-/*************************************************************************\r
-* Copyright(c) 1998-2008, ALICE Experiment at CERN, All rights reserved. *\r
-* *\r
-* Author: The ALICE Off-line Project. *\r
-* Contributors are mentioned in the code where appropriate. *\r
-* *\r
-* Permission to use, copy, modify and distribute this software and its *\r
-* documentation strictly for non-commercial purposes is hereby granted *\r
-* without fee, provided that the above copyright notice appears in all *\r
-* copies and that both the copyright notice and this permission notice *\r
-* appear in the supporting documentation. The authors make no claims *\r
-* about the suitability of this software for any purpose. It is *\r
-* provided "as is" without express or implied warranty. * \r
-**************************************************************************/\r
-\r
-/********************************** \r
- * flow analysis with Q-cumulants * \r
- * * \r
- * author: Ante Bilandzic * \r
- * (anteb@nikhef.nl) *\r
- *********************************/ \r
-\r
-#define AliFlowAnalysisWithQCumulants_cxx\r
-\r
-#include "Riostream.h"\r
-#include "AliFlowCommonConstants.h"\r
-#include "AliFlowCommonHist.h"\r
-#include "AliFlowCommonHistResults.h"\r
-#include "TChain.h"\r
-\r
-#include "TFile.h"\r
-#include "TList.h"\r
-#include "TGraph.h"\r
-#include "TParticle.h"\r
-#include "TRandom3.h"\r
-#include "TStyle.h"\r
-#include "TProfile.h"\r
-#include "TProfile2D.h" \r
-#include "TProfile3D.h"\r
-#include "TMath.h"\r
-#include "TArrow.h"\r
-#include "TPaveLabel.h"\r
-#include "TCanvas.h"\r
-#include "AliFlowEventSimple.h"\r
-#include "AliFlowTrackSimple.h"\r
-#include "AliFlowAnalysisWithQCumulants.h"\r
-#include "TArrayD.h"\r
-#include "TRandom.h"\r
-#include "TF1.h"\r
-\r
-class TH1;\r
-class TH2;\r
-class TGraph;\r
-class TPave;\r
-class TLatex;\r
-class TMarker;\r
-class TRandom3;\r
-class TObjArray;\r
-class TList;\r
-class TCanvas;\r
-class TSystem;\r
-class TROOT;\r
-class AliFlowVector;\r
-class TVector;\r
-\r
-\r
-//================================================================================================================\r
-\r
-\r
-ClassImp(AliFlowAnalysisWithQCumulants)\r
-\r
-AliFlowAnalysisWithQCumulants::AliFlowAnalysisWithQCumulants(): \r
- // 0.) base:\r
- fHistList(NULL),\r
- // 1.) common:\r
- fCommonHists(NULL),\r
- fCommonHists2nd(NULL), \r
- fCommonHists4th(NULL),\r
- fCommonHists6th(NULL),\r
- fCommonHists8th(NULL),\r
- fCommonHistsResults2nd(NULL),\r
- fCommonHistsResults4th(NULL),\r
- fCommonHistsResults6th(NULL),\r
- fCommonHistsResults8th(NULL),\r
- fnBinsPhi(0),\r
- fPhiMin(0),\r
- fPhiMax(0),\r
- fPhiBinWidth(0),\r
- fnBinsPt(0),\r
- fPtMin(0),\r
- fPtMax(0),\r
- fPtBinWidth(0),\r
- fnBinsEta(0),\r
- fEtaMin(0),\r
- fEtaMax(0),\r
- fEtaBinWidth(0),\r
- fHarmonic(2),\r
- fAnalysisLabel(NULL),\r
- // 2a.) particle weights:\r
- fWeightsList(NULL),\r
- fUsePhiWeights(kFALSE),\r
- fUsePtWeights(kFALSE),\r
- fUseEtaWeights(kFALSE),\r
- fUseParticleWeights(NULL),\r
- fPhiWeights(NULL),\r
- fPtWeights(NULL),\r
- fEtaWeights(NULL),\r
- // 2b.) event weights:\r
- fMultiplicityWeight(NULL),\r
- // 3.) integrated flow:\r
- fIntFlowList(NULL), \r
- fIntFlowProfiles(NULL),\r
- fIntFlowResults(NULL),\r
- fIntFlowFlags(NULL),\r
- fApplyCorrectionForNUA(kTRUE), \r
- fReQ(NULL),\r
- fImQ(NULL),\r
- fSMpk(NULL),\r
- fIntFlowCorrelationsEBE(NULL),\r
- fIntFlowEventWeightsForCorrelationsEBE(NULL),\r
- fIntFlowCorrelationsAllEBE(NULL),\r
- fAvMultiplicity(NULL),\r
- fIntFlowCorrelationsPro(NULL),\r
- fIntFlowCorrelationsAllPro(NULL),\r
- fIntFlowExtraCorrelationsPro(NULL),\r
- fIntFlowProductOfCorrelationsPro(NULL),\r
- fIntFlowCorrelationsHist(NULL),\r
- fIntFlowCorrelationsAllHist(NULL),\r
- fIntFlowCovariances(NULL),\r
- fIntFlowSumOfProductOfEventWeights(NULL),\r
- fIntFlowQcumulants(NULL),\r
- fIntFlow(NULL),\r
- // 4.) differential flow:\r
- fDiffFlowList(NULL),\r
- fDiffFlowProfiles(NULL),\r
- fDiffFlowResults(NULL),\r
- fDiffFlowFlags(NULL),\r
- fCalculate2DFlow(kFALSE),\r
- // 5.) distributions:\r
+/*************************************************************************
+* Copyright(c) 1998-2008, ALICE Experiment at CERN, All rights reserved. *
+* *
+* Author: The ALICE Off-line Project. *
+* Contributors are mentioned in the code where appropriate. *
+* *
+* Permission to use, copy, modify and distribute this software and its *
+* documentation strictly for non-commercial purposes is hereby granted *
+* without fee, provided that the above copyright notice appears in all *
+* copies and that both the copyright notice and this permission notice *
+* appear in the supporting documentation. The authors make no claims *
+* about the suitability of this software for any purpose. It is *
+* provided "as is" without express or implied warranty. *
+**************************************************************************/
+
+/**********************************
+ * flow analysis with Q-cumulants *
+ * *
+ * author: Ante Bilandzic *
+ * (abilandzic@gmail.com) *
+ *********************************/
+
+#define AliFlowAnalysisWithQCumulants_cxx
+
+#include "Riostream.h"
+#include "AliFlowCommonConstants.h"
+#include "AliFlowCommonHist.h"
+#include "AliFlowCommonHistResults.h"
+#include "TChain.h"
+
+#include "TFile.h"
+#include "TList.h"
+#include "TGraph.h"
+#include "TParticle.h"
+#include "TRandom3.h"
+#include "TStyle.h"
+#include "TProfile.h"
+#include "TProfile2D.h"
+#include "TProfile3D.h"
+#include "TMath.h"
+#include "TArrow.h"
+#include "TPaveLabel.h"
+#include "TCanvas.h"
+#include "AliFlowEventSimple.h"
+#include "AliFlowTrackSimple.h"
+#include "AliFlowAnalysisWithQCumulants.h"
+#include "TArrayD.h"
+#include "TRandom.h"
+#include "TF1.h"
+
+class TH1;
+class TH2;
+class TGraph;
+class TPave;
+class TLatex;
+class TMarker;
+class TRandom3;
+class TObjArray;
+class TList;
+class TCanvas;
+class TSystem;
+class TROOT;
+class AliFlowVector;
+class TVector;
+
+//================================================================================================================
+
+ClassImp(AliFlowAnalysisWithQCumulants)
+
+AliFlowAnalysisWithQCumulants::AliFlowAnalysisWithQCumulants():
+ // 0.) base:
+ fHistList(NULL),
+ // 1.) common:
+ fCommonHists(NULL),
+ fCommonHists2nd(NULL),
+ fCommonHists4th(NULL),
+ fCommonHists6th(NULL),
+ fCommonHists8th(NULL),
+ fCommonHistsResults2nd(NULL),
+ fCommonHistsResults4th(NULL),
+ fCommonHistsResults6th(NULL),
+ fCommonHistsResults8th(NULL),
+ fnBinsPhi(0),
+ fPhiMin(0),
+ fPhiMax(0),
+ fPhiBinWidth(0),
+ fnBinsPt(0),
+ fPtMin(0),
+ fPtMax(0),
+ fPtBinWidth(0),
+ fnBinsEta(0),
+ fEtaMin(0),
+ fEtaMax(0),
+ fEtaBinWidth(0),
+ fHarmonic(2),
+ fAnalysisLabel(NULL),
+ // 2a.) particle weights:
+ fWeightsList(NULL),
+ fUsePhiWeights(kFALSE),
+ fUsePtWeights(kFALSE),
+ fUseEtaWeights(kFALSE),
+ fUseParticleWeights(NULL),
+ fPhiWeights(NULL),
+ fPtWeights(NULL),
+ fEtaWeights(NULL),
+ // 2b.) event weights:
+ fMultiplicityWeight(NULL),
+ // 3.) integrated flow:
+ fIntFlowList(NULL),
+ fIntFlowProfiles(NULL),
+ fIntFlowResults(NULL),
+ fIntFlowFlags(NULL),
+ fApplyCorrectionForNUA(kFALSE),
+ fApplyCorrectionForNUAVsM(kFALSE),
+ fnBinsMult(10000),
+ fMinMult(0.),
+ fMaxMult(10000.),
+ fPropagateErrorAlsoFromNUATerms(kFALSE),
+ fCalculateCumulantsVsM(kTRUE),
+ fMinimumBiasReferenceFlow(kTRUE),
+ fReQ(NULL),
+ fImQ(NULL),
+ fSMpk(NULL),
+ fIntFlowCorrelationsEBE(NULL),
+ fIntFlowEventWeightsForCorrelationsEBE(NULL),
+ fIntFlowCorrelationsAllEBE(NULL),
+ fAvMultiplicity(NULL),
+ fIntFlowCorrelationsPro(NULL),
+ fIntFlowCorrelationsAllPro(NULL),
+ fIntFlowExtraCorrelationsPro(NULL),
+ fIntFlowProductOfCorrelationsPro(NULL),
+ fIntFlowProductOfCorrectionTermsForNUAPro(NULL),
+ fIntFlowCorrelationsHist(NULL),
+ fIntFlowCorrelationsAllHist(NULL),
+ fIntFlowCovariances(NULL),
+ fIntFlowSumOfProductOfEventWeights(NULL),
+ fIntFlowCovariancesNUA(NULL),
+ fIntFlowSumOfProductOfEventWeightsNUA(NULL),
+ fIntFlowQcumulants(NULL),
+ fIntFlowQcumulantsRebinnedInM(NULL),
+ fIntFlowQcumulantsErrorSquaredRatio(NULL),
+ fIntFlow(NULL),
+ fIntFlowRebinnedInM(NULL),
+ fIntFlowDetectorBias(NULL),
+ // 4.) differential flow:
+ fDiffFlowList(NULL),
+ fDiffFlowProfiles(NULL),
+ fDiffFlowResults(NULL),
+ fDiffFlowFlags(NULL),
+ fCalculate2DFlow(kFALSE),
+ // 5.) distributions:
fDistributionsList(NULL),
fDistributionsFlags(NULL),
- fStoreDistributions(kFALSE),\r
- // x.) debugging and cross-checking:\r
- fNestedLoopsList(NULL),\r
- fEvaluateIntFlowNestedLoops(kFALSE),\r
- fEvaluateDiffFlowNestedLoops(kFALSE),\r
- fMaxAllowedMultiplicity(10),\r
- fEvaluateNestedLoops(NULL),\r
- fIntFlowDirectCorrelations(NULL),\r
- fIntFlowExtraDirectCorrelations(NULL),\r
- fCrossCheckInPtBinNo(10),\r
- fCrossCheckInEtaBinNo(20)\r
- {\r
- // constructor \r
- \r
- // base list to hold all output objects:\r
- fHistList = new TList();\r
- fHistList->SetName("cobjQC");\r
- fHistList->SetOwner(kTRUE);\r
- \r
- // list to hold histograms with phi, pt and eta weights: \r
- fWeightsList = new TList();\r
- \r
- // multiplicity weight:\r
- fMultiplicityWeight = new TString("combinations");\r
- \r
- // analysis label;\r
- fAnalysisLabel = new TString();\r
- \r
- // initialize all arrays: \r
- this->InitializeArraysForIntFlow();\r
- this->InitializeArraysForDiffFlow();\r
- this->InitializeArraysForDistributions();\r
- this->InitializeArraysForNestedLoops();\r
- \r
- } // end of constructor\r
- \r
-\r
-//================================================================================================================ \r
-\r
-\r
-AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants()\r
-{\r
- // destructor\r
- \r
- delete fHistList;\r
-\r
-} // end of AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants()\r
-\r
-\r
-//================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::Init()\r
-{\r
- // a) Access all common constants;\r
- // b) Book all objects;\r
- // c) Store flags for integrated and differential flow;
- // d) Store flags for distributions of corelations;\r
- // e) Store harmonic which will be estimated.\r
- \r
- // a) Access all common constants:\r
- this->AccessConstants();\r
- \r
- // b) Book all objects:\r
- this->BookAndFillWeightsHistograms();\r
- this->BookAndNestAllLists();\r
- this->BookCommonHistograms();\r
- this->BookEverythingForIntegratedFlow(); \r
- this->BookEverythingForDifferentialFlow(); \r
- this->BookEverythingForDistributions();\r
- this->BookEverythingForNestedLoops();\r
- \r
- // c) Store flags for integrated and differential flow:\r
- this->StoreIntFlowFlags();\r
- this->StoreDiffFlowFlags();\r
-
- // d) Store flags for distributions of corelations:\r
- this->StoreFlagsForDistributions();\r
-\r
- // e) Store harmonic which will be estimated:\r
- this->StoreHarmonic();\r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::Init()\r
-\r
-\r
-//================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent)\r
-{\r
- // Running over data only in this method.\r
- \r
- // a) Fill the common control histograms and call the method to fill fAvMultiplicity;\r
- // b) Loop over data and calculate e-b-e quantities;\r
- // c) Call all the methods;\r
- // d) Debugging and cross-checking (evaluate nested loops);\r
- // e) Reset all event by event quantities. \r
- \r
- Double_t dPhi = 0.; // azimuthal angle in the laboratory frame\r
- Double_t dPt = 0.; // transverse momentum\r
- Double_t dEta = 0.; // pseudorapidity\r
-\r
- Double_t wPhi = 1.; // phi weight\r
- Double_t wPt = 1.; // pt weight\r
- Double_t wEta = 1.; // eta weight\r
- \r
- Int_t nRP = anEvent->GetEventNSelTracksRP(); // number of RPs (i.e. number of particles used to determine the reaction plane)\r
- \r
- // a) Fill the common control histograms and call the method to fill fAvMultiplicity:\r
- this->FillCommonControlHistograms(anEvent); \r
- this->FillAverageMultiplicities(nRP); \r
- \r
- // b) Loop over data and calculate e-b-e quantities:\r
- Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = total number of primary tracks, i.e. nPrim = nRP + nPOI + rest, where:\r
- // nRP = # of particles used to determine the reaction plane;\r
- // nPOI = # of particles of interest for a detailed flow analysis;\r
- // rest = # of particles which are not niether RPs nor POIs. \r
- \r
- AliFlowTrackSimple *aftsTrack = NULL;\r
- \r
- for(Int_t i=0;i<nPrim;i++) \r
- { \r
- aftsTrack=anEvent->GetTrack(i);\r
- if(aftsTrack)\r
- {\r
- if(!(aftsTrack->InRPSelection() || aftsTrack->InPOISelection())) continue; // consider only tracks which are RPs or POIs\r
- Int_t n = fHarmonic; // shortcut for the harmonic\r
- if(aftsTrack->InRPSelection()) // RP condition:\r
- { \r
- dPhi = aftsTrack->Phi();\r
- dPt = aftsTrack->Pt();\r
- dEta = aftsTrack->Eta();\r
- if(fUsePhiWeights && fPhiWeights && fnBinsPhi) // determine phi weight for this particle:\r
- {\r
- wPhi = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(dPhi*fnBinsPhi/TMath::TwoPi())));\r
- }\r
- if(fUsePtWeights && fPtWeights && fnBinsPt) // determine pt weight for this particle:\r
- {\r
- wPt = fPtWeights->GetBinContent(1+(Int_t)(TMath::Floor((dPt-fPtMin)/fPtBinWidth))); \r
- } \r
- if(fUseEtaWeights && fEtaWeights && fEtaBinWidth) // determine eta weight for this particle: \r
- {\r
- wEta = fEtaWeights->GetBinContent(1+(Int_t)(TMath::Floor((dEta-fEtaMin)/fEtaBinWidth))); \r
- } \r
- \r
- // integrated flow: \r
- // calculate Re[Q_{m*n,k}] and Im[Q_{m*n,k}], m = 1,2,3,4, for this event:\r
- for(Int_t m=0;m<4;m++)\r
- {\r
- for(Int_t k=0;k<9;k++)\r
- {\r
- (*fReQ)(m,k)+=pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1)*n*dPhi); \r
- (*fImQ)(m,k)+=pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1)*n*dPhi); \r
- } \r
- }\r
- // calculate S^{M}_{p,k} for this event \r
- // Remark: final calculation of S^{M}_{p,k} follows after the loop over data bellow:\r
- for(Int_t p=0;p<8;p++)\r
- {\r
- for(Int_t k=0;k<9;k++)\r
- { \r
- (*fSMpk)(p,k)+=pow(wPhi*wPt*wEta,k);\r
- }\r
- } \r
- \r
- // differential flow:\r
- // 1D (pt):\r
- // (r_{m*m,k}(pt)): \r
- for(Int_t m=0;m<4;m++)\r
- {\r
- for(Int_t k=0;k<9;k++)\r
- {\r
- fReRPQ1dEBE[0][0][m][k]->Fill(dPt,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.);\r
- fImRPQ1dEBE[0][0][m][k]->Fill(dPt,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.);\r
- }\r
- }\r
- \r
- // s_{k}(pt) for RPs // to be improved (clarified)\r
- // Remark: final calculation of s_{p,k}(pt) follows after the loop over data bellow:\r
- for(Int_t k=0;k<9;k++)\r
- {\r
- fs1dEBE[0][0][k]->Fill(dPt,pow(wPhi*wPt*wEta,k),1.);\r
- }\r
- // 1D (eta):\r
- // (r_{m*m,k}(eta)): \r
- for(Int_t m=0;m<4;m++)\r
- {\r
- for(Int_t k=0;k<9;k++)\r
- {\r
- fReRPQ1dEBE[0][1][m][k]->Fill(dEta,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.);\r
- fImRPQ1dEBE[0][1][m][k]->Fill(dEta,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.);\r
- }\r
- } \r
- // s_{k}(eta) for RPs // to be improved (clarified)\r
- // Remark: final calculation of s_{p,k}(eta) follows after the loop over data bellow:\r
- for(Int_t k=0;k<9;k++)\r
- {\r
- fs1dEBE[0][1][k]->Fill(dEta,pow(wPhi*wPt*wEta,k),1.);\r
- }\r
- \r
- \r
- \r
- /*\r
- // 2D (pt,eta):\r
- if(fCalculate2DFlow)\r
- {\r
- // (r_{m*m,k}(pt,eta)): \r
- for(Int_t m=0;m<4;m++)\r
- {\r
- for(Int_t k=0;k<9;k++)\r
- {\r
- fReRPQ2dEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.);\r
- fImRPQ2dEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.);\r
- }\r
- } \r
- // s_{k}(pt,eta) for RPs // to be improved (clarified)\r
- // Remark: final calculation of s_{p,k}(pt,eta) follows after the loop over data bellow:\r
- for(Int_t k=0;k<9;k++)\r
- {\r
- fs2dEBE[0][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k),1.);\r
- }\r
- } // end of if(fCalculate2DFlow) \r
- */ \r
- \r
- \r
- \r
- if(aftsTrack->InPOISelection())\r
- {\r
- // 1D (pt): \r
- // (q_{m*m,k}(pt)): \r
- for(Int_t m=0;m<4;m++)\r
- {\r
- for(Int_t k=0;k<9;k++)\r
- {\r
- fReRPQ1dEBE[2][0][m][k]->Fill(dPt,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.);\r
- fImRPQ1dEBE[2][0][m][k]->Fill(dPt,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.);\r
- }\r
- } \r
- // s_{k}(pt) for RP&&POIs // to be improved (clarified)\r
- // Remark: final calculation of s_{p,k}(pt,eta) follows after the loop over data bellow:\r
- for(Int_t k=0;k<9;k++)\r
- {\r
- fs1dEBE[2][0][k]->Fill(dPt,pow(wPhi*wPt*wEta,k),1.);\r
- }\r
- // 1D (eta): \r
- // (q_{m*m,k}(eta)): \r
- for(Int_t m=0;m<4;m++)\r
- {\r
- for(Int_t k=0;k<9;k++)\r
- {\r
- fReRPQ1dEBE[2][1][m][k]->Fill(dEta,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.);\r
- fImRPQ1dEBE[2][1][m][k]->Fill(dEta,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.);\r
- }\r
- } \r
- // s_{k}(eta) for RP&&POIs // to be improved (clarified)\r
- // Remark: final calculation of s_{p,k}(pt,eta) follows after the loop over data bellow:\r
- for(Int_t k=0;k<9;k++)\r
- {\r
- fs1dEBE[2][1][k]->Fill(dEta,pow(wPhi*wPt*wEta,k),1.);\r
- }\r
- \r
- /*\r
- // 2D (pt,eta) \r
- if(fCalculate2DFlow)\r
- {\r
- // (q_{m*m,k}(pt,eta)): \r
- for(Int_t m=0;m<4;m++)\r
- {\r
- for(Int_t k=0;k<9;k++)\r
- {\r
- fReRPQ2dEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.);\r
- fImRPQ2dEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.);\r
- }\r
- } \r
- // s_{k}(pt,eta) for RP&&POIs // to be improved (clarified)\r
- // Remark: final calculation of s_{p,k}(pt,eta) follows after the loop over data bellow:\r
- for(Int_t k=0;k<9;k++)\r
- {\r
- fs2dEBE[2][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k),1.);\r
- }\r
- } // end of if(fCalculate2DFlow) \r
- */\r
- \r
- } // end of if(aftsTrack->InPOISelection())\r
- \r
-\r
- \r
- } // end of if(pTrack->InRPSelection())\r
-\r
- \r
- \r
- if(aftsTrack->InPOISelection())\r
- {\r
- dPhi = aftsTrack->Phi();\r
- dPt = aftsTrack->Pt();\r
- dEta = aftsTrack->Eta();\r
- \r
- // 1D (pt)\r
- // p_n(m*n,0): \r
- for(Int_t m=0;m<4;m++)\r
- {\r
- fReRPQ1dEBE[1][0][m][0]->Fill(dPt,TMath::Cos((m+1.)*n*dPhi),1.);\r
- fImRPQ1dEBE[1][0][m][0]->Fill(dPt,TMath::Sin((m+1.)*n*dPhi),1.);\r
- }\r
- // 1D (eta)\r
- // p_n(m*n,0): \r
- for(Int_t m=0;m<4;m++)\r
- {\r
- fReRPQ1dEBE[1][1][m][0]->Fill(dEta,TMath::Cos((m+1.)*n*dPhi),1.);\r
- fImRPQ1dEBE[1][1][m][0]->Fill(dEta,TMath::Sin((m+1.)*n*dPhi),1.);\r
- }\r
- \r
- \r
- /*\r
- // 2D (pt,eta):\r
- if(fCalculate2DFlow)\r
- { \r
- // p_n(m*n,0): \r
- for(Int_t m=0;m<4;m++)\r
- {\r
- fReRPQ2dEBE[1][m][0]->Fill(dPt,dEta,TMath::Cos((m+1.)*n*dPhi),1.);\r
- fImRPQ2dEBE[1][m][0]->Fill(dPt,dEta,TMath::Sin((m+1.)*n*dPhi),1.);\r
- }\r
- } // end of if(fCalculate2DFlow) \r
- */\r
- \r
- \r
- } // end of if(pTrack->InPOISelection() ) \r
- \r
- \r
- } else // to if(aftsTrack)\r
- {\r
- cout<<endl;\r
- cout<<" WARNING: no particle! (i.e. aftsTrack is a NULL pointer in AFAWQC::Make().)"<<endl;\r
- cout<<endl; \r
- }\r
- } // end of for(Int_t i=0;i<nPrim;i++) \r
-\r
- // calculate the final expressions for S^{M}_{p,k}:\r
- for(Int_t p=0;p<8;p++)\r
- {\r
- for(Int_t k=0;k<9;k++)\r
- {\r
- (*fSMpk)(p,k)=pow((*fSMpk)(p,k),p+1);\r
- } \r
- } \r
- \r
- // *****************************\r
- // **** CALL THE METHODS *******\r
- // *****************************\r
- // integrated flow:\r
- if(!fEvaluateIntFlowNestedLoops)\r
- {\r
- if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
- {\r
- if(nRP>1) this->CalculateIntFlowCorrelations(); // without using particle weights\r
- } else \r
- {\r
- if(nRP>1) this->CalculateIntFlowCorrelationsUsingParticleWeights(); // with using particle weights \r
- } \r
- \r
- if(nRP>3) this->CalculateIntFlowProductOfCorrelations();\r
- if(nRP>1) this->CalculateIntFlowSumOfEventWeights();\r
- if(nRP>1) this->CalculateIntFlowSumOfProductOfEventWeights();\r
- if(fApplyCorrectionForNUA)\r
- {\r
- if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))
+ fStoreDistributions(kFALSE),
+ // x.) debugging and cross-checking:
+ fNestedLoopsList(NULL),
+ fEvaluateIntFlowNestedLoops(kFALSE),
+ fEvaluateDiffFlowNestedLoops(kFALSE),
+ fMaxAllowedMultiplicity(10),
+ fEvaluateNestedLoops(NULL),
+ fIntFlowDirectCorrelations(NULL),
+ fIntFlowExtraDirectCorrelations(NULL),
+ fCrossCheckInPtBinNo(10),
+ fCrossCheckInEtaBinNo(20),
+ fNoOfParticlesInBin(NULL)
+ {
+ // constructor
+
+ // base list to hold all output objects:
+ fHistList = new TList();
+ fHistList->SetName("cobjQC");
+ fHistList->SetOwner(kTRUE);
+
+ // list to hold histograms with phi, pt and eta weights:
+ fWeightsList = new TList();
+
+ // multiplicity weight:
+ fMultiplicityWeight = new TString("combinations");
+
+ // analysis label;
+ fAnalysisLabel = new TString();
+
+ // initialize all arrays:
+ this->InitializeArraysForIntFlow();
+ this->InitializeArraysForDiffFlow();
+ this->InitializeArraysForDistributions();
+ this->InitializeArraysForNestedLoops();
+
+ } // end of constructor
+
+
+//================================================================================================================
+
+
+AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants()
+{
+ // destructor
+
+ delete fHistList;
+
+} // end of AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants()
+
+
+//================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::Init()
+{
+ // a) Cross check if the settings make sense before starting the QC adventure;
+ // b) Access all common constants;
+ // c) Book all objects;
+ // d) Store flags for integrated and differential flow;
+ // e) Store flags for distributions of corelations;
+ // f) Store harmonic which will be estimated.
+
+ //save old value and prevent histograms from being added to directory
+ //to avoid name clashes in case multiple analaysis objects are used
+ //in an analysis
+ Bool_t oldHistAddStatus = TH1::AddDirectoryStatus();
+ TH1::AddDirectory(kFALSE);
+
+ // a) Cross check if the settings make sense before starting the QC adventure;
+ this->CrossCheckSettings();
+ // b) Access all common constants:
+ this->AccessConstants();
+ // c) Book all objects:
+ this->BookAndFillWeightsHistograms();
+ this->BookAndNestAllLists();
+ this->BookCommonHistograms();
+ this->BookEverythingForIntegratedFlow();
+ this->BookEverythingForDifferentialFlow();
+ this->BookEverythingForDistributions();
+ this->BookEverythingForNestedLoops();
+ // d) Store flags for integrated and differential flow:
+ this->StoreIntFlowFlags();
+ this->StoreDiffFlowFlags();
+ // e) Store flags for distributions of corelations:
+ this->StoreFlagsForDistributions();
+ // f) Store harmonic which will be estimated:
+ this->StoreHarmonic();
+
+ TH1::AddDirectory(oldHistAddStatus);
+} // end of void AliFlowAnalysisWithQCumulants::Init()
+
+
+//================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent)
+{
+ // Running over data only in this method.
+
+ // a) Check all pointers used in this method;
+ // b) Define local variables;
+ // c) Fill the common control histograms and call the method to fill fAvMultiplicity;
+ // d) Loop over data and calculate e-b-e quantities;
+ // e) Call all the methods which calculate correlations for reference flow;
+ // f) Call all the methods which calculate correlations for differential flow;
+ // g) Distributions of correlations;
+ // h) Debugging and cross-checking (evaluate nested loops);
+ // i) Reset all event-by-event quantities.
+
+ // a) Check all pointers used in this method:
+ this->CheckPointersUsedInMake();
+
+ // b) Define local variables:
+ Double_t dPhi = 0.; // azimuthal angle in the laboratory frame
+ Double_t dPt = 0.; // transverse momentum
+ Double_t dEta = 0.; // pseudorapidity
+ Double_t wPhi = 1.; // phi weight
+ Double_t wPt = 1.; // pt weight
+ Double_t wEta = 1.; // eta weight
+ Int_t nRP = anEvent->GetEventNSelTracksRP(); // number of RPs (i.e. number of particles used to determine the reaction plane)
+
+ // c) Fill the common control histograms and call the method to fill fAvMultiplicity:
+ this->FillCommonControlHistograms(anEvent);
+ this->FillAverageMultiplicities(nRP);
+
+ // d) Loop over data and calculate e-b-e quantities:
+ Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = total number of primary tracks, i.e. nPrim = nRP + nPOI where:
+ // nRP = # of particles used to determine the reaction plane;
+ // nPOI = # of particles of interest for a detailed flow analysis;
+
+ AliFlowTrackSimple *aftsTrack = NULL;
+
+ for(Int_t i=0;i<nPrim;i++)
+ {
+ aftsTrack=anEvent->GetTrack(i);
+ if(aftsTrack)
+ {
+ if(!(aftsTrack->InRPSelection() || aftsTrack->InPOISelection())) continue; // consider only tracks which are RPs or POIs
+ Int_t n = fHarmonic; // shortcut for the harmonic
+ if(aftsTrack->InRPSelection()) // RP condition:
+ {
+ dPhi = aftsTrack->Phi();
+ dPt = aftsTrack->Pt();
+ dEta = aftsTrack->Eta();
+ if(fUsePhiWeights && fPhiWeights && fnBinsPhi) // determine phi weight for this particle:
+ {
+ wPhi = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(dPhi*fnBinsPhi/TMath::TwoPi())));
+ }
+ if(fUsePtWeights && fPtWeights && fnBinsPt) // determine pt weight for this particle:
+ {
+ wPt = fPtWeights->GetBinContent(1+(Int_t)(TMath::Floor((dPt-fPtMin)/fPtBinWidth)));
+ }
+ if(fUseEtaWeights && fEtaWeights && fEtaBinWidth) // determine eta weight for this particle:
+ {
+ wEta = fEtaWeights->GetBinContent(1+(Int_t)(TMath::Floor((dEta-fEtaMin)/fEtaBinWidth)));
+ }
+
+ // integrated flow:
+ // calculate Re[Q_{m*n,k}] and Im[Q_{m*n,k}], m = 1,2,3,4, for this event:
+ for(Int_t m=0;m<4;m++)
+ {
+ for(Int_t k=0;k<9;k++)
+ {
+ (*fReQ)(m,k)+=pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1)*n*dPhi);
+ (*fImQ)(m,k)+=pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1)*n*dPhi);
+ }
+ }
+ // calculate S^{M}_{p,k} for this event
+ // Remark: final calculation of S^{M}_{p,k} follows after the loop over data bellow:
+ for(Int_t p=0;p<8;p++)
+ {
+ for(Int_t k=0;k<9;k++)
+ {
+ (*fSMpk)(p,k)+=pow(wPhi*wPt*wEta,k);
+ }
+ }
+
+ // differential flow:
+ // 1D (pt):
+ // (r_{m*m,k}(pt)):
+ for(Int_t m=0;m<4;m++)
+ {
+ for(Int_t k=0;k<9;k++)
+ {
+ fReRPQ1dEBE[0][0][m][k]->Fill(dPt,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.);
+ fImRPQ1dEBE[0][0][m][k]->Fill(dPt,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.);
+ }
+ }
+
+ // s_{k}(pt) for RPs // to be improved (clarified)
+ // Remark: final calculation of s_{p,k}(pt) follows after the loop over data bellow:
+ for(Int_t k=0;k<9;k++)
+ {
+ fs1dEBE[0][0][k]->Fill(dPt,pow(wPhi*wPt*wEta,k),1.);
+ }
+ // 1D (eta):
+ // (r_{m*m,k}(eta)):
+ for(Int_t m=0;m<4;m++)
+ {
+ for(Int_t k=0;k<9;k++)
+ {
+ fReRPQ1dEBE[0][1][m][k]->Fill(dEta,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.);
+ fImRPQ1dEBE[0][1][m][k]->Fill(dEta,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.);
+ }
+ }
+ // s_{k}(eta) for RPs // to be improved (clarified)
+ // Remark: final calculation of s_{p,k}(eta) follows after the loop over data bellow:
+ for(Int_t k=0;k<9;k++)
+ {
+ fs1dEBE[0][1][k]->Fill(dEta,pow(wPhi*wPt*wEta,k),1.);
+ }
+
+
+
+ /*
+ // 2D (pt,eta):
+ if(fCalculate2DFlow)
+ {
+ // (r_{m*m,k}(pt,eta)):
+ for(Int_t m=0;m<4;m++)
+ {
+ for(Int_t k=0;k<9;k++)
+ {
+ fReRPQ2dEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.);
+ fImRPQ2dEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.);
+ }
+ }
+ // s_{k}(pt,eta) for RPs // to be improved (clarified)
+ // Remark: final calculation of s_{p,k}(pt,eta) follows after the loop over data bellow:
+ for(Int_t k=0;k<9;k++)
+ {
+ fs2dEBE[0][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k),1.);
+ }
+ } // end of if(fCalculate2DFlow)
+ */
+
+
+
+ if(aftsTrack->InPOISelection())
+ {
+ // 1D (pt):
+ // (q_{m*m,k}(pt)):
+ for(Int_t m=0;m<4;m++)
+ {
+ for(Int_t k=0;k<9;k++)
+ {
+ fReRPQ1dEBE[2][0][m][k]->Fill(dPt,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.);
+ fImRPQ1dEBE[2][0][m][k]->Fill(dPt,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.);
+ }
+ }
+ // s_{k}(pt) for RP&&POIs // to be improved (clarified)
+ // Remark: final calculation of s_{p,k}(pt,eta) follows after the loop over data bellow:
+ for(Int_t k=0;k<9;k++)
+ {
+ fs1dEBE[2][0][k]->Fill(dPt,pow(wPhi*wPt*wEta,k),1.);
+ }
+ // 1D (eta):
+ // (q_{m*m,k}(eta)):
+ for(Int_t m=0;m<4;m++)
+ {
+ for(Int_t k=0;k<9;k++)
+ {
+ fReRPQ1dEBE[2][1][m][k]->Fill(dEta,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.);
+ fImRPQ1dEBE[2][1][m][k]->Fill(dEta,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.);
+ }
+ }
+ // s_{k}(eta) for RP&&POIs // to be improved (clarified)
+ // Remark: final calculation of s_{p,k}(pt,eta) follows after the loop over data bellow:
+ for(Int_t k=0;k<9;k++)
+ {
+ fs1dEBE[2][1][k]->Fill(dEta,pow(wPhi*wPt*wEta,k),1.);
+ }
+
+ /*
+ // 2D (pt,eta)
+ if(fCalculate2DFlow)
+ {
+ // (q_{m*m,k}(pt,eta)):
+ for(Int_t m=0;m<4;m++)
+ {
+ for(Int_t k=0;k<9;k++)
+ {
+ fReRPQ2dEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.);
+ fImRPQ2dEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.);
+ }
+ }
+ // s_{k}(pt,eta) for RP&&POIs // to be improved (clarified)
+ // Remark: final calculation of s_{p,k}(pt,eta) follows after the loop over data bellow:
+ for(Int_t k=0;k<9;k++)
+ {
+ fs2dEBE[2][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k),1.);
+ }
+ } // end of if(fCalculate2DFlow)
+ */
+
+ } // end of if(aftsTrack->InPOISelection())
+
+
+
+ } // end of if(pTrack->InRPSelection())
+
+
+
+ if(aftsTrack->InPOISelection())
{
- if(nRP>0) this->CalculateIntFlowCorrectionsForNUASinTerms();\r
- if(nRP>0) this->CalculateIntFlowCorrectionsForNUACosTerms();\r
- } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))
+ dPhi = aftsTrack->Phi();
+ dPt = aftsTrack->Pt();
+ dEta = aftsTrack->Eta();
+
+ // 1D (pt)
+ // p_n(m*n,0):
+ for(Int_t m=0;m<4;m++)
+ {
+ fReRPQ1dEBE[1][0][m][0]->Fill(dPt,TMath::Cos((m+1.)*n*dPhi),1.);
+ fImRPQ1dEBE[1][0][m][0]->Fill(dPt,TMath::Sin((m+1.)*n*dPhi),1.);
+ }
+ // 1D (eta)
+ // p_n(m*n,0):
+ for(Int_t m=0;m<4;m++)
+ {
+ fReRPQ1dEBE[1][1][m][0]->Fill(dEta,TMath::Cos((m+1.)*n*dPhi),1.);
+ fImRPQ1dEBE[1][1][m][0]->Fill(dEta,TMath::Sin((m+1.)*n*dPhi),1.);
+ }
+
+
+ /*
+ // 2D (pt,eta):
+ if(fCalculate2DFlow)
+ {
+ // p_n(m*n,0):
+ for(Int_t m=0;m<4;m++)
{
- if(nRP>0) this->CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights();\r
- if(nRP>0) this->CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights();
- }
- } // end of if(fApplyCorrectionForNUA)\r
- } // end of if(!fEvaluateIntFlowNestedLoops)\r
-\r
- // differential flow:\r
- if(!fEvaluateDiffFlowNestedLoops)\r
- {\r
- if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
- {\r
- // without using particle weights:\r
- this->CalculateDiffFlowCorrelations("RP","Pt"); \r
- this->CalculateDiffFlowCorrelations("RP","Eta");\r
- this->CalculateDiffFlowCorrelations("POI","Pt");\r
+ fReRPQ2dEBE[1][m][0]->Fill(dPt,dEta,TMath::Cos((m+1.)*n*dPhi),1.);
+ fImRPQ2dEBE[1][m][0]->Fill(dPt,dEta,TMath::Sin((m+1.)*n*dPhi),1.);
+ }
+ } // end of if(fCalculate2DFlow)
+ */
+
+
+ } // end of if(pTrack->InPOISelection() )
+
+
+ } else // to if(aftsTrack)
+ {
+ cout<<endl;
+ cout<<" WARNING: no particle! (i.e. aftsTrack is a NULL pointer in AFAWQC::Make().)"<<endl;
+ cout<<endl;
+ }
+ } // end of for(Int_t i=0;i<nPrim;i++)
+
+ // calculate the final expressions for S^{M}_{p,k}:
+ for(Int_t p=0;p<8;p++)
+ {
+ for(Int_t k=0;k<9;k++)
+ {
+ (*fSMpk)(p,k)=pow((*fSMpk)(p,k),p+1);
+ }
+ }
+
+ // e) Call all the methods which calculate correlations for reference flow:
+ if(!fEvaluateIntFlowNestedLoops)
+ {
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))
+ {
+ if(nRP>1) this->CalculateIntFlowCorrelations(); // without using particle weights
+ } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))
+ {
+ if(nRP>1) this->CalculateIntFlowCorrelationsUsingParticleWeights(); // with using particle weights
+ }
+
+ if(nRP>3) this->CalculateIntFlowProductOfCorrelations();
+ if(nRP>1) this->CalculateIntFlowSumOfEventWeights();
+ if(nRP>1) this->CalculateIntFlowSumOfProductOfEventWeights();
+
+ // non-isotropic terms:
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))
+ {
+ if(nRP>0) this->CalculateIntFlowCorrectionsForNUASinTerms();
+ if(nRP>0) this->CalculateIntFlowCorrectionsForNUACosTerms();
+ } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))
+ {
+ if(nRP>0) this->CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights();
+ if(nRP>0) this->CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights();
+ }
+
+ if(nRP>0) this->CalculateIntFlowProductOfCorrectionTermsForNUA();
+ if(nRP>0) this->CalculateIntFlowSumOfEventWeightsNUA();
+ if(nRP>0) this->CalculateIntFlowSumOfProductOfEventWeightsNUA();
+ } // end of if(!fEvaluateIntFlowNestedLoops)
+
+ // f) Call all the methods which calculate correlations for differential flow:
+ if(!fEvaluateDiffFlowNestedLoops)
+ {
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))
+ {
+ // without using particle weights:
+ this->CalculateDiffFlowCorrelations("RP","Pt");
+ this->CalculateDiffFlowCorrelations("RP","Eta");
+ this->CalculateDiffFlowCorrelations("POI","Pt");
this->CalculateDiffFlowCorrelations("POI","Eta");
- if(fApplyCorrectionForNUA)
- {
- this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Pt");\r
- this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Eta");\r
- this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Pt");\r
- this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Eta");\r
- this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Pt");\r
- this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Eta");\r
- this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Pt");\r
- this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Eta");
- } // end of if(fApplyCorrectionForNUA) \r
- } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
- {\r
- // with using particle weights: \r
- this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Pt"); \r
- this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Eta"); \r
- this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Pt"); \r
- this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Eta"); \r
- if(fApplyCorrectionForNUA)
- {
- this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Pt");\r
- this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Eta");\r
- this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Pt");\r
- this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Eta");\r
- this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Pt");\r
- this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Eta");\r
- this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Pt");\r
- this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Eta");
- } // end of if(fApplyCorrectionForNUA) \r
- } \r
+ // non-isotropic terms:
+ this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Pt");
+ this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Eta");
+ this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Pt");
+ this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Eta");
+ this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Pt");
+ this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Eta");
+ this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Pt");
+ this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Eta");
+ } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))
+ {
+ // with using particle weights:
+ this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Pt");
+ this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Eta");
+ this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Pt");
+ this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Eta");
+ // non-isotropic terms:
+ this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Pt");
+ this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Eta");
+ this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Pt");
+ this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Eta");
+ this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Pt");
+ this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Eta");
+ this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Pt");
+ this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Eta");
+ }
- // whether or not using particle weights the following is calculated in the same way: \r
- this->CalculateDiffFlowProductOfCorrelations("RP","Pt");\r
- this->CalculateDiffFlowProductOfCorrelations("RP","Eta");\r
- this->CalculateDiffFlowProductOfCorrelations("POI","Pt");\r
- this->CalculateDiffFlowProductOfCorrelations("POI","Eta");\r
- this->CalculateDiffFlowSumOfEventWeights("RP","Pt");\r
- this->CalculateDiffFlowSumOfEventWeights("RP","Eta");\r
- this->CalculateDiffFlowSumOfEventWeights("POI","Pt");\r
- this->CalculateDiffFlowSumOfEventWeights("POI","Eta");\r
- this->CalculateDiffFlowSumOfProductOfEventWeights("RP","Pt");\r
- this->CalculateDiffFlowSumOfProductOfEventWeights("RP","Eta");\r
- this->CalculateDiffFlowSumOfProductOfEventWeights("POI","Pt");\r
- this->CalculateDiffFlowSumOfProductOfEventWeights("POI","Eta"); \r
- } // end of if(!fEvaluateDiffFlowNestedLoops)\r
-\r
-\r
- \r
- // with weights:\r
- // ... \r
- \r
- /*\r
- // 2D differential flow\r
- if(fCalculate2DFlow)\r
- {\r
- // without weights:\r
- if(nRP>1) this->CalculateCorrelationsForDifferentialFlow2D("RP");\r
- if(nRP>1) this->CalculateCorrelationsForDifferentialFlow2D("POI");\r
- \r
- // with weights:\r
- if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)\r
- {\r
- if(nRP>1) this->CalculateWeightedCorrelationsForDifferentialFlow2D("RP");\r
- if(nRP>1) this->CalculateWeightedCorrelationsForDifferentialFlow2D("POI");\r
- } \r
- } // end of if(fCalculate2DFlow)\r
- */\r
-
- // distributions of correlations:
+ // whether or not using particle weights the following is calculated in the same way:
+ this->CalculateDiffFlowProductOfCorrelations("RP","Pt");
+ this->CalculateDiffFlowProductOfCorrelations("RP","Eta");
+ this->CalculateDiffFlowProductOfCorrelations("POI","Pt");
+ this->CalculateDiffFlowProductOfCorrelations("POI","Eta");
+ this->CalculateDiffFlowSumOfEventWeights("RP","Pt");
+ this->CalculateDiffFlowSumOfEventWeights("RP","Eta");
+ this->CalculateDiffFlowSumOfEventWeights("POI","Pt");
+ this->CalculateDiffFlowSumOfEventWeights("POI","Eta");
+ this->CalculateDiffFlowSumOfProductOfEventWeights("RP","Pt");
+ this->CalculateDiffFlowSumOfProductOfEventWeights("RP","Eta");
+ this->CalculateDiffFlowSumOfProductOfEventWeights("POI","Pt");
+ this->CalculateDiffFlowSumOfProductOfEventWeights("POI","Eta");
+ } // end of if(!fEvaluateDiffFlowNestedLoops)
+
+
+
+ // with weights:
+ // ...
+
+ /*
+ // 2D differential flow
+ if(fCalculate2DFlow)
+ {
+ // without weights:
+ if(nRP>1) this->CalculateCorrelationsForDifferentialFlow2D("RP");
+ if(nRP>1) this->CalculateCorrelationsForDifferentialFlow2D("POI");
+
+ // with weights:
+ if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)
+ {
+ if(nRP>1) this->CalculateWeightedCorrelationsForDifferentialFlow2D("RP");
+ if(nRP>1) this->CalculateWeightedCorrelationsForDifferentialFlow2D("POI");
+ }
+ } // end of if(fCalculate2DFlow)
+ */
+
+ // g) Distributions of correlations;
if(fStoreDistributions)
{
this->StoreDistributionsOfCorrelations();
}
- \r
- // d) Debugging and cross-checking (evaluate nested loops):\r
- // d1) cross-checking results for integrated flow:\r
- if(fEvaluateIntFlowNestedLoops)\r
- {\r
- if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 \r
- {\r
- // without using particle weights:\r
- if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
- {\r
- // correlations:\r
- this->CalculateIntFlowCorrelations(); // from Q-vectors\r
- this->EvaluateIntFlowCorrelationsWithNestedLoops(anEvent); // from nested loops (to be improved: do I have to pass here anEvent or not?)\r
- // correction for non-uniform acceptance:\r
- this->CalculateIntFlowCorrectionsForNUASinTerms(); // from Q-vectors (sin terms)\r
- this->CalculateIntFlowCorrectionsForNUACosTerms(); // from Q-vectors (cos terms)\r
- this->EvaluateIntFlowCorrectionsForNUAWithNestedLoops(anEvent); // from nested loops (both sin and cos terms)\r
- }\r
- // using particle weights:\r
- if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)\r
- {\r
- // correlations:\r
- this->CalculateIntFlowCorrelationsUsingParticleWeights(); // from Q-vectors\r
- this->EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent); // from nested loops (to be improved: do I have to pass here anEvent or not?)\r
- // correction for non-uniform acceptance:\r
- this->CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights(); // from Q-vectors (sin terms)\r
- this->CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights(); // from Q-vectors (cos terms)\r
+
+ // h) Debugging and cross-checking (evaluate nested loops):
+ // h1) cross-checking results for integrated flow:
+ if(fEvaluateIntFlowNestedLoops)
+ {
+ if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10
+ {
+ // without using particle weights:
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))
+ {
+ // correlations:
+ this->CalculateIntFlowCorrelations(); // from Q-vectors
+ this->EvaluateIntFlowCorrelationsWithNestedLoops(anEvent); // from nested loops (to be improved: do I have to pass here anEvent or not?)
+ // correction for non-uniform acceptance:
+ this->CalculateIntFlowCorrectionsForNUASinTerms(); // from Q-vectors (sin terms)
+ this->CalculateIntFlowCorrectionsForNUACosTerms(); // from Q-vectors (cos terms)
+ this->EvaluateIntFlowCorrectionsForNUAWithNestedLoops(anEvent); // from nested loops (both sin and cos terms)
+ }
+ // using particle weights:
+ if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)
+ {
+ // correlations:
+ this->CalculateIntFlowCorrelationsUsingParticleWeights(); // from Q-vectors
+ this->EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent); // from nested loops (to be improved: do I have to pass here anEvent or not?)
+ // correction for non-uniform acceptance:
+ this->CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights(); // from Q-vectors (sin terms)
+ this->CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights(); // from Q-vectors (cos terms)
this->EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(anEvent); // from nested loops (both sin and cos terms)
- }\r
- } else if (nPrim>fMaxAllowedMultiplicity) // to if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity)\r
- {\r
- cout<<endl;\r
- cout<<"Skipping the event because multiplicity is "<<nPrim<<". Too high to evaluate nested loops!"<<endl;\r
- } else\r
- {\r
- cout<<endl;\r
- cout<<"Skipping the event because multiplicity is "<<nPrim<<"."<<endl; \r
- } \r
- } // end of if(fEvaluateIntFlowNestedLoops) \r
- \r
- // d2) cross-checking results for differential flow:\r
- if(fEvaluateDiffFlowNestedLoops)\r
- {\r
- if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10\r
- {\r
- // without using particle weights:\r
- if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
- {\r
- // reduced correlations:\r
- // Q-vectors:\r
- this->CalculateDiffFlowCorrelations("RP","Pt");\r
- this->CalculateDiffFlowCorrelations("RP","Eta");\r
- this->CalculateDiffFlowCorrelations("POI","Pt");\r
- this->CalculateDiffFlowCorrelations("POI","Eta");\r
- // nested loops:\r
- //this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"RP","Pt"); // to be improved (enabled eventually)\r
- //this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"RP","Eta"); // to be improved (enabled eventually)\r
- this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"POI","Pt"); // to be improved (do I need to pass here anEvent?)\r
- this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"POI","Eta"); // to be improved (do I need to pass here anEvent?)\r
- // reduced corrections for non-uniform acceptance:\r
- // Q-vectors:\r
- this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Pt");\r
- this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Eta");\r
- this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Pt");\r
- this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Eta");\r
- this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Pt");\r
- this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Eta");\r
- this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Pt");\r
- this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Eta");\r
- // nested loops:\r
- //this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"RP","Pt"); // to be improved (enabled eventually)\r
- //this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"RP","Eta"); // to be improved (enabled eventually)\r
- this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"POI","Pt"); // to be improved (do I need to pass here anEvent?)\r
- this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"POI","Eta"); // to be improved (do I need to pass here anEvent?)\r
- } // end of if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
- // using particle weights:\r
- if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)\r
- {\r
- this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Pt"); \r
- this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Eta"); \r
- this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Pt"); \r
- this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Eta"); \r
- this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Pt");\r
- this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Eta");\r
- this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Pt");\r
- this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Eta");\r
- this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Pt");\r
- this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Eta");\r
- this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Pt");\r
- this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Eta");\r
- this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"RP","Pt"); // to be improved (enabled eventually)\r
- this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"RP","Eta"); // to be improved (enabled eventually)\r
- this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"POI","Pt"); // to be improved (do I need to pass here anEvent?)\r
- this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"POI","Eta"); // to be improved (do I need to pass here anEvent?)
- //this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"RP","Pt"); // to be improved (enabled eventually)\r
- //this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"RP","Eta"); // to be improved (enabled eventually)\r
- this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"POI","Pt"); // to be improved (do I need to pass here anEvent?)\r
- this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"POI","Eta"); // to be improved (do I need to pass here anEvent?)\r
- } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)\r
- } // end of if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10\r
- } // end of if(fEvaluateDiffFlowNestedLoops) \r
- \r
- // e) Reset all event by event quantities: \r
- this->ResetEventByEventQuantities();\r
- \r
-} // end of AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent)\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::Finish()\r
-{\r
- // Calculate the final results.\r
- // a) acces the constants;\r
- // b) access the flags;\r
- // c) calculate the final results for integrated flow (without and with weights);\r
- // d) store in AliFlowCommonHistResults and print the final results for integrated flow;\r
- // e) calculate the final results for differential flow (without and with weights);\r
- // f) print the final results for integrated flow obtained from differential flow (to be improved (terminology));\r
- // g) cross-check the results: results from Q-vectors vs results from nested loops\r
- \r
- // ******************************\r
- // **** ACCESS THE CONSTANTS ****\r
- // ******************************\r
- \r
- this->AccessConstants(); \r
- \r
- if(fCommonHists && fCommonHists->GetHarmonic())\r
- {\r
- fHarmonic = (Int_t)(fCommonHists->GetHarmonic())->GetBinContent(1); // to be improved (moved somewhere else)\r
- } \r
-\r
- // **************************\r
- // **** ACCESS THE FLAGS ****\r
- // ************************** \r
- fUsePhiWeights = (Int_t)fUseParticleWeights->GetBinContent(1); \r
- fUsePtWeights = (Int_t)fUseParticleWeights->GetBinContent(2); \r
- fUseEtaWeights = (Int_t)fUseParticleWeights->GetBinContent(3); \r
- fApplyCorrectionForNUA = (Int_t)fIntFlowFlags->GetBinContent(3); \r
- fEvaluateIntFlowNestedLoops = (Int_t)fEvaluateNestedLoops->GetBinContent(1);\r
- fEvaluateDiffFlowNestedLoops = (Int_t)fEvaluateNestedLoops->GetBinContent(2); \r
- fCrossCheckInPtBinNo = (Int_t)fEvaluateNestedLoops->GetBinContent(3);\r
- fCrossCheckInEtaBinNo = (Int_t)fEvaluateNestedLoops->GetBinContent(4); \r
- \r
- // *********************************************************\r
- // **** CALCULATE THE FINAL RESULTS FOR INTEGRATED FLOW ****\r
- // ********************************************************* \r
- \r
- this->FinalizeCorrelationsIntFlow();\r
- this->CalculateCovariancesIntFlow();\r
- this->CalculateCumulantsIntFlow();\r
- this->CalculateIntFlow(); \r
-\r
- if(fApplyCorrectionForNUA) // to be improved (reorganized, etc)\r
- {\r
- this->FinalizeCorrectionTermsForNUAIntFlow();\r
- this->CalculateQcumulantsCorrectedForNUAIntFlow(); \r
- this->CalculateIntFlowCorrectedForNUA(); \r
- }\r
- \r
- // ***************************************************************\r
- // **** STORE AND PRINT THE FINAL RESULTS FOR INTEGRATED FLOW ****\r
- // ***************************************************************\r
- \r
- this->FillCommonHistResultsIntFlow(); \r
- \r
- this->PrintFinalResultsForIntegratedFlow("NONAME"); // to be improved (name)\r
- \r
- // ***********************************************************\r
- // **** CALCULATE THE FINAL RESULTS FOR DIFFERENTIAL FLOW ****\r
- // *********************************************************** \r
- \r
- this->FinalizeReducedCorrelations("RP","Pt"); \r
- this->FinalizeReducedCorrelations("RP","Eta"); \r
- this->FinalizeReducedCorrelations("POI","Pt"); \r
- this->FinalizeReducedCorrelations("POI","Eta");\r
- this->CalculateDiffFlowCovariances("RP","Pt");\r
- this->CalculateDiffFlowCovariances("RP","Eta");\r
- this->CalculateDiffFlowCovariances("POI","Pt");\r
- this->CalculateDiffFlowCovariances("POI","Eta");\r
- this->CalculateDiffFlowCumulants("RP","Pt");\r
- this->CalculateDiffFlowCumulants("RP","Eta");\r
- this->CalculateDiffFlowCumulants("POI","Pt");\r
- this->CalculateDiffFlowCumulants("POI","Eta");\r
- this->CalculateDiffFlow("RP","Pt");\r
- this->CalculateDiffFlow("RP","Eta");\r
- this->CalculateDiffFlow("POI","Pt");\r
- this->CalculateDiffFlow("POI","Eta");\r
- \r
- if(fApplyCorrectionForNUA) // to be improved (reorganized, etc)\r
- {\r
- this->FinalizeCorrectionTermsForNUADiffFlow("RP","Pt");\r
- this->FinalizeCorrectionTermsForNUADiffFlow("RP","Eta");\r
- this->FinalizeCorrectionTermsForNUADiffFlow("POI","Pt");\r
- this->FinalizeCorrectionTermsForNUADiffFlow("POI","Eta"); \r
- this->CalculateDiffFlowCumulantsCorrectedForNUA("RP","Pt"); \r
- this->CalculateDiffFlowCumulantsCorrectedForNUA("RP","Eta"); \r
- this->CalculateDiffFlowCumulantsCorrectedForNUA("POI","Pt"); \r
- this->CalculateDiffFlowCumulantsCorrectedForNUA("POI","Eta"); \r
- this->CalculateDiffFlowCorrectedForNUA("RP","Pt"); \r
- this->CalculateDiffFlowCorrectedForNUA("RP","Eta"); \r
- this->CalculateDiffFlowCorrectedForNUA("POI","Pt"); \r
- this->CalculateDiffFlowCorrectedForNUA("POI","Eta"); \r
- }\r
- \r
- this->CalculateFinalResultsForRPandPOIIntegratedFlow("RP");\r
- this->CalculateFinalResultsForRPandPOIIntegratedFlow("POI");\r
-\r
- // *****************************************************************\r
- // **** STORE AND PRINT THE FINAL RESULTS FOR DIFFERENTIAL FLOW ****\r
- // *****************************************************************\r
- this->FillCommonHistResultsDiffFlow("RP");\r
- this->FillCommonHistResultsDiffFlow("POI");\r
-\r
- this->PrintFinalResultsForIntegratedFlow("RP"); \r
- this->PrintFinalResultsForIntegratedFlow("POI"); \r
- \r
- // g) cross-check the results: results from Q-vectors vs results from nested loops\r
-
- // g1) integrated flow:\r
- if(fEvaluateIntFlowNestedLoops)\r
- {\r
- this->CrossCheckIntFlowCorrelations();\r
- this->CrossCheckIntFlowCorrectionTermsForNUA(); \r
- if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) this->CrossCheckIntFlowExtraCorrelations(); \r
- } // end of if(fEvaluateIntFlowNestedLoops) \r
-
- // g2) differential flow: \r
- if(fEvaluateDiffFlowNestedLoops) \r
- {\r
- // correlations:\r
- //this->CrossCheckDiffFlowCorrelations("RP","Pt"); // to be improved (enabled eventually) \r
- //this->CrossCheckDiffFlowCorrelations("RP","Eta"); // to be improved (enabled eventually) \r
- this->CrossCheckDiffFlowCorrelations("POI","Pt"); \r
- this->CrossCheckDiffFlowCorrelations("POI","Eta");\r
- // correction terms for non-uniform acceptance:\r
- //this->CrossCheckDiffFlowCorrectionTermsForNUA("RP","Pt"); // to be improved (enabled eventually) \r
- //this->CrossCheckDiffFlowCorrectionTermsForNUA("RP","Eta"); // to be improved (enabled eventually) \r
- this->CrossCheckDiffFlowCorrectionTermsForNUA("POI","Pt"); \r
- this->CrossCheckDiffFlowCorrectionTermsForNUA("POI","Eta"); \r
- } // end of if(fEvaluateDiffFlowNestedLoops)\r
- \r
-} // end of AliFlowAnalysisWithQCumulants::Finish()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTerms()\r
-{\r
- // calculate corrections for non-uniform acceptance of the detector for no-name integrated flow (cos terms)\r
- \r
- // multiplicity:\r
- Double_t dMult = (*fSMpk)(0,0);\r
- \r
- // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
- Double_t dReQ1n = (*fReQ)(0,0);\r
- Double_t dReQ2n = (*fReQ)(1,0);\r
- //Double_t dReQ3n = (*fReQ)(2,0);\r
- //Double_t dReQ4n = (*fReQ)(3,0);\r
- Double_t dImQ1n = (*fImQ)(0,0);\r
- Double_t dImQ2n = (*fImQ)(1,0);\r
- //Double_t dImQ3n = (*fImQ)(2,0);\r
- //Double_t dImQ4n = (*fImQ)(3,0);\r
- \r
- // *************************************************************\r
- // **** corrections for non-uniform acceptance (cos terms): ****\r
- // *************************************************************\r
- //\r
- // Remark 1: corrections for non-uniform acceptance (cos terms) calculated with non-weighted Q-vectors \r
- // are stored in 1D profile fQCorrectionsCos.\r
- // Remark 2: binning of fIntFlowCorrectionTermsForNUAPro[1] is organized as follows:\r
- // --------------------------------------------------------------------------------------------------------------------\r
- // 1st bin: <<cos(n*(phi1))>> = cosP1n\r
- // 2nd bin: <<cos(n*(phi1+phi2))>> = cosP1nP1n\r
- // 3rd bin: <<cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1n\r
- // ...\r
- // --------------------------------------------------------------------------------------------------------------------\r
- \r
- // 1-particle:\r
- Double_t cosP1n = 0.; // <<cos(n*(phi1))>>\r
- \r
- if(dMult>0)\r
- {\r
- cosP1n = dReQ1n/dMult; \r
- \r
- // average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for single event:\r
- fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(1,cosP1n);\r
- \r
- // final average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for all events:\r
- fIntFlowCorrectionTermsForNUAPro[1]->Fill(0.5,cosP1n,dMult); \r
- } \r
- \r
- // 2-particle:\r
- Double_t cosP1nP1n = 0.; // <<cos(n*(phi1+phi2))>>\r
- \r
- if(dMult>1)\r
- {\r
- cosP1nP1n = (pow(dReQ1n,2)-pow(dImQ1n,2)-dReQ2n)/(dMult*(dMult-1)); \r
- \r
- // average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for single event:\r
- fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(2,cosP1nP1n);\r
- \r
- // final average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for all events:\r
- fIntFlowCorrectionTermsForNUAPro[1]->Fill(1.5,cosP1nP1n,dMult*(dMult-1)); \r
- } \r
- \r
- // 3-particle:\r
- Double_t cosP1nM1nM1n = 0.; // <<cos(n*(phi1-phi2-phi3))>>\r
- \r
- if(dMult>2)\r
- {\r
- cosP1nM1nM1n = (dReQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))-dReQ1n*dReQ2n-dImQ1n*dImQ2n-2.*(dMult-1)*dReQ1n)\r
- / (dMult*(dMult-1)*(dMult-2)); \r
- \r
- // average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for single event:\r
- fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(3,cosP1nM1nM1n);\r
- \r
- // final average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for all events:\r
- fIntFlowCorrectionTermsForNUAPro[1]->Fill(2.5,cosP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); \r
- } \r
- \r
-} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTerms()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTerms()\r
-{\r
- // calculate corrections for non-uniform acceptance of the detector for no-name integrated flow (sin terms)\r
- \r
- // multiplicity:\r
- Double_t dMult = (*fSMpk)(0,0);\r
- \r
- // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
- Double_t dReQ1n = (*fReQ)(0,0);\r
- Double_t dReQ2n = (*fReQ)(1,0);\r
- //Double_t dReQ3n = (*fReQ)(2,0);\r
- //Double_t dReQ4n = (*fReQ)(3,0);\r
- Double_t dImQ1n = (*fImQ)(0,0);\r
- Double_t dImQ2n = (*fImQ)(1,0);\r
- //Double_t dImQ3n = (*fImQ)(2,0);\r
- //Double_t dImQ4n = (*fImQ)(3,0);\r
- \r
- // *************************************************************\r
- // **** corrections for non-uniform acceptance (sin terms): ****\r
- // *************************************************************\r
- //\r
- // Remark 1: corrections for non-uniform acceptance (sin terms) calculated with non-weighted Q-vectors \r
- // are stored in 1D profile fQCorrectionsSin.\r
- // Remark 2: binning of fIntFlowCorrectionTermsForNUAPro[0] is organized as follows:\r
- // --------------------------------------------------------------------------------------------------------------------\r
- // 1st bin: <<sin(n*(phi1))>> = sinP1n\r
- // 2nd bin: <<sin(n*(phi1+phi2))>> = sinP1nP1n\r
- // 3rd bin: <<sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1n\r
- // ...\r
- // --------------------------------------------------------------------------------------------------------------------\r
- \r
- // 1-particle:\r
- Double_t sinP1n = 0.; // <sin(n*(phi1))>\r
- \r
- if(dMult>0)\r
- {\r
- sinP1n = dImQ1n/dMult; \r
- \r
- // average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for single event:\r
- fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(1,sinP1n);\r
- \r
- // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: \r
- fIntFlowCorrectionTermsForNUAPro[0]->Fill(0.5,sinP1n,dMult); \r
- } \r
- \r
- // 2-particle:\r
- Double_t sinP1nP1n = 0.; // <<sin(n*(phi1+phi2))>>\r
- \r
- if(dMult>1)\r
- {\r
- sinP1nP1n = (2.*dReQ1n*dImQ1n-dImQ2n)/(dMult*(dMult-1)); \r
- \r
- // average non-weighted 2-particle correction (sin terms) for non-uniform acceptance for single event:\r
- fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(2,sinP1nP1n);\r
- \r
- // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: \r
- fIntFlowCorrectionTermsForNUAPro[0]->Fill(1.5,sinP1nP1n,dMult*(dMult-1)); \r
- } \r
- \r
- // 3-particle:\r
- Double_t sinP1nM1nM1n = 0.; // <<sin(n*(phi1-phi2-phi3))>>\r
- \r
- if(dMult>2)\r
- {\r
- sinP1nM1nM1n = (-dImQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))+dReQ1n*dImQ2n-dImQ1n*dReQ2n+2.*(dMult-1)*dImQ1n)\r
- / (dMult*(dMult-1)*(dMult-2)); \r
- \r
- // average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for single event:\r
- fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(3,sinP1nM1nM1n);\r
- \r
- // final average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for all events: \r
- fIntFlowCorrectionTermsForNUAPro[0]->Fill(2.5,sinP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); \r
- } \r
- \r
-} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTerms()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos)\r
-{\r
- // a) Get pointers for common control and common result histograms and profiles.\r
- // b) Get pointers for histograms with particle weights.\r
- // c) Get pointers for histograms and profiles relevant for integrated flow.\r
- // d) Get pointers for histograms and profiles relevant for differental flow.\r
- // e) Get pointers for histograms and profiles holding results obtained with nested loops.\r
- \r
- if(outputListHistos)\r
- { \r
- this->GetPointersForCommonHistograms(outputListHistos); // to be improved (no need to pass here argument, use setter for base list instead)\r
- this->GetPointersForParticleWeightsHistograms(outputListHistos); // to be improved (no need to pass here argument, use setter for base list instead)\r
- this->GetPointersForIntFlowHistograms(outputListHistos); // to be improved (no need to pass here argument, use setter for base list instead)\r
- this->GetPointersForDiffFlowHistograms(outputListHistos); // to be improved (no need to pass here argument, use setter for base list instead)\r
- this->GetPointersForNestedLoopsHistograms(outputListHistos); // to be improved (no need to pass here argument, use setter for base list instead)\r
- }\r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos)\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) const\r
-{\r
- // project 2D profile onto pt axis to get 1D profile\r
- \r
- Int_t nBinsPt = profilePtEta->GetNbinsX();\r
- Double_t dPtMin = (profilePtEta->GetXaxis())->GetXmin();\r
- Double_t dPtMax = (profilePtEta->GetXaxis())->GetXmax();\r
- \r
- Int_t nBinsEta = profilePtEta->GetNbinsY();\r
- \r
- TProfile *profilePt = new TProfile("","",nBinsPt,dPtMin,dPtMax); \r
- \r
- for(Int_t p=1;p<=nBinsPt;p++)\r
- {\r
- Double_t contentPt = 0.;\r
- Double_t entryPt = 0.;\r
- Double_t spreadPt = 0.;\r
- Double_t sum1 = 0.;\r
- Double_t sum2 = 0.;\r
- Double_t sum3 = 0.;\r
- for(Int_t e=1;e<=nBinsEta;e++)\r
- {\r
- contentPt += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e)))\r
- * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)));\r
- entryPt += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)));\r
- \r
- sum1 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)))\r
- * (pow(profilePtEta->GetBinError(profilePtEta->GetBin(p,e)),2.)\r
- + pow(profilePtEta->GetBinContent(profilePtEta->GetBin(p,e)),2.)); \r
- sum2 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)));\r
- sum3 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)))\r
- * (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))); \r
- }\r
- if(sum2>0. && sum1/sum2-pow(sum3/sum2,2.) > 0.)\r
- {\r
- spreadPt = pow(sum1/sum2-pow(sum3/sum2,2.),0.5);\r
- }\r
- profilePt->SetBinContent(p,contentPt);\r
- profilePt->SetBinEntries(p,entryPt);\r
- {\r
- profilePt->SetBinError(p,spreadPt);\r
- }\r
- \r
- }\r
- \r
- return profilePt;\r
- \r
-} // end of TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta)\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) const\r
-{\r
- // project 2D profile onto eta axis to get 1D profile\r
- \r
- Int_t nBinsEta = profilePtEta->GetNbinsY();\r
- Double_t dEtaMin = (profilePtEta->GetYaxis())->GetXmin();\r
- Double_t dEtaMax = (profilePtEta->GetYaxis())->GetXmax();\r
- \r
- Int_t nBinsPt = profilePtEta->GetNbinsX();\r
- \r
- TProfile *profileEta = new TProfile("","",nBinsEta,dEtaMin,dEtaMax); \r
- \r
- for(Int_t e=1;e<=nBinsEta;e++)\r
- {\r
- Double_t contentEta = 0.;\r
- Double_t entryEta = 0.;\r
- for(Int_t p=1;p<=nBinsPt;p++)\r
- {\r
- contentEta += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e)))\r
- * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)));\r
- entryEta += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)));\r
- }\r
- profileEta->SetBinContent(e,contentEta);\r
- profileEta->SetBinEntries(e,entryEta);\r
- }\r
- \r
- return profileEta;\r
- \r
-} // end of TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta)\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type)\r
-{\r
- // printing on the screen the final results for integrated flow (NONAME, POI and RP) // to be improved (NONAME) \r
- \r
- Int_t n = fHarmonic; \r
- \r
- if(type == "NONAME" || type == "RP" || type == "POI")\r
- {\r
- if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th))\r
- {\r
- cout<<"WARNING: fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th"<<endl;\r
- cout<<" is NULL in AFAWQC::PFRFIF() !!!!"<<endl;\r
- }\r
- } else\r
- {\r
- cout<<"WARNING: type in not from {NONAME, RP, POI} in AFAWQC::PFRFIF() !!!!"<<endl;\r
- exit(0);\r
- }\r
- \r
- Double_t dVn[4] = {0.}; // array to hold Vn{2}, Vn{4}, Vn{6} and Vn{8} \r
- Double_t dVnErr[4] = {0.}; // array to hold errors of Vn{2}, Vn{4}, Vn{6} and Vn{8} \r
- \r
- if(type == "NONAME")\r
- {\r
- dVn[0] = (fCommonHistsResults2nd->GetHistIntFlow())->GetBinContent(1); \r
- dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlow())->GetBinError(1); \r
- dVn[1] = (fCommonHistsResults4th->GetHistIntFlow())->GetBinContent(1); \r
- dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlow())->GetBinError(1); \r
- dVn[2] = (fCommonHistsResults6th->GetHistIntFlow())->GetBinContent(1); \r
- dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlow())->GetBinError(1); \r
- dVn[3] = (fCommonHistsResults8th->GetHistIntFlow())->GetBinContent(1); \r
- dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlow())->GetBinError(1); \r
- } else if(type == "RP")\r
- {\r
- dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinContent(1); \r
- dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinError(1); \r
- dVn[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinContent(1); \r
- dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinError(1); \r
- dVn[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinContent(1); \r
- dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinError(1); \r
- dVn[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinContent(1); \r
- dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinError(1); \r
- } else if(type == "POI")\r
- {\r
- dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinContent(1); \r
- dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinError(1); \r
- dVn[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinContent(1); \r
- dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinError(1); \r
- dVn[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinContent(1); \r
- dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinError(1); \r
- dVn[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinContent(1); \r
- dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinError(1); \r
- }\r
- \r
- TString title = " flow estimates from Q-cumulants"; \r
- TString subtitle = " ("; \r
- \r
- if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
- {\r
- subtitle.Append(type);\r
- subtitle.Append(", without weights)");\r
- } else \r
- {\r
- subtitle.Append(type);\r
- subtitle.Append(", with weights)");\r
- }\r
- \r
- cout<<endl;\r
- cout<<"*************************************"<<endl;\r
- cout<<"*************************************"<<endl;\r
- cout<<title.Data()<<endl; \r
- cout<<subtitle.Data()<<endl; \r
- cout<<endl;\r
- \r
- for(Int_t i=0;i<4;i++)\r
- {\r
- if(dVn[i]>=0.)\r
- {\r
- cout<<" v_"<<n<<"{"<<2*(i+1)<<"} = "<<dVn[i]<<" +/- "<<dVnErr[i]<<endl;\r
- }\r
- else\r
- {\r
- cout<<" v_"<<n<<"{"<<2*(i+1)<<"} = Im"<<endl;\r
- } \r
- }\r
-\r
- cout<<endl;\r
- /*\r
- if(type == "NONAME")\r
- {\r
- cout<<" nEvts = "<<nEvtsNoName<<", AvM = "<<dMultNoName<<endl; // to be improved\r
- }\r
- else if (type == "RP")\r
- {\r
- cout<<" nEvts = "<<nEvtsRP<<", AvM = "<<dMultRP<<endl; // to be improved \r
- } \r
- else if (type == "POI")\r
- {\r
- cout<<" nEvts = "<<nEvtsPOI<<", AvM = "<<dMultPOI<<endl; // to be improved \r
- } \r
- */\r
- cout<<"*************************************"<<endl;\r
- cout<<"*************************************"<<endl;\r
- cout<<endl; \r
- \r
-}// end of AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type="NONAME");\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::WriteHistograms(TString outputFileName)\r
-{\r
- //store the final results in output .root file\r
- TFile *output = new TFile(outputFileName.Data(),"RECREATE");\r
- //output->WriteObject(fHistList, "cobjQC","SingleKey");\r
- fHistList->Write(fHistList->GetName(), TObject::kSingleKey);\r
- delete output;\r
-}\r
-\r
-\r
-//================================================================================================================================\r
+ }
+ } else if (nPrim>fMaxAllowedMultiplicity) // to if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity)
+ {
+ cout<<endl;
+ cout<<"Skipping the event because multiplicity is "<<nPrim<<". Too high to evaluate nested loops!"<<endl;
+ } else
+ {
+ cout<<endl;
+ cout<<"Skipping the event because multiplicity is "<<nPrim<<"."<<endl;
+ }
+ } // end of if(fEvaluateIntFlowNestedLoops)
+
+ // h2) cross-checking results for differential flow:
+ if(fEvaluateDiffFlowNestedLoops)
+ {
+ if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10
+ {
+ // without using particle weights:
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))
+ {
+ // reduced correlations:
+ // Q-vectors:
+ this->CalculateDiffFlowCorrelations("RP","Pt");
+ this->CalculateDiffFlowCorrelations("RP","Eta");
+ this->CalculateDiffFlowCorrelations("POI","Pt");
+ this->CalculateDiffFlowCorrelations("POI","Eta");
+ // nested loops:
+ this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"RP","Pt");
+ this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"RP","Eta");
+ this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"POI","Pt");
+ this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"POI","Eta");
+ // reduced corrections for non-uniform acceptance:
+ // Q-vectors:
+ this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Pt");
+ this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Eta");
+ this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Pt");
+ this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Eta");
+ this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Pt");
+ this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Eta");
+ this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Pt");
+ this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Eta");
+ // nested loops:
+ this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"RP","Pt");
+ this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"RP","Eta");
+ this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"POI","Pt");
+ this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"POI","Eta");
+ } // end of if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))
+ // using particle weights:
+ if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)
+ {
+ this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Pt");
+ this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Eta");
+ this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Pt");
+ this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Eta");
+ this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Pt");
+ this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Eta");
+ this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Pt");
+ this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Eta");
+ this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Pt");
+ this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Eta");
+ this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Pt");
+ this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Eta");
+ this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"RP","Pt");
+ this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"RP","Eta");
+ this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"POI","Pt");
+ this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"POI","Eta");
+ this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"RP","Pt");
+ this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"RP","Eta");
+ this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"POI","Pt");
+ this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"POI","Eta");
+ } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)
+ } // end of if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10
+ } // end of if(fEvaluateDiffFlowNestedLoops)
+
+ // i) Reset all event-by-event quantities.
+ this->ResetEventByEventQuantities();
+
+} // end of AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent)
+//================================================================================================================================
-void AliFlowAnalysisWithQCumulants::WriteHistograms(TDirectoryFile *outputFileName)
+void AliFlowAnalysisWithQCumulants::Finish()
{
- //store the final results in output .root file
- fHistList->SetName("cobjQC");
- fHistList->SetOwner(kTRUE);
- outputFileName->Add(fHistList);
- outputFileName->Write(outputFileName->GetName(), TObject::kSingleKey);
-}
-\r
-
-//================================================================================================================================\r
-
-\r
-void AliFlowAnalysisWithQCumulants::BookCommonHistograms()\r
-{\r
- // Book common control histograms and common histograms for final results.\r
- // common control histogram (ALL events)\r
- TString commonHistsName = "AliFlowCommonHistQC";\r
- commonHistsName += fAnalysisLabel->Data();\r
- fCommonHists = new AliFlowCommonHist(commonHistsName.Data());\r
- fHistList->Add(fCommonHists); \r
- // common control histogram (for events with 2 and more particles)\r
- TString commonHists2ndOrderName = "AliFlowCommonHist2ndOrderQC";\r
- commonHists2ndOrderName += fAnalysisLabel->Data();\r
- fCommonHists2nd = new AliFlowCommonHist(commonHists2ndOrderName.Data());\r
- fHistList->Add(fCommonHists2nd); \r
- // common control histogram (for events with 4 and more particles)\r
- TString commonHists4thOrderName = "AliFlowCommonHist4thOrderQC";\r
- commonHists4thOrderName += fAnalysisLabel->Data();\r
- fCommonHists4th = new AliFlowCommonHist(commonHists4thOrderName.Data());\r
- fHistList->Add(fCommonHists4th); \r
- // common control histogram (for events with 6 and more particles)\r
- TString commonHists6thOrderName = "AliFlowCommonHist6thOrderQC";\r
- commonHists6thOrderName += fAnalysisLabel->Data();\r
- fCommonHists6th = new AliFlowCommonHist(commonHists6thOrderName.Data());\r
- fHistList->Add(fCommonHists6th); \r
- // common control histogram (for events with 8 and more particles)\r
- TString commonHists8thOrderName = "AliFlowCommonHist8thOrderQC";\r
- commonHists8thOrderName += fAnalysisLabel->Data();\r
- fCommonHists8th = new AliFlowCommonHist(commonHists8thOrderName.Data());\r
- fHistList->Add(fCommonHists8th); \r
- // common histograms for final results (calculated for events with 2 and more particles)\r
- TString commonHistResults2ndOrderName = "AliFlowCommonHistResults2ndOrderQC";\r
- commonHistResults2ndOrderName += fAnalysisLabel->Data();\r
- fCommonHistsResults2nd = new AliFlowCommonHistResults(commonHistResults2ndOrderName.Data());\r
- fHistList->Add(fCommonHistsResults2nd); \r
- // common histograms for final results (calculated for events with 4 and more particles)\r
- TString commonHistResults4thOrderName = "AliFlowCommonHistResults4thOrderQC";\r
- commonHistResults4thOrderName += fAnalysisLabel->Data();\r
- fCommonHistsResults4th = new AliFlowCommonHistResults(commonHistResults4thOrderName.Data());\r
- fHistList->Add(fCommonHistsResults4th); \r
- // common histograms for final results (calculated for events with 6 and more particles)\r
- TString commonHistResults6thOrderName = "AliFlowCommonHistResults6thOrderQC";\r
- commonHistResults6thOrderName += fAnalysisLabel->Data();\r
- fCommonHistsResults6th = new AliFlowCommonHistResults(commonHistResults6thOrderName.Data());\r
- fHistList->Add(fCommonHistsResults6th); \r
- // common histograms for final results (calculated for events with 8 and more particles)\r
- TString commonHistResults8thOrderName = "AliFlowCommonHistResults8thOrderQC";\r
- commonHistResults8thOrderName += fAnalysisLabel->Data();\r
- fCommonHistsResults8th = new AliFlowCommonHistResults(commonHistResults8thOrderName.Data());\r
- fHistList->Add(fCommonHistsResults8th); \r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::BookCommonHistograms()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms()\r
-{\r
- // book and fill histograms which hold phi, pt and eta weights\r
-\r
- if(!fWeightsList)\r
- {\r
- cout<<"WARNING: fWeightsList is NULL in AFAWQC::BAFWH() !!!!"<<endl;\r
- exit(0); \r
- }\r
- \r
- TString fUseParticleWeightsName = "fUseParticleWeightsQC";\r
- fUseParticleWeightsName += fAnalysisLabel->Data();\r
- fUseParticleWeights = new TProfile(fUseParticleWeightsName.Data(),"0 = particle weight not used, 1 = particle weight used ",3,0,3);\r
- fUseParticleWeights->SetLabelSize(0.06);\r
- (fUseParticleWeights->GetXaxis())->SetBinLabel(1,"w_{#phi}");\r
- (fUseParticleWeights->GetXaxis())->SetBinLabel(2,"w_{p_{T}}");\r
- (fUseParticleWeights->GetXaxis())->SetBinLabel(3,"w_{#eta}");\r
- fUseParticleWeights->Fill(0.5,(Int_t)fUsePhiWeights);\r
- fUseParticleWeights->Fill(1.5,(Int_t)fUsePtWeights);\r
- fUseParticleWeights->Fill(2.5,(Int_t)fUseEtaWeights);\r
- fWeightsList->Add(fUseParticleWeights); \r
- \r
- if(fUsePhiWeights)\r
- {\r
- if(fWeightsList->FindObject("phi_weights"))\r
- {\r
- fPhiWeights = dynamic_cast<TH1F*>(fWeightsList->FindObject("phi_weights"));\r
- if((fPhiWeights->GetBinWidth(1) > fPhiBinWidth) || (fPhiWeights->GetBinWidth(1) < fPhiBinWidth))\r
- {\r
- cout<<"WARNING: fPhiWeights->GetBinWidth(1) != fPhiBinWidth in AFAWQC::BAFWH() !!!! "<<endl;\r
- cout<<" This indicates inconsistent binning in phi histograms throughout the code."<<endl;\r
- exit(0);\r
- }\r
- } else \r
- {\r
- cout<<"WARNING: fWeightsList->FindObject(\"phi_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl;\r
- exit(0);\r
- }\r
- } // end of if(fUsePhiWeights)\r
- \r
- if(fUsePtWeights) \r
- {\r
- if(fWeightsList->FindObject("pt_weights"))\r
- {\r
- fPtWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("pt_weights"));\r
- if((fPtWeights->GetBinWidth(1) > fPtBinWidth) || (fPtWeights->GetBinWidth(1) < fPtBinWidth))\r
- {\r
- cout<<"WARNING: fPtWeights->GetBinWidth(1) != fPtBinWidth in AFAWQC::BAFWH() !!!! "<<endl;\r
- cout<<" This indicates insconsistent binning in pt histograms throughout the code."<<endl;\r
- exit(0);\r
- }\r
- } else \r
- {\r
- cout<<"WARNING: fWeightsList->FindObject(\"pt_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl;\r
- exit(0);\r
- }\r
- } // end of if(fUsePtWeights) \r
-\r
- if(fUseEtaWeights) \r
- {\r
- if(fWeightsList->FindObject("eta_weights"))\r
- {\r
- fEtaWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("eta_weights"));\r
- if((fEtaWeights->GetBinWidth(1) > fEtaBinWidth) || (fEtaWeights->GetBinWidth(1) < fEtaBinWidth))\r
- {\r
- cout<<"WARNING: fEtaWeights->GetBinWidth(1) != fEtaBinWidth in AFAWQC::BAFWH() !!!! "<<endl;\r
- cout<<" This indicates insconsistent binning in eta histograms throughout the code."<<endl;\r
- exit(0);\r
- }\r
- } else \r
- {\r
- cout<<"WARNING: fUseEtaWeights && fWeightsList->FindObject(\"eta_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl;\r
- exit(0);\r
- }\r
- } // end of if(fUseEtaWeights)\r
- \r
-} // end of AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow()\r
-{\r
- // Book all objects for integrated flow:\r
- // a) Book profile to hold all flags for integrated flow.\r
- // b) Book event-by-event quantities.\r
- // c) Book profiles. // to be improved (comment)\r
- // d) Book histograms holding the final results.\r
- \r
- TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?)\r
- TString powerFlag[2] = {"linear","quadratic"}; // to be improved (should I promote this to data members?)\r
- \r
- // a) Book profile to hold all flags for integrated flow:\r
- TString intFlowFlagsName = "fIntFlowFlags";\r
- intFlowFlagsName += fAnalysisLabel->Data();\r
- fIntFlowFlags = new TProfile(intFlowFlagsName.Data(),"Flags for Integrated Flow",3,0,3);\r
- fIntFlowFlags->SetTickLength(-0.01,"Y");\r
- fIntFlowFlags->SetMarkerStyle(25);\r
- fIntFlowFlags->SetLabelSize(0.05);\r
- fIntFlowFlags->SetLabelOffset(0.02,"Y");\r
- (fIntFlowFlags->GetXaxis())->SetBinLabel(1,"Particle Weights");\r
- (fIntFlowFlags->GetXaxis())->SetBinLabel(2,"Event Weights");\r
- (fIntFlowFlags->GetXaxis())->SetBinLabel(3,"Corrected for NUA?");\r
- fIntFlowList->Add(fIntFlowFlags);\r
-\r
- // b) Book event-by-event quantities:\r
- // Re[Q_{m*n,k}], Im[Q_{m*n,k}] and S_{p,k}^M: \r
- fReQ = new TMatrixD(4,9);\r
- fImQ = new TMatrixD(4,9);\r
- fSMpk = new TMatrixD(8,9);\r
- // average correlations <2>, <4>, <6> and <8> for single event (bining is the same as in fIntFlowCorrelationsPro and fIntFlowCorrelationsHist):\r
- TString intFlowCorrelationsEBEName = "fIntFlowCorrelationsEBE";\r
- intFlowCorrelationsEBEName += fAnalysisLabel->Data();\r
- fIntFlowCorrelationsEBE = new TH1D(intFlowCorrelationsEBEName.Data(),intFlowCorrelationsEBEName.Data(),4,0,4);\r
- // weights for average correlations <2>, <4>, <6> and <8> for single event:\r
- TString intFlowEventWeightsForCorrelationsEBEName = "fIntFlowEventWeightsForCorrelationsEBE";\r
- intFlowEventWeightsForCorrelationsEBEName += fAnalysisLabel->Data();\r
- fIntFlowEventWeightsForCorrelationsEBE = new TH1D(intFlowEventWeightsForCorrelationsEBEName.Data(),intFlowEventWeightsForCorrelationsEBEName.Data(),4,0,4);\r
- // average all correlations for single event (bining is the same as in fIntFlowCorrelationsAllPro and fIntFlowCorrelationsAllHist):\r
- TString intFlowCorrelationsAllEBEName = "fIntFlowCorrelationsAllEBE";\r
- intFlowCorrelationsAllEBEName += fAnalysisLabel->Data();\r
- fIntFlowCorrelationsAllEBE = new TH1D(intFlowCorrelationsAllEBEName.Data(),intFlowCorrelationsAllEBEName.Data(),32,0,32);\r
- // average correction terms for non-uniform acceptance for single event \r
- // (binning is the same as in fIntFlowCorrectionTermsForNUAPro[2] and fIntFlowCorrectionTermsForNUAHist[2]):\r
- TString fIntFlowCorrectionTermsForNUAEBEName = "fIntFlowCorrectionTermsForNUAEBE";\r
- fIntFlowCorrectionTermsForNUAEBEName += fAnalysisLabel->Data();\r
- for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
- {\r
- fIntFlowCorrectionTermsForNUAEBE[sc] = new TH1D(Form("%s: %s terms",fIntFlowCorrectionTermsForNUAEBEName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),10,0,10); \r
- }\r
- \r
- // c) Book profiles: // to be improved (comment)\r
- // profile to hold average multiplicities and number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8:\r
- TString avMultiplicityName = "fAvMultiplicity";\r
- avMultiplicityName += fAnalysisLabel->Data();\r
- fAvMultiplicity = new TProfile(avMultiplicityName.Data(),"Average Multiplicities of RPs",9,0,9);\r
- fAvMultiplicity->SetTickLength(-0.01,"Y");\r
- fAvMultiplicity->SetMarkerStyle(25);\r
- fAvMultiplicity->SetLabelSize(0.05);\r
- fAvMultiplicity->SetLabelOffset(0.02,"Y");\r
- fAvMultiplicity->SetYTitle("Average Multiplicity");\r
- (fAvMultiplicity->GetXaxis())->SetBinLabel(1,"all evts");\r
- (fAvMultiplicity->GetXaxis())->SetBinLabel(2,"n_{RP} #geq 1");\r
- (fAvMultiplicity->GetXaxis())->SetBinLabel(3,"n_{RP} #geq 2");\r
- (fAvMultiplicity->GetXaxis())->SetBinLabel(4,"n_{RP} #geq 3");\r
- (fAvMultiplicity->GetXaxis())->SetBinLabel(5,"n_{RP} #geq 4");\r
- (fAvMultiplicity->GetXaxis())->SetBinLabel(6,"n_{RP} #geq 5");\r
- (fAvMultiplicity->GetXaxis())->SetBinLabel(7,"n_{RP} #geq 6");\r
- (fAvMultiplicity->GetXaxis())->SetBinLabel(8,"n_{RP} #geq 7");\r
- (fAvMultiplicity->GetXaxis())->SetBinLabel(9,"n_{RP} #geq 8");\r
- fIntFlowProfiles->Add(fAvMultiplicity);\r
- // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with wrong errors!):\r
- TString intFlowCorrelationsProName = "fIntFlowCorrelationsPro";\r
- intFlowCorrelationsProName += fAnalysisLabel->Data();\r
- fIntFlowCorrelationsPro = new TProfile(intFlowCorrelationsProName.Data(),"Average correlations for all events",4,0,4,"s");\r
- fIntFlowCorrelationsPro->SetTickLength(-0.01,"Y");\r
- fIntFlowCorrelationsPro->SetMarkerStyle(25);\r
- fIntFlowCorrelationsPro->SetLabelSize(0.06);\r
- fIntFlowCorrelationsPro->SetLabelOffset(0.01,"Y");\r
- (fIntFlowCorrelationsPro->GetXaxis())->SetBinLabel(1,"<<2>>");\r
- (fIntFlowCorrelationsPro->GetXaxis())->SetBinLabel(2,"<<4>>");\r
- (fIntFlowCorrelationsPro->GetXaxis())->SetBinLabel(3,"<<6>>");\r
- (fIntFlowCorrelationsPro->GetXaxis())->SetBinLabel(4,"<<8>>");\r
- fIntFlowProfiles->Add(fIntFlowCorrelationsPro);\r
- // averaged all correlations for all events (with wrong errors!):\r
- TString intFlowCorrelationsAllProName = "fIntFlowCorrelationsAllPro";\r
- intFlowCorrelationsAllProName += fAnalysisLabel->Data();\r
- fIntFlowCorrelationsAllPro = new TProfile(intFlowCorrelationsAllProName.Data(),"Average correlations for all events",32,0,32,"s");\r
- fIntFlowCorrelationsAllPro->SetTickLength(-0.01,"Y");\r
- fIntFlowCorrelationsAllPro->SetMarkerStyle(25);\r
- fIntFlowCorrelationsAllPro->SetLabelSize(0.03);\r
- fIntFlowCorrelationsAllPro->SetLabelOffset(0.01,"Y");\r
- // 2-p correlations:\r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(1,"<<2>>_{n|n}");\r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(2,"<<2>>_{2n|2n}");\r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(3,"<<2>>_{3n|3n}");\r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(4,"<<2>>_{4n|4n}");\r
- // 3-p correlations:\r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(6,"<<3>>_{2n|n,n}");\r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}");\r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}");\r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}");\r
- // 4-p correlations:\r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}"); \r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}");\r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}");\r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}");\r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}");\r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}"); \r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}");\r
- // 5-p correlations:\r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}"); \r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}");\r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}");\r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}");\r
- // 6-p correlations:\r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}");\r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}");\r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}");\r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}");\r
- // 7-p correlations: \r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}");\r
- // 8-p correlations:\r
- (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}");\r
- fIntFlowProfiles->Add(fIntFlowCorrelationsAllPro);\r
- // when particle weights are used some extra correlations appear:\r
- if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) \r
- {\r
- TString intFlowExtraCorrelationsProName = "fIntFlowExtraCorrelationsPro";\r
- intFlowExtraCorrelationsProName += fAnalysisLabel->Data();\r
- fIntFlowExtraCorrelationsPro = new TProfile(intFlowExtraCorrelationsProName.Data(),"Average extra correlations for all events",100,0,100,"s");\r
- fIntFlowExtraCorrelationsPro->SetTickLength(-0.01,"Y");\r
- fIntFlowExtraCorrelationsPro->SetMarkerStyle(25);\r
- fIntFlowExtraCorrelationsPro->SetLabelSize(0.03);\r
- fIntFlowExtraCorrelationsPro->SetLabelOffset(0.01,"Y");\r
- // extra 2-p correlations:\r
- (fIntFlowExtraCorrelationsPro->GetXaxis())->SetBinLabel(1,"<<w1^3 w2 cos(n*(phi1-phi2))>>");\r
- (fIntFlowExtraCorrelationsPro->GetXaxis())->SetBinLabel(2,"<<w1 w2 w3^2 cos(n*(phi1-phi2))>>");\r
- fIntFlowProfiles->Add(fIntFlowExtraCorrelationsPro);\r
- } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)\r
- // average product of correlations <2>, <4>, <6> and <8>: \r
- TString intFlowProductOfCorrelationsProName = "fIntFlowProductOfCorrelationsPro";\r
- intFlowProductOfCorrelationsProName += fAnalysisLabel->Data();\r
- fIntFlowProductOfCorrelationsPro = new TProfile(intFlowProductOfCorrelationsProName.Data(),"Average products of correlations",6,0,6);\r
- fIntFlowProductOfCorrelationsPro->SetTickLength(-0.01,"Y");\r
- fIntFlowProductOfCorrelationsPro->SetMarkerStyle(25); \r
- fIntFlowProductOfCorrelationsPro->SetLabelSize(0.05);\r
- fIntFlowProductOfCorrelationsPro->SetLabelOffset(0.01,"Y");\r
- (fIntFlowProductOfCorrelationsPro->GetXaxis())->SetBinLabel(1,"<<2><4>>");\r
- (fIntFlowProductOfCorrelationsPro->GetXaxis())->SetBinLabel(2,"<<2><6>>");\r
- (fIntFlowProductOfCorrelationsPro->GetXaxis())->SetBinLabel(3,"<<2><8>>");\r
- (fIntFlowProductOfCorrelationsPro->GetXaxis())->SetBinLabel(4,"<<4><6>>");\r
- (fIntFlowProductOfCorrelationsPro->GetXaxis())->SetBinLabel(5,"<<4><8>>");\r
- (fIntFlowProductOfCorrelationsPro->GetXaxis())->SetBinLabel(6,"<<6><8>>");\r
- fIntFlowProfiles->Add(fIntFlowProductOfCorrelationsPro);\r
- // average correction terms for non-uniform acceptance (with wrong errors!):\r
- for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
- {\r
- TString intFlowCorrectionTermsForNUAProName = "fIntFlowCorrectionTermsForNUAPro";\r
- intFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data();\r
- fIntFlowCorrectionTermsForNUAPro[sc] = new TProfile(Form("%s: %s terms",intFlowCorrectionTermsForNUAProName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),10,0,10,"s");\r
- fIntFlowCorrectionTermsForNUAPro[sc]->SetTickLength(-0.01,"Y");\r
- fIntFlowCorrectionTermsForNUAPro[sc]->SetMarkerStyle(25);\r
- fIntFlowCorrectionTermsForNUAPro[sc]->SetLabelSize(0.03);\r
- fIntFlowCorrectionTermsForNUAPro[sc]->SetLabelOffset(0.01,"Y");\r
- // 1-particle terms:\r
- (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(1,Form("<<%s(n(phi1))>>",sinCosFlag[sc].Data()));\r
- // 2-particle terms:\r
- (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(2,Form("<<%s(n(phi1+phi2))>>",sinCosFlag[sc].Data())); \r
- // 3-particle terms:\r
- (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(3,Form("<<%s(n(phi1-phi2-phi3))>>",sinCosFlag[sc].Data())); \r
- // ... \r
- fIntFlowProfiles->Add(fIntFlowCorrectionTermsForNUAPro[sc]);\r
- } // end of for(Int_t sc=0;sc<2;sc++) \r
- \r
- // d) Book histograms holding the final results:\r
- // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with correct errors!):\r
- TString intFlowCorrelationsHistName = "fIntFlowCorrelationsHist";\r
- intFlowCorrelationsHistName += fAnalysisLabel->Data();\r
- fIntFlowCorrelationsHist = new TH1D(intFlowCorrelationsHistName.Data(),"Average correlations for all events",4,0,4);\r
- fIntFlowCorrelationsHist->SetTickLength(-0.01,"Y");\r
- fIntFlowCorrelationsHist->SetMarkerStyle(25);\r
- fIntFlowCorrelationsHist->SetLabelSize(0.06);\r
- fIntFlowCorrelationsHist->SetLabelOffset(0.01,"Y");\r
- (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(1,"<<2>>");\r
- (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(2,"<<4>>");\r
- (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(3,"<<6>>");\r
- (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(4,"<<8>>");\r
- fIntFlowResults->Add(fIntFlowCorrelationsHist);\r
- // average all correlations for all events (with correct errors!):\r
- TString intFlowCorrelationsAllHistName = "fIntFlowCorrelationsAllHist";\r
- intFlowCorrelationsAllHistName += fAnalysisLabel->Data();\r
- fIntFlowCorrelationsAllHist = new TH1D(intFlowCorrelationsAllHistName.Data(),"Average correlations for all events",32,0,32);\r
- fIntFlowCorrelationsAllHist->SetTickLength(-0.01,"Y");\r
- fIntFlowCorrelationsAllHist->SetMarkerStyle(25);\r
- fIntFlowCorrelationsAllHist->SetLabelSize(0.03);\r
- fIntFlowCorrelationsAllHist->SetLabelOffset(0.01,"Y");\r
- // 2-p correlations:\r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(1,"<<2>>_{n|n}");\r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(2,"<<2>>_{2n|2n}");\r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(3,"<<2>>_{3n|3n}");\r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(4,"<<2>>_{4n|4n}");\r
- // 3-p correlations:\r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(6,"<<3>>_{2n|n,n}");\r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}");\r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}");\r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}");\r
- // 4-p correlations:\r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}"); \r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}");\r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}");\r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}");\r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}");\r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}"); \r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}");\r
- // 5-p correlations:\r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}"); \r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}");\r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}");\r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}");\r
- // 6-p correlations:\r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}");\r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}");\r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}");\r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}");\r
- // 7-p correlations: \r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}");\r
- // 8-p correlations:\r
- (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}");\r
- fIntFlowResults->Add(fIntFlowCorrelationsAllHist);\r
- // average correction terms for non-uniform acceptance (with correct errors!):\r
- for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
- {\r
- TString intFlowCorrectionTermsForNUAHistName = "fIntFlowCorrectionTermsForNUAHist";\r
- intFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data();\r
- fIntFlowCorrectionTermsForNUAHist[sc] = new TH1D(Form("%s: %s terms",intFlowCorrectionTermsForNUAHistName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),10,0,10);\r
- fIntFlowCorrectionTermsForNUAHist[sc]->SetTickLength(-0.01,"Y");\r
- fIntFlowCorrectionTermsForNUAHist[sc]->SetMarkerStyle(25);\r
- fIntFlowCorrectionTermsForNUAHist[sc]->SetLabelSize(0.03);\r
- fIntFlowCorrectionTermsForNUAHist[sc]->SetLabelOffset(0.01,"Y");\r
- // ......................................................................... \r
- // 1-p terms:\r
- (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(1,Form("%s(n(#phi_{1}))>",sinCosFlag[sc].Data()));\r
- // 2-p terms:\r
- // 3-p terms:\r
- // ...\r
- // ......................................................................... \r
- fIntFlowResults->Add(fIntFlowCorrectionTermsForNUAHist[sc]);\r
- } // end of for(Int_t sc=0;sc<2;sc++) \r
- // covariances (multiplied with weight dependent prefactor):\r
- TString intFlowCovariancesName = "fIntFlowCovariances";\r
- intFlowCovariancesName += fAnalysisLabel->Data();\r
- fIntFlowCovariances = new TH1D(intFlowCovariancesName.Data(),"Covariances (multiplied with weight dependent prefactor)",6,0,6);\r
- fIntFlowCovariances->SetLabelSize(0.04);\r
- fIntFlowCovariances->SetMarkerStyle(25);\r
- (fIntFlowCovariances->GetXaxis())->SetBinLabel(1,"Cov(<2>,<4>)");\r
- (fIntFlowCovariances->GetXaxis())->SetBinLabel(2,"Cov(<2>,<6>)");\r
- (fIntFlowCovariances->GetXaxis())->SetBinLabel(3,"Cov(<2>,<8>)");\r
- (fIntFlowCovariances->GetXaxis())->SetBinLabel(4,"Cov(<4>,<6>)");\r
- (fIntFlowCovariances->GetXaxis())->SetBinLabel(5,"Cov(<4>,<8>)");\r
- (fIntFlowCovariances->GetXaxis())->SetBinLabel(6,"Cov(<6>,<8>)"); \r
- fIntFlowResults->Add(fIntFlowCovariances);\r
- // sum of linear and quadratic event weights for <2>, <4>, <6> and <8>:\r
- TString intFlowSumOfEventWeightsName = "fIntFlowSumOfEventWeights";\r
- intFlowSumOfEventWeightsName += fAnalysisLabel->Data();\r
- for(Int_t power=0;power<2;power++)\r
- {\r
- fIntFlowSumOfEventWeights[power] = new TH1D(Form("%s: %s",intFlowSumOfEventWeightsName.Data(),powerFlag[power].Data()),Form("Sum of %s event weights for correlations",powerFlag[power].Data()),4,0,4);\r
- fIntFlowSumOfEventWeights[power]->SetLabelSize(0.05);\r
- fIntFlowSumOfEventWeights[power]->SetMarkerStyle(25);\r
- if(power == 0)\r
- {\r
- (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>}");\r
- (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<4>}");\r
- (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<6>}");\r
- (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{<8>}");\r
- } else if (power == 1) \r
- {\r
- (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>}^{2}");\r
- (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<4>}^{2}");\r
- (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<6>}^{2}");\r
- (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{<8>}^{2}");\r
- }\r
- fIntFlowResults->Add(fIntFlowSumOfEventWeights[power]);\r
- } \r
- // sum of products of event weights for correlations <2>, <4>, <6> and <8>: \r
- TString intFlowSumOfProductOfEventWeightsName = "fIntFlowSumOfProductOfEventWeights";\r
- intFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data();\r
- fIntFlowSumOfProductOfEventWeights = new TH1D(intFlowSumOfProductOfEventWeightsName.Data(),"Sum of product of event weights for correlations",6,0,6);\r
- fIntFlowSumOfProductOfEventWeights->SetLabelSize(0.05);\r
- fIntFlowSumOfProductOfEventWeights->SetMarkerStyle(25);\r
- (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>} w_{<4>}");\r
- (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<2>} w_{<6>}");\r
- (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<2>} w_{<8>}");\r
- (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{<4>} w_{<6>}");\r
- (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(5,"#sum_{i=1}^{N} w_{<4>} w_{<8>}");\r
- (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(6,"#sum_{i=1}^{N} w_{<6>} w_{<8>}");\r
- fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeights);\r
- // final results for integrated Q-cumulants:\r
- TString intFlowQcumulantsName = "fIntFlowQcumulants";\r
- intFlowQcumulantsName += fAnalysisLabel->Data();\r
- fIntFlowQcumulants = new TH1D(intFlowQcumulantsName.Data(),"Integrated Q-cumulants",4,0,4);\r
- fIntFlowQcumulants->SetLabelSize(0.05);\r
- fIntFlowQcumulants->SetMarkerStyle(25);\r
- (fIntFlowQcumulants->GetXaxis())->SetBinLabel(1,"QC{2}");\r
- (fIntFlowQcumulants->GetXaxis())->SetBinLabel(2,"QC{4}");\r
- (fIntFlowQcumulants->GetXaxis())->SetBinLabel(3,"QC{6}");\r
- (fIntFlowQcumulants->GetXaxis())->SetBinLabel(4,"QC{8}");\r
- fIntFlowResults->Add(fIntFlowQcumulants);\r
- // final integrated flow estimates from Q-cumulants:\r
- TString intFlowName = "fIntFlow";\r
- intFlowName += fAnalysisLabel->Data(); \r
- // integrated flow from Q-cumulants:\r
- fIntFlow = new TH1D(intFlowName.Data(),"Integrated flow estimates from Q-cumulants",4,0,4);\r
- fIntFlow->SetLabelSize(0.05);\r
- fIntFlow->SetMarkerStyle(25);\r
- (fIntFlow->GetXaxis())->SetBinLabel(1,"v_{2}{2,QC}");\r
- (fIntFlow->GetXaxis())->SetBinLabel(2,"v_{2}{4,QC}");\r
- (fIntFlow->GetXaxis())->SetBinLabel(3,"v_{2}{6,QC}");\r
- (fIntFlow->GetXaxis())->SetBinLabel(4,"v_{2}{8,QC}");\r
- fIntFlowResults->Add(fIntFlow);\r
-\r
- /* // to be improved (removed):\r
- // final average weighted multi-particle correlations for all events calculated from Q-vectors\r
- fQCorrelations[1] = new TProfile("Weighted correlations","final average multi-particle correlations from weighted Q-vectors",200,0,200,"s");\r
- fQCorrelations[1]->SetTickLength(-0.01,"Y");\r
- fQCorrelations[1]->SetMarkerStyle(25);\r
- fQCorrelations[1]->SetLabelSize(0.03);\r
- fQCorrelations[1]->SetLabelOffset(0.01,"Y");\r
- // 2-particle correlations:\r
- (fQCorrelations[1]->GetXaxis())->SetBinLabel(1,"<w_{1}w_{2}cos(n(#phi_{1}-#phi_{2}))>");\r
- (fQCorrelations[1]->GetXaxis())->SetBinLabel(2,"<w_{1}^{2}w_{2}^{2}cos(2n(#phi_{1}-#phi_{2}))>");\r
- (fQCorrelations[1]->GetXaxis())->SetBinLabel(3,"<w_{1}^{3}w_{2}^{3}cos(3n(#phi_{1}-#phi_{2}))>");\r
- (fQCorrelations[1]->GetXaxis())->SetBinLabel(4,"<w_{1}^{4}w_{2}^{4}cos(4n(#phi_{1}-#phi_{2}))>");\r
- (fQCorrelations[1]->GetXaxis())->SetBinLabel(5,"<w_{1}^{3}w_{2}cos(n(#phi_{1}-#phi_{2}))>");\r
- (fQCorrelations[1]->GetXaxis())->SetBinLabel(6,"<w_{1}^{2}w_{2}w_{3}cos(n(#phi_{1}-#phi_{2}))>");\r
- // 3-particle correlations:\r
- (fQCorrelations[1]->GetXaxis())->SetBinLabel(21,"<w_{1}w_{2}w_{3}^{2}cos(n(2#phi_{1}-#phi_{2}-#phi_{3}))>");\r
- // 4-particle correlations:\r
- (fQCorrelations[1]->GetXaxis())->SetBinLabel(41,"<w_{1}w_{2}w_{3}w_{4}cos(n(#phi_{1}+#phi_{2}-#phi_{3}-#phi_{4}))>");\r
- // add fQCorrelations[1] to the list fIntFlowList:\r
- fIntFlowList->Add(fQCorrelations[1]); \r
- */\r
- \r
-} // end of AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::InitializeArraysForNestedLoops()\r
-{\r
- // Initialize arrays of all objects relevant for calculations with nested loops.\r
- \r
- // integrated flow:\r
- for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
- {\r
- fIntFlowDirectCorrectionTermsForNUA[sc] = NULL;\r
- } \r
-\r
- // differential flow: \r
- // correlations:\r
- for(Int_t t=0;t<2;t++) // type: RP or POI\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- for(Int_t ci=0;ci<4;ci++) // correlation index\r
- {\r
- fDiffFlowDirectCorrelations[t][pe][ci] = NULL;\r
- } // end of for(Int_t ci=0;ci<4;ci++) // correlation index \r
- } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- } // end of for(Int_t t=0;t<2;t++) // type: RP or POI\r
- // correction terms for non-uniform acceptance:\r
- for(Int_t t=0;t<2;t++) // type: RP or POI\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
- {\r
- for(Int_t cti=0;cti<9;cti++) // correction term index\r
- {\r
- fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = NULL;\r
- } \r
- }\r
- } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- } // end of for(Int_t t=0;t<2;t++) // type: RP or POI\r
-\r
-\r
-} // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForNestedLoops()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops()\r
-{\r
- // Book all objects relevant for calculations with nested loops.\r
- \r
- TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?)\r
- TString typeFlag[2] = {"RP","POI"}; // to be improved (should I promote this to data members?)\r
- TString ptEtaFlag[2] = {"p_{T}","#eta"}; // to be improved (should I promote this to data members?)\r
- TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; // to be improved (should I promote this to data members?)\r
- Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth};\r
- Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth};\r
-\r
- TString evaluateNestedLoopsName = "fEvaluateNestedLoops";\r
- evaluateNestedLoopsName += fAnalysisLabel->Data();\r
- fEvaluateNestedLoops = new TProfile(evaluateNestedLoopsName.Data(),"Flags for nested loops",4,0,4);\r
- fEvaluateNestedLoops->SetLabelSize(0.03);\r
- (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(1,"fEvaluateIntFlowNestedLoops");\r
- (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(2,"fEvaluateDiffFlowNestedLoops");\r
- (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(3,"fCrossCheckInPtBinNo");\r
- (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(4,"fCrossCheckInEtaBinNo");\r
- fEvaluateNestedLoops->Fill(0.5,(Int_t)fEvaluateIntFlowNestedLoops);\r
- fEvaluateNestedLoops->Fill(1.5,(Int_t)fEvaluateDiffFlowNestedLoops);\r
- fEvaluateNestedLoops->Fill(2.5,fCrossCheckInPtBinNo);\r
- fEvaluateNestedLoops->Fill(3.5,fCrossCheckInEtaBinNo);\r
- fNestedLoopsList->Add(fEvaluateNestedLoops);\r
- // nested loops for integrated flow:\r
- if(fEvaluateIntFlowNestedLoops)\r
- {\r
- // correlations:\r
- TString intFlowDirectCorrelationsName = "fIntFlowDirectCorrelations";\r
- intFlowDirectCorrelationsName += fAnalysisLabel->Data();\r
- fIntFlowDirectCorrelations = new TProfile(intFlowDirectCorrelationsName.Data(),"Multiparticle correlations calculated with nested loops (for int. flow)",32,0,32,"s");\r
- fNestedLoopsList->Add(fIntFlowDirectCorrelations);\r
- if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)\r
- {\r
- TString intFlowExtraDirectCorrelationsName = "fIntFlowExtraDirectCorrelations";\r
- intFlowExtraDirectCorrelationsName += fAnalysisLabel->Data();\r
- fIntFlowExtraDirectCorrelations = new TProfile(intFlowExtraDirectCorrelationsName.Data(),"Extra multiparticle correlations calculated with nested loops (for int. flow)",100,0,100,"s");\r
- fNestedLoopsList->Add(fIntFlowExtraDirectCorrelations); \r
- } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)\r
- // correction terms for non-uniform acceptance:\r
- for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
- {\r
- TString intFlowDirectCorrectionTermsForNUAName = "fIntFlowDirectCorrectionTermsForNUA";\r
- intFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data();\r
- fIntFlowDirectCorrectionTermsForNUA[sc] = new TProfile(Form("%s: %s terms",intFlowDirectCorrectionTermsForNUAName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),10,0,10,"s");\r
- fNestedLoopsList->Add(fIntFlowDirectCorrectionTermsForNUA[sc]);\r
- } // end of for(Int_t sc=0;sc<2;sc++) \r
- } // end of if(fEvaluateIntFlowNestedLoops)\r
- \r
- // nested loops for differential flow: \r
- if(fEvaluateDiffFlowNestedLoops)\r
- {\r
- // reduced correlations:\r
- TString diffFlowDirectCorrelationsName = "fDiffFlowDirectCorrelations";\r
- diffFlowDirectCorrelationsName += fAnalysisLabel->Data();\r
- for(Int_t t=0;t<2;t++) // type: RP or POI\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- for(Int_t rci=0;rci<4;rci++) // reduced correlation index\r
- {\r
- // reduced correlations:\r
- fDiffFlowDirectCorrelations[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe],"s");\r
- fDiffFlowDirectCorrelations[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data());\r
- fNestedLoopsList->Add(fDiffFlowDirectCorrelations[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations)\r
- } // end of for(Int_t rci=0;rci<4;rci++) // correlation index\r
- } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta \r
- } // end of for(Int_t t=0;t<2;t++) // type: RP or POI \r
- // correction terms for non-uniform acceptance:\r
- TString diffFlowDirectCorrectionTermsForNUAName = "fDiffFlowDirectCorrectionTermsForNUA";\r
- diffFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data();\r
- for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI)\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- for(Int_t sc=0;sc<2;sc++) // sin or cos\r
- {\r
- for(Int_t cti=0;cti<9;cti++) // correction term index\r
- {\r
- fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = new TProfile(Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe],"s"); \r
- fNestedLoopsList->Add(fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]);\r
- }\r
- }\r
- }\r
- } \r
- } // end of if(fEvaluateDiffFlowNestedLoops)\r
-\r
-} // end of AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelations()\r
-{\r
- // calculate all correlations needed for integrated flow\r
- \r
- // multiplicity:\r
- Double_t dMult = (*fSMpk)(0,0);\r
- \r
- // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
- Double_t dReQ1n = (*fReQ)(0,0);\r
- Double_t dReQ2n = (*fReQ)(1,0);\r
- Double_t dReQ3n = (*fReQ)(2,0);\r
- Double_t dReQ4n = (*fReQ)(3,0);\r
- Double_t dImQ1n = (*fImQ)(0,0);\r
- Double_t dImQ2n = (*fImQ)(1,0);\r
- Double_t dImQ3n = (*fImQ)(2,0);\r
- Double_t dImQ4n = (*fImQ)(3,0);\r
- \r
- // real and imaginary parts of some expressions involving various combinations of Q-vectors evaluated in harmonics n, 2n, 3n and 4n:\r
- // (these expression appear in the Eqs. for the multi-particle correlations bellow)\r
- \r
- // Re[Q_{2n} Q_{n}^* Q_{n}^*]\r
- Double_t reQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dReQ2n + 2.*dReQ1n*dImQ1n*dImQ2n - pow(dImQ1n,2.)*dReQ2n; \r
- \r
- // Im[Q_{2n} Q_{n}^* Q_{n}^*]\r
- //Double_t imQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dImQ2n-2.*dReQ1n*dImQ1n*dReQ2n-pow(dImQ1n,2.)*dImQ2n; \r
- \r
- // Re[Q_{n} Q_{n} Q_{2n}^*] = Re[Q_{2n} Q_{n}^* Q_{n}^*]\r
- Double_t reQ1nQ1nQ2nstar = reQ2nQ1nstarQ1nstar; \r
- \r
- // Re[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*]\r
- Double_t reQ3nQ1nQ2nstarQ2nstar = (pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n) \r
- + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n);\r
-\r
- // Im[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*] \r
- //Double_t imQ3nQ1nQ2nstarQ2nstar = calculate and implement this (deleteMe)\r
- \r
- // Re[Q_{2n} Q_{2n} Q_{3n}^* Q_{1n}^*] = Re[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*]\r
- Double_t reQ2nQ2nQ3nstarQ1nstar = reQ3nQ1nQ2nstarQ2nstar;\r
- \r
- // Re[Q_{4n} Q_{2n}^* Q_{2n}^*]\r
- Double_t reQ4nQ2nstarQ2nstar = pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n;\r
-\r
- // Im[Q_{4n} Q_{2n}^* Q_{2n}^*]\r
- //Double_t imQ4nQ2nstarQ2nstar = calculate and implement this (deleteMe)\r
- \r
- // Re[Q_{2n} Q_{2n} Q_{4n}^*] = Re[Q_{4n} Q_{2n}^* Q_{2n}^*]\r
- Double_t reQ2nQ2nQ4nstar = reQ4nQ2nstarQ2nstar;\r
- \r
- // Re[Q_{4n} Q_{3n}^* Q_{n}^*]\r
- Double_t reQ4nQ3nstarQ1nstar = dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n);\r
- \r
- // Re[Q_{3n} Q_{n} Q_{4n}^*] = Re[Q_{4n} Q_{3n}^* Q_{n}^*]\r
- Double_t reQ3nQ1nQ4nstar = reQ4nQ3nstarQ1nstar;\r
- \r
- // Im[Q_{4n} Q_{3n}^* Q_{n}^*]\r
- //Double_t imQ4nQ3nstarQ1nstar = calculate and implement this (deleteMe)\r
-\r
- // Re[Q_{3n} Q_{2n}^* Q_{n}^*]\r
- Double_t reQ3nQ2nstarQ1nstar = dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n\r
- + dImQ3n*dImQ2n*dReQ1n;\r
- \r
- // Re[Q_{2n} Q_{n} Q_{3n}^*] = Re[Q_{3n} Q_{2n}^* Q_{n}^*]\r
- Double_t reQ2nQ1nQ3nstar = reQ3nQ2nstarQ1nstar;\r
- \r
- // Im[Q_{3n} Q_{2n}^* Q_{n}^*]\r
- //Double_t imQ3nQ2nstarQ1nstar; //calculate and implement this (deleteMe)\r
- \r
- // Re[Q_{3n} Q_{n}^* Q_{n}^* Q_{n}^*]\r
- Double_t reQ3nQ1nstarQ1nstarQ1nstar = dReQ3n*pow(dReQ1n,3)-3.*dReQ1n*dReQ3n*pow(dImQ1n,2)\r
- + 3.*dImQ1n*dImQ3n*pow(dReQ1n,2)-dImQ3n*pow(dImQ1n,3);\r
-\r
- // Im[Q_{3n} Q_{n}^* Q_{n}^* Q_{n}^*]\r
- //Double_t imQ3nQ1nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe)\r
- \r
- // |Q_{2n}|^2 |Q_{n}|^2\r
- Double_t dQ2nQ1nQ2nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.));\r
- \r
- // Re[Q_{4n} Q_{2n}^* Q_{n}^* Q_{n}^*]\r
- Double_t reQ4nQ2nstarQ1nstarQ1nstar = (dReQ4n*dReQ2n+dImQ4n*dImQ2n)*(pow(dReQ1n,2)-pow(dImQ1n,2))\r
- + 2.*dReQ1n*dImQ1n*(dImQ4n*dReQ2n-dReQ4n*dImQ2n); \r
- \r
- // Im[Q_{4n} Q_{2n}^* Q_{n}^* Q_{n}^*]\r
- //Double_t imQ4nQ2nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe)\r
- \r
- // Re[Q_{2n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^*]\r
- Double_t reQ2nQ1nQ1nstarQ1nstarQ1nstar = (dReQ2n*dReQ1n-dImQ2n*dImQ1n)*(pow(dReQ1n,3)-3.*dReQ1n*pow(dImQ1n,2))\r
- + (dReQ2n*dImQ1n+dReQ1n*dImQ2n)*(3.*dImQ1n*pow(dReQ1n,2)-pow(dImQ1n,3));\r
-\r
- // Im[Q_{2n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^*] \r
- //Double_t imQ2nQ1nQ1nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe)\r
- \r
- // Re[Q_{2n} Q_{2n} Q_{2n}^* Q_{n}^* Q_{n}^*]\r
- Double_t reQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))\r
- * (dReQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) + 2.*dImQ2n*dReQ1n*dImQ1n);\r
-\r
- // Im[Q_{2n} Q_{2n} Q_{2n}^* Q_{n}^* Q_{n}^*]\r
- //Double_t imQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))\r
- // * (dImQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) - 2.*dReQ2n*dReQ1n*dImQ1n);\r
- \r
- // Re[Q_{4n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]\r
- Double_t reQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dReQ4n-6.*pow(dReQ1n,2.)*dReQ4n*pow(dImQ1n,2.)\r
- + pow(dImQ1n,4.)*dReQ4n+4.*pow(dReQ1n,3.)*dImQ1n*dImQ4n\r
- - 4.*pow(dImQ1n,3.)*dReQ1n*dImQ4n;\r
- \r
- // Im[Q_{4n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]\r
- //Double_t imQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dImQ4n-6.*pow(dReQ1n,2.)*dImQ4n*pow(dImQ1n,2.)\r
- // + pow(dImQ1n,4.)*dImQ4n+4.*pow(dImQ1n,3.)*dReQ1n*dReQ4n\r
- // - 4.*pow(dReQ1n,3.)*dImQ1n*dReQ4n;\r
- \r
- // Re[Q_{3n} Q_{n} Q_{2n}^* Q_{n}^* Q_{n}^*]\r
- Double_t reQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.))\r
- * (dReQ1n*dReQ2n*dReQ3n-dReQ3n*dImQ1n*dImQ2n+dReQ2n*dImQ1n*dImQ3n+dReQ1n*dImQ2n*dImQ3n);\r
- \r
- // Im[Q_{3n} Q_{n} Q_{2n}^* Q_{n}^* Q_{n}^*]\r
- //Double_t imQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.))\r
- // * (-dReQ2n*dReQ3n*dImQ1n-dReQ1n*dReQ3n*dImQ2n+dReQ1n*dReQ2n*dImQ3n-dImQ1n*dImQ2n*dImQ3n);\r
- \r
- \r
- // Re[Q_{2n} Q_{2n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]\r
- Double_t reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)*dReQ2n-2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.)\r
- + dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dImQ2n)\r
- * (pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.)\r
- - dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n+pow(dImQ1n,2.)*dImQ2n);\r
- \r
- // Im[Q_{2n} Q_{2n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]\r
- //Double_t imQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = 2.*(pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.)\r
- // + 2.*dReQ1n*dImQ1n*dImQ2n)*(pow(dReQ1n,2.)*dImQ2n\r
- // - 2.*dReQ1n*dImQ1n*dReQ2n-pow(dImQ1n,2.)*dImQ2n);\r
- \r
- // Re[Q_{3n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]\r
- Double_t reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.))\r
- * (pow(dReQ1n,3.)*dReQ3n-3.*dReQ1n*dReQ3n*pow(dImQ1n,2.)\r
- + 3.*pow(dReQ1n,2.)*dImQ1n*dImQ3n-pow(dImQ1n,3.)*dImQ3n);\r
- \r
- // Im[Q_{3n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] \r
- //Double_t imQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.))\r
- // * (pow(dImQ1n,3.)*dReQ3n-3.*dImQ1n*dReQ3n*pow(dReQ1n,2.)\r
- // - 3.*pow(dImQ1n,2.)*dReQ1n*dImQ3n+pow(dReQ1n,3.)*dImQ3n);\r
- \r
- // |Q_{2n}|^2 |Q_{n}|^4\r
- Double_t dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.);\r
- \r
- // Re[Q_{2n} Q_{n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]\r
- Double_t reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)\r
- * (pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.)\r
- + 2.*dReQ1n*dImQ1n*dImQ2n);\r
- \r
- // Im[Q_{2n} Q_{n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] \r
- //Double_t imQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)\r
- // * (pow(dReQ1n,2.)*dImQ2n-dImQ2n*pow(dImQ1n,2.)\r
- // - 2.*dReQ1n*dReQ2n*dImQ1n);\r
- \r
- \r
- \r
- \r
- // **************************************\r
- // **** multi-particle correlations: ****\r
- // **************************************\r
- //\r
- // Remark 1: multi-particle correlations calculated with non-weighted Q-vectors are stored in 1D profile fQCorrelations[0]. // to be improved (wrong profiles)\r
- // Remark 2: binning of fQCorrelations[0] is organized as follows: // to be improved (wrong profiles)\r
- // --------------------------------------------------------------------------------------------------------------------\r
- // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))>\r
- // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))>\r
- // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))> \r
- // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))>\r
- // 5th bin: ---- EMPTY ----\r
- // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))>\r
- // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))>\r
- // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))>\r
- // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))>\r
- // 10th bin: ---- EMPTY ----\r
- // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))>\r
- // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))>\r
- // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))>\r
- // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))> \r
- // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))>\r
- // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))>\r
- // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> \r
- // 18th bin: ---- EMPTY ----\r
- // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))>\r
- // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))>\r
- // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))>\r
- // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))>\r
- // 23rd bin: ---- EMPTY ----\r
- // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))>\r
- // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))>\r
- // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))>\r
- // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))>\r
- // 28th bin: ---- EMPTY ----\r
- // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))>\r
- // 30th bin: ---- EMPTY ----\r
- // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))>\r
- // --------------------------------------------------------------------------------------------------------------------\r
- \r
- // 2-particle:\r
- Double_t two1n1n = 0.; // <cos(n*(phi1-phi2))>\r
- Double_t two2n2n = 0.; // <cos(2n*(phi1-phi2))>\r
- Double_t two3n3n = 0.; // <cos(3n*(phi1-phi2))>\r
- Double_t two4n4n = 0.; // <cos(4n*(phi1-phi2))>\r
- \r
- if(dMult>1)\r
- {\r
- two1n1n = (pow(dReQ1n,2.)+pow(dImQ1n,2.)-dMult)/(dMult*(dMult-1.)); \r
- two2n2n = (pow(dReQ2n,2.)+pow(dImQ2n,2.)-dMult)/(dMult*(dMult-1.)); \r
- two3n3n = (pow(dReQ3n,2.)+pow(dImQ3n,2.)-dMult)/(dMult*(dMult-1.)); \r
- two4n4n = (pow(dReQ4n,2.)+pow(dImQ4n,2.)-dMult)/(dMult*(dMult-1.)); \r
- \r
- // average 2-particle correlations for single event: \r
- fIntFlowCorrelationsAllEBE->SetBinContent(1,two1n1n);\r
- fIntFlowCorrelationsAllEBE->SetBinContent(2,two2n2n);\r
- fIntFlowCorrelationsAllEBE->SetBinContent(3,two3n3n);\r
- fIntFlowCorrelationsAllEBE->SetBinContent(4,two4n4n);\r
- \r
- // average 2-particle correlations for all events: \r
- fIntFlowCorrelationsAllPro->Fill(0.5,two1n1n,dMult*(dMult-1.)); \r
- fIntFlowCorrelationsAllPro->Fill(1.5,two2n2n,dMult*(dMult-1.)); \r
- fIntFlowCorrelationsAllPro->Fill(2.5,two3n3n,dMult*(dMult-1.)); \r
- fIntFlowCorrelationsAllPro->Fill(3.5,two4n4n,dMult*(dMult-1.)); \r
- \r
- // store separetately <2> (to be improved: do I really need this?)\r
- fIntFlowCorrelationsEBE->SetBinContent(1,two1n1n); // <2>\r
- \r
- // to be improved (this can be implemented better):\r
- Double_t mWeight2p = 0.;\r
- if(!strcmp(fMultiplicityWeight->Data(),"combinations"))\r
- {\r
- mWeight2p = dMult*(dMult-1.);\r
- } else if(!strcmp(fMultiplicityWeight->Data(),"unit"))\r
- {\r
- mWeight2p = 1.; \r
- } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity"))\r
- {\r
- mWeight2p = dMult; \r
- }\r
- \r
- fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(1,mWeight2p); // eW_<2>\r
- fIntFlowCorrelationsPro->Fill(0.5,two1n1n,mWeight2p);\r
- \r
- // distribution of <cos(n*(phi1-phi2))>:\r
- //f2pDistribution->Fill(two1n1n,dMult*(dMult-1.)); \r
- } // end of if(dMult>1)\r
- \r
- // 3-particle:\r
- Double_t three2n1n1n = 0.; // <cos(n*(2.*phi1-phi2-phi3))>\r
- Double_t three3n2n1n = 0.; // <cos(n*(3.*phi1-2.*phi2-phi3))>\r
- Double_t three4n2n2n = 0.; // <cos(n*(4.*phi1-2.*phi2-2.*phi3))>\r
- Double_t three4n3n1n = 0.; // <cos(n*(4.*phi1-3.*phi2-phi3))>\r
- \r
- if(dMult>2)\r
- {\r
- three2n1n1n = (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))\r
- - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult)\r
- / (dMult*(dMult-1.)*(dMult-2.)); \r
- three3n2n1n = (reQ3nQ2nstarQ1nstar-(pow(dReQ3n,2.)+pow(dImQ3n,2.))\r
- - (pow(dReQ2n,2.)+pow(dImQ2n,2.))\r
- - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult)\r
- / (dMult*(dMult-1.)*(dMult-2.));\r
- three4n2n2n = (reQ4nQ2nstarQ2nstar-2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))\r
- - (pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*dMult)\r
- / (dMult*(dMult-1.)*(dMult-2.)); \r
- three4n3n1n = (reQ4nQ3nstarQ1nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.))\r
- - (pow(dReQ3n,2.)+pow(dImQ3n,2.))\r
- - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult)\r
- / (dMult*(dMult-1.)*(dMult-2.)); \r
- \r
- // average 3-particle correlations for single event: \r
- fIntFlowCorrelationsAllEBE->SetBinContent(6,three2n1n1n);\r
- fIntFlowCorrelationsAllEBE->SetBinContent(7,three3n2n1n);\r
- fIntFlowCorrelationsAllEBE->SetBinContent(8,three4n2n2n);\r
- fIntFlowCorrelationsAllEBE->SetBinContent(9,three4n3n1n);\r
- \r
- // average 3-particle correlations for all events: \r
- fIntFlowCorrelationsAllPro->Fill(5.5,three2n1n1n,dMult*(dMult-1.)*(dMult-2.)); \r
- fIntFlowCorrelationsAllPro->Fill(6.5,three3n2n1n,dMult*(dMult-1.)*(dMult-2.));\r
- fIntFlowCorrelationsAllPro->Fill(7.5,three4n2n2n,dMult*(dMult-1.)*(dMult-2.)); \r
- fIntFlowCorrelationsAllPro->Fill(8.5,three4n3n1n,dMult*(dMult-1.)*(dMult-2.)); \r
- } // end of if(dMult>2)\r
- \r
- // 4-particle:\r
- Double_t four1n1n1n1n = 0.; // <cos(n*(phi1+phi2-phi3-phi4))>\r
- Double_t four2n2n2n2n = 0.; // <cos(2.*n*(phi1+phi2-phi3-phi4))>\r
- Double_t four2n1n2n1n = 0.; // <cos(n*(2.*phi1+phi2-2.*phi3-phi4))> \r
- Double_t four3n1n1n1n = 0.; // <cos(n*(3.*phi1-phi2-phi3-phi4))> \r
- Double_t four4n2n1n1n = 0.; // <cos(n*(4.*phi1-2.*phi2-phi3-phi4))> \r
- Double_t four3n1n2n2n = 0.; // <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))> \r
- Double_t four3n1n3n1n = 0.; // <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> \r
- \r
- if(dMult>3)\r
- {\r
- four1n1n1n1n = (2.*dMult*(dMult-3.)+pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ1n,2.)\r
- + pow(dImQ1n,2.))-2.*reQ2nQ1nstarQ1nstar+(pow(dReQ2n,2.)+pow(dImQ2n,2.)))\r
- / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); \r
- four2n2n2n2n = (2.*dMult*(dMult-3.)+pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ2n,2.)\r
- + pow(dImQ2n,2.))-2.*reQ4nQ2nstarQ2nstar+(pow(dReQ4n,2.)+pow(dImQ4n,2.)))\r
- / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.));\r
- four2n1n2n1n = (dQ2nQ1nQ2nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar-2.*reQ2nQ1nstarQ1nstar)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
- - ((dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))\r
- + (dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-(pow(dReQ3n,2.)+pow(dImQ3n,2.)))\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
- + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.));\r
- four3n1n1n1n = (reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar-3.*reQ2nQ1nstarQ1nstar)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
- + (2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))\r
- + 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));\r
- four4n2n1n1n = (reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar-2.*reQ3nQ2nstarQ1nstar)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
- - (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))\r
- - 3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
- - 6./((dMult-1.)*(dMult-2.)*(dMult-3.));\r
- four3n1n2n2n = (reQ3nQ1nQ2nstarQ2nstar-reQ4nQ2nstarQ2nstar-reQ3nQ1nQ4nstar-2.*reQ3nQ2nstarQ1nstar)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
- - (2.*reQ1nQ1nQ2nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))\r
- - 4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
- - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); \r
- four3n1n3n1n = ((pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.))\r
- - 2.*reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
- + ((pow(dReQ4n,2.)+pow(dImQ4n,2.))-(dMult-4.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))\r
- + (pow(dReQ2n,2.)+pow(dImQ2n,2.))-(dMult-4.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
- + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.));\r
- \r
- // average 4-particle correlations for single event: \r
- fIntFlowCorrelationsAllEBE->SetBinContent(11,four1n1n1n1n);\r
- fIntFlowCorrelationsAllEBE->SetBinContent(12,four2n1n2n1n);\r
- fIntFlowCorrelationsAllEBE->SetBinContent(13,four2n2n2n2n);\r
- fIntFlowCorrelationsAllEBE->SetBinContent(14,four3n1n1n1n);\r
- fIntFlowCorrelationsAllEBE->SetBinContent(15,four3n1n3n1n);\r
- fIntFlowCorrelationsAllEBE->SetBinContent(16,four3n1n2n2n);\r
- fIntFlowCorrelationsAllEBE->SetBinContent(17,four4n2n1n1n);\r
- \r
- // average 4-particle correlations for all events: \r
- fIntFlowCorrelationsAllPro->Fill(10.5,four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));\r
- fIntFlowCorrelationsAllPro->Fill(11.5,four2n1n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));\r
- fIntFlowCorrelationsAllPro->Fill(12.5,four2n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));\r
- fIntFlowCorrelationsAllPro->Fill(13.5,four3n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));\r
- fIntFlowCorrelationsAllPro->Fill(14.5,four3n1n3n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));\r
- fIntFlowCorrelationsAllPro->Fill(15.5,four3n1n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); \r
- fIntFlowCorrelationsAllPro->Fill(16.5,four4n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); \r
- \r
- // store separetately <4> (to be improved: do I really need this?)\r
- fIntFlowCorrelationsEBE->SetBinContent(2,four1n1n1n1n); // <4>\r
- \r
- // to be improved (this can be implemented better):\r
- Double_t mWeight4p = 0.;\r
- if(!strcmp(fMultiplicityWeight->Data(),"combinations"))\r
- {\r
- mWeight4p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.);\r
- } else if(!strcmp(fMultiplicityWeight->Data(),"unit"))\r
- {\r
- mWeight4p = 1.; \r
- } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity"))\r
- {\r
- mWeight4p = dMult; \r
- }\r
- \r
- fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(2,mWeight4p); // eW_<4>\r
- fIntFlowCorrelationsPro->Fill(1.5,four1n1n1n1n,mWeight4p);\r
- \r
- // distribution of <cos(n*(phi1+phi2-phi3-phi4))>\r
- //f4pDistribution->Fill(four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));\r
- \r
- } // end of if(dMult>3)\r
-\r
- // 5-particle:\r
- Double_t five2n1n1n1n1n = 0.; // <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))>\r
- Double_t five2n2n2n1n1n = 0.; // <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))>\r
- Double_t five3n1n2n1n1n = 0.; // <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))>\r
- Double_t five4n1n1n1n1n = 0.; // <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))>\r
- \r
- if(dMult>4)\r
- {\r
- five2n1n1n1n1n = (reQ2nQ1nQ1nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar+6.*reQ3nQ2nstarQ1nstar)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
- - (reQ2nQ1nQ3nstar+3.*(dMult-6.)*reQ2nQ1nstarQ1nstar+3.*reQ1nQ1nQ2nstar)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
- - (2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))\r
- + 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) \r
- - 3.*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)))\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
- - 3.*(pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)\r
- - 2.*(2*dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult*(dMult-4.))\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));\r
- \r
- five2n2n2n1n1n = (reQ2nQ2nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ2nQ2nQ3nstarQ1nstar)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
- + 2.*(reQ4nQ2nstarQ2nstar+4.*reQ3nQ2nstarQ1nstar+reQ3nQ1nQ4nstar)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
- + (reQ2nQ2nQ4nstar-2.*(dMult-5.)*reQ2nQ1nstarQ1nstar+2.*reQ1nQ1nQ2nstar)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
- - (2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))\r
- + 1.*pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)\r
- - 2.*(3.*dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)))\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
- - (4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.))\r
- - 4.*(dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+4.*dMult*(dMult-6.))\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); \r
-\r
- five4n1n1n1n1n = (reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ4nQ2nstarQ1nstarQ1nstar-4.*reQ3nQ1nstarQ1nstarQ1nstar)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
- + (8.*reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar+12.*reQ3nQ2nstarQ1nstar+12.*reQ2nQ1nstarQ1nstar)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
- - (6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+8.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))\r
- + 12.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+24.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-24.*dMult)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));\r
- \r
- five3n1n2n1n1n = (reQ3nQ1nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
- - (reQ3nQ1nQ2nstarQ2nstar-3.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
- - ((2.*dMult-13.)*reQ3nQ2nstarQ1nstar-reQ3nQ1nQ4nstar-9.*reQ2nQ1nstarQ1nstar)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
- - (2.*reQ1nQ1nQ2nstar+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))\r
- - 2.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+2.*(pow(dReQ3n,2.)\r
- + pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
- + (2.*(dMult-6.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))\r
- - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.))\r
- - pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)\r
- + 2.*(3.*dMult-11.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
- - 4.*(dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));\r
- \r
- // average 5-particle correlations for single event: \r
- fIntFlowCorrelationsAllEBE->SetBinContent(19,five2n1n1n1n1n);\r
- fIntFlowCorrelationsAllEBE->SetBinContent(20,five2n2n2n1n1n);\r
- fIntFlowCorrelationsAllEBE->SetBinContent(21,five3n1n2n1n1n);\r
- fIntFlowCorrelationsAllEBE->SetBinContent(22,five4n1n1n1n1n);\r
- \r
- // average 5-particle correlations for all events: \r
- fIntFlowCorrelationsAllPro->Fill(18.5,five2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); \r
- fIntFlowCorrelationsAllPro->Fill(19.5,five2n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));\r
- fIntFlowCorrelationsAllPro->Fill(20.5,five3n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));\r
- fIntFlowCorrelationsAllPro->Fill(21.5,five4n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));\r
- } // end of if(dMult>4)\r
- \r
- // 6-particle:\r
- Double_t six1n1n1n1n1n1n = 0.; // <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))>\r
- Double_t six2n2n1n1n1n1n = 0.; // <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))>\r
- Double_t six3n1n1n1n1n1n = 0.; // <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))>\r
- Double_t six2n1n1n2n1n1n = 0.; // <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))>\r
- \r
- if(dMult>5)\r
- {\r
- six1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),3.)+9.*dQ2nQ1nQ2nstarQ1nstar-6.*reQ2nQ1nQ1nstarQ1nstarQ1nstar)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.))\r
- + 4.*(reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.))\r
- + 2.*(9.*(dMult-4.)*reQ2nQ1nstarQ1nstar+2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)))\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.))\r
- - 9.*(pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)+(pow(dReQ2n,2.)+pow(dImQ2n,2.)))\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-5.))\r
- + (18.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))\r
- / (dMult*(dMult-1)*(dMult-3)*(dMult-4))\r
- - 6./((dMult-1.)*(dMult-2.)*(dMult-3.));\r
- \r
- six2n1n1n2n1n1n = (dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)\r
- * (2.*five2n2n2n1n1n+4.*five2n1n1n1n1n+4.*five3n1n2n1n1n+4.*four2n1n2n1n+1.*four1n1n1n1n)\r
- - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four1n1n1n1n+4.*two1n1n\r
- + 2.*three2n1n1n+2.*three2n1n1n+4.*four3n1n1n1n+8.*three2n1n1n+2.*four4n2n1n1n\r
- + 4.*four2n1n2n1n+2.*two2n2n+8.*four2n1n2n1n+4.*four3n1n3n1n+8.*three3n2n1n\r
- + 4.*four3n1n2n2n+4.*four1n1n1n1n+4.*four2n1n2n1n+1.*four2n2n2n2n)\r
- - dMult*(dMult-1.)*(dMult-2.)*(2.*three2n1n1n+8.*two1n1n+4.*two1n1n+2.\r
- + 4.*two1n1n+4.*three2n1n1n+2.*two2n2n+4.*three2n1n1n+8.*three3n2n1n\r
- + 8.*two2n2n+4.*three4n3n1n+4.*two3n3n+4.*three3n2n1n+4.*two1n1n\r
- + 8.*three2n1n1n+4.*two1n1n+4.*three3n2n1n+4.*three2n1n1n+2.*two2n2n\r
- + 4.*three3n2n1n+2.*three4n2n2n)-dMult*(dMult-1.)\r
- * (4.*two1n1n+4.+4.*two1n1n+2.*two2n2n+1.+4.*two1n1n+4.*two2n2n+4.*two3n3n\r
- + 1.+2.*two2n2n+1.*two4n4n)-dMult)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed)\r
- \r
- six2n2n1n1n1n1n = (reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)\r
- * (five4n1n1n1n1n+8.*five2n1n1n1n1n+6.*five2n2n2n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)\r
- * (4.*four3n1n1n1n+6.*four4n2n1n1n+12.*three2n1n1n+12.*four1n1n1n1n+24.*four2n1n2n1n\r
- + 4.*four3n1n2n2n+3.*four2n2n2n2n)-dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+12.*three3n2n1n\r
- + 4.*three4n3n1n+3.*three4n2n2n+8.*three2n1n1n+24.*two1n1n+12.*two2n2n+12.*three2n1n1n+8.*three3n2n1n\r
- + 1.*three4n2n2n)-dMult*(dMult-1.)*(4.*two1n1n+6.*two2n2n+4.*two3n3n+1.*two4n4n+2.*two2n2n+8.*two1n1n+6.)-dMult)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed)\r
- \r
- six3n1n1n1n1n1n = (reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)\r
- * (five4n1n1n1n1n+4.*five2n1n1n1n1n+6.*five3n1n2n1n1n+4.*four3n1n1n1n)\r
- - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four3n1n1n1n+6.*four4n2n1n1n+6.*four1n1n1n1n\r
- + 12.*three2n1n1n+12.*four2n1n2n1n+6.*four3n1n1n1n+12.*three3n2n1n+4.*four3n1n3n1n+3.*four3n1n2n2n)\r
- - dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+12.*three3n2n1n+4.*three4n3n1n+3.*three4n2n2n+4.*two1n1n\r
- + 12.*two1n1n+6.*three2n1n1n+12.*three2n1n1n+4.*three3n2n1n+12.*two2n2n+4.*three3n2n1n+4.*two3n3n+1.*three4n3n1n\r
- + 6.*three3n2n1n)-dMult*(dMult-1.)*(4.*two1n1n+6.*two2n2n+4.*two3n3n+1.*two4n4n+1.*two1n1n+4.+6.*two1n1n+4.*two2n2n\r
- + 1.*two3n3n)-dMult)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed)\r
- \r
- // average 6-particle correlations for single event: \r
- fIntFlowCorrelationsAllEBE->SetBinContent(24,six1n1n1n1n1n1n);\r
- fIntFlowCorrelationsAllEBE->SetBinContent(25,six2n1n1n2n1n1n);\r
- fIntFlowCorrelationsAllEBE->SetBinContent(26,six2n2n1n1n1n1n);\r
- fIntFlowCorrelationsAllEBE->SetBinContent(27,six3n1n1n1n1n1n);\r
- \r
- // average 6-particle correlations for all events: \r
- fIntFlowCorrelationsAllPro->Fill(23.5,six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); \r
- fIntFlowCorrelationsAllPro->Fill(24.5,six2n1n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); \r
- fIntFlowCorrelationsAllPro->Fill(25.5,six2n2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.));\r
- fIntFlowCorrelationsAllPro->Fill(26.5,six3n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); \r
-\r
- // store separetately <6> (to be improved: do I really need this?)\r
- fIntFlowCorrelationsEBE->SetBinContent(3,six1n1n1n1n1n1n); // <6>\r
- \r
- // to be improved (this can be implemented better):\r
- Double_t mWeight6p = 0.;\r
- if(!strcmp(fMultiplicityWeight->Data(),"combinations"))\r
- {\r
- mWeight6p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.);\r
- } else if(!strcmp(fMultiplicityWeight->Data(),"unit"))\r
- {\r
- mWeight6p = 1.; \r
- } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity"))\r
- {\r
- mWeight6p = dMult; \r
- }\r
- \r
- fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(3,mWeight6p); // eW_<6>\r
- fIntFlowCorrelationsPro->Fill(2.5,six1n1n1n1n1n1n,mWeight6p);\r
- \r
- // distribution of <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))>\r
- //f6pDistribution->Fill(six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); \r
- } // end of if(dMult>5)\r
- \r
- // 7-particle:\r
- Double_t seven2n1n1n1n1n1n1n = 0.; // <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))>\r
- \r
- if(dMult>6)\r
- {\r
- seven2n1n1n1n1n1n1n = (reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)\r
- * (2.*six3n1n1n1n1n1n+4.*six1n1n1n1n1n1n+1.*six2n2n1n1n1n1n+6.*six2n1n1n2n1n1n+8.*five2n1n1n1n1n)\r
- - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(1.*five4n1n1n1n1n +8.*five2n1n1n1n1n+8.*four3n1n1n1n\r
- + 12.*five3n1n2n1n1n+4.*five2n1n1n1n1n+3.*five2n2n2n1n1n+6.*five2n2n2n1n1n+6.*four1n1n1n1n+24.*four1n1n1n1n\r
- + 12.*five2n1n1n1n1n+12.*five2n1n1n1n1n+12.*three2n1n1n+24.*four2n1n2n1n+4.*five3n1n2n1n1n+4.*five2n1n1n1n1n)\r
- - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four3n1n1n1n+6.*four4n2n1n1n+12.*four1n1n1n1n+24.*three2n1n1n\r
- + 24.*four2n1n2n1n+12.*four3n1n1n1n+24.*three3n2n1n+8.*four3n1n3n1n+6.*four3n1n2n2n+6.*three2n1n1n+12.*four1n1n1n1n\r
- + 12.*four2n1n2n1n+6.*three2n1n1n+12.*four2n1n2n1n+4.*four3n1n2n2n+3.*four2n2n2n2n+4.*four1n1n1n1n+6.*three2n1n1n\r
- + 24.*two1n1n+24.*four1n1n1n1n+4.*four3n1n1n1n+24.*two1n1n+24.*three2n1n1n+12.*two2n2n+24.*three2n1n1n+12.*four2n1n2n1n\r
- + 8.*three3n2n1n+8.*four2n1n2n1n+1.*four4n2n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+1.*three2n1n1n+8.*two1n1n\r
- + 12.*three3n2n1n+24.*two1n1n+12.*three2n1n1n+4.*three2n1n1n+8.*two1n1n+4.*three4n3n1n+24.*three2n1n1n+8.*three3n2n1n\r
- + 12.*two1n1n+12.*two1n1n+3.*three4n2n2n+24.*two2n2n+6.*two2n2n+12.+12.*three3n2n1n+8.*two3n3n+12.*three2n1n1n+24.*two1n1n\r
- + 4.*three3n2n1n+8.*three3n2n1n+2.*three4n3n1n+12.*two1n1n+8.*three2n1n1n+4.*three2n1n1n+2.*three3n2n1n+6.*two2n2n+8.*two2n2n\r
- + 1.*three4n2n2n+4.*three3n2n1n+6.*three2n1n1n)-dMult*(dMult-1.)*(4.*two1n1n+2.*two1n1n+6.*two2n2n+8.+1.*two2n2n+4.*two3n3n\r
- + 12.*two1n1n+4.*two1n1n+1.*two4n4n+8.*two2n2n+6.+2.*two3n3n+4.*two1n1n+1.*two2n2n)-dMult)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)); // to be improved (direct formula needed)\r
- \r
- // average 7-particle correlations for single event: \r
- fIntFlowCorrelationsAllEBE->SetBinContent(29,seven2n1n1n1n1n1n1n);\r
- \r
- // average 7-particle correlations for all events: \r
- fIntFlowCorrelationsAllPro->Fill(28.5,seven2n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.));\r
- } // end of if(dMult>6)\r
- \r
- // 8-particle:\r
- Double_t eight1n1n1n1n1n1n1n1n = 0.; // <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))>\r
- if(dMult>7)\r
- {\r
- eight1n1n1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),4.)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)\r
- * (12.*seven2n1n1n1n1n1n1n+16.*six1n1n1n1n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)\r
- * (8.*six3n1n1n1n1n1n+48.*six1n1n1n1n1n1n+6.*six2n2n1n1n1n1n+96.*five2n1n1n1n1n+72.*four1n1n1n1n+36.*six2n1n1n2n1n1n)\r
- - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(2.*five4n1n1n1n1n+32.*five2n1n1n1n1n+36.*four1n1n1n1n\r
- + 32.*four3n1n1n1n+48.*five2n1n1n1n1n+48.*five3n1n2n1n1n+144.*five2n1n1n1n1n+288.*four1n1n1n1n+36.*five2n2n2n1n1n\r
- + 144.*three2n1n1n+96.*two1n1n+144.*four2n1n2n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)\r
- * (8.*four3n1n1n1n+48.*four1n1n1n1n+12.*four4n2n1n1n+96.*four2n1n2n1n+96.*three2n1n1n+72.*three2n1n1n+144.*two1n1n\r
- + 16.*four3n1n3n1n+48.*four3n1n1n1n+144.*four1n1n1n1n+72.*four1n1n1n1n+96.*three3n2n1n+24.*four3n1n2n2n+144.*four2n1n2n1n\r
- + 288.*two1n1n+288.*three2n1n1n+9.*four2n2n2n2n+72.*two2n2n+24.)-dMult*(dMult-1.)*(dMult-2.)*(12.*three2n1n1n+16.*two1n1n\r
- + 24.*three3n2n1n+48.*three2n1n1n+96.*two1n1n+8.*three4n3n1n+32.*three3n2n1n+96.*three2n1n1n+144.*two1n1n+6.*three4n2n2n\r
- + 96.*two2n2n+36.*two2n2n+72.+48.*three3n2n1n+16.*two3n3n+72.*three2n1n1n+144.*two1n1n)-dMult*(dMult-1.)*(8.*two1n1n\r
- + 12.*two2n2n+16.+8.*two3n3n+48.*two1n1n+1.*two4n4n+16.*two2n2n+18.)-dMult)\r
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); // to be improved (direct formula needed)\r
- \r
- // average 8-particle correlations for single event: \r
- fIntFlowCorrelationsAllEBE->SetBinContent(31,eight1n1n1n1n1n1n1n1n);\r
- \r
- // average 8-particle correlations for all events: \r
- fIntFlowCorrelationsAllPro->Fill(30.5,eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.));\r
- \r
- // store separetately <8> (to be improved: do I really need this?)\r
- fIntFlowCorrelationsEBE->SetBinContent(4,eight1n1n1n1n1n1n1n1n); // <8>\r
- \r
- // to be improved (this can be implemented better):\r
- Double_t mWeight8p = 0.;\r
- if(!strcmp(fMultiplicityWeight->Data(),"combinations"))\r
- {\r
- mWeight8p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.);\r
- } else if(!strcmp(fMultiplicityWeight->Data(),"unit"))\r
- {\r
- mWeight8p = 1.; \r
- } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity"))\r
- {\r
- mWeight8p = dMult; \r
- }\r
- \r
- fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(4,mWeight8p); // eW_<8>\r
- fIntFlowCorrelationsPro->Fill(3.5,eight1n1n1n1n1n1n1n1n,mWeight8p); \r
- \r
- // distribution of <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))>\r
- //f8pDistribution->Fill(eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.));\r
- } // end of if(dMult>7) \r
- \r
-} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelations()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrelations()\r
-{\r
- // Calculate averages of products of correlations for integrated flow // to be improved (this method can be implemented better)\r
- \r
- // a) Binning of fIntFlowProductOfCorrelationsPro is organized as follows:\r
- // 1st bin: <<2><4>> \r
- // 2nd bin: <<2><6>>\r
- // 3rd bin: <<2><8>>\r
- // 4th bin: <<4><6>>\r
- // 5th bin: <<4><8>>\r
- // 6th bin: <<6><8>>\r
-\r
- /*\r
- Double_t dMult = (*fSMpk)(0,0); // multiplicity \r
-\r
- Double_t twoEBE = fIntFlowCorrelationsEBE->GetBinContent(1); // <2>\r
- Double_t fourEBE = fIntFlowCorrelationsEBE->GetBinContent(2); // <4>\r
- Double_t sixEBE = fIntFlowCorrelationsEBE->GetBinContent(3); // <6>\r
- Double_t eightEBE = fIntFlowCorrelationsEBE->GetBinContent(4); // <8>\r
- \r
- Double_t eW2 = 0.; // event weight for <2>\r
- Double_t eW4 = 0.; // event weight for <4>\r
- Double_t eW6 = 0.; // event weight for <6>\r
- Double_t eW8 = 0.; // event weight for <8>\r
- \r
- if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
- {\r
- eW2 = dMult*(dMult-1);\r
- eW4 = dMult*(dMult-1)*(dMult-2)*(dMult-3);\r
- eW6 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5);\r
- eW8 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)*(dMult-6)*(dMult-7);\r
- } else \r
- {\r
- eW2 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j;\r
- eW4 = (*fSMpk)(3,1)-6.*(*fSMpk)(0,2)*(*fSMpk)(1,1) \r
- + 8.*(*fSMpk)(0,3)*(*fSMpk)(0,1)\r
- + 3.*(*fSMpk)(1,2)-6.*(*fSMpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l\r
- }\r
- \r
- fIntFlowProductOfCorrelationsPro->Fill(0.5,twoEBE*fourEBE,eW2*eW4); // <<2><4>> \r
- fIntFlowProductOfCorrelationsPro->Fill(1.5,twoEBE*sixEBE,eW2*eW6); // <<2><6>>\r
- fIntFlowProductOfCorrelationsPro->Fill(2.5,twoEBE*eightEBE,eW2*eW8); // <<2><8>>\r
- fIntFlowProductOfCorrelationsPro->Fill(3.5,fourEBE*sixEBE,eW4*eW6); // <<4><6>>\r
- fIntFlowProductOfCorrelationsPro->Fill(4.5,fourEBE*eightEBE,eW4*eW8); // <<4><8>>\r
- fIntFlowProductOfCorrelationsPro->Fill(5.5,sixEBE*eightEBE,eW6*eW8); // <<6><8>>\r
- */\r
- \r
- \r
- Int_t counter = 0;\r
- \r
- for(Int_t ci1=1;ci1<4;ci1++)\r
- {\r
- for(Int_t ci2=ci1+1;ci2<=4;ci2++)\r
- {\r
- fIntFlowProductOfCorrelationsPro->Fill(0.5+counter++,\r
- fIntFlowCorrelationsEBE->GetBinContent(ci1)*fIntFlowCorrelationsEBE->GetBinContent(ci2),\r
- fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)*fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2));\r
- }\r
- }\r
- \r
-} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrelations()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateCovariancesIntFlow()\r
-{\r
- // a) Calculate unbiased estimators Cov(<2>,<4>), Cov(<2>,<6>), Cov(<2>,<8>), Cov(<4>,<6>), Cov(<4>,<8>) and Cov(<6>,<8>)\r
- // for covariances V_(<2>,<4>), V_(<2>,<6>), V_(<2>,<8>), V_(<4>,<6>), V_(<4>,<8>) and V_(<6>,<8>).\r
- // b) Store in histogram fIntFlowCovariances for instance the following: \r
- //\r
- // Cov(<2>,<4>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4>}_j)]\r
- // \r
- // where N is the number of events, w_{<2>} is event weight for <2> and w_{<4>} is event weight for <4>.\r
- // c) Binning of fIntFlowCovariances is organized as follows:\r
- // \r
- // 1st bin: Cov(<2>,<4>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4>}_j)] \r
- // 2nd bin: Cov(<2>,<6>) * (sum_{i=1}^{N} w_{<2>}_i w_{<6>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<6>}_j)]\r
- // 3rd bin: Cov(<2>,<8>) * (sum_{i=1}^{N} w_{<2>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<8>}_j)]\r
- // 4th bin: Cov(<4>,<6>) * (sum_{i=1}^{N} w_{<4>}_i w_{<6>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<6>}_j)]\r
- // 5th bin: Cov(<4>,<8>) * (sum_{i=1}^{N} w_{<4>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<8>}_j)]\r
- // 6th bin: Cov(<6>,<8>) * (sum_{i=1}^{N} w_{<6>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<6>}_i) * (sum_{j=1}^{N} w_{<8>}_j)]\r
- \r
- for(Int_t power=0;power<2;power++)\r
- { \r
- if(!(fIntFlowCorrelationsPro && fIntFlowProductOfCorrelationsPro \r
- && fIntFlowSumOfEventWeights[power] && fIntFlowSumOfProductOfEventWeights\r
- && fIntFlowCovariances)) \r
- {\r
- cout<<"WARNING: fIntFlowCorrelationsPro && fIntFlowProductOfCorrelationsPro "<<endl;\r
- cout<<" && fIntFlowSumOfEventWeights[power] && fIntFlowSumOfProductOfEventWeights"<<endl;\r
- cout<<" && fIntFlowCovariances is NULL in AFAWQC::FCIF() !!!!"<<endl;\r
- cout<<"power = "<<power<<endl;\r
- exit(0);\r
- }\r
- }\r
- \r
- // average 2-, 4-, 6- and 8-particle correlations for all events:\r
- Double_t correlation[4] = {0.};\r
- for(Int_t ci=0;ci<4;ci++)\r
- {\r
- correlation[ci] = fIntFlowCorrelationsPro->GetBinContent(ci+1);\r
- } \r
- // average products of 2-, 4-, 6- and 8-particle correlations: \r
- Double_t productOfCorrelations[4][4] = {{0.}};\r
- Int_t productOfCorrelationsLabel = 1;\r
- // denominators in the expressions for the unbiased estimator for covariance:\r
- Double_t denominator[4][4] = {{0.}};\r
- Int_t sumOfProductOfEventWeightsLabel1 = 1;\r
- // weight dependent prefactor which multiply unbiased estimators for covariances:\r
- Double_t wPrefactor[4][4] = {{0.}}; \r
- Int_t sumOfProductOfEventWeightsLabel2 = 1;\r
- for(Int_t c1=0;c1<4;c1++)\r
- {\r
- for(Int_t c2=c1+1;c2<4;c2++)\r
- {\r
- productOfCorrelations[c1][c2] = fIntFlowProductOfCorrelationsPro->GetBinContent(productOfCorrelationsLabel);\r
- if(fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1) && fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1))\r
- {\r
- denominator[c1][c2] = 1.-(fIntFlowSumOfProductOfEventWeights->GetBinContent(sumOfProductOfEventWeightsLabel1))/\r
- (fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1) \r
- * fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1));\r
- \r
- wPrefactor[c1][c2] = fIntFlowSumOfProductOfEventWeights->GetBinContent(sumOfProductOfEventWeightsLabel2)/ \r
- (fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1)\r
- * fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1));\r
- \r
- \r
- }\r
- productOfCorrelationsLabel++;\r
- sumOfProductOfEventWeightsLabel1++;\r
- sumOfProductOfEventWeightsLabel2++; \r
- }\r
- }\r
- \r
- // covariance label:\r
- Int_t covarianceLabel = 1;\r
- for(Int_t c1=0;c1<4;c1++)\r
- {\r
- for(Int_t c2=c1+1;c2<4;c2++)\r
- {\r
- if(denominator[c1][c2])\r
- {\r
- // covariances:\r
- Double_t cov = (productOfCorrelations[c1][c2]-correlation[c1]*correlation[c2])/denominator[c1][c2]; \r
- // covarianced multiplied with weight dependent prefactor:\r
- Double_t wCov = cov * wPrefactor[c1][c2];\r
- fIntFlowCovariances->SetBinContent(covarianceLabel,wCov);\r
- }\r
- covarianceLabel++;\r
- }\r
- }\r
- \r
-} // end of AliFlowAnalysisWithQCumulants::CalculateCovariancesIntFlow()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::FinalizeCorrelationsIntFlow() \r
-{\r
- // From profile fIntFlowCorrelationsPro access measured correlations and spread, \r
- // correctly calculate the statistical errors and store the final results and \r
- // statistical errors for correlations in histogram fIntFlowCorrelationsHist.\r
- //\r
- // Remark: Statistical error of correlation is calculated as:\r
- //\r
- // statistical error = termA * spread * termB:\r
- // termA = sqrt{sum_{i=1}^{N} w^2}/(sum_{i=1}^{N} w)\r
- // termB = 1/sqrt(1-termA^2) \r
- \r
- for(Int_t power=0;power<2;power++)\r
- { \r
- if(!(fIntFlowCorrelationsHist && fIntFlowCorrelationsPro && fIntFlowSumOfEventWeights[power])) \r
- {\r
- cout<<"WARNING: fIntFlowCorrelationsHist && fIntFlowCorrelationsPro && fIntFlowSumOfEventWeights[power] is NULL in AFAWQC::FCIF() !!!!"<<endl;\r
- cout<<"power = "<<power<<endl;\r
- exit(0);\r
- }\r
- }\r
- \r
- for(Int_t ci=1;ci<=4;ci++) // correlation index\r
- {\r
- Double_t correlation = fIntFlowCorrelationsPro->GetBinContent(ci);\r
- Double_t spread = fIntFlowCorrelationsPro->GetBinError(ci);\r
- Double_t sumOfLinearEventWeights = fIntFlowSumOfEventWeights[0]->GetBinContent(ci);\r
- Double_t sumOfQuadraticEventWeights = fIntFlowSumOfEventWeights[1]->GetBinContent(ci);\r
- Double_t termA = 0.;\r
- Double_t termB = 0.;\r
- if(sumOfLinearEventWeights)\r
- {\r
- termA = pow(sumOfQuadraticEventWeights,0.5)/sumOfLinearEventWeights;\r
- } else\r
- {\r
- cout<<"WARNING: sumOfLinearEventWeights == 0 in AFAWQC::FCIF() !!!!"<<endl;\r
- cout<<" (for "<<2*ci<<"-particle correlation)"<<endl;\r
- }\r
- if(1.-pow(termA,2.) > 0.)\r
- {\r
- termB = 1./pow(1-pow(termA,2.),0.5);\r
- } else\r
- {\r
- cout<<"WARNING: 1.-pow(termA,2.) <= 0 in AFAWQC::FCIF() !!!!"<<endl; \r
- cout<<" (for "<<2*ci<<"-particle correlation)"<<endl;\r
- } \r
- Double_t statisticalError = termA * spread * termB;\r
- fIntFlowCorrelationsHist->SetBinContent(ci,correlation);\r
- fIntFlowCorrelationsHist->SetBinError(ci,statisticalError);\r
- } // end of for(Int_t ci=1;ci<=4;ci++) // correlation index \r
- \r
-} // end of AliFlowAnalysisWithQCumulants::FinalizeCorrelationsIntFlow()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(Int_t nRP)\r
-{\r
- // Fill profile fAverageMultiplicity to hold average multiplicities and number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8\r
- \r
- // Binning of fAverageMultiplicity is organized as follows:\r
- // 1st bin: all events (including the empty ones)\r
- // 2nd bin: event with # of RPs greater or equal to 1\r
- // 3rd bin: event with # of RPs greater or equal to 2\r
- // 4th bin: event with # of RPs greater or equal to 3\r
- // 5th bin: event with # of RPs greater or equal to 4\r
- // 6th bin: event with # of RPs greater or equal to 5\r
- // 7th bin: event with # of RPs greater or equal to 6\r
- // 8th bin: event with # of RPs greater or equal to 7\r
- // 9th bin: event with # of RPs greater or equal to 8\r
- \r
- if(!fAvMultiplicity)\r
- {\r
- cout<<"WARNING: fAvMultiplicity is NULL in AFAWQC::FAM() !!!!"<<endl;\r
- exit(0);\r
- }\r
- \r
- if(nRP<0)\r
- {\r
- cout<<"WARNING: nRP<0 in in AFAWQC::FAM() !!!!"<<endl;\r
- exit(0);\r
- }\r
- \r
- for(Int_t i=0;i<9;i++)\r
- {\r
- if(nRP>=i) fAvMultiplicity->Fill(i+0.5,nRP,1);\r
- }\r
- \r
-} // end of AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(nRP)\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateCumulantsIntFlow()\r
-{\r
- // a) Calculate Q-cumulants from the measured multiparticle correlations.\r
- // b) Propagate the statistical errors of measured multiparticle correlations to statistical errors of Q-cumulants. \r
- // c) REMARK: Q-cumulants calculated in this method are biased by non-uniform acceptance of detector !!!! \r
- // Method ApplyCorrectionForNonUniformAcceptance* (to be improved: finalize the name here)\r
- // is called afterwards to correct for this bias. \r
- // d) Store the results and statistical error of Q-cumulants in histogram fCumulants.\r
- // Binning of fCumulants is organized as follows:\r
- //\r
- // 1st bin: QC{2}\r
- // 2nd bin: QC{4}\r
- // 3rd bin: QC{6}\r
- // 4th bin: QC{8}\r
- \r
- if(!(fIntFlowCorrelationsHist && fIntFlowCovariances && fIntFlowQcumulants))\r
- {\r
- cout<<"WARNING: fIntFlowCorrelationsHist && fIntFlowCovariances && fIntFlowQcumulants is NULL in AFAWQC::CCIF() !!!!"<<endl;\r
- exit(0);\r
- }\r
- \r
- // correlations:\r
- Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> \r
- Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> \r
- Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> \r
- Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> \r
- \r
- // statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations:\r
- Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <2> \r
- Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <4> \r
- Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <6> \r
- Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <8> \r
- \r
- // covariances (multiplied by prefactor depending on weights - see comments in CalculateCovariancesIntFlow()):\r
- Double_t wCov24 = fIntFlowCovariances->GetBinContent(1); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>)\r
- Double_t wCov26 = fIntFlowCovariances->GetBinContent(2); // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>)\r
- Double_t wCov28 = fIntFlowCovariances->GetBinContent(3); // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>)\r
- Double_t wCov46 = fIntFlowCovariances->GetBinContent(4); // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>)\r
- Double_t wCov48 = fIntFlowCovariances->GetBinContent(5); // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>)\r
- Double_t wCov68 = fIntFlowCovariances->GetBinContent(6); // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>)\r
- \r
- // Q-cumulants: \r
- Double_t qc2 = 0.; // QC{2}\r
- Double_t qc4 = 0.; // QC{4}\r
- Double_t qc6 = 0.; // QC{6}\r
- Double_t qc8 = 0.; // QC{8}\r
- if(two) qc2 = two; \r
- if(four) qc4 = four-2.*pow(two,2.); \r
- if(six) qc6 = six-9.*two*four+12.*pow(two,3.); \r
- if(eight) qc8 = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.); \r
- \r
- // statistical errors of Q-cumulants: \r
- Double_t qc2Error = 0.;\r
- Double_t qc4Error = 0.;\r
- Double_t qc6Error = 0.;\r
- Double_t qc8Error = 0.;\r
- \r
- // squared statistical errors of Q-cumulants: \r
- //Double_t qc2ErrorSquared = 0.;\r
- Double_t qc4ErrorSquared = 0.;\r
- Double_t qc6ErrorSquared = 0.;\r
- Double_t qc8ErrorSquared = 0.;\r
- \r
- // statistical error of QC{2}: \r
- qc2Error = twoError; \r
- \r
- // statistical error of QC{4}: \r
- qc4ErrorSquared = 16.*pow(two,2.)*pow(twoError,2)+pow(fourError,2.)\r
- - 8.*two*wCov24; \r
- if(qc4ErrorSquared>0.)\r
- {\r
- qc4Error = pow(qc4ErrorSquared,0.5);\r
- } else \r
- {\r
- cout<<"WARNING: Statistical error of QC{4} is imaginary !!!!"<<endl;\r
- }\r
- \r
- // statistical error of QC{6}: \r
- qc6ErrorSquared = 81.*pow(4.*pow(two,2.)-four,2.)*pow(twoError,2.)\r
- + 81.*pow(two,2.)*pow(fourError,2.)\r
- + pow(sixError,2.)\r
- - 162.*two*(4.*pow(two,2.)-four)*wCov24\r
- + 18.*(4.*pow(two,2.)-four)*wCov26\r
- - 18.*two*wCov46; \r
- \r
- if(qc6ErrorSquared>0.)\r
- {\r
- qc6Error = pow(qc6ErrorSquared,0.5);\r
- } else \r
- {\r
- cout<<"WARNING: Statistical error of QC{6} is imaginary !!!!"<<endl;\r
- }\r
- \r
- // statistical error of QC{8}: \r
- qc8ErrorSquared = 256.*pow(36.*pow(two,3.)-18.*four*two+six,2.)*pow(twoError,2.)\r
- + 1296.*pow(4.*pow(two,2.)-four,2.)*pow(fourError,2.)\r
- + 256.*pow(two,2.)*pow(sixError,2.)\r
- + pow(eightError,2.)\r
- - 1152.*(36.*pow(two,3.)-18.*four*two+six)*(4.*pow(two,2.)-four)*wCov24\r
- + 512.*two*(36.*pow(two,3.)-18.*four*two+six)*wCov26\r
- - 32.*(36.*pow(two,3.)-18.*four*two+six)*wCov28\r
- - 1152.*two*(4.*pow(two,2.)-four)*wCov46\r
- + 72.*(4.*pow(two,2.)-four)*wCov48\r
- - 32.*two*wCov68; \r
- if(qc8ErrorSquared>0.)\r
- {\r
- qc8Error = pow(qc8ErrorSquared,0.5);\r
- } else \r
- {\r
- cout<<"WARNING: Statistical error of QC{8} is imaginary !!!!"<<endl;\r
- }\r
-\r
- // store the results and statistical errors for Q-cumulants:\r
- fIntFlowQcumulants->SetBinContent(1,qc2);\r
- fIntFlowQcumulants->SetBinError(1,qc2Error);\r
- fIntFlowQcumulants->SetBinContent(2,qc4);\r
- fIntFlowQcumulants->SetBinError(2,qc4Error);\r
- fIntFlowQcumulants->SetBinContent(3,qc6);\r
- fIntFlowQcumulants->SetBinError(3,qc6Error);\r
- fIntFlowQcumulants->SetBinContent(4,qc8); \r
- fIntFlowQcumulants->SetBinError(4,qc8Error); \r
- \r
-} // end of AliFlowAnalysisWithQCumulants::CalculateCumulantsIntFlow()\r
-\r
-\r
-//================================================================================================================================ \r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateIntFlow()\r
-{\r
- // a) Calculate the final results for integrated flow estimates from Q-cumulants.\r
- // b) Propagate the statistical errors of measured multiparticle correlations to statistical errors of integrated flow estimates. \r
- // c) Store the results and statistical errors of integrated flow estimates in histogram fIntFlow.\r
- // Binning of fIntFlow is organized as follows:\r
- //\r
- // 1st bin: v{2,QC}\r
- // 2nd bin: v{4,QC}\r
- // 3rd bin: v{6,QC}\r
- // 4th bin: v{8,QC}\r
- \r
- if(!(fIntFlowCorrelationsHist && fIntFlowCovariances && fIntFlowQcumulants && fIntFlow))\r
- {\r
- cout<<"WARNING: fIntFlowCorrelationsHist && fIntFlowCovariances && fIntFlowQcumulants && fIntFlow is NULL in AFAWQC::CCIF() !!!!"<<endl;\r
- exit(0);\r
- }\r
- \r
- // Q-cumulants:\r
- Double_t qc2 = fIntFlowQcumulants->GetBinContent(1); // QC{2} \r
- Double_t qc4 = fIntFlowQcumulants->GetBinContent(2); // QC{4} \r
- Double_t qc6 = fIntFlowQcumulants->GetBinContent(3); // QC{6} \r
- Double_t qc8 = fIntFlowQcumulants->GetBinContent(4); // QC{8}\r
- \r
- // correlations:\r
- Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> \r
- Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> \r
- Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> \r
- Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> \r
- \r
- // statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations:\r
- Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <2> \r
- Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <4> \r
- Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <6> \r
- Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <8> \r
- \r
- // covariances (multiplied by prefactor depending on weights - see comments in CalculateCovariancesIntFlow()):\r
- Double_t wCov24 = fIntFlowCovariances->GetBinContent(1); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>)\r
- Double_t wCov26 = fIntFlowCovariances->GetBinContent(2); // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>)\r
- Double_t wCov28 = fIntFlowCovariances->GetBinContent(3); // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>)\r
- Double_t wCov46 = fIntFlowCovariances->GetBinContent(4); // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>)\r
- Double_t wCov48 = fIntFlowCovariances->GetBinContent(5); // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>)\r
- Double_t wCov68 = fIntFlowCovariances->GetBinContent(6); // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>)\r
- \r
- // integrated flow estimates:\r
- Double_t v2 = 0.; // v{2,QC} \r
- Double_t v4 = 0.; // v{4,QC} \r
- Double_t v6 = 0.; // v{6,QC} \r
- Double_t v8 = 0.; // v{8,QC}\r
- \r
- // calculate integrated flow estimates from Q-cumulants: \r
- if(qc2>=0.) v2 = pow(qc2,1./2.); \r
- if(qc4<=0.) v4 = pow(-1.*qc4,1./4.); \r
- if(qc6>=0.) v6 = pow((1./4.)*qc6,1./6.); \r
- if(qc8<=0.) v8 = pow((-1./33.)*qc8,1./8.); \r
- \r
- // statistical errors of integrated flow estimates:\r
- Double_t v2Error = 0.; // statistical error of v{2,QC} \r
- Double_t v4Error = 0.; // statistical error of v{4,QC} \r
- Double_t v6Error = 0.; // statistical error of v{6,QC} \r
- Double_t v8Error = 0.; // statistical error of v{8,QC}\r
- \r
- // squares of statistical errors of integrated flow estimates:\r
- Double_t v2ErrorSquared = 0.; // squared statistical error of v{2,QC} \r
- Double_t v4ErrorSquared = 0.; // squared statistical error of v{4,QC} \r
- Double_t v6ErrorSquared = 0.; // squared statistical error of v{6,QC} \r
- Double_t v8ErrorSquared = 0.; // squared statistical error of v{8,QC} \r
- \r
- // calculate squared statistical errors of integrated flow estimates:\r
- if(two > 0.) \r
- { \r
- v2ErrorSquared = (1./(4.*two))*pow(twoError,2.);\r
- } \r
- if(2.*pow(two,2.)-four > 0.)\r
- {\r
- v4ErrorSquared = (1./pow(2.*pow(two,2.)-four,3./2.))*\r
- (pow(two,2.)*pow(twoError,2.)+(1./16.)*pow(fourError,2.)-(1./2.)*two*wCov24);\r
- }\r
- if(six-9.*four*two+12.*pow(two,3.) > 0.) \r
- {\r
- v6ErrorSquared = ((1./2.)*(1./pow(2.,2./3.))*(1./pow(six-9.*four*two+12.*pow(two,3.),5./3.)))*\r
- ((9./2.)*pow(4.*pow(two,2.)-four,2.)*pow(twoError,2.) \r
- + (9./2.)*pow(two,2.)*pow(fourError,2.)+(1./18.)*pow(sixError,2.)\r
- - 9.*two*(4.*pow(two,2.)-four)*wCov24+(4.*pow(two,2.)-four)*wCov26-two*wCov46); \r
- }\r
- if(-1.*eight+16.*six*two+18.*pow(four,2.)-144.*four*pow(two,2.)+144.*pow(two,4.) > 0.) \r
- {\r
- v8ErrorSquared = (4./pow(33,1./4.))*(1./pow(-1.*eight+16.*six*two+18.*pow(four,2.)-144.*four*pow(two,2.)+144.*pow(two,4.),7./4.))*\r
- (pow(36.*pow(two,3.)-18.*four*two+six,2.)*pow(twoError,2.)\r
- + (81./16.)*pow(4.*pow(two,2.)-four,2.)*pow(fourError,2.)\r
- + pow(two,2.)*pow(sixError,2.)\r
- + (1./256.)*pow(eightError,2.)\r
- - (9./2.)*(36.*pow(two,3.)-18.*four*two+six)*(4.*pow(two,2.)-four)*wCov24\r
- + 2.*two*(36.*pow(two,3.)-18.*four*two+six)*wCov26\r
- - (1./8.)*(36.*pow(two,3.)-18.*four*two+six)*wCov28 \r
- - (9./2.)*two*(4.*pow(two,2.)-four)*wCov46 \r
- + (9./32.)*(4.*pow(two,2.)-four)*wCov48 \r
- - (1./8.)*two*wCov68);\r
- } \r
-\r
- // calculate statistical errors of integrated flow estimates: \r
- if(v2ErrorSquared > 0.)\r
- {\r
- v2Error = pow(v2ErrorSquared,0.5);\r
- } else\r
- {\r
- cout<<"WARNING: Statistical error of v{2,QC} is imaginary !!!!"<<endl;\r
- } \r
- if(v4ErrorSquared > 0.)\r
- {\r
- v4Error = pow(v4ErrorSquared,0.5);\r
- } else\r
- {\r
- cout<<"WARNING: Statistical error of v{4,QC} is imaginary !!!!"<<endl;\r
- } \r
- if(v6ErrorSquared > 0.)\r
- {\r
- v6Error = pow(v6ErrorSquared,0.5);\r
- } else\r
- {\r
- cout<<"WARNING: Statistical error of v{6,QC} is imaginary !!!!"<<endl;\r
- } \r
- if(v8ErrorSquared > 0.)\r
- {\r
- v8Error = pow(v8ErrorSquared,0.5);\r
- } else\r
- {\r
- cout<<"WARNING: Statistical error of v{8,QC} is imaginary !!!!"<<endl;\r
- } \r
- \r
- // store the results and statistical errors of integrated flow estimates:\r
- fIntFlow->SetBinContent(1,v2);\r
- fIntFlow->SetBinError(1,v2Error);\r
- fIntFlow->SetBinContent(2,v4);\r
- fIntFlow->SetBinError(2,v4Error);\r
- fIntFlow->SetBinContent(3,v6);\r
- fIntFlow->SetBinError(3,v6Error);\r
- fIntFlow->SetBinContent(4,v8);\r
- fIntFlow->SetBinError(4,v8Error);\r
- \r
-} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlow()\r
-\r
-\r
-//================================================================================================================================ \r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow()\r
-{\r
- // Fill in AliFlowCommonHistResults histograms relevant for 'NONAME' integrated flow (to be improved (name))\r
- \r
- if(!fIntFlow)\r
- {\r
- cout<<"WARNING: fIntFlow is NULL in AFAWQC::FCHRIF() !!!!"<<endl;\r
- exit(0); \r
- } \r
- \r
- if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th))\r
- {\r
- cout<<"WARNING: fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th"<<endl; \r
- cout<<" is NULL in AFAWQC::FCHRIF() !!!!"<<endl;\r
- exit(0);\r
- }\r
- \r
- Double_t v2 = fIntFlow->GetBinContent(1);\r
- Double_t v4 = fIntFlow->GetBinContent(2);\r
- Double_t v6 = fIntFlow->GetBinContent(3);\r
- Double_t v8 = fIntFlow->GetBinContent(4);\r
- \r
- Double_t v2Error = fIntFlow->GetBinError(1);\r
- Double_t v4Error = fIntFlow->GetBinError(2);\r
- Double_t v6Error = fIntFlow->GetBinError(3);\r
- Double_t v8Error = fIntFlow->GetBinError(4);\r
- \r
- fCommonHistsResults2nd->FillIntegratedFlow(v2,v2Error); // to be improved (hardwired 2nd in the name) \r
- fCommonHistsResults4th->FillIntegratedFlow(v4,v4Error); // to be improved (hardwired 4th in the name)\r
- if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) // to be improved (calculate also 6th and 8th order)\r
- {\r
- fCommonHistsResults6th->FillIntegratedFlow(v6,v6Error); // to be improved (hardwired 6th in the name)\r
- fCommonHistsResults8th->FillIntegratedFlow(v8,v8Error); // to be improved (hardwired 8th in the name) \r
- }\r
- \r
-} // end of AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow()\r
-\r
-\r
-//================================================================================================================================ \r
-\r
-\r
-/*\r
-void AliFlowAnalysisWithQCumulants::ApplyCorrectionForNonUniformAcceptanceToCumulantsForIntFlow(Bool_t useParticleWeights, TString eventWeights)\r
-{\r
- // apply correction for non-uniform acceptance to cumulants for integrated flow \r
- // (Remark: non-corrected cumulants are accessed from fCumulants[pW][0], corrected cumulants are stored in fCumulants[pW][1])\r
- \r
- // shortcuts for the flags:\r
- Int_t pW = (Int_t)(useParticleWeights); // 0=pWeights not used, 1=pWeights used\r
- Int_t eW = -1;\r
- \r
- if(eventWeights == "exact")\r
- {\r
- eW = 0;\r
- }\r
- \r
- if(!(fCumulants[pW][eW][0] && fCumulants[pW][eW][1] && fCorrections[pW][eW]))\r
- {\r
- cout<<"WARNING: fCumulants[pW][eW][0] && fCumulants[pW][eW][1] && fCorrections[pW][eW] is NULL in AFAWQC::ACFNUATCFIF() !!!!"<<endl;\r
- cout<<"pW = "<<pW<<endl;\r
- cout<<"eW = "<<eW<<endl;\r
- exit(0);\r
- } \r
- \r
- // non-corrected cumulants:\r
- Double_t qc2 = fCumulants[pW][eW][0]->GetBinContent(1); \r
- Double_t qc4 = fCumulants[pW][eW][0]->GetBinContent(2); \r
- Double_t qc6 = fCumulants[pW][eW][0]->GetBinContent(3); \r
- Double_t qc8 = fCumulants[pW][eW][0]->GetBinContent(4); \r
- // statistical error of non-corrected cumulants: \r
- Double_t qc2Error = fCumulants[pW][eW][0]->GetBinError(1); \r
- Double_t qc4Error = fCumulants[pW][eW][0]->GetBinError(2); \r
- Double_t qc6Error = fCumulants[pW][eW][0]->GetBinError(3); \r
- Double_t qc8Error = fCumulants[pW][eW][0]->GetBinError(4); \r
- // corrections for non-uniform acceptance:\r
- Double_t qc2Correction = fCorrections[pW][eW]->GetBinContent(1); \r
- Double_t qc4Correction = fCorrections[pW][eW]->GetBinContent(2); \r
- Double_t qc6Correction = fCorrections[pW][eW]->GetBinContent(3); \r
- Double_t qc8Correction = fCorrections[pW][eW]->GetBinContent(4); \r
- // corrected cumulants:\r
- Double_t qc2Corrected = qc2 + qc2Correction;\r
- Double_t qc4Corrected = qc4 + qc4Correction;\r
- Double_t qc6Corrected = qc6 + qc6Correction;\r
- Double_t qc8Corrected = qc8 + qc8Correction;\r
- \r
- // ... to be improved (I need here also to correct error of QCs for NUA. \r
- // For simplicity sake I assume at the moment that this correction is negliglible, but it will be added eventually...)\r
- \r
- // store corrected results and statistical errors for cumulants: \r
- fCumulants[pW][eW][1]->SetBinContent(1,qc2Corrected);\r
- fCumulants[pW][eW][1]->SetBinContent(2,qc4Corrected);\r
- fCumulants[pW][eW][1]->SetBinContent(3,qc6Corrected);\r
- fCumulants[pW][eW][1]->SetBinContent(4,qc8Corrected);\r
- fCumulants[pW][eW][1]->SetBinError(1,qc2Error); // to be improved (correct also qc2Error for NUA)\r
- fCumulants[pW][eW][1]->SetBinError(2,qc4Error); // to be improved (correct also qc4Error for NUA)\r
- fCumulants[pW][eW][1]->SetBinError(3,qc6Error); // to be improved (correct also qc6Error for NUA)\r
- fCumulants[pW][eW][1]->SetBinError(4,qc8Error); // to be improved (correct also qc8Error for NUA) \r
- \r
-} // end of AliFlowAnalysisWithQCumulants::ApplyCorrectionForNonUniformAcceptanceToCumulantsForIntFlow(Bool_t useParticleWeights, TString eventWeights)\r
-*/\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-/* \r
-void AliFlowAnalysisWithQCumulants::PrintQuantifyingCorrectionsForNonUniformAcceptance(Bool_t useParticleWeights, TString eventWeights)\r
-{\r
- // print on the screen QC{n,biased}/QC{n,corrected}\r
- \r
- // shortcuts for the flags:\r
- Int_t pW = (Int_t)(useParticleWeights); // 0=pWeights not used, 1=pWeights used\r
- \r
- Int_t eW = -1;\r
- \r
- if(eventWeights == "exact")\r
- {\r
- eW = 0;\r
- } \r
- \r
- if(!(fCumulants[pW][eW][0] && fCumulants[pW][eW][1]))\r
- {\r
- cout<<"WARNING: fCumulants[pW][eW][0] && fCumulants[pW][eW][1] is NULL in AFAWQC::PQCFNUA() !!!!"<<endl;\r
- cout<<"pW = "<<pW<<endl;\r
- cout<<"eW = "<<eW<<endl;\r
- exit(0);\r
- }\r
- \r
- cout<<endl;\r
- cout<<" Quantifying the bias to Q-cumulants from"<<endl;\r
- cout<<" non-uniform acceptance of the detector:"<<endl;\r
- cout<<endl;\r
- \r
- if(fCumulants[pW][eW][1]->GetBinContent(1)) \r
- { \r
- cout<<" QC{2,biased}/QC{2,corrected} = "<<(fCumulants[pW][eW][0]->GetBinContent(1))/(fCumulants[pW][eW][1]->GetBinContent(1))<<endl; \r
- }\r
- if(fCumulants[pW][eW][1]->GetBinContent(2)) \r
- { \r
- cout<<" QC{4,biased}/QC{4,corrected} = "<<fCumulants[pW][eW][0]->GetBinContent(2)/fCumulants[pW][eW][1]->GetBinContent(2)<<endl; \r
- }\r
- \r
- cout<<endl;\r
- \r
-} // end of AliFlowAnalysisWithQCumulants::PrintQuantifyingCorrectionsForNonUniformAcceptance(Bool_t useParticleWeights, TString eventWeights)\r
-*/\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelationsUsingParticleWeights()\r
-{\r
- // Calculate all correlations needed for integrated flow using particle weights.\r
- \r
- // Remark 1: When particle weights are used the binning of fIntFlowCorrelationAllPro is organized as follows:\r
- //\r
- // 1st bin: <2>_{1n|1n} = two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))>\r
- // 2nd bin: <2>_{2n|2n} = two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))>\r
- // 3rd bin: <2>_{3n|3n} = two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> \r
- // 4th bin: <2>_{4n|4n} = two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))>\r
- // 5th bin: ---- EMPTY ----\r
- // 6th bin: <3>_{2n|1n,1n} = three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))>\r
- // 7th bin: <3>_{3n|2n,1n} = ...\r
- // 8th bin: <3>_{4n|2n,2n} = ...\r
- // 9th bin: <3>_{4n|3n,1n} = ...\r
- // 10th bin: ---- EMPTY ----\r
- // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))>\r
- // 12th bin: <4>_{2n,1n|2n,1n} = ...\r
- // 13th bin: <4>_{2n,2n|2n,2n} = ...\r
- // 14th bin: <4>_{3n|1n,1n,1n} = ... \r
- // 15th bin: <4>_{3n,1n|3n,1n} = ...\r
- // 16th bin: <4>_{3n,1n|2n,2n} = ...\r
- // 17th bin: <4>_{4n|2n,1n,1n} = ... \r
- // 18th bin: ---- EMPTY ----\r
- // 19th bin: <5>_{2n|1n,1n,1n,1n} = ...\r
- // 20th bin: <5>_{2n,2n|2n,1n,1n} = ...\r
- // 21st bin: <5>_{3n,1n|2n,1n,1n} = ...\r
- // 22nd bin: <5>_{4n|1n,1n,1n,1n} = ...\r
- // 23rd bin: ---- EMPTY ----\r
- // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = ...\r
- // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = ...\r
- // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = ...\r
- // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = ...\r
- // 28th bin: ---- EMPTY ----\r
- // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = ...\r
- // 30th bin: ---- EMPTY ----\r
- // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = ...\r
- \r
- // Remark 2: When particle weights are used there are some extra correlations. They are stored in \r
- // fIntFlowExtraCorrelationsPro binning of which is organized as follows:\r
- \r
- // 1st bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))>\r
- // 2nd bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> \r
-
- // multiplicity (number of particles used to determine the reaction plane)\r
- Double_t dMult = (*fSMpk)(0,0);\r
- \r
- // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
- Double_t dReQ1n1k = (*fReQ)(0,1);\r
- Double_t dReQ2n2k = (*fReQ)(1,2);\r
- Double_t dReQ3n3k = (*fReQ)(2,3);\r
- Double_t dReQ4n4k = (*fReQ)(3,4);\r
- Double_t dReQ1n3k = (*fReQ)(0,3);\r
- Double_t dImQ1n1k = (*fImQ)(0,1);\r
- Double_t dImQ2n2k = (*fImQ)(1,2);\r
- Double_t dImQ3n3k = (*fImQ)(2,3);\r
- Double_t dImQ4n4k = (*fImQ)(3,4);\r
- Double_t dImQ1n3k = (*fImQ)(0,3);\r
-\r
- // dMs are variables introduced in order to simplify some Eqs. bellow:\r
- //..............................................................................................\r
- Double_t dM11 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j\r
- Double_t dM22 = (*fSMpk)(1,2)-(*fSMpk)(0,4); // dM22 = sum_{i,j=1,i!=j}^M w_i^2 w_j^2\r
- Double_t dM33 = (*fSMpk)(1,3)-(*fSMpk)(0,6); // dM33 = sum_{i,j=1,i!=j}^M w_i^3 w_j^3\r
- Double_t dM44 = (*fSMpk)(1,4)-(*fSMpk)(0,8); // dM44 = sum_{i,j=1,i!=j}^M w_i^4 w_j^4\r
- Double_t dM31 = (*fSMpk)(0,3)*(*fSMpk)(0,1)-(*fSMpk)(0,4); // dM31 = sum_{i,j=1,i!=j}^M w_i^3 w_j\r
- Double_t dM211 = (*fSMpk)(0,2)*(*fSMpk)(1,1)-2.*(*fSMpk)(0,3)*(*fSMpk)(0,1)\r
- - (*fSMpk)(1,2)+2.*(*fSMpk)(0,4); // dM211 = sum_{i,j,k=1,i!=j!=k}^M w_i^2 w_j w_k\r
- Double_t dM1111 = (*fSMpk)(3,1)-6.*(*fSMpk)(0,2)*(*fSMpk)(1,1) \r
- + 8.*(*fSMpk)(0,3)*(*fSMpk)(0,1)\r
- + 3.*(*fSMpk)(1,2)-6.*(*fSMpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l\r
- //..............................................................................................\r
-\r
- // 2-particle correlations:\r
- Double_t two1n1nW1W1 = 0.; // <w1 w2 cos(n*(phi1-phi2))>\r
- Double_t two2n2nW2W2 = 0.; // <w1^2 w2^2 cos(2n*(phi1-phi2))>\r
- Double_t two3n3nW3W3 = 0.; // <w1^3 w2^3 cos(3n*(phi1-phi2))>\r
- Double_t two4n4nW4W4 = 0.; // <w1^4 w2^4 cos(4n*(phi1-phi2))>\r
- if(dMult>1) \r
- { \r
- if(dM11)\r
- {\r
- two1n1nW1W1 = (pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSMpk)(0,2))/dM11; \r
- // average correlation <w1 w2 cos(n*(phi1-phi2))> for single event: \r
- fIntFlowCorrelationsEBE->SetBinContent(1,two1n1nW1W1);\r
- fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(1,dM11);\r
- // average correlation <w1 w2 cos(n*(phi1-phi2))> for all events:\r
- fIntFlowCorrelationsPro->Fill(0.5,two1n1nW1W1,dM11); \r
- fIntFlowCorrelationsAllPro->Fill(0.5,two1n1nW1W1,dM11); \r
- }\r
- if(dM22)\r
- {\r
- two2n2nW2W2 = (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)-(*fSMpk)(0,4))/dM22; \r
- // ...\r
- // average correlation <w1^2 w2^2 cos(2n*(phi1-phi2))> for all events:\r
- fIntFlowCorrelationsAllPro->Fill(1.5,two2n2nW2W2,dM22); \r
- }\r
- if(dM33)\r
- {\r
- two3n3nW3W3 = (pow(dReQ3n3k,2)+pow(dImQ3n3k,2)-(*fSMpk)(0,6))/dM33;\r
- // ...\r
- // average correlation <w1^3 w2^3 cos(3n*(phi1-phi2))> for all events:\r
- fIntFlowCorrelationsAllPro->Fill(2.5,two3n3nW3W3,dM33); \r
- }\r
- if(dM44)\r
- {\r
- two4n4nW4W4 = (pow(dReQ4n4k,2)+pow(dImQ4n4k,2)-(*fSMpk)(0,8))/dM44; \r
- // ...\r
- // average correlation <w1^4 w2^4 cos(4n*(phi1-phi2))> for all events:\r
- fIntFlowCorrelationsAllPro->Fill(3.5,two4n4nW4W4,dM44); \r
- }\r
- } // end of if(dMult>1) \r
-\r
- // extra 2-particle correlations:\r
- Double_t two1n1nW3W1 = 0.; // <w1^3 w2 cos(n*(phi1-phi2))>\r
- Double_t two1n1nW1W1W2 = 0.; // <w1 w2 w3^2 cos(n*(phi1-phi2))> \r
- if(dMult>1) \r
- { \r
- if(dM31)\r
- {\r
- two1n1nW3W1 = (dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k-(*fSMpk)(0,4))/dM31; \r
- fIntFlowExtraCorrelationsPro->Fill(0.5,two1n1nW3W1,dM31); \r
- } \r
- if(dM211)\r
- {\r
- two1n1nW1W1W2 = ((*fSMpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSMpk)(0,2))\r
- - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k\r
- - (*fSMpk)(0,4)))/dM211;\r
- fIntFlowExtraCorrelationsPro->Fill(1.5,two1n1nW1W1W2,dM211); \r
- } \r
- } // end of if(dMult>1)\r
- //..............................................................................................\r
- \r
- //..............................................................................................\r
- // 3-particle correlations:\r
- Double_t three2n1n1nW2W1W1 = 0.; // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))>\r
- \r
- if(dMult>2) \r
- { \r
- if(dM211)\r
- { \r
- three2n1n1nW2W1W1 = (pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k\r
- - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k)\r
- - pow(dReQ2n2k,2)-pow(dImQ2n2k,2)\r
- + 2.*(*fSMpk)(0,4))/dM211; \r
- fIntFlowCorrelationsAllPro->Fill(5.5,three2n1n1nW2W1W1,dM211);\r
- } \r
- } // end of if(dMult>2) \r
- //..............................................................................................\r
- \r
- //..............................................................................................\r
- // 4-particle correlations:\r
- Double_t four1n1n1n1nW1W1W1W1 = 0.; // <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))>\r
- if(dMult>3) \r
- { \r
- if(dM1111)\r
- { \r
- four1n1n1n1nW1W1W1W1 = (pow(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.),2)\r
- - 2.*(pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k)\r
- + 8.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k)\r
- + (pow(dReQ2n2k,2)+pow(dImQ2n2k,2))\r
- - 4.*(*fSMpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2))\r
- - 6.*(*fSMpk)(0,4)+2.*(*fSMpk)(1,2))/dM1111; \r
- \r
- // average correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for single event: \r
- fIntFlowCorrelationsEBE->SetBinContent(2,four1n1n1n1nW1W1W1W1);\r
- fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(2,dM1111);\r
- // average correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for all events:\r
- fIntFlowCorrelationsPro->Fill(1.5,four1n1n1n1nW1W1W1W1,dM1111); \r
- fIntFlowCorrelationsAllPro->Fill(10.5,four1n1n1n1nW1W1W1W1,dM1111); \r
- } \r
- } // end of if(dMult>3) \r
- //..............................................................................................\r
- \r
-} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelationsUsingParticleWeights()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateWeightedQProductsForIntFlow() // to be improved (completed)\r
-{\r
- // calculate averages like <<2><4>>, <<2><6>>, <<4><6>>, etc. which are needed to calculate covariances \r
- // Remark: here we take weighted correlations!\r
- \r
- /*\r
- \r
- // binning of fQProductsW is organized as follows:\r
- // \r
- // 1st bin: <2><4> \r
- // 2nd bin: <2><6>\r
- // 3rd bin: <2><8>\r
- // 4th bin: <4><6>\r
- // 5th bin: <4><8>\r
- // 6th bin: <6><8>\r
- \r
- Double_t dMult = (*fSMpk)(0,0); // multiplicity (number of particles used to determine the reaction plane)\r
-\r
- Double_t dM11 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j\r
- Double_t dM1111 = (*fSMpk)(3,1)-6.*(*fSMpk)(0,2)*(*fSMpk)(1,1) \r
- + 8.*(*fSMpk)(0,3)*(*fSMpk)(0,1)\r
- + 3.*(*fSMpk)(1,2)-6.*(*fSMpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l\r
-\r
- Double_t twoEBEW = 0.; // <2>\r
- Double_t fourEBEW = 0.; // <4>\r
- \r
- twoEBEW = fQCorrelationsEBE[1]->GetBinContent(1);\r
- fourEBEW = fQCorrelationsEBE[1]->GetBinContent(11);\r
- \r
- // <2><4>\r
- if(dMult>3)\r
- {\r
- fQProducts[1][0]->Fill(0.5,twoEBEW*fourEBEW,dM11*dM1111);\r
- }\r
- \r
- */\r
- \r
-} // end of AliFlowAnalysisWithQCumulants::CalculateWeightedQProductsForIntFlow() \r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow()\r
-{\r
- // Initialize all arrays used to calculate integrated flow.\r
- \r
- for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
- {\r
- fIntFlowCorrectionTermsForNUAEBE[sc] = NULL;\r
- fIntFlowCorrectionTermsForNUAPro[sc] = NULL;\r
- fIntFlowCorrectionTermsForNUAHist[sc] = NULL;\r
- }\r
- \r
- for(Int_t power=0;power<2;power++) // linear or quadratic \r
- {\r
- fIntFlowSumOfEventWeights[power] = NULL; \r
- }\r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow()\r
-{\r
- // Initialize all arrays needed to calculate differential flow.\r
- // a) Initialize lists holding profiles;\r
- // b) Initialize lists holding histograms;\r
- // c) Initialize event-by-event quantities;\r
- // d) Initialize profiles;\r
- // e) Initialize histograms holding final results.\r
- \r
- // a) Initialize lists holding profiles;\r
- for(Int_t t=0;t<2;t++) // type (RP, POI)\r
- {\r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- fDiffFlowCorrelationsProList[t][pe] = NULL;\r
- fDiffFlowProductOfCorrelationsProList[t][pe] = NULL;\r
- fDiffFlowCorrectionsProList[t][pe] = NULL;\r
- }\r
- } \r
- \r
- // b) Initialize lists holding histograms;\r
- for(Int_t t=0;t<2;t++) // type (RP, POI)\r
- {\r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- fDiffFlowCorrelationsHistList[t][pe] = NULL;\r
- for(Int_t power=0;power<2;power++)\r
- {\r
- fDiffFlowSumOfEventWeightsHistList[t][pe][power] = NULL;\r
- } // end of for(Int_t power=0;power<2;power++) \r
- fDiffFlowSumOfProductOfEventWeightsHistList[t][pe] = NULL;\r
- fDiffFlowCorrectionsHistList[t][pe] = NULL;\r
- fDiffFlowCovariancesHistList[t][pe] = NULL;\r
- fDiffFlowCumulantsHistList[t][pe] = NULL;\r
- fDiffFlowHistList[t][pe] = NULL;\r
- } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- } // enf of for(Int_t t=0;t<2;t++) // type (RP, POI) \r
- \r
- // c) Initialize event-by-event quantities:\r
- // 1D:\r
- for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP)\r
- {\r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- { \r
- for(Int_t m=0;m<4;m++) // multiple of harmonic\r
- {\r
- for(Int_t k=0;k<9;k++) // power of weight\r
- {\r
- fReRPQ1dEBE[t][pe][m][k] = NULL;\r
- fImRPQ1dEBE[t][pe][m][k] = NULL;\r
- fs1dEBE[t][pe][k] = NULL; // to be improved (this doesn't need to be within loop over m)\r
- } \r
- }\r
- }\r
- }\r
- // 1D:\r
- for(Int_t t=0;t<2;t++) // type (RP or POI)\r
- {\r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- { \r
- for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
- {\r
- for(Int_t cti=0;cti<9;cti++) // correction term index\r
- {\r
- fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti] = NULL;\r
- } \r
- }\r
- }\r
- }\r
- // 2D: \r
- for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP)\r
- {\r
- for(Int_t m=0;m<4;m++) // multiple of harmonic\r
- {\r
- for(Int_t k=0;k<9;k++) // power of weight\r
- {\r
- fReRPQ2dEBE[t][m][k] = NULL;\r
- fImRPQ2dEBE[t][m][k] = NULL;\r
- fs2dEBE[t][k] = NULL; // to be improved (this doesn't need to be within loop over m)\r
- } \r
- }\r
- }\r
- \r
- // d) Initialize profiles:\r
- for(Int_t t=0;t<2;t++) // type: RP or POI\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- for(Int_t ci=0;ci<4;ci++) // correlation index\r
- {\r
- fDiffFlowCorrelationsPro[t][pe][ci] = NULL;\r
- } // end of for(Int_t ci=0;ci<4;ci++) \r
- for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index\r
- {\r
- for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index\r
- {\r
- fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = NULL;\r
- } // end of for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index\r
- } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index \r
- // correction terms for nua:\r
- for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
- {\r
- for(Int_t cti=0;cti<9;cti++) // correction term index\r
- {\r
- fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = NULL;\r
- } \r
- }\r
- } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- } // end of for(Int_t t=0;t<2;t++) // type: RP or POI\r
- \r
- // e) Initialize histograms holding final results.\r
- for(Int_t t=0;t<2;t++) // type: RP or POI\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- for(Int_t ci=0;ci<4;ci++) // correlation index\r
- {\r
- fDiffFlowCorrelationsHist[t][pe][ci] = NULL;\r
- fDiffFlowCumulants[t][pe][ci] = NULL;\r
- fDiffFlow[t][pe][ci] = NULL;\r
- } // end of for(Int_t ci=0;ci<4;ci++) \r
- for(Int_t covarianceIndex=0;covarianceIndex<5;covarianceIndex++) \r
- {\r
- fDiffFlowCovariances[t][pe][covarianceIndex] = NULL; \r
- } // end of for(Int_t covarianceIndex=0;covarianceIndex<5;covarianceIndex++) \r
- // correction terms for nua:\r
- for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
- {\r
- for(Int_t cti=0;cti<9;cti++) // correction term index\r
- {\r
- fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = NULL;\r
- } \r
- }\r
- } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- } // end of for(Int_t t=0;t<2;t++) // type: RP or POI\r
- \r
- // sum of event weights for reduced correlations:\r
- for(Int_t t=0;t<2;t++) // type = RP or POI\r
- {\r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- for(Int_t p=0;p<2;p++) // power of weight is 1 or 2\r
- {\r
- for(Int_t ew=0;ew<4;ew++) // event weight index for reduced correlations\r
- {\r
- fDiffFlowSumOfEventWeights[t][pe][p][ew] = NULL;\r
- } \r
- } \r
- }\r
- }\r
- // product of event weights for both types of correlations:\r
- for(Int_t t=0;t<2;t++) // type = RP or POI\r
- {\r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index\r
- {\r
- for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index\r
- {\r
- fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = NULL;\r
- } \r
- } \r
- }\r
- }\r
-\r
- \r
- \r
- \r
- /*\r
- \r
- // nested lists in fDiffFlowProfiles:\r
- for(Int_t t=0;t<2;t++)\r
- {\r
- fDFPType[t] = NULL;\r
- for(Int_t pW=0;pW<2;pW++) // particle weights not used (0) or used (1)\r
- {\r
- fDFPParticleWeights[t][pW] = NULL;\r
- for(Int_t eW=0;eW<2;eW++)\r
- { \r
- fDFPEventWeights[t][pW][eW] = NULL;\r
- fDiffFlowCorrelations[t][pW][eW] = NULL;\r
- fDiffFlowProductsOfCorrelations[t][pW][eW] = NULL;\r
- for(Int_t sc=0;sc<2;sc++)\r
- {\r
- fDiffFlowCorrectionTerms[t][pW][eW][sc] = NULL;\r
- }\r
- } \r
- }\r
- } \r
- \r
- \r
- */\r
- \r
- \r
- \r
- /*\r
- for(Int_t pW=0;pW<2;pW++) // particle weights not used (0) or used (1)\r
- {\r
- for(Int_t eW=0;eW<2;eW++)\r
- {\r
- // correlations:\r
- for(Int_t correlationIndex=0;correlationIndex<4;correlationIndex++)\r
- {\r
- fCorrelationsPro[t][pW][eW][correlationIndex] = NULL;\r
- }\r
- // products of correlations:\r
- for(Int_t productOfCorrelationsIndex=0;productOfCorrelationsIndex<6;productOfCorrelationsIndex++)\r
- {\r
- fProductsOfCorrelationsPro[t][pW][eW][productOfCorrelationsIndex] = NULL;\r
- }\r
- // correction terms:\r
- for(Int_t sc=0;sc<2;sc++)\r
- {\r
- for(Int_t correctionsIndex=0;correctionsIndex<2;correctionsIndex++)\r
- {\r
- fCorrectionTermsPro[t][pW][eW][sc][correctionsIndex] = NULL;\r
- } \r
- } \r
- }\r
- } \r
- */\r
- \r
-} // end of AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow()\r
-\r
-\r
-//================================================================================================================================\r
- /*\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateCorrelationsForDifferentialFlow2D(TString type)\r
-{\r
- // calculate all reduced correlations needed for differential flow for each (pt,eta) bin: \r
- \r
- if(type == "RP") // to be improved (removed)\r
- {\r
- cout<<endl;\r
- }\r
- // ... \r
- \r
- \r
- Int_t typeFlag = -1; \r
- \r
- // reduced correlations ares stored in fCorrelationsPro[t][pW][index] and are indexed as follows:\r
- // index:\r
- // 0: <2'>\r
- // 1: <4'>\r
-\r
- // multiplicity:\r
- Double_t dMult = (*fSMpk)(0,0);\r
- \r
- // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
- Double_t dReQ1n = (*fReQ)(0,0);\r
- Double_t dReQ2n = (*fReQ)(1,0);\r
- //Double_t dReQ3n = (*fReQ)(2,0);\r
- //Double_t dReQ4n = (*fReQ)(3,0);\r
- Double_t dImQ1n = (*fImQ)(0,0);\r
- Double_t dImQ2n = (*fImQ)(1,0);\r
- //Double_t dImQ3n = (*fImQ)(2,0);\r
- //Double_t dImQ4n = (*fImQ)(3,0);\r
-\r
- // looping over all (pt,eta) bins and calculating correlations needed for differential flow: \r
- for(Int_t p=1;p<=fnBinsPt;p++)\r
- {\r
- for(Int_t e=1;e<=fnBinsEta;e++)\r
- {\r
- // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): \r
- Double_t p1n0kRe = 0.;\r
- Double_t p1n0kIm = 0.;\r
-\r
- // number of POIs in particular (pt,eta) bin:\r
- Double_t mp = 0.;\r
-\r
- // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular (pt,eta) bin):\r
- Double_t q1n0kRe = 0.;\r
- Double_t q1n0kIm = 0.;\r
- Double_t q2n0kRe = 0.;\r
- Double_t q2n0kIm = 0.;\r
-\r
- // number of particles which are both RPs and POIs in particular (pt,eta) bin:\r
- Double_t mq = 0.;\r
- \r
- // q_{m*n,0}:\r
- q1n0kRe = fReEBE2D[2][0][0]->GetBinContent(fReEBE2D[2][0][0]->GetBin(p,e))\r
- * fReEBE2D[2][0][0]->GetBinEntries(fReEBE2D[2][0][0]->GetBin(p,e));\r
- q1n0kIm = fImEBE2D[2][0][0]->GetBinContent(fImEBE2D[2][0][0]->GetBin(p,e))\r
- * fImEBE2D[2][0][0]->GetBinEntries(fImEBE2D[2][0][0]->GetBin(p,e));\r
- q2n0kRe = fReEBE2D[2][1][0]->GetBinContent(fReEBE2D[2][1][0]->GetBin(p,e))\r
- * fReEBE2D[2][1][0]->GetBinEntries(fReEBE2D[2][1][0]->GetBin(p,e));\r
- q2n0kIm = fImEBE2D[2][1][0]->GetBinContent(fImEBE2D[2][1][0]->GetBin(p,e))\r
- * fImEBE2D[2][1][0]->GetBinEntries(fImEBE2D[2][1][0]->GetBin(p,e));\r
- \r
- mq = fReEBE2D[2][0][0]->GetBinEntries(fReEBE2D[2][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here)\r
- \r
- if(type == "POI")\r
- {\r
- // p_{m*n,0}:\r
- p1n0kRe = fReEBE2D[1][0][0]->GetBinContent(fReEBE2D[1][0][0]->GetBin(p,e))\r
- * fReEBE2D[1][0][0]->GetBinEntries(fReEBE2D[1][0][0]->GetBin(p,e));\r
- p1n0kIm = fImEBE2D[1][0][0]->GetBinContent(fImEBE2D[1][0][0]->GetBin(p,e)) \r
- * fImEBE2D[1][0][0]->GetBinEntries(fImEBE2D[1][0][0]->GetBin(p,e));\r
- \r
- mp = fReEBE2D[1][0][0]->GetBinEntries(fReEBE2D[1][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here)\r
- \r
- typeFlag = 1;\r
- }\r
- else if(type == "RP")\r
- {\r
- // p_{m*n,0} = q_{m*n,0}:\r
- p1n0kRe = q1n0kRe; \r
- p1n0kIm = q1n0kIm; \r
- mp = mq; \r
- \r
- typeFlag = 0;\r
- }\r
- \r
- // count events with non-empty (pt,eta) bin:\r
- if(mp>0)\r
- {\r
- fNonEmptyBins2D[typeFlag]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,1);\r
- }\r
- \r
- // 2'-particle correlation for particular (pt,eta) bin:\r
- Double_t two1n1nPtEta = 0.;\r
- if(mp*dMult-mq)\r
- {\r
- two1n1nPtEta = (p1n0kRe*dReQ1n+p1n0kIm*dImQ1n-mq)\r
- / (mp*dMult-mq);\r
- \r
- // fill the 2D profile to get the average correlation for each (pt,eta) bin:\r
- if(type == "POI")\r
- { \r
- //f2pPtEtaPOI->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mp*dMult-mq);\r
- \r
- fCorrelationsPro[1][0][0][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mp*dMult-mq);\r
- }\r
- else if(type == "RP")\r
- {\r
- //f2pPtEtaRP->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mp*dMult-mq); \r
- fCorrelationsPro[0][0][0][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mp*dMult-mq);\r
- }\r
- } // end of if(mp*dMult-mq)\r
- \r
- // 4'-particle correlation:\r
- Double_t four1n1n1n1nPtEta = 0.;\r
- if((mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
- + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression)\r
- {\r
- four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n)\r
- - q2n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.))\r
- - 2.*q2n0kIm*dReQ1n*dImQ1n\r
- - p1n0kRe*(dReQ1n*dReQ2n+dImQ1n*dImQ2n)\r
- + p1n0kIm*(dImQ1n*dReQ2n-dReQ1n*dImQ2n)\r
- - 2.*dMult*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n)\r
- - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*mq \r
- + 6.*(q1n0kRe*dReQ1n+q1n0kIm*dImQ1n) \r
- + 1.*(q2n0kRe*dReQ2n+q2n0kIm*dImQ2n) \r
- + 2.*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) \r
- + 2.*mq*dMult \r
- - 6.*mq) \r
- / ((mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
- + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); \r
- \r
- // fill the 2D profile to get the average correlation for each (pt, eta) bin:\r
- if(type == "POI")\r
- {\r
- //f4pPtEtaPOI->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta,\r
- // (mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
- // + mq*(dMult-1.)*(dMult-2.)*(dMult-3.));\r
- \r
- fCorrelationsPro[1][0][0][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta,\r
- (mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
- + mq*(dMult-1.)*(dMult-2.)*(dMult-3.));\r
- }\r
- else if(type == "RP")\r
- {\r
- //f4pPtEtaRP->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta,\r
- // (mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
- // + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); \r
- \r
- fCorrelationsPro[0][0][0][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta,\r
- (mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
- + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); \r
- }\r
- } // end of if((mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
- // +mq*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
- \r
- } // end of for(Int_t e=1;e<=fnBinsEta;e++)\r
- } // end of for(Int_t p=1;p<=fnBinsPt;p++)\r
-\r
- \r
- \r
- \r
- \r
-} // end of AliFlowAnalysisWithQCumulants::CalculateCorrelationsForDifferentialFlow2D()\r
-\r
-\r
-\r
- \r
- \r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateWeightedCorrelationsForDifferentialFlow2D(TString type)\r
-{\r
- // calculate all weighted correlations needed for differential flow \r
- \r
- if(type == "RP") // to be improved (removed)\r
- {\r
- cout<<endl;\r
- }\r
- // ... \r
- \r
- \r
- \r
- \r
- // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
- Double_t dReQ1n1k = (*fReQ)(0,1);\r
- Double_t dReQ2n2k = (*fReQ)(1,2);\r
- Double_t dReQ1n3k = (*fReQ)(0,3);\r
- //Double_t dReQ4n4k = (*fReQ)(3,4);\r
- Double_t dImQ1n1k = (*fImQ)(0,1);\r
- Double_t dImQ2n2k = (*fImQ)(1,2);\r
- Double_t dImQ1n3k = (*fImQ)(0,3);\r
- //Double_t dImQ4n4k = (*fImQ)(3,4);\r
- \r
- // S^M_{p,k} (see .h file for the definition of fSMpk):\r
- Double_t dSM1p1k = (*fSMpk)(0,1);\r
- Double_t dSM1p2k = (*fSMpk)(0,2);\r
- Double_t dSM1p3k = (*fSMpk)(0,3);\r
- Double_t dSM2p1k = (*fSMpk)(1,1);\r
- Double_t dSM3p1k = (*fSMpk)(2,1);\r
- \r
- // looping over all (pt,eta) bins and calculating weighted correlations needed for differential flow: \r
- for(Int_t p=1;p<=fnBinsPt;p++)\r
- {\r
- for(Int_t e=1;e<=fnBinsEta;e++)\r
- {\r
- // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): \r
- Double_t p1n0kRe = 0.;\r
- Double_t p1n0kIm = 0.;\r
-\r
- // number of POIs in particular (pt,eta) bin):\r
- Double_t mp = 0.;\r
-\r
- // real and imaginary parts of q_{m*n,k}: \r
- // (weighted Q-vector evaluated for particles which are both RPs and POIs in particular (pt,eta) bin)\r
- Double_t q1n2kRe = 0.;\r
- Double_t q1n2kIm = 0.;\r
- Double_t q2n1kRe = 0.;\r
- Double_t q2n1kIm = 0.;\r
-\r
- // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) \r
- Double_t s1p1k = 0.; \r
- Double_t s1p2k = 0.; \r
- Double_t s1p3k = 0.; \r
- \r
- // M0111 from Eq. (118) in QC2c (to be improved (notation))\r
- Double_t dM0111 = 0.;\r
- \r
- if(type == "POI")\r
- {\r
- // p_{m*n,0}:\r
- p1n0kRe = fReEBE2D[1][0][0]->GetBinContent(fReEBE2D[1][0][0]->GetBin(p,e))\r
- * fReEBE2D[1][0][0]->GetBinEntries(fReEBE2D[1][0][0]->GetBin(p,e));\r
- p1n0kIm = fImEBE2D[1][0][0]->GetBinContent(fImEBE2D[1][0][0]->GetBin(p,e))\r
- * fImEBE2D[1][0][0]->GetBinEntries(fImEBE2D[1][0][0]->GetBin(p,e)); \r
- \r
- mp = fReEBE2D[1][0][0]->GetBinEntries(fReEBE2D[1][0][0]->GetBin(p,e));\r
- \r
- // q_{m*n,k}: \r
- q1n2kRe = fReEBE2D[2][0][2]->GetBinContent(fReEBE2D[2][0][2]->GetBin(p,e))\r
- * fReEBE2D[2][0][2]->GetBinEntries(fReEBE2D[2][0][2]->GetBin(p,e));\r
- q1n2kIm = fImEBE2D[2][0][2]->GetBinContent(fImEBE2D[2][0][2]->GetBin(p,e))\r
- * fImEBE2D[2][0][2]->GetBinEntries(fImEBE2D[2][0][2]->GetBin(p,e));\r
- q2n1kRe = fReEBE2D[2][1][1]->GetBinContent(fReEBE2D[2][1][1]->GetBin(p,e))\r
- * fReEBE2D[2][1][1]->GetBinEntries(fReEBE2D[2][1][1]->GetBin(p,e)); \r
- q2n1kIm = fImEBE2D[2][1][1]->GetBinContent(fImEBE2D[2][1][1]->GetBin(p,e))\r
- * fImEBE2D[2][1][1]->GetBinEntries(fImEBE2D[2][1][1]->GetBin(p,e));\r
- \r
- // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) \r
- s1p1k = pow(fs2D[2][1]->GetBinContent(fs2D[2][1]->GetBin(p,e)),1.); \r
- s1p2k = pow(fs2D[2][2]->GetBinContent(fs2D[2][2]->GetBin(p,e)),1.); \r
- s1p3k = pow(fs2D[2][3]->GetBinContent(fs2D[2][3]->GetBin(p,e)),1.); \r
- \r
- // M0111 from Eq. (118) in QC2c (to be improved (notation)):\r
- dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k)\r
- - 3.*(s1p1k*(dSM2p1k-dSM1p2k)\r
- + 2.*(s1p3k-s1p2k*dSM1p1k));\r
- }\r
- else if(type == "RP")\r
- {\r
- p1n0kRe = fReEBE2D[0][0][0]->GetBinContent(fReEBE2D[0][0][0]->GetBin(p,e))\r
- * fReEBE2D[0][0][0]->GetBinEntries(fReEBE2D[0][0][0]->GetBin(p,e));\r
- p1n0kIm = fImEBE2D[0][0][0]->GetBinContent(fImEBE2D[0][0][0]->GetBin(p,e))\r
- * fImEBE2D[0][0][0]->GetBinEntries(fImEBE2D[0][0][0]->GetBin(p,e));\r
- \r
- mp = fReEBE2D[0][0][0]->GetBinEntries(fReEBE2D[0][0][0]->GetBin(p,e));\r
- \r
- // q_{m*n,k}: \r
- q1n2kRe = fReEBE2D[0][0][2]->GetBinContent(fReEBE2D[0][0][2]->GetBin(p,e))\r
- * fReEBE2D[0][0][2]->GetBinEntries(fReEBE2D[0][0][2]->GetBin(p,e));\r
- q1n2kIm = fImEBE2D[0][0][2]->GetBinContent(fImEBE2D[0][0][2]->GetBin(p,e))\r
- * fImEBE2D[0][0][2]->GetBinEntries(fImEBE2D[0][0][2]->GetBin(p,e));\r
- q2n1kRe = fReEBE2D[0][1][1]->GetBinContent(fReEBE2D[0][1][1]->GetBin(p,e))\r
- * fReEBE2D[0][1][1]->GetBinEntries(fReEBE2D[0][1][1]->GetBin(p,e));\r
- q2n1kIm = fImEBE2D[0][1][1]->GetBinContent(fImEBE2D[0][1][1]->GetBin(p,e))\r
- * fImEBE2D[0][1][1]->GetBinEntries(fImEBE2D[0][1][1]->GetBin(p,e));\r
- \r
- // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) \r
- s1p1k = pow(fs2D[0][1]->GetBinContent(fs2D[0][1]->GetBin(p,e)),1.); \r
- s1p2k = pow(fs2D[0][2]->GetBinContent(fs2D[0][2]->GetBin(p,e)),1.); \r
- s1p3k = pow(fs2D[0][3]->GetBinContent(fs2D[0][3]->GetBin(p,e)),1.); \r
- \r
- // M0111 from Eq. (118) in QC2c (to be improved (notation)):\r
- dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k)\r
- - 3.*(s1p1k*(dSM2p1k-dSM1p2k)\r
- + 2.*(s1p3k-s1p2k*dSM1p1k));\r
- //............................................................................................... \r
- }\r
- \r
- // 2'-particle correlation:\r
- Double_t two1n1nW0W1PtEta = 0.;\r
- if(mp*dSM1p1k-s1p1k)\r
- {\r
- two1n1nW0W1PtEta = (p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k-s1p1k)\r
- / (mp*dSM1p1k-s1p1k);\r
- \r
- // fill the 2D profile to get the average correlation for each (pt, eta) bin:\r
- if(type == "POI")\r
- {\r
- //f2pPtEtaPOIW->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nW0W1PtEta,\r
- // mp*dSM1p1k-s1p1k);\r
- fCorrelationsPro[1][1][0][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nW0W1PtEta,mp*dSM1p1k-s1p1k);\r
- }\r
- else if(type == "RP")\r
- {\r
- //f2pPtEtaRPW->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nW0W1PtEta,\r
- // mp*dSM1p1k-s1p1k); \r
- fCorrelationsPro[0][1][0][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nW0W1PtEta,mp*dSM1p1k-s1p1k); \r
- }\r
- } // end of if(mp*dMult-dmPrimePrimePtEta)\r
- \r
- // 4'-particle correlation:\r
- Double_t four1n1n1n1nW0W1W1W1PtEta = 0.;\r
- if(dM0111)\r
- {\r
- four1n1n1n1nW0W1W1W1PtEta = ((pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k)\r
- - q2n1kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))\r
- - 2.*q2n1kIm*dReQ1n1k*dImQ1n1k\r
- - p1n0kRe*(dReQ1n1k*dReQ2n2k+dImQ1n1k*dImQ2n2k)\r
- + p1n0kIm*(dImQ1n1k*dReQ2n2k-dReQ1n1k*dImQ2n2k)\r
- - 2.*dSM1p2k*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k)\r
- - 2.*(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*s1p1k \r
- + 6.*(q1n2kRe*dReQ1n1k+q1n2kIm*dImQ1n1k) \r
- + 1.*(q2n1kRe*dReQ2n2k+q2n1kIm*dImQ2n2k) \r
- + 2.*(p1n0kRe*dReQ1n3k+p1n0kIm*dImQ1n3k) \r
- + 2.*s1p1k*dSM1p2k \r
- - 6.*s1p3k) \r
- / dM0111; // to be imropoved (notation of dM0111)\r
- \r
- // fill the 2D profile to get the average correlation for each (pt, eta) bin:\r
- if(type == "POI")\r
- {\r
- //f4pPtEtaPOIW->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nW0W1W1W1PtEta,dM0111);\r
- fCorrelationsPro[1][1][0][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nW0W1W1W1PtEta,dM0111);\r
- }\r
- else if(type == "RP")\r
- {\r
- //f4pPtEtaRPW->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nW0W1W1W1PtEta,dM0111); \r
- fCorrelationsPro[0][1][0][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nW0W1W1W1PtEta,dM0111); \r
- }\r
- } // end of if(dM0111)\r
- \r
- } // end of for(Int_t e=1;e<=fnBinsEta;e++)\r
- } // end of for(Int_t p=1;p<=fnBinsPt;p++)\r
- \r
- \r
- \r
- \r
-} // end of AliFlowAnalysisWithQCumulants::CalculateWeightedCorrelationsForDifferentialFlow2D(TString type)\r
-\r
-\r
-//================================================================================================================================\r
-\r
- */ \r
-\r
-/*\r
-void AliFlowAnalysisWithQCumulants::FinalizeCorrelationsForDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights)\r
-{\r
- // 1.) Access average for 2D correlations from profiles and store them in 2D final results histograms;\r
- // 2.) Access spread for 2D correlations from profiles, calculate error and store it in 2D final results histograms;\r
- // 3.) Make projections along pt and eta axis and store results and errors in 1D final results histograms. \r
- \r
- Int_t typeFlag = -1;\r
- Int_t pWeightsFlag = -1;\r
- Int_t eWeightsFlag = -1;\r
-\r
- if(type == "RP")\r
- {\r
- typeFlag = 0;\r
- } else if(type == "POI")\r
- {\r
- typeFlag = 1;\r
- } else \r
- {\r
- cout<<"WARNING: type must be either RP or POI in AFAWQC::FCFDF() !!!!"<<endl;\r
- exit(0);\r
- }\r
- \r
- if(!useParticleWeights)\r
- {\r
- pWeightsFlag = 0;\r
- } else \r
- {\r
- pWeightsFlag = 1; \r
- } \r
- \r
- if(eventWeights == "exact")\r
- {\r
- eWeightsFlag = 0;\r
- } \r
- \r
- // shortcuts:\r
- Int_t t = typeFlag;\r
- Int_t pW = pWeightsFlag;\r
- Int_t eW = eWeightsFlag;\r
- \r
- // from 2D histogram fNonEmptyBins2D make two 1D histograms fNonEmptyBins1D in pt and eta (to be improved (i.e. moved somewhere else)) \r
- // pt:\r
- for(Int_t p=1;p<fnBinsPt;p++)\r
- {\r
- Double_t contentPt = 0.;\r
- for(Int_t e=1;e<=fnBinsEta;e++)\r
- {\r
- contentPt += (fNonEmptyBins2D[t]->GetBinContent(fNonEmptyBins2D[t]->GetBin(p,e))); \r
- }\r
- fNonEmptyBins1D[t][0]->SetBinContent(p,contentPt);\r
- }\r
- // eta:\r
- for(Int_t e=1;e<fnBinsEta;e++)\r
- {\r
- Double_t contentEta = 0.;\r
- for(Int_t p=1;p<=fnBinsPt;p++)\r
- {\r
- contentEta += (fNonEmptyBins2D[t]->GetBinContent(fNonEmptyBins2D[t]->GetBin(p,e))); \r
- }\r
- fNonEmptyBins1D[t][1]->SetBinContent(e,contentEta);\r
- }\r
- \r
- // from 2D profile in (pt,eta) make two 1D profiles in (pt) and (eta):\r
- TProfile *profile[2][4]; // [0=pt,1=eta][correlation index] // to be improved (do not hardwire the correlation index)\r
- \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- for(Int_t ci=0;ci<4;ci++) // correlation index\r
- {\r
- if(pe==0) profile[pe][ci] = this->MakePtProjection(fCorrelationsPro[t][pW][eW][ci]);\r
- if(pe==1) profile[pe][ci] = this->MakeEtaProjection(fCorrelationsPro[t][pW][eW][ci]);\r
- }\r
- }\r
- \r
- // transfer 2D profile into 2D histogram:\r
- // to be improved (see in documentation if there is a method to transfer values from 2D profile into 2D histogram) \r
- for(Int_t ci=0;ci<4;ci++)\r
- {\r
- for(Int_t p=1;p<=fnBinsPt;p++)\r
- {\r
- for(Int_t e=1;e<=fnBinsEta;e++)\r
- {\r
- Double_t correlation = fCorrelationsPro[t][pW][eW][ci]->GetBinContent(fCorrelationsPro[t][pW][eW][ci]->GetBin(p,e)); \r
- Double_t spread = fCorrelationsPro[t][pW][eW][ci]->GetBinError(fCorrelationsPro[t][pW][eW][ci]->GetBin(p,e));\r
- Double_t nEvts = fNonEmptyBins2D[t]->GetBinContent(fNonEmptyBins2D[t]->GetBin(p,e));\r
- Double_t error = 0.;\r
- fFinalCorrelations2D[t][pW][eW][ci]->SetBinContent(fFinalCorrelations2D[t][pW][eW][ci]->GetBin(p,e),correlation); \r
- if(nEvts>0)\r
- {\r
- error = spread/pow(nEvts,0.5);\r
- fFinalCorrelations2D[t][pW][eW][ci]->SetBinError(fFinalCorrelations2D[t][pW][eW][ci]->GetBin(p,e),error);\r
- }\r
- } // end of for(Int_t e=1;e<=fnBinsEta;e++)\r
- } // end of for(Int_t p=1;p<=fnBinsPt;p++)\r
- } // end of for(Int_t ci=0;ci<4;ci++)\r
- \r
- // transfer 1D profile into 1D histogram (pt):\r
- // to be improved (see in documentation if there is a method to transfer values from 1D profile into 1D histogram) \r
- for(Int_t ci=0;ci<4;ci++)\r
- {\r
- for(Int_t p=1;p<=fnBinsPt;p++)\r
- {\r
- if(profile[0][ci])\r
- {\r
- Double_t correlation = profile[0][ci]->GetBinContent(p); \r
- Double_t spread = profile[0][ci]->GetBinError(p);\r
- Double_t nEvts = fNonEmptyBins1D[t][0]->GetBinContent(p);\r
- Double_t error = 0.;\r
- fFinalCorrelations1D[t][pW][eW][0][ci]->SetBinContent(p,correlation); \r
- if(nEvts>0)\r
- {\r
- error = spread/pow(nEvts,0.5);\r
- fFinalCorrelations1D[t][pW][eW][0][ci]->SetBinError(p,error);\r
- } \r
- } \r
- } // end of for(Int_t p=1;p<=fnBinsPt;p++)\r
- } // end of for(Int_t ci=0;ci<4;ci++)\r
- \r
- // transfer 1D profile into 1D histogram (eta):\r
- // to be improved (see in documentation if there is a method to transfer values from 1D profile into 1D histogram) \r
- for(Int_t ci=0;ci<4;ci++)\r
- {\r
- for(Int_t e=1;e<=fnBinsEta;e++)\r
- {\r
- if(profile[1][ci])\r
- {\r
- Double_t correlation = profile[1][ci]->GetBinContent(e); \r
- fFinalCorrelations1D[t][pW][eW][1][ci]->SetBinContent(e,correlation); \r
- } \r
- } // end of for(Int_t e=1;e<=fnBinsEta;e++)\r
- } // end of for(Int_t ci=0;ci<4;ci++)\r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::FinalizeCorrelationsForDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights)\r
-*/\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulants(TString type, TString ptOrEta)\r
-{\r
- // calcualate cumulants for differential flow from measured correlations\r
- // Remark: cumulants calculated here are NOT corrected for non-uniform acceptance. This correction is applied in the method ...\r
- // to be improved (description) \r
- \r
- Int_t typeFlag = -1;\r
- Int_t ptEtaFlag = -1;\r
-\r
- if(type == "RP")\r
- {\r
- typeFlag = 0;\r
- } else if(type == "POI")\r
- {\r
- typeFlag = 1;\r
- } \r
- \r
- if(ptOrEta == "Pt")\r
- {\r
- ptEtaFlag = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- ptEtaFlag = 1;\r
- } \r
- \r
- // shortcuts:\r
- Int_t t = typeFlag;\r
- Int_t pe = ptEtaFlag;\r
- \r
- // common:\r
- Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
- \r
- // correlation <<2>>: \r
- Double_t two = fIntFlowCorrelationsHist->GetBinContent(1);\r
- \r
- // 1D:\r
- for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- {\r
- // reduced correlations: \r
- Double_t twoPrime = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); // <<2'>>(pt)\r
- Double_t fourPrime = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); // <<4'>>(pt)\r
- // final statistical error of reduced correlations:\r
- //Double_t twoPrimeError = fFinalCorrelations1D[t][pW][eW][0][0]->GetBinError(p); \r
- // QC{2'}:\r
- Double_t qc2Prime = twoPrime; // QC{2'}\r
- //Double_t qc2PrimeError = twoPrimeError; // final stat. error of QC{2'}\r
- fDiffFlowCumulants[t][pe][0]->SetBinContent(b,qc2Prime); \r
- //fFinalCumulantsPt[t][pW][eW][nua][0]->SetBinError(p,qc2PrimeError); \r
- // QC{4'}:\r
- Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>>\r
- fDiffFlowCumulants[t][pe][1]->SetBinContent(b,qc4Prime); \r
- } // end of for(Int_t p=1;p<=fnBinsPt;p++)\r
- \r
- \r
- /* \r
- // 2D (pt,eta):\r
- // to be improved (see documentation if I can do all this without looping)\r
- for(Int_t p=1;p<=fnBinsPt;p++)\r
- {\r
- for(Int_t e=1;e<=fnBinsEta;e++) \r
- { \r
- // reduced correlations: \r
- Double_t twoPrime = fFinalCorrelations2D[t][pW][eW][0]->GetBinContent(fFinalCorrelations2D[t][pW][eW][0]->GetBin(p,e)); // <<2'>>(pt,eta)\r
- Double_t fourPrime = fFinalCorrelations2D[t][pW][eW][1]->GetBinContent(fFinalCorrelations2D[t][pW][eW][1]->GetBin(p,e)); // <<4'>>(pt,eta)\r
- for(Int_t nua=0;nua<2;nua++)\r
- {\r
- // QC{2'}:\r
- Double_t qc2Prime = twoPrime; // QC{2'} = <<2'>>\r
- fFinalCumulants2D[t][pW][eW][nua][0]->SetBinContent(fFinalCumulants2D[t][pW][eW][nua][0]->GetBin(p,e),qc2Prime); \r
- // QC{4'}:\r
- Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>>\r
- fFinalCumulants2D[t][pW][eW][nua][1]->SetBinContent(fFinalCumulants2D[t][pW][eW][nua][1]->GetBin(p,e),qc4Prime); \r
- } // end of for(Int_t nua=0;nua<2;nua++) \r
- } // end of for(Int_t e=1;e<=fnBinsEta;e++)\r
- } // end of for(Int_t p=1;p<=fnBinsPt;p++)\r
- */\r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulants(TString type, Bool_t useParticleWeights, TString eventWeights); \r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type)\r
-{\r
- // calculate final results for integrated flow of RPs and POIs \r
- \r
- Int_t typeFlag = -1;\r
-\r
- if(type == "RP")\r
- {\r
- typeFlag = 0;\r
- } else if(type == "POI")\r
- {\r
- typeFlag = 1;\r
- } else \r
- {\r
- cout<<"WARNING: type must be either RP or POI in AFAWQC::CDF() !!!!"<<endl;\r
- exit(0);\r
- }\r
- \r
- // shortcuts:\r
- Int_t t = typeFlag;\r
- \r
- // pt yield: \r
- TH1F *yield2ndPt = NULL;\r
- TH1F *yield4thPt = NULL;\r
- TH1F *yield6thPt = NULL;\r
- TH1F *yield8thPt = NULL;\r
- \r
- if(type == "POI")\r
- {\r
- yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtPOI())->Clone();\r
- yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtPOI())->Clone();\r
- yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtPOI())->Clone();\r
- yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtPOI())->Clone(); \r
- } \r
- else if(type == "RP")\r
- {\r
- yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtRP())->Clone();\r
- yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtRP())->Clone();\r
- yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtRP())->Clone();\r
- yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtRP())->Clone(); \r
- } \r
- \r
- Int_t nBinsPt = yield2ndPt->GetNbinsX();\r
- \r
- TH1D *flow2ndPt = NULL;\r
- TH1D *flow4thPt = NULL;\r
- TH1D *flow6thPt = NULL;\r
- TH1D *flow8thPt = NULL;\r
- \r
- // to be improved (hardwired pt index)\r
- flow2ndPt = (TH1D*)fDiffFlow[t][0][0]->Clone();\r
- flow4thPt = (TH1D*)fDiffFlow[t][0][1]->Clone();\r
- flow6thPt = (TH1D*)fDiffFlow[t][0][2]->Clone();\r
- flow8thPt = (TH1D*)fDiffFlow[t][0][3]->Clone(); \r
- \r
- Double_t dvn2nd = 0., dvn4th = 0., dvn6th = 0., dvn8th = 0.; // differential flow\r
- Double_t dErrvn2nd = 0., dErrvn4th = 0., dErrvn6th = 0., dErrvn8th = 0.; // error on differential flow\r
- \r
- Double_t dVn2nd = 0., dVn4th = 0., dVn6th = 0., dVn8th = 0.; // integrated flow \r
- Double_t dErrVn2nd = 0., dErrVn4th = 0., dErrVn6th = 0., dErrVn8th = 0.; // error on integrated flow\r
-\r
- Double_t dYield2nd = 0., dYield4th = 0., dYield6th = 0., dYield8th = 0.; // pt yield \r
- Double_t dSum2nd = 0., dSum4th = 0., dSum6th = 0., dSum8th = 0.; // needed for normalizing integrated flow\r
- \r
- // looping over pt bins:\r
- for(Int_t p=1;p<nBinsPt+1;p++)\r
- {\r
- dvn2nd = flow2ndPt->GetBinContent(p);\r
- dvn4th = flow4thPt->GetBinContent(p);\r
- dvn6th = flow6thPt->GetBinContent(p);\r
- dvn8th = flow8thPt->GetBinContent(p);\r
- \r
- dErrvn2nd = flow2ndPt->GetBinError(p);\r
- dErrvn4th = flow4thPt->GetBinError(p);\r
- dErrvn6th = flow6thPt->GetBinError(p);\r
- dErrvn8th = flow8thPt->GetBinError(p);\r
-\r
- dYield2nd = yield2ndPt->GetBinContent(p); \r
- dYield4th = yield4thPt->GetBinContent(p);\r
- dYield6th = yield6thPt->GetBinContent(p);\r
- dYield8th = yield8thPt->GetBinContent(p);\r
- \r
- dVn2nd += dvn2nd*dYield2nd;\r
- dVn4th += dvn4th*dYield4th;\r
- dVn6th += dvn6th*dYield6th;\r
- dVn8th += dvn8th*dYield8th;\r
- \r
- dSum2nd += dYield2nd;\r
- dSum4th += dYield4th;\r
- dSum6th += dYield6th;\r
- dSum8th += dYield8th;\r
- \r
- dErrVn2nd += dYield2nd*dYield2nd*dErrvn2nd*dErrvn2nd; // ro be improved (check this relation)\r
- dErrVn4th += dYield4th*dYield4th*dErrvn4th*dErrvn4th;\r
- dErrVn6th += dYield6th*dYield6th*dErrvn6th*dErrvn6th;\r
- dErrVn8th += dYield8th*dYield8th*dErrvn8th*dErrvn8th;\r
- \r
- } // end of for(Int_t p=1;p<nBinsPt+1;p++)\r
-\r
- // normalizing the results for integrated flow:\r
- if(dSum2nd) \r
- {\r
- dVn2nd /= dSum2nd;\r
- dErrVn2nd /= (dSum2nd*dSum2nd);\r
- dErrVn2nd = TMath::Sqrt(dErrVn2nd);\r
- } \r
- if(dSum4th) \r
- {\r
- dVn4th /= dSum4th;\r
- dErrVn4th /= (dSum4th*dSum4th);\r
- dErrVn4th = TMath::Sqrt(dErrVn4th);\r
- } \r
- //if(dSum6th) dVn6th/=dSum6th;\r
- //if(dSum8th) dVn8th/=dSum8th;\r
- \r
- // storing the results for integrated flow in common histos: (to be improved: new method for this?)\r
- if(type == "POI")\r
- {\r
- fCommonHistsResults2nd->FillIntegratedFlowPOI(dVn2nd,dErrVn2nd); \r
- fCommonHistsResults4th->FillIntegratedFlowPOI(dVn4th,dErrVn4th); \r
- fCommonHistsResults6th->FillIntegratedFlowPOI(dVn6th,0.); // to be improved (errors)\r
- fCommonHistsResults8th->FillIntegratedFlowPOI(dVn8th,0.); // to be improved (errors)\r
- }\r
- else if (type == "RP")\r
- {\r
- fCommonHistsResults2nd->FillIntegratedFlowRP(dVn2nd,dErrVn2nd); \r
- fCommonHistsResults4th->FillIntegratedFlowRP(dVn4th,dErrVn4th);\r
- fCommonHistsResults6th->FillIntegratedFlowRP(dVn6th,0.); // to be improved (errors)\r
- fCommonHistsResults8th->FillIntegratedFlowRP(dVn8th,0.); // to be improved (errors)\r
- }\r
- \r
- delete flow2ndPt;\r
- delete flow4thPt;\r
- //delete flow6thPt;\r
- //delete flow8thPt;\r
- \r
- delete yield2ndPt;\r
- delete yield4thPt;\r
- delete yield6thPt;\r
- delete yield8thPt;\r
- \r
-} // end of AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type)\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions()\r
-{\r
- // Initialize all arrays used for distributions.
+ // Calculate the final results.
- // a) Initialize arrays of histograms used to hold distributions of correlations;
- // b) Initialize array to hold min and max values of correlations.
+ // a) Check all pointers used in this method;
+ // b) Acces the constants;
+ // c) Access the flags;
+ // d) Calculate reference cumulants (not corrected for detector effects);
+ // e) Correct reference cumulants for detector effects;
+ // f) Calculate reference flow;
- // a) Initialize arrays of histograms used to hold distributions of correlations:
- for(Int_t di=0;di<4;di++) // distribution index\r
- {\r
- fDistributions[di] = NULL;\r
- }\r
- // b) Initialize default min and max values of correlations:
- // (Remark: The default values bellow were chosen for v2=5% and M=500)
- fMinValueOfCorrelation[0] = -0.01; // <2>_min
- fMaxValueOfCorrelation[0] = 0.04; // <2>_max
- fMinValueOfCorrelation[1] = -0.00002; // <4>_min
- fMaxValueOfCorrelation[1] = 0.00015; // <4>_max
- fMinValueOfCorrelation[2] = -0.0000003; // <6>_min
- fMaxValueOfCorrelation[2] = 0.0000006; // <6>_max
- fMinValueOfCorrelation[3] = -0.000000006; // <8>_min
- fMaxValueOfCorrelation[3] = 0.000000003; // <8>_max
- \r
-} // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions()\r
-\r
-
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions()\r
-{\r
- // a) Book profile to hold all flags for distributions of correlations;
- // b) Book all histograms to hold distributions of correlations.
+ // g) Store results for reference flow in AliFlowCommonHistResults and print them on the screen;
+ // h) Calculate the final results for differential flow (without/with weights);
+ // i) Correct the results for differential flow (without/with weights) for effects of non-uniform acceptance (NUA);
+ // j) Calculate the final results for integrated flow (RP/POI) and store in AliFlowCommonHistResults;
+ // k) Store results for differential flow in AliFlowCommonHistResults;
+ // l) Print the final results for integrated flow (RP/POI) on the screen;
+ // m) Cross-checking: Results from Q-vectors vs results from nested loops.
- TString correlationIndex[4] = {"<2>","<4>","<6>","<8>"}; // to be improved (should I promote this to data members?)
+ // a) Check all pointers used in this method:
+ this->CheckPointersUsedInFinish();
- // a) Book profile to hold all flags for distributions of correlations:
- TString distributionsFlagsName = "fDistributionsFlags";\r
- distributionsFlagsName += fAnalysisLabel->Data();\r
- fDistributionsFlags = new TProfile(distributionsFlagsName.Data(),"Flags for Distributions of Correlations",9,0,9);\r
- fDistributionsFlags->SetTickLength(-0.01,"Y");\r
- fDistributionsFlags->SetMarkerStyle(25);\r
- fDistributionsFlags->SetLabelSize(0.05);\r
- fDistributionsFlags->SetLabelOffset(0.02,"Y");\r
- (fDistributionsFlags->GetXaxis())->SetBinLabel(1,"Store or not?");\r
- (fDistributionsFlags->GetXaxis())->SetBinLabel(2,"<2>_{min}");\r
- (fDistributionsFlags->GetXaxis())->SetBinLabel(3,"<2>_{max}");\r
- (fDistributionsFlags->GetXaxis())->SetBinLabel(4,"<4>_{min}");\r
- (fDistributionsFlags->GetXaxis())->SetBinLabel(5,"<4>_{max}");\r
- (fDistributionsFlags->GetXaxis())->SetBinLabel(6,"<6>_{min}");\r
- (fDistributionsFlags->GetXaxis())->SetBinLabel(7,"<6>_{max}");\r
- (fDistributionsFlags->GetXaxis())->SetBinLabel(8,"<8>_{min}");\r
- (fDistributionsFlags->GetXaxis())->SetBinLabel(9,"<8>_{max}");\r
- fDistributionsList->Add(fDistributionsFlags);\r
+ // b) Acces the constants:
+ this->AccessConstants();
- // b) Book all histograms to hold distributions of correlations.
- if(fStoreDistributions)
- {
- TString distributionsName = "fDistributions";\r
- distributionsName += fAnalysisLabel->Data();\r
- for(Int_t di=0;di<4;di++) // distribution index\r
+ if(fCommonHists && fCommonHists->GetHarmonic()) // to be improved (moved somewhere else)
+ {
+ fHarmonic = (Int_t)(fCommonHists->GetHarmonic())->GetBinContent(1);
+ }
+
+ // c) Access the flags: // to be improved (implement a method for this)
+ fUsePhiWeights = (Bool_t)fUseParticleWeights->GetBinContent(1);
+ fUsePtWeights = (Bool_t)fUseParticleWeights->GetBinContent(2);
+ fUseEtaWeights = (Bool_t)fUseParticleWeights->GetBinContent(3);
+ fApplyCorrectionForNUA = (Bool_t)fIntFlowFlags->GetBinContent(3);
+ fPrintFinalResults[0] = (Bool_t)fIntFlowFlags->GetBinContent(4);
+ fPrintFinalResults[1] = (Bool_t)fIntFlowFlags->GetBinContent(5);
+ fPrintFinalResults[2] = (Bool_t)fIntFlowFlags->GetBinContent(6);
+ fPrintFinalResults[3] = (Bool_t)fIntFlowFlags->GetBinContent(7);
+ fApplyCorrectionForNUAVsM = (Bool_t)fIntFlowFlags->GetBinContent(8);
+ fPropagateErrorAlsoFromNUATerms = (Bool_t)fIntFlowFlags->GetBinContent(9);
+ fCalculateCumulantsVsM = (Bool_t)fIntFlowFlags->GetBinContent(10);
+ fMinimumBiasReferenceFlow = (Bool_t)fIntFlowFlags->GetBinContent(11);
+ fEvaluateIntFlowNestedLoops = (Bool_t)fEvaluateNestedLoops->GetBinContent(1);
+ fEvaluateDiffFlowNestedLoops = (Bool_t)fEvaluateNestedLoops->GetBinContent(2);
+ fCrossCheckInPtBinNo = (Int_t)fEvaluateNestedLoops->GetBinContent(3);
+ fCrossCheckInEtaBinNo = (Int_t)fEvaluateNestedLoops->GetBinContent(4);
+
+ // d) Calculate reference cumulants (not corrected for detector effects):
+ this->FinalizeCorrelationsIntFlow();
+ this->CalculateCovariancesIntFlow();
+ this->CalculateCumulantsIntFlow();
+
+ // e) Correct reference cumulants for detector effects:
+ this->FinalizeCorrectionTermsForNUAIntFlow();
+ this->CalculateCovariancesNUAIntFlow();
+ this->CalculateQcumulantsCorrectedForNUAIntFlow();
+
+ // f) Calculate reference flow:
+ this->CalculateReferenceFlow();
+
+ // f) Store results for reference flow in AliFlowCommonHistResults and print them on the screen:
+ this->FillCommonHistResultsIntFlow();
+ if(fPrintFinalResults[0]){this->PrintFinalResultsForIntegratedFlow("RF");}
+ if(fPrintFinalResults[3] && fCalculateCumulantsVsM){this->PrintFinalResultsForIntegratedFlow("RF, rebinned in M");}
+
+ // g) Calculate the final results for differential flow (without/with weights):
+ this->FinalizeReducedCorrelations("RP","Pt");
+ this->FinalizeReducedCorrelations("RP","Eta");
+ this->FinalizeReducedCorrelations("POI","Pt");
+ this->FinalizeReducedCorrelations("POI","Eta");
+ this->CalculateDiffFlowCovariances("RP","Pt");
+ this->CalculateDiffFlowCovariances("RP","Eta");
+ this->CalculateDiffFlowCovariances("POI","Pt");
+ this->CalculateDiffFlowCovariances("POI","Eta");
+ this->CalculateDiffFlowCumulants("RP","Pt");
+ this->CalculateDiffFlowCumulants("RP","Eta");
+ this->CalculateDiffFlowCumulants("POI","Pt");
+ this->CalculateDiffFlowCumulants("POI","Eta");
+ this->CalculateDiffFlow("RP","Pt");
+ this->CalculateDiffFlow("RP","Eta");
+ this->CalculateDiffFlow("POI","Pt");
+ this->CalculateDiffFlow("POI","Eta");
+
+ // h) Correct the results for differential flow (without/with weights) for effects of non-uniform acceptance (NUA):
+ if(fApplyCorrectionForNUA)
+ {
+ this->FinalizeCorrectionTermsForNUADiffFlow("RP","Pt");
+ this->FinalizeCorrectionTermsForNUADiffFlow("RP","Eta");
+ this->FinalizeCorrectionTermsForNUADiffFlow("POI","Pt");
+ this->FinalizeCorrectionTermsForNUADiffFlow("POI","Eta");
+ this->CalculateDiffFlowCumulantsCorrectedForNUA("RP","Pt");
+ this->CalculateDiffFlowCumulantsCorrectedForNUA("RP","Eta");
+ this->CalculateDiffFlowCumulantsCorrectedForNUA("POI","Pt");
+ this->CalculateDiffFlowCumulantsCorrectedForNUA("POI","Eta");
+ this->CalculateDiffFlowCorrectedForNUA("RP","Pt");
+ this->CalculateDiffFlowCorrectedForNUA("RP","Eta");
+ this->CalculateDiffFlowCorrectedForNUA("POI","Pt");
+ this->CalculateDiffFlowCorrectedForNUA("POI","Eta");
+ }
+
+ // i) Calculate the final results for integrated flow (RP/POI) and store in AliFlowCommonHistResults:
+ this->CalculateFinalResultsForRPandPOIIntegratedFlow("RP");
+ this->CalculateFinalResultsForRPandPOIIntegratedFlow("POI");
+
+ // j) Store results for differential flow in AliFlowCommonHistResults:
+ this->FillCommonHistResultsDiffFlow("RP");
+ this->FillCommonHistResultsDiffFlow("POI");
+
+ // k) Print the final results for integrated flow (RP/POI) on the screen:
+ if(fPrintFinalResults[1]){this->PrintFinalResultsForIntegratedFlow("RP");}
+ if(fPrintFinalResults[2]){this->PrintFinalResultsForIntegratedFlow("POI");}
+
+ // l) Cross-checking: Results from Q-vectors vs results from nested loops:
+ // l1) Reference flow:
+ if(fEvaluateIntFlowNestedLoops)
+ {
+ this->CrossCheckIntFlowCorrelations();
+ this->CrossCheckIntFlowCorrectionTermsForNUA();
+ if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) this->CrossCheckIntFlowExtraCorrelations();
+ } // end of if(fEvaluateIntFlowNestedLoops)
+
+ // l2) Differential flow:
+ if(fEvaluateDiffFlowNestedLoops)
+ {
+ // Correlations:
+ this->PrintNumberOfParticlesInSelectedBin();
+ this->CrossCheckDiffFlowCorrelations("RP","Pt");
+ this->CrossCheckDiffFlowCorrelations("RP","Eta");
+ this->CrossCheckDiffFlowCorrelations("POI","Pt");
+ this->CrossCheckDiffFlowCorrelations("POI","Eta");
+ // Correction terms for non-uniform acceptance:
+ this->CrossCheckDiffFlowCorrectionTermsForNUA("RP","Pt");
+ this->CrossCheckDiffFlowCorrectionTermsForNUA("RP","Eta");
+ this->CrossCheckDiffFlowCorrectionTermsForNUA("POI","Pt");
+ this->CrossCheckDiffFlowCorrectionTermsForNUA("POI","Eta");
+ } // end of if(fEvaluateDiffFlowNestedLoops)
+
+} // end of AliFlowAnalysisWithQCumulants::Finish()
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTerms()
+{
+ // Calculate correction terms for non-uniform acceptance of the detector for reference flow (cos terms).
+
+ // multiplicity:
+ Double_t dMult = (*fSMpk)(0,0);
+
+ // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
+ Double_t dReQ1n = (*fReQ)(0,0);
+ Double_t dReQ2n = (*fReQ)(1,0);
+ //Double_t dReQ3n = (*fReQ)(2,0);
+ //Double_t dReQ4n = (*fReQ)(3,0);
+ Double_t dImQ1n = (*fImQ)(0,0);
+ Double_t dImQ2n = (*fImQ)(1,0);
+ //Double_t dImQ3n = (*fImQ)(2,0);
+ //Double_t dImQ4n = (*fImQ)(3,0);
+
+ // *************************************************************
+ // **** corrections for non-uniform acceptance (cos terms): ****
+ // *************************************************************
+ //
+ // Remark 1: corrections for non-uniform acceptance (cos terms) calculated with non-weighted Q-vectors
+ // are stored in 1D profile fQCorrectionsCos.
+ // Remark 2: binning of fIntFlowCorrectionTermsForNUAPro[1] is organized as follows:
+ // --------------------------------------------------------------------------------------------------------------------
+ // 1st bin: <<cos(n*(phi1))>> = cosP1n
+ // 2nd bin: <<cos(n*(phi1+phi2))>> = cosP1nP1n
+ // 3rd bin: <<cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1n
+ // 4th bin: <<cos(n*(2phi1-phi2))>> = cosP2nM1n
+ // --------------------------------------------------------------------------------------------------------------------
+
+ // 1-particle:
+ Double_t cosP1n = 0.; // <<cos(n*(phi1))>>
+
+ if(dMult>0)
+ {
+ cosP1n = dReQ1n/dMult;
+
+ // average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for single event:
+ fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(1,cosP1n);
+ // event weights for NUA terms:
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(1,dMult);
+
+ // final average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for all events:
+ fIntFlowCorrectionTermsForNUAPro[1]->Fill(0.5,cosP1n,dMult);
+ if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[1][0]->Fill(dMult+0.5,cosP1n,dMult);}
+ }
+
+ // 2-particle:
+ Double_t cosP1nP1n = 0.; // <<cos(n*(phi1+phi2))>>
+ Double_t cosP2nM1n = 0.; // <<cos(n*(2phi1-phi2))>>
+
+ if(dMult>1)
+ {
+ cosP1nP1n = (pow(dReQ1n,2)-pow(dImQ1n,2)-dReQ2n)/(dMult*(dMult-1));
+ cosP2nM1n = (dReQ2n*dReQ1n+dImQ2n*dImQ1n-dReQ1n)/(dMult*(dMult-1));
+
+ // average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for single event:
+ fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(2,cosP1nP1n);
+ fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(4,cosP2nM1n);
+ // event weights for NUA terms:
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(2,dMult*(dMult-1));
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(4,dMult*(dMult-1));
+
+ // final average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for all events:
+ fIntFlowCorrectionTermsForNUAPro[1]->Fill(1.5,cosP1nP1n,dMult*(dMult-1));
+ fIntFlowCorrectionTermsForNUAPro[1]->Fill(3.5,cosP2nM1n,dMult*(dMult-1));
+ if(fCalculateCumulantsVsM)
{
- fDistributions[di] = new TH1D(Form("Distribution of %s",correlationIndex[di].Data()),Form("Distribution of %s",correlationIndex[di].Data()),10000,fMinValueOfCorrelation[di],fMaxValueOfCorrelation[di]); \r
- fDistributions[di]->SetXTitle(correlationIndex[di].Data());\r
- fDistributionsList->Add(fDistributions[di]);\r
- } // end of for(Int_t di=0;di<4;di++) // distribution index
- } // end of if(fStoreDistributions)
+ fIntFlowCorrectionTermsForNUAVsMPro[1][1]->Fill(dMult+0.5,cosP1nP1n,dMult*(dMult-1));
+ fIntFlowCorrectionTermsForNUAVsMPro[1][3]->Fill(dMult+0.5,cosP2nM1n,dMult*(dMult-1));
+ }
+ }
-} // end of void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-
-void AliFlowAnalysisWithQCumulants::StoreFlagsForDistributions()\r
-{\r
- // Store all flags for distributiuons of correlations in profile fDistributionsFlags.\r
- \r
- if(!fDistributionsFlags)\r
- {\r
- cout<<"WARNING: fDistributionsFlags is NULL in AFAWQC::SDF() !!!!"<<endl;\r
- exit(0);\r
- } \r
-\r
- fDistributionsFlags->Fill(0.5,(Int_t)fStoreDistributions); // histos with distributions of correlations stored or not in the output file
- // store min and max values of correlations:
- for(Int_t di=0;di<4;di++) // distribution index\r
- {\r
- fDistributionsFlags->Fill(1.5+2.*(Double_t)di,fMinValueOfCorrelation[di]);
- fDistributionsFlags->Fill(2.5+2.*(Double_t)di,fMaxValueOfCorrelation[di]);
- }\r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::StoreFlagsForDistributions()\r
-\r
+ // 3-particle:
+ Double_t cosP1nM1nM1n = 0.; // <<cos(n*(phi1-phi2-phi3))>>
+
+ if(dMult>2)
+ {
+ cosP1nM1nM1n = (dReQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))-dReQ1n*dReQ2n-dImQ1n*dImQ2n-2.*(dMult-1)*dReQ1n)
+ / (dMult*(dMult-1)*(dMult-2));
+
+ // average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for single event:
+ fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(3,cosP1nM1nM1n);
+ // event weights for NUA terms:
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(3,dMult*(dMult-1)*(dMult-2));
+
+ // final average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for all events:
+ fIntFlowCorrectionTermsForNUAPro[1]->Fill(2.5,cosP1nM1nM1n,dMult*(dMult-1)*(dMult-2));
+ if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[1][2]->Fill(dMult+0.5,cosP1nM1nM1n,dMult*(dMult-1)*(dMult-2));}
+ }
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTerms()
+
-//================================================================================================================================\r
+//================================================================================================================================
-void AliFlowAnalysisWithQCumulants::StoreDistributionsOfCorrelations()
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTerms()
{
- // Store distributions of correlations.
+ // calculate corrections for non-uniform acceptance of the detector for no-name integrated flow (sin terms)
+
+ // multiplicity:
+ Double_t dMult = (*fSMpk)(0,0);
+
+ // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
+ Double_t dReQ1n = (*fReQ)(0,0);
+ Double_t dReQ2n = (*fReQ)(1,0);
+ //Double_t dReQ3n = (*fReQ)(2,0);
+ //Double_t dReQ4n = (*fReQ)(3,0);
+ Double_t dImQ1n = (*fImQ)(0,0);
+ Double_t dImQ2n = (*fImQ)(1,0);
+ //Double_t dImQ3n = (*fImQ)(2,0);
+ //Double_t dImQ4n = (*fImQ)(3,0);
+
+ // *************************************************************
+ // **** corrections for non-uniform acceptance (sin terms): ****
+ // *************************************************************
+ //
+ // Remark 1: corrections for non-uniform acceptance (sin terms) calculated with non-weighted Q-vectors
+ // are stored in 1D profile fQCorrectionsSin.
+ // Remark 2: binning of fIntFlowCorrectionTermsForNUAPro[0] is organized as follows:
+ // --------------------------------------------------------------------------------------------------------------------
+ // 1st bin: <<sin(n*(phi1))>> = sinP1n
+ // 2nd bin: <<sin(n*(phi1+phi2))>> = sinP1nP1n
+ // 3rd bin: <<sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1n
+ // 4th bin: <<sin(n*(2phi1-phi2))>> = sinP2nM1n
+ // --------------------------------------------------------------------------------------------------------------------
+
+ // 1-particle:
+ Double_t sinP1n = 0.; // <sin(n*(phi1))>
+
+ if(dMult>0)
+ {
+ sinP1n = dImQ1n/dMult;
+
+ // average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for single event:
+ fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(1,sinP1n);
+ // event weights for NUA terms:
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(1,dMult);
+
+ // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events:
+ fIntFlowCorrectionTermsForNUAPro[0]->Fill(0.5,sinP1n,dMult);
+ if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[0][0]->Fill(dMult+0.5,sinP1n,dMult);}
+ }
+
+ // 2-particle:
+ Double_t sinP1nP1n = 0.; // <<sin(n*(phi1+phi2))>>
+ Double_t sinP2nM1n = 0.; // <<sin(n*(2phi1-phi2))>>
+ if(dMult>1)
+ {
+ sinP1nP1n = (2.*dReQ1n*dImQ1n-dImQ2n)/(dMult*(dMult-1));
+ sinP2nM1n = (dImQ2n*dReQ1n-dReQ2n*dImQ1n-dImQ1n)/(dMult*(dMult-1));
+
+ // average non-weighted 2-particle correction (sin terms) for non-uniform acceptance for single event:
+ fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(2,sinP1nP1n);
+ fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(4,sinP2nM1n);
+ // event weights for NUA terms:
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(2,dMult*(dMult-1));
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(4,dMult*(dMult-1));
+
+ // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events:
+ fIntFlowCorrectionTermsForNUAPro[0]->Fill(1.5,sinP1nP1n,dMult*(dMult-1));
+ fIntFlowCorrectionTermsForNUAPro[0]->Fill(3.5,sinP2nM1n,dMult*(dMult-1));
+ if(fCalculateCumulantsVsM)
+ {
+ fIntFlowCorrectionTermsForNUAVsMPro[0][1]->Fill(dMult+0.5,sinP1nP1n,dMult*(dMult-1));
+ fIntFlowCorrectionTermsForNUAVsMPro[0][3]->Fill(dMult+0.5,sinP2nM1n,dMult*(dMult-1));
+ }
+ }
- if(!(fIntFlowCorrelationsEBE && fIntFlowEventWeightsForCorrelationsEBE))\r
- {\r
- cout<<"WARNING: fIntFlowCorrelationsEBE && fIntFlowEventWeightsForCorrelationsEBE"<<endl; \r
- cout<<" is NULL in AFAWQC::SDOC() !!!!"<<endl;\r
- exit(0);\r
- }\r
+ // 3-particle:
+ Double_t sinP1nM1nM1n = 0.; // <<sin(n*(phi1-phi2-phi3))>>
+
+ if(dMult>2)
+ {
+ sinP1nM1nM1n = (-dImQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))+dReQ1n*dImQ2n-dImQ1n*dReQ2n+2.*(dMult-1)*dImQ1n)
+ / (dMult*(dMult-1)*(dMult-2));
+
+ // average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for single event:
+ fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(3,sinP1nM1nM1n);
+ // event weights for NUA terms:
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(3,dMult*(dMult-1)*(dMult-2));
+
+ // final average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for all events:
+ fIntFlowCorrectionTermsForNUAPro[0]->Fill(2.5,sinP1nM1nM1n,dMult*(dMult-1)*(dMult-2));
+ if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[0][2]->Fill(dMult+0.5,sinP1nM1nM1n,dMult*(dMult-1)*(dMult-2));}
+ }
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTerms()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos)
+{
+ // a) Get pointers for common control and common result histograms and profiles.
+ // b) Get pointers for histograms with particle weights.
+ // c) Get pointers for histograms and profiles relevant for integrated flow.
+ // d) Get pointers for histograms and profiles relevant for differental flow.
+ // e) Get pointers for histograms and profiles holding results obtained with nested loops.
+
+ if(outputListHistos)
+ {
+ this->SetHistList(outputListHistos);
+ if(!fHistList)
+ {
+ cout<<endl;
+ cout<<" WARNING (QC): fHistList is NULL in AFAWQC::GOH() !!!!"<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ this->GetPointersForCommonHistograms();
+ this->GetPointersForParticleWeightsHistograms();
+ this->GetPointersForIntFlowHistograms();
+ this->GetPointersForDiffFlowHistograms();
+ this->GetPointersForNestedLoopsHistograms();
+ } else
+ {
+ cout<<endl;
+ cout<<" WARNING (QC): outputListHistos is NULL in AFAWQC::GOH() !!!!"<<endl;
+ cout<<endl;
+ exit(0);
+ }
+
+} // end of void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos)
+
- for(Int_t di=0;di<4;di++) // distribution index\r
+//================================================================================================================================
+
+
+TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) const
+{
+ // project 2D profile onto pt axis to get 1D profile
+
+ Int_t nBinsPt = profilePtEta->GetNbinsX();
+ Double_t dPtMin = (profilePtEta->GetXaxis())->GetXmin();
+ Double_t dPtMax = (profilePtEta->GetXaxis())->GetXmax();
+
+ Int_t nBinsEta = profilePtEta->GetNbinsY();
+
+ TProfile *profilePt = new TProfile("","",nBinsPt,dPtMin,dPtMax);
+
+ for(Int_t p=1;p<=nBinsPt;p++)
{
- if(!fDistributions[di])\r
- { \r
- cout<<"WARNING: fDistributions[di] is NULL in AFAWQC::SDOC() !!!!"<<endl;\r
- cout<<"di = "<<di<<endl;\r
- exit(0);\r
- } else
- {
- fDistributions[di]->Fill(fIntFlowCorrelationsEBE->GetBinContent(di+1),fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(di+1));
- } \r
- } // end of for(Int_t di=0;di<4;di++) // distribution index\r
+ Double_t contentPt = 0.;
+ Double_t entryPt = 0.;
+ Double_t spreadPt = 0.;
+ Double_t sum1 = 0.;
+ Double_t sum2 = 0.;
+ Double_t sum3 = 0.;
+ for(Int_t e=1;e<=nBinsEta;e++)
+ {
+ contentPt += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e)))
+ * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)));
+ entryPt += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)));
+
+ sum1 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)))
+ * (pow(profilePtEta->GetBinError(profilePtEta->GetBin(p,e)),2.)
+ + pow(profilePtEta->GetBinContent(profilePtEta->GetBin(p,e)),2.));
+ sum2 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)));
+ sum3 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)))
+ * (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e)));
+ }
+ if(sum2>0. && sum1/sum2-pow(sum3/sum2,2.) > 0.)
+ {
+ spreadPt = pow(sum1/sum2-pow(sum3/sum2,2.),0.5);
+ }
+ profilePt->SetBinContent(p,contentPt);
+ profilePt->SetBinEntries(p,entryPt);
+ {
+ profilePt->SetBinError(p,spreadPt);
+ }
+
+ }
+
+ return profilePt;
+
+} // end of TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta)
+
+
+//================================================================================================================================
+
+
+TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) const
+{
+ // project 2D profile onto eta axis to get 1D profile
+
+ Int_t nBinsEta = profilePtEta->GetNbinsY();
+ Double_t dEtaMin = (profilePtEta->GetYaxis())->GetXmin();
+ Double_t dEtaMax = (profilePtEta->GetYaxis())->GetXmax();
+
+ Int_t nBinsPt = profilePtEta->GetNbinsX();
+
+ TProfile *profileEta = new TProfile("","",nBinsEta,dEtaMin,dEtaMax);
+
+ for(Int_t e=1;e<=nBinsEta;e++)
+ {
+ Double_t contentEta = 0.;
+ Double_t entryEta = 0.;
+ for(Int_t p=1;p<=nBinsPt;p++)
+ {
+ contentEta += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e)))
+ * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)));
+ entryEta += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)));
+ }
+ profileEta->SetBinContent(e,contentEta);
+ profileEta->SetBinEntries(e,entryEta);
+ }
+
+ return profileEta;
+
+} // end of TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta)
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type)
+{
+ // Printing on the screen the final results for integrated flow (RF, POI and RP).
+
+ Int_t n = fHarmonic;
+
+ Double_t dVn[4] = {0.}; // array to hold Vn{2}, Vn{4}, Vn{6} and Vn{8}
+ Double_t dVnErr[4] = {0.}; // array to hold errors of Vn{2}, Vn{4}, Vn{6} and Vn{8}
+
+ if(type == "RF")
+ {
+ for(Int_t b=0;b<4;b++)
+ {
+ dVn[b] = fIntFlow->GetBinContent(b+1);
+ dVnErr[b] = fIntFlow->GetBinError(b+1);
+ }
+ } else if(type == "RP")
+ {
+ dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinContent(1);
+ dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinError(1);
+ dVn[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinContent(1);
+ dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinError(1);
+ dVn[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinContent(1);
+ dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinError(1);
+ dVn[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinContent(1);
+ dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinError(1);
+ } else if(type == "POI")
+ {
+ dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinContent(1);
+ dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinError(1);
+ dVn[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinContent(1);
+ dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinError(1);
+ dVn[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinContent(1);
+ dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinError(1);
+ dVn[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinContent(1);
+ dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinError(1);
+ } else if(type == "RF, rebinned in M")
+ {
+ for(Int_t b=0;b<4;b++)
+ {
+ dVn[b] = fIntFlowRebinnedInM->GetBinContent(b+1);
+ dVnErr[b] = fIntFlowRebinnedInM->GetBinError(b+1);
+ }
+ }
+
+ TString title = " flow estimates from Q-cumulants";
+ TString subtitle = " (";
+ TString subtitle2 = " (rebinned in M)";
+
+ if(type != "RF, rebinned in M")
+ {
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))
+ {
+ subtitle.Append(type);
+ subtitle.Append(", without weights)");
+ } else
+ {
+ subtitle.Append(type);
+ subtitle.Append(", with weights)");
+ }
+ } else
+ {
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))
+ {
+ subtitle.Append("RF");
+ subtitle.Append(", without weights)");
+ } else
+ {
+ subtitle.Append("RF");
+ subtitle.Append(", with weights)");
+ }
+ }
+
+ cout<<endl;
+ cout<<"*************************************"<<endl;
+ cout<<"*************************************"<<endl;
+ cout<<title.Data()<<endl;
+ cout<<subtitle.Data()<<endl;
+ if(type == "RF, rebinned in M"){cout<<subtitle2.Data()<<endl;}
+ cout<<endl;
+
+ for(Int_t i=0;i<4;i++)
+ {
+ cout<<" v_"<<n<<"{"<<2*(i+1)<<"} = "<<dVn[i]<<" +/- "<<dVnErr[i]<<endl;
+ }
+
+ cout<<endl;
+ if(type == "RF")
+ {
+ cout<<" detector bias:"<<endl;
+ cout<<" to QC{2}: "<<fIntFlowDetectorBias->GetBinContent(1)<<" +/- "<<fIntFlowDetectorBias->GetBinError(1)<<endl;
+ cout<<" to QC{4}: "<<fIntFlowDetectorBias->GetBinContent(2)<<" +/- "<<fIntFlowDetectorBias->GetBinError(2)<<endl;
+ cout<<endl;
+ }
+ if(type == "RF" || type == "RF, rebinned in M")
+ {
+ cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultRP()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultRP()->GetMean()<<endl;
+ }
+ else if (type == "RP")
+ {
+ cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultRP()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultRP()->GetMean()<<endl;
+ }
+ else if (type == "POI")
+ {
+ cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultPOI()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultPOI()->GetMean()<<endl;
+ }
+
+ cout<<"*************************************"<<endl;
+ cout<<"*************************************"<<endl;
+ cout<<endl;
+
+}// end of AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type="RF");
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::WriteHistograms(TString outputFileName)
+{
+ //store the final results in output .root file
+ TFile *output = new TFile(outputFileName.Data(),"RECREATE");
+ //output->WriteObject(fHistList, "cobjQC","SingleKey");
+ fHistList->Write(fHistList->GetName(), TObject::kSingleKey);
+ delete output;
+}
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::WriteHistograms(TDirectoryFile *outputFileName)
+{
+ //store the final results in output .root file
+ fHistList->SetName("cobjQC");
+ fHistList->SetOwner(kTRUE);
+ outputFileName->Add(fHistList);
+ outputFileName->Write(outputFileName->GetName(), TObject::kSingleKey);
+}
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::BookCommonHistograms()
+{
+ // Book common control histograms and common histograms for final results.
+ // common control histogram (ALL events)
+ TString commonHistsName = "AliFlowCommonHistQC";
+ commonHistsName += fAnalysisLabel->Data();
+ fCommonHists = new AliFlowCommonHist(commonHistsName.Data());
+ fHistList->Add(fCommonHists);
+ // common control histogram (for events with 2 and more particles)
+ TString commonHists2ndOrderName = "AliFlowCommonHist2ndOrderQC";
+ commonHists2ndOrderName += fAnalysisLabel->Data();
+ fCommonHists2nd = new AliFlowCommonHist(commonHists2ndOrderName.Data());
+ fHistList->Add(fCommonHists2nd);
+ // common control histogram (for events with 4 and more particles)
+ TString commonHists4thOrderName = "AliFlowCommonHist4thOrderQC";
+ commonHists4thOrderName += fAnalysisLabel->Data();
+ fCommonHists4th = new AliFlowCommonHist(commonHists4thOrderName.Data());
+ fHistList->Add(fCommonHists4th);
+ // common control histogram (for events with 6 and more particles)
+ TString commonHists6thOrderName = "AliFlowCommonHist6thOrderQC";
+ commonHists6thOrderName += fAnalysisLabel->Data();
+ fCommonHists6th = new AliFlowCommonHist(commonHists6thOrderName.Data());
+ fHistList->Add(fCommonHists6th);
+ // common control histogram (for events with 8 and more particles)
+ TString commonHists8thOrderName = "AliFlowCommonHist8thOrderQC";
+ commonHists8thOrderName += fAnalysisLabel->Data();
+ fCommonHists8th = new AliFlowCommonHist(commonHists8thOrderName.Data());
+ fHistList->Add(fCommonHists8th);
+ // common histograms for final results (calculated for events with 2 and more particles)
+ TString commonHistResults2ndOrderName = "AliFlowCommonHistResults2ndOrderQC";
+ commonHistResults2ndOrderName += fAnalysisLabel->Data();
+ fCommonHistsResults2nd = new AliFlowCommonHistResults(commonHistResults2ndOrderName.Data());
+ fHistList->Add(fCommonHistsResults2nd);
+ // common histograms for final results (calculated for events with 4 and more particles)
+ TString commonHistResults4thOrderName = "AliFlowCommonHistResults4thOrderQC";
+ commonHistResults4thOrderName += fAnalysisLabel->Data();
+ fCommonHistsResults4th = new AliFlowCommonHistResults(commonHistResults4thOrderName.Data());
+ fHistList->Add(fCommonHistsResults4th);
+ // common histograms for final results (calculated for events with 6 and more particles)
+ TString commonHistResults6thOrderName = "AliFlowCommonHistResults6thOrderQC";
+ commonHistResults6thOrderName += fAnalysisLabel->Data();
+ fCommonHistsResults6th = new AliFlowCommonHistResults(commonHistResults6thOrderName.Data());
+ fHistList->Add(fCommonHistsResults6th);
+ // common histograms for final results (calculated for events with 8 and more particles)
+ TString commonHistResults8thOrderName = "AliFlowCommonHistResults8thOrderQC";
+ commonHistResults8thOrderName += fAnalysisLabel->Data();
+ fCommonHistsResults8th = new AliFlowCommonHistResults(commonHistResults8thOrderName.Data());
+ fHistList->Add(fCommonHistsResults8th);
+
+} // end of void AliFlowAnalysisWithQCumulants::BookCommonHistograms()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms()
+{
+ // book and fill histograms which hold phi, pt and eta weights
+
+ if(!fWeightsList)
+ {
+ cout<<"WARNING: fWeightsList is NULL in AFAWQC::BAFWH() !!!!"<<endl;
+ exit(0);
+ }
+
+ TString fUseParticleWeightsName = "fUseParticleWeightsQC";
+ fUseParticleWeightsName += fAnalysisLabel->Data();
+ fUseParticleWeights = new TProfile(fUseParticleWeightsName.Data(),"0 = particle weight not used, 1 = particle weight used ",3,0,3);
+ fUseParticleWeights->SetLabelSize(0.06);
+ (fUseParticleWeights->GetXaxis())->SetBinLabel(1,"w_{#phi}");
+ (fUseParticleWeights->GetXaxis())->SetBinLabel(2,"w_{p_{T}}");
+ (fUseParticleWeights->GetXaxis())->SetBinLabel(3,"w_{#eta}");
+ fUseParticleWeights->Fill(0.5,(Int_t)fUsePhiWeights);
+ fUseParticleWeights->Fill(1.5,(Int_t)fUsePtWeights);
+ fUseParticleWeights->Fill(2.5,(Int_t)fUseEtaWeights);
+ fWeightsList->Add(fUseParticleWeights);
+
+ if(fUsePhiWeights)
+ {
+ if(fWeightsList->FindObject("phi_weights"))
+ {
+ fPhiWeights = dynamic_cast<TH1F*>(fWeightsList->FindObject("phi_weights"));
+ if(TMath::Abs(fPhiWeights->GetBinWidth(1)-fPhiBinWidth)>pow(10.,-6.))
+ {
+ cout<<endl;
+ cout<<"WARNING (QC): Inconsistent binning in histograms for phi-weights throughout the code."<<endl;
+ cout<<endl;
+ //exit(0);
+ }
+ } else
+ {
+ cout<<"WARNING: fWeightsList->FindObject(\"phi_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl;
+ exit(0);
+ }
+ } // end of if(fUsePhiWeights)
+
+ if(fUsePtWeights)
+ {
+ if(fWeightsList->FindObject("pt_weights"))
+ {
+ fPtWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("pt_weights"));
+ if(TMath::Abs(fPtWeights->GetBinWidth(1)-fPtBinWidth)>pow(10.,-6.))
+ {
+ cout<<endl;
+ cout<<"WARNING (QC): Inconsistent binning in histograms for pt-weights throughout the code."<<endl;
+ cout<<endl;
+ //exit(0);
+ }
+ } else
+ {
+ cout<<"WARNING: fWeightsList->FindObject(\"pt_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl;
+ exit(0);
+ }
+ } // end of if(fUsePtWeights)
+
+ if(fUseEtaWeights)
+ {
+ if(fWeightsList->FindObject("eta_weights"))
+ {
+ fEtaWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("eta_weights"));
+ if(TMath::Abs(fEtaWeights->GetBinWidth(1)-fEtaBinWidth)>pow(10.,-6.))
+ {
+ cout<<endl;
+ cout<<"WARNING (QC): Inconsistent binning in histograms for eta-weights throughout the code."<<endl;
+ cout<<endl;
+ //exit(0);
+ }
+ } else
+ {
+ cout<<"WARNING: fUseEtaWeights && fWeightsList->FindObject(\"eta_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl;
+ exit(0);
+ }
+ } // end of if(fUseEtaWeights)
+
+} // end of AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow()
+{
+ // Book all objects for integrated flow:
+ // a) Book profile to hold all flags for integrated flow.
+ // b) Book event-by-event quantities.
+ // c) Book profiles. // to be improved (comment)
+ // d) Book histograms holding the final results.
+
+ TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?)
+ TString powerFlag[2] = {"linear","quadratic"}; // to be improved (should I promote this to data members?)
+
+ // a) Book profile to hold all flags for integrated flow:
+ TString intFlowFlagsName = "fIntFlowFlags";
+ intFlowFlagsName += fAnalysisLabel->Data();
+ fIntFlowFlags = new TProfile(intFlowFlagsName.Data(),"Flags for Integrated Flow",11,0,11);
+ fIntFlowFlags->SetTickLength(-0.01,"Y");
+ fIntFlowFlags->SetMarkerStyle(25);
+ fIntFlowFlags->SetLabelSize(0.05);
+ fIntFlowFlags->SetLabelOffset(0.02,"Y");
+ fIntFlowFlags->GetXaxis()->SetBinLabel(1,"Particle Weights");
+ fIntFlowFlags->GetXaxis()->SetBinLabel(2,"Event Weights");
+ fIntFlowFlags->GetXaxis()->SetBinLabel(3,"Corrected for NUA?");
+ fIntFlowFlags->GetXaxis()->SetBinLabel(4,"Print RF results");
+ fIntFlowFlags->GetXaxis()->SetBinLabel(5,"Print RP results");
+ fIntFlowFlags->GetXaxis()->SetBinLabel(6,"Print POI results");
+ fIntFlowFlags->GetXaxis()->SetBinLabel(7,"Print RF (rebinned in M) results");
+ fIntFlowFlags->GetXaxis()->SetBinLabel(8,"Corrected for NUA vs M?");
+ fIntFlowFlags->GetXaxis()->SetBinLabel(9,"Propagate errors to v_{n} from correlations?");
+ fIntFlowFlags->GetXaxis()->SetBinLabel(10,"Calculate cumulants vs M");
+ fIntFlowFlags->GetXaxis()->SetBinLabel(11,"fMinimumBiasReferenceFlow");
+ fIntFlowList->Add(fIntFlowFlags);
+
+ // b) Book event-by-event quantities:
+ // Re[Q_{m*n,k}], Im[Q_{m*n,k}] and S_{p,k}^M:
+ fReQ = new TMatrixD(4,9);
+ fImQ = new TMatrixD(4,9);
+ fSMpk = new TMatrixD(8,9);
+ // average correlations <2>, <4>, <6> and <8> for single event (bining is the same as in fIntFlowCorrelationsPro and fIntFlowCorrelationsHist):
+ TString intFlowCorrelationsEBEName = "fIntFlowCorrelationsEBE";
+ intFlowCorrelationsEBEName += fAnalysisLabel->Data();
+ fIntFlowCorrelationsEBE = new TH1D(intFlowCorrelationsEBEName.Data(),intFlowCorrelationsEBEName.Data(),4,0,4);
+ // weights for average correlations <2>, <4>, <6> and <8> for single event:
+ TString intFlowEventWeightsForCorrelationsEBEName = "fIntFlowEventWeightsForCorrelationsEBE";
+ intFlowEventWeightsForCorrelationsEBEName += fAnalysisLabel->Data();
+ fIntFlowEventWeightsForCorrelationsEBE = new TH1D(intFlowEventWeightsForCorrelationsEBEName.Data(),intFlowEventWeightsForCorrelationsEBEName.Data(),4,0,4);
+ // average all correlations for single event (bining is the same as in fIntFlowCorrelationsAllPro and fIntFlowCorrelationsAllHist):
+ TString intFlowCorrelationsAllEBEName = "fIntFlowCorrelationsAllEBE";
+ intFlowCorrelationsAllEBEName += fAnalysisLabel->Data();
+ fIntFlowCorrelationsAllEBE = new TH1D(intFlowCorrelationsAllEBEName.Data(),intFlowCorrelationsAllEBEName.Data(),32,0,32);
+ // average correction terms for non-uniform acceptance for single event
+ // (binning is the same as in fIntFlowCorrectionTermsForNUAPro[2] and fIntFlowCorrectionTermsForNUAHist[2]):
+ TString fIntFlowCorrectionTermsForNUAEBEName = "fIntFlowCorrectionTermsForNUAEBE";
+ fIntFlowCorrectionTermsForNUAEBEName += fAnalysisLabel->Data();
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms
+ {
+ fIntFlowCorrectionTermsForNUAEBE[sc] = new TH1D(Form("%s: %s terms",fIntFlowCorrectionTermsForNUAEBEName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4);
+ }
+ // event weights for terms for non-uniform acceptance:
+ TString fIntFlowEventWeightForCorrectionTermsForNUAEBEName = "fIntFlowEventWeightForCorrectionTermsForNUAEBE";
+ fIntFlowEventWeightForCorrectionTermsForNUAEBEName += fAnalysisLabel->Data();
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms
+ {
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc] = new TH1D(Form("%s: %s terms",fIntFlowEventWeightForCorrectionTermsForNUAEBEName.Data(),sinCosFlag[sc].Data()),Form("Event weights for terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4); // to be improved - 4
+ }
+ // c) Book profiles: // to be improved (comment)
+ // profile to hold average multiplicities and number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8:
+ TString avMultiplicityName = "fAvMultiplicity";
+ avMultiplicityName += fAnalysisLabel->Data();
+ fAvMultiplicity = new TProfile(avMultiplicityName.Data(),"Average Multiplicities of RPs",9,0,9);
+ fAvMultiplicity->SetTickLength(-0.01,"Y");
+ fAvMultiplicity->SetMarkerStyle(25);
+ fAvMultiplicity->SetLabelSize(0.05);
+ fAvMultiplicity->SetLabelOffset(0.02,"Y");
+ fAvMultiplicity->SetYTitle("Average Multiplicity");
+ (fAvMultiplicity->GetXaxis())->SetBinLabel(1,"all evts");
+ (fAvMultiplicity->GetXaxis())->SetBinLabel(2,"n_{RP} #geq 1");
+ (fAvMultiplicity->GetXaxis())->SetBinLabel(3,"n_{RP} #geq 2");
+ (fAvMultiplicity->GetXaxis())->SetBinLabel(4,"n_{RP} #geq 3");
+ (fAvMultiplicity->GetXaxis())->SetBinLabel(5,"n_{RP} #geq 4");
+ (fAvMultiplicity->GetXaxis())->SetBinLabel(6,"n_{RP} #geq 5");
+ (fAvMultiplicity->GetXaxis())->SetBinLabel(7,"n_{RP} #geq 6");
+ (fAvMultiplicity->GetXaxis())->SetBinLabel(8,"n_{RP} #geq 7");
+ (fAvMultiplicity->GetXaxis())->SetBinLabel(9,"n_{RP} #geq 8");
+ fIntFlowProfiles->Add(fAvMultiplicity);
+ // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with wrong errors!):
+ TString correlationFlag[4] = {"<<2>>","<<4>>","<<6>>","<<8>>"};
+ TString intFlowCorrelationsProName = "fIntFlowCorrelationsPro";
+ intFlowCorrelationsProName += fAnalysisLabel->Data();
+ fIntFlowCorrelationsPro = new TProfile(intFlowCorrelationsProName.Data(),"Average correlations for all events",4,0,4,"s");
+ fIntFlowCorrelationsPro->SetTickLength(-0.01,"Y");
+ fIntFlowCorrelationsPro->SetMarkerStyle(25);
+ fIntFlowCorrelationsPro->SetLabelSize(0.06);
+ fIntFlowCorrelationsPro->SetLabelOffset(0.01,"Y");
+ for(Int_t b=0;b<4;b++)
+ {
+ (fIntFlowCorrelationsPro->GetXaxis())->SetBinLabel(b+1,correlationFlag[b].Data());
+ }
+ fIntFlowProfiles->Add(fIntFlowCorrelationsPro);
+ // average correlations <<2>>, <<4>>, <<6>> and <<8>> versus multiplicity for all events (with wrong errors):
+ if(fCalculateCumulantsVsM)
+ {
+ for(Int_t ci=0;ci<4;ci++) // correlation index
+ {
+ TString intFlowCorrelationsVsMProName = "fIntFlowCorrelationsVsMPro";
+ intFlowCorrelationsVsMProName += fAnalysisLabel->Data();
+ fIntFlowCorrelationsVsMPro[ci] = new TProfile(Form("%s, %s",intFlowCorrelationsVsMProName.Data(),correlationFlag[ci].Data()),
+ Form("%s vs multiplicity",correlationFlag[ci].Data()),
+ fnBinsMult,fMinMult,fMaxMult,"s");
+ fIntFlowCorrelationsVsMPro[ci]->GetYaxis()->SetTitle(correlationFlag[ci].Data());
+ fIntFlowCorrelationsVsMPro[ci]->GetXaxis()->SetTitle("M");
+ fIntFlowProfiles->Add(fIntFlowCorrelationsVsMPro[ci]);
+ } // end of for(Int_t ci=0;ci<4;ci++) // correlation index
+ } // end of if(fCalculateCumulantsVsM)
+ // averaged all correlations for all events (with wrong errors!):
+ TString intFlowCorrelationsAllProName = "fIntFlowCorrelationsAllPro";
+ intFlowCorrelationsAllProName += fAnalysisLabel->Data();
+ fIntFlowCorrelationsAllPro = new TProfile(intFlowCorrelationsAllProName.Data(),"Average correlations for all events",32,0,32,"s");
+ fIntFlowCorrelationsAllPro->SetTickLength(-0.01,"Y");
+ fIntFlowCorrelationsAllPro->SetMarkerStyle(25);
+ fIntFlowCorrelationsAllPro->SetLabelSize(0.03);
+ fIntFlowCorrelationsAllPro->SetLabelOffset(0.01,"Y");
+ // 2-p correlations:
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(1,"<<2>>_{n|n}");
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(2,"<<2>>_{2n|2n}");
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(3,"<<2>>_{3n|3n}");
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(4,"<<2>>_{4n|4n}");
+ // 3-p correlations:
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(6,"<<3>>_{2n|n,n}");
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}");
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}");
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}");
+ // 4-p correlations:
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}");
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}");
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}");
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}");
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}");
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}");
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}");
+ // 5-p correlations:
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}");
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}");
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}");
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}");
+ // 6-p correlations:
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}");
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}");
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}");
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}");
+ // 7-p correlations:
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}");
+ // 8-p correlations:
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}");
+ fIntFlowProfiles->Add(fIntFlowCorrelationsAllPro);
+ // when particle weights are used some extra correlations appear:
+ if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)
+ {
+ TString intFlowExtraCorrelationsProName = "fIntFlowExtraCorrelationsPro";
+ intFlowExtraCorrelationsProName += fAnalysisLabel->Data();
+ fIntFlowExtraCorrelationsPro = new TProfile(intFlowExtraCorrelationsProName.Data(),"Average extra correlations for all events",100,0,100,"s");
+ fIntFlowExtraCorrelationsPro->SetTickLength(-0.01,"Y");
+ fIntFlowExtraCorrelationsPro->SetMarkerStyle(25);
+ fIntFlowExtraCorrelationsPro->SetLabelSize(0.03);
+ fIntFlowExtraCorrelationsPro->SetLabelOffset(0.01,"Y");
+ // extra 2-p correlations:
+ (fIntFlowExtraCorrelationsPro->GetXaxis())->SetBinLabel(1,"<<w1^3 w2 cos(n*(phi1-phi2))>>");
+ (fIntFlowExtraCorrelationsPro->GetXaxis())->SetBinLabel(2,"<<w1 w2 w3^2 cos(n*(phi1-phi2))>>");
+ fIntFlowProfiles->Add(fIntFlowExtraCorrelationsPro);
+ } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)
+ // average product of correlations <2>, <4>, <6> and <8>:
+ TString productFlag[6] = {"<<2><4>>","<<2><6>>","<<2><8>>","<<4><6>>","<<4><8>>","<<6><8>>"};
+ TString intFlowProductOfCorrelationsProName = "fIntFlowProductOfCorrelationsPro";
+ intFlowProductOfCorrelationsProName += fAnalysisLabel->Data();
+ fIntFlowProductOfCorrelationsPro = new TProfile(intFlowProductOfCorrelationsProName.Data(),"Average products of correlations",6,0,6);
+ fIntFlowProductOfCorrelationsPro->SetTickLength(-0.01,"Y");
+ fIntFlowProductOfCorrelationsPro->SetMarkerStyle(25);
+ fIntFlowProductOfCorrelationsPro->SetLabelSize(0.05);
+ fIntFlowProductOfCorrelationsPro->SetLabelOffset(0.01,"Y");
+ for(Int_t b=0;b<6;b++)
+ {
+ (fIntFlowProductOfCorrelationsPro->GetXaxis())->SetBinLabel(b+1,productFlag[b].Data());
+ }
+ fIntFlowProfiles->Add(fIntFlowProductOfCorrelationsPro);
+ // average product of correlations <2>, <4>, <6> and <8> versus multiplicity
+ // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>]
+ if(fCalculateCumulantsVsM)
+ {
+ TString intFlowProductOfCorrelationsVsMProName = "fIntFlowProductOfCorrelationsVsMPro";
+ intFlowProductOfCorrelationsVsMProName += fAnalysisLabel->Data();
+ for(Int_t pi=0;pi<6;pi++)
+ {
+ fIntFlowProductOfCorrelationsVsMPro[pi] = new TProfile(Form("%s, %s",intFlowProductOfCorrelationsVsMProName.Data(),productFlag[pi].Data()),
+ Form("%s versus multiplicity",productFlag[pi].Data()),
+ fnBinsMult,fMinMult,fMaxMult);
+ fIntFlowProductOfCorrelationsVsMPro[pi]->GetXaxis()->SetTitle("M");
+ fIntFlowProfiles->Add(fIntFlowProductOfCorrelationsVsMPro[pi]);
+ } // end of for(Int_t pi=0;pi<6;pi++)
+ } // end of if(fCalculateCumulantsVsM)
+ // average product of correction terms for NUA:
+ TString intFlowProductOfCorrectionTermsForNUAProName = "fIntFlowProductOfCorrectionTermsForNUAPro";
+ intFlowProductOfCorrectionTermsForNUAProName += fAnalysisLabel->Data();
+ fIntFlowProductOfCorrectionTermsForNUAPro = new TProfile(intFlowProductOfCorrectionTermsForNUAProName.Data(),"Average products of correction terms for NUA",27,0,27);
+ fIntFlowProductOfCorrectionTermsForNUAPro->SetTickLength(-0.01,"Y");
+ fIntFlowProductOfCorrectionTermsForNUAPro->SetMarkerStyle(25);
+ fIntFlowProductOfCorrectionTermsForNUAPro->SetLabelSize(0.05);
+ fIntFlowProductOfCorrectionTermsForNUAPro->SetLabelOffset(0.01,"Y");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(1,"<<2><cos(#phi)>>");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(2,"<<2><sin(#phi)>>");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(3,"<<cos(#phi)><sin(#phi)>>");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(4,"Cov(<2>,<cos(#phi_{1}+#phi_{2})>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(5,"Cov(<2>,<sin(#phi_{1}+#phi_{2})>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(6,"Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(7,"Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(8,"Cov(<4>,<cos(#phi)>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(9,"Cov(<4>,<sin(#phi)>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(10,"Cov(<4>,<cos(#phi_{1}+#phi_{2})>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(11,"Cov(<4>,<sin(#phi_{1}+#phi_{2})>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(12,"Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(13,"Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(14,"Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(15,"Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(16,"Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(17,"Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(18,"Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(19,"Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(20,"Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(21,"Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(22,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(23,"Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(24,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(25,"Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(26,"Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)");
+ (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(27,"Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>)");
+ fIntFlowProfiles->Add(fIntFlowProductOfCorrectionTermsForNUAPro);
+ // average correction terms for non-uniform acceptance (with wrong errors!):
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms
+ {
+ TString intFlowCorrectionTermsForNUAProName = "fIntFlowCorrectionTermsForNUAPro";
+ intFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data();
+ fIntFlowCorrectionTermsForNUAPro[sc] = new TProfile(Form("%s: %s terms",intFlowCorrectionTermsForNUAProName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4,"s");
+ fIntFlowCorrectionTermsForNUAPro[sc]->SetTickLength(-0.01,"Y");
+ fIntFlowCorrectionTermsForNUAPro[sc]->SetMarkerStyle(25);
+ fIntFlowCorrectionTermsForNUAPro[sc]->SetLabelSize(0.03);
+ fIntFlowCorrectionTermsForNUAPro[sc]->SetLabelOffset(0.01,"Y");
+ (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(1,Form("#LT#LT%s(n(phi1))#GT#GT",sinCosFlag[sc].Data()));
+ (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(2,Form("#LT#LT%s(n(phi1+phi2))#GT#GT",sinCosFlag[sc].Data()));
+ (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(3,Form("#LT#LT%s(n(phi1-phi2-phi3))#GT#GT",sinCosFlag[sc].Data()));
+ (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(4,Form("#LT#LT%s(n(2phi1-phi2))#GT#GT",sinCosFlag[sc].Data()));
+ fIntFlowProfiles->Add(fIntFlowCorrectionTermsForNUAPro[sc]);
+ // versus multiplicity:
+ if(fCalculateCumulantsVsM)
+ {
+ TString correctionTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4
+ for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4)
+ {
+ TString intFlowCorrectionTermsForNUAVsMProName = "fIntFlowCorrectionTermsForNUAVsMPro";
+ intFlowCorrectionTermsForNUAVsMProName += fAnalysisLabel->Data();
+ fIntFlowCorrectionTermsForNUAVsMPro[sc][ci] = new TProfile(Form("%s: #LT#LT%s%s#GT#GT",intFlowCorrectionTermsForNUAVsMProName.Data(),sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()),Form("#LT#LT%s%s#GT#GT vs M",sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()),fnBinsMult,fMinMult,fMaxMult,"s");
+ fIntFlowProfiles->Add(fIntFlowCorrectionTermsForNUAVsMPro[sc][ci]);
+ }
+ } // end of if(fCalculateCumulantsVsM)
+ } // end of for(Int_t sc=0;sc<2;sc++)
+
+ // d) Book histograms holding the final results:
+ // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with correct errors!):
+ TString intFlowCorrelationsHistName = "fIntFlowCorrelationsHist";
+ intFlowCorrelationsHistName += fAnalysisLabel->Data();
+ fIntFlowCorrelationsHist = new TH1D(intFlowCorrelationsHistName.Data(),"Average correlations for all events",4,0,4);
+ fIntFlowCorrelationsHist->SetTickLength(-0.01,"Y");
+ fIntFlowCorrelationsHist->SetMarkerStyle(25);
+ fIntFlowCorrelationsHist->SetLabelSize(0.06);
+ fIntFlowCorrelationsHist->SetLabelOffset(0.01,"Y");
+ (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(1,"<<2>>");
+ (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(2,"<<4>>");
+ (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(3,"<<6>>");
+ (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(4,"<<8>>");
+ fIntFlowResults->Add(fIntFlowCorrelationsHist);
+ // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with correct errors!) vs M:
+ if(fCalculateCumulantsVsM)
+ {
+ for(Int_t ci=0;ci<4;ci++) // correlation index
+ {
+ TString intFlowCorrelationsVsMHistName = "fIntFlowCorrelationsVsMHist";
+ intFlowCorrelationsVsMHistName += fAnalysisLabel->Data();
+ fIntFlowCorrelationsVsMHist[ci] = new TH1D(Form("%s, %s",intFlowCorrelationsVsMHistName.Data(),correlationFlag[ci].Data()),
+ Form("%s vs multiplicity",correlationFlag[ci].Data()),
+ fnBinsMult,fMinMult,fMaxMult);
+ fIntFlowCorrelationsVsMHist[ci]->GetYaxis()->SetTitle(correlationFlag[ci].Data());
+ fIntFlowCorrelationsVsMHist[ci]->GetXaxis()->SetTitle("M");
+ fIntFlowResults->Add(fIntFlowCorrelationsVsMHist[ci]);
+ } // end of for(Int_t ci=0;ci<4;ci++) // correlation index
+ } // end of if(fCalculateCumulantsVsM)
+ // average all correlations for all events (with correct errors!):
+ TString intFlowCorrelationsAllHistName = "fIntFlowCorrelationsAllHist";
+ intFlowCorrelationsAllHistName += fAnalysisLabel->Data();
+ fIntFlowCorrelationsAllHist = new TH1D(intFlowCorrelationsAllHistName.Data(),"Average correlations for all events",32,0,32);
+ fIntFlowCorrelationsAllHist->SetTickLength(-0.01,"Y");
+ fIntFlowCorrelationsAllHist->SetMarkerStyle(25);
+ fIntFlowCorrelationsAllHist->SetLabelSize(0.03);
+ fIntFlowCorrelationsAllHist->SetLabelOffset(0.01,"Y");
+ // 2-p correlations:
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(1,"<<2>>_{n|n}");
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(2,"<<2>>_{2n|2n}");
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(3,"<<2>>_{3n|3n}");
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(4,"<<2>>_{4n|4n}");
+ // 3-p correlations:
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(6,"<<3>>_{2n|n,n}");
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}");
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}");
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}");
+ // 4-p correlations:
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}");
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}");
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}");
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}");
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}");
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}");
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}");
+ // 5-p correlations:
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}");
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}");
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}");
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}");
+ // 6-p correlations:
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}");
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}");
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}");
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}");
+ // 7-p correlations:
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}");
+ // 8-p correlations:
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}");
+ fIntFlowResults->Add(fIntFlowCorrelationsAllHist);
+ // average correction terms for non-uniform acceptance (with correct errors!):
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms
+ {
+ TString intFlowCorrectionTermsForNUAHistName = "fIntFlowCorrectionTermsForNUAHist";
+ intFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data();
+ fIntFlowCorrectionTermsForNUAHist[sc] = new TH1D(Form("%s: %s terms",intFlowCorrectionTermsForNUAHistName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4);
+ fIntFlowCorrectionTermsForNUAHist[sc]->SetTickLength(-0.01,"Y");
+ fIntFlowCorrectionTermsForNUAHist[sc]->SetMarkerStyle(25);
+ fIntFlowCorrectionTermsForNUAHist[sc]->SetLabelSize(0.03);
+ fIntFlowCorrectionTermsForNUAHist[sc]->SetLabelOffset(0.01,"Y");
+ (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(1,Form("#LT#LT%s(n(#phi_{1}))#GT#GT",sinCosFlag[sc].Data()));
+ (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(2,Form("#LT#LT%s(n(phi1+phi2))#GT#GT",sinCosFlag[sc].Data()));
+ (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(3,Form("#LT#LT%s(n(phi1-phi2-phi3))#GT#GT",sinCosFlag[sc].Data()));
+ (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(4,Form("#LT#LT%s(n(2phi1-phi2))#GT#GT",sinCosFlag[sc].Data()));
+ fIntFlowResults->Add(fIntFlowCorrectionTermsForNUAHist[sc]);
+ } // end of for(Int_t sc=0;sc<2;sc++)
+ // covariances (multiplied with weight dependent prefactor):
+ TString intFlowCovariancesName = "fIntFlowCovariances";
+ intFlowCovariancesName += fAnalysisLabel->Data();
+ fIntFlowCovariances = new TH1D(intFlowCovariancesName.Data(),"Covariances (multiplied with weight dependent prefactor)",6,0,6);
+ fIntFlowCovariances->SetLabelSize(0.04);
+ fIntFlowCovariances->SetMarkerStyle(25);
+ (fIntFlowCovariances->GetXaxis())->SetBinLabel(1,"Cov(<2>,<4>)");
+ (fIntFlowCovariances->GetXaxis())->SetBinLabel(2,"Cov(<2>,<6>)");
+ (fIntFlowCovariances->GetXaxis())->SetBinLabel(3,"Cov(<2>,<8>)");
+ (fIntFlowCovariances->GetXaxis())->SetBinLabel(4,"Cov(<4>,<6>)");
+ (fIntFlowCovariances->GetXaxis())->SetBinLabel(5,"Cov(<4>,<8>)");
+ (fIntFlowCovariances->GetXaxis())->SetBinLabel(6,"Cov(<6>,<8>)");
+ fIntFlowResults->Add(fIntFlowCovariances);
+ // sum of linear and quadratic event weights for <2>, <4>, <6> and <8>:
+ TString intFlowSumOfEventWeightsName = "fIntFlowSumOfEventWeights";
+ intFlowSumOfEventWeightsName += fAnalysisLabel->Data();
+ for(Int_t power=0;power<2;power++)
+ {
+ fIntFlowSumOfEventWeights[power] = new TH1D(Form("%s: %s",intFlowSumOfEventWeightsName.Data(),powerFlag[power].Data()),Form("Sum of %s event weights for correlations",powerFlag[power].Data()),4,0,4);
+ fIntFlowSumOfEventWeights[power]->SetLabelSize(0.05);
+ fIntFlowSumOfEventWeights[power]->SetMarkerStyle(25);
+ if(power == 0)
+ {
+ (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>}");
+ (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<4>}");
+ (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<6>}");
+ (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{<8>}");
+ } else if (power == 1)
+ {
+ (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>}^{2}");
+ (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<4>}^{2}");
+ (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<6>}^{2}");
+ (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{<8>}^{2}");
+ }
+ fIntFlowResults->Add(fIntFlowSumOfEventWeights[power]);
+ }
+ // sum of products of event weights for correlations <2>, <4>, <6> and <8>:
+ TString intFlowSumOfProductOfEventWeightsName = "fIntFlowSumOfProductOfEventWeights";
+ intFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data();
+ fIntFlowSumOfProductOfEventWeights = new TH1D(intFlowSumOfProductOfEventWeightsName.Data(),"Sum of product of event weights for correlations",6,0,6);
+ fIntFlowSumOfProductOfEventWeights->SetLabelSize(0.05);
+ fIntFlowSumOfProductOfEventWeights->SetMarkerStyle(25);
+ (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>} w_{<4>}");
+ (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<2>} w_{<6>}");
+ (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<2>} w_{<8>}");
+ (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{<4>} w_{<6>}");
+ (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(5,"#sum_{i=1}^{N} w_{<4>} w_{<8>}");
+ (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(6,"#sum_{i=1}^{N} w_{<6>} w_{<8>}");
+ fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeights);
+ // final result for covariances of correlations (multiplied with weight dependent prefactor) versus M
+ // [0=Cov(2,4),1=Cov(2,6),2=Cov(2,8),3=Cov(4,6),4=Cov(4,8),5=Cov(6,8)]:
+ if(fCalculateCumulantsVsM)
+ {
+ TString intFlowCovariancesVsMName = "fIntFlowCovariancesVsM";
+ intFlowCovariancesVsMName += fAnalysisLabel->Data();
+ TString covarianceFlag[6] = {"Cov(<2>,<4>)","Cov(<2>,<6>)","Cov(<2>,<8>)","Cov(<4>,<6>)","Cov(<4>,<8>)","Cov(<6>,<8>)"};
+ for(Int_t ci=0;ci<6;ci++)
+ {
+ fIntFlowCovariancesVsM[ci] = new TH1D(Form("%s, %s",intFlowCovariancesVsMName.Data(),covarianceFlag[ci].Data()),
+ Form("%s vs multiplicity",covarianceFlag[ci].Data()),
+ fnBinsMult,fMinMult,fMaxMult);
+ fIntFlowCovariancesVsM[ci]->GetYaxis()->SetTitle(covarianceFlag[ci].Data());
+ fIntFlowCovariancesVsM[ci]->GetXaxis()->SetTitle("M");
+ fIntFlowResults->Add(fIntFlowCovariancesVsM[ci]);
+ }
+ } // end of if(fCalculateCumulantsVsM)
+ // sum of linear and quadratic event weights for <2>, <4>, <6> and <8> versus multiplicity
+ // [0=sum{w_{<2>}},1=sum{w_{<4>}},2=sum{w_{<6>}},3=sum{w_{<8>}}][0=linear 1,1=quadratic]:
+ if(fCalculateCumulantsVsM)
+ {
+ TString intFlowSumOfEventWeightsVsMName = "fIntFlowSumOfEventWeightsVsM";
+ intFlowSumOfEventWeightsVsMName += fAnalysisLabel->Data();
+ TString sumFlag[2][4] = {{"#sum_{i=1}^{N} w_{<2>}","#sum_{i=1}^{N} w_{<4>}","#sum_{i=1}^{N} w_{<6>}","#sum_{i=1}^{N} w_{<8>}"},
+ {"#sum_{i=1}^{N} w_{<2>}^{2}","#sum_{i=1}^{N} w_{<4>}^{2}","#sum_{i=1}^{N} w_{<6>}^{2}","#sum_{i=1}^{N} w_{<8>}^{2}"}};
+ for(Int_t si=0;si<4;si++)
+ {
+ for(Int_t power=0;power<2;power++)
+ {
+ fIntFlowSumOfEventWeightsVsM[si][power] = new TH1D(Form("%s, %s",intFlowSumOfEventWeightsVsMName.Data(),sumFlag[power][si].Data()),
+ Form("%s vs multiplicity",sumFlag[power][si].Data()),
+ fnBinsMult,fMinMult,fMaxMult);
+ fIntFlowSumOfEventWeightsVsM[si][power]->GetYaxis()->SetTitle(sumFlag[power][si].Data());
+ fIntFlowSumOfEventWeightsVsM[si][power]->GetXaxis()->SetTitle("M");
+ fIntFlowResults->Add(fIntFlowSumOfEventWeightsVsM[si][power]);
+ } // end of for(Int_t power=0;power<2;power++)
+ } // end of for(Int_t si=0;si<4;si++)
+ } // end of if(fCalculateCumulantsVsM)
+ // sum of products of event weights for correlations <2>, <4>, <6> and <8> vs M
+ // [0=sum{w_{<2>}w_{<4>}},1=sum{w_{<2>}w_{<6>}},2=sum{w_{<2>}w_{<8>}},
+ // 3=sum{w_{<4>}w_{<6>}},4=sum{w_{<4>}w_{<8>}},5=sum{w_{<6>}w_{<8>}}]:
+ if(fCalculateCumulantsVsM)
+ {
+ TString intFlowSumOfProductOfEventWeightsVsMName = "fIntFlowSumOfProductOfEventWeightsVsM";
+ intFlowSumOfProductOfEventWeightsVsMName += fAnalysisLabel->Data();
+ TString sopowFlag[6] = {"#sum_{i=1}^{N} w_{<2>} w_{<4>}","#sum_{i=1}^{N} w_{<2>} w_{<6>}","#sum_{i=1}^{N} w_{<2>} w_{<8>}",
+ "#sum_{i=1}^{N} w_{<4>} w_{<6>}","#sum_{i=1}^{N} w_{<4>} w_{<8>}","#sum_{i=1}^{N} w_{<6>} w_{<8>}"};
+ for(Int_t pi=0;pi<6;pi++)
+ {
+ fIntFlowSumOfProductOfEventWeightsVsM[pi] = new TH1D(Form("%s, %s",intFlowSumOfProductOfEventWeightsVsMName.Data(),sopowFlag[pi].Data()),
+ Form("%s versus multiplicity",sopowFlag[pi].Data()),
+ fnBinsMult,fMinMult,fMaxMult);
+ fIntFlowSumOfProductOfEventWeightsVsM[pi]->GetXaxis()->SetTitle("M");
+ fIntFlowSumOfProductOfEventWeightsVsM[pi]->GetYaxis()->SetTitle(sopowFlag[pi].Data());
+ fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeightsVsM[pi]);
+ } // end of for(Int_t pi=0;pi<6;pi++)
+ } // end of if(fCalculateCumulantsVsM)
+ // covariances of NUA terms (multiplied with weight dependent prefactor):
+ TString intFlowCovariancesNUAName = "fIntFlowCovariancesNUA";
+ intFlowCovariancesNUAName += fAnalysisLabel->Data();
+ fIntFlowCovariancesNUA = new TH1D(intFlowCovariancesNUAName.Data(),"Covariances for NUA (multiplied with weight dependent prefactor)",27,0,27);
+ fIntFlowCovariancesNUA->SetLabelSize(0.04);
+ fIntFlowCovariancesNUA->SetMarkerStyle(25);
+ fIntFlowCovariancesNUA->GetXaxis()->SetLabelSize(0.02);
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(1,"Cov(<2>,<cos(#phi)>");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(2,"Cov(<2>,<sin(#phi)>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(3,"Cov(<cos(#phi)>,<sin(#phi)>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(4,"Cov(<2>,<cos(#phi_{1}+#phi_{2})>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(5,"Cov(<2>,<sin(#phi_{1}+#phi_{2})>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(6,"Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(7,"Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(8,"Cov(<4>,<cos(#phi)>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(9,"Cov(<4>,<sin(#phi)>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(10,"Cov(<4>,<cos(#phi_{1}+#phi_{2})>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(11,"Cov(<4>,<sin(#phi_{1}+#phi_{2})>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(12,"Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(13,"Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(14,"Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(15,"Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(16,"Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(17,"Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(18,"Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(19,"Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(20,"Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(21,"Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(22,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(23,"Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(24,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(25,"Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(26,"Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)");
+ (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(27,"Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>)");
+ fIntFlowResults->Add(fIntFlowCovariancesNUA);
+ // sum of linear and quadratic event weights for NUA terms:
+ TString intFlowSumOfEventWeightsNUAName = "fIntFlowSumOfEventWeightsNUA";
+ intFlowSumOfEventWeightsNUAName += fAnalysisLabel->Data();
+ for(Int_t sc=0;sc<2;sc++)
+ {
+ for(Int_t power=0;power<2;power++)
+ {
+ fIntFlowSumOfEventWeightsNUA[sc][power] = new TH1D(Form("%s: %s, %s",intFlowSumOfEventWeightsNUAName.Data(),powerFlag[power].Data(),sinCosFlag[sc].Data()),Form("Sum of %s event weights for NUA %s terms",powerFlag[power].Data(),sinCosFlag[sc].Data()),4,0,4); // to be improved - 4
+ fIntFlowSumOfEventWeightsNUA[sc][power]->SetLabelSize(0.05);
+ fIntFlowSumOfEventWeightsNUA[sc][power]->SetMarkerStyle(25);
+ if(power == 0)
+ {
+ (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(1,Form("#sum_{i=1}^{N} w_{<%s(#phi)>}",sinCosFlag[sc].Data()));
+ (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(2,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}+#phi_{2})>}",sinCosFlag[sc].Data()));
+ (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(3,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}-#phi_{2}-#phi_{3})>}",sinCosFlag[sc].Data()));
+ (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(4,Form("#sum_{i=1}^{N} w_{<%s(2#phi_{1}-#phi_{2})>}",sinCosFlag[sc].Data()));
+ } else if(power == 1)
+ {
+ (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(1,Form("#sum_{i=1}^{N} w_{<%s(#phi)>}^{2}",sinCosFlag[sc].Data()));
+ (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(2,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}+#phi_{2})>}^{2}",sinCosFlag[sc].Data()));
+ (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(3,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}-#phi_{2}-#phi_{3})>}^{2}",sinCosFlag[sc].Data()));
+ (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(4,Form("#sum_{i=1}^{N} w_{<%s(2#phi_{1}-#phi_{2})>}^{2}",sinCosFlag[sc].Data()));
+ }
+ fIntFlowResults->Add(fIntFlowSumOfEventWeightsNUA[sc][power]);
+ }
+ }
+ // sum of products of event weights for NUA terms:
+ TString intFlowSumOfProductOfEventWeightsNUAName = "fIntFlowSumOfProductOfEventWeightsNUA";
+ intFlowSumOfProductOfEventWeightsNUAName += fAnalysisLabel->Data();
+ fIntFlowSumOfProductOfEventWeightsNUA = new TH1D(intFlowSumOfProductOfEventWeightsNUAName.Data(),"Sum of product of event weights for NUA terms",27,0,27);
+ fIntFlowSumOfProductOfEventWeightsNUA->SetLabelSize(0.05);
+ fIntFlowSumOfProductOfEventWeightsNUA->SetMarkerStyle(25);
+ (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>} w_{<cos(#phi)>}");
+ (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<2>} w_{<sin(#phi)>}");
+ (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<cos(#phi)>} w_{<sin(#phi)>}");
+ // ....
+ // to be improved - add labels for remaining bins
+ // ....
+ fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeightsNUA);
+ // Final results for reference Q-cumulants:
+ TString cumulantFlag[4] = {"QC{2}","QC{4}","QC{6}","QC{8}"};
+ TString intFlowQcumulantsName = "fIntFlowQcumulants";
+ intFlowQcumulantsName += fAnalysisLabel->Data();
+ fIntFlowQcumulants = new TH1D(intFlowQcumulantsName.Data(),"Reference Q-cumulants",4,0,4);
+ if(fPropagateErrorAlsoFromNUATerms)
+ {
+ fIntFlowQcumulants->SetTitle("Reference Q-cumulants (error from NUA terms also propagated)");
+ }
+ fIntFlowQcumulants->SetLabelSize(0.05);
+ fIntFlowQcumulants->SetMarkerStyle(25);
+ for(Int_t b=0;b<4;b++)
+ {
+ (fIntFlowQcumulants->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data());
+ }
+ fIntFlowResults->Add(fIntFlowQcumulants);
+ // Final results for reference Q-cumulants rebinned in M:
+ if(fCalculateCumulantsVsM)
+ {
+ TString intFlowQcumulantsRebinnedInMName = "fIntFlowQcumulantsRebinnedInM";
+ intFlowQcumulantsRebinnedInMName += fAnalysisLabel->Data();
+ fIntFlowQcumulantsRebinnedInM = new TH1D(intFlowQcumulantsRebinnedInMName.Data(),"Reference Q-cumulants rebinned in M",4,0,4);
+ fIntFlowQcumulantsRebinnedInM->SetLabelSize(0.05);
+ fIntFlowQcumulantsRebinnedInM->SetMarkerStyle(25);
+ for(Int_t b=0;b<4;b++)
+ {
+ (fIntFlowQcumulantsRebinnedInM->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data());
+ }
+ fIntFlowResults->Add(fIntFlowQcumulantsRebinnedInM);
+ } // end of if(fCalculateCumulantsVsM)
+ // Ratio between error squared: with/without non-isotropic terms:
+ TString intFlowQcumulantsErrorSquaredRatioName = "fIntFlowQcumulantsErrorSquaredRatio";
+ intFlowQcumulantsErrorSquaredRatioName += fAnalysisLabel->Data();
+ fIntFlowQcumulantsErrorSquaredRatio = new TH1D(intFlowQcumulantsErrorSquaredRatioName.Data(),"Error squared of reference Q-cumulants: #frac{with NUA terms}{without NUA terms}",4,0,4);
+ fIntFlowQcumulantsErrorSquaredRatio->SetLabelSize(0.05);
+ fIntFlowQcumulantsErrorSquaredRatio->SetMarkerStyle(25);
+ for(Int_t b=0;b<4;b++)
+ {
+ (fIntFlowQcumulantsErrorSquaredRatio->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data());
+ }
+ fIntFlowResults->Add(fIntFlowQcumulantsErrorSquaredRatio);
+ // final results for integrated Q-cumulants versus multiplicity:
+ if(fCalculateCumulantsVsM)
+ {
+ TString intFlowQcumulantsVsMName = "fIntFlowQcumulantsVsM";
+ intFlowQcumulantsVsMName += fAnalysisLabel->Data();
+ for(Int_t co=0;co<4;co++) // cumulant order
+ {
+ fIntFlowQcumulantsVsM[co] = new TH1D(Form("%s, %s",intFlowQcumulantsVsMName.Data(),cumulantFlag[co].Data()),
+ Form("%s vs multipicity",cumulantFlag[co].Data()),
+ fnBinsMult,fMinMult,fMaxMult);
+ fIntFlowQcumulantsVsM[co]->GetXaxis()->SetTitle("M");
+ fIntFlowQcumulantsVsM[co]->GetYaxis()->SetTitle(cumulantFlag[co].Data());
+ fIntFlowResults->Add(fIntFlowQcumulantsVsM[co]);
+ } // end of for(Int_t co=0;co<4;co++) // cumulant order
+ } // end of if(fCalculateCumulantsVsM)
+ // final integrated flow estimates from Q-cumulants:
+ TString flowFlag[4] = {Form("v_{%d}{2,QC}",fHarmonic),Form("v_{%d}{4,QC}",fHarmonic),Form("v_{%d}{6,QC}",fHarmonic),Form("v_{%d}{8,QC}",fHarmonic)};
+ TString intFlowName = "fIntFlow";
+ intFlowName += fAnalysisLabel->Data();
+ // integrated flow from Q-cumulants:
+ fIntFlow = new TH1D(intFlowName.Data(),"Reference flow estimates from Q-cumulants",4,0,4);
+ fIntFlow->SetLabelSize(0.05);
+ fIntFlow->SetMarkerStyle(25);
+ for(Int_t b=0;b<4;b++)
+ {
+ (fIntFlow->GetXaxis())->SetBinLabel(b+1,flowFlag[b].Data());
+ }
+ fIntFlowResults->Add(fIntFlow);
+ // Reference flow vs M rebinned in one huge bin:
+ if(fCalculateCumulantsVsM)
+ {
+ TString intFlowRebinnedInMName = "fIntFlowRebinnedInM";
+ intFlowRebinnedInMName += fAnalysisLabel->Data();
+ fIntFlowRebinnedInM = new TH1D(intFlowRebinnedInMName.Data(),"Reference flow estimates from Q-cumulants (rebinned in M)",4,0,4);
+ fIntFlowRebinnedInM->SetLabelSize(0.05);
+ fIntFlowRebinnedInM->SetMarkerStyle(25);
+ for(Int_t b=0;b<4;b++)
+ {
+ (fIntFlowRebinnedInM->GetXaxis())->SetBinLabel(b+1,flowFlag[b].Data());
+ }
+ fIntFlowResults->Add(fIntFlowRebinnedInM);
+ }
+ // integrated flow from Q-cumulants: versus multiplicity:
+ if(fCalculateCumulantsVsM)
+ {
+ TString intFlowVsMName = "fIntFlowVsM";
+ intFlowVsMName += fAnalysisLabel->Data();
+ for(Int_t co=0;co<4;co++) // cumulant order
+ {
+ fIntFlowVsM[co] = new TH1D(Form("%s, %s",intFlowVsMName.Data(),flowFlag[co].Data()),
+ Form("%s vs multipicity",flowFlag[co].Data()),
+ fnBinsMult,fMinMult,fMaxMult);
+ fIntFlowVsM[co]->GetXaxis()->SetTitle("M");
+ fIntFlowVsM[co]->GetYaxis()->SetTitle(flowFlag[co].Data());
+ fIntFlowResults->Add(fIntFlowVsM[co]);
+ } // end of for(Int_t co=0;co<4;co++) // cumulant order
+ } // end of if(fCalculateCumulantsVsM)
+ // quantifying detector effects effects to correlations:
+ TString intFlowDetectorBiasName = "fIntFlowDetectorBias";
+ intFlowDetectorBiasName += fAnalysisLabel->Data();
+ fIntFlowDetectorBias = new TH1D(intFlowDetectorBiasName.Data(),"Quantifying detector bias",4,0,4);
+ fIntFlowDetectorBias->SetLabelSize(0.05);
+ fIntFlowDetectorBias->SetMarkerStyle(25);
+ for(Int_t ci=0;ci<4;ci++)
+ {
+ (fIntFlowDetectorBias->GetXaxis())->SetBinLabel(ci+1,Form("#frac{corrected}{measured} %s",cumulantFlag[ci].Data()));
+ }
+ fIntFlowResults->Add(fIntFlowDetectorBias);
+ // quantifying detector effects to correlations versus multiplicity:
+ if(fCalculateCumulantsVsM)
+ {
+ TString intFlowDetectorBiasVsMName = "fIntFlowDetectorBiasVsM";
+ intFlowDetectorBiasVsMName += fAnalysisLabel->Data();
+ for(Int_t ci=0;ci<4;ci++) // correlation index
+ {
+ fIntFlowDetectorBiasVsM[ci] = new TH1D(Form("%s for %s",intFlowDetectorBiasVsMName.Data(),cumulantFlag[ci].Data()),
+ Form("Quantifying detector bias for %s vs multipicity",cumulantFlag[ci].Data()),
+ fnBinsMult,fMinMult,fMaxMult);
+ fIntFlowDetectorBiasVsM[ci]->GetXaxis()->SetTitle("M");
+ fIntFlowDetectorBiasVsM[ci]->GetYaxis()->SetTitle("#frac{corrected}{measured}");
+ if(fApplyCorrectionForNUAVsM){fIntFlowResults->Add(fIntFlowDetectorBiasVsM[ci]);}
+ } // end of for(Int_t co=0;co<4;co++) // cumulant order
+ } // end of if(fCalculateCumulantsVsM)
+
+ /* // to be improved (removed):
+ // final average weighted multi-particle correlations for all events calculated from Q-vectors
+ fQCorrelations[1] = new TProfile("Weighted correlations","final average multi-particle correlations from weighted Q-vectors",200,0,200,"s");
+ fQCorrelations[1]->SetTickLength(-0.01,"Y");
+ fQCorrelations[1]->SetMarkerStyle(25);
+ fQCorrelations[1]->SetLabelSize(0.03);
+ fQCorrelations[1]->SetLabelOffset(0.01,"Y");
+ // 2-particle correlations:
+ (fQCorrelations[1]->GetXaxis())->SetBinLabel(1,"<w_{1}w_{2}cos(n(#phi_{1}-#phi_{2}))>");
+ (fQCorrelations[1]->GetXaxis())->SetBinLabel(2,"<w_{1}^{2}w_{2}^{2}cos(2n(#phi_{1}-#phi_{2}))>");
+ (fQCorrelations[1]->GetXaxis())->SetBinLabel(3,"<w_{1}^{3}w_{2}^{3}cos(3n(#phi_{1}-#phi_{2}))>");
+ (fQCorrelations[1]->GetXaxis())->SetBinLabel(4,"<w_{1}^{4}w_{2}^{4}cos(4n(#phi_{1}-#phi_{2}))>");
+ (fQCorrelations[1]->GetXaxis())->SetBinLabel(5,"<w_{1}^{3}w_{2}cos(n(#phi_{1}-#phi_{2}))>");
+ (fQCorrelations[1]->GetXaxis())->SetBinLabel(6,"<w_{1}^{2}w_{2}w_{3}cos(n(#phi_{1}-#phi_{2}))>");
+ // 3-particle correlations:
+ (fQCorrelations[1]->GetXaxis())->SetBinLabel(21,"<w_{1}w_{2}w_{3}^{2}cos(n(2#phi_{1}-#phi_{2}-#phi_{3}))>");
+ // 4-particle correlations:
+ (fQCorrelations[1]->GetXaxis())->SetBinLabel(41,"<w_{1}w_{2}w_{3}w_{4}cos(n(#phi_{1}+#phi_{2}-#phi_{3}-#phi_{4}))>");
+ // add fQCorrelations[1] to the list fIntFlowList:
+ fIntFlowList->Add(fQCorrelations[1]);
+ */
+
+} // end of AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::InitializeArraysForNestedLoops()
+{
+ // Initialize arrays of all objects relevant for calculations with nested loops.
+
+ // integrated flow:
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms
+ {
+ fIntFlowDirectCorrectionTermsForNUA[sc] = NULL;
+ }
+
+ // differential flow:
+ // correlations:
+ for(Int_t t=0;t<2;t++) // type: RP or POI
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t ci=0;ci<4;ci++) // correlation index
+ {
+ fDiffFlowDirectCorrelations[t][pe][ci] = NULL;
+ } // end of for(Int_t ci=0;ci<4;ci++) // correlation index
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI
+ // correction terms for non-uniform acceptance:
+ for(Int_t t=0;t<2;t++) // type: RP or POI
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms
+ {
+ for(Int_t cti=0;cti<9;cti++) // correction term index
+ {
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = NULL;
+ }
+ }
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI
+
+
+} // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForNestedLoops()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops()
+{
+ // Book all objects relevant for calculations with nested loops.
+
+ TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?)
+ TString typeFlag[2] = {"RP","POI"}; // to be improved (should I promote this to data members?)
+ TString ptEtaFlag[2] = {"p_{T}","#eta"}; // to be improved (should I promote this to data members?)
+ TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; // to be improved (should I promote this to data members?)
+ Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth};
+ Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth};
+
+ TString evaluateNestedLoopsName = "fEvaluateNestedLoops";
+ evaluateNestedLoopsName += fAnalysisLabel->Data();
+ fEvaluateNestedLoops = new TProfile(evaluateNestedLoopsName.Data(),"Flags for nested loops",4,0,4);
+ fEvaluateNestedLoops->SetLabelSize(0.03);
+ (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(1,"fEvaluateIntFlowNestedLoops");
+ (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(2,"fEvaluateDiffFlowNestedLoops");
+ (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(3,"fCrossCheckInPtBinNo");
+ (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(4,"fCrossCheckInEtaBinNo");
+ fEvaluateNestedLoops->Fill(0.5,(Int_t)fEvaluateIntFlowNestedLoops);
+ fEvaluateNestedLoops->Fill(1.5,(Int_t)fEvaluateDiffFlowNestedLoops);
+ fEvaluateNestedLoops->Fill(2.5,fCrossCheckInPtBinNo);
+ fEvaluateNestedLoops->Fill(3.5,fCrossCheckInEtaBinNo);
+ fNestedLoopsList->Add(fEvaluateNestedLoops);
+ // nested loops for integrated flow:
+ if(fEvaluateIntFlowNestedLoops)
+ {
+ // correlations:
+ TString intFlowDirectCorrelationsName = "fIntFlowDirectCorrelations";
+ intFlowDirectCorrelationsName += fAnalysisLabel->Data();
+ fIntFlowDirectCorrelations = new TProfile(intFlowDirectCorrelationsName.Data(),"Multiparticle correlations calculated with nested loops (for int. flow)",32,0,32,"s");
+ fNestedLoopsList->Add(fIntFlowDirectCorrelations);
+ if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)
+ {
+ TString intFlowExtraDirectCorrelationsName = "fIntFlowExtraDirectCorrelations";
+ intFlowExtraDirectCorrelationsName += fAnalysisLabel->Data();
+ fIntFlowExtraDirectCorrelations = new TProfile(intFlowExtraDirectCorrelationsName.Data(),"Extra multiparticle correlations calculated with nested loops (for int. flow)",100,0,100,"s");
+ fNestedLoopsList->Add(fIntFlowExtraDirectCorrelations);
+ } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)
+ // correction terms for non-uniform acceptance:
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms
+ {
+ TString intFlowDirectCorrectionTermsForNUAName = "fIntFlowDirectCorrectionTermsForNUA";
+ intFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data();
+ fIntFlowDirectCorrectionTermsForNUA[sc] = new TProfile(Form("%s: %s terms",intFlowDirectCorrectionTermsForNUAName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),10,0,10,"s");
+ fNestedLoopsList->Add(fIntFlowDirectCorrectionTermsForNUA[sc]);
+ } // end of for(Int_t sc=0;sc<2;sc++)
+ } // end of if(fEvaluateIntFlowNestedLoops)
+
+ // nested loops for differential flow:
+ if(fEvaluateDiffFlowNestedLoops)
+ {
+ // reduced correlations:
+ TString diffFlowDirectCorrelationsName = "fDiffFlowDirectCorrelations";
+ diffFlowDirectCorrelationsName += fAnalysisLabel->Data();
+ for(Int_t t=0;t<2;t++) // type: RP or POI
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t rci=0;rci<4;rci++) // reduced correlation index
+ {
+ // reduced correlations:
+ fDiffFlowDirectCorrelations[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe],"s");
+ fDiffFlowDirectCorrelations[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data());
+ fNestedLoopsList->Add(fDiffFlowDirectCorrelations[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations)
+ } // end of for(Int_t rci=0;rci<4;rci++) // correlation index
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI
+ // correction terms for non-uniform acceptance:
+ TString diffFlowDirectCorrectionTermsForNUAName = "fDiffFlowDirectCorrectionTermsForNUA";
+ diffFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data();
+ for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI)
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t sc=0;sc<2;sc++) // sin or cos
+ {
+ for(Int_t cti=0;cti<9;cti++) // correction term index
+ {
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = new TProfile(Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe],"s");
+ fNestedLoopsList->Add(fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]);
+ }
+ }
+ }
+ }
+ // number of RPs and POIs in selected pt and eta bins for cross-checkings:
+ TString noOfParticlesInBinName = "fNoOfParticlesInBin";
+ fNoOfParticlesInBin = new TH1D(noOfParticlesInBinName.Data(),"Number of RPs and POIs in selected p_{T} and #eta bin",4,0,4);
+ fNoOfParticlesInBin->GetXaxis()->SetBinLabel(1,"# of RPs in p_{T} bin");
+ fNoOfParticlesInBin->GetXaxis()->SetBinLabel(2,"# of RPs in #eta bin");
+ fNoOfParticlesInBin->GetXaxis()->SetBinLabel(3,"# of POIs in p_{T} bin");
+ fNoOfParticlesInBin->GetXaxis()->SetBinLabel(4,"# of POIs in #eta bin");
+ fNestedLoopsList->Add(fNoOfParticlesInBin);
+ } // end of if(fEvaluateDiffFlowNestedLoops)
+
+} // end of AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelations()
+{
+ // calculate all correlations needed for integrated flow
+
+ // multiplicity:
+ Double_t dMult = (*fSMpk)(0,0);
+
+ // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
+ Double_t dReQ1n = (*fReQ)(0,0);
+ Double_t dReQ2n = (*fReQ)(1,0);
+ Double_t dReQ3n = (*fReQ)(2,0);
+ Double_t dReQ4n = (*fReQ)(3,0);
+ Double_t dImQ1n = (*fImQ)(0,0);
+ Double_t dImQ2n = (*fImQ)(1,0);
+ Double_t dImQ3n = (*fImQ)(2,0);
+ Double_t dImQ4n = (*fImQ)(3,0);
+
+ // real and imaginary parts of some expressions involving various combinations of Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
+ // (these expression appear in the Eqs. for the multi-particle correlations bellow)
+
+ // Re[Q_{2n} Q_{n}^* Q_{n}^*]
+ Double_t reQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dReQ2n + 2.*dReQ1n*dImQ1n*dImQ2n - pow(dImQ1n,2.)*dReQ2n;
+
+ // Im[Q_{2n} Q_{n}^* Q_{n}^*]
+ //Double_t imQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dImQ2n-2.*dReQ1n*dImQ1n*dReQ2n-pow(dImQ1n,2.)*dImQ2n;
+
+ // Re[Q_{n} Q_{n} Q_{2n}^*] = Re[Q_{2n} Q_{n}^* Q_{n}^*]
+ Double_t reQ1nQ1nQ2nstar = reQ2nQ1nstarQ1nstar;
+
+ // Re[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*]
+ Double_t reQ3nQ1nQ2nstarQ2nstar = (pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)
+ + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n);
+
+ // Im[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*]
+ //Double_t imQ3nQ1nQ2nstarQ2nstar = calculate and implement this (deleteMe)
+
+ // Re[Q_{2n} Q_{2n} Q_{3n}^* Q_{1n}^*] = Re[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*]
+ Double_t reQ2nQ2nQ3nstarQ1nstar = reQ3nQ1nQ2nstarQ2nstar;
+
+ // Re[Q_{4n} Q_{2n}^* Q_{2n}^*]
+ Double_t reQ4nQ2nstarQ2nstar = pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n;
+
+ // Im[Q_{4n} Q_{2n}^* Q_{2n}^*]
+ //Double_t imQ4nQ2nstarQ2nstar = calculate and implement this (deleteMe)
+
+ // Re[Q_{2n} Q_{2n} Q_{4n}^*] = Re[Q_{4n} Q_{2n}^* Q_{2n}^*]
+ Double_t reQ2nQ2nQ4nstar = reQ4nQ2nstarQ2nstar;
+
+ // Re[Q_{4n} Q_{3n}^* Q_{n}^*]
+ Double_t reQ4nQ3nstarQ1nstar = dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n);
+
+ // Re[Q_{3n} Q_{n} Q_{4n}^*] = Re[Q_{4n} Q_{3n}^* Q_{n}^*]
+ Double_t reQ3nQ1nQ4nstar = reQ4nQ3nstarQ1nstar;
+
+ // Im[Q_{4n} Q_{3n}^* Q_{n}^*]
+ //Double_t imQ4nQ3nstarQ1nstar = calculate and implement this (deleteMe)
+
+ // Re[Q_{3n} Q_{2n}^* Q_{n}^*]
+ Double_t reQ3nQ2nstarQ1nstar = dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n
+ + dImQ3n*dImQ2n*dReQ1n;
+
+ // Re[Q_{2n} Q_{n} Q_{3n}^*] = Re[Q_{3n} Q_{2n}^* Q_{n}^*]
+ Double_t reQ2nQ1nQ3nstar = reQ3nQ2nstarQ1nstar;
+
+ // Im[Q_{3n} Q_{2n}^* Q_{n}^*]
+ //Double_t imQ3nQ2nstarQ1nstar; //calculate and implement this (deleteMe)
+
+ // Re[Q_{3n} Q_{n}^* Q_{n}^* Q_{n}^*]
+ Double_t reQ3nQ1nstarQ1nstarQ1nstar = dReQ3n*pow(dReQ1n,3)-3.*dReQ1n*dReQ3n*pow(dImQ1n,2)
+ + 3.*dImQ1n*dImQ3n*pow(dReQ1n,2)-dImQ3n*pow(dImQ1n,3);
+
+ // Im[Q_{3n} Q_{n}^* Q_{n}^* Q_{n}^*]
+ //Double_t imQ3nQ1nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe)
+
+ // |Q_{2n}|^2 |Q_{n}|^2
+ Double_t dQ2nQ1nQ2nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.));
+
+ // Re[Q_{4n} Q_{2n}^* Q_{n}^* Q_{n}^*]
+ Double_t reQ4nQ2nstarQ1nstarQ1nstar = (dReQ4n*dReQ2n+dImQ4n*dImQ2n)*(pow(dReQ1n,2)-pow(dImQ1n,2))
+ + 2.*dReQ1n*dImQ1n*(dImQ4n*dReQ2n-dReQ4n*dImQ2n);
+
+ // Im[Q_{4n} Q_{2n}^* Q_{n}^* Q_{n}^*]
+ //Double_t imQ4nQ2nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe)
+
+ // Re[Q_{2n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^*]
+ Double_t reQ2nQ1nQ1nstarQ1nstarQ1nstar = (dReQ2n*dReQ1n-dImQ2n*dImQ1n)*(pow(dReQ1n,3)-3.*dReQ1n*pow(dImQ1n,2))
+ + (dReQ2n*dImQ1n+dReQ1n*dImQ2n)*(3.*dImQ1n*pow(dReQ1n,2)-pow(dImQ1n,3));
+
+ // Im[Q_{2n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^*]
+ //Double_t imQ2nQ1nQ1nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe)
+
+ // Re[Q_{2n} Q_{2n} Q_{2n}^* Q_{n}^* Q_{n}^*]
+ Double_t reQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))
+ * (dReQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) + 2.*dImQ2n*dReQ1n*dImQ1n);
+
+ // Im[Q_{2n} Q_{2n} Q_{2n}^* Q_{n}^* Q_{n}^*]
+ //Double_t imQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))
+ // * (dImQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) - 2.*dReQ2n*dReQ1n*dImQ1n);
+
+ // Re[Q_{4n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]
+ Double_t reQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dReQ4n-6.*pow(dReQ1n,2.)*dReQ4n*pow(dImQ1n,2.)
+ + pow(dImQ1n,4.)*dReQ4n+4.*pow(dReQ1n,3.)*dImQ1n*dImQ4n
+ - 4.*pow(dImQ1n,3.)*dReQ1n*dImQ4n;
+
+ // Im[Q_{4n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]
+ //Double_t imQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dImQ4n-6.*pow(dReQ1n,2.)*dImQ4n*pow(dImQ1n,2.)
+ // + pow(dImQ1n,4.)*dImQ4n+4.*pow(dImQ1n,3.)*dReQ1n*dReQ4n
+ // - 4.*pow(dReQ1n,3.)*dImQ1n*dReQ4n;
+
+ // Re[Q_{3n} Q_{n} Q_{2n}^* Q_{n}^* Q_{n}^*]
+ Double_t reQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.))
+ * (dReQ1n*dReQ2n*dReQ3n-dReQ3n*dImQ1n*dImQ2n+dReQ2n*dImQ1n*dImQ3n+dReQ1n*dImQ2n*dImQ3n);
+
+ // Im[Q_{3n} Q_{n} Q_{2n}^* Q_{n}^* Q_{n}^*]
+ //Double_t imQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.))
+ // * (-dReQ2n*dReQ3n*dImQ1n-dReQ1n*dReQ3n*dImQ2n+dReQ1n*dReQ2n*dImQ3n-dImQ1n*dImQ2n*dImQ3n);
+
+
+ // Re[Q_{2n} Q_{2n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]
+ Double_t reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)*dReQ2n-2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.)
+ + dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dImQ2n)
+ * (pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.)
+ - dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n+pow(dImQ1n,2.)*dImQ2n);
+
+ // Im[Q_{2n} Q_{2n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]
+ //Double_t imQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = 2.*(pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.)
+ // + 2.*dReQ1n*dImQ1n*dImQ2n)*(pow(dReQ1n,2.)*dImQ2n
+ // - 2.*dReQ1n*dImQ1n*dReQ2n-pow(dImQ1n,2.)*dImQ2n);
+
+ // Re[Q_{3n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]
+ Double_t reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.))
+ * (pow(dReQ1n,3.)*dReQ3n-3.*dReQ1n*dReQ3n*pow(dImQ1n,2.)
+ + 3.*pow(dReQ1n,2.)*dImQ1n*dImQ3n-pow(dImQ1n,3.)*dImQ3n);
+
+ // Im[Q_{3n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]
+ //Double_t imQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.))
+ // * (pow(dImQ1n,3.)*dReQ3n-3.*dImQ1n*dReQ3n*pow(dReQ1n,2.)
+ // - 3.*pow(dImQ1n,2.)*dReQ1n*dImQ3n+pow(dReQ1n,3.)*dImQ3n);
+
+ // |Q_{2n}|^2 |Q_{n}|^4
+ Double_t dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.);
+
+ // Re[Q_{2n} Q_{n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]
+ Double_t reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)
+ * (pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.)
+ + 2.*dReQ1n*dImQ1n*dImQ2n);
+
+ // Im[Q_{2n} Q_{n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]
+ //Double_t imQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)
+ // * (pow(dReQ1n,2.)*dImQ2n-dImQ2n*pow(dImQ1n,2.)
+ // - 2.*dReQ1n*dReQ2n*dImQ1n);
+
+
+
+
+ // **************************************
+ // **** multi-particle correlations: ****
+ // **************************************
+ //
+ // Remark 1: multi-particle correlations calculated with non-weighted Q-vectors are stored in 1D profile fQCorrelations[0]. // to be improved (wrong profiles)
+ // Remark 2: binning of fQCorrelations[0] is organized as follows: // to be improved (wrong profiles)
+ // --------------------------------------------------------------------------------------------------------------------
+ // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))>
+ // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))>
+ // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))>
+ // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))>
+ // 5th bin: ---- EMPTY ----
+ // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))>
+ // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))>
+ // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))>
+ // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))>
+ // 10th bin: ---- EMPTY ----
+ // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))>
+ // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))>
+ // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))>
+ // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))>
+ // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))>
+ // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))>
+ // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))>
+ // 18th bin: ---- EMPTY ----
+ // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))>
+ // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))>
+ // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))>
+ // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))>
+ // 23rd bin: ---- EMPTY ----
+ // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))>
+ // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))>
+ // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))>
+ // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))>
+ // 28th bin: ---- EMPTY ----
+ // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))>
+ // 30th bin: ---- EMPTY ----
+ // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))>
+ // --------------------------------------------------------------------------------------------------------------------
+
+ // 2-particle:
+ Double_t two1n1n = 0.; // <cos(n*(phi1-phi2))>
+ Double_t two2n2n = 0.; // <cos(2n*(phi1-phi2))>
+ Double_t two3n3n = 0.; // <cos(3n*(phi1-phi2))>
+ Double_t two4n4n = 0.; // <cos(4n*(phi1-phi2))>
+
+ if(dMult>1)
+ {
+ two1n1n = (pow(dReQ1n,2.)+pow(dImQ1n,2.)-dMult)/(dMult*(dMult-1.));
+ two2n2n = (pow(dReQ2n,2.)+pow(dImQ2n,2.)-dMult)/(dMult*(dMult-1.));
+ two3n3n = (pow(dReQ3n,2.)+pow(dImQ3n,2.)-dMult)/(dMult*(dMult-1.));
+ two4n4n = (pow(dReQ4n,2.)+pow(dImQ4n,2.)-dMult)/(dMult*(dMult-1.));
+
+ // average 2-particle correlations for single event:
+ fIntFlowCorrelationsAllEBE->SetBinContent(1,two1n1n);
+ fIntFlowCorrelationsAllEBE->SetBinContent(2,two2n2n);
+ fIntFlowCorrelationsAllEBE->SetBinContent(3,two3n3n);
+ fIntFlowCorrelationsAllEBE->SetBinContent(4,two4n4n);
+
+ // average 2-particle correlations for all events:
+ fIntFlowCorrelationsAllPro->Fill(0.5,two1n1n,dMult*(dMult-1.));
+ fIntFlowCorrelationsAllPro->Fill(1.5,two2n2n,dMult*(dMult-1.));
+ fIntFlowCorrelationsAllPro->Fill(2.5,two3n3n,dMult*(dMult-1.));
+ fIntFlowCorrelationsAllPro->Fill(3.5,two4n4n,dMult*(dMult-1.));
+
+ // store separetately <2> (to be improved: do I really need this?)
+ fIntFlowCorrelationsEBE->SetBinContent(1,two1n1n); // <2>
+
+ // to be improved (this can be implemented better):
+ Double_t mWeight2p = 0.;
+ if(!strcmp(fMultiplicityWeight->Data(),"combinations"))
+ {
+ mWeight2p = dMult*(dMult-1.);
+ } else if(!strcmp(fMultiplicityWeight->Data(),"unit"))
+ {
+ mWeight2p = 1.;
+ } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity"))
+ {
+ mWeight2p = dMult;
+ }
+
+ fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(1,mWeight2p); // eW_<2>
+ fIntFlowCorrelationsPro->Fill(0.5,two1n1n,mWeight2p);
+ if(fCalculateCumulantsVsM){fIntFlowCorrelationsVsMPro[0]->Fill(dMult+0.5,two1n1n,mWeight2p);}
+
+ // distribution of <cos(n*(phi1-phi2))>:
+ //f2pDistribution->Fill(two1n1n,dMult*(dMult-1.));
+ } // end of if(dMult>1)
+
+ // 3-particle:
+ Double_t three2n1n1n = 0.; // <cos(n*(2.*phi1-phi2-phi3))>
+ Double_t three3n2n1n = 0.; // <cos(n*(3.*phi1-2.*phi2-phi3))>
+ Double_t three4n2n2n = 0.; // <cos(n*(4.*phi1-2.*phi2-2.*phi3))>
+ Double_t three4n3n1n = 0.; // <cos(n*(4.*phi1-3.*phi2-phi3))>
+
+ if(dMult>2)
+ {
+ three2n1n1n = (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))
+ - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult)
+ / (dMult*(dMult-1.)*(dMult-2.));
+ three3n2n1n = (reQ3nQ2nstarQ1nstar-(pow(dReQ3n,2.)+pow(dImQ3n,2.))
+ - (pow(dReQ2n,2.)+pow(dImQ2n,2.))
+ - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult)
+ / (dMult*(dMult-1.)*(dMult-2.));
+ three4n2n2n = (reQ4nQ2nstarQ2nstar-2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))
+ - (pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*dMult)
+ / (dMult*(dMult-1.)*(dMult-2.));
+ three4n3n1n = (reQ4nQ3nstarQ1nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.))
+ - (pow(dReQ3n,2.)+pow(dImQ3n,2.))
+ - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult)
+ / (dMult*(dMult-1.)*(dMult-2.));
+
+ // average 3-particle correlations for single event:
+ fIntFlowCorrelationsAllEBE->SetBinContent(6,three2n1n1n);
+ fIntFlowCorrelationsAllEBE->SetBinContent(7,three3n2n1n);
+ fIntFlowCorrelationsAllEBE->SetBinContent(8,three4n2n2n);
+ fIntFlowCorrelationsAllEBE->SetBinContent(9,three4n3n1n);
+
+ // average 3-particle correlations for all events:
+ fIntFlowCorrelationsAllPro->Fill(5.5,three2n1n1n,dMult*(dMult-1.)*(dMult-2.));
+ fIntFlowCorrelationsAllPro->Fill(6.5,three3n2n1n,dMult*(dMult-1.)*(dMult-2.));
+ fIntFlowCorrelationsAllPro->Fill(7.5,three4n2n2n,dMult*(dMult-1.)*(dMult-2.));
+ fIntFlowCorrelationsAllPro->Fill(8.5,three4n3n1n,dMult*(dMult-1.)*(dMult-2.));
+ } // end of if(dMult>2)
+
+ // 4-particle:
+ Double_t four1n1n1n1n = 0.; // <cos(n*(phi1+phi2-phi3-phi4))>
+ Double_t four2n2n2n2n = 0.; // <cos(2.*n*(phi1+phi2-phi3-phi4))>
+ Double_t four2n1n2n1n = 0.; // <cos(n*(2.*phi1+phi2-2.*phi3-phi4))>
+ Double_t four3n1n1n1n = 0.; // <cos(n*(3.*phi1-phi2-phi3-phi4))>
+ Double_t four4n2n1n1n = 0.; // <cos(n*(4.*phi1-2.*phi2-phi3-phi4))>
+ Double_t four3n1n2n2n = 0.; // <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))>
+ Double_t four3n1n3n1n = 0.; // <cos(n*(3.*phi1+phi2-3.*phi3-phi4))>
+
+ if(dMult>3)
+ {
+ four1n1n1n1n = (2.*dMult*(dMult-3.)+pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ1n,2.)
+ + pow(dImQ1n,2.))-2.*reQ2nQ1nstarQ1nstar+(pow(dReQ2n,2.)+pow(dImQ2n,2.)))
+ / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.));
+ four2n2n2n2n = (2.*dMult*(dMult-3.)+pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ2n,2.)
+ + pow(dImQ2n,2.))-2.*reQ4nQ2nstarQ2nstar+(pow(dReQ4n,2.)+pow(dImQ4n,2.)))
+ / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.));
+ four2n1n2n1n = (dQ2nQ1nQ2nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar-2.*reQ2nQ1nstarQ1nstar)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))
+ - ((dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))
+ + (dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-(pow(dReQ3n,2.)+pow(dImQ3n,2.)))
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))
+ + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.));
+ four3n1n1n1n = (reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar-3.*reQ2nQ1nstarQ1nstar)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))
+ + (2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))
+ + 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));
+ four4n2n1n1n = (reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar-2.*reQ3nQ2nstarQ1nstar)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))
+ - (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))
+ - 3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))
+ - 6./((dMult-1.)*(dMult-2.)*(dMult-3.));
+ four3n1n2n2n = (reQ3nQ1nQ2nstarQ2nstar-reQ4nQ2nstarQ2nstar-reQ3nQ1nQ4nstar-2.*reQ3nQ2nstarQ1nstar)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))
+ - (2.*reQ1nQ1nQ2nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))
+ - 4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))
+ - 6./((dMult-1.)*(dMult-2.)*(dMult-3.));
+ four3n1n3n1n = ((pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.))
+ - 2.*reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))
+ + ((pow(dReQ4n,2.)+pow(dImQ4n,2.))-(dMult-4.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))
+ + (pow(dReQ2n,2.)+pow(dImQ2n,2.))-(dMult-4.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))
+ + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.));
+
+ // average 4-particle correlations for single event:
+ fIntFlowCorrelationsAllEBE->SetBinContent(11,four1n1n1n1n);
+ fIntFlowCorrelationsAllEBE->SetBinContent(12,four2n1n2n1n);
+ fIntFlowCorrelationsAllEBE->SetBinContent(13,four2n2n2n2n);
+ fIntFlowCorrelationsAllEBE->SetBinContent(14,four3n1n1n1n);
+ fIntFlowCorrelationsAllEBE->SetBinContent(15,four3n1n3n1n);
+ fIntFlowCorrelationsAllEBE->SetBinContent(16,four3n1n2n2n);
+ fIntFlowCorrelationsAllEBE->SetBinContent(17,four4n2n1n1n);
+
+ // average 4-particle correlations for all events:
+ fIntFlowCorrelationsAllPro->Fill(10.5,four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));
+ fIntFlowCorrelationsAllPro->Fill(11.5,four2n1n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));
+ fIntFlowCorrelationsAllPro->Fill(12.5,four2n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));
+ fIntFlowCorrelationsAllPro->Fill(13.5,four3n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));
+ fIntFlowCorrelationsAllPro->Fill(14.5,four3n1n3n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));
+ fIntFlowCorrelationsAllPro->Fill(15.5,four3n1n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));
+ fIntFlowCorrelationsAllPro->Fill(16.5,four4n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));
+
+ // store separetately <4> (to be improved: do I really need this?)
+ fIntFlowCorrelationsEBE->SetBinContent(2,four1n1n1n1n); // <4>
+
+ // to be improved (this can be implemented better):
+ Double_t mWeight4p = 0.;
+ if(!strcmp(fMultiplicityWeight->Data(),"combinations"))
+ {
+ mWeight4p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.);
+ } else if(!strcmp(fMultiplicityWeight->Data(),"unit"))
+ {
+ mWeight4p = 1.;
+ } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity"))
+ {
+ mWeight4p = dMult;
+ }
+
+ fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(2,mWeight4p); // eW_<4>
+ fIntFlowCorrelationsPro->Fill(1.5,four1n1n1n1n,mWeight4p);
+ if(fCalculateCumulantsVsM){fIntFlowCorrelationsVsMPro[1]->Fill(dMult+0.5,four1n1n1n1n,mWeight4p);}
+
+ // distribution of <cos(n*(phi1+phi2-phi3-phi4))>
+ //f4pDistribution->Fill(four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));
+
+ } // end of if(dMult>3)
+
+ // 5-particle:
+ Double_t five2n1n1n1n1n = 0.; // <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))>
+ Double_t five2n2n2n1n1n = 0.; // <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))>
+ Double_t five3n1n2n1n1n = 0.; // <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))>
+ Double_t five4n1n1n1n1n = 0.; // <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))>
+
+ if(dMult>4)
+ {
+ five2n1n1n1n1n = (reQ2nQ1nQ1nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar+6.*reQ3nQ2nstarQ1nstar)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
+ - (reQ2nQ1nQ3nstar+3.*(dMult-6.)*reQ2nQ1nstarQ1nstar+3.*reQ1nQ1nQ2nstar)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
+ - (2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))
+ + 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.))
+ - 3.*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)))
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
+ - 3.*(pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)
+ - 2.*(2*dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult*(dMult-4.))
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));
+
+ five2n2n2n1n1n = (reQ2nQ2nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ2nQ2nQ3nstarQ1nstar)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
+ + 2.*(reQ4nQ2nstarQ2nstar+4.*reQ3nQ2nstarQ1nstar+reQ3nQ1nQ4nstar)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
+ + (reQ2nQ2nQ4nstar-2.*(dMult-5.)*reQ2nQ1nstarQ1nstar+2.*reQ1nQ1nQ2nstar)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
+ - (2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))
+ + 1.*pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)
+ - 2.*(3.*dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)))
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
+ - (4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.))
+ - 4.*(dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+4.*dMult*(dMult-6.))
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));
+
+ five4n1n1n1n1n = (reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ4nQ2nstarQ1nstarQ1nstar-4.*reQ3nQ1nstarQ1nstarQ1nstar)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
+ + (8.*reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar+12.*reQ3nQ2nstarQ1nstar+12.*reQ2nQ1nstarQ1nstar)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
+ - (6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+8.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))
+ + 12.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+24.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-24.*dMult)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));
+
+ five3n1n2n1n1n = (reQ3nQ1nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
+ - (reQ3nQ1nQ2nstarQ2nstar-3.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
+ - ((2.*dMult-13.)*reQ3nQ2nstarQ1nstar-reQ3nQ1nQ4nstar-9.*reQ2nQ1nstarQ1nstar)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
+ - (2.*reQ1nQ1nQ2nstar+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))
+ - 2.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+2.*(pow(dReQ3n,2.)
+ + pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
+ + (2.*(dMult-6.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))
+ - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.))
+ - pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)
+ + 2.*(3.*dMult-11.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
+ - 4.*(dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));
+
+ // average 5-particle correlations for single event:
+ fIntFlowCorrelationsAllEBE->SetBinContent(19,five2n1n1n1n1n);
+ fIntFlowCorrelationsAllEBE->SetBinContent(20,five2n2n2n1n1n);
+ fIntFlowCorrelationsAllEBE->SetBinContent(21,five3n1n2n1n1n);
+ fIntFlowCorrelationsAllEBE->SetBinContent(22,five4n1n1n1n1n);
+
+ // average 5-particle correlations for all events:
+ fIntFlowCorrelationsAllPro->Fill(18.5,five2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));
+ fIntFlowCorrelationsAllPro->Fill(19.5,five2n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));
+ fIntFlowCorrelationsAllPro->Fill(20.5,five3n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));
+ fIntFlowCorrelationsAllPro->Fill(21.5,five4n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));
+ } // end of if(dMult>4)
+
+ // 6-particle:
+ Double_t six1n1n1n1n1n1n = 0.; // <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))>
+ Double_t six2n2n1n1n1n1n = 0.; // <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))>
+ Double_t six3n1n1n1n1n1n = 0.; // <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))>
+ Double_t six2n1n1n2n1n1n = 0.; // <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))>
+
+ if(dMult>5)
+ {
+ six1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),3.)+9.*dQ2nQ1nQ2nstarQ1nstar-6.*reQ2nQ1nQ1nstarQ1nstarQ1nstar)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.))
+ + 4.*(reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.))
+ + 2.*(9.*(dMult-4.)*reQ2nQ1nstarQ1nstar+2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)))
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.))
+ - 9.*(pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)+(pow(dReQ2n,2.)+pow(dImQ2n,2.)))
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-5.))
+ + (18.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))
+ / (dMult*(dMult-1)*(dMult-3)*(dMult-4))
+ - 6./((dMult-1.)*(dMult-2.)*(dMult-3.));
+
+ six2n1n1n2n1n1n = (dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)
+ * (2.*five2n2n2n1n1n+4.*five2n1n1n1n1n+4.*five3n1n2n1n1n+4.*four2n1n2n1n+1.*four1n1n1n1n)
+ - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four1n1n1n1n+4.*two1n1n
+ + 2.*three2n1n1n+2.*three2n1n1n+4.*four3n1n1n1n+8.*three2n1n1n+2.*four4n2n1n1n
+ + 4.*four2n1n2n1n+2.*two2n2n+8.*four2n1n2n1n+4.*four3n1n3n1n+8.*three3n2n1n
+ + 4.*four3n1n2n2n+4.*four1n1n1n1n+4.*four2n1n2n1n+1.*four2n2n2n2n)
+ - dMult*(dMult-1.)*(dMult-2.)*(2.*three2n1n1n+8.*two1n1n+4.*two1n1n+2.
+ + 4.*two1n1n+4.*three2n1n1n+2.*two2n2n+4.*three2n1n1n+8.*three3n2n1n
+ + 8.*two2n2n+4.*three4n3n1n+4.*two3n3n+4.*three3n2n1n+4.*two1n1n
+ + 8.*three2n1n1n+4.*two1n1n+4.*three3n2n1n+4.*three2n1n1n+2.*two2n2n
+ + 4.*three3n2n1n+2.*three4n2n2n)-dMult*(dMult-1.)
+ * (4.*two1n1n+4.+4.*two1n1n+2.*two2n2n+1.+4.*two1n1n+4.*two2n2n+4.*two3n3n
+ + 1.+2.*two2n2n+1.*two4n4n)-dMult)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed)
+
+ six2n2n1n1n1n1n = (reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)
+ * (five4n1n1n1n1n+8.*five2n1n1n1n1n+6.*five2n2n2n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)
+ * (4.*four3n1n1n1n+6.*four4n2n1n1n+12.*three2n1n1n+12.*four1n1n1n1n+24.*four2n1n2n1n
+ + 4.*four3n1n2n2n+3.*four2n2n2n2n)-dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+12.*three3n2n1n
+ + 4.*three4n3n1n+3.*three4n2n2n+8.*three2n1n1n+24.*two1n1n+12.*two2n2n+12.*three2n1n1n+8.*three3n2n1n
+ + 1.*three4n2n2n)-dMult*(dMult-1.)*(4.*two1n1n+6.*two2n2n+4.*two3n3n+1.*two4n4n+2.*two2n2n+8.*two1n1n+6.)-dMult)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed)
+
+ six3n1n1n1n1n1n = (reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)
+ * (five4n1n1n1n1n+4.*five2n1n1n1n1n+6.*five3n1n2n1n1n+4.*four3n1n1n1n)
+ - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four3n1n1n1n+6.*four4n2n1n1n+6.*four1n1n1n1n
+ + 12.*three2n1n1n+12.*four2n1n2n1n+6.*four3n1n1n1n+12.*three3n2n1n+4.*four3n1n3n1n+3.*four3n1n2n2n)
+ - dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+12.*three3n2n1n+4.*three4n3n1n+3.*three4n2n2n+4.*two1n1n
+ + 12.*two1n1n+6.*three2n1n1n+12.*three2n1n1n+4.*three3n2n1n+12.*two2n2n+4.*three3n2n1n+4.*two3n3n+1.*three4n3n1n
+ + 6.*three3n2n1n)-dMult*(dMult-1.)*(4.*two1n1n+6.*two2n2n+4.*two3n3n+1.*two4n4n+1.*two1n1n+4.+6.*two1n1n+4.*two2n2n
+ + 1.*two3n3n)-dMult)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed)
+
+ // average 6-particle correlations for single event:
+ fIntFlowCorrelationsAllEBE->SetBinContent(24,six1n1n1n1n1n1n);
+ fIntFlowCorrelationsAllEBE->SetBinContent(25,six2n1n1n2n1n1n);
+ fIntFlowCorrelationsAllEBE->SetBinContent(26,six2n2n1n1n1n1n);
+ fIntFlowCorrelationsAllEBE->SetBinContent(27,six3n1n1n1n1n1n);
+
+ // average 6-particle correlations for all events:
+ fIntFlowCorrelationsAllPro->Fill(23.5,six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.));
+ fIntFlowCorrelationsAllPro->Fill(24.5,six2n1n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.));
+ fIntFlowCorrelationsAllPro->Fill(25.5,six2n2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.));
+ fIntFlowCorrelationsAllPro->Fill(26.5,six3n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.));
+
+ // store separetately <6> (to be improved: do I really need this?)
+ fIntFlowCorrelationsEBE->SetBinContent(3,six1n1n1n1n1n1n); // <6>
+
+ // to be improved (this can be implemented better):
+ Double_t mWeight6p = 0.;
+ if(!strcmp(fMultiplicityWeight->Data(),"combinations"))
+ {
+ mWeight6p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.);
+ } else if(!strcmp(fMultiplicityWeight->Data(),"unit"))
+ {
+ mWeight6p = 1.;
+ } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity"))
+ {
+ mWeight6p = dMult;
+ }
+
+ fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(3,mWeight6p); // eW_<6>
+ fIntFlowCorrelationsPro->Fill(2.5,six1n1n1n1n1n1n,mWeight6p);
+ if(fCalculateCumulantsVsM){fIntFlowCorrelationsVsMPro[2]->Fill(dMult+0.5,six1n1n1n1n1n1n,mWeight6p);}
+
+ // distribution of <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))>
+ //f6pDistribution->Fill(six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.));
+ } // end of if(dMult>5)
+
+ // 7-particle:
+ Double_t seven2n1n1n1n1n1n1n = 0.; // <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))>
+
+ if(dMult>6)
+ {
+ seven2n1n1n1n1n1n1n = (reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)
+ * (2.*six3n1n1n1n1n1n+4.*six1n1n1n1n1n1n+1.*six2n2n1n1n1n1n+6.*six2n1n1n2n1n1n+8.*five2n1n1n1n1n)
+ - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(1.*five4n1n1n1n1n +8.*five2n1n1n1n1n+8.*four3n1n1n1n
+ + 12.*five3n1n2n1n1n+4.*five2n1n1n1n1n+3.*five2n2n2n1n1n+6.*five2n2n2n1n1n+6.*four1n1n1n1n+24.*four1n1n1n1n
+ + 12.*five2n1n1n1n1n+12.*five2n1n1n1n1n+12.*three2n1n1n+24.*four2n1n2n1n+4.*five3n1n2n1n1n+4.*five2n1n1n1n1n)
+ - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four3n1n1n1n+6.*four4n2n1n1n+12.*four1n1n1n1n+24.*three2n1n1n
+ + 24.*four2n1n2n1n+12.*four3n1n1n1n+24.*three3n2n1n+8.*four3n1n3n1n+6.*four3n1n2n2n+6.*three2n1n1n+12.*four1n1n1n1n
+ + 12.*four2n1n2n1n+6.*three2n1n1n+12.*four2n1n2n1n+4.*four3n1n2n2n+3.*four2n2n2n2n+4.*four1n1n1n1n+6.*three2n1n1n
+ + 24.*two1n1n+24.*four1n1n1n1n+4.*four3n1n1n1n+24.*two1n1n+24.*three2n1n1n+12.*two2n2n+24.*three2n1n1n+12.*four2n1n2n1n
+ + 8.*three3n2n1n+8.*four2n1n2n1n+1.*four4n2n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+1.*three2n1n1n+8.*two1n1n
+ + 12.*three3n2n1n+24.*two1n1n+12.*three2n1n1n+4.*three2n1n1n+8.*two1n1n+4.*three4n3n1n+24.*three2n1n1n+8.*three3n2n1n
+ + 12.*two1n1n+12.*two1n1n+3.*three4n2n2n+24.*two2n2n+6.*two2n2n+12.+12.*three3n2n1n+8.*two3n3n+12.*three2n1n1n+24.*two1n1n
+ + 4.*three3n2n1n+8.*three3n2n1n+2.*three4n3n1n+12.*two1n1n+8.*three2n1n1n+4.*three2n1n1n+2.*three3n2n1n+6.*two2n2n+8.*two2n2n
+ + 1.*three4n2n2n+4.*three3n2n1n+6.*three2n1n1n)-dMult*(dMult-1.)*(4.*two1n1n+2.*two1n1n+6.*two2n2n+8.+1.*two2n2n+4.*two3n3n
+ + 12.*two1n1n+4.*two1n1n+1.*two4n4n+8.*two2n2n+6.+2.*two3n3n+4.*two1n1n+1.*two2n2n)-dMult)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)); // to be improved (direct formula needed)
+
+ // average 7-particle correlations for single event:
+ fIntFlowCorrelationsAllEBE->SetBinContent(29,seven2n1n1n1n1n1n1n);
+
+ // average 7-particle correlations for all events:
+ fIntFlowCorrelationsAllPro->Fill(28.5,seven2n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.));
+ } // end of if(dMult>6)
+
+ // 8-particle:
+ Double_t eight1n1n1n1n1n1n1n1n = 0.; // <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))>
+ if(dMult>7)
+ {
+ eight1n1n1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),4.)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)
+ * (12.*seven2n1n1n1n1n1n1n+16.*six1n1n1n1n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)
+ * (8.*six3n1n1n1n1n1n+48.*six1n1n1n1n1n1n+6.*six2n2n1n1n1n1n+96.*five2n1n1n1n1n+72.*four1n1n1n1n+36.*six2n1n1n2n1n1n)
+ - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(2.*five4n1n1n1n1n+32.*five2n1n1n1n1n+36.*four1n1n1n1n
+ + 32.*four3n1n1n1n+48.*five2n1n1n1n1n+48.*five3n1n2n1n1n+144.*five2n1n1n1n1n+288.*four1n1n1n1n+36.*five2n2n2n1n1n
+ + 144.*three2n1n1n+96.*two1n1n+144.*four2n1n2n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)
+ * (8.*four3n1n1n1n+48.*four1n1n1n1n+12.*four4n2n1n1n+96.*four2n1n2n1n+96.*three2n1n1n+72.*three2n1n1n+144.*two1n1n
+ + 16.*four3n1n3n1n+48.*four3n1n1n1n+144.*four1n1n1n1n+72.*four1n1n1n1n+96.*three3n2n1n+24.*four3n1n2n2n+144.*four2n1n2n1n
+ + 288.*two1n1n+288.*three2n1n1n+9.*four2n2n2n2n+72.*two2n2n+24.)-dMult*(dMult-1.)*(dMult-2.)*(12.*three2n1n1n+16.*two1n1n
+ + 24.*three3n2n1n+48.*three2n1n1n+96.*two1n1n+8.*three4n3n1n+32.*three3n2n1n+96.*three2n1n1n+144.*two1n1n+6.*three4n2n2n
+ + 96.*two2n2n+36.*two2n2n+72.+48.*three3n2n1n+16.*two3n3n+72.*three2n1n1n+144.*two1n1n)-dMult*(dMult-1.)*(8.*two1n1n
+ + 12.*two2n2n+16.+8.*two3n3n+48.*two1n1n+1.*two4n4n+16.*two2n2n+18.)-dMult)
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); // to be improved (direct formula needed)
+
+ // average 8-particle correlations for single event:
+ fIntFlowCorrelationsAllEBE->SetBinContent(31,eight1n1n1n1n1n1n1n1n);
+
+ // average 8-particle correlations for all events:
+ fIntFlowCorrelationsAllPro->Fill(30.5,eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.));
+
+ // store separetately <8> (to be improved: do I really need this?)
+ fIntFlowCorrelationsEBE->SetBinContent(4,eight1n1n1n1n1n1n1n1n); // <8>
+
+ // to be improved (this can be implemented better):
+ Double_t mWeight8p = 0.;
+ if(!strcmp(fMultiplicityWeight->Data(),"combinations"))
+ {
+ mWeight8p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.);
+ } else if(!strcmp(fMultiplicityWeight->Data(),"unit"))
+ {
+ mWeight8p = 1.;
+ } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity"))
+ {
+ mWeight8p = dMult;
+ }
+
+ fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(4,mWeight8p); // eW_<8>
+ fIntFlowCorrelationsPro->Fill(3.5,eight1n1n1n1n1n1n1n1n,mWeight8p);
+ if(fCalculateCumulantsVsM){fIntFlowCorrelationsVsMPro[3]->Fill(dMult+0.5,eight1n1n1n1n1n1n1n1n,mWeight8p);}
+
+ // distribution of <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))>
+ //f8pDistribution->Fill(eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.));
+ } // end of if(dMult>7)
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelations()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrelations()
+{
+ // Calculate averages of products of correlations for integrated flow.
+
+ // multiplicity:
+ Double_t dMult = (*fSMpk)(0,0);
+
+ Int_t counter = 0;
+
+ for(Int_t ci1=1;ci1<4;ci1++)
+ {
+ for(Int_t ci2=ci1+1;ci2<=4;ci2++)
+ {
+ fIntFlowProductOfCorrelationsPro->Fill(0.5+counter,
+ fIntFlowCorrelationsEBE->GetBinContent(ci1)*
+ fIntFlowCorrelationsEBE->GetBinContent(ci2),
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)*
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2));
+ // products versus multiplicity: // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>]
+ if(fCalculateCumulantsVsM)
+ {
+ fIntFlowProductOfCorrelationsVsMPro[counter]->Fill(dMult+0.5, // to be improved: dMult => sum of weights ?
+ fIntFlowCorrelationsEBE->GetBinContent(ci1)*
+ fIntFlowCorrelationsEBE->GetBinContent(ci2),
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)*
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2));
+ } // end of if(fCalculateCumulantsVsM)
+ counter++;
+ }
+ }
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrelations()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrectionTermsForNUA()
+{
+ // Calculate averages of products of correction terms for NUA.
+
+ // a) Binning of fIntFlowProductOfCorrectionTermsForNUAPro is organized as follows:
+ // 1st bin: <<2><cos(phi)>>
+ // 2nd bin: <<2><sin(phi)>>
+ // 3rd bin: <<cos(phi)><sin(phi)>>
+ // 4th bin: <<2><cos(phi1+phi2)>>
+ // 5th bin: <<2><sin(phi1+phi2)>>
+ // 6th bin: <<2><cos(phi1-phi2-phi3)>>
+ // 7th bin: <<2><sin(phi1-phi2-phi3)>>
+ // 8th bin: <<4><cos(phi1)>>
+ // 9th bin: <<4><sin(phi1)>>
+ // 10th bin: <<4><cos(phi1+phi2)>>
+ // 11th bin: <<4><sin(phi1+phi2)>>
+ // 12th bin: <<4><cos(phi1-phi2-phi3)>>
+ // 13th bin: <<4><sin(phi1-phi2-phi3)>>
+ // 14th bin: <<cos(phi1)><cos(phi1+phi2)>>
+ // 15th bin: <<cos(phi1)><sin(phi1+phi2)>>
+ // 16th bin: <<cos(phi1)><cos(phi1-phi2-phi3)>>
+ // 17th bin: <<cos(phi1)><sin(phi1-phi2-phi3)>>
+ // 18th bin: <<sin(phi1)><cos(phi1+phi2)>>
+ // 19th bin: <<sin(phi1)><sin(phi1+phi2)>>
+ // 20th bin: <<sin(phi1)><cos(phi1-phi2-phi3)>>
+ // 21st bin: <<sin(phi1)><sin(phi1-phi2-phi3)>>
+ // 22nd bin: <<cos(phi1+phi2)><sin(phi1+phi2)>>
+ // 23rd bin: <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>>
+ // 24th bin: <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>>
+ // 25th bin: <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>>
+ // 26th bin: <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>>
+ // 27th bin: <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>>
+
+ // <<2><cos(phi)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(0.5,
+ fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1),
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1));
+ // <<2><sin(phi)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(1.5,
+ fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1),
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1));
+ // <<cos(phi)><sin(phi)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(2.5,
+ fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1),
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1));
+ // <<2><cos(phi1+phi2)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(3.5,
+ fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2),
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2));
+ // <<2><sin(phi1+phi2)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(4.5,
+ fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2),
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2));
+ // <<2><cos(phi1-phi2-phi3)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(5.5,
+ fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3),
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3));
+ // <<2><sin(phi1-phi2-phi3)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(6.5,
+ fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3),
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3));
+ // <<4><cos(phi1)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(7.5,
+ fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1),
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1));
+ // <<4><sin(phi1)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(8.5,
+ fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1),
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1));
+ // <<4><cos(phi1+phi2)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(9.5,
+ fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2),
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2));
+ // <<4><sin(phi1+phi2)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(10.5,
+ fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2),
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2));
+ // <<4><cos(phi1-phi2-phi3)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(11.5,
+ fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3),
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3));
+ // <<4><sin(phi1-phi2-phi3)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(12.5,
+ fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3),
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3));
+ // <<cos(phi1)><cos(phi1+phi2)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(13.5,
+ fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2),
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2));
+ // <<cos(phi1)><sin(phi1+phi2)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(14.5,
+ fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2),
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2));
+ // <<cos(phi1)><cos(phi1-phi2-phi3)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(15.5,
+ fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3),
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3));
+ // <<cos(phi1)><sin(phi1-phi2-phi3)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(16.5,
+ fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3),
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3));
+ // <<sin(phi1)><cos(phi1+phi2)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(17.5,
+ fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2),
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2));
+ // <<sin(phi1)><sin(phi1+phi2)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(18.5,
+ fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2),
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2));
+ // <<sin(phi1)><cos(phi1-phi2-phi3)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(19.5,
+ fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3),
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3));
+ // <<sin(phi1)><sin(phi1-phi2-phi3)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(20.5,
+ fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3),
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3));
+ // <<cos(phi1+phi2)><sin(phi1+phi2)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(21.5,
+ fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2),
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2));
+ // <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(22.5,
+ fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3),
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3));
+ // <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(23.5,
+ fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3),
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3));
+ // <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(24.5,
+ fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3),
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3));
+ // <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(25.5,
+ fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3),
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3));
+ // <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>>:
+ fIntFlowProductOfCorrectionTermsForNUAPro->Fill(26.5,
+ fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3),
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)
+ *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3));
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrectionTermsForNUA()
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::CalculateCovariancesIntFlow()
+{
+ // a) Calculate unbiased estimators Cov(<2>,<4>), Cov(<2>,<6>), Cov(<2>,<8>), Cov(<4>,<6>), Cov(<4>,<8>) and Cov(<6>,<8>)
+ // for covariances V_(<2>,<4>), V_(<2>,<6>), V_(<2>,<8>), V_(<4>,<6>), V_(<4>,<8>) and V_(<6>,<8>).
+ // b) Store in histogram fIntFlowCovariances for instance the following:
+ //
+ // Cov(<2>,<4>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4>}_j)]
+ //
+ // where N is the number of events, w_{<2>} is event weight for <2> and w_{<4>} is event weight for <4>.
+ // c) Binning of fIntFlowCovariances is organized as follows:
+ //
+ // 1st bin: Cov(<2>,<4>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4>}_j)]
+ // 2nd bin: Cov(<2>,<6>) * (sum_{i=1}^{N} w_{<2>}_i w_{<6>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<6>}_j)]
+ // 3rd bin: Cov(<2>,<8>) * (sum_{i=1}^{N} w_{<2>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<8>}_j)]
+ // 4th bin: Cov(<4>,<6>) * (sum_{i=1}^{N} w_{<4>}_i w_{<6>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<6>}_j)]
+ // 5th bin: Cov(<4>,<8>) * (sum_{i=1}^{N} w_{<4>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<8>}_j)]
+ // 6th bin: Cov(<6>,<8>) * (sum_{i=1}^{N} w_{<6>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<6>}_i) * (sum_{j=1}^{N} w_{<8>}_j)]
+ //
+
+ // Average 2-, 4-, 6- and 8-particle correlations for all events:
+ Double_t correlation[4] = {0.};
+ for(Int_t ci=0;ci<4;ci++)
+ {
+ correlation[ci] = fIntFlowCorrelationsPro->GetBinContent(ci+1);
+ }
+ // Average products of 2-, 4-, 6- and 8-particle correlations:
+ Double_t productOfCorrelations[4][4] = {{0.}};
+ Int_t productOfCorrelationsLabel = 1;
+ // Denominators in the expressions for the unbiased estimator for covariance:
+ Double_t denominator[4][4] = {{0.}};
+ Int_t sumOfProductOfEventWeightsLabel1 = 1;
+ // Weight dependent prefactor which multiply unbiased estimators for covariances:
+ Double_t wPrefactor[4][4] = {{0.}};
+ Int_t sumOfProductOfEventWeightsLabel2 = 1;
+ for(Int_t c1=0;c1<4;c1++)
+ {
+ for(Int_t c2=c1+1;c2<4;c2++)
+ {
+ productOfCorrelations[c1][c2] = fIntFlowProductOfCorrelationsPro->GetBinContent(productOfCorrelationsLabel);
+ if(TMath::Abs(fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1)) > 1.e-44 && TMath::Abs(fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)) > 1.e-44)
+ {
+ denominator[c1][c2] = 1.-(fIntFlowSumOfProductOfEventWeights->GetBinContent(sumOfProductOfEventWeightsLabel1))
+ / (fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1)
+ * fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1));
+ wPrefactor[c1][c2] = fIntFlowSumOfProductOfEventWeights->GetBinContent(sumOfProductOfEventWeightsLabel2)
+ / (fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1)
+ * fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1));
+ }
+ productOfCorrelationsLabel++; // to be improved - do I need here all 3 counters?
+ sumOfProductOfEventWeightsLabel1++;
+ sumOfProductOfEventWeightsLabel2++;
+ } // end of for(Int_t c2=c1+1;c2<4;c2++)
+ } // end of for(Int_t c1=0;c1<4;c1++)
+
+ Int_t covarianceLabel = 1;
+ for(Int_t c1=0;c1<4;c1++)
+ {
+ for(Int_t c2=c1+1;c2<4;c2++)
+ {
+ if(TMath::Abs(denominator[c1][c2]) > 1.e-44)
+ {
+ // Covariances:
+ Double_t cov = (productOfCorrelations[c1][c2]-correlation[c1]*correlation[c2])/denominator[c1][c2];
+ // Covariances multiplied with weight dependent prefactor:
+ Double_t wCov = cov * wPrefactor[c1][c2];
+ fIntFlowCovariances->SetBinContent(covarianceLabel,wCov);
+ }
+ covarianceLabel++;
+ } // end of for(Int_t c2=c1+1;c2<4;c2++)
+ } // end of for(Int_t c1=0;c1<4;c1++)
+
+ // Versus multiplicity:
+ if(!fCalculateCumulantsVsM){return;}
+ Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0)
+ for(Int_t b=1;b<=nBins;b++)
+ {
+ // Average 2-, 4-, 6- and 8-particle correlations for all events:
+ Double_t correlationVsM[4] = {0.};
+ for(Int_t ci=0;ci<4;ci++)
+ {
+ correlationVsM[ci] = fIntFlowCorrelationsVsMPro[ci]->GetBinContent(b);
+ } // end of for(Int_t ci=0;ci<4;ci++)
+ // Average products of 2-, 4-, 6- and 8-particle correlations:
+ Double_t productOfCorrelationsVsM[4][4] = {{0.}};
+ Int_t productOfCorrelationsLabelVsM = 1;
+ // Denominators in the expressions for the unbiased estimator for covariance:
+ Double_t denominatorVsM[4][4] = {{0.}};
+ Int_t sumOfProductOfEventWeightsLabel1VsM = 1;
+ // Weight dependent prefactor which multiply unbiased estimators for covariances:
+ Double_t wPrefactorVsM[4][4] = {{0.}};
+ Int_t sumOfProductOfEventWeightsLabel2VsM = 1;
+ for(Int_t c1=0;c1<4;c1++)
+ {
+ for(Int_t c2=c1+1;c2<4;c2++)
+ {
+ productOfCorrelationsVsM[c1][c2] = fIntFlowProductOfCorrelationsVsMPro[productOfCorrelationsLabelVsM-1]->GetBinContent(b);
+ if(TMath::Abs(fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b)) > 1.e-44 && TMath::Abs(fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)) > 1.e-44)
+ {
+ denominatorVsM[c1][c2] = 1.-(fIntFlowSumOfProductOfEventWeightsVsM[sumOfProductOfEventWeightsLabel1VsM-1]->GetBinContent(b))
+ / (fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b)
+ * fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b));
+ wPrefactorVsM[c1][c2] = fIntFlowSumOfProductOfEventWeightsVsM[sumOfProductOfEventWeightsLabel2VsM-1]->GetBinContent(b)
+ / (fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b)
+ * fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b));
+ }
+ productOfCorrelationsLabelVsM++;
+ sumOfProductOfEventWeightsLabel1VsM++;
+ sumOfProductOfEventWeightsLabel2VsM++;
+ } // end of for(Int_t c1=0;c1<4;c1++)
+ } // end of for(Int_t c2=c1+1;c2<4;c2++)
+
+ Int_t covarianceLabelVsM = 1;
+ for(Int_t c1=0;c1<4;c1++)
+ {
+ for(Int_t c2=c1+1;c2<4;c2++)
+ {
+ if(TMath::Abs(denominatorVsM[c1][c2]) > 1.e-44)
+ {
+ // Covariances:
+ Double_t covVsM = (productOfCorrelationsVsM[c1][c2]-correlationVsM[c1]*correlationVsM[c2])/denominatorVsM[c1][c2];
+ // Covariances multiplied with weight dependent prefactor:
+ Double_t wCovVsM = covVsM * wPrefactorVsM[c1][c2];
+ fIntFlowCovariancesVsM[covarianceLabelVsM-1]->SetBinContent(b,wCovVsM);
+ }
+ covarianceLabelVsM++;
+ } // end of for(Int_t c2=c1+1;c2<4;c2++)
+ } // end of for(Int_t c1=0;c1<4;c1++)
+ } // end of for(Int_t b=1;b<=nBins;b++)
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateCovariancesIntFlow()
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::CalculateCovariancesNUAIntFlow()
+{
+ // a) Calculate unbiased estimators Cov(*,*) for true covariances V_(*,*) for NUA terms.
+ // b) Store in histogram fIntFlowCovariancesNUA for instance the following:
+ //
+ // Cov(<2>,<cos(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<cos(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<cos(phi)>}_j)]
+ //
+ // where N is the number of events, w_{<2>} is event weight for <2> and w_{<cos(phi)>} is event weight for <cos(phi)>.
+ // c) Binning of fIntFlowCovariancesNUA is organized as follows:
+ //
+ // 1st bin: Cov(<2>,<cos(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<cos(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<cos(phi)>}_j)]
+ // 2nd bin: Cov(<2>,<sin(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<sin(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<sin(phi)>}_j)]
+ // 3rd bin: Cov(<cos(phi)>,<sin(phi)>) * (sum_{i=1}^{N} w_{<cos(phi)>}_i w_{<sin(phi)>}_i )/[(sum_{i=1}^{N} w_{<cos(phi)>}_i) * (sum_{j=1}^{N} w_{<sin(phi)>}_j)]
+ // ...
+
+ // Cov(<2>,<cos(phi)>):
+ Double_t product1 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(1); // <<2><cos(phi)>>
+ Double_t term1st1 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>>
+ Double_t term2nd1 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi)>>
+ Double_t sumOfW1st1 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>}
+ Double_t sumOfW2nd1 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi)>}
+ Double_t sumOfWW1 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(1); // W_{<2>} * W_{<cos(phi)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator1 = product1 - term1st1*term2nd1;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator1 = 0.;
+ if(TMath::Abs(sumOfW1st1*sumOfW2nd1)>0.)
+ {
+ denominator1 = 1.-sumOfWW1/(sumOfW1st1*sumOfW2nd1);
+ if(TMath::Abs(denominator1)>0.)
+ {
+ // covariance:
+ Double_t covariance1 = numerator1/denominator1;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor1 = sumOfWW1/(sumOfW1st1*sumOfW2nd1);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(1,wPrefactor1*covariance1);
+ } // end of if(TMath::Abs(denominator)>0.)
+ } // end of if(TMath::Abs(sumOfW1st1*sumOfW2nd1)>0.)
+
+ // Cov(<2>,<sin(phi)>):
+ Double_t product2 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(2); // <<2><sin(phi)>>
+ Double_t term1st2 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>>
+ Double_t term2nd2 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi)>>
+ Double_t sumOfW1st2 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>}
+ Double_t sumOfW2nd2 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi)>}
+ Double_t sumOfWW2 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(2); // W_{<2>} * W_{<sin(phi)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator2 = product2 - term1st2*term2nd2;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator2 = 0.;
+ if(TMath::Abs(sumOfW1st2*sumOfW2nd2)>0.)
+ {
+ denominator2 = 1.-sumOfWW2/(sumOfW1st2*sumOfW2nd2);
+ if(TMath::Abs(denominator2)>0.)
+ {
+ // covariance:
+ Double_t covariance2 = numerator2/denominator2;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor2 = sumOfWW2/(sumOfW1st2*sumOfW2nd2);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(2,wPrefactor2*covariance2);
+ } // end of if(TMath::Abs(denominator2)>0.)
+ } // end of if(TMath::Abs(sumOfW1st2*sumOfW2nd2)>0.)
+
+ // Cov(<cos(phi)>,<sin(phi)>):
+ Double_t product3 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(3); // <<cos(phi)><sin(phi)>>
+ Double_t term1st3 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi)>>
+ Double_t term2nd3 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi)>>
+ Double_t sumOfW1st3 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi)>}
+ Double_t sumOfW2nd3 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi)>}
+ Double_t sumOfWW3 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(3); // W_{<cos(phi)>} * W_{<sin(phi)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator3 = product3 - term1st3*term2nd3;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator3 = 0;
+ if(TMath::Abs(sumOfW1st3*sumOfW2nd3)>0.)
+ {
+ denominator3 = 1.-sumOfWW3/(sumOfW1st3*sumOfW2nd3);
+ if(TMath::Abs(denominator3)>0.)
+ {
+ // covariance:
+ Double_t covariance3 = numerator3/denominator3;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor3 = sumOfWW3/(sumOfW1st3*sumOfW2nd3);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(3,wPrefactor3*covariance3);
+ } // end of if(TMath::Abs(denominator3)>0.)
+ } // end of if(TMath::Abs(sumOfW1st3*sumOfW2nd3)>0.)
+
+ // Cov(<2>,<cos(phi1+phi2)>):
+ Double_t product4 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(4); // <<2><cos(phi1+phi2)>>
+ Double_t term1st4 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>>
+ Double_t term2nd4 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>>
+ Double_t sumOfW1st4 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>}
+ Double_t sumOfW2nd4 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>}
+ Double_t sumOfWW4 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(4); // W_{<2>} * W_{<cos(phi1+phi2)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator4 = product4 - term1st4*term2nd4;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator4 = 0.;
+ if(TMath::Abs(sumOfW1st4*sumOfW2nd4)>0.)
+ {
+ denominator4 = 1.-sumOfWW4/(sumOfW1st4*sumOfW2nd4);
+ if(TMath::Abs(denominator4)>0.)
+ {
+ // covariance:
+ Double_t covariance4 = numerator4/denominator4;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor4 = sumOfWW4/(sumOfW1st4*sumOfW2nd4);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(4,wPrefactor4*covariance4);
+ } // end of if(TMath::Abs(denominator4)>0.)
+ } // end of if(TMath::Abs(sumOfW1st4*sumOfW2nd4)>0.)
+
+ // Cov(<2>,<sin(phi1+phi2)>):
+ Double_t product5 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(5); // <<2><sin(phi1+phi2)>>
+ Double_t term1st5 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>>
+ Double_t term2nd5 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>>
+ Double_t sumOfW1st5 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>}
+ Double_t sumOfW2nd5 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>}
+ Double_t sumOfWW5 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(5); // W_{<2>} * W_{<sin(phi1+phi2)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator5 = product5 - term1st5*term2nd5;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator5 = 0.;
+ if(TMath::Abs(sumOfW1st5*sumOfW2nd5)>0.)
+ {
+ denominator5 = 1.-sumOfWW5/(sumOfW1st5*sumOfW2nd5);
+ if(TMath::Abs(denominator5)>0.)
+ {
+ // covariance:
+ Double_t covariance5 = numerator5/denominator5;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor5 = sumOfWW5/(sumOfW1st5*sumOfW2nd5);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(5,wPrefactor5*covariance5);
+ } // end of if(TMath::Abs(denominator5)>0.)
+ } // end of if(TMath::Abs(sumOfW1st5*sumOfW2nd5)>0.)
+
+ // Cov(<2>,<cos(phi1-phi2-phi3)>):
+ Double_t product6 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(6); // <<2><cos(phi1-phi2-phi3)>>
+ Double_t term1st6 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>>
+ Double_t term2nd6 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>>
+ Double_t sumOfW1st6 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>}
+ Double_t sumOfW2nd6 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>}
+ Double_t sumOfWW6 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(6); // W_{<2>} * W_{<cos(phi1-phi2-phi3)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator6 = product6 - term1st6*term2nd6;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator6 = 0.;
+ if(TMath::Abs(sumOfW1st6*sumOfW2nd6)>0.)
+ {
+ denominator6 = 1.-sumOfWW6/(sumOfW1st6*sumOfW2nd6);
+ if(TMath::Abs(denominator6)>0.)
+ {
+ // covariance:
+ Double_t covariance6 = numerator6/denominator6;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor6 = sumOfWW6/(sumOfW1st6*sumOfW2nd6);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(6,wPrefactor6*covariance6);
+ } // end of if(TMath::Abs(denominator6)>0.)
+ } // end of if(TMath::Abs(sumOfW1st6*sumOfW2nd6)>0.)
+
+ // Cov(<2>,<sin(phi1-phi2-phi3)>):
+ Double_t product7 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(7); // <<2><sin(phi1-phi2-phi3)>>
+ Double_t term1st7 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>>
+ Double_t term2nd7 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>>
+ Double_t sumOfW1st7 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>}
+ Double_t sumOfW2nd7 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>}
+ Double_t sumOfWW7 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(7); // W_{<2>} * W_{<sin(phi1-phi2-phi3)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator7 = product7 - term1st7*term2nd7;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator7 = 0.;
+ if(TMath::Abs(sumOfW1st7*sumOfW2nd7)>0.)
+ {
+ denominator7 = 1.-sumOfWW7/(sumOfW1st7*sumOfW2nd7);
+ if(TMath::Abs(denominator7)>0.)
+ {
+ // covariance:
+ Double_t covariance7 = numerator7/denominator7;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor7 = sumOfWW7/(sumOfW1st7*sumOfW2nd7);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(7,wPrefactor7*covariance7);
+ } // end of if(TMath::Abs(denominator7)>0.)
+ } // end of if(TMath::Abs(sumOfW1st7*sumOfW2nd7)>0.)
+
+ // Cov(<4>,<cos(phi1>):
+ Double_t product8 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(8); // <<4><cos(phi1)>>
+ Double_t term1st8 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>>
+ Double_t term2nd8 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>>
+ Double_t sumOfW1st8 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>}
+ Double_t sumOfW2nd8 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>}
+ Double_t sumOfWW8 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(8); // W_{<4>} * W_{<cos(phi1)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator8 = product8 - term1st8*term2nd8;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator8 = 0.;
+ if(TMath::Abs(sumOfW1st8*sumOfW2nd8)>0.)
+ {
+ denominator8 = 1.-sumOfWW8/(sumOfW1st8*sumOfW2nd8);
+ if(TMath::Abs(denominator8)>0.)
+ {
+ // covariance:
+ Double_t covariance8 = numerator8/denominator8;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor8 = sumOfWW8/(sumOfW1st8*sumOfW2nd8);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(8,wPrefactor8*covariance8);
+ } // end of if(TMath::Abs(denominator8)>0.)
+ } // end of if(TMath::Abs(sumOfW1st8*sumOfW2nd8)>0.)
+
+ // Cov(<4>,<sin(phi1)>):
+ Double_t product9 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(9); // <<4><sin(phi1)>>
+ Double_t term1st9 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>>
+ Double_t term2nd9 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>>
+ Double_t sumOfW1st9 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>}
+ Double_t sumOfW2nd9 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>}
+ Double_t sumOfWW9 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(9); // W_{<4>} * W_{<sin(phi1)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator9 = product9 - term1st9*term2nd9;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator9 = 0.;
+ if(TMath::Abs(sumOfW1st9*sumOfW2nd9)>0.)
+ {
+ denominator9 = 1.-sumOfWW9/(sumOfW1st9*sumOfW2nd9);
+ if(TMath::Abs(denominator9)>0.)
+ {
+ // covariance:
+ Double_t covariance9 = numerator9/denominator9;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor9 = sumOfWW9/(sumOfW1st9*sumOfW2nd9);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(9,wPrefactor9*covariance9);
+ }
+ } // end of if(TMath::Abs(sumOfW1st9*sumOfW2nd9)>0.)
+
+ // Cov(<4>,<cos(phi1+phi2)>):
+ Double_t product10 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(10); // <<4><cos(phi1+phi2)>>
+ Double_t term1st10 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>>
+ Double_t term2nd10 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>>
+ Double_t sumOfW1st10 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>}
+ Double_t sumOfW2nd10 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>}
+ Double_t sumOfWW10 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(10); // W_{<4>} * W_{<cos(phi1+phi2)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator10 = product10 - term1st10*term2nd10;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator10 = 0.;
+ if(TMath::Abs(sumOfW1st10*sumOfW2nd10)>0.)
+ {
+ denominator10 = 1.-sumOfWW10/(sumOfW1st10*sumOfW2nd10);
+ if(TMath::Abs(denominator10)>0.)
+ {
+ // covariance:
+ Double_t covariance10 = numerator10/denominator10;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor10 = sumOfWW10/(sumOfW1st10*sumOfW2nd10);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(10,wPrefactor10*covariance10);
+ } // end of if(TMath::Abs(denominator10)>0.)
+ } // end of if(TMath::Abs(sumOfW1st10*sumOfW2nd10)>0.)
+
+ // Cov(<4>,<sin(phi1+phi2)>):
+ Double_t product11 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(11); // <<4><sin(phi1+phi2)>>
+ Double_t term1st11 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>>
+ Double_t term2nd11 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>>
+ Double_t sumOfW1st11 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>}
+ Double_t sumOfW2nd11 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>}
+ Double_t sumOfWW11 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(11); // W_{<4>} * W_{<sin(phi1+phi2)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator11 = product11 - term1st11*term2nd11;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator11 = 0.;
+ if(TMath::Abs(sumOfW1st11*sumOfW2nd11)>0.)
+ {
+ denominator11 = 1.-sumOfWW11/(sumOfW1st11*sumOfW2nd11);
+ if(TMath::Abs(denominator11)>0.)
+ {
+ // covariance:
+ Double_t covariance11 = numerator11/denominator11;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor11 = sumOfWW11/(sumOfW1st11*sumOfW2nd11);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(11,wPrefactor11*covariance11);
+ } // end of if(TMath::Abs(denominator11)>0.)
+ } // end of if(TMath::Abs(sumOfW1st11*sumOfW2nd11)>0.)
+
+ // Cov(<4>,<cos(phi1-phi2-phi3)>):
+ Double_t product12 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(12); // <<4><cos(phi1-phi2-phi3)>>
+ Double_t term1st12 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>>
+ Double_t term2nd12 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>>
+ Double_t sumOfW1st12 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>}
+ Double_t sumOfW2nd12 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>}
+ Double_t sumOfWW12 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(12); // W_{<4>} * W_{<cos(phi1-phi2-phi3)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator12 = product12 - term1st12*term2nd12;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator12 = 0.;
+ if(TMath::Abs(sumOfW1st12*sumOfW2nd12)>0.)
+ {
+ denominator12 = 1.-sumOfWW12/(sumOfW1st12*sumOfW2nd12);
+ if(TMath::Abs(denominator12)>0.)
+ {
+ // covariance:
+ Double_t covariance12 = numerator12/denominator12;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor12 = sumOfWW12/(sumOfW1st12*sumOfW2nd12);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(12,wPrefactor12*covariance12);
+ } // end of if(TMath::Abs(denominator12)>0.)
+ } // end of if(TMath::Abs(sumOfW1st12*sumOfW2nd12)>0.)
+
+ // Cov(<4>,<sin(phi1-phi2-phi3)>):
+ Double_t product13 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(13); // <<4><sin(phi1-phi2-phi3)>>
+ Double_t term1st13 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>>
+ Double_t term2nd13 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>>
+ Double_t sumOfW1st13 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>}
+ Double_t sumOfW2nd13 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>}
+ Double_t sumOfWW13 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(13); // W_{<4>} * W_{<sin(phi1-phi2-phi3)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator13 = product13 - term1st13*term2nd13;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator13 = 0.;
+ if(TMath::Abs(sumOfW1st13*sumOfW2nd13)>0.)
+ {
+ denominator13 = 1.-sumOfWW13/(sumOfW1st13*sumOfW2nd13);
+ if(TMath::Abs(denominator13)>0.)
+ {
+ // covariance:
+ Double_t covariance13 = numerator13/denominator13;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor13 = sumOfWW13/(sumOfW1st13*sumOfW2nd13);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(13,wPrefactor13*covariance13);
+ } // end of if(TMath::Abs(denominator13)>0.)
+ } // end of if(TMath::Abs(sumOfW1st13*sumOfW2nd13)>0.)
+
+ // Cov(<cos(phi1)>,<cos(phi1+phi2)>):
+ Double_t product14 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(14); // <<cos(phi1)><cos(phi1+phi2)>>
+ Double_t term1st14 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>>
+ Double_t term2nd14 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>>
+ Double_t sumOfW1st14 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>}
+ Double_t sumOfW2nd14 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>}
+ Double_t sumOfWW14 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(14); // W_{<cos(phi1)>} * W_{<cos(phi1+phi2)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator14 = product14 - term1st14*term2nd14;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator14 = 0.;
+ if(TMath::Abs(sumOfW1st14*sumOfW2nd14)>0.)
+ {
+ denominator14 = 1.-sumOfWW14/(sumOfW1st14*sumOfW2nd14);
+ if(TMath::Abs(denominator14)>0.)
+ {
+ // covariance:
+ Double_t covariance14 = numerator14/denominator14;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor14 = sumOfWW14/(sumOfW1st14*sumOfW2nd14);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(14,wPrefactor14*covariance14);
+ } // end of if(TMath::Abs(denominator14)>0.)
+ } // end of if(TMath::Abs(sumOfW1st14*sumOfW2nd14)>0.)
+
+ // Cov(<cos(phi1)>,<sin(phi1+phi2)>):
+ Double_t product15 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(15); // <<cos(phi1)><sin(phi1+phi2)>>
+ Double_t term1st15 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>>
+ Double_t term2nd15 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>>
+ Double_t sumOfW1st15 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>}
+ Double_t sumOfW2nd15 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>}
+ Double_t sumOfWW15 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(15); // W_{<cos(phi1)>} * W_{<sin(phi1+phi2)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator15 = product15 - term1st15*term2nd15;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator15 = 0.;
+ if(TMath::Abs(sumOfW1st15*sumOfW2nd15)>0.)
+ {
+ denominator15 = 1.-sumOfWW15/(sumOfW1st15*sumOfW2nd15);
+ if(TMath::Abs(denominator15)>0.)
+ {
+ // covariance:
+ Double_t covariance15 = numerator15/denominator15;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor15 = sumOfWW15/(sumOfW1st15*sumOfW2nd15);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(15,wPrefactor15*covariance15);
+ } // end of if(TMath::Abs(denominator15)>0.)
+ } // end of if(TMath::Abs(sumOfW1st15*sumOfW2nd15)>0.)
+
+ // Cov(<cos(phi1)>,<cos(phi1-phi2-phi3)>):
+ Double_t product16 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(16); // <<cos(phi1)><cos(phi1-phi2-phi3)>>
+ Double_t term1st16 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>>
+ Double_t term2nd16 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>>
+ Double_t sumOfW1st16 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>}
+ Double_t sumOfW2nd16 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>}
+ Double_t sumOfWW16 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(16); // W_{<cos(phi1)>} * W_{<cos(phi1-phi2-phi3)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator16 = product16 - term1st16*term2nd16;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator16 = 0.;
+ if(TMath::Abs(sumOfW1st16*sumOfW2nd16)>0.)
+ {
+ denominator16 = 1.-sumOfWW16/(sumOfW1st16*sumOfW2nd16);
+ if(TMath::Abs(denominator16)>0.)
+ {
+ // covariance:
+ Double_t covariance16 = numerator16/denominator16;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor16 = sumOfWW16/(sumOfW1st16*sumOfW2nd16);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(16,wPrefactor16*covariance16);
+ } // end of if(TMath::Abs(denominator16)>0.)
+ } // end ofif(TMath::Abs(sumOfW1st16*sumOfW2nd16)>0.)
+
+ // Cov(<cos(phi1)>,<sin(phi1-phi2-phi3)>):
+ Double_t product17 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(17); // <<cos(phi1)><sin(phi1-phi2-phi3)>>
+ Double_t term1st17 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>>
+ Double_t term2nd17 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>>
+ Double_t sumOfW1st17 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>}
+ Double_t sumOfW2nd17 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>}
+ Double_t sumOfWW17 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(17); // W_{<cos(phi1)>} * W_{<sin(phi1-phi2-phi3)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator17 = product17 - term1st17*term2nd17;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator17 = 0.;
+ if(TMath::Abs(sumOfW1st17*sumOfW2nd17)>0.)
+ {
+ denominator17 = 1.-sumOfWW17/(sumOfW1st17*sumOfW2nd17);
+ if(TMath::Abs(denominator17)>0.)
+ {
+ // covariance:
+ Double_t covariance17 = numerator17/denominator17;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor17 = sumOfWW17/(sumOfW1st17*sumOfW2nd17);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(17,wPrefactor17*covariance17);
+ } // end of if(TMath::Abs(denominator17)>0.)
+ } // end of if(TMath::Abs(sumOfW1st17*sumOfW2nd17)>0.)
+
+ // Cov(<sin(phi1)>,<cos(phi1+phi2)>):
+ Double_t product18 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(18); // <<sin(phi1)><cos(phi1+phi2)>>
+ Double_t term1st18 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>>
+ Double_t term2nd18 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>>
+ Double_t sumOfW1st18 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>}
+ Double_t sumOfW2nd18 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>}
+ Double_t sumOfWW18 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(18); // W_{<sin(phi1)>} * W_{<cos(phi1+phi2)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator18 = product18 - term1st18*term2nd18;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator18 = 0.;
+ if(TMath::Abs(sumOfW1st18*sumOfW2nd18)>0.)
+ {
+ denominator18 = 1.-sumOfWW18/(sumOfW1st18*sumOfW2nd18);
+ if(TMath::Abs(denominator18)>0.)
+ {
+ // covariance:
+ Double_t covariance18 = numerator18/denominator18;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor18 = sumOfWW18/(sumOfW1st18*sumOfW2nd18);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(18,wPrefactor18*covariance18);
+ } // end of if(TMath::Abs(denominator18)>0.)
+ } // end of if(TMath::Abs(sumOfW1st18*sumOfW2nd18)>0.)
+
+ // Cov(<sin(phi1)>,<sin(phi1+phi2)>):
+ Double_t product19 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(19); // <<sin(phi1)><sin(phi1+phi2)>>
+ Double_t term1st19 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>>
+ Double_t term2nd19 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>>
+ Double_t sumOfW1st19 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>}
+ Double_t sumOfW2nd19 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>}
+ Double_t sumOfWW19 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(19); // W_{<sin(phi1)>} * W_{<sin(phi1+phi2)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator19 = product19 - term1st19*term2nd19;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator19 = 0.;
+ if(TMath::Abs(sumOfW1st19*sumOfW2nd19)>0.)
+ {
+ denominator19 = 1.-sumOfWW19/(sumOfW1st19*sumOfW2nd19);
+ if(TMath::Abs(denominator19)>0.)
+ {
+ // covariance:
+ Double_t covariance19 = numerator19/denominator19;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor19 = sumOfWW19/(sumOfW1st19*sumOfW2nd19);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(19,wPrefactor19*covariance19);
+ } // end of if(TMath::Abs(denominator19)>0.)
+ } // end of if(TMath::Abs(sumOfW1st19*sumOfW2nd19)>0.)
+
+ // Cov(<sin(phi1)>,<cos(phi1-phi2-phi3)>):
+ Double_t product20 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(20); // <<sin(phi1)><cos(phi1-phi2-phi3)>>
+ Double_t term1st20 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>>
+ Double_t term2nd20 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>>
+ Double_t sumOfW1st20 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>}
+ Double_t sumOfW2nd20 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>}
+ Double_t sumOfWW20 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(20); // W_{<sin(phi1)>} * W_{<cos(phi1-phi2-phi3)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator20 = product20 - term1st20*term2nd20;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator20 = 0.;
+ if(TMath::Abs(sumOfW1st20*sumOfW2nd20)>0.)
+ {
+ denominator20 = 1.-sumOfWW20/(sumOfW1st20*sumOfW2nd20);
+ if(TMath::Abs(denominator20)>0.)
+ {
+ // covariance:
+ Double_t covariance20 = numerator20/denominator20;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor20 = sumOfWW20/(sumOfW1st20*sumOfW2nd20);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(20,wPrefactor20*covariance20);
+ } // end of if(TMath::Abs(denominator20)>0.)
+ } // end of if(TMath::Abs(sumOfW1st20*sumOfW2nd20)>0.)
+
+ // Cov(<sin(phi1)>,<sin(phi1-phi2-phi3)>):
+ Double_t product21 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(21); // <<sin(phi1)><sin(phi1-phi2-phi3)>>
+ Double_t term1st21 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>>
+ Double_t term2nd21 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>>
+ Double_t sumOfW1st21 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>}
+ Double_t sumOfW2nd21 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>}
+ Double_t sumOfWW21 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(21); // W_{<sin(phi1)>} * W_{<sin(phi1-phi2-phi3)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator21 = product21 - term1st21*term2nd21;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator21 = 0.;
+ if(TMath::Abs(sumOfW1st21*sumOfW2nd21)>0.)
+ {
+ denominator21 = 1.-sumOfWW21/(sumOfW1st21*sumOfW2nd21);
+ if(TMath::Abs(denominator21)>0.)
+ {
+ // covariance:
+ Double_t covariance21 = numerator21/denominator21;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor21 = sumOfWW21/(sumOfW1st21*sumOfW2nd21);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(21,wPrefactor21*covariance21);
+ } // end of if(TMath::Abs(denominator21)>0.)
+ } // end of if(TMath::Abs(sumOfW1st21*sumOfW2nd21)>0.)
+
+ // Cov(<cos(phi1+phi2)>,<sin(phi1+phi2)>):
+ Double_t product22 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(22); // <<cos(phi1+phi2)><sin(phi1+phi2)>>
+ Double_t term1st22 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>>
+ Double_t term2nd22 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>>
+ Double_t sumOfW1st22 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>}
+ Double_t sumOfW2nd22 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>}
+ Double_t sumOfWW22 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(22); // W_{<cos(phi1+phi2)>} * W_{<sin(phi1+phi2)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator22 = product22 - term1st22*term2nd22;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator22 = 0.;
+ if(TMath::Abs(sumOfW1st22*sumOfW2nd22)>0.)
+ {
+ denominator22 = 1.-sumOfWW22/(sumOfW1st22*sumOfW2nd22);
+ if(TMath::Abs(denominator22)>0.)
+ {
+ // covariance:
+ Double_t covariance22 = numerator22/denominator22;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor22 = sumOfWW22/(sumOfW1st22*sumOfW2nd22);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(22,wPrefactor22*covariance22);
+ } // end of if(TMath::Abs(denominator22)>0.)
+ } // end of if(TMath::Abs(sumOfW1st22*sumOfW2nd22)>0.)
+
+ // Cov(<cos(phi1+phi2)>,<cos(phi1-phi2-phi3)>):
+ Double_t product23 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(23); // <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>>
+ Double_t term1st23 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>>
+ Double_t term2nd23 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>>
+ Double_t sumOfW1st23 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>}
+ Double_t sumOfW2nd23 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>}
+ Double_t sumOfWW23 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(23); // W_{<cos(phi1+phi2)>} * W_{<cos(phi1-phi2-phi3)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator23 = product23 - term1st23*term2nd23;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator23 = 0.;
+ if(TMath::Abs(sumOfW1st23*sumOfW2nd23)>0.)
+ {
+ denominator23 = 1.-sumOfWW23/(sumOfW1st23*sumOfW2nd23);
+ if(TMath::Abs(denominator23)>0.)
+ {
+ // covariance:
+ Double_t covariance23 = numerator23/denominator23;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor23 = sumOfWW23/(sumOfW1st23*sumOfW2nd23);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(23,wPrefactor23*covariance23);
+ } // end of if(TMath::Abs(denominator23)>0.)
+ } // end of if(TMath::Abs(sumOfW1st23*sumOfW2nd23)>0.)
+
+ // Cov(<cos(phi1+phi2)>,<sin(phi1-phi2-phi3)>):
+ Double_t product24 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(24); // <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>>
+ Double_t term1st24 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>>
+ Double_t term2nd24 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>>
+ Double_t sumOfW1st24 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>}
+ Double_t sumOfW2nd24 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>}
+ Double_t sumOfWW24 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(24); // W_{<cos(phi1+phi2)>} * W_{<sin(phi1-phi2-phi3)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator24 = product24 - term1st24*term2nd24;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator24 = 0.;
+ if(TMath::Abs(sumOfW1st24*sumOfW2nd24)>0.)
+ {
+ denominator24 = 1.-sumOfWW24/(sumOfW1st24*sumOfW2nd24);
+ if(TMath::Abs(denominator24)>0.)
+ {
+ // covariance:
+ Double_t covariance24 = numerator24/denominator24;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor24 = sumOfWW24/(sumOfW1st24*sumOfW2nd24);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(24,wPrefactor24*covariance24);
+ } // end of if(TMath::Abs(denominator24)>0.)
+ } // end of if(TMath::Abs(sumOfW1st24*sumOfW2nd24)>0.)
+
+ // Cov(<sin(phi1+phi2)>,<cos(phi1-phi2-phi3)>):
+ Double_t product25 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(25); // <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>>
+ Double_t term1st25 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>>
+ Double_t term2nd25 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>>
+ Double_t sumOfW1st25 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>}
+ Double_t sumOfW2nd25 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>}
+ Double_t sumOfWW25 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(25); // W_{<sin(phi1+phi2)>} * W_{<cos(phi1-phi2-phi3)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator25 = product25 - term1st25*term2nd25;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator25 = 0.;
+ if(TMath::Abs(sumOfW1st25*sumOfW2nd25)>0.)
+ {
+ denominator25 = 1.-sumOfWW25/(sumOfW1st25*sumOfW2nd25);
+ if(TMath::Abs(denominator25)>0.)
+ {
+ // covariance:
+ Double_t covariance25 = numerator25/denominator25;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor25 = sumOfWW25/(sumOfW1st25*sumOfW2nd25);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(25,wPrefactor25*covariance25);
+ } // end of if(TMath::Abs(denominator25)>0.)
+ } // end of if(TMath::Abs(sumOfW1st25*sumOfW2nd25)>0.)
+
+ // Cov(<sin(phi1+phi2)>,<sin(phi1-phi2-phi3)>):
+ Double_t product26 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(26); // <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>>
+ Double_t term1st26 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>>
+ Double_t term2nd26 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>>
+ Double_t sumOfW1st26 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>}
+ Double_t sumOfW2nd26 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>}
+ Double_t sumOfWW26 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(26); // W_{<sin(phi1+phi2)>} * W_{<sin(phi1-phi2-phi3)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator26 = product26 - term1st26*term2nd26;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator26 = 0.;
+ if(TMath::Abs(sumOfW1st26*sumOfW2nd26)>0.)
+ {
+ denominator26 = 1.-sumOfWW26/(sumOfW1st26*sumOfW2nd26);
+ if(TMath::Abs(denominator26)>0.)
+ {
+ // covariance:
+ Double_t covariance26 = numerator26/denominator26;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor26 = sumOfWW26/(sumOfW1st26*sumOfW2nd26);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(26,wPrefactor26*covariance26);
+ } // end of if(TMath::Abs(denominator26)>0.)
+ } // end of if(TMath::Abs(sumOfW1st26*sumOfW2nd26)>0.)
+
+ // Cov(<cos(phi1-phi2-phi3)>,<sin(phi1-phi2-phi3)>):
+ Double_t product27 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(27); // <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>>
+ Double_t term1st27 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>>
+ Double_t term2nd27 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>>
+ Double_t sumOfW1st27 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>}
+ Double_t sumOfW2nd27 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>}
+ Double_t sumOfWW27 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(27); // W_{<cos(phi1-phi2-phi3)>} * W_{<sin(phi1-phi2-phi3)>}
+ // numerator in the expression for the the unbiased estimator for covariance:
+ Double_t numerator27 = product27 - term1st27*term2nd27;
+ // denominator in the expression for the the unbiased estimator for covariance:
+ Double_t denominator27 = 0.;
+ if(TMath::Abs(sumOfW1st27*sumOfW2nd27)>0.)
+ {
+ denominator27 = 1.-sumOfWW27/(sumOfW1st27*sumOfW2nd27);
+ if(TMath::Abs(denominator27)>0.)
+ {
+ // covariance:
+ Double_t covariance27 = numerator27/denominator27;
+ // weight dependent prefactor for covariance:
+ Double_t wPrefactor27 = sumOfWW27/(sumOfW1st27*sumOfW2nd27);
+ // finally, store "weighted" covariance:
+ fIntFlowCovariancesNUA->SetBinContent(27,wPrefactor27*covariance27);
+ } // end of if(TMath::Abs(denominator27)>0.)
+ } // end of if(TMath::Abs(sumOfW1st27*sumOfW2nd27)>0.)
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateCovariancesNUAIntFlow()
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::FinalizeCorrelationsIntFlow()
+{
+ // From profile fIntFlowCorrelationsPro access measured correlations and spread,
+ // correctly calculate the statistical errors and store the final results and
+ // statistical errors for correlations in histogram fIntFlowCorrelationsHist.
+ //
+ // Remark: Statistical error of correlation is calculated as:
+ //
+ // statistical error = termA * spread * termB:
+ // termA = sqrt{sum_{i=1}^{N} w^2}/(sum_{i=1}^{N} w)
+ // termB = 1/sqrt(1-termA^2)
+ //
+
+ for(Int_t ci=1;ci<=4;ci++) // correlation index
+ {
+ Double_t correlation = fIntFlowCorrelationsPro->GetBinContent(ci);
+ Double_t spread = fIntFlowCorrelationsPro->GetBinError(ci);
+ Double_t sumOfLinearEventWeights = fIntFlowSumOfEventWeights[0]->GetBinContent(ci);
+ Double_t sumOfQuadraticEventWeights = fIntFlowSumOfEventWeights[1]->GetBinContent(ci);
+ Double_t termA = 0.;
+ Double_t termB = 0.;
+ if(TMath::Abs(sumOfLinearEventWeights) > 0.) // to be improved - shall I omitt here Abs() ?
+ {
+ termA = pow(sumOfQuadraticEventWeights,0.5)/sumOfLinearEventWeights;
+ } else
+ {
+ cout<<endl;
+ cout<<" WARNING (QC): sumOfLinearEventWeights == 0 in method FinalizeCorrelationsIntFlow() !!!!"<<endl;
+ cout<<" (for "<<2*ci<<"-particle correlation)"<<endl;
+ cout<<endl;
+ }
+ if(1.-pow(termA,2.) > 0.)
+ {
+ termB = 1./pow(1-pow(termA,2.),0.5);
+ } else
+ {
+ cout<<endl;
+ cout<<" WARNING (QC): 1.-pow(termA,2.) <= 0 in method FinalizeCorrelationsIntFlow() !!!!"<<endl;
+ cout<<" (for "<<2*ci<<"-particle correlation)"<<endl;
+ cout<<endl;
+ }
+ Double_t statisticalError = termA * spread * termB;
+ fIntFlowCorrelationsHist->SetBinContent(ci,correlation);
+ fIntFlowCorrelationsHist->SetBinError(ci,statisticalError);
+ } // end of for(Int_t ci=1;ci<=4;ci++) // correlation index
+
+ // Versus multiplicity:
+ if(!fCalculateCumulantsVsM){return;}
+ for(Int_t ci=0;ci<=3;ci++) // correlation index
+ {
+ Int_t nBins = fIntFlowCorrelationsVsMPro[ci]->GetNbinsX();
+ for(Int_t b=1;b<=nBins;b++) // looping over multiplicity bins
+ {
+ Double_t correlationVsM = fIntFlowCorrelationsVsMPro[ci]->GetBinContent(b);
+ Double_t spreadVsM = fIntFlowCorrelationsVsMPro[ci]->GetBinError(b);
+ Double_t sumOfLinearEventWeightsVsM = fIntFlowSumOfEventWeightsVsM[ci][0]->GetBinContent(b);
+ Double_t sumOfQuadraticEventWeightsVsM = fIntFlowSumOfEventWeightsVsM[ci][1]->GetBinContent(b);
+ Double_t termAVsM = 0.;
+ Double_t termBVsM = 0.;
+ if(TMath::Abs(sumOfLinearEventWeightsVsM) > 0.) // to be improved - shall I omitt here Abs() ?
+ {
+ termAVsM = pow(sumOfQuadraticEventWeightsVsM,0.5)/sumOfLinearEventWeightsVsM;
+ }
+ if(1.-pow(termAVsM,2.) > 0.)
+ {
+ termBVsM = 1./pow(1-pow(termAVsM,2.),0.5);
+ }
+ Double_t statisticalErrorVsM = termAVsM * spreadVsM * termBVsM;
+ fIntFlowCorrelationsVsMHist[ci]->SetBinContent(b,correlationVsM);
+ fIntFlowCorrelationsVsMHist[ci]->SetBinError(b,statisticalErrorVsM);
+ } // end of for(Int_t b=1;b<=nBins;b++)
+ } // end of for(Int_t ci=1;ci<=4;ci++) // correlation index
+
+} // end of AliFlowAnalysisWithQCumulants::FinalizeCorrelationsIntFlow()
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(Int_t nRP)
+{
+ // Fill profile fAverageMultiplicity to hold average multiplicities and number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8
+
+ // Binning of fAverageMultiplicity is organized as follows:
+ // 1st bin: all events (including the empty ones)
+ // 2nd bin: event with # of RPs greater or equal to 1
+ // 3rd bin: event with # of RPs greater or equal to 2
+ // 4th bin: event with # of RPs greater or equal to 3
+ // 5th bin: event with # of RPs greater or equal to 4
+ // 6th bin: event with # of RPs greater or equal to 5
+ // 7th bin: event with # of RPs greater or equal to 6
+ // 8th bin: event with # of RPs greater or equal to 7
+ // 9th bin: event with # of RPs greater or equal to 8
+
+ if(!fAvMultiplicity)
+ {
+ cout<<"WARNING: fAvMultiplicity is NULL in AFAWQC::FAM() !!!!"<<endl;
+ exit(0);
+ }
+
+ if(nRP<0)
+ {
+ cout<<"WARNING: nRP<0 in in AFAWQC::FAM() !!!!"<<endl;
+ exit(0);
+ }
+
+ for(Int_t i=0;i<9;i++)
+ {
+ if(nRP>=i) fAvMultiplicity->Fill(i+0.5,nRP,1);
+ }
+
+} // end of AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(nRP)
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::CalculateCumulantsIntFlow()
+{
+ // a) Calculate Q-cumulants from the measured multiparticle correlations;
+ // b) Propagate the statistical errors from measured multiparticle correlations to statistical errors of Q-cumulants;
+ // c) Remark: Q-cumulants calculated in this method are biased by non-uniform acceptance of detector !!!!
+ // Method CalculateQcumulantsCorrectedForNUAIntFlow() is called afterwards to correct for this bias;
+ // d) Store the results and statistical error of Q-cumulants in histogram fIntFlowQcumulants.
+ // Binning of fIntFlowQcumulants is organized as follows:
+ //
+ // 1st bin: QC{2}
+ // 2nd bin: QC{4}
+ // 3rd bin: QC{6}
+ // 4th bin: QC{8}
+ //
+
+ // Correlations:
+ Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>>
+ Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>>
+ Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>>
+ Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>>
+ // Statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations:
+ Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <2>
+ Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <4>
+ Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <6>
+ Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <8>
+ // Covariances (multiplied by prefactor depending on weights - see comments in CalculateCovariancesIntFlow()):
+ Double_t wCov24 = fIntFlowCovariances->GetBinContent(1); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>)
+ Double_t wCov26 = fIntFlowCovariances->GetBinContent(2); // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>)
+ Double_t wCov28 = fIntFlowCovariances->GetBinContent(3); // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>)
+ Double_t wCov46 = fIntFlowCovariances->GetBinContent(4); // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>)
+ Double_t wCov48 = fIntFlowCovariances->GetBinContent(5); // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>)
+ Double_t wCov68 = fIntFlowCovariances->GetBinContent(6); // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>)
+ // Q-cumulants:
+ Double_t qc2 = 0.; // QC{2}
+ Double_t qc4 = 0.; // QC{4}
+ Double_t qc6 = 0.; // QC{6}
+ Double_t qc8 = 0.; // QC{8}
+ if(TMath::Abs(two) > 0.){qc2 = two;}
+ if(TMath::Abs(four) > 0.){qc4 = four-2.*pow(two,2.);}
+ if(TMath::Abs(six) > 0.){qc6 = six-9.*two*four+12.*pow(two,3.);}
+ if(TMath::Abs(eight) > 0.){qc8 = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.);}
+ // Statistical errors of Q-cumulants:
+ Double_t qc2Error = 0.;
+ Double_t qc4Error = 0.;
+ Double_t qc6Error = 0.;
+ Double_t qc8Error = 0.;
+ // Squared statistical errors of Q-cumulants:
+ //Double_t qc2ErrorSquared = 0.;
+ Double_t qc4ErrorSquared = 0.;
+ Double_t qc6ErrorSquared = 0.;
+ Double_t qc8ErrorSquared = 0.;
+ // Statistical error of QC{2}:
+ qc2Error = twoError;
+ // Statistical error of QC{4}:
+ qc4ErrorSquared = 16.*pow(two,2.)*pow(twoError,2)+pow(fourError,2.)
+ - 8.*two*wCov24;
+ if(qc4ErrorSquared>0.)
+ {
+ qc4Error = pow(qc4ErrorSquared,0.5);
+ } else
+ {
+ cout<<" WARNING (QC): Statistical error of QC{4} is imaginary !!!!"<<endl;
+ }
+ // Statistical error of QC{6}:
+ qc6ErrorSquared = 81.*pow(4.*pow(two,2.)-four,2.)*pow(twoError,2.)
+ + 81.*pow(two,2.)*pow(fourError,2.)
+ + pow(sixError,2.)
+ - 162.*two*(4.*pow(two,2.)-four)*wCov24
+ + 18.*(4.*pow(two,2.)-four)*wCov26
+ - 18.*two*wCov46;
+ if(qc6ErrorSquared>0.)
+ {
+ qc6Error = pow(qc6ErrorSquared,0.5);
+ } else
+ {
+ cout<<" WARNING (QC): Statistical error of QC{6} is imaginary !!!!"<<endl;
+ }
+ // Statistical error of QC{8}:
+ qc8ErrorSquared = 256.*pow(36.*pow(two,3.)-18.*four*two+six,2.)*pow(twoError,2.)
+ + 1296.*pow(4.*pow(two,2.)-four,2.)*pow(fourError,2.)
+ + 256.*pow(two,2.)*pow(sixError,2.)
+ + pow(eightError,2.)
+ - 1152.*(36.*pow(two,3.)-18.*four*two+six)*(4.*pow(two,2.)-four)*wCov24
+ + 512.*two*(36.*pow(two,3.)-18.*four*two+six)*wCov26
+ - 32.*(36.*pow(two,3.)-18.*four*two+six)*wCov28
+ - 1152.*two*(4.*pow(two,2.)-four)*wCov46
+ + 72.*(4.*pow(two,2.)-four)*wCov48
+ - 32.*two*wCov68;
+ if(qc8ErrorSquared>0.)
+ {
+ qc8Error = pow(qc8ErrorSquared,0.5);
+ } else
+ {
+ cout<<"WARNING (QC): Statistical error of QC{8} is imaginary !!!!"<<endl;
+ }
+ // Store the results and statistical errors for Q-cumulants:
+ if(TMath::Abs(qc2)>0.)
+ {
+ fIntFlowQcumulants->SetBinContent(1,qc2);
+ fIntFlowQcumulants->SetBinError(1,qc2Error);
+ }
+ if(TMath::Abs(qc4)>0.)
+ {
+ fIntFlowQcumulants->SetBinContent(2,qc4);
+ fIntFlowQcumulants->SetBinError(2,qc4Error);
+ }
+ if(TMath::Abs(qc6)>0.)
+ {
+ fIntFlowQcumulants->SetBinContent(3,qc6);
+ fIntFlowQcumulants->SetBinError(3,qc6Error);
+ }
+ if(TMath::Abs(qc8)>0.)
+ {
+ fIntFlowQcumulants->SetBinContent(4,qc8);
+ fIntFlowQcumulants->SetBinError(4,qc8Error);
+ }
+
+ // Versus multiplicity:
+ if(!fCalculateCumulantsVsM){return;}
+ Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0)
+ Double_t value[4] = {0.}; // QCs vs M
+ Double_t error[4] = {0.}; // error of QCs vs M
+ Double_t dSum1[4] = {0.}; // sum value_i/(error_i)^2
+ Double_t dSum2[4] = {0.}; // sum 1/(error_i)^2
+ for(Int_t b=1;b<=nBins;b++)
+ {
+ // Correlations:
+ two = fIntFlowCorrelationsVsMHist[0]->GetBinContent(b); // <<2>>
+ four = fIntFlowCorrelationsVsMHist[1]->GetBinContent(b); // <<4>>
+ six = fIntFlowCorrelationsVsMHist[2]->GetBinContent(b); // <<6>>
+ eight = fIntFlowCorrelationsVsMHist[3]->GetBinContent(b); // <<8>>
+ // Statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations:
+ twoError = fIntFlowCorrelationsVsMHist[0]->GetBinError(b); // statistical error of <2>
+ fourError = fIntFlowCorrelationsVsMHist[1]->GetBinError(b); // statistical error of <4>
+ sixError = fIntFlowCorrelationsVsMHist[2]->GetBinError(b); // statistical error of <6>
+ eightError = fIntFlowCorrelationsVsMHist[3]->GetBinError(b); // statistical error of <8>
+ // Covariances (multiplied by prefactor depending on weights - see comments in CalculateCovariancesIntFlow()):
+ wCov24 = fIntFlowCovariancesVsM[0]->GetBinContent(b); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>)
+ wCov26 = fIntFlowCovariancesVsM[1]->GetBinContent(b); // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>)
+ wCov28 = fIntFlowCovariancesVsM[2]->GetBinContent(b); // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>)
+ wCov46 = fIntFlowCovariancesVsM[3]->GetBinContent(b); // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>)
+ wCov48 = fIntFlowCovariancesVsM[4]->GetBinContent(b); // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>)
+ wCov68 = fIntFlowCovariancesVsM[5]->GetBinContent(b); // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>)
+ // Q-cumulants:
+ qc2 = 0.; // QC{2}
+ qc4 = 0.; // QC{4}
+ qc6 = 0.; // QC{6}
+ qc8 = 0.; // QC{8}
+ if(TMath::Abs(two) > 0.){qc2 = two;}
+ if(TMath::Abs(four) > 0.){qc4 = four-2.*pow(two,2.);}
+ if(TMath::Abs(six) > 0.){qc6 = six-9.*two*four+12.*pow(two,3.);}
+ if(TMath::Abs(eight) > 0.){qc8 = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.);}
+ // Statistical errors of Q-cumulants:
+ qc2Error = 0.;
+ qc4Error = 0.;
+ qc6Error = 0.;
+ qc8Error = 0.;
+ // Squared statistical errors of Q-cumulants:
+ //Double_t qc2ErrorSquared = 0.;
+ qc4ErrorSquared = 0.;
+ qc6ErrorSquared = 0.;
+ qc8ErrorSquared = 0.;
+ // Statistical error of QC{2}:
+ qc2Error = twoError;
+ // Statistical error of QC{4}:
+ qc4ErrorSquared = 16.*pow(two,2.)*pow(twoError,2)+pow(fourError,2.)
+ - 8.*two*wCov24;
+ if(qc4ErrorSquared>0.)
+ {
+ qc4Error = pow(qc4ErrorSquared,0.5);
+ } else
+ {
+ // cout<<"WARNING: Statistical error of QC{4} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl;
+ }
+ // Statistical error of QC{6}:
+ qc6ErrorSquared = 81.*pow(4.*pow(two,2.)-four,2.)*pow(twoError,2.)
+ + 81.*pow(two,2.)*pow(fourError,2.)
+ + pow(sixError,2.)
+ - 162.*two*(4.*pow(two,2.)-four)*wCov24
+ + 18.*(4.*pow(two,2.)-four)*wCov26
+ - 18.*two*wCov46;
+ if(qc6ErrorSquared>0.)
+ {
+ qc6Error = pow(qc6ErrorSquared,0.5);
+ } else
+ {
+ // cout<<"WARNING: Statistical error of QC{6} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl;
+ }
+ // Statistical error of QC{8}:
+ qc8ErrorSquared = 256.*pow(36.*pow(two,3.)-18.*four*two+six,2.)*pow(twoError,2.)
+ + 1296.*pow(4.*pow(two,2.)-four,2.)*pow(fourError,2.)
+ + 256.*pow(two,2.)*pow(sixError,2.)
+ + pow(eightError,2.)
+ - 1152.*(36.*pow(two,3.)-18.*four*two+six)*(4.*pow(two,2.)-four)*wCov24
+ + 512.*two*(36.*pow(two,3.)-18.*four*two+six)*wCov26
+ - 32.*(36.*pow(two,3.)-18.*four*two+six)*wCov28
+ - 1152.*two*(4.*pow(two,2.)-four)*wCov46
+ + 72.*(4.*pow(two,2.)-four)*wCov48
+ - 32.*two*wCov68;
+ if(qc8ErrorSquared>0.)
+ {
+ qc8Error = pow(qc8ErrorSquared,0.5);
+ } else
+ {
+ // cout<<"WARNING: Statistical error of QC{8} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl;
+ }
+ // Store the results and statistical errors for Q-cumulants:
+ if(TMath::Abs(qc2)>0.)
+ {
+ fIntFlowQcumulantsVsM[0]->SetBinContent(b,qc2);
+ fIntFlowQcumulantsVsM[0]->SetBinError(b,qc2Error);
+ }
+ if(TMath::Abs(qc4)>0.)
+ {
+ fIntFlowQcumulantsVsM[1]->SetBinContent(b,qc4);
+ fIntFlowQcumulantsVsM[1]->SetBinError(b,qc4Error);
+ }
+ if(TMath::Abs(qc6)>0.)
+ {
+ fIntFlowQcumulantsVsM[2]->SetBinContent(b,qc6);
+ fIntFlowQcumulantsVsM[2]->SetBinError(b,qc6Error);
+ }
+ if(TMath::Abs(qc8)>0.)
+ {
+ fIntFlowQcumulantsVsM[3]->SetBinContent(b,qc8);
+ fIntFlowQcumulantsVsM[3]->SetBinError(b,qc8Error);
+ }
+ // Rebin in M:
+ for(Int_t co=0;co<4;co++)
+ {
+ value[co] = fIntFlowQcumulantsVsM[co]->GetBinContent(b);
+ error[co] = fIntFlowQcumulantsVsM[co]->GetBinError(b);
+ if(error[co]>0.)
+ {
+ dSum1[co]+=value[co]/(error[co]*error[co]);
+ dSum2[co]+=1./(error[co]*error[co]);
+ }
+ } // end of for(Int_t co=0;co<4;co++)
+ } // end of for(Int_t b=1;b<=nBins;b++)
+ // Store rebinned Q-cumulants:
+ for(Int_t co=0;co<4;co++)
+ {
+ if(dSum2[co]>0.)
+ {
+ fIntFlowQcumulantsRebinnedInM->SetBinContent(co+1,dSum1[co]/dSum2[co]);
+ fIntFlowQcumulantsRebinnedInM->SetBinError(co+1,pow(1./dSum2[co],0.5));
+ }
+ } // end of for(Int_t co=0;co<4;co++)
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateCumulantsIntFlow()
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::CalculateReferenceFlow()
+{
+ // a) Calculate the final results for reference flow estimates from Q-cumulants;
+ // b) Propagate the statistical errors to reference flow estimates from statistical error of Q-cumulants;
+ // c) Store the results and statistical errors of reference flow estimates in histogram fIntFlow.
+ // Binning of fIntFlow is organized as follows:
+ //
+ // 1st bin: v{2,QC}
+ // 2nd bin: v{4,QC}
+ // 3rd bin: v{6,QC}
+ // 4th bin: v{8,QC}
+ //
+
+ // to be improved: revise the names and check the pointers used in this method, add something about calculation vs M
+
+ if(!(fIntFlowCorrelationsHist && fIntFlowCovariances && fIntFlowQcumulants && fIntFlow))
+ {
+ cout<<"WARNING: fIntFlowCorrelationsHist && fIntFlowCovariances && fIntFlowQcumulants && fIntFlow is NULL in AFAWQC::CCIF() !!!!"<<endl;
+ exit(0);
+ }
+
+ // Reference flow estimates:
+ Double_t v2 = 0.; // v{2,QC}
+ Double_t v4 = 0.; // v{4,QC}
+ Double_t v6 = 0.; // v{6,QC}
+ Double_t v8 = 0.; // v{8,QC}
+ // Reference flow's statistical errors:
+ Double_t v2Error = 0.; // v{2,QC} stat. error
+ Double_t v4Error = 0.; // v{4,QC} stat. error
+ Double_t v6Error = 0.; // v{6,QC} stat. error
+ Double_t v8Error = 0.; // v{8,QC} stat. error
+
+ // Q-cumulants:
+ Double_t qc2 = fIntFlowQcumulants->GetBinContent(1); // QC{2}
+ Double_t qc4 = fIntFlowQcumulants->GetBinContent(2); // QC{4}
+ Double_t qc6 = fIntFlowQcumulants->GetBinContent(3); // QC{6}
+ Double_t qc8 = fIntFlowQcumulants->GetBinContent(4); // QC{8}
+ // Q-cumulants's statistical errors:
+ Double_t qc2Error = fIntFlowQcumulants->GetBinError(1); // QC{2} stat. error
+ Double_t qc4Error = fIntFlowQcumulants->GetBinError(2); // QC{4} stat. error
+ Double_t qc6Error = fIntFlowQcumulants->GetBinError(3); // QC{6} stat. error
+ Double_t qc8Error = fIntFlowQcumulants->GetBinError(4); // QC{8} stat. error
+ // Calculate reference flow estimates from Q-cumulants:
+ if(qc2>=0.){v2 = pow(qc2,1./2.);}
+ if(qc4<=0.){v4 = pow(-1.*qc4,1./4.);}
+ if(qc6>=0.){v6 = pow((1./4.)*qc6,1./6.);}
+ if(qc8<=0.){v8 = pow((-1./33.)*qc8,1./8.);}
+ // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants:
+ if(qc2>0.){v2Error = (1./2.)*pow(qc2,-1./2.)*qc2Error;}
+ if(qc4<0.){v4Error = (1./4.)*pow(-qc4,-3./4.)*qc4Error;}
+ if(qc6>0.){v6Error = (1./6.)*pow(2.,-1./3.)*pow(qc6,-5./6.)*qc6Error;}
+ if(qc8<0.){v8Error = (1./8.)*pow(33.,-1./8.)*pow(-qc8,-7./8.)*qc8Error;}
+ // Print warnings for the 'wrong sign' cumulants:
+ if(TMath::Abs(v2) < 1.e-44)
+ {
+ cout<<" WARNING: Wrong sign QC{2}, couldn't calculate v{2,QC} !!!!"<<endl;
+ }
+ if(TMath::Abs(v4) < 1.e-44)
+ {
+ cout<<" WARNING: Wrong sign QC{4}, couldn't calculate v{4,QC} !!!!"<<endl;
+ }
+ if(TMath::Abs(v6) < 1.e-44)
+ {
+ cout<<" WARNING: Wrong sign QC{6}, couldn't calculate v{6,QC} !!!!"<<endl;
+ }
+ if(TMath::Abs(v8) < 1.e-44)
+ {
+ cout<<" WARNING: Wrong sign QC{8}, couldn't calculate v{8,QC} !!!!"<<endl;
+ }
+ // Store the results and statistical errors of integrated flow estimates:
+ fIntFlow->SetBinContent(1,v2);
+ fIntFlow->SetBinError(1,v2Error);
+ fIntFlow->SetBinContent(2,v4);
+ fIntFlow->SetBinError(2,v4Error);
+ fIntFlow->SetBinContent(3,v6);
+ fIntFlow->SetBinError(3,v6Error);
+ fIntFlow->SetBinContent(4,v8);
+ fIntFlow->SetBinError(4,v8Error);
+
+ // Versus multiplicity:
+ if(!fCalculateCumulantsVsM){return;}
+ Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0)
+ for(Int_t b=1;b<=nBins;b++)
+ {
+ // Q-cumulants:
+ Double_t qc2VsM = fIntFlowQcumulantsVsM[0]->GetBinContent(b); // QC{2}
+ Double_t qc4VsM = fIntFlowQcumulantsVsM[1]->GetBinContent(b); // QC{4}
+ Double_t qc6VsM = fIntFlowQcumulantsVsM[2]->GetBinContent(b); // QC{6}
+ Double_t qc8VsM = fIntFlowQcumulantsVsM[3]->GetBinContent(b); // QC{8}
+ // Q-cumulants's statistical errors:
+ Double_t qc2ErrorVsM = fIntFlowQcumulantsVsM[0]->GetBinError(b); // QC{2} stat. error
+ Double_t qc4ErrorVsM = fIntFlowQcumulantsVsM[1]->GetBinError(b); // QC{4} stat. error
+ Double_t qc6ErrorVsM = fIntFlowQcumulantsVsM[2]->GetBinError(b); // QC{6} stat. error
+ Double_t qc8ErrorVsM = fIntFlowQcumulantsVsM[3]->GetBinError(b); // QC{8} stat. error
+ // Reference flow estimates:
+ Double_t v2VsM = 0.; // v{2,QC}
+ Double_t v4VsM = 0.; // v{4,QC}
+ Double_t v6VsM = 0.; // v{6,QC}
+ Double_t v8VsM = 0.; // v{8,QC}
+ // Reference flow estimates errors:
+ Double_t v2ErrorVsM = 0.; // v{2,QC} stat. error
+ Double_t v4ErrorVsM = 0.; // v{4,QC} stat. error
+ Double_t v6ErrorVsM = 0.; // v{6,QC} stat. error
+ Double_t v8ErrorVsM = 0.; // v{8,QC} stat. error
+ // Calculate reference flow estimates from Q-cumulants:
+ if(qc2VsM>=0.){v2VsM = pow(qc2VsM,1./2.);}
+ if(qc4VsM<=0.){v4VsM = pow(-1.*qc4VsM,1./4.);}
+ if(qc6VsM>=0.){v6VsM = pow((1./4.)*qc6VsM,1./6.);}
+ if(qc8VsM<=0.){v8VsM = pow((-1./33.)*qc8VsM,1./8.);}
+ // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants:
+ if(qc2VsM>0.){v2ErrorVsM = (1./2.)*pow(qc2VsM,-1./2.)*qc2ErrorVsM;}
+ if(qc4VsM<0.){v4ErrorVsM = (1./4.)*pow(-qc4VsM,-3./4.)*qc4ErrorVsM;}
+ if(qc6VsM>0.){v6ErrorVsM = (1./6.)*pow(2.,-1./3.)*pow(qc6VsM,-5./6.)*qc6ErrorVsM;}
+ if(qc8VsM<0.){v8ErrorVsM = (1./8.)*pow(33.,-1./8.)*pow(-qc8VsM,-7./8.)*qc8ErrorVsM;}
+ // Store the results and statistical errors of integrated flow estimates:
+ fIntFlowVsM[0]->SetBinContent(b,v2VsM);
+ fIntFlowVsM[0]->SetBinError(b,v2ErrorVsM);
+ fIntFlowVsM[1]->SetBinContent(b,v4VsM);
+ fIntFlowVsM[1]->SetBinError(b,v4ErrorVsM);
+ fIntFlowVsM[2]->SetBinContent(b,v6VsM);
+ fIntFlowVsM[2]->SetBinError(b,v6ErrorVsM);
+ fIntFlowVsM[3]->SetBinContent(b,v8VsM);
+ fIntFlowVsM[3]->SetBinError(b,v8ErrorVsM);
+ } // end of for(Int_t b=1;b<=nBins;b++)
+
+ // 'Rebinned in M' calculation: // to be improved - this can be implemented better:
+ // Reference flow estimates:
+ Double_t v2RebinnedInM = 0.; // v{2,QC}
+ Double_t v4RebinnedInM = 0.; // v{4,QC}
+ Double_t v6RebinnedInM = 0.; // v{6,QC}
+ Double_t v8RebinnedInM = 0.; // v{8,QC}
+ // Reference flow's statistical errors:
+ Double_t v2ErrorRebinnedInM = 0.; // v{2,QC} stat. error
+ Double_t v4ErrorRebinnedInM = 0.; // v{4,QC} stat. error
+ Double_t v6ErrorRebinnedInM = 0.; // v{6,QC} stat. error
+ Double_t v8ErrorRebinnedInM = 0.; // v{8,QC} stat. error
+ // Q-cumulants:
+ Double_t qc2RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(1); // QC{2}
+ Double_t qc4RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(2); // QC{4}
+ Double_t qc6RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(3); // QC{6}
+ Double_t qc8RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(4); // QC{8}
+ // Q-cumulants's statistical errors:
+ Double_t qc2ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(1); // QC{2} stat. error
+ Double_t qc4ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(2); // QC{4} stat. error
+ Double_t qc6ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(3); // QC{6} stat. error
+ Double_t qc8ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(4); // QC{8} stat. error
+ // Calculate reference flow estimates from Q-cumulants:
+ if(qc2RebinnedInM>=0.){v2RebinnedInM = pow(qc2RebinnedInM,1./2.);}
+ if(qc4RebinnedInM<=0.){v4RebinnedInM = pow(-1.*qc4RebinnedInM,1./4.);}
+ if(qc6RebinnedInM>=0.){v6RebinnedInM = pow((1./4.)*qc6RebinnedInM,1./6.);}
+ if(qc8RebinnedInM<=0.){v8RebinnedInM = pow((-1./33.)*qc8RebinnedInM,1./8.);}
+ // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants:
+ if(qc2RebinnedInM>0.){v2ErrorRebinnedInM = (1./2.)*pow(qc2RebinnedInM,-1./2.)*qc2ErrorRebinnedInM;}
+ if(qc4RebinnedInM<0.){v4ErrorRebinnedInM = (1./4.)*pow(-qc4RebinnedInM,-3./4.)*qc4ErrorRebinnedInM;}
+ if(qc6RebinnedInM>0.){v6ErrorRebinnedInM = (1./6.)*pow(2.,-1./3.)*pow(qc6RebinnedInM,-5./6.)*qc6ErrorRebinnedInM;}
+ if(qc8RebinnedInM<0.){v8ErrorRebinnedInM = (1./8.)*pow(33.,-1./8.)*pow(-qc8RebinnedInM,-7./8.)*qc8ErrorRebinnedInM;}
+ // Print warnings for the 'wrong sign' cumulants:
+ if(TMath::Abs(v2RebinnedInM) < 1.e-44)
+ {
+ cout<<" WARNING: Wrong sign QC{2} rebinned in M, couldn't calculate v{2,QC} !!!!"<<endl;
+ }
+ if(TMath::Abs(v4RebinnedInM) < 1.e-44)
+ {
+ cout<<" WARNING: Wrong sign QC{4} rebinned in M, couldn't calculate v{4,QC} !!!!"<<endl;
+ }
+ if(TMath::Abs(v6RebinnedInM) < 1.e-44)
+ {
+ cout<<" WARNING: Wrong sign QC{6} rebinned in M, couldn't calculate v{6,QC} !!!!"<<endl;
+ }
+ if(TMath::Abs(v8RebinnedInM) < 1.e-44)
+ {
+ cout<<" WARNING: Wrong sign QC{8} rebinned in M, couldn't calculate v{8,QC} !!!!"<<endl;
+ }
+ // Store the results and statistical errors of integrated flow estimates:
+ fIntFlowRebinnedInM->SetBinContent(1,v2RebinnedInM);
+ fIntFlowRebinnedInM->SetBinError(1,v2ErrorRebinnedInM);
+ fIntFlowRebinnedInM->SetBinContent(2,v4RebinnedInM);
+ fIntFlowRebinnedInM->SetBinError(2,v4ErrorRebinnedInM);
+ fIntFlowRebinnedInM->SetBinContent(3,v6RebinnedInM);
+ fIntFlowRebinnedInM->SetBinError(3,v6ErrorRebinnedInM);
+ fIntFlowRebinnedInM->SetBinContent(4,v8RebinnedInM);
+ fIntFlowRebinnedInM->SetBinError(4,v8ErrorRebinnedInM);
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateReferenceFlow()
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow()
+{
+ // Fill in AliFlowCommonHistResults histograms relevant for reference flow.
+
+ // There are two possibilities here:
+ // a) Store minimum bias reference flow - use SetMinimumBiasReferenceFlow(kTRUE). This result is
+ // biased by the interplay between nonflow correlations and multiplicity fluctuations and is
+ // also stored in local histogram fIntFlow;
+ // b) Store reference flow obtained from flow analysis performed at fixed multiplicity and
+ // rebinned only at the end of the day - use SetMinimumBiasReferenceFlow(kFALSE). This result
+ // is also stored in local histogram fIntFlowRebinnedInM.
+
+ // Reference flow estimates:
+ Double_t v[4] = {0.};
+ // Statistical errors of reference flow estimates:
+ Double_t vError[4] = {0.};
+
+ for(Int_t b=0;b<4;b++)
+ {
+ if(fMinimumBiasReferenceFlow)
+ {
+ v[b] = fIntFlow->GetBinContent(b+1);
+ vError[b] = fIntFlow->GetBinError(b+1);
+ } else
+ {
+ v[b] = fIntFlowRebinnedInM->GetBinContent(b+1);
+ vError[b] = fIntFlowRebinnedInM->GetBinError(b+1);
+ }
+ } // end of for(Int_t b=0;b<4;b++)
+
+ // Fill AliFlowCommonHistResults histogram:
+ fCommonHistsResults2nd->FillIntegratedFlow(v[0],vError[0]); // to be improved (hardwired 2nd in the name)
+ fCommonHistsResults4th->FillIntegratedFlow(v[1],vError[1]); // to be improved (hardwired 4th in the name)
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) // to be improved (calculate also 6th and 8th order)
+ {
+ fCommonHistsResults6th->FillIntegratedFlow(v[2],vError[2]); // to be improved (hardwired 6th in the name)
+ fCommonHistsResults8th->FillIntegratedFlow(v[3],vError[3]); // to be improved (hardwired 8th in the name)
+ }
+
+} // end of AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow()
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelationsUsingParticleWeights()
+{
+ // Calculate all correlations needed for integrated flow using particle weights.
+
+ // Remark 1: When particle weights are used the binning of fIntFlowCorrelationAllPro is organized as follows:
+ //
+ // 1st bin: <2>_{1n|1n} = two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))>
+ // 2nd bin: <2>_{2n|2n} = two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))>
+ // 3rd bin: <2>_{3n|3n} = two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))>
+ // 4th bin: <2>_{4n|4n} = two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))>
+ // 5th bin: ---- EMPTY ----
+ // 6th bin: <3>_{2n|1n,1n} = three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))>
+ // 7th bin: <3>_{3n|2n,1n} = ...
+ // 8th bin: <3>_{4n|2n,2n} = ...
+ // 9th bin: <3>_{4n|3n,1n} = ...
+ // 10th bin: ---- EMPTY ----
+ // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))>
+ // 12th bin: <4>_{2n,1n|2n,1n} = ...
+ // 13th bin: <4>_{2n,2n|2n,2n} = ...
+ // 14th bin: <4>_{3n|1n,1n,1n} = ...
+ // 15th bin: <4>_{3n,1n|3n,1n} = ...
+ // 16th bin: <4>_{3n,1n|2n,2n} = ...
+ // 17th bin: <4>_{4n|2n,1n,1n} = ...
+ // 18th bin: ---- EMPTY ----
+ // 19th bin: <5>_{2n|1n,1n,1n,1n} = ...
+ // 20th bin: <5>_{2n,2n|2n,1n,1n} = ...
+ // 21st bin: <5>_{3n,1n|2n,1n,1n} = ...
+ // 22nd bin: <5>_{4n|1n,1n,1n,1n} = ...
+ // 23rd bin: ---- EMPTY ----
+ // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = ...
+ // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = ...
+ // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = ...
+ // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = ...
+ // 28th bin: ---- EMPTY ----
+ // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = ...
+ // 30th bin: ---- EMPTY ----
+ // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = ...
+
+ // Remark 2: When particle weights are used there are some extra correlations. They are stored in
+ // fIntFlowExtraCorrelationsPro binning of which is organized as follows:
+
+ // 1st bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))>
+ // 2nd bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))>
+
+ // multiplicity (number of particles used to determine the reaction plane)
+ Double_t dMult = (*fSMpk)(0,0);
+
+ // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
+ Double_t dReQ1n1k = (*fReQ)(0,1);
+ Double_t dReQ2n2k = (*fReQ)(1,2);
+ Double_t dReQ3n3k = (*fReQ)(2,3);
+ Double_t dReQ4n4k = (*fReQ)(3,4);
+ Double_t dReQ1n3k = (*fReQ)(0,3);
+ Double_t dImQ1n1k = (*fImQ)(0,1);
+ Double_t dImQ2n2k = (*fImQ)(1,2);
+ Double_t dImQ3n3k = (*fImQ)(2,3);
+ Double_t dImQ4n4k = (*fImQ)(3,4);
+ Double_t dImQ1n3k = (*fImQ)(0,3);
+
+ // dMs are variables introduced in order to simplify some Eqs. bellow:
+ //..............................................................................................
+ Double_t dM11 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j
+ Double_t dM22 = (*fSMpk)(1,2)-(*fSMpk)(0,4); // dM22 = sum_{i,j=1,i!=j}^M w_i^2 w_j^2
+ Double_t dM33 = (*fSMpk)(1,3)-(*fSMpk)(0,6); // dM33 = sum_{i,j=1,i!=j}^M w_i^3 w_j^3
+ Double_t dM44 = (*fSMpk)(1,4)-(*fSMpk)(0,8); // dM44 = sum_{i,j=1,i!=j}^M w_i^4 w_j^4
+ Double_t dM31 = (*fSMpk)(0,3)*(*fSMpk)(0,1)-(*fSMpk)(0,4); // dM31 = sum_{i,j=1,i!=j}^M w_i^3 w_j
+ Double_t dM211 = (*fSMpk)(0,2)*(*fSMpk)(1,1)-2.*(*fSMpk)(0,3)*(*fSMpk)(0,1)
+ - (*fSMpk)(1,2)+2.*(*fSMpk)(0,4); // dM211 = sum_{i,j,k=1,i!=j!=k}^M w_i^2 w_j w_k
+ Double_t dM1111 = (*fSMpk)(3,1)-6.*(*fSMpk)(0,2)*(*fSMpk)(1,1)
+ + 8.*(*fSMpk)(0,3)*(*fSMpk)(0,1)
+ + 3.*(*fSMpk)(1,2)-6.*(*fSMpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l
+ //..............................................................................................
+
+ // 2-particle correlations:
+ Double_t two1n1nW1W1 = 0.; // <w1 w2 cos(n*(phi1-phi2))>
+ Double_t two2n2nW2W2 = 0.; // <w1^2 w2^2 cos(2n*(phi1-phi2))>
+ Double_t two3n3nW3W3 = 0.; // <w1^3 w2^3 cos(3n*(phi1-phi2))>
+ Double_t two4n4nW4W4 = 0.; // <w1^4 w2^4 cos(4n*(phi1-phi2))>
+ if(dMult>1)
+ {
+ if(dM11)
+ {
+ two1n1nW1W1 = (pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSMpk)(0,2))/dM11;
+ // average correlation <w1 w2 cos(n*(phi1-phi2))> for single event:
+ fIntFlowCorrelationsEBE->SetBinContent(1,two1n1nW1W1);
+ fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(1,dM11);
+ // average correlation <w1 w2 cos(n*(phi1-phi2))> for all events:
+ fIntFlowCorrelationsPro->Fill(0.5,two1n1nW1W1,dM11);
+ fIntFlowCorrelationsAllPro->Fill(0.5,two1n1nW1W1,dM11);
+ }
+ if(dM22)
+ {
+ two2n2nW2W2 = (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)-(*fSMpk)(0,4))/dM22;
+ // ...
+ // average correlation <w1^2 w2^2 cos(2n*(phi1-phi2))> for all events:
+ fIntFlowCorrelationsAllPro->Fill(1.5,two2n2nW2W2,dM22);
+ }
+ if(dM33)
+ {
+ two3n3nW3W3 = (pow(dReQ3n3k,2)+pow(dImQ3n3k,2)-(*fSMpk)(0,6))/dM33;
+ // ...
+ // average correlation <w1^3 w2^3 cos(3n*(phi1-phi2))> for all events:
+ fIntFlowCorrelationsAllPro->Fill(2.5,two3n3nW3W3,dM33);
+ }
+ if(dM44)
+ {
+ two4n4nW4W4 = (pow(dReQ4n4k,2)+pow(dImQ4n4k,2)-(*fSMpk)(0,8))/dM44;
+ // ...
+ // average correlation <w1^4 w2^4 cos(4n*(phi1-phi2))> for all events:
+ fIntFlowCorrelationsAllPro->Fill(3.5,two4n4nW4W4,dM44);
+ }
+ } // end of if(dMult>1)
+
+ // extra 2-particle correlations:
+ Double_t two1n1nW3W1 = 0.; // <w1^3 w2 cos(n*(phi1-phi2))>
+ Double_t two1n1nW1W1W2 = 0.; // <w1 w2 w3^2 cos(n*(phi1-phi2))>
+ if(dMult>1)
+ {
+ if(dM31)
+ {
+ two1n1nW3W1 = (dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k-(*fSMpk)(0,4))/dM31;
+ fIntFlowExtraCorrelationsPro->Fill(0.5,two1n1nW3W1,dM31);
+ }
+ if(dM211)
+ {
+ two1n1nW1W1W2 = ((*fSMpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSMpk)(0,2))
+ - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k
+ - (*fSMpk)(0,4)))/dM211;
+ fIntFlowExtraCorrelationsPro->Fill(1.5,two1n1nW1W1W2,dM211);
+ }
+ } // end of if(dMult>1)
+ //..............................................................................................
+
+ //..............................................................................................
+ // 3-particle correlations:
+ Double_t three2n1n1nW2W1W1 = 0.; // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))>
+
+ if(dMult>2)
+ {
+ if(dM211)
+ {
+ three2n1n1nW2W1W1 = (pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k
+ - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k)
+ - pow(dReQ2n2k,2)-pow(dImQ2n2k,2)
+ + 2.*(*fSMpk)(0,4))/dM211;
+ fIntFlowCorrelationsAllPro->Fill(5.5,three2n1n1nW2W1W1,dM211);
+ }
+ } // end of if(dMult>2)
+ //..............................................................................................
+
+ //..............................................................................................
+ // 4-particle correlations:
+ Double_t four1n1n1n1nW1W1W1W1 = 0.; // <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))>
+ if(dMult>3)
+ {
+ if(dM1111)
+ {
+ four1n1n1n1nW1W1W1W1 = (pow(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.),2)
+ - 2.*(pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k)
+ + 8.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k)
+ + (pow(dReQ2n2k,2)+pow(dImQ2n2k,2))
+ - 4.*(*fSMpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2))
+ - 6.*(*fSMpk)(0,4)+2.*(*fSMpk)(1,2))/dM1111;
+
+ // average correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for single event:
+ fIntFlowCorrelationsEBE->SetBinContent(2,four1n1n1n1nW1W1W1W1);
+ fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(2,dM1111);
+ // average correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for all events:
+ fIntFlowCorrelationsPro->Fill(1.5,four1n1n1n1nW1W1W1W1,dM1111);
+ fIntFlowCorrelationsAllPro->Fill(10.5,four1n1n1n1nW1W1W1W1,dM1111);
+ }
+ } // end of if(dMult>3)
+ //..............................................................................................
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelationsUsingParticleWeights()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CalculateWeightedQProductsForIntFlow() // to be improved (completed)
+{
+ // calculate averages like <<2><4>>, <<2><6>>, <<4><6>>, etc. which are needed to calculate covariances
+ // Remark: here we take weighted correlations!
+
+ /*
+
+ // binning of fQProductsW is organized as follows:
+ //
+ // 1st bin: <2><4>
+ // 2nd bin: <2><6>
+ // 3rd bin: <2><8>
+ // 4th bin: <4><6>
+ // 5th bin: <4><8>
+ // 6th bin: <6><8>
+
+ Double_t dMult = (*fSMpk)(0,0); // multiplicity (number of particles used to determine the reaction plane)
+
+ Double_t dM11 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j
+ Double_t dM1111 = (*fSMpk)(3,1)-6.*(*fSMpk)(0,2)*(*fSMpk)(1,1)
+ + 8.*(*fSMpk)(0,3)*(*fSMpk)(0,1)
+ + 3.*(*fSMpk)(1,2)-6.*(*fSMpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l
+
+ Double_t twoEBEW = 0.; // <2>
+ Double_t fourEBEW = 0.; // <4>
+
+ twoEBEW = fQCorrelationsEBE[1]->GetBinContent(1);
+ fourEBEW = fQCorrelationsEBE[1]->GetBinContent(11);
+
+ // <2><4>
+ if(dMult>3)
+ {
+ fQProducts[1][0]->Fill(0.5,twoEBEW*fourEBEW,dM11*dM1111);
+ }
+
+ */
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateWeightedQProductsForIntFlow()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow()
+{
+ // Initialize all arrays used to calculate integrated flow.
+
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms
+ {
+ fIntFlowCorrectionTermsForNUAEBE[sc] = NULL;
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc] = NULL;
+ fIntFlowCorrectionTermsForNUAPro[sc] = NULL;
+ fIntFlowCorrectionTermsForNUAHist[sc] = NULL;
+ for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4)
+ {
+ fIntFlowCorrectionTermsForNUAVsMPro[sc][ci] = NULL;
+ }
+ for(Int_t power=0;power<2;power++) // linear or quadratic
+ {
+ fIntFlowSumOfEventWeightsNUA[sc][power] = NULL;
+ }
+ }
+ for(Int_t power=0;power<2;power++) // linear or quadratic
+ {
+ fIntFlowSumOfEventWeights[power] = NULL;
+ }
+ for(Int_t i=0;i<4;i++) // print on the screen the final results (0=RF, 1=RP, 2=POI, 3=RF (rebbined in M))
+ {
+ fPrintFinalResults[i] = kTRUE;
+ }
+ for(Int_t ci=0;ci<4;ci++) // correlation index or cumulant order
+ {
+ fIntFlowCorrelationsVsMPro[ci] = NULL;
+ fIntFlowCorrelationsVsMHist[ci] = NULL;
+ fIntFlowQcumulantsVsM[ci] = NULL;
+ fIntFlowVsM[ci] = NULL;
+ fIntFlowDetectorBiasVsM[ci] = NULL;
+ for(Int_t lc=0;lc<2;lc++)
+ {
+ fIntFlowSumOfEventWeightsVsM[ci][lc] = NULL;
+ }
+ }
+ for(Int_t pi=0;pi<6;pi++) // product or covariance index
+ {
+ fIntFlowProductOfCorrelationsVsMPro[pi] = NULL;
+ fIntFlowCovariancesVsM[pi] = NULL;
+ fIntFlowSumOfProductOfEventWeightsVsM[pi] = NULL;
+ }
+
+} // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow()
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow()
+{
+ // Initialize all arrays needed to calculate differential flow.
+ // a) Initialize lists holding profiles;
+ // b) Initialize lists holding histograms;
+ // c) Initialize event-by-event quantities;
+ // d) Initialize profiles;
+ // e) Initialize histograms holding final results.
+
+ // a) Initialize lists holding profiles;
+ for(Int_t t=0;t<2;t++) // type (RP, POI)
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ fDiffFlowCorrelationsProList[t][pe] = NULL;
+ fDiffFlowProductOfCorrelationsProList[t][pe] = NULL;
+ fDiffFlowCorrectionsProList[t][pe] = NULL;
+ }
+ }
+
+ // b) Initialize lists holding histograms;
+ for(Int_t t=0;t<2;t++) // type (RP, POI)
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ fDiffFlowCorrelationsHistList[t][pe] = NULL;
+ for(Int_t power=0;power<2;power++)
+ {
+ fDiffFlowSumOfEventWeightsHistList[t][pe][power] = NULL;
+ } // end of for(Int_t power=0;power<2;power++)
+ fDiffFlowSumOfProductOfEventWeightsHistList[t][pe] = NULL;
+ fDiffFlowCorrectionsHistList[t][pe] = NULL;
+ fDiffFlowCovariancesHistList[t][pe] = NULL;
+ fDiffFlowCumulantsHistList[t][pe] = NULL;
+ fDiffFlowHistList[t][pe] = NULL;
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta
+ } // enf of for(Int_t t=0;t<2;t++) // type (RP, POI)
+
+ // c) Initialize event-by-event quantities:
+ // 1D:
+ for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP)
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t m=0;m<4;m++) // multiple of harmonic
+ {
+ for(Int_t k=0;k<9;k++) // power of weight
+ {
+ fReRPQ1dEBE[t][pe][m][k] = NULL;
+ fImRPQ1dEBE[t][pe][m][k] = NULL;
+ fs1dEBE[t][pe][k] = NULL; // to be improved (this doesn't need to be within loop over m)
+ }
+ }
+ }
+ }
+ // 1D:
+ for(Int_t t=0;t<2;t++) // type (RP or POI)
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms
+ {
+ for(Int_t cti=0;cti<9;cti++) // correction term index
+ {
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti] = NULL;
+ }
+ }
+ }
+ }
+ // 2D:
+ for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP)
+ {
+ for(Int_t m=0;m<4;m++) // multiple of harmonic
+ {
+ for(Int_t k=0;k<9;k++) // power of weight
+ {
+ fReRPQ2dEBE[t][m][k] = NULL;
+ fImRPQ2dEBE[t][m][k] = NULL;
+ fs2dEBE[t][k] = NULL; // to be improved (this doesn't need to be within loop over m)
+ }
+ }
+ }
+
+ // d) Initialize profiles:
+ for(Int_t t=0;t<2;t++) // type: RP or POI
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t ci=0;ci<4;ci++) // correlation index
+ {
+ fDiffFlowCorrelationsPro[t][pe][ci] = NULL;
+ } // end of for(Int_t ci=0;ci<4;ci++)
+ for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index
+ {
+ for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index
+ {
+ fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = NULL;
+ } // end of for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index
+ } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index
+ // correction terms for nua:
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms
+ {
+ for(Int_t cti=0;cti<9;cti++) // correction term index
+ {
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = NULL;
+ }
+ }
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI
+
+ // e) Initialize histograms holding final results.
+ for(Int_t t=0;t<2;t++) // type: RP or POI
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t ci=0;ci<4;ci++) // correlation index
+ {
+ fDiffFlowCorrelationsHist[t][pe][ci] = NULL;
+ fDiffFlowCumulants[t][pe][ci] = NULL;
+ fDiffFlow[t][pe][ci] = NULL;
+ } // end of for(Int_t ci=0;ci<4;ci++)
+ for(Int_t covarianceIndex=0;covarianceIndex<5;covarianceIndex++)
+ {
+ fDiffFlowCovariances[t][pe][covarianceIndex] = NULL;
+ } // end of for(Int_t covarianceIndex=0;covarianceIndex<5;covarianceIndex++)
+ // correction terms for nua:
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms
+ {
+ for(Int_t cti=0;cti<9;cti++) // correction term index
+ {
+ fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = NULL;
+ }
+ }
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI
+
+ // sum of event weights for reduced correlations:
+ for(Int_t t=0;t<2;t++) // type = RP or POI
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t p=0;p<2;p++) // power of weight is 1 or 2
+ {
+ for(Int_t ew=0;ew<4;ew++) // event weight index for reduced correlations
+ {
+ fDiffFlowSumOfEventWeights[t][pe][p][ew] = NULL;
+ }
+ }
+ }
+ }
+ // product of event weights for both types of correlations:
+ for(Int_t t=0;t<2;t++) // type = RP or POI
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index
+ {
+ for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index
+ {
+ fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = NULL;
+ }
+ }
+ }
+ }
+
+
+
+
+ /*
+
+ // nested lists in fDiffFlowProfiles:
+ for(Int_t t=0;t<2;t++)
+ {
+ fDFPType[t] = NULL;
+ for(Int_t pW=0;pW<2;pW++) // particle weights not used (0) or used (1)
+ {
+ fDFPParticleWeights[t][pW] = NULL;
+ for(Int_t eW=0;eW<2;eW++)
+ {
+ fDFPEventWeights[t][pW][eW] = NULL;
+ fDiffFlowCorrelations[t][pW][eW] = NULL;
+ fDiffFlowProductsOfCorrelations[t][pW][eW] = NULL;
+ for(Int_t sc=0;sc<2;sc++)
+ {
+ fDiffFlowCorrectionTerms[t][pW][eW][sc] = NULL;
+ }
+ }
+ }
+ }
+
+
+ */
+
+
+
+ /*
+ for(Int_t pW=0;pW<2;pW++) // particle weights not used (0) or used (1)
+ {
+ for(Int_t eW=0;eW<2;eW++)
+ {
+ // correlations:
+ for(Int_t correlationIndex=0;correlationIndex<4;correlationIndex++)
+ {
+ fCorrelationsPro[t][pW][eW][correlationIndex] = NULL;
+ }
+ // products of correlations:
+ for(Int_t productOfCorrelationsIndex=0;productOfCorrelationsIndex<6;productOfCorrelationsIndex++)
+ {
+ fProductsOfCorrelationsPro[t][pW][eW][productOfCorrelationsIndex] = NULL;
+ }
+ // correction terms:
+ for(Int_t sc=0;sc<2;sc++)
+ {
+ for(Int_t correctionsIndex=0;correctionsIndex<2;correctionsIndex++)
+ {
+ fCorrectionTermsPro[t][pW][eW][sc][correctionsIndex] = NULL;
+ }
+ }
+ }
+ }
+ */
+
+} // end of AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow()
+
+
+//================================================================================================================================
+ /*
+
+
+void AliFlowAnalysisWithQCumulants::CalculateCorrelationsForDifferentialFlow2D(TString type)
+{
+ // calculate all reduced correlations needed for differential flow for each (pt,eta) bin:
+
+ if(type == "RP") // to be improved (removed)
+ {
+ cout<<endl;
+ }
+ // ...
+
+
+ Int_t typeFlag = -1;
+
+ // reduced correlations ares stored in fCorrelationsPro[t][pW][index] and are indexed as follows:
+ // index:
+ // 0: <2'>
+ // 1: <4'>
+
+ // multiplicity:
+ Double_t dMult = (*fSMpk)(0,0);
+
+ // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
+ Double_t dReQ1n = (*fReQ)(0,0);
+ Double_t dReQ2n = (*fReQ)(1,0);
+ //Double_t dReQ3n = (*fReQ)(2,0);
+ //Double_t dReQ4n = (*fReQ)(3,0);
+ Double_t dImQ1n = (*fImQ)(0,0);
+ Double_t dImQ2n = (*fImQ)(1,0);
+ //Double_t dImQ3n = (*fImQ)(2,0);
+ //Double_t dImQ4n = (*fImQ)(3,0);
+
+ // looping over all (pt,eta) bins and calculating correlations needed for differential flow:
+ for(Int_t p=1;p<=fnBinsPt;p++)
+ {
+ for(Int_t e=1;e<=fnBinsEta;e++)
+ {
+ // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin):
+ Double_t p1n0kRe = 0.;
+ Double_t p1n0kIm = 0.;
+
+ // number of POIs in particular (pt,eta) bin:
+ Double_t mp = 0.;
+
+ // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular (pt,eta) bin):
+ Double_t q1n0kRe = 0.;
+ Double_t q1n0kIm = 0.;
+ Double_t q2n0kRe = 0.;
+ Double_t q2n0kIm = 0.;
+
+ // number of particles which are both RPs and POIs in particular (pt,eta) bin:
+ Double_t mq = 0.;
+
+ // q_{m*n,0}:
+ q1n0kRe = fReEBE2D[2][0][0]->GetBinContent(fReEBE2D[2][0][0]->GetBin(p,e))
+ * fReEBE2D[2][0][0]->GetBinEntries(fReEBE2D[2][0][0]->GetBin(p,e));
+ q1n0kIm = fImEBE2D[2][0][0]->GetBinContent(fImEBE2D[2][0][0]->GetBin(p,e))
+ * fImEBE2D[2][0][0]->GetBinEntries(fImEBE2D[2][0][0]->GetBin(p,e));
+ q2n0kRe = fReEBE2D[2][1][0]->GetBinContent(fReEBE2D[2][1][0]->GetBin(p,e))
+ * fReEBE2D[2][1][0]->GetBinEntries(fReEBE2D[2][1][0]->GetBin(p,e));
+ q2n0kIm = fImEBE2D[2][1][0]->GetBinContent(fImEBE2D[2][1][0]->GetBin(p,e))
+ * fImEBE2D[2][1][0]->GetBinEntries(fImEBE2D[2][1][0]->GetBin(p,e));
+
+ mq = fReEBE2D[2][0][0]->GetBinEntries(fReEBE2D[2][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here)
+
+ if(type == "POI")
+ {
+ // p_{m*n,0}:
+ p1n0kRe = fReEBE2D[1][0][0]->GetBinContent(fReEBE2D[1][0][0]->GetBin(p,e))
+ * fReEBE2D[1][0][0]->GetBinEntries(fReEBE2D[1][0][0]->GetBin(p,e));
+ p1n0kIm = fImEBE2D[1][0][0]->GetBinContent(fImEBE2D[1][0][0]->GetBin(p,e))
+ * fImEBE2D[1][0][0]->GetBinEntries(fImEBE2D[1][0][0]->GetBin(p,e));
+
+ mp = fReEBE2D[1][0][0]->GetBinEntries(fReEBE2D[1][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here)
+
+ typeFlag = 1;
+ }
+ else if(type == "RP")
+ {
+ // p_{m*n,0} = q_{m*n,0}:
+ p1n0kRe = q1n0kRe;
+ p1n0kIm = q1n0kIm;
+ mp = mq;
+
+ typeFlag = 0;
+ }
+
+ // count events with non-empty (pt,eta) bin:
+ if(mp>0)
+ {
+ fNonEmptyBins2D[typeFlag]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,1);
+ }
+
+ // 2'-particle correlation for particular (pt,eta) bin:
+ Double_t two1n1nPtEta = 0.;
+ if(mp*dMult-mq)
+ {
+ two1n1nPtEta = (p1n0kRe*dReQ1n+p1n0kIm*dImQ1n-mq)
+ / (mp*dMult-mq);
+
+ // fill the 2D profile to get the average correlation for each (pt,eta) bin:
+ if(type == "POI")
+ {
+ //f2pPtEtaPOI->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mp*dMult-mq);
+
+ fCorrelationsPro[1][0][0][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mp*dMult-mq);
+ }
+ else if(type == "RP")
+ {
+ //f2pPtEtaRP->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mp*dMult-mq);
+ fCorrelationsPro[0][0][0][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mp*dMult-mq);
+ }
+ } // end of if(mp*dMult-mq)
+
+ // 4'-particle correlation:
+ Double_t four1n1n1n1nPtEta = 0.;
+ if((mp-mq)*dMult*(dMult-1.)*(dMult-2.)
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression)
+ {
+ four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n)
+ - q2n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.))
+ - 2.*q2n0kIm*dReQ1n*dImQ1n
+ - p1n0kRe*(dReQ1n*dReQ2n+dImQ1n*dImQ2n)
+ + p1n0kIm*(dImQ1n*dReQ2n-dReQ1n*dImQ2n)
+ - 2.*dMult*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n)
+ - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*mq
+ + 6.*(q1n0kRe*dReQ1n+q1n0kIm*dImQ1n)
+ + 1.*(q2n0kRe*dReQ2n+q2n0kIm*dImQ2n)
+ + 2.*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n)
+ + 2.*mq*dMult
+ - 6.*mq)
+ / ((mp-mq)*dMult*(dMult-1.)*(dMult-2.)
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.));
+
+ // fill the 2D profile to get the average correlation for each (pt, eta) bin:
+ if(type == "POI")
+ {
+ //f4pPtEtaPOI->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta,
+ // (mp-mq)*dMult*(dMult-1.)*(dMult-2.)
+ // + mq*(dMult-1.)*(dMult-2.)*(dMult-3.));
+
+ fCorrelationsPro[1][0][0][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta,
+ (mp-mq)*dMult*(dMult-1.)*(dMult-2.)
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.));
+ }
+ else if(type == "RP")
+ {
+ //f4pPtEtaRP->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta,
+ // (mp-mq)*dMult*(dMult-1.)*(dMult-2.)
+ // + mq*(dMult-1.)*(dMult-2.)*(dMult-3.));
+
+ fCorrelationsPro[0][0][0][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta,
+ (mp-mq)*dMult*(dMult-1.)*(dMult-2.)
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.));
+ }
+ } // end of if((mp-mq)*dMult*(dMult-1.)*(dMult-2.)
+ // +mq*(dMult-1.)*(dMult-2.)*(dMult-3.))
+
+ } // end of for(Int_t e=1;e<=fnBinsEta;e++)
+ } // end of for(Int_t p=1;p<=fnBinsPt;p++)
+
+
+
+
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateCorrelationsForDifferentialFlow2D()
+
+
+
+
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CalculateWeightedCorrelationsForDifferentialFlow2D(TString type)
+{
+ // calculate all weighted correlations needed for differential flow
+
+ if(type == "RP") // to be improved (removed)
+ {
+ cout<<endl;
+ }
+ // ...
+
+
+
+
+ // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
+ Double_t dReQ1n1k = (*fReQ)(0,1);
+ Double_t dReQ2n2k = (*fReQ)(1,2);
+ Double_t dReQ1n3k = (*fReQ)(0,3);
+ //Double_t dReQ4n4k = (*fReQ)(3,4);
+ Double_t dImQ1n1k = (*fImQ)(0,1);
+ Double_t dImQ2n2k = (*fImQ)(1,2);
+ Double_t dImQ1n3k = (*fImQ)(0,3);
+ //Double_t dImQ4n4k = (*fImQ)(3,4);
+
+ // S^M_{p,k} (see .h file for the definition of fSMpk):
+ Double_t dSM1p1k = (*fSMpk)(0,1);
+ Double_t dSM1p2k = (*fSMpk)(0,2);
+ Double_t dSM1p3k = (*fSMpk)(0,3);
+ Double_t dSM2p1k = (*fSMpk)(1,1);
+ Double_t dSM3p1k = (*fSMpk)(2,1);
+
+ // looping over all (pt,eta) bins and calculating weighted correlations needed for differential flow:
+ for(Int_t p=1;p<=fnBinsPt;p++)
+ {
+ for(Int_t e=1;e<=fnBinsEta;e++)
+ {
+ // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin):
+ Double_t p1n0kRe = 0.;
+ Double_t p1n0kIm = 0.;
+
+ // number of POIs in particular (pt,eta) bin):
+ Double_t mp = 0.;
+
+ // real and imaginary parts of q_{m*n,k}:
+ // (weighted Q-vector evaluated for particles which are both RPs and POIs in particular (pt,eta) bin)
+ Double_t q1n2kRe = 0.;
+ Double_t q1n2kIm = 0.;
+ Double_t q2n1kRe = 0.;
+ Double_t q2n1kIm = 0.;
+
+ // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation)
+ Double_t s1p1k = 0.;
+ Double_t s1p2k = 0.;
+ Double_t s1p3k = 0.;
+
+ // M0111 from Eq. (118) in QC2c (to be improved (notation))
+ Double_t dM0111 = 0.;
+
+ if(type == "POI")
+ {
+ // p_{m*n,0}:
+ p1n0kRe = fReEBE2D[1][0][0]->GetBinContent(fReEBE2D[1][0][0]->GetBin(p,e))
+ * fReEBE2D[1][0][0]->GetBinEntries(fReEBE2D[1][0][0]->GetBin(p,e));
+ p1n0kIm = fImEBE2D[1][0][0]->GetBinContent(fImEBE2D[1][0][0]->GetBin(p,e))
+ * fImEBE2D[1][0][0]->GetBinEntries(fImEBE2D[1][0][0]->GetBin(p,e));
+
+ mp = fReEBE2D[1][0][0]->GetBinEntries(fReEBE2D[1][0][0]->GetBin(p,e));
+
+ // q_{m*n,k}:
+ q1n2kRe = fReEBE2D[2][0][2]->GetBinContent(fReEBE2D[2][0][2]->GetBin(p,e))
+ * fReEBE2D[2][0][2]->GetBinEntries(fReEBE2D[2][0][2]->GetBin(p,e));
+ q1n2kIm = fImEBE2D[2][0][2]->GetBinContent(fImEBE2D[2][0][2]->GetBin(p,e))
+ * fImEBE2D[2][0][2]->GetBinEntries(fImEBE2D[2][0][2]->GetBin(p,e));
+ q2n1kRe = fReEBE2D[2][1][1]->GetBinContent(fReEBE2D[2][1][1]->GetBin(p,e))
+ * fReEBE2D[2][1][1]->GetBinEntries(fReEBE2D[2][1][1]->GetBin(p,e));
+ q2n1kIm = fImEBE2D[2][1][1]->GetBinContent(fImEBE2D[2][1][1]->GetBin(p,e))
+ * fImEBE2D[2][1][1]->GetBinEntries(fImEBE2D[2][1][1]->GetBin(p,e));
+
+ // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation)
+ s1p1k = pow(fs2D[2][1]->GetBinContent(fs2D[2][1]->GetBin(p,e)),1.);
+ s1p2k = pow(fs2D[2][2]->GetBinContent(fs2D[2][2]->GetBin(p,e)),1.);
+ s1p3k = pow(fs2D[2][3]->GetBinContent(fs2D[2][3]->GetBin(p,e)),1.);
+
+ // M0111 from Eq. (118) in QC2c (to be improved (notation)):
+ dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k)
+ - 3.*(s1p1k*(dSM2p1k-dSM1p2k)
+ + 2.*(s1p3k-s1p2k*dSM1p1k));
+ }
+ else if(type == "RP")
+ {
+ p1n0kRe = fReEBE2D[0][0][0]->GetBinContent(fReEBE2D[0][0][0]->GetBin(p,e))
+ * fReEBE2D[0][0][0]->GetBinEntries(fReEBE2D[0][0][0]->GetBin(p,e));
+ p1n0kIm = fImEBE2D[0][0][0]->GetBinContent(fImEBE2D[0][0][0]->GetBin(p,e))
+ * fImEBE2D[0][0][0]->GetBinEntries(fImEBE2D[0][0][0]->GetBin(p,e));
+
+ mp = fReEBE2D[0][0][0]->GetBinEntries(fReEBE2D[0][0][0]->GetBin(p,e));
+
+ // q_{m*n,k}:
+ q1n2kRe = fReEBE2D[0][0][2]->GetBinContent(fReEBE2D[0][0][2]->GetBin(p,e))
+ * fReEBE2D[0][0][2]->GetBinEntries(fReEBE2D[0][0][2]->GetBin(p,e));
+ q1n2kIm = fImEBE2D[0][0][2]->GetBinContent(fImEBE2D[0][0][2]->GetBin(p,e))
+ * fImEBE2D[0][0][2]->GetBinEntries(fImEBE2D[0][0][2]->GetBin(p,e));
+ q2n1kRe = fReEBE2D[0][1][1]->GetBinContent(fReEBE2D[0][1][1]->GetBin(p,e))
+ * fReEBE2D[0][1][1]->GetBinEntries(fReEBE2D[0][1][1]->GetBin(p,e));
+ q2n1kIm = fImEBE2D[0][1][1]->GetBinContent(fImEBE2D[0][1][1]->GetBin(p,e))
+ * fImEBE2D[0][1][1]->GetBinEntries(fImEBE2D[0][1][1]->GetBin(p,e));
+
+ // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation)
+ s1p1k = pow(fs2D[0][1]->GetBinContent(fs2D[0][1]->GetBin(p,e)),1.);
+ s1p2k = pow(fs2D[0][2]->GetBinContent(fs2D[0][2]->GetBin(p,e)),1.);
+ s1p3k = pow(fs2D[0][3]->GetBinContent(fs2D[0][3]->GetBin(p,e)),1.);
+
+ // M0111 from Eq. (118) in QC2c (to be improved (notation)):
+ dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k)
+ - 3.*(s1p1k*(dSM2p1k-dSM1p2k)
+ + 2.*(s1p3k-s1p2k*dSM1p1k));
+ //...............................................................................................
+ }
+
+ // 2'-particle correlation:
+ Double_t two1n1nW0W1PtEta = 0.;
+ if(mp*dSM1p1k-s1p1k)
+ {
+ two1n1nW0W1PtEta = (p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k-s1p1k)
+ / (mp*dSM1p1k-s1p1k);
+
+ // fill the 2D profile to get the average correlation for each (pt, eta) bin:
+ if(type == "POI")
+ {
+ //f2pPtEtaPOIW->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nW0W1PtEta,
+ // mp*dSM1p1k-s1p1k);
+ fCorrelationsPro[1][1][0][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nW0W1PtEta,mp*dSM1p1k-s1p1k);
+ }
+ else if(type == "RP")
+ {
+ //f2pPtEtaRPW->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nW0W1PtEta,
+ // mp*dSM1p1k-s1p1k);
+ fCorrelationsPro[0][1][0][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nW0W1PtEta,mp*dSM1p1k-s1p1k);
+ }
+ } // end of if(mp*dMult-dmPrimePrimePtEta)
+
+ // 4'-particle correlation:
+ Double_t four1n1n1n1nW0W1W1W1PtEta = 0.;
+ if(dM0111)
+ {
+ four1n1n1n1nW0W1W1W1PtEta = ((pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k)
+ - q2n1kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))
+ - 2.*q2n1kIm*dReQ1n1k*dImQ1n1k
+ - p1n0kRe*(dReQ1n1k*dReQ2n2k+dImQ1n1k*dImQ2n2k)
+ + p1n0kIm*(dImQ1n1k*dReQ2n2k-dReQ1n1k*dImQ2n2k)
+ - 2.*dSM1p2k*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k)
+ - 2.*(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*s1p1k
+ + 6.*(q1n2kRe*dReQ1n1k+q1n2kIm*dImQ1n1k)
+ + 1.*(q2n1kRe*dReQ2n2k+q2n1kIm*dImQ2n2k)
+ + 2.*(p1n0kRe*dReQ1n3k+p1n0kIm*dImQ1n3k)
+ + 2.*s1p1k*dSM1p2k
+ - 6.*s1p3k)
+ / dM0111; // to be imropoved (notation of dM0111)
+
+ // fill the 2D profile to get the average correlation for each (pt, eta) bin:
+ if(type == "POI")
+ {
+ //f4pPtEtaPOIW->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nW0W1W1W1PtEta,dM0111);
+ fCorrelationsPro[1][1][0][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nW0W1W1W1PtEta,dM0111);
+ }
+ else if(type == "RP")
+ {
+ //f4pPtEtaRPW->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nW0W1W1W1PtEta,dM0111);
+ fCorrelationsPro[0][1][0][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nW0W1W1W1PtEta,dM0111);
+ }
+ } // end of if(dM0111)
+
+ } // end of for(Int_t e=1;e<=fnBinsEta;e++)
+ } // end of for(Int_t p=1;p<=fnBinsPt;p++)
+
+
+
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateWeightedCorrelationsForDifferentialFlow2D(TString type)
+
+
+//================================================================================================================================
+
+ */
+
+/*
+void AliFlowAnalysisWithQCumulants::FinalizeCorrelationsForDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights)
+{
+ // 1.) Access average for 2D correlations from profiles and store them in 2D final results histograms;
+ // 2.) Access spread for 2D correlations from profiles, calculate error and store it in 2D final results histograms;
+ // 3.) Make projections along pt and eta axis and store results and errors in 1D final results histograms.
+
+ Int_t typeFlag = -1;
+ Int_t pWeightsFlag = -1;
+ Int_t eWeightsFlag = -1;
+
+ if(type == "RP")
+ {
+ typeFlag = 0;
+ } else if(type == "POI")
+ {
+ typeFlag = 1;
+ } else
+ {
+ cout<<"WARNING: type must be either RP or POI in AFAWQC::FCFDF() !!!!"<<endl;
+ exit(0);
+ }
+
+ if(!useParticleWeights)
+ {
+ pWeightsFlag = 0;
+ } else
+ {
+ pWeightsFlag = 1;
+ }
+
+ if(eventWeights == "exact")
+ {
+ eWeightsFlag = 0;
+ }
+
+ // shortcuts:
+ Int_t t = typeFlag;
+ Int_t pW = pWeightsFlag;
+ Int_t eW = eWeightsFlag;
+
+ // from 2D histogram fNonEmptyBins2D make two 1D histograms fNonEmptyBins1D in pt and eta (to be improved (i.e. moved somewhere else))
+ // pt:
+ for(Int_t p=1;p<fnBinsPt;p++)
+ {
+ Double_t contentPt = 0.;
+ for(Int_t e=1;e<=fnBinsEta;e++)
+ {
+ contentPt += (fNonEmptyBins2D[t]->GetBinContent(fNonEmptyBins2D[t]->GetBin(p,e)));
+ }
+ fNonEmptyBins1D[t][0]->SetBinContent(p,contentPt);
+ }
+ // eta:
+ for(Int_t e=1;e<fnBinsEta;e++)
+ {
+ Double_t contentEta = 0.;
+ for(Int_t p=1;p<=fnBinsPt;p++)
+ {
+ contentEta += (fNonEmptyBins2D[t]->GetBinContent(fNonEmptyBins2D[t]->GetBin(p,e)));
+ }
+ fNonEmptyBins1D[t][1]->SetBinContent(e,contentEta);
+ }
+
+ // from 2D profile in (pt,eta) make two 1D profiles in (pt) and (eta):
+ TProfile *profile[2][4]; // [0=pt,1=eta][correlation index] // to be improved (do not hardwire the correlation index)
+
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t ci=0;ci<4;ci++) // correlation index
+ {
+ if(pe==0) profile[pe][ci] = this->MakePtProjection(fCorrelationsPro[t][pW][eW][ci]);
+ if(pe==1) profile[pe][ci] = this->MakeEtaProjection(fCorrelationsPro[t][pW][eW][ci]);
+ }
+ }
+
+ // transfer 2D profile into 2D histogram:
+ // to be improved (see in documentation if there is a method to transfer values from 2D profile into 2D histogram)
+ for(Int_t ci=0;ci<4;ci++)
+ {
+ for(Int_t p=1;p<=fnBinsPt;p++)
+ {
+ for(Int_t e=1;e<=fnBinsEta;e++)
+ {
+ Double_t correlation = fCorrelationsPro[t][pW][eW][ci]->GetBinContent(fCorrelationsPro[t][pW][eW][ci]->GetBin(p,e));
+ Double_t spread = fCorrelationsPro[t][pW][eW][ci]->GetBinError(fCorrelationsPro[t][pW][eW][ci]->GetBin(p,e));
+ Double_t nEvts = fNonEmptyBins2D[t]->GetBinContent(fNonEmptyBins2D[t]->GetBin(p,e));
+ Double_t error = 0.;
+ fFinalCorrelations2D[t][pW][eW][ci]->SetBinContent(fFinalCorrelations2D[t][pW][eW][ci]->GetBin(p,e),correlation);
+ if(nEvts>0)
+ {
+ error = spread/pow(nEvts,0.5);
+ fFinalCorrelations2D[t][pW][eW][ci]->SetBinError(fFinalCorrelations2D[t][pW][eW][ci]->GetBin(p,e),error);
+ }
+ } // end of for(Int_t e=1;e<=fnBinsEta;e++)
+ } // end of for(Int_t p=1;p<=fnBinsPt;p++)
+ } // end of for(Int_t ci=0;ci<4;ci++)
+
+ // transfer 1D profile into 1D histogram (pt):
+ // to be improved (see in documentation if there is a method to transfer values from 1D profile into 1D histogram)
+ for(Int_t ci=0;ci<4;ci++)
+ {
+ for(Int_t p=1;p<=fnBinsPt;p++)
+ {
+ if(profile[0][ci])
+ {
+ Double_t correlation = profile[0][ci]->GetBinContent(p);
+ Double_t spread = profile[0][ci]->GetBinError(p);
+ Double_t nEvts = fNonEmptyBins1D[t][0]->GetBinContent(p);
+ Double_t error = 0.;
+ fFinalCorrelations1D[t][pW][eW][0][ci]->SetBinContent(p,correlation);
+ if(nEvts>0)
+ {
+ error = spread/pow(nEvts,0.5);
+ fFinalCorrelations1D[t][pW][eW][0][ci]->SetBinError(p,error);
+ }
+ }
+ } // end of for(Int_t p=1;p<=fnBinsPt;p++)
+ } // end of for(Int_t ci=0;ci<4;ci++)
+
+ // transfer 1D profile into 1D histogram (eta):
+ // to be improved (see in documentation if there is a method to transfer values from 1D profile into 1D histogram)
+ for(Int_t ci=0;ci<4;ci++)
+ {
+ for(Int_t e=1;e<=fnBinsEta;e++)
+ {
+ if(profile[1][ci])
+ {
+ Double_t correlation = profile[1][ci]->GetBinContent(e);
+ fFinalCorrelations1D[t][pW][eW][1][ci]->SetBinContent(e,correlation);
+ }
+ } // end of for(Int_t e=1;e<=fnBinsEta;e++)
+ } // end of for(Int_t ci=0;ci<4;ci++)
+
+} // end of void AliFlowAnalysisWithQCumulants::FinalizeCorrelationsForDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights)
+*/
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulants(TString type, TString ptOrEta)
+{
+ // calcualate cumulants for differential flow from measured correlations
+ // Remark: cumulants calculated here are NOT corrected for non-uniform acceptance. This correction is applied in the method ...
+ // to be improved (description)
+
+ Int_t typeFlag = -1;
+ Int_t ptEtaFlag = -1;
+
+ if(type == "RP")
+ {
+ typeFlag = 0;
+ } else if(type == "POI")
+ {
+ typeFlag = 1;
+ }
+
+ if(ptOrEta == "Pt")
+ {
+ ptEtaFlag = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ ptEtaFlag = 1;
+ }
+
+ // shortcuts:
+ Int_t t = typeFlag;
+ Int_t pe = ptEtaFlag;
+
+ // common:
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};
+
+ // correlation <<2>>:
+ Double_t two = fIntFlowCorrelationsHist->GetBinContent(1);
+
+ // 1D:
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+ {
+ // reduced correlations:
+ Double_t twoPrime = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); // <<2'>>(pt)
+ Double_t fourPrime = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); // <<4'>>(pt)
+ // final statistical error of reduced correlations:
+ //Double_t twoPrimeError = fFinalCorrelations1D[t][pW][eW][0][0]->GetBinError(p);
+ // QC{2'}:
+ Double_t qc2Prime = twoPrime; // QC{2'}
+ //Double_t qc2PrimeError = twoPrimeError; // final stat. error of QC{2'}
+ fDiffFlowCumulants[t][pe][0]->SetBinContent(b,qc2Prime);
+ //fFinalCumulantsPt[t][pW][eW][nua][0]->SetBinError(p,qc2PrimeError);
+ // QC{4'}:
+ Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>>
+ fDiffFlowCumulants[t][pe][1]->SetBinContent(b,qc4Prime);
+ } // end of for(Int_t p=1;p<=fnBinsPt;p++)
+
+
+ /*
+ // 2D (pt,eta):
+ // to be improved (see documentation if I can do all this without looping)
+ for(Int_t p=1;p<=fnBinsPt;p++)
+ {
+ for(Int_t e=1;e<=fnBinsEta;e++)
+ {
+ // reduced correlations:
+ Double_t twoPrime = fFinalCorrelations2D[t][pW][eW][0]->GetBinContent(fFinalCorrelations2D[t][pW][eW][0]->GetBin(p,e)); // <<2'>>(pt,eta)
+ Double_t fourPrime = fFinalCorrelations2D[t][pW][eW][1]->GetBinContent(fFinalCorrelations2D[t][pW][eW][1]->GetBin(p,e)); // <<4'>>(pt,eta)
+ for(Int_t nua=0;nua<2;nua++)
+ {
+ // QC{2'}:
+ Double_t qc2Prime = twoPrime; // QC{2'} = <<2'>>
+ fFinalCumulants2D[t][pW][eW][nua][0]->SetBinContent(fFinalCumulants2D[t][pW][eW][nua][0]->GetBin(p,e),qc2Prime);
+ // QC{4'}:
+ Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>>
+ fFinalCumulants2D[t][pW][eW][nua][1]->SetBinContent(fFinalCumulants2D[t][pW][eW][nua][1]->GetBin(p,e),qc4Prime);
+ } // end of for(Int_t nua=0;nua<2;nua++)
+ } // end of for(Int_t e=1;e<=fnBinsEta;e++)
+ } // end of for(Int_t p=1;p<=fnBinsPt;p++)
+ */
+
+} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulants(TString type, Bool_t useParticleWeights, TString eventWeights);
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type)
+{
+ // calculate final results for integrated flow of RPs and POIs
+
+ Int_t typeFlag = -1;
+
+ if(type == "RP")
+ {
+ typeFlag = 0;
+ } else if(type == "POI")
+ {
+ typeFlag = 1;
+ } else
+ {
+ cout<<"WARNING: type must be either RP or POI in AFAWQC::CDF() !!!!"<<endl;
+ exit(0);
+ }
+
+ // shortcuts:
+ Int_t t = typeFlag;
+
+ // pt yield:
+ TH1F *yield2ndPt = NULL;
+ TH1F *yield4thPt = NULL;
+ TH1F *yield6thPt = NULL;
+ TH1F *yield8thPt = NULL;
+
+ if(type == "POI")
+ {
+ yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtPOI())->Clone();
+ yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtPOI())->Clone();
+ yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtPOI())->Clone();
+ yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtPOI())->Clone();
+ }
+ else if(type == "RP")
+ {
+ yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtRP())->Clone();
+ yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtRP())->Clone();
+ yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtRP())->Clone();
+ yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtRP())->Clone();
+ }
+
+ Int_t nBinsPt = yield2ndPt->GetNbinsX();
+
+ TH1D *flow2ndPt = NULL;
+ TH1D *flow4thPt = NULL;
+ TH1D *flow6thPt = NULL;
+ TH1D *flow8thPt = NULL;
+
+ // to be improved (hardwired pt index)
+ flow2ndPt = (TH1D*)fDiffFlow[t][0][0]->Clone();
+ flow4thPt = (TH1D*)fDiffFlow[t][0][1]->Clone();
+ flow6thPt = (TH1D*)fDiffFlow[t][0][2]->Clone();
+ flow8thPt = (TH1D*)fDiffFlow[t][0][3]->Clone();
+
+ Double_t dvn2nd = 0., dvn4th = 0., dvn6th = 0., dvn8th = 0.; // differential flow
+ Double_t dErrvn2nd = 0., dErrvn4th = 0., dErrvn6th = 0., dErrvn8th = 0.; // error on differential flow
+
+ Double_t dVn2nd = 0., dVn4th = 0., dVn6th = 0., dVn8th = 0.; // integrated flow
+ Double_t dErrVn2nd = 0., dErrVn4th = 0., dErrVn6th = 0., dErrVn8th = 0.; // error on integrated flow
+
+ Double_t dYield2nd = 0., dYield4th = 0., dYield6th = 0., dYield8th = 0.; // pt yield
+ Double_t dSum2nd = 0., dSum4th = 0., dSum6th = 0., dSum8th = 0.; // needed for normalizing integrated flow
+
+ // looping over pt bins:
+ for(Int_t p=1;p<nBinsPt+1;p++)
+ {
+ dvn2nd = flow2ndPt->GetBinContent(p);
+ dvn4th = flow4thPt->GetBinContent(p);
+ dvn6th = flow6thPt->GetBinContent(p);
+ dvn8th = flow8thPt->GetBinContent(p);
+
+ dErrvn2nd = flow2ndPt->GetBinError(p);
+ dErrvn4th = flow4thPt->GetBinError(p);
+ dErrvn6th = flow6thPt->GetBinError(p);
+ dErrvn8th = flow8thPt->GetBinError(p);
+
+ dYield2nd = yield2ndPt->GetBinContent(p);
+ dYield4th = yield4thPt->GetBinContent(p);
+ dYield6th = yield6thPt->GetBinContent(p);
+ dYield8th = yield8thPt->GetBinContent(p);
+
+ dVn2nd += dvn2nd*dYield2nd;
+ dVn4th += dvn4th*dYield4th;
+ dVn6th += dvn6th*dYield6th;
+ dVn8th += dvn8th*dYield8th;
+
+ dSum2nd += dYield2nd;
+ dSum4th += dYield4th;
+ dSum6th += dYield6th;
+ dSum8th += dYield8th;
+
+ dErrVn2nd += dYield2nd*dYield2nd*dErrvn2nd*dErrvn2nd; // ro be improved (check this relation)
+ dErrVn4th += dYield4th*dYield4th*dErrvn4th*dErrvn4th;
+ dErrVn6th += dYield6th*dYield6th*dErrvn6th*dErrvn6th;
+ dErrVn8th += dYield8th*dYield8th*dErrvn8th*dErrvn8th;
+
+ } // end of for(Int_t p=1;p<nBinsPt+1;p++)
+
+ // normalizing the results for integrated flow:
+ if(dSum2nd)
+ {
+ dVn2nd /= dSum2nd;
+ dErrVn2nd /= (dSum2nd*dSum2nd);
+ dErrVn2nd = TMath::Sqrt(dErrVn2nd);
+ }
+ if(dSum4th)
+ {
+ dVn4th /= dSum4th;
+ dErrVn4th /= (dSum4th*dSum4th);
+ dErrVn4th = TMath::Sqrt(dErrVn4th);
+ }
+ //if(dSum6th) dVn6th/=dSum6th;
+ //if(dSum8th) dVn8th/=dSum8th;
+
+ // storing the results for integrated flow in common histos: (to be improved: new method for this?)
+ if(type == "POI")
+ {
+ fCommonHistsResults2nd->FillIntegratedFlowPOI(dVn2nd,dErrVn2nd);
+ fCommonHistsResults4th->FillIntegratedFlowPOI(dVn4th,dErrVn4th);
+ fCommonHistsResults6th->FillIntegratedFlowPOI(dVn6th,0.); // to be improved (errors)
+ fCommonHistsResults8th->FillIntegratedFlowPOI(dVn8th,0.); // to be improved (errors)
+ }
+ else if (type == "RP")
+ {
+ fCommonHistsResults2nd->FillIntegratedFlowRP(dVn2nd,dErrVn2nd);
+ fCommonHistsResults4th->FillIntegratedFlowRP(dVn4th,dErrVn4th);
+ fCommonHistsResults6th->FillIntegratedFlowRP(dVn6th,0.); // to be improved (errors)
+ fCommonHistsResults8th->FillIntegratedFlowRP(dVn8th,0.); // to be improved (errors)
+ }
+
+ delete flow2ndPt;
+ delete flow4thPt;
+ //delete flow6thPt;
+ //delete flow8thPt;
+
+ delete yield2ndPt;
+ delete yield4thPt;
+ delete yield6thPt;
+ delete yield8thPt;
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type)
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions()
+{
+ // Initialize all arrays used for distributions.
+
+ // a) Initialize arrays of histograms used to hold distributions of correlations;
+ // b) Initialize array to hold min and max values of correlations.
+
+ // a) Initialize arrays of histograms used to hold distributions of correlations:
+ for(Int_t di=0;di<4;di++) // distribution index
+ {
+ fDistributions[di] = NULL;
+ }
+
+ // b) Initialize default min and max values of correlations:
+ // (Remark: The default values bellow were chosen for v2=5% and M=500)
+ fMinValueOfCorrelation[0] = -0.01; // <2>_min
+ fMaxValueOfCorrelation[0] = 0.04; // <2>_max
+ fMinValueOfCorrelation[1] = -0.00002; // <4>_min
+ fMaxValueOfCorrelation[1] = 0.00015; // <4>_max
+ fMinValueOfCorrelation[2] = -0.0000003; // <6>_min
+ fMaxValueOfCorrelation[2] = 0.0000006; // <6>_max
+ fMinValueOfCorrelation[3] = -0.000000006; // <8>_min
+ fMaxValueOfCorrelation[3] = 0.000000003; // <8>_max
+
+} // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions()
+{
+ // a) Book profile to hold all flags for distributions of correlations;
+ // b) Book all histograms to hold distributions of correlations.
+
+ TString correlationIndex[4] = {"<2>","<4>","<6>","<8>"}; // to be improved (should I promote this to data members?)
+
+ // a) Book profile to hold all flags for distributions of correlations:
+ TString distributionsFlagsName = "fDistributionsFlags";
+ distributionsFlagsName += fAnalysisLabel->Data();
+ fDistributionsFlags = new TProfile(distributionsFlagsName.Data(),"Flags for Distributions of Correlations",9,0,9);
+ fDistributionsFlags->SetTickLength(-0.01,"Y");
+ fDistributionsFlags->SetMarkerStyle(25);
+ fDistributionsFlags->SetLabelSize(0.05);
+ fDistributionsFlags->SetLabelOffset(0.02,"Y");
+ fDistributionsFlags->GetXaxis()->SetBinLabel(1,"Store or not?");
+ fDistributionsFlags->GetXaxis()->SetBinLabel(2,"<2>_{min}");
+ fDistributionsFlags->GetXaxis()->SetBinLabel(3,"<2>_{max}");
+ fDistributionsFlags->GetXaxis()->SetBinLabel(4,"<4>_{min}");
+ fDistributionsFlags->GetXaxis()->SetBinLabel(5,"<4>_{max}");
+ fDistributionsFlags->GetXaxis()->SetBinLabel(6,"<6>_{min}");
+ fDistributionsFlags->GetXaxis()->SetBinLabel(7,"<6>_{max}");
+ fDistributionsFlags->GetXaxis()->SetBinLabel(8,"<8>_{min}");
+ fDistributionsFlags->GetXaxis()->SetBinLabel(9,"<8>_{max}");
+ fDistributionsList->Add(fDistributionsFlags);
+
+ // b) Book all histograms to hold distributions of correlations.
+ if(fStoreDistributions)
+ {
+ TString distributionsName = "fDistributions";
+ distributionsName += fAnalysisLabel->Data();
+ for(Int_t di=0;di<4;di++) // distribution index
+ {
+ fDistributions[di] = new TH1D(Form("Distribution of %s",correlationIndex[di].Data()),Form("Distribution of %s",correlationIndex[di].Data()),10000,fMinValueOfCorrelation[di],fMaxValueOfCorrelation[di]);
+ fDistributions[di]->SetXTitle(correlationIndex[di].Data());
+ fDistributionsList->Add(fDistributions[di]);
+ } // end of for(Int_t di=0;di<4;di++) // distribution index
+ } // end of if(fStoreDistributions)
+
+} // end of void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::StoreFlagsForDistributions()
+{
+ // Store all flags for distributiuons of correlations in profile fDistributionsFlags.
+
+ if(!fDistributionsFlags)
+ {
+ cout<<"WARNING: fDistributionsFlags is NULL in AFAWQC::SDF() !!!!"<<endl;
+ exit(0);
+ }
+
+ fDistributionsFlags->Fill(0.5,(Int_t)fStoreDistributions); // histos with distributions of correlations stored or not in the output file
+ // store min and max values of correlations:
+ for(Int_t di=0;di<4;di++) // distribution index
+ {
+ fDistributionsFlags->Fill(1.5+2.*(Double_t)di,fMinValueOfCorrelation[di]);
+ fDistributionsFlags->Fill(2.5+2.*(Double_t)di,fMaxValueOfCorrelation[di]);
+ }
+
+} // end of void AliFlowAnalysisWithQCumulants::StoreFlagsForDistributions()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::StoreDistributionsOfCorrelations()
+{
+ // Store distributions of correlations.
+
+ if(!(fIntFlowCorrelationsEBE && fIntFlowEventWeightsForCorrelationsEBE))
+ {
+ cout<<"WARNING: fIntFlowCorrelationsEBE && fIntFlowEventWeightsForCorrelationsEBE"<<endl;
+ cout<<" is NULL in AFAWQC::SDOC() !!!!"<<endl;
+ exit(0);
+ }
+
+ for(Int_t di=0;di<4;di++) // distribution index
+ {
+ if(!fDistributions[di])
+ {
+ cout<<"WARNING: fDistributions[di] is NULL in AFAWQC::SDOC() !!!!"<<endl;
+ cout<<"di = "<<di<<endl;
+ exit(0);
+ } else
+ {
+ fDistributions[di]->Fill(fIntFlowCorrelationsEBE->GetBinContent(di+1),fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(di+1));
+ }
+ } // end of for(Int_t di=0;di<4;di++) // distribution index
+
+} // end of void AliFlowAnalysisWithQCumulants::StoreDistributionsOfCorrelations()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::BookAndNestAllLists()
+{
+ // Book and nest all lists nested in the base list fHistList.
+ // a) Book and nest lists for integrated flow;
+ // b) Book and nest lists for differential flow;
+ // c) Book and nest list for particle weights;
+ // d) Book and nest list for distributions;
+ // e) Book and nest list for nested loops;
+
+ // a) Book and nest all lists for integrated flow:
+ // base list for integrated flow:
+ fIntFlowList = new TList();
+ fIntFlowList->SetName("Integrated Flow");
+ fIntFlowList->SetOwner(kTRUE);
+ fHistList->Add(fIntFlowList);
+ // list holding profiles:
+ fIntFlowProfiles = new TList();
+ fIntFlowProfiles->SetName("Profiles");
+ fIntFlowProfiles->SetOwner(kTRUE);
+ fIntFlowList->Add(fIntFlowProfiles);
+ // list holding histograms with results:
+ fIntFlowResults = new TList();
+ fIntFlowResults->SetName("Results");
+ fIntFlowResults->SetOwner(kTRUE);
+ fIntFlowList->Add(fIntFlowResults);
+
+ // b) Book and nest lists for differential flow;
+ fDiffFlowList = new TList();
+ fDiffFlowList->SetName("Differential Flow");
+ fDiffFlowList->SetOwner(kTRUE);
+ fHistList->Add(fDiffFlowList);
+ // list holding profiles:
+ fDiffFlowProfiles = new TList();
+ fDiffFlowProfiles->SetName("Profiles");
+ fDiffFlowProfiles->SetOwner(kTRUE);
+ fDiffFlowList->Add(fDiffFlowProfiles);
+ // list holding histograms with results:
+ fDiffFlowResults = new TList();
+ fDiffFlowResults->SetName("Results");
+ fDiffFlowResults->SetOwner(kTRUE);
+ fDiffFlowList->Add(fDiffFlowResults);
+ // flags used for naming nested lists in list fDiffFlowProfiles and fDiffFlowResults:
+ TList list;
+ list.SetOwner(kTRUE);
+ TString typeFlag[2] = {"RP","POI"};
+ TString ptEtaFlag[2] = {"p_{T}","#eta"};
+ TString powerFlag[2] = {"linear","quadratic"};
+ // nested lists in fDiffFlowProfiles (~/Differential Flow/Profiles):
+ for(Int_t t=0;t<2;t++) // type: RP or POI
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ // list holding profiles with correlations:
+ fDiffFlowCorrelationsProList[t][pe] = (TList*)list.Clone();
+ fDiffFlowCorrelationsProList[t][pe]->SetName(Form("Profiles with correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));
+ fDiffFlowProfiles->Add(fDiffFlowCorrelationsProList[t][pe]);
+ // list holding profiles with products of correlations:
+ fDiffFlowProductOfCorrelationsProList[t][pe] = (TList*)list.Clone();
+ fDiffFlowProductOfCorrelationsProList[t][pe]->SetName(Form("Profiles with products of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));
+ fDiffFlowProfiles->Add(fDiffFlowProductOfCorrelationsProList[t][pe]);
+ // list holding profiles with corrections:
+ fDiffFlowCorrectionsProList[t][pe] = (TList*)list.Clone();
+ fDiffFlowCorrectionsProList[t][pe]->SetName(Form("Profiles with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));
+ fDiffFlowProfiles->Add(fDiffFlowCorrectionsProList[t][pe]);
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI
+ // nested lists in fDiffFlowResults (~/Differential Flow/Results):
+ for(Int_t t=0;t<2;t++) // type: RP or POI
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ // list holding histograms with correlations:
+ fDiffFlowCorrelationsHistList[t][pe] = (TList*)list.Clone();
+ fDiffFlowCorrelationsHistList[t][pe]->SetName(Form("Correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));
+ fDiffFlowResults->Add(fDiffFlowCorrelationsHistList[t][pe]);
+ // list holding histograms with corrections:
+ fDiffFlowCorrectionsHistList[t][pe] = (TList*)list.Clone();
+ fDiffFlowCorrectionsHistList[t][pe]->SetName(Form("Histograms with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));
+ fDiffFlowResults->Add(fDiffFlowCorrectionsHistList[t][pe]);
+ for(Int_t power=0;power<2;power++)
+ {
+ // list holding histograms with sums of event weights:
+ fDiffFlowSumOfEventWeightsHistList[t][pe][power] = (TList*)list.Clone();
+ fDiffFlowSumOfEventWeightsHistList[t][pe][power]->SetName(Form("Sum of %s event weights (%s, %s)",powerFlag[power].Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data()));
+ fDiffFlowResults->Add(fDiffFlowSumOfEventWeightsHistList[t][pe][power]);
+ } // end of for(Int_t power=0;power<2;power++)
+ // list holding histograms with sums of products of event weights:
+ fDiffFlowSumOfProductOfEventWeightsHistList[t][pe] = (TList*)list.Clone();
+ fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]->SetName(Form("Sum of products of event weights (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));
+ fDiffFlowResults->Add(fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]);
+ // list holding histograms with covariances of correlations:
+ fDiffFlowCovariancesHistList[t][pe] = (TList*)list.Clone();
+ fDiffFlowCovariancesHistList[t][pe]->SetName(Form("Covariances of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));
+ fDiffFlowResults->Add(fDiffFlowCovariancesHistList[t][pe]);
+ // list holding histograms with differential Q-cumulants:
+ fDiffFlowCumulantsHistList[t][pe] = (TList*)list.Clone();
+ fDiffFlowCumulantsHistList[t][pe]->SetName(Form("Differential Q-cumulants (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));
+ fDiffFlowResults->Add(fDiffFlowCumulantsHistList[t][pe]);
+ // list holding histograms with differential flow estimates from Q-cumulants:
+ fDiffFlowHistList[t][pe] = (TList*)list.Clone();
+ fDiffFlowHistList[t][pe]->SetName(Form("Differential flow (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));
+ fDiffFlowResults->Add(fDiffFlowHistList[t][pe]);
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI
+
+ // c) Book and nest list for particle weights:
+ fWeightsList->SetName("Weights");
+ fWeightsList->SetOwner(kTRUE);
+ fHistList->Add(fWeightsList);
+
+ // d) Book and nest list for distributions:
+ fDistributionsList = new TList();
+ fDistributionsList->SetName("Distributions");
+ fDistributionsList->SetOwner(kTRUE);
+ fHistList->Add(fDistributionsList);
+
+ // e) Book and nest list for nested loops:
+ fNestedLoopsList = new TList();
+ fNestedLoopsList->SetName("Nested Loops");
+ fNestedLoopsList->SetOwner(kTRUE);
+ fHistList->Add(fNestedLoopsList);
+
+} // end of void AliFlowAnalysisWithQCumulants::BookAndNestAllLists()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type)
+{
+ // fill common result histograms for differential flow
+
+ Int_t typeFlag = -1;
+ //Int_t ptEtaFlag = -1;
+
+ if(type == "RP")
+ {
+ typeFlag = 0;
+ } else if(type == "POI")
+ {
+ typeFlag = 1;
+ }
+
+ // shortcuts:
+ Int_t t = typeFlag;
+ //Int_t pe = ptEtaFlag;
+
+ // to be improved (implement protection here)
+
+ if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th))
+ {
+ cout<<"WARNING: fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th"<<endl;
+ cout<<" is NULL in AFAWQC::FCHRIF() !!!!"<<endl;
+ exit(0);
+ }
+
+ // pt:
+ for(Int_t p=1;p<=fnBinsPt;p++)
+ {
+ Double_t v2 = fDiffFlow[t][0][0]->GetBinContent(p);
+ Double_t v4 = fDiffFlow[t][0][1]->GetBinContent(p);
+ Double_t v6 = fDiffFlow[t][0][2]->GetBinContent(p);
+ Double_t v8 = fDiffFlow[t][0][3]->GetBinContent(p);
+
+ Double_t v2Error = fDiffFlow[t][0][0]->GetBinError(p);
+ Double_t v4Error = fDiffFlow[t][0][1]->GetBinError(p);
+ //Double_t v6Error = fFinalFlow1D[t][pW][nua][0][2]->GetBinError(p);
+ //Double_t v8Error = fFinalFlow1D[t][pW][nua][0][3]->GetBinError(p);
+
+ if(type == "RP")
+ {
+ fCommonHistsResults2nd->FillDifferentialFlowPtRP(p,v2,v2Error);
+ fCommonHistsResults4th->FillDifferentialFlowPtRP(p,v4,v4Error);
+ fCommonHistsResults6th->FillDifferentialFlowPtRP(p,v6,0.);
+ fCommonHistsResults8th->FillDifferentialFlowPtRP(p,v8,0.);
+ } else if(type == "POI")
+ {
+ fCommonHistsResults2nd->FillDifferentialFlowPtPOI(p,v2,v2Error);
+ fCommonHistsResults4th->FillDifferentialFlowPtPOI(p,v4,v4Error);
+ fCommonHistsResults6th->FillDifferentialFlowPtPOI(p,v6,0.);
+ fCommonHistsResults8th->FillDifferentialFlowPtPOI(p,v8,0.);
+ }
+ } // end of for(Int_t p=1;p<=fnBinsPt;p++)
+
+ // eta:
+ for(Int_t e=1;e<=fnBinsEta;e++)
+ {
+ Double_t v2 = fDiffFlow[t][1][0]->GetBinContent(e);
+ Double_t v4 = fDiffFlow[t][1][1]->GetBinContent(e);
+ Double_t v6 = fDiffFlow[t][1][2]->GetBinContent(e);
+ Double_t v8 = fDiffFlow[t][1][3]->GetBinContent(e);
+
+ Double_t v2Error = fDiffFlow[t][1][0]->GetBinError(e);
+ Double_t v4Error = fDiffFlow[t][1][1]->GetBinError(e);
+ //Double_t v6Error = fDiffFlow[t][1][2]->GetBinError(e);
+ //Double_t v8Error = fDiffFlow[t][1][3]->GetBinError(e);
+
+ if(type == "RP")
+ {
+ fCommonHistsResults2nd->FillDifferentialFlowEtaRP(e,v2,v2Error);
+ fCommonHistsResults4th->FillDifferentialFlowEtaRP(e,v4,v4Error);
+ fCommonHistsResults6th->FillDifferentialFlowEtaRP(e,v6,0.);
+ fCommonHistsResults8th->FillDifferentialFlowEtaRP(e,v8,0.);
+ } else if(type == "POI")
+ {
+ fCommonHistsResults2nd->FillDifferentialFlowEtaPOI(e,v2,v2Error);
+ fCommonHistsResults4th->FillDifferentialFlowEtaPOI(e,v4,v4Error);
+ fCommonHistsResults6th->FillDifferentialFlowEtaPOI(e,v6,0.);
+ fCommonHistsResults8th->FillDifferentialFlowEtaPOI(e,v8,0.);
+ }
+ } // end of for(Int_t e=1;e<=fnBinsEta;e++)
+
+} // end of void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights, Bool_t correctedForNUA)
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::AccessConstants()
+{
+ // Access needed common constants from AliFlowCommonConstants.
+
+ fnBinsPhi = AliFlowCommonConstants::GetMaster()->GetNbinsPhi();
+ fPhiMin = AliFlowCommonConstants::GetMaster()->GetPhiMin();
+ fPhiMax = AliFlowCommonConstants::GetMaster()->GetPhiMax();
+ if(fnBinsPhi) fPhiBinWidth = (fPhiMax-fPhiMin)/fnBinsPhi;
+ fnBinsPt = AliFlowCommonConstants::GetMaster()->GetNbinsPt();
+ fPtMin = AliFlowCommonConstants::GetMaster()->GetPtMin();
+ fPtMax = AliFlowCommonConstants::GetMaster()->GetPtMax();
+ if(fnBinsPt) fPtBinWidth = (fPtMax-fPtMin)/fnBinsPt;
+ fnBinsEta = AliFlowCommonConstants::GetMaster()->GetNbinsEta();
+ fEtaMin = AliFlowCommonConstants::GetMaster()->GetEtaMin();
+ fEtaMax = AliFlowCommonConstants::GetMaster()->GetEtaMax();
+ if(fnBinsEta) fEtaBinWidth = (fEtaMax-fEtaMin)/fnBinsEta;
+
+} // end of void AliFlowAnalysisWithQCumulants::AccessConstants()
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::CrossCheckSettings()
+{
+ // a) Cross check if the choice for multiplicity weights make sense;
+
+ // a) Cross check if the choice for multiplicity weights make sense:
+ if(strcmp(fMultiplicityWeight->Data(),"combinations") &&
+ strcmp(fMultiplicityWeight->Data(),"unit") &&
+ strcmp(fMultiplicityWeight->Data(),"multiplicity"))
+ {
+ cout<<"WARNING (QC): Multiplicity weight can be either \"combinations\", \"unit\""<<endl;
+ cout<<" or \"multiplicity\". Certainly not \""<<fMultiplicityWeight->Data()<<"\"."<<endl;
+ exit(0);
+ }
+
+} // end of void AliFlowAnalysisWithQCumulants::CrossCheckSettings()
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeights()
+{
+ // Calculate sum of linear and quadratic event weights for correlations.
+
+ // multiplicity:
+ Double_t dMult = (*fSMpk)(0,0);
+
+ for(Int_t p=0;p<2;p++) // power-1
+ {
+ for(Int_t ci=0;ci<4;ci++) // correlation index
+ {
+ fIntFlowSumOfEventWeights[p]->Fill(ci+0.5,pow(fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci+1),p+1));
+ if(fCalculateCumulantsVsM)
+ {
+ fIntFlowSumOfEventWeightsVsM[ci][p]->Fill(dMult+0.5,pow(fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci+1),p+1)); // to be improved: dMult => sum of weights?
+ }
+ }
+ }
+
+} // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeights()
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeightsNUA()
+{
+ // Calculate sum of linear and quadratic event weights for NUA terms.
+
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms
+ {
+ for(Int_t p=0;p<2;p++) // power-1
+ {
+ for(Int_t ci=0;ci<4;ci++) // nua term index
+ {
+ fIntFlowSumOfEventWeightsNUA[sc][p]->Fill(ci+0.5,pow(fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc]->GetBinContent(ci+1),p+1));
+ }
+ }
+ }
+
+} // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeightsNUA()
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeights()
+{
+ // Calculate sum of product of event weights for correlations.
+
+ // multiplicity:
+ Double_t dMult = (*fSMpk)(0,0);
+
+ Int_t counter = 0;
+
+ for(Int_t ci1=1;ci1<4;ci1++)
+ {
+ for(Int_t ci2=ci1+1;ci2<=4;ci2++)
+ {
+ fIntFlowSumOfProductOfEventWeights->Fill(0.5+counter,
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)*
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2));
+ if(fCalculateCumulantsVsM)
+ {
+ fIntFlowSumOfProductOfEventWeightsVsM[counter]->Fill(dMult+0.5, // to be improved: dMult => sum of weights?
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)*
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2));
+ } // end of if(fCalculateCumulantsVsM)
+ counter++;
+ }
+ }
+
+} // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeights()
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeightsNUA()
+{
+ // Calculate sum of product of event weights for NUA terms.
+
+ // w_{<2>} * w_{<cos(#phi)>}:
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(0.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1));
+ // w_{<2>} * w_{<sin(#phi)>}:
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(1.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1));
+ // w_{<cos(#phi)> * w_{<sin(#phi)>}:
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(2.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1));
+ // w_{<2>} * w{<cos(phi1+phi2)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(3.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2));
+ // w_{<2>} * w{<sin(phi1+phi2)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(4.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2));
+ // w_{<2>} * w{<cos(phi1-phi2-phi3)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(5.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3));
+ // w_{<2>} * w{<sin(phi1-phi2-phi3)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(6.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3));
+ // w_{<4>} * w{<cos(phi1)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(7.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1));
+ // w_{<4>} * w{<sin(phi1)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(8.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1));
+ // w_{<4>} * w{<cos(phi1+phi2)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(9.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2));
+ // w_{<4>} * w{<sin(phi1+phi2)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(10.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2));
+ // w_{<4>} * w{<cos(phi1-phi2-phi3)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(11.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3));
+ // w_{<4>} * w{<sin(phi1-phi2-phi3)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(12.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3));
+ // w_{<cos(phi1)>} * w{<cos(phi1+phi2)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(13.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2));
+ // w_{<cos(phi1)>} * w{<sin(phi1+phi2)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(14.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2));
+ // w_{<cos(phi1)>} * w{<cos(phi1-phi2-phi3)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(15.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3));
+ // w_{<cos(phi1)>} * w{<sin(phi1-phi2-phi3)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(16.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3));
+ // w_{<sin(phi1)>} * w{<cos(phi1+phi2)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(17.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2));
+ // w_{<sin(phi1)>} * w{<sin(phi1+phi2)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(18.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2));
+ // w_{<sin(phi1)>} * w{<cos(phi1-phi2-phi3)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(19.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3));
+ // w_{<sin(phi1)>} * w{<sin(phi1-phi2-phi3)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(20.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3));
+ // w_{<cos(phi1+phi2)>} * w{<sin(phi1+phi2))>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(21.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2));
+ // w_{<cos(phi1+phi2)>} * w{<cos(phi1-phi2-phi3)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(22.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3));
+ // w_{<cos(phi1+phi2)>} * w{<sin(phi1-phi2-phi3)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(23.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3));
+ // w_{<sin(phi1+phi2)>} * w{<cos(phi1-phi2-phi3)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(24.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3));
+ // w_{<sin(phi1+phi2)>} * w{<sin(phi1-phi2-phi3)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(25.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3));
+ // w_{<cos(phi1-phi2-phi3)>} * w{<sin(phi1-phi2-phi3)>}
+ fIntFlowSumOfProductOfEventWeightsNUA->Fill(26.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)*
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3));
+
+} // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowIntFlowSumOfProductOfEventWeightsNUA()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelations(TString type, TString ptOrEta)
+{
+ // calculate reduced correlations for RPs or POIs in pt or eta bins
+
+ // multiplicity:
+ Double_t dMult = (*fSMpk)(0,0);
+
+ // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
+ Double_t dReQ1n = (*fReQ)(0,0);
+ Double_t dReQ2n = (*fReQ)(1,0);
+ //Double_t dReQ3n = (*fReQ)(2,0);
+ //Double_t dReQ4n = (*fReQ)(3,0);
+ Double_t dImQ1n = (*fImQ)(0,0);
+ Double_t dImQ2n = (*fImQ)(1,0);
+ //Double_t dImQ3n = (*fImQ)(2,0);
+ //Double_t dImQ4n = (*fImQ)(3,0);
+
+ // reduced correlations are stored in fDiffFlowCorrelationsPro[0=RP,1=POI][0=pt,1=eta][correlation index]. Correlation index runs as follows:
+ //
+ // 0: <<2'>>
+ // 1: <<4'>>
+ // 2: <<6'>>
+ // 3: <<8'>>
+
+ Int_t t = -1; // type flag
+ Int_t pe = -1; // ptEta flag
+
+ if(type == "RP")
+ {
+ t = 0;
+ } else if(type == "POI")
+ {
+ t = 1;
+ }
+
+ if(ptOrEta == "Pt")
+ {
+ pe = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ pe = 1;
+ }
+
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};
+ Double_t minPtEta[2] = {fPtMin,fEtaMin};
+ //Double_t maxPtEta[2] = {fPtMax,fEtaMax};
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};
+
+ // looping over all bins and calculating reduced correlations:
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+ {
+ // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin):
+ Double_t p1n0kRe = 0.;
+ Double_t p1n0kIm = 0.;
+
+ // number of POIs in particular pt or eta bin:
+ Double_t mp = 0.;
+
+ // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin):
+ Double_t q1n0kRe = 0.;
+ Double_t q1n0kIm = 0.;
+ Double_t q2n0kRe = 0.;
+ Double_t q2n0kIm = 0.;
+
+ // number of particles which are both RPs and POIs in particular pt or eta bin:
+ Double_t mq = 0.;
+
+ if(type == "POI")
+ {
+ // q_{m*n,0}:
+ q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b))
+ * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b));
+ q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b))
+ * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b));
+ q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b))
+ * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b));
+ q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b))
+ * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b));
+
+ mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)
+ }
+ else if(type == "RP")
+ {
+ // q_{m*n,0}:
+ q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b))
+ * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b));
+ q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b))
+ * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b));
+ q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b))
+ * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b));
+ q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b))
+ * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b));
+
+ mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)
+ }
+
+ if(type == "POI")
+ {
+ // p_{m*n,0}:
+ p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b))
+ * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b));
+ p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b))
+ * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b));
+
+ mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)
+
+ t = 1; // typeFlag = RP or POI
+ }
+ else if(type == "RP")
+ {
+ // p_{m*n,0} = q_{m*n,0}:
+ p1n0kRe = q1n0kRe;
+ p1n0kIm = q1n0kIm;
+
+ mp = mq;
+
+ t = 0; // typeFlag = RP or POI
+ }
+
+ // 2'-particle correlation for particular (pt,eta) bin:
+ Double_t two1n1nPtEta = 0.;
+ if(mp*dMult-mq)
+ {
+ two1n1nPtEta = (p1n0kRe*dReQ1n+p1n0kIm*dImQ1n-mq)
+ / (mp*dMult-mq);
+
+ if(type == "POI") // to be improved (I do not this if)
+ {
+ // fill profile to get <<2'>> for POIs
+ fDiffFlowCorrelationsPro[1][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta,mp*dMult-mq);
+ // histogram to store <2'> for POIs e-b-e (needed in some other methods):
+ fDiffFlowCorrelationsEBE[1][pe][0]->SetBinContent(b,two1n1nPtEta);
+ fDiffFlowEventWeightsForCorrelationsEBE[1][pe][0]->SetBinContent(b,mp*dMult-mq);
+ }
+ else if(type == "RP") // to be improved (I do not this if)
+ {
+ // profile to get <<2'>> for RPs:
+ fDiffFlowCorrelationsPro[0][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta,mp*dMult-mq);
+ // histogram to store <2'> for RPs e-b-e (needed in some other methods):
+ fDiffFlowCorrelationsEBE[0][pe][0]->SetBinContent(b,two1n1nPtEta);
+ fDiffFlowEventWeightsForCorrelationsEBE[0][pe][0]->SetBinContent(b,mp*dMult-mq);
+ }
+ } // end of if(mp*dMult-mq)
+
+ // 4'-particle correlation:
+ Double_t four1n1n1n1nPtEta = 0.;
+ if((mp-mq)*dMult*(dMult-1.)*(dMult-2.)
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression)
+ {
+ four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n)
+ - q2n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.))
+ - 2.*q2n0kIm*dReQ1n*dImQ1n
+ - p1n0kRe*(dReQ1n*dReQ2n+dImQ1n*dImQ2n)
+ + p1n0kIm*(dImQ1n*dReQ2n-dReQ1n*dImQ2n)
+ - 2.*dMult*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n)
+ - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*mq
+ + 6.*(q1n0kRe*dReQ1n+q1n0kIm*dImQ1n)
+ + 1.*(q2n0kRe*dReQ2n+q2n0kIm*dImQ2n)
+ + 2.*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n)
+ + 2.*mq*dMult
+ - 6.*mq)
+ / ((mp-mq)*dMult*(dMult-1.)*(dMult-2.)
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.));
+
+ if(type == "POI")
+ {
+ // profile to get <<4'>> for POIs:
+ fDiffFlowCorrelationsPro[1][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta,
+ (mp-mq)*dMult*(dMult-1.)*(dMult-2.)
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.));
+ // histogram to store <4'> for POIs e-b-e (needed in some other methods):
+ fDiffFlowCorrelationsEBE[1][pe][1]->SetBinContent(b,four1n1n1n1nPtEta);
+ fDiffFlowEventWeightsForCorrelationsEBE[1][pe][1]->SetBinContent(b,(mp-mq)*dMult*(dMult-1.)*(dMult-2.)
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.));
+ }
+ else if(type == "RP")
+ {
+ // profile to get <<4'>> for RPs:
+ fDiffFlowCorrelationsPro[0][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta,
+ (mp-mq)*dMult*(dMult-1.)*(dMult-2.)
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.));
+ // histogram to store <4'> for RPs e-b-e (needed in some other methods):
+ fDiffFlowCorrelationsEBE[0][pe][1]->SetBinContent(b,four1n1n1n1nPtEta);
+ fDiffFlowEventWeightsForCorrelationsEBE[0][pe][1]->SetBinContent(b,(mp-mq)*dMult*(dMult-1.)*(dMult-2.)
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.));
+ }
+ } // end of if((mp-mq)*dMult*(dMult-1.)*(dMult-2.)
+ // +mq*(dMult-1.)*(dMult-2.)*(dMult-3.))
+
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+
+
+} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelations(TString type, TString ptOrEta);
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfEventWeights(TString type, TString ptOrEta)
+{
+ // Calculate sums of various event weights for reduced correlations.
+ // (These quantitites are needed in expressions for unbiased estimators relevant for the statistical errors.)
+
+ Int_t typeFlag = -1;
+ Int_t ptEtaFlag = -1;
+
+ if(type == "RP")
+ {
+ typeFlag = 0;
+ } else if(type == "POI")
+ {
+ typeFlag = 1;
+ }
+
+ if(ptOrEta == "Pt")
+ {
+ ptEtaFlag = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ ptEtaFlag = 1;
+ }
+
+ // shortcuts:
+ Int_t t = typeFlag;
+ Int_t pe = ptEtaFlag;
+
+ // binning:
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};
+ Double_t minPtEta[2] = {fPtMin,fEtaMin};
+ //Double_t maxPtEta[2] = {fPtMax,fEtaMax};
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};
+
+ for(Int_t rpq=0;rpq<3;rpq++)
+ {
+ for(Int_t m=0;m<4;m++)
+ {
+ for(Int_t k=0;k<9;k++)
+ {
+ if(!fReRPQ1dEBE[rpq][pe][m][k])
+ {
+ cout<<"WARNING: fReRPQ1dEBE[rpq][pe][m][k] is NULL in AFAWQC::CSAPOEWFDF() !!!!"<<endl;
+ cout<<"pe = "<<pe<<endl;
+ cout<<"rpq = "<<rpq<<endl;
+ cout<<"m = "<<m<<endl;
+ cout<<"k = "<<k<<endl;
+ exit(0);
+ }
+ }
+ }
+ }
+
+ // multiplicities:
+ Double_t dMult = (*fSMpk)(0,0); // total event multiplicity
+ //Double_t mr = 0.; // number of RPs in particular pt or eta bin
+ Double_t mp = 0.; // number of POIs in particular pt or eta bin
+ Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin
+
+ // event weights for reduced correlations:
+ Double_t dw2 = 0.; // event weight for <2'>
+ Double_t dw4 = 0.; // event weight for <4'>
+ //Double_t dw6 = 0.; // event weight for <6'>
+ //Double_t dw8 = 0.; // event weight for <8'>
+
+ // looping over bins:
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+ {
+ if(type == "RP")
+ {
+ mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b);
+ mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow
+ } else if(type == "POI")
+ {
+ mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b);
+ mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b);
+ }
+
+ // event weight for <2'>:
+ dw2 = mp*dMult-mq;
+ fDiffFlowSumOfEventWeights[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2);
+ fDiffFlowSumOfEventWeights[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw2,2.));
+
+ // event weight for <4'>:
+ dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.)
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.);
+ fDiffFlowSumOfEventWeights[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4);
+ fDiffFlowSumOfEventWeights[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw4,2.));
+
+ // event weight for <6'>:
+ //dw6 = ...;
+ //fDiffFlowSumOfEventWeights[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6);
+ //fDiffFlowSumOfEventWeights[t][pe][t][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw6,2.));
+
+ // event weight for <8'>:
+ //dw8 = ...;
+ //fDiffFlowSumOfEventWeights[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw8);
+ //fDiffFlowSumOfEventWeights[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw8,2.));
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+
+} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfEventWeights()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfProductOfEventWeights(TString type, TString ptOrEta)
+{
+ // Calculate sum of products of various event weights for both types of correlations (the ones for int. and diff. flow).
+ // (These quantitites are needed in expressions for unbiased estimators relevant for the statistical errors.)
+ //
+ // Important: To fill fDiffFlowSumOfProductOfEventWeights[][][][] use bellow table (i,j) with following constraints:
+ // 1.) i<j
+ // 2.) do not store terms which DO NOT include reduced correlations;
+ // Table:
+ // [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] x [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>]
+
+ Int_t typeFlag = -1;
+ Int_t ptEtaFlag = -1;
+
+ if(type == "RP")
+ {
+ typeFlag = 0;
+ } else if(type == "POI")
+ {
+ typeFlag = 1;
+ }
+
+ if(ptOrEta == "Pt")
+ {
+ ptEtaFlag = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ ptEtaFlag = 1;
+ }
+
+ // shortcuts:
+ Int_t t = typeFlag;
+ Int_t pe = ptEtaFlag;
+
+ // binning:
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};
+ Double_t minPtEta[2] = {fPtMin,fEtaMin};
+ //Double_t maxPtEta[2] = {fPtMax,fEtaMax};
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};
+
+ // protection:
+ for(Int_t rpq=0;rpq<3;rpq++)
+ {
+ for(Int_t m=0;m<4;m++)
+ {
+ for(Int_t k=0;k<9;k++)
+ {
+ if(!fReRPQ1dEBE[rpq][pe][m][k])
+ {
+ cout<<"WARNING: fReRPQ1dEBE[rpq][pe][m][k] is NULL in AFAWQC::CSAPOEWFDF() !!!!"<<endl;
+ cout<<"pe = "<<pe<<endl;
+ cout<<"rpq = "<<rpq<<endl;
+ cout<<"m = "<<m<<endl;
+ cout<<"k = "<<k<<endl;
+ exit(0);
+ }
+ }
+ }
+ }
+
+ // multiplicities:
+ Double_t dMult = (*fSMpk)(0,0); // total event multiplicity
+ //Double_t mr = 0.; // number of RPs in particular pt or eta bin
+ Double_t mp = 0.; // number of POIs in particular pt or eta bin
+ Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin
+
+ // event weights for correlations:
+ Double_t dW2 = dMult*(dMult-1); // event weight for <2>
+ Double_t dW4 = dMult*(dMult-1)*(dMult-2)*(dMult-3); // event weight for <4>
+ Double_t dW6 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5); // event weight for <6>
+ Double_t dW8 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)*(dMult-6)*(dMult-7); // event weight for <8>
+
+ // event weights for reduced correlations:
+ Double_t dw2 = 0.; // event weight for <2'>
+ Double_t dw4 = 0.; // event weight for <4'>
+ //Double_t dw6 = 0.; // event weight for <6'>
+ //Double_t dw8 = 0.; // event weight for <8'>
+
+ // looping over bins:
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+ {
+ if(type == "RP")
+ {
+ mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b);
+ mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow
+ } else if(type == "POI")
+ {
+ mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b);
+ mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b);
+ }
+
+ // event weight for <2'>:
+ dw2 = mp*dMult-mq;
+ fDiffFlowSumOfProductOfEventWeights[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw2); // storing product of even weights for <2> and <2'>
+ fDiffFlowSumOfProductOfEventWeights[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW4); // storing product of even weights for <4> and <2'>
+ fDiffFlowSumOfProductOfEventWeights[t][pe][1][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW6); // storing product of even weights for <6> and <2'>
+ fDiffFlowSumOfProductOfEventWeights[t][pe][1][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW8); // storing product of even weights for <8> and <2'>
+
+ // event weight for <4'>:
+ dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.)
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.);
+ fDiffFlowSumOfProductOfEventWeights[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw4); // storing product of even weights for <2> and <4'>
+ fDiffFlowSumOfProductOfEventWeights[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw4); // storing product of even weights for <2'> and <4'>
+ fDiffFlowSumOfProductOfEventWeights[t][pe][2][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw4); // storing product of even weights for <4> and <4'>
+ fDiffFlowSumOfProductOfEventWeights[t][pe][3][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dW6); // storing product of even weights for <6> and <4'>
+ fDiffFlowSumOfProductOfEventWeights[t][pe][3][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dW8); // storing product of even weights for <8> and <4'>
+
+ // event weight for <6'>:
+ //dw6 = ...;
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][0][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw6); // storing product of even weights for <2> and <6'>
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][1][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw6); // storing product of even weights for <2'> and <6'>
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][2][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw6); // storing product of even weights for <4> and <6'>
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][3][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dw6); // storing product of even weights for <4'> and <6'>
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][4][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW6*dw6); // storing product of even weights for <6> and <6'>
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][5][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dW8); // storing product of even weights for <6'> and <8>
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dw8); // storing product of even weights for <6'> and <8'>
+
+ // event weight for <8'>:
+ //dw8 = ...;
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][0][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw8); // storing product of even weights for <2> and <8'>
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][1][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw8); // storing product of even weights for <2'> and <8'>
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][2][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw8); // storing product of even weights for <4> and <8'>
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][3][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dw8); // storing product of even weights for <4'> and <8'>
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][4][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW6*dw8); // storing product of even weights for <6> and <8'>
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dw8); // storing product of even weights for <6'> and <8'>
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][6][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW8*dw8); // storing product of even weights for <8> and <8'>
+
+ // Table:
+ // [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] x [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>]
+
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+
+
+
+} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfProductOfEventWeights(TString type, TString ptOrEta)
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::FinalizeReducedCorrelations(TString type, TString ptOrEta)
+{
+ // Transfer profiles into histograms and calculate statistical errors correctly.
+
+ Int_t typeFlag = -1;
+ Int_t ptEtaFlag = -1;
+
+ if(type == "RP")
+ {
+ typeFlag = 0;
+ } else if(type == "POI")
+ {
+ typeFlag = 1;
+ }
+
+ if(ptOrEta == "Pt")
+ {
+ ptEtaFlag = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ ptEtaFlag = 1;
+ }
+
+ // shortcuts:
+ Int_t t = typeFlag;
+ Int_t pe = ptEtaFlag;
+
+ for(Int_t rci=0;rci<4;rci++)
+ {
+ if(!fDiffFlowCorrelationsPro[t][pe][rci])
+ {
+ cout<<"WARNING: fDiffFlowCorrelationsPro[t][pe][rci] is NULL in AFAWQC::FRC() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ cout<<"rci = "<<rci<<endl;
+ exit(0);
+ }
+ for(Int_t power=0;power<2;power++)
+ {
+ if(!fDiffFlowSumOfEventWeights[t][pe][power][rci])
+ {
+ cout<<"WARNING: fDiffFlowSumOfEventWeights[t][pe][power][rci] is NULL in AFAWQC::FRC() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ cout<<"power = "<<power<<endl;
+ cout<<"rci = "<<rci<<endl;
+ exit(0);
+ }
+ } // end of for(Int_t power=0;power<2;power++)
+ } // end of for(Int_t rci=0;rci<4;rci++)
+
+ // common:
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};
+
+ // transfer 1D profile into 1D histogram:
+ Double_t correlation = 0.;
+ Double_t spread = 0.;
+ Double_t sumOfWeights = 0.; // sum of weights for particular reduced correlations for particular pt or eta bin
+ Double_t sumOfSquaredWeights = 0.; // sum of squared weights for particular reduced correlations for particular pt or eta bin
+ Double_t error = 0.; // error = termA * spread * termB
+ // termA = (sqrt(sumOfSquaredWeights)/sumOfWeights)
+ // termB = 1/pow(1-termA^2,0.5)
+ Double_t termA = 0.;
+ Double_t termB = 0.;
+ for(Int_t rci=0;rci<4;rci++) // index of reduced correlation
+ {
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++) // number of pt or eta bins
+ {
+ correlation = fDiffFlowCorrelationsPro[t][pe][rci]->GetBinContent(b);
+ spread = fDiffFlowCorrelationsPro[t][pe][rci]->GetBinError(b);
+ sumOfWeights = fDiffFlowSumOfEventWeights[t][pe][0][rci]->GetBinContent(b);
+ sumOfSquaredWeights = fDiffFlowSumOfEventWeights[t][pe][1][rci]->GetBinContent(b);
+ if(sumOfWeights) termA = (pow(sumOfSquaredWeights,0.5)/sumOfWeights);
+ if(1.-pow(termA,2.)>0.) termB = 1./pow(1.-pow(termA,2.),0.5);
+ error = termA*spread*termB; // final error (unbiased estimator for standard deviation)
+ fDiffFlowCorrelationsHist[t][pe][rci]->SetBinContent(b,correlation);
+ fDiffFlowCorrelationsHist[t][pe][rci]->SetBinError(b,error);
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+ } // end of for(Int_t rci=0;rci<4;rci++)
+
+} // end of void AliFlowAnalysisWithQCumulants::FinalizeReducedCorrelations(TString type, TString ptOrEta)
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowProductOfCorrelations(TString type, TString ptOrEta)
+{
+ // store products: <2><2'>, <2><4'>, <2><6'>, <2><8'>, <2'><4>,
+ // <2'><4'>, <2'><6>, <2'><6'>, <2'><8>, <2'><8'>,
+ // <4><4'>, <4><6'>, <4><8'>, <4'><6>, <4'><6'>,
+ // <4'><8>, <4'><8'>, <6><6'>, <6><8'>, <6'><8>,
+ // <6'><8'>, <8><8'>.
+
+ Int_t typeFlag = -1;
+ Int_t ptEtaFlag = -1;
+
+ if(type == "RP")
+ {
+ typeFlag = 0;
+ } else if(type == "POI")
+ {
+ typeFlag = 1;
+ }
+
+ if(ptOrEta == "Pt")
+ {
+ ptEtaFlag = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ ptEtaFlag = 1;
+ }
+
+ // shortcuts:
+ Int_t t = typeFlag;
+ Int_t pe = ptEtaFlag;
+
+ // common:
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};
+ Double_t minPtEta[2] = {fPtMin,fEtaMin};
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};
+
+ // protections // to be improved (add protection for all pointers in this method)
+ if(!fIntFlowCorrelationsEBE)
+ {
+ cout<<"WARNING: fIntFlowCorrelationsEBE is NULL in AFAWQC::CDFPOC() !!!!"<<endl;
+ exit(0);
+ }
+
+ /*
+ Double_t dMult = (*fSMpk)(0,0); // multiplicity (number of particles used to determine the reaction plane)
+ //Double_t mr = 0.; // number of RPs in particular pt or eta bin
+ Double_t mp = 0.; // number of POIs in particular pt or eta bin
+ Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin
+ */
+
+ // e-b-e correlations:
+ Double_t twoEBE = fIntFlowCorrelationsEBE->GetBinContent(1); // <2>
+ Double_t fourEBE = fIntFlowCorrelationsEBE->GetBinContent(2); // <4>
+ Double_t sixEBE = fIntFlowCorrelationsEBE->GetBinContent(3); // <6>
+ Double_t eightEBE = fIntFlowCorrelationsEBE->GetBinContent(4); // <8>
+
+ // event weights for correlations:
+ Double_t dW2 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1); // event weight for <2>
+ Double_t dW4 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2); // event weight for <4>
+ Double_t dW6 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(3); // event weight for <6>
+ Double_t dW8 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(4); // event weight for <8>
+
+ // e-b-e reduced correlations:
+ Double_t twoReducedEBE = 0.; // <2'>
+ Double_t fourReducedEBE = 0.; // <4'>
+ Double_t sixReducedEBE = 0.; // <6'>
+ Double_t eightReducedEBE = 0.; // <8'>
+
+ // event weights for reduced correlations:
+ Double_t dw2 = 0.; // event weight for <2'>
+ Double_t dw4 = 0.; // event weight for <4'>
+ //Double_t dw6 = 0.; // event weight for <6'>
+ //Double_t dw8 = 0.; // event weight for <8'>
+
+ // looping over bins:
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+ {
+ // e-b-e reduced correlations:
+ twoReducedEBE = fDiffFlowCorrelationsEBE[t][pe][0]->GetBinContent(b);
+ fourReducedEBE = fDiffFlowCorrelationsEBE[t][pe][1]->GetBinContent(b);
+ sixReducedEBE = fDiffFlowCorrelationsEBE[t][pe][2]->GetBinContent(b);
+ eightReducedEBE = fDiffFlowCorrelationsEBE[t][pe][3]->GetBinContent(b);
+
+ /*
+ // to be improved (I should not do this here again)
+ if(type == "RP")
+ {
+ mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b);
+ mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow
+ } else if(type == "POI")
+ {
+ mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b);
+ mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b);
+ }
+
+ // event weights for reduced correlations:
+ dw2 = mp*dMult-mq; // weight for <2'>
+ dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.)
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); // weight for <4'>
+ //dw6 = ...
+ //dw8 = ...
+
+ */
+
+ dw2 = fDiffFlowEventWeightsForCorrelationsEBE[t][pe][0]->GetBinContent(b);
+ dw4 = fDiffFlowEventWeightsForCorrelationsEBE[t][pe][1]->GetBinContent(b);
+
+ // storing all products:
+ fDiffFlowProductOfCorrelationsPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*twoReducedEBE,dW2*dw2); // storing <2><2'>
+ fDiffFlowProductOfCorrelationsPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*twoReducedEBE,dW4*dw2); // storing <4><2'>
+ fDiffFlowProductOfCorrelationsPro[t][pe][1][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*twoReducedEBE,dW6*dw2); // storing <6><2'>
+ fDiffFlowProductOfCorrelationsPro[t][pe][1][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*twoReducedEBE,dW8*dw2); // storing <8><2'>
+
+ // event weight for <4'>:
+ fDiffFlowProductOfCorrelationsPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*fourReducedEBE,dW2*dw4); // storing <2><4'>
+ fDiffFlowProductOfCorrelationsPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*fourReducedEBE,dw2*dw4); // storing <2'><4'>
+ fDiffFlowProductOfCorrelationsPro[t][pe][2][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*fourReducedEBE,dW4*dw4); // storing <4><4'>
+ fDiffFlowProductOfCorrelationsPro[t][pe][3][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*fourReducedEBE,dW6*dw4); // storing <6><4'>
+ fDiffFlowProductOfCorrelationsPro[t][pe][3][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*fourReducedEBE,dW8*dw4); // storing <8><4'>
+
+ // event weight for <6'>:
+ //dw6 = ...;
+ //fDiffFlowProductOfCorrelationsPro[t][pe][0][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*sixReducedEBE,dW2*dw6); // storing <2><6'>
+ //fDiffFlowProductOfCorrelationsPro[t][pe][1][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*sixReducedEBE,dw2*dw6); // storing <2'><6'>
+ //fDiffFlowProductOfCorrelationsPro[t][pe][2][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*sixReducedEBE,dW4*dw6); // storing <4><6'>
+ //fDiffFlowProductOfCorrelationsPro[t][pe][3][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourReducedEBE*sixReducedEBE,dw4*dw6); // storing <4'><6'>
+ //fDiffFlowProductOfCorrelationsPro[t][pe][4][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*sixReducedEBE,dW6*dw6); // storing <6><6'>
+ //fDiffFlowProductOfCorrelationsPro[t][pe][5][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightEBE,dw6*dW8); // storing <6'><8>
+ //fDiffFlowProductOfCorrelationsPro[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightReducedEBE,dw6*dw8); // storing <6'><8'>
+
+ // event weight for <8'>:
+ //dw8 = ...;
+ //fDiffFlowProductOfCorrelationsPro[t][pe][0][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*eightReducedEBE,dW2*dw8); // storing <2><8'>
+ //fDiffFlowProductOfCorrelationsPro[t][pe][1][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*eightReducedEBE,dw2*dw8); // storing <2'><8'>
+ //fDiffFlowProductOfCorrelationsPro[t][pe][2][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*eightReducedEBE,dW4*dw8); // storing <4><8'>
+ //fDiffFlowProductOfCorrelationsPro[t][pe][3][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourReducedEBE*eightReducedEBE,dw4*dw8); // storing <4'><8'>
+ //fDiffFlowProductOfCorrelationsPro[t][pe][4][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*eightReducedEBE,dW6*dw8); // storing <6><8'>
+ //fDiffFlowProductOfCorrelationsPro[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightReducedEBE,dw6*dw8); // storing <6'><8'>
+ //fDiffFlowProductOfCorrelationsPro[t][pe][6][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*eightReducedEBE,dW8*dw8); // storing <8><8'>
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++
+
+} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowProductOfCorrelations(TString type, TString ptOrEta)
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCovariances(TString type, TString ptOrEta) // to be improved (reimplemented)
+{
+ // a) Calculate unbiased estimators Cov(<2>,<2'>), Cov(<2>,<4'>), Cov(<4>,<2'>), Cov(<4>,<4'>) and Cov(<2'>,<4'>)
+ // for covariances V(<2>,<2'>), V(<2>,<4'>), V(<4>,<2'>), V(<4>,<4'>) and V(<2'>,<4'>).
+ // b) Store in histogram fDiffFlowCovariances[t][pe][index] for instance the following:
+ //
+ // Cov(<2>,<2'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)]
+ //
+ // where N is the number of events, w_{<2>} is event weight for <2> and w_{<2'>} is event weight for <2'>.
+ // c) Binning of fDiffFlowCovariances[t][pe][index] is organized as follows:
+ //
+ // 1st bin: Cov(<2>,<2'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)]
+ // 2nd bin: Cov(<2>,<4'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)]
+ // 3rd bin: Cov(<4>,<2'>) * (sum_{i=1}^{N} w_{<4>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)]
+ // 4th bin: Cov(<4>,<4'>) * (sum_{i=1}^{N} w_{<4>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)]
+ // 5th bin: Cov(<2'>,<4'>) * (sum_{i=1}^{N} w_{<2'>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<2'>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)]
+ // ...
+
+ Int_t typeFlag = -1;
+ Int_t ptEtaFlag = -1;
+
+ if(type == "RP")
+ {
+ typeFlag = 0;
+ } else if(type == "POI")
+ {
+ typeFlag = 1;
+ }
+
+ if(ptOrEta == "Pt")
+ {
+ ptEtaFlag = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ ptEtaFlag = 1;
+ }
+
+ // shortcuts:
+ Int_t t = typeFlag;
+ Int_t pe = ptEtaFlag;
+
+ // common:
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};
+ //Double_t minPtEta[2] = {fPtMin,fEtaMin};
+ //Double_t maxPtEta[2] = {fPtMax,fEtaMax};
+ //Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};
+
+ // average correlations:
+ Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>>
+ Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>>
+ //Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>>
+ //Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>>
+
+ // sum of weights for correlation:
+ Double_t sumOfWeightsForTwo = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // sum_{i=1}^{N} w_{<2>}
+ Double_t sumOfWeightsForFour = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // sum_{i=1}^{N} w_{<4>}
+ //Double_t sumOfWeightsForSix = fIntFlowSumOfEventWeights[0]->GetBinContent(3); // sum_{i=1}^{N} w_{<6>}
+ //Double_t sumOfWeightsForEight = fIntFlowSumOfEventWeights[0]->GetBinContent(4); // sum_{i=1}^{N} w_{<8>}
+
+ // average reduced correlations:
+ Double_t twoReduced = 0.; // <<2'>>
+ Double_t fourReduced = 0.; // <<4'>>
+ //Double_t sixReduced = 0.; // <<6'>>
+ //Double_t eightReduced = 0.; // <<8'>>
+
+ // sum of weights for reduced correlation:
+ Double_t sumOfWeightsForTwoReduced = 0.; // sum_{i=1}^{N} w_{<2'>}
+ Double_t sumOfWeightsForFourReduced = 0.; // sum_{i=1}^{N} w_{<4'>}
+ //Double_t sumOfWeightsForSixReduced = 0.; // sum_{i=1}^{N} w_{<6'>}
+ //Double_t sumOfWeightsForEightReduced = 0.; // sum_{i=1}^{N} w_{<8'>}
+
+ // product of weights for reduced correlation:
+ Double_t productOfWeightsForTwoTwoReduced = 0.; // sum_{i=1}^{N} w_{<2>}w_{<2'>}
+ Double_t productOfWeightsForTwoFourReduced = 0.; // sum_{i=1}^{N} w_{<2>}w_{<4'>}
+ Double_t productOfWeightsForFourTwoReduced = 0.; // sum_{i=1}^{N} w_{<4>}w_{<2'>}
+ Double_t productOfWeightsForFourFourReduced = 0.; // sum_{i=1}^{N} w_{<4>}w_{<4'>}
+ Double_t productOfWeightsForTwoReducedFourReduced = 0.; // sum_{i=1}^{N} w_{<2'>}w_{<4'>}
+ // ...
+
+ // products for differential flow:
+ Double_t twoTwoReduced = 0; // <<2><2'>>
+ Double_t twoFourReduced = 0; // <<2><4'>>
+ Double_t fourTwoReduced = 0; // <<4><2'>>
+ Double_t fourFourReduced = 0; // <<4><4'>>
+ Double_t twoReducedFourReduced = 0; // <<2'><4'>>
+
+ // denominators in the expressions for the unbiased estimators for covariances:
+ // denominator = 1 - term1/(term2*term3)
+ // prefactor = term1/(term2*term3)
+ Double_t denominator = 0.;
+ Double_t prefactor = 0.;
+ Double_t term1 = 0.;
+ Double_t term2 = 0.;
+ Double_t term3 = 0.;
+
+ // unbiased estimators for covariances for differential flow:
+ Double_t covTwoTwoReduced = 0.; // Cov(<2>,<2'>)
+ Double_t wCovTwoTwoReduced = 0.; // Cov(<2>,<2'>) * prefactor(w_{<2>},w_{<2'>})
+ Double_t covTwoFourReduced = 0.; // Cov(<2>,<4'>)
+ Double_t wCovTwoFourReduced = 0.; // Cov(<2>,<4'>) * prefactor(w_{<2>},w_{<4'>})
+ Double_t covFourTwoReduced = 0.; // Cov(<4>,<2'>)
+ Double_t wCovFourTwoReduced = 0.; // Cov(<4>,<2'>) * prefactor(w_{<4>},w_{<2'>})
+ Double_t covFourFourReduced = 0.; // Cov(<4>,<4'>)
+ Double_t wCovFourFourReduced = 0.; // Cov(<4>,<4'>) * prefactor(w_{<4>},w_{<4'>})
+ Double_t covTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>)
+ Double_t wCovTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) * prefactor(w_{<2'>},w_{<4'>})
+
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+ {
+ // average reduced corelations:
+ twoReduced = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b);
+ fourReduced = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b);
+ // average products:
+ twoTwoReduced = fDiffFlowProductOfCorrelationsPro[t][pe][0][1]->GetBinContent(b);
+ twoFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][0][3]->GetBinContent(b);
+ fourTwoReduced = fDiffFlowProductOfCorrelationsPro[t][pe][1][2]->GetBinContent(b);
+ fourFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][2][3]->GetBinContent(b);
+ twoReducedFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][1][3]->GetBinContent(b);
+ // sum of weights for reduced correlations:
+ sumOfWeightsForTwoReduced = fDiffFlowSumOfEventWeights[t][pe][0][0]->GetBinContent(b);
+ sumOfWeightsForFourReduced = fDiffFlowSumOfEventWeights[t][pe][0][1]->GetBinContent(b);
+ // products of weights for correlations:
+ productOfWeightsForTwoTwoReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][0][1]->GetBinContent(b);
+ productOfWeightsForTwoFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][0][3]->GetBinContent(b);
+ productOfWeightsForFourTwoReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][1][2]->GetBinContent(b);
+ productOfWeightsForFourFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][2][3]->GetBinContent(b);
+ productOfWeightsForTwoReducedFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][1][3]->GetBinContent(b);
+ // denominator for the unbiased estimator for covariances: 1 - term1/(term2*term3)
+ // prefactor (multiplies Cov's) = term1/(term2*term3)
+ // <2>,<2'>:
+ term1 = productOfWeightsForTwoTwoReduced;
+ term2 = sumOfWeightsForTwo;
+ term3 = sumOfWeightsForTwoReduced;
+ if(term2*term3>0.)
+ {
+ denominator = 1.-term1/(term2*term3);
+ prefactor = term1/(term2*term3);
+ if(TMath::Abs(denominator)>1e-6)
+ {
+ covTwoTwoReduced = (twoTwoReduced-two*twoReduced)/denominator;
+ wCovTwoTwoReduced = covTwoTwoReduced*prefactor;
+ fDiffFlowCovariances[t][pe][0]->SetBinContent(b,wCovTwoTwoReduced);
+ }
+ }
+ // <2>,<4'>:
+ term1 = productOfWeightsForTwoFourReduced;
+ term2 = sumOfWeightsForTwo;
+ term3 = sumOfWeightsForFourReduced;
+ if(term2*term3>0.)
+ {
+ denominator = 1.-term1/(term2*term3);
+ prefactor = term1/(term2*term3);
+ if(TMath::Abs(denominator)>1e-6)
+ {
+ covTwoFourReduced = (twoFourReduced-two*fourReduced)/denominator;
+ wCovTwoFourReduced = covTwoFourReduced*prefactor;
+ fDiffFlowCovariances[t][pe][1]->SetBinContent(b,wCovTwoFourReduced);
+ }
+ }
+ // <4>,<2'>:
+ term1 = productOfWeightsForFourTwoReduced;
+ term2 = sumOfWeightsForFour;
+ term3 = sumOfWeightsForTwoReduced;
+ if(term2*term3>0.)
+ {
+ denominator = 1.-term1/(term2*term3);
+ prefactor = term1/(term2*term3);
+ if(TMath::Abs(denominator)>1e-6)
+ {
+ covFourTwoReduced = (fourTwoReduced-four*twoReduced)/denominator;
+ wCovFourTwoReduced = covFourTwoReduced*prefactor;
+ fDiffFlowCovariances[t][pe][2]->SetBinContent(b,wCovFourTwoReduced);
+ }
+ }
+ // <4>,<4'>:
+ term1 = productOfWeightsForFourFourReduced;
+ term2 = sumOfWeightsForFour;
+ term3 = sumOfWeightsForFourReduced;
+ if(term2*term3>0.)
+ {
+ denominator = 1.-term1/(term2*term3);
+ prefactor = term1/(term2*term3);
+ if(TMath::Abs(denominator)>1e-6)
+ {
+ covFourFourReduced = (fourFourReduced-four*fourReduced)/denominator;
+ wCovFourFourReduced = covFourFourReduced*prefactor;
+ fDiffFlowCovariances[t][pe][3]->SetBinContent(b,wCovFourFourReduced);
+ }
+ }
+ // <2'>,<4'>:
+ term1 = productOfWeightsForTwoReducedFourReduced;
+ term2 = sumOfWeightsForTwoReduced;
+ term3 = sumOfWeightsForFourReduced;
+ if(term2*term3>0.)
+ {
+ denominator = 1.-term1/(term2*term3);
+ prefactor = term1/(term2*term3);
+ if(TMath::Abs(denominator)>1e-6)
+ {
+ covTwoReducedFourReduced = (twoReducedFourReduced-twoReduced*fourReduced)/denominator;
+ wCovTwoReducedFourReduced = covTwoReducedFourReduced*prefactor;
+ fDiffFlowCovariances[t][pe][4]->SetBinContent(b,wCovTwoReducedFourReduced);
+ }
+ }
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+
+} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCovariances(TString type, TString ptOrEta)
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, TString ptOrEta)
+{
+ // calculate differential flow from differential cumulants and previously obtained integrated flow: (to be improved: description)
+
+ Int_t typeFlag = -1;
+ Int_t ptEtaFlag = -1;
+
+ if(type == "RP")
+ {
+ typeFlag = 0;
+ } else if(type == "POI")
+ {
+ typeFlag = 1;
+ }
+
+ if(ptOrEta == "Pt")
+ {
+ ptEtaFlag = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ ptEtaFlag = 1;
+ }
+
+ // shortcuts:
+ Int_t t = typeFlag;
+ Int_t pe = ptEtaFlag;
+
+ // common:
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};
+
+ // correlations:
+ Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>>
+ Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>>
+
+ // statistical errors of correlations:
+ Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1);
+ Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2);
+
+ // reduced correlations:
+ Double_t twoReduced = 0.; // <<2'>>
+ Double_t fourReduced = 0.; // <<4'>>
+
+ // statistical errors of reduced correlations:
+ Double_t twoReducedError = 0.;
+ Double_t fourReducedError = 0.;
+
+ // covariances:
+ Double_t wCovTwoFour = fIntFlowCovariances->GetBinContent(1);// // Cov(<2>,<4>) * prefactor(<2>,<4>)
+ Double_t wCovTwoTwoReduced = 0.; // Cov(<2>,<2'>) * prefactor(<2>,<2'>)
+ Double_t wCovTwoFourReduced = 0.; // Cov(<2>,<4'>) * prefactor(<2>,<4'>)
+ Double_t wCovFourTwoReduced = 0.; // Cov(<4>,<2'>) * prefactor(<4>,<2'>)
+ Double_t wCovFourFourReduced = 0.; // Cov(<4>,<4'>) * prefactor(<4>,<4'>)
+ Double_t wCovTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) * prefactor(<2'>,<4'>)
+
+ // differential flow:
+ Double_t v2Prime = 0.; // v'{2}
+ Double_t v4Prime = 0.; // v'{4}
+
+ // statistical error of differential flow:
+ Double_t v2PrimeError = 0.;
+ Double_t v4PrimeError = 0.;
+
+ // squared statistical error of differential flow:
+ Double_t v2PrimeErrorSquared = 0.;
+ Double_t v4PrimeErrorSquared = 0.;
+
+ // loop over pt or eta bins:
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+ {
+ // reduced correlations and statistical errors:
+ twoReduced = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b);
+ twoReducedError = fDiffFlowCorrelationsHist[t][pe][0]->GetBinError(b);
+ fourReduced = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b);
+ fourReducedError = fDiffFlowCorrelationsHist[t][pe][1]->GetBinError(b);
+ // covariances:
+ wCovTwoTwoReduced = fDiffFlowCovariances[t][pe][0]->GetBinContent(b);
+ wCovTwoFourReduced = fDiffFlowCovariances[t][pe][1]->GetBinContent(b);
+ wCovFourTwoReduced = fDiffFlowCovariances[t][pe][2]->GetBinContent(b);
+ wCovFourFourReduced = fDiffFlowCovariances[t][pe][3]->GetBinContent(b);
+ wCovTwoReducedFourReduced = fDiffFlowCovariances[t][pe][4]->GetBinContent(b);
+ // differential flow:
+ // v'{2}:
+ if(two>0.)
+ {
+ v2Prime = twoReduced/pow(two,0.5);
+ v2PrimeErrorSquared = (1./4.)*pow(two,-3.)*
+ (pow(twoReduced,2.)*pow(twoError,2.)
+ + 4.*pow(two,2.)*pow(twoReducedError,2.)
+ - 4.*two*twoReduced*wCovTwoTwoReduced);
+
+
+ if(v2PrimeErrorSquared>0.) v2PrimeError = pow(v2PrimeErrorSquared,0.5);
+ fDiffFlow[t][pe][0]->SetBinContent(b,v2Prime);
+ if(TMath::Abs(v2Prime)>1.e-44)fDiffFlow[t][pe][0]->SetBinError(b,v2PrimeError);
+ }
+ // differential flow:
+ // v'{4}
+ if(2.*pow(two,2.)-four > 0.)
+ {
+ v4Prime = (2.*two*twoReduced-fourReduced)/pow(2.*pow(two,2.)-four,3./4.);
+ v4PrimeErrorSquared = pow(2.*pow(two,2.)-four,-7./2.)*
+ (pow(2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced,2.)*pow(twoError,2.)
+ + (9./16.)*pow(2.*two*twoReduced-fourReduced,2.)*pow(fourError,2.)
+ + 4.*pow(two,2.)*pow(2.*pow(two,2.)-four,2.)*pow(twoReducedError,2.)
+ + pow(2.*pow(two,2.)-four,2.)*pow(fourReducedError,2.)
+ - (3./2.)*(2.*two*twoReduced-fourReduced)
+ * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoFour
+ - 4.*two*(2.*pow(two,2.)-four)
+ * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoTwoReduced
+ + 2.*(2.*pow(two,2.)-four)
+ * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoFourReduced
+ + 3.*two*(2.*pow(two,2.)-four)*(2.*two*twoReduced-fourReduced)*wCovFourTwoReduced
+ - (3./2.)*(2.*pow(two,2.)-four)*(2.*two*twoReduced-fourReduced)*wCovFourFourReduced
+ - 4.*two*pow(2.*pow(two,2.)-four,2.)*wCovTwoReducedFourReduced);
+ if(v4PrimeErrorSquared>0.) v4PrimeError = pow(v4PrimeErrorSquared,0.5);
+ fDiffFlow[t][pe][1]->SetBinContent(b,v4Prime);
+ if(TMath::Abs(v4Prime)>1.e-44)fDiffFlow[t][pe][1]->SetBinError(b,v4PrimeError);
+ }
+
+ } // end of for(Int_t b=1;b<=fnBinsPtEta[pe];b++)
+
+
+
+
+ /*
+ // 2D:
+ for(Int_t nua=0;nua<2;nua++)
+ {
+ for(Int_t p=1;p<=fnBinsPt;p++)
+ {
+ for(Int_t e=1;e<=fnBinsEta;e++)
+ {
+ // differential cumulants:
+ Double_t qc2Prime = fFinalCumulants2D[t][pW][eW][nua][0]->GetBinContent(fFinalCumulants2D[t][pW][eW][nua][0]->GetBin(p,e)); // QC{2'}
+ Double_t qc4Prime = fFinalCumulants2D[t][pW][eW][nua][1]->GetBinContent(fFinalCumulants2D[t][pW][eW][nua][1]->GetBin(p,e)); // QC{4'}
+ // differential flow:
+ Double_t v2Prime = 0.;
+ Double_t v4Prime = 0.;
+ if(v2)
+ {
+ v2Prime = qc2Prime/v2;
+ fFinalFlow2D[t][pW][eW][nua][0]->SetBinContent(fFinalFlow2D[t][pW][eW][nua][0]->GetBin(p,e),v2Prime);
+ }
+ if(v4)
+ {
+ v4Prime = -qc4Prime/pow(v4,3.);
+ fFinalFlow2D[t][pW][eW][nua][1]->SetBinContent(fFinalFlow2D[t][pW][eW][nua][1]->GetBin(p,e),v4Prime);
+ }
+ } // end of for(Int_t e=1;e<=fnBinsEta;e++)
+ } // end of for(Int_t p=1;p<=fnBinsPt;p++)
+ } // end of for(Int_t nua=0;nua<2;nua++)
+ */
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, Bool_t useParticleWeights)
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::StoreIntFlowFlags()
+{
+ // a) Store all flags for integrated flow in profile fIntFlowFlags.
+
+ if(!fIntFlowFlags)
+ {
+ cout<<"WARNING: fIntFlowFlags is NULL in AFAWQC::SFFIF() !!!!"<<endl;
+ exit(0);
+ }
+
+ // particle weights used or not:
+ fIntFlowFlags->Fill(0.5,(Int_t)fUsePhiWeights||fUsePtWeights||fUseEtaWeights);
+ // which event weights were used:
+ if(strcmp(fMultiplicityWeight->Data(),"combinations"))
+ {
+ fIntFlowFlags->Fill(1.5,0); // 0 = "combinations" (default)
+ } else if(strcmp(fMultiplicityWeight->Data(),"unit"))
+ {
+ fIntFlowFlags->Fill(1.5,1); // 1 = "unit"
+ } else if(strcmp(fMultiplicityWeight->Data(),"multiplicity"))
+ {
+ fIntFlowFlags->Fill(1.5,2); // 2 = "multiplicity"
+ }
+ // corrected for non-uniform acceptance or not:
+ fIntFlowFlags->Fill(2.5,(Int_t)fApplyCorrectionForNUA);
+ fIntFlowFlags->Fill(3.5,(Int_t)fPrintFinalResults[0]);
+ fIntFlowFlags->Fill(4.5,(Int_t)fPrintFinalResults[1]);
+ fIntFlowFlags->Fill(5.5,(Int_t)fPrintFinalResults[2]);
+ fIntFlowFlags->Fill(6.5,(Int_t)fPrintFinalResults[3]);
+ fIntFlowFlags->Fill(7.5,(Int_t)fApplyCorrectionForNUAVsM);
+ fIntFlowFlags->Fill(8.5,(Int_t)fPropagateErrorAlsoFromNUATerms);
+ fIntFlowFlags->Fill(9.5,(Int_t)fCalculateCumulantsVsM);
+ fIntFlowFlags->Fill(10.5,(Int_t)fMinimumBiasReferenceFlow);
+
+} // end of void AliFlowAnalysisWithQCumulants::StoreIntFlowFlags()
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::StoreDiffFlowFlags()
+{
+ // Store all flags for differential flow in the profile fDiffFlowFlags.
+
+ if(!fDiffFlowFlags)
+ {
+ cout<<"WARNING: fDiffFlowFlags is NULL in AFAWQC::SFFDF() !!!!"<<endl;
+ exit(0);
+ }
+
+ fDiffFlowFlags->Fill(0.5,fUsePhiWeights||fUsePtWeights||fUseEtaWeights); // particle weights used or not
+ //fDiffFlowFlags->Fill(1.5,""); // which event weight was used? // to be improved
+ fDiffFlowFlags->Fill(2.5,fApplyCorrectionForNUA); // corrected for non-uniform acceptance or not
+ fDiffFlowFlags->Fill(3.5,fCalculate2DFlow); // calculate also 2D differential flow in (pt,eta) or not
+
+} // end of void AliFlowAnalysisWithQCumulants::StoreDiffFlowFlags()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::GetPointersForCommonHistograms()
+{
+ // Access all pointers to common control and common result histograms and profiles.
+
+ TString commonHistsName = "AliFlowCommonHistQC";
+ commonHistsName += fAnalysisLabel->Data();
+ AliFlowCommonHist *commonHist = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHistsName.Data()));
+ if(commonHist) this->SetCommonHists(commonHist);
+ TString commonHists2ndOrderName = "AliFlowCommonHist2ndOrderQC";
+ commonHists2ndOrderName += fAnalysisLabel->Data();
+ AliFlowCommonHist *commonHist2nd = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists2ndOrderName.Data()));
+ if(commonHist2nd) this->SetCommonHists2nd(commonHist2nd);
+ TString commonHists4thOrderName = "AliFlowCommonHist4thOrderQC";
+ commonHists4thOrderName += fAnalysisLabel->Data();
+ AliFlowCommonHist *commonHist4th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists4thOrderName.Data()));
+ if(commonHist4th) this->SetCommonHists4th(commonHist4th);
+ TString commonHists6thOrderName = "AliFlowCommonHist6thOrderQC";
+ commonHists6thOrderName += fAnalysisLabel->Data();
+ AliFlowCommonHist *commonHist6th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists6thOrderName.Data()));
+ if(commonHist6th) this->SetCommonHists6th(commonHist6th);
+ TString commonHists8thOrderName = "AliFlowCommonHist8thOrderQC";
+ commonHists8thOrderName += fAnalysisLabel->Data();
+ AliFlowCommonHist *commonHist8th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists8thOrderName.Data()));
+ if(commonHist8th) this->SetCommonHists8th(commonHist8th);
+ TString commonHistResults2ndOrderName = "AliFlowCommonHistResults2ndOrderQC";
+ commonHistResults2ndOrderName += fAnalysisLabel->Data();
+ AliFlowCommonHistResults *commonHistRes2nd = dynamic_cast<AliFlowCommonHistResults*> (fHistList->FindObject(commonHistResults2ndOrderName.Data()));
+ if(commonHistRes2nd) this->SetCommonHistsResults2nd(commonHistRes2nd);
+ TString commonHistResults4thOrderName = "AliFlowCommonHistResults4thOrderQC";
+ commonHistResults4thOrderName += fAnalysisLabel->Data();
+ AliFlowCommonHistResults *commonHistRes4th = dynamic_cast<AliFlowCommonHistResults*>
+ (fHistList->FindObject(commonHistResults4thOrderName.Data()));
+ if(commonHistRes4th) this->SetCommonHistsResults4th(commonHistRes4th);
+ TString commonHistResults6thOrderName = "AliFlowCommonHistResults6thOrderQC";
+ commonHistResults6thOrderName += fAnalysisLabel->Data();
+ AliFlowCommonHistResults *commonHistRes6th = dynamic_cast<AliFlowCommonHistResults*>
+ (fHistList->FindObject(commonHistResults6thOrderName.Data()));
+ if(commonHistRes6th) this->SetCommonHistsResults6th(commonHistRes6th);
+ TString commonHistResults8thOrderName = "AliFlowCommonHistResults8thOrderQC";
+ commonHistResults8thOrderName += fAnalysisLabel->Data();
+ AliFlowCommonHistResults *commonHistRes8th = dynamic_cast<AliFlowCommonHistResults*>
+ (fHistList->FindObject(commonHistResults8thOrderName.Data()));
+ if(commonHistRes8th) this->SetCommonHistsResults8th(commonHistRes8th);
+
+} // end of void AliFlowAnalysisWithQCumulants::GetPointersForCommonHistograms()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::GetPointersForParticleWeightsHistograms()
+{
+ // Get pointers for histograms with particle weights.
+
+ TList *weightsList = dynamic_cast<TList*>(fHistList->FindObject("Weights"));
+ if(weightsList) this->SetWeightsList(weightsList);
+ TString fUseParticleWeightsName = "fUseParticleWeightsQC"; // to be improved (hirdwired label QC)
+ fUseParticleWeightsName += fAnalysisLabel->Data();
+ TProfile *useParticleWeights = dynamic_cast<TProfile*>(weightsList->FindObject(fUseParticleWeightsName.Data()));
+ if(useParticleWeights)
+ {
+ this->SetUseParticleWeights(useParticleWeights);
+ fUsePhiWeights = (Int_t)fUseParticleWeights->GetBinContent(1);
+ fUsePtWeights = (Int_t)fUseParticleWeights->GetBinContent(2);
+ fUseEtaWeights = (Int_t)fUseParticleWeights->GetBinContent(3);
+ }
+} // end of void AliFlowAnalysisWithQCumulants::GetPointersForParticleWeightsHistograms();
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::GetPointersForIntFlowHistograms()
+{
+ // Get pointers for histograms and profiles relevant for integrated flow:
+ // a) Get pointer to base list for integrated flow holding profile fIntFlowFlags and lists fIntFlowProfiles and fIntFlowResults.
+ // b) Get pointer to profile fIntFlowFlags holding all flags for integrated flow.
+ // c) Get pointer to list fIntFlowProfiles and pointers to all objects that she holds.
+ // d) Get pointer to list fIntFlowResults and pointers to all objects that she holds.
+
+ TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data member?)
+ TString powerFlag[2] = {"linear","quadratic"}; // to be improved (should I promote this to data member?)
+ TString correlationFlag[4] = {"<<2>>","<<4>>","<<6>>","<<8>>"}; // to be improved (should I promote this to data member?)
+
+ // a) Get pointer to base list for integrated flow holding profile fIntFlowFlags and lists fIntFlowProfiles and fIntFlowResults:
+ TList *intFlowList = NULL;
+ intFlowList = dynamic_cast<TList*>(fHistList->FindObject("Integrated Flow"));
+ if(!intFlowList)
+ {
+ cout<<"WARNING: intFlowList is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ exit(0);
+ }
+
+ // b) Get pointer to profile fIntFlowFlags holding all flags for integrated flow:
+ TString intFlowFlagsName = "fIntFlowFlags";
+ intFlowFlagsName += fAnalysisLabel->Data();
+ TProfile *intFlowFlags = dynamic_cast<TProfile*>(intFlowList->FindObject(intFlowFlagsName.Data()));
+ if(intFlowFlags)
+ {
+ this->SetIntFlowFlags(intFlowFlags);
+ fApplyCorrectionForNUA = (Bool_t)intFlowFlags->GetBinContent(3);
+ fApplyCorrectionForNUAVsM = (Bool_t)intFlowFlags->GetBinContent(8);
+ fCalculateCumulantsVsM = (Bool_t)intFlowFlags->GetBinContent(10);
+ } else
+ {
+ cout<<"WARNING: intFlowFlags is NULL in FAWQC::GPFIFH() !!!!"<<endl;
+ }
+
+ // c) Get pointer to list fIntFlowProfiles and pointers to all objects that she holds:
+ TList *intFlowProfiles = NULL;
+ intFlowProfiles = dynamic_cast<TList*>(intFlowList->FindObject("Profiles"));
+ if(intFlowProfiles)
+ {
+ // average multiplicities:
+ TString avMultiplicityName = "fAvMultiplicity";
+ avMultiplicityName += fAnalysisLabel->Data();
+ TProfile *avMultiplicity = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(avMultiplicityName.Data()));
+ if(avMultiplicity)
+ {
+ this->SetAvMultiplicity(avMultiplicity);
+ } else
+ {
+ cout<<"WARNING: avMultiplicity is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with wrong errors!):
+ TString intFlowCorrelationsProName = "fIntFlowCorrelationsPro";
+ intFlowCorrelationsProName += fAnalysisLabel->Data();
+ TProfile *intFlowCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowCorrelationsProName.Data()));
+ if(intFlowCorrelationsPro)
+ {
+ this->SetIntFlowCorrelationsPro(intFlowCorrelationsPro);
+ } else
+ {
+ cout<<"WARNING: intFlowCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ // average correlations <<2>>, <<4>>, <<6>> and <<8>> versus multiplicity for all events (error is wrong here):
+ if(fCalculateCumulantsVsM)
+ {
+ TString intFlowCorrelationsVsMProName = "fIntFlowCorrelationsVsMPro";
+ intFlowCorrelationsVsMProName += fAnalysisLabel->Data();
+ for(Int_t ci=0;ci<4;ci++) // correlation index
+ {
+ TProfile *intFlowCorrelationsVsMPro = dynamic_cast<TProfile*>
+ (intFlowProfiles->FindObject(Form("%s, %s",intFlowCorrelationsVsMProName.Data(),correlationFlag[ci].Data())));
+ if(intFlowCorrelationsVsMPro)
+ {
+ this->SetIntFlowCorrelationsVsMPro(intFlowCorrelationsVsMPro,ci);
+ } else
+ {
+ cout<<"WARNING: "<<Form("intFlowCorrelationsVsMPro[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ } // end of for(Int_t ci=0;ci<4;ci++) // correlation index
+ } // end of if(fCalculateCumulantsVsM)
+ // average all correlations for integrated flow (with wrong errors!):
+ TString intFlowCorrelationsAllProName = "fIntFlowCorrelationsAllPro";
+ intFlowCorrelationsAllProName += fAnalysisLabel->Data();
+ TProfile *intFlowCorrelationsAllPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowCorrelationsAllProName.Data()));
+ if(intFlowCorrelationsAllPro)
+ {
+ this->SetIntFlowCorrelationsAllPro(intFlowCorrelationsAllPro);
+ } else
+ {
+ cout<<"WARNING: intFlowCorrelationsAllPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ // average extra correlations for integrated flow (which appear only when particle weights are used):
+ // (to be improved: Weak point in implementation, I am assuming here that method GetPointersForParticleWeightsHistograms() was called)
+ if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)
+ {
+ TString intFlowExtraCorrelationsProName = "fIntFlowExtraCorrelationsPro";
+ intFlowExtraCorrelationsProName += fAnalysisLabel->Data();
+ TProfile *intFlowExtraCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowExtraCorrelationsProName.Data()));
+ if(intFlowExtraCorrelationsPro)
+ {
+ this->SetIntFlowExtraCorrelationsPro(intFlowExtraCorrelationsPro);
+ } else
+ {
+ cout<<"WARNING: intFlowExtraCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)
+ // average products of correlations <2>, <4>, <6> and <8>:
+ TString intFlowProductOfCorrelationsProName = "fIntFlowProductOfCorrelationsPro";
+ intFlowProductOfCorrelationsProName += fAnalysisLabel->Data();
+ TProfile *intFlowProductOfCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowProductOfCorrelationsProName.Data()));
+ if(intFlowProductOfCorrelationsPro)
+ {
+ this->SetIntFlowProductOfCorrelationsPro(intFlowProductOfCorrelationsPro);
+ } else
+ {
+ cout<<"WARNING: intFlowProductOfCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ // average product of correlations <2>, <4>, <6> and <8> versus multiplicity
+ // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>]
+ if(fCalculateCumulantsVsM)
+ {
+ TString intFlowProductOfCorrelationsVsMProName = "fIntFlowProductOfCorrelationsVsMPro";
+ intFlowProductOfCorrelationsVsMProName += fAnalysisLabel->Data();
+ TString productFlag[6] = {"<<2><4>>","<<2><6>>","<<2><8>>","<<4><6>>","<<4><8>>","<<6><8>>"};
+ for(Int_t pi=0;pi<6;pi++)
+ {
+ TProfile *intFlowProductOfCorrelationsVsMPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(Form("%s, %s",intFlowProductOfCorrelationsVsMProName.Data(),productFlag[pi].Data())));
+ if(intFlowProductOfCorrelationsVsMPro)
+ {
+ this->SetIntFlowProductOfCorrelationsVsMPro(intFlowProductOfCorrelationsVsMPro,pi);
+ } else
+ {
+ cout<<"WARNING: "<<Form("intFlowProductOfCorrelationsVsMPro[%d]",pi)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ } // end of for(Int_t pi=0;pi<6;pi++)
+ } // end of if(fCalculateCumulantsVsM)
+ // average correction terms for non-uniform acceptance (with wrong errors!):
+ for(Int_t sc=0;sc<2;sc++)
+ {
+ TString intFlowCorrectionTermsForNUAProName = "fIntFlowCorrectionTermsForNUAPro";
+ intFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data();
+ TProfile *intFlowCorrectionTermsForNUAPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject((Form("%s: %s terms",intFlowCorrectionTermsForNUAProName.Data(),sinCosFlag[sc].Data()))));
+ if(intFlowCorrectionTermsForNUAPro)
+ {
+ this->SetIntFlowCorrectionTermsForNUAPro(intFlowCorrectionTermsForNUAPro,sc);
+ } else
+ {
+ cout<<"WARNING: intFlowCorrectionTermsForNUAPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ cout<<"sc = "<<sc<<endl;
+ }
+ // versus multiplicity:
+ if(fCalculateCumulantsVsM)
+ {
+ TString correctionTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4
+ TString intFlowCorrectionTermsForNUAVsMProName = "fIntFlowCorrectionTermsForNUAVsMPro";
+ intFlowCorrectionTermsForNUAVsMProName += fAnalysisLabel->Data();
+ for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4)
+ {
+ TProfile *intFlowCorrectionTermsForNUAVsMPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(Form("%s: #LT#LT%s%s#GT#GT",intFlowCorrectionTermsForNUAVsMProName.Data(),sinCosFlag[sc].Data(),correctionTermFlag[ci].Data())));
+ if(intFlowCorrectionTermsForNUAVsMPro)
+ {
+ this->SetIntFlowCorrectionTermsForNUAVsMPro(intFlowCorrectionTermsForNUAVsMPro,sc,ci);
+ } else
+ {
+ cout<<"WARNING: intFlowCorrectionTermsForNUAVsMPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ cout<<"sc = "<<sc<<endl;
+ cout<<"ci = "<<ci<<endl;
+ }
+ } // end of for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4)
+ } // end of if(fCalculateCumulantsVsM)
+ } // end of for(Int_t sc=0;sc<2;sc++)
+ // average products of correction terms for NUA:
+ TString intFlowProductOfCorrectionTermsForNUAProName = "fIntFlowProductOfCorrectionTermsForNUAPro";
+ intFlowProductOfCorrectionTermsForNUAProName += fAnalysisLabel->Data();
+ TProfile *intFlowProductOfCorrectionTermsForNUAPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowProductOfCorrectionTermsForNUAProName.Data()));
+ if(intFlowProductOfCorrectionTermsForNUAPro)
+ {
+ this->SetIntFlowProductOfCorrectionTermsForNUAPro(intFlowProductOfCorrectionTermsForNUAPro);
+ } else
+ {
+ cout<<"WARNING: intFlowProductOfCorrectionTermsForNUAPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ } else // to if(intFlowProfiles)
+ {
+ cout<<"WARNING: intFlowProfiles is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+
+ // d) Get pointer to list fIntFlowResults and pointers to all objects that she holds.
+ TList *intFlowResults = NULL;
+ intFlowResults = dynamic_cast<TList*>(intFlowList->FindObject("Results"));
+ if(intFlowResults)
+ {
+ // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with correct errors!):
+ TString intFlowCorrelationsHistName = "fIntFlowCorrelationsHist";
+ intFlowCorrelationsHistName += fAnalysisLabel->Data();
+ TH1D *intFlowCorrelationsHist = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCorrelationsHistName.Data()));
+ if(intFlowCorrelationsHist)
+ {
+ this->SetIntFlowCorrelationsHist(intFlowCorrelationsHist);
+ } else
+ {
+ cout<<"WARNING: intFlowCorrelationsHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with correct errors!) vs M:
+ if(fCalculateCumulantsVsM)
+ {
+ TString intFlowCorrelationsVsMHistName = "fIntFlowCorrelationsVsMHist";
+ intFlowCorrelationsVsMHistName += fAnalysisLabel->Data();
+ for(Int_t ci=0;ci<4;ci++) // correlation index
+ {
+ TH1D *intFlowCorrelationsVsMHist = dynamic_cast<TH1D*>
+ (intFlowResults->FindObject(Form("%s, %s",intFlowCorrelationsVsMHistName.Data(),correlationFlag[ci].Data())));
+ if(intFlowCorrelationsVsMHist)
+ {
+ this->SetIntFlowCorrelationsVsMHist(intFlowCorrelationsVsMHist,ci);
+ } else
+ {
+ cout<<"WARNING: "<<Form("intFlowCorrelationsVsMHist[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ } // end of for(Int_t ci=0;ci<4;ci++) // correlation index
+ } // end of if(fCalculateCumulantsVsM)
+ // average all correlations for integrated flow (with correct errors!):
+ TString intFlowCorrelationsAllHistName = "fIntFlowCorrelationsAllHist";
+ intFlowCorrelationsAllHistName += fAnalysisLabel->Data();
+ TH1D *intFlowCorrelationsAllHist = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCorrelationsAllHistName.Data()));
+ if(intFlowCorrelationsAllHist)
+ {
+ this->SetIntFlowCorrelationsAllHist(intFlowCorrelationsAllHist);
+ } else
+ {
+ cout<<"WARNING: intFlowCorrelationsAllHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ // average correction terms for non-uniform acceptance (with correct errors!):
+ TString intFlowCorrectionTermsForNUAHistName = "fIntFlowCorrectionTermsForNUAHist";
+ intFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data();
+ for(Int_t sc=0;sc<2;sc++)
+ {
+ TH1D *intFlowCorrectionTermsForNUAHist = dynamic_cast<TH1D*>(intFlowResults->FindObject((Form("%s: %s terms",intFlowCorrectionTermsForNUAHistName.Data(),sinCosFlag[sc].Data()))));
+ if(intFlowCorrectionTermsForNUAHist)
+ {
+ this->SetIntFlowCorrectionTermsForNUAHist(intFlowCorrectionTermsForNUAHist,sc);
+ } else
+ {
+ cout<<"WARNING: intFlowCorrectionTermsForNUAHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ cout<<"sc = "<<sc<<endl;
+ }
+ } // end of for(Int_t sc=0;sc<2;sc++)
+ // covariances (multiplied with weight dependent prefactor):
+ TString intFlowCovariancesName = "fIntFlowCovariances";
+ intFlowCovariancesName += fAnalysisLabel->Data();
+ TH1D *intFlowCovariances = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCovariancesName.Data()));
+ if(intFlowCovariances)
+ {
+ this->SetIntFlowCovariances(intFlowCovariances);
+ } else
+ {
+ cout<<"WARNING: intFlowCovariances is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ // sum of linear and quadratic event weights for <2>, <4>, <6> and <8>:
+ TString intFlowSumOfEventWeightsName = "fIntFlowSumOfEventWeights";
+ intFlowSumOfEventWeightsName += fAnalysisLabel->Data();
+ for(Int_t power=0;power<2;power++)
+ {
+ TH1D *intFlowSumOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s: %s",intFlowSumOfEventWeightsName.Data(),powerFlag[power].Data())));
+ if(intFlowSumOfEventWeights)
+ {
+ this->SetIntFlowSumOfEventWeights(intFlowSumOfEventWeights,power);
+ } else
+ {
+ cout<<"WARNING: intFlowSumOfEventWeights is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ cout<<"power = "<<power<<endl;
+ }
+ } // end of for(Int_t power=0;power<2;power++)
+ // sum of products of event weights for correlations <2>, <4>, <6> and <8>:
+ TString intFlowSumOfProductOfEventWeightsName = "fIntFlowSumOfProductOfEventWeights";
+ intFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data();
+ TH1D *intFlowSumOfProductOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowSumOfProductOfEventWeightsName.Data()));
+ if(intFlowSumOfProductOfEventWeights)
+ {
+ this->SetIntFlowSumOfProductOfEventWeights(intFlowSumOfProductOfEventWeights);
+ } else
+ {
+ cout<<"WARNING: intFlowSumOfProductOfEventWeights is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ // final result for covariances of correlations (multiplied with weight dependent prefactor) versus M
+ // [0=Cov(2,4),1=Cov(2,6),2=Cov(2,8),3=Cov(4,6),4=Cov(4,8),5=Cov(6,8)]:
+ if(fCalculateCumulantsVsM)
+ {
+ TString intFlowCovariancesVsMName = "fIntFlowCovariancesVsM";
+ intFlowCovariancesVsMName += fAnalysisLabel->Data();
+ TString covarianceFlag[6] = {"Cov(<2>,<4>)","Cov(<2>,<6>)","Cov(<2>,<8>)","Cov(<4>,<6>)","Cov(<4>,<8>)","Cov(<6>,<8>)"};
+ for(Int_t ci=0;ci<6;ci++)
+ {
+ TH1D *intFlowCovariancesVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowCovariancesVsMName.Data(),covarianceFlag[ci].Data())));
+ if(intFlowCovariancesVsM)
+ {
+ this->SetIntFlowCovariancesVsM(intFlowCovariancesVsM,ci);
+ } else
+ {
+ cout<<"WARNING: "<<Form("intFlowCovariancesVsM[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ } // end of for(Int_t ci=0;ci<6;ci++)
+ } // end of if(fCalculateCumulantsVsM)
+ // sum of linear and quadratic event weights for <2>, <4>, <6> and <8> versus multiplicity
+ // [0=sum{w_{<2>}},1=sum{w_{<4>}},2=sum{w_{<6>}},3=sum{w_{<8>}}][0=linear 1,1=quadratic]:
+ if(fCalculateCumulantsVsM)
+ {
+ TString intFlowSumOfEventWeightsVsMName = "fIntFlowSumOfEventWeightsVsM";
+ intFlowSumOfEventWeightsVsMName += fAnalysisLabel->Data();
+ TString sumFlag[2][4] = {{"#sum_{i=1}^{N} w_{<2>}","#sum_{i=1}^{N} w_{<4>}","#sum_{i=1}^{N} w_{<6>}","#sum_{i=1}^{N} w_{<8>}"},
+ {"#sum_{i=1}^{N} w_{<2>}^{2}","#sum_{i=1}^{N} w_{<4>}^{2}","#sum_{i=1}^{N} w_{<6>}^{2}","#sum_{i=1}^{N} w_{<8>}^{2}"}};
+ for(Int_t si=0;si<4;si++)
+ {
+ for(Int_t power=0;power<2;power++)
+ {
+ TH1D *intFlowSumOfEventWeightsVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowSumOfEventWeightsVsMName.Data(),sumFlag[power][si].Data())));
+ if(intFlowSumOfEventWeightsVsM)
+ {
+ this->SetIntFlowSumOfEventWeightsVsM(intFlowSumOfEventWeightsVsM,si,power);
+ } else
+ {
+ cout<<"WARNING: "<<Form("intFlowSumOfEventWeightsVsM[%d][%d]",si,power)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ } // end of for(Int_t power=0;power<2;power++)
+ } // end of for(Int_t si=0;si<4;si++)
+ } // end of if(fCalculateCumulantsVsM)
+ // sum of products of event weights for correlations <2>, <4>, <6> and <8> vs M
+ // [0=sum{w_{<2>}w_{<4>}},1=sum{w_{<2>}w_{<6>}},2=sum{w_{<2>}w_{<8>}},
+ // 3=sum{w_{<4>}w_{<6>}},4=sum{w_{<4>}w_{<8>}},5=sum{w_{<6>}w_{<8>}}]:
+ if(fCalculateCumulantsVsM)
+ {
+ TString intFlowSumOfProductOfEventWeightsVsMName = "fIntFlowSumOfProductOfEventWeightsVsM";
+ intFlowSumOfProductOfEventWeightsVsMName += fAnalysisLabel->Data();
+ TString sopowFlag[6] = {"#sum_{i=1}^{N} w_{<2>} w_{<4>}","#sum_{i=1}^{N} w_{<2>} w_{<6>}","#sum_{i=1}^{N} w_{<2>} w_{<8>}",
+ "#sum_{i=1}^{N} w_{<4>} w_{<6>}","#sum_{i=1}^{N} w_{<4>} w_{<8>}","#sum_{i=1}^{N} w_{<6>} w_{<8>}"};
+ for(Int_t pi=0;pi<6;pi++)
+ {
+ TH1D *intFlowSumOfProductOfEventWeightsVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowSumOfProductOfEventWeightsVsMName.Data(),sopowFlag[pi].Data())));
+ if(intFlowSumOfProductOfEventWeightsVsM)
+ {
+ this->SetIntFlowSumOfProductOfEventWeightsVsM(intFlowSumOfProductOfEventWeightsVsM,pi);
+ } else
+ {
+ cout<<"WARNING: "<<Form("intFlowSumOfProductOfEventWeightsVsM[%d]",pi)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ } // end of for(Int_t pi=0;pi<6;pi++)
+ } // end of if(fCalculateCumulantsVsM)
+ // covariances for NUA (multiplied with weight dependent prefactor):
+ TString intFlowCovariancesNUAName = "fIntFlowCovariancesNUA";
+ intFlowCovariancesNUAName += fAnalysisLabel->Data();
+ TH1D *intFlowCovariancesNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCovariancesNUAName.Data()));
+ if(intFlowCovariancesNUA)
+ {
+ this->SetIntFlowCovariancesNUA(intFlowCovariancesNUA);
+ } else
+ {
+ cout<<"WARNING: intFlowCovariancesNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ // sum of linear and quadratic event weights NUA terms:
+ TString intFlowSumOfEventWeightsNUAName = "fIntFlowSumOfEventWeightsNUA";
+ intFlowSumOfEventWeightsNUAName += fAnalysisLabel->Data();
+ for(Int_t sc=0;sc<2;sc++)
+ {
+ for(Int_t power=0;power<2;power++)
+ {
+ TH1D *intFlowSumOfEventWeightsNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s: %s, %s",intFlowSumOfEventWeightsNUAName.Data(),powerFlag[power].Data(),sinCosFlag[sc].Data())));
+ if(intFlowSumOfEventWeightsNUA)
+ {
+ this->SetIntFlowSumOfEventWeightsNUA(intFlowSumOfEventWeightsNUA,sc,power);
+ } else
+ {
+ cout<<"WARNING: intFlowSumOfEventWeightsNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ cout<<"sc = "<<sc<<endl;
+ cout<<"power = "<<power<<endl;
+ }
+ } // end of for(Int_t power=0;power<2;power++)
+ } // end of for(Int_t sc=0;sc<2;sc++)
+ // sum of products of event weights for NUA terms:
+ TString intFlowSumOfProductOfEventWeightsNUAName = "fIntFlowSumOfProductOfEventWeightsNUA";
+ intFlowSumOfProductOfEventWeightsNUAName += fAnalysisLabel->Data();
+ TH1D *intFlowSumOfProductOfEventWeightsNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowSumOfProductOfEventWeightsNUAName.Data()));
+ if(intFlowSumOfProductOfEventWeightsNUA)
+ {
+ this->SetIntFlowSumOfProductOfEventWeightsNUA(intFlowSumOfProductOfEventWeightsNUA);
+ } else
+ {
+ cout<<"WARNING: intFlowSumOfProductOfEventWeightsNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ // Final results for reference Q-cumulants:
+ TString intFlowQcumulantsName = "fIntFlowQcumulants";
+ intFlowQcumulantsName += fAnalysisLabel->Data();
+ TH1D *intFlowQcumulants = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsName.Data()));
+ if(intFlowQcumulants)
+ {
+ this->SetIntFlowQcumulants(intFlowQcumulants);
+ } else
+ {
+ cout<<"WARNING: intFlowQcumulants is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ // Final results for reference Q-cumulants rebinned in M:
+ if(fCalculateCumulantsVsM)
+ {
+ TString intFlowQcumulantsRebinnedInMName = "fIntFlowQcumulantsRebinnedInM";
+ intFlowQcumulantsRebinnedInMName += fAnalysisLabel->Data();
+ TH1D *intFlowQcumulantsRebinnedInM = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsRebinnedInMName.Data()));
+ if(intFlowQcumulantsRebinnedInM)
+ {
+ this->SetIntFlowQcumulantsRebinnedInM(intFlowQcumulantsRebinnedInM);
+ } else
+ {
+ cout<<"WARNING: intFlowQcumulantsRebinnedInM is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ } // end of if(fCalculateCumulantsVsM)
+ // Ratio between error squared: with/without non-isotropic terms:
+ TString intFlowQcumulantsErrorSquaredRatioName = "fIntFlowQcumulantsErrorSquaredRatio";
+ intFlowQcumulantsErrorSquaredRatioName += fAnalysisLabel->Data();
+ TH1D *intFlowQcumulantsErrorSquaredRatio = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsErrorSquaredRatioName.Data()));
+ if(intFlowQcumulantsErrorSquaredRatio)
+ {
+ this->SetIntFlowQcumulantsErrorSquaredRatio(intFlowQcumulantsErrorSquaredRatio);
+ } else
+ {
+ cout<<" WARNING: intntFlowQcumulantsErrorSquaredRatio is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ // final results for integrated Q-cumulants versus multiplicity:
+ TString cumulantFlag[4] = {"QC{2}","QC{4}","QC{6}","QC{8}"};
+ if(fCalculateCumulantsVsM)
+ {
+ TString intFlowQcumulantsVsMName = "fIntFlowQcumulantsVsM";
+ intFlowQcumulantsVsMName += fAnalysisLabel->Data();
+ for(Int_t co=0;co<4;co++) // cumulant order
+ {
+ TH1D *intFlowQcumulantsVsM = dynamic_cast<TH1D*>
+ (intFlowResults->FindObject(Form("%s, %s",intFlowQcumulantsVsMName.Data(),cumulantFlag[co].Data())));
+ if(intFlowQcumulantsVsM)
+ {
+ this->SetIntFlowQcumulantsVsM(intFlowQcumulantsVsM,co);
+ } else
+ {
+ cout<<"WARNING: "<<Form("intFlowQcumulantsVsM[%d]",co)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ } // end of for(Int_t co=0;co<4;co++) // cumulant order
+ } // end of if(fCalculateCumulantsVsM)
+ // Final reference flow estimates from Q-cumulants:
+ TString intFlowName = "fIntFlow";
+ intFlowName += fAnalysisLabel->Data();
+ TH1D *intFlow = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowName.Data()));
+ if(intFlow)
+ {
+ this->SetIntFlow(intFlow);
+ } else
+ {
+ cout<<"WARNING: intFlow is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ // Final reference flow estimates from Q-cumulants vs M rebinned in M:
+ if(fCalculateCumulantsVsM)
+ {
+ TString intFlowRebinnedInMName = "fIntFlowRebinnedInM";
+ intFlowRebinnedInMName += fAnalysisLabel->Data();
+ TH1D *intFlowRebinnedInM = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowRebinnedInMName.Data()));
+ if(intFlowRebinnedInM)
+ {
+ this->SetIntFlowRebinnedInM(intFlowRebinnedInM);
+ } else
+ {
+ cout<<"WARNING: intFlowRebinnedInM is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ } // end of if(fCalculateCumulantsVsM)
+ // integrated flow from Q-cumulants versus multiplicity:
+ if(fCalculateCumulantsVsM)
+ {
+ TString intFlowVsMName = "fIntFlowVsM";
+ intFlowVsMName += fAnalysisLabel->Data();
+ TString flowFlag[4] = {"v_{2}{2,QC}","v_{2}{4,QC}","v_{2}{6,QC}","v_{2}{8,QC}"}; // to be improved (harwired harmonic)
+ for(Int_t co=0;co<4;co++) // cumulant order
+ {
+ TH1D *intFlowVsM = dynamic_cast<TH1D*>
+ (intFlowResults->FindObject(Form("%s, %s",intFlowVsMName.Data(),flowFlag[co].Data())));
+ if(intFlowVsM)
+ {
+ this->SetIntFlowVsM(intFlowVsM,co);
+ } else
+ {
+ cout<<"WARNING: "<<Form("intFlowVsM[%d]",co)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ } // end of for(Int_t co=0;co<4;co++) // cumulant order
+ } // end of if(fCalculateCumulantsVsM)
+ // quantifying detector effects effects to correlations:
+ TString intFlowDetectorBiasName = "fIntFlowDetectorBias";
+ intFlowDetectorBiasName += fAnalysisLabel->Data();
+ TH1D *intFlowDetectorBias = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowDetectorBiasName.Data()));
+ if(intFlowDetectorBias)
+ {
+ this->SetIntFlowDetectorBias(intFlowDetectorBias);
+ } else
+ {
+ cout<<"WARNING: intFlowDetectorBias is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ // quantifying detector effects effects to correlations vs multiplicity:
+ if(fApplyCorrectionForNUAVsM && fCalculateCumulantsVsM)
+ {
+ TString intFlowDetectorBiasVsMName = "fIntFlowDetectorBiasVsM";
+ intFlowDetectorBiasVsMName += fAnalysisLabel->Data();
+ for(Int_t ci=0;ci<4;ci++) // correlation index
+ {
+ TH1D *intFlowDetectorBiasVsM = dynamic_cast<TH1D*>
+ (intFlowResults->FindObject(Form("%s for %s",intFlowDetectorBiasVsMName.Data(),cumulantFlag[ci].Data())));
+ if(intFlowDetectorBiasVsM)
+ {
+ this->SetIntFlowDetectorBiasVsM(intFlowDetectorBiasVsM,ci);
+ } else
+ {
+ cout<<"WARNING: "<<Form("intFlowDetectorBiasVsM[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+ } // end of for(Int_t ci=0;ci<4;ci++) // correlation index
+ } // end of if(ApplyCorrectionForNUAVsM)
+ } else // to if(intFlowResults)
+ {
+ cout<<"WARNING: intFlowResults is NULL in AFAWQC::GPFIFH() !!!!"<<endl;
+ }
+
+} // end of void AliFlowAnalysisWithQCumulants::GetPointersForIntFlowHistograms()
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::GetPointersForDiffFlowHistograms()
+{
+ // Get pointer to all objects relevant for differential flow.
+ // a) Define flags locally (to be improved: should I promote flags to data members?);
+ // b) Get pointer to base list for differential flow fDiffFlowList and nested lists fDiffFlowListProfiles and fDiffFlowListResults;
+ // c) Get pointer to profile fDiffFlowFlags holding all flags for differential flow;
+ // d) Get pointers to all nested lists in fDiffFlowListProfiles and to profiles which they hold;
+ // e) Get pointers to all nested lists in fDiffFlowListResults and to histograms which they hold.
+
+ // a) Define flags locally (to be improved: should I promote flags to data members?):
+ TString typeFlag[2] = {"RP","POI"};
+ TString ptEtaFlag[2] = {"p_{T}","#eta"};
+ TString powerFlag[2] = {"linear","quadratic"};
+ TString sinCosFlag[2] = {"sin","cos"};
+ TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"};
+ TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"};
+ TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"};
+ TString mixedCorrelationIndex[8] = {"<2>","<2'>","<4>","<4'>","<6>","<6'>","<8>","<8'>"};
+ TString covarianceName[5] = {"Cov(<2>,<2'>)","Cov(<2>,<4'>)","Cov(<4>,<2'>)","Cov(<4>,<4'>)","Cov(<2'>,<4'>)"};
+
+ // b) Get pointer to base list for differential flow fDiffFlowList and nested lists fDiffFlowListProfiles and fDiffFlowListResults:
+ TList *diffFlowList = NULL;
+ diffFlowList = dynamic_cast<TList*>(fHistList->FindObject("Differential Flow"));
+ if(!diffFlowList)
+ {
+ cout<<"WARNING: diffFlowList is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ exit(0);
+ }
+ // list holding nested lists containing profiles:
+ TList *diffFlowListProfiles = NULL;
+ diffFlowListProfiles = dynamic_cast<TList*>(diffFlowList->FindObject("Profiles"));
+ if(!diffFlowListProfiles)
+ {
+ cout<<"WARNING: diffFlowListProfiles is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ exit(0);
+ }
+ // list holding nested lists containing 2D and 1D histograms with final results:
+ TList *diffFlowListResults = NULL;
+ diffFlowListResults = dynamic_cast<TList*>(diffFlowList->FindObject("Results"));
+ if(!diffFlowListResults)
+ {
+ cout<<"WARNING: diffFlowListResults is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ exit(0);
+ }
+
+ // c) Get pointer to profile holding all flags for differential flow;
+ TString diffFlowFlagsName = "fDiffFlowFlags";
+ diffFlowFlagsName += fAnalysisLabel->Data();
+ TProfile *diffFlowFlags = dynamic_cast<TProfile*>(diffFlowList->FindObject(diffFlowFlagsName.Data()));
+ Bool_t bCalculate2DFlow = kFALSE;
+ if(diffFlowFlags)
+ {
+ this->SetDiffFlowFlags(diffFlowFlags);
+ bCalculate2DFlow = (Int_t)diffFlowFlags->GetBinContent(4);
+ this->SetCalculate2DFlow(bCalculate2DFlow); // to be improved (shoul I call this setter somewhere else?)
+ }
+
+ // d) Get pointers to all nested lists in fDiffFlowListProfiles and to profiles which they hold;
+ // correlations:
+ TList *diffFlowCorrelationsProList[2][2] = {{NULL}};
+ TString diffFlowCorrelationsProName = "fDiffFlowCorrelationsPro";
+ diffFlowCorrelationsProName += fAnalysisLabel->Data();
+ TProfile *diffFlowCorrelationsPro[2][2][4] = {{{NULL}}};
+ // products of correlations:
+ TList *diffFlowProductOfCorrelationsProList[2][2] = {{NULL}};
+ TString diffFlowProductOfCorrelationsProName = "fDiffFlowProductOfCorrelationsPro";
+ diffFlowProductOfCorrelationsProName += fAnalysisLabel->Data();
+ TProfile *diffFlowProductOfCorrelationsPro[2][2][8][8] = {{{{NULL}}}};
+ // corrections:
+ TList *diffFlowCorrectionsProList[2][2] = {{NULL}};
+ TString diffFlowCorrectionTermsForNUAProName = "fDiffFlowCorrectionTermsForNUAPro";
+ diffFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data();
+ TProfile *diffFlowCorrectionTermsForNUAPro[2][2][2][10] = {{{{NULL}}}};
+ for(Int_t t=0;t<2;t++)
+ {
+ for(Int_t pe=0;pe<2;pe++)
+ {
+ diffFlowCorrelationsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));
+ if(!diffFlowCorrelationsProList[t][pe])
+ {
+ cout<<"WARNING: diffFlowCorrelationsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ exit(0);
+ }
+ for(Int_t ci=0;ci<4;ci++) // correlation index
+ {
+ diffFlowCorrelationsPro[t][pe][ci] = dynamic_cast<TProfile*>(diffFlowCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[ci].Data())));
+ if(diffFlowCorrelationsPro[t][pe][ci])
+ {
+ this->SetDiffFlowCorrelationsPro(diffFlowCorrelationsPro[t][pe][ci],t,pe,ci);
+ } else
+ {
+ cout<<"WARNING: diffFlowCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ cout<<"ci = "<<ci<<endl;
+ }
+ } // end of for(Int_t ci=0;ci<4;ci++) // correlation index
+ // products of correlations:
+ diffFlowProductOfCorrelationsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with products of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));
+ if(!diffFlowProductOfCorrelationsProList[t][pe])
+ {
+ cout<<"WARNING: ddiffFlowProductOfCorrelationsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ exit(0);
+ }
+ for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index
+ {
+ for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index
+ {
+ diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = dynamic_cast<TProfile*>(diffFlowProductOfCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data())));
+ if(diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2])
+ {
+ this->SetDiffFlowProductOfCorrelationsPro(diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2],t,pe,mci1,mci2);
+ } else
+ {
+ cout<<"WARNING: diffFlowCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ cout<<"mci1 = "<<mci1<<endl;
+ cout<<"mci2 = "<<mci2<<endl;
+ }
+ if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here
+ } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index
+ } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index
+ // corrections:
+ diffFlowCorrectionsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));
+ if(!diffFlowCorrectionsProList[t][pe])
+ {
+ cout<<"WARNING: diffFlowCorrectionsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ exit(0);
+ }
+ // correction terms for NUA:
+ for(Int_t sc=0;sc<2;sc++) // sin or cos
+ {
+ for(Int_t cti=0;cti<9;cti++) // correction term index
+ {
+ diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = dynamic_cast<TProfile*>(diffFlowCorrectionsProList[t][pe]->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1)));
+ if(diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti])
+ {
+ this->SetDiffFlowCorrectionTermsForNUAPro(diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti],t,pe,sc,cti);
+ } else
+ {
+ cout<<"WARNING: diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ cout<<"sc = "<<sc<<endl;
+ cout<<"cti = "<<cti<<endl;
+ }
+ } // end of for(Int_t cti=0;cti<9;cti++) // correction term index
+ } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos
+ // ...
+ } // end of for(Int_t pe=0;pe<2;pe++)
+ } // end of for(Int_t t=0;t<2;t++)
+
+ // e) Get pointers to all nested lists in fDiffFlowListResults and to histograms which they hold.
+ // reduced correlations:
+ TList *diffFlowCorrelationsHistList[2][2] = {{NULL}};
+ TString diffFlowCorrelationsHistName = "fDiffFlowCorrelationsHist";
+ diffFlowCorrelationsHistName += fAnalysisLabel->Data();
+ TH1D *diffFlowCorrelationsHist[2][2][4] = {{{NULL}}};
+ // corrections for NUA:
+ TList *diffFlowCorrectionsHistList[2][2] = {{NULL}};
+ TString diffFlowCorrectionTermsForNUAHistName = "fDiffFlowCorrectionTermsForNUAHist";
+ diffFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data();
+ TH1D *diffFlowCorrectionTermsForNUAHist[2][2][2][10] = {{{{NULL}}}};
+ // differential Q-cumulants:
+ TList *diffFlowCumulantsHistList[2][2] = {{NULL}};
+ TString diffFlowCumulantsName = "fDiffFlowCumulants";
+ diffFlowCumulantsName += fAnalysisLabel->Data();
+ TH1D *diffFlowCumulants[2][2][4] = {{{NULL}}};
+ // differential flow estimates from Q-cumulants:
+ TList *diffFlowHistList[2][2] = {{NULL}};
+ TString diffFlowName = "fDiffFlow";
+ diffFlowName += fAnalysisLabel->Data();
+ TH1D *diffFlow[2][2][4] = {{{NULL}}};
+ // differential covariances:
+ TList *diffFlowCovariancesHistList[2][2] = {{NULL}};
+ TString diffFlowCovariancesName = "fDiffFlowCovariances";
+ diffFlowCovariancesName += fAnalysisLabel->Data();
+ TH1D *diffFlowCovariances[2][2][5] = {{{NULL}}};
+ for(Int_t t=0;t<2;t++) // type: RP or POI
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ // reduced correlations:
+ diffFlowCorrelationsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));
+ if(!diffFlowCorrelationsHistList[t][pe])
+ {
+ cout<<"WARNING: diffFlowCorrelationsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ exit(0);
+ }
+ for(Int_t index=0;index<4;index++)
+ {
+ diffFlowCorrelationsHist[t][pe][index] = dynamic_cast<TH1D*>(diffFlowCorrelationsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data())));
+ if(diffFlowCorrelationsHist[t][pe][index])
+ {
+ this->SetDiffFlowCorrelationsHist(diffFlowCorrelationsHist[t][pe][index],t,pe,index);
+ } else
+ {
+ cout<<"WARNING: diffFlowCorrelationsHist[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ cout<<"index = "<<index<<endl;
+ exit(0);
+ }
+ } // end of for(Int_t index=0;index<4;index++)
+ // corrections:
+ diffFlowCorrectionsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Histograms with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));
+ if(!diffFlowCorrectionsHistList[t][pe])
+ {
+ cout<<"WARNING: diffFlowCorrectionsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ exit(0);
+ }
+ // correction terms for NUA:
+ for(Int_t sc=0;sc<2;sc++) // sin or cos
+ {
+ for(Int_t cti=0;cti<9;cti++) // correction term index
+ {
+ diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = dynamic_cast<TH1D*>(diffFlowCorrectionsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1)));
+ if(diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti])
+ {
+ this->SetDiffFlowCorrectionTermsForNUAHist(diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti],t,pe,sc,cti);
+ } else
+ {
+ cout<<"WARNING: diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ cout<<"sc = "<<sc<<endl;
+ cout<<"cti = "<<cti<<endl;
+ }
+ } // end of for(Int_t cti=0;cti<9;cti++) // correction term index
+ } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos
+ // ...
+ // differential Q-cumulants:
+ diffFlowCumulantsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Differential Q-cumulants (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));
+ if(!diffFlowCumulantsHistList[t][pe])
+ {
+ cout<<"WARNING: diffFlowCumulantsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ exit(0);
+ }
+ for(Int_t index=0;index<4;index++)
+ {
+ diffFlowCumulants[t][pe][index] = dynamic_cast<TH1D*>(diffFlowCumulantsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data())));
+ if(diffFlowCumulants[t][pe][index])
+ {
+ this->SetDiffFlowCumulants(diffFlowCumulants[t][pe][index],t,pe,index);
+ } else
+ {
+ cout<<"WARNING: diffFlowCumulants[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ cout<<"index = "<<index<<endl;
+ exit(0);
+ }
+ } // end of for(Int_t index=0;index<4;index++)
+ // differential flow estimates from Q-cumulants:
+ diffFlowHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Differential flow (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));
+ if(!diffFlowHistList[t][pe])
+ {
+ cout<<"WARNING: diffFlowHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ exit(0);
+ }
+ for(Int_t index=0;index<4;index++)
+ {
+ diffFlow[t][pe][index] = dynamic_cast<TH1D*>(diffFlowHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data())));
+ if(diffFlow[t][pe][index])
+ {
+ this->SetDiffFlow(diffFlow[t][pe][index],t,pe,index);
+ } else
+ {
+ cout<<"WARNING: diffFlow[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ cout<<"index = "<<index<<endl;
+ exit(0);
+ }
+ } // end of for(Int_t index=0;index<4;index++)
+ // differential covariances:
+ diffFlowCovariancesHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Covariances of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));
+ if(!diffFlowCovariancesHistList[t][pe])
+ {
+ cout<<"WARNING: diffFlowCovariancesHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ exit(0);
+ }
+ for(Int_t covIndex=0;covIndex<5;covIndex++)
+ {
+ diffFlowCovariances[t][pe][covIndex] = dynamic_cast<TH1D*>(diffFlowCovariancesHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data())));
+ if(diffFlowCovariances[t][pe][covIndex])
+ {
+ this->SetDiffFlowCovariances(diffFlowCovariances[t][pe][covIndex],t,pe,covIndex);
+ } else
+ {
+ cout<<"WARNING: diffFlowCovariances[t][pe][covIndex] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ cout<<"covIndex = "<<covIndex<<endl;
+ exit(0);
+ }
+ } // end of for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI
+ // sum of event weights for reduced correlations:
+ TList *diffFlowSumOfEventWeightsHistList[2][2][2] = {{{NULL}}};
+ TString diffFlowSumOfEventWeightsName = "fDiffFlowSumOfEventWeights";
+ diffFlowSumOfEventWeightsName += fAnalysisLabel->Data();
+ TH1D *diffFlowSumOfEventWeights[2][2][2][4] = {{{{NULL}}}};
+ for(Int_t t=0;t<2;t++) // type is RP or POI
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t p=0;p<2;p++) // power of event weights is either 1 or 2
+ {
+ diffFlowSumOfEventWeightsHistList[t][pe][p] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Sum of %s event weights (%s, %s)",powerFlag[p].Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data())));
+ if(!diffFlowSumOfEventWeightsHistList[t][pe][p])
+ {
+ cout<<"WARNING: diffFlowSumOfEventWeightsHistList[t][pe][p] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ cout<<"power = "<<p<<endl;
+ exit(0);
+ }
+ for(Int_t ew=0;ew<4;ew++) // index of reduced correlation
+ {
+ diffFlowSumOfEventWeights[t][pe][p][ew] = dynamic_cast<TH1D*>(diffFlowSumOfEventWeightsHistList[t][pe][p]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data())));
+ if(diffFlowSumOfEventWeights[t][pe][p][ew])
+ {
+ this->SetDiffFlowSumOfEventWeights(diffFlowSumOfEventWeights[t][pe][p][ew],t,pe,p,ew);
+ } else
+ {
+ cout<<"WARNING: diffFlowSumOfEventWeights[t][pe][p][ew] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ cout<<"power = "<<p<<endl;
+ cout<<"ew = "<<ew<<endl;
+ exit(0);
+ }
+ }
+ } // end of for(Int_t p=0;p<2;p++) // power of event weights is either 1 or 2
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta
+ } // end of for(Int_t t=0;t<2;t++) // type is RP or POI
+ //
+ TList *diffFlowSumOfProductOfEventWeightsHistList[2][2] = {{NULL}};
+ TString diffFlowSumOfProductOfEventWeightsName = "fDiffFlowSumOfProductOfEventWeights";
+ diffFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data();
+ TH1D *diffFlowSumOfProductOfEventWeights[2][2][8][8] = {{{{NULL}}}};
+ for(Int_t t=0;t<2;t++) // type is RP or POI
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ diffFlowSumOfProductOfEventWeightsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Sum of products of event weights (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));
+ if(!diffFlowSumOfProductOfEventWeightsHistList[t][pe])
+ {
+ cout<<"WARNING: diffFlowSumOfProductOfEventWeightsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ exit(0);
+ }
+ for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index
+ {
+ for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index
+ {
+ diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = dynamic_cast<TH1D*>(diffFlowSumOfProductOfEventWeightsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data())));
+ if(diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2])
+ {
+ this->SetDiffFlowSumOfProductOfEventWeights(diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2],t,pe,mci1,mci2);
+ } else
+ {
+ cout<<"WARNING: diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ cout<<"mci1 = "<<mci1<<endl;
+ cout<<"mci2 = "<<mci2<<endl;
+ exit(0);
+ }
+ if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here
+ } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index
+ } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta
+ } // end of for(Int_t t=0;t<2;t++) // type is RP or POI
+
+} // end void AliFlowAnalysisWithQCumulants::GetPointersForDiffFlowHistograms()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow()
+{
+ // Book all histograms and profiles needed for differential flow.
+ // a) Define flags locally (to be improved: should I promote flags to data members?);
+ // b) Book profile to hold all flags for differential flow;
+ // c) Book e-b-e quantities;
+ // d) Book profiles;
+ // e) Book histograms holding final results.
+
+ // a) Define flags locally (to be improved: should I promote flags to data members?):
+ TString typeFlag[2] = {"RP","POI"};
+ TString ptEtaFlag[2] = {"p_{T}","#eta"};
+ TString powerFlag[2] = {"linear","quadratic"};
+ TString sinCosFlag[2] = {"sin","cos"};
+ TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"};
+ TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"};
+ TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"};
+ TString mixedCorrelationIndex[8] = {"<2>","<2'>","<4>","<4'>","<6>","<6'>","<8>","<8'>"};
+ TString covarianceName[5] = {"Cov(<2>,<2'>)","Cov(<2>,<4'>)","Cov(<4>,<2'>)","Cov(<4>,<4'>)","Cov(<2'>,<4'>)"};
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};
+ Double_t minPtEta[2] = {fPtMin,fEtaMin};
+ Double_t maxPtEta[2] = {fPtMax,fEtaMax};
+
+ // b) Book profile to hold all flags for differential flow:
+ TString diffFlowFlagsName = "fDiffFlowFlags";
+ diffFlowFlagsName += fAnalysisLabel->Data();
+ fDiffFlowFlags = new TProfile(diffFlowFlagsName.Data(),"Flags for Differential Flow",4,0,4);
+ fDiffFlowFlags->SetTickLength(-0.01,"Y");
+ fDiffFlowFlags->SetMarkerStyle(25);
+ fDiffFlowFlags->SetLabelSize(0.05);
+ fDiffFlowFlags->SetLabelOffset(0.02,"Y");
+ (fDiffFlowFlags->GetXaxis())->SetBinLabel(1,"Particle Weights");
+ (fDiffFlowFlags->GetXaxis())->SetBinLabel(2,"Event Weights");
+ (fDiffFlowFlags->GetXaxis())->SetBinLabel(3,"Corrected for NUA?");
+ (fDiffFlowFlags->GetXaxis())->SetBinLabel(4,"Calculated 2D flow?");
+ fDiffFlowList->Add(fDiffFlowFlags);
+
+ // c) Book e-b-e quantities:
+ // Event-by-event r_{m*n,k}(pt,eta), p_{m*n,k}(pt,eta) and q_{m*n,k}(pt,eta)
+ // Explanantion of notation:
+ // 1.) n is harmonic, m is multiple of harmonic;
+ // 2.) k is power of particle weight;
+ // 3.) r_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for RPs in particular (pt,eta) bin (i-th RP is weighted with w_i^k);
+ // 4.) p_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for POIs in particular (pt,eta) bin
+ // (if i-th POI is also RP, than it is weighted with w_i^k);
+ // 5.) q_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for particles which are both RPs and POIs in particular (pt,eta) bin
+ // (i-th RP&&POI is weighted with w_i^k)
+
+ // 1D:
+ for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP && POI )
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t m=0;m<4;m++) // multiple of harmonic
+ {
+ for(Int_t k=0;k<9;k++) // power of particle weight
+ {
+ fReRPQ1dEBE[t][pe][m][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%dpower%dRe",t,pe,m,k),
+ Form("TypeFlag%dpteta%dmultiple%dpower%dRe",t,pe,m,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);
+ fImRPQ1dEBE[t][pe][m][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%dpower%dIm",t,pe,m,k),
+ Form("TypeFlag%dpteta%dmultiple%dpower%dIm",t,pe,m,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);
+ }
+ }
+ }
+ }
+ // to be improved (add explanation of fs1dEBE[t][pe][k]):
+ for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI )
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t k=0;k<9;k++) // power of particle weight
+ {
+ fs1dEBE[t][pe][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%d",t,pe,k),
+ Form("TypeFlag%dpteta%dmultiple%d",t,pe,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);
+ }
+ }
+ }
+ // correction terms for nua:
+ for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI)
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t sc=0;sc<2;sc++) // sin or cos
+ {
+ for(Int_t cti=0;cti<9;cti++) // correction term index
+ {
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti] = new TH1D(Form("typeFlag%d pteta%d sincos%d cti%d",t,pe,sc,cti),
+ Form("typeFlag%d pteta%d sincos%d cti%d",t,pe,sc,cti),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);
+ }
+ }
+ }
+ }
+ // 2D:
+ TProfile2D styleRe("typeMultiplePowerRe","typeMultiplePowerRe",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
+ TProfile2D styleIm("typeMultiplePowerIm","typeMultiplePowerIm",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
+ for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI )
+ {
+ for(Int_t m=0;m<4;m++)
+ {
+ for(Int_t k=0;k<9;k++)
+ {
+ fReRPQ2dEBE[t][m][k] = (TProfile2D*)styleRe.Clone(Form("typeFlag%dmultiple%dpower%dRe",t,m,k));
+ fImRPQ2dEBE[t][m][k] = (TProfile2D*)styleIm.Clone(Form("typeFlag%dmultiple%dpower%dIm",t,m,k));
+ }
+ }
+ }
+ TProfile2D styleS("typePower","typePower",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
+ for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI )
+ {
+ for(Int_t k=0;k<9;k++)
+ {
+ fs2dEBE[t][k] = (TProfile2D*)styleS.Clone(Form("typeFlag%dpower%d",t,k));
+ }
+ }
+ // reduced correlations e-b-e:
+ TString diffFlowCorrelationsEBEName = "fDiffFlowCorrelationsEBE";
+ diffFlowCorrelationsEBEName += fAnalysisLabel->Data();
+ for(Int_t t=0;t<2;t++) // type: RP or POI
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t rci=0;rci<4;rci++) // reduced correlation index
+ {
+ fDiffFlowCorrelationsEBE[t][pe][rci] = new TH1D(Form("%s, %s, %s, %s",diffFlowCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);
+ } // end of for(Int_t ci=0;ci<4;ci++) // correlation index
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI
+ // event weights for reduced correlations e-b-e:
+ TString diffFlowEventWeightsForCorrelationsEBEName = "fDiffFlowEventWeightsForCorrelationsEBE";
+ diffFlowEventWeightsForCorrelationsEBEName += fAnalysisLabel->Data();
+ for(Int_t t=0;t<2;t++) // type: RP or POI
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t rci=0;rci<4;rci++) // event weight for reduced correlation index
+ {
+ fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci] = new TH1D(Form("%s, %s, %s, eW for %s",diffFlowEventWeightsForCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, eW for %s",diffFlowEventWeightsForCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);
+ } // end of for(Int_t ci=0;ci<4;ci++) // correlation index
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI
+
+ // d) Book profiles;
+ // reduced correlations:
+ TString diffFlowCorrelationsProName = "fDiffFlowCorrelationsPro";
+ diffFlowCorrelationsProName += fAnalysisLabel->Data();
+ // corrections terms:
+ TString diffFlowCorrectionTermsForNUAProName = "fDiffFlowCorrectionTermsForNUAPro";
+ diffFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data();
+ for(Int_t t=0;t<2;t++) // type: RP or POI
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t rci=0;rci<4;rci++) // reduced correlation index
+ {
+ // reduced correlations:
+ fDiffFlowCorrelationsPro[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe],"s");
+ fDiffFlowCorrelationsPro[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data());
+ fDiffFlowCorrelationsProList[t][pe]->Add(fDiffFlowCorrelationsPro[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations)
+ } // end of for(Int_t rci=0;rci<4;rci++) // correlation index
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI
+ // correction terms for nua:
+ for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI)
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t sc=0;sc<2;sc++) // sin or cos
+ {
+ for(Int_t cti=0;cti<9;cti++) // correction term index
+ {
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = new TProfile(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);
+ fDiffFlowCorrectionsProList[t][pe]->Add(fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]);
+ }
+ }
+ }
+ }
+ // e) Book histograms holding final results.
+ // reduced correlations:
+ TString diffFlowCorrelationsHistName = "fDiffFlowCorrelationsHist";
+ diffFlowCorrelationsHistName += fAnalysisLabel->Data();
+ // corrections terms:
+ TString diffFlowCorrectionTermsForNUAHistName = "fDiffFlowCorrectionTermsForNUAHist";
+ diffFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data();
+ // differential covariances:
+ TString diffFlowCovariancesName = "fDiffFlowCovariances";
+ diffFlowCovariancesName += fAnalysisLabel->Data();
+ // differential Q-cumulants:
+ TString diffFlowCumulantsName = "fDiffFlowCumulants";
+ diffFlowCumulantsName += fAnalysisLabel->Data();
+ // differential flow:
+ TString diffFlowName = "fDiffFlow";
+ diffFlowName += fAnalysisLabel->Data();
+ for(Int_t t=0;t<2;t++) // type: RP or POI
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t index=0;index<4;index++)
+ {
+ // reduced correlations:
+ fDiffFlowCorrelationsHist[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);
+ fDiffFlowCorrelationsHist[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data());
+ fDiffFlowCorrelationsHistList[t][pe]->Add(fDiffFlowCorrelationsHist[t][pe][index]);
+ // differential Q-cumulants:
+ fDiffFlowCumulants[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);
+ fDiffFlowCumulants[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data());
+ fDiffFlowCumulantsHistList[t][pe]->Add(fDiffFlowCumulants[t][pe][index]);
+ // differential flow estimates from Q-cumulants:
+ fDiffFlow[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);
+ fDiffFlow[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data());
+ fDiffFlowHistList[t][pe]->Add(fDiffFlow[t][pe][index]);
+ } // end of for(Int_t index=0;index<4;index++)
+ for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index
+ {
+ // differential covariances:
+ fDiffFlowCovariances[t][pe][covIndex] = new TH1D(Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()),Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);
+ fDiffFlowCovariances[t][pe][covIndex]->SetXTitle(ptEtaFlag[pe].Data());
+ fDiffFlowCovariancesHistList[t][pe]->Add(fDiffFlowCovariances[t][pe][covIndex]);
+ } // end of for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index
+ // products of both types of correlations:
+ TString diffFlowProductOfCorrelationsProName = "fDiffFlowProductOfCorrelationsPro";
+ diffFlowProductOfCorrelationsProName += fAnalysisLabel->Data();
+ for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index
+ {
+ for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index
+ {
+ fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = new TProfile(Form("%s, %s, %s, %s, %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),Form("%s, %s, %s, %s #times %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);
+ fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]->SetXTitle(ptEtaFlag[pe].Data());
+ fDiffFlowProductOfCorrelationsProList[t][pe]->Add(fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]);
+ if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here
+ } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index
+ } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI
+ // sums of event weights for reduced correlations:
+ TString diffFlowSumOfEventWeightsName = "fDiffFlowSumOfEventWeights";
+ diffFlowSumOfEventWeightsName += fAnalysisLabel->Data();
+ for(Int_t t=0;t<2;t++) // type is RP or POI
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t p=0;p<2;p++) // power of weights is either 1 or 2
+ {
+ for(Int_t ew=0;ew<4;ew++) // index of reduced correlation
+ {
+ fDiffFlowSumOfEventWeights[t][pe][p][ew] = new TH1D(Form("%s, %s, %s, %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()),Form("%s, %s, %s, power = %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);
+ fDiffFlowSumOfEventWeights[t][pe][p][ew]->SetXTitle(ptEtaFlag[pe].Data());
+ fDiffFlowSumOfEventWeightsHistList[t][pe][p]->Add(fDiffFlowSumOfEventWeights[t][pe][p][ew]); // to be improved (add dedicated list to hold all this)
+ }
+ }
+ }
+ }
+ // sum of products of event weights for both types of correlations:
+ TString diffFlowSumOfProductOfEventWeightsName = "fDiffFlowSumOfProductOfEventWeights";
+ diffFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data();
+ for(Int_t t=0;t<2;t++) // type is RP or POI
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index
+ {
+ for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index
+ {
+ fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = new TH1D(Form("%s, %s, %s, %s, %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),Form("%s, %s, %s, %s #times %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);
+ fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]->SetXTitle(ptEtaFlag[pe].Data());
+ fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]->Add(fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]);
+ if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here
+ }
+ }
+ }
+ }
+ // correction terms for nua:
+ for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI)
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t sc=0;sc<2;sc++) // sin or cos
+ {
+ for(Int_t cti=0;cti<9;cti++) // correction term index
+ {
+ fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = new TH1D(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);
+ fDiffFlowCorrectionsHistList[t][pe]->Add(fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]);
+ }
+ }
+ }
+ }
+
+} // end of AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow()
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::CalculateQcumulantsCorrectedForNUAIntFlow()
+{
+ // Calculate generalized Q-cumulants (cumulants corrected for non-unifom acceptance).
+
+ // Isotropic cumulants:
+ Double_t QC2 = fIntFlowQcumulants->GetBinContent(1);
+ Double_t QC2Error = fIntFlowQcumulants->GetBinError(1);
+ Double_t QC4 = fIntFlowQcumulants->GetBinContent(2);
+ Double_t QC4Error = fIntFlowQcumulants->GetBinError(2);
+ //Double_t QC6 = fIntFlowQcumulants->GetBinContent(3);
+ //Double_t QC6Error = fIntFlowQcumulants->GetBinError(3);
+ //Double_t QC8 = fIntFlowQcumulants->GetBinContent(4);
+ //Double_t QC8Error = fIntFlowQcumulants->GetBinError(4);
+
+ // Measured 2-, 4-, 6- and 8-particle correlations:
+ Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>>
+ Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <<2>>
+ Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>>
+ Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <<4>>
+ //Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>>
+ //Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <<6>>
+ //Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>>
+ //Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <<8>>
+
+ // Non-isotropic terms:
+ Double_t c1 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1); // <<cos(n*phi1)>>
+ Double_t c1Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(1); // statistical error of <<cos(n*phi1)>>
+ Double_t c2 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2); // <<cos(n*(phi1+phi2))>>
+ Double_t c2Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(2); // statistical error of <<cos(n*(phi1+phi2))>>
+ Double_t c3 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(3); // <<cos(n*(phi1-phi2-phi3))>>
+ Double_t c3Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(3); // statistical error of <<cos(n*(phi1-phi2-phi3))>>
+ Double_t s1 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1); // <<sin(n*phi1)>>
+ Double_t s1Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(1); // statistical error of <<sin(n*phi1)>>
+ Double_t s2 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2); // <<sin(n*(phi1+phi2))>>
+ Double_t s2Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(2); // statistical error of <<sin(n*(phi1+phi2))>>
+ Double_t s3 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(3); // <<sin(n*(phi1-phi2-phi3))>>
+ Double_t s3Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(3); // statistical error of <<sin(n*(phi1-phi2-phi3))>>
+
+ // Shortcuts:
+ Double_t a1 = 2.*pow(c1,2.)+2.*pow(s1,2.)-two;
+ Double_t a2 = 6.*pow(c1,3.)-2.*c1*c2+c3+6.*c1*pow(s1,2.)-2.*s1*s2-4.*c1*two;
+ Double_t a3 = 2.*pow(s1,2.)-2.*pow(c1,2.)+c2;
+ Double_t a4 = 6.*pow(s1,3.)+6.*pow(c1,2.)*s1+2.*c2*s1-2.*c1*s2-s3-4.*s1*two;
+ Double_t a5 = 4.*c1*s1-s2;
+
+ // Covariances (including weight dependent prefactor):
+ Double_t wCov1 = fIntFlowCovariancesNUA->GetBinContent(1); // w*Cov(<2>,<cos(phi))
+ Double_t wCov2 = fIntFlowCovariancesNUA->GetBinContent(2); // w*Cov(<2>,<sin(phi))
+ Double_t wCov3 = fIntFlowCovariancesNUA->GetBinContent(3); // w*Cov(<cos(phi),<sin(phi))
+ Double_t wCov4 = fIntFlowCovariances->GetBinContent(1); // w*Cov(<2>,<4>)
+ Double_t wCov5 = fIntFlowCovariancesNUA->GetBinContent(4); // w*Cov(<2>,<cos(#phi_{1}+#phi_{2})>)
+ Double_t wCov6 = fIntFlowCovariancesNUA->GetBinContent(6); // w*Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)
+ Double_t wCov7 = fIntFlowCovariancesNUA->GetBinContent(5); // w*Cov(<2>,<sin(#phi_{1}+#phi_{2})>)
+ Double_t wCov8 = fIntFlowCovariancesNUA->GetBinContent(7); // w*Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)
+ Double_t wCov9 = fIntFlowCovariancesNUA->GetBinContent(8); // w*Cov(<4>,<cos(#phi)>
+ Double_t wCov10 = fIntFlowCovariancesNUA->GetBinContent(10); // w*Cov(<4>,<cos(#phi_{1}+#phi_{2})>)
+ Double_t wCov11 = fIntFlowCovariancesNUA->GetBinContent(12); // w*Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)
+ Double_t wCov12 = fIntFlowCovariancesNUA->GetBinContent(9); // w*Cov(<4>,<sin(#phi)>
+ Double_t wCov13 = fIntFlowCovariancesNUA->GetBinContent(11); // w*Cov(<4>,<sin(#phi_{1}+#phi_{2})>)
+ Double_t wCov14 = fIntFlowCovariancesNUA->GetBinContent(13); // w*Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)
+ Double_t wCov15 = fIntFlowCovariancesNUA->GetBinContent(14); // w*Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>)
+ Double_t wCov16 = fIntFlowCovariancesNUA->GetBinContent(16); // w*Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)
+ Double_t wCov17 = fIntFlowCovariancesNUA->GetBinContent(15); // w*Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>)
+ Double_t wCov18 = fIntFlowCovariancesNUA->GetBinContent(17); // w*Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)
+ Double_t wCov19 = fIntFlowCovariancesNUA->GetBinContent(23); // w*Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)
+ Double_t wCov20 = fIntFlowCovariancesNUA->GetBinContent(18); // w*Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>)
+ Double_t wCov21 = fIntFlowCovariancesNUA->GetBinContent(22); // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>)
+ Double_t wCov22 = fIntFlowCovariancesNUA->GetBinContent(24); // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)
+ Double_t wCov23 = fIntFlowCovariancesNUA->GetBinContent(20); // w*Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)
+ Double_t wCov24 = fIntFlowCovariancesNUA->GetBinContent(25); // w*Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)
+ Double_t wCov25 = fIntFlowCovariancesNUA->GetBinContent(27); // w*Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>)
+ Double_t wCov26 = fIntFlowCovariancesNUA->GetBinContent(19); // w*Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>)
+ Double_t wCov27 = fIntFlowCovariancesNUA->GetBinContent(21); // w*Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)
+ Double_t wCov28 = fIntFlowCovariancesNUA->GetBinContent(26); // w*Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)
+
+ // Calculating generalized QC{2}:
+ // Generalized QC{2}:
+ Double_t gQC2 = two - pow(c1,2.) - pow(s1,2.);
+ if(fApplyCorrectionForNUA){fIntFlowQcumulants->SetBinContent(1,gQC2);}
+ // Statistical error of generalized QC{2}:
+ Double_t gQC2ErrorSquared = pow(twoError,2.)+4.*pow(c1,2.)*pow(c1Error,2.)
+ + 4.*pow(s1,2.)*pow(s1Error,2.)
+ - 4*c1*wCov1-4*s1*wCov2
+ + 8.*c1*s1*wCov3;
+ // Store ratio of error squared - with/without NUA terms:
+ Double_t ratioErrorSquaredQC2 = 0.;
+ if(fIntFlowQcumulants->GetBinError(1)>0.)
+ {
+ ratioErrorSquaredQC2 = (gQC2ErrorSquared/pow(fIntFlowQcumulants->GetBinError(1),2.));
+ fIntFlowQcumulantsErrorSquaredRatio->SetBinContent(1,ratioErrorSquaredQC2);
+ }
+ // If enabled, store error by including non-isotropic terms:
+ if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNUATerms)
+ {
+ if(gQC2ErrorSquared>=0.)
+ {
+ fIntFlowQcumulants->SetBinError(1,pow(gQC2ErrorSquared,0.5));
+ } else
+ {
+ fIntFlowQcumulants->SetBinError(1,0.);
+ cout<<endl;
+ cout<<" WARNING (QC): Statistical error of generalized QC{2} is imaginary !!!!"<<endl;
+ cout<<endl;
+ }
+ } // end of if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNUATerms)
+ // Quantify detector bias to QC{2}:
+ if(TMath::Abs(QC2)>0.)
+ {
+ fIntFlowDetectorBias->SetBinContent(1,gQC2/QC2);
+ if(QC2Error>0.)
+ {
+ Double_t errorSquared = gQC2ErrorSquared/pow(QC2,2.)+pow(gQC2,2.)*pow(QC2Error,2.)/pow(QC2,4.);
+ if(errorSquared>0.)
+ {
+ fIntFlowDetectorBias->SetBinError(1,pow(errorSquared,0.5));
+ }
+ }
+ } // end of if(TMath::Abs(QC2)>0.)
+
+ // Calculating generalized QC{4}:
+ // Generalized QC{4}:
+ Double_t gQC4 = four-2.*pow(two,2.)
+ - 4.*c1*c3+4.*s1*s3-pow(c2,2.)-pow(s2,2.)
+ + 4.*c2*(pow(c1,2.)-pow(s1,2.))+8.*s2*s1*c1
+ + 8.*two*(pow(c1,2.)+pow(s1,2.))-6.*pow((pow(c1,2.)+pow(s1,2.)),2.);
+ if(fApplyCorrectionForNUA){fIntFlowQcumulants->SetBinContent(2,gQC4);}
+ // Statistical error of generalized QC{4}:
+ Double_t gQC4ErrorSquared = 16.*pow(a1,2.)*pow(twoError,2.)+pow(fourError,2.)+16.*pow(a2,2.)*pow(c1Error,2.)
+ + 4.*pow(a3,2.)*pow(c2Error,2.)+16.*pow(c1,2.)*pow(c3Error,2.)
+ + 16.*pow(a4,2.)*pow(s1Error,2.)+4.*pow(a5,2.)*pow(s2Error,2.)
+ + 16.*pow(s1,2.)*pow(s3Error,2.)+8.*a1*wCov4-32.*a1*a2*wCov1
+ - 16.*a3*a1*wCov5-32.*c1*a1*wCov6-32.*a1*a4*wCov2+16.*a5*a1*wCov7
+ + 32.*s1*a1*wCov8-8.*a2*wCov9-4.*a3*wCov10-8.*c1*wCov11-8.*a4*wCov12
+ + 4.*a5*wCov13+8.*s1*wCov14+16.*a3*a2*wCov15+32.*c1*a2*wCov16+32.*a2*a4*wCov3
+ - 16.*a5*a2*wCov17-32.*s1*a2*wCov18+16.*c1*a3*wCov19+16.*a3*a4*wCov20
+ - 8.*a3*a5*wCov21-16.*s1*a3*wCov22+32.*c1*a4*wCov23-16.*c1*a5*wCov24
+ - 32.*c1*s1*wCov25-16.*a5*a4*wCov26-32.*s1*a4*wCov27+16.*s1*a5*wCov28;
+ // Store ratio of error squared - with/without NUA terms:
+ Double_t ratioErrorSquaredQC4 = 0.;
+ if(fIntFlowQcumulants->GetBinError(2)>0.)
+ {
+ ratioErrorSquaredQC4 = (gQC4ErrorSquared/pow(fIntFlowQcumulants->GetBinError(2),2.));
+ fIntFlowQcumulantsErrorSquaredRatio->SetBinContent(2,ratioErrorSquaredQC4);
+ }
+ if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNUATerms)
+ {
+ if(gQC4ErrorSquared>=0.)
+ {
+ fIntFlowQcumulants->SetBinError(2,pow(gQC4ErrorSquared,0.5));
+ } else
+ {
+ fIntFlowQcumulants->SetBinError(2,0.);
+ cout<<endl;
+ cout<<" WARNING (QC): Statistical error of generalized QC{4} is imaginary !!!!"<<endl;
+ cout<<endl;
+ }
+ } // end of if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNUATerms)
+ // Quantify detector bias to QC{4}:
+ if(TMath::Abs(QC4)>0.)
+ {
+ fIntFlowDetectorBias->SetBinContent(2,gQC4/QC4);
+ if(QC4Error>0.)
+ {
+ Double_t errorSquared = gQC4ErrorSquared/pow(QC4,2.)+pow(gQC4,2.)*pow(QC4Error,2.)/pow(QC4,4.);
+ if(errorSquared>0.)
+ {
+ fIntFlowDetectorBias->SetBinError(2,pow(errorSquared,0.5));
+ }
+ }
+ } // end of if(TMath::Abs(QC4)>0.)
+
+
+ // .... to be improved (continued for 6th and 8th order) ....
+
+
+ // versus multiplicity:
+ if(fApplyCorrectionForNUAVsM && fCalculateCumulantsVsM) // to be improved - propagate error for nua terms vs M
+ {
+ Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0)
+ for(Int_t b=1;b<=nBins;b++)
+ {
+ // Measured correlations:
+ two = fIntFlowCorrelationsVsMHist[0]->GetBinContent(b); // <<2>> vs M
+ four = fIntFlowCorrelationsVsMHist[1]->GetBinContent(b); // <<4>> vs M
+ // Isotropic cumulants:
+ QC2 = two;
+ QC4 = four-2.*pow(two,2.);
+ // Non-isotropic terms:
+ c1 = fIntFlowCorrectionTermsForNUAVsMPro[1][0]->GetBinContent(b); // <<cos(n*phi1)>>
+ c2 = fIntFlowCorrectionTermsForNUAVsMPro[1][1]->GetBinContent(b); // <<cos(n*(phi1+phi2))>>
+ c3 = fIntFlowCorrectionTermsForNUAVsMPro[1][2]->GetBinContent(b); // <<cos(n*(phi1-phi2-phi3))>>
+ s1 = fIntFlowCorrectionTermsForNUAVsMPro[0][0]->GetBinContent(b); // <<sin(n*phi1)>>
+ s2 = fIntFlowCorrectionTermsForNUAVsMPro[0][1]->GetBinContent(b); // <<sin(n*(phi1+phi2))>>
+ s3 = fIntFlowCorrectionTermsForNUAVsMPro[0][2]->GetBinContent(b); // <<sin(n*(phi1-phi2-phi3))>>
+ // Generalized QC{2} vs M:
+ gQC2 = two - pow(c1,2.) - pow(s1,2.);
+ fIntFlowQcumulantsVsM[0]->SetBinContent(b,gQC2);
+ // Generalized QC{4} vs M:
+ gQC4 = four-2.*pow(two,2.)
+ - 4.*c1*c3+4.*s1*s3-pow(c2,2.)-pow(s2,2.)
+ + 4.*c2*(pow(c1,2.)-pow(s1,2.))+8.*s2*s1*c1
+ + 8.*two*(pow(c1,2.)+pow(s1,2.))-6.*pow((pow(c1,2.)+pow(s1,2.)),2.);
+ fIntFlowQcumulantsVsM[1]->SetBinContent(b,gQC4);
+ // Detector bias vs M:
+ if(TMath::Abs(QC2)>0.)
+ {
+ fIntFlowDetectorBiasVsM[0]->SetBinContent(b,gQC2/QC2);
+ } // end of if(TMath::Abs(QC2)>0.)
+ if(TMath::Abs(QC4)>0.)
+ {
+ fIntFlowDetectorBiasVsM[1]->SetBinContent(b,gQC4/QC4);
+ } // end of if(TMath::Abs(QC4)>0.)
+ } // end of for(Int_t b=1;b<=nBins;b++)
+ } // end of if(fApplyCorrectionForNUAVsM && fCalculateCumulantsVsM)
+
+} // end of void AliFlowAnalysisWithQCumulants::CalculateQcumulantsCorrectedForNUAIntFlow()
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUAIntFlow()
+{
+ // From profile fIntFlowCorrectionTermsForNUAPro[sc] access measured correction terms for NUA
+ // and their spread, correctly calculate the statistical errors and store the final
+ // results and statistical errors for correction terms for NUA in histogram fIntFlowCorrectionTermsForNUAHist[sc].
+ //
+ // Remark: Statistical error of correction temrs is calculated as:
+ //
+ // statistical error = termA * spread * termB:
+ // termA = sqrt{sum_{i=1}^{N} w^2}/(sum_{i=1}^{N} w)
+ // termB = 1/sqrt(1-termA^2)
+
+ TString sinCosFlag[2] = {"sin","cos"}; // to be improved - promore this to data member?
+ TString nonisotropicTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4
+
+ for(Int_t sc=0;sc<2;sc++) // sin or cos correction terms
+ {
+ for(Int_t ci=1;ci<=4;ci++) // correction term index (to be improved - hardwired 4)
+ {
+ Double_t correction = fIntFlowCorrectionTermsForNUAPro[sc]->GetBinContent(ci);
+ Double_t spread = fIntFlowCorrectionTermsForNUAPro[sc]->GetBinError(ci);
+ Double_t sumOfLinearEventWeights = fIntFlowSumOfEventWeightsNUA[sc][0]->GetBinContent(ci);
+ Double_t sumOfQuadraticEventWeights = fIntFlowSumOfEventWeightsNUA[sc][1]->GetBinContent(ci);
+ Double_t termA = 0.;
+ Double_t termB = 0.;
+ if(TMath::Abs(sumOfLinearEventWeights)>1.e-44)
+ {
+ termA = pow(sumOfQuadraticEventWeights,0.5)/sumOfLinearEventWeights;
+ } else
+ {
+ cout<<" WARNING (QC): sumOfLinearEventWeights == 0 in AFAWQC::FCTFNIF() !!!!"<<endl;
+ cout<<Form(" (for <<%s[%s]>> non-isotropic term)",sinCosFlag[sc].Data(),nonisotropicTermFlag[ci-1].Data())<<endl;
+ }
+ if(1.-pow(termA,2.) > 0.)
+ {
+ termB = 1./pow(1-pow(termA,2.),0.5);
+ } else
+ {
+ cout<<" WARNING (QC): 1.-pow(termA,2.) <= 0 in AFAWQC::FCTFNIF() !!!!"<<endl;
+ cout<<Form(" (for <<%s[%s]>> non-isotropic term)",sinCosFlag[sc].Data(),nonisotropicTermFlag[ci-1].Data())<<endl;
+ }
+ Double_t statisticalError = termA * spread * termB;
+ fIntFlowCorrectionTermsForNUAHist[sc]->SetBinContent(ci,correction);
+ fIntFlowCorrectionTermsForNUAHist[sc]->SetBinError(ci,statisticalError);
+ } // end of for(Int_t ci=1;ci<=4;ci++) // correction term index
+ } // end of for(Int sc=0;sc<2;sc++) // sin or cos correction terms
+
+} // end of void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUAIntFlow()
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::GetPointersForNestedLoopsHistograms()
+{
+ // Get pointers to all objects relevant for calculations with nested loops.
+
+ TList *nestedLoopsList = dynamic_cast<TList*>(fHistList->FindObject("Nested Loops"));
+ if(nestedLoopsList)
+ {
+ this->SetNestedLoopsList(nestedLoopsList);
+ } else
+ {
+ cout<<"WARNING: nestedLoopsList is NULL in AFAWQC::GPFNLH() !!!!"<<endl;
+ exit(0);
+ }
+
+ TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?)
+ TString typeFlag[2] = {"RP","POI"}; // to be improved (should I promote this to data members?)
+ TString ptEtaFlag[2] = {"p_{T}","#eta"}; // to be improved (should I promote this to data members?)
+ TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; // to be improved (should I promote this to data members?)
+
+ TString evaluateNestedLoopsName = "fEvaluateNestedLoops";
+ evaluateNestedLoopsName += fAnalysisLabel->Data();
+ TProfile *evaluateNestedLoops = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(evaluateNestedLoopsName.Data()));
+ Bool_t bEvaluateIntFlowNestedLoops = kFALSE;
+ Bool_t bEvaluateDiffFlowNestedLoops = kFALSE;
+ if(evaluateNestedLoops)
+ {
+ this->SetEvaluateNestedLoops(evaluateNestedLoops);
+ bEvaluateIntFlowNestedLoops = (Int_t)evaluateNestedLoops->GetBinContent(1);
+ bEvaluateDiffFlowNestedLoops = (Int_t)evaluateNestedLoops->GetBinContent(2);
+ }
+ // nested loops relevant for integrated flow:
+ if(bEvaluateIntFlowNestedLoops)
+ {
+ // correlations:
+ TString intFlowDirectCorrelationsName = "fIntFlowDirectCorrelations";
+ intFlowDirectCorrelationsName += fAnalysisLabel->Data();
+ TProfile *intFlowDirectCorrelations = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(intFlowDirectCorrelationsName.Data()));
+ if(intFlowDirectCorrelations)
+ {
+ this->SetIntFlowDirectCorrelations(intFlowDirectCorrelations);
+ } else
+ {
+ cout<<"WARNING: intFlowDirectCorrelations is NULL in AFAWQC::GPFNLH() !!!!"<<endl;
+ exit(0);
+ }
+ if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)
+ {
+ TString intFlowExtraDirectCorrelationsName = "fIntFlowExtraDirectCorrelations";
+ intFlowExtraDirectCorrelationsName += fAnalysisLabel->Data();
+ TProfile *intFlowExtraDirectCorrelations = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(intFlowExtraDirectCorrelationsName.Data()));
+ if(intFlowExtraDirectCorrelations)
+ {
+ this->SetIntFlowExtraDirectCorrelations(intFlowExtraDirectCorrelations);
+ } else
+ {
+ cout<<"WARNING: intFlowExtraDirectCorrelations is NULL in AFAWQC::GPFNLH() !!!!"<<endl;
+ exit(0);
+ }
+ } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)
+ // correction terms for non-uniform acceptance:
+ TString intFlowDirectCorrectionTermsForNUAName = "fIntFlowDirectCorrectionTermsForNUA";
+ intFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data();
+ TProfile *intFlowDirectCorrectionTermsForNUA[2] = {NULL};
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms
+ {
+ intFlowDirectCorrectionTermsForNUA[sc] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s: %s terms",intFlowDirectCorrectionTermsForNUAName.Data(),sinCosFlag[sc].Data())));
+ if(intFlowDirectCorrectionTermsForNUA[sc])
+ {
+ this->SetIntFlowDirectCorrectionTermsForNUA(intFlowDirectCorrectionTermsForNUA[sc],sc);
+ } else
+ {
+ cout<<"WARNING: intFlowDirectCorrectionTermsForNUA[sc] is NULL in AFAWQC::GPFNLH() !!!!"<<endl;
+ cout<<"sc = "<<sc<<endl;
+ exit(0);
+ }
+ } // end of for(Int_t sc=0;sc<2;sc++)
+ } // end of if(bEvaluateIntFlowNestedLoops)
+
+ // nested loops relevant for differential flow:
+ if(bEvaluateDiffFlowNestedLoops)
+ {
+ // correlations:
+ TString diffFlowDirectCorrelationsName = "fDiffFlowDirectCorrelations";
+ diffFlowDirectCorrelationsName += fAnalysisLabel->Data();
+ TProfile *diffFlowDirectCorrelations[2][2][4] = {{{NULL}}};
+ for(Int_t t=0;t<2;t++)
+ {
+ for(Int_t pe=0;pe<2;pe++)
+ {
+ for(Int_t ci=0;ci<4;ci++) // correlation index
+ {
+ diffFlowDirectCorrelations[t][pe][ci] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[ci].Data())));
+ if(diffFlowDirectCorrelations[t][pe][ci])
+ {
+ this->SetDiffFlowDirectCorrelations(diffFlowDirectCorrelations[t][pe][ci],t,pe,ci);
+ } else
+ {
+ cout<<"WARNING: diffFlowDirectCorrelations[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ cout<<"ci = "<<ci<<endl;
+ }
+ } // end of for(Int_t ci=0;ci<4;ci++) // correlation index
+ } // end of for(Int_t pe=0;pe<2;pe++)
+ } // end of for(Int_t t=0;t<2;t++)
+ // correction terms for non-uniform acceptance:
+ TString diffFlowDirectCorrectionTermsForNUAName = "fDiffFlowDirectCorrectionTermsForNUA";
+ diffFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data();
+ TProfile *diffFlowDirectCorrectionTermsForNUA[2][2][2][10] = {{{{NULL}}}};
+ for(Int_t t=0;t<2;t++)
+ {
+ for(Int_t pe=0;pe<2;pe++)
+ {
+ // correction terms for NUA:
+ for(Int_t sc=0;sc<2;sc++) // sin or cos
+ {
+ for(Int_t cti=0;cti<9;cti++) // correction term index
+ {
+ diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1)));
+ if(diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti])
+ {
+ this->SetDiffFlowDirectCorrectionTermsForNUA(diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti],t,pe,sc,cti);
+ } else
+ {
+ cout<<"WARNING: diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<"t = "<<t<<endl;
+ cout<<"pe = "<<pe<<endl;
+ cout<<"sc = "<<sc<<endl;
+ cout<<"cti = "<<cti<<endl;
+ }
+ } // end of for(Int_t cti=0;cti<9;cti++) // correction term index
+ } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos
+ } // end of for(Int_t pe=0;pe<2;pe++)
+ } // end of for(Int_t t=0;t<2;t++)
+ // number of RPs and POIs in selected pt and eta bins for cross-checkings:
+ TString noOfParticlesInBinName = "fNoOfParticlesInBin";
+ TH1D *noOfParticlesInBin = NULL;
+ noOfParticlesInBin = dynamic_cast<TH1D*>(nestedLoopsList->FindObject(noOfParticlesInBinName.Data()));
+ if(noOfParticlesInBin)
+ {
+ this->SetNoOfParticlesInBin(noOfParticlesInBin);
+ } else
+ {
+ cout<<endl;
+ cout<<" WARNING (QC): noOfParticlesInBin is NULL in AFAWQC::GPFDFH() !!!!"<<endl;
+ cout<<endl;
+ }
+ } // end of if(bEvaluateDiffFlowNestedLoops)
+
+} // end of void AliFlowAnalysisWithQCumulants::GetPointersForNestedLoopsHistograms()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::StoreHarmonic()
+{
+ // Store flow harmonic in common control histograms.
+
+ (fCommonHists->GetHarmonic())->Fill(0.5,fHarmonic);
+ (fCommonHists2nd->GetHarmonic())->Fill(0.5,fHarmonic);
+ (fCommonHists4th->GetHarmonic())->Fill(0.5,fHarmonic);
+ (fCommonHists6th->GetHarmonic())->Fill(0.5,fHarmonic);
+ (fCommonHists8th->GetHarmonic())->Fill(0.5,fHarmonic);
+
+} // end of void AliFlowAnalysisWithQCumulants::StoreHarmonic()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelationsUsingParticleWeights(TString type, TString ptOrEta) // type = RP or POI
+{
+ // Calculate all correlations needed for differential flow using particle weights.
+
+ Int_t t = -1; // type flag
+ Int_t pe = -1; // ptEta flag
+
+ if(type == "RP")
+ {
+ t = 0;
+ } else if(type == "POI")
+ {
+ t = 1;
+ }
+
+ if(ptOrEta == "Pt")
+ {
+ pe = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ pe = 1;
+ }
+
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};
+ Double_t minPtEta[2] = {fPtMin,fEtaMin};
+ //Double_t maxPtEta[2] = {fPtMax,fEtaMax};
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};
+
+ // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
+ Double_t dReQ1n1k = (*fReQ)(0,1);
+ Double_t dReQ2n2k = (*fReQ)(1,2);
+ Double_t dReQ1n3k = (*fReQ)(0,3);
+ //Double_t dReQ4n4k = (*fReQ)(3,4);
+ Double_t dImQ1n1k = (*fImQ)(0,1);
+ Double_t dImQ2n2k = (*fImQ)(1,2);
+ Double_t dImQ1n3k = (*fImQ)(0,3);
+ //Double_t dImQ4n4k = (*fImQ)(3,4);
+
+ // S^M_{p,k} (see .h file for the definition of fSMpk):
+ Double_t dSM1p1k = (*fSMpk)(0,1);
+ Double_t dSM1p2k = (*fSMpk)(0,2);
+ Double_t dSM1p3k = (*fSMpk)(0,3);
+ Double_t dSM2p1k = (*fSMpk)(1,1);
+ Double_t dSM3p1k = (*fSMpk)(2,1);
+
+ // looping over all bins and calculating reduced correlations:
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+ {
+ // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin):
+ Double_t p1n0kRe = 0.;
+ Double_t p1n0kIm = 0.;
+
+ // number of POIs in particular (pt,eta) bin):
+ Double_t mp = 0.;
+
+ // real and imaginary parts of q_{m*n,k}:
+ // (weighted Q-vector evaluated for particles which are both RPs and POIs in particular (pt,eta) bin)
+ Double_t q1n2kRe = 0.;
+ Double_t q1n2kIm = 0.;
+ Double_t q2n1kRe = 0.;
+ Double_t q2n1kIm = 0.;
+
+ // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation)
+ Double_t s1p1k = 0.;
+ Double_t s1p2k = 0.;
+ Double_t s1p3k = 0.;
+
+ // M0111 from Eq. (118) in QC2c (to be improved (notation))
+ Double_t dM0111 = 0.;
+
+ if(type == "POI")
+ {
+ p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b))
+ * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b));
+ p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b))
+ * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b));
+
+ mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)
+
+ t = 1; // typeFlag = RP or POI
+
+ // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!))
+ q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b))
+ * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b));
+ q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b))
+ * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b));
+ q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b))
+ * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b));
+ q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b))
+ * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b));
+
+ // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation)
+ s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.);
+ s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.);
+ s1p3k = pow(fs1dEBE[2][pe][3]->GetBinContent(b)*fs1dEBE[2][pe][3]->GetBinEntries(b),1.);
+
+ // M0111 from Eq. (118) in QC2c (to be improved (notation)):
+ dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k)
+ - 3.*(s1p1k*(dSM2p1k-dSM1p2k)
+ + 2.*(s1p3k-s1p2k*dSM1p1k));
+ }
+ else if(type == "RP")
+ {
+ // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!))
+ q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b))
+ * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b));
+ q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b))
+ * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b));
+ q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b))
+ * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b));
+ q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b))
+ * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b));
+
+ // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation)
+ s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.);
+ s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.);
+ s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.);
+
+ // to be improved (cross-checked):
+ p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b))
+ * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b));
+ p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b))
+ * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b));
+
+ mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)
+
+ t = 0; // typeFlag = RP or POI
+
+ // M0111 from Eq. (118) in QC2c (to be improved (notation)):
+ dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k)
+ - 3.*(s1p1k*(dSM2p1k-dSM1p2k)
+ + 2.*(s1p3k-s1p2k*dSM1p1k));
+ //...............................................................................................
+ }
+
+ // 2'-particle correlation:
+ Double_t two1n1nW0W1 = 0.;
+ if(mp*dSM1p1k-s1p1k)
+ {
+ two1n1nW0W1 = (p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k-s1p1k)
+ / (mp*dSM1p1k-s1p1k);
+
+ // fill profile to get <<2'>>
+ fDiffFlowCorrelationsPro[t][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nW0W1,mp*dSM1p1k-s1p1k);
+ // histogram to store <2'> e-b-e (needed in some other methods):
+ fDiffFlowCorrelationsEBE[t][pe][0]->SetBinContent(b,two1n1nW0W1);
+ fDiffFlowEventWeightsForCorrelationsEBE[t][pe][0]->SetBinContent(b,mp*dSM1p1k-s1p1k);
+ } // end of if(mp*dSM1p1k-s1p1k)
+
+ // 4'-particle correlation:
+ Double_t four1n1n1n1nW0W1W1W1 = 0.;
+ if(dM0111)
+ {
+ four1n1n1n1nW0W1W1W1 = ((pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k)
+ - q2n1kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))
+ - 2.*q2n1kIm*dReQ1n1k*dImQ1n1k
+ - p1n0kRe*(dReQ1n1k*dReQ2n2k+dImQ1n1k*dImQ2n2k)
+ + p1n0kIm*(dImQ1n1k*dReQ2n2k-dReQ1n1k*dImQ2n2k)
+ - 2.*dSM1p2k*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k)
+ - 2.*(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*s1p1k
+ + 6.*(q1n2kRe*dReQ1n1k+q1n2kIm*dImQ1n1k)
+ + 1.*(q2n1kRe*dReQ2n2k+q2n1kIm*dImQ2n2k)
+ + 2.*(p1n0kRe*dReQ1n3k+p1n0kIm*dImQ1n3k)
+ + 2.*s1p1k*dSM1p2k
+ - 6.*s1p3k)
+ / dM0111; // to be improved (notation of dM0111)
+
+ // fill profile to get <<4'>>
+ fDiffFlowCorrelationsPro[t][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nW0W1W1W1,dM0111);
+ // histogram to store <4'> e-b-e (needed in some other methods):
+ fDiffFlowCorrelationsEBE[t][pe][1]->SetBinContent(b,four1n1n1n1nW0W1W1W1);
+ fDiffFlowEventWeightsForCorrelationsEBE[t][pe][1]->SetBinContent(b,dM0111);
+ } // end of if(dM0111)
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+
+} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelationsUsingParticleWeights(TString type, TString ptOrEta); // type = RP or POI
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::FillCommonControlHistograms(AliFlowEventSimple *anEvent)
+{
+ // Fill common control histograms.
+
+ Int_t nRP = anEvent->GetEventNSelTracksRP(); // number of RPs (i.e. number of particles used to determine the reaction plane)
+ fCommonHists->FillControlHistograms(anEvent);
+ if(nRP>1)
+ {
+ fCommonHists2nd->FillControlHistograms(anEvent);
+ if(nRP>3)
+ {
+ fCommonHists4th->FillControlHistograms(anEvent);
+ if(nRP>5)
+ {
+ fCommonHists6th->FillControlHistograms(anEvent);
+ if(nRP>7)
+ {
+ fCommonHists8th->FillControlHistograms(anEvent);
+ } // end of if(nRP>7)
+ } // end of if(nRP>5)
+ } // end of if(nRP>3)
+ } // end of if(nRP>1)
+
+} // end of void AliFlowAnalysisWithQCumulants::FillCommonControlHistograms(AliFlowEventSimple *anEvent)
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::ResetEventByEventQuantities()
+{
+ // Reset all event by event quantities.
+
+ // integrated flow:
+ fReQ->Zero();
+ fImQ->Zero();
+ fSMpk->Zero();
+ fIntFlowCorrelationsEBE->Reset();
+ fIntFlowEventWeightsForCorrelationsEBE->Reset();
+ fIntFlowCorrelationsAllEBE->Reset();
+
+ for(Int_t sc=0;sc<2;sc++)
+ {
+ fIntFlowCorrectionTermsForNUAEBE[sc]->Reset();
+ fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc]->Reset();
+ }
+
+ // differential flow:
+ // 1D:
+ for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP)
+ {
+ for(Int_t pe=0;pe<2;pe++) // 1D in pt or eta
+ {
+ for(Int_t m=0;m<4;m++) // multiple of harmonic
+ {
+ for(Int_t k=0;k<9;k++) // power of weight
+ {
+ if(fReRPQ1dEBE[t][pe][m][k]) fReRPQ1dEBE[t][pe][m][k]->Reset();
+ if(fImRPQ1dEBE[t][pe][m][k]) fImRPQ1dEBE[t][pe][m][k]->Reset();
+ }
+ }
+ }
+ }
+
+ for(Int_t t=0;t<3;t++) // type (0 = RP, 1 = POI, 2 = RP&&POI )
+ {
+ for(Int_t pe=0;pe<2;pe++) // 1D in pt or eta
+ {
+ for(Int_t k=0;k<9;k++)
+ {
+ if(fs1dEBE[t][pe][k]) fs1dEBE[t][pe][k]->Reset();
+ }
+ }
+ }
+
+ // e-b-e reduced correlations:
+ for(Int_t t=0;t<2;t++) // type (0 = RP, 1 = POI)
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t rci=0;rci<4;rci++) // reduced correlation index
+ {
+ if(fDiffFlowCorrelationsEBE[t][pe][rci]) fDiffFlowCorrelationsEBE[t][pe][rci]->Reset();
+ if(fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci]) fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci]->Reset();
+ }
+ }
+ }
+
+ // correction terms for NUA:
+ for(Int_t t=0;t<2;t++) // type (0 = RP, 1 = POI)
+ {
+ for(Int_t pe=0;pe<2;pe++) // pt or eta
+ {
+ for(Int_t sc=0;sc<2;sc++) // sin or cos
+ {
+ for(Int_t cti=0;cti<9;cti++) // correction term index
+ {
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti]->Reset();
+ }
+ }
+ }
+ }
+
+ // 2D (pt,eta)
+ if(fCalculate2DFlow)
+ {
+ for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP)
+ {
+ for(Int_t m=0;m<4;m++) // multiple of harmonic
+ {
+ for(Int_t k=0;k<9;k++) // power of weight
+ {
+ if(fReRPQ2dEBE[t][m][k]) fReRPQ2dEBE[t][m][k]->Reset();
+ if(fImRPQ2dEBE[t][m][k]) fImRPQ2dEBE[t][m][k]->Reset();
+ }
+ }
+ }
+ for(Int_t t=0;t<3;t++) // type (0 = RP, 1 = POI, 2 = RP&&POI )
+ {
+ for(Int_t k=0;k<9;k++)
+ {
+ if(fs2dEBE[t][k]) fs2dEBE[t][k]->Reset();
+ }
+ }
+ } // end of if(fCalculate2DFlow)
+
+} // end of void AliFlowAnalysisWithQCumulants::ResetEventByEventQuantities();
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTerms(TString type, TString ptOrEta)
+{
+ // Calculate correction terms for non-uniform acceptance for differential flow (sin terms).
+
+ // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][0][cti], where cti runs as follows:
+ // 0: <<sin n(psi1)>>
+ // 1: <<sin n(psi1+phi2)>>
+ // 2: <<sin n(psi1+phi2-phi3)>>
+ // 3: <<sin n(psi1-phi2-phi3)>>:
+ // 4:
+ // 5:
+ // 6:
+
+ // multiplicity:
+ Double_t dMult = (*fSMpk)(0,0);
+
+ // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
+ Double_t dReQ1n = (*fReQ)(0,0);
+ Double_t dReQ2n = (*fReQ)(1,0);
+ //Double_t dReQ3n = (*fReQ)(2,0);
+ //Double_t dReQ4n = (*fReQ)(3,0);
+ Double_t dImQ1n = (*fImQ)(0,0);
+ Double_t dImQ2n = (*fImQ)(1,0);
+ //Double_t dImQ3n = (*fImQ)(2,0);
+ //Double_t dImQ4n = (*fImQ)(3,0);
+
+ Int_t t = -1; // type flag
+ Int_t pe = -1; // ptEta flag
+
+ if(type == "RP")
+ {
+ t = 0;
+ } else if(type == "POI")
+ {
+ t = 1;
+ }
+
+ if(ptOrEta == "Pt")
+ {
+ pe = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ pe = 1;
+ }
+
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};
+ Double_t minPtEta[2] = {fPtMin,fEtaMin};
+ //Double_t maxPtEta[2] = {fPtMax,fEtaMax};
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};
+
+ // looping over all bins and calculating correction terms:
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+ {
+ // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin):
+ Double_t p1n0kRe = 0.;
+ Double_t p1n0kIm = 0.;
+
+ // number of POIs in particular pt or eta bin:
+ Double_t mp = 0.;
+
+ // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin):
+ Double_t q1n0kRe = 0.;
+ Double_t q1n0kIm = 0.;
+ Double_t q2n0kRe = 0.;
+ Double_t q2n0kIm = 0.;
+
+ // number of particles which are both RPs and POIs in particular pt or eta bin:
+ Double_t mq = 0.;
+
+ if(type == "POI")
+ {
+ // q_{m*n,0}:
+ q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b))
+ * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b));
+ q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b))
+ * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b));
+ q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b))
+ * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b));
+ q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b))
+ * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b));
+
+ mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)
+ }
+ else if(type == "RP")
+ {
+ // q_{m*n,0}:
+ q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b))
+ * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b));
+ q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b))
+ * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b));
+ q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b))
+ * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b));
+ q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b))
+ * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b));
+
+ mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)
+ }
+ if(type == "POI")
+ {
+ // p_{m*n,0}:
+ p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b))
+ * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b));
+ p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b))
+ * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b));
+
+ mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)
+
+ t = 1; // typeFlag = RP or POI
+ }
+ else if(type == "RP")
+ {
+ // p_{m*n,0} = q_{m*n,0}:
+ p1n0kRe = q1n0kRe;
+ p1n0kIm = q1n0kIm;
+
+ mp = mq;
+
+ t = 0; // typeFlag = RP or POI
+ }
+
+ // <<sin n(psi1)>>:
+ Double_t sinP1nPsi = 0.;
+ if(mp)
+ {
+ sinP1nPsi = p1n0kIm/mp;
+ // fill profile for <<sin n(psi1)>>:
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi,mp);
+ // histogram to store <sin n(psi1)> e-b-e (needed in some other methods):
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][0]->SetBinContent(b,sinP1nPsi);
+ } // end of if(mp)
+
+ // <<sin n(psi1+phi2)>>:
+ Double_t sinP1nPsiP1nPhi = 0.;
+ if(mp*dMult-mq)
+ {
+ sinP1nPsiP1nPhi = (p1n0kRe*dImQ1n+p1n0kIm*dReQ1n-q2n0kIm)/(mp*dMult-mq);
+ // fill profile for <<sin n(psi1+phi2)>>:
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsiP1nPhi,mp*dMult-mq);
+ // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods):
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][1]->SetBinContent(b,sinP1nPsiP1nPhi);
+ } // end of if(mp*dMult-mq)
+
+ // <<sin n(psi1+phi2-phi3)>>:
+ Double_t sinP1nPsi1P1nPhi2MPhi3 = 0.;
+ if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.))
+ {
+ sinP1nPsi1P1nPhi2MPhi3 = (p1n0kIm*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult)
+ - 1.*(q2n0kIm*dReQ1n-q2n0kRe*dImQ1n)
+ - mq*dImQ1n+2.*q1n0kIm)
+ / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));
+ // fill profile for <<sin n(psi1+phi2)>>:
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));
+ // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods):
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][2]->SetBinContent(b,sinP1nPsi1P1nPhi2MPhi3);
+ } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.))
+
+ // <<sin n(psi1-phi2-phi3)>>:
+ Double_t sinP1nPsi1M1nPhi2MPhi3 = 0.;
+ if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.))
+ {
+ sinP1nPsi1M1nPhi2MPhi3 = (p1n0kIm*(pow(dReQ1n,2.)-pow(dImQ1n,2.))-2.*p1n0kRe*dReQ1n*dImQ1n
+ - 1.*(p1n0kIm*dReQ2n-p1n0kRe*dImQ2n)
+ + 2.*mq*dImQ1n-2.*q1n0kIm)
+ / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));
+ // fill profile for <<sin n(psi1+phi2)>>:
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));
+ // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods):
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][3]->SetBinContent(b,sinP1nPsi1M1nPhi2MPhi3);
+ } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.))
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTerms(TString type, TString ptOrEta)
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTerms(TString type, TString ptOrEta)
+{
+ // Calculate correction terms for non-uniform acceptance for differential flow (cos terms).
+
+ // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][1][cti], where cti runs as follows:
+ // 0: <<cos n(psi)>>
+ // 1: <<cos n(psi1+phi2)>>
+ // 2: <<cos n(psi1+phi2-phi3)>>
+ // 3: <<cos n(psi1-phi2-phi3)>>
+ // 4:
+ // 5:
+ // 6:
+
+ // multiplicity:
+ Double_t dMult = (*fSMpk)(0,0);
+
+ // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
+ Double_t dReQ1n = (*fReQ)(0,0);
+ Double_t dReQ2n = (*fReQ)(1,0);
+ //Double_t dReQ3n = (*fReQ)(2,0);
+ //Double_t dReQ4n = (*fReQ)(3,0);
+ Double_t dImQ1n = (*fImQ)(0,0);
+ Double_t dImQ2n = (*fImQ)(1,0);
+ //Double_t dImQ3n = (*fImQ)(2,0);
+ //Double_t dImQ4n = (*fImQ)(3,0);
+
+ Int_t t = -1; // type flag
+ Int_t pe = -1; // ptEta flag
+
+ if(type == "RP")
+ {
+ t = 0;
+ } else if(type == "POI")
+ {
+ t = 1;
+ }
+
+ if(ptOrEta == "Pt")
+ {
+ pe = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ pe = 1;
+ }
+
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};
+ Double_t minPtEta[2] = {fPtMin,fEtaMin};
+ //Double_t maxPtEta[2] = {fPtMax,fEtaMax};
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};
+
+ // looping over all bins and calculating correction terms:
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+ {
+ // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin):
+ Double_t p1n0kRe = 0.;
+ Double_t p1n0kIm = 0.;
+
+ // number of POIs in particular pt or eta bin:
+ Double_t mp = 0.;
+
+ // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin):
+ Double_t q1n0kRe = 0.;
+ Double_t q1n0kIm = 0.;
+ Double_t q2n0kRe = 0.;
+ Double_t q2n0kIm = 0.;
+
+ // number of particles which are both RPs and POIs in particular pt or eta bin:
+ Double_t mq = 0.;
+
+ if(type == "POI")
+ {
+ // q_{m*n,0}:
+ q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b))
+ * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b));
+ q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b))
+ * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b));
+ q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b))
+ * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b));
+ q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b))
+ * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b));
+
+ mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)
+ }
+ else if(type == "RP")
+ {
+ // q_{m*n,0}:
+ q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b))
+ * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b));
+ q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b))
+ * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b));
+ q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b))
+ * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b));
+ q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b))
+ * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b));
+
+ mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)
+ }
+ if(type == "POI")
+ {
+ // p_{m*n,0}:
+ p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b))
+ * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b));
+ p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b))
+ * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b));
+
+ mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)
+
+ t = 1; // typeFlag = RP or POI
+ }
+ else if(type == "RP")
+ {
+ // p_{m*n,0} = q_{m*n,0}:
+ p1n0kRe = q1n0kRe;
+ p1n0kIm = q1n0kIm;
+
+ mp = mq;
+
+ t = 0; // typeFlag = RP or POI
+ }
+
+ // <<cos n(psi1)>>:
+ Double_t cosP1nPsi = 0.;
+ if(mp)
+ {
+ cosP1nPsi = p1n0kRe/mp;
+
+ // fill profile for <<cos n(psi1)>>:
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi,mp);
+ // histogram to store <cos n(psi1)> e-b-e (needed in some other methods):
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][0]->SetBinContent(b,cosP1nPsi);
+ } // end of if(mp)
+
+ // <<cos n(psi1+phi2)>>:
+ Double_t cosP1nPsiP1nPhi = 0.;
+ if(mp*dMult-mq)
+ {
+ cosP1nPsiP1nPhi = (p1n0kRe*dReQ1n-p1n0kIm*dImQ1n-q2n0kRe)/(mp*dMult-mq);
+ // fill profile for <<sin n(psi1+phi2)>>:
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsiP1nPhi,mp*dMult-mq);
+ // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods):
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][1]->SetBinContent(b,cosP1nPsiP1nPhi);
+ } // end of if(mp*dMult-mq)
+
+ // <<cos n(psi1+phi2-phi3)>>:
+ Double_t cosP1nPsi1P1nPhi2MPhi3 = 0.;
+ if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.))
+ {
+ cosP1nPsi1P1nPhi2MPhi3 = (p1n0kRe*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult)
+ - 1.*(q2n0kRe*dReQ1n+q2n0kIm*dImQ1n)
+ - mq*dReQ1n+2.*q1n0kRe)
+ / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));
+ // fill profile for <<sin n(psi1+phi2)>>:
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));
+ // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods):
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][2]->SetBinContent(b,cosP1nPsi1P1nPhi2MPhi3);
+ } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.))
+
+ // <<cos n(psi1-phi2-phi3)>>:
+ Double_t cosP1nPsi1M1nPhi2MPhi3 = 0.;
+ if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.))
+ {
+ cosP1nPsi1M1nPhi2MPhi3 = (p1n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.))+2.*p1n0kIm*dReQ1n*dImQ1n
+ - 1.*(p1n0kRe*dReQ2n+p1n0kIm*dImQ2n)
+ - 2.*mq*dReQ1n+2.*q1n0kRe)
+ / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));
+ // fill profile for <<sin n(psi1+phi2)>>:
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));
+ // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods):
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][3]->SetBinContent(b,cosP1nPsi1M1nPhi2MPhi3);
+ } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.))
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTerms(TString type, TString ptOrEta)
+
+
+//==================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUADiffFlow(TString type, TString ptOrEta)
+{
+ // Transfer prolfiles into histogams and correctly propagate the error (to be improved: description)
+
+ // to be improved: debugged - I do not correctly transfer all profiles into histos (bug appears only after merging)
+
+ Int_t t = -1; // type flag
+ Int_t pe = -1; // ptEta flag
+
+ if(type == "RP")
+ {
+ t = 0;
+ } else if(type == "POI")
+ {
+ t = 1;
+ }
+
+ if(ptOrEta == "Pt")
+ {
+ pe = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ pe = 1;
+ }
+
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};
+ //Double_t minPtEta[2] = {fPtMin,fEtaMin};
+ //Double_t maxPtEta[2] = {fPtMax,fEtaMax};
+ //Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};
+
+ for(Int_t sc=0;sc<2;sc++) // sin or cos
+ {
+ for(Int_t cti=0;cti<9;cti++) // correction term index
+ {
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+ {
+ Double_t correctionTerm = fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]->GetBinContent(b);
+ fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]->SetBinContent(b,correctionTerm);
+ // to be improved (propagate error correctly)
+ // ...
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+ } // correction term index
+ } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos
+
+}// end of void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUADiffFlow(TString type, TString ptOrEta)
+
+
+//==================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta)
+{
+ // Calculate generalized differential flow Q-cumulants (corrected for non-uniform acceptance)
+
+ Int_t typeFlag = -1;
+ Int_t ptEtaFlag = -1;
+
+ if(type == "RP")
+ {
+ typeFlag = 0;
+ } else if(type == "POI")
+ {
+ typeFlag = 1;
+ }
+
+ if(ptOrEta == "Pt")
+ {
+ ptEtaFlag = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ ptEtaFlag = 1;
+ }
+
+ // shortcuts:
+ Int_t t = typeFlag;
+ Int_t pe = ptEtaFlag;
+
+ // common:
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};
+
+ // 2-particle correlation:
+ Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>>
+ // sin term coming from integrated flow:
+ Double_t sinP1nPhi = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1); // <<sin(n*phi1)>>
+ Double_t sinP1nPhi1P1nPhi2 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2); // <<sin(n*(phi1+phi2))>>
+ Double_t sinP1nPhi1M1nPhi2M1nPhi3 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(3); // <<sin(n*(phi1-phi2-phi3))>>
+ // cos term coming from integrated flow:
+ Double_t cosP1nPhi = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1); // <<cos(n*phi1)>>
+ Double_t cosP1nPhi1P1nPhi2 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2); // <<cos(n*(phi1+phi2))>>
+ Double_t cosP1nPhi1M1nPhi2M1nPhi3 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(3); // <<cos(n*(phi1-phi2-phi3))>>
+
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+ {
+ Double_t twoPrime = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); // <<2'>>
+ Double_t fourPrime = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); // <<4'>>
+ Double_t sinP1nPsi = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][0]->GetBinContent(b); // <<sin n(Psi)>>
+ Double_t cosP1nPsi = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][0]->GetBinContent(b); // <<cos n(Psi)>>
+ Double_t sinP1nPsi1P1nPhi2 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][1]->GetBinContent(b); // <<sin n(psi1+phi2)>>
+ Double_t cosP1nPsi1P1nPhi2 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][1]->GetBinContent(b); // <<cos n(psi1+phi2)>>
+ Double_t sinP1nPsi1P1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][2]->GetBinContent(b); // <<sin n(psi1+phi2-phi3)>>
+ Double_t cosP1nPsi1P1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][2]->GetBinContent(b); // <<cos n(psi1+phi2-phi3)>>
+ Double_t sinP1nPsi1M1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][3]->GetBinContent(b); // <<sin n(psi1-phi2-phi3)>>
+ Double_t cosP1nPsi1M1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][3]->GetBinContent(b); // <<cos n(psi1-phi2-phi3)>>
+ // generalized QC{2'}:
+ Double_t qc2Prime = twoPrime - sinP1nPsi*sinP1nPhi - cosP1nPsi*cosP1nPhi;
+ fDiffFlowCumulants[t][pe][0]->SetBinContent(b,qc2Prime);
+ // generalized QC{4'}:
+ Double_t qc4Prime = fourPrime-2.*twoPrime*two
+ - cosP1nPsi*cosP1nPhi1M1nPhi2M1nPhi3
+ + sinP1nPsi*sinP1nPhi1M1nPhi2M1nPhi3
+ - cosP1nPhi*cosP1nPsi1M1nPhi2M1nPhi3
+ + sinP1nPhi*sinP1nPsi1M1nPhi2M1nPhi3
+ - 2.*cosP1nPhi*cosP1nPsi1P1nPhi2M1nPhi3
+ - 2.*sinP1nPhi*sinP1nPsi1P1nPhi2M1nPhi3
+ - cosP1nPsi1P1nPhi2*cosP1nPhi1P1nPhi2
+ - sinP1nPsi1P1nPhi2*sinP1nPhi1P1nPhi2
+ + 2.*cosP1nPhi1P1nPhi2*(cosP1nPsi*cosP1nPhi-sinP1nPsi*sinP1nPhi)
+ + 2.*sinP1nPhi1P1nPhi2*(cosP1nPsi*sinP1nPhi+sinP1nPsi*cosP1nPhi)
+ + 4.*two*(cosP1nPsi*cosP1nPhi+sinP1nPsi*sinP1nPhi)
+ + 2.*cosP1nPsi1P1nPhi2*(pow(cosP1nPhi,2.)-pow(sinP1nPhi,2.))
+ + 4.*sinP1nPsi1P1nPhi2*cosP1nPhi*sinP1nPhi
+ + 4.*twoPrime*(pow(cosP1nPhi,2.)+pow(sinP1nPhi,2.))
+ - 6.*(pow(cosP1nPhi,2.)-pow(sinP1nPhi,2.))
+ * (cosP1nPsi*cosP1nPhi-sinP1nPsi*sinP1nPhi)
+ - 12.*cosP1nPhi*sinP1nPhi
+ * (sinP1nPsi*cosP1nPhi+cosP1nPsi*sinP1nPhi);
+ fDiffFlowCumulants[t][pe][1]->SetBinContent(b,qc4Prime);
+ } // end of for(Int_t p=1;p<=fnBinsPt;p++)
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta)
+
+
+//==================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta)
+{
+ // Calculate differential flow corrected for non-uniform acceptance.
+
+ // to be improved (rewritten completely)
+
+ Int_t typeFlag = -1;
+ Int_t ptEtaFlag = -1;
+
+ if(type == "RP")
+ {
+ typeFlag = 0;
+ } else if(type == "POI")
+ {
+ typeFlag = 1;
+ }
+
+ if(ptOrEta == "Pt")
+ {
+ ptEtaFlag = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ ptEtaFlag = 1;
+ }
+
+ // shortcuts:
+ Int_t t = typeFlag;
+ Int_t pe = ptEtaFlag;
+
+ // common:
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};
+
+ // to be improved: access here generalized QC{2} and QC{4} instead:
+ Double_t dV2 = fIntFlow->GetBinContent(1);
+ Double_t dV4 = fIntFlow->GetBinContent(2);
+
+ // loop over pt or eta bins:
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+ {
+ // generalized QC{2'}:
+ Double_t gQC2Prime = fDiffFlowCumulants[t][pe][0]->GetBinContent(b);
+ // v'{2}:
+ if(dV2>0)
+ {
+ Double_t v2Prime = gQC2Prime/dV2;
+ fDiffFlow[t][pe][0]->SetBinContent(b,v2Prime);
+ }
+ // generalized QC{4'}:
+ Double_t gQC4Prime = fDiffFlowCumulants[t][pe][1]->GetBinContent(b);
+ // v'{4}:
+ if(dV4>0)
+ {
+ Double_t v4Prime = -gQC4Prime/pow(dV4,3.);
+ fDiffFlow[t][pe][1]->SetBinContent(b,v4Prime);
+ }
+ } // end of for(Int_t b=1;b<=fnBinsPtEta[pe];b++)
+
+} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta);
+
+
+//==================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoops(AliFlowEventSimple * const anEvent)
+{
+ // Evaluate with nested loops multiparticle correlations for integrated flow (without using the particle weights).
+
+ // Remark: Results are stored in profile fIntFlowDirectCorrelations whose binning is organized as follows:
+ //
+ // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))>
+ // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))>
+ // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))>
+ // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))>
+ // 5th bin: ---- EMPTY ----
+ // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))>
+ // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))>
+ // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))>
+ // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))>
+ // 10th bin: ---- EMPTY ----
+ // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))>
+ // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))>
+ // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))>
+ // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))>
+ // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))>
+ // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))>
+ // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))>
+ // 18th bin: ---- EMPTY ----
+ // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))>
+ // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))>
+ // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))>
+ // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))>
+ // 23rd bin: ---- EMPTY ----
+ // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))>
+ // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))>
+ // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))>
+ // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))>
+ // 28th bin: ---- EMPTY ----
+ // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))>
+ // 30th bin: ---- EMPTY ----
+ // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))>
+
+ Int_t nPrim = anEvent->NumberOfTracks();
+ AliFlowTrackSimple *aftsTrack = NULL;
+ Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.;
+ Int_t n = fHarmonic;
+ Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?)
+ Double_t dMult = (*fSMpk)(0,0);
+ cout<<endl;
+ cout<<"Multiparticle correlations: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl;
+ if(dMult<2)
+ {
+ cout<<"... skipping this event (multiplicity too low) ..."<<endl;
+ } else if (dMult>fMaxAllowedMultiplicity)
+ {
+ cout<<"... skipping this event (multiplicity too high) ..."<<endl;
+ } else
+ {
+ cout<<"... evaluating nested loops (without using particle weights)..."<<endl;
+ }
+
+ // 2-particle correlations:
+ if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity)
+ {
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi1=aftsTrack->Phi();
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1)continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush;
+ // fill the profile with 2-p correlations:
+ fIntFlowDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),1.); // <cos(n*(phi1-phi2))>
+ fIntFlowDirectCorrelations->Fill(1.5,cos(2.*n*(phi1-phi2)),1.); // <cos(2n*(phi1-phi2))>
+ fIntFlowDirectCorrelations->Fill(2.5,cos(3.*n*(phi1-phi2)),1.); // <cos(3n*(phi1-phi2))>
+ fIntFlowDirectCorrelations->Fill(3.5,cos(4.*n*(phi1-phi2)),1.); // <cos(4n*(phi1-phi2))>
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)
+ } // end of if(nPrim>=2)
+
+ // 3-particle correlations:
+ if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity)
+ {
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi1=aftsTrack->Phi();
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1)continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ for(Int_t i3=0;i3<nPrim;i3++)
+ {
+ if(i3==i1||i3==i2)continue;
+ aftsTrack=anEvent->GetTrack(i3);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi3=aftsTrack->Phi();
+ if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush;
+ // fill the profile with 3-p correlations:
+ fIntFlowDirectCorrelations->Fill(5.,cos(2.*n*phi1-n*(phi2+phi3)),1.); //<3>_{2n|nn,n}
+ fIntFlowDirectCorrelations->Fill(6.,cos(3.*n*phi1-2.*n*phi2-n*phi3),1.); //<3>_{3n|2n,n}
+ fIntFlowDirectCorrelations->Fill(7.,cos(4.*n*phi1-2.*n*phi2-2.*n*phi3),1.); //<3>_{4n|2n,2n}
+ fIntFlowDirectCorrelations->Fill(8.,cos(4.*n*phi1-3.*n*phi2-n*phi3),1.); //<3>_{4n|3n,n}
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)
+ } // end of if(nPrim>=3)
+
+ // 4-particle correlations:
+ if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity)
+ {
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi1=aftsTrack->Phi();
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1)continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ for(Int_t i3=0;i3<nPrim;i3++)
+ {
+ if(i3==i1||i3==i2)continue;
+ aftsTrack=anEvent->GetTrack(i3);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi3=aftsTrack->Phi();
+ for(Int_t i4=0;i4<nPrim;i4++)
+ {
+ if(i4==i1||i4==i2||i4==i3)continue;
+ aftsTrack=anEvent->GetTrack(i4);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi4=aftsTrack->Phi();
+ if(nPrim==4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush;
+ // fill the profile with 4-p correlations:
+ fIntFlowDirectCorrelations->Fill(10.,cos(n*phi1+n*phi2-n*phi3-n*phi4),1.); // <4>_{n,n|n,n}
+ fIntFlowDirectCorrelations->Fill(11.,cos(2.*n*phi1+n*phi2-2.*n*phi3-n*phi4),1.); // <4>_{2n,n|2n,n}
+ fIntFlowDirectCorrelations->Fill(12.,cos(2.*n*phi1+2*n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{2n,2n|2n,2n}
+ fIntFlowDirectCorrelations->Fill(13.,cos(3.*n*phi1-n*phi2-n*phi3-n*phi4),1.); // <4>_{3n|n,n,n}
+ fIntFlowDirectCorrelations->Fill(14.,cos(3.*n*phi1+n*phi2-3.*n*phi3-n*phi4),1.); // <4>_{3n,n|3n,n}
+ fIntFlowDirectCorrelations->Fill(15.,cos(3.*n*phi1+n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{3n,n|2n,2n}
+ fIntFlowDirectCorrelations->Fill(16.,cos(4.*n*phi1-2.*n*phi2-n*phi3-n*phi4),1.); // <4>_{4n|2n,n,n}
+ } // end of for(Int_t i4=0;i4<nPrim;i4++)
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)
+ } // end of if(nPrim>=)
+
+ // 5-particle correlations:
+ if(nPrim>=5 && nPrim<=fMaxAllowedMultiplicity)
+ {
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi1=aftsTrack->Phi();
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1)continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ for(Int_t i3=0;i3<nPrim;i3++)
+ {
+ if(i3==i1||i3==i2)continue;
+ aftsTrack=anEvent->GetTrack(i3);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi3=aftsTrack->Phi();
+ for(Int_t i4=0;i4<nPrim;i4++)
+ {
+ if(i4==i1||i4==i2||i4==i3)continue;
+ aftsTrack=anEvent->GetTrack(i4);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi4=aftsTrack->Phi();
+ for(Int_t i5=0;i5<nPrim;i5++)
+ {
+ if(i5==i1||i5==i2||i5==i3||i5==i4)continue;
+ aftsTrack=anEvent->GetTrack(i5);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi5=aftsTrack->Phi();
+ if(nPrim==5) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<"\r"<<flush;
+ // fill the profile with 5-p correlations:
+ fIntFlowDirectCorrelations->Fill(18.,cos(2.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5),1.); //<5>_{2n,n|n,n,n}
+ fIntFlowDirectCorrelations->Fill(19.,cos(2.*n*phi1+2.*n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); //<5>_{2n,2n|2n,n,n}
+ fIntFlowDirectCorrelations->Fill(20.,cos(3.*n*phi1+n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); //<5>_{3n,n|2n,n,n}
+ fIntFlowDirectCorrelations->Fill(21.,cos(4.*n*phi1-n*phi2-n*phi3-n*phi4-n*phi5),1.); //<5>_{4n|n,n,n,n}
+ } // end of for(Int_t i5=0;i5<nPrim;i5++)
+ } // end of for(Int_t i4=0;i4<nPrim;i4++)
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)
+ } // end of if(nPrim>=5)
+
+ // 6-particle correlations:
+ if(nPrim>=6 && nPrim<=fMaxAllowedMultiplicity)
+ {
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi1=aftsTrack->Phi();
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1)continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ for(Int_t i3=0;i3<nPrim;i3++)
+ {
+ if(i3==i1||i3==i2)continue;
+ aftsTrack=anEvent->GetTrack(i3);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi3=aftsTrack->Phi();
+ for(Int_t i4=0;i4<nPrim;i4++)
+ {
+ if(i4==i1||i4==i2||i4==i3)continue;
+ aftsTrack=anEvent->GetTrack(i4);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi4=aftsTrack->Phi();
+ for(Int_t i5=0;i5<nPrim;i5++)
+ {
+ if(i5==i1||i5==i2||i5==i3||i5==i4)continue;
+ aftsTrack=anEvent->GetTrack(i5);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi5=aftsTrack->Phi();
+ for(Int_t i6=0;i6<nPrim;i6++)
+ {
+ if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue;
+ aftsTrack=anEvent->GetTrack(i6);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi6=aftsTrack->Phi();
+ if(nPrim==6) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<"\r"<<flush;
+ // fill the profile with 6-p correlations:
+ fIntFlowDirectCorrelations->Fill(23.,cos(n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{n,n,n|n,n,n}
+ fIntFlowDirectCorrelations->Fill(24.,cos(2.*n*phi1+n*phi2+n*phi3-2.*n*phi4-n*phi5-n*phi6),1.); //<6>_{2n,n,n|2n,n,n}
+ fIntFlowDirectCorrelations->Fill(25.,cos(2.*n*phi1+2.*n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{2n,2n|n,n,n,n}
+ fIntFlowDirectCorrelations->Fill(26.,cos(3.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{3n,n|n,n,n,n}
+ } // end of for(Int_t i6=0;i6<nPrim;i6++)
+ } // end of for(Int_t i5=0;i5<nPrim;i5++)
+ } // end of for(Int_t i4=0;i4<nPrim;i4++)
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)
+ } // end of if(nPrim>=6)
+
+ // 7-particle correlations:
+ if(nPrim>=7 && nPrim<=fMaxAllowedMultiplicity)
+ {
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi1=aftsTrack->Phi();
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1)continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ for(Int_t i3=0;i3<nPrim;i3++)
+ {
+ if(i3==i1||i3==i2)continue;
+ aftsTrack=anEvent->GetTrack(i3);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi3=aftsTrack->Phi();
+ for(Int_t i4=0;i4<nPrim;i4++)
+ {
+ if(i4==i1||i4==i2||i4==i3)continue;
+ aftsTrack=anEvent->GetTrack(i4);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi4=aftsTrack->Phi();
+ for(Int_t i5=0;i5<nPrim;i5++)
+ {
+ if(i5==i1||i5==i2||i5==i3||i5==i4)continue;
+ aftsTrack=anEvent->GetTrack(i5);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi5=aftsTrack->Phi();
+ for(Int_t i6=0;i6<nPrim;i6++)
+ {
+ if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue;
+ aftsTrack=anEvent->GetTrack(i6);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi6=aftsTrack->Phi();
+ for(Int_t i7=0;i7<nPrim;i7++)
+ {
+ if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue;
+ aftsTrack=anEvent->GetTrack(i7);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi7=aftsTrack->Phi();
+ if(nPrim==7) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<" "<<i7<<"\r"<<flush;
+ // fill the profile with 7-p correlation:
+ fIntFlowDirectCorrelations->Fill(28.,cos(2.*n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6-n*phi7),1.); // <7>_{2n,n,n|n,n,n,n}
+ } // end of for(Int_t i7=0;i7<nPrim;i7++)
+ } // end of for(Int_t i6=0;i6<nPrim;i6++)
+ } // end of for(Int_t i5=0;i5<nPrim;i5++)
+ } // end of for(Int_t i4=0;i4<nPrim;i4++)
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)
+ } // end of if(nPrim>=7)
+
+ // 8-particle correlations:
+ if(nPrim>=8 && nPrim<=fMaxAllowedMultiplicity)
+ {
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi1=aftsTrack->Phi();
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1)continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ for(Int_t i3=0;i3<nPrim;i3++)
+ {
+ if(i3==i1||i3==i2)continue;
+ aftsTrack=anEvent->GetTrack(i3);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi3=aftsTrack->Phi();
+ for(Int_t i4=0;i4<nPrim;i4++)
+ {
+ if(i4==i1||i4==i2||i4==i3)continue;
+ aftsTrack=anEvent->GetTrack(i4);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi4=aftsTrack->Phi();
+ for(Int_t i5=0;i5<nPrim;i5++)
+ {
+ if(i5==i1||i5==i2||i5==i3||i5==i4)continue;
+ aftsTrack=anEvent->GetTrack(i5);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi5=aftsTrack->Phi();
+ for(Int_t i6=0;i6<nPrim;i6++)
+ {
+ if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue;
+ aftsTrack=anEvent->GetTrack(i6);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi6=aftsTrack->Phi();
+ for(Int_t i7=0;i7<nPrim;i7++)
+ {
+ if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue;
+ aftsTrack=anEvent->GetTrack(i7);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi7=aftsTrack->Phi();
+ for(Int_t i8=0;i8<nPrim;i8++)
+ {
+ if(i8==i1||i8==i2||i8==i3||i8==i4||i8==i5||i8==i6||i8==i7)continue;
+ aftsTrack=anEvent->GetTrack(i8);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi8=aftsTrack->Phi();
+ cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<" "<<i7<<" "<<i8<<"\r"<<flush;
+ // fill the profile with 8-p correlation:
+ fIntFlowDirectCorrelations->Fill(30.,cos(n*phi1+n*phi2+n*phi3+n*phi4-n*phi5-n*phi6-n*phi7-n*phi8),1.); // <8>_{n,n,n,n|n,n,n,n}
+ } // end of for(Int_t i8=0;i8<nPrim;i8++)
+ } // end of for(Int_t i7=0;i7<nPrim;i7++)
+ } // end of for(Int_t i6=0;i6<nPrim;i6++)
+ } // end of for(Int_t i5=0;i5<nPrim;i5++)
+ } // end of for(Int_t i4=0;i4<nPrim;i4++)
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)
+ } // end of if(nPrim>=8)
+
+ cout<<endl;
+
+} // end of AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent)
+
+
+//==================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrelations()
+{
+ // Cross-check results for multiparticle correlations needed for int. flow: results from Q-vectors vs results from nested loops.
+
+ cout<<endl;
+ cout<<endl;
+ cout<<" *****************************************"<<endl;
+ cout<<" **** cross-checking the correlations ****"<<endl;
+ cout<<" **** for integrated flow ****"<<endl;
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))
+ {
+ cout<<" **** (particle weights not used) ****"<<endl;
+ } else
+ {
+ cout<<" **** (particle weights used) ****"<<endl;
+ }
+ cout<<" *****************************************"<<endl;
+ cout<<endl;
+ cout<<endl;
+
+ Int_t ciMax = 32; // to be improved (removed eventually when I calculate 6th and 8th order with particle weights)
+
+ if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)
+ {
+ ciMax = 11;
+ }
+
+ for(Int_t ci=1;ci<=ciMax;ci++)
+ {
+ if(strcmp((fIntFlowCorrelationsAllPro->GetXaxis())->GetBinLabel(ci), "") == 0) continue; // to be improved (access finalized histogram here)
+ cout<<(fIntFlowCorrelationsAllPro->GetXaxis())->GetBinLabel(ci)<<":"<<endl; // to be improved (access finalized histogram here)
+ cout<<"from Q-vectors = "<<fIntFlowCorrelationsAllPro->GetBinContent(ci)<<endl; // to be improved (access finalized histogram here)
+ cout<<"from nested loops = "<<fIntFlowDirectCorrelations->GetBinContent(ci)<<endl;
+ cout<<endl;
+ }
+
+} // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrelations()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrectionTermsForNUA()
+{
+ // Cross-check results for corrections terms for non-uniform acceptance needed for int. flow: results from Q-vectors vs results from nested loops.
+
+ cout<<endl;
+ cout<<endl;
+ cout<<" *********************************************"<<endl;
+ cout<<" **** cross-checking the correction terms ****"<<endl;
+ cout<<" **** for non-uniform acceptance relevant ****"<<endl;
+ cout<<" **** for integrated flow ****"<<endl;
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))
+ {
+ cout<<" **** (particle weights not used) ****"<<endl;
+ } else
+ {
+ cout<<" **** (particle weights used) ****"<<endl;
+ }
+ cout<<" *********************************************"<<endl;
+ cout<<endl;
+ cout<<endl;
+
+ for(Int_t ci=1;ci<=4;ci++) // correction term index (to be improved - hardwired 4)
+ {
+ for(Int_t sc=0;sc<2;sc++) // sin or cos term
+ {
+ if(strcmp((fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->GetBinLabel(ci), "") == 0) continue; // to be improved (access finalized histogram here)
+ cout<<(fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->GetBinLabel(ci)<<":"<<endl; // to be improved (access finalized histogram here)
+ cout<<"from Q-vectors = "<<fIntFlowCorrectionTermsForNUAPro[sc]->GetBinContent(ci)<<endl; // to be improved (access finalized histogram here)
+ cout<<"from nested loops = "<<fIntFlowDirectCorrectionTermsForNUA[sc]->GetBinContent(ci)<<endl;
+ cout<<endl;
+ } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos term
+ } // end of for(Int_t ci=1;ci<=10;ci++) // correction term index
+
+} // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrectionTermsForNUA()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent)
+{
+ // Evaluate with nested loops multiparticle correlations for integrated flow (using the particle weights).
+
+ // Results are stored in profile fIntFlowDirectCorrelations.
+ // Remark 1: When particle weights are used the binning of fIntFlowDirectCorrelations is organized as follows:
+ //
+ // 1st bin: <2>_{1n|1n} = two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))>
+ // 2nd bin: <2>_{2n|2n} = two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))>
+ // 3rd bin: <2>_{3n|3n} = two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))>
+ // 4th bin: <2>_{4n|4n} = two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))>
+ // 5th bin: ---- EMPTY ----
+ // 6th bin: <3>_{2n|1n,1n} = three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))>
+ // 7th bin: <3>_{3n|2n,1n} = ...
+ // 8th bin: <3>_{4n|2n,2n} = ...
+ // 9th bin: <3>_{4n|3n,1n} = ...
+ // 10th bin: ---- EMPTY ----
+ // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))>
+ // 12th bin: <4>_{2n,1n|2n,1n} = ...
+ // 13th bin: <4>_{2n,2n|2n,2n} = ...
+ // 14th bin: <4>_{3n|1n,1n,1n} = ...
+ // 15th bin: <4>_{3n,1n|3n,1n} = ...
+ // 16th bin: <4>_{3n,1n|2n,2n} = ...
+ // 17th bin: <4>_{4n|2n,1n,1n} = ...
+ // 18th bin: ---- EMPTY ----
+ // 19th bin: <5>_{2n|1n,1n,1n,1n} = ...
+ // 20th bin: <5>_{2n,2n|2n,1n,1n} = ...
+ // 21st bin: <5>_{3n,1n|2n,1n,1n} = ...
+ // 22nd bin: <5>_{4n|1n,1n,1n,1n} = ...
+ // 23rd bin: ---- EMPTY ----
+ // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = ...
+ // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = ...
+ // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = ...
+ // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = ...
+ // 28th bin: ---- EMPTY ----
+ // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = ...
+ // 30th bin: ---- EMPTY ----
+ // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = ...
+
+ // Remark 2: When particle weights are used there are some extra correlations. They are stored in
+ // fIntFlowExtraDirectCorrelations binning of which is organized as follows:
+
+ // 1st bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))>
+ // 2nd bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))>
+ // ...
+
+ Int_t nPrim = anEvent->NumberOfTracks();
+ AliFlowTrackSimple *aftsTrack = NULL;
+ //Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.;
+ //Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.;
+ Double_t phi1=0., phi2=0., phi3=0., phi4=0.;
+ Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1.;
+ Int_t n = fHarmonic;
+ Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?)
+ Double_t dMult = (*fSMpk)(0,0);
+ cout<<endl;
+ cout<<"Multiparticle correlations: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl;
+ if(dMult<2)
+ {
+ cout<<"... skipping this event (multiplicity too low) ..."<<endl;
+ } else if (dMult>fMaxAllowedMultiplicity)
+ {
+ cout<<"... skipping this event (multiplicity too high) ..."<<endl;
+ } else
+ {
+ cout<<"... evaluating nested loops (using particle weights) ..."<<endl;
+ }
+
+ // 2-particle correlations:
+ if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity)
+ {
+ // 2 nested loops multiparticle correlations using particle weights:
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi1=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi())));
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1)continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));
+ if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush;
+ // 2-p correlations using particle weights:
+ if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),wPhi1*wPhi2); // <w1 w2 cos( n*(phi1-phi2))>
+ if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(1.5,cos(2.*n*(phi1-phi2)),pow(wPhi1,2)*pow(wPhi2,2)); // <w1^2 w2^2 cos(2n*(phi1-phi2))>
+ if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(2.5,cos(3.*n*(phi1-phi2)),pow(wPhi1,3)*pow(wPhi2,3)); // <w1^3 w2^3 cos(3n*(phi1-phi2))>
+ if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(3.5,cos(4.*n*(phi1-phi2)),pow(wPhi1,4)*pow(wPhi2,4)); // <w1^4 w2^4 cos(4n*(phi1-phi2))>
+ // extra correlations:
+ // 2-p extra correlations (do not appear if particle weights are not used):
+ if(fUsePhiWeights) fIntFlowExtraDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),pow(wPhi1,3)*wPhi2); // <w1^3 w2 cos(n*(phi1-phi2))>
+ // ...
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)
+ } // end of if(nPrim>=2)
+
+ if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity)
+ {
+ // 3 nested loops multiparticle correlations using particle weights:
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi1=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi())));
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1)continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));
+ for(Int_t i3=0;i3<nPrim;i3++)
+ {
+ if(i3==i1||i3==i2)continue;
+ aftsTrack=anEvent->GetTrack(i3);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi3=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi())));
+ if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush;
+ // 3-p correlations using particle weights:
+ if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(5.5,cos(2.*n*phi1-n*(phi2+phi3)),pow(wPhi1,2)*wPhi2*wPhi3); // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))>
+ // ...
+ // extra correlations:
+ // 2-p extra correlations (do not appear if particle weights are not used):
+ if(fUsePhiWeights) fIntFlowExtraDirectCorrelations->Fill(1.5,cos(n*(phi1-phi2)),wPhi1*wPhi2*pow(wPhi3,2)); // <w1 w2 w3^2 cos(n*(phi1-phi2))>
+ // ...
+ // 3-p extra correlations (do not appear if particle weights are not used):
+ // ...
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)
+ } // end of if(nPrim>=3)
+
+ if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity)
+ {
+ // 4 nested loops multiparticle correlations using particle weights:
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi1=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi())));
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1)continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));
+ for(Int_t i3=0;i3<nPrim;i3++)
+ {
+ if(i3==i1||i3==i2)continue;
+ aftsTrack=anEvent->GetTrack(i3);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi3=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi())));
+ for(Int_t i4=0;i4<nPrim;i4++)
+ {
+ if(i4==i1||i4==i2||i4==i3)continue;
+ aftsTrack=anEvent->GetTrack(i4);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi4=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi())));
+ if(nPrim>=4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; // to be improved (replace eventually this if statement with if(nPrim==4))
+ // 4-p correlations using particle weights:
+ if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(10.5,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4);
+ // extra correlations:
+ // 2-p extra correlations (do not appear if particle weights are not used):
+ // ...
+ // 3-p extra correlations (do not appear if particle weights are not used):
+ // ...
+ // 4-p extra correlations (do not appear if particle weights are not used):
+ // ...
+ } // end of for(Int_t i4=0;i4<nPrim;i4++)
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)
+ } // end of if(nPrim>=4)
+
+ cout<<endl;
+
+} // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent)
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowExtraCorrelations()
+{
+ // Cross-check results for extra multiparticle correlations needed for int. flow
+ // which appear only when particle weights are used: results from Q-vectors vs results from nested loops.
+
+ cout<<endl;
+ cout<<endl;
+ cout<<" ***********************************************"<<endl;
+ cout<<" **** cross-checking the extra correlations ****"<<endl;
+ cout<<" **** for integrated flow ****"<<endl;
+ cout<<" ***********************************************"<<endl;
+ cout<<endl;
+ cout<<endl;
+
+ for(Int_t eci=1;eci<=2;eci++) // to be improved (increased eciMax eventually when I calculate 6th and 8th)
+ {
+ if(strcmp((fIntFlowExtraCorrelationsPro->GetXaxis())->GetBinLabel(eci), "") == 0) continue;
+ cout<<(fIntFlowExtraCorrelationsPro->GetXaxis())->GetBinLabel(eci)<<":"<<endl;
+ cout<<"from Q-vectors = "<<fIntFlowExtraCorrelationsPro->GetBinContent(eci)<<endl;
+ cout<<"from nested loops = "<<fIntFlowExtraDirectCorrelations->GetBinContent(eci)<<endl;
+ cout<<endl;
+ }
+
+} // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowExtraCorrelations()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoops(AliFlowEventSimple * const anEvent)
+{
+ // Evaluate with nested loops correction terms for non-uniform acceptance relevant for NONAME integrated flow (to be improved (name)).
+ //
+ // Remark: Both sin and cos correction terms are calculated in this method. Sin terms are stored in fIntFlowDirectCorrectionTermsForNUA[0],
+ // and cos terms in fIntFlowDirectCorrectionTermsForNUA[1]. Binning of fIntFlowDirectCorrectionTermsForNUA[sc] is organized as follows
+ // (sc stands for either sin or cos):
+
+ // 1st bin: <<sc(n*(phi1))>>
+ // 2nd bin: <<sc(n*(phi1+phi2))>>
+ // 3rd bin: <<sc(n*(phi1-phi2-phi3))>>
+ // 4th bin: <<sc(n*(2phi1-phi2))>>
+
+ Int_t nPrim = anEvent->NumberOfTracks();
+ AliFlowTrackSimple *aftsTrack = NULL;
+ Double_t phi1=0., phi2=0., phi3=0.;
+ Int_t n = fHarmonic;
+ Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?)
+ Double_t dMult = (*fSMpk)(0,0);
+ cout<<endl;
+ cout<<"Correction terms for non-uniform acceptance: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl;
+ if(dMult<1)
+ {
+ cout<<"... skipping this event (multiplicity too low) ..."<<endl;
+ } else if (dMult>fMaxAllowedMultiplicity)
+ {
+ cout<<"... skipping this event (multiplicity too high) ..."<<endl;
+ } else
+ {
+ cout<<"... evaluating nested loops (without using particle weights)..."<<endl;
+ }
+
+ if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity)
+ {
+ // 1-particle correction terms for non-uniform acceptance:
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi1=aftsTrack->Phi();
+ if(nPrim==1) cout<<i1<<"\r"<<flush;
+ // sin terms:
+ fIntFlowDirectCorrectionTermsForNUA[0]->Fill(0.5,sin(n*phi1),1.); // <sin(n*phi1)>
+ // cos terms:
+ fIntFlowDirectCorrectionTermsForNUA[1]->Fill(0.5,cos(n*phi1),1.); // <cos(n*phi1)>
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)
+ } // end of if(nPrim>=1)
+
+ if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity)
+ {
+ // 2-particle correction terms for non-uniform acceptance:
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi1=aftsTrack->Phi();
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1)continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush;
+ // sin terms:
+ fIntFlowDirectCorrectionTermsForNUA[0]->Fill(1.5,sin(n*(phi1+phi2)),1.); // <<sin(n*(phi1+phi2))>>
+ fIntFlowDirectCorrectionTermsForNUA[0]->Fill(3.5,sin(n*(2*phi1-phi2)),1.); // <<sin(n*(2*phi1-phi2))>>
+ // cos terms:
+ fIntFlowDirectCorrectionTermsForNUA[1]->Fill(1.5,cos(n*(phi1+phi2)),1.); // <<cos(n*(phi1+phi2))>>
+ fIntFlowDirectCorrectionTermsForNUA[1]->Fill(3.5,cos(n*(2*phi1-phi2)),1.); // <<cos(n*(2*phi1-phi2))>>
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)
+ } // end of if(nPrim>=2)
+
+ if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity)
+ {
+ // 3-particle correction terms for non-uniform acceptance:
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi1=aftsTrack->Phi();
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1)continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ for(Int_t i3=0;i3<nPrim;i3++)
+ {
+ if(i3==i1||i3==i2)continue;
+ aftsTrack=anEvent->GetTrack(i3);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi3=aftsTrack->Phi();
+ if(nPrim>=3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; // to be improved (eventually I will change this if statement)
+ // sin terms:
+ fIntFlowDirectCorrectionTermsForNUA[0]->Fill(2.5,sin(n*(phi1-phi2-phi3)),1.); // <<sin(n*(phi1-phi2-phi3))>>
+ // cos terms:
+ fIntFlowDirectCorrectionTermsForNUA[1]->Fill(2.5,cos(n*(phi1-phi2-phi3)),1.); // <<cos(n*(phi1-phi2-phi3))>>
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)
+ } // end of if(nPrim>=3)
+
+ cout<<endl;
+}
+//================================================================================================================================
+void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta)
+{
+ // Evaluate reduced correlations with nested loops without using the particle weights.
+
+ // Remark 1: Reduced correlations are evaluated in pt bin number fCrossCheckInPtBinNo and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs.
+ // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrelations[t][pe][ci], where indices runs as follows:
+ // [0=RP,1=POI][0=Pt,1=Eta][0=<2'>,1=<4'>,2=<6'>,3=<8'>]
+ // Remark 3: <2'> = <cos(n*(psi1-phi2))>
+ // <4'> = <cos(n*(psi1+phi2-phi3-phi4))>
+ // ...
+
+ Int_t typeFlag = -1;
+ Int_t ptEtaFlag = -1;
+ if(type == "RP")
+ {
+ typeFlag = 0;
+ } else if(type == "POI")
+ {
+ typeFlag = 1;
+ }
+ if(ptOrEta == "Pt")
+ {
+ ptEtaFlag = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ ptEtaFlag = 1;
+ }
+ // shortcuts:
+ Int_t t = typeFlag;
+ Int_t pe = ptEtaFlag;
+
+ Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth};
+ Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth};
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};
+
+ Int_t nPrim = anEvent->NumberOfTracks();
+ AliFlowTrackSimple *aftsTrack = NULL;
+
+ Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.;
+
+ Int_t n = fHarmonic;
+
+ // 2'-particle correlations:
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)
+ if(typeFlag==1) // this is diff flow of POIs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ }
+ } else // this is diff flow of RPs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ }
+ }
+
+ psi1=aftsTrack->Phi();
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1)continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ // RP condition (!(first) particle in the correlator must be RP):
+ if(!(aftsTrack->InRPSelection()))continue;
+ phi2=aftsTrack->Phi();
+ // 2'-particle correlations:
+ fDiffFlowDirectCorrelations[t][pe][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(1.*n*(psi1-phi2)),1.); // <cos(n*(psi1-phi2))
+ }//end of for(Int_t i2=0;i2<nPrim;i2++)
+ }//end of for(Int_t i1=0;i1<nPrim;i1++)
+
+ /*
+
+ // 3'-particle correlations:
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ }
+ psi1=aftsTrack->Phi();
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1)continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ // RP condition (!(first) particle in the correlator must be RP):
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ for(Int_t i3=0;i3<nPrim;i3++)
+ {
+ if(i3==i1||i3==i2)continue;
+ aftsTrack=anEvent->GetTrack(i3);
+ // RP condition (!(first) particle in the correlator must be RP):
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi3=aftsTrack->Phi();
+ // to be improved : where to store it? ->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(2.*phi1-phi2-phi3)),1.); // <w1 w2 w3 cos(n(2psi1-phi2-phi3))>
+ }//end of for(Int_t i3=0;i3<nPrim;i3++)
+ }//end of for(Int_t i2=0;i2<nPrim;i2++)
+ }//end of for(Int_t i1=0;i1<nPrim;i1++)
+
+ */
+
+ // 4'-particle correlations:
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)
+ if(typeFlag==1) // this is diff flow of POIs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ }
+ } else // this is diff flow of RPs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ }
+ }
+
+ psi1=aftsTrack->Phi();
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1) continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ // RP condition (!(first) particle in the correlator must be RP):
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ for(Int_t i3=0;i3<nPrim;i3++)
+ {
+ if(i3==i1||i3==i2) continue;
+ aftsTrack=anEvent->GetTrack(i3);
+ // RP condition (!(first) particle in the correlator must be RP):
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi3=aftsTrack->Phi();
+ for(Int_t i4=0;i4<nPrim;i4++)
+ {
+ if(i4==i1||i4==i2||i4==i3) continue;
+ aftsTrack=anEvent->GetTrack(i4);
+ // RP condition (!(first) particle in the correlator must be RP):
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi4=aftsTrack->Phi();
+ // 4'-particle correlations:
+ fDiffFlowDirectCorrelations[t][pe][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3-phi4)),1.); // <cos(n(psi1+phi2-phi3-phi4))>
+ }//end of for(Int_t i4=0;i4<nPrim;i4++)
+ }//end of for(Int_t i3=0;i3<nPrim;i3++)
+ }//end of for(Int_t i2=0;i2<nPrim;i2++)
+ }//end of for(Int_t i1=0;i1<nPrim;i1++)
+
+ // count # of RPs and POIs in selected pt and eta bins for cross-checkings:
+ for(Int_t i=0;i<nPrim;i++)
+ {
+ aftsTrack=anEvent->GetTrack(i);
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)
+ if(typeFlag==1) // this is diff flow of POIs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ }
+ } else // this is diff flow of RPs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ }
+ }
+ if(t==1)t++;
+ fNoOfParticlesInBin->Fill(t+pe+0.5);
+ }
+
+} // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta)
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrelations(TString type, TString ptOrEta)
+{
+ // Compare correlations needed for diff. flow calculated with nested loops and those calculated from Q-vectors
+
+ Int_t typeFlag = -1;
+ Int_t ptEtaFlag = -1;
+ if(type == "RP")
+ {
+ typeFlag = 0;
+ } else if(type == "POI")
+ {
+ typeFlag = 1;
+ }
+ if(ptOrEta == "Pt")
+ {
+ ptEtaFlag = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ ptEtaFlag = 1;
+ }
+ // shortcuts:
+ Int_t t = typeFlag;
+ Int_t pe = ptEtaFlag;
+
+ TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member)
+ TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member)
+ TString reducedCorrelations[4] = {"<<cos(n(psi1-phi2))>>","<<cos(n(psi1+phi2-phi3-phi4))>>","",""}; // to be improved (access this from pro or hist)
+ Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth};
+ Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth};
+
+ Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo};
+
+
+ cout<<endl;
+ cout<<" *****************************************"<<endl;
+ cout<<" **** cross-checking the correlations ****"<<endl;
+ cout<<" **** for differential flow ("<<rpORpoiString[t]<<") ****"<<endl;
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))
+ {
+ cout<<" **** (particle weights not used) ****"<<endl;
+ } else
+ {
+ cout<<" **** (particle weights used) ****"<<endl;
+ }
+ cout<<" *****************************************"<<endl;
+ cout<<endl;
+ cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl;
+ cout<<endl;
+
+ for(Int_t rci=0;rci<2;rci++) // to be improved (calculate 6th and 8th order)
+ {
+ cout<<" "<<reducedCorrelations[rci].Data()<<":"<<endl;
+ cout<<" from Q-vectors = "<<fDiffFlowCorrelationsPro[t][pe][rci]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl;
+ cout<<" from nested loops = "<<fDiffFlowDirectCorrelations[t][pe][rci]->GetBinContent(1)<<endl;
+ cout<<endl;
+ } // end of for(Int_t rci=0;rci<4;rci++)
+
+} // end of void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrelations(TString type, TString ptOrEta)
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::PrintNumberOfParticlesInSelectedBin()
+{
+ // Print on the screen number of RPs and POIs in selected pt and eta bin for cross checkings.
+
+ cout<<endl;
+ cout<<"Number of RPs in selected pt bin = "<<fNoOfParticlesInBin->GetBinContent(1)<<endl;
+ cout<<"Number of RPs in selected eta bin = "<<fNoOfParticlesInBin->GetBinContent(2)<<endl;
+ cout<<"Number of POIs in selected pt bin = "<<fNoOfParticlesInBin->GetBinContent(3)<<endl;
+ cout<<"Number of POIs in selected eta bin = "<<fNoOfParticlesInBin->GetBinContent(4)<<endl;
+
+} // end of void AliFlowAnalysisWithQCumulants::PrintNumberOfParticlesInSelectedBin()
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta)
+{
+ // Evaluate reduced correlations with nested loops without using the particle weights.
+
+ // Remark 1: Reduced correlations are evaluated in pt bin number fCrossCheckInPtBinNo and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs.
+ // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrelations[t][pe][ci], where indices runs as follows:
+ // [0=RP,1=POI][0=Pt,1=Eta][0=<2'>,1=<4'>,2=<6'>,3=<8'>]
+ // Remark 3: <2'> = <w2 cos(n*(psi1-phi2))>
+ // <4'> = <w2 w3 w4 cos(n*(psi1+phi2-phi3-phi4))>
+ // ...
+
+ Int_t typeFlag = -1;
+ Int_t ptEtaFlag = -1;
+ if(type == "RP")
+ {
+ typeFlag = 0;
+ } else if(type == "POI")
+ {
+ typeFlag = 1;
+ }
+ if(ptOrEta == "Pt")
+ {
+ ptEtaFlag = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ ptEtaFlag = 1;
+ }
+ // shortcuts:
+ Int_t t = typeFlag;
+ Int_t pe = ptEtaFlag;
+
+ Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth};
+ Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth};
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};
+
+ Int_t nPrim = anEvent->NumberOfTracks();
+ AliFlowTrackSimple *aftsTrack = NULL;
+
+ Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.;
+ Double_t wPhi2=1., wPhi3=1., wPhi4=1.;// wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.;
+
+ Int_t n = fHarmonic;
+
+ // 2'-particle correlations:
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)
+ if(typeFlag==1) // this is diff flow of POIs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ }
+ } else // this is diff flow of RPs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ }
+ }
+ psi1=aftsTrack->Phi();
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1) continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ // RP condition (!(first) particle in the correlator must be RP):
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));
+ // 2'-particle correlations:
+ fDiffFlowDirectCorrelations[t][pe][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(1.*n*(psi1-phi2)),wPhi2); // <w2 cos(n*(psi1-phi2))
+ }//end of for(Int_t i2=0;i2<nPrim;i2++)
+ }//end of for(Int_t i1=0;i1<nPrim;i1++)
+
+ // 4'-particle correlations:
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)
+ if(typeFlag==1) // this is diff flow of POIs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ }
+ } else // this is diff flow of RPs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ }
+ }
+ psi1=aftsTrack->Phi();
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1) continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ // RP condition (!(first) particle in the correlator must be RP):
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));
+ for(Int_t i3=0;i3<nPrim;i3++)
+ {
+ if(i3==i1||i3==i2) continue;
+ aftsTrack=anEvent->GetTrack(i3);
+ // RP condition (!(first) particle in the correlator must be RP):
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi3=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi())));
+ for(Int_t i4=0;i4<nPrim;i4++)
+ {
+ if(i4==i1||i4==i2||i4==i3) continue;
+ aftsTrack=anEvent->GetTrack(i4);
+ // RP condition (!(first) particle in the correlator must be RP):
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi4=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi())));
+ // 4'-particle correlations <w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))>:
+ fDiffFlowDirectCorrelations[t][pe][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3-phi4)),wPhi2*wPhi3*wPhi4);
+ }//end of for(Int_t i4=0;i4<nPrim;i4++)
+ }//end of for(Int_t i3=0;i3<nPrim;i3++)
+ }//end of for(Int_t i2=0;i2<nPrim;i2++)
+ }//end of for(Int_t i1=0;i1<nPrim;i1++)
+
+ // count # of RPs and POIs in selected pt and eta bins for cross-checkings: (to be improved - moved to dedicated method)
+ for(Int_t i=0;i<nPrim;i++)
+ {
+ aftsTrack=anEvent->GetTrack(i);
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)
+ if(typeFlag==1) // this is diff flow of POIs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ }
+ } else // this is diff flow of RPs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ }
+ }
+ if(t==1)t++;
+ fNoOfParticlesInBin->Fill(t+pe+0.5);
+ }
+
+} // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta)
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta)
+{
+ // Evaluate with nested loops correction terms for non-uniform acceptance (both sin and cos terms) relevant for differential flow.
+
+ // Remark 1: Reduced correction terms for non-uniform acceptance are evaluated in pt bin number fCrossCheckInPtBinNo
+ // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs.
+ // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrections[t][pe][sc][cti], where first three indices runs as:
+ // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms], whilst the cti (correction term index) runs as follows:
+ // cti:
+ // 0: <<sc n(psi1)>>
+ // 1: <<sc n(psi1+phi2)>>
+ // 2: <<sc n(psi1+phi2-phi3)>>
+ // 3: <<sc n(psi1-phi2-phi3)>>
+ // 4:
+ // 5:
+ // 6:
+
+ Int_t typeFlag = -1;
+ Int_t ptEtaFlag = -1;
+ if(type == "RP")
+ {
+ typeFlag = 0;
+ } else if(type == "POI")
+ {
+ typeFlag = 1;
+ }
+ if(ptOrEta == "Pt")
+ {
+ ptEtaFlag = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ ptEtaFlag = 1;
+ }
+ // shortcuts:
+ Int_t t = typeFlag;
+ Int_t pe = ptEtaFlag;
+
+ Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth};
+ Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth};
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};
+
+ Int_t nPrim = anEvent->NumberOfTracks();
+ AliFlowTrackSimple *aftsTrack = NULL;
+
+ Double_t psi1=0., phi2=0., phi3=0.;// phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.;
+
+ Int_t n = fHarmonic;
+
+ // 1-particle correction terms:
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)
+ if(typeFlag==1) // this is diff flow of POIs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ }
+ } else // this is diff flow of RPs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ }
+ }
+ psi1=aftsTrack->Phi();
+ // sin terms:
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*psi1),1.); // <<sin(n*(psi1))>>
+ // cos terms:
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*psi1),1.); // <<cos(n*(psi1))>>
+ }//end of for(Int_t i1=0;i1<nPrim;i1++)
+
+ // 2-particle correction terms:
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)
+ if(typeFlag==1) // this is diff flow of POIs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ }
+ } else // this is diff flow of RPs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ }
+ }
+ psi1=aftsTrack->Phi();
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1) continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ // RP condition (!(first) particle in the correlator must be RP):
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ // sin terms:
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2)),1.); // <<sin(n*(psi1+phi2))>>
+ // cos terms:
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2)),1.); // <<cos(n*(psi1+phi2))>>
+ }//end of for(Int_t i2=0;i2<nPrim;i2++)
+ }//end of for(Int_t i1=0;i1<nPrim;i1++)
+
+ // 3-particle correction terms:
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)
+ if(typeFlag==1) // this is diff flow of POIs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ }
+ } else // this is diff flow of RPs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ }
+ }
+ psi1=aftsTrack->Phi();
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1) continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ // RP condition (!(first) particle in the correlator must be RP):
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ for(Int_t i3=0;i3<nPrim;i3++)
+ {
+ if(i3==i1||i3==i2) continue;
+ aftsTrack=anEvent->GetTrack(i3);
+ // RP condition (!(first) particle in the correlator must be RP):
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi3=aftsTrack->Phi();
+ // sin terms:
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2-phi3)),1.); // <<sin(n*(psi1+phi2-phi3))>>
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1-phi2-phi3)),1.); // <<sin(n*(psi1-phi2-phi3))>>
+ // cos terms:
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3)),1.); // <<cos(n*(psi1+phi2-phi3))>>
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-phi2-phi3)),1.); // <<cos(n*(psi1-phi2-phi3))>>
+ }//end of for(Int_t i3=0;i3<nPrim;i3++)
+ }//end of for(Int_t i2=0;i2<nPrim;i2++)
+ }//end of for(Int_t i1=0;i1<nPrim;i1++)
+
+} // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta)
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrectionTermsForNUA(TString type, TString ptOrEta)
+{
+ // Compare corrections temrs for non-uniform acceptance needed for diff. flow calculated with nested loops and those calculated from Q-vectors
+
+ Int_t typeFlag = -1;
+ Int_t ptEtaFlag = -1;
+ if(type == "RP")
+ {
+ typeFlag = 0;
+ } else if(type == "POI")
+ {
+ typeFlag = 1;
+ }
+ if(ptOrEta == "Pt")
+ {
+ ptEtaFlag = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ ptEtaFlag = 1;
+ }
+ // shortcuts:
+ Int_t t = typeFlag;
+ Int_t pe = ptEtaFlag;
+
+ TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member)
+ TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member)
+ //TString sinCosFlag[2] = {"sin","cos"}; // to be improved (eventually promote to data member)
+ TString reducedCorrectionSinTerms[4] = {"<<sin(n(psi1))>>","<<sin(n(psi1+phi2))>>","<<sin(n*(psi1+phi2-phi3))>>","<<sin(n*(psi1-phi2-phi3))>>"}; // to be improved (access this from pro or hist)
+ TString reducedCorrectionCosTerms[4] = {"<<cos(n(psi1))>>","<<cos(n(psi1+phi2))>>","<<cos(n*(psi1+phi2-phi3))>>","<<cos(n*(psi1-phi2-phi3))>>"}; // to be improved (access this from pro or hist)
+ Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth};
+ Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth};
+
+ Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo};
+
+ cout<<endl;
+ cout<<" ******************************************"<<endl;
+ cout<<" **** cross-checking the correction ****"<<endl;
+ cout<<" **** terms for non-uniform acceptance ****"<<endl;
+ cout<<" **** for differential flow ("<<rpORpoiString[t]<<") ****"<<endl;
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))
+ {
+ cout<<" **** (particle weights not used) ****"<<endl;
+ } else
+ {
+ cout<<" **** (particle weights used) ****"<<endl;
+ }
+ cout<<" ******************************************"<<endl;
+ cout<<endl;
+ cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl;
+ cout<<endl;
+
+ for(Int_t cti=0;cti<4;cti++) // correction term index
+ {
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms
+ {
+ if(sc==0) // to be improved (this can be implemented better)
+ {
+ cout<<" "<<reducedCorrectionSinTerms[cti].Data()<<":"<<endl;
+ } else
+ {
+ cout<<" "<<reducedCorrectionCosTerms[cti].Data()<<":"<<endl;
+ }
+ cout<<" from Q-vectors = "<<fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl;
+ cout<<" from nested loops = "<<fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]->GetBinContent(1)<<endl;
+ cout<<endl;
+ }
+ } // end of for(Int_t rci=0;rci<4;rci++)
-} // end of void AliFlowAnalysisWithQCumulants::StoreDistributionsOfCorrelations()
+} // end of void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrectionTermsForNUA(TString type, TString ptOrEta)
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::BookAndNestAllLists()\r
-{\r
- // Book and nest all lists nested in the base list fHistList.\r
- // a) Book and nest lists for integrated flow;\r
- // b) Book and nest lists for differential flow;\r
- // c) Book and nest list for particle weights;\r
- // d) Book and nest list for distributions;\r
- // e) Book and nest list for nested loops;\r
- \r
- // a) Book and nest all lists for integrated flow:\r
- // base list for integrated flow:\r
- fIntFlowList = new TList();\r
- fIntFlowList->SetName("Integrated Flow");\r
- fIntFlowList->SetOwner(kTRUE);\r
- fHistList->Add(fIntFlowList);\r
- // list holding profiles: \r
- fIntFlowProfiles = new TList();\r
- fIntFlowProfiles->SetName("Profiles");\r
- fIntFlowProfiles->SetOwner(kTRUE);\r
- fIntFlowList->Add(fIntFlowProfiles);\r
- // list holding histograms with results:\r
- fIntFlowResults = new TList();\r
- fIntFlowResults->SetName("Results");\r
- fIntFlowResults->SetOwner(kTRUE);\r
- fIntFlowList->Add(fIntFlowResults);\r
- \r
- // b) Book and nest lists for differential flow;\r
- fDiffFlowList = new TList();\r
- fDiffFlowList->SetName("Differential Flow");\r
- fDiffFlowList->SetOwner(kTRUE); \r
- fHistList->Add(fDiffFlowList);\r
- // list holding profiles: \r
- fDiffFlowProfiles = new TList(); \r
- fDiffFlowProfiles->SetName("Profiles");\r
- fDiffFlowProfiles->SetOwner(kTRUE);\r
- fDiffFlowList->Add(fDiffFlowProfiles);\r
- // list holding histograms with results: \r
- fDiffFlowResults = new TList();\r
- fDiffFlowResults->SetName("Results");\r
- fDiffFlowResults->SetOwner(kTRUE);\r
- fDiffFlowList->Add(fDiffFlowResults);\r
- // flags used for naming nested lists in list fDiffFlowProfiles and fDiffFlowResults: \r
- TList list;\r
- list.SetOwner(kTRUE);\r
- TString typeFlag[2] = {"RP","POI"}; \r
- TString ptEtaFlag[2] = {"p_{T}","#eta"}; \r
- TString powerFlag[2] = {"linear","quadratic"}; \r
- // nested lists in fDiffFlowProfiles (~/Differential Flow/Profiles):\r
- for(Int_t t=0;t<2;t++) // type: RP or POI\r
- {\r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- // list holding profiles with correlations:\r
- fDiffFlowCorrelationsProList[t][pe] = (TList*)list.Clone();\r
- fDiffFlowCorrelationsProList[t][pe]->SetName(Form("Profiles with correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));\r
- fDiffFlowProfiles->Add(fDiffFlowCorrelationsProList[t][pe]);\r
- // list holding profiles with products of correlations:\r
- fDiffFlowProductOfCorrelationsProList[t][pe] = (TList*)list.Clone();\r
- fDiffFlowProductOfCorrelationsProList[t][pe]->SetName(Form("Profiles with products of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));\r
- fDiffFlowProfiles->Add(fDiffFlowProductOfCorrelationsProList[t][pe]);\r
- // list holding profiles with corrections:\r
- fDiffFlowCorrectionsProList[t][pe] = (TList*)list.Clone();\r
- fDiffFlowCorrectionsProList[t][pe]->SetName(Form("Profiles with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));\r
- fDiffFlowProfiles->Add(fDiffFlowCorrectionsProList[t][pe]); \r
- } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta \r
- } // end of for(Int_t t=0;t<2;t++) // type: RP or POI \r
- // nested lists in fDiffFlowResults (~/Differential Flow/Results):\r
- for(Int_t t=0;t<2;t++) // type: RP or POI\r
- {\r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- // list holding histograms with correlations:\r
- fDiffFlowCorrelationsHistList[t][pe] = (TList*)list.Clone();\r
- fDiffFlowCorrelationsHistList[t][pe]->SetName(Form("Correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));\r
- fDiffFlowResults->Add(fDiffFlowCorrelationsHistList[t][pe]);\r
- // list holding histograms with corrections:\r
- fDiffFlowCorrectionsHistList[t][pe] = (TList*)list.Clone();\r
- fDiffFlowCorrectionsHistList[t][pe]->SetName(Form("Histograms with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));\r
- fDiffFlowResults->Add(fDiffFlowCorrectionsHistList[t][pe]); \r
- for(Int_t power=0;power<2;power++)\r
- {\r
- // list holding histograms with sums of event weights:\r
- fDiffFlowSumOfEventWeightsHistList[t][pe][power] = (TList*)list.Clone();\r
- fDiffFlowSumOfEventWeightsHistList[t][pe][power]->SetName(Form("Sum of %s event weights (%s, %s)",powerFlag[power].Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data()));\r
- fDiffFlowResults->Add(fDiffFlowSumOfEventWeightsHistList[t][pe][power]); \r
- } // end of for(Int_t power=0;power<2;power++)\r
- // list holding histograms with sums of products of event weights:\r
- fDiffFlowSumOfProductOfEventWeightsHistList[t][pe] = (TList*)list.Clone();\r
- fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]->SetName(Form("Sum of products of event weights (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));\r
- fDiffFlowResults->Add(fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]);\r
- // list holding histograms with covariances of correlations:\r
- fDiffFlowCovariancesHistList[t][pe] = (TList*)list.Clone();\r
- fDiffFlowCovariancesHistList[t][pe]->SetName(Form("Covariances of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));\r
- fDiffFlowResults->Add(fDiffFlowCovariancesHistList[t][pe]);\r
- // list holding histograms with differential Q-cumulants:\r
- fDiffFlowCumulantsHistList[t][pe] = (TList*)list.Clone();\r
- fDiffFlowCumulantsHistList[t][pe]->SetName(Form("Differential Q-cumulants (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));\r
- fDiffFlowResults->Add(fDiffFlowCumulantsHistList[t][pe]); \r
- // list holding histograms with differential flow estimates from Q-cumulants:\r
- fDiffFlowHistList[t][pe] = (TList*)list.Clone();\r
- fDiffFlowHistList[t][pe]->SetName(Form("Differential flow (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));\r
- fDiffFlowResults->Add(fDiffFlowHistList[t][pe]); \r
- } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- } // end of for(Int_t t=0;t<2;t++) // type: RP or POI\r
- \r
- // c) Book and nest list for particle weights:\r
- fWeightsList->SetName("Weights");\r
- fWeightsList->SetOwner(kTRUE); \r
- fHistList->Add(fWeightsList); \r
-\r
- // d) Book and nest list for distributions:\r
- fDistributionsList = new TList();\r
- fDistributionsList->SetName("Distributions");\r
- fDistributionsList->SetOwner(kTRUE);\r
- fHistList->Add(fDistributionsList);\r
- \r
- // e) Book and nest list for nested loops:\r
- fNestedLoopsList = new TList();\r
- fNestedLoopsList->SetName("Nested Loops");\r
- fNestedLoopsList->SetOwner(kTRUE);\r
- fHistList->Add(fNestedLoopsList);\r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::BookAndNestAllLists()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type)\r
-{\r
- // fill common result histograms for differential flow\r
- \r
- Int_t typeFlag = -1;\r
- //Int_t ptEtaFlag = -1;\r
-\r
- if(type == "RP")\r
- {\r
- typeFlag = 0;\r
- } else if(type == "POI")\r
- {\r
- typeFlag = 1;\r
- } \r
- \r
- // shortcuts:\r
- Int_t t = typeFlag;\r
- //Int_t pe = ptEtaFlag;\r
-\r
- // to be improved (implement protection here)\r
- \r
- if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th))\r
- {\r
- cout<<"WARNING: fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th"<<endl; \r
- cout<<" is NULL in AFAWQC::FCHRIF() !!!!"<<endl;\r
- exit(0);\r
- }\r
- \r
- // pt:\r
- for(Int_t p=1;p<=fnBinsPt;p++)\r
- {\r
- Double_t v2 = fDiffFlow[t][0][0]->GetBinContent(p);\r
- Double_t v4 = fDiffFlow[t][0][1]->GetBinContent(p);\r
- Double_t v6 = fDiffFlow[t][0][2]->GetBinContent(p);\r
- Double_t v8 = fDiffFlow[t][0][3]->GetBinContent(p);\r
- \r
- Double_t v2Error = fDiffFlow[t][0][0]->GetBinError(p);\r
- Double_t v4Error = fDiffFlow[t][0][1]->GetBinError(p);\r
- //Double_t v6Error = fFinalFlow1D[t][pW][nua][0][2]->GetBinError(p);\r
- //Double_t v8Error = fFinalFlow1D[t][pW][nua][0][3]->GetBinError(p);\r
- \r
- if(type == "RP")\r
- {\r
- fCommonHistsResults2nd->FillDifferentialFlowPtRP(p,v2,v2Error);\r
- fCommonHistsResults4th->FillDifferentialFlowPtRP(p,v4,v4Error);\r
- fCommonHistsResults6th->FillDifferentialFlowPtRP(p,v6,0.);\r
- fCommonHistsResults8th->FillDifferentialFlowPtRP(p,v8,0.);\r
- } else if(type == "POI")\r
- {\r
- fCommonHistsResults2nd->FillDifferentialFlowPtPOI(p,v2,v2Error);\r
- fCommonHistsResults4th->FillDifferentialFlowPtPOI(p,v4,v4Error);\r
- fCommonHistsResults6th->FillDifferentialFlowPtPOI(p,v6,0.);\r
- fCommonHistsResults8th->FillDifferentialFlowPtPOI(p,v8,0.);\r
- }\r
- } // end of for(Int_t p=1;p<=fnBinsPt;p++) \r
- \r
- // eta:\r
- for(Int_t e=1;e<=fnBinsEta;e++)\r
- {\r
- Double_t v2 = fDiffFlow[t][1][0]->GetBinContent(e);\r
- Double_t v4 = fDiffFlow[t][1][1]->GetBinContent(e);\r
- Double_t v6 = fDiffFlow[t][1][2]->GetBinContent(e);\r
- Double_t v8 = fDiffFlow[t][1][3]->GetBinContent(e);\r
- \r
- Double_t v2Error = fDiffFlow[t][1][0]->GetBinError(e);\r
- Double_t v4Error = fDiffFlow[t][1][1]->GetBinError(e);\r
- //Double_t v6Error = fDiffFlow[t][1][2]->GetBinError(e);\r
- //Double_t v8Error = fDiffFlow[t][1][3]->GetBinError(e);\r
- \r
- if(type == "RP")\r
- {\r
- fCommonHistsResults2nd->FillDifferentialFlowEtaRP(e,v2,v2Error);\r
- fCommonHistsResults4th->FillDifferentialFlowEtaRP(e,v4,v4Error);\r
- fCommonHistsResults6th->FillDifferentialFlowEtaRP(e,v6,0.);\r
- fCommonHistsResults8th->FillDifferentialFlowEtaRP(e,v8,0.);\r
- } else if(type == "POI")\r
- {\r
- fCommonHistsResults2nd->FillDifferentialFlowEtaPOI(e,v2,v2Error);\r
- fCommonHistsResults4th->FillDifferentialFlowEtaPOI(e,v4,v4Error);\r
- fCommonHistsResults6th->FillDifferentialFlowEtaPOI(e,v6,0.);\r
- fCommonHistsResults8th->FillDifferentialFlowEtaPOI(e,v8,0.);\r
- }\r
- } // end of for(Int_t e=1;e<=fnBinsEta;e++) \r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights, Bool_t correctedForNUA)\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::AccessConstants()\r
-{\r
- // access needed common constants from AliFlowCommonConstants\r
- \r
- fnBinsPhi = AliFlowCommonConstants::GetMaster()->GetNbinsPhi();\r
- fPhiMin = AliFlowCommonConstants::GetMaster()->GetPhiMin(); \r
- fPhiMax = AliFlowCommonConstants::GetMaster()->GetPhiMax();\r
- if(fnBinsPhi) fPhiBinWidth = (fPhiMax-fPhiMin)/fnBinsPhi; \r
- fnBinsPt = AliFlowCommonConstants::GetMaster()->GetNbinsPt();\r
- fPtMin = AliFlowCommonConstants::GetMaster()->GetPtMin(); \r
- fPtMax = AliFlowCommonConstants::GetMaster()->GetPtMax();\r
- if(fnBinsPt) fPtBinWidth = (fPtMax-fPtMin)/fnBinsPt; \r
- fnBinsEta = AliFlowCommonConstants::GetMaster()->GetNbinsEta();\r
- fEtaMin = AliFlowCommonConstants::GetMaster()->GetEtaMin(); \r
- fEtaMax = AliFlowCommonConstants::GetMaster()->GetEtaMax();\r
- if(fnBinsEta) fEtaBinWidth = (fEtaMax-fEtaMin)/fnBinsEta; \r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::AccessConstants()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeights()\r
-{\r
- // Calculate sum of linear and quadratic event weights for correlations\r
- \r
- \r
- /*\r
- Double_t dMult = (*fSMpk)(0,0); // multiplicity \r
-\r
- Double_t eventWeight[4] = {0}; \r
- \r
- if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
- {\r
- eventWeight[0] = dMult*(dMult-1); // event weight for <2> \r
- eventWeight[1] = dMult*(dMult-1)*(dMult-2)*(dMult-3); // event weight for <4> \r
- eventWeight[2] = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5); // event weight for <6> \r
- eventWeight[3] = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)*(dMult-6)*(dMult-7); // event weight for <8> \r
- } else\r
- {\r
- eventWeight[0] = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j;\r
- eventWeight[1] = (*fSMpk)(3,1)-6.*(*fSMpk)(0,2)*(*fSMpk)(1,1) \r
- + 8.*(*fSMpk)(0,3)*(*fSMpk)(0,1)\r
- + 3.*(*fSMpk)(1,2)-6.*(*fSMpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l\r
- //eventWeight[2] = ... // to be improved (calculated) \r
- //eventWeight[3] = ... // to be improved (calculated) \r
- }\r
- */\r
- \r
- \r
- for(Int_t p=0;p<2;p++) // power-1\r
- {\r
- for(Int_t ci=0;ci<4;ci++) // correlation index\r
- { \r
- fIntFlowSumOfEventWeights[p]->Fill(ci+0.5,pow(fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci+1),p+1)); \r
- }\r
- }\r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeights()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeights()\r
-{\r
- // Calculate sum of product of event weights for correlations\r
- \r
- \r
- /*\r
- Double_t dMult = (*fSMpk)(0,0); // multiplicity \r
-\r
- Double_t eventWeight[4] = {0}; \r
- \r
- if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
- {\r
- eventWeight[0] = dMult*(dMult-1); // event weight for <2> \r
- eventWeight[1] = dMult*(dMult-1)*(dMult-2)*(dMult-3); // event weight for <4> \r
- eventWeight[2] = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5); // event weight for <6> \r
- eventWeight[3] = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)*(dMult-6)*(dMult-7); // event weight for <8> \r
- } else\r
- {\r
- eventWeight[0] = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j;\r
- eventWeight[1] = (*fSMpk)(3,1)-6.*(*fSMpk)(0,2)*(*fSMpk)(1,1) \r
- + 8.*(*fSMpk)(0,3)*(*fSMpk)(0,1)\r
- + 3.*(*fSMpk)(1,2)-6.*(*fSMpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l\r
- //eventWeight[2] = ... // to be improved (calculated) \r
- //eventWeight[3] = ... // to be improved (calculated) \r
- }\r
-\r
- fIntFlowSumOfProductOfEventWeights->Fill(0.5,eventWeight[0]*eventWeight[1]); \r
- fIntFlowSumOfProductOfEventWeights->Fill(1.5,eventWeight[0]*eventWeight[2]); \r
- fIntFlowSumOfProductOfEventWeights->Fill(2.5,eventWeight[0]*eventWeight[3]); \r
- fIntFlowSumOfProductOfEventWeights->Fill(3.5,eventWeight[1]*eventWeight[2]); \r
- fIntFlowSumOfProductOfEventWeights->Fill(4.5,eventWeight[1]*eventWeight[3]); \r
- fIntFlowSumOfProductOfEventWeights->Fill(5.5,eventWeight[2]*eventWeight[3]); \r
- */\r
- \r
- \r
- Int_t counter = 0;\r
- \r
- for(Int_t ci1=1;ci1<4;ci1++)\r
- {\r
- for(Int_t ci2=ci1+1;ci2<=4;ci2++)\r
- {\r
- fIntFlowSumOfProductOfEventWeights->Fill(0.5+counter++,\r
- fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)*fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2));\r
- }\r
- }\r
-\r
- \r
-\r
-} // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowIntFlowSumOfProductOfEventWeights()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelations(TString type, TString ptOrEta)\r
-{\r
- // calculate reduced correlations for RPs or POIs in pt or eta bins\r
-\r
- // multiplicity:\r
- Double_t dMult = (*fSMpk)(0,0);\r
- \r
- // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
- Double_t dReQ1n = (*fReQ)(0,0);\r
- Double_t dReQ2n = (*fReQ)(1,0);\r
- //Double_t dReQ3n = (*fReQ)(2,0);\r
- //Double_t dReQ4n = (*fReQ)(3,0);\r
- Double_t dImQ1n = (*fImQ)(0,0);\r
- Double_t dImQ2n = (*fImQ)(1,0);\r
- //Double_t dImQ3n = (*fImQ)(2,0);\r
- //Double_t dImQ4n = (*fImQ)(3,0);\r
-\r
- // reduced correlations are stored in fDiffFlowCorrelationsPro[0=RP,1=POI][0=pt,1=eta][correlation index]. Correlation index runs as follows:\r
- // \r
- // 0: <<2'>>\r
- // 1: <<4'>>\r
- // 2: <<6'>>\r
- // 3: <<8'>>\r
- \r
- Int_t t = -1; // type flag \r
- Int_t pe = -1; // ptEta flag\r
- \r
- if(type == "RP")\r
- {\r
- t = 0;\r
- } else if(type == "POI")\r
- {\r
- t = 1;\r
- }\r
-\r
- if(ptOrEta == "Pt")\r
- {\r
- pe = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- pe = 1;\r
- }\r
- \r
- Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
- Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
- //Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
- Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
-\r
- // looping over all bins and calculating reduced correlations: \r
- for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- {\r
- // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): \r
- Double_t p1n0kRe = 0.;\r
- Double_t p1n0kIm = 0.;\r
-\r
- // number of POIs in particular pt or eta bin:\r
- Double_t mp = 0.;\r
-\r
- // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin):\r
- Double_t q1n0kRe = 0.;\r
- Double_t q1n0kIm = 0.;\r
- Double_t q2n0kRe = 0.;\r
- Double_t q2n0kIm = 0.;\r
-\r
- // number of particles which are both RPs and POIs in particular pt or eta bin:\r
- Double_t mq = 0.;\r
- \r
- if(type == "POI")\r
- {\r
- // q_{m*n,0}:\r
- q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b))\r
- * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b));\r
- q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b))\r
- * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b));\r
- q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b))\r
- * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b));\r
- q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b))\r
- * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); \r
- \r
- mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
- } \r
- else if(type == "RP")\r
- {\r
- // q_{m*n,0}:\r
- q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b))\r
- * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
- q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b))\r
- * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
- q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b))\r
- * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b));\r
- q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b))\r
- * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); \r
- \r
- mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) \r
- }\r
- \r
- if(type == "POI")\r
- {\r
- // p_{m*n,0}:\r
- p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b))\r
- * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b));\r
- p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) \r
- * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b));\r
- \r
- mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
- \r
- t = 1; // typeFlag = RP or POI\r
- }\r
- else if(type == "RP")\r
- {\r
- // p_{m*n,0} = q_{m*n,0}:\r
- p1n0kRe = q1n0kRe; \r
- p1n0kIm = q1n0kIm; \r
- \r
- mp = mq; \r
- \r
- t = 0; // typeFlag = RP or POI\r
- }\r
- \r
- // 2'-particle correlation for particular (pt,eta) bin:\r
- Double_t two1n1nPtEta = 0.;\r
- if(mp*dMult-mq)\r
- {\r
- two1n1nPtEta = (p1n0kRe*dReQ1n+p1n0kIm*dImQ1n-mq)\r
- / (mp*dMult-mq);\r
- \r
- if(type == "POI") // to be improved (I do not this if)\r
- { \r
- // fill profile to get <<2'>> for POIs\r
- fDiffFlowCorrelationsPro[1][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta,mp*dMult-mq);\r
- // histogram to store <2'> for POIs e-b-e (needed in some other methods):\r
- fDiffFlowCorrelationsEBE[1][pe][0]->SetBinContent(b,two1n1nPtEta); \r
- fDiffFlowEventWeightsForCorrelationsEBE[1][pe][0]->SetBinContent(b,mp*dMult-mq); \r
- }\r
- else if(type == "RP") // to be improved (I do not this if)\r
- {\r
- // profile to get <<2'>> for RPs:\r
- fDiffFlowCorrelationsPro[0][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta,mp*dMult-mq);\r
- // histogram to store <2'> for RPs e-b-e (needed in some other methods):\r
- fDiffFlowCorrelationsEBE[0][pe][0]->SetBinContent(b,two1n1nPtEta); \r
- fDiffFlowEventWeightsForCorrelationsEBE[0][pe][0]->SetBinContent(b,mp*dMult-mq); \r
- }\r
- } // end of if(mp*dMult-mq)\r
- \r
- // 4'-particle correlation:\r
- Double_t four1n1n1n1nPtEta = 0.;\r
- if((mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
- + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression)\r
- {\r
- four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n)\r
- - q2n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.))\r
- - 2.*q2n0kIm*dReQ1n*dImQ1n\r
- - p1n0kRe*(dReQ1n*dReQ2n+dImQ1n*dImQ2n)\r
- + p1n0kIm*(dImQ1n*dReQ2n-dReQ1n*dImQ2n)\r
- - 2.*dMult*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n)\r
- - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*mq \r
- + 6.*(q1n0kRe*dReQ1n+q1n0kIm*dImQ1n) \r
- + 1.*(q2n0kRe*dReQ2n+q2n0kIm*dImQ2n) \r
- + 2.*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) \r
- + 2.*mq*dMult \r
- - 6.*mq) \r
- / ((mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
- + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); \r
- \r
- if(type == "POI")\r
- {\r
- // profile to get <<4'>> for POIs:\r
- fDiffFlowCorrelationsPro[1][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta,\r
- (mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
- + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); \r
- // histogram to store <4'> for POIs e-b-e (needed in some other methods):\r
- fDiffFlowCorrelationsEBE[1][pe][1]->SetBinContent(b,four1n1n1n1nPtEta); \r
- fDiffFlowEventWeightsForCorrelationsEBE[1][pe][1]->SetBinContent(b,(mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
- + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); \r
- }\r
- else if(type == "RP")\r
- {\r
- // profile to get <<4'>> for RPs:\r
- fDiffFlowCorrelationsPro[0][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta,\r
- (mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
- + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); \r
- // histogram to store <4'> for RPs e-b-e (needed in some other methods):\r
- fDiffFlowCorrelationsEBE[0][pe][1]->SetBinContent(b,four1n1n1n1nPtEta); \r
- fDiffFlowEventWeightsForCorrelationsEBE[0][pe][1]->SetBinContent(b,(mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
- + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); \r
- }\r
- } // end of if((mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
- // +mq*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
- \r
- } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- \r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelations(TString type, TString ptOrEta);\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfEventWeights(TString type, TString ptOrEta)\r
-{\r
- // Calculate sums of various event weights for reduced correlations. \r
- // (These quantitites are needed in expressions for unbiased estimators relevant for the statistical errors.)\r
-\r
- Int_t typeFlag = -1;\r
- Int_t ptEtaFlag = -1;\r
-\r
- if(type == "RP")\r
- {\r
- typeFlag = 0;\r
- } else if(type == "POI")\r
- {\r
- typeFlag = 1;\r
- } \r
- \r
- if(ptOrEta == "Pt")\r
- {\r
- ptEtaFlag = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- ptEtaFlag = 1;\r
- } \r
- \r
- // shortcuts:\r
- Int_t t = typeFlag;\r
- Int_t pe = ptEtaFlag;\r
- \r
- // binning:\r
- Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
- Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
- //Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
- Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
- \r
- for(Int_t rpq=0;rpq<3;rpq++)\r
- {\r
- for(Int_t m=0;m<4;m++)\r
- {\r
- for(Int_t k=0;k<9;k++)\r
- {\r
- if(!fReRPQ1dEBE[rpq][pe][m][k])\r
- {\r
- cout<<"WARNING: fReRPQ1dEBE[rpq][pe][m][k] is NULL in AFAWQC::CSAPOEWFDF() !!!!"<<endl;\r
- cout<<"pe = "<<pe<<endl;\r
- cout<<"rpq = "<<rpq<<endl;\r
- cout<<"m = "<<m<<endl;\r
- cout<<"k = "<<k<<endl;\r
- exit(0); \r
- }\r
- }\r
- }\r
- } \r
-\r
- // multiplicities:\r
- Double_t dMult = (*fSMpk)(0,0); // total event multiplicity\r
- //Double_t mr = 0.; // number of RPs in particular pt or eta bin\r
- Double_t mp = 0.; // number of POIs in particular pt or eta bin \r
- Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin\r
- \r
- // event weights for reduced correlations:\r
- Double_t dw2 = 0.; // event weight for <2'>\r
- Double_t dw4 = 0.; // event weight for <4'>\r
- //Double_t dw6 = 0.; // event weight for <6'>\r
- //Double_t dw8 = 0.; // event weight for <8'>\r
-\r
- // looping over bins:\r
- for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- {\r
- if(type == "RP")\r
- {\r
- mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b);\r
- mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow\r
- } else if(type == "POI")\r
- {\r
- mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b);\r
- mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); \r
- }\r
- \r
- // event weight for <2'>:\r
- dw2 = mp*dMult-mq; \r
- fDiffFlowSumOfEventWeights[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2);\r
- fDiffFlowSumOfEventWeights[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw2,2.));\r
- \r
- // event weight for <4'>:\r
- dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
- + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); \r
- fDiffFlowSumOfEventWeights[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4);\r
- fDiffFlowSumOfEventWeights[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw4,2.));\r
- \r
- // event weight for <6'>:\r
- //dw6 = ...; \r
- //fDiffFlowSumOfEventWeights[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6);\r
- //fDiffFlowSumOfEventWeights[t][pe][t][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw6,2.));\r
- \r
- // event weight for <8'>:\r
- //dw8 = ...; \r
- //fDiffFlowSumOfEventWeights[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw8);\r
- //fDiffFlowSumOfEventWeights[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw8,2.)); \r
- } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) \r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfEventWeights()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfProductOfEventWeights(TString type, TString ptOrEta)\r
-{\r
- // Calculate sum of products of various event weights for both types of correlations (the ones for int. and diff. flow). \r
- // (These quantitites are needed in expressions for unbiased estimators relevant for the statistical errors.)\r
- //\r
- // Important: To fill fDiffFlowSumOfProductOfEventWeights[][][][] use bellow table (i,j) with following constraints: \r
- // 1.) i<j \r
- // 2.) do not store terms which DO NOT include reduced correlations;\r
- // Table:\r
- // [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] x [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>]\r
- \r
- Int_t typeFlag = -1;\r
- Int_t ptEtaFlag = -1;\r
-\r
- if(type == "RP")\r
- {\r
- typeFlag = 0;\r
- } else if(type == "POI")\r
- {\r
- typeFlag = 1;\r
- } \r
- \r
- if(ptOrEta == "Pt")\r
- {\r
- ptEtaFlag = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- ptEtaFlag = 1;\r
- } \r
- \r
- // shortcuts:\r
- Int_t t = typeFlag;\r
- Int_t pe = ptEtaFlag;\r
- \r
- // binning:\r
- Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
- Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
- //Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
- Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
- \r
- // protection:\r
- for(Int_t rpq=0;rpq<3;rpq++)\r
- {\r
- for(Int_t m=0;m<4;m++)\r
- {\r
- for(Int_t k=0;k<9;k++)\r
- {\r
- if(!fReRPQ1dEBE[rpq][pe][m][k])\r
- {\r
- cout<<"WARNING: fReRPQ1dEBE[rpq][pe][m][k] is NULL in AFAWQC::CSAPOEWFDF() !!!!"<<endl;\r
- cout<<"pe = "<<pe<<endl;\r
- cout<<"rpq = "<<rpq<<endl;\r
- cout<<"m = "<<m<<endl;\r
- cout<<"k = "<<k<<endl;\r
- exit(0); \r
- }\r
- }\r
- }\r
- } \r
- \r
- // multiplicities:\r
- Double_t dMult = (*fSMpk)(0,0); // total event multiplicity\r
- //Double_t mr = 0.; // number of RPs in particular pt or eta bin\r
- Double_t mp = 0.; // number of POIs in particular pt or eta bin \r
- Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin\r
- \r
- // event weights for correlations:\r
- Double_t dW2 = dMult*(dMult-1); // event weight for <2> \r
- Double_t dW4 = dMult*(dMult-1)*(dMult-2)*(dMult-3); // event weight for <4> \r
- Double_t dW6 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5); // event weight for <6> \r
- Double_t dW8 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)*(dMult-6)*(dMult-7); // event weight for <8> \r
-\r
- // event weights for reduced correlations:\r
- Double_t dw2 = 0.; // event weight for <2'>\r
- Double_t dw4 = 0.; // event weight for <4'>\r
- //Double_t dw6 = 0.; // event weight for <6'>\r
- //Double_t dw8 = 0.; // event weight for <8'>\r
- \r
- // looping over bins:\r
- for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- {\r
- if(type == "RP")\r
- {\r
- mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b);\r
- mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow\r
- } else if(type == "POI")\r
- {\r
- mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b);\r
- mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); \r
- }\r
- \r
- // event weight for <2'>:\r
- dw2 = mp*dMult-mq; \r
- fDiffFlowSumOfProductOfEventWeights[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw2); // storing product of even weights for <2> and <2'>\r
- fDiffFlowSumOfProductOfEventWeights[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW4); // storing product of even weights for <4> and <2'>\r
- fDiffFlowSumOfProductOfEventWeights[t][pe][1][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW6); // storing product of even weights for <6> and <2'>\r
- fDiffFlowSumOfProductOfEventWeights[t][pe][1][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW8); // storing product of even weights for <8> and <2'>\r
- \r
- // event weight for <4'>:\r
- dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
- + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); \r
- fDiffFlowSumOfProductOfEventWeights[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw4); // storing product of even weights for <2> and <4'>\r
- fDiffFlowSumOfProductOfEventWeights[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw4); // storing product of even weights for <2'> and <4'>\r
- fDiffFlowSumOfProductOfEventWeights[t][pe][2][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw4); // storing product of even weights for <4> and <4'>\r
- fDiffFlowSumOfProductOfEventWeights[t][pe][3][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dW6); // storing product of even weights for <6> and <4'> \r
- fDiffFlowSumOfProductOfEventWeights[t][pe][3][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dW8); // storing product of even weights for <8> and <4'>\r
-\r
- // event weight for <6'>:\r
- //dw6 = ...; \r
- //fDiffFlowSumOfProductOfEventWeights[t][pe][0][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw6); // storing product of even weights for <2> and <6'>\r
- //fDiffFlowSumOfProductOfEventWeights[t][pe][1][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw6); // storing product of even weights for <2'> and <6'>\r
- //fDiffFlowSumOfProductOfEventWeights[t][pe][2][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw6); // storing product of even weights for <4> and <6'>\r
- //fDiffFlowSumOfProductOfEventWeights[t][pe][3][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dw6); // storing product of even weights for <4'> and <6'> \r
- //fDiffFlowSumOfProductOfEventWeights[t][pe][4][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW6*dw6); // storing product of even weights for <6> and <6'>\r
- //fDiffFlowSumOfProductOfEventWeights[t][pe][5][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dW8); // storing product of even weights for <6'> and <8>\r
- //fDiffFlowSumOfProductOfEventWeights[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dw8); // storing product of even weights for <6'> and <8'>\r
-\r
- // event weight for <8'>:\r
- //dw8 = ...; \r
- //fDiffFlowSumOfProductOfEventWeights[t][pe][0][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw8); // storing product of even weights for <2> and <8'>\r
- //fDiffFlowSumOfProductOfEventWeights[t][pe][1][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw8); // storing product of even weights for <2'> and <8'>\r
- //fDiffFlowSumOfProductOfEventWeights[t][pe][2][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw8); // storing product of even weights for <4> and <8'>\r
- //fDiffFlowSumOfProductOfEventWeights[t][pe][3][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dw8); // storing product of even weights for <4'> and <8'> \r
- //fDiffFlowSumOfProductOfEventWeights[t][pe][4][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW6*dw8); // storing product of even weights for <6> and <8'>\r
- //fDiffFlowSumOfProductOfEventWeights[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dw8); // storing product of even weights for <6'> and <8'>\r
- //fDiffFlowSumOfProductOfEventWeights[t][pe][6][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW8*dw8); // storing product of even weights for <8> and <8'>\r
- \r
- // Table:\r
- // [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] x [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>]\r
- \r
- } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- \r
-\r
-\r
-} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfProductOfEventWeights(TString type, TString ptOrEta)\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::FinalizeReducedCorrelations(TString type, TString ptOrEta)\r
-{\r
- // Transfer profiles into histograms and calculate statistical errors correctly.\r
-\r
- Int_t typeFlag = -1;\r
- Int_t ptEtaFlag = -1;\r
-\r
- if(type == "RP")\r
- {\r
- typeFlag = 0;\r
- } else if(type == "POI")\r
- {\r
- typeFlag = 1;\r
- } \r
- \r
- if(ptOrEta == "Pt")\r
- {\r
- ptEtaFlag = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- ptEtaFlag = 1;\r
- } \r
- \r
- // shortcuts:\r
- Int_t t = typeFlag;\r
- Int_t pe = ptEtaFlag;\r
- \r
- for(Int_t rci=0;rci<4;rci++)\r
- {\r
- if(!fDiffFlowCorrelationsPro[t][pe][rci])\r
- {\r
- cout<<"WARNING: fDiffFlowCorrelationsPro[t][pe][rci] is NULL in AFAWQC::FRC() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl; \r
- cout<<"pe = "<<pe<<endl; \r
- cout<<"rci = "<<rci<<endl;\r
- exit(0); \r
- }\r
- for(Int_t power=0;power<2;power++)\r
- {\r
- if(!fDiffFlowSumOfEventWeights[t][pe][power][rci])\r
- {\r
- cout<<"WARNING: fDiffFlowSumOfEventWeights[t][pe][power][rci] is NULL in AFAWQC::FRC() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl; \r
- cout<<"pe = "<<pe<<endl;\r
- cout<<"power = "<<power<<endl; \r
- cout<<"rci = "<<rci<<endl;\r
- exit(0); \r
- } \r
- } // end of for(Int_t power=0;power<2;power++)\r
- } // end of for(Int_t rci=0;rci<4;rci++)\r
- \r
- // common:\r
- Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
- \r
- // transfer 1D profile into 1D histogram:\r
- Double_t correlation = 0.;\r
- Double_t spread = 0.;\r
- Double_t sumOfWeights = 0.; // sum of weights for particular reduced correlations for particular pt or eta bin\r
- Double_t sumOfSquaredWeights = 0.; // sum of squared weights for particular reduced correlations for particular pt or eta bin\r
- Double_t error = 0.; // error = termA * spread * termB\r
- // termA = (sqrt(sumOfSquaredWeights)/sumOfWeights) \r
- // termB = 1/pow(1-termA^2,0.5)\r
- Double_t termA = 0.; \r
- Double_t termB = 0.; \r
- for(Int_t rci=0;rci<4;rci++) // index of reduced correlation\r
- {\r
- for(Int_t b=1;b<=nBinsPtEta[pe];b++) // number of pt or eta bins\r
- {\r
- correlation = fDiffFlowCorrelationsPro[t][pe][rci]->GetBinContent(b); \r
- spread = fDiffFlowCorrelationsPro[t][pe][rci]->GetBinError(b);\r
- sumOfWeights = fDiffFlowSumOfEventWeights[t][pe][0][rci]->GetBinContent(b);\r
- sumOfSquaredWeights = fDiffFlowSumOfEventWeights[t][pe][1][rci]->GetBinContent(b);\r
- if(sumOfWeights) termA = (pow(sumOfSquaredWeights,0.5)/sumOfWeights);\r
- if(1.-pow(termA,2.)>0.) termB = 1./pow(1.-pow(termA,2.),0.5); \r
- error = termA*spread*termB; // final error (unbiased estimator for standard deviation)\r
- fDiffFlowCorrelationsHist[t][pe][rci]->SetBinContent(b,correlation); \r
- fDiffFlowCorrelationsHist[t][pe][rci]->SetBinError(b,error); \r
- } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- } // end of for(Int_t rci=0;rci<4;rci++)\r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::FinalizeReducedCorrelations(TString type, TString ptOrEta)\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateDiffFlowProductOfCorrelations(TString type, TString ptOrEta)\r
-{\r
- // store products: <2><2'>, <2><4'>, <2><6'>, <2><8'>, <2'><4>, \r
- // <2'><4'>, <2'><6>, <2'><6'>, <2'><8>, <2'><8'>,\r
- // <4><4'>, <4><6'>, <4><8'>, <4'><6>, <4'><6'>, \r
- // <4'><8>, <4'><8'>, <6><6'>, <6><8'>, <6'><8>, \r
- // <6'><8'>, <8><8'>.\r
- \r
- Int_t typeFlag = -1;\r
- Int_t ptEtaFlag = -1;\r
-\r
- if(type == "RP")\r
- {\r
- typeFlag = 0;\r
- } else if(type == "POI")\r
- {\r
- typeFlag = 1;\r
- } \r
- \r
- if(ptOrEta == "Pt")\r
- {\r
- ptEtaFlag = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- ptEtaFlag = 1;\r
- } \r
- \r
- // shortcuts:\r
- Int_t t = typeFlag;\r
- Int_t pe = ptEtaFlag;\r
- \r
- // common:\r
- Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
- Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
- Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
- \r
- // protections // to be improved (add protection for all pointers in this method)\r
- if(!fIntFlowCorrelationsEBE)\r
- {\r
- cout<<"WARNING: fIntFlowCorrelationsEBE is NULL in AFAWQC::CDFPOC() !!!!"<<endl;\r
- exit(0);\r
- } \r
- \r
- /* \r
- Double_t dMult = (*fSMpk)(0,0); // multiplicity (number of particles used to determine the reaction plane)\r
- //Double_t mr = 0.; // number of RPs in particular pt or eta bin\r
- Double_t mp = 0.; // number of POIs in particular pt or eta bin \r
- Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin\r
- */\r
-\r
- // e-b-e correlations:\r
- Double_t twoEBE = fIntFlowCorrelationsEBE->GetBinContent(1); // <2>\r
- Double_t fourEBE = fIntFlowCorrelationsEBE->GetBinContent(2); // <4>\r
- Double_t sixEBE = fIntFlowCorrelationsEBE->GetBinContent(3); // <6>\r
- Double_t eightEBE = fIntFlowCorrelationsEBE->GetBinContent(4); // <8>\r
- \r
- // event weights for correlations:\r
- Double_t dW2 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1); // event weight for <2> \r
- Double_t dW4 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2); // event weight for <4> \r
- Double_t dW6 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(3); // event weight for <6> \r
- Double_t dW8 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(4); // event weight for <8> \r
- \r
- // e-b-e reduced correlations:\r
- Double_t twoReducedEBE = 0.; // <2'>\r
- Double_t fourReducedEBE = 0.; // <4'>\r
- Double_t sixReducedEBE = 0.; // <6'>\r
- Double_t eightReducedEBE = 0.; // <8'> \r
- \r
- // event weights for reduced correlations:\r
- Double_t dw2 = 0.; // event weight for <2'>\r
- Double_t dw4 = 0.; // event weight for <4'>\r
- //Double_t dw6 = 0.; // event weight for <6'>\r
- //Double_t dw8 = 0.; // event weight for <8'>\r
-\r
- // looping over bins:\r
- for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- {\r
- // e-b-e reduced correlations:\r
- twoReducedEBE = fDiffFlowCorrelationsEBE[t][pe][0]->GetBinContent(b);\r
- fourReducedEBE = fDiffFlowCorrelationsEBE[t][pe][1]->GetBinContent(b);\r
- sixReducedEBE = fDiffFlowCorrelationsEBE[t][pe][2]->GetBinContent(b);\r
- eightReducedEBE = fDiffFlowCorrelationsEBE[t][pe][3]->GetBinContent(b);\r
- \r
- /*\r
- // to be improved (I should not do this here again)\r
- if(type == "RP")\r
- {\r
- mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b);\r
- mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow\r
- } else if(type == "POI")\r
- {\r
- mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b);\r
- mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); \r
- }\r
- \r
- // event weights for reduced correlations:\r
- dw2 = mp*dMult-mq; // weight for <2'> \r
- dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
- + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); // weight for <4'>\r
- //dw6 = ... \r
- //dw8 = ... \r
- \r
- */\r
- \r
- dw2 = fDiffFlowEventWeightsForCorrelationsEBE[t][pe][0]->GetBinContent(b);\r
- dw4 = fDiffFlowEventWeightsForCorrelationsEBE[t][pe][1]->GetBinContent(b);\r
- \r
- // storing all products:\r
- fDiffFlowProductOfCorrelationsPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*twoReducedEBE,dW2*dw2); // storing <2><2'>\r
- fDiffFlowProductOfCorrelationsPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*twoReducedEBE,dW4*dw2); // storing <4><2'>\r
- fDiffFlowProductOfCorrelationsPro[t][pe][1][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*twoReducedEBE,dW6*dw2); // storing <6><2'>\r
- fDiffFlowProductOfCorrelationsPro[t][pe][1][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*twoReducedEBE,dW8*dw2); // storing <8><2'>\r
- \r
- // event weight for <4'>:\r
- fDiffFlowProductOfCorrelationsPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*fourReducedEBE,dW2*dw4); // storing <2><4'>\r
- fDiffFlowProductOfCorrelationsPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*fourReducedEBE,dw2*dw4); // storing <2'><4'>\r
- fDiffFlowProductOfCorrelationsPro[t][pe][2][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*fourReducedEBE,dW4*dw4); // storing <4><4'>\r
- fDiffFlowProductOfCorrelationsPro[t][pe][3][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*fourReducedEBE,dW6*dw4); // storing <6><4'> \r
- fDiffFlowProductOfCorrelationsPro[t][pe][3][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*fourReducedEBE,dW8*dw4); // storing <8><4'>\r
-\r
- // event weight for <6'>:\r
- //dw6 = ...; \r
- //fDiffFlowProductOfCorrelationsPro[t][pe][0][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*sixReducedEBE,dW2*dw6); // storing <2><6'>\r
- //fDiffFlowProductOfCorrelationsPro[t][pe][1][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*sixReducedEBE,dw2*dw6); // storing <2'><6'>\r
- //fDiffFlowProductOfCorrelationsPro[t][pe][2][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*sixReducedEBE,dW4*dw6); // storing <4><6'>\r
- //fDiffFlowProductOfCorrelationsPro[t][pe][3][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourReducedEBE*sixReducedEBE,dw4*dw6); // storing <4'><6'> \r
- //fDiffFlowProductOfCorrelationsPro[t][pe][4][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*sixReducedEBE,dW6*dw6); // storing <6><6'>\r
- //fDiffFlowProductOfCorrelationsPro[t][pe][5][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightEBE,dw6*dW8); // storing <6'><8>\r
- //fDiffFlowProductOfCorrelationsPro[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightReducedEBE,dw6*dw8); // storing <6'><8'>\r
-\r
- // event weight for <8'>:\r
- //dw8 = ...; \r
- //fDiffFlowProductOfCorrelationsPro[t][pe][0][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*eightReducedEBE,dW2*dw8); // storing <2><8'>\r
- //fDiffFlowProductOfCorrelationsPro[t][pe][1][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*eightReducedEBE,dw2*dw8); // storing <2'><8'>\r
- //fDiffFlowProductOfCorrelationsPro[t][pe][2][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*eightReducedEBE,dW4*dw8); // storing <4><8'>\r
- //fDiffFlowProductOfCorrelationsPro[t][pe][3][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourReducedEBE*eightReducedEBE,dw4*dw8); // storing <4'><8'> \r
- //fDiffFlowProductOfCorrelationsPro[t][pe][4][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*eightReducedEBE,dW6*dw8); // storing <6><8'>\r
- //fDiffFlowProductOfCorrelationsPro[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightReducedEBE,dw6*dw8); // storing <6'><8'>\r
- //fDiffFlowProductOfCorrelationsPro[t][pe][6][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*eightReducedEBE,dW8*dw8); // storing <8><8'> \r
- } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++ \r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowProductOfCorrelations(TString type, TString ptOrEta)\r
-\r
-\r
-//================================================================================================================================\r
- \r
- \r
-void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCovariances(TString type, TString ptOrEta) // to be improved (reimplemented)\r
-{\r
- // a) Calculate unbiased estimators Cov(<2>,<2'>), Cov(<2>,<4'>), Cov(<4>,<2'>), Cov(<4>,<4'>) and Cov(<2'>,<4'>)\r
- // for covariances V(<2>,<2'>), V(<2>,<4'>), V(<4>,<2'>), V(<4>,<4'>) and V(<2'>,<4'>). \r
- // b) Store in histogram fDiffFlowCovariances[t][pe][index] for instance the following: \r
- //\r
- // Cov(<2>,<2'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)]\r
- // \r
- // where N is the number of events, w_{<2>} is event weight for <2> and w_{<2'>} is event weight for <2'>.\r
- // c) Binning of fDiffFlowCovariances[t][pe][index] is organized as follows:\r
- // \r
- // 1st bin: Cov(<2>,<2'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] \r
- // 2nd bin: Cov(<2>,<4'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] \r
- // 3rd bin: Cov(<4>,<2'>) * (sum_{i=1}^{N} w_{<4>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] \r
- // 4th bin: Cov(<4>,<4'>) * (sum_{i=1}^{N} w_{<4>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] \r
- // 5th bin: Cov(<2'>,<4'>) * (sum_{i=1}^{N} w_{<2'>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<2'>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] \r
- // ...\r
- \r
- Int_t typeFlag = -1;\r
- Int_t ptEtaFlag = -1;\r
-\r
- if(type == "RP")\r
- {\r
- typeFlag = 0;\r
- } else if(type == "POI")\r
- {\r
- typeFlag = 1;\r
- } \r
- \r
- if(ptOrEta == "Pt")\r
- {\r
- ptEtaFlag = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- ptEtaFlag = 1;\r
- } \r
- \r
- // shortcuts:\r
- Int_t t = typeFlag;\r
- Int_t pe = ptEtaFlag;\r
- \r
- // common:\r
- Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
- //Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
- //Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
- //Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
- \r
- // average correlations:\r
- Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>>\r
- Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>>\r
- //Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>>\r
- //Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>>\r
- \r
- // sum of weights for correlation:\r
- Double_t sumOfWeightsForTwo = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // sum_{i=1}^{N} w_{<2>}\r
- Double_t sumOfWeightsForFour = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // sum_{i=1}^{N} w_{<4>}\r
- //Double_t sumOfWeightsForSix = fIntFlowSumOfEventWeights[0]->GetBinContent(3); // sum_{i=1}^{N} w_{<6>}\r
- //Double_t sumOfWeightsForEight = fIntFlowSumOfEventWeights[0]->GetBinContent(4); // sum_{i=1}^{N} w_{<8>}\r
- \r
- // average reduced correlations:\r
- Double_t twoReduced = 0.; // <<2'>> \r
- Double_t fourReduced = 0.; // <<4'>>\r
- //Double_t sixReduced = 0.; // <<6'>>\r
- //Double_t eightReduced = 0.; // <<8'>>\r
-\r
- // sum of weights for reduced correlation:\r
- Double_t sumOfWeightsForTwoReduced = 0.; // sum_{i=1}^{N} w_{<2'>}\r
- Double_t sumOfWeightsForFourReduced = 0.; // sum_{i=1}^{N} w_{<4'>}\r
- //Double_t sumOfWeightsForSixReduced = 0.; // sum_{i=1}^{N} w_{<6'>}\r
- //Double_t sumOfWeightsForEightReduced = 0.; // sum_{i=1}^{N} w_{<8'>}\r
- \r
- // product of weights for reduced correlation:\r
- Double_t productOfWeightsForTwoTwoReduced = 0.; // sum_{i=1}^{N} w_{<2>}w_{<2'>}\r
- Double_t productOfWeightsForTwoFourReduced = 0.; // sum_{i=1}^{N} w_{<2>}w_{<4'>}\r
- Double_t productOfWeightsForFourTwoReduced = 0.; // sum_{i=1}^{N} w_{<4>}w_{<2'>}\r
- Double_t productOfWeightsForFourFourReduced = 0.; // sum_{i=1}^{N} w_{<4>}w_{<4'>}\r
- Double_t productOfWeightsForTwoReducedFourReduced = 0.; // sum_{i=1}^{N} w_{<2'>}w_{<4'>}\r
- // ...\r
- \r
- // products for differential flow:\r
- Double_t twoTwoReduced = 0; // <<2><2'>> \r
- Double_t twoFourReduced = 0; // <<2><4'>> \r
- Double_t fourTwoReduced = 0; // <<4><2'>> \r
- Double_t fourFourReduced = 0; // <<4><4'>> \r
- Double_t twoReducedFourReduced = 0; // <<2'><4'>> \r
-\r
- // denominators in the expressions for the unbiased estimators for covariances:\r
- // denominator = 1 - term1/(term2*term3)\r
- // prefactor = term1/(term2*term3)\r
- Double_t denominator = 0.; \r
- Double_t prefactor = 0.;\r
- Double_t term1 = 0.; \r
- Double_t term2 = 0.; \r
- Double_t term3 = 0.; \r
- \r
- // unbiased estimators for covariances for differential flow:\r
- Double_t covTwoTwoReduced = 0.; // Cov(<2>,<2'>)\r
- Double_t wCovTwoTwoReduced = 0.; // Cov(<2>,<2'>) * prefactor(w_{<2>},w_{<2'>})\r
- Double_t covTwoFourReduced = 0.; // Cov(<2>,<4'>)\r
- Double_t wCovTwoFourReduced = 0.; // Cov(<2>,<4'>) * prefactor(w_{<2>},w_{<4'>})\r
- Double_t covFourTwoReduced = 0.; // Cov(<4>,<2'>)\r
- Double_t wCovFourTwoReduced = 0.; // Cov(<4>,<2'>) * prefactor(w_{<4>},w_{<2'>})\r
- Double_t covFourFourReduced = 0.; // Cov(<4>,<4'>)\r
- Double_t wCovFourFourReduced = 0.; // Cov(<4>,<4'>) * prefactor(w_{<4>},w_{<4'>})\r
- Double_t covTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>)\r
- Double_t wCovTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) * prefactor(w_{<2'>},w_{<4'>})\r
- \r
- for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- {\r
- // average reduced corelations:\r
- twoReduced = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b);\r
- fourReduced = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b);\r
- // average products:\r
- twoTwoReduced = fDiffFlowProductOfCorrelationsPro[t][pe][0][1]->GetBinContent(b);\r
- twoFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][0][3]->GetBinContent(b);\r
- fourTwoReduced = fDiffFlowProductOfCorrelationsPro[t][pe][1][2]->GetBinContent(b);\r
- fourFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][2][3]->GetBinContent(b);\r
- twoReducedFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][1][3]->GetBinContent(b); \r
- // sum of weights for reduced correlations:\r
- sumOfWeightsForTwoReduced = fDiffFlowSumOfEventWeights[t][pe][0][0]->GetBinContent(b);\r
- sumOfWeightsForFourReduced = fDiffFlowSumOfEventWeights[t][pe][0][1]->GetBinContent(b);\r
- // products of weights for correlations:\r
- productOfWeightsForTwoTwoReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][0][1]->GetBinContent(b); \r
- productOfWeightsForTwoFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][0][3]->GetBinContent(b);\r
- productOfWeightsForFourTwoReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][1][2]->GetBinContent(b);\r
- productOfWeightsForFourFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][2][3]->GetBinContent(b);\r
- productOfWeightsForTwoReducedFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][1][3]->GetBinContent(b);\r
- // denominator for the unbiased estimator for covariances: 1 - term1/(term2*term3) \r
- // prefactor (multiplies Cov's) = term1/(term2*term3) \r
- // <2>,<2'>:\r
- term1 = productOfWeightsForTwoTwoReduced; \r
- term2 = sumOfWeightsForTwo;\r
- term3 = sumOfWeightsForTwoReduced; \r
- if(term2*term3>0.)\r
- {\r
- denominator = 1.-term1/(term2*term3);\r
- prefactor = term1/(term2*term3);\r
- if(denominator!=0)\r
- {\r
- covTwoTwoReduced = (twoTwoReduced-two*twoReduced)/denominator; \r
- wCovTwoTwoReduced = covTwoTwoReduced*prefactor; \r
- fDiffFlowCovariances[t][pe][0]->SetBinContent(b,wCovTwoTwoReduced);\r
- }\r
- }\r
- // <2>,<4'>:\r
- term1 = productOfWeightsForTwoFourReduced; \r
- term2 = sumOfWeightsForTwo;\r
- term3 = sumOfWeightsForFourReduced; \r
- if(term2*term3>0.)\r
- {\r
- denominator = 1.-term1/(term2*term3);\r
- prefactor = term1/(term2*term3);\r
- if(denominator!=0)\r
- {\r
- covTwoFourReduced = (twoFourReduced-two*fourReduced)/denominator; \r
- wCovTwoFourReduced = covTwoFourReduced*prefactor; \r
- fDiffFlowCovariances[t][pe][1]->SetBinContent(b,wCovTwoFourReduced);\r
- }\r
- }\r
- // <4>,<2'>:\r
- term1 = productOfWeightsForFourTwoReduced; \r
- term2 = sumOfWeightsForFour;\r
- term3 = sumOfWeightsForTwoReduced; \r
- if(term2*term3>0.)\r
- {\r
- denominator = 1.-term1/(term2*term3);\r
- prefactor = term1/(term2*term3);\r
- if(denominator!=0)\r
- {\r
- covFourTwoReduced = (fourTwoReduced-four*twoReduced)/denominator; \r
- wCovFourTwoReduced = covFourTwoReduced*prefactor; \r
- fDiffFlowCovariances[t][pe][2]->SetBinContent(b,wCovFourTwoReduced);\r
- }\r
- }\r
- // <4>,<4'>:\r
- term1 = productOfWeightsForFourFourReduced; \r
- term2 = sumOfWeightsForFour;\r
- term3 = sumOfWeightsForFourReduced; \r
- if(term2*term3>0.)\r
- {\r
- denominator = 1.-term1/(term2*term3);\r
- prefactor = term1/(term2*term3);\r
- if(denominator!=0)\r
- {\r
- covFourFourReduced = (fourFourReduced-four*fourReduced)/denominator; \r
- wCovFourFourReduced = covFourFourReduced*prefactor; \r
- fDiffFlowCovariances[t][pe][3]->SetBinContent(b,wCovFourFourReduced);\r
- }\r
- }\r
- // <2'>,<4'>:\r
- term1 = productOfWeightsForTwoReducedFourReduced; \r
- term2 = sumOfWeightsForTwoReduced;\r
- term3 = sumOfWeightsForFourReduced; \r
- if(term2*term3>0.)\r
- {\r
- denominator = 1.-term1/(term2*term3);\r
- prefactor = term1/(term2*term3);\r
- if(denominator!=0)\r
- {\r
- covTwoReducedFourReduced = (twoReducedFourReduced-twoReduced*fourReduced)/denominator; \r
- wCovTwoReducedFourReduced = covTwoReducedFourReduced*prefactor; \r
- fDiffFlowCovariances[t][pe][4]->SetBinContent(b,wCovTwoReducedFourReduced);\r
- }\r
- } \r
- } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCovariances(TString type, TString ptOrEta)\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, TString ptOrEta)\r
-{\r
- // calculate differential flow from differential cumulants and previously obtained integrated flow: (to be improved: description)\r
- \r
- Int_t typeFlag = -1;\r
- Int_t ptEtaFlag = -1;\r
-\r
- if(type == "RP")\r
- {\r
- typeFlag = 0;\r
- } else if(type == "POI")\r
- {\r
- typeFlag = 1;\r
- } \r
- \r
- if(ptOrEta == "Pt")\r
- {\r
- ptEtaFlag = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- ptEtaFlag = 1;\r
- } \r
- \r
- // shortcuts:\r
- Int_t t = typeFlag;\r
- Int_t pe = ptEtaFlag;\r
- \r
- // common:\r
- Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
- \r
- // correlations:\r
- Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>>\r
- Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>>\r
- \r
- // statistical errors of correlations:\r
- Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1);\r
- Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); \r
- \r
- // reduced correlations:\r
- Double_t twoReduced = 0.; // <<2'>>\r
- Double_t fourReduced = 0.; // <<4'>>\r
- \r
- // statistical errors of reduced correlations:\r
- Double_t twoReducedError = 0.; \r
- Double_t fourReducedError = 0.; \r
-\r
- // covariances:\r
- Double_t wCovTwoFour = fIntFlowCovariances->GetBinContent(1);// // Cov(<2>,<4>) * prefactor(<2>,<4>)\r
- Double_t wCovTwoTwoReduced = 0.; // Cov(<2>,<2'>) * prefactor(<2>,<2'>)\r
- Double_t wCovTwoFourReduced = 0.; // Cov(<2>,<4'>) * prefactor(<2>,<4'>)\r
- Double_t wCovFourTwoReduced = 0.; // Cov(<4>,<2'>) * prefactor(<4>,<2'>)\r
- Double_t wCovFourFourReduced = 0.; // Cov(<4>,<4'>) * prefactor(<4>,<4'>)\r
- Double_t wCovTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) * prefactor(<2'>,<4'>)\r
- \r
- // differential flow:\r
- Double_t v2Prime = 0.; // v'{2} \r
- Double_t v4Prime = 0.; // v'{4}\r
- \r
- // statistical error of differential flow:\r
- Double_t v2PrimeError = 0.; \r
- Double_t v4PrimeError = 0.; \r
- \r
- // squared statistical error of differential flow:\r
- Double_t v2PrimeErrorSquared = 0.; \r
- Double_t v4PrimeErrorSquared = 0.; \r
- \r
- // loop over pt or eta bins:\r
- for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- {\r
- // reduced correlations and statistical errors:\r
- twoReduced = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b);\r
- twoReducedError = fDiffFlowCorrelationsHist[t][pe][0]->GetBinError(b);\r
- fourReduced = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b);\r
- fourReducedError = fDiffFlowCorrelationsHist[t][pe][1]->GetBinError(b);\r
- // covariances:\r
- wCovTwoTwoReduced = fDiffFlowCovariances[t][pe][0]->GetBinContent(b);\r
- wCovTwoFourReduced = fDiffFlowCovariances[t][pe][1]->GetBinContent(b);\r
- wCovFourTwoReduced = fDiffFlowCovariances[t][pe][2]->GetBinContent(b);\r
- wCovFourFourReduced = fDiffFlowCovariances[t][pe][3]->GetBinContent(b);\r
- wCovTwoReducedFourReduced = fDiffFlowCovariances[t][pe][4]->GetBinContent(b);\r
- // differential flow:\r
- // v'{2}:\r
- if(two>0.) \r
- {\r
- v2Prime = twoReduced/pow(two,0.5);\r
- v2PrimeErrorSquared = (1./4.)*pow(two,-3.)*\r
- (pow(twoReduced,2.)*pow(twoError,2.)\r
- + 4.*pow(two,2.)*pow(twoReducedError,2.)\r
- - 4.*two*twoReduced*wCovTwoTwoReduced);\r
- \r
- \r
- if(v2PrimeErrorSquared>0.) v2PrimeError = pow(v2PrimeErrorSquared,0.5);\r
- fDiffFlow[t][pe][0]->SetBinContent(b,v2Prime); \r
- fDiffFlow[t][pe][0]->SetBinError(b,v2PrimeError); \r
- }\r
- // differential flow:\r
- // v'{4}\r
- if(2.*pow(two,2.)-four > 0.) \r
- {\r
- v4Prime = (2.*two*twoReduced-fourReduced)/pow(2.*pow(two,2.)-four,3./4.);\r
- v4PrimeErrorSquared = pow(2.*pow(two,2.)-four,-7./2.)*\r
- (pow(2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced,2.)*pow(twoError,2.)\r
- + (9./16.)*pow(2.*two*twoReduced-fourReduced,2.)*pow(fourError,2.)\r
- + 4.*pow(two,2.)*pow(2.*pow(two,2.)-four,2.)*pow(twoReducedError,2.)\r
- + pow(2.*pow(two,2.)-four,2.)*pow(fourReducedError,2.) \r
- - (3./2.)*(2.*two*twoReduced-fourReduced)\r
- * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoFour\r
- - 4.*two*(2.*pow(two,2.)-four)\r
- * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoTwoReduced\r
- + 2.*(2.*pow(two,2.)-four)\r
- * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoFourReduced\r
- + 3.*two*(2.*pow(two,2.)-four)*(2.*two*twoReduced-fourReduced)*wCovFourTwoReduced\r
- - (3./2.)*(2.*pow(two,2.)-four)*(2.*two*twoReduced-fourReduced)*wCovFourFourReduced \r
- - 4.*two*pow(2.*pow(two,2.)-four,2.)*wCovTwoReducedFourReduced); \r
- if(v4PrimeErrorSquared>0.) v4PrimeError = pow(v4PrimeErrorSquared,0.5); \r
- fDiffFlow[t][pe][1]->SetBinContent(b,v4Prime);\r
- fDiffFlow[t][pe][1]->SetBinError(b,v4PrimeError); \r
- }\r
- \r
- } // end of for(Int_t b=1;b<=fnBinsPtEta[pe];b++)\r
- \r
- \r
- \r
- \r
- /*\r
- // 2D:\r
- for(Int_t nua=0;nua<2;nua++)\r
- {\r
- for(Int_t p=1;p<=fnBinsPt;p++)\r
- {\r
- for(Int_t e=1;e<=fnBinsEta;e++) \r
- { \r
- // differential cumulants:\r
- Double_t qc2Prime = fFinalCumulants2D[t][pW][eW][nua][0]->GetBinContent(fFinalCumulants2D[t][pW][eW][nua][0]->GetBin(p,e)); // QC{2'} \r
- Double_t qc4Prime = fFinalCumulants2D[t][pW][eW][nua][1]->GetBinContent(fFinalCumulants2D[t][pW][eW][nua][1]->GetBin(p,e)); // QC{4'}\r
- // differential flow:\r
- Double_t v2Prime = 0.; \r
- Double_t v4Prime = 0.; \r
- if(v2) \r
- {\r
- v2Prime = qc2Prime/v2;\r
- fFinalFlow2D[t][pW][eW][nua][0]->SetBinContent(fFinalFlow2D[t][pW][eW][nua][0]->GetBin(p,e),v2Prime); \r
- } \r
- if(v4)\r
- {\r
- v4Prime = -qc4Prime/pow(v4,3.); \r
- fFinalFlow2D[t][pW][eW][nua][1]->SetBinContent(fFinalFlow2D[t][pW][eW][nua][1]->GetBin(p,e),v4Prime); \r
- } \r
- } // end of for(Int_t e=1;e<=fnBinsEta;e++)\r
- } // end of for(Int_t p=1;p<=fnBinsPt;p++)\r
- } // end of for(Int_t nua=0;nua<2;nua++)\r
- */\r
-\r
-} // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, Bool_t useParticleWeights)\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::StoreIntFlowFlags()\r
-{\r
- // a) Store all flags for integrated flow in profile fIntFlowFlags.\r
- \r
- if(!fIntFlowFlags)\r
- {\r
- cout<<"WARNING: fIntFlowFlags is NULL in AFAWQC::SFFIF() !!!!"<<endl;\r
- exit(0);\r
- } \r
-\r
- fIntFlowFlags->Fill(0.5,(Int_t)fUsePhiWeights||fUsePtWeights||fUseEtaWeights); // particle weights used or not\r
- //fIntFlowFlags->Fill(1.5,""); // which event weight was used? // to be improved\r
- fIntFlowFlags->Fill(2.5,(Int_t)fApplyCorrectionForNUA); // corrected for non-uniform acceptance or not\r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::StoreIntFlowFlags()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::StoreDiffFlowFlags()\r
-{\r
- // Store all flags for differential flow in the profile fDiffFlowFlags.\r
- \r
- if(!fDiffFlowFlags)\r
- {\r
- cout<<"WARNING: fDiffFlowFlags is NULL in AFAWQC::SFFDF() !!!!"<<endl;\r
- exit(0);\r
- } \r
- \r
- fDiffFlowFlags->Fill(0.5,fUsePhiWeights||fUsePtWeights||fUseEtaWeights); // particle weights used or not\r
- //fDiffFlowFlags->Fill(1.5,""); // which event weight was used? // to be improved\r
- fDiffFlowFlags->Fill(2.5,fApplyCorrectionForNUA); // corrected for non-uniform acceptance or not\r
- fDiffFlowFlags->Fill(3.5,fCalculate2DFlow); // calculate also 2D differential flow in (pt,eta) or not\r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::StoreDiffFlowFlags()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::GetPointersForCommonHistograms(TList *outputListHistos) \r
-{\r
- // Access all pointers to common control and common result histograms and profiles.\r
- \r
- if(outputListHistos) \r
- {\r
- TString commonHistsName = "AliFlowCommonHistQC";\r
- commonHistsName += fAnalysisLabel->Data();\r
- AliFlowCommonHist *commonHist = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject(commonHistsName.Data()));\r
- if(commonHist) this->SetCommonHists(commonHist); \r
- TString commonHists2ndOrderName = "AliFlowCommonHist2ndOrderQC";\r
- commonHists2ndOrderName += fAnalysisLabel->Data();\r
- AliFlowCommonHist *commonHist2nd = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject(commonHists2ndOrderName.Data()));\r
- if(commonHist2nd) this->SetCommonHists2nd(commonHist2nd); \r
- TString commonHists4thOrderName = "AliFlowCommonHist4thOrderQC";\r
- commonHists4thOrderName += fAnalysisLabel->Data();\r
- AliFlowCommonHist *commonHist4th = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject(commonHists4thOrderName.Data()));\r
- if(commonHist4th) this->SetCommonHists4th(commonHist4th); \r
- TString commonHists6thOrderName = "AliFlowCommonHist6thOrderQC";\r
- commonHists6thOrderName += fAnalysisLabel->Data();\r
- AliFlowCommonHist *commonHist6th = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject(commonHists6thOrderName.Data()));\r
- if(commonHist6th) this->SetCommonHists6th(commonHist6th); \r
- TString commonHists8thOrderName = "AliFlowCommonHist8thOrderQC";\r
- commonHists8thOrderName += fAnalysisLabel->Data();\r
- AliFlowCommonHist *commonHist8th = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject(commonHists8thOrderName.Data()));\r
- if(commonHist8th) this->SetCommonHists8th(commonHist8th); \r
- TString commonHistResults2ndOrderName = "AliFlowCommonHistResults2ndOrderQC"; \r
- commonHistResults2ndOrderName += fAnalysisLabel->Data(); \r
- AliFlowCommonHistResults *commonHistRes2nd = dynamic_cast<AliFlowCommonHistResults*>\r
- (outputListHistos->FindObject(commonHistResults2ndOrderName.Data()));\r
- if(commonHistRes2nd) this->SetCommonHistsResults2nd(commonHistRes2nd); \r
- TString commonHistResults4thOrderName = "AliFlowCommonHistResults4thOrderQC";\r
- commonHistResults4thOrderName += fAnalysisLabel->Data();\r
- AliFlowCommonHistResults *commonHistRes4th = dynamic_cast<AliFlowCommonHistResults*>\r
- (outputListHistos->FindObject(commonHistResults4thOrderName.Data()));\r
- if(commonHistRes4th) this->SetCommonHistsResults4th(commonHistRes4th); \r
- TString commonHistResults6thOrderName = "AliFlowCommonHistResults6thOrderQC";\r
- commonHistResults6thOrderName += fAnalysisLabel->Data();\r
- AliFlowCommonHistResults *commonHistRes6th = dynamic_cast<AliFlowCommonHistResults*>\r
- (outputListHistos->FindObject(commonHistResults6thOrderName.Data()));\r
- if(commonHistRes6th) this->SetCommonHistsResults6th(commonHistRes6th); \r
- TString commonHistResults8thOrderName = "AliFlowCommonHistResults8thOrderQC";\r
- commonHistResults8thOrderName += fAnalysisLabel->Data();\r
- AliFlowCommonHistResults *commonHistRes8th = dynamic_cast<AliFlowCommonHistResults*>\r
- (outputListHistos->FindObject(commonHistResults8thOrderName.Data())); \r
- if(commonHistRes8th) this->SetCommonHistsResults8th(commonHistRes8th);\r
- } else\r
- {\r
- cout<<"WARNING: outputListHistos is NULL in AFAWQC::GPFCH() !!!!"<<endl;\r
- exit(0);\r
- }\r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::GetPointersForCommonHistograms(TList *outputListHistos) \r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::GetPointersForParticleWeightsHistograms(TList *outputListHistos) \r
-{\r
- // Get pointers for histograms with particle weights.\r
-\r
- if(outputListHistos)\r
- {\r
- TList *weightsList = dynamic_cast<TList*>(outputListHistos->FindObject("Weights"));\r
- if(weightsList) this->SetWeightsList(weightsList);\r
- TString fUseParticleWeightsName = "fUseParticleWeightsQC"; // to be improved (hirdwired label QC)\r
- fUseParticleWeightsName += fAnalysisLabel->Data();\r
- TProfile *useParticleWeights = dynamic_cast<TProfile*>(weightsList->FindObject(fUseParticleWeightsName.Data()));\r
- if(useParticleWeights)\r
- {\r
- this->SetUseParticleWeights(useParticleWeights); \r
- fUsePhiWeights = (Int_t)fUseParticleWeights->GetBinContent(1); \r
- fUsePtWeights = (Int_t)fUseParticleWeights->GetBinContent(2); \r
- fUseEtaWeights = (Int_t)fUseParticleWeights->GetBinContent(3); \r
- }\r
- } else\r
- {\r
- cout<<"WARNING: outputListHistos is NULL in AFAWQC::GPFPWH() !!!!"<<endl;\r
- exit(0);\r
- }\r
-\r
-} // end of void AliFlowAnalysisWithQCumulants::GetPointersForParticleWeightsHistograms(TList *outputListHistos); \r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::GetPointersForIntFlowHistograms(TList *outputListHistos) \r
-{\r
- // Get pointers for histograms and profiles relevant for integrated flow:\r
- // a) Get pointer to base list for integrated flow holding profile fIntFlowFlags and lists fIntFlowProfiles and fIntFlowResults.\r
- // b) Get pointer to profile fIntFlowFlags holding all flags for integrated flow.\r
- // c) Get pointer to list fIntFlowProfiles and pointers to all objects that she holds. \r
- // d) Get pointer to list fIntFlowResults and pointers to all objects that she holds. \r
- \r
- TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data member?)\r
- TString powerFlag[2] = {"linear","quadratic"}; // to be improved (should I promote this to data member?)\r
- \r
- if(outputListHistos)\r
- {\r
- // a) Get pointer to base list for integrated flow holding profile fIntFlowFlags and lists fIntFlowProfiles and fIntFlowResults:\r
- TList *intFlowList = NULL;\r
- intFlowList = dynamic_cast<TList*>(outputListHistos->FindObject("Integrated Flow"));\r
- if(!intFlowList) \r
- {\r
- cout<<"WARNING: intFlowList is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
- exit(0); \r
- } \r
- \r
- // b) Get pointer to profile fIntFlowFlags holding all flags for integrated flow:\r
- TString intFlowFlagsName = "fIntFlowFlags";\r
- intFlowFlagsName += fAnalysisLabel->Data();\r
- TProfile *intFlowFlags = dynamic_cast<TProfile*>(intFlowList->FindObject(intFlowFlagsName.Data()));\r
- Bool_t bApplyCorrectionForNUA = kFALSE;\r
- if(intFlowFlags)\r
- {\r
- this->SetIntFlowFlags(intFlowFlags); \r
- bApplyCorrectionForNUA = (Int_t)intFlowFlags->GetBinContent(3); \r
- this->SetApplyCorrectionForNUA(bApplyCorrectionForNUA); \r
- } else \r
- {\r
- cout<<"WARNING: intFlowFlags is NULL in FAWQC::GPFIFH() !!!!"<<endl;\r
- }\r
- \r
- // c) Get pointer to list fIntFlowProfiles and pointers to all objects that she holds:\r
- TList *intFlowProfiles = NULL;\r
- intFlowProfiles = dynamic_cast<TList*>(intFlowList->FindObject("Profiles"));\r
- if(intFlowProfiles) \r
- {\r
- // average multiplicities:\r
- TString avMultiplicityName = "fAvMultiplicity";\r
- avMultiplicityName += fAnalysisLabel->Data();\r
- TProfile *avMultiplicity = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(avMultiplicityName.Data()));\r
- if(avMultiplicity) \r
- {\r
- this->SetAvMultiplicity(avMultiplicity);\r
- } else \r
- {\r
- cout<<"WARNING: avMultiplicity is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
- }\r
- // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with wrong errors!):\r
- TString intFlowCorrelationsProName = "fIntFlowCorrelationsPro";\r
- intFlowCorrelationsProName += fAnalysisLabel->Data();\r
- TProfile *intFlowCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowCorrelationsProName.Data()));\r
- if(intFlowCorrelationsPro) \r
- {\r
- this->SetIntFlowCorrelationsPro(intFlowCorrelationsPro);\r
- } else \r
- {\r
- cout<<"WARNING: intFlowCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
- } \r
- // average all correlations for integrated flow (with wrong errors!):\r
- TString intFlowCorrelationsAllProName = "fIntFlowCorrelationsAllPro";\r
- intFlowCorrelationsAllProName += fAnalysisLabel->Data();\r
- TProfile *intFlowCorrelationsAllPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowCorrelationsAllProName.Data()));\r
- if(intFlowCorrelationsAllPro) \r
- {\r
- this->SetIntFlowCorrelationsAllPro(intFlowCorrelationsAllPro);\r
- } else \r
- {\r
- cout<<"WARNING: intFlowCorrelationsAllPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
- } \r
- // average extra correlations for integrated flow (which appear only when particle weights are used):\r
- // (to be improved: Weak point in implementation, I am assuming here that method GetPointersForParticleWeightsHistograms() was called)\r
- if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)\r
- {\r
- TString intFlowExtraCorrelationsProName = "fIntFlowExtraCorrelationsPro";\r
- intFlowExtraCorrelationsProName += fAnalysisLabel->Data();\r
- TProfile *intFlowExtraCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowExtraCorrelationsProName.Data()));\r
- if(intFlowExtraCorrelationsPro) \r
- {\r
- this->SetIntFlowExtraCorrelationsPro(intFlowExtraCorrelationsPro);\r
- } else \r
- {\r
- cout<<"WARNING: intFlowExtraCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
- }\r
- } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) \r
- // average products of correlations <2>, <4>, <6> and <8>: \r
- TString intFlowProductOfCorrelationsProName = "fIntFlowProductOfCorrelationsPro";\r
- intFlowProductOfCorrelationsProName += fAnalysisLabel->Data();\r
- TProfile *intFlowProductOfCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowProductOfCorrelationsProName.Data()));\r
- if(intFlowProductOfCorrelationsPro) \r
- {\r
- this->SetIntFlowProductOfCorrelationsPro(intFlowProductOfCorrelationsPro);\r
- } else \r
- {\r
- cout<<"WARNING: intFlowProductOfCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
- } \r
- // average correction terms for non-uniform acceptance (with wrong errors!):\r
- for(Int_t sc=0;sc<2;sc++)\r
- {\r
- TString intFlowCorrectionTermsForNUAProName = "fIntFlowCorrectionTermsForNUAPro";\r
- intFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data();\r
- TProfile *intFlowCorrectionTermsForNUAPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject((Form("%s: %s terms",intFlowCorrectionTermsForNUAProName.Data(),sinCosFlag[sc].Data()))));\r
- if(intFlowCorrectionTermsForNUAPro) \r
- {\r
- this->SetIntFlowCorrectionTermsForNUAPro(intFlowCorrectionTermsForNUAPro,sc);\r
- } else \r
- {\r
- cout<<"WARNING: intFlowCorrectionTermsForNUAPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
- cout<<"sc = "<<sc<<endl;\r
- } \r
- } // end of for(Int_t sc=0;sc<2;sc++) \r
- } else // to if(intFlowProfiles) \r
- {\r
- cout<<"WARNING: intFlowProfiles is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
- }\r
- \r
- // d) Get pointer to list fIntFlowResults and pointers to all objects that she holds. \r
- TList *intFlowResults = NULL;\r
- intFlowResults = dynamic_cast<TList*>(intFlowList->FindObject("Results"));\r
- if(intFlowResults)\r
- {\r
- // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with correct errors!):\r
- TString intFlowCorrelationsHistName = "fIntFlowCorrelationsHist";\r
- intFlowCorrelationsHistName += fAnalysisLabel->Data();\r
- TH1D *intFlowCorrelationsHist = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCorrelationsHistName.Data()));\r
- if(intFlowCorrelationsHist) \r
- {\r
- this->SetIntFlowCorrelationsHist(intFlowCorrelationsHist);\r
- } else \r
- {\r
- cout<<"WARNING: intFlowCorrelationsHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
- } \r
- // average all correlations for integrated flow (with correct errors!):\r
- TString intFlowCorrelationsAllHistName = "fIntFlowCorrelationsAllHist";\r
- intFlowCorrelationsAllHistName += fAnalysisLabel->Data();\r
- TH1D *intFlowCorrelationsAllHist = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCorrelationsAllHistName.Data()));\r
- if(intFlowCorrelationsAllHist) \r
- {\r
- this->SetIntFlowCorrelationsAllHist(intFlowCorrelationsAllHist);\r
- } else \r
- {\r
- cout<<"WARNING: intFlowCorrelationsAllHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
- } \r
- // average correction terms for non-uniform acceptance (with correct errors!):\r
- TString intFlowCorrectionTermsForNUAHistName = "fIntFlowCorrectionTermsForNUAHist";\r
- intFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data();\r
- for(Int_t sc=0;sc<2;sc++)\r
- {\r
- TH1D *intFlowCorrectionTermsForNUAHist = dynamic_cast<TH1D*>(intFlowResults->FindObject((Form("%s: %s terms",intFlowCorrectionTermsForNUAHistName.Data(),sinCosFlag[sc].Data()))));\r
- if(intFlowCorrectionTermsForNUAHist) \r
- {\r
- this->SetIntFlowCorrectionTermsForNUAHist(intFlowCorrectionTermsForNUAHist,sc);\r
- } else \r
- {\r
- cout<<"WARNING: intFlowCorrectionTermsForNUAHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
- cout<<"sc = "<<sc<<endl;\r
- } \r
- } // end of for(Int_t sc=0;sc<2;sc++) \r
- // covariances (multiplied with weight dependent prefactor):\r
- TString intFlowCovariancesName = "fIntFlowCovariances";\r
- intFlowCovariancesName += fAnalysisLabel->Data();\r
- TH1D *intFlowCovariances = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCovariancesName.Data()));\r
- if(intFlowCovariances) \r
- {\r
- this->SetIntFlowCovariances(intFlowCovariances); \r
- } else \r
- {\r
- cout<<"WARNING: intFlowCovariances is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
- } \r
- // sum of linear and quadratic event weights for <2>, <4>, <6> and <8>:\r
- TString intFlowSumOfEventWeightsName = "fIntFlowSumOfEventWeights";\r
- intFlowSumOfEventWeightsName += fAnalysisLabel->Data();\r
- for(Int_t power=0;power<2;power++)\r
- {\r
- TH1D *intFlowSumOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s: %s",intFlowSumOfEventWeightsName.Data(),powerFlag[power].Data())));\r
- if(intFlowSumOfEventWeights) \r
- {\r
- this->SetIntFlowSumOfEventWeights(intFlowSumOfEventWeights,power);\r
- } else \r
- {\r
- cout<<"WARNING: intFlowSumOfEventWeights is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
- cout<<"power = "<<power<<endl;\r
- } \r
- } // end of for(Int_t power=0;power<2;power++) \r
- // sum of products of event weights for correlations <2>, <4>, <6> and <8>: \r
- TString intFlowSumOfProductOfEventWeightsName = "fIntFlowSumOfProductOfEventWeights";\r
- intFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data();\r
- TH1D *intFlowSumOfProductOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowSumOfProductOfEventWeightsName.Data()));\r
- if(intFlowSumOfProductOfEventWeights) \r
- {\r
- this->SetIntFlowSumOfProductOfEventWeights(intFlowSumOfProductOfEventWeights);\r
- } else \r
- {\r
- cout<<"WARNING: intFlowSumOfProductOfEventWeights is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
- } \r
- // final results for integrated Q-cumulants:\r
- TString intFlowQcumulantsName = "fIntFlowQcumulants";\r
- intFlowQcumulantsName += fAnalysisLabel->Data();\r
- TH1D *intFlowQcumulants = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsName.Data()));\r
- if(intFlowQcumulants) \r
- {\r
- this->SetIntFlowQcumulants(intFlowQcumulants);\r
- } else \r
- {\r
- cout<<"WARNING: intFlowQcumulants is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
- } \r
- // final integrated flow estimates from Q-cumulants:\r
- TString intFlowName = "fIntFlow";\r
- intFlowName += fAnalysisLabel->Data();\r
- TH1D *intFlow = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowName.Data()));\r
- if(intFlow) \r
- {\r
- this->SetIntFlow(intFlow);\r
- } else \r
- {\r
- cout<<"WARNING: intFlow is NULL in AFAWQC::GPFIFH() !!!!"<<endl; \r
- } \r
- } else // to if(intFlowResults)\r
- {\r
- cout<<"WARNING: intFlowResults is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
- }\r
- } // end of if(outputListHistos)\r
-\r
-} // end of void AliFlowAnalysisWithQCumulants::GetPointersForIntFlowHistograms(TList *outputListHistos)\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::GetPointersForDiffFlowHistograms(TList *outputListHistos)\r
-{\r
- // Get pointer to all objects relevant for differential flow.\r
- // a) Define flags locally (to be improved: should I promote flags to data members?);\r
- // b) Get pointer to base list for differential flow fDiffFlowList and nested lists fDiffFlowListProfiles and fDiffFlowListResults;\r
- // c) Get pointer to profile fDiffFlowFlags holding all flags for differential flow;\r
- // d) Get pointers to all nested lists in fDiffFlowListProfiles and to profiles which they hold;\r
- // e) Get pointers to all nested lists in fDiffFlowListResults and to histograms which they hold.\r
- \r
- // a) Define flags locally (to be improved: should I promote flags to data members?): \r
- TString typeFlag[2] = {"RP","POI"}; \r
- TString ptEtaFlag[2] = {"p_{T}","#eta"};\r
- TString powerFlag[2] = {"linear","quadratic"};\r
- TString sinCosFlag[2] = {"sin","cos"};\r
- TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; \r
- TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; \r
- TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"};\r
- TString mixedCorrelationIndex[8] = {"<2>","<2'>","<4>","<4'>","<6>","<6'>","<8>","<8'>"};\r
- TString covarianceName[5] = {"Cov(<2>,<2'>)","Cov(<2>,<4'>)","Cov(<4>,<2'>)","Cov(<4>,<4'>)","Cov(<2'>,<4'>)"}; \r
- \r
- // b) Get pointer to base list for differential flow fDiffFlowList and nested lists fDiffFlowListProfiles and fDiffFlowListResults:\r
- TList *diffFlowList = NULL;\r
- diffFlowList = dynamic_cast<TList*>(outputListHistos->FindObject("Differential Flow")); \r
- if(!diffFlowList)\r
- { \r
- cout<<"WARNING: diffFlowList is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- exit(0);\r
- }\r
- // list holding nested lists containing profiles:\r
- TList *diffFlowListProfiles = NULL;\r
- diffFlowListProfiles = dynamic_cast<TList*>(diffFlowList->FindObject("Profiles"));\r
- if(!diffFlowListProfiles)\r
- { \r
- cout<<"WARNING: diffFlowListProfiles is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- exit(0);\r
- }\r
- // list holding nested lists containing 2D and 1D histograms with final results:\r
- TList *diffFlowListResults = NULL;\r
- diffFlowListResults = dynamic_cast<TList*>(diffFlowList->FindObject("Results"));\r
- if(!diffFlowListResults)\r
- { \r
- cout<<"WARNING: diffFlowListResults is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- exit(0);\r
- }\r
- \r
- // c) Get pointer to profile holding all flags for differential flow;\r
- TString diffFlowFlagsName = "fDiffFlowFlags";\r
- diffFlowFlagsName += fAnalysisLabel->Data();\r
- TProfile *diffFlowFlags = dynamic_cast<TProfile*>(diffFlowList->FindObject(diffFlowFlagsName.Data()));\r
- Bool_t bCalculate2DFlow = kFALSE;\r
- if(diffFlowFlags)\r
- {\r
- this->SetDiffFlowFlags(diffFlowFlags); \r
- bCalculate2DFlow = (Int_t)diffFlowFlags->GetBinContent(4);\r
- this->SetCalculate2DFlow(bCalculate2DFlow); // to be improved (shoul I call this setter somewhere else?) \r
- }\r
- \r
- // d) Get pointers to all nested lists in fDiffFlowListProfiles and to profiles which they hold;\r
- // correlations:\r
- TList *diffFlowCorrelationsProList[2][2] = {{NULL}};\r
- TString diffFlowCorrelationsProName = "fDiffFlowCorrelationsPro";\r
- diffFlowCorrelationsProName += fAnalysisLabel->Data();\r
- TProfile *diffFlowCorrelationsPro[2][2][4] = {{{NULL}}}; \r
- // products of correlations:\r
- TList *diffFlowProductOfCorrelationsProList[2][2] = {{NULL}};\r
- TString diffFlowProductOfCorrelationsProName = "fDiffFlowProductOfCorrelationsPro";\r
- diffFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); \r
- TProfile *diffFlowProductOfCorrelationsPro[2][2][8][8] = {{{{NULL}}}}; \r
- // corrections:\r
- TList *diffFlowCorrectionsProList[2][2] = {{NULL}};\r
- TString diffFlowCorrectionTermsForNUAProName = "fDiffFlowCorrectionTermsForNUAPro";\r
- diffFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); \r
- TProfile *diffFlowCorrectionTermsForNUAPro[2][2][2][10] = {{{{NULL}}}}; \r
- for(Int_t t=0;t<2;t++)\r
- {\r
- for(Int_t pe=0;pe<2;pe++)\r
- {\r
- diffFlowCorrelationsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));\r
- if(!diffFlowCorrelationsProList[t][pe])\r
- { \r
- cout<<"WARNING: diffFlowCorrelationsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl;\r
- exit(0);\r
- }\r
- for(Int_t ci=0;ci<4;ci++) // correlation index\r
- {\r
- diffFlowCorrelationsPro[t][pe][ci] = dynamic_cast<TProfile*>(diffFlowCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[ci].Data())));\r
- if(diffFlowCorrelationsPro[t][pe][ci])\r
- {\r
- this->SetDiffFlowCorrelationsPro(diffFlowCorrelationsPro[t][pe][ci],t,pe,ci);\r
- } else\r
- {\r
- cout<<"WARNING: diffFlowCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl; \r
- cout<<"ci = "<<ci<<endl;\r
- } \r
- } // end of for(Int_t ci=0;ci<4;ci++) // correlation index \r
- // products of correlations: \r
- diffFlowProductOfCorrelationsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with products of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); \r
- if(!diffFlowProductOfCorrelationsProList[t][pe])\r
- { \r
- cout<<"WARNING: ddiffFlowProductOfCorrelationsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl;\r
- exit(0);\r
- }\r
- for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index\r
- {\r
- for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index\r
- {\r
- diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = dynamic_cast<TProfile*>(diffFlowProductOfCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data())));\r
- if(diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2])\r
- {\r
- this->SetDiffFlowProductOfCorrelationsPro(diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2],t,pe,mci1,mci2);\r
- } else\r
- {\r
- cout<<"WARNING: diffFlowCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl; \r
- cout<<"mci1 = "<<mci1<<endl;\r
- cout<<"mci2 = "<<mci2<<endl;\r
- }\r
- if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here\r
- } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index\r
- } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index \r
- // corrections:\r
- diffFlowCorrectionsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));\r
- if(!diffFlowCorrectionsProList[t][pe])\r
- { \r
- cout<<"WARNING: diffFlowCorrectionsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl;\r
- exit(0);\r
- }\r
- // correction terms for NUA:\r
- for(Int_t sc=0;sc<2;sc++) // sin or cos\r
- {\r
- for(Int_t cti=0;cti<9;cti++) // correction term index\r
- {\r
- diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = dynamic_cast<TProfile*>(diffFlowCorrectionsProList[t][pe]->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1)));\r
- if(diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti])\r
- {\r
- this->SetDiffFlowCorrectionTermsForNUAPro(diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti],t,pe,sc,cti);\r
- } else\r
- {\r
- cout<<"WARNING: diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl; \r
- cout<<"sc = "<<sc<<endl;\r
- cout<<"cti = "<<cti<<endl;\r
- } \r
- } // end of for(Int_t cti=0;cti<9;cti++) // correction term index\r
- } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos\r
- // ...\r
- } // end of for(Int_t pe=0;pe<2;pe++)\r
- } // end of for(Int_t t=0;t<2;t++)\r
- \r
- // e) Get pointers to all nested lists in fDiffFlowListResults and to histograms which they hold.\r
- // reduced correlations:\r
- TList *diffFlowCorrelationsHistList[2][2] = {{NULL}};\r
- TString diffFlowCorrelationsHistName = "fDiffFlowCorrelationsHist";\r
- diffFlowCorrelationsHistName += fAnalysisLabel->Data(); \r
- TH1D *diffFlowCorrelationsHist[2][2][4] = {{{NULL}}};\r
- // corrections for NUA:\r
- TList *diffFlowCorrectionsHistList[2][2] = {{NULL}};\r
- TString diffFlowCorrectionTermsForNUAHistName = "fDiffFlowCorrectionTermsForNUAHist";\r
- diffFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); \r
- TH1D *diffFlowCorrectionTermsForNUAHist[2][2][2][10] = {{{{NULL}}}};\r
- // differential Q-cumulants:\r
- TList *diffFlowCumulantsHistList[2][2] = {{NULL}};\r
- TString diffFlowCumulantsName = "fDiffFlowCumulants";\r
- diffFlowCumulantsName += fAnalysisLabel->Data(); \r
- TH1D *diffFlowCumulants[2][2][4] = {{{NULL}}};\r
- // differential flow estimates from Q-cumulants:\r
- TList *diffFlowHistList[2][2] = {{NULL}};\r
- TString diffFlowName = "fDiffFlow";\r
- diffFlowName += fAnalysisLabel->Data(); \r
- TH1D *diffFlow[2][2][4] = {{{NULL}}};\r
- // differential covariances:\r
- TList *diffFlowCovariancesHistList[2][2] = {{NULL}};\r
- TString diffFlowCovariancesName = "fDiffFlowCovariances";\r
- diffFlowCovariancesName += fAnalysisLabel->Data(); \r
- TH1D *diffFlowCovariances[2][2][5] = {{{NULL}}};\r
- for(Int_t t=0;t<2;t++) // type: RP or POI\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- // reduced correlations:\r
- diffFlowCorrelationsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));\r
- if(!diffFlowCorrelationsHistList[t][pe])\r
- { \r
- cout<<"WARNING: diffFlowCorrelationsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl;\r
- exit(0);\r
- }\r
- for(Int_t index=0;index<4;index++) \r
- {\r
- diffFlowCorrelationsHist[t][pe][index] = dynamic_cast<TH1D*>(diffFlowCorrelationsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data())));\r
- if(diffFlowCorrelationsHist[t][pe][index])\r
- {\r
- this->SetDiffFlowCorrelationsHist(diffFlowCorrelationsHist[t][pe][index],t,pe,index);\r
- } else \r
- {\r
- cout<<"WARNING: diffFlowCorrelationsHist[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl;\r
- cout<<"index = "<<index<<endl;\r
- exit(0); \r
- } \r
- } // end of for(Int_t index=0;index<4;index++)\r
- // corrections:\r
- diffFlowCorrectionsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Histograms with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));\r
- if(!diffFlowCorrectionsHistList[t][pe])\r
- { \r
- cout<<"WARNING: diffFlowCorrectionsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl;\r
- exit(0);\r
- }\r
- // correction terms for NUA:\r
- for(Int_t sc=0;sc<2;sc++) // sin or cos\r
- {\r
- for(Int_t cti=0;cti<9;cti++) // correction term index\r
- {\r
- diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = dynamic_cast<TH1D*>(diffFlowCorrectionsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1)));\r
- if(diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti])\r
- {\r
- this->SetDiffFlowCorrectionTermsForNUAHist(diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti],t,pe,sc,cti);\r
- } else\r
- {\r
- cout<<"WARNING: diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl; \r
- cout<<"sc = "<<sc<<endl;\r
- cout<<"cti = "<<cti<<endl;\r
- } \r
- } // end of for(Int_t cti=0;cti<9;cti++) // correction term index\r
- } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos\r
- // ...\r
- // differential Q-cumulants:\r
- diffFlowCumulantsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Differential Q-cumulants (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));\r
- if(!diffFlowCumulantsHistList[t][pe])\r
- { \r
- cout<<"WARNING: diffFlowCumulantsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl;\r
- exit(0);\r
- }\r
- for(Int_t index=0;index<4;index++) \r
- {\r
- diffFlowCumulants[t][pe][index] = dynamic_cast<TH1D*>(diffFlowCumulantsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data())));\r
- if(diffFlowCumulants[t][pe][index])\r
- {\r
- this->SetDiffFlowCumulants(diffFlowCumulants[t][pe][index],t,pe,index);\r
- } else \r
- {\r
- cout<<"WARNING: diffFlowCumulants[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl;\r
- cout<<"index = "<<index<<endl;\r
- exit(0); \r
- } \r
- } // end of for(Int_t index=0;index<4;index++)\r
- // differential flow estimates from Q-cumulants:\r
- diffFlowHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Differential flow (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));\r
- if(!diffFlowHistList[t][pe])\r
- { \r
- cout<<"WARNING: diffFlowHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl;\r
- exit(0);\r
- }\r
- for(Int_t index=0;index<4;index++) \r
- {\r
- diffFlow[t][pe][index] = dynamic_cast<TH1D*>(diffFlowHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data())));\r
- if(diffFlow[t][pe][index])\r
- {\r
- this->SetDiffFlow(diffFlow[t][pe][index],t,pe,index);\r
- } else \r
- {\r
- cout<<"WARNING: diffFlow[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl;\r
- cout<<"index = "<<index<<endl;\r
- exit(0); \r
- } \r
- } // end of for(Int_t index=0;index<4;index++)\r
- // differential covariances:\r
- diffFlowCovariancesHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Covariances of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));\r
- if(!diffFlowCovariancesHistList[t][pe])\r
- { \r
- cout<<"WARNING: diffFlowCovariancesHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl;\r
- exit(0);\r
- }\r
- for(Int_t covIndex=0;covIndex<5;covIndex++) \r
- {\r
- diffFlowCovariances[t][pe][covIndex] = dynamic_cast<TH1D*>(diffFlowCovariancesHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data())));\r
- if(diffFlowCovariances[t][pe][covIndex])\r
- {\r
- this->SetDiffFlowCovariances(diffFlowCovariances[t][pe][covIndex],t,pe,covIndex);\r
- } else \r
- {\r
- cout<<"WARNING: diffFlowCovariances[t][pe][covIndex] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl;\r
- cout<<"covIndex = "<<covIndex<<endl;\r
- exit(0); \r
- } \r
- } // end of for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index \r
- } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- } // end of for(Int_t t=0;t<2;t++) // type: RP or POI \r
- // sum of event weights for reduced correlations:\r
- TList *diffFlowSumOfEventWeightsHistList[2][2][2] = {{{NULL}}};\r
- TString diffFlowSumOfEventWeightsName = "fDiffFlowSumOfEventWeights";\r
- diffFlowSumOfEventWeightsName += fAnalysisLabel->Data(); \r
- TH1D *diffFlowSumOfEventWeights[2][2][2][4] = {{{{NULL}}}};\r
- for(Int_t t=0;t<2;t++) // type is RP or POI\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- { \r
- for(Int_t p=0;p<2;p++) // power of event weights is either 1 or 2\r
- {\r
- diffFlowSumOfEventWeightsHistList[t][pe][p] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Sum of %s event weights (%s, %s)",powerFlag[p].Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data())));\r
- if(!diffFlowSumOfEventWeightsHistList[t][pe][p])\r
- { \r
- cout<<"WARNING: diffFlowSumOfEventWeightsHistList[t][pe][p] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl;\r
- cout<<"power = "<<p<<endl;\r
- exit(0);\r
- }\r
- for(Int_t ew=0;ew<4;ew++) // index of reduced correlation\r
- {\r
- diffFlowSumOfEventWeights[t][pe][p][ew] = dynamic_cast<TH1D*>(diffFlowSumOfEventWeightsHistList[t][pe][p]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()))); \r
- if(diffFlowSumOfEventWeights[t][pe][p][ew])\r
- {\r
- this->SetDiffFlowSumOfEventWeights(diffFlowSumOfEventWeights[t][pe][p][ew],t,pe,p,ew);\r
- } else \r
- {\r
- cout<<"WARNING: diffFlowSumOfEventWeights[t][pe][p][ew] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl;\r
- cout<<"power = "<<p<<endl;\r
- cout<<"ew = "<<ew<<endl;\r
- exit(0); \r
- } \r
- }\r
- } // end of for(Int_t p=0;p<2;p++) // power of event weights is either 1 or 2\r
- } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- } // end of for(Int_t t=0;t<2;t++) // type is RP or POI\r
- // \r
- TList *diffFlowSumOfProductOfEventWeightsHistList[2][2] = {{NULL}};\r
- TString diffFlowSumOfProductOfEventWeightsName = "fDiffFlowSumOfProductOfEventWeights";\r
- diffFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); \r
- TH1D *diffFlowSumOfProductOfEventWeights[2][2][8][8] = {{{{NULL}}}};\r
- for(Int_t t=0;t<2;t++) // type is RP or POI\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- { \r
- diffFlowSumOfProductOfEventWeightsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Sum of products of event weights (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));\r
- if(!diffFlowSumOfProductOfEventWeightsHistList[t][pe])\r
- { \r
- cout<<"WARNING: diffFlowSumOfProductOfEventWeightsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl;\r
- exit(0);\r
- }\r
- for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index\r
- {\r
- for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index\r
- {\r
- diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = dynamic_cast<TH1D*>(diffFlowSumOfProductOfEventWeightsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()))); \r
- if(diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2])\r
- {\r
- this->SetDiffFlowSumOfProductOfEventWeights(diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2],t,pe,mci1,mci2);\r
- } else \r
- {\r
- cout<<"WARNING: diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl;\r
- cout<<"mci1 = "<<mci1<<endl;\r
- cout<<"mci2 = "<<mci2<<endl;\r
- exit(0); \r
- } \r
- if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here\r
- } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index\r
- } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index\r
- } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- } // end of for(Int_t t=0;t<2;t++) // type is RP or POI\r
-\r
-} // end void AliFlowAnalysisWithQCumulants::GetPointersForDiffFlowHistograms(TList *outputListHistos)\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow()\r
-{\r
- // Book all histograms and profiles needed for differential flow.\r
- // a) Define flags locally (to be improved: should I promote flags to data members?);\r
- // b) Book profile to hold all flags for differential flow;\r
- // c) Book e-b-e quantities;\r
- // d) Book profiles;\r
- // e) Book histograms holding final results. \r
- \r
- // a) Define flags locally (to be improved: should I promote flags to data members?): \r
- TString typeFlag[2] = {"RP","POI"}; \r
- TString ptEtaFlag[2] = {"p_{T}","#eta"};\r
- TString powerFlag[2] = {"linear","quadratic"};\r
- TString sinCosFlag[2] = {"sin","cos"};\r
- TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; \r
- TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; \r
- TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"};\r
- TString mixedCorrelationIndex[8] = {"<2>","<2'>","<4>","<4'>","<6>","<6'>","<8>","<8'>"};\r
- TString covarianceName[5] = {"Cov(<2>,<2'>)","Cov(<2>,<4'>)","Cov(<4>,<2'>)","Cov(<4>,<4'>)","Cov(<2'>,<4'>)"}; \r
- Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
- Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
- Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
- \r
- // b) Book profile to hold all flags for differential flow:\r
- TString diffFlowFlagsName = "fDiffFlowFlags";\r
- diffFlowFlagsName += fAnalysisLabel->Data();\r
- fDiffFlowFlags = new TProfile(diffFlowFlagsName.Data(),"Flags for Differential Flow",4,0,4);\r
- fDiffFlowFlags->SetTickLength(-0.01,"Y");\r
- fDiffFlowFlags->SetMarkerStyle(25);\r
- fDiffFlowFlags->SetLabelSize(0.05);\r
- fDiffFlowFlags->SetLabelOffset(0.02,"Y");\r
- (fDiffFlowFlags->GetXaxis())->SetBinLabel(1,"Particle Weights");\r
- (fDiffFlowFlags->GetXaxis())->SetBinLabel(2,"Event Weights");\r
- (fDiffFlowFlags->GetXaxis())->SetBinLabel(3,"Corrected for NUA?");\r
- (fDiffFlowFlags->GetXaxis())->SetBinLabel(4,"Calculated 2D flow?");\r
- fDiffFlowList->Add(fDiffFlowFlags);\r
-\r
- // c) Book e-b-e quantities:\r
- // Event-by-event r_{m*n,k}(pt,eta), p_{m*n,k}(pt,eta) and q_{m*n,k}(pt,eta)\r
- // Explanantion of notation:\r
- // 1.) n is harmonic, m is multiple of harmonic;\r
- // 2.) k is power of particle weight;\r
- // 3.) r_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for RPs in particular (pt,eta) bin (i-th RP is weighted with w_i^k); \r
- // 4.) p_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for POIs in particular (pt,eta) bin \r
- // (if i-th POI is also RP, than it is weighted with w_i^k); \r
- // 5.) q_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for particles which are both RPs and POIs in particular (pt,eta) bin \r
- // (i-th RP&&POI is weighted with w_i^k) \r
- \r
- // 1D:\r
- for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP && POI )\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- for(Int_t m=0;m<4;m++) // multiple of harmonic\r
- {\r
- for(Int_t k=0;k<9;k++) // power of particle weight\r
- {\r
- fReRPQ1dEBE[t][pe][m][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%dpower%dRe",t,pe,m,k),\r
- Form("TypeFlag%dpteta%dmultiple%dpower%dRe",t,pe,m,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); \r
- fImRPQ1dEBE[t][pe][m][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%dpower%dIm",t,pe,m,k),\r
- Form("TypeFlag%dpteta%dmultiple%dpower%dIm",t,pe,m,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); \r
- }\r
- }\r
- }\r
- } \r
- // to be improved (add explanation of fs1dEBE[t][pe][k]): \r
- for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI )\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- for(Int_t k=0;k<9;k++) // power of particle weight\r
- {\r
- fs1dEBE[t][pe][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%d",t,pe,k),\r
- Form("TypeFlag%dpteta%dmultiple%d",t,pe,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); \r
- }\r
- }\r
- }\r
- // correction terms for nua:\r
- for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI)\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- for(Int_t sc=0;sc<2;sc++) // sin or cos\r
- {\r
- for(Int_t cti=0;cti<9;cti++) // correction term index\r
- {\r
- fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti] = new TH1D(Form("typeFlag%d pteta%d sincos%d cti%d",t,pe,sc,cti),\r
- Form("typeFlag%d pteta%d sincos%d cti%d",t,pe,sc,cti),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); \r
- }\r
- }\r
- }\r
- } \r
- // 2D:\r
- TProfile2D styleRe("typeMultiplePowerRe","typeMultiplePowerRe",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);\r
- TProfile2D styleIm("typeMultiplePowerIm","typeMultiplePowerIm",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);\r
- for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI )\r
- { \r
- for(Int_t m=0;m<4;m++)\r
- {\r
- for(Int_t k=0;k<9;k++)\r
- {\r
- fReRPQ2dEBE[t][m][k] = (TProfile2D*)styleRe.Clone(Form("typeFlag%dmultiple%dpower%dRe",t,m,k)); \r
- fImRPQ2dEBE[t][m][k] = (TProfile2D*)styleIm.Clone(Form("typeFlag%dmultiple%dpower%dIm",t,m,k));\r
- }\r
- } \r
- } \r
- TProfile2D styleS("typePower","typePower",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);\r
- for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI )\r
- { \r
- for(Int_t k=0;k<9;k++)\r
- {\r
- fs2dEBE[t][k] = (TProfile2D*)styleS.Clone(Form("typeFlag%dpower%d",t,k));\r
- }\r
- }\r
- // reduced correlations e-b-e:\r
- TString diffFlowCorrelationsEBEName = "fDiffFlowCorrelationsEBE";\r
- diffFlowCorrelationsEBEName += fAnalysisLabel->Data();\r
- for(Int_t t=0;t<2;t++) // type: RP or POI\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- for(Int_t rci=0;rci<4;rci++) // reduced correlation index\r
- {\r
- fDiffFlowCorrelationsEBE[t][pe][rci] = new TH1D(Form("%s, %s, %s, %s",diffFlowCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);\r
- } // end of for(Int_t ci=0;ci<4;ci++) // correlation index\r
- } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta \r
- } // end of for(Int_t t=0;t<2;t++) // type: RP or POI\r
- // event weights for reduced correlations e-b-e:\r
- TString diffFlowEventWeightsForCorrelationsEBEName = "fDiffFlowEventWeightsForCorrelationsEBE";\r
- diffFlowEventWeightsForCorrelationsEBEName += fAnalysisLabel->Data();\r
- for(Int_t t=0;t<2;t++) // type: RP or POI\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- for(Int_t rci=0;rci<4;rci++) // event weight for reduced correlation index\r
- {\r
- fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci] = new TH1D(Form("%s, %s, %s, eW for %s",diffFlowEventWeightsForCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, eW for %s",diffFlowEventWeightsForCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);\r
- } // end of for(Int_t ci=0;ci<4;ci++) // correlation index\r
- } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta \r
- } // end of for(Int_t t=0;t<2;t++) // type: RP or POI\r
- \r
- // d) Book profiles;\r
- // reduced correlations:\r
- TString diffFlowCorrelationsProName = "fDiffFlowCorrelationsPro";\r
- diffFlowCorrelationsProName += fAnalysisLabel->Data();\r
- // corrections terms:\r
- TString diffFlowCorrectionTermsForNUAProName = "fDiffFlowCorrectionTermsForNUAPro";\r
- diffFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data();\r
- for(Int_t t=0;t<2;t++) // type: RP or POI\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- for(Int_t rci=0;rci<4;rci++) // reduced correlation index\r
- {\r
- // reduced correlations:\r
- fDiffFlowCorrelationsPro[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe],"s");\r
- fDiffFlowCorrelationsPro[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data());\r
- fDiffFlowCorrelationsProList[t][pe]->Add(fDiffFlowCorrelationsPro[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations)\r
- } // end of for(Int_t rci=0;rci<4;rci++) // correlation index\r
- } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta \r
- } // end of for(Int_t t=0;t<2;t++) // type: RP or POI\r
- // correction terms for nua:\r
- for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI)\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- for(Int_t sc=0;sc<2;sc++) // sin or cos\r
- {\r
- for(Int_t cti=0;cti<9;cti++) // correction term index\r
- {\r
- fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = new TProfile(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); \r
- fDiffFlowCorrectionsProList[t][pe]->Add(fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]);\r
- }\r
- }\r
- }\r
- } \r
- // e) Book histograms holding final results. \r
- // reduced correlations:\r
- TString diffFlowCorrelationsHistName = "fDiffFlowCorrelationsHist";\r
- diffFlowCorrelationsHistName += fAnalysisLabel->Data();\r
- // corrections terms:\r
- TString diffFlowCorrectionTermsForNUAHistName = "fDiffFlowCorrectionTermsForNUAHist";\r
- diffFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data();\r
- // differential covariances:\r
- TString diffFlowCovariancesName = "fDiffFlowCovariances";\r
- diffFlowCovariancesName += fAnalysisLabel->Data();\r
- // differential Q-cumulants:\r
- TString diffFlowCumulantsName = "fDiffFlowCumulants";\r
- diffFlowCumulantsName += fAnalysisLabel->Data();\r
- // differential flow:\r
- TString diffFlowName = "fDiffFlow";\r
- diffFlowName += fAnalysisLabel->Data();\r
- for(Int_t t=0;t<2;t++) // type: RP or POI\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- for(Int_t index=0;index<4;index++) \r
- {\r
- // reduced correlations:\r
- fDiffFlowCorrelationsHist[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);\r
- fDiffFlowCorrelationsHist[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data());\r
- fDiffFlowCorrelationsHistList[t][pe]->Add(fDiffFlowCorrelationsHist[t][pe][index]); \r
- // differential Q-cumulants:\r
- fDiffFlowCumulants[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);\r
- fDiffFlowCumulants[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data());\r
- fDiffFlowCumulantsHistList[t][pe]->Add(fDiffFlowCumulants[t][pe][index]); \r
- // differential flow estimates from Q-cumulants:\r
- fDiffFlow[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);\r
- fDiffFlow[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data());\r
- fDiffFlowHistList[t][pe]->Add(fDiffFlow[t][pe][index]); \r
- } // end of for(Int_t index=0;index<4;index++) \r
- for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index \r
- {\r
- // differential covariances:\r
- fDiffFlowCovariances[t][pe][covIndex] = new TH1D(Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()),Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);\r
- fDiffFlowCovariances[t][pe][covIndex]->SetXTitle(ptEtaFlag[pe].Data());\r
- fDiffFlowCovariancesHistList[t][pe]->Add(fDiffFlowCovariances[t][pe][covIndex]); \r
- } // end of for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index\r
- // products of both types of correlations: \r
- TString diffFlowProductOfCorrelationsProName = "fDiffFlowProductOfCorrelationsPro";\r
- diffFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); \r
- for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index\r
- {\r
- for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index\r
- {\r
- fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = new TProfile(Form("%s, %s, %s, %s, %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),Form("%s, %s, %s, %s #times %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); \r
- fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]->SetXTitle(ptEtaFlag[pe].Data());\r
- fDiffFlowProductOfCorrelationsProList[t][pe]->Add(fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]); \r
- if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here\r
- } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index\r
- } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index \r
- } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta \r
- } // end of for(Int_t t=0;t<2;t++) // type: RP or POI\r
- // sums of event weights for reduced correlations: \r
- TString diffFlowSumOfEventWeightsName = "fDiffFlowSumOfEventWeights";\r
- diffFlowSumOfEventWeightsName += fAnalysisLabel->Data(); \r
- for(Int_t t=0;t<2;t++) // type is RP or POI\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- { \r
- for(Int_t p=0;p<2;p++) // power of weights is either 1 or 2\r
- {\r
- for(Int_t ew=0;ew<4;ew++) // index of reduced correlation\r
- {\r
- fDiffFlowSumOfEventWeights[t][pe][p][ew] = new TH1D(Form("%s, %s, %s, %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()),Form("%s, %s, %s, power = %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); \r
- fDiffFlowSumOfEventWeights[t][pe][p][ew]->SetXTitle(ptEtaFlag[pe].Data());\r
- fDiffFlowSumOfEventWeightsHistList[t][pe][p]->Add(fDiffFlowSumOfEventWeights[t][pe][p][ew]); // to be improved (add dedicated list to hold all this)\r
- }\r
- }\r
- }\r
- } \r
- // sum of products of event weights for both types of correlations: \r
- TString diffFlowSumOfProductOfEventWeightsName = "fDiffFlowSumOfProductOfEventWeights";\r
- diffFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); \r
- for(Int_t t=0;t<2;t++) // type is RP or POI\r
- {\r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- { \r
- for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index\r
- {\r
- for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index\r
- {\r
- fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = new TH1D(Form("%s, %s, %s, %s, %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),Form("%s, %s, %s, %s #times %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); \r
- fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]->SetXTitle(ptEtaFlag[pe].Data());\r
- fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]->Add(fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]); \r
- if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here\r
- }\r
- }\r
- }\r
- } \r
- // correction terms for nua:\r
- for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI)\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- for(Int_t sc=0;sc<2;sc++) // sin or cos\r
- {\r
- for(Int_t cti=0;cti<9;cti++) // correction term index\r
- {\r
- fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = new TH1D(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); \r
- fDiffFlowCorrectionsHistList[t][pe]->Add(fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]);\r
- }\r
- }\r
- }\r
- } \r
- \r
-} // end of AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-/*\r
-void AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNUAForIntQcumulants() // to be improved (do I really need this method?)\r
-{\r
- // Calculate final corrections for non-uniform acceptance for Q-cumulants.\r
- \r
- // Corrections for non-uniform acceptance are stored in histogram fCorrectionsForNUA,\r
- // binning of fCorrectionsForNUA is organized as follows:\r
- //\r
- // 1st bin: correction to QC{2}\r
- // 2nd bin: correction to QC{4}\r
- // 3rd bin: correction to QC{6}\r
- // 4th bin: correction to QC{8}\r
- \r
- // shortcuts flags:\r
- Int_t pW = (Int_t)(useParticleWeights);\r
- \r
- Int_t eW = -1;\r
- \r
- if(eventWeights == "exact")\r
- {\r
- eW = 0;\r
- }\r
-\r
- for(Int_t sc=0;sc<2;sc++) // sin or cos terms flag\r
- {\r
- if(!(fQCorrelations[pW][eW] && fQCorrections[pW][eW][sc] && fCorrections[pW][eW]))\r
- {\r
- cout<<"WARNING: fQCorrelations[pW][eW] && fQCorrections[pW][eW][sc] && fCorrections[pW][eW] is NULL in AFAWQC::CFCFNUAFIF() !!!!"<<endl;\r
- cout<<"pW = "<<pW<<endl;\r
- cout<<"eW = "<<eW<<endl;\r
- cout<<"sc = "<<sc<<endl;\r
- exit(0);\r
- }\r
- } \r
-\r
- // measured 2-, 4-, 6- and 8-particle azimuthal correlations (biased with non-uniform acceptance!):\r
- Double_t two = fQCorrelations[pW][eW]->GetBinContent(1); // <<2>>\r
- //Double_t four = fQCorrelations[pW][eW]->GetBinContent(11); // <<4>>\r
- //Double_t six = fQCorrelations[pW][eW]->GetBinContent(24); // <<6>>\r
- //Double_t eight = fQCorrelations[pW][eW]->GetBinContent(31); // <<8>>\r
- \r
- // correction terms to QC{2}:\r
- // <<cos(n*phi1)>>^2\r
- Double_t two1stTerm = pow(fQCorrections[pW][eW][1]->GetBinContent(1),2); \r
- // <<sin(n*phi1)>>^2\r
- Double_t two2ndTerm = pow(fQCorrections[pW][eW][0]->GetBinContent(1),2); \r
- // final corrections for non-uniform acceptance to QC{2}:\r
- Double_t correctionQC2 = -1.*two1stTerm-1.*two2ndTerm;\r
- fCorrections[pW][eW]->SetBinContent(1,correctionQC2); \r
- \r
- // correction terms to QC{4}:\r
- // <<cos(n*phi1)>> <<cos(n*(phi1-phi2-phi3))>>\r
- Double_t four1stTerm = fQCorrections[pW][eW][1]->GetBinContent(1)*fQCorrections[pW][eW][1]->GetBinContent(3); \r
- // <<sin(n*phi1)>> <<sin(n*(phi1-phi2-phi3))>>\r
- Double_t four2ndTerm = fQCorrections[pW][eW][0]->GetBinContent(1)*fQCorrections[pW][eW][0]->GetBinContent(3); \r
- // <<cos(n*(phi1+phi2))>>^2\r
- Double_t four3rdTerm = pow(fQCorrections[pW][eW][1]->GetBinContent(2),2); \r
- // <<sin(n*(phi1+phi2))>>^2\r
- Double_t four4thTerm = pow(fQCorrections[pW][eW][0]->GetBinContent(2),2); \r
- // <<cos(n*(phi1+phi2))>> (<<cos(n*phi1)>>^2 - <<sin(n*phi1)>>^2)\r
- Double_t four5thTerm = fQCorrections[pW][eW][1]->GetBinContent(2)\r
- * (pow(fQCorrections[pW][eW][1]->GetBinContent(1),2)-pow(fQCorrections[pW][eW][0]->GetBinContent(1),2));\r
- // <<sin(n*(phi1+phi2))>> <<cos(n*phi1)>> <<sin(n*phi1)>>\r
- Double_t four6thTerm = fQCorrections[pW][eW][0]->GetBinContent(2)\r
- * fQCorrections[pW][eW][1]->GetBinContent(1)\r
- * fQCorrections[pW][eW][0]->GetBinContent(1); \r
- // <<cos(n*(phi1-phi2))>> (<<cos(n*phi1)>>^2 + <<sin(n*phi1)>>^2)\r
- Double_t four7thTerm = two*(pow(fQCorrections[pW][eW][1]->GetBinContent(1),2)+pow(fQCorrections[pW][eW][0]->GetBinContent(1),2)); \r
- // (<<cos(n*phi1)>>^2 + <<sin(n*phi1)>>^2)^2\r
- Double_t four8thTerm = pow(pow(fQCorrections[pW][eW][1]->GetBinContent(1),2)+pow(fQCorrections[pW][eW][0]->GetBinContent(1),2),2); \r
- // final correction to QC{4}:\r
- Double_t correctionQC4 = -4.*four1stTerm+4.*four2ndTerm-four3rdTerm-four4thTerm\r
- + 4.*four5thTerm+8.*four6thTerm+8.*four7thTerm-6.*four8thTerm; \r
- fCorrections[pW][eW]->SetBinContent(2,correctionQC4); \r
-\r
- // ... to be improved (continued for 6th and 8th order) \r
-\r
-\r
-} // end of AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNUAForIntQcumulants()\r
-*/\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateQcumulantsCorrectedForNUAIntFlow()\r
-{\r
- // Calculate generalized Q-cumulants (cumulants corrected for non-unifom acceptance).\r
- \r
- // measured 2-, 4-, 6- and 8-particle correlations (biased by non-uniform acceptance!):\r
- Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>>\r
- Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>>\r
- //Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>>\r
- //Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>>\r
- \r
- // statistical error of measured 2-, 4-, 6- and 8-particle correlations:\r
- //Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <<2>>\r
- //Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <<4>>\r
- //Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <<6>>\r
- //Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <<8>>\r
-\r
- // QC{2}:\r
- // <<cos(n*phi1)>>^2\r
- Double_t two1stTerm = pow(fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1),2); \r
- //Double_t two1stTermErrorSquared = pow(fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(1),2); \r
- // <<sin(n*phi1)>>^2\r
- Double_t two2ndTerm = pow(fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1),2); \r
- //Double_t two2ndTermErrorSquared = pow(fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(1),2); \r
- // generalized QC{2}:\r
- Double_t gQC2 = two - two1stTerm - two2ndTerm; // to be improved (terminology, notation)\r
- fIntFlowQcumulants->SetBinContent(1,gQC2); \r
- //fIntFlowQcumulants->SetBinError(1,0.); // to be improved (propagate error) \r
- \r
- // QC{4}:\r
- // <<cos(n*phi1)>> <<cos(n*(phi1-phi2-phi3))>>\r
- Double_t four1stTerm = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1)\r
- * fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(3); \r
- // <<sin(n*phi1)>> <<sin(n*(phi1-phi2-phi3))>>\r
- Double_t four2ndTerm = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1)\r
- * fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(3); \r
- // <<cos(n*(phi1+phi2))>>^2\r
- Double_t four3rdTerm = pow(fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2),2); \r
- // <<sin(n*(phi1+phi2))>>^2\r
- Double_t four4thTerm = pow(fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2),2); \r
- // <<cos(n*(phi1+phi2))>> (<<cos(n*phi1)>>^2 - <<sin(n*phi1)>>^2)\r
- Double_t four5thTerm = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2)\r
- * (pow(fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1),2)\r
- - pow(fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1),2));\r
- // <<sin(n*(phi1+phi2))>> <<cos(n*phi1)>> <<sin(n*phi1)>>\r
- Double_t four6thTerm = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2)\r
- * fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1)\r
- * fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1); \r
- // <<cos(n*(phi1-phi2))>> (<<cos(n*phi1)>>^2 + <<sin(n*phi1)>>^2)\r
- Double_t four7thTerm = two*(pow(fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1),2)\r
- + pow(fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1),2)); \r
- // (<<cos(n*phi1)>>^2 + <<sin(n*phi1)>>^2)^2\r
- Double_t four8thTerm = pow(pow(fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1),2)\r
- + pow(fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1),2),2); \r
- // generalized QC{4}:\r
- Double_t gQC4 = four-2.*pow(two,2.)-4.*four1stTerm+4.*four2ndTerm-four3rdTerm\r
- - four4thTerm+4.*four5thTerm+8.*four6thTerm+8.*four7thTerm-6.*four8thTerm; \r
- fIntFlowQcumulants->SetBinContent(2,gQC4); \r
- //fIntFlowQcumulants->SetBinError(2,0.); // to be improved (propagate error) \r
-\r
- // ... to be improved (continued for 6th and 8th order) \r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::CalculateQcumulantsCorrectedForNUAIntFlow()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectedForNUA()\r
-{\r
- // Calculate integrated flow from generalized Q-cumulants (corrected for non-uniform acceptance).\r
- \r
- // to be improved: add protection for NULL pointers, propagate statistical errors from \r
- // measured correlations and correction terms\r
- \r
- // generalized Q-cumulants:\r
- Double_t qc2 = fIntFlowQcumulants->GetBinContent(1); // QC{2} \r
- Double_t qc4 = fIntFlowQcumulants->GetBinContent(2); // QC{4} \r
- //Double_t qc6 = fIntFlowQcumulants->GetBinContent(3); // QC{6} \r
- //Double_t qc8 = fIntFlowQcumulants->GetBinContent(4); // QC{8}\r
- \r
- // integrated flow estimates:\r
- Double_t v2 = 0.; // v{2,QC} \r
- Double_t v4 = 0.; // v{4,QC} \r
- //Double_t v6 = 0.; // v{6,QC} \r
- //Double_t v8 = 0.; // v{8,QC}\r
-\r
- // calculate integrated flow estimates from generalized Q-cumulants: \r
- if(qc2>=0.) v2 = pow(qc2,1./2.); \r
- if(qc4<=0.) v4 = pow(-1.*qc4,1./4.); \r
- //if(qc6>=0.) v6 = pow((1./4.)*qc6,1./6.); \r
- //if(qc8<=0.) v8 = pow((-1./33.)*qc8,1./8.); \r
-\r
- // store integrated flow estimates from generalized Q-cumulants:\r
- fIntFlow->SetBinContent(1,v2);\r
- fIntFlow->SetBinContent(2,v4);\r
- //fIntFlow->SetBinContent(3,v6);\r
- //fIntFlow->SetBinContent(4,v8);\r
-\r
-} // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectedForNUA()\r
-\r
- \r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUAIntFlow() \r
-{\r
- // From profile fIntFlowCorrectionTermsForNUAPro[2] access measured corretion terms\r
- // and their spread, correctly calculate the statistical errors and store the final \r
- // results and statistical errors for correction terms in histogram fIntFlowCorrectionTermsForNUAHist[2].\r
- //\r
- // Remark: Statistical error of correction temrs is calculated as:\r
- //\r
- // statistical error = termA * spread * termB:\r
- // termA = sqrt{sum_{i=1}^{N} w^2}/(sum_{i=1}^{N} w)\r
- // termB = 1/sqrt(1-termA^2) \r
- \r
- /* // to be improved (implement protection here)\r
- for(Int_t power=0;power<2;power++)\r
- { \r
- if(!(fIntFlowCorrelationsHist && fIntFlowCorrelationsPro && fIntFlowSumOfEventWeights[power])) \r
- {\r
- cout<<"WARNING: fIntFlowCorrelationsHist && fIntFlowCorrelationsPro && fIntFlowSumOfEventWeights[power] is NULL in AFAWQC::FCIF() !!!!"<<endl;\r
- cout<<"power = "<<power<<endl;\r
- exit(0);\r
- }\r
- }\r
- */\r
- \r
- for(Int_t sc=0;sc<2;sc++) // sin or cos correction terms \r
- {\r
- for(Int_t ci=1;ci<=10;ci++) // correction term index\r
- {\r
- Double_t correction = fIntFlowCorrectionTermsForNUAPro[sc]->GetBinContent(ci);\r
- //Double_t spread = fIntFlowCorrectionTermsForNUAPro[sc]->GetBinError(ci);\r
- //Double_t sumOfLinearEventWeights = fIntFlowSumOfEventWeights[0]->GetBinContent(ci);\r
- //Double_t sumOfQuadraticEventWeights = fIntFlowSumOfEventWeights[1]->GetBinContent(ci);\r
- //Double_t termA = 0.;\r
- //Double_t termB = 0.;\r
- //if(sumOfLinearEventWeights)\r
- //{\r
- // termA = pow(sumOfQuadraticEventWeights,0.5)/sumOfLinearEventWeights;\r
- //} else\r
- // {\r
- // cout<<"WARNING: sumOfLinearEventWeights == 0 in AFAWQC::FCIF() !!!!"<<endl;\r
- // cout<<" (for "<<2*ci<<"-particle correlation)"<<endl;\r
- // }\r
- /*\r
- if(1.-pow(termA,2.) > 0.)\r
- {\r
- termB = 1./pow(1-pow(termA,2.),0.5);\r
- } else\r
- {\r
- cout<<"WARNING: 1.-pow(termA,2.) <= 0 in AFAWQC::FCIF() !!!!"<<endl; \r
- cout<<" (for "<<2*ci<<"-particle correlation)"<<endl;\r
- } \r
- Double_t statisticalError = termA * spread * termB;\r
- */\r
- fIntFlowCorrectionTermsForNUAHist[sc]->SetBinContent(ci,correction);\r
- //fIntFlowCorrectionTermsForNUAHist[sc]->SetBinError(ci,statisticalError);\r
- } // end of for(Int_t ci=1;ci<=10;ci++) // correction term index\r
- } // end of for(Int sc=0;sc<2;sc++) // sin or cos correction terms \r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUAIntFlow()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::GetPointersForNestedLoopsHistograms(TList *outputListHistos)\r
-{\r
- // Get pointers to all objects relevant for calculations with nested loops.\r
- \r
- if(outputListHistos)\r
- {\r
- TList *nestedLoopsList = dynamic_cast<TList*>(outputListHistos->FindObject("Nested Loops"));\r
- if(nestedLoopsList) \r
- {\r
- this->SetNestedLoopsList(nestedLoopsList);\r
- } else\r
- {\r
- cout<<"WARNING: nestedLoopsList is NULL in AFAWQC::GPFNLH() !!!!"<<endl;\r
- exit(0);\r
- }\r
- \r
- TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?)\r
- TString typeFlag[2] = {"RP","POI"}; // to be improved (should I promote this to data members?)\r
- TString ptEtaFlag[2] = {"p_{T}","#eta"}; // to be improved (should I promote this to data members?)\r
- TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; // to be improved (should I promote this to data members?)\r
- \r
- TString evaluateNestedLoopsName = "fEvaluateNestedLoops";\r
- evaluateNestedLoopsName += fAnalysisLabel->Data(); \r
- TProfile *evaluateNestedLoops = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(evaluateNestedLoopsName.Data()));\r
- Bool_t bEvaluateIntFlowNestedLoops = kFALSE;\r
- Bool_t bEvaluateDiffFlowNestedLoops = kFALSE;\r
- if(evaluateNestedLoops)\r
- {\r
- this->SetEvaluateNestedLoops(evaluateNestedLoops);\r
- bEvaluateIntFlowNestedLoops = (Int_t)evaluateNestedLoops->GetBinContent(1);\r
- bEvaluateDiffFlowNestedLoops = (Int_t)evaluateNestedLoops->GetBinContent(2);\r
- }\r
- // nested loops relevant for integrated flow: \r
- if(bEvaluateIntFlowNestedLoops)\r
- {\r
- // correlations:\r
- TString intFlowDirectCorrelationsName = "fIntFlowDirectCorrelations";\r
- intFlowDirectCorrelationsName += fAnalysisLabel->Data();\r
- TProfile *intFlowDirectCorrelations = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(intFlowDirectCorrelationsName.Data()));\r
- if(intFlowDirectCorrelations) \r
- { \r
- this->SetIntFlowDirectCorrelations(intFlowDirectCorrelations);\r
- } else\r
- {\r
- cout<<"WARNING: intFlowDirectCorrelations is NULL in AFAWQC::GPFNLH() !!!!"<<endl;\r
- exit(0);\r
- }\r
- if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) \r
- {\r
- TString intFlowExtraDirectCorrelationsName = "fIntFlowExtraDirectCorrelations";\r
- intFlowExtraDirectCorrelationsName += fAnalysisLabel->Data();\r
- TProfile *intFlowExtraDirectCorrelations = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(intFlowExtraDirectCorrelationsName.Data()));\r
- if(intFlowExtraDirectCorrelations) \r
- { \r
- this->SetIntFlowExtraDirectCorrelations(intFlowExtraDirectCorrelations);\r
- } else\r
- {\r
- cout<<"WARNING: intFlowExtraDirectCorrelations is NULL in AFAWQC::GPFNLH() !!!!"<<endl;\r
- exit(0);\r
- } \r
- } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) \r
- // correction terms for non-uniform acceptance:\r
- TString intFlowDirectCorrectionTermsForNUAName = "fIntFlowDirectCorrectionTermsForNUA";\r
- intFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data();\r
- TProfile *intFlowDirectCorrectionTermsForNUA[2] = {NULL};\r
- for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
- {\r
- intFlowDirectCorrectionTermsForNUA[sc] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s: %s terms",intFlowDirectCorrectionTermsForNUAName.Data(),sinCosFlag[sc].Data())));\r
- if(intFlowDirectCorrectionTermsForNUA[sc]) \r
- { \r
- this->SetIntFlowDirectCorrectionTermsForNUA(intFlowDirectCorrectionTermsForNUA[sc],sc);\r
- } else\r
- {\r
- cout<<"WARNING: intFlowDirectCorrectionTermsForNUA[sc] is NULL in AFAWQC::GPFNLH() !!!!"<<endl;\r
- cout<<"sc = "<<sc<<endl;\r
- exit(0);\r
- }\r
- } // end of for(Int_t sc=0;sc<2;sc++) \r
- } // end of if(bEvaluateIntFlowNestedLoops)\r
- \r
- // nested loops relevant for differential flow: \r
- if(bEvaluateDiffFlowNestedLoops)\r
- {\r
- // correlations:\r
- TString diffFlowDirectCorrelationsName = "fDiffFlowDirectCorrelations";\r
- diffFlowDirectCorrelationsName += fAnalysisLabel->Data();\r
- TProfile *diffFlowDirectCorrelations[2][2][4] = {{{NULL}}};\r
- for(Int_t t=0;t<2;t++)\r
- {\r
- for(Int_t pe=0;pe<2;pe++)\r
- {\r
- for(Int_t ci=0;ci<4;ci++) // correlation index\r
- {\r
- diffFlowDirectCorrelations[t][pe][ci] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[ci].Data())));\r
- if(diffFlowDirectCorrelations[t][pe][ci])\r
- {\r
- this->SetDiffFlowDirectCorrelations(diffFlowDirectCorrelations[t][pe][ci],t,pe,ci);\r
- } else\r
- {\r
- cout<<"WARNING: diffFlowDirectCorrelations[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl; \r
- cout<<"ci = "<<ci<<endl;\r
- } \r
- } // end of for(Int_t ci=0;ci<4;ci++) // correlation index \r
- } // end of for(Int_t pe=0;pe<2;pe++)\r
- } // end of for(Int_t t=0;t<2;t++) \r
- // correction terms for non-uniform acceptance:\r
- TString diffFlowDirectCorrectionTermsForNUAName = "fDiffFlowDirectCorrectionTermsForNUA";\r
- diffFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); \r
- TProfile *diffFlowDirectCorrectionTermsForNUA[2][2][2][10] = {{{{NULL}}}}; \r
- for(Int_t t=0;t<2;t++)\r
- {\r
- for(Int_t pe=0;pe<2;pe++)\r
- {\r
- // correction terms for NUA:\r
- for(Int_t sc=0;sc<2;sc++) // sin or cos\r
- {\r
- for(Int_t cti=0;cti<9;cti++) // correction term index\r
- {\r
- diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1)));\r
- if(diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti])\r
- {\r
- this->SetDiffFlowDirectCorrectionTermsForNUA(diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti],t,pe,sc,cti);\r
- } else\r
- {\r
- cout<<"WARNING: diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
- cout<<"t = "<<t<<endl;\r
- cout<<"pe = "<<pe<<endl; \r
- cout<<"sc = "<<sc<<endl;\r
- cout<<"cti = "<<cti<<endl;\r
- } \r
- } // end of for(Int_t cti=0;cti<9;cti++) // correction term index\r
- } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos\r
- } // end of for(Int_t pe=0;pe<2;pe++)\r
- } // end of for(Int_t t=0;t<2;t++)\r
- } // end of if(bEvaluateDiffFlowNestedLoops)\r
- } else // to if(outputListHistos)\r
- {\r
- cout<<"WARNING: outputListHistos is NULL in AFAWQC::GPFNLH() !!!!"<<endl;\r
- exit(0);\r
- }\r
-\r
-} // end of void AliFlowAnalysisWithQCumulants::GetPointersForNestedLoopsHistograms(TList *outputListHistos)\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::StoreHarmonic()\r
-{\r
- // Store flow harmonic in common control histograms.\r
-\r
- (fCommonHists->GetHarmonic())->Fill(0.5,fHarmonic);\r
- (fCommonHists2nd->GetHarmonic())->Fill(0.5,fHarmonic);\r
- (fCommonHists4th->GetHarmonic())->Fill(0.5,fHarmonic);\r
- (fCommonHists6th->GetHarmonic())->Fill(0.5,fHarmonic);\r
- (fCommonHists8th->GetHarmonic())->Fill(0.5,fHarmonic);\r
-\r
-} // end of void AliFlowAnalysisWithQCumulants::StoreHarmonic()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelationsUsingParticleWeights(TString type, TString ptOrEta) // type = RP or POI \r
-{\r
- // Calculate all correlations needed for differential flow using particle weights.\r
- \r
- Int_t t = -1; // type flag \r
- Int_t pe = -1; // ptEta flag\r
- \r
- if(type == "RP")\r
- {\r
- t = 0;\r
- } else if(type == "POI")\r
- {\r
- t = 1;\r
- }\r
-\r
- if(ptOrEta == "Pt")\r
- {\r
- pe = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- pe = 1;\r
- }\r
- \r
- Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
- Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
- //Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
- Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
-\r
- // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
- Double_t dReQ1n1k = (*fReQ)(0,1);\r
- Double_t dReQ2n2k = (*fReQ)(1,2);\r
- Double_t dReQ1n3k = (*fReQ)(0,3);\r
- //Double_t dReQ4n4k = (*fReQ)(3,4);\r
- Double_t dImQ1n1k = (*fImQ)(0,1);\r
- Double_t dImQ2n2k = (*fImQ)(1,2);\r
- Double_t dImQ1n3k = (*fImQ)(0,3);\r
- //Double_t dImQ4n4k = (*fImQ)(3,4);\r
- \r
- // S^M_{p,k} (see .h file for the definition of fSMpk):\r
- Double_t dSM1p1k = (*fSMpk)(0,1);\r
- Double_t dSM1p2k = (*fSMpk)(0,2);\r
- Double_t dSM1p3k = (*fSMpk)(0,3);\r
- Double_t dSM2p1k = (*fSMpk)(1,1);\r
- Double_t dSM3p1k = (*fSMpk)(2,1);\r
- \r
- // looping over all bins and calculating reduced correlations: \r
- for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- {\r
- // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): \r
- Double_t p1n0kRe = 0.;\r
- Double_t p1n0kIm = 0.;\r
-\r
- // number of POIs in particular (pt,eta) bin):\r
- Double_t mp = 0.;\r
-\r
- // real and imaginary parts of q_{m*n,k}: \r
- // (weighted Q-vector evaluated for particles which are both RPs and POIs in particular (pt,eta) bin)\r
- Double_t q1n2kRe = 0.;\r
- Double_t q1n2kIm = 0.;\r
- Double_t q2n1kRe = 0.;\r
- Double_t q2n1kIm = 0.;\r
-\r
- // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) \r
- Double_t s1p1k = 0.; \r
- Double_t s1p2k = 0.; \r
- Double_t s1p3k = 0.; \r
- \r
- // M0111 from Eq. (118) in QC2c (to be improved (notation))\r
- Double_t dM0111 = 0.;\r
- \r
- if(type == "POI")\r
- {\r
- p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b))\r
- * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b));\r
- p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) \r
- * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b));\r
- \r
- mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
- \r
- t = 1; // typeFlag = RP or POI\r
- \r
- // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) \r
- q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b))\r
- * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b));\r
- q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b))\r
- * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b));\r
- q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b))\r
- * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b));\r
- q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b))\r
- * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b));\r
- \r
- // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) \r
- s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); \r
- s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); \r
- s1p3k = pow(fs1dEBE[2][pe][3]->GetBinContent(b)*fs1dEBE[2][pe][3]->GetBinEntries(b),1.); \r
- \r
- // M0111 from Eq. (118) in QC2c (to be improved (notation)):\r
- dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k)\r
- - 3.*(s1p1k*(dSM2p1k-dSM1p2k)\r
- + 2.*(s1p3k-s1p2k*dSM1p1k));\r
- }\r
- else if(type == "RP")\r
- {\r
- // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) \r
- q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b))\r
- * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b));\r
- q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b))\r
- * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b));\r
- q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b))\r
- * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b));\r
- q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b))\r
- * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b));\r
-\r
- // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) \r
- s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); \r
- s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); \r
- s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); \r
- \r
- // to be improved (cross-checked):\r
- p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b))\r
- * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
- p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) \r
- * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
- \r
- mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
- \r
- t = 0; // typeFlag = RP or POI\r
- \r
- // M0111 from Eq. (118) in QC2c (to be improved (notation)):\r
- dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k)\r
- - 3.*(s1p1k*(dSM2p1k-dSM1p2k)\r
- + 2.*(s1p3k-s1p2k*dSM1p1k));\r
- //............................................................................................... \r
- }\r
- \r
- // 2'-particle correlation:\r
- Double_t two1n1nW0W1 = 0.;\r
- if(mp*dSM1p1k-s1p1k)\r
- {\r
- two1n1nW0W1 = (p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k-s1p1k)\r
- / (mp*dSM1p1k-s1p1k);\r
- \r
- // fill profile to get <<2'>> \r
- fDiffFlowCorrelationsPro[t][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nW0W1,mp*dSM1p1k-s1p1k);\r
- // histogram to store <2'> e-b-e (needed in some other methods):\r
- fDiffFlowCorrelationsEBE[t][pe][0]->SetBinContent(b,two1n1nW0W1); \r
- fDiffFlowEventWeightsForCorrelationsEBE[t][pe][0]->SetBinContent(b,mp*dSM1p1k-s1p1k); \r
- } // end of if(mp*dSM1p1k-s1p1k)\r
- \r
- // 4'-particle correlation:\r
- Double_t four1n1n1n1nW0W1W1W1 = 0.;\r
- if(dM0111)\r
- {\r
- four1n1n1n1nW0W1W1W1 = ((pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k)\r
- - q2n1kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))\r
- - 2.*q2n1kIm*dReQ1n1k*dImQ1n1k\r
- - p1n0kRe*(dReQ1n1k*dReQ2n2k+dImQ1n1k*dImQ2n2k)\r
- + p1n0kIm*(dImQ1n1k*dReQ2n2k-dReQ1n1k*dImQ2n2k)\r
- - 2.*dSM1p2k*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k)\r
- - 2.*(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*s1p1k \r
- + 6.*(q1n2kRe*dReQ1n1k+q1n2kIm*dImQ1n1k) \r
- + 1.*(q2n1kRe*dReQ2n2k+q2n1kIm*dImQ2n2k) \r
- + 2.*(p1n0kRe*dReQ1n3k+p1n0kIm*dImQ1n3k) \r
- + 2.*s1p1k*dSM1p2k \r
- - 6.*s1p3k) \r
- / dM0111; // to be improved (notation of dM0111)\r
- \r
- // fill profile to get <<4'>> \r
- fDiffFlowCorrelationsPro[t][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nW0W1W1W1,dM0111);\r
- // histogram to store <4'> e-b-e (needed in some other methods):\r
- fDiffFlowCorrelationsEBE[t][pe][1]->SetBinContent(b,four1n1n1n1nW0W1W1W1); \r
- fDiffFlowEventWeightsForCorrelationsEBE[t][pe][1]->SetBinContent(b,dM0111); \r
- } // end of if(dM0111)\r
- } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
-\r
-} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelationsUsingParticleWeights(TString type, TString ptOrEta); // type = RP or POI \r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::FillCommonControlHistograms(AliFlowEventSimple *anEvent)\r
-{\r
- // Fill common control histograms.\r
- \r
- Int_t nRP = anEvent->GetEventNSelTracksRP(); // number of RPs (i.e. number of particles used to determine the reaction plane)\r
- fCommonHists->FillControlHistograms(anEvent); \r
- if(nRP>1)\r
- {\r
- fCommonHists2nd->FillControlHistograms(anEvent); \r
- if(nRP>3)\r
- {\r
- fCommonHists4th->FillControlHistograms(anEvent); \r
- if(nRP>5)\r
- {\r
- fCommonHists6th->FillControlHistograms(anEvent); \r
- if(nRP>7)\r
- {\r
- fCommonHists8th->FillControlHistograms(anEvent); \r
- } // end of if(nRP>7) \r
- } // end of if(nRP>5) \r
- } // end of if(nRP>3) \r
- } // end of if(nRP>1) \r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::FillCommonControlHistograms(AliFlowEventSimple *anEvent)\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::ResetEventByEventQuantities()\r
-{\r
- // Reset all event by event quantities.\r
- \r
- // integrated flow:\r
- fReQ->Zero();\r
- fImQ->Zero();\r
- fSMpk->Zero();\r
- fIntFlowCorrelationsEBE->Reset();\r
- fIntFlowEventWeightsForCorrelationsEBE->Reset();\r
- fIntFlowCorrelationsAllEBE->Reset();\r
- \r
- if(fApplyCorrectionForNUA) \r
- {\r
- for(Int_t sc=0;sc<2;sc++)\r
- {\r
- fIntFlowCorrectionTermsForNUAEBE[sc]->Reset();\r
- } \r
- }\r
- \r
- // differential flow:\r
- // 1D:\r
- for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP)\r
- {\r
- for(Int_t pe=0;pe<2;pe++) // 1D in pt or eta\r
- {\r
- for(Int_t m=0;m<4;m++) // multiple of harmonic\r
- {\r
- for(Int_t k=0;k<9;k++) // power of weight\r
- {\r
- if(fReRPQ1dEBE[t][pe][m][k]) fReRPQ1dEBE[t][pe][m][k]->Reset();\r
- if(fImRPQ1dEBE[t][pe][m][k]) fImRPQ1dEBE[t][pe][m][k]->Reset();\r
- } \r
- }\r
- }\r
- }\r
- \r
- for(Int_t t=0;t<3;t++) // type (0 = RP, 1 = POI, 2 = RP&&POI )\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // 1D in pt or eta\r
- {\r
- for(Int_t k=0;k<9;k++)\r
- {\r
- if(fs1dEBE[t][pe][k]) fs1dEBE[t][pe][k]->Reset();\r
- }\r
- }\r
- }\r
-\r
- // e-b-e reduced correlations:\r
- for(Int_t t=0;t<2;t++) // type (0 = RP, 1 = POI)\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- for(Int_t rci=0;rci<4;rci++) // reduced correlation index\r
- {\r
- if(fDiffFlowCorrelationsEBE[t][pe][rci]) fDiffFlowCorrelationsEBE[t][pe][rci]->Reset();\r
- if(fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci]) fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci]->Reset();\r
- }\r
- }\r
- }\r
- \r
- // correction terms for NUA:\r
- for(Int_t t=0;t<2;t++) // type (0 = RP, 1 = POI)\r
- { \r
- for(Int_t pe=0;pe<2;pe++) // pt or eta\r
- {\r
- for(Int_t sc=0;sc<2;sc++) // sin or cos\r
- {\r
- for(Int_t cti=0;cti<9;cti++) // correction term index\r
- {\r
- fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti]->Reset(); \r
- }\r
- }\r
- } \r
- }\r
- \r
- // 2D (pt,eta)\r
- if(fCalculate2DFlow)\r
- {\r
- for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP)\r
- {\r
- for(Int_t m=0;m<4;m++) // multiple of harmonic\r
- {\r
- for(Int_t k=0;k<9;k++) // power of weight\r
- {\r
- if(fReRPQ2dEBE[t][m][k]) fReRPQ2dEBE[t][m][k]->Reset();\r
- if(fImRPQ2dEBE[t][m][k]) fImRPQ2dEBE[t][m][k]->Reset();\r
- } \r
- }\r
- }\r
- for(Int_t t=0;t<3;t++) // type (0 = RP, 1 = POI, 2 = RP&&POI )\r
- { \r
- for(Int_t k=0;k<9;k++)\r
- {\r
- if(fs2dEBE[t][k]) fs2dEBE[t][k]->Reset();\r
- }\r
- } \r
- } // end of if(fCalculate2DFlow) \r
-\r
-} // end of void AliFlowAnalysisWithQCumulants::ResetEventByEventQuantities();\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTerms(TString type, TString ptOrEta)\r
-{\r
- // Calculate correction terms for non-uniform acceptance for differential flow (sin terms).\r
- \r
- // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][0][cti], where cti runs as follows:\r
- // 0: <<sin n(psi1)>>\r
- // 1: <<sin n(psi1+phi2)>>\r
- // 2: <<sin n(psi1+phi2-phi3)>>\r
- // 3: <<sin n(psi1-phi2-phi3)>>:\r
- // 4:\r
- // 5:\r
- // 6:\r
- \r
- // multiplicity:\r
- Double_t dMult = (*fSMpk)(0,0);\r
- \r
- // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
- Double_t dReQ1n = (*fReQ)(0,0);\r
- Double_t dReQ2n = (*fReQ)(1,0);\r
- //Double_t dReQ3n = (*fReQ)(2,0);\r
- //Double_t dReQ4n = (*fReQ)(3,0);\r
- Double_t dImQ1n = (*fImQ)(0,0);\r
- Double_t dImQ2n = (*fImQ)(1,0);\r
- //Double_t dImQ3n = (*fImQ)(2,0);\r
- //Double_t dImQ4n = (*fImQ)(3,0);\r
-\r
- Int_t t = -1; // type flag \r
- Int_t pe = -1; // ptEta flag\r
- \r
- if(type == "RP")\r
- {\r
- t = 0;\r
- } else if(type == "POI")\r
- {\r
- t = 1;\r
- }\r
-\r
- if(ptOrEta == "Pt")\r
- {\r
- pe = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- pe = 1;\r
- }\r
- \r
- Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
- Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
- //Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
- Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
-\r
- // looping over all bins and calculating correction terms: \r
- for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- {\r
- // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): \r
- Double_t p1n0kRe = 0.;\r
- Double_t p1n0kIm = 0.;\r
-\r
- // number of POIs in particular pt or eta bin:\r
- Double_t mp = 0.;\r
-\r
- // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin):\r
- Double_t q1n0kRe = 0.;\r
- Double_t q1n0kIm = 0.;\r
- Double_t q2n0kRe = 0.;\r
- Double_t q2n0kIm = 0.;\r
-\r
- // number of particles which are both RPs and POIs in particular pt or eta bin:\r
- Double_t mq = 0.;\r
- \r
- if(type == "POI")\r
- {\r
- // q_{m*n,0}:\r
- q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b))\r
- * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b));\r
- q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b))\r
- * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b));\r
- q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b))\r
- * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b));\r
- q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b))\r
- * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); \r
- \r
- mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
- } \r
- else if(type == "RP")\r
- {\r
- // q_{m*n,0}:\r
- q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b))\r
- * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
- q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b))\r
- * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
- q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b))\r
- * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b));\r
- q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b))\r
- * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); \r
- \r
- mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) \r
- } \r
- if(type == "POI")\r
- {\r
- // p_{m*n,0}:\r
- p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b))\r
- * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b));\r
- p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) \r
- * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b));\r
- \r
- mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
- \r
- t = 1; // typeFlag = RP or POI\r
- }\r
- else if(type == "RP")\r
- {\r
- // p_{m*n,0} = q_{m*n,0}:\r
- p1n0kRe = q1n0kRe; \r
- p1n0kIm = q1n0kIm; \r
- \r
- mp = mq; \r
- \r
- t = 0; // typeFlag = RP or POI\r
- }\r
-\r
- // <<sin n(psi1)>>:\r
- Double_t sinP1nPsi = 0.;\r
- if(mp)\r
- {\r
- sinP1nPsi = p1n0kIm/mp;\r
- // fill profile for <<sin n(psi1)>>:\r
- fDiffFlowCorrectionTermsForNUAPro[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi,mp);\r
- // histogram to store <sin n(psi1)> e-b-e (needed in some other methods):\r
- fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][0]->SetBinContent(b,sinP1nPsi);\r
- } // end of if(mp) \r
- \r
- // <<sin n(psi1+phi2)>>:\r
- Double_t sinP1nPsiP1nPhi = 0.;\r
- if(mp*dMult-mq)\r
- {\r
- sinP1nPsiP1nPhi = (p1n0kRe*dImQ1n+p1n0kIm*dReQ1n-q2n0kIm)/(mp*dMult-mq);\r
- // fill profile for <<sin n(psi1+phi2)>>:\r
- fDiffFlowCorrectionTermsForNUAPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsiP1nPhi,mp*dMult-mq);\r
- // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods):\r
- fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][1]->SetBinContent(b,sinP1nPsiP1nPhi);\r
- } // end of if(mp*dMult-mq) \r
- \r
- // <<sin n(psi1+phi2-phi3)>>:\r
- Double_t sinP1nPsi1P1nPhi2MPhi3 = 0.;\r
- if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.))\r
- {\r
- sinP1nPsi1P1nPhi2MPhi3 = (p1n0kIm*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult)\r
- - 1.*(q2n0kIm*dReQ1n-q2n0kRe*dImQ1n) \r
- - mq*dImQ1n+2.*q1n0kIm)\r
- / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
- // fill profile for <<sin n(psi1+phi2)>>:\r
- fDiffFlowCorrectionTermsForNUAPro[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
- // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods):\r
- fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][2]->SetBinContent(b,sinP1nPsi1P1nPhi2MPhi3);\r
- } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) \r
- \r
- // <<sin n(psi1-phi2-phi3)>>:\r
- Double_t sinP1nPsi1M1nPhi2MPhi3 = 0.;\r
- if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.))\r
- {\r
- sinP1nPsi1M1nPhi2MPhi3 = (p1n0kIm*(pow(dReQ1n,2.)-pow(dImQ1n,2.))-2.*p1n0kRe*dReQ1n*dImQ1n\r
- - 1.*(p1n0kIm*dReQ2n-p1n0kRe*dImQ2n)\r
- + 2.*mq*dImQ1n-2.*q1n0kIm)\r
- / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
- // fill profile for <<sin n(psi1+phi2)>>:\r
- fDiffFlowCorrectionTermsForNUAPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
- // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods):\r
- fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][3]->SetBinContent(b,sinP1nPsi1M1nPhi2MPhi3);\r
- } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) \r
- } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- \r
-} // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTerms(TString type, TString ptOrEta)\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTerms(TString type, TString ptOrEta)\r
-{\r
- // Calculate correction terms for non-uniform acceptance for differential flow (cos terms).\r
- \r
- // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][1][cti], where cti runs as follows:\r
- // 0: <<cos n(psi)>>\r
- // 1: <<cos n(psi1+phi2)>>\r
- // 2: <<cos n(psi1+phi2-phi3)>>\r
- // 3: <<cos n(psi1-phi2-phi3)>>\r
- // 4:\r
- // 5:\r
- // 6:\r
- \r
- // multiplicity:\r
- Double_t dMult = (*fSMpk)(0,0);\r
- \r
- // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
- Double_t dReQ1n = (*fReQ)(0,0);\r
- Double_t dReQ2n = (*fReQ)(1,0);\r
- //Double_t dReQ3n = (*fReQ)(2,0);\r
- //Double_t dReQ4n = (*fReQ)(3,0);\r
- Double_t dImQ1n = (*fImQ)(0,0);\r
- Double_t dImQ2n = (*fImQ)(1,0);\r
- //Double_t dImQ3n = (*fImQ)(2,0);\r
- //Double_t dImQ4n = (*fImQ)(3,0);\r
-\r
- Int_t t = -1; // type flag \r
- Int_t pe = -1; // ptEta flag\r
- \r
- if(type == "RP")\r
- {\r
- t = 0;\r
- } else if(type == "POI")\r
- {\r
- t = 1;\r
- }\r
-\r
- if(ptOrEta == "Pt")\r
- {\r
- pe = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- pe = 1;\r
- }\r
- \r
- Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
- Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
- //Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
- Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
-\r
- // looping over all bins and calculating correction terms: \r
- for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- {\r
- // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): \r
- Double_t p1n0kRe = 0.;\r
- Double_t p1n0kIm = 0.;\r
-\r
- // number of POIs in particular pt or eta bin:\r
- Double_t mp = 0.;\r
-\r
- // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin):\r
- Double_t q1n0kRe = 0.;\r
- Double_t q1n0kIm = 0.;\r
- Double_t q2n0kRe = 0.;\r
- Double_t q2n0kIm = 0.;\r
-\r
- // number of particles which are both RPs and POIs in particular pt or eta bin:\r
- Double_t mq = 0.;\r
- \r
- if(type == "POI")\r
- {\r
- // q_{m*n,0}:\r
- q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b))\r
- * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b));\r
- q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b))\r
- * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b));\r
- q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b))\r
- * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b));\r
- q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b))\r
- * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); \r
- \r
- mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
- } \r
- else if(type == "RP")\r
- {\r
- // q_{m*n,0}:\r
- q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b))\r
- * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
- q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b))\r
- * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
- q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b))\r
- * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b));\r
- q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b))\r
- * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); \r
- \r
- mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) \r
- } \r
- if(type == "POI")\r
- {\r
- // p_{m*n,0}:\r
- p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b))\r
- * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b));\r
- p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) \r
- * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b));\r
- \r
- mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
- \r
- t = 1; // typeFlag = RP or POI\r
- }\r
- else if(type == "RP")\r
- {\r
- // p_{m*n,0} = q_{m*n,0}:\r
- p1n0kRe = q1n0kRe; \r
- p1n0kIm = q1n0kIm; \r
- \r
- mp = mq; \r
- \r
- t = 0; // typeFlag = RP or POI\r
- }\r
-\r
- // <<cos n(psi1)>>:\r
- Double_t cosP1nPsi = 0.;\r
- if(mp)\r
- {\r
- cosP1nPsi = p1n0kRe/mp;\r
- \r
- // fill profile for <<cos n(psi1)>>:\r
- fDiffFlowCorrectionTermsForNUAPro[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi,mp);\r
- // histogram to store <cos n(psi1)> e-b-e (needed in some other methods):\r
- fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][0]->SetBinContent(b,cosP1nPsi);\r
- } // end of if(mp) \r
- \r
- // <<cos n(psi1+phi2)>>:\r
- Double_t cosP1nPsiP1nPhi = 0.;\r
- if(mp*dMult-mq)\r
- {\r
- cosP1nPsiP1nPhi = (p1n0kRe*dReQ1n-p1n0kIm*dImQ1n-q2n0kRe)/(mp*dMult-mq);\r
- // fill profile for <<sin n(psi1+phi2)>>:\r
- fDiffFlowCorrectionTermsForNUAPro[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsiP1nPhi,mp*dMult-mq);\r
- // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods):\r
- fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][1]->SetBinContent(b,cosP1nPsiP1nPhi);\r
- } // end of if(mp*dMult-mq) \r
- \r
- // <<cos n(psi1+phi2-phi3)>>:\r
- Double_t cosP1nPsi1P1nPhi2MPhi3 = 0.;\r
- if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.))\r
- {\r
- cosP1nPsi1P1nPhi2MPhi3 = (p1n0kRe*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult)\r
- - 1.*(q2n0kRe*dReQ1n+q2n0kIm*dImQ1n) \r
- - mq*dReQ1n+2.*q1n0kRe)\r
- / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
- // fill profile for <<sin n(psi1+phi2)>>:\r
- fDiffFlowCorrectionTermsForNUAPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
- // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods):\r
- fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][2]->SetBinContent(b,cosP1nPsi1P1nPhi2MPhi3);\r
- } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) \r
- \r
- // <<cos n(psi1-phi2-phi3)>>:\r
- Double_t cosP1nPsi1M1nPhi2MPhi3 = 0.;\r
- if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.))\r
- {\r
- cosP1nPsi1M1nPhi2MPhi3 = (p1n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.))+2.*p1n0kIm*dReQ1n*dImQ1n\r
- - 1.*(p1n0kRe*dReQ2n+p1n0kIm*dImQ2n) \r
- - 2.*mq*dReQ1n+2.*q1n0kRe)\r
- / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
- // fill profile for <<sin n(psi1+phi2)>>:\r
- fDiffFlowCorrectionTermsForNUAPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
- // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods):\r
- fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][3]->SetBinContent(b,cosP1nPsi1M1nPhi2MPhi3);\r
- } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) \r
- } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- \r
-} // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTerms(TString type, TString ptOrEta)\r
-\r
-\r
-//==================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUADiffFlow(TString type, TString ptOrEta)\r
-{\r
- // Transfer prolfiles into histogams and correctly propagate the error (to be improved: description)\r
- \r
- // to be improved: debugged - I do not correctly transfer all profiles into histos (bug appears only after merging) \r
- \r
- Int_t t = -1; // type flag \r
- Int_t pe = -1; // ptEta flag\r
- \r
- if(type == "RP")\r
- {\r
- t = 0;\r
- } else if(type == "POI")\r
- {\r
- t = 1;\r
- }\r
-\r
- if(ptOrEta == "Pt")\r
- {\r
- pe = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- pe = 1;\r
- }\r
- \r
- Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
- //Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
- //Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
- //Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
-\r
- for(Int_t sc=0;sc<2;sc++) // sin or cos\r
- {\r
- for(Int_t cti=0;cti<9;cti++) // correction term index\r
- {\r
- for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- {\r
- Double_t correctionTerm = fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]->GetBinContent(b);\r
- fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]->SetBinContent(b,correctionTerm);\r
- // to be improved (propagate error correctly)\r
- // ...\r
- } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- } // correction term index\r
- } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos\r
-\r
-}// end of void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUADiffFlow(TString type, TString ptOrEta)\r
-\r
-\r
-//==================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta)\r
-{ \r
- // Calculate generalized differential flow Q-cumulants (corrected for non-uniform acceptance)\r
- \r
- Int_t typeFlag = -1;\r
- Int_t ptEtaFlag = -1;\r
-\r
- if(type == "RP")\r
- {\r
- typeFlag = 0;\r
- } else if(type == "POI")\r
- {\r
- typeFlag = 1;\r
- } \r
- \r
- if(ptOrEta == "Pt")\r
- {\r
- ptEtaFlag = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- ptEtaFlag = 1;\r
- } \r
- \r
- // shortcuts:\r
- Int_t t = typeFlag;\r
- Int_t pe = ptEtaFlag;\r
- \r
- // common:\r
- Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
- \r
- // 2-particle correlation:\r
- Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>>\r
- // sin term coming from integrated flow: \r
- Double_t sinP1nPhi = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1); // <<sin(n*phi1)>>\r
- Double_t sinP1nPhi1P1nPhi2 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2); // <<sin(n*(phi1+phi2))>>\r
- Double_t sinP1nPhi1M1nPhi2M1nPhi3 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(3); // <<sin(n*(phi1-phi2-phi3))>>\r
- // cos term coming from integrated flow: \r
- Double_t cosP1nPhi = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1); // <<cos(n*phi1)>>\r
- Double_t cosP1nPhi1P1nPhi2 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2); // <<cos(n*(phi1+phi2))>>\r
- Double_t cosP1nPhi1M1nPhi2M1nPhi3 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(3); // <<cos(n*(phi1-phi2-phi3))>>\r
-\r
- for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- {\r
- Double_t twoPrime = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); // <<2'>>\r
- Double_t fourPrime = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); // <<4'>>\r
- Double_t sinP1nPsi = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][0]->GetBinContent(b); // <<sin n(Psi)>> \r
- Double_t cosP1nPsi = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][0]->GetBinContent(b); // <<cos n(Psi)>> \r
- Double_t sinP1nPsi1P1nPhi2 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][1]->GetBinContent(b); // <<sin n(psi1+phi2)>> \r
- Double_t cosP1nPsi1P1nPhi2 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][1]->GetBinContent(b); // <<cos n(psi1+phi2)>> \r
- Double_t sinP1nPsi1P1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][2]->GetBinContent(b); // <<sin n(psi1+phi2-phi3)>> \r
- Double_t cosP1nPsi1P1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][2]->GetBinContent(b); // <<cos n(psi1+phi2-phi3)>> \r
- Double_t sinP1nPsi1M1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][3]->GetBinContent(b); // <<sin n(psi1-phi2-phi3)>> \r
- Double_t cosP1nPsi1M1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][3]->GetBinContent(b); // <<cos n(psi1-phi2-phi3)>> \r
- // generalized QC{2'}:\r
- Double_t qc2Prime = twoPrime - sinP1nPsi*sinP1nPhi - cosP1nPsi*cosP1nPhi;\r
- fDiffFlowCumulants[t][pe][0]->SetBinContent(b,qc2Prime);\r
- // generalized QC{4'}:\r
- Double_t qc4Prime = fourPrime-2.*twoPrime*two\r
- - cosP1nPsi*cosP1nPhi1M1nPhi2M1nPhi3\r
- + sinP1nPsi*sinP1nPhi1M1nPhi2M1nPhi3\r
- - cosP1nPhi*cosP1nPsi1M1nPhi2M1nPhi3\r
- + sinP1nPhi*sinP1nPsi1M1nPhi2M1nPhi3\r
- - 2.*cosP1nPhi*cosP1nPsi1P1nPhi2M1nPhi3\r
- - 2.*sinP1nPhi*sinP1nPsi1P1nPhi2M1nPhi3\r
- - cosP1nPsi1P1nPhi2*cosP1nPhi1P1nPhi2\r
- - sinP1nPsi1P1nPhi2*sinP1nPhi1P1nPhi2\r
- + 2.*cosP1nPhi1P1nPhi2*(cosP1nPsi*cosP1nPhi-sinP1nPsi*sinP1nPhi)\r
- + 2.*sinP1nPhi1P1nPhi2*(cosP1nPsi*sinP1nPhi+sinP1nPsi*cosP1nPhi)\r
- + 4.*two*(cosP1nPsi*cosP1nPhi+sinP1nPsi*sinP1nPhi)\r
- + 2.*cosP1nPsi1P1nPhi2*(pow(cosP1nPhi,2.)-pow(sinP1nPhi,2.))\r
- + 4.*sinP1nPsi1P1nPhi2*cosP1nPhi*sinP1nPhi\r
- + 4.*twoPrime*(pow(cosP1nPhi,2.)+pow(sinP1nPhi,2.))\r
- - 6.*(pow(cosP1nPhi,2.)-pow(sinP1nPhi,2.)) \r
- * (cosP1nPsi*cosP1nPhi-sinP1nPsi*sinP1nPhi)\r
- - 12.*cosP1nPhi*sinP1nPhi\r
- * (sinP1nPsi*cosP1nPhi+cosP1nPsi*sinP1nPhi);\r
- fDiffFlowCumulants[t][pe][1]->SetBinContent(b,qc4Prime); \r
- } // end of for(Int_t p=1;p<=fnBinsPt;p++)\r
- \r
-} // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta)\r
-\r
-\r
-//==================================================================================================================================\r
- \r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta)\r
-{\r
- // Calculate differential flow corrected for non-uniform acceptance.\r
- \r
- // to be improved (rewritten completely)\r
- \r
- Int_t typeFlag = -1;\r
- Int_t ptEtaFlag = -1;\r
-\r
- if(type == "RP")\r
- {\r
- typeFlag = 0;\r
- } else if(type == "POI")\r
- {\r
- typeFlag = 1;\r
- } \r
- \r
- if(ptOrEta == "Pt")\r
- {\r
- ptEtaFlag = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- ptEtaFlag = 1;\r
- } \r
- \r
- // shortcuts:\r
- Int_t t = typeFlag;\r
- Int_t pe = ptEtaFlag;\r
- \r
- // common:\r
- Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
- \r
- // to be improved: access here generalized QC{2} and QC{4} instead: \r
- Double_t dV2 = fIntFlow->GetBinContent(1); \r
- Double_t dV4 = fIntFlow->GetBinContent(2); \r
- \r
- // loop over pt or eta bins:\r
- for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- {\r
- // generalized QC{2'}:\r
- Double_t gQC2Prime = fDiffFlowCumulants[t][pe][0]->GetBinContent(b);\r
- // v'{2}:\r
- if(dV2>0)\r
- { \r
- Double_t v2Prime = gQC2Prime/dV2;\r
- fDiffFlow[t][pe][0]->SetBinContent(b,v2Prime); \r
- } \r
- // generalized QC{4'}:\r
- Double_t gQC4Prime = fDiffFlowCumulants[t][pe][1]->GetBinContent(b);\r
- // v'{4}:\r
- if(dV4>0)\r
- { \r
- Double_t v4Prime = -gQC4Prime/pow(dV4,3.);\r
- fDiffFlow[t][pe][1]->SetBinContent(b,v4Prime); \r
- } \r
- } // end of for(Int_t b=1;b<=fnBinsPtEta[pe];b++)\r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta); \r
-\r
-\r
-//==================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent)\r
-{\r
- // Evaluate with nested loops multiparticle correlations for integrated flow (without using the particle weights). \r
-\r
- // Remark: Results are stored in profile fIntFlowDirectCorrelations whose binning is organized as follows:\r
- // \r
- // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))>\r
- // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))>\r
- // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))> \r
- // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))>\r
- // 5th bin: ---- EMPTY ----\r
- // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))>\r
- // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))>\r
- // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))>\r
- // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))>\r
- // 10th bin: ---- EMPTY ----\r
- // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))>\r
- // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))>\r
- // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))>\r
- // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))> \r
- // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))>\r
- // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))>\r
- // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> \r
- // 18th bin: ---- EMPTY ----\r
- // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))>\r
- // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))>\r
- // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))>\r
- // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))>\r
- // 23rd bin: ---- EMPTY ----\r
- // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))>\r
- // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))>\r
- // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))>\r
- // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))>\r
- // 28th bin: ---- EMPTY ----\r
- // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))>\r
- // 30th bin: ---- EMPTY ----\r
- // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))>\r
- \r
- Int_t nPrim = anEvent->NumberOfTracks(); \r
- AliFlowTrackSimple *aftsTrack = NULL; \r
- Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; \r
- Int_t n = fHarmonic; \r
- Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?)\r
- Double_t dMult = (*fSMpk)(0,0);\r
- cout<<endl;\r
- cout<<"Multiparticle correlations: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl;\r
- if(dMult<2)\r
- {\r
- cout<<"... skipping this event (multiplicity too low) ..."<<endl;\r
- } else if (dMult>fMaxAllowedMultiplicity)\r
- {\r
- cout<<"... skipping this event (multiplicity too high) ..."<<endl;\r
- } else \r
- { \r
- cout<<"... evaluating nested loops (without using particle weights)..."<<endl;\r
- } \r
- \r
- // 2-particle correlations: \r
- if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity)\r
- {\r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi1=aftsTrack->Phi(); \r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1)continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi();\r
- if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush;\r
- // fill the profile with 2-p correlations: \r
- fIntFlowDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),1.); // <cos(n*(phi1-phi2))>\r
- fIntFlowDirectCorrelations->Fill(1.5,cos(2.*n*(phi1-phi2)),1.); // <cos(2n*(phi1-phi2))>\r
- fIntFlowDirectCorrelations->Fill(2.5,cos(3.*n*(phi1-phi2)),1.); // <cos(3n*(phi1-phi2))>\r
- fIntFlowDirectCorrelations->Fill(3.5,cos(4.*n*(phi1-phi2)),1.); // <cos(4n*(phi1-phi2))> \r
- } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
- } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
- } // end of if(nPrim>=2)\r
- \r
- // 3-particle correlations: \r
- if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity)\r
- {\r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi1=aftsTrack->Phi();\r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1)continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi();\r
- for(Int_t i3=0;i3<nPrim;i3++)\r
- {\r
- if(i3==i1||i3==i2)continue;\r
- aftsTrack=anEvent->GetTrack(i3);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi3=aftsTrack->Phi();\r
- if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush;\r
- // fill the profile with 3-p correlations: \r
- fIntFlowDirectCorrelations->Fill(5.,cos(2.*n*phi1-n*(phi2+phi3)),1.); //<3>_{2n|nn,n}\r
- fIntFlowDirectCorrelations->Fill(6.,cos(3.*n*phi1-2.*n*phi2-n*phi3),1.); //<3>_{3n|2n,n}\r
- fIntFlowDirectCorrelations->Fill(7.,cos(4.*n*phi1-2.*n*phi2-2.*n*phi3),1.); //<3>_{4n|2n,2n}\r
- fIntFlowDirectCorrelations->Fill(8.,cos(4.*n*phi1-3.*n*phi2-n*phi3),1.); //<3>_{4n|3n,n}\r
- } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
- } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
- } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
- } // end of if(nPrim>=3)\r
-\r
- // 4-particle correlations:\r
- if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity)\r
- { \r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- { \r
- aftsTrack=anEvent->GetTrack(i1);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi1=aftsTrack->Phi();\r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1)continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi();\r
- for(Int_t i3=0;i3<nPrim;i3++)\r
- {\r
- if(i3==i1||i3==i2)continue;\r
- aftsTrack=anEvent->GetTrack(i3);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi3=aftsTrack->Phi();\r
- for(Int_t i4=0;i4<nPrim;i4++)\r
- {\r
- if(i4==i1||i4==i2||i4==i3)continue;\r
- aftsTrack=anEvent->GetTrack(i4);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi4=aftsTrack->Phi();\r
- if(nPrim==4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush;\r
- // fill the profile with 4-p correlations: \r
- fIntFlowDirectCorrelations->Fill(10.,cos(n*phi1+n*phi2-n*phi3-n*phi4),1.); // <4>_{n,n|n,n} \r
- fIntFlowDirectCorrelations->Fill(11.,cos(2.*n*phi1+n*phi2-2.*n*phi3-n*phi4),1.); // <4>_{2n,n|2n,n}\r
- fIntFlowDirectCorrelations->Fill(12.,cos(2.*n*phi1+2*n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{2n,2n|2n,2n}\r
- fIntFlowDirectCorrelations->Fill(13.,cos(3.*n*phi1-n*phi2-n*phi3-n*phi4),1.); // <4>_{3n|n,n,n}\r
- fIntFlowDirectCorrelations->Fill(14.,cos(3.*n*phi1+n*phi2-3.*n*phi3-n*phi4),1.); // <4>_{3n,n|3n,n} \r
- fIntFlowDirectCorrelations->Fill(15.,cos(3.*n*phi1+n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{3n,n|2n,2n}\r
- fIntFlowDirectCorrelations->Fill(16.,cos(4.*n*phi1-2.*n*phi2-n*phi3-n*phi4),1.); // <4>_{4n|2n,n,n} \r
- } // end of for(Int_t i4=0;i4<nPrim;i4++) \r
- } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
- } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
- } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
- } // end of if(nPrim>=)\r
-\r
- // 5-particle correlations: \r
- if(nPrim>=5 && nPrim<=fMaxAllowedMultiplicity)\r
- {\r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- if(!(aftsTrack->InRPSelection())) continue; \r
- phi1=aftsTrack->Phi();\r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1)continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi();\r
- for(Int_t i3=0;i3<nPrim;i3++)\r
- {\r
- if(i3==i1||i3==i2)continue;\r
- aftsTrack=anEvent->GetTrack(i3);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi3=aftsTrack->Phi();\r
- for(Int_t i4=0;i4<nPrim;i4++)\r
- {\r
- if(i4==i1||i4==i2||i4==i3)continue;\r
- aftsTrack=anEvent->GetTrack(i4);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi4=aftsTrack->Phi();\r
- for(Int_t i5=0;i5<nPrim;i5++)\r
- {\r
- if(i5==i1||i5==i2||i5==i3||i5==i4)continue;\r
- aftsTrack=anEvent->GetTrack(i5);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi5=aftsTrack->Phi();\r
- if(nPrim==5) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<"\r"<<flush;\r
- // fill the profile with 5-p correlations: \r
- fIntFlowDirectCorrelations->Fill(18.,cos(2.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5),1.); //<5>_{2n,n|n,n,n}\r
- fIntFlowDirectCorrelations->Fill(19.,cos(2.*n*phi1+2.*n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); //<5>_{2n,2n|2n,n,n}\r
- fIntFlowDirectCorrelations->Fill(20.,cos(3.*n*phi1+n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); //<5>_{3n,n|2n,n,n}\r
- fIntFlowDirectCorrelations->Fill(21.,cos(4.*n*phi1-n*phi2-n*phi3-n*phi4-n*phi5),1.); //<5>_{4n|n,n,n,n}\r
- } // end of for(Int_t i5=0;i5<nPrim;i5++)\r
- } // end of for(Int_t i4=0;i4<nPrim;i4++) \r
- } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
- } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
- } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
- } // end of if(nPrim>=5)\r
- \r
- // 6-particle correlations:\r
- if(nPrim>=6 && nPrim<=fMaxAllowedMultiplicity)\r
- {\r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi1=aftsTrack->Phi();\r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1)continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi();\r
- for(Int_t i3=0;i3<nPrim;i3++)\r
- {\r
- if(i3==i1||i3==i2)continue;\r
- aftsTrack=anEvent->GetTrack(i3);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi3=aftsTrack->Phi();\r
- for(Int_t i4=0;i4<nPrim;i4++)\r
- {\r
- if(i4==i1||i4==i2||i4==i3)continue;\r
- aftsTrack=anEvent->GetTrack(i4);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi4=aftsTrack->Phi();\r
- for(Int_t i5=0;i5<nPrim;i5++)\r
- {\r
- if(i5==i1||i5==i2||i5==i3||i5==i4)continue;\r
- aftsTrack=anEvent->GetTrack(i5);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi5=aftsTrack->Phi();\r
- for(Int_t i6=0;i6<nPrim;i6++)\r
- {\r
- if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue;\r
- aftsTrack=anEvent->GetTrack(i6);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi6=aftsTrack->Phi(); \r
- if(nPrim==6) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<"\r"<<flush;\r
- // fill the profile with 6-p correlations: \r
- fIntFlowDirectCorrelations->Fill(23.,cos(n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{n,n,n|n,n,n}\r
- fIntFlowDirectCorrelations->Fill(24.,cos(2.*n*phi1+n*phi2+n*phi3-2.*n*phi4-n*phi5-n*phi6),1.); //<6>_{2n,n,n|2n,n,n}\r
- fIntFlowDirectCorrelations->Fill(25.,cos(2.*n*phi1+2.*n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{2n,2n|n,n,n,n}\r
- fIntFlowDirectCorrelations->Fill(26.,cos(3.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{3n,n|n,n,n,n} \r
- } // end of for(Int_t i6=0;i6<nPrim;i6++)\r
- } // end of for(Int_t i5=0;i5<nPrim;i5++)\r
- } // end of for(Int_t i4=0;i4<nPrim;i4++)\r
- } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
- } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
- } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
- } // end of if(nPrim>=6)\r
- \r
- // 7-particle correlations:\r
- if(nPrim>=7 && nPrim<=fMaxAllowedMultiplicity)\r
- {\r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- { \r
- aftsTrack=anEvent->GetTrack(i1);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi1=aftsTrack->Phi();\r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1)continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi();\r
- for(Int_t i3=0;i3<nPrim;i3++)\r
- {\r
- if(i3==i1||i3==i2)continue;\r
- aftsTrack=anEvent->GetTrack(i3);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi3=aftsTrack->Phi();\r
- for(Int_t i4=0;i4<nPrim;i4++)\r
- {\r
- if(i4==i1||i4==i2||i4==i3)continue;\r
- aftsTrack=anEvent->GetTrack(i4);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi4=aftsTrack->Phi();\r
- for(Int_t i5=0;i5<nPrim;i5++)\r
- {\r
- if(i5==i1||i5==i2||i5==i3||i5==i4)continue;\r
- aftsTrack=anEvent->GetTrack(i5);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi5=aftsTrack->Phi();\r
- for(Int_t i6=0;i6<nPrim;i6++)\r
- {\r
- if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue;\r
- aftsTrack=anEvent->GetTrack(i6);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi6=aftsTrack->Phi(); \r
- for(Int_t i7=0;i7<nPrim;i7++)\r
- {\r
- if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue;\r
- aftsTrack=anEvent->GetTrack(i7);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi7=aftsTrack->Phi(); \r
- if(nPrim==7) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<" "<<i7<<"\r"<<flush;\r
- // fill the profile with 7-p correlation: \r
- fIntFlowDirectCorrelations->Fill(28.,cos(2.*n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6-n*phi7),1.); // <7>_{2n,n,n|n,n,n,n}\r
- } // end of for(Int_t i7=0;i7<nPrim;i7++)\r
- } // end of for(Int_t i6=0;i6<nPrim;i6++) \r
- } // end of for(Int_t i5=0;i5<nPrim;i5++)\r
- } // end of for(Int_t i4=0;i4<nPrim;i4++) \r
- } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
- } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
- } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
- } // end of if(nPrim>=7)\r
- \r
- // 8-particle correlations:\r
- if(nPrim>=8 && nPrim<=fMaxAllowedMultiplicity)\r
- {\r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi1=aftsTrack->Phi();\r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1)continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi();\r
- for(Int_t i3=0;i3<nPrim;i3++)\r
- {\r
- if(i3==i1||i3==i2)continue;\r
- aftsTrack=anEvent->GetTrack(i3);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi3=aftsTrack->Phi();\r
- for(Int_t i4=0;i4<nPrim;i4++)\r
- {\r
- if(i4==i1||i4==i2||i4==i3)continue;\r
- aftsTrack=anEvent->GetTrack(i4);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi4=aftsTrack->Phi();\r
- for(Int_t i5=0;i5<nPrim;i5++)\r
- {\r
- if(i5==i1||i5==i2||i5==i3||i5==i4)continue;\r
- aftsTrack=anEvent->GetTrack(i5);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi5=aftsTrack->Phi();\r
- for(Int_t i6=0;i6<nPrim;i6++)\r
- {\r
- if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue;\r
- aftsTrack=anEvent->GetTrack(i6);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi6=aftsTrack->Phi();\r
- for(Int_t i7=0;i7<nPrim;i7++)\r
- {\r
- if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue;\r
- aftsTrack=anEvent->GetTrack(i7);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi7=aftsTrack->Phi();\r
- for(Int_t i8=0;i8<nPrim;i8++)\r
- {\r
- if(i8==i1||i8==i2||i8==i3||i8==i4||i8==i5||i8==i6||i8==i7)continue;\r
- aftsTrack=anEvent->GetTrack(i8);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi8=aftsTrack->Phi();\r
- cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<" "<<i7<<" "<<i8<<"\r"<<flush;\r
- // fill the profile with 8-p correlation: \r
- fIntFlowDirectCorrelations->Fill(30.,cos(n*phi1+n*phi2+n*phi3+n*phi4-n*phi5-n*phi6-n*phi7-n*phi8),1.); // <8>_{n,n,n,n|n,n,n,n}\r
- } // end of for(Int_t i8=0;i8<nPrim;i8++)\r
- } // end of for(Int_t i7=0;i7<nPrim;i7++) \r
- } // end of for(Int_t i6=0;i6<nPrim;i6++) \r
- } // end of for(Int_t i5=0;i5<nPrim;i5++)\r
- } // end of for(Int_t i4=0;i4<nPrim;i4++) \r
- } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
- } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
- } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
- } // end of if(nPrim>=8)\r
- \r
- cout<<endl;\r
-\r
-} // end of AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent)\r
-\r
-\r
-//==================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrelations()\r
-{\r
- // Cross-check results for multiparticle correlations needed for int. flow: results from Q-vectors vs results from nested loops.\r
-\r
- cout<<endl;\r
- cout<<endl;\r
- cout<<" *****************************************"<<endl;\r
- cout<<" **** cross-checking the correlations ****"<<endl;\r
- cout<<" **** for integrated flow ****"<<endl;\r
- if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
- {\r
- cout<<" **** (particle weights not used) ****"<<endl;\r
- } else\r
- {\r
- cout<<" **** (particle weights used) ****"<<endl;\r
- } \r
- cout<<" *****************************************"<<endl;\r
- cout<<endl;\r
- cout<<endl;\r
-\r
- Int_t ciMax = 32; // to be improved (removed eventually when I calculate 6th and 8th order with particle weights)\r
- \r
- if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)\r
- {\r
- ciMax = 11;\r
- }\r
-\r
- for(Int_t ci=1;ci<=ciMax;ci++)\r
- {\r
- if(strcmp((fIntFlowCorrelationsAllPro->GetXaxis())->GetBinLabel(ci), "") == 0) continue; // to be improved (access finalized histogram here)\r
- cout<<(fIntFlowCorrelationsAllPro->GetXaxis())->GetBinLabel(ci)<<":"<<endl; // to be improved (access finalized histogram here)\r
- cout<<"from Q-vectors = "<<fIntFlowCorrelationsAllPro->GetBinContent(ci)<<endl; // to be improved (access finalized histogram here)\r
- cout<<"from nested loops = "<<fIntFlowDirectCorrelations->GetBinContent(ci)<<endl;\r
- cout<<endl;\r
- }\r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrelations()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrectionTermsForNUA()\r
-{\r
- // Cross-check results for corrections terms for non-uniform acceptance needed for int. flow: results from Q-vectors vs results from nested loops.\r
-\r
- cout<<endl;\r
- cout<<endl;\r
- cout<<" *********************************************"<<endl;\r
- cout<<" **** cross-checking the correction terms ****"<<endl;\r
- cout<<" **** for non-uniform acceptance relevant ****"<<endl;\r
- cout<<" **** for integrated flow ****"<<endl;\r
- if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
- {\r
- cout<<" **** (particle weights not used) ****"<<endl;\r
- } else\r
- {\r
- cout<<" **** (particle weights used) ****"<<endl;\r
- } \r
- cout<<" *********************************************"<<endl;\r
- cout<<endl;\r
- cout<<endl;\r
-\r
- for(Int_t ci=1;ci<=10;ci++) // correction term index\r
- {\r
- for(Int_t sc=0;sc<2;sc++) // sin or cos term\r
- {\r
- if(strcmp((fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->GetBinLabel(ci), "") == 0) continue; // to be improved (access finalized histogram here)\r
- cout<<(fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->GetBinLabel(ci)<<":"<<endl; // to be improved (access finalized histogram here)\r
- cout<<"from Q-vectors = "<<fIntFlowCorrectionTermsForNUAPro[sc]->GetBinContent(ci)<<endl; // to be improved (access finalized histogram here)\r
- cout<<"from nested loops = "<<fIntFlowDirectCorrectionTermsForNUA[sc]->GetBinContent(ci)<<endl;\r
- cout<<endl;\r
- } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos term\r
- } // end of for(Int_t ci=1;ci<=10;ci++) // correction term index\r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrectionTermsForNUA() \r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent)\r
-{\r
- // Evaluate with nested loops multiparticle correlations for integrated flow (using the particle weights). \r
-\r
- // Results are stored in profile fIntFlowDirectCorrelations. \r
- // Remark 1: When particle weights are used the binning of fIntFlowDirectCorrelations is organized as follows:\r
- //\r
- // 1st bin: <2>_{1n|1n} = two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))>\r
- // 2nd bin: <2>_{2n|2n} = two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))>\r
- // 3rd bin: <2>_{3n|3n} = two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> \r
- // 4th bin: <2>_{4n|4n} = two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))>\r
- // 5th bin: ---- EMPTY ----\r
- // 6th bin: <3>_{2n|1n,1n} = three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))>\r
- // 7th bin: <3>_{3n|2n,1n} = ...\r
- // 8th bin: <3>_{4n|2n,2n} = ...\r
- // 9th bin: <3>_{4n|3n,1n} = ...\r
- // 10th bin: ---- EMPTY ----\r
- // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))>\r
- // 12th bin: <4>_{2n,1n|2n,1n} = ...\r
- // 13th bin: <4>_{2n,2n|2n,2n} = ...\r
- // 14th bin: <4>_{3n|1n,1n,1n} = ... \r
- // 15th bin: <4>_{3n,1n|3n,1n} = ...\r
- // 16th bin: <4>_{3n,1n|2n,2n} = ...\r
- // 17th bin: <4>_{4n|2n,1n,1n} = ... \r
- // 18th bin: ---- EMPTY ----\r
- // 19th bin: <5>_{2n|1n,1n,1n,1n} = ...\r
- // 20th bin: <5>_{2n,2n|2n,1n,1n} = ...\r
- // 21st bin: <5>_{3n,1n|2n,1n,1n} = ...\r
- // 22nd bin: <5>_{4n|1n,1n,1n,1n} = ...\r
- // 23rd bin: ---- EMPTY ----\r
- // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = ...\r
- // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = ...\r
- // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = ...\r
- // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = ...\r
- // 28th bin: ---- EMPTY ----\r
- // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = ...\r
- // 30th bin: ---- EMPTY ----\r
- // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = ...\r
- \r
- // Remark 2: When particle weights are used there are some extra correlations. They are stored in \r
- // fIntFlowExtraDirectCorrelations binning of which is organized as follows:\r
- \r
- // 1st bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))>\r
- // 2nd bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> \r
- // ...\r
- \r
- Int_t nPrim = anEvent->NumberOfTracks(); \r
- AliFlowTrackSimple *aftsTrack = NULL;\r
- //Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.;\r
- //Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.;\r
- Double_t phi1=0., phi2=0., phi3=0., phi4=0.;\r
- Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1.;\r
- Int_t n = fHarmonic; \r
- Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?)\r
- Double_t dMult = (*fSMpk)(0,0);\r
- cout<<endl;\r
- cout<<"Multiparticle correlations: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl;\r
- if(dMult<2)\r
- {\r
- cout<<"... skipping this event (multiplicity too low) ..."<<endl;\r
- } else if (dMult>fMaxAllowedMultiplicity)\r
- {\r
- cout<<"... skipping this event (multiplicity too high) ..."<<endl;\r
- } else \r
- { \r
- cout<<"... evaluating nested loops (using particle weights) ..."<<endl;\r
- } \r
- \r
- // 2-particle correlations: \r
- if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity)\r
- {\r
- // 2 nested loops multiparticle correlations using particle weights: \r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi1=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi())));\r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1)continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); \r
- if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush;\r
- // 2-p correlations using particle weights:\r
- if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),wPhi1*wPhi2); // <w1 w2 cos( n*(phi1-phi2))>\r
- if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(1.5,cos(2.*n*(phi1-phi2)),pow(wPhi1,2)*pow(wPhi2,2)); // <w1^2 w2^2 cos(2n*(phi1-phi2))>\r
- if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(2.5,cos(3.*n*(phi1-phi2)),pow(wPhi1,3)*pow(wPhi2,3)); // <w1^3 w2^3 cos(3n*(phi1-phi2))>\r
- if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(3.5,cos(4.*n*(phi1-phi2)),pow(wPhi1,4)*pow(wPhi2,4)); // <w1^4 w2^4 cos(4n*(phi1-phi2))> \r
- // extra correlations: \r
- // 2-p extra correlations (do not appear if particle weights are not used):\r
- if(fUsePhiWeights) fIntFlowExtraDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),pow(wPhi1,3)*wPhi2); // <w1^3 w2 cos(n*(phi1-phi2))>\r
- // ...\r
- } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
- } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
- } // end of if(nPrim>=2)\r
-\r
- if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity)\r
- { \r
- // 3 nested loops multiparticle correlations using particle weights: \r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi1=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi())));\r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1)continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));\r
- for(Int_t i3=0;i3<nPrim;i3++)\r
- {\r
- if(i3==i1||i3==i2)continue;\r
- aftsTrack=anEvent->GetTrack(i3);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi3=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi())));\r
- if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush;\r
- // 3-p correlations using particle weights:\r
- if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(5.5,cos(2.*n*phi1-n*(phi2+phi3)),pow(wPhi1,2)*wPhi2*wPhi3); // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))>\r
- // ...\r
- // extra correlations: \r
- // 2-p extra correlations (do not appear if particle weights are not used):\r
- if(fUsePhiWeights) fIntFlowExtraDirectCorrelations->Fill(1.5,cos(n*(phi1-phi2)),wPhi1*wPhi2*pow(wPhi3,2)); // <w1 w2 w3^2 cos(n*(phi1-phi2))>\r
- // ...\r
- // 3-p extra correlations (do not appear if particle weights are not used):\r
- // ...\r
- } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
- } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
- } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
- } // end of if(nPrim>=3)\r
- \r
- if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity)\r
- {\r
- // 4 nested loops multiparticle correlations using particle weights: \r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi1=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi())));\r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1)continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));\r
- for(Int_t i3=0;i3<nPrim;i3++)\r
- {\r
- if(i3==i1||i3==i2)continue;\r
- aftsTrack=anEvent->GetTrack(i3);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi3=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi())));\r
- for(Int_t i4=0;i4<nPrim;i4++)\r
- {\r
- if(i4==i1||i4==i2||i4==i3)continue;\r
- aftsTrack=anEvent->GetTrack(i4);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi4=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi())));\r
- if(nPrim>=4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; // to be improved (replace eventually this if statement with if(nPrim==4))\r
- // 4-p correlations using particle weights:\r
- if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(10.5,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); \r
- // extra correlations: \r
- // 2-p extra correlations (do not appear if particle weights are not used):\r
- // ...\r
- // 3-p extra correlations (do not appear if particle weights are not used):\r
- // ...\r
- // 4-p extra correlations (do not appear if particle weights are not used):\r
- // ...\r
- } // end of for(Int_t i4=0;i4<nPrim;i4++) \r
- } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
- } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
- } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
- } // end of if(nPrim>=4)\r
-\r
- cout<<endl; \r
-\r
-} // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent)\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowExtraCorrelations()\r
-{\r
- // Cross-check results for extra multiparticle correlations needed for int. flow \r
- // which appear only when particle weights are used: results from Q-vectors vs results from nested loops.\r
-\r
- cout<<endl;\r
- cout<<endl;\r
- cout<<" ***********************************************"<<endl;\r
- cout<<" **** cross-checking the extra correlations ****"<<endl;\r
- cout<<" **** for integrated flow ****"<<endl;\r
- cout<<" ***********************************************"<<endl;\r
- cout<<endl;\r
- cout<<endl;\r
- \r
- for(Int_t eci=1;eci<=2;eci++) // to be improved (increased eciMax eventually when I calculate 6th and 8th)\r
- {\r
- if(strcmp((fIntFlowExtraCorrelationsPro->GetXaxis())->GetBinLabel(eci), "") == 0) continue;\r
- cout<<(fIntFlowExtraCorrelationsPro->GetXaxis())->GetBinLabel(eci)<<":"<<endl;\r
- cout<<"from Q-vectors = "<<fIntFlowExtraCorrelationsPro->GetBinContent(eci)<<endl;\r
- cout<<"from nested loops = "<<fIntFlowExtraDirectCorrelations->GetBinContent(eci)<<endl;\r
- cout<<endl;\r
- }\r
-\r
-} // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowExtraCorrelations()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoops(AliFlowEventSimple* anEvent)\r
-{\r
- // Evaluate with nested loops correction terms for non-uniform acceptance relevant for NONAME integrated flow (to be improved (name)).\r
- //\r
- // Remark: Both sin and cos correction terms are calculated in this method. Sin terms are stored in fIntFlowDirectCorrectionTermsForNUA[0],\r
- // and cos terms in fIntFlowDirectCorrectionTermsForNUA[1]. Binning of fIntFlowDirectCorrectionTermsForNUA[sc] is organized as follows \r
- // (sc stands for either sin or cos):\r
- \r
- // 1st bin: <<sc(n*(phi1))>> \r
- // 2nd bin: <<sc(n*(phi1+phi2))>> \r
- // 3rd bin: <<sc(n*(phi1-phi2-phi3))>>\r
- // ...\r
- \r
- Int_t nPrim = anEvent->NumberOfTracks(); \r
- AliFlowTrackSimple *aftsTrack = NULL;\r
- Double_t phi1=0., phi2=0., phi3=0.;\r
- Int_t n = fHarmonic; \r
- Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?)\r
- Double_t dMult = (*fSMpk)(0,0);\r
- cout<<endl;\r
- cout<<"Correction terms for non-uniform acceptance: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl;\r
- if(dMult<1)\r
- {\r
- cout<<"... skipping this event (multiplicity too low) ..."<<endl;\r
- } else if (dMult>fMaxAllowedMultiplicity)\r
- {\r
- cout<<"... skipping this event (multiplicity too high) ..."<<endl;\r
- } else \r
- { \r
- cout<<"... evaluating nested loops (without using particle weights)..."<<endl;\r
- }\r
- \r
- if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity)\r
- {\r
- // 1-particle correction terms for non-uniform acceptance: \r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi1=aftsTrack->Phi();\r
- if(nPrim==1) cout<<i1<<"\r"<<flush;\r
- // sin terms:\r
- fIntFlowDirectCorrectionTermsForNUA[0]->Fill(0.5,sin(n*phi1),1.); // <sin(n*phi1)> \r
- // cos terms:\r
- fIntFlowDirectCorrectionTermsForNUA[1]->Fill(0.5,cos(n*phi1),1.); // <cos(n*phi1)>\r
- } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
- } // end of if(nPrim>=1) \r
- \r
- if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity)\r
- {\r
- // 2-particle correction terms for non-uniform acceptance: \r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi1=aftsTrack->Phi(); \r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1)continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi();\r
- if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush;\r
- // sin terms:\r
- fIntFlowDirectCorrectionTermsForNUA[0]->Fill(1.5,sin(n*(phi1+phi2)),1.); // <<sin(n*(phi1+phi2))>>\r
- // cos terms:\r
- fIntFlowDirectCorrectionTermsForNUA[1]->Fill(1.5,cos(n*(phi1+phi2)),1.); // <<cos(n*(phi1+phi2))>>\r
- } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
- } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
- } // end of if(nPrim>=2)\r
-\r
- if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity)\r
- {\r
- // 3-particle correction terms for non-uniform acceptance: \r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi1=aftsTrack->Phi();\r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1)continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi();\r
- for(Int_t i3=0;i3<nPrim;i3++)\r
- {\r
- if(i3==i1||i3==i2)continue;\r
- aftsTrack=anEvent->GetTrack(i3);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi3=aftsTrack->Phi();\r
- if(nPrim>=3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; // to be improved (eventually I will change this if statement)\r
- // sin terms:\r
- fIntFlowDirectCorrectionTermsForNUA[0]->Fill(2.5,sin(n*(phi1-phi2-phi3)),1.); // <<sin(n*(phi1-phi2-phi3))>>\r
- // cos terms:\r
- fIntFlowDirectCorrectionTermsForNUA[1]->Fill(2.5,cos(n*(phi1-phi2-phi3)),1.); // <<cos(n*(phi1-phi2-phi3))>>\r
- } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
- } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
- } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
- } // end of if(nPrim>=3)\r
-\r
- cout<<endl;\r
-}\r
-//================================================================================================================================\r
-void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta)\r
-{\r
- // Evaluate reduced correlations with nested loops without using the particle weights.\r
- \r
- // Remark 1: Reduced correlations are evaluated in pt bin number fCrossCheckInPtBinNo and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs.\r
- // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrelations[t][pe][ci], where indices runs as follows:\r
- // [0=RP,1=POI][0=Pt,1=Eta][0=<2'>,1=<4'>,2=<6'>,3=<8'>] \r
- // Remark 3: <2'> = <cos(n*(psi1-phi2))>\r
- // <4'> = <cos(n*(psi1+phi2-phi3-phi4))>\r
- // ...\r
- \r
- Int_t typeFlag = -1;\r
- Int_t ptEtaFlag = -1;\r
- if(type == "RP")\r
- {\r
- typeFlag = 0;\r
- } else if(type == "POI")\r
- {\r
- typeFlag = 1;\r
- } \r
- if(ptOrEta == "Pt")\r
- {\r
- ptEtaFlag = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- ptEtaFlag = 1;\r
- } \r
- // shortcuts:\r
- Int_t t = typeFlag;\r
- Int_t pe = ptEtaFlag;\r
- \r
- Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth};\r
- Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth};\r
- Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
- \r
- Int_t nPrim = anEvent->NumberOfTracks(); \r
- AliFlowTrackSimple *aftsTrack = NULL;\r
- \r
- Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.;\r
- \r
- Int_t n = fHarmonic; \r
- \r
- // 2'-particle correlations:\r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
- if(ptOrEta == "Pt")\r
- { \r
- if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;\r
- } else if (ptOrEta == "Eta")\r
- {\r
- if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; \r
- }\r
- psi1=aftsTrack->Phi(); \r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1)continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- // RP condition (!(first) particle in the correlator must be RP):\r
- if(!(aftsTrack->InRPSelection()))continue;\r
- phi2=aftsTrack->Phi(); \r
- // 2'-particle correlations: \r
- fDiffFlowDirectCorrelations[t][pe][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(1.*n*(psi1-phi2)),1.); // <cos(n*(psi1-phi2)) \r
- }//end of for(Int_t i2=0;i2<nPrim;i2++)\r
- }//end of for(Int_t i1=0;i1<nPrim;i1++)\r
- \r
- /*\r
- \r
- // 3'-particle correlations:\r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
- if(ptOrEta == "Pt")\r
- { \r
- if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;\r
- } else if (ptOrEta == "Eta")\r
- {\r
- if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; \r
- }\r
- psi1=aftsTrack->Phi();\r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1)continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- // RP condition (!(first) particle in the correlator must be RP):\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi();\r
- for(Int_t i3=0;i3<nPrim;i3++)\r
- {\r
- if(i3==i1||i3==i2)continue;\r
- aftsTrack=anEvent->GetTrack(i3);\r
- // RP condition (!(first) particle in the correlator must be RP):\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi3=aftsTrack->Phi();\r
- // to be improved : where to store it? ->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(2.*phi1-phi2-phi3)),1.); // <w1 w2 w3 cos(n(2psi1-phi2-phi3))> \r
- }//end of for(Int_t i3=0;i3<nPrim;i3++) \r
- }//end of for(Int_t i2=0;i2<nPrim;i2++) \r
- }//end of for(Int_t i1=0;i1<nPrim;i1++)\r
- \r
- */\r
- \r
- // 4'-particle correlations:\r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
- if(ptOrEta == "Pt")\r
- { \r
- if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;\r
- } else if (ptOrEta == "Eta")\r
- {\r
- if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; \r
- }\r
- psi1=aftsTrack->Phi();\r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1) continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- // RP condition (!(first) particle in the correlator must be RP): \r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi();\r
- for(Int_t i3=0;i3<nPrim;i3++)\r
- { \r
- if(i3==i1||i3==i2) continue;\r
- aftsTrack=anEvent->GetTrack(i3);\r
- // RP condition (!(first) particle in the correlator must be RP):\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi3=aftsTrack->Phi();\r
- for(Int_t i4=0;i4<nPrim;i4++)\r
- {\r
- if(i4==i1||i4==i2||i4==i3) continue;\r
- aftsTrack=anEvent->GetTrack(i4);\r
- // RP condition (!(first) particle in the correlator must be RP):\r
- if(!(aftsTrack->InRPSelection())) continue; \r
- phi4=aftsTrack->Phi();\r
- // 4'-particle correlations:\r
- fDiffFlowDirectCorrelations[t][pe][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3-phi4)),1.); // <cos(n(psi1+phi2-phi3-phi4))> \r
- }//end of for(Int_t i4=0;i4<nPrim;i4++)\r
- }//end of for(Int_t i3=0;i3<nPrim;i3++)\r
- }//end of for(Int_t i2=0;i2<nPrim;i2++) \r
- }//end of for(Int_t i1=0;i1<nPrim;i1++)\r
- \r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta)\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrelations(TString type, TString ptOrEta)\r
-{\r
- // Compare correlations needed for diff. flow calculated with nested loops and those calculated from Q-vectors\r
- \r
- Int_t typeFlag = -1;\r
- Int_t ptEtaFlag = -1;\r
- if(type == "RP")\r
- {\r
- typeFlag = 0;\r
- } else if(type == "POI")\r
- {\r
- typeFlag = 1;\r
- } \r
- if(ptOrEta == "Pt")\r
- {\r
- ptEtaFlag = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- ptEtaFlag = 1;\r
- } \r
- // shortcuts:\r
- Int_t t = typeFlag;\r
- Int_t pe = ptEtaFlag;\r
- \r
- TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) \r
- TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) \r
- TString reducedCorrelations[4] = {"<<cos(n(psi1-phi2))>>","<<cos(n(psi1+phi2-phi3-phi4))>>","",""}; // to be improved (access this from pro or hist)\r
- Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth};\r
- Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth};\r
- \r
- Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo};\r
- \r
-\r
- cout<<endl;\r
- cout<<" *****************************************"<<endl;\r
- cout<<" **** cross-checking the correlations ****"<<endl;\r
- cout<<" **** for differential flow ("<<rpORpoiString[t]<<") ****"<<endl;\r
- if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
- {\r
- cout<<" **** (particle weights not used) ****"<<endl;\r
- } else\r
- {\r
- cout<<" **** (particle weights used) ****"<<endl;\r
- } \r
- cout<<" *****************************************"<<endl; \r
- cout<<endl;\r
- cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl;\r
- cout<<endl;\r
- \r
- for(Int_t rci=0;rci<2;rci++) // to be improved (calculate 6th and 8th order)\r
- {\r
- cout<<" "<<reducedCorrelations[rci].Data()<<":"<<endl;\r
- cout<<" from Q-vectors = "<<fDiffFlowCorrelationsPro[t][pe][rci]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl;\r
- cout<<" from nested loops = "<<fDiffFlowDirectCorrelations[t][pe][rci]->GetBinContent(1)<<endl;\r
- cout<<endl; \r
- } // end of for(Int_t rci=0;rci<4;rci++)\r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrelations(TString type, TString ptOrEta)\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta)\r
-{\r
- // Evaluate reduced correlations with nested loops without using the particle weights.\r
- \r
- // Remark 1: Reduced correlations are evaluated in pt bin number fCrossCheckInPtBinNo and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs.\r
- // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrelations[t][pe][ci], where indices runs as follows:\r
- // [0=RP,1=POI][0=Pt,1=Eta][0=<2'>,1=<4'>,2=<6'>,3=<8'>] \r
- // Remark 3: <2'> = <w2 cos(n*(psi1-phi2))>\r
- // <4'> = <w2 w3 w4 cos(n*(psi1+phi2-phi3-phi4))>\r
- // ...\r
- \r
- Int_t typeFlag = -1;\r
- Int_t ptEtaFlag = -1;\r
- if(type == "RP")\r
- {\r
- typeFlag = 0;\r
- } else if(type == "POI")\r
- {\r
- typeFlag = 1;\r
- } \r
- if(ptOrEta == "Pt")\r
- {\r
- ptEtaFlag = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- ptEtaFlag = 1;\r
- } \r
- // shortcuts:\r
- Int_t t = typeFlag;\r
- Int_t pe = ptEtaFlag;\r
- \r
- Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth};\r
- Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth};\r
- Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
- \r
- Int_t nPrim = anEvent->NumberOfTracks(); \r
- AliFlowTrackSimple *aftsTrack = NULL;\r
- \r
- Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.;\r
- Double_t wPhi2=1., wPhi3=1., wPhi4=1.;// wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.;\r
- \r
- Int_t n = fHarmonic; \r
- \r
- // 2'-particle correlations:\r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
- if(ptOrEta == "Pt")\r
- { \r
- if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue;\r
- } else if (ptOrEta == "Eta")\r
- {\r
- if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue; \r
- }\r
- psi1=aftsTrack->Phi(); \r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1) continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- // RP condition (!(first) particle in the correlator must be RP):\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi(); \r
- if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));\r
- // 2'-particle correlations: \r
- fDiffFlowDirectCorrelations[t][pe][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(1.*n*(psi1-phi2)),wPhi2); // <w2 cos(n*(psi1-phi2)) \r
- }//end of for(Int_t i2=0;i2<nPrim;i2++)\r
- }//end of for(Int_t i1=0;i1<nPrim;i1++)\r
- \r
- // 4'-particle correlations:\r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
- if(ptOrEta == "Pt")\r
- { \r
- if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue;\r
- } else if (ptOrEta == "Eta")\r
- {\r
- if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue; \r
- }\r
- psi1=aftsTrack->Phi();\r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1) continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- // RP condition (!(first) particle in the correlator must be RP): \r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));\r
- for(Int_t i3=0;i3<nPrim;i3++)\r
- { \r
- if(i3==i1||i3==i2) continue;\r
- aftsTrack=anEvent->GetTrack(i3);\r
- // RP condition (!(first) particle in the correlator must be RP):\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi3=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi())));\r
- for(Int_t i4=0;i4<nPrim;i4++)\r
- {\r
- if(i4==i1||i4==i2||i4==i3) continue;\r
- aftsTrack=anEvent->GetTrack(i4);\r
- // RP condition (!(first) particle in the correlator must be RP):\r
- if(!(aftsTrack->InRPSelection())) continue; \r
- phi4=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi())));\r
- // 4'-particle correlations <w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))>:\r
- fDiffFlowDirectCorrelations[t][pe][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3-phi4)),wPhi2*wPhi3*wPhi4); \r
- }//end of for(Int_t i4=0;i4<nPrim;i4++)\r
- }//end of for(Int_t i3=0;i3<nPrim;i3++)\r
- }//end of for(Int_t i2=0;i2<nPrim;i2++) \r
- }//end of for(Int_t i1=0;i1<nPrim;i1++) \r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta)\r
-\r
-\r
-//================================================================================================================================\r
-\r
- \r
-void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta)\r
-{\r
- // Evaluate with nested loops correction terms for non-uniform acceptance (both sin and cos terms) relevant for differential flow.\r
- \r
- // Remark 1: Reduced correction terms for non-uniform acceptance are evaluated in pt bin number fCrossCheckInPtBinNo \r
- // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs.\r
- // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrections[t][pe][sc][cti], where first three indices runs as: \r
- // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms], whilst the cti (correction term index) runs as follows: \r
- // cti: \r
- // 0: <<sc n(psi1)>>\r
- // 1: <<sc n(psi1+phi2)>> \r
- // 2: <<sc n(psi1+phi2-phi3)>>\r
- // 3: <<sc n(psi1-phi2-phi3)>>\r
- // 4:\r
- // 5:\r
- // 6:\r
- \r
- Int_t typeFlag = -1;\r
- Int_t ptEtaFlag = -1;\r
- if(type == "RP")\r
- {\r
- typeFlag = 0;\r
- } else if(type == "POI")\r
- {\r
- typeFlag = 1;\r
- } \r
- if(ptOrEta == "Pt")\r
- {\r
- ptEtaFlag = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- ptEtaFlag = 1;\r
- } \r
- // shortcuts:\r
- Int_t t = typeFlag;\r
- Int_t pe = ptEtaFlag;\r
- \r
- Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth};\r
- Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth};\r
- Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
- \r
- Int_t nPrim = anEvent->NumberOfTracks(); \r
- AliFlowTrackSimple *aftsTrack = NULL;\r
- \r
- Double_t psi1=0., phi2=0., phi3=0.;// phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.;\r
- \r
- Int_t n = fHarmonic; \r
- \r
- // 1-particle correction terms:\r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
- if(ptOrEta == "Pt")\r
- { \r
- if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue;\r
- } else if (ptOrEta == "Eta")\r
- {\r
- if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue; \r
- }\r
- psi1=aftsTrack->Phi(); \r
- // sin terms: \r
- fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*psi1),1.); // <<sin(n*(psi1))>> \r
- // cos terms: \r
- fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*psi1),1.); // <<cos(n*(psi1))>> \r
- }//end of for(Int_t i1=0;i1<nPrim;i1++)\r
- \r
- // 2-particle correction terms:\r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
- if(ptOrEta == "Pt")\r
- { \r
- if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue;\r
- } else if (ptOrEta == "Eta")\r
- {\r
- if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue; \r
- }\r
- psi1=aftsTrack->Phi(); \r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1) continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- // RP condition (!(first) particle in the correlator must be RP):\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi(); \r
- // sin terms: \r
- fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2)),1.); // <<sin(n*(psi1+phi2))>> \r
- // cos terms: \r
- fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2)),1.); // <<cos(n*(psi1+phi2))>> \r
- }//end of for(Int_t i2=0;i2<nPrim;i2++)\r
- }//end of for(Int_t i1=0;i1<nPrim;i1++) \r
- \r
- // 3-particle correction terms:\r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
- if(ptOrEta == "Pt")\r
- { \r
- if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;\r
- } else if (ptOrEta == "Eta")\r
- {\r
- if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; \r
- }\r
- psi1=aftsTrack->Phi();\r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1) continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- // RP condition (!(first) particle in the correlator must be RP):\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi();\r
- for(Int_t i3=0;i3<nPrim;i3++)\r
- {\r
- if(i3==i1||i3==i2) continue;\r
- aftsTrack=anEvent->GetTrack(i3);\r
- // RP condition (!(first) particle in the correlator must be RP):\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi3=aftsTrack->Phi();\r
- // sin terms: \r
- fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2-phi3)),1.); // <<sin(n*(psi1+phi2-phi3))>> \r
- fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1-phi2-phi3)),1.); // <<sin(n*(psi1-phi2-phi3))>> \r
- // cos terms: \r
- fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3)),1.); // <<cos(n*(psi1+phi2-phi3))>> \r
- fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-phi2-phi3)),1.); // <<cos(n*(psi1-phi2-phi3))>> \r
- }//end of for(Int_t i3=0;i3<nPrim;i3++) \r
- }//end of for(Int_t i2=0;i2<nPrim;i2++) \r
- }//end of for(Int_t i1=0;i1<nPrim;i1++)\r
- \r
-} // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta)\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrectionTermsForNUA(TString type, TString ptOrEta)\r
-{\r
- // Compare corrections temrs for non-uniform acceptance needed for diff. flow calculated with nested loops and those calculated from Q-vectors\r
- \r
- Int_t typeFlag = -1;\r
- Int_t ptEtaFlag = -1;\r
- if(type == "RP")\r
- {\r
- typeFlag = 0;\r
- } else if(type == "POI")\r
- {\r
- typeFlag = 1;\r
- } \r
- if(ptOrEta == "Pt")\r
- {\r
- ptEtaFlag = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- ptEtaFlag = 1;\r
- } \r
- // shortcuts:\r
- Int_t t = typeFlag;\r
- Int_t pe = ptEtaFlag;\r
- \r
- TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) \r
- TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) \r
- //TString sinCosFlag[2] = {"sin","cos"}; // to be improved (eventually promote to data member)\r
- TString reducedCorrectionSinTerms[4] = {"<<sin(n(psi1))>>","<<sin(n(psi1+phi2))>>","<<sin(n*(psi1+phi2-phi3))>>","<<sin(n*(psi1-phi2-phi3))>>"}; // to be improved (access this from pro or hist)\r
- TString reducedCorrectionCosTerms[4] = {"<<cos(n(psi1))>>","<<cos(n(psi1+phi2))>>","<<cos(n*(psi1+phi2-phi3))>>","<<cos(n*(psi1-phi2-phi3))>>"}; // to be improved (access this from pro or hist)\r
- Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth};\r
- Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth};\r
- \r
- Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo};\r
- \r
- cout<<endl;\r
- cout<<" ******************************************"<<endl;\r
- cout<<" **** cross-checking the correction ****"<<endl;\r
- cout<<" **** terms for non-uniform acceptance ****"<<endl;
- cout<<" **** for differential flow ("<<rpORpoiString[t]<<") ****"<<endl;\r
- if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
- {\r
- cout<<" **** (particle weights not used) ****"<<endl;\r
- } else\r
- {\r
- cout<<" **** (particle weights used) ****"<<endl;\r
- } \r
- cout<<" ******************************************"<<endl; \r
- cout<<endl;\r
- cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl;\r
- cout<<endl;\r
- \r
- for(Int_t cti=0;cti<4;cti++) // correction term index\r
- {\r
- for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
- {\r
- if(sc==0) // to be improved (this can be implemented better)\r
- { \r
- cout<<" "<<reducedCorrectionSinTerms[cti].Data()<<":"<<endl;\r
- } else\r
- {\r
- cout<<" "<<reducedCorrectionCosTerms[cti].Data()<<":"<<endl; \r
- }\r
- cout<<" from Q-vectors = "<<fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl;\r
- cout<<" from nested loops = "<<fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]->GetBinContent(1)<<endl;\r
- cout<<endl; \r
- } \r
- } // end of for(Int_t rci=0;rci<4;rci++)\r
-\r
-} // end of void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrectionTermsForNUA(TString type, TString ptOrEta)\r
-\r
-\r
//================================================================================================================================
-\r
-void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights()\r
-{\r
- // Calculate corrections using particle weights for non-uniform acceptance of the detector for no-name integrated flow (cos terms).\r
- \r
- // **********************************************************************\r
- // **** weighted corrections for non-uniform acceptance (cos terms): ****\r
- // **********************************************************************\r
+
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights()
+{
+ // Calculate corrections using particle weights for non-uniform acceptance of the detector for no-name integrated flow (cos terms).
- // Remark 1: When particle weights are used the binning of fIntFlowCorrectionTermsForNUAPro[1] is organized as follows:\r
+ // **********************************************************************
+ // **** weighted corrections for non-uniform acceptance (cos terms): ****
+ // **********************************************************************
+
+ // Remark 1: When particle weights are used the binning of fIntFlowCorrectionTermsForNUAPro[1] is organized as follows:
//
- // 1st bin: <<w1 cos(n*(phi1))>> = cosP1nW1\r
- // 2nd bin: <<w1 w2 cos(n*(phi1+phi2))>> = cosP1nP1nW1W1\r
- // 3rd bin: <<w1 w2 w3 cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1nW1W1W1 \r
- // ...\r
-
- // multiplicity (number of particles used to determine the reaction plane)\r
- Double_t dMult = (*fSMpk)(0,0);\r
- \r
- // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
- Double_t dReQ1n1k = (*fReQ)(0,1);\r
- Double_t dReQ2n2k = (*fReQ)(1,2);\r
- //Double_t dReQ3n3k = (*fReQ)(2,3);\r
- //Double_t dReQ4n4k = (*fReQ)(3,4);\r
- Double_t dReQ1n3k = (*fReQ)(0,3);\r
- Double_t dImQ1n1k = (*fImQ)(0,1);\r
- Double_t dImQ2n2k = (*fImQ)(1,2);\r
- //Double_t dImQ3n3k = (*fImQ)(2,3);\r
- //Double_t dImQ4n4k = (*fImQ)(3,4);\r
- //Double_t dImQ1n3k = (*fImQ)(0,3);\r
-\r
- // dMs are variables introduced in order to simplify some Eqs. bellow:\r
- //..............................................................................................\r
- Double_t dM11 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j\r
+ // 1st bin: <<w1 cos(n*(phi1))>> = cosP1nW1
+ // 2nd bin: <<w1 w2 cos(n*(phi1+phi2))>> = cosP1nP1nW1W1
+ // 3rd bin: <<w1 w2 w3 cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1nW1W1W1
+ // ...
+
+ // multiplicity (number of particles used to determine the reaction plane)
+ Double_t dMult = (*fSMpk)(0,0);
+
+ // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
+ Double_t dReQ1n1k = (*fReQ)(0,1);
+ Double_t dReQ2n2k = (*fReQ)(1,2);
+ //Double_t dReQ3n3k = (*fReQ)(2,3);
+ //Double_t dReQ4n4k = (*fReQ)(3,4);
+ Double_t dReQ1n3k = (*fReQ)(0,3);
+ Double_t dImQ1n1k = (*fImQ)(0,1);
+ Double_t dImQ2n2k = (*fImQ)(1,2);
+ //Double_t dImQ3n3k = (*fImQ)(2,3);
+ //Double_t dImQ4n4k = (*fImQ)(3,4);
+ //Double_t dImQ1n3k = (*fImQ)(0,3);
+
+ // dMs are variables introduced in order to simplify some Eqs. bellow:
+ //..............................................................................................
+ Double_t dM11 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j
Double_t dM111 = (*fSMpk)(2,1)-3.*(*fSMpk)(0,2)*(*fSMpk)(0,1)
- + 2.*(*fSMpk)(0,3); // dM111 = sum_{i,j,k=1,i!=j!=k}^M w_i w_j w_k\r
- //..............................................................................................\r
- \r // 1-particle:\r
- Double_t cosP1nW1 = 0.; // <<w1 cos(n*(phi1))>>\r
- \r
- if(dMult>0 && (*fSMpk)(0,1) !=0.)\r
- {\r
- cosP1nW1 = dReQ1n1k/(*fSMpk)(0,1); \r
- \r
- // average weighted 1-particle correction (cos terms) for non-uniform acceptance for single event:\r
- fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(1,cosP1nW1);\r
- \r
- // final average weighted 1-particle correction (cos terms) for non-uniform acceptance for all events:\r
- fIntFlowCorrectionTermsForNUAPro[1]->Fill(0.5,cosP1nW1,(*fSMpk)(0,1)); \r
- } \r
- \r
- // 2-particle:\r
- Double_t cosP1nP1nW1W1 = 0.; // <<w1 w2 cos(n*(phi1+phi2))>>\r
- \r
- if(dMult>1 && dM11 !=0.)\r
- {\r
- cosP1nP1nW1W1 = (pow(dReQ1n1k,2)-pow(dImQ1n1k,2)-dReQ2n2k)/dM11; \r
- \r
- // average weighted 2-particle correction (cos terms) for non-uniform acceptance for single event:\r
- fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(2,cosP1nP1nW1W1);\r
- \r
- // final average weighted 2-particle correction (cos terms) for non-uniform acceptance for all events:\r
- fIntFlowCorrectionTermsForNUAPro[1]->Fill(1.5,cosP1nP1nW1W1,dM11); \r
- } \r
- \r
- // 3-particle:\r
- Double_t cosP1nM1nM1nW1W1W1 = 0.; // <<w1 w2 w3 cos(n*(phi1-phi2-phi3))>>\r
- \r
- if(dMult>2 && dM111 !=0.)\r
- {\r
+ + 2.*(*fSMpk)(0,3); // dM111 = sum_{i,j,k=1,i!=j!=k}^M w_i w_j w_k
+ //..............................................................................................
+ // 1-particle:
+ Double_t cosP1nW1 = 0.; // <<w1 cos(n*(phi1))>>
+
+ if(dMult>0 && TMath::Abs((*fSMpk)(0,1))>1e-6)
+ {
+ cosP1nW1 = dReQ1n1k/(*fSMpk)(0,1);
+
+ // average weighted 1-particle correction (cos terms) for non-uniform acceptance for single event:
+ fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(1,cosP1nW1);
+
+ // final average weighted 1-particle correction (cos terms) for non-uniform acceptance for all events:
+ fIntFlowCorrectionTermsForNUAPro[1]->Fill(0.5,cosP1nW1,(*fSMpk)(0,1));
+ }
+
+ // 2-particle:
+ Double_t cosP1nP1nW1W1 = 0.; // <<w1 w2 cos(n*(phi1+phi2))>>
+
+ if(dMult>1 && TMath::Abs(dM11)>1e-6)
+ {
+ cosP1nP1nW1W1 = (pow(dReQ1n1k,2)-pow(dImQ1n1k,2)-dReQ2n2k)/dM11;
+
+ // average weighted 2-particle correction (cos terms) for non-uniform acceptance for single event:
+ fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(2,cosP1nP1nW1W1);
+
+ // final average weighted 2-particle correction (cos terms) for non-uniform acceptance for all events:
+ fIntFlowCorrectionTermsForNUAPro[1]->Fill(1.5,cosP1nP1nW1W1,dM11);
+ }
+
+ // 3-particle:
+ Double_t cosP1nM1nM1nW1W1W1 = 0.; // <<w1 w2 w3 cos(n*(phi1-phi2-phi3))>>
+
+ if(dMult>2 && TMath::Abs(dM111)>1e-6)
+ {
cosP1nM1nM1nW1W1W1 = (dReQ1n1k*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2))
- dReQ1n1k*dReQ2n2k-dImQ1n1k*dImQ2n2k
- 2.*((*fSMpk)(0,2))*dReQ1n1k
- + 2.*dReQ1n3k) \r
- / dM111; \r
- \r
- // average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for single event:\r
- fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(3,cosP1nM1nM1nW1W1W1);\r
- \r
- // final average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for all events:\r
- fIntFlowCorrectionTermsForNUAPro[1]->Fill(2.5,cosP1nM1nM1nW1W1W1,dM111); \r
- } \r
- \r
-} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights()\r
-\r
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights()\r
-{\r
- // calculate corrections using particle weights for non-uniform acceptance of the detector for no-name integrated flow (sin terms)\r
- \r
- // **********************************************************************\r
- // **** weighted corrections for non-uniform acceptance (sin terms): ****\r
- // **********************************************************************\r
-
- // Remark 1: When particle weights are used the binning of fIntFlowCorrectionTermsForNUAPro[0] is organized as follows:\r
+ + 2.*dReQ1n3k)
+ / dM111;
+
+ // average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for single event:
+ fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(3,cosP1nM1nM1nW1W1W1);
+
+ // final average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for all events:
+ fIntFlowCorrectionTermsForNUAPro[1]->Fill(2.5,cosP1nM1nM1nW1W1W1,dM111);
+ }
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights()
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights()
+{
+ // calculate corrections using particle weights for non-uniform acceptance of the detector for no-name integrated flow (sin terms)
+
+ // **********************************************************************
+ // **** weighted corrections for non-uniform acceptance (sin terms): ****
+ // **********************************************************************
+
+ // Remark 1: When particle weights are used the binning of fIntFlowCorrectionTermsForNUAPro[0] is organized as follows:
//
- // 1st bin: <<w1 sin(n*(phi1))>> = sinP1nW1\r
- // 2nd bin: <<w1 w2 sin(n*(phi1+phi2))>> = sinP1nP1nW1W1\r
- // 3rd bin: <<w1 w2 w3 sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1nW1W1W1 \r
- // ...\r
-
- // multiplicity (number of particles used to determine the reaction plane)\r
- Double_t dMult = (*fSMpk)(0,0);\r
- \r
- // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
- Double_t dReQ1n1k = (*fReQ)(0,1);\r
- Double_t dReQ2n2k = (*fReQ)(1,2);\r
- //Double_t dReQ3n3k = (*fReQ)(2,3);\r
- //Double_t dReQ4n4k = (*fReQ)(3,4);\r
- //Double_t dReQ1n3k = (*fReQ)(0,3);\r
- Double_t dImQ1n1k = (*fImQ)(0,1);\r
- Double_t dImQ2n2k = (*fImQ)(1,2);\r
- //Double_t dImQ3n3k = (*fImQ)(2,3);\r
- //Double_t dImQ4n4k = (*fImQ)(3,4);\r
- Double_t dImQ1n3k = (*fImQ)(0,3);\r
-\r
- // dMs are variables introduced in order to simplify some Eqs. bellow:\r
- //..............................................................................................\r
- Double_t dM11 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j\r
+ // 1st bin: <<w1 sin(n*(phi1))>> = sinP1nW1
+ // 2nd bin: <<w1 w2 sin(n*(phi1+phi2))>> = sinP1nP1nW1W1
+ // 3rd bin: <<w1 w2 w3 sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1nW1W1W1
+ // ...
+
+ // multiplicity (number of particles used to determine the reaction plane)
+ Double_t dMult = (*fSMpk)(0,0);
+
+ // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
+ Double_t dReQ1n1k = (*fReQ)(0,1);
+ Double_t dReQ2n2k = (*fReQ)(1,2);
+ //Double_t dReQ3n3k = (*fReQ)(2,3);
+ //Double_t dReQ4n4k = (*fReQ)(3,4);
+ //Double_t dReQ1n3k = (*fReQ)(0,3);
+ Double_t dImQ1n1k = (*fImQ)(0,1);
+ Double_t dImQ2n2k = (*fImQ)(1,2);
+ //Double_t dImQ3n3k = (*fImQ)(2,3);
+ //Double_t dImQ4n4k = (*fImQ)(3,4);
+ Double_t dImQ1n3k = (*fImQ)(0,3);
+
+ // dMs are variables introduced in order to simplify some Eqs. bellow:
+ //..............................................................................................
+ Double_t dM11 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j
Double_t dM111 = (*fSMpk)(2,1)-3.*(*fSMpk)(0,2)*(*fSMpk)(0,1)
- + 2.*(*fSMpk)(0,3); // dM111 = sum_{i,j,k=1,i!=j!=k}^M w_i w_j w_k\r
- //..............................................................................................\r
- \r
- // 1-particle:\r
- Double_t sinP1nW1 = 0.; // <<w1 sin(n*(phi1))>>\r
- \r
- if(dMult>0 && (*fSMpk)(0,1) !=0.)\r
- {\r
- sinP1nW1 = dImQ1n1k/((*fSMpk)(0,1)); \r
- \r
- // average weighted 1-particle correction (sin terms) for non-uniform acceptance for single event:\r
- fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(1,sinP1nW1);\r
- \r
- // final average weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: \r
- fIntFlowCorrectionTermsForNUAPro[0]->Fill(0.5,sinP1nW1,(*fSMpk)(0,1)); \r
- } \r
- \r
- // 2-particle:\r
- Double_t sinP1nP1nW1W1 = 0.; // <<w1 w2 sin(n*(phi1+phi2))>>\r
- \r
- if(dMult>1 && dM11 !=0.)\r
- {\r
- sinP1nP1nW1W1 = (2.*dReQ1n1k*dImQ1n1k-dImQ2n2k)/dM11; \r
- \r
- // average weighted 2-particle correction (sin terms) for non-uniform acceptance for single event:\r
- fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(2,sinP1nP1nW1W1);\r
- \r
- // final average weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: \r
- fIntFlowCorrectionTermsForNUAPro[0]->Fill(1.5,sinP1nP1nW1W1,dM11); \r
- } \r
- \r
- // 3-particle:\r
- Double_t sinP1nM1nM1nW1W1W1 = 0.; // <<w1 w2 w3 sin(n*(phi1-phi2-phi3))>>\r
- \r
- if(dMult>2 && dM111 !=0.)\r
- {\r
+ + 2.*(*fSMpk)(0,3); // dM111 = sum_{i,j,k=1,i!=j!=k}^M w_i w_j w_k
+ //..............................................................................................
+
+ // 1-particle:
+ Double_t sinP1nW1 = 0.; // <<w1 sin(n*(phi1))>>
+
+ if(dMult>0 && TMath::Abs((*fSMpk)(0,1))>1e-6)
+ {
+ sinP1nW1 = dImQ1n1k/((*fSMpk)(0,1));
+
+ // average weighted 1-particle correction (sin terms) for non-uniform acceptance for single event:
+ fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(1,sinP1nW1);
+
+ // final average weighted 1-particle correction (sin terms) for non-uniform acceptance for all events:
+ fIntFlowCorrectionTermsForNUAPro[0]->Fill(0.5,sinP1nW1,(*fSMpk)(0,1));
+ }
+
+ // 2-particle:
+ Double_t sinP1nP1nW1W1 = 0.; // <<w1 w2 sin(n*(phi1+phi2))>>
+
+ if(dMult>1 && TMath::Abs(dM11)>1e-6)
+ {
+ sinP1nP1nW1W1 = (2.*dReQ1n1k*dImQ1n1k-dImQ2n2k)/dM11;
+
+ // average weighted 2-particle correction (sin terms) for non-uniform acceptance for single event:
+ fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(2,sinP1nP1nW1W1);
+
+ // final average weighted 1-particle correction (sin terms) for non-uniform acceptance for all events:
+ fIntFlowCorrectionTermsForNUAPro[0]->Fill(1.5,sinP1nP1nW1W1,dM11);
+ }
+
+ // 3-particle:
+ Double_t sinP1nM1nM1nW1W1W1 = 0.; // <<w1 w2 w3 sin(n*(phi1-phi2-phi3))>>
+
+ if(dMult>2 && TMath::Abs(dM111)>1e-6)
+ {
sinP1nM1nM1nW1W1W1 = (-dImQ1n1k*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2))
+ dReQ1n1k*dImQ2n2k-dImQ1n1k*dReQ2n2k
+ 2.*((*fSMpk)(0,2))*dImQ1n1k
- - 2.*dImQ1n3k)\r
- / dM111; \r
- \r
- // average weighted 3-particle correction (sin terms) for non-uniform acceptance for single event:\r
- fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(3,sinP1nM1nM1nW1W1W1);\r
- \r
- // final average weighted 3-particle correction (sin terms) for non-uniform acceptance for all events: \r
- fIntFlowCorrectionTermsForNUAPro[0]->Fill(2.5,sinP1nM1nM1nW1W1W1,dM111); \r
- } \r
- \r
-} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights()\r
-\r
-\r
+ - 2.*dImQ1n3k)
+ / dM111;
+
+ // average weighted 3-particle correction (sin terms) for non-uniform acceptance for single event:
+ fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(3,sinP1nM1nM1nW1W1W1);
+
+ // final average weighted 3-particle correction (sin terms) for non-uniform acceptance for all events:
+ fIntFlowCorrectionTermsForNUAPro[0]->Fill(2.5,sinP1nM1nM1nW1W1W1,dM111);
+ }
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights()
+
+
//================================================================================================================================
-\r
-\r
-void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent)\r
-{\r
- // Evaluate with nested loops correction terms for non-uniform acceptance for integrated flow (using the particle weights). \r
-\r
+
+
+void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent)
+{
+ // Evaluate with nested loops correction terms for non-uniform acceptance for integrated flow (using the particle weights).
+
// Results are stored in profiles fIntFlowDirectCorrectionTermsForNUA[0] (sin terms) and
// fIntFlowDirectCorrectionTermsForNUA[1] (cos terms).
- \r
+
// Remark 1: When particle weights are used the binning of fIntFlowDirectCorrectionTermsForNUA[sc] is
- // organized as follows (sc stands for either sin or cos):\r
- //\r
- // 1st bin: <<w1 sc(n*(phi1))>> = scP1nW1\r
- // 2nd bin: <<w1 w2 sc(n*(phi1+phi2))>> = scP1nP1nW1W1\r
- // 3rd bin: <<w1 w2 w3 sc(n*(phi1-phi2-phi3))>> = scP1nM1nM1nW1W1W1 \r
- // ...\r
- \r
- Int_t nPrim = anEvent->NumberOfTracks(); \r
- AliFlowTrackSimple *aftsTrack = NULL;\r
- //Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.;\r
- //Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.;\r
- Double_t phi1=0., phi2=0., phi3=0.;\r
- Double_t wPhi1=1., wPhi2=1., wPhi3=1.;\r
- Int_t n = fHarmonic; \r
- Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?)\r
- Double_t dMult = (*fSMpk)(0,0);\r
- cout<<endl;\r
- cout<<"Correction terms for non-uniform acceptance: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl;\r
- if(dMult<1)\r
- {\r
- cout<<"... skipping this event (multiplicity too low) ..."<<endl;\r
- } else if (dMult>fMaxAllowedMultiplicity)\r
- {\r
- cout<<"... skipping this event (multiplicity too high) ..."<<endl;\r
- } else \r
- { \r
- cout<<"... evaluating nested loops (using particle weights) ..."<<endl;\r
- } \r
- \r
- // 1-particle correction terms using particle weights: \r
- if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity)\r
- {\r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi1=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi())));\r
+ // organized as follows (sc stands for either sin or cos):
+ //
+ // 1st bin: <<w1 sc(n*(phi1))>> = scP1nW1
+ // 2nd bin: <<w1 w2 sc(n*(phi1+phi2))>> = scP1nP1nW1W1
+ // 3rd bin: <<w1 w2 w3 sc(n*(phi1-phi2-phi3))>> = scP1nM1nM1nW1W1W1
+ // ...
+
+ Int_t nPrim = anEvent->NumberOfTracks();
+ AliFlowTrackSimple *aftsTrack = NULL;
+ //Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.;
+ //Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.;
+ Double_t phi1=0., phi2=0., phi3=0.;
+ Double_t wPhi1=1., wPhi2=1., wPhi3=1.;
+ Int_t n = fHarmonic;
+ Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?)
+ Double_t dMult = (*fSMpk)(0,0);
+ cout<<endl;
+ cout<<"Correction terms for non-uniform acceptance: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl;
+ if(dMult<1)
+ {
+ cout<<"... skipping this event (multiplicity too low) ..."<<endl;
+ } else if (dMult>fMaxAllowedMultiplicity)
+ {
+ cout<<"... skipping this event (multiplicity too high) ..."<<endl;
+ } else
+ {
+ cout<<"... evaluating nested loops (using particle weights) ..."<<endl;
+ }
+
+ // 1-particle correction terms using particle weights:
+ if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity)
+ {
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi1=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi())));
// 1-particle correction terms using particle weights:
- if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(0.5,sin(n*phi1),wPhi1); // <w1 sin(n*phi1)>\r
- if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(0.5,cos(n*phi1),wPhi1); // <w1 cos(n*phi1)>\r
+ if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(0.5,sin(n*phi1),wPhi1); // <w1 sin(n*phi1)>
+ if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(0.5,cos(n*phi1),wPhi1); // <w1 cos(n*phi1)>
} // end of for(Int_t i1=0;i1<nPrim;i1++)
} // end of if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity)
- // 2-particle correction terms using particle weights: \r
- if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity)\r
- {\r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi1=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi())));\r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1)continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); \r
- if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush;\r
+ // 2-particle correction terms using particle weights:
+ if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity)
+ {
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi1=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi())));
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1)continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));
+ if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush;
// 2-p correction terms using particle weights:
- if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(1.5,sin(n*(phi1+phi2)),wPhi1*wPhi2); // <w1 w2 sin(n*(phi1+phi2))>\r
- if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(1.5,cos(n*(phi1+phi2)),wPhi1*wPhi2); // <w1 w2 cos(n*(phi1+phi2))>\r
- } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
- } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
- } // end of if(nPrim>=2)\r
-\r
- // 3-particle correction terms using particle weights: \r
- if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity)\r
- { \r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi1=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi())));\r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1)continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));\r
- for(Int_t i3=0;i3<nPrim;i3++)\r
- {\r
- if(i3==i1||i3==i2)continue;\r
- aftsTrack=anEvent->GetTrack(i3);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi3=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi())));\r
- if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush;\r
+ if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(1.5,sin(n*(phi1+phi2)),wPhi1*wPhi2); // <w1 w2 sin(n*(phi1+phi2))>
+ if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(1.5,cos(n*(phi1+phi2)),wPhi1*wPhi2); // <w1 w2 cos(n*(phi1+phi2))>
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)
+ } // end of if(nPrim>=2)
+
+ // 3-particle correction terms using particle weights:
+ if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity)
+ {
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi1=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi())));
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1)continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));
+ for(Int_t i3=0;i3<nPrim;i3++)
+ {
+ if(i3==i1||i3==i2)continue;
+ aftsTrack=anEvent->GetTrack(i3);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi3=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi())));
+ if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush;
// 3-p correction terms using particle weights:
- if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(2.5,sin(n*(phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 sin(n*(phi1-phi2-phi3))>\r
- if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(2.5,cos(n*(phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 cos(n*(phi1-phi2-phi3))>\r
- } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
- } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
- } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
- } // end of if(nPrim>=3)\r
- \r
+ if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(2.5,sin(n*(phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 sin(n*(phi1-phi2-phi3))>
+ if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(2.5,cos(n*(phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 cos(n*(phi1-phi2-phi3))>
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)
+ } // end of if(nPrim>=3)
+
/*
- if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity)\r
- {\r
- // 4 nested loops multiparticle correlations using particle weights: \r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi1=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi())));\r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1)continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));\r
- for(Int_t i3=0;i3<nPrim;i3++)\r
- {\r
- if(i3==i1||i3==i2)continue;\r
- aftsTrack=anEvent->GetTrack(i3);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi3=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi())));\r
- for(Int_t i4=0;i4<nPrim;i4++)\r
- {\r
- if(i4==i1||i4==i2||i4==i3)continue;\r
- aftsTrack=anEvent->GetTrack(i4);\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi4=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi())));\r
- if(nPrim>=4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; // to be improved (replace eventually this if statement with if(nPrim==4))\r
- // 4-p correlations using particle weights:\r
- if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(10.5,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); \r
- // extra correlations: \r
- // 2-p extra correlations (do not appear if particle weights are not used):\r
- // ...\r
- // 3-p extra correlations (do not appear if particle weights are not used):\r
- // ...\r
- // 4-p extra correlations (do not appear if particle weights are not used):\r
- // ...\r
- } // end of for(Int_t i4=0;i4<nPrim;i4++) \r
- } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
- } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
- } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
- } // end of if(nPrim>=4)\r
-
- */\r
-
- cout<<endl; \r
-\r
-} // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent)\r
-\r
-\r
+ if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity)
+ {
+ // 4 nested loops multiparticle correlations using particle weights:
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi1=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi())));
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1)continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));
+ for(Int_t i3=0;i3<nPrim;i3++)
+ {
+ if(i3==i1||i3==i2)continue;
+ aftsTrack=anEvent->GetTrack(i3);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi3=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi())));
+ for(Int_t i4=0;i4<nPrim;i4++)
+ {
+ if(i4==i1||i4==i2||i4==i3)continue;
+ aftsTrack=anEvent->GetTrack(i4);
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi4=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi())));
+ if(nPrim>=4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; // to be improved (replace eventually this if statement with if(nPrim==4))
+ // 4-p correlations using particle weights:
+ if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(10.5,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4);
+ // extra correlations:
+ // 2-p extra correlations (do not appear if particle weights are not used):
+ // ...
+ // 3-p extra correlations (do not appear if particle weights are not used):
+ // ...
+ // 4-p extra correlations (do not appear if particle weights are not used):
+ // ...
+ } // end of for(Int_t i4=0;i4<nPrim;i4++)
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)
+ } // end of if(nPrim>=4)
+
+ */
+
+ cout<<endl;
+
+} // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent)
+
+
//================================================================================================================================
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights(TString type, TString ptOrEta)\r
-{\r
- // Calculate correction terms for non-uniform acceptance for differential flow (cos terms) using particle weights.\r
+
+
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights(TString type, TString ptOrEta)
+{
+ // Calculate correction terms for non-uniform acceptance for differential flow (cos terms) using particle weights.
- // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][1][cti], where cti runs as follows:\r
+ // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][1][cti], where cti runs as follows:
//
- // 0: <<cos n(psi)>>\r
- // 1: <<w2 cos n(psi1+phi2)>>\r
- // 2: <<w2 w3 cos n(psi1+phi2-phi3)>>\r
- // 3: <<w2 w3 cos n(psi1-phi2-phi3)>>\r
- // 4:\r
- // 5:\r
- // 6:\r
- \r
- // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
- Double_t dReQ1n1k = (*fReQ)(0,1);\r
- Double_t dReQ2n2k = (*fReQ)(1,2);\r
- //Double_t dReQ1n3k = (*fReQ)(0,3);\r
- //Double_t dReQ4n4k = (*fReQ)(3,4);\r
- Double_t dImQ1n1k = (*fImQ)(0,1);\r
- Double_t dImQ2n2k = (*fImQ)(1,2);\r
- //Double_t dImQ1n3k = (*fImQ)(0,3);\r
- //Double_t dImQ4n4k = (*fImQ)(3,4);\r
-
- // S^M_{p,k} (see .h file for the definition of fSMpk):\r
- Double_t dSM1p1k = (*fSMpk)(0,1);\r
- Double_t dSM1p2k = (*fSMpk)(0,2);\r
- Double_t dSM2p1k = (*fSMpk)(1,1);\r
-\r
- Int_t t = -1; // type flag \r
- Int_t pe = -1; // ptEta flag\r
- \r
- if(type == "RP")\r
- {\r
- t = 0;\r
- } else if(type == "POI")\r
- {\r
- t = 1;\r
- }\r
-\r
- if(ptOrEta == "Pt")\r
- {\r
- pe = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- pe = 1;\r
- }\r
- \r
- Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
- Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
- //Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
- Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
-
- // looping over all bins and calculating correction terms: \r
- for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- {\r
- // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): \r
- Double_t p1n0kRe = 0.;\r
- Double_t p1n0kIm = 0.;\r
-\r
- // number of POIs in particular pt or eta bin:\r
- Double_t mp = 0.;\r
-\r
- // real and imaginary parts of q_{m*n,0} (weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin):\r
- Double_t q1n2kRe = 0.;\r
- Double_t q1n2kIm = 0.;\r
- Double_t q2n1kRe = 0.;\r
- Double_t q2n1kIm = 0.;\r
+ // 0: <<cos n(psi)>>
+ // 1: <<w2 cos n(psi1+phi2)>>
+ // 2: <<w2 w3 cos n(psi1+phi2-phi3)>>
+ // 3: <<w2 w3 cos n(psi1-phi2-phi3)>>
+ // 4:
+ // 5:
+ // 6:
+
+ // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
+ Double_t dReQ1n1k = (*fReQ)(0,1);
+ Double_t dReQ2n2k = (*fReQ)(1,2);
+ //Double_t dReQ1n3k = (*fReQ)(0,3);
+ //Double_t dReQ4n4k = (*fReQ)(3,4);
+ Double_t dImQ1n1k = (*fImQ)(0,1);
+ Double_t dImQ2n2k = (*fImQ)(1,2);
+ //Double_t dImQ1n3k = (*fImQ)(0,3);
+ //Double_t dImQ4n4k = (*fImQ)(3,4);
+
+ // S^M_{p,k} (see .h file for the definition of fSMpk):
+ Double_t dSM1p1k = (*fSMpk)(0,1);
+ Double_t dSM1p2k = (*fSMpk)(0,2);
+ Double_t dSM2p1k = (*fSMpk)(1,1);
+
+ Int_t t = -1; // type flag
+ Int_t pe = -1; // ptEta flag
+
+ if(type == "RP")
+ {
+ t = 0;
+ } else if(type == "POI")
+ {
+ t = 1;
+ }
+
+ if(ptOrEta == "Pt")
+ {
+ pe = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ pe = 1;
+ }
+
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};
+ Double_t minPtEta[2] = {fPtMin,fEtaMin};
+ //Double_t maxPtEta[2] = {fPtMax,fEtaMax};
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};
+
+ // looping over all bins and calculating correction terms:
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+ {
+ // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin):
+ Double_t p1n0kRe = 0.;
+ Double_t p1n0kIm = 0.;
+
+ // number of POIs in particular pt or eta bin:
+ Double_t mp = 0.;
+
+ // real and imaginary parts of q_{m*n,0} (weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin):
+ Double_t q1n2kRe = 0.;
+ Double_t q1n2kIm = 0.;
+ Double_t q2n1kRe = 0.;
+ Double_t q2n1kIm = 0.;
- // s_{1,1}, s_{1,2} // to be improved (add explanation) \r
- Double_t s1p1k = 0.; \r
- Double_t s1p2k = 0.; \r
+ // s_{1,1}, s_{1,2} // to be improved (add explanation)
+ Double_t s1p1k = 0.;
+ Double_t s1p2k = 0.;
- // number of particles which are both RPs and POIs in particular pt or eta bin:\r
+ // number of particles which are both RPs and POIs in particular pt or eta bin:
Double_t mq = 0.;
- \r
- // M0111 from Eq. (118) in QC2c (to be improved (notation))\r
- Double_t dM01 = 0.;\r
- Double_t dM011 = 0.;\r
- if(type == "POI")\r
- {\r
+ // M0111 from Eq. (118) in QC2c (to be improved (notation))
+ Double_t dM01 = 0.;
+ Double_t dM011 = 0.;
+
+ if(type == "POI")
+ {
+ // q_{m*n,k}:
+ q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b))
+ * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b));
+ q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b))
+ * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b));
+ q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b))
+ * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b));
+ q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b))
+ * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b));
+ mq = fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)
+
+ s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.);
+ s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.);
+ }else if(type == "RP")
+ {
+ // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!))
+ q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b))
+ * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b));
+ q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b))
+ * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b));
+ q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b))
+ * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b));
+ q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b))
+ * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b));
+ // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation)
+ s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.);
+ s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.);
+ //s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.);
+
+ mq = fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)
+ }
+
+ if(type == "POI")
+ {
// p_{m*n,k}:
- p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b))\r
- * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b));\r
- p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) \r
+ p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b))
+ * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b));
+ p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b))
* fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b));
- mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) \r
- // q_{m*n,k}:\r
- q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b))\r
- * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b));\r
- q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b))\r
- * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); \r
- q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b))\r
- * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b));\r
- q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b))\r
- * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); \r
- mq = fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
-
- s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); \r
- s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); \r
-
- // M01 from Eq. (118) in QC2c (to be improved (notation)):\r
+ mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)
+ // M01 from Eq. (118) in QC2c (to be improved (notation)):
dM01 = mp*dSM1p1k-s1p1k;
dM011 = mp*(dSM2p1k-dSM1p2k)
- 2.*(s1p1k*dSM1p1k-s1p2k);
-
+
// typeFlag = RP (0) or POI (1):
- t = 1; \r
- }else if(type == "RP")\r
- {\r
- /*
- // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) \r
- q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b))\r
- * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b));\r
- q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b))\r
- * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b));\r
- q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b))\r
- * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b));\r
- q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b))\r
- * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b));\r
- // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) \r
- s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); \r
- s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); \r
- s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); \r
- \r
- // to be improved (cross-checked):\r
- p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b))\r
- * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
- p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) \r
- * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
- mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
- // typeFlag = RP (0) or POI (1): \r
- t = 0;
- */\r
- } \r
- \r
- // <<cos n(psi1)>>:\r
- Double_t cosP1nPsi = 0.;\r
- if(mp)\r
- {\r
- cosP1nPsi = p1n0kRe/mp;\r
- \r
- // fill profile for <<cos n(psi1)>>:\r
- fDiffFlowCorrectionTermsForNUAPro[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi,mp);\r
- // histogram to store <cos n(psi1)> e-b-e (needed in some other methods):\r
- fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][0]->SetBinContent(b,cosP1nPsi);\r
+ t = 1;
+ } else if(type == "RP")
+ {
+ // to be improved (cross-checked):
+ p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b))
+ * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b));
+ p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b))
+ * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b));
+ mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)
+ // M01 from Eq. (118) in QC2c (to be improved (notation)):
+ dM01 = mp*dSM1p1k-s1p1k;
+ dM011 = mp*(dSM2p1k-dSM1p2k)
+ - 2.*(s1p1k*dSM1p1k-s1p2k);
+ // typeFlag = RP (0) or POI (1):
+ t = 0;
+ }
+
+ // <<cos n(psi1)>>:
+ Double_t cosP1nPsi = 0.;
+ if(mp)
+ {
+ cosP1nPsi = p1n0kRe/mp;
+
+ // fill profile for <<cos n(psi1)>>:
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi,mp);
+ // histogram to store <cos n(psi1)> e-b-e (needed in some other methods):
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][0]->SetBinContent(b,cosP1nPsi);
} // end of if(mp)
- // <<w2 cos n(psi1+phi2)>>:\r
- Double_t cosP1nPsiP1nPhiW2 = 0.;\r
- if(dM01)\r
- {\r
- cosP1nPsiP1nPhiW2 = (p1n0kRe*dReQ1n1k-p1n0kIm*dImQ1n1k-q2n1kRe)/(dM01);\r
- // fill profile for <<w2 cos n(psi1+phi2)>>:\r
- fDiffFlowCorrectionTermsForNUAPro[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsiP1nPhiW2,dM01);\r
- // histogram to store <w2 cos n(psi1+phi2)> e-b-e (needed in some other methods):\r
- fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][1]->SetBinContent(b,cosP1nPsiP1nPhiW2);\r
- } // end of if(dM01) \r
-
- // <<w2 w3 cos n(psi1+phi2-phi3)>>:\r
- Double_t cosP1nPsi1P1nPhi2MPhi3W2W3 = 0.;\r
- if(dM011)\r
- {\r
+ // <<w2 cos n(psi1+phi2)>>:
+ Double_t cosP1nPsiP1nPhiW2 = 0.;
+ if(dM01)
+ {
+ cosP1nPsiP1nPhiW2 = (p1n0kRe*dReQ1n1k-p1n0kIm*dImQ1n1k-q2n1kRe)/(dM01);
+ // fill profile for <<w2 cos n(psi1+phi2)>>:
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsiP1nPhiW2,dM01);
+ // histogram to store <w2 cos n(psi1+phi2)> e-b-e (needed in some other methods):
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][1]->SetBinContent(b,cosP1nPsiP1nPhiW2);
+ } // end of if(dM01)
+
+ // <<w2 w3 cos n(psi1+phi2-phi3)>>:
+ Double_t cosP1nPsi1P1nPhi2MPhi3W2W3 = 0.;
+ if(dM011)
+ {
cosP1nPsi1P1nPhi2MPhi3W2W3 = (p1n0kRe*(pow(dImQ1n1k,2.)+pow(dReQ1n1k,2.))
- p1n0kRe*dSM1p2k
- q2n1kRe*dReQ1n1k-q2n1kIm*dImQ1n1k
- s1p1k*dReQ1n1k
+ 2.*q1n2kRe)
/ dM011;
- // fill profile for <<w1 w2 w3 cos n(psi1+phi2)>>:\r
- fDiffFlowCorrectionTermsForNUAPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1P1nPhi2MPhi3W2W3,dM011);\r
- // histogram to store <w1 w2 w3 cos n(psi1+phi2)> e-b-e (needed in some other methods):\r
- fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][2]->SetBinContent(b,cosP1nPsi1P1nPhi2MPhi3W2W3);\r
- } // end of if(dM011) \r
- \r
- // <<w2 w3 cos n(psi1-phi2-phi3)>>:\r
- Double_t cosP1nPsi1M1nPhi2MPhi3W2W3 = 0.;\r
- if(dM011)\r
- {\r
- cosP1nPsi1M1nPhi2MPhi3W2W3 = (p1n0kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))+2.*p1n0kIm*dReQ1n1k*dImQ1n1k\r
- - 1.*(p1n0kRe*dReQ2n2k+p1n0kIm*dImQ2n2k) \r
+ // fill profile for <<w1 w2 w3 cos n(psi1+phi2)>>:
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1P1nPhi2MPhi3W2W3,dM011);
+ // histogram to store <w1 w2 w3 cos n(psi1+phi2)> e-b-e (needed in some other methods):
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][2]->SetBinContent(b,cosP1nPsi1P1nPhi2MPhi3W2W3);
+ } // end of if(dM011)
+
+ // <<w2 w3 cos n(psi1-phi2-phi3)>>:
+ Double_t cosP1nPsi1M1nPhi2MPhi3W2W3 = 0.;
+ if(dM011)
+ {
+ cosP1nPsi1M1nPhi2MPhi3W2W3 = (p1n0kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))+2.*p1n0kIm*dReQ1n1k*dImQ1n1k
+ - 1.*(p1n0kRe*dReQ2n2k+p1n0kIm*dImQ2n2k)
- 2.*s1p1k*dReQ1n1k
- + 2.*q1n2kRe)\r
- / dM011;\r
- // fill profile for <<w1 w2 w3 cos n(psi1+phi2)>>:\r
- fDiffFlowCorrectionTermsForNUAPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1M1nPhi2MPhi3W2W3,dM011);\r
- // histogram to store <w1 w2 w3 cos n(psi1+phi2)> e-b-e (needed in some other methods):\r
- fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][3]->SetBinContent(b,cosP1nPsi1M1nPhi2MPhi3W2W3);\r
- } // end of if(dM011) \r
-
- } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ + 2.*q1n2kRe)
+ / dM011;
+ // fill profile for <<w1 w2 w3 cos n(psi1+phi2)>>:
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1M1nPhi2MPhi3W2W3,dM011);
+ // histogram to store <w1 w2 w3 cos n(psi1+phi2)> e-b-e (needed in some other methods):
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][3]->SetBinContent(b,cosP1nPsi1M1nPhi2MPhi3W2W3);
+ } // end of if(dM011)
+
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)
} // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights(TString type, TString ptOrEta)
-\r
-//================================================================================================================================\r
-\r
-\r
-void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights(TString type, TString ptOrEta)\r
-{\r
- // Calculate correction terms for non-uniform acceptance for differential flow (sin terms).\r
-
- // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][0][cti], where cti runs as follows:\r
- // 0: <<sin n(psi1)>>\r
- // 1: <<w2 sin n(psi1+phi2)>>\r
- // 2: <<w2 w3 sin n(psi1+phi2-phi3)>>\r
- // 3: <<w2 w3 sin n(psi1-phi2-phi3)>>:\r
- // 4:\r
- // 5:\r
- // 6:\r
- \r
- // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
- Double_t dReQ1n1k = (*fReQ)(0,1);\r
- Double_t dReQ2n2k = (*fReQ)(1,2);\r
- //Double_t dReQ1n3k = (*fReQ)(0,3);\r
- //Double_t dReQ4n4k = (*fReQ)(3,4);\r
- Double_t dImQ1n1k = (*fImQ)(0,1);\r
- Double_t dImQ2n2k = (*fImQ)(1,2);\r
- //Double_t dImQ1n3k = (*fImQ)(0,3);\r
- //Double_t dImQ4n4k = (*fImQ)(3,4);\r
-
- // S^M_{p,k} (see .h file for the definition of fSMpk):\r
- Double_t dSM1p1k = (*fSMpk)(0,1);\r
- Double_t dSM1p2k = (*fSMpk)(0,2);\r
- Double_t dSM2p1k = (*fSMpk)(1,1);\r
-\r
- Int_t t = -1; // type flag \r
- Int_t pe = -1; // ptEta flag\r
- \r
- if(type == "RP")\r
- {\r
- t = 0;\r
- } else if(type == "POI")\r
- {\r
- t = 1;\r
- }\r
-\r
- if(ptOrEta == "Pt")\r
- {\r
- pe = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- pe = 1;\r
- }\r
- \r
- Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
- Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
- //Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
- Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
-\r
- // looping over all bins and calculating correction terms: \r
- for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- {\r
- // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): \r
- Double_t p1n0kRe = 0.;\r
- Double_t p1n0kIm = 0.;\r
-\r
- // number of POIs in particular pt or eta bin:\r
- Double_t mp = 0.;\r
-\r
- // real and imaginary parts of q_{m*n,0} (weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin):\r
- Double_t q1n2kRe = 0.;\r
- Double_t q1n2kIm = 0.;\r
- Double_t q2n1kRe = 0.;\r
- Double_t q2n1kIm = 0.;\r
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights(TString type, TString ptOrEta)
+{
+ // Calculate correction terms for non-uniform acceptance for differential flow (sin terms).
+
+ // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][0][cti], where cti runs as follows:
+ // 0: <<sin n(psi1)>>
+ // 1: <<w2 sin n(psi1+phi2)>>
+ // 2: <<w2 w3 sin n(psi1+phi2-phi3)>>
+ // 3: <<w2 w3 sin n(psi1-phi2-phi3)>>:
+ // 4:
+ // 5:
+ // 6:
+
+ // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
+ Double_t dReQ1n1k = (*fReQ)(0,1);
+ Double_t dReQ2n2k = (*fReQ)(1,2);
+ //Double_t dReQ1n3k = (*fReQ)(0,3);
+ //Double_t dReQ4n4k = (*fReQ)(3,4);
+ Double_t dImQ1n1k = (*fImQ)(0,1);
+ Double_t dImQ2n2k = (*fImQ)(1,2);
+ //Double_t dImQ1n3k = (*fImQ)(0,3);
+ //Double_t dImQ4n4k = (*fImQ)(3,4);
+
+ // S^M_{p,k} (see .h file for the definition of fSMpk):
+ Double_t dSM1p1k = (*fSMpk)(0,1);
+ Double_t dSM1p2k = (*fSMpk)(0,2);
+ Double_t dSM2p1k = (*fSMpk)(1,1);
+
+ Int_t t = -1; // type flag
+ Int_t pe = -1; // ptEta flag
+
+ if(type == "RP")
+ {
+ t = 0;
+ } else if(type == "POI")
+ {
+ t = 1;
+ }
+
+ if(ptOrEta == "Pt")
+ {
+ pe = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ pe = 1;
+ }
+
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};
+ Double_t minPtEta[2] = {fPtMin,fEtaMin};
+ //Double_t maxPtEta[2] = {fPtMax,fEtaMax};
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};
+
+ // looping over all bins and calculating correction terms:
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+ {
+ // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin):
+ Double_t p1n0kRe = 0.;
+ Double_t p1n0kIm = 0.;
+
+ // number of POIs in particular pt or eta bin:
+ Double_t mp = 0.;
+
+ // real and imaginary parts of q_{m*n,0} (weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin):
+ Double_t q1n2kRe = 0.;
+ Double_t q1n2kIm = 0.;
+ Double_t q2n1kRe = 0.;
+ Double_t q2n1kIm = 0.;
- // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) \r
- Double_t s1p1k = 0.; \r
- Double_t s1p2k = 0.; \r
+ // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation)
+ Double_t s1p1k = 0.;
+ Double_t s1p2k = 0.;
- // number of particles which are both RPs and POIs in particular pt or eta bin:\r
+ // number of particles which are both RPs and POIs in particular pt or eta bin:
Double_t mq = 0.;
- \r
- // M0111 from Eq. (118) in QC2c (to be improved (notation))\r
- Double_t dM01 = 0.;\r
- Double_t dM011 = 0.;\r
-\r
- if(type == "POI")\r
- {\r
+
+ // M0111 from Eq. (118) in QC2c (to be improved (notation))
+ Double_t dM01 = 0.;
+ Double_t dM011 = 0.;
+
+ if(type == "POI")
+ {
+ // q_{m*n,k}:
+ q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b))
+ * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b));
+ q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b))
+ * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b));
+ q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b))
+ * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b));
+ q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b))
+ * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b));
+ mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)
+
+ s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.);
+ s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.);
+ }else if(type == "RP")
+ {
+ // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!))
+ q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b))
+ * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b));
+ q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b))
+ * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b));
+ q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b))
+ * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b));
+ q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b))
+ * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b));
+ // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation)
+ s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.);
+ s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.);
+ //s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.);
+ }
+
+ if(type == "POI")
+ {
// p_{m*n,k}:
- p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b))\r
- * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b));\r
- p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) \r
+ p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b))
+ * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b));
+ p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b))
* fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b));
- mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) \r
- // q_{m*n,k}:\r
- q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b))\r
- * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b));\r
- q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b))\r
- * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); \r
- q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b))\r
- * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b));\r
- q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b))\r
- * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); \r
- mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
-
- s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); \r
- s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); \r
-
- // M01 from Eq. (118) in QC2c (to be improved (notation)):\r
+ mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)
+ // M01 from Eq. (118) in QC2c (to be improved (notation)):
dM01 = mp*dSM1p1k-s1p1k;
dM011 = mp*(dSM2p1k-dSM1p2k)
- - 2.*(s1p1k*dSM1p1k-s1p2k);
-
+ - 2.*(s1p1k*dSM1p1k-s1p2k);
// typeFlag = RP (0) or POI (1):
- t = 1; \r
- }else if(type == "RP")\r
- {\r
- /*
- // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) \r
- q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b))\r
- * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b));\r
- q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b))\r
- * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b));\r
- q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b))\r
- * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b));\r
- q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b))\r
- * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b));\r
- // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) \r
- s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); \r
- s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); \r
- s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); \r
- \r
- // to be improved (cross-checked):\r
- p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b))\r
- * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
- p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) \r
- * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
- mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
- // typeFlag = RP (0) or POI (1): \r
- t = 0;
- */\r
- } \r
- \r
- // <<sin n(psi1)>>:\r
- Double_t sinP1nPsi = 0.;\r
- if(mp)\r
- {\r
- sinP1nPsi = p1n0kIm/mp;\r
- \r
- // fill profile for <<sin n(psi1)>>:\r
- fDiffFlowCorrectionTermsForNUAPro[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi,mp);\r
- // histogram to store <sin n(psi1)> e-b-e (needed in some other methods):\r
- fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][0]->SetBinContent(b,sinP1nPsi);\r
+ t = 1;
+ } else if(type == "RP")
+ {
+ // to be improved (cross-checked):
+ p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b))
+ * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b));
+ p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b))
+ * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b));
+ mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)
+ // M01 from Eq. (118) in QC2c (to be improved (notation)):
+ dM01 = mp*dSM1p1k-s1p1k;
+ dM011 = mp*(dSM2p1k-dSM1p2k)
+ - 2.*(s1p1k*dSM1p1k-s1p2k);
+ // typeFlag = RP (0) or POI (1):
+ t = 0;
+ }
+
+ // <<sin n(psi1)>>:
+ Double_t sinP1nPsi = 0.;
+ if(mp)
+ {
+ sinP1nPsi = p1n0kIm/mp;
+
+ // fill profile for <<sin n(psi1)>>:
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi,mp);
+ // histogram to store <sin n(psi1)> e-b-e (needed in some other methods):
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][0]->SetBinContent(b,sinP1nPsi);
} // end of if(mp)
- // <<w2 sin n(psi1+phi2)>>:\r
- Double_t sinP1nPsiP1nPhiW2 = 0.;\r
- if(dM01)\r
- {\r
- sinP1nPsiP1nPhiW2 = (p1n0kRe*dImQ1n1k+p1n0kIm*dReQ1n1k-q2n1kIm)/(dM01);\r
- // fill profile for <<w2 sin n(psi1+phi2)>>:\r
- fDiffFlowCorrectionTermsForNUAPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsiP1nPhiW2,dM01);\r
- // histogram to store <w2 sin n(psi1+phi2)> e-b-e (needed in some other methods):\r
- fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][1]->SetBinContent(b,sinP1nPsiP1nPhiW2);\r
- } // end of if(mp*dMult-mq) \r
-
- // <<w2 w3 sin n(psi1+phi2-phi3)>>:\r
- Double_t sinP1nPsi1P1nPhi2MPhi3W2W3 = 0.;\r
- if(dM011)\r
- {\r
+ // <<w2 sin n(psi1+phi2)>>:
+ Double_t sinP1nPsiP1nPhiW2 = 0.;
+ if(dM01)
+ {
+ sinP1nPsiP1nPhiW2 = (p1n0kRe*dImQ1n1k+p1n0kIm*dReQ1n1k-q2n1kIm)/(dM01);
+ // fill profile for <<w2 sin n(psi1+phi2)>>:
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsiP1nPhiW2,dM01);
+ // histogram to store <w2 sin n(psi1+phi2)> e-b-e (needed in some other methods):
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][1]->SetBinContent(b,sinP1nPsiP1nPhiW2);
+ } // end of if(mp*dMult-mq)
+
+ // <<w2 w3 sin n(psi1+phi2-phi3)>>:
+ Double_t sinP1nPsi1P1nPhi2MPhi3W2W3 = 0.;
+ if(dM011)
+ {
sinP1nPsi1P1nPhi2MPhi3W2W3 = (p1n0kIm*(pow(dImQ1n1k,2.)+pow(dReQ1n1k,2.))
- p1n0kIm*dSM1p2k
+ q2n1kRe*dImQ1n1k-q2n1kIm*dReQ1n1k
- s1p1k*dImQ1n1k
+ 2.*q1n2kIm)
/ dM011;
- // fill profile for <<w2 w3 sin n(psi1+phi2-phi3)>>:\r
- fDiffFlowCorrectionTermsForNUAPro[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1P1nPhi2MPhi3W2W3,dM011);\r
- // histogram to store <w2 w3 sin n(psi1+phi2-phi3)> e-b-e (needed in some other methods):\r
- fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][2]->SetBinContent(b,sinP1nPsi1P1nPhi2MPhi3W2W3);\r
- } // end of if(dM011) \r
-
- // <<w2 w3 sin n(psi1-phi2-phi3)>>:\r
- Double_t sinP1nPsi1M1nPhi2MPhi3W2W3 = 0.;\r
- if(dM011)\r
- {\r
- sinP1nPsi1M1nPhi2MPhi3W2W3 = (p1n0kIm*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))-2.*p1n0kRe*dReQ1n1k*dImQ1n1k\r
- + 1.*(p1n0kRe*dImQ2n2k-p1n0kIm*dReQ2n2k) \r
+ // fill profile for <<w2 w3 sin n(psi1+phi2-phi3)>>:
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1P1nPhi2MPhi3W2W3,dM011);
+ // histogram to store <w2 w3 sin n(psi1+phi2-phi3)> e-b-e (needed in some other methods):
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][2]->SetBinContent(b,sinP1nPsi1P1nPhi2MPhi3W2W3);
+ } // end of if(dM011)
+
+ // <<w2 w3 sin n(psi1-phi2-phi3)>>:
+ Double_t sinP1nPsi1M1nPhi2MPhi3W2W3 = 0.;
+ if(dM011)
+ {
+ sinP1nPsi1M1nPhi2MPhi3W2W3 = (p1n0kIm*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))-2.*p1n0kRe*dReQ1n1k*dImQ1n1k
+ + 1.*(p1n0kRe*dImQ2n2k-p1n0kIm*dReQ2n2k)
+ 2.*s1p1k*dImQ1n1k
- - 2.*q1n2kIm)\r
- / dM011;\r
- // fill profile for <<w2 w3 sin n(psi1-phi2-phi3)>>:\r
- fDiffFlowCorrectionTermsForNUAPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1M1nPhi2MPhi3W2W3,dM011);\r
- // histogram to store <w2 w3 sin n(psi1-phi2-phi3)> e-b-e (needed in some other methods):\r
- fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][3]->SetBinContent(b,sinP1nPsi1M1nPhi2MPhi3W2W3);\r
- } // end of if(dM011) \r
-
- } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
-
-} // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights(TString type, TString ptOrEta)\r
-\r
-\r
-//================================================================================================================================\r
-\r
- \r
-void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta)\r
-{\r
+ - 2.*q1n2kIm)
+ / dM011;
+ // fill profile for <<w2 w3 sin n(psi1-phi2-phi3)>>:
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1M1nPhi2MPhi3W2W3,dM011);
+ // histogram to store <w2 w3 sin n(psi1-phi2-phi3)> e-b-e (needed in some other methods):
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][3]->SetBinContent(b,sinP1nPsi1M1nPhi2MPhi3W2W3);
+ } // end of if(dM011)
+
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights(TString type, TString ptOrEta)
+
+
+//================================================================================================================================
+
+
+void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta)
+{
// Evaluate with nested loops correction terms for non-uniform acceptance
- // with using particle weights (both sin and cos terms) relevant for differential flow.\r
- \r
+ // with using particle weights (both sin and cos terms) relevant for differential flow.
+
// Remark 1: "w1" in expressions bellow is a particle weight used only for particles which were
// flagged both as POI and RP.
- // Remark 2: Reduced correction terms for non-uniform acceptance are evaluated in pt bin number fCrossCheckInPtBinNo \r
- // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs.\r
- // Remark 3: Results are stored in 1 bin profiles fDiffFlowDirectCorrections[t][pe][sc][cti], where first three indices runs as: \r
- // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms], whilst the cti (correction term index) runs as follows: \r
- // cti: \r
- // 0: <<sc n(psi1)>>\r
- // 1: <<w2 sc n(psi1+phi2)>> \r
- // 2: <<w2 w3 sc n(psi1+phi2-phi3)>>\r
- // 3: <<w2 w3 sc n(psi1-phi2-phi3)>>\r
- // 4:\r
- // 5:\r
- // 6:\r
+ // Remark 2: Reduced correction terms for non-uniform acceptance are evaluated in pt bin number fCrossCheckInPtBinNo
+ // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs.
+ // Remark 3: Results are stored in 1 bin profiles fDiffFlowDirectCorrections[t][pe][sc][cti], where first three indices runs as:
+ // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms], whilst the cti (correction term index) runs as follows:
+ // cti:
+ // 0: <<sc n(psi1)>>
+ // 1: <<w2 sc n(psi1+phi2)>>
+ // 2: <<w2 w3 sc n(psi1+phi2-phi3)>>
+ // 3: <<w2 w3 sc n(psi1-phi2-phi3)>>
+ // 4:
+ // 5:
+ // 6:
- Int_t typeFlag = -1;\r
- Int_t ptEtaFlag = -1;\r
- if(type == "RP")\r
- {\r
- typeFlag = 0;\r
- } else if(type == "POI")\r
- {\r
- typeFlag = 1;\r
- } \r
- if(ptOrEta == "Pt")\r
- {\r
- ptEtaFlag = 0;\r
- } else if(ptOrEta == "Eta")\r
- {\r
- ptEtaFlag = 1;\r
- } \r
- // shortcuts:\r
- Int_t t = typeFlag;\r
- Int_t pe = ptEtaFlag;\r
- \r
- Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth};\r
- Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth};\r
- Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
- \r
- Int_t nPrim = anEvent->NumberOfTracks(); \r
- AliFlowTrackSimple *aftsTrack = NULL;\r
- \r
- Double_t psi1=0., phi2=0., phi3=0.;// phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.;\r
- Double_t wPhi2=1., wPhi3=1.;\r
-
- Int_t n = fHarmonic; \r
- \r
- // 1'-particle correction terms:\r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
- if(ptOrEta == "Pt")\r
- { \r
- if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue;\r
- } else if (ptOrEta == "Eta")\r
- {\r
- if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue; \r
- }\r
- psi1=aftsTrack->Phi(); \r
- // sin terms: \r
- fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*psi1),1.); // <<sin(n*(psi1))>> \r
- // cos terms: \r
- fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*psi1),1.); // <<cos(n*(psi1))>> \r
- }//end of for(Int_t i1=0;i1<nPrim;i1++)\r
- \r
- // 2'-particle correction terms:\r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
- if(ptOrEta == "Pt")\r
- { \r
- if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue;\r
- } else if (ptOrEta == "Eta")\r
- {\r
- if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue; \r
- }\r
- psi1=aftsTrack->Phi(); \r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1) continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- // RP condition (!(first) particle in the correlator must be RP):\r
- if(!(aftsTrack->InRPSelection())) continue;\r
+ Int_t typeFlag = -1;
+ Int_t ptEtaFlag = -1;
+ if(type == "RP")
+ {
+ typeFlag = 0;
+ } else if(type == "POI")
+ {
+ typeFlag = 1;
+ }
+ if(ptOrEta == "Pt")
+ {
+ ptEtaFlag = 0;
+ } else if(ptOrEta == "Eta")
+ {
+ ptEtaFlag = 1;
+ }
+ // shortcuts:
+ Int_t t = typeFlag;
+ Int_t pe = ptEtaFlag;
+
+ Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth};
+ Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth};
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};
+
+ Int_t nPrim = anEvent->NumberOfTracks();
+ AliFlowTrackSimple *aftsTrack = NULL;
+
+ Double_t psi1=0., phi2=0., phi3=0.;// phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.;
+ Double_t wPhi2=1., wPhi3=1.;
+
+ Int_t n = fHarmonic;
+
+ // 1'-particle correction terms:
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)
+ if(typeFlag==1) // this is diff flow of POIs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ }
+ } else // this is diff flow of RPs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ }
+ }
+ psi1=aftsTrack->Phi();
+ // sin terms:
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*psi1),1.); // <<sin(n*(psi1))>>
+ // cos terms:
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*psi1),1.); // <<cos(n*(psi1))>>
+ }//end of for(Int_t i1=0;i1<nPrim;i1++)
+
+ // 2'-particle correction terms:
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)
+ if(typeFlag==1) // this is diff flow of POIs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ }
+ } else // this is diff flow of RPs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ }
+ }
+ psi1=aftsTrack->Phi();
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1) continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ // RP condition (!(first) particle in the correlator must be RP):
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi2=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));
+ // sin terms:
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2)),wPhi2); // <<w2 sin(n*(psi1+phi2))>>
+ // cos terms:
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2)),wPhi2); // <<w2 cos(n*(psi1+phi2))>>
+ }//end of for(Int_t i2=0;i2<nPrim;i2++)
+ }//end of for(Int_t i1=0;i1<nPrim;i1++)
+
+ // 3'-particle correction terms:
+ for(Int_t i1=0;i1<nPrim;i1++)
+ {
+ aftsTrack=anEvent->GetTrack(i1);
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)
+ if(typeFlag==1) // this is diff flow of POIs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;
+ }
+ } else // this is diff flow of RPs
+ {
+ if(ptOrEta == "Pt")
+ {
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ } else if (ptOrEta == "Eta")
+ {
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue;
+ }
+ }
+ psi1=aftsTrack->Phi();
+ for(Int_t i2=0;i2<nPrim;i2++)
+ {
+ if(i2==i1) continue;
+ aftsTrack=anEvent->GetTrack(i2);
+ // RP condition (!(first) particle in the correlator must be RP):
+ if(!(aftsTrack->InRPSelection())) continue;
phi2=aftsTrack->Phi();
- if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); \r
- // sin terms: \r
- fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2)),wPhi2); // <<w2 sin(n*(psi1+phi2))>> \r
- // cos terms: \r
- fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2)),wPhi2); // <<w2 cos(n*(psi1+phi2))>> \r
- }//end of for(Int_t i2=0;i2<nPrim;i2++)\r
- }//end of for(Int_t i1=0;i1<nPrim;i1++) \r
- \r
- // 3'-particle correction terms:\r
- for(Int_t i1=0;i1<nPrim;i1++)\r
- {\r
- aftsTrack=anEvent->GetTrack(i1);\r
- // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
- if(ptOrEta == "Pt")\r
- { \r
- if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;\r
- } else if (ptOrEta == "Eta")\r
- {\r
- if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; \r
- }\r
- psi1=aftsTrack->Phi();\r
- for(Int_t i2=0;i2<nPrim;i2++)\r
- {\r
- if(i2==i1) continue;\r
- aftsTrack=anEvent->GetTrack(i2);\r
- // RP condition (!(first) particle in the correlator must be RP):\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi2=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); \r
- for(Int_t i3=0;i3<nPrim;i3++)\r
- {\r
- if(i3==i1||i3==i2) continue;\r
- aftsTrack=anEvent->GetTrack(i3);\r
- // RP condition (!(first) particle in the correlator must be RP):\r
- if(!(aftsTrack->InRPSelection())) continue;\r
- phi3=aftsTrack->Phi();\r
- if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); \r
- // sin terms: \r
- fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 sin(n*(psi1+phi2-phi3))>> \r
- fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1-phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 sin(n*(psi1-phi2-phi3))>> \r
- // cos terms: \r
- fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 cos(n*(psi1+phi2-phi3))>> \r
- fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 cos(n*(psi1-phi2-phi3))>> \r
- }//end of for(Int_t i3=0;i3<nPrim;i3++) \r
- }//end of for(Int_t i2=0;i2<nPrim;i2++) \r
+ if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));
+ for(Int_t i3=0;i3<nPrim;i3++)
+ {
+ if(i3==i1||i3==i2) continue;
+ aftsTrack=anEvent->GetTrack(i3);
+ // RP condition (!(first) particle in the correlator must be RP):
+ if(!(aftsTrack->InRPSelection())) continue;
+ phi3=aftsTrack->Phi();
+ if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi())));
+ // sin terms:
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 sin(n*(psi1+phi2-phi3))>>
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1-phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 sin(n*(psi1-phi2-phi3))>>
+ // cos terms:
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 cos(n*(psi1+phi2-phi3))>>
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 cos(n*(psi1-phi2-phi3))>>
+ }//end of for(Int_t i3=0;i3<nPrim;i3++)
+ }//end of for(Int_t i2=0;i2<nPrim;i2++)
}//end of for(Int_t i1=0;i1<nPrim;i1++)
- \r
-} // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta)\r
-\r
-\r
+
+} // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta)
+
+//================================================================================================================================
+
+void AliFlowAnalysisWithQCumulants::CheckPointersUsedInFinish()
+{
+ // Check all pointers used in method Finish().
+
+ if(!fIntFlowCorrelationsPro)
+ {
+ cout<<endl;
+ cout<<" WARNING (QC): fIntFlowCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ if(!fIntFlowCorrelationsHist)
+ {
+ cout<<endl;
+ cout<<" WARNING (QC): fIntFlowCorrelationsHist is NULL in CheckPointersUsedInFinish() !!!!"<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ for(Int_t power=0;power<2;power++)
+ {
+ if(!fIntFlowSumOfEventWeights[power])
+ {
+ cout<<endl;
+ cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeights[%d] is NULL in CheckPointersUsedInFinish() !!!!",power)<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ } // end of for(Int_t power=0;power<2;power++)
+ if(!fIntFlowProductOfCorrelationsPro)
+ {
+ cout<<endl;
+ cout<<" WARNING (QC): fIntFlowProductOfCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ if(!fIntFlowSumOfProductOfEventWeights)
+ {
+ cout<<endl;
+ cout<<" WARNING (QC): fIntFlowSumOfProductOfEventWeights is NULL in CheckPointersUsedInFinish() !!!!"<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ if(!fIntFlowCovariances)
+ {
+ cout<<endl;
+ cout<<" WARNING (QC): fIntFlowCovariances is NULL in CheckPointersUsedInFinish() !!!!"<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ if(!fIntFlowQcumulants)
+ {
+ cout<<endl;
+ cout<<" WARNING (QC): fIntFlowQcumulants is NULL in CheckPointersUsedInFinish() !!!!"<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ if(!fIntFlow)
+ {
+ cout<<endl;
+ cout<<" WARNING (QC): fIntFlow is NULL in CheckPointersUsedInFinish() !!!!"<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ if(!fCommonHists)
+ {
+ cout<<endl;
+ cout<<" WARNING (QC): fCommonHists is NULL in CheckPointersUsedInFinish() !!!!"<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th))
+ {
+ cout<<endl;
+ cout<<" WARNING (QC): fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th"<<endl;
+ cout<<" && fCommonHistsResults8th is NULL in CheckPointersUsedInFinish() !!!!"<<endl;
+ cout<<endl;
+ exit(0);
+ }
+
+ // NUA stuff:
+ for(Int_t sc=0;sc<2;sc++) // sin/cos
+ {
+ if(!fIntFlowCorrectionTermsForNUAPro[sc])
+ {
+ cout<<endl;
+ cout<<Form(" WARNING (QC): fIntFlowCorrectionTermsForNUAPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",sc)<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ if(!fIntFlowCorrectionTermsForNUAHist[sc])
+ {
+ cout<<endl;
+ cout<<Form(" WARNING (QC): fIntFlowCorrectionTermsForNUAHist[%d] is NULL in CheckPointersUsedInFinish() !!!!",sc)<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ for(Int_t lq=0;lq<2;lq++) // linear/quadratic
+ {
+ if(!fIntFlowSumOfEventWeightsNUA[sc][lq])
+ {
+ cout<<endl;
+ cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeightsNUA[%d][%d] is NULL in CheckPointersUsedInFinish() !!!!",sc,lq)<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ } // end of for(Int_t lq=0;lq<2;lq++) // linear/quadratic
+ } // end of for(Int_t power=0;power<2;power++)
+ if(!fIntFlowProductOfCorrectionTermsForNUAPro)
+ {
+ cout<<endl;
+ cout<<" WARNING (QC): fIntFlowProductOfCorrectionTermsForNUAPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ if(!fIntFlowSumOfProductOfEventWeightsNUA)
+ {
+ cout<<endl;
+ cout<<" WARNING (QC): fIntFlowSumOfProductOfEventWeightsNUA is NULL in CheckPointersUsedInFinish() !!!!"<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ if(!fIntFlowCovariancesNUA)
+ {
+ cout<<endl;
+ cout<<" WARNING (QC): fIntFlowCovariancesNUA is NULL in CheckPointersUsedInFinish() !!!!"<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ if(!fIntFlowQcumulantsErrorSquaredRatio)
+ {
+ cout<<endl;
+ cout<<" WARNING (QC): fIntFlowQcumulantsErrorSquaredRatio is NULL in CheckPointersUsedInFinish() !!!!"<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ if(!fIntFlowDetectorBias)
+ {
+ cout<<endl;
+ cout<<" WARNING (QC): fIntFlowDetectorBias is NULL in CheckPointersUsedInFinish() !!!!"<<endl;
+ cout<<endl;
+ exit(0);
+ }
+
+ // Versus multiplicity:
+ if(!fCalculateCumulantsVsM){return;}
+ for(Int_t ci=0;ci<=3;ci++) // correlation index
+ {
+ if(!fIntFlowCorrelationsVsMPro[ci])
+ {
+ cout<<endl;
+ cout<<Form(" WARNING (QC): fIntFlowCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ if(!fIntFlowCorrelationsVsMHist[ci])
+ {
+ cout<<endl;
+ cout<<Form(" WARNING (QC): fIntFlowCorrelationsVsMHist[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ if(fApplyCorrectionForNUAVsM && !fIntFlowDetectorBiasVsM[ci])
+ {
+ cout<<endl;
+ cout<<Form(" WARNING (QC): fIntFlowDetectorBiasVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ for(Int_t power=0;power<2;power++)
+ {
+ if(!fIntFlowSumOfEventWeightsVsM[ci][power])
+ {
+ cout<<endl;
+ cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeightsVsM[%d][%d] is NULL in CheckPointersUsedInFinish() !!!!",ci,power)<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ } // end of for(Int_t power=0;power<2;power++)
+ } // end of for(Int_t ci=0;ci<=3;ci++) // correlation index
+ for(Int_t i=0;i<6;i++)
+ {
+ if(!fIntFlowProductOfCorrelationsVsMPro[i])
+ {
+ cout<<endl;
+ cout<<Form(" WARNING (QC): fIntFlowProductOfCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ if(!fIntFlowSumOfProductOfEventWeightsVsM[i])
+ {
+ cout<<endl;
+ cout<<Form(" WARNING (QC): fIntFlowSumOfProductOfEventWeightsVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ if(!fIntFlowCovariancesVsM[i])
+ {
+ cout<<endl;
+ cout<<Form(" WARNING (QC): fIntFlowCovariancesVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ } // end of for(Int_t i=0;i<6;i++)
+ if(!fIntFlowRebinnedInM)
+ {
+ cout<<endl;
+ cout<<" WARNING (QC): fIntFlowRebinnedInM is NULL in CheckPointersUsedInFinish() !!!!"<<endl;
+ cout<<endl;
+ exit(0);
+ }
+ if(!fIntFlowQcumulantsRebinnedInM)
+ {
+ cout<<endl;
+ cout<<" WARNING (QC): fIntFlowQcumulantsRebinnedInM is NULL in CheckPointersUsedInFinish() !!!!"<<endl;
+ cout<<endl;
+ exit(0);
+ }
+
+} // end of void AliFlowAnalysisWithQCumulants::CheckPointersUsedInFinish()
+
+//================================================================================================================================
+void AliFlowAnalysisWithQCumulants::CheckPointersUsedInMake()
+{
+ // Check all pointers used in method Make().
+
+} // end of void AliFlowAnalysisWithQCumulants::CheckPointersUsedInMake()
+