitle("M"); | |
1674 | fIntFlowProfiles->Add(fIntFlowCorrelationsVsMPro[ci]); | |
b40a910e | 1675 | // average squared correlations <<2>^2>, <<4>^2>, <<6>^2> and <<8>^2> versus multiplicity for all events: |
1676 | TString intFlowSquaredCorrelationsVsMProName = "fIntFlowSquaredCorrelationsVsMPro"; | |
1677 | intFlowSquaredCorrelationsVsMProName += fAnalysisLabel->Data(); | |
1678 | fIntFlowSquaredCorrelationsVsMPro[ci] = new TProfile(Form("%s, %s",intFlowSquaredCorrelationsVsMProName.Data(),squaredCorrelationFlag[ci].Data()), | |
1679 | Form("%s vs multiplicity",squaredCorrelationFlag[ci].Data()), | |
1680 | fnBinsMult,fMinMult,fMaxMult,"s"); | |
1681 | fIntFlowSquaredCorrelationsVsMPro[ci]->Sumw2(); | |
1682 | fIntFlowSquaredCorrelationsVsMPro[ci]->GetYaxis()->SetTitle(squaredCorrelationFlag[ci].Data()); | |
1683 | fIntFlowSquaredCorrelationsVsMPro[ci]->GetXaxis()->SetTitle("M"); | |
1684 | fIntFlowProfiles->Add(fIntFlowSquaredCorrelationsVsMPro[ci]); | |
b3dacf6b | 1685 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index |
1686 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 1687 | // averaged all correlations for all events (with wrong errors!): |
1688 | TString intFlowCorrelationsAllProName = "fIntFlowCorrelationsAllPro"; | |
1689 | intFlowCorrelationsAllProName += fAnalysisLabel->Data(); | |
403e3389 | 1690 | fIntFlowCorrelationsAllPro = new TProfile(intFlowCorrelationsAllProName.Data(),"Average all correlations for all events",64,0,64); |
b84464d3 | 1691 | fIntFlowCorrelationsAllPro->Sumw2(); |
489d5531 | 1692 | fIntFlowCorrelationsAllPro->SetTickLength(-0.01,"Y"); |
1693 | fIntFlowCorrelationsAllPro->SetMarkerStyle(25); | |
1694 | fIntFlowCorrelationsAllPro->SetLabelSize(0.03); | |
1695 | fIntFlowCorrelationsAllPro->SetLabelOffset(0.01,"Y"); | |
1696 | // 2-p correlations: | |
403e3389 | 1697 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(1,"#LT#LT2#GT#GT_{n|n}"); |
1698 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(2,"#LT#LT2#GT#GT_{2n|2n}"); | |
1699 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(3,"#LT#LT2#GT#GT_{3n|3n}"); | |
1700 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(4,"#LT#LT2#GT#GT_{4n|4n}"); | |
489d5531 | 1701 | // 3-p correlations: |
403e3389 | 1702 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(6,"#LT#LT3#GT#GT_{2n|n,n}"); |
1703 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(7,"#LT#LT3#GT#GT_{3n|2n,n}"); | |
1704 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(8,"#LT#LT3#GT#GT_{4n|2n,2n}"); | |
1705 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(9,"#LT#LT3#GT#GT_{4n|3n,n}"); | |
489d5531 | 1706 | // 4-p correlations: |
403e3389 | 1707 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(11,"#LT#LT4#GT#GT_{n,n|n,n}"); |
1708 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(12,"#LT#LT4#GT#GT_{2n,n|2n,n}"); | |
1709 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(13,"#LT#LT4#GT#GT_{2n,2n|2n,2n}"); | |
1710 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(14,"#LT#LT4#GT#GT_{3n|n,n,n}"); | |
1711 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(15,"#LT#LT4#GT#GT_{3n,n|3n,n}"); | |
1712 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(16,"#LT#LT4#GT#GT_{3n,n|2n,2n}"); | |
1713 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(17,"#LT#LT4#GT#GT_{4n|2n,n,n}"); | |
489d5531 | 1714 | // 5-p correlations: |
403e3389 | 1715 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(19,"#LT#LT5#GT#GT_{2n,n|n,n,n}"); |
1716 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(20,"#LT#LT5#GT#GT_{2n,2n|2n,n,n}"); | |
1717 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(21,"#LT#LT5#GT#GT_{3n,n|2n,n,n}"); | |
1718 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(22,"#LT#LT5#GT#GT_{4n|n,n,n,n}"); | |
489d5531 | 1719 | // 6-p correlations: |
403e3389 | 1720 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(24,"#LT#LT6#GT#GT_{n,n,n|n,n,n}"); |
1721 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(25,"#LT#LT6#GT#GT_{2n,n,n|2n,n,n}"); | |
1722 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(26,"#LT#LT6#GT#GT_{2n,2n|n,n,n,n}"); | |
1723 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(27,"#LT#LT6#GT#GT_{3n,n|n,n,n,n}"); | |
489d5531 | 1724 | // 7-p correlations: |
403e3389 | 1725 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(29,"#LT#LT7#GT#GT_{2n,n,n|n,n,n,n}"); |
489d5531 | 1726 | // 8-p correlations: |
403e3389 | 1727 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(31,"#LT#LT8#GT#GT_{n,n,n,n|n,n,n,n}"); |
b84464d3 | 1728 | // EXTRA correlations for v3{5} study: |
403e3389 | 1729 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(33,"#LT#LT4#GT#GT_{4n,2n|3n,3n}"); |
1730 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(34,"#LT#LT5#GT#GT_{3n,3n|2n,2n,2n}"); | |
b84464d3 | 1731 | // EXTRA correlations for Teaney-Yan study: |
403e3389 | 1732 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(35,"#LT#LT2#GT#GT_{5n|5n}"); |
1733 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(36,"#LT#LT2#GT#GT_{6n|6n}"); | |
1734 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(37,"#LT#LT3#GT#GT_{5n|3n,2n}"); | |
1735 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(38,"#LT#LT3#GT#GT_{5n|4n,1n}"); | |
1736 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(39,"#LT#LT3#GT#GT_{6n|3n,3n}"); | |
1737 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(40,"#LT#LT3#GT#GT_{6n|4n,2n}"); | |
1738 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(41,"#LT#LT3#GT#GT_{6n|5n,1n}"); | |
1739 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(42,"#LT#LT4#GT#GT_{6n|3n,2n,1n}"); | |
1740 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(43,"#LT#LT4#GT#GT_{3n,2n|3n,2n}"); | |
1741 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(44,"#LT#LT4#GT#GT_{4n,1n|3n,2n}"); | |
1742 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(45,"#LT#LT4#GT#GT_{3n,3n|3n,3n}"); | |
1743 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(46,"#LT#LT4#GT#GT_{4n,2n|3n,3n}"); | |
1744 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(47,"#LT#LT4#GT#GT_{5n,1n|3n,3n}"); | |
1745 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(48,"#LT#LT4#GT#GT_{4n,2n|4n,2n}"); | |
1746 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(49,"#LT#LT4#GT#GT_{5n,1n|4n,2n}"); | |
1747 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(50,"#LT#LT4#GT#GT_{5n|3n,1n,1n}"); | |
1748 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(51,"#LT#LT4#GT#GT_{5n|2n,2n,1n}"); | |
1749 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(52,"#LT#LT4#GT#GT_{5n,1n|5n,1n}"); | |
1750 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(53,"#LT#LT5#GT#GT_{3n,3n|3n,2n,1n}"); | |
1751 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(54,"#LT#LT5#GT#GT_{4n,2n|3n,2n,1n}"); | |
1752 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(55,"#LT#LT5#GT#GT_{3n,2n|3n,1n,1n}"); | |
1753 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(56,"#LT#LT5#GT#GT_{3n,2n|2n,2n,1n}"); | |
1754 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(57,"#LT#LT5#GT#GT_{5n,1n|3n,2n,1n}"); | |
1755 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(58,"#LT#LT6#GT#GT_{3n,2n,1n|3n,2n,1n}"); | |
1756 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(59,"#LT#LT4#GT#GT_{6n|4n,1n,1n}"); | |
1757 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(60,"#LT#LT4#GT#GT_{6n|2n,2n,2n}"); | |
1758 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(61,"#LT#LT5#GT#GT_{6n|2n,2n,1n,1n}"); | |
1759 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(62,"#LT#LT5#GT#GT_{4n,1n,1n|3n,3n}"); | |
1760 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(63,"#LT#LT6#GT#GT_{3n,3n|2n,2n,1n,1n}"); | |
489d5531 | 1761 | fIntFlowProfiles->Add(fIntFlowCorrelationsAllPro); |
3435cacb | 1762 | // average all correlations versus multiplicity (errors via Sumw2 - to be improved): |
1763 | if(fCalculateAllCorrelationsVsM) | |
1764 | { | |
1765 | // 2-p correlations vs M: | |
1766 | fIntFlowCorrelationsAllVsMPro[0] = new TProfile("two1n1n","#LT#LT2#GT#GT_{n|n}",fnBinsMult,fMinMult,fMaxMult); | |
1767 | fIntFlowCorrelationsAllVsMPro[0]->Sumw2(); | |
1768 | fIntFlowCorrelationsAllVsMPro[0]->GetXaxis()->SetTitle("M"); | |
1769 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[0]); | |
1770 | fIntFlowCorrelationsAllVsMPro[1] = new TProfile("two2n2n","#LT#LT2#GT#GT_{2n|2n}",fnBinsMult,fMinMult,fMaxMult); | |
1771 | fIntFlowCorrelationsAllVsMPro[1]->Sumw2(); | |
1772 | fIntFlowCorrelationsAllVsMPro[1]->GetXaxis()->SetTitle("M"); | |
1773 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[1]); | |
1774 | fIntFlowCorrelationsAllVsMPro[2] = new TProfile("two3n3n","#LT#LT2#GT#GT_{3n|3n}",fnBinsMult,fMinMult,fMaxMult); | |
1775 | fIntFlowCorrelationsAllVsMPro[2]->Sumw2(); | |
1776 | fIntFlowCorrelationsAllVsMPro[2]->GetXaxis()->SetTitle("M"); | |
1777 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[2]); | |
1778 | fIntFlowCorrelationsAllVsMPro[3] = new TProfile("two4n4n","#LT#LT2#GT#GT_{4n|4n}",fnBinsMult,fMinMult,fMaxMult); | |
1779 | fIntFlowCorrelationsAllVsMPro[3]->Sumw2(); | |
1780 | fIntFlowCorrelationsAllVsMPro[3]->GetXaxis()->SetTitle("M"); | |
1781 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[3]); | |
1782 | // 3-p correlations vs M: | |
1783 | fIntFlowCorrelationsAllVsMPro[5] = new TProfile("three2n1n1n","#LT#LT3#GT#GT_{2n|n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1784 | fIntFlowCorrelationsAllVsMPro[5]->Sumw2(); | |
1785 | fIntFlowCorrelationsAllVsMPro[5]->GetXaxis()->SetTitle("M"); | |
1786 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[5]); | |
1787 | fIntFlowCorrelationsAllVsMPro[6] = new TProfile("three3n2n1n","#LT#LT3#GT#GT_{3n|2n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1788 | fIntFlowCorrelationsAllVsMPro[6]->Sumw2(); | |
1789 | fIntFlowCorrelationsAllVsMPro[6]->GetXaxis()->SetTitle("M"); | |
1790 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[6]); | |
1791 | fIntFlowCorrelationsAllVsMPro[7] = new TProfile("three4n2n2n","#LT#LT3#GT#GT_{4n|2n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1792 | fIntFlowCorrelationsAllVsMPro[7]->Sumw2(); | |
1793 | fIntFlowCorrelationsAllVsMPro[7]->GetXaxis()->SetTitle("M"); | |
1794 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[7]); | |
1795 | fIntFlowCorrelationsAllVsMPro[8] = new TProfile("three4n3n1n","#LT#LT3#GT#GT_{4n|3n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1796 | fIntFlowCorrelationsAllVsMPro[8]->Sumw2(); | |
1797 | fIntFlowCorrelationsAllVsMPro[8]->GetXaxis()->SetTitle("M"); | |
1798 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[8]); | |
1799 | // 4-p correlations vs M: | |
1800 | fIntFlowCorrelationsAllVsMPro[10] = new TProfile("four1n1n1n1n","#LT#LT4#GT#GT_{n,n|n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1801 | fIntFlowCorrelationsAllVsMPro[10]->Sumw2(); | |
1802 | fIntFlowCorrelationsAllVsMPro[10]->GetXaxis()->SetTitle("M"); | |
1803 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[10]); | |
1804 | fIntFlowCorrelationsAllVsMPro[11] = new TProfile("four2n1n2n1n","#LT#LT4#GT#GT_{2n,n|2n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1805 | fIntFlowCorrelationsAllVsMPro[11]->Sumw2(); | |
1806 | fIntFlowCorrelationsAllVsMPro[11]->GetXaxis()->SetTitle("M"); | |
1807 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[11]); | |
1808 | fIntFlowCorrelationsAllVsMPro[12] = new TProfile("four2n2n2n2n","#LT#LT4#GT#GT_{2n,2n|2n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1809 | fIntFlowCorrelationsAllVsMPro[12]->Sumw2(); | |
1810 | fIntFlowCorrelationsAllVsMPro[12]->GetXaxis()->SetTitle("M"); | |
1811 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[12]); | |
1812 | fIntFlowCorrelationsAllVsMPro[13] = new TProfile("four3n1n1n1n","#LT#LT4#GT#GT_{3n|n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1813 | fIntFlowCorrelationsAllVsMPro[13]->Sumw2(); | |
1814 | fIntFlowCorrelationsAllVsMPro[13]->GetXaxis()->SetTitle("M"); | |
1815 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[13]); | |
1816 | fIntFlowCorrelationsAllVsMPro[14] = new TProfile("four3n1n3n1n","#LT#LT4#GT#GT_{3n,n|3n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1817 | fIntFlowCorrelationsAllVsMPro[14]->Sumw2(); | |
1818 | fIntFlowCorrelationsAllVsMPro[14]->GetXaxis()->SetTitle("M"); | |
1819 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[14]); | |
1820 | fIntFlowCorrelationsAllVsMPro[15] = new TProfile("four3n1n2n2n","#LT#LT4#GT#GT_{3n,n|2n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1821 | fIntFlowCorrelationsAllVsMPro[15]->Sumw2(); | |
1822 | fIntFlowCorrelationsAllVsMPro[15]->GetXaxis()->SetTitle("M"); | |
1823 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[15]); | |
1824 | fIntFlowCorrelationsAllVsMPro[16] = new TProfile("four4n2n1n1n","#LT#LT4#GT#GT_{4n|2n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1825 | fIntFlowCorrelationsAllVsMPro[16]->Sumw2(); | |
1826 | fIntFlowCorrelationsAllVsMPro[16]->GetXaxis()->SetTitle("M"); | |
1827 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[16]); | |
1828 | // 5-p correlations vs M: | |
403e3389 | 1829 | fIntFlowCorrelationsAllVsMPro[18] = new TProfile("five2n1n1n1n1n","#LT#LT5#GT#GT_{2n,n|n,n,n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1830 | fIntFlowCorrelationsAllVsMPro[18]->Sumw2(); |
1831 | fIntFlowCorrelationsAllVsMPro[18]->GetXaxis()->SetTitle("M"); | |
1832 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[18]); | |
1833 | fIntFlowCorrelationsAllVsMPro[19] = new TProfile("five2n2n2n1n1n","#LT#LT5#GT#GT_{2n,2n|2n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1834 | fIntFlowCorrelationsAllVsMPro[19]->Sumw2(); | |
1835 | fIntFlowCorrelationsAllVsMPro[19]->GetXaxis()->SetTitle("M"); | |
1836 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[19]); | |
1837 | fIntFlowCorrelationsAllVsMPro[20] = new TProfile("five3n1n2n1n1n","#LT#LT5#GT#GT_{3n,n|2n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1838 | fIntFlowCorrelationsAllVsMPro[20]->Sumw2(); | |
1839 | fIntFlowCorrelationsAllVsMPro[20]->GetXaxis()->SetTitle("M"); | |
1840 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[20]); | |
1841 | fIntFlowCorrelationsAllVsMPro[21] = new TProfile("five4n1n1n1n1n","#LT#LT5#GT#GT_{4n|n,n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1842 | fIntFlowCorrelationsAllVsMPro[21]->Sumw2(); | |
1843 | fIntFlowCorrelationsAllVsMPro[21]->GetXaxis()->SetTitle("M"); | |
1844 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[21]); | |
1845 | // 6-p correlations vs M: | |
1846 | fIntFlowCorrelationsAllVsMPro[23] = new TProfile("six1n1n1n1n1n1n","#LT#LT6#GT#GT_{n,n,n|n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1847 | fIntFlowCorrelationsAllVsMPro[23]->Sumw2(); | |
1848 | fIntFlowCorrelationsAllVsMPro[23]->GetXaxis()->SetTitle("M"); | |
1849 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[23]); | |
1850 | fIntFlowCorrelationsAllVsMPro[24] = new TProfile("six2n1n1n2n1n1n","#LT#LT6#GT#GT_{2n,n,n|2n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1851 | fIntFlowCorrelationsAllVsMPro[24]->Sumw2(); | |
1852 | fIntFlowCorrelationsAllVsMPro[24]->GetXaxis()->SetTitle("M"); | |
1853 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[24]); | |
1854 | fIntFlowCorrelationsAllVsMPro[25] = new TProfile("six2n2n1n1n1n1n","#LT#LT6#GT#GT_{2n,2n|n,n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1855 | fIntFlowCorrelationsAllVsMPro[25]->Sumw2(); | |
1856 | fIntFlowCorrelationsAllVsMPro[25]->GetXaxis()->SetTitle("M"); | |
1857 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[25]); | |
1858 | fIntFlowCorrelationsAllVsMPro[26] = new TProfile("six3n1n1n1n1n1n","#LT#LT6#GT#GT_{3n,n|n,n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1859 | fIntFlowCorrelationsAllVsMPro[26]->Sumw2(); | |
1860 | fIntFlowCorrelationsAllVsMPro[26]->GetXaxis()->SetTitle("M"); | |
1861 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[26]); | |
1862 | // 7-p correlations vs M: | |
1863 | fIntFlowCorrelationsAllVsMPro[28] = new TProfile("seven2n1n1n1n1n1n1n","#LT#LT7#GT#GT_{2n,n,n|n,n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1864 | fIntFlowCorrelationsAllVsMPro[28]->Sumw2(); | |
1865 | fIntFlowCorrelationsAllVsMPro[28]->GetXaxis()->SetTitle("M"); | |
1866 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[28]); | |
1867 | // 8-p correlations vs M: | |
1868 | fIntFlowCorrelationsAllVsMPro[30] = new TProfile("eight1n1n1n1n1n1n1n1n","#LT#LT8#GT#GT_{n,n,n,n|n,n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1869 | fIntFlowCorrelationsAllVsMPro[30]->Sumw2(); | |
1870 | fIntFlowCorrelationsAllVsMPro[30]->GetXaxis()->SetTitle("M"); | |
1871 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[30]); | |
b84464d3 | 1872 | // EXTRA correlations vs M for v3{5} study (to be improved - put them in a right order somewhere): |
3435cacb | 1873 | fIntFlowCorrelationsAllVsMPro[32] = new TProfile("four4n2n3n3n","#LT#LT4#GT#GT_{4n,2n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); |
1874 | fIntFlowCorrelationsAllVsMPro[32]->Sumw2(); | |
1875 | fIntFlowCorrelationsAllVsMPro[32]->GetXaxis()->SetTitle("M"); | |
1876 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[32]); | |
b84464d3 | 1877 | fIntFlowCorrelationsAllVsMPro[33] = new TProfile("five3n3n2n2n2n","#LT#LT5#GT#GT_{3n,3n|2n,2n,2n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1878 | fIntFlowCorrelationsAllVsMPro[33]->Sumw2(); |
1879 | fIntFlowCorrelationsAllVsMPro[33]->GetXaxis()->SetTitle("M"); | |
1880 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[33]); | |
b84464d3 | 1881 | // EXTRA correlations vs M for Teaney-Yan study (to be improved - put them in a right order somewhere): |
1882 | fIntFlowCorrelationsAllVsMPro[34] = new TProfile("two5n5n","#LT#LT2#GT#GT_{5n|5n}",fnBinsMult,fMinMult,fMaxMult); | |
1883 | fIntFlowCorrelationsAllVsMPro[34]->Sumw2(); | |
1884 | fIntFlowCorrelationsAllVsMPro[34]->GetXaxis()->SetTitle("M"); | |
1885 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[34]); | |
1886 | fIntFlowCorrelationsAllVsMPro[35] = new TProfile("two6n6n","#LT#LT2#GT#GT_{6n|6n}",fnBinsMult,fMinMult,fMaxMult); | |
1887 | fIntFlowCorrelationsAllVsMPro[35]->Sumw2(); | |
1888 | fIntFlowCorrelationsAllVsMPro[35]->GetXaxis()->SetTitle("M"); | |
1889 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[35]); | |
1890 | fIntFlowCorrelationsAllVsMPro[36] = new TProfile("three5n3n2n","#LT#LT3#GT#GT_{5n|3n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1891 | fIntFlowCorrelationsAllVsMPro[36]->Sumw2(); | |
1892 | fIntFlowCorrelationsAllVsMPro[36]->GetXaxis()->SetTitle("M"); | |
1893 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[36]); | |
1894 | fIntFlowCorrelationsAllVsMPro[37] = new TProfile("three5n4n1n","#LT#LT3#GT#GT_{5n|4n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1895 | fIntFlowCorrelationsAllVsMPro[37]->Sumw2(); | |
1896 | fIntFlowCorrelationsAllVsMPro[37]->GetXaxis()->SetTitle("M"); | |
1897 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[37]); | |
1898 | fIntFlowCorrelationsAllVsMPro[38] = new TProfile("three6n3n3n","#LT#LT3#GT#GT_{6n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); | |
1899 | fIntFlowCorrelationsAllVsMPro[38]->Sumw2(); | |
1900 | fIntFlowCorrelationsAllVsMPro[38]->GetXaxis()->SetTitle("M"); | |
1901 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[38]); | |
1902 | fIntFlowCorrelationsAllVsMPro[39] = new TProfile("three6n4n2n","#LT#LT3#GT#GT_{6n|4n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1903 | fIntFlowCorrelationsAllVsMPro[39]->Sumw2(); | |
1904 | fIntFlowCorrelationsAllVsMPro[39]->GetXaxis()->SetTitle("M"); | |
1905 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[39]); | |
1906 | fIntFlowCorrelationsAllVsMPro[40] = new TProfile("three6n5n1n","#LT#LT3#GT#GT_{6n|5n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1907 | fIntFlowCorrelationsAllVsMPro[40]->Sumw2(); | |
1908 | fIntFlowCorrelationsAllVsMPro[40]->GetXaxis()->SetTitle("M"); | |
1909 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[40]); | |
1910 | fIntFlowCorrelationsAllVsMPro[41] = new TProfile("four6n3n2n1n","#LT#LT4#GT#GT_{6n|3n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1911 | fIntFlowCorrelationsAllVsMPro[41]->Sumw2(); | |
1912 | fIntFlowCorrelationsAllVsMPro[41]->GetXaxis()->SetTitle("M"); | |
1913 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[41]); | |
1914 | fIntFlowCorrelationsAllVsMPro[42] = new TProfile("four3n2n3n2n","#LT#LT4#GT#GT_{3n,2n|3n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1915 | fIntFlowCorrelationsAllVsMPro[42]->Sumw2(); | |
1916 | fIntFlowCorrelationsAllVsMPro[42]->GetXaxis()->SetTitle("M"); | |
1917 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[42]); | |
1918 | fIntFlowCorrelationsAllVsMPro[43] = new TProfile("four4n1n3n2n","#LT#LT4#GT#GT_{4n,1n|3n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1919 | fIntFlowCorrelationsAllVsMPro[43]->Sumw2(); | |
1920 | fIntFlowCorrelationsAllVsMPro[43]->GetXaxis()->SetTitle("M"); | |
1921 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[43]); | |
1922 | fIntFlowCorrelationsAllVsMPro[44] = new TProfile("four3n3n3n3n","#LT#LT4#GT#GT_{3n,3n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); | |
1923 | fIntFlowCorrelationsAllVsMPro[44]->Sumw2(); | |
1924 | fIntFlowCorrelationsAllVsMPro[44]->GetXaxis()->SetTitle("M"); | |
1925 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[44]); | |
1926 | fIntFlowCorrelationsAllVsMPro[45] = new TProfile("four4n2n3n3n","#LT#LT4#GT#GT_{4n,2n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); | |
1927 | fIntFlowCorrelationsAllVsMPro[45]->Sumw2(); | |
1928 | fIntFlowCorrelationsAllVsMPro[45]->GetXaxis()->SetTitle("M"); | |
1929 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[45]); | |
1930 | fIntFlowCorrelationsAllVsMPro[46] = new TProfile("four5n1n3n3n","#LT#LT4#GT#GT_{5n,1n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); | |
1931 | fIntFlowCorrelationsAllVsMPro[46]->Sumw2(); | |
1932 | fIntFlowCorrelationsAllVsMPro[46]->GetXaxis()->SetTitle("M"); | |
1933 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[46]); | |
1934 | fIntFlowCorrelationsAllVsMPro[47] = new TProfile("four4n2n4n2n","#LT#LT4#GT#GT_{4n,2n|4n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1935 | fIntFlowCorrelationsAllVsMPro[47]->Sumw2(); | |
1936 | fIntFlowCorrelationsAllVsMPro[47]->GetXaxis()->SetTitle("M"); | |
1937 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[47]); | |
1938 | fIntFlowCorrelationsAllVsMPro[48] = new TProfile("four5n1n4n2n","#LT#LT4#GT#GT_{5n,1n|4n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1939 | fIntFlowCorrelationsAllVsMPro[48]->Sumw2(); | |
1940 | fIntFlowCorrelationsAllVsMPro[48]->GetXaxis()->SetTitle("M"); | |
1941 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[48]); | |
1942 | fIntFlowCorrelationsAllVsMPro[49] = new TProfile("four5n3n1n1n","#LT#LT4#GT#GT_{5n|3n,1n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1943 | fIntFlowCorrelationsAllVsMPro[49]->Sumw2(); | |
1944 | fIntFlowCorrelationsAllVsMPro[49]->GetXaxis()->SetTitle("M"); | |
1945 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[49]); | |
1946 | fIntFlowCorrelationsAllVsMPro[50] = new TProfile("four5n2n2n1n","#LT#LT4#GT#GT_{5n|2n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1947 | fIntFlowCorrelationsAllVsMPro[50]->Sumw2(); | |
1948 | fIntFlowCorrelationsAllVsMPro[50]->GetXaxis()->SetTitle("M"); | |
1949 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[50]); | |
1950 | fIntFlowCorrelationsAllVsMPro[51] = new TProfile("four5n1n5n1n","#LT#LT4#GT#GT_{5n,1n|5n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1951 | fIntFlowCorrelationsAllVsMPro[51]->Sumw2(); | |
1952 | fIntFlowCorrelationsAllVsMPro[51]->GetXaxis()->SetTitle("M"); | |
1953 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[51]); | |
1954 | fIntFlowCorrelationsAllVsMPro[52] = new TProfile("five3n3n3n2n1n","#LT#LT5#GT#GT_{3n,3n|3n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1955 | fIntFlowCorrelationsAllVsMPro[52]->Sumw2(); | |
1956 | fIntFlowCorrelationsAllVsMPro[52]->GetXaxis()->SetTitle("M"); | |
1957 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[52]); | |
1958 | fIntFlowCorrelationsAllVsMPro[53] = new TProfile("five4n2n3n2n1n","#LT#LT5#GT#GT_{4n,2n|3n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1959 | fIntFlowCorrelationsAllVsMPro[53]->Sumw2(); | |
1960 | fIntFlowCorrelationsAllVsMPro[53]->GetXaxis()->SetTitle("M"); | |
1961 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[53]); | |
1962 | fIntFlowCorrelationsAllVsMPro[54] = new TProfile("five3n2n3n1n1n","#LT#LT5#GT#GT_{3n,2n|3n,1n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1963 | fIntFlowCorrelationsAllVsMPro[54]->Sumw2(); | |
1964 | fIntFlowCorrelationsAllVsMPro[54]->GetXaxis()->SetTitle("M"); | |
1965 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[54]); | |
1966 | fIntFlowCorrelationsAllVsMPro[55] = new TProfile("five3n2n2n2n1n","#LT#LT5#GT#GT_{3n,2n|2n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1967 | fIntFlowCorrelationsAllVsMPro[55]->Sumw2(); | |
1968 | fIntFlowCorrelationsAllVsMPro[55]->GetXaxis()->SetTitle("M"); | |
1969 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[55]); | |
1970 | fIntFlowCorrelationsAllVsMPro[56] = new TProfile("five5n1n3n2n1n","#LT#LT5#GT#GT_{5n,1n|3n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1971 | fIntFlowCorrelationsAllVsMPro[56]->Sumw2(); | |
1972 | fIntFlowCorrelationsAllVsMPro[56]->GetXaxis()->SetTitle("M"); | |
1973 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[56]); | |
1974 | fIntFlowCorrelationsAllVsMPro[57] = new TProfile("six3n2n1n3n2n1n","#LT#LT6#GT#GT_{3n,2n,1n|3n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1975 | fIntFlowCorrelationsAllVsMPro[57]->Sumw2(); | |
1976 | fIntFlowCorrelationsAllVsMPro[57]->GetXaxis()->SetTitle("M"); | |
403e3389 | 1977 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[57]); |
1978 | fIntFlowCorrelationsAllVsMPro[58] = new TProfile("four6n4n1n1n","#LT#LT4#GT#GT_{6n|4n,1n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1979 | fIntFlowCorrelationsAllVsMPro[58]->Sumw2(); | |
1980 | fIntFlowCorrelationsAllVsMPro[58]->GetXaxis()->SetTitle("M"); | |
1981 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[58]); | |
1982 | fIntFlowCorrelationsAllVsMPro[59] = new TProfile("four6n2n2n2n","#LT#LT4#GT#GT_{6n|2n,2n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1983 | fIntFlowCorrelationsAllVsMPro[59]->Sumw2(); | |
1984 | fIntFlowCorrelationsAllVsMPro[59]->GetXaxis()->SetTitle("M"); | |
1985 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[59]); | |
1986 | fIntFlowCorrelationsAllVsMPro[60] = new TProfile("five6n2n2n1n1n","#LT#LT5#GT#GT_{6n|2n,2n,1n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1987 | fIntFlowCorrelationsAllVsMPro[60]->Sumw2(); | |
1988 | fIntFlowCorrelationsAllVsMPro[60]->GetXaxis()->SetTitle("M"); | |
1989 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[60]); | |
1990 | fIntFlowCorrelationsAllVsMPro[61] = new TProfile("five4n1n1n3n3n","#LT#LT5#GT#GT_{4n,1n,1n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); | |
1991 | fIntFlowCorrelationsAllVsMPro[61]->Sumw2(); | |
1992 | fIntFlowCorrelationsAllVsMPro[61]->GetXaxis()->SetTitle("M"); | |
1993 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[61]); | |
1994 | fIntFlowCorrelationsAllVsMPro[62] = new TProfile("six3n3n2n2n1n1n","#LT#LT6#GT#GT_{3n,3n|2n,2n,1n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1995 | fIntFlowCorrelationsAllVsMPro[62]->Sumw2(); | |
1996 | fIntFlowCorrelationsAllVsMPro[62]->GetXaxis()->SetTitle("M"); | |
1997 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[62]); | |
3435cacb | 1998 | } // end of if(fCalculateAllCorrelationsVsM) |
489d5531 | 1999 | // when particle weights are used some extra correlations appear: |
403e3389 | 2000 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 2001 | { |
2002 | TString intFlowExtraCorrelationsProName = "fIntFlowExtraCorrelationsPro"; | |
2003 | intFlowExtraCorrelationsProName += fAnalysisLabel->Data(); | |
2004 | fIntFlowExtraCorrelationsPro = new TProfile(intFlowExtraCorrelationsProName.Data(),"Average extra correlations for all events",100,0,100,"s"); | |
2005 | fIntFlowExtraCorrelationsPro->SetTickLength(-0.01,"Y"); | |
2006 | fIntFlowExtraCorrelationsPro->SetMarkerStyle(25); | |
2007 | fIntFlowExtraCorrelationsPro->SetLabelSize(0.03); | |
2008 | fIntFlowExtraCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
2009 | // extra 2-p correlations: | |
2010 | (fIntFlowExtraCorrelationsPro->GetXaxis())->SetBinLabel(1,"<<w1^3 w2 cos(n*(phi1-phi2))>>"); | |
2011 | (fIntFlowExtraCorrelationsPro->GetXaxis())->SetBinLabel(2,"<<w1 w2 w3^2 cos(n*(phi1-phi2))>>"); | |
2012 | fIntFlowProfiles->Add(fIntFlowExtraCorrelationsPro); | |
403e3389 | 2013 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 2014 | // average product of correlations <2>, <4>, <6> and <8>: |
403e3389 | 2015 | TString productFlag[6] = {"#LT#LT2#GT#LT4#GT#GT","#LT#LT2#GT#LT6#GT#GT","#LT#LT2#GT#LT8#GT#GT", |
2016 | "#LT#LT4#GT#LT6#GT#GT","#LT#LT4#GT#LT8#GT#GT","#LT#LT6#GT#LT8#GT#GT"}; | |
489d5531 | 2017 | TString intFlowProductOfCorrelationsProName = "fIntFlowProductOfCorrelationsPro"; |
2018 | intFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
2019 | fIntFlowProductOfCorrelationsPro = new TProfile(intFlowProductOfCorrelationsProName.Data(),"Average products of correlations",6,0,6); | |
2020 | fIntFlowProductOfCorrelationsPro->SetTickLength(-0.01,"Y"); | |
2021 | fIntFlowProductOfCorrelationsPro->SetMarkerStyle(25); | |
2022 | fIntFlowProductOfCorrelationsPro->SetLabelSize(0.05); | |
2023 | fIntFlowProductOfCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
68a3b4b1 | 2024 | for(Int_t b=0;b<6;b++) |
b3dacf6b | 2025 | { |
68a3b4b1 | 2026 | (fIntFlowProductOfCorrelationsPro->GetXaxis())->SetBinLabel(b+1,productFlag[b].Data()); |
b3dacf6b | 2027 | } |
2028 | fIntFlowProfiles->Add(fIntFlowProductOfCorrelationsPro); | |
ff70ca91 | 2029 | // average product of correlations <2>, <4>, <6> and <8> versus multiplicity |
2030 | // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>] | |
b3dacf6b | 2031 | if(fCalculateCumulantsVsM) |
2032 | { | |
2033 | TString intFlowProductOfCorrelationsVsMProName = "fIntFlowProductOfCorrelationsVsMPro"; | |
2034 | intFlowProductOfCorrelationsVsMProName += fAnalysisLabel->Data(); | |
2035 | for(Int_t pi=0;pi<6;pi++) | |
2036 | { | |
2037 | fIntFlowProductOfCorrelationsVsMPro[pi] = new TProfile(Form("%s, %s",intFlowProductOfCorrelationsVsMProName.Data(),productFlag[pi].Data()), | |
2038 | Form("%s versus multiplicity",productFlag[pi].Data()), | |
2039 | fnBinsMult,fMinMult,fMaxMult); | |
2040 | fIntFlowProductOfCorrelationsVsMPro[pi]->GetXaxis()->SetTitle("M"); | |
2041 | fIntFlowProfiles->Add(fIntFlowProductOfCorrelationsVsMPro[pi]); | |
2042 | } // end of for(Int_t pi=0;pi<6;pi++) | |
2043 | } // end of if(fCalculateCumulantsVsM) | |
0328db2d | 2044 | // average product of correction terms for NUA: |
2045 | TString intFlowProductOfCorrectionTermsForNUAProName = "fIntFlowProductOfCorrectionTermsForNUAPro"; | |
2046 | intFlowProductOfCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
2047 | fIntFlowProductOfCorrectionTermsForNUAPro = new TProfile(intFlowProductOfCorrectionTermsForNUAProName.Data(),"Average products of correction terms for NUA",27,0,27); | |
2048 | fIntFlowProductOfCorrectionTermsForNUAPro->SetTickLength(-0.01,"Y"); | |
2049 | fIntFlowProductOfCorrectionTermsForNUAPro->SetMarkerStyle(25); | |
403e3389 | 2050 | fIntFlowProductOfCorrectionTermsForNUAPro->SetLabelSize(0.03); |
0328db2d | 2051 | fIntFlowProductOfCorrectionTermsForNUAPro->SetLabelOffset(0.01,"Y"); |
2052 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(1,"<<2><cos(#phi)>>"); | |
2053 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(2,"<<2><sin(#phi)>>"); | |
2054 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(3,"<<cos(#phi)><sin(#phi)>>"); | |
2055 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(4,"Cov(<2>,<cos(#phi_{1}+#phi_{2})>)"); | |
2056 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(5,"Cov(<2>,<sin(#phi_{1}+#phi_{2})>)"); | |
2057 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(6,"Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2058 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(7,"Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2059 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(8,"Cov(<4>,<cos(#phi)>)"); | |
2060 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(9,"Cov(<4>,<sin(#phi)>)"); | |
2061 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(10,"Cov(<4>,<cos(#phi_{1}+#phi_{2})>)"); | |
2062 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(11,"Cov(<4>,<sin(#phi_{1}+#phi_{2})>)"); | |
2063 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(12,"Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
2064 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(13,"Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
2065 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(14,"Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
2066 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(15,"Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
2067 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(16,"Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2068 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(17,"Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2069 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(18,"Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
2070 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(19,"Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
2071 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(20,"Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2072 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(21,"Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2073 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(22,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>)"); | |
2074 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(23,"Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2075 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(24,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2076 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(25,"Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2077 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(26,"Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2078 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(27,"Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>)"); | |
2079 | fIntFlowProfiles->Add(fIntFlowProductOfCorrectionTermsForNUAPro); | |
489d5531 | 2080 | // average correction terms for non-uniform acceptance (with wrong errors!): |
2081 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2082 | { | |
2083 | TString intFlowCorrectionTermsForNUAProName = "fIntFlowCorrectionTermsForNUAPro"; | |
2084 | intFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
b92ea2b9 | 2085 | fIntFlowCorrectionTermsForNUAPro[sc] = new TProfile(Form("%s: %s terms",intFlowCorrectionTermsForNUAProName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4,"s"); |
489d5531 | 2086 | fIntFlowCorrectionTermsForNUAPro[sc]->SetTickLength(-0.01,"Y"); |
2087 | fIntFlowCorrectionTermsForNUAPro[sc]->SetMarkerStyle(25); | |
403e3389 | 2088 | fIntFlowCorrectionTermsForNUAPro[sc]->SetLabelSize(0.05); |
489d5531 | 2089 | fIntFlowCorrectionTermsForNUAPro[sc]->SetLabelOffset(0.01,"Y"); |
403e3389 | 2090 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(1,Form("#LT#LT%s(n(#phi_{1}))#GT#GT",sinCosFlag[sc].Data())); |
2091 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(2,Form("#LT#LT%s(n(#phi_{1}+#phi_{2}))#GT#GT",sinCosFlag[sc].Data())); | |
2092 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(3,Form("#LT#LT%s(n(#phi_{1}-#phi_{2}-#phi_{3}))#GT#GT",sinCosFlag[sc].Data())); | |
2093 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(4,Form("#LT#LT%s(n(2#phi_{1}-#phi_{2}))#GT#GT",sinCosFlag[sc].Data())); | |
489d5531 | 2094 | fIntFlowProfiles->Add(fIntFlowCorrectionTermsForNUAPro[sc]); |
2001bc3a | 2095 | // versus multiplicity: |
b3dacf6b | 2096 | if(fCalculateCumulantsVsM) |
2097 | { | |
2098 | TString correctionTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4 | |
2099 | for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) | |
2100 | { | |
2101 | TString intFlowCorrectionTermsForNUAVsMProName = "fIntFlowCorrectionTermsForNUAVsMPro"; | |
2102 | intFlowCorrectionTermsForNUAVsMProName += fAnalysisLabel->Data(); | |
2103 | fIntFlowCorrectionTermsForNUAVsMPro[sc][ci] = new TProfile(Form("%s: #LT#LT%s%s#GT#GT",intFlowCorrectionTermsForNUAVsMProName.Data(),sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()),Form("#LT#LT%s%s#GT#GT vs M",sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()),fnBinsMult,fMinMult,fMaxMult,"s"); | |
2104 | fIntFlowProfiles->Add(fIntFlowCorrectionTermsForNUAVsMPro[sc][ci]); | |
2105 | } | |
2106 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 2107 | } // end of for(Int_t sc=0;sc<2;sc++) |
2108 | ||
2109 | // d) Book histograms holding the final results: | |
2110 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with correct errors!): | |
2111 | TString intFlowCorrelationsHistName = "fIntFlowCorrelationsHist"; | |
2112 | intFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
2113 | fIntFlowCorrelationsHist = new TH1D(intFlowCorrelationsHistName.Data(),"Average correlations for all events",4,0,4); | |
2114 | fIntFlowCorrelationsHist->SetTickLength(-0.01,"Y"); | |
2115 | fIntFlowCorrelationsHist->SetMarkerStyle(25); | |
2116 | fIntFlowCorrelationsHist->SetLabelSize(0.06); | |
2117 | fIntFlowCorrelationsHist->SetLabelOffset(0.01,"Y"); | |
403e3389 | 2118 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(1,"#LT#LT2#GT#GT"); |
2119 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(2,"#LT#LT4#GT#GT"); | |
2120 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(3,"#LT#LT6#GT#GT"); | |
2121 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(4,"#LT#LT8#GT#GT"); | |
489d5531 | 2122 | fIntFlowResults->Add(fIntFlowCorrelationsHist); |
ff70ca91 | 2123 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with correct errors!) vs M: |
b3dacf6b | 2124 | if(fCalculateCumulantsVsM) |
2125 | { | |
2126 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2127 | { | |
2128 | TString intFlowCorrelationsVsMHistName = "fIntFlowCorrelationsVsMHist"; | |
2129 | intFlowCorrelationsVsMHistName += fAnalysisLabel->Data(); | |
2130 | fIntFlowCorrelationsVsMHist[ci] = new TH1D(Form("%s, %s",intFlowCorrelationsVsMHistName.Data(),correlationFlag[ci].Data()), | |
2131 | Form("%s vs multiplicity",correlationFlag[ci].Data()), | |
2132 | fnBinsMult,fMinMult,fMaxMult); | |
2133 | fIntFlowCorrelationsVsMHist[ci]->GetYaxis()->SetTitle(correlationFlag[ci].Data()); | |
2134 | fIntFlowCorrelationsVsMHist[ci]->GetXaxis()->SetTitle("M"); | |
2135 | fIntFlowResults->Add(fIntFlowCorrelationsVsMHist[ci]); | |
2136 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
2137 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 2138 | // average all correlations for all events (with correct errors!): |
2139 | TString intFlowCorrelationsAllHistName = "fIntFlowCorrelationsAllHist"; | |
2140 | intFlowCorrelationsAllHistName += fAnalysisLabel->Data(); | |
8ed4edc7 | 2141 | fIntFlowCorrelationsAllHist = new TH1D(intFlowCorrelationsAllHistName.Data(),"Average correlations for all events",34,0,34); |
489d5531 | 2142 | fIntFlowCorrelationsAllHist->SetTickLength(-0.01,"Y"); |
2143 | fIntFlowCorrelationsAllHist->SetMarkerStyle(25); | |
2144 | fIntFlowCorrelationsAllHist->SetLabelSize(0.03); | |
2145 | fIntFlowCorrelationsAllHist->SetLabelOffset(0.01,"Y"); | |
2146 | // 2-p correlations: | |
2147 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(1,"<<2>>_{n|n}"); | |
2148 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(2,"<<2>>_{2n|2n}"); | |
2149 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(3,"<<2>>_{3n|3n}"); | |
2150 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(4,"<<2>>_{4n|4n}"); | |
2151 | // 3-p correlations: | |
2152 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(6,"<<3>>_{2n|n,n}"); | |
2153 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}"); | |
2154 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}"); | |
2155 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}"); | |
2156 | // 4-p correlations: | |
2157 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}"); | |
2158 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}"); | |
2159 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}"); | |
2160 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}"); | |
2161 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}"); | |
2162 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}"); | |
2163 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}"); | |
2164 | // 5-p correlations: | |
2165 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}"); | |
2166 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}"); | |
2167 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}"); | |
2168 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}"); | |
2169 | // 6-p correlations: | |
2170 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}"); | |
2171 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}"); | |
2172 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}"); | |
2173 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}"); | |
2174 | // 7-p correlations: | |
2175 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}"); | |
2176 | // 8-p correlations: | |
2177 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}"); | |
2178 | fIntFlowResults->Add(fIntFlowCorrelationsAllHist); | |
2179 | // average correction terms for non-uniform acceptance (with correct errors!): | |
2180 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2181 | { | |
2182 | TString intFlowCorrectionTermsForNUAHistName = "fIntFlowCorrectionTermsForNUAHist"; | |
2183 | intFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
b92ea2b9 | 2184 | fIntFlowCorrectionTermsForNUAHist[sc] = new TH1D(Form("%s: %s terms",intFlowCorrectionTermsForNUAHistName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4); |
489d5531 | 2185 | fIntFlowCorrectionTermsForNUAHist[sc]->SetTickLength(-0.01,"Y"); |
2186 | fIntFlowCorrectionTermsForNUAHist[sc]->SetMarkerStyle(25); | |
403e3389 | 2187 | fIntFlowCorrectionTermsForNUAHist[sc]->SetLabelSize(0.05); |
489d5531 | 2188 | fIntFlowCorrectionTermsForNUAHist[sc]->SetLabelOffset(0.01,"Y"); |
b92ea2b9 | 2189 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(1,Form("#LT#LT%s(n(#phi_{1}))#GT#GT",sinCosFlag[sc].Data())); |
403e3389 | 2190 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(2,Form("#LT#LT%s(n(#phi_{1}+#phi_{2}))#GT#GT",sinCosFlag[sc].Data())); |
2191 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(3,Form("#LT#LT%s(n(#phi_{1}-#phi_{2}-#phi_{3}))#GT#GT",sinCosFlag[sc].Data())); | |
2192 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(4,Form("#LT#LT%s(n(2#phi_{1}-#phi_{2}))#GT#GT",sinCosFlag[sc].Data())); | |
489d5531 | 2193 | fIntFlowResults->Add(fIntFlowCorrectionTermsForNUAHist[sc]); |
2194 | } // end of for(Int_t sc=0;sc<2;sc++) | |
2195 | // covariances (multiplied with weight dependent prefactor): | |
2196 | TString intFlowCovariancesName = "fIntFlowCovariances"; | |
2197 | intFlowCovariancesName += fAnalysisLabel->Data(); | |
2198 | fIntFlowCovariances = new TH1D(intFlowCovariancesName.Data(),"Covariances (multiplied with weight dependent prefactor)",6,0,6); | |
2199 | fIntFlowCovariances->SetLabelSize(0.04); | |
2200 | fIntFlowCovariances->SetMarkerStyle(25); | |
403e3389 | 2201 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(1,"Cov(#LT2#GT,#LT4#GT)"); |
2202 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(2,"Cov(#LT2#GT,#LT6#GT)"); | |
2203 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(3,"Cov(#LT2#GT,#LT8#GT)"); | |
2204 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(4,"Cov(#LT4#GT,#LT6#GT)"); | |
2205 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(5,"Cov(#LT4#GT,#LT8#GT)"); | |
2206 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(6,"Cov(#LT6#GT,#LT8#GT)"); | |
489d5531 | 2207 | fIntFlowResults->Add(fIntFlowCovariances); |
2208 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8>: | |
2209 | TString intFlowSumOfEventWeightsName = "fIntFlowSumOfEventWeights"; | |
2210 | intFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
2211 | for(Int_t power=0;power<2;power++) | |
2212 | { | |
2213 | fIntFlowSumOfEventWeights[power] = new TH1D(Form("%s: %s",intFlowSumOfEventWeightsName.Data(),powerFlag[power].Data()),Form("Sum of %s event weights for correlations",powerFlag[power].Data()),4,0,4); | |
403e3389 | 2214 | fIntFlowSumOfEventWeights[power]->SetLabelSize(0.04); |
489d5531 | 2215 | fIntFlowSumOfEventWeights[power]->SetMarkerStyle(25); |
2216 | if(power == 0) | |
2217 | { | |
403e3389 | 2218 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{#LT2#GT}"); |
2219 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{#LT4#GT}"); | |
2220 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{#LT6#GT}"); | |
2221 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{#LT8#GT}"); | |
489d5531 | 2222 | } else if (power == 1) |
2223 | { | |
403e3389 | 2224 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{#LT2#GT}^{2}"); |
2225 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{#LT4#GT}^{2}"); | |
2226 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{#LT6#GT}^{2}"); | |
2227 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{#LT8#GT}^{2}"); | |
489d5531 | 2228 | } |
2229 | fIntFlowResults->Add(fIntFlowSumOfEventWeights[power]); | |
2230 | } | |
2231 | // sum of products of event weights for correlations <2>, <4>, <6> and <8>: | |
2232 | TString intFlowSumOfProductOfEventWeightsName = "fIntFlowSumOfProductOfEventWeights"; | |
2233 | intFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
2234 | fIntFlowSumOfProductOfEventWeights = new TH1D(intFlowSumOfProductOfEventWeightsName.Data(),"Sum of product of event weights for correlations",6,0,6); | |
403e3389 | 2235 | fIntFlowSumOfProductOfEventWeights->SetLabelSize(0.04); |
489d5531 | 2236 | fIntFlowSumOfProductOfEventWeights->SetMarkerStyle(25); |
403e3389 | 2237 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LT4#GT}"); |
2238 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LT6#GT}"); | |
2239 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LT8#GT}"); | |
2240 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LT6#GT}"); | |
2241 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(5,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LT8#GT}"); | |
2242 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(6,"#sum_{i=1}^{N} w_{#LT6#GT} w_{#LT8#GT}"); | |
489d5531 | 2243 | fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeights); |
ff70ca91 | 2244 | // final result for covariances of correlations (multiplied with weight dependent prefactor) versus M |
2245 | // [0=Cov(2,4),1=Cov(2,6),2=Cov(2,8),3=Cov(4,6),4=Cov(4,8),5=Cov(6,8)]: | |
b3dacf6b | 2246 | if(fCalculateCumulantsVsM) |
ff70ca91 | 2247 | { |
b3dacf6b | 2248 | TString intFlowCovariancesVsMName = "fIntFlowCovariancesVsM"; |
2249 | intFlowCovariancesVsMName += fAnalysisLabel->Data(); | |
2250 | TString covarianceFlag[6] = {"Cov(<2>,<4>)","Cov(<2>,<6>)","Cov(<2>,<8>)","Cov(<4>,<6>)","Cov(<4>,<8>)","Cov(<6>,<8>)"}; | |
2251 | for(Int_t ci=0;ci<6;ci++) | |
2252 | { | |
2253 | fIntFlowCovariancesVsM[ci] = new TH1D(Form("%s, %s",intFlowCovariancesVsMName.Data(),covarianceFlag[ci].Data()), | |
2254 | Form("%s vs multiplicity",covarianceFlag[ci].Data()), | |
2255 | fnBinsMult,fMinMult,fMaxMult); | |
2256 | fIntFlowCovariancesVsM[ci]->GetYaxis()->SetTitle(covarianceFlag[ci].Data()); | |
2257 | fIntFlowCovariancesVsM[ci]->GetXaxis()->SetTitle("M"); | |
2258 | fIntFlowResults->Add(fIntFlowCovariancesVsM[ci]); | |
2259 | } | |
2260 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 2261 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8> versus multiplicity |
2262 | // [0=sum{w_{<2>}},1=sum{w_{<4>}},2=sum{w_{<6>}},3=sum{w_{<8>}}][0=linear 1,1=quadratic]: | |
b3dacf6b | 2263 | if(fCalculateCumulantsVsM) |
ff70ca91 | 2264 | { |
b3dacf6b | 2265 | TString intFlowSumOfEventWeightsVsMName = "fIntFlowSumOfEventWeightsVsM"; |
2266 | intFlowSumOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
2267 | TString sumFlag[2][4] = {{"#sum_{i=1}^{N} w_{<2>}","#sum_{i=1}^{N} w_{<4>}","#sum_{i=1}^{N} w_{<6>}","#sum_{i=1}^{N} w_{<8>}"}, | |
2268 | {"#sum_{i=1}^{N} w_{<2>}^{2}","#sum_{i=1}^{N} w_{<4>}^{2}","#sum_{i=1}^{N} w_{<6>}^{2}","#sum_{i=1}^{N} w_{<8>}^{2}"}}; | |
2269 | for(Int_t si=0;si<4;si++) | |
ff70ca91 | 2270 | { |
b3dacf6b | 2271 | for(Int_t power=0;power<2;power++) |
2272 | { | |
2273 | fIntFlowSumOfEventWeightsVsM[si][power] = new TH1D(Form("%s, %s",intFlowSumOfEventWeightsVsMName.Data(),sumFlag[power][si].Data()), | |
2274 | Form("%s vs multiplicity",sumFlag[power][si].Data()), | |
2275 | fnBinsMult,fMinMult,fMaxMult); | |
2276 | fIntFlowSumOfEventWeightsVsM[si][power]->GetYaxis()->SetTitle(sumFlag[power][si].Data()); | |
2277 | fIntFlowSumOfEventWeightsVsM[si][power]->GetXaxis()->SetTitle("M"); | |
2278 | fIntFlowResults->Add(fIntFlowSumOfEventWeightsVsM[si][power]); | |
2279 | } // end of for(Int_t power=0;power<2;power++) | |
2280 | } // end of for(Int_t si=0;si<4;si++) | |
2281 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 2282 | // sum of products of event weights for correlations <2>, <4>, <6> and <8> vs M |
2283 | // [0=sum{w_{<2>}w_{<4>}},1=sum{w_{<2>}w_{<6>}},2=sum{w_{<2>}w_{<8>}}, | |
2284 | // 3=sum{w_{<4>}w_{<6>}},4=sum{w_{<4>}w_{<8>}},5=sum{w_{<6>}w_{<8>}}]: | |
b3dacf6b | 2285 | if(fCalculateCumulantsVsM) |
2286 | { | |
2287 | TString intFlowSumOfProductOfEventWeightsVsMName = "fIntFlowSumOfProductOfEventWeightsVsM"; | |
2288 | intFlowSumOfProductOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
2289 | TString sopowFlag[6] = {"#sum_{i=1}^{N} w_{<2>} w_{<4>}","#sum_{i=1}^{N} w_{<2>} w_{<6>}","#sum_{i=1}^{N} w_{<2>} w_{<8>}", | |
2290 | "#sum_{i=1}^{N} w_{<4>} w_{<6>}","#sum_{i=1}^{N} w_{<4>} w_{<8>}","#sum_{i=1}^{N} w_{<6>} w_{<8>}"}; | |
2291 | for(Int_t pi=0;pi<6;pi++) | |
2292 | { | |
2293 | fIntFlowSumOfProductOfEventWeightsVsM[pi] = new TH1D(Form("%s, %s",intFlowSumOfProductOfEventWeightsVsMName.Data(),sopowFlag[pi].Data()), | |
2294 | Form("%s versus multiplicity",sopowFlag[pi].Data()), | |
2295 | fnBinsMult,fMinMult,fMaxMult); | |
2296 | fIntFlowSumOfProductOfEventWeightsVsM[pi]->GetXaxis()->SetTitle("M"); | |
2297 | fIntFlowSumOfProductOfEventWeightsVsM[pi]->GetYaxis()->SetTitle(sopowFlag[pi].Data()); | |
2298 | fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeightsVsM[pi]); | |
2299 | } // end of for(Int_t pi=0;pi<6;pi++) | |
2300 | } // end of if(fCalculateCumulantsVsM) | |
0328db2d | 2301 | // covariances of NUA terms (multiplied with weight dependent prefactor): |
2302 | TString intFlowCovariancesNUAName = "fIntFlowCovariancesNUA"; | |
2303 | intFlowCovariancesNUAName += fAnalysisLabel->Data(); | |
2304 | fIntFlowCovariancesNUA = new TH1D(intFlowCovariancesNUAName.Data(),"Covariances for NUA (multiplied with weight dependent prefactor)",27,0,27); | |
2305 | fIntFlowCovariancesNUA->SetLabelSize(0.04); | |
2306 | fIntFlowCovariancesNUA->SetMarkerStyle(25); | |
2307 | fIntFlowCovariancesNUA->GetXaxis()->SetLabelSize(0.02); | |
2308 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(1,"Cov(<2>,<cos(#phi)>"); | |
2309 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(2,"Cov(<2>,<sin(#phi)>)"); | |
2310 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(3,"Cov(<cos(#phi)>,<sin(#phi)>)"); | |
2311 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(4,"Cov(<2>,<cos(#phi_{1}+#phi_{2})>)"); | |
2312 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(5,"Cov(<2>,<sin(#phi_{1}+#phi_{2})>)"); | |
2313 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(6,"Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2314 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(7,"Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2315 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(8,"Cov(<4>,<cos(#phi)>)"); | |
2316 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(9,"Cov(<4>,<sin(#phi)>)"); | |
2317 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(10,"Cov(<4>,<cos(#phi_{1}+#phi_{2})>)"); | |
2318 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(11,"Cov(<4>,<sin(#phi_{1}+#phi_{2})>)"); | |
2319 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(12,"Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
2320 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(13,"Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
2321 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(14,"Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
2322 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(15,"Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
2323 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(16,"Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2324 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(17,"Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2325 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(18,"Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
2326 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(19,"Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
2327 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(20,"Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2328 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(21,"Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2329 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(22,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>)"); | |
2330 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(23,"Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2331 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(24,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2332 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(25,"Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2333 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(26,"Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2334 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(27,"Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>)"); | |
2335 | fIntFlowResults->Add(fIntFlowCovariancesNUA); | |
2336 | // sum of linear and quadratic event weights for NUA terms: | |
2337 | TString intFlowSumOfEventWeightsNUAName = "fIntFlowSumOfEventWeightsNUA"; | |
2338 | intFlowSumOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
2339 | for(Int_t sc=0;sc<2;sc++) | |
2340 | { | |
2341 | for(Int_t power=0;power<2;power++) | |
2342 | { | |
b92ea2b9 | 2343 | fIntFlowSumOfEventWeightsNUA[sc][power] = new TH1D(Form("%s: %s, %s",intFlowSumOfEventWeightsNUAName.Data(),powerFlag[power].Data(),sinCosFlag[sc].Data()),Form("Sum of %s event weights for NUA %s terms",powerFlag[power].Data(),sinCosFlag[sc].Data()),4,0,4); // to be improved - 4 |
0328db2d | 2344 | fIntFlowSumOfEventWeightsNUA[sc][power]->SetLabelSize(0.05); |
2345 | fIntFlowSumOfEventWeightsNUA[sc][power]->SetMarkerStyle(25); | |
2346 | if(power == 0) | |
2347 | { | |
2348 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(1,Form("#sum_{i=1}^{N} w_{<%s(#phi)>}",sinCosFlag[sc].Data())); | |
2349 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(2,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}+#phi_{2})>}",sinCosFlag[sc].Data())); | |
b92ea2b9 | 2350 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(3,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}-#phi_{2}-#phi_{3})>}",sinCosFlag[sc].Data())); |
2351 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(4,Form("#sum_{i=1}^{N} w_{<%s(2#phi_{1}-#phi_{2})>}",sinCosFlag[sc].Data())); | |
0328db2d | 2352 | } else if(power == 1) |
2353 | { | |
2354 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(1,Form("#sum_{i=1}^{N} w_{<%s(#phi)>}^{2}",sinCosFlag[sc].Data())); | |
2355 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(2,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}+#phi_{2})>}^{2}",sinCosFlag[sc].Data())); | |
2356 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(3,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}-#phi_{2}-#phi_{3})>}^{2}",sinCosFlag[sc].Data())); | |
b92ea2b9 | 2357 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(4,Form("#sum_{i=1}^{N} w_{<%s(2#phi_{1}-#phi_{2})>}^{2}",sinCosFlag[sc].Data())); |
0328db2d | 2358 | } |
2359 | fIntFlowResults->Add(fIntFlowSumOfEventWeightsNUA[sc][power]); | |
2360 | } | |
2361 | } | |
2362 | // sum of products of event weights for NUA terms: | |
2363 | TString intFlowSumOfProductOfEventWeightsNUAName = "fIntFlowSumOfProductOfEventWeightsNUA"; | |
2364 | intFlowSumOfProductOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
2365 | fIntFlowSumOfProductOfEventWeightsNUA = new TH1D(intFlowSumOfProductOfEventWeightsNUAName.Data(),"Sum of product of event weights for NUA terms",27,0,27); | |
403e3389 | 2366 | fIntFlowSumOfProductOfEventWeightsNUA->SetLabelSize(0.02); |
0328db2d | 2367 | fIntFlowSumOfProductOfEventWeightsNUA->SetMarkerStyle(25); |
2368 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>} w_{<cos(#phi)>}"); | |
2369 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<2>} w_{<sin(#phi)>}"); | |
2370 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<cos(#phi)>} w_{<sin(#phi)>}"); | |
2371 | // .... | |
2372 | // to be improved - add labels for remaining bins | |
2373 | // .... | |
2374 | fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeightsNUA); | |
b3dacf6b | 2375 | // Final results for reference Q-cumulants: |
2376 | TString cumulantFlag[4] = {"QC{2}","QC{4}","QC{6}","QC{8}"}; | |
489d5531 | 2377 | TString intFlowQcumulantsName = "fIntFlowQcumulants"; |
2378 | intFlowQcumulantsName += fAnalysisLabel->Data(); | |
b92ea2b9 | 2379 | fIntFlowQcumulants = new TH1D(intFlowQcumulantsName.Data(),"Reference Q-cumulants",4,0,4); |
b77b6434 | 2380 | if(fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 2381 | { |
b77b6434 | 2382 | fIntFlowQcumulants->SetTitle("Reference Q-cumulants (error from non-isotropic terms also propagated)"); |
b92ea2b9 | 2383 | } |
489d5531 | 2384 | fIntFlowQcumulants->SetLabelSize(0.05); |
2385 | fIntFlowQcumulants->SetMarkerStyle(25); | |
68a3b4b1 | 2386 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2387 | { |
68a3b4b1 | 2388 | (fIntFlowQcumulants->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data()); |
b3dacf6b | 2389 | } |
489d5531 | 2390 | fIntFlowResults->Add(fIntFlowQcumulants); |
b3dacf6b | 2391 | // Final results for reference Q-cumulants rebinned in M: |
2392 | if(fCalculateCumulantsVsM) | |
2393 | { | |
2394 | TString intFlowQcumulantsRebinnedInMName = "fIntFlowQcumulantsRebinnedInM"; | |
2395 | intFlowQcumulantsRebinnedInMName += fAnalysisLabel->Data(); | |
2396 | fIntFlowQcumulantsRebinnedInM = new TH1D(intFlowQcumulantsRebinnedInMName.Data(),"Reference Q-cumulants rebinned in M",4,0,4); | |
2397 | fIntFlowQcumulantsRebinnedInM->SetLabelSize(0.05); | |
2398 | fIntFlowQcumulantsRebinnedInM->SetMarkerStyle(25); | |
68a3b4b1 | 2399 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2400 | { |
68a3b4b1 | 2401 | (fIntFlowQcumulantsRebinnedInM->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data()); |
b3dacf6b | 2402 | } |
2403 | fIntFlowResults->Add(fIntFlowQcumulantsRebinnedInM); | |
2404 | } // end of if(fCalculateCumulantsVsM) | |
b92ea2b9 | 2405 | // Ratio between error squared: with/without non-isotropic terms: |
2406 | TString intFlowQcumulantsErrorSquaredRatioName = "fIntFlowQcumulantsErrorSquaredRatio"; | |
2407 | intFlowQcumulantsErrorSquaredRatioName += fAnalysisLabel->Data(); | |
2408 | fIntFlowQcumulantsErrorSquaredRatio = new TH1D(intFlowQcumulantsErrorSquaredRatioName.Data(),"Error squared of reference Q-cumulants: #frac{with NUA terms}{without NUA terms}",4,0,4); | |
2409 | fIntFlowQcumulantsErrorSquaredRatio->SetLabelSize(0.05); | |
2410 | fIntFlowQcumulantsErrorSquaredRatio->SetMarkerStyle(25); | |
2411 | for(Int_t b=0;b<4;b++) | |
2412 | { | |
2413 | (fIntFlowQcumulantsErrorSquaredRatio->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data()); | |
2414 | } | |
2415 | fIntFlowResults->Add(fIntFlowQcumulantsErrorSquaredRatio); | |
ff70ca91 | 2416 | // final results for integrated Q-cumulants versus multiplicity: |
b3dacf6b | 2417 | if(fCalculateCumulantsVsM) |
2418 | { | |
2419 | TString intFlowQcumulantsVsMName = "fIntFlowQcumulantsVsM"; | |
2420 | intFlowQcumulantsVsMName += fAnalysisLabel->Data(); | |
2421 | for(Int_t co=0;co<4;co++) // cumulant order | |
2422 | { | |
2423 | fIntFlowQcumulantsVsM[co] = new TH1D(Form("%s, %s",intFlowQcumulantsVsMName.Data(),cumulantFlag[co].Data()), | |
2424 | Form("%s vs multipicity",cumulantFlag[co].Data()), | |
2425 | fnBinsMult,fMinMult,fMaxMult); | |
2426 | fIntFlowQcumulantsVsM[co]->GetXaxis()->SetTitle("M"); | |
2427 | fIntFlowQcumulantsVsM[co]->GetYaxis()->SetTitle(cumulantFlag[co].Data()); | |
2428 | fIntFlowResults->Add(fIntFlowQcumulantsVsM[co]); | |
2429 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
2430 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 2431 | // final integrated flow estimates from Q-cumulants: |
b3dacf6b | 2432 | TString flowFlag[4] = {Form("v_{%d}{2,QC}",fHarmonic),Form("v_{%d}{4,QC}",fHarmonic),Form("v_{%d}{6,QC}",fHarmonic),Form("v_{%d}{8,QC}",fHarmonic)}; |
489d5531 | 2433 | TString intFlowName = "fIntFlow"; |
2434 | intFlowName += fAnalysisLabel->Data(); | |
2435 | // integrated flow from Q-cumulants: | |
b3dacf6b | 2436 | fIntFlow = new TH1D(intFlowName.Data(),"Reference flow estimates from Q-cumulants",4,0,4); |
489d5531 | 2437 | fIntFlow->SetLabelSize(0.05); |
2438 | fIntFlow->SetMarkerStyle(25); | |
68a3b4b1 | 2439 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2440 | { |
68a3b4b1 | 2441 | (fIntFlow->GetXaxis())->SetBinLabel(b+1,flowFlag[b].Data()); |
b3dacf6b | 2442 | } |
ff70ca91 | 2443 | fIntFlowResults->Add(fIntFlow); |
b3dacf6b | 2444 | // Reference flow vs M rebinned in one huge bin: |
2445 | if(fCalculateCumulantsVsM) | |
2446 | { | |
2447 | TString intFlowRebinnedInMName = "fIntFlowRebinnedInM"; | |
2448 | intFlowRebinnedInMName += fAnalysisLabel->Data(); | |
2449 | fIntFlowRebinnedInM = new TH1D(intFlowRebinnedInMName.Data(),"Reference flow estimates from Q-cumulants (rebinned in M)",4,0,4); | |
2450 | fIntFlowRebinnedInM->SetLabelSize(0.05); | |
2451 | fIntFlowRebinnedInM->SetMarkerStyle(25); | |
68a3b4b1 | 2452 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2453 | { |
68a3b4b1 | 2454 | (fIntFlowRebinnedInM->GetXaxis())->SetBinLabel(b+1,flowFlag[b].Data()); |
b3dacf6b | 2455 | } |
2456 | fIntFlowResults->Add(fIntFlowRebinnedInM); | |
2457 | } | |
ff70ca91 | 2458 | // integrated flow from Q-cumulants: versus multiplicity: |
b3dacf6b | 2459 | if(fCalculateCumulantsVsM) |
2460 | { | |
2461 | TString intFlowVsMName = "fIntFlowVsM"; | |
2462 | intFlowVsMName += fAnalysisLabel->Data(); | |
2463 | for(Int_t co=0;co<4;co++) // cumulant order | |
2464 | { | |
2465 | fIntFlowVsM[co] = new TH1D(Form("%s, %s",intFlowVsMName.Data(),flowFlag[co].Data()), | |
2466 | Form("%s vs multipicity",flowFlag[co].Data()), | |
2467 | fnBinsMult,fMinMult,fMaxMult); | |
2468 | fIntFlowVsM[co]->GetXaxis()->SetTitle("M"); | |
2469 | fIntFlowVsM[co]->GetYaxis()->SetTitle(flowFlag[co].Data()); | |
2470 | fIntFlowResults->Add(fIntFlowVsM[co]); | |
2471 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
2472 | } // end of if(fCalculateCumulantsVsM) | |
2001bc3a | 2473 | // quantifying detector effects effects to correlations: |
2474 | TString intFlowDetectorBiasName = "fIntFlowDetectorBias"; | |
2475 | intFlowDetectorBiasName += fAnalysisLabel->Data(); | |
2476 | fIntFlowDetectorBias = new TH1D(intFlowDetectorBiasName.Data(),"Quantifying detector bias",4,0,4); | |
2477 | fIntFlowDetectorBias->SetLabelSize(0.05); | |
2478 | fIntFlowDetectorBias->SetMarkerStyle(25); | |
2479 | for(Int_t ci=0;ci<4;ci++) | |
2480 | { | |
2481 | (fIntFlowDetectorBias->GetXaxis())->SetBinLabel(ci+1,Form("#frac{corrected}{measured} %s",cumulantFlag[ci].Data())); | |
2482 | } | |
2483 | fIntFlowResults->Add(fIntFlowDetectorBias); | |
2484 | // quantifying detector effects to correlations versus multiplicity: | |
b3dacf6b | 2485 | if(fCalculateCumulantsVsM) |
2001bc3a | 2486 | { |
b3dacf6b | 2487 | TString intFlowDetectorBiasVsMName = "fIntFlowDetectorBiasVsM"; |
2488 | intFlowDetectorBiasVsMName += fAnalysisLabel->Data(); | |
2489 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2490 | { | |
2491 | fIntFlowDetectorBiasVsM[ci] = new TH1D(Form("%s for %s",intFlowDetectorBiasVsMName.Data(),cumulantFlag[ci].Data()), | |
2492 | Form("Quantifying detector bias for %s vs multipicity",cumulantFlag[ci].Data()), | |
2493 | fnBinsMult,fMinMult,fMaxMult); | |
2494 | fIntFlowDetectorBiasVsM[ci]->GetXaxis()->SetTitle("M"); | |
2495 | fIntFlowDetectorBiasVsM[ci]->GetYaxis()->SetTitle("#frac{corrected}{measured}"); | |
b77b6434 | 2496 | fIntFlowResults->Add(fIntFlowDetectorBiasVsM[ci]); |
b3dacf6b | 2497 | } // end of for(Int_t co=0;co<4;co++) // cumulant order |
2498 | } // end of if(fCalculateCumulantsVsM) | |
1268c371 | 2499 | |
489d5531 | 2500 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow() |
2501 | ||
489d5531 | 2502 | //================================================================================================================================ |
2503 | ||
489d5531 | 2504 | void AliFlowAnalysisWithQCumulants::InitializeArraysForNestedLoops() |
2505 | { | |
2506 | // Initialize arrays of all objects relevant for calculations with nested loops. | |
2507 | ||
2508 | // integrated flow: | |
2509 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2510 | { | |
2511 | fIntFlowDirectCorrectionTermsForNUA[sc] = NULL; | |
2512 | } | |
2513 | ||
2514 | // differential flow: | |
2515 | // correlations: | |
2516 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
2517 | { | |
2518 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2519 | { | |
2520 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2521 | { | |
2522 | fDiffFlowDirectCorrelations[t][pe][ci] = NULL; | |
2523 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
2524 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2525 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
2526 | // correction terms for non-uniform acceptance: | |
2527 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
2528 | { | |
2529 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2530 | { | |
2531 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2532 | { | |
2533 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
2534 | { | |
2535 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = NULL; | |
2536 | } | |
2537 | } | |
2538 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2539 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
2540 | ||
64e500e3 | 2541 | // other differential correlators: |
2542 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
2543 | { | |
2544 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2545 | { | |
2546 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2547 | { | |
2548 | for(Int_t ci=0;ci<1;ci++) // correlator index | |
2549 | { | |
2550 | fOtherDirectDiffCorrelators[t][pe][sc][ci] = NULL; | |
2551 | } | |
2552 | } | |
2553 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2554 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
489d5531 | 2555 | |
2556 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForNestedLoops() | |
2557 | ||
489d5531 | 2558 | //================================================================================================================================ |
2559 | ||
489d5531 | 2560 | void AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops() |
2561 | { | |
2562 | // Book all objects relevant for calculations with nested loops. | |
2563 | ||
2564 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?) | |
2565 | TString typeFlag[2] = {"RP","POI"}; // to be improved (should I promote this to data members?) | |
2566 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; // to be improved (should I promote this to data members?) | |
2567 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; // to be improved (should I promote this to data members?) | |
2568 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
2569 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
2570 | ||
2571 | TString evaluateNestedLoopsName = "fEvaluateNestedLoops"; | |
2572 | evaluateNestedLoopsName += fAnalysisLabel->Data(); | |
2573 | fEvaluateNestedLoops = new TProfile(evaluateNestedLoopsName.Data(),"Flags for nested loops",4,0,4); | |
2574 | fEvaluateNestedLoops->SetLabelSize(0.03); | |
2575 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(1,"fEvaluateIntFlowNestedLoops"); | |
2576 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(2,"fEvaluateDiffFlowNestedLoops"); | |
2577 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(3,"fCrossCheckInPtBinNo"); | |
2578 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(4,"fCrossCheckInEtaBinNo"); | |
2579 | fEvaluateNestedLoops->Fill(0.5,(Int_t)fEvaluateIntFlowNestedLoops); | |
2580 | fEvaluateNestedLoops->Fill(1.5,(Int_t)fEvaluateDiffFlowNestedLoops); | |
2581 | fEvaluateNestedLoops->Fill(2.5,fCrossCheckInPtBinNo); | |
2582 | fEvaluateNestedLoops->Fill(3.5,fCrossCheckInEtaBinNo); | |
2583 | fNestedLoopsList->Add(fEvaluateNestedLoops); | |
2584 | // nested loops for integrated flow: | |
2585 | if(fEvaluateIntFlowNestedLoops) | |
2586 | { | |
2587 | // correlations: | |
2588 | TString intFlowDirectCorrelationsName = "fIntFlowDirectCorrelations"; | |
2589 | intFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
403e3389 | 2590 | fIntFlowDirectCorrelations = new TProfile(intFlowDirectCorrelationsName.Data(),"Multiparticle correlations calculated with nested loops (for int. flow)",64,0,64,"s"); |
489d5531 | 2591 | fNestedLoopsList->Add(fIntFlowDirectCorrelations); |
403e3389 | 2592 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 2593 | { |
2594 | TString intFlowExtraDirectCorrelationsName = "fIntFlowExtraDirectCorrelations"; | |
2595 | intFlowExtraDirectCorrelationsName += fAnalysisLabel->Data(); | |
2596 | fIntFlowExtraDirectCorrelations = new TProfile(intFlowExtraDirectCorrelationsName.Data(),"Extra multiparticle correlations calculated with nested loops (for int. flow)",100,0,100,"s"); | |
2597 | fNestedLoopsList->Add(fIntFlowExtraDirectCorrelations); | |
403e3389 | 2598 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 2599 | // correction terms for non-uniform acceptance: |
2600 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2601 | { | |
2602 | TString intFlowDirectCorrectionTermsForNUAName = "fIntFlowDirectCorrectionTermsForNUA"; | |
2603 | intFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
2604 | fIntFlowDirectCorrectionTermsForNUA[sc] = new TProfile(Form("%s: %s terms",intFlowDirectCorrectionTermsForNUAName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),10,0,10,"s"); | |
2605 | fNestedLoopsList->Add(fIntFlowDirectCorrectionTermsForNUA[sc]); | |
2606 | } // end of for(Int_t sc=0;sc<2;sc++) | |
2607 | } // end of if(fEvaluateIntFlowNestedLoops) | |
2608 | ||
2609 | // nested loops for differential flow: | |
2610 | if(fEvaluateDiffFlowNestedLoops) | |
2611 | { | |
2612 | // reduced correlations: | |
2613 | TString diffFlowDirectCorrelationsName = "fDiffFlowDirectCorrelations"; | |
2614 | diffFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
2615 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
2616 | { | |
2617 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2618 | { | |
2619 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
2620 | { | |
2621 | // reduced correlations: | |
2622 | fDiffFlowDirectCorrelations[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe],"s"); | |
2623 | fDiffFlowDirectCorrelations[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data()); | |
2624 | fNestedLoopsList->Add(fDiffFlowDirectCorrelations[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations) | |
2625 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
2626 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2627 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
64e500e3 | 2628 | |
2629 | ||
489d5531 | 2630 | // correction terms for non-uniform acceptance: |
2631 | TString diffFlowDirectCorrectionTermsForNUAName = "fDiffFlowDirectCorrectionTermsForNUA"; | |
2632 | diffFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
2633 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
2634 | { | |
2635 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2636 | { | |
2637 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
2638 | { | |
2639 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
2640 | { | |
2641 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = new TProfile(Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe],"s"); | |
2642 | fNestedLoopsList->Add(fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]); | |
2643 | } | |
2644 | } | |
2645 | } | |
64e500e3 | 2646 | } |
2647 | // other differential correlators: | |
2648 | TString otherDirectDiffCorrelatorsName = "fOtherDirectDiffCorrelators"; | |
2649 | otherDirectDiffCorrelatorsName += fAnalysisLabel->Data(); | |
2650 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
2651 | { | |
2652 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2653 | { | |
2654 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
2655 | { | |
2656 | for(Int_t ci=0;ci<1;ci++) // correlator index | |
2657 | { | |
2658 | fOtherDirectDiffCorrelators[t][pe][sc][ci] = new TProfile(Form("%s, %s, %s, %s, ci = %d",otherDirectDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1),Form("%s, %s, %s, %s, ci = %d",otherDirectDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe]); | |
2659 | fNestedLoopsList->Add(fOtherDirectDiffCorrelators[t][pe][sc][ci]); | |
2660 | } | |
2661 | } | |
2662 | } | |
2663 | } | |
3b552efe | 2664 | // number of RPs and POIs in selected pt and eta bins for cross-checkings: |
2665 | TString noOfParticlesInBinName = "fNoOfParticlesInBin"; | |
2666 | fNoOfParticlesInBin = new TH1D(noOfParticlesInBinName.Data(),"Number of RPs and POIs in selected p_{T} and #eta bin",4,0,4); | |
489d5531 | 2667 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(1,"# of RPs in p_{T} bin"); |
2668 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(2,"# of RPs in #eta bin"); | |
2669 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(3,"# of POIs in p_{T} bin"); | |
3b552efe | 2670 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(4,"# of POIs in #eta bin"); |
489d5531 | 2671 | fNestedLoopsList->Add(fNoOfParticlesInBin); |
2672 | } // end of if(fEvaluateDiffFlowNestedLoops) | |
2673 | ||
2674 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops() | |
2675 | ||
489d5531 | 2676 | //================================================================================================================================ |
2677 | ||
489d5531 | 2678 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelations() |
2679 | { | |
b84464d3 | 2680 | // Calculate in this method all multiparticle azimuthal correlations. |
2681 | // | |
2682 | // Remark 1: All multiparticle correlations are stored in TProfile fIntFlowCorrelationsAllPro; | |
2683 | // Remark 2: There is a special TProfile fIntFlowCorrelationsPro holding results | |
2684 | // only for same harmonic's correlations <<2>>, <<4>>, <<6>> and <<8>>; | |
2685 | // Remark 3: Binning of fIntFlowCorrelationsAllPro is organized as follows: | |
2686 | // -------------------------------------------------------------------------------------------------------------------- | |
2687 | // 1st bin: <2>_{1n|1n} = two1n1n = cos(1n(phi1-phi2))> | |
2688 | // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n(phi1-phi2))> | |
2689 | // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n(phi1-phi2))> | |
2690 | // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n(phi1-phi2))> | |
2691 | // 5th bin: ---- EMPTY ---- | |
2692 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n(2*phi1-phi2-phi3))> | |
2693 | // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n(3*phi1-2*phi2-phi3))> | |
2694 | // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n(4*phi1-2*phi2-2*phi3))> | |
2695 | // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n(4*phi1-3*phi2-phi3))> | |
2696 | // 10th bin: ---- EMPTY ---- | |
2697 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n(phi1+phi2-phi3-phi4))> | |
2698 | // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(n(2*phi1+phi2-2*phi3-phi4))> | |
2699 | // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(2n(phi1+phi2-phi3-phi4))> | |
2700 | // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n(3*phi1-phi2-phi3-phi4))> | |
2701 | // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n(3*phi1+phi2-3*phi3-phi4))> | |
2702 | // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n(3*phi1+phi2-2*phi3-2*phi4))> | |
2703 | // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n(4*phi1-2*phi2-phi3-phi4))> | |
2704 | // 18th bin: ---- EMPTY ---- | |
2705 | // 19th bin: <5>_{2n,1n|1n,1n,1n} = five2n1n1n1n1n = <cos(n(2*phi1+phi2-phi3-phi4-phi5))> | |
2706 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n(2*phi1+2*phi2-2*phi3-phi4-phi5))> | |
2707 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n(3*phi1+phi2-2*phi3-phi4-phi5))> | |
2708 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n(4*phi1-phi2-phi3-phi4-phi5))> | |
2709 | // 23rd bin: ---- EMPTY ---- | |
2710 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n(phi1+phi2+phi3-phi4-phi5-phi6))> | |
2711 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n(2*phi1+phi2+phi3-2*phi4-phi5-phi6))> | |
2712 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n(2*phi1+2*phi2-phi3-phi4-phi5-phi6))> | |
2713 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n(3*phi1+phi2-phi3-phi4-phi5-phi6))> | |
2714 | // 28th bin: ---- EMPTY ---- | |
2715 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n(2*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> | |
2716 | // 30th bin: ---- EMPTY ---- | |
2717 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> | |
2718 | // 32nd bin: ---- EMPTY ---- | |
2719 | // Extra correlations for v3{5} study: | |
2720 | // 33rd bin: <4>_{4n,2n|3n,3n} = four4n2n3n3n = <cos(n(4*phi1+2*phi2-3*phi3-3*phi4))> | |
2721 | // 34th bin: <5>_{3n,3n|2n,2n,2n} = five3n3n2n2n2n = <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-2*phi5))> | |
2722 | // Extra correlations for Teaney-Yan study: | |
2723 | // 35th bin: <2>_{5n|5n} = two5n5n = <cos(5n(phi1-phi2)> | |
2724 | // 36th bin: <2>_{6n|6n} = two6n6n = <cos(6n(phi1-phi2)> | |
2725 | // 37th bin: <3>_{5n|3n,2n} = three5n3n2n = <cos(n(5*phi1-3*phi2-2*phi3)> | |
2726 | // 38th bin: <3>_{5n|4n,1n} = three5n4n1n = <cos(n(5*phi1-4*phi2-1*phi3)> | |
2727 | // 39th bin: <3>_{6n|3n,3n} = three6n3n3n = <cos(n(6*phi1-3*phi2-3*phi3)> | |
2728 | // 40th bin: <3>_{6n|4n,2n} = three6n4n2n = <cos(n(6*phi1-4*phi2-2*phi3)> | |
2729 | // 41st bin: <3>_{6n|5n,1n} = three6n5n1n = <cos(n(6*phi1-5*phi2-1*phi3)> | |
2730 | // 42nd bin: <4>_{6n|3n,2n,1n} = four6n3n2n1n = <cos(n(6*phi1-3*phi2-2*phi3-1*phi4)> | |
2731 | // 43rd bin: <4>_{3n,2n|3n,2n} = four3n2n3n2n = <cos(n(3*phi1+2*phi2-3*phi3-2*phi4)> | |
2732 | // 44th bin: <4>_{4n,1n|3n,2n} = four4n1n3n2n = <cos(n(4*phi1+1*phi2-3*phi3-2*phi4)> | |
2733 | // 45th bin: <4>_{3n,3n|3n,3n} = four3n3n3n3n = <cos(3n*(phi1+phi2-phi3-phi4))> | |
2734 | // 46th bin: <4>_{4n,2n|3n,3n} = four4n2n3n3n = <cos(n(4*phi1+2*phi2-3*phi3-3*phi4)> | |
2735 | // 47th bin: <4>_{5n,1n|3n,3n} = four5n1n3n3n = <cos(n(5*phi1+1*phi2-3*phi3-3*phi4)> | |
2736 | // 48th bin: <4>_{4n,2n|4n,2n} = four4n2n4n2n = <cos(n(4*phi1+2*phi2-4*phi3-2*phi4)> | |
2737 | // 49th bin: <4>_{5n,1n|4n,2n} = four5n1n4n2n = <cos(n(5*phi1+1*phi2-4*phi3-2*phi4)> | |
2738 | // 50th bin: <4>_{5n|3n,1n,1n} = four5n3n1n1n = <cos(n(5*phi1-3*phi2-1*phi3-1*phi4)> | |
2739 | // 51st bin: <4>_{5n|2n,2n,1n} = four5n2n2n1n = <cos(n(5*phi1-2*phi2-2*phi3-1*phi4)> | |
2740 | // 52nd bin: <4>_{5n,1n|5n,1n} = four5n1n5n1n = <cos(n(5*phi1+1*phi2-5*phi3-1*phi4)> | |
2741 | // 53rd bin: <5>_{3n,3n|3n,2n,1n} = five3n3n3n2n1n = <cos(n(3*phi1+3*phi2-3*phi3-2*phi4-1*phi5)> | |
2742 | // 54th bin: <5>_{4n,2n|3n,2n,1n} = five4n2n3n2n1n = <cos(n(4*phi1+2*phi2-3*phi3-2*phi4-1*phi5)> | |
2743 | // 55th bin: <5>_{3n,2n|3n,1n,1n} = five3n2n3n1n1n = <cos(n(3*phi1+2*phi2-3*phi3-1*phi4-1*phi5)> | |
2744 | // 56th bin: <5>_{3n,2n|2n,2n,1n} = five3n2n2n2n1n = <cos(n(3*phi1+2*phi2-2*phi3-2*phi4-1*phi5)> | |
2745 | // 57th bin: <5>_{5n,1n|3n,2n,1n} = five5n1n3n2n1n = <cos(n(5*phi1+1*phi2-3*phi3-2*phi4-1*phi5)> | |
2746 | // 58th bin: <6>_{3n,2n,1n|3n,2n,1n} = six3n2n1n3n2n1n = <cos(n(3*phi1+2*phi2+1*phi3-3*phi4-2*phi5-1*phi6)> | |
403e3389 | 2747 | // Extra correlations for Teaney-Yan study (B): |
2748 | // 59th bin: <4>_{6n|4n,1n,1n} = four6n4n1n1n = <cos(n(6*phi1-4*phi2-1*phi3-1*phi4)> | |
2749 | // 60th bin: <4>_{6n|2n,2n,2n} = four6n2n2n2n = <cos(n(6*phi1-2*phi2-2*phi3-2*phi4)> | |
2750 | // 61st bin: <5>_{6n|2n,2n,1n,1n} = five6n2n2n1n1n = <cos(n(6*phi1-2*phi2-2*phi3-1*phi4-1*phi5)> | |
2751 | // 62nd bin: <5>_{4n,1n,1n|3n,3n} = five4n1n1n3n3n = <cos(n(4*phi1+1*phi2+1*phi3-3*phi4-3*phi5)> | |
2752 | // 63rd bin: <6>_{3n,3n|2n,2n,1n,1n} = six3n3n2n2n1n1n = <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-1*phi5-1*phi6)> | |
b84464d3 | 2753 | // -------------------------------------------------------------------------------------------------------------------- |
403e3389 | 2754 | |
2755 | // Multiplicity of an event: | |
1268c371 | 2756 | Double_t dMult = (*fSpk)(0,0); |
b84464d3 | 2757 | // Real parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n, 4n, 5n and 6n: |
489d5531 | 2758 | Double_t dReQ1n = (*fReQ)(0,0); |
2759 | Double_t dReQ2n = (*fReQ)(1,0); | |
2760 | Double_t dReQ3n = (*fReQ)(2,0); | |
2761 | Double_t dReQ4n = (*fReQ)(3,0); | |
b84464d3 | 2762 | Double_t dReQ5n = (*fReQ)(4,0); |
8ed4edc7 | 2763 | Double_t dReQ6n = (*fReQ)(5,0); |
b84464d3 | 2764 | // Imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n, 4n, 5n and 6n: |
489d5531 | 2765 | Double_t dImQ1n = (*fImQ)(0,0); |
2766 | Double_t dImQ2n = (*fImQ)(1,0); | |
2767 | Double_t dImQ3n = (*fImQ)(2,0); | |
2768 | Double_t dImQ4n = (*fImQ)(3,0); | |
b84464d3 | 2769 | Double_t dImQ5n = (*fImQ)(4,0); |
8ed4edc7 | 2770 | Double_t dImQ6n = (*fImQ)(5,0); |
489d5531 | 2771 | |
b84464d3 | 2772 | // Real parts of expressions involving various combinations of Q-vectors which appears |
2773 | // simultaneously in several equations for multiparticle correlations bellow: | |
2774 | // Re[Q_{2n}Q_{n}^*Q_{n}^*] | |
2775 | Double_t reQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n; | |
2776 | // Re[Q_{6n}Q_{3n}^*Q_{3n}^*] | |
2777 | Double_t reQ6nQ3nstarQ3nstar = pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n; | |
2778 | // Re[Q_{4n}Q_{2n}^*Q_{2n}^*] | |
489d5531 | 2779 | Double_t reQ4nQ2nstarQ2nstar = pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n; |
b84464d3 | 2780 | // Re[Q_{4n}Q_{3n}^*Q_{n}^*] |
489d5531 | 2781 | Double_t reQ4nQ3nstarQ1nstar = dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n); |
b84464d3 | 2782 | // Re[Q_{3n}Q_{2n}^*Q_{n}^*] |
489d5531 | 2783 | Double_t reQ3nQ2nstarQ1nstar = dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n |
b84464d3 | 2784 | + dImQ3n*dImQ2n*dReQ1n; |
2785 | // Re[Q_{5n}Q_{3n}^*Q_{2n}^*] | |
2786 | Double_t reQ5nQ3nstarQ2nstar = dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n | |
2787 | + dImQ5n*dImQ2n*dReQ3n; | |
2788 | // Re[Q_{5n}Q_{4n}^*Q_{1n}^*] | |
2789 | Double_t reQ5nQ4nstarQ1nstar = dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n | |
2790 | + dImQ5n*dImQ4n*dReQ1n; | |
2791 | // Re[Q_{6n}Q_{5n}^*Q_{1n}^*] | |
2792 | Double_t reQ6nQ5nstarQ1nstar = dReQ6n*dReQ5n*dReQ1n-dReQ6n*dImQ5n*dImQ1n+dImQ6n*dReQ5n*dImQ1n | |
2793 | + dImQ6n*dImQ5n*dReQ1n; | |
2794 | // Re[Q_{6n}Q_{4n}^*Q_{2n}^*] | |
2795 | Double_t reQ6nQ4nstarQ2nstar = dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n | |
2796 | + dImQ6n*dImQ4n*dReQ2n; | |
2797 | // Re[Q_{3n}Q_{n}Q_{2n}^*Q_{2n}^*] | |
2798 | Double_t reQ3nQ1nQ2nstarQ2nstar = (pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n) | |
2799 | + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n); | |
2800 | // Re[Q_{3n}Q_{n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 2801 | Double_t reQ3nQ1nstarQ1nstarQ1nstar = dReQ3n*pow(dReQ1n,3)-3.*dReQ1n*dReQ3n*pow(dImQ1n,2) |
2802 | + 3.*dImQ1n*dImQ3n*pow(dReQ1n,2)-dImQ3n*pow(dImQ1n,3); | |
403e3389 | 2803 | // Re[Q_{6n}Q_{2n}^*Q_{2n}^*Q_{2n}^*] |
2804 | Double_t reQ6nQ2nstarQ2nstarQ2nstar = dReQ6n*pow(dReQ2n,3)-3.*dReQ2n*dReQ6n*pow(dImQ2n,2) | |
2805 | + 3.*dImQ2n*dImQ6n*pow(dReQ2n,2)-dImQ6n*pow(dImQ2n,3); | |
b84464d3 | 2806 | // Re[Q_{4n}Q_{2n}^*Q_{n}^*Q_{n}^*] |
2807 | Double_t reQ4nQ2nstarQ1nstarQ1nstar = (dReQ4n*dReQ2n+dImQ4n*dImQ2n)*(pow(dReQ1n,2)-pow(dImQ1n,2)) | |
2808 | + 2.*dReQ1n*dImQ1n*(dImQ4n*dReQ2n-dReQ4n*dImQ2n); | |
2809 | // Re[Q_{4n}Q_{2n}^*Q_{3n}^*Q_{3n}^*] | |
2810 | Double_t reQ4nQ2nQ3nstarQ3nstar = (dReQ4n*dReQ2n-dImQ4n*dImQ2n)*(dReQ3n*dReQ3n-dImQ3n*dImQ3n) | |
2811 | + 2.*(dReQ4n*dImQ2n+dImQ4n*dReQ2n)*dReQ3n*dImQ3n; | |
2812 | // Re[Q_{4n}Q_{n}Q_{3n}^*Q_{2n}^*] | |
2813 | Double_t reQ4nQ1nQ3nstarQ2nstar = dImQ1n*dImQ2n*dImQ3n*dImQ4n+dImQ3n*dImQ4n*dReQ1n*dReQ2n | |
2814 | + dImQ2n*dImQ4n*dReQ1n*dReQ3n-dImQ1n*dImQ4n*dReQ2n*dReQ3n | |
2815 | - dImQ2n*dImQ3n*dReQ1n*dReQ4n+dImQ1n*dImQ3n*dReQ2n*dReQ4n | |
2816 | + dImQ1n*dImQ2n*dReQ3n*dReQ4n+dReQ1n*dReQ2n*dReQ3n*dReQ4n; | |
2817 | // Re[Q_{5n}Q_{n}Q_{4n}^*Q_{2n}^*] | |
2818 | Double_t reQ5nQ1nQ4nstarQ2nstar = dImQ1n*dImQ2n*dImQ4n*dImQ5n+dImQ4n*dImQ5n*dReQ1n*dReQ2n | |
2819 | + dImQ2n*dImQ5n*dReQ1n*dReQ4n-dImQ1n*dImQ5n*dReQ2n*dReQ4n | |
2820 | - dImQ2n*dImQ4n*dReQ1n*dReQ5n+dImQ1n*dImQ4n*dReQ2n*dReQ5n | |
2821 | + dImQ1n*dImQ2n*dReQ4n*dReQ5n+dReQ1n*dReQ2n*dReQ4n*dReQ5n; | |
2822 | // Re[Q_{5n}Q_{n}Q_{3n}^*Q_{3n}^*] | |
2823 | Double_t reQ5nQ1nQ3nstarQ3nstar = dImQ1n*pow(dImQ3n,2.)*dImQ5n+2.*dImQ3n*dImQ5n*dReQ1n*dReQ3n | |
2824 | - dImQ1n*dImQ5n*pow(dReQ3n,2.)-pow(dImQ3n,2.)*dReQ1n*dReQ5n | |
2825 | + 2.*dImQ1n*dImQ3n*dReQ3n*dReQ5n+dReQ1n*pow(dReQ3n,2.)*dReQ5n; | |
2826 | // Re[Q_{5n}Q_{3n}^*Q_{n}^*Q_{n}^*] | |
2827 | Double_t reQ5nQ3nstarQ1nstarQ1nstar = -pow(dImQ1n,2.)*dImQ3n*dImQ5n+dImQ3n*dImQ5n*pow(dReQ1n,2.) | |
2828 | + 2.*dImQ1n*dImQ5n*dReQ1n*dReQ3n-2.*dImQ1n*dImQ3n*dReQ1n*dReQ5n | |
2829 | - pow(dImQ1n,2.)*dReQ3n*dReQ5n+pow(dReQ1n,2.)*dReQ3n*dReQ5n; | |
2830 | // Re[Q_{5n}Q_{2n}^*Q_{2n}^*Q_{n}^*] | |
2831 | Double_t reQ5nQ2nstarQ2nstarQ1nstar = -pow(dImQ2n,2.)*dImQ1n*dImQ5n+dImQ1n*dImQ5n*pow(dReQ2n,2.) | |
2832 | + 2.*dImQ2n*dImQ5n*dReQ2n*dReQ1n-2.*dImQ2n*dImQ1n*dReQ2n*dReQ5n | |
403e3389 | 2833 | - pow(dImQ2n,2.)*dReQ1n*dReQ5n+pow(dReQ2n,2.)*dReQ1n*dReQ5n; |
2834 | // Re[Q_{6n}Q_{4n}^*Q_{n}^*Q_{n}^*] | |
2835 | Double_t reQ6nQ4nstarQ1nstarQ1nstar = -pow(dImQ1n,2.)*dImQ4n*dImQ6n+dImQ4n*dImQ6n*pow(dReQ1n,2.) | |
2836 | + 2.*dImQ1n*dImQ6n*dReQ1n*dReQ4n-2.*dImQ1n*dImQ4n*dReQ1n*dReQ6n | |
2837 | - pow(dImQ1n,2.)*dReQ4n*dReQ6n+pow(dReQ1n,2.)*dReQ4n*dReQ6n; | |
489d5531 | 2838 | // |Q_{2n}|^2 |Q_{n}|^2 |
2839 | Double_t dQ2nQ1nQ2nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
b84464d3 | 2840 | // |Q_{4n}|^2 |Q_{2n}|^2 |
2841 | Double_t dQ4nQ2nQ4nstarQ2nstar = (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)); | |
2842 | // |Q_{3n}|^2 |Q_{2n}|^2 | |
2843 | Double_t dQ3nQ2nQ3nstarQ2nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)); | |
2844 | // |Q_{5n}|^2 |Q_{n}|^2 | |
2845 | Double_t dQ5nQ1nQ5nstarQ1nstar = (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
2846 | // Re[Q_{2n}Q_{n}Q_{n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 2847 | Double_t reQ2nQ1nQ1nstarQ1nstarQ1nstar = (dReQ2n*dReQ1n-dImQ2n*dImQ1n)*(pow(dReQ1n,3)-3.*dReQ1n*pow(dImQ1n,2)) |
b84464d3 | 2848 | + (dReQ2n*dImQ1n+dReQ1n*dImQ2n)*(3.*dImQ1n*pow(dReQ1n,2)-pow(dImQ1n,3)); |
2849 | // Re[Q_{2n}Q_{2n}Q_{2n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 2850 | Double_t reQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.)) |
2851 | * (dReQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) + 2.*dImQ2n*dReQ1n*dImQ1n); | |
b84464d3 | 2852 | // Re[Q_{4n}Q_{n}^*Q_{n}^*Q_{n}^*Q_{n}^*] |
489d5531 | 2853 | Double_t reQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dReQ4n-6.*pow(dReQ1n,2.)*dReQ4n*pow(dImQ1n,2.) |
2854 | + pow(dImQ1n,4.)*dReQ4n+4.*pow(dReQ1n,3.)*dImQ1n*dImQ4n | |
2855 | - 4.*pow(dImQ1n,3.)*dReQ1n*dImQ4n; | |
b84464d3 | 2856 | // Re[Q_{3n}Q_{n}Q_{2n}^*Q_{n}^*Q_{n}^*] |
489d5531 | 2857 | Double_t reQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
b84464d3 | 2858 | * (dReQ1n*dReQ2n*dReQ3n-dReQ3n*dImQ1n*dImQ2n |
2859 | + dReQ2n*dImQ1n*dImQ3n+dReQ1n*dImQ2n*dImQ3n); | |
2860 | // Re[Q_{6n}Q_{n}Q_{3n}^*Q_{2n}^*Q_{n}^*] | |
2861 | Double_t reQ6nQ3nstarQ2nstarQ1nstar = dReQ1n*dReQ2n*dReQ3n*dReQ6n-dReQ3n*dReQ6n*dImQ1n*dImQ2n | |
2862 | - dReQ2n*dReQ6n*dImQ1n*dImQ3n-dReQ1n*dReQ6n*dImQ2n*dImQ3n | |
2863 | + dReQ2n*dReQ3n*dImQ1n*dImQ6n+dReQ1n*dReQ3n*dImQ2n*dImQ6n | |
2864 | + dReQ1n*dReQ2n*dImQ3n*dImQ6n-dImQ1n*dImQ2n*dImQ3n*dImQ6n; | |
2865 | // Re[Q_{3n}Q_{3n}Q_{3n}^*Q_{2n}^*Q_{n}^*] | |
2866 | Double_t reQ3nQ3nQ3nstarQ2nstarQ1nstar = (pow(dImQ3n,2.)+pow(dReQ3n,2.)) | |
2867 | * (dImQ2n*dImQ3n*dReQ1n+dImQ1n*dImQ3n*dReQ2n | |
2868 | - dImQ1n*dImQ2n*dReQ3n+dReQ1n*dReQ2n*dReQ3n); | |
2869 | // Re[Q_{3n}Q_{3n}Q_{2n}^*Q_{2n}^*Q_{2n}^*] | |
2870 | Double_t reQ3nQ3nQ2nstarQ2nstarQ2nstar = pow(dReQ2n,3.)*pow(dReQ3n,2.) | |
2871 | - 3.*dReQ2n*pow(dReQ3n,2.)*pow(dImQ2n,2.) | |
2872 | + 6.*pow(dReQ2n,2.)*dReQ3n*dImQ2n*dImQ3n | |
2873 | - 2.*dReQ3n*pow(dImQ2n,3.)*dImQ3n-pow(dReQ2n,3.)*pow(dImQ3n,2.) | |
2874 | + 3.*dReQ2n*pow(dImQ2n,2.)*pow(dImQ3n,2.); | |
2875 | // Re[Q_{4n}Q_{2n}Q_{3n}^*Q_{2n}^*Q_{n}^*] | |
2876 | Double_t reQ4nQ2nQ3nstarQ2nstarQ1nstar = (pow(dImQ2n,2.)+pow(dReQ2n,2.)) | |
2877 | * (dImQ3n*dImQ4n*dReQ1n+dImQ1n*dImQ4n*dReQ3n | |
2878 | - dImQ1n*dImQ3n*dReQ4n+dReQ1n*dReQ3n*dReQ4n); | |
2879 | // Re[Q_{3n}Q_{2n}Q_{3n}^*Q_{n}^*Q_{n}^*] | |
2880 | Double_t reQ3nQ2nQ3nstarQ1nstarQ1nstar = -(pow(dImQ3n,2.)+pow(dReQ3n,2.)) | |
2881 | * (-2.*dImQ1n*dImQ2n*dReQ1n+pow(dImQ1n,2.)*dReQ2n-pow(dReQ1n,2.)*dReQ2n); | |
2882 | // Re[Q_{3n}Q_{2n}Q_{2n}^*Q_{2n}^*Q_{n}^*] | |
2883 | Double_t reQ3nQ2nQ2nstarQ2nstarQ1nstar = (pow(dImQ2n,2.)+pow(dReQ2n,2.)) | |
2884 | * (dImQ2n*dImQ3n*dReQ1n+dImQ1n*dImQ3n*dReQ2n | |
2885 | - dImQ1n*dImQ2n*dReQ3n+dReQ1n*dReQ2n*dReQ3n); | |
2886 | // Re[Q_{5n}Q_{n}Q_{3n}^*Q_{2n}^*Q_{n}^*] | |
2887 | Double_t reQ5nQ1nQ3nstarQ2nstarQ1nstar = (pow(dImQ1n,2.)+pow(dReQ1n,2.)) | |
2888 | * (dImQ3n*dImQ5n*dReQ2n+dImQ2n*dImQ5n*dReQ3n | |
2889 | - dImQ2n*dImQ3n*dReQ5n+dReQ2n*dReQ3n*dReQ5n); | |
2890 | // Re[Q_{2n}Q_{2n}Q_{n}^*Q_{n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 2891 | Double_t reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)*dReQ2n-2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.) |
2892 | + dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dImQ2n) | |
2893 | * (pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.) | |
b84464d3 | 2894 | - dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n+pow(dImQ1n,2.)*dImQ2n); |
2895 | // Re[Q_{3n}Q_{n}Q_{n}^*Q_{n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 2896 | Double_t reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
2897 | * (pow(dReQ1n,3.)*dReQ3n-3.*dReQ1n*dReQ3n*pow(dImQ1n,2.) | |
2898 | + 3.*pow(dReQ1n,2.)*dImQ1n*dImQ3n-pow(dImQ1n,3.)*dImQ3n); | |
489d5531 | 2899 | // |Q_{2n}|^2 |Q_{n}|^4 |
b84464d3 | 2900 | Double_t dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.); |
2901 | // |Q_{3n}|^2 |Q_{2n}|^2 |Q_{n}|^2 | |
2902 | Double_t dQ3nQ2nQ1nQ3nstarQ2nstarQ1nstar = (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2903 | * (pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
2904 | // Re[Q_{2n}Q_{n}Q_{n}Q_{n}^*Q_{n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 2905 | Double_t reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) |
2906 | * (pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.) | |
2907 | + 2.*dReQ1n*dImQ1n*dImQ2n); | |
489d5531 | 2908 | |
b84464d3 | 2909 | // Results for multiparticle azimuthal correlations: |
489d5531 | 2910 | // 2-particle: |
b84464d3 | 2911 | Double_t two1n1n = 0.; // <cos(n(phi1-phi2))> |
2912 | Double_t two2n2n = 0.; // <cos(2n(phi1-phi2))> | |
2913 | Double_t two3n3n = 0.; // <cos(3n(phi1-phi2))> | |
2914 | Double_t two4n4n = 0.; // <cos(4n(phi1-phi2))> | |
489d5531 | 2915 | if(dMult>1) |
2916 | { | |
2917 | two1n1n = (pow(dReQ1n,2.)+pow(dImQ1n,2.)-dMult)/(dMult*(dMult-1.)); | |
2918 | two2n2n = (pow(dReQ2n,2.)+pow(dImQ2n,2.)-dMult)/(dMult*(dMult-1.)); | |
2919 | two3n3n = (pow(dReQ3n,2.)+pow(dImQ3n,2.)-dMult)/(dMult*(dMult-1.)); | |
2920 | two4n4n = (pow(dReQ4n,2.)+pow(dImQ4n,2.)-dMult)/(dMult*(dMult-1.)); | |
b84464d3 | 2921 | // Average 2-particle correlations for single event: |
489d5531 | 2922 | fIntFlowCorrelationsAllEBE->SetBinContent(1,two1n1n); |
2923 | fIntFlowCorrelationsAllEBE->SetBinContent(2,two2n2n); | |
2924 | fIntFlowCorrelationsAllEBE->SetBinContent(3,two3n3n); | |
b84464d3 | 2925 | fIntFlowCorrelationsAllEBE->SetBinContent(4,two4n4n); |
2926 | // Average 2-particle correlations for all events: | |
2927 | fIntFlowCorrelationsAllPro->Fill(0.5,two1n1n,dMult*(dMult-1.)); | |
2928 | fIntFlowCorrelationsAllPro->Fill(1.5,two2n2n,dMult*(dMult-1.)); | |
2929 | fIntFlowCorrelationsAllPro->Fill(2.5,two3n3n,dMult*(dMult-1.)); | |
2930 | fIntFlowCorrelationsAllPro->Fill(3.5,two4n4n,dMult*(dMult-1.)); | |
2931 | // Store separetately <2>: | |
2932 | fIntFlowCorrelationsEBE->SetBinContent(1,two1n1n); // <2> | |
2933 | // Testing other multiplicity weights: | |
489d5531 | 2934 | Double_t mWeight2p = 0.; |
2935 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
2936 | { | |
2937 | mWeight2p = dMult*(dMult-1.); | |
2938 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
2939 | { | |
2940 | mWeight2p = 1.; | |
2941 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
2942 | { | |
2943 | mWeight2p = dMult; | |
b84464d3 | 2944 | } |
489d5531 | 2945 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(1,mWeight2p); // eW_<2> |
2946 | fIntFlowCorrelationsPro->Fill(0.5,two1n1n,mWeight2p); | |
b40a910e | 2947 | fIntFlowSquaredCorrelationsPro->Fill(0.5,two1n1n*two1n1n,mWeight2p); |
2948 | if(fCalculateCumulantsVsM) | |
2949 | { | |
2950 | fIntFlowCorrelationsVsMPro[0]->Fill(dMult+0.5,two1n1n,mWeight2p); | |
2951 | fIntFlowSquaredCorrelationsVsMPro[0]->Fill(dMult+0.5,two1n1n*two1n1n,mWeight2p); | |
2952 | } | |
3435cacb | 2953 | if(fCalculateAllCorrelationsVsM) |
2954 | { | |
2955 | fIntFlowCorrelationsAllVsMPro[0]->Fill(dMult+0.5,two1n1n,mWeight2p); | |
2956 | fIntFlowCorrelationsAllVsMPro[1]->Fill(dMult+0.5,two2n2n,mWeight2p); | |
2957 | fIntFlowCorrelationsAllVsMPro[2]->Fill(dMult+0.5,two3n3n,mWeight2p); | |
2958 | fIntFlowCorrelationsAllVsMPro[3]->Fill(dMult+0.5,two4n4n,mWeight2p); | |
2959 | } | |
489d5531 | 2960 | } // end of if(dMult>1) |
2961 | ||
2962 | // 3-particle: | |
b84464d3 | 2963 | Double_t three2n1n1n = 0.; // <cos(n(2*phi1-phi2-phi3))> |
2964 | Double_t three3n2n1n = 0.; // <cos(n(3*phi1-2*phi2-phi3))> | |
2965 | Double_t three4n2n2n = 0.; // <cos(n(4*phi1-2*phi2-2*phi3))> | |
2966 | Double_t three4n3n1n = 0.; // <cos(n(4*phi1-3*phi2-phi3))> | |
489d5531 | 2967 | if(dMult>2) |
2968 | { | |
2969 | three2n1n1n = (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
2970 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult) | |
2971 | / (dMult*(dMult-1.)*(dMult-2.)); | |
2972 | three3n2n1n = (reQ3nQ2nstarQ1nstar-(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2973 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2974 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
2975 | / (dMult*(dMult-1.)*(dMult-2.)); | |
2976 | three4n2n2n = (reQ4nQ2nstarQ2nstar-2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2977 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*dMult) | |
2978 | / (dMult*(dMult-1.)*(dMult-2.)); | |
2979 | three4n3n1n = (reQ4nQ3nstarQ1nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
2980 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
2981 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
b84464d3 | 2982 | / (dMult*(dMult-1.)*(dMult-2.)); |
2983 | // Average 3-particle correlations for single event: | |
489d5531 | 2984 | fIntFlowCorrelationsAllEBE->SetBinContent(6,three2n1n1n); |
2985 | fIntFlowCorrelationsAllEBE->SetBinContent(7,three3n2n1n); | |
2986 | fIntFlowCorrelationsAllEBE->SetBinContent(8,three4n2n2n); | |
2987 | fIntFlowCorrelationsAllEBE->SetBinContent(9,three4n3n1n); | |
b84464d3 | 2988 | // Average 3-particle correlations for all events: |
489d5531 | 2989 | fIntFlowCorrelationsAllPro->Fill(5.5,three2n1n1n,dMult*(dMult-1.)*(dMult-2.)); |
2990 | fIntFlowCorrelationsAllPro->Fill(6.5,three3n2n1n,dMult*(dMult-1.)*(dMult-2.)); | |
2991 | fIntFlowCorrelationsAllPro->Fill(7.5,three4n2n2n,dMult*(dMult-1.)*(dMult-2.)); | |
3435cacb | 2992 | fIntFlowCorrelationsAllPro->Fill(8.5,three4n3n1n,dMult*(dMult-1.)*(dMult-2.)); |
b84464d3 | 2993 | // Average 3-particle correlations vs M for all events: |
3435cacb | 2994 | if(fCalculateAllCorrelationsVsM) |
2995 | { | |
2996 | fIntFlowCorrelationsAllVsMPro[5]->Fill(dMult+0.5,three2n1n1n,dMult*(dMult-1.)*(dMult-2.)); | |
2997 | fIntFlowCorrelationsAllVsMPro[6]->Fill(dMult+0.5,three3n2n1n,dMult*(dMult-1.)*(dMult-2.)); | |
2998 | fIntFlowCorrelationsAllVsMPro[7]->Fill(dMult+0.5,three4n2n2n,dMult*(dMult-1.)*(dMult-2.)); | |
2999 | fIntFlowCorrelationsAllVsMPro[8]->Fill(dMult+0.5,three4n3n1n,dMult*(dMult-1.)*(dMult-2.)); | |
3000 | } | |
489d5531 | 3001 | } // end of if(dMult>2) |
3002 | ||
3003 | // 4-particle: | |
b84464d3 | 3004 | Double_t four1n1n1n1n = 0.; // <cos(n(phi1+phi2-phi3-phi4))> |
3005 | Double_t four2n2n2n2n = 0.; // <cos(2n(phi1+phi2-phi3-phi4))> | |
3006 | Double_t four2n1n2n1n = 0.; // <cos(n(2*phi1+phi2-2*phi3-phi4))> | |
3007 | Double_t four3n1n1n1n = 0.; // <cos(n(3*phi1-phi2-phi3-phi4))> | |
3008 | Double_t four4n2n1n1n = 0.; // <cos(n(4*phi1-2*phi2-phi3-phi4))> | |
3009 | Double_t four3n1n2n2n = 0.; // <cos(n(3*phi1+phi2-2*phi3-2*phi4))> | |
3010 | Double_t four3n1n3n1n = 0.; // <cos(n(3*phi1+phi2-3*phi3-phi4))> | |
489d5531 | 3011 | if(dMult>3) |
3012 | { | |
3013 | four1n1n1n1n = (2.*dMult*(dMult-3.)+pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ1n,2.) | |
3014 | + pow(dImQ1n,2.))-2.*reQ2nQ1nstarQ1nstar+(pow(dReQ2n,2.)+pow(dImQ2n,2.))) | |
3015 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
3016 | four2n2n2n2n = (2.*dMult*(dMult-3.)+pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ2n,2.) | |
3017 | + pow(dImQ2n,2.))-2.*reQ4nQ2nstarQ2nstar+(pow(dReQ4n,2.)+pow(dImQ4n,2.))) | |
3018 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
3019 | four2n1n2n1n = (dQ2nQ1nQ2nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar-2.*reQ2nQ1nstarQ1nstar) | |
3020 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3021 | - ((dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3022 | + (dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-(pow(dReQ3n,2.)+pow(dImQ3n,2.))) | |
3023 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3024 | + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3025 | four3n1n1n1n = (reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar-3.*reQ2nQ1nstarQ1nstar |
3026 | + 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
489d5531 | 3027 | + 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) |
3028 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3029 | four4n2n1n1n = (reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar-2.*reQ3nQ2nstarQ1nstar) | |
3030 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3031 | - (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3032 | - 3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
3033 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3034 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3035 | four3n1n2n2n = (reQ3nQ1nQ2nstarQ2nstar-reQ4nQ2nstarQ2nstar-reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar) |
489d5531 | 3036 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
b84464d3 | 3037 | - (2.*reQ2nQ1nstarQ1nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) |
489d5531 | 3038 | - 4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) |
3039 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3040 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3041 | four3n1n3n1n = ((pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
b84464d3 | 3042 | - 2.*reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar |
3043 | + pow(dReQ4n,2.)+pow(dImQ4n,2.)-(dMult-4.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3044 | + pow(dReQ2n,2.)+pow(dImQ2n,2.)-(dMult-4.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3045 | + dMult*(dMult-6.)) | |
3046 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3047 | // Average 4-particle correlations for single event: | |
489d5531 | 3048 | fIntFlowCorrelationsAllEBE->SetBinContent(11,four1n1n1n1n); |
3049 | fIntFlowCorrelationsAllEBE->SetBinContent(12,four2n1n2n1n); | |
3050 | fIntFlowCorrelationsAllEBE->SetBinContent(13,four2n2n2n2n); | |
3051 | fIntFlowCorrelationsAllEBE->SetBinContent(14,four3n1n1n1n); | |
3052 | fIntFlowCorrelationsAllEBE->SetBinContent(15,four3n1n3n1n); | |
3053 | fIntFlowCorrelationsAllEBE->SetBinContent(16,four3n1n2n2n); | |
b84464d3 | 3054 | fIntFlowCorrelationsAllEBE->SetBinContent(17,four4n2n1n1n); |
3055 | // Average 4-particle correlations for all events: | |
489d5531 | 3056 | fIntFlowCorrelationsAllPro->Fill(10.5,four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
3057 | fIntFlowCorrelationsAllPro->Fill(11.5,four2n1n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3058 | fIntFlowCorrelationsAllPro->Fill(12.5,four2n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3059 | fIntFlowCorrelationsAllPro->Fill(13.5,four3n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3060 | fIntFlowCorrelationsAllPro->Fill(14.5,four3n1n3n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3061 | fIntFlowCorrelationsAllPro->Fill(15.5,four3n1n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3062 | fIntFlowCorrelationsAllPro->Fill(16.5,four4n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
3063 | // Average 4-particle correlations vs M for all events: | |
3435cacb | 3064 | if(fCalculateAllCorrelationsVsM) |
3065 | { | |
3066 | fIntFlowCorrelationsAllVsMPro[10]->Fill(dMult+0.5,four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3067 | fIntFlowCorrelationsAllVsMPro[11]->Fill(dMult+0.5,four2n1n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3068 | fIntFlowCorrelationsAllVsMPro[12]->Fill(dMult+0.5,four2n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3069 | fIntFlowCorrelationsAllVsMPro[13]->Fill(dMult+0.5,four3n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3070 | fIntFlowCorrelationsAllVsMPro[14]->Fill(dMult+0.5,four3n1n3n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3071 | fIntFlowCorrelationsAllVsMPro[15]->Fill(dMult+0.5,four3n1n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3072 | fIntFlowCorrelationsAllVsMPro[16]->Fill(dMult+0.5,four4n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3073 | } |
3074 | // Store separetately <4>: | |
489d5531 | 3075 | fIntFlowCorrelationsEBE->SetBinContent(2,four1n1n1n1n); // <4> |
b84464d3 | 3076 | // Testing other multiplicity weights: |
489d5531 | 3077 | Double_t mWeight4p = 0.; |
3078 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
3079 | { | |
3080 | mWeight4p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
3081 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
3082 | { | |
3083 | mWeight4p = 1.; | |
3084 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
3085 | { | |
3086 | mWeight4p = dMult; | |
b84464d3 | 3087 | } |
489d5531 | 3088 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(2,mWeight4p); // eW_<4> |
3089 | fIntFlowCorrelationsPro->Fill(1.5,four1n1n1n1n,mWeight4p); | |
b40a910e | 3090 | fIntFlowSquaredCorrelationsPro->Fill(1.5,four1n1n1n1n*four1n1n1n1n,mWeight4p); |
3091 | if(fCalculateCumulantsVsM) | |
3092 | { | |
3093 | fIntFlowCorrelationsVsMPro[1]->Fill(dMult+0.5,four1n1n1n1n,mWeight4p); | |
3094 | fIntFlowSquaredCorrelationsVsMPro[1]->Fill(dMult+0.5,four1n1n1n1n*four1n1n1n1n,mWeight4p); | |
3095 | } | |
489d5531 | 3096 | } // end of if(dMult>3) |
3097 | ||
3098 | // 5-particle: | |
b84464d3 | 3099 | Double_t five2n1n1n1n1n = 0.; // <cos(n(2*phi1+phi2-phi3-phi4-phi5))> |
3100 | Double_t five2n2n2n1n1n = 0.; // <cos(n(2*phi1+2*phi2-2*phi3-phi4-phi5))> | |
3101 | Double_t five3n1n2n1n1n = 0.; // <cos(n(3*phi1+phi2-2*phi3-phi4-phi5))> | |
3102 | Double_t five4n1n1n1n1n = 0.; // <cos(n(4*phi1-phi2-phi3-phi4-phi5))> | |
489d5531 | 3103 | if(dMult>4) |
b84464d3 | 3104 | { |
3105 | five2n1n1n1n1n = (reQ2nQ1nQ1nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar+5.*reQ3nQ2nstarQ1nstar | |
3106 | - 3.*(dMult-5.)*reQ2nQ1nstarQ1nstar-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3107 | - 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3108 | + 3.*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3109 | - 3.*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
3110 | + 6.*(2.*dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult*(dMult-4.)) | |
489d5531 | 3111 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
b84464d3 | 3112 | five2n2n2n1n1n = (reQ2nQ2nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ3nQ1nQ2nstarQ2nstar |
3113 | + 3.*reQ4nQ2nstarQ2nstar+8.*reQ3nQ2nstarQ1nstar+2.*reQ4nQ3nstarQ1nstar | |
3114 | - 2.*(dMult-6.)*reQ2nQ1nstarQ1nstar | |
3115 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3116 | - pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.) | |
3117 | + 2.*(3.*dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3118 | - 4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3119 | + 4.*(dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*dMult*(dMult-6.)) | |
489d5531 | 3120 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
b84464d3 | 3121 | five4n1n1n1n1n = (reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ4nQ2nstarQ1nstarQ1nstar-4.*reQ3nQ1nstarQ1nstarQ1nstar |
3122 | + 8.*reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar+12.*reQ3nQ2nstarQ1nstar+12.*reQ2nQ1nstarQ1nstar | |
3123 | - 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-8.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3124 | - 12.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-24.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+24.*dMult) | |
3125 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3126 | five3n1n2n1n1n = (reQ3nQ1nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar | |
3127 | - reQ3nQ1nQ2nstarQ2nstar+4.*reQ4nQ3nstarQ1nstar+reQ4nQ2nstarQ2nstar | |
3128 | - (2.*dMult-13.)*reQ3nQ2nstarQ1nstar+7.*reQ2nQ1nstarQ1nstar | |
3129 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3130 | + 2.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3131 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3132 | + 2.*(dMult-6.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
489d5531 | 3133 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
3134 | - pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
b84464d3 | 3135 | + 2.*(3.*dMult-11.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*dMult*(dMult-6.)) |
3136 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3137 | // Average 5-particle correlations for single event: | |
489d5531 | 3138 | fIntFlowCorrelationsAllEBE->SetBinContent(19,five2n1n1n1n1n); |
3139 | fIntFlowCorrelationsAllEBE->SetBinContent(20,five2n2n2n1n1n); | |
3140 | fIntFlowCorrelationsAllEBE->SetBinContent(21,five3n1n2n1n1n); | |
b84464d3 | 3141 | fIntFlowCorrelationsAllEBE->SetBinContent(22,five4n1n1n1n1n); |
3142 | // Average 5-particle correlations for all events: | |
489d5531 | 3143 | fIntFlowCorrelationsAllPro->Fill(18.5,five2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
3144 | fIntFlowCorrelationsAllPro->Fill(19.5,five2n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3145 | fIntFlowCorrelationsAllPro->Fill(20.5,five3n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
b84464d3 | 3146 | fIntFlowCorrelationsAllPro->Fill(21.5,five4n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
3147 | // Average 5-particle correlations vs M for all events: | |
3435cacb | 3148 | if(fCalculateAllCorrelationsVsM) |
3149 | { | |
3150 | fIntFlowCorrelationsAllVsMPro[18]->Fill(dMult+0.5,five2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3151 | fIntFlowCorrelationsAllVsMPro[19]->Fill(dMult+0.5,five2n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3152 | fIntFlowCorrelationsAllVsMPro[20]->Fill(dMult+0.5,five3n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3153 | fIntFlowCorrelationsAllVsMPro[21]->Fill(dMult+0.5,five4n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3154 | } | |
489d5531 | 3155 | } // end of if(dMult>4) |
3156 | ||
3157 | // 6-particle: | |
b84464d3 | 3158 | Double_t six1n1n1n1n1n1n = 0.; // <cos(n(phi1+phi2+phi3-phi4-phi5-phi6))> |
3159 | Double_t six2n2n1n1n1n1n = 0.; // <cos(n(2*phi1+2*phi2-phi3-phi4-phi5-phi6))> | |
3160 | Double_t six3n1n1n1n1n1n = 0.; // <cos(n(3*phi1+phi2-phi3-phi4-phi5-phi6))> | |
3161 | Double_t six2n1n1n2n1n1n = 0.; // <cos(n(2*phi1+phi2+phi3-2*phi4-phi5-phi6))> | |
489d5531 | 3162 | if(dMult>5) |
3163 | { | |
b84464d3 | 3164 | six1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),3.)-6.*reQ2nQ1nQ1nstarQ1nstarQ1nstar |
3165 | + 4.*reQ3nQ1nstarQ1nstarQ1nstar-12.*reQ3nQ2nstarQ1nstar+18.*(dMult-4.)*reQ2nQ1nstarQ1nstar | |
3166 | + 9.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3167 | + 4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))-9.*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3168 | - 9.*(dMult-4.)*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
3169 | + 18.*(dMult*dMult-7.*dMult+10.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3170 | - 6.*dMult*(dMult*dMult-9.*dMult+20.)) | |
3171 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3172 | six2n1n1n2n1n1n = (dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar-4.*reQ3nQ1nQ2nstarQ1nstarQ1nstar | |
3173 | - 4.*reQ2nQ1nQ1nstarQ1nstarQ1nstar-2.*reQ2nQ2nQ2nstarQ1nstarQ1nstar | |
3174 | + 4.*reQ4nQ2nstarQ1nstarQ1nstar+4.*reQ3nQ1nQ2nstarQ2nstar+4.*reQ3nQ1nstarQ1nstarQ1nstar | |
3175 | - 8.*reQ4nQ3nstarQ1nstar-4.*reQ4nQ2nstarQ2nstar+4.*(2.*dMult-13.)*reQ3nQ2nstarQ1nstar | |
3176 | + 2.*(7.*dMult-34.)*reQ2nQ1nstarQ1nstar+4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3177 | - 4.*(dMult-7.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3178 | + 4.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-4.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3179 | + pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)+(2.*dMult*dMult-27.*dMult+76.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3180 | - (dMult-12.)*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
3181 | + 4.*(dMult*dMult-15.*dMult+34.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3182 | - 2.*dMult*(dMult*dMult-17.*dMult+60.)) | |
3183 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3184 | six2n2n1n1n1n1n = (reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ2nQ2nQ2nstarQ1nstarQ1nstar-reQ4nQ1nstarQ1nstarQ1nstarQ1nstar | |
3185 | - 8.*reQ2nQ1nQ1nstarQ1nstarQ1nstar+8.*reQ3nQ1nstarQ1nstarQ1nstar+6.*reQ4nQ2nstarQ1nstarQ1nstar | |
3186 | + 8.*reQ3nQ1nQ2nstarQ2nstar-40.*reQ3nQ2nstarQ1nstar-8.*reQ4nQ3nstarQ1nstar-9.*reQ4nQ2nstarQ2nstar | |
3187 | + 24.*(dMult-4.)*reQ2nQ1nstarQ1nstar+24.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3188 | + 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+16.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3189 | + 3.*pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)-12.*(2.*dMult-7.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3190 | + 12.*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)-48.*(dMult-3.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3191 | + 24.*dMult*(dMult-5.)) | |
3192 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3193 | six3n1n1n1n1n1n = (reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ3nQ1nQ2nstarQ1nstarQ1nstar+6.*reQ4nQ2nstarQ1nstarQ1nstar | |
3194 | - reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-4.*reQ2nQ1nQ1nstarQ1nstarQ1nstar+3.*reQ3nQ1nQ2nstarQ2nstar | |
3195 | - 4.*(dMult-5.)*reQ3nQ1nstarQ1nstarQ1nstar-14.*reQ4nQ3nstarQ1nstar | |
3196 | - 3.*reQ4nQ2nstarQ2nstar+4.*(3.*dMult-17.)*reQ3nQ2nstarQ1nstar+12.*(dMult-6.)*reQ2nQ1nstarQ1nstar | |
3197 | + 12.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3198 | + 8.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3199 | + 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-8.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3200 | - 12.*(dMult-5.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-48.*(dMult-3.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3201 | + 12.*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)+24.*dMult*(dMult-5.)) | |
3202 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3203 | // Average 6-particle correlations for single event: | |
489d5531 | 3204 | fIntFlowCorrelationsAllEBE->SetBinContent(24,six1n1n1n1n1n1n); |
3205 | fIntFlowCorrelationsAllEBE->SetBinContent(25,six2n1n1n2n1n1n); | |
3206 | fIntFlowCorrelationsAllEBE->SetBinContent(26,six2n2n1n1n1n1n); | |
3207 | fIntFlowCorrelationsAllEBE->SetBinContent(27,six3n1n1n1n1n1n); | |
b84464d3 | 3208 | // Average 6-particle correlations for all events: |
489d5531 | 3209 | fIntFlowCorrelationsAllPro->Fill(23.5,six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
3210 | fIntFlowCorrelationsAllPro->Fill(24.5,six2n1n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3211 | fIntFlowCorrelationsAllPro->Fill(25.5,six2n2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3212 | fIntFlowCorrelationsAllPro->Fill(26.5,six3n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
b84464d3 | 3213 | // Average 6-particle correlations vs M for all events: |
3435cacb | 3214 | if(fCalculateAllCorrelationsVsM) |
3215 | { | |
3216 | fIntFlowCorrelationsAllVsMPro[23]->Fill(dMult+0.5,six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3217 | fIntFlowCorrelationsAllVsMPro[24]->Fill(dMult+0.5,six2n1n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3218 | fIntFlowCorrelationsAllVsMPro[25]->Fill(dMult+0.5,six2n2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3219 | fIntFlowCorrelationsAllVsMPro[26]->Fill(dMult+0.5,six3n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3220 | } | |
b84464d3 | 3221 | // Store separetately <6>: |
489d5531 | 3222 | fIntFlowCorrelationsEBE->SetBinContent(3,six1n1n1n1n1n1n); // <6> |
b84464d3 | 3223 | // Testing other multiplicity weights: |
489d5531 | 3224 | Double_t mWeight6p = 0.; |
3225 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
3226 | { | |
3227 | mWeight6p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.); | |
3228 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
3229 | { | |
3230 | mWeight6p = 1.; | |
3231 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
3232 | { | |
3233 | mWeight6p = dMult; | |
3234 | } | |
489d5531 | 3235 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(3,mWeight6p); // eW_<6> |
3236 | fIntFlowCorrelationsPro->Fill(2.5,six1n1n1n1n1n1n,mWeight6p); | |
b40a910e | 3237 | fIntFlowSquaredCorrelationsPro->Fill(2.5,six1n1n1n1n1n1n*six1n1n1n1n1n1n,mWeight6p); |
3238 | if(fCalculateCumulantsVsM) | |
3239 | { | |
3240 | fIntFlowCorrelationsVsMPro[2]->Fill(dMult+0.5,six1n1n1n1n1n1n,mWeight6p); | |
3241 | fIntFlowSquaredCorrelationsVsMPro[2]->Fill(dMult+0.5,six1n1n1n1n1n1n*six1n1n1n1n1n1n,mWeight6p); | |
3242 | } | |
489d5531 | 3243 | } // end of if(dMult>5) |
3244 | ||
3245 | // 7-particle: | |
b84464d3 | 3246 | Double_t seven2n1n1n1n1n1n1n = 0.; // <cos(n(2*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> |
489d5531 | 3247 | if(dMult>6) |
3248 | { | |
b84464d3 | 3249 | seven2n1n1n1n1n1n1n = (reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-4.*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),3.) |
3250 | - reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar-2.*reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar | |
3251 | + 9.*reQ2nQ2nQ2nstarQ1nstarQ1nstar+20.*reQ3nQ1nQ2nstarQ1nstarQ1nstar | |
3252 | + 2.*reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-8.*(dMult-8.)*reQ2nQ1nQ1nstarQ1nstarQ1nstar | |
3253 | - 18.*reQ4nQ2nstarQ1nstarQ1nstar-14.*reQ3nQ1nQ2nstarQ2nstar | |
3254 | + 8.*(dMult-7.)*reQ3nQ1nstarQ1nstarQ1nstar+28.*reQ4nQ3nstarQ1nstar | |
3255 | + 12.*reQ4nQ2nstarQ2nstar-8.*(5.*dMult-31.)*reQ3nQ2nstarQ1nstar | |
3256 | + 12.*(dMult*dMult-15.*dMult+46.)*reQ2nQ1nstarQ1nstar | |
3257 | - 16.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3258 | - 6.*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),2.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3259 | - 3.*pow(pow(dReQ2n,2.)+pow(dImQ2n,2.),2.) | |
3260 | + 12.*(2.*dMult-13.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3261 | - 12.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+16.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3262 | - 12.*(dMult-8.)*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3263 | + 12.*(3.*dMult-14.)*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),2.) | |
3264 | - 24.*(3.*dMult-7.)*(dMult-6.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3265 | + 24.*dMult*(dMult-5.)*(dMult-6.)) | |
3266 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)); | |
3267 | // Average 7-particle correlations for single event: | |
3268 | fIntFlowCorrelationsAllEBE->SetBinContent(29,seven2n1n1n1n1n1n1n); | |
3269 | // Average 7-particle correlations for all events: | |
3270 | fIntFlowCorrelationsAllPro->Fill(28.5,seven2n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) | |
3271 | *(dMult-4.)*(dMult-5.)*(dMult-6.)); | |
3272 | // Average 7-particle correlations vs M for all events: | |
3435cacb | 3273 | if(fCalculateAllCorrelationsVsM) |
3274 | { | |
b84464d3 | 3275 | fIntFlowCorrelationsAllVsMPro[28]->Fill(dMult+0.5,seven2n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) |
3276 | *(dMult-4.)*(dMult-5.)*(dMult-6.)); | |
3435cacb | 3277 | } |
489d5531 | 3278 | } // end of if(dMult>6) |
3279 | ||
3280 | // 8-particle: | |
b84464d3 | 3281 | Double_t eight1n1n1n1n1n1n1n1n = 0.; // <cos(n(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> |
489d5531 | 3282 | if(dMult>7) |
b84464d3 | 3283 | { |
3284 | eight1n1n1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),4.)-12.*reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar | |
3285 | + 16.*reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar+6.*reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar | |
3286 | - 12.*reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-36.*reQ2nQ2nQ2nstarQ1nstarQ1nstar | |
3287 | - 96.*reQ3nQ1nQ2nstarQ1nstarQ1nstar | |
3288 | + 72.*reQ4nQ2nstarQ1nstarQ1nstar+48.*reQ3nQ1nQ2nstarQ2nstar | |
3289 | - 64.*(dMult-6.)*reQ3nQ1nstarQ1nstarQ1nstar | |
3290 | + 96.*(dMult-6.)*reQ2nQ1nQ1nstarQ1nstarQ1nstar | |
3291 | - 96.*reQ4nQ3nstarQ1nstar-36.*reQ4nQ2nstarQ2nstar | |
3292 | + 192.*(dMult-6.)*reQ3nQ2nstarQ1nstar | |
3293 | - 144.*(dMult-7.)*(dMult-4.)*reQ2nQ1nstarQ1nstar | |
3294 | + 64.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3295 | - 144.*(dMult-6.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3296 | + 72.*(dMult-7.)*(dMult-4.)*(pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3297 | - 96.*(dMult-7.)*(dMult-6.)*(dMult-2.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3298 | + 36.*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),2.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3299 | + 9.*pow(pow(dReQ2n,2.)+pow(dImQ2n,2.),2.) | |
3300 | - 64.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3301 | + 36.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3302 | - 16.*(dMult-6.)*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),3.) | |
3303 | + 24.*dMult*(dMult-7.)*(dMult-6.)*(dMult-5.)) | |
3304 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); | |
3305 | // Average 8-particle correlations for single event: | |
3306 | fIntFlowCorrelationsAllEBE->SetBinContent(31,eight1n1n1n1n1n1n1n1n); | |
3307 | // Average 8-particle correlations for all events: | |
3308 | fIntFlowCorrelationsAllPro->Fill(30.5,eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) | |
3309 | *(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); | |
3310 | // Average 8-particle correlations vs M for all events: | |
3435cacb | 3311 | if(fCalculateAllCorrelationsVsM) |
3312 | { | |
b84464d3 | 3313 | fIntFlowCorrelationsAllVsMPro[30]->Fill(dMult+0.5,eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) |
3314 | *(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); | |
3315 | } | |
3316 | // Store separetately <8>: | |
489d5531 | 3317 | fIntFlowCorrelationsEBE->SetBinContent(4,eight1n1n1n1n1n1n1n1n); // <8> |
b84464d3 | 3318 | // Testing other multiplicity weights: |
489d5531 | 3319 | Double_t mWeight8p = 0.; |
3320 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
3321 | { | |
3322 | mWeight8p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.); | |
3323 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
3324 | { | |
3325 | mWeight8p = 1.; | |
3326 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
3327 | { | |
3328 | mWeight8p = dMult; | |
b84464d3 | 3329 | } |
489d5531 | 3330 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(4,mWeight8p); // eW_<8> |
b40a910e | 3331 | fIntFlowCorrelationsPro->Fill(3.5,eight1n1n1n1n1n1n1n1n,mWeight8p); |
3332 | fIntFlowSquaredCorrelationsPro->Fill(3.5,eight1n1n1n1n1n1n1n1n*eight1n1n1n1n1n1n1n1n,mWeight8p); | |
3333 | if(fCalculateCumulantsVsM) | |
3334 | { | |
3335 | fIntFlowCorrelationsVsMPro[3]->Fill(dMult+0.5,eight1n1n1n1n1n1n1n1n,mWeight8p); | |
3336 | fIntFlowSquaredCorrelationsVsMPro[3]->Fill(dMult+0.5,eight1n1n1n1n1n1n1n1n*eight1n1n1n1n1n1n1n1n,mWeight8p); | |
3337 | } | |
489d5531 | 3338 | } // end of if(dMult>7) |
3339 | ||
b84464d3 | 3340 | // EXTRA correlations for v3{5} study: |
8ed4edc7 | 3341 | // 4-particle: |
b84464d3 | 3342 | Double_t four4n2n3n3n = 0.; // <cos(n(4*phi1+2*phi2-3*phi3-3*phi4))> |
8ed4edc7 | 3343 | if(dMult>3.) |
3344 | { | |
11d3e40e | 3345 | four4n2n3n3n = (reQ4nQ2nQ3nstarQ3nstar-reQ6nQ4nstarQ2nstar-reQ6nQ3nstarQ3nstar |
3346 | - 2.*reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar | |
3347 | + (pow(dReQ6n,2.)+pow(dImQ6n,2.))+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3348 | + 2.*(2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3349 | + (pow(dReQ1n,2.)+pow(dImQ1n,2.))-3.*dMult)) | |
b84464d3 | 3350 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
8ed4edc7 | 3351 | fIntFlowCorrelationsAllPro->Fill(32.5,four4n2n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
b84464d3 | 3352 | // Average 4-particle correlations vs M for all events: |
3435cacb | 3353 | if(fCalculateAllCorrelationsVsM) |
3354 | { | |
3355 | fIntFlowCorrelationsAllVsMPro[32]->Fill(dMult+0.5,four4n2n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3356 | } | |
11d3e40e | 3357 | } // end of if(dMult>3.) |
8ed4edc7 | 3358 | |
3359 | // 5-particle: | |
b84464d3 | 3360 | Double_t five3n3n2n2n2n = 0.; // <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-2*phi5))> |
8ed4edc7 | 3361 | if(dMult>4.) |
3362 | { | |
b84464d3 | 3363 | five3n3n2n2n2n = (reQ3nQ3nQ2nstarQ2nstarQ2nstar-reQ6nQ2nstarQ2nstarQ2nstar-3.*reQ4nQ2nQ3nstarQ3nstar |
3364 | - 6.*reQ3nQ1nQ2nstarQ2nstar+2.*reQ6nQ3nstarQ3nstar+3.*reQ6nQ4nstarQ2nstar | |
3365 | + 6.*reQ4nQ3nstarQ1nstar+6.*reQ4nQ2nstarQ2nstar | |
3366 | + 12.*reQ3nQ2nstarQ1nstar+6.*reQ2nQ1nstarQ1nstar | |
11d3e40e | 3367 | - 2.*((pow(dReQ6n,2.)+pow(dImQ6n,2.)) |
3368 | + 3.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3369 | + 6.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3370 | + 9.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3371 | + 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-12.*dMult)) | |
b84464d3 | 3372 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
3373 | fIntFlowCorrelationsAllPro->Fill(33.5,five3n3n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3435cacb | 3374 | if(fCalculateAllCorrelationsVsM) |
3375 | { | |
b84464d3 | 3376 | fIntFlowCorrelationsAllVsMPro[33]->Fill(dMult+0.5,five3n3n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
3435cacb | 3377 | } |
11d3e40e | 3378 | } // end of if(dMult>4.) |
8ed4edc7 | 3379 | |
b84464d3 | 3380 | // EXTRA correlations for Teaney-Yan study: |
3381 | // 2-particle: | |
3382 | Double_t two5n5n = 0.; // <cos(5n(phi1-phi2))> | |
3383 | Double_t two6n6n = 0.; // <cos(6n(phi1-phi2))> | |
3384 | if(dMult>1) | |
3385 | { | |
3386 | two5n5n = (pow(dReQ5n,2.)+pow(dImQ5n,2.)-dMult)/(dMult*(dMult-1.)); | |
3387 | two6n6n = (pow(dReQ6n,2.)+pow(dImQ6n,2.)-dMult)/(dMult*(dMult-1.)); | |
3388 | // Average 2-particle correlations for all events: | |
3389 | fIntFlowCorrelationsAllPro->Fill(34.5,two5n5n,dMult*(dMult-1.)); | |
3390 | fIntFlowCorrelationsAllPro->Fill(35.5,two6n6n,dMult*(dMult-1.)); | |
3391 | if(fCalculateAllCorrelationsVsM) | |
3392 | { | |
3393 | fIntFlowCorrelationsAllVsMPro[34]->Fill(dMult+0.5,two5n5n,dMult*(dMult-1.)); | |
3394 | fIntFlowCorrelationsAllVsMPro[35]->Fill(dMult+0.5,two6n6n,dMult*(dMult-1.)); | |
3395 | } | |
3396 | } // end of if(dMult>1) | |
3397 | ||
3398 | // 3-particle: | |
3399 | Double_t three5n3n2n = 0.; // <cos(n(5*phi1-3*phi2-2*phi3)> | |
3400 | Double_t three5n4n1n = 0.; // <cos(n(5*phi1-4*phi2-1*phi3)> | |
3401 | Double_t three6n3n3n = 0.; // <cos(n(6*phi1-3*phi2-3*phi3)> | |
3402 | Double_t three6n4n2n = 0.; // <cos(n(6*phi1-4*phi2-2*phi3)> | |
3403 | Double_t three6n5n1n = 0.; // <cos(n(6*phi1-5*phi2-1*phi3)> | |
3404 | if(dMult>2) | |
3405 | { | |
3406 | three5n3n2n = (reQ5nQ3nstarQ2nstar-(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3407 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3408 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult) | |
3409 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3410 | three5n4n1n = (reQ5nQ4nstarQ1nstar-(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3411 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3412 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
3413 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3414 | three6n3n3n = (reQ6nQ3nstarQ3nstar-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3415 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))+2.*dMult) | |
3416 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3417 | three6n4n2n = (reQ6nQ4nstarQ2nstar-(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
3418 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3419 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult) | |
3420 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3421 | three6n5n1n = (reQ6nQ5nstarQ1nstar-(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
3422 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3423 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
3424 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3425 | // Average 3-particle correlations for all events: | |
3426 | fIntFlowCorrelationsAllPro->Fill(36.5,three5n3n2n,dMult*(dMult-1.)*(dMult-2.)); // <<cos(n(5*phi1-3*phi2-2*phi3)>> | |
3427 | fIntFlowCorrelationsAllPro->Fill(37.5,three5n4n1n,dMult*(dMult-1.)*(dMult-2.)); // <<cos(n(5*phi1-4*phi2-1*phi3)>> | |
3428 | fIntFlowCorrelationsAllPro->Fill(38.5,three6n3n3n,dMult*(dMult-1.)*(dMult-2.)); // <<cos(n(6*phi1-3*phi2-3*phi3)>> | |
3429 | fIntFlowCorrelationsAllPro->Fill(39.5,three6n4n2n,dMult*(dMult-1.)*(dMult-2.)); // <<cos(n(6*phi1-4*phi2-2*phi3)>> | |
3430 | fIntFlowCorrelationsAllPro->Fill(40.5,three6n5n1n,dMult*(dMult-1.)*(dMult-2.)); // <<cos(n(6*phi1-5*phi2-1*phi3)>> | |
3431 | if(fCalculateAllCorrelationsVsM) | |
3432 | { | |
3433 | fIntFlowCorrelationsAllVsMPro[36]->Fill(dMult+0.5,three5n3n2n,dMult*(dMult-1.)*(dMult-2.)); | |
3434 | fIntFlowCorrelationsAllVsMPro[37]->Fill(dMult+0.5,three5n4n1n,dMult*(dMult-1.)*(dMult-2.)); | |
3435 | fIntFlowCorrelationsAllVsMPro[38]->Fill(dMult+0.5,three6n3n3n,dMult*(dMult-1.)*(dMult-2.)); | |
3436 | fIntFlowCorrelationsAllVsMPro[39]->Fill(dMult+0.5,three6n4n2n,dMult*(dMult-1.)*(dMult-2.)); | |
3437 | fIntFlowCorrelationsAllVsMPro[40]->Fill(dMult+0.5,three6n5n1n,dMult*(dMult-1.)*(dMult-2.)); | |
3438 | } | |
3439 | } // end of if(dMult>2) | |
3440 | ||
3441 | // 4-particle: | |
3442 | Double_t four6n3n2n1n = 0.; // <cos(n(6*phi1-3*phi2-2*phi3-1*phi4)> | |
3443 | Double_t four3n2n3n2n = 0.; // <cos(n(3*phi1+2*phi2-3*phi3-2*phi4)> | |
3444 | Double_t four4n1n3n2n = 0.; // <cos(n(4*phi1+1*phi2-3*phi3-2*phi4)> | |
3445 | Double_t four3n3n3n3n = 0.; // <cos(3n(phi1+phi2-phi3-phi4))> | |
3446 | //Double_t four4n2n3n3n = 0.; // <cos(n(4*phi1+2*phi2-3*phi3-3*phi4)> // I already have this one above | |
3447 | Double_t four5n1n3n3n = 0.; // <cos(n(5*phi1+1*phi2-3*phi3-3*phi4)> | |
3448 | Double_t four4n2n4n2n = 0.; // <cos(n(4*phi1+2*phi2-4*phi3-2*phi4)> | |
3449 | Double_t four5n1n4n2n = 0.; // <cos(n(5*phi1+1*phi2-4*phi3-2*phi4)> | |
3450 | Double_t four5n3n1n1n = 0.; // <cos(n(5*phi1-3*phi2-1*phi3-1*phi4)> | |
3451 | Double_t four5n2n2n1n = 0.; // <cos(n(5*phi1-2*phi2-2*phi3-1*phi4)> | |
403e3389 | 3452 | Double_t four5n1n5n1n = 0.; // <cos(n(5*phi1+1*phi2-5*phi3-1*phi4)> |
3453 | Double_t four6n4n1n1n = 0.; // <cos(n(6*phi1-4*phi2-1*phi3-1*phi4)> | |
3454 | Double_t four6n2n2n2n = 0.; // <cos(n(6*phi1-2*phi2-2*phi3-2*phi4)> | |
b84464d3 | 3455 | if(dMult>3) |
3456 | { | |
3457 | four6n3n2n1n = (reQ6nQ3nstarQ2nstarQ1nstar-reQ6nQ4nstarQ2nstar-reQ6nQ3nstarQ3nstar-reQ6nQ5nstarQ1nstar | |
3458 | - reQ5nQ3nstarQ2nstar-reQ4nQ3nstarQ1nstar-reQ3nQ2nstarQ1nstar | |
3459 | + 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))+pow(dReQ5n,2.)+pow(dImQ5n,2.) | |
3460 | + pow(dReQ4n,2.)+pow(dImQ4n,2.)+3.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3461 | + 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
3462 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3463 | four3n2n3n2n = (dQ3nQ2nQ3nstarQ2nstar-2.*reQ5nQ3nstarQ2nstar-2.*reQ3nQ2nstarQ1nstar | |
3464 | + pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.) | |
3465 | -(dMult-4.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3466 | + dMult*(dMult-6.)) | |
3467 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3468 | four4n1n3n2n = (reQ4nQ1nQ3nstarQ2nstar-reQ5nQ3nstarQ2nstar-reQ5nQ4nstarQ1nstar-reQ4nQ3nstarQ1nstar | |
3469 | - reQ4nQ2nstarQ2nstar-reQ3nQ2nstarQ1nstar-reQ2nQ1nstarQ1nstar | |
3470 | + pow(dReQ5n,2.)+pow(dImQ5n,2.)+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3471 | + 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3472 | + 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
3473 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3474 | four3n3n3n3n = (2.*dMult*(dMult-3.)+pow((pow(dReQ3n,2.)+pow(dImQ3n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ3n,2.) | |
3475 | + pow(dImQ3n,2.))-2.*reQ6nQ3nstarQ3nstar+(pow(dReQ6n,2.)+pow(dImQ6n,2.))) | |
3476 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
3477 | //four4n2n3n3n = ; // I already have this one above | |
3478 | four5n1n3n3n = (reQ5nQ1nQ3nstarQ3nstar-reQ6nQ5nstarQ1nstar-reQ6nQ3nstarQ3nstar-2.*reQ5nQ3nstarQ2nstar | |
3479 | - 2.*reQ3nQ2nstarQ1nstar+pow(dReQ6n,2.)+pow(dImQ6n,2.)+2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3480 | + 4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3481 | + 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
3482 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3483 | four4n2n4n2n = (dQ4nQ2nQ4nstarQ2nstar-2.*reQ6nQ4nstarQ2nstar-2.*reQ4nQ2nstarQ2nstar) | |
3484 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3485 | - ((dMult-5.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3486 | + (dMult-4.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-(pow(dReQ6n,2.)+pow(dImQ6n,2.))) | |
3487 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3488 | + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3489 | four5n1n4n2n = (reQ5nQ1nQ4nstarQ2nstar-reQ6nQ5nstarQ1nstar-reQ6nQ4nstarQ2nstar-reQ5nQ4nstarQ1nstar | |
3490 | - reQ5nQ3nstarQ2nstar-reQ4nQ3nstarQ1nstar-reQ2nQ1nstarQ1nstar+pow(dReQ6n,2.)+pow(dImQ6n,2.) | |
3491 | + 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3492 | + pow(dReQ3n,2.)+pow(dImQ3n,2.)+2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3493 | + 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
3494 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3495 | four5n3n1n1n = (reQ5nQ3nstarQ1nstarQ1nstar-2.*reQ5nQ4nstarQ1nstar-reQ5nQ3nstarQ2nstar-2.*reQ4nQ3nstarQ1nstar | |
3496 | - reQ2nQ1nstarQ1nstar+2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3497 | + 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+pow(dReQ2n,2.)+pow(dImQ2n,2.) | |
3498 | + 4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
3499 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3500 | four5n2n2n1n = (reQ5nQ2nstarQ2nstarQ1nstar-reQ5nQ4nstarQ1nstar-2.*reQ5nQ3nstarQ2nstar-reQ4nQ2nstarQ2nstar | |
3501 | - 2.*reQ3nQ2nstarQ1nstar+2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))+pow(dReQ4n,2.)+pow(dImQ4n,2.) | |
3502 | + 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3503 | + 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
3504 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3505 | four5n1n5n1n = (dQ5nQ1nQ5nstarQ1nstar-2.*reQ6nQ5nstarQ1nstar-2.*reQ5nQ4nstarQ1nstar | |
3506 | + pow(dReQ6n,2.)+pow(dImQ6n,2.)-(dMult-4.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3507 | + pow(dReQ4n,2.)+pow(dImQ4n,2.)-(dMult-4.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+dMult*(dMult-6.)) | |
3508 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
403e3389 | 3509 | |
3510 | four6n4n1n1n = (reQ6nQ4nstarQ1nstarQ1nstar | |
3511 | - dMult*(dMult-1.)*(dMult-2.)*(three2n1n1n+2.*three5n4n1n+2.*three6n5n1n+three6n4n2n) | |
3512 | - dMult*(dMult-1.)*(2.*two1n1n+1.*two4n4n+1.*two6n6n+1.*two2n2n+2.*two5n5n) | |
3513 | - 1.*dMult) | |
3514 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3515 | ||
3516 | four6n2n2n2n = (reQ6nQ2nstarQ2nstarQ2nstar-3.*reQ6nQ4nstarQ2nstar-3.*reQ4nQ2nstarQ2nstar | |
3517 | + 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))+3.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3518 | + 6.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-6.*dMult) | |
3519 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3520 | // Average 4-particle correlations for all events: |
3521 | fIntFlowCorrelationsAllPro->Fill(41.5,four6n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3522 | fIntFlowCorrelationsAllPro->Fill(42.5,four3n2n3n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3523 | fIntFlowCorrelationsAllPro->Fill(43.5,four4n1n3n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3524 | fIntFlowCorrelationsAllPro->Fill(44.5,four3n3n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3525 | //fIntFlowCorrelationsAllPro->Fill(45.5,four4n2n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); // I already have this one above | |
3526 | fIntFlowCorrelationsAllPro->Fill(46.5,four5n1n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3527 | fIntFlowCorrelationsAllPro->Fill(47.5,four4n2n4n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3528 | fIntFlowCorrelationsAllPro->Fill(48.5,four5n1n4n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3529 | fIntFlowCorrelationsAllPro->Fill(49.5,four5n3n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3530 | fIntFlowCorrelationsAllPro->Fill(50.5,four5n2n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3531 | fIntFlowCorrelationsAllPro->Fill(51.5,four5n1n5n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
403e3389 | 3532 | fIntFlowCorrelationsAllPro->Fill(58.5,four6n4n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
3533 | fIntFlowCorrelationsAllPro->Fill(59.5,four6n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3534 | if(fCalculateAllCorrelationsVsM) |
3535 | { | |
3536 | fIntFlowCorrelationsAllVsMPro[41]->Fill(dMult+0.5,four6n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3537 | fIntFlowCorrelationsAllVsMPro[42]->Fill(dMult+0.5,four3n2n3n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3538 | fIntFlowCorrelationsAllVsMPro[43]->Fill(dMult+0.5,four4n1n3n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3539 | fIntFlowCorrelationsAllVsMPro[44]->Fill(dMult+0.5,four3n3n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3540 | //fIntFlowCorrelationsAllVsMPro[45]->Fill(dMult+0.5,four4n2n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3541 | fIntFlowCorrelationsAllVsMPro[46]->Fill(dMult+0.5,four5n1n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3542 | fIntFlowCorrelationsAllVsMPro[47]->Fill(dMult+0.5,four4n2n4n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3543 | fIntFlowCorrelationsAllVsMPro[48]->Fill(dMult+0.5,four5n1n4n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3544 | fIntFlowCorrelationsAllVsMPro[49]->Fill(dMult+0.5,four5n3n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3545 | fIntFlowCorrelationsAllVsMPro[50]->Fill(dMult+0.5,four5n2n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3546 | fIntFlowCorrelationsAllVsMPro[51]->Fill(dMult+0.5,four5n1n5n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
403e3389 | 3547 | fIntFlowCorrelationsAllVsMPro[58]->Fill(dMult+0.5,four6n4n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
3548 | fIntFlowCorrelationsAllVsMPro[59]->Fill(dMult+0.5,four6n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3549 | } |
3550 | } // end of if(dMult>3) | |
3551 | ||
3552 | // 5-particle: | |
3553 | Double_t five3n3n3n2n1n = 0.; // <cos(n(3*phi1+3*phi2-3*phi3-2*phi4-1*phi5)> | |
3554 | Double_t five4n2n3n2n1n = 0.; // <cos(n(4*phi1+2*phi2-3*phi3-2*phi4-1*phi5)> | |
3555 | Double_t five3n2n3n1n1n = 0.; // <cos(n(3*phi1+2*phi2-3*phi3-1*phi4-1*phi5)> | |
3556 | Double_t five3n2n2n2n1n = 0.; // <cos(n(3*phi1+2*phi2-2*phi3-2*phi4-1*phi5)> | |
3557 | Double_t five5n1n3n2n1n = 0.; // <cos(n(5*phi1+1*phi2-3*phi3-2*phi4-1*phi5)> | |
403e3389 | 3558 | Double_t five6n2n2n1n1n = 0.; // <cos(n(6*phi1-2*phi2-2*phi3-1*phi4-1*phi5)> |
3559 | Double_t five4n1n1n3n3n = 0.; // <cos(n(4*phi1+1*phi2+1*phi3-3*phi4-3*phi5)> | |
b84464d3 | 3560 | if(dMult>4) |
3561 | { | |
3562 | five3n3n3n2n1n = (reQ3nQ3nQ3nstarQ2nstarQ1nstar-reQ6nQ3nstarQ2nstarQ1nstar-reQ5nQ1nQ3nstarQ3nstar-reQ4nQ2nQ3nstarQ3nstar | |
3563 | + reQ6nQ5nstarQ1nstar+reQ6nQ4nstarQ2nstar+3.*reQ6nQ3nstarQ3nstar+4.*reQ5nQ3nstarQ2nstar+4.*reQ4nQ3nstarQ1nstar | |
3564 | - 2.*(dMult-6.)*reQ3nQ2nstarQ1nstar-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3565 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3566 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3567 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*(3.*dMult-10.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3568 | - pow((pow(dReQ3n,2.)+pow(dImQ3n,2.)),2.)+2.*(dMult-5.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3569 | + 2.*(dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*dMult*(dMult-6.)) | |
3570 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3571 | five4n2n3n2n1n = (reQ4nQ2nQ3nstarQ2nstarQ1nstar-reQ6nQ3nstarQ2nstarQ1nstar-reQ5nQ1nQ4nstarQ2nstar | |
3572 | - reQ4nQ2nQ3nstarQ3nstar-reQ4nQ1nQ3nstarQ2nstar-reQ4nQ2nstarQ1nstarQ1nstar | |
3573 | - reQ3nQ1nQ2nstarQ2nstar-(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3574 | + 3.*reQ6nQ4nstarQ2nstar+reQ6nQ5nstarQ1nstar+reQ6nQ3nstarQ3nstar+reQ5nQ4nstarQ1nstar | |
3575 | + 3.*reQ5nQ3nstarQ2nstar-(dMult-7.)*reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar+7.*reQ3nQ2nstarQ1nstar | |
3576 | + 4.*reQ2nQ1nstarQ1nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3577 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3578 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3579 | + (dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+(dMult-10.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3580 | + 2.*(dMult-7.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+(dMult-12.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3581 | - 2.*dMult*(dMult-12.)) | |
3582 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3583 | five3n2n3n1n1n = (reQ3nQ2nQ3nstarQ1nstarQ1nstar-reQ5nQ3nstarQ1nstarQ1nstar-2.*reQ4nQ1nQ3nstarQ2nstar-reQ3nQ1nstarQ1nstarQ1nstar | |
3584 | - 2.*reQ3nQ1nQ2nstarQ2nstar+2.*reQ5nQ4nstarQ1nstar+3.*reQ5nQ3nstarQ2nstar+6.*reQ4nQ3nstarQ1nstar | |
3585 | + 2.*reQ4nQ2nstarQ2nstar+9.*reQ3nQ2nstarQ1nstar-(dMult-8.)*reQ2nQ1nstarQ1nstar | |
3586 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3587 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3588 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))-4.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3589 | + 2.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+(dMult-12.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3590 | + 2.*(dMult-9.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-2.*dMult*(dMult-12.)) | |
3591 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3592 | five3n2n2n2n1n = (reQ3nQ2nQ2nstarQ2nstarQ1nstar-reQ5nQ2nstarQ2nstarQ1nstar-reQ4nQ1nQ3nstarQ2nstar-reQ3nQ1nQ2nstarQ2nstar | |
3593 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+reQ5nQ4nstarQ1nstar | |
3594 | + 4.*reQ5nQ3nstarQ2nstar+reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar-2.*(dMult-6.)*reQ3nQ2nstarQ1nstar | |
3595 | + 4.*reQ2nQ1nstarQ1nstar-2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3596 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3597 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3598 | - pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)+2.*(3.*dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3599 | + 2.*(dMult-6.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*dMult*(dMult-6.)) | |
3600 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3601 | five5n1n3n2n1n = (reQ5nQ1nQ3nstarQ2nstarQ1nstar-reQ6nQ3nstarQ2nstarQ1nstar-reQ5nQ1nQ4nstarQ2nstar-reQ5nQ1nQ3nstarQ3nstar | |
3602 | - reQ4nQ1nQ3nstarQ2nstar-reQ5nQ3nstarQ1nstarQ1nstar-reQ5nQ2nstarQ2nstarQ1nstar | |
3603 | + 3.*reQ6nQ5nstarQ1nstar+reQ6nQ4nstarQ2nstar+reQ6nQ3nstarQ3nstar+4.*reQ5nQ4nstarQ1nstar | |
3604 | - (dMult-7.)*reQ5nQ3nstarQ2nstar+4.*reQ4nQ3nstarQ1nstar+reQ4nQ2nstarQ2nstar+6.*reQ3nQ2nstarQ1nstar | |
3605 | + 3.*reQ2nQ1nstarQ1nstar-(pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3606 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3607 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3608 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))+(dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3609 | - 4.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+(dMult-10.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3610 | + (dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*(dMult-7.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3611 | - 2.*dMult*(dMult-12.)) | |
3612 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
403e3389 | 3613 | |
3614 | // five6n2n2n1n1n = ; | |
3615 | // five4n1n1n3n3n = ; | |
3616 | ||
b84464d3 | 3617 | // Average 5-particle correlations for all events: |
3618 | fIntFlowCorrelationsAllPro->Fill(52.5,five3n3n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3619 | fIntFlowCorrelationsAllPro->Fill(53.5,five4n2n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3620 | fIntFlowCorrelationsAllPro->Fill(54.5,five3n2n3n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3621 | fIntFlowCorrelationsAllPro->Fill(55.5,five3n2n2n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3622 | fIntFlowCorrelationsAllPro->Fill(56.5,five5n1n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
403e3389 | 3623 | fIntFlowCorrelationsAllPro->Fill(60.5,five6n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
3624 | fIntFlowCorrelationsAllPro->Fill(61.5,five4n1n1n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
b84464d3 | 3625 | if(fCalculateAllCorrelationsVsM) |
3626 | { | |
3627 | fIntFlowCorrelationsAllVsMPro[52]->Fill(dMult+0.5,five3n3n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3628 | fIntFlowCorrelationsAllVsMPro[53]->Fill(dMult+0.5,five4n2n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3629 | fIntFlowCorrelationsAllVsMPro[54]->Fill(dMult+0.5,five3n2n3n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3630 | fIntFlowCorrelationsAllVsMPro[55]->Fill(dMult+0.5,five3n2n2n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3631 | fIntFlowCorrelationsAllVsMPro[56]->Fill(dMult+0.5,five5n1n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
403e3389 | 3632 | fIntFlowCorrelationsAllVsMPro[60]->Fill(dMult+0.5,five6n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
3633 | fIntFlowCorrelationsAllVsMPro[61]->Fill(dMult+0.5,five4n1n1n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
b84464d3 | 3634 | } |
3635 | } // end of if(dMult>4) | |
3636 | ||
3637 | // 6-particle: | |
3638 | Double_t six3n2n1n3n2n1n = 0.; // <cos(n(3*phi1+2*phi2+1*phi3-3*phi4-2*phi5-1*phi6)> | |
403e3389 | 3639 | Double_t six3n3n2n2n1n1n = 0.; // <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-1*phi5-1*phi6)> |
b84464d3 | 3640 | if(dMult>5.) |
3641 | { | |
3642 | six3n2n1n3n2n1n = (dQ3nQ2nQ1nQ3nstarQ2nstarQ1nstar-2.*reQ3nQ3nQ3nstarQ2nstarQ1nstar | |
3643 | - 2.*reQ3nQ2nQ2nstarQ2nstarQ1nstar-2.*reQ3nQ1nQ2nstarQ1nstarQ1nstar | |
3644 | - 2.*reQ3nQ2nQ3nstarQ1nstarQ1nstar-2.*reQ4nQ2nQ3nstarQ2nstarQ1nstar | |
3645 | - 2.*reQ5nQ1nQ3nstarQ2nstarQ1nstar+4.*reQ6nQ3nstarQ2nstarQ1nstar | |
3646 | + 2.*reQ5nQ1nQ4nstarQ2nstar+2.*reQ5nQ1nQ3nstarQ3nstar | |
3647 | + 2.*reQ4nQ2nQ3nstarQ3nstar+6.*reQ4nQ1nQ3nstarQ2nstar | |
3648 | + 2.*reQ5nQ3nstarQ1nstarQ1nstar+2.*reQ5nQ2nstarQ2nstarQ1nstar | |
3649 | + 6.*reQ3nQ1nQ2nstarQ2nstar+2.*reQ4nQ2nstarQ1nstarQ1nstar | |
3650 | - 4.*reQ6nQ5nstarQ1nstar-4.*reQ6nQ4nstarQ2nstar-6.*reQ5nQ4nstarQ1nstar | |
3651 | - 4.*reQ6nQ3nstarQ3nstar+2.*(dMult-11.)*reQ5nQ3nstarQ2nstar | |
3652 | + 2.*(dMult-13.)*reQ4nQ3nstarQ1nstar-8.*reQ4nQ2nstarQ2nstar | |
3653 | + 2.*(5.*dMult-32.)*reQ3nQ2nstarQ1nstar+2.*reQ3nQ1nstarQ1nstarQ1nstar | |
3654 | + 2.*(dMult-13.)*reQ2nQ1nstarQ1nstar | |
3655 | - (dMult-10.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3656 | + (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3657 | + (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3658 | - (dMult-11.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3659 | - (dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3660 | + 4.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-(dMult-12.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3661 | - (dMult-16.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+pow((pow(dReQ3n,2.)+pow(dImQ3n,2.)),2.) | |
3662 | + (dMult*dMult-19.*dMult+68.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3663 | + (dMult*dMult-19.*dMult+72.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3664 | + pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)+pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
3665 | + (dMult*dMult-20.*dMult+80.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3666 | - dMult*(dMult-12.)*(dMult-10.)) | |
3667 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
403e3389 | 3668 | |
3669 | // six3n3n2n2n1n1n = ; | |
3670 | ||
b84464d3 | 3671 | // Average 6-particle correlations for all events: |
3672 | fIntFlowCorrelationsAllPro->Fill(57.5,six3n2n1n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
403e3389 | 3673 | fIntFlowCorrelationsAllPro->Fill(62.5,six3n3n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
b84464d3 | 3674 | if(fCalculateAllCorrelationsVsM) |
3675 | { | |
3676 | fIntFlowCorrelationsAllVsMPro[57]->Fill(dMult+0.5,six3n2n1n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
403e3389 | 3677 | fIntFlowCorrelationsAllVsMPro[62]->Fill(dMult+0.5,six3n3n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
b84464d3 | 3678 | } |
3679 | } // end of if(dMult>5.) | |
3680 | ||
489d5531 | 3681 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelations() |
3682 | ||
489d5531 | 3683 | //================================================================================================================================ |
3684 | ||
e5834fcb | 3685 | void AliFlowAnalysisWithQCumulants::StorePhiDistributionForOneEvent(AliFlowEventSimple *anEvent) |
3686 | { | |
3687 | // Store phi distribution for one event to illustrate flow. | |
3688 | ||
3689 | if(fPhiDistributionForOneEvent->GetEntries()>0){return;} // store only phi distribution for one event | |
3690 | ||
3691 | Double_t vMin = fPhiDistributionForOneEventSettings[0]; | |
3692 | Double_t vMax = fPhiDistributionForOneEventSettings[1]; | |
3693 | Double_t refMultMin = fPhiDistributionForOneEventSettings[2]; | |
3694 | Double_t refMultMax = fPhiDistributionForOneEventSettings[3]; | |
3695 | ||
3696 | Double_t vEBE = 0.; | |
3697 | Double_t cumulant4thEBE = fIntFlowCorrelationsEBE->GetBinContent(2)-2.*pow(fIntFlowCorrelationsEBE->GetBinContent(1),2.); | |
3698 | if(cumulant4thEBE<0.) | |
3699 | { | |
3700 | vEBE = pow(-1.*cumulant4thEBE,0.25); | |
3701 | if((vEBE>vMin && vEBE<vMax) && (fReferenceMultiplicityEBE>refMultMin && fReferenceMultiplicityEBE<refMultMax)) | |
3702 | { | |
3958eee6 | 3703 | fPhiDistributionForOneEvent->SetTitle(Form("v_{%i} = %f",fHarmonic,vEBE)); |
e5834fcb | 3704 | for(Int_t p=0;p<anEvent->NumberOfTracks();p++) |
3705 | { | |
3706 | if(anEvent->GetTrack(p)->InRPSelection()) | |
3707 | { | |
3708 | fPhiDistributionForOneEvent->Fill(anEvent->GetTrack(p)->Phi()); | |
3709 | } | |
3710 | } // end of for(Int_t p=0;p<anEvent->NumberOfTracks();p++) | |
3958eee6 | 3711 | } else |
3712 | { | |
3713 | fPhiDistributionForOneEvent->SetTitle(Form("v_{%i} = %f, out of specified boundaries",fHarmonic,vEBE)); | |
3714 | } | |
3715 | ||
e5834fcb | 3716 | } // end of if(cumulant4thEBE<0.) |
3717 | ||
3718 | } // end of void AliFlowAnalysisWithQCumulants::StorePhiDistributionForOneEvent(AliFlowEventSimple *anEvent) | |
3719 | ||
3720 | //================================================================================================================================ | |
489d5531 | 3721 | |
3722 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrelations() | |
3723 | { | |
0328db2d | 3724 | // Calculate averages of products of correlations for integrated flow. |
489d5531 | 3725 | |
2001bc3a | 3726 | // multiplicity: |
1268c371 | 3727 | Double_t dMult = (*fSpk)(0,0); |
2001bc3a | 3728 | |
489d5531 | 3729 | Int_t counter = 0; |
3730 | ||
3731 | for(Int_t ci1=1;ci1<4;ci1++) | |
3732 | { | |
3733 | for(Int_t ci2=ci1+1;ci2<=4;ci2++) | |
3734 | { | |
ff70ca91 | 3735 | fIntFlowProductOfCorrelationsPro->Fill(0.5+counter, |
3736 | fIntFlowCorrelationsEBE->GetBinContent(ci1)* | |
3737 | fIntFlowCorrelationsEBE->GetBinContent(ci2), | |
3738 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
3739 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); | |
3740 | // products versus multiplicity: // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>] | |
b3dacf6b | 3741 | if(fCalculateCumulantsVsM) |
3742 | { | |
3743 | fIntFlowProductOfCorrelationsVsMPro[counter]->Fill(dMult+0.5, // to be improved: dMult => sum of weights ? | |
3744 | fIntFlowCorrelationsEBE->GetBinContent(ci1)* | |
3745 | fIntFlowCorrelationsEBE->GetBinContent(ci2), | |
3746 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
3747 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); | |
3748 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 3749 | counter++; |
489d5531 | 3750 | } |
3751 | } | |
3752 | ||
3753 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrelations() | |
3754 | ||
3755 | ||
3756 | //================================================================================================================================ | |
3757 | ||
3758 | ||
0328db2d | 3759 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrectionTermsForNUA() |
3760 | { | |
3761 | // Calculate averages of products of correction terms for NUA. | |
3762 | ||
3763 | // a) Binning of fIntFlowProductOfCorrectionTermsForNUAPro is organized as follows: | |
3764 | // 1st bin: <<2><cos(phi)>> | |
3765 | // 2nd bin: <<2><sin(phi)>> | |
3766 | // 3rd bin: <<cos(phi)><sin(phi)>> | |
3767 | // 4th bin: <<2><cos(phi1+phi2)>> | |
3768 | // 5th bin: <<2><sin(phi1+phi2)>> | |
3769 | // 6th bin: <<2><cos(phi1-phi2-phi3)>> | |
3770 | // 7th bin: <<2><sin(phi1-phi2-phi3)>> | |
3771 | // 8th bin: <<4><cos(phi1)>> | |
3772 | // 9th bin: <<4><sin(phi1)>> | |
3773 | // 10th bin: <<4><cos(phi1+phi2)>> | |
3774 | // 11th bin: <<4><sin(phi1+phi2)>> | |
3775 | // 12th bin: <<4><cos(phi1-phi2-phi3)>> | |
3776 | // 13th bin: <<4><sin(phi1-phi2-phi3)>> | |
3777 | // 14th bin: <<cos(phi1)><cos(phi1+phi2)>> | |
3778 | // 15th bin: <<cos(phi1)><sin(phi1+phi2)>> | |
3779 | // 16th bin: <<cos(phi1)><cos(phi1-phi2-phi3)>> | |
3780 | // 17th bin: <<cos(phi1)><sin(phi1-phi2-phi3)>> | |
3781 | // 18th bin: <<sin(phi1)><cos(phi1+phi2)>> | |
3782 | // 19th bin: <<sin(phi1)><sin(phi1+phi2)>> | |
3783 | // 20th bin: <<sin(phi1)><cos(phi1-phi2-phi3)>> | |
3784 | // 21st bin: <<sin(phi1)><sin(phi1-phi2-phi3)>> | |
3785 | // 22nd bin: <<cos(phi1+phi2)><sin(phi1+phi2)>> | |
3786 | // 23rd bin: <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
3787 | // 24th bin: <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
3788 | // 25th bin: <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
3789 | // 26th bin: <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
3790 | // 27th bin: <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>> | |
3791 | ||
3792 | // <<2><cos(phi)>>: | |
3793 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(0.5, | |
3794 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1), | |
3795 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3796 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
3797 | // <<2><sin(phi)>>: | |
3798 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(1.5, | |
3799 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1), | |
3800 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3801 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
3802 | // <<cos(phi)><sin(phi)>>: | |
3803 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(2.5, | |
3804 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1), | |
3805 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3806 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
3807 | // <<2><cos(phi1+phi2)>>: | |
3808 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(3.5, | |
3809 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3810 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3811 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3812 | // <<2><sin(phi1+phi2)>>: | |
3813 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(4.5, | |
3814 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3815 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3816 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3817 | // <<2><cos(phi1-phi2-phi3)>>: | |
3818 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(5.5, | |
3819 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3820 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3821 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3822 | // <<2><sin(phi1-phi2-phi3)>>: | |
3823 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(6.5, | |
3824 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3825 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3826 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3827 | // <<4><cos(phi1)>>: | |
3828 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(7.5, | |
3829 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1), | |
3830 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3831 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
3832 | // <<4><sin(phi1)>>: | |
3833 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(8.5, | |
3834 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1), | |
3835 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3836 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
3837 | // <<4><cos(phi1+phi2)>>: | |
3838 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(9.5, | |
3839 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3840 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3841 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3842 | // <<4><sin(phi1+phi2)>>: | |
3843 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(10.5, | |
3844 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3845 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3846 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3847 | // <<4><cos(phi1-phi2-phi3)>>: | |
3848 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(11.5, | |
3849 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3850 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3851 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3852 | // <<4><sin(phi1-phi2-phi3)>>: | |
3853 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(12.5, | |
3854 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3855 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3856 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3857 | // <<cos(phi1)><cos(phi1+phi2)>>: | |
3858 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(13.5, | |
3859 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3860 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3861 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3862 | // <<cos(phi1)><sin(phi1+phi2)>>: | |
3863 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(14.5, | |
3864 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3865 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3866 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3867 | // <<cos(phi1)><cos(phi1-phi2-phi3)>>: | |
3868 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(15.5, | |
3869 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3870 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3871 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3872 | // <<cos(phi1)><sin(phi1-phi2-phi3)>>: | |
3873 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(16.5, | |
3874 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3875 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3876 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3877 | // <<sin(phi1)><cos(phi1+phi2)>>: | |
3878 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(17.5, | |
3879 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3880 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3881 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3882 | // <<sin(phi1)><sin(phi1+phi2)>>: | |
3883 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(18.5, | |
3884 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3885 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3886 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3887 | // <<sin(phi1)><cos(phi1-phi2-phi3)>>: | |
3888 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(19.5, | |
3889 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3890 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3891 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3892 | // <<sin(phi1)><sin(phi1-phi2-phi3)>>: | |
3893 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(20.5, | |
3894 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3895 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3896 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3897 | // <<cos(phi1+phi2)><sin(phi1+phi2)>>: | |
3898 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(21.5, | |
3899 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3900 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2) | |
3901 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3902 | // <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>>: | |
3903 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(22.5, | |
3904 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3905 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2) | |
3906 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3907 | // <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>>: | |
3908 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(23.5, | |
3909 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3910 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2) | |
3911 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3912 | // <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>>: | |
3913 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(24.5, | |
3914 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3915 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2) | |
3916 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3917 | // <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>>: | |
3918 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(25.5, | |
3919 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3920 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2) | |
3921 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3922 | // <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>>: | |
3923 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(26.5, | |
3924 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3925 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3) | |
3926 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3927 | ||
3928 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrectionTermsForNUA() | |
3929 | ||
0328db2d | 3930 | //================================================================================================================================ |
3931 | ||
489d5531 | 3932 | void AliFlowAnalysisWithQCumulants::CalculateCovariancesIntFlow() |
3933 | { | |
3934 | // a) Calculate unbiased estimators Cov(<2>,<4>), Cov(<2>,<6>), Cov(<2>,<8>), Cov(<4>,<6>), Cov(<4>,<8>) and Cov(<6>,<8>) | |
3935 | // for covariances V_(<2>,<4>), V_(<2>,<6>), V_(<2>,<8>), V_(<4>,<6>), V_(<4>,<8>) and V_(<6>,<8>). | |
3936 | // b) Store in histogram fIntFlowCovariances for instance the following: | |
3937 | // | |
3938 | // Cov(<2>,<4>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4>}_j)] | |
3939 | // | |
3940 | // where N is the number of events, w_{<2>} is event weight for <2> and w_{<4>} is event weight for <4>. | |
3941 | // c) Binning of fIntFlowCovariances is organized as follows: | |
3942 | // | |
3943 | // 1st bin: Cov(<2>,<4>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4>}_j)] | |
3944 | // 2nd bin: Cov(<2>,<6>) * (sum_{i=1}^{N} w_{<2>}_i w_{<6>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<6>}_j)] | |
3945 | // 3rd bin: Cov(<2>,<8>) * (sum_{i=1}^{N} w_{<2>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<8>}_j)] | |
3946 | // 4th bin: Cov(<4>,<6>) * (sum_{i=1}^{N} w_{<4>}_i w_{<6>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<6>}_j)] | |
3947 | // 5th bin: Cov(<4>,<8>) * (sum_{i=1}^{N} w_{<4>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<8>}_j)] | |
3948 | // 6th bin: Cov(<6>,<8>) * (sum_{i=1}^{N} w_{<6>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<6>}_i) * (sum_{j=1}^{N} w_{<8>}_j)] | |
b3dacf6b | 3949 | // |
489d5531 | 3950 | |
b3dacf6b | 3951 | // Average 2-, 4-, 6- and 8-particle correlations for all events: |
489d5531 | 3952 | Double_t correlation[4] = {0.}; |
3953 | for(Int_t ci=0;ci<4;ci++) | |
3954 | { | |
3955 | correlation[ci] = fIntFlowCorrelationsPro->GetBinContent(ci+1); | |
3956 | } | |
b3dacf6b | 3957 | // Average products of 2-, 4-, 6- and 8-particle correlations: |
489d5531 | 3958 | Double_t productOfCorrelations[4][4] = {{0.}}; |
3959 | Int_t productOfCorrelationsLabel = 1; | |
b3dacf6b | 3960 | // Denominators in the expressions for the unbiased estimator for covariance: |
489d5531 | 3961 | Double_t denominator[4][4] = {{0.}}; |
3962 | Int_t sumOfProductOfEventWeightsLabel1 = 1; | |
b3dacf6b | 3963 | // Weight dependent prefactor which multiply unbiased estimators for covariances: |
489d5531 | 3964 | Double_t wPrefactor[4][4] = {{0.}}; |
3965 | Int_t sumOfProductOfEventWeightsLabel2 = 1; | |
3966 | for(Int_t c1=0;c1<4;c1++) | |
3967 | { | |
3968 | for(Int_t c2=c1+1;c2<4;c2++) | |
3969 | { | |
3970 | productOfCorrelations[c1][c2] = fIntFlowProductOfCorrelationsPro->GetBinContent(productOfCorrelationsLabel); | |
b3dacf6b | 3971 | if(TMath::Abs(fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1)) > 1.e-44 && TMath::Abs(fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)) > 1.e-44) |
3972 | { | |
3973 | denominator[c1][c2] = 1.-(fIntFlowSumOfProductOfEventWeights->GetBinContent(sumOfProductOfEventWeightsLabel1)) | |
3974 | / (fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1) | |
3975 | * fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)); | |
3976 | wPrefactor[c1][c2] = fIntFlowSumOfProductOfEventWeights->GetBinContent(sumOfProductOfEventWeightsLabel2) | |
3977 | / (fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1) | |
3978 | * fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)); | |
489d5531 | 3979 | } |
b3dacf6b | 3980 | productOfCorrelationsLabel++; // to be improved - do I need here all 3 counters? |
489d5531 | 3981 | sumOfProductOfEventWeightsLabel1++; |
3982 | sumOfProductOfEventWeightsLabel2++; | |
b3dacf6b | 3983 | } // end of for(Int_t c2=c1+1;c2<4;c2++) |
3984 | } // end of for(Int_t c1=0;c1<4;c1++) | |
489d5531 | 3985 | |
489d5531 | 3986 | Int_t covarianceLabel = 1; |
3987 | for(Int_t c1=0;c1<4;c1++) | |
3988 | { | |
3989 | for(Int_t c2=c1+1;c2<4;c2++) | |
3990 | { | |
b3dacf6b | 3991 | if(TMath::Abs(denominator[c1][c2]) > 1.e-44) |
489d5531 | 3992 | { |
b3dacf6b | 3993 | // Covariances: |
489d5531 | 3994 | Double_t cov = (productOfCorrelations[c1][c2]-correlation[c1]*correlation[c2])/denominator[c1][c2]; |
b3dacf6b | 3995 | // Covariances multiplied with weight dependent prefactor: |
489d5531 | 3996 | Double_t wCov = cov * wPrefactor[c1][c2]; |
3997 | fIntFlowCovariances->SetBinContent(covarianceLabel,wCov); | |
3998 | } | |
3999 | covarianceLabel++; | |
b3dacf6b | 4000 | } // end of for(Int_t c2=c1+1;c2<4;c2++) |
4001 | } // end of for(Int_t c1=0;c1<4;c1++) | |
489d5531 | 4002 | |
b3dacf6b | 4003 | // Versus multiplicity: |
4004 | if(!fCalculateCumulantsVsM){return;} | |
9da1a4f3 | 4005 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) |
4006 | for(Int_t b=1;b<=nBins;b++) | |
4007 | { | |
b3dacf6b | 4008 | // Average 2-, 4-, 6- and 8-particle correlations for all events: |
9da1a4f3 | 4009 | Double_t correlationVsM[4] = {0.}; |
4010 | for(Int_t ci=0;ci<4;ci++) | |
4011 | { | |
4012 | correlationVsM[ci] = fIntFlowCorrelationsVsMPro[ci]->GetBinContent(b); | |
4013 | } // end of for(Int_t ci=0;ci<4;ci++) | |
b3dacf6b | 4014 | // Average products of 2-, 4-, 6- and 8-particle correlations: |
9da1a4f3 | 4015 | Double_t productOfCorrelationsVsM[4][4] = {{0.}}; |
4016 | Int_t productOfCorrelationsLabelVsM = 1; | |
b3dacf6b | 4017 | // Denominators in the expressions for the unbiased estimator for covariance: |
9da1a4f3 | 4018 | Double_t denominatorVsM[4][4] = {{0.}}; |
4019 | Int_t sumOfProductOfEventWeightsLabel1VsM = 1; | |
b3dacf6b | 4020 | // Weight dependent prefactor which multiply unbiased estimators for covariances: |
9da1a4f3 | 4021 | Double_t wPrefactorVsM[4][4] = {{0.}}; |
4022 | Int_t sumOfProductOfEventWeightsLabel2VsM = 1; | |
4023 | for(Int_t c1=0;c1<4;c1++) | |
4024 | { | |
4025 | for(Int_t c2=c1+1;c2<4;c2++) | |
4026 | { | |
4027 | productOfCorrelationsVsM[c1][c2] = fIntFlowProductOfCorrelationsVsMPro[productOfCorrelationsLabelVsM-1]->GetBinContent(b); | |
b3dacf6b | 4028 | if(TMath::Abs(fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b)) > 1.e-44 && TMath::Abs(fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)) > 1.e-44) |
4029 | { | |
4030 | denominatorVsM[c1][c2] = 1.-(fIntFlowSumOfProductOfEventWeightsVsM[sumOfProductOfEventWeightsLabel1VsM-1]->GetBinContent(b)) | |
4031 | / (fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b) | |
4032 | * fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)); | |
4033 | wPrefactorVsM[c1][c2] = fIntFlowSumOfProductOfEventWeightsVsM[sumOfProductOfEventWeightsLabel2VsM-1]->GetBinContent(b) | |
4034 | / (fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b) | |
4035 | * fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)); | |
9da1a4f3 | 4036 | } |
4037 | productOfCorrelationsLabelVsM++; | |
4038 | sumOfProductOfEventWeightsLabel1VsM++; | |
4039 | sumOfProductOfEventWeightsLabel2VsM++; | |
4040 | } // end of for(Int_t c1=0;c1<4;c1++) | |
4041 | } // end of for(Int_t c2=c1+1;c2<4;c2++) | |
b3dacf6b | 4042 | |
9da1a4f3 | 4043 | Int_t covarianceLabelVsM = 1; |
4044 | for(Int_t c1=0;c1<4;c1++) | |
4045 | { | |
4046 | for(Int_t c2=c1+1;c2<4;c2++) | |
4047 | { | |
b3dacf6b | 4048 | if(TMath::Abs(denominatorVsM[c1][c2]) > 1.e-44) |
9da1a4f3 | 4049 | { |
b3dacf6b | 4050 | // Covariances: |
9da1a4f3 | 4051 | Double_t covVsM = (productOfCorrelationsVsM[c1][c2]-correlationVsM[c1]*correlationVsM[c2])/denominatorVsM[c1][c2]; |
b3dacf6b | 4052 | // Covariances multiplied with weight dependent prefactor: |
9da1a4f3 | 4053 | Double_t wCovVsM = covVsM * wPrefactorVsM[c1][c2]; |
4054 | fIntFlowCovariancesVsM[covarianceLabelVsM-1]->SetBinContent(b,wCovVsM); | |
4055 | } | |
4056 | covarianceLabelVsM++; | |
b3dacf6b | 4057 | } // end of for(Int_t c2=c1+1;c2<4;c2++) |
4058 | } // end of for(Int_t c1=0;c1<4;c1++) | |
9da1a4f3 | 4059 | } // end of for(Int_t b=1;b<=nBins;b++) |
4060 | ||
489d5531 | 4061 | } // end of AliFlowAnalysisWithQCumulants::CalculateCovariancesIntFlow() |
4062 | ||
489d5531 | 4063 | //================================================================================================================================ |
4064 | ||
0328db2d | 4065 | void AliFlowAnalysisWithQCumulants::CalculateCovariancesNUAIntFlow() |
4066 | { | |
4067 | // a) Calculate unbiased estimators Cov(*,*) for true covariances V_(*,*) for NUA terms. | |
4068 | // b) Store in histogram fIntFlowCovariancesNUA for instance the following: | |
4069 | // | |
4070 | // Cov(<2>,<cos(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<cos(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<cos(phi)>}_j)] | |
4071 | // | |
4072 | // where N is the number of events, w_{<2>} is event weight for <2> and w_{<cos(phi)>} is event weight for <cos(phi)>. | |
4073 | // c) Binning of fIntFlowCovariancesNUA is organized as follows: | |
4074 | // | |
4075 | // 1st bin: Cov(<2>,<cos(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<cos(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<cos(phi)>}_j)] | |
4076 | // 2nd bin: Cov(<2>,<sin(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<sin(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<sin(phi)>}_j)] | |
4077 | // 3rd bin: Cov(<cos(phi)>,<sin(phi)>) * (sum_{i=1}^{N} w_{<cos(phi)>}_i w_{<sin(phi)>}_i )/[(sum_{i=1}^{N} w_{<cos(phi)>}_i) * (sum_{j=1}^{N} w_{<sin(phi)>}_j)] | |
4078 | // ... | |
4079 | ||
4080 | // Cov(<2>,<cos(phi)>): | |
4081 | Double_t product1 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(1); // <<2><cos(phi)>> | |
4082 | Double_t term1st1 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
4083 | Double_t term2nd1 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi)>> | |
4084 | Double_t sumOfW1st1 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
4085 | Double_t sumOfW2nd1 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi)>} | |
4086 | Double_t sumOfWW1 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(1); // W_{<2>} * W_{<cos(phi)>} | |
4087 | // numerator in the expression for the the unbiased estimator for covariance: | |
4088 | Double_t numerator1 = product1 - term1st1*term2nd1; | |
4089 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4090 | Double_t denominator1 = 0.; |
4091 | if(TMath::Abs(sumOfW1st1*sumOfW2nd1)>0.) | |
4092 | { | |
4093 | denominator1 = 1.-sumOfWW1/(sumOfW1st1*sumOfW2nd1); | |
4094 | if(TMath::Abs(denominator1)>0.) | |
4095 | { | |
4096 | // covariance: | |
4097 | Double_t covariance1 = numerator1/denominator1; | |
4098 | // weight dependent prefactor for covariance: | |
4099 | Double_t wPrefactor1 = sumOfWW1/(sumOfW1st1*sumOfW2nd1); | |
4100 | // finally, store "weighted" covariance: | |
4101 | fIntFlowCovariancesNUA->SetBinContent(1,wPrefactor1*covariance1); | |
4102 | } // end of if(TMath::Abs(denominator)>0.) | |
4103 | } // end of if(TMath::Abs(sumOfW1st1*sumOfW2nd1)>0.) | |
4104 | ||
0328db2d | 4105 | // Cov(<2>,<sin(phi)>): |
4106 | Double_t product2 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(2); // <<2><sin(phi)>> | |
4107 | Double_t term1st2 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
4108 | Double_t term2nd2 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi)>> | |
4109 | Double_t sumOfW1st2 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
4110 | Double_t sumOfW2nd2 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi)>} | |
4111 | Double_t sumOfWW2 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(2); // W_{<2>} * W_{<sin(phi)>} | |
4112 | // numerator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4113 | Double_t numerator2 = product2 - term1st2*term2nd2; |
0328db2d | 4114 | // denominator in the expression for the the unbiased estimator for covariance: |
b92ea2b9 | 4115 | Double_t denominator2 = 0.; |
4116 | if(TMath::Abs(sumOfW1st2*sumOfW2nd2)>0.) | |
4117 | { | |
4118 | denominator2 = 1.-sumOfWW2/(sumOfW1st2*sumOfW2nd2); | |
4119 | if(TMath::Abs(denominator2)>0.) | |
4120 | { | |
4121 | // covariance: | |
4122 | Double_t covariance2 = numerator2/denominator2; | |
4123 | // weight dependent prefactor for covariance: | |
4124 | Double_t wPrefactor2 = sumOfWW2/(sumOfW1st2*sumOfW2nd2); | |
4125 | // finally, store "weighted" covariance: | |
4126 | fIntFlowCovariancesNUA->SetBinContent(2,wPrefactor2*covariance2); | |
4127 | } // end of if(TMath::Abs(denominator2)>0.) | |
4128 | } // end of if(TMath::Abs(sumOfW1st2*sumOfW2nd2)>0.) | |
0328db2d | 4129 | |
4130 | // Cov(<cos(phi)>,<sin(phi)>): | |
4131 | Double_t product3 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(3); // <<cos(phi)><sin(phi)>> | |
4132 | Double_t term1st3 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi)>> | |
4133 | Double_t term2nd3 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi)>> | |
4134 | Double_t sumOfW1st3 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi)>} | |
4135 | Double_t sumOfW2nd3 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi)>} | |
4136 | Double_t sumOfWW3 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(3); // W_{<cos(phi)>} * W_{<sin(phi)>} | |
4137 | // numerator in the expression for the the unbiased estimator for covariance: | |
4138 | Double_t numerator3 = product3 - term1st3*term2nd3; | |
4139 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4140 | Double_t denominator3 = 0; |
4141 | if(TMath::Abs(sumOfW1st3*sumOfW2nd3)>0.) | |
4142 | { | |
4143 | denominator3 = 1.-sumOfWW3/(sumOfW1st3*sumOfW2nd3); | |
4144 | if(TMath::Abs(denominator3)>0.) | |
4145 | { | |
4146 | // covariance: | |
4147 | Double_t covariance3 = numerator3/denominator3; | |
4148 | // weight dependent prefactor for covariance: | |
4149 | Double_t wPrefactor3 = sumOfWW3/(sumOfW1st3*sumOfW2nd3); | |
4150 | // finally, store "weighted" covariance: | |
4151 | fIntFlowCovariancesNUA->SetBinContent(3,wPrefactor3*covariance3); | |
4152 | } // end of if(TMath::Abs(denominator3)>0.) | |
4153 | } // end of if(TMath::Abs(sumOfW1st3*sumOfW2nd3)>0.) | |
0328db2d | 4154 | |
4155 | // Cov(<2>,<cos(phi1+phi2)>): | |
4156 | Double_t product4 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(4); // <<2><cos(phi1+phi2)>> | |
4157 | Double_t term1st4 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
4158 | Double_t term2nd4 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
4159 | Double_t sumOfW1st4 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
4160 | Double_t sumOfW2nd4 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
4161 | Double_t sumOfWW4 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(4); // W_{<2>} * W_{<cos(phi1+phi2)>} | |
4162 | // numerator in the expression for the the unbiased estimator for covariance: | |
4163 | Double_t numerator4 = product4 - term1st4*term2nd4; | |
4164 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4165 | Double_t denominator4 = 0.; |
4166 | if(TMath::Abs(sumOfW1st4*sumOfW2nd4)>0.) | |
4167 | { | |
4168 | denominator4 = 1.-sumOfWW4/(sumOfW1st4*sumOfW2nd4); | |
4169 | if(TMath::Abs(denominator4)>0.) | |
4170 | { | |
4171 | // covariance: | |
4172 | Double_t covariance4 = numerator4/denominator4; | |
4173 | // weight dependent prefactor for covariance: | |
4174 | Double_t wPrefactor4 = sumOfWW4/(sumOfW1st4*sumOfW2nd4); | |
4175 | // finally, store "weighted" covariance: | |
4176 | fIntFlowCovariancesNUA->SetBinContent(4,wPrefactor4*covariance4); | |
4177 | } // end of if(TMath::Abs(denominator4)>0.) | |
4178 | } // end of if(TMath::Abs(sumOfW1st4*sumOfW2nd4)>0.) | |
4179 | ||
0328db2d | 4180 | // Cov(<2>,<sin(phi1+phi2)>): |
4181 | Double_t product5 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(5); // <<2><sin(phi1+phi2)>> | |
4182 | Double_t term1st5 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
4183 | Double_t term2nd5 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4184 | Double_t sumOfW1st5 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
4185 | Double_t sumOfW2nd5 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4186 | Double_t sumOfWW5 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(5); // W_{<2>} * W_{<sin(phi1+phi2)>} | |
4187 | // numerator in the expression for the the unbiased estimator for covariance: | |
4188 | Double_t numerator5 = product5 - term1st5*term2nd5; | |
4189 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4190 | Double_t denominator5 = 0.; |
4191 | if(TMath::Abs(sumOfW1st5*sumOfW2nd5)>0.) | |
4192 | { | |
4193 | denominator5 = 1.-sumOfWW5/(sumOfW1st5*sumOfW2nd5); | |
4194 | if(TMath::Abs(denominator5)>0.) | |
4195 | { | |
4196 | // covariance: | |
4197 | Double_t covariance5 = numerator5/denominator5; | |
4198 | // weight dependent prefactor for covariance: | |
4199 | Double_t wPrefactor5 = sumOfWW5/(sumOfW1st5*sumOfW2nd5); | |
4200 | // finally, store "weighted" covariance: | |
4201 | fIntFlowCovariancesNUA->SetBinContent(5,wPrefactor5*covariance5); | |
4202 | } // end of if(TMath::Abs(denominator5)>0.) | |
4203 | } // end of if(TMath::Abs(sumOfW1st5*sumOfW2nd5)>0.) | |
4204 | ||
0328db2d | 4205 | // Cov(<2>,<cos(phi1-phi2-phi3)>): |
4206 | Double_t product6 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(6); // <<2><cos(phi1-phi2-phi3)>> | |
4207 | Double_t term1st6 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
4208 | Double_t term2nd6 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
4209 | Double_t sumOfW1st6 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
4210 | Double_t sumOfW2nd6 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
4211 | Double_t sumOfWW6 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(6); // W_{<2>} * W_{<cos(phi1-phi2-phi3)>} | |
4212 | // numerator in the expression for the the unbiased estimator for covariance: | |
4213 | Double_t numerator6 = product6 - term1st6*term2nd6; | |
4214 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4215 | Double_t denominator6 = 0.; |
4216 | if(TMath::Abs(sumOfW1st6*sumOfW2nd6)>0.) | |
4217 | { | |
4218 | denominator6 = 1.-sumOfWW6/(sumOfW1st6*sumOfW2nd6); | |
4219 | if(TMath::Abs(denominator6)>0.) | |
4220 | { | |
4221 | // covariance: | |
4222 | Double_t covariance6 = numerator6/denominator6; | |
4223 | // weight dependent prefactor for covariance: | |
4224 | Double_t wPrefactor6 = sumOfWW6/(sumOfW1st6*sumOfW2nd6); | |
4225 | // finally, store "weighted" covariance: | |
4226 | fIntFlowCovariancesNUA->SetBinContent(6,wPrefactor6*covariance6); | |
4227 | } // end of if(TMath::Abs(denominator6)>0.) | |
4228 | } // end of if(TMath::Abs(sumOfW1st6*sumOfW2nd6)>0.) | |
4229 | ||
0328db2d | 4230 | // Cov(<2>,<sin(phi1-phi2-phi3)>): |
4231 | Double_t product7 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(7); // <<2><sin(phi1-phi2-phi3)>> | |
4232 | Double_t term1st7 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
4233 | Double_t term2nd7 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
4234 | Double_t sumOfW1st7 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
4235 | Double_t sumOfW2nd7 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
4236 | Double_t sumOfWW7 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(7); // W_{<2>} * W_{<sin(phi1-phi2-phi3)>} | |
4237 | // numerator in the expression for the the unbiased estimator for covariance: | |
4238 | Double_t numerator7 = product7 - term1st7*term2nd7; | |
4239 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4240 | Double_t denominator7 = 0.; |
4241 | if(TMath::Abs(sumOfW1st7*sumOfW2nd7)>0.) | |
4242 | { | |
4243 | denominator7 = 1.-sumOfWW7/(sumOfW1st7*sumOfW2nd7); | |
4244 | if(TMath::Abs(denominator7)>0.) | |
4245 | { | |
4246 | // covariance: | |
4247 | Double_t covariance7 = numerator7/denominator7; | |
4248 | // weight dependent prefactor for covariance: | |
4249 | Double_t wPrefactor7 = sumOfWW7/(sumOfW1st7*sumOfW2nd7); | |
4250 | // finally, store "weighted" covariance: | |
4251 | fIntFlowCovariancesNUA->SetBinContent(7,wPrefactor7*covariance7); | |
4252 | } // end of if(TMath::Abs(denominator7)>0.) | |
4253 | } // end of if(TMath::Abs(sumOfW1st7*sumOfW2nd7)>0.) | |
4254 | ||
0328db2d | 4255 | // Cov(<4>,<cos(phi1>): |
4256 | Double_t product8 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(8); // <<4><cos(phi1)>> | |
4257 | Double_t term1st8 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
4258 | Double_t term2nd8 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
4259 | Double_t sumOfW1st8 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
4260 | Double_t sumOfW2nd8 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
4261 | Double_t sumOfWW8 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(8); // W_{<4>} * W_{<cos(phi1)>} | |
4262 | // numerator in the expression for the the unbiased estimator for covariance: | |
4263 | Double_t numerator8 = product8 - term1st8*term2nd8; | |
4264 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4265 | Double_t denominator8 = 0.; |
4266 | if(TMath::Abs(sumOfW1st8*sumOfW2nd8)>0.) | |
4267 | { | |
4268 | denominator8 = 1.-sumOfWW8/(sumOfW1st8*sumOfW2nd8); | |
4269 | if(TMath::Abs(denominator8)>0.) | |
4270 | { | |
4271 | // covariance: | |
4272 | Double_t covariance8 = numerator8/denominator8; | |
4273 | // weight dependent prefactor for covariance: | |
4274 | Double_t wPrefactor8 = sumOfWW8/(sumOfW1st8*sumOfW2nd8); | |
4275 | // finally, store "weighted" covariance: | |
4276 | fIntFlowCovariancesNUA->SetBinContent(8,wPrefactor8*covariance8); | |
4277 | } // end of if(TMath::Abs(denominator8)>0.) | |
4278 | } // end of if(TMath::Abs(sumOfW1st8*sumOfW2nd8)>0.) | |
4279 | ||
0328db2d | 4280 | // Cov(<4>,<sin(phi1)>): |
4281 | Double_t product9 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(9); // <<4><sin(phi1)>> | |
4282 | Double_t term1st9 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
4283 | Double_t term2nd9 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
4284 | Double_t sumOfW1st9 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
4285 | Double_t sumOfW2nd9 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
4286 | Double_t sumOfWW9 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(9); // W_{<4>} * W_{<sin(phi1)>} | |
4287 | // numerator in the expression for the the unbiased estimator for covariance: | |
4288 | Double_t numerator9 = product9 - term1st9*term2nd9; | |
4289 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4290 | Double_t denominator9 = 0.; |
4291 | if(TMath::Abs(sumOfW1st9*sumOfW2nd9)>0.) | |
4292 | { | |
4293 | denominator9 = 1.-sumOfWW9/(sumOfW1st9*sumOfW2nd9); | |
4294 | if(TMath::Abs(denominator9)>0.) | |
4295 | { | |
4296 | // covariance: | |
4297 | Double_t covariance9 = numerator9/denominator9; | |
4298 | // weight dependent prefactor for covariance: | |
4299 | Double_t wPrefactor9 = sumOfWW9/(sumOfW1st9*sumOfW2nd9); | |
4300 | // finally, store "weighted" covariance: | |
4301 | fIntFlowCovariancesNUA->SetBinContent(9,wPrefactor9*covariance9); | |
4302 | } | |
4303 | } // end of if(TMath::Abs(sumOfW1st9*sumOfW2nd9)>0.) | |
4304 | ||
0328db2d | 4305 | // Cov(<4>,<cos(phi1+phi2)>): |
4306 | Double_t product10 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(10); // <<4><cos(phi1+phi2)>> | |
4307 | Double_t term1st10 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
4308 | Double_t term2nd10 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
4309 | Double_t sumOfW1st10 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
4310 | Double_t sumOfW2nd10 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
4311 | Double_t sumOfWW10 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(10); // W_{<4>} * W_{<cos(phi1+phi2)>} | |
4312 | // numerator in the expression for the the unbiased estimator for covariance: | |
4313 | Double_t numerator10 = product10 - term1st10*term2nd10; | |
4314 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4315 | Double_t denominator10 = 0.; |
4316 | if(TMath::Abs(sumOfW1st10*sumOfW2nd10)>0.) | |
4317 | { | |
4318 | denominator10 = 1.-sumOfWW10/(sumOfW1st10*sumOfW2nd10); | |
4319 | if(TMath::Abs(denominator10)>0.) | |
4320 | { | |
4321 | // covariance: | |
4322 | Double_t covariance10 = numerator10/denominator10; | |
4323 | // weight dependent prefactor for covariance: | |
4324 | Double_t wPrefactor10 = sumOfWW10/(sumOfW1st10*sumOfW2nd10); | |
4325 | // finally, store "weighted" covariance: | |
4326 | fIntFlowCovariancesNUA->SetBinContent(10,wPrefactor10*covariance10); | |
4327 | } // end of if(TMath::Abs(denominator10)>0.) | |
4328 | } // end of if(TMath::Abs(sumOfW1st10*sumOfW2nd10)>0.) | |
4329 | ||
0328db2d | 4330 | // Cov(<4>,<sin(phi1+phi2)>): |
4331 | Double_t product11 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(11); // <<4><sin(phi1+phi2)>> | |
4332 | Double_t term1st11 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
4333 | Double_t term2nd11 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4334 | Double_t sumOfW1st11 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
4335 | Double_t sumOfW2nd11 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4336 | Double_t sumOfWW11 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(11); // W_{<4>} * W_{<sin(phi1+phi2)>} | |
4337 | // numerator in the expression for the the unbiased estimator for covariance: | |
4338 | Double_t numerator11 = product11 - term1st11*term2nd11; | |
4339 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4340 | Double_t denominator11 = 0.; |
4341 | if(TMath::Abs(sumOfW1st11*sumOfW2nd11)>0.) | |
4342 | { | |
4343 | denominator11 = 1.-sumOfWW11/(sumOfW1st11*sumOfW2nd11); | |
4344 | if(TMath::Abs(denominator11)>0.) | |
4345 | { | |
4346 | // covariance: | |
4347 | Double_t covariance11 = numerator11/denominator11; | |
4348 | // weight dependent prefactor for covariance: | |
4349 | Double_t wPrefactor11 = sumOfWW11/(sumOfW1st11*sumOfW2nd11); | |
4350 | // finally, store "weighted" covariance: | |
4351 | fIntFlowCovariancesNUA->SetBinContent(11,wPrefactor11*covariance11); | |
4352 | } // end of if(TMath::Abs(denominator11)>0.) | |
4353 | } // end of if(TMath::Abs(sumOfW1st11*sumOfW2nd11)>0.) | |
0328db2d | 4354 | |
4355 | // Cov(<4>,<cos(phi1-phi2-phi3)>): | |
4356 | Double_t product12 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(12); // <<4><cos(phi1-phi2-phi3)>> | |
4357 | Double_t term1st12 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
4358 | Double_t term2nd12 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
4359 | Double_t sumOfW1st12 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
4360 | Double_t sumOfW2nd12 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
4361 | Double_t sumOfWW12 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(12); // W_{<4>} * W_{<cos(phi1-phi2-phi3)>} | |
4362 | // numerator in the expression for the the unbiased estimator for covariance: | |
4363 | Double_t numerator12 = product12 - term1st12*term2nd12; | |
4364 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4365 | Double_t denominator12 = 0.; |
4366 | if(TMath::Abs(sumOfW1st12*sumOfW2nd12)>0.) | |
4367 | { | |
4368 | denominator12 = 1.-sumOfWW12/(sumOfW1st12*sumOfW2nd12); | |
4369 | if(TMath::Abs(denominator12)>0.) | |
4370 | { | |
4371 | // covariance: | |
4372 | Double_t covariance12 = numerator12/denominator12; | |
4373 | // weight dependent prefactor for covariance: | |
4374 | Double_t wPrefactor12 = sumOfWW12/(sumOfW1st12*sumOfW2nd12); | |
4375 | // finally, store "weighted" covariance: | |
4376 | fIntFlowCovariancesNUA->SetBinContent(12,wPrefactor12*covariance12); | |
4377 | } // end of if(TMath::Abs(denominator12)>0.) | |
4378 | } // end of if(TMath::Abs(sumOfW1st12*sumOfW2nd12)>0.) | |
0328db2d | 4379 | |
4380 | // Cov(<4>,<sin(phi1-phi2-phi3)>): | |
4381 | Double_t product13 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(13); // <<4><sin(phi1-phi2-phi3)>> | |
4382 | Double_t term1st13 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
4383 | Double_t term2nd13 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
4384 | Double_t sumOfW1st13 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
4385 | Double_t sumOfW2nd13 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
4386 | Double_t sumOfWW13 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(13); // W_{<4>} * W_{<sin(phi1-phi2-phi3)>} | |
4387 | // numerator in the expression for the the unbiased estimator for covariance: | |
4388 | Double_t numerator13 = product13 - term1st13*term2nd13; | |
4389 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4390 | Double_t denominator13 = 0.; |
4391 | if(TMath::Abs(sumOfW1st13*sumOfW2nd13)>0.) | |
4392 | { | |
4393 | denominator13 = 1.-sumOfWW13/(sumOfW1st13*sumOfW2nd13); | |
4394 | if(TMath::Abs(denominator13)>0.) | |
4395 | { | |
4396 | // covariance: | |
4397 | Double_t covariance13 = numerator13/denominator13; | |
4398 | // weight dependent prefactor for covariance: | |
4399 | Double_t wPrefactor13 = sumOfWW13/(sumOfW1st13*sumOfW2nd13); | |
4400 | // finally, store "weighted" covariance: | |
4401 | fIntFlowCovariancesNUA->SetBinContent(13,wPrefactor13*covariance13); | |
4402 | } // end of if(TMath::Abs(denominator13)>0.) | |
4403 | } // end of if(TMath::Abs(sumOfW1st13*sumOfW2nd13)>0.) | |
0328db2d | 4404 | |
4405 | // Cov(<cos(phi1)>,<cos(phi1+phi2)>): | |
4406 | Double_t product14 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(14); // <<cos(phi1)><cos(phi1+phi2)>> | |
4407 | Double_t term1st14 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
4408 | Double_t term2nd14 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
4409 | Double_t sumOfW1st14 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
4410 | Double_t sumOfW2nd14 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
4411 | Double_t sumOfWW14 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(14); // W_{<cos(phi1)>} * W_{<cos(phi1+phi2)>} | |
4412 | // numerator in the expression for the the unbiased estimator for covariance: | |
4413 | Double_t numerator14 = product14 - term1st14*term2nd14; | |
4414 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4415 | Double_t denominator14 = 0.; |
4416 | if(TMath::Abs(sumOfW1st14*sumOfW2nd14)>0.) | |
4417 | { | |
4418 | denominator14 = 1.-sumOfWW14/(sumOfW1st14*sumOfW2nd14); | |
4419 | if(TMath::Abs(denominator14)>0.) | |
4420 | { | |
4421 | // covariance: | |
4422 | Double_t covariance14 = numerator14/denominator14; | |
4423 | // weight dependent prefactor for covariance: | |
4424 | Double_t wPrefactor14 = sumOfWW14/(sumOfW1st14*sumOfW2nd14); | |
4425 | // finally, store "weighted" covariance: | |
4426 | fIntFlowCovariancesNUA->SetBinContent(14,wPrefactor14*covariance14); | |
4427 | } // end of if(TMath::Abs(denominator14)>0.) | |
4428 | } // end of if(TMath::Abs(sumOfW1st14*sumOfW2nd14)>0.) | |
0328db2d | 4429 | |
4430 | // Cov(<cos(phi1)>,<sin(phi1+phi2)>): | |
4431 | Double_t product15 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(15); // <<cos(phi1)><sin(phi1+phi2)>> | |
4432 | Double_t term1st15 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
4433 | Double_t term2nd15 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4434 | Double_t sumOfW1st15 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
4435 | Double_t sumOfW2nd15 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4436 | Double_t sumOfWW15 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(15); // W_{<cos(phi1)>} * W_{<sin(phi1+phi2)>} | |
4437 | // numerator in the expression for the the unbiased estimator for covariance: | |
4438 | Double_t numerator15 = product15 - term1st15*term2nd15; | |
4439 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4440 | Double_t denominator15 = 0.; |
4441 | if(TMath::Abs(sumOfW1st15*sumOfW2nd15)>0.) | |
4442 | { | |
4443 | denominator15 = 1.-sumOfWW15/(sumOfW1st15*sumOfW2nd15); | |
4444 | if(TMath::Abs(denominator15)>0.) | |
4445 | { | |
4446 | // covariance: | |
4447 | Double_t covariance15 = numerator15/denominator15; | |
4448 | // weight dependent prefactor for covariance: | |
4449 | Double_t wPrefactor15 = sumOfWW15/(sumOfW1st15*sumOfW2nd15); | |
4450 | // finally, store "weighted" covariance: | |
4451 | fIntFlowCovariancesNUA->SetBinContent(15,wPrefactor15*covariance15); | |
4452 | } // end of if(TMath::Abs(denominator15)>0.) | |
4453 | } // end of if(TMath::Abs(sumOfW1st15*sumOfW2nd15)>0.) | |
4454 | ||
0328db2d | 4455 | // Cov(<cos(phi1)>,<cos(phi1-phi2-phi3)>): |
4456 | Double_t product16 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(16); // <<cos(phi1)><cos(phi1-phi2-phi3)>> | |
4457 | Double_t term1st16 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
4458 | Double_t term2nd16 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
4459 | Double_t sumOfW1st16 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
4460 | Double_t sumOfW2nd16 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
4461 | Double_t sumOfWW16 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(16); // W_{<cos(phi1)>} * W_{<cos(phi1-phi2-phi3)>} | |
4462 | // numerator in the expression for the the unbiased estimator for covariance: | |
4463 | Double_t numerator16 = product16 - term1st16*term2nd16; | |
4464 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4465 | Double_t denominator16 = 0.; |
4466 | if(TMath::Abs(sumOfW1st16*sumOfW2nd16)>0.) | |
4467 | { | |
4468 | denominator16 = 1.-sumOfWW16/(sumOfW1st16*sumOfW2nd16); | |
4469 | if(TMath::Abs(denominator16)>0.) | |
4470 | { | |
4471 | // covariance: | |
4472 | Double_t covariance16 = numerator16/denominator16; | |
4473 | // weight dependent prefactor for covariance: | |
4474 | Double_t wPrefactor16 = sumOfWW16/(sumOfW1st16*sumOfW2nd16); | |
4475 | // finally, store "weighted" covariance: | |
4476 | fIntFlowCovariancesNUA->SetBinContent(16,wPrefactor16*covariance16); | |
4477 | } // end of if(TMath::Abs(denominator16)>0.) | |
4478 | } // end ofif(TMath::Abs(sumOfW1st16*sumOfW2nd16)>0.) | |
4479 | ||
0328db2d | 4480 | // Cov(<cos(phi1)>,<sin(phi1-phi2-phi3)>): |
4481 | Double_t product17 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(17); // <<cos(phi1)><sin(phi1-phi2-phi3)>> | |
4482 | Double_t term1st17 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
4483 | Double_t term2nd17 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
4484 | Double_t sumOfW1st17 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
4485 | Double_t sumOfW2nd17 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
4486 | Double_t sumOfWW17 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(17); // W_{<cos(phi1)>} * W_{<sin(phi1-phi2-phi3)>} | |
4487 | // numerator in the expression for the the unbiased estimator for covariance: | |
4488 | Double_t numerator17 = product17 - term1st17*term2nd17; | |
4489 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4490 | Double_t denominator17 = 0.; |
4491 | if(TMath::Abs(sumOfW1st17*sumOfW2nd17)>0.) | |
4492 | { | |
4493 | denominator17 = 1.-sumOfWW17/(sumOfW1st17*sumOfW2nd17); | |
4494 | if(TMath::Abs(denominator17)>0.) | |
4495 | { | |
4496 | // covariance: | |
4497 | Double_t covariance17 = numerator17/denominator17; | |
4498 | // weight dependent prefactor for covariance: | |
4499 | Double_t wPrefactor17 = sumOfWW17/(sumOfW1st17*sumOfW2nd17); | |
4500 | // finally, store "weighted" covariance: | |
4501 | fIntFlowCovariancesNUA->SetBinContent(17,wPrefactor17*covariance17); | |
4502 | } // end of if(TMath::Abs(denominator17)>0.) | |
4503 | } // end of if(TMath::Abs(sumOfW1st17*sumOfW2nd17)>0.) | |
0328db2d | 4504 | |
4505 | // Cov(<sin(phi1)>,<cos(phi1+phi2)>): | |
4506 | Double_t product18 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(18); // <<sin(phi1)><cos(phi1+phi2)>> | |
4507 | Double_t term1st18 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
4508 | Double_t term2nd18 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
4509 | Double_t sumOfW1st18 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
4510 | Double_t sumOfW2nd18 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
4511 | Double_t sumOfWW18 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(18); // W_{<sin(phi1)>} * W_{<cos(phi1+phi2)>} | |
4512 | // numerator in the expression for the the unbiased estimator for covariance: | |
4513 | Double_t numerator18 = product18 - term1st18*term2nd18; | |
4514 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4515 | Double_t denominator18 = 0.; |
4516 | if(TMath::Abs(sumOfW1st18*sumOfW2nd18)>0.) | |
4517 | { | |
4518 | denominator18 = 1.-sumOfWW18/(sumOfW1st18*sumOfW2nd18); | |
4519 | if(TMath::Abs(denominator18)>0.) | |
4520 | { | |
4521 | // covariance: | |
4522 | Double_t covariance18 = numerator18/denominator18; | |
4523 | // weight dependent prefactor for covariance: | |
4524 | Double_t wPrefactor18 = sumOfWW18/(sumOfW1st18*sumOfW2nd18); | |
4525 | // finally, store "weighted" covariance: | |
4526 | fIntFlowCovariancesNUA->SetBinContent(18,wPrefactor18*covariance18); | |
4527 | } // end of if(TMath::Abs(denominator18)>0.) | |
4528 | } // end of if(TMath::Abs(sumOfW1st18*sumOfW2nd18)>0.) | |
0328db2d | 4529 | |
4530 | // Cov(<sin(phi1)>,<sin(phi1+phi2)>): | |
4531 | Double_t product19 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(19); // <<sin(phi1)><sin(phi1+phi2)>> | |
4532 | Double_t term1st19 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
4533 | Double_t term2nd19 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4534 | Double_t sumOfW1st19 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
4535 | Double_t sumOfW2nd19 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4536 | Double_t sumOfWW19 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(19); // W_{<sin(phi1)>} * W_{<sin(phi1+phi2)>} | |
4537 | // numerator in the expression for the the unbiased estimator for covariance: | |
4538 | Double_t numerator19 = product19 - term1st19*term2nd19; | |
4539 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4540 | Double_t denominator19 = 0.; |
4541 | if(TMath::Abs(sumOfW1st19*sumOfW2nd19)>0.) | |
4542 | { | |
4543 | denominator19 = 1.-sumOfWW19/(sumOfW1st19*sumOfW2nd19); | |
4544 | if(TMath::Abs(denominator19)>0.) | |
4545 | { | |
4546 | // covariance: | |
4547 | Double_t covariance19 = numerator19/denominator19; | |
4548 | // weight dependent prefactor for covariance: | |
4549 | Double_t wPrefactor19 = sumOfWW19/(sumOfW1st19*sumOfW2nd19); | |
4550 | // finally, store "weighted" covariance: | |
4551 | fIntFlowCovariancesNUA->SetBinContent(19,wPrefactor19*covariance19); | |
4552 | } // end of if(TMath::Abs(denominator19)>0.) | |
4553 | } // end of if(TMath::Abs(sumOfW1st19*sumOfW2nd19)>0.) | |
4554 | ||
0328db2d | 4555 | // Cov(<sin(phi1)>,<cos(phi1-phi2-phi3)>): |
4556 | Double_t product20 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(20); // <<sin(phi1)><cos(phi1-phi2-phi3)>> | |
4557 | Double_t term1st20 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
4558 | Double_t term2nd20 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
4559 | Double_t sumOfW1st20 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
4560 | Double_t sumOfW2nd20 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
4561 | Double_t sumOfWW20 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(20); // W_{<sin(phi1)>} * W_{<cos(phi1-phi2-phi3)>} | |
4562 | // numerator in the expression for the the unbiased estimator for covariance: | |
4563 | Double_t numerator20 = product20 - term1st20*term2nd20; | |
4564 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4565 | Double_t denominator20 = 0.; |
4566 | if(TMath::Abs(sumOfW1st20*sumOfW2nd20)>0.) | |
4567 | { | |
4568 | denominator20 = 1.-sumOfWW20/(sumOfW1st20*sumOfW2nd20); | |
4569 | if(TMath::Abs(denominator20)>0.) | |
4570 | { | |
4571 | // covariance: | |
4572 | Double_t covariance20 = numerator20/denominator20; | |
4573 | // weight dependent prefactor for covariance: | |
4574 | Double_t wPrefactor20 = sumOfWW20/(sumOfW1st20*sumOfW2nd20); | |
4575 | // finally, store "weighted" covariance: | |
4576 | fIntFlowCovariancesNUA->SetBinContent(20,wPrefactor20*covariance20); | |
4577 | } // end of if(TMath::Abs(denominator20)>0.) | |
4578 | } // end of if(TMath::Abs(sumOfW1st20*sumOfW2nd20)>0.) | |
0328db2d | 4579 | |
4580 | // Cov(<sin(phi1)>,<sin(phi1-phi2-phi3)>): | |
4581 | Double_t product21 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(21); // <<sin(phi1)><sin(phi1-phi2-phi3)>> | |
4582 | Double_t term1st21 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
4583 | Double_t term2nd21 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
4584 | Double_t sumOfW1st21 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
4585 | Double_t sumOfW2nd21 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
4586 | Double_t sumOfWW21 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(21); // W_{<sin(phi1)>} * W_{<sin(phi1-phi2-phi3)>} | |
4587 | // numerator in the expression for the the unbiased estimator for covariance: | |
4588 | Double_t numerator21 = product21 - term1st21*term2nd21; | |
4589 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4590 | Double_t denominator21 = 0.; |
4591 | if(TMath::Abs(sumOfW1st21*sumOfW2nd21)>0.) | |
4592 | { | |
4593 | denominator21 = 1.-sumOfWW21/(sumOfW1st21*sumOfW2nd21); | |
4594 | if(TMath::Abs(denominator21)>0.) | |
4595 | { | |
4596 | // covariance: | |
4597 | Double_t covariance21 = numerator21/denominator21; | |
4598 | // weight dependent prefactor for covariance: | |
4599 | Double_t wPrefactor21 = sumOfWW21/(sumOfW1st21*sumOfW2nd21); | |
4600 | // finally, store "weighted" covariance: | |
4601 | fIntFlowCovariancesNUA->SetBinContent(21,wPrefactor21*covariance21); | |
4602 | } // end of if(TMath::Abs(denominator21)>0.) | |
4603 | } // end of if(TMath::Abs(sumOfW1st21*sumOfW2nd21)>0.) | |
0328db2d | 4604 | |
4605 | // Cov(<cos(phi1+phi2)>,<sin(phi1+phi2)>): | |
4606 | Double_t product22 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(22); // <<cos(phi1+phi2)><sin(phi1+phi2)>> | |
4607 | Double_t term1st22 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
4608 | Double_t term2nd22 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4609 | Double_t sumOfW1st22 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
4610 | Double_t sumOfW2nd22 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4611 | Double_t sumOfWW22 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(22); // W_{<cos(phi1+phi2)>} * W_{<sin(phi1+phi2)>} | |
4612 | // numerator in the expression for the the unbiased estimator for covariance: | |
4613 | Double_t numerator22 = product22 - term1st22*term2nd22; | |
4614 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4615 | Double_t denominator22 = 0.; |
4616 | if(TMath::Abs(sumOfW1st22*sumOfW2nd22)>0.) | |
4617 | { | |
4618 | denominator22 = 1.-sumOfWW22/(sumOfW1st22*sumOfW2nd22); | |
4619 | if(TMath::Abs(denominator22)>0.) | |
4620 | { | |
4621 | // covariance: | |
4622 | Double_t covariance22 = numerator22/denominator22; | |
4623 | // weight dependent prefactor for covariance: | |
4624 | Double_t wPrefactor22 = sumOfWW22/(sumOfW1st22*sumOfW2nd22); | |
4625 | // finally, store "weighted" covariance: | |
4626 | fIntFlowCovariancesNUA->SetBinContent(22,wPrefactor22*covariance22); | |
4627 | } // end of if(TMath::Abs(denominator22)>0.) | |
4628 | } // end of if(TMath::Abs(sumOfW1st22*sumOfW2nd22)>0.) | |
0328db2d | 4629 | |
4630 | // Cov(<cos(phi1+phi2)>,<cos(phi1-phi2-phi3)>): | |
4631 | Double_t product23 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(23); // <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
4632 | Double_t term1st23 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
4633 | Double_t term2nd23 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
4634 | Double_t sumOfW1st23 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
4635 | Double_t sumOfW2nd23 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
4636 | Double_t sumOfWW23 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(23); // W_{<cos(phi1+phi2)>} * W_{<cos(phi1-phi2-phi3)>} | |
4637 | // numerator in the expression for the the unbiased estimator for covariance: | |
4638 | Double_t numerator23 = product23 - term1st23*term2nd23; | |
4639 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4640 | Double_t denominator23 = 0.; |
4641 | if(TMath::Abs(sumOfW1st23*sumOfW2nd23)>0.) | |
4642 | { | |
4643 | denominator23 = 1.-sumOfWW23/(sumOfW1st23*sumOfW2nd23); | |
4644 | if(TMath::Abs(denominator23)>0.) | |
4645 | { | |
4646 | // covariance: | |
4647 | Double_t covariance23 = numerator23/denominator23; | |
4648 | // weight dependent prefactor for covariance: | |
4649 | Double_t wPrefactor23 = sumOfWW23/(sumOfW1st23*sumOfW2nd23); | |
4650 | // finally, store "weighted" covariance: | |
4651 | fIntFlowCovariancesNUA->SetBinContent(23,wPrefactor23*covariance23); | |
4652 | } // end of if(TMath::Abs(denominator23)>0.) | |
4653 | } // end of if(TMath::Abs(sumOfW1st23*sumOfW2nd23)>0.) | |
4654 | ||
0328db2d | 4655 | // Cov(<cos(phi1+phi2)>,<sin(phi1-phi2-phi3)>): |
4656 | Double_t product24 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(24); // <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
4657 | Double_t term1st24 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
4658 | Double_t term2nd24 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
4659 | Double_t sumOfW1st24 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
4660 | Double_t sumOfW2nd24 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
4661 | Double_t sumOfWW24 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(24); // W_{<cos(phi1+phi2)>} * W_{<sin(phi1-phi2-phi3)>} | |
4662 | // numerator in the expression for the the unbiased estimator for covariance: | |
4663 | Double_t numerator24 = product24 - term1st24*term2nd24; | |
4664 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4665 | Double_t denominator24 = 0.; |
4666 | if(TMath::Abs(sumOfW1st24*sumOfW2nd24)>0.) | |
4667 | { | |
4668 | denominator24 = 1.-sumOfWW24/(sumOfW1st24*sumOfW2nd24); | |
4669 | if(TMath::Abs(denominator24)>0.) | |
4670 | { | |
4671 | // covariance: | |
4672 | Double_t covariance24 = numerator24/denominator24; | |
4673 | // weight dependent prefactor for covariance: | |
4674 | Double_t wPrefactor24 = sumOfWW24/(sumOfW1st24*sumOfW2nd24); | |
4675 | // finally, store "weighted" covariance: | |
4676 | fIntFlowCovariancesNUA->SetBinContent(24,wPrefactor24*covariance24); | |
4677 | } // end of if(TMath::Abs(denominator24)>0.) | |
4678 | } // end of if(TMath::Abs(sumOfW1st24*sumOfW2nd24)>0.) | |
0328db2d | 4679 | |
4680 | // Cov(<sin(phi1+phi2)>,<cos(phi1-phi2-phi3)>): | |
4681 | Double_t product25 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(25); // <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
4682 | Double_t term1st25 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4683 | Double_t term2nd25 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
4684 | Double_t sumOfW1st25 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4685 | Double_t sumOfW2nd25 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
4686 | Double_t sumOfWW25 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(25); // W_{<sin(phi1+phi2)>} * W_{<cos(phi1-phi2-phi3)>} | |
4687 | // numerator in the expression for the the unbiased estimator for covariance: | |
4688 | Double_t numerator25 = product25 - term1st25*term2nd25; | |
4689 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4690 | Double_t denominator25 = 0.; |
4691 | if(TMath::Abs(sumOfW1st25*sumOfW2nd25)>0.) | |
4692 | { | |
4693 | denominator25 = 1.-sumOfWW25/(sumOfW1st25*sumOfW2nd25); | |
4694 | if(TMath::Abs(denominator25)>0.) | |
4695 | { | |
4696 | // covariance: | |
4697 | Double_t covariance25 = numerator25/denominator25; | |
4698 | // weight dependent prefactor for covariance: | |
4699 | Double_t wPrefactor25 = sumOfWW25/(sumOfW1st25*sumOfW2nd25); | |
4700 | // finally, store "weighted" covariance: | |
4701 | fIntFlowCovariancesNUA->SetBinContent(25,wPrefactor25*covariance25); | |
4702 | } // end of if(TMath::Abs(denominator25)>0.) | |
4703 | } // end of if(TMath::Abs(sumOfW1st25*sumOfW2nd25)>0.) | |
4704 | ||
0328db2d | 4705 | // Cov(<sin(phi1+phi2)>,<sin(phi1-phi2-phi3)>): |
4706 | Double_t product26 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(26); // <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
4707 | Double_t term1st26 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4708 | Double_t term2nd26 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
4709 | Double_t sumOfW1st26 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4710 | Double_t sumOfW2nd26 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
4711 | Double_t sumOfWW26 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(26); // W_{<sin(phi1+phi2)>} * W_{<sin(phi1-phi2-phi3)>} | |
4712 | // numerator in the expression for the the unbiased estimator for covariance: | |
4713 | Double_t numerator26 = product26 - term1st26*term2nd26; | |
4714 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4715 | Double_t denominator26 = 0.; |
4716 | if(TMath::Abs(sumOfW1st26*sumOfW2nd26)>0.) | |
4717 | { | |
4718 | denominator26 = 1.-sumOfWW26/(sumOfW1st26*sumOfW2nd26); | |
4719 | if(TMath::Abs(denominator26)>0.) | |
4720 | { | |
4721 | // covariance: | |
4722 | Double_t covariance26 = numerator26/denominator26; | |
4723 | // weight dependent prefactor for covariance: | |
4724 | Double_t wPrefactor26 = sumOfWW26/(sumOfW1st26*sumOfW2nd26); | |
4725 | // finally, store "weighted" covariance: | |
4726 | fIntFlowCovariancesNUA->SetBinContent(26,wPrefactor26*covariance26); | |
4727 | } // end of if(TMath::Abs(denominator26)>0.) | |
4728 | } // end of if(TMath::Abs(sumOfW1st26*sumOfW2nd26)>0.) | |
4729 | ||
0328db2d | 4730 | // Cov(<cos(phi1-phi2-phi3)>,<sin(phi1-phi2-phi3)>): |
4731 | Double_t product27 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(27); // <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>> | |
b92ea2b9 | 4732 | Double_t term1st27 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> |
0328db2d | 4733 | Double_t term2nd27 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> |
b92ea2b9 | 4734 | Double_t sumOfW1st27 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} |
0328db2d | 4735 | Double_t sumOfW2nd27 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} |
4736 | Double_t sumOfWW27 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(27); // W_{<cos(phi1-phi2-phi3)>} * W_{<sin(phi1-phi2-phi3)>} | |
4737 | // numerator in the expression for the the unbiased estimator for covariance: | |
4738 | Double_t numerator27 = product27 - term1st27*term2nd27; | |
4739 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4740 | Double_t denominator27 = 0.; |
4741 | if(TMath::Abs(sumOfW1st27*sumOfW2nd27)>0.) | |
4742 | { | |
4743 | denominator27 = 1.-sumOfWW27/(sumOfW1st27*sumOfW2nd27); | |
4744 | if(TMath::Abs(denominator27)>0.) | |
4745 | { | |
4746 | // covariance: | |
4747 | Double_t covariance27 = numerator27/denominator27; | |
4748 | // weight dependent prefactor for covariance: | |
4749 | Double_t wPrefactor27 = sumOfWW27/(sumOfW1st27*sumOfW2nd27); | |
4750 | // finally, store "weighted" covariance: | |
4751 | fIntFlowCovariancesNUA->SetBinContent(27,wPrefactor27*covariance27); | |
4752 | } // end of if(TMath::Abs(denominator27)>0.) | |
4753 | } // end of if(TMath::Abs(sumOfW1st27*sumOfW2nd27)>0.) | |
4754 | ||
0328db2d | 4755 | } // end of AliFlowAnalysisWithQCumulants::CalculateCovariancesNUAIntFlow() |
4756 | ||
0328db2d | 4757 | //================================================================================================================================ |
4758 | ||
489d5531 | 4759 | void AliFlowAnalysisWithQCumulants::FinalizeCorrelationsIntFlow() |
4760 | { | |
4761 | // From profile fIntFlowCorrelationsPro access measured correlations and spread, | |
4762 | // correctly calculate the statistical errors and store the final results and | |
4763 | // statistical errors for correlations in histogram fIntFlowCorrelationsHist. | |
4764 | // | |
4765 | // Remark: Statistical error of correlation is calculated as: | |
4766 | // | |
4767 | // statistical error = termA * spread * termB: | |
4768 | // termA = sqrt{sum_{i=1}^{N} w^2}/(sum_{i=1}^{N} w) | |
4769 | // termB = 1/sqrt(1-termA^2) | |
b3dacf6b | 4770 | // |
4771 | ||
489d5531 | 4772 | for(Int_t ci=1;ci<=4;ci++) // correlation index |
4773 | { | |
b40a910e | 4774 | if(fIntFlowCorrelationsPro->GetBinEffectiveEntries(ci) < 2 || fIntFlowSquaredCorrelationsPro->GetBinEffectiveEntries(ci) < 2) |
4775 | { | |
4776 | fIntFlowCorrelationsPro->SetBinError(ci,0.); | |
4777 | fIntFlowSquaredCorrelationsPro->SetBinError(ci,0.); | |
4778 | continue; | |
4779 | } | |
489d5531 | 4780 | Double_t correlation = fIntFlowCorrelationsPro->GetBinContent(ci); |
b40a910e | 4781 | Double_t squaredCorrelation = fIntFlowSquaredCorrelationsPro->GetBinContent(ci); |
4782 | Double_t spread = 0.; | |
4783 | if(squaredCorrelation-correlation*correlation >= 0.) | |
4784 | { | |
4785 | spread = pow(squaredCorrelation-correlation*correlation,0.5); | |
4786 | } else | |
4787 | { | |
4788 | cout<<endl; | |
4789 | cout<<Form(" WARNING: Imaginary 'spread' for %d-particle correlation!!!! ",2*ci)<<endl; | |
4790 | cout<<endl; | |
4791 | } | |
489d5531 | 4792 | Double_t sumOfLinearEventWeights = fIntFlowSumOfEventWeights[0]->GetBinContent(ci); |
4793 | Double_t sumOfQuadraticEventWeights = fIntFlowSumOfEventWeights[1]->GetBinContent(ci); | |
4794 | Double_t termA = 0.; | |
4795 | Double_t termB = 0.; | |
b3dacf6b | 4796 | if(TMath::Abs(sumOfLinearEventWeights) > 0.) // to be improved - shall I omitt here Abs() ? |
489d5531 | 4797 | { |
4798 | termA = pow(sumOfQuadraticEventWeights,0.5)/sumOfLinearEventWeights; | |
4799 | } else | |
4800 | { | |
b3dacf6b | 4801 | cout<<endl; |
4802 | cout<<" WARNING (QC): sumOfLinearEventWeights == 0 in method FinalizeCorrelationsIntFlow() !!!!"<<endl; | |
4803 | cout<<" (for "<<2*ci<<"-particle correlation)"<<endl; | |
4804 | cout<<endl; | |
489d5531 | 4805 | } |
4806 | if(1.-pow(termA,2.) > 0.) | |
4807 | { | |
4808 | termB = 1./pow(1-pow(termA,2.),0.5); | |
4809 | } else | |
4810 | { | |
b3dacf6b | 4811 | cout<<endl; |
4812 | cout<<" WARNING (QC): 1.-pow(termA,2.) <= 0 in method FinalizeCorrelationsIntFlow() !!!!"<<endl; | |
4813 | cout<<" (for "<<2*ci<<"-particle correlation)"<<endl; | |
4814 | cout<<endl; | |
489d5531 | 4815 | } |
4816 | Double_t statisticalError = termA * spread * termB; | |
4817 | fIntFlowCorrelationsHist->SetBinContent(ci,correlation); | |
4818 | fIntFlowCorrelationsHist->SetBinError(ci,statisticalError); | |
ff70ca91 | 4819 | } // end of for(Int_t ci=1;ci<=4;ci++) // correlation index |
4820 | ||
b3dacf6b | 4821 | // Versus multiplicity: |
4822 | if(!fCalculateCumulantsVsM){return;} | |
ff70ca91 | 4823 | for(Int_t ci=0;ci<=3;ci++) // correlation index |
4824 | { | |
4825 | Int_t nBins = fIntFlowCorrelationsVsMPro[ci]->GetNbinsX(); | |
4826 | for(Int_t b=1;b<=nBins;b++) // looping over multiplicity bins | |
4827 | { | |
b40a910e | 4828 | if(fIntFlowCorrelationsVsMPro[ci]->GetBinEffectiveEntries(b) < 2 || fIntFlowSquaredCorrelationsVsMPro[ci]->GetBinEffectiveEntries(b) < 2) |
4829 | { | |
4830 | fIntFlowCorrelationsVsMPro[ci]->SetBinError(b,0.); | |
4831 | fIntFlowSquaredCorrelationsVsMPro[ci]->SetBinError(b,0.); | |
4832 | continue; | |
4833 | } | |
ff70ca91 | 4834 | Double_t correlationVsM = fIntFlowCorrelationsVsMPro[ci]->GetBinContent(b); |
b40a910e | 4835 | Double_t squaredCorrelationVsM = fIntFlowSquaredCorrelationsVsMPro[ci]->GetBinContent(b); |
4836 | Double_t spreadVsM = 0.; | |
4837 | if(squaredCorrelationVsM-correlationVsM*correlationVsM >= 0.) | |
4838 | { | |
4839 | spreadVsM = pow(squaredCorrelationVsM-correlationVsM*correlationVsM,0.5); | |
4840 | } else | |
4841 | { | |
4842 | cout<<endl; | |
4843 | cout<<Form(" WARNING (QC): Imaginary 'spreadVsM' for ci = %d, bin = %d, entries = %f !!!!", | |
4844 | ci,b,fIntFlowCorrelationsVsMPro[ci]->GetBinEffectiveEntries(b))<<endl; | |
4845 | cout<<endl; | |
4846 | } | |
ff70ca91 | 4847 | Double_t sumOfLinearEventWeightsVsM = fIntFlowSumOfEventWeightsVsM[ci][0]->GetBinContent(b); |
4848 | Double_t sumOfQuadraticEventWeightsVsM = fIntFlowSumOfEventWeightsVsM[ci][1]->GetBinContent(b); | |
4849 | Double_t termAVsM = 0.; | |
4850 | Double_t termBVsM = 0.; | |
b40a910e | 4851 | if(sumOfLinearEventWeightsVsM > 0.) |
ff70ca91 | 4852 | { |
4853 | termAVsM = pow(sumOfQuadraticEventWeightsVsM,0.5)/sumOfLinearEventWeightsVsM; | |
b3dacf6b | 4854 | } |
ff70ca91 | 4855 | if(1.-pow(termAVsM,2.) > 0.) |
4856 | { | |
4857 | termBVsM = 1./pow(1-pow(termAVsM,2.),0.5); | |
b3dacf6b | 4858 | } |
ff70ca91 | 4859 | Double_t statisticalErrorVsM = termAVsM * spreadVsM * termBVsM; |
4860 | fIntFlowCorrelationsVsMHist[ci]->SetBinContent(b,correlationVsM); | |
4861 | fIntFlowCorrelationsVsMHist[ci]->SetBinError(b,statisticalErrorVsM); | |
4862 | } // end of for(Int_t b=1;b<=nBins;b++) | |
4863 | } // end of for(Int_t ci=1;ci<=4;ci++) // correlation index | |
4864 | ||
489d5531 | 4865 | } // end of AliFlowAnalysisWithQCumulants::FinalizeCorrelationsIntFlow() |
4866 | ||
489d5531 | 4867 | //================================================================================================================================ |
4868 | ||
489d5531 | 4869 | void AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(Int_t nRP) |
4870 | { | |
b77b6434 | 4871 | // Fill profile fAverageMultiplicity to hold average multiplicities and |
4872 | // number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8 | |
489d5531 | 4873 | |
4874 | // Binning of fAverageMultiplicity is organized as follows: | |
4875 | // 1st bin: all events (including the empty ones) | |
4876 | // 2nd bin: event with # of RPs greater or equal to 1 | |
4877 | // 3rd bin: event with # of RPs greater or equal to 2 | |
4878 | // 4th bin: event with # of RPs greater or equal to 3 | |
4879 | // 5th bin: event with # of RPs greater or equal to 4 | |
4880 | // 6th bin: event with # of RPs greater or equal to 5 | |
4881 | // 7th bin: event with # of RPs greater or equal to 6 | |
4882 | // 8th bin: event with # of RPs greater or equal to 7 | |
4883 | // 9th bin: event with # of RPs greater or equal to 8 | |
4884 | ||
489d5531 | 4885 | if(nRP<0) |
4886 | { | |
b77b6434 | 4887 | cout<<endl; |
4888 | cout<<" WARNING (QC): nRP<0 in in AFAWQC::FAM() !!!!"<<endl; | |
4889 | cout<<endl; | |
489d5531 | 4890 | exit(0); |
4891 | } | |
4892 | ||
4893 | for(Int_t i=0;i<9;i++) | |
4894 | { | |
b77b6434 | 4895 | if(nRP>=i){fAvMultiplicity->Fill(i+0.5,nRP,1);} |
489d5531 | 4896 | } |
4897 | ||
4898 | } // end of AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(nRP) | |
4899 | ||
489d5531 | 4900 | //================================================================================================================================ |
4901 | ||
489d5531 | 4902 | void AliFlowAnalysisWithQCumulants::CalculateCumulantsIntFlow() |
b3dacf6b | 4903 | { |
b92ea2b9 | 4904 | // a) Calculate Q-cumulants from the measured multiparticle correlations; |
4905 | // b) Propagate the statistical errors from measured multiparticle correlations to statistical errors of Q-cumulants; | |
4906 | // c) Remark: Q-cumulants calculated in this method are biased by non-uniform acceptance of detector !!!! | |
4907 | // Method CalculateQcumulantsCorrectedForNUAIntFlow() is called afterwards to correct for this bias; | |
4908 | // d) Store the results and statistical error of Q-cumulants in histogram fIntFlowQcumulants. | |
4909 | // Binning of fIntFlowQcumulants is organized as follows: | |
489d5531 | 4910 | // |
b3dacf6b | 4911 | // 1st bin: QC{2} |
4912 | // 2nd bin: QC{4} | |
4913 | // 3rd bin: QC{6} | |
4914 | // 4th bin: QC{8} | |
4915 | // | |
489d5531 | 4916 | |
b3dacf6b | 4917 | // Correlations: |
489d5531 | 4918 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> |
4919 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> | |
4920 | Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> | |
4921 | Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> | |
b3dacf6b | 4922 | // Statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations: |
489d5531 | 4923 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <2> |
4924 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <4> | |
4925 | Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <6> | |
4926 | Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <8> | |
b3dacf6b | 4927 | // Covariances (multiplied by prefactor depending on weights - see comments in CalculateCovariancesIntFlow()): |
8e1cefdd | 4928 | Double_t wCov24 = 0.; // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) |
4929 | Double_t wCov26 = 0.; // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>) | |
4930 | Double_t wCov28 = 0.; // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>) | |
4931 | Double_t wCov46 = 0.; // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>) | |
4932 | Double_t wCov48 = 0.; // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>) | |
4933 | Double_t wCov68 = 0.; // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>) | |
4934 | if(!fForgetAboutCovariances) | |
4935 | { | |
4936 | wCov24 = fIntFlowCovariances->GetBinContent(1); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) | |
4937 | wCov26 = fIntFlowCovariances->GetBinContent(2); // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>) | |
4938 | wCov28 = fIntFlowCovariances->GetBinContent(3); // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>) | |
4939 | wCov46 = fIntFlowCovariances->GetBinContent(4); // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>) | |
4940 | wCov48 = fIntFlowCovariances->GetBinContent(5); // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>) | |
4941 | wCov68 = fIntFlowCovariances->GetBinContent(6); // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>) | |
4942 | } | |
489d5531 | 4943 | // Q-cumulants: |
4944 | Double_t qc2 = 0.; // QC{2} | |
4945 | Double_t qc4 = 0.; // QC{4} | |
4946 | Double_t qc6 = 0.; // QC{6} | |
4947 | Double_t qc8 = 0.; // QC{8} | |
b3dacf6b | 4948 | if(TMath::Abs(two) > 0.){qc2 = two;} |
4949 | if(TMath::Abs(four) > 0.){qc4 = four-2.*pow(two,2.);} | |
4950 | if(TMath::Abs(six) > 0.){qc6 = six-9.*two*four+12.*pow(two,3.);} | |
4951 | if(TMath::Abs(eight) > 0.){qc8 = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.);} | |
4952 | // Statistical errors of Q-cumulants: | |
489d5531 | 4953 | Double_t qc2Error = 0.; |
4954 | Double_t qc4Error = 0.; | |
4955 | Double_t qc6Error = 0.; | |
b3dacf6b | 4956 | Double_t qc8Error = 0.; |
4957 | // Squared statistical errors of Q-cumulants: | |
489d5531 | 4958 | //Double_t qc2ErrorSquared = 0.; |
4959 | Double_t qc4ErrorSquared = 0.; | |
4960 | Double_t qc6ErrorSquared = 0.; | |
b3dacf6b | 4961 | Double_t qc8ErrorSquared = 0.; |
4962 | // Statistical error of QC{2}: | |
4963 | qc2Error = twoError; | |
4964 | // Statistical error of QC{4}: | |
489d5531 | 4965 | qc4ErrorSquared = 16.*pow(two,2.)*pow(twoError,2)+pow(fourError,2.) |
4966 | - 8.*two*wCov24; | |
4967 | if(qc4ErrorSquared>0.) | |
4968 | { | |
4969 | qc4Error = pow(qc4ErrorSquared,0.5); | |
4970 | } else | |
4971 | { | |
b3dacf6b | 4972 | cout<<" WARNING (QC): Statistical error of QC{4} is imaginary !!!!"<<endl; |
4973 | } | |
4974 | // Statistical error of QC{6}: | |
489d5531 | 4975 | qc6ErrorSquared = 81.*pow(4.*pow(two,2.)-four,2.)*pow(twoError,2.) |
4976 | + 81.*pow(two,2.)*pow(fourError,2.) | |
4977 | + pow(sixError,2.) | |
4978 | - 162.*two*(4.*pow(two,2.)-four)*wCov24 | |
4979 | + 18.*(4.*pow(two,2.)-four)*wCov26 | |
b3dacf6b | 4980 | - 18.*two*wCov46; |
489d5531 | 4981 | if(qc6ErrorSquared>0.) |
4982 | { | |
4983 | qc6Error = pow(qc6ErrorSquared,0.5); | |
4984 | } else | |
4985 | { | |
b3dacf6b | 4986 | cout<<" WARNING (QC): Statistical error of QC{6} is imaginary !!!!"<<endl; |
4987 | } | |
4988 | // Statistical error of QC{8}: | |
489d5531 | 4989 | qc8ErrorSquared = 256.*pow(36.*pow(two,3.)-18.*four*two+six,2.)*pow(twoError,2.) |
4990 | + 1296.*pow(4.*pow(two,2.)-four,2.)*pow(fourError,2.) | |
4991 | + 256.*pow(two,2.)*pow(sixError,2.) | |
4992 | + pow(eightError,2.) | |
4993 | - 1152.*(36.*pow(two,3.)-18.*four*two+six)*(4.*pow(two,2.)-four)*wCov24 | |
4994 | + 512.*two*(36.*pow(two,3.)-18.*four*two+six)*wCov26 | |
4995 | - 32.*(36.*pow(two,3.)-18.*four*two+six)*wCov28 | |
4996 | - 1152.*two*(4.*pow(two,2.)-four)*wCov46 | |
4997 | + 72.*(4.*pow(two,2.)-four)*wCov48 | |
4998 | - 32.*two*wCov68; | |
4999 | if(qc8ErrorSquared>0.) | |
5000 | { | |
5001 | qc8Error = pow(qc8ErrorSquared,0.5); | |
5002 | } else | |
5003 | { | |
b3dacf6b | 5004 | cout<<"WARNING (QC): Statistical error of QC{8} is imaginary !!!!"<<endl; |
489d5531 | 5005 | } |
b3dacf6b | 5006 | // Store the results and statistical errors for Q-cumulants: |
5007 | if(TMath::Abs(qc2)>0.) | |
5008 | { | |
5009 | fIntFlowQcumulants->SetBinContent(1,qc2); | |
5010 | fIntFlowQcumulants->SetBinError(1,qc2Error); | |
5011 | } | |
5012 | if(TMath::Abs(qc4)>0.) | |
5013 | { | |
5014 | fIntFlowQcumulants->SetBinContent(2,qc4); | |
5015 | fIntFlowQcumulants->SetBinError(2,qc4Error); | |
5016 | } | |
5017 | if(TMath::Abs(qc6)>0.) | |
5018 | { | |
5019 | fIntFlowQcumulants->SetBinContent(3,qc6); | |
5020 | fIntFlowQcumulants->SetBinError(3,qc6Error); | |
5021 | } | |
5022 | if(TMath::Abs(qc8)>0.) | |
5023 | { | |
5024 | fIntFlowQcumulants->SetBinContent(4,qc8); | |
5025 | fIntFlowQcumulants->SetBinError(4,qc8Error); | |
5026 | } | |
5027 | ||
5028 | // Versus multiplicity: | |
5029 | if(!fCalculateCumulantsVsM){return;} | |
9da1a4f3 | 5030 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) |
b3dacf6b | 5031 | Double_t value[4] = {0.}; // QCs vs M |
5032 | Double_t error[4] = {0.}; // error of QCs vs M | |
5033 | Double_t dSum1[4] = {0.}; // sum value_i/(error_i)^2 | |
5034 | Double_t dSum2[4] = {0.}; // sum 1/(error_i)^2 | |
9da1a4f3 | 5035 | for(Int_t b=1;b<=nBins;b++) |
5036 | { | |
b3dacf6b | 5037 | // Correlations: |
9da1a4f3 | 5038 | two = fIntFlowCorrelationsVsMHist[0]->GetBinContent(b); // <<2>> |
5039 | four = fIntFlowCorrelationsVsMHist[1]->GetBinContent(b); // <<4>> | |
5040 | six = fIntFlowCorrelationsVsMHist[2]->GetBinContent(b); // <<6>> | |
5041 | eight = fIntFlowCorrelationsVsMHist[3]->GetBinContent(b); // <<8>> | |
b3dacf6b | 5042 | // Statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations: |
9da1a4f3 | 5043 | twoError = fIntFlowCorrelationsVsMHist[0]->GetBinError(b); // statistical error of <2> |
5044 | fourError = fIntFlowCorrelationsVsMHist[1]->GetBinError(b); // statistical error of <4> | |
5045 | sixError = fIntFlowCorrelationsVsMHist[2]->GetBinError(b); // statistical error of <6> | |
5046 | eightError = fIntFlowCorrelationsVsMHist[3]->GetBinError(b); // statistical error of <8> | |
b3dacf6b | 5047 | // Covariances (multiplied by prefactor depending on weights - see comments in CalculateCovariancesIntFlow()): |
8e1cefdd | 5048 | if(!fForgetAboutCovariances) |
5049 | { | |
5050 | wCov24 = fIntFlowCovariancesVsM[0]->GetBinContent(b); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) | |
5051 | wCov26 = fIntFlowCovariancesVsM[1]->GetBinContent(b); // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>) | |
5052 | wCov28 = fIntFlowCovariancesVsM[2]->GetBinContent(b); // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>) | |
5053 | wCov46 = fIntFlowCovariancesVsM[3]->GetBinContent(b); // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>) | |
5054 | wCov48 = fIntFlowCovariancesVsM[4]->GetBinContent(b); // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>) | |
5055 | wCov68 = fIntFlowCovariancesVsM[5]->GetBinContent(b); // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>) | |
5056 | } | |
9da1a4f3 | 5057 | // Q-cumulants: |
5058 | qc2 = 0.; // QC{2} | |
5059 | qc4 = 0.; // QC{4} | |
5060 | qc6 = 0.; // QC{6} | |
5061 | qc8 = 0.; // QC{8} | |
b3dacf6b | 5062 | if(TMath::Abs(two) > 0.){qc2 = two;} |
5063 | if(TMath::Abs(four) > 0.){qc4 = four-2.*pow(two,2.);} | |
5064 | if(TMath::Abs(six) > 0.){qc6 = six-9.*two*four+12.*pow(two,3.);} | |
5065 | if(TMath::Abs(eight) > 0.){qc8 = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.);} | |
5066 | // Statistical errors of Q-cumulants: | |
9da1a4f3 | 5067 | qc2Error = 0.; |
5068 | qc4Error = 0.; | |
5069 | qc6Error = 0.; | |
b3dacf6b | 5070 | qc8Error = 0.; |
5071 | // Squared statistical errors of Q-cumulants: | |
9da1a4f3 | 5072 | //Double_t qc2ErrorSquared = 0.; |
5073 | qc4ErrorSquared = 0.; | |
5074 | qc6ErrorSquared = 0.; | |
b3dacf6b | 5075 | qc8ErrorSquared = 0.; |
5076 | // Statistical error of QC{2}: | |
5077 | qc2Error = twoError; | |
5078 | // Statistical error of QC{4}: | |
9da1a4f3 | 5079 | qc4ErrorSquared = 16.*pow(two,2.)*pow(twoError,2)+pow(fourError,2.) |
5080 | - 8.*two*wCov24; | |
5081 | if(qc4ErrorSquared>0.) | |
5082 | { | |
5083 | qc4Error = pow(qc4ErrorSquared,0.5); | |
5084 | } else | |
5085 | { | |
5086 | // cout<<"WARNING: Statistical error of QC{4} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl; | |
b3dacf6b | 5087 | } |
5088 | // Statistical error of QC{6}: | |
9da1a4f3 | 5089 | qc6ErrorSquared = 81.*pow(4.*pow(two,2.)-four,2.)*pow(twoError,2.) |
5090 | + 81.*pow(two,2.)*pow(fourError,2.) | |
5091 | + pow(sixError,2.) | |
5092 | - 162.*two*(4.*pow(two,2.)-four)*wCov24 | |
5093 | + 18.*(4.*pow(two,2.)-four)*wCov26 | |
b3dacf6b | 5094 | - 18.*two*wCov46; |
9da1a4f3 | 5095 | if(qc6ErrorSquared>0.) |
5096 | { | |
5097 | qc6Error = pow(qc6ErrorSquared,0.5); | |
5098 | } else | |
5099 | { | |
5100 | // cout<<"WARNING: Statistical error of QC{6} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl; | |
b3dacf6b | 5101 | } |
5102 | // Statistical error of QC{8}: | |
9da1a4f3 | 5103 | qc8ErrorSquared = 256.*pow(36.*pow(two,3.)-18.*four*two+six,2.)*pow(twoError,2.) |
5104 | + 1296.*pow(4.*pow(two,2.)-four,2.)*pow(fourError,2.) | |
5105 | + 256.*pow(two,2.)*pow(sixError,2.) | |
5106 | + pow(eightError,2.) | |
5107 | - 1152.*(36.*pow(two,3.)-18.*four*two+six)*(4.*pow(two,2.)-four)*wCov24 | |
5108 | + 512.*two*(36.*pow(two,3.)-18.*four*two+six)*wCov26 | |
5109 | - 32.*(36.*pow(two,3.)-18.*four*two+six)*wCov28 | |
5110 | - 1152.*two*(4.*pow(two,2.)-four)*wCov46 | |
5111 | + 72.*(4.*pow(two,2.)-four)*wCov48 | |
5112 | - 32.*two*wCov68; | |
5113 | if(qc8ErrorSquared>0.) | |
5114 | { | |
5115 | qc8Error = pow(qc8ErrorSquared,0.5); | |
5116 | } else | |
5117 | { | |
5118 | // cout<<"WARNING: Statistical error of QC{8} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl; | |
5119 | } | |
b3dacf6b | 5120 | // Store the results and statistical errors for Q-cumulants: |
5121 | if(TMath::Abs(qc2)>0.) | |
5122 | { | |
5123 | fIntFlowQcumulantsVsM[0]->SetBinContent(b,qc2); | |
5124 | fIntFlowQcumulantsVsM[0]->SetBinError(b,qc2Error); | |
5125 | } | |
5126 | if(TMath::Abs(qc4)>0.) | |
5127 | { | |
5128 | fIntFlowQcumulantsVsM[1]->SetBinContent(b,qc4); | |
5129 | fIntFlowQcumulantsVsM[1]->SetBinError(b,qc4Error); | |
5130 | } | |
5131 | if(TMath::Abs(qc6)>0.) | |
5132 | { | |
5133 | fIntFlowQcumulantsVsM[2]->SetBinContent(b,qc6); | |
5134 | fIntFlowQcumulantsVsM[2]->SetBinError(b,qc6Error); | |
5135 | } | |
5136 | if(TMath::Abs(qc8)>0.) | |
5137 | { | |
5138 | fIntFlowQcumulantsVsM[3]->SetBinContent(b,qc8); | |
5139 | fIntFlowQcumulantsVsM[3]->SetBinError(b,qc8Error); | |
5140 | } | |
5141 | // Rebin in M: | |
5142 | for(Int_t co=0;co<4;co++) | |
5143 | { | |
b40a910e | 5144 | if(fIntFlowCorrelationsVsMPro[co]->GetBinEffectiveEntries(b)<2){continue;} |
b3dacf6b | 5145 | value[co] = fIntFlowQcumulantsVsM[co]->GetBinContent(b); |
5146 | error[co] = fIntFlowQcumulantsVsM[co]->GetBinError(b); | |
5147 | if(error[co]>0.) | |
5148 | { | |
5149 | dSum1[co]+=value[co]/(error[co]*error[co]); | |
5150 | dSum2[co]+=1./(error[co]*error[co]); | |
5151 | } | |
5152 | } // end of for(Int_t co=0;co<4;co++) | |
9da1a4f3 | 5153 | } // end of for(Int_t b=1;b<=nBins;b++) |
b3dacf6b | 5154 | // Store rebinned Q-cumulants: |
5155 | for(Int_t co=0;co<4;co++) | |
5156 | { | |
5157 | if(dSum2[co]>0.) | |
5158 | { | |
5159 | fIntFlowQcumulantsRebinnedInM->SetBinContent(co+1,dSum1[co]/dSum2[co]); | |
5160 | fIntFlowQcumulantsRebinnedInM->SetBinError(co+1,pow(1./dSum2[co],0.5)); | |
5161 | } | |
5162 | } // end of for(Int_t co=0;co<4;co++) | |
5163 | ||
489d5531 | 5164 | } // end of AliFlowAnalysisWithQCumulants::CalculateCumulantsIntFlow() |
5165 | ||
489d5531 | 5166 | //================================================================================================================================ |
5167 | ||
b92ea2b9 | 5168 | void AliFlowAnalysisWithQCumulants::CalculateReferenceFlow() |
489d5531 | 5169 | { |
b92ea2b9 | 5170 | // a) Calculate the final results for reference flow estimates from Q-cumulants; |
5171 | // b) Propagate the statistical errors to reference flow estimates from statistical error of Q-cumulants; | |
0328db2d | 5172 | // c) Store the results and statistical errors of reference flow estimates in histogram fIntFlow. |
489d5531 | 5173 | // Binning of fIntFlow is organized as follows: |
5174 | // | |
b3dacf6b | 5175 | // 1st bin: v{2,QC} |
5176 | // 2nd bin: v{4,QC} | |
5177 | // 3rd bin: v{6,QC} | |
5178 | // 4th bin: v{8,QC} | |
5179 | // | |
489d5531 | 5180 | |
b3dacf6b | 5181 | // Reference flow estimates: |
489d5531 | 5182 | Double_t v2 = 0.; // v{2,QC} |
5183 | Double_t v4 = 0.; // v{4,QC} | |
5184 | Double_t v6 = 0.; // v{6,QC} | |
5185 | Double_t v8 = 0.; // v{8,QC} | |
b3dacf6b | 5186 | // Reference flow's statistical errors: |
5187 | Double_t v2Error = 0.; // v{2,QC} stat. error | |
5188 | Double_t v4Error = 0.; // v{4,QC} stat. error | |
5189 | Double_t v6Error = 0.; // v{6,QC} stat. error | |
5190 | Double_t v8Error = 0.; // v{8,QC} stat. error | |
5191 | ||
b92ea2b9 | 5192 | // Q-cumulants: |
5193 | Double_t qc2 = fIntFlowQcumulants->GetBinContent(1); // QC{2} | |
5194 | Double_t qc4 = fIntFlowQcumulants->GetBinContent(2); // QC{4} | |
5195 | Double_t qc6 = fIntFlowQcumulants->GetBinContent(3); // QC{6} | |
5196 | Double_t qc8 = fIntFlowQcumulants->GetBinContent(4); // QC{8} | |
5197 | // Q-cumulants's statistical errors: | |
5198 | Double_t qc2Error = fIntFlowQcumulants->GetBinError(1); // QC{2} stat. error | |
5199 | Double_t qc4Error = fIntFlowQcumulants->GetBinError(2); // QC{4} stat. error | |
5200 | Double_t qc6Error = fIntFlowQcumulants->GetBinError(3); // QC{6} stat. error | |
5201 | Double_t qc8Error = fIntFlowQcumulants->GetBinError(4); // QC{8} stat. error | |
5202 | // Calculate reference flow estimates from Q-cumulants: | |
1268c371 | 5203 | if(qc2>=0.){v2 = pow(qc2,0.5);} |
b92ea2b9 | 5204 | if(qc4<=0.){v4 = pow(-1.*qc4,1./4.);} |
5205 | if(qc6>=0.){v6 = pow((1./4.)*qc6,1./6.);} | |
5206 | if(qc8<=0.){v8 = pow((-1./33.)*qc8,1./8.);} | |
5207 | // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants: | |
1268c371 | 5208 | if(qc2>0.){v2Error = (1./2.)*pow(qc2,-0.5)*qc2Error;} |
b92ea2b9 | 5209 | if(qc4<0.){v4Error = (1./4.)*pow(-qc4,-3./4.)*qc4Error;} |
5210 | if(qc6>0.){v6Error = (1./6.)*pow(2.,-1./3.)*pow(qc6,-5./6.)*qc6Error;} | |
5211 | if(qc8<0.){v8Error = (1./8.)*pow(33.,-1./8.)*pow(-qc8,-7./8.)*qc8Error;} | |
5212 | // Print warnings for the 'wrong sign' cumulants: | |
5213 | if(TMath::Abs(v2) < 1.e-44) | |
5214 | { | |
5215 | cout<<" WARNING: Wrong sign QC{2}, couldn't calculate v{2,QC} !!!!"<<endl; | |
5216 | } | |
5217 | if(TMath::Abs(v4) < 1.e-44) | |
5218 | { | |
5219 | cout<<" WARNING: Wrong sign QC{4}, couldn't calculate v{4,QC} !!!!"<<endl; | |
5220 | } | |
5221 | if(TMath::Abs(v6) < 1.e-44) | |
5222 | { | |
5223 | cout<<" WARNING: Wrong sign QC{6}, couldn't calculate v{6,QC} !!!!"<<endl; | |
5224 | } | |
5225 | if(TMath::Abs(v8) < 1.e-44) | |
5226 | { | |
5227 | cout<<" WARNING: Wrong sign QC{8}, couldn't calculate v{8,QC} !!!!"<<endl; | |
5228 | } | |
5229 | // Store the results and statistical errors of integrated flow estimates: | |
5230 | fIntFlow->SetBinContent(1,v2); | |
5231 | fIntFlow->SetBinError(1,v2Error); | |
5232 | fIntFlow->SetBinContent(2,v4); | |
5233 | fIntFlow->SetBinError(2,v4Error); | |
5234 | fIntFlow->SetBinContent(3,v6); | |
5235 | fIntFlow->SetBinError(3,v6Error); | |
5236 | fIntFlow->SetBinContent(4,v8); | |
5237 | fIntFlow->SetBinError(4,v8Error); | |
5238 | ||
5239 | // Versus multiplicity: | |
5240 | if(!fCalculateCumulantsVsM){return;} | |
5241 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) | |
5242 | for(Int_t b=1;b<=nBins;b++) | |
9da1a4f3 | 5243 | { |
5244 | // Q-cumulants: | |
b92ea2b9 | 5245 | Double_t qc2VsM = fIntFlowQcumulantsVsM[0]->GetBinContent(b); // QC{2} |
5246 | Double_t qc4VsM = fIntFlowQcumulantsVsM[1]->GetBinContent(b); // QC{4} | |
5247 | Double_t qc6VsM = fIntFlowQcumulantsVsM[2]->GetBinContent(b); // QC{6} | |
5248 | Double_t qc8VsM = fIntFlowQcumulantsVsM[3]->GetBinContent(b); // QC{8} | |
b3dacf6b | 5249 | // Q-cumulants's statistical errors: |
b92ea2b9 | 5250 | Double_t qc2ErrorVsM = fIntFlowQcumulantsVsM[0]->GetBinError(b); // QC{2} stat. error |
5251 | Double_t qc4ErrorVsM = fIntFlowQcumulantsVsM[1]->GetBinError(b); // QC{4} stat. error | |
5252 | Double_t qc6ErrorVsM = fIntFlowQcumulantsVsM[2]->GetBinError(b); // QC{6} stat. error | |
5253 | Double_t qc8ErrorVsM = fIntFlowQcumulantsVsM[3]->GetBinError(b); // QC{8} stat. error | |
b3dacf6b | 5254 | // Reference flow estimates: |
b92ea2b9 | 5255 | Double_t v2VsM = 0.; // v{2,QC} |
5256 | Double_t v4VsM = 0.; // v{4,QC} | |
5257 | Double_t v6VsM = 0.; // v{6,QC} | |
5258 | Double_t v8VsM = 0.; // v{8,QC} | |
5259 | // Reference flow estimates errors: | |
5260 | Double_t v2ErrorVsM = 0.; // v{2,QC} stat. error | |
5261 | Double_t v4ErrorVsM = 0.; // v{4,QC} stat. error | |
5262 | Double_t v6ErrorVsM = 0.; // v{6,QC} stat. error | |
5263 | Double_t v8ErrorVsM = 0.; // v{8,QC} stat. error | |
b3dacf6b | 5264 | // Calculate reference flow estimates from Q-cumulants: |
1268c371 | 5265 | if(qc2VsM>=0.){v2VsM = pow(qc2VsM,0.5);} |
b92ea2b9 | 5266 | if(qc4VsM<=0.){v4VsM = pow(-1.*qc4VsM,1./4.);} |
5267 | if(qc6VsM>=0.){v6VsM = pow((1./4.)*qc6VsM,1./6.);} | |
5268 | if(qc8VsM<=0.){v8VsM = pow((-1./33.)*qc8VsM,1./8.);} | |
b3dacf6b | 5269 | // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants: |
1268c371 | 5270 | if(qc2VsM>0.){v2ErrorVsM = (1./2.)*pow(qc2VsM,-0.5)*qc2ErrorVsM;} |
b92ea2b9 | 5271 | if(qc4VsM<0.){v4ErrorVsM = (1./4.)*pow(-qc4VsM,-3./4.)*qc4ErrorVsM;} |
5272 | if(qc6VsM>0.){v6ErrorVsM = (1./6.)*pow(2.,-1./3.)*pow(qc6VsM,-5./6.)*qc6ErrorVsM;} | |
5273 | if(qc8VsM<0.){v8ErrorVsM = (1./8.)*pow(33.,-1./8.)*pow(-qc8VsM,-7./8.)*qc8ErrorVsM;} | |
b3dacf6b | 5274 | // Store the results and statistical errors of integrated flow estimates: |
b92ea2b9 | 5275 | fIntFlowVsM[0]->SetBinContent(b,v2VsM); |
5276 | fIntFlowVsM[0]->SetBinError(b,v2ErrorVsM); | |
5277 | fIntFlowVsM[1]->SetBinContent(b,v4VsM); | |
5278 | fIntFlowVsM[1]->SetBinError(b,v4ErrorVsM); | |
5279 | fIntFlowVsM[2]->SetBinContent(b,v6VsM); | |
5280 | fIntFlowVsM[2]->SetBinError(b,v6ErrorVsM); | |
5281 | fIntFlowVsM[3]->SetBinContent(b,v8VsM); | |
5282 | fIntFlowVsM[3]->SetBinError(b,v8ErrorVsM); | |
5283 | } // end of for(Int_t b=1;b<=nBins;b++) | |
5284 | ||
5285 | // 'Rebinned in M' calculation: // to be improved - this can be implemented better: | |
5286 | // Reference flow estimates: | |
5287 | Double_t v2RebinnedInM = 0.; // v{2,QC} | |
5288 | Double_t v4RebinnedInM = 0.; // v{4,QC} | |
5289 | Double_t v6RebinnedInM = 0.; // v{6,QC} | |
5290 | Double_t v8RebinnedInM = 0.; // v{8,QC} | |
5291 | // Reference flow's statistical errors: | |
5292 | Double_t v2ErrorRebinnedInM = 0.; // v{2,QC} stat. error | |
5293 | Double_t v4ErrorRebinnedInM = 0.; // v{4,QC} stat. error | |
5294 | Double_t v6ErrorRebinnedInM = 0.; // v{6,QC} stat. error | |
5295 | Double_t v8ErrorRebinnedInM = 0.; // v{8,QC} stat. error | |
5296 | // Q-cumulants: | |
5297 | Double_t qc2RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(1); // QC{2} | |
5298 | Double_t qc4RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(2); // QC{4} | |
5299 | Double_t qc6RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(3); // QC{6} | |
5300 | Double_t qc8RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(4); // QC{8} | |
5301 | // Q-cumulants's statistical errors: | |
5302 | Double_t qc2ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(1); // QC{2} stat. error | |
5303 | Double_t qc4ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(2); // QC{4} stat. error | |
5304 | Double_t qc6ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(3); // QC{6} stat. error | |
5305 | Double_t qc8ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(4); // QC{8} stat. error | |
5306 | // Calculate reference flow estimates from Q-cumulants: | |
1268c371 | 5307 | if(qc2RebinnedInM>=0.){v2RebinnedInM = pow(qc2RebinnedInM,0.5);} |
b92ea2b9 | 5308 | if(qc4RebinnedInM<=0.){v4RebinnedInM = pow(-1.*qc4RebinnedInM,1./4.);} |
5309 | if(qc6RebinnedInM>=0.){v6RebinnedInM = pow((1./4.)*qc6RebinnedInM,1./6.);} | |
5310 | if(qc8RebinnedInM<=0.){v8RebinnedInM = pow((-1./33.)*qc8RebinnedInM,1./8.);} | |
5311 | // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants: | |
1268c371 | 5312 | if(qc2RebinnedInM>0.){v2ErrorRebinnedInM = (1./2.)*pow(qc2RebinnedInM,-0.5)*qc2ErrorRebinnedInM;} |
b92ea2b9 | 5313 | if(qc4RebinnedInM<0.){v4ErrorRebinnedInM = (1./4.)*pow(-qc4RebinnedInM,-3./4.)*qc4ErrorRebinnedInM;} |
5314 | if(qc6RebinnedInM>0.){v6ErrorRebinnedInM = (1./6.)*pow(2.,-1./3.)*pow(qc6RebinnedInM,-5./6.)*qc6ErrorRebinnedInM;} | |
5315 | if(qc8RebinnedInM<0.){v8ErrorRebinnedInM = (1./8.)*pow(33.,-1./8.)*pow(-qc8RebinnedInM,-7./8.)*qc8ErrorRebinnedInM;} | |
5316 | // Print warnings for the 'wrong sign' cumulants: | |
5317 | if(TMath::Abs(v2RebinnedInM) < 1.e-44) | |
5318 | { | |
5319 | cout<<" WARNING: Wrong sign QC{2} rebinned in M, couldn't calculate v{2,QC} !!!!"<<endl; | |
5320 | } | |
5321 | if(TMath::Abs(v4RebinnedInM) < 1.e-44) | |
5322 | { | |
5323 | cout<<" WARNING: Wrong sign QC{4} rebinned in M, couldn't calculate v{4,QC} !!!!"<<endl; | |
5324 | } | |
5325 | if(TMath::Abs(v6RebinnedInM) < 1.e-44) | |
5326 | { | |
5327 | cout<<" WARNING: Wrong sign QC{6} rebinned in M, couldn't calculate v{6,QC} !!!!"<<endl; | |
5328 | } | |
5329 | if(TMath::Abs(v8RebinnedInM) < 1.e-44) | |
5330 | { | |
5331 | cout<<" WARNING: Wrong sign QC{8} rebinned in M, couldn't calculate v{8,QC} !!!!"<<endl; | |
5332 | } | |
5333 | // Store the results and statistical errors of integrated flow estimates: | |
5334 | fIntFlowRebinnedInM->SetBinContent(1,v2RebinnedInM); | |
5335 | fIntFlowRebinnedInM->SetBinError(1,v2ErrorRebinnedInM); | |
5336 | fIntFlowRebinnedInM->SetBinContent(2,v4RebinnedInM); | |
5337 | fIntFlowRebinnedInM->SetBinError(2,v4ErrorRebinnedInM); | |
5338 | fIntFlowRebinnedInM->SetBinContent(3,v6RebinnedInM); | |
5339 | fIntFlowRebinnedInM->SetBinError(3,v6ErrorRebinnedInM); | |
5340 | fIntFlowRebinnedInM->SetBinContent(4,v8RebinnedInM); | |
5341 | fIntFlowRebinnedInM->SetBinError(4,v8ErrorRebinnedInM); | |
5342 | ||
5343 | } // end of AliFlowAnalysisWithQCumulants::CalculateReferenceFlow() | |
489d5531 | 5344 | |
489d5531 | 5345 | //================================================================================================================================ |
5346 | ||
489d5531 | 5347 | void AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow() |
5348 | { | |
0dd3b008 | 5349 | // Fill in AliFlowCommonHistResults histograms relevant for reference flow. |
489d5531 | 5350 | |
0dd3b008 | 5351 | // There are two possibilities here: |
5352 | // a) Store minimum bias reference flow - use SetMinimumBiasReferenceFlow(kTRUE). This result is | |
5353 | // biased by the interplay between nonflow correlations and multiplicity fluctuations and is | |
5354 | // also stored in local histogram fIntFlow; | |
5355 | // b) Store reference flow obtained from flow analysis performed at fixed multiplicity and | |
5356 | // rebinned only at the end of the day - use SetMinimumBiasReferenceFlow(kFALSE). This result | |
5357 | // is also stored in local histogram fIntFlowRebinnedInM. | |
489d5531 | 5358 | |
0dd3b008 | 5359 | // Reference flow estimates: |
5360 | Double_t v[4] = {0.}; | |
5361 | // Statistical errors of reference flow estimates: | |
5362 | Double_t vError[4] = {0.}; | |
489d5531 | 5363 | |
0dd3b008 | 5364 | for(Int_t b=0;b<4;b++) |
5365 | { | |
5366 | if(fMinimumBiasReferenceFlow) | |
5367 | { | |
5368 | v[b] = fIntFlow->GetBinContent(b+1); | |
5369 | vError[b] = fIntFlow->GetBinError(b+1); | |
5370 | } else | |
5371 | { | |
5372 | v[b] = fIntFlowRebinnedInM->GetBinContent(b+1); | |
5373 | vError[b] = fIntFlowRebinnedInM->GetBinError(b+1); | |
5374 | } | |
5375 | } // end of for(Int_t b=0;b<4;b++) | |
5376 | ||
5377 | // Fill AliFlowCommonHistResults histogram: | |
5378 | fCommonHistsResults2nd->FillIntegratedFlow(v[0],vError[0]); // to be improved (hardwired 2nd in the name) | |
5379 | fCommonHistsResults4th->FillIntegratedFlow(v[1],vError[1]); // to be improved (hardwired 4th in the name) | |
403e3389 | 5380 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) // to be improved (calculate also 6th and 8th order) |
489d5531 | 5381 | { |
0dd3b008 | 5382 | fCommonHistsResults6th->FillIntegratedFlow(v[2],vError[2]); // to be improved (hardwired 6th in the name) |
5383 | fCommonHistsResults8th->FillIntegratedFlow(v[3],vError[3]); // to be improved (hardwired 8th in the name) | |
489d5531 | 5384 | } |
5385 | ||
5386 | } // end of AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow() | |
5387 | ||
489d5531 | 5388 | //================================================================================================================================ |
5389 | ||
489d5531 | 5390 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelationsUsingParticleWeights() |
5391 | { | |
5392 | // Calculate all correlations needed for integrated flow using particle weights. | |
5393 | ||
5394 | // Remark 1: When particle weights are used the binning of fIntFlowCorrelationAllPro is organized as follows: | |
5395 | // | |
5396 | // 1st bin: <2>_{1n|1n} = two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))> | |
5397 | // 2nd bin: <2>_{2n|2n} = two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
5398 | // 3rd bin: <2>_{3n|3n} = two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
5399 | // 4th bin: <2>_{4n|4n} = two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
5400 | // 5th bin: ---- EMPTY ---- | |
5401 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
5402 | // 7th bin: <3>_{3n|2n,1n} = ... | |
5403 | // 8th bin: <3>_{4n|2n,2n} = ... | |
5404 | // 9th bin: <3>_{4n|3n,1n} = ... | |
5405 | // 10th bin: ---- EMPTY ---- | |
5406 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
5407 | // 12th bin: <4>_{2n,1n|2n,1n} = ... | |
5408 | // 13th bin: <4>_{2n,2n|2n,2n} = ... | |
5409 | // 14th bin: <4>_{3n|1n,1n,1n} = ... | |
5410 | // 15th bin: <4>_{3n,1n|3n,1n} = ... | |
5411 | // 16th bin: <4>_{3n,1n|2n,2n} = ... | |
5412 | // 17th bin: <4>_{4n|2n,1n,1n} = ... | |
5413 | // 18th bin: ---- EMPTY ---- | |
5414 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = ... | |
5415 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = ... | |
5416 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = ... | |
5417 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = ... | |
5418 | // 23rd bin: ---- EMPTY ---- | |
5419 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = ... | |
5420 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = ... | |
5421 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = ... | |
5422 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = ... | |
5423 | // 28th bin: ---- EMPTY ---- | |
5424 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = ... | |
5425 | // 30th bin: ---- EMPTY ---- | |
5426 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = ... | |
5427 | ||
5428 | // Remark 2: When particle weights are used there are some extra correlations. They are stored in | |
5429 | // fIntFlowExtraCorrelationsPro binning of which is organized as follows: | |
5430 | ||
5431 | // 1st bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))> | |
5432 | // 2nd bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
5433 | ||
5434 | // multiplicity (number of particles used to determine the reaction plane) | |
1268c371 | 5435 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 5436 | |
5437 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
5438 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
5439 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
5440 | Double_t dReQ3n3k = (*fReQ)(2,3); | |
5441 | Double_t dReQ4n4k = (*fReQ)(3,4); | |
5442 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
5443 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
5444 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
5445 | Double_t dImQ3n3k = (*fImQ)(2,3); | |
5446 | Double_t dImQ4n4k = (*fImQ)(3,4); | |
5447 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
5448 | ||
5449 | // dMs are variables introduced in order to simplify some Eqs. bellow: | |
5450 | //.............................................................................................. | |
1268c371 | 5451 | Double_t dM11 = (*fSpk)(1,1)-(*fSpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
5452 | Double_t dM22 = (*fSpk)(1,2)-(*fSpk)(0,4); // dM22 = sum_{i,j=1,i!=j}^M w_i^2 w_j^2 | |
5453 | Double_t dM33 = (*fSpk)(1,3)-(*fSpk)(0,6); // dM33 = sum_{i,j=1,i!=j}^M w_i^3 w_j^3 | |
5454 | Double_t dM44 = (*fSpk)(1,4)-(*fSpk)(0,8); // dM44 = sum_{i,j=1,i!=j}^M w_i^4 w_j^4 | |
5455 | Double_t dM31 = (*fSpk)(0,3)*(*fSpk)(0,1)-(*fSpk)(0,4); // dM31 = sum_{i,j=1,i!=j}^M w_i^3 w_j | |
5456 | Double_t dM211 = (*fSpk)(0,2)*(*fSpk)(1,1)-2.*(*fSpk)(0,3)*(*fSpk)(0,1) | |
5457 | - (*fSpk)(1,2)+2.*(*fSpk)(0,4); // dM211 = sum_{i,j,k=1,i!=j!=k}^M w_i^2 w_j w_k | |
5458 | Double_t dM1111 = (*fSpk)(3,1)-6.*(*fSpk)(0,2)*(*fSpk)(1,1) | |
5459 | + 8.*(*fSpk)(0,3)*(*fSpk)(0,1) | |
5460 | + 3.*(*fSpk)(1,2)-6.*(*fSpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l | |
489d5531 | 5461 | //.............................................................................................. |
5462 | ||
5463 | // 2-particle correlations: | |
5464 | Double_t two1n1nW1W1 = 0.; // <w1 w2 cos(n*(phi1-phi2))> | |
5465 | Double_t two2n2nW2W2 = 0.; // <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
5466 | Double_t two3n3nW3W3 = 0.; // <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
5467 | Double_t two4n4nW4W4 = 0.; // <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
5468 | if(dMult>1) | |
5469 | { | |
5470 | if(dM11) | |
5471 | { | |
1268c371 | 5472 | two1n1nW1W1 = (pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSpk)(0,2))/dM11; |
489d5531 | 5473 | // average correlation <w1 w2 cos(n*(phi1-phi2))> for single event: |
5474 | fIntFlowCorrelationsEBE->SetBinContent(1,two1n1nW1W1); | |
5475 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(1,dM11); | |
5476 | // average correlation <w1 w2 cos(n*(phi1-phi2))> for all events: | |
b40a910e | 5477 | fIntFlowCorrelationsPro->Fill(0.5,two1n1nW1W1,dM11); |
5478 | // average squared correlation <w1 w2 cos(n*(phi1-phi2))> for all events: | |
5479 | fIntFlowSquaredCorrelationsPro->Fill(0.5,two1n1nW1W1*two1n1nW1W1,dM11); | |
489d5531 | 5480 | fIntFlowCorrelationsAllPro->Fill(0.5,two1n1nW1W1,dM11); |
5481 | } | |
5482 | if(dM22) | |
5483 | { | |
1268c371 | 5484 | two2n2nW2W2 = (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)-(*fSpk)(0,4))/dM22; |
489d5531 | 5485 | // ... |
5486 | // average correlation <w1^2 w2^2 cos(2n*(phi1-phi2))> for all events: | |
5487 | fIntFlowCorrelationsAllPro->Fill(1.5,two2n2nW2W2,dM22); | |
5488 | } | |
5489 | if(dM33) | |
5490 | { | |
1268c371 | 5491 | two3n3nW3W3 = (pow(dReQ3n3k,2)+pow(dImQ3n3k,2)-(*fSpk)(0,6))/dM33; |
489d5531 | 5492 | // ... |
5493 | // average correlation <w1^3 w2^3 cos(3n*(phi1-phi2))> for all events: | |
5494 | fIntFlowCorrelationsAllPro->Fill(2.5,two3n3nW3W3,dM33); | |
5495 | } | |
5496 | if(dM44) | |
5497 | { | |
1268c371 | 5498 | two4n4nW4W4 = (pow(dReQ4n4k,2)+pow(dImQ4n4k,2)-(*fSpk)(0,8))/dM44; |
489d5531 | 5499 | // ... |
5500 | // average correlation <w1^4 w2^4 cos(4n*(phi1-phi2))> for all events: | |
5501 | fIntFlowCorrelationsAllPro->Fill(3.5,two4n4nW4W4,dM44); | |
5502 | } | |
5503 | } // end of if(dMult>1) | |
5504 | ||
5505 | // extra 2-particle correlations: | |
5506 | Double_t two1n1nW3W1 = 0.; // <w1^3 w2 cos(n*(phi1-phi2))> | |
5507 | Double_t two1n1nW1W1W2 = 0.; // <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
5508 | if(dMult>1) | |
5509 | { | |
5510 | if(dM31) | |
5511 | { | |
1268c371 | 5512 | two1n1nW3W1 = (dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k-(*fSpk)(0,4))/dM31; |
489d5531 | 5513 | fIntFlowExtraCorrelationsPro->Fill(0.5,two1n1nW3W1,dM31); |
5514 | } | |
5515 | if(dM211) | |
5516 | { | |
1268c371 | 5517 | two1n1nW1W1W2 = ((*fSpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSpk)(0,2)) |
489d5531 | 5518 | - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k |
1268c371 | 5519 | - (*fSpk)(0,4)))/dM211; |
489d5531 | 5520 | fIntFlowExtraCorrelationsPro->Fill(1.5,two1n1nW1W1W2,dM211); |
5521 | } | |
5522 | } // end of if(dMult>1) | |
5523 | //.............................................................................................. | |
5524 | ||
5525 | //.............................................................................................. | |
5526 | // 3-particle correlations: | |
5527 | Double_t three2n1n1nW2W1W1 = 0.; // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
5528 | ||
5529 | if(dMult>2) | |
5530 | { | |
5531 | if(dM211) | |
5532 | { | |
5533 | three2n1n1nW2W1W1 = (pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k | |
5534 | - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k) | |
5535 | - pow(dReQ2n2k,2)-pow(dImQ2n2k,2) | |
1268c371 | 5536 | + 2.*(*fSpk)(0,4))/dM211; |
489d5531 | 5537 | fIntFlowCorrelationsAllPro->Fill(5.5,three2n1n1nW2W1W1,dM211); |
5538 | } | |
5539 | } // end of if(dMult>2) | |
5540 | //.............................................................................................. | |
5541 | ||
5542 | //.............................................................................................. | |
5543 | // 4-particle correlations: | |
5544 | Double_t four1n1n1n1nW1W1W1W1 = 0.; // <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
5545 | if(dMult>3) | |
5546 | { | |
5547 | if(dM1111) | |
5548 | { | |
5549 | four1n1n1n1nW1W1W1W1 = (pow(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.),2) | |
5550 | - 2.*(pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k) | |
5551 | + 8.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k) | |
5552 | + (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)) | |
1268c371 | 5553 | - 4.*(*fSpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
5554 | - 6.*(*fSpk)(0,4)+2.*(*fSpk)(1,2))/dM1111; | |
489d5531 | 5555 | |
5556 | // average correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for single event: | |
5557 | fIntFlowCorrelationsEBE->SetBinContent(2,four1n1n1n1nW1W1W1W1); | |
5558 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(2,dM1111); | |
5559 | // average correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for all events: | |
5560 | fIntFlowCorrelationsPro->Fill(1.5,four1n1n1n1nW1W1W1W1,dM1111); | |
b40a910e | 5561 | // average squared correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for all events: |
5562 | fIntFlowSquaredCorrelationsPro->Fill(1.5,four1n1n1n1nW1W1W1W1*four1n1n1n1nW1W1W1W1,dM1111); | |
489d5531 | 5563 | fIntFlowCorrelationsAllPro->Fill(10.5,four1n1n1n1nW1W1W1W1,dM1111); |
5564 | } | |
5565 | } // end of if(dMult>3) | |
5566 | //.............................................................................................. | |
5567 | ||
5568 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelationsUsingParticleWeights() | |
5569 | ||
489d5531 | 5570 | //================================================================================================================================ |
5571 | ||
489d5531 | 5572 | void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow() |
5573 | { | |
5574 | // Initialize all arrays used to calculate integrated flow. | |
5575 | ||
5576 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
5577 | { | |
5578 | fIntFlowCorrectionTermsForNUAEBE[sc] = NULL; | |
0328db2d | 5579 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc] = NULL; |
489d5531 | 5580 | fIntFlowCorrectionTermsForNUAPro[sc] = NULL; |
5581 | fIntFlowCorrectionTermsForNUAHist[sc] = NULL; | |
b92ea2b9 | 5582 | for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) |
2001bc3a | 5583 | { |
5584 | fIntFlowCorrectionTermsForNUAVsMPro[sc][ci] = NULL; | |
5585 | } | |
0328db2d | 5586 | for(Int_t power=0;power<2;power++) // linear or quadratic |
5587 | { | |
5588 | fIntFlowSumOfEventWeightsNUA[sc][power] = NULL; | |
5589 | } | |
489d5531 | 5590 | } |
5591 | for(Int_t power=0;power<2;power++) // linear or quadratic | |
5592 | { | |
5593 | fIntFlowSumOfEventWeights[power] = NULL; | |
5594 | } | |
b3dacf6b | 5595 | for(Int_t i=0;i<4;i++) // print on the screen the final results (0=RF, 1=RP, 2=POI, 3=RF (rebbined in M)) |
489d5531 | 5596 | { |
5597 | fPrintFinalResults[i] = kTRUE; | |
5598 | } | |
ff70ca91 | 5599 | for(Int_t ci=0;ci<4;ci++) // correlation index or cumulant order |
5600 | { | |
5601 | fIntFlowCorrelationsVsMPro[ci] = NULL; | |
b40a910e | 5602 | fIntFlowSquaredCorrelationsVsMPro[ci] = NULL; |
ff70ca91 | 5603 | fIntFlowCorrelationsVsMHist[ci] = NULL; |
5604 | fIntFlowQcumulantsVsM[ci] = NULL; | |
5605 | fIntFlowVsM[ci] = NULL; | |
2001bc3a | 5606 | fIntFlowDetectorBiasVsM[ci] = NULL; |
ff70ca91 | 5607 | for(Int_t lc=0;lc<2;lc++) |
5608 | { | |
5609 | fIntFlowSumOfEventWeightsVsM[ci][lc] = NULL; | |
5610 | } | |
5611 | } | |
5612 | for(Int_t pi=0;pi<6;pi++) // product or covariance index | |
5613 | { | |
5614 | fIntFlowProductOfCorrelationsVsMPro[pi] = NULL; | |
5615 | fIntFlowCovariancesVsM[pi] = NULL; | |
5616 | fIntFlowSumOfProductOfEventWeightsVsM[pi] = NULL; | |
5617 | } | |
403e3389 | 5618 | for(Int_t ci=0;ci<64;ci++) // correlation index for all correlations vs M profiles (to be improved - hardwired 64) |
3435cacb | 5619 | { |
5620 | fIntFlowCorrelationsAllVsMPro[ci] = NULL; | |
5621 | } | |
5622 | ||
489d5531 | 5623 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow() |
5624 | ||
489d5531 | 5625 | //================================================================================================================================ |
5626 | ||
489d5531 | 5627 | void AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow() |
5628 | { | |
5629 | // Initialize all arrays needed to calculate differential flow. | |
5630 | // a) Initialize lists holding profiles; | |
5631 | // b) Initialize lists holding histograms; | |
5632 | // c) Initialize event-by-event quantities; | |
5633 | // d) Initialize profiles; | |
5634 | // e) Initialize histograms holding final results. | |
5635 | ||
5636 | // a) Initialize lists holding profiles; | |
5637 | for(Int_t t=0;t<2;t++) // type (RP, POI) | |
5638 | { | |
5639 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5640 | { | |
5641 | fDiffFlowCorrelationsProList[t][pe] = NULL; | |
5642 | fDiffFlowProductOfCorrelationsProList[t][pe] = NULL; | |
5643 | fDiffFlowCorrectionsProList[t][pe] = NULL; | |
5644 | } | |
1268c371 | 5645 | // 2D: |
5646 | f2DDiffFlowCorrelationsProList[t] = NULL; | |
489d5531 | 5647 | } |
5648 | ||
5649 | // b) Initialize lists holding histograms; | |
5650 | for(Int_t t=0;t<2;t++) // type (RP, POI) | |
5651 | { | |
5652 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5653 | { | |
5654 | fDiffFlowCorrelationsHistList[t][pe] = NULL; | |
5655 | for(Int_t power=0;power<2;power++) | |
5656 | { | |
5657 | fDiffFlowSumOfEventWeightsHistList[t][pe][power] = NULL; | |
5658 | } // end of for(Int_t power=0;power<2;power++) | |
5659 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe] = NULL; | |
5660 | fDiffFlowCorrectionsHistList[t][pe] = NULL; | |
5661 | fDiffFlowCovariancesHistList[t][pe] = NULL; | |
5662 | fDiffFlowCumulantsHistList[t][pe] = NULL; | |
1268c371 | 5663 | fDiffFlowDetectorBiasHistList[t][pe] = NULL; |
489d5531 | 5664 | fDiffFlowHistList[t][pe] = NULL; |
5665 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5666 | } // enf of for(Int_t t=0;t<2;t++) // type (RP, POI) | |
5667 | ||
5668 | // c) Initialize event-by-event quantities: | |
5669 | // 1D: | |
5670 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
5671 | { | |
5672 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5673 | { | |
5674 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
5675 | { | |
5676 | for(Int_t k=0;k<9;k++) // power of weight | |
5677 | { | |
5678 | fReRPQ1dEBE[t][pe][m][k] = NULL; | |
5679 | fImRPQ1dEBE[t][pe][m][k] = NULL; | |
5680 | fs1dEBE[t][pe][k] = NULL; // to be improved (this doesn't need to be within loop over m) | |
5681 | } | |
5682 | } | |
5683 | } | |
5684 | } | |
5685 | // 1D: | |
5686 | for(Int_t t=0;t<2;t++) // type (RP or POI) | |
5687 | { | |
5688 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5689 | { | |
5690 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
5691 | { | |
5692 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
5693 | { | |
5694 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti] = NULL; | |
5695 | } | |
5696 | } | |
5697 | } | |
5698 | } | |
5699 | // 2D: | |
5700 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
5701 | { | |
5702 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
5703 | { | |
5704 | for(Int_t k=0;k<9;k++) // power of weight | |
5705 | { | |
5706 | fReRPQ2dEBE[t][m][k] = NULL; | |
5707 | fImRPQ2dEBE[t][m][k] = NULL; | |
5708 | fs2dEBE[t][k] = NULL; // to be improved (this doesn't need to be within loop over m) | |
5709 | } | |
5710 | } | |
5711 | } | |
5712 | ||
5713 | // d) Initialize profiles: | |
5714 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
5715 | { | |
5716 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5717 | { | |
5718 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
5719 | { | |
5720 | fDiffFlowCorrelationsPro[t][pe][ci] = NULL; | |
b40a910e | 5721 | fDiffFlowSquaredCorrelationsPro[t][pe][ci] = NULL; |
489d5531 | 5722 | } // end of for(Int_t ci=0;ci<4;ci++) |
5723 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
5724 | { | |
5725 | for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index | |
5726 | { | |
5727 | fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = NULL; | |
5728 | } // end of for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index | |
5729 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
5730 | // correction terms for nua: | |
5731 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
5732 | { | |
5733 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
5734 | { | |
5735 | fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = NULL; | |
5736 | } | |
5737 | } | |
64e500e3 | 5738 | // other differential correlators: |
5739 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
5740 | { | |
5741 | for(Int_t ci=0;ci<1;ci++) // correction term index | |
5742 | { | |
5743 | fOtherDiffCorrelators[t][pe][sc][ci] = NULL; | |
5744 | } | |
5745 | } | |
489d5531 | 5746 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta |
1268c371 | 5747 | for(Int_t ci=0;ci<4;ci++) // correlation index |
5748 | { | |
5749 | f2DDiffFlowCorrelationsPro[t][ci] = NULL; | |
5750 | } | |
489d5531 | 5751 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI |
5752 | ||
5753 | // e) Initialize histograms holding final results. | |
5754 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
5755 | { | |
5756 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5757 | { | |
5758 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
5759 | { | |
5760 | fDiffFlowCorrelationsHist[t][pe][ci] = NULL; | |
5761 | fDiffFlowCumulants[t][pe][ci] = NULL; | |
1268c371 | 5762 | fDiffFlowDetectorBias[t][pe][ci] = NULL; |
489d5531 | 5763 | fDiffFlow[t][pe][ci] = NULL; |
5764 | } // end of for(Int_t ci=0;ci<4;ci++) | |
5765 | for(Int_t covarianceIndex=0;covarianceIndex<5;covarianceIndex++) | |
5766 | { | |
5767 | fDiffFlowCovariances[t][pe][covarianceIndex] = NULL; | |
5768 | } // end of for(Int_t covarianceIndex=0;covarianceIndex<5;covarianceIndex++) | |
5769 | // correction terms for nua: | |
5770 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
5771 | { | |
5772 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
5773 | { | |
5774 | fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = NULL; | |
5775 | } | |
5776 | } | |
5777 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
1268c371 | 5778 | for(Int_t ci=0;ci<4;ci++) // correlation index |
5779 | { | |
5780 | f2DDiffFlowCumulants[t][ci] = NULL; | |
5781 | f2DDiffFlow[t][ci] = NULL; | |
5782 | } | |
489d5531 | 5783 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI |
5784 | ||
5785 | // sum of event weights for reduced correlations: | |
5786 | for(Int_t t=0;t<2;t++) // type = RP or POI | |
5787 | { | |
5788 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5789 | { | |
5790 | for(Int_t p=0;p<2;p++) // power of weight is 1 or 2 | |
5791 | { | |
5792 | for(Int_t ew=0;ew<4;ew++) // event weight index for reduced correlations | |
5793 | { | |
5794 | fDiffFlowSumOfEventWeights[t][pe][p][ew] = NULL; | |
5795 | } | |
5796 | } | |
5797 | } | |
5798 | } | |
5799 | // product of event weights for both types of correlations: | |
5800 | for(Int_t t=0;t<2;t++) // type = RP or POI | |
5801 | { | |
5802 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5803 | { | |
5804 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
5805 | { | |
5806 | for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index | |
5807 | { | |
5808 | fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = NULL; | |
5809 | } | |
5810 | } | |
5811 | } | |
5812 | } | |
1268c371 | 5813 | |
5814 | } // end of AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow() | |
5815 | ||
5816 | //================================================================================================================================ | |
489d5531 | 5817 | |
1268c371 | 5818 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulants(TString type, TString ptOrEta) |
5819 | { | |
5820 | // Calculate differential flow cumulants from measured multiparticle correlations. | |
489d5531 | 5821 | |
1268c371 | 5822 | // REMARK: Cumulants calculated in this method are NOT corrected for non-uniform acceptance. |
5823 | // This correction, if enabled via setter SetApplyCorrectionForNUA(Bool_t), is applied | |
5824 | // in the method CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta) | |
489d5531 | 5825 | |
1268c371 | 5826 | Int_t t = 0; |
5827 | Int_t pe = 0; | |
5828 | ||
5829 | if(type == "RP") | |
5830 | { | |
5831 | t = 0; | |
5832 | } else if(type == "POI") | |
5833 | { | |
5834 | t = 1; | |
5835 | } | |
5836 | ||
5837 | if(ptOrEta == "Pt") | |
5838 | { | |
5839 | pe = 0; | |
5840 | } else if(ptOrEta == "Eta") | |
5841 | { | |
5842 | pe = 1; | |
5843 | } | |
5844 | ||
5845 | // Common: | |
5846 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
489d5531 | 5847 | |
1268c371 | 5848 | // Correlation <<2>>: |
5849 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); | |
5850 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); | |
489d5531 | 5851 | |
1268c371 | 5852 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) |
489d5531 | 5853 | { |
1268c371 | 5854 | // Reduced correlations: |
5855 | Double_t twoPrime = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); // <<2'>> | |
5856 | Double_t twoPrimeError = fDiffFlowCorrelationsHist[t][pe][0]->GetBinError(b); // stat. error of <<2'>> | |
5857 | Double_t fourPrime = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); // <<4'>> | |
5858 | Double_t fourPrimeError = fDiffFlowCorrelationsHist[t][pe][1]->GetBinError(b); // stat. error of <<4'>> | |
5859 | // Covariances: | |
5860 | Double_t wCovTwoTwoReduced = fDiffFlowCovariances[t][pe][0]->GetBinContent(b); // Cov(<2>,<2'>) * prefactor(<2>,<2'>) | |
5861 | Double_t wCovTwoFourReduced = fDiffFlowCovariances[t][pe][1]->GetBinContent(b); // Cov(<2>,<4'>) * prefactor(<2>,<4'>) | |
5862 | Double_t wCovTwoReducedFourReduced = fDiffFlowCovariances[t][pe][4]->GetBinContent(b); // Cov(<2'>,<4'>) * prefactor(<2'>,<4'>) | |
5863 | // QC{2'}: | |
5864 | Double_t qc2Prime = twoPrime; // QC{2'} | |
5865 | Double_t qc2PrimeError = twoPrimeError; // stat. error of QC{2'} | |
5866 | fDiffFlowCumulants[t][pe][0]->SetBinContent(b,qc2Prime); | |
5867 | fDiffFlowCumulants[t][pe][0]->SetBinError(b,qc2PrimeError); | |
5868 | // QC{4'}: | |
5869 | Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>> | |
5870 | Double_t qc4PrimeError = 0.; // stat. error of QC{4'} | |
5871 | Double_t qc4PrimeErrorSquared = 4.*pow(twoPrime,2.)*pow(twoError,2.) | |
5872 | + 4.*pow(two,2.)*pow(twoPrimeError,2.) | |
5873 | + pow(fourPrimeError,2.) | |
5874 | + 8.*two*twoPrime*wCovTwoTwoReduced | |
5875 | - 4.*twoPrime*wCovTwoFourReduced | |
5876 | - 4.*two*wCovTwoReducedFourReduced; | |
5877 | if(qc4PrimeErrorSquared>0.) | |
5878 | { | |
5879 | qc4PrimeError = pow(qc4PrimeErrorSquared,0.5); | |
489d5531 | 5880 | } |
1268c371 | 5881 | fDiffFlowCumulants[t][pe][1]->SetBinContent(b,qc4Prime); |
5882 | fDiffFlowCumulants[t][pe][1]->SetBinError(b,qc4PrimeError); | |
489d5531 | 5883 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
489d5531 | 5884 | |
1268c371 | 5885 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulants(TString type, Bool_t useParticleWeights, TString eventWeights); |
489d5531 | 5886 | |
5887 | //================================================================================================================================ | |
5888 | ||
1268c371 | 5889 | void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCumulants(TString type) |
489d5531 | 5890 | { |
1268c371 | 5891 | // Calculate 2D differential cumulants. |
489d5531 | 5892 | |
1268c371 | 5893 | // Remark: correction for detector effects and error propagation not implemented yet for 2D differential cumulants. |
489d5531 | 5894 | |
1268c371 | 5895 | Int_t t = 0; |
489d5531 | 5896 | |
5897 | if(type == "RP") | |
5898 | { | |
1268c371 | 5899 | t = 0; |
489d5531 | 5900 | } else if(type == "POI") |
5901 | { | |
1268c371 | 5902 | t = 1; |
5903 | } | |
5904 | ||
5905 | // Reference correlation <<2>>: | |
5906 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); | |
489d5531 | 5907 | |
1268c371 | 5908 | // Looping over all (pt,eta) bins and calculating differential flow cumulants: |
5909 | for(Int_t p=1;p<=fnBinsPt;p++) | |
489d5531 | 5910 | { |
5911 | for(Int_t e=1;e<=fnBinsEta;e++) | |
5912 | { | |
1268c371 | 5913 | // Reduced correlations: |
5914 | Double_t twoPrime = f2DDiffFlowCorrelationsPro[t][0]->GetBinContent(f2DDiffFlowCorrelationsPro[t][0]->GetBin(p,e)); // <<2'>>(pt,eta) | |
5915 | Double_t fourPrime = f2DDiffFlowCorrelationsPro[t][1]->GetBinContent(f2DDiffFlowCorrelationsPro[t][1]->GetBin(p,e)); // <<4'>>(pt,eta) | |
5916 | // Cumulants: | |
5917 | Double_t qc2Prime = twoPrime; // QC{2'} = <<2'>> | |
5918 | f2DDiffFlowCumulants[t][0]->SetBinContent(f2DDiffFlowCumulants[t][0]->GetBin(p,e),qc2Prime); | |
5919 | Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>> | |
5920 | f2DDiffFlowCumulants[t][1]->SetBinContent(f2DDiffFlowCumulants[t][1]->GetBin(p,e),qc4Prime); | |
489d5531 | 5921 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) |
489d5531 | 5922 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
5923 | ||
1268c371 | 5924 | } // end of void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCumulants(TString type) |
489d5531 | 5925 | |
489d5531 | 5926 | //================================================================================================================================ |
5927 | ||
489d5531 | 5928 | void AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type) |
5929 | { | |
1268c371 | 5930 | // Calculate final results for integrated flow of RPs and POIs. |
489d5531 | 5931 | |
1268c371 | 5932 | // to be improved - check if the integrated flow calculation here is actually correct |
5933 | ||
5934 | Int_t t = 0; // RP = 0, POI = 1 | |
489d5531 | 5935 | |
5936 | if(type == "RP") | |
5937 | { | |
1268c371 | 5938 | t = 0; |
489d5531 | 5939 | } else if(type == "POI") |
5940 | { | |
1268c371 | 5941 | t = 1; |
5942 | } | |
489d5531 | 5943 | |
489d5531 | 5944 | // pt yield: |
5945 | TH1F *yield2ndPt = NULL; | |
5946 | TH1F *yield4thPt = NULL; | |
5947 | TH1F *yield6thPt = NULL; | |
5948 | TH1F *yield8thPt = NULL; | |
5949 | ||
5950 | if(type == "POI") | |
5951 | { | |
dd442cd2 | 5952 | if(fFillMultipleControlHistograms) |
5953 | { | |
5954 | yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtPOI())->Clone(); | |
5955 | yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtPOI())->Clone(); | |
5956 | yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtPOI())->Clone(); | |
5957 | yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtPOI())->Clone(); | |
5958 | } else | |
5959 | { | |
5960 | yield2ndPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
5961 | yield4thPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
5962 | yield6thPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
5963 | yield8thPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
5964 | } | |
489d5531 | 5965 | } |
5966 | else if(type == "RP") | |
5967 | { | |
dd442cd2 | 5968 | if(fFillMultipleControlHistograms) |
5969 | { | |
5970 | yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtRP())->Clone(); | |
5971 | yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtRP())->Clone(); | |
5972 | yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtRP())->Clone(); | |
5973 | yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtRP())->Clone(); | |
5974 | } else | |
5975 | { | |
5976 | yield2ndPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
5977 | yield4thPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
5978 | yield6thPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
5979 | yield8thPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
5980 | } | |
489d5531 | 5981 | } |
5982 | ||
0d11c335 | 5983 | if(!yield2ndPt){return;} |
5984 | if(!yield4thPt){return;} | |
5985 | if(!yield6thPt){return;} | |
5986 | if(!yield8thPt){return;} | |
5987 | ||
489d5531 | 5988 | Int_t nBinsPt = yield2ndPt->GetNbinsX(); |
5989 | ||
5990 | TH1D *flow2ndPt = NULL; | |
5991 | TH1D *flow4thPt = NULL; | |
5992 | TH1D *flow6thPt = NULL; | |
5993 | TH1D *flow8thPt = NULL; | |
5994 | ||
5995 | // to be improved (hardwired pt index) | |
5996 | flow2ndPt = (TH1D*)fDiffFlow[t][0][0]->Clone(); | |
5997 | flow4thPt = (TH1D*)fDiffFlow[t][0][1]->Clone(); | |
5998 | flow6thPt = (TH1D*)fDiffFlow[t][0][2]->Clone(); | |
5999 | flow8thPt = (TH1D*)fDiffFlow[t][0][3]->Clone(); | |
0d11c335 | 6000 | |
6001 | if(!flow2ndPt){return;} | |
6002 | if(!flow4thPt){return;} | |
6003 | if(!flow6thPt){return;} | |
6004 | if(!flow8thPt){return;} | |
489d5531 | 6005 | |
6006 | Double_t dvn2nd = 0., dvn4th = 0., dvn6th = 0., dvn8th = 0.; // differential flow | |
6007 | Double_t dErrvn2nd = 0., dErrvn4th = 0., dErrvn6th = 0., dErrvn8th = 0.; // error on differential flow | |
6008 | ||
6009 | Double_t dVn2nd = 0., dVn4th = 0., dVn6th = 0., dVn8th = 0.; // integrated flow | |
6010 | Double_t dErrVn2nd = 0., dErrVn4th = 0., dErrVn6th = 0., dErrVn8th = 0.; // error on integrated flow | |
6011 | ||
6012 | Double_t dYield2nd = 0., dYield4th = 0., dYield6th = 0., dYield8th = 0.; // pt yield | |
6013 | Double_t dSum2nd = 0., dSum4th = 0., dSum6th = 0., dSum8th = 0.; // needed for normalizing integrated flow | |
6014 | ||
6015 | // looping over pt bins: | |
6016 | for(Int_t p=1;p<nBinsPt+1;p++) | |
6017 | { | |
6018 | dvn2nd = flow2ndPt->GetBinContent(p); | |
6019 | dvn4th = flow4thPt->GetBinContent(p); | |
6020 | dvn6th = flow6thPt->GetBinContent(p); | |
6021 | dvn8th = flow8thPt->GetBinContent(p); | |
6022 | ||
6023 | dErrvn2nd = flow2ndPt->GetBinError(p); | |
6024 | dErrvn4th = flow4thPt->GetBinError(p); | |
6025 | dErrvn6th = flow6thPt->GetBinError(p); | |
6026 | dErrvn8th = flow8thPt->GetBinError(p); | |
6027 | ||
6028 | dYield2nd = yield2ndPt->GetBinContent(p); | |
6029 | dYield4th = yield4thPt->GetBinContent(p); | |
6030 | dYield6th = yield6thPt->GetBinContent(p); | |
6031 | dYield8th = yield8thPt->GetBinContent(p); | |
6032 | ||
6033 | dVn2nd += dvn2nd*dYield2nd; | |
6034 | dVn4th += dvn4th*dYield4th; | |
6035 | dVn6th += dvn6th*dYield6th; | |
6036 | dVn8th += dvn8th*dYield8th; | |
6037 | ||
6038 | dSum2nd += dYield2nd; | |
6039 | dSum4th += dYield4th; | |
6040 | dSum6th += dYield6th; | |
6041 | dSum8th += dYield8th; | |
6042 | ||
6043 | dErrVn2nd += dYield2nd*dYield2nd*dErrvn2nd*dErrvn2nd; // ro be improved (check this relation) | |
6044 | dErrVn4th += dYield4th*dYield4th*dErrvn4th*dErrvn4th; | |
6045 | dErrVn6th += dYield6th*dYield6th*dErrvn6th*dErrvn6th; | |
6046 | dErrVn8th += dYield8th*dYield8th*dErrvn8th*dErrvn8th; | |
6047 | ||
6048 | } // end of for(Int_t p=1;p<nBinsPt+1;p++) | |
6049 | ||
6050 | // normalizing the results for integrated flow: | |
6051 | if(dSum2nd) | |
6052 | { | |
6053 | dVn2nd /= dSum2nd; | |
6054 | dErrVn2nd /= (dSum2nd*dSum2nd); | |
6055 | dErrVn2nd = TMath::Sqrt(dErrVn2nd); | |
6056 | } | |
6057 | if(dSum4th) | |
6058 | { | |
6059 | dVn4th /= dSum4th; | |
6060 | dErrVn4th /= (dSum4th*dSum4th); | |
6061 | dErrVn4th = TMath::Sqrt(dErrVn4th); | |
6062 | } | |
6063 | //if(dSum6th) dVn6th/=dSum6th; | |
6064 | //if(dSum8th) dVn8th/=dSum8th; | |
6065 | ||
6066 | // storing the results for integrated flow in common histos: (to be improved: new method for this?) | |
6067 | if(type == "POI") | |
6068 | { | |
6069 | fCommonHistsResults2nd->FillIntegratedFlowPOI(dVn2nd,dErrVn2nd); | |
6070 | fCommonHistsResults4th->FillIntegratedFlowPOI(dVn4th,dErrVn4th); | |
6071 | fCommonHistsResults6th->FillIntegratedFlowPOI(dVn6th,0.); // to be improved (errors) | |
6072 | fCommonHistsResults8th->FillIntegratedFlowPOI(dVn8th,0.); // to be improved (errors) | |
6073 | } | |
6074 | else if (type == "RP") | |
6075 | { | |
6076 | fCommonHistsResults2nd->FillIntegratedFlowRP(dVn2nd,dErrVn2nd); | |
6077 | fCommonHistsResults4th->FillIntegratedFlowRP(dVn4th,dErrVn4th); | |
6078 | fCommonHistsResults6th->FillIntegratedFlowRP(dVn6th,0.); // to be improved (errors) | |
6079 | fCommonHistsResults8th->FillIntegratedFlowRP(dVn8th,0.); // to be improved (errors) | |
6080 | } | |
6081 | ||
6082 | delete flow2ndPt; | |
6083 | delete flow4thPt; | |
6084 | //delete flow6thPt; | |
6085 | //delete flow8thPt; | |
6086 | ||
6087 | delete yield2ndPt; | |
6088 | delete yield4thPt; | |
6089 | delete yield6thPt; | |
6090 | delete yield8thPt; | |
6091 | ||
6092 | } // end of AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type) | |
6093 | ||
489d5531 | 6094 | //================================================================================================================================ |
6095 | ||
489d5531 | 6096 | void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions() |
6097 | { | |
6098 | // Initialize all arrays used for distributions. | |
6099 | ||
6100 | // a) Initialize arrays of histograms used to hold distributions of correlations; | |
6101 | // b) Initialize array to hold min and max values of correlations. | |
6102 | ||
6103 | // a) Initialize arrays of histograms used to hold distributions of correlations: | |
6104 | for(Int_t di=0;di<4;di++) // distribution index | |
6105 | { | |
6106 | fDistributions[di] = NULL; | |
6107 | } | |
6108 | ||
6109 | // b) Initialize default min and max values of correlations: | |
6110 | // (Remark: The default values bellow were chosen for v2=5% and M=500) | |
6111 | fMinValueOfCorrelation[0] = -0.01; // <2>_min | |
6112 | fMaxValueOfCorrelation[0] = 0.04; // <2>_max | |
6113 | fMinValueOfCorrelation[1] = -0.00002; // <4>_min | |
6114 | fMaxValueOfCorrelation[1] = 0.00015; // <4>_max | |
6115 | fMinValueOfCorrelation[2] = -0.0000003; // <6>_min | |
6116 | fMaxValueOfCorrelation[2] = 0.0000006; // <6>_max | |
6117 | fMinValueOfCorrelation[3] = -0.000000006; // <8>_min | |
6118 | fMaxValueOfCorrelation[3] = 0.000000003; // <8>_max | |
6119 | ||
6120 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions() | |
6121 | ||
489d5531 | 6122 | //================================================================================================================================ |
6123 | ||
e5834fcb | 6124 | void AliFlowAnalysisWithQCumulants::InitializeArraysForVarious() |
6125 | { | |
6126 | // Initialize all arrays used for various unclassified objects. | |
6127 | ||
6128 | for(Int_t p=0;p<4;p++) // [v_min,v_max,refMult_min,refMult_max] | |
6129 | { | |
6130 | fPhiDistributionForOneEventSettings[p] = 0.; | |
6131 | } | |
6132 | ||
6133 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForVarious() | |
6134 | ||
6135 | //================================================================================================================================ | |
489d5531 | 6136 | |
6137 | void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions() | |
6138 | { | |
6139 | // a) Book profile to hold all flags for distributions of correlations; | |
6140 | // b) Book all histograms to hold distributions of correlations. | |
6141 | ||
6142 | TString correlationIndex[4] = {"<2>","<4>","<6>","<8>"}; // to be improved (should I promote this to data members?) | |
6143 | ||
6144 | // a) Book profile to hold all flags for distributions of correlations: | |
6145 | TString distributionsFlagsName = "fDistributionsFlags"; | |
6146 | distributionsFlagsName += fAnalysisLabel->Data(); | |
6147 | fDistributionsFlags = new TProfile(distributionsFlagsName.Data(),"Flags for Distributions of Correlations",9,0,9); | |
6148 | fDistributionsFlags->SetTickLength(-0.01,"Y"); | |
6149 | fDistributionsFlags->SetMarkerStyle(25); | |
6150 | fDistributionsFlags->SetLabelSize(0.05); | |
6151 | fDistributionsFlags->SetLabelOffset(0.02,"Y"); | |
6152 | fDistributionsFlags->GetXaxis()->SetBinLabel(1,"Store or not?"); | |
6153 | fDistributionsFlags->GetXaxis()->SetBinLabel(2,"<2>_{min}"); | |
6154 | fDistributionsFlags->GetXaxis()->SetBinLabel(3,"<2>_{max}"); | |
6155 | fDistributionsFlags->GetXaxis()->SetBinLabel(4,"<4>_{min}"); | |
6156 | fDistributionsFlags->GetXaxis()->SetBinLabel(5,"<4>_{max}"); | |
6157 | fDistributionsFlags->GetXaxis()->SetBinLabel(6,"<6>_{min}"); | |
6158 | fDistributionsFlags->GetXaxis()->SetBinLabel(7,"<6>_{max}"); | |
6159 | fDistributionsFlags->GetXaxis()->SetBinLabel(8,"<8>_{min}"); | |
6160 | fDistributionsFlags->GetXaxis()->SetBinLabel(9,"<8>_{max}"); | |
6161 | fDistributionsList->Add(fDistributionsFlags); | |
6162 | ||
6163 | // b) Book all histograms to hold distributions of correlations. | |
6164 | if(fStoreDistributions) | |
6165 | { | |
6166 | TString distributionsName = "fDistributions"; | |
6167 | distributionsName += fAnalysisLabel->Data(); | |
6168 | for(Int_t di=0;di<4;di++) // distribution index | |
6169 | { | |
6170 | fDistributions[di] = new TH1D(Form("Distribution of %s",correlationIndex[di].Data()),Form("Distribution of %s",correlationIndex[di].Data()),10000,fMinValueOfCorrelation[di],fMaxValueOfCorrelation[di]); | |
6171 | fDistributions[di]->SetXTitle(correlationIndex[di].Data()); | |
6172 | fDistributionsList->Add(fDistributions[di]); | |
6173 | } // end of for(Int_t di=0;di<4;di++) // distribution index | |
6174 | } // end of if(fStoreDistributions) | |
6175 | ||
6176 | } // end of void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions() | |
6177 | ||
489d5531 | 6178 | //================================================================================================================================ |
6179 | ||
e5834fcb | 6180 | void AliFlowAnalysisWithQCumulants::BookEverythingForVarious() |
6181 | { | |
6182 | // Book all objects for various unclassified quantities. | |
6183 | ||
6184 | if(!fStorePhiDistributionForOneEvent){return;} | |
6185 | ||
6186 | // a) Book histogram holding phi distribution for single event to illustrate flow. | |
6187 | ||
6188 | // a) Book histogram holding phi distribution for single event to illustrate flow: | |
6189 | fPhiDistributionForOneEvent = new TH1D("fPhiDistributionForOneEvent","",360,0.,TMath::TwoPi()); | |
6190 | fPhiDistributionForOneEvent->GetXaxis()->SetTitle("#phi"); | |
6191 | fVariousList->Add(fPhiDistributionForOneEvent); | |
6192 | ||
6193 | } // end of void AliFlowAnalysisWithQCumulants::BookEverythingForVarious() | |
6194 | ||
6195 | //================================================================================================================================ | |
489d5531 | 6196 | |
6197 | void AliFlowAnalysisWithQCumulants::StoreFlagsForDistributions() | |
6198 | { | |
6199 | // Store all flags for distributiuons of correlations in profile fDistributionsFlags. | |
6200 | ||
6201 | if(!fDistributionsFlags) | |
6202 | { | |
6203 | cout<<"WARNING: fDistributionsFlags is NULL in AFAWQC::SDF() !!!!"<<endl; | |
6204 | exit(0); | |
6205 | } | |
6206 | ||
6207 | fDistributionsFlags->Fill(0.5,(Int_t)fStoreDistributions); // histos with distributions of correlations stored or not in the output file | |
6208 | // store min and max values of correlations: | |
6209 | for(Int_t di=0;di<4;di++) // distribution index | |
6210 | { | |
6211 | fDistributionsFlags->Fill(1.5+2.*(Double_t)di,fMinValueOfCorrelation[di]); | |
6212 | fDistributionsFlags->Fill(2.5+2.*(Double_t)di,fMaxValueOfCorrelation[di]); | |
6213 | } | |
6214 | ||
6215 | } // end of void AliFlowAnalysisWithQCumulants::StoreFlagsForDistributions() | |
6216 | ||
489d5531 | 6217 | //================================================================================================================================ |
6218 | ||
489d5531 | 6219 | void AliFlowAnalysisWithQCumulants::StoreDistributionsOfCorrelations() |
6220 | { | |
6221 | // Store distributions of correlations. | |
6222 | ||
6223 | if(!(fIntFlowCorrelationsEBE && fIntFlowEventWeightsForCorrelationsEBE)) | |
6224 | { | |
6225 | cout<<"WARNING: fIntFlowCorrelationsEBE && fIntFlowEventWeightsForCorrelationsEBE"<<endl; | |
6226 | cout<<" is NULL in AFAWQC::SDOC() !!!!"<<endl; | |
6227 | exit(0); | |
6228 | } | |
6229 | ||
6230 | for(Int_t di=0;di<4;di++) // distribution index | |
6231 | { | |
6232 | if(!fDistributions[di]) | |
6233 | { | |
6234 | cout<<"WARNING: fDistributions[di] is NULL in AFAWQC::SDOC() !!!!"<<endl; | |
6235 | cout<<"di = "<<di<<endl; | |
6236 | exit(0); | |
6237 | } else | |
6238 | { | |
6239 | fDistributions[di]->Fill(fIntFlowCorrelationsEBE->GetBinContent(di+1),fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(di+1)); | |
6240 | } | |
6241 | } // end of for(Int_t di=0;di<4;di++) // distribution index | |
6242 | ||
6243 | } // end of void AliFlowAnalysisWithQCumulants::StoreDistributionsOfCorrelations() | |
6244 | ||
489d5531 | 6245 | //================================================================================================================================ |
6246 | ||
489d5531 | 6247 | void AliFlowAnalysisWithQCumulants::BookAndNestAllLists() |
6248 | { | |
6249 | // Book and nest all lists nested in the base list fHistList. | |
6250 | // a) Book and nest lists for integrated flow; | |
6251 | // b) Book and nest lists for differential flow; | |
6252 | // c) Book and nest list for particle weights; | |
6253 | // d) Book and nest list for distributions; | |
e5834fcb | 6254 | // e) Book and nest list for various unclassified objects; |
6255 | // f) Book and nest list for nested loops. | |
489d5531 | 6256 | |
6257 | // a) Book and nest all lists for integrated flow: | |
1268c371 | 6258 | // Base list for integrated flow: |
489d5531 | 6259 | fIntFlowList = new TList(); |
6260 | fIntFlowList->SetName("Integrated Flow"); | |
6261 | fIntFlowList->SetOwner(kTRUE); | |
6262 | fHistList->Add(fIntFlowList); | |
1268c371 | 6263 | // List holding profiles: |
489d5531 | 6264 | fIntFlowProfiles = new TList(); |
6265 | fIntFlowProfiles->SetName("Profiles"); | |
6266 | fIntFlowProfiles->SetOwner(kTRUE); | |
6267 | fIntFlowList->Add(fIntFlowProfiles); | |
3435cacb | 6268 | // List holding all profiles with results for correlations vs M: |
6269 | if(fCalculateAllCorrelationsVsM) | |
6270 | { | |
6271 | fIntFlowAllCorrelationsVsM = new TList(); | |
6272 | fIntFlowAllCorrelationsVsM->SetName("Correlations vs M"); | |
6273 | fIntFlowAllCorrelationsVsM->SetOwner(kTRUE); | |
6274 | fIntFlowProfiles->Add(fIntFlowAllCorrelationsVsM); | |
6275 | } // end of if(fCalculateAllCorrelationsVsM) | |
1268c371 | 6276 | // List holding histograms with results: |
489d5531 | 6277 | fIntFlowResults = new TList(); |
6278 | fIntFlowResults->SetName("Results"); | |
6279 | fIntFlowResults->SetOwner(kTRUE); | |
6280 | fIntFlowList->Add(fIntFlowResults); | |
6281 | ||
1268c371 | 6282 | // b) Book and nest lists for differential flow: |
6283 | this->BookAndNestListsForDifferentialFlow(); | |
6284 | ||
6285 | // c) Book and nest list for particle weights: | |
6286 | fWeightsList->SetName("Weights"); | |
6287 | fWeightsList->SetOwner(kTRUE); | |
6288 | fHistList->Add(fWeightsList); | |
6289 | ||
6290 | // d) Book and nest list for distributions: | |
6291 | fDistributionsList = new TList(); | |
6292 | fDistributionsList->SetName("Distributions"); | |
6293 | fDistributionsList->SetOwner(kTRUE); | |
6294 | fHistList->Add(fDistributionsList); | |
6295 | ||
6296 | // e) Book and nest list for various unclassified objects: | |
6297 | if(fStorePhiDistributionForOneEvent) | |
6298 | { | |
6299 | fVariousList = new TList(); | |
6300 | fVariousList->SetName("Various"); | |
6301 | fVariousList->SetOwner(kTRUE); | |
6302 | fHistList->Add(fVariousList); | |
6303 | } | |
6304 | ||
64e500e3 | 6305 | // f) Book and nest list for other differential correlators: |
6306 | fOtherDiffCorrelatorsList = new TList(); | |
6307 | fOtherDiffCorrelatorsList->SetName("Other differential correlators"); | |
6308 | fOtherDiffCorrelatorsList->SetOwner(kTRUE); | |
6309 | fHistList->Add(fOtherDiffCorrelatorsList); | |
6310 | ||
6311 | // g) Book and nest list for nested loops: | |
1268c371 | 6312 | fNestedLoopsList = new TList(); |
6313 | fNestedLoopsList->SetName("Nested Loops"); | |
6314 | fNestedLoopsList->SetOwner(kTRUE); | |
6315 | fHistList->Add(fNestedLoopsList); | |
6316 | ||
6317 | } // end of void AliFlowAnalysisWithQCumulants::BookAndNestAllLists() | |
6318 | ||
6319 | //================================================================================================================================ | |
6320 | ||
6321 | void AliFlowAnalysisWithQCumulants::BookAndNestListsForDifferentialFlow() | |
6322 | { | |
6323 | // Book and nest lists for differential flow. | |
6324 | ||
6325 | // Base list for differential flow objects: | |
489d5531 | 6326 | fDiffFlowList = new TList(); |
6327 | fDiffFlowList->SetName("Differential Flow"); | |
6328 | fDiffFlowList->SetOwner(kTRUE); | |
6329 | fHistList->Add(fDiffFlowList); | |
1268c371 | 6330 | |
6331 | // Local flags: | |
6332 | TString typeFlag[2] = {"RP","POI"}; | |
6333 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
6334 | TString powerFlag[2] = {"linear","quadratic"}; | |
6335 | ||
6336 | // 2D: | |
6337 | if(fCalculate2DDiffFlow) | |
6338 | { | |
6339 | fDiffFlow2D = new TList(); | |
6340 | fDiffFlow2D->SetName("2D"); | |
6341 | fDiffFlow2D->SetOwner(kTRUE); | |
6342 | fDiffFlowList->Add(fDiffFlow2D); | |
6343 | for(Int_t t=0;t<2;t++) | |
6344 | { | |
6345 | f2DDiffFlowCorrelationsProList[t] = new TList(); | |
6346 | f2DDiffFlowCorrelationsProList[t]->SetOwner(kTRUE); | |
6347 | f2DDiffFlowCorrelationsProList[t]->SetName(Form("Profiles with 2D correlations (%s)",typeFlag[t].Data())); | |
6348 | fDiffFlow2D->Add(f2DDiffFlowCorrelationsProList[t]); | |
6349 | } // end of for(Int_t t=0;t<2;t++) | |
6350 | } // end of if(fCalculate2DDiffFlow) | |
6351 | ||
6352 | // What follows bellow in this method is relevant only for 1D differential flow: | |
6353 | if(!fCalculateDiffFlow){return;} | |
6354 | ||
6355 | // List holding profiles: | |
489d5531 | 6356 | fDiffFlowProfiles = new TList(); |
6357 | fDiffFlowProfiles->SetName("Profiles"); | |
6358 | fDiffFlowProfiles->SetOwner(kTRUE); | |
6359 | fDiffFlowList->Add(fDiffFlowProfiles); | |
1268c371 | 6360 | // List holding histograms with results: |
489d5531 | 6361 | fDiffFlowResults = new TList(); |
6362 | fDiffFlowResults->SetName("Results"); | |
6363 | fDiffFlowResults->SetOwner(kTRUE); | |
6364 | fDiffFlowList->Add(fDiffFlowResults); | |
1268c371 | 6365 | // Flags used for naming nested lists in list fDiffFlowProfiles and fDiffFlowResults: |
489d5531 | 6366 | TList list; |
6367 | list.SetOwner(kTRUE); | |
1268c371 | 6368 | // Nested lists in fDiffFlowProfiles (~/Differential Flow/Profiles): |
489d5531 | 6369 | for(Int_t t=0;t<2;t++) // type: RP or POI |
6370 | { | |
6371 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
6372 | { | |
6373 | // list holding profiles with correlations: | |
6374 | fDiffFlowCorrelationsProList[t][pe] = (TList*)list.Clone(); | |
6375 | fDiffFlowCorrelationsProList[t][pe]->SetName(Form("Profiles with correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6376 | fDiffFlowProfiles->Add(fDiffFlowCorrelationsProList[t][pe]); | |
6377 | // list holding profiles with products of correlations: | |
6378 | fDiffFlowProductOfCorrelationsProList[t][pe] = (TList*)list.Clone(); | |
6379 | fDiffFlowProductOfCorrelationsProList[t][pe]->SetName(Form("Profiles with products of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6380 | fDiffFlowProfiles->Add(fDiffFlowProductOfCorrelationsProList[t][pe]); | |
6381 | // list holding profiles with corrections: | |
6382 | fDiffFlowCorrectionsProList[t][pe] = (TList*)list.Clone(); | |
6383 | fDiffFlowCorrectionsProList[t][pe]->SetName(Form("Profiles with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6384 | fDiffFlowProfiles->Add(fDiffFlowCorrectionsProList[t][pe]); | |
6385 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
6386 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
6387 | // nested lists in fDiffFlowResults (~/Differential Flow/Results): | |
6388 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
6389 | { | |
6390 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
6391 | { | |
6392 | // list holding histograms with correlations: | |
6393 | fDiffFlowCorrelationsHistList[t][pe] = (TList*)list.Clone(); | |
6394 | fDiffFlowCorrelationsHistList[t][pe]->SetName(Form("Correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6395 | fDiffFlowResults->Add(fDiffFlowCorrelationsHistList[t][pe]); | |
6396 | // list holding histograms with corrections: | |
6397 | fDiffFlowCorrectionsHistList[t][pe] = (TList*)list.Clone(); | |
6398 | fDiffFlowCorrectionsHistList[t][pe]->SetName(Form("Histograms with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6399 | fDiffFlowResults->Add(fDiffFlowCorrectionsHistList[t][pe]); | |
6400 | for(Int_t power=0;power<2;power++) | |
6401 | { | |
6402 | // list holding histograms with sums of event weights: | |
6403 | fDiffFlowSumOfEventWeightsHistList[t][pe][power] = (TList*)list.Clone(); | |
6404 | fDiffFlowSumOfEventWeightsHistList[t][pe][power]->SetName(Form("Sum of %s event weights (%s, %s)",powerFlag[power].Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6405 | fDiffFlowResults->Add(fDiffFlowSumOfEventWeightsHistList[t][pe][power]); | |
6406 | } // end of for(Int_t power=0;power<2;power++) | |
6407 | // list holding histograms with sums of products of event weights: | |
6408 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe] = (TList*)list.Clone(); | |
6409 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]->SetName(Form("Sum of products of event weights (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6410 | fDiffFlowResults->Add(fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]); | |
6411 | // list holding histograms with covariances of correlations: | |
6412 | fDiffFlowCovariancesHistList[t][pe] = (TList*)list.Clone(); | |
6413 | fDiffFlowCovariancesHistList[t][pe]->SetName(Form("Covariances of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6414 | fDiffFlowResults->Add(fDiffFlowCovariancesHistList[t][pe]); | |
6415 | // list holding histograms with differential Q-cumulants: | |
6416 | fDiffFlowCumulantsHistList[t][pe] = (TList*)list.Clone(); | |
6417 | fDiffFlowCumulantsHistList[t][pe]->SetName(Form("Differential Q-cumulants (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6418 | fDiffFlowResults->Add(fDiffFlowCumulantsHistList[t][pe]); | |
1268c371 | 6419 | // list holding histograms which quantify detector bias to differential Q-cumulants: |
6420 | fDiffFlowDetectorBiasHistList[t][pe] = (TList*)list.Clone(); | |
6421 | fDiffFlowDetectorBiasHistList[t][pe]->SetName(Form("Detector bias (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6422 | fDiffFlowResults->Add(fDiffFlowDetectorBiasHistList[t][pe]); | |
489d5531 | 6423 | // list holding histograms with differential flow estimates from Q-cumulants: |
6424 | fDiffFlowHistList[t][pe] = (TList*)list.Clone(); | |
6425 | fDiffFlowHistList[t][pe]->SetName(Form("Differential flow (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6426 | fDiffFlowResults->Add(fDiffFlowHistList[t][pe]); | |
6427 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
6428 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
6429 | ||
1268c371 | 6430 | } // end of void AliFlowAnalysisWithQCumulants::BookAndNestListsForDifferentialFlow() |
489d5531 | 6431 | |
6432 | //================================================================================================================================ | |
6433 | ||
489d5531 | 6434 | void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type) |
6435 | { | |
1268c371 | 6436 | // Fill common result histograms for differential flow. |
489d5531 | 6437 | |
1268c371 | 6438 | Int_t t = 0; |
489d5531 | 6439 | |
6440 | if(type == "RP") | |
6441 | { | |
1268c371 | 6442 | t = 0; |
489d5531 | 6443 | } else if(type == "POI") |
6444 | { | |
1268c371 | 6445 | t = 1; |
489d5531 | 6446 | } |
1268c371 | 6447 | |
6448 | // to be improved - check all pointers used in this method | |
489d5531 | 6449 | |
6450 | if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th)) | |
6451 | { | |
6452 | cout<<"WARNING: fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th"<<endl; | |
6453 | cout<<" is NULL in AFAWQC::FCHRIF() !!!!"<<endl; | |
6454 | exit(0); | |
6455 | } | |
6456 | ||
6457 | // pt: | |
6458 | for(Int_t p=1;p<=fnBinsPt;p++) | |
6459 | { | |
6460 | Double_t v2 = fDiffFlow[t][0][0]->GetBinContent(p); | |
6461 | Double_t v4 = fDiffFlow[t][0][1]->GetBinContent(p); | |
6462 | Double_t v6 = fDiffFlow[t][0][2]->GetBinContent(p); | |
6463 | Double_t v8 = fDiffFlow[t][0][3]->GetBinContent(p); | |
6464 | ||
6465 | Double_t v2Error = fDiffFlow[t][0][0]->GetBinError(p); | |
6466 | Double_t v4Error = fDiffFlow[t][0][1]->GetBinError(p); | |
6467 | //Double_t v6Error = fFinalFlow1D[t][pW][nua][0][2]->GetBinError(p); | |
6468 | //Double_t v8Error = fFinalFlow1D[t][pW][nua][0][3]->GetBinError(p); | |
6469 | ||
6470 | if(type == "RP") | |
6471 | { | |
6472 | fCommonHistsResults2nd->FillDifferentialFlowPtRP(p,v2,v2Error); | |
6473 | fCommonHistsResults4th->FillDifferentialFlowPtRP(p,v4,v4Error); | |
6474 | fCommonHistsResults6th->FillDifferentialFlowPtRP(p,v6,0.); | |
6475 | fCommonHistsResults8th->FillDifferentialFlowPtRP(p,v8,0.); | |
6476 | } else if(type == "POI") | |
6477 | { | |
6478 | fCommonHistsResults2nd->FillDifferentialFlowPtPOI(p,v2,v2Error); | |
6479 | fCommonHistsResults4th->FillDifferentialFlowPtPOI(p,v4,v4Error); | |
6480 | fCommonHistsResults6th->FillDifferentialFlowPtPOI(p,v6,0.); | |
6481 | fCommonHistsResults8th->FillDifferentialFlowPtPOI(p,v8,0.); | |
6482 | } | |
6483 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
6484 | ||
6485 | // eta: | |
6486 | for(Int_t e=1;e<=fnBinsEta;e++) | |
6487 | { | |
6488 | Double_t v2 = fDiffFlow[t][1][0]->GetBinContent(e); | |
6489 | Double_t v4 = fDiffFlow[t][1][1]->GetBinContent(e); | |
6490 | Double_t v6 = fDiffFlow[t][1][2]->GetBinContent(e); | |
6491 | Double_t v8 = fDiffFlow[t][1][3]->GetBinContent(e); | |
6492 | ||
6493 | Double_t v2Error = fDiffFlow[t][1][0]->GetBinError(e); | |
6494 | Double_t v4Error = fDiffFlow[t][1][1]->GetBinError(e); | |
6495 | //Double_t v6Error = fDiffFlow[t][1][2]->GetBinError(e); | |
6496 | //Double_t v8Error = fDiffFlow[t][1][3]->GetBinError(e); | |
6497 | ||
6498 | if(type == "RP") | |
6499 | { | |
6500 | fCommonHistsResults2nd->FillDifferentialFlowEtaRP(e,v2,v2Error); | |
6501 | fCommonHistsResults4th->FillDifferentialFlowEtaRP(e,v4,v4Error); | |
6502 | fCommonHistsResults6th->FillDifferentialFlowEtaRP(e,v6,0.); | |
6503 | fCommonHistsResults8th->FillDifferentialFlowEtaRP(e,v8,0.); | |
6504 | } else if(type == "POI") | |
6505 | { | |
6506 | fCommonHistsResults2nd->FillDifferentialFlowEtaPOI(e,v2,v2Error); | |
6507 | fCommonHistsResults4th->FillDifferentialFlowEtaPOI(e,v4,v4Error); | |
6508 | fCommonHistsResults6th->FillDifferentialFlowEtaPOI(e,v6,0.); | |
6509 | fCommonHistsResults8th->FillDifferentialFlowEtaPOI(e,v8,0.); | |
6510 | } | |
6511 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
6512 | ||
6513 | } // end of void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights, Bool_t correctedForNUA) | |
6514 | ||
489d5531 | 6515 | //================================================================================================================================ |
6516 | ||
1268c371 | 6517 | void AliFlowAnalysisWithQCumulants::CommonConstants(TString method) |
489d5531 | 6518 | { |
1268c371 | 6519 | // Access and store common constants. |
6520 | ||
6521 | // a) If this method was called in Init() access common constants from AliFlowCommonConstants; | |
6522 | // b) If this method was called in Init() book and fill TProfile to hold constants accessed in a); | |
6523 | // c) If this method was called in Finish() access common constants from TProfile booked and filled in b). | |
6524 | ||
6525 | if(method == "Init") | |
6526 | { | |
6527 | // a) If this method was called in Init() access common constants from AliFlowCommonConstants: | |
6528 | fnBinsPhi = AliFlowCommonConstants::GetMaster()->GetNbinsPhi(); | |
6529 | fPhiMin = AliFlowCommonConstants::GetMaster()->GetPhiMin(); | |
6530 | fPhiMax = AliFlowCommonConstants::GetMaster()->GetPhiMax(); | |
6531 | if(fnBinsPhi){fPhiBinWidth = (fPhiMax-fPhiMin)/fnBinsPhi;} | |
6532 | fnBinsPt = AliFlowCommonConstants::GetMaster()->GetNbinsPt(); | |
6533 | fPtMin = AliFlowCommonConstants::GetMaster()->GetPtMin(); | |
6534 | fPtMax = AliFlowCommonConstants::GetMaster()->GetPtMax(); | |
6535 | if(fnBinsPt){fPtBinWidth = (fPtMax-fPtMin)/fnBinsPt;} | |
6536 | fnBinsEta = AliFlowCommonConstants::GetMaster()->GetNbinsEta(); | |
6537 | fEtaMin = AliFlowCommonConstants::GetMaster()->GetEtaMin(); | |
6538 | fEtaMax = AliFlowCommonConstants::GetMaster()->GetEtaMax(); | |
6539 | if(fnBinsEta){fEtaBinWidth = (fEtaMax-fEtaMin)/fnBinsEta;} | |
6540 | ||
6541 | // b) If this method was called in Init() book and fill TProfile to hold constants accessed in a): | |
6542 | TString fCommonConstantsName = "fCommonConstants"; | |
6543 | fCommonConstantsName += fAnalysisLabel->Data(); | |
6544 | fCommonConstants = new TProfile(fCommonConstantsName.Data(),"Common constants",9,0.,9.); | |
6545 | fCommonConstants->SetLabelSize(0.05); | |
6546 | fCommonConstants->GetXaxis()->SetBinLabel(1,"nBins (#phi)"); | |
6547 | fCommonConstants->Fill(0.5,fnBinsPhi); | |
6548 | fCommonConstants->GetXaxis()->SetBinLabel(2,"#phi_{min}"); | |
6549 | fCommonConstants->Fill(1.5,fPhiMin); | |
6550 | fCommonConstants->GetXaxis()->SetBinLabel(3,"#phi_{max}"); | |
6551 | fCommonConstants->Fill(2.5,fPhiMax); | |
6552 | fCommonConstants->GetXaxis()->SetBinLabel(4,"nBins (p_{t})"); | |
6553 | fCommonConstants->Fill(3.5,fnBinsPt); | |
6554 | fCommonConstants->GetXaxis()->SetBinLabel(5,"(p_{t})_{min}"); | |
6555 | fCommonConstants->Fill(4.5,fPtMin); | |
6556 | fCommonConstants->GetXaxis()->SetBinLabel(6,"(p_{t})_{max}"); | |
6557 | fCommonConstants->Fill(5.5,fPtMax); | |
6558 | fCommonConstants->GetXaxis()->SetBinLabel(7,"nBins (#eta)"); | |
6559 | fCommonConstants->Fill(6.5,fnBinsEta); | |
6560 | fCommonConstants->GetXaxis()->SetBinLabel(8,"#eta_{min}"); | |
6561 | fCommonConstants->Fill(7.5,fEtaMin); | |
6562 | fCommonConstants->GetXaxis()->SetBinLabel(9,"#eta_{max}"); | |
6563 | fCommonConstants->Fill(8.5,fEtaMax); | |
6564 | fHistList->Add(fCommonConstants); | |
6565 | } // end of if(method == "Init") | |
6566 | else if(method == "Finish") | |
6567 | { | |
6568 | // c) If this method was called in Finish() access common constants from TProfile booked and filled in b): | |
6569 | if(!fCommonConstants) | |
6570 | { | |
6571 | printf("\n WARNING (QC): fCommonConstants is NULL in AFAWQC::AC(\"%s\") !!!!\n\n",method.Data()); | |
6572 | exit(0); | |
6573 | } | |
6574 | fnBinsPhi = (Int_t)fCommonConstants->GetBinContent(1); | |
6575 | fPhiMin = fCommonConstants->GetBinContent(2); | |
6576 | fPhiMax = fCommonConstants->GetBinContent(3); | |
6577 | if(fnBinsPhi){fPhiBinWidth = (fPhiMax-fPhiMin)/fnBinsPhi;} | |
6578 | fnBinsPt = (Int_t)fCommonConstants->GetBinContent(4); | |
6579 | fPtMin = fCommonConstants->GetBinContent(5); | |
6580 | fPtMax = fCommonConstants->GetBinContent(6); | |
6581 | if(fnBinsPt){fPtBinWidth = (fPtMax-fPtMin)/fnBinsPt;} | |
6582 | fnBinsEta = (Int_t)fCommonConstants->GetBinContent(7); | |
6583 | fEtaMin = fCommonConstants->GetBinContent(8); | |
6584 | fEtaMax = fCommonConstants->GetBinContent(9); | |
6585 | if(fnBinsEta){fEtaBinWidth = (fEtaMax-fEtaMin)/fnBinsEta;} | |
6586 | } // end of else if(method == "Finish") | |
6587 | ||
6588 | } // end of void AliFlowAnalysisWithQCumulants::CommonConstants(TString method) | |
489d5531 | 6589 | |
489d5531 | 6590 | //================================================================================================================================ |
6591 | ||
489d5531 | 6592 | void AliFlowAnalysisWithQCumulants::CrossCheckSettings() |
6593 | { | |
1268c371 | 6594 | // a) Cross check if the choice for multiplicity weights make sense. |
489d5531 | 6595 | |
6596 | // a) Cross check if the choice for multiplicity weights make sense: | |
6597 | if(strcmp(fMultiplicityWeight->Data(),"combinations") && | |
6598 | strcmp(fMultiplicityWeight->Data(),"unit") && | |
6599 | strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
6600 | { | |
6601 | cout<<"WARNING (QC): Multiplicity weight can be either \"combinations\", \"unit\""<<endl; | |
6602 | cout<<" or \"multiplicity\". Certainly not \""<<fMultiplicityWeight->Data()<<"\"."<<endl; | |
6603 | exit(0); | |
6604 | } | |
6605 | ||
6606 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckSettings() | |
6607 | ||
489d5531 | 6608 | //================================================================================================================================ |
6609 | ||
489d5531 | 6610 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeights() |
6611 | { | |
0328db2d | 6612 | // Calculate sum of linear and quadratic event weights for correlations. |
2001bc3a | 6613 | |
6614 | // multiplicity: | |
1268c371 | 6615 | Double_t dMult = (*fSpk)(0,0); |
9f33751d | 6616 | |
489d5531 | 6617 | for(Int_t p=0;p<2;p++) // power-1 |
6618 | { | |
6619 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
6620 | { | |
6621 | fIntFlowSumOfEventWeights[p]->Fill(ci+0.5,pow(fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci+1),p+1)); | |
b3dacf6b | 6622 | if(fCalculateCumulantsVsM) |
6623 | { | |
6624 | fIntFlowSumOfEventWeightsVsM[ci][p]->Fill(dMult+0.5,pow(fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci+1),p+1)); // to be improved: dMult => sum of weights? | |
6625 | } | |
489d5531 | 6626 | } |
6627 | } | |
6628 | ||
6629 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeights() | |
6630 | ||
489d5531 | 6631 | //================================================================================================================================ |
6632 | ||
0328db2d | 6633 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeightsNUA() |
489d5531 | 6634 | { |
0328db2d | 6635 | // Calculate sum of linear and quadratic event weights for NUA terms. |
6636 | ||
6637 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
489d5531 | 6638 | { |
0328db2d | 6639 | for(Int_t p=0;p<2;p++) // power-1 |
6640 | { | |
b92ea2b9 | 6641 | for(Int_t ci=0;ci<4;ci++) // nua term index |
0328db2d | 6642 | { |
6643 | fIntFlowSumOfEventWeightsNUA[sc][p]->Fill(ci+0.5,pow(fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc]->GetBinContent(ci+1),p+1)); | |
489d5531 | 6644 | } |
0328db2d | 6645 | } |
6646 | } | |
6647 | ||
6648 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeightsNUA() | |
489d5531 | 6649 | |
0328db2d | 6650 | //================================================================================================================================ |
6651 | ||
0328db2d | 6652 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeights() |
6653 | { | |
ff70ca91 | 6654 | // Calculate sum of product of event weights for correlations. |
2001bc3a | 6655 | |
6656 | // multiplicity: | |
1268c371 | 6657 | Double_t dMult = (*fSpk)(0,0); |
2001bc3a | 6658 | |
489d5531 | 6659 | Int_t counter = 0; |
6660 | ||
6661 | for(Int_t ci1=1;ci1<4;ci1++) | |
6662 | { | |
6663 | for(Int_t ci2=ci1+1;ci2<=4;ci2++) | |
6664 | { | |
ff70ca91 | 6665 | fIntFlowSumOfProductOfEventWeights->Fill(0.5+counter, |
6666 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
b3dacf6b | 6667 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); |
6668 | if(fCalculateCumulantsVsM) | |
6669 | { | |
6670 | fIntFlowSumOfProductOfEventWeightsVsM[counter]->Fill(dMult+0.5, // to be improved: dMult => sum of weights? | |
6671 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
6672 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); | |
6673 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 6674 | counter++; |
489d5531 | 6675 | } |
6676 | } | |
6677 | ||
0328db2d | 6678 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeights() |
6679 | ||
0328db2d | 6680 | //================================================================================================================================ |
6681 | ||
0328db2d | 6682 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeightsNUA() |
6683 | { | |
6684 | // Calculate sum of product of event weights for NUA terms. | |
6685 | ||
6686 | // w_{<2>} * w_{<cos(#phi)>}: | |
6687 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(0.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6688 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
6689 | // w_{<2>} * w_{<sin(#phi)>}: | |
6690 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(1.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6691 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
6692 | // w_{<cos(#phi)> * w_{<sin(#phi)>}: | |
6693 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(2.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6694 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
6695 | // w_{<2>} * w{<cos(phi1+phi2)>} | |
6696 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(3.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6697 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6698 | // w_{<2>} * w{<sin(phi1+phi2)>} | |
6699 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(4.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6700 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6701 | // w_{<2>} * w{<cos(phi1-phi2-phi3)>} | |
6702 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(5.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6703 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6704 | // w_{<2>} * w{<sin(phi1-phi2-phi3)>} | |
6705 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(6.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6706 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6707 | // w_{<4>} * w{<cos(phi1)>} | |
6708 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(7.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6709 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
6710 | // w_{<4>} * w{<sin(phi1)>} | |
6711 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(8.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6712 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
6713 | // w_{<4>} * w{<cos(phi1+phi2)>} | |
6714 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(9.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6715 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6716 | // w_{<4>} * w{<sin(phi1+phi2)>} | |
6717 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(10.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6718 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6719 | // w_{<4>} * w{<cos(phi1-phi2-phi3)>} | |
6720 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(11.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6721 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6722 | // w_{<4>} * w{<sin(phi1-phi2-phi3)>} | |
6723 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(12.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6724 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6725 | // w_{<cos(phi1)>} * w{<cos(phi1+phi2)>} | |
6726 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(13.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6727 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6728 | // w_{<cos(phi1)>} * w{<sin(phi1+phi2)>} | |
6729 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(14.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6730 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6731 | // w_{<cos(phi1)>} * w{<cos(phi1-phi2-phi3)>} | |
6732 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(15.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6733 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6734 | // w_{<cos(phi1)>} * w{<sin(phi1-phi2-phi3)>} | |
6735 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(16.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6736 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6737 | // w_{<sin(phi1)>} * w{<cos(phi1+phi2)>} | |
6738 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(17.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6739 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6740 | // w_{<sin(phi1)>} * w{<sin(phi1+phi2)>} | |
6741 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(18.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6742 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6743 | // w_{<sin(phi1)>} * w{<cos(phi1-phi2-phi3)>} | |
6744 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(19.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6745 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6746 | // w_{<sin(phi1)>} * w{<sin(phi1-phi2-phi3)>} | |
6747 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(20.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6748 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6749 | // w_{<cos(phi1+phi2)>} * w{<sin(phi1+phi2))>} | |
6750 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(21.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)* | |
6751 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6752 | // w_{<cos(phi1+phi2)>} * w{<cos(phi1-phi2-phi3)>} | |
6753 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(22.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)* | |
6754 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6755 | // w_{<cos(phi1+phi2)>} * w{<sin(phi1-phi2-phi3)>} | |
6756 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(23.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)* | |
6757 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6758 | // w_{<sin(phi1+phi2)>} * w{<cos(phi1-phi2-phi3)>} | |
6759 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(24.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)* | |
6760 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6761 | // w_{<sin(phi1+phi2)>} * w{<sin(phi1-phi2-phi3)>} | |
6762 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(25.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)* | |
6763 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6764 | // w_{<cos(phi1-phi2-phi3)>} * w{<sin(phi1-phi2-phi3)>} | |
6765 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(26.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)* | |
6766 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6767 | ||
6768 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowIntFlowSumOfProductOfEventWeightsNUA() | |
489d5531 | 6769 | |
489d5531 | 6770 | //================================================================================================================================ |
6771 | ||
489d5531 | 6772 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelations(TString type, TString ptOrEta) |
6773 | { | |
1268c371 | 6774 | // Calculate reduced correlations for RPs or POIs for all pt and eta bins. |
489d5531 | 6775 | |
1268c371 | 6776 | // Multiplicity: |
6777 | Double_t dMult = (*fSpk)(0,0); | |
489d5531 | 6778 | |
6779 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
6780 | Double_t dReQ1n = (*fReQ)(0,0); | |
6781 | Double_t dReQ2n = (*fReQ)(1,0); | |
6782 | //Double_t dReQ3n = (*fReQ)(2,0); | |
6783 | //Double_t dReQ4n = (*fReQ)(3,0); | |
6784 | Double_t dImQ1n = (*fImQ)(0,0); | |
6785 | Double_t dImQ2n = (*fImQ)(1,0); | |
6786 | //Double_t dImQ3n = (*fImQ)(2,0); | |
6787 | //Double_t dImQ4n = (*fImQ)(3,0); | |
6788 | ||
6789 | // reduced correlations are stored in fDiffFlowCorrelationsPro[0=RP,1=POI][0=pt,1=eta][correlation index]. Correlation index runs as follows: | |
6790 | // | |
6791 | // 0: <<2'>> | |
6792 | // 1: <<4'>> | |
6793 | // 2: <<6'>> | |
6794 | // 3: <<8'>> | |
6795 | ||
2a98ceb8 | 6796 | Int_t t = 0; // type flag |
6797 | Int_t pe = 0; // ptEta flag | |
489d5531 | 6798 | |
6799 | if(type == "RP") | |
6800 | { | |
6801 | t = 0; | |
6802 | } else if(type == "POI") | |
6803 | { | |
6804 | t = 1; | |
6805 | } | |
6806 | ||
6807 | if(ptOrEta == "Pt") | |
6808 | { | |
6809 | pe = 0; | |
6810 | } else if(ptOrEta == "Eta") | |
6811 | { | |
6812 | pe = 1; | |
6813 | } | |
6814 | ||
6815 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
6816 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
6817 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
6818 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
6819 | ||
6820 | // looping over all bins and calculating reduced correlations: | |
6821 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6822 | { | |
6823 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
6824 | Double_t p1n0kRe = 0.; | |
6825 | Double_t p1n0kIm = 0.; | |
6826 | ||
6827 | // number of POIs in particular pt or eta bin: | |
6828 | Double_t mp = 0.; | |
6829 | ||
6830 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
6831 | Double_t q1n0kRe = 0.; | |
6832 | Double_t q1n0kIm = 0.; | |
6833 | Double_t q2n0kRe = 0.; | |
6834 | Double_t q2n0kIm = 0.; | |
6835 | ||
6836 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
6837 | Double_t mq = 0.; | |
6838 | ||
6839 | if(type == "POI") | |
6840 | { | |
6841 | // q_{m*n,0}: | |
6842 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
6843 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
6844 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
6845 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
6846 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
6847 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
6848 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
6849 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
6850 | ||
6851 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
6852 | } | |
6853 | else if(type == "RP") | |
6854 | { | |
6855 | // q_{m*n,0}: | |
6856 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
6857 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
6858 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
6859 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
6860 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
6861 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
6862 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
6863 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
6864 | ||
6865 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
6866 | } | |
6867 | ||
6868 | if(type == "POI") | |
6869 | { | |
6870 | // p_{m*n,0}: | |
6871 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
6872 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
6873 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
6874 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
6875 | ||
6876 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
6877 | ||
6878 | t = 1; // typeFlag = RP or POI | |
6879 | } | |
6880 | else if(type == "RP") | |
6881 | { | |
6882 | // p_{m*n,0} = q_{m*n,0}: | |
6883 | p1n0kRe = q1n0kRe; | |
6884 | p1n0kIm = q1n0kIm; | |
6885 | ||
6886 | mp = mq; | |
6887 | ||
6888 | t = 0; // typeFlag = RP or POI | |
6889 | } | |
6890 | ||
1268c371 | 6891 | // 2'-particle correlation for particular pt or eta bin: |
489d5531 | 6892 | Double_t two1n1nPtEta = 0.; |
b40a910e | 6893 | Double_t mWeight2pPrime = 0.; // multiplicity weight for <2'> |
489d5531 | 6894 | if(mp*dMult-mq) |
6895 | { | |
6896 | two1n1nPtEta = (p1n0kRe*dReQ1n+p1n0kIm*dImQ1n-mq) | |
6897 | / (mp*dMult-mq); | |
b40a910e | 6898 | // determine multiplicity weight: |
6899 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
6900 | { | |
6901 | mWeight2pPrime = mp*dMult-mq; | |
6902 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
6903 | { | |
6904 | mWeight2pPrime = 1.; | |
6905 | } | |
489d5531 | 6906 | if(type == "POI") // to be improved (I do not this if) |
6907 | { | |
6908 | // fill profile to get <<2'>> for POIs | |
b40a910e | 6909 | fDiffFlowCorrelationsPro[1][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta,mWeight2pPrime); |
6910 | // fill profile to get <<2'>^2> for POIs | |
6911 | fDiffFlowSquaredCorrelationsPro[1][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta*two1n1nPtEta,mWeight2pPrime); | |
489d5531 | 6912 | // histogram to store <2'> for POIs e-b-e (needed in some other methods): |
6913 | fDiffFlowCorrelationsEBE[1][pe][0]->SetBinContent(b,two1n1nPtEta); | |
b40a910e | 6914 | fDiffFlowEventWeightsForCorrelationsEBE[1][pe][0]->SetBinContent(b,mWeight2pPrime); |
489d5531 | 6915 | } |
6916 | else if(type == "RP") // to be improved (I do not this if) | |
6917 | { | |
6918 | // profile to get <<2'>> for RPs: | |
b40a910e | 6919 | fDiffFlowCorrelationsPro[0][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta,mWeight2pPrime); |
6920 | // profile to get <<2'>^2> for RPs: | |
6921 | fDiffFlowSquaredCorrelationsPro[0][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta*two1n1nPtEta,mWeight2pPrime); | |
489d5531 | 6922 | // histogram to store <2'> for RPs e-b-e (needed in some other methods): |
6923 | fDiffFlowCorrelationsEBE[0][pe][0]->SetBinContent(b,two1n1nPtEta); | |
b40a910e | 6924 | fDiffFlowEventWeightsForCorrelationsEBE[0][pe][0]->SetBinContent(b,mWeight2pPrime); |
489d5531 | 6925 | } |
6926 | } // end of if(mp*dMult-mq) | |
6927 | ||
6928 | // 4'-particle correlation: | |
6929 | Double_t four1n1n1n1nPtEta = 0.; | |
b40a910e | 6930 | Double_t mWeight4pPrime = 0.; // multiplicity weight for <4'> |
489d5531 | 6931 | if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) |
6932 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression) | |
6933 | { | |
6934 | four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
6935 | - q2n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) | |
6936 | - 2.*q2n0kIm*dReQ1n*dImQ1n | |
6937 | - p1n0kRe*(dReQ1n*dReQ2n+dImQ1n*dImQ2n) | |
6938 | + p1n0kIm*(dImQ1n*dReQ2n-dReQ1n*dImQ2n) | |
6939 | - 2.*dMult*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
6940 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*mq | |
6941 | + 6.*(q1n0kRe*dReQ1n+q1n0kIm*dImQ1n) | |
6942 | + 1.*(q2n0kRe*dReQ2n+q2n0kIm*dImQ2n) | |
6943 | + 2.*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
6944 | + 2.*mq*dMult | |
6945 | - 6.*mq) | |
6946 | / ((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6947 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b40a910e | 6948 | // determine multiplicity weight: |
6949 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
6950 | { | |
6951 | mWeight4pPrime = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
6952 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
6953 | { | |
6954 | mWeight4pPrime = 1.; | |
6955 | } | |
489d5531 | 6956 | if(type == "POI") |
6957 | { | |
6958 | // profile to get <<4'>> for POIs: | |
b40a910e | 6959 | fDiffFlowCorrelationsPro[1][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta,mWeight4pPrime); |
6960 | // profile to get <<4'>^2> for POIs: | |
6961 | fDiffFlowSquaredCorrelationsPro[1][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta*four1n1n1n1nPtEta,mWeight4pPrime); | |
489d5531 | 6962 | // histogram to store <4'> for POIs e-b-e (needed in some other methods): |
6963 | fDiffFlowCorrelationsEBE[1][pe][1]->SetBinContent(b,four1n1n1n1nPtEta); | |
b40a910e | 6964 | fDiffFlowEventWeightsForCorrelationsEBE[1][pe][1]->SetBinContent(b,mWeight4pPrime); |
489d5531 | 6965 | } |
6966 | else if(type == "RP") | |
6967 | { | |
6968 | // profile to get <<4'>> for RPs: | |
b40a910e | 6969 | fDiffFlowCorrelationsPro[0][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta,mWeight4pPrime); |
6970 | // profile to get <<4'>^2> for RPs: | |
6971 | fDiffFlowSquaredCorrelationsPro[0][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta*four1n1n1n1nPtEta,mWeight4pPrime); | |
489d5531 | 6972 | // histogram to store <4'> for RPs e-b-e (needed in some other methods): |
6973 | fDiffFlowCorrelationsEBE[0][pe][1]->SetBinContent(b,four1n1n1n1nPtEta); | |
b40a910e | 6974 | fDiffFlowEventWeightsForCorrelationsEBE[0][pe][1]->SetBinContent(b,mWeight4pPrime); |
489d5531 | 6975 | } |
6976 | } // end of if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
6977 | // +mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
6978 | ||
6979 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6980 | ||
6981 | ||
6982 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelations(TString type, TString ptOrEta); | |
6983 | ||
489d5531 | 6984 | //================================================================================================================================ |
6985 | ||
64e500e3 | 6986 | void AliFlowAnalysisWithQCumulants::CalculateOtherDiffCorrelators(TString type, TString ptOrEta) |
6987 | { | |
6988 | // Calculate other differential correlators for RPs or POIs for all pt and eta bins. | |
6989 | ||
6990 | // Multiplicity: | |
6991 | Double_t dMult = (*fSpk)(0,0); | |
6992 | ||
6993 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
6994 | Double_t dReQ1n = (*fReQ)(0,0); | |
6995 | Double_t dReQ2n = (*fReQ)(1,0); | |
6996 | Double_t dReQ3n = (*fReQ)(2,0); | |
6997 | //Double_t dReQ4n = (*fReQ)(3,0); | |
6998 | Double_t dImQ1n = (*fImQ)(0,0); | |
6999 | Double_t dImQ2n = (*fImQ)(1,0); | |
7000 | Double_t dImQ3n = (*fImQ)(2,0); | |
7001 | //Double_t dImQ4n = (*fImQ)(3,0); | |
7002 | ||
7003 | // Other correlations are stored in fOtherDiffCorrelators[2][2][2][1], [0=RP,1=POI][0=pt,1=eta][0=sin terms,1=cos terms][correlator index] | |
7004 | // Correlation index runs as follows: | |
7005 | // | |
7006 | // 0: <exp[in(psi1-3phi2+2phi3)]> | |
7007 | ||
7008 | Int_t t = 0; // type flag | |
7009 | Int_t pe = 0; // ptEta flag | |
7010 | ||
7011 | if(type == "RP") | |
7012 | { | |
7013 | t = 0; | |
7014 | } else if(type == "POI") | |
7015 | { | |
7016 | t = 1; | |
7017 | } | |
7018 | ||
7019 | if(ptOrEta == "Pt") | |
7020 | { | |
7021 | pe = 0; | |
7022 | } else if(ptOrEta == "Eta") | |
7023 | { | |
7024 | pe = 1; | |
7025 | } | |
7026 | ||
7027 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
7028 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
7029 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
7030 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
7031 | ||
7032 | // looping over all bins and calculating reduced correlations: | |
7033 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7034 | { | |
7035 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
7036 | Double_t p1n0kRe = 0.; | |
7037 | Double_t p1n0kIm = 0.; | |
7038 | ||
7039 | // number of POIs in particular pt or eta bin: | |
7040 | Double_t mp = 0.; | |
7041 | ||
7042 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
7043 | Double_t q1n0kRe = 0.; | |
7044 | Double_t q1n0kIm = 0.; | |
7045 | Double_t q2n0kRe = 0.; | |
7046 | Double_t q2n0kIm = 0.; | |
7047 | Double_t q3n0kRe = 0.; | |
7048 | Double_t q3n0kIm = 0.; | |
7049 | ||
7050 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
7051 | Double_t mq = 0.; | |
7052 | ||
7053 | if(type == "POI") | |
7054 | { | |
7055 | // q_{m*n,0}: | |
7056 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
7057 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
7058 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
7059 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
7060 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
7061 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
7062 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
7063 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
7064 | q3n0kRe = fReRPQ1dEBE[2][pe][2][0]->GetBinContent(fReRPQ1dEBE[2][pe][2][0]->GetBin(b)) | |
7065 | * fReRPQ1dEBE[2][pe][2][0]->GetBinEntries(fReRPQ1dEBE[2][pe][2][0]->GetBin(b)); | |
7066 | q3n0kIm = fImRPQ1dEBE[2][pe][2][0]->GetBinContent(fImRPQ1dEBE[2][pe][2][0]->GetBin(b)) | |
7067 | * fImRPQ1dEBE[2][pe][2][0]->GetBinEntries(fImRPQ1dEBE[2][pe][2][0]->GetBin(b)); | |
7068 | ||
7069 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
7070 | } | |
7071 | else if(type == "RP") | |
7072 | { | |
7073 | // q_{m*n,0}: | |
7074 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
7075 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
7076 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
7077 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
7078 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
7079 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
7080 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
7081 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
7082 | q3n0kRe = fReRPQ1dEBE[0][pe][2][0]->GetBinContent(fReRPQ1dEBE[0][pe][2][0]->GetBin(b)) | |
7083 | * fReRPQ1dEBE[0][pe][2][0]->GetBinEntries(fReRPQ1dEBE[0][pe][2][0]->GetBin(b)); | |
7084 | q3n0kIm = fImRPQ1dEBE[0][pe][2][0]->GetBinContent(fImRPQ1dEBE[0][pe][2][0]->GetBin(b)) | |
7085 | * fImRPQ1dEBE[0][pe][2][0]->GetBinEntries(fImRPQ1dEBE[0][pe][2][0]->GetBin(b)); | |
7086 | ||
7087 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
7088 | } | |
7089 | ||
7090 | if(type == "POI") | |
7091 | { | |
7092 | // p_{m*n,0}: | |
7093 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
7094 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
7095 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
7096 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
7097 | ||
7098 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
7099 | ||
7100 | t = 1; // typeFlag = RP or POI | |
7101 | } | |
7102 | else if(type == "RP") | |
7103 | { | |
7104 | // p_{m*n,0} = q_{m*n,0}: | |
7105 | p1n0kRe = q1n0kRe; | |
7106 | p1n0kIm = q1n0kIm; | |
7107 | ||
7108 | mp = mq; | |
7109 | ||
7110 | t = 0; // typeFlag = RP or POI | |
7111 | } | |
7112 | ||
7113 | // 3'-particle correlators: | |
7114 | // Taeney-Yan correlator: | |
7115 | Double_t dTaeneyYan = 0.; | |
7116 | Double_t mWeightTaeneyYan = 0.; // multiplicity weight for Taeney-Yan correlator | |
7117 | if((mp*dMult-2.*mq)*(dMult-1.) > 0.) // to be improved - is this condition fully justified? | |
7118 | { | |
7119 | dTaeneyYan = (dReQ3n*(p1n0kRe*dReQ2n-p1n0kIm*dImQ2n)+dImQ3n*(p1n0kIm*dReQ2n+p1n0kRe*dImQ2n) | |
7120 | - p1n0kRe*dReQ1n - p1n0kIm*dImQ1n | |
7121 | - q2n0kRe*dReQ2n - q2n0kIm*dImQ2n | |
7122 | - q3n0kRe*dReQ3n - q3n0kIm*dImQ3n | |
7123 | + 2.*mq) | |
7124 | / ((mp*dMult-2.*mq)*(dMult-1.)); | |
7125 | // determine multiplicity weight: | |
7126 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
7127 | { | |
7128 | mWeightTaeneyYan = (mp*dMult-2.*mq)*(dMult-1.); | |
7129 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
7130 | { | |
7131 | mWeightTaeneyYan = 1.; | |
7132 | } | |
7133 | // Fill profiles: | |
7134 | fOtherDiffCorrelators[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dTaeneyYan,mWeightTaeneyYan); | |
7135 | } // end of if((mp*dMult-2.*mq)*(dMult-1.) > 0.) | |
7136 | ||
7137 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7138 | ||
7139 | } // end of void AliFlowAnalysisWithQCumulants::CalculateOtherDiffCorrelators(TString type, TString ptOrEta) | |
7140 | ||
7141 | //================================================================================================================================ | |
7142 | ||
1268c371 | 7143 | void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCorrelations(TString type) |
7144 | { | |
7145 | // Calculate all reduced correlations needed for 2D differential flow for each (pt,eta) bin. | |
7146 | ||
7147 | // Multiplicity: | |
7148 | Double_t dMult = (*fSpk)(0,0); | |
7149 | // Real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
7150 | Double_t dReQ1n = (*fReQ)(0,0); | |
7151 | Double_t dReQ2n = (*fReQ)(1,0); | |
7152 | //Double_t dReQ3n = (*fReQ)(2,0); | |
7153 | //Double_t dReQ4n = (*fReQ)(3,0); | |
7154 | Double_t dImQ1n = (*fImQ)(0,0); | |
7155 | Double_t dImQ2n = (*fImQ)(1,0); | |
7156 | //Double_t dImQ3n = (*fImQ)(2,0); | |
7157 | //Double_t dImQ4n = (*fImQ)(3,0); | |
7158 | ||
7159 | // 2D reduced correlations are stored in TProfile2D f2DDiffFlowCorrelationsPro[0=RP,1=POI][correlation index]. | |
7160 | // Correlation index runs as follows: | |
7161 | // 0: <<2'>> | |
7162 | // 1: <<4'>> | |
7163 | // 2: <<6'>> | |
7164 | // 3: <<8'>> | |
7165 | ||
7166 | Int_t t = 0; // type flag | |
7167 | if(type == "RP") | |
7168 | { | |
7169 | t = 0; | |
7170 | } else if(type == "POI") | |
7171 | { | |
7172 | t = 1; | |
7173 | } | |
7174 | ||
7175 | // Looping over all (pt,eta) bins and calculating correlations needed for differential flow: | |
7176 | for(Int_t p=1;p<=fnBinsPt;p++) | |
7177 | { | |
7178 | for(Int_t e=1;e<=fnBinsEta;e++) | |
7179 | { | |
7180 | // Real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): | |
7181 | Double_t p1n0kRe = 0.; | |
7182 | Double_t p1n0kIm = 0.; | |
7183 | // Number of POIs in particular pt or eta bin: | |
7184 | Double_t mp = 0.; | |
7185 | // Real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for 'RP && POI particles' in particular pt or eta bin): | |
7186 | Double_t q1n0kRe = 0.; | |
7187 | Double_t q1n0kIm = 0.; | |
7188 | Double_t q2n0kRe = 0.; | |
7189 | Double_t q2n0kIm = 0.; | |
7190 | // Number of 'RP && POI particles' in particular pt or eta bin: | |
7191 | Double_t mq = 0.; | |
7192 | if(type == "POI") | |
7193 | { | |
7194 | // q_{m*n,0}: | |
7195 | q1n0kRe = fReRPQ2dEBE[2][0][0]->GetBinContent(fReRPQ2dEBE[2][0][0]->GetBin(p,e)) | |
7196 | * fReRPQ2dEBE[2][0][0]->GetBinEntries(fReRPQ2dEBE[2][0][0]->GetBin(p,e)); | |
7197 | q1n0kIm = fImRPQ2dEBE[2][0][0]->GetBinContent(fImRPQ2dEBE[2][0][0]->GetBin(p,e)) | |
7198 | * fImRPQ2dEBE[2][0][0]->GetBinEntries(fImRPQ2dEBE[2][0][0]->GetBin(p,e)); | |
7199 | q2n0kRe = fReRPQ2dEBE[2][1][0]->GetBinContent(fReRPQ2dEBE[2][1][0]->GetBin(p,e)) | |
7200 | * fReRPQ2dEBE[2][1][0]->GetBinEntries(fReRPQ2dEBE[2][1][0]->GetBin(p,e)); | |
7201 | q2n0kIm = fImRPQ2dEBE[2][1][0]->GetBinContent(fImRPQ2dEBE[2][1][0]->GetBin(p,e)) | |
7202 | * fImRPQ2dEBE[2][1][0]->GetBinEntries(fImRPQ2dEBE[2][1][0]->GetBin(p,e)); | |
7203 | // m_{q}: | |
7204 | mq = fReRPQ2dEBE[2][0][0]->GetBinEntries(fReRPQ2dEBE[2][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) | |
7205 | } // end of if(type == "POI") | |
7206 | else if(type == "RP") | |
7207 | { | |
7208 | // q_{m*n,0}: | |
7209 | q1n0kRe = fReRPQ2dEBE[0][0][0]->GetBinContent(fReRPQ2dEBE[0][0][0]->GetBin(p,e)) | |
7210 | * fReRPQ2dEBE[0][0][0]->GetBinEntries(fReRPQ2dEBE[0][0][0]->GetBin(p,e)); | |
7211 | q1n0kIm = fImRPQ2dEBE[0][0][0]->GetBinContent(fImRPQ2dEBE[0][0][0]->GetBin(p,e)) | |
7212 | * fImRPQ2dEBE[0][0][0]->GetBinEntries(fImRPQ2dEBE[0][0][0]->GetBin(p,e)); | |
7213 | q2n0kRe = fReRPQ2dEBE[0][1][0]->GetBinContent(fReRPQ2dEBE[0][1][0]->GetBin(p,e)) | |
7214 | * fReRPQ2dEBE[0][1][0]->GetBinEntries(fReRPQ2dEBE[0][1][0]->GetBin(p,e)); | |
7215 | q2n0kIm = fImRPQ2dEBE[0][1][0]->GetBinContent(fImRPQ2dEBE[0][1][0]->GetBin(p,e)) | |
7216 | * fImRPQ2dEBE[0][1][0]->GetBinEntries(fImRPQ2dEBE[0][1][0]->GetBin(p,e)); | |
7217 | // m_{q}: | |
7218 | mq = fReRPQ2dEBE[0][0][0]->GetBinEntries(fReRPQ2dEBE[0][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) | |
7219 | } // end of else if(type == "RP") | |
7220 | if(type == "POI") | |
7221 | { | |
7222 | // p_{m*n,0}: | |
7223 | p1n0kRe = fReRPQ2dEBE[1][0][0]->GetBinContent(fReRPQ2dEBE[1][0][0]->GetBin(p,e)) | |
7224 | * fReRPQ2dEBE[1][0][0]->GetBinEntries(fReRPQ2dEBE[1][0][0]->GetBin(p,e)); | |
7225 | p1n0kIm = fImRPQ2dEBE[1][0][0]->GetBinContent(fImRPQ2dEBE[1][0][0]->GetBin(p,e)) | |
7226 | * fImRPQ2dEBE[1][0][0]->GetBinEntries(fImRPQ2dEBE[1][0][0]->GetBin(p,e)); | |
7227 | // m_{p} | |
7228 | mp = fReRPQ2dEBE[1][0][0]->GetBinEntries(fReRPQ2dEBE[1][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) | |
7229 | ||
7230 | t = 1; // typeFlag = RP or POI | |
7231 | } // end of if(type == "POI") | |
7232 | else if(type == "RP") | |
7233 | { | |
7234 | // p_{m*n,0} = q_{m*n,0}: | |
7235 | p1n0kRe = q1n0kRe; | |
7236 | p1n0kIm = q1n0kIm; | |
7237 | // m_{p} = m_{q}: | |
7238 | mp = mq; | |
7239 | ||
7240 | t = 0; // typeFlag = RP or POI | |
7241 | } // end of if(type == "RP") | |
7242 | ||
7243 | // 2'-particle correlation for particular (pt,eta) bin: | |
7244 | Double_t two1n1nPtEta = 0.; | |
7245 | Double_t mWeight2pPrime = 0.; // multiplicity weight for <2'> | |
7246 | if(mp*dMult-mq) | |
7247 | { | |
7248 | two1n1nPtEta = (p1n0kRe*dReQ1n+p1n0kIm*dImQ1n-mq) | |
7249 | / (mp*dMult-mq); | |
7250 | // Determine multiplicity weight: | |
7251 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
7252 | { | |
7253 | mWeight2pPrime = mp*dMult-mq; | |
7254 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
7255 | { | |
7256 | mWeight2pPrime = 1.; | |
7257 | } | |
7258 | // Fill 2D profile holding <<2'>>: | |
7259 | f2DDiffFlowCorrelationsPro[t][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mWeight2pPrime); | |
7260 | } // end of if(mp*dMult-mq) | |
7261 | ||
7262 | // 4'-particle correlation: | |
7263 | Double_t four1n1n1n1nPtEta = 0.; | |
7264 | Double_t mWeight4pPrime = 0.; // multiplicity weight for <4'> | |
7265 | if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
7266 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression) | |
7267 | { | |
7268 | four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
7269 | - q2n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) | |
7270 | - 2.*q2n0kIm*dReQ1n*dImQ1n | |
7271 | - p1n0kRe*(dReQ1n*dReQ2n+dImQ1n*dImQ2n) | |
7272 | + p1n0kIm*(dImQ1n*dReQ2n-dReQ1n*dImQ2n) | |
7273 | - 2.*dMult*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
7274 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*mq | |
7275 | + 6.*(q1n0kRe*dReQ1n+q1n0kIm*dImQ1n) | |
7276 | + 1.*(q2n0kRe*dReQ2n+q2n0kIm*dImQ2n) | |
7277 | + 2.*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
7278 | + 2.*mq*dMult | |
7279 | - 6.*mq) | |
7280 | / ((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
7281 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
7282 | // Determine multiplicity weight: | |
7283 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
7284 | { | |
7285 | mWeight4pPrime = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
7286 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
7287 | { | |
7288 | mWeight4pPrime = 1.; | |
7289 | } | |
7290 | // Fill 2D profile holding <<4'>>: | |
7291 | f2DDiffFlowCorrelationsPro[t][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta,mWeight4pPrime); | |
7292 | } // end of if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
7293 | // +mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
7294 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
7295 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
7296 | ||
7297 | } // end of AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCorrelations(TString type) | |
7298 | ||
7299 | //================================================================================================================================ | |
7300 | ||
489d5531 | 7301 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfEventWeights(TString type, TString ptOrEta) |
7302 | { | |
7303 | // Calculate sums of various event weights for reduced correlations. | |
7304 | // (These quantitites are needed in expressions for unbiased estimators relevant for the statistical errors.) | |
7305 | ||
2a98ceb8 | 7306 | Int_t typeFlag = 0; |
7307 | Int_t ptEtaFlag = 0; | |
489d5531 | 7308 | |
7309 | if(type == "RP") | |
7310 | { | |
7311 | typeFlag = 0; | |
7312 | } else if(type == "POI") | |
7313 | { | |
7314 | typeFlag = 1; | |
7315 | } | |
7316 | ||
7317 | if(ptOrEta == "Pt") | |
7318 | { | |
7319 | ptEtaFlag = 0; | |
7320 | } else if(ptOrEta == "Eta") | |
7321 | { | |
7322 | ptEtaFlag = 1; | |
7323 | } | |
7324 | ||
7325 | // shortcuts: | |
7326 | Int_t t = typeFlag; | |
7327 | Int_t pe = ptEtaFlag; | |
7328 | ||
7329 | // binning: | |
7330 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
7331 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
7332 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
7333 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
7334 | ||
7335 | for(Int_t rpq=0;rpq<3;rpq++) | |
7336 | { | |
7337 | for(Int_t m=0;m<4;m++) | |
7338 | { | |
7339 | for(Int_t k=0;k<9;k++) | |
7340 | { | |
7341 | if(!fReRPQ1dEBE[rpq][pe][m][k]) | |
7342 | { | |
7343 | cout<<"WARNING: fReRPQ1dEBE[rpq][pe][m][k] is NULL in AFAWQC::CSAPOEWFDF() !!!!"<<endl; | |
7344 | cout<<"pe = "<<pe<<endl; | |
7345 | cout<<"rpq = "<<rpq<<endl; | |
7346 | cout<<"m = "<<m<<endl; | |
7347 | cout<<"k = "<<k<<endl; | |
7348 | exit(0); | |
7349 | } | |
7350 | } | |
7351 | } | |
7352 | } | |
7353 | ||
7354 | // multiplicities: | |
1268c371 | 7355 | Double_t dMult = (*fSpk)(0,0); // total event multiplicity |
489d5531 | 7356 | //Double_t mr = 0.; // number of RPs in particular pt or eta bin |
7357 | Double_t mp = 0.; // number of POIs in particular pt or eta bin | |
7358 | Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin | |
7359 | ||
7360 | // event weights for reduced correlations: | |
7361 | Double_t dw2 = 0.; // event weight for <2'> | |
7362 | Double_t dw4 = 0.; // event weight for <4'> | |
7363 | //Double_t dw6 = 0.; // event weight for <6'> | |
7364 | //Double_t dw8 = 0.; // event weight for <8'> | |
7365 | ||
7366 | // looping over bins: | |
7367 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7368 | { | |
7369 | if(type == "RP") | |
7370 | { | |
7371 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b); | |
7372 | mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow | |
7373 | } else if(type == "POI") | |
7374 | { | |
7375 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b); | |
7376 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); | |
7377 | } | |
7378 | ||
7379 | // event weight for <2'>: | |
7380 | dw2 = mp*dMult-mq; | |
7381 | fDiffFlowSumOfEventWeights[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2); | |
7382 | fDiffFlowSumOfEventWeights[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw2,2.)); | |
7383 | ||
7384 | // event weight for <4'>: | |
7385 | dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
7386 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
7387 | fDiffFlowSumOfEventWeights[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4); | |
7388 | fDiffFlowSumOfEventWeights[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw4,2.)); | |
7389 | ||
7390 | // event weight for <6'>: | |
7391 | //dw6 = ...; | |
7392 | //fDiffFlowSumOfEventWeights[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6); | |
7393 | //fDiffFlowSumOfEventWeights[t][pe][t][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw6,2.)); | |
7394 | ||
7395 | // event weight for <8'>: | |
7396 | //dw8 = ...; | |
7397 | //fDiffFlowSumOfEventWeights[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw8); | |
7398 | //fDiffFlowSumOfEventWeights[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw8,2.)); | |
7399 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7400 | ||
7401 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfEventWeights() | |
7402 | ||
7403 | ||
7404 | //================================================================================================================================ | |
7405 | ||
7406 | ||
7407 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfProductOfEventWeights(TString type, TString ptOrEta) | |
7408 | { | |
7409 | // Calculate sum of products of various event weights for both types of correlations (the ones for int. and diff. flow). | |
7410 | // (These quantitites are needed in expressions for unbiased estimators relevant for the statistical errors.) | |
7411 | // | |
7412 | // Important: To fill fDiffFlowSumOfProductOfEventWeights[][][][] use bellow table (i,j) with following constraints: | |
7413 | // 1.) i<j | |
7414 | // 2.) do not store terms which DO NOT include reduced correlations; | |
7415 | // Table: | |
7416 | // [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] x [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] | |
7417 | ||
2a98ceb8 | 7418 | Int_t typeFlag = 0; |
7419 | Int_t ptEtaFlag = 0; | |
489d5531 | 7420 | |
7421 | if(type == "RP") | |
7422 | { | |
7423 | typeFlag = 0; | |
7424 | } else if(type == "POI") | |
7425 | { | |
7426 | typeFlag = 1; | |
7427 | } | |
7428 | ||
7429 | if(ptOrEta == "Pt") | |
7430 | { | |
7431 | ptEtaFlag = 0; | |
7432 | } else if(ptOrEta == "Eta") | |
7433 | { | |
7434 | ptEtaFlag = 1; | |
7435 | } | |
7436 | ||
7437 | // shortcuts: | |
7438 | Int_t t = typeFlag; | |
7439 | Int_t pe = ptEtaFlag; | |
7440 | ||
7441 | // binning: | |
7442 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
7443 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
7444 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
7445 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
7446 | ||
7447 | // protection: | |
7448 | for(Int_t rpq=0;rpq<3;rpq++) | |
7449 | { | |
7450 | for(Int_t m=0;m<4;m++) | |
7451 | { | |
7452 | for(Int_t k=0;k<9;k++) | |
7453 | { | |
7454 | if(!fReRPQ1dEBE[rpq][pe][m][k]) | |
7455 | { | |
7456 | cout<<"WARNING: fReRPQ1dEBE[rpq][pe][m][k] is NULL in AFAWQC::CSAPOEWFDF() !!!!"<<endl; | |
7457 | cout<<"pe = "<<pe<<endl; | |
7458 | cout<<"rpq = "<<rpq<<endl; | |
7459 | cout<<"m = "<<m<<endl; | |
7460 | cout<<"k = "<<k<<endl; | |
7461 | exit(0); | |
7462 | } | |
7463 | } | |
7464 | } | |
7465 | } | |
7466 | ||
7467 | // multiplicities: | |
1268c371 | 7468 | Double_t dMult = (*fSpk)(0,0); // total event multiplicity |
489d5531 | 7469 | //Double_t mr = 0.; // number of RPs in particular pt or eta bin |
7470 | Double_t mp = 0.; // number of POIs in particular pt or eta bin | |
7471 | Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin | |
7472 | ||
7473 | // event weights for correlations: | |
7474 | Double_t dW2 = dMult*(dMult-1); // event weight for <2> | |
7475 | Double_t dW4 = dMult*(dMult-1)*(dMult-2)*(dMult-3); // event weight for <4> | |
7476 | Double_t dW6 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5); // event weight for <6> | |
7477 | Double_t dW8 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)*(dMult-6)*(dMult-7); // event weight for <8> | |
7478 | ||
7479 | // event weights for reduced correlations: | |
7480 | Double_t dw2 = 0.; // event weight for <2'> | |
7481 | Double_t dw4 = 0.; // event weight for <4'> | |
7482 | //Double_t dw6 = 0.; // event weight for <6'> | |
7483 | //Double_t dw8 = 0.; // event weight for <8'> | |
7484 | ||
7485 | // looping over bins: | |
7486 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7487 | { | |
7488 | if(type == "RP") | |
7489 | { | |
7490 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b); | |
7491 | mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow | |
7492 | } else if(type == "POI") | |
7493 | { | |
7494 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b); | |
7495 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); | |
7496 | } | |
7497 | ||
7498 | // event weight for <2'>: | |
7499 | dw2 = mp*dMult-mq; | |
7500 | fDiffFlowSumOfProductOfEventWeights[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw2); // storing product of even weights for <2> and <2'> | |
7501 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW4); // storing product of even weights for <4> and <2'> | |
7502 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW6); // storing product of even weights for <6> and <2'> | |
7503 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW8); // storing product of even weights for <8> and <2'> | |
7504 | ||
7505 | // event weight for <4'>: | |
7506 | dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
7507 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
7508 | fDiffFlowSumOfProductOfEventWeights[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw4); // storing product of even weights for <2> and <4'> | |
7509 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw4); // storing product of even weights for <2'> and <4'> | |
7510 | fDiffFlowSumOfProductOfEventWeights[t][pe][2][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw4); // storing product of even weights for <4> and <4'> | |
7511 | fDiffFlowSumOfProductOfEventWeights[t][pe][3][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dW6); // storing product of even weights for <6> and <4'> | |
7512 | fDiffFlowSumOfProductOfEventWeights[t][pe][3][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dW8); // storing product of even weights for <8> and <4'> | |
7513 | ||
7514 | // event weight for <6'>: | |
7515 | //dw6 = ...; | |
7516 | //fDiffFlowSumOfProductOfEventWeights[t][pe][0][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw6); // storing product of even weights for <2> and <6'> | |
7517 | //fDiffFlowSumOfProductOfEventWeights[t][pe][1][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw6); // storing product of even weights for <2'> and <6'> | |
7518 | //fDiffFlowSumOfProductOfEventWeights[t][pe][2][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw6); // storing product of even weights for <4> and <6'> | |
7519 | //fDiffFlowSumOfProductOfEventWeights[t][pe][3][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dw6); // storing product of even weights for <4'> and <6'> | |
7520 | //fDiffFlowSumOfProductOfEventWeights[t][pe][4][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW6*dw6); // storing product of even weights for <6> and <6'> | |
7521 | //fDiffFlowSumOfProductOfEventWeights[t][pe][5][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dW8); // storing product of even weights for <6'> and <8> | |
7522 | //fDiffFlowSumOfProductOfEventWeights[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dw8); // storing product of even weights for <6'> and <8'> | |
7523 | ||
7524 | // event weight for <8'>: | |
7525 | //dw8 = ...; | |
7526 | //fDiffFlowSumOfProductOfEventWeights[t][pe][0][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw8); // storing product of even weights for <2> and <8'> | |
7527 | //fDiffFlowSumOfProductOfEventWeights[t][pe][1][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw8); // storing product of even weights for <2'> and <8'> | |
7528 | //fDiffFlowSumOfProductOfEventWeights[t][pe][2][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw8); // storing product of even weights for <4> and <8'> | |
7529 | //fDiffFlowSumOfProductOfEventWeights[t][pe][3][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dw8); // storing product of even weights for <4'> and <8'> | |
7530 | //fDiffFlowSumOfProductOfEventWeights[t][pe][4][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW6*dw8); // storing product of even weights for <6> and <8'> | |
7531 | //fDiffFlowSumOfProductOfEventWeights[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dw8); // storing product of even weights for <6'> and <8'> | |
7532 | //fDiffFlowSumOfProductOfEventWeights[t][pe][6][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW8*dw8); // storing product of even weights for <8> and <8'> | |
7533 | ||
7534 | // Table: | |
7535 | // [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] x [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] | |
7536 | ||
7537 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7538 | ||
7539 | ||
7540 | ||
7541 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfProductOfEventWeights(TString type, TString ptOrEta) | |
7542 | ||
489d5531 | 7543 | //================================================================================================================================ |
7544 | ||
489d5531 | 7545 | void AliFlowAnalysisWithQCumulants::FinalizeReducedCorrelations(TString type, TString ptOrEta) |
7546 | { | |
7547 | // Transfer profiles into histograms and calculate statistical errors correctly. | |
7548 | ||
1268c371 | 7549 | Int_t t = 0; // RP or POI |
7550 | Int_t pe = 0; // pt or eta | |
489d5531 | 7551 | |
7552 | if(type == "RP") | |
7553 | { | |
1268c371 | 7554 | t = 0; |
489d5531 | 7555 | } else if(type == "POI") |
7556 | { | |
1268c371 | 7557 | t = 1; |
489d5531 | 7558 | } |
7559 | ||
7560 | if(ptOrEta == "Pt") | |
7561 | { | |
1268c371 | 7562 | pe = 0; |
489d5531 | 7563 | } else if(ptOrEta == "Eta") |
7564 | { | |
1268c371 | 7565 | pe = 1; |
489d5531 | 7566 | } |
1268c371 | 7567 | |
7568 | for(Int_t rci=0;rci<4;rci++) // to be improved - moved into the method CheckPointersUsedInFinish() | |
489d5531 | 7569 | { |
7570 | if(!fDiffFlowCorrelationsPro[t][pe][rci]) | |
7571 | { | |
7572 | cout<<"WARNING: fDiffFlowCorrelationsPro[t][pe][rci] is NULL in AFAWQC::FRC() !!!!"<<endl; | |
7573 | cout<<"t = "<<t<<endl; | |
7574 | cout<<"pe = "<<pe<<endl; | |
7575 | cout<<"rci = "<<rci<<endl; | |
7576 | exit(0); | |
7577 | } | |
b40a910e | 7578 | if(!fDiffFlowSquaredCorrelationsPro[t][pe][rci]) |
7579 | { | |
7580 | cout<<"WARNING: fDiffFlowSquaredCorrelationsPro[t][pe][rci] is NULL in AFAWQC::FRC() !!!!"<<endl; | |
7581 | cout<<"t = "<<t<<endl; | |
7582 | cout<<"pe = "<<pe<<endl; | |
7583 | cout<<"rci = "<<rci<<endl; | |
7584 | exit(0); | |
7585 | } | |
489d5531 | 7586 | for(Int_t power=0;power<2;power++) |
7587 | { | |
7588 | if(!fDiffFlowSumOfEventWeights[t][pe][power][rci]) | |
7589 | { | |
7590 | cout<<"WARNING: fDiffFlowSumOfEventWeights[t][pe][power][rci] is NULL in AFAWQC::FRC() !!!!"<<endl; | |
7591 | cout<<"t = "<<t<<endl; | |
7592 | cout<<"pe = "<<pe<<endl; | |
7593 | cout<<"power = "<<power<<endl; | |
7594 | cout<<"rci = "<<rci<<endl; | |
7595 | exit(0); | |
7596 | } | |
7597 | } // end of for(Int_t power=0;power<2;power++) | |
7598 | } // end of for(Int_t rci=0;rci<4;rci++) | |
7599 | ||
7600 | // common: | |
b40a910e | 7601 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
489d5531 | 7602 | // transfer 1D profile into 1D histogram: |
7603 | Double_t correlation = 0.; | |
b40a910e | 7604 | Double_t squaredCorrelation = 0.; |
489d5531 | 7605 | Double_t spread = 0.; |
7606 | Double_t sumOfWeights = 0.; // sum of weights for particular reduced correlations for particular pt or eta bin | |
7607 | Double_t sumOfSquaredWeights = 0.; // sum of squared weights for particular reduced correlations for particular pt or eta bin | |
7608 | Double_t error = 0.; // error = termA * spread * termB | |
7609 | // termA = (sqrt(sumOfSquaredWeights)/sumOfWeights) | |
7610 | // termB = 1/pow(1-termA^2,0.5) | |
7611 | Double_t termA = 0.; | |
7612 | Double_t termB = 0.; | |
7613 | for(Int_t rci=0;rci<4;rci++) // index of reduced correlation | |
7614 | { | |
7615 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) // number of pt or eta bins | |
7616 | { | |
b40a910e | 7617 | if(fDiffFlowCorrelationsPro[t][pe][rci]->GetBinEffectiveEntries(b) < 2 || |
7618 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->GetBinEffectiveEntries(b) < 2) | |
7619 | { | |
7620 | fDiffFlowCorrelationsPro[t][pe][rci]->SetBinError(b,0.); | |
7621 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->SetBinError(b,0.); | |
7622 | continue; // to be improved - should I ignore results in pt bins with one entry for reduced correlations or not? | |
7623 | } | |
489d5531 | 7624 | correlation = fDiffFlowCorrelationsPro[t][pe][rci]->GetBinContent(b); |
b40a910e | 7625 | squaredCorrelation = fDiffFlowSquaredCorrelationsPro[t][pe][rci]->GetBinContent(b); |
7626 | if(squaredCorrelation-correlation*correlation >= 0.) | |
7627 | { | |
7628 | spread = pow(squaredCorrelation-correlation*correlation,0.5); | |
7629 | } else | |
7630 | { | |
7631 | cout<<endl; | |
7632 | cout<<Form(" WARNING: Imaginary 'spread' for rci = %d, pe = %d, bin = %d !!!!",rci,pe,b)<<endl; | |
7633 | cout<<endl; | |
7634 | } | |
489d5531 | 7635 | sumOfWeights = fDiffFlowSumOfEventWeights[t][pe][0][rci]->GetBinContent(b); |
7636 | sumOfSquaredWeights = fDiffFlowSumOfEventWeights[t][pe][1][rci]->GetBinContent(b); | |
1268c371 | 7637 | if(TMath::Abs(sumOfWeights)>0.){termA = (pow(sumOfSquaredWeights,0.5)/sumOfWeights);} |
7638 | if(1.-pow(termA,2.)>0.){termB = 1./pow(1.-pow(termA,2.),0.5);} | |
489d5531 | 7639 | error = termA*spread*termB; // final error (unbiased estimator for standard deviation) |
7640 | fDiffFlowCorrelationsHist[t][pe][rci]->SetBinContent(b,correlation); | |
7641 | fDiffFlowCorrelationsHist[t][pe][rci]->SetBinError(b,error); | |
7642 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7643 | } // end of for(Int_t rci=0;rci<4;rci++) | |
7644 | ||
7645 | } // end of void AliFlowAnalysisWithQCumulants::FinalizeReducedCorrelations(TString type, TString ptOrEta) | |
7646 | ||
489d5531 | 7647 | //================================================================================================================================ |
7648 | ||
489d5531 | 7649 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowProductOfCorrelations(TString type, TString ptOrEta) |
7650 | { | |
7651 | // store products: <2><2'>, <2><4'>, <2><6'>, <2><8'>, <2'><4>, | |
7652 | // <2'><4'>, <2'><6>, <2'><6'>, <2'><8>, <2'><8'>, | |
7653 | // <4><4'>, <4><6'>, <4><8'>, <4'><6>, <4'><6'>, | |
7654 | // <4'><8>, <4'><8'>, <6><6'>, <6><8'>, <6'><8>, | |
7655 | // <6'><8'>, <8><8'>. | |
7656 | ||
2a98ceb8 | 7657 | Int_t typeFlag = 0; |
7658 | Int_t ptEtaFlag = 0; | |
489d5531 | 7659 | |
7660 | if(type == "RP") | |
7661 | { | |
7662 | typeFlag = 0; | |
7663 | } else if(type == "POI") | |
7664 | { | |
7665 | typeFlag = 1; | |
7666 | } | |
7667 | ||
7668 | if(ptOrEta == "Pt") | |
7669 | { | |
7670 | ptEtaFlag = 0; | |
7671 | } else if(ptOrEta == "Eta") | |
7672 | { | |
7673 | ptEtaFlag = 1; | |
7674 | } | |
7675 | ||
7676 | // shortcuts: | |
7677 | Int_t t = typeFlag; | |
7678 | Int_t pe = ptEtaFlag; | |
7679 | ||
7680 | // common: | |
7681 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
7682 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
7683 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
7684 | ||
7685 | // protections // to be improved (add protection for all pointers in this method) | |
7686 | if(!fIntFlowCorrelationsEBE) | |
7687 | { | |
7688 | cout<<"WARNING: fIntFlowCorrelationsEBE is NULL in AFAWQC::CDFPOC() !!!!"<<endl; | |
7689 | exit(0); | |
7690 | } | |
7691 | ||
7692 | /* | |
1268c371 | 7693 | Double_t dMult = (*fSpk)(0,0); // multiplicity (number of particles used to determine the reaction plane) |
489d5531 | 7694 | //Double_t mr = 0.; // number of RPs in particular pt or eta bin |
7695 | Double_t mp = 0.; // number of POIs in particular pt or eta bin | |
7696 | Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin | |
7697 | */ | |
7698 | ||
7699 | // e-b-e correlations: | |
7700 | Double_t twoEBE = fIntFlowCorrelationsEBE->GetBinContent(1); // <2> | |
7701 | Double_t fourEBE = fIntFlowCorrelationsEBE->GetBinContent(2); // <4> | |
7702 | Double_t sixEBE = fIntFlowCorrelationsEBE->GetBinContent(3); // <6> | |
7703 | Double_t eightEBE = fIntFlowCorrelationsEBE->GetBinContent(4); // <8> | |
7704 | ||
7705 | // event weights for correlations: | |
7706 | Double_t dW2 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1); // event weight for <2> | |
7707 | Double_t dW4 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2); // event weight for <4> | |
7708 | Double_t dW6 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(3); // event weight for <6> | |
7709 | Double_t dW8 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(4); // event weight for <8> | |
7710 | ||
7711 | // e-b-e reduced correlations: | |
7712 | Double_t twoReducedEBE = 0.; // <2'> | |
7713 | Double_t fourReducedEBE = 0.; // <4'> | |
7714 | Double_t sixReducedEBE = 0.; // <6'> | |
7715 | Double_t eightReducedEBE = 0.; // <8'> | |
7716 | ||
7717 | // event weights for reduced correlations: | |
7718 | Double_t dw2 = 0.; // event weight for <2'> | |
7719 | Double_t dw4 = 0.; // event weight for <4'> | |
7720 | //Double_t dw6 = 0.; // event weight for <6'> | |
7721 | //Double_t dw8 = 0.; // event weight for <8'> | |
7722 | ||
7723 | // looping over bins: | |
7724 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7725 | { | |
7726 | // e-b-e reduced correlations: | |
7727 | twoReducedEBE = fDiffFlowCorrelationsEBE[t][pe][0]->GetBinContent(b); | |
7728 | fourReducedEBE = fDiffFlowCorrelationsEBE[t][pe][1]->GetBinContent(b); | |
7729 | sixReducedEBE = fDiffFlowCorrelationsEBE[t][pe][2]->GetBinContent(b); | |
7730 | eightReducedEBE = fDiffFlowCorrelationsEBE[t][pe][3]->GetBinContent(b); | |
7731 | ||
7732 | /* | |
7733 | // to be improved (I should not do this here again) | |
7734 | if(type == "RP") | |
7735 | { | |
7736 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b); | |
7737 | mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow | |
7738 | } else if(type == "POI") | |
7739 | { | |
7740 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b); | |
7741 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); | |
7742 | } | |
7743 | ||
7744 | // event weights for reduced correlations: | |
7745 | dw2 = mp*dMult-mq; // weight for <2'> | |
7746 | dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
7747 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); // weight for <4'> | |
7748 | //dw6 = ... | |
7749 | //dw8 = ... | |
7750 | ||
7751 | */ | |
7752 | ||
7753 | dw2 = fDiffFlowEventWeightsForCorrelationsEBE[t][pe][0]->GetBinContent(b); | |
7754 | dw4 = fDiffFlowEventWeightsForCorrelationsEBE[t][pe][1]->GetBinContent(b); | |
7755 | ||
7756 | // storing all products: | |
7757 | fDiffFlowProductOfCorrelationsPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*twoReducedEBE,dW2*dw2); // storing <2><2'> | |
7758 | fDiffFlowProductOfCorrelationsPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*twoReducedEBE,dW4*dw2); // storing <4><2'> | |
7759 | fDiffFlowProductOfCorrelationsPro[t][pe][1][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*twoReducedEBE,dW6*dw2); // storing <6><2'> | |
7760 | fDiffFlowProductOfCorrelationsPro[t][pe][1][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*twoReducedEBE,dW8*dw2); // storing <8><2'> | |
7761 | ||
7762 | // event weight for <4'>: | |
7763 | fDiffFlowProductOfCorrelationsPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*fourReducedEBE,dW2*dw4); // storing <2><4'> | |
7764 | fDiffFlowProductOfCorrelationsPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*fourReducedEBE,dw2*dw4); // storing <2'><4'> | |
7765 | fDiffFlowProductOfCorrelationsPro[t][pe][2][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*fourReducedEBE,dW4*dw4); // storing <4><4'> | |
7766 | fDiffFlowProductOfCorrelationsPro[t][pe][3][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*fourReducedEBE,dW6*dw4); // storing <6><4'> | |
7767 | fDiffFlowProductOfCorrelationsPro[t][pe][3][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*fourReducedEBE,dW8*dw4); // storing <8><4'> | |
7768 | ||
7769 | // event weight for <6'>: | |
7770 | //dw6 = ...; | |
7771 | //fDiffFlowProductOfCorrelationsPro[t][pe][0][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*sixReducedEBE,dW2*dw6); // storing <2><6'> | |
7772 | //fDiffFlowProductOfCorrelationsPro[t][pe][1][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*sixReducedEBE,dw2*dw6); // storing <2'><6'> | |
7773 | //fDiffFlowProductOfCorrelationsPro[t][pe][2][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*sixReducedEBE,dW4*dw6); // storing <4><6'> | |
7774 | //fDiffFlowProductOfCorrelationsPro[t][pe][3][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourReducedEBE*sixReducedEBE,dw4*dw6); // storing <4'><6'> | |
7775 | //fDiffFlowProductOfCorrelationsPro[t][pe][4][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*sixReducedEBE,dW6*dw6); // storing <6><6'> | |
7776 | //fDiffFlowProductOfCorrelationsPro[t][pe][5][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightEBE,dw6*dW8); // storing <6'><8> | |
7777 | //fDiffFlowProductOfCorrelationsPro[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightReducedEBE,dw6*dw8); // storing <6'><8'> | |
7778 | ||
7779 | // event weight for <8'>: | |
7780 | //dw8 = ...; | |
7781 | //fDiffFlowProductOfCorrelationsPro[t][pe][0][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*eightReducedEBE,dW2*dw8); // storing <2><8'> | |
7782 | //fDiffFlowProductOfCorrelationsPro[t][pe][1][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*eightReducedEBE,dw2*dw8); // storing <2'><8'> | |
7783 | //fDiffFlowProductOfCorrelationsPro[t][pe][2][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*eightReducedEBE,dW4*dw8); // storing <4><8'> | |
7784 | //fDiffFlowProductOfCorrelationsPro[t][pe][3][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourReducedEBE*eightReducedEBE,dw4*dw8); // storing <4'><8'> | |
7785 | //fDiffFlowProductOfCorrelationsPro[t][pe][4][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*eightReducedEBE,dW6*dw8); // storing <6><8'> | |
7786 | //fDiffFlowProductOfCorrelationsPro[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightReducedEBE,dw6*dw8); // storing <6'><8'> | |
7787 | //fDiffFlowProductOfCorrelationsPro[t][pe][6][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*eightReducedEBE,dW8*dw8); // storing <8><8'> | |
7788 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++ | |
7789 | ||
7790 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowProductOfCorrelations(TString type, TString ptOrEta) | |
7791 | ||
489d5531 | 7792 | //================================================================================================================================ |
7793 | ||
489d5531 | 7794 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCovariances(TString type, TString ptOrEta) // to be improved (reimplemented) |
7795 | { | |
7796 | // a) Calculate unbiased estimators Cov(<2>,<2'>), Cov(<2>,<4'>), Cov(<4>,<2'>), Cov(<4>,<4'>) and Cov(<2'>,<4'>) | |
7797 | // for covariances V(<2>,<2'>), V(<2>,<4'>), V(<4>,<2'>), V(<4>,<4'>) and V(<2'>,<4'>). | |
7798 | // b) Store in histogram fDiffFlowCovariances[t][pe][index] for instance the following: | |
7799 | // | |
7800 | // Cov(<2>,<2'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] | |
7801 | // | |
7802 | // where N is the number of events, w_{<2>} is event weight for <2> and w_{<2'>} is event weight for <2'>. | |
7803 | // c) Binning of fDiffFlowCovariances[t][pe][index] is organized as follows: | |
7804 | // | |
7805 | // 1st bin: Cov(<2>,<2'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] | |
7806 | // 2nd bin: Cov(<2>,<4'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] | |
7807 | // 3rd bin: Cov(<4>,<2'>) * (sum_{i=1}^{N} w_{<4>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] | |
7808 | // 4th bin: Cov(<4>,<4'>) * (sum_{i=1}^{N} w_{<4>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] | |
7809 | // 5th bin: Cov(<2'>,<4'>) * (sum_{i=1}^{N} w_{<2'>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<2'>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] | |
7810 | // ... | |
7811 | ||
2a98ceb8 | 7812 | Int_t typeFlag = 0; |
7813 | Int_t ptEtaFlag = 0; | |
489d5531 | 7814 | |
7815 | if(type == "RP") | |
7816 | { | |
7817 | typeFlag = 0; | |
7818 | } else if(type == "POI") | |
7819 | { | |
7820 | typeFlag = 1; | |
7821 | } | |
7822 | ||
7823 | if(ptOrEta == "Pt") | |
7824 | { | |
7825 | ptEtaFlag = 0; | |
7826 | } else if(ptOrEta == "Eta") | |
7827 | { | |
7828 | ptEtaFlag = 1; | |
7829 | } | |
7830 | ||
7831 | // shortcuts: | |
7832 | Int_t t = typeFlag; | |
7833 | Int_t pe = ptEtaFlag; | |
7834 | ||
7835 | // common: | |
7836 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
7837 | //Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
7838 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
7839 | //Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
7840 | ||
7841 | // average correlations: | |
7842 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> | |
7843 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> | |
7844 | //Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> | |
7845 | //Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> | |
7846 | ||
7847 | // sum of weights for correlation: | |
7848 | Double_t sumOfWeightsForTwo = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // sum_{i=1}^{N} w_{<2>} | |
7849 | Double_t sumOfWeightsForFour = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // sum_{i=1}^{N} w_{<4>} | |
7850 | //Double_t sumOfWeightsForSix = fIntFlowSumOfEventWeights[0]->GetBinContent(3); // sum_{i=1}^{N} w_{<6>} | |
7851 | //Double_t sumOfWeightsForEight = fIntFlowSumOfEventWeights[0]->GetBinContent(4); // sum_{i=1}^{N} w_{<8>} | |
7852 | ||
7853 | // average reduced correlations: | |
7854 | Double_t twoReduced = 0.; // <<2'>> | |
7855 | Double_t fourReduced = 0.; // <<4'>> | |
7856 | //Double_t sixReduced = 0.; // <<6'>> | |
7857 | //Double_t eightReduced = 0.; // <<8'>> | |
7858 | ||
7859 | // sum of weights for reduced correlation: | |
7860 | Double_t sumOfWeightsForTwoReduced = 0.; // sum_{i=1}^{N} w_{<2'>} | |
7861 | Double_t sumOfWeightsForFourReduced = 0.; // sum_{i=1}^{N} w_{<4'>} | |
7862 | //Double_t sumOfWeightsForSixReduced = 0.; // sum_{i=1}^{N} w_{<6'>} | |
7863 | //Double_t sumOfWeightsForEightReduced = 0.; // sum_{i=1}^{N} w_{<8'>} | |
7864 | ||
7865 | // product of weights for reduced correlation: | |
7866 | Double_t productOfWeightsForTwoTwoReduced = 0.; // sum_{i=1}^{N} w_{<2>}w_{<2'>} | |
7867 | Double_t productOfWeightsForTwoFourReduced = 0.; // sum_{i=1}^{N} w_{<2>}w_{<4'>} | |
7868 | Double_t productOfWeightsForFourTwoReduced = 0.; // sum_{i=1}^{N} w_{<4>}w_{<2'>} | |
7869 | Double_t productOfWeightsForFourFourReduced = 0.; // sum_{i=1}^{N} w_{<4>}w_{<4'>} | |
7870 | Double_t productOfWeightsForTwoReducedFourReduced = 0.; // sum_{i=1}^{N} w_{<2'>}w_{<4'>} | |
7871 | // ... | |
7872 | ||
7873 | // products for differential flow: | |
7874 | Double_t twoTwoReduced = 0; // <<2><2'>> | |
7875 | Double_t twoFourReduced = 0; // <<2><4'>> | |
7876 | Double_t fourTwoReduced = 0; // <<4><2'>> | |
7877 | Double_t fourFourReduced = 0; // <<4><4'>> | |
7878 | Double_t twoReducedFourReduced = 0; // <<2'><4'>> | |
7879 | ||
7880 | // denominators in the expressions for the unbiased estimators for covariances: | |
7881 | // denominator = 1 - term1/(term2*term3) | |
7882 | // prefactor = term1/(term2*term3) | |
7883 | Double_t denominator = 0.; | |
7884 | Double_t prefactor = 0.; | |
7885 | Double_t term1 = 0.; | |
7886 | Double_t term2 = 0.; | |
7887 | Double_t term3 = 0.; | |
7888 | ||
7889 | // unbiased estimators for covariances for differential flow: | |
7890 | Double_t covTwoTwoReduced = 0.; // Cov(<2>,<2'>) | |
7891 | Double_t wCovTwoTwoReduced = 0.; // Cov(<2>,<2'>) * prefactor(w_{<2>},w_{<2'>}) | |
7892 | Double_t covTwoFourReduced = 0.; // Cov(<2>,<4'>) | |
7893 | Double_t wCovTwoFourReduced = 0.; // Cov(<2>,<4'>) * prefactor(w_{<2>},w_{<4'>}) | |
7894 | Double_t covFourTwoReduced = 0.; // Cov(<4>,<2'>) | |
7895 | Double_t wCovFourTwoReduced = 0.; // Cov(<4>,<2'>) * prefactor(w_{<4>},w_{<2'>}) | |
7896 | Double_t covFourFourReduced = 0.; // Cov(<4>,<4'>) | |
7897 | Double_t wCovFourFourReduced = 0.; // Cov(<4>,<4'>) * prefactor(w_{<4>},w_{<4'>}) | |
7898 | Double_t covTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) | |
7899 | Double_t wCovTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) * prefactor(w_{<2'>},w_{<4'>}) | |
7900 | ||
7901 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7902 | { | |
7903 | // average reduced corelations: | |
7904 | twoReduced = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); | |
7905 | fourReduced = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); | |
7906 | // average products: | |
7907 | twoTwoReduced = fDiffFlowProductOfCorrelationsPro[t][pe][0][1]->GetBinContent(b); | |
7908 | twoFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][0][3]->GetBinContent(b); | |
7909 | fourTwoReduced = fDiffFlowProductOfCorrelationsPro[t][pe][1][2]->GetBinContent(b); | |
7910 | fourFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][2][3]->GetBinContent(b); | |
7911 | twoReducedFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][1][3]->GetBinContent(b); | |
7912 | // sum of weights for reduced correlations: | |
7913 | sumOfWeightsForTwoReduced = fDiffFlowSumOfEventWeights[t][pe][0][0]->GetBinContent(b); | |
7914 | sumOfWeightsForFourReduced = fDiffFlowSumOfEventWeights[t][pe][0][1]->GetBinContent(b); | |
7915 | // products of weights for correlations: | |
7916 | productOfWeightsForTwoTwoReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][0][1]->GetBinContent(b); | |
7917 | productOfWeightsForTwoFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][0][3]->GetBinContent(b); | |
7918 | productOfWeightsForFourTwoReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][1][2]->GetBinContent(b); | |
7919 | productOfWeightsForFourFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][2][3]->GetBinContent(b); | |
7920 | productOfWeightsForTwoReducedFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][1][3]->GetBinContent(b); | |
7921 | // denominator for the unbiased estimator for covariances: 1 - term1/(term2*term3) | |
7922 | // prefactor (multiplies Cov's) = term1/(term2*term3) | |
7923 | // <2>,<2'>: | |
7924 | term1 = productOfWeightsForTwoTwoReduced; | |
7925 | term2 = sumOfWeightsForTwo; | |
7926 | term3 = sumOfWeightsForTwoReduced; | |
7927 | if(term2*term3>0.) | |
7928 | { | |
7929 | denominator = 1.-term1/(term2*term3); | |
7930 | prefactor = term1/(term2*term3); | |
1268c371 | 7931 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 7932 | { |
7933 | covTwoTwoReduced = (twoTwoReduced-two*twoReduced)/denominator; | |
7934 | wCovTwoTwoReduced = covTwoTwoReduced*prefactor; | |
7935 | fDiffFlowCovariances[t][pe][0]->SetBinContent(b,wCovTwoTwoReduced); | |
7936 | } | |
7937 | } | |
7938 | // <2>,<4'>: | |
7939 | term1 = productOfWeightsForTwoFourReduced; | |
7940 | term2 = sumOfWeightsForTwo; | |
7941 | term3 = sumOfWeightsForFourReduced; | |
7942 | if(term2*term3>0.) | |
7943 | { | |
7944 | denominator = 1.-term1/(term2*term3); | |
7945 | prefactor = term1/(term2*term3); | |
1268c371 | 7946 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 7947 | { |
7948 | covTwoFourReduced = (twoFourReduced-two*fourReduced)/denominator; | |
7949 | wCovTwoFourReduced = covTwoFourReduced*prefactor; | |
7950 | fDiffFlowCovariances[t][pe][1]->SetBinContent(b,wCovTwoFourReduced); | |
7951 | } | |
7952 | } | |
7953 | // <4>,<2'>: | |
7954 | term1 = productOfWeightsForFourTwoReduced; | |
7955 | term2 = sumOfWeightsForFour; | |
7956 | term3 = sumOfWeightsForTwoReduced; | |
7957 | if(term2*term3>0.) | |
7958 | { | |
7959 | denominator = 1.-term1/(term2*term3); | |
7960 | prefactor = term1/(term2*term3); | |
1268c371 | 7961 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 7962 | { |
7963 | covFourTwoReduced = (fourTwoReduced-four*twoReduced)/denominator; | |
7964 | wCovFourTwoReduced = covFourTwoReduced*prefactor; | |
7965 | fDiffFlowCovariances[t][pe][2]->SetBinContent(b,wCovFourTwoReduced); | |
7966 | } | |
7967 | } | |
7968 | // <4>,<4'>: | |
7969 | term1 = productOfWeightsForFourFourReduced; | |
7970 | term2 = sumOfWeightsForFour; | |
7971 | term3 = sumOfWeightsForFourReduced; | |
7972 | if(term2*term3>0.) | |
7973 | { | |
7974 | denominator = 1.-term1/(term2*term3); | |
7975 | prefactor = term1/(term2*term3); | |
1268c371 | 7976 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 7977 | { |
7978 | covFourFourReduced = (fourFourReduced-four*fourReduced)/denominator; | |
7979 | wCovFourFourReduced = covFourFourReduced*prefactor; | |
7980 | fDiffFlowCovariances[t][pe][3]->SetBinContent(b,wCovFourFourReduced); | |
7981 | } | |
7982 | } | |
7983 | // <2'>,<4'>: | |
7984 | term1 = productOfWeightsForTwoReducedFourReduced; | |
7985 | term2 = sumOfWeightsForTwoReduced; | |
7986 | term3 = sumOfWeightsForFourReduced; | |
7987 | if(term2*term3>0.) | |
7988 | { | |
7989 | denominator = 1.-term1/(term2*term3); | |
7990 | prefactor = term1/(term2*term3); | |
1268c371 | 7991 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 7992 | { |
7993 | covTwoReducedFourReduced = (twoReducedFourReduced-twoReduced*fourReduced)/denominator; | |
7994 | wCovTwoReducedFourReduced = covTwoReducedFourReduced*prefactor; | |
7995 | fDiffFlowCovariances[t][pe][4]->SetBinContent(b,wCovTwoReducedFourReduced); | |
7996 | } | |
7997 | } | |
7998 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7999 | ||
8000 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCovariances(TString type, TString ptOrEta) | |
8001 | ||
489d5531 | 8002 | //================================================================================================================================ |
8003 | ||
489d5531 | 8004 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, TString ptOrEta) |
8005 | { | |
1268c371 | 8006 | // Calculate final results for differential flow. |
489d5531 | 8007 | |
1268c371 | 8008 | // REMARK: Differential flow calculated in this method is NOT corrected for non-uniform acceptance. |
8009 | // This correction, if enabled via setter SetApplyCorrectionForNUA(Bool_t), is applied in the method | |
8010 | // CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta) | |
8011 | ||
8012 | Int_t t = 0; // RP or POI | |
8013 | Int_t pe = 0; // pt or eta | |
489d5531 | 8014 | |
8015 | if(type == "RP") | |
8016 | { | |
1268c371 | 8017 | t = 0; |
489d5531 | 8018 | } else if(type == "POI") |
8019 | { | |
1268c371 | 8020 | t = 1; |
489d5531 | 8021 | } |
8022 | ||
8023 | if(ptOrEta == "Pt") | |
8024 | { | |
1268c371 | 8025 | pe = 0; |
489d5531 | 8026 | } else if(ptOrEta == "Eta") |
8027 | { | |
1268c371 | 8028 | pe = 1; |
489d5531 | 8029 | } |
1268c371 | 8030 | |
8031 | // Common: | |
489d5531 | 8032 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
1268c371 | 8033 | // Correlations: |
489d5531 | 8034 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> |
1268c371 | 8035 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> |
8036 | // Statistical errors of correlations: | |
489d5531 | 8037 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); |
8038 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); | |
1268c371 | 8039 | // Reduced correlations: |
489d5531 | 8040 | Double_t twoReduced = 0.; // <<2'>> |
8041 | Double_t fourReduced = 0.; // <<4'>> | |
1268c371 | 8042 | // Statistical errors of reduced correlations: |
489d5531 | 8043 | Double_t twoReducedError = 0.; |
8044 | Double_t fourReducedError = 0.; | |
1268c371 | 8045 | // Covariances: |
8e1cefdd | 8046 | Double_t wCovTwoFour = 0.; // Cov(<2>,<4>) * prefactor(<2>,<4>) |
8047 | if(!fForgetAboutCovariances) | |
8048 | { | |
8049 | wCovTwoFour = fIntFlowCovariances->GetBinContent(1); // Cov(<2>,<4>) * prefactor(<2>,<4>) | |
8050 | } | |
489d5531 | 8051 | Double_t wCovTwoTwoReduced = 0.; // Cov(<2>,<2'>) * prefactor(<2>,<2'>) |
8052 | Double_t wCovTwoFourReduced = 0.; // Cov(<2>,<4'>) * prefactor(<2>,<4'>) | |
8053 | Double_t wCovFourTwoReduced = 0.; // Cov(<4>,<2'>) * prefactor(<4>,<2'>) | |
8054 | Double_t wCovFourFourReduced = 0.; // Cov(<4>,<4'>) * prefactor(<4>,<4'>) | |
8055 | Double_t wCovTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) * prefactor(<2'>,<4'>) | |
1268c371 | 8056 | // Differential flow: |
489d5531 | 8057 | Double_t v2Prime = 0.; // v'{2} |
8058 | Double_t v4Prime = 0.; // v'{4} | |
1268c371 | 8059 | // Statistical error of differential flow: |
489d5531 | 8060 | Double_t v2PrimeError = 0.; |
8061 | Double_t v4PrimeError = 0.; | |
1268c371 | 8062 | // Squared statistical error of differential flow: |
489d5531 | 8063 | Double_t v2PrimeErrorSquared = 0.; |
8064 | Double_t v4PrimeErrorSquared = 0.; | |
1268c371 | 8065 | // Loop over pt or eta bins: |
489d5531 | 8066 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) |
8067 | { | |
1268c371 | 8068 | // Reduced correlations and statistical errors: |
489d5531 | 8069 | twoReduced = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); |
8070 | twoReducedError = fDiffFlowCorrelationsHist[t][pe][0]->GetBinError(b); | |
8071 | fourReduced = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); | |
8072 | fourReducedError = fDiffFlowCorrelationsHist[t][pe][1]->GetBinError(b); | |
1268c371 | 8073 | // Covariances: |
8e1cefdd | 8074 | if(!fForgetAboutCovariances) |
8075 | { | |
8076 | wCovTwoTwoReduced = fDiffFlowCovariances[t][pe][0]->GetBinContent(b); | |
8077 | wCovTwoFourReduced = fDiffFlowCovariances[t][pe][1]->GetBinContent(b); | |
8078 | wCovFourTwoReduced = fDiffFlowCovariances[t][pe][2]->GetBinContent(b); | |
8079 | wCovFourFourReduced = fDiffFlowCovariances[t][pe][3]->GetBinContent(b); | |
8080 | wCovTwoReducedFourReduced = fDiffFlowCovariances[t][pe][4]->GetBinContent(b); | |
8081 | } | |
1268c371 | 8082 | // Differential flow: |
489d5531 | 8083 | // v'{2}: |
8084 | if(two>0.) | |
8085 | { | |
8086 | v2Prime = twoReduced/pow(two,0.5); | |
1268c371 | 8087 | v2PrimeErrorSquared = (1./4.)*pow(two,-3.)*(pow(twoReduced,2.)*pow(twoError,2.) |
8088 | + 4.*pow(two,2.)*pow(twoReducedError,2.) | |
8089 | - 4.*two*twoReduced*wCovTwoTwoReduced); | |
8090 | if(v2PrimeErrorSquared>0.){v2PrimeError = pow(v2PrimeErrorSquared,0.5);} | |
8091 | if(TMath::Abs(v2Prime)>0.) | |
8092 | { | |
8093 | fDiffFlow[t][pe][0]->SetBinContent(b,v2Prime); | |
8094 | fDiffFlow[t][pe][0]->SetBinError(b,v2PrimeError); | |
8095 | } | |
8096 | } // end of if(two>0.) | |
489d5531 | 8097 | // differential flow: |
8098 | // v'{4} | |
8099 | if(2.*pow(two,2.)-four > 0.) | |
8100 | { | |
8101 | v4Prime = (2.*two*twoReduced-fourReduced)/pow(2.*pow(two,2.)-four,3./4.); | |
1268c371 | 8102 | v4PrimeErrorSquared = pow(2.*pow(two,2.)-four,-7./2.) |
8103 | * (pow(2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced,2.)*pow(twoError,2.) | |
8104 | + (9./16.)*pow(2.*two*twoReduced-fourReduced,2.)*pow(fourError,2.) | |
8105 | + 4.*pow(two,2.)*pow(2.*pow(two,2.)-four,2.)*pow(twoReducedError,2.) | |
8106 | + pow(2.*pow(two,2.)-four,2.)*pow(fourReducedError,2.) | |
8107 | - (3./2.)*(2.*two*twoReduced-fourReduced) | |
8108 | * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoFour | |
8109 | - 4.*two*(2.*pow(two,2.)-four) | |
8110 | * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoTwoReduced | |
8111 | + 2.*(2.*pow(two,2.)-four) | |
8112 | * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoFourReduced | |
8113 | + 3.*two*(2.*pow(two,2.)-four)*(2.*two*twoReduced-fourReduced)*wCovFourTwoReduced | |
8114 | - (3./2.)*(2.*pow(two,2.)-four)*(2.*two*twoReduced-fourReduced)*wCovFourFourReduced | |
8115 | - 4.*two*pow(2.*pow(two,2.)-four,2.)*wCovTwoReducedFourReduced); | |
8116 | if(v4PrimeErrorSquared>0.){v4PrimeError = pow(v4PrimeErrorSquared,0.5);} | |
8117 | if(TMath::Abs(v4Prime)>0.) | |
8118 | { | |
8119 | fDiffFlow[t][pe][1]->SetBinContent(b,v4Prime); | |
8120 | fDiffFlow[t][pe][1]->SetBinError(b,v4PrimeError); | |
8121 | } | |
8122 | } // end of if(2.*pow(two,2.)-four > 0.) | |
489d5531 | 8123 | } // end of for(Int_t b=1;b<=fnBinsPtEta[pe];b++) |
1268c371 | 8124 | |
8125 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, Bool_t useParticleWeights) | |
8126 | ||
8127 | //================================================================================================================================ | |
8128 | ||
8129 | void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlow(TString type) | |
8130 | { | |
8131 | // Calculate final results for 2D diferential flow. | |
8132 | ||
8133 | // to be improved - check pointers used in this method | |
8134 | ||
8135 | Int_t t = 0; // RP or POI | |
8136 | ||
8137 | if(type == "RP") | |
8138 | { | |
8139 | t = 0; | |
8140 | } else if(type == "POI") | |
8141 | { | |
8142 | t = 1; | |
8143 | } | |
489d5531 | 8144 | |
1268c371 | 8145 | // Differential flow: |
8146 | Double_t v2Prime = 0.; // v'{2} | |
8147 | Double_t v4Prime = 0.; // v'{4} | |
8148 | // Differential cumulants: | |
8149 | Double_t qc2Prime = 0.; // QC{2'} | |
8150 | Double_t qc4Prime = 0.; // QC{4'} | |
8151 | // Looping over all (pt,eta) bins and calculating differential flow: | |
8152 | for(Int_t p=1;p<=fnBinsPt;p++) | |
489d5531 | 8153 | { |
1268c371 | 8154 | for(Int_t e=1;e<=fnBinsEta;e++) |
489d5531 | 8155 | { |
1268c371 | 8156 | // QC{2'}: |
8157 | qc2Prime = f2DDiffFlowCumulants[t][0]->GetBinContent(f2DDiffFlowCumulants[t][0]->GetBin(p,e)); | |
8158 | if(qc2Prime>=0.) | |
8159 | { | |
8160 | v2Prime = pow(qc2Prime,0.5); | |
8161 | f2DDiffFlow[t][0]->SetBinContent(f2DDiffFlow[t][0]->GetBin(p,e),v2Prime); | |
8162 | } | |
8163 | // QC{4'}: | |
8164 | qc4Prime = f2DDiffFlowCumulants[t][1]->GetBinContent(f2DDiffFlowCumulants[t][1]->GetBin(p,e)); | |
8165 | if(qc4Prime<=0.) | |
8166 | { | |
8167 | v4Prime = pow(-1.*qc4Prime,1./4.); | |
8168 | f2DDiffFlow[t][1]->SetBinContent(f2DDiffFlow[t][1]->GetBin(p,e),v4Prime); | |
8169 | } | |
8170 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
8171 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
8172 | ||
8173 | } // end of void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlow(TString type) | |
489d5531 | 8174 | |
489d5531 | 8175 | //================================================================================================================================ |
8176 | ||
489d5531 | 8177 | void AliFlowAnalysisWithQCumulants::StoreIntFlowFlags() |
8178 | { | |
8179 | // a) Store all flags for integrated flow in profile fIntFlowFlags. | |
8180 | ||
8181 | if(!fIntFlowFlags) | |
8182 | { | |
8183 | cout<<"WARNING: fIntFlowFlags is NULL in AFAWQC::SFFIF() !!!!"<<endl; | |
8184 | exit(0); | |
8185 | } | |
8186 | ||
8187 | // particle weights used or not: | |
403e3389 | 8188 | fIntFlowFlags->Fill(0.5,(Int_t)fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights); |
489d5531 | 8189 | // which event weights were used: |
8190 | if(strcmp(fMultiplicityWeight->Data(),"combinations")) | |
8191 | { | |
8192 | fIntFlowFlags->Fill(1.5,0); // 0 = "combinations" (default) | |
8193 | } else if(strcmp(fMultiplicityWeight->Data(),"unit")) | |
8194 | { | |
8195 | fIntFlowFlags->Fill(1.5,1); // 1 = "unit" | |
8196 | } else if(strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
8197 | { | |
8198 | fIntFlowFlags->Fill(1.5,2); // 2 = "multiplicity" | |
8199 | } | |
489d5531 | 8200 | fIntFlowFlags->Fill(2.5,(Int_t)fApplyCorrectionForNUA); |
8201 | fIntFlowFlags->Fill(3.5,(Int_t)fPrintFinalResults[0]); | |
8202 | fIntFlowFlags->Fill(4.5,(Int_t)fPrintFinalResults[1]); | |
8203 | fIntFlowFlags->Fill(5.5,(Int_t)fPrintFinalResults[2]); | |
b3dacf6b | 8204 | fIntFlowFlags->Fill(6.5,(Int_t)fPrintFinalResults[3]); |
8205 | fIntFlowFlags->Fill(7.5,(Int_t)fApplyCorrectionForNUAVsM); | |
b77b6434 | 8206 | fIntFlowFlags->Fill(8.5,(Int_t)fPropagateErrorAlsoFromNIT); |
b3dacf6b | 8207 | fIntFlowFlags->Fill(9.5,(Int_t)fCalculateCumulantsVsM); |
0dd3b008 | 8208 | fIntFlowFlags->Fill(10.5,(Int_t)fMinimumBiasReferenceFlow); |
8e1cefdd | 8209 | fIntFlowFlags->Fill(11.5,(Int_t)fForgetAboutCovariances); |
e5834fcb | 8210 | fIntFlowFlags->Fill(12.5,(Int_t)fStorePhiDistributionForOneEvent); |
dd442cd2 | 8211 | fIntFlowFlags->Fill(13.5,(Int_t)fFillMultipleControlHistograms); |
3435cacb | 8212 | fIntFlowFlags->Fill(14.5,(Int_t)fCalculateAllCorrelationsVsM); |
489d5531 | 8213 | } // end of void AliFlowAnalysisWithQCumulants::StoreIntFlowFlags() |
8214 | ||
489d5531 | 8215 | //================================================================================================================================ |
8216 | ||
489d5531 | 8217 | void AliFlowAnalysisWithQCumulants::StoreDiffFlowFlags() |
8218 | { | |
8219 | // Store all flags for differential flow in the profile fDiffFlowFlags. | |
8220 | ||
8221 | if(!fDiffFlowFlags) | |
8222 | { | |
1268c371 | 8223 | printf("\n WARNING (QC): fDiffFlowFlags is NULL in AFAWQC::SDFF() !!!!\n\n"); |
489d5531 | 8224 | exit(0); |
8225 | } | |
8226 | ||
1268c371 | 8227 | fDiffFlowFlags->Fill(0.5,fCalculateDiffFlow); // calculate differential flow |
403e3389 | 8228 | fDiffFlowFlags->Fill(1.5,fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights); // particle weights used or not? |
1268c371 | 8229 | //fDiffFlowFlags->Fill(2.5,""); // which event weight was used? ("combinations", "unit" or "multiplicity") to be improved - finalized |
8230 | fDiffFlowFlags->Fill(3.5,fApplyCorrectionForNUA); // corrected for non-uniform acceptance or not | |
8231 | fDiffFlowFlags->Fill(4.5,fCalculate2DDiffFlow); // calculate also 2D differential flow vs (pt,eta) | |
8232 | ||
489d5531 | 8233 | } // end of void AliFlowAnalysisWithQCumulants::StoreDiffFlowFlags() |
8234 | ||
489d5531 | 8235 | //================================================================================================================================ |
8236 | ||
489d5531 | 8237 | void AliFlowAnalysisWithQCumulants::GetPointersForCommonHistograms() |
8238 | { | |
8239 | // Access all pointers to common control and common result histograms and profiles. | |
8240 | ||
1268c371 | 8241 | TString sCommonConstantsName = "fCommonConstants"; |
8242 | sCommonConstantsName += fAnalysisLabel->Data(); | |
8243 | fCommonConstants = dynamic_cast<TProfile*>(fHistList->FindObject(sCommonConstantsName.Data())); | |
8244 | if(!fCommonConstants) | |
8245 | { | |
8246 | printf("\n WARNING (QC): fCommonConstants is NULL in AFAWQC::GPFCH() !!!!\n\n"); | |
8247 | exit(0); | |
8248 | } | |
8249 | ||
8250 | // to be improved - lines bellow can be implemented better. | |
8251 | ||
489d5531 | 8252 | TString commonHistsName = "AliFlowCommonHistQC"; |
8253 | commonHistsName += fAnalysisLabel->Data(); | |
8254 | AliFlowCommonHist *commonHist = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHistsName.Data())); | |
b77b6434 | 8255 | if(commonHist) |
8256 | { | |
8257 | this->SetCommonHists(commonHist); | |
8258 | if(fCommonHists->GetHarmonic()) | |
8259 | { | |
8260 | fHarmonic = (Int_t)(fCommonHists->GetHarmonic())->GetBinContent(1); | |
8261 | } | |
8262 | } // end of if(commonHist) | |
489d5531 | 8263 | TString commonHists2ndOrderName = "AliFlowCommonHist2ndOrderQC"; |
8264 | commonHists2ndOrderName += fAnalysisLabel->Data(); | |
8265 | AliFlowCommonHist *commonHist2nd = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists2ndOrderName.Data())); | |
8266 | if(commonHist2nd) this->SetCommonHists2nd(commonHist2nd); | |
8267 | TString commonHists4thOrderName = "AliFlowCommonHist4thOrderQC"; | |
8268 | commonHists4thOrderName += fAnalysisLabel->Data(); | |
8269 | AliFlowCommonHist *commonHist4th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists4thOrderName.Data())); | |
8270 | if(commonHist4th) this->SetCommonHists4th(commonHist4th); | |
8271 | TString commonHists6thOrderName = "AliFlowCommonHist6thOrderQC"; | |
8272 | commonHists6thOrderName += fAnalysisLabel->Data(); | |
8273 | AliFlowCommonHist *commonHist6th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists6thOrderName.Data())); | |
8274 | if(commonHist6th) this->SetCommonHists6th(commonHist6th); | |
8275 | TString commonHists8thOrderName = "AliFlowCommonHist8thOrderQC"; | |
8276 | commonHists8thOrderName += fAnalysisLabel->Data(); | |
8277 | AliFlowCommonHist *commonHist8th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists8thOrderName.Data())); | |
dd442cd2 | 8278 | if(commonHist8th) this->SetCommonHists8th(commonHist8th); |
8279 | ||
489d5531 | 8280 | TString commonHistResults2ndOrderName = "AliFlowCommonHistResults2ndOrderQC"; |
8281 | commonHistResults2ndOrderName += fAnalysisLabel->Data(); | |
b77b6434 | 8282 | AliFlowCommonHistResults *commonHistRes2nd = dynamic_cast<AliFlowCommonHistResults*> |
8283 | (fHistList->FindObject(commonHistResults2ndOrderName.Data())); | |
489d5531 | 8284 | if(commonHistRes2nd) this->SetCommonHistsResults2nd(commonHistRes2nd); |
8285 | TString commonHistResults4thOrderName = "AliFlowCommonHistResults4thOrderQC"; | |
8286 | commonHistResults4thOrderName += fAnalysisLabel->Data(); | |
8287 | AliFlowCommonHistResults *commonHistRes4th = dynamic_cast<AliFlowCommonHistResults*> | |
8288 | (fHistList->FindObject(commonHistResults4thOrderName.Data())); | |
8289 | if(commonHistRes4th) this->SetCommonHistsResults4th(commonHistRes4th); | |
8290 | TString commonHistResults6thOrderName = "AliFlowCommonHistResults6thOrderQC"; | |
8291 | commonHistResults6thOrderName += fAnalysisLabel->Data(); | |
8292 | AliFlowCommonHistResults *commonHistRes6th = dynamic_cast<AliFlowCommonHistResults*> | |
8293 | (fHistList->FindObject(commonHistResults6thOrderName.Data())); | |
8294 | if(commonHistRes6th) this->SetCommonHistsResults6th(commonHistRes6th); | |
8295 | TString commonHistResults8thOrderName = "AliFlowCommonHistResults8thOrderQC"; | |
8296 | commonHistResults8thOrderName += fAnalysisLabel->Data(); | |
8297 | AliFlowCommonHistResults *commonHistRes8th = dynamic_cast<AliFlowCommonHistResults*> | |
8298 | (fHistList->FindObject(commonHistResults8thOrderName.Data())); | |
8299 | if(commonHistRes8th) this->SetCommonHistsResults8th(commonHistRes8th); | |
8300 | ||
8301 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForCommonHistograms() | |
8302 | ||
489d5531 | 8303 | //================================================================================================================================ |
8304 | ||
489d5531 | 8305 | void AliFlowAnalysisWithQCumulants::GetPointersForParticleWeightsHistograms() |
8306 | { | |
8307 | // Get pointers for histograms with particle weights. | |
8308 | ||
8309 | TList *weightsList = dynamic_cast<TList*>(fHistList->FindObject("Weights")); | |
ca5f47e7 | 8310 | if(!weightsList){printf("\n WARNING (QC): weightsList is NULL in AFAWQC::GPFPWH() !!!!\n");exit(0);} |
8311 | this->SetWeightsList(weightsList); | |
489d5531 | 8312 | TString fUseParticleWeightsName = "fUseParticleWeightsQC"; // to be improved (hirdwired label QC) |
8313 | fUseParticleWeightsName += fAnalysisLabel->Data(); | |
8314 | TProfile *useParticleWeights = dynamic_cast<TProfile*>(weightsList->FindObject(fUseParticleWeightsName.Data())); | |
8315 | if(useParticleWeights) | |
8316 | { | |
8317 | this->SetUseParticleWeights(useParticleWeights); | |
8318 | fUsePhiWeights = (Int_t)fUseParticleWeights->GetBinContent(1); | |
8319 | fUsePtWeights = (Int_t)fUseParticleWeights->GetBinContent(2); | |
8320 | fUseEtaWeights = (Int_t)fUseParticleWeights->GetBinContent(3); | |
403e3389 | 8321 | fUseTrackWeights = (Int_t)fUseParticleWeights->GetBinContent(4); |
489d5531 | 8322 | } |
8323 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForParticleWeightsHistograms(); | |
8324 | ||
489d5531 | 8325 | //================================================================================================================================ |
8326 | ||
489d5531 | 8327 | void AliFlowAnalysisWithQCumulants::GetPointersForIntFlowHistograms() |
8328 | { | |
8329 | // Get pointers for histograms and profiles relevant for integrated flow: | |
8330 | // a) Get pointer to base list for integrated flow holding profile fIntFlowFlags and lists fIntFlowProfiles and fIntFlowResults. | |
8331 | // b) Get pointer to profile fIntFlowFlags holding all flags for integrated flow. | |
8332 | // c) Get pointer to list fIntFlowProfiles and pointers to all objects that she holds. | |
8333 | // d) Get pointer to list fIntFlowResults and pointers to all objects that she holds. | |
8334 | ||
8335 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data member?) | |
8336 | TString powerFlag[2] = {"linear","quadratic"}; // to be improved (should I promote this to data member?) | |
b40a910e | 8337 | TString correlationFlag[4] = {"#LT#LT2#GT#GT","#LT#LT4#GT#GT","#LT#LT6#GT#GT","#LT#LT8#GT#GT"}; // to be improved (should I promote this to data member?) |
8338 | TString squaredCorrelationFlag[4] = {"#LT#LT2#GT^{2}#GT","#LT#LT4#GT^{2}#GT","#LT#LT6#GT^{2}#GT","#LT#LT8#GT^{2}#GT"}; // to be improved (should I promote this to data member?) | |
489d5531 | 8339 | |
8340 | // a) Get pointer to base list for integrated flow holding profile fIntFlowFlags and lists fIntFlowProfiles and fIntFlowResults: | |
8341 | TList *intFlowList = NULL; | |
8342 | intFlowList = dynamic_cast<TList*>(fHistList->FindObject("Integrated Flow")); | |
8343 | if(!intFlowList) | |
8344 | { | |
8345 | cout<<"WARNING: intFlowList is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8346 | exit(0); | |
8347 | } | |
8348 | ||
b92ea2b9 | 8349 | // b) Get pointer to profile fIntFlowFlags holding all flags for integrated flow: |
8350 | TString intFlowFlagsName = "fIntFlowFlags"; | |
8351 | intFlowFlagsName += fAnalysisLabel->Data(); | |
8352 | TProfile *intFlowFlags = dynamic_cast<TProfile*>(intFlowList->FindObject(intFlowFlagsName.Data())); | |
8353 | if(intFlowFlags) | |
8354 | { | |
8355 | this->SetIntFlowFlags(intFlowFlags); | |
8356 | fApplyCorrectionForNUA = (Bool_t)intFlowFlags->GetBinContent(3); | |
8357 | fApplyCorrectionForNUAVsM = (Bool_t)intFlowFlags->GetBinContent(8); | |
8358 | fCalculateCumulantsVsM = (Bool_t)intFlowFlags->GetBinContent(10); | |
8359 | } else | |
8360 | { | |
8361 | cout<<"WARNING: intFlowFlags is NULL in FAWQC::GPFIFH() !!!!"<<endl; | |
8362 | } | |
489d5531 | 8363 | |
8364 | // c) Get pointer to list fIntFlowProfiles and pointers to all objects that she holds: | |
8365 | TList *intFlowProfiles = NULL; | |
8366 | intFlowProfiles = dynamic_cast<TList*>(intFlowList->FindObject("Profiles")); | |
8367 | if(intFlowProfiles) | |
8368 | { | |
8369 | // average multiplicities: | |
8370 | TString avMultiplicityName = "fAvMultiplicity"; | |
8371 | avMultiplicityName += fAnalysisLabel->Data(); | |
8372 | TProfile *avMultiplicity = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(avMultiplicityName.Data())); | |
8373 | if(avMultiplicity) | |
8374 | { | |
8375 | this->SetAvMultiplicity(avMultiplicity); | |
8376 | } else | |
8377 | { | |
8378 | cout<<"WARNING: avMultiplicity is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8379 | } | |
8380 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with wrong errors!): | |
8381 | TString intFlowCorrelationsProName = "fIntFlowCorrelationsPro"; | |
8382 | intFlowCorrelationsProName += fAnalysisLabel->Data(); | |
8383 | TProfile *intFlowCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowCorrelationsProName.Data())); | |
8384 | if(intFlowCorrelationsPro) | |
8385 | { | |
8386 | this->SetIntFlowCorrelationsPro(intFlowCorrelationsPro); | |
8387 | } else | |
8388 | { | |
8389 | cout<<"WARNING: intFlowCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
ff70ca91 | 8390 | } |
b40a910e | 8391 | // average squared correlations <<2>^2>, <<4>^2>, <<6>^2> and <<8^2>>: |
8392 | TString intFlowSquaredCorrelationsProName = "fIntFlowSquaredCorrelationsPro"; | |
8393 | intFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
8394 | TProfile *intFlowSquaredCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowSquaredCorrelationsProName.Data())); | |
8395 | if(intFlowSquaredCorrelationsPro) | |
8396 | { | |
8397 | this->SetIntFlowSquaredCorrelationsPro(intFlowSquaredCorrelationsPro); | |
8398 | } else | |
8399 | { | |
8400 | cout<<"WARNING: intFlowSquaredCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8401 | } | |
b3dacf6b | 8402 | if(fCalculateCumulantsVsM) |
ff70ca91 | 8403 | { |
b40a910e | 8404 | // Average correlations <<2>>, <<4>>, <<6>> and <<8>> versus multiplicity for all events (error is wrong here): |
b3dacf6b | 8405 | TString intFlowCorrelationsVsMProName = "fIntFlowCorrelationsVsMPro"; |
8406 | intFlowCorrelationsVsMProName += fAnalysisLabel->Data(); | |
8407 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
ff70ca91 | 8408 | { |
b3dacf6b | 8409 | TProfile *intFlowCorrelationsVsMPro = dynamic_cast<TProfile*> |
8410 | (intFlowProfiles->FindObject(Form("%s, %s",intFlowCorrelationsVsMProName.Data(),correlationFlag[ci].Data()))); | |
8411 | if(intFlowCorrelationsVsMPro) | |
8412 | { | |
8413 | this->SetIntFlowCorrelationsVsMPro(intFlowCorrelationsVsMPro,ci); | |
8414 | } else | |
8415 | { | |
8416 | cout<<"WARNING: "<<Form("intFlowCorrelationsVsMPro[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8417 | } | |
8418 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
b40a910e | 8419 | // Average squared correlations <<2>^2>, <<4>^2>, <<6>^2> and <<8>^2> versus multiplicity for all events: |
8420 | TString intFlowSquaredCorrelationsVsMProName = "fIntFlowSquaredCorrelationsVsMPro"; | |
8421 | intFlowSquaredCorrelationsVsMProName += fAnalysisLabel->Data(); | |
8422 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
8423 | { | |
8424 | TProfile *intFlowSquaredCorrelationsVsMPro = dynamic_cast<TProfile*> | |
8425 | (intFlowProfiles->FindObject(Form("%s, %s",intFlowSquaredCorrelationsVsMProName.Data(),squaredCorrelationFlag[ci].Data()))); | |
8426 | if(intFlowSquaredCorrelationsVsMPro) | |
8427 | { | |
8428 | this->SetIntFlowSquaredCorrelationsVsMPro(intFlowSquaredCorrelationsVsMPro,ci); | |
8429 | } else | |
8430 | { | |
8431 | cout<<"WARNING: "<<Form("intFlowSquaredCorrelationsVsMPro[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8432 | } | |
8433 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
b3dacf6b | 8434 | } // end of if(fCalculateCumulantsVsM) |
489d5531 | 8435 | // average all correlations for integrated flow (with wrong errors!): |
8436 | TString intFlowCorrelationsAllProName = "fIntFlowCorrelationsAllPro"; | |
8437 | intFlowCorrelationsAllProName += fAnalysisLabel->Data(); | |
8438 | TProfile *intFlowCorrelationsAllPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowCorrelationsAllProName.Data())); | |
8439 | if(intFlowCorrelationsAllPro) | |
8440 | { | |
8441 | this->SetIntFlowCorrelationsAllPro(intFlowCorrelationsAllPro); | |
8442 | } else | |
8443 | { | |
8444 | cout<<"WARNING: intFlowCorrelationsAllPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8445 | } | |
8446 | // average extra correlations for integrated flow (which appear only when particle weights are used): | |
8447 | // (to be improved: Weak point in implementation, I am assuming here that method GetPointersForParticleWeightsHistograms() was called) | |
403e3389 | 8448 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 8449 | { |
8450 | TString intFlowExtraCorrelationsProName = "fIntFlowExtraCorrelationsPro"; | |
8451 | intFlowExtraCorrelationsProName += fAnalysisLabel->Data(); | |
8452 | TProfile *intFlowExtraCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowExtraCorrelationsProName.Data())); | |
8453 | if(intFlowExtraCorrelationsPro) | |
8454 | { | |
8455 | this->SetIntFlowExtraCorrelationsPro(intFlowExtraCorrelationsPro); | |
8456 | } else | |
8457 | { | |
8458 | cout<<"WARNING: intFlowExtraCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8459 | } | |
403e3389 | 8460 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 8461 | // average products of correlations <2>, <4>, <6> and <8>: |
8462 | TString intFlowProductOfCorrelationsProName = "fIntFlowProductOfCorrelationsPro"; | |
8463 | intFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
8464 | TProfile *intFlowProductOfCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowProductOfCorrelationsProName.Data())); | |
8465 | if(intFlowProductOfCorrelationsPro) | |
8466 | { | |
8467 | this->SetIntFlowProductOfCorrelationsPro(intFlowProductOfCorrelationsPro); | |
8468 | } else | |
8469 | { | |
8470 | cout<<"WARNING: intFlowProductOfCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
ff70ca91 | 8471 | } |
8472 | // average product of correlations <2>, <4>, <6> and <8> versus multiplicity | |
8473 | // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>] | |
b3dacf6b | 8474 | if(fCalculateCumulantsVsM) |
8475 | { | |
8476 | TString intFlowProductOfCorrelationsVsMProName = "fIntFlowProductOfCorrelationsVsMPro"; | |
8477 | intFlowProductOfCorrelationsVsMProName += fAnalysisLabel->Data(); | |
403e3389 | 8478 | TString productFlag[6] = {"#LT#LT2#GT#LT4#GT#GT","#LT#LT2#GT#LT6#GT#GT","#LT#LT2#GT#LT8#GT#GT", |
8479 | "#LT#LT4#GT#LT6#GT#GT","#LT#LT4#GT#LT8#GT#GT","#LT#LT6#GT#LT8#GT#GT"}; | |
b3dacf6b | 8480 | for(Int_t pi=0;pi<6;pi++) |
8481 | { | |
8482 | TProfile *intFlowProductOfCorrelationsVsMPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(Form("%s, %s",intFlowProductOfCorrelationsVsMProName.Data(),productFlag[pi].Data()))); | |
8483 | if(intFlowProductOfCorrelationsVsMPro) | |
8484 | { | |
8485 | this->SetIntFlowProductOfCorrelationsVsMPro(intFlowProductOfCorrelationsVsMPro,pi); | |
8486 | } else | |
8487 | { | |
8488 | cout<<"WARNING: "<<Form("intFlowProductOfCorrelationsVsMPro[%d]",pi)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8489 | } | |
8490 | } // end of for(Int_t pi=0;pi<6;pi++) | |
8491 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 8492 | // average correction terms for non-uniform acceptance (with wrong errors!): |
8493 | for(Int_t sc=0;sc<2;sc++) | |
8494 | { | |
8495 | TString intFlowCorrectionTermsForNUAProName = "fIntFlowCorrectionTermsForNUAPro"; | |
8496 | intFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
8497 | TProfile *intFlowCorrectionTermsForNUAPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject((Form("%s: %s terms",intFlowCorrectionTermsForNUAProName.Data(),sinCosFlag[sc].Data())))); | |
8498 | if(intFlowCorrectionTermsForNUAPro) | |
8499 | { | |
8500 | this->SetIntFlowCorrectionTermsForNUAPro(intFlowCorrectionTermsForNUAPro,sc); | |
8501 | } else | |
8502 | { | |
8503 | cout<<"WARNING: intFlowCorrectionTermsForNUAPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8504 | cout<<"sc = "<<sc<<endl; | |
8505 | } | |
2001bc3a | 8506 | // versus multiplicity: |
b3dacf6b | 8507 | if(fCalculateCumulantsVsM) |
2001bc3a | 8508 | { |
b3dacf6b | 8509 | TString correctionTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4 |
8510 | TString intFlowCorrectionTermsForNUAVsMProName = "fIntFlowCorrectionTermsForNUAVsMPro"; | |
8511 | intFlowCorrectionTermsForNUAVsMProName += fAnalysisLabel->Data(); | |
8512 | for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) | |
2001bc3a | 8513 | { |
b3dacf6b | 8514 | TProfile *intFlowCorrectionTermsForNUAVsMPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(Form("%s: #LT#LT%s%s#GT#GT",intFlowCorrectionTermsForNUAVsMProName.Data(),sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()))); |
8515 | if(intFlowCorrectionTermsForNUAVsMPro) | |
8516 | { | |
8517 | this->SetIntFlowCorrectionTermsForNUAVsMPro(intFlowCorrectionTermsForNUAVsMPro,sc,ci); | |
8518 | } else | |
8519 | { | |
8520 | cout<<"WARNING: intFlowCorrectionTermsForNUAVsMPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8521 | cout<<"sc = "<<sc<<endl; | |
8522 | cout<<"ci = "<<ci<<endl; | |
8523 | } | |
8524 | } // end of for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) | |
8525 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 8526 | } // end of for(Int_t sc=0;sc<2;sc++) |
0328db2d | 8527 | // average products of correction terms for NUA: |
8528 | TString intFlowProductOfCorrectionTermsForNUAProName = "fIntFlowProductOfCorrectionTermsForNUAPro"; | |
8529 | intFlowProductOfCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
8530 | TProfile *intFlowProductOfCorrectionTermsForNUAPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowProductOfCorrectionTermsForNUAProName.Data())); | |
8531 | if(intFlowProductOfCorrectionTermsForNUAPro) | |
8532 | { | |
8533 | this->SetIntFlowProductOfCorrectionTermsForNUAPro(intFlowProductOfCorrectionTermsForNUAPro); | |
8534 | } else | |
8535 | { | |
8536 | cout<<"WARNING: intFlowProductOfCorrectionTermsForNUAPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8537 | } | |
489d5531 | 8538 | } else // to if(intFlowProfiles) |
8539 | { | |
8540 | cout<<"WARNING: intFlowProfiles is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8541 | } | |
8542 | ||
8543 | // d) Get pointer to list fIntFlowResults and pointers to all objects that she holds. | |
8544 | TList *intFlowResults = NULL; | |
8545 | intFlowResults = dynamic_cast<TList*>(intFlowList->FindObject("Results")); | |
8546 | if(intFlowResults) | |
8547 | { | |
8548 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with correct errors!): | |
8549 | TString intFlowCorrelationsHistName = "fIntFlowCorrelationsHist"; | |
8550 | intFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
8551 | TH1D *intFlowCorrelationsHist = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCorrelationsHistName.Data())); | |
8552 | if(intFlowCorrelationsHist) | |
8553 | { | |
8554 | this->SetIntFlowCorrelationsHist(intFlowCorrelationsHist); | |
8555 | } else | |
8556 | { | |
8557 | cout<<"WARNING: intFlowCorrelationsHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8558 | } | |
ff70ca91 | 8559 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with correct errors!) vs M: |
b3dacf6b | 8560 | if(fCalculateCumulantsVsM) |
ff70ca91 | 8561 | { |
b3dacf6b | 8562 | TString intFlowCorrelationsVsMHistName = "fIntFlowCorrelationsVsMHist"; |
8563 | intFlowCorrelationsVsMHistName += fAnalysisLabel->Data(); | |
8564 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
ff70ca91 | 8565 | { |
b3dacf6b | 8566 | TH1D *intFlowCorrelationsVsMHist = dynamic_cast<TH1D*> |
8567 | (intFlowResults->FindObject(Form("%s, %s",intFlowCorrelationsVsMHistName.Data(),correlationFlag[ci].Data()))); | |
8568 | if(intFlowCorrelationsVsMHist) | |
8569 | { | |
8570 | this->SetIntFlowCorrelationsVsMHist(intFlowCorrelationsVsMHist,ci); | |
8571 | } else | |
8572 | { | |
8573 | cout<<"WARNING: "<<Form("intFlowCorrelationsVsMHist[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8574 | } | |
8575 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
8576 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 8577 | // average all correlations for integrated flow (with correct errors!): |
8578 | TString intFlowCorrelationsAllHistName = "fIntFlowCorrelationsAllHist"; | |
8579 | intFlowCorrelationsAllHistName += fAnalysisLabel->Data(); | |
8580 | TH1D *intFlowCorrelationsAllHist = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCorrelationsAllHistName.Data())); | |
8581 | if(intFlowCorrelationsAllHist) | |
8582 | { | |
8583 | this->SetIntFlowCorrelationsAllHist(intFlowCorrelationsAllHist); | |
8584 | } else | |
8585 | { | |
8586 | cout<<"WARNING: intFlowCorrelationsAllHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8587 | } | |
8588 | // average correction terms for non-uniform acceptance (with correct errors!): | |
8589 | TString intFlowCorrectionTermsForNUAHistName = "fIntFlowCorrectionTermsForNUAHist"; | |
8590 | intFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
8591 | for(Int_t sc=0;sc<2;sc++) | |
8592 | { | |
8593 | TH1D *intFlowCorrectionTermsForNUAHist = dynamic_cast<TH1D*>(intFlowResults->FindObject((Form("%s: %s terms",intFlowCorrectionTermsForNUAHistName.Data(),sinCosFlag[sc].Data())))); | |
8594 | if(intFlowCorrectionTermsForNUAHist) | |
8595 | { | |
8596 | this->SetIntFlowCorrectionTermsForNUAHist(intFlowCorrectionTermsForNUAHist,sc); | |
8597 | } else | |
8598 | { | |
8599 | cout<<"WARNING: intFlowCorrectionTermsForNUAHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8600 | cout<<"sc = "<<sc<<endl; | |
8601 | } | |
8602 | } // end of for(Int_t sc=0;sc<2;sc++) | |
8603 | // covariances (multiplied with weight dependent prefactor): | |
8604 | TString intFlowCovariancesName = "fIntFlowCovariances"; | |
8605 | intFlowCovariancesName += fAnalysisLabel->Data(); | |
8606 | TH1D *intFlowCovariances = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCovariancesName.Data())); | |
8607 | if(intFlowCovariances) | |
8608 | { | |
8609 | this->SetIntFlowCovariances(intFlowCovariances); | |
8610 | } else | |
8611 | { | |
8612 | cout<<"WARNING: intFlowCovariances is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8613 | } | |
8614 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8>: | |
8615 | TString intFlowSumOfEventWeightsName = "fIntFlowSumOfEventWeights"; | |
8616 | intFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
8617 | for(Int_t power=0;power<2;power++) | |
8618 | { | |
8619 | TH1D *intFlowSumOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s: %s",intFlowSumOfEventWeightsName.Data(),powerFlag[power].Data()))); | |
8620 | if(intFlowSumOfEventWeights) | |
8621 | { | |
8622 | this->SetIntFlowSumOfEventWeights(intFlowSumOfEventWeights,power); | |
8623 | } else | |
8624 | { | |
8625 | cout<<"WARNING: intFlowSumOfEventWeights is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8626 | cout<<"power = "<<power<<endl; | |
8627 | } | |
8628 | } // end of for(Int_t power=0;power<2;power++) | |
8629 | // sum of products of event weights for correlations <2>, <4>, <6> and <8>: | |
8630 | TString intFlowSumOfProductOfEventWeightsName = "fIntFlowSumOfProductOfEventWeights"; | |
8631 | intFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
8632 | TH1D *intFlowSumOfProductOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowSumOfProductOfEventWeightsName.Data())); | |
8633 | if(intFlowSumOfProductOfEventWeights) | |
8634 | { | |
8635 | this->SetIntFlowSumOfProductOfEventWeights(intFlowSumOfProductOfEventWeights); | |
8636 | } else | |
8637 | { | |
8638 | cout<<"WARNING: intFlowSumOfProductOfEventWeights is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8639 | } | |
ff70ca91 | 8640 | // final result for covariances of correlations (multiplied with weight dependent prefactor) versus M |
8641 | // [0=Cov(2,4),1=Cov(2,6),2=Cov(2,8),3=Cov(4,6),4=Cov(4,8),5=Cov(6,8)]: | |
b3dacf6b | 8642 | if(fCalculateCumulantsVsM) |
ff70ca91 | 8643 | { |
b3dacf6b | 8644 | TString intFlowCovariancesVsMName = "fIntFlowCovariancesVsM"; |
8645 | intFlowCovariancesVsMName += fAnalysisLabel->Data(); | |
8646 | TString covarianceFlag[6] = {"Cov(<2>,<4>)","Cov(<2>,<6>)","Cov(<2>,<8>)","Cov(<4>,<6>)","Cov(<4>,<8>)","Cov(<6>,<8>)"}; | |
8647 | for(Int_t ci=0;ci<6;ci++) | |
8648 | { | |
8649 | TH1D *intFlowCovariancesVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowCovariancesVsMName.Data(),covarianceFlag[ci].Data()))); | |
8650 | if(intFlowCovariancesVsM) | |
ff70ca91 | 8651 | { |
b3dacf6b | 8652 | this->SetIntFlowCovariancesVsM(intFlowCovariancesVsM,ci); |
ff70ca91 | 8653 | } else |
8654 | { | |
b3dacf6b | 8655 | cout<<"WARNING: "<<Form("intFlowCovariancesVsM[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; |
ff70ca91 | 8656 | } |
b3dacf6b | 8657 | } // end of for(Int_t ci=0;ci<6;ci++) |
8658 | } // end of if(fCalculateCumulantsVsM) | |
8659 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8> versus multiplicity | |
8660 | // [0=sum{w_{<2>}},1=sum{w_{<4>}},2=sum{w_{<6>}},3=sum{w_{<8>}}][0=linear 1,1=quadratic]: | |
8661 | if(fCalculateCumulantsVsM) | |
8662 | { | |
8663 | TString intFlowSumOfEventWeightsVsMName = "fIntFlowSumOfEventWeightsVsM"; | |
8664 | intFlowSumOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
8665 | TString sumFlag[2][4] = {{"#sum_{i=1}^{N} w_{<2>}","#sum_{i=1}^{N} w_{<4>}","#sum_{i=1}^{N} w_{<6>}","#sum_{i=1}^{N} w_{<8>}"}, | |
8666 | {"#sum_{i=1}^{N} w_{<2>}^{2}","#sum_{i=1}^{N} w_{<4>}^{2}","#sum_{i=1}^{N} w_{<6>}^{2}","#sum_{i=1}^{N} w_{<8>}^{2}"}}; | |
8667 | for(Int_t si=0;si<4;si++) | |
8668 | { | |
8669 | for(Int_t power=0;power<2;power++) | |
8670 | { | |
8671 | TH1D *intFlowSumOfEventWeightsVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowSumOfEventWeightsVsMName.Data(),sumFlag[power][si].Data()))); | |
8672 | if(intFlowSumOfEventWeightsVsM) | |
8673 | { | |
8674 | this->SetIntFlowSumOfEventWeightsVsM(intFlowSumOfEventWeightsVsM,si,power); | |
8675 | } else | |
8676 | { | |
8677 | cout<<"WARNING: "<<Form("intFlowSumOfEventWeightsVsM[%d][%d]",si,power)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8678 | } | |
8679 | } // end of for(Int_t power=0;power<2;power++) | |
8680 | } // end of for(Int_t si=0;si<4;si++) | |
8681 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 8682 | // sum of products of event weights for correlations <2>, <4>, <6> and <8> vs M |
8683 | // [0=sum{w_{<2>}w_{<4>}},1=sum{w_{<2>}w_{<6>}},2=sum{w_{<2>}w_{<8>}}, | |
8684 | // 3=sum{w_{<4>}w_{<6>}},4=sum{w_{<4>}w_{<8>}},5=sum{w_{<6>}w_{<8>}}]: | |
b3dacf6b | 8685 | if(fCalculateCumulantsVsM) |
ff70ca91 | 8686 | { |
b3dacf6b | 8687 | TString intFlowSumOfProductOfEventWeightsVsMName = "fIntFlowSumOfProductOfEventWeightsVsM"; |
8688 | intFlowSumOfProductOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
8689 | TString sopowFlag[6] = {"#sum_{i=1}^{N} w_{<2>} w_{<4>}","#sum_{i=1}^{N} w_{<2>} w_{<6>}","#sum_{i=1}^{N} w_{<2>} w_{<8>}", | |
8690 | "#sum_{i=1}^{N} w_{<4>} w_{<6>}","#sum_{i=1}^{N} w_{<4>} w_{<8>}","#sum_{i=1}^{N} w_{<6>} w_{<8>}"}; | |
8691 | for(Int_t pi=0;pi<6;pi++) | |
ff70ca91 | 8692 | { |
b3dacf6b | 8693 | TH1D *intFlowSumOfProductOfEventWeightsVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowSumOfProductOfEventWeightsVsMName.Data(),sopowFlag[pi].Data()))); |
8694 | if(intFlowSumOfProductOfEventWeightsVsM) | |
8695 | { | |
8696 | this->SetIntFlowSumOfProductOfEventWeightsVsM(intFlowSumOfProductOfEventWeightsVsM,pi); | |
8697 | } else | |
8698 | { | |
8699 | cout<<"WARNING: "<<Form("intFlowSumOfProductOfEventWeightsVsM[%d]",pi)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8700 | } | |
8701 | } // end of for(Int_t pi=0;pi<6;pi++) | |
8702 | } // end of if(fCalculateCumulantsVsM) | |
0328db2d | 8703 | // covariances for NUA (multiplied with weight dependent prefactor): |
8704 | TString intFlowCovariancesNUAName = "fIntFlowCovariancesNUA"; | |
8705 | intFlowCovariancesNUAName += fAnalysisLabel->Data(); | |
8706 | TH1D *intFlowCovariancesNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCovariancesNUAName.Data())); | |
8707 | if(intFlowCovariancesNUA) | |
8708 | { | |
8709 | this->SetIntFlowCovariancesNUA(intFlowCovariancesNUA); | |
8710 | } else | |
8711 | { | |
8712 | cout<<"WARNING: intFlowCovariancesNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8713 | } | |
8714 | // sum of linear and quadratic event weights NUA terms: | |
8715 | TString intFlowSumOfEventWeightsNUAName = "fIntFlowSumOfEventWeightsNUA"; | |
8716 | intFlowSumOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
8717 | for(Int_t sc=0;sc<2;sc++) | |
8718 | { | |
8719 | for(Int_t power=0;power<2;power++) | |
8720 | { | |
8721 | TH1D *intFlowSumOfEventWeightsNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s: %s, %s",intFlowSumOfEventWeightsNUAName.Data(),powerFlag[power].Data(),sinCosFlag[sc].Data()))); | |
8722 | if(intFlowSumOfEventWeightsNUA) | |
8723 | { | |
8724 | this->SetIntFlowSumOfEventWeightsNUA(intFlowSumOfEventWeightsNUA,sc,power); | |
8725 | } else | |
8726 | { | |
8727 | cout<<"WARNING: intFlowSumOfEventWeightsNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8728 | cout<<"sc = "<<sc<<endl; | |
8729 | cout<<"power = "<<power<<endl; | |
8730 | } | |
8731 | } // end of for(Int_t power=0;power<2;power++) | |
8732 | } // end of for(Int_t sc=0;sc<2;sc++) | |
8733 | // sum of products of event weights for NUA terms: | |
8734 | TString intFlowSumOfProductOfEventWeightsNUAName = "fIntFlowSumOfProductOfEventWeightsNUA"; | |
8735 | intFlowSumOfProductOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
8736 | TH1D *intFlowSumOfProductOfEventWeightsNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowSumOfProductOfEventWeightsNUAName.Data())); | |
8737 | if(intFlowSumOfProductOfEventWeightsNUA) | |
8738 | { | |
8739 | this->SetIntFlowSumOfProductOfEventWeightsNUA(intFlowSumOfProductOfEventWeightsNUA); | |
8740 | } else | |
8741 | { | |
8742 | cout<<"WARNING: intFlowSumOfProductOfEventWeightsNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8743 | } | |
b3dacf6b | 8744 | // Final results for reference Q-cumulants: |
489d5531 | 8745 | TString intFlowQcumulantsName = "fIntFlowQcumulants"; |
8746 | intFlowQcumulantsName += fAnalysisLabel->Data(); | |
8747 | TH1D *intFlowQcumulants = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsName.Data())); | |
8748 | if(intFlowQcumulants) | |
8749 | { | |
8750 | this->SetIntFlowQcumulants(intFlowQcumulants); | |
8751 | } else | |
8752 | { | |
8753 | cout<<"WARNING: intFlowQcumulants is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8754 | } | |
b3dacf6b | 8755 | // Final results for reference Q-cumulants rebinned in M: |
8756 | if(fCalculateCumulantsVsM) | |
8757 | { | |
8758 | TString intFlowQcumulantsRebinnedInMName = "fIntFlowQcumulantsRebinnedInM"; | |
8759 | intFlowQcumulantsRebinnedInMName += fAnalysisLabel->Data(); | |
8760 | TH1D *intFlowQcumulantsRebinnedInM = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsRebinnedInMName.Data())); | |
8761 | if(intFlowQcumulantsRebinnedInM) | |
8762 | { | |
8763 | this->SetIntFlowQcumulantsRebinnedInM(intFlowQcumulantsRebinnedInM); | |
8764 | } else | |
8765 | { | |
8766 | cout<<"WARNING: intFlowQcumulantsRebinnedInM is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8767 | } | |
8768 | } // end of if(fCalculateCumulantsVsM) | |
b92ea2b9 | 8769 | // Ratio between error squared: with/without non-isotropic terms: |
8770 | TString intFlowQcumulantsErrorSquaredRatioName = "fIntFlowQcumulantsErrorSquaredRatio"; | |
8771 | intFlowQcumulantsErrorSquaredRatioName += fAnalysisLabel->Data(); | |
8772 | TH1D *intFlowQcumulantsErrorSquaredRatio = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsErrorSquaredRatioName.Data())); | |
8773 | if(intFlowQcumulantsErrorSquaredRatio) | |
8774 | { | |
8775 | this->SetIntFlowQcumulantsErrorSquaredRatio(intFlowQcumulantsErrorSquaredRatio); | |
8776 | } else | |
8777 | { | |
8778 | cout<<" WARNING: intntFlowQcumulantsErrorSquaredRatio is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8779 | } | |
ff70ca91 | 8780 | // final results for integrated Q-cumulants versus multiplicity: |
ff70ca91 | 8781 | TString cumulantFlag[4] = {"QC{2}","QC{4}","QC{6}","QC{8}"}; |
b3dacf6b | 8782 | if(fCalculateCumulantsVsM) |
ff70ca91 | 8783 | { |
b3dacf6b | 8784 | TString intFlowQcumulantsVsMName = "fIntFlowQcumulantsVsM"; |
8785 | intFlowQcumulantsVsMName += fAnalysisLabel->Data(); | |
8786 | for(Int_t co=0;co<4;co++) // cumulant order | |
ff70ca91 | 8787 | { |
b3dacf6b | 8788 | TH1D *intFlowQcumulantsVsM = dynamic_cast<TH1D*> |
8789 | (intFlowResults->FindObject(Form("%s, %s",intFlowQcumulantsVsMName.Data(),cumulantFlag[co].Data()))); | |
8790 | if(intFlowQcumulantsVsM) | |
8791 | { | |
8792 | this->SetIntFlowQcumulantsVsM(intFlowQcumulantsVsM,co); | |
8793 | } else | |
8794 | { | |
8795 | cout<<"WARNING: "<<Form("intFlowQcumulantsVsM[%d]",co)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8796 | } | |
8797 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
8798 | } // end of if(fCalculateCumulantsVsM) | |
8799 | // Final reference flow estimates from Q-cumulants: | |
489d5531 | 8800 | TString intFlowName = "fIntFlow"; |
8801 | intFlowName += fAnalysisLabel->Data(); | |
8802 | TH1D *intFlow = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowName.Data())); | |
8803 | if(intFlow) | |
8804 | { | |
8805 | this->SetIntFlow(intFlow); | |
8806 | } else | |
8807 | { | |
8808 | cout<<"WARNING: intFlow is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
ff70ca91 | 8809 | } |
b3dacf6b | 8810 | // Final reference flow estimates from Q-cumulants vs M rebinned in M: |
8811 | if(fCalculateCumulantsVsM) | |
ff70ca91 | 8812 | { |
b3dacf6b | 8813 | TString intFlowRebinnedInMName = "fIntFlowRebinnedInM"; |
8814 | intFlowRebinnedInMName += fAnalysisLabel->Data(); | |
8815 | TH1D *intFlowRebinnedInM = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowRebinnedInMName.Data())); | |
8816 | if(intFlowRebinnedInM) | |
ff70ca91 | 8817 | { |
b3dacf6b | 8818 | this->SetIntFlowRebinnedInM(intFlowRebinnedInM); |
8819 | } else | |
ff70ca91 | 8820 | { |
b3dacf6b | 8821 | cout<<"WARNING: intFlowRebinnedInM is NULL in AFAWQC::GPFIFH() !!!!"<<endl; |
8822 | } | |
8823 | } // end of if(fCalculateCumulantsVsM) | |
8824 | // integrated flow from Q-cumulants versus multiplicity: | |
8825 | if(fCalculateCumulantsVsM) | |
8826 | { | |
8827 | TString intFlowVsMName = "fIntFlowVsM"; | |
8828 | intFlowVsMName += fAnalysisLabel->Data(); | |
b77b6434 | 8829 | TString flowFlag[4] = {Form("v_{%d}{2,QC}",fHarmonic),Form("v_{%d}{4,QC}",fHarmonic),Form("v_{%d}{6,QC}",fHarmonic),Form("v_{%d}{8,QC}",fHarmonic)}; |
b3dacf6b | 8830 | for(Int_t co=0;co<4;co++) // cumulant order |
8831 | { | |
8832 | TH1D *intFlowVsM = dynamic_cast<TH1D*> | |
b77b6434 | 8833 | (intFlowResults->FindObject(Form("%s, %s",intFlowVsMName.Data(),flowFlag[co].Data()))); |
b3dacf6b | 8834 | if(intFlowVsM) |
8835 | { | |
8836 | this->SetIntFlowVsM(intFlowVsM,co); | |
8837 | } else | |
8838 | { | |
8839 | cout<<"WARNING: "<<Form("intFlowVsM[%d]",co)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8840 | } | |
8841 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
8842 | } // end of if(fCalculateCumulantsVsM) | |
2001bc3a | 8843 | // quantifying detector effects effects to correlations: |
8844 | TString intFlowDetectorBiasName = "fIntFlowDetectorBias"; | |
8845 | intFlowDetectorBiasName += fAnalysisLabel->Data(); | |
8846 | TH1D *intFlowDetectorBias = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowDetectorBiasName.Data())); | |
8847 | if(intFlowDetectorBias) | |
8848 | { | |
8849 | this->SetIntFlowDetectorBias(intFlowDetectorBias); | |
8850 | } else | |
8851 | { | |
8852 | cout<<"WARNING: intFlowDetectorBias is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8853 | } | |
8854 | // quantifying detector effects effects to correlations vs multiplicity: | |
b77b6434 | 8855 | if(fCalculateCumulantsVsM) |
2001bc3a | 8856 | { |
3c5d5752 | 8857 | TString intFlowDetectorBiasVsMName = "fIntFlowDetectorBiasVsM"; |
8858 | intFlowDetectorBiasVsMName += fAnalysisLabel->Data(); | |
8859 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2001bc3a | 8860 | { |
3c5d5752 | 8861 | TH1D *intFlowDetectorBiasVsM = dynamic_cast<TH1D*> |
8862 | (intFlowResults->FindObject(Form("%s for %s",intFlowDetectorBiasVsMName.Data(),cumulantFlag[ci].Data()))); | |
8863 | if(intFlowDetectorBiasVsM) | |
8864 | { | |
8865 | this->SetIntFlowDetectorBiasVsM(intFlowDetectorBiasVsM,ci); | |
8866 | } else | |
8867 | { | |
8868 | cout<<"WARNING: "<<Form("intFlowDetectorBiasVsM[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8869 | } | |
8870 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
b77b6434 | 8871 | } // end of if(fCalculateCumulantsVsM) |
489d5531 | 8872 | } else // to if(intFlowResults) |
8873 | { | |
8874 | cout<<"WARNING: intFlowResults is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8875 | } | |
ff70ca91 | 8876 | |
489d5531 | 8877 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForIntFlowHistograms() |
8878 | ||
489d5531 | 8879 | //================================================================================================================================ |
8880 | ||
1268c371 | 8881 | void AliFlowAnalysisWithQCumulants::GetPointersFor2DDiffFlowHistograms() |
8882 | { | |
8883 | // Get pointers for 2D differential flow histograms. | |
8884 | // a) Check pointers used in this method; | |
8885 | // b) Get pointers to 2D differential flow lists; | |
8886 | // c) Get pointers to 2D differential flow profiles; | |
8887 | // d) Get pointers to 2D differential flow histograms. | |
8888 | ||
8889 | // a) Check pointers used in this method: | |
8890 | if(!fDiffFlowList) | |
8891 | { | |
8892 | printf("\n WARNING (QC): fDiffFlowList is NULL in AFAWQC::GPF2DDFH() !!!!\n"); | |
8893 | printf(" Call method GetPointersForDiffFlowHistograms() first.\n\n"); | |
8894 | exit(0); | |
8895 | } | |
8896 | if(!fDiffFlowFlags) | |
8897 | { | |
8898 | printf("\n WARNING (QC): fDiffFlowFlags is NULL in AFAWQC::GPF2DDFH() !!!!\n\n"); | |
8899 | printf(" Call method GetPointersForDiffFlowHistograms() first.\n\n"); | |
8900 | exit(0); | |
8901 | } | |
8902 | ||
8903 | // b) Get pointers to 2D differential flow lists: | |
8904 | this->SetCalculate2DDiffFlow((Bool_t)fDiffFlowFlags->GetBinContent(5)); // to be improved - hardwired 5 | |
8905 | if(!fCalculate2DDiffFlow){return;} | |
8906 | TString typeFlag[2] = {"RP","POI"}; | |
8907 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
8908 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
8909 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
8910 | // Base list: | |
8911 | TString diffFlow2DListName = "2D"; | |
8912 | diffFlow2DListName += fAnalysisLabel->Data(); | |
8913 | fDiffFlow2D = dynamic_cast<TList*>(fDiffFlowList->FindObject(diffFlow2DListName.Data())); | |
8914 | if(!fDiffFlow2D) | |
8915 | { | |
8916 | printf("\n WARNING (QC): fDiffFlow2D is NULL in AFAWQC::GPFDFH() !!!!\n\n"); | |
8917 | exit(0); | |
8918 | } | |
8919 | // Lists holding profiles with 2D correlations: | |
8920 | TString s2DDiffFlowCorrelationsProListName = "Profiles with 2D correlations"; | |
8921 | s2DDiffFlowCorrelationsProListName += fAnalysisLabel->Data(); // to be improved | |
8922 | for(Int_t t=0;t<2;t++) | |
8923 | { | |
8924 | f2DDiffFlowCorrelationsProList[t] = dynamic_cast<TList*>(fDiffFlow2D->FindObject(Form("Profiles with 2D correlations (%s)",typeFlag[t].Data()))); | |
8925 | if(!f2DDiffFlowCorrelationsProList[t]) | |
8926 | { | |
8927 | printf("\n WARNING (QC): f2DDiffFlowCorrelationsProList[%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t); | |
8928 | exit(0); | |
8929 | } | |
8930 | } // end of for(Int_t t=0;t<2;t++) | |
8931 | ||
8932 | // c) Get pointers to 2D differential flow profiles: | |
8933 | TString s2DDiffFlowCorrelationsProName = "f2DDiffFlowCorrelationsPro"; | |
8934 | s2DDiffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
8935 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8936 | { | |
8937 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8938 | { | |
8939 | f2DDiffFlowCorrelationsPro[t][rci] = dynamic_cast<TProfile2D*>(f2DDiffFlowCorrelationsProList[t]->FindObject(Form("%s, %s, %s",s2DDiffFlowCorrelationsProName.Data(),typeFlag[t].Data(),reducedCorrelationIndex[rci].Data()))); | |
8940 | if(!f2DDiffFlowCorrelationsPro[t][rci]) | |
8941 | { | |
8942 | printf("\n WARNING (QC): f2DDiffFlowCorrelationsPro[%i][%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t,rci); | |
8943 | exit(0); | |
8944 | } else | |
8945 | { | |
8946 | this->Set2DDiffFlowCorrelationsPro(f2DDiffFlowCorrelationsPro[t][rci],t,rci); | |
8947 | } | |
8948 | } // end of for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8949 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
8950 | ||
8951 | // d) Get pointers to 2D differential flow histograms: | |
8952 | TString s2DDiffFlowCumulantsName = "f2DDiffFlowCumulants"; | |
8953 | s2DDiffFlowCumulantsName += fAnalysisLabel->Data(); | |
8954 | TString s2DDiffFlowName = "f2DDiffFlow"; | |
8955 | s2DDiffFlowName += fAnalysisLabel->Data(); | |
8956 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
8957 | { | |
8958 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8959 | { | |
8960 | // 2D differential cumulants: | |
8961 | f2DDiffFlowCumulants[t][rci] = dynamic_cast<TH2D*>(f2DDiffFlowCorrelationsProList[t]->FindObject(Form("%s, %s, %s",s2DDiffFlowCumulantsName.Data(),typeFlag[t].Data(),differentialCumulantIndex[rci].Data()))); | |
8962 | if(!f2DDiffFlowCumulants[t][rci]) | |
8963 | { | |
8964 | printf("\n WARNING (QC): f2DDiffFlowCumulants[%i][%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t,rci); | |
8965 | exit(0); | |
8966 | } else | |
8967 | { | |
8968 | this->Set2DDiffFlowCumulants(f2DDiffFlowCumulants[t][rci],t,rci); | |
8969 | } | |
8970 | // 2D differential flow: | |
8971 | f2DDiffFlow[t][rci] = dynamic_cast<TH2D*>(f2DDiffFlowCorrelationsProList[t]->FindObject(Form("%s, %s, %s",s2DDiffFlowName.Data(),typeFlag[t].Data(),differentialFlowIndex[rci].Data()))); | |
8972 | if(!f2DDiffFlow[t][rci]) | |
8973 | { | |
8974 | printf("\n WARNING (QC): f2DDiffFlow[%i][%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t,rci); | |
8975 | exit(0); | |
8976 | } else | |
8977 | { | |
8978 | this->Set2DDiffFlow(f2DDiffFlow[t][rci],t,rci); | |
8979 | } | |
8980 | } // end of for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
8981 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
8982 | ||
8983 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersFor2DDiffFlowHistograms() | |
8984 | ||
8985 | //================================================================================================================================ | |
8986 | ||
64e500e3 | 8987 | void AliFlowAnalysisWithQCumulants::GetPointersForOtherDiffCorrelators() |
8988 | { | |
8989 | // Get pointers for other differential correlators. | |
8990 | // a) Get pointer to list with other differential correlators; | |
8991 | // b) Declare local flags; | |
8992 | // c) Get pointers to other differential profiles. | |
8993 | ||
8994 | // a) Get pointer to list with other differential correlators: | |
8995 | fOtherDiffCorrelatorsList = dynamic_cast<TList*>(fHistList->FindObject("Other differential correlators")); | |
8996 | if(!fOtherDiffCorrelatorsList) | |
8997 | { | |
8998 | printf("\n WARNING (QC): fOtherDiffCorrelatorsList is NULL in AFAWQC::GPFDFH() !!!!\n\n"); | |
8999 | exit(0); | |
9000 | } | |
9001 | ||
9002 | // b) Declare local flags: // (to be improved - promoted to data members) | |
9003 | TString typeFlag[2] = {"RP","POI"}; | |
9004 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
9005 | TString sinCosFlag[2] = {"sin","cos"}; | |
9006 | ||
9007 | // c) Get pointers to other differential profiles: | |
9008 | TString otherDiffCorrelatorsName = "fOtherDiffCorrelators"; | |
9009 | otherDiffCorrelatorsName += fAnalysisLabel->Data(); | |
9010 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
9011 | { | |
9012 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9013 | { | |
9014 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9015 | { | |
9016 | for(Int_t ci=0;ci<1;ci++) // correlator index | |
9017 | { | |
9018 | fOtherDiffCorrelators[t][pe][sc][ci] = dynamic_cast<TProfile*>(fOtherDiffCorrelatorsList->FindObject(Form("%s, %s, %s, %s, ci = %d",otherDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1))); | |
9019 | if(!fOtherDiffCorrelators[t][pe][sc][ci]) | |
9020 | { | |
9021 | printf("\n WARNING (QC): fOtherDiffCorrelators[%i][%i][%i][%i] is NULL in AFAWQC::GPFODC() !!!!\n\n",t,pe,sc,ci); | |
9022 | exit(0); | |
9023 | } else | |
9024 | { | |
9025 | this->SetOtherDiffCorrelators(fOtherDiffCorrelators[t][pe][sc][ci],t,pe,sc,ci); | |
9026 | } | |
9027 | } // end of for(Int_t ci=0;ci<1;ci++) // correlator index | |
9028 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9029 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9030 | } // end of for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
9031 | ||
9032 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForOtherDiffCorrelators() | |
9033 | ||
9034 | //================================================================================================================================ | |
9035 | ||
489d5531 | 9036 | void AliFlowAnalysisWithQCumulants::GetPointersForDiffFlowHistograms() |
9037 | { | |
9038 | // Get pointer to all objects relevant for differential flow. | |
1268c371 | 9039 | // a) Get pointer to base list for differential flow fDiffFlowList; |
9040 | // b) Get pointer to profile fDiffFlowFlags holding all flags for differential flow. Access and set some flags; | |
9041 | // c) Get pointers to nested lists fDiffFlowListProfiles and fDiffFlowListResults; | |
9042 | // d) Define flags locally (to be improved: should I promote these flags to data members?); | |
9043 | // e) Get pointers to all nested lists in fDiffFlowListProfiles and to profiles which they hold; | |
9044 | // f) Get pointers to all nested lists in fDiffFlowListResults and to histograms which they hold. | |
9045 | ||
9046 | // a) Get pointer to base list for differential flow fDiffFlowList: | |
9047 | fDiffFlowList = dynamic_cast<TList*>(fHistList->FindObject("Differential Flow")); | |
9048 | if(!fDiffFlowList) | |
489d5531 | 9049 | { |
1268c371 | 9050 | printf("\n WARNING (QC): fDiffFlowList is NULL in AFAWQC::GPFDFH() !!!!\n\n"); |
489d5531 | 9051 | exit(0); |
9052 | } | |
1268c371 | 9053 | |
9054 | // b) Get pointer to profile fDiffFlowFlags holding all flags for differential flow. Access and set some flags: | |
9055 | TString diffFlowFlagsName = "fDiffFlowFlags"; | |
9056 | diffFlowFlagsName += fAnalysisLabel->Data(); | |
9057 | fDiffFlowFlags = dynamic_cast<TProfile*>(fDiffFlowList->FindObject(diffFlowFlagsName.Data())); | |
9058 | if(fDiffFlowFlags) | |
9059 | { | |
9060 | this->SetCalculateDiffFlow((Bool_t)fDiffFlowFlags->GetBinContent(1)); // to be improved - hardwired 5 | |
9061 | } else | |
9062 | { | |
9063 | printf("\n WARNING (QC): fDiffFlowFlags is NULL in AFAWQC::GPFDFH() !!!!\n\n"); | |
9064 | printf("\n Flags in method Finish() are wrong.\n\n"); | |
9065 | exit(0); | |
9066 | } | |
9067 | ||
9068 | if(!fCalculateDiffFlow){return;} // IMPORTANT: do not move this anywhere above in this method (to be improved) | |
9069 | ||
9070 | // c) Get pointers to nested lists fDiffFlowListProfiles and fDiffFlowListResults: | |
9071 | // List holding nested lists holding profiles: | |
489d5531 | 9072 | TList *diffFlowListProfiles = NULL; |
1268c371 | 9073 | diffFlowListProfiles = dynamic_cast<TList*>(fDiffFlowList->FindObject("Profiles")); |
489d5531 | 9074 | if(!diffFlowListProfiles) |
9075 | { | |
1268c371 | 9076 | printf("\n WARNING (QC): diffFlowListProfiles is NULL in AFAWQC::GPFDFH() !!!!\n\n"); |
489d5531 | 9077 | exit(0); |
9078 | } | |
1268c371 | 9079 | // List holding nested lists holding histograms with final results: |
489d5531 | 9080 | TList *diffFlowListResults = NULL; |
1268c371 | 9081 | diffFlowListResults = dynamic_cast<TList*>(fDiffFlowList->FindObject("Results")); |
489d5531 | 9082 | if(!diffFlowListResults) |
9083 | { | |
1268c371 | 9084 | printf("\n WARNING (QC): diffFlowListResults is NULL in AFAWQC::GPFDFH() !!!!\n\n"); |
489d5531 | 9085 | exit(0); |
9086 | } | |
9087 | ||
1268c371 | 9088 | // d) Define flags locally (to be improved: should I promote these flags to data members?): |
9089 | TString typeFlag[2] = {"RP","POI"}; | |
9090 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
9091 | TString powerFlag[2] = {"linear","quadratic"}; | |
9092 | TString sinCosFlag[2] = {"sin","cos"}; | |
9093 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
9094 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
9095 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
9096 | TString reducedSquaredCorrelationIndex[4] = {"<2'>^{2}","<4'>^{2}","<6'>^{2}","<8'>^{2}"}; | |
9097 | TString mixedCorrelationIndex[8] = {"<2>","<2'>","<4>","<4'>","<6>","<6'>","<8>","<8'>"}; | |
9098 | TString covarianceName[5] = {"Cov(<2>,<2'>)","Cov(<2>,<4'>)","Cov(<4>,<2'>)","Cov(<4>,<4'>)","Cov(<2'>,<4'>)"}; | |
489d5531 | 9099 | |
1268c371 | 9100 | // e) Get pointers to all nested lists in fDiffFlowListProfiles and to profiles which they hold: |
489d5531 | 9101 | // correlations: |
9102 | TList *diffFlowCorrelationsProList[2][2] = {{NULL}}; | |
9103 | TString diffFlowCorrelationsProName = "fDiffFlowCorrelationsPro"; | |
9104 | diffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
b40a910e | 9105 | TProfile *diffFlowCorrelationsPro[2][2][4] = {{{NULL}}}; |
9106 | // squared correlations: | |
9107 | TString diffFlowSquaredCorrelationsProName = "fDiffFlowSquaredCorrelationsPro"; | |
9108 | diffFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
9109 | TProfile *diffFlowSquaredCorrelationsPro[2][2][4] = {{{NULL}}}; | |
489d5531 | 9110 | // products of correlations: |
9111 | TList *diffFlowProductOfCorrelationsProList[2][2] = {{NULL}}; | |
9112 | TString diffFlowProductOfCorrelationsProName = "fDiffFlowProductOfCorrelationsPro"; | |
9113 | diffFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
9114 | TProfile *diffFlowProductOfCorrelationsPro[2][2][8][8] = {{{{NULL}}}}; | |
9115 | // corrections: | |
9116 | TList *diffFlowCorrectionsProList[2][2] = {{NULL}}; | |
9117 | TString diffFlowCorrectionTermsForNUAProName = "fDiffFlowCorrectionTermsForNUAPro"; | |
9118 | diffFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
9119 | TProfile *diffFlowCorrectionTermsForNUAPro[2][2][2][10] = {{{{NULL}}}}; | |
9120 | for(Int_t t=0;t<2;t++) | |
9121 | { | |
9122 | for(Int_t pe=0;pe<2;pe++) | |
9123 | { | |
9124 | diffFlowCorrelationsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9125 | if(!diffFlowCorrelationsProList[t][pe]) | |
9126 | { | |
9127 | cout<<"WARNING: diffFlowCorrelationsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9128 | cout<<"t = "<<t<<endl; | |
9129 | cout<<"pe = "<<pe<<endl; | |
9130 | exit(0); | |
9131 | } | |
9132 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
9133 | { | |
b40a910e | 9134 | // reduced correlations: |
489d5531 | 9135 | diffFlowCorrelationsPro[t][pe][ci] = dynamic_cast<TProfile*>(diffFlowCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[ci].Data()))); |
9136 | if(diffFlowCorrelationsPro[t][pe][ci]) | |
9137 | { | |
9138 | this->SetDiffFlowCorrelationsPro(diffFlowCorrelationsPro[t][pe][ci],t,pe,ci); | |
9139 | } else | |
9140 | { | |
9141 | cout<<"WARNING: diffFlowCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9142 | cout<<"t = "<<t<<endl; | |
9143 | cout<<"pe = "<<pe<<endl; | |
9144 | cout<<"ci = "<<ci<<endl; | |
9145 | } | |
b40a910e | 9146 | // reduced squared correlations: |
9147 | diffFlowSquaredCorrelationsPro[t][pe][ci] = dynamic_cast<TProfile*>(diffFlowCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowSquaredCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedSquaredCorrelationIndex[ci].Data()))); | |
9148 | if(diffFlowSquaredCorrelationsPro[t][pe][ci]) | |
9149 | { | |
9150 | this->SetDiffFlowSquaredCorrelationsPro(diffFlowSquaredCorrelationsPro[t][pe][ci],t,pe,ci); | |
9151 | } else | |
9152 | { | |
9153 | cout<<"WARNING: diffFlowSquaredCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9154 | cout<<"t = "<<t<<endl; | |
9155 | cout<<"pe = "<<pe<<endl; | |
9156 | cout<<"ci = "<<ci<<endl; | |
9157 | } | |
489d5531 | 9158 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index |
9159 | // products of correlations: | |
9160 | diffFlowProductOfCorrelationsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with products of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9161 | if(!diffFlowProductOfCorrelationsProList[t][pe]) | |
9162 | { | |
9163 | cout<<"WARNING: ddiffFlowProductOfCorrelationsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9164 | cout<<"t = "<<t<<endl; | |
9165 | cout<<"pe = "<<pe<<endl; | |
9166 | exit(0); | |
9167 | } | |
9168 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
9169 | { | |
9170 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
9171 | { | |
9172 | diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = dynamic_cast<TProfile*>(diffFlowProductOfCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()))); | |
9173 | if(diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]) | |
9174 | { | |
9175 | this->SetDiffFlowProductOfCorrelationsPro(diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2],t,pe,mci1,mci2); | |
9176 | } else | |
9177 | { | |
b40a910e | 9178 | cout<<"WARNING: diffFlowProductOfCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; |
489d5531 | 9179 | cout<<"t = "<<t<<endl; |
9180 | cout<<"pe = "<<pe<<endl; | |
9181 | cout<<"mci1 = "<<mci1<<endl; | |
9182 | cout<<"mci2 = "<<mci2<<endl; | |
9183 | } | |
9184 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
9185 | } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
9186 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
9187 | // corrections: | |
9188 | diffFlowCorrectionsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9189 | if(!diffFlowCorrectionsProList[t][pe]) | |
9190 | { | |
9191 | cout<<"WARNING: diffFlowCorrectionsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9192 | cout<<"t = "<<t<<endl; | |
9193 | cout<<"pe = "<<pe<<endl; | |
9194 | exit(0); | |
9195 | } | |
9196 | // correction terms for NUA: | |
9197 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9198 | { | |
9199 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
9200 | { | |
9201 | diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = dynamic_cast<TProfile*>(diffFlowCorrectionsProList[t][pe]->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1))); | |
9202 | if(diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]) | |
9203 | { | |
9204 | this->SetDiffFlowCorrectionTermsForNUAPro(diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti],t,pe,sc,cti); | |
9205 | } else | |
9206 | { | |
9207 | cout<<"WARNING: diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9208 | cout<<"t = "<<t<<endl; | |
9209 | cout<<"pe = "<<pe<<endl; | |
9210 | cout<<"sc = "<<sc<<endl; | |
9211 | cout<<"cti = "<<cti<<endl; | |
9212 | } | |
9213 | } // end of for(Int_t cti=0;cti<9;cti++) // correction term index | |
9214 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9215 | // ... | |
9216 | } // end of for(Int_t pe=0;pe<2;pe++) | |
9217 | } // end of for(Int_t t=0;t<2;t++) | |
9218 | ||
1268c371 | 9219 | // f) Get pointers to all nested lists in fDiffFlowListResults and to histograms which they hold: |
489d5531 | 9220 | // reduced correlations: |
9221 | TList *diffFlowCorrelationsHistList[2][2] = {{NULL}}; | |
9222 | TString diffFlowCorrelationsHistName = "fDiffFlowCorrelationsHist"; | |
9223 | diffFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
9224 | TH1D *diffFlowCorrelationsHist[2][2][4] = {{{NULL}}}; | |
9225 | // corrections for NUA: | |
9226 | TList *diffFlowCorrectionsHistList[2][2] = {{NULL}}; | |
9227 | TString diffFlowCorrectionTermsForNUAHistName = "fDiffFlowCorrectionTermsForNUAHist"; | |
9228 | diffFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
9229 | TH1D *diffFlowCorrectionTermsForNUAHist[2][2][2][10] = {{{{NULL}}}}; | |
9230 | // differential Q-cumulants: | |
9231 | TList *diffFlowCumulantsHistList[2][2] = {{NULL}}; | |
9232 | TString diffFlowCumulantsName = "fDiffFlowCumulants"; | |
9233 | diffFlowCumulantsName += fAnalysisLabel->Data(); | |
9234 | TH1D *diffFlowCumulants[2][2][4] = {{{NULL}}}; | |
1268c371 | 9235 | // detector bias to differential Q-cumulants: |
9236 | TList *diffFlowDetectorBiasHistList[2][2] = {{NULL}}; | |
9237 | TString diffFlowDetectorBiasName = "fDiffFlowDetectorBias"; | |
9238 | diffFlowDetectorBiasName += fAnalysisLabel->Data(); | |
9239 | TH1D *diffFlowDetectorBias[2][2][4] = {{{NULL}}}; | |
489d5531 | 9240 | // differential flow estimates from Q-cumulants: |
9241 | TList *diffFlowHistList[2][2] = {{NULL}}; | |
9242 | TString diffFlowName = "fDiffFlow"; | |
9243 | diffFlowName += fAnalysisLabel->Data(); | |
9244 | TH1D *diffFlow[2][2][4] = {{{NULL}}}; | |
9245 | // differential covariances: | |
9246 | TList *diffFlowCovariancesHistList[2][2] = {{NULL}}; | |
9247 | TString diffFlowCovariancesName = "fDiffFlowCovariances"; | |
9248 | diffFlowCovariancesName += fAnalysisLabel->Data(); | |
9249 | TH1D *diffFlowCovariances[2][2][5] = {{{NULL}}}; | |
9250 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9251 | { | |
9252 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9253 | { | |
9254 | // reduced correlations: | |
9255 | diffFlowCorrelationsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9256 | if(!diffFlowCorrelationsHistList[t][pe]) | |
9257 | { | |
9258 | cout<<"WARNING: diffFlowCorrelationsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9259 | cout<<"t = "<<t<<endl; | |
9260 | cout<<"pe = "<<pe<<endl; | |
9261 | exit(0); | |
9262 | } | |
9263 | for(Int_t index=0;index<4;index++) | |
9264 | { | |
9265 | diffFlowCorrelationsHist[t][pe][index] = dynamic_cast<TH1D*>(diffFlowCorrelationsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()))); | |
9266 | if(diffFlowCorrelationsHist[t][pe][index]) | |
9267 | { | |
9268 | this->SetDiffFlowCorrelationsHist(diffFlowCorrelationsHist[t][pe][index],t,pe,index); | |
9269 | } else | |
9270 | { | |
9271 | cout<<"WARNING: diffFlowCorrelationsHist[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9272 | cout<<"t = "<<t<<endl; | |
9273 | cout<<"pe = "<<pe<<endl; | |
9274 | cout<<"index = "<<index<<endl; | |
9275 | exit(0); | |
9276 | } | |
9277 | } // end of for(Int_t index=0;index<4;index++) | |
9278 | // corrections: | |
9279 | diffFlowCorrectionsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Histograms with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9280 | if(!diffFlowCorrectionsHistList[t][pe]) | |
9281 | { | |
9282 | cout<<"WARNING: diffFlowCorrectionsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9283 | cout<<"t = "<<t<<endl; | |
9284 | cout<<"pe = "<<pe<<endl; | |
9285 | exit(0); | |
9286 | } | |
9287 | // correction terms for NUA: | |
9288 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9289 | { | |
9290 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
9291 | { | |
9292 | diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = dynamic_cast<TH1D*>(diffFlowCorrectionsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1))); | |
9293 | if(diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]) | |
9294 | { | |
9295 | this->SetDiffFlowCorrectionTermsForNUAHist(diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti],t,pe,sc,cti); | |
9296 | } else | |
9297 | { | |
9298 | cout<<"WARNING: diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9299 | cout<<"t = "<<t<<endl; | |
9300 | cout<<"pe = "<<pe<<endl; | |
9301 | cout<<"sc = "<<sc<<endl; | |
9302 | cout<<"cti = "<<cti<<endl; | |
9303 | } | |
9304 | } // end of for(Int_t cti=0;cti<9;cti++) // correction term index | |
9305 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9306 | // ... | |
9307 | // differential Q-cumulants: | |
9308 | diffFlowCumulantsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Differential Q-cumulants (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9309 | if(!diffFlowCumulantsHistList[t][pe]) | |
9310 | { | |
9311 | cout<<"WARNING: diffFlowCumulantsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9312 | cout<<"t = "<<t<<endl; | |
9313 | cout<<"pe = "<<pe<<endl; | |
9314 | exit(0); | |
9315 | } | |
9316 | for(Int_t index=0;index<4;index++) | |
9317 | { | |
9318 | diffFlowCumulants[t][pe][index] = dynamic_cast<TH1D*>(diffFlowCumulantsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()))); | |
9319 | if(diffFlowCumulants[t][pe][index]) | |
9320 | { | |
9321 | this->SetDiffFlowCumulants(diffFlowCumulants[t][pe][index],t,pe,index); | |
9322 | } else | |
9323 | { | |
9324 | cout<<"WARNING: diffFlowCumulants[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9325 | cout<<"t = "<<t<<endl; | |
9326 | cout<<"pe = "<<pe<<endl; | |
9327 | cout<<"index = "<<index<<endl; | |
9328 | exit(0); | |
9329 | } | |
9330 | } // end of for(Int_t index=0;index<4;index++) | |
1268c371 | 9331 | // Detector bias to differential Q-cumulants: |
9332 | diffFlowDetectorBiasHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Detector bias (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9333 | if(!diffFlowDetectorBiasHistList[t][pe]) | |
9334 | { | |
9335 | cout<<"WARNING: diffFlowDetectorBiasHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9336 | cout<<"t = "<<t<<endl; | |
9337 | cout<<"pe = "<<pe<<endl; | |
9338 | exit(0); | |
9339 | } | |
9340 | for(Int_t index=0;index<4;index++) | |
9341 | { | |
9342 | diffFlowDetectorBias[t][pe][index] = dynamic_cast<TH1D*>(diffFlowDetectorBiasHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowDetectorBiasName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()))); | |
9343 | if(diffFlowDetectorBias[t][pe][index]) | |
9344 | { | |
9345 | this->SetDiffFlowDetectorBias(diffFlowDetectorBias[t][pe][index],t,pe,index); | |
9346 | } else | |
9347 | { | |
9348 | cout<<"WARNING: diffFlowDetectorBias[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9349 | cout<<"t = "<<t<<endl; | |
9350 | cout<<"pe = "<<pe<<endl; | |
9351 | cout<<"index = "<<index<<endl; | |
9352 | exit(0); | |
9353 | } | |
9354 | } // end of for(Int_t index=0;index<4;index++) | |
489d5531 | 9355 | // differential flow estimates from Q-cumulants: |
9356 | diffFlowHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Differential flow (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9357 | if(!diffFlowHistList[t][pe]) | |
9358 | { | |
9359 | cout<<"WARNING: diffFlowHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9360 | cout<<"t = "<<t<<endl; | |
9361 | cout<<"pe = "<<pe<<endl; | |
9362 | exit(0); | |
9363 | } | |
9364 | for(Int_t index=0;index<4;index++) | |
9365 | { | |
9366 | diffFlow[t][pe][index] = dynamic_cast<TH1D*>(diffFlowHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()))); | |
9367 | if(diffFlow[t][pe][index]) | |
9368 | { | |
9369 | this->SetDiffFlow(diffFlow[t][pe][index],t,pe,index); | |
9370 | } else | |
9371 | { | |
9372 | cout<<"WARNING: diffFlow[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9373 | cout<<"t = "<<t<<endl; | |
9374 | cout<<"pe = "<<pe<<endl; | |
9375 | cout<<"index = "<<index<<endl; | |
9376 | exit(0); | |
9377 | } | |
9378 | } // end of for(Int_t index=0;index<4;index++) | |
9379 | // differential covariances: | |
9380 | diffFlowCovariancesHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Covariances of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9381 | if(!diffFlowCovariancesHistList[t][pe]) | |
9382 | { | |
9383 | cout<<"WARNING: diffFlowCovariancesHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9384 | cout<<"t = "<<t<<endl; | |
9385 | cout<<"pe = "<<pe<<endl; | |
9386 | exit(0); | |
9387 | } | |
9388 | for(Int_t covIndex=0;covIndex<5;covIndex++) | |
9389 | { | |
9390 | diffFlowCovariances[t][pe][covIndex] = dynamic_cast<TH1D*>(diffFlowCovariancesHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()))); | |
9391 | if(diffFlowCovariances[t][pe][covIndex]) | |
9392 | { | |
9393 | this->SetDiffFlowCovariances(diffFlowCovariances[t][pe][covIndex],t,pe,covIndex); | |
9394 | } else | |
9395 | { | |
9396 | cout<<"WARNING: diffFlowCovariances[t][pe][covIndex] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9397 | cout<<"t = "<<t<<endl; | |
9398 | cout<<"pe = "<<pe<<endl; | |
9399 | cout<<"covIndex = "<<covIndex<<endl; | |
9400 | exit(0); | |
9401 | } | |
9402 | } // end of for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index | |
9403 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9404 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
9405 | // sum of event weights for reduced correlations: | |
9406 | TList *diffFlowSumOfEventWeightsHistList[2][2][2] = {{{NULL}}}; | |
9407 | TString diffFlowSumOfEventWeightsName = "fDiffFlowSumOfEventWeights"; | |
9408 | diffFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
9409 | TH1D *diffFlowSumOfEventWeights[2][2][2][4] = {{{{NULL}}}}; | |
9410 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
9411 | { | |
9412 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9413 | { | |
9414 | for(Int_t p=0;p<2;p++) // power of event weights is either 1 or 2 | |
9415 | { | |
9416 | diffFlowSumOfEventWeightsHistList[t][pe][p] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Sum of %s event weights (%s, %s)",powerFlag[p].Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9417 | if(!diffFlowSumOfEventWeightsHistList[t][pe][p]) | |
9418 | { | |
9419 | cout<<"WARNING: diffFlowSumOfEventWeightsHistList[t][pe][p] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9420 | cout<<"t = "<<t<<endl; | |
9421 | cout<<"pe = "<<pe<<endl; | |
9422 | cout<<"power = "<<p<<endl; | |
9423 | exit(0); | |
9424 | } | |
9425 | for(Int_t ew=0;ew<4;ew++) // index of reduced correlation | |
9426 | { | |
9427 | diffFlowSumOfEventWeights[t][pe][p][ew] = dynamic_cast<TH1D*>(diffFlowSumOfEventWeightsHistList[t][pe][p]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()))); | |
9428 | if(diffFlowSumOfEventWeights[t][pe][p][ew]) | |
9429 | { | |
9430 | this->SetDiffFlowSumOfEventWeights(diffFlowSumOfEventWeights[t][pe][p][ew],t,pe,p,ew); | |
9431 | } else | |
9432 | { | |
9433 | cout<<"WARNING: diffFlowSumOfEventWeights[t][pe][p][ew] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9434 | cout<<"t = "<<t<<endl; | |
9435 | cout<<"pe = "<<pe<<endl; | |
9436 | cout<<"power = "<<p<<endl; | |
9437 | cout<<"ew = "<<ew<<endl; | |
9438 | exit(0); | |
9439 | } | |
9440 | } | |
9441 | } // end of for(Int_t p=0;p<2;p++) // power of event weights is either 1 or 2 | |
9442 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9443 | } // end of for(Int_t t=0;t<2;t++) // type is RP or POI | |
9444 | // | |
9445 | TList *diffFlowSumOfProductOfEventWeightsHistList[2][2] = {{NULL}}; | |
9446 | TString diffFlowSumOfProductOfEventWeightsName = "fDiffFlowSumOfProductOfEventWeights"; | |
9447 | diffFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
9448 | TH1D *diffFlowSumOfProductOfEventWeights[2][2][8][8] = {{{{NULL}}}}; | |
9449 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
9450 | { | |
9451 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9452 | { | |
9453 | diffFlowSumOfProductOfEventWeightsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Sum of products of event weights (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9454 | if(!diffFlowSumOfProductOfEventWeightsHistList[t][pe]) | |
9455 | { | |
9456 | cout<<"WARNING: diffFlowSumOfProductOfEventWeightsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9457 | cout<<"t = "<<t<<endl; | |
9458 | cout<<"pe = "<<pe<<endl; | |
9459 | exit(0); | |
9460 | } | |
9461 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
9462 | { | |
9463 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
9464 | { | |
9465 | diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = dynamic_cast<TH1D*>(diffFlowSumOfProductOfEventWeightsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()))); | |
9466 | if(diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]) | |
9467 | { | |
9468 | this->SetDiffFlowSumOfProductOfEventWeights(diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2],t,pe,mci1,mci2); | |
9469 | } else | |
9470 | { | |
9471 | cout<<"WARNING: diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9472 | cout<<"t = "<<t<<endl; | |
9473 | cout<<"pe = "<<pe<<endl; | |
9474 | cout<<"mci1 = "<<mci1<<endl; | |
9475 | cout<<"mci2 = "<<mci2<<endl; | |
9476 | exit(0); | |
9477 | } | |
9478 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
9479 | } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
9480 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
9481 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9482 | } // end of for(Int_t t=0;t<2;t++) // type is RP or POI | |
9483 | ||
9484 | } // end void AliFlowAnalysisWithQCumulants::GetPointersForDiffFlowHistograms() | |
9485 | ||
489d5531 | 9486 | //================================================================================================================================ |
9487 | ||
1268c371 | 9488 | void AliFlowAnalysisWithQCumulants::BookEverythingFor2DDifferentialFlow() |
9489 | { | |
9490 | // Book all objects needed for 2D differential flow. | |
9491 | // a) Define flags locally (to be improved: should I promote flags to data members?); | |
9492 | // b) Book e-b-e quantities; | |
9493 | // c) Book 2D profiles; | |
9494 | // d) Book 2D histograms. | |
9495 | ||
9496 | if(!fCalculate2DDiffFlow){return;} | |
9497 | ||
9498 | // a) Define flags locally (to be improved: should I promote flags to data members?): | |
9499 | TString typeFlag[2] = {"RP","POI"}; | |
9500 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
9501 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
9502 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
9503 | ||
9504 | // b) Book e-b-e quantities: | |
9505 | TProfile2D styleRe("typeMultiplePowerRe","typeMultiplePowerRe",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
9506 | TProfile2D styleIm("typeMultiplePowerIm","typeMultiplePowerIm",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
9507 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) | |
9508 | { | |
9509 | for(Int_t m=0;m<4;m++) | |
9510 | { | |
9511 | for(Int_t k=0;k<9;k++) | |
9512 | { | |
9513 | fReRPQ2dEBE[t][m][k] = (TProfile2D*)styleRe.Clone(Form("typeFlag%dmultiple%dpower%dRe",t,m,k)); | |
9514 | fImRPQ2dEBE[t][m][k] = (TProfile2D*)styleIm.Clone(Form("typeFlag%dmultiple%dpower%dIm",t,m,k)); | |
9515 | } | |
9516 | } | |
9517 | } | |
9518 | TProfile2D styleS("typePower","typePower",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
9519 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) | |
9520 | { | |
9521 | for(Int_t k=0;k<9;k++) | |
9522 | { | |
9523 | fs2dEBE[t][k] = (TProfile2D*)styleS.Clone(Form("typeFlag%dpower%d",t,k)); | |
9524 | } | |
9525 | } | |
9526 | ||
9527 | // c) Book 2D profiles: | |
9528 | TString s2DDiffFlowCorrelationsProName = "f2DDiffFlowCorrelationsPro"; | |
9529 | s2DDiffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
9530 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9531 | { | |
9532 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
9533 | { | |
9534 | f2DDiffFlowCorrelationsPro[t][rci] = new TProfile2D(Form("%s, %s, %s",s2DDiffFlowCorrelationsProName.Data(),typeFlag[t].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s",s2DDiffFlowCorrelationsProName.Data(),typeFlag[t].Data(),reducedCorrelationIndex[rci].Data()),fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,""); | |
9535 | f2DDiffFlowCorrelationsPro[t][rci]->Sumw2(); | |
9536 | f2DDiffFlowCorrelationsPro[t][rci]->SetXTitle("p_{t}"); | |
9537 | f2DDiffFlowCorrelationsPro[t][rci]->SetYTitle("#eta"); | |
9538 | f2DDiffFlowCorrelationsProList[t]->Add(f2DDiffFlowCorrelationsPro[t][rci]); | |
9539 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
9540 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POIs | |
9541 | ||
9542 | // d) Book 2D histograms: | |
9543 | TString s2DDiffFlowCumulantsName = "f2DDiffFlowCumulants"; | |
9544 | s2DDiffFlowCumulantsName += fAnalysisLabel->Data(); | |
9545 | TString s2DDiffFlowName = "f2DDiffFlow"; | |
9546 | s2DDiffFlowName += fAnalysisLabel->Data(); | |
9547 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9548 | { | |
9549 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
9550 | { | |
9551 | // 2D diferential cumulants: | |
9552 | f2DDiffFlowCumulants[t][rci] = new TH2D(Form("%s, %s, %s",s2DDiffFlowCumulantsName.Data(),typeFlag[t].Data(),differentialCumulantIndex[rci].Data()),Form("%s, %s, %s",s2DDiffFlowCumulantsName.Data(),typeFlag[t].Data(),differentialCumulantIndex[rci].Data()),fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
9553 | f2DDiffFlowCumulants[t][rci]->SetXTitle("p_{t}"); | |
9554 | f2DDiffFlowCumulants[t][rci]->SetYTitle("#eta"); | |
9555 | f2DDiffFlowCorrelationsProList[t]->Add(f2DDiffFlowCumulants[t][rci]); // to be improved - moved to another list | |
9556 | // 2D differential flow: | |
9557 | f2DDiffFlow[t][rci] = new TH2D(Form("%s, %s, %s",s2DDiffFlowName.Data(),typeFlag[t].Data(),differentialFlowIndex[rci].Data()),Form("%s, %s, %s",s2DDiffFlowName.Data(),typeFlag[t].Data(),differentialFlowIndex[rci].Data()),fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
9558 | f2DDiffFlow[t][rci]->SetXTitle("p_{t}"); | |
9559 | f2DDiffFlow[t][rci]->SetYTitle("#eta"); | |
9560 | f2DDiffFlowCorrelationsProList[t]->Add(f2DDiffFlow[t][rci]); // to be improved - moved to another list | |
9561 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
9562 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POIs | |
9563 | ||
9564 | } // void AliFlowAnalysisWithQCumulants::BookEverythingFor2DDifferentialFlow() | |
9565 | ||
9566 | //================================================================================================================================ | |
489d5531 | 9567 | |
9568 | void AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow() | |
9569 | { | |
9570 | // Book all histograms and profiles needed for differential flow. | |
1268c371 | 9571 | // a) Book profile to hold all flags for differential flow; |
9572 | // b) Define flags locally (to be improved: should I promote flags to data members?); | |
489d5531 | 9573 | // c) Book e-b-e quantities; |
9574 | // d) Book profiles; | |
9575 | // e) Book histograms holding final results. | |
9576 | ||
1268c371 | 9577 | // a) Book profile to hold all flags for differential flow: |
9578 | TString diffFlowFlagsName = "fDiffFlowFlags"; | |
9579 | diffFlowFlagsName += fAnalysisLabel->Data(); | |
9580 | fDiffFlowFlags = new TProfile(diffFlowFlagsName.Data(),"Flags for differential flow",5,0,5); | |
9581 | fDiffFlowFlags->SetTickLength(-0.01,"Y"); | |
9582 | fDiffFlowFlags->SetMarkerStyle(25); | |
9583 | fDiffFlowFlags->SetLabelSize(0.04,"X"); | |
9584 | fDiffFlowFlags->SetLabelOffset(0.02,"Y"); | |
9585 | fDiffFlowFlags->GetXaxis()->SetBinLabel(1,"Calculate diff. flow"); | |
9586 | fDiffFlowFlags->GetXaxis()->SetBinLabel(2,"Particle weights"); | |
9587 | fDiffFlowFlags->GetXaxis()->SetBinLabel(3,"Event weights"); | |
9588 | fDiffFlowFlags->GetXaxis()->SetBinLabel(4,"Correct for NUA"); | |
9589 | fDiffFlowFlags->GetXaxis()->SetBinLabel(5,"Calculate 2D diff. flow"); | |
9590 | fDiffFlowList->Add(fDiffFlowFlags); | |
9591 | ||
9592 | if(!fCalculateDiffFlow){return;} | |
9593 | ||
9594 | // b) Define flags locally (to be improved: should I promote flags to data members?): | |
489d5531 | 9595 | TString typeFlag[2] = {"RP","POI"}; |
9596 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
9597 | TString powerFlag[2] = {"linear","quadratic"}; | |
9598 | TString sinCosFlag[2] = {"sin","cos"}; | |
9599 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
9600 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
9601 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
b40a910e | 9602 | TString reducedSquaredCorrelationIndex[4] = {"<2'>^{2}","<4'>^{2}","<6'>^{2}","<8'>^{2}"}; |
489d5531 | 9603 | TString mixedCorrelationIndex[8] = {"<2>","<2'>","<4>","<4'>","<6>","<6'>","<8>","<8'>"}; |
9604 | TString covarianceName[5] = {"Cov(<2>,<2'>)","Cov(<2>,<4'>)","Cov(<4>,<2'>)","Cov(<4>,<4'>)","Cov(<2'>,<4'>)"}; | |
9605 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
9606 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
9607 | Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
1268c371 | 9608 | |
489d5531 | 9609 | // c) Book e-b-e quantities: |
9610 | // Event-by-event r_{m*n,k}(pt,eta), p_{m*n,k}(pt,eta) and q_{m*n,k}(pt,eta) | |
9611 | // Explanantion of notation: | |
9612 | // 1.) n is harmonic, m is multiple of harmonic; | |
9613 | // 2.) k is power of particle weight; | |
9614 | // 3.) r_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for RPs in particular (pt,eta) bin (i-th RP is weighted with w_i^k); | |
9615 | // 4.) p_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for POIs in particular (pt,eta) bin | |
9616 | // (if i-th POI is also RP, than it is weighted with w_i^k); | |
9617 | // 5.) q_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for particles which are both RPs and POIs in particular (pt,eta) bin | |
9618 | // (i-th RP&&POI is weighted with w_i^k) | |
9619 | ||
9620 | // 1D: | |
9621 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP && POI ) | |
9622 | { | |
9623 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9624 | { | |
9625 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
9626 | { | |
9627 | for(Int_t k=0;k<9;k++) // power of particle weight | |
9628 | { | |
9629 | fReRPQ1dEBE[t][pe][m][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%dpower%dRe",t,pe,m,k), | |
9630 | Form("TypeFlag%dpteta%dmultiple%dpower%dRe",t,pe,m,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9631 | fImRPQ1dEBE[t][pe][m][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%dpower%dIm",t,pe,m,k), | |
9632 | Form("TypeFlag%dpteta%dmultiple%dpower%dIm",t,pe,m,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9633 | } | |
9634 | } | |
9635 | } | |
9636 | } | |
9637 | // to be improved (add explanation of fs1dEBE[t][pe][k]): | |
9638 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) | |
9639 | { | |
9640 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9641 | { | |
9642 | for(Int_t k=0;k<9;k++) // power of particle weight | |
9643 | { | |
9644 | fs1dEBE[t][pe][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%d",t,pe,k), | |
9645 | Form("TypeFlag%dpteta%dmultiple%d",t,pe,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9646 | } | |
9647 | } | |
9648 | } | |
9649 | // correction terms for nua: | |
9650 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
9651 | { | |
9652 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9653 | { | |
9654 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9655 | { | |
9656 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
9657 | { | |
9658 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti] = new TH1D(Form("typeFlag%d pteta%d sincos%d cti%d",t,pe,sc,cti), | |
9659 | Form("typeFlag%d pteta%d sincos%d cti%d",t,pe,sc,cti),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9660 | } | |
9661 | } | |
9662 | } | |
9663 | } | |
489d5531 | 9664 | // reduced correlations e-b-e: |
9665 | TString diffFlowCorrelationsEBEName = "fDiffFlowCorrelationsEBE"; | |
9666 | diffFlowCorrelationsEBEName += fAnalysisLabel->Data(); | |
9667 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9668 | { | |
9669 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9670 | { | |
9671 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
9672 | { | |
9673 | fDiffFlowCorrelationsEBE[t][pe][rci] = new TH1D(Form("%s, %s, %s, %s",diffFlowCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9674 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
9675 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9676 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
9677 | // event weights for reduced correlations e-b-e: | |
9678 | TString diffFlowEventWeightsForCorrelationsEBEName = "fDiffFlowEventWeightsForCorrelationsEBE"; | |
9679 | diffFlowEventWeightsForCorrelationsEBEName += fAnalysisLabel->Data(); | |
9680 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9681 | { | |
9682 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9683 | { | |
9684 | for(Int_t rci=0;rci<4;rci++) // event weight for reduced correlation index | |
9685 | { | |
9686 | fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci] = new TH1D(Form("%s, %s, %s, eW for %s",diffFlowEventWeightsForCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, eW for %s",diffFlowEventWeightsForCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9687 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
9688 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9689 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
9690 | ||
9691 | // d) Book profiles; | |
9692 | // reduced correlations: | |
9693 | TString diffFlowCorrelationsProName = "fDiffFlowCorrelationsPro"; | |
9694 | diffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
b40a910e | 9695 | // reduced squared correlations: |
9696 | TString diffFlowSquaredCorrelationsProName = "fDiffFlowSquaredCorrelationsPro"; | |
9697 | diffFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
489d5531 | 9698 | // corrections terms: |
9699 | TString diffFlowCorrectionTermsForNUAProName = "fDiffFlowCorrectionTermsForNUAPro"; | |
9700 | diffFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
b40a910e | 9701 | // reduced correlations: |
489d5531 | 9702 | for(Int_t t=0;t<2;t++) // type: RP or POI |
9703 | { | |
9704 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9705 | { | |
9706 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
9707 | { | |
489d5531 | 9708 | fDiffFlowCorrelationsPro[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe],"s"); |
b40a910e | 9709 | fDiffFlowCorrelationsPro[t][pe][rci]->Sumw2(); |
489d5531 | 9710 | fDiffFlowCorrelationsPro[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data()); |
9711 | fDiffFlowCorrelationsProList[t][pe]->Add(fDiffFlowCorrelationsPro[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations) | |
9712 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
9713 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9714 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
b40a910e | 9715 | // reduced squared correlations: |
9716 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9717 | { | |
9718 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9719 | { | |
9720 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
9721 | { | |
9722 | fDiffFlowSquaredCorrelationsPro[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowSquaredCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedSquaredCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowSquaredCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedSquaredCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe],"s"); | |
9723 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->Sumw2(); | |
9724 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data()); | |
9725 | fDiffFlowCorrelationsProList[t][pe]->Add(fDiffFlowSquaredCorrelationsPro[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations) | |
9726 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
9727 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9728 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
489d5531 | 9729 | // correction terms for nua: |
9730 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
9731 | { | |
9732 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9733 | { | |
9734 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9735 | { | |
9736 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
9737 | { | |
9738 | fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = new TProfile(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9739 | fDiffFlowCorrectionsProList[t][pe]->Add(fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]); | |
9740 | } | |
9741 | } | |
9742 | } | |
9743 | } | |
64e500e3 | 9744 | // Other differential correlators: |
9745 | TString otherDiffCorrelatorsName = "fOtherDiffCorrelators"; | |
9746 | otherDiffCorrelatorsName += fAnalysisLabel->Data(); | |
9747 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
9748 | { | |
9749 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9750 | { | |
9751 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9752 | { | |
9753 | for(Int_t ci=0;ci<1;ci++) // correlator index | |
9754 | { | |
9755 | fOtherDiffCorrelators[t][pe][sc][ci] = new TProfile(Form("%s, %s, %s, %s, ci = %d",otherDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1),Form("%s, %s, %s, %s, ci = %d",otherDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9756 | fOtherDiffCorrelators[t][pe][sc][ci]->Sumw2(); | |
9757 | fOtherDiffCorrelatorsList->Add(fOtherDiffCorrelators[t][pe][sc][ci]); | |
9758 | } | |
9759 | } | |
9760 | } | |
9761 | } | |
489d5531 | 9762 | // e) Book histograms holding final results. |
9763 | // reduced correlations: | |
9764 | TString diffFlowCorrelationsHistName = "fDiffFlowCorrelationsHist"; | |
9765 | diffFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
9766 | // corrections terms: | |
9767 | TString diffFlowCorrectionTermsForNUAHistName = "fDiffFlowCorrectionTermsForNUAHist"; | |
9768 | diffFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
9769 | // differential covariances: | |
9770 | TString diffFlowCovariancesName = "fDiffFlowCovariances"; | |
9771 | diffFlowCovariancesName += fAnalysisLabel->Data(); | |
9772 | // differential Q-cumulants: | |
9773 | TString diffFlowCumulantsName = "fDiffFlowCumulants"; | |
9774 | diffFlowCumulantsName += fAnalysisLabel->Data(); | |
1268c371 | 9775 | // Detector bias to differential Q-cumulants: |
9776 | TString diffFlowDetectorBiasName = "fDiffFlowDetectorBias"; | |
9777 | diffFlowDetectorBiasName += fAnalysisLabel->Data(); | |
489d5531 | 9778 | // differential flow: |
9779 | TString diffFlowName = "fDiffFlow"; | |
9780 | diffFlowName += fAnalysisLabel->Data(); | |
9781 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9782 | { | |
9783 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9784 | { | |
9785 | for(Int_t index=0;index<4;index++) | |
9786 | { | |
9787 | // reduced correlations: | |
9788 | fDiffFlowCorrelationsHist[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9789 | fDiffFlowCorrelationsHist[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
9790 | fDiffFlowCorrelationsHistList[t][pe]->Add(fDiffFlowCorrelationsHist[t][pe][index]); | |
9791 | // differential Q-cumulants: | |
9792 | fDiffFlowCumulants[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9793 | fDiffFlowCumulants[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
9794 | fDiffFlowCumulantsHistList[t][pe]->Add(fDiffFlowCumulants[t][pe][index]); | |
1268c371 | 9795 | // Detector bias to differential Q-cumulants: |
9796 | fDiffFlowDetectorBias[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowDetectorBiasName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowDetectorBiasName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9797 | fDiffFlowDetectorBias[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
9798 | fDiffFlowDetectorBias[t][pe][index]->SetTitle(Form("#frac{corrected}{measured} %s",differentialCumulantIndex[index].Data())); | |
9799 | fDiffFlowDetectorBiasHistList[t][pe]->Add(fDiffFlowDetectorBias[t][pe][index]); | |
489d5531 | 9800 | // differential flow estimates from Q-cumulants: |
9801 | fDiffFlow[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9802 | fDiffFlow[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
9803 | fDiffFlowHistList[t][pe]->Add(fDiffFlow[t][pe][index]); | |
9804 | } // end of for(Int_t index=0;index<4;index++) | |
9805 | for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index | |
9806 | { | |
9807 | // differential covariances: | |
9808 | fDiffFlowCovariances[t][pe][covIndex] = new TH1D(Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()),Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9809 | fDiffFlowCovariances[t][pe][covIndex]->SetXTitle(ptEtaFlag[pe].Data()); | |
9810 | fDiffFlowCovariancesHistList[t][pe]->Add(fDiffFlowCovariances[t][pe][covIndex]); | |
9811 | } // end of for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index | |
9812 | // products of both types of correlations: | |
9813 | TString diffFlowProductOfCorrelationsProName = "fDiffFlowProductOfCorrelationsPro"; | |
9814 | diffFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
9815 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
9816 | { | |
9817 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
9818 | { | |
9819 | fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = new TProfile(Form("%s, %s, %s, %s, %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),Form("%s, %s, %s, %s #times %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9820 | fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]->SetXTitle(ptEtaFlag[pe].Data()); | |
9821 | fDiffFlowProductOfCorrelationsProList[t][pe]->Add(fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]); | |
9822 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
9823 | } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
9824 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
9825 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9826 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
9827 | // sums of event weights for reduced correlations: | |
9828 | TString diffFlowSumOfEventWeightsName = "fDiffFlowSumOfEventWeights"; | |
9829 | diffFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
9830 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
9831 | { | |
9832 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9833 | { | |
9834 | for(Int_t p=0;p<2;p++) // power of weights is either 1 or 2 | |
9835 | { | |
9836 | for(Int_t ew=0;ew<4;ew++) // index of reduced correlation | |
9837 | { | |
9838 | fDiffFlowSumOfEventWeights[t][pe][p][ew] = new TH1D(Form("%s, %s, %s, %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()),Form("%s, %s, %s, power = %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9839 | fDiffFlowSumOfEventWeights[t][pe][p][ew]->SetXTitle(ptEtaFlag[pe].Data()); | |
9840 | fDiffFlowSumOfEventWeightsHistList[t][pe][p]->Add(fDiffFlowSumOfEventWeights[t][pe][p][ew]); // to be improved (add dedicated list to hold all this) | |
9841 | } | |
9842 | } | |
9843 | } | |
9844 | } | |
9845 | // sum of products of event weights for both types of correlations: | |
9846 | TString diffFlowSumOfProductOfEventWeightsName = "fDiffFlowSumOfProductOfEventWeights"; | |
9847 | diffFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
9848 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
9849 | { | |
9850 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9851 | { | |
9852 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
9853 | { | |
9854 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
9855 | { | |
9856 | fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = new TH1D(Form("%s, %s, %s, %s, %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),Form("%s, %s, %s, %s #times %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9857 | fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]->SetXTitle(ptEtaFlag[pe].Data()); | |
9858 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]->Add(fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]); | |
9859 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
9860 | } | |
9861 | } | |
9862 | } | |
9863 | } | |
9864 | // correction terms for nua: | |
9865 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
9866 | { | |
9867 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9868 | { | |
9869 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9870 | { | |
9871 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
9872 | { | |
9873 | fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = new TH1D(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9874 | fDiffFlowCorrectionsHistList[t][pe]->Add(fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]); | |
9875 | } | |
9876 | } | |
9877 | } | |
9878 | } | |
9879 | ||
9880 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow() | |
9881 | ||
489d5531 | 9882 | //================================================================================================================================ |
9883 | ||
489d5531 | 9884 | void AliFlowAnalysisWithQCumulants::CalculateQcumulantsCorrectedForNUAIntFlow() |
9885 | { | |
9886 | // Calculate generalized Q-cumulants (cumulants corrected for non-unifom acceptance). | |
9887 | ||
b92ea2b9 | 9888 | // Isotropic cumulants: |
9889 | Double_t QC2 = fIntFlowQcumulants->GetBinContent(1); | |
9890 | Double_t QC2Error = fIntFlowQcumulants->GetBinError(1); | |
9891 | Double_t QC4 = fIntFlowQcumulants->GetBinContent(2); | |
9892 | Double_t QC4Error = fIntFlowQcumulants->GetBinError(2); | |
9893 | //Double_t QC6 = fIntFlowQcumulants->GetBinContent(3); | |
9894 | //Double_t QC6Error = fIntFlowQcumulants->GetBinError(3); | |
9895 | //Double_t QC8 = fIntFlowQcumulants->GetBinContent(4); | |
9896 | //Double_t QC8Error = fIntFlowQcumulants->GetBinError(4); | |
9897 | ||
9898 | // Measured 2-, 4-, 6- and 8-particle correlations: | |
489d5531 | 9899 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> |
b92ea2b9 | 9900 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <<2>> |
489d5531 | 9901 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> |
b92ea2b9 | 9902 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <<4>> |
489d5531 | 9903 | //Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> |
489d5531 | 9904 | //Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <<6>> |
b92ea2b9 | 9905 | //Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> |
489d5531 | 9906 | //Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <<8>> |
b92ea2b9 | 9907 | |
9908 | // Non-isotropic terms: | |
9909 | Double_t c1 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1); // <<cos(n*phi1)>> | |
9910 | Double_t c1Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(1); // statistical error of <<cos(n*phi1)>> | |
9911 | Double_t c2 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2); // <<cos(n*(phi1+phi2))>> | |
9912 | Double_t c2Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(2); // statistical error of <<cos(n*(phi1+phi2))>> | |
9913 | Double_t c3 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(3); // <<cos(n*(phi1-phi2-phi3))>> | |
9914 | Double_t c3Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(3); // statistical error of <<cos(n*(phi1-phi2-phi3))>> | |
9915 | Double_t s1 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1); // <<sin(n*phi1)>> | |
9916 | Double_t s1Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(1); // statistical error of <<sin(n*phi1)>> | |
9917 | Double_t s2 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2); // <<sin(n*(phi1+phi2))>> | |
9918 | Double_t s2Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(2); // statistical error of <<sin(n*(phi1+phi2))>> | |
9919 | Double_t s3 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(3); // <<sin(n*(phi1-phi2-phi3))>> | |
9920 | Double_t s3Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(3); // statistical error of <<sin(n*(phi1-phi2-phi3))>> | |
9921 | ||
9922 | // Shortcuts: | |
9923 | Double_t a1 = 2.*pow(c1,2.)+2.*pow(s1,2.)-two; | |
9924 | Double_t a2 = 6.*pow(c1,3.)-2.*c1*c2+c3+6.*c1*pow(s1,2.)-2.*s1*s2-4.*c1*two; | |
9925 | Double_t a3 = 2.*pow(s1,2.)-2.*pow(c1,2.)+c2; | |
9926 | Double_t a4 = 6.*pow(s1,3.)+6.*pow(c1,2.)*s1+2.*c2*s1-2.*c1*s2-s3-4.*s1*two; | |
9927 | Double_t a5 = 4.*c1*s1-s2; | |
9928 | ||
9929 | // Covariances (including weight dependent prefactor): | |
8e1cefdd | 9930 | Double_t wCov1 = 0.; // w*Cov(<2>,<cos(phi)) |
9931 | Double_t wCov2 = 0.; // w*Cov(<2>,<sin(phi)) | |
9932 | Double_t wCov3 = 0.; // w*Cov(<cos(phi),<sin(phi)) | |
9933 | Double_t wCov4 = 0.; // w*Cov(<2>,<4>) | |
9934 | Double_t wCov5 = 0.; // w*Cov(<2>,<cos(#phi_{1}+#phi_{2})>) | |
9935 | Double_t wCov6 = 0.; // w*Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9936 | Double_t wCov7 = 0.; // w*Cov(<2>,<sin(#phi_{1}+#phi_{2})>) | |
9937 | Double_t wCov8 = 0.; // w*Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9938 | Double_t wCov9 = 0.; // w*Cov(<4>,<cos(#phi)> | |
9939 | Double_t wCov10 = 0.; // w*Cov(<4>,<cos(#phi_{1}+#phi_{2})>) | |
9940 | Double_t wCov11 = 0.; // w*Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9941 | Double_t wCov12 = 0.; // w*Cov(<4>,<sin(#phi)> | |
9942 | Double_t wCov13 = 0.; // w*Cov(<4>,<sin(#phi_{1}+#phi_{2})>) | |
9943 | Double_t wCov14 = 0.; // w*Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9944 | Double_t wCov15 = 0.; // w*Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
9945 | Double_t wCov16 = 0.; // w*Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9946 | Double_t wCov17 = 0.; // w*Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
9947 | Double_t wCov18 = 0.; // w*Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9948 | Double_t wCov19 = 0.; // w*Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9949 | Double_t wCov20 = 0.; // w*Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
9950 | Double_t wCov21 = 0.; // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>) | |
9951 | Double_t wCov22 = 0.; // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9952 | Double_t wCov23 = 0.; // w*Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9953 | Double_t wCov24 = 0.; // w*Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9954 | Double_t wCov25 = 0.; // w*Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>) | |
9955 | Double_t wCov26 = 0.; // w*Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
9956 | Double_t wCov27 = 0.; // w*Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9957 | Double_t wCov28 = 0.; // w*Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9958 | if(!fForgetAboutCovariances) | |
9959 | { | |
9960 | wCov1 = fIntFlowCovariancesNUA->GetBinContent(1); // w*Cov(<2>,<cos(phi)) | |
9961 | wCov2 = fIntFlowCovariancesNUA->GetBinContent(2); // w*Cov(<2>,<sin(phi)) | |
9962 | wCov3 = fIntFlowCovariancesNUA->GetBinContent(3); // w*Cov(<cos(phi),<sin(phi)) | |
9963 | wCov4 = fIntFlowCovariances->GetBinContent(1); // w*Cov(<2>,<4>) | |
9964 | wCov5 = fIntFlowCovariancesNUA->GetBinContent(4); // w*Cov(<2>,<cos(#phi_{1}+#phi_{2})>) | |
9965 | wCov6 = fIntFlowCovariancesNUA->GetBinContent(6); // w*Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9966 | wCov7 = fIntFlowCovariancesNUA->GetBinContent(5); // w*Cov(<2>,<sin(#phi_{1}+#phi_{2})>) | |
9967 | wCov8 = fIntFlowCovariancesNUA->GetBinContent(7); // w*Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9968 | wCov9 = fIntFlowCovariancesNUA->GetBinContent(8); // w*Cov(<4>,<cos(#phi)> | |
9969 | wCov10 = fIntFlowCovariancesNUA->GetBinContent(10); // w*Cov(<4>,<cos(#phi_{1}+#phi_{2})>) | |
9970 | wCov11 = fIntFlowCovariancesNUA->GetBinContent(12); // w*Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9971 | wCov12 = fIntFlowCovariancesNUA->GetBinContent(9); // w*Cov(<4>,<sin(#phi)> | |
9972 | wCov13 = fIntFlowCovariancesNUA->GetBinContent(11); // w*Cov(<4>,<sin(#phi_{1}+#phi_{2})>) | |
9973 | wCov14 = fIntFlowCovariancesNUA->GetBinContent(13); // w*Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9974 | wCov15 = fIntFlowCovariancesNUA->GetBinContent(14); // w*Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
9975 | wCov16 = fIntFlowCovariancesNUA->GetBinContent(16); // w*Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9976 | wCov17 = fIntFlowCovariancesNUA->GetBinContent(15); // w*Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
9977 | wCov18 = fIntFlowCovariancesNUA->GetBinContent(17); // w*Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9978 | wCov19 = fIntFlowCovariancesNUA->GetBinContent(23); // w*Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9979 | wCov20 = fIntFlowCovariancesNUA->GetBinContent(18); // w*Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
9980 | wCov21 = fIntFlowCovariancesNUA->GetBinContent(22); // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>) | |
9981 | wCov22 = fIntFlowCovariancesNUA->GetBinContent(24); // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9982 | wCov23 = fIntFlowCovariancesNUA->GetBinContent(20); // w*Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9983 | wCov24 = fIntFlowCovariancesNUA->GetBinContent(25); // w*Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9984 | wCov25 = fIntFlowCovariancesNUA->GetBinContent(27); // w*Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>) | |
9985 | wCov26 = fIntFlowCovariancesNUA->GetBinContent(19); // w*Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
9986 | wCov27 = fIntFlowCovariancesNUA->GetBinContent(21); // w*Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9987 | wCov28 = fIntFlowCovariancesNUA->GetBinContent(26); // w*Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
9988 | } // end of if(!fForgetAboutCovariances) | |
9989 | ||
b92ea2b9 | 9990 | // Calculating generalized QC{2}: |
9991 | // Generalized QC{2}: | |
9992 | Double_t gQC2 = two - pow(c1,2.) - pow(s1,2.); | |
9993 | if(fApplyCorrectionForNUA){fIntFlowQcumulants->SetBinContent(1,gQC2);} | |
9994 | // Statistical error of generalized QC{2}: | |
9995 | Double_t gQC2ErrorSquared = pow(twoError,2.)+4.*pow(c1,2.)*pow(c1Error,2.) | |
9996 | + 4.*pow(s1,2.)*pow(s1Error,2.) | |
9997 | - 4*c1*wCov1-4*s1*wCov2 | |
9998 | + 8.*c1*s1*wCov3; | |
9999 | // Store ratio of error squared - with/without NUA terms: | |
10000 | Double_t ratioErrorSquaredQC2 = 0.; | |
10001 | if(fIntFlowQcumulants->GetBinError(1)>0.) | |
10002 | { | |
10003 | ratioErrorSquaredQC2 = (gQC2ErrorSquared/pow(fIntFlowQcumulants->GetBinError(1),2.)); | |
10004 | fIntFlowQcumulantsErrorSquaredRatio->SetBinContent(1,ratioErrorSquaredQC2); | |
10005 | } | |
10006 | // If enabled, store error by including non-isotropic terms: | |
b77b6434 | 10007 | if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 10008 | { |
10009 | if(gQC2ErrorSquared>=0.) | |
10010 | { | |
10011 | fIntFlowQcumulants->SetBinError(1,pow(gQC2ErrorSquared,0.5)); | |
10012 | } else | |
10013 | { | |
10014 | fIntFlowQcumulants->SetBinError(1,0.); | |
10015 | cout<<endl; | |
10016 | cout<<" WARNING (QC): Statistical error of generalized QC{2} is imaginary !!!!"<<endl; | |
10017 | cout<<endl; | |
10018 | } | |
b77b6434 | 10019 | } // end of if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 10020 | // Quantify detector bias to QC{2}: |
10021 | if(TMath::Abs(QC2)>0.) | |
10022 | { | |
10023 | fIntFlowDetectorBias->SetBinContent(1,gQC2/QC2); | |
10024 | if(QC2Error>0.) | |
10025 | { | |
10026 | Double_t errorSquared = gQC2ErrorSquared/pow(QC2,2.)+pow(gQC2,2.)*pow(QC2Error,2.)/pow(QC2,4.); | |
10027 | if(errorSquared>0.) | |
10028 | { | |
10029 | fIntFlowDetectorBias->SetBinError(1,pow(errorSquared,0.5)); | |
10030 | } | |
10031 | } | |
10032 | } // end of if(TMath::Abs(QC2)>0.) | |
10033 | ||
10034 | // Calculating generalized QC{4}: | |
10035 | // Generalized QC{4}: | |
10036 | Double_t gQC4 = four-2.*pow(two,2.) | |
10037 | - 4.*c1*c3+4.*s1*s3-pow(c2,2.)-pow(s2,2.) | |
10038 | + 4.*c2*(pow(c1,2.)-pow(s1,2.))+8.*s2*s1*c1 | |
10039 | + 8.*two*(pow(c1,2.)+pow(s1,2.))-6.*pow((pow(c1,2.)+pow(s1,2.)),2.); | |
10040 | if(fApplyCorrectionForNUA){fIntFlowQcumulants->SetBinContent(2,gQC4);} | |
10041 | // Statistical error of generalized QC{4}: | |
10042 | Double_t gQC4ErrorSquared = 16.*pow(a1,2.)*pow(twoError,2.)+pow(fourError,2.)+16.*pow(a2,2.)*pow(c1Error,2.) | |
10043 | + 4.*pow(a3,2.)*pow(c2Error,2.)+16.*pow(c1,2.)*pow(c3Error,2.) | |
10044 | + 16.*pow(a4,2.)*pow(s1Error,2.)+4.*pow(a5,2.)*pow(s2Error,2.) | |
10045 | + 16.*pow(s1,2.)*pow(s3Error,2.)+8.*a1*wCov4-32.*a1*a2*wCov1 | |
10046 | - 16.*a3*a1*wCov5-32.*c1*a1*wCov6-32.*a1*a4*wCov2+16.*a5*a1*wCov7 | |
10047 | + 32.*s1*a1*wCov8-8.*a2*wCov9-4.*a3*wCov10-8.*c1*wCov11-8.*a4*wCov12 | |
10048 | + 4.*a5*wCov13+8.*s1*wCov14+16.*a3*a2*wCov15+32.*c1*a2*wCov16+32.*a2*a4*wCov3 | |
10049 | - 16.*a5*a2*wCov17-32.*s1*a2*wCov18+16.*c1*a3*wCov19+16.*a3*a4*wCov20 | |
10050 | - 8.*a3*a5*wCov21-16.*s1*a3*wCov22+32.*c1*a4*wCov23-16.*c1*a5*wCov24 | |
10051 | - 32.*c1*s1*wCov25-16.*a5*a4*wCov26-32.*s1*a4*wCov27+16.*s1*a5*wCov28; | |
10052 | // Store ratio of error squared - with/without NUA terms: | |
10053 | Double_t ratioErrorSquaredQC4 = 0.; | |
10054 | if(fIntFlowQcumulants->GetBinError(2)>0.) | |
10055 | { | |
10056 | ratioErrorSquaredQC4 = (gQC4ErrorSquared/pow(fIntFlowQcumulants->GetBinError(2),2.)); | |
10057 | fIntFlowQcumulantsErrorSquaredRatio->SetBinContent(2,ratioErrorSquaredQC4); | |
10058 | } | |
b77b6434 | 10059 | if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 10060 | { |
10061 | if(gQC4ErrorSquared>=0.) | |
10062 | { | |
10063 | fIntFlowQcumulants->SetBinError(2,pow(gQC4ErrorSquared,0.5)); | |
10064 | } else | |
10065 | { | |
10066 | fIntFlowQcumulants->SetBinError(2,0.); | |
10067 | cout<<endl; | |
10068 | cout<<" WARNING (QC): Statistical error of generalized QC{4} is imaginary !!!!"<<endl; | |
10069 | cout<<endl; | |
10070 | } | |
b77b6434 | 10071 | } // end of if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 10072 | // Quantify detector bias to QC{4}: |
10073 | if(TMath::Abs(QC4)>0.) | |
10074 | { | |
10075 | fIntFlowDetectorBias->SetBinContent(2,gQC4/QC4); | |
10076 | if(QC4Error>0.) | |
10077 | { | |
10078 | Double_t errorSquared = gQC4ErrorSquared/pow(QC4,2.)+pow(gQC4,2.)*pow(QC4Error,2.)/pow(QC4,4.); | |
10079 | if(errorSquared>0.) | |
10080 | { | |
10081 | fIntFlowDetectorBias->SetBinError(2,pow(errorSquared,0.5)); | |
10082 | } | |
10083 | } | |
10084 | } // end of if(TMath::Abs(QC4)>0.) | |
489d5531 | 10085 | |
b92ea2b9 | 10086 | |
10087 | // .... to be improved (continued for 6th and 8th order) .... | |
10088 | ||
10089 | ||
2001bc3a | 10090 | // versus multiplicity: |
b77b6434 | 10091 | if(fCalculateCumulantsVsM) // to be improved - propagate error for nua terms vs M |
2001bc3a | 10092 | { |
10093 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) | |
b77b6434 | 10094 | Double_t value[4] = {0.}; // QCs vs M |
10095 | Double_t error[4] = {0.}; // error of QCs vs M | |
10096 | Double_t dSum1[4] = {0.}; // sum value_i/(error_i)^2 | |
10097 | Double_t dSum2[4] = {0.}; // sum 1/(error_i)^2 | |
2001bc3a | 10098 | for(Int_t b=1;b<=nBins;b++) |
10099 | { | |
b92ea2b9 | 10100 | // Measured correlations: |
2001bc3a | 10101 | two = fIntFlowCorrelationsVsMHist[0]->GetBinContent(b); // <<2>> vs M |
10102 | four = fIntFlowCorrelationsVsMHist[1]->GetBinContent(b); // <<4>> vs M | |
b92ea2b9 | 10103 | // Isotropic cumulants: |
10104 | QC2 = two; | |
10105 | QC4 = four-2.*pow(two,2.); | |
10106 | // Non-isotropic terms: | |
10107 | c1 = fIntFlowCorrectionTermsForNUAVsMPro[1][0]->GetBinContent(b); // <<cos(n*phi1)>> | |
10108 | c2 = fIntFlowCorrectionTermsForNUAVsMPro[1][1]->GetBinContent(b); // <<cos(n*(phi1+phi2))>> | |
10109 | c3 = fIntFlowCorrectionTermsForNUAVsMPro[1][2]->GetBinContent(b); // <<cos(n*(phi1-phi2-phi3))>> | |
10110 | s1 = fIntFlowCorrectionTermsForNUAVsMPro[0][0]->GetBinContent(b); // <<sin(n*phi1)>> | |
10111 | s2 = fIntFlowCorrectionTermsForNUAVsMPro[0][1]->GetBinContent(b); // <<sin(n*(phi1+phi2))>> | |
10112 | s3 = fIntFlowCorrectionTermsForNUAVsMPro[0][2]->GetBinContent(b); // <<sin(n*(phi1-phi2-phi3))>> | |
10113 | // Generalized QC{2} vs M: | |
10114 | gQC2 = two - pow(c1,2.) - pow(s1,2.); | |
b77b6434 | 10115 | if(fApplyCorrectionForNUAVsM){fIntFlowQcumulantsVsM[0]->SetBinContent(b,gQC2);} |
b92ea2b9 | 10116 | // Generalized QC{4} vs M: |
10117 | gQC4 = four-2.*pow(two,2.) | |
10118 | - 4.*c1*c3+4.*s1*s3-pow(c2,2.)-pow(s2,2.) | |
10119 | + 4.*c2*(pow(c1,2.)-pow(s1,2.))+8.*s2*s1*c1 | |
10120 | + 8.*two*(pow(c1,2.)+pow(s1,2.))-6.*pow((pow(c1,2.)+pow(s1,2.)),2.); | |
b77b6434 | 10121 | if(fApplyCorrectionForNUAVsM){fIntFlowQcumulantsVsM[1]->SetBinContent(b,gQC4);} |
b92ea2b9 | 10122 | // Detector bias vs M: |
10123 | if(TMath::Abs(QC2)>0.) | |
10124 | { | |
10125 | fIntFlowDetectorBiasVsM[0]->SetBinContent(b,gQC2/QC2); | |
10126 | } // end of if(TMath::Abs(QC2)>0.) | |
10127 | if(TMath::Abs(QC4)>0.) | |
10128 | { | |
10129 | fIntFlowDetectorBiasVsM[1]->SetBinContent(b,gQC4/QC4); | |
b77b6434 | 10130 | } // end of if(TMath::Abs(QC4)>0.) |
10131 | // Rebin in M: | |
10132 | for(Int_t co=0;co<4;co++) | |
10133 | { | |
10134 | value[co] = fIntFlowQcumulantsVsM[co]->GetBinContent(b); | |
10135 | error[co] = fIntFlowQcumulantsVsM[co]->GetBinError(b); | |
10136 | if(error[co]>0.) | |
10137 | { | |
10138 | dSum1[co]+=value[co]/(error[co]*error[co]); | |
10139 | dSum2[co]+=1./(error[co]*error[co]); | |
10140 | } | |
10141 | } // end of for(Int_t co=0;co<4;co++) | |
10142 | } // end of for(Int_t b=1;b<=nBins;b++) | |
10143 | // Store rebinned Q-cumulants: | |
10144 | if(fApplyCorrectionForNUAVsM) | |
10145 | { | |
10146 | for(Int_t co=0;co<4;co++) | |
10147 | { | |
10148 | if(dSum2[co]>0.) | |
10149 | { | |
10150 | fIntFlowQcumulantsRebinnedInM->SetBinContent(co+1,dSum1[co]/dSum2[co]); | |
10151 | fIntFlowQcumulantsRebinnedInM->SetBinError(co+1,pow(1./dSum2[co],0.5)); | |
10152 | } | |
10153 | } // end of for(Int_t co=0;co<4;co++) | |
10154 | } // end of if(fApplyCorrectionForNUAVsM) | |
10155 | } // end of if(fCalculateCumulantsVsM) | |
2001bc3a | 10156 | |
489d5531 | 10157 | } // end of void AliFlowAnalysisWithQCumulants::CalculateQcumulantsCorrectedForNUAIntFlow() |
0328db2d | 10158 | |
489d5531 | 10159 | //================================================================================================================================ |
10160 | ||
489d5531 | 10161 | void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUAIntFlow() |
10162 | { | |
0328db2d | 10163 | // From profile fIntFlowCorrectionTermsForNUAPro[sc] access measured correction terms for NUA |
489d5531 | 10164 | // and their spread, correctly calculate the statistical errors and store the final |
0328db2d | 10165 | // results and statistical errors for correction terms for NUA in histogram fIntFlowCorrectionTermsForNUAHist[sc]. |
489d5531 | 10166 | // |
10167 | // Remark: Statistical error of correction temrs is calculated as: | |
10168 | // | |
10169 | // statistical error = termA * spread * termB: | |
10170 | // termA = sqrt{sum_{i=1}^{N} w^2}/(sum_{i=1}^{N} w) | |
10171 | // termB = 1/sqrt(1-termA^2) | |
10172 | ||
b92ea2b9 | 10173 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved - promore this to data member? |
10174 | TString nonisotropicTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4 | |
10175 | ||
489d5531 | 10176 | for(Int_t sc=0;sc<2;sc++) // sin or cos correction terms |
10177 | { | |
b92ea2b9 | 10178 | for(Int_t ci=1;ci<=4;ci++) // correction term index (to be improved - hardwired 4) |
489d5531 | 10179 | { |
10180 | Double_t correction = fIntFlowCorrectionTermsForNUAPro[sc]->GetBinContent(ci); | |
0328db2d | 10181 | Double_t spread = fIntFlowCorrectionTermsForNUAPro[sc]->GetBinError(ci); |
10182 | Double_t sumOfLinearEventWeights = fIntFlowSumOfEventWeightsNUA[sc][0]->GetBinContent(ci); | |
10183 | Double_t sumOfQuadraticEventWeights = fIntFlowSumOfEventWeightsNUA[sc][1]->GetBinContent(ci); | |
10184 | Double_t termA = 0.; | |
10185 | Double_t termB = 0.; | |
b92ea2b9 | 10186 | if(TMath::Abs(sumOfLinearEventWeights)>1.e-44) |
0328db2d | 10187 | { |
10188 | termA = pow(sumOfQuadraticEventWeights,0.5)/sumOfLinearEventWeights; | |
10189 | } else | |
10190 | { | |
b92ea2b9 | 10191 | cout<<" WARNING (QC): sumOfLinearEventWeights == 0 in AFAWQC::FCTFNIF() !!!!"<<endl; |
10192 | cout<<Form(" (for <<%s[%s]>> non-isotropic term)",sinCosFlag[sc].Data(),nonisotropicTermFlag[ci-1].Data())<<endl; | |
0328db2d | 10193 | } |
489d5531 | 10194 | if(1.-pow(termA,2.) > 0.) |
10195 | { | |
10196 | termB = 1./pow(1-pow(termA,2.),0.5); | |
10197 | } else | |
10198 | { | |
b92ea2b9 | 10199 | cout<<" WARNING (QC): 1.-pow(termA,2.) <= 0 in AFAWQC::FCTFNIF() !!!!"<<endl; |
10200 | cout<<Form(" (for <<%s[%s]>> non-isotropic term)",sinCosFlag[sc].Data(),nonisotropicTermFlag[ci-1].Data())<<endl; | |
489d5531 | 10201 | } |
10202 | Double_t statisticalError = termA * spread * termB; | |
489d5531 | 10203 | fIntFlowCorrectionTermsForNUAHist[sc]->SetBinContent(ci,correction); |
0328db2d | 10204 | fIntFlowCorrectionTermsForNUAHist[sc]->SetBinError(ci,statisticalError); |
b92ea2b9 | 10205 | } // end of for(Int_t ci=1;ci<=4;ci++) // correction term index |
489d5531 | 10206 | } // end of for(Int sc=0;sc<2;sc++) // sin or cos correction terms |
10207 | ||
10208 | } // end of void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUAIntFlow() | |
10209 | ||
489d5531 | 10210 | //================================================================================================================================ |
10211 | ||
489d5531 | 10212 | void AliFlowAnalysisWithQCumulants::GetPointersForNestedLoopsHistograms() |
10213 | { | |
10214 | // Get pointers to all objects relevant for calculations with nested loops. | |
10215 | ||
10216 | TList *nestedLoopsList = dynamic_cast<TList*>(fHistList->FindObject("Nested Loops")); | |
10217 | if(nestedLoopsList) | |
10218 | { | |
10219 | this->SetNestedLoopsList(nestedLoopsList); | |
10220 | } else | |
10221 | { | |
10222 | cout<<"WARNING: nestedLoopsList is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
10223 | exit(0); | |
10224 | } | |
10225 | ||
10226 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?) | |
10227 | TString typeFlag[2] = {"RP","POI"}; // to be improved (should I promote this to data members?) | |
10228 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; // to be improved (should I promote this to data members?) | |
10229 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; // to be improved (should I promote this to data members?) | |
10230 | ||
10231 | TString evaluateNestedLoopsName = "fEvaluateNestedLoops"; | |
10232 | evaluateNestedLoopsName += fAnalysisLabel->Data(); | |
10233 | TProfile *evaluateNestedLoops = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(evaluateNestedLoopsName.Data())); | |
10234 | Bool_t bEvaluateIntFlowNestedLoops = kFALSE; | |
10235 | Bool_t bEvaluateDiffFlowNestedLoops = kFALSE; | |
10236 | if(evaluateNestedLoops) | |
10237 | { | |
10238 | this->SetEvaluateNestedLoops(evaluateNestedLoops); | |
10239 | bEvaluateIntFlowNestedLoops = (Int_t)evaluateNestedLoops->GetBinContent(1); | |
10240 | bEvaluateDiffFlowNestedLoops = (Int_t)evaluateNestedLoops->GetBinContent(2); | |
10241 | } | |
10242 | // nested loops relevant for integrated flow: | |
10243 | if(bEvaluateIntFlowNestedLoops) | |
10244 | { | |
10245 | // correlations: | |
10246 | TString intFlowDirectCorrelationsName = "fIntFlowDirectCorrelations"; | |
10247 | intFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
10248 | TProfile *intFlowDirectCorrelations = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(intFlowDirectCorrelationsName.Data())); | |
10249 | if(intFlowDirectCorrelations) | |
10250 | { | |
10251 | this->SetIntFlowDirectCorrelations(intFlowDirectCorrelations); | |
10252 | } else | |
10253 | { | |
10254 | cout<<"WARNING: intFlowDirectCorrelations is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
10255 | exit(0); | |
10256 | } | |
403e3389 | 10257 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 10258 | { |
10259 | TString intFlowExtraDirectCorrelationsName = "fIntFlowExtraDirectCorrelations"; | |
10260 | intFlowExtraDirectCorrelationsName += fAnalysisLabel->Data(); | |
10261 | TProfile *intFlowExtraDirectCorrelations = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(intFlowExtraDirectCorrelationsName.Data())); | |
10262 | if(intFlowExtraDirectCorrelations) | |
10263 | { | |
10264 | this->SetIntFlowExtraDirectCorrelations(intFlowExtraDirectCorrelations); | |
10265 | } else | |
10266 | { | |
10267 | cout<<"WARNING: intFlowExtraDirectCorrelations is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
10268 | exit(0); | |
10269 | } | |
403e3389 | 10270 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 10271 | // correction terms for non-uniform acceptance: |
10272 | TString intFlowDirectCorrectionTermsForNUAName = "fIntFlowDirectCorrectionTermsForNUA"; | |
10273 | intFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
10274 | TProfile *intFlowDirectCorrectionTermsForNUA[2] = {NULL}; | |
10275 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
10276 | { | |
10277 | intFlowDirectCorrectionTermsForNUA[sc] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s: %s terms",intFlowDirectCorrectionTermsForNUAName.Data(),sinCosFlag[sc].Data()))); | |
10278 | if(intFlowDirectCorrectionTermsForNUA[sc]) | |
10279 | { | |
10280 | this->SetIntFlowDirectCorrectionTermsForNUA(intFlowDirectCorrectionTermsForNUA[sc],sc); | |
10281 | } else | |
10282 | { | |
10283 | cout<<"WARNING: intFlowDirectCorrectionTermsForNUA[sc] is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
10284 | cout<<"sc = "<<sc<<endl; | |
10285 | exit(0); | |
10286 | } | |
10287 | } // end of for(Int_t sc=0;sc<2;sc++) | |
10288 | } // end of if(bEvaluateIntFlowNestedLoops) | |
10289 | ||
10290 | // nested loops relevant for differential flow: | |
10291 | if(bEvaluateDiffFlowNestedLoops) | |
10292 | { | |
10293 | // correlations: | |
10294 | TString diffFlowDirectCorrelationsName = "fDiffFlowDirectCorrelations"; | |
10295 | diffFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
10296 | TProfile *diffFlowDirectCorrelations[2][2][4] = {{{NULL}}}; | |
10297 | for(Int_t t=0;t<2;t++) | |
10298 | { | |
10299 | for(Int_t pe=0;pe<2;pe++) | |
10300 | { | |
10301 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
10302 | { | |
10303 | diffFlowDirectCorrelations[t][pe][ci] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[ci].Data()))); | |
10304 | if(diffFlowDirectCorrelations[t][pe][ci]) | |
10305 | { | |
10306 | this->SetDiffFlowDirectCorrelations(diffFlowDirectCorrelations[t][pe][ci],t,pe,ci); | |
10307 | } else | |
10308 | { | |
10309 | cout<<"WARNING: diffFlowDirectCorrelations[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
10310 | cout<<"t = "<<t<<endl; | |
10311 | cout<<"pe = "<<pe<<endl; | |
10312 | cout<<"ci = "<<ci<<endl; | |
10313 | } | |
10314 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
10315 | } // end of for(Int_t pe=0;pe<2;pe++) | |
10316 | } // end of for(Int_t t=0;t<2;t++) | |
10317 | // correction terms for non-uniform acceptance: | |
10318 | TString diffFlowDirectCorrectionTermsForNUAName = "fDiffFlowDirectCorrectionTermsForNUA"; | |
10319 | diffFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
10320 | TProfile *diffFlowDirectCorrectionTermsForNUA[2][2][2][10] = {{{{NULL}}}}; | |
10321 | for(Int_t t=0;t<2;t++) | |
10322 | { | |
10323 | for(Int_t pe=0;pe<2;pe++) | |
10324 | { | |
10325 | // correction terms for NUA: | |
10326 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
10327 | { | |
10328 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
10329 | { | |
10330 | diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1))); | |
10331 | if(diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]) | |
10332 | { | |
10333 | this->SetDiffFlowDirectCorrectionTermsForNUA(diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti],t,pe,sc,cti); | |
10334 | } else | |
10335 | { | |
10336 | cout<<"WARNING: diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
10337 | cout<<"t = "<<t<<endl; | |
10338 | cout<<"pe = "<<pe<<endl; | |
10339 | cout<<"sc = "<<sc<<endl; | |
10340 | cout<<"cti = "<<cti<<endl; | |
10341 | } | |
10342 | } // end of for(Int_t cti=0;cti<9;cti++) // correction term index | |
10343 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
10344 | } // end of for(Int_t pe=0;pe<2;pe++) | |
10345 | } // end of for(Int_t t=0;t<2;t++) | |
64e500e3 | 10346 | // other differential correlators: |
10347 | TString otherDirectDiffCorrelatorsName = "fOtherDirectDiffCorrelators"; | |
10348 | otherDirectDiffCorrelatorsName += fAnalysisLabel->Data(); | |
10349 | TProfile *otherDirectDiffCorrelators[2][2][2][1] = {{{{NULL}}}}; | |
10350 | for(Int_t t=0;t<2;t++) | |
10351 | { | |
10352 | for(Int_t pe=0;pe<2;pe++) | |
10353 | { | |
10354 | // correction terms for NUA: | |
10355 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
10356 | { | |
10357 | for(Int_t ci=0;ci<1;ci++) // correlator index | |
10358 | { | |
10359 | otherDirectDiffCorrelators[t][pe][sc][ci] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s, ci = %d",otherDirectDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1))); | |
10360 | if(otherDirectDiffCorrelators[t][pe][sc][ci]) | |
10361 | { | |
10362 | this->SetOtherDirectDiffCorrelators(otherDirectDiffCorrelators[t][pe][sc][ci],t,pe,sc,ci); | |
10363 | } else | |
10364 | { | |
10365 | cout<<"WARNING: otherDirectDiffCorrelators[t][pe][sc][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
10366 | cout<<"t = "<<t<<endl; | |
10367 | cout<<"pe = "<<pe<<endl; | |
10368 | cout<<"sc = "<<sc<<endl; | |
10369 | cout<<"ci = "<<ci<<endl; | |
10370 | } | |
10371 | } // end of for(Int_t ci=0;ci<9;ci++) // correction term index | |
10372 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
10373 | } // end of for(Int_t pe=0;pe<2;pe++) | |
10374 | } // end of for(Int_t t=0;t<2;t++) | |
489d5531 | 10375 | // number of RPs and POIs in selected pt and eta bins for cross-checkings: |
10376 | TString noOfParticlesInBinName = "fNoOfParticlesInBin"; | |
10377 | TH1D *noOfParticlesInBin = NULL; | |
10378 | noOfParticlesInBin = dynamic_cast<TH1D*>(nestedLoopsList->FindObject(noOfParticlesInBinName.Data())); | |
10379 | if(noOfParticlesInBin) | |
10380 | { | |
10381 | this->SetNoOfParticlesInBin(noOfParticlesInBin); | |
10382 | } else | |
10383 | { | |
10384 | cout<<endl; | |
10385 | cout<<" WARNING (QC): noOfParticlesInBin is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
10386 | cout<<endl; | |
10387 | } | |
10388 | } // end of if(bEvaluateDiffFlowNestedLoops) | |
10389 | ||
10390 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForNestedLoopsHistograms() | |
10391 | ||
489d5531 | 10392 | //================================================================================================================================ |
10393 | ||
489d5531 | 10394 | void AliFlowAnalysisWithQCumulants::StoreHarmonic() |
10395 | { | |
10396 | // Store flow harmonic in common control histograms. | |
10397 | ||
10398 | (fCommonHists->GetHarmonic())->Fill(0.5,fHarmonic); | |
dd442cd2 | 10399 | if(fFillMultipleControlHistograms) |
10400 | { | |
10401 | (fCommonHists2nd->GetHarmonic())->Fill(0.5,fHarmonic); | |
10402 | (fCommonHists4th->GetHarmonic())->Fill(0.5,fHarmonic); | |
10403 | (fCommonHists6th->GetHarmonic())->Fill(0.5,fHarmonic); | |
10404 | (fCommonHists8th->GetHarmonic())->Fill(0.5,fHarmonic); | |
10405 | } | |
10406 | ||
489d5531 | 10407 | } // end of void AliFlowAnalysisWithQCumulants::StoreHarmonic() |
10408 | ||
489d5531 | 10409 | //================================================================================================================================ |
10410 | ||
489d5531 | 10411 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelationsUsingParticleWeights(TString type, TString ptOrEta) // type = RP or POI |
10412 | { | |
10413 | // Calculate all correlations needed for differential flow using particle weights. | |
10414 | ||
2a98ceb8 | 10415 | Int_t t = 0; // type flag |
10416 | Int_t pe = 0; // ptEta flag | |
489d5531 | 10417 | |
10418 | if(type == "RP") | |
10419 | { | |
10420 | t = 0; | |
10421 | } else if(type == "POI") | |
10422 | { | |
10423 | t = 1; | |
10424 | } | |
10425 | ||
10426 | if(ptOrEta == "Pt") | |
10427 | { | |
10428 | pe = 0; | |
10429 | } else if(ptOrEta == "Eta") | |
10430 | { | |
10431 | pe = 1; | |
10432 | } | |
10433 | ||
10434 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
10435 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
10436 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
10437 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
10438 | ||
10439 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
10440 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
10441 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
10442 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
10443 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
10444 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
10445 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
10446 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
10447 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
10448 | ||
1268c371 | 10449 | // S^M_{p,k} (see .h file for the definition of fSpk): |
10450 | Double_t dSM1p1k = (*fSpk)(0,1); | |
10451 | Double_t dSM1p2k = (*fSpk)(0,2); | |
10452 | Double_t dSM1p3k = (*fSpk)(0,3); | |
10453 | Double_t dSM2p1k = (*fSpk)(1,1); | |
10454 | Double_t dSM3p1k = (*fSpk)(2,1); | |
489d5531 | 10455 | |
10456 | // looping over all bins and calculating reduced correlations: | |
10457 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10458 | { | |
10459 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): | |
10460 | Double_t p1n0kRe = 0.; | |
10461 | Double_t p1n0kIm = 0.; | |
10462 | ||
10463 | // number of POIs in particular (pt,eta) bin): | |
10464 | Double_t mp = 0.; | |
10465 | ||
10466 | // real and imaginary parts of q_{m*n,k}: | |
10467 | // (weighted Q-vector evaluated for particles which are both RPs and POIs in particular (pt,eta) bin) | |
10468 | Double_t q1n2kRe = 0.; | |
10469 | Double_t q1n2kIm = 0.; | |
10470 | Double_t q2n1kRe = 0.; | |
10471 | Double_t q2n1kIm = 0.; | |
10472 | ||
10473 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
10474 | Double_t s1p1k = 0.; | |
10475 | Double_t s1p2k = 0.; | |
10476 | Double_t s1p3k = 0.; | |
10477 | ||
10478 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
10479 | Double_t dM0111 = 0.; | |
10480 | ||
10481 | if(type == "POI") | |
10482 | { | |
10483 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
10484 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
10485 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
10486 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
10487 | ||
10488 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10489 | ||
10490 | t = 1; // typeFlag = RP or POI | |
10491 | ||
10492 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
10493 | q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
10494 | * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
10495 | q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
10496 | * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
10497 | q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
10498 | * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
10499 | q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
10500 | * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
10501 | ||
10502 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
10503 | s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); | |
10504 | s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); | |
10505 | s1p3k = pow(fs1dEBE[2][pe][3]->GetBinContent(b)*fs1dEBE[2][pe][3]->GetBinEntries(b),1.); | |
10506 | ||
10507 | // M0111 from Eq. (118) in QC2c (to be improved (notation)): | |
10508 | dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k) | |
10509 | - 3.*(s1p1k*(dSM2p1k-dSM1p2k) | |
10510 | + 2.*(s1p3k-s1p2k*dSM1p1k)); | |
10511 | } | |
10512 | else if(type == "RP") | |
10513 | { | |
10514 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
10515 | q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
10516 | * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
10517 | q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
10518 | * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
10519 | q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
10520 | * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
10521 | q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
10522 | * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
10523 | ||
10524 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
10525 | s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); | |
10526 | s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); | |
10527 | s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); | |
10528 | ||
10529 | // to be improved (cross-checked): | |
10530 | p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
10531 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
10532 | p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
10533 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
10534 | ||
10535 | mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10536 | ||
10537 | t = 0; // typeFlag = RP or POI | |
10538 | ||
10539 | // M0111 from Eq. (118) in QC2c (to be improved (notation)): | |
10540 | dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k) | |
10541 | - 3.*(s1p1k*(dSM2p1k-dSM1p2k) | |
10542 | + 2.*(s1p3k-s1p2k*dSM1p1k)); | |
10543 | //............................................................................................... | |
10544 | } | |
10545 | ||
10546 | // 2'-particle correlation: | |
10547 | Double_t two1n1nW0W1 = 0.; | |
10548 | if(mp*dSM1p1k-s1p1k) | |
10549 | { | |
10550 | two1n1nW0W1 = (p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k-s1p1k) | |
10551 | / (mp*dSM1p1k-s1p1k); | |
10552 | ||
10553 | // fill profile to get <<2'>> | |
b40a910e | 10554 | fDiffFlowCorrelationsPro[t][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nW0W1,mp*dSM1p1k-s1p1k); |
10555 | // fill profile to get <<2'>^2> | |
10556 | fDiffFlowSquaredCorrelationsPro[t][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nW0W1*two1n1nW0W1,mp*dSM1p1k-s1p1k); | |
489d5531 | 10557 | // histogram to store <2'> e-b-e (needed in some other methods): |
10558 | fDiffFlowCorrelationsEBE[t][pe][0]->SetBinContent(b,two1n1nW0W1); | |
10559 | fDiffFlowEventWeightsForCorrelationsEBE[t][pe][0]->SetBinContent(b,mp*dSM1p1k-s1p1k); | |
10560 | } // end of if(mp*dSM1p1k-s1p1k) | |
10561 | ||
10562 | // 4'-particle correlation: | |
10563 | Double_t four1n1n1n1nW0W1W1W1 = 0.; | |
10564 | if(dM0111) | |
10565 | { | |
10566 | four1n1n1n1nW0W1W1W1 = ((pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k) | |
10567 | - q2n1kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.)) | |
10568 | - 2.*q2n1kIm*dReQ1n1k*dImQ1n1k | |
10569 | - p1n0kRe*(dReQ1n1k*dReQ2n2k+dImQ1n1k*dImQ2n2k) | |
10570 | + p1n0kIm*(dImQ1n1k*dReQ2n2k-dReQ1n1k*dImQ2n2k) | |
10571 | - 2.*dSM1p2k*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k) | |
10572 | - 2.*(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*s1p1k | |
10573 | + 6.*(q1n2kRe*dReQ1n1k+q1n2kIm*dImQ1n1k) | |
10574 | + 1.*(q2n1kRe*dReQ2n2k+q2n1kIm*dImQ2n2k) | |
10575 | + 2.*(p1n0kRe*dReQ1n3k+p1n0kIm*dImQ1n3k) | |
10576 | + 2.*s1p1k*dSM1p2k | |
10577 | - 6.*s1p3k) | |
10578 | / dM0111; // to be improved (notation of dM0111) | |
10579 | ||
10580 | // fill profile to get <<4'>> | |
b40a910e | 10581 | fDiffFlowCorrelationsPro[t][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nW0W1W1W1,dM0111); |
10582 | // fill profile to get <<4'>^2> | |
10583 | fDiffFlowSquaredCorrelationsPro[t][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nW0W1W1W1*four1n1n1n1nW0W1W1W1,dM0111); | |
489d5531 | 10584 | // histogram to store <4'> e-b-e (needed in some other methods): |
10585 | fDiffFlowCorrelationsEBE[t][pe][1]->SetBinContent(b,four1n1n1n1nW0W1W1W1); | |
10586 | fDiffFlowEventWeightsForCorrelationsEBE[t][pe][1]->SetBinContent(b,dM0111); | |
10587 | } // end of if(dM0111) | |
10588 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10589 | ||
10590 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelationsUsingParticleWeights(TString type, TString ptOrEta); // type = RP or POI | |
10591 | ||
489d5531 | 10592 | //================================================================================================================================ |
10593 | ||
489d5531 | 10594 | void AliFlowAnalysisWithQCumulants::FillCommonControlHistograms(AliFlowEventSimple *anEvent) |
10595 | { | |
10596 | // Fill common control histograms. | |
10597 | ||
10598 | Int_t nRP = anEvent->GetEventNSelTracksRP(); // number of RPs (i.e. number of particles used to determine the reaction plane) | |
10599 | fCommonHists->FillControlHistograms(anEvent); | |
dd442cd2 | 10600 | if(fFillMultipleControlHistograms) |
489d5531 | 10601 | { |
dd442cd2 | 10602 | if(nRP>1) |
489d5531 | 10603 | { |
dd442cd2 | 10604 | fCommonHists2nd->FillControlHistograms(anEvent); |
10605 | if(nRP>3) | |
489d5531 | 10606 | { |
dd442cd2 | 10607 | fCommonHists4th->FillControlHistograms(anEvent); |
10608 | if(nRP>5) | |
489d5531 | 10609 | { |
dd442cd2 | 10610 | fCommonHists6th->FillControlHistograms(anEvent); |
10611 | if(nRP>7) | |
10612 | { | |
10613 | fCommonHists8th->FillControlHistograms(anEvent); | |
10614 | } // end of if(nRP>7) | |
10615 | } // end of if(nRP>5) | |
10616 | } // end of if(nRP>3) | |
10617 | } // end of if(nRP>1) | |
10618 | } // end of if(fFillMultipleControlHistograms) | |
489d5531 | 10619 | |
10620 | } // end of void AliFlowAnalysisWithQCumulants::FillCommonControlHistograms(AliFlowEventSimple *anEvent) | |
10621 | ||
489d5531 | 10622 | //================================================================================================================================ |
10623 | ||
489d5531 | 10624 | void AliFlowAnalysisWithQCumulants::ResetEventByEventQuantities() |
10625 | { | |
10626 | // Reset all event by event quantities. | |
10627 | ||
1268c371 | 10628 | // Reference flow: |
489d5531 | 10629 | fReQ->Zero(); |
10630 | fImQ->Zero(); | |
1268c371 | 10631 | fSpk->Zero(); |
489d5531 | 10632 | fIntFlowCorrelationsEBE->Reset(); |
10633 | fIntFlowEventWeightsForCorrelationsEBE->Reset(); | |
10634 | fIntFlowCorrelationsAllEBE->Reset(); | |
10635 | ||
b92ea2b9 | 10636 | for(Int_t sc=0;sc<2;sc++) |
489d5531 | 10637 | { |
b92ea2b9 | 10638 | fIntFlowCorrectionTermsForNUAEBE[sc]->Reset(); |
10639 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc]->Reset(); | |
489d5531 | 10640 | } |
10641 | ||
1268c371 | 10642 | // Differential flow: |
10643 | if(fCalculateDiffFlow) | |
489d5531 | 10644 | { |
1268c371 | 10645 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) |
489d5531 | 10646 | { |
1268c371 | 10647 | for(Int_t pe=0;pe<2;pe++) // 1D in pt or eta |
489d5531 | 10648 | { |
1268c371 | 10649 | for(Int_t m=0;m<4;m++) // multiple of harmonic |
489d5531 | 10650 | { |
1268c371 | 10651 | for(Int_t k=0;k<9;k++) // power of weight |
10652 | { | |
10653 | if(fReRPQ1dEBE[t][pe][m][k]) fReRPQ1dEBE[t][pe][m][k]->Reset(); | |
10654 | if(fImRPQ1dEBE[t][pe][m][k]) fImRPQ1dEBE[t][pe][m][k]->Reset(); | |
10655 | } | |
10656 | } | |
489d5531 | 10657 | } |
1268c371 | 10658 | } |
10659 | for(Int_t t=0;t<3;t++) // type (0 = RP, 1 = POI, 2 = RP&&POI ) | |
10660 | { | |
10661 | for(Int_t pe=0;pe<2;pe++) // 1D in pt or eta | |
489d5531 | 10662 | { |
1268c371 | 10663 | for(Int_t k=0;k<9;k++) |
10664 | { | |
10665 | if(fs1dEBE[t][pe][k]) fs1dEBE[t][pe][k]->Reset(); | |
10666 | } | |
489d5531 | 10667 | } |
10668 | } | |
1268c371 | 10669 | // e-b-e reduced correlations: |
10670 | for(Int_t t=0;t<2;t++) // type (0 = RP, 1 = POI) | |
10671 | { | |
10672 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
489d5531 | 10673 | { |
1268c371 | 10674 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index |
10675 | { | |
10676 | if(fDiffFlowCorrelationsEBE[t][pe][rci]) fDiffFlowCorrelationsEBE[t][pe][rci]->Reset(); | |
10677 | if(fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci]) fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci]->Reset(); | |
10678 | } | |
489d5531 | 10679 | } |
1268c371 | 10680 | } |
10681 | // correction terms for NUA: | |
10682 | for(Int_t t=0;t<2;t++) // type (0 = RP, 1 = POI) | |
10683 | { | |
10684 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
489d5531 | 10685 | { |
1268c371 | 10686 | for(Int_t sc=0;sc<2;sc++) // sin or cos |
489d5531 | 10687 | { |
1268c371 | 10688 | for(Int_t cti=0;cti<9;cti++) // correction term index |
10689 | { | |
489d5531 | 10690 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti]->Reset(); |
1268c371 | 10691 | } |
489d5531 | 10692 | } |
1268c371 | 10693 | } |
10694 | } | |
10695 | } // end of if(fCalculateDiffFlow) | |
10696 | ||
489d5531 | 10697 | // 2D (pt,eta) |
1268c371 | 10698 | if(fCalculate2DDiffFlow) |
489d5531 | 10699 | { |
10700 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
10701 | { | |
10702 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
10703 | { | |
10704 | for(Int_t k=0;k<9;k++) // power of weight | |
10705 | { | |
b77b6434 | 10706 | if(fReRPQ2dEBE[t][m][k]){fReRPQ2dEBE[t][m][k]->Reset();} |
10707 | if(fImRPQ2dEBE[t][m][k]){fImRPQ2dEBE[t][m][k]->Reset();} | |
489d5531 | 10708 | } |
10709 | } | |
10710 | } | |
10711 | for(Int_t t=0;t<3;t++) // type (0 = RP, 1 = POI, 2 = RP&&POI ) | |
10712 | { | |
10713 | for(Int_t k=0;k<9;k++) | |
10714 | { | |
b77b6434 | 10715 | if(fs2dEBE[t][k]){fs2dEBE[t][k]->Reset();} |
489d5531 | 10716 | } |
10717 | } | |
1268c371 | 10718 | } // end of if(fCalculate2DDiffFlow) |
489d5531 | 10719 | |
10720 | } // end of void AliFlowAnalysisWithQCumulants::ResetEventByEventQuantities(); | |
10721 | ||
489d5531 | 10722 | //================================================================================================================================ |
10723 | ||
489d5531 | 10724 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTerms(TString type, TString ptOrEta) |
10725 | { | |
10726 | // Calculate correction terms for non-uniform acceptance for differential flow (sin terms). | |
10727 | ||
10728 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][0][cti], where cti runs as follows: | |
10729 | // 0: <<sin n(psi1)>> | |
10730 | // 1: <<sin n(psi1+phi2)>> | |
10731 | // 2: <<sin n(psi1+phi2-phi3)>> | |
10732 | // 3: <<sin n(psi1-phi2-phi3)>>: | |
10733 | // 4: | |
10734 | // 5: | |
10735 | // 6: | |
10736 | ||
10737 | // multiplicity: | |
1268c371 | 10738 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 10739 | |
10740 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
10741 | Double_t dReQ1n = (*fReQ)(0,0); | |
10742 | Double_t dReQ2n = (*fReQ)(1,0); | |
10743 | //Double_t dReQ3n = (*fReQ)(2,0); | |
10744 | //Double_t dReQ4n = (*fReQ)(3,0); | |
10745 | Double_t dImQ1n = (*fImQ)(0,0); | |
10746 | Double_t dImQ2n = (*fImQ)(1,0); | |
10747 | //Double_t dImQ3n = (*fImQ)(2,0); | |
10748 | //Double_t dImQ4n = (*fImQ)(3,0); | |
10749 | ||
2a98ceb8 | 10750 | Int_t t = 0; // type flag |
10751 | Int_t pe = 0; // ptEta flag | |
489d5531 | 10752 | |
10753 | if(type == "RP") | |
10754 | { | |
10755 | t = 0; | |
10756 | } else if(type == "POI") | |
10757 | { | |
10758 | t = 1; | |
10759 | } | |
10760 | ||
10761 | if(ptOrEta == "Pt") | |
10762 | { | |
10763 | pe = 0; | |
10764 | } else if(ptOrEta == "Eta") | |
10765 | { | |
10766 | pe = 1; | |
10767 | } | |
10768 | ||
10769 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
10770 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
10771 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
10772 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
10773 | ||
10774 | // looping over all bins and calculating correction terms: | |
10775 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10776 | { | |
10777 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
10778 | Double_t p1n0kRe = 0.; | |
10779 | Double_t p1n0kIm = 0.; | |
10780 | ||
10781 | // number of POIs in particular pt or eta bin: | |
10782 | Double_t mp = 0.; | |
10783 | ||
10784 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
10785 | Double_t q1n0kRe = 0.; | |
10786 | Double_t q1n0kIm = 0.; | |
10787 | Double_t q2n0kRe = 0.; | |
10788 | Double_t q2n0kIm = 0.; | |
10789 | ||
10790 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
10791 | Double_t mq = 0.; | |
10792 | ||
10793 | if(type == "POI") | |
10794 | { | |
10795 | // q_{m*n,0}: | |
10796 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
10797 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
10798 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
10799 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
10800 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
10801 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
10802 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
10803 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
10804 | ||
10805 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10806 | } | |
10807 | else if(type == "RP") | |
10808 | { | |
10809 | // q_{m*n,0}: | |
10810 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
10811 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
10812 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
10813 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
10814 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
10815 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
10816 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
10817 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
10818 | ||
10819 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10820 | } | |
10821 | if(type == "POI") | |
10822 | { | |
10823 | // p_{m*n,0}: | |
10824 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
10825 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
10826 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
10827 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
10828 | ||
10829 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10830 | ||
10831 | t = 1; // typeFlag = RP or POI | |
10832 | } | |
10833 | else if(type == "RP") | |
10834 | { | |
10835 | // p_{m*n,0} = q_{m*n,0}: | |
10836 | p1n0kRe = q1n0kRe; | |
10837 | p1n0kIm = q1n0kIm; | |
10838 | ||
10839 | mp = mq; | |
10840 | ||
10841 | t = 0; // typeFlag = RP or POI | |
10842 | } | |
10843 | ||
10844 | // <<sin n(psi1)>>: | |
10845 | Double_t sinP1nPsi = 0.; | |
10846 | if(mp) | |
10847 | { | |
10848 | sinP1nPsi = p1n0kIm/mp; | |
10849 | // fill profile for <<sin n(psi1)>>: | |
10850 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi,mp); | |
10851 | // histogram to store <sin n(psi1)> e-b-e (needed in some other methods): | |
10852 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][0]->SetBinContent(b,sinP1nPsi); | |
10853 | } // end of if(mp) | |
10854 | ||
10855 | // <<sin n(psi1+phi2)>>: | |
10856 | Double_t sinP1nPsiP1nPhi = 0.; | |
10857 | if(mp*dMult-mq) | |
10858 | { | |
10859 | sinP1nPsiP1nPhi = (p1n0kRe*dImQ1n+p1n0kIm*dReQ1n-q2n0kIm)/(mp*dMult-mq); | |
10860 | // fill profile for <<sin n(psi1+phi2)>>: | |
10861 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsiP1nPhi,mp*dMult-mq); | |
10862 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
10863 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][1]->SetBinContent(b,sinP1nPsiP1nPhi); | |
10864 | } // end of if(mp*dMult-mq) | |
10865 | ||
10866 | // <<sin n(psi1+phi2-phi3)>>: | |
10867 | Double_t sinP1nPsi1P1nPhi2MPhi3 = 0.; | |
10868 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
10869 | { | |
10870 | sinP1nPsi1P1nPhi2MPhi3 = (p1n0kIm*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult) | |
10871 | - 1.*(q2n0kIm*dReQ1n-q2n0kRe*dImQ1n) | |
10872 | - mq*dImQ1n+2.*q1n0kIm) | |
10873 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
10874 | // fill profile for <<sin n(psi1+phi2)>>: | |
10875 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
10876 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
10877 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][2]->SetBinContent(b,sinP1nPsi1P1nPhi2MPhi3); | |
10878 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
10879 | ||
10880 | // <<sin n(psi1-phi2-phi3)>>: | |
10881 | Double_t sinP1nPsi1M1nPhi2MPhi3 = 0.; | |
10882 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
10883 | { | |
10884 | sinP1nPsi1M1nPhi2MPhi3 = (p1n0kIm*(pow(dReQ1n,2.)-pow(dImQ1n,2.))-2.*p1n0kRe*dReQ1n*dImQ1n | |
10885 | - 1.*(p1n0kIm*dReQ2n-p1n0kRe*dImQ2n) | |
10886 | + 2.*mq*dImQ1n-2.*q1n0kIm) | |
10887 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
10888 | // fill profile for <<sin n(psi1+phi2)>>: | |
10889 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
10890 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
10891 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][3]->SetBinContent(b,sinP1nPsi1M1nPhi2MPhi3); | |
10892 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
10893 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10894 | ||
10895 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTerms(TString type, TString ptOrEta) | |
10896 | ||
10897 | ||
10898 | //================================================================================================================================ | |
10899 | ||
10900 | ||
10901 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTerms(TString type, TString ptOrEta) | |
10902 | { | |
10903 | // Calculate correction terms for non-uniform acceptance for differential flow (cos terms). | |
10904 | ||
10905 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][1][cti], where cti runs as follows: | |
10906 | // 0: <<cos n(psi)>> | |
10907 | // 1: <<cos n(psi1+phi2)>> | |
10908 | // 2: <<cos n(psi1+phi2-phi3)>> | |
10909 | // 3: <<cos n(psi1-phi2-phi3)>> | |
10910 | // 4: | |
10911 | // 5: | |
10912 | // 6: | |
10913 | ||
10914 | // multiplicity: | |
1268c371 | 10915 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 10916 | |
10917 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
10918 | Double_t dReQ1n = (*fReQ)(0,0); | |
10919 | Double_t dReQ2n = (*fReQ)(1,0); | |
10920 | //Double_t dReQ3n = (*fReQ)(2,0); | |
10921 | //Double_t dReQ4n = (*fReQ)(3,0); | |
10922 | Double_t dImQ1n = (*fImQ)(0,0); | |
10923 | Double_t dImQ2n = (*fImQ)(1,0); | |
10924 | //Double_t dImQ3n = (*fImQ)(2,0); | |
10925 | //Double_t dImQ4n = (*fImQ)(3,0); | |
10926 | ||
2a98ceb8 | 10927 | Int_t t = 0; // type flag |
10928 | Int_t pe = 0; // ptEta flag | |
489d5531 | 10929 | |
10930 | if(type == "RP") | |
10931 | { | |
10932 | t = 0; | |
10933 | } else if(type == "POI") | |
10934 | { | |
10935 | t = 1; | |
10936 | } | |
10937 | ||
10938 | if(ptOrEta == "Pt") | |
10939 | { | |
10940 | pe = 0; | |
10941 | } else if(ptOrEta == "Eta") | |
10942 | { | |
10943 | pe = 1; | |
10944 | } | |
10945 | ||
10946 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
10947 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
10948 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
10949 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
10950 | ||
10951 | // looping over all bins and calculating correction terms: | |
10952 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10953 | { | |
10954 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
10955 | Double_t p1n0kRe = 0.; | |
10956 | Double_t p1n0kIm = 0.; | |
10957 | ||
10958 | // number of POIs in particular pt or eta bin: | |
10959 | Double_t mp = 0.; | |
10960 | ||
10961 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
10962 | Double_t q1n0kRe = 0.; | |
10963 | Double_t q1n0kIm = 0.; | |
10964 | Double_t q2n0kRe = 0.; | |
10965 | Double_t q2n0kIm = 0.; | |
10966 | ||
10967 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
10968 | Double_t mq = 0.; | |
10969 | ||
10970 | if(type == "POI") | |
10971 | { | |
10972 | // q_{m*n,0}: | |
10973 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
10974 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
10975 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
10976 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
10977 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
10978 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
10979 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
10980 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
10981 | ||
10982 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10983 | } | |
10984 | else if(type == "RP") | |
10985 | { | |
10986 | // q_{m*n,0}: | |
10987 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
10988 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
10989 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
10990 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
10991 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
10992 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
10993 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
10994 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
10995 | ||
10996 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10997 | } | |
10998 | if(type == "POI") | |
10999 | { | |
11000 | // p_{m*n,0}: | |
11001 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
11002 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
11003 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
11004 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
11005 | ||
11006 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
11007 | ||
11008 | t = 1; // typeFlag = RP or POI | |
11009 | } | |
11010 | else if(type == "RP") | |
11011 | { | |
11012 | // p_{m*n,0} = q_{m*n,0}: | |
11013 | p1n0kRe = q1n0kRe; | |
11014 | p1n0kIm = q1n0kIm; | |
11015 | ||
11016 | mp = mq; | |
11017 | ||
11018 | t = 0; // typeFlag = RP or POI | |
11019 | } | |
11020 | ||
11021 | // <<cos n(psi1)>>: | |
11022 | Double_t cosP1nPsi = 0.; | |
11023 | if(mp) | |
11024 | { | |
11025 | cosP1nPsi = p1n0kRe/mp; | |
11026 | ||
11027 | // fill profile for <<cos n(psi1)>>: | |
11028 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi,mp); | |
11029 | // histogram to store <cos n(psi1)> e-b-e (needed in some other methods): | |
11030 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][0]->SetBinContent(b,cosP1nPsi); | |
11031 | } // end of if(mp) | |
11032 | ||
11033 | // <<cos n(psi1+phi2)>>: | |
11034 | Double_t cosP1nPsiP1nPhi = 0.; | |
11035 | if(mp*dMult-mq) | |
11036 | { | |
11037 | cosP1nPsiP1nPhi = (p1n0kRe*dReQ1n-p1n0kIm*dImQ1n-q2n0kRe)/(mp*dMult-mq); | |
11038 | // fill profile for <<sin n(psi1+phi2)>>: | |
11039 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsiP1nPhi,mp*dMult-mq); | |
11040 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
11041 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][1]->SetBinContent(b,cosP1nPsiP1nPhi); | |
11042 | } // end of if(mp*dMult-mq) | |
11043 | ||
11044 | // <<cos n(psi1+phi2-phi3)>>: | |
11045 | Double_t cosP1nPsi1P1nPhi2MPhi3 = 0.; | |
11046 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
11047 | { | |
11048 | cosP1nPsi1P1nPhi2MPhi3 = (p1n0kRe*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult) | |
11049 | - 1.*(q2n0kRe*dReQ1n+q2n0kIm*dImQ1n) | |
11050 | - mq*dReQ1n+2.*q1n0kRe) | |
11051 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
11052 | // fill profile for <<sin n(psi1+phi2)>>: | |
11053 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
11054 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
11055 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][2]->SetBinContent(b,cosP1nPsi1P1nPhi2MPhi3); | |
11056 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
11057 | ||
11058 | // <<cos n(psi1-phi2-phi3)>>: | |
11059 | Double_t cosP1nPsi1M1nPhi2MPhi3 = 0.; | |
11060 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
11061 | { | |
11062 | cosP1nPsi1M1nPhi2MPhi3 = (p1n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.))+2.*p1n0kIm*dReQ1n*dImQ1n | |
11063 | - 1.*(p1n0kRe*dReQ2n+p1n0kIm*dImQ2n) | |
11064 | - 2.*mq*dReQ1n+2.*q1n0kRe) | |
11065 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
11066 | // fill profile for <<sin n(psi1+phi2)>>: | |
11067 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
11068 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
11069 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][3]->SetBinContent(b,cosP1nPsi1M1nPhi2MPhi3); | |
11070 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
11071 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
11072 | ||
11073 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTerms(TString type, TString ptOrEta) | |
11074 | ||
489d5531 | 11075 | //================================================================================================================================== |
11076 | ||
489d5531 | 11077 | void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUADiffFlow(TString type, TString ptOrEta) |
11078 | { | |
1268c371 | 11079 | // Transfer profiles into histogams and correctly propagate the error. |
489d5531 | 11080 | |
2a98ceb8 | 11081 | Int_t t = 0; // type flag |
11082 | Int_t pe = 0; // ptEta flag | |
489d5531 | 11083 | |
11084 | if(type == "RP") | |
11085 | { | |
11086 | t = 0; | |
11087 | } else if(type == "POI") | |
11088 | { | |
11089 | t = 1; | |
11090 | } | |
11091 | ||
11092 | if(ptOrEta == "Pt") | |
11093 | { | |
11094 | pe = 0; | |
11095 | } else if(ptOrEta == "Eta") | |
11096 | { | |
11097 | pe = 1; | |
11098 | } | |
11099 | ||
11100 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
11101 | //Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
11102 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
11103 | //Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
11104 | ||
11105 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
11106 | { | |
11107 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
11108 | { | |
11109 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
11110 | { | |
11111 | Double_t correctionTerm = fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]->GetBinContent(b); | |
11112 | fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]->SetBinContent(b,correctionTerm); | |
11113 | // to be improved (propagate error correctly) | |
11114 | // ... | |
11115 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
11116 | } // correction term index | |
11117 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
11118 | ||
11119 | }// end of void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUADiffFlow(TString type, TString ptOrEta) | |
11120 | ||
489d5531 | 11121 | //================================================================================================================================== |
11122 | ||
489d5531 | 11123 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta) |
11124 | { | |
1268c371 | 11125 | // Calculate generalized differential flow cumulants (corrected for non-uniform acceptance). |
11126 | ||
11127 | // to be improved - propagate error also from non-isotropic terms | |
489d5531 | 11128 | |
1268c371 | 11129 | Int_t t = 0; // RP = 0, POI = 1 |
11130 | Int_t pe = 0; // pt = 0, eta = 1 | |
489d5531 | 11131 | |
11132 | if(type == "RP") | |
11133 | { | |
1268c371 | 11134 | t = 0; |
489d5531 | 11135 | } else if(type == "POI") |
11136 | { | |
1268c371 | 11137 | t = 1; |
489d5531 | 11138 | } |
11139 | ||
11140 | if(ptOrEta == "Pt") | |
11141 | { | |
1268c371 | 11142 | pe = 0; |
489d5531 | 11143 | } else if(ptOrEta == "Eta") |
11144 | { | |
1268c371 | 11145 | pe = 1; |
489d5531 | 11146 | } |
1268c371 | 11147 | |
11148 | // Common: | |
489d5531 | 11149 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
489d5531 | 11150 | // 2-particle correlation: |
11151 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> | |
1268c371 | 11152 | // sinus terms coming from reference flow: |
489d5531 | 11153 | Double_t sinP1nPhi = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1); // <<sin(n*phi1)>> |
11154 | Double_t sinP1nPhi1P1nPhi2 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2); // <<sin(n*(phi1+phi2))>> | |
11155 | Double_t sinP1nPhi1M1nPhi2M1nPhi3 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(3); // <<sin(n*(phi1-phi2-phi3))>> | |
1268c371 | 11156 | // cosinus terms coming from reference flow: |
489d5531 | 11157 | Double_t cosP1nPhi = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1); // <<cos(n*phi1)>> |
11158 | Double_t cosP1nPhi1P1nPhi2 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2); // <<cos(n*(phi1+phi2))>> | |
11159 | Double_t cosP1nPhi1M1nPhi2M1nPhi3 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(3); // <<cos(n*(phi1-phi2-phi3))>> | |
11160 | ||
11161 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
11162 | { | |
11163 | Double_t twoPrime = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); // <<2'>> | |
11164 | Double_t fourPrime = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); // <<4'>> | |
11165 | Double_t sinP1nPsi = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][0]->GetBinContent(b); // <<sin n(Psi)>> | |
11166 | Double_t cosP1nPsi = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][0]->GetBinContent(b); // <<cos n(Psi)>> | |
11167 | Double_t sinP1nPsi1P1nPhi2 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][1]->GetBinContent(b); // <<sin n(psi1+phi2)>> | |
11168 | Double_t cosP1nPsi1P1nPhi2 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][1]->GetBinContent(b); // <<cos n(psi1+phi2)>> | |
11169 | Double_t sinP1nPsi1P1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][2]->GetBinContent(b); // <<sin n(psi1+phi2-phi3)>> | |
11170 | Double_t cosP1nPsi1P1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][2]->GetBinContent(b); // <<cos n(psi1+phi2-phi3)>> | |
11171 | Double_t sinP1nPsi1M1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][3]->GetBinContent(b); // <<sin n(psi1-phi2-phi3)>> | |
11172 | Double_t cosP1nPsi1M1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][3]->GetBinContent(b); // <<cos n(psi1-phi2-phi3)>> | |
1268c371 | 11173 | // Generalized QC{2'}: |
489d5531 | 11174 | Double_t qc2Prime = twoPrime - sinP1nPsi*sinP1nPhi - cosP1nPsi*cosP1nPhi; |
1268c371 | 11175 | if(fApplyCorrectionForNUA) |
11176 | { | |
11177 | fDiffFlowCumulants[t][pe][0]->SetBinContent(b,qc2Prime); | |
11178 | } | |
11179 | if(TMath::Abs(twoPrime)>0.) | |
11180 | { | |
11181 | fDiffFlowDetectorBias[t][pe][0]->SetBinContent(b,qc2Prime/twoPrime); // detector bias = generalized/isotropic cumulant. | |
11182 | } | |
11183 | // Generalized QC{4'}: | |
489d5531 | 11184 | Double_t qc4Prime = fourPrime-2.*twoPrime*two |
11185 | - cosP1nPsi*cosP1nPhi1M1nPhi2M1nPhi3 | |
11186 | + sinP1nPsi*sinP1nPhi1M1nPhi2M1nPhi3 | |
11187 | - cosP1nPhi*cosP1nPsi1M1nPhi2M1nPhi3 | |
11188 | + sinP1nPhi*sinP1nPsi1M1nPhi2M1nPhi3 | |
11189 | - 2.*cosP1nPhi*cosP1nPsi1P1nPhi2M1nPhi3 | |
11190 | - 2.*sinP1nPhi*sinP1nPsi1P1nPhi2M1nPhi3 | |
11191 | - cosP1nPsi1P1nPhi2*cosP1nPhi1P1nPhi2 | |
11192 | - sinP1nPsi1P1nPhi2*sinP1nPhi1P1nPhi2 | |
11193 | + 2.*cosP1nPhi1P1nPhi2*(cosP1nPsi*cosP1nPhi-sinP1nPsi*sinP1nPhi) | |
11194 | + 2.*sinP1nPhi1P1nPhi2*(cosP1nPsi*sinP1nPhi+sinP1nPsi*cosP1nPhi) | |
11195 | + 4.*two*(cosP1nPsi*cosP1nPhi+sinP1nPsi*sinP1nPhi) | |
11196 | + 2.*cosP1nPsi1P1nPhi2*(pow(cosP1nPhi,2.)-pow(sinP1nPhi,2.)) | |
11197 | + 4.*sinP1nPsi1P1nPhi2*cosP1nPhi*sinP1nPhi | |
11198 | + 4.*twoPrime*(pow(cosP1nPhi,2.)+pow(sinP1nPhi,2.)) | |
11199 | - 6.*(pow(cosP1nPhi,2.)-pow(sinP1nPhi,2.)) | |
11200 | * (cosP1nPsi*cosP1nPhi-sinP1nPsi*sinP1nPhi) | |
11201 | - 12.*cosP1nPhi*sinP1nPhi | |
11202 | * (sinP1nPsi*cosP1nPhi+cosP1nPsi*sinP1nPhi); | |
1268c371 | 11203 | if(fApplyCorrectionForNUA) |
11204 | { | |
11205 | fDiffFlowCumulants[t][pe][1]->SetBinContent(b,qc4Prime); | |
11206 | } | |
11207 | if(TMath::Abs(fourPrime-2.*twoPrime*two)>0.) | |
11208 | { | |
11209 | fDiffFlowDetectorBias[t][pe][1]->SetBinContent(b,qc4Prime/(fourPrime-2.*twoPrime*two)); // detector bias = generalized/isotropic cumulant. | |
11210 | } | |
489d5531 | 11211 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
11212 | ||
11213 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta) | |
11214 | ||
1268c371 | 11215 | //================================================================================================================================== |
489d5531 | 11216 | |
11217 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta) | |
11218 | { | |
11219 | // Calculate differential flow corrected for non-uniform acceptance. | |
11220 | ||
1268c371 | 11221 | // to be improved: eventually I will have to access here masured correlations and NUA terms |
11222 | // instead of cumulants in order to propagate statistical error correctly also | |
11223 | // to NUA terms (propagating errors directly from cumulants is WRONG for | |
11224 | // differential flow becuase that doesn't account at all cross-covariance terms) | |
489d5531 | 11225 | |
1268c371 | 11226 | // REMARK: When NUA correction is apllied error for differential flow DOES NOT get corrected, |
11227 | // i.e. only value is being corrected, error is still the one relevant for isotropic | |
11228 | // case. This eventually will be resolved. | |
11229 | ||
11230 | ||
11231 | Int_t t = 0; // RP or POI | |
11232 | Int_t pe = 0; // pt or eta | |
489d5531 | 11233 | |
11234 | if(type == "RP") | |
11235 | { | |
1268c371 | 11236 | t = 0; |
489d5531 | 11237 | } else if(type == "POI") |
11238 | { | |
1268c371 | 11239 | t = 1; |
11240 | } | |
489d5531 | 11241 | if(ptOrEta == "Pt") |
11242 | { | |
1268c371 | 11243 | pe = 0; |
489d5531 | 11244 | } else if(ptOrEta == "Eta") |
11245 | { | |
1268c371 | 11246 | pe = 1; |
489d5531 | 11247 | } |
11248 | ||
1268c371 | 11249 | // Common: |
489d5531 | 11250 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
1268c371 | 11251 | // Reference Q-cumulants |
11252 | Double_t qc2 = fIntFlowQcumulants->GetBinContent(1); // QC{2} | |
11253 | Double_t qc4 = fIntFlowQcumulants->GetBinContent(2); // QC{4} | |
11254 | // Loop over pt or eta bins: | |
489d5531 | 11255 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) |
11256 | { | |
1268c371 | 11257 | // Differential Q-cumulants: |
11258 | Double_t qc2Prime = fDiffFlowCumulants[t][pe][0]->GetBinContent(b); // QC{2'} | |
11259 | Double_t qc4Prime = fDiffFlowCumulants[t][pe][1]->GetBinContent(b); // QC{4'} | |
489d5531 | 11260 | // v'{2}: |
1268c371 | 11261 | if(qc2>0.) |
489d5531 | 11262 | { |
1268c371 | 11263 | Double_t v2Prime = qc2Prime/pow(qc2,0.5); |
11264 | if(TMath::Abs(v2Prime)>0.){fDiffFlow[t][pe][0]->SetBinContent(b,v2Prime);} | |
489d5531 | 11265 | } |
489d5531 | 11266 | // v'{4}: |
1268c371 | 11267 | if(qc4<0.) |
489d5531 | 11268 | { |
1268c371 | 11269 | Double_t v4Prime = -qc4Prime/pow(-qc4,3./4.); |
11270 | if(TMath::Abs(v4Prime)>0.){fDiffFlow[t][pe][1]->SetBinContent(b,v4Prime);} | |
489d5531 | 11271 | } |
11272 | } // end of for(Int_t b=1;b<=fnBinsPtEta[pe];b++) | |
11273 | ||
11274 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta); | |
11275 | ||
489d5531 | 11276 | //================================================================================================================================== |
11277 | ||
0328db2d | 11278 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoops(AliFlowEventSimple * const anEvent) |
489d5531 | 11279 | { |
11280 | // Evaluate with nested loops multiparticle correlations for integrated flow (without using the particle weights). | |
11281 | ||
11282 | // Remark: Results are stored in profile fIntFlowDirectCorrelations whose binning is organized as follows: | |
11283 | // | |
11284 | // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))> | |
11285 | // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))> | |
11286 | // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))> | |
11287 | // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))> | |
11288 | // 5th bin: ---- EMPTY ---- | |
11289 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))> | |
11290 | // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))> | |
11291 | // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))> | |
11292 | // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))> | |
11293 | // 10th bin: ---- EMPTY ---- | |
11294 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))> | |
11295 | // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))> | |
11296 | // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))> | |
11297 | // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))> | |
11298 | // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))> | |
11299 | // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))> | |
11300 | // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> | |
11301 | // 18th bin: ---- EMPTY ---- | |
11302 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))> | |
11303 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))> | |
11304 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))> | |
11305 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))> | |
11306 | // 23rd bin: ---- EMPTY ---- | |
11307 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> | |
11308 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))> | |
11309 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))> | |
11310 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))> | |
11311 | // 28th bin: ---- EMPTY ---- | |
11312 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> | |
11313 | // 30th bin: ---- EMPTY ---- | |
11314 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> | |
8ed4edc7 | 11315 | // 32nd bin: ---- EMPTY ---- |
b84464d3 | 11316 | // Extra correlations for 3p TY study: |
8ed4edc7 | 11317 | // 33rd bin: <4>_{4n,2n|3n,3n}= four4n2n3n3n = <cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4))> |
b84464d3 | 11318 | // 34th bin: <5>_{3n,3n|2n,2n,2n} = five3n3n2n2n2n = <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-2*phi5))> |
11319 | // Extra correlations for 6p TY study: | |
11320 | // 35th bin: <2>_{5n|5n} = two5n5n = <cos(5n*(phi1-phi2)> T | |
11321 | // 36th bin: <2>_{6n|6n} = two6n6n = <cos(6n*(phi1-phi2)> T | |
11322 | // 37th bin: <3>_{5n|3n,2n} = three5n3n2n = <cos(n*(5*phi1-3*phi2-2*phi3)> | |
11323 | // 38th bin: <3>_{5n|4n,1n} = three5n4n1n = <cos(n*(5*phi1-4*phi2-1*phi3)> | |
11324 | // 39th bin: <3>_{6n|3n,3n} = three6n3n3n = <cos(n*(6*phi1-3*phi2-3*phi3)> T | |
11325 | // 40th bin: <3>_{6n|4n,2n} = three6n4n2n = <cos(n*(6*phi1-4*phi2-2*phi3)> T | |
11326 | // 41st bin: <3>_{6n|5n,1n} = three6n5n1n = <cos(n*(6*phi1-5*phi2-1*phi3)> | |
11327 | // 42nd bin: <4>_{6n|3n,2n,1n} = four6n3n2n1n = <cos(n*(6*phi1-3*phi2-2*phi3-1*phi4)> | |
11328 | // 43rd bin: <4>_{3n,2n|3n,2n} = four3n2n3n2n = <cos(n*(3*phi1+2*phi2-3*phi3-2*phi4)> | |
11329 | // 44th bin: <4>_{4n,1n|3n,2n} = four4n1n3n2n = <cos(n*(4*phi1+1*phi2-3*phi3-2*phi4)> | |
11330 | // 45th bin: <4>_{3n,3n|3n,3n} = four3n3n3n3n = <cos(3.*n*(phi1+phi2-phi3-phi4))> T | |
11331 | // 46th bin: <4>_{4n,2n|3n,3n} = four4n2n3n3n = <cos(n*(4*phi1+2*phi2-3*phi3-3*phi4)> | |
11332 | // 47th bin: <4>_{5n,1n|3n,3n} = four5n1n3n3n = <cos(n*(5*phi1+1*phi2-3*phi3-3*phi4)> | |
11333 | // 48th bin: <4>_{4n,2n|4n,2n} = four4n2n4n2n = <cos(n*(4*phi1+2*phi2-4*phi3-2*phi4)> T | |
11334 | // 49th bin: <4>_{5n,1n|4n,2n} = four5n1n4n2n = <cos(n*(5*phi1+1*phi2-4*phi3-2*phi4)> | |
11335 | // 50th bin: <4>_{5n|3n,1n,1n} = four5n3n1n1n = <cos(n*(5*phi1-3*phi2-1*phi3-1*phi4)> | |
11336 | // 51st bin: <4>_{5n|2n,2n,1n} = four5n2n2n1n = <cos(n*(5*phi1-2*phi2-2*phi3-1*phi4)> | |
11337 | // 52nd bin: <4>_{5n,1n|5n,1n} = four5n1n5n1n = <cos(n*(5*phi1+1*phi2-5*phi3-1*phi4)> | |
11338 | // 53rd bin: <5>_{3n,3n|3n,2n,1n} = four3n3n3n2n1n = <cos(n*(3*phi1+3*phi2-3*phi3-2*phi4-1*phi5)> | |
11339 | // 54th bin: <5>_{4n,2n|3n,2n,1n} = four4n2n3n2n1n = <cos(n*(4*phi1+2*phi2-3*phi3-2*phi4-1*phi5)> | |
11340 | // 55th bin: <5>_{3n,2n|3n,1n,1n} = four3n2n3n1n1n = <cos(n*(3*phi1+2*phi2-3*phi3-1*phi4-1*phi5)> | |
11341 | // 56th bin: <5>_{3n,2n|2n,2n,1n} = four3n2n2n2n1n = <cos(n*(3*phi1+2*phi2-2*phi3-2*phi4-1*phi5)> | |
11342 | // 57th bin: <5>_{5n,1n|3n,2n,1n} = four5n1n3n2n1n = <cos(n*(5*phi1+1*phi2-3*phi3-2*phi4-1*phi5)> | |
11343 | // 58th bin: <6>_{3n,2n,1n|3n,2n,1n} = six3n2n1n3n2n1n = <cos(n*(3*phi1+2*phi2+1*phi3-3*phi4-2*phi5-1*phi6)> | |
8ed4edc7 | 11344 | |
489d5531 | 11345 | Int_t nPrim = anEvent->NumberOfTracks(); |
11346 | AliFlowTrackSimple *aftsTrack = NULL; | |
11347 | Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; | |
11348 | Int_t n = fHarmonic; | |
11349 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 11350 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 11351 | cout<<endl; |
11352 | cout<<"Multiparticle correlations: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
11353 | if(dMult<2) | |
11354 | { | |
11355 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
11356 | } else if (dMult>fMaxAllowedMultiplicity) | |
11357 | { | |
11358 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
11359 | } else | |
11360 | { | |
11361 | cout<<"... evaluating nested loops (without using particle weights)..."<<endl; | |
11362 | } | |
11363 | ||
11364 | // 2-particle correlations: | |
11365 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
11366 | { | |
11367 | for(Int_t i1=0;i1<nPrim;i1++) | |
11368 | { | |
11369 | aftsTrack=anEvent->GetTrack(i1); | |
11370 | if(!(aftsTrack->InRPSelection())) continue; | |
11371 | phi1=aftsTrack->Phi(); | |
11372 | for(Int_t i2=0;i2<nPrim;i2++) | |
11373 | { | |
11374 | if(i2==i1)continue; | |
11375 | aftsTrack=anEvent->GetTrack(i2); | |
11376 | if(!(aftsTrack->InRPSelection())) continue; | |
11377 | phi2=aftsTrack->Phi(); | |
11378 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
11379 | // fill the profile with 2-p correlations: | |
b84464d3 | 11380 | fIntFlowDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),1.); // <cos(n*(phi1-phi2))> |
11381 | fIntFlowDirectCorrelations->Fill(1.5,cos(2.*n*(phi1-phi2)),1.); // <cos(2n*(phi1-phi2))> | |
11382 | fIntFlowDirectCorrelations->Fill(2.5,cos(3.*n*(phi1-phi2)),1.); // <cos(3n*(phi1-phi2))> | |
11383 | fIntFlowDirectCorrelations->Fill(3.5,cos(4.*n*(phi1-phi2)),1.); // <cos(4n*(phi1-phi2))> | |
11384 | fIntFlowDirectCorrelations->Fill(34.5,cos(5.*n*(phi1-phi2)),1.); // <cos(5n*(phi1-phi2))> | |
11385 | fIntFlowDirectCorrelations->Fill(35.5,cos(6.*n*(phi1-phi2)),1.); // <cos(6n*(phi1-phi2))> | |
489d5531 | 11386 | } // end of for(Int_t i2=0;i2<nPrim;i2++) |
11387 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11388 | } // end of if(nPrim>=2) | |
11389 | ||
11390 | // 3-particle correlations: | |
11391 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
11392 | { | |
11393 | for(Int_t i1=0;i1<nPrim;i1++) | |
11394 | { | |
11395 | aftsTrack=anEvent->GetTrack(i1); | |
11396 | if(!(aftsTrack->InRPSelection())) continue; | |
11397 | phi1=aftsTrack->Phi(); | |
11398 | for(Int_t i2=0;i2<nPrim;i2++) | |
11399 | { | |
11400 | if(i2==i1)continue; | |
11401 | aftsTrack=anEvent->GetTrack(i2); | |
11402 | if(!(aftsTrack->InRPSelection())) continue; | |
11403 | phi2=aftsTrack->Phi(); | |
11404 | for(Int_t i3=0;i3<nPrim;i3++) | |
11405 | { | |
11406 | if(i3==i1||i3==i2)continue; | |
11407 | aftsTrack=anEvent->GetTrack(i3); | |
11408 | if(!(aftsTrack->InRPSelection())) continue; | |
11409 | phi3=aftsTrack->Phi(); | |
11410 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
11411 | // fill the profile with 3-p correlations: | |
b84464d3 | 11412 | fIntFlowDirectCorrelations->Fill(5.,cos(2.*n*phi1-n*(phi2+phi3)),1.); //<3>_{2n|nn,n} |
11413 | fIntFlowDirectCorrelations->Fill(6.,cos(3.*n*phi1-2.*n*phi2-n*phi3),1.); //<3>_{3n|2n,n} | |
11414 | fIntFlowDirectCorrelations->Fill(7.,cos(4.*n*phi1-2.*n*phi2-2.*n*phi3),1.); //<3>_{4n|2n,2n} | |
11415 | fIntFlowDirectCorrelations->Fill(8.,cos(4.*n*phi1-3.*n*phi2-n*phi3),1.); //<3>_{4n|3n,n} | |
11416 | fIntFlowDirectCorrelations->Fill(36.5,cos(5.*n*phi1-3.*n*phi2-2.*n*phi3),1.); //<3>_{5n|3n,2n} | |
11417 | fIntFlowDirectCorrelations->Fill(37.5,cos(5.*n*phi1-4.*n*phi2-1.*n*phi3),1.); //<3>_{5n|4n,1n} | |
11418 | fIntFlowDirectCorrelations->Fill(38.5,cos(6.*n*phi1-3.*n*phi2-3.*n*phi3),1.); //<3>_{6n|3n,3n} | |
11419 | fIntFlowDirectCorrelations->Fill(39.5,cos(6.*n*phi1-4.*n*phi2-2.*n*phi3),1.); //<3>_{6n|4n,2n} | |
11420 | fIntFlowDirectCorrelations->Fill(40.5,cos(6.*n*phi1-5.*n*phi2-1.*n*phi3),1.); //<3>_{6n|5n,1n} | |
489d5531 | 11421 | } // end of for(Int_t i3=0;i3<nPrim;i3++) |
11422 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11423 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11424 | } // end of if(nPrim>=3) | |
11425 | ||
11426 | // 4-particle correlations: | |
11427 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) | |
11428 | { | |
11429 | for(Int_t i1=0;i1<nPrim;i1++) | |
11430 | { | |
11431 | aftsTrack=anEvent->GetTrack(i1); | |
11432 | if(!(aftsTrack->InRPSelection())) continue; | |
11433 | phi1=aftsTrack->Phi(); | |
11434 | for(Int_t i2=0;i2<nPrim;i2++) | |
11435 | { | |
11436 | if(i2==i1)continue; | |
11437 | aftsTrack=anEvent->GetTrack(i2); | |
11438 | if(!(aftsTrack->InRPSelection())) continue; | |
11439 | phi2=aftsTrack->Phi(); | |
11440 | for(Int_t i3=0;i3<nPrim;i3++) | |
11441 | { | |
11442 | if(i3==i1||i3==i2)continue; | |
11443 | aftsTrack=anEvent->GetTrack(i3); | |
11444 | if(!(aftsTrack->InRPSelection())) continue; | |
11445 | phi3=aftsTrack->Phi(); | |
11446 | for(Int_t i4=0;i4<nPrim;i4++) | |
11447 | { | |
11448 | if(i4==i1||i4==i2||i4==i3)continue; | |
11449 | aftsTrack=anEvent->GetTrack(i4); | |
11450 | if(!(aftsTrack->InRPSelection())) continue; | |
11451 | phi4=aftsTrack->Phi(); | |
11452 | if(nPrim==4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; | |
11453 | // fill the profile with 4-p correlations: | |
11454 | fIntFlowDirectCorrelations->Fill(10.,cos(n*phi1+n*phi2-n*phi3-n*phi4),1.); // <4>_{n,n|n,n} | |
11455 | fIntFlowDirectCorrelations->Fill(11.,cos(2.*n*phi1+n*phi2-2.*n*phi3-n*phi4),1.); // <4>_{2n,n|2n,n} | |
11456 | fIntFlowDirectCorrelations->Fill(12.,cos(2.*n*phi1+2*n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{2n,2n|2n,2n} | |
11457 | fIntFlowDirectCorrelations->Fill(13.,cos(3.*n*phi1-n*phi2-n*phi3-n*phi4),1.); // <4>_{3n|n,n,n} | |
11458 | fIntFlowDirectCorrelations->Fill(14.,cos(3.*n*phi1+n*phi2-3.*n*phi3-n*phi4),1.); // <4>_{3n,n|3n,n} | |
11459 | fIntFlowDirectCorrelations->Fill(15.,cos(3.*n*phi1+n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{3n,n|2n,2n} | |
11460 | fIntFlowDirectCorrelations->Fill(16.,cos(4.*n*phi1-2.*n*phi2-n*phi3-n*phi4),1.); // <4>_{4n|2n,n,n} | |
b84464d3 | 11461 | fIntFlowDirectCorrelations->Fill(32.,cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4)),1.); // <4>_{4n,2n|3n,3n} |
11462 | fIntFlowDirectCorrelations->Fill(41.5,cos(n*(6.*phi1-3.*phi2-2.*phi3-1.*phi4)),1.); // <4>_{6n|3n,2n,1n} | |
11463 | fIntFlowDirectCorrelations->Fill(42.5,cos(n*(3.*phi1+2.*phi2-3.*phi3-2.*phi4)),1.); // <4>_{3n,2n|3n,2n} | |
11464 | fIntFlowDirectCorrelations->Fill(43.5,cos(n*(4.*phi1+1.*phi2-3.*phi3-2.*phi4)),1.); // <4>_{4n,1n|3n,2n} | |
11465 | fIntFlowDirectCorrelations->Fill(44.5,cos(n*(3.*phi1+3.*phi2-3.*phi3-3.*phi4)),1.); // <4>_{3n,3n|3n,3n} | |
11466 | fIntFlowDirectCorrelations->Fill(45.5,cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4)),1.); // <4>_{4n,2n|3n,3n} | |
11467 | fIntFlowDirectCorrelations->Fill(46.5,cos(n*(5.*phi1+1.*phi2-3.*phi3-3.*phi4)),1.); // <4>_{5n,1n|3n,3n} | |
11468 | fIntFlowDirectCorrelations->Fill(47.5,cos(n*(4.*phi1+2.*phi2-4.*phi3-2.*phi4)),1.); // <4>_{4n,2n|4n,2n} | |
11469 | fIntFlowDirectCorrelations->Fill(48.5,cos(n*(5.*phi1+1.*phi2-4.*phi3-2.*phi4)),1.); // <4>_{5n,1n|4n,2n} | |
11470 | fIntFlowDirectCorrelations->Fill(49.5,cos(n*(5.*phi1-3.*phi2-1.*phi3-1.*phi4)),1.); // <4>_{5n|3n,1n,1n} | |
11471 | fIntFlowDirectCorrelations->Fill(50.5,cos(n*(5.*phi1-2.*phi2-2.*phi3-1.*phi4)),1.); // <4>_{5n|2n,2n,1n} | |
403e3389 | 11472 | fIntFlowDirectCorrelations->Fill(51.5,cos(n*(5.*phi1+1.*phi2-5.*phi3-1.*phi4)),1.); // <4>_{5n,1n|5n,1n} |
11473 | fIntFlowDirectCorrelations->Fill(58.5,cos(n*(6.*phi1-4.*phi2-1.*phi3-1.*phi4)),1.); // <4>_{6n|4n,1n,1n} | |
11474 | fIntFlowDirectCorrelations->Fill(59.5,cos(n*(6.*phi1-2.*phi2-2.*phi3-2.*phi4)),1.); // <4>_{6n|2n,2n,2n} | |
489d5531 | 11475 | } // end of for(Int_t i4=0;i4<nPrim;i4++) |
11476 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11477 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11478 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11479 | } // end of if(nPrim>=) | |
11480 | ||
11481 | // 5-particle correlations: | |
11482 | if(nPrim>=5 && nPrim<=fMaxAllowedMultiplicity) | |
11483 | { | |
11484 | for(Int_t i1=0;i1<nPrim;i1++) | |
11485 | { | |
11486 | aftsTrack=anEvent->GetTrack(i1); | |
11487 | if(!(aftsTrack->InRPSelection())) continue; | |
11488 | phi1=aftsTrack->Phi(); | |
11489 | for(Int_t i2=0;i2<nPrim;i2++) | |
11490 | { | |
11491 | if(i2==i1)continue; | |
11492 | aftsTrack=anEvent->GetTrack(i2); | |
11493 | if(!(aftsTrack->InRPSelection())) continue; | |
11494 | phi2=aftsTrack->Phi(); | |
11495 | for(Int_t i3=0;i3<nPrim;i3++) | |
11496 | { | |
11497 | if(i3==i1||i3==i2)continue; | |
11498 | aftsTrack=anEvent->GetTrack(i3); | |
11499 | if(!(aftsTrack->InRPSelection())) continue; | |
11500 | phi3=aftsTrack->Phi(); | |
11501 | for(Int_t i4=0;i4<nPrim;i4++) | |
11502 | { | |
11503 | if(i4==i1||i4==i2||i4==i3)continue; | |
11504 | aftsTrack=anEvent->GetTrack(i4); | |
11505 | if(!(aftsTrack->InRPSelection())) continue; | |
11506 | phi4=aftsTrack->Phi(); | |
11507 | for(Int_t i5=0;i5<nPrim;i5++) | |
11508 | { | |
11509 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
11510 | aftsTrack=anEvent->GetTrack(i5); | |
11511 | if(!(aftsTrack->InRPSelection())) continue; | |
11512 | phi5=aftsTrack->Phi(); | |
11513 | if(nPrim==5) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<"\r"<<flush; | |
11514 | // fill the profile with 5-p correlations: | |
b84464d3 | 11515 | fIntFlowDirectCorrelations->Fill(18.,cos(2.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5),1.); // <5>_{2n,n|n,n,n} |
11516 | fIntFlowDirectCorrelations->Fill(19.,cos(2.*n*phi1+2.*n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); // <5>_{2n,2n|2n,n,n} | |
11517 | fIntFlowDirectCorrelations->Fill(20.,cos(3.*n*phi1+n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); // <5>_{3n,n|2n,n,n} | |
11518 | fIntFlowDirectCorrelations->Fill(21.,cos(4.*n*phi1-n*phi2-n*phi3-n*phi4-n*phi5),1.); // <5>_{4n|n,n,n,n} | |
11519 | fIntFlowDirectCorrelations->Fill(33.,cos(3.*n*phi1+3.*n*phi2-2.*n*phi3-2.*n*phi4-2.*n*phi5),1.); // <5>_{3n,3n|2n,2n,2n} | |
11520 | fIntFlowDirectCorrelations->Fill(52.5,cos(3.*n*phi1+3.*n*phi2-3.*n*phi3-2.*n*phi4-1.*n*phi5),1.); // <5>_{3n,3n|3n,2n,1n} | |
11521 | fIntFlowDirectCorrelations->Fill(53.5,cos(4.*n*phi1+2.*n*phi2-3.*n*phi3-2.*n*phi4-1.*n*phi5),1.); // <5>_{4n,2n|3n,2n,1n} | |
11522 | fIntFlowDirectCorrelations->Fill(54.5,cos(3.*n*phi1+2.*n*phi2-3.*n*phi3-1.*n*phi4-1.*n*phi5),1.); // <5>_{3n,2n|3n,1n,1n} | |
11523 | fIntFlowDirectCorrelations->Fill(55.5,cos(3.*n*phi1+2.*n*phi2-2.*n*phi3-2.*n*phi4-1.*n*phi5),1.); // <5>_{3n,2n|2n,2n,1n} | |
11524 | fIntFlowDirectCorrelations->Fill(56.5,cos(5.*n*phi1+1.*n*phi2-3.*n*phi3-2.*n*phi4-1.*n*phi5),1.); // <5>_{5n,1n|3n,2n,1n} | |
403e3389 | 11525 | fIntFlowDirectCorrelations->Fill(60.5,cos(6.*n*phi1-2.*n*phi2-2.*n*phi3-1.*n*phi4-1.*n*phi5),1.); // <5>_{6n|2n,2n,1n,1n} |
11526 | fIntFlowDirectCorrelations->Fill(61.5,cos(4.*n*phi1+1.*n*phi2+1.*n*phi3-3.*n*phi4-3.*n*phi5),1.); // <5>_{4n,1n,1n|3n,3n} | |
489d5531 | 11527 | } // end of for(Int_t i5=0;i5<nPrim;i5++) |
11528 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
11529 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11530 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11531 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11532 | } // end of if(nPrim>=5) | |
11533 | ||
11534 | // 6-particle correlations: | |
11535 | if(nPrim>=6 && nPrim<=fMaxAllowedMultiplicity) | |
11536 | { | |
11537 | for(Int_t i1=0;i1<nPrim;i1++) | |
11538 | { | |
11539 | aftsTrack=anEvent->GetTrack(i1); | |
11540 | if(!(aftsTrack->InRPSelection())) continue; | |
11541 | phi1=aftsTrack->Phi(); | |
11542 | for(Int_t i2=0;i2<nPrim;i2++) | |
11543 | { | |
11544 | if(i2==i1)continue; | |
11545 | aftsTrack=anEvent->GetTrack(i2); | |
11546 | if(!(aftsTrack->InRPSelection())) continue; | |
11547 | phi2=aftsTrack->Phi(); | |
11548 | for(Int_t i3=0;i3<nPrim;i3++) | |
11549 | { | |
11550 | if(i3==i1||i3==i2)continue; | |
11551 | aftsTrack=anEvent->GetTrack(i3); | |
11552 | if(!(aftsTrack->InRPSelection())) continue; | |
11553 | phi3=aftsTrack->Phi(); | |
11554 | for(Int_t i4=0;i4<nPrim;i4++) | |
11555 | { | |
11556 | if(i4==i1||i4==i2||i4==i3)continue; | |
11557 | aftsTrack=anEvent->GetTrack(i4); | |
11558 | if(!(aftsTrack->InRPSelection())) continue; | |
11559 | phi4=aftsTrack->Phi(); | |
11560 | for(Int_t i5=0;i5<nPrim;i5++) | |
11561 | { | |
11562 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
11563 | aftsTrack=anEvent->GetTrack(i5); | |
11564 | if(!(aftsTrack->InRPSelection())) continue; | |
11565 | phi5=aftsTrack->Phi(); | |
11566 | for(Int_t i6=0;i6<nPrim;i6++) | |
11567 | { | |
11568 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
11569 | aftsTrack=anEvent->GetTrack(i6); | |
11570 | if(!(aftsTrack->InRPSelection())) continue; | |
11571 | phi6=aftsTrack->Phi(); | |
11572 | if(nPrim==6) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<"\r"<<flush; | |
11573 | // fill the profile with 6-p correlations: | |
403e3389 | 11574 | fIntFlowDirectCorrelations->Fill(23.,cos(n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6),1.); // <6>_{1n,1n,1n|1n,1n,1n} |
11575 | fIntFlowDirectCorrelations->Fill(24.,cos(2.*n*phi1+n*phi2+n*phi3-2.*n*phi4-n*phi5-n*phi6),1.); // <6>_{2n,1n,1n|2n,1n,1n} | |
11576 | fIntFlowDirectCorrelations->Fill(25.,cos(2.*n*phi1+2.*n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); // <6>_{2n,2n|1n,1n,1n,1n} | |
11577 | fIntFlowDirectCorrelations->Fill(26.,cos(3.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); // <6>_{3n,1n|1n,1n,1n,1n} | |
b84464d3 | 11578 | fIntFlowDirectCorrelations->Fill(57.5,cos(3.*n*phi1+2.*n*phi2+1.*n*phi3-3.*n*phi4-2.*n*phi5-1.*n*phi6),1.); // <6>_{3n,2n,1n|3n,2n,1n} |
403e3389 | 11579 | fIntFlowDirectCorrelations->Fill(62.5,cos(3.*n*phi1+3.*n*phi2-2.*n*phi3-2.*n*phi4-1.*n*phi5-1.*n*phi6),1.); // <6>_{3n,3n|2n,2n,1n,1n} |
489d5531 | 11580 | } // end of for(Int_t i6=0;i6<nPrim;i6++) |
11581 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
11582 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
11583 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11584 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11585 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11586 | } // end of if(nPrim>=6) | |
11587 | ||
11588 | // 7-particle correlations: | |
11589 | if(nPrim>=7 && nPrim<=fMaxAllowedMultiplicity) | |
11590 | { | |
11591 | for(Int_t i1=0;i1<nPrim;i1++) | |
11592 | { | |
11593 | aftsTrack=anEvent->GetTrack(i1); | |
11594 | if(!(aftsTrack->InRPSelection())) continue; | |
11595 | phi1=aftsTrack->Phi(); | |
11596 | for(Int_t i2=0;i2<nPrim;i2++) | |
11597 | { | |
11598 | if(i2==i1)continue; | |
11599 | aftsTrack=anEvent->GetTrack(i2); | |
11600 | if(!(aftsTrack->InRPSelection())) continue; | |
11601 | phi2=aftsTrack->Phi(); | |
11602 | for(Int_t i3=0;i3<nPrim;i3++) | |
11603 | { | |
11604 | if(i3==i1||i3==i2)continue; | |
11605 | aftsTrack=anEvent->GetTrack(i3); | |
11606 | if(!(aftsTrack->InRPSelection())) continue; | |
11607 | phi3=aftsTrack->Phi(); | |
11608 | for(Int_t i4=0;i4<nPrim;i4++) | |
11609 | { | |
11610 | if(i4==i1||i4==i2||i4==i3)continue; | |
11611 | aftsTrack=anEvent->GetTrack(i4); | |
11612 | if(!(aftsTrack->InRPSelection())) continue; | |
11613 | phi4=aftsTrack->Phi(); | |
11614 | for(Int_t i5=0;i5<nPrim;i5++) | |
11615 | { | |
11616 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
11617 | aftsTrack=anEvent->GetTrack(i5); | |
11618 | if(!(aftsTrack->InRPSelection())) continue; | |
11619 | phi5=aftsTrack->Phi(); | |
11620 | for(Int_t i6=0;i6<nPrim;i6++) | |
11621 | { | |
11622 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
11623 | aftsTrack=anEvent->GetTrack(i6); | |
11624 | if(!(aftsTrack->InRPSelection())) continue; | |
11625 | phi6=aftsTrack->Phi(); | |
11626 | for(Int_t i7=0;i7<nPrim;i7++) | |
11627 | { | |
11628 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; | |
11629 | aftsTrack=anEvent->GetTrack(i7); | |
11630 | if(!(aftsTrack->InRPSelection())) continue; | |
11631 | phi7=aftsTrack->Phi(); | |
11632 | if(nPrim==7) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<" "<<i7<<"\r"<<flush; | |
11633 | // fill the profile with 7-p correlation: | |
11634 | fIntFlowDirectCorrelations->Fill(28.,cos(2.*n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6-n*phi7),1.); // <7>_{2n,n,n|n,n,n,n} | |
11635 | } // end of for(Int_t i7=0;i7<nPrim;i7++) | |
11636 | } // end of for(Int_t i6=0;i6<nPrim;i6++) | |
11637 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
11638 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
11639 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11640 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11641 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11642 | } // end of if(nPrim>=7) | |
11643 | ||
11644 | // 8-particle correlations: | |
11645 | if(nPrim>=8 && nPrim<=fMaxAllowedMultiplicity) | |
11646 | { | |
11647 | for(Int_t i1=0;i1<nPrim;i1++) | |
11648 | { | |
11649 | aftsTrack=anEvent->GetTrack(i1); | |
11650 | if(!(aftsTrack->InRPSelection())) continue; | |
11651 | phi1=aftsTrack->Phi(); | |
11652 | for(Int_t i2=0;i2<nPrim;i2++) | |
11653 | { | |
11654 | if(i2==i1)continue; | |
11655 | aftsTrack=anEvent->GetTrack(i2); | |
11656 | if(!(aftsTrack->InRPSelection())) continue; | |
11657 | phi2=aftsTrack->Phi(); | |
11658 | for(Int_t i3=0;i3<nPrim;i3++) | |
11659 | { | |
11660 | if(i3==i1||i3==i2)continue; | |
11661 | aftsTrack=anEvent->GetTrack(i3); | |
11662 | if(!(aftsTrack->InRPSelection())) continue; | |
11663 | phi3=aftsTrack->Phi(); | |
11664 | for(Int_t i4=0;i4<nPrim;i4++) | |
11665 | { | |
11666 | if(i4==i1||i4==i2||i4==i3)continue; | |
11667 | aftsTrack=anEvent->GetTrack(i4); | |
11668 | if(!(aftsTrack->InRPSelection())) continue; | |
11669 | phi4=aftsTrack->Phi(); | |
11670 | for(Int_t i5=0;i5<nPrim;i5++) | |
11671 | { | |
11672 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
11673 | aftsTrack=anEvent->GetTrack(i5); | |
11674 | if(!(aftsTrack->InRPSelection())) continue; | |
11675 | phi5=aftsTrack->Phi(); | |
11676 | for(Int_t i6=0;i6<nPrim;i6++) | |
11677 | { | |
11678 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
11679 | aftsTrack=anEvent->GetTrack(i6); | |
11680 | if(!(aftsTrack->InRPSelection())) continue; | |
11681 | phi6=aftsTrack->Phi(); | |
11682 | for(Int_t i7=0;i7<nPrim;i7++) | |
11683 | { | |
11684 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; | |
11685 | aftsTrack=anEvent->GetTrack(i7); | |
11686 | if(!(aftsTrack->InRPSelection())) continue; | |
11687 | phi7=aftsTrack->Phi(); | |
11688 | for(Int_t i8=0;i8<nPrim;i8++) | |
11689 | { | |
11690 | if(i8==i1||i8==i2||i8==i3||i8==i4||i8==i5||i8==i6||i8==i7)continue; | |
11691 | aftsTrack=anEvent->GetTrack(i8); | |
11692 | if(!(aftsTrack->InRPSelection())) continue; | |
11693 | phi8=aftsTrack->Phi(); | |
11694 | cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<" "<<i7<<" "<<i8<<"\r"<<flush; | |
11695 | // fill the profile with 8-p correlation: | |
11696 | fIntFlowDirectCorrelations->Fill(30.,cos(n*phi1+n*phi2+n*phi3+n*phi4-n*phi5-n*phi6-n*phi7-n*phi8),1.); // <8>_{n,n,n,n|n,n,n,n} | |
11697 | } // end of for(Int_t i8=0;i8<nPrim;i8++) | |
11698 | } // end of for(Int_t i7=0;i7<nPrim;i7++) | |
11699 | } // end of for(Int_t i6=0;i6<nPrim;i6++) | |
11700 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
11701 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
11702 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11703 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11704 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11705 | } // end of if(nPrim>=8) | |
11706 | ||
11707 | cout<<endl; | |
11708 | ||
11709 | } // end of AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent) | |
11710 | ||
11711 | ||
11712 | //================================================================================================================================== | |
11713 | ||
11714 | ||
11715 | void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrelations() | |
11716 | { | |
11717 | // Cross-check results for multiparticle correlations needed for int. flow: results from Q-vectors vs results from nested loops. | |
11718 | ||
11719 | cout<<endl; | |
11720 | cout<<endl; | |
11721 | cout<<" *****************************************"<<endl; | |
11722 | cout<<" **** cross-checking the correlations ****"<<endl; | |
11723 | cout<<" **** for integrated flow ****"<<endl; | |
403e3389 | 11724 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 11725 | { |
11726 | cout<<" **** (particle weights not used) ****"<<endl; | |
11727 | } else | |
11728 | { | |
11729 | cout<<" **** (particle weights used) ****"<<endl; | |
11730 | } | |
11731 | cout<<" *****************************************"<<endl; | |
11732 | cout<<endl; | |
11733 | cout<<endl; | |
11734 | ||
403e3389 | 11735 | Int_t ciMax = 64; // to be improved (removed eventually when I calculate 6th and 8th order with particle weights) |
489d5531 | 11736 | |
403e3389 | 11737 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 11738 | { |
11739 | ciMax = 11; | |
11740 | } | |
11741 | ||
11742 | for(Int_t ci=1;ci<=ciMax;ci++) | |
11743 | { | |
11744 | if(strcmp((fIntFlowCorrelationsAllPro->GetXaxis())->GetBinLabel(ci), "") == 0) continue; // to be improved (access finalized histogram here) | |
11745 | cout<<(fIntFlowCorrelationsAllPro->GetXaxis())->GetBinLabel(ci)<<":"<<endl; // to be improved (access finalized histogram here) | |
11746 | cout<<"from Q-vectors = "<<fIntFlowCorrelationsAllPro->GetBinContent(ci)<<endl; // to be improved (access finalized histogram here) | |
11747 | cout<<"from nested loops = "<<fIntFlowDirectCorrelations->GetBinContent(ci)<<endl; | |
11748 | cout<<endl; | |
11749 | } | |
11750 | ||
11751 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrelations() | |
11752 | ||
489d5531 | 11753 | //================================================================================================================================ |
11754 | ||
489d5531 | 11755 | void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrectionTermsForNUA() |
11756 | { | |
11757 | // Cross-check results for corrections terms for non-uniform acceptance needed for int. flow: results from Q-vectors vs results from nested loops. | |
11758 | ||
11759 | cout<<endl; | |
11760 | cout<<endl; | |
11761 | cout<<" *********************************************"<<endl; | |
11762 | cout<<" **** cross-checking the correction terms ****"<<endl; | |
11763 | cout<<" **** for non-uniform acceptance relevant ****"<<endl; | |
11764 | cout<<" **** for integrated flow ****"<<endl; | |
403e3389 | 11765 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 11766 | { |
11767 | cout<<" **** (particle weights not used) ****"<<endl; | |
11768 | } else | |
11769 | { | |
11770 | cout<<" **** (particle weights used) ****"<<endl; | |
11771 | } | |
11772 | cout<<" *********************************************"<<endl; | |
11773 | cout<<endl; | |
11774 | cout<<endl; | |
11775 | ||
b92ea2b9 | 11776 | for(Int_t ci=1;ci<=4;ci++) // correction term index (to be improved - hardwired 4) |
489d5531 | 11777 | { |
11778 | for(Int_t sc=0;sc<2;sc++) // sin or cos term | |
11779 | { | |
11780 | if(strcmp((fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->GetBinLabel(ci), "") == 0) continue; // to be improved (access finalized histogram here) | |
11781 | cout<<(fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->GetBinLabel(ci)<<":"<<endl; // to be improved (access finalized histogram here) | |
11782 | cout<<"from Q-vectors = "<<fIntFlowCorrectionTermsForNUAPro[sc]->GetBinContent(ci)<<endl; // to be improved (access finalized histogram here) | |
11783 | cout<<"from nested loops = "<<fIntFlowDirectCorrectionTermsForNUA[sc]->GetBinContent(ci)<<endl; | |
11784 | cout<<endl; | |
11785 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos term | |
11786 | } // end of for(Int_t ci=1;ci<=10;ci++) // correction term index | |
11787 | ||
11788 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrectionTermsForNUA() | |
11789 | ||
489d5531 | 11790 | //================================================================================================================================ |
11791 | ||
0328db2d | 11792 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent) |
489d5531 | 11793 | { |
11794 | // Evaluate with nested loops multiparticle correlations for integrated flow (using the particle weights). | |
11795 | ||
11796 | // Results are stored in profile fIntFlowDirectCorrelations. | |
11797 | // Remark 1: When particle weights are used the binning of fIntFlowDirectCorrelations is organized as follows: | |
11798 | // | |
11799 | // 1st bin: <2>_{1n|1n} = two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))> | |
11800 | // 2nd bin: <2>_{2n|2n} = two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
11801 | // 3rd bin: <2>_{3n|3n} = two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
11802 | // 4th bin: <2>_{4n|4n} = two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
11803 | // 5th bin: ---- EMPTY ---- | |
11804 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
11805 | // 7th bin: <3>_{3n|2n,1n} = ... | |
11806 | // 8th bin: <3>_{4n|2n,2n} = ... | |
11807 | // 9th bin: <3>_{4n|3n,1n} = ... | |
11808 | // 10th bin: ---- EMPTY ---- | |
11809 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
11810 | // 12th bin: <4>_{2n,1n|2n,1n} = ... | |
11811 | // 13th bin: <4>_{2n,2n|2n,2n} = ... | |
11812 | // 14th bin: <4>_{3n|1n,1n,1n} = ... | |
11813 | // 15th bin: <4>_{3n,1n|3n,1n} = ... | |
11814 | // 16th bin: <4>_{3n,1n|2n,2n} = ... | |
11815 | // 17th bin: <4>_{4n|2n,1n,1n} = ... | |
11816 | // 18th bin: ---- EMPTY ---- | |
11817 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = ... | |
11818 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = ... | |
11819 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = ... | |
11820 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = ... | |
11821 | // 23rd bin: ---- EMPTY ---- | |
11822 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = ... | |
11823 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = ... | |
11824 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = ... | |
11825 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = ... | |
11826 | // 28th bin: ---- EMPTY ---- | |
11827 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = ... | |
11828 | // 30th bin: ---- EMPTY ---- | |
11829 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = ... | |
57340a27 | 11830 | |
489d5531 | 11831 | // Remark 2: When particle weights are used there are some extra correlations. They are stored in |
11832 | // fIntFlowExtraDirectCorrelations binning of which is organized as follows: | |
57340a27 | 11833 | |
489d5531 | 11834 | // 1st bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))> |
11835 | // 2nd bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
11836 | // ... | |
57340a27 | 11837 | |
489d5531 | 11838 | Int_t nPrim = anEvent->NumberOfTracks(); |
11839 | AliFlowTrackSimple *aftsTrack = NULL; | |
11840 | //Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; | |
11841 | //Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
11842 | Double_t phi1=0., phi2=0., phi3=0., phi4=0.; | |
11843 | Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1.; | |
11844 | Int_t n = fHarmonic; | |
11845 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 11846 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 11847 | cout<<endl; |
11848 | cout<<"Multiparticle correlations: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
11849 | if(dMult<2) | |
11850 | { | |
11851 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
11852 | } else if (dMult>fMaxAllowedMultiplicity) | |
11853 | { | |
11854 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
11855 | } else | |
11856 | { | |
11857 | cout<<"... evaluating nested loops (using particle weights) ..."<<endl; | |
11858 | } | |
11859 | ||
11860 | // 2-particle correlations: | |
11861 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
11862 | { | |
11863 | // 2 nested loops multiparticle correlations using particle weights: | |
11864 | for(Int_t i1=0;i1<nPrim;i1++) | |
11865 | { | |
11866 | aftsTrack=anEvent->GetTrack(i1); | |
11867 | if(!(aftsTrack->InRPSelection())) continue; | |
11868 | phi1=aftsTrack->Phi(); | |
11869 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
11870 | for(Int_t i2=0;i2<nPrim;i2++) | |
11871 | { | |
11872 | if(i2==i1)continue; | |
11873 | aftsTrack=anEvent->GetTrack(i2); | |
11874 | if(!(aftsTrack->InRPSelection())) continue; | |
11875 | phi2=aftsTrack->Phi(); | |
11876 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
11877 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
11878 | // 2-p correlations using particle weights: | |
11879 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),wPhi1*wPhi2); // <w1 w2 cos( n*(phi1-phi2))> | |
11880 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(1.5,cos(2.*n*(phi1-phi2)),pow(wPhi1,2)*pow(wPhi2,2)); // <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
11881 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(2.5,cos(3.*n*(phi1-phi2)),pow(wPhi1,3)*pow(wPhi2,3)); // <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
11882 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(3.5,cos(4.*n*(phi1-phi2)),pow(wPhi1,4)*pow(wPhi2,4)); // <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
11883 | // extra correlations: | |
11884 | // 2-p extra correlations (do not appear if particle weights are not used): | |
11885 | if(fUsePhiWeights) fIntFlowExtraDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),pow(wPhi1,3)*wPhi2); // <w1^3 w2 cos(n*(phi1-phi2))> | |
11886 | // ... | |
11887 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11888 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11889 | } // end of if(nPrim>=2) | |
11890 | ||
11891 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
57340a27 | 11892 | { |
489d5531 | 11893 | // 3 nested loops multiparticle correlations using particle weights: |
11894 | for(Int_t i1=0;i1<nPrim;i1++) | |
57340a27 | 11895 | { |
489d5531 | 11896 | aftsTrack=anEvent->GetTrack(i1); |
11897 | if(!(aftsTrack->InRPSelection())) continue; | |
11898 | phi1=aftsTrack->Phi(); | |
11899 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
11900 | for(Int_t i2=0;i2<nPrim;i2++) | |
11901 | { | |
11902 | if(i2==i1)continue; | |
11903 | aftsTrack=anEvent->GetTrack(i2); | |
11904 | if(!(aftsTrack->InRPSelection())) continue; | |
11905 | phi2=aftsTrack->Phi(); | |
11906 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
11907 | for(Int_t i3=0;i3<nPrim;i3++) | |
11908 | { | |
11909 | if(i3==i1||i3==i2)continue; | |
11910 | aftsTrack=anEvent->GetTrack(i3); | |
11911 | if(!(aftsTrack->InRPSelection())) continue; | |
11912 | phi3=aftsTrack->Phi(); | |
11913 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
11914 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
11915 | // 3-p correlations using particle weights: | |
11916 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(5.5,cos(2.*n*phi1-n*(phi2+phi3)),pow(wPhi1,2)*wPhi2*wPhi3); // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
11917 | // ... | |
11918 | // extra correlations: | |
11919 | // 2-p extra correlations (do not appear if particle weights are not used): | |
11920 | if(fUsePhiWeights) fIntFlowExtraDirectCorrelations->Fill(1.5,cos(n*(phi1-phi2)),wPhi1*wPhi2*pow(wPhi3,2)); // <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
11921 | // ... | |
11922 | // 3-p extra correlations (do not appear if particle weights are not used): | |
11923 | // ... | |
11924 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11925 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11926 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11927 | } // end of if(nPrim>=3) | |
57340a27 | 11928 | |
489d5531 | 11929 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) |
11930 | { | |
11931 | // 4 nested loops multiparticle correlations using particle weights: | |
11932 | for(Int_t i1=0;i1<nPrim;i1++) | |
11933 | { | |
11934 | aftsTrack=anEvent->GetTrack(i1); | |
11935 | if(!(aftsTrack->InRPSelection())) continue; | |
11936 | phi1=aftsTrack->Phi(); | |
11937 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
11938 | for(Int_t i2=0;i2<nPrim;i2++) | |
11939 | { | |
11940 | if(i2==i1)continue; | |
11941 | aftsTrack=anEvent->GetTrack(i2); | |
11942 | if(!(aftsTrack->InRPSelection())) continue; | |
11943 | phi2=aftsTrack->Phi(); | |
11944 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
11945 | for(Int_t i3=0;i3<nPrim;i3++) | |
11946 | { | |
11947 | if(i3==i1||i3==i2)continue; | |
11948 | aftsTrack=anEvent->GetTrack(i3); | |
11949 | if(!(aftsTrack->InRPSelection())) continue; | |
11950 | phi3=aftsTrack->Phi(); | |
11951 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
11952 | for(Int_t i4=0;i4<nPrim;i4++) | |
11953 | { | |
11954 | if(i4==i1||i4==i2||i4==i3)continue; | |
11955 | aftsTrack=anEvent->GetTrack(i4); | |
11956 | if(!(aftsTrack->InRPSelection())) continue; | |
11957 | phi4=aftsTrack->Phi(); | |
11958 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); | |
11959 | if(nPrim>=4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; // to be improved (replace eventually this if statement with if(nPrim==4)) | |
11960 | // 4-p correlations using particle weights: | |
11961 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(10.5,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); | |
11962 | // extra correlations: | |
11963 | // 2-p extra correlations (do not appear if particle weights are not used): | |
11964 | // ... | |
11965 | // 3-p extra correlations (do not appear if particle weights are not used): | |
11966 | // ... | |
11967 | // 4-p extra correlations (do not appear if particle weights are not used): | |
11968 | // ... | |
11969 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
11970 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11971 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11972 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11973 | } // end of if(nPrim>=4) | |
57340a27 | 11974 | |
489d5531 | 11975 | cout<<endl; |
57340a27 | 11976 | |
489d5531 | 11977 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent) |
57340a27 | 11978 | |
489d5531 | 11979 | //================================================================================================================================ |
11980 | ||
489d5531 | 11981 | void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowExtraCorrelations() |
57340a27 | 11982 | { |
489d5531 | 11983 | // Cross-check results for extra multiparticle correlations needed for int. flow |
11984 | // which appear only when particle weights are used: results from Q-vectors vs results from nested loops. | |
57340a27 | 11985 | |
489d5531 | 11986 | cout<<endl; |
11987 | cout<<endl; | |
11988 | cout<<" ***********************************************"<<endl; | |
11989 | cout<<" **** cross-checking the extra correlations ****"<<endl; | |
11990 | cout<<" **** for integrated flow ****"<<endl; | |
11991 | cout<<" ***********************************************"<<endl; | |
11992 | cout<<endl; | |
11993 | cout<<endl; | |
11994 | ||
11995 | for(Int_t eci=1;eci<=2;eci++) // to be improved (increased eciMax eventually when I calculate 6th and 8th) | |
57340a27 | 11996 | { |
489d5531 | 11997 | if(strcmp((fIntFlowExtraCorrelationsPro->GetXaxis())->GetBinLabel(eci), "") == 0) continue; |
11998 | cout<<(fIntFlowExtraCorrelationsPro->GetXaxis())->GetBinLabel(eci)<<":"<<endl; | |
11999 | cout<<"from Q-vectors = "<<fIntFlowExtraCorrelationsPro->GetBinContent(eci)<<endl; | |
12000 | cout<<"from nested loops = "<<fIntFlowExtraDirectCorrelations->GetBinContent(eci)<<endl; | |
12001 | cout<<endl; | |
12002 | } | |
57340a27 | 12003 | |
489d5531 | 12004 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowExtraCorrelations() |
57340a27 | 12005 | |
489d5531 | 12006 | //================================================================================================================================ |
3b552efe | 12007 | |
0328db2d | 12008 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoops(AliFlowEventSimple * const anEvent) |
489d5531 | 12009 | { |
12010 | // Evaluate with nested loops correction terms for non-uniform acceptance relevant for NONAME integrated flow (to be improved (name)). | |
12011 | // | |
12012 | // Remark: Both sin and cos correction terms are calculated in this method. Sin terms are stored in fIntFlowDirectCorrectionTermsForNUA[0], | |
12013 | // and cos terms in fIntFlowDirectCorrectionTermsForNUA[1]. Binning of fIntFlowDirectCorrectionTermsForNUA[sc] is organized as follows | |
12014 | // (sc stands for either sin or cos): | |
12015 | ||
12016 | // 1st bin: <<sc(n*(phi1))>> | |
12017 | // 2nd bin: <<sc(n*(phi1+phi2))>> | |
12018 | // 3rd bin: <<sc(n*(phi1-phi2-phi3))>> | |
12019 | // 4th bin: <<sc(n*(2phi1-phi2))>> | |
12020 | ||
12021 | Int_t nPrim = anEvent->NumberOfTracks(); | |
12022 | AliFlowTrackSimple *aftsTrack = NULL; | |
12023 | Double_t phi1=0., phi2=0., phi3=0.; | |
12024 | Int_t n = fHarmonic; | |
12025 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 12026 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 12027 | cout<<endl; |
12028 | cout<<"Correction terms for non-uniform acceptance: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
12029 | if(dMult<1) | |
3b552efe | 12030 | { |
489d5531 | 12031 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; |
12032 | } else if (dMult>fMaxAllowedMultiplicity) | |
3b552efe | 12033 | { |
489d5531 | 12034 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; |
12035 | } else | |
12036 | { | |
12037 | cout<<"... evaluating nested loops (without using particle weights)..."<<endl; | |
12038 | } | |
12039 | ||
12040 | if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity) | |
12041 | { | |
12042 | // 1-particle correction terms for non-uniform acceptance: | |
12043 | for(Int_t i1=0;i1<nPrim;i1++) | |
12044 | { | |
12045 | aftsTrack=anEvent->GetTrack(i1); | |
12046 | if(!(aftsTrack->InRPSelection())) continue; | |
12047 | phi1=aftsTrack->Phi(); | |
12048 | if(nPrim==1) cout<<i1<<"\r"<<flush; | |
12049 | // sin terms: | |
12050 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(0.5,sin(n*phi1),1.); // <sin(n*phi1)> | |
12051 | // cos terms: | |
12052 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(0.5,cos(n*phi1),1.); // <cos(n*phi1)> | |
12053 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
12054 | } // end of if(nPrim>=1) | |
12055 | ||
12056 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
12057 | { | |
12058 | // 2-particle correction terms for non-uniform acceptance: | |
12059 | for(Int_t i1=0;i1<nPrim;i1++) | |
12060 | { | |
12061 | aftsTrack=anEvent->GetTrack(i1); | |
12062 | if(!(aftsTrack->InRPSelection())) continue; | |
12063 | phi1=aftsTrack->Phi(); | |
12064 | for(Int_t i2=0;i2<nPrim;i2++) | |
3b552efe | 12065 | { |
489d5531 | 12066 | if(i2==i1)continue; |
12067 | aftsTrack=anEvent->GetTrack(i2); | |
12068 | if(!(aftsTrack->InRPSelection())) continue; | |
12069 | phi2=aftsTrack->Phi(); | |
12070 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
12071 | // sin terms: | |
3b552efe | 12072 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(1.5,sin(n*(phi1+phi2)),1.); // <<sin(n*(phi1+phi2))>> |
489d5531 | 12073 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(3.5,sin(n*(2*phi1-phi2)),1.); // <<sin(n*(2*phi1-phi2))>> |
12074 | // cos terms: | |
3b552efe | 12075 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(1.5,cos(n*(phi1+phi2)),1.); // <<cos(n*(phi1+phi2))>> |
489d5531 | 12076 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(3.5,cos(n*(2*phi1-phi2)),1.); // <<cos(n*(2*phi1-phi2))>> |
12077 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
12078 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
12079 | } // end of if(nPrim>=2) | |
12080 | ||
12081 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
12082 | { | |
12083 | // 3-particle correction terms for non-uniform acceptance: | |
12084 | for(Int_t i1=0;i1<nPrim;i1++) | |
12085 | { | |
12086 | aftsTrack=anEvent->GetTrack(i1); | |
12087 | if(!(aftsTrack->InRPSelection())) continue; | |
12088 | phi1=aftsTrack->Phi(); | |
12089 | for(Int_t i2=0;i2<nPrim;i2++) | |
12090 | { | |
12091 | if(i2==i1)continue; | |
12092 | aftsTrack=anEvent->GetTrack(i2); | |
12093 | if(!(aftsTrack->InRPSelection())) continue; | |
12094 | phi2=aftsTrack->Phi(); | |
12095 | for(Int_t i3=0;i3<nPrim;i3++) | |
12096 | { | |
12097 | if(i3==i1||i3==i2)continue; | |
12098 | aftsTrack=anEvent->GetTrack(i3); | |
12099 | if(!(aftsTrack->InRPSelection())) continue; | |
12100 | phi3=aftsTrack->Phi(); | |
12101 | if(nPrim>=3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; // to be improved (eventually I will change this if statement) | |
12102 | // sin terms: | |
12103 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(2.5,sin(n*(phi1-phi2-phi3)),1.); // <<sin(n*(phi1-phi2-phi3))>> | |
12104 | // cos terms: | |
12105 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(2.5,cos(n*(phi1-phi2-phi3)),1.); // <<cos(n*(phi1-phi2-phi3))>> | |
12106 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
12107 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
12108 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
12109 | } // end of if(nPrim>=3) | |
12110 | ||
12111 | cout<<endl; | |
12112 | } | |
64e500e3 | 12113 | |
489d5531 | 12114 | //================================================================================================================================ |
64e500e3 | 12115 | |
0328db2d | 12116 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 12117 | { |
12118 | // Evaluate reduced correlations with nested loops without using the particle weights. | |
12119 | ||
12120 | // Remark 1: Reduced correlations are evaluated in pt bin number fCrossCheckInPtBinNo and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
12121 | // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrelations[t][pe][ci], where indices runs as follows: | |
12122 | // [0=RP,1=POI][0=Pt,1=Eta][0=<2'>,1=<4'>,2=<6'>,3=<8'>] | |
12123 | // Remark 3: <2'> = <cos(n*(psi1-phi2))> | |
12124 | // <4'> = <cos(n*(psi1+phi2-phi3-phi4))> | |
12125 | // ... | |
12126 | ||
2a98ceb8 | 12127 | Int_t typeFlag = 0; |
12128 | Int_t ptEtaFlag = 0; | |
489d5531 | 12129 | if(type == "RP") |
12130 | { | |
12131 | typeFlag = 0; | |
12132 | } else if(type == "POI") | |
12133 | { | |
12134 | typeFlag = 1; | |
12135 | } | |
12136 | if(ptOrEta == "Pt") | |
12137 | { | |
12138 | ptEtaFlag = 0; | |
12139 | } else if(ptOrEta == "Eta") | |
12140 | { | |
12141 | ptEtaFlag = 1; | |
12142 | } | |
12143 | // shortcuts: | |
12144 | Int_t t = typeFlag; | |
12145 | Int_t pe = ptEtaFlag; | |
12146 | ||
12147 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12148 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12149 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
12150 | ||
12151 | Int_t nPrim = anEvent->NumberOfTracks(); | |
12152 | AliFlowTrackSimple *aftsTrack = NULL; | |
12153 | ||
12154 | Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
12155 | ||
3b552efe | 12156 | Int_t n = fHarmonic; |
489d5531 | 12157 | |
12158 | // 2'-particle correlations: | |
12159 | for(Int_t i1=0;i1<nPrim;i1++) | |
12160 | { | |
12161 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12162 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12163 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12164 | { |
12165 | if(ptOrEta == "Pt") | |
12166 | { | |
12167 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12168 | } else if (ptOrEta == "Eta") | |
12169 | { | |
12170 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12171 | } |
12172 | } else // this is diff flow of RPs | |
12173 | { | |
489d5531 | 12174 | if(ptOrEta == "Pt") |
12175 | { | |
12176 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12177 | } else if (ptOrEta == "Eta") | |
12178 | { | |
12179 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12180 | } |
12181 | } | |
489d5531 | 12182 | |
12183 | psi1=aftsTrack->Phi(); | |
12184 | for(Int_t i2=0;i2<nPrim;i2++) | |
12185 | { | |
12186 | if(i2==i1)continue; | |
12187 | aftsTrack=anEvent->GetTrack(i2); | |
12188 | // RP condition (!(first) particle in the correlator must be RP): | |
12189 | if(!(aftsTrack->InRPSelection()))continue; | |
12190 | phi2=aftsTrack->Phi(); | |
12191 | // 2'-particle correlations: | |
12192 | fDiffFlowDirectCorrelations[t][pe][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(1.*n*(psi1-phi2)),1.); // <cos(n*(psi1-phi2)) | |
12193 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12194 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12195 | ||
12196 | /* | |
12197 | ||
12198 | // 3'-particle correlations: | |
12199 | for(Int_t i1=0;i1<nPrim;i1++) | |
12200 | { | |
12201 | aftsTrack=anEvent->GetTrack(i1); | |
12202 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
12203 | if(ptOrEta == "Pt") | |
12204 | { | |
12205 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12206 | } else if (ptOrEta == "Eta") | |
12207 | { | |
12208 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12209 | } | |
12210 | psi1=aftsTrack->Phi(); | |
12211 | for(Int_t i2=0;i2<nPrim;i2++) | |
12212 | { | |
12213 | if(i2==i1)continue; | |
12214 | aftsTrack=anEvent->GetTrack(i2); | |
12215 | // RP condition (!(first) particle in the correlator must be RP): | |
12216 | if(!(aftsTrack->InRPSelection())) continue; | |
12217 | phi2=aftsTrack->Phi(); | |
12218 | for(Int_t i3=0;i3<nPrim;i3++) | |
12219 | { | |
12220 | if(i3==i1||i3==i2)continue; | |
12221 | aftsTrack=anEvent->GetTrack(i3); | |
12222 | // RP condition (!(first) particle in the correlator must be RP): | |
12223 | if(!(aftsTrack->InRPSelection())) continue; | |
12224 | phi3=aftsTrack->Phi(); | |
12225 | // to be improved : where to store it? ->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(2.*phi1-phi2-phi3)),1.); // <w1 w2 w3 cos(n(2psi1-phi2-phi3))> | |
12226 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
12227 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12228 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12229 | ||
12230 | */ | |
12231 | ||
12232 | // 4'-particle correlations: | |
12233 | for(Int_t i1=0;i1<nPrim;i1++) | |
12234 | { | |
12235 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12236 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12237 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12238 | { |
12239 | if(ptOrEta == "Pt") | |
12240 | { | |
12241 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12242 | } else if (ptOrEta == "Eta") | |
12243 | { | |
12244 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12245 | } |
12246 | } else // this is diff flow of RPs | |
12247 | { | |
489d5531 | 12248 | if(ptOrEta == "Pt") |
12249 | { | |
12250 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12251 | } else if (ptOrEta == "Eta") | |
12252 | { | |
12253 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12254 | } |
12255 | } | |
489d5531 | 12256 | |
12257 | psi1=aftsTrack->Phi(); | |
12258 | for(Int_t i2=0;i2<nPrim;i2++) | |
12259 | { | |
12260 | if(i2==i1) continue; | |
12261 | aftsTrack=anEvent->GetTrack(i2); | |
12262 | // RP condition (!(first) particle in the correlator must be RP): | |
12263 | if(!(aftsTrack->InRPSelection())) continue; | |
12264 | phi2=aftsTrack->Phi(); | |
12265 | for(Int_t i3=0;i3<nPrim;i3++) | |
12266 | { | |
12267 | if(i3==i1||i3==i2) continue; | |
12268 | aftsTrack=anEvent->GetTrack(i3); | |
12269 | // RP condition (!(first) particle in the correlator must be RP): | |
12270 | if(!(aftsTrack->InRPSelection())) continue; | |
12271 | phi3=aftsTrack->Phi(); | |
12272 | for(Int_t i4=0;i4<nPrim;i4++) | |
12273 | { | |
12274 | if(i4==i1||i4==i2||i4==i3) continue; | |
12275 | aftsTrack=anEvent->GetTrack(i4); | |
12276 | // RP condition (!(first) particle in the correlator must be RP): | |
12277 | if(!(aftsTrack->InRPSelection())) continue; | |
12278 | phi4=aftsTrack->Phi(); | |
12279 | // 4'-particle correlations: | |
12280 | fDiffFlowDirectCorrelations[t][pe][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3-phi4)),1.); // <cos(n(psi1+phi2-phi3-phi4))> | |
12281 | }//end of for(Int_t i4=0;i4<nPrim;i4++) | |
12282 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
12283 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12284 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12285 | ||
12286 | // count # of RPs and POIs in selected pt and eta bins for cross-checkings: | |
3b552efe | 12287 | for(Int_t i=0;i<nPrim;i++) |
12288 | { | |
12289 | aftsTrack=anEvent->GetTrack(i); | |
12290 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
12291 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12292 | { |
12293 | if(ptOrEta == "Pt") | |
12294 | { | |
12295 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12296 | } else if (ptOrEta == "Eta") | |
12297 | { | |
12298 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12299 | } |
12300 | } else // this is diff flow of RPs | |
12301 | { | |
489d5531 | 12302 | if(ptOrEta == "Pt") |
12303 | { | |
12304 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12305 | } else if (ptOrEta == "Eta") | |
12306 | { | |
12307 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12308 | } |
12309 | } | |
12310 | if(t==1)t++; | |
12311 | fNoOfParticlesInBin->Fill(t+pe+0.5); | |
489d5531 | 12312 | } |
12313 | ||
12314 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
12315 | ||
489d5531 | 12316 | //================================================================================================================================ |
12317 | ||
64e500e3 | 12318 | void AliFlowAnalysisWithQCumulants::EvaluateOtherDiffCorrelatorsWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
12319 | { | |
12320 | // Evaluate other differential correlators with nested loops without using the particle weights. | |
12321 | ||
12322 | // Remark 1: Other differential correlators are evaluated in pt bin number fCrossCheckInPtBinNo | |
12323 | // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
12324 | // Remark 2: Results are stored in 1 bin profiles fOtherDirectDiffCorrelators[t][pe][sc][ci], where indices runs as follows: | |
12325 | // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms][ci = correlator index] | |
12326 | // Remark 3: Correlator index 'ci' runs as follows: | |
12327 | // 0: <exp(n*(psi1-3phi2+2phi3))> (Teaney-Yan correlator) | |
12328 | ||
12329 | Int_t typeFlag = 0; | |
12330 | Int_t ptEtaFlag = 0; | |
12331 | if(type == "RP") | |
12332 | { | |
12333 | typeFlag = 0; | |
12334 | } else if(type == "POI") | |
12335 | { | |
12336 | typeFlag = 1; | |
12337 | } | |
12338 | if(ptOrEta == "Pt") | |
12339 | { | |
12340 | ptEtaFlag = 0; | |
12341 | } else if(ptOrEta == "Eta") | |
12342 | { | |
12343 | ptEtaFlag = 1; | |
12344 | } | |
12345 | // shortcuts: | |
12346 | Int_t t = typeFlag; | |
12347 | Int_t pe = ptEtaFlag; | |
12348 | ||
12349 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12350 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12351 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
12352 | ||
12353 | Int_t nPrim = anEvent->NumberOfTracks(); | |
12354 | AliFlowTrackSimple *aftsTrack = NULL; | |
12355 | ||
12356 | Double_t psi1=0., phi2=0., phi3=0.; | |
12357 | ||
12358 | Int_t n = fHarmonic; | |
12359 | ||
12360 | // 3-p correlators: | |
12361 | for(Int_t i1=0;i1<nPrim;i1++) | |
12362 | { | |
12363 | aftsTrack=anEvent->GetTrack(i1); | |
12364 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
12365 | if(typeFlag==1) // this is diff flow of POIs | |
12366 | { | |
12367 | if(ptOrEta == "Pt") | |
12368 | { | |
12369 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12370 | } else if (ptOrEta == "Eta") | |
12371 | { | |
12372 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12373 | } | |
12374 | } else // this is diff flow of RPs | |
12375 | { | |
12376 | if(ptOrEta == "Pt") | |
12377 | { | |
12378 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12379 | } else if (ptOrEta == "Eta") | |
12380 | { | |
12381 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12382 | } | |
12383 | } | |
12384 | psi1=aftsTrack->Phi(); | |
12385 | for(Int_t i2=0;i2<nPrim;i2++) | |
12386 | { | |
12387 | if(i2==i1) continue; | |
12388 | aftsTrack=anEvent->GetTrack(i2); | |
12389 | // RP condition (!(first) particle in the correlator must be RP): | |
12390 | if(!(aftsTrack->InRPSelection())) continue; | |
12391 | phi2=aftsTrack->Phi(); | |
12392 | for(Int_t i3=0;i3<nPrim;i3++) | |
12393 | { | |
12394 | if(i3==i1||i3==i2) continue; | |
12395 | aftsTrack=anEvent->GetTrack(i3); | |
12396 | // RP condition (!(first) particle in the correlator must be RP): | |
12397 | if(!(aftsTrack->InRPSelection())) continue; | |
12398 | phi3=aftsTrack->Phi(); | |
12399 | // Fill 3-p correlators: | |
12400 | fOtherDirectDiffCorrelators[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-3.*phi2+2.*phi3)),1.); // <cos(n(psi1-3.*phi2+2.*phi3))> | |
12401 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
12402 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12403 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12404 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateOtherDiffCorrelatorsWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) | |
12405 | ||
12406 | //================================================================================================================================ | |
489d5531 | 12407 | |
12408 | void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrelations(TString type, TString ptOrEta) | |
12409 | { | |
12410 | // Compare correlations needed for diff. flow calculated with nested loops and those calculated from Q-vectors | |
12411 | ||
2a98ceb8 | 12412 | Int_t typeFlag = 0; |
12413 | Int_t ptEtaFlag = 0; | |
489d5531 | 12414 | if(type == "RP") |
12415 | { | |
12416 | typeFlag = 0; | |
12417 | } else if(type == "POI") | |
12418 | { | |
12419 | typeFlag = 1; | |
12420 | } | |
12421 | if(ptOrEta == "Pt") | |
12422 | { | |
12423 | ptEtaFlag = 0; | |
12424 | } else if(ptOrEta == "Eta") | |
12425 | { | |
12426 | ptEtaFlag = 1; | |
12427 | } | |
12428 | // shortcuts: | |
12429 | Int_t t = typeFlag; | |
12430 | Int_t pe = ptEtaFlag; | |
12431 | ||
12432 | TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
12433 | TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
12434 | TString reducedCorrelations[4] = {"<<cos(n(psi1-phi2))>>","<<cos(n(psi1+phi2-phi3-phi4))>>","",""}; // to be improved (access this from pro or hist) | |
12435 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12436 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12437 | ||
12438 | Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo}; | |
12439 | ||
12440 | ||
12441 | cout<<endl; | |
12442 | cout<<" *****************************************"<<endl; | |
12443 | cout<<" **** cross-checking the correlations ****"<<endl; | |
12444 | cout<<" **** for differential flow ("<<rpORpoiString[t]<<") ****"<<endl; | |
403e3389 | 12445 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 12446 | { |
12447 | cout<<" **** (particle weights not used) ****"<<endl; | |
12448 | } else | |
12449 | { | |
12450 | cout<<" **** (particle weights used) ****"<<endl; | |
12451 | } | |
12452 | cout<<" *****************************************"<<endl; | |
12453 | cout<<endl; | |
12454 | cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl; | |
12455 | cout<<endl; | |
12456 | ||
12457 | for(Int_t rci=0;rci<2;rci++) // to be improved (calculate 6th and 8th order) | |
12458 | { | |
12459 | cout<<" "<<reducedCorrelations[rci].Data()<<":"<<endl; | |
12460 | cout<<" from Q-vectors = "<<fDiffFlowCorrelationsPro[t][pe][rci]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl; | |
12461 | cout<<" from nested loops = "<<fDiffFlowDirectCorrelations[t][pe][rci]->GetBinContent(1)<<endl; | |
12462 | cout<<endl; | |
12463 | } // end of for(Int_t rci=0;rci<4;rci++) | |
12464 | ||
12465 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrelations(TString type, TString ptOrEta) | |
12466 | ||
3b552efe | 12467 | //================================================================================================================================ |
12468 | ||
64e500e3 | 12469 | void AliFlowAnalysisWithQCumulants::CrossCheckOtherDiffCorrelators(TString type, TString ptOrEta) |
12470 | { | |
12471 | // Compare correlations needed for diff. flow calculated with nested loops and those calculated from Q-vectors | |
12472 | ||
12473 | Int_t typeFlag = 0; | |
12474 | Int_t ptEtaFlag = 0; | |
12475 | if(type == "RP") | |
12476 | { | |
12477 | typeFlag = 0; | |
12478 | } else if(type == "POI") | |
12479 | { | |
12480 | typeFlag = 1; | |
12481 | } | |
12482 | if(ptOrEta == "Pt") | |
12483 | { | |
12484 | ptEtaFlag = 0; | |
12485 | } else if(ptOrEta == "Eta") | |
12486 | { | |
12487 | ptEtaFlag = 1; | |
12488 | } | |
12489 | // shortcuts: | |
12490 | Int_t t = typeFlag; | |
12491 | Int_t pe = ptEtaFlag; | |
12492 | ||
12493 | TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
12494 | TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
12495 | TString otherCorrelators[1] = {"<<cos(n(psi1-3phi2+2phi3))>>"}; // to be improved (access this from pro or hist) | |
12496 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12497 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12498 | ||
12499 | Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo}; | |
12500 | ||
12501 | cout<<endl; | |
12502 | cout<<" *****************************************"<<endl; | |
12503 | cout<<" **** cross-checking the other ****"<<endl; | |
12504 | cout<<" **** diff. correlators ("<<rpORpoiString[t]<<") ****"<<endl; | |
403e3389 | 12505 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
64e500e3 | 12506 | { |
12507 | cout<<" **** (particle weights not used) ****"<<endl; | |
12508 | } else | |
12509 | { | |
12510 | cout<<" **** (particle weights used) ****"<<endl; | |
12511 | } | |
12512 | cout<<" *****************************************"<<endl; | |
12513 | cout<<endl; | |
12514 | cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl; | |
12515 | cout<<endl; | |
12516 | ||
12517 | for(Int_t ci=0;ci<1;ci++) | |
12518 | { | |
12519 | cout<<" "<<otherCorrelators[ci].Data()<<":"<<endl; | |
12520 | cout<<" from Q-vectors = "<<fOtherDiffCorrelators[t][pe][1][ci]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl; | |
12521 | cout<<" from nested loops = "<<fOtherDirectDiffCorrelators[t][pe][1][ci]->GetBinContent(1)<<endl; | |
12522 | cout<<endl; | |
12523 | } // end of for(Int_t ci=0;ci<1;ci++) | |
12524 | ||
12525 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckOtherDiffCorrelators(TString type, TString ptOrEta) | |
12526 | ||
12527 | //================================================================================================================================ | |
12528 | ||
489d5531 | 12529 | void AliFlowAnalysisWithQCumulants::PrintNumberOfParticlesInSelectedBin() |
3b552efe | 12530 | { |
12531 | // Print on the screen number of RPs and POIs in selected pt and eta bin for cross checkings. | |
12532 | ||
12533 | cout<<endl; | |
12534 | cout<<"Number of RPs in selected pt bin = "<<fNoOfParticlesInBin->GetBinContent(1)<<endl; | |
12535 | cout<<"Number of RPs in selected eta bin = "<<fNoOfParticlesInBin->GetBinContent(2)<<endl; | |
12536 | cout<<"Number of POIs in selected pt bin = "<<fNoOfParticlesInBin->GetBinContent(3)<<endl; | |
12537 | cout<<"Number of POIs in selected eta bin = "<<fNoOfParticlesInBin->GetBinContent(4)<<endl; | |
12538 | ||
489d5531 | 12539 | } // end of void AliFlowAnalysisWithQCumulants::PrintNumberOfParticlesInSelectedBin() |
12540 | ||
3b552efe | 12541 | //================================================================================================================================ |
12542 | ||
0328db2d | 12543 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 12544 | { |
12545 | // Evaluate reduced correlations with nested loops without using the particle weights. | |
12546 | ||
12547 | // Remark 1: Reduced correlations are evaluated in pt bin number fCrossCheckInPtBinNo and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
12548 | // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrelations[t][pe][ci], where indices runs as follows: | |
12549 | // [0=RP,1=POI][0=Pt,1=Eta][0=<2'>,1=<4'>,2=<6'>,3=<8'>] | |
12550 | // Remark 3: <2'> = <w2 cos(n*(psi1-phi2))> | |
12551 | // <4'> = <w2 w3 w4 cos(n*(psi1+phi2-phi3-phi4))> | |
12552 | // ... | |
12553 | ||
2a98ceb8 | 12554 | Int_t typeFlag = 0; |
12555 | Int_t ptEtaFlag = 0; | |
489d5531 | 12556 | if(type == "RP") |
12557 | { | |
12558 | typeFlag = 0; | |
12559 | } else if(type == "POI") | |
12560 | { | |
12561 | typeFlag = 1; | |
12562 | } | |
12563 | if(ptOrEta == "Pt") | |
12564 | { | |
12565 | ptEtaFlag = 0; | |
12566 | } else if(ptOrEta == "Eta") | |
12567 | { | |
12568 | ptEtaFlag = 1; | |
12569 | } | |
12570 | // shortcuts: | |
12571 | Int_t t = typeFlag; | |
12572 | Int_t pe = ptEtaFlag; | |
12573 | ||
12574 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12575 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12576 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
12577 | ||
12578 | Int_t nPrim = anEvent->NumberOfTracks(); | |
12579 | AliFlowTrackSimple *aftsTrack = NULL; | |
12580 | ||
12581 | Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
12582 | Double_t wPhi2=1., wPhi3=1., wPhi4=1.;// wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
12583 | ||
12584 | Int_t n = fHarmonic; | |
12585 | ||
12586 | // 2'-particle correlations: | |
12587 | for(Int_t i1=0;i1<nPrim;i1++) | |
12588 | { | |
12589 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12590 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12591 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12592 | { |
12593 | if(ptOrEta == "Pt") | |
12594 | { | |
12595 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12596 | } else if (ptOrEta == "Eta") | |
12597 | { | |
12598 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12599 | } |
12600 | } else // this is diff flow of RPs | |
12601 | { | |
489d5531 | 12602 | if(ptOrEta == "Pt") |
12603 | { | |
12604 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12605 | } else if (ptOrEta == "Eta") | |
12606 | { | |
12607 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12608 | } |
489d5531 | 12609 | } |
12610 | psi1=aftsTrack->Phi(); | |
12611 | for(Int_t i2=0;i2<nPrim;i2++) | |
12612 | { | |
12613 | if(i2==i1) continue; | |
12614 | aftsTrack=anEvent->GetTrack(i2); | |
12615 | // RP condition (!(first) particle in the correlator must be RP): | |
12616 | if(!(aftsTrack->InRPSelection())) continue; | |
12617 | phi2=aftsTrack->Phi(); | |
12618 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
12619 | // 2'-particle correlations: | |
12620 | fDiffFlowDirectCorrelations[t][pe][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(1.*n*(psi1-phi2)),wPhi2); // <w2 cos(n*(psi1-phi2)) | |
12621 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12622 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12623 | ||
12624 | // 4'-particle correlations: | |
12625 | for(Int_t i1=0;i1<nPrim;i1++) | |
12626 | { | |
12627 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12628 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12629 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12630 | { |
12631 | if(ptOrEta == "Pt") | |
12632 | { | |
12633 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12634 | } else if (ptOrEta == "Eta") | |
12635 | { | |
12636 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12637 | } |
12638 | } else // this is diff flow of RPs | |
12639 | { | |
489d5531 | 12640 | if(ptOrEta == "Pt") |
12641 | { | |
12642 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12643 | } else if (ptOrEta == "Eta") | |
12644 | { | |
12645 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12646 | } |
489d5531 | 12647 | } |
12648 | psi1=aftsTrack->Phi(); | |
12649 | for(Int_t i2=0;i2<nPrim;i2++) | |
12650 | { | |
12651 | if(i2==i1) continue; | |
12652 | aftsTrack=anEvent->GetTrack(i2); | |
12653 | // RP condition (!(first) particle in the correlator must be RP): | |
12654 | if(!(aftsTrack->InRPSelection())) continue; | |
12655 | phi2=aftsTrack->Phi(); | |
12656 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
12657 | for(Int_t i3=0;i3<nPrim;i3++) | |
12658 | { | |
12659 | if(i3==i1||i3==i2) continue; | |
12660 | aftsTrack=anEvent->GetTrack(i3); | |
12661 | // RP condition (!(first) particle in the correlator must be RP): | |
12662 | if(!(aftsTrack->InRPSelection())) continue; | |
12663 | phi3=aftsTrack->Phi(); | |
12664 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
12665 | for(Int_t i4=0;i4<nPrim;i4++) | |
12666 | { | |
12667 | if(i4==i1||i4==i2||i4==i3) continue; | |
12668 | aftsTrack=anEvent->GetTrack(i4); | |
12669 | // RP condition (!(first) particle in the correlator must be RP): | |
12670 | if(!(aftsTrack->InRPSelection())) continue; | |
12671 | phi4=aftsTrack->Phi(); | |
12672 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); | |
12673 | // 4'-particle correlations <w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))>: | |
12674 | fDiffFlowDirectCorrelations[t][pe][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3-phi4)),wPhi2*wPhi3*wPhi4); | |
12675 | }//end of for(Int_t i4=0;i4<nPrim;i4++) | |
12676 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
12677 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12678 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12679 | ||
12680 | // count # of RPs and POIs in selected pt and eta bins for cross-checkings: (to be improved - moved to dedicated method) | |
3b552efe | 12681 | for(Int_t i=0;i<nPrim;i++) |
12682 | { | |
489d5531 | 12683 | aftsTrack=anEvent->GetTrack(i); |
12684 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
12685 | if(typeFlag==1) // this is diff flow of POIs | |
12686 | { | |
12687 | if(ptOrEta == "Pt") | |
12688 | { | |
12689 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12690 | } else if (ptOrEta == "Eta") | |
12691 | { | |
12692 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12693 | } | |
12694 | } else // this is diff flow of RPs | |
12695 | { | |
12696 | if(ptOrEta == "Pt") | |
12697 | { | |
12698 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12699 | } else if (ptOrEta == "Eta") | |
12700 | { | |
12701 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12702 | } | |
12703 | } | |
12704 | if(t==1)t++; | |
12705 | fNoOfParticlesInBin->Fill(t+pe+0.5); | |
12706 | } | |
12707 | ||
12708 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
12709 | ||
489d5531 | 12710 | //================================================================================================================================ |
12711 | ||
0328db2d | 12712 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 12713 | { |
12714 | // Evaluate with nested loops correction terms for non-uniform acceptance (both sin and cos terms) relevant for differential flow. | |
12715 | ||
12716 | // Remark 1: Reduced correction terms for non-uniform acceptance are evaluated in pt bin number fCrossCheckInPtBinNo | |
12717 | // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
12718 | // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrections[t][pe][sc][cti], where first three indices runs as: | |
12719 | // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms], whilst the cti (correction term index) runs as follows: | |
12720 | // cti: | |
12721 | // 0: <<sc n(psi1)>> | |
12722 | // 1: <<sc n(psi1+phi2)>> | |
12723 | // 2: <<sc n(psi1+phi2-phi3)>> | |
12724 | // 3: <<sc n(psi1-phi2-phi3)>> | |
12725 | // 4: | |
12726 | // 5: | |
12727 | // 6: | |
12728 | ||
2a98ceb8 | 12729 | Int_t typeFlag = 0; |
12730 | Int_t ptEtaFlag = 0; | |
489d5531 | 12731 | if(type == "RP") |
12732 | { | |
12733 | typeFlag = 0; | |
12734 | } else if(type == "POI") | |
12735 | { | |
12736 | typeFlag = 1; | |
12737 | } | |
12738 | if(ptOrEta == "Pt") | |
12739 | { | |
12740 | ptEtaFlag = 0; | |
12741 | } else if(ptOrEta == "Eta") | |
12742 | { | |
12743 | ptEtaFlag = 1; | |
12744 | } | |
12745 | // shortcuts: | |
12746 | Int_t t = typeFlag; | |
12747 | Int_t pe = ptEtaFlag; | |
12748 | ||
12749 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12750 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12751 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
12752 | ||
12753 | Int_t nPrim = anEvent->NumberOfTracks(); | |
12754 | AliFlowTrackSimple *aftsTrack = NULL; | |
12755 | ||
12756 | Double_t psi1=0., phi2=0., phi3=0.;// phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
12757 | ||
12758 | Int_t n = fHarmonic; | |
12759 | ||
12760 | // 1-particle correction terms: | |
12761 | for(Int_t i1=0;i1<nPrim;i1++) | |
12762 | { | |
12763 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12764 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12765 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12766 | { |
12767 | if(ptOrEta == "Pt") | |
12768 | { | |
12769 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12770 | } else if (ptOrEta == "Eta") | |
12771 | { | |
12772 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12773 | } |
12774 | } else // this is diff flow of RPs | |
12775 | { | |
489d5531 | 12776 | if(ptOrEta == "Pt") |
12777 | { | |
12778 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12779 | } else if (ptOrEta == "Eta") | |
12780 | { | |
12781 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12782 | } |
12783 | } | |
489d5531 | 12784 | psi1=aftsTrack->Phi(); |
12785 | // sin terms: | |
12786 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*psi1),1.); // <<sin(n*(psi1))>> | |
12787 | // cos terms: | |
12788 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*psi1),1.); // <<cos(n*(psi1))>> | |
12789 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12790 | ||
12791 | // 2-particle correction terms: | |
12792 | for(Int_t i1=0;i1<nPrim;i1++) | |
12793 | { | |
12794 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12795 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12796 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12797 | { |
12798 | if(ptOrEta == "Pt") | |
12799 | { | |
12800 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12801 | } else if (ptOrEta == "Eta") | |
12802 | { | |
12803 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12804 | } |
12805 | } else // this is diff flow of RPs | |
12806 | { | |
489d5531 | 12807 | if(ptOrEta == "Pt") |
12808 | { | |
12809 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12810 | } else if (ptOrEta == "Eta") | |
12811 | { | |
12812 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12813 | } |
489d5531 | 12814 | } |
12815 | psi1=aftsTrack->Phi(); | |
12816 | for(Int_t i2=0;i2<nPrim;i2++) | |
12817 | { | |
12818 | if(i2==i1) continue; | |
12819 | aftsTrack=anEvent->GetTrack(i2); | |
12820 | // RP condition (!(first) particle in the correlator must be RP): | |
12821 | if(!(aftsTrack->InRPSelection())) continue; | |
12822 | phi2=aftsTrack->Phi(); | |
12823 | // sin terms: | |
12824 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2)),1.); // <<sin(n*(psi1+phi2))>> | |
12825 | // cos terms: | |
12826 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2)),1.); // <<cos(n*(psi1+phi2))>> | |
12827 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12828 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12829 | ||
12830 | // 3-particle correction terms: | |
12831 | for(Int_t i1=0;i1<nPrim;i1++) | |
12832 | { | |
12833 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12834 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12835 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12836 | { |
12837 | if(ptOrEta == "Pt") | |
12838 | { | |
12839 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12840 | } else if (ptOrEta == "Eta") | |
12841 | { | |
12842 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12843 | } |
12844 | } else // this is diff flow of RPs | |
12845 | { | |
489d5531 | 12846 | if(ptOrEta == "Pt") |
12847 | { | |
12848 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12849 | } else if (ptOrEta == "Eta") | |
12850 | { | |
12851 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12852 | } |
489d5531 | 12853 | } |
12854 | psi1=aftsTrack->Phi(); | |
12855 | for(Int_t i2=0;i2<nPrim;i2++) | |
12856 | { | |
12857 | if(i2==i1) continue; | |
12858 | aftsTrack=anEvent->GetTrack(i2); | |
12859 | // RP condition (!(first) particle in the correlator must be RP): | |
12860 | if(!(aftsTrack->InRPSelection())) continue; | |
12861 | phi2=aftsTrack->Phi(); | |
12862 | for(Int_t i3=0;i3<nPrim;i3++) | |
12863 | { | |
12864 | if(i3==i1||i3==i2) continue; | |
12865 | aftsTrack=anEvent->GetTrack(i3); | |
12866 | // RP condition (!(first) particle in the correlator must be RP): | |
12867 | if(!(aftsTrack->InRPSelection())) continue; | |
12868 | phi3=aftsTrack->Phi(); | |
12869 | // sin terms: | |
12870 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2-phi3)),1.); // <<sin(n*(psi1+phi2-phi3))>> | |
12871 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1-phi2-phi3)),1.); // <<sin(n*(psi1-phi2-phi3))>> | |
12872 | // cos terms: | |
12873 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3)),1.); // <<cos(n*(psi1+phi2-phi3))>> | |
12874 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-phi2-phi3)),1.); // <<cos(n*(psi1-phi2-phi3))>> | |
12875 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
12876 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12877 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12878 | ||
12879 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
12880 | ||
12881 | ||
12882 | //================================================================================================================================ | |
12883 | ||
12884 | ||
12885 | void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrectionTermsForNUA(TString type, TString ptOrEta) | |
12886 | { | |
12887 | // Compare corrections temrs for non-uniform acceptance needed for diff. flow calculated with nested loops and those calculated from Q-vectors | |
12888 | ||
2a98ceb8 | 12889 | Int_t typeFlag = 0; |
12890 | Int_t ptEtaFlag = 0; | |
489d5531 | 12891 | if(type == "RP") |
12892 | { | |
12893 | typeFlag = 0; | |
12894 | } else if(type == "POI") | |
12895 | { | |
12896 | typeFlag = 1; | |
12897 | } | |
12898 | if(ptOrEta == "Pt") | |
12899 | { | |
12900 | ptEtaFlag = 0; | |
12901 | } else if(ptOrEta == "Eta") | |
12902 | { | |
12903 | ptEtaFlag = 1; | |
12904 | } | |
12905 | // shortcuts: | |
12906 | Int_t t = typeFlag; | |
12907 | Int_t pe = ptEtaFlag; | |
12908 | ||
12909 | TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
12910 | TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
12911 | //TString sinCosFlag[2] = {"sin","cos"}; // to be improved (eventually promote to data member) | |
12912 | TString reducedCorrectionSinTerms[4] = {"<<sin(n(psi1))>>","<<sin(n(psi1+phi2))>>","<<sin(n*(psi1+phi2-phi3))>>","<<sin(n*(psi1-phi2-phi3))>>"}; // to be improved (access this from pro or hist) | |
12913 | TString reducedCorrectionCosTerms[4] = {"<<cos(n(psi1))>>","<<cos(n(psi1+phi2))>>","<<cos(n*(psi1+phi2-phi3))>>","<<cos(n*(psi1-phi2-phi3))>>"}; // to be improved (access this from pro or hist) | |
12914 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12915 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12916 | ||
12917 | Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo}; | |
12918 | ||
12919 | cout<<endl; | |
12920 | cout<<" ******************************************"<<endl; | |
12921 | cout<<" **** cross-checking the correction ****"<<endl; | |
46b94261 | 12922 | cout<<" **** terms for non-uniform acceptance ****"<<endl; |
489d5531 | 12923 | cout<<" **** for differential flow ("<<rpORpoiString[t]<<") ****"<<endl; |
403e3389 | 12924 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 12925 | { |
12926 | cout<<" **** (particle weights not used) ****"<<endl; | |
12927 | } else | |
12928 | { | |
12929 | cout<<" **** (particle weights used) ****"<<endl; | |
12930 | } | |
12931 | cout<<" ******************************************"<<endl; | |
12932 | cout<<endl; | |
12933 | cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl; | |
12934 | cout<<endl; | |
12935 | ||
12936 | for(Int_t cti=0;cti<4;cti++) // correction term index | |
12937 | { | |
12938 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
12939 | { | |
12940 | if(sc==0) // to be improved (this can be implemented better) | |
12941 | { | |
12942 | cout<<" "<<reducedCorrectionSinTerms[cti].Data()<<":"<<endl; | |
12943 | } else | |
12944 | { | |
12945 | cout<<" "<<reducedCorrectionCosTerms[cti].Data()<<":"<<endl; | |
12946 | } | |
12947 | cout<<" from Q-vectors = "<<fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl; | |
12948 | cout<<" from nested loops = "<<fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]->GetBinContent(1)<<endl; | |
12949 | cout<<endl; | |
12950 | } | |
12951 | } // end of for(Int_t rci=0;rci<4;rci++) | |
12952 | ||
12953 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrectionTermsForNUA(TString type, TString ptOrEta) | |
12954 | ||
57340a27 | 12955 | //================================================================================================================================ |
12956 | ||
489d5531 | 12957 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights() |
12958 | { | |
12959 | // Calculate corrections using particle weights for non-uniform acceptance of the detector for no-name integrated flow (cos terms). | |
12960 | ||
12961 | // ********************************************************************** | |
12962 | // **** weighted corrections for non-uniform acceptance (cos terms): **** | |
12963 | // ********************************************************************** | |
57340a27 | 12964 | |
489d5531 | 12965 | // Remark 1: When particle weights are used the binning of fIntFlowCorrectionTermsForNUAPro[1] is organized as follows: |
57340a27 | 12966 | // |
489d5531 | 12967 | // 1st bin: <<w1 cos(n*(phi1))>> = cosP1nW1 |
12968 | // 2nd bin: <<w1 w2 cos(n*(phi1+phi2))>> = cosP1nP1nW1W1 | |
12969 | // 3rd bin: <<w1 w2 w3 cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1nW1W1W1 | |
12970 | // ... | |
12971 | ||
12972 | // multiplicity (number of particles used to determine the reaction plane) | |
1268c371 | 12973 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 12974 | |
12975 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
12976 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
12977 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
12978 | //Double_t dReQ3n3k = (*fReQ)(2,3); | |
12979 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
12980 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
12981 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
12982 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
12983 | //Double_t dImQ3n3k = (*fImQ)(2,3); | |
12984 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
12985 | //Double_t dImQ1n3k = (*fImQ)(0,3); | |
12986 | ||
12987 | // dMs are variables introduced in order to simplify some Eqs. bellow: | |
12988 | //.............................................................................................. | |
1268c371 | 12989 | Double_t dM11 = (*fSpk)(1,1)-(*fSpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
12990 | Double_t dM111 = (*fSpk)(2,1)-3.*(*fSpk)(0,2)*(*fSpk)(0,1) | |
12991 | + 2.*(*fSpk)(0,3); // dM111 = sum_{i,j,k=1,i!=j!=k}^M w_i w_j w_k | |
489d5531 | 12992 | //.............................................................................................. |
ecac11c2 | 12993 | // 1-particle: |
489d5531 | 12994 | Double_t cosP1nW1 = 0.; // <<w1 cos(n*(phi1))>> |
12995 | ||
1268c371 | 12996 | if(dMult>0 && TMath::Abs((*fSpk)(0,1))>1.e-6) |
489d5531 | 12997 | { |
1268c371 | 12998 | cosP1nW1 = dReQ1n1k/(*fSpk)(0,1); |
489d5531 | 12999 | |
13000 | // average weighted 1-particle correction (cos terms) for non-uniform acceptance for single event: | |
13001 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(1,cosP1nW1); | |
13002 | ||
13003 | // final average weighted 1-particle correction (cos terms) for non-uniform acceptance for all events: | |
1268c371 | 13004 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(0.5,cosP1nW1,(*fSpk)(0,1)); |
489d5531 | 13005 | } |
13006 | ||
13007 | // 2-particle: | |
13008 | Double_t cosP1nP1nW1W1 = 0.; // <<w1 w2 cos(n*(phi1+phi2))>> | |
13009 | ||
1268c371 | 13010 | if(dMult>1 && TMath::Abs(dM11)>1.e-6) |
489d5531 | 13011 | { |
13012 | cosP1nP1nW1W1 = (pow(dReQ1n1k,2)-pow(dImQ1n1k,2)-dReQ2n2k)/dM11; | |
13013 | ||
13014 | // average weighted 2-particle correction (cos terms) for non-uniform acceptance for single event: | |
13015 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(2,cosP1nP1nW1W1); | |
13016 | ||
13017 | // final average weighted 2-particle correction (cos terms) for non-uniform acceptance for all events: | |
13018 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(1.5,cosP1nP1nW1W1,dM11); | |
13019 | } | |
13020 | ||
13021 | // 3-particle: | |
13022 | Double_t cosP1nM1nM1nW1W1W1 = 0.; // <<w1 w2 w3 cos(n*(phi1-phi2-phi3))>> | |
13023 | ||
1268c371 | 13024 | if(dMult>2 && TMath::Abs(dM111)>1.e-6) |
489d5531 | 13025 | { |
57340a27 | 13026 | cosP1nM1nM1nW1W1W1 = (dReQ1n1k*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
13027 | - dReQ1n1k*dReQ2n2k-dImQ1n1k*dImQ2n2k | |
1268c371 | 13028 | - 2.*((*fSpk)(0,2))*dReQ1n1k |
489d5531 | 13029 | + 2.*dReQ1n3k) |
13030 | / dM111; | |
13031 | ||
13032 | // average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for single event: | |
13033 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(3,cosP1nM1nM1nW1W1W1); | |
13034 | ||
13035 | // final average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for all events: | |
13036 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(2.5,cosP1nM1nM1nW1W1W1,dM111); | |
13037 | } | |
13038 | ||
13039 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights() | |
13040 | ||
13041 | ||
13042 | //================================================================================================================================ | |
13043 | ||
13044 | ||
13045 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights() | |
13046 | { | |
13047 | // calculate corrections using particle weights for non-uniform acceptance of the detector for no-name integrated flow (sin terms) | |
13048 | ||
13049 | // ********************************************************************** | |
13050 | // **** weighted corrections for non-uniform acceptance (sin terms): **** | |
13051 | // ********************************************************************** | |
13052 | ||
13053 | // Remark 1: When particle weights are used the binning of fIntFlowCorrectionTermsForNUAPro[0] is organized as follows: | |
57340a27 | 13054 | // |
489d5531 | 13055 | // 1st bin: <<w1 sin(n*(phi1))>> = sinP1nW1 |
13056 | // 2nd bin: <<w1 w2 sin(n*(phi1+phi2))>> = sinP1nP1nW1W1 | |
13057 | // 3rd bin: <<w1 w2 w3 sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1nW1W1W1 | |
13058 | // ... | |
13059 | ||
13060 | // multiplicity (number of particles used to determine the reaction plane) | |
1268c371 | 13061 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 13062 | |
13063 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
13064 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
13065 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
13066 | //Double_t dReQ3n3k = (*fReQ)(2,3); | |
13067 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
13068 | //Double_t dReQ1n3k = (*fReQ)(0,3); | |
13069 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
13070 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
13071 | //Double_t dImQ3n3k = (*fImQ)(2,3); | |
13072 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
13073 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
13074 | ||
13075 | // dMs are variables introduced in order to simplify some Eqs. bellow: | |
13076 | //.............................................................................................. | |
1268c371 | 13077 | Double_t dM11 = (*fSpk)(1,1)-(*fSpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
13078 | Double_t dM111 = (*fSpk)(2,1)-3.*(*fSpk)(0,2)*(*fSpk)(0,1) | |
13079 | + 2.*(*fSpk)(0,3); // dM111 = sum_{i,j,k=1,i!=j!=k}^M w_i w_j w_k | |
489d5531 | 13080 | //.............................................................................................. |
13081 | ||
13082 | // 1-particle: | |
13083 | Double_t sinP1nW1 = 0.; // <<w1 sin(n*(phi1))>> | |
13084 | ||
1268c371 | 13085 | if(dMult>0 && TMath::Abs((*fSpk)(0,1))>1.e-6) |
489d5531 | 13086 | { |
1268c371 | 13087 | sinP1nW1 = dImQ1n1k/((*fSpk)(0,1)); |
489d5531 | 13088 | |
13089 | // average weighted 1-particle correction (sin terms) for non-uniform acceptance for single event: | |
13090 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(1,sinP1nW1); | |
13091 | ||
13092 | // final average weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
1268c371 | 13093 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(0.5,sinP1nW1,(*fSpk)(0,1)); |
489d5531 | 13094 | } |
13095 | ||
13096 | // 2-particle: | |
13097 | Double_t sinP1nP1nW1W1 = 0.; // <<w1 w2 sin(n*(phi1+phi2))>> | |
13098 | ||
1268c371 | 13099 | if(dMult>1 && TMath::Abs(dM11)>1.e-6) |
489d5531 | 13100 | { |
13101 | sinP1nP1nW1W1 = (2.*dReQ1n1k*dImQ1n1k-dImQ2n2k)/dM11; | |
13102 | ||
13103 | // average weighted 2-particle correction (sin terms) for non-uniform acceptance for single event: | |
13104 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(2,sinP1nP1nW1W1); | |
13105 | ||
13106 | // final average weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
13107 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(1.5,sinP1nP1nW1W1,dM11); | |
13108 | } | |
13109 | ||
13110 | // 3-particle: | |
13111 | Double_t sinP1nM1nM1nW1W1W1 = 0.; // <<w1 w2 w3 sin(n*(phi1-phi2-phi3))>> | |
13112 | ||
1268c371 | 13113 | if(dMult>2 && TMath::Abs(dM111)>1.e-6) |
489d5531 | 13114 | { |
57340a27 | 13115 | sinP1nM1nM1nW1W1W1 = (-dImQ1n1k*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
13116 | + dReQ1n1k*dImQ2n2k-dImQ1n1k*dReQ2n2k | |
1268c371 | 13117 | + 2.*((*fSpk)(0,2))*dImQ1n1k |
489d5531 | 13118 | - 2.*dImQ1n3k) |
13119 | / dM111; | |
13120 | ||
13121 | // average weighted 3-particle correction (sin terms) for non-uniform acceptance for single event: | |
13122 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(3,sinP1nM1nM1nW1W1W1); | |
13123 | ||
13124 | // final average weighted 3-particle correction (sin terms) for non-uniform acceptance for all events: | |
13125 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(2.5,sinP1nM1nM1nW1W1W1,dM111); | |
13126 | } | |
13127 | ||
13128 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights() | |
13129 | ||
57340a27 | 13130 | //================================================================================================================================ |
489d5531 | 13131 | |
0328db2d | 13132 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent) |
489d5531 | 13133 | { |
13134 | // Evaluate with nested loops correction terms for non-uniform acceptance for integrated flow (using the particle weights). | |
13135 | ||
57340a27 | 13136 | // Results are stored in profiles fIntFlowDirectCorrectionTermsForNUA[0] (sin terms) and |
13137 | // fIntFlowDirectCorrectionTermsForNUA[1] (cos terms). | |
489d5531 | 13138 | |
57340a27 | 13139 | // Remark 1: When particle weights are used the binning of fIntFlowDirectCorrectionTermsForNUA[sc] is |
489d5531 | 13140 | // organized as follows (sc stands for either sin or cos): |
13141 | // | |
13142 | // 1st bin: <<w1 sc(n*(phi1))>> = scP1nW1 | |
13143 | // 2nd bin: <<w1 w2 sc(n*(phi1+phi2))>> = scP1nP1nW1W1 | |
13144 | // 3rd bin: <<w1 w2 w3 sc(n*(phi1-phi2-phi3))>> = scP1nM1nM1nW1W1W1 | |
3b552efe | 13145 | // ... |
489d5531 | 13146 | |
13147 | Int_t nPrim = anEvent->NumberOfTracks(); | |
13148 | AliFlowTrackSimple *aftsTrack = NULL; | |
13149 | //Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; | |
13150 | //Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
13151 | Double_t phi1=0., phi2=0., phi3=0.; | |
13152 | Double_t wPhi1=1., wPhi2=1., wPhi3=1.; | |
13153 | Int_t n = fHarmonic; | |
13154 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 13155 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 13156 | cout<<endl; |
13157 | cout<<"Correction terms for non-uniform acceptance: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
13158 | if(dMult<1) | |
13159 | { | |
13160 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
13161 | } else if (dMult>fMaxAllowedMultiplicity) | |
13162 | { | |
13163 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
13164 | } else | |
13165 | { | |
13166 | cout<<"... evaluating nested loops (using particle weights) ..."<<endl; | |
13167 | } | |
13168 | ||
13169 | // 1-particle correction terms using particle weights: | |
13170 | if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity) | |
13171 | { | |
13172 | for(Int_t i1=0;i1<nPrim;i1++) | |
13173 | { | |
13174 | aftsTrack=anEvent->GetTrack(i1); | |
13175 | if(!(aftsTrack->InRPSelection())) continue; | |
13176 | phi1=aftsTrack->Phi(); | |
13177 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
57340a27 | 13178 | // 1-particle correction terms using particle weights: |
489d5531 | 13179 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(0.5,sin(n*phi1),wPhi1); // <w1 sin(n*phi1)> |
13180 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(0.5,cos(n*phi1),wPhi1); // <w1 cos(n*phi1)> | |
57340a27 | 13181 | } // end of for(Int_t i1=0;i1<nPrim;i1++) |
13182 | } // end of if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity) | |
13183 | ||
489d5531 | 13184 | // 2-particle correction terms using particle weights: |
13185 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
13186 | { | |
13187 | for(Int_t i1=0;i1<nPrim;i1++) | |
13188 | { | |
13189 | aftsTrack=anEvent->GetTrack(i1); | |
13190 | if(!(aftsTrack->InRPSelection())) continue; | |
13191 | phi1=aftsTrack->Phi(); | |
13192 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
13193 | for(Int_t i2=0;i2<nPrim;i2++) | |
13194 | { | |
13195 | if(i2==i1)continue; | |
13196 | aftsTrack=anEvent->GetTrack(i2); | |
13197 | if(!(aftsTrack->InRPSelection())) continue; | |
13198 | phi2=aftsTrack->Phi(); | |
13199 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
13200 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
57340a27 | 13201 | // 2-p correction terms using particle weights: |
489d5531 | 13202 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(1.5,sin(n*(phi1+phi2)),wPhi1*wPhi2); // <w1 w2 sin(n*(phi1+phi2))> |
13203 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(1.5,cos(n*(phi1+phi2)),wPhi1*wPhi2); // <w1 w2 cos(n*(phi1+phi2))> | |
13204 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
13205 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
13206 | } // end of if(nPrim>=2) | |
13207 | ||
13208 | // 3-particle correction terms using particle weights: | |
13209 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
13210 | { | |
13211 | for(Int_t i1=0;i1<nPrim;i1++) | |
13212 | { | |
13213 | aftsTrack=anEvent->GetTrack(i1); | |
13214 | if(!(aftsTrack->InRPSelection())) continue; | |
13215 | phi1=aftsTrack->Phi(); | |
13216 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
13217 | for(Int_t i2=0;i2<nPrim;i2++) | |
13218 | { | |
13219 | if(i2==i1)continue; | |
13220 | aftsTrack=anEvent->GetTrack(i2); | |
13221 | if(!(aftsTrack->InRPSelection())) continue; | |
13222 | phi2=aftsTrack->Phi(); | |
13223 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
13224 | for(Int_t i3=0;i3<nPrim;i3++) | |
13225 | { | |
13226 | if(i3==i1||i3==i2)continue; | |
13227 | aftsTrack=anEvent->GetTrack(i3); | |
13228 | if(!(aftsTrack->InRPSelection())) continue; | |
13229 | phi3=aftsTrack->Phi(); | |
13230 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
13231 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
57340a27 | 13232 | // 3-p correction terms using particle weights: |
489d5531 | 13233 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(2.5,sin(n*(phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 sin(n*(phi1-phi2-phi3))> |
13234 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(2.5,cos(n*(phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 cos(n*(phi1-phi2-phi3))> | |
13235 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
13236 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
13237 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
13238 | } // end of if(nPrim>=3) | |
13239 | ||
57340a27 | 13240 | /* |
13241 | ||
489d5531 | 13242 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) |
13243 | { | |
13244 | // 4 nested loops multiparticle correlations using particle weights: | |
13245 | for(Int_t i1=0;i1<nPrim;i1++) | |
13246 | { | |
13247 | aftsTrack=anEvent->GetTrack(i1); | |
13248 | if(!(aftsTrack->InRPSelection())) continue; | |
13249 | phi1=aftsTrack->Phi(); | |
13250 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
13251 | for(Int_t i2=0;i2<nPrim;i2++) | |
13252 | { | |
13253 | if(i2==i1)continue; | |
13254 | aftsTrack=anEvent->GetTrack(i2); | |
13255 | if(!(aftsTrack->InRPSelection())) continue; | |
13256 | phi2=aftsTrack->Phi(); | |
13257 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
13258 | for(Int_t i3=0;i3<nPrim;i3++) | |
13259 | { | |
13260 | if(i3==i1||i3==i2)continue; | |
13261 | aftsTrack=anEvent->GetTrack(i3); | |
13262 | if(!(aftsTrack->InRPSelection())) continue; | |
13263 | phi3=aftsTrack->Phi(); | |
13264 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
13265 | for(Int_t i4=0;i4<nPrim;i4++) | |
13266 | { | |
13267 | if(i4==i1||i4==i2||i4==i3)continue; | |
13268 | aftsTrack=anEvent->GetTrack(i4); | |
13269 | if(!(aftsTrack->InRPSelection())) continue; | |
13270 | phi4=aftsTrack->Phi(); | |
13271 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); | |
13272 | if(nPrim>=4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; // to be improved (replace eventually this if statement with if(nPrim==4)) | |
13273 | // 4-p correlations using particle weights: | |
13274 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(10.5,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); | |
13275 | // extra correlations: | |
13276 | // 2-p extra correlations (do not appear if particle weights are not used): | |
13277 | // ... | |
13278 | // 3-p extra correlations (do not appear if particle weights are not used): | |
13279 | // ... | |
13280 | // 4-p extra correlations (do not appear if particle weights are not used): | |
13281 | // ... | |
13282 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
13283 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
13284 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
13285 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
13286 | } // end of if(nPrim>=4) | |
13287 | ||
13288 | */ | |
13289 | ||
13290 | cout<<endl; | |
13291 | ||
13292 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent) | |
13293 | ||
57340a27 | 13294 | //================================================================================================================================ |
489d5531 | 13295 | |
489d5531 | 13296 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights(TString type, TString ptOrEta) |
13297 | { | |
13298 | // Calculate correction terms for non-uniform acceptance for differential flow (cos terms) using particle weights. | |
57340a27 | 13299 | |
489d5531 | 13300 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][1][cti], where cti runs as follows: |
57340a27 | 13301 | // |
489d5531 | 13302 | // 0: <<cos n(psi)>> |
13303 | // 1: <<w2 cos n(psi1+phi2)>> | |
13304 | // 2: <<w2 w3 cos n(psi1+phi2-phi3)>> | |
13305 | // 3: <<w2 w3 cos n(psi1-phi2-phi3)>> | |
13306 | // 4: | |
13307 | // 5: | |
13308 | // 6: | |
13309 | ||
13310 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
13311 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
13312 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
13313 | //Double_t dReQ1n3k = (*fReQ)(0,3); | |
13314 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
13315 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
13316 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
13317 | //Double_t dImQ1n3k = (*fImQ)(0,3); | |
13318 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
13319 | ||
1268c371 | 13320 | // S^M_{p,k} (see .h file for the definition of fSpk): |
13321 | Double_t dSM1p1k = (*fSpk)(0,1); | |
13322 | Double_t dSM1p2k = (*fSpk)(0,2); | |
13323 | Double_t dSM2p1k = (*fSpk)(1,1); | |
489d5531 | 13324 | |
2a98ceb8 | 13325 | Int_t t = 0; // type flag |
13326 | Int_t pe = 0; // ptEta flag | |
489d5531 | 13327 | |
13328 | if(type == "RP") | |
13329 | { | |
13330 | t = 0; | |
13331 | } else if(type == "POI") | |
13332 | { | |
13333 | t = 1; | |
13334 | } | |
13335 | ||
13336 | if(ptOrEta == "Pt") | |
13337 | { | |
13338 | pe = 0; | |
13339 | } else if(ptOrEta == "Eta") | |
13340 | { | |
13341 | pe = 1; | |
13342 | } | |
13343 | ||
13344 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
13345 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
13346 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
13347 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
13348 | ||
13349 | // looping over all bins and calculating correction terms: | |
13350 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
13351 | { | |
13352 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
13353 | Double_t p1n0kRe = 0.; | |
13354 | Double_t p1n0kIm = 0.; | |
13355 | ||
13356 | // number of POIs in particular pt or eta bin: | |
13357 | Double_t mp = 0.; | |
13358 | ||
13359 | // real and imaginary parts of q_{m*n,0} (weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
13360 | Double_t q1n2kRe = 0.; | |
13361 | Double_t q1n2kIm = 0.; | |
13362 | Double_t q2n1kRe = 0.; | |
13363 | Double_t q2n1kIm = 0.; | |
46b94261 | 13364 | |
489d5531 | 13365 | // s_{1,1}, s_{1,2} // to be improved (add explanation) |
13366 | Double_t s1p1k = 0.; | |
13367 | Double_t s1p2k = 0.; | |
46b94261 | 13368 | |
489d5531 | 13369 | // number of particles which are both RPs and POIs in particular pt or eta bin: |
46b94261 | 13370 | Double_t mq = 0.; |
489d5531 | 13371 | |
13372 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
13373 | Double_t dM01 = 0.; | |
13374 | Double_t dM011 = 0.; | |
13375 | ||
13376 | if(type == "POI") | |
13377 | { | |
13378 | // q_{m*n,k}: | |
13379 | q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
13380 | * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
13381 | q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
13382 | * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
13383 | q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
13384 | * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
13385 | q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
13386 | * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
13387 | mq = fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
46b94261 | 13388 | |
489d5531 | 13389 | s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); |
13390 | s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); | |
13391 | }else if(type == "RP") | |
13392 | { | |
13393 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
13394 | q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
13395 | * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
13396 | q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
13397 | * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
13398 | q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
13399 | * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
13400 | q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
13401 | * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
13402 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
13403 | s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); | |
13404 | s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); | |
3b552efe | 13405 | //s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); |
13406 | ||
489d5531 | 13407 | mq = fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) |
13408 | } | |
3b552efe | 13409 | |
489d5531 | 13410 | if(type == "POI") |
3b552efe | 13411 | { |
13412 | // p_{m*n,k}: | |
489d5531 | 13413 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) |
13414 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
13415 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
3b552efe | 13416 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); |
13417 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
489d5531 | 13418 | // M01 from Eq. (118) in QC2c (to be improved (notation)): |
3b552efe | 13419 | dM01 = mp*dSM1p1k-s1p1k; |
13420 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
13421 | - 2.*(s1p1k*dSM1p1k-s1p2k); | |
13422 | ||
13423 | // typeFlag = RP (0) or POI (1): | |
13424 | t = 1; | |
13425 | } else if(type == "RP") | |
489d5531 | 13426 | { |
13427 | // to be improved (cross-checked): | |
13428 | p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
13429 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
13430 | p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
13431 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
13432 | mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
13433 | // M01 from Eq. (118) in QC2c (to be improved (notation)): | |
3b552efe | 13434 | dM01 = mp*dSM1p1k-s1p1k; |
13435 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
13436 | - 2.*(s1p1k*dSM1p1k-s1p2k); | |
489d5531 | 13437 | // typeFlag = RP (0) or POI (1): |
3b552efe | 13438 | t = 0; |
13439 | } | |
489d5531 | 13440 | |
13441 | // <<cos n(psi1)>>: | |
13442 | Double_t cosP1nPsi = 0.; | |
13443 | if(mp) | |
13444 | { | |
13445 | cosP1nPsi = p1n0kRe/mp; | |
13446 | ||
13447 | // fill profile for <<cos n(psi1)>>: | |
13448 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi,mp); | |
13449 | // histogram to store <cos n(psi1)> e-b-e (needed in some other methods): | |
13450 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][0]->SetBinContent(b,cosP1nPsi); | |
46b94261 | 13451 | } // end of if(mp) |
57340a27 | 13452 | |
489d5531 | 13453 | // <<w2 cos n(psi1+phi2)>>: |
13454 | Double_t cosP1nPsiP1nPhiW2 = 0.; | |
13455 | if(dM01) | |
13456 | { | |
13457 | cosP1nPsiP1nPhiW2 = (p1n0kRe*dReQ1n1k-p1n0kIm*dImQ1n1k-q2n1kRe)/(dM01); | |
13458 | // fill profile for <<w2 cos n(psi1+phi2)>>: | |
13459 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsiP1nPhiW2,dM01); | |
13460 | // histogram to store <w2 cos n(psi1+phi2)> e-b-e (needed in some other methods): | |
13461 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][1]->SetBinContent(b,cosP1nPsiP1nPhiW2); | |
13462 | } // end of if(dM01) | |
13463 | ||
13464 | // <<w2 w3 cos n(psi1+phi2-phi3)>>: | |
13465 | Double_t cosP1nPsi1P1nPhi2MPhi3W2W3 = 0.; | |
13466 | if(dM011) | |
13467 | { | |
46b94261 | 13468 | cosP1nPsi1P1nPhi2MPhi3W2W3 = (p1n0kRe*(pow(dImQ1n1k,2.)+pow(dReQ1n1k,2.)) |
13469 | - p1n0kRe*dSM1p2k | |
13470 | - q2n1kRe*dReQ1n1k-q2n1kIm*dImQ1n1k | |
13471 | - s1p1k*dReQ1n1k | |
13472 | + 2.*q1n2kRe) | |
13473 | / dM011; | |
489d5531 | 13474 | // fill profile for <<w1 w2 w3 cos n(psi1+phi2)>>: |
13475 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1P1nPhi2MPhi3W2W3,dM011); | |
13476 | // histogram to store <w1 w2 w3 cos n(psi1+phi2)> e-b-e (needed in some other methods): | |
13477 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][2]->SetBinContent(b,cosP1nPsi1P1nPhi2MPhi3W2W3); | |
13478 | } // end of if(dM011) | |
13479 | ||
13480 | // <<w2 w3 cos n(psi1-phi2-phi3)>>: | |
13481 | Double_t cosP1nPsi1M1nPhi2MPhi3W2W3 = 0.; | |
13482 | if(dM011) | |
13483 | { | |
13484 | cosP1nPsi1M1nPhi2MPhi3W2W3 = (p1n0kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))+2.*p1n0kIm*dReQ1n1k*dImQ1n1k | |
13485 | - 1.*(p1n0kRe*dReQ2n2k+p1n0kIm*dImQ2n2k) | |
46b94261 | 13486 | - 2.*s1p1k*dReQ1n1k |
489d5531 | 13487 | + 2.*q1n2kRe) |
13488 | / dM011; | |
13489 | // fill profile for <<w1 w2 w3 cos n(psi1+phi2)>>: | |
13490 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1M1nPhi2MPhi3W2W3,dM011); | |
13491 | // histogram to store <w1 w2 w3 cos n(psi1+phi2)> e-b-e (needed in some other methods): | |
13492 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][3]->SetBinContent(b,cosP1nPsi1M1nPhi2MPhi3W2W3); | |
13493 | } // end of if(dM011) | |
13494 | ||
13495 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
46b94261 | 13496 | |
57340a27 | 13497 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights(TString type, TString ptOrEta) |
13498 | ||
489d5531 | 13499 | |
13500 | //================================================================================================================================ | |
13501 | ||
13502 | ||
13503 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights(TString type, TString ptOrEta) | |
13504 | { | |
13505 | // Calculate correction terms for non-uniform acceptance for differential flow (sin terms). | |
13506 | ||
13507 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][0][cti], where cti runs as follows: | |
13508 | // 0: <<sin n(psi1)>> | |
13509 | // 1: <<w2 sin n(psi1+phi2)>> | |
13510 | // 2: <<w2 w3 sin n(psi1+phi2-phi3)>> | |
13511 | // 3: <<w2 w3 sin n(psi1-phi2-phi3)>>: | |
13512 | // 4: | |
13513 | // 5: | |
13514 | // 6: | |
13515 | ||
13516 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
13517 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
13518 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
13519 | //Double_t dReQ1n3k = (*fReQ)(0,3); | |
13520 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
13521 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
13522 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
13523 | //Double_t dImQ1n3k = (*fImQ)(0,3); | |
13524 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
13525 | ||
1268c371 | 13526 | // S^M_{p,k} (see .h file for the definition of fSpk): |
13527 | Double_t dSM1p1k = (*fSpk)(0,1); | |
13528 | Double_t dSM1p2k = (*fSpk)(0,2); | |
13529 | Double_t dSM2p1k = (*fSpk)(1,1); | |
489d5531 | 13530 | |
2a98ceb8 | 13531 | Int_t t = 0; // type flag |
13532 | Int_t pe = 0; // ptEta flag | |
489d5531 | 13533 | |
13534 | if(type == "RP") | |
13535 | { | |
13536 | t = 0; | |
13537 | } else if(type == "POI") | |
13538 | { | |
13539 | t = 1; | |
13540 | } | |
13541 | ||
13542 | if(ptOrEta == "Pt") | |
13543 | { | |
13544 | pe = 0; | |
13545 | } else if(ptOrEta == "Eta") | |
13546 | { | |
13547 | pe = 1; | |
13548 | } | |
13549 | ||
13550 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
13551 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
13552 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
13553 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
13554 | ||
13555 | // looping over all bins and calculating correction terms: | |
13556 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
13557 | { | |
13558 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
13559 | Double_t p1n0kRe = 0.; | |
13560 | Double_t p1n0kIm = 0.; | |
13561 | ||
13562 | // number of POIs in particular pt or eta bin: | |
13563 | Double_t mp = 0.; | |
13564 | ||
13565 | // real and imaginary parts of q_{m*n,0} (weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
13566 | Double_t q1n2kRe = 0.; | |
13567 | Double_t q1n2kIm = 0.; | |
13568 | Double_t q2n1kRe = 0.; | |
13569 | Double_t q2n1kIm = 0.; | |
46b94261 | 13570 | |
489d5531 | 13571 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) |
13572 | Double_t s1p1k = 0.; | |
13573 | Double_t s1p2k = 0.; | |
46b94261 | 13574 | |
489d5531 | 13575 | // number of particles which are both RPs and POIs in particular pt or eta bin: |
46b94261 | 13576 | Double_t mq = 0.; |
489d5531 | 13577 | |
13578 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
13579 | Double_t dM01 = 0.; | |
13580 | Double_t dM011 = 0.; | |
13581 | ||
13582 | if(type == "POI") | |
13583 | { | |
13584 | // q_{m*n,k}: | |
13585 | q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
13586 | * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
13587 | q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
13588 | * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
13589 | q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
13590 | * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
13591 | q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
13592 | * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
13593 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
46b94261 | 13594 | |
489d5531 | 13595 | s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); |
13596 | s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); | |
13597 | }else if(type == "RP") | |
13598 | { | |
13599 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
13600 | q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
13601 | * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
13602 | q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
13603 | * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
13604 | q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
13605 | * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
13606 | q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
13607 | * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
13608 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
13609 | s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); | |
13610 | s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); | |
13611 | //s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); | |
3b552efe | 13612 | } |
13613 | ||
13614 | if(type == "POI") | |
13615 | { | |
13616 | // p_{m*n,k}: | |
489d5531 | 13617 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) |
13618 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
13619 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
3b552efe | 13620 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); |
13621 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
489d5531 | 13622 | // M01 from Eq. (118) in QC2c (to be improved (notation)): |
3b552efe | 13623 | dM01 = mp*dSM1p1k-s1p1k; |
13624 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
13625 | - 2.*(s1p1k*dSM1p1k-s1p2k); | |
13626 | // typeFlag = RP (0) or POI (1): | |
13627 | t = 1; | |
489d5531 | 13628 | } else if(type == "RP") |
3b552efe | 13629 | { |
489d5531 | 13630 | // to be improved (cross-checked): |
13631 | p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
13632 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
13633 | p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
13634 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
13635 | mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
13636 | // M01 from Eq. (118) in QC2c (to be improved (notation)): | |
3b552efe | 13637 | dM01 = mp*dSM1p1k-s1p1k; |
13638 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
489d5531 | 13639 | - 2.*(s1p1k*dSM1p1k-s1p2k); |
13640 | // typeFlag = RP (0) or POI (1): | |
3b552efe | 13641 | t = 0; |
13642 | } | |
13643 | ||
489d5531 | 13644 | // <<sin n(psi1)>>: |
13645 | Double_t sinP1nPsi = 0.; | |
13646 | if(mp) | |
13647 | { | |
13648 | sinP1nPsi = p1n0kIm/mp; | |
13649 | ||
13650 | // fill profile for <<sin n(psi1)>>: | |
13651 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi,mp); | |
13652 | // histogram to store <sin n(psi1)> e-b-e (needed in some other methods): | |
13653 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][0]->SetBinContent(b,sinP1nPsi); | |
46b94261 | 13654 | } // end of if(mp) |
13655 | ||
489d5531 | 13656 | // <<w2 sin n(psi1+phi2)>>: |
13657 | Double_t sinP1nPsiP1nPhiW2 = 0.; | |
13658 | if(dM01) | |
13659 | { | |
13660 | sinP1nPsiP1nPhiW2 = (p1n0kRe*dImQ1n1k+p1n0kIm*dReQ1n1k-q2n1kIm)/(dM01); | |
13661 | // fill profile for <<w2 sin n(psi1+phi2)>>: | |
13662 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsiP1nPhiW2,dM01); | |
13663 | // histogram to store <w2 sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
13664 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][1]->SetBinContent(b,sinP1nPsiP1nPhiW2); | |
13665 | } // end of if(mp*dMult-mq) | |
13666 | ||
13667 | // <<w2 w3 sin n(psi1+phi2-phi3)>>: | |
13668 | Double_t sinP1nPsi1P1nPhi2MPhi3W2W3 = 0.; | |
13669 | if(dM011) | |
13670 | { | |
46b94261 | 13671 | sinP1nPsi1P1nPhi2MPhi3W2W3 = (p1n0kIm*(pow(dImQ1n1k,2.)+pow(dReQ1n1k,2.)) |
13672 | - p1n0kIm*dSM1p2k | |
13673 | + q2n1kRe*dImQ1n1k-q2n1kIm*dReQ1n1k | |
13674 | - s1p1k*dImQ1n1k | |
13675 | + 2.*q1n2kIm) | |
13676 | / dM011; | |
489d5531 | 13677 | // fill profile for <<w2 w3 sin n(psi1+phi2-phi3)>>: |
13678 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1P1nPhi2MPhi3W2W3,dM011); | |
13679 | // histogram to store <w2 w3 sin n(psi1+phi2-phi3)> e-b-e (needed in some other methods): | |
13680 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][2]->SetBinContent(b,sinP1nPsi1P1nPhi2MPhi3W2W3); | |
13681 | } // end of if(dM011) | |
13682 | ||
13683 | // <<w2 w3 sin n(psi1-phi2-phi3)>>: | |
13684 | Double_t sinP1nPsi1M1nPhi2MPhi3W2W3 = 0.; | |
13685 | if(dM011) | |
13686 | { | |
13687 | sinP1nPsi1M1nPhi2MPhi3W2W3 = (p1n0kIm*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))-2.*p1n0kRe*dReQ1n1k*dImQ1n1k | |
13688 | + 1.*(p1n0kRe*dImQ2n2k-p1n0kIm*dReQ2n2k) | |
46b94261 | 13689 | + 2.*s1p1k*dImQ1n1k |
489d5531 | 13690 | - 2.*q1n2kIm) |
13691 | / dM011; | |
13692 | // fill profile for <<w2 w3 sin n(psi1-phi2-phi3)>>: | |
13693 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1M1nPhi2MPhi3W2W3,dM011); | |
13694 | // histogram to store <w2 w3 sin n(psi1-phi2-phi3)> e-b-e (needed in some other methods): | |
13695 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][3]->SetBinContent(b,sinP1nPsi1M1nPhi2MPhi3W2W3); | |
13696 | } // end of if(dM011) | |
13697 | ||
13698 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
13699 | ||
13700 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights(TString type, TString ptOrEta) | |
13701 | ||
489d5531 | 13702 | //================================================================================================================================ |
489d5531 | 13703 | |
0328db2d | 13704 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 13705 | { |
57340a27 | 13706 | // Evaluate with nested loops correction terms for non-uniform acceptance |
489d5531 | 13707 | // with using particle weights (both sin and cos terms) relevant for differential flow. |
13708 | ||
57340a27 | 13709 | // Remark 1: "w1" in expressions bellow is a particle weight used only for particles which were |
13710 | // flagged both as POI and RP. | |
489d5531 | 13711 | // Remark 2: Reduced correction terms for non-uniform acceptance are evaluated in pt bin number fCrossCheckInPtBinNo |
13712 | // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
13713 | // Remark 3: Results are stored in 1 bin profiles fDiffFlowDirectCorrections[t][pe][sc][cti], where first three indices runs as: | |
13714 | // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms], whilst the cti (correction term index) runs as follows: | |
13715 | // cti: | |
13716 | // 0: <<sc n(psi1)>> | |
13717 | // 1: <<w2 sc n(psi1+phi2)>> | |
13718 | // 2: <<w2 w3 sc n(psi1+phi2-phi3)>> | |
13719 | // 3: <<w2 w3 sc n(psi1-phi2-phi3)>> | |
13720 | // 4: | |
13721 | // 5: | |
13722 | // 6: | |
46b94261 | 13723 | |
2a98ceb8 | 13724 | Int_t typeFlag = 0; |
13725 | Int_t ptEtaFlag = 0; | |
489d5531 | 13726 | if(type == "RP") |
13727 | { | |
13728 | typeFlag = 0; | |
13729 | } else if(type == "POI") | |
13730 | { | |
13731 | typeFlag = 1; | |
13732 | } | |
13733 | if(ptOrEta == "Pt") | |
13734 | { | |
13735 | ptEtaFlag = 0; | |
13736 | } else if(ptOrEta == "Eta") | |
13737 | { | |
13738 | ptEtaFlag = 1; | |
13739 | } | |
13740 | // shortcuts: | |
13741 | Int_t t = typeFlag; | |
13742 | Int_t pe = ptEtaFlag; | |
13743 | ||
13744 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
13745 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
13746 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
13747 | ||
13748 | Int_t nPrim = anEvent->NumberOfTracks(); | |
13749 | AliFlowTrackSimple *aftsTrack = NULL; | |
13750 | ||
13751 | Double_t psi1=0., phi2=0., phi3=0.;// phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
13752 | Double_t wPhi2=1., wPhi3=1.; | |
13753 | ||
13754 | Int_t n = fHarmonic; | |
13755 | ||
13756 | // 1'-particle correction terms: | |
13757 | for(Int_t i1=0;i1<nPrim;i1++) | |
13758 | { | |
13759 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 13760 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
13761 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 13762 | { |
13763 | if(ptOrEta == "Pt") | |
13764 | { | |
13765 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
13766 | } else if (ptOrEta == "Eta") | |
13767 | { | |
13768 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 13769 | } |
13770 | } else // this is diff flow of RPs | |
13771 | { | |
489d5531 | 13772 | if(ptOrEta == "Pt") |
13773 | { | |
13774 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
13775 | } else if (ptOrEta == "Eta") | |
13776 | { | |
13777 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 13778 | } |
489d5531 | 13779 | } |
13780 | psi1=aftsTrack->Phi(); | |
13781 | // sin terms: | |
13782 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*psi1),1.); // <<sin(n*(psi1))>> | |
13783 | // cos terms: | |
13784 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*psi1),1.); // <<cos(n*(psi1))>> | |
13785 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
13786 | ||
13787 | // 2'-particle correction terms: | |
13788 | for(Int_t i1=0;i1<nPrim;i1++) | |
13789 | { | |
13790 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 13791 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
13792 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 13793 | { |
13794 | if(ptOrEta == "Pt") | |
13795 | { | |
13796 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
13797 | } else if (ptOrEta == "Eta") | |
13798 | { | |
13799 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 13800 | } |
13801 | } else // this is diff flow of RPs | |
13802 | { | |
489d5531 | 13803 | if(ptOrEta == "Pt") |
13804 | { | |
13805 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
13806 | } else if (ptOrEta == "Eta") | |
13807 | { | |
13808 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 13809 | } |
489d5531 | 13810 | } |
13811 | psi1=aftsTrack->Phi(); | |
13812 | for(Int_t i2=0;i2<nPrim;i2++) | |
13813 | { | |
13814 | if(i2==i1) continue; | |
13815 | aftsTrack=anEvent->GetTrack(i2); | |
13816 | // RP condition (!(first) particle in the correlator must be RP): | |
13817 | if(!(aftsTrack->InRPSelection())) continue; | |
46b94261 | 13818 | phi2=aftsTrack->Phi(); |
489d5531 | 13819 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); |
13820 | // sin terms: | |
13821 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2)),wPhi2); // <<w2 sin(n*(psi1+phi2))>> | |
13822 | // cos terms: | |
13823 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2)),wPhi2); // <<w2 cos(n*(psi1+phi2))>> | |
13824 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
13825 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
13826 | ||
13827 | // 3'-particle correction terms: | |
13828 | for(Int_t i1=0;i1<nPrim;i1++) | |
13829 | { | |
13830 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 13831 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
13832 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 13833 | { |
13834 | if(ptOrEta == "Pt") | |
13835 | { | |
13836 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
13837 | } else if (ptOrEta == "Eta") | |
13838 | { | |
13839 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 13840 | } |
13841 | } else // this is diff flow of RPs | |
13842 | { | |
489d5531 | 13843 | if(ptOrEta == "Pt") |
13844 | { | |
13845 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
13846 | } else if (ptOrEta == "Eta") | |
13847 | { | |
13848 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 13849 | } |
489d5531 | 13850 | } |
13851 | psi1=aftsTrack->Phi(); | |
13852 | for(Int_t i2=0;i2<nPrim;i2++) | |
13853 | { | |
13854 | if(i2==i1) continue; | |
13855 | aftsTrack=anEvent->GetTrack(i2); | |
13856 | // RP condition (!(first) particle in the correlator must be RP): | |
13857 | if(!(aftsTrack->InRPSelection())) continue; | |
13858 | phi2=aftsTrack->Phi(); | |
13859 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
13860 | for(Int_t i3=0;i3<nPrim;i3++) | |
13861 | { | |
13862 | if(i3==i1||i3==i2) continue; | |
13863 | aftsTrack=anEvent->GetTrack(i3); | |
13864 | // RP condition (!(first) particle in the correlator must be RP): | |
13865 | if(!(aftsTrack->InRPSelection())) continue; | |
13866 | phi3=aftsTrack->Phi(); | |
13867 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
13868 | // sin terms: | |
13869 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 sin(n*(psi1+phi2-phi3))>> | |
13870 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1-phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 sin(n*(psi1-phi2-phi3))>> | |
13871 | // cos terms: | |
13872 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 cos(n*(psi1+phi2-phi3))>> | |
13873 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 cos(n*(psi1-phi2-phi3))>> | |
13874 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
13875 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
46b94261 | 13876 | }//end of for(Int_t i1=0;i1<nPrim;i1++) |
489d5531 | 13877 | |
13878 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
13879 | ||
2001bc3a | 13880 | //================================================================================================================================ |
13881 | ||
b3dacf6b | 13882 | void AliFlowAnalysisWithQCumulants::CheckPointersUsedInFinish() |
13883 | { | |
13884 | // Check all pointers used in method Finish(). | |
13885 | ||
b77b6434 | 13886 | if(!fAvMultiplicity) |
13887 | { | |
13888 | cout<<endl; | |
13889 | cout<<" WARNING (QC): fAvMultiplicity is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13890 | cout<<endl; | |
13891 | exit(0); | |
13892 | } | |
b3dacf6b | 13893 | if(!fIntFlowCorrelationsPro) |
13894 | { | |
13895 | cout<<endl; | |
13896 | cout<<" WARNING (QC): fIntFlowCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13897 | cout<<endl; | |
13898 | exit(0); | |
13899 | } | |
b40a910e | 13900 | if(!fIntFlowSquaredCorrelationsPro) |
13901 | { | |
13902 | cout<<endl; | |
13903 | cout<<" WARNING (QC): fIntFlowSquaredCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13904 | cout<<endl; | |
13905 | exit(0); | |
13906 | } | |
b3dacf6b | 13907 | if(!fIntFlowCorrelationsHist) |
13908 | { | |
13909 | cout<<endl; | |
13910 | cout<<" WARNING (QC): fIntFlowCorrelationsHist is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13911 | cout<<endl; | |
13912 | exit(0); | |
13913 | } | |
403e3389 | 13914 | if((fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) && !fIntFlowExtraCorrelationsPro) |
b77b6434 | 13915 | { |
13916 | cout<<endl; | |
13917 | cout<<" WARNING (QC): fIntFlowExtraCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13918 | cout<<endl; | |
13919 | exit(0); | |
13920 | } | |
b3dacf6b | 13921 | for(Int_t power=0;power<2;power++) |
13922 | { | |
13923 | if(!fIntFlowSumOfEventWeights[power]) | |
13924 | { | |
13925 | cout<<endl; | |
13926 | cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeights[%d] is NULL in CheckPointersUsedInFinish() !!!!",power)<<endl; | |
13927 | cout<<endl; | |
13928 | exit(0); | |
13929 | } | |
13930 | } // end of for(Int_t power=0;power<2;power++) | |
13931 | if(!fIntFlowProductOfCorrelationsPro) | |
13932 | { | |
13933 | cout<<endl; | |
13934 | cout<<" WARNING (QC): fIntFlowProductOfCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13935 | cout<<endl; | |
13936 | exit(0); | |
13937 | } | |
13938 | if(!fIntFlowSumOfProductOfEventWeights) | |
13939 | { | |
13940 | cout<<endl; | |
13941 | cout<<" WARNING (QC): fIntFlowSumOfProductOfEventWeights is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13942 | cout<<endl; | |
13943 | exit(0); | |
13944 | } | |
13945 | if(!fIntFlowCovariances) | |
13946 | { | |
13947 | cout<<endl; | |
13948 | cout<<" WARNING (QC): fIntFlowCovariances is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13949 | cout<<endl; | |
13950 | exit(0); | |
13951 | } | |
13952 | if(!fIntFlowQcumulants) | |
13953 | { | |
13954 | cout<<endl; | |
13955 | cout<<" WARNING (QC): fIntFlowQcumulants is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13956 | cout<<endl; | |
13957 | exit(0); | |
13958 | } | |
0dd3b008 | 13959 | if(!fIntFlow) |
13960 | { | |
13961 | cout<<endl; | |
13962 | cout<<" WARNING (QC): fIntFlow is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13963 | cout<<endl; | |
13964 | exit(0); | |
13965 | } | |
13966 | if(!fCommonHists) | |
13967 | { | |
13968 | cout<<endl; | |
13969 | cout<<" WARNING (QC): fCommonHists is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13970 | cout<<endl; | |
13971 | exit(0); | |
13972 | } | |
13973 | if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th)) | |
13974 | { | |
13975 | cout<<endl; | |
13976 | cout<<" WARNING (QC): fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th"<<endl; | |
13977 | cout<<" && fCommonHistsResults8th is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
13978 | cout<<endl; | |
13979 | exit(0); | |
13980 | } | |
b3dacf6b | 13981 | |
b92ea2b9 | 13982 | // NUA stuff: |
13983 | for(Int_t sc=0;sc<2;sc++) // sin/cos | |
13984 | { | |
13985 | if(!fIntFlowCorrectionTermsForNUAPro[sc]) | |
13986 | { | |
13987 | cout<<endl; | |
13988 | cout<<Form(" WARNING (QC): fIntFlowCorrectionTermsForNUAPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",sc)<<endl; | |
13989 | cout<<endl; | |
13990 | exit(0); | |
13991 | } | |
13992 | if(!fIntFlowCorrectionTermsForNUAHist[sc]) | |
13993 | { | |
13994 | cout<<endl; | |
13995 | cout<<Form(" WARNING (QC): fIntFlowCorrectionTermsForNUAHist[%d] is NULL in CheckPointersUsedInFinish() !!!!",sc)<<endl; | |
13996 | cout<<endl; | |
13997 | exit(0); | |
13998 | } | |
13999 | for(Int_t lq=0;lq<2;lq++) // linear/quadratic | |
14000 | { | |
14001 | if(!fIntFlowSumOfEventWeightsNUA[sc][lq]) | |
14002 | { | |
14003 | cout<<endl; | |
14004 | cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeightsNUA[%d][%d] is NULL in CheckPointersUsedInFinish() !!!!",sc,lq)<<endl; | |
14005 | cout<<endl; | |
14006 | exit(0); | |
14007 | } | |
14008 | } // end of for(Int_t lq=0;lq<2;lq++) // linear/quadratic | |
14009 | } // end of for(Int_t power=0;power<2;power++) | |
14010 | if(!fIntFlowProductOfCorrectionTermsForNUAPro) | |
14011 | { | |
14012 | cout<<endl; | |
14013 | cout<<" WARNING (QC): fIntFlowProductOfCorrectionTermsForNUAPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14014 | cout<<endl; | |
14015 | exit(0); | |
14016 | } | |
14017 | if(!fIntFlowSumOfProductOfEventWeightsNUA) | |
14018 | { | |
14019 | cout<<endl; | |
14020 | cout<<" WARNING (QC): fIntFlowSumOfProductOfEventWeightsNUA is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14021 | cout<<endl; | |
14022 | exit(0); | |
14023 | } | |
14024 | if(!fIntFlowCovariancesNUA) | |
14025 | { | |
14026 | cout<<endl; | |
14027 | cout<<" WARNING (QC): fIntFlowCovariancesNUA is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14028 | cout<<endl; | |
14029 | exit(0); | |
14030 | } | |
14031 | if(!fIntFlowQcumulantsErrorSquaredRatio) | |
14032 | { | |
14033 | cout<<endl; | |
14034 | cout<<" WARNING (QC): fIntFlowQcumulantsErrorSquaredRatio is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14035 | cout<<endl; | |
14036 | exit(0); | |
14037 | } | |
14038 | if(!fIntFlowDetectorBias) | |
14039 | { | |
14040 | cout<<endl; | |
14041 | cout<<" WARNING (QC): fIntFlowDetectorBias is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14042 | cout<<endl; | |
14043 | exit(0); | |
14044 | } | |
14045 | ||
b3dacf6b | 14046 | // Versus multiplicity: |
14047 | if(!fCalculateCumulantsVsM){return;} | |
b77b6434 | 14048 | for(Int_t co=0;co<=3;co++) // cumulant order |
b3dacf6b | 14049 | { |
b77b6434 | 14050 | if(!fIntFlowQcumulantsVsM[co]) |
b3dacf6b | 14051 | { |
14052 | cout<<endl; | |
b77b6434 | 14053 | cout<<Form(" WARNING (QC): fIntFlowQcumulantsVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",co)<<endl; |
b3dacf6b | 14054 | cout<<endl; |
14055 | exit(0); | |
14056 | } | |
b77b6434 | 14057 | if(!fIntFlowVsM[co]) |
b3dacf6b | 14058 | { |
14059 | cout<<endl; | |
b77b6434 | 14060 | cout<<Form(" WARNING (QC): fIntFlowVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",co)<<endl; |
14061 | cout<<endl; | |
14062 | exit(0); | |
14063 | } | |
14064 | if(!fIntFlowDetectorBiasVsM[co]) | |
14065 | { | |
14066 | cout<<endl; | |
14067 | cout<<Form(" WARNING (QC): fIntFlowDetectorBiasVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",co)<<endl; | |
14068 | cout<<endl; | |
14069 | exit(0); | |
14070 | } | |
14071 | } // end of for(Int_t c0=0;c0<=3;c0++) // cumulant order | |
14072 | for(Int_t ci=0;ci<=3;ci++) // correlation index | |
14073 | { | |
14074 | if(!fIntFlowCorrelationsVsMPro[ci]) | |
14075 | { | |
14076 | cout<<endl; | |
14077 | cout<<Form(" WARNING (QC): fIntFlowCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl; | |
b3dacf6b | 14078 | cout<<endl; |
14079 | exit(0); | |
14080 | } | |
b40a910e | 14081 | if(!fIntFlowSquaredCorrelationsVsMPro[ci]) |
14082 | { | |
14083 | cout<<endl; | |
14084 | cout<<Form(" WARNING (QC): fIntFlowSquaredCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl; | |
14085 | cout<<endl; | |
14086 | exit(0); | |
14087 | } | |
b77b6434 | 14088 | if(!fIntFlowCorrelationsVsMHist[ci]) |
b92ea2b9 | 14089 | { |
14090 | cout<<endl; | |
b77b6434 | 14091 | cout<<Form(" WARNING (QC): fIntFlowCorrelationsVsMHist[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl; |
b92ea2b9 | 14092 | cout<<endl; |
14093 | exit(0); | |
14094 | } | |
b3dacf6b | 14095 | for(Int_t power=0;power<2;power++) |
14096 | { | |
14097 | if(!fIntFlowSumOfEventWeightsVsM[ci][power]) | |
14098 | { | |
14099 | cout<<endl; | |
14100 | cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeightsVsM[%d][%d] is NULL in CheckPointersUsedInFinish() !!!!",ci,power)<<endl; | |
14101 | cout<<endl; | |
14102 | exit(0); | |
14103 | } | |
14104 | } // end of for(Int_t power=0;power<2;power++) | |
14105 | } // end of for(Int_t ci=0;ci<=3;ci++) // correlation index | |
14106 | for(Int_t i=0;i<6;i++) | |
14107 | { | |
14108 | if(!fIntFlowProductOfCorrelationsVsMPro[i]) | |
14109 | { | |
14110 | cout<<endl; | |
14111 | cout<<Form(" WARNING (QC): fIntFlowProductOfCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl; | |
14112 | cout<<endl; | |
14113 | exit(0); | |
14114 | } | |
14115 | if(!fIntFlowSumOfProductOfEventWeightsVsM[i]) | |
14116 | { | |
14117 | cout<<endl; | |
14118 | cout<<Form(" WARNING (QC): fIntFlowSumOfProductOfEventWeightsVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl; | |
14119 | cout<<endl; | |
14120 | exit(0); | |
14121 | } | |
14122 | if(!fIntFlowCovariancesVsM[i]) | |
14123 | { | |
14124 | cout<<endl; | |
14125 | cout<<Form(" WARNING (QC): fIntFlowCovariancesVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl; | |
14126 | cout<<endl; | |
14127 | exit(0); | |
14128 | } | |
14129 | } // end of for(Int_t i=0;i<6;i++) | |
14130 | if(!fIntFlowRebinnedInM) | |
14131 | { | |
14132 | cout<<endl; | |
14133 | cout<<" WARNING (QC): fIntFlowRebinnedInM is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14134 | cout<<endl; | |
14135 | exit(0); | |
14136 | } | |
14137 | if(!fIntFlowQcumulantsRebinnedInM) | |
14138 | { | |
14139 | cout<<endl; | |
14140 | cout<<" WARNING (QC): fIntFlowQcumulantsRebinnedInM is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14141 | cout<<endl; | |
14142 | exit(0); | |
14143 | } | |
14144 | ||
14145 | } // end of void AliFlowAnalysisWithQCumulants::CheckPointersUsedInFinish() | |
14146 | ||
14147 | //================================================================================================================================ | |
14148 | ||
14149 | void AliFlowAnalysisWithQCumulants::CheckPointersUsedInMake() | |
14150 | { | |
1268c371 | 14151 | // Check all pointers used in method Make(). // to be improved - check other pointers as well |
b3dacf6b | 14152 | |
b77b6434 | 14153 | if(!fAvMultiplicity) |
14154 | { | |
1268c371 | 14155 | printf("\n WARNING (QC): fAvMultiplicity is NULL in CheckPointersUsedInMake() !!!!\n\n"); |
b77b6434 | 14156 | exit(0); |
14157 | } | |
403e3389 | 14158 | if((fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) && !fIntFlowExtraCorrelationsPro) |
b77b6434 | 14159 | { |
1268c371 | 14160 | printf("\n WARNING (QC): fIntFlowExtraCorrelationsPro is NULL in CheckPointersUsedInMake() !!!!\n\n"); |
b77b6434 | 14161 | exit(0); |
14162 | } | |
1268c371 | 14163 | // 2D: |
14164 | if(fCalculate2DDiffFlow) | |
14165 | { | |
14166 | for(Int_t t=0;t<2;t++) // type = RP or POI | |
14167 | { | |
14168 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
14169 | { | |
14170 | if(!f2DDiffFlowCorrelationsPro[t][rci]) | |
14171 | { | |
14172 | printf("\n WARNING (QC): f2DDiffFlowCorrelationsPro[%i][%i] is NULL in CheckPointersUsedInMake() !!!!\n\n",t,rci); | |
14173 | exit(0); | |
14174 | } // end of if(!f2DDiffFlowCorrelationsPro[t][rci]) | |
14175 | } // end of for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
14176 | } // end of for(Int_t t=0;t<2;t++) | |
14177 | } // end of if(fCalculate2DDiffFlow) | |
b3dacf6b | 14178 | |
14179 | } // end of void AliFlowAnalysisWithQCumulants::CheckPointersUsedInMake() | |
14180 | ||
57340a27 | 14181 |