-/*************************************************************************
-* Copyright(c) 1998-2008, ALICE Experiment at CERN, All rights reserved. *
-* *
-* Author: The ALICE Off-line Project. *
-* Contributors are mentioned in the code where appropriate. *
-* *
-* Permission to use, copy, modify and distribute this software and its *
-* documentation strictly for non-commercial purposes is hereby granted *
-* without fee, provided that the above copyright notice appears in all *
-* copies and that both the copyright notice and this permission notice *
-* appear in the supporting documentation. The authors make no claims *
-* about the suitability of this software for any purpose. It is *
-* provided "as is" without express or implied warranty. *
-**************************************************************************/
-
-/**********************************
- * flow analysis with Q-cumulants *
- * *
- * author: Ante Bilandzic *
- * (anteb@nikhef.nl) *
- *********************************/
-
-#define AliFlowAnalysisWithQCumulants_cxx
-
-#include "Riostream.h"
-#include "AliFlowCommonConstants.h"
-#include "AliFlowCommonHist.h"
-#include "AliFlowCommonHistResults.h"
-#include "TChain.h"
-#include "TFile.h"
-#include "TList.h"
-#include "TGraph.h"
-#include "TParticle.h"
-#include "TRandom3.h"
-#include "TStyle.h"
-#include "TProfile.h"
-#include "TProfile2D.h"
-#include "TProfile3D.h"
-#include "TMath.h"
-#include "TArrow.h"
-#include "TPaveLabel.h"
-#include "TCanvas.h"
-#include "AliFlowEventSimple.h"
-#include "AliFlowTrackSimple.h"
-#include "AliFlowAnalysisWithQCumulants.h"
-#include "TArrayD.h"
-#include "TRandom.h"
-
-class TH1;
-class TH2;
-class TGraph;
-class TPave;
-class TLatex;
-class TMarker;
-class TRandom3;
-class TObjArray;
-class TList;
-class TCanvas;
-class TSystem;
-class TROOT;
-class AliFlowVector;
-class TVector;
-
-//================================================================================================================
-
-ClassImp(AliFlowAnalysisWithQCumulants)
-
-AliFlowAnalysisWithQCumulants::AliFlowAnalysisWithQCumulants():
- fTrack(NULL),
- fHistList(NULL),
- fDiffFlowList(NULL),
- fWeightsList(NULL),
- fResultsList(NULL),
- fAvMultIntFlowQC(NULL),
- fQvectorComponents(NULL),
- fDiffFlowResults2ndOrderQC(NULL),
- fDiffFlowResults4thOrderQC(NULL),
- fCovariances(NULL),
- fQvectorForEachEventX(NULL),//to be removed
- fQvectorForEachEventY(NULL),//to be removed
- fQCorrelations(NULL),
- fQCorrelationsW(NULL),
- fQCorrectionsCos(NULL),
- fQCorrectionsSin(NULL),
- fQProduct(NULL),
- fDirectCorrelations(NULL),
- fDirectCorrelationsW(NULL),
- fDirectCorrelationsDiffFlow(NULL),
- fDirectCorrelationsDiffFlowW(NULL),
- fDirectCorrectionsCos(NULL),
- fDirectCorrectionsSin(NULL),
- f2PerPtBin1n1nPOI(NULL),
- f4PerPtBin1n1n1n1nPOI(NULL),
- f2PerEtaBin1n1nPOI(NULL),
- f4PerEtaBin1n1n1n1nPOI(NULL),
- f2WPerPtBin1n1nPOI(NULL),
- f4WPerPtBin1n1n1n1nPOI(NULL),
- f2WPerEtaBin1n1nPOI(NULL),
- f4WPerEtaBin1n1n1n1nPOI(NULL),
- f2PerPtBin1n1nRP(NULL),
- f4PerPtBin1n1n1n1nRP(NULL),
- f2PerEtaBin1n1nRP(NULL),
- f4PerEtaBin1n1n1n1nRP(NULL),
- f2WPerPtBin1n1nRP(NULL),
- f4WPerPtBin1n1n1n1nRP(NULL),
- f2WPerEtaBin1n1nRP(NULL),
- f4WPerEtaBin1n1n1n1nRP(NULL),
- fCommonHists2nd(NULL),
- fCommonHists4th(NULL),
- fCommonHists6th(NULL),
- fCommonHists8th(NULL),
- fCommonHistsResults2nd(NULL),
- fCommonHistsResults4th(NULL),
- fCommonHistsResults6th(NULL),
- fCommonHistsResults8th(NULL),
- f2pDistribution(NULL),
- f4pDistribution(NULL),
- f6pDistribution(NULL),
- f8pDistribution(NULL),
- fnBinsPt(0),
- fPtMin(0),
- fPtMax(0),
- fnBinsEta(0),
- fEtaMin(0),
- fEtaMax(0),
- fEventCounter(0),
- fUsePhiWeights(kFALSE),
- fUsePtWeights(kFALSE),
- fUseEtaWeights(kFALSE),
- fUseWeights(kFALSE),
- fUseWeightsBits(NULL),
-
- // ...................................................................................................................
- // Q_{n,k} and S^M_{n,k}:
- fReQ(NULL),
- fImQ(NULL),
- fSMpk(NULL),
-
- // q_n and m:
- fReqnPtEta(NULL),
- fImqnPtEta(NULL),
- fmPtEta(NULL),
-
- // non-weighted q''_{n} and q''_{2n}:
- fReqPrimePrime1nPtEta(NULL),
- fImqPrimePrime1nPtEta(NULL),
- fReqPrimePrime2nPtEta(NULL),
- fImqPrimePrime2nPtEta(NULL),
-
- // weighted q''_{n,2k} and q''_{2n,k}:
- fReqPrimePrime1n2kPtEta(NULL),
- fImqPrimePrime1n2kPtEta(NULL),
- fReqPrimePrime2n1kPtEta(NULL),
- fImqPrimePrime2n1kPtEta(NULL),
-
- // m''
- fmPrimePrimePtEta(NULL),
-
- // S^{m''}_{n,k}
- fSmPrimePrime1p1kPtEta(NULL),
- fSmPrimePrime1p2kPtEta(NULL),
- fSmPrimePrime1p3kPtEta(NULL),
-
- // non-weighted q_RP{n} and q_RP{2n}:
- fReqRP1nPtEta(NULL),
- fImqRP1nPtEta(NULL),
- fReqRP2nPtEta(NULL),
- fImqRP2nPtEta(NULL),
-
- // weighted q_RP{n,2k} and q_RP{2n,k} (for each (pt,eta) bin for RPs)
- fReqRP1n2kPtEta(NULL),
- fImqRP1n2kPtEta(NULL),
- fReqRP2n1kPtEta(NULL),
- fImqRP2n1kPtEta(NULL),
-
- // m_RP:
- fmRPPtEta(NULL), // # of particles which are RPs for each (pt,eta) bin
-
- // S^{m_RP}_{p,k} (for each (pt,eta) bin for RPs):
- fSmRP1p1kPtEta(NULL),
- fSmRP1p2kPtEta(NULL),
- fSmRP1p3kPtEta(NULL),
-
- // ----- RESULTS ----
-
- fFinalCorrectionsForNUA(NULL), // NUA = non-uniform acceptance
-
- // non-weighted integrated flow:
- fIntFlowResultsQC(NULL),
- fIntFlowResultsPOIQC(NULL),
- fIntFlowResultsRPQC(NULL),
-
- // weighted integrated flow:
- fIntFlowResultsQCW(NULL),
- fIntFlowResultsPOIQCW(NULL),
- fIntFlowResultsRPQCW(NULL),
-
- // non-weighted correlations for each (pt,eta) bin for POIs:
- f2pPtEtaPOI(NULL),
- f4pPtEtaPOI(NULL),
- f6pPtEtaPOI(NULL),
- f8pPtEtaPOI(NULL),
-
- // non-weighted final results for differential flow for POIs:
- // 3D (pt,eta)
- fvn2ndPtEtaPOI(NULL),
- fvn4thPtEtaPOI(NULL),
- fvn6thPtEtaPOI(NULL),
- fvn8thPtEtaPOI(NULL),
- // 2D (pt)
- fvn2ndPtPOI(NULL),
- fvn4thPtPOI(NULL),
- fvn6thPtPOI(NULL),
- fvn8thPtPOI(NULL),
- // 2D (eta)
- fvn2ndEtaPOI(NULL),
- fvn4thEtaPOI(NULL),
- fvn6thEtaPOI(NULL),
- fvn8thEtaPOI(NULL),
-
- // weighted correlations for each (pt,eta) bin for POIs:
- f2pPtEtaPOIW(NULL),
- f4pPtEtaPOIW(NULL),
- f6pPtEtaPOIW(NULL),
- f8pPtEtaPOIW(NULL),
-
- // weighted final results for differential flow for POIs:
- // 3D (pt,eta)
- fvn2ndPtEtaPOIW(NULL),
- fvn4thPtEtaPOIW(NULL),
- fvn6thPtEtaPOIW(NULL),
- fvn8thPtEtaPOIW(NULL),
- // 2D (pt)
- fvn2ndPtPOIW(NULL),
- fvn4thPtPOIW(NULL),
- fvn6thPtPOIW(NULL),
- fvn8thPtPOIW(NULL),
- // 2D (eta)
- fvn2ndEtaPOIW(NULL),
- fvn4thEtaPOIW(NULL),
- fvn6thEtaPOIW(NULL),
- fvn8thEtaPOIW(NULL),
-
- // non-weighted correlations for each (pt,eta) bin for RPs:
- f2pPtEtaRP(NULL),
- f4pPtEtaRP(NULL),
- f6pPtEtaRP(NULL),
- f8pPtEtaRP(NULL),
-
- // non-weighted final results for differential flow for RPs:
- // 3D (pt,eta)
- fvn2ndPtEtaRP(NULL),
- fvn4thPtEtaRP(NULL),
- fvn6thPtEtaRP(NULL),
- fvn8thPtEtaRP(NULL),
- // 2D (pt)
- fvn2ndPtRP(NULL),
- fvn4thPtRP(NULL),
- fvn6thPtRP(NULL),
- fvn8thPtRP(NULL),
- // 2D (eta)
- fvn2ndEtaRP(NULL),
- fvn4thEtaRP(NULL),
- fvn6thEtaRP(NULL),
- fvn8thEtaRP(NULL),
-
- // weighted correlations for each (pt,eta) bin for RPs:
- f2pPtEtaRPW(NULL),
- f4pPtEtaRPW(NULL),
- f6pPtEtaRPW(NULL),
- f8pPtEtaRPW(NULL),
-
- // weighted final results for differential flow for RPs:
- // 3D (pt,eta)
- fvn2ndPtEtaRPW(NULL),
- fvn4thPtEtaRPW(NULL),
- fvn6thPtEtaRPW(NULL),
- fvn8thPtEtaRPW(NULL),
- // 2D (pt)
- fvn2ndPtRPW(NULL),
- fvn4thPtRPW(NULL),
- fvn6thPtRPW(NULL),
- fvn8thPtRPW(NULL),
- // 2D (eta)
- fvn2ndEtaRPW(NULL),
- fvn4thEtaRPW(NULL),
- fvn6thEtaRPW(NULL),
- fvn8thEtaRPW(NULL)
- // ...................................................................................................................
-
-{
- // constructor
- fHistList = new TList();
- fDiffFlowList = new TList();
- fDiffFlowList->SetName("DifferentialFlow");
- fWeightsList = new TList();
- fWeightsList->SetName("Weights");
- fResultsList = new TList();
- fResultsList->SetName("Results");
-
- fnBinsPt = AliFlowCommonConstants::GetNbinsPt();
- fPtMin = AliFlowCommonConstants::GetPtMin();
- fPtMax = AliFlowCommonConstants::GetPtMax();
-
- fnBinsEta = AliFlowCommonConstants::GetNbinsEta();
- fEtaMin = AliFlowCommonConstants::GetEtaMin();
- fEtaMax = AliFlowCommonConstants::GetEtaMax();
-}
-
-AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants()
-{
- //destructor
- delete fHistList;
- delete fDiffFlowList;
- delete fWeightsList;
- delete fResultsList;
-}
-
-//================================================================================================================
-
-void AliFlowAnalysisWithQCumulants::Init()
-{
- //various output histograms
- //avarage multiplicity
- fAvMultIntFlowQC = new TProfile("fAvMultIntFlowQC","Average Multiplicity",1,0,1,"s");
- fAvMultIntFlowQC->SetXTitle("");
- fAvMultIntFlowQC->SetYTitle("");
- fAvMultIntFlowQC->SetLabelSize(0.06);
- fAvMultIntFlowQC->SetMarkerStyle(25);
- fAvMultIntFlowQC->SetLabelOffset(0.01);
- (fAvMultIntFlowQC->GetXaxis())->SetBinLabel(1,"Average Multiplicity");
- fHistList->Add(fAvMultIntFlowQC);
-
- //Q-vector stuff
- fQvectorComponents = new TProfile("fQvectorComponents","Avarage of Q-vector components",44,0.,44.,"s");
- fQvectorComponents->SetXTitle("");
- fQvectorComponents->SetYTitle("");
- //fHistList->Add(fQvectorComponents);
-
- //final results for differential flow from 2nd order Q-cumulant
- fDiffFlowResults2ndOrderQC = new TH1D("fDiffFlowResults2ndOrderQC","Differential Flow from 2nd Order Q-cumulant",fnBinsPt,fPtMin,fPtMax);
- fDiffFlowResults2ndOrderQC->SetXTitle("p_{t} [GeV]");
- //fDiffFlowResults2ndOrderQC->SetYTitle("Differential Flow");
- fHistList->Add(fDiffFlowResults2ndOrderQC);
-
- //final results for differential flow from 4th order Q-cumulant
- fDiffFlowResults4thOrderQC = new TH1D("fDiffFlowResults4thOrderQC","Differential Flow from 4th Order Q-cumulant",fnBinsPt,fPtMin,fPtMax);
- fDiffFlowResults4thOrderQC->SetXTitle("p_{t} [GeV]");
- //fDiffFlowResults4thOrderQC->SetYTitle("Differential Flow");
- fHistList->Add(fDiffFlowResults4thOrderQC);
-
- //final results for covariances (1st bin: <2*4>-<2>*<4>, 2nd bin: <2*6>-<2>*<6>, ...)
- fCovariances = new TH1D("fCovariances","Covariances",6,0,6);
- //fCovariances->SetXTitle("");
- //fCovariances->SetYTitle("<covariance>");
- fCovariances->SetLabelSize(0.04);
- fCovariances->SetTickLength(1);
- fCovariances->SetMarkerStyle(25);
- (fCovariances->GetXaxis())->SetBinLabel(1,"Cov(2,4)");
- (fCovariances->GetXaxis())->SetBinLabel(2,"Cov(2,6)");
- (fCovariances->GetXaxis())->SetBinLabel(3,"Cov(2,8)");
- (fCovariances->GetXaxis())->SetBinLabel(4,"Cov(4,6)");
- (fCovariances->GetXaxis())->SetBinLabel(5,"Cov(4,8)");
- (fCovariances->GetXaxis())->SetBinLabel(6,"Cov(6,8)");
- fHistList->Add(fCovariances);
-
- //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx
- // !!!! to be removed !!!!
- //profile containing the x-components of Q-vectors from all events
- fQvectorForEachEventX = new TProfile("fQvectorForEachEventX","x-components of Q-vectors",44000,1,44000,"s");
- fHistList->Add(fQvectorForEachEventX);
-
- //profile containing the y-components of Q-vectors from all events
- fQvectorForEachEventY = new TProfile("fQvectorForEachEventY","y-components of Q-vectors",44000,1,44000,"s");
- fHistList->Add(fQvectorForEachEventY);
- //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx
-
- // multi-particle correlations calculated from Q-vectors
- fQCorrelations = new TProfile("fQCorrelations","multi-particle correlations from Q-vectors",32,0,32,"s");
- fQCorrelations->SetTickLength(-0.01,"Y");
- fQCorrelations->SetMarkerStyle(25);
- fQCorrelations->SetLabelSize(0.03);
- fQCorrelations->SetLabelOffset(0.01,"Y");
- // 2-p:
- (fQCorrelations->GetXaxis())->SetBinLabel(1,"<<2>>_{n|n}");
- (fQCorrelations->GetXaxis())->SetBinLabel(2,"<<2>>_{2n|2n}");
- (fQCorrelations->GetXaxis())->SetBinLabel(3,"<<2>>_{3n|3n}");
- (fQCorrelations->GetXaxis())->SetBinLabel(4,"<<2>>_{4n|4n}");
- // 3-p:
- (fQCorrelations->GetXaxis())->SetBinLabel(6,"<<3>>_{2n|n,n}");
- (fQCorrelations->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}");
- (fQCorrelations->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}");
- (fQCorrelations->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}");
- // 4-p:
- (fQCorrelations->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}");
- (fQCorrelations->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}");
- (fQCorrelations->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}");
- (fQCorrelations->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}");
- (fQCorrelations->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}");
- (fQCorrelations->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}");
- (fQCorrelations->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}");
- // 5-p:
- (fQCorrelations->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}");
- (fQCorrelations->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}");
- (fQCorrelations->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}");
- (fQCorrelations->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}");
- // 6-p:
- (fQCorrelations->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}");
- (fQCorrelations->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}");
- (fQCorrelations->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}");
- (fQCorrelations->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}");
- // 7-p:
- (fQCorrelations->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}");
- // 8-p:
- (fQCorrelations->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}");
- // add fQCorrelations to the main list:
- fHistList->Add(fQCorrelations);
-
- //.........................................................................
- //weighted multi-particle correlations calculated from Q-vectors
- fQCorrelationsW = new TProfile("fQCorrelationsW","weighted multi-particle correlations from Q-vectors",200,0,200,"s");
- fQCorrelationsW->SetTickLength(-0.01,"Y");
- fQCorrelationsW->SetMarkerStyle(25);
- fQCorrelationsW->SetLabelSize(0.03);
- fQCorrelationsW->SetLabelOffset(0.01,"Y");
- // 2-p:
- (fQCorrelationsW->GetXaxis())->SetBinLabel(1,"<w_{1}w_{2}cos(n(#phi_{1}-#phi_{2}))>");
- (fQCorrelationsW->GetXaxis())->SetBinLabel(2,"<w_{1}^{2}w_{2}^{2}cos(2n(#phi_{1}-#phi_{2}))>");
- (fQCorrelationsW->GetXaxis())->SetBinLabel(3,"<w_{1}^{3}w_{2}^{3}cos(3n(#phi_{1}-#phi_{2}))>");
- (fQCorrelationsW->GetXaxis())->SetBinLabel(4,"<w_{1}^{4}w_{2}^{4}cos(4n(#phi_{1}-#phi_{2}))>");
- (fQCorrelationsW->GetXaxis())->SetBinLabel(5,"<w_{1}^{3}w_{2}cos(n(#phi_{1}-#phi_{2}))>");
- (fQCorrelationsW->GetXaxis())->SetBinLabel(6,"<w_{1}^{2}w_{2}w_{3}cos(n(#phi_{1}-#phi_{2}))>");
- // 3-p:
- (fQCorrelationsW->GetXaxis())->SetBinLabel(21,"<w_{1}w_{2}w_{3}^{2}cos(n(2#phi_{1}-#phi_{2}-#phi_{3}))>");
- // 4-p:
- (fQCorrelationsW->GetXaxis())->SetBinLabel(41,"<w_{1}w_{2}w_{3}w_{4}cos(n(#phi_{1}+#phi_{2}-#phi_{3}-#phi_{4}))>");
- // add fQCorrelationsW to the main list:
- fHistList->Add(fQCorrelationsW);
- //.........................................................................
-
- //.........................................................................
- // corrections for non-uniform acceptance (cos terms) calculated from Q-vectors
- fQCorrectionsCos = new TProfile("fQCorrectionsCos"," corrections for non-uniform acceptance (cos terms)",100,0,100,"s");
- fQCorrectionsCos->SetTickLength(-0.01,"Y");
- fQCorrectionsCos->SetMarkerStyle(25);
- fQCorrectionsCos->SetLabelSize(0.03);
- fQCorrectionsCos->SetLabelOffset(0.01,"Y");
- // 1-p:
- (fQCorrectionsCos->GetXaxis())->SetBinLabel(1,"cos(n(#phi_{1}))>");
- // 2-p:
- // 3-p:
-
- // add fQCorrectionsCos to the main list:
- fHistList->Add(fQCorrectionsCos);
- //.........................................................................
-
- // corrections for non-uniform acceptance (cos terms) calculated with nested loops
- fDirectCorrectionsCos = new TProfile("fDirectCorrectionsCos"," corrections for non-uniform acceptance (cos terms)",100,0,100,"s");
- fDirectCorrectionsCos->SetTickLength(-0.01,"Y");
- fDirectCorrectionsCos->SetMarkerStyle(25);
- fDirectCorrectionsCos->SetLabelSize(0.03);
- fDirectCorrectionsCos->SetLabelOffset(0.01,"Y");
- // binned in the samw way as fQCorrectionsCos (see above)
- // add fDirectCorrectionsCos to the main list:
- fHistList->Add(fDirectCorrectionsCos);
-
- //.........................................................................
- // corrections for non-uniform acceptance (sin terms) calculated from Q-vectors
- fQCorrectionsSin = new TProfile("fQCorrectionsSin"," corrections for non-uniform acceptance (sin terms)",100,0,100,"s");
- fQCorrectionsSin->SetTickLength(-0.01,"Y");
- fQCorrectionsSin->SetMarkerStyle(25);
- fQCorrectionsSin->SetLabelSize(0.03);
- fQCorrectionsSin->SetLabelOffset(0.01,"Y");
- // 1-p:
- (fQCorrectionsSin->GetXaxis())->SetBinLabel(1,"sin(n(#phi_{1}))>");
- // 2-p:
- // 3-p:
-
- // add fQCorrectionsSin to the main list:
- fHistList->Add(fQCorrectionsSin);
- //.........................................................................
-
- // corrections for non-uniform acceptance (sin terms) calculated with nested loops
- fDirectCorrectionsSin = new TProfile("fDirectCorrectionsSin"," corrections for non-uniform acceptance (sin terms)",100,0,100,"s");
- fDirectCorrectionsSin->SetTickLength(-0.01,"Y");
- fDirectCorrectionsSin->SetMarkerStyle(25);
- fDirectCorrectionsSin->SetLabelSize(0.03);
- fDirectCorrectionsSin->SetLabelOffset(0.01,"Y");
- // binned in the samw way as fQCorrectionsSin (see above)
- // add fDirectCorrectionsSin to the main list:
- fHistList->Add(fDirectCorrectionsSin);
-
- //average products
- fQProduct = new TProfile("fQProduct","average of products",6,0,6,"s");
- fQProduct->SetTickLength(-0.01,"Y");
- fQProduct->SetMarkerStyle(25);
- fQProduct->SetLabelSize(0.03);
- fQProduct->SetLabelOffset(0.01,"Y");
- (fQProduct->GetXaxis())->SetBinLabel(1,"<<2*4>>");
- (fQProduct->GetXaxis())->SetBinLabel(2,"<<2*6>>");
- (fQProduct->GetXaxis())->SetBinLabel(3,"<<2*8>>");
- (fQProduct->GetXaxis())->SetBinLabel(4,"<<4*6>>");
- (fQProduct->GetXaxis())->SetBinLabel(5,"<<4*8>>");
- (fQProduct->GetXaxis())->SetBinLabel(6,"<<6*8>>");
- fQProduct->SetXTitle("");
- fQProduct->SetYTitle("");
- fHistList->Add(fQProduct);
-
- // multi-particle correlations calculated with nested loops (needed for int. flow)
- fDirectCorrelations = new TProfile("fDirectCorrelations","multi-particle correlations with nested loops",100,0,100,"s");
- fDirectCorrelations->SetXTitle("");
- fDirectCorrelations->SetYTitle("correlations");
- fHistList->Add(fDirectCorrelations);
-
- // multi-particle correlations calculated with nested loops (needed for weighted int. flow)
- fDirectCorrelationsW = new TProfile("fDirectCorrelationsW","multi-particle correlations with nested loops",200,0,200,"s");
- fDirectCorrelationsW->SetXTitle("");
- fDirectCorrelationsW->SetYTitle("correlations");
- fHistList->Add(fDirectCorrelationsW);
-
- // multi-particle correlations calculated with nested loops (needed for diff. flow)
- fDirectCorrelationsDiffFlow = new TProfile("fDirectCorrelationsDiffFlow","multi-particle correlations with nested loops",200,0,200,"s");
- fDirectCorrelationsDiffFlow->SetXTitle("");
- fDirectCorrelationsDiffFlow->SetYTitle("correlations");
- fHistList->Add(fDirectCorrelationsDiffFlow);
-
- // multi-particle correlations calculated with nested loops (needed for weighted diff. flow)
- fDirectCorrelationsDiffFlowW = new TProfile("fDirectCorrelationsDiffFlowW","multi-particle correlations with nested loops",200,0,200,"s");
- fDirectCorrelationsDiffFlowW->SetXTitle("");
- fDirectCorrelationsDiffFlowW->SetYTitle("correlations");
- fHistList->Add(fDirectCorrelationsDiffFlowW);
-
- //f2PerPtBin1n1nRP
- f2PerPtBin1n1nRP = new TProfile("f2PerPtBin1n1nRP","<2'>_{n|n}",fnBinsPt,fPtMin,fPtMax,"s");
- f2PerPtBin1n1nRP->SetXTitle("p_{t} [GeV]");
- fDiffFlowList->Add(f2PerPtBin1n1nRP);
-
- //f4PerPtBin1n1n1n1nRP
- f4PerPtBin1n1n1n1nRP = new TProfile("f4PerPtBin1n1n1n1nRP","<4'>_{n,n|n,n}",fnBinsPt,fPtMin,fPtMax,"s");
- f4PerPtBin1n1n1n1nRP->SetXTitle("p_{t} [GeV]");
- fDiffFlowList->Add(f4PerPtBin1n1n1n1nRP);
-
- //f2PerEtaBin1n1nRP
- f2PerEtaBin1n1nRP = new TProfile("f2PerEtaBin1n1nRP","<2'>_{n|n}",fnBinsEta,fEtaMin,fEtaMax,"s");
- f2PerEtaBin1n1nRP->SetXTitle("#eta");
- fDiffFlowList->Add(f2PerEtaBin1n1nRP);
-
- //f4PerEtaBin1n1n1n1nRP
- f4PerEtaBin1n1n1n1nRP = new TProfile("f4PerEtaBin1n1n1n1nRP","<4'>_{n,n|n,n}",fnBinsEta,fEtaMin,fEtaMax,"s");
- f4PerEtaBin1n1n1n1nRP->SetXTitle("#eta");
- fDiffFlowList->Add(f4PerEtaBin1n1n1n1nRP);
-
- //f2PerPtBin1n1nPOI
- f2PerPtBin1n1nPOI = new TProfile("f2PerPtBin1n1nPOI","<2'>_{n|n}",fnBinsPt,fPtMin,fPtMax,"s");
- f2PerPtBin1n1nPOI->SetXTitle("#eta");
- fDiffFlowList->Add(f2PerPtBin1n1nPOI);
-
- //f4PerPtBin1n1n1n1nPOI
- f4PerPtBin1n1n1n1nPOI = new TProfile("f4PerPtBin1n1n1n1nPOI","<4'>_{n,n|n,n}",fnBinsPt,fPtMin,fPtMax,"s");
- f4PerPtBin1n1n1n1nPOI->SetXTitle("p_{t} [GeV]");
- fDiffFlowList->Add(f4PerPtBin1n1n1n1nPOI);
-
- //f2PerEtaBin1n1nPOI
- f2PerEtaBin1n1nPOI = new TProfile("f2PerEtaBin1n1nPOI","<2'>_{n|n}",fnBinsEta,fEtaMin,fEtaMax,"s");
- f2PerEtaBin1n1nPOI->SetXTitle("#eta");
- fDiffFlowList->Add(f2PerEtaBin1n1nPOI);
-
- //f4PerEtaBin1n1n1n1nPOI
- f4PerEtaBin1n1n1n1nPOI = new TProfile("f4PerEtaBin1n1n1n1nPOI","<4'>_{n,n|n,n}",fnBinsEta,fEtaMin,fEtaMax,"s");
- f4PerEtaBin1n1n1n1nPOI->SetXTitle("#eta");
- fDiffFlowList->Add(f4PerEtaBin1n1n1n1nPOI);
-
- //f2WPerPtBin1n1nPOI
- f2WPerPtBin1n1nPOI = new TProfile("f2WPerPtBin1n1nPOI","<2'>_{n|n}",fnBinsPt,fPtMin,fPtMax,"s");
- f2WPerPtBin1n1nPOI->SetXTitle("#pt");
- fDiffFlowList->Add(f2WPerPtBin1n1nPOI);
-
- //f4WPerPtBin1n1n1n1nPOI
- f4WPerPtBin1n1n1n1nPOI = new TProfile("f4WPerPtBin1n1n1n1nPOI","<4'>_{n,n|n,n}",fnBinsPt,fPtMin,fPtMax,"s");
- f4WPerPtBin1n1n1n1nPOI->SetXTitle("#Pt");
- fDiffFlowList->Add(f4WPerPtBin1n1n1n1nPOI);
-
- //f2WPerEtaBin1n1nPOI
- f2WPerEtaBin1n1nPOI = new TProfile("f2WPerEtaBin1n1nPOI","<2'>_{n|n}",fnBinsEta,fEtaMin,fEtaMax,"s");
- f2WPerEtaBin1n1nPOI->SetXTitle("#eta");
- fDiffFlowList->Add(f2WPerEtaBin1n1nPOI);
-
- //f4WPerEtaBin1n1n1n1nPOI
- f4WPerEtaBin1n1n1n1nPOI = new TProfile("f4WPerEtaBin1n1n1n1nPOI","<4'>_{n,n|n,n}",fnBinsEta,fEtaMin,fEtaMax,"s");
- f4WPerEtaBin1n1n1n1nPOI->SetXTitle("#eta");
- fDiffFlowList->Add(f4WPerEtaBin1n1n1n1nPOI);
-
- //f2WPerPtBin1n1nRP
- f2WPerPtBin1n1nRP = new TProfile("f2WPerPtBin1n1nRP","<2'>_{n|n}",fnBinsPt,fPtMin,fPtMax,"s");
- f2WPerPtBin1n1nRP->SetXTitle("#pt");
- fDiffFlowList->Add(f2WPerPtBin1n1nRP);
-
- //f4WPerPtBin1n1n1n1nRP
- f4WPerPtBin1n1n1n1nRP = new TProfile("f4WPerPtBin1n1n1n1nRP","<4'>_{n,n|n,n}",fnBinsPt,fPtMin,fPtMax,"s");
- f4WPerPtBin1n1n1n1nRP->SetXTitle("#Pt");
- fDiffFlowList->Add(f4WPerPtBin1n1n1n1nRP);
-
- //f2WPerEtaBin1n1nRP
- f2WPerEtaBin1n1nRP = new TProfile("f2WPerEtaBin1n1nRP","<2'>_{n|n}",fnBinsEta,fEtaMin,fEtaMax,"s");
- f2WPerEtaBin1n1nRP->SetXTitle("#eta");
- fDiffFlowList->Add(f2WPerEtaBin1n1nRP);
-
- //f4WPerEtaBin1n1n1n1nRP
- f4WPerEtaBin1n1n1n1nRP = new TProfile("f4WPerEtaBin1n1n1n1nRP","<4'>_{n,n|n,n}",fnBinsEta,fEtaMin,fEtaMax,"s");
- f4WPerEtaBin1n1n1n1nRP->SetXTitle("#eta");
- fDiffFlowList->Add(f4WPerEtaBin1n1n1n1nRP);
-
- //common control histogram (2nd order)
- fCommonHists2nd = new AliFlowCommonHist("AliFlowCommonHist2ndOrderQC");
- fHistList->Add(fCommonHists2nd);
-
- //common control histogram (4th order)
- fCommonHists4th = new AliFlowCommonHist("AliFlowCommonHist4thOrderQC");
- fHistList->Add(fCommonHists4th);
-
- //common control histogram (6th order)
- fCommonHists6th = new AliFlowCommonHist("AliFlowCommonHist6thOrderQC");
- fHistList->Add(fCommonHists6th);
-
- //common control histogram (8th order)
- fCommonHists8th = new AliFlowCommonHist("AliFlowCommonHist8thOrderQC");
- fHistList->Add(fCommonHists8th);
-
- //common histograms for final results (2nd order)
- fCommonHistsResults2nd = new AliFlowCommonHistResults("AliFlowCommonHistResults2ndOrderQC");
- fHistList->Add(fCommonHistsResults2nd);
-
- //common histograms for final results (4th order)
- fCommonHistsResults4th = new AliFlowCommonHistResults("AliFlowCommonHistResults4thOrderQC");
- fHistList->Add(fCommonHistsResults4th);
-
- //common histograms for final results (6th order)
- fCommonHistsResults6th = new AliFlowCommonHistResults("AliFlowCommonHistResults6thOrderQC");
- fHistList->Add(fCommonHistsResults6th);
-
- //common histograms for final results (8th order)
- fCommonHistsResults8th = new AliFlowCommonHistResults("AliFlowCommonHistResults8thOrderQC");
- fHistList->Add(fCommonHistsResults8th);
-
- //weighted <2>_{n|n} distribution
- f2pDistribution = new TH1D("f2pDistribution","<2>_{n|n} distribution",100000,-0.02,0.1);
- f2pDistribution->SetXTitle("<2>_{n|n}");
- f2pDistribution->SetYTitle("Counts");
- fHistList->Add(f2pDistribution);
-
- //weighted <4>_{n,n|n,n} distribution
- f4pDistribution = new TH1D("f4pDistribution","<4>_{n,n|n,n} distribution",100000,-0.00025,0.002);
- f4pDistribution->SetXTitle("<4>_{n,n|n,n}");
- f4pDistribution->SetYTitle("Counts");
- fHistList->Add(f4pDistribution);
-
- //weighted <6>_{n,n,n|n,n,n} distribution
- f6pDistribution = new TH1D("f6pDistribution","<6>_{n,n,n|n,n,n} distribution",100000,-0.000005,0.000025);
- f6pDistribution->SetXTitle("<6>_{n,n,n|n,n,n}");
- f6pDistribution->SetYTitle("Counts");
- fHistList->Add(f6pDistribution);
-
- //weighted <8>_{n,n,n,n|n,n,n,n} distribution
- f8pDistribution = new TH1D("f8pDistribution","<8>_{n,n,n,n|n,n,n,n} distribution",100000,-0.000000001,0.00000001);
- f8pDistribution->SetXTitle("<8>_{n,n,n,n|n,n,n,n}");
- f8pDistribution->SetYTitle("Counts");
- fHistList->Add(f8pDistribution);
-
-
-
-
-
-
-
-
- // .......................................................................................................................................
- // Q_{n,k} and S^M_{n,k}:
- fReQ = new TMatrixD(4,9);
- fImQ = new TMatrixD(4,9);
- fSMpk = new TMatrixD(8,9);
-
- // q'_{n}:
- fReqnPtEta = new TH2D("fReqnPtEta","Re[q_{n}(p_{t},#eta)]",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fImqnPtEta = new TH2D("fImqnPtEta","Im[q_{n}(p_{t},#eta)]",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fmPtEta = new TH2D("fmPtEta","m(p_{t},#eta)",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
-
- // non-weighted q''_{n} and q''_{2n}:
- fReqPrimePrime1nPtEta = new TH2D("fReqPrimePrime1nPtEta","Re[q''_{n}(p_{t},#eta)]",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fImqPrimePrime1nPtEta = new TH2D("fImqPrimePrime1nPtEta","Im[q''_{n}(p_{t},#eta)]",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fReqPrimePrime2nPtEta = new TH2D("fReqPrimePrime2nPtEta","Re[q''_{2n}(p_{t},#eta)]",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fImqPrimePrime2nPtEta = new TH2D("fImqPrimePrime2nPtEta","Im[q''_{2n}(p_{t},#eta)]",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
-
- // weighted q''_{n,2k} and q''_{2n,k}:
- fReqPrimePrime1n2kPtEta = new TH2D("fReqPrimePrime1n2kPtEta","Re[q''_{n,2}(p_{t},#eta)]",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fImqPrimePrime1n2kPtEta = new TH2D("fImqPrimePrime1n2kPtEta","Im[q''_{n,2}(p_{t},#eta)]",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fReqPrimePrime2n1kPtEta = new TH2D("fReqPrimePrime2n1kPtEta","Re[q''_{2n,1(p_{t},#eta)}]",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fImqPrimePrime2n1kPtEta = new TH2D("fImqPrimePrime2n1kPtEta","Im[q''_{2n,1}(p_{t},#eta)]",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
-
- // m'':
- fmPrimePrimePtEta = new TH2D("fmPrimePrimePtEta","m''(p_{t},#eta)",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
-
- // S^{m''}_{p,k}:
- fSmPrimePrime1p1kPtEta = new TH2D("fSmPrimePrime1p1kPtEta","S^{m''}_{1,1}(p_{t},#eta)",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fSmPrimePrime1p2kPtEta = new TH2D("fSmPrimePrime1p2kPtEta","S^{m''}_{1,2}(p_{t},#eta)",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fSmPrimePrime1p3kPtEta = new TH2D("fSmPrimePrime1p3kPtEta","S^{m''}_{1,3}(p_{t},#eta)",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
-
- // non-weighted q_RP{n} and q_RP{2n}:
- fReqRP1nPtEta = new TH2D("fReqRP1nPtEta","Re[q_{n}(p_{t},#eta)] for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fImqRP1nPtEta = new TH2D("fImqRP1nPtEta","Im[q_{n}(p_{t},#eta)] for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fReqRP2nPtEta = new TH2D("fReqRP2nPtEta","Re[q_{2n}(p_{t},#eta)] for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fImqRP2nPtEta = new TH2D("fImqRP2nPtEta","Im[q_{2n}(p_{t},#eta)] for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
-
- // weighted q_RP{n,2k} and q_RP{2n,k}:
- fReqRP1n2kPtEta = new TH2D("fReqRP1n2kPtEta","Re[q_{n,2}(p_{t},#eta)] for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fImqRP1n2kPtEta = new TH2D("fImqRP1n2kPtEta","Im[q_{n,2}(p_{t},#eta)] for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fReqRP2n1kPtEta = new TH2D("fReqRP2n1kPtEta","Re[q_{2n,1(p_{t},#eta)}] for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fImqRP2n1kPtEta = new TH2D("fImqRP2n1kPtEta","Im[q_{2n,1}(p_{t},#eta)] for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
-
- // mRP:
- fmRPPtEta = new TH2D("fmRPPtEta","m(p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
-
- // S^{mRP}_{p,k}:
- fSmRP1p1kPtEta = new TH2D("fSmRP1p1kPtEta","S^{m}_{1,1}(p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fSmRP1p2kPtEta = new TH2D("fSmRP1p2kPtEta","S^{m}_{1,2}(p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fSmRP1p3kPtEta = new TH2D("fSmRP1p3kPtEta","S^{m}_{1,3}(p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
-
- // ----- RESULTS ----
-
- // final corrections for non-uniform acceptance for QC{2}, QC{4}, QC{6} and QC{8}:
- fFinalCorrectionsForNUA = new TH1D("fFinalCorrectionsForNUA","Corrections for non-uniform acceptance to Q-cumulants",4,0,4);
- fFinalCorrectionsForNUA->SetLabelSize(0.06);
- fFinalCorrectionsForNUA->SetMarkerStyle(25);
- (fFinalCorrectionsForNUA->GetXaxis())->SetBinLabel(1,"QC{2}");
- (fFinalCorrectionsForNUA->GetXaxis())->SetBinLabel(2,"QC{4}");
- (fFinalCorrectionsForNUA->GetXaxis())->SetBinLabel(3,"QC{6}");
- (fFinalCorrectionsForNUA->GetXaxis())->SetBinLabel(4,"QC{8}");
- fResultsList->Add(fFinalCorrectionsForNUA);
-
- // final results for non-weighted no-name integrated flow:
- fIntFlowResultsQC = new TH1D("fIntFlowResultsQC","Integrated Flow from Q-cumulants",4,0,4);
- fIntFlowResultsQC->SetLabelSize(0.06);
- fIntFlowResultsQC->SetMarkerStyle(25);
- (fIntFlowResultsQC->GetXaxis())->SetBinLabel(1,"v_{n}{2}");
- (fIntFlowResultsQC->GetXaxis())->SetBinLabel(2,"v_{n}{4}");
- (fIntFlowResultsQC->GetXaxis())->SetBinLabel(3,"v_{n}{6}");
- (fIntFlowResultsQC->GetXaxis())->SetBinLabel(4,"v_{n}{8}");
- fResultsList->Add(fIntFlowResultsQC);
-
- // final results for non-weighted POIs integrated flow:
- fIntFlowResultsPOIQC = new TH1D("fIntFlowResultsPOIQC","Integrated Flow (POI) from Q-cumulants",4,0,4);
- fIntFlowResultsPOIQC->SetLabelSize(0.06);
- fIntFlowResultsPOIQC->SetMarkerStyle(25);
- (fIntFlowResultsPOIQC->GetXaxis())->SetBinLabel(1,"v_{n}{2}");
- (fIntFlowResultsPOIQC->GetXaxis())->SetBinLabel(2,"v_{n}{4}");
- (fIntFlowResultsPOIQC->GetXaxis())->SetBinLabel(3,"v_{n}{6}");
- (fIntFlowResultsPOIQC->GetXaxis())->SetBinLabel(4,"v_{n}{8}");
- fResultsList->Add(fIntFlowResultsPOIQC);
-
- // final results for non-weighted RPs integrated flow:
- fIntFlowResultsRPQC = new TH1D("fIntFlowResultsRPQC","Integrated Flow (RP) from Q-cumulants",4,0,4);
- fIntFlowResultsRPQC->SetLabelSize(0.06);
- fIntFlowResultsRPQC->SetMarkerStyle(25);
- (fIntFlowResultsRPQC->GetXaxis())->SetBinLabel(1,"v_{n}{2}");
- (fIntFlowResultsRPQC->GetXaxis())->SetBinLabel(2,"v_{n}{4}");
- (fIntFlowResultsRPQC->GetXaxis())->SetBinLabel(3,"v_{n}{6}");
- (fIntFlowResultsRPQC->GetXaxis())->SetBinLabel(4,"v_{n}{8}");
- fResultsList->Add(fIntFlowResultsRPQC);
-
- // final results for weighted no-name integrated flow:
- fIntFlowResultsQCW = new TH1D("fIntFlowResultsQCW","Integrated Flow from Q-cumulants with Weights",4,0,4);
- fIntFlowResultsQCW->SetLabelSize(0.06);
- fIntFlowResultsQCW->SetMarkerStyle(25);
- (fIntFlowResultsQCW->GetXaxis())->SetBinLabel(1,"v_{n}{2}");
- (fIntFlowResultsQCW->GetXaxis())->SetBinLabel(2,"v_{n}{4}");
- (fIntFlowResultsQCW->GetXaxis())->SetBinLabel(3,"v_{n}{6}");
- (fIntFlowResultsQCW->GetXaxis())->SetBinLabel(4,"v_{n}{8}");
- fResultsList->Add(fIntFlowResultsQCW);
-
- // final results for weighted POIs integrated flow:
- fIntFlowResultsPOIQCW = new TH1D("fIntFlowResultsPOIQCW","Integrated Flow (POI) from Q-cumulants with Weights",4,0,4);
- fIntFlowResultsPOIQCW->SetLabelSize(0.06);
- fIntFlowResultsPOIQCW->SetMarkerStyle(25);
- (fIntFlowResultsPOIQCW->GetXaxis())->SetBinLabel(1,"v_{n}{2}");
- (fIntFlowResultsPOIQCW->GetXaxis())->SetBinLabel(2,"v_{n}{4}");
- (fIntFlowResultsPOIQCW->GetXaxis())->SetBinLabel(3,"v_{n}{6}");
- (fIntFlowResultsPOIQCW->GetXaxis())->SetBinLabel(4,"v_{n}{8}");
- fResultsList->Add(fIntFlowResultsPOIQCW);
-
- // final results for weighted RPs integrated flow:
- fIntFlowResultsRPQCW = new TH1D("fIntFlowResultsRPQCW","Integrated Flow (RP) from Q-cumulants with Weights",4,0,4);
- fIntFlowResultsRPQCW->SetLabelSize(0.06);
- fIntFlowResultsRPQCW->SetMarkerStyle(25);
- (fIntFlowResultsRPQCW->GetXaxis())->SetBinLabel(1,"v_{n}{2}");
- (fIntFlowResultsRPQCW->GetXaxis())->SetBinLabel(2,"v_{n}{4}");
- (fIntFlowResultsRPQCW->GetXaxis())->SetBinLabel(3,"v_{n}{6}");
- (fIntFlowResultsRPQCW->GetXaxis())->SetBinLabel(4,"v_{n}{8}");
- fResultsList->Add(fIntFlowResultsRPQCW);
-
- // <cos n(psi1-phi2)> for POIs:
- f2pPtEtaPOI = new TProfile2D("f2pPtEtaPOI","<cos n(#psi_{1}-#phi_{2})> (p_{t},#eta) for POIs",
- fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s");
- f2pPtEtaPOI->SetXTitle("p_{t}");
- f2pPtEtaPOI->SetYTitle("#eta");
- fDiffFlowList->Add(f2pPtEtaPOI);
-
- // <cos n(psi1+phi2-phi3-phi4)> for POIs:
- f4pPtEtaPOI = new TProfile2D("f4pPtEtaPOI","<cos n(#psi_{1}+#phi_{2}-#phi_{3}-#phi_{4})> (p_{t},#eta) for POIs",
- fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s");
- f4pPtEtaPOI->SetXTitle("p_{t}");
- f4pPtEtaPOI->SetYTitle("#eta");
- fDiffFlowList->Add(f4pPtEtaPOI);
-
- // <cos n(psi1+phi2+phi3-phi4-phi5-phi6)> for POIs:
- f6pPtEtaPOI = new TProfile2D("f6pPtEtaPOI","<cos n(#psi_{1}+#phi_{2}+#phi_{3}-#phi_{4}-#phi_{5}-#phi_{6})> (p_{t},#eta) for POIs",
- fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s");
- f6pPtEtaPOI->SetXTitle("p_{t}");
- f6pPtEtaPOI->SetYTitle("#eta");
- fDiffFlowList->Add(f6pPtEtaPOI);
-
- // <cos n(psi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)> for POIs:
- f8pPtEtaPOI = new TProfile2D("f8pPtEtaPOI","<cos n(#psi_{1}+#phi_{2}+#phi_{3}+#phi_{4}-#phi_{5}-#phi_{6}-#phi_{7}-#phi_{8})> (p_{t},#eta) for POIs",
- fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s");
- f8pPtEtaPOI->SetXTitle("p_{t}");
- f8pPtEtaPOI->SetYTitle("#eta");
- fDiffFlowList->Add(f8pPtEtaPOI);
-
- // non-weighted v'_{n}{2,QC} (pt,eta) for POIs
- fvn2ndPtEtaPOI = new TH2D("fvn2ndPtEtaPOI","v'_{n}{2,QC} (p_{t},#eta) for POIs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fvn2ndPtEtaPOI->SetXTitle("p_{t}");
- fvn2ndPtEtaPOI->SetYTitle("#eta");
- fResultsList->Add(fvn2ndPtEtaPOI);
-
- // non-weighted v'_{n}{4,QC} (pt,eta) for POIs
- fvn4thPtEtaPOI = new TH2D("fvn4thPtEtaPOI","v'_{n}{4,QC} (p_{t},#eta) for POIs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fvn4thPtEtaPOI->SetXTitle("p_{t}");
- fvn4thPtEtaPOI->SetYTitle("#eta");
- fResultsList->Add(fvn4thPtEtaPOI);
-
- // non-weighted v'_{n}{6,QC} (pt,eta) for POIs
- fvn6thPtEtaPOI = new TH2D("fvn6thPtEtaPOI","v'_{n}{6,QC} (p_{t},#eta) for POIs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fvn6thPtEtaPOI->SetXTitle("p_{t}");
- fvn6thPtEtaPOI->SetYTitle("#eta");
- fResultsList->Add(fvn6thPtEtaPOI);
-
- // non-weighted v'_{n}{8,QC} (pt,eta) for POIs
- fvn8thPtEtaPOI = new TH2D("fvn8thPtEtaPOI","v'_{n}{8,QC} (p_{t},#eta) for POIs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fvn8thPtEtaPOI->SetXTitle("p_{t}");
- fvn8thPtEtaPOI->SetYTitle("#eta");
- fResultsList->Add(fvn8thPtEtaPOI);
-
- // non-weighted v'_{n}{2,QC} (pt) for POIs
- fvn2ndPtPOI = new TH1D("fvn2ndPtPOI","v'_{n}{2,QC} (p_{t}) for POIs",fnBinsPt,fPtMin,fPtMax);
- fvn2ndPtPOI->SetXTitle("p_{t}");
- fResultsList->Add(fvn2ndPtPOI);
-
- // non-weighted v'_{n}{4,QC} (pt) for POIs
- fvn4thPtPOI = new TH1D("fvn4thPtPOI","v'_{n}{4,QC} (p_{t}) for POIs",fnBinsPt,fPtMin,fPtMax);
- fvn4thPtPOI->SetXTitle("p_{t}");
- fvn4thPtPOI->SetYTitle("#eta");
- fResultsList->Add(fvn4thPtPOI);
-
- // non-weighted v'_{n}{6,QC} (pt) for POIs
- fvn6thPtPOI = new TH1D("fvn6thPtPOI","v'_{n}{6,QC} (p_{t}) for POIs",fnBinsPt,fPtMin,fPtMax);
- fvn6thPtPOI->SetXTitle("p_{t}");
- fResultsList->Add(fvn6thPtPOI);
-
- // non-weighted v'_{n}{8,QC} (pt) for POIs
- fvn8thPtPOI = new TH1D("fvn8thPtPOI","v'_{n}{8,QC} (p_{t}) for POIs",fnBinsPt,fPtMin,fPtMax);
- fvn8thPtPOI->SetXTitle("p_{t}");
- fResultsList->Add(fvn8thPtPOI);
-
- // non-weighted v'_{n}{2,QC} (eta) for POIs
- fvn2ndEtaPOI = new TH1D("fvn2ndEtaPOI","v'_{n}{2,QC} (#eta) for POIs",fnBinsEta,fEtaMin,fEtaMax);
- fvn2ndEtaPOI->SetXTitle("#eta");
- fResultsList->Add(fvn2ndEtaPOI);
-
- // non-weighted v'_{n}{4,QC} (eta) for POIs
- fvn4thEtaPOI = new TH1D("fvn4thEtaPOI","v'_{n}{4,QC} (#eta) for POIs",fnBinsEta,fEtaMin,fEtaMax);
- fvn4thEtaPOI->SetXTitle("#eta");
- fResultsList->Add(fvn4thEtaPOI);
-
- // non-weighted v'_{n}{6,QC} (eta) for POIs
- fvn6thEtaPOI = new TH1D("fvn6thEtaPOI","v'_{n}{6,QC} (#eta) for POIs",fnBinsEta,fEtaMin,fEtaMax);
- fvn6thEtaPOI->SetXTitle("#eta");
- fResultsList->Add(fvn6thEtaPOI);
-
- // non-weighted v'_{n}{8,QC} (eta) for POIs
- fvn8thEtaPOI = new TH1D("fvn8thEtaPOI","v'_{n}{8,QC} (#eta) for POIs",fnBinsEta,fEtaMin,fEtaMax);
- fvn8thEtaPOI->SetXTitle("p_{t}");
- fResultsList->Add(fvn8thEtaPOI);
-
- // <w2 cos n(psi1-phi2)> for POIs:
- f2pPtEtaPOIW = new TProfile2D("f2pPtEtaPOIW","<w_{2} cos n(#psi_{1}-#phi_{2})> (p_{t},#eta) for POIs",
- fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s");
- f2pPtEtaPOIW->SetXTitle("p_{t}");
- fDiffFlowList->Add(f2pPtEtaPOIW);
-
- // <w2 w3 w4 cos n(psi1+phi2-phi3-phi4)> for POIs:
- f4pPtEtaPOIW = new TProfile2D("f4pPtEtaPOIW","<w_{2}w_{3}w_{4} cos n(#psi_{1}+#phi_{2}-#phi_{3}-#phi_{4})> (p_{t},#eta) for POIs",
- fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s");
- f4pPtEtaPOIW->SetXTitle("p_{t}");
- fDiffFlowList->Add(f4pPtEtaPOIW);
-
- // <w2 w3 w4 w5 w6 cos n(psi1+phi2+phi3-phi4-phi5-phi6)> for POIs:
- f6pPtEtaPOIW = new TProfile2D("f6pPtEtaPOIW","<w_{2}w_{3}w_{4}w_{5}w_{6} cos n(#psi_{1}+#phi_{2}+#phi_{3}-#phi_{4}-#phi_{5}-#phi_{6})> (p_{t},#eta) for POIs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s");
- f6pPtEtaPOIW->SetXTitle("p_{t}");
- fDiffFlowList->Add(f6pPtEtaPOIW);
-
- // <w2 w3 w4 w5 w6 w7 w8 cos n(psi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)> for POIs:
- f8pPtEtaPOIW = new TProfile2D("f8pPtEtaPOIW","<w_{2}w_{3}w_{4}w_{5}w_{6}w_{7}w_{8} cos n(#psi_{1}+#phi_{2}+#phi_{3}+#phi_{4}-#phi_{5}-#phi_{6}-#phi_{7}-#phi_{8})> (p_{t},#eta) for POIs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s");
- f8pPtEtaPOIW->SetXTitle("p_{t}");
- f8pPtEtaPOIW->SetYTitle("#eta");
- fDiffFlowList->Add(f8pPtEtaPOIW);
-
- // weighted v'_{n}{2,QC} (pt,eta) for POIs
- fvn2ndPtEtaPOIW = new TH2D("fvn2ndPtEtaPOIW","weighted v'_{n}{2,QC} (p_{t},#eta) for POIs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fvn2ndPtEtaPOIW->SetXTitle("p_{t}");
- fvn2ndPtEtaPOIW->SetYTitle("#eta");
- fResultsList->Add(fvn2ndPtEtaPOIW);
-
- // weighted v'_{n}{4,QC} (pt,eta) for POIs
- fvn4thPtEtaPOIW = new TH2D("fvn4thPtEtaPOIW","weighted v'_{n}{4,QC} (p_{t},#eta) for POIs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fvn4thPtEtaPOIW->SetXTitle("p_{t}");
- fvn4thPtEtaPOIW->SetYTitle("#eta");
- fResultsList->Add(fvn4thPtEtaPOIW);
-
- // weighted v'_{n}{6,QC} (pt,eta) for POIs
- fvn6thPtEtaPOIW = new TH2D("fvn6thPtEtaPOIW","weighted v'_{n}{6,QC} (p_{t},#eta) for POIs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fvn6thPtEtaPOIW->SetXTitle("p_{t}");
- fvn6thPtEtaPOIW->SetYTitle("#eta");
- fResultsList->Add(fvn6thPtEtaPOIW);
-
- // weighted v'_{n}{8,QC} (pt,eta) for POIs
- fvn8thPtEtaPOIW = new TH2D("fvn8thPtEtaPOIW","weighted v'_{n}{8,QC} (p_{t},#eta) for POIs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fvn8thPtEtaPOIW->SetXTitle("p_{t}");
- fvn8thPtEtaPOIW->SetYTitle("#eta");
- fResultsList->Add(fvn8thPtEtaPOIW);
-
- // weighted v'_{n}{2,QC} (pt) for POIs
- fvn2ndPtPOIW = new TH1D("fvn2ndPtPOIW","weighted v'_{n}{2,QC} (p_{t}) for POIs",fnBinsPt,fPtMin,fPtMax);
- fvn2ndPtPOIW->SetXTitle("p_{t}");
- fResultsList->Add(fvn2ndPtPOIW);
-
- // weighted v'_{n}{4,QC} (pt) for POIs
- fvn4thPtPOIW = new TH1D("fvn4thPtPOIW","weighted v'_{n}{4,QC} (p_{t}) for POIs",fnBinsPt,fPtMin,fPtMax);
- fvn4thPtPOIW->SetXTitle("p_{t}");
- fResultsList->Add(fvn4thPtPOIW);
-
- // weighted v'_{n}{6,QC} (pt) for POIs
- fvn6thPtPOIW = new TH1D("fvn6thPtPOIW","weighted v'_{n}{6,QC} (p_{t}) for POIs",fnBinsPt,fPtMin,fPtMax);
- fvn6thPtPOIW->SetXTitle("p_{t}");
- fResultsList->Add(fvn6thPtPOIW);
-
- // weighted v'_{n}{8,QC} (pt) for POIs
- fvn8thPtPOIW = new TH1D("fvn8thPtPOIW","weighted v'_{n}{8,QC} (p_{t}) for POIs",fnBinsPt,fPtMin,fPtMax);
- fvn8thPtPOIW->SetXTitle("p_{t}");
- fResultsList->Add(fvn8thPtPOIW);
-
- // weighted v'_{n}{2,QC} (eta) for POIs
- fvn2ndEtaPOIW = new TH1D("fvn2ndEtaPOIW","weighted v'_{n}{2,QC} (#eta) for POIs",fnBinsEta,fEtaMin,fEtaMax);
- fvn2ndEtaPOIW->SetXTitle("#eta");
- fResultsList->Add(fvn2ndEtaPOIW);
-
- // weighted v'_{n}{4,QC} (eta) for POIs
- fvn4thEtaPOIW = new TH1D("fvn4thEtaPOIW","weighted v'_{n}{4,QC} (#eta) for POIs",fnBinsEta,fEtaMin,fEtaMax);
- fvn4thEtaPOIW->SetXTitle("#eta");
- fResultsList->Add(fvn4thEtaPOIW);
-
- // weighted v'_{n}{6,QC} (eta) for POIs
- fvn6thEtaPOIW = new TH1D("fvn6thEtaPOIW","weighted v'_{n}{6,QC} (#eta) for POIs",fnBinsEta,fEtaMin,fEtaMax);
- fvn6thEtaPOIW->SetXTitle("#eta");
- fResultsList->Add(fvn6thEtaPOIW);
-
- // weighted v'_{n}{8,QC} (eta) for POIs
- fvn8thEtaPOIW = new TH1D("fvn8thEtaPOIW","weighted v'_{n}{8,QC} (#eta) for POIs",fnBinsEta,fEtaMin,fEtaMax);
- fvn8thEtaPOIW->SetXTitle("#eta");
- fResultsList->Add(fvn8thEtaPOIW);
-
- // <cos n(psi1-phi2)> for RPs:
- f2pPtEtaRP = new TProfile2D("f2pPtEtaRP","<cos n(#psi_{1}-#phi_{2})> (p_{t},#eta) for RPs",
- fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s");
- f2pPtEtaRP->SetXTitle("p_{t}");
- f2pPtEtaRP->SetYTitle("#eta");
- fDiffFlowList->Add(f2pPtEtaRP);
-
- // <cos n(psi1+phi2-phi3-phi4)> for RPs:
- f4pPtEtaRP = new TProfile2D("f4pPtEtaRP","<cos n(#psi_{1}+#phi_{2}-#phi_{3}-#phi_{4})> (p_{t},#eta) for RPs",
- fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s");
- f4pPtEtaRP->SetXTitle("p_{t}");
- f4pPtEtaRP->SetYTitle("#eta");
- fDiffFlowList->Add(f4pPtEtaRP);
-
- // <cos n(psi1+phi2+phi3-phi4-phi5-phi6)> for RPs:
- f6pPtEtaRP = new TProfile2D("f6pPtEtaRP","<cos n(#psi_{1}+#phi_{2}+#phi_{3}-#phi_{4}-#phi_{5}-#phi_{6})> (p_{t},#eta) for RPs",
- fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s");
- f6pPtEtaRP->SetXTitle("p_{t}");
- f6pPtEtaRP->SetYTitle("#eta");
- fDiffFlowList->Add(f6pPtEtaRP);
-
- // <cos n(psi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)> for RPs:
- f8pPtEtaRP = new TProfile2D("f8pPtEtaRP","<cos n(#psi_{1}+#phi_{2}+#phi_{3}+#phi_{4}-#phi_{5}-#phi_{6}-#phi_{7}-#phi_{8})> (p_{t},#eta) for RPs",
- fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s");
- f8pPtEtaRP->SetXTitle("p_{t}");
- f8pPtEtaRP->SetYTitle("#eta");
- fDiffFlowList->Add(f8pPtEtaRP);
-
- // non-weighted v'_{n}{2,QC} (pt,eta) for RPs
- fvn2ndPtEtaRP = new TH2D("fvn2ndPtEtaRP","v'_{n}{2,QC} (p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fvn2ndPtEtaRP->SetXTitle("p_{t}");
- fvn2ndPtEtaRP->SetYTitle("#eta");
- fResultsList->Add(fvn2ndPtEtaRP);
-
- // non-weighted v'_{n}{4,QC} (pt,eta) for RPs
- fvn4thPtEtaRP = new TH2D("fvn4thPtEtaRP","v'_{n}{4,QC} (p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fvn4thPtEtaRP->SetXTitle("p_{t}");
- fvn4thPtEtaRP->SetYTitle("#eta");
- fResultsList->Add(fvn4thPtEtaRP);
-
- // non-weighted v'_{n}{6,QC} (pt,eta) for RPs
- fvn6thPtEtaRP = new TH2D("fvn6thPtEtaRP","v'_{n}{6,QC} (p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fvn6thPtEtaRP->SetXTitle("p_{t}");
- fvn6thPtEtaRP->SetYTitle("#eta");
- fResultsList->Add(fvn6thPtEtaRP);
-
- // non-weighted v'_{n}{8,QC} (pt,eta) for RPs
- fvn8thPtEtaRP = new TH2D("fvn8thPtEtaRP","v'_{n}{8,QC} (p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fvn8thPtEtaRP->SetXTitle("p_{t}");
- fvn8thPtEtaRP->SetYTitle("#eta");
- fResultsList->Add(fvn8thPtEtaRP);
-
- // non-weighted v'_{n}{2,QC} (pt) for RPs
- fvn2ndPtRP = new TH1D("fvn2ndPtRP","v'_{n}{2,QC} (p_{t}) for RPs",fnBinsPt,fPtMin,fPtMax);
- fvn2ndPtRP->SetXTitle("p_{t}");
- fResultsList->Add(fvn2ndPtRP);
-
- // non-weighted v'_{n}{4,QC} (pt) for RPs
- fvn4thPtRP = new TH1D("fvn4thPtRP","v'_{n}{4,QC} (p_{t}) for RPs",fnBinsPt,fPtMin,fPtMax);
- fvn4thPtRP->SetXTitle("p_{t}");
- fResultsList->Add(fvn4thPtRP);
-
- // non-weighted v'_{n}{6,QC} (pt) for RPs
- fvn6thPtRP = new TH1D("fvn6thPtRP","v'_{n}{6,QC} (p_{t}) for RPs",fnBinsPt,fPtMin,fPtMax);
- fvn6thPtRP->SetXTitle("p_{t}");
- fResultsList->Add(fvn6thPtRP);
-
- // non-weighted v'_{n}{8,QC} (pt) for RPs
- fvn8thPtRP = new TH1D("fvn8thPtRP","v'_{n}{8,QC} (p_{t}) for RPs",fnBinsPt,fPtMin,fPtMax);
- fvn8thPtRP->SetXTitle("p_{t}");
- fResultsList->Add(fvn8thPtRP);
-
- // non-weighted v'_{n}{2,QC} (eta) for RPs
- fvn2ndEtaRP = new TH1D("fvn2ndEtaRP","v'_{n}{2,QC} (#eta) for RPs",fnBinsEta,fEtaMin,fEtaMax);
- fvn2ndEtaRP->SetXTitle("#eta");
- fResultsList->Add(fvn2ndEtaRP);
-
- // non-weighted v'_{n}{4,QC} (eta) for RPs
- fvn4thEtaRP = new TH1D("fvn4thEtaRP","v'_{n}{4,QC} (#eta) for RPs",fnBinsEta,fEtaMin,fEtaMax);
- fvn4thEtaRP->SetXTitle("#eta");
- fResultsList->Add(fvn4thEtaRP);
-
- // non-weighted v'_{n}{6,QC} (eta) for RPs
- fvn6thEtaRP = new TH1D("fvn6thEtaRP","v'_{n}{6,QC} (#eta) for RPs",fnBinsEta,fEtaMin,fEtaMax);
- fvn6thEtaRP->SetXTitle("#eta");
- fResultsList->Add(fvn6thEtaRP);
-
- // non-weighted v'_{n}{8,QC} (eta) for RPs
- fvn8thEtaRP = new TH1D("fvn8thEtaRP","v'_{n}{8,QC} (#eta) for RPs",fnBinsEta,fEtaMin,fEtaMax);
- fvn8thEtaRP->SetXTitle("#eta");
- fResultsList->Add(fvn8thEtaRP);
-
- // <w2 cos n(psi1-phi2)> for RPs:
- f2pPtEtaRPW = new TProfile2D("f2pPtEtaRPW","<w_{2} cos n(#psi_{1}-#phi_{2})> (p_{t},#eta) for RPs",
- fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s");
- f2pPtEtaRPW->SetXTitle("p_{t}");
- f2pPtEtaRPW->SetYTitle("#eta");
- fDiffFlowList->Add(f2pPtEtaRPW);
-
- // <w2 w3 w4 cos n(psi1+phi2-phi3-phi4)> for RPs:
- f4pPtEtaRPW = new TProfile2D("f4pPtEtaRPW","<w_{2}w_{3}w_{4} cos n(#psi_{1}+#phi_{2}-#phi_{3}-#phi_{4})> (p_{t},#eta) for RPs",
- fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s");
- f4pPtEtaRPW->SetXTitle("p_{t}");
- f4pPtEtaRPW->SetYTitle("#eta");
- fDiffFlowList->Add(f4pPtEtaRPW);
-
- // <w2 w3 w4 w5 w6 cos n(psi1+phi2+phi3-phi4-phi5-phi6)> for RPs:
- f6pPtEtaRPW = new TProfile2D("f6pPtEtaRPW","<w_{2}w_{3}w_{4}w_{5}w_{6} cos n(#psi_{1}+#phi_{2}+#phi_{3}-#phi_{4}-#phi_{5}-#phi_{6})> (p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s");
- f6pPtEtaRPW->SetXTitle("p_{t}");
- f6pPtEtaRPW->SetYTitle("#eta");
- fDiffFlowList->Add(f6pPtEtaRPW);
-
- // <w2 w3 w4 w5 w6 w7 w8 cos n(psi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)> for RPs:
- f8pPtEtaRPW = new TProfile2D("f8pPtEtaRPW","<w_{2}w_{3}w_{4}w_{5}w_{6}w_{7}w_{8} cos n(#psi_{1}+#phi_{2}+#phi_{3}+#phi_{4}-#phi_{5}-#phi_{6}-#phi_{7}-#phi_{8})> (p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,"s");
- f8pPtEtaRPW->SetXTitle("p_{t}");
- f8pPtEtaRPW->SetYTitle("#eta");
- fDiffFlowList->Add(f8pPtEtaRPW);
-
- // weighted v'_{n}{2,QC} (pt,eta) for RPs
- fvn2ndPtEtaRPW = new TH2D("fvn2ndPtEtaRPW","weighted v'_{n}{2,QC} (p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fvn2ndPtEtaRPW->SetXTitle("p_{t}");
- fvn2ndPtEtaRPW->SetYTitle("#eta");
- fResultsList->Add(fvn2ndPtEtaRPW);
-
- // weighted v'_{n}{4,QC} (pt,eta) for RPs
- fvn4thPtEtaRPW = new TH2D("fvn4thPtEtaRPW","weighted v'_{n}{4,QC} (p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fvn4thPtEtaRPW->SetXTitle("p_{t}");
- fvn4thPtEtaRPW->SetYTitle("#eta");
- fResultsList->Add(fvn4thPtEtaRPW);
-
- // weighted v'_{n}{6,QC} (pt,eta) for RPs
- fvn6thPtEtaRPW = new TH2D("fvn6thPtEtaRPW","weighted v'_{n}{6,QC} (p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fvn6thPtEtaRPW->SetXTitle("p_{t}");
- fvn6thPtEtaRPW->SetYTitle("#eta");
- fResultsList->Add(fvn6thPtEtaRPW);
-
- // weighted v'_{n}{8,QC} (pt,eta) for RPs
- fvn8thPtEtaRPW = new TH2D("fvn8thPtEtaRPW","weighted v'_{n}{8,QC} (p_{t},#eta) for RPs",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);
- fvn8thPtEtaRPW->SetXTitle("p_{t}");
- fvn8thPtEtaRPW->SetYTitle("#eta");
- fResultsList->Add(fvn8thPtEtaRPW);
-
- // weighted v'_{n}{2,QC} (pt) for RPs
- fvn2ndPtRPW = new TH1D("fvn2ndPtRPW","weighted v'_{n}{2,QC} (p_{t}) for RPs",fnBinsPt,fPtMin,fPtMax);
- fvn2ndPtRPW->SetXTitle("p_{t}");
- fResultsList->Add(fvn2ndPtRPW);
-
- // weighted v'_{n}{4,QC} (pt) for RPs
- fvn4thPtRPW = new TH1D("fvn4thPtRPW","weighted v'_{n}{4,QC} (p_{t}) for RPs",fnBinsPt,fPtMin,fPtMax);
- fvn4thPtRPW->SetXTitle("p_{t}");
- fResultsList->Add(fvn4thPtRPW);
-
- // weighted v'_{n}{6,QC} (pt) for RPs
- fvn6thPtRPW = new TH1D("fvn6thPtRPW","weighted v'_{n}{6,QC} (p_{t}) for RPs",fnBinsPt,fPtMin,fPtMax);
- fvn6thPtRPW->SetXTitle("p_{t}");
- fResultsList->Add(fvn6thPtRPW);
-
- // weighted v'_{n}{8,QC} (pt) for RPs
- fvn8thPtRPW = new TH1D("fvn8thPtRPW","weighted v'_{n}{8,QC} (p_{t}) for RPs",fnBinsPt,fPtMin,fPtMax);
- fvn8thPtRPW->SetXTitle("p_{t}");
- fResultsList->Add(fvn8thPtRPW);
-
- // weighted v'_{n}{2,QC} (eta) for RPs
- fvn2ndEtaRPW = new TH1D("fvn2ndEtaRPW","weighted v'_{n}{2,QC} (#eta) for RPs",fnBinsEta,fEtaMin,fEtaMax);
- fvn2ndEtaRPW->SetXTitle("#eta");
- fResultsList->Add(fvn2ndEtaRPW);
-
- // weighted v'_{n}{4,QC} (eta) for RPs
- fvn4thEtaRPW = new TH1D("fvn4thEtaRPW","weighted v'_{n}{4,QC} (#eta) for RPs",fnBinsEta,fEtaMin,fEtaMax);
- fvn4thEtaRPW->SetXTitle("#eta");
- fResultsList->Add(fvn4thEtaRPW);
-
- // weighted v'_{n}{6,QC} (eta) for RPs
- fvn6thEtaRPW = new TH1D("fvn6thEtaRPW","weighted v'_{n}{6,QC} (#eta) for RPs",fnBinsEta,fEtaMin,fEtaMax);
- fvn6thEtaRPW->SetXTitle("#eta");
- fResultsList->Add(fvn6thEtaRPW);
-
- // weighted v'_{n}{8,QC} (eta) for RPs
- fvn8thEtaRP = new TH1D("fvn8thEtaEtaRP","weighted v'_{n}{8,QC} (#eta) for RPs",fnBinsEta,fEtaMin,fEtaMax);
- fvn8thEtaRP->SetXTitle("#eta");
- fResultsList->Add(fvn8thEtaRP);
- // .....................................................................................................................................
-
-
-
-
- // add fUseWeightsBits to the main list (to be improved)
- fUseWeightsBits = new TBits(1);
- fHistList->Add(fUseWeightsBits);
-
- // add list fWeightsList with weights to the main list
- fHistList->Add(fWeightsList);
-
- // add list fDiffFlowList with histograms and profiles needed for differential flow to the main list
- fHistList->Add(fDiffFlowList);
-
- // add list fResultsList with final results to the main list
- fHistList->Add(fResultsList);
-
-
-}//end of Init()
-
-
-//================================================================================================================
-
-
-void AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent)
-{
- // running over data only in this method
-
-
-
-
- // *********************************************
- // **** ACCESS THE OUTPUT FILE WITH WEIGHTS ****
- // *********************************************
-
- fUseWeights = fUsePhiWeights||fUsePtWeights||fUseEtaWeights;
- fUseWeightsBits->SetBitNumber(1,fUseWeights); // to be improved (how to pass boolean to Finish()?)
-
- TH1F *phiWeights = NULL; // histogram with phi weights
- TH1D *ptWeights = NULL; // histogram with pt weights
- TH1D *etaWeights = NULL; // histogram with eta weights
-
- if(fUseWeights)
- {
- if(!fWeightsList)
- {
- cout<<" WARNING: fWeightsList is NULL pointer in AFAWQC::Make(). "<<endl;
- exit(0);
- }
- if(fUsePhiWeights)
- {
- phiWeights = dynamic_cast<TH1F *>(fWeightsList->FindObject("phi_weights"));
- if(!phiWeights)
- {
- cout<<" WARNING: couldn't access the histogram with phi weights in AFAWQC::Make(). "<<endl;
- exit(0);
- }
- }
- if(fUsePtWeights)
- {
- ptWeights = dynamic_cast<TH1D *>(fWeightsList->FindObject("pt_weights"));
- if(!ptWeights)
- {
- cout<<" WARNING: couldn't access the histogram with pt weights in AFAWQC::Make(). "<<endl;
- exit(0);
- }
- }
- if(fUseEtaWeights)
- {
- etaWeights = dynamic_cast<TH1D *>(fWeightsList->FindObject("eta_weights"));
- if(!etaWeights)
- {
- cout<<" WARNING: couldn't access the histogram with eta weights in AFAWQC::Make(). "<<endl;
- exit(0);
- }
- }
- }
-
- Int_t nBinsPhi = 0;
- Double_t dBinWidthPt = 0.;
- Double_t dBinWidthEta = 0.;
-
- if(fnBinsPt)
- {
- dBinWidthPt=(fPtMax-fPtMin)/fnBinsPt;
- }
-
- if(fnBinsEta)
- {
- dBinWidthEta=(fEtaMax-fEtaMin)/fnBinsEta;
- }
-
- if(fWeightsList)
- {
- if(fUsePhiWeights)
- {
- if(phiWeights) nBinsPhi = phiWeights->GetNbinsX();
- }
- if(fUsePtWeights)
- {
- if(ptWeights)
- {
- Double_t dBinWidthPtW = ptWeights->GetBinWidth(1); // assuming that all bins have the same width
- if(dBinWidthPtW != dBinWidthPt)
- {
- cout<<" WARNING: dBinWidthPtW != dBinWidthPt in AFAWQC::Make()."<<endl;
- exit(0);
- }
- Double_t dPtMinW = (ptWeights->GetXaxis())->GetXmin();
- if(dPtMinW != fPtMin)
- {
- cout<<" WARNING: dPtMinW != fPtMin in AFAWQC::Make()."<<endl;
- exit(0);
- }
- }
- }
- if(fUseEtaWeights)
- {
- if(etaWeights)
- {
- Double_t dBinWidthEtaW = etaWeights->GetBinWidth(1); // assuming that all bins have the same width
- if(dBinWidthEtaW != dBinWidthEta)
- {
- cout<<" WARNING: dBinWidthEtaW != dBinWidthEta in AFAWQC::Make()."<<endl;
- exit(0);
- }
- Double_t dEtaMinW = (etaWeights->GetXaxis())->GetXmin();
- if(dEtaMinW != fEtaMin)
- {
- cout<<" WARNING: dEtaMinW != fEtaMin in AFAWQC::Make()."<<endl;
- exit(0);
- }
- }
- }
- } // end of if(weightsList)
-
- Double_t dPhi = 0.; // azumithal angle in the laboratory frame
- Double_t dPt = 0.; // transverse momentum
- Double_t dEta = 0.; // pseudorapidity
-
- Double_t wPhi = 1.; // phi weight
- Double_t wPt = 1.; // pt weight
- Double_t wEta = 1.; // eta weight
-
-
-
-
- // ********************************************
- // **** FILL THE COMMON CONTROL HISTOGRAMS ****
- // ********************************************
-
- Int_t nRP = anEvent->GetEventNSelTracksRP();
- if(nRP>1)
- {
- fCommonHists2nd->FillControlHistograms(anEvent);
- if(nRP>3)
- {
- fCommonHists4th->FillControlHistograms(anEvent);
- if(nRP>5)
- {
- fCommonHists6th->FillControlHistograms(anEvent);
- if(nRP>7)
- {
- fCommonHists8th->FillControlHistograms(anEvent);
- } // end of if(nRP>7)
- } // end of if(nRP>5)
- } // end of if(nRP>3)
- } // end of if(nRP>1)
-
-
-
-
- // ***************************
- // **** LOOPING OVER DATA ****
- // ***************************
-
- Int_t nPrim = anEvent->NumberOfTracks();
-
- // nPrim = total number of primary tracks, i.e. nPrim = nRP + nPOI + rest, where:
- // nRP = # of particles used to determine the reaction plane;
- // nPOI = # of particles of interest for a detailed flow analysis;
- // rest = # of particles which are niether RPs not POIs.
-
- for(Int_t i=0;i<nPrim;i++)
- {
- fTrack=anEvent->GetTrack(i);
- if(fTrack)
- {
- if(!(fTrack->InRPSelection() || fTrack->InPOISelection())) continue;
-
- // checking the RP condition:
- if(fTrack->InRPSelection())
- {
- dPhi = fTrack->Phi();
- dPt = fTrack->Pt();
- dEta = fTrack->Eta();
-
- // determine phi weight for this particle:
- if(phiWeights && nBinsPhi)
- {
- wPhi = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(dPhi*nBinsPhi/TMath::TwoPi())));
- }
- // determine pt weight for this particle:
- if(ptWeights && dBinWidthPt)
- {
- wPt = ptWeights->GetBinContent(1+(Int_t)(TMath::Floor((dPt-fPtMin)/dBinWidthPt)));
- }
- // determine eta weight for this particle:
- if(etaWeights && dBinWidthEta)
- {
- wEta = etaWeights->GetBinContent(1+(Int_t)(TMath::Floor((dEta-fEtaMin)/dBinWidthEta)));
- }
-
- // fill Re[Q_{n,k}] and Im[Q_{n,k}]:
- for(Int_t n=0;n<4;n++)
- {
- for(Int_t k=0;k<9;k++)
- {
- (*fReQ)(n,k)+=pow(wPhi*wPt*wEta,k)*TMath::Cos(2*(n+1)*dPhi);
- (*fImQ)(n,k)+=pow(wPhi*wPt*wEta,k)*TMath::Sin(2*(n+1)*dPhi);
- }
- }
-
- // fill S^{M}_{p,k}:
- for(Int_t p=0;p<8;p++)
- {
- for(Int_t k=0;k<9;k++)
- {
- (*fSMpk)(p,k)+=pow(wPhi*wPt*wEta,k);
- }
- }
-
- Int_t n = 2; // to be improved (add setter for harmonic)
-
- // fill non-weighted q_RPs
- fReqRP1nPtEta->Fill(dPt,dEta,TMath::Cos(1.*n*dPhi));
- fImqRP1nPtEta->Fill(dPt,dEta,TMath::Sin(1.*n*dPhi));
- fReqRP2nPtEta->Fill(dPt,dEta,TMath::Cos(2.*n*dPhi));
- fImqRP2nPtEta->Fill(dPt,dEta,TMath::Sin(2.*n*dPhi));
-
- // mRP:
- fmRPPtEta->Fill(dPt,dEta,1);
-
- // fill weighted q_RPs
- if(fUseWeights)
- {
- n = 2; // to be improved (add setter for harmonic)
-
- // qRP_{n,k} (weighted qRP):
- fReqRP1n2kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,2.)*TMath::Cos(1.*n*dPhi));
- fImqRP1n2kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,2.)*TMath::Sin(1.*n*dPhi));
- fReqRP2n1kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,1.)*TMath::Cos(2.*n*dPhi));
- fImqRP2n1kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,1.)*TMath::Sin(2.*n*dPhi));
-
- // S^{mRP}_{p,k}:
- fSmRP1p1kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,1.));
- fSmRP1p2kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,2.));
- fSmRP1p3kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,3.));
- }
-
- // checking if RP particle is also POI particle:
- if(fTrack->InPOISelection())
- {
- n = 2; // to be improved (add setter for harmonic)
-
- // q''_{n} (non-weighted q''):
- fReqPrimePrime1nPtEta->Fill(dPt,dEta,TMath::Cos(1.*n*dPhi));
- fImqPrimePrime1nPtEta->Fill(dPt,dEta,TMath::Sin(1.*n*dPhi));
- fReqPrimePrime2nPtEta->Fill(dPt,dEta,TMath::Cos(2.*n*dPhi));
- fImqPrimePrime2nPtEta->Fill(dPt,dEta,TMath::Sin(2.*n*dPhi));
-
- // m'':
- fmPrimePrimePtEta->Fill(dPt,dEta,1);
-
- if(fUseWeights)
- {
- // q''_{n,k} (weighted q''):
- fReqPrimePrime1n2kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,2.)*TMath::Cos(1.*n*dPhi));
- fImqPrimePrime1n2kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,2.)*TMath::Sin(1.*n*dPhi));
- fReqPrimePrime2n1kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,1.)*TMath::Cos(2.*n*dPhi));
- fImqPrimePrime2n1kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,1.)*TMath::Sin(2.*n*dPhi));
-
- // S^{m''}_{p,k}:
- fSmPrimePrime1p1kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,1.));
- fSmPrimePrime1p2kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,2.));
- fSmPrimePrime1p3kPtEta->Fill(dPt,dEta,pow(wPhi*wPt*wEta,3.));
- }
- } // end of if(fTrack->InPOISelection())
- } // end of if(pTrack->InRPSelection())
-
- // checking the POI condition:
- if(fTrack->InPOISelection())
- {
- Int_t n = 2; // to be improved (add setter for harmonic)
-
- dPhi = fTrack->Phi();
- dPt = fTrack->Pt();
- dEta = fTrack->Eta();
-
- // q_n:
- fReqnPtEta->Fill(dPt,dEta,TMath::Cos(1.*n*dPhi));
- fImqnPtEta->Fill(dPt,dEta,TMath::Sin(1.*n*dPhi));
-
- // m:
- fmPtEta->Fill(dPt,dEta,1);
-
- } // end of if(pTrack->InPOISelection() )
- } // end of if(fTrack)
- else{
- cout<<endl;
- cout<<" WARNING: no particle! (i.e. fTrack is a NULL pointer in AFAWQC::Make().)"<<endl;
- cout<<endl;
- }
- } // end of for(Int_t i=0;i<nPrim;i++)
-
- // calculate the final expressions for S^{M}_{p,k} = (sum_{i=1}^{M} w_{i}^{k})^{p}:
- for(Int_t p=0;p<8;p++)
- {
- for(Int_t k=0;k<9;k++)
- {
- (*fSMpk)(p,k)=pow((*fSMpk)(p,k),p+1);
- }
- }
-
-
-
-
- // *****************************
- // **** CALLING THE METHODS ****
- // *****************************
-
- // nested loops (needed for cross-checking the results):
- Bool_t evaluateNestedLoopsForIntegratedFlow = kFALSE; // to be improved / removed
- Bool_t evaluateNestedLoopsForDifferentialFlow = kFALSE; // to be improved / removed
-
- if(evaluateNestedLoopsForIntegratedFlow && nPrim>0 && nPrim<14) // to be improved / removed (eventually I would not need this if())
- {
- // calculate all correlations needed for 'no-name' integrated flow WITHOUT weights
- // (the results are stored in 1D profile fQCorrelations)
- if(!(fUseWeights))
- {
- this->CalculateCorrelationsForIntegratedFlow();
- this->CalculateCorrectionsForNonUniformAcceptanceCosTerms();
- this->CalculateCorrectionsForNonUniformAcceptanceSinTerms();
- }
- // calculate all correlations needed for 'no-name' integrated flow WITH weights
- // (the results are stored in 1D profile fQCorrelationsW)
- if(fUseWeights) this->CalculateWeightedCorrelationsForIntegratedFlow();
- }
- else if (!evaluateNestedLoopsForIntegratedFlow)
- {
- this->CalculateCorrelationsForIntegratedFlow();
- this->CalculateCorrectionsForNonUniformAcceptanceCosTerms();
- this->CalculateCorrectionsForNonUniformAcceptanceSinTerms();
- if(fUseWeights) this->CalculateWeightedCorrelationsForIntegratedFlow();
- }
-
- if(evaluateNestedLoopsForDifferentialFlow && nPrim>0 && nPrim<14 ) // to be improved / removed (eventually I would not need this if())
- {
- // calculate all correlations needed for differential flow WITHOUT weights
- // and store the results in 2D profiles (pt,eta):
- // a) POIs: f2pPtEtaPOI, f4pPtEtaPOI, f6pPtEtaPOI and f8pPtEtaPOI;
- // b) RPs: f2pPtEtaRP, f4pPtEtaRP, f6pPtEtaRP and f8pPtEtaRP.
- if(!(fUseWeights))
- {
- this->CalculateCorrelationsForDifferentialFlow("POI");
- this->CalculateCorrelationsForDifferentialFlow("RP");
- }
- // calculate all correlations needed for differential flow WITH weights
- // and store the results in 2D profiles (pt,eta):
- // a) POIs: f2pPtEtaPOIW, f4pPtEtaPOIW, f6pPtEtaPOIW and f8pPtEtaPOIW;
- // b) RPs: f2pPtEtaRPW, f4pPtEtaRPW, f6pPtEtaRPW and f8pPtEtaRPW.
- if(fUseWeights)
- {
- this->CalculateWeightedCorrelationsForDifferentialFlow("POI");
- this->CalculateWeightedCorrelationsForDifferentialFlow("RP");
- }
- }
- else if (!evaluateNestedLoopsForDifferentialFlow)
- {
- this->CalculateCorrelationsForDifferentialFlow("POI");
- this->CalculateCorrelationsForDifferentialFlow("RP");
-
- if(fUseWeights)
- {
- this->CalculateWeightedCorrelationsForDifferentialFlow("POI");
- this->CalculateWeightedCorrelationsForDifferentialFlow("RP");
- }
-
- }
-
- if(evaluateNestedLoopsForIntegratedFlow && nPrim>0 && nPrim<14) // to be improved / removed (eventually I would not need this if())
- {
- this->EvaluateNestedLoopsForIntegratedFlow(anEvent);
- }
-
- if(evaluateNestedLoopsForDifferentialFlow && nPrim>0 && nPrim<14) // to be improved / removed (eventually I would not need this if())
- {
- this->EvaluateNestedLoopsForDifferentialFlow(anEvent);
- }
-
-
-
-
- // ********************************
- // **** RESET E-B-E QUANTITIES ****
- // ********************************
-
- fReQ->Zero();
- fImQ->Zero();
- fSMpk->Zero();
- fReqnPtEta->Reset();
- fImqnPtEta->Reset();
- fmPtEta->Reset();
- fReqPrimePrime1nPtEta->Reset();
- fImqPrimePrime1nPtEta->Reset();
- fReqPrimePrime2nPtEta->Reset();
- fImqPrimePrime2nPtEta->Reset();
- fmPrimePrimePtEta->Reset();
- fReqPrimePrime1n2kPtEta->Reset();
- fImqPrimePrime1n2kPtEta->Reset();
- fReqPrimePrime2n1kPtEta->Reset();
- fImqPrimePrime2n1kPtEta->Reset();
- fSmPrimePrime1p1kPtEta->Reset();
- fSmPrimePrime1p2kPtEta->Reset();
- fSmPrimePrime1p3kPtEta->Reset();
- // qRPs (to be improved - notation)
- fReqRP1nPtEta->Reset();
- fImqRP1nPtEta->Reset();
- fReqRP2nPtEta->Reset();
- fImqRP2nPtEta->Reset();
- fmRPPtEta->Reset();
- fReqRP1n2kPtEta->Reset();
- fImqRP1n2kPtEta->Reset();
- fReqRP2n1kPtEta->Reset();
- fImqRP2n1kPtEta->Reset();
- fSmRP1p1kPtEta->Reset();
- fSmRP1p2kPtEta->Reset();
- fSmRP1p3kPtEta->Reset();
-
-} // end of AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent)
-
-
-//================================================================================================================================
-
-
-void AliFlowAnalysisWithQCumulants::CalculateCorrelationsForIntegratedFlow()
-{
- // calculate all correlations needed for 'no-name' integrated flow // to be improved (name)
-
- // multiplicity:
- Double_t dMult = (*fSMpk)(0,0);
-
- // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
- Double_t dReQ1n = (*fReQ)(0,0);
- Double_t dReQ2n = (*fReQ)(1,0);
- Double_t dReQ3n = (*fReQ)(2,0);
- Double_t dReQ4n = (*fReQ)(3,0);
- Double_t dImQ1n = (*fImQ)(0,0);
- Double_t dImQ2n = (*fImQ)(1,0);
- Double_t dImQ3n = (*fImQ)(2,0);
- Double_t dImQ4n = (*fImQ)(3,0);
-
- // real and imaginary parts of some expressions involving various combinations of Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
- // (these expression appear in the Eqs. for the multi-particle correlations bellow)
-
- // Re[Q_{2n} Q_{n}^* Q_{n}^*]
- Double_t reQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dReQ2n + 2.*dReQ1n*dImQ1n*dImQ2n - pow(dImQ1n,2.)*dReQ2n;
-
- // Im[Q_{2n} Q_{n}^* Q_{n}^*]
- //Double_t imQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dImQ2n-2.*dReQ1n*dImQ1n*dReQ2n-pow(dImQ1n,2.)*dImQ2n;
-
- // Re[Q_{n} Q_{n} Q_{2n}^*] = Re[Q_{2n} Q_{n}^* Q_{n}^*]
- Double_t reQ1nQ1nQ2nstar = reQ2nQ1nstarQ1nstar;
-
- // Re[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*]
- Double_t reQ3nQ1nQ2nstarQ2nstar = (pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)
- + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n);
-
- // Im[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*]
- //Double_t imQ3nQ1nQ2nstarQ2nstar = calculate and implement this (deleteMe)
-
- // Re[Q_{2n} Q_{2n} Q_{3n}^* Q_{1n}^*] = Re[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*]
- Double_t reQ2nQ2nQ3nstarQ1nstar = reQ3nQ1nQ2nstarQ2nstar;
-
- // Re[Q_{4n} Q_{2n}^* Q_{2n}^*]
- Double_t reQ4nQ2nstarQ2nstar = pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n;
-
- // Im[Q_{4n} Q_{2n}^* Q_{2n}^*]
- //Double_t imQ4nQ2nstarQ2nstar = calculate and implement this (deleteMe)
-
- // Re[Q_{2n} Q_{2n} Q_{4n}^*] = Re[Q_{4n} Q_{2n}^* Q_{2n}^*]
- Double_t reQ2nQ2nQ4nstar = reQ4nQ2nstarQ2nstar;
-
- // Re[Q_{4n} Q_{3n}^* Q_{n}^*]
- Double_t reQ4nQ3nstarQ1nstar = dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n);
-
- // Re[Q_{3n} Q_{n} Q_{4n}^*] = Re[Q_{4n} Q_{3n}^* Q_{n}^*]
- Double_t reQ3nQ1nQ4nstar = reQ4nQ3nstarQ1nstar;
-
- // Im[Q_{4n} Q_{3n}^* Q_{n}^*]
- //Double_t imQ4nQ3nstarQ1nstar = calculate and implement this (deleteMe)
-
- // Re[Q_{3n} Q_{2n}^* Q_{n}^*]
- Double_t reQ3nQ2nstarQ1nstar = dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n
- + dImQ3n*dImQ2n*dReQ1n;
-
- // Re[Q_{2n} Q_{n} Q_{3n}^*] = Re[Q_{3n} Q_{2n}^* Q_{n}^*]
- Double_t reQ2nQ1nQ3nstar = reQ3nQ2nstarQ1nstar;
-
- // Im[Q_{3n} Q_{2n}^* Q_{n}^*]
- //Double_t imQ3nQ2nstarQ1nstar; //calculate and implement this (deleteMe)
-
- // Re[Q_{3n} Q_{n}^* Q_{n}^* Q_{n}^*]
- Double_t reQ3nQ1nstarQ1nstarQ1nstar = dReQ3n*pow(dReQ1n,3)-3.*dReQ1n*dReQ3n*pow(dImQ1n,2)
- + 3.*dImQ1n*dImQ3n*pow(dReQ1n,2)-dImQ3n*pow(dImQ1n,3);
-
- // Im[Q_{3n} Q_{n}^* Q_{n}^* Q_{n}^*]
- //Double_t imQ3nQ1nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe)
-
- // |Q_{2n}|^2 |Q_{n}|^2
- Double_t dQ2nQ1nQ2nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.));
-
- // Re[Q_{4n} Q_{2n}^* Q_{n}^* Q_{n}^*]
- Double_t reQ4nQ2nstarQ1nstarQ1nstar = (dReQ4n*dReQ2n+dImQ4n*dImQ2n)*(pow(dReQ1n,2)-pow(dImQ1n,2))
- + 2.*dReQ1n*dImQ1n*(dImQ4n*dReQ2n-dReQ4n*dImQ2n);
-
- // Im[Q_{4n} Q_{2n}^* Q_{n}^* Q_{n}^*]
- //Double_t imQ4nQ2nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe)
-
- // Re[Q_{2n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^*]
- Double_t reQ2nQ1nQ1nstarQ1nstarQ1nstar = (dReQ2n*dReQ1n-dImQ2n*dImQ1n)*(pow(dReQ1n,3)-3.*dReQ1n*pow(dImQ1n,2))
- + (dReQ2n*dImQ1n+dReQ1n*dImQ2n)*(3.*dImQ1n*pow(dReQ1n,2)-pow(dImQ1n,3));
-
- // Im[Q_{2n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^*]
- //Double_t imQ2nQ1nQ1nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe)
-
- // Re[Q_{2n} Q_{2n} Q_{2n}^* Q_{n}^* Q_{n}^*]
- Double_t reQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))
- * (dReQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) + 2.*dImQ2n*dReQ1n*dImQ1n);
-
- // Im[Q_{2n} Q_{2n} Q_{2n}^* Q_{n}^* Q_{n}^*]
- //Double_t imQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))
- // * (dImQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) - 2.*dReQ2n*dReQ1n*dImQ1n);
-
- // Re[Q_{4n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]
- Double_t reQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dReQ4n-6.*pow(dReQ1n,2.)*dReQ4n*pow(dImQ1n,2.)
- + pow(dImQ1n,4.)*dReQ4n+4.*pow(dReQ1n,3.)*dImQ1n*dImQ4n
- - 4.*pow(dImQ1n,3.)*dReQ1n*dImQ4n;
-
- // Im[Q_{4n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]
- //Double_t imQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dImQ4n-6.*pow(dReQ1n,2.)*dImQ4n*pow(dImQ1n,2.)
- // + pow(dImQ1n,4.)*dImQ4n+4.*pow(dImQ1n,3.)*dReQ1n*dReQ4n
- // - 4.*pow(dReQ1n,3.)*dImQ1n*dReQ4n;
-
- // Re[Q_{3n} Q_{n} Q_{2n}^* Q_{n}^* Q_{n}^*]
- Double_t reQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.))
- * (dReQ1n*dReQ2n*dReQ3n-dReQ3n*dImQ1n*dImQ2n+dReQ2n*dImQ1n*dImQ3n+dReQ1n*dImQ2n*dImQ3n);
-
- // Im[Q_{3n} Q_{n} Q_{2n}^* Q_{n}^* Q_{n}^*]
- //Double_t imQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.))
- // * (-dReQ2n*dReQ3n*dImQ1n-dReQ1n*dReQ3n*dImQ2n+dReQ1n*dReQ2n*dImQ3n-dImQ1n*dImQ2n*dImQ3n);
-
-
- // Re[Q_{2n} Q_{2n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]
- Double_t reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)*dReQ2n-2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.)
- + dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dImQ2n)
- * (pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.)
- - dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n+pow(dImQ1n,2.)*dImQ2n);
-
- // Im[Q_{2n} Q_{2n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]
- //Double_t imQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = 2.*(pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.)
- // + 2.*dReQ1n*dImQ1n*dImQ2n)*(pow(dReQ1n,2.)*dImQ2n
- // - 2.*dReQ1n*dImQ1n*dReQ2n-pow(dImQ1n,2.)*dImQ2n);
-
- // Re[Q_{3n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]
- Double_t reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.))
- * (pow(dReQ1n,3.)*dReQ3n-3.*dReQ1n*dReQ3n*pow(dImQ1n,2.)
- + 3.*pow(dReQ1n,2.)*dImQ1n*dImQ3n-pow(dImQ1n,3.)*dImQ3n);
-
- // Im[Q_{3n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]
- //Double_t imQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.))
- // * (pow(dImQ1n,3.)*dReQ3n-3.*dImQ1n*dReQ3n*pow(dReQ1n,2.)
- // - 3.*pow(dImQ1n,2.)*dReQ1n*dImQ3n+pow(dReQ1n,3.)*dImQ3n);
-
- // |Q_{2n}|^2 |Q_{n}|^4
- Double_t dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.);
-
- // Re[Q_{2n} Q_{n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]
- Double_t reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)
- * (pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.)
- + 2.*dReQ1n*dImQ1n*dImQ2n);
-
- // Im[Q_{2n} Q_{n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]
- //Double_t imQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)
- // * (pow(dReQ1n,2.)*dImQ2n-dImQ2n*pow(dImQ1n,2.)
- // - 2.*dReQ1n*dReQ2n*dImQ1n);
-
-
-
-
- // **************************************
- // **** multi-particle correlations: ****
- // **************************************
- //
- // Remark 1: multi-particle correlations calculated with non-weighted Q-vectors are stored in 1D profile fQCorrelations.
- // Remark 2: binning of fQCorrelations is organized as follows:
- // --------------------------------------------------------------------------------------------------------------------
- // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))>
- // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))>
- // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))>
- // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))>
- // 5th bin: ---- EMPTY ----
- // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))>
- // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))>
- // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))>
- // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))>
- // 10th bin: ---- EMPTY ----
- // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))>
- // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))>
- // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))>
- // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))>
- // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))>
- // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))>
- // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))>
- // 18th bin: ---- EMPTY ----
- // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))>
- // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))>
- // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))>
- // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))>
- // 23rd bin: ---- EMPTY ----
- // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))>
- // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))>
- // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))>
- // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))>
- // 28th bin: ---- EMPTY ----
- // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))>
- // 30th bin: ---- EMPTY ----
- // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))>
- // --------------------------------------------------------------------------------------------------------------------
-
- // 2-particle:
- Double_t two1n1n = 0.; // <cos(n*(phi1-phi2))>
- Double_t two2n2n = 0.; // <cos(2n*(phi1-phi2))>
- Double_t two3n3n = 0.; // <cos(3n*(phi1-phi2))>
- Double_t two4n4n = 0.; // <cos(4n*(phi1-phi2))>
-
- if(dMult>1)
- {
- two1n1n = (pow(dReQ1n,2.)+pow(dImQ1n,2.)-dMult)/(dMult*(dMult-1.));
- two2n2n = (pow(dReQ2n,2.)+pow(dImQ2n,2.)-dMult)/(dMult*(dMult-1.));
- two3n3n = (pow(dReQ3n,2.)+pow(dImQ3n,2.)-dMult)/(dMult*(dMult-1.));
- two4n4n = (pow(dReQ4n,2.)+pow(dImQ4n,2.)-dMult)/(dMult*(dMult-1.));
-
- fQCorrelations->Fill(0.,two1n1n,dMult*(dMult-1.));
- fQCorrelations->Fill(1.,two2n2n,dMult*(dMult-1.));
- fQCorrelations->Fill(2.,two3n3n,dMult*(dMult-1.));
- fQCorrelations->Fill(3.,two4n4n,dMult*(dMult-1.));
-
- // distribution of <cos(n*(phi1-phi2))>:
- f2pDistribution->Fill(two1n1n,dMult*(dMult-1.));
- } // end of if(dMult>1)
-
- // 3-particle:
- Double_t three2n1n1n = 0.; // <cos(n*(2.*phi1-phi2-phi3))>
- Double_t three3n2n1n = 0.; // <cos(n*(3.*phi1-2.*phi2-phi3))>
- Double_t three4n2n2n = 0.; // <cos(n*(4.*phi1-2.*phi2-2.*phi3))>
- Double_t three4n3n1n = 0.; // <cos(n*(4.*phi1-3.*phi2-phi3))>
-
- if(dMult>2)
- {
- three2n1n1n = (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))
- - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult)
- / (dMult*(dMult-1.)*(dMult-2.));
- three3n2n1n = (reQ3nQ2nstarQ1nstar-(pow(dReQ3n,2.)+pow(dImQ3n,2.))
- - (pow(dReQ2n,2.)+pow(dImQ2n,2.))
- - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult)
- / (dMult*(dMult-1.)*(dMult-2.));
- three4n2n2n = (reQ4nQ2nstarQ2nstar-2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))
- - (pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*dMult)
- / (dMult*(dMult-1.)*(dMult-2.));
- three4n3n1n = (reQ4nQ3nstarQ1nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.))
- - (pow(dReQ3n,2.)+pow(dImQ3n,2.))
- - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult)
- / (dMult*(dMult-1.)*(dMult-2.));
-
- fQCorrelations->Fill(5.,three2n1n1n,dMult*(dMult-1.)*(dMult-2.));
- fQCorrelations->Fill(6.,three3n2n1n,dMult*(dMult-1.)*(dMult-2.));
- fQCorrelations->Fill(7.,three4n2n2n,dMult*(dMult-1.)*(dMult-2.));
- fQCorrelations->Fill(8.,three4n3n1n,dMult*(dMult-1.)*(dMult-2.));
- } // end of if(dMult>2)
-
- // 4-particle:
- Double_t four1n1n1n1n = 0.; // <cos(n*(phi1+phi2-phi3-phi4))>
- Double_t four2n2n2n2n = 0.; // <cos(2.*n*(phi1+phi2-phi3-phi4))>
- Double_t four2n1n2n1n = 0.; // <cos(n*(2.*phi1+phi2-2.*phi3-phi4))>
- Double_t four3n1n1n1n = 0.; // <cos(n*(3.*phi1-phi2-phi3-phi4))>
- Double_t four4n2n1n1n = 0.; // <cos(n*(4.*phi1-2.*phi2-phi3-phi4))>
- Double_t four3n1n2n2n = 0.; // <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))>
- Double_t four3n1n3n1n = 0.; // <cos(n*(3.*phi1+phi2-3.*phi3-phi4))>
-
- if(dMult>3)
- {
- four1n1n1n1n = (2.*dMult*(dMult-3.)+pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ1n,2.)
- + pow(dImQ1n,2.))-2.*reQ2nQ1nstarQ1nstar+(pow(dReQ2n,2.)+pow(dImQ2n,2.)))
- / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.));
- four2n2n2n2n = (2.*dMult*(dMult-3.)+pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ2n,2.)
- + pow(dImQ2n,2.))-2.*reQ4nQ2nstarQ2nstar+(pow(dReQ4n,2.)+pow(dImQ4n,2.)))
- / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.));
- four2n1n2n1n = (dQ2nQ1nQ2nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar-2.*reQ2nQ1nstarQ1nstar)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))
- - ((dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))
- + (dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-(pow(dReQ3n,2.)+pow(dImQ3n,2.)))
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))
- + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.));
- four3n1n1n1n = (reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar-3.*reQ2nQ1nstarQ1nstar)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))
- + (2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))
- + 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));
- four4n2n1n1n = (reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar-2.*reQ3nQ2nstarQ1nstar)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))
- - (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))
- - 3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))
- - 6./((dMult-1.)*(dMult-2.)*(dMult-3.));
- four3n1n2n2n = (reQ3nQ1nQ2nstarQ2nstar-reQ4nQ2nstarQ2nstar-reQ3nQ1nQ4nstar-2.*reQ3nQ2nstarQ1nstar)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))
- - (2.*reQ1nQ1nQ2nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))
- - 4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))
- - 6./((dMult-1.)*(dMult-2.)*(dMult-3.));
- four3n1n3n1n = ((pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.))
- - 2.*reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))
- + ((pow(dReQ4n,2.)+pow(dImQ4n,2.))-(dMult-4.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))
- + (pow(dReQ2n,2.)+pow(dImQ2n,2.))-(dMult-4.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))
- + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.));
-
- fQCorrelations->Fill(10.,four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));
- fQCorrelations->Fill(11.,four2n1n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));
- fQCorrelations->Fill(12.,four2n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));
- fQCorrelations->Fill(13.,four3n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));
- fQCorrelations->Fill(14.,four3n1n3n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));
- fQCorrelations->Fill(15.,four3n1n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));
- fQCorrelations->Fill(16.,four4n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));
-
- // distribution of <cos(n*(phi1+phi2-phi3-phi4))>
- f4pDistribution->Fill(four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));
-
- // fQProduct->Fill(0.,two1n1n*four1n1n1n1n,dMult*(dMult-1.)*dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));
- } // end of if(dMult>3)
-
- // 5-particle:
- Double_t five2n1n1n1n1n = 0.; // <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))>
- Double_t five2n2n2n1n1n = 0.; // <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))>
- Double_t five3n1n2n1n1n = 0.; // <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))>
- Double_t five4n1n1n1n1n = 0.; // <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))>
-
- if(dMult>4)
- {
- five2n1n1n1n1n = (reQ2nQ1nQ1nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar+6.*reQ3nQ2nstarQ1nstar)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
- - (reQ2nQ1nQ3nstar+3.*(dMult-6.)*reQ2nQ1nstarQ1nstar+3.*reQ1nQ1nQ2nstar)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
- - (2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))
- + 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.))
- - 3.*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)))
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
- - 3.*(pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)
- - 2.*(2*dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult*(dMult-4.))
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));
-
- five2n2n2n1n1n = (reQ2nQ2nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ2nQ2nQ3nstarQ1nstar)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
- + 2.*(reQ4nQ2nstarQ2nstar+4.*reQ3nQ2nstarQ1nstar+reQ3nQ1nQ4nstar)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
- + (reQ2nQ2nQ4nstar-2.*(dMult-5.)*reQ2nQ1nstarQ1nstar+2.*reQ1nQ1nQ2nstar)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
- - (2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))
- + 1.*pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)
- - 2.*(3.*dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)))
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
- - (4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.))
- - 4.*(dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+4.*dMult*(dMult-6.))
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));
-
- five4n1n1n1n1n = (reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ4nQ2nstarQ1nstarQ1nstar-4.*reQ3nQ1nstarQ1nstarQ1nstar)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
- + (8.*reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar+12.*reQ3nQ2nstarQ1nstar+12.*reQ2nQ1nstarQ1nstar)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
- - (6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+8.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))
- + 12.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+24.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-24.*dMult)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));
-
- five3n1n2n1n1n = (reQ3nQ1nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
- - (reQ3nQ1nQ2nstarQ2nstar-3.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
- - ((2.*dMult-13.)*reQ3nQ2nstarQ1nstar-reQ3nQ1nQ4nstar-9.*reQ2nQ1nstarQ1nstar)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
- - (2.*reQ1nQ1nQ2nstar+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))
- - 2.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+2.*(pow(dReQ3n,2.)
- + pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
- + (2.*(dMult-6.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))
- - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.))
- - pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)
- + 2.*(3.*dMult-11.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))
- - 4.*(dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));
-
- fQCorrelations->Fill(18.,five2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));
- fQCorrelations->Fill(19.,five2n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));
- fQCorrelations->Fill(20.,five3n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));
- fQCorrelations->Fill(21.,five4n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));
- } // end of if(dMult>4)
-
- // 6-particle:
- Double_t six1n1n1n1n1n1n = 0.; // <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))>
- Double_t six2n2n1n1n1n1n = 0.; // <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))>
- Double_t six3n1n1n1n1n1n = 0.; // <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))>
- Double_t six2n1n1n2n1n1n = 0.; // <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))>
-
- if(dMult>5)
- {
- six1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),3.)+9.*dQ2nQ1nQ2nstarQ1nstar-6.*reQ2nQ1nQ1nstarQ1nstarQ1nstar)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.))
- + 4.*(reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.))
- + 2.*(9.*(dMult-4.)*reQ2nQ1nstarQ1nstar+2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)))
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.))
- - 9.*(pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)+(pow(dReQ2n,2.)+pow(dImQ2n,2.)))
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-5.))
- + (18.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))
- / (dMult*(dMult-1)*(dMult-3)*(dMult-4))
- - 6./((dMult-1.)*(dMult-2.)*(dMult-3.));
-
- six2n1n1n2n1n1n = (dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)
- * (2.*five2n2n2n1n1n+4.*five2n1n1n1n1n+4.*five3n1n2n1n1n+4.*four2n1n2n1n+1.*four1n1n1n1n)
- - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four1n1n1n1n+4.*two1n1n
- + 2.*three2n1n1n+2.*three2n1n1n+4.*four3n1n1n1n+8.*three2n1n1n+2.*four4n2n1n1n
- + 4.*four2n1n2n1n+2.*two2n2n+8.*four2n1n2n1n+4.*four3n1n3n1n+8.*three3n2n1n
- + 4.*four3n1n2n2n+4.*four1n1n1n1n+4.*four2n1n2n1n+1.*four2n2n2n2n)
- - dMult*(dMult-1.)*(dMult-2.)*(2.*three2n1n1n+8.*two1n1n+4.*two1n1n+2.
- + 4.*two1n1n+4.*three2n1n1n+2.*two2n2n+4.*three2n1n1n+8.*three3n2n1n
- + 8.*two2n2n+4.*three4n3n1n+4.*two3n3n+4.*three3n2n1n+4.*two1n1n
- + 8.*three2n1n1n+4.*two1n1n+4.*three3n2n1n+4.*three2n1n1n+2.*two2n2n
- + 4.*three3n2n1n+2.*three4n2n2n)-dMult*(dMult-1.)
- * (4.*two1n1n+4.+4.*two1n1n+2.*two2n2n+1.+4.*two1n1n+4.*two2n2n+4.*two3n3n
- + 1.+2.*two2n2n+1.*two4n4n)-dMult)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed)
-
- six2n2n1n1n1n1n = (reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)
- * (five4n1n1n1n1n+8.*five2n1n1n1n1n+6.*five2n2n2n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)
- * (4.*four3n1n1n1n+6.*four4n2n1n1n+12.*three2n1n1n+12.*four1n1n1n1n+24.*four2n1n2n1n
- + 4.*four3n1n2n2n+3.*four2n2n2n2n)-dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+12.*three3n2n1n
- + 4.*three4n3n1n+3.*three4n2n2n+8.*three2n1n1n+24.*two1n1n+12.*two2n2n+12.*three2n1n1n+8.*three3n2n1n
- + 1.*three4n2n2n)-dMult*(dMult-1.)*(4.*two1n1n+6.*two2n2n+4.*two3n3n+1.*two4n4n+2.*two2n2n+8.*two1n1n+6.)-dMult)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed)
-
- six3n1n1n1n1n1n = (reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)
- * (five4n1n1n1n1n+4.*five2n1n1n1n1n+6.*five3n1n2n1n1n+4.*four3n1n1n1n)
- - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four3n1n1n1n+6.*four4n2n1n1n+6.*four1n1n1n1n
- + 12.*three2n1n1n+12.*four2n1n2n1n+6.*four3n1n1n1n+12.*three3n2n1n+4.*four3n1n3n1n+3.*four3n1n2n2n)
- - dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+12.*three3n2n1n+4.*three4n3n1n+3.*three4n2n2n+4.*two1n1n
- + 12.*two1n1n+6.*three2n1n1n+12.*three2n1n1n+4.*three3n2n1n+12.*two2n2n+4.*three3n2n1n+4.*two3n3n+1.*three4n3n1n
- + 6.*three3n2n1n)-dMult*(dMult-1.)*(4.*two1n1n+6.*two2n2n+4.*two3n3n+1.*two4n4n+1.*two1n1n+4.+6.*two1n1n+4.*two2n2n
- + 1.*two3n3n)-dMult)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed)
-
- fQCorrelations->Fill(23.,six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.));
- fQCorrelations->Fill(24.,six2n1n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.));
- fQCorrelations->Fill(25.,six2n2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.));
- fQCorrelations->Fill(26.,six3n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.));
-
- // distribution of <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))>
- f6pDistribution->Fill(six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.));
-
- //fQProduct->Fill(1.,two1n1n*six1n1n1n1n1n1n,dMult*(dMult-1.)*dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.));
- //fQProduct->Fill(3.,four1n1n1n1n*six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.));
- } // end of if(dMult>5)
-
- // 7-particle:
- Double_t seven2n1n1n1n1n1n1n = 0.; // <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))>
-
- if(dMult>6)
- {
- seven2n1n1n1n1n1n1n = (reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)
- * (2.*six3n1n1n1n1n1n+4.*six1n1n1n1n1n1n+1.*six2n2n1n1n1n1n+6.*six2n1n1n2n1n1n+8.*five2n1n1n1n1n)
- - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(1.*five4n1n1n1n1n +8.*five2n1n1n1n1n+8.*four3n1n1n1n
- + 12.*five3n1n2n1n1n+4.*five2n1n1n1n1n+3.*five2n2n2n1n1n+6.*five2n2n2n1n1n+6.*four1n1n1n1n+24.*four1n1n1n1n
- + 12.*five2n1n1n1n1n+12.*five2n1n1n1n1n+12.*three2n1n1n+24.*four2n1n2n1n+4.*five3n1n2n1n1n+4.*five2n1n1n1n1n)
- - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four3n1n1n1n+6.*four4n2n1n1n+12.*four1n1n1n1n+24.*three2n1n1n
- + 24.*four2n1n2n1n+12.*four3n1n1n1n+24.*three3n2n1n+8.*four3n1n3n1n+6.*four3n1n2n2n+6.*three2n1n1n+12.*four1n1n1n1n
- + 12.*four2n1n2n1n+6.*three2n1n1n+12.*four2n1n2n1n+4.*four3n1n2n2n+3.*four2n2n2n2n+4.*four1n1n1n1n+6.*three2n1n1n
- + 24.*two1n1n+24.*four1n1n1n1n+4.*four3n1n1n1n+24.*two1n1n+24.*three2n1n1n+12.*two2n2n+24.*three2n1n1n+12.*four2n1n2n1n
- + 8.*three3n2n1n+8.*four2n1n2n1n+1.*four4n2n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+1.*three2n1n1n+8.*two1n1n
- + 12.*three3n2n1n+24.*two1n1n+12.*three2n1n1n+4.*three2n1n1n+8.*two1n1n+4.*three4n3n1n+24.*three2n1n1n+8.*three3n2n1n
- + 12.*two1n1n+12.*two1n1n+3.*three4n2n2n+24.*two2n2n+6.*two2n2n+12.+12.*three3n2n1n+8.*two3n3n+12.*three2n1n1n+24.*two1n1n
- + 4.*three3n2n1n+8.*three3n2n1n+2.*three4n3n1n+12.*two1n1n+8.*three2n1n1n+4.*three2n1n1n+2.*three3n2n1n+6.*two2n2n+8.*two2n2n
- + 1.*three4n2n2n+4.*three3n2n1n+6.*three2n1n1n)-dMult*(dMult-1.)*(4.*two1n1n+2.*two1n1n+6.*two2n2n+8.+1.*two2n2n+4.*two3n3n
- + 12.*two1n1n+4.*two1n1n+1.*two4n4n+8.*two2n2n+6.+2.*two3n3n+4.*two1n1n+1.*two2n2n)-dMult)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)); // to be improved (direct formula needed)
-
- fQCorrelations->Fill(28.,seven2n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.));
- } // end of if(dMult>6)
-
- // 8-particle:
- Double_t eight1n1n1n1n1n1n1n1n = 0.; // <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))>
- if(dMult>7)
- {
- eight1n1n1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),4.)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)
- * (12.*seven2n1n1n1n1n1n1n+16.*six1n1n1n1n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)
- * (8.*six3n1n1n1n1n1n+48.*six1n1n1n1n1n1n+6.*six2n2n1n1n1n1n+96.*five2n1n1n1n1n+72.*four1n1n1n1n+36.*six2n1n1n2n1n1n)
- - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(2.*five4n1n1n1n1n+32.*five2n1n1n1n1n+36.*four1n1n1n1n
- + 32.*four3n1n1n1n+48.*five2n1n1n1n1n+48.*five3n1n2n1n1n+144.*five2n1n1n1n1n+288.*four1n1n1n1n+36.*five2n2n2n1n1n
- + 144.*three2n1n1n+96.*two1n1n+144.*four2n1n2n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)
- * (8.*four3n1n1n1n+48.*four1n1n1n1n+12.*four4n2n1n1n+96.*four2n1n2n1n+96.*three2n1n1n+72.*three2n1n1n+144.*two1n1n
- + 16.*four3n1n3n1n+48.*four3n1n1n1n+144.*four1n1n1n1n+72.*four1n1n1n1n+96.*three3n2n1n+24.*four3n1n2n2n+144.*four2n1n2n1n
- + 288.*two1n1n+288.*three2n1n1n+9.*four2n2n2n2n+72.*two2n2n+24.)-dMult*(dMult-1.)*(dMult-2.)*(12.*three2n1n1n+16.*two1n1n
- + 24.*three3n2n1n+48.*three2n1n1n+96.*two1n1n+8.*three4n3n1n+32.*three3n2n1n+96.*three2n1n1n+144.*two1n1n+6.*three4n2n2n
- + 96.*two2n2n+36.*two2n2n+72.+48.*three3n2n1n+16.*two3n3n+72.*three2n1n1n+144.*two1n1n)-dMult*(dMult-1.)*(8.*two1n1n
- + 12.*two2n2n+16.+8.*two3n3n+48.*two1n1n+1.*two4n4n+16.*two2n2n+18.)-dMult)
- / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); // to be improved (direct formula needed)
-
- fQCorrelations->Fill(30.,eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.));
-
- // distribution of <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))>
- f8pDistribution->Fill(eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.));
-
- } // end of if(dMult>7)
-
-} // end of AliFlowAnalysisWithQCumulants::CalculateCorrelationsForIntegratedFlow()
-
-
-//================================================================================================================================
-
-
-void AliFlowAnalysisWithQCumulants::CalculateWeightedCorrelationsForIntegratedFlow()
-{
- // calculate all weighted correlations needed for 'no-name' integrated flow and store them in 1D profile fQCorrelationsW
-
- // Remark 1: binning of fQCorrelationsW is organized as follows:
- //..............................................................................................
- // ---- bins 1-20: 2-particle correlations ----
- // 1st bin: two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))>
- // 2nd bin: two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))>
- // 3rd bin: two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))>
- // 4th bin: two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))>
- // 5th bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))>
- // 6th bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))>
- // ---- bins 21-40: 3-particle correlations ----
- // 21st bin: three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))>
- // ---- bins 41-60: 4-particle correlations ----
- // 41st bin: four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))>
- // ---- bins 61-80: 5-particle correlations ----
- // ---- bins 81-100: 6-particle correlations ----
- // ---- bins 101-120: 7-particle correlations ----
- // ---- bins 121-140: 8-particle correlations ----
- //..............................................................................................
-
- // multiplicity (number of particles used to determine the reaction plane)
- Double_t dMult = (*fSMpk)(0,0);
-
- // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
- Double_t dReQ1n1k = (*fReQ)(0,1);
- Double_t dReQ2n2k = (*fReQ)(1,2);
- Double_t dReQ3n3k = (*fReQ)(2,3);
- Double_t dReQ4n4k = (*fReQ)(3,4);
- Double_t dReQ1n3k = (*fReQ)(0,3);
- Double_t dImQ1n1k = (*fImQ)(0,1);
- Double_t dImQ2n2k = (*fImQ)(1,2);
- Double_t dImQ3n3k = (*fImQ)(2,3);
- Double_t dImQ4n4k = (*fImQ)(3,4);
- Double_t dImQ1n3k = (*fImQ)(0,3);
-
- // dMs are variables introduced in order to simplify some Eqs. bellow:
- //..............................................................................................
- Double_t dM11 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j
- Double_t dM22 = (*fSMpk)(1,2)-(*fSMpk)(0,4); // dM22 = sum_{i,j=1,i!=j}^M w_i^2 w_j^2
- Double_t dM33 = (*fSMpk)(1,3)-(*fSMpk)(0,6); // dM33 = sum_{i,j=1,i!=j}^M w_i^3 w_j^3
- Double_t dM44 = (*fSMpk)(1,4)-(*fSMpk)(0,8); // dM44 = sum_{i,j=1,i!=j}^M w_i^4 w_j^4
- Double_t dM31 = (*fSMpk)(0,3)*(*fSMpk)(0,1)-(*fSMpk)(0,4); // dM31 = sum_{i,j=1,i!=j}^M w_i^3 w_j
- Double_t dM211 = (*fSMpk)(0,2)*(*fSMpk)(1,1)-2.*(*fSMpk)(0,3)*(*fSMpk)(0,1)
- - (*fSMpk)(1,2)+2.*(*fSMpk)(0,4); // dM211 = sum_{i,j,k=1,i!=j!=k}^M w_i^2 w_j w_k
- Double_t dM1111 = (*fSMpk)(3,1)-6.*(*fSMpk)(0,2)*(*fSMpk)(1,1)
- + 8.*(*fSMpk)(0,3)*(*fSMpk)(0,1)
- + 3.*(*fSMpk)(1,2)-6.*(*fSMpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l
- //..............................................................................................
-
-
-
-
- // ***********************************************
- // **** weighted multi-particle correlations: ****
- // ***********************************************
- //..............................................................................................
- // weighted 2-particle correlations:
- Double_t two1n1nW1W1 = 0.; // <w1 w2 cos(n*(phi1-phi2))>
- Double_t two2n2nW2W2 = 0.; // <w1^2 w2^2 cos(2n*(phi1-phi2))>
- Double_t two3n3nW3W3 = 0.; // <w1^3 w2^3 cos(3n*(phi1-phi2))>
- Double_t two4n4nW4W4 = 0.; // <w1^4 w2^4 cos(4n*(phi1-phi2))>
- Double_t two1n1nW3W1 = 0.; // <w1^3 w2 cos(n*(phi1-phi2))>
- Double_t two1n1nW1W1W2 = 0.; // <w1 w2 w3^2 cos(n*(phi1-phi2))>
-
- if(dMult>1)
- {
- if(dM11)
- {
- two1n1nW1W1 = (pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSMpk)(0,2))/dM11;
- fQCorrelationsW->Fill(0.,two1n1nW1W1,dM11);
- }
- if(dM22)
- {
- two2n2nW2W2 = (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)-(*fSMpk)(0,4))/dM22;
- fQCorrelationsW->Fill(1.,two2n2nW2W2,dM22);
- }
- if(dM33)
- {
- two3n3nW3W3 = (pow(dReQ3n3k,2)+pow(dImQ3n3k,2)-(*fSMpk)(0,6))/dM33;
- fQCorrelationsW->Fill(2.,two3n3nW3W3,dM33);
- }
- if(dM44)
- {
- two4n4nW4W4 = (pow(dReQ4n4k,2)+pow(dImQ4n4k,2)-(*fSMpk)(0,8))/dM44;
- fQCorrelationsW->Fill(3.,two4n4nW4W4,dM44);
- }
- if(dM31)
- {
- two1n1nW3W1 = (dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k-(*fSMpk)(0,4))/dM31;
- fQCorrelationsW->Fill(4.,two1n1nW3W1,dM31);
- }
- if(dM211)
- {
- two1n1nW1W1W2 = ((*fSMpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSMpk)(0,2))
- - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k
- - (*fSMpk)(0,4)))/dM211;
- fQCorrelationsW->Fill(5.,two1n1nW1W1W2,dM211);
- }
- } // end of if(dMult>1)
- //..............................................................................................
-
- //..............................................................................................
- // weighted 3-particle correlations:
- Double_t three2n1n1nW2W1W1 = 0.; // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))>
-
- if(dMult>2)
- {
- if(dM211)
- {
- three2n1n1nW2W1W1 = (pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k
- - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k)
- - pow(dReQ2n2k,2)-pow(dImQ2n2k,2)
- + 2.*(*fSMpk)(0,4))/dM211;
- fQCorrelationsW->Fill(20.,three2n1n1nW2W1W1,dM211);
- }
- } // end of if(dMult>2)
- //..............................................................................................
-
- //..............................................................................................
- // weighted 4-particle correlations:
- Double_t four1n1n1n1nW1W1W1W1 = 0.; // <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))>
- if(dMult>3)
- {
- if(dM1111)
- {
- four1n1n1n1nW1W1W1W1 = (pow(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.),2)
- - 2.*(pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k)
- + 8.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k)
- + (pow(dReQ2n2k,2)+pow(dImQ2n2k,2))
- - 4.*(*fSMpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2))
- - 6.*(*fSMpk)(0,4)+2.*(*fSMpk)(1,2))/dM1111;
- fQCorrelationsW->Fill(40.,four1n1n1n1nW1W1W1W1,dM1111);
- }
- } // end of if(dMult>3)
- //..............................................................................................
-
-} // end of AliFlowAnalysisWithQCumulants::CalculateWeightedCorrelationsForIntegratedFlow()
-
-
-//================================================================================================================================
-
-
-void AliFlowAnalysisWithQCumulants::CalculateCorrelationsForDifferentialFlow(TString type)
-{
- // calculate all correlations needed for differential flow for each (pt,eta) bin:
-
- // pt and eta bin width:
- Double_t dBinWidthPt = 0.; // to be improved (should I promote this variable to data members?)
- Double_t dBinWidthEta = 0.; // to be improved (should I promote this variable to data members?)
-
- if(fnBinsPt) dBinWidthPt=(fPtMax-fPtMin)/fnBinsPt;
- if(fnBinsEta) dBinWidthEta=(fEtaMax-fEtaMin)/fnBinsEta;
-
- // multiplicity:
- Double_t dMult = (*fSMpk)(0,0);
-
- // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
- Double_t dReQ1n = (*fReQ)(0,0);
- Double_t dReQ2n = (*fReQ)(1,0);
- //Double_t dReQ3n = (*fReQ)(2,0);
- //Double_t dReQ4n = (*fReQ)(3,0);
- Double_t dImQ1n = (*fImQ)(0,0);
- Double_t dImQ2n = (*fImQ)(1,0);
- //Double_t dImQ3n = (*fImQ)(2,0);
- //Double_t dImQ4n = (*fImQ)(3,0);
-
- // looping over all (pt,eta) bins and calculating correlations needed for differential flow:
- for(Int_t p=1;p<=fnBinsPt;p++)
- {
- for(Int_t e=1;e<=fnBinsEta;e++)
- {
- // real and imaginary parts of q_n (non-weighted Q-vector evaluated only for POIs in harmonic n for each (pt,eta) bin):
- Double_t dReqnPtEta = 0.;
- Double_t dImqnPtEta = 0.;
-
- // number of POIs in each (pt,eta) bin:
- Double_t dmPtEta = 0.;
-
- // real and imaginary parts of q''_{n}, q''_{2n}, ...
- // (non-weighted Q-vectors evaluated only for particles which are both RPs and POIs in harmonic n, 2n, ... for each (pt,eta) bin):
- Double_t dReqPrimePrime1nPtEta = 0.;
- Double_t dImqPrimePrime1nPtEta = 0.;
- Double_t dReqPrimePrime2nPtEta = 0.;
- Double_t dImqPrimePrime2nPtEta = 0.;
-
- // number of particles which are both RPs and POIs in each (pt,eta) bin:
- Double_t dmPrimePrimePtEta = 0.;
-
- if(type == "POI")
- {
- // q''_{n}, q''_{2n}:
- //...............................................................................................
- dReqPrimePrime1nPtEta = fReqPrimePrime1nPtEta->GetBinContent(fReqPrimePrime1nPtEta->GetBin(p,e));
- dImqPrimePrime1nPtEta = fImqPrimePrime1nPtEta->GetBinContent(fImqPrimePrime1nPtEta->GetBin(p,e));
- dReqPrimePrime2nPtEta = fReqPrimePrime2nPtEta->GetBinContent(fReqPrimePrime2nPtEta->GetBin(p,e));
- dImqPrimePrime2nPtEta = fImqPrimePrime2nPtEta->GetBinContent(fImqPrimePrime2nPtEta->GetBin(p,e));
- //...............................................................................................
-
- // m'':
- dmPrimePrimePtEta = fmPrimePrimePtEta->GetBinContent(fmPrimePrimePtEta->GetBin(p,e));
-
- // q'_{n}:
- dReqnPtEta = fReqnPtEta->GetBinContent(fReqnPtEta->GetBin(p,e));
- dImqnPtEta = fImqnPtEta->GetBinContent(fImqnPtEta->GetBin(p,e));
- dmPtEta = fmPtEta->GetBinContent(fmPtEta->GetBin(p,e));
- }
- else if(type == "RP")
- {
- // q_RP{n}, q_RP{2n}:
- //...............................................................................................
- dReqPrimePrime1nPtEta = fReqRP1nPtEta->GetBinContent(fReqRP1nPtEta->GetBin(p,e));
- dImqPrimePrime1nPtEta = fImqRP1nPtEta->GetBinContent(fImqRP1nPtEta->GetBin(p,e));
- dReqPrimePrime2nPtEta = fReqRP2nPtEta->GetBinContent(fReqRP2nPtEta->GetBin(p,e));
- dImqPrimePrime2nPtEta = fImqRP2nPtEta->GetBinContent(fImqRP2nPtEta->GetBin(p,e));
- //...............................................................................................
-
- // m'':
- dmPrimePrimePtEta = fmRPPtEta->GetBinContent(fmRPPtEta->GetBin(p,e));
-
- dReqnPtEta = fReqRP1nPtEta->GetBinContent(fReqRP1nPtEta->GetBin(p,e)); // not a bug ;-)
- dImqnPtEta = fImqRP1nPtEta->GetBinContent(fImqRP1nPtEta->GetBin(p,e)); // not a bug ;-)
- dmPtEta = fmRPPtEta->GetBinContent(fmRPPtEta->GetBin(p,e)); // not a bug ;-)
- }
-
- // 2'-particle correlation:
- Double_t two1n1nPtEta = 0.;
- if(dmPtEta*dMult-dmPrimePrimePtEta)
- {
- two1n1nPtEta = (dReqnPtEta*dReQ1n+dImqnPtEta*dImQ1n-dmPrimePrimePtEta)
- / (dmPtEta*dMult-dmPrimePrimePtEta);
-
- // fill the 2D profile to get the average correlation for each (pt, eta) bin:
- if(type == "POI")
- {
- f2pPtEtaPOI->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta,two1n1nPtEta,dmPtEta*dMult-dmPrimePrimePtEta);
- }
- else if(type == "RP")
- {
- f2pPtEtaRP->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta,two1n1nPtEta,dmPtEta*dMult-dmPrimePrimePtEta);
- }
- } // end of if(dmPtEta*dMult-dmPrimePrimePtEta)
-
- // 4'-particle correlation:
- Double_t four1n1n1n1nPtEta = 0.;
- if((dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.)
- + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression)
- {
- four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(dReqnPtEta*dReQ1n+dImqnPtEta*dImQ1n)
- - dReqPrimePrime2nPtEta*(pow(dReQ1n,2.)-pow(dImQ1n,2.))
- - 2.*dImqPrimePrime2nPtEta*dReQ1n*dImQ1n
- - dReqnPtEta*(dReQ1n*dReQ2n+dImQ1n*dImQ2n)
- + dImqnPtEta*(dImQ1n*dReQ2n-dReQ1n*dImQ2n)
- - 2.*dMult*(dReqnPtEta*dReQ1n+dImqnPtEta*dImQ1n)
- - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*dmPrimePrimePtEta
- + 6.*(dReqPrimePrime1nPtEta*dReQ1n+dImqPrimePrime1nPtEta*dImQ1n)
- + 1.*(dReqPrimePrime2nPtEta*dReQ2n+dImqPrimePrime2nPtEta*dImQ2n)
- + 2.*(dReqnPtEta*dReQ1n+dImqnPtEta*dImQ1n)
- + 2.*dmPrimePrimePtEta*dMult
- - 6.*dmPrimePrimePtEta)
- / ((dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.)
- + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.));
-
- // fill the 2D profile to get the average correlation for each (pt, eta) bin:
- if(type == "POI")
- {
- f4pPtEtaPOI->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta,four1n1n1n1nPtEta,
- (dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.)
- + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.));
- }
- else if(type == "RP")
- {
- f4pPtEtaRP->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta,four1n1n1n1nPtEta,
- (dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.)
- + dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.));
- }
- } // end of if((dmPtEta-dmPrimePrimePtEta)*dMult*(dMult-1.)*(dMult-2.)
- // +dmPrimePrimePtEta*(dMult-1.)*(dMult-2.)*(dMult-3.))
-
- } // end of for(Int_t e=1;e<=fnBinsEta;e++)
- } // end of for(Int_t p=1;p<=fnBinsPt;p++)
-
-} // end of AliFlowAnalysisWithQCumulants::CalculateCorrelationsForDifferentialFlow()
-
-
-//================================================================================================================================
-
-
-void AliFlowAnalysisWithQCumulants::CalculateWeightedCorrelationsForDifferentialFlow(TString type)
-{
- // calculate all weighted correlations needed for differential flow
-
- // pt and eta bin width:
- Double_t dBinWidthPt = 0.; // to be improved (should I promote this variable to data members?)
- Double_t dBinWidthEta = 0.; // to be improved (should I promote this variable to data members?)
-
- if(fnBinsPt) dBinWidthPt=(fPtMax-fPtMin)/fnBinsPt;
- if(fnBinsEta) dBinWidthEta=(fEtaMax-fEtaMin)/fnBinsEta;
-
- // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
- Double_t dReQ1n1k = (*fReQ)(0,1);
- Double_t dReQ2n2k = (*fReQ)(1,2);
- Double_t dReQ1n3k = (*fReQ)(0,3);
- //Double_t dReQ4n4k = (*fReQ)(3,4);
- Double_t dImQ1n1k = (*fImQ)(0,1);
- Double_t dImQ2n2k = (*fImQ)(1,2);
- Double_t dImQ1n3k = (*fImQ)(0,3);
- //Double_t dImQ4n4k = (*fImQ)(3,4);
-
- // S^M_{p,k} (see .h file for the definition of fSMpk):
- Double_t dSM1p1k = (*fSMpk)(0,1);
- Double_t dSM1p2k = (*fSMpk)(0,2);
- Double_t dSM1p3k = (*fSMpk)(0,3);
- Double_t dSM2p1k = (*fSMpk)(1,1);
- Double_t dSM3p1k = (*fSMpk)(2,1);
-
- // looping over all (pt,eta) bins and calculating weighted correlations needed for differential flow:
- for(Int_t p=1;p<=fnBinsPt;p++)
- {
- for(Int_t e=1;e<=fnBinsEta;e++)
- {
- // real and imaginary parts of q_n (non-weighted Q-vector evaluated only for POIs in harmonic n for each (pt,eta) bin):
- Double_t dReqnPtEta = 0.;
- Double_t dImqnPtEta = 0.;
-
- // number of POIs in each (pt,eta) bin:
- Double_t dmPtEta = 0.;
-
- // real and imaginary parts of q''_{n,2k}, q''_{2n,1k}, ...
- // (weighted Q-vectors evaluated only for particles which are both RPs and POIs in harmonic n, 2n, ... for each (pt,eta) bin):
- Double_t dReqPrimePrime1n2kPtEta = 0.;
- Double_t dImqPrimePrime1n2kPtEta = 0.;
- Double_t dReqPrimePrime2n1kPtEta = 0.;
- Double_t dImqPrimePrime2n1kPtEta = 0.;
-
- // S^{m''}_{1,1}, S^{m''}_{1,2}, S^{m''}_{1,3}... (see .h file for the definition):
- Double_t dSmPrimePrime1p1kPtEta = 0.;
- Double_t dSmPrimePrime1p2kPtEta = 0.;
- Double_t dSmPrimePrime1p3kPtEta = 0.;
-
- // M0111 from Eq. (118) in QC2c (to be improved (notation))
- Double_t dM0111 = 0.;
-
- // qPOI_{n}: // to be improved (notation)
- if(type == "POI")
- {
- dReqnPtEta = fReqnPtEta->GetBinContent(fReqnPtEta->GetBin(p,e));
- dImqnPtEta = fImqnPtEta->GetBinContent(fImqnPtEta->GetBin(p,e));
- dmPtEta = fmPtEta->GetBinContent(fmPtEta->GetBin(p,e));
-
- //...............................................................................................
- // q''_{n,2k}, q''_{2n,1k}:
- dReqPrimePrime1n2kPtEta = fReqPrimePrime1n2kPtEta->GetBinContent(fReqPrimePrime1n2kPtEta->GetBin(p,e));
- dImqPrimePrime1n2kPtEta = fImqPrimePrime1n2kPtEta->GetBinContent(fImqPrimePrime1n2kPtEta->GetBin(p,e));
- dReqPrimePrime2n1kPtEta = fReqPrimePrime2n1kPtEta->GetBinContent(fReqPrimePrime2n1kPtEta->GetBin(p,e));
- dImqPrimePrime2n1kPtEta = fImqPrimePrime2n1kPtEta->GetBinContent(fImqPrimePrime2n1kPtEta->GetBin(p,e));
-
- // S^{m''}_{1,1}, S^{m''}_{1,2}, S^{m''}_{1,3}...:
- dSmPrimePrime1p1kPtEta = fSmPrimePrime1p1kPtEta->GetBinContent(fSmPrimePrime1p1kPtEta->GetBin(p,e));
- dSmPrimePrime1p2kPtEta = fSmPrimePrime1p2kPtEta->GetBinContent(fSmPrimePrime1p2kPtEta->GetBin(p,e));
- dSmPrimePrime1p3kPtEta = fSmPrimePrime1p3kPtEta->GetBinContent(fSmPrimePrime1p3kPtEta->GetBin(p,e));
-
- // M0111 from Eq. (118) in QC2c (to be improved (notation)):
- dM0111 = dmPtEta*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k)
- - 3.*(dSmPrimePrime1p1kPtEta*(dSM2p1k-dSM1p2k)
- + 2.*(dSmPrimePrime1p3kPtEta-dSmPrimePrime1p2kPtEta*dSM1p1k));
- //...............................................................................................
- }
- else if(type == "RP")
- {
- dReqnPtEta = fReqRP1nPtEta->GetBinContent(fReqRP1nPtEta->GetBin(p,e)); // not a bug ;-)
- dImqnPtEta = fImqRP1nPtEta->GetBinContent(fImqRP1nPtEta->GetBin(p,e)); // not a bug ;-)
- dmPtEta = fmRPPtEta->GetBinContent(fmRPPtEta->GetBin(p,e)); // not a bug ;-)
-
- //...............................................................................................
- // q''_{n,2k}, q''_{2n,1k}: (to be improved (notation)):
- dReqPrimePrime1n2kPtEta = fReqRP1n2kPtEta->GetBinContent(fReqRP1n2kPtEta->GetBin(p,e));
- dImqPrimePrime1n2kPtEta = fImqRP1n2kPtEta->GetBinContent(fImqRP1n2kPtEta->GetBin(p,e));
- dReqPrimePrime2n1kPtEta = fReqRP2n1kPtEta->GetBinContent(fReqRP2n1kPtEta->GetBin(p,e));
- dImqPrimePrime2n1kPtEta = fImqRP2n1kPtEta->GetBinContent(fImqRP2n1kPtEta->GetBin(p,e));
-
- // S^{m''}_{1,1}, S^{m''}_{1,2}, S^{m''}_{1,3}...: (to be improved (notation)):
- dSmPrimePrime1p1kPtEta = fSmRP1p1kPtEta->GetBinContent(fSmRP1p1kPtEta->GetBin(p,e));
- dSmPrimePrime1p2kPtEta = fSmRP1p2kPtEta->GetBinContent(fSmRP1p2kPtEta->GetBin(p,e));
- dSmPrimePrime1p3kPtEta = fSmRP1p3kPtEta->GetBinContent(fSmRP1p3kPtEta->GetBin(p,e));
-
- // M0111 from Eq. (118) in QC2c (to be improved (notation)):
- dM0111 = dmPtEta*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k)
- - 3.*(dSmPrimePrime1p1kPtEta*(dSM2p1k-dSM1p2k)
- + 2.*(dSmPrimePrime1p3kPtEta-dSmPrimePrime1p2kPtEta*dSM1p1k));
- //...............................................................................................
- }
-
- // 2'-particle correlation:
- Double_t two1n1nW0W1PtEta = 0.;
- if(dmPtEta*dSM1p1k-dSmPrimePrime1p1kPtEta)
- {
- two1n1nW0W1PtEta = (dReqnPtEta*dReQ1n1k+dImqnPtEta*dImQ1n1k-dSmPrimePrime1p1kPtEta)
- / (dmPtEta*dSM1p1k-dSmPrimePrime1p1kPtEta);
-
- // fill the 2D profile to get the average correlation for each (pt, eta) bin:
- if(type == "POI")
- {
- f2pPtEtaPOIW->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta,two1n1nW0W1PtEta,
- dmPtEta*dSM1p1k-dSmPrimePrime1p1kPtEta);
- }
- else if(type == "RP")
- {
- f2pPtEtaRPW->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta,two1n1nW0W1PtEta,
- dmPtEta*dSM1p1k-dSmPrimePrime1p1kPtEta);
- }
- } // end of if(dmPtEta*dMult-dmPrimePrimePtEta)
-
- // 4'-particle correlation:
- Double_t four1n1n1n1nW0W1W1W1PtEta = 0.;
- if(dM0111)
- {
- four1n1n1n1nW0W1W1W1PtEta = ((pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*(dReqnPtEta*dReQ1n1k+dImqnPtEta*dImQ1n1k)
- - dReqPrimePrime2n1kPtEta*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))
- - 2.*dImqPrimePrime2n1kPtEta*dReQ1n1k*dImQ1n1k
- - dReqnPtEta*(dReQ1n1k*dReQ2n2k+dImQ1n1k*dImQ2n2k)
- + dImqnPtEta*(dImQ1n1k*dReQ2n2k-dReQ1n1k*dImQ2n2k)
- - 2.*dSM1p2k*(dReqnPtEta*dReQ1n1k+dImqnPtEta*dImQ1n1k)
- - 2.*(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*dSmPrimePrime1p1kPtEta
- + 6.*(dReqPrimePrime1n2kPtEta*dReQ1n1k+dImqPrimePrime1n2kPtEta*dImQ1n1k)
- + 1.*(dReqPrimePrime2n1kPtEta*dReQ2n2k+dImqPrimePrime2n1kPtEta*dImQ2n2k)
- + 2.*(dReqnPtEta*dReQ1n3k+dImqnPtEta*dImQ1n3k)
- + 2.*dSmPrimePrime1p1kPtEta*dSM1p2k
- - 6.*dSmPrimePrime1p3kPtEta)
- / dM0111; // to be imropoved (notation of dM0111)
-
- // fill the 2D profile to get the average correlation for each (pt, eta) bin:
- if(type == "POI")
- {
- f4pPtEtaPOIW->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta,four1n1n1n1nW0W1W1W1PtEta,dM0111);
- }
- else if(type == "RP")
- {
- f4pPtEtaRPW->Fill(fPtMin+(p-1)*dBinWidthPt,fEtaMin+(e-1)*dBinWidthEta,four1n1n1n1nW0W1W1W1PtEta,dM0111);
- }
- } // end of if(dM0111)
-
- } // end of for(Int_t e=1;e<=fnBinsEta;e++)
- } // end of for(Int_t p=1;p<=fnBinsPt;p++)
-
-} // end of AliFlowAnalysisWithQCumulants::CalculateWeightedCorrelationsForDifferentialFlow(TString type)
-
-
-//================================================================================================================================
-
-
-void AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNonUniformAcceptanceCosTerms()
-{
- // calculate corrections for non-uniform acceptance of the detector (cos terms)
-
- // multiplicity:
- Double_t dMult = (*fSMpk)(0,0);
-
- // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
- Double_t dReQ1n = (*fReQ)(0,0);
- Double_t dReQ2n = (*fReQ)(1,0);
- //Double_t dReQ3n = (*fReQ)(2,0);
- //Double_t dReQ4n = (*fReQ)(3,0);
- Double_t dImQ1n = (*fImQ)(0,0);
- Double_t dImQ2n = (*fImQ)(1,0);
- //Double_t dImQ3n = (*fImQ)(2,0);
- //Double_t dImQ4n = (*fImQ)(3,0);
-
- // *************************************************************
- // **** corrections for non-uniform acceptance (cos terms): ****
- // *************************************************************
- //
- // Remark 1: corrections for non-uniform acceptance (cos terms) calculated with non-weighted Q-vectors
- // are stored in 1D profile fQCorrectionsCos.
- // Remark 2: binning of fQCorrectionsCos is organized as follows:
- // --------------------------------------------------------------------------------------------------------------------
- // 1st bin: <<cos(n*(phi1))>> = cosP1n
- // 2nd bin: <<cos(n*(phi1+phi2))>> = cosP1nP1n
- // 3rd bin: <<cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1n
- // ...
- // --------------------------------------------------------------------------------------------------------------------
-
- // 1-particle:
- Double_t cosP1n = 0.; // <<cos(n*(phi1))>>
-
- if(dMult>0)
- {
- cosP1n = dReQ1n/dMult;
-
- fQCorrectionsCos->Fill(0.,cosP1n,dMult);
- }
-
- // 2-particle:
- Double_t cosP1nP1n = 0.; // <<cos(n*(phi1+phi2))>>
-
- if(dMult>1)
- {
- cosP1nP1n = (pow(dReQ1n,2)-pow(dImQ1n,2)-dReQ2n)/(dMult*(dMult-1));
-
- fQCorrectionsCos->Fill(1.,cosP1nP1n,dMult*(dMult-1));
- }
-
- // 3-particle:
- Double_t cosP1nM1nM1n = 0.; // <<cos(n*(phi1-phi2-phi3))>>
-
- if(dMult>2)
- {
- cosP1nM1nM1n = ( dReQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2)) - dReQ1n*dReQ2n - dImQ1n*dImQ2n - 2.*(dMult-1)*dReQ1n ) /(dMult*(dMult-1)*(dMult-2));
-
- fQCorrectionsCos->Fill(2.,cosP1nM1nM1n,dMult*(dMult-1)*(dMult-2));
- }
-
-} // end of AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNonUniformAcceptanceCosTerms()
-
-
-//================================================================================================================================
-
-
-void AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNonUniformAcceptanceSinTerms()
-{
- // calculate corrections for non-uniform acceptance of the detector (sin terms)
-
- // multiplicity:
- Double_t dMult = (*fSMpk)(0,0);
-
- // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n:
- Double_t dReQ1n = (*fReQ)(0,0);
- Double_t dReQ2n = (*fReQ)(1,0);
- //Double_t dReQ3n = (*fReQ)(2,0);
- //Double_t dReQ4n = (*fReQ)(3,0);
- Double_t dImQ1n = (*fImQ)(0,0);
- Double_t dImQ2n = (*fImQ)(1,0);
- //Double_t dImQ3n = (*fImQ)(2,0);
- //Double_t dImQ4n = (*fImQ)(3,0);
-
- // *************************************************************
- // **** corrections for non-uniform acceptance (sin terms): ****
- // *************************************************************
- //
- // Remark 1: corrections for non-uniform acceptance (sin terms) calculated with non-weighted Q-vectors
- // are stored in 1D profile fQCorrectionsSin.
- // Remark 2: binning of fQCorrectionsSin is organized as follows:
- // --------------------------------------------------------------------------------------------------------------------
- // 1st bin: <<sin(n*(phi1))>> = sinP1n
- // 2nd bin: <<sin(n*(phi1+phi2))>> = sinP1nP1n
- // 3rd bin: <<sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1n
- // ...
- // --------------------------------------------------------------------------------------------------------------------
-
- // 1-particle:
- Double_t sinP1n = 0.; // <sin(n*(phi1))>
-
- if(dMult>0)
- {
- sinP1n = dImQ1n/dMult;
-
- fQCorrectionsSin->Fill(0.,sinP1n,dMult);
- }
-
- // 2-particle:
- Double_t sinP1nP1n = 0.; // <<sin(n*(phi1+phi2))>>
-
- if(dMult>1)
- {
- sinP1nP1n = (2.*dReQ1n*dImQ1n-dImQ2n)/(dMult*(dMult-1));
-
- fQCorrectionsSin->Fill(1.,sinP1nP1n,dMult*(dMult-1));
- }
-
- // 3-particle:
- Double_t sinP1nM1nM1n = 0.; // <<sin(n*(phi1-phi2-phi3))>>
-
- if(dMult>2)
- {
- sinP1nM1nM1n = ( -dImQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2)) + dReQ1n*dImQ2n - dImQ1n*dReQ2n + 2.*(dMult-1)*dImQ1n ) /(dMult*(dMult-1)*(dMult-2));
-
- fQCorrectionsSin->Fill(2.,sinP1nM1nM1n,dMult*(dMult-1)*(dMult-2));
- }
-
-} // end of AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNonUniformAcceptanceSinTerms()
-
-
-//================================================================================================================================
-
-
-void AliFlowAnalysisWithQCumulants::EvaluateNestedLoopsForIntegratedFlow(AliFlowEventSimple* anEvent)
-{
- // evaluate the nested loops relevant for integrated flow (needed for cross-checking the results)
-
- Int_t nPrim = anEvent->NumberOfTracks();
-
- TH1F *phiWeights = NULL; // histogram with phi weights
- Int_t nBinsPhi = 0;
-
- if(fUsePhiWeights)
- {
- if(!fWeightsList)
- {
- cout<<" WARNING: fWeightsList is NULL pointer in AFAWQC::ENLFIF(). "<<endl;
- exit(0);
- }
- phiWeights = dynamic_cast<TH1F *>(fWeightsList->FindObject("phi_weights"));
- if(!phiWeights)
- {
- cout<<" WARNING: couldn't access the histogram with phi weights in AFAWQC::ENLFIF(). "<<endl;
- exit(0);
- }
- nBinsPhi = phiWeights->GetNbinsX();
- }
-
- Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.;
- Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.;
-
- Int_t n=2; // to be improved
-
- // ******************************************
- // **** NESTED LOOPS FOR INTEGRATED FLOW ****
- // ******************************************
- //
- // Remark 1: multi-particle correlations calculated with nested loops without weights are stored in 1D profile fDirectCorrelations;
- // Remark 2: multi-particle correlations calculated with nested loops with weights are stored in 1D profile fDirectCorrelationsW;
-
- // Remark 3: binning of fDirectCorrelations is organized as follows:
- // --------------------------------------------------------------------------------------------------------------------
- // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))>
- // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))>
- // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))>
- // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))>
- // 5th bin: ---- EMPTY ----
- // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))>
- // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))>
- // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))>
- // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))>
- // 10th bin: ---- EMPTY ----
- // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))>
- // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))>
- // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))>
- // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))>
- // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))>
- // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))>
- // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))>
- // 18th bin: ---- EMPTY ----
- // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))>
- // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))>
- // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))>
- // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))>
- // 23rd bin: ---- EMPTY ----
- // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))>
- // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))>
- // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))>
- // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))>
- // 28th bin: ---- EMPTY ----
- // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))>
- // 30th bin: ---- EMPTY ----
- // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))>
- // --------------------------------------------------------------------------------------------------------------------
-
- // Remark 4: binning of fDirectCorrelationsW is organized as follows:
- //..............................................................................................
- // ---- bins 1-20: 2-particle correlations ----
- // 1st bin: two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))>
- // 2nd bin: two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))>
- // 3rd bin: two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))>
- // 4th bin: two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))>
- // 5th bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))>
- // 6th bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))>
- // ---- bins 21-40: 3-particle correlations ----
- // 21st bin: three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))>
- // ---- bins 41-60: 4-particle correlations ----
- // 41st bin: four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))>
- // ---- bins 61-80: 5-particle correlations ----
- // ---- bins 81-100: 6-particle correlations ----
- // ---- bins 101-120: 7-particle correlations ----
- // ---- bins 121-140: 8-particle correlations ----
- //..............................................................................................
-
- // Remark 5: corrections for non-uniform acceptance (cos terms) calculated with nested loops are stored
- // in 1D profile fDirectCorrectionsCos (binning is the same as in fQCorrectionsCos - see above);
- // Remark 6: corrections for non-uniform acceptance (sin terms) calculated with nested loops are stored
- // in 1D profile fDirectCorrectionsSin (binning is the same as in fQCorrectionsSin - see above);
-
- // 2-particle correlations:
- for(Int_t i1=0;i1<nPrim;i1++)
- {
- fTrack=anEvent->GetTrack(i1);
- if(!(fTrack->InRPSelection())) continue;
- phi1=fTrack->Phi();
- if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi())));
- // corrections for non-uniform acceptance (cos terms)
- fDirectCorrectionsCos->Fill(0.,cos(n*phi1),1.); // <cos(n*phi1)>
- // corrections for non-uniform acceptance (sin terms)
- fDirectCorrectionsSin->Fill(0.,sin(n*phi1),1.); // <sin(n*phi1)>
- for(Int_t i2=0;i2<nPrim;i2++)
- {
- if(i2==i1)continue;
- fTrack=anEvent->GetTrack(i2);
- if(!(fTrack->InRPSelection())) continue;
- phi2=fTrack->Phi();
- if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi())));
-
- // non-weighted:
- //------------------------------------------------------------------------------
- fDirectCorrelations->Fill(0.,cos(n*(phi1-phi2)),1.); // <cos(n*(phi1-phi2))>
- fDirectCorrelations->Fill(1.,cos(2.*n*(phi1-phi2)),1.); // <cos(2n*(phi1-phi2))>
- fDirectCorrelations->Fill(2.,cos(3.*n*(phi1-phi2)),1.); // <cos(3n*(phi1-phi2))>
- fDirectCorrelations->Fill(3.,cos(4.*n*(phi1-phi2)),1.); // <cos(4n*(phi1-phi2))>
- //------------------------------------------------------------------------------
-
- // weighted:
- //................................................................................................................
- fDirectCorrelationsW->Fill(0.,cos(n*(phi1-phi2)),wPhi1*wPhi2); // <w1 w2 cos( n*(phi1-phi2))>
- fDirectCorrelationsW->Fill(1.,cos(2.*n*(phi1-phi2)),pow(wPhi1,2)*pow(wPhi2,2)); // <w1^2 w2^2 cos(2n*(phi1-phi2))>
- fDirectCorrelationsW->Fill(2.,cos(3.*n*(phi1-phi2)),pow(wPhi1,3)*pow(wPhi2,3)); // <w1^3 w2^3 cos(3n*(phi1-phi2))>
- fDirectCorrelationsW->Fill(3.,cos(4.*n*(phi1-phi2)),pow(wPhi1,4)*pow(wPhi2,4)); // <w1^4 w2^4 cos(4n*(phi1-phi2))>
- fDirectCorrelationsW->Fill(4.,cos(n*(phi1-phi2)),pow(wPhi1,3)*wPhi2); // <w1^3 w2 cos(n*(phi1-phi2))>
- //................................................................................................................
-
- // corrections for non-uniform acceptance (cos terms)
- //................................................................................................................
- fDirectCorrectionsCos->Fill(1.,cos(n*(phi1+phi2)),1.); // <<cos(n*(phi1+phi2))>>
- //................................................................................................................
-
- // corrections for non-uniform acceptance (sin terms)
- //................................................................................................................
- fDirectCorrectionsSin->Fill(1.,sin(n*(phi1+phi2)),1.); // <<sin(n*(phi1+phi2))>>
- //................................................................................................................
-
- }
- }
-
- // 3-particle correlations:
- for(Int_t i1=0;i1<nPrim;i1++)
- {
- fTrack=anEvent->GetTrack(i1);
- if(!(fTrack->InRPSelection())) continue;
- phi1=fTrack->Phi();
- if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi())));
- for(Int_t i2=0;i2<nPrim;i2++)
- {
- if(i2==i1)continue;
- fTrack=anEvent->GetTrack(i2);
- if(!(fTrack->InRPSelection())) continue;
- phi2=fTrack->Phi();
- if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi())));
- for(Int_t i3=0;i3<nPrim;i3++)
- {
- if(i3==i1||i3==i2)continue;
- fTrack=anEvent->GetTrack(i3);
- if(!(fTrack->InRPSelection())) continue;
- phi3=fTrack->Phi();
- if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi())));
-
- // non-weighted:
- //-----------------------------------------------------------------------------------
- fDirectCorrelations->Fill(5.,cos(2.*n*phi1-n*(phi2+phi3)),1.); //<3>_{2n|nn,n}
- fDirectCorrelations->Fill(6.,cos(3.*n*phi1-2.*n*phi2-n*phi3),1.); //<3>_{3n|2n,n}
- fDirectCorrelations->Fill(7.,cos(4.*n*phi1-2.*n*phi2-2.*n*phi3),1.); //<3>_{4n|2n,2n}
- fDirectCorrelations->Fill(8.,cos(4.*n*phi1-3.*n*phi2-n*phi3),1.); //<3>_{4n|3n,n}
- //-----------------------------------------------------------------------------------
-
- // weighted:
- //..............................................................................................................................
- // 2-p:
- fDirectCorrelationsW->Fill(5.,cos(n*(phi1-phi2)),wPhi1*wPhi2*pow(wPhi3,2)); // <w1 w2 w3^2 cos(n*(phi1-phi2))>
-
- // 3-p:
- fDirectCorrelationsW->Fill(20.,cos(2.*n*phi1-n*(phi2+phi3)),pow(wPhi1,2)*wPhi2*wPhi3); // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))>
- //..............................................................................................................................
-
-
- // corrections for non-uniform acceptance (cos terms)
- //................................................................................................................
- fDirectCorrectionsCos->Fill(2.,cos(n*(phi1-phi2-phi3)),1.); // <<cos(n*(phi1-phi2-phi3))>>
- //................................................................................................................
-
- // corrections for non-uniform acceptance (sin terms)
- //................................................................................................................
- fDirectCorrectionsSin->Fill(2.,sin(n*(phi1-phi2-phi3)),1.); // <<sin(n*(phi1-phi2-phi3))>>
- //................................................................................................................
-
- }
- }
- }
-
- // 4-particle correlations:
- for(Int_t i1=0;i1<nPrim;i1++)
- {
- fTrack=anEvent->GetTrack(i1);
- if(!(fTrack->InRPSelection())) continue;
- phi1=fTrack->Phi();
- if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi())));
- for(Int_t i2=0;i2<nPrim;i2++)
- {
- if(i2==i1)continue;
- fTrack=anEvent->GetTrack(i2);
- if(!(fTrack->InRPSelection())) continue;
- phi2=fTrack->Phi();
- if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi())));
- for(Int_t i3=0;i3<nPrim;i3++)
- {
- if(i3==i1||i3==i2)continue;
- fTrack=anEvent->GetTrack(i3);
- if(!(fTrack->InRPSelection())) continue;
- phi3=fTrack->Phi();
- if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi())));
- for(Int_t i4=0;i4<nPrim;i4++)
- {
- if(i4==i1||i4==i2||i4==i3)continue;
- fTrack=anEvent->GetTrack(i4);
- if(!(fTrack->InRPSelection())) continue;
- phi4=fTrack->Phi();
- if(phiWeights) wPhi4 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*nBinsPhi/TMath::TwoPi())));
-
- // non-weighted:
- //-------------------------------------------------------------------------------------------------
- fDirectCorrelations->Fill(10.,cos(n*phi1+n*phi2-n*phi3-n*phi4),1.); // <4>_{n,n|n,n}
- fDirectCorrelations->Fill(11.,cos(2.*n*phi1+n*phi2-2.*n*phi3-n*phi4),1.); // <4>_{2n,n|2n,n}
- fDirectCorrelations->Fill(12.,cos(2.*n*phi1+2*n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{2n,2n|2n,2n}
- fDirectCorrelations->Fill(13.,cos(3.*n*phi1-n*phi2-n*phi3-n*phi4),1.); // <4>_{3n|n,n,n}
- fDirectCorrelations->Fill(14.,cos(3.*n*phi1+n*phi2-3.*n*phi3-n*phi4),1.); // <4>_{3n,n|3n,n}
- fDirectCorrelations->Fill(15.,cos(3.*n*phi1+n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{3n,n|2n,2n}
- fDirectCorrelations->Fill(16.,cos(4.*n*phi1-2.*n*phi2-n*phi3-n*phi4),1.); // <4>_{4n|2n,n,n}
- //-------------------------------------------------------------------------------------------------
-
- // weighted:
- //.......................................................................................
- // 4-p:
- fDirectCorrelationsW->Fill(40.,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4);
- //.......................................................................................
-
- }
- }
- }
- }
-
- // 5-particle correlations:
- for(Int_t i1=0;i1<nPrim;i1++)
- {
- //cout<<"i1 = "<<i1<<endl;
- fTrack=anEvent->GetTrack(i1);
- if(!(fTrack->InRPSelection())) continue;
- phi1=fTrack->Phi();
- if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi())));
- for(Int_t i2=0;i2<nPrim;i2++)
- {
- if(i2==i1)continue;
- fTrack=anEvent->GetTrack(i2);
- if(!(fTrack->InRPSelection())) continue;
- phi2=fTrack->Phi();
- if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi())));
- for(Int_t i3=0;i3<nPrim;i3++)
- {
- if(i3==i1||i3==i2)continue;
- fTrack=anEvent->GetTrack(i3);
- if(!(fTrack->InRPSelection())) continue;
- phi3=fTrack->Phi();
- if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi())));
- for(Int_t i4=0;i4<nPrim;i4++)
- {
- if(i4==i1||i4==i2||i4==i3)continue;
- fTrack=anEvent->GetTrack(i4);
- if(!(fTrack->InRPSelection())) continue;
- phi4=fTrack->Phi();
- if(phiWeights) wPhi4 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*nBinsPhi/TMath::TwoPi())));
- for(Int_t i5=0;i5<nPrim;i5++)
- {
- if(i5==i1||i5==i2||i5==i3||i5==i4)continue;
- fTrack=anEvent->GetTrack(i5);
- if(!(fTrack->InRPSelection())) continue;
- phi5=fTrack->Phi();
- if(phiWeights) wPhi5 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi5*nBinsPhi/TMath::TwoPi())));
-
- // non-weighted:
- //------------------------------------------------------------------------------------------------------
- fDirectCorrelations->Fill(18.,cos(2.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5),1.); //<5>_{2n,n|n,n,n}
- fDirectCorrelations->Fill(19.,cos(2.*n*phi1+2.*n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); //<5>_{2n,2n|2n,n,n}
- fDirectCorrelations->Fill(20.,cos(3.*n*phi1+n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); //<5>_{3n,n|2n,n,n}
- fDirectCorrelations->Fill(21.,cos(4.*n*phi1-n*phi2-n*phi3-n*phi4-n*phi5),1.); //<5>_{4n|n,n,n,n}
- //------------------------------------------------------------------------------------------------------
-
- // weighted:
- //..............................................................................................................
- // 5-p:
- fDirectCorrelationsW->Fill(60.,cos(2.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5),pow(wPhi1,2)*wPhi2*wPhi3*wPhi4*wPhi5);
- //..............................................................................................................
-
- }
- }
- }
- }
- }
-
- // 6-particle correlations:
- for(Int_t i1=0;i1<nPrim;i1++)
- {
- //cout<<"i1 = "<<i1<<endl;
- fTrack=anEvent->GetTrack(i1);
- if(!(fTrack->InRPSelection())) continue;
- phi1=fTrack->Phi();
- if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi())));
- for(Int_t i2=0;i2<nPrim;i2++)
- {
- if(i2==i1)continue;
- fTrack=anEvent->GetTrack(i2);
- if(!(fTrack->InRPSelection())) continue;
- phi2=fTrack->Phi();
- if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi())));
- for(Int_t i3=0;i3<nPrim;i3++)
- {
- if(i3==i1||i3==i2)continue;
- fTrack=anEvent->GetTrack(i3);
- if(!(fTrack->InRPSelection())) continue;
- phi3=fTrack->Phi();
- if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi())));
- for(Int_t i4=0;i4<nPrim;i4++)
- {
- if(i4==i1||i4==i2||i4==i3)continue;
- fTrack=anEvent->GetTrack(i4);
- if(!(fTrack->InRPSelection())) continue;
- phi4=fTrack->Phi();
- if(phiWeights) wPhi4 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*nBinsPhi/TMath::TwoPi())));
- for(Int_t i5=0;i5<nPrim;i5++)
- {
- if(i5==i1||i5==i2||i5==i3||i5==i4)continue;
- fTrack=anEvent->GetTrack(i5);
- if(!(fTrack->InRPSelection())) continue;
- phi5=fTrack->Phi();
- if(phiWeights) wPhi5 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi5*nBinsPhi/TMath::TwoPi())));
- for(Int_t i6=0;i6<nPrim;i6++)
- {
- if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue;
- fTrack=anEvent->GetTrack(i6);
- if(!(fTrack->InRPSelection())) continue;
- phi6=fTrack->Phi();
- if(phiWeights) wPhi6 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi6*nBinsPhi/TMath::TwoPi())));
-
- // non-weighted:
- //-----------------------------------------------------------------------------------------------------------
- fDirectCorrelations->Fill(23.,cos(n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{n,n,n|n,n,n}
- fDirectCorrelations->Fill(24.,cos(2.*n*phi1+n*phi2+n*phi3-2.*n*phi4-n*phi5-n*phi6),1.); //<6>_{2n,n,n|2n,n,n}
- fDirectCorrelations->Fill(25.,cos(2.*n*phi1+2.*n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{2n,2n|n,n,n,n}
- fDirectCorrelations->Fill(26.,cos(3.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{3n,n|n,n,n,n}
- //-----------------------------------------------------------------------------------------------------------
-
- // weighted:
- //.................................................................................................................
- // 6-p:
- fDirectCorrelationsW->Fill(80.,cos(n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6),wPhi1*wPhi2*wPhi3*wPhi4*wPhi5*wPhi6);
- //.................................................................................................................
-
- }
- }
- }
- }
- }
- }
-
- // 7-particle correlations:
- for(Int_t i1=0;i1<nPrim;i1++)
- {
- //cout<<"i1 = "<<i1<<endl;
- fTrack=anEvent->GetTrack(i1);
- if(!(fTrack->InRPSelection())) continue;
- phi1=fTrack->Phi();
- if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi())));
- for(Int_t i2=0;i2<nPrim;i2++)
- {
- if(i2==i1)continue;
- fTrack=anEvent->GetTrack(i2);
- if(!(fTrack->InRPSelection())) continue;
- phi2=fTrack->Phi();
- if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi())));
- for(Int_t i3=0;i3<nPrim;i3++)
- {
- if(i3==i1||i3==i2)continue;
- fTrack=anEvent->GetTrack(i3);
- if(!(fTrack->InRPSelection())) continue;
- phi3=fTrack->Phi();
- if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi())));
- for(Int_t i4=0;i4<nPrim;i4++)
- {
- if(i4==i1||i4==i2||i4==i3)continue;
- fTrack=anEvent->GetTrack(i4);
- if(!(fTrack->InRPSelection())) continue;
- phi4=fTrack->Phi();
- if(phiWeights) wPhi4 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*nBinsPhi/TMath::TwoPi())));
- for(Int_t i5=0;i5<nPrim;i5++)
- {
- if(i5==i1||i5==i2||i5==i3||i5==i4)continue;
- fTrack=anEvent->GetTrack(i5);
- if(!(fTrack->InRPSelection())) continue;
- phi5=fTrack->Phi();
- if(phiWeights) wPhi5 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi5*nBinsPhi/TMath::TwoPi())));
- for(Int_t i6=0;i6<nPrim;i6++)
- {
- if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue;
- fTrack=anEvent->GetTrack(i6);
- if(!(fTrack->InRPSelection())) continue;
- phi6=fTrack->Phi();
- if(phiWeights) wPhi6 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi6*nBinsPhi/TMath::TwoPi())));
- for(Int_t i7=0;i7<nPrim;i7++)
- {
- if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue;
- fTrack=anEvent->GetTrack(i7);
- if(!(fTrack->InRPSelection())) continue;
- phi7=fTrack->Phi();
- if(phiWeights) wPhi7 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi7*nBinsPhi/TMath::TwoPi())));
-
- // non-weighted:
- //---------------------------------------------------------------------------------------------------------------
- fDirectCorrelations->Fill(28.,cos(2.*n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6-n*phi7),1.);//<7>_{2n,n,n|n,n,n,n}
- //---------------------------------------------------------------------------------------------------------------
-
- // weighted:
- //..........................................................................................................................................
- fDirectCorrelationsW->Fill(100.,cos(2.*n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6-n*phi7),pow(wPhi1,2.)*wPhi2*wPhi3*wPhi4*wPhi5*wPhi6*wPhi7);
- //..........................................................................................................................................
-
- }
- }
- }
- }
- }
- }
- }
-
- // 8-particle correlations:
- for(Int_t i1=0;i1<nPrim;i1++)
- {
- cout<<"i1 = "<<i1<<endl;
- fTrack=anEvent->GetTrack(i1);
- if(!(fTrack->InRPSelection())) continue;
- phi1=fTrack->Phi();
- if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*nBinsPhi/TMath::TwoPi())));
- for(Int_t i2=0;i2<nPrim;i2++)
- {
- if(i2==i1)continue;
- fTrack=anEvent->GetTrack(i2);
- if(!(fTrack->InRPSelection())) continue;
- phi2=fTrack->Phi();
- if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi())));
- for(Int_t i3=0;i3<nPrim;i3++)
- {
- if(i3==i1||i3==i2)continue;
- fTrack=anEvent->GetTrack(i3);
- if(!(fTrack->InRPSelection())) continue;
- phi3=fTrack->Phi();
- if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi())));
- for(Int_t i4=0;i4<nPrim;i4++)
- {
- if(i4==i1||i4==i2||i4==i3)continue;
- fTrack=anEvent->GetTrack(i4);
- if(!(fTrack->InRPSelection())) continue;
- phi4=fTrack->Phi();
- if(phiWeights) wPhi4 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*nBinsPhi/TMath::TwoPi())));
- for(Int_t i5=0;i5<nPrim;i5++)
- {
- if(i5==i1||i5==i2||i5==i3||i5==i4)continue;
- fTrack=anEvent->GetTrack(i5);
- if(!(fTrack->InRPSelection())) continue;
- phi5=fTrack->Phi();
- if(phiWeights) wPhi5 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi5*nBinsPhi/TMath::TwoPi())));
- for(Int_t i6=0;i6<nPrim;i6++)
- {
- if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue;
- fTrack=anEvent->GetTrack(i6);
- if(!(fTrack->InRPSelection())) continue;
- phi6=fTrack->Phi();
- if(phiWeights) wPhi6 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi6*nBinsPhi/TMath::TwoPi())));
- for(Int_t i7=0;i7<nPrim;i7++)
- {
- if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue;
- fTrack=anEvent->GetTrack(i7);
- if(!(fTrack->InRPSelection())) continue;
- phi7=fTrack->Phi();
- if(phiWeights) wPhi7 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi7*nBinsPhi/TMath::TwoPi())));
- for(Int_t i8=0;i8<nPrim;i8++)
- {
- if(i8==i1||i8==i2||i8==i3||i8==i4||i8==i5||i8==i6||i8==i7)continue;
- fTrack=anEvent->GetTrack(i8);
- if(!(fTrack->InRPSelection())) continue;
- phi8=fTrack->Phi();
- if(phiWeights) wPhi8 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi8*nBinsPhi/TMath::TwoPi())));
-
- // non-weighted:
- //--------------------------------------------------------------------------------------------------------------------
- fDirectCorrelations->Fill(30.,cos(n*phi1+n*phi2+n*phi3+n*phi4-n*phi5-n*phi6-n*phi7-n*phi8),1.);//<8>_{n,n,n,n|n,n,n,n}
- //--------------------------------------------------------------------------------------------------------------------
-
- // weighted:
- //...........................................................................................................................................
- fDirectCorrelations->Fill(120.,cos(n*phi1+n*phi2+n*phi3+n*phi4-n*phi5-n*phi6-n*phi7-n*phi8),wPhi1*wPhi2*wPhi3*wPhi4*wPhi5*wPhi6*wPhi7*wPhi8);
- //...........................................................................................................................................
-
- }
- }
- }
- }
- }
- }
- }
- }
-
-} // end of AliFlowAnalysisWithQCumulants::EvaluateNestedLoopsForIntegratedFlow(AliFlowEventSimple* anEvent)
-
-
-//================================================================================================================================
-
-
-void AliFlowAnalysisWithQCumulants::EvaluateNestedLoopsForDifferentialFlow(AliFlowEventSimple* anEvent)
-{
- // evaluate the nested loops relevant for differential flow (needed for cross-checking the results)
-
- Int_t nPrim = anEvent->NumberOfTracks();
-
- TH1F *phiWeights = NULL; // histogram with phi weights
- Int_t nBinsPhi = 0;
-
- if(fUsePhiWeights)
- {
- if(!fWeightsList)
- {
- cout<<" WARNING: fWeightsList is NULL pointer in AFAWQC::ENLFDF(). "<<endl;
- exit(0);
- }
- phiWeights = dynamic_cast<TH1F *>(fWeightsList->FindObject("phi_weights"));
- if(!phiWeights)
- {
- cout<<" WARNING: couldn't access the histogram with phi weights in AFAWQC::ENLFDF(). "<<endl;
- exit(0);
- }
- nBinsPhi = phiWeights->GetNbinsX();
- }
-
- Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.;
- Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1.;// wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.;
-
- Int_t n=2; // to be improved
-
- // ********************************************
- // **** NESTED LOOPS FOR DIFFERENTIAL FLOW ****
- // ********************************************
-
- // Remark 1: (pt,eta) bin in which the cross-checking will be performed is given by 1.1 < pt < 1.2 GeV and -0.55 < eta < -0.525
-
- // Remark 2: multi-particle correlations needed for diff. flow calculated with nested loops without weights are stored in 1D profile
- // fDirectCorrelationsDiffFlow
-
- // Remark 3: multi-particle correlations needed for diff. flow calculated with nested loops with weights are stored in 1D profile
- // fDirectCorrelationsDiffFlowW;
-
- // Remark 4: binning of fDirectCorrelationsDiffFlow is organized as follows:
- //......................................................................................
- // ---- bins 1-20: 2-particle correlations ----
- // 1st bin: <2'>_{1n|1n} = twoPrime1n1n = <cos(n*(psi1-phi2))>
- // ---- bins 21-40: 3-particle correlations ----
- // ---- bins 41-60: 4-particle correlations ----
- // 41st bin: <4'>_{1n,1n|1n,1n} = fourPrime1n1n1n1n = <cos(n*(psi1+phi2-phi3-phi4))>
- //......................................................................................
-
- // Remark 5: binning of fDirectCorrelationsDiffFlow is organized as follows:
- //......................................................................................
- // ---- bins 1-20: 2-particle correlations ----
- // 1st bin: twoPrime1n1nW0W1 = <w2 cos(n*(psi1-phi2))>
- // ---- bins 21-40: 3-particle correlations ----
- // ---- bins 41-60: 4-particle correlations ----
- // 41st bin: fourPrime1n1n1n1nW0W1W1W1 = <w2 w3 w4 cos(n*(psi1+phi2-phi3-phi4))>
- //......................................................................................
-
- // 2'-particle:
- for(Int_t i1=0;i1<nPrim;i1++)
- {
- fTrack=anEvent->GetTrack(i1);
- // POI condition (first particle in the correlator must be POI):
- if(!((fTrack->Pt()>=1.1 && fTrack->Pt()<1.2) && (fTrack->Eta()>=-0.55 && fTrack->Eta()<-0.525) && (fTrack->InPOISelection())))continue;
- psi1=fTrack->Phi();
- if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(psi1*nBinsPhi/TMath::TwoPi())));
- for(Int_t i2=0;i2<nPrim;i2++)
- {
- if(i2==i1)continue;
- fTrack=anEvent->GetTrack(i2);
- // RP condition (!(first) particle in the correlator must be RP):
- if(!(fTrack->InRPSelection()))continue;
- phi2=fTrack->Phi();
- if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi())));
-
- // non-weighted:
- //.....................................................................................
- fDirectCorrelationsDiffFlow->Fill(0.,cos(1.*n*(psi1-phi2)),1.); // <cos(n*(psi1-phi2))>
- //.....................................................................................
-
- // weighted:
- //.....................................................................................
- fDirectCorrelationsDiffFlowW->Fill(0.,cos(1.*n*(psi1-phi2)),wPhi2); // <w2 cos(n*(psi1-phi2))>
- //.....................................................................................
-
- //fDirectCorrelations->Fill(103.,cos(1.*n*(phi1-phi2)),pow(wPhi1,2)*wPhi2);//<2'>_{n,n}
- //fDirectCorrelations->Fill(104.,cos(2.*n*(phi1-phi2)),wPhi1*pow(wPhi2,2));//<2'>_{n,n}
- //fDirectCorrelations->Fill(105.,cos(1.*n*(phi1-phi2)),pow(wPhi2,3));//<2'>_{n,n}
- //fDirectCorrelations->Fill(41.,cos(2.*n*(phi1-phi2)),1);//<2'>_{2n,2n}
- //fDirectCorrelations->Fill(42.,cos(3.*n*(phi1-phi2)),1);//<2'>_{3n,3n}
- //fDirectCorrelations->Fill(43.,cos(4.*n*(phi1-phi2)),1);//<2'>_{4n,4n}
-
- }//end of for(Int_t i2=0;i2<nPrim;i2++)
- }//end of for(Int_t i1=0;i1<nPrim;i1++)
-
-
-
- /*
-
- //<3'>_{2n|n,n}
- for(Int_t i1=0;i1<nPrim;i1++)
- {
- fTrack=anEvent->GetTrack(i1);
- if(!((fTrack->Pt()>=0.5&&fTrack->Pt()<0.6)&&(fTrack->InPOISelection())))continue;//POI condition
- psi1=fTrack->Phi();
- if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(psi1*nBinsPhi/TMath::TwoPi())));
- for(Int_t i2=0;i2<nPrim;i2++)
- {
- if(i2==i1)continue;
- fTrack=anEvent->GetTrack(i2);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi2=fTrack->Phi();
- if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi())));
- for(Int_t i3=0;i3<nPrim;i3++)
- {
- if(i3==i1||i3==i2)continue;
- fTrack=anEvent->GetTrack(i3);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi3=fTrack->Phi();
- if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi())));
- //fill the fDirectCorrelations:
-
- // 2-p
- //fDirectCorrelations->Fill(101.,cos(n*(phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 cos(n(phi2-phi3))>
- //fDirectCorrelations->Fill(102.,cos(n*(phi1-phi3)),pow(wPhi2,2.)*wPhi3); // <w2^2 w3 cos(n(psi1-phi2))>
-
- // 3-p
- //fDirectCorrelations->Fill(110.,cos(n*(2.*phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 cos(n(2psi1-phi2-phi3))>
- //fDirectCorrelations->Fill(111.,cos(n*(phi1+phi2-2.*phi3)),wPhi2*pow(wPhi3,2.)); // <w2 w3^2 cos(n(psi1+phi2-2.*phi3))>
-
-
- //fDirectCorrelations->Fill(46.,cos(n*(phi1+phi2-2.*phi3)),1);//<3'>_{n,n|2n}
- }//end of for(Int_t i3=0;i3<nPrim;i3++)
- }//end of for(Int_t i2=0;i2<nPrim;i2++)
- }//end of for(Int_t i1=0;i1<nPrim;i1++)
- */
-
- // 4'-particle:
- for(Int_t i1=0;i1<nPrim;i1++)
- {
- fTrack=anEvent->GetTrack(i1);
- // POI condition (first particle in the correlator must be POI):
- if(!((fTrack->Pt()>=1.1 && fTrack->Pt()<1.2) && (fTrack->Eta()>=-0.55 && fTrack->Eta()<-0.525) && (fTrack->InPOISelection())))continue;
- psi1=fTrack->Phi();
- if(phiWeights) wPhi1 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(psi1*nBinsPhi/TMath::TwoPi())));
- for(Int_t i2=0;i2<nPrim;i2++)
- {
- if(i2==i1)continue;
- fTrack=anEvent->GetTrack(i2);
- // RP condition (!(first) particle in the correlator must be RP):
- if(!(fTrack->InRPSelection()))continue;
- phi2=fTrack->Phi();
- if(phiWeights) wPhi2 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*nBinsPhi/TMath::TwoPi())));
- for(Int_t i3=0;i3<nPrim;i3++)
- {
- if(i3==i1||i3==i2)continue;
- fTrack=anEvent->GetTrack(i3);
- // RP condition (!(first) particle in the correlator must be RP):
- if(!(fTrack->InRPSelection()))continue;
- phi3=fTrack->Phi();
- if(phiWeights) wPhi3 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*nBinsPhi/TMath::TwoPi())));
- for(Int_t i4=0;i4<nPrim;i4++)
- {
- if(i4==i1||i4==i2||i4==i3)continue;
- fTrack=anEvent->GetTrack(i4);
- // RP condition (!(first) particle in the correlator must be RP):
- if(!(fTrack->InRPSelection()))continue;
- phi4=fTrack->Phi();
- if(phiWeights) wPhi4 = phiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*nBinsPhi/TMath::TwoPi())));
-
- // non-weighted:
- //.........................................................................................................................
- fDirectCorrelationsDiffFlow->Fill(40.,cos(n*(psi1+phi2-phi3-phi4)),1.); // <cos(n(psi1+phi1-phi2-phi3))>
- //.........................................................................................................................
-
- // weighted:
- //...............................................................................................................................
- fDirectCorrelationsDiffFlowW->Fill(40.,cos(n*(psi1+phi2-phi3-phi4)),wPhi2*wPhi3*wPhi4); // <w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))>
- //...............................................................................................................................
-
- }//end of for(Int_t i4=0;i4<nPrim;i4++)
- }//end of for(Int_t i3=0;i3<nPrim;i3++)
- }//end of for(Int_t i2=0;i2<nPrim;i2++)
- }//end of for(Int_t i1=0;i1<nPrim;i1++)
-
- /*
- //<5'>_{2n,n|n,n,n}
- for(Int_t i1=0;i1<nPrim;i1++)
- {
- fTrack=anEvent->GetTrack(i1);
- if(!((fTrack->Pt()>=0.5&&fTrack->Pt()<0.6)&&(fTrack->InPOISelection())))continue;//POI condition
- phi1=fTrack->Phi();
- for(Int_t i2=0;i2<nPrim;i2++)
- {
- if(i2==i1)continue;
- fTrack=anEvent->GetTrack(i2);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi2=fTrack->Phi();
- for(Int_t i3=0;i3<nPrim;i3++)
- {
- if(i3==i1||i3==i2)continue;
- fTrack=anEvent->GetTrack(i3);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi3=fTrack->Phi();
- for(Int_t i4=0;i4<nPrim;i4++)
- {
- if(i4==i1||i4==i2||i4==i3)continue;
- fTrack=anEvent->GetTrack(i4);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi4=fTrack->Phi();//
- for(Int_t i5=0;i5<nPrim;i5++)
- {
- if(i5==i1||i5==i2||i5==i3||i5==i4)continue;
- fTrack=anEvent->GetTrack(i5);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi5=fTrack->Phi();
- //fill the fDirectCorrelations:if(bNestedLoops)
- //fDirectCorrelations->Fill(55.,cos(2.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5),1);//<5'>_{2n,n|n,n,n}
- }//end of for(Int_t i5=0;i5<nPrim;i5++)
- }//end of for(Int_t i4=0;i4<nPrim;i4++)
- }//end of for(Int_t i3=0;i3<nPrim;i3++)
- }//end of for(Int_t i2=0;i2<nPrim;i2++)
- }//end of for(Int_t i1=0;i1<nPrim;i1++)
-
-
-
- */
- /*
-
-
-
- //<6'>_{n,n,n|n,n,n}
- for(Int_t i1=0;i1<nPrim;i1++)
- {
- fTrack=anEvent->GetTrack(i1);
- if(!((fTrack->Pt()>=0.5&&fTrack->Pt()<0.6)&&(fTrack->InPOISelection())))continue;//POI condition
- phi1=fTrack->Phi();
- for(Int_t i2=0;i2<nPrim;i2++)
- {
- if(i2==i1)continue;
- fTrack=anEvent->GetTrack(i2);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi2=fTrack->Phi();
- for(Int_t i3=0;i3<nPrim;i3++)
- {
- if(i3==i1||i3==i2)continue;
- fTrack=anEvent->GetTrack(i3);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi3=fTrack->Phi();
- for(Int_t i4=0;i4<nPrim;i4++)
- {
- if(i4==i1||i4==i2||i4==i3)continue;
- fTrack=anEvent->GetTrack(i4);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi4=fTrack->Phi();
- for(Int_t i5=0;i5<nPrim;i5++)
- {
- if(i5==i1||i5==i2||i5==i3||i5==i4)continue;
- fTrack=anEvent->GetTrack(i5);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi5=fTrack->Phi();
- for(Int_t i6=0;i6<nPrim;i6++)
- {
- if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue;
- fTrack=anEvent->GetTrack(i6);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi6=fTrack->Phi();
- //fill the fDirectCorrelations:
- //fDirectCorrelations->Fill(60.,cos(n*(phi1+phi2+phi3-phi4-phi5-phi6)),1);//<6'>_{n,n,n|n,n,n}
- }//end of for(Int_t i6=0;i6<nPrim;i6++)
- }//end of for(Int_t i5=0;i5<nPrim;i5++)
- }//end of for(Int_t i4=0;i4<nPrim;i4++)
- }//end of for(Int_t i3=0;i3<nPrim;i3++)
- }//end of for(Int_t i2=0;i2<nPrim;i2++)
- }//end of for(Int_t i1=0;i1<nPrim;i1++)
-
-
- */
- /*
-
-
- //<7'>_{2n,n,n|n,n,n,n}
- for(Int_t i1=0;i1<nPrim;i1++)
- {
- fTrack=anEvent->GetTrack(i1);
- if(!((fTrack->Pt()>=0.5&&fTrack->Pt()<0.6)&&(fTrack->InPOISelection())))continue;//POI condition
- phi1=fTrack->Phi();
- for(Int_t i2=0;i2<nPrim;i2++)
- {
- if(i2==i1)continue;
- fTrack=anEvent->GetTrack(i2);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi2=fTrack->Phi();
- for(Int_t i3=0;i3<nPrim;i3++)
- {
- if(i3==i1||i3==i2)continue;
- fTrack=anEvent->GetTrack(i3);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi3=fTrack->Phi();
- for(Int_t i4=0;i4<nPrim;i4++)
- {
- if(i4==i1||i4==i2||i4==i3)continue;
- fTrack=anEvent->GetTrack(i4);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi4=fTrack->Phi();
- for(Int_t i5=0;i5<nPrim;i5++)
- {
- if(i5==i1||i5==i2||i5==i3||i5==i4)continue;
- fTrack=anEvent->GetTrack(i5);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi5=fTrack->Phi();
- for(Int_t i6=0;i6<nPrim;i6++)
- {
- if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue;
- fTrack=anEvent->GetTrack(i6);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi6=fTrack->Phi();
- for(Int_t i7=0;i7<nPrim;i7++)
- {
- if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue;
- fTrack=anEvent->GetTrack(i7);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi7=fTrack->Phi();
- //fill the fDirectCorrelations:
- //fDirectCorrelations->Fill(65.,cos(2.*n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6-n*phi7),1);//<7'>_{2n,n,n|n,n,n,n}
- }//end of for(Int_t i7=0;i7<nPrim;i7++)
- }//end of for(Int_t i6=0;i6<nPrim;i6++)
- }//end of for(Int_t i5=0;i5<nPrim;i5++)
- }//end of for(Int_t i4=0;i4<nPrim;i4++)
- }//end of for(Int_t i3=0;i3<nPrim;i3++)
- }//end of for(Int_t i2=0;i2<nPrim;i2++)
- }//end of for(Int_t i1=0;i1<nPrim;i1++)
-
-
-
- */
- /*
-
-
-
- //<8'>_{n,n,n,n|n,n,n,n}
- for(Int_t i1=0;i1<nPrim;i1++)
- {
- fTrack=anEvent->GetTrack(i1);
- if(!((fTrack->Pt()>=0.5&&fTrack->Pt()<0.6)&&(fTrack->InPOISelection())))continue;//POI condition
- phi1=fTrack->Phi();
- for(Int_t i2=0;i2<nPrim;i2++)
- {
- if(i2==i1)continue;
- fTrack=anEvent->GetTrack(i2);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi2=fTrack->Phi();
- for(Int_t i3=0;i3<nPrim;i3++)
- {
- if(i3==i1||i3==i2)continue;
- fTrack=anEvent->GetTrack(i3);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi3=fTrack->Phi();
- for(Int_t i4=0;i4<nPrim;i4++)
- {
- if(i4==i1||i4==i2||i4==i3)continue;
- fTrack=anEvent->GetTrack(i4);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi4=fTrack->Phi();
- for(Int_t i5=0;i5<nPrim;i5++)
- {
- if(i5==i1||i5==i2||i5==i3||i5==i4)continue;
- fTrack=anEvent->GetTrack(i5);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi5=fTrack->Phi();
- for(Int_t i6=0;i6<nPrim;i6++)
- {
- if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue;
- fTrack=anEvent->GetTrack(i6);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi6=fTrack->Phi();
- for(Int_t i7=0;i7<nPrim;i7++)
- {
- if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue;
- fTrack=anEvent->GetTrack(i7);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi7=fTrack->Phi();
- for(Int_t i8=0;i8<nPrim;i8++)
- {
- if(i8==i1||i8==i2||i8==i3||i8==i4||i8==i5||i8==i6||i8==i7)continue;
- fTrack=anEvent->GetTrack(i8);
- if(!(fTrack->InRPSelection()))continue;//RP condition
- phi8=fTrack->Phi();
- //fill the fDirectCorrelations:
- //fDirectCorrelations->Fill(70.,cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8)),1);//<8'>_{n,n,n,n|n,n,n,n}
- }//end of for(Int_t i8=0;i8<nPrim;i8++)
- }//end of for(Int_t i7=0;i7<nPrim;i7++)
- }//end of for(Int_t i6=0;i6<nPrim;i6++)
- }//end of for(Int_t i5=0;i5<nPrim;i5++)
- }//end of for(Int_t i4=0;i4<nPrim;i4++)
- }//end of for(Int_t i3=0;i3<nPrim;i3++)
- }//end of for(Int_t i2=0;i2<nPrim;i2++)
- }//end of for(Int_t i1=0;i1<nPrim;i1++)
-
-
-
- */
-
-
-
-
-} // end of AliFlowAnalysisWithQCumulants::EvaluateNestedLoopsForDifferentialFlow(AliFlowEventSimple* anEvent)
-
-
-//================================================================================================================================
-
-
-void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos)
-{
- // get pointers to all output histograms (called before Finish())
- if(outputListHistos)
- {
- // with or without weights
- TBits *useWeightsBits = dynamic_cast<TBits*>(outputListHistos->FindObject("TBits"));
-
- //final results (no-name integrated flow without weights)
- TH1D *finalCorrectionsForNUA = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fFinalCorrectionsForNUA"));
-
- //final results (no-name integrated flow without weights)
- TH1D *intFlowResultsQC = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fIntFlowResultsQC"));
-
- //final results (no-name integrated flow with weights)
- TH1D *intFlowResultsQCW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fIntFlowResultsQCW"));
-
- //final results (POIs integrated flow without weights)
- TH1D *intFlowResultsPOIQC = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fIntFlowResultsPOIQC"));
-
- //final results (POIs integrated flow with weights)
- TH1D *intFlowResultsPOIQCW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fIntFlowResultsPOIQCW"));
-
- //final results (RPs integrated flow without weights)
- TH1D *intFlowResultsRPQC = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fIntFlowResultsRPQC"));
-
- //final results (RPs integrated flow with weights)
- TH1D *intFlowResultsRPQCW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fIntFlowResultsRPQCW"));
-
- //final results (differential flow)
- TH1D *diffFlowResults2ndOrder = dynamic_cast<TH1D*>(outputListHistos->FindObject("fDiffFlowResults2ndOrderQC"));
- TH1D *diffFlowResults4thOrder = dynamic_cast<TH1D*>(outputListHistos->FindObject("fDiffFlowResults4thOrderQC"));
-
- //final results for covariances (1st bin <2*4>-<2>*<4>, 2nd bin <2*6>-<2>*<6>, ...)
- TH1D *covariances = dynamic_cast<TH1D*>(outputListHistos->FindObject("fCovariances"));
-
- //common control histograms (taking into account only the events with 2 and more particles)
- AliFlowCommonHist *commonHist2nd = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject("AliFlowCommonHist2ndOrderQC"));
-
- //common control histograms (taking into account only the events with 4 and more particles)
- AliFlowCommonHist *commonHist4th = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject("AliFlowCommonHist4thOrderQC"));
-
- //common control histograms (taking into account only the events with 6 and more particles)
- AliFlowCommonHist *commonHist6th = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject("AliFlowCommonHist6thOrderQC"));
-
- //common control histograms (taking into account only the events with 8 and more particles)
- AliFlowCommonHist *commonHist8th = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject("AliFlowCommonHist8thOrderQC"));
-
- //common histograms to store the final results for the 2nd order integrated and differential flow
- AliFlowCommonHistResults *commonHistRes2nd = dynamic_cast<AliFlowCommonHistResults*>(outputListHistos->FindObject("AliFlowCommonHistResults2ndOrderQC"));
-
- //common histograms to store the final results for the 4th order integrated and differential flow
- AliFlowCommonHistResults *commonHistRes4th = dynamic_cast<AliFlowCommonHistResults*>(outputListHistos->FindObject("AliFlowCommonHistResults4thOrderQC"));
-
- //common histograms to store the final results for the 6th order integrated and differential flow
- AliFlowCommonHistResults *commonHistRes6th = dynamic_cast<AliFlowCommonHistResults*>(outputListHistos->FindObject("AliFlowCommonHistResults6thOrderQC"));
-
- //common histograms to store the final results for the 8th order integrated and differential flow
- AliFlowCommonHistResults *commonHistRes8th = dynamic_cast<AliFlowCommonHistResults*>(outputListHistos->FindObject("AliFlowCommonHistResults8thOrderQC"));
-
- //average selected multiplicity (for int. flow)
- TProfile *AvMult = dynamic_cast<TProfile*>(outputListHistos->FindObject("fAvMultIntFlowQC"));
-
- //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx
- // !!!! to be removed !!!!
- //profiles containing the Q-vectors from all events
- TProfile *qvectorForEachEventX = dynamic_cast<TProfile*>(outputListHistos->FindObject("fQvectorForEachEventX"));
- TProfile *qvectorForEachEventY = dynamic_cast<TProfile*>(outputListHistos->FindObject("fQvectorForEachEventY"));
- //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx
-
- //multi-particle correlations calculated from Q-vectors
- TProfile *qCorrelations = dynamic_cast<TProfile*>(outputListHistos->FindObject("fQCorrelations"));
-
- //weighted multi-particle correlations calculated from Q-vectors
- TProfile *qCorrelationsW = dynamic_cast<TProfile*>(outputListHistos->FindObject("fQCorrelationsW"));
-
- // corrections for non-uniform acceptance (cos terms) calculated from Q-vectors
- TProfile *qCorrectionsCos = dynamic_cast<TProfile*>(outputListHistos->FindObject("fQCorrectionsCos"));
-
- // corrections for non-uniform acceptance (sin terms) calculated from Q-vectors
- TProfile *qCorrectionsSin = dynamic_cast<TProfile*>(outputListHistos->FindObject("fQCorrectionsSin"));
-
- //average of products: 1st bin: <2*4>, 2nd bin: <2*6>, ...
- TProfile *QProduct = dynamic_cast<TProfile*>(outputListHistos->FindObject("fQProduct"));
-
- //average 2- and 4-particle correlations per pt-bin
- TProfile *binnedPt2p1n1nRP = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2PerPtBin1n1nRP"));
- TProfile *binnedPt4p1n1n1n1nRP = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4PerPtBin1n1n1n1nRP"));
-
- //average 2- and 4-particle correlations per eta-bin
- TProfile *binnedEta2p1n1nRP = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2PerEtaBin1n1nRP"));
- TProfile *binnedEta4p1n1n1n1nRP = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4PerEtaBin1n1n1n1nRP"));
-
- //average 2- and 4-particle correlations per pt-bin
- TProfile *binnedPt2p1n1nPOI = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2PerPtBin1n1nPOI"));
- TProfile *binnedPt4p1n1n1n1nPOI = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4PerPtBin1n1n1n1nPOI"));
-
- //average 2- and 4-particle correlations per eta-bin
- TProfile *binnedEta2p1n1nPOI = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2PerEtaBin1n1nPOI"));
- TProfile *binnedEta4p1n1n1n1nPOI = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4PerEtaBin1n1n1n1nPOI"));
-
- //average 2- and 4-particle correlations per pt-bin
- TProfile *binnedWPt2p1n1nPOI = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2WPerPtBin1n1nPOI"));
- TProfile *binnedWPt4p1n1n1n1nPOI = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4WPerPtBin1n1n1n1nPOI"));
-
- TProfile *binnedWEta2p1n1nPOI = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2WPerEtaBin1n1nPOI"));
- TProfile *binnedWEta4p1n1n1n1nPOI = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4WPerEtaBin1n1n1n1nPOI"));
-
- TProfile *binnedWPt2p1n1nRP = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2WPerPtBin1n1nRP"));
- TProfile *binnedWPt4p1n1n1n1nRP = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4WPerPtBin1n1n1n1nRP"));
-
- TProfile *binnedWEta2p1n1nRP = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2WPerEtaBin1n1nRP"));
- TProfile *binnedWEta4p1n1n1n1nRP = dynamic_cast<TProfile*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4WPerEtaBin1n1n1n1nRP"));
-
- //average values of Q-vector components (1st bin: <Q_x>, 2nd bin: <Q_y>, 3rd bin: <(Q_x)^2>, 4th bin: <(Q_y)^2>)
- TProfile *QVectorComponents = dynamic_cast<TProfile*>(outputListHistos->FindObject("fQvectorComponents"));
-
- // multi-particle correlations calculated with nested loop (needed for int. flow)
- TProfile *directCorrelations = dynamic_cast<TProfile*>(outputListHistos->FindObject("fDirectCorrelations"));
-
- // multi-particle correlations calculated with nested loop (needed for weighted int. flow)
- TProfile *directCorrelationsW = dynamic_cast<TProfile*>(outputListHistos->FindObject("fDirectCorrelationsW"));
-
- // multi-particle correlations calculated with nested loop (needed for diff. flow)
- TProfile *directCorrelationsDiffFlow = dynamic_cast<TProfile*>(outputListHistos->FindObject("fDirectCorrelationsDiffFlow"));
-
- // multi-particle correlations calculated with nested loop (needed for int. flow)
- TProfile *directCorrelationsDiffFlowW = dynamic_cast<TProfile*>(outputListHistos->FindObject("fDirectCorrelationsDiffFlowW"));
-
- // corrections for non-uniform acceptance (cos terms) calculated with nested loop
- TProfile *directCorrectionsCos = dynamic_cast<TProfile*>(outputListHistos->FindObject("fDirectCorrectionsCos"));
-
- // corrections for non-uniform acceptance (sin terms) calculated with nested loop
- TProfile *directCorrectionsSin = dynamic_cast<TProfile*>(outputListHistos->FindObject("fDirectCorrectionsSin"));
-
-
-
-
- // ...............................................................................................................................................
- // non-weighted correlations for each (pt,eta) bin for POIs:
- TProfile2D *twoPtEtaPOI = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2pPtEtaPOI"));
- TProfile2D *fourPtEtaPOI = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4pPtEtaPOI"));
- TProfile2D *sixPtEtaPOI = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f6pPtEtaPOI"));
- TProfile2D *eightPtEtaPOI = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f8pPtEtaPOI"));
-
- // non-weighted final results for differential flow for each for POIs:
- // 3D (pt,eta)
- TH2D *vn2ndPtEtaPOI = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndPtEtaPOI"));
- TH2D *vn4thPtEtaPOI = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thPtEtaPOI"));
- TH2D *vn6thPtEtaPOI = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thPtEtaPOI"));
- TH2D *vn8thPtEtaPOI = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thPtEtaPOI"));
- // 2D (pt)
- TH1D *vn2ndPtPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndPtPOI"));
- TH1D *vn4thPtPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thPtPOI"));
- TH1D *vn6thPtPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thPtPOI"));
- TH1D *vn8thPtPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thPtPOI"));
- // 2D (eta)
- TH1D *vn2ndEtaPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndEtaPOI"));
- TH1D *vn4thEtaPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thEtaPOI"));
- TH1D *vn6thEtaPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thEtaPOI"));
- TH1D *vn8thEtaPOI = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thEtaPOI"));
-
- // weighted correlations for each (pt,eta) bin for POIs:
- TProfile2D *twoPtEtaPOIW = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2pPtEtaPOIW"));
- TProfile2D *fourPtEtaPOIW = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4pPtEtaPOIW"));
- TProfile2D *sixPtEtaPOIW = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f6pPtEtaPOIW"));
- TProfile2D *eightPtEtaPOIW = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f8pPtEtaPOIW"));
-
- // weighted final results for differential flow for each for POIs:
- // 3D (pt,eta)
- TH2D *vn2ndPtEtaPOIW = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndPtEtaPOIW"));
- TH2D *vn4thPtEtaPOIW = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thPtEtaPOIW"));
- TH2D *vn6thPtEtaPOIW = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thPtEtaPOIW"));
- TH2D *vn8thPtEtaPOIW = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thPtEtaPOIW"));
- // 2D (pt)
- TH1D *vn2ndPtPOIW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndPtPOIW"));
- TH1D *vn4thPtPOIW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thPtPOIW"));
- TH1D *vn6thPtPOIW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thPtPOIW"));
- TH1D *vn8thPtPOIW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thPtPOIW"));
- // 2D (eta)
- TH1D *vn2ndEtaPOIW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndEtaPOIW"));
- TH1D *vn4thEtaPOIW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thEtaPOIW"));
- TH1D *vn6thEtaPOIW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thEtaPOIW"));
- TH1D *vn8thEtaPOIW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thEtaPOIW"));
-
- // non-weighted correlations for each (pt,eta) bin for RPs:
- TProfile2D *twoPtEtaRP = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2pPtEtaRP"));
- TProfile2D *fourPtEtaRP = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4pPtEtaRP"));
- TProfile2D *sixPtEtaRP = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f6pPtEtaRP"));
- TProfile2D *eightPtEtaRP = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f8pPtEtaRP"));
-
- // non-weighted final results for differential flow for RPs:
- // 3D (pt,eta)
- TH2D *vn2ndPtEtaRP = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndPtEtaRP"));
- TH2D *vn4thPtEtaRP = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thPtEtaRP"));
- TH2D *vn6thPtEtaRP = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thPtEtaRP"));
- TH2D *vn8thPtEtaRP = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thPtEtaRP"));
- // 2D (pt)
- TH1D *vn2ndPtRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndPtRP"));
- TH1D *vn4thPtRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thPtRP"));
- TH1D *vn6thPtRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thPtRP"));
- TH1D *vn8thPtRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thPtRP"));
- // 2D (eta)
- TH1D *vn2ndEtaRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndEtaRP"));
- TH1D *vn4thEtaRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thEtaRP"));
- TH1D *vn6thEtaRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thEtaRP"));
- TH1D *vn8thEtaRP = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thEtaRP"));
-
- // weighted correlations for each (pt,eta) bin for RPs:
- TProfile2D *twoPtEtaRPW = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f2pPtEtaRPW"));
- TProfile2D *fourPtEtaRPW = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f4pPtEtaRPW"));
- TProfile2D *sixPtEtaRPW = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f6pPtEtaRPW"));
- TProfile2D *eightPtEtaRPW = dynamic_cast<TProfile2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("DifferentialFlow")))->FindObject("f8pPtEtaRPW"));
-
- // weighted final results for differential flow for RPs:
- // 3D (pt,eta)
- TH2D *vn2ndPtEtaRPW = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndPtEtaRPW"));
- TH2D *vn4thPtEtaRPW = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thPtEtaRPW"));
- TH2D *vn6thPtEtaRPW = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thPtEtaRPW"));
- TH2D *vn8thPtEtaRPW = dynamic_cast<TH2D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thPtEtaRPW"));
- // 2D (pt)
- TH1D *vn2ndPtRPW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndPtRPW"));
- TH1D *vn4thPtRPW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thPtRPW"));
- TH1D *vn6thPtRPW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thPtRPW"));
- TH1D *vn8thPtRPW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thPtRPW"));
- // 2D (eta)
- TH1D *vn2ndEtaRPW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn2ndEtaRPW"));
- TH1D *vn4thEtaRPW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn4thEtaRPW"));
- TH1D *vn6thEtaRPW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn6thEtaRPW"));
- TH1D *vn8thEtaRPW = dynamic_cast<TH1D*>((dynamic_cast<TList*>(outputListHistos->FindObject("Results")))->FindObject("fvn8thEtaRPW"));
- // ...............................................................................................................................................
-
-
-
- //----------------------------------------------------
-
- this->SetUseWeightsBits(useWeightsBits);
- this->SetFinalCorrectionsForNUA(finalCorrectionsForNUA);
- this->SetIntFlowResults(intFlowResultsQC);
- this->SetIntFlowResultsW(intFlowResultsQCW);
- this->SetIntFlowResultsPOI(intFlowResultsPOIQC);
- this->SetIntFlowResultsPOIW(intFlowResultsPOIQCW);
- this->SetIntFlowResultsRP(intFlowResultsRPQC);
- this->SetIntFlowResultsRPW(intFlowResultsRPQCW);
-
- this->SetDiffFlowResults2nd(diffFlowResults2ndOrder);
- this->SetDiffFlowResults4th(diffFlowResults4thOrder);
- this->SetCovariances(covariances);
-
- this->SetCommonHists2nd(commonHist2nd);
- this->SetCommonHists4th(commonHist4th);
- this->SetCommonHists6th(commonHist6th);
- this->SetCommonHists8th(commonHist8th);
-
- this->SetCommonHistsResults2nd(commonHistRes2nd);
- this->SetCommonHistsResults4th(commonHistRes4th);
- this->SetCommonHistsResults6th(commonHistRes6th);
- this->SetCommonHistsResults8th(commonHistRes8th);
-
- this->SetAverageMultiplicity(AvMult);
- //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx
- // !!!! to be removed !!!!
- this->SetQvectorForEachEventX(qvectorForEachEventX);
- this->SetQvectorForEachEventY(qvectorForEachEventY);
- //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx
- this->SetQCorrelations(qCorrelations);
- this->SetQCorrelationsW(qCorrelationsW);
- this->SetQCorrectionsCos(qCorrectionsCos);
- this->SetQCorrectionsSin(qCorrectionsSin);
- this->SetQProduct(QProduct);
- this->SetQVectorComponents(QVectorComponents);
-
- this->SetTwo1n1nPerPtBinRP(binnedPt2p1n1nRP);
- this->SetFour1n1n1n1nPerPtBinRP(binnedPt4p1n1n1n1nRP);
-
- this->SetTwo1n1nPerEtaBinRP(binnedEta2p1n1nRP);
- this->SetFour1n1n1n1nPerEtaBinRP(binnedEta4p1n1n1n1nRP);
-
- this->SetTwo1n1nPerPtBinPOI(binnedPt2p1n1nPOI);
- this->SetFour1n1n1n1nPerPtBinPOI(binnedPt4p1n1n1n1nPOI);
-
- this->SetTwo1n1nPerEtaBinPOI(binnedEta2p1n1nPOI);
- this->SetFour1n1n1n1nPerEtaBinPOI(binnedEta4p1n1n1n1nPOI);
-
- this->SetTwo1n1nWPerPtBinPOI(binnedWPt2p1n1nPOI);
- this->SetFour1n1n1n1nWPerPtBinPOI(binnedWPt4p1n1n1n1nPOI);
-
- this->SetTwo1n1nWPerEtaBinPOI(binnedWEta2p1n1nPOI);
- this->SetFour1n1n1n1nWPerEtaBinPOI(binnedWEta4p1n1n1n1nPOI);
-
- this->SetTwo1n1nWPerPtBinRP(binnedWPt2p1n1nRP);
- this->SetFour1n1n1n1nWPerPtBinRP(binnedWPt4p1n1n1n1nRP);
-
- this->SetTwo1n1nWPerEtaBinRP(binnedWEta2p1n1nRP);
- this->SetFour1n1n1n1nWPerEtaBinRP(binnedWEta4p1n1n1n1nRP);
-
- // nested loops results:
- this->SetDirectCorrelations(directCorrelations);
- this->SetDirectCorrelationsW(directCorrelationsW);
- this->SetDirectCorrelationsDiffFlow(directCorrelationsDiffFlow);
- this->SetDirectCorrelationsDiffFlowW(directCorrelationsDiffFlowW);
- this->SetDirectCorrectionsCos(directCorrectionsCos);
- this->SetDirectCorrectionsSin(directCorrectionsSin);
-
- // non-weighted correlations for each (pt,eta) bin for POIs:
- this->Set2pPtEtaPOI(twoPtEtaPOI);
- this->Set4pPtEtaPOI(fourPtEtaPOI);
- this->Set6pPtEtaPOI(sixPtEtaPOI);
- this->Set8pPtEtaPOI(eightPtEtaPOI);
-
- // non-weighted final results for differential flow for POIs:
- // 3D (pt,eta)
- this->Setvn2ndPtEtaPOI(vn2ndPtEtaPOI);
- this->Setvn4thPtEtaPOI(vn4thPtEtaPOI);
- this->Setvn6thPtEtaPOI(vn6thPtEtaPOI);
- this->Setvn8thPtEtaPOI(vn8thPtEtaPOI);
- // 2D (pt)
- this->Setvn2ndPtPOI(vn2ndPtPOI);
- this->Setvn4thPtPOI(vn4thPtPOI);
- this->Setvn6thPtPOI(vn6thPtPOI);
- this->Setvn8thPtPOI(vn8thPtPOI);
- // 2D (eta)
- this->Setvn2ndEtaPOI(vn2ndEtaPOI);
- this->Setvn4thEtaPOI(vn4thEtaPOI);
- this->Setvn6thEtaPOI(vn6thEtaPOI);
- this->Setvn8thEtaPOI(vn8thEtaPOI);
-
- // weighted correlations for each (pt,eta) bin for POIs:
- this->Set2pPtEtaPOIW(twoPtEtaPOIW);
- this->Set4pPtEtaPOIW(fourPtEtaPOIW);
- this->Set6pPtEtaPOIW(sixPtEtaPOIW);
- this->Set8pPtEtaPOIW(eightPtEtaPOIW);
-
- // weighted final results for differential flow for POIs:
- // 3D (pt,eta)
- this->Setvn2ndPtEtaPOIW(vn2ndPtEtaPOIW);
- this->Setvn4thPtEtaPOIW(vn4thPtEtaPOIW);
- this->Setvn6thPtEtaPOIW(vn6thPtEtaPOIW);
- this->Setvn8thPtEtaPOIW(vn8thPtEtaPOIW);
- // 2D (pt)
- this->Setvn2ndPtPOIW(vn2ndPtPOIW);
- this->Setvn4thPtPOIW(vn4thPtPOIW);
- this->Setvn6thPtPOIW(vn6thPtPOIW);
- this->Setvn8thPtPOIW(vn8thPtPOIW);
- // 2D (eta)
- this->Setvn2ndEtaPOIW(vn2ndEtaPOIW);
- this->Setvn4thEtaPOIW(vn4thEtaPOIW);
- this->Setvn6thEtaPOIW(vn6thEtaPOIW);
- this->Setvn8thEtaPOIW(vn8thEtaPOIW);
-
- // non-weighted correlations for each (pt,eta) bin for RPs:
- this->Set2pPtEtaRP(twoPtEtaRP);
- this->Set4pPtEtaRP(fourPtEtaRP);
- this->Set6pPtEtaRP(sixPtEtaRP);
- this->Set8pPtEtaRP(eightPtEtaRP);
-
- // non-weighted final results for differential flow for RPs:
- // 3D (pt,eta)
- this->Setvn2ndPtEtaRP(vn2ndPtEtaRP);
- this->Setvn4thPtEtaRP(vn4thPtEtaRP);
- this->Setvn6thPtEtaRP(vn6thPtEtaRP);
- this->Setvn8thPtEtaRP(vn8thPtEtaRP);
- // 2D (pt)
- this->Setvn2ndPtRP(vn2ndPtRP);
- this->Setvn4thPtRP(vn4thPtRP);
- this->Setvn6thPtRP(vn6thPtRP);
- this->Setvn8thPtRP(vn8thPtRP);
- // 2D (eta)
- this->Setvn2ndEtaRP(vn2ndEtaRP);
- this->Setvn4thEtaRP(vn4thEtaRP);
- this->Setvn6thEtaRP(vn6thEtaRP);
- this->Setvn8thEtaRP(vn8thEtaRP);
-
- // weighted correlations for each (pt,eta) bin for RPs:
- this->Set2pPtEtaRPW(twoPtEtaRPW);
- this->Set4pPtEtaRPW(fourPtEtaRPW);
- this->Set6pPtEtaRPW(sixPtEtaRPW);
- this->Set8pPtEtaRPW(eightPtEtaRPW);
-
- // weighted final results for differential flow for RPs:
- // 3D (pt,eta)
- this->Setvn2ndPtEtaRPW(vn2ndPtEtaRPW);
- this->Setvn4thPtEtaRPW(vn4thPtEtaRPW);
- this->Setvn6thPtEtaRPW(vn6thPtEtaRPW);
- this->Setvn8thPtEtaRPW(vn8thPtEtaRPW);
- // 2D (pt)
- this->Setvn2ndPtRPW(vn2ndPtRPW);
- this->Setvn4thPtRPW(vn4thPtRPW);
- this->Setvn6thPtRPW(vn6thPtRPW);
- this->Setvn8thPtRPW(vn8thPtRPW);
- // 2D (eta)
- this->Setvn2ndEtaRPW(vn2ndEtaRPW);
- this->Setvn4thEtaRPW(vn4thEtaRPW);
- this->Setvn6thEtaRPW(vn6thEtaRPW);
- this->Setvn8thEtaRPW(vn8thEtaRPW);
- }
-}
-
-
-//================================================================================================================================
-
-
-void AliFlowAnalysisWithQCumulants::Finish()
-{
- // calculate the final results
-
- fUseWeights = fUseWeightsBits->TestBitNumber(1); // to be improved
-
- // compare correlations needed for integrated flow:
- if(fDirectCorrelations->GetBinContent(1) != 0 || fDirectCorrelationsW->GetBinContent(1) != 0)
- {
- this->CompareDirectAndQCorrelationsForIntegratedFlow(fUseWeights);
- }
- // compare correlations needed for integrated flow:
- if(fDirectCorrelationsDiffFlow->GetBinContent(1) != 0 || fDirectCorrelationsDiffFlowW->GetBinContent(1) != 0)
- {
- this->CompareDirectAndQCorrelationsForDifferentialFlow(fUseWeights);
- }
-
-
-
-
- // *************************************
- // **** CALCULATE THE FINAL RESULTS ****
- // *************************************
-
- if(!fUseWeights) this->CalculateFinalCorrectionsForNonUniformAcceptance(); // to be improved (to calculate also when weights are used)
-
- // integrated flow ('no-name') without weights:
- // calculate final results for no-name integrated flow without weights:
- this->CalculateFinalResultsForNoNameIntegratedFlow(kFALSE);
-
- // integrated flow ('no-name') with weights:
- // calculate final results for no-name integrated flow with weights:
- if(fUseWeights) this->CalculateFinalResultsForNoNameIntegratedFlow(fUseWeights);
-
-
- // **** POI ****
-
- // differential flow (POI) without weights:
- // calculate final results for 2nd order differential flow of POIs without weights:
- this->CalculateFinalResultsForDifferentialFlow(fvn2ndPtEtaPOI,fvn2ndPtPOI,fvn2ndEtaPOI,f2pPtEtaPOI);
- // calculate final results for 4th order differential flow of POIs without weights:
- this->CalculateFinalResultsForDifferentialFlow(fvn4thPtEtaPOI,fvn4thPtPOI,fvn4thEtaPOI,f2pPtEtaPOI,f4pPtEtaPOI);
- // calculate final results for 6th order differential flow of POIs without weights:
- // this->CalculateFinalResultsForDifferentialFlow(fvn6thPtEtaPOI,fvn6thPtPOI,fvn6thEtaPOI,f2pPtEtaPOI,f4pPtEtaPOI,f6pPtEtaPOI);
- // calculate final results for 8th order differential flow of POIs without weights:
- // this->CalculateFinalResultsForDifferentialFlow(fvn8thPtEtaPOI,fvn8thPtPOI,fvn8thEtaPOI,f2pPtEtaPOI,f4pPtEtaPOI,f6pPtEtaPOI,f8pPtEtaPOI);
-
- // differential flow (POI) with weights:
- // calculate final results for 2nd order differential flow of POIs with weights:
- if(fUseWeights) this->CalculateFinalResultsForDifferentialFlow(fvn2ndPtEtaPOIW,fvn2ndPtPOIW,fvn2ndEtaPOIW,f2pPtEtaPOIW);
- // calculate final results for 4th order differential flow of POIs without weights:
- if(fUseWeights) this->CalculateFinalResultsForDifferentialFlow(fvn4thPtEtaPOIW,fvn4thPtPOIW,fvn4thEtaPOIW,f2pPtEtaPOIW,f4pPtEtaPOIW);
- // calculate final results for 6th order differential flow of POIs with weights:
- // if(fUseWeights) this->CalculateFinalResultsForDifferentialFlow(fvn6thPtEtaPOIW,fvn6thPtPOIW,fvn6thEtaPOIW,f2pPtEtaPOIW,f4pPtEtaPOIW,f6pPtEtaPOIW);
- // calculate final results for 8th order differential flow of POIs without weights:
- // if(fUseWeights) this->CalculateFinalResultsForDifferentialFlow(fvn8thPtEtaPOIW,fvn8thPtPOIW,fvn8thEtaPOIW,f2pPtEtaPOIW,f4pPtEtaPOIW,f6pPtEtaPOIW,f8pPtEtaPOIW);
-
- // integrated flow (POI) without weights:
- // calculate final results for integrated flow of POIs without weights:
- this->CalculateFinalResultsForRPandPOIIntegratedFlow(kFALSE,"POI");
-
- // integrated flow (POI) with weights:
- // calculate final results for integrated flow of POIs with weights:
- if(fUseWeights) this->CalculateFinalResultsForRPandPOIIntegratedFlow(kTRUE,"POI");
-
-
- // **** RP ****
-
- // differential flow (RP) without weights:
- // calculate final results for 2nd order differential flow of RPs without weights:
- this->CalculateFinalResultsForDifferentialFlow(fvn2ndPtEtaRP,fvn2ndPtRP,fvn2ndEtaRP,f2pPtEtaRP);
- // calculate final results for 4th order differential flow of RPs without weights:
- this->CalculateFinalResultsForDifferentialFlow(fvn4thPtEtaRP,fvn4thPtRP,fvn4thEtaRP,f2pPtEtaRP,f4pPtEtaRP);
- // calculate final results for 6th order differential flow of RPs without weights:
- // this->CalculateFinalResultsForDifferentialFlow(fvn6thPtEtaRP,fvn6thPtRP,fvn6thEtaRP,f2pPtEtaRP,f4pPtEtaRP,f6pPtEtaRP);
- // calculate final results for 8th order differential flow of RPs without weights:
- // this->CalculateFinalResultsForDifferentialFlow(fvn8thPtEtaRP,fvn8thPtRP,fvn8thEtaRP,f2pPtEtaRP,f4pPtEtaRP,f6pPtEtaRP,f8pPtEtaRP);
-
- // differential flow (RP) with weights:
- // calculate final results for 2nd order differential flow of RPs with weights:
- if(fUseWeights) this->CalculateFinalResultsForDifferentialFlow(fvn2ndPtEtaRPW,fvn2ndPtRPW,fvn2ndEtaRPW,f2pPtEtaRPW);
- // calculate final results for 4th order differential flow of RPs without weights:
- if(fUseWeights) this->CalculateFinalResultsForDifferentialFlow(fvn4thPtEtaRPW,fvn4thPtRPW,fvn4thEtaRPW,f2pPtEtaRPW,f4pPtEtaRPW);
- // calculate final results for 6th order differential flow of RPs with weights:
- // if(fUseWeights) this->CalculateFinalResultsForDifferentialFlow(fvn6thPtEtaRPW,fvn6thPtRPW,fvn6thEtaRPW,f2pPtEtaRPW,f4pPtEtaRPW,f6pPtEtaRPW);
- // calculate final results for 8th order differential flow of RPs without weights:
- // if(fUseWeights) this->CalculateFinalResultsForDifferentialFlow(fvn8thPtEtaRPW,fvn8thPtRPW,fvn8thEtaRPW,f2pPtEtaRPW,f4pPtEtaRPW,f6pPtEtaRPW,f8pPtEtaRPW);
-
- // integrated flow (RP) without weights:
- // calculate final results for integrated flow of RPs without weights:
- this->CalculateFinalResultsForRPandPOIIntegratedFlow(kFALSE,"RP");
-
- // integrated flow (RP) with weights:
- // calculate final results for integrated flow of POIs with weights:
- if(fUseWeights) this->CalculateFinalResultsForRPandPOIIntegratedFlow(kTRUE,"RP");
-
-
-
- // *****************************************************
- // **** PRINT THE FINAL RESULTS FOR INTEGRATED FLOW ****
- // *****************************************************
-
- // print the final results for 'no-name' integrated flow without weights:
- this->PrintFinalResultsForIntegratedFlow(kFALSE,"NONAME"); // OK tested (just still nEvts and AvM)
-
- // print the final results for 'no-name' integrated flow with weights:
- if(fUseWeights) this->PrintFinalResultsForIntegratedFlow(fUseWeights,"NONAME"); // OK tested (just still nEvts and AvM)
-
- // print the final results for RPs integrated flow without weights:
- this->PrintFinalResultsForIntegratedFlow(kFALSE,"RP");
-
- // print the final results for RPs integrated flow with weights:
- if(fUseWeights) this->PrintFinalResultsForIntegratedFlow(kTRUE,"RP");
-
- // print the final results for POIs integrated flow without weights:
- this->PrintFinalResultsForIntegratedFlow(kFALSE,"POI");
-
- // print the final results for POIs integrated flow with weights:
- if(fUseWeights) this->PrintFinalResultsForIntegratedFlow(kTRUE,"POI");
-
- //this->TempDeleteMe();
-
-} // end of AliFlowAnalysisWithQCumulants::Finish()
-
-
-//================================================================================================================================
-
-
-TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) const
-{
- // project 2D profile onto pt axis to get 1D profile
-
- Int_t nBinsPt = profilePtEta->GetNbinsX();
- Double_t dPtMin = (profilePtEta->GetXaxis())->GetXmin();
- Double_t dPtMax = (profilePtEta->GetXaxis())->GetXmax();
-
- Int_t nBinsEta = profilePtEta->GetNbinsY();
-
- TProfile *profilePt = new TProfile("","",nBinsPt,dPtMin,dPtMax);
-
- for(Int_t p=1;p<=nBinsPt;p++)
- {
- Double_t contentPt = 0.;
- Double_t entryPt = 0.;
- for(Int_t e=1;e<=nBinsEta;e++)
- {
- contentPt += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e)))
- * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)));
- entryPt += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)));
- }
- profilePt->SetBinContent(p,contentPt);
- profilePt->SetBinEntries(p,entryPt);
- }
-
- return profilePt;
-
-} // end of TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta)
-
-
-//================================================================================================================================
-
-
-TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) const
-{
- // project 2D profile onto eta axis to get 1D profile
-
- Int_t nBinsEta = profilePtEta->GetNbinsY();
- Double_t dEtaMin = (profilePtEta->GetYaxis())->GetXmin();
- Double_t dEtaMax = (profilePtEta->GetYaxis())->GetXmax();
-
- Int_t nBinsPt = profilePtEta->GetNbinsX();
-
- TProfile *profileEta = new TProfile("","",nBinsEta,dEtaMin,dEtaMax);
-
- for(Int_t e=1;e<=nBinsEta;e++)
- {
- Double_t contentEta = 0.;
- Double_t entryEta = 0.;
- for(Int_t p=1;p<=nBinsPt;p++)
- {
- contentEta += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e)))
- * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)));
- entryEta += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)));
- }
- profileEta->SetBinContent(e,contentEta);
- profileEta->SetBinEntries(e,entryEta);
- }
-
- return profileEta;
-
-} // end of TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta)
-
-
-//================================================================================================================================
-
-
-void AliFlowAnalysisWithQCumulants::CalculateFinalCorrectionsForNonUniformAcceptance(Bool_t useWeights)
-{
- // final corrections for non-uniform acceptance for QC{2}, QC{4}, QC{6} and QC{8}
-
- // 2-, 4-, 6- and 8-particle azimuthal correlation (not corrected for bias from non-uniform accaptance!):
- Double_t two = 0.; // <<2>>_{n|n}
- Double_t four = 0.; // <<4>>_{n,n|n,n}
- Double_t six = 0.; // <<6>>_{n,n,n|n,n,n}
- Double_t eight = 0.; // <<8>>_{n,n,n,n|n,n,n,n}
-
- if(!(useWeights))
- {
- // measured multi-particle correlations:
- two = fQCorrelations->GetBinContent(1);
- four = fQCorrelations->GetBinContent(11);
- six = fQCorrelations->GetBinContent(24);
- eight = fQCorrelations->GetBinContent(31);
- }
-
- // corrections for non-uniform acceptance for QC{2}, QC{4}, QC{6} and QC{8}
- Double_t twoCorrection = 0.; // bias to QC{2} coming from non-uniform acceptance of the detector
- Double_t fourCorrection = 0.; // bias to QC{4} coming from non-uniform acceptance of the detector
- //Double_t sixCorrection = 0.; // bias to QC{6} coming from non-uniform acceptance of the detector
- //Double_t eightCorrection = 0.; // bias to QC{8} coming from non-uniform acceptance of the detector
-
- if(fQCorrectionsCos && fQCorrectionsCos && fFinalCorrectionsForNUA)
- {
- // correction to QC{2}:
- Double_t twoCorrection1stTerm = pow(fQCorrectionsCos->GetBinContent(1),2); // <<cos(n*phi1)>>^2
- Double_t twoCorrection2ndTerm = pow(fQCorrectionsSin->GetBinContent(1),2); // <<sin(n*phi1)>>^2
- // final correction to QC{2}:
- twoCorrection = twoCorrection1stTerm + twoCorrection2ndTerm;
- // store final correction to QC{2}:
- fFinalCorrectionsForNUA->SetBinContent(1,twoCorrection);
-
- cout<<"Quantifying corrections for non-uniform acceptance for QC:"<<endl;
- cout<<endl;
-
- if(two-twoCorrection)
- {
- cout<<" QC{2,biased}/QC{2,corrected} = "<<two/(two-twoCorrection)<<endl;
- } else
- {
- cout<<" QC{2,corrected} = 0"<<endl;
- }
-
- // correction to QC{4}:
- Double_t fourCorrection1stTerm = fQCorrectionsCos->GetBinContent(1)
- * fQCorrectionsCos->GetBinContent(3); // <<cos(n*phi1)>><<cos(n*(phi1-phi2-phi3))>>
- Double_t fourCorrection2ndTerm = fQCorrectionsSin->GetBinContent(1)
- * fQCorrectionsSin->GetBinContent(3); // <<sin(n*phi1)>><<sin(n*(phi1-phi2-phi3))>>
- Double_t fourCorrection3rdTerm = pow(fQCorrectionsCos->GetBinContent(2),2); // <<cos(n*(phi1+phi2))>>^2
- Double_t fourCorrection4thTerm = pow(fQCorrectionsSin->GetBinContent(2),2); // <<sin(n*(phi1+phi2))>>^2
- Double_t fourCorrection5thTerm = fQCorrectionsCos->GetBinContent(2)
- * (pow(fQCorrectionsCos->GetBinContent(1),2)
- - pow(fQCorrectionsSin->GetBinContent(1),2)); // <<cos(n*(phi1+phi2))>>(<<cos(n*phi1)>>^2+<<sin(n*phi1)>>^2)
- Double_t fourCorrection6thTerm = fQCorrectionsSin->GetBinContent(2)
- * fQCorrectionsCos->GetBinContent(1)
- * fQCorrectionsSin->GetBinContent(1); // <<sin(n*(phi1+phi2))>><<cos(n*phi1)>><<sin(n*phi1)>>
- Double_t fourCorrection7thTerm = two*(pow(fQCorrectionsCos->GetBinContent(1),2)
- + pow(fQCorrectionsSin->GetBinContent(1),2)); // <<cos(n*(phi1-phi2))>>(<<cos(n*phi1)>>^2+<<sin(n*phi1)>>^2)
- Double_t fourCorrection8thTerm = pow(pow(fQCorrectionsCos->GetBinContent(1),2)
- + pow(fQCorrectionsSin->GetBinContent(1),2),2); // (<<cos(n*phi1)>>^2+<<sin(n*phi1)>>^2)^2
- // final correction to QC{4}:
- fourCorrection = 4.*fourCorrection1stTerm-4.*fourCorrection2ndTerm
- + fourCorrection3rdTerm+fourCorrection4thTerm
- - 4.*fourCorrection5thTerm-8.*fourCorrection6thTerm
- - 8.*fourCorrection7thTerm+6.*fourCorrection8thTerm;
- // store final correction to QC{4}:
- fFinalCorrectionsForNUA->SetBinContent(2,fourCorrection);
-
- if(four-2.*pow(two,2.)-fourCorrection)
- {
- cout<<" QC{4,biased}/QC{4,corrected} = "<<(four-2.*pow(two,2.))/(four-2.*pow(two,2.)-fourCorrection)<<endl;
- } else
- {
- cout<<" QC{4,corrected} = 0"<<endl;
- }
-
- } else
+/*************************************************************************\r
+* Copyright(c) 1998-2008, ALICE Experiment at CERN, All rights reserved. *\r
+* *\r
+* Author: The ALICE Off-line Project. *\r
+* Contributors are mentioned in the code where appropriate. *\r
+* *\r
+* Permission to use, copy, modify and distribute this software and its *\r
+* documentation strictly for non-commercial purposes is hereby granted *\r
+* without fee, provided that the above copyright notice appears in all *\r
+* copies and that both the copyright notice and this permission notice *\r
+* appear in the supporting documentation. The authors make no claims *\r
+* about the suitability of this software for any purpose. It is *\r
+* provided "as is" without express or implied warranty. * \r
+**************************************************************************/\r
+\r
+/********************************** \r
+ * flow analysis with Q-cumulants * \r
+ * * \r
+ * author: Ante Bilandzic * \r
+ * (anteb@nikhef.nl) *\r
+ *********************************/ \r
+\r
+#define AliFlowAnalysisWithQCumulants_cxx\r
+\r
+#include "Riostream.h"\r
+#include "AliFlowCommonConstants.h"\r
+#include "AliFlowCommonHist.h"\r
+#include "AliFlowCommonHistResults.h"\r
+#include "TChain.h"\r
+\r
+#include "TFile.h"\r
+#include "TList.h"\r
+#include "TGraph.h"\r
+#include "TParticle.h"\r
+#include "TRandom3.h"\r
+#include "TStyle.h"\r
+#include "TProfile.h"\r
+#include "TProfile2D.h" \r
+#include "TProfile3D.h"\r
+#include "TMath.h"\r
+#include "TArrow.h"\r
+#include "TPaveLabel.h"\r
+#include "TCanvas.h"\r
+#include "AliFlowEventSimple.h"\r
+#include "AliFlowTrackSimple.h"\r
+#include "AliFlowAnalysisWithQCumulants.h"\r
+#include "TArrayD.h"\r
+#include "TRandom.h"\r
+#include "TF1.h"\r
+\r
+class TH1;\r
+class TH2;\r
+class TGraph;\r
+class TPave;\r
+class TLatex;\r
+class TMarker;\r
+class TRandom3;\r
+class TObjArray;\r
+class TList;\r
+class TCanvas;\r
+class TSystem;\r
+class TROOT;\r
+class AliFlowVector;\r
+class TVector;\r
+\r
+\r
+//================================================================================================================\r
+\r
+\r
+ClassImp(AliFlowAnalysisWithQCumulants)\r
+\r
+AliFlowAnalysisWithQCumulants::AliFlowAnalysisWithQCumulants(): \r
+ // 0.) base:\r
+ fHistList(NULL),\r
+ // 1.) common:\r
+ fCommonHists(NULL),\r
+ fCommonHists2nd(NULL), \r
+ fCommonHists4th(NULL),\r
+ fCommonHists6th(NULL),\r
+ fCommonHists8th(NULL),\r
+ fCommonHistsResults2nd(NULL),\r
+ fCommonHistsResults4th(NULL),\r
+ fCommonHistsResults6th(NULL),\r
+ fCommonHistsResults8th(NULL),\r
+ fnBinsPhi(0),\r
+ fPhiMin(0),\r
+ fPhiMax(0),\r
+ fPhiBinWidth(0),\r
+ fnBinsPt(0),\r
+ fPtMin(0),\r
+ fPtMax(0),\r
+ fPtBinWidth(0),\r
+ fnBinsEta(0),\r
+ fEtaMin(0),\r
+ fEtaMax(0),\r
+ fEtaBinWidth(0),\r
+ fHarmonic(2),\r
+ fAnalysisLabel(NULL),\r
+ // 2a.) particle weights:\r
+ fWeightsList(NULL),\r
+ fUsePhiWeights(kFALSE),\r
+ fUsePtWeights(kFALSE),\r
+ fUseEtaWeights(kFALSE),\r
+ fUseParticleWeights(NULL),\r
+ fPhiWeights(NULL),\r
+ fPtWeights(NULL),\r
+ fEtaWeights(NULL),\r
+ // 2b.) event weights:\r
+ fMultiplicityWeight(NULL),\r
+ // 3.) integrated flow:\r
+ fIntFlowList(NULL), \r
+ fIntFlowProfiles(NULL),\r
+ fIntFlowResults(NULL),\r
+ fIntFlowFlags(NULL),\r
+ fApplyCorrectionForNUA(kTRUE), \r
+ fReQ(NULL),\r
+ fImQ(NULL),\r
+ fSMpk(NULL),\r
+ fIntFlowCorrelationsEBE(NULL),\r
+ fIntFlowEventWeightsForCorrelationsEBE(NULL),\r
+ fIntFlowCorrelationsAllEBE(NULL),\r
+ fAvMultiplicity(NULL),\r
+ fIntFlowCorrelationsPro(NULL),\r
+ fIntFlowCorrelationsAllPro(NULL),\r
+ fIntFlowExtraCorrelationsPro(NULL),\r
+ fIntFlowProductOfCorrelationsPro(NULL),\r
+ fIntFlowCorrelationsHist(NULL),\r
+ fIntFlowCorrelationsAllHist(NULL),\r
+ fIntFlowCovariances(NULL),\r
+ fIntFlowSumOfProductOfEventWeights(NULL),\r
+ fIntFlowQcumulants(NULL),\r
+ fIntFlow(NULL),\r
+ // 4.) differential flow:\r
+ fDiffFlowList(NULL),\r
+ fDiffFlowProfiles(NULL),\r
+ fDiffFlowResults(NULL),\r
+ fDiffFlowFlags(NULL),\r
+ fCalculate2DFlow(kFALSE),\r
+ // 5.) distributions:\r
+ fDistributionsList(NULL),
+ fDistributionsFlags(NULL),
+ fStoreDistributions(kFALSE),\r
+ // x.) debugging and cross-checking:\r
+ fNestedLoopsList(NULL),\r
+ fEvaluateIntFlowNestedLoops(kFALSE),\r
+ fEvaluateDiffFlowNestedLoops(kFALSE),\r
+ fMaxAllowedMultiplicity(10),\r
+ fEvaluateNestedLoops(NULL),\r
+ fIntFlowDirectCorrelations(NULL),\r
+ fIntFlowExtraDirectCorrelations(NULL),\r
+ fCrossCheckInPtBinNo(10),\r
+ fCrossCheckInEtaBinNo(20)\r
+ {\r
+ // constructor \r
+ \r
+ // base list to hold all output objects:\r
+ fHistList = new TList();\r
+ fHistList->SetName("cobjQC");\r
+ fHistList->SetOwner(kTRUE);\r
+ \r
+ // list to hold histograms with phi, pt and eta weights: \r
+ fWeightsList = new TList();\r
+ \r
+ // multiplicity weight:\r
+ fMultiplicityWeight = new TString("combinations");\r
+ \r
+ // analysis label;\r
+ fAnalysisLabel = new TString();\r
+ \r
+ // initialize all arrays: \r
+ this->InitializeArraysForIntFlow();\r
+ this->InitializeArraysForDiffFlow();\r
+ this->InitializeArraysForDistributions();\r
+ this->InitializeArraysForNestedLoops();\r
+ \r
+ } // end of constructor\r
+ \r
+\r
+//================================================================================================================ \r
+\r
+\r
+AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants()\r
+{\r
+ // destructor\r
+ \r
+ delete fHistList;\r
+\r
+} // end of AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants()\r
+\r
+\r
+//================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::Init()\r
+{\r
+ // a) Access all common constants;\r
+ // b) Book all objects;\r
+ // c) Store flags for integrated and differential flow;
+ // d) Store flags for distributions of corelations;\r
+ // e) Store harmonic which will be estimated.\r
+ \r
+ // a) Access all common constants:\r
+ this->AccessConstants();\r
+ \r
+ // b) Book all objects:\r
+ this->BookAndFillWeightsHistograms();\r
+ this->BookAndNestAllLists();\r
+ this->BookCommonHistograms();\r
+ this->BookEverythingForIntegratedFlow(); \r
+ this->BookEverythingForDifferentialFlow(); \r
+ this->BookEverythingForDistributions();\r
+ this->BookEverythingForNestedLoops();\r
+ \r
+ // c) Store flags for integrated and differential flow:\r
+ this->StoreIntFlowFlags();\r
+ this->StoreDiffFlowFlags();\r
+
+ // d) Store flags for distributions of corelations:\r
+ this->StoreFlagsForDistributions();\r
+\r
+ // e) Store harmonic which will be estimated:\r
+ this->StoreHarmonic();\r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::Init()\r
+\r
+\r
+//================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent)\r
+{\r
+ // Running over data only in this method.\r
+ \r
+ // a) Fill the common control histograms and call the method to fill fAvMultiplicity;\r
+ // b) Loop over data and calculate e-b-e quantities;\r
+ // c) Call all the methods;\r
+ // d) Debugging and cross-checking (evaluate nested loops);\r
+ // e) Reset all event by event quantities. \r
+ \r
+ Double_t dPhi = 0.; // azimuthal angle in the laboratory frame\r
+ Double_t dPt = 0.; // transverse momentum\r
+ Double_t dEta = 0.; // pseudorapidity\r
+\r
+ Double_t wPhi = 1.; // phi weight\r
+ Double_t wPt = 1.; // pt weight\r
+ Double_t wEta = 1.; // eta weight\r
+ \r
+ Int_t nRP = anEvent->GetEventNSelTracksRP(); // number of RPs (i.e. number of particles used to determine the reaction plane)\r
+ \r
+ // a) Fill the common control histograms and call the method to fill fAvMultiplicity:\r
+ this->FillCommonControlHistograms(anEvent); \r
+ this->FillAverageMultiplicities(nRP); \r
+ \r
+ // b) Loop over data and calculate e-b-e quantities:\r
+ Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = total number of primary tracks, i.e. nPrim = nRP + nPOI + rest, where:\r
+ // nRP = # of particles used to determine the reaction plane;\r
+ // nPOI = # of particles of interest for a detailed flow analysis;\r
+ // rest = # of particles which are not niether RPs nor POIs. \r
+ \r
+ AliFlowTrackSimple *aftsTrack = NULL;\r
+ \r
+ for(Int_t i=0;i<nPrim;i++) \r
+ { \r
+ aftsTrack=anEvent->GetTrack(i);\r
+ if(aftsTrack)\r
+ {\r
+ if(!(aftsTrack->InRPSelection() || aftsTrack->InPOISelection())) continue; // consider only tracks which are RPs or POIs\r
+ Int_t n = fHarmonic; // shortcut for the harmonic\r
+ if(aftsTrack->InRPSelection()) // RP condition:\r
+ { \r
+ dPhi = aftsTrack->Phi();\r
+ dPt = aftsTrack->Pt();\r
+ dEta = aftsTrack->Eta();\r
+ if(fUsePhiWeights && fPhiWeights && fnBinsPhi) // determine phi weight for this particle:\r
+ {\r
+ wPhi = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(dPhi*fnBinsPhi/TMath::TwoPi())));\r
+ }\r
+ if(fUsePtWeights && fPtWeights && fnBinsPt) // determine pt weight for this particle:\r
+ {\r
+ wPt = fPtWeights->GetBinContent(1+(Int_t)(TMath::Floor((dPt-fPtMin)/fPtBinWidth))); \r
+ } \r
+ if(fUseEtaWeights && fEtaWeights && fEtaBinWidth) // determine eta weight for this particle: \r
+ {\r
+ wEta = fEtaWeights->GetBinContent(1+(Int_t)(TMath::Floor((dEta-fEtaMin)/fEtaBinWidth))); \r
+ } \r
+ \r
+ // integrated flow: \r
+ // calculate Re[Q_{m*n,k}] and Im[Q_{m*n,k}], m = 1,2,3,4, for this event:\r
+ for(Int_t m=0;m<4;m++)\r
+ {\r
+ for(Int_t k=0;k<9;k++)\r
+ {\r
+ (*fReQ)(m,k)+=pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1)*n*dPhi); \r
+ (*fImQ)(m,k)+=pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1)*n*dPhi); \r
+ } \r
+ }\r
+ // calculate S^{M}_{p,k} for this event \r
+ // Remark: final calculation of S^{M}_{p,k} follows after the loop over data bellow:\r
+ for(Int_t p=0;p<8;p++)\r
+ {\r
+ for(Int_t k=0;k<9;k++)\r
+ { \r
+ (*fSMpk)(p,k)+=pow(wPhi*wPt*wEta,k);\r
+ }\r
+ } \r
+ \r
+ // differential flow:\r
+ // 1D (pt):\r
+ // (r_{m*m,k}(pt)): \r
+ for(Int_t m=0;m<4;m++)\r
+ {\r
+ for(Int_t k=0;k<9;k++)\r
+ {\r
+ fReRPQ1dEBE[0][0][m][k]->Fill(dPt,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.);\r
+ fImRPQ1dEBE[0][0][m][k]->Fill(dPt,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.);\r
+ }\r
+ }\r
+ \r
+ // s_{k}(pt) for RPs // to be improved (clarified)\r
+ // Remark: final calculation of s_{p,k}(pt) follows after the loop over data bellow:\r
+ for(Int_t k=0;k<9;k++)\r
+ {\r
+ fs1dEBE[0][0][k]->Fill(dPt,pow(wPhi*wPt*wEta,k),1.);\r
+ }\r
+ // 1D (eta):\r
+ // (r_{m*m,k}(eta)): \r
+ for(Int_t m=0;m<4;m++)\r
+ {\r
+ for(Int_t k=0;k<9;k++)\r
+ {\r
+ fReRPQ1dEBE[0][1][m][k]->Fill(dEta,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.);\r
+ fImRPQ1dEBE[0][1][m][k]->Fill(dEta,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.);\r
+ }\r
+ } \r
+ // s_{k}(eta) for RPs // to be improved (clarified)\r
+ // Remark: final calculation of s_{p,k}(eta) follows after the loop over data bellow:\r
+ for(Int_t k=0;k<9;k++)\r
+ {\r
+ fs1dEBE[0][1][k]->Fill(dEta,pow(wPhi*wPt*wEta,k),1.);\r
+ }\r
+ \r
+ \r
+ \r
+ /*\r
+ // 2D (pt,eta):\r
+ if(fCalculate2DFlow)\r
+ {\r
+ // (r_{m*m,k}(pt,eta)): \r
+ for(Int_t m=0;m<4;m++)\r
+ {\r
+ for(Int_t k=0;k<9;k++)\r
+ {\r
+ fReRPQ2dEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.);\r
+ fImRPQ2dEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.);\r
+ }\r
+ } \r
+ // s_{k}(pt,eta) for RPs // to be improved (clarified)\r
+ // Remark: final calculation of s_{p,k}(pt,eta) follows after the loop over data bellow:\r
+ for(Int_t k=0;k<9;k++)\r
+ {\r
+ fs2dEBE[0][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k),1.);\r
+ }\r
+ } // end of if(fCalculate2DFlow) \r
+ */ \r
+ \r
+ \r
+ \r
+ if(aftsTrack->InPOISelection())\r
+ {\r
+ // 1D (pt): \r
+ // (q_{m*m,k}(pt)): \r
+ for(Int_t m=0;m<4;m++)\r
+ {\r
+ for(Int_t k=0;k<9;k++)\r
+ {\r
+ fReRPQ1dEBE[2][0][m][k]->Fill(dPt,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.);\r
+ fImRPQ1dEBE[2][0][m][k]->Fill(dPt,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.);\r
+ }\r
+ } \r
+ // s_{k}(pt) for RP&&POIs // to be improved (clarified)\r
+ // Remark: final calculation of s_{p,k}(pt,eta) follows after the loop over data bellow:\r
+ for(Int_t k=0;k<9;k++)\r
+ {\r
+ fs1dEBE[2][0][k]->Fill(dPt,pow(wPhi*wPt*wEta,k),1.);\r
+ }\r
+ // 1D (eta): \r
+ // (q_{m*m,k}(eta)): \r
+ for(Int_t m=0;m<4;m++)\r
+ {\r
+ for(Int_t k=0;k<9;k++)\r
+ {\r
+ fReRPQ1dEBE[2][1][m][k]->Fill(dEta,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.);\r
+ fImRPQ1dEBE[2][1][m][k]->Fill(dEta,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.);\r
+ }\r
+ } \r
+ // s_{k}(eta) for RP&&POIs // to be improved (clarified)\r
+ // Remark: final calculation of s_{p,k}(pt,eta) follows after the loop over data bellow:\r
+ for(Int_t k=0;k<9;k++)\r
+ {\r
+ fs1dEBE[2][1][k]->Fill(dEta,pow(wPhi*wPt*wEta,k),1.);\r
+ }\r
+ \r
+ /*\r
+ // 2D (pt,eta) \r
+ if(fCalculate2DFlow)\r
+ {\r
+ // (q_{m*m,k}(pt,eta)): \r
+ for(Int_t m=0;m<4;m++)\r
+ {\r
+ for(Int_t k=0;k<9;k++)\r
+ {\r
+ fReRPQ2dEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Cos((m+1.)*n*dPhi),1.);\r
+ fImRPQ2dEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k)*TMath::Sin((m+1.)*n*dPhi),1.);\r
+ }\r
+ } \r
+ // s_{k}(pt,eta) for RP&&POIs // to be improved (clarified)\r
+ // Remark: final calculation of s_{p,k}(pt,eta) follows after the loop over data bellow:\r
+ for(Int_t k=0;k<9;k++)\r
+ {\r
+ fs2dEBE[2][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta,k),1.);\r
+ }\r
+ } // end of if(fCalculate2DFlow) \r
+ */\r
+ \r
+ } // end of if(aftsTrack->InPOISelection())\r
+ \r
+\r
+ \r
+ } // end of if(pTrack->InRPSelection())\r
+\r
+ \r
+ \r
+ if(aftsTrack->InPOISelection())\r
+ {\r
+ dPhi = aftsTrack->Phi();\r
+ dPt = aftsTrack->Pt();\r
+ dEta = aftsTrack->Eta();\r
+ \r
+ // 1D (pt)\r
+ // p_n(m*n,0): \r
+ for(Int_t m=0;m<4;m++)\r
+ {\r
+ fReRPQ1dEBE[1][0][m][0]->Fill(dPt,TMath::Cos((m+1.)*n*dPhi),1.);\r
+ fImRPQ1dEBE[1][0][m][0]->Fill(dPt,TMath::Sin((m+1.)*n*dPhi),1.);\r
+ }\r
+ // 1D (eta)\r
+ // p_n(m*n,0): \r
+ for(Int_t m=0;m<4;m++)\r
+ {\r
+ fReRPQ1dEBE[1][1][m][0]->Fill(dEta,TMath::Cos((m+1.)*n*dPhi),1.);\r
+ fImRPQ1dEBE[1][1][m][0]->Fill(dEta,TMath::Sin((m+1.)*n*dPhi),1.);\r
+ }\r
+ \r
+ \r
+ /*\r
+ // 2D (pt,eta):\r
+ if(fCalculate2DFlow)\r
+ { \r
+ // p_n(m*n,0): \r
+ for(Int_t m=0;m<4;m++)\r
+ {\r
+ fReRPQ2dEBE[1][m][0]->Fill(dPt,dEta,TMath::Cos((m+1.)*n*dPhi),1.);\r
+ fImRPQ2dEBE[1][m][0]->Fill(dPt,dEta,TMath::Sin((m+1.)*n*dPhi),1.);\r
+ }\r
+ } // end of if(fCalculate2DFlow) \r
+ */\r
+ \r
+ \r
+ } // end of if(pTrack->InPOISelection() ) \r
+ \r
+ \r
+ } else // to if(aftsTrack)\r
+ {\r
+ cout<<endl;\r
+ cout<<" WARNING: no particle! (i.e. aftsTrack is a NULL pointer in AFAWQC::Make().)"<<endl;\r
+ cout<<endl; \r
+ }\r
+ } // end of for(Int_t i=0;i<nPrim;i++) \r
+\r
+ // calculate the final expressions for S^{M}_{p,k}:\r
+ for(Int_t p=0;p<8;p++)\r
+ {\r
+ for(Int_t k=0;k<9;k++)\r
+ {\r
+ (*fSMpk)(p,k)=pow((*fSMpk)(p,k),p+1);\r
+ } \r
+ } \r
+ \r
+ // *****************************\r
+ // **** CALL THE METHODS *******\r
+ // *****************************\r
+ // integrated flow:\r
+ if(!fEvaluateIntFlowNestedLoops)\r
+ {\r
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
+ {\r
+ if(nRP>1) this->CalculateIntFlowCorrelations(); // without using particle weights\r
+ } else \r
+ {\r
+ if(nRP>1) this->CalculateIntFlowCorrelationsUsingParticleWeights(); // with using particle weights \r
+ } \r
+ \r
+ if(nRP>3) this->CalculateIntFlowProductOfCorrelations();\r
+ if(nRP>1) this->CalculateIntFlowSumOfEventWeights();\r
+ if(nRP>1) this->CalculateIntFlowSumOfProductOfEventWeights();\r
+ if(fApplyCorrectionForNUA)\r
+ {\r
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))
{
- cout<<"WARNING: fQCorrectionsCos, fQCorrectionsCos or fFinalCorrectionsForNUA is NULL in QC::CFCFNUA !!!!"<<endl;
- cout<<" Corrections for non-uniform acceptance were not calculated. "<<endl;
- }
-
-} // end of AliFlowAnalysisWithQCumulants::CalculateFinalCorrectionsForNonUniformAcceptance(Bool_t useWeights)
-
-
-//================================================================================================================================
-
-
-void AliFlowAnalysisWithQCumulants::CalculateFinalResultsForNoNameIntegratedFlow(Bool_t useWeights)
-{
- // calculate final results for 'no-name' integrated flow
-
- // 2-, 4-, 6- and 8-particle azimuthal correlation:
- Double_t two = 0.; // <<2>>_{n|n}
- Double_t four = 0.; // <<4>>_{n,n|n,n}
- Double_t six = 0.; // <<6>>_{n,n,n|n,n,n}
- Double_t eight = 0.; // <<8>>_{n,n,n,n|n,n,n,n}
-
- if(!(useWeights))
- {
- // measured multi-particle correlations:
- two = fQCorrelations->GetBinContent(1);
- four = fQCorrelations->GetBinContent(11);
- six = fQCorrelations->GetBinContent(24);
- eight = fQCorrelations->GetBinContent(31);
- }
-
- if(useWeights)
- {
- two = fQCorrelationsW->GetBinContent(1);
- four = fQCorrelationsW->GetBinContent(41);
- six = fQCorrelationsW->GetBinContent(81);
- eight = fQCorrelationsW->GetBinContent(121);
- }
-
- // 2nd, 4th, 6th and 8th order Q-cumulant:
- Double_t secondOrderQCumulant = two; // c_n{2}
- Double_t fourthOrderQCumulant = four-2.*pow(two,2.); // c_n{4}
- Double_t sixthOrderQCumulant = six-9.*two*four+12.*pow(two,3.); // c_n{6}
- Double_t eightOrderQCumulant = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.); // c_n{8}
-
- // corrections for non-uniform acceptance for QC{2}, QC{4}, QC{6} and QC{8}
- Double_t twoCorrection = 0.;
- Double_t fourCorrection = 0.;
- //Double_t sixCorrection = 0.;
- //Double_t eightCorrection = 0.;
- if(fFinalCorrectionsForNUA)
- {
- twoCorrection = fFinalCorrectionsForNUA->GetBinContent(1); // bias to QC{2} coming from non-uniform acceptance of the detector
- fourCorrection = fFinalCorrectionsForNUA->GetBinContent(2); // bias to QC{4} coming from non-uniform acceptance of the detector
- // sixCorrection = fFinalCorrectionsForNUA->GetBinContent(3); // bias to QC{6} coming from non-uniform acceptance of the detector
- // eightCorrection = fFinalCorrectionsForNUA->GetBinContent(4); // bias to QC{8} coming from non-uniform acceptance of the detector
- }
-
- // applying the corrections for non-uniform acceptance:
- secondOrderQCumulant = secondOrderQCumulant - twoCorrection;
- fourthOrderQCumulant = fourthOrderQCumulant - fourCorrection;
- //sixthOrderQCumulant = sixthOrderQCumulant - sixCorrection;
- //eightOrderQCumulant = eightOrderQCumulant - eightCorrection;
-
- if(useWeights) sixthOrderQCumulant = 0.; // to be removed (once 6th order with weights is calculated)
- if(useWeights) eightOrderQCumulant = 0.; // to be removed (once 8th order with weights is calculated)
-
- // "no-name" integrated flow estimates from Q-cumulants:
- Double_t dVn2 = 0.,dVn4 = 0.,dVn6 = 0.,dVn8 = 0.;
- // Double_t sd2=0.,sd4=0.,sd6=0.,sd8=0.; // to be improved (errors needed)
- if(secondOrderQCumulant>0.)
- {
- // v_n{2}
- dVn2 = pow(secondOrderQCumulant,0.5);
- if(!(useWeights))
- {
- fIntFlowResultsQC->SetBinContent(1,dVn2);
- fIntFlowResultsQC->SetBinError(1,0.); // to be improved
- }
- if(useWeights)
- {
- fIntFlowResultsQCW->SetBinContent(1,dVn2);
- fIntFlowResultsQCW->SetBinError(1,0.); // to be improved
- }
-
- // fill common histogram:
- fCommonHistsResults2nd->FillIntegratedFlow(dVn2, 0.); // to be improved
-
- }
- if(fourthOrderQCumulant<0.)
- {
- // v_n{4}
- dVn4 = pow(-fourthOrderQCumulant,1./4.);
- if(!(useWeights))
- {
- fIntFlowResultsQC->SetBinContent(2,dVn4);
- fIntFlowResultsQC->SetBinError(2,0.); // to be improved
- }
- if(useWeights)
- {
- fIntFlowResultsQCW->SetBinContent(2,dVn4);
- fIntFlowResultsQCW->SetBinError(2,0.); // to be improved
- }
-
- // fill common histogram:
- fCommonHistsResults4th->FillIntegratedFlow(dVn4, 0.); // to be improved
-
- }
- if(sixthOrderQCumulant>0.)
- {
- // v_n{6}
- dVn6 = pow((1./4.)*sixthOrderQCumulant,1./6.);
- if(!(useWeights))
- {
- fIntFlowResultsQC->SetBinContent(3,dVn6);
- fIntFlowResultsQC->SetBinError(3,0.); // to be improved
- }
- if(useWeights)
- {
- fIntFlowResultsQCW->SetBinContent(3,dVn6);
- fIntFlowResultsQCW->SetBinError(3,0.); // to be improved
- }
-
- // fill common histogram:
- fCommonHistsResults6th->FillIntegratedFlow(dVn6, 0.); // to be improved
-
- }
- if(eightOrderQCumulant<0.)
+ if(nRP>0) this->CalculateIntFlowCorrectionsForNUASinTerms();\r
+ if(nRP>0) this->CalculateIntFlowCorrectionsForNUACosTerms();\r
+ } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))
+ {
+ if(nRP>0) this->CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights();\r
+ if(nRP>0) this->CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights();
+ }
+ } // end of if(fApplyCorrectionForNUA)\r
+ } // end of if(!fEvaluateIntFlowNestedLoops)\r
+\r
+ // differential flow:\r
+ if(!fEvaluateDiffFlowNestedLoops)\r
+ {\r
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
+ {\r
+ // without using particle weights:\r
+ this->CalculateDiffFlowCorrelations("RP","Pt"); \r
+ this->CalculateDiffFlowCorrelations("RP","Eta");\r
+ this->CalculateDiffFlowCorrelations("POI","Pt");\r
+ this->CalculateDiffFlowCorrelations("POI","Eta");
+ if(fApplyCorrectionForNUA)
+ {
+ this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Pt");\r
+ this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Eta");\r
+ this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Pt");\r
+ this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Eta");\r
+ this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Pt");\r
+ this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Eta");\r
+ this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Pt");\r
+ this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Eta");
+ } // end of if(fApplyCorrectionForNUA) \r
+ } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
+ {\r
+ // with using particle weights: \r
+ this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Pt"); \r
+ this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Eta"); \r
+ this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Pt"); \r
+ this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Eta"); \r
+ if(fApplyCorrectionForNUA)
+ {
+ this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Pt");\r
+ this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Eta");\r
+ this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Pt");\r
+ this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Eta");\r
+ this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Pt");\r
+ this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Eta");\r
+ this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Pt");\r
+ this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Eta");
+ } // end of if(fApplyCorrectionForNUA) \r
+ } \r
+
+ // whether or not using particle weights the following is calculated in the same way: \r
+ this->CalculateDiffFlowProductOfCorrelations("RP","Pt");\r
+ this->CalculateDiffFlowProductOfCorrelations("RP","Eta");\r
+ this->CalculateDiffFlowProductOfCorrelations("POI","Pt");\r
+ this->CalculateDiffFlowProductOfCorrelations("POI","Eta");\r
+ this->CalculateDiffFlowSumOfEventWeights("RP","Pt");\r
+ this->CalculateDiffFlowSumOfEventWeights("RP","Eta");\r
+ this->CalculateDiffFlowSumOfEventWeights("POI","Pt");\r
+ this->CalculateDiffFlowSumOfEventWeights("POI","Eta");\r
+ this->CalculateDiffFlowSumOfProductOfEventWeights("RP","Pt");\r
+ this->CalculateDiffFlowSumOfProductOfEventWeights("RP","Eta");\r
+ this->CalculateDiffFlowSumOfProductOfEventWeights("POI","Pt");\r
+ this->CalculateDiffFlowSumOfProductOfEventWeights("POI","Eta"); \r
+ } // end of if(!fEvaluateDiffFlowNestedLoops)\r
+\r
+\r
+ \r
+ // with weights:\r
+ // ... \r
+ \r
+ /*\r
+ // 2D differential flow\r
+ if(fCalculate2DFlow)\r
+ {\r
+ // without weights:\r
+ if(nRP>1) this->CalculateCorrelationsForDifferentialFlow2D("RP");\r
+ if(nRP>1) this->CalculateCorrelationsForDifferentialFlow2D("POI");\r
+ \r
+ // with weights:\r
+ if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)\r
+ {\r
+ if(nRP>1) this->CalculateWeightedCorrelationsForDifferentialFlow2D("RP");\r
+ if(nRP>1) this->CalculateWeightedCorrelationsForDifferentialFlow2D("POI");\r
+ } \r
+ } // end of if(fCalculate2DFlow)\r
+ */\r
+
+ // distributions of correlations:
+ if(fStoreDistributions)
{
- // v_n{8}
- dVn8 = pow((-1./33.)*eightOrderQCumulant,1./8.);
- if(!(useWeights))
- {
- fIntFlowResultsQC->SetBinContent(4,dVn8);
- fIntFlowResultsQC->SetBinError(4,0.); // to be improved
- }
- if(useWeights)
- {
- fIntFlowResultsQCW->SetBinContent(4,dVn8);
- fIntFlowResultsQCW->SetBinError(4,0.); // to be improved
- }
-
- // fill common histogram:
- fCommonHistsResults8th->FillIntegratedFlow(dVn8, 0.); // to be improved
-
+ this->StoreDistributionsOfCorrelations();
}
-
-} // end of AliFlowAnalysisWithQCumulants::CalculateFinalResultsForNoNameIntegratedFlow(Bool_t useWeights)
-
-
-//================================================================================================================================
-
-
-void AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(Bool_t useWeights, TString type)
+ \r
+ // d) Debugging and cross-checking (evaluate nested loops):\r
+ // d1) cross-checking results for integrated flow:\r
+ if(fEvaluateIntFlowNestedLoops)\r
+ {\r
+ if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 \r
+ {\r
+ // without using particle weights:\r
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
+ {\r
+ // correlations:\r
+ this->CalculateIntFlowCorrelations(); // from Q-vectors\r
+ this->EvaluateIntFlowCorrelationsWithNestedLoops(anEvent); // from nested loops (to be improved: do I have to pass here anEvent or not?)\r
+ // correction for non-uniform acceptance:\r
+ this->CalculateIntFlowCorrectionsForNUASinTerms(); // from Q-vectors (sin terms)\r
+ this->CalculateIntFlowCorrectionsForNUACosTerms(); // from Q-vectors (cos terms)\r
+ this->EvaluateIntFlowCorrectionsForNUAWithNestedLoops(anEvent); // from nested loops (both sin and cos terms)\r
+ }\r
+ // using particle weights:\r
+ if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)\r
+ {\r
+ // correlations:\r
+ this->CalculateIntFlowCorrelationsUsingParticleWeights(); // from Q-vectors\r
+ this->EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent); // from nested loops (to be improved: do I have to pass here anEvent or not?)\r
+ // correction for non-uniform acceptance:\r
+ this->CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights(); // from Q-vectors (sin terms)\r
+ this->CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights(); // from Q-vectors (cos terms)\r
+ this->EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(anEvent); // from nested loops (both sin and cos terms)
+ }\r
+ } else if (nPrim>fMaxAllowedMultiplicity) // to if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity)\r
+ {\r
+ cout<<endl;\r
+ cout<<"Skipping the event because multiplicity is "<<nPrim<<". Too high to evaluate nested loops!"<<endl;\r
+ } else\r
+ {\r
+ cout<<endl;\r
+ cout<<"Skipping the event because multiplicity is "<<nPrim<<"."<<endl; \r
+ } \r
+ } // end of if(fEvaluateIntFlowNestedLoops) \r
+ \r
+ // d2) cross-checking results for differential flow:\r
+ if(fEvaluateDiffFlowNestedLoops)\r
+ {\r
+ if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10\r
+ {\r
+ // without using particle weights:\r
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
+ {\r
+ // reduced correlations:\r
+ // Q-vectors:\r
+ this->CalculateDiffFlowCorrelations("RP","Pt");\r
+ this->CalculateDiffFlowCorrelations("RP","Eta");\r
+ this->CalculateDiffFlowCorrelations("POI","Pt");\r
+ this->CalculateDiffFlowCorrelations("POI","Eta");\r
+ // nested loops:\r
+ //this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"RP","Pt"); // to be improved (enabled eventually)\r
+ //this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"RP","Eta"); // to be improved (enabled eventually)\r
+ this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"POI","Pt"); // to be improved (do I need to pass here anEvent?)\r
+ this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"POI","Eta"); // to be improved (do I need to pass here anEvent?)\r
+ // reduced corrections for non-uniform acceptance:\r
+ // Q-vectors:\r
+ this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Pt");\r
+ this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Eta");\r
+ this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Pt");\r
+ this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Eta");\r
+ this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Pt");\r
+ this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Eta");\r
+ this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Pt");\r
+ this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Eta");\r
+ // nested loops:\r
+ //this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"RP","Pt"); // to be improved (enabled eventually)\r
+ //this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"RP","Eta"); // to be improved (enabled eventually)\r
+ this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"POI","Pt"); // to be improved (do I need to pass here anEvent?)\r
+ this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"POI","Eta"); // to be improved (do I need to pass here anEvent?)\r
+ } // end of if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
+ // using particle weights:\r
+ if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)\r
+ {\r
+ this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Pt"); \r
+ this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Eta"); \r
+ this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Pt"); \r
+ this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Eta"); \r
+ this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Pt");\r
+ this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Eta");\r
+ this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Pt");\r
+ this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Eta");\r
+ this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Pt");\r
+ this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Eta");\r
+ this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Pt");\r
+ this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Eta");\r
+ this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"RP","Pt"); // to be improved (enabled eventually)\r
+ this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"RP","Eta"); // to be improved (enabled eventually)\r
+ this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"POI","Pt"); // to be improved (do I need to pass here anEvent?)\r
+ this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"POI","Eta"); // to be improved (do I need to pass here anEvent?)
+ //this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"RP","Pt"); // to be improved (enabled eventually)\r
+ //this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"RP","Eta"); // to be improved (enabled eventually)\r
+ this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"POI","Pt"); // to be improved (do I need to pass here anEvent?)\r
+ this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"POI","Eta"); // to be improved (do I need to pass here anEvent?)\r
+ } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)\r
+ } // end of if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10\r
+ } // end of if(fEvaluateDiffFlowNestedLoops) \r
+ \r
+ // e) Reset all event by event quantities: \r
+ this->ResetEventByEventQuantities();\r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::Finish()\r
+{\r
+ // Calculate the final results.\r
+ // a) acces the constants;\r
+ // b) access the flags;\r
+ // c) calculate the final results for integrated flow (without and with weights);\r
+ // d) store in AliFlowCommonHistResults and print the final results for integrated flow;\r
+ // e) calculate the final results for differential flow (without and with weights);\r
+ // f) print the final results for integrated flow obtained from differential flow (to be improved (terminology));\r
+ // g) cross-check the results: results from Q-vectors vs results from nested loops\r
+ \r
+ // ******************************\r
+ // **** ACCESS THE CONSTANTS ****\r
+ // ******************************\r
+ \r
+ this->AccessConstants(); \r
+ \r
+ if(fCommonHists && fCommonHists->GetHarmonic())\r
+ {\r
+ fHarmonic = (Int_t)(fCommonHists->GetHarmonic())->GetBinContent(1); // to be improved (moved somewhere else)\r
+ } \r
+\r
+ // **************************\r
+ // **** ACCESS THE FLAGS ****\r
+ // ************************** \r
+ fUsePhiWeights = (Int_t)fUseParticleWeights->GetBinContent(1); \r
+ fUsePtWeights = (Int_t)fUseParticleWeights->GetBinContent(2); \r
+ fUseEtaWeights = (Int_t)fUseParticleWeights->GetBinContent(3); \r
+ fApplyCorrectionForNUA = (Int_t)fIntFlowFlags->GetBinContent(3); \r
+ fEvaluateIntFlowNestedLoops = (Int_t)fEvaluateNestedLoops->GetBinContent(1);\r
+ fEvaluateDiffFlowNestedLoops = (Int_t)fEvaluateNestedLoops->GetBinContent(2); \r
+ fCrossCheckInPtBinNo = (Int_t)fEvaluateNestedLoops->GetBinContent(3);\r
+ fCrossCheckInEtaBinNo = (Int_t)fEvaluateNestedLoops->GetBinContent(4); \r
+ \r
+ // *********************************************************\r
+ // **** CALCULATE THE FINAL RESULTS FOR INTEGRATED FLOW ****\r
+ // ********************************************************* \r
+ \r
+ this->FinalizeCorrelationsIntFlow();\r
+ this->CalculateCovariancesIntFlow();\r
+ this->CalculateCumulantsIntFlow();\r
+ this->CalculateIntFlow(); \r
+\r
+ if(fApplyCorrectionForNUA && !(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) // to be improved (reorganized, etc)\r
+ {\r
+ this->FinalizeCorrectionTermsForNUAIntFlow();\r
+ this->CalculateQcumulantsCorrectedForNUAIntFlow(); \r
+ this->CalculateIntFlowCorrectedForNUA(); \r
+ }\r
+ \r
+ // ***************************************************************\r
+ // **** STORE AND PRINT THE FINAL RESULTS FOR INTEGRATED FLOW ****\r
+ // ***************************************************************\r
+ \r
+ this->FillCommonHistResultsIntFlow(); \r
+ \r
+ this->PrintFinalResultsForIntegratedFlow("NONAME"); // to be improved (name)\r
+ \r
+ // ***********************************************************\r
+ // **** CALCULATE THE FINAL RESULTS FOR DIFFERENTIAL FLOW ****\r
+ // *********************************************************** \r
+ \r
+ this->FinalizeReducedCorrelations("RP","Pt"); \r
+ this->FinalizeReducedCorrelations("RP","Eta"); \r
+ this->FinalizeReducedCorrelations("POI","Pt"); \r
+ this->FinalizeReducedCorrelations("POI","Eta");\r
+ this->CalculateDiffFlowCovariances("RP","Pt");\r
+ this->CalculateDiffFlowCovariances("RP","Eta");\r
+ this->CalculateDiffFlowCovariances("POI","Pt");\r
+ this->CalculateDiffFlowCovariances("POI","Eta");\r
+ this->CalculateDiffFlowCumulants("RP","Pt");\r
+ this->CalculateDiffFlowCumulants("RP","Eta");\r
+ this->CalculateDiffFlowCumulants("POI","Pt");\r
+ this->CalculateDiffFlowCumulants("POI","Eta");\r
+ this->CalculateDiffFlow("RP","Pt");\r
+ this->CalculateDiffFlow("RP","Eta");\r
+ this->CalculateDiffFlow("POI","Pt");\r
+ this->CalculateDiffFlow("POI","Eta");\r
+ \r
+ if(fApplyCorrectionForNUA && !(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) // to be improved (reorganized, etc)\r
+ {\r
+ this->FinalizeCorrectionTermsForNUADiffFlow("RP","Pt");\r
+ this->FinalizeCorrectionTermsForNUADiffFlow("RP","Eta");\r
+ this->FinalizeCorrectionTermsForNUADiffFlow("POI","Pt");\r
+ this->FinalizeCorrectionTermsForNUADiffFlow("POI","Eta"); \r
+ this->CalculateDiffFlowCumulantsCorrectedForNUA("RP","Pt"); \r
+ this->CalculateDiffFlowCumulantsCorrectedForNUA("RP","Eta"); \r
+ this->CalculateDiffFlowCumulantsCorrectedForNUA("POI","Pt"); \r
+ this->CalculateDiffFlowCumulantsCorrectedForNUA("POI","Eta"); \r
+ this->CalculateDiffFlowCorrectedForNUA("RP","Pt"); \r
+ this->CalculateDiffFlowCorrectedForNUA("RP","Eta"); \r
+ this->CalculateDiffFlowCorrectedForNUA("POI","Pt"); \r
+ this->CalculateDiffFlowCorrectedForNUA("POI","Eta"); \r
+ }\r
+ \r
+ this->CalculateFinalResultsForRPandPOIIntegratedFlow("RP");\r
+ this->CalculateFinalResultsForRPandPOIIntegratedFlow("POI");\r
+\r
+ // *****************************************************************\r
+ // **** STORE AND PRINT THE FINAL RESULTS FOR DIFFERENTIAL FLOW ****\r
+ // *****************************************************************\r
+ this->FillCommonHistResultsDiffFlow("RP");\r
+ this->FillCommonHistResultsDiffFlow("POI");\r
+\r
+ this->PrintFinalResultsForIntegratedFlow("RP"); \r
+ this->PrintFinalResultsForIntegratedFlow("POI"); \r
+ \r
+ // g) cross-check the results: results from Q-vectors vs results from nested loops\r
+
+ // g1) integrated flow:\r
+ if(fEvaluateIntFlowNestedLoops)\r
+ {\r
+ this->CrossCheckIntFlowCorrelations();\r
+ this->CrossCheckIntFlowCorrectionTermsForNUA(); \r
+ if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) this->CrossCheckIntFlowExtraCorrelations(); \r
+ } // end of if(fEvaluateIntFlowNestedLoops) \r
+
+ // g2) differential flow: \r
+ if(fEvaluateDiffFlowNestedLoops) \r
+ {\r
+ // correlations:\r
+ //this->CrossCheckDiffFlowCorrelations("RP","Pt"); // to be improved (enabled eventually) \r
+ //this->CrossCheckDiffFlowCorrelations("RP","Eta"); // to be improved (enabled eventually) \r
+ this->CrossCheckDiffFlowCorrelations("POI","Pt"); \r
+ this->CrossCheckDiffFlowCorrelations("POI","Eta");\r
+ // correction terms for non-uniform acceptance:\r
+ //this->CrossCheckDiffFlowCorrectionTermsForNUA("RP","Pt"); // to be improved (enabled eventually) \r
+ //this->CrossCheckDiffFlowCorrectionTermsForNUA("RP","Eta"); // to be improved (enabled eventually) \r
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) \r
+ {\r
+ this->CrossCheckDiffFlowCorrectionTermsForNUA("POI","Pt"); \r
+ this->CrossCheckDiffFlowCorrectionTermsForNUA("POI","Eta"); \r
+ } \r
+ } // end of if(fEvaluateDiffFlowNestedLoops)\r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::Finish()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTerms()\r
+{\r
+ // calculate corrections for non-uniform acceptance of the detector for no-name integrated flow (cos terms)\r
+ \r
+ // multiplicity:\r
+ Double_t dMult = (*fSMpk)(0,0);\r
+ \r
+ // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
+ Double_t dReQ1n = (*fReQ)(0,0);\r
+ Double_t dReQ2n = (*fReQ)(1,0);\r
+ //Double_t dReQ3n = (*fReQ)(2,0);\r
+ //Double_t dReQ4n = (*fReQ)(3,0);\r
+ Double_t dImQ1n = (*fImQ)(0,0);\r
+ Double_t dImQ2n = (*fImQ)(1,0);\r
+ //Double_t dImQ3n = (*fImQ)(2,0);\r
+ //Double_t dImQ4n = (*fImQ)(3,0);\r
+ \r
+ // *************************************************************\r
+ // **** corrections for non-uniform acceptance (cos terms): ****\r
+ // *************************************************************\r
+ //\r
+ // Remark 1: corrections for non-uniform acceptance (cos terms) calculated with non-weighted Q-vectors \r
+ // are stored in 1D profile fQCorrectionsCos.\r
+ // Remark 2: binning of fIntFlowCorrectionTermsForNUAPro[1] is organized as follows:\r
+ // --------------------------------------------------------------------------------------------------------------------\r
+ // 1st bin: <<cos(n*(phi1))>> = cosP1n\r
+ // 2nd bin: <<cos(n*(phi1+phi2))>> = cosP1nP1n\r
+ // 3rd bin: <<cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1n\r
+ // ...\r
+ // --------------------------------------------------------------------------------------------------------------------\r
+ \r
+ // 1-particle:\r
+ Double_t cosP1n = 0.; // <<cos(n*(phi1))>>\r
+ \r
+ if(dMult>0)\r
+ {\r
+ cosP1n = dReQ1n/dMult; \r
+ \r
+ // average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for single event:\r
+ fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(1,cosP1n);\r
+ \r
+ // final average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for all events:\r
+ fIntFlowCorrectionTermsForNUAPro[1]->Fill(0.5,cosP1n,dMult); \r
+ } \r
+ \r
+ // 2-particle:\r
+ Double_t cosP1nP1n = 0.; // <<cos(n*(phi1+phi2))>>\r
+ \r
+ if(dMult>1)\r
+ {\r
+ cosP1nP1n = (pow(dReQ1n,2)-pow(dImQ1n,2)-dReQ2n)/(dMult*(dMult-1)); \r
+ \r
+ // average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for single event:\r
+ fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(2,cosP1nP1n);\r
+ \r
+ // final average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for all events:\r
+ fIntFlowCorrectionTermsForNUAPro[1]->Fill(1.5,cosP1nP1n,dMult*(dMult-1)); \r
+ } \r
+ \r
+ // 3-particle:\r
+ Double_t cosP1nM1nM1n = 0.; // <<cos(n*(phi1-phi2-phi3))>>\r
+ \r
+ if(dMult>2)\r
+ {\r
+ cosP1nM1nM1n = (dReQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))-dReQ1n*dReQ2n-dImQ1n*dImQ2n-2.*(dMult-1)*dReQ1n)\r
+ / (dMult*(dMult-1)*(dMult-2)); \r
+ \r
+ // average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for single event:\r
+ fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(3,cosP1nM1nM1n);\r
+ \r
+ // final average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for all events:\r
+ fIntFlowCorrectionTermsForNUAPro[1]->Fill(2.5,cosP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); \r
+ } \r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTerms()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTerms()\r
+{\r
+ // calculate corrections for non-uniform acceptance of the detector for no-name integrated flow (sin terms)\r
+ \r
+ // multiplicity:\r
+ Double_t dMult = (*fSMpk)(0,0);\r
+ \r
+ // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
+ Double_t dReQ1n = (*fReQ)(0,0);\r
+ Double_t dReQ2n = (*fReQ)(1,0);\r
+ //Double_t dReQ3n = (*fReQ)(2,0);\r
+ //Double_t dReQ4n = (*fReQ)(3,0);\r
+ Double_t dImQ1n = (*fImQ)(0,0);\r
+ Double_t dImQ2n = (*fImQ)(1,0);\r
+ //Double_t dImQ3n = (*fImQ)(2,0);\r
+ //Double_t dImQ4n = (*fImQ)(3,0);\r
+ \r
+ // *************************************************************\r
+ // **** corrections for non-uniform acceptance (sin terms): ****\r
+ // *************************************************************\r
+ //\r
+ // Remark 1: corrections for non-uniform acceptance (sin terms) calculated with non-weighted Q-vectors \r
+ // are stored in 1D profile fQCorrectionsSin.\r
+ // Remark 2: binning of fIntFlowCorrectionTermsForNUAPro[0] is organized as follows:\r
+ // --------------------------------------------------------------------------------------------------------------------\r
+ // 1st bin: <<sin(n*(phi1))>> = sinP1n\r
+ // 2nd bin: <<sin(n*(phi1+phi2))>> = sinP1nP1n\r
+ // 3rd bin: <<sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1n\r
+ // ...\r
+ // --------------------------------------------------------------------------------------------------------------------\r
+ \r
+ // 1-particle:\r
+ Double_t sinP1n = 0.; // <sin(n*(phi1))>\r
+ \r
+ if(dMult>0)\r
+ {\r
+ sinP1n = dImQ1n/dMult; \r
+ \r
+ // average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for single event:\r
+ fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(1,sinP1n);\r
+ \r
+ // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: \r
+ fIntFlowCorrectionTermsForNUAPro[0]->Fill(0.5,sinP1n,dMult); \r
+ } \r
+ \r
+ // 2-particle:\r
+ Double_t sinP1nP1n = 0.; // <<sin(n*(phi1+phi2))>>\r
+ \r
+ if(dMult>1)\r
+ {\r
+ sinP1nP1n = (2.*dReQ1n*dImQ1n-dImQ2n)/(dMult*(dMult-1)); \r
+ \r
+ // average non-weighted 2-particle correction (sin terms) for non-uniform acceptance for single event:\r
+ fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(2,sinP1nP1n);\r
+ \r
+ // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: \r
+ fIntFlowCorrectionTermsForNUAPro[0]->Fill(1.5,sinP1nP1n,dMult*(dMult-1)); \r
+ } \r
+ \r
+ // 3-particle:\r
+ Double_t sinP1nM1nM1n = 0.; // <<sin(n*(phi1-phi2-phi3))>>\r
+ \r
+ if(dMult>2)\r
+ {\r
+ sinP1nM1nM1n = (-dImQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))+dReQ1n*dImQ2n-dImQ1n*dReQ2n+2.*(dMult-1)*dImQ1n)\r
+ / (dMult*(dMult-1)*(dMult-2)); \r
+ \r
+ // average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for single event:\r
+ fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(3,sinP1nM1nM1n);\r
+ \r
+ // final average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for all events: \r
+ fIntFlowCorrectionTermsForNUAPro[0]->Fill(2.5,sinP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); \r
+ } \r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTerms()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos)\r
+{\r
+ // a) Get pointers for common control and common result histograms and profiles.\r
+ // b) Get pointers for histograms with particle weights.\r
+ // c) Get pointers for histograms and profiles relevant for integrated flow.\r
+ // d) Get pointers for histograms and profiles relevant for differental flow.\r
+ // e) Get pointers for histograms and profiles holding results obtained with nested loops.\r
+ \r
+ if(outputListHistos)\r
+ { \r
+ this->GetPointersForCommonHistograms(outputListHistos); // to be improved (no need to pass here argument, use setter for base list instead)\r
+ this->GetPointersForParticleWeightsHistograms(outputListHistos); // to be improved (no need to pass here argument, use setter for base list instead)\r
+ this->GetPointersForIntFlowHistograms(outputListHistos); // to be improved (no need to pass here argument, use setter for base list instead)\r
+ this->GetPointersForDiffFlowHistograms(outputListHistos); // to be improved (no need to pass here argument, use setter for base list instead)\r
+ this->GetPointersForNestedLoopsHistograms(outputListHistos); // to be improved (no need to pass here argument, use setter for base list instead)\r
+ }\r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) const\r
+{\r
+ // project 2D profile onto pt axis to get 1D profile\r
+ \r
+ Int_t nBinsPt = profilePtEta->GetNbinsX();\r
+ Double_t dPtMin = (profilePtEta->GetXaxis())->GetXmin();\r
+ Double_t dPtMax = (profilePtEta->GetXaxis())->GetXmax();\r
+ \r
+ Int_t nBinsEta = profilePtEta->GetNbinsY();\r
+ \r
+ TProfile *profilePt = new TProfile("","",nBinsPt,dPtMin,dPtMax); \r
+ \r
+ for(Int_t p=1;p<=nBinsPt;p++)\r
+ {\r
+ Double_t contentPt = 0.;\r
+ Double_t entryPt = 0.;\r
+ Double_t spreadPt = 0.;\r
+ Double_t sum1 = 0.;\r
+ Double_t sum2 = 0.;\r
+ Double_t sum3 = 0.;\r
+ for(Int_t e=1;e<=nBinsEta;e++)\r
+ {\r
+ contentPt += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e)))\r
+ * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)));\r
+ entryPt += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)));\r
+ \r
+ sum1 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)))\r
+ * (pow(profilePtEta->GetBinError(profilePtEta->GetBin(p,e)),2.)\r
+ + pow(profilePtEta->GetBinContent(profilePtEta->GetBin(p,e)),2.)); \r
+ sum2 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)));\r
+ sum3 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)))\r
+ * (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))); \r
+ }\r
+ if(sum2>0. && sum1/sum2-pow(sum3/sum2,2.) > 0.)\r
+ {\r
+ spreadPt = pow(sum1/sum2-pow(sum3/sum2,2.),0.5);\r
+ }\r
+ profilePt->SetBinContent(p,contentPt);\r
+ profilePt->SetBinEntries(p,entryPt);\r
+ {\r
+ profilePt->SetBinError(p,spreadPt);\r
+ }\r
+ \r
+ }\r
+ \r
+ return profilePt;\r
+ \r
+} // end of TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) const\r
+{\r
+ // project 2D profile onto eta axis to get 1D profile\r
+ \r
+ Int_t nBinsEta = profilePtEta->GetNbinsY();\r
+ Double_t dEtaMin = (profilePtEta->GetYaxis())->GetXmin();\r
+ Double_t dEtaMax = (profilePtEta->GetYaxis())->GetXmax();\r
+ \r
+ Int_t nBinsPt = profilePtEta->GetNbinsX();\r
+ \r
+ TProfile *profileEta = new TProfile("","",nBinsEta,dEtaMin,dEtaMax); \r
+ \r
+ for(Int_t e=1;e<=nBinsEta;e++)\r
+ {\r
+ Double_t contentEta = 0.;\r
+ Double_t entryEta = 0.;\r
+ for(Int_t p=1;p<=nBinsPt;p++)\r
+ {\r
+ contentEta += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e)))\r
+ * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)));\r
+ entryEta += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e)));\r
+ }\r
+ profileEta->SetBinContent(e,contentEta);\r
+ profileEta->SetBinEntries(e,entryEta);\r
+ }\r
+ \r
+ return profileEta;\r
+ \r
+} // end of TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type)\r
+{\r
+ // printing on the screen the final results for integrated flow (NONAME, POI and RP) // to be improved (NONAME) \r
+ \r
+ Int_t n = fHarmonic; \r
+ \r
+ if(type == "NONAME" || type == "RP" || type == "POI")\r
+ {\r
+ if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th))\r
+ {\r
+ cout<<"WARNING: fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th"<<endl;\r
+ cout<<" is NULL in AFAWQC::PFRFIF() !!!!"<<endl;\r
+ }\r
+ } else\r
+ {\r
+ cout<<"WARNING: type in not from {NONAME, RP, POI} in AFAWQC::PFRFIF() !!!!"<<endl;\r
+ exit(0);\r
+ }\r
+ \r
+ Double_t dVn[4] = {0.}; // array to hold Vn{2}, Vn{4}, Vn{6} and Vn{8} \r
+ Double_t dVnErr[4] = {0.}; // array to hold errors of Vn{2}, Vn{4}, Vn{6} and Vn{8} \r
+ \r
+ if(type == "NONAME")\r
+ {\r
+ dVn[0] = (fCommonHistsResults2nd->GetHistIntFlow())->GetBinContent(1); \r
+ dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlow())->GetBinError(1); \r
+ dVn[1] = (fCommonHistsResults4th->GetHistIntFlow())->GetBinContent(1); \r
+ dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlow())->GetBinError(1); \r
+ dVn[2] = (fCommonHistsResults6th->GetHistIntFlow())->GetBinContent(1); \r
+ dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlow())->GetBinError(1); \r
+ dVn[3] = (fCommonHistsResults8th->GetHistIntFlow())->GetBinContent(1); \r
+ dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlow())->GetBinError(1); \r
+ } else if(type == "RP")\r
+ {\r
+ dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinContent(1); \r
+ dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinError(1); \r
+ dVn[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinContent(1); \r
+ dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinError(1); \r
+ dVn[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinContent(1); \r
+ dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinError(1); \r
+ dVn[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinContent(1); \r
+ dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinError(1); \r
+ } else if(type == "POI")\r
+ {\r
+ dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinContent(1); \r
+ dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinError(1); \r
+ dVn[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinContent(1); \r
+ dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinError(1); \r
+ dVn[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinContent(1); \r
+ dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinError(1); \r
+ dVn[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinContent(1); \r
+ dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinError(1); \r
+ }\r
+ \r
+ TString title = " flow estimates from Q-cumulants"; \r
+ TString subtitle = " ("; \r
+ \r
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
+ {\r
+ subtitle.Append(type);\r
+ subtitle.Append(", without weights)");\r
+ } else \r
+ {\r
+ subtitle.Append(type);\r
+ subtitle.Append(", with weights)");\r
+ }\r
+ \r
+ cout<<endl;\r
+ cout<<"*************************************"<<endl;\r
+ cout<<"*************************************"<<endl;\r
+ cout<<title.Data()<<endl; \r
+ cout<<subtitle.Data()<<endl; \r
+ cout<<endl;\r
+ \r
+ for(Int_t i=0;i<4;i++)\r
+ {\r
+ if(dVn[i]>=0.)\r
+ {\r
+ cout<<" v_"<<n<<"{"<<2*(i+1)<<"} = "<<dVn[i]<<" +/- "<<dVnErr[i]<<endl;\r
+ }\r
+ else\r
+ {\r
+ cout<<" v_"<<n<<"{"<<2*(i+1)<<"} = Im"<<endl;\r
+ } \r
+ }\r
+\r
+ cout<<endl;\r
+ /*\r
+ if(type == "NONAME")\r
+ {\r
+ cout<<" nEvts = "<<nEvtsNoName<<", AvM = "<<dMultNoName<<endl; // to be improved\r
+ }\r
+ else if (type == "RP")\r
+ {\r
+ cout<<" nEvts = "<<nEvtsRP<<", AvM = "<<dMultRP<<endl; // to be improved \r
+ } \r
+ else if (type == "POI")\r
+ {\r
+ cout<<" nEvts = "<<nEvtsPOI<<", AvM = "<<dMultPOI<<endl; // to be improved \r
+ } \r
+ */\r
+ cout<<"*************************************"<<endl;\r
+ cout<<"*************************************"<<endl;\r
+ cout<<endl; \r
+ \r
+}// end of AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type="NONAME");\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::WriteHistograms(TString outputFileName)\r
+{\r
+ //store the final results in output .root file\r
+ TFile *output = new TFile(outputFileName.Data(),"RECREATE");\r
+ //output->WriteObject(fHistList, "cobjQC","SingleKey");\r
+ fHistList->Write(fHistList->GetName(), TObject::kSingleKey);\r
+ delete output;\r
+}\r
+\r
+\r
+//================================================================================================================================\r
+
+
+void AliFlowAnalysisWithQCumulants::WriteHistograms(TDirectoryFile *outputFileName)
{
- // calculate final results for integrated flow of RPs and POIs
-
- TH1F *yield2ndPt = NULL;
- TH1F *yield4thPt = NULL;
- TH1F *yield6thPt = NULL;
- TH1F *yield8thPt = NULL;
-
- if(type == "POI")
- {
- yield2ndPt = new TH1F(*(fCommonHists2nd->GetHistPtPOI()));
- yield4thPt = new TH1F(*(fCommonHists4th->GetHistPtPOI()));
- yield6thPt = new TH1F(*(fCommonHists6th->GetHistPtPOI()));
- yield8thPt = new TH1F(*(fCommonHists8th->GetHistPtPOI()));
- }
- else if (type == "RP")
- {
- yield2ndPt = new TH1F(*(fCommonHists2nd->GetHistPtRP()));
- yield4thPt = new TH1F(*(fCommonHists4th->GetHistPtRP()));
- yield6thPt = new TH1F(*(fCommonHists6th->GetHistPtRP()));
- yield8thPt = new TH1F(*(fCommonHists8th->GetHistPtRP()));
- }
-
- Int_t nBinsPt = yield2ndPt->GetNbinsX();
-
- TH1D *flow2ndPt = NULL;
- TH1D *flow4thPt = NULL;
- TH1D *flow6thPt = NULL;
- TH1D *flow8thPt = NULL;
-
- if(!(useWeights))
+ //store the final results in output .root file
+ fHistList->SetName("cobjQC");
+ fHistList->SetOwner(kTRUE);
+ outputFileName->Add(fHistList);
+ outputFileName->Write(outputFileName->GetName(), TObject::kSingleKey);
+}
+\r
+
+//================================================================================================================================\r
+
+\r
+void AliFlowAnalysisWithQCumulants::BookCommonHistograms()\r
+{\r
+ // Book common control histograms and common histograms for final results.\r
+ // common control histogram (ALL events)\r
+ TString commonHistsName = "AliFlowCommonHistQC";\r
+ commonHistsName += fAnalysisLabel->Data();\r
+ fCommonHists = new AliFlowCommonHist(commonHistsName.Data());\r
+ fHistList->Add(fCommonHists); \r
+ // common control histogram (for events with 2 and more particles)\r
+ TString commonHists2ndOrderName = "AliFlowCommonHist2ndOrderQC";\r
+ commonHists2ndOrderName += fAnalysisLabel->Data();\r
+ fCommonHists2nd = new AliFlowCommonHist(commonHists2ndOrderName.Data());\r
+ fHistList->Add(fCommonHists2nd); \r
+ // common control histogram (for events with 4 and more particles)\r
+ TString commonHists4thOrderName = "AliFlowCommonHist4thOrderQC";\r
+ commonHists4thOrderName += fAnalysisLabel->Data();\r
+ fCommonHists4th = new AliFlowCommonHist(commonHists4thOrderName.Data());\r
+ fHistList->Add(fCommonHists4th); \r
+ // common control histogram (for events with 6 and more particles)\r
+ TString commonHists6thOrderName = "AliFlowCommonHist6thOrderQC";\r
+ commonHists6thOrderName += fAnalysisLabel->Data();\r
+ fCommonHists6th = new AliFlowCommonHist(commonHists6thOrderName.Data());\r
+ fHistList->Add(fCommonHists6th); \r
+ // common control histogram (for events with 8 and more particles)\r
+ TString commonHists8thOrderName = "AliFlowCommonHist8thOrderQC";\r
+ commonHists8thOrderName += fAnalysisLabel->Data();\r
+ fCommonHists8th = new AliFlowCommonHist(commonHists8thOrderName.Data());\r
+ fHistList->Add(fCommonHists8th); \r
+ // common histograms for final results (calculated for events with 2 and more particles)\r
+ TString commonHistResults2ndOrderName = "AliFlowCommonHistResults2ndOrderQC";\r
+ commonHistResults2ndOrderName += fAnalysisLabel->Data();\r
+ fCommonHistsResults2nd = new AliFlowCommonHistResults(commonHistResults2ndOrderName.Data());\r
+ fHistList->Add(fCommonHistsResults2nd); \r
+ // common histograms for final results (calculated for events with 4 and more particles)\r
+ TString commonHistResults4thOrderName = "AliFlowCommonHistResults4thOrderQC";\r
+ commonHistResults4thOrderName += fAnalysisLabel->Data();\r
+ fCommonHistsResults4th = new AliFlowCommonHistResults(commonHistResults4thOrderName.Data());\r
+ fHistList->Add(fCommonHistsResults4th); \r
+ // common histograms for final results (calculated for events with 6 and more particles)\r
+ TString commonHistResults6thOrderName = "AliFlowCommonHistResults6thOrderQC";\r
+ commonHistResults6thOrderName += fAnalysisLabel->Data();\r
+ fCommonHistsResults6th = new AliFlowCommonHistResults(commonHistResults6thOrderName.Data());\r
+ fHistList->Add(fCommonHistsResults6th); \r
+ // common histograms for final results (calculated for events with 8 and more particles)\r
+ TString commonHistResults8thOrderName = "AliFlowCommonHistResults8thOrderQC";\r
+ commonHistResults8thOrderName += fAnalysisLabel->Data();\r
+ fCommonHistsResults8th = new AliFlowCommonHistResults(commonHistResults8thOrderName.Data());\r
+ fHistList->Add(fCommonHistsResults8th); \r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::BookCommonHistograms()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms()\r
+{\r
+ // book and fill histograms which hold phi, pt and eta weights\r
+\r
+ if(!fWeightsList)\r
+ {\r
+ cout<<"WARNING: fWeightsList is NULL in AFAWQC::BAFWH() !!!!"<<endl;\r
+ exit(0); \r
+ }\r
+ \r
+ TString fUseParticleWeightsName = "fUseParticleWeightsQC";\r
+ fUseParticleWeightsName += fAnalysisLabel->Data();\r
+ fUseParticleWeights = new TProfile(fUseParticleWeightsName.Data(),"0 = particle weight not used, 1 = particle weight used ",3,0,3);\r
+ fUseParticleWeights->SetLabelSize(0.06);\r
+ (fUseParticleWeights->GetXaxis())->SetBinLabel(1,"w_{#phi}");\r
+ (fUseParticleWeights->GetXaxis())->SetBinLabel(2,"w_{p_{T}}");\r
+ (fUseParticleWeights->GetXaxis())->SetBinLabel(3,"w_{#eta}");\r
+ fUseParticleWeights->Fill(0.5,(Int_t)fUsePhiWeights);\r
+ fUseParticleWeights->Fill(1.5,(Int_t)fUsePtWeights);\r
+ fUseParticleWeights->Fill(2.5,(Int_t)fUseEtaWeights);\r
+ fWeightsList->Add(fUseParticleWeights); \r
+ \r
+ if(fUsePhiWeights)\r
+ {\r
+ if(fWeightsList->FindObject("phi_weights"))\r
+ {\r
+ fPhiWeights = dynamic_cast<TH1F*>(fWeightsList->FindObject("phi_weights"));\r
+ if((fPhiWeights->GetBinWidth(1) > fPhiBinWidth) || (fPhiWeights->GetBinWidth(1) < fPhiBinWidth))\r
+ {\r
+ cout<<"WARNING: fPhiWeights->GetBinWidth(1) != fPhiBinWidth in AFAWQC::BAFWH() !!!! "<<endl;\r
+ cout<<" This indicates inconsistent binning in phi histograms throughout the code."<<endl;\r
+ exit(0);\r
+ }\r
+ } else \r
+ {\r
+ cout<<"WARNING: fWeightsList->FindObject(\"phi_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl;\r
+ exit(0);\r
+ }\r
+ } // end of if(fUsePhiWeights)\r
+ \r
+ if(fUsePtWeights) \r
+ {\r
+ if(fWeightsList->FindObject("pt_weights"))\r
+ {\r
+ fPtWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("pt_weights"));\r
+ if((fPtWeights->GetBinWidth(1) > fPtBinWidth) || (fPtWeights->GetBinWidth(1) < fPtBinWidth))\r
+ {\r
+ cout<<"WARNING: fPtWeights->GetBinWidth(1) != fPtBinWidth in AFAWQC::BAFWH() !!!! "<<endl;\r
+ cout<<" This indicates insconsistent binning in pt histograms throughout the code."<<endl;\r
+ exit(0);\r
+ }\r
+ } else \r
+ {\r
+ cout<<"WARNING: fWeightsList->FindObject(\"pt_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl;\r
+ exit(0);\r
+ }\r
+ } // end of if(fUsePtWeights) \r
+\r
+ if(fUseEtaWeights) \r
+ {\r
+ if(fWeightsList->FindObject("eta_weights"))\r
+ {\r
+ fEtaWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("eta_weights"));\r
+ if((fEtaWeights->GetBinWidth(1) > fEtaBinWidth) || (fEtaWeights->GetBinWidth(1) < fEtaBinWidth))\r
+ {\r
+ cout<<"WARNING: fEtaWeights->GetBinWidth(1) != fEtaBinWidth in AFAWQC::BAFWH() !!!! "<<endl;\r
+ cout<<" This indicates insconsistent binning in eta histograms throughout the code."<<endl;\r
+ exit(0);\r
+ }\r
+ } else \r
+ {\r
+ cout<<"WARNING: fUseEtaWeights && fWeightsList->FindObject(\"eta_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl;\r
+ exit(0);\r
+ }\r
+ } // end of if(fUseEtaWeights)\r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow()\r
+{\r
+ // Book all objects for integrated flow:\r
+ // a) Book profile to hold all flags for integrated flow.\r
+ // b) Book event-by-event quantities.\r
+ // c) Book profiles. // to be improved (comment)\r
+ // d) Book histograms holding the final results.\r
+ \r
+ TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?)\r
+ TString powerFlag[2] = {"linear","quadratic"}; // to be improved (should I promote this to data members?)\r
+ \r
+ // a) Book profile to hold all flags for integrated flow:\r
+ TString intFlowFlagsName = "fIntFlowFlags";\r
+ intFlowFlagsName += fAnalysisLabel->Data();\r
+ fIntFlowFlags = new TProfile(intFlowFlagsName.Data(),"Flags for Integrated Flow",3,0,3);\r
+ fIntFlowFlags->SetTickLength(-0.01,"Y");\r
+ fIntFlowFlags->SetMarkerStyle(25);\r
+ fIntFlowFlags->SetLabelSize(0.05);\r
+ fIntFlowFlags->SetLabelOffset(0.02,"Y");\r
+ (fIntFlowFlags->GetXaxis())->SetBinLabel(1,"Particle Weights");\r
+ (fIntFlowFlags->GetXaxis())->SetBinLabel(2,"Event Weights");\r
+ (fIntFlowFlags->GetXaxis())->SetBinLabel(3,"Corrected for NUA?");\r
+ fIntFlowList->Add(fIntFlowFlags);\r
+\r
+ // b) Book event-by-event quantities:\r
+ // Re[Q_{m*n,k}], Im[Q_{m*n,k}] and S_{p,k}^M: \r
+ fReQ = new TMatrixD(4,9);\r
+ fImQ = new TMatrixD(4,9);\r
+ fSMpk = new TMatrixD(8,9);\r
+ // average correlations <2>, <4>, <6> and <8> for single event (bining is the same as in fIntFlowCorrelationsPro and fIntFlowCorrelationsHist):\r
+ TString intFlowCorrelationsEBEName = "fIntFlowCorrelationsEBE";\r
+ intFlowCorrelationsEBEName += fAnalysisLabel->Data();\r
+ fIntFlowCorrelationsEBE = new TH1D(intFlowCorrelationsEBEName.Data(),intFlowCorrelationsEBEName.Data(),4,0,4);\r
+ // weights for average correlations <2>, <4>, <6> and <8> for single event:\r
+ TString intFlowEventWeightsForCorrelationsEBEName = "fIntFlowEventWeightsForCorrelationsEBE";\r
+ intFlowEventWeightsForCorrelationsEBEName += fAnalysisLabel->Data();\r
+ fIntFlowEventWeightsForCorrelationsEBE = new TH1D(intFlowEventWeightsForCorrelationsEBEName.Data(),intFlowEventWeightsForCorrelationsEBEName.Data(),4,0,4);\r
+ // average all correlations for single event (bining is the same as in fIntFlowCorrelationsAllPro and fIntFlowCorrelationsAllHist):\r
+ TString intFlowCorrelationsAllEBEName = "fIntFlowCorrelationsAllEBE";\r
+ intFlowCorrelationsAllEBEName += fAnalysisLabel->Data();\r
+ fIntFlowCorrelationsAllEBE = new TH1D(intFlowCorrelationsAllEBEName.Data(),intFlowCorrelationsAllEBEName.Data(),32,0,32);\r
+ // average correction terms for non-uniform acceptance for single event \r
+ // (binning is the same as in fIntFlowCorrectionTermsForNUAPro[2] and fIntFlowCorrectionTermsForNUAHist[2]):\r
+ TString fIntFlowCorrectionTermsForNUAEBEName = "fIntFlowCorrectionTermsForNUAEBE";\r
+ fIntFlowCorrectionTermsForNUAEBEName += fAnalysisLabel->Data();\r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
+ {\r
+ fIntFlowCorrectionTermsForNUAEBE[sc] = new TH1D(Form("%s: %s terms",fIntFlowCorrectionTermsForNUAEBEName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),10,0,10); \r
+ }\r
+ \r
+ // c) Book profiles: // to be improved (comment)\r
+ // profile to hold average multiplicities and number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8:\r
+ TString avMultiplicityName = "fAvMultiplicity";\r
+ avMultiplicityName += fAnalysisLabel->Data();\r
+ fAvMultiplicity = new TProfile(avMultiplicityName.Data(),"Average Multiplicities of RPs",9,0,9);\r
+ fAvMultiplicity->SetTickLength(-0.01,"Y");\r
+ fAvMultiplicity->SetMarkerStyle(25);\r
+ fAvMultiplicity->SetLabelSize(0.05);\r
+ fAvMultiplicity->SetLabelOffset(0.02,"Y");\r
+ fAvMultiplicity->SetYTitle("Average Multiplicity");\r
+ (fAvMultiplicity->GetXaxis())->SetBinLabel(1,"all evts");\r
+ (fAvMultiplicity->GetXaxis())->SetBinLabel(2,"n_{RP} #geq 1");\r
+ (fAvMultiplicity->GetXaxis())->SetBinLabel(3,"n_{RP} #geq 2");\r
+ (fAvMultiplicity->GetXaxis())->SetBinLabel(4,"n_{RP} #geq 3");\r
+ (fAvMultiplicity->GetXaxis())->SetBinLabel(5,"n_{RP} #geq 4");\r
+ (fAvMultiplicity->GetXaxis())->SetBinLabel(6,"n_{RP} #geq 5");\r
+ (fAvMultiplicity->GetXaxis())->SetBinLabel(7,"n_{RP} #geq 6");\r
+ (fAvMultiplicity->GetXaxis())->SetBinLabel(8,"n_{RP} #geq 7");\r
+ (fAvMultiplicity->GetXaxis())->SetBinLabel(9,"n_{RP} #geq 8");\r
+ fIntFlowProfiles->Add(fAvMultiplicity);\r
+ // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with wrong errors!):\r
+ TString intFlowCorrelationsProName = "fIntFlowCorrelationsPro";\r
+ intFlowCorrelationsProName += fAnalysisLabel->Data();\r
+ fIntFlowCorrelationsPro = new TProfile(intFlowCorrelationsProName.Data(),"Average correlations for all events",4,0,4,"s");\r
+ fIntFlowCorrelationsPro->SetTickLength(-0.01,"Y");\r
+ fIntFlowCorrelationsPro->SetMarkerStyle(25);\r
+ fIntFlowCorrelationsPro->SetLabelSize(0.06);\r
+ fIntFlowCorrelationsPro->SetLabelOffset(0.01,"Y");\r
+ (fIntFlowCorrelationsPro->GetXaxis())->SetBinLabel(1,"<<2>>");\r
+ (fIntFlowCorrelationsPro->GetXaxis())->SetBinLabel(2,"<<4>>");\r
+ (fIntFlowCorrelationsPro->GetXaxis())->SetBinLabel(3,"<<6>>");\r
+ (fIntFlowCorrelationsPro->GetXaxis())->SetBinLabel(4,"<<8>>");\r
+ fIntFlowProfiles->Add(fIntFlowCorrelationsPro);\r
+ // averaged all correlations for all events (with wrong errors!):\r
+ TString intFlowCorrelationsAllProName = "fIntFlowCorrelationsAllPro";\r
+ intFlowCorrelationsAllProName += fAnalysisLabel->Data();\r
+ fIntFlowCorrelationsAllPro = new TProfile(intFlowCorrelationsAllProName.Data(),"Average correlations for all events",32,0,32,"s");\r
+ fIntFlowCorrelationsAllPro->SetTickLength(-0.01,"Y");\r
+ fIntFlowCorrelationsAllPro->SetMarkerStyle(25);\r
+ fIntFlowCorrelationsAllPro->SetLabelSize(0.03);\r
+ fIntFlowCorrelationsAllPro->SetLabelOffset(0.01,"Y");\r
+ // 2-p correlations:\r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(1,"<<2>>_{n|n}");\r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(2,"<<2>>_{2n|2n}");\r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(3,"<<2>>_{3n|3n}");\r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(4,"<<2>>_{4n|4n}");\r
+ // 3-p correlations:\r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(6,"<<3>>_{2n|n,n}");\r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}");\r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}");\r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}");\r
+ // 4-p correlations:\r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}"); \r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}");\r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}");\r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}");\r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}");\r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}"); \r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}");\r
+ // 5-p correlations:\r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}"); \r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}");\r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}");\r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}");\r
+ // 6-p correlations:\r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}");\r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}");\r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}");\r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}");\r
+ // 7-p correlations: \r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}");\r
+ // 8-p correlations:\r
+ (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}");\r
+ fIntFlowProfiles->Add(fIntFlowCorrelationsAllPro);\r
+ // when particle weights are used some extra correlations appear:\r
+ if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) \r
+ {\r
+ TString intFlowExtraCorrelationsProName = "fIntFlowExtraCorrelationsPro";\r
+ intFlowExtraCorrelationsProName += fAnalysisLabel->Data();\r
+ fIntFlowExtraCorrelationsPro = new TProfile(intFlowExtraCorrelationsProName.Data(),"Average extra correlations for all events",100,0,100,"s");\r
+ fIntFlowExtraCorrelationsPro->SetTickLength(-0.01,"Y");\r
+ fIntFlowExtraCorrelationsPro->SetMarkerStyle(25);\r
+ fIntFlowExtraCorrelationsPro->SetLabelSize(0.03);\r
+ fIntFlowExtraCorrelationsPro->SetLabelOffset(0.01,"Y");\r
+ // extra 2-p correlations:\r
+ (fIntFlowExtraCorrelationsPro->GetXaxis())->SetBinLabel(1,"<<w1^3 w2 cos(n*(phi1-phi2))>>");\r
+ (fIntFlowExtraCorrelationsPro->GetXaxis())->SetBinLabel(2,"<<w1 w2 w3^2 cos(n*(phi1-phi2))>>");\r
+ fIntFlowProfiles->Add(fIntFlowExtraCorrelationsPro);\r
+ } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)\r
+ // average product of correlations <2>, <4>, <6> and <8>: \r
+ TString intFlowProductOfCorrelationsProName = "fIntFlowProductOfCorrelationsPro";\r
+ intFlowProductOfCorrelationsProName += fAnalysisLabel->Data();\r
+ fIntFlowProductOfCorrelationsPro = new TProfile(intFlowProductOfCorrelationsProName.Data(),"Average products of correlations",6,0,6);\r
+ fIntFlowProductOfCorrelationsPro->SetTickLength(-0.01,"Y");\r
+ fIntFlowProductOfCorrelationsPro->SetMarkerStyle(25); \r
+ fIntFlowProductOfCorrelationsPro->SetLabelSize(0.05);\r
+ fIntFlowProductOfCorrelationsPro->SetLabelOffset(0.01,"Y");\r
+ (fIntFlowProductOfCorrelationsPro->GetXaxis())->SetBinLabel(1,"<<2><4>>");\r
+ (fIntFlowProductOfCorrelationsPro->GetXaxis())->SetBinLabel(2,"<<2><6>>");\r
+ (fIntFlowProductOfCorrelationsPro->GetXaxis())->SetBinLabel(3,"<<2><8>>");\r
+ (fIntFlowProductOfCorrelationsPro->GetXaxis())->SetBinLabel(4,"<<4><6>>");\r
+ (fIntFlowProductOfCorrelationsPro->GetXaxis())->SetBinLabel(5,"<<4><8>>");\r
+ (fIntFlowProductOfCorrelationsPro->GetXaxis())->SetBinLabel(6,"<<6><8>>");\r
+ fIntFlowProfiles->Add(fIntFlowProductOfCorrelationsPro);\r
+ // average correction terms for non-uniform acceptance (with wrong errors!):\r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
+ {\r
+ TString intFlowCorrectionTermsForNUAProName = "fIntFlowCorrectionTermsForNUAPro";\r
+ intFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data();\r
+ fIntFlowCorrectionTermsForNUAPro[sc] = new TProfile(Form("%s: %s terms",intFlowCorrectionTermsForNUAProName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),10,0,10,"s");\r
+ fIntFlowCorrectionTermsForNUAPro[sc]->SetTickLength(-0.01,"Y");\r
+ fIntFlowCorrectionTermsForNUAPro[sc]->SetMarkerStyle(25);\r
+ fIntFlowCorrectionTermsForNUAPro[sc]->SetLabelSize(0.03);\r
+ fIntFlowCorrectionTermsForNUAPro[sc]->SetLabelOffset(0.01,"Y");\r
+ // 1-particle terms:\r
+ (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(1,Form("<<%s(n(phi1))>>",sinCosFlag[sc].Data()));\r
+ // 2-particle terms:\r
+ (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(2,Form("<<%s(n(phi1+phi2))>>",sinCosFlag[sc].Data())); \r
+ // 3-particle terms:\r
+ (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(3,Form("<<%s(n(phi1-phi2-phi3))>>",sinCosFlag[sc].Data())); \r
+ // ... \r
+ fIntFlowProfiles->Add(fIntFlowCorrectionTermsForNUAPro[sc]);\r
+ } // end of for(Int_t sc=0;sc<2;sc++) \r
+ \r
+ // d) Book histograms holding the final results:\r
+ // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with correct errors!):\r
+ TString intFlowCorrelationsHistName = "fIntFlowCorrelationsHist";\r
+ intFlowCorrelationsHistName += fAnalysisLabel->Data();\r
+ fIntFlowCorrelationsHist = new TH1D(intFlowCorrelationsHistName.Data(),"Average correlations for all events",4,0,4);\r
+ fIntFlowCorrelationsHist->SetTickLength(-0.01,"Y");\r
+ fIntFlowCorrelationsHist->SetMarkerStyle(25);\r
+ fIntFlowCorrelationsHist->SetLabelSize(0.06);\r
+ fIntFlowCorrelationsHist->SetLabelOffset(0.01,"Y");\r
+ (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(1,"<<2>>");\r
+ (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(2,"<<4>>");\r
+ (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(3,"<<6>>");\r
+ (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(4,"<<8>>");\r
+ fIntFlowResults->Add(fIntFlowCorrelationsHist);\r
+ // average all correlations for all events (with correct errors!):\r
+ TString intFlowCorrelationsAllHistName = "fIntFlowCorrelationsAllHist";\r
+ intFlowCorrelationsAllHistName += fAnalysisLabel->Data();\r
+ fIntFlowCorrelationsAllHist = new TH1D(intFlowCorrelationsAllHistName.Data(),"Average correlations for all events",32,0,32);\r
+ fIntFlowCorrelationsAllHist->SetTickLength(-0.01,"Y");\r
+ fIntFlowCorrelationsAllHist->SetMarkerStyle(25);\r
+ fIntFlowCorrelationsAllHist->SetLabelSize(0.03);\r
+ fIntFlowCorrelationsAllHist->SetLabelOffset(0.01,"Y");\r
+ // 2-p correlations:\r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(1,"<<2>>_{n|n}");\r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(2,"<<2>>_{2n|2n}");\r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(3,"<<2>>_{3n|3n}");\r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(4,"<<2>>_{4n|4n}");\r
+ // 3-p correlations:\r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(6,"<<3>>_{2n|n,n}");\r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}");\r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}");\r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}");\r
+ // 4-p correlations:\r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}"); \r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}");\r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}");\r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}");\r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}");\r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}"); \r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}");\r
+ // 5-p correlations:\r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}"); \r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}");\r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}");\r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}");\r
+ // 6-p correlations:\r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}");\r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}");\r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}");\r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}");\r
+ // 7-p correlations: \r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}");\r
+ // 8-p correlations:\r
+ (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}");\r
+ fIntFlowResults->Add(fIntFlowCorrelationsAllHist);\r
+ // average correction terms for non-uniform acceptance (with correct errors!):\r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
+ {\r
+ TString intFlowCorrectionTermsForNUAHistName = "fIntFlowCorrectionTermsForNUAHist";\r
+ intFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data();\r
+ fIntFlowCorrectionTermsForNUAHist[sc] = new TH1D(Form("%s: %s terms",intFlowCorrectionTermsForNUAHistName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),10,0,10);\r
+ fIntFlowCorrectionTermsForNUAHist[sc]->SetTickLength(-0.01,"Y");\r
+ fIntFlowCorrectionTermsForNUAHist[sc]->SetMarkerStyle(25);\r
+ fIntFlowCorrectionTermsForNUAHist[sc]->SetLabelSize(0.03);\r
+ fIntFlowCorrectionTermsForNUAHist[sc]->SetLabelOffset(0.01,"Y");\r
+ // ......................................................................... \r
+ // 1-p terms:\r
+ (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(1,Form("%s(n(#phi_{1}))>",sinCosFlag[sc].Data()));\r
+ // 2-p terms:\r
+ // 3-p terms:\r
+ // ...\r
+ // ......................................................................... \r
+ fIntFlowResults->Add(fIntFlowCorrectionTermsForNUAHist[sc]);\r
+ } // end of for(Int_t sc=0;sc<2;sc++) \r
+ // covariances (multiplied with weight dependent prefactor):\r
+ TString intFlowCovariancesName = "fIntFlowCovariances";\r
+ intFlowCovariancesName += fAnalysisLabel->Data();\r
+ fIntFlowCovariances = new TH1D(intFlowCovariancesName.Data(),"Covariances (multiplied with weight dependent prefactor)",6,0,6);\r
+ fIntFlowCovariances->SetLabelSize(0.04);\r
+ fIntFlowCovariances->SetMarkerStyle(25);\r
+ (fIntFlowCovariances->GetXaxis())->SetBinLabel(1,"Cov(<2>,<4>)");\r
+ (fIntFlowCovariances->GetXaxis())->SetBinLabel(2,"Cov(<2>,<6>)");\r
+ (fIntFlowCovariances->GetXaxis())->SetBinLabel(3,"Cov(<2>,<8>)");\r
+ (fIntFlowCovariances->GetXaxis())->SetBinLabel(4,"Cov(<4>,<6>)");\r
+ (fIntFlowCovariances->GetXaxis())->SetBinLabel(5,"Cov(<4>,<8>)");\r
+ (fIntFlowCovariances->GetXaxis())->SetBinLabel(6,"Cov(<6>,<8>)"); \r
+ fIntFlowResults->Add(fIntFlowCovariances);\r
+ // sum of linear and quadratic event weights for <2>, <4>, <6> and <8>:\r
+ TString intFlowSumOfEventWeightsName = "fIntFlowSumOfEventWeights";\r
+ intFlowSumOfEventWeightsName += fAnalysisLabel->Data();\r
+ for(Int_t power=0;power<2;power++)\r
+ {\r
+ fIntFlowSumOfEventWeights[power] = new TH1D(Form("%s: %s",intFlowSumOfEventWeightsName.Data(),powerFlag[power].Data()),Form("Sum of %s event weights for correlations",powerFlag[power].Data()),4,0,4);\r
+ fIntFlowSumOfEventWeights[power]->SetLabelSize(0.05);\r
+ fIntFlowSumOfEventWeights[power]->SetMarkerStyle(25);\r
+ if(power == 0)\r
+ {\r
+ (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>}");\r
+ (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<4>}");\r
+ (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<6>}");\r
+ (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{<8>}");\r
+ } else if (power == 1) \r
+ {\r
+ (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>}^{2}");\r
+ (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<4>}^{2}");\r
+ (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<6>}^{2}");\r
+ (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{<8>}^{2}");\r
+ }\r
+ fIntFlowResults->Add(fIntFlowSumOfEventWeights[power]);\r
+ } \r
+ // sum of products of event weights for correlations <2>, <4>, <6> and <8>: \r
+ TString intFlowSumOfProductOfEventWeightsName = "fIntFlowSumOfProductOfEventWeights";\r
+ intFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data();\r
+ fIntFlowSumOfProductOfEventWeights = new TH1D(intFlowSumOfProductOfEventWeightsName.Data(),"Sum of product of event weights for correlations",6,0,6);\r
+ fIntFlowSumOfProductOfEventWeights->SetLabelSize(0.05);\r
+ fIntFlowSumOfProductOfEventWeights->SetMarkerStyle(25);\r
+ (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{<2>} w_{<4>}");\r
+ (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{<2>} w_{<6>}");\r
+ (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{<2>} w_{<8>}");\r
+ (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{<4>} w_{<6>}");\r
+ (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(5,"#sum_{i=1}^{N} w_{<4>} w_{<8>}");\r
+ (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(6,"#sum_{i=1}^{N} w_{<6>} w_{<8>}");\r
+ fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeights);\r
+ // final results for integrated Q-cumulants:\r
+ TString intFlowQcumulantsName = "fIntFlowQcumulants";\r
+ intFlowQcumulantsName += fAnalysisLabel->Data();\r
+ fIntFlowQcumulants = new TH1D(intFlowQcumulantsName.Data(),"Integrated Q-cumulants",4,0,4);\r
+ fIntFlowQcumulants->SetLabelSize(0.05);\r
+ fIntFlowQcumulants->SetMarkerStyle(25);\r
+ (fIntFlowQcumulants->GetXaxis())->SetBinLabel(1,"QC{2}");\r
+ (fIntFlowQcumulants->GetXaxis())->SetBinLabel(2,"QC{4}");\r
+ (fIntFlowQcumulants->GetXaxis())->SetBinLabel(3,"QC{6}");\r
+ (fIntFlowQcumulants->GetXaxis())->SetBinLabel(4,"QC{8}");\r
+ fIntFlowResults->Add(fIntFlowQcumulants);\r
+ // final integrated flow estimates from Q-cumulants:\r
+ TString intFlowName = "fIntFlow";\r
+ intFlowName += fAnalysisLabel->Data(); \r
+ // integrated flow from Q-cumulants:\r
+ fIntFlow = new TH1D(intFlowName.Data(),"Integrated flow estimates from Q-cumulants",4,0,4);\r
+ fIntFlow->SetLabelSize(0.05);\r
+ fIntFlow->SetMarkerStyle(25);\r
+ (fIntFlow->GetXaxis())->SetBinLabel(1,"v_{2}{2,QC}");\r
+ (fIntFlow->GetXaxis())->SetBinLabel(2,"v_{2}{4,QC}");\r
+ (fIntFlow->GetXaxis())->SetBinLabel(3,"v_{2}{6,QC}");\r
+ (fIntFlow->GetXaxis())->SetBinLabel(4,"v_{2}{8,QC}");\r
+ fIntFlowResults->Add(fIntFlow);\r
+\r
+ /* // to be improved (removed):\r
+ // final average weighted multi-particle correlations for all events calculated from Q-vectors\r
+ fQCorrelations[1] = new TProfile("Weighted correlations","final average multi-particle correlations from weighted Q-vectors",200,0,200,"s");\r
+ fQCorrelations[1]->SetTickLength(-0.01,"Y");\r
+ fQCorrelations[1]->SetMarkerStyle(25);\r
+ fQCorrelations[1]->SetLabelSize(0.03);\r
+ fQCorrelations[1]->SetLabelOffset(0.01,"Y");\r
+ // 2-particle correlations:\r
+ (fQCorrelations[1]->GetXaxis())->SetBinLabel(1,"<w_{1}w_{2}cos(n(#phi_{1}-#phi_{2}))>");\r
+ (fQCorrelations[1]->GetXaxis())->SetBinLabel(2,"<w_{1}^{2}w_{2}^{2}cos(2n(#phi_{1}-#phi_{2}))>");\r
+ (fQCorrelations[1]->GetXaxis())->SetBinLabel(3,"<w_{1}^{3}w_{2}^{3}cos(3n(#phi_{1}-#phi_{2}))>");\r
+ (fQCorrelations[1]->GetXaxis())->SetBinLabel(4,"<w_{1}^{4}w_{2}^{4}cos(4n(#phi_{1}-#phi_{2}))>");\r
+ (fQCorrelations[1]->GetXaxis())->SetBinLabel(5,"<w_{1}^{3}w_{2}cos(n(#phi_{1}-#phi_{2}))>");\r
+ (fQCorrelations[1]->GetXaxis())->SetBinLabel(6,"<w_{1}^{2}w_{2}w_{3}cos(n(#phi_{1}-#phi_{2}))>");\r
+ // 3-particle correlations:\r
+ (fQCorrelations[1]->GetXaxis())->SetBinLabel(21,"<w_{1}w_{2}w_{3}^{2}cos(n(2#phi_{1}-#phi_{2}-#phi_{3}))>");\r
+ // 4-particle correlations:\r
+ (fQCorrelations[1]->GetXaxis())->SetBinLabel(41,"<w_{1}w_{2}w_{3}w_{4}cos(n(#phi_{1}+#phi_{2}-#phi_{3}-#phi_{4}))>");\r
+ // add fQCorrelations[1] to the list fIntFlowList:\r
+ fIntFlowList->Add(fQCorrelations[1]); \r
+ */\r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::InitializeArraysForNestedLoops()\r
+{\r
+ // Initialize arrays of all objects relevant for calculations with nested loops.\r
+ \r
+ // integrated flow:\r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
+ {\r
+ fIntFlowDirectCorrectionTermsForNUA[sc] = NULL;\r
+ } \r
+\r
+ // differential flow: \r
+ // correlations:\r
+ for(Int_t t=0;t<2;t++) // type: RP or POI\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ for(Int_t ci=0;ci<4;ci++) // correlation index\r
+ {\r
+ fDiffFlowDirectCorrelations[t][pe][ci] = NULL;\r
+ } // end of for(Int_t ci=0;ci<4;ci++) // correlation index \r
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI\r
+ // correction terms for non-uniform acceptance:\r
+ for(Int_t t=0;t<2;t++) // type: RP or POI\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
+ {\r
+ for(Int_t cti=0;cti<9;cti++) // correction term index\r
+ {\r
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = NULL;\r
+ } \r
+ }\r
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI\r
+\r
+\r
+} // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForNestedLoops()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops()\r
+{\r
+ // Book all objects relevant for calculations with nested loops.\r
+ \r
+ TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?)\r
+ TString typeFlag[2] = {"RP","POI"}; // to be improved (should I promote this to data members?)\r
+ TString ptEtaFlag[2] = {"p_{T}","#eta"}; // to be improved (should I promote this to data members?)\r
+ TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; // to be improved (should I promote this to data members?)\r
+ Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth};\r
+ Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth};\r
+\r
+ TString evaluateNestedLoopsName = "fEvaluateNestedLoops";\r
+ evaluateNestedLoopsName += fAnalysisLabel->Data();\r
+ fEvaluateNestedLoops = new TProfile(evaluateNestedLoopsName.Data(),"Flags for nested loops",4,0,4);\r
+ fEvaluateNestedLoops->SetLabelSize(0.03);\r
+ (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(1,"fEvaluateIntFlowNestedLoops");\r
+ (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(2,"fEvaluateDiffFlowNestedLoops");\r
+ (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(3,"fCrossCheckInPtBinNo");\r
+ (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(4,"fCrossCheckInEtaBinNo");\r
+ fEvaluateNestedLoops->Fill(0.5,(Int_t)fEvaluateIntFlowNestedLoops);\r
+ fEvaluateNestedLoops->Fill(1.5,(Int_t)fEvaluateDiffFlowNestedLoops);\r
+ fEvaluateNestedLoops->Fill(2.5,fCrossCheckInPtBinNo);\r
+ fEvaluateNestedLoops->Fill(3.5,fCrossCheckInEtaBinNo);\r
+ fNestedLoopsList->Add(fEvaluateNestedLoops);\r
+ // nested loops for integrated flow:\r
+ if(fEvaluateIntFlowNestedLoops)\r
+ {\r
+ // correlations:\r
+ TString intFlowDirectCorrelationsName = "fIntFlowDirectCorrelations";\r
+ intFlowDirectCorrelationsName += fAnalysisLabel->Data();\r
+ fIntFlowDirectCorrelations = new TProfile(intFlowDirectCorrelationsName.Data(),"Multiparticle correlations calculated with nested loops (for int. flow)",32,0,32,"s");\r
+ fNestedLoopsList->Add(fIntFlowDirectCorrelations);\r
+ if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)\r
+ {\r
+ TString intFlowExtraDirectCorrelationsName = "fIntFlowExtraDirectCorrelations";\r
+ intFlowExtraDirectCorrelationsName += fAnalysisLabel->Data();\r
+ fIntFlowExtraDirectCorrelations = new TProfile(intFlowExtraDirectCorrelationsName.Data(),"Extra multiparticle correlations calculated with nested loops (for int. flow)",100,0,100,"s");\r
+ fNestedLoopsList->Add(fIntFlowExtraDirectCorrelations); \r
+ } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)\r
+ // correction terms for non-uniform acceptance:\r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
+ {\r
+ TString intFlowDirectCorrectionTermsForNUAName = "fIntFlowDirectCorrectionTermsForNUA";\r
+ intFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data();\r
+ fIntFlowDirectCorrectionTermsForNUA[sc] = new TProfile(Form("%s: %s terms",intFlowDirectCorrectionTermsForNUAName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),10,0,10,"s");\r
+ fNestedLoopsList->Add(fIntFlowDirectCorrectionTermsForNUA[sc]);\r
+ } // end of for(Int_t sc=0;sc<2;sc++) \r
+ } // end of if(fEvaluateIntFlowNestedLoops)\r
+ \r
+ // nested loops for differential flow: \r
+ if(fEvaluateDiffFlowNestedLoops)\r
+ {\r
+ // reduced correlations:\r
+ TString diffFlowDirectCorrelationsName = "fDiffFlowDirectCorrelations";\r
+ diffFlowDirectCorrelationsName += fAnalysisLabel->Data();\r
+ for(Int_t t=0;t<2;t++) // type: RP or POI\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ for(Int_t rci=0;rci<4;rci++) // reduced correlation index\r
+ {\r
+ // reduced correlations:\r
+ fDiffFlowDirectCorrelations[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe],"s");\r
+ fDiffFlowDirectCorrelations[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data());\r
+ fNestedLoopsList->Add(fDiffFlowDirectCorrelations[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations)\r
+ } // end of for(Int_t rci=0;rci<4;rci++) // correlation index\r
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta \r
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI \r
+ // correction terms for non-uniform acceptance:\r
+ TString diffFlowDirectCorrectionTermsForNUAName = "fDiffFlowDirectCorrectionTermsForNUA";\r
+ diffFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data();\r
+ for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI)\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos\r
+ {\r
+ for(Int_t cti=0;cti<9;cti++) // correction term index\r
+ {\r
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = new TProfile(Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe],"s"); \r
+ fNestedLoopsList->Add(fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]);\r
+ }\r
+ }\r
+ }\r
+ } \r
+ } // end of if(fEvaluateDiffFlowNestedLoops)\r
+\r
+} // end of AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelations()\r
+{\r
+ // calculate all correlations needed for integrated flow\r
+ \r
+ // multiplicity:\r
+ Double_t dMult = (*fSMpk)(0,0);\r
+ \r
+ // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
+ Double_t dReQ1n = (*fReQ)(0,0);\r
+ Double_t dReQ2n = (*fReQ)(1,0);\r
+ Double_t dReQ3n = (*fReQ)(2,0);\r
+ Double_t dReQ4n = (*fReQ)(3,0);\r
+ Double_t dImQ1n = (*fImQ)(0,0);\r
+ Double_t dImQ2n = (*fImQ)(1,0);\r
+ Double_t dImQ3n = (*fImQ)(2,0);\r
+ Double_t dImQ4n = (*fImQ)(3,0);\r
+ \r
+ // real and imaginary parts of some expressions involving various combinations of Q-vectors evaluated in harmonics n, 2n, 3n and 4n:\r
+ // (these expression appear in the Eqs. for the multi-particle correlations bellow)\r
+ \r
+ // Re[Q_{2n} Q_{n}^* Q_{n}^*]\r
+ Double_t reQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dReQ2n + 2.*dReQ1n*dImQ1n*dImQ2n - pow(dImQ1n,2.)*dReQ2n; \r
+ \r
+ // Im[Q_{2n} Q_{n}^* Q_{n}^*]\r
+ //Double_t imQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dImQ2n-2.*dReQ1n*dImQ1n*dReQ2n-pow(dImQ1n,2.)*dImQ2n; \r
+ \r
+ // Re[Q_{n} Q_{n} Q_{2n}^*] = Re[Q_{2n} Q_{n}^* Q_{n}^*]\r
+ Double_t reQ1nQ1nQ2nstar = reQ2nQ1nstarQ1nstar; \r
+ \r
+ // Re[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*]\r
+ Double_t reQ3nQ1nQ2nstarQ2nstar = (pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n) \r
+ + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n);\r
+\r
+ // Im[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*] \r
+ //Double_t imQ3nQ1nQ2nstarQ2nstar = calculate and implement this (deleteMe)\r
+ \r
+ // Re[Q_{2n} Q_{2n} Q_{3n}^* Q_{1n}^*] = Re[Q_{3n} Q_{n} Q_{2n}^* Q_{2n}^*]\r
+ Double_t reQ2nQ2nQ3nstarQ1nstar = reQ3nQ1nQ2nstarQ2nstar;\r
+ \r
+ // Re[Q_{4n} Q_{2n}^* Q_{2n}^*]\r
+ Double_t reQ4nQ2nstarQ2nstar = pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n;\r
+\r
+ // Im[Q_{4n} Q_{2n}^* Q_{2n}^*]\r
+ //Double_t imQ4nQ2nstarQ2nstar = calculate and implement this (deleteMe)\r
+ \r
+ // Re[Q_{2n} Q_{2n} Q_{4n}^*] = Re[Q_{4n} Q_{2n}^* Q_{2n}^*]\r
+ Double_t reQ2nQ2nQ4nstar = reQ4nQ2nstarQ2nstar;\r
+ \r
+ // Re[Q_{4n} Q_{3n}^* Q_{n}^*]\r
+ Double_t reQ4nQ3nstarQ1nstar = dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n);\r
+ \r
+ // Re[Q_{3n} Q_{n} Q_{4n}^*] = Re[Q_{4n} Q_{3n}^* Q_{n}^*]\r
+ Double_t reQ3nQ1nQ4nstar = reQ4nQ3nstarQ1nstar;\r
+ \r
+ // Im[Q_{4n} Q_{3n}^* Q_{n}^*]\r
+ //Double_t imQ4nQ3nstarQ1nstar = calculate and implement this (deleteMe)\r
+\r
+ // Re[Q_{3n} Q_{2n}^* Q_{n}^*]\r
+ Double_t reQ3nQ2nstarQ1nstar = dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n\r
+ + dImQ3n*dImQ2n*dReQ1n;\r
+ \r
+ // Re[Q_{2n} Q_{n} Q_{3n}^*] = Re[Q_{3n} Q_{2n}^* Q_{n}^*]\r
+ Double_t reQ2nQ1nQ3nstar = reQ3nQ2nstarQ1nstar;\r
+ \r
+ // Im[Q_{3n} Q_{2n}^* Q_{n}^*]\r
+ //Double_t imQ3nQ2nstarQ1nstar; //calculate and implement this (deleteMe)\r
+ \r
+ // Re[Q_{3n} Q_{n}^* Q_{n}^* Q_{n}^*]\r
+ Double_t reQ3nQ1nstarQ1nstarQ1nstar = dReQ3n*pow(dReQ1n,3)-3.*dReQ1n*dReQ3n*pow(dImQ1n,2)\r
+ + 3.*dImQ1n*dImQ3n*pow(dReQ1n,2)-dImQ3n*pow(dImQ1n,3);\r
+\r
+ // Im[Q_{3n} Q_{n}^* Q_{n}^* Q_{n}^*]\r
+ //Double_t imQ3nQ1nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe)\r
+ \r
+ // |Q_{2n}|^2 |Q_{n}|^2\r
+ Double_t dQ2nQ1nQ2nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.));\r
+ \r
+ // Re[Q_{4n} Q_{2n}^* Q_{n}^* Q_{n}^*]\r
+ Double_t reQ4nQ2nstarQ1nstarQ1nstar = (dReQ4n*dReQ2n+dImQ4n*dImQ2n)*(pow(dReQ1n,2)-pow(dImQ1n,2))\r
+ + 2.*dReQ1n*dImQ1n*(dImQ4n*dReQ2n-dReQ4n*dImQ2n); \r
+ \r
+ // Im[Q_{4n} Q_{2n}^* Q_{n}^* Q_{n}^*]\r
+ //Double_t imQ4nQ2nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe)\r
+ \r
+ // Re[Q_{2n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^*]\r
+ Double_t reQ2nQ1nQ1nstarQ1nstarQ1nstar = (dReQ2n*dReQ1n-dImQ2n*dImQ1n)*(pow(dReQ1n,3)-3.*dReQ1n*pow(dImQ1n,2))\r
+ + (dReQ2n*dImQ1n+dReQ1n*dImQ2n)*(3.*dImQ1n*pow(dReQ1n,2)-pow(dImQ1n,3));\r
+\r
+ // Im[Q_{2n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^*] \r
+ //Double_t imQ2nQ1nQ1nstarQ1nstarQ1nstar; //calculate and implement this (deleteMe)\r
+ \r
+ // Re[Q_{2n} Q_{2n} Q_{2n}^* Q_{n}^* Q_{n}^*]\r
+ Double_t reQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))\r
+ * (dReQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) + 2.*dImQ2n*dReQ1n*dImQ1n);\r
+\r
+ // Im[Q_{2n} Q_{2n} Q_{2n}^* Q_{n}^* Q_{n}^*]\r
+ //Double_t imQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))\r
+ // * (dImQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) - 2.*dReQ2n*dReQ1n*dImQ1n);\r
+ \r
+ // Re[Q_{4n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]\r
+ Double_t reQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dReQ4n-6.*pow(dReQ1n,2.)*dReQ4n*pow(dImQ1n,2.)\r
+ + pow(dImQ1n,4.)*dReQ4n+4.*pow(dReQ1n,3.)*dImQ1n*dImQ4n\r
+ - 4.*pow(dImQ1n,3.)*dReQ1n*dImQ4n;\r
+ \r
+ // Im[Q_{4n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]\r
+ //Double_t imQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dImQ4n-6.*pow(dReQ1n,2.)*dImQ4n*pow(dImQ1n,2.)\r
+ // + pow(dImQ1n,4.)*dImQ4n+4.*pow(dImQ1n,3.)*dReQ1n*dReQ4n\r
+ // - 4.*pow(dReQ1n,3.)*dImQ1n*dReQ4n;\r
+ \r
+ // Re[Q_{3n} Q_{n} Q_{2n}^* Q_{n}^* Q_{n}^*]\r
+ Double_t reQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.))\r
+ * (dReQ1n*dReQ2n*dReQ3n-dReQ3n*dImQ1n*dImQ2n+dReQ2n*dImQ1n*dImQ3n+dReQ1n*dImQ2n*dImQ3n);\r
+ \r
+ // Im[Q_{3n} Q_{n} Q_{2n}^* Q_{n}^* Q_{n}^*]\r
+ //Double_t imQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.))\r
+ // * (-dReQ2n*dReQ3n*dImQ1n-dReQ1n*dReQ3n*dImQ2n+dReQ1n*dReQ2n*dImQ3n-dImQ1n*dImQ2n*dImQ3n);\r
+ \r
+ \r
+ // Re[Q_{2n} Q_{2n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]\r
+ Double_t reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)*dReQ2n-2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.)\r
+ + dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dImQ2n)\r
+ * (pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.)\r
+ - dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n+pow(dImQ1n,2.)*dImQ2n);\r
+ \r
+ // Im[Q_{2n} Q_{2n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]\r
+ //Double_t imQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = 2.*(pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.)\r
+ // + 2.*dReQ1n*dImQ1n*dImQ2n)*(pow(dReQ1n,2.)*dImQ2n\r
+ // - 2.*dReQ1n*dImQ1n*dReQ2n-pow(dImQ1n,2.)*dImQ2n);\r
+ \r
+ // Re[Q_{3n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]\r
+ Double_t reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.))\r
+ * (pow(dReQ1n,3.)*dReQ3n-3.*dReQ1n*dReQ3n*pow(dImQ1n,2.)\r
+ + 3.*pow(dReQ1n,2.)*dImQ1n*dImQ3n-pow(dImQ1n,3.)*dImQ3n);\r
+ \r
+ // Im[Q_{3n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] \r
+ //Double_t imQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.))\r
+ // * (pow(dImQ1n,3.)*dReQ3n-3.*dImQ1n*dReQ3n*pow(dReQ1n,2.)\r
+ // - 3.*pow(dImQ1n,2.)*dReQ1n*dImQ3n+pow(dReQ1n,3.)*dImQ3n);\r
+ \r
+ // |Q_{2n}|^2 |Q_{n}|^4\r
+ Double_t dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.);\r
+ \r
+ // Re[Q_{2n} Q_{n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*]\r
+ Double_t reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)\r
+ * (pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.)\r
+ + 2.*dReQ1n*dImQ1n*dImQ2n);\r
+ \r
+ // Im[Q_{2n} Q_{n} Q_{n} Q_{n}^* Q_{n}^* Q_{n}^* Q_{n}^*] \r
+ //Double_t imQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)\r
+ // * (pow(dReQ1n,2.)*dImQ2n-dImQ2n*pow(dImQ1n,2.)\r
+ // - 2.*dReQ1n*dReQ2n*dImQ1n);\r
+ \r
+ \r
+ \r
+ \r
+ // **************************************\r
+ // **** multi-particle correlations: ****\r
+ // **************************************\r
+ //\r
+ // Remark 1: multi-particle correlations calculated with non-weighted Q-vectors are stored in 1D profile fQCorrelations[0]. // to be improved (wrong profiles)\r
+ // Remark 2: binning of fQCorrelations[0] is organized as follows: // to be improved (wrong profiles)\r
+ // --------------------------------------------------------------------------------------------------------------------\r
+ // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))>\r
+ // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))>\r
+ // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))> \r
+ // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))>\r
+ // 5th bin: ---- EMPTY ----\r
+ // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))>\r
+ // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))>\r
+ // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))>\r
+ // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))>\r
+ // 10th bin: ---- EMPTY ----\r
+ // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))>\r
+ // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))>\r
+ // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))>\r
+ // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))> \r
+ // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))>\r
+ // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))>\r
+ // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> \r
+ // 18th bin: ---- EMPTY ----\r
+ // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))>\r
+ // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))>\r
+ // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))>\r
+ // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))>\r
+ // 23rd bin: ---- EMPTY ----\r
+ // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))>\r
+ // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))>\r
+ // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))>\r
+ // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))>\r
+ // 28th bin: ---- EMPTY ----\r
+ // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))>\r
+ // 30th bin: ---- EMPTY ----\r
+ // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))>\r
+ // --------------------------------------------------------------------------------------------------------------------\r
+ \r
+ // 2-particle:\r
+ Double_t two1n1n = 0.; // <cos(n*(phi1-phi2))>\r
+ Double_t two2n2n = 0.; // <cos(2n*(phi1-phi2))>\r
+ Double_t two3n3n = 0.; // <cos(3n*(phi1-phi2))>\r
+ Double_t two4n4n = 0.; // <cos(4n*(phi1-phi2))>\r
+ \r
+ if(dMult>1)\r
+ {\r
+ two1n1n = (pow(dReQ1n,2.)+pow(dImQ1n,2.)-dMult)/(dMult*(dMult-1.)); \r
+ two2n2n = (pow(dReQ2n,2.)+pow(dImQ2n,2.)-dMult)/(dMult*(dMult-1.)); \r
+ two3n3n = (pow(dReQ3n,2.)+pow(dImQ3n,2.)-dMult)/(dMult*(dMult-1.)); \r
+ two4n4n = (pow(dReQ4n,2.)+pow(dImQ4n,2.)-dMult)/(dMult*(dMult-1.)); \r
+ \r
+ // average 2-particle correlations for single event: \r
+ fIntFlowCorrelationsAllEBE->SetBinContent(1,two1n1n);\r
+ fIntFlowCorrelationsAllEBE->SetBinContent(2,two2n2n);\r
+ fIntFlowCorrelationsAllEBE->SetBinContent(3,two3n3n);\r
+ fIntFlowCorrelationsAllEBE->SetBinContent(4,two4n4n);\r
+ \r
+ // average 2-particle correlations for all events: \r
+ fIntFlowCorrelationsAllPro->Fill(0.5,two1n1n,dMult*(dMult-1.)); \r
+ fIntFlowCorrelationsAllPro->Fill(1.5,two2n2n,dMult*(dMult-1.)); \r
+ fIntFlowCorrelationsAllPro->Fill(2.5,two3n3n,dMult*(dMult-1.)); \r
+ fIntFlowCorrelationsAllPro->Fill(3.5,two4n4n,dMult*(dMult-1.)); \r
+ \r
+ // store separetately <2> (to be improved: do I really need this?)\r
+ fIntFlowCorrelationsEBE->SetBinContent(1,two1n1n); // <2>\r
+ \r
+ // to be improved (this can be implemented better):\r
+ Double_t mWeight2p = 0.;\r
+ if(!strcmp(fMultiplicityWeight->Data(),"combinations"))\r
+ {\r
+ mWeight2p = dMult*(dMult-1.);\r
+ } else if(!strcmp(fMultiplicityWeight->Data(),"unit"))\r
+ {\r
+ mWeight2p = 1.; \r
+ } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity"))\r
+ {\r
+ mWeight2p = dMult; \r
+ }\r
+ \r
+ fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(1,mWeight2p); // eW_<2>\r
+ fIntFlowCorrelationsPro->Fill(0.5,two1n1n,mWeight2p);\r
+ \r
+ // distribution of <cos(n*(phi1-phi2))>:\r
+ //f2pDistribution->Fill(two1n1n,dMult*(dMult-1.)); \r
+ } // end of if(dMult>1)\r
+ \r
+ // 3-particle:\r
+ Double_t three2n1n1n = 0.; // <cos(n*(2.*phi1-phi2-phi3))>\r
+ Double_t three3n2n1n = 0.; // <cos(n*(3.*phi1-2.*phi2-phi3))>\r
+ Double_t three4n2n2n = 0.; // <cos(n*(4.*phi1-2.*phi2-2.*phi3))>\r
+ Double_t three4n3n1n = 0.; // <cos(n*(4.*phi1-3.*phi2-phi3))>\r
+ \r
+ if(dMult>2)\r
+ {\r
+ three2n1n1n = (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))\r
+ - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult)\r
+ / (dMult*(dMult-1.)*(dMult-2.)); \r
+ three3n2n1n = (reQ3nQ2nstarQ1nstar-(pow(dReQ3n,2.)+pow(dImQ3n,2.))\r
+ - (pow(dReQ2n,2.)+pow(dImQ2n,2.))\r
+ - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult)\r
+ / (dMult*(dMult-1.)*(dMult-2.));\r
+ three4n2n2n = (reQ4nQ2nstarQ2nstar-2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))\r
+ - (pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*dMult)\r
+ / (dMult*(dMult-1.)*(dMult-2.)); \r
+ three4n3n1n = (reQ4nQ3nstarQ1nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.))\r
+ - (pow(dReQ3n,2.)+pow(dImQ3n,2.))\r
+ - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult)\r
+ / (dMult*(dMult-1.)*(dMult-2.)); \r
+ \r
+ // average 3-particle correlations for single event: \r
+ fIntFlowCorrelationsAllEBE->SetBinContent(6,three2n1n1n);\r
+ fIntFlowCorrelationsAllEBE->SetBinContent(7,three3n2n1n);\r
+ fIntFlowCorrelationsAllEBE->SetBinContent(8,three4n2n2n);\r
+ fIntFlowCorrelationsAllEBE->SetBinContent(9,three4n3n1n);\r
+ \r
+ // average 3-particle correlations for all events: \r
+ fIntFlowCorrelationsAllPro->Fill(5.5,three2n1n1n,dMult*(dMult-1.)*(dMult-2.)); \r
+ fIntFlowCorrelationsAllPro->Fill(6.5,three3n2n1n,dMult*(dMult-1.)*(dMult-2.));\r
+ fIntFlowCorrelationsAllPro->Fill(7.5,three4n2n2n,dMult*(dMult-1.)*(dMult-2.)); \r
+ fIntFlowCorrelationsAllPro->Fill(8.5,three4n3n1n,dMult*(dMult-1.)*(dMult-2.)); \r
+ } // end of if(dMult>2)\r
+ \r
+ // 4-particle:\r
+ Double_t four1n1n1n1n = 0.; // <cos(n*(phi1+phi2-phi3-phi4))>\r
+ Double_t four2n2n2n2n = 0.; // <cos(2.*n*(phi1+phi2-phi3-phi4))>\r
+ Double_t four2n1n2n1n = 0.; // <cos(n*(2.*phi1+phi2-2.*phi3-phi4))> \r
+ Double_t four3n1n1n1n = 0.; // <cos(n*(3.*phi1-phi2-phi3-phi4))> \r
+ Double_t four4n2n1n1n = 0.; // <cos(n*(4.*phi1-2.*phi2-phi3-phi4))> \r
+ Double_t four3n1n2n2n = 0.; // <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))> \r
+ Double_t four3n1n3n1n = 0.; // <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> \r
+ \r
+ if(dMult>3)\r
+ {\r
+ four1n1n1n1n = (2.*dMult*(dMult-3.)+pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ1n,2.)\r
+ + pow(dImQ1n,2.))-2.*reQ2nQ1nstarQ1nstar+(pow(dReQ2n,2.)+pow(dImQ2n,2.)))\r
+ / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); \r
+ four2n2n2n2n = (2.*dMult*(dMult-3.)+pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ2n,2.)\r
+ + pow(dImQ2n,2.))-2.*reQ4nQ2nstarQ2nstar+(pow(dReQ4n,2.)+pow(dImQ4n,2.)))\r
+ / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.));\r
+ four2n1n2n1n = (dQ2nQ1nQ2nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar-2.*reQ2nQ1nstarQ1nstar)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
+ - ((dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))\r
+ + (dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-(pow(dReQ3n,2.)+pow(dImQ3n,2.)))\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
+ + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.));\r
+ four3n1n1n1n = (reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar-3.*reQ2nQ1nstarQ1nstar)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
+ + (2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))\r
+ + 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));\r
+ four4n2n1n1n = (reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar-2.*reQ3nQ2nstarQ1nstar)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
+ - (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))\r
+ - 3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
+ - 6./((dMult-1.)*(dMult-2.)*(dMult-3.));\r
+ four3n1n2n2n = (reQ3nQ1nQ2nstarQ2nstar-reQ4nQ2nstarQ2nstar-reQ3nQ1nQ4nstar-2.*reQ3nQ2nstarQ1nstar)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
+ - (2.*reQ1nQ1nQ2nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))\r
+ - 4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
+ - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); \r
+ four3n1n3n1n = ((pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.))\r
+ - 2.*reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
+ + ((pow(dReQ4n,2.)+pow(dImQ4n,2.))-(dMult-4.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))\r
+ + (pow(dReQ2n,2.)+pow(dImQ2n,2.))-(dMult-4.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
+ + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.));\r
+ \r
+ // average 4-particle correlations for single event: \r
+ fIntFlowCorrelationsAllEBE->SetBinContent(11,four1n1n1n1n);\r
+ fIntFlowCorrelationsAllEBE->SetBinContent(12,four2n1n2n1n);\r
+ fIntFlowCorrelationsAllEBE->SetBinContent(13,four2n2n2n2n);\r
+ fIntFlowCorrelationsAllEBE->SetBinContent(14,four3n1n1n1n);\r
+ fIntFlowCorrelationsAllEBE->SetBinContent(15,four3n1n3n1n);\r
+ fIntFlowCorrelationsAllEBE->SetBinContent(16,four3n1n2n2n);\r
+ fIntFlowCorrelationsAllEBE->SetBinContent(17,four4n2n1n1n);\r
+ \r
+ // average 4-particle correlations for all events: \r
+ fIntFlowCorrelationsAllPro->Fill(10.5,four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));\r
+ fIntFlowCorrelationsAllPro->Fill(11.5,four2n1n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));\r
+ fIntFlowCorrelationsAllPro->Fill(12.5,four2n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));\r
+ fIntFlowCorrelationsAllPro->Fill(13.5,four3n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));\r
+ fIntFlowCorrelationsAllPro->Fill(14.5,four3n1n3n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));\r
+ fIntFlowCorrelationsAllPro->Fill(15.5,four3n1n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); \r
+ fIntFlowCorrelationsAllPro->Fill(16.5,four4n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); \r
+ \r
+ // store separetately <4> (to be improved: do I really need this?)\r
+ fIntFlowCorrelationsEBE->SetBinContent(2,four1n1n1n1n); // <4>\r
+ \r
+ // to be improved (this can be implemented better):\r
+ Double_t mWeight4p = 0.;\r
+ if(!strcmp(fMultiplicityWeight->Data(),"combinations"))\r
+ {\r
+ mWeight4p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.);\r
+ } else if(!strcmp(fMultiplicityWeight->Data(),"unit"))\r
+ {\r
+ mWeight4p = 1.; \r
+ } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity"))\r
+ {\r
+ mWeight4p = dMult; \r
+ }\r
+ \r
+ fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(2,mWeight4p); // eW_<4>\r
+ fIntFlowCorrelationsPro->Fill(1.5,four1n1n1n1n,mWeight4p);\r
+ \r
+ // distribution of <cos(n*(phi1+phi2-phi3-phi4))>\r
+ //f4pDistribution->Fill(four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.));\r
+ \r
+ } // end of if(dMult>3)\r
+\r
+ // 5-particle:\r
+ Double_t five2n1n1n1n1n = 0.; // <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))>\r
+ Double_t five2n2n2n1n1n = 0.; // <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))>\r
+ Double_t five3n1n2n1n1n = 0.; // <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))>\r
+ Double_t five4n1n1n1n1n = 0.; // <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))>\r
+ \r
+ if(dMult>4)\r
+ {\r
+ five2n1n1n1n1n = (reQ2nQ1nQ1nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar+6.*reQ3nQ2nstarQ1nstar)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
+ - (reQ2nQ1nQ3nstar+3.*(dMult-6.)*reQ2nQ1nstarQ1nstar+3.*reQ1nQ1nQ2nstar)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
+ - (2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))\r
+ + 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) \r
+ - 3.*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)))\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
+ - 3.*(pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)\r
+ - 2.*(2*dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult*(dMult-4.))\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));\r
+ \r
+ five2n2n2n1n1n = (reQ2nQ2nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ2nQ2nQ3nstarQ1nstar)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
+ + 2.*(reQ4nQ2nstarQ2nstar+4.*reQ3nQ2nstarQ1nstar+reQ3nQ1nQ4nstar)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
+ + (reQ2nQ2nQ4nstar-2.*(dMult-5.)*reQ2nQ1nstarQ1nstar+2.*reQ1nQ1nQ2nstar)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
+ - (2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))\r
+ + 1.*pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)\r
+ - 2.*(3.*dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)))\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
+ - (4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.))\r
+ - 4.*(dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+4.*dMult*(dMult-6.))\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); \r
+\r
+ five4n1n1n1n1n = (reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ4nQ2nstarQ1nstarQ1nstar-4.*reQ3nQ1nstarQ1nstarQ1nstar)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
+ + (8.*reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar+12.*reQ3nQ2nstarQ1nstar+12.*reQ2nQ1nstarQ1nstar)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
+ - (6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+8.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))\r
+ + 12.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+24.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-24.*dMult)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));\r
+ \r
+ five3n1n2n1n1n = (reQ3nQ1nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
+ - (reQ3nQ1nQ2nstarQ2nstar-3.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
+ - ((2.*dMult-13.)*reQ3nQ2nstarQ1nstar-reQ3nQ1nQ4nstar-9.*reQ2nQ1nstarQ1nstar)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
+ - (2.*reQ1nQ1nQ2nstar+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))\r
+ - 2.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+2.*(pow(dReQ3n,2.)\r
+ + pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
+ + (2.*(dMult-6.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))\r
+ - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.))\r
+ - pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)\r
+ + 2.*(3.*dMult-11.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.))\r
+ - 4.*(dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));\r
+ \r
+ // average 5-particle correlations for single event: \r
+ fIntFlowCorrelationsAllEBE->SetBinContent(19,five2n1n1n1n1n);\r
+ fIntFlowCorrelationsAllEBE->SetBinContent(20,five2n2n2n1n1n);\r
+ fIntFlowCorrelationsAllEBE->SetBinContent(21,five3n1n2n1n1n);\r
+ fIntFlowCorrelationsAllEBE->SetBinContent(22,five4n1n1n1n1n);\r
+ \r
+ // average 5-particle correlations for all events: \r
+ fIntFlowCorrelationsAllPro->Fill(18.5,five2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); \r
+ fIntFlowCorrelationsAllPro->Fill(19.5,five2n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));\r
+ fIntFlowCorrelationsAllPro->Fill(20.5,five3n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));\r
+ fIntFlowCorrelationsAllPro->Fill(21.5,five4n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.));\r
+ } // end of if(dMult>4)\r
+ \r
+ // 6-particle:\r
+ Double_t six1n1n1n1n1n1n = 0.; // <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))>\r
+ Double_t six2n2n1n1n1n1n = 0.; // <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))>\r
+ Double_t six3n1n1n1n1n1n = 0.; // <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))>\r
+ Double_t six2n1n1n2n1n1n = 0.; // <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))>\r
+ \r
+ if(dMult>5)\r
+ {\r
+ six1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),3.)+9.*dQ2nQ1nQ2nstarQ1nstar-6.*reQ2nQ1nQ1nstarQ1nstarQ1nstar)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.))\r
+ + 4.*(reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.))\r
+ + 2.*(9.*(dMult-4.)*reQ2nQ1nstarQ1nstar+2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)))\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.))\r
+ - 9.*(pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)+(pow(dReQ2n,2.)+pow(dImQ2n,2.)))\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-5.))\r
+ + (18.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)))\r
+ / (dMult*(dMult-1)*(dMult-3)*(dMult-4))\r
+ - 6./((dMult-1.)*(dMult-2.)*(dMult-3.));\r
+ \r
+ six2n1n1n2n1n1n = (dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)\r
+ * (2.*five2n2n2n1n1n+4.*five2n1n1n1n1n+4.*five3n1n2n1n1n+4.*four2n1n2n1n+1.*four1n1n1n1n)\r
+ - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four1n1n1n1n+4.*two1n1n\r
+ + 2.*three2n1n1n+2.*three2n1n1n+4.*four3n1n1n1n+8.*three2n1n1n+2.*four4n2n1n1n\r
+ + 4.*four2n1n2n1n+2.*two2n2n+8.*four2n1n2n1n+4.*four3n1n3n1n+8.*three3n2n1n\r
+ + 4.*four3n1n2n2n+4.*four1n1n1n1n+4.*four2n1n2n1n+1.*four2n2n2n2n)\r
+ - dMult*(dMult-1.)*(dMult-2.)*(2.*three2n1n1n+8.*two1n1n+4.*two1n1n+2.\r
+ + 4.*two1n1n+4.*three2n1n1n+2.*two2n2n+4.*three2n1n1n+8.*three3n2n1n\r
+ + 8.*two2n2n+4.*three4n3n1n+4.*two3n3n+4.*three3n2n1n+4.*two1n1n\r
+ + 8.*three2n1n1n+4.*two1n1n+4.*three3n2n1n+4.*three2n1n1n+2.*two2n2n\r
+ + 4.*three3n2n1n+2.*three4n2n2n)-dMult*(dMult-1.)\r
+ * (4.*two1n1n+4.+4.*two1n1n+2.*two2n2n+1.+4.*two1n1n+4.*two2n2n+4.*two3n3n\r
+ + 1.+2.*two2n2n+1.*two4n4n)-dMult)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed)\r
+ \r
+ six2n2n1n1n1n1n = (reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)\r
+ * (five4n1n1n1n1n+8.*five2n1n1n1n1n+6.*five2n2n2n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)\r
+ * (4.*four3n1n1n1n+6.*four4n2n1n1n+12.*three2n1n1n+12.*four1n1n1n1n+24.*four2n1n2n1n\r
+ + 4.*four3n1n2n2n+3.*four2n2n2n2n)-dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+12.*three3n2n1n\r
+ + 4.*three4n3n1n+3.*three4n2n2n+8.*three2n1n1n+24.*two1n1n+12.*two2n2n+12.*three2n1n1n+8.*three3n2n1n\r
+ + 1.*three4n2n2n)-dMult*(dMult-1.)*(4.*two1n1n+6.*two2n2n+4.*two3n3n+1.*two4n4n+2.*two2n2n+8.*two1n1n+6.)-dMult)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed)\r
+ \r
+ six3n1n1n1n1n1n = (reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)\r
+ * (five4n1n1n1n1n+4.*five2n1n1n1n1n+6.*five3n1n2n1n1n+4.*four3n1n1n1n)\r
+ - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four3n1n1n1n+6.*four4n2n1n1n+6.*four1n1n1n1n\r
+ + 12.*three2n1n1n+12.*four2n1n2n1n+6.*four3n1n1n1n+12.*three3n2n1n+4.*four3n1n3n1n+3.*four3n1n2n2n)\r
+ - dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+12.*three3n2n1n+4.*three4n3n1n+3.*three4n2n2n+4.*two1n1n\r
+ + 12.*two1n1n+6.*three2n1n1n+12.*three2n1n1n+4.*three3n2n1n+12.*two2n2n+4.*three3n2n1n+4.*two3n3n+1.*three4n3n1n\r
+ + 6.*three3n2n1n)-dMult*(dMult-1.)*(4.*two1n1n+6.*two2n2n+4.*two3n3n+1.*two4n4n+1.*two1n1n+4.+6.*two1n1n+4.*two2n2n\r
+ + 1.*two3n3n)-dMult)/(dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); // to be improved (direct formula needed)\r
+ \r
+ // average 6-particle correlations for single event: \r
+ fIntFlowCorrelationsAllEBE->SetBinContent(24,six1n1n1n1n1n1n);\r
+ fIntFlowCorrelationsAllEBE->SetBinContent(25,six2n1n1n2n1n1n);\r
+ fIntFlowCorrelationsAllEBE->SetBinContent(26,six2n2n1n1n1n1n);\r
+ fIntFlowCorrelationsAllEBE->SetBinContent(27,six3n1n1n1n1n1n);\r
+ \r
+ // average 6-particle correlations for all events: \r
+ fIntFlowCorrelationsAllPro->Fill(23.5,six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); \r
+ fIntFlowCorrelationsAllPro->Fill(24.5,six2n1n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); \r
+ fIntFlowCorrelationsAllPro->Fill(25.5,six2n2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.));\r
+ fIntFlowCorrelationsAllPro->Fill(26.5,six3n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); \r
+\r
+ // store separetately <6> (to be improved: do I really need this?)\r
+ fIntFlowCorrelationsEBE->SetBinContent(3,six1n1n1n1n1n1n); // <6>\r
+ \r
+ // to be improved (this can be implemented better):\r
+ Double_t mWeight6p = 0.;\r
+ if(!strcmp(fMultiplicityWeight->Data(),"combinations"))\r
+ {\r
+ mWeight6p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.);\r
+ } else if(!strcmp(fMultiplicityWeight->Data(),"unit"))\r
+ {\r
+ mWeight6p = 1.; \r
+ } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity"))\r
+ {\r
+ mWeight6p = dMult; \r
+ }\r
+ \r
+ fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(3,mWeight6p); // eW_<6>\r
+ fIntFlowCorrelationsPro->Fill(2.5,six1n1n1n1n1n1n,mWeight6p);\r
+ \r
+ // distribution of <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))>\r
+ //f6pDistribution->Fill(six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); \r
+ } // end of if(dMult>5)\r
+ \r
+ // 7-particle:\r
+ Double_t seven2n1n1n1n1n1n1n = 0.; // <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))>\r
+ \r
+ if(dMult>6)\r
+ {\r
+ seven2n1n1n1n1n1n1n = (reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)\r
+ * (2.*six3n1n1n1n1n1n+4.*six1n1n1n1n1n1n+1.*six2n2n1n1n1n1n+6.*six2n1n1n2n1n1n+8.*five2n1n1n1n1n)\r
+ - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(1.*five4n1n1n1n1n +8.*five2n1n1n1n1n+8.*four3n1n1n1n\r
+ + 12.*five3n1n2n1n1n+4.*five2n1n1n1n1n+3.*five2n2n2n1n1n+6.*five2n2n2n1n1n+6.*four1n1n1n1n+24.*four1n1n1n1n\r
+ + 12.*five2n1n1n1n1n+12.*five2n1n1n1n1n+12.*three2n1n1n+24.*four2n1n2n1n+4.*five3n1n2n1n1n+4.*five2n1n1n1n1n)\r
+ - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(4.*four3n1n1n1n+6.*four4n2n1n1n+12.*four1n1n1n1n+24.*three2n1n1n\r
+ + 24.*four2n1n2n1n+12.*four3n1n1n1n+24.*three3n2n1n+8.*four3n1n3n1n+6.*four3n1n2n2n+6.*three2n1n1n+12.*four1n1n1n1n\r
+ + 12.*four2n1n2n1n+6.*three2n1n1n+12.*four2n1n2n1n+4.*four3n1n2n2n+3.*four2n2n2n2n+4.*four1n1n1n1n+6.*three2n1n1n\r
+ + 24.*two1n1n+24.*four1n1n1n1n+4.*four3n1n1n1n+24.*two1n1n+24.*three2n1n1n+12.*two2n2n+24.*three2n1n1n+12.*four2n1n2n1n\r
+ + 8.*three3n2n1n+8.*four2n1n2n1n+1.*four4n2n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(6.*three2n1n1n+1.*three2n1n1n+8.*two1n1n\r
+ + 12.*three3n2n1n+24.*two1n1n+12.*three2n1n1n+4.*three2n1n1n+8.*two1n1n+4.*three4n3n1n+24.*three2n1n1n+8.*three3n2n1n\r
+ + 12.*two1n1n+12.*two1n1n+3.*three4n2n2n+24.*two2n2n+6.*two2n2n+12.+12.*three3n2n1n+8.*two3n3n+12.*three2n1n1n+24.*two1n1n\r
+ + 4.*three3n2n1n+8.*three3n2n1n+2.*three4n3n1n+12.*two1n1n+8.*three2n1n1n+4.*three2n1n1n+2.*three3n2n1n+6.*two2n2n+8.*two2n2n\r
+ + 1.*three4n2n2n+4.*three3n2n1n+6.*three2n1n1n)-dMult*(dMult-1.)*(4.*two1n1n+2.*two1n1n+6.*two2n2n+8.+1.*two2n2n+4.*two3n3n\r
+ + 12.*two1n1n+4.*two1n1n+1.*two4n4n+8.*two2n2n+6.+2.*two3n3n+4.*two1n1n+1.*two2n2n)-dMult)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)); // to be improved (direct formula needed)\r
+ \r
+ // average 7-particle correlations for single event: \r
+ fIntFlowCorrelationsAllEBE->SetBinContent(29,seven2n1n1n1n1n1n1n);\r
+ \r
+ // average 7-particle correlations for all events: \r
+ fIntFlowCorrelationsAllPro->Fill(28.5,seven2n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.));\r
+ } // end of if(dMult>6)\r
+ \r
+ // 8-particle:\r
+ Double_t eight1n1n1n1n1n1n1n1n = 0.; // <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))>\r
+ if(dMult>7)\r
+ {\r
+ eight1n1n1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),4.)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)\r
+ * (12.*seven2n1n1n1n1n1n1n+16.*six1n1n1n1n1n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)\r
+ * (8.*six3n1n1n1n1n1n+48.*six1n1n1n1n1n1n+6.*six2n2n1n1n1n1n+96.*five2n1n1n1n1n+72.*four1n1n1n1n+36.*six2n1n1n2n1n1n)\r
+ - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(2.*five4n1n1n1n1n+32.*five2n1n1n1n1n+36.*four1n1n1n1n\r
+ + 32.*four3n1n1n1n+48.*five2n1n1n1n1n+48.*five3n1n2n1n1n+144.*five2n1n1n1n1n+288.*four1n1n1n1n+36.*five2n2n2n1n1n\r
+ + 144.*three2n1n1n+96.*two1n1n+144.*four2n1n2n1n)-dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)\r
+ * (8.*four3n1n1n1n+48.*four1n1n1n1n+12.*four4n2n1n1n+96.*four2n1n2n1n+96.*three2n1n1n+72.*three2n1n1n+144.*two1n1n\r
+ + 16.*four3n1n3n1n+48.*four3n1n1n1n+144.*four1n1n1n1n+72.*four1n1n1n1n+96.*three3n2n1n+24.*four3n1n2n2n+144.*four2n1n2n1n\r
+ + 288.*two1n1n+288.*three2n1n1n+9.*four2n2n2n2n+72.*two2n2n+24.)-dMult*(dMult-1.)*(dMult-2.)*(12.*three2n1n1n+16.*two1n1n\r
+ + 24.*three3n2n1n+48.*three2n1n1n+96.*two1n1n+8.*three4n3n1n+32.*three3n2n1n+96.*three2n1n1n+144.*two1n1n+6.*three4n2n2n\r
+ + 96.*two2n2n+36.*two2n2n+72.+48.*three3n2n1n+16.*two3n3n+72.*three2n1n1n+144.*two1n1n)-dMult*(dMult-1.)*(8.*two1n1n\r
+ + 12.*two2n2n+16.+8.*two3n3n+48.*two1n1n+1.*two4n4n+16.*two2n2n+18.)-dMult)\r
+ / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); // to be improved (direct formula needed)\r
+ \r
+ // average 8-particle correlations for single event: \r
+ fIntFlowCorrelationsAllEBE->SetBinContent(31,eight1n1n1n1n1n1n1n1n);\r
+ \r
+ // average 8-particle correlations for all events: \r
+ fIntFlowCorrelationsAllPro->Fill(30.5,eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.));\r
+ \r
+ // store separetately <8> (to be improved: do I really need this?)\r
+ fIntFlowCorrelationsEBE->SetBinContent(4,eight1n1n1n1n1n1n1n1n); // <8>\r
+ \r
+ // to be improved (this can be implemented better):\r
+ Double_t mWeight8p = 0.;\r
+ if(!strcmp(fMultiplicityWeight->Data(),"combinations"))\r
+ {\r
+ mWeight8p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.);\r
+ } else if(!strcmp(fMultiplicityWeight->Data(),"unit"))\r
+ {\r
+ mWeight8p = 1.; \r
+ } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity"))\r
+ {\r
+ mWeight8p = dMult; \r
+ }\r
+ \r
+ fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(4,mWeight8p); // eW_<8>\r
+ fIntFlowCorrelationsPro->Fill(3.5,eight1n1n1n1n1n1n1n1n,mWeight8p); \r
+ \r
+ // distribution of <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))>\r
+ //f8pDistribution->Fill(eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.));\r
+ } // end of if(dMult>7) \r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelations()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrelations()\r
+{\r
+ // Calculate averages of products of correlations for integrated flow // to be improved (this method can be implemented better)\r
+ \r
+ // a) Binning of fIntFlowProductOfCorrelationsPro is organized as follows:\r
+ // 1st bin: <<2><4>> \r
+ // 2nd bin: <<2><6>>\r
+ // 3rd bin: <<2><8>>\r
+ // 4th bin: <<4><6>>\r
+ // 5th bin: <<4><8>>\r
+ // 6th bin: <<6><8>>\r
+\r
+ /*\r
+ Double_t dMult = (*fSMpk)(0,0); // multiplicity \r
+\r
+ Double_t twoEBE = fIntFlowCorrelationsEBE->GetBinContent(1); // <2>\r
+ Double_t fourEBE = fIntFlowCorrelationsEBE->GetBinContent(2); // <4>\r
+ Double_t sixEBE = fIntFlowCorrelationsEBE->GetBinContent(3); // <6>\r
+ Double_t eightEBE = fIntFlowCorrelationsEBE->GetBinContent(4); // <8>\r
+ \r
+ Double_t eW2 = 0.; // event weight for <2>\r
+ Double_t eW4 = 0.; // event weight for <4>\r
+ Double_t eW6 = 0.; // event weight for <6>\r
+ Double_t eW8 = 0.; // event weight for <8>\r
+ \r
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
+ {\r
+ eW2 = dMult*(dMult-1);\r
+ eW4 = dMult*(dMult-1)*(dMult-2)*(dMult-3);\r
+ eW6 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5);\r
+ eW8 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)*(dMult-6)*(dMult-7);\r
+ } else \r
+ {\r
+ eW2 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j;\r
+ eW4 = (*fSMpk)(3,1)-6.*(*fSMpk)(0,2)*(*fSMpk)(1,1) \r
+ + 8.*(*fSMpk)(0,3)*(*fSMpk)(0,1)\r
+ + 3.*(*fSMpk)(1,2)-6.*(*fSMpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l\r
+ }\r
+ \r
+ fIntFlowProductOfCorrelationsPro->Fill(0.5,twoEBE*fourEBE,eW2*eW4); // <<2><4>> \r
+ fIntFlowProductOfCorrelationsPro->Fill(1.5,twoEBE*sixEBE,eW2*eW6); // <<2><6>>\r
+ fIntFlowProductOfCorrelationsPro->Fill(2.5,twoEBE*eightEBE,eW2*eW8); // <<2><8>>\r
+ fIntFlowProductOfCorrelationsPro->Fill(3.5,fourEBE*sixEBE,eW4*eW6); // <<4><6>>\r
+ fIntFlowProductOfCorrelationsPro->Fill(4.5,fourEBE*eightEBE,eW4*eW8); // <<4><8>>\r
+ fIntFlowProductOfCorrelationsPro->Fill(5.5,sixEBE*eightEBE,eW6*eW8); // <<6><8>>\r
+ */\r
+ \r
+ \r
+ Int_t counter = 0;\r
+ \r
+ for(Int_t ci1=1;ci1<4;ci1++)\r
+ {\r
+ for(Int_t ci2=ci1+1;ci2<=4;ci2++)\r
+ {\r
+ fIntFlowProductOfCorrelationsPro->Fill(0.5+counter++,\r
+ fIntFlowCorrelationsEBE->GetBinContent(ci1)*fIntFlowCorrelationsEBE->GetBinContent(ci2),\r
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)*fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2));\r
+ }\r
+ }\r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrelations()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateCovariancesIntFlow()\r
+{\r
+ // a) Calculate unbiased estimators Cov(<2>,<4>), Cov(<2>,<6>), Cov(<2>,<8>), Cov(<4>,<6>), Cov(<4>,<8>) and Cov(<6>,<8>)\r
+ // for covariances V_(<2>,<4>), V_(<2>,<6>), V_(<2>,<8>), V_(<4>,<6>), V_(<4>,<8>) and V_(<6>,<8>).\r
+ // b) Store in histogram fIntFlowCovariances for instance the following: \r
+ //\r
+ // Cov(<2>,<4>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4>}_j)]\r
+ // \r
+ // where N is the number of events, w_{<2>} is event weight for <2> and w_{<4>} is event weight for <4>.\r
+ // c) Binning of fIntFlowCovariances is organized as follows:\r
+ // \r
+ // 1st bin: Cov(<2>,<4>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4>}_j)] \r
+ // 2nd bin: Cov(<2>,<6>) * (sum_{i=1}^{N} w_{<2>}_i w_{<6>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<6>}_j)]\r
+ // 3rd bin: Cov(<2>,<8>) * (sum_{i=1}^{N} w_{<2>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<8>}_j)]\r
+ // 4th bin: Cov(<4>,<6>) * (sum_{i=1}^{N} w_{<4>}_i w_{<6>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<6>}_j)]\r
+ // 5th bin: Cov(<4>,<8>) * (sum_{i=1}^{N} w_{<4>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<8>}_j)]\r
+ // 6th bin: Cov(<6>,<8>) * (sum_{i=1}^{N} w_{<6>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<6>}_i) * (sum_{j=1}^{N} w_{<8>}_j)]\r
+ \r
+ for(Int_t power=0;power<2;power++)\r
+ { \r
+ if(!(fIntFlowCorrelationsPro && fIntFlowProductOfCorrelationsPro \r
+ && fIntFlowSumOfEventWeights[power] && fIntFlowSumOfProductOfEventWeights\r
+ && fIntFlowCovariances)) \r
+ {\r
+ cout<<"WARNING: fIntFlowCorrelationsPro && fIntFlowProductOfCorrelationsPro "<<endl;\r
+ cout<<" && fIntFlowSumOfEventWeights[power] && fIntFlowSumOfProductOfEventWeights"<<endl;\r
+ cout<<" && fIntFlowCovariances is NULL in AFAWQC::FCIF() !!!!"<<endl;\r
+ cout<<"power = "<<power<<endl;\r
+ exit(0);\r
+ }\r
+ }\r
+ \r
+ // average 2-, 4-, 6- and 8-particle correlations for all events:\r
+ Double_t correlation[4] = {0.};\r
+ for(Int_t ci=0;ci<4;ci++)\r
+ {\r
+ correlation[ci] = fIntFlowCorrelationsPro->GetBinContent(ci+1);\r
+ } \r
+ // average products of 2-, 4-, 6- and 8-particle correlations: \r
+ Double_t productOfCorrelations[4][4] = {{0.}};\r
+ Int_t productOfCorrelationsLabel = 1;\r
+ // denominators in the expressions for the unbiased estimator for covariance:\r
+ Double_t denominator[4][4] = {{0.}};\r
+ Int_t sumOfProductOfEventWeightsLabel1 = 1;\r
+ // weight dependent prefactor which multiply unbiased estimators for covariances:\r
+ Double_t wPrefactor[4][4] = {{0.}}; \r
+ Int_t sumOfProductOfEventWeightsLabel2 = 1;\r
+ for(Int_t c1=0;c1<4;c1++)\r
+ {\r
+ for(Int_t c2=c1+1;c2<4;c2++)\r
+ {\r
+ productOfCorrelations[c1][c2] = fIntFlowProductOfCorrelationsPro->GetBinContent(productOfCorrelationsLabel);\r
+ if(fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1) && fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1))\r
+ {\r
+ denominator[c1][c2] = 1.-(fIntFlowSumOfProductOfEventWeights->GetBinContent(sumOfProductOfEventWeightsLabel1))/\r
+ (fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1) \r
+ * fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1));\r
+ \r
+ wPrefactor[c1][c2] = fIntFlowSumOfProductOfEventWeights->GetBinContent(sumOfProductOfEventWeightsLabel2)/ \r
+ (fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1)\r
+ * fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1));\r
+ \r
+ \r
+ }\r
+ productOfCorrelationsLabel++;\r
+ sumOfProductOfEventWeightsLabel1++;\r
+ sumOfProductOfEventWeightsLabel2++; \r
+ }\r
+ }\r
+ \r
+ // covariance label:\r
+ Int_t covarianceLabel = 1;\r
+ for(Int_t c1=0;c1<4;c1++)\r
+ {\r
+ for(Int_t c2=c1+1;c2<4;c2++)\r
+ {\r
+ if(denominator[c1][c2])\r
+ {\r
+ // covariances:\r
+ Double_t cov = (productOfCorrelations[c1][c2]-correlation[c1]*correlation[c2])/denominator[c1][c2]; \r
+ // covarianced multiplied with weight dependent prefactor:\r
+ Double_t wCov = cov * wPrefactor[c1][c2];\r
+ fIntFlowCovariances->SetBinContent(covarianceLabel,wCov);\r
+ }\r
+ covarianceLabel++;\r
+ }\r
+ }\r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::CalculateCovariancesIntFlow()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::FinalizeCorrelationsIntFlow() \r
+{\r
+ // From profile fIntFlowCorrelationsPro access measured correlations and spread, \r
+ // correctly calculate the statistical errors and store the final results and \r
+ // statistical errors for correlations in histogram fIntFlowCorrelationsHist.\r
+ //\r
+ // Remark: Statistical error of correlation is calculated as:\r
+ //\r
+ // statistical error = termA * spread * termB:\r
+ // termA = sqrt{sum_{i=1}^{N} w^2}/(sum_{i=1}^{N} w)\r
+ // termB = 1/sqrt(1-termA^2) \r
+ \r
+ for(Int_t power=0;power<2;power++)\r
+ { \r
+ if(!(fIntFlowCorrelationsHist && fIntFlowCorrelationsPro && fIntFlowSumOfEventWeights[power])) \r
+ {\r
+ cout<<"WARNING: fIntFlowCorrelationsHist && fIntFlowCorrelationsPro && fIntFlowSumOfEventWeights[power] is NULL in AFAWQC::FCIF() !!!!"<<endl;\r
+ cout<<"power = "<<power<<endl;\r
+ exit(0);\r
+ }\r
+ }\r
+ \r
+ for(Int_t ci=1;ci<=4;ci++) // correlation index\r
+ {\r
+ Double_t correlation = fIntFlowCorrelationsPro->GetBinContent(ci);\r
+ Double_t spread = fIntFlowCorrelationsPro->GetBinError(ci);\r
+ Double_t sumOfLinearEventWeights = fIntFlowSumOfEventWeights[0]->GetBinContent(ci);\r
+ Double_t sumOfQuadraticEventWeights = fIntFlowSumOfEventWeights[1]->GetBinContent(ci);\r
+ Double_t termA = 0.;\r
+ Double_t termB = 0.;\r
+ if(sumOfLinearEventWeights)\r
+ {\r
+ termA = pow(sumOfQuadraticEventWeights,0.5)/sumOfLinearEventWeights;\r
+ } else\r
+ {\r
+ cout<<"WARNING: sumOfLinearEventWeights == 0 in AFAWQC::FCIF() !!!!"<<endl;\r
+ cout<<" (for "<<2*ci<<"-particle correlation)"<<endl;\r
+ }\r
+ if(1.-pow(termA,2.) > 0.)\r
+ {\r
+ termB = 1./pow(1-pow(termA,2.),0.5);\r
+ } else\r
+ {\r
+ cout<<"WARNING: 1.-pow(termA,2.) <= 0 in AFAWQC::FCIF() !!!!"<<endl; \r
+ cout<<" (for "<<2*ci<<"-particle correlation)"<<endl;\r
+ } \r
+ Double_t statisticalError = termA * spread * termB;\r
+ fIntFlowCorrelationsHist->SetBinContent(ci,correlation);\r
+ fIntFlowCorrelationsHist->SetBinError(ci,statisticalError);\r
+ } // end of for(Int_t ci=1;ci<=4;ci++) // correlation index \r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::FinalizeCorrelationsIntFlow()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(Int_t nRP)\r
+{\r
+ // Fill profile fAverageMultiplicity to hold average multiplicities and number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8\r
+ \r
+ // Binning of fAverageMultiplicity is organized as follows:\r
+ // 1st bin: all events (including the empty ones)\r
+ // 2nd bin: event with # of RPs greater or equal to 1\r
+ // 3rd bin: event with # of RPs greater or equal to 2\r
+ // 4th bin: event with # of RPs greater or equal to 3\r
+ // 5th bin: event with # of RPs greater or equal to 4\r
+ // 6th bin: event with # of RPs greater or equal to 5\r
+ // 7th bin: event with # of RPs greater or equal to 6\r
+ // 8th bin: event with # of RPs greater or equal to 7\r
+ // 9th bin: event with # of RPs greater or equal to 8\r
+ \r
+ if(!fAvMultiplicity)\r
+ {\r
+ cout<<"WARNING: fAvMultiplicity is NULL in AFAWQC::FAM() !!!!"<<endl;\r
+ exit(0);\r
+ }\r
+ \r
+ if(nRP<0)\r
+ {\r
+ cout<<"WARNING: nRP<0 in in AFAWQC::FAM() !!!!"<<endl;\r
+ exit(0);\r
+ }\r
+ \r
+ for(Int_t i=0;i<9;i++)\r
+ {\r
+ if(nRP>=i) fAvMultiplicity->Fill(i+0.5,nRP,1);\r
+ }\r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(nRP)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateCumulantsIntFlow()\r
+{\r
+ // a) Calculate Q-cumulants from the measured multiparticle correlations.\r
+ // b) Propagate the statistical errors of measured multiparticle correlations to statistical errors of Q-cumulants. \r
+ // c) REMARK: Q-cumulants calculated in this method are biased by non-uniform acceptance of detector !!!! \r
+ // Method ApplyCorrectionForNonUniformAcceptance* (to be improved: finalize the name here)\r
+ // is called afterwards to correct for this bias. \r
+ // d) Store the results and statistical error of Q-cumulants in histogram fCumulants.\r
+ // Binning of fCumulants is organized as follows:\r
+ //\r
+ // 1st bin: QC{2}\r
+ // 2nd bin: QC{4}\r
+ // 3rd bin: QC{6}\r
+ // 4th bin: QC{8}\r
+ \r
+ if(!(fIntFlowCorrelationsHist && fIntFlowCovariances && fIntFlowQcumulants))\r
+ {\r
+ cout<<"WARNING: fIntFlowCorrelationsHist && fIntFlowCovariances && fIntFlowQcumulants is NULL in AFAWQC::CCIF() !!!!"<<endl;\r
+ exit(0);\r
+ }\r
+ \r
+ // correlations:\r
+ Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> \r
+ Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> \r
+ Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> \r
+ Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> \r
+ \r
+ // statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations:\r
+ Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <2> \r
+ Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <4> \r
+ Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <6> \r
+ Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <8> \r
+ \r
+ // covariances (multiplied by prefactor depending on weights - see comments in CalculateCovariancesIntFlow()):\r
+ Double_t wCov24 = fIntFlowCovariances->GetBinContent(1); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>)\r
+ Double_t wCov26 = fIntFlowCovariances->GetBinContent(2); // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>)\r
+ Double_t wCov28 = fIntFlowCovariances->GetBinContent(3); // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>)\r
+ Double_t wCov46 = fIntFlowCovariances->GetBinContent(4); // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>)\r
+ Double_t wCov48 = fIntFlowCovariances->GetBinContent(5); // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>)\r
+ Double_t wCov68 = fIntFlowCovariances->GetBinContent(6); // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>)\r
+ \r
+ // Q-cumulants: \r
+ Double_t qc2 = 0.; // QC{2}\r
+ Double_t qc4 = 0.; // QC{4}\r
+ Double_t qc6 = 0.; // QC{6}\r
+ Double_t qc8 = 0.; // QC{8}\r
+ if(two) qc2 = two; \r
+ if(four) qc4 = four-2.*pow(two,2.); \r
+ if(six) qc6 = six-9.*two*four+12.*pow(two,3.); \r
+ if(eight) qc8 = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.); \r
+ \r
+ // statistical errors of Q-cumulants: \r
+ Double_t qc2Error = 0.;\r
+ Double_t qc4Error = 0.;\r
+ Double_t qc6Error = 0.;\r
+ Double_t qc8Error = 0.;\r
+ \r
+ // squared statistical errors of Q-cumulants: \r
+ //Double_t qc2ErrorSquared = 0.;\r
+ Double_t qc4ErrorSquared = 0.;\r
+ Double_t qc6ErrorSquared = 0.;\r
+ Double_t qc8ErrorSquared = 0.;\r
+ \r
+ // statistical error of QC{2}: \r
+ qc2Error = twoError; \r
+ \r
+ // statistical error of QC{4}: \r
+ qc4ErrorSquared = 16.*pow(two,2.)*pow(twoError,2)+pow(fourError,2.)\r
+ - 8.*two*wCov24; \r
+ if(qc4ErrorSquared>0.)\r
+ {\r
+ qc4Error = pow(qc4ErrorSquared,0.5);\r
+ } else \r
+ {\r
+ cout<<"WARNING: Statistical error of QC{4} is imaginary !!!!"<<endl;\r
+ }\r
+ \r
+ // statistical error of QC{6}: \r
+ qc6ErrorSquared = 81.*pow(4.*pow(two,2.)-four,2.)*pow(twoError,2.)\r
+ + 81.*pow(two,2.)*pow(fourError,2.)\r
+ + pow(sixError,2.)\r
+ - 162.*two*(4.*pow(two,2.)-four)*wCov24\r
+ + 18.*(4.*pow(two,2.)-four)*wCov26\r
+ - 18.*two*wCov46; \r
+ \r
+ if(qc6ErrorSquared>0.)\r
+ {\r
+ qc6Error = pow(qc6ErrorSquared,0.5);\r
+ } else \r
+ {\r
+ cout<<"WARNING: Statistical error of QC{6} is imaginary !!!!"<<endl;\r
+ }\r
+ \r
+ // statistical error of QC{8}: \r
+ qc8ErrorSquared = 256.*pow(36.*pow(two,3.)-18.*four*two+six,2.)*pow(twoError,2.)\r
+ + 1296.*pow(4.*pow(two,2.)-four,2.)*pow(fourError,2.)\r
+ + 256.*pow(two,2.)*pow(sixError,2.)\r
+ + pow(eightError,2.)\r
+ - 1152.*(36.*pow(two,3.)-18.*four*two+six)*(4.*pow(two,2.)-four)*wCov24\r
+ + 512.*two*(36.*pow(two,3.)-18.*four*two+six)*wCov26\r
+ - 32.*(36.*pow(two,3.)-18.*four*two+six)*wCov28\r
+ - 1152.*two*(4.*pow(two,2.)-four)*wCov46\r
+ + 72.*(4.*pow(two,2.)-four)*wCov48\r
+ - 32.*two*wCov68; \r
+ if(qc8ErrorSquared>0.)\r
+ {\r
+ qc8Error = pow(qc8ErrorSquared,0.5);\r
+ } else \r
+ {\r
+ cout<<"WARNING: Statistical error of QC{8} is imaginary !!!!"<<endl;\r
+ }\r
+\r
+ // store the results and statistical errors for Q-cumulants:\r
+ fIntFlowQcumulants->SetBinContent(1,qc2);\r
+ fIntFlowQcumulants->SetBinError(1,qc2Error);\r
+ fIntFlowQcumulants->SetBinContent(2,qc4);\r
+ fIntFlowQcumulants->SetBinError(2,qc4Error);\r
+ fIntFlowQcumulants->SetBinContent(3,qc6);\r
+ fIntFlowQcumulants->SetBinError(3,qc6Error);\r
+ fIntFlowQcumulants->SetBinContent(4,qc8); \r
+ fIntFlowQcumulants->SetBinError(4,qc8Error); \r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::CalculateCumulantsIntFlow()\r
+\r
+\r
+//================================================================================================================================ \r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateIntFlow()\r
+{\r
+ // a) Calculate the final results for integrated flow estimates from Q-cumulants.\r
+ // b) Propagate the statistical errors of measured multiparticle correlations to statistical errors of integrated flow estimates. \r
+ // c) Store the results and statistical errors of integrated flow estimates in histogram fIntFlow.\r
+ // Binning of fIntFlow is organized as follows:\r
+ //\r
+ // 1st bin: v{2,QC}\r
+ // 2nd bin: v{4,QC}\r
+ // 3rd bin: v{6,QC}\r
+ // 4th bin: v{8,QC}\r
+ \r
+ if(!(fIntFlowCorrelationsHist && fIntFlowCovariances && fIntFlowQcumulants && fIntFlow))\r
+ {\r
+ cout<<"WARNING: fIntFlowCorrelationsHist && fIntFlowCovariances && fIntFlowQcumulants && fIntFlow is NULL in AFAWQC::CCIF() !!!!"<<endl;\r
+ exit(0);\r
+ }\r
+ \r
+ // Q-cumulants:\r
+ Double_t qc2 = fIntFlowQcumulants->GetBinContent(1); // QC{2} \r
+ Double_t qc4 = fIntFlowQcumulants->GetBinContent(2); // QC{4} \r
+ Double_t qc6 = fIntFlowQcumulants->GetBinContent(3); // QC{6} \r
+ Double_t qc8 = fIntFlowQcumulants->GetBinContent(4); // QC{8}\r
+ \r
+ // correlations:\r
+ Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> \r
+ Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> \r
+ Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> \r
+ Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> \r
+ \r
+ // statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations:\r
+ Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <2> \r
+ Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <4> \r
+ Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <6> \r
+ Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <8> \r
+ \r
+ // covariances (multiplied by prefactor depending on weights - see comments in CalculateCovariancesIntFlow()):\r
+ Double_t wCov24 = fIntFlowCovariances->GetBinContent(1); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>)\r
+ Double_t wCov26 = fIntFlowCovariances->GetBinContent(2); // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>)\r
+ Double_t wCov28 = fIntFlowCovariances->GetBinContent(3); // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>)\r
+ Double_t wCov46 = fIntFlowCovariances->GetBinContent(4); // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>)\r
+ Double_t wCov48 = fIntFlowCovariances->GetBinContent(5); // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>)\r
+ Double_t wCov68 = fIntFlowCovariances->GetBinContent(6); // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>)\r
+ \r
+ // integrated flow estimates:\r
+ Double_t v2 = 0.; // v{2,QC} \r
+ Double_t v4 = 0.; // v{4,QC} \r
+ Double_t v6 = 0.; // v{6,QC} \r
+ Double_t v8 = 0.; // v{8,QC}\r
+ \r
+ // calculate integrated flow estimates from Q-cumulants: \r
+ if(qc2>=0.) v2 = pow(qc2,1./2.); \r
+ if(qc4<=0.) v4 = pow(-1.*qc4,1./4.); \r
+ if(qc6>=0.) v6 = pow((1./4.)*qc6,1./6.); \r
+ if(qc8<=0.) v8 = pow((-1./33.)*qc8,1./8.); \r
+ \r
+ // statistical errors of integrated flow estimates:\r
+ Double_t v2Error = 0.; // statistical error of v{2,QC} \r
+ Double_t v4Error = 0.; // statistical error of v{4,QC} \r
+ Double_t v6Error = 0.; // statistical error of v{6,QC} \r
+ Double_t v8Error = 0.; // statistical error of v{8,QC}\r
+ \r
+ // squares of statistical errors of integrated flow estimates:\r
+ Double_t v2ErrorSquared = 0.; // squared statistical error of v{2,QC} \r
+ Double_t v4ErrorSquared = 0.; // squared statistical error of v{4,QC} \r
+ Double_t v6ErrorSquared = 0.; // squared statistical error of v{6,QC} \r
+ Double_t v8ErrorSquared = 0.; // squared statistical error of v{8,QC} \r
+ \r
+ // calculate squared statistical errors of integrated flow estimates:\r
+ if(two > 0.) \r
+ { \r
+ v2ErrorSquared = (1./(4.*two))*pow(twoError,2.);\r
+ } \r
+ if(2.*pow(two,2.)-four > 0.)\r
+ {\r
+ v4ErrorSquared = (1./pow(2.*pow(two,2.)-four,3./2.))*\r
+ (pow(two,2.)*pow(twoError,2.)+(1./16.)*pow(fourError,2.)-(1./2.)*two*wCov24);\r
+ }\r
+ if(six-9.*four*two+12.*pow(two,3.) > 0.) \r
+ {\r
+ v6ErrorSquared = ((1./2.)*(1./pow(2.,2./3.))*(1./pow(six-9.*four*two+12.*pow(two,3.),5./3.)))*\r
+ ((9./2.)*pow(4.*pow(two,2.)-four,2.)*pow(twoError,2.) \r
+ + (9./2.)*pow(two,2.)*pow(fourError,2.)+(1./18.)*pow(sixError,2.)\r
+ - 9.*two*(4.*pow(two,2.)-four)*wCov24+(4.*pow(two,2.)-four)*wCov26-two*wCov46); \r
+ }\r
+ if(-1.*eight+16.*six*two+18.*pow(four,2.)-144.*four*pow(two,2.)+144.*pow(two,4.) > 0.) \r
+ {\r
+ v8ErrorSquared = (4./pow(33,1./4.))*(1./pow(-1.*eight+16.*six*two+18.*pow(four,2.)-144.*four*pow(two,2.)+144.*pow(two,4.),7./4.))*\r
+ (pow(36.*pow(two,3.)-18.*four*two+six,2.)*pow(twoError,2.)\r
+ + (81./16.)*pow(4.*pow(two,2.)-four,2.)*pow(fourError,2.)\r
+ + pow(two,2.)*pow(sixError,2.)\r
+ + (1./256.)*pow(eightError,2.)\r
+ - (9./2.)*(36.*pow(two,3.)-18.*four*two+six)*(4.*pow(two,2.)-four)*wCov24\r
+ + 2.*two*(36.*pow(two,3.)-18.*four*two+six)*wCov26\r
+ - (1./8.)*(36.*pow(two,3.)-18.*four*two+six)*wCov28 \r
+ - (9./2.)*two*(4.*pow(two,2.)-four)*wCov46 \r
+ + (9./32.)*(4.*pow(two,2.)-four)*wCov48 \r
+ - (1./8.)*two*wCov68);\r
+ } \r
+\r
+ // calculate statistical errors of integrated flow estimates: \r
+ if(v2ErrorSquared > 0.)\r
+ {\r
+ v2Error = pow(v2ErrorSquared,0.5);\r
+ } else\r
+ {\r
+ cout<<"WARNING: Statistical error of v{2,QC} is imaginary !!!!"<<endl;\r
+ } \r
+ if(v4ErrorSquared > 0.)\r
+ {\r
+ v4Error = pow(v4ErrorSquared,0.5);\r
+ } else\r
+ {\r
+ cout<<"WARNING: Statistical error of v{4,QC} is imaginary !!!!"<<endl;\r
+ } \r
+ if(v6ErrorSquared > 0.)\r
+ {\r
+ v6Error = pow(v6ErrorSquared,0.5);\r
+ } else\r
+ {\r
+ cout<<"WARNING: Statistical error of v{6,QC} is imaginary !!!!"<<endl;\r
+ } \r
+ if(v8ErrorSquared > 0.)\r
+ {\r
+ v8Error = pow(v8ErrorSquared,0.5);\r
+ } else\r
+ {\r
+ cout<<"WARNING: Statistical error of v{8,QC} is imaginary !!!!"<<endl;\r
+ } \r
+ \r
+ // store the results and statistical errors of integrated flow estimates:\r
+ fIntFlow->SetBinContent(1,v2);\r
+ fIntFlow->SetBinError(1,v2Error);\r
+ fIntFlow->SetBinContent(2,v4);\r
+ fIntFlow->SetBinError(2,v4Error);\r
+ fIntFlow->SetBinContent(3,v6);\r
+ fIntFlow->SetBinError(3,v6Error);\r
+ fIntFlow->SetBinContent(4,v8);\r
+ fIntFlow->SetBinError(4,v8Error);\r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlow()\r
+\r
+\r
+//================================================================================================================================ \r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow()\r
+{\r
+ // Fill in AliFlowCommonHistResults histograms relevant for 'NONAME' integrated flow (to be improved (name))\r
+ \r
+ if(!fIntFlow)\r
+ {\r
+ cout<<"WARNING: fIntFlow is NULL in AFAWQC::FCHRIF() !!!!"<<endl;\r
+ exit(0); \r
+ } \r
+ \r
+ if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th))\r
+ {\r
+ cout<<"WARNING: fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th"<<endl; \r
+ cout<<" is NULL in AFAWQC::FCHRIF() !!!!"<<endl;\r
+ exit(0);\r
+ }\r
+ \r
+ Double_t v2 = fIntFlow->GetBinContent(1);\r
+ Double_t v4 = fIntFlow->GetBinContent(2);\r
+ Double_t v6 = fIntFlow->GetBinContent(3);\r
+ Double_t v8 = fIntFlow->GetBinContent(4);\r
+ \r
+ Double_t v2Error = fIntFlow->GetBinError(1);\r
+ Double_t v4Error = fIntFlow->GetBinError(2);\r
+ Double_t v6Error = fIntFlow->GetBinError(3);\r
+ Double_t v8Error = fIntFlow->GetBinError(4);\r
+ \r
+ fCommonHistsResults2nd->FillIntegratedFlow(v2,v2Error); // to be improved (hardwired 2nd in the name) \r
+ fCommonHistsResults4th->FillIntegratedFlow(v4,v4Error); // to be improved (hardwired 4th in the name)\r
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)) // to be improved (calculate also 6th and 8th order)\r
+ {\r
+ fCommonHistsResults6th->FillIntegratedFlow(v6,v6Error); // to be improved (hardwired 6th in the name)\r
+ fCommonHistsResults8th->FillIntegratedFlow(v8,v8Error); // to be improved (hardwired 8th in the name) \r
+ }\r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow()\r
+\r
+\r
+//================================================================================================================================ \r
+\r
+\r
+/*\r
+void AliFlowAnalysisWithQCumulants::ApplyCorrectionForNonUniformAcceptanceToCumulantsForIntFlow(Bool_t useParticleWeights, TString eventWeights)\r
+{\r
+ // apply correction for non-uniform acceptance to cumulants for integrated flow \r
+ // (Remark: non-corrected cumulants are accessed from fCumulants[pW][0], corrected cumulants are stored in fCumulants[pW][1])\r
+ \r
+ // shortcuts for the flags:\r
+ Int_t pW = (Int_t)(useParticleWeights); // 0=pWeights not used, 1=pWeights used\r
+ Int_t eW = -1;\r
+ \r
+ if(eventWeights == "exact")\r
+ {\r
+ eW = 0;\r
+ }\r
+ \r
+ if(!(fCumulants[pW][eW][0] && fCumulants[pW][eW][1] && fCorrections[pW][eW]))\r
+ {\r
+ cout<<"WARNING: fCumulants[pW][eW][0] && fCumulants[pW][eW][1] && fCorrections[pW][eW] is NULL in AFAWQC::ACFNUATCFIF() !!!!"<<endl;\r
+ cout<<"pW = "<<pW<<endl;\r
+ cout<<"eW = "<<eW<<endl;\r
+ exit(0);\r
+ } \r
+ \r
+ // non-corrected cumulants:\r
+ Double_t qc2 = fCumulants[pW][eW][0]->GetBinContent(1); \r
+ Double_t qc4 = fCumulants[pW][eW][0]->GetBinContent(2); \r
+ Double_t qc6 = fCumulants[pW][eW][0]->GetBinContent(3); \r
+ Double_t qc8 = fCumulants[pW][eW][0]->GetBinContent(4); \r
+ // statistical error of non-corrected cumulants: \r
+ Double_t qc2Error = fCumulants[pW][eW][0]->GetBinError(1); \r
+ Double_t qc4Error = fCumulants[pW][eW][0]->GetBinError(2); \r
+ Double_t qc6Error = fCumulants[pW][eW][0]->GetBinError(3); \r
+ Double_t qc8Error = fCumulants[pW][eW][0]->GetBinError(4); \r
+ // corrections for non-uniform acceptance:\r
+ Double_t qc2Correction = fCorrections[pW][eW]->GetBinContent(1); \r
+ Double_t qc4Correction = fCorrections[pW][eW]->GetBinContent(2); \r
+ Double_t qc6Correction = fCorrections[pW][eW]->GetBinContent(3); \r
+ Double_t qc8Correction = fCorrections[pW][eW]->GetBinContent(4); \r
+ // corrected cumulants:\r
+ Double_t qc2Corrected = qc2 + qc2Correction;\r
+ Double_t qc4Corrected = qc4 + qc4Correction;\r
+ Double_t qc6Corrected = qc6 + qc6Correction;\r
+ Double_t qc8Corrected = qc8 + qc8Correction;\r
+ \r
+ // ... to be improved (I need here also to correct error of QCs for NUA. \r
+ // For simplicity sake I assume at the moment that this correction is negliglible, but it will be added eventually...)\r
+ \r
+ // store corrected results and statistical errors for cumulants: \r
+ fCumulants[pW][eW][1]->SetBinContent(1,qc2Corrected);\r
+ fCumulants[pW][eW][1]->SetBinContent(2,qc4Corrected);\r
+ fCumulants[pW][eW][1]->SetBinContent(3,qc6Corrected);\r
+ fCumulants[pW][eW][1]->SetBinContent(4,qc8Corrected);\r
+ fCumulants[pW][eW][1]->SetBinError(1,qc2Error); // to be improved (correct also qc2Error for NUA)\r
+ fCumulants[pW][eW][1]->SetBinError(2,qc4Error); // to be improved (correct also qc4Error for NUA)\r
+ fCumulants[pW][eW][1]->SetBinError(3,qc6Error); // to be improved (correct also qc6Error for NUA)\r
+ fCumulants[pW][eW][1]->SetBinError(4,qc8Error); // to be improved (correct also qc8Error for NUA) \r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::ApplyCorrectionForNonUniformAcceptanceToCumulantsForIntFlow(Bool_t useParticleWeights, TString eventWeights)\r
+*/\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+/* \r
+void AliFlowAnalysisWithQCumulants::PrintQuantifyingCorrectionsForNonUniformAcceptance(Bool_t useParticleWeights, TString eventWeights)\r
+{\r
+ // print on the screen QC{n,biased}/QC{n,corrected}\r
+ \r
+ // shortcuts for the flags:\r
+ Int_t pW = (Int_t)(useParticleWeights); // 0=pWeights not used, 1=pWeights used\r
+ \r
+ Int_t eW = -1;\r
+ \r
+ if(eventWeights == "exact")\r
+ {\r
+ eW = 0;\r
+ } \r
+ \r
+ if(!(fCumulants[pW][eW][0] && fCumulants[pW][eW][1]))\r
+ {\r
+ cout<<"WARNING: fCumulants[pW][eW][0] && fCumulants[pW][eW][1] is NULL in AFAWQC::PQCFNUA() !!!!"<<endl;\r
+ cout<<"pW = "<<pW<<endl;\r
+ cout<<"eW = "<<eW<<endl;\r
+ exit(0);\r
+ }\r
+ \r
+ cout<<endl;\r
+ cout<<" Quantifying the bias to Q-cumulants from"<<endl;\r
+ cout<<" non-uniform acceptance of the detector:"<<endl;\r
+ cout<<endl;\r
+ \r
+ if(fCumulants[pW][eW][1]->GetBinContent(1)) \r
+ { \r
+ cout<<" QC{2,biased}/QC{2,corrected} = "<<(fCumulants[pW][eW][0]->GetBinContent(1))/(fCumulants[pW][eW][1]->GetBinContent(1))<<endl; \r
+ }\r
+ if(fCumulants[pW][eW][1]->GetBinContent(2)) \r
+ { \r
+ cout<<" QC{4,biased}/QC{4,corrected} = "<<fCumulants[pW][eW][0]->GetBinContent(2)/fCumulants[pW][eW][1]->GetBinContent(2)<<endl; \r
+ }\r
+ \r
+ cout<<endl;\r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::PrintQuantifyingCorrectionsForNonUniformAcceptance(Bool_t useParticleWeights, TString eventWeights)\r
+*/\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelationsUsingParticleWeights()\r
+{\r
+ // Calculate all correlations needed for integrated flow using particle weights.\r
+ \r
+ // Remark 1: When particle weights are used the binning of fIntFlowCorrelationAllPro is organized as follows:\r
+ //\r
+ // 1st bin: <2>_{1n|1n} = two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))>\r
+ // 2nd bin: <2>_{2n|2n} = two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))>\r
+ // 3rd bin: <2>_{3n|3n} = two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> \r
+ // 4th bin: <2>_{4n|4n} = two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))>\r
+ // 5th bin: ---- EMPTY ----\r
+ // 6th bin: <3>_{2n|1n,1n} = three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))>\r
+ // 7th bin: <3>_{3n|2n,1n} = ...\r
+ // 8th bin: <3>_{4n|2n,2n} = ...\r
+ // 9th bin: <3>_{4n|3n,1n} = ...\r
+ // 10th bin: ---- EMPTY ----\r
+ // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))>\r
+ // 12th bin: <4>_{2n,1n|2n,1n} = ...\r
+ // 13th bin: <4>_{2n,2n|2n,2n} = ...\r
+ // 14th bin: <4>_{3n|1n,1n,1n} = ... \r
+ // 15th bin: <4>_{3n,1n|3n,1n} = ...\r
+ // 16th bin: <4>_{3n,1n|2n,2n} = ...\r
+ // 17th bin: <4>_{4n|2n,1n,1n} = ... \r
+ // 18th bin: ---- EMPTY ----\r
+ // 19th bin: <5>_{2n|1n,1n,1n,1n} = ...\r
+ // 20th bin: <5>_{2n,2n|2n,1n,1n} = ...\r
+ // 21st bin: <5>_{3n,1n|2n,1n,1n} = ...\r
+ // 22nd bin: <5>_{4n|1n,1n,1n,1n} = ...\r
+ // 23rd bin: ---- EMPTY ----\r
+ // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = ...\r
+ // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = ...\r
+ // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = ...\r
+ // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = ...\r
+ // 28th bin: ---- EMPTY ----\r
+ // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = ...\r
+ // 30th bin: ---- EMPTY ----\r
+ // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = ...\r
+ \r
+ // Remark 2: When particle weights are used there are some extra correlations. They are stored in \r
+ // fIntFlowExtraCorrelationsPro binning of which is organized as follows:\r
+ \r
+ // 1st bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))>\r
+ // 2nd bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> \r
+
+ // multiplicity (number of particles used to determine the reaction plane)\r
+ Double_t dMult = (*fSMpk)(0,0);\r
+ \r
+ // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
+ Double_t dReQ1n1k = (*fReQ)(0,1);\r
+ Double_t dReQ2n2k = (*fReQ)(1,2);\r
+ Double_t dReQ3n3k = (*fReQ)(2,3);\r
+ Double_t dReQ4n4k = (*fReQ)(3,4);\r
+ Double_t dReQ1n3k = (*fReQ)(0,3);\r
+ Double_t dImQ1n1k = (*fImQ)(0,1);\r
+ Double_t dImQ2n2k = (*fImQ)(1,2);\r
+ Double_t dImQ3n3k = (*fImQ)(2,3);\r
+ Double_t dImQ4n4k = (*fImQ)(3,4);\r
+ Double_t dImQ1n3k = (*fImQ)(0,3);\r
+\r
+ // dMs are variables introduced in order to simplify some Eqs. bellow:\r
+ //..............................................................................................\r
+ Double_t dM11 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j\r
+ Double_t dM22 = (*fSMpk)(1,2)-(*fSMpk)(0,4); // dM22 = sum_{i,j=1,i!=j}^M w_i^2 w_j^2\r
+ Double_t dM33 = (*fSMpk)(1,3)-(*fSMpk)(0,6); // dM33 = sum_{i,j=1,i!=j}^M w_i^3 w_j^3\r
+ Double_t dM44 = (*fSMpk)(1,4)-(*fSMpk)(0,8); // dM44 = sum_{i,j=1,i!=j}^M w_i^4 w_j^4\r
+ Double_t dM31 = (*fSMpk)(0,3)*(*fSMpk)(0,1)-(*fSMpk)(0,4); // dM31 = sum_{i,j=1,i!=j}^M w_i^3 w_j\r
+ Double_t dM211 = (*fSMpk)(0,2)*(*fSMpk)(1,1)-2.*(*fSMpk)(0,3)*(*fSMpk)(0,1)\r
+ - (*fSMpk)(1,2)+2.*(*fSMpk)(0,4); // dM211 = sum_{i,j,k=1,i!=j!=k}^M w_i^2 w_j w_k\r
+ Double_t dM1111 = (*fSMpk)(3,1)-6.*(*fSMpk)(0,2)*(*fSMpk)(1,1) \r
+ + 8.*(*fSMpk)(0,3)*(*fSMpk)(0,1)\r
+ + 3.*(*fSMpk)(1,2)-6.*(*fSMpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l\r
+ //..............................................................................................\r
+\r
+ // 2-particle correlations:\r
+ Double_t two1n1nW1W1 = 0.; // <w1 w2 cos(n*(phi1-phi2))>\r
+ Double_t two2n2nW2W2 = 0.; // <w1^2 w2^2 cos(2n*(phi1-phi2))>\r
+ Double_t two3n3nW3W3 = 0.; // <w1^3 w2^3 cos(3n*(phi1-phi2))>\r
+ Double_t two4n4nW4W4 = 0.; // <w1^4 w2^4 cos(4n*(phi1-phi2))>\r
+ if(dMult>1) \r
+ { \r
+ if(dM11)\r
+ {\r
+ two1n1nW1W1 = (pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSMpk)(0,2))/dM11; \r
+ // average correlation <w1 w2 cos(n*(phi1-phi2))> for single event: \r
+ fIntFlowCorrelationsEBE->SetBinContent(1,two1n1nW1W1);\r
+ fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(1,dM11);\r
+ // average correlation <w1 w2 cos(n*(phi1-phi2))> for all events:\r
+ fIntFlowCorrelationsPro->Fill(0.5,two1n1nW1W1,dM11); \r
+ fIntFlowCorrelationsAllPro->Fill(0.5,two1n1nW1W1,dM11); \r
+ }\r
+ if(dM22)\r
+ {\r
+ two2n2nW2W2 = (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)-(*fSMpk)(0,4))/dM22; \r
+ // ...\r
+ // average correlation <w1^2 w2^2 cos(2n*(phi1-phi2))> for all events:\r
+ fIntFlowCorrelationsAllPro->Fill(1.5,two2n2nW2W2,dM22); \r
+ }\r
+ if(dM33)\r
+ {\r
+ two3n3nW3W3 = (pow(dReQ3n3k,2)+pow(dImQ3n3k,2)-(*fSMpk)(0,6))/dM33;\r
+ // ...\r
+ // average correlation <w1^3 w2^3 cos(3n*(phi1-phi2))> for all events:\r
+ fIntFlowCorrelationsAllPro->Fill(2.5,two3n3nW3W3,dM33); \r
+ }\r
+ if(dM44)\r
+ {\r
+ two4n4nW4W4 = (pow(dReQ4n4k,2)+pow(dImQ4n4k,2)-(*fSMpk)(0,8))/dM44; \r
+ // ...\r
+ // average correlation <w1^4 w2^4 cos(4n*(phi1-phi2))> for all events:\r
+ fIntFlowCorrelationsAllPro->Fill(3.5,two4n4nW4W4,dM44); \r
+ }\r
+ } // end of if(dMult>1) \r
+\r
+ // extra 2-particle correlations:\r
+ Double_t two1n1nW3W1 = 0.; // <w1^3 w2 cos(n*(phi1-phi2))>\r
+ Double_t two1n1nW1W1W2 = 0.; // <w1 w2 w3^2 cos(n*(phi1-phi2))> \r
+ if(dMult>1) \r
+ { \r
+ if(dM31)\r
+ {\r
+ two1n1nW3W1 = (dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k-(*fSMpk)(0,4))/dM31; \r
+ fIntFlowExtraCorrelationsPro->Fill(0.5,two1n1nW3W1,dM31); \r
+ } \r
+ if(dM211)\r
+ {\r
+ two1n1nW1W1W2 = ((*fSMpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSMpk)(0,2))\r
+ - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k\r
+ - (*fSMpk)(0,4)))/dM211;\r
+ fIntFlowExtraCorrelationsPro->Fill(1.5,two1n1nW1W1W2,dM211); \r
+ } \r
+ } // end of if(dMult>1)\r
+ //..............................................................................................\r
+ \r
+ //..............................................................................................\r
+ // 3-particle correlations:\r
+ Double_t three2n1n1nW2W1W1 = 0.; // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))>\r
+ \r
+ if(dMult>2) \r
+ { \r
+ if(dM211)\r
+ { \r
+ three2n1n1nW2W1W1 = (pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k\r
+ - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k)\r
+ - pow(dReQ2n2k,2)-pow(dImQ2n2k,2)\r
+ + 2.*(*fSMpk)(0,4))/dM211; \r
+ fIntFlowCorrelationsAllPro->Fill(5.5,three2n1n1nW2W1W1,dM211);\r
+ } \r
+ } // end of if(dMult>2) \r
+ //..............................................................................................\r
+ \r
+ //..............................................................................................\r
+ // 4-particle correlations:\r
+ Double_t four1n1n1n1nW1W1W1W1 = 0.; // <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))>\r
+ if(dMult>3) \r
+ { \r
+ if(dM1111)\r
+ { \r
+ four1n1n1n1nW1W1W1W1 = (pow(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.),2)\r
+ - 2.*(pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k)\r
+ + 8.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k)\r
+ + (pow(dReQ2n2k,2)+pow(dImQ2n2k,2))\r
+ - 4.*(*fSMpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2))\r
+ - 6.*(*fSMpk)(0,4)+2.*(*fSMpk)(1,2))/dM1111; \r
+ \r
+ // average correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for single event: \r
+ fIntFlowCorrelationsEBE->SetBinContent(2,four1n1n1n1nW1W1W1W1);\r
+ fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(2,dM1111);\r
+ // average correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for all events:\r
+ fIntFlowCorrelationsPro->Fill(1.5,four1n1n1n1nW1W1W1W1,dM1111); \r
+ fIntFlowCorrelationsAllPro->Fill(10.5,four1n1n1n1nW1W1W1W1,dM1111); \r
+ } \r
+ } // end of if(dMult>3) \r
+ //..............................................................................................\r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelationsUsingParticleWeights()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateWeightedQProductsForIntFlow() // to be improved (completed)\r
+{\r
+ // calculate averages like <<2><4>>, <<2><6>>, <<4><6>>, etc. which are needed to calculate covariances \r
+ // Remark: here we take weighted correlations!\r
+ \r
+ /*\r
+ \r
+ // binning of fQProductsW is organized as follows:\r
+ // \r
+ // 1st bin: <2><4> \r
+ // 2nd bin: <2><6>\r
+ // 3rd bin: <2><8>\r
+ // 4th bin: <4><6>\r
+ // 5th bin: <4><8>\r
+ // 6th bin: <6><8>\r
+ \r
+ Double_t dMult = (*fSMpk)(0,0); // multiplicity (number of particles used to determine the reaction plane)\r
+\r
+ Double_t dM11 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j\r
+ Double_t dM1111 = (*fSMpk)(3,1)-6.*(*fSMpk)(0,2)*(*fSMpk)(1,1) \r
+ + 8.*(*fSMpk)(0,3)*(*fSMpk)(0,1)\r
+ + 3.*(*fSMpk)(1,2)-6.*(*fSMpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l\r
+\r
+ Double_t twoEBEW = 0.; // <2>\r
+ Double_t fourEBEW = 0.; // <4>\r
+ \r
+ twoEBEW = fQCorrelationsEBE[1]->GetBinContent(1);\r
+ fourEBEW = fQCorrelationsEBE[1]->GetBinContent(11);\r
+ \r
+ // <2><4>\r
+ if(dMult>3)\r
+ {\r
+ fQProducts[1][0]->Fill(0.5,twoEBEW*fourEBEW,dM11*dM1111);\r
+ }\r
+ \r
+ */\r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::CalculateWeightedQProductsForIntFlow() \r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow()\r
+{\r
+ // Initialize all arrays used to calculate integrated flow.\r
+ \r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
+ {\r
+ fIntFlowCorrectionTermsForNUAEBE[sc] = NULL;\r
+ fIntFlowCorrectionTermsForNUAPro[sc] = NULL;\r
+ fIntFlowCorrectionTermsForNUAHist[sc] = NULL;\r
+ }\r
+ \r
+ for(Int_t power=0;power<2;power++) // linear or quadratic \r
+ {\r
+ fIntFlowSumOfEventWeights[power] = NULL; \r
+ }\r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow()\r
+{\r
+ // Initialize all arrays needed to calculate differential flow.\r
+ // a) Initialize lists holding profiles;\r
+ // b) Initialize lists holding histograms;\r
+ // c) Initialize event-by-event quantities;\r
+ // d) Initialize profiles;\r
+ // e) Initialize histograms holding final results.\r
+ \r
+ // a) Initialize lists holding profiles;\r
+ for(Int_t t=0;t<2;t++) // type (RP, POI)\r
+ {\r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ fDiffFlowCorrelationsProList[t][pe] = NULL;\r
+ fDiffFlowProductOfCorrelationsProList[t][pe] = NULL;\r
+ fDiffFlowCorrectionsProList[t][pe] = NULL;\r
+ }\r
+ } \r
+ \r
+ // b) Initialize lists holding histograms;\r
+ for(Int_t t=0;t<2;t++) // type (RP, POI)\r
+ {\r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ fDiffFlowCorrelationsHistList[t][pe] = NULL;\r
+ for(Int_t power=0;power<2;power++)\r
+ {\r
+ fDiffFlowSumOfEventWeightsHistList[t][pe][power] = NULL;\r
+ } // end of for(Int_t power=0;power<2;power++) \r
+ fDiffFlowSumOfProductOfEventWeightsHistList[t][pe] = NULL;\r
+ fDiffFlowCorrectionsHistList[t][pe] = NULL;\r
+ fDiffFlowCovariancesHistList[t][pe] = NULL;\r
+ fDiffFlowCumulantsHistList[t][pe] = NULL;\r
+ fDiffFlowHistList[t][pe] = NULL;\r
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ } // enf of for(Int_t t=0;t<2;t++) // type (RP, POI) \r
+ \r
+ // c) Initialize event-by-event quantities:\r
+ // 1D:\r
+ for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP)\r
+ {\r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ { \r
+ for(Int_t m=0;m<4;m++) // multiple of harmonic\r
+ {\r
+ for(Int_t k=0;k<9;k++) // power of weight\r
+ {\r
+ fReRPQ1dEBE[t][pe][m][k] = NULL;\r
+ fImRPQ1dEBE[t][pe][m][k] = NULL;\r
+ fs1dEBE[t][pe][k] = NULL; // to be improved (this doesn't need to be within loop over m)\r
+ } \r
+ }\r
+ }\r
+ }\r
+ // 1D:\r
+ for(Int_t t=0;t<2;t++) // type (RP or POI)\r
+ {\r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ { \r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
+ {\r
+ for(Int_t cti=0;cti<9;cti++) // correction term index\r
+ {\r
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti] = NULL;\r
+ } \r
+ }\r
+ }\r
+ }\r
+ // 2D: \r
+ for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP)\r
+ {\r
+ for(Int_t m=0;m<4;m++) // multiple of harmonic\r
+ {\r
+ for(Int_t k=0;k<9;k++) // power of weight\r
+ {\r
+ fReRPQ2dEBE[t][m][k] = NULL;\r
+ fImRPQ2dEBE[t][m][k] = NULL;\r
+ fs2dEBE[t][k] = NULL; // to be improved (this doesn't need to be within loop over m)\r
+ } \r
+ }\r
+ }\r
+ \r
+ // d) Initialize profiles:\r
+ for(Int_t t=0;t<2;t++) // type: RP or POI\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ for(Int_t ci=0;ci<4;ci++) // correlation index\r
+ {\r
+ fDiffFlowCorrelationsPro[t][pe][ci] = NULL;\r
+ } // end of for(Int_t ci=0;ci<4;ci++) \r
+ for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index\r
+ {\r
+ for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index\r
+ {\r
+ fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = NULL;\r
+ } // end of for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index\r
+ } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index \r
+ // correction terms for nua:\r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
+ {\r
+ for(Int_t cti=0;cti<9;cti++) // correction term index\r
+ {\r
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = NULL;\r
+ } \r
+ }\r
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI\r
+ \r
+ // e) Initialize histograms holding final results.\r
+ for(Int_t t=0;t<2;t++) // type: RP or POI\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ for(Int_t ci=0;ci<4;ci++) // correlation index\r
+ {\r
+ fDiffFlowCorrelationsHist[t][pe][ci] = NULL;\r
+ fDiffFlowCumulants[t][pe][ci] = NULL;\r
+ fDiffFlow[t][pe][ci] = NULL;\r
+ } // end of for(Int_t ci=0;ci<4;ci++) \r
+ for(Int_t covarianceIndex=0;covarianceIndex<5;covarianceIndex++) \r
+ {\r
+ fDiffFlowCovariances[t][pe][covarianceIndex] = NULL; \r
+ } // end of for(Int_t covarianceIndex=0;covarianceIndex<5;covarianceIndex++) \r
+ // correction terms for nua:\r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
+ {\r
+ for(Int_t cti=0;cti<9;cti++) // correction term index\r
+ {\r
+ fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = NULL;\r
+ } \r
+ }\r
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI\r
+ \r
+ // sum of event weights for reduced correlations:\r
+ for(Int_t t=0;t<2;t++) // type = RP or POI\r
+ {\r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ for(Int_t p=0;p<2;p++) // power of weight is 1 or 2\r
+ {\r
+ for(Int_t ew=0;ew<4;ew++) // event weight index for reduced correlations\r
+ {\r
+ fDiffFlowSumOfEventWeights[t][pe][p][ew] = NULL;\r
+ } \r
+ } \r
+ }\r
+ }\r
+ // product of event weights for both types of correlations:\r
+ for(Int_t t=0;t<2;t++) // type = RP or POI\r
+ {\r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index\r
+ {\r
+ for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index\r
+ {\r
+ fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = NULL;\r
+ } \r
+ } \r
+ }\r
+ }\r
+\r
+ \r
+ \r
+ \r
+ /*\r
+ \r
+ // nested lists in fDiffFlowProfiles:\r
+ for(Int_t t=0;t<2;t++)\r
+ {\r
+ fDFPType[t] = NULL;\r
+ for(Int_t pW=0;pW<2;pW++) // particle weights not used (0) or used (1)\r
+ {\r
+ fDFPParticleWeights[t][pW] = NULL;\r
+ for(Int_t eW=0;eW<2;eW++)\r
+ { \r
+ fDFPEventWeights[t][pW][eW] = NULL;\r
+ fDiffFlowCorrelations[t][pW][eW] = NULL;\r
+ fDiffFlowProductsOfCorrelations[t][pW][eW] = NULL;\r
+ for(Int_t sc=0;sc<2;sc++)\r
+ {\r
+ fDiffFlowCorrectionTerms[t][pW][eW][sc] = NULL;\r
+ }\r
+ } \r
+ }\r
+ } \r
+ \r
+ \r
+ */\r
+ \r
+ \r
+ \r
+ /*\r
+ for(Int_t pW=0;pW<2;pW++) // particle weights not used (0) or used (1)\r
+ {\r
+ for(Int_t eW=0;eW<2;eW++)\r
+ {\r
+ // correlations:\r
+ for(Int_t correlationIndex=0;correlationIndex<4;correlationIndex++)\r
+ {\r
+ fCorrelationsPro[t][pW][eW][correlationIndex] = NULL;\r
+ }\r
+ // products of correlations:\r
+ for(Int_t productOfCorrelationsIndex=0;productOfCorrelationsIndex<6;productOfCorrelationsIndex++)\r
+ {\r
+ fProductsOfCorrelationsPro[t][pW][eW][productOfCorrelationsIndex] = NULL;\r
+ }\r
+ // correction terms:\r
+ for(Int_t sc=0;sc<2;sc++)\r
+ {\r
+ for(Int_t correctionsIndex=0;correctionsIndex<2;correctionsIndex++)\r
+ {\r
+ fCorrectionTermsPro[t][pW][eW][sc][correctionsIndex] = NULL;\r
+ } \r
+ } \r
+ }\r
+ } \r
+ */\r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow()\r
+\r
+\r
+//================================================================================================================================\r
+ /*\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateCorrelationsForDifferentialFlow2D(TString type)\r
+{\r
+ // calculate all reduced correlations needed for differential flow for each (pt,eta) bin: \r
+ \r
+ if(type == "RP") // to be improved (removed)\r
+ {\r
+ cout<<endl;\r
+ }\r
+ // ... \r
+ \r
+ \r
+ Int_t typeFlag = -1; \r
+ \r
+ // reduced correlations ares stored in fCorrelationsPro[t][pW][index] and are indexed as follows:\r
+ // index:\r
+ // 0: <2'>\r
+ // 1: <4'>\r
+\r
+ // multiplicity:\r
+ Double_t dMult = (*fSMpk)(0,0);\r
+ \r
+ // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
+ Double_t dReQ1n = (*fReQ)(0,0);\r
+ Double_t dReQ2n = (*fReQ)(1,0);\r
+ //Double_t dReQ3n = (*fReQ)(2,0);\r
+ //Double_t dReQ4n = (*fReQ)(3,0);\r
+ Double_t dImQ1n = (*fImQ)(0,0);\r
+ Double_t dImQ2n = (*fImQ)(1,0);\r
+ //Double_t dImQ3n = (*fImQ)(2,0);\r
+ //Double_t dImQ4n = (*fImQ)(3,0);\r
+\r
+ // looping over all (pt,eta) bins and calculating correlations needed for differential flow: \r
+ for(Int_t p=1;p<=fnBinsPt;p++)\r
+ {\r
+ for(Int_t e=1;e<=fnBinsEta;e++)\r
+ {\r
+ // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): \r
+ Double_t p1n0kRe = 0.;\r
+ Double_t p1n0kIm = 0.;\r
+\r
+ // number of POIs in particular (pt,eta) bin:\r
+ Double_t mp = 0.;\r
+\r
+ // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular (pt,eta) bin):\r
+ Double_t q1n0kRe = 0.;\r
+ Double_t q1n0kIm = 0.;\r
+ Double_t q2n0kRe = 0.;\r
+ Double_t q2n0kIm = 0.;\r
+\r
+ // number of particles which are both RPs and POIs in particular (pt,eta) bin:\r
+ Double_t mq = 0.;\r
+ \r
+ // q_{m*n,0}:\r
+ q1n0kRe = fReEBE2D[2][0][0]->GetBinContent(fReEBE2D[2][0][0]->GetBin(p,e))\r
+ * fReEBE2D[2][0][0]->GetBinEntries(fReEBE2D[2][0][0]->GetBin(p,e));\r
+ q1n0kIm = fImEBE2D[2][0][0]->GetBinContent(fImEBE2D[2][0][0]->GetBin(p,e))\r
+ * fImEBE2D[2][0][0]->GetBinEntries(fImEBE2D[2][0][0]->GetBin(p,e));\r
+ q2n0kRe = fReEBE2D[2][1][0]->GetBinContent(fReEBE2D[2][1][0]->GetBin(p,e))\r
+ * fReEBE2D[2][1][0]->GetBinEntries(fReEBE2D[2][1][0]->GetBin(p,e));\r
+ q2n0kIm = fImEBE2D[2][1][0]->GetBinContent(fImEBE2D[2][1][0]->GetBin(p,e))\r
+ * fImEBE2D[2][1][0]->GetBinEntries(fImEBE2D[2][1][0]->GetBin(p,e));\r
+ \r
+ mq = fReEBE2D[2][0][0]->GetBinEntries(fReEBE2D[2][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here)\r
+ \r
+ if(type == "POI")\r
+ {\r
+ // p_{m*n,0}:\r
+ p1n0kRe = fReEBE2D[1][0][0]->GetBinContent(fReEBE2D[1][0][0]->GetBin(p,e))\r
+ * fReEBE2D[1][0][0]->GetBinEntries(fReEBE2D[1][0][0]->GetBin(p,e));\r
+ p1n0kIm = fImEBE2D[1][0][0]->GetBinContent(fImEBE2D[1][0][0]->GetBin(p,e)) \r
+ * fImEBE2D[1][0][0]->GetBinEntries(fImEBE2D[1][0][0]->GetBin(p,e));\r
+ \r
+ mp = fReEBE2D[1][0][0]->GetBinEntries(fReEBE2D[1][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here)\r
+ \r
+ typeFlag = 1;\r
+ }\r
+ else if(type == "RP")\r
+ {\r
+ // p_{m*n,0} = q_{m*n,0}:\r
+ p1n0kRe = q1n0kRe; \r
+ p1n0kIm = q1n0kIm; \r
+ mp = mq; \r
+ \r
+ typeFlag = 0;\r
+ }\r
+ \r
+ // count events with non-empty (pt,eta) bin:\r
+ if(mp>0)\r
+ {\r
+ fNonEmptyBins2D[typeFlag]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,1);\r
+ }\r
+ \r
+ // 2'-particle correlation for particular (pt,eta) bin:\r
+ Double_t two1n1nPtEta = 0.;\r
+ if(mp*dMult-mq)\r
+ {\r
+ two1n1nPtEta = (p1n0kRe*dReQ1n+p1n0kIm*dImQ1n-mq)\r
+ / (mp*dMult-mq);\r
+ \r
+ // fill the 2D profile to get the average correlation for each (pt,eta) bin:\r
+ if(type == "POI")\r
+ { \r
+ //f2pPtEtaPOI->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mp*dMult-mq);\r
+ \r
+ fCorrelationsPro[1][0][0][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mp*dMult-mq);\r
+ }\r
+ else if(type == "RP")\r
+ {\r
+ //f2pPtEtaRP->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mp*dMult-mq); \r
+ fCorrelationsPro[0][0][0][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mp*dMult-mq);\r
+ }\r
+ } // end of if(mp*dMult-mq)\r
+ \r
+ // 4'-particle correlation:\r
+ Double_t four1n1n1n1nPtEta = 0.;\r
+ if((mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression)\r
+ {\r
+ four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n)\r
+ - q2n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.))\r
+ - 2.*q2n0kIm*dReQ1n*dImQ1n\r
+ - p1n0kRe*(dReQ1n*dReQ2n+dImQ1n*dImQ2n)\r
+ + p1n0kIm*(dImQ1n*dReQ2n-dReQ1n*dImQ2n)\r
+ - 2.*dMult*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n)\r
+ - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*mq \r
+ + 6.*(q1n0kRe*dReQ1n+q1n0kIm*dImQ1n) \r
+ + 1.*(q2n0kRe*dReQ2n+q2n0kIm*dImQ2n) \r
+ + 2.*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) \r
+ + 2.*mq*dMult \r
+ - 6.*mq) \r
+ / ((mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); \r
+ \r
+ // fill the 2D profile to get the average correlation for each (pt, eta) bin:\r
+ if(type == "POI")\r
+ {\r
+ //f4pPtEtaPOI->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta,\r
+ // (mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
+ // + mq*(dMult-1.)*(dMult-2.)*(dMult-3.));\r
+ \r
+ fCorrelationsPro[1][0][0][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta,\r
+ (mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.));\r
+ }\r
+ else if(type == "RP")\r
+ {\r
+ //f4pPtEtaRP->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta,\r
+ // (mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
+ // + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); \r
+ \r
+ fCorrelationsPro[0][0][0][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta,\r
+ (mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); \r
+ }\r
+ } // end of if((mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
+ // +mq*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
+ \r
+ } // end of for(Int_t e=1;e<=fnBinsEta;e++)\r
+ } // end of for(Int_t p=1;p<=fnBinsPt;p++)\r
+\r
+ \r
+ \r
+ \r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::CalculateCorrelationsForDifferentialFlow2D()\r
+\r
+\r
+\r
+ \r
+ \r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateWeightedCorrelationsForDifferentialFlow2D(TString type)\r
+{\r
+ // calculate all weighted correlations needed for differential flow \r
+ \r
+ if(type == "RP") // to be improved (removed)\r
+ {\r
+ cout<<endl;\r
+ }\r
+ // ... \r
+ \r
+ \r
+ \r
+ \r
+ // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
+ Double_t dReQ1n1k = (*fReQ)(0,1);\r
+ Double_t dReQ2n2k = (*fReQ)(1,2);\r
+ Double_t dReQ1n3k = (*fReQ)(0,3);\r
+ //Double_t dReQ4n4k = (*fReQ)(3,4);\r
+ Double_t dImQ1n1k = (*fImQ)(0,1);\r
+ Double_t dImQ2n2k = (*fImQ)(1,2);\r
+ Double_t dImQ1n3k = (*fImQ)(0,3);\r
+ //Double_t dImQ4n4k = (*fImQ)(3,4);\r
+ \r
+ // S^M_{p,k} (see .h file for the definition of fSMpk):\r
+ Double_t dSM1p1k = (*fSMpk)(0,1);\r
+ Double_t dSM1p2k = (*fSMpk)(0,2);\r
+ Double_t dSM1p3k = (*fSMpk)(0,3);\r
+ Double_t dSM2p1k = (*fSMpk)(1,1);\r
+ Double_t dSM3p1k = (*fSMpk)(2,1);\r
+ \r
+ // looping over all (pt,eta) bins and calculating weighted correlations needed for differential flow: \r
+ for(Int_t p=1;p<=fnBinsPt;p++)\r
+ {\r
+ for(Int_t e=1;e<=fnBinsEta;e++)\r
+ {\r
+ // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): \r
+ Double_t p1n0kRe = 0.;\r
+ Double_t p1n0kIm = 0.;\r
+\r
+ // number of POIs in particular (pt,eta) bin):\r
+ Double_t mp = 0.;\r
+\r
+ // real and imaginary parts of q_{m*n,k}: \r
+ // (weighted Q-vector evaluated for particles which are both RPs and POIs in particular (pt,eta) bin)\r
+ Double_t q1n2kRe = 0.;\r
+ Double_t q1n2kIm = 0.;\r
+ Double_t q2n1kRe = 0.;\r
+ Double_t q2n1kIm = 0.;\r
+\r
+ // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) \r
+ Double_t s1p1k = 0.; \r
+ Double_t s1p2k = 0.; \r
+ Double_t s1p3k = 0.; \r
+ \r
+ // M0111 from Eq. (118) in QC2c (to be improved (notation))\r
+ Double_t dM0111 = 0.;\r
+ \r
+ if(type == "POI")\r
+ {\r
+ // p_{m*n,0}:\r
+ p1n0kRe = fReEBE2D[1][0][0]->GetBinContent(fReEBE2D[1][0][0]->GetBin(p,e))\r
+ * fReEBE2D[1][0][0]->GetBinEntries(fReEBE2D[1][0][0]->GetBin(p,e));\r
+ p1n0kIm = fImEBE2D[1][0][0]->GetBinContent(fImEBE2D[1][0][0]->GetBin(p,e))\r
+ * fImEBE2D[1][0][0]->GetBinEntries(fImEBE2D[1][0][0]->GetBin(p,e)); \r
+ \r
+ mp = fReEBE2D[1][0][0]->GetBinEntries(fReEBE2D[1][0][0]->GetBin(p,e));\r
+ \r
+ // q_{m*n,k}: \r
+ q1n2kRe = fReEBE2D[2][0][2]->GetBinContent(fReEBE2D[2][0][2]->GetBin(p,e))\r
+ * fReEBE2D[2][0][2]->GetBinEntries(fReEBE2D[2][0][2]->GetBin(p,e));\r
+ q1n2kIm = fImEBE2D[2][0][2]->GetBinContent(fImEBE2D[2][0][2]->GetBin(p,e))\r
+ * fImEBE2D[2][0][2]->GetBinEntries(fImEBE2D[2][0][2]->GetBin(p,e));\r
+ q2n1kRe = fReEBE2D[2][1][1]->GetBinContent(fReEBE2D[2][1][1]->GetBin(p,e))\r
+ * fReEBE2D[2][1][1]->GetBinEntries(fReEBE2D[2][1][1]->GetBin(p,e)); \r
+ q2n1kIm = fImEBE2D[2][1][1]->GetBinContent(fImEBE2D[2][1][1]->GetBin(p,e))\r
+ * fImEBE2D[2][1][1]->GetBinEntries(fImEBE2D[2][1][1]->GetBin(p,e));\r
+ \r
+ // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) \r
+ s1p1k = pow(fs2D[2][1]->GetBinContent(fs2D[2][1]->GetBin(p,e)),1.); \r
+ s1p2k = pow(fs2D[2][2]->GetBinContent(fs2D[2][2]->GetBin(p,e)),1.); \r
+ s1p3k = pow(fs2D[2][3]->GetBinContent(fs2D[2][3]->GetBin(p,e)),1.); \r
+ \r
+ // M0111 from Eq. (118) in QC2c (to be improved (notation)):\r
+ dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k)\r
+ - 3.*(s1p1k*(dSM2p1k-dSM1p2k)\r
+ + 2.*(s1p3k-s1p2k*dSM1p1k));\r
+ }\r
+ else if(type == "RP")\r
+ {\r
+ p1n0kRe = fReEBE2D[0][0][0]->GetBinContent(fReEBE2D[0][0][0]->GetBin(p,e))\r
+ * fReEBE2D[0][0][0]->GetBinEntries(fReEBE2D[0][0][0]->GetBin(p,e));\r
+ p1n0kIm = fImEBE2D[0][0][0]->GetBinContent(fImEBE2D[0][0][0]->GetBin(p,e))\r
+ * fImEBE2D[0][0][0]->GetBinEntries(fImEBE2D[0][0][0]->GetBin(p,e));\r
+ \r
+ mp = fReEBE2D[0][0][0]->GetBinEntries(fReEBE2D[0][0][0]->GetBin(p,e));\r
+ \r
+ // q_{m*n,k}: \r
+ q1n2kRe = fReEBE2D[0][0][2]->GetBinContent(fReEBE2D[0][0][2]->GetBin(p,e))\r
+ * fReEBE2D[0][0][2]->GetBinEntries(fReEBE2D[0][0][2]->GetBin(p,e));\r
+ q1n2kIm = fImEBE2D[0][0][2]->GetBinContent(fImEBE2D[0][0][2]->GetBin(p,e))\r
+ * fImEBE2D[0][0][2]->GetBinEntries(fImEBE2D[0][0][2]->GetBin(p,e));\r
+ q2n1kRe = fReEBE2D[0][1][1]->GetBinContent(fReEBE2D[0][1][1]->GetBin(p,e))\r
+ * fReEBE2D[0][1][1]->GetBinEntries(fReEBE2D[0][1][1]->GetBin(p,e));\r
+ q2n1kIm = fImEBE2D[0][1][1]->GetBinContent(fImEBE2D[0][1][1]->GetBin(p,e))\r
+ * fImEBE2D[0][1][1]->GetBinEntries(fImEBE2D[0][1][1]->GetBin(p,e));\r
+ \r
+ // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) \r
+ s1p1k = pow(fs2D[0][1]->GetBinContent(fs2D[0][1]->GetBin(p,e)),1.); \r
+ s1p2k = pow(fs2D[0][2]->GetBinContent(fs2D[0][2]->GetBin(p,e)),1.); \r
+ s1p3k = pow(fs2D[0][3]->GetBinContent(fs2D[0][3]->GetBin(p,e)),1.); \r
+ \r
+ // M0111 from Eq. (118) in QC2c (to be improved (notation)):\r
+ dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k)\r
+ - 3.*(s1p1k*(dSM2p1k-dSM1p2k)\r
+ + 2.*(s1p3k-s1p2k*dSM1p1k));\r
+ //............................................................................................... \r
+ }\r
+ \r
+ // 2'-particle correlation:\r
+ Double_t two1n1nW0W1PtEta = 0.;\r
+ if(mp*dSM1p1k-s1p1k)\r
+ {\r
+ two1n1nW0W1PtEta = (p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k-s1p1k)\r
+ / (mp*dSM1p1k-s1p1k);\r
+ \r
+ // fill the 2D profile to get the average correlation for each (pt, eta) bin:\r
+ if(type == "POI")\r
+ {\r
+ //f2pPtEtaPOIW->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nW0W1PtEta,\r
+ // mp*dSM1p1k-s1p1k);\r
+ fCorrelationsPro[1][1][0][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nW0W1PtEta,mp*dSM1p1k-s1p1k);\r
+ }\r
+ else if(type == "RP")\r
+ {\r
+ //f2pPtEtaRPW->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nW0W1PtEta,\r
+ // mp*dSM1p1k-s1p1k); \r
+ fCorrelationsPro[0][1][0][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nW0W1PtEta,mp*dSM1p1k-s1p1k); \r
+ }\r
+ } // end of if(mp*dMult-dmPrimePrimePtEta)\r
+ \r
+ // 4'-particle correlation:\r
+ Double_t four1n1n1n1nW0W1W1W1PtEta = 0.;\r
+ if(dM0111)\r
+ {\r
+ four1n1n1n1nW0W1W1W1PtEta = ((pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k)\r
+ - q2n1kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))\r
+ - 2.*q2n1kIm*dReQ1n1k*dImQ1n1k\r
+ - p1n0kRe*(dReQ1n1k*dReQ2n2k+dImQ1n1k*dImQ2n2k)\r
+ + p1n0kIm*(dImQ1n1k*dReQ2n2k-dReQ1n1k*dImQ2n2k)\r
+ - 2.*dSM1p2k*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k)\r
+ - 2.*(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*s1p1k \r
+ + 6.*(q1n2kRe*dReQ1n1k+q1n2kIm*dImQ1n1k) \r
+ + 1.*(q2n1kRe*dReQ2n2k+q2n1kIm*dImQ2n2k) \r
+ + 2.*(p1n0kRe*dReQ1n3k+p1n0kIm*dImQ1n3k) \r
+ + 2.*s1p1k*dSM1p2k \r
+ - 6.*s1p3k) \r
+ / dM0111; // to be imropoved (notation of dM0111)\r
+ \r
+ // fill the 2D profile to get the average correlation for each (pt, eta) bin:\r
+ if(type == "POI")\r
+ {\r
+ //f4pPtEtaPOIW->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nW0W1W1W1PtEta,dM0111);\r
+ fCorrelationsPro[1][1][0][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nW0W1W1W1PtEta,dM0111);\r
+ }\r
+ else if(type == "RP")\r
+ {\r
+ //f4pPtEtaRPW->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nW0W1W1W1PtEta,dM0111); \r
+ fCorrelationsPro[0][1][0][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nW0W1W1W1PtEta,dM0111); \r
+ }\r
+ } // end of if(dM0111)\r
+ \r
+ } // end of for(Int_t e=1;e<=fnBinsEta;e++)\r
+ } // end of for(Int_t p=1;p<=fnBinsPt;p++)\r
+ \r
+ \r
+ \r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::CalculateWeightedCorrelationsForDifferentialFlow2D(TString type)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+ */ \r
+\r
+/*\r
+void AliFlowAnalysisWithQCumulants::FinalizeCorrelationsForDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights)\r
+{\r
+ // 1.) Access average for 2D correlations from profiles and store them in 2D final results histograms;\r
+ // 2.) Access spread for 2D correlations from profiles, calculate error and store it in 2D final results histograms;\r
+ // 3.) Make projections along pt and eta axis and store results and errors in 1D final results histograms. \r
+ \r
+ Int_t typeFlag = -1;\r
+ Int_t pWeightsFlag = -1;\r
+ Int_t eWeightsFlag = -1;\r
+\r
+ if(type == "RP")\r
+ {\r
+ typeFlag = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ typeFlag = 1;\r
+ } else \r
+ {\r
+ cout<<"WARNING: type must be either RP or POI in AFAWQC::FCFDF() !!!!"<<endl;\r
+ exit(0);\r
+ }\r
+ \r
+ if(!useParticleWeights)\r
+ {\r
+ pWeightsFlag = 0;\r
+ } else \r
+ {\r
+ pWeightsFlag = 1; \r
+ } \r
+ \r
+ if(eventWeights == "exact")\r
+ {\r
+ eWeightsFlag = 0;\r
+ } \r
+ \r
+ // shortcuts:\r
+ Int_t t = typeFlag;\r
+ Int_t pW = pWeightsFlag;\r
+ Int_t eW = eWeightsFlag;\r
+ \r
+ // from 2D histogram fNonEmptyBins2D make two 1D histograms fNonEmptyBins1D in pt and eta (to be improved (i.e. moved somewhere else)) \r
+ // pt:\r
+ for(Int_t p=1;p<fnBinsPt;p++)\r
+ {\r
+ Double_t contentPt = 0.;\r
+ for(Int_t e=1;e<=fnBinsEta;e++)\r
+ {\r
+ contentPt += (fNonEmptyBins2D[t]->GetBinContent(fNonEmptyBins2D[t]->GetBin(p,e))); \r
+ }\r
+ fNonEmptyBins1D[t][0]->SetBinContent(p,contentPt);\r
+ }\r
+ // eta:\r
+ for(Int_t e=1;e<fnBinsEta;e++)\r
+ {\r
+ Double_t contentEta = 0.;\r
+ for(Int_t p=1;p<=fnBinsPt;p++)\r
+ {\r
+ contentEta += (fNonEmptyBins2D[t]->GetBinContent(fNonEmptyBins2D[t]->GetBin(p,e))); \r
+ }\r
+ fNonEmptyBins1D[t][1]->SetBinContent(e,contentEta);\r
+ }\r
+ \r
+ // from 2D profile in (pt,eta) make two 1D profiles in (pt) and (eta):\r
+ TProfile *profile[2][4]; // [0=pt,1=eta][correlation index] // to be improved (do not hardwire the correlation index)\r
+ \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ for(Int_t ci=0;ci<4;ci++) // correlation index\r
+ {\r
+ if(pe==0) profile[pe][ci] = this->MakePtProjection(fCorrelationsPro[t][pW][eW][ci]);\r
+ if(pe==1) profile[pe][ci] = this->MakeEtaProjection(fCorrelationsPro[t][pW][eW][ci]);\r
+ }\r
+ }\r
+ \r
+ // transfer 2D profile into 2D histogram:\r
+ // to be improved (see in documentation if there is a method to transfer values from 2D profile into 2D histogram) \r
+ for(Int_t ci=0;ci<4;ci++)\r
+ {\r
+ for(Int_t p=1;p<=fnBinsPt;p++)\r
+ {\r
+ for(Int_t e=1;e<=fnBinsEta;e++)\r
+ {\r
+ Double_t correlation = fCorrelationsPro[t][pW][eW][ci]->GetBinContent(fCorrelationsPro[t][pW][eW][ci]->GetBin(p,e)); \r
+ Double_t spread = fCorrelationsPro[t][pW][eW][ci]->GetBinError(fCorrelationsPro[t][pW][eW][ci]->GetBin(p,e));\r
+ Double_t nEvts = fNonEmptyBins2D[t]->GetBinContent(fNonEmptyBins2D[t]->GetBin(p,e));\r
+ Double_t error = 0.;\r
+ fFinalCorrelations2D[t][pW][eW][ci]->SetBinContent(fFinalCorrelations2D[t][pW][eW][ci]->GetBin(p,e),correlation); \r
+ if(nEvts>0)\r
+ {\r
+ error = spread/pow(nEvts,0.5);\r
+ fFinalCorrelations2D[t][pW][eW][ci]->SetBinError(fFinalCorrelations2D[t][pW][eW][ci]->GetBin(p,e),error);\r
+ }\r
+ } // end of for(Int_t e=1;e<=fnBinsEta;e++)\r
+ } // end of for(Int_t p=1;p<=fnBinsPt;p++)\r
+ } // end of for(Int_t ci=0;ci<4;ci++)\r
+ \r
+ // transfer 1D profile into 1D histogram (pt):\r
+ // to be improved (see in documentation if there is a method to transfer values from 1D profile into 1D histogram) \r
+ for(Int_t ci=0;ci<4;ci++)\r
+ {\r
+ for(Int_t p=1;p<=fnBinsPt;p++)\r
+ {\r
+ if(profile[0][ci])\r
+ {\r
+ Double_t correlation = profile[0][ci]->GetBinContent(p); \r
+ Double_t spread = profile[0][ci]->GetBinError(p);\r
+ Double_t nEvts = fNonEmptyBins1D[t][0]->GetBinContent(p);\r
+ Double_t error = 0.;\r
+ fFinalCorrelations1D[t][pW][eW][0][ci]->SetBinContent(p,correlation); \r
+ if(nEvts>0)\r
+ {\r
+ error = spread/pow(nEvts,0.5);\r
+ fFinalCorrelations1D[t][pW][eW][0][ci]->SetBinError(p,error);\r
+ } \r
+ } \r
+ } // end of for(Int_t p=1;p<=fnBinsPt;p++)\r
+ } // end of for(Int_t ci=0;ci<4;ci++)\r
+ \r
+ // transfer 1D profile into 1D histogram (eta):\r
+ // to be improved (see in documentation if there is a method to transfer values from 1D profile into 1D histogram) \r
+ for(Int_t ci=0;ci<4;ci++)\r
+ {\r
+ for(Int_t e=1;e<=fnBinsEta;e++)\r
+ {\r
+ if(profile[1][ci])\r
+ {\r
+ Double_t correlation = profile[1][ci]->GetBinContent(e); \r
+ fFinalCorrelations1D[t][pW][eW][1][ci]->SetBinContent(e,correlation); \r
+ } \r
+ } // end of for(Int_t e=1;e<=fnBinsEta;e++)\r
+ } // end of for(Int_t ci=0;ci<4;ci++)\r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::FinalizeCorrelationsForDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights)\r
+*/\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulants(TString type, TString ptOrEta)\r
+{\r
+ // calcualate cumulants for differential flow from measured correlations\r
+ // Remark: cumulants calculated here are NOT corrected for non-uniform acceptance. This correction is applied in the method ...\r
+ // to be improved (description) \r
+ \r
+ Int_t typeFlag = -1;\r
+ Int_t ptEtaFlag = -1;\r
+\r
+ if(type == "RP")\r
+ {\r
+ typeFlag = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ typeFlag = 1;\r
+ } \r
+ \r
+ if(ptOrEta == "Pt")\r
+ {\r
+ ptEtaFlag = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ ptEtaFlag = 1;\r
+ } \r
+ \r
+ // shortcuts:\r
+ Int_t t = typeFlag;\r
+ Int_t pe = ptEtaFlag;\r
+ \r
+ // common:\r
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
+ \r
+ // correlation <<2>>: \r
+ Double_t two = fIntFlowCorrelationsHist->GetBinContent(1);\r
+ \r
+ // 1D:\r
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ {\r
+ // reduced correlations: \r
+ Double_t twoPrime = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); // <<2'>>(pt)\r
+ Double_t fourPrime = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); // <<4'>>(pt)\r
+ // final statistical error of reduced correlations:\r
+ //Double_t twoPrimeError = fFinalCorrelations1D[t][pW][eW][0][0]->GetBinError(p); \r
+ // QC{2'}:\r
+ Double_t qc2Prime = twoPrime; // QC{2'}\r
+ //Double_t qc2PrimeError = twoPrimeError; // final stat. error of QC{2'}\r
+ fDiffFlowCumulants[t][pe][0]->SetBinContent(b,qc2Prime); \r
+ //fFinalCumulantsPt[t][pW][eW][nua][0]->SetBinError(p,qc2PrimeError); \r
+ // QC{4'}:\r
+ Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>>\r
+ fDiffFlowCumulants[t][pe][1]->SetBinContent(b,qc4Prime); \r
+ } // end of for(Int_t p=1;p<=fnBinsPt;p++)\r
+ \r
+ \r
+ /* \r
+ // 2D (pt,eta):\r
+ // to be improved (see documentation if I can do all this without looping)\r
+ for(Int_t p=1;p<=fnBinsPt;p++)\r
+ {\r
+ for(Int_t e=1;e<=fnBinsEta;e++) \r
+ { \r
+ // reduced correlations: \r
+ Double_t twoPrime = fFinalCorrelations2D[t][pW][eW][0]->GetBinContent(fFinalCorrelations2D[t][pW][eW][0]->GetBin(p,e)); // <<2'>>(pt,eta)\r
+ Double_t fourPrime = fFinalCorrelations2D[t][pW][eW][1]->GetBinContent(fFinalCorrelations2D[t][pW][eW][1]->GetBin(p,e)); // <<4'>>(pt,eta)\r
+ for(Int_t nua=0;nua<2;nua++)\r
+ {\r
+ // QC{2'}:\r
+ Double_t qc2Prime = twoPrime; // QC{2'} = <<2'>>\r
+ fFinalCumulants2D[t][pW][eW][nua][0]->SetBinContent(fFinalCumulants2D[t][pW][eW][nua][0]->GetBin(p,e),qc2Prime); \r
+ // QC{4'}:\r
+ Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>>\r
+ fFinalCumulants2D[t][pW][eW][nua][1]->SetBinContent(fFinalCumulants2D[t][pW][eW][nua][1]->GetBin(p,e),qc4Prime); \r
+ } // end of for(Int_t nua=0;nua<2;nua++) \r
+ } // end of for(Int_t e=1;e<=fnBinsEta;e++)\r
+ } // end of for(Int_t p=1;p<=fnBinsPt;p++)\r
+ */\r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulants(TString type, Bool_t useParticleWeights, TString eventWeights); \r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type)\r
+{\r
+ // calculate final results for integrated flow of RPs and POIs \r
+ \r
+ Int_t typeFlag = -1;\r
+\r
+ if(type == "RP")\r
+ {\r
+ typeFlag = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ typeFlag = 1;\r
+ } else \r
+ {\r
+ cout<<"WARNING: type must be either RP or POI in AFAWQC::CDF() !!!!"<<endl;\r
+ exit(0);\r
+ }\r
+ \r
+ // shortcuts:\r
+ Int_t t = typeFlag;\r
+ \r
+ // pt yield: \r
+ TH1F *yield2ndPt = NULL;\r
+ TH1F *yield4thPt = NULL;\r
+ TH1F *yield6thPt = NULL;\r
+ TH1F *yield8thPt = NULL;\r
+ \r
+ if(type == "POI")\r
+ {\r
+ yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtPOI())->Clone();\r
+ yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtPOI())->Clone();\r
+ yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtPOI())->Clone();\r
+ yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtPOI())->Clone(); \r
+ } \r
+ else if(type == "RP")\r
+ {\r
+ yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtRP())->Clone();\r
+ yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtRP())->Clone();\r
+ yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtRP())->Clone();\r
+ yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtRP())->Clone(); \r
+ } \r
+ \r
+ Int_t nBinsPt = yield2ndPt->GetNbinsX();\r
+ \r
+ TH1D *flow2ndPt = NULL;\r
+ TH1D *flow4thPt = NULL;\r
+ TH1D *flow6thPt = NULL;\r
+ TH1D *flow8thPt = NULL;\r
+ \r
+ // to be improved (hardwired pt index)\r
+ flow2ndPt = (TH1D*)fDiffFlow[t][0][0]->Clone();\r
+ flow4thPt = (TH1D*)fDiffFlow[t][0][1]->Clone();\r
+ flow6thPt = (TH1D*)fDiffFlow[t][0][2]->Clone();\r
+ flow8thPt = (TH1D*)fDiffFlow[t][0][3]->Clone(); \r
+ \r
+ Double_t dvn2nd = 0., dvn4th = 0., dvn6th = 0., dvn8th = 0.; // differential flow\r
+ Double_t dErrvn2nd = 0., dErrvn4th = 0., dErrvn6th = 0., dErrvn8th = 0.; // error on differential flow\r
+ \r
+ Double_t dVn2nd = 0., dVn4th = 0., dVn6th = 0., dVn8th = 0.; // integrated flow \r
+ Double_t dErrVn2nd = 0., dErrVn4th = 0., dErrVn6th = 0., dErrVn8th = 0.; // error on integrated flow\r
+\r
+ Double_t dYield2nd = 0., dYield4th = 0., dYield6th = 0., dYield8th = 0.; // pt yield \r
+ Double_t dSum2nd = 0., dSum4th = 0., dSum6th = 0., dSum8th = 0.; // needed for normalizing integrated flow\r
+ \r
+ // looping over pt bins:\r
+ for(Int_t p=1;p<nBinsPt+1;p++)\r
+ {\r
+ dvn2nd = flow2ndPt->GetBinContent(p);\r
+ dvn4th = flow4thPt->GetBinContent(p);\r
+ dvn6th = flow6thPt->GetBinContent(p);\r
+ dvn8th = flow8thPt->GetBinContent(p);\r
+ \r
+ dErrvn2nd = flow2ndPt->GetBinError(p);\r
+ dErrvn4th = flow4thPt->GetBinError(p);\r
+ dErrvn6th = flow6thPt->GetBinError(p);\r
+ dErrvn8th = flow8thPt->GetBinError(p);\r
+\r
+ dYield2nd = yield2ndPt->GetBinContent(p); \r
+ dYield4th = yield4thPt->GetBinContent(p);\r
+ dYield6th = yield6thPt->GetBinContent(p);\r
+ dYield8th = yield8thPt->GetBinContent(p);\r
+ \r
+ dVn2nd += dvn2nd*dYield2nd;\r
+ dVn4th += dvn4th*dYield4th;\r
+ dVn6th += dvn6th*dYield6th;\r
+ dVn8th += dvn8th*dYield8th;\r
+ \r
+ dSum2nd += dYield2nd;\r
+ dSum4th += dYield4th;\r
+ dSum6th += dYield6th;\r
+ dSum8th += dYield8th;\r
+ \r
+ dErrVn2nd += dYield2nd*dYield2nd*dErrvn2nd*dErrvn2nd; // ro be improved (check this relation)\r
+ dErrVn4th += dYield4th*dYield4th*dErrvn4th*dErrvn4th;\r
+ dErrVn6th += dYield6th*dYield6th*dErrvn6th*dErrvn6th;\r
+ dErrVn8th += dYield8th*dYield8th*dErrvn8th*dErrvn8th;\r
+ \r
+ } // end of for(Int_t p=1;p<nBinsPt+1;p++)\r
+\r
+ // normalizing the results for integrated flow:\r
+ if(dSum2nd) \r
+ {\r
+ dVn2nd /= dSum2nd;\r
+ dErrVn2nd /= (dSum2nd*dSum2nd);\r
+ dErrVn2nd = TMath::Sqrt(dErrVn2nd);\r
+ } \r
+ if(dSum4th) \r
+ {\r
+ dVn4th /= dSum4th;\r
+ dErrVn4th /= (dSum4th*dSum4th);\r
+ dErrVn4th = TMath::Sqrt(dErrVn4th);\r
+ } \r
+ //if(dSum6th) dVn6th/=dSum6th;\r
+ //if(dSum8th) dVn8th/=dSum8th;\r
+ \r
+ // storing the results for integrated flow in common histos: (to be improved: new method for this?)\r
+ if(type == "POI")\r
+ {\r
+ fCommonHistsResults2nd->FillIntegratedFlowPOI(dVn2nd,dErrVn2nd); \r
+ fCommonHistsResults4th->FillIntegratedFlowPOI(dVn4th,dErrVn4th); \r
+ fCommonHistsResults6th->FillIntegratedFlowPOI(dVn6th,0.); // to be improved (errors)\r
+ fCommonHistsResults8th->FillIntegratedFlowPOI(dVn8th,0.); // to be improved (errors)\r
+ }\r
+ else if (type == "RP")\r
+ {\r
+ fCommonHistsResults2nd->FillIntegratedFlowRP(dVn2nd,dErrVn2nd); \r
+ fCommonHistsResults4th->FillIntegratedFlowRP(dVn4th,dErrVn4th);\r
+ fCommonHistsResults6th->FillIntegratedFlowRP(dVn6th,0.); // to be improved (errors)\r
+ fCommonHistsResults8th->FillIntegratedFlowRP(dVn8th,0.); // to be improved (errors)\r
+ }\r
+ \r
+ delete flow2ndPt;\r
+ delete flow4thPt;\r
+ //delete flow6thPt;\r
+ //delete flow8thPt;\r
+ \r
+ delete yield2ndPt;\r
+ delete yield4thPt;\r
+ delete yield6thPt;\r
+ delete yield8thPt;\r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions()\r
+{\r
+ // Initialize all arrays used for distributions.
+
+ // a) Initialize arrays of histograms used to hold distributions of correlations;
+ // b) Initialize array to hold min and max values of correlations.
+
+ // a) Initialize arrays of histograms used to hold distributions of correlations:
+ for(Int_t di=0;di<4;di++) // distribution index\r
+ {\r
+ fDistributions[di] = NULL;\r
+ }\r
+
+ // b) Initialize default min and max values of correlations:
+ // (Remark: The default values bellow were chosen for v2=5% and M=500)
+ fMinValueOfCorrelation[0] = -0.01; // <2>_min
+ fMaxValueOfCorrelation[0] = 0.04; // <2>_max
+ fMinValueOfCorrelation[1] = -0.00002; // <4>_min
+ fMaxValueOfCorrelation[1] = 0.00015; // <4>_max
+ fMinValueOfCorrelation[2] = -0.0000003; // <6>_min
+ fMaxValueOfCorrelation[2] = 0.0000006; // <6>_max
+ fMinValueOfCorrelation[3] = -0.000000006; // <8>_min
+ fMaxValueOfCorrelation[3] = 0.000000003; // <8>_max
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions()\r
+\r
+
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions()\r
+{\r
+ // a) Book profile to hold all flags for distributions of correlations;
+ // b) Book all histograms to hold distributions of correlations.
+
+ TString correlationIndex[4] = {"<2>","<4>","<6>","<8>"}; // to be improved (should I promote this to data members?)
+
+ // a) Book profile to hold all flags for distributions of correlations:
+ TString distributionsFlagsName = "fDistributionsFlags";\r
+ distributionsFlagsName += fAnalysisLabel->Data();\r
+ fDistributionsFlags = new TProfile(distributionsFlagsName.Data(),"Flags for Distributions of Correlations",9,0,9);\r
+ fDistributionsFlags->SetTickLength(-0.01,"Y");\r
+ fDistributionsFlags->SetMarkerStyle(25);\r
+ fDistributionsFlags->SetLabelSize(0.05);\r
+ fDistributionsFlags->SetLabelOffset(0.02,"Y");\r
+ (fDistributionsFlags->GetXaxis())->SetBinLabel(1,"Store or not?");\r
+ (fDistributionsFlags->GetXaxis())->SetBinLabel(2,"<2>_{min}");\r
+ (fDistributionsFlags->GetXaxis())->SetBinLabel(3,"<2>_{max}");\r
+ (fDistributionsFlags->GetXaxis())->SetBinLabel(4,"<4>_{min}");\r
+ (fDistributionsFlags->GetXaxis())->SetBinLabel(5,"<4>_{max}");\r
+ (fDistributionsFlags->GetXaxis())->SetBinLabel(6,"<6>_{min}");\r
+ (fDistributionsFlags->GetXaxis())->SetBinLabel(7,"<6>_{max}");\r
+ (fDistributionsFlags->GetXaxis())->SetBinLabel(8,"<8>_{min}");\r
+ (fDistributionsFlags->GetXaxis())->SetBinLabel(9,"<8>_{max}");\r
+ fDistributionsList->Add(fDistributionsFlags);\r
+
+ // b) Book all histograms to hold distributions of correlations.
+ if(fStoreDistributions)
{
- if(type == "POI")
- {
- flow2ndPt = new TH1D(*fvn2ndPtPOI);
- flow4thPt = new TH1D(*fvn4thPtPOI);
- flow6thPt = new TH1D(*fvn6thPtPOI);
- flow8thPt = new TH1D(*fvn8thPtPOI);
- }
- else if (type == "RP")
- {
- flow2ndPt = new TH1D(*fvn2ndPtRP);
- flow4thPt = new TH1D(*fvn4thPtRP);
- flow6thPt = new TH1D(*fvn6thPtRP);
- flow8thPt = new TH1D(*fvn8thPtRP);
- }
- }
- else if (useWeights)
- {
- if(type == "POI")
- {
- flow2ndPt = new TH1D(*fvn2ndPtPOIW);
- flow4thPt = new TH1D(*fvn4thPtPOIW);
- flow6thPt = new TH1D(*fvn6thPtPOIW);
- flow8thPt = new TH1D(*fvn8thPtPOIW);
- }
- else if (type == "RP")
+ TString distributionsName = "fDistributions";\r
+ distributionsName += fAnalysisLabel->Data();\r
+ for(Int_t di=0;di<4;di++) // distribution index\r
{
- flow2ndPt = new TH1D(*fvn2ndPtRPW);
- flow4thPt = new TH1D(*fvn4thPtRPW);
- flow6thPt = new TH1D(*fvn6thPtRPW);
- flow8thPt = new TH1D(*fvn8thPtRPW);
- }
- }
-
- Double_t dvn2nd = 0., dvn4th = 0., dvn6th = 0., dvn8th = 0.; // differential flow
- Double_t dVn2nd = 0., dVn4th = 0., dVn6th = 0., dVn8th = 0.; // integrated flow
- Double_t dSd2nd = 0., dSd4th = 0., dSd6th = 0., dSd8th = 0.; // error on integrated flow (to be improved - calculation needed)
-
- Double_t dYield2nd = 0., dYield4th = 0., dYield6th = 0., dYield8th = 0.; // pt yield
- Double_t dSum2nd = 0., dSum4th = 0., dSum6th = 0., dSum8th = 0.; // needed for normalizing integrated flow
-
- // looping over pt bins:
- for(Int_t p=1;p<nBinsPt+1;p++)
- {
- dvn2nd = flow2ndPt->GetBinContent(p);
- dvn4th = flow4thPt->GetBinContent(p);
- dvn6th = flow6thPt->GetBinContent(p);
- dvn8th = flow8thPt->GetBinContent(p);
-
- dYield2nd = yield2ndPt->GetBinContent(p);
- dYield4th = yield4thPt->GetBinContent(p);
- dYield6th = yield6thPt->GetBinContent(p);
- dYield8th = yield8thPt->GetBinContent(p);
-
- dVn2nd += dvn2nd*dYield2nd;
- dVn4th += dvn4th*dYield4th;
- dVn6th += dvn6th*dYield6th;
- dVn8th += dvn8th*dYield8th;
-
- dSum2nd += dYield2nd;
- dSum4th += dYield4th;
- dSum6th += dYield6th;
- dSum8th += dYield8th;
-
- // ... to be improved - errors needed to be calculated
-
- } // end of for(Int_t p=1;p<nBinsPt+1;p++)
-
- // normalizing the results for integrated flow:
- if(dSum2nd) dVn2nd/=dSum2nd;
- if(dSum4th) dVn4th/=dSum4th;
- if(dSum6th) dVn6th/=dSum6th;
- if(dSum8th) dVn8th/=dSum8th;
-
- // storing the results for integrated flow:
- if(!(useWeights))
- {
- if(type == "POI")
- {
- // 2nd:
- fIntFlowResultsPOIQC->SetBinContent(1,dVn2nd);
- fIntFlowResultsPOIQC->SetBinError(1,dSd2nd);
- // 4th:
- fIntFlowResultsPOIQC->SetBinContent(2,dVn4th);
- fIntFlowResultsPOIQC->SetBinError(2,dSd4th);
- // 6th:
- fIntFlowResultsPOIQC->SetBinContent(3,dVn6th);
- fIntFlowResultsPOIQC->SetBinError(3,dSd6th);
- // 8th:
- fIntFlowResultsPOIQC->SetBinContent(4,dVn8th);
- fIntFlowResultsPOIQC->SetBinError(4,dSd8th);
- }
- else if (type == "RP")
- {
- // 2nd:
- fIntFlowResultsRPQC->SetBinContent(1,dVn2nd);
- fIntFlowResultsRPQC->SetBinError(1,dSd2nd);
- // 4th:
- fIntFlowResultsRPQC->SetBinContent(2,dVn4th);
- fIntFlowResultsRPQC->SetBinError(2,dSd4th);
- // 6th:
- fIntFlowResultsRPQC->SetBinContent(3,dVn6th);
- fIntFlowResultsRPQC->SetBinError(3,dSd6th);
- // 8th:
- fIntFlowResultsRPQC->SetBinContent(4,dVn8th);
- fIntFlowResultsRPQC->SetBinError(4,dSd8th);
- }
- }
- else if (useWeights)
- {
- if(type == "POI")
- {
- // 2nd:
- fIntFlowResultsPOIQCW->SetBinContent(1,dVn2nd);
- fIntFlowResultsPOIQCW->SetBinError(1,dSd2nd);
- // 4th:
- fIntFlowResultsPOIQCW->SetBinContent(2,dVn4th);
- fIntFlowResultsPOIQCW->SetBinError(2,dSd4th);
- // 6th:
- fIntFlowResultsPOIQCW->SetBinContent(3,dVn6th);
- fIntFlowResultsPOIQCW->SetBinError(3,dSd6th);
- // 8th:
- fIntFlowResultsPOIQCW->SetBinContent(4,dVn8th);
- fIntFlowResultsPOIQCW->SetBinError(4,dSd8th);
- }
- else if (type == "RP")
- {
- // 2nd:
- fIntFlowResultsRPQCW->SetBinContent(1,dVn2nd);
- fIntFlowResultsRPQCW->SetBinError(1,dSd2nd);
- // 4th:
- fIntFlowResultsRPQCW->SetBinContent(2,dVn4th);
- fIntFlowResultsRPQCW->SetBinError(2,dSd4th);
- // 6th:
- fIntFlowResultsRPQCW->SetBinContent(3,dVn6th);
- fIntFlowResultsRPQCW->SetBinError(3,dSd6th);
- // 8th:
- fIntFlowResultsRPQCW->SetBinContent(4,dVn8th);
- fIntFlowResultsRPQCW->SetBinError(4,dSd8th);
- }
- }
-
- // storing the results for integrated flow in common histos:
- // to be improved - now they are being filled twice ...
- if(type == "POI")
- {
- fCommonHistsResults2nd->FillIntegratedFlowPOI(dVn2nd,0.); // to be improved (errors)
- fCommonHistsResults4th->FillIntegratedFlowPOI(dVn4th,0.); // to be improved (errors)
- fCommonHistsResults6th->FillIntegratedFlowPOI(dVn6th,0.); // to be improved (errors)
- fCommonHistsResults8th->FillIntegratedFlowPOI(dVn8th,0.); // to be improved (errors)
- }
- else if (type == "RP")
- {
- fCommonHistsResults2nd->FillIntegratedFlowRP(dVn2nd,0.); // to be improved (errors)
- fCommonHistsResults4th->FillIntegratedFlowRP(dVn4th,0.); // to be improved (errors)
- fCommonHistsResults6th->FillIntegratedFlowRP(dVn6th,0.); // to be improved (errors)
- fCommonHistsResults8th->FillIntegratedFlowRP(dVn8th,0.); // to be improved (errors)
- }
-
- delete flow2ndPt;
- delete flow4thPt;
- delete flow6thPt;
- delete flow8thPt;
-
- delete yield2ndPt;
- delete yield4thPt;
- delete yield6thPt;
- delete yield8thPt;
-
-} // end of AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(Bool_t useWeights, TString type)
-
-
-//==================================================================================================================================
-
-
-void AliFlowAnalysisWithQCumulants::CalculateFinalResultsForDifferentialFlow(
- TH2D *flowPtEta, TH1D *flowPt, TH1D *flowEta,
- TProfile2D *profile2ndPtEta, TProfile2D *profile4thPtEta,
- TProfile2D *profile6thPtEta, TProfile2D *profile8thPtEta)
+ fDistributions[di] = new TH1D(Form("Distribution of %s",correlationIndex[di].Data()),Form("Distribution of %s",correlationIndex[di].Data()),10000,fMinValueOfCorrelation[di],fMaxValueOfCorrelation[di]); \r
+ fDistributions[di]->SetXTitle(correlationIndex[di].Data());\r
+ fDistributionsList->Add(fDistributions[di]);\r
+ } // end of for(Int_t di=0;di<4;di++) // distribution index
+ } // end of if(fStoreDistributions)
+
+} // end of void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+
+void AliFlowAnalysisWithQCumulants::StoreFlagsForDistributions()\r
+{\r
+ // Store all flags for distributiuons of correlations in profile fDistributionsFlags.\r
+ \r
+ if(!fDistributionsFlags)\r
+ {\r
+ cout<<"WARNING: fDistributionsFlags is NULL in AFAWQC::SDF() !!!!"<<endl;\r
+ exit(0);\r
+ } \r
+\r
+ fDistributionsFlags->Fill(0.5,(Int_t)fStoreDistributions); // histos with distributions of correlations stored or not in the output file
+ // store min and max values of correlations:
+ for(Int_t di=0;di<4;di++) // distribution index\r
+ {\r
+ fDistributionsFlags->Fill(1.5+2.*(Double_t)di,fMinValueOfCorrelation[di]);
+ fDistributionsFlags->Fill(2.5+2.*(Double_t)di,fMaxValueOfCorrelation[di]);
+ }\r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::StoreFlagsForDistributions()\r
+\r
+
+//================================================================================================================================\r
+
+
+void AliFlowAnalysisWithQCumulants::StoreDistributionsOfCorrelations()
{
- // calculate and store the final results for integrated flow
-
- TString *namePtEta = new TString();
- TString *type = new TString();
- TString *order2nd = new TString();
- TString *order4th = new TString();
- TString *order6th = new TString();
- TString *order8th = new TString();
- TString *w = new TString();
-
- if(profile2ndPtEta) *namePtEta = profile2ndPtEta->GetName();
- if(namePtEta->Contains("POI")) *type = "POI";
- if(namePtEta->Contains("RP")) *type = "RP";
- if(namePtEta->Contains("W")) *w = "W";
- if(namePtEta->Contains("2")) *order2nd = "2";
+ // Store distributions of correlations.
- if(profile4thPtEta) *namePtEta = profile4thPtEta->GetName();
- if(namePtEta->Contains("4")) *order4th = "4";
+ if(!(fIntFlowCorrelationsEBE && fIntFlowEventWeightsForCorrelationsEBE))\r
+ {\r
+ cout<<"WARNING: fIntFlowCorrelationsEBE && fIntFlowEventWeightsForCorrelationsEBE"<<endl; \r
+ cout<<" is NULL in AFAWQC::SDOC() !!!!"<<endl;\r
+ exit(0);\r
+ }\r
- if(profile6thPtEta) *namePtEta = profile6thPtEta->GetName();
- if(namePtEta->Contains("6")) *order6th = "6";
-
- if(profile8thPtEta) *namePtEta = profile8thPtEta->GetName();
- if(namePtEta->Contains("8")) *order8th = "8";
-
- TProfile *profile2ndPt = NULL;
- TProfile *profile4thPt = NULL;
- TProfile *profile6thPt = NULL;
- TProfile *profile8thPt = NULL;
-
- TProfile *profile2ndEta = NULL;
- TProfile *profile4thEta = NULL;
- TProfile *profile6thEta = NULL;
- TProfile *profile8thEta = NULL;
-
- if(*order2nd == "2")
- {
- profile2ndPt = new TProfile(*(this->MakePtProjection(profile2ndPtEta)));
- profile2ndEta = new TProfile(*(this->MakeEtaProjection(profile2ndPtEta)));
- if(*order4th == "4")
- {
- profile4thPt = new TProfile(*(this->MakePtProjection(profile4thPtEta)));
- profile4thEta = new TProfile(*(this->MakeEtaProjection(profile4thPtEta)));
- if(*order6th == "6")
- {
- profile6thPt = new TProfile(*(this->MakePtProjection(profile6thPtEta)));
- profile6thEta = new TProfile(*(this->MakeEtaProjection(profile6thPtEta)));
- if(*order8th == "8")
- {
- profile8thPt = new TProfile(*(this->MakePtProjection(profile8thPtEta)));
- profile8thEta = new TProfile(*(this->MakeEtaProjection(profile8thPtEta)));
- }
- }
- }
- }
-
- Int_t nBinsPt = profile2ndPt->GetNbinsX();
- Int_t nBinsEta = profile2ndEta->GetNbinsX();
-
- Double_t dV2 = 0.;
- Double_t dV4 = 0.;
- Double_t dV6 = 0.;
- Double_t dV8 = 0.;
-
- if(!(*w == "W"))
- {
- dV2 = fIntFlowResultsQC->GetBinContent(1);
- dV4 = fIntFlowResultsQC->GetBinContent(2);
- dV6 = fIntFlowResultsQC->GetBinContent(3);
- dV8 = fIntFlowResultsQC->GetBinContent(4);
- }
- else if(*w == "W")
- {
- dV2 = fIntFlowResultsQCW->GetBinContent(1);
- dV4 = fIntFlowResultsQCW->GetBinContent(2);
- dV6 = fIntFlowResultsQCW->GetBinContent(3);
- dV8 = fIntFlowResultsQCW->GetBinContent(4);
- }
-
- // 3D (pt,eta):
- Double_t twoPrimePtEta = 0.; // <<2'>> (pt,eta)
- Double_t fourPrimePtEta = 0.; // <<4'>> (pt,eta)
- //Double_t sixPrimePtEta = 0.; // <<6'>> (pt,eta)
- //Double_t eightPrimePtEta = 0.; // <<8'>> (pt,eta)
- Double_t secondOrderDiffFlowCumulantPtEta = 0.; // d_n{2,Q} (pt,eta)
- Double_t fourthOrderDiffFlowCumulantPtEta = 0.; // d_n{4,Q} (pt,eta)
- //Double_t sixthOrderDiffFlowCumulantPtEta = 0.; // d_n{6,Q} (pt,eta)
- //Double_t eightOrderDiffFlowCumulantPtEta = 0.; // d_n{8,Q} (pt,eta)2nd
- Double_t dv2PtEta = 0.; // v'_n{2} (pt,eta)
- Double_t dv4PtEta = 0.; // v'_n{4} (pt,eta)
- //Double_t dv6PtEta = 0.; // v'_n{6} (pt,eta)
- //Double_t dv8PtEta = 0.; // v'_n{8} (pt,eta)
-
- // 2D (pt):
- Double_t twoPrimePt = 0.; // <<2'>> (pt)
- Double_t fourPrimePt = 0.; // <<4'>> (pt)
- //Double_t sixPrimePt = 0.; // <<6'>> (pt)
- //Double_t eightPrimePt = 0.; // <<8'>> (pt)
- Double_t secondOrderDiffFlowCumulantPt = 0.; // d_n{2,Q} (pt)
- Double_t fourthOrderDiffFlowCumulantPt = 0.; // d_n{4,Q} (pt)
- //Double_t sixthOrderDiffFlowCumulantPt = 0.; // d_n{6,Q} (pt)
- //Double_t eightOrderDiffFlowCumulantPt = 0.; // d_n{8,Q} (pt)
- Double_t dv2Pt = 0.; // v'_n{2} (pt)
- Double_t dv4Pt = 0.; // v'_n{4} (pt)
- //Double_t dv6Pt = 0.; // v'_n{6} (pt)
- //Double_t dv8Pt = 0.; // v'_n{8} (pt)
-
- // 2D (eta):
- Double_t twoPrimeEta = 0.; // <<2'>> (eta)
- Double_t fourPrimeEta = 0.; // <<4>> (eta)
- //Double_t sixPrimeEta = 0.; // <<6>> (eta)
- //Double_t eightPrimeEta = 0.; // <<8'>> (eta)
- Double_t secondOrderDiffFlowCumulantEta = 0.; // d_n{2,Q} (eta)
- Double_t fourthOrderDiffFlowCumulantEta = 0.; // d_n{4,Q} (eta)
- //Double_t sixthOrderDiffFlowCumulantEta = 0.; // d_n{6,Q} (eta)
- //Double_t eightOrderDiffFlowCumulantEta = 0.; // d_n{8,Q} (eta)
- Double_t dv2Eta = 0.; // v'_n{2} (eta)
- Double_t dv4Eta = 0.; // v'_n{4} (eta)
- //Double_t dv6Eta = 0.; // v'_n{6} (eta)
- //Double_t dv8Eta = 0.; // v'_n{8} (eta)
-
-
- // looping over (pt,eta) bins to calculate v'(pt,eta)
- for(Int_t p=1;p<nBinsPt+1;p++)
- {
- for(Int_t e=1;e<nBinsEta+1;e++)
- {
-
- // 2nd order:
- twoPrimePtEta = profile2ndPtEta->GetBinContent(profile2ndPtEta->GetBin(p,e));
- secondOrderDiffFlowCumulantPtEta = twoPrimePtEta;
- if(dV2)
- {
- dv2PtEta = secondOrderDiffFlowCumulantPtEta/dV2;
- if(*order2nd == "2")
- {
- flowPtEta->SetBinContent(p,e,dv2PtEta);
- }
- }
-
- // 4th order:
- if(*order4th == "4" || *order6th == "6" || *order8th == "8")
- {
- fourPrimePtEta = profile4thPtEta->GetBinContent(profile4thPtEta->GetBin(p,e));
- fourthOrderDiffFlowCumulantPtEta = fourPrimePtEta - 2.*twoPrimePtEta*pow(dV2,2.); // to be improved (correlations instead of pow(dV2,2.))
- if(dV4)
- {
- dv4PtEta = -fourthOrderDiffFlowCumulantPtEta/pow(dV4,3);
- if(*order4th == "4")
- {
- flowPtEta->SetBinContent(p,e,dv4PtEta);
- }
- }
- }
-
- } // end of for(Int_t e=1;e<nBinsEta+1;e++)
- } // end of for(Int_t p=1;p<nBinsPt+1;p++)
-
-
- // looping over (pt) bins to calcualate v'(pt)
- for(Int_t p=1;p<nBinsPt+1;p++)
- {
-
- // 2nd order:
- twoPrimePt = profile2ndPt->GetBinContent(p);
- secondOrderDiffFlowCumulantPt = twoPrimePt;
- if(dV2)
- {
- dv2Pt = secondOrderDiffFlowCumulantPt/dV2;
- if(*order2nd == "2")
- {
- flowPt->SetBinContent(p,dv2Pt);
- }
-
- // common control histos: (to be improved fill only once. now they are filled first without weights and then with weights):
- if(namePtEta->Contains("POI") && *order2nd == "2")
- {
- fCommonHistsResults2nd->FillDifferentialFlowPtPOI(p,dv2Pt,0.); //to be improved (errors && bb or bb+1 ?)
- }
- else if(namePtEta->Contains("RP") && *order2nd == "2")
- {
- fCommonHistsResults2nd->FillDifferentialFlowPtRP(p,dv2Pt,0.); //to be improved (errors && bb or bb+1 ?)
- }
-
- }
-
- // 4th order:
- if(*order4th == "4" || *order6th == "6" || *order8th == "8")
- {
- fourPrimePt = profile4thPt->GetBinContent(profile4thPt->GetBin(p));
- fourthOrderDiffFlowCumulantPt = fourPrimePt - 2.*twoPrimePt*pow(dV2,2.); // to be improved (correlations instead of pow(dV2,2.))
- if(dV4)
- {
- dv4Pt = -fourthOrderDiffFlowCumulantPt/pow(dV4,3);
- if(*order4th == "4")
- {
- flowPt->SetBinContent(p,dv4Pt);
- }
-
- // common control histos: (to be improved):
- if(namePtEta->Contains("POI") && *order4th == "4")
- {
- fCommonHistsResults4th->FillDifferentialFlowPtPOI(p,dv4Pt,0.); //to be improved (errors && bb or bb+1 ?)
- }
- else if(namePtEta->Contains("RP") && *order4th == "4" )
- {
- fCommonHistsResults4th->FillDifferentialFlowPtRP(p,dv4Pt,0.); //to be improved (errors && bb or bb+1 ?)
- }
-
- }
- }
-
- } // end of for(Int_t p=1;p<nBinsPt+1;p++)
-
-
- // looping over (eta) bins to calcualate v'(eta)
- for(Int_t e=1;e<nBinsEta+1;e++)
+ for(Int_t di=0;di<4;di++) // distribution index\r
{
-
- // 2nd order:
- twoPrimeEta = profile2ndEta->GetBinContent(e);
- secondOrderDiffFlowCumulantEta = twoPrimeEta;
- if(dV2)
- {
- dv2Eta = secondOrderDiffFlowCumulantEta/dV2;
- if(*order2nd == "2")
- {
- flowEta->SetBinContent(e,dv2Eta);
- }
-
- // common control histos: (to be improved):
- if(namePtEta->Contains("POI") && *order2nd == "2")
- {
- fCommonHistsResults2nd->FillDifferentialFlowEtaPOI(e,dv2Eta,0.); //to be improved (errors && bb or bb+1 ?)
- }
- else if(namePtEta->Contains("RP") && *order2nd == "2")
- {
- fCommonHistsResults2nd->FillDifferentialFlowEtaRP(e,dv2Eta,0.); //to be improved (errors && bb or bb+1 ?)
- }
-
- }
-
- // 4th order:
- if(*order4th == "4" || *order6th == "6" || *order8th == "8")
- {
- fourPrimeEta = profile4thEta->GetBinContent(profile4thEta->GetBin(e));
- fourthOrderDiffFlowCumulantEta = fourPrimeEta - 2.*twoPrimeEta*pow(dV2,2.); // to be improved (correlations instead of pow(dV2,2.))
- if(dV4)
- {
- dv4Eta = -fourthOrderDiffFlowCumulantEta/pow(dV4,3);
- if(*order4th == "4")
- {
- flowEta->SetBinContent(e,dv4Eta);
- }
-
- // common control histos: (to be improved):
- if(namePtEta->Contains("POI") && *order4th == "4")
- {
- fCommonHistsResults4th->FillDifferentialFlowEtaPOI(e,dv4Eta,0.); //to be improved (errors && bb or bb+1 ?)
- }
- else if(namePtEta->Contains("RP") && *order4th == "4")
+ if(!fDistributions[di])\r
+ { \r
+ cout<<"WARNING: fDistributions[di] is NULL in AFAWQC::SDOC() !!!!"<<endl;\r
+ cout<<"di = "<<di<<endl;\r
+ exit(0);\r
+ } else
{
- fCommonHistsResults4th->FillDifferentialFlowEtaRP(e,dv4Eta,0.); //to be improved (errors && bb or bb+1 ?)
- }
-
- }
- }
-
- } // end of for(Int_t e=1;e<nBinsEta+1;e++)
-
- delete namePtEta;
- delete type;
- delete order2nd;
- delete order4th;
- delete order6th;
- delete order8th;
- delete w;
- delete profile2ndPt;
- delete profile4thPt;
- delete profile6thPt;
- delete profile8thPt;
- delete profile2ndEta;
- delete profile4thEta;
- delete profile6thEta;
- delete profile8thEta;
-
-} // end of AliFlowAnalysisWithQCumulants::CalculateFinalResultsForDifferentialFlow(Bool_t useWeights, TString type)
-
-
-//================================================================================================================================
-
-
-void AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(Bool_t useWeights, TString type)
-{
- // printing on the screen the final results for integrated flow ('no-name', POI and RP, without/with weights)
-
- Int_t n = 2; // to be improved / removed
-
- Double_t nEvtsNoName = (fCommonHists2nd->GetHistMultRP())->GetEntries(); // to be improved
- Double_t dMultNoName = (fCommonHists2nd->GetHistMultRP())->GetMean(); // to be improved
- Double_t nEvtsPOI = (fCommonHists2nd->GetHistMultPOI())->GetEntries(); // to be improved
- Double_t dMultPOI = (fCommonHists2nd->GetHistMultPOI())->GetMean(); // to be improved
- Double_t nEvtsRP = (fCommonHists2nd->GetHistMultRP())->GetEntries(); // to be improved
- Double_t dMultRP = (fCommonHists2nd->GetHistMultRP())->GetMean(); // to be improved
-
- TH1D *finalResultsIntFlow = NULL;
-
- if(!(useWeights))
- {
- if(type == "NONAME") finalResultsIntFlow = new TH1D(*fIntFlowResultsQC);
- if(type == "POI") finalResultsIntFlow = new TH1D(*fIntFlowResultsPOIQC);
- if(type == "RP") finalResultsIntFlow = new TH1D(*fIntFlowResultsRPQC);
- }
-
- if(useWeights)
- {
- if(type == "NONAME") finalResultsIntFlow = new TH1D(*fIntFlowResultsQCW);
- if(type == "POI") finalResultsIntFlow = new TH1D(*fIntFlowResultsPOIQCW);
- if(type == "RP") finalResultsIntFlow = new TH1D(*fIntFlowResultsRPQCW);
- }
-
- Double_t dVn[4] = {0.}; // array to hold Vn{2}, Vn{4}, Vn{6} and Vn{8}
- Double_t dVnErr[4] = {0.}; // array to hold errors of Vn{2}, Vn{4}, Vn{6} and Vn{8}
-
- if(finalResultsIntFlow)
- {
- for(Int_t i=0;i<4;i++)
- {
- dVn[i] = finalResultsIntFlow->GetBinContent(i+1);
- dVnErr[i] = finalResultsIntFlow->GetBinError(i+1);
- }
- }
-
- TString title = " flow estimates from Q-cumulants";
- TString subtitle = " (";
-
- if(!(useWeights))
- {
- subtitle.Append(type);
- subtitle.Append(", without weights)");
- }
-
- if(useWeights)
- {
- subtitle.Append(type);
- subtitle.Append(", with weights)");
- }
-
- cout<<endl;
- cout<<"**********************************"<<endl;
- cout<<"**********************************"<<endl;
- cout<<title.Data()<<endl;
- cout<<subtitle.Data()<<endl;
- cout<<endl;
-
- for(Int_t i=0;i<4;i++)
- {
- if(dVn[i]>=0.)
- {
- cout<<" v_"<<n<<"{"<<2*(i+1)<<"} = "<<dVn[i]<<" +/- "<<dVnErr[i]<<endl;
- }
- else
- {
- cout<<" v_"<<n<<"{"<<2*(i+1)<<"} = Im"<<endl;
- }
- }
-
- cout<<endl;
- if(type == "NONAME")
- {
- cout<<" nEvts = "<<nEvtsNoName<<", AvM = "<<dMultNoName<<endl; // to be improved
- }
- else if (type == "RP")
- {
- cout<<" nEvts = "<<nEvtsRP<<", AvM = "<<dMultRP<<endl; // to be improved
- }
- else if (type == "POI")
- {
- cout<<" nEvts = "<<nEvtsPOI<<", AvM = "<<dMultPOI<<endl; // to be improved
- }
- cout<<"**********************************"<<endl;
- cout<<"**********************************"<<endl;
- cout<<endl;
-
-}// end of AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(Bool_t useWeights=kTRUE, TString type="NONAME");
-
-
+ fDistributions[di]->Fill(fIntFlowCorrelationsEBE->GetBinContent(di+1),fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(di+1));
+ } \r
+ } // end of for(Int_t di=0;di<4;di++) // distribution index\r
+
+} // end of void AliFlowAnalysisWithQCumulants::StoreDistributionsOfCorrelations()
+
+
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::BookAndNestAllLists()\r
+{\r
+ // Book and nest all lists nested in the base list fHistList.\r
+ // a) Book and nest lists for integrated flow;\r
+ // b) Book and nest lists for differential flow;\r
+ // c) Book and nest list for particle weights;\r
+ // d) Book and nest list for distributions;\r
+ // e) Book and nest list for nested loops;\r
+ \r
+ // a) Book and nest all lists for integrated flow:\r
+ // base list for integrated flow:\r
+ fIntFlowList = new TList();\r
+ fIntFlowList->SetName("Integrated Flow");\r
+ fIntFlowList->SetOwner(kTRUE);\r
+ fHistList->Add(fIntFlowList);\r
+ // list holding profiles: \r
+ fIntFlowProfiles = new TList();\r
+ fIntFlowProfiles->SetName("Profiles");\r
+ fIntFlowProfiles->SetOwner(kTRUE);\r
+ fIntFlowList->Add(fIntFlowProfiles);\r
+ // list holding histograms with results:\r
+ fIntFlowResults = new TList();\r
+ fIntFlowResults->SetName("Results");\r
+ fIntFlowResults->SetOwner(kTRUE);\r
+ fIntFlowList->Add(fIntFlowResults);\r
+ \r
+ // b) Book and nest lists for differential flow;\r
+ fDiffFlowList = new TList();\r
+ fDiffFlowList->SetName("Differential Flow");\r
+ fDiffFlowList->SetOwner(kTRUE); \r
+ fHistList->Add(fDiffFlowList);\r
+ // list holding profiles: \r
+ fDiffFlowProfiles = new TList(); \r
+ fDiffFlowProfiles->SetName("Profiles");\r
+ fDiffFlowProfiles->SetOwner(kTRUE);\r
+ fDiffFlowList->Add(fDiffFlowProfiles);\r
+ // list holding histograms with results: \r
+ fDiffFlowResults = new TList();\r
+ fDiffFlowResults->SetName("Results");\r
+ fDiffFlowResults->SetOwner(kTRUE);\r
+ fDiffFlowList->Add(fDiffFlowResults);\r
+ // flags used for naming nested lists in list fDiffFlowProfiles and fDiffFlowResults: \r
+ TList list;\r
+ list.SetOwner(kTRUE);\r
+ TString typeFlag[2] = {"RP","POI"}; \r
+ TString ptEtaFlag[2] = {"p_{T}","#eta"}; \r
+ TString powerFlag[2] = {"linear","quadratic"}; \r
+ // nested lists in fDiffFlowProfiles (~/Differential Flow/Profiles):\r
+ for(Int_t t=0;t<2;t++) // type: RP or POI\r
+ {\r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ // list holding profiles with correlations:\r
+ fDiffFlowCorrelationsProList[t][pe] = (TList*)list.Clone();\r
+ fDiffFlowCorrelationsProList[t][pe]->SetName(Form("Profiles with correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));\r
+ fDiffFlowProfiles->Add(fDiffFlowCorrelationsProList[t][pe]);\r
+ // list holding profiles with products of correlations:\r
+ fDiffFlowProductOfCorrelationsProList[t][pe] = (TList*)list.Clone();\r
+ fDiffFlowProductOfCorrelationsProList[t][pe]->SetName(Form("Profiles with products of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));\r
+ fDiffFlowProfiles->Add(fDiffFlowProductOfCorrelationsProList[t][pe]);\r
+ // list holding profiles with corrections:\r
+ fDiffFlowCorrectionsProList[t][pe] = (TList*)list.Clone();\r
+ fDiffFlowCorrectionsProList[t][pe]->SetName(Form("Profiles with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));\r
+ fDiffFlowProfiles->Add(fDiffFlowCorrectionsProList[t][pe]); \r
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta \r
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI \r
+ // nested lists in fDiffFlowResults (~/Differential Flow/Results):\r
+ for(Int_t t=0;t<2;t++) // type: RP or POI\r
+ {\r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ // list holding histograms with correlations:\r
+ fDiffFlowCorrelationsHistList[t][pe] = (TList*)list.Clone();\r
+ fDiffFlowCorrelationsHistList[t][pe]->SetName(Form("Correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));\r
+ fDiffFlowResults->Add(fDiffFlowCorrelationsHistList[t][pe]);\r
+ // list holding histograms with corrections:\r
+ fDiffFlowCorrectionsHistList[t][pe] = (TList*)list.Clone();\r
+ fDiffFlowCorrectionsHistList[t][pe]->SetName(Form("Histograms with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));\r
+ fDiffFlowResults->Add(fDiffFlowCorrectionsHistList[t][pe]); \r
+ for(Int_t power=0;power<2;power++)\r
+ {\r
+ // list holding histograms with sums of event weights:\r
+ fDiffFlowSumOfEventWeightsHistList[t][pe][power] = (TList*)list.Clone();\r
+ fDiffFlowSumOfEventWeightsHistList[t][pe][power]->SetName(Form("Sum of %s event weights (%s, %s)",powerFlag[power].Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data()));\r
+ fDiffFlowResults->Add(fDiffFlowSumOfEventWeightsHistList[t][pe][power]); \r
+ } // end of for(Int_t power=0;power<2;power++)\r
+ // list holding histograms with sums of products of event weights:\r
+ fDiffFlowSumOfProductOfEventWeightsHistList[t][pe] = (TList*)list.Clone();\r
+ fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]->SetName(Form("Sum of products of event weights (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));\r
+ fDiffFlowResults->Add(fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]);\r
+ // list holding histograms with covariances of correlations:\r
+ fDiffFlowCovariancesHistList[t][pe] = (TList*)list.Clone();\r
+ fDiffFlowCovariancesHistList[t][pe]->SetName(Form("Covariances of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));\r
+ fDiffFlowResults->Add(fDiffFlowCovariancesHistList[t][pe]);\r
+ // list holding histograms with differential Q-cumulants:\r
+ fDiffFlowCumulantsHistList[t][pe] = (TList*)list.Clone();\r
+ fDiffFlowCumulantsHistList[t][pe]->SetName(Form("Differential Q-cumulants (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));\r
+ fDiffFlowResults->Add(fDiffFlowCumulantsHistList[t][pe]); \r
+ // list holding histograms with differential flow estimates from Q-cumulants:\r
+ fDiffFlowHistList[t][pe] = (TList*)list.Clone();\r
+ fDiffFlowHistList[t][pe]->SetName(Form("Differential flow (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()));\r
+ fDiffFlowResults->Add(fDiffFlowHistList[t][pe]); \r
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI\r
+ \r
+ // c) Book and nest list for particle weights:\r
+ fWeightsList->SetName("Weights");\r
+ fWeightsList->SetOwner(kTRUE); \r
+ fHistList->Add(fWeightsList); \r
+\r
+ // d) Book and nest list for distributions:\r
+ fDistributionsList = new TList();\r
+ fDistributionsList->SetName("Distributions");\r
+ fDistributionsList->SetOwner(kTRUE);\r
+ fHistList->Add(fDistributionsList);\r
+ \r
+ // e) Book and nest list for nested loops:\r
+ fNestedLoopsList = new TList();\r
+ fNestedLoopsList->SetName("Nested Loops");\r
+ fNestedLoopsList->SetOwner(kTRUE);\r
+ fHistList->Add(fNestedLoopsList);\r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::BookAndNestAllLists()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type)\r
+{\r
+ // fill common result histograms for differential flow\r
+ \r
+ Int_t typeFlag = -1;\r
+ //Int_t ptEtaFlag = -1;\r
+\r
+ if(type == "RP")\r
+ {\r
+ typeFlag = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ typeFlag = 1;\r
+ } \r
+ \r
+ // shortcuts:\r
+ Int_t t = typeFlag;\r
+ //Int_t pe = ptEtaFlag;\r
+\r
+ // to be improved (implement protection here)\r
+ \r
+ if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th))\r
+ {\r
+ cout<<"WARNING: fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th"<<endl; \r
+ cout<<" is NULL in AFAWQC::FCHRIF() !!!!"<<endl;\r
+ exit(0);\r
+ }\r
+ \r
+ // pt:\r
+ for(Int_t p=1;p<=fnBinsPt;p++)\r
+ {\r
+ Double_t v2 = fDiffFlow[t][0][0]->GetBinContent(p);\r
+ Double_t v4 = fDiffFlow[t][0][1]->GetBinContent(p);\r
+ Double_t v6 = fDiffFlow[t][0][2]->GetBinContent(p);\r
+ Double_t v8 = fDiffFlow[t][0][3]->GetBinContent(p);\r
+ \r
+ Double_t v2Error = fDiffFlow[t][0][0]->GetBinError(p);\r
+ Double_t v4Error = fDiffFlow[t][0][1]->GetBinError(p);\r
+ //Double_t v6Error = fFinalFlow1D[t][pW][nua][0][2]->GetBinError(p);\r
+ //Double_t v8Error = fFinalFlow1D[t][pW][nua][0][3]->GetBinError(p);\r
+ \r
+ if(type == "RP")\r
+ {\r
+ fCommonHistsResults2nd->FillDifferentialFlowPtRP(p,v2,v2Error);\r
+ fCommonHistsResults4th->FillDifferentialFlowPtRP(p,v4,v4Error);\r
+ fCommonHistsResults6th->FillDifferentialFlowPtRP(p,v6,0.);\r
+ fCommonHistsResults8th->FillDifferentialFlowPtRP(p,v8,0.);\r
+ } else if(type == "POI")\r
+ {\r
+ fCommonHistsResults2nd->FillDifferentialFlowPtPOI(p,v2,v2Error);\r
+ fCommonHistsResults4th->FillDifferentialFlowPtPOI(p,v4,v4Error);\r
+ fCommonHistsResults6th->FillDifferentialFlowPtPOI(p,v6,0.);\r
+ fCommonHistsResults8th->FillDifferentialFlowPtPOI(p,v8,0.);\r
+ }\r
+ } // end of for(Int_t p=1;p<=fnBinsPt;p++) \r
+ \r
+ // eta:\r
+ for(Int_t e=1;e<=fnBinsEta;e++)\r
+ {\r
+ Double_t v2 = fDiffFlow[t][1][0]->GetBinContent(e);\r
+ Double_t v4 = fDiffFlow[t][1][1]->GetBinContent(e);\r
+ Double_t v6 = fDiffFlow[t][1][2]->GetBinContent(e);\r
+ Double_t v8 = fDiffFlow[t][1][3]->GetBinContent(e);\r
+ \r
+ Double_t v2Error = fDiffFlow[t][1][0]->GetBinError(e);\r
+ Double_t v4Error = fDiffFlow[t][1][1]->GetBinError(e);\r
+ //Double_t v6Error = fDiffFlow[t][1][2]->GetBinError(e);\r
+ //Double_t v8Error = fDiffFlow[t][1][3]->GetBinError(e);\r
+ \r
+ if(type == "RP")\r
+ {\r
+ fCommonHistsResults2nd->FillDifferentialFlowEtaRP(e,v2,v2Error);\r
+ fCommonHistsResults4th->FillDifferentialFlowEtaRP(e,v4,v4Error);\r
+ fCommonHistsResults6th->FillDifferentialFlowEtaRP(e,v6,0.);\r
+ fCommonHistsResults8th->FillDifferentialFlowEtaRP(e,v8,0.);\r
+ } else if(type == "POI")\r
+ {\r
+ fCommonHistsResults2nd->FillDifferentialFlowEtaPOI(e,v2,v2Error);\r
+ fCommonHistsResults4th->FillDifferentialFlowEtaPOI(e,v4,v4Error);\r
+ fCommonHistsResults6th->FillDifferentialFlowEtaPOI(e,v6,0.);\r
+ fCommonHistsResults8th->FillDifferentialFlowEtaPOI(e,v8,0.);\r
+ }\r
+ } // end of for(Int_t e=1;e<=fnBinsEta;e++) \r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights, Bool_t correctedForNUA)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::AccessConstants()\r
+{\r
+ // access needed common constants from AliFlowCommonConstants\r
+ \r
+ fnBinsPhi = AliFlowCommonConstants::GetMaster()->GetNbinsPhi();\r
+ fPhiMin = AliFlowCommonConstants::GetMaster()->GetPhiMin(); \r
+ fPhiMax = AliFlowCommonConstants::GetMaster()->GetPhiMax();\r
+ if(fnBinsPhi) fPhiBinWidth = (fPhiMax-fPhiMin)/fnBinsPhi; \r
+ fnBinsPt = AliFlowCommonConstants::GetMaster()->GetNbinsPt();\r
+ fPtMin = AliFlowCommonConstants::GetMaster()->GetPtMin(); \r
+ fPtMax = AliFlowCommonConstants::GetMaster()->GetPtMax();\r
+ if(fnBinsPt) fPtBinWidth = (fPtMax-fPtMin)/fnBinsPt; \r
+ fnBinsEta = AliFlowCommonConstants::GetMaster()->GetNbinsEta();\r
+ fEtaMin = AliFlowCommonConstants::GetMaster()->GetEtaMin(); \r
+ fEtaMax = AliFlowCommonConstants::GetMaster()->GetEtaMax();\r
+ if(fnBinsEta) fEtaBinWidth = (fEtaMax-fEtaMin)/fnBinsEta; \r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::AccessConstants()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeights()\r
+{\r
+ // Calculate sum of linear and quadratic event weights for correlations\r
+ \r
+ \r
+ /*\r
+ Double_t dMult = (*fSMpk)(0,0); // multiplicity \r
+\r
+ Double_t eventWeight[4] = {0}; \r
+ \r
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
+ {\r
+ eventWeight[0] = dMult*(dMult-1); // event weight for <2> \r
+ eventWeight[1] = dMult*(dMult-1)*(dMult-2)*(dMult-3); // event weight for <4> \r
+ eventWeight[2] = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5); // event weight for <6> \r
+ eventWeight[3] = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)*(dMult-6)*(dMult-7); // event weight for <8> \r
+ } else\r
+ {\r
+ eventWeight[0] = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j;\r
+ eventWeight[1] = (*fSMpk)(3,1)-6.*(*fSMpk)(0,2)*(*fSMpk)(1,1) \r
+ + 8.*(*fSMpk)(0,3)*(*fSMpk)(0,1)\r
+ + 3.*(*fSMpk)(1,2)-6.*(*fSMpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l\r
+ //eventWeight[2] = ... // to be improved (calculated) \r
+ //eventWeight[3] = ... // to be improved (calculated) \r
+ }\r
+ */\r
+ \r
+ \r
+ for(Int_t p=0;p<2;p++) // power-1\r
+ {\r
+ for(Int_t ci=0;ci<4;ci++) // correlation index\r
+ { \r
+ fIntFlowSumOfEventWeights[p]->Fill(ci+0.5,pow(fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci+1),p+1)); \r
+ }\r
+ }\r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeights()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeights()\r
+{\r
+ // Calculate sum of product of event weights for correlations\r
+ \r
+ \r
+ /*\r
+ Double_t dMult = (*fSMpk)(0,0); // multiplicity \r
+\r
+ Double_t eventWeight[4] = {0}; \r
+ \r
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
+ {\r
+ eventWeight[0] = dMult*(dMult-1); // event weight for <2> \r
+ eventWeight[1] = dMult*(dMult-1)*(dMult-2)*(dMult-3); // event weight for <4> \r
+ eventWeight[2] = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5); // event weight for <6> \r
+ eventWeight[3] = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)*(dMult-6)*(dMult-7); // event weight for <8> \r
+ } else\r
+ {\r
+ eventWeight[0] = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j;\r
+ eventWeight[1] = (*fSMpk)(3,1)-6.*(*fSMpk)(0,2)*(*fSMpk)(1,1) \r
+ + 8.*(*fSMpk)(0,3)*(*fSMpk)(0,1)\r
+ + 3.*(*fSMpk)(1,2)-6.*(*fSMpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l\r
+ //eventWeight[2] = ... // to be improved (calculated) \r
+ //eventWeight[3] = ... // to be improved (calculated) \r
+ }\r
+\r
+ fIntFlowSumOfProductOfEventWeights->Fill(0.5,eventWeight[0]*eventWeight[1]); \r
+ fIntFlowSumOfProductOfEventWeights->Fill(1.5,eventWeight[0]*eventWeight[2]); \r
+ fIntFlowSumOfProductOfEventWeights->Fill(2.5,eventWeight[0]*eventWeight[3]); \r
+ fIntFlowSumOfProductOfEventWeights->Fill(3.5,eventWeight[1]*eventWeight[2]); \r
+ fIntFlowSumOfProductOfEventWeights->Fill(4.5,eventWeight[1]*eventWeight[3]); \r
+ fIntFlowSumOfProductOfEventWeights->Fill(5.5,eventWeight[2]*eventWeight[3]); \r
+ */\r
+ \r
+ \r
+ Int_t counter = 0;\r
+ \r
+ for(Int_t ci1=1;ci1<4;ci1++)\r
+ {\r
+ for(Int_t ci2=ci1+1;ci2<=4;ci2++)\r
+ {\r
+ fIntFlowSumOfProductOfEventWeights->Fill(0.5+counter++,\r
+ fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)*fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2));\r
+ }\r
+ }\r
+\r
+ \r
+\r
+} // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowIntFlowSumOfProductOfEventWeights()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelations(TString type, TString ptOrEta)\r
+{\r
+ // calculate reduced correlations for RPs or POIs in pt or eta bins\r
+\r
+ // multiplicity:\r
+ Double_t dMult = (*fSMpk)(0,0);\r
+ \r
+ // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
+ Double_t dReQ1n = (*fReQ)(0,0);\r
+ Double_t dReQ2n = (*fReQ)(1,0);\r
+ //Double_t dReQ3n = (*fReQ)(2,0);\r
+ //Double_t dReQ4n = (*fReQ)(3,0);\r
+ Double_t dImQ1n = (*fImQ)(0,0);\r
+ Double_t dImQ2n = (*fImQ)(1,0);\r
+ //Double_t dImQ3n = (*fImQ)(2,0);\r
+ //Double_t dImQ4n = (*fImQ)(3,0);\r
+\r
+ // reduced correlations are stored in fDiffFlowCorrelationsPro[0=RP,1=POI][0=pt,1=eta][correlation index]. Correlation index runs as follows:\r
+ // \r
+ // 0: <<2'>>\r
+ // 1: <<4'>>\r
+ // 2: <<6'>>\r
+ // 3: <<8'>>\r
+ \r
+ Int_t t = -1; // type flag \r
+ Int_t pe = -1; // ptEta flag\r
+ \r
+ if(type == "RP")\r
+ {\r
+ t = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ t = 1;\r
+ }\r
+\r
+ if(ptOrEta == "Pt")\r
+ {\r
+ pe = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ pe = 1;\r
+ }\r
+ \r
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
+ Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
+ //Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
+\r
+ // looping over all bins and calculating reduced correlations: \r
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ {\r
+ // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): \r
+ Double_t p1n0kRe = 0.;\r
+ Double_t p1n0kIm = 0.;\r
+\r
+ // number of POIs in particular pt or eta bin:\r
+ Double_t mp = 0.;\r
+\r
+ // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin):\r
+ Double_t q1n0kRe = 0.;\r
+ Double_t q1n0kIm = 0.;\r
+ Double_t q2n0kRe = 0.;\r
+ Double_t q2n0kIm = 0.;\r
+\r
+ // number of particles which are both RPs and POIs in particular pt or eta bin:\r
+ Double_t mq = 0.;\r
+ \r
+ if(type == "POI")\r
+ {\r
+ // q_{m*n,0}:\r
+ q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b))\r
+ * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b));\r
+ q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b))\r
+ * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b));\r
+ q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b))\r
+ * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b));\r
+ q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b))\r
+ * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); \r
+ \r
+ mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
+ } \r
+ else if(type == "RP")\r
+ {\r
+ // q_{m*n,0}:\r
+ q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b))\r
+ * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
+ q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b))\r
+ * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
+ q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b))\r
+ * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b));\r
+ q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b))\r
+ * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); \r
+ \r
+ mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) \r
+ }\r
+ \r
+ if(type == "POI")\r
+ {\r
+ // p_{m*n,0}:\r
+ p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b))\r
+ * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b));\r
+ p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) \r
+ * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b));\r
+ \r
+ mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
+ \r
+ t = 1; // typeFlag = RP or POI\r
+ }\r
+ else if(type == "RP")\r
+ {\r
+ // p_{m*n,0} = q_{m*n,0}:\r
+ p1n0kRe = q1n0kRe; \r
+ p1n0kIm = q1n0kIm; \r
+ \r
+ mp = mq; \r
+ \r
+ t = 0; // typeFlag = RP or POI\r
+ }\r
+ \r
+ // 2'-particle correlation for particular (pt,eta) bin:\r
+ Double_t two1n1nPtEta = 0.;\r
+ if(mp*dMult-mq)\r
+ {\r
+ two1n1nPtEta = (p1n0kRe*dReQ1n+p1n0kIm*dImQ1n-mq)\r
+ / (mp*dMult-mq);\r
+ \r
+ if(type == "POI") // to be improved (I do not this if)\r
+ { \r
+ // fill profile to get <<2'>> for POIs\r
+ fDiffFlowCorrelationsPro[1][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta,mp*dMult-mq);\r
+ // histogram to store <2'> for POIs e-b-e (needed in some other methods):\r
+ fDiffFlowCorrelationsEBE[1][pe][0]->SetBinContent(b,two1n1nPtEta); \r
+ fDiffFlowEventWeightsForCorrelationsEBE[1][pe][0]->SetBinContent(b,mp*dMult-mq); \r
+ }\r
+ else if(type == "RP") // to be improved (I do not this if)\r
+ {\r
+ // profile to get <<2'>> for RPs:\r
+ fDiffFlowCorrelationsPro[0][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta,mp*dMult-mq);\r
+ // histogram to store <2'> for RPs e-b-e (needed in some other methods):\r
+ fDiffFlowCorrelationsEBE[0][pe][0]->SetBinContent(b,two1n1nPtEta); \r
+ fDiffFlowEventWeightsForCorrelationsEBE[0][pe][0]->SetBinContent(b,mp*dMult-mq); \r
+ }\r
+ } // end of if(mp*dMult-mq)\r
+ \r
+ // 4'-particle correlation:\r
+ Double_t four1n1n1n1nPtEta = 0.;\r
+ if((mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression)\r
+ {\r
+ four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n)\r
+ - q2n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.))\r
+ - 2.*q2n0kIm*dReQ1n*dImQ1n\r
+ - p1n0kRe*(dReQ1n*dReQ2n+dImQ1n*dImQ2n)\r
+ + p1n0kIm*(dImQ1n*dReQ2n-dReQ1n*dImQ2n)\r
+ - 2.*dMult*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n)\r
+ - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*mq \r
+ + 6.*(q1n0kRe*dReQ1n+q1n0kIm*dImQ1n) \r
+ + 1.*(q2n0kRe*dReQ2n+q2n0kIm*dImQ2n) \r
+ + 2.*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) \r
+ + 2.*mq*dMult \r
+ - 6.*mq) \r
+ / ((mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); \r
+ \r
+ if(type == "POI")\r
+ {\r
+ // profile to get <<4'>> for POIs:\r
+ fDiffFlowCorrelationsPro[1][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta,\r
+ (mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); \r
+ // histogram to store <4'> for POIs e-b-e (needed in some other methods):\r
+ fDiffFlowCorrelationsEBE[1][pe][1]->SetBinContent(b,four1n1n1n1nPtEta); \r
+ fDiffFlowEventWeightsForCorrelationsEBE[1][pe][1]->SetBinContent(b,(mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); \r
+ }\r
+ else if(type == "RP")\r
+ {\r
+ // profile to get <<4'>> for RPs:\r
+ fDiffFlowCorrelationsPro[0][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta,\r
+ (mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); \r
+ // histogram to store <4'> for RPs e-b-e (needed in some other methods):\r
+ fDiffFlowCorrelationsEBE[0][pe][1]->SetBinContent(b,four1n1n1n1nPtEta); \r
+ fDiffFlowEventWeightsForCorrelationsEBE[0][pe][1]->SetBinContent(b,(mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); \r
+ }\r
+ } // end of if((mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
+ // +mq*(dMult-1.)*(dMult-2.)*(dMult-3.))\r
+ \r
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ \r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelations(TString type, TString ptOrEta);\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfEventWeights(TString type, TString ptOrEta)\r
+{\r
+ // Calculate sums of various event weights for reduced correlations. \r
+ // (These quantitites are needed in expressions for unbiased estimators relevant for the statistical errors.)\r
+\r
+ Int_t typeFlag = -1;\r
+ Int_t ptEtaFlag = -1;\r
+\r
+ if(type == "RP")\r
+ {\r
+ typeFlag = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ typeFlag = 1;\r
+ } \r
+ \r
+ if(ptOrEta == "Pt")\r
+ {\r
+ ptEtaFlag = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ ptEtaFlag = 1;\r
+ } \r
+ \r
+ // shortcuts:\r
+ Int_t t = typeFlag;\r
+ Int_t pe = ptEtaFlag;\r
+ \r
+ // binning:\r
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
+ Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
+ //Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
+ \r
+ for(Int_t rpq=0;rpq<3;rpq++)\r
+ {\r
+ for(Int_t m=0;m<4;m++)\r
+ {\r
+ for(Int_t k=0;k<9;k++)\r
+ {\r
+ if(!fReRPQ1dEBE[rpq][pe][m][k])\r
+ {\r
+ cout<<"WARNING: fReRPQ1dEBE[rpq][pe][m][k] is NULL in AFAWQC::CSAPOEWFDF() !!!!"<<endl;\r
+ cout<<"pe = "<<pe<<endl;\r
+ cout<<"rpq = "<<rpq<<endl;\r
+ cout<<"m = "<<m<<endl;\r
+ cout<<"k = "<<k<<endl;\r
+ exit(0); \r
+ }\r
+ }\r
+ }\r
+ } \r
+\r
+ // multiplicities:\r
+ Double_t dMult = (*fSMpk)(0,0); // total event multiplicity\r
+ //Double_t mr = 0.; // number of RPs in particular pt or eta bin\r
+ Double_t mp = 0.; // number of POIs in particular pt or eta bin \r
+ Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin\r
+ \r
+ // event weights for reduced correlations:\r
+ Double_t dw2 = 0.; // event weight for <2'>\r
+ Double_t dw4 = 0.; // event weight for <4'>\r
+ //Double_t dw6 = 0.; // event weight for <6'>\r
+ //Double_t dw8 = 0.; // event weight for <8'>\r
+\r
+ // looping over bins:\r
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ {\r
+ if(type == "RP")\r
+ {\r
+ mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b);\r
+ mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow\r
+ } else if(type == "POI")\r
+ {\r
+ mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b);\r
+ mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); \r
+ }\r
+ \r
+ // event weight for <2'>:\r
+ dw2 = mp*dMult-mq; \r
+ fDiffFlowSumOfEventWeights[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2);\r
+ fDiffFlowSumOfEventWeights[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw2,2.));\r
+ \r
+ // event weight for <4'>:\r
+ dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); \r
+ fDiffFlowSumOfEventWeights[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4);\r
+ fDiffFlowSumOfEventWeights[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw4,2.));\r
+ \r
+ // event weight for <6'>:\r
+ //dw6 = ...; \r
+ //fDiffFlowSumOfEventWeights[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6);\r
+ //fDiffFlowSumOfEventWeights[t][pe][t][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw6,2.));\r
+ \r
+ // event weight for <8'>:\r
+ //dw8 = ...; \r
+ //fDiffFlowSumOfEventWeights[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw8);\r
+ //fDiffFlowSumOfEventWeights[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw8,2.)); \r
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) \r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfEventWeights()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfProductOfEventWeights(TString type, TString ptOrEta)\r
+{\r
+ // Calculate sum of products of various event weights for both types of correlations (the ones for int. and diff. flow). \r
+ // (These quantitites are needed in expressions for unbiased estimators relevant for the statistical errors.)\r
+ //\r
+ // Important: To fill fDiffFlowSumOfProductOfEventWeights[][][][] use bellow table (i,j) with following constraints: \r
+ // 1.) i<j \r
+ // 2.) do not store terms which DO NOT include reduced correlations;\r
+ // Table:\r
+ // [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] x [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>]\r
+ \r
+ Int_t typeFlag = -1;\r
+ Int_t ptEtaFlag = -1;\r
+\r
+ if(type == "RP")\r
+ {\r
+ typeFlag = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ typeFlag = 1;\r
+ } \r
+ \r
+ if(ptOrEta == "Pt")\r
+ {\r
+ ptEtaFlag = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ ptEtaFlag = 1;\r
+ } \r
+ \r
+ // shortcuts:\r
+ Int_t t = typeFlag;\r
+ Int_t pe = ptEtaFlag;\r
+ \r
+ // binning:\r
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
+ Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
+ //Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
+ \r
+ // protection:\r
+ for(Int_t rpq=0;rpq<3;rpq++)\r
+ {\r
+ for(Int_t m=0;m<4;m++)\r
+ {\r
+ for(Int_t k=0;k<9;k++)\r
+ {\r
+ if(!fReRPQ1dEBE[rpq][pe][m][k])\r
+ {\r
+ cout<<"WARNING: fReRPQ1dEBE[rpq][pe][m][k] is NULL in AFAWQC::CSAPOEWFDF() !!!!"<<endl;\r
+ cout<<"pe = "<<pe<<endl;\r
+ cout<<"rpq = "<<rpq<<endl;\r
+ cout<<"m = "<<m<<endl;\r
+ cout<<"k = "<<k<<endl;\r
+ exit(0); \r
+ }\r
+ }\r
+ }\r
+ } \r
+ \r
+ // multiplicities:\r
+ Double_t dMult = (*fSMpk)(0,0); // total event multiplicity\r
+ //Double_t mr = 0.; // number of RPs in particular pt or eta bin\r
+ Double_t mp = 0.; // number of POIs in particular pt or eta bin \r
+ Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin\r
+ \r
+ // event weights for correlations:\r
+ Double_t dW2 = dMult*(dMult-1); // event weight for <2> \r
+ Double_t dW4 = dMult*(dMult-1)*(dMult-2)*(dMult-3); // event weight for <4> \r
+ Double_t dW6 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5); // event weight for <6> \r
+ Double_t dW8 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)*(dMult-6)*(dMult-7); // event weight for <8> \r
+\r
+ // event weights for reduced correlations:\r
+ Double_t dw2 = 0.; // event weight for <2'>\r
+ Double_t dw4 = 0.; // event weight for <4'>\r
+ //Double_t dw6 = 0.; // event weight for <6'>\r
+ //Double_t dw8 = 0.; // event weight for <8'>\r
+ \r
+ // looping over bins:\r
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ {\r
+ if(type == "RP")\r
+ {\r
+ mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b);\r
+ mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow\r
+ } else if(type == "POI")\r
+ {\r
+ mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b);\r
+ mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); \r
+ }\r
+ \r
+ // event weight for <2'>:\r
+ dw2 = mp*dMult-mq; \r
+ fDiffFlowSumOfProductOfEventWeights[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw2); // storing product of even weights for <2> and <2'>\r
+ fDiffFlowSumOfProductOfEventWeights[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW4); // storing product of even weights for <4> and <2'>\r
+ fDiffFlowSumOfProductOfEventWeights[t][pe][1][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW6); // storing product of even weights for <6> and <2'>\r
+ fDiffFlowSumOfProductOfEventWeights[t][pe][1][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW8); // storing product of even weights for <8> and <2'>\r
+ \r
+ // event weight for <4'>:\r
+ dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); \r
+ fDiffFlowSumOfProductOfEventWeights[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw4); // storing product of even weights for <2> and <4'>\r
+ fDiffFlowSumOfProductOfEventWeights[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw4); // storing product of even weights for <2'> and <4'>\r
+ fDiffFlowSumOfProductOfEventWeights[t][pe][2][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw4); // storing product of even weights for <4> and <4'>\r
+ fDiffFlowSumOfProductOfEventWeights[t][pe][3][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dW6); // storing product of even weights for <6> and <4'> \r
+ fDiffFlowSumOfProductOfEventWeights[t][pe][3][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dW8); // storing product of even weights for <8> and <4'>\r
+\r
+ // event weight for <6'>:\r
+ //dw6 = ...; \r
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][0][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw6); // storing product of even weights for <2> and <6'>\r
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][1][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw6); // storing product of even weights for <2'> and <6'>\r
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][2][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw6); // storing product of even weights for <4> and <6'>\r
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][3][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dw6); // storing product of even weights for <4'> and <6'> \r
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][4][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW6*dw6); // storing product of even weights for <6> and <6'>\r
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][5][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dW8); // storing product of even weights for <6'> and <8>\r
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dw8); // storing product of even weights for <6'> and <8'>\r
+\r
+ // event weight for <8'>:\r
+ //dw8 = ...; \r
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][0][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw8); // storing product of even weights for <2> and <8'>\r
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][1][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw8); // storing product of even weights for <2'> and <8'>\r
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][2][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw8); // storing product of even weights for <4> and <8'>\r
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][3][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dw8); // storing product of even weights for <4'> and <8'> \r
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][4][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW6*dw8); // storing product of even weights for <6> and <8'>\r
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dw8); // storing product of even weights for <6'> and <8'>\r
+ //fDiffFlowSumOfProductOfEventWeights[t][pe][6][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW8*dw8); // storing product of even weights for <8> and <8'>\r
+ \r
+ // Table:\r
+ // [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] x [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>]\r
+ \r
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ \r
+\r
+\r
+} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfProductOfEventWeights(TString type, TString ptOrEta)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::FinalizeReducedCorrelations(TString type, TString ptOrEta)\r
+{\r
+ // Transfer profiles into histograms and calculate statistical errors correctly.\r
+\r
+ Int_t typeFlag = -1;\r
+ Int_t ptEtaFlag = -1;\r
+\r
+ if(type == "RP")\r
+ {\r
+ typeFlag = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ typeFlag = 1;\r
+ } \r
+ \r
+ if(ptOrEta == "Pt")\r
+ {\r
+ ptEtaFlag = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ ptEtaFlag = 1;\r
+ } \r
+ \r
+ // shortcuts:\r
+ Int_t t = typeFlag;\r
+ Int_t pe = ptEtaFlag;\r
+ \r
+ for(Int_t rci=0;rci<4;rci++)\r
+ {\r
+ if(!fDiffFlowCorrelationsPro[t][pe][rci])\r
+ {\r
+ cout<<"WARNING: fDiffFlowCorrelationsPro[t][pe][rci] is NULL in AFAWQC::FRC() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl; \r
+ cout<<"pe = "<<pe<<endl; \r
+ cout<<"rci = "<<rci<<endl;\r
+ exit(0); \r
+ }\r
+ for(Int_t power=0;power<2;power++)\r
+ {\r
+ if(!fDiffFlowSumOfEventWeights[t][pe][power][rci])\r
+ {\r
+ cout<<"WARNING: fDiffFlowSumOfEventWeights[t][pe][power][rci] is NULL in AFAWQC::FRC() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl; \r
+ cout<<"pe = "<<pe<<endl;\r
+ cout<<"power = "<<power<<endl; \r
+ cout<<"rci = "<<rci<<endl;\r
+ exit(0); \r
+ } \r
+ } // end of for(Int_t power=0;power<2;power++)\r
+ } // end of for(Int_t rci=0;rci<4;rci++)\r
+ \r
+ // common:\r
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
+ \r
+ // transfer 1D profile into 1D histogram:\r
+ Double_t correlation = 0.;\r
+ Double_t spread = 0.;\r
+ Double_t sumOfWeights = 0.; // sum of weights for particular reduced correlations for particular pt or eta bin\r
+ Double_t sumOfSquaredWeights = 0.; // sum of squared weights for particular reduced correlations for particular pt or eta bin\r
+ Double_t error = 0.; // error = termA * spread * termB\r
+ // termA = (sqrt(sumOfSquaredWeights)/sumOfWeights) \r
+ // termB = 1/pow(1-termA^2,0.5)\r
+ Double_t termA = 0.; \r
+ Double_t termB = 0.; \r
+ for(Int_t rci=0;rci<4;rci++) // index of reduced correlation\r
+ {\r
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++) // number of pt or eta bins\r
+ {\r
+ correlation = fDiffFlowCorrelationsPro[t][pe][rci]->GetBinContent(b); \r
+ spread = fDiffFlowCorrelationsPro[t][pe][rci]->GetBinError(b);\r
+ sumOfWeights = fDiffFlowSumOfEventWeights[t][pe][0][rci]->GetBinContent(b);\r
+ sumOfSquaredWeights = fDiffFlowSumOfEventWeights[t][pe][1][rci]->GetBinContent(b);\r
+ if(sumOfWeights) termA = (pow(sumOfSquaredWeights,0.5)/sumOfWeights);\r
+ if(1.-pow(termA,2.)>0.) termB = 1./pow(1.-pow(termA,2.),0.5); \r
+ error = termA*spread*termB; // final error (unbiased estimator for standard deviation)\r
+ fDiffFlowCorrelationsHist[t][pe][rci]->SetBinContent(b,correlation); \r
+ fDiffFlowCorrelationsHist[t][pe][rci]->SetBinError(b,error); \r
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ } // end of for(Int_t rci=0;rci<4;rci++)\r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::FinalizeReducedCorrelations(TString type, TString ptOrEta)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowProductOfCorrelations(TString type, TString ptOrEta)\r
+{\r
+ // store products: <2><2'>, <2><4'>, <2><6'>, <2><8'>, <2'><4>, \r
+ // <2'><4'>, <2'><6>, <2'><6'>, <2'><8>, <2'><8'>,\r
+ // <4><4'>, <4><6'>, <4><8'>, <4'><6>, <4'><6'>, \r
+ // <4'><8>, <4'><8'>, <6><6'>, <6><8'>, <6'><8>, \r
+ // <6'><8'>, <8><8'>.\r
+ \r
+ Int_t typeFlag = -1;\r
+ Int_t ptEtaFlag = -1;\r
+\r
+ if(type == "RP")\r
+ {\r
+ typeFlag = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ typeFlag = 1;\r
+ } \r
+ \r
+ if(ptOrEta == "Pt")\r
+ {\r
+ ptEtaFlag = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ ptEtaFlag = 1;\r
+ } \r
+ \r
+ // shortcuts:\r
+ Int_t t = typeFlag;\r
+ Int_t pe = ptEtaFlag;\r
+ \r
+ // common:\r
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
+ Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
+ \r
+ // protections // to be improved (add protection for all pointers in this method)\r
+ if(!fIntFlowCorrelationsEBE)\r
+ {\r
+ cout<<"WARNING: fIntFlowCorrelationsEBE is NULL in AFAWQC::CDFPOC() !!!!"<<endl;\r
+ exit(0);\r
+ } \r
+ \r
+ /* \r
+ Double_t dMult = (*fSMpk)(0,0); // multiplicity (number of particles used to determine the reaction plane)\r
+ //Double_t mr = 0.; // number of RPs in particular pt or eta bin\r
+ Double_t mp = 0.; // number of POIs in particular pt or eta bin \r
+ Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin\r
+ */\r
+\r
+ // e-b-e correlations:\r
+ Double_t twoEBE = fIntFlowCorrelationsEBE->GetBinContent(1); // <2>\r
+ Double_t fourEBE = fIntFlowCorrelationsEBE->GetBinContent(2); // <4>\r
+ Double_t sixEBE = fIntFlowCorrelationsEBE->GetBinContent(3); // <6>\r
+ Double_t eightEBE = fIntFlowCorrelationsEBE->GetBinContent(4); // <8>\r
+ \r
+ // event weights for correlations:\r
+ Double_t dW2 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1); // event weight for <2> \r
+ Double_t dW4 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2); // event weight for <4> \r
+ Double_t dW6 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(3); // event weight for <6> \r
+ Double_t dW8 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(4); // event weight for <8> \r
+ \r
+ // e-b-e reduced correlations:\r
+ Double_t twoReducedEBE = 0.; // <2'>\r
+ Double_t fourReducedEBE = 0.; // <4'>\r
+ Double_t sixReducedEBE = 0.; // <6'>\r
+ Double_t eightReducedEBE = 0.; // <8'> \r
+ \r
+ // event weights for reduced correlations:\r
+ Double_t dw2 = 0.; // event weight for <2'>\r
+ Double_t dw4 = 0.; // event weight for <4'>\r
+ //Double_t dw6 = 0.; // event weight for <6'>\r
+ //Double_t dw8 = 0.; // event weight for <8'>\r
+\r
+ // looping over bins:\r
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ {\r
+ // e-b-e reduced correlations:\r
+ twoReducedEBE = fDiffFlowCorrelationsEBE[t][pe][0]->GetBinContent(b);\r
+ fourReducedEBE = fDiffFlowCorrelationsEBE[t][pe][1]->GetBinContent(b);\r
+ sixReducedEBE = fDiffFlowCorrelationsEBE[t][pe][2]->GetBinContent(b);\r
+ eightReducedEBE = fDiffFlowCorrelationsEBE[t][pe][3]->GetBinContent(b);\r
+ \r
+ /*\r
+ // to be improved (I should not do this here again)\r
+ if(type == "RP")\r
+ {\r
+ mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b);\r
+ mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow\r
+ } else if(type == "POI")\r
+ {\r
+ mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b);\r
+ mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); \r
+ }\r
+ \r
+ // event weights for reduced correlations:\r
+ dw2 = mp*dMult-mq; // weight for <2'> \r
+ dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.)\r
+ + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); // weight for <4'>\r
+ //dw6 = ... \r
+ //dw8 = ... \r
+ \r
+ */\r
+ \r
+ dw2 = fDiffFlowEventWeightsForCorrelationsEBE[t][pe][0]->GetBinContent(b);\r
+ dw4 = fDiffFlowEventWeightsForCorrelationsEBE[t][pe][1]->GetBinContent(b);\r
+ \r
+ // storing all products:\r
+ fDiffFlowProductOfCorrelationsPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*twoReducedEBE,dW2*dw2); // storing <2><2'>\r
+ fDiffFlowProductOfCorrelationsPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*twoReducedEBE,dW4*dw2); // storing <4><2'>\r
+ fDiffFlowProductOfCorrelationsPro[t][pe][1][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*twoReducedEBE,dW6*dw2); // storing <6><2'>\r
+ fDiffFlowProductOfCorrelationsPro[t][pe][1][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*twoReducedEBE,dW8*dw2); // storing <8><2'>\r
+ \r
+ // event weight for <4'>:\r
+ fDiffFlowProductOfCorrelationsPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*fourReducedEBE,dW2*dw4); // storing <2><4'>\r
+ fDiffFlowProductOfCorrelationsPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*fourReducedEBE,dw2*dw4); // storing <2'><4'>\r
+ fDiffFlowProductOfCorrelationsPro[t][pe][2][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*fourReducedEBE,dW4*dw4); // storing <4><4'>\r
+ fDiffFlowProductOfCorrelationsPro[t][pe][3][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*fourReducedEBE,dW6*dw4); // storing <6><4'> \r
+ fDiffFlowProductOfCorrelationsPro[t][pe][3][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*fourReducedEBE,dW8*dw4); // storing <8><4'>\r
+\r
+ // event weight for <6'>:\r
+ //dw6 = ...; \r
+ //fDiffFlowProductOfCorrelationsPro[t][pe][0][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*sixReducedEBE,dW2*dw6); // storing <2><6'>\r
+ //fDiffFlowProductOfCorrelationsPro[t][pe][1][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*sixReducedEBE,dw2*dw6); // storing <2'><6'>\r
+ //fDiffFlowProductOfCorrelationsPro[t][pe][2][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*sixReducedEBE,dW4*dw6); // storing <4><6'>\r
+ //fDiffFlowProductOfCorrelationsPro[t][pe][3][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourReducedEBE*sixReducedEBE,dw4*dw6); // storing <4'><6'> \r
+ //fDiffFlowProductOfCorrelationsPro[t][pe][4][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*sixReducedEBE,dW6*dw6); // storing <6><6'>\r
+ //fDiffFlowProductOfCorrelationsPro[t][pe][5][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightEBE,dw6*dW8); // storing <6'><8>\r
+ //fDiffFlowProductOfCorrelationsPro[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightReducedEBE,dw6*dw8); // storing <6'><8'>\r
+\r
+ // event weight for <8'>:\r
+ //dw8 = ...; \r
+ //fDiffFlowProductOfCorrelationsPro[t][pe][0][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*eightReducedEBE,dW2*dw8); // storing <2><8'>\r
+ //fDiffFlowProductOfCorrelationsPro[t][pe][1][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*eightReducedEBE,dw2*dw8); // storing <2'><8'>\r
+ //fDiffFlowProductOfCorrelationsPro[t][pe][2][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*eightReducedEBE,dW4*dw8); // storing <4><8'>\r
+ //fDiffFlowProductOfCorrelationsPro[t][pe][3][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourReducedEBE*eightReducedEBE,dw4*dw8); // storing <4'><8'> \r
+ //fDiffFlowProductOfCorrelationsPro[t][pe][4][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*eightReducedEBE,dW6*dw8); // storing <6><8'>\r
+ //fDiffFlowProductOfCorrelationsPro[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightReducedEBE,dw6*dw8); // storing <6'><8'>\r
+ //fDiffFlowProductOfCorrelationsPro[t][pe][6][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*eightReducedEBE,dW8*dw8); // storing <8><8'> \r
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++ \r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowProductOfCorrelations(TString type, TString ptOrEta)\r
+\r
+\r
+//================================================================================================================================\r
+ \r
+ \r
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCovariances(TString type, TString ptOrEta) // to be improved (reimplemented)\r
+{\r
+ // a) Calculate unbiased estimators Cov(<2>,<2'>), Cov(<2>,<4'>), Cov(<4>,<2'>), Cov(<4>,<4'>) and Cov(<2'>,<4'>)\r
+ // for covariances V(<2>,<2'>), V(<2>,<4'>), V(<4>,<2'>), V(<4>,<4'>) and V(<2'>,<4'>). \r
+ // b) Store in histogram fDiffFlowCovariances[t][pe][index] for instance the following: \r
+ //\r
+ // Cov(<2>,<2'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)]\r
+ // \r
+ // where N is the number of events, w_{<2>} is event weight for <2> and w_{<2'>} is event weight for <2'>.\r
+ // c) Binning of fDiffFlowCovariances[t][pe][index] is organized as follows:\r
+ // \r
+ // 1st bin: Cov(<2>,<2'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] \r
+ // 2nd bin: Cov(<2>,<4'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] \r
+ // 3rd bin: Cov(<4>,<2'>) * (sum_{i=1}^{N} w_{<4>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] \r
+ // 4th bin: Cov(<4>,<4'>) * (sum_{i=1}^{N} w_{<4>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] \r
+ // 5th bin: Cov(<2'>,<4'>) * (sum_{i=1}^{N} w_{<2'>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<2'>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] \r
+ // ...\r
+ \r
+ Int_t typeFlag = -1;\r
+ Int_t ptEtaFlag = -1;\r
+\r
+ if(type == "RP")\r
+ {\r
+ typeFlag = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ typeFlag = 1;\r
+ } \r
+ \r
+ if(ptOrEta == "Pt")\r
+ {\r
+ ptEtaFlag = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ ptEtaFlag = 1;\r
+ } \r
+ \r
+ // shortcuts:\r
+ Int_t t = typeFlag;\r
+ Int_t pe = ptEtaFlag;\r
+ \r
+ // common:\r
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
+ //Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
+ //Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
+ //Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
+ \r
+ // average correlations:\r
+ Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>>\r
+ Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>>\r
+ //Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>>\r
+ //Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>>\r
+ \r
+ // sum of weights for correlation:\r
+ Double_t sumOfWeightsForTwo = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // sum_{i=1}^{N} w_{<2>}\r
+ Double_t sumOfWeightsForFour = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // sum_{i=1}^{N} w_{<4>}\r
+ //Double_t sumOfWeightsForSix = fIntFlowSumOfEventWeights[0]->GetBinContent(3); // sum_{i=1}^{N} w_{<6>}\r
+ //Double_t sumOfWeightsForEight = fIntFlowSumOfEventWeights[0]->GetBinContent(4); // sum_{i=1}^{N} w_{<8>}\r
+ \r
+ // average reduced correlations:\r
+ Double_t twoReduced = 0.; // <<2'>> \r
+ Double_t fourReduced = 0.; // <<4'>>\r
+ //Double_t sixReduced = 0.; // <<6'>>\r
+ //Double_t eightReduced = 0.; // <<8'>>\r
+\r
+ // sum of weights for reduced correlation:\r
+ Double_t sumOfWeightsForTwoReduced = 0.; // sum_{i=1}^{N} w_{<2'>}\r
+ Double_t sumOfWeightsForFourReduced = 0.; // sum_{i=1}^{N} w_{<4'>}\r
+ //Double_t sumOfWeightsForSixReduced = 0.; // sum_{i=1}^{N} w_{<6'>}\r
+ //Double_t sumOfWeightsForEightReduced = 0.; // sum_{i=1}^{N} w_{<8'>}\r
+ \r
+ // product of weights for reduced correlation:\r
+ Double_t productOfWeightsForTwoTwoReduced = 0.; // sum_{i=1}^{N} w_{<2>}w_{<2'>}\r
+ Double_t productOfWeightsForTwoFourReduced = 0.; // sum_{i=1}^{N} w_{<2>}w_{<4'>}\r
+ Double_t productOfWeightsForFourTwoReduced = 0.; // sum_{i=1}^{N} w_{<4>}w_{<2'>}\r
+ Double_t productOfWeightsForFourFourReduced = 0.; // sum_{i=1}^{N} w_{<4>}w_{<4'>}\r
+ Double_t productOfWeightsForTwoReducedFourReduced = 0.; // sum_{i=1}^{N} w_{<2'>}w_{<4'>}\r
+ // ...\r
+ \r
+ // products for differential flow:\r
+ Double_t twoTwoReduced = 0; // <<2><2'>> \r
+ Double_t twoFourReduced = 0; // <<2><4'>> \r
+ Double_t fourTwoReduced = 0; // <<4><2'>> \r
+ Double_t fourFourReduced = 0; // <<4><4'>> \r
+ Double_t twoReducedFourReduced = 0; // <<2'><4'>> \r
+\r
+ // denominators in the expressions for the unbiased estimators for covariances:\r
+ // denominator = 1 - term1/(term2*term3)\r
+ // prefactor = term1/(term2*term3)\r
+ Double_t denominator = 0.; \r
+ Double_t prefactor = 0.;\r
+ Double_t term1 = 0.; \r
+ Double_t term2 = 0.; \r
+ Double_t term3 = 0.; \r
+ \r
+ // unbiased estimators for covariances for differential flow:\r
+ Double_t covTwoTwoReduced = 0.; // Cov(<2>,<2'>)\r
+ Double_t wCovTwoTwoReduced = 0.; // Cov(<2>,<2'>) * prefactor(w_{<2>},w_{<2'>})\r
+ Double_t covTwoFourReduced = 0.; // Cov(<2>,<4'>)\r
+ Double_t wCovTwoFourReduced = 0.; // Cov(<2>,<4'>) * prefactor(w_{<2>},w_{<4'>})\r
+ Double_t covFourTwoReduced = 0.; // Cov(<4>,<2'>)\r
+ Double_t wCovFourTwoReduced = 0.; // Cov(<4>,<2'>) * prefactor(w_{<4>},w_{<2'>})\r
+ Double_t covFourFourReduced = 0.; // Cov(<4>,<4'>)\r
+ Double_t wCovFourFourReduced = 0.; // Cov(<4>,<4'>) * prefactor(w_{<4>},w_{<4'>})\r
+ Double_t covTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>)\r
+ Double_t wCovTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) * prefactor(w_{<2'>},w_{<4'>})\r
+ \r
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ {\r
+ // average reduced corelations:\r
+ twoReduced = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b);\r
+ fourReduced = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b);\r
+ // average products:\r
+ twoTwoReduced = fDiffFlowProductOfCorrelationsPro[t][pe][0][1]->GetBinContent(b);\r
+ twoFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][0][3]->GetBinContent(b);\r
+ fourTwoReduced = fDiffFlowProductOfCorrelationsPro[t][pe][1][2]->GetBinContent(b);\r
+ fourFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][2][3]->GetBinContent(b);\r
+ twoReducedFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][1][3]->GetBinContent(b); \r
+ // sum of weights for reduced correlations:\r
+ sumOfWeightsForTwoReduced = fDiffFlowSumOfEventWeights[t][pe][0][0]->GetBinContent(b);\r
+ sumOfWeightsForFourReduced = fDiffFlowSumOfEventWeights[t][pe][0][1]->GetBinContent(b);\r
+ // products of weights for correlations:\r
+ productOfWeightsForTwoTwoReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][0][1]->GetBinContent(b); \r
+ productOfWeightsForTwoFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][0][3]->GetBinContent(b);\r
+ productOfWeightsForFourTwoReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][1][2]->GetBinContent(b);\r
+ productOfWeightsForFourFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][2][3]->GetBinContent(b);\r
+ productOfWeightsForTwoReducedFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][1][3]->GetBinContent(b);\r
+ // denominator for the unbiased estimator for covariances: 1 - term1/(term2*term3) \r
+ // prefactor (multiplies Cov's) = term1/(term2*term3) \r
+ // <2>,<2'>:\r
+ term1 = productOfWeightsForTwoTwoReduced; \r
+ term2 = sumOfWeightsForTwo;\r
+ term3 = sumOfWeightsForTwoReduced; \r
+ if(term2*term3>0.)\r
+ {\r
+ denominator = 1.-term1/(term2*term3);\r
+ prefactor = term1/(term2*term3);\r
+ if(denominator!=0)\r
+ {\r
+ covTwoTwoReduced = (twoTwoReduced-two*twoReduced)/denominator; \r
+ wCovTwoTwoReduced = covTwoTwoReduced*prefactor; \r
+ fDiffFlowCovariances[t][pe][0]->SetBinContent(b,wCovTwoTwoReduced);\r
+ }\r
+ }\r
+ // <2>,<4'>:\r
+ term1 = productOfWeightsForTwoFourReduced; \r
+ term2 = sumOfWeightsForTwo;\r
+ term3 = sumOfWeightsForFourReduced; \r
+ if(term2*term3>0.)\r
+ {\r
+ denominator = 1.-term1/(term2*term3);\r
+ prefactor = term1/(term2*term3);\r
+ if(denominator!=0)\r
+ {\r
+ covTwoFourReduced = (twoFourReduced-two*fourReduced)/denominator; \r
+ wCovTwoFourReduced = covTwoFourReduced*prefactor; \r
+ fDiffFlowCovariances[t][pe][1]->SetBinContent(b,wCovTwoFourReduced);\r
+ }\r
+ }\r
+ // <4>,<2'>:\r
+ term1 = productOfWeightsForFourTwoReduced; \r
+ term2 = sumOfWeightsForFour;\r
+ term3 = sumOfWeightsForTwoReduced; \r
+ if(term2*term3>0.)\r
+ {\r
+ denominator = 1.-term1/(term2*term3);\r
+ prefactor = term1/(term2*term3);\r
+ if(denominator!=0)\r
+ {\r
+ covFourTwoReduced = (fourTwoReduced-four*twoReduced)/denominator; \r
+ wCovFourTwoReduced = covFourTwoReduced*prefactor; \r
+ fDiffFlowCovariances[t][pe][2]->SetBinContent(b,wCovFourTwoReduced);\r
+ }\r
+ }\r
+ // <4>,<4'>:\r
+ term1 = productOfWeightsForFourFourReduced; \r
+ term2 = sumOfWeightsForFour;\r
+ term3 = sumOfWeightsForFourReduced; \r
+ if(term2*term3>0.)\r
+ {\r
+ denominator = 1.-term1/(term2*term3);\r
+ prefactor = term1/(term2*term3);\r
+ if(denominator!=0)\r
+ {\r
+ covFourFourReduced = (fourFourReduced-four*fourReduced)/denominator; \r
+ wCovFourFourReduced = covFourFourReduced*prefactor; \r
+ fDiffFlowCovariances[t][pe][3]->SetBinContent(b,wCovFourFourReduced);\r
+ }\r
+ }\r
+ // <2'>,<4'>:\r
+ term1 = productOfWeightsForTwoReducedFourReduced; \r
+ term2 = sumOfWeightsForTwoReduced;\r
+ term3 = sumOfWeightsForFourReduced; \r
+ if(term2*term3>0.)\r
+ {\r
+ denominator = 1.-term1/(term2*term3);\r
+ prefactor = term1/(term2*term3);\r
+ if(denominator!=0)\r
+ {\r
+ covTwoReducedFourReduced = (twoReducedFourReduced-twoReduced*fourReduced)/denominator; \r
+ wCovTwoReducedFourReduced = covTwoReducedFourReduced*prefactor; \r
+ fDiffFlowCovariances[t][pe][4]->SetBinContent(b,wCovTwoReducedFourReduced);\r
+ }\r
+ } \r
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCovariances(TString type, TString ptOrEta)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, TString ptOrEta)\r
+{\r
+ // calculate differential flow from differential cumulants and previously obtained integrated flow: (to be improved: description)\r
+ \r
+ Int_t typeFlag = -1;\r
+ Int_t ptEtaFlag = -1;\r
+\r
+ if(type == "RP")\r
+ {\r
+ typeFlag = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ typeFlag = 1;\r
+ } \r
+ \r
+ if(ptOrEta == "Pt")\r
+ {\r
+ ptEtaFlag = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ ptEtaFlag = 1;\r
+ } \r
+ \r
+ // shortcuts:\r
+ Int_t t = typeFlag;\r
+ Int_t pe = ptEtaFlag;\r
+ \r
+ // common:\r
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
+ \r
+ // correlations:\r
+ Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>>\r
+ Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>>\r
+ \r
+ // statistical errors of correlations:\r
+ Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1);\r
+ Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); \r
+ \r
+ // reduced correlations:\r
+ Double_t twoReduced = 0.; // <<2'>>\r
+ Double_t fourReduced = 0.; // <<4'>>\r
+ \r
+ // statistical errors of reduced correlations:\r
+ Double_t twoReducedError = 0.; \r
+ Double_t fourReducedError = 0.; \r
+\r
+ // covariances:\r
+ Double_t wCovTwoFour = fIntFlowCovariances->GetBinContent(1);// // Cov(<2>,<4>) * prefactor(<2>,<4>)\r
+ Double_t wCovTwoTwoReduced = 0.; // Cov(<2>,<2'>) * prefactor(<2>,<2'>)\r
+ Double_t wCovTwoFourReduced = 0.; // Cov(<2>,<4'>) * prefactor(<2>,<4'>)\r
+ Double_t wCovFourTwoReduced = 0.; // Cov(<4>,<2'>) * prefactor(<4>,<2'>)\r
+ Double_t wCovFourFourReduced = 0.; // Cov(<4>,<4'>) * prefactor(<4>,<4'>)\r
+ Double_t wCovTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) * prefactor(<2'>,<4'>)\r
+ \r
+ // differential flow:\r
+ Double_t v2Prime = 0.; // v'{2} \r
+ Double_t v4Prime = 0.; // v'{4}\r
+ \r
+ // statistical error of differential flow:\r
+ Double_t v2PrimeError = 0.; \r
+ Double_t v4PrimeError = 0.; \r
+ \r
+ // squared statistical error of differential flow:\r
+ Double_t v2PrimeErrorSquared = 0.; \r
+ Double_t v4PrimeErrorSquared = 0.; \r
+ \r
+ // loop over pt or eta bins:\r
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ {\r
+ // reduced correlations and statistical errors:\r
+ twoReduced = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b);\r
+ twoReducedError = fDiffFlowCorrelationsHist[t][pe][0]->GetBinError(b);\r
+ fourReduced = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b);\r
+ fourReducedError = fDiffFlowCorrelationsHist[t][pe][1]->GetBinError(b);\r
+ // covariances:\r
+ wCovTwoTwoReduced = fDiffFlowCovariances[t][pe][0]->GetBinContent(b);\r
+ wCovTwoFourReduced = fDiffFlowCovariances[t][pe][1]->GetBinContent(b);\r
+ wCovFourTwoReduced = fDiffFlowCovariances[t][pe][2]->GetBinContent(b);\r
+ wCovFourFourReduced = fDiffFlowCovariances[t][pe][3]->GetBinContent(b);\r
+ wCovTwoReducedFourReduced = fDiffFlowCovariances[t][pe][4]->GetBinContent(b);\r
+ // differential flow:\r
+ // v'{2}:\r
+ if(two>0.) \r
+ {\r
+ v2Prime = twoReduced/pow(two,0.5);\r
+ v2PrimeErrorSquared = (1./4.)*pow(two,-3.)*\r
+ (pow(twoReduced,2.)*pow(twoError,2.)\r
+ + 4.*pow(two,2.)*pow(twoReducedError,2.)\r
+ - 4.*two*twoReduced*wCovTwoTwoReduced);\r
+ \r
+ \r
+ if(v2PrimeErrorSquared>0.) v2PrimeError = pow(v2PrimeErrorSquared,0.5);\r
+ fDiffFlow[t][pe][0]->SetBinContent(b,v2Prime); \r
+ fDiffFlow[t][pe][0]->SetBinError(b,v2PrimeError); \r
+ }\r
+ // differential flow:\r
+ // v'{4}\r
+ if(2.*pow(two,2.)-four > 0.) \r
+ {\r
+ v4Prime = (2.*two*twoReduced-fourReduced)/pow(2.*pow(two,2.)-four,3./4.);\r
+ v4PrimeErrorSquared = pow(2.*pow(two,2.)-four,-7./2.)*\r
+ (pow(2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced,2.)*pow(twoError,2.)\r
+ + (9./16.)*pow(2.*two*twoReduced-fourReduced,2.)*pow(fourError,2.)\r
+ + 4.*pow(two,2.)*pow(2.*pow(two,2.)-four,2.)*pow(twoReducedError,2.)\r
+ + pow(2.*pow(two,2.)-four,2.)*pow(fourReducedError,2.) \r
+ - (3./2.)*(2.*two*twoReduced-fourReduced)\r
+ * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoFour\r
+ - 4.*two*(2.*pow(two,2.)-four)\r
+ * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoTwoReduced\r
+ + 2.*(2.*pow(two,2.)-four)\r
+ * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoFourReduced\r
+ + 3.*two*(2.*pow(two,2.)-four)*(2.*two*twoReduced-fourReduced)*wCovFourTwoReduced\r
+ - (3./2.)*(2.*pow(two,2.)-four)*(2.*two*twoReduced-fourReduced)*wCovFourFourReduced \r
+ - 4.*two*pow(2.*pow(two,2.)-four,2.)*wCovTwoReducedFourReduced); \r
+ if(v4PrimeErrorSquared>0.) v4PrimeError = pow(v4PrimeErrorSquared,0.5); \r
+ fDiffFlow[t][pe][1]->SetBinContent(b,v4Prime);\r
+ fDiffFlow[t][pe][1]->SetBinError(b,v4PrimeError); \r
+ }\r
+ \r
+ } // end of for(Int_t b=1;b<=fnBinsPtEta[pe];b++)\r
+ \r
+ \r
+ \r
+ \r
+ /*\r
+ // 2D:\r
+ for(Int_t nua=0;nua<2;nua++)\r
+ {\r
+ for(Int_t p=1;p<=fnBinsPt;p++)\r
+ {\r
+ for(Int_t e=1;e<=fnBinsEta;e++) \r
+ { \r
+ // differential cumulants:\r
+ Double_t qc2Prime = fFinalCumulants2D[t][pW][eW][nua][0]->GetBinContent(fFinalCumulants2D[t][pW][eW][nua][0]->GetBin(p,e)); // QC{2'} \r
+ Double_t qc4Prime = fFinalCumulants2D[t][pW][eW][nua][1]->GetBinContent(fFinalCumulants2D[t][pW][eW][nua][1]->GetBin(p,e)); // QC{4'}\r
+ // differential flow:\r
+ Double_t v2Prime = 0.; \r
+ Double_t v4Prime = 0.; \r
+ if(v2) \r
+ {\r
+ v2Prime = qc2Prime/v2;\r
+ fFinalFlow2D[t][pW][eW][nua][0]->SetBinContent(fFinalFlow2D[t][pW][eW][nua][0]->GetBin(p,e),v2Prime); \r
+ } \r
+ if(v4)\r
+ {\r
+ v4Prime = -qc4Prime/pow(v4,3.); \r
+ fFinalFlow2D[t][pW][eW][nua][1]->SetBinContent(fFinalFlow2D[t][pW][eW][nua][1]->GetBin(p,e),v4Prime); \r
+ } \r
+ } // end of for(Int_t e=1;e<=fnBinsEta;e++)\r
+ } // end of for(Int_t p=1;p<=fnBinsPt;p++)\r
+ } // end of for(Int_t nua=0;nua<2;nua++)\r
+ */\r
+\r
+} // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, Bool_t useParticleWeights)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::StoreIntFlowFlags()\r
+{\r
+ // a) Store all flags for integrated flow in profile fIntFlowFlags.\r
+ \r
+ if(!fIntFlowFlags)\r
+ {\r
+ cout<<"WARNING: fIntFlowFlags is NULL in AFAWQC::SFFIF() !!!!"<<endl;\r
+ exit(0);\r
+ } \r
+\r
+ fIntFlowFlags->Fill(0.5,(Int_t)fUsePhiWeights||fUsePtWeights||fUseEtaWeights); // particle weights used or not\r
+ //fIntFlowFlags->Fill(1.5,""); // which event weight was used? // to be improved\r
+ fIntFlowFlags->Fill(2.5,(Int_t)fApplyCorrectionForNUA); // corrected for non-uniform acceptance or not\r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::StoreIntFlowFlags()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::StoreDiffFlowFlags()\r
+{\r
+ // Store all flags for differential flow in the profile fDiffFlowFlags.\r
+ \r
+ if(!fDiffFlowFlags)\r
+ {\r
+ cout<<"WARNING: fDiffFlowFlags is NULL in AFAWQC::SFFDF() !!!!"<<endl;\r
+ exit(0);\r
+ } \r
+ \r
+ fDiffFlowFlags->Fill(0.5,fUsePhiWeights||fUsePtWeights||fUseEtaWeights); // particle weights used or not\r
+ //fDiffFlowFlags->Fill(1.5,""); // which event weight was used? // to be improved\r
+ fDiffFlowFlags->Fill(2.5,fApplyCorrectionForNUA); // corrected for non-uniform acceptance or not\r
+ fDiffFlowFlags->Fill(3.5,fCalculate2DFlow); // calculate also 2D differential flow in (pt,eta) or not\r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::StoreDiffFlowFlags()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::GetPointersForCommonHistograms(TList *outputListHistos) \r
+{\r
+ // Access all pointers to common control and common result histograms and profiles.\r
+ \r
+ if(outputListHistos) \r
+ {\r
+ TString commonHistsName = "AliFlowCommonHistQC";\r
+ commonHistsName += fAnalysisLabel->Data();\r
+ AliFlowCommonHist *commonHist = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject(commonHistsName.Data()));\r
+ if(commonHist) this->SetCommonHists(commonHist); \r
+ TString commonHists2ndOrderName = "AliFlowCommonHist2ndOrderQC";\r
+ commonHists2ndOrderName += fAnalysisLabel->Data();\r
+ AliFlowCommonHist *commonHist2nd = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject(commonHists2ndOrderName.Data()));\r
+ if(commonHist2nd) this->SetCommonHists2nd(commonHist2nd); \r
+ TString commonHists4thOrderName = "AliFlowCommonHist4thOrderQC";\r
+ commonHists4thOrderName += fAnalysisLabel->Data();\r
+ AliFlowCommonHist *commonHist4th = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject(commonHists4thOrderName.Data()));\r
+ if(commonHist4th) this->SetCommonHists4th(commonHist4th); \r
+ TString commonHists6thOrderName = "AliFlowCommonHist6thOrderQC";\r
+ commonHists6thOrderName += fAnalysisLabel->Data();\r
+ AliFlowCommonHist *commonHist6th = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject(commonHists6thOrderName.Data()));\r
+ if(commonHist6th) this->SetCommonHists6th(commonHist6th); \r
+ TString commonHists8thOrderName = "AliFlowCommonHist8thOrderQC";\r
+ commonHists8thOrderName += fAnalysisLabel->Data();\r
+ AliFlowCommonHist *commonHist8th = dynamic_cast<AliFlowCommonHist*>(outputListHistos->FindObject(commonHists8thOrderName.Data()));\r
+ if(commonHist8th) this->SetCommonHists8th(commonHist8th); \r
+ TString commonHistResults2ndOrderName = "AliFlowCommonHistResults2ndOrderQC"; \r
+ commonHistResults2ndOrderName += fAnalysisLabel->Data(); \r
+ AliFlowCommonHistResults *commonHistRes2nd = dynamic_cast<AliFlowCommonHistResults*>\r
+ (outputListHistos->FindObject(commonHistResults2ndOrderName.Data()));\r
+ if(commonHistRes2nd) this->SetCommonHistsResults2nd(commonHistRes2nd); \r
+ TString commonHistResults4thOrderName = "AliFlowCommonHistResults4thOrderQC";\r
+ commonHistResults4thOrderName += fAnalysisLabel->Data();\r
+ AliFlowCommonHistResults *commonHistRes4th = dynamic_cast<AliFlowCommonHistResults*>\r
+ (outputListHistos->FindObject(commonHistResults4thOrderName.Data()));\r
+ if(commonHistRes4th) this->SetCommonHistsResults4th(commonHistRes4th); \r
+ TString commonHistResults6thOrderName = "AliFlowCommonHistResults6thOrderQC";\r
+ commonHistResults6thOrderName += fAnalysisLabel->Data();\r
+ AliFlowCommonHistResults *commonHistRes6th = dynamic_cast<AliFlowCommonHistResults*>\r
+ (outputListHistos->FindObject(commonHistResults6thOrderName.Data()));\r
+ if(commonHistRes6th) this->SetCommonHistsResults6th(commonHistRes6th); \r
+ TString commonHistResults8thOrderName = "AliFlowCommonHistResults8thOrderQC";\r
+ commonHistResults8thOrderName += fAnalysisLabel->Data();\r
+ AliFlowCommonHistResults *commonHistRes8th = dynamic_cast<AliFlowCommonHistResults*>\r
+ (outputListHistos->FindObject(commonHistResults8thOrderName.Data())); \r
+ if(commonHistRes8th) this->SetCommonHistsResults8th(commonHistRes8th);\r
+ } else\r
+ {\r
+ cout<<"WARNING: outputListHistos is NULL in AFAWQC::GPFCH() !!!!"<<endl;\r
+ exit(0);\r
+ }\r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::GetPointersForCommonHistograms(TList *outputListHistos) \r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::GetPointersForParticleWeightsHistograms(TList *outputListHistos) \r
+{\r
+ // Get pointers for histograms with particle weights.\r
+\r
+ if(outputListHistos)\r
+ {\r
+ TList *weightsList = dynamic_cast<TList*>(outputListHistos->FindObject("Weights"));\r
+ if(weightsList) this->SetWeightsList(weightsList);\r
+ TString fUseParticleWeightsName = "fUseParticleWeightsQC"; // to be improved (hirdwired label QC)\r
+ fUseParticleWeightsName += fAnalysisLabel->Data();\r
+ TProfile *useParticleWeights = dynamic_cast<TProfile*>(weightsList->FindObject(fUseParticleWeightsName.Data()));\r
+ if(useParticleWeights)\r
+ {\r
+ this->SetUseParticleWeights(useParticleWeights); \r
+ fUsePhiWeights = (Int_t)fUseParticleWeights->GetBinContent(1); \r
+ fUsePtWeights = (Int_t)fUseParticleWeights->GetBinContent(2); \r
+ fUseEtaWeights = (Int_t)fUseParticleWeights->GetBinContent(3); \r
+ }\r
+ } else\r
+ {\r
+ cout<<"WARNING: outputListHistos is NULL in AFAWQC::GPFPWH() !!!!"<<endl;\r
+ exit(0);\r
+ }\r
+\r
+} // end of void AliFlowAnalysisWithQCumulants::GetPointersForParticleWeightsHistograms(TList *outputListHistos); \r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::GetPointersForIntFlowHistograms(TList *outputListHistos) \r
+{\r
+ // Get pointers for histograms and profiles relevant for integrated flow:\r
+ // a) Get pointer to base list for integrated flow holding profile fIntFlowFlags and lists fIntFlowProfiles and fIntFlowResults.\r
+ // b) Get pointer to profile fIntFlowFlags holding all flags for integrated flow.\r
+ // c) Get pointer to list fIntFlowProfiles and pointers to all objects that she holds. \r
+ // d) Get pointer to list fIntFlowResults and pointers to all objects that she holds. \r
+ \r
+ TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data member?)\r
+ TString powerFlag[2] = {"linear","quadratic"}; // to be improved (should I promote this to data member?)\r
+ \r
+ if(outputListHistos)\r
+ {\r
+ // a) Get pointer to base list for integrated flow holding profile fIntFlowFlags and lists fIntFlowProfiles and fIntFlowResults:\r
+ TList *intFlowList = NULL;\r
+ intFlowList = dynamic_cast<TList*>(outputListHistos->FindObject("Integrated Flow"));\r
+ if(!intFlowList) \r
+ {\r
+ cout<<"WARNING: intFlowList is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
+ exit(0); \r
+ } \r
+ \r
+ // b) Get pointer to profile fIntFlowFlags holding all flags for integrated flow:\r
+ TString intFlowFlagsName = "fIntFlowFlags";\r
+ intFlowFlagsName += fAnalysisLabel->Data();\r
+ TProfile *intFlowFlags = dynamic_cast<TProfile*>(intFlowList->FindObject(intFlowFlagsName.Data()));\r
+ Bool_t bApplyCorrectionForNUA = kFALSE;\r
+ if(intFlowFlags)\r
+ {\r
+ this->SetIntFlowFlags(intFlowFlags); \r
+ bApplyCorrectionForNUA = (Int_t)intFlowFlags->GetBinContent(3); \r
+ this->SetApplyCorrectionForNUA(bApplyCorrectionForNUA); \r
+ } else \r
+ {\r
+ cout<<"WARNING: intFlowFlags is NULL in FAWQC::GPFIFH() !!!!"<<endl;\r
+ }\r
+ \r
+ // c) Get pointer to list fIntFlowProfiles and pointers to all objects that she holds:\r
+ TList *intFlowProfiles = NULL;\r
+ intFlowProfiles = dynamic_cast<TList*>(intFlowList->FindObject("Profiles"));\r
+ if(intFlowProfiles) \r
+ {\r
+ // average multiplicities:\r
+ TString avMultiplicityName = "fAvMultiplicity";\r
+ avMultiplicityName += fAnalysisLabel->Data();\r
+ TProfile *avMultiplicity = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(avMultiplicityName.Data()));\r
+ if(avMultiplicity) \r
+ {\r
+ this->SetAvMultiplicity(avMultiplicity);\r
+ } else \r
+ {\r
+ cout<<"WARNING: avMultiplicity is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
+ }\r
+ // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with wrong errors!):\r
+ TString intFlowCorrelationsProName = "fIntFlowCorrelationsPro";\r
+ intFlowCorrelationsProName += fAnalysisLabel->Data();\r
+ TProfile *intFlowCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowCorrelationsProName.Data()));\r
+ if(intFlowCorrelationsPro) \r
+ {\r
+ this->SetIntFlowCorrelationsPro(intFlowCorrelationsPro);\r
+ } else \r
+ {\r
+ cout<<"WARNING: intFlowCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
+ } \r
+ // average all correlations for integrated flow (with wrong errors!):\r
+ TString intFlowCorrelationsAllProName = "fIntFlowCorrelationsAllPro";\r
+ intFlowCorrelationsAllProName += fAnalysisLabel->Data();\r
+ TProfile *intFlowCorrelationsAllPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowCorrelationsAllProName.Data()));\r
+ if(intFlowCorrelationsAllPro) \r
+ {\r
+ this->SetIntFlowCorrelationsAllPro(intFlowCorrelationsAllPro);\r
+ } else \r
+ {\r
+ cout<<"WARNING: intFlowCorrelationsAllPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
+ } \r
+ // average extra correlations for integrated flow (which appear only when particle weights are used):\r
+ // (to be improved: Weak point in implementation, I am assuming here that method GetPointersForParticleWeightsHistograms() was called)\r
+ if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)\r
+ {\r
+ TString intFlowExtraCorrelationsProName = "fIntFlowExtraCorrelationsPro";\r
+ intFlowExtraCorrelationsProName += fAnalysisLabel->Data();\r
+ TProfile *intFlowExtraCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowExtraCorrelationsProName.Data()));\r
+ if(intFlowExtraCorrelationsPro) \r
+ {\r
+ this->SetIntFlowExtraCorrelationsPro(intFlowExtraCorrelationsPro);\r
+ } else \r
+ {\r
+ cout<<"WARNING: intFlowExtraCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
+ }\r
+ } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) \r
+ // average products of correlations <2>, <4>, <6> and <8>: \r
+ TString intFlowProductOfCorrelationsProName = "fIntFlowProductOfCorrelationsPro";\r
+ intFlowProductOfCorrelationsProName += fAnalysisLabel->Data();\r
+ TProfile *intFlowProductOfCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowProductOfCorrelationsProName.Data()));\r
+ if(intFlowProductOfCorrelationsPro) \r
+ {\r
+ this->SetIntFlowProductOfCorrelationsPro(intFlowProductOfCorrelationsPro);\r
+ } else \r
+ {\r
+ cout<<"WARNING: intFlowProductOfCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
+ } \r
+ // average correction terms for non-uniform acceptance (with wrong errors!):\r
+ for(Int_t sc=0;sc<2;sc++)\r
+ {\r
+ TString intFlowCorrectionTermsForNUAProName = "fIntFlowCorrectionTermsForNUAPro";\r
+ intFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data();\r
+ TProfile *intFlowCorrectionTermsForNUAPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject((Form("%s: %s terms",intFlowCorrectionTermsForNUAProName.Data(),sinCosFlag[sc].Data()))));\r
+ if(intFlowCorrectionTermsForNUAPro) \r
+ {\r
+ this->SetIntFlowCorrectionTermsForNUAPro(intFlowCorrectionTermsForNUAPro,sc);\r
+ } else \r
+ {\r
+ cout<<"WARNING: intFlowCorrectionTermsForNUAPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
+ cout<<"sc = "<<sc<<endl;\r
+ } \r
+ } // end of for(Int_t sc=0;sc<2;sc++) \r
+ } else // to if(intFlowProfiles) \r
+ {\r
+ cout<<"WARNING: intFlowProfiles is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
+ }\r
+ \r
+ // d) Get pointer to list fIntFlowResults and pointers to all objects that she holds. \r
+ TList *intFlowResults = NULL;\r
+ intFlowResults = dynamic_cast<TList*>(intFlowList->FindObject("Results"));\r
+ if(intFlowResults)\r
+ {\r
+ // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with correct errors!):\r
+ TString intFlowCorrelationsHistName = "fIntFlowCorrelationsHist";\r
+ intFlowCorrelationsHistName += fAnalysisLabel->Data();\r
+ TH1D *intFlowCorrelationsHist = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCorrelationsHistName.Data()));\r
+ if(intFlowCorrelationsHist) \r
+ {\r
+ this->SetIntFlowCorrelationsHist(intFlowCorrelationsHist);\r
+ } else \r
+ {\r
+ cout<<"WARNING: intFlowCorrelationsHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
+ } \r
+ // average all correlations for integrated flow (with correct errors!):\r
+ TString intFlowCorrelationsAllHistName = "fIntFlowCorrelationsAllHist";\r
+ intFlowCorrelationsAllHistName += fAnalysisLabel->Data();\r
+ TH1D *intFlowCorrelationsAllHist = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCorrelationsAllHistName.Data()));\r
+ if(intFlowCorrelationsAllHist) \r
+ {\r
+ this->SetIntFlowCorrelationsAllHist(intFlowCorrelationsAllHist);\r
+ } else \r
+ {\r
+ cout<<"WARNING: intFlowCorrelationsAllHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
+ } \r
+ // average correction terms for non-uniform acceptance (with correct errors!):\r
+ TString intFlowCorrectionTermsForNUAHistName = "fIntFlowCorrectionTermsForNUAHist";\r
+ intFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data();\r
+ for(Int_t sc=0;sc<2;sc++)\r
+ {\r
+ TH1D *intFlowCorrectionTermsForNUAHist = dynamic_cast<TH1D*>(intFlowResults->FindObject((Form("%s: %s terms",intFlowCorrectionTermsForNUAHistName.Data(),sinCosFlag[sc].Data()))));\r
+ if(intFlowCorrectionTermsForNUAHist) \r
+ {\r
+ this->SetIntFlowCorrectionTermsForNUAHist(intFlowCorrectionTermsForNUAHist,sc);\r
+ } else \r
+ {\r
+ cout<<"WARNING: intFlowCorrectionTermsForNUAHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
+ cout<<"sc = "<<sc<<endl;\r
+ } \r
+ } // end of for(Int_t sc=0;sc<2;sc++) \r
+ // covariances (multiplied with weight dependent prefactor):\r
+ TString intFlowCovariancesName = "fIntFlowCovariances";\r
+ intFlowCovariancesName += fAnalysisLabel->Data();\r
+ TH1D *intFlowCovariances = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCovariancesName.Data()));\r
+ if(intFlowCovariances) \r
+ {\r
+ this->SetIntFlowCovariances(intFlowCovariances); \r
+ } else \r
+ {\r
+ cout<<"WARNING: intFlowCovariances is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
+ } \r
+ // sum of linear and quadratic event weights for <2>, <4>, <6> and <8>:\r
+ TString intFlowSumOfEventWeightsName = "fIntFlowSumOfEventWeights";\r
+ intFlowSumOfEventWeightsName += fAnalysisLabel->Data();\r
+ for(Int_t power=0;power<2;power++)\r
+ {\r
+ TH1D *intFlowSumOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s: %s",intFlowSumOfEventWeightsName.Data(),powerFlag[power].Data())));\r
+ if(intFlowSumOfEventWeights) \r
+ {\r
+ this->SetIntFlowSumOfEventWeights(intFlowSumOfEventWeights,power);\r
+ } else \r
+ {\r
+ cout<<"WARNING: intFlowSumOfEventWeights is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
+ cout<<"power = "<<power<<endl;\r
+ } \r
+ } // end of for(Int_t power=0;power<2;power++) \r
+ // sum of products of event weights for correlations <2>, <4>, <6> and <8>: \r
+ TString intFlowSumOfProductOfEventWeightsName = "fIntFlowSumOfProductOfEventWeights";\r
+ intFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data();\r
+ TH1D *intFlowSumOfProductOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowSumOfProductOfEventWeightsName.Data()));\r
+ if(intFlowSumOfProductOfEventWeights) \r
+ {\r
+ this->SetIntFlowSumOfProductOfEventWeights(intFlowSumOfProductOfEventWeights);\r
+ } else \r
+ {\r
+ cout<<"WARNING: intFlowSumOfProductOfEventWeights is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
+ } \r
+ // final results for integrated Q-cumulants:\r
+ TString intFlowQcumulantsName = "fIntFlowQcumulants";\r
+ intFlowQcumulantsName += fAnalysisLabel->Data();\r
+ TH1D *intFlowQcumulants = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsName.Data()));\r
+ if(intFlowQcumulants) \r
+ {\r
+ this->SetIntFlowQcumulants(intFlowQcumulants);\r
+ } else \r
+ {\r
+ cout<<"WARNING: intFlowQcumulants is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
+ } \r
+ // final integrated flow estimates from Q-cumulants:\r
+ TString intFlowName = "fIntFlow";\r
+ intFlowName += fAnalysisLabel->Data();\r
+ TH1D *intFlow = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowName.Data()));\r
+ if(intFlow) \r
+ {\r
+ this->SetIntFlow(intFlow);\r
+ } else \r
+ {\r
+ cout<<"WARNING: intFlow is NULL in AFAWQC::GPFIFH() !!!!"<<endl; \r
+ } \r
+ } else // to if(intFlowResults)\r
+ {\r
+ cout<<"WARNING: intFlowResults is NULL in AFAWQC::GPFIFH() !!!!"<<endl;\r
+ }\r
+ } // end of if(outputListHistos)\r
+\r
+} // end of void AliFlowAnalysisWithQCumulants::GetPointersForIntFlowHistograms(TList *outputListHistos)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::GetPointersForDiffFlowHistograms(TList *outputListHistos)\r
+{\r
+ // Get pointer to all objects relevant for differential flow.\r
+ // a) Define flags locally (to be improved: should I promote flags to data members?);\r
+ // b) Get pointer to base list for differential flow fDiffFlowList and nested lists fDiffFlowListProfiles and fDiffFlowListResults;\r
+ // c) Get pointer to profile fDiffFlowFlags holding all flags for differential flow;\r
+ // d) Get pointers to all nested lists in fDiffFlowListProfiles and to profiles which they hold;\r
+ // e) Get pointers to all nested lists in fDiffFlowListResults and to histograms which they hold.\r
+ \r
+ // a) Define flags locally (to be improved: should I promote flags to data members?): \r
+ TString typeFlag[2] = {"RP","POI"}; \r
+ TString ptEtaFlag[2] = {"p_{T}","#eta"};\r
+ TString powerFlag[2] = {"linear","quadratic"};\r
+ TString sinCosFlag[2] = {"sin","cos"};\r
+ TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; \r
+ TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; \r
+ TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"};\r
+ TString mixedCorrelationIndex[8] = {"<2>","<2'>","<4>","<4'>","<6>","<6'>","<8>","<8'>"};\r
+ TString covarianceName[5] = {"Cov(<2>,<2'>)","Cov(<2>,<4'>)","Cov(<4>,<2'>)","Cov(<4>,<4'>)","Cov(<2'>,<4'>)"}; \r
+ \r
+ // b) Get pointer to base list for differential flow fDiffFlowList and nested lists fDiffFlowListProfiles and fDiffFlowListResults:\r
+ TList *diffFlowList = NULL;\r
+ diffFlowList = dynamic_cast<TList*>(outputListHistos->FindObject("Differential Flow")); \r
+ if(!diffFlowList)\r
+ { \r
+ cout<<"WARNING: diffFlowList is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ exit(0);\r
+ }\r
+ // list holding nested lists containing profiles:\r
+ TList *diffFlowListProfiles = NULL;\r
+ diffFlowListProfiles = dynamic_cast<TList*>(diffFlowList->FindObject("Profiles"));\r
+ if(!diffFlowListProfiles)\r
+ { \r
+ cout<<"WARNING: diffFlowListProfiles is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ exit(0);\r
+ }\r
+ // list holding nested lists containing 2D and 1D histograms with final results:\r
+ TList *diffFlowListResults = NULL;\r
+ diffFlowListResults = dynamic_cast<TList*>(diffFlowList->FindObject("Results"));\r
+ if(!diffFlowListResults)\r
+ { \r
+ cout<<"WARNING: diffFlowListResults is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ exit(0);\r
+ }\r
+ \r
+ // c) Get pointer to profile holding all flags for differential flow;\r
+ TString diffFlowFlagsName = "fDiffFlowFlags";\r
+ diffFlowFlagsName += fAnalysisLabel->Data();\r
+ TProfile *diffFlowFlags = dynamic_cast<TProfile*>(diffFlowList->FindObject(diffFlowFlagsName.Data()));\r
+ Bool_t bCalculate2DFlow = kFALSE;\r
+ if(diffFlowFlags)\r
+ {\r
+ this->SetDiffFlowFlags(diffFlowFlags); \r
+ bCalculate2DFlow = (Int_t)diffFlowFlags->GetBinContent(4);\r
+ this->SetCalculate2DFlow(bCalculate2DFlow); // to be improved (shoul I call this setter somewhere else?) \r
+ }\r
+ \r
+ // d) Get pointers to all nested lists in fDiffFlowListProfiles and to profiles which they hold;\r
+ // correlations:\r
+ TList *diffFlowCorrelationsProList[2][2] = {{NULL}};\r
+ TString diffFlowCorrelationsProName = "fDiffFlowCorrelationsPro";\r
+ diffFlowCorrelationsProName += fAnalysisLabel->Data();\r
+ TProfile *diffFlowCorrelationsPro[2][2][4] = {{{NULL}}}; \r
+ // products of correlations:\r
+ TList *diffFlowProductOfCorrelationsProList[2][2] = {{NULL}};\r
+ TString diffFlowProductOfCorrelationsProName = "fDiffFlowProductOfCorrelationsPro";\r
+ diffFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); \r
+ TProfile *diffFlowProductOfCorrelationsPro[2][2][8][8] = {{{{NULL}}}}; \r
+ // corrections:\r
+ TList *diffFlowCorrectionsProList[2][2] = {{NULL}};\r
+ TString diffFlowCorrectionTermsForNUAProName = "fDiffFlowCorrectionTermsForNUAPro";\r
+ diffFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); \r
+ TProfile *diffFlowCorrectionTermsForNUAPro[2][2][2][10] = {{{{NULL}}}}; \r
+ for(Int_t t=0;t<2;t++)\r
+ {\r
+ for(Int_t pe=0;pe<2;pe++)\r
+ {\r
+ diffFlowCorrelationsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));\r
+ if(!diffFlowCorrelationsProList[t][pe])\r
+ { \r
+ cout<<"WARNING: diffFlowCorrelationsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl;\r
+ exit(0);\r
+ }\r
+ for(Int_t ci=0;ci<4;ci++) // correlation index\r
+ {\r
+ diffFlowCorrelationsPro[t][pe][ci] = dynamic_cast<TProfile*>(diffFlowCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[ci].Data())));\r
+ if(diffFlowCorrelationsPro[t][pe][ci])\r
+ {\r
+ this->SetDiffFlowCorrelationsPro(diffFlowCorrelationsPro[t][pe][ci],t,pe,ci);\r
+ } else\r
+ {\r
+ cout<<"WARNING: diffFlowCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl; \r
+ cout<<"ci = "<<ci<<endl;\r
+ } \r
+ } // end of for(Int_t ci=0;ci<4;ci++) // correlation index \r
+ // products of correlations: \r
+ diffFlowProductOfCorrelationsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with products of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); \r
+ if(!diffFlowProductOfCorrelationsProList[t][pe])\r
+ { \r
+ cout<<"WARNING: ddiffFlowProductOfCorrelationsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl;\r
+ exit(0);\r
+ }\r
+ for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index\r
+ {\r
+ for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index\r
+ {\r
+ diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = dynamic_cast<TProfile*>(diffFlowProductOfCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data())));\r
+ if(diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2])\r
+ {\r
+ this->SetDiffFlowProductOfCorrelationsPro(diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2],t,pe,mci1,mci2);\r
+ } else\r
+ {\r
+ cout<<"WARNING: diffFlowCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl; \r
+ cout<<"mci1 = "<<mci1<<endl;\r
+ cout<<"mci2 = "<<mci2<<endl;\r
+ }\r
+ if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here\r
+ } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index\r
+ } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index \r
+ // corrections:\r
+ diffFlowCorrectionsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));\r
+ if(!diffFlowCorrectionsProList[t][pe])\r
+ { \r
+ cout<<"WARNING: diffFlowCorrectionsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl;\r
+ exit(0);\r
+ }\r
+ // correction terms for NUA:\r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos\r
+ {\r
+ for(Int_t cti=0;cti<9;cti++) // correction term index\r
+ {\r
+ diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = dynamic_cast<TProfile*>(diffFlowCorrectionsProList[t][pe]->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1)));\r
+ if(diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti])\r
+ {\r
+ this->SetDiffFlowCorrectionTermsForNUAPro(diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti],t,pe,sc,cti);\r
+ } else\r
+ {\r
+ cout<<"WARNING: diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl; \r
+ cout<<"sc = "<<sc<<endl;\r
+ cout<<"cti = "<<cti<<endl;\r
+ } \r
+ } // end of for(Int_t cti=0;cti<9;cti++) // correction term index\r
+ } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos\r
+ // ...\r
+ } // end of for(Int_t pe=0;pe<2;pe++)\r
+ } // end of for(Int_t t=0;t<2;t++)\r
+ \r
+ // e) Get pointers to all nested lists in fDiffFlowListResults and to histograms which they hold.\r
+ // reduced correlations:\r
+ TList *diffFlowCorrelationsHistList[2][2] = {{NULL}};\r
+ TString diffFlowCorrelationsHistName = "fDiffFlowCorrelationsHist";\r
+ diffFlowCorrelationsHistName += fAnalysisLabel->Data(); \r
+ TH1D *diffFlowCorrelationsHist[2][2][4] = {{{NULL}}};\r
+ // corrections for NUA:\r
+ TList *diffFlowCorrectionsHistList[2][2] = {{NULL}};\r
+ TString diffFlowCorrectionTermsForNUAHistName = "fDiffFlowCorrectionTermsForNUAHist";\r
+ diffFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); \r
+ TH1D *diffFlowCorrectionTermsForNUAHist[2][2][2][10] = {{{{NULL}}}};\r
+ // differential Q-cumulants:\r
+ TList *diffFlowCumulantsHistList[2][2] = {{NULL}};\r
+ TString diffFlowCumulantsName = "fDiffFlowCumulants";\r
+ diffFlowCumulantsName += fAnalysisLabel->Data(); \r
+ TH1D *diffFlowCumulants[2][2][4] = {{{NULL}}};\r
+ // differential flow estimates from Q-cumulants:\r
+ TList *diffFlowHistList[2][2] = {{NULL}};\r
+ TString diffFlowName = "fDiffFlow";\r
+ diffFlowName += fAnalysisLabel->Data(); \r
+ TH1D *diffFlow[2][2][4] = {{{NULL}}};\r
+ // differential covariances:\r
+ TList *diffFlowCovariancesHistList[2][2] = {{NULL}};\r
+ TString diffFlowCovariancesName = "fDiffFlowCovariances";\r
+ diffFlowCovariancesName += fAnalysisLabel->Data(); \r
+ TH1D *diffFlowCovariances[2][2][5] = {{{NULL}}};\r
+ for(Int_t t=0;t<2;t++) // type: RP or POI\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ // reduced correlations:\r
+ diffFlowCorrelationsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));\r
+ if(!diffFlowCorrelationsHistList[t][pe])\r
+ { \r
+ cout<<"WARNING: diffFlowCorrelationsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl;\r
+ exit(0);\r
+ }\r
+ for(Int_t index=0;index<4;index++) \r
+ {\r
+ diffFlowCorrelationsHist[t][pe][index] = dynamic_cast<TH1D*>(diffFlowCorrelationsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data())));\r
+ if(diffFlowCorrelationsHist[t][pe][index])\r
+ {\r
+ this->SetDiffFlowCorrelationsHist(diffFlowCorrelationsHist[t][pe][index],t,pe,index);\r
+ } else \r
+ {\r
+ cout<<"WARNING: diffFlowCorrelationsHist[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl;\r
+ cout<<"index = "<<index<<endl;\r
+ exit(0); \r
+ } \r
+ } // end of for(Int_t index=0;index<4;index++)\r
+ // corrections:\r
+ diffFlowCorrectionsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Histograms with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));\r
+ if(!diffFlowCorrectionsHistList[t][pe])\r
+ { \r
+ cout<<"WARNING: diffFlowCorrectionsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl;\r
+ exit(0);\r
+ }\r
+ // correction terms for NUA:\r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos\r
+ {\r
+ for(Int_t cti=0;cti<9;cti++) // correction term index\r
+ {\r
+ diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = dynamic_cast<TH1D*>(diffFlowCorrectionsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1)));\r
+ if(diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti])\r
+ {\r
+ this->SetDiffFlowCorrectionTermsForNUAHist(diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti],t,pe,sc,cti);\r
+ } else\r
+ {\r
+ cout<<"WARNING: diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl; \r
+ cout<<"sc = "<<sc<<endl;\r
+ cout<<"cti = "<<cti<<endl;\r
+ } \r
+ } // end of for(Int_t cti=0;cti<9;cti++) // correction term index\r
+ } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos\r
+ // ...\r
+ // differential Q-cumulants:\r
+ diffFlowCumulantsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Differential Q-cumulants (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));\r
+ if(!diffFlowCumulantsHistList[t][pe])\r
+ { \r
+ cout<<"WARNING: diffFlowCumulantsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl;\r
+ exit(0);\r
+ }\r
+ for(Int_t index=0;index<4;index++) \r
+ {\r
+ diffFlowCumulants[t][pe][index] = dynamic_cast<TH1D*>(diffFlowCumulantsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data())));\r
+ if(diffFlowCumulants[t][pe][index])\r
+ {\r
+ this->SetDiffFlowCumulants(diffFlowCumulants[t][pe][index],t,pe,index);\r
+ } else \r
+ {\r
+ cout<<"WARNING: diffFlowCumulants[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl;\r
+ cout<<"index = "<<index<<endl;\r
+ exit(0); \r
+ } \r
+ } // end of for(Int_t index=0;index<4;index++)\r
+ // differential flow estimates from Q-cumulants:\r
+ diffFlowHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Differential flow (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));\r
+ if(!diffFlowHistList[t][pe])\r
+ { \r
+ cout<<"WARNING: diffFlowHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl;\r
+ exit(0);\r
+ }\r
+ for(Int_t index=0;index<4;index++) \r
+ {\r
+ diffFlow[t][pe][index] = dynamic_cast<TH1D*>(diffFlowHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data())));\r
+ if(diffFlow[t][pe][index])\r
+ {\r
+ this->SetDiffFlow(diffFlow[t][pe][index],t,pe,index);\r
+ } else \r
+ {\r
+ cout<<"WARNING: diffFlow[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl;\r
+ cout<<"index = "<<index<<endl;\r
+ exit(0); \r
+ } \r
+ } // end of for(Int_t index=0;index<4;index++)\r
+ // differential covariances:\r
+ diffFlowCovariancesHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Covariances of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));\r
+ if(!diffFlowCovariancesHistList[t][pe])\r
+ { \r
+ cout<<"WARNING: diffFlowCovariancesHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl;\r
+ exit(0);\r
+ }\r
+ for(Int_t covIndex=0;covIndex<5;covIndex++) \r
+ {\r
+ diffFlowCovariances[t][pe][covIndex] = dynamic_cast<TH1D*>(diffFlowCovariancesHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data())));\r
+ if(diffFlowCovariances[t][pe][covIndex])\r
+ {\r
+ this->SetDiffFlowCovariances(diffFlowCovariances[t][pe][covIndex],t,pe,covIndex);\r
+ } else \r
+ {\r
+ cout<<"WARNING: diffFlowCovariances[t][pe][covIndex] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl;\r
+ cout<<"covIndex = "<<covIndex<<endl;\r
+ exit(0); \r
+ } \r
+ } // end of for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index \r
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI \r
+ // sum of event weights for reduced correlations:\r
+ TList *diffFlowSumOfEventWeightsHistList[2][2][2] = {{{NULL}}};\r
+ TString diffFlowSumOfEventWeightsName = "fDiffFlowSumOfEventWeights";\r
+ diffFlowSumOfEventWeightsName += fAnalysisLabel->Data(); \r
+ TH1D *diffFlowSumOfEventWeights[2][2][2][4] = {{{{NULL}}}};\r
+ for(Int_t t=0;t<2;t++) // type is RP or POI\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ { \r
+ for(Int_t p=0;p<2;p++) // power of event weights is either 1 or 2\r
+ {\r
+ diffFlowSumOfEventWeightsHistList[t][pe][p] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Sum of %s event weights (%s, %s)",powerFlag[p].Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data())));\r
+ if(!diffFlowSumOfEventWeightsHistList[t][pe][p])\r
+ { \r
+ cout<<"WARNING: diffFlowSumOfEventWeightsHistList[t][pe][p] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl;\r
+ cout<<"power = "<<p<<endl;\r
+ exit(0);\r
+ }\r
+ for(Int_t ew=0;ew<4;ew++) // index of reduced correlation\r
+ {\r
+ diffFlowSumOfEventWeights[t][pe][p][ew] = dynamic_cast<TH1D*>(diffFlowSumOfEventWeightsHistList[t][pe][p]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()))); \r
+ if(diffFlowSumOfEventWeights[t][pe][p][ew])\r
+ {\r
+ this->SetDiffFlowSumOfEventWeights(diffFlowSumOfEventWeights[t][pe][p][ew],t,pe,p,ew);\r
+ } else \r
+ {\r
+ cout<<"WARNING: diffFlowSumOfEventWeights[t][pe][p][ew] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl;\r
+ cout<<"power = "<<p<<endl;\r
+ cout<<"ew = "<<ew<<endl;\r
+ exit(0); \r
+ } \r
+ }\r
+ } // end of for(Int_t p=0;p<2;p++) // power of event weights is either 1 or 2\r
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ } // end of for(Int_t t=0;t<2;t++) // type is RP or POI\r
+ // \r
+ TList *diffFlowSumOfProductOfEventWeightsHistList[2][2] = {{NULL}};\r
+ TString diffFlowSumOfProductOfEventWeightsName = "fDiffFlowSumOfProductOfEventWeights";\r
+ diffFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); \r
+ TH1D *diffFlowSumOfProductOfEventWeights[2][2][8][8] = {{{{NULL}}}};\r
+ for(Int_t t=0;t<2;t++) // type is RP or POI\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ { \r
+ diffFlowSumOfProductOfEventWeightsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Sum of products of event weights (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())));\r
+ if(!diffFlowSumOfProductOfEventWeightsHistList[t][pe])\r
+ { \r
+ cout<<"WARNING: diffFlowSumOfProductOfEventWeightsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl;\r
+ exit(0);\r
+ }\r
+ for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index\r
+ {\r
+ for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index\r
+ {\r
+ diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = dynamic_cast<TH1D*>(diffFlowSumOfProductOfEventWeightsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()))); \r
+ if(diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2])\r
+ {\r
+ this->SetDiffFlowSumOfProductOfEventWeights(diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2],t,pe,mci1,mci2);\r
+ } else \r
+ {\r
+ cout<<"WARNING: diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl;\r
+ cout<<"mci1 = "<<mci1<<endl;\r
+ cout<<"mci2 = "<<mci2<<endl;\r
+ exit(0); \r
+ } \r
+ if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here\r
+ } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index\r
+ } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index\r
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ } // end of for(Int_t t=0;t<2;t++) // type is RP or POI\r
+\r
+} // end void AliFlowAnalysisWithQCumulants::GetPointersForDiffFlowHistograms(TList *outputListHistos)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow()\r
+{\r
+ // Book all histograms and profiles needed for differential flow.\r
+ // a) Define flags locally (to be improved: should I promote flags to data members?);\r
+ // b) Book profile to hold all flags for differential flow;\r
+ // c) Book e-b-e quantities;\r
+ // d) Book profiles;\r
+ // e) Book histograms holding final results. \r
+ \r
+ // a) Define flags locally (to be improved: should I promote flags to data members?): \r
+ TString typeFlag[2] = {"RP","POI"}; \r
+ TString ptEtaFlag[2] = {"p_{T}","#eta"};\r
+ TString powerFlag[2] = {"linear","quadratic"};\r
+ TString sinCosFlag[2] = {"sin","cos"};\r
+ TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; \r
+ TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; \r
+ TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"};\r
+ TString mixedCorrelationIndex[8] = {"<2>","<2'>","<4>","<4'>","<6>","<6'>","<8>","<8'>"};\r
+ TString covarianceName[5] = {"Cov(<2>,<2'>)","Cov(<2>,<4'>)","Cov(<4>,<2'>)","Cov(<4>,<4'>)","Cov(<2'>,<4'>)"}; \r
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
+ Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
+ Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
+ \r
+ // b) Book profile to hold all flags for differential flow:\r
+ TString diffFlowFlagsName = "fDiffFlowFlags";\r
+ diffFlowFlagsName += fAnalysisLabel->Data();\r
+ fDiffFlowFlags = new TProfile(diffFlowFlagsName.Data(),"Flags for Differential Flow",4,0,4);\r
+ fDiffFlowFlags->SetTickLength(-0.01,"Y");\r
+ fDiffFlowFlags->SetMarkerStyle(25);\r
+ fDiffFlowFlags->SetLabelSize(0.05);\r
+ fDiffFlowFlags->SetLabelOffset(0.02,"Y");\r
+ (fDiffFlowFlags->GetXaxis())->SetBinLabel(1,"Particle Weights");\r
+ (fDiffFlowFlags->GetXaxis())->SetBinLabel(2,"Event Weights");\r
+ (fDiffFlowFlags->GetXaxis())->SetBinLabel(3,"Corrected for NUA?");\r
+ (fDiffFlowFlags->GetXaxis())->SetBinLabel(4,"Calculated 2D flow?");\r
+ fDiffFlowList->Add(fDiffFlowFlags);\r
+\r
+ // c) Book e-b-e quantities:\r
+ // Event-by-event r_{m*n,k}(pt,eta), p_{m*n,k}(pt,eta) and q_{m*n,k}(pt,eta)\r
+ // Explanantion of notation:\r
+ // 1.) n is harmonic, m is multiple of harmonic;\r
+ // 2.) k is power of particle weight;\r
+ // 3.) r_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for RPs in particular (pt,eta) bin (i-th RP is weighted with w_i^k); \r
+ // 4.) p_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for POIs in particular (pt,eta) bin \r
+ // (if i-th POI is also RP, than it is weighted with w_i^k); \r
+ // 5.) q_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for particles which are both RPs and POIs in particular (pt,eta) bin \r
+ // (i-th RP&&POI is weighted with w_i^k) \r
+ \r
+ // 1D:\r
+ for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP && POI )\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ for(Int_t m=0;m<4;m++) // multiple of harmonic\r
+ {\r
+ for(Int_t k=0;k<9;k++) // power of particle weight\r
+ {\r
+ fReRPQ1dEBE[t][pe][m][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%dpower%dRe",t,pe,m,k),\r
+ Form("TypeFlag%dpteta%dmultiple%dpower%dRe",t,pe,m,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); \r
+ fImRPQ1dEBE[t][pe][m][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%dpower%dIm",t,pe,m,k),\r
+ Form("TypeFlag%dpteta%dmultiple%dpower%dIm",t,pe,m,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); \r
+ }\r
+ }\r
+ }\r
+ } \r
+ // to be improved (add explanation of fs1dEBE[t][pe][k]): \r
+ for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI )\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ for(Int_t k=0;k<9;k++) // power of particle weight\r
+ {\r
+ fs1dEBE[t][pe][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%d",t,pe,k),\r
+ Form("TypeFlag%dpteta%dmultiple%d",t,pe,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); \r
+ }\r
+ }\r
+ }\r
+ // correction terms for nua:\r
+ for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI)\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos\r
+ {\r
+ for(Int_t cti=0;cti<9;cti++) // correction term index\r
+ {\r
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti] = new TH1D(Form("typeFlag%d pteta%d sincos%d cti%d",t,pe,sc,cti),\r
+ Form("typeFlag%d pteta%d sincos%d cti%d",t,pe,sc,cti),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); \r
+ }\r
+ }\r
+ }\r
+ } \r
+ // 2D:\r
+ TProfile2D styleRe("typeMultiplePowerRe","typeMultiplePowerRe",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);\r
+ TProfile2D styleIm("typeMultiplePowerIm","typeMultiplePowerIm",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);\r
+ for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI )\r
+ { \r
+ for(Int_t m=0;m<4;m++)\r
+ {\r
+ for(Int_t k=0;k<9;k++)\r
+ {\r
+ fReRPQ2dEBE[t][m][k] = (TProfile2D*)styleRe.Clone(Form("typeFlag%dmultiple%dpower%dRe",t,m,k)); \r
+ fImRPQ2dEBE[t][m][k] = (TProfile2D*)styleIm.Clone(Form("typeFlag%dmultiple%dpower%dIm",t,m,k));\r
+ }\r
+ } \r
+ } \r
+ TProfile2D styleS("typePower","typePower",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax);\r
+ for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI )\r
+ { \r
+ for(Int_t k=0;k<9;k++)\r
+ {\r
+ fs2dEBE[t][k] = (TProfile2D*)styleS.Clone(Form("typeFlag%dpower%d",t,k));\r
+ }\r
+ }\r
+ // reduced correlations e-b-e:\r
+ TString diffFlowCorrelationsEBEName = "fDiffFlowCorrelationsEBE";\r
+ diffFlowCorrelationsEBEName += fAnalysisLabel->Data();\r
+ for(Int_t t=0;t<2;t++) // type: RP or POI\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ for(Int_t rci=0;rci<4;rci++) // reduced correlation index\r
+ {\r
+ fDiffFlowCorrelationsEBE[t][pe][rci] = new TH1D(Form("%s, %s, %s, %s",diffFlowCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);\r
+ } // end of for(Int_t ci=0;ci<4;ci++) // correlation index\r
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta \r
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI\r
+ // event weights for reduced correlations e-b-e:\r
+ TString diffFlowEventWeightsForCorrelationsEBEName = "fDiffFlowEventWeightsForCorrelationsEBE";\r
+ diffFlowEventWeightsForCorrelationsEBEName += fAnalysisLabel->Data();\r
+ for(Int_t t=0;t<2;t++) // type: RP or POI\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ for(Int_t rci=0;rci<4;rci++) // event weight for reduced correlation index\r
+ {\r
+ fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci] = new TH1D(Form("%s, %s, %s, eW for %s",diffFlowEventWeightsForCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, eW for %s",diffFlowEventWeightsForCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);\r
+ } // end of for(Int_t ci=0;ci<4;ci++) // correlation index\r
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta \r
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI\r
+ \r
+ // d) Book profiles;\r
+ // reduced correlations:\r
+ TString diffFlowCorrelationsProName = "fDiffFlowCorrelationsPro";\r
+ diffFlowCorrelationsProName += fAnalysisLabel->Data();\r
+ // corrections terms:\r
+ TString diffFlowCorrectionTermsForNUAProName = "fDiffFlowCorrectionTermsForNUAPro";\r
+ diffFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data();\r
+ for(Int_t t=0;t<2;t++) // type: RP or POI\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ for(Int_t rci=0;rci<4;rci++) // reduced correlation index\r
+ {\r
+ // reduced correlations:\r
+ fDiffFlowCorrelationsPro[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe],"s");\r
+ fDiffFlowCorrelationsPro[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data());\r
+ fDiffFlowCorrelationsProList[t][pe]->Add(fDiffFlowCorrelationsPro[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations)\r
+ } // end of for(Int_t rci=0;rci<4;rci++) // correlation index\r
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta \r
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI\r
+ // correction terms for nua:\r
+ for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI)\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos\r
+ {\r
+ for(Int_t cti=0;cti<9;cti++) // correction term index\r
+ {\r
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = new TProfile(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); \r
+ fDiffFlowCorrectionsProList[t][pe]->Add(fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]);\r
+ }\r
+ }\r
+ }\r
+ } \r
+ // e) Book histograms holding final results. \r
+ // reduced correlations:\r
+ TString diffFlowCorrelationsHistName = "fDiffFlowCorrelationsHist";\r
+ diffFlowCorrelationsHistName += fAnalysisLabel->Data();\r
+ // corrections terms:\r
+ TString diffFlowCorrectionTermsForNUAHistName = "fDiffFlowCorrectionTermsForNUAHist";\r
+ diffFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data();\r
+ // differential covariances:\r
+ TString diffFlowCovariancesName = "fDiffFlowCovariances";\r
+ diffFlowCovariancesName += fAnalysisLabel->Data();\r
+ // differential Q-cumulants:\r
+ TString diffFlowCumulantsName = "fDiffFlowCumulants";\r
+ diffFlowCumulantsName += fAnalysisLabel->Data();\r
+ // differential flow:\r
+ TString diffFlowName = "fDiffFlow";\r
+ diffFlowName += fAnalysisLabel->Data();\r
+ for(Int_t t=0;t<2;t++) // type: RP or POI\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ for(Int_t index=0;index<4;index++) \r
+ {\r
+ // reduced correlations:\r
+ fDiffFlowCorrelationsHist[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);\r
+ fDiffFlowCorrelationsHist[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data());\r
+ fDiffFlowCorrelationsHistList[t][pe]->Add(fDiffFlowCorrelationsHist[t][pe][index]); \r
+ // differential Q-cumulants:\r
+ fDiffFlowCumulants[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);\r
+ fDiffFlowCumulants[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data());\r
+ fDiffFlowCumulantsHistList[t][pe]->Add(fDiffFlowCumulants[t][pe][index]); \r
+ // differential flow estimates from Q-cumulants:\r
+ fDiffFlow[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);\r
+ fDiffFlow[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data());\r
+ fDiffFlowHistList[t][pe]->Add(fDiffFlow[t][pe][index]); \r
+ } // end of for(Int_t index=0;index<4;index++) \r
+ for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index \r
+ {\r
+ // differential covariances:\r
+ fDiffFlowCovariances[t][pe][covIndex] = new TH1D(Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()),Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]);\r
+ fDiffFlowCovariances[t][pe][covIndex]->SetXTitle(ptEtaFlag[pe].Data());\r
+ fDiffFlowCovariancesHistList[t][pe]->Add(fDiffFlowCovariances[t][pe][covIndex]); \r
+ } // end of for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index\r
+ // products of both types of correlations: \r
+ TString diffFlowProductOfCorrelationsProName = "fDiffFlowProductOfCorrelationsPro";\r
+ diffFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); \r
+ for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index\r
+ {\r
+ for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index\r
+ {\r
+ fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = new TProfile(Form("%s, %s, %s, %s, %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),Form("%s, %s, %s, %s #times %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); \r
+ fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]->SetXTitle(ptEtaFlag[pe].Data());\r
+ fDiffFlowProductOfCorrelationsProList[t][pe]->Add(fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]); \r
+ if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here\r
+ } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index\r
+ } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index \r
+ } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta \r
+ } // end of for(Int_t t=0;t<2;t++) // type: RP or POI\r
+ // sums of event weights for reduced correlations: \r
+ TString diffFlowSumOfEventWeightsName = "fDiffFlowSumOfEventWeights";\r
+ diffFlowSumOfEventWeightsName += fAnalysisLabel->Data(); \r
+ for(Int_t t=0;t<2;t++) // type is RP or POI\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ { \r
+ for(Int_t p=0;p<2;p++) // power of weights is either 1 or 2\r
+ {\r
+ for(Int_t ew=0;ew<4;ew++) // index of reduced correlation\r
+ {\r
+ fDiffFlowSumOfEventWeights[t][pe][p][ew] = new TH1D(Form("%s, %s, %s, %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()),Form("%s, %s, %s, power = %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); \r
+ fDiffFlowSumOfEventWeights[t][pe][p][ew]->SetXTitle(ptEtaFlag[pe].Data());\r
+ fDiffFlowSumOfEventWeightsHistList[t][pe][p]->Add(fDiffFlowSumOfEventWeights[t][pe][p][ew]); // to be improved (add dedicated list to hold all this)\r
+ }\r
+ }\r
+ }\r
+ } \r
+ // sum of products of event weights for both types of correlations: \r
+ TString diffFlowSumOfProductOfEventWeightsName = "fDiffFlowSumOfProductOfEventWeights";\r
+ diffFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); \r
+ for(Int_t t=0;t<2;t++) // type is RP or POI\r
+ {\r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ { \r
+ for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index\r
+ {\r
+ for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index\r
+ {\r
+ fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = new TH1D(Form("%s, %s, %s, %s, %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),Form("%s, %s, %s, %s #times %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); \r
+ fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]->SetXTitle(ptEtaFlag[pe].Data());\r
+ fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]->Add(fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]); \r
+ if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here\r
+ }\r
+ }\r
+ }\r
+ } \r
+ // correction terms for nua:\r
+ for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI)\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos\r
+ {\r
+ for(Int_t cti=0;cti<9;cti++) // correction term index\r
+ {\r
+ fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = new TH1D(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); \r
+ fDiffFlowCorrectionsHistList[t][pe]->Add(fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]);\r
+ }\r
+ }\r
+ }\r
+ } \r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+/*\r
+void AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNUAForIntQcumulants() // to be improved (do I really need this method?)\r
+{\r
+ // Calculate final corrections for non-uniform acceptance for Q-cumulants.\r
+ \r
+ // Corrections for non-uniform acceptance are stored in histogram fCorrectionsForNUA,\r
+ // binning of fCorrectionsForNUA is organized as follows:\r
+ //\r
+ // 1st bin: correction to QC{2}\r
+ // 2nd bin: correction to QC{4}\r
+ // 3rd bin: correction to QC{6}\r
+ // 4th bin: correction to QC{8}\r
+ \r
+ // shortcuts flags:\r
+ Int_t pW = (Int_t)(useParticleWeights);\r
+ \r
+ Int_t eW = -1;\r
+ \r
+ if(eventWeights == "exact")\r
+ {\r
+ eW = 0;\r
+ }\r
+\r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms flag\r
+ {\r
+ if(!(fQCorrelations[pW][eW] && fQCorrections[pW][eW][sc] && fCorrections[pW][eW]))\r
+ {\r
+ cout<<"WARNING: fQCorrelations[pW][eW] && fQCorrections[pW][eW][sc] && fCorrections[pW][eW] is NULL in AFAWQC::CFCFNUAFIF() !!!!"<<endl;\r
+ cout<<"pW = "<<pW<<endl;\r
+ cout<<"eW = "<<eW<<endl;\r
+ cout<<"sc = "<<sc<<endl;\r
+ exit(0);\r
+ }\r
+ } \r
+\r
+ // measured 2-, 4-, 6- and 8-particle azimuthal correlations (biased with non-uniform acceptance!):\r
+ Double_t two = fQCorrelations[pW][eW]->GetBinContent(1); // <<2>>\r
+ //Double_t four = fQCorrelations[pW][eW]->GetBinContent(11); // <<4>>\r
+ //Double_t six = fQCorrelations[pW][eW]->GetBinContent(24); // <<6>>\r
+ //Double_t eight = fQCorrelations[pW][eW]->GetBinContent(31); // <<8>>\r
+ \r
+ // correction terms to QC{2}:\r
+ // <<cos(n*phi1)>>^2\r
+ Double_t two1stTerm = pow(fQCorrections[pW][eW][1]->GetBinContent(1),2); \r
+ // <<sin(n*phi1)>>^2\r
+ Double_t two2ndTerm = pow(fQCorrections[pW][eW][0]->GetBinContent(1),2); \r
+ // final corrections for non-uniform acceptance to QC{2}:\r
+ Double_t correctionQC2 = -1.*two1stTerm-1.*two2ndTerm;\r
+ fCorrections[pW][eW]->SetBinContent(1,correctionQC2); \r
+ \r
+ // correction terms to QC{4}:\r
+ // <<cos(n*phi1)>> <<cos(n*(phi1-phi2-phi3))>>\r
+ Double_t four1stTerm = fQCorrections[pW][eW][1]->GetBinContent(1)*fQCorrections[pW][eW][1]->GetBinContent(3); \r
+ // <<sin(n*phi1)>> <<sin(n*(phi1-phi2-phi3))>>\r
+ Double_t four2ndTerm = fQCorrections[pW][eW][0]->GetBinContent(1)*fQCorrections[pW][eW][0]->GetBinContent(3); \r
+ // <<cos(n*(phi1+phi2))>>^2\r
+ Double_t four3rdTerm = pow(fQCorrections[pW][eW][1]->GetBinContent(2),2); \r
+ // <<sin(n*(phi1+phi2))>>^2\r
+ Double_t four4thTerm = pow(fQCorrections[pW][eW][0]->GetBinContent(2),2); \r
+ // <<cos(n*(phi1+phi2))>> (<<cos(n*phi1)>>^2 - <<sin(n*phi1)>>^2)\r
+ Double_t four5thTerm = fQCorrections[pW][eW][1]->GetBinContent(2)\r
+ * (pow(fQCorrections[pW][eW][1]->GetBinContent(1),2)-pow(fQCorrections[pW][eW][0]->GetBinContent(1),2));\r
+ // <<sin(n*(phi1+phi2))>> <<cos(n*phi1)>> <<sin(n*phi1)>>\r
+ Double_t four6thTerm = fQCorrections[pW][eW][0]->GetBinContent(2)\r
+ * fQCorrections[pW][eW][1]->GetBinContent(1)\r
+ * fQCorrections[pW][eW][0]->GetBinContent(1); \r
+ // <<cos(n*(phi1-phi2))>> (<<cos(n*phi1)>>^2 + <<sin(n*phi1)>>^2)\r
+ Double_t four7thTerm = two*(pow(fQCorrections[pW][eW][1]->GetBinContent(1),2)+pow(fQCorrections[pW][eW][0]->GetBinContent(1),2)); \r
+ // (<<cos(n*phi1)>>^2 + <<sin(n*phi1)>>^2)^2\r
+ Double_t four8thTerm = pow(pow(fQCorrections[pW][eW][1]->GetBinContent(1),2)+pow(fQCorrections[pW][eW][0]->GetBinContent(1),2),2); \r
+ // final correction to QC{4}:\r
+ Double_t correctionQC4 = -4.*four1stTerm+4.*four2ndTerm-four3rdTerm-four4thTerm\r
+ + 4.*four5thTerm+8.*four6thTerm+8.*four7thTerm-6.*four8thTerm; \r
+ fCorrections[pW][eW]->SetBinContent(2,correctionQC4); \r
+\r
+ // ... to be improved (continued for 6th and 8th order) \r
+\r
+\r
+} // end of AliFlowAnalysisWithQCumulants::CalculateCorrectionsForNUAForIntQcumulants()\r
+*/\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateQcumulantsCorrectedForNUAIntFlow()\r
+{\r
+ // Calculate generalized Q-cumulants (cumulants corrected for non-unifom acceptance).\r
+ \r
+ // measured 2-, 4-, 6- and 8-particle correlations (biased by non-uniform acceptance!):\r
+ Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>>\r
+ Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>>\r
+ //Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>>\r
+ //Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>>\r
+ \r
+ // statistical error of measured 2-, 4-, 6- and 8-particle correlations:\r
+ //Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <<2>>\r
+ //Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <<4>>\r
+ //Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <<6>>\r
+ //Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <<8>>\r
+\r
+ // QC{2}:\r
+ // <<cos(n*phi1)>>^2\r
+ Double_t two1stTerm = pow(fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1),2); \r
+ //Double_t two1stTermErrorSquared = pow(fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(1),2); \r
+ // <<sin(n*phi1)>>^2\r
+ Double_t two2ndTerm = pow(fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1),2); \r
+ //Double_t two2ndTermErrorSquared = pow(fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(1),2); \r
+ // generalized QC{2}:\r
+ Double_t gQC2 = two - two1stTerm - two2ndTerm; // to be improved (terminology, notation)\r
+ fIntFlowQcumulants->SetBinContent(1,gQC2); \r
+ //fIntFlowQcumulants->SetBinError(1,0.); // to be improved (propagate error) \r
+ \r
+ // QC{4}:\r
+ // <<cos(n*phi1)>> <<cos(n*(phi1-phi2-phi3))>>\r
+ Double_t four1stTerm = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1)\r
+ * fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(3); \r
+ // <<sin(n*phi1)>> <<sin(n*(phi1-phi2-phi3))>>\r
+ Double_t four2ndTerm = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1)\r
+ * fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(3); \r
+ // <<cos(n*(phi1+phi2))>>^2\r
+ Double_t four3rdTerm = pow(fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2),2); \r
+ // <<sin(n*(phi1+phi2))>>^2\r
+ Double_t four4thTerm = pow(fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2),2); \r
+ // <<cos(n*(phi1+phi2))>> (<<cos(n*phi1)>>^2 - <<sin(n*phi1)>>^2)\r
+ Double_t four5thTerm = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2)\r
+ * (pow(fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1),2)\r
+ - pow(fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1),2));\r
+ // <<sin(n*(phi1+phi2))>> <<cos(n*phi1)>> <<sin(n*phi1)>>\r
+ Double_t four6thTerm = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2)\r
+ * fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1)\r
+ * fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1); \r
+ // <<cos(n*(phi1-phi2))>> (<<cos(n*phi1)>>^2 + <<sin(n*phi1)>>^2)\r
+ Double_t four7thTerm = two*(pow(fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1),2)\r
+ + pow(fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1),2)); \r
+ // (<<cos(n*phi1)>>^2 + <<sin(n*phi1)>>^2)^2\r
+ Double_t four8thTerm = pow(pow(fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1),2)\r
+ + pow(fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1),2),2); \r
+ // generalized QC{4}:\r
+ Double_t gQC4 = four-2.*pow(two,2.)-4.*four1stTerm+4.*four2ndTerm-four3rdTerm\r
+ - four4thTerm+4.*four5thTerm+8.*four6thTerm+8.*four7thTerm-6.*four8thTerm; \r
+ fIntFlowQcumulants->SetBinContent(2,gQC4); \r
+ //fIntFlowQcumulants->SetBinError(2,0.); // to be improved (propagate error) \r
+\r
+ // ... to be improved (continued for 6th and 8th order) \r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::CalculateQcumulantsCorrectedForNUAIntFlow()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectedForNUA()\r
+{\r
+ // Calculate integrated flow from generalized Q-cumulants (corrected for non-uniform acceptance).\r
+ \r
+ // to be improved: add protection for NULL pointers, propagate statistical errors from \r
+ // measured correlations and correction terms\r
+ \r
+ // generalized Q-cumulants:\r
+ Double_t qc2 = fIntFlowQcumulants->GetBinContent(1); // QC{2} \r
+ Double_t qc4 = fIntFlowQcumulants->GetBinContent(2); // QC{4} \r
+ //Double_t qc6 = fIntFlowQcumulants->GetBinContent(3); // QC{6} \r
+ //Double_t qc8 = fIntFlowQcumulants->GetBinContent(4); // QC{8}\r
+ \r
+ // integrated flow estimates:\r
+ Double_t v2 = 0.; // v{2,QC} \r
+ Double_t v4 = 0.; // v{4,QC} \r
+ //Double_t v6 = 0.; // v{6,QC} \r
+ //Double_t v8 = 0.; // v{8,QC}\r
+\r
+ // calculate integrated flow estimates from generalized Q-cumulants: \r
+ if(qc2>=0.) v2 = pow(qc2,1./2.); \r
+ if(qc4<=0.) v4 = pow(-1.*qc4,1./4.); \r
+ //if(qc6>=0.) v6 = pow((1./4.)*qc6,1./6.); \r
+ //if(qc8<=0.) v8 = pow((-1./33.)*qc8,1./8.); \r
+\r
+ // store integrated flow estimates from generalized Q-cumulants:\r
+ fIntFlow->SetBinContent(1,v2);\r
+ fIntFlow->SetBinContent(2,v4);\r
+ //fIntFlow->SetBinContent(3,v6);\r
+ //fIntFlow->SetBinContent(4,v8);\r
+\r
+} // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectedForNUA()\r
+\r
+ \r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUAIntFlow() \r
+{\r
+ // From profile fIntFlowCorrectionTermsForNUAPro[2] access measured corretion terms\r
+ // and their spread, correctly calculate the statistical errors and store the final \r
+ // results and statistical errors for correction terms in histogram fIntFlowCorrectionTermsForNUAHist[2].\r
+ //\r
+ // Remark: Statistical error of correction temrs is calculated as:\r
+ //\r
+ // statistical error = termA * spread * termB:\r
+ // termA = sqrt{sum_{i=1}^{N} w^2}/(sum_{i=1}^{N} w)\r
+ // termB = 1/sqrt(1-termA^2) \r
+ \r
+ /* // to be improved (implement protection here)\r
+ for(Int_t power=0;power<2;power++)\r
+ { \r
+ if(!(fIntFlowCorrelationsHist && fIntFlowCorrelationsPro && fIntFlowSumOfEventWeights[power])) \r
+ {\r
+ cout<<"WARNING: fIntFlowCorrelationsHist && fIntFlowCorrelationsPro && fIntFlowSumOfEventWeights[power] is NULL in AFAWQC::FCIF() !!!!"<<endl;\r
+ cout<<"power = "<<power<<endl;\r
+ exit(0);\r
+ }\r
+ }\r
+ */\r
+ \r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos correction terms \r
+ {\r
+ for(Int_t ci=1;ci<=10;ci++) // correction term index\r
+ {\r
+ Double_t correction = fIntFlowCorrectionTermsForNUAPro[sc]->GetBinContent(ci);\r
+ //Double_t spread = fIntFlowCorrectionTermsForNUAPro[sc]->GetBinError(ci);\r
+ //Double_t sumOfLinearEventWeights = fIntFlowSumOfEventWeights[0]->GetBinContent(ci);\r
+ //Double_t sumOfQuadraticEventWeights = fIntFlowSumOfEventWeights[1]->GetBinContent(ci);\r
+ //Double_t termA = 0.;\r
+ //Double_t termB = 0.;\r
+ //if(sumOfLinearEventWeights)\r
+ //{\r
+ // termA = pow(sumOfQuadraticEventWeights,0.5)/sumOfLinearEventWeights;\r
+ //} else\r
+ // {\r
+ // cout<<"WARNING: sumOfLinearEventWeights == 0 in AFAWQC::FCIF() !!!!"<<endl;\r
+ // cout<<" (for "<<2*ci<<"-particle correlation)"<<endl;\r
+ // }\r
+ /*\r
+ if(1.-pow(termA,2.) > 0.)\r
+ {\r
+ termB = 1./pow(1-pow(termA,2.),0.5);\r
+ } else\r
+ {\r
+ cout<<"WARNING: 1.-pow(termA,2.) <= 0 in AFAWQC::FCIF() !!!!"<<endl; \r
+ cout<<" (for "<<2*ci<<"-particle correlation)"<<endl;\r
+ } \r
+ Double_t statisticalError = termA * spread * termB;\r
+ */\r
+ fIntFlowCorrectionTermsForNUAHist[sc]->SetBinContent(ci,correction);\r
+ //fIntFlowCorrectionTermsForNUAHist[sc]->SetBinError(ci,statisticalError);\r
+ } // end of for(Int_t ci=1;ci<=10;ci++) // correction term index\r
+ } // end of for(Int sc=0;sc<2;sc++) // sin or cos correction terms \r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUAIntFlow()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::GetPointersForNestedLoopsHistograms(TList *outputListHistos)\r
+{\r
+ // Get pointers to all objects relevant for calculations with nested loops.\r
+ \r
+ if(outputListHistos)\r
+ {\r
+ TList *nestedLoopsList = dynamic_cast<TList*>(outputListHistos->FindObject("Nested Loops"));\r
+ if(nestedLoopsList) \r
+ {\r
+ this->SetNestedLoopsList(nestedLoopsList);\r
+ } else\r
+ {\r
+ cout<<"WARNING: nestedLoopsList is NULL in AFAWQC::GPFNLH() !!!!"<<endl;\r
+ exit(0);\r
+ }\r
+ \r
+ TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?)\r
+ TString typeFlag[2] = {"RP","POI"}; // to be improved (should I promote this to data members?)\r
+ TString ptEtaFlag[2] = {"p_{T}","#eta"}; // to be improved (should I promote this to data members?)\r
+ TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; // to be improved (should I promote this to data members?)\r
+ \r
+ TString evaluateNestedLoopsName = "fEvaluateNestedLoops";\r
+ evaluateNestedLoopsName += fAnalysisLabel->Data(); \r
+ TProfile *evaluateNestedLoops = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(evaluateNestedLoopsName.Data()));\r
+ Bool_t bEvaluateIntFlowNestedLoops = kFALSE;\r
+ Bool_t bEvaluateDiffFlowNestedLoops = kFALSE;\r
+ if(evaluateNestedLoops)\r
+ {\r
+ this->SetEvaluateNestedLoops(evaluateNestedLoops);\r
+ bEvaluateIntFlowNestedLoops = (Int_t)evaluateNestedLoops->GetBinContent(1);\r
+ bEvaluateDiffFlowNestedLoops = (Int_t)evaluateNestedLoops->GetBinContent(2);\r
+ }\r
+ // nested loops relevant for integrated flow: \r
+ if(bEvaluateIntFlowNestedLoops)\r
+ {\r
+ // correlations:\r
+ TString intFlowDirectCorrelationsName = "fIntFlowDirectCorrelations";\r
+ intFlowDirectCorrelationsName += fAnalysisLabel->Data();\r
+ TProfile *intFlowDirectCorrelations = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(intFlowDirectCorrelationsName.Data()));\r
+ if(intFlowDirectCorrelations) \r
+ { \r
+ this->SetIntFlowDirectCorrelations(intFlowDirectCorrelations);\r
+ } else\r
+ {\r
+ cout<<"WARNING: intFlowDirectCorrelations is NULL in AFAWQC::GPFNLH() !!!!"<<endl;\r
+ exit(0);\r
+ }\r
+ if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) \r
+ {\r
+ TString intFlowExtraDirectCorrelationsName = "fIntFlowExtraDirectCorrelations";\r
+ intFlowExtraDirectCorrelationsName += fAnalysisLabel->Data();\r
+ TProfile *intFlowExtraDirectCorrelations = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(intFlowExtraDirectCorrelationsName.Data()));\r
+ if(intFlowExtraDirectCorrelations) \r
+ { \r
+ this->SetIntFlowExtraDirectCorrelations(intFlowExtraDirectCorrelations);\r
+ } else\r
+ {\r
+ cout<<"WARNING: intFlowExtraDirectCorrelations is NULL in AFAWQC::GPFNLH() !!!!"<<endl;\r
+ exit(0);\r
+ } \r
+ } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights) \r
+ // correction terms for non-uniform acceptance:\r
+ TString intFlowDirectCorrectionTermsForNUAName = "fIntFlowDirectCorrectionTermsForNUA";\r
+ intFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data();\r
+ TProfile *intFlowDirectCorrectionTermsForNUA[2] = {NULL};\r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
+ {\r
+ intFlowDirectCorrectionTermsForNUA[sc] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s: %s terms",intFlowDirectCorrectionTermsForNUAName.Data(),sinCosFlag[sc].Data())));\r
+ if(intFlowDirectCorrectionTermsForNUA[sc]) \r
+ { \r
+ this->SetIntFlowDirectCorrectionTermsForNUA(intFlowDirectCorrectionTermsForNUA[sc],sc);\r
+ } else\r
+ {\r
+ cout<<"WARNING: intFlowDirectCorrectionTermsForNUA[sc] is NULL in AFAWQC::GPFNLH() !!!!"<<endl;\r
+ cout<<"sc = "<<sc<<endl;\r
+ exit(0);\r
+ }\r
+ } // end of for(Int_t sc=0;sc<2;sc++) \r
+ } // end of if(bEvaluateIntFlowNestedLoops)\r
+ \r
+ // nested loops relevant for differential flow: \r
+ if(bEvaluateDiffFlowNestedLoops)\r
+ {\r
+ // correlations:\r
+ TString diffFlowDirectCorrelationsName = "fDiffFlowDirectCorrelations";\r
+ diffFlowDirectCorrelationsName += fAnalysisLabel->Data();\r
+ TProfile *diffFlowDirectCorrelations[2][2][4] = {{{NULL}}};\r
+ for(Int_t t=0;t<2;t++)\r
+ {\r
+ for(Int_t pe=0;pe<2;pe++)\r
+ {\r
+ for(Int_t ci=0;ci<4;ci++) // correlation index\r
+ {\r
+ diffFlowDirectCorrelations[t][pe][ci] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[ci].Data())));\r
+ if(diffFlowDirectCorrelations[t][pe][ci])\r
+ {\r
+ this->SetDiffFlowDirectCorrelations(diffFlowDirectCorrelations[t][pe][ci],t,pe,ci);\r
+ } else\r
+ {\r
+ cout<<"WARNING: diffFlowDirectCorrelations[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl; \r
+ cout<<"ci = "<<ci<<endl;\r
+ } \r
+ } // end of for(Int_t ci=0;ci<4;ci++) // correlation index \r
+ } // end of for(Int_t pe=0;pe<2;pe++)\r
+ } // end of for(Int_t t=0;t<2;t++) \r
+ // correction terms for non-uniform acceptance:\r
+ TString diffFlowDirectCorrectionTermsForNUAName = "fDiffFlowDirectCorrectionTermsForNUA";\r
+ diffFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); \r
+ TProfile *diffFlowDirectCorrectionTermsForNUA[2][2][2][10] = {{{{NULL}}}}; \r
+ for(Int_t t=0;t<2;t++)\r
+ {\r
+ for(Int_t pe=0;pe<2;pe++)\r
+ {\r
+ // correction terms for NUA:\r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos\r
+ {\r
+ for(Int_t cti=0;cti<9;cti++) // correction term index\r
+ {\r
+ diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1)));\r
+ if(diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti])\r
+ {\r
+ this->SetDiffFlowDirectCorrectionTermsForNUA(diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti],t,pe,sc,cti);\r
+ } else\r
+ {\r
+ cout<<"WARNING: diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl;\r
+ cout<<"t = "<<t<<endl;\r
+ cout<<"pe = "<<pe<<endl; \r
+ cout<<"sc = "<<sc<<endl;\r
+ cout<<"cti = "<<cti<<endl;\r
+ } \r
+ } // end of for(Int_t cti=0;cti<9;cti++) // correction term index\r
+ } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos\r
+ } // end of for(Int_t pe=0;pe<2;pe++)\r
+ } // end of for(Int_t t=0;t<2;t++)\r
+ } // end of if(bEvaluateDiffFlowNestedLoops)\r
+ } else // to if(outputListHistos)\r
+ {\r
+ cout<<"WARNING: outputListHistos is NULL in AFAWQC::GPFNLH() !!!!"<<endl;\r
+ exit(0);\r
+ }\r
+\r
+} // end of void AliFlowAnalysisWithQCumulants::GetPointersForNestedLoopsHistograms(TList *outputListHistos)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::StoreHarmonic()\r
+{\r
+ // Store flow harmonic in common control histograms.\r
+\r
+ (fCommonHists->GetHarmonic())->Fill(0.5,fHarmonic);\r
+ (fCommonHists2nd->GetHarmonic())->Fill(0.5,fHarmonic);\r
+ (fCommonHists4th->GetHarmonic())->Fill(0.5,fHarmonic);\r
+ (fCommonHists6th->GetHarmonic())->Fill(0.5,fHarmonic);\r
+ (fCommonHists8th->GetHarmonic())->Fill(0.5,fHarmonic);\r
+\r
+} // end of void AliFlowAnalysisWithQCumulants::StoreHarmonic()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelationsUsingParticleWeights(TString type, TString ptOrEta) // type = RP or POI \r
+{\r
+ // Calculate all correlations needed for differential flow using particle weights.\r
+ \r
+ Int_t t = -1; // type flag \r
+ Int_t pe = -1; // ptEta flag\r
+ \r
+ if(type == "RP")\r
+ {\r
+ t = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ t = 1;\r
+ }\r
+\r
+ if(ptOrEta == "Pt")\r
+ {\r
+ pe = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ pe = 1;\r
+ }\r
+ \r
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
+ Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
+ //Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
+\r
+ // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
+ Double_t dReQ1n1k = (*fReQ)(0,1);\r
+ Double_t dReQ2n2k = (*fReQ)(1,2);\r
+ Double_t dReQ1n3k = (*fReQ)(0,3);\r
+ //Double_t dReQ4n4k = (*fReQ)(3,4);\r
+ Double_t dImQ1n1k = (*fImQ)(0,1);\r
+ Double_t dImQ2n2k = (*fImQ)(1,2);\r
+ Double_t dImQ1n3k = (*fImQ)(0,3);\r
+ //Double_t dImQ4n4k = (*fImQ)(3,4);\r
+ \r
+ // S^M_{p,k} (see .h file for the definition of fSMpk):\r
+ Double_t dSM1p1k = (*fSMpk)(0,1);\r
+ Double_t dSM1p2k = (*fSMpk)(0,2);\r
+ Double_t dSM1p3k = (*fSMpk)(0,3);\r
+ Double_t dSM2p1k = (*fSMpk)(1,1);\r
+ Double_t dSM3p1k = (*fSMpk)(2,1);\r
+ \r
+ // looping over all bins and calculating reduced correlations: \r
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ {\r
+ // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): \r
+ Double_t p1n0kRe = 0.;\r
+ Double_t p1n0kIm = 0.;\r
+\r
+ // number of POIs in particular (pt,eta) bin):\r
+ Double_t mp = 0.;\r
+\r
+ // real and imaginary parts of q_{m*n,k}: \r
+ // (weighted Q-vector evaluated for particles which are both RPs and POIs in particular (pt,eta) bin)\r
+ Double_t q1n2kRe = 0.;\r
+ Double_t q1n2kIm = 0.;\r
+ Double_t q2n1kRe = 0.;\r
+ Double_t q2n1kIm = 0.;\r
+\r
+ // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) \r
+ Double_t s1p1k = 0.; \r
+ Double_t s1p2k = 0.; \r
+ Double_t s1p3k = 0.; \r
+ \r
+ // M0111 from Eq. (118) in QC2c (to be improved (notation))\r
+ Double_t dM0111 = 0.;\r
+ \r
+ if(type == "POI")\r
+ {\r
+ p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b))\r
+ * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b));\r
+ p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) \r
+ * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b));\r
+ \r
+ mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
+ \r
+ t = 1; // typeFlag = RP or POI\r
+ \r
+ // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) \r
+ q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b))\r
+ * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b));\r
+ q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b))\r
+ * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b));\r
+ q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b))\r
+ * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b));\r
+ q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b))\r
+ * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b));\r
+ \r
+ // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) \r
+ s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); \r
+ s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); \r
+ s1p3k = pow(fs1dEBE[2][pe][3]->GetBinContent(b)*fs1dEBE[2][pe][3]->GetBinEntries(b),1.); \r
+ \r
+ // M0111 from Eq. (118) in QC2c (to be improved (notation)):\r
+ dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k)\r
+ - 3.*(s1p1k*(dSM2p1k-dSM1p2k)\r
+ + 2.*(s1p3k-s1p2k*dSM1p1k));\r
+ }\r
+ else if(type == "RP")\r
+ {\r
+ // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) \r
+ q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b))\r
+ * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b));\r
+ q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b))\r
+ * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b));\r
+ q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b))\r
+ * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b));\r
+ q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b))\r
+ * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b));\r
+\r
+ // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) \r
+ s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); \r
+ s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); \r
+ s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); \r
+ \r
+ // to be improved (cross-checked):\r
+ p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b))\r
+ * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
+ p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) \r
+ * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
+ \r
+ mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
+ \r
+ t = 0; // typeFlag = RP or POI\r
+ \r
+ // M0111 from Eq. (118) in QC2c (to be improved (notation)):\r
+ dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k)\r
+ - 3.*(s1p1k*(dSM2p1k-dSM1p2k)\r
+ + 2.*(s1p3k-s1p2k*dSM1p1k));\r
+ //............................................................................................... \r
+ }\r
+ \r
+ // 2'-particle correlation:\r
+ Double_t two1n1nW0W1 = 0.;\r
+ if(mp*dSM1p1k-s1p1k)\r
+ {\r
+ two1n1nW0W1 = (p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k-s1p1k)\r
+ / (mp*dSM1p1k-s1p1k);\r
+ \r
+ // fill profile to get <<2'>> \r
+ fDiffFlowCorrelationsPro[t][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nW0W1,mp*dSM1p1k-s1p1k);\r
+ // histogram to store <2'> e-b-e (needed in some other methods):\r
+ fDiffFlowCorrelationsEBE[t][pe][0]->SetBinContent(b,two1n1nW0W1); \r
+ fDiffFlowEventWeightsForCorrelationsEBE[t][pe][0]->SetBinContent(b,mp*dSM1p1k-s1p1k); \r
+ } // end of if(mp*dSM1p1k-s1p1k)\r
+ \r
+ // 4'-particle correlation:\r
+ Double_t four1n1n1n1nW0W1W1W1 = 0.;\r
+ if(dM0111)\r
+ {\r
+ four1n1n1n1nW0W1W1W1 = ((pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k)\r
+ - q2n1kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))\r
+ - 2.*q2n1kIm*dReQ1n1k*dImQ1n1k\r
+ - p1n0kRe*(dReQ1n1k*dReQ2n2k+dImQ1n1k*dImQ2n2k)\r
+ + p1n0kIm*(dImQ1n1k*dReQ2n2k-dReQ1n1k*dImQ2n2k)\r
+ - 2.*dSM1p2k*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k)\r
+ - 2.*(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*s1p1k \r
+ + 6.*(q1n2kRe*dReQ1n1k+q1n2kIm*dImQ1n1k) \r
+ + 1.*(q2n1kRe*dReQ2n2k+q2n1kIm*dImQ2n2k) \r
+ + 2.*(p1n0kRe*dReQ1n3k+p1n0kIm*dImQ1n3k) \r
+ + 2.*s1p1k*dSM1p2k \r
+ - 6.*s1p3k) \r
+ / dM0111; // to be improved (notation of dM0111)\r
+ \r
+ // fill profile to get <<4'>> \r
+ fDiffFlowCorrelationsPro[t][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nW0W1W1W1,dM0111);\r
+ // histogram to store <4'> e-b-e (needed in some other methods):\r
+ fDiffFlowCorrelationsEBE[t][pe][1]->SetBinContent(b,four1n1n1n1nW0W1W1W1); \r
+ fDiffFlowEventWeightsForCorrelationsEBE[t][pe][1]->SetBinContent(b,dM0111); \r
+ } // end of if(dM0111)\r
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+\r
+} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelationsUsingParticleWeights(TString type, TString ptOrEta); // type = RP or POI \r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::FillCommonControlHistograms(AliFlowEventSimple *anEvent)\r
+{\r
+ // Fill common control histograms.\r
+ \r
+ Int_t nRP = anEvent->GetEventNSelTracksRP(); // number of RPs (i.e. number of particles used to determine the reaction plane)\r
+ fCommonHists->FillControlHistograms(anEvent); \r
+ if(nRP>1)\r
+ {\r
+ fCommonHists2nd->FillControlHistograms(anEvent); \r
+ if(nRP>3)\r
+ {\r
+ fCommonHists4th->FillControlHistograms(anEvent); \r
+ if(nRP>5)\r
+ {\r
+ fCommonHists6th->FillControlHistograms(anEvent); \r
+ if(nRP>7)\r
+ {\r
+ fCommonHists8th->FillControlHistograms(anEvent); \r
+ } // end of if(nRP>7) \r
+ } // end of if(nRP>5) \r
+ } // end of if(nRP>3) \r
+ } // end of if(nRP>1) \r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::FillCommonControlHistograms(AliFlowEventSimple *anEvent)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::ResetEventByEventQuantities()\r
+{\r
+ // Reset all event by event quantities.\r
+ \r
+ // integrated flow:\r
+ fReQ->Zero();\r
+ fImQ->Zero();\r
+ fSMpk->Zero();\r
+ fIntFlowCorrelationsEBE->Reset();\r
+ fIntFlowEventWeightsForCorrelationsEBE->Reset();\r
+ fIntFlowCorrelationsAllEBE->Reset();\r
+ \r
+ if(fApplyCorrectionForNUA) \r
+ {\r
+ for(Int_t sc=0;sc<2;sc++)\r
+ {\r
+ fIntFlowCorrectionTermsForNUAEBE[sc]->Reset();\r
+ } \r
+ }\r
+ \r
+ // differential flow:\r
+ // 1D:\r
+ for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP)\r
+ {\r
+ for(Int_t pe=0;pe<2;pe++) // 1D in pt or eta\r
+ {\r
+ for(Int_t m=0;m<4;m++) // multiple of harmonic\r
+ {\r
+ for(Int_t k=0;k<9;k++) // power of weight\r
+ {\r
+ if(fReRPQ1dEBE[t][pe][m][k]) fReRPQ1dEBE[t][pe][m][k]->Reset();\r
+ if(fImRPQ1dEBE[t][pe][m][k]) fImRPQ1dEBE[t][pe][m][k]->Reset();\r
+ } \r
+ }\r
+ }\r
+ }\r
+ \r
+ for(Int_t t=0;t<3;t++) // type (0 = RP, 1 = POI, 2 = RP&&POI )\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // 1D in pt or eta\r
+ {\r
+ for(Int_t k=0;k<9;k++)\r
+ {\r
+ if(fs1dEBE[t][pe][k]) fs1dEBE[t][pe][k]->Reset();\r
+ }\r
+ }\r
+ }\r
+\r
+ // e-b-e reduced correlations:\r
+ for(Int_t t=0;t<2;t++) // type (0 = RP, 1 = POI)\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ for(Int_t rci=0;rci<4;rci++) // reduced correlation index\r
+ {\r
+ if(fDiffFlowCorrelationsEBE[t][pe][rci]) fDiffFlowCorrelationsEBE[t][pe][rci]->Reset();\r
+ if(fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci]) fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci]->Reset();\r
+ }\r
+ }\r
+ }\r
+ \r
+ // correction terms for NUA:\r
+ for(Int_t t=0;t<2;t++) // type (0 = RP, 1 = POI)\r
+ { \r
+ for(Int_t pe=0;pe<2;pe++) // pt or eta\r
+ {\r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos\r
+ {\r
+ for(Int_t cti=0;cti<9;cti++) // correction term index\r
+ {\r
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti]->Reset(); \r
+ }\r
+ }\r
+ } \r
+ }\r
+ \r
+ // 2D (pt,eta)\r
+ if(fCalculate2DFlow)\r
+ {\r
+ for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP)\r
+ {\r
+ for(Int_t m=0;m<4;m++) // multiple of harmonic\r
+ {\r
+ for(Int_t k=0;k<9;k++) // power of weight\r
+ {\r
+ if(fReRPQ2dEBE[t][m][k]) fReRPQ2dEBE[t][m][k]->Reset();\r
+ if(fImRPQ2dEBE[t][m][k]) fImRPQ2dEBE[t][m][k]->Reset();\r
+ } \r
+ }\r
+ }\r
+ for(Int_t t=0;t<3;t++) // type (0 = RP, 1 = POI, 2 = RP&&POI )\r
+ { \r
+ for(Int_t k=0;k<9;k++)\r
+ {\r
+ if(fs2dEBE[t][k]) fs2dEBE[t][k]->Reset();\r
+ }\r
+ } \r
+ } // end of if(fCalculate2DFlow) \r
+\r
+} // end of void AliFlowAnalysisWithQCumulants::ResetEventByEventQuantities();\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTerms(TString type, TString ptOrEta)\r
+{\r
+ // Calculate correction terms for non-uniform acceptance for differential flow (sin terms).\r
+ \r
+ // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][0][cti], where cti runs as follows:\r
+ // 0: <<sin n(psi1)>>\r
+ // 1: <<sin n(psi1+phi2)>>\r
+ // 2: <<sin n(psi1+phi2-phi3)>>\r
+ // 3: <<sin n(psi1-phi2-phi3)>>:\r
+ // 4:\r
+ // 5:\r
+ // 6:\r
+ \r
+ // multiplicity:\r
+ Double_t dMult = (*fSMpk)(0,0);\r
+ \r
+ // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
+ Double_t dReQ1n = (*fReQ)(0,0);\r
+ Double_t dReQ2n = (*fReQ)(1,0);\r
+ //Double_t dReQ3n = (*fReQ)(2,0);\r
+ //Double_t dReQ4n = (*fReQ)(3,0);\r
+ Double_t dImQ1n = (*fImQ)(0,0);\r
+ Double_t dImQ2n = (*fImQ)(1,0);\r
+ //Double_t dImQ3n = (*fImQ)(2,0);\r
+ //Double_t dImQ4n = (*fImQ)(3,0);\r
+\r
+ Int_t t = -1; // type flag \r
+ Int_t pe = -1; // ptEta flag\r
+ \r
+ if(type == "RP")\r
+ {\r
+ t = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ t = 1;\r
+ }\r
+\r
+ if(ptOrEta == "Pt")\r
+ {\r
+ pe = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ pe = 1;\r
+ }\r
+ \r
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
+ Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
+ //Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
+\r
+ // looping over all bins and calculating correction terms: \r
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ {\r
+ // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): \r
+ Double_t p1n0kRe = 0.;\r
+ Double_t p1n0kIm = 0.;\r
+\r
+ // number of POIs in particular pt or eta bin:\r
+ Double_t mp = 0.;\r
+\r
+ // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin):\r
+ Double_t q1n0kRe = 0.;\r
+ Double_t q1n0kIm = 0.;\r
+ Double_t q2n0kRe = 0.;\r
+ Double_t q2n0kIm = 0.;\r
+\r
+ // number of particles which are both RPs and POIs in particular pt or eta bin:\r
+ Double_t mq = 0.;\r
+ \r
+ if(type == "POI")\r
+ {\r
+ // q_{m*n,0}:\r
+ q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b))\r
+ * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b));\r
+ q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b))\r
+ * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b));\r
+ q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b))\r
+ * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b));\r
+ q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b))\r
+ * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); \r
+ \r
+ mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
+ } \r
+ else if(type == "RP")\r
+ {\r
+ // q_{m*n,0}:\r
+ q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b))\r
+ * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
+ q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b))\r
+ * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
+ q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b))\r
+ * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b));\r
+ q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b))\r
+ * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); \r
+ \r
+ mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) \r
+ } \r
+ if(type == "POI")\r
+ {\r
+ // p_{m*n,0}:\r
+ p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b))\r
+ * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b));\r
+ p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) \r
+ * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b));\r
+ \r
+ mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
+ \r
+ t = 1; // typeFlag = RP or POI\r
+ }\r
+ else if(type == "RP")\r
+ {\r
+ // p_{m*n,0} = q_{m*n,0}:\r
+ p1n0kRe = q1n0kRe; \r
+ p1n0kIm = q1n0kIm; \r
+ \r
+ mp = mq; \r
+ \r
+ t = 0; // typeFlag = RP or POI\r
+ }\r
+\r
+ // <<sin n(psi1)>>:\r
+ Double_t sinP1nPsi = 0.;\r
+ if(mp)\r
+ {\r
+ sinP1nPsi = p1n0kIm/mp;\r
+ // fill profile for <<sin n(psi1)>>:\r
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi,mp);\r
+ // histogram to store <sin n(psi1)> e-b-e (needed in some other methods):\r
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][0]->SetBinContent(b,sinP1nPsi);\r
+ } // end of if(mp) \r
+ \r
+ // <<sin n(psi1+phi2)>>:\r
+ Double_t sinP1nPsiP1nPhi = 0.;\r
+ if(mp*dMult-mq)\r
+ {\r
+ sinP1nPsiP1nPhi = (p1n0kRe*dImQ1n+p1n0kIm*dReQ1n-q2n0kIm)/(mp*dMult-mq);\r
+ // fill profile for <<sin n(psi1+phi2)>>:\r
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsiP1nPhi,mp*dMult-mq);\r
+ // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods):\r
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][1]->SetBinContent(b,sinP1nPsiP1nPhi);\r
+ } // end of if(mp*dMult-mq) \r
+ \r
+ // <<sin n(psi1+phi2-phi3)>>:\r
+ Double_t sinP1nPsi1P1nPhi2MPhi3 = 0.;\r
+ if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.))\r
+ {\r
+ sinP1nPsi1P1nPhi2MPhi3 = (p1n0kIm*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult)\r
+ - 1.*(q2n0kIm*dReQ1n-q2n0kRe*dImQ1n) \r
+ - mq*dImQ1n+2.*q1n0kIm)\r
+ / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
+ // fill profile for <<sin n(psi1+phi2)>>:\r
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
+ // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods):\r
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][2]->SetBinContent(b,sinP1nPsi1P1nPhi2MPhi3);\r
+ } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) \r
+ \r
+ // <<sin n(psi1-phi2-phi3)>>:\r
+ Double_t sinP1nPsi1M1nPhi2MPhi3 = 0.;\r
+ if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.))\r
+ {\r
+ sinP1nPsi1M1nPhi2MPhi3 = (p1n0kIm*(pow(dReQ1n,2.)-pow(dImQ1n,2.))-2.*p1n0kRe*dReQ1n*dImQ1n\r
+ - 1.*(p1n0kIm*dReQ2n-p1n0kRe*dImQ2n)\r
+ + 2.*mq*dImQ1n-2.*q1n0kIm)\r
+ / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
+ // fill profile for <<sin n(psi1+phi2)>>:\r
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
+ // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods):\r
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][3]->SetBinContent(b,sinP1nPsi1M1nPhi2MPhi3);\r
+ } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) \r
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTerms(TString type, TString ptOrEta)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTerms(TString type, TString ptOrEta)\r
+{\r
+ // Calculate correction terms for non-uniform acceptance for differential flow (cos terms).\r
+ \r
+ // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][1][cti], where cti runs as follows:\r
+ // 0: <<cos n(psi)>>\r
+ // 1: <<cos n(psi1+phi2)>>\r
+ // 2: <<cos n(psi1+phi2-phi3)>>\r
+ // 3: <<cos n(psi1-phi2-phi3)>>\r
+ // 4:\r
+ // 5:\r
+ // 6:\r
+ \r
+ // multiplicity:\r
+ Double_t dMult = (*fSMpk)(0,0);\r
+ \r
+ // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
+ Double_t dReQ1n = (*fReQ)(0,0);\r
+ Double_t dReQ2n = (*fReQ)(1,0);\r
+ //Double_t dReQ3n = (*fReQ)(2,0);\r
+ //Double_t dReQ4n = (*fReQ)(3,0);\r
+ Double_t dImQ1n = (*fImQ)(0,0);\r
+ Double_t dImQ2n = (*fImQ)(1,0);\r
+ //Double_t dImQ3n = (*fImQ)(2,0);\r
+ //Double_t dImQ4n = (*fImQ)(3,0);\r
+\r
+ Int_t t = -1; // type flag \r
+ Int_t pe = -1; // ptEta flag\r
+ \r
+ if(type == "RP")\r
+ {\r
+ t = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ t = 1;\r
+ }\r
+\r
+ if(ptOrEta == "Pt")\r
+ {\r
+ pe = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ pe = 1;\r
+ }\r
+ \r
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
+ Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
+ //Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
+\r
+ // looping over all bins and calculating correction terms: \r
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ {\r
+ // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): \r
+ Double_t p1n0kRe = 0.;\r
+ Double_t p1n0kIm = 0.;\r
+\r
+ // number of POIs in particular pt or eta bin:\r
+ Double_t mp = 0.;\r
+\r
+ // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin):\r
+ Double_t q1n0kRe = 0.;\r
+ Double_t q1n0kIm = 0.;\r
+ Double_t q2n0kRe = 0.;\r
+ Double_t q2n0kIm = 0.;\r
+\r
+ // number of particles which are both RPs and POIs in particular pt or eta bin:\r
+ Double_t mq = 0.;\r
+ \r
+ if(type == "POI")\r
+ {\r
+ // q_{m*n,0}:\r
+ q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b))\r
+ * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b));\r
+ q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b))\r
+ * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b));\r
+ q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b))\r
+ * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b));\r
+ q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b))\r
+ * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); \r
+ \r
+ mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
+ } \r
+ else if(type == "RP")\r
+ {\r
+ // q_{m*n,0}:\r
+ q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b))\r
+ * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
+ q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b))\r
+ * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
+ q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b))\r
+ * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b));\r
+ q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b))\r
+ * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); \r
+ \r
+ mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) \r
+ } \r
+ if(type == "POI")\r
+ {\r
+ // p_{m*n,0}:\r
+ p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b))\r
+ * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b));\r
+ p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) \r
+ * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b));\r
+ \r
+ mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
+ \r
+ t = 1; // typeFlag = RP or POI\r
+ }\r
+ else if(type == "RP")\r
+ {\r
+ // p_{m*n,0} = q_{m*n,0}:\r
+ p1n0kRe = q1n0kRe; \r
+ p1n0kIm = q1n0kIm; \r
+ \r
+ mp = mq; \r
+ \r
+ t = 0; // typeFlag = RP or POI\r
+ }\r
+\r
+ // <<cos n(psi1)>>:\r
+ Double_t cosP1nPsi = 0.;\r
+ if(mp)\r
+ {\r
+ cosP1nPsi = p1n0kRe/mp;\r
+ \r
+ // fill profile for <<cos n(psi1)>>:\r
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi,mp);\r
+ // histogram to store <cos n(psi1)> e-b-e (needed in some other methods):\r
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][0]->SetBinContent(b,cosP1nPsi);\r
+ } // end of if(mp) \r
+ \r
+ // <<cos n(psi1+phi2)>>:\r
+ Double_t cosP1nPsiP1nPhi = 0.;\r
+ if(mp*dMult-mq)\r
+ {\r
+ cosP1nPsiP1nPhi = (p1n0kRe*dReQ1n-p1n0kIm*dImQ1n-q2n0kRe)/(mp*dMult-mq);\r
+ // fill profile for <<sin n(psi1+phi2)>>:\r
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsiP1nPhi,mp*dMult-mq);\r
+ // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods):\r
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][1]->SetBinContent(b,cosP1nPsiP1nPhi);\r
+ } // end of if(mp*dMult-mq) \r
+ \r
+ // <<cos n(psi1+phi2-phi3)>>:\r
+ Double_t cosP1nPsi1P1nPhi2MPhi3 = 0.;\r
+ if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.))\r
+ {\r
+ cosP1nPsi1P1nPhi2MPhi3 = (p1n0kRe*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult)\r
+ - 1.*(q2n0kRe*dReQ1n+q2n0kIm*dImQ1n) \r
+ - mq*dReQ1n+2.*q1n0kRe)\r
+ / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
+ // fill profile for <<sin n(psi1+phi2)>>:\r
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
+ // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods):\r
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][2]->SetBinContent(b,cosP1nPsi1P1nPhi2MPhi3);\r
+ } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) \r
+ \r
+ // <<cos n(psi1-phi2-phi3)>>:\r
+ Double_t cosP1nPsi1M1nPhi2MPhi3 = 0.;\r
+ if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.))\r
+ {\r
+ cosP1nPsi1M1nPhi2MPhi3 = (p1n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.))+2.*p1n0kIm*dReQ1n*dImQ1n\r
+ - 1.*(p1n0kRe*dReQ2n+p1n0kIm*dImQ2n) \r
+ - 2.*mq*dReQ1n+2.*q1n0kRe)\r
+ / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
+ // fill profile for <<sin n(psi1+phi2)>>:\r
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
+ // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods):\r
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][3]->SetBinContent(b,cosP1nPsi1M1nPhi2MPhi3);\r
+ } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) \r
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTerms(TString type, TString ptOrEta)\r
+\r
+\r
+//==================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUADiffFlow(TString type, TString ptOrEta)\r
+{\r
+ // Transfer prolfiles into histogams and correctly propagate the error (to be improved: description)\r
+ \r
+ // to be improved: debugged - I do not correctly transfer all profiles into histos (bug appears only after merging) \r
+ \r
+ Int_t t = -1; // type flag \r
+ Int_t pe = -1; // ptEta flag\r
+ \r
+ if(type == "RP")\r
+ {\r
+ t = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ t = 1;\r
+ }\r
+\r
+ if(ptOrEta == "Pt")\r
+ {\r
+ pe = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ pe = 1;\r
+ }\r
+ \r
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
+ //Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
+ //Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
+ //Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
+\r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos\r
+ {\r
+ for(Int_t cti=0;cti<9;cti++) // correction term index\r
+ {\r
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ {\r
+ Double_t correctionTerm = fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]->GetBinContent(b);\r
+ fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]->SetBinContent(b,correctionTerm);\r
+ // to be improved (propagate error correctly)\r
+ // ...\r
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ } // correction term index\r
+ } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos\r
+\r
+}// end of void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUADiffFlow(TString type, TString ptOrEta)\r
+\r
+\r
+//==================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta)\r
+{ \r
+ // Calculate generalized differential flow Q-cumulants (corrected for non-uniform acceptance)\r
+ \r
+ Int_t typeFlag = -1;\r
+ Int_t ptEtaFlag = -1;\r
+\r
+ if(type == "RP")\r
+ {\r
+ typeFlag = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ typeFlag = 1;\r
+ } \r
+ \r
+ if(ptOrEta == "Pt")\r
+ {\r
+ ptEtaFlag = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ ptEtaFlag = 1;\r
+ } \r
+ \r
+ // shortcuts:\r
+ Int_t t = typeFlag;\r
+ Int_t pe = ptEtaFlag;\r
+ \r
+ // common:\r
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
+ \r
+ // 2-particle correlation:\r
+ Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>>\r
+ // sin term coming from integrated flow: \r
+ Double_t sinP1nPhi = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1); // <<sin(n*phi1)>>\r
+ Double_t sinP1nPhi1P1nPhi2 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2); // <<sin(n*(phi1+phi2))>>\r
+ Double_t sinP1nPhi1M1nPhi2M1nPhi3 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(3); // <<sin(n*(phi1-phi2-phi3))>>\r
+ // cos term coming from integrated flow: \r
+ Double_t cosP1nPhi = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1); // <<cos(n*phi1)>>\r
+ Double_t cosP1nPhi1P1nPhi2 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2); // <<cos(n*(phi1+phi2))>>\r
+ Double_t cosP1nPhi1M1nPhi2M1nPhi3 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(3); // <<cos(n*(phi1-phi2-phi3))>>\r
+\r
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ {\r
+ Double_t twoPrime = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); // <<2'>>\r
+ Double_t fourPrime = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); // <<4'>>\r
+ Double_t sinP1nPsi = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][0]->GetBinContent(b); // <<sin n(Psi)>> \r
+ Double_t cosP1nPsi = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][0]->GetBinContent(b); // <<cos n(Psi)>> \r
+ Double_t sinP1nPsi1P1nPhi2 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][1]->GetBinContent(b); // <<sin n(psi1+phi2)>> \r
+ Double_t cosP1nPsi1P1nPhi2 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][1]->GetBinContent(b); // <<cos n(psi1+phi2)>> \r
+ Double_t sinP1nPsi1P1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][2]->GetBinContent(b); // <<sin n(psi1+phi2-phi3)>> \r
+ Double_t cosP1nPsi1P1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][2]->GetBinContent(b); // <<cos n(psi1+phi2-phi3)>> \r
+ Double_t sinP1nPsi1M1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][3]->GetBinContent(b); // <<sin n(psi1-phi2-phi3)>> \r
+ Double_t cosP1nPsi1M1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][3]->GetBinContent(b); // <<cos n(psi1-phi2-phi3)>> \r
+ // generalized QC{2'}:\r
+ Double_t qc2Prime = twoPrime - sinP1nPsi*sinP1nPhi - cosP1nPsi*cosP1nPhi;\r
+ fDiffFlowCumulants[t][pe][0]->SetBinContent(b,qc2Prime);\r
+ // generalized QC{4'}:\r
+ Double_t qc4Prime = fourPrime-2.*twoPrime*two\r
+ - cosP1nPsi*cosP1nPhi1M1nPhi2M1nPhi3\r
+ + sinP1nPsi*sinP1nPhi1M1nPhi2M1nPhi3\r
+ - cosP1nPhi*cosP1nPsi1M1nPhi2M1nPhi3\r
+ + sinP1nPhi*sinP1nPsi1M1nPhi2M1nPhi3\r
+ - 2.*cosP1nPhi*cosP1nPsi1P1nPhi2M1nPhi3\r
+ - 2.*sinP1nPhi*sinP1nPsi1P1nPhi2M1nPhi3\r
+ - cosP1nPsi1P1nPhi2*cosP1nPhi1P1nPhi2\r
+ - sinP1nPsi1P1nPhi2*sinP1nPhi1P1nPhi2\r
+ + 2.*cosP1nPhi1P1nPhi2*(cosP1nPsi*cosP1nPhi-sinP1nPsi*sinP1nPhi)\r
+ + 2.*sinP1nPhi1P1nPhi2*(cosP1nPsi*sinP1nPhi+sinP1nPsi*cosP1nPhi)\r
+ + 4.*two*(cosP1nPsi*cosP1nPhi+sinP1nPsi*sinP1nPhi)\r
+ + 2.*cosP1nPsi1P1nPhi2*(pow(cosP1nPhi,2.)-pow(sinP1nPhi,2.))\r
+ + 4.*sinP1nPsi1P1nPhi2*cosP1nPhi*sinP1nPhi\r
+ + 4.*twoPrime*(pow(cosP1nPhi,2.)+pow(sinP1nPhi,2.))\r
+ - 6.*(pow(cosP1nPhi,2.)-pow(sinP1nPhi,2.)) \r
+ * (cosP1nPsi*cosP1nPhi-sinP1nPsi*sinP1nPhi)\r
+ - 12.*cosP1nPhi*sinP1nPhi\r
+ * (sinP1nPsi*cosP1nPhi+cosP1nPsi*sinP1nPhi);\r
+ fDiffFlowCumulants[t][pe][1]->SetBinContent(b,qc4Prime); \r
+ } // end of for(Int_t p=1;p<=fnBinsPt;p++)\r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta)\r
+\r
+\r
+//==================================================================================================================================\r
+ \r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta)\r
+{\r
+ // Calculate differential flow corrected for non-uniform acceptance.\r
+ \r
+ // to be improved (rewritten completely)\r
+ \r
+ Int_t typeFlag = -1;\r
+ Int_t ptEtaFlag = -1;\r
+\r
+ if(type == "RP")\r
+ {\r
+ typeFlag = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ typeFlag = 1;\r
+ } \r
+ \r
+ if(ptOrEta == "Pt")\r
+ {\r
+ ptEtaFlag = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ ptEtaFlag = 1;\r
+ } \r
+ \r
+ // shortcuts:\r
+ Int_t t = typeFlag;\r
+ Int_t pe = ptEtaFlag;\r
+ \r
+ // common:\r
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
+ \r
+ // to be improved: access here generalized QC{2} and QC{4} instead: \r
+ Double_t dV2 = fIntFlow->GetBinContent(1); \r
+ Double_t dV4 = fIntFlow->GetBinContent(2); \r
+ \r
+ // loop over pt or eta bins:\r
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ {\r
+ // generalized QC{2'}:\r
+ Double_t gQC2Prime = fDiffFlowCumulants[t][pe][0]->GetBinContent(b);\r
+ // v'{2}:\r
+ if(dV2>0)\r
+ { \r
+ Double_t v2Prime = gQC2Prime/dV2;\r
+ fDiffFlow[t][pe][0]->SetBinContent(b,v2Prime); \r
+ } \r
+ // generalized QC{4'}:\r
+ Double_t gQC4Prime = fDiffFlowCumulants[t][pe][1]->GetBinContent(b);\r
+ // v'{4}:\r
+ if(dV4>0)\r
+ { \r
+ Double_t v4Prime = -gQC4Prime/pow(dV4,3.);\r
+ fDiffFlow[t][pe][1]->SetBinContent(b,v4Prime); \r
+ } \r
+ } // end of for(Int_t b=1;b<=fnBinsPtEta[pe];b++)\r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta); \r
+\r
+\r
+//==================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent)\r
+{\r
+ // Evaluate with nested loops multiparticle correlations for integrated flow (without using the particle weights). \r
+\r
+ // Remark: Results are stored in profile fIntFlowDirectCorrelations whose binning is organized as follows:\r
+ // \r
+ // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))>\r
+ // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))>\r
+ // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))> \r
+ // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))>\r
+ // 5th bin: ---- EMPTY ----\r
+ // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))>\r
+ // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))>\r
+ // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))>\r
+ // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))>\r
+ // 10th bin: ---- EMPTY ----\r
+ // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))>\r
+ // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))>\r
+ // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))>\r
+ // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))> \r
+ // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))>\r
+ // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))>\r
+ // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> \r
+ // 18th bin: ---- EMPTY ----\r
+ // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))>\r
+ // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))>\r
+ // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))>\r
+ // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))>\r
+ // 23rd bin: ---- EMPTY ----\r
+ // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))>\r
+ // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))>\r
+ // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))>\r
+ // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))>\r
+ // 28th bin: ---- EMPTY ----\r
+ // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))>\r
+ // 30th bin: ---- EMPTY ----\r
+ // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))>\r
+ \r
+ Int_t nPrim = anEvent->NumberOfTracks(); \r
+ AliFlowTrackSimple *aftsTrack = NULL; \r
+ Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; \r
+ Int_t n = fHarmonic; \r
+ Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?)\r
+ Double_t dMult = (*fSMpk)(0,0);\r
+ cout<<endl;\r
+ cout<<"Multiparticle correlations: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl;\r
+ if(dMult<2)\r
+ {\r
+ cout<<"... skipping this event (multiplicity too low) ..."<<endl;\r
+ } else if (dMult>fMaxAllowedMultiplicity)\r
+ {\r
+ cout<<"... skipping this event (multiplicity too high) ..."<<endl;\r
+ } else \r
+ { \r
+ cout<<"... evaluating nested loops (without using particle weights)..."<<endl;\r
+ } \r
+ \r
+ // 2-particle correlations: \r
+ if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity)\r
+ {\r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi1=aftsTrack->Phi(); \r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1)continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi();\r
+ if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush;\r
+ // fill the profile with 2-p correlations: \r
+ fIntFlowDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),1.); // <cos(n*(phi1-phi2))>\r
+ fIntFlowDirectCorrelations->Fill(1.5,cos(2.*n*(phi1-phi2)),1.); // <cos(2n*(phi1-phi2))>\r
+ fIntFlowDirectCorrelations->Fill(2.5,cos(3.*n*(phi1-phi2)),1.); // <cos(3n*(phi1-phi2))>\r
+ fIntFlowDirectCorrelations->Fill(3.5,cos(4.*n*(phi1-phi2)),1.); // <cos(4n*(phi1-phi2))> \r
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ } // end of if(nPrim>=2)\r
+ \r
+ // 3-particle correlations: \r
+ if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity)\r
+ {\r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi1=aftsTrack->Phi();\r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1)continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi();\r
+ for(Int_t i3=0;i3<nPrim;i3++)\r
+ {\r
+ if(i3==i1||i3==i2)continue;\r
+ aftsTrack=anEvent->GetTrack(i3);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi3=aftsTrack->Phi();\r
+ if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush;\r
+ // fill the profile with 3-p correlations: \r
+ fIntFlowDirectCorrelations->Fill(5.,cos(2.*n*phi1-n*(phi2+phi3)),1.); //<3>_{2n|nn,n}\r
+ fIntFlowDirectCorrelations->Fill(6.,cos(3.*n*phi1-2.*n*phi2-n*phi3),1.); //<3>_{3n|2n,n}\r
+ fIntFlowDirectCorrelations->Fill(7.,cos(4.*n*phi1-2.*n*phi2-2.*n*phi3),1.); //<3>_{4n|2n,2n}\r
+ fIntFlowDirectCorrelations->Fill(8.,cos(4.*n*phi1-3.*n*phi2-n*phi3),1.); //<3>_{4n|3n,n}\r
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ } // end of if(nPrim>=3)\r
+\r
+ // 4-particle correlations:\r
+ if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity)\r
+ { \r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ { \r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi1=aftsTrack->Phi();\r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1)continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi();\r
+ for(Int_t i3=0;i3<nPrim;i3++)\r
+ {\r
+ if(i3==i1||i3==i2)continue;\r
+ aftsTrack=anEvent->GetTrack(i3);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi3=aftsTrack->Phi();\r
+ for(Int_t i4=0;i4<nPrim;i4++)\r
+ {\r
+ if(i4==i1||i4==i2||i4==i3)continue;\r
+ aftsTrack=anEvent->GetTrack(i4);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi4=aftsTrack->Phi();\r
+ if(nPrim==4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush;\r
+ // fill the profile with 4-p correlations: \r
+ fIntFlowDirectCorrelations->Fill(10.,cos(n*phi1+n*phi2-n*phi3-n*phi4),1.); // <4>_{n,n|n,n} \r
+ fIntFlowDirectCorrelations->Fill(11.,cos(2.*n*phi1+n*phi2-2.*n*phi3-n*phi4),1.); // <4>_{2n,n|2n,n}\r
+ fIntFlowDirectCorrelations->Fill(12.,cos(2.*n*phi1+2*n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{2n,2n|2n,2n}\r
+ fIntFlowDirectCorrelations->Fill(13.,cos(3.*n*phi1-n*phi2-n*phi3-n*phi4),1.); // <4>_{3n|n,n,n}\r
+ fIntFlowDirectCorrelations->Fill(14.,cos(3.*n*phi1+n*phi2-3.*n*phi3-n*phi4),1.); // <4>_{3n,n|3n,n} \r
+ fIntFlowDirectCorrelations->Fill(15.,cos(3.*n*phi1+n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{3n,n|2n,2n}\r
+ fIntFlowDirectCorrelations->Fill(16.,cos(4.*n*phi1-2.*n*phi2-n*phi3-n*phi4),1.); // <4>_{4n|2n,n,n} \r
+ } // end of for(Int_t i4=0;i4<nPrim;i4++) \r
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ } // end of if(nPrim>=)\r
+\r
+ // 5-particle correlations: \r
+ if(nPrim>=5 && nPrim<=fMaxAllowedMultiplicity)\r
+ {\r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ if(!(aftsTrack->InRPSelection())) continue; \r
+ phi1=aftsTrack->Phi();\r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1)continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi();\r
+ for(Int_t i3=0;i3<nPrim;i3++)\r
+ {\r
+ if(i3==i1||i3==i2)continue;\r
+ aftsTrack=anEvent->GetTrack(i3);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi3=aftsTrack->Phi();\r
+ for(Int_t i4=0;i4<nPrim;i4++)\r
+ {\r
+ if(i4==i1||i4==i2||i4==i3)continue;\r
+ aftsTrack=anEvent->GetTrack(i4);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi4=aftsTrack->Phi();\r
+ for(Int_t i5=0;i5<nPrim;i5++)\r
+ {\r
+ if(i5==i1||i5==i2||i5==i3||i5==i4)continue;\r
+ aftsTrack=anEvent->GetTrack(i5);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi5=aftsTrack->Phi();\r
+ if(nPrim==5) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<"\r"<<flush;\r
+ // fill the profile with 5-p correlations: \r
+ fIntFlowDirectCorrelations->Fill(18.,cos(2.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5),1.); //<5>_{2n,n|n,n,n}\r
+ fIntFlowDirectCorrelations->Fill(19.,cos(2.*n*phi1+2.*n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); //<5>_{2n,2n|2n,n,n}\r
+ fIntFlowDirectCorrelations->Fill(20.,cos(3.*n*phi1+n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); //<5>_{3n,n|2n,n,n}\r
+ fIntFlowDirectCorrelations->Fill(21.,cos(4.*n*phi1-n*phi2-n*phi3-n*phi4-n*phi5),1.); //<5>_{4n|n,n,n,n}\r
+ } // end of for(Int_t i5=0;i5<nPrim;i5++)\r
+ } // end of for(Int_t i4=0;i4<nPrim;i4++) \r
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ } // end of if(nPrim>=5)\r
+ \r
+ // 6-particle correlations:\r
+ if(nPrim>=6 && nPrim<=fMaxAllowedMultiplicity)\r
+ {\r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi1=aftsTrack->Phi();\r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1)continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi();\r
+ for(Int_t i3=0;i3<nPrim;i3++)\r
+ {\r
+ if(i3==i1||i3==i2)continue;\r
+ aftsTrack=anEvent->GetTrack(i3);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi3=aftsTrack->Phi();\r
+ for(Int_t i4=0;i4<nPrim;i4++)\r
+ {\r
+ if(i4==i1||i4==i2||i4==i3)continue;\r
+ aftsTrack=anEvent->GetTrack(i4);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi4=aftsTrack->Phi();\r
+ for(Int_t i5=0;i5<nPrim;i5++)\r
+ {\r
+ if(i5==i1||i5==i2||i5==i3||i5==i4)continue;\r
+ aftsTrack=anEvent->GetTrack(i5);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi5=aftsTrack->Phi();\r
+ for(Int_t i6=0;i6<nPrim;i6++)\r
+ {\r
+ if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue;\r
+ aftsTrack=anEvent->GetTrack(i6);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi6=aftsTrack->Phi(); \r
+ if(nPrim==6) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<"\r"<<flush;\r
+ // fill the profile with 6-p correlations: \r
+ fIntFlowDirectCorrelations->Fill(23.,cos(n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{n,n,n|n,n,n}\r
+ fIntFlowDirectCorrelations->Fill(24.,cos(2.*n*phi1+n*phi2+n*phi3-2.*n*phi4-n*phi5-n*phi6),1.); //<6>_{2n,n,n|2n,n,n}\r
+ fIntFlowDirectCorrelations->Fill(25.,cos(2.*n*phi1+2.*n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{2n,2n|n,n,n,n}\r
+ fIntFlowDirectCorrelations->Fill(26.,cos(3.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); //<6>_{3n,n|n,n,n,n} \r
+ } // end of for(Int_t i6=0;i6<nPrim;i6++)\r
+ } // end of for(Int_t i5=0;i5<nPrim;i5++)\r
+ } // end of for(Int_t i4=0;i4<nPrim;i4++)\r
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ } // end of if(nPrim>=6)\r
+ \r
+ // 7-particle correlations:\r
+ if(nPrim>=7 && nPrim<=fMaxAllowedMultiplicity)\r
+ {\r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ { \r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi1=aftsTrack->Phi();\r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1)continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi();\r
+ for(Int_t i3=0;i3<nPrim;i3++)\r
+ {\r
+ if(i3==i1||i3==i2)continue;\r
+ aftsTrack=anEvent->GetTrack(i3);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi3=aftsTrack->Phi();\r
+ for(Int_t i4=0;i4<nPrim;i4++)\r
+ {\r
+ if(i4==i1||i4==i2||i4==i3)continue;\r
+ aftsTrack=anEvent->GetTrack(i4);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi4=aftsTrack->Phi();\r
+ for(Int_t i5=0;i5<nPrim;i5++)\r
+ {\r
+ if(i5==i1||i5==i2||i5==i3||i5==i4)continue;\r
+ aftsTrack=anEvent->GetTrack(i5);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi5=aftsTrack->Phi();\r
+ for(Int_t i6=0;i6<nPrim;i6++)\r
+ {\r
+ if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue;\r
+ aftsTrack=anEvent->GetTrack(i6);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi6=aftsTrack->Phi(); \r
+ for(Int_t i7=0;i7<nPrim;i7++)\r
+ {\r
+ if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue;\r
+ aftsTrack=anEvent->GetTrack(i7);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi7=aftsTrack->Phi(); \r
+ if(nPrim==7) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<" "<<i7<<"\r"<<flush;\r
+ // fill the profile with 7-p correlation: \r
+ fIntFlowDirectCorrelations->Fill(28.,cos(2.*n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6-n*phi7),1.); // <7>_{2n,n,n|n,n,n,n}\r
+ } // end of for(Int_t i7=0;i7<nPrim;i7++)\r
+ } // end of for(Int_t i6=0;i6<nPrim;i6++) \r
+ } // end of for(Int_t i5=0;i5<nPrim;i5++)\r
+ } // end of for(Int_t i4=0;i4<nPrim;i4++) \r
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ } // end of if(nPrim>=7)\r
+ \r
+ // 8-particle correlations:\r
+ if(nPrim>=8 && nPrim<=fMaxAllowedMultiplicity)\r
+ {\r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi1=aftsTrack->Phi();\r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1)continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi();\r
+ for(Int_t i3=0;i3<nPrim;i3++)\r
+ {\r
+ if(i3==i1||i3==i2)continue;\r
+ aftsTrack=anEvent->GetTrack(i3);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi3=aftsTrack->Phi();\r
+ for(Int_t i4=0;i4<nPrim;i4++)\r
+ {\r
+ if(i4==i1||i4==i2||i4==i3)continue;\r
+ aftsTrack=anEvent->GetTrack(i4);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi4=aftsTrack->Phi();\r
+ for(Int_t i5=0;i5<nPrim;i5++)\r
+ {\r
+ if(i5==i1||i5==i2||i5==i3||i5==i4)continue;\r
+ aftsTrack=anEvent->GetTrack(i5);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi5=aftsTrack->Phi();\r
+ for(Int_t i6=0;i6<nPrim;i6++)\r
+ {\r
+ if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue;\r
+ aftsTrack=anEvent->GetTrack(i6);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi6=aftsTrack->Phi();\r
+ for(Int_t i7=0;i7<nPrim;i7++)\r
+ {\r
+ if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue;\r
+ aftsTrack=anEvent->GetTrack(i7);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi7=aftsTrack->Phi();\r
+ for(Int_t i8=0;i8<nPrim;i8++)\r
+ {\r
+ if(i8==i1||i8==i2||i8==i3||i8==i4||i8==i5||i8==i6||i8==i7)continue;\r
+ aftsTrack=anEvent->GetTrack(i8);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi8=aftsTrack->Phi();\r
+ cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<" "<<i7<<" "<<i8<<"\r"<<flush;\r
+ // fill the profile with 8-p correlation: \r
+ fIntFlowDirectCorrelations->Fill(30.,cos(n*phi1+n*phi2+n*phi3+n*phi4-n*phi5-n*phi6-n*phi7-n*phi8),1.); // <8>_{n,n,n,n|n,n,n,n}\r
+ } // end of for(Int_t i8=0;i8<nPrim;i8++)\r
+ } // end of for(Int_t i7=0;i7<nPrim;i7++) \r
+ } // end of for(Int_t i6=0;i6<nPrim;i6++) \r
+ } // end of for(Int_t i5=0;i5<nPrim;i5++)\r
+ } // end of for(Int_t i4=0;i4<nPrim;i4++) \r
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ } // end of if(nPrim>=8)\r
+ \r
+ cout<<endl;\r
+\r
+} // end of AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent)\r
+\r
+\r
+//==================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrelations()\r
+{\r
+ // Cross-check results for multiparticle correlations needed for int. flow: results from Q-vectors vs results from nested loops.\r
+\r
+ cout<<endl;\r
+ cout<<endl;\r
+ cout<<" *****************************************"<<endl;\r
+ cout<<" **** cross-checking the correlations ****"<<endl;\r
+ cout<<" **** for integrated flow ****"<<endl;\r
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
+ {\r
+ cout<<" **** (particle weights not used) ****"<<endl;\r
+ } else\r
+ {\r
+ cout<<" **** (particle weights used) ****"<<endl;\r
+ } \r
+ cout<<" *****************************************"<<endl;\r
+ cout<<endl;\r
+ cout<<endl;\r
+\r
+ Int_t ciMax = 32; // to be improved (removed eventually when I calculate 6th and 8th order with particle weights)\r
+ \r
+ if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights)\r
+ {\r
+ ciMax = 11;\r
+ }\r
+\r
+ for(Int_t ci=1;ci<=ciMax;ci++)\r
+ {\r
+ if(strcmp((fIntFlowCorrelationsAllPro->GetXaxis())->GetBinLabel(ci), "") == 0) continue; // to be improved (access finalized histogram here)\r
+ cout<<(fIntFlowCorrelationsAllPro->GetXaxis())->GetBinLabel(ci)<<":"<<endl; // to be improved (access finalized histogram here)\r
+ cout<<"from Q-vectors = "<<fIntFlowCorrelationsAllPro->GetBinContent(ci)<<endl; // to be improved (access finalized histogram here)\r
+ cout<<"from nested loops = "<<fIntFlowDirectCorrelations->GetBinContent(ci)<<endl;\r
+ cout<<endl;\r
+ }\r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrelations()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrectionTermsForNUA()\r
+{\r
+ // Cross-check results for corrections terms for non-uniform acceptance needed for int. flow: results from Q-vectors vs results from nested loops.\r
+\r
+ cout<<endl;\r
+ cout<<endl;\r
+ cout<<" *********************************************"<<endl;\r
+ cout<<" **** cross-checking the correction terms ****"<<endl;\r
+ cout<<" **** for non-uniform acceptance relevant ****"<<endl;\r
+ cout<<" **** for integrated flow ****"<<endl;\r
+ if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights))\r
+ {\r
+ cout<<" **** (particle weights not used) ****"<<endl;\r
+ } else\r
+ {\r
+ cout<<" **** (particle weights used) ****"<<endl;\r
+ } \r
+ cout<<" *********************************************"<<endl;\r
+ cout<<endl;\r
+ cout<<endl;\r
+\r
+ for(Int_t ci=1;ci<=10;ci++) // correction term index\r
+ {\r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos term\r
+ {\r
+ if(strcmp((fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->GetBinLabel(ci), "") == 0) continue; // to be improved (access finalized histogram here)\r
+ cout<<(fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->GetBinLabel(ci)<<":"<<endl; // to be improved (access finalized histogram here)\r
+ cout<<"from Q-vectors = "<<fIntFlowCorrectionTermsForNUAPro[sc]->GetBinContent(ci)<<endl; // to be improved (access finalized histogram here)\r
+ cout<<"from nested loops = "<<fIntFlowDirectCorrectionTermsForNUA[sc]->GetBinContent(ci)<<endl;\r
+ cout<<endl;\r
+ } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos term\r
+ } // end of for(Int_t ci=1;ci<=10;ci++) // correction term index\r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrectionTermsForNUA() \r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent)\r
+{\r
+ // Evaluate with nested loops multiparticle correlations for integrated flow (using the particle weights). \r
+\r
+ // Results are stored in profile fIntFlowDirectCorrelations. \r
+ // Remark 1: When particle weights are used the binning of fIntFlowDirectCorrelations is organized as follows:\r
+ //\r
+ // 1st bin: <2>_{1n|1n} = two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))>\r
+ // 2nd bin: <2>_{2n|2n} = two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))>\r
+ // 3rd bin: <2>_{3n|3n} = two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> \r
+ // 4th bin: <2>_{4n|4n} = two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))>\r
+ // 5th bin: ---- EMPTY ----\r
+ // 6th bin: <3>_{2n|1n,1n} = three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))>\r
+ // 7th bin: <3>_{3n|2n,1n} = ...\r
+ // 8th bin: <3>_{4n|2n,2n} = ...\r
+ // 9th bin: <3>_{4n|3n,1n} = ...\r
+ // 10th bin: ---- EMPTY ----\r
+ // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))>\r
+ // 12th bin: <4>_{2n,1n|2n,1n} = ...\r
+ // 13th bin: <4>_{2n,2n|2n,2n} = ...\r
+ // 14th bin: <4>_{3n|1n,1n,1n} = ... \r
+ // 15th bin: <4>_{3n,1n|3n,1n} = ...\r
+ // 16th bin: <4>_{3n,1n|2n,2n} = ...\r
+ // 17th bin: <4>_{4n|2n,1n,1n} = ... \r
+ // 18th bin: ---- EMPTY ----\r
+ // 19th bin: <5>_{2n|1n,1n,1n,1n} = ...\r
+ // 20th bin: <5>_{2n,2n|2n,1n,1n} = ...\r
+ // 21st bin: <5>_{3n,1n|2n,1n,1n} = ...\r
+ // 22nd bin: <5>_{4n|1n,1n,1n,1n} = ...\r
+ // 23rd bin: ---- EMPTY ----\r
+ // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = ...\r
+ // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = ...\r
+ // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = ...\r
+ // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = ...\r
+ // 28th bin: ---- EMPTY ----\r
+ // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = ...\r
+ // 30th bin: ---- EMPTY ----\r
+ // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = ...\r
+ \r
+ // Remark 2: When particle weights are used there are some extra correlations. They are stored in \r
+ // fIntFlowExtraDirectCorrelations binning of which is organized as follows:\r
+ \r
+ // 1st bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))>\r
+ // 2nd bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> \r
+ // ...\r
+ \r
+ Int_t nPrim = anEvent->NumberOfTracks(); \r
+ AliFlowTrackSimple *aftsTrack = NULL;\r
+ //Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.;\r
+ //Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.;\r
+ Double_t phi1=0., phi2=0., phi3=0., phi4=0.;\r
+ Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1.;\r
+ Int_t n = fHarmonic; \r
+ Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?)\r
+ Double_t dMult = (*fSMpk)(0,0);\r
+ cout<<endl;\r
+ cout<<"Multiparticle correlations: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl;\r
+ if(dMult<2)\r
+ {\r
+ cout<<"... skipping this event (multiplicity too low) ..."<<endl;\r
+ } else if (dMult>fMaxAllowedMultiplicity)\r
+ {\r
+ cout<<"... skipping this event (multiplicity too high) ..."<<endl;\r
+ } else \r
+ { \r
+ cout<<"... evaluating nested loops (using particle weights) ..."<<endl;\r
+ } \r
+ \r
+ // 2-particle correlations: \r
+ if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity)\r
+ {\r
+ // 2 nested loops multiparticle correlations using particle weights: \r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi1=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi())));\r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1)continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); \r
+ if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush;\r
+ // 2-p correlations using particle weights:\r
+ if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),wPhi1*wPhi2); // <w1 w2 cos( n*(phi1-phi2))>\r
+ if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(1.5,cos(2.*n*(phi1-phi2)),pow(wPhi1,2)*pow(wPhi2,2)); // <w1^2 w2^2 cos(2n*(phi1-phi2))>\r
+ if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(2.5,cos(3.*n*(phi1-phi2)),pow(wPhi1,3)*pow(wPhi2,3)); // <w1^3 w2^3 cos(3n*(phi1-phi2))>\r
+ if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(3.5,cos(4.*n*(phi1-phi2)),pow(wPhi1,4)*pow(wPhi2,4)); // <w1^4 w2^4 cos(4n*(phi1-phi2))> \r
+ // extra correlations: \r
+ // 2-p extra correlations (do not appear if particle weights are not used):\r
+ if(fUsePhiWeights) fIntFlowExtraDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),pow(wPhi1,3)*wPhi2); // <w1^3 w2 cos(n*(phi1-phi2))>\r
+ // ...\r
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ } // end of if(nPrim>=2)\r
+\r
+ if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity)\r
+ { \r
+ // 3 nested loops multiparticle correlations using particle weights: \r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi1=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi())));\r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1)continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));\r
+ for(Int_t i3=0;i3<nPrim;i3++)\r
+ {\r
+ if(i3==i1||i3==i2)continue;\r
+ aftsTrack=anEvent->GetTrack(i3);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi3=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi())));\r
+ if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush;\r
+ // 3-p correlations using particle weights:\r
+ if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(5.5,cos(2.*n*phi1-n*(phi2+phi3)),pow(wPhi1,2)*wPhi2*wPhi3); // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))>\r
+ // ...\r
+ // extra correlations: \r
+ // 2-p extra correlations (do not appear if particle weights are not used):\r
+ if(fUsePhiWeights) fIntFlowExtraDirectCorrelations->Fill(1.5,cos(n*(phi1-phi2)),wPhi1*wPhi2*pow(wPhi3,2)); // <w1 w2 w3^2 cos(n*(phi1-phi2))>\r
+ // ...\r
+ // 3-p extra correlations (do not appear if particle weights are not used):\r
+ // ...\r
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ } // end of if(nPrim>=3)\r
+ \r
+ if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity)\r
+ {\r
+ // 4 nested loops multiparticle correlations using particle weights: \r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi1=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi())));\r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1)continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));\r
+ for(Int_t i3=0;i3<nPrim;i3++)\r
+ {\r
+ if(i3==i1||i3==i2)continue;\r
+ aftsTrack=anEvent->GetTrack(i3);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi3=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi())));\r
+ for(Int_t i4=0;i4<nPrim;i4++)\r
+ {\r
+ if(i4==i1||i4==i2||i4==i3)continue;\r
+ aftsTrack=anEvent->GetTrack(i4);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi4=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi())));\r
+ if(nPrim>=4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; // to be improved (replace eventually this if statement with if(nPrim==4))\r
+ // 4-p correlations using particle weights:\r
+ if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(10.5,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); \r
+ // extra correlations: \r
+ // 2-p extra correlations (do not appear if particle weights are not used):\r
+ // ...\r
+ // 3-p extra correlations (do not appear if particle weights are not used):\r
+ // ...\r
+ // 4-p extra correlations (do not appear if particle weights are not used):\r
+ // ...\r
+ } // end of for(Int_t i4=0;i4<nPrim;i4++) \r
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ } // end of if(nPrim>=4)\r
+\r
+ cout<<endl; \r
+\r
+} // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowExtraCorrelations()\r
+{\r
+ // Cross-check results for extra multiparticle correlations needed for int. flow \r
+ // which appear only when particle weights are used: results from Q-vectors vs results from nested loops.\r
+\r
+ cout<<endl;\r
+ cout<<endl;\r
+ cout<<" ***********************************************"<<endl;\r
+ cout<<" **** cross-checking the extra correlations ****"<<endl;\r
+ cout<<" **** for integrated flow ****"<<endl;\r
+ cout<<" ***********************************************"<<endl;\r
+ cout<<endl;\r
+ cout<<endl;\r
+ \r
+ for(Int_t eci=1;eci<=2;eci++) // to be improved (increased eciMax eventually when I calculate 6th and 8th)\r
+ {\r
+ if(strcmp((fIntFlowExtraCorrelationsPro->GetXaxis())->GetBinLabel(eci), "") == 0) continue;\r
+ cout<<(fIntFlowExtraCorrelationsPro->GetXaxis())->GetBinLabel(eci)<<":"<<endl;\r
+ cout<<"from Q-vectors = "<<fIntFlowExtraCorrelationsPro->GetBinContent(eci)<<endl;\r
+ cout<<"from nested loops = "<<fIntFlowExtraDirectCorrelations->GetBinContent(eci)<<endl;\r
+ cout<<endl;\r
+ }\r
+\r
+} // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowExtraCorrelations()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoops(AliFlowEventSimple* anEvent)\r
+{\r
+ // Evaluate with nested loops correction terms for non-uniform acceptance relevant for NONAME integrated flow (to be improved (name)).\r
+ //\r
+ // Remark: Both sin and cos correction terms are calculated in this method. Sin terms are stored in fIntFlowDirectCorrectionTermsForNUA[0],\r
+ // and cos terms in fIntFlowDirectCorrectionTermsForNUA[1]. Binning of fIntFlowDirectCorrectionTermsForNUA[sc] is organized as follows \r
+ // (sc stands for either sin or cos):\r
+ \r
+ // 1st bin: <<sc(n*(phi1))>> \r
+ // 2nd bin: <<sc(n*(phi1+phi2))>> \r
+ // 3rd bin: <<sc(n*(phi1-phi2-phi3))>>\r
+ // ...\r
+ \r
+ Int_t nPrim = anEvent->NumberOfTracks(); \r
+ AliFlowTrackSimple *aftsTrack = NULL;\r
+ Double_t phi1=0., phi2=0., phi3=0.;\r
+ Int_t n = fHarmonic; \r
+ Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?)\r
+ Double_t dMult = (*fSMpk)(0,0);\r
+ cout<<endl;\r
+ cout<<"Correction terms for non-uniform acceptance: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl;\r
+ if(dMult<1)\r
+ {\r
+ cout<<"... skipping this event (multiplicity too low) ..."<<endl;\r
+ } else if (dMult>fMaxAllowedMultiplicity)\r
+ {\r
+ cout<<"... skipping this event (multiplicity too high) ..."<<endl;\r
+ } else \r
+ { \r
+ cout<<"... evaluating nested loops (without using particle weights)..."<<endl;\r
+ }\r
+ \r
+ if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity)\r
+ {\r
+ // 1-particle correction terms for non-uniform acceptance: \r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi1=aftsTrack->Phi();\r
+ if(nPrim==1) cout<<i1<<"\r"<<flush;\r
+ // sin terms:\r
+ fIntFlowDirectCorrectionTermsForNUA[0]->Fill(0.5,sin(n*phi1),1.); // <sin(n*phi1)> \r
+ // cos terms:\r
+ fIntFlowDirectCorrectionTermsForNUA[1]->Fill(0.5,cos(n*phi1),1.); // <cos(n*phi1)>\r
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ } // end of if(nPrim>=1) \r
+ \r
+ if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity)\r
+ {\r
+ // 2-particle correction terms for non-uniform acceptance: \r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi1=aftsTrack->Phi(); \r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1)continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi();\r
+ if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush;\r
+ // sin terms:\r
+ fIntFlowDirectCorrectionTermsForNUA[0]->Fill(1.5,sin(n*(phi1+phi2)),1.); // <<sin(n*(phi1+phi2))>>\r
+ // cos terms:\r
+ fIntFlowDirectCorrectionTermsForNUA[1]->Fill(1.5,cos(n*(phi1+phi2)),1.); // <<cos(n*(phi1+phi2))>>\r
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ } // end of if(nPrim>=2)\r
+\r
+ if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity)\r
+ {\r
+ // 3-particle correction terms for non-uniform acceptance: \r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi1=aftsTrack->Phi();\r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1)continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi();\r
+ for(Int_t i3=0;i3<nPrim;i3++)\r
+ {\r
+ if(i3==i1||i3==i2)continue;\r
+ aftsTrack=anEvent->GetTrack(i3);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi3=aftsTrack->Phi();\r
+ if(nPrim>=3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; // to be improved (eventually I will change this if statement)\r
+ // sin terms:\r
+ fIntFlowDirectCorrectionTermsForNUA[0]->Fill(2.5,sin(n*(phi1-phi2-phi3)),1.); // <<sin(n*(phi1-phi2-phi3))>>\r
+ // cos terms:\r
+ fIntFlowDirectCorrectionTermsForNUA[1]->Fill(2.5,cos(n*(phi1-phi2-phi3)),1.); // <<cos(n*(phi1-phi2-phi3))>>\r
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ } // end of if(nPrim>=3)\r
+\r
+ cout<<endl;\r
+}\r
+//================================================================================================================================\r
+void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta)\r
+{\r
+ // Evaluate reduced correlations with nested loops without using the particle weights.\r
+ \r
+ // Remark 1: Reduced correlations are evaluated in pt bin number fCrossCheckInPtBinNo and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs.\r
+ // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrelations[t][pe][ci], where indices runs as follows:\r
+ // [0=RP,1=POI][0=Pt,1=Eta][0=<2'>,1=<4'>,2=<6'>,3=<8'>] \r
+ // Remark 3: <2'> = <cos(n*(psi1-phi2))>\r
+ // <4'> = <cos(n*(psi1+phi2-phi3-phi4))>\r
+ // ...\r
+ \r
+ Int_t typeFlag = -1;\r
+ Int_t ptEtaFlag = -1;\r
+ if(type == "RP")\r
+ {\r
+ typeFlag = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ typeFlag = 1;\r
+ } \r
+ if(ptOrEta == "Pt")\r
+ {\r
+ ptEtaFlag = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ ptEtaFlag = 1;\r
+ } \r
+ // shortcuts:\r
+ Int_t t = typeFlag;\r
+ Int_t pe = ptEtaFlag;\r
+ \r
+ Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth};\r
+ Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth};\r
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
+ \r
+ Int_t nPrim = anEvent->NumberOfTracks(); \r
+ AliFlowTrackSimple *aftsTrack = NULL;\r
+ \r
+ Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.;\r
+ \r
+ Int_t n = fHarmonic; \r
+ \r
+ // 2'-particle correlations:\r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
+ if(ptOrEta == "Pt")\r
+ { \r
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;\r
+ } else if (ptOrEta == "Eta")\r
+ {\r
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; \r
+ }\r
+ psi1=aftsTrack->Phi(); \r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1)continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ // RP condition (!(first) particle in the correlator must be RP):\r
+ if(!(aftsTrack->InRPSelection()))continue;\r
+ phi2=aftsTrack->Phi(); \r
+ // 2'-particle correlations: \r
+ fDiffFlowDirectCorrelations[t][pe][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(1.*n*(psi1-phi2)),1.); // <cos(n*(psi1-phi2)) \r
+ }//end of for(Int_t i2=0;i2<nPrim;i2++)\r
+ }//end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ \r
+ /*\r
+ \r
+ // 3'-particle correlations:\r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
+ if(ptOrEta == "Pt")\r
+ { \r
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;\r
+ } else if (ptOrEta == "Eta")\r
+ {\r
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; \r
+ }\r
+ psi1=aftsTrack->Phi();\r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1)continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ // RP condition (!(first) particle in the correlator must be RP):\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi();\r
+ for(Int_t i3=0;i3<nPrim;i3++)\r
+ {\r
+ if(i3==i1||i3==i2)continue;\r
+ aftsTrack=anEvent->GetTrack(i3);\r
+ // RP condition (!(first) particle in the correlator must be RP):\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi3=aftsTrack->Phi();\r
+ // to be improved : where to store it? ->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(2.*phi1-phi2-phi3)),1.); // <w1 w2 w3 cos(n(2psi1-phi2-phi3))> \r
+ }//end of for(Int_t i3=0;i3<nPrim;i3++) \r
+ }//end of for(Int_t i2=0;i2<nPrim;i2++) \r
+ }//end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ \r
+ */\r
+ \r
+ // 4'-particle correlations:\r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
+ if(ptOrEta == "Pt")\r
+ { \r
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;\r
+ } else if (ptOrEta == "Eta")\r
+ {\r
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; \r
+ }\r
+ psi1=aftsTrack->Phi();\r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1) continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ // RP condition (!(first) particle in the correlator must be RP): \r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi();\r
+ for(Int_t i3=0;i3<nPrim;i3++)\r
+ { \r
+ if(i3==i1||i3==i2) continue;\r
+ aftsTrack=anEvent->GetTrack(i3);\r
+ // RP condition (!(first) particle in the correlator must be RP):\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi3=aftsTrack->Phi();\r
+ for(Int_t i4=0;i4<nPrim;i4++)\r
+ {\r
+ if(i4==i1||i4==i2||i4==i3) continue;\r
+ aftsTrack=anEvent->GetTrack(i4);\r
+ // RP condition (!(first) particle in the correlator must be RP):\r
+ if(!(aftsTrack->InRPSelection())) continue; \r
+ phi4=aftsTrack->Phi();\r
+ // 4'-particle correlations:\r
+ fDiffFlowDirectCorrelations[t][pe][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3-phi4)),1.); // <cos(n(psi1+phi2-phi3-phi4))> \r
+ }//end of for(Int_t i4=0;i4<nPrim;i4++)\r
+ }//end of for(Int_t i3=0;i3<nPrim;i3++)\r
+ }//end of for(Int_t i2=0;i2<nPrim;i2++) \r
+ }//end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ \r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrelations(TString type, TString ptOrEta)\r
+{\r
+ // Compare correlations needed for diff. flow calculated with nested loops and those calculated from Q-vectors\r
+ \r
+ Int_t typeFlag = -1;\r
+ Int_t ptEtaFlag = -1;\r
+ if(type == "RP")\r
+ {\r
+ typeFlag = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ typeFlag = 1;\r
+ } \r
+ if(ptOrEta == "Pt")\r
+ {\r
+ ptEtaFlag = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ ptEtaFlag = 1;\r
+ } \r
+ // shortcuts:\r
+ Int_t t = typeFlag;\r
+ Int_t pe = ptEtaFlag;\r
+ \r
+ TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) \r
+ TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) \r
+ TString reducedCorrelations[4] = {"<<cos(n(psi1-phi2))>>","<<cos(n(psi1+phi2-phi3-phi4))>>","",""}; // to be improved (access this from pro or hist)\r
+ Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth};\r
+ Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth};\r
+ \r
+ Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo};\r
+ \r
+\r
+ cout<<endl;\r
+ cout<<" *****************************************"<<endl;\r
+ cout<<" **** cross-checking the correlations ****"<<endl;\r
+ cout<<" **** for differential flow ****"<<endl;\r
+ cout<<" **** "<<rpORpoiString[t]<<" ****"<<endl;\r
+ cout<<" *****************************************"<<endl; \r
+ cout<<endl;\r
+ cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl;\r
+ cout<<endl;\r
+ \r
+ for(Int_t rci=0;rci<2;rci++) // to be improved (calculate 6th and 8th order)\r
+ {\r
+ cout<<" "<<reducedCorrelations[rci].Data()<<":"<<endl;\r
+ cout<<" from Q-vectors = "<<fDiffFlowCorrelationsPro[t][pe][rci]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl;\r
+ cout<<" from nested loops = "<<fDiffFlowDirectCorrelations[t][pe][rci]->GetBinContent(1)<<endl;\r
+ cout<<endl; \r
+ } // end of for(Int_t rci=0;rci<4;rci++)\r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrelations(TString type, TString ptOrEta)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta)\r
+{\r
+ // Evaluate reduced correlations with nested loops without using the particle weights.\r
+ \r
+ // Remark 1: Reduced correlations are evaluated in pt bin number fCrossCheckInPtBinNo and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs.\r
+ // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrelations[t][pe][ci], where indices runs as follows:\r
+ // [0=RP,1=POI][0=Pt,1=Eta][0=<2'>,1=<4'>,2=<6'>,3=<8'>] \r
+ // Remark 3: <2'> = <w2 cos(n*(psi1-phi2))>\r
+ // <4'> = <w2 w3 w4 cos(n*(psi1+phi2-phi3-phi4))>\r
+ // ...\r
+ \r
+ Int_t typeFlag = -1;\r
+ Int_t ptEtaFlag = -1;\r
+ if(type == "RP")\r
+ {\r
+ typeFlag = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ typeFlag = 1;\r
+ } \r
+ if(ptOrEta == "Pt")\r
+ {\r
+ ptEtaFlag = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ ptEtaFlag = 1;\r
+ } \r
+ // shortcuts:\r
+ Int_t t = typeFlag;\r
+ Int_t pe = ptEtaFlag;\r
+ \r
+ Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth};\r
+ Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth};\r
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
+ \r
+ Int_t nPrim = anEvent->NumberOfTracks(); \r
+ AliFlowTrackSimple *aftsTrack = NULL;\r
+ \r
+ Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.;\r
+ Double_t wPhi2=1., wPhi3=1., wPhi4=1.;// wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.;\r
+ \r
+ Int_t n = fHarmonic; \r
+ \r
+ // 2'-particle correlations:\r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
+ if(ptOrEta == "Pt")\r
+ { \r
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue;\r
+ } else if (ptOrEta == "Eta")\r
+ {\r
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue; \r
+ }\r
+ psi1=aftsTrack->Phi(); \r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1) continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ // RP condition (!(first) particle in the correlator must be RP):\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi(); \r
+ if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));\r
+ // 2'-particle correlations: \r
+ fDiffFlowDirectCorrelations[t][pe][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(1.*n*(psi1-phi2)),wPhi2); // <w2 cos(n*(psi1-phi2)) \r
+ }//end of for(Int_t i2=0;i2<nPrim;i2++)\r
+ }//end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ \r
+ // 4'-particle correlations:\r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
+ if(ptOrEta == "Pt")\r
+ { \r
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue;\r
+ } else if (ptOrEta == "Eta")\r
+ {\r
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue; \r
+ }\r
+ psi1=aftsTrack->Phi();\r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1) continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ // RP condition (!(first) particle in the correlator must be RP): \r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));\r
+ for(Int_t i3=0;i3<nPrim;i3++)\r
+ { \r
+ if(i3==i1||i3==i2) continue;\r
+ aftsTrack=anEvent->GetTrack(i3);\r
+ // RP condition (!(first) particle in the correlator must be RP):\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi3=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi())));\r
+ for(Int_t i4=0;i4<nPrim;i4++)\r
+ {\r
+ if(i4==i1||i4==i2||i4==i3) continue;\r
+ aftsTrack=anEvent->GetTrack(i4);\r
+ // RP condition (!(first) particle in the correlator must be RP):\r
+ if(!(aftsTrack->InRPSelection())) continue; \r
+ phi4=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi())));\r
+ // 4'-particle correlations <w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))>:\r
+ fDiffFlowDirectCorrelations[t][pe][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3-phi4)),wPhi2*wPhi3*wPhi4); \r
+ }//end of for(Int_t i4=0;i4<nPrim;i4++)\r
+ }//end of for(Int_t i3=0;i3<nPrim;i3++)\r
+ }//end of for(Int_t i2=0;i2<nPrim;i2++) \r
+ }//end of for(Int_t i1=0;i1<nPrim;i1++) \r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+ \r
+void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta)\r
+{\r
+ // Evaluate with nested loops correction terms for non-uniform acceptance (both sin and cos terms) relevant for differential flow.\r
+ \r
+ // Remark 1: Reduced correction terms for non-uniform acceptance are evaluated in pt bin number fCrossCheckInPtBinNo \r
+ // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs.\r
+ // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrections[t][pe][sc][cti], where first three indices runs as: \r
+ // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms], whilst the cti (correction term index) runs as follows: \r
+ // cti: \r
+ // 0: <<sc n(psi1)>>\r
+ // 1: <<sc n(psi1+phi2)>> \r
+ // 2: <<sc n(psi1+phi2-phi3)>>\r
+ // 3: <<sc n(psi1-phi2-phi3)>>\r
+ // 4:\r
+ // 5:\r
+ // 6:\r
+ \r
+ Int_t typeFlag = -1;\r
+ Int_t ptEtaFlag = -1;\r
+ if(type == "RP")\r
+ {\r
+ typeFlag = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ typeFlag = 1;\r
+ } \r
+ if(ptOrEta == "Pt")\r
+ {\r
+ ptEtaFlag = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ ptEtaFlag = 1;\r
+ } \r
+ // shortcuts:\r
+ Int_t t = typeFlag;\r
+ Int_t pe = ptEtaFlag;\r
+ \r
+ Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth};\r
+ Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth};\r
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
+ \r
+ Int_t nPrim = anEvent->NumberOfTracks(); \r
+ AliFlowTrackSimple *aftsTrack = NULL;\r
+ \r
+ Double_t psi1=0., phi2=0., phi3=0.;// phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.;\r
+ \r
+ Int_t n = fHarmonic; \r
+ \r
+ // 1-particle correction terms:\r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
+ if(ptOrEta == "Pt")\r
+ { \r
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue;\r
+ } else if (ptOrEta == "Eta")\r
+ {\r
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue; \r
+ }\r
+ psi1=aftsTrack->Phi(); \r
+ // sin terms: \r
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*psi1),1.); // <<sin(n*(psi1))>> \r
+ // cos terms: \r
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*psi1),1.); // <<cos(n*(psi1))>> \r
+ }//end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ \r
+ // 2-particle correction terms:\r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
+ if(ptOrEta == "Pt")\r
+ { \r
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue;\r
+ } else if (ptOrEta == "Eta")\r
+ {\r
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue; \r
+ }\r
+ psi1=aftsTrack->Phi(); \r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1) continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ // RP condition (!(first) particle in the correlator must be RP):\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi(); \r
+ // sin terms: \r
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2)),1.); // <<sin(n*(psi1+phi2))>> \r
+ // cos terms: \r
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2)),1.); // <<cos(n*(psi1+phi2))>> \r
+ }//end of for(Int_t i2=0;i2<nPrim;i2++)\r
+ }//end of for(Int_t i1=0;i1<nPrim;i1++) \r
+ \r
+ // 3-particle correction terms:\r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
+ if(ptOrEta == "Pt")\r
+ { \r
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;\r
+ } else if (ptOrEta == "Eta")\r
+ {\r
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; \r
+ }\r
+ psi1=aftsTrack->Phi();\r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1) continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ // RP condition (!(first) particle in the correlator must be RP):\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi();\r
+ for(Int_t i3=0;i3<nPrim;i3++)\r
+ {\r
+ if(i3==i1||i3==i2) continue;\r
+ aftsTrack=anEvent->GetTrack(i3);\r
+ // RP condition (!(first) particle in the correlator must be RP):\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi3=aftsTrack->Phi();\r
+ // sin terms: \r
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2-phi3)),1.); // <<sin(n*(psi1+phi2-phi3))>> \r
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1-phi2-phi3)),1.); // <<sin(n*(psi1-phi2-phi3))>> \r
+ // cos terms: \r
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3)),1.); // <<cos(n*(psi1+phi2-phi3))>> \r
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-phi2-phi3)),1.); // <<cos(n*(psi1-phi2-phi3))>> \r
+ }//end of for(Int_t i3=0;i3<nPrim;i3++) \r
+ }//end of for(Int_t i2=0;i2<nPrim;i2++) \r
+ }//end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrectionTermsForNUA(TString type, TString ptOrEta)\r
+{\r
+ // Compare corrections temrs for non-uniform acceptance needed for diff. flow calculated with nested loops and those calculated from Q-vectors\r
+ \r
+ Int_t typeFlag = -1;\r
+ Int_t ptEtaFlag = -1;\r
+ if(type == "RP")\r
+ {\r
+ typeFlag = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ typeFlag = 1;\r
+ } \r
+ if(ptOrEta == "Pt")\r
+ {\r
+ ptEtaFlag = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ ptEtaFlag = 1;\r
+ } \r
+ // shortcuts:\r
+ Int_t t = typeFlag;\r
+ Int_t pe = ptEtaFlag;\r
+ \r
+ TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) \r
+ TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) \r
+ //TString sinCosFlag[2] = {"sin","cos"}; // to be improved (eventually promote to data member)\r
+ TString reducedCorrectionSinTerms[4] = {"<<sin(n(psi1))>>","<<sin(n(psi1+phi2))>>","<<sin(n*(psi1+phi2-phi3))>>","<<sin(n*(psi1-phi2-phi3))>>"}; // to be improved (access this from pro or hist)\r
+ TString reducedCorrectionCosTerms[4] = {"<<cos(n(psi1))>>","<<cos(n(psi1+phi2))>>","<<cos(n*(psi1+phi2-phi3))>>","<<cos(n*(psi1-phi2-phi3))>>"}; // to be improved (access this from pro or hist)\r
+ Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth};\r
+ Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth};\r
+ \r
+ Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo};\r
+ \r
+ cout<<endl;\r
+ cout<<" ******************************************"<<endl;\r
+ cout<<" **** cross-checking the correction ****"<<endl;\r
+ cout<<" **** terms for non-uniform acceptance ****"<<endl;\r
+ cout<<" **** for differential flow ****"<<endl;\r
+ cout<<" **** "<<rpORpoiString[t]<<" ****"<<endl;\r
+ cout<<" ******************************************"<<endl; \r
+ cout<<endl;\r
+ cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl;\r
+ cout<<endl;\r
+ \r
+ for(Int_t cti=0;cti<4;cti++) // correction term index\r
+ {\r
+ for(Int_t sc=0;sc<2;sc++) // sin or cos terms\r
+ {\r
+ if(sc==0) // to be improved (this can be implemented better)\r
+ { \r
+ cout<<" "<<reducedCorrectionSinTerms[cti].Data()<<":"<<endl;\r
+ } else\r
+ {\r
+ cout<<" "<<reducedCorrectionCosTerms[cti].Data()<<":"<<endl; \r
+ }\r
+ cout<<" from Q-vectors = "<<fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl;\r
+ cout<<" from nested loops = "<<fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]->GetBinContent(1)<<endl;\r
+ cout<<endl; \r
+ } \r
+ } // end of for(Int_t rci=0;rci<4;rci++)\r
+\r
+} // end of void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrectionTermsForNUA(TString type, TString ptOrEta)\r
+\r
+\r
//================================================================================================================================
-
-void AliFlowAnalysisWithQCumulants::CompareDirectAndQCorrelationsForIntegratedFlow(Bool_t useWeights)
-{
- // compare correlations needed for int. flow calculated with nested loops and those calculated from Q-vectors
-
- cout<<endl;
- cout<<" *************************************"<<endl;
- cout<<" **** cross-checking the formulas ****"<<endl;
- cout<<" **** for integrated flow ****"<<endl;
- cout<<" *************************************"<<endl;
- cout<<endl;
-
- if(!(useWeights))
- {
- cout<<"<2>_{1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(1)<<endl;
- cout<<"<2>_{1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(1)<<endl;
- cout<<endl;
- cout<<"<2>_{2n,2n} from Q-vectors = "<<fQCorrelations->GetBinContent(2)<<endl;
- cout<<"<2>_{2n,2n} from nested loops = "<<fDirectCorrelations->GetBinContent(2)<<endl;
- cout<<endl;
- cout<<"<2>_{3n,3n} from Q-vectors = "<<fQCorrelations->GetBinContent(3)<<endl;
- cout<<"<2>_{3n,3n} from nested loops = "<<fDirectCorrelations->GetBinContent(3)<<endl;
- cout<<endl;
- cout<<"<2>_{4n,4n} from Q-vectors = "<<fQCorrelations->GetBinContent(4)<<endl;
- cout<<"<2>_{4n,4n} from nested loops = "<<fDirectCorrelations->GetBinContent(4)<<endl;
- cout<<endl;
- cout<<"<3>_{2n|1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(6)<<endl;
- cout<<"<3>_{2n|1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(6)<<endl;
- cout<<endl;
- cout<<"<3>_{3n|2n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(7)<<endl;
- cout<<"<3>_{3n|2n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(7)<<endl;
- cout<<endl;
- cout<<"<3>_{4n,2n,2n} from Q-vectors = "<<fQCorrelations->GetBinContent(8)<<endl;
- cout<<"<3>_{4n,2n,2n} from nested loops = "<<fDirectCorrelations->GetBinContent(8)<<endl;
- cout<<endl;
- cout<<"<3>_{4n,3n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(9)<<endl;
- cout<<"<3>_{4n,3n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(9)<<endl;
- cout<<endl;
- cout<<"<4>_{1n,1n|1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(11)<<endl;
- cout<<"<4>_{1n,1n|1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(11)<<endl;
- cout<<endl;
- cout<<"<4>_{2n,1n|2n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(12)<<endl;
- cout<<"<4>_{2n,1n|2n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(12)<<endl;
- cout<<endl;
- cout<<"<4>_{2n,2n|2n,2n} from Q-vectors = "<<fQCorrelations->GetBinContent(13)<<endl;
- cout<<"<4>_{2n,2n|2n,2n} from nested loops = "<<fDirectCorrelations->GetBinContent(13)<<endl;
- cout<<endl;
- cout<<"<4>_{3n|1n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(14)<<endl;
- cout<<"<4>_{3n|1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(14)<<endl;
- cout<<endl;
- cout<<"<4>_{3n,1n|3n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(15)<<endl;
- cout<<"<4>_{3n,1n|3n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(15)<<endl;
- cout<<endl;
- cout<<"<4>_{3n,1n|2n,2n} from Q-vectors = "<<fQCorrelations->GetBinContent(16)<<endl;
- cout<<"<4>_{3n,1n|2n,2n} from nested loops = "<<fDirectCorrelations->GetBinContent(16)<<endl;
- cout<<endl;
- cout<<"<4>_{4n|2n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(17)<<endl;
- cout<<"<4>_{4n|2n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(17)<<endl;
- cout<<endl;
- cout<<"<5>_{2n,1n|1n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(19)<<endl;
- cout<<"<5>_{2n,1n|1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(19)<<endl;
- cout<<endl;
- cout<<"<5>_{2n,2n|2n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(20)<<endl;
- cout<<"<5>_{2n,2n|2n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(20)<<endl;
- cout<<endl;
- cout<<"<5>_{3n,1n|2n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(21)<<endl;
- cout<<"<5>_{3n,1n|2n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(21)<<endl;
- cout<<endl;
- cout<<"<5>_{4n|1n,1n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(22)<<endl;
- cout<<"<5>_{4n|1n,1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(22)<<endl;
- cout<<endl;
- cout<<"<6>_{1n,1n,1n|1n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(24)<<endl;
- cout<<"<6>_{1n,1n,1n|1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(24)<<endl;
- cout<<endl;
- cout<<"<6>_{2n,1n,1n|2n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(25)<<endl;
- cout<<"<6>_{2n,1n,1n|2n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(25)<<endl;
- cout<<endl;
- cout<<"<6>_{2n,2n|1n,1n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(26)<<endl;
- cout<<"<6>_{2n,2n|1n,1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(26)<<endl;
- cout<<endl;
- cout<<"<6>_{3n,1n|1n,1n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(27)<<endl;
- cout<<"<6>_{3n,1n|1n,1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(27)<<endl;
- cout<<endl;
- cout<<"<7>_{2n,1n,1n|1n,1n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(29)<<endl;
- cout<<"<7>_{2n,1n,1n|1n,1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(29)<<endl;
- cout<<endl;
- cout<<"<8>_{1n,1n,1n,1n|1n,1n,1n,1n} from Q-vectors = "<<fQCorrelations->GetBinContent(31)<<endl;
- cout<<"<8>_{1n,1n,1n,1n|1n,1n,1n,1n} from nested loops = "<<fDirectCorrelations->GetBinContent(31)<<endl;
- cout<<endl;
- cout<<"****************************************************"<<endl;
- cout<<"****************************************************"<<endl;
- cout<<endl;
- cout<<"<cos(n*phi1)> from Q-vectors = "<<fQCorrectionsCos->GetBinContent(1)<<endl;
- cout<<"<cos(n*phi1)> from nested loops = "<<fDirectCorrectionsCos->GetBinContent(1)<<endl;
- cout<<endl;
- cout<<"<sin(n*phi1)> from Q-vectors = "<<fQCorrectionsSin->GetBinContent(1)<<endl;
- cout<<"<sin(n*phi1)> from nested loops = "<<fDirectCorrectionsSin->GetBinContent(1)<<endl;
- cout<<endl;
- cout<<"<cos(n*(phi1+phi2))> from Q-vectors = "<<fQCorrectionsCos->GetBinContent(2)<<endl;
- cout<<"<cos(n*(phi1+phi2))> from nested loops = "<<fDirectCorrectionsCos->GetBinContent(2)<<endl;
- cout<<endl;
- cout<<"<sin(n*(phi1+phi2))> from Q-vectors = "<<fQCorrectionsSin->GetBinContent(2)<<endl;
- cout<<"<sin(n*(phi1+phi2))> from nested loops = "<<fDirectCorrectionsSin->GetBinContent(2)<<endl;
- cout<<endl;
- cout<<"<cos(n*(phi1-phi2-phi3))> from Q-vectors = "<<fQCorrectionsCos->GetBinContent(3)<<endl;
- cout<<"<cos(n*(phi1-phi2-phi3))> from nested loops = "<<fDirectCorrectionsCos->GetBinContent(3)<<endl;
- cout<<endl;
- cout<<"<sin(n*(phi1-phi2-phi3))> from Q-vectors = "<<fQCorrectionsSin->GetBinContent(3)<<endl;
- cout<<"<sin(n*(phi1-phi2-phi3))> from nested loops = "<<fDirectCorrectionsSin->GetBinContent(3)<<endl;
- cout<<endl;
- }
-
- if(useWeights)
- {
- //.........................................................................................
- cout<<"<w1 w2 cos(n*(phi1-phi2))> from Q-vectors = "<<fQCorrelationsW->GetBinContent(1)<<endl;
- cout<<"<<w1 w2 cos(n*(phi1-phi2))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(1)<<endl;
- cout<<endl;
- cout<<"<w1^2 w2^2 cos(2n*(phi1-phi2))> from Q-vectors = "<<fQCorrelationsW->GetBinContent(2)<<endl;
- cout<<"<w1^2 w2^2 cos(2n*(phi1-phi2))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(2)<<endl;
- cout<<endl;
- cout<<"<w1^3 w2^3 cos(3n*(phi1-phi2))> from Q-vectors = "<<fQCorrelationsW->GetBinContent(3)<<endl;
- cout<<"<w1^3 w2^3 cos(3n*(phi1-phi2))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(3)<<endl;
- cout<<endl;
- cout<<"<w1^4 w2^4 cos(4n*(phi1-phi2))> from Q-vectors = "<<fQCorrelationsW->GetBinContent(4)<<endl;
- cout<<"<w1^4 w2^4 cos(4n*(phi1-phi2))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(4)<<endl;
- cout<<endl;
- cout<<"<w1^3 w2 cos(n*(phi1-phi2))> from Q-vectors = "<<fQCorrelationsW->GetBinContent(5)<<endl;
- cout<<"<w1^3 w2 cos(n*(phi1-phi2))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(5)<<endl;
- cout<<endl;
- cout<<"<w1 w2 w3^2 cos(n*(phi1-phi2))> from Q-vectors = "<<fQCorrelationsW->GetBinContent(6)<<endl;
- cout<<"<w1 w2 w3^2 cos(n*(phi1-phi2))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(6)<<endl;
- cout<<endl;
- cout<<"<w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> from Q-vectors = "<<fQCorrelationsW->GetBinContent(21)<<endl;
- cout<<"<w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(21)<<endl;
- cout<<endl;
- cout<<"<w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> from Q-vectors = "<<fQCorrelationsW->GetBinContent(41)<<endl;
- cout<<"<w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> from nested loops = "<<fDirectCorrelationsW->GetBinContent(41)<<endl;
- cout<<endl;
- //.........................................................................................
- }
+\r
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights()\r
+{\r
+ // Calculate corrections using particle weights for non-uniform acceptance of the detector for no-name integrated flow (cos terms).\r
+ \r
+ // **********************************************************************\r
+ // **** weighted corrections for non-uniform acceptance (cos terms): ****\r
+ // **********************************************************************\r
-} // end of AliFlowAnalysisWithQCumulants::CompareDirectAndQCorrelationsForIntegratedFlow(Bool_t useWeights)
-
-
+ // Remark 1: When particle weights are used the binning of fIntFlowCorrectionTermsForNUAPro[1] is organized as follows:\r
+ //
+ // 1st bin: <<w1 cos(n*(phi1))>> = cosP1nW1\r
+ // 2nd bin: <<w1 w2 cos(n*(phi1+phi2))>> = cosP1nP1nW1W1\r
+ // 3rd bin: <<w1 w2 w3 cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1nW1W1W1 \r
+ // ...\r
+
+ // multiplicity (number of particles used to determine the reaction plane)\r
+ Double_t dMult = (*fSMpk)(0,0);\r
+ \r
+ // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
+ Double_t dReQ1n1k = (*fReQ)(0,1);\r
+ Double_t dReQ2n2k = (*fReQ)(1,2);\r
+ //Double_t dReQ3n3k = (*fReQ)(2,3);\r
+ //Double_t dReQ4n4k = (*fReQ)(3,4);\r
+ Double_t dReQ1n3k = (*fReQ)(0,3);\r
+ Double_t dImQ1n1k = (*fImQ)(0,1);\r
+ Double_t dImQ2n2k = (*fImQ)(1,2);\r
+ //Double_t dImQ3n3k = (*fImQ)(2,3);\r
+ //Double_t dImQ4n4k = (*fImQ)(3,4);\r
+ //Double_t dImQ1n3k = (*fImQ)(0,3);\r
+\r
+ // dMs are variables introduced in order to simplify some Eqs. bellow:\r
+ //..............................................................................................\r
+ Double_t dM11 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j\r
+ Double_t dM111 = (*fSMpk)(2,1)-3.*(*fSMpk)(0,2)*(*fSMpk)(0,1)
+ + 2.*(*fSMpk)(0,3); // dM111 = sum_{i,j,k=1,i!=j!=k}^M w_i w_j w_k\r
+ //..............................................................................................\r
+ \r // 1-particle:\r
+ Double_t cosP1nW1 = 0.; // <<w1 cos(n*(phi1))>>\r
+ \r
+ if(dMult>0 && (*fSMpk)(0,1) !=0.)\r
+ {\r
+ cosP1nW1 = dReQ1n1k/(*fSMpk)(0,1); \r
+ \r
+ // average weighted 1-particle correction (cos terms) for non-uniform acceptance for single event:\r
+ fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(1,cosP1nW1);\r
+ \r
+ // final average weighted 1-particle correction (cos terms) for non-uniform acceptance for all events:\r
+ fIntFlowCorrectionTermsForNUAPro[1]->Fill(0.5,cosP1nW1,(*fSMpk)(0,1)); \r
+ } \r
+ \r
+ // 2-particle:\r
+ Double_t cosP1nP1nW1W1 = 0.; // <<w1 w2 cos(n*(phi1+phi2))>>\r
+ \r
+ if(dMult>1 && dM11 !=0.)\r
+ {\r
+ cosP1nP1nW1W1 = (pow(dReQ1n1k,2)-pow(dImQ1n1k,2)-dReQ2n2k)/dM11; \r
+ \r
+ // average weighted 2-particle correction (cos terms) for non-uniform acceptance for single event:\r
+ fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(2,cosP1nP1nW1W1);\r
+ \r
+ // final average weighted 2-particle correction (cos terms) for non-uniform acceptance for all events:\r
+ fIntFlowCorrectionTermsForNUAPro[1]->Fill(1.5,cosP1nP1nW1W1,dM11); \r
+ } \r
+ \r
+ // 3-particle:\r
+ Double_t cosP1nM1nM1nW1W1W1 = 0.; // <<w1 w2 w3 cos(n*(phi1-phi2-phi3))>>\r
+ \r
+ if(dMult>2 && dM111 !=0.)\r
+ {\r
+ cosP1nM1nM1nW1W1W1 = (dReQ1n1k*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2))
+ - dReQ1n1k*dReQ2n2k-dImQ1n1k*dImQ2n2k
+ - 2.*((*fSMpk)(0,2))*dReQ1n1k
+ + 2.*dReQ1n3k) \r
+ / dM111; \r
+ \r
+ // average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for single event:\r
+ fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(3,cosP1nM1nM1nW1W1W1);\r
+ \r
+ // final average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for all events:\r
+ fIntFlowCorrectionTermsForNUAPro[1]->Fill(2.5,cosP1nM1nM1nW1W1W1,dM111); \r
+ } \r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights()\r
+\r
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights()\r
+{\r
+ // calculate corrections using particle weights for non-uniform acceptance of the detector for no-name integrated flow (sin terms)\r
+ \r
+ // **********************************************************************\r
+ // **** weighted corrections for non-uniform acceptance (sin terms): ****\r
+ // **********************************************************************\r
+
+ // Remark 1: When particle weights are used the binning of fIntFlowCorrectionTermsForNUAPro[0] is organized as follows:\r
+ //
+ // 1st bin: <<w1 sin(n*(phi1))>> = sinP1nW1\r
+ // 2nd bin: <<w1 w2 sin(n*(phi1+phi2))>> = sinP1nP1nW1W1\r
+ // 3rd bin: <<w1 w2 w3 sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1nW1W1W1 \r
+ // ...\r
+
+ // multiplicity (number of particles used to determine the reaction plane)\r
+ Double_t dMult = (*fSMpk)(0,0);\r
+ \r
+ // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
+ Double_t dReQ1n1k = (*fReQ)(0,1);\r
+ Double_t dReQ2n2k = (*fReQ)(1,2);\r
+ //Double_t dReQ3n3k = (*fReQ)(2,3);\r
+ //Double_t dReQ4n4k = (*fReQ)(3,4);\r
+ //Double_t dReQ1n3k = (*fReQ)(0,3);\r
+ Double_t dImQ1n1k = (*fImQ)(0,1);\r
+ Double_t dImQ2n2k = (*fImQ)(1,2);\r
+ //Double_t dImQ3n3k = (*fImQ)(2,3);\r
+ //Double_t dImQ4n4k = (*fImQ)(3,4);\r
+ Double_t dImQ1n3k = (*fImQ)(0,3);\r
+\r
+ // dMs are variables introduced in order to simplify some Eqs. bellow:\r
+ //..............................................................................................\r
+ Double_t dM11 = (*fSMpk)(1,1)-(*fSMpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j\r
+ Double_t dM111 = (*fSMpk)(2,1)-3.*(*fSMpk)(0,2)*(*fSMpk)(0,1)
+ + 2.*(*fSMpk)(0,3); // dM111 = sum_{i,j,k=1,i!=j!=k}^M w_i w_j w_k\r
+ //..............................................................................................\r
+ \r
+ // 1-particle:\r
+ Double_t sinP1nW1 = 0.; // <<w1 sin(n*(phi1))>>\r
+ \r
+ if(dMult>0 && (*fSMpk)(0,1) !=0.)\r
+ {\r
+ sinP1nW1 = dImQ1n1k/((*fSMpk)(0,1)); \r
+ \r
+ // average weighted 1-particle correction (sin terms) for non-uniform acceptance for single event:\r
+ fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(1,sinP1nW1);\r
+ \r
+ // final average weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: \r
+ fIntFlowCorrectionTermsForNUAPro[0]->Fill(0.5,sinP1nW1,(*fSMpk)(0,1)); \r
+ } \r
+ \r
+ // 2-particle:\r
+ Double_t sinP1nP1nW1W1 = 0.; // <<w1 w2 sin(n*(phi1+phi2))>>\r
+ \r
+ if(dMult>1 && dM11 !=0.)\r
+ {\r
+ sinP1nP1nW1W1 = (2.*dReQ1n1k*dImQ1n1k-dImQ2n2k)/dM11; \r
+ \r
+ // average weighted 2-particle correction (sin terms) for non-uniform acceptance for single event:\r
+ fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(2,sinP1nP1nW1W1);\r
+ \r
+ // final average weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: \r
+ fIntFlowCorrectionTermsForNUAPro[0]->Fill(1.5,sinP1nP1nW1W1,dM11); \r
+ } \r
+ \r
+ // 3-particle:\r
+ Double_t sinP1nM1nM1nW1W1W1 = 0.; // <<w1 w2 w3 sin(n*(phi1-phi2-phi3))>>\r
+ \r
+ if(dMult>2 && dM111 !=0.)\r
+ {\r
+ sinP1nM1nM1nW1W1W1 = (-dImQ1n1k*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2))
+ + dReQ1n1k*dImQ2n2k-dImQ1n1k*dReQ2n2k
+ + 2.*((*fSMpk)(0,2))*dImQ1n1k
+ - 2.*dImQ1n3k)\r
+ / dM111; \r
+ \r
+ // average weighted 3-particle correction (sin terms) for non-uniform acceptance for single event:\r
+ fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(3,sinP1nM1nM1nW1W1W1);\r
+ \r
+ // final average weighted 3-particle correction (sin terms) for non-uniform acceptance for all events: \r
+ fIntFlowCorrectionTermsForNUAPro[0]->Fill(2.5,sinP1nM1nM1nW1W1W1,dM111); \r
+ } \r
+ \r
+} // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights()\r
+\r
+\r
//================================================================================================================================
-
-
-void AliFlowAnalysisWithQCumulants::CompareDirectAndQCorrelationsForDifferentialFlow(Bool_t useWeights)
-{
- // compare correlations needed for diff. flow calculated with nested loops and those calculated from Q-vectors
-
- cout<<endl;
- cout<<" *************************************"<<endl;
- cout<<" **** cross-checking the formulas ****"<<endl;
- cout<<" **** for differential flow ****"<<endl;
- cout<<" **** ****"<<endl;
- cout<<" **** (pt,eta) bin: ****"<<endl;
- cout<<" **** 1.1 < pt < 1.2 GeV ****"<<endl;
- cout<<" **** -0.55 < eta < -0.525 ****"<<endl;
- cout<<" *************************************"<<endl;
- cout<<endl;
-
- if(!useWeights)
- {
- cout<<"<cos(n(psi1-phi2))> from Q-vectors = "<<f2pPtEtaPOI->GetBinContent(f2pPtEtaPOI->GetBin(12,19))<<endl;
- cout<<"<cos(n(psi1-phi2))> from nested loops = "<<fDirectCorrelationsDiffFlow->GetBinContent(1)<<endl;
- cout<<endl;
- cout<<"<cos(n(psi1+phi2-phi3-phi4))> from Q-vectors = "<<f4pPtEtaPOI->GetBinContent(f4pPtEtaPOI->GetBin(12,19))<<endl;
- cout<<"<cos(n(psi1+phi2-phi3-phi4))> from nested loops = "<<fDirectCorrelationsDiffFlow->GetBinContent(41)<<endl;
- cout<<endl;
- }
-
- if(useWeights)
- {
- cout<<"<w2 cos(n(psi1-phi2))> from Q-vectors = "<<f2pPtEtaPOIW->GetBinContent(f2pPtEtaPOIW->GetBin(12,19))<<endl;
- cout<<"<w2 cos(n(psi1-phi2))> from nested loops = "<<fDirectCorrelationsDiffFlowW->GetBinContent(1)<<endl;
- cout<<endl;
- cout<<"<w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))> from Q-vectors = "<<f4pPtEtaPOIW->GetBinContent(f4pPtEtaPOIW->GetBin(12,19))<<endl;
- cout<<"<w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))> from nested loops = "<<fDirectCorrelationsDiffFlowW->GetBinContent(41)<<endl;
- cout<<endl;
- }
+\r
+\r
+void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent)\r
+{\r
+ // Evaluate with nested loops correction terms for non-uniform acceptance for integrated flow (using the particle weights). \r
+\r
+ // Results are stored in profiles fIntFlowDirectCorrectionTermsForNUA[0] (sin terms) and
+ // fIntFlowDirectCorrectionTermsForNUA[1] (cos terms).
+ \r
+ // Remark 1: When particle weights are used the binning of fIntFlowDirectCorrectionTermsForNUA[sc] is
+ // organized as follows (sc stands for either sin or cos):\r
+ //\r
+ // 1st bin: <<w1 sc(n*(phi1))>> = scP1nW1\r
+ // 2nd bin: <<w1 w2 sc(n*(phi1+phi2))>> = scP1nP1nW1W1\r
+ // 3rd bin: <<w1 w2 w3 sc(n*(phi1-phi2-phi3))>> = scP1nM1nM1nW1W1W1 \r
+ // ...\r
+ \r
+ Int_t nPrim = anEvent->NumberOfTracks(); \r
+ AliFlowTrackSimple *aftsTrack = NULL;\r
+ //Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.;\r
+ //Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.;\r
+ Double_t phi1=0., phi2=0., phi3=0.;\r
+ Double_t wPhi1=1., wPhi2=1., wPhi3=1.;\r
+ Int_t n = fHarmonic; \r
+ Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?)\r
+ Double_t dMult = (*fSMpk)(0,0);\r
+ cout<<endl;\r
+ cout<<"Correction terms for non-uniform acceptance: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl;\r
+ if(dMult<1)\r
+ {\r
+ cout<<"... skipping this event (multiplicity too low) ..."<<endl;\r
+ } else if (dMult>fMaxAllowedMultiplicity)\r
+ {\r
+ cout<<"... skipping this event (multiplicity too high) ..."<<endl;\r
+ } else \r
+ { \r
+ cout<<"... evaluating nested loops (using particle weights) ..."<<endl;\r
+ } \r
+ \r
+ // 1-particle correction terms using particle weights: \r
+ if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity)\r
+ {\r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi1=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi())));\r
+ // 1-particle correction terms using particle weights:
+ if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(0.5,sin(n*phi1),wPhi1); // <w1 sin(n*phi1)>\r
+ if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(0.5,cos(n*phi1),wPhi1); // <w1 cos(n*phi1)>\r
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)
+ } // end of if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity)
+
+ // 2-particle correction terms using particle weights: \r
+ if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity)\r
+ {\r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi1=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi())));\r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1)continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); \r
+ if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush;\r
+ // 2-p correction terms using particle weights:
+ if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(1.5,sin(n*(phi1+phi2)),wPhi1*wPhi2); // <w1 w2 sin(n*(phi1+phi2))>\r
+ if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(1.5,cos(n*(phi1+phi2)),wPhi1*wPhi2); // <w1 w2 cos(n*(phi1+phi2))>\r
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ } // end of if(nPrim>=2)\r
+\r
+ // 3-particle correction terms using particle weights: \r
+ if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity)\r
+ { \r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi1=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi())));\r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1)continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));\r
+ for(Int_t i3=0;i3<nPrim;i3++)\r
+ {\r
+ if(i3==i1||i3==i2)continue;\r
+ aftsTrack=anEvent->GetTrack(i3);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi3=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi())));\r
+ if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush;\r
+ // 3-p correction terms using particle weights:
+ if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(2.5,sin(n*(phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 sin(n*(phi1-phi2-phi3))>\r
+ if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(2.5,cos(n*(phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 cos(n*(phi1-phi2-phi3))>\r
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ } // end of if(nPrim>=3)\r
+ \r
+ /*
-} // end of void AliFlowAnalysisWithQCumulants::CompareDirectAndQCorrelationsForDifferentialFlow()
-
-
-//================================================================================================================================
-
-
-void AliFlowAnalysisWithQCumulants::WriteHistograms(TString outputFileName)
-{
- //store the final results in output .root file
- TFile *output = new TFile(outputFileName.Data(),"RECREATE");
- //output->WriteObject(fHistList, "cobjQC","SingleKey");
- fHistList->SetName("cobjQC");
- fHistList->Write(fHistList->GetName(), TObject::kSingleKey);
- delete output;
-}
-
-
+ if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity)\r
+ {\r
+ // 4 nested loops multiparticle correlations using particle weights: \r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi1=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi())));\r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1)continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi())));\r
+ for(Int_t i3=0;i3<nPrim;i3++)\r
+ {\r
+ if(i3==i1||i3==i2)continue;\r
+ aftsTrack=anEvent->GetTrack(i3);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi3=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi())));\r
+ for(Int_t i4=0;i4<nPrim;i4++)\r
+ {\r
+ if(i4==i1||i4==i2||i4==i3)continue;\r
+ aftsTrack=anEvent->GetTrack(i4);\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi4=aftsTrack->Phi();\r
+ if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi())));\r
+ if(nPrim>=4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; // to be improved (replace eventually this if statement with if(nPrim==4))\r
+ // 4-p correlations using particle weights:\r
+ if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(10.5,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); \r
+ // extra correlations: \r
+ // 2-p extra correlations (do not appear if particle weights are not used):\r
+ // ...\r
+ // 3-p extra correlations (do not appear if particle weights are not used):\r
+ // ...\r
+ // 4-p extra correlations (do not appear if particle weights are not used):\r
+ // ...\r
+ } // end of for(Int_t i4=0;i4<nPrim;i4++) \r
+ } // end of for(Int_t i3=0;i3<nPrim;i3++)\r
+ } // end of for(Int_t i2=0;i2<nPrim;i2++)\r
+ } // end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ } // end of if(nPrim>=4)\r
+
+ */\r
+
+ cout<<endl; \r
+\r
+} // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent)\r
+\r
+\r
//================================================================================================================================
-
-
-void AliFlowAnalysisWithQCumulants::TempDeleteMe()
-{
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights(TString type, TString ptOrEta)\r
+{\r
+ // Calculate correction terms for non-uniform acceptance for differential flow (cos terms) using particle weights.\r
+
+ type+=""; // to be removed
+ ptOrEta+=""; // to be removed
+
+// Remark: w1 bellow is a particle weight used only for particles which were flagged both as POI and RP.
+ \r
+ // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][1][cti], where cti runs as follows:\r
+ //
+ // 0: <<w1 cos n(psi)>>\r
+ // 1: <<w1 w2 cos n(psi1+phi2)>>\r
+ // 2: <<w1 w2 w3 cos n(psi1+phi2-phi3)>>\r
+ // 3: <<w1 w2 w3 cos n(psi1-phi2-phi3)>>\r
+ // 4:\r
+ // 5:\r
+ // 6:\r
+ \r
/*
- //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx
- TCanvas* qvectorPlot = new TCanvas("qvectorPlot","Q-vector Plot",1000,1000);
-
- qvectorPlot->cd(1);
- TH1D* style = new TH1D("style","Q-vectors",100,-244,244);
- (style->GetYaxis())->SetRangeUser(-244,244);
-
- style->Draw();
+ // multiplicity:\r
+ Double_t dMult = (*fSMpk)(0,0);\r
+ \r
+ // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
+ Double_t dReQ1n1k = (*fReQ)(0,1);\r
+ Double_t dReQ2n2k = (*fReQ)(1,2);\r
+ Double_t dReQ1n3k = (*fReQ)(0,3);\r
+ //Double_t dReQ4n4k = (*fReQ)(3,4);\r
+ Double_t dImQ1n1k = (*fImQ)(0,1);\r
+ Double_t dImQ2n2k = (*fImQ)(1,2);\r
+ Double_t dImQ1n3k = (*fImQ)(0,3);\r
+ //Double_t dImQ4n4k = (*fImQ)(3,4);\r
+
+ // S^M_{p,k} (see .h file for the definition of fSMpk):\r
+ Double_t dSM1p1k = (*fSMpk)(0,1);\r
+ Double_t dSM1p2k = (*fSMpk)(0,2);\r
+ Double_t dSM1p3k = (*fSMpk)(0,3);\r
+ Double_t dSM2p1k = (*fSMpk)(1,1);\r
+ Double_t dSM3p1k = (*fSMpk)(2,1);\r
+\r
+ Int_t t = -1; // type flag \r
+ Int_t pe = -1; // ptEta flag\r
+ \r
+ if(type == "RP")\r
+ {\r
+ t = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ t = 1;\r
+ }\r
+\r
+ if(ptOrEta == "Pt")\r
+ {\r
+ pe = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ pe = 1;\r
+ }\r
+ \r
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
+ Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
+ //Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
+\r
+ // looping over all bins and calculating correction terms: \r
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ {\r
+ // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): \r
+ Double_t p1n0kRe = 0.;\r
+ Double_t p1n0kIm = 0.;\r
+\r
+ // number of POIs in particular pt or eta bin:\r
+ Double_t mp = 0.;\r
+\r
+ // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin):\r
+ Double_t q1n0kRe = 0.;\r
+ Double_t q1n0kIm = 0.;\r
+ Double_t q2n0kRe = 0.;\r
+ Double_t q2n0kIm = 0.;\r
+\r
+ // real and imaginary parts of q_{m*n,0} (weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin):\r
+ Double_t q1n1kRe = 0.;\r
+ Double_t q1n1kIm = 0.;\r
+ Double_t q1n2kRe = 0.;\r
+ Double_t q1n2kIm = 0.;\r
+ Double_t q2n1kRe = 0.;\r
+ Double_t q2n1kIm = 0.;\r
+ Double_t q2n2kRe = 0.;\r
+ Double_t q2n2kIm = 0.;\r
+
+ // number of particles which are both RPs and POIs in particular pt or eta bin:\r
+ Double_t mq = 0.;\r
+
+ // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) \r
+ Double_t s1p1k = 0.; \r
+ Double_t s1p2k = 0.; \r
+ Double_t s1p3k = 0.; \r
+
+ if(type == "POI")\r
+ {\r
+ // p_{m*n,k}:
+ p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b))\r
+ * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b));\r
+ p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) \r
+ * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b));
+ mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) \r
+ // q_{m*n,k}:\r
+ q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b))\r
+ * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b));\r
+ q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b))\r
+ * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b));\r
+ q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b))\r
+ * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b));\r
+ q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b))\r
+ * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); \r
+ q1n1kRe = fReRPQ1dEBE[2][pe][0][1]->GetBinContent(fReRPQ1dEBE[2][pe][0][1]->GetBin(b))\r
+ * fReRPQ1dEBE[2][pe][0][1]->GetBinEntries(fReRPQ1dEBE[2][pe][0][1]->GetBin(b));\r
+ q1n1kIm = fImRPQ1dEBE[2][pe][0][1]->GetBinContent(fImRPQ1dEBE[2][pe][0][1]->GetBin(b))\r
+ * fImRPQ1dEBE[2][pe][0][1]->GetBinEntries(fImRPQ1dEBE[2][pe][0][1]->GetBin(b));\r
+ q2n2kRe = fReRPQ1dEBE[2][pe][1][2]->GetBinContent(fReRPQ1dEBE[2][pe][1][2]->GetBin(b))\r
+ * fReRPQ1dEBE[2][pe][1][2]->GetBinEntries(fReRPQ1dEBE[2][pe][1][2]->GetBin(b));\r
+ q2n2kIm = fImRPQ1dEBE[2][pe][1][2]->GetBinContent(fImRPQ1dEBE[2][pe][1][2]->GetBin(b))\r
+ * fImRPQ1dEBE[2][pe][1][2]->GetBinEntries(fImRPQ1dEBE[2][pe][1][2]->GetBin(b));
+ mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
+ // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) \r
+ s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); \r
+ s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); \r
+ s1p3k = pow(fs1dEBE[2][pe][3]->GetBinContent(b)*fs1dEBE[2][pe][3]->GetBinEntries(b),1.);
+ // typeFlag = RP (0) or POI (1):
+ t = 1; \r
+ }else if(type == "RP")\r
+ {\r
+ // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) \r
+ q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b))\r
+ * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b));\r
+ q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b))\r
+ * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b));\r
+ q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b))\r
+ * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b));\r
+ q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b))\r
+ * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b));\r
+ // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) \r
+ s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); \r
+ s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); \r
+ s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); \r
+ \r
+ // to be improved (cross-checked):\r
+ p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b))\r
+ * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
+ p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) \r
+ * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
+ mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
+ // typeFlag = RP (0) or POI (1): \r
+ t = 0;\r
+ } \r
+ \r
+ // <<w1 cos n(psi1)>>:\r
+ Double_t cosP1nPsiW1 = 0.;\r
+ if(mp-mq+s1p1k)\r
+ {\r
+ cosP1nPsiW1 = (p1n0kRe-q1n0kRe+q1n1kRe)/(mp-mq+s1p1k);\r
+ \r
+ // fill profile for <<w1 cos n(psi1)>>:\r
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsiW1,mp-mq+s1p1k);\r
+ // histogram to store <w1 cos n(psi1)> e-b-e (needed in some other methods):\r
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][0]->SetBinContent(b,cosP1nPsiW1);\r
+ } // end of if(mp-mq+s1p1k) \r
+ \r
+
+
+ // <<w1 w2 cos n(psi1+phi2)>>:\r
+ Double_t cosP1nPsiP1nPhi = 0.;\r
+ if(mp*dMult-mq)\r
+ {\r
+ cosP1nPsiP1nPhi = (p1n0kRe*dReQ1n-p1n0kIm*dImQ1n-q2n0kRe)/(mp*dMult-mq);\r
+ // fill profile for <<w1 w2 cos n(psi1+phi2)>>:\r
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsiP1nPhi,mp*dMult-mq);\r
+ // histogram to store <w1 w2 cos n(psi1+phi2)> e-b-e (needed in some other methods):\r
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][1]->SetBinContent(b,cosP1nPsiP1nPhi);\r
+ } // end of if(mp*dMult-mq) \r
+ \r
+ // <<w1 w2 w3 cos n(psi1+phi2-phi3)>>:\r
+ Double_t cosP1nPsi1P1nPhi2MPhi3 = 0.;\r
+ if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.))\r
+ {\r
+ cosP1nPsi1P1nPhi2MPhi3 = (p1n0kRe*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult)\r
+ - 1.*(q2n0kRe*dReQ1n+q2n0kIm*dImQ1n) \r
+ - mq*dReQ1n+2.*q1n0kRe)\r
+ / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
+ // fill profile for <<w1 w2 w3 cos n(psi1+phi2)>>:\r
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
+ // histogram to store <w1 w2 w3 cos n(psi1+phi2)> e-b-e (needed in some other methods):\r
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][2]->SetBinContent(b,cosP1nPsi1P1nPhi2MPhi3);\r
+ } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) \r
+ \r
+ // <<w1 w2 w3 cos n(psi1-phi2-phi3)>>:\r
+ Double_t cosP1nPsi1M1nPhi2MPhi3 = 0.;\r
+ if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.))\r
+ {\r
+ cosP1nPsi1M1nPhi2MPhi3 = (p1n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.))+2.*p1n0kIm*dReQ1n*dImQ1n\r
+ - 1.*(p1n0kRe*dReQ2n+p1n0kIm*dImQ2n) \r
+ - 2.*mq*dReQ1n+2.*q1n0kRe)\r
+ / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
+ // fill profile for <<w1 w2 w3 cos n(psi1+phi2)>>:\r
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
+ // histogram to store <w1 w2 w3 cos n(psi1+phi2)> e-b-e (needed in some other methods):\r
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][3]->SetBinContent(b,cosP1nPsi1M1nPhi2MPhi3);\r
+ } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) \r
+
+
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
- Int_t nBins=fQvectorForEachEventX->GetNbinsX();
- Double_t qxxx=0.,qyyy=0.;
- //cout<<"nBins = "<<nBins<<endl;
- //cout<<fQvectorForEachEventX->GetBinEntries(4)<<endl;
- //cout<<fQvectorForEachEventY->GetBinEntries(4)<<endl;
-
- for(Int_t b=1;b<nBins+1;b++)
- {
- if(fQvectorForEachEventX->GetBinEntries(b)==1 && fQvectorForEachEventY->GetBinEntries(b)==1)
- {
- qxxx=fQvectorForEachEventX->GetBinContent(b);
- qyyy=fQvectorForEachEventY->GetBinContent(b);
- //cout<<qxxx<<" "<<qyyy<<endl;
- TArrow *qvector = new TArrow(0.0,0.0,qxxx,qyyy,0.0144,"|>");
- qvector->SetAngle(40);
- qvector->SetLineWidth(2);
- qvector->Draw("");
- }
- }
- //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx
- */
-
-
-
- //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx
- Int_t nBinsPt=3, nBinsEta=2;
- Double_t ptMin=0., ptMax=3.;
- Double_t etaMin=0., etaMax=2.;
-
-
- //avarage of the generating function for integrated flow <G[p][q]>
- TProfile2D *tempPtEta = new TProfile2D("tempPtEta","<2'>(pt,eta)",nBinsPt,ptMin,ptMax,nBinsEta,etaMin,etaMax);
- tempPtEta->SetXTitle("pt");
- tempPtEta->SetYTitle("eta");
-
- // (1,1):
- tempPtEta->Fill(0.5,0.67,0.4,2);
- tempPtEta->Fill(0.1,0.44,0.6,3);
+ */
- // (3,1):
- tempPtEta->Fill(2.5,0.01,2.2,4);
- tempPtEta->Fill(2.1,0.74,2.6,3.7);
-
- //tempPtEta->Fill(2.5,0.5,1,2);
- //tempPtEta->Fill(2.5,1.5,3,1);
- //tempPtEta->Fill(2.6,0.6,7,3);
- //tempPtEta->Fill(2.5,0.5,1,1);
+} // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights(TString type, TString ptOrEta)
+\r
+//================================================================================================================================\r
+\r
+\r
+void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights(TString type, TString ptOrEta)\r
+{\r
+ // Calculate correction terms for non-uniform acceptance for differential flow (sin terms).\r
+ type+=""; // to be removed
+ ptOrEta+=""; // to be removed
- TCanvas* tempCanvas = new TCanvas("tempCanvas","tempCanvas",1000,600);
-
- tempCanvas->Divide(1,2);
-
- tempCanvas->cd(1);
- tempPtEta->Draw("SURF1");
-
- (tempCanvas->cd(2))->Divide(1,2);
-
- tempCanvas->cd(1);
- //tempPt->Draw();
-
- tempCanvas->cd(2);
- //tempEta->Draw();
+ // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][0][cti], where cti runs as follows:\r
+ // 0: <<sin n(psi1)>>\r
+ // 1: <<sin n(psi1+phi2)>>\r
+ // 2: <<sin n(psi1+phi2-phi3)>>\r
+ // 3: <<sin n(psi1-phi2-phi3)>>:\r
+ // 4:\r
+ // 5:\r
+ // 6:\r
/*
- cout<<tempPtEta->GetBinContent(tempPtEta->GetBin(1,1))<<endl;
- cout<<tempPtEta->GetBinContent(tempPtEta->GetBin(3,1))<<endl;
- cout<<tempEta->GetBinContent(1)<<endl;
- cout<<tempEta->GetBinEntries(1)<<endl;
- cout<<tempEta->GetBinContent(2)<<endl;
- cout<<tempEta->GetBinEntries(2)<<endl;
- cout<<endl;
+
+ // multiplicity:\r
+ Double_t dMult = (*fSMpk)(0,0);\r
+ \r
+ // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: \r
+ Double_t dReQ1n = (*fReQ)(0,0);\r
+ Double_t dReQ2n = (*fReQ)(1,0);\r
+ //Double_t dReQ3n = (*fReQ)(2,0);\r
+ //Double_t dReQ4n = (*fReQ)(3,0);\r
+ Double_t dImQ1n = (*fImQ)(0,0);\r
+ Double_t dImQ2n = (*fImQ)(1,0);\r
+ //Double_t dImQ3n = (*fImQ)(2,0);\r
+ //Double_t dImQ4n = (*fImQ)(3,0);\r
+\r
+ Int_t t = -1; // type flag \r
+ Int_t pe = -1; // ptEta flag\r
+ \r
+ if(type == "RP")\r
+ {\r
+ t = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ t = 1;\r
+ }\r
+\r
+ if(ptOrEta == "Pt")\r
+ {\r
+ pe = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ pe = 1;\r
+ }\r
+ \r
+ Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta};\r
+ Double_t minPtEta[2] = {fPtMin,fEtaMin};\r
+ //Double_t maxPtEta[2] = {fPtMax,fEtaMax};\r
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
+\r
+ // looping over all bins and calculating correction terms: \r
+ for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ {\r
+ // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): \r
+ Double_t p1n0kRe = 0.;\r
+ Double_t p1n0kIm = 0.;\r
+\r
+ // number of POIs in particular pt or eta bin:\r
+ Double_t mp = 0.;\r
+\r
+ // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin):\r
+ Double_t q1n0kRe = 0.;\r
+ Double_t q1n0kIm = 0.;\r
+ Double_t q2n0kRe = 0.;\r
+ Double_t q2n0kIm = 0.;\r
+\r
+ // number of particles which are both RPs and POIs in particular pt or eta bin:\r
+ Double_t mq = 0.;\r
+ \r
+ if(type == "POI")\r
+ {\r
+ // q_{m*n,0}:\r
+ q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b))\r
+ * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b));\r
+ q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b))\r
+ * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b));\r
+ q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b))\r
+ * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b));\r
+ q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b))\r
+ * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); \r
+ \r
+ mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
+ } \r
+ else if(type == "RP")\r
+ {\r
+ // q_{m*n,0}:\r
+ q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b))\r
+ * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
+ q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b))\r
+ * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b));\r
+ q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b))\r
+ * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b));\r
+ q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b))\r
+ * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); \r
+ \r
+ mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) \r
+ } \r
+ if(type == "POI")\r
+ {\r
+ // p_{m*n,0}:\r
+ p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b))\r
+ * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b));\r
+ p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) \r
+ * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b));\r
+ \r
+ mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here)\r
+ \r
+ t = 1; // typeFlag = RP or POI\r
+ }\r
+ else if(type == "RP")\r
+ {\r
+ // p_{m*n,0} = q_{m*n,0}:\r
+ p1n0kRe = q1n0kRe; \r
+ p1n0kIm = q1n0kIm; \r
+ \r
+ mp = mq; \r
+ \r
+ t = 0; // typeFlag = RP or POI\r
+ }\r
+\r
+ // <<sin n(psi1)>>:\r
+ Double_t sinP1nPsi = 0.;\r
+ if(mp)\r
+ {\r
+ sinP1nPsi = p1n0kIm/mp;\r
+ // fill profile for <<sin n(psi1)>>:\r
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi,mp);\r
+ // histogram to store <sin n(psi1)> e-b-e (needed in some other methods):\r
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][0]->SetBinContent(b,sinP1nPsi);\r
+ } // end of if(mp) \r
+ \r
+ // <<sin n(psi1+phi2)>>:\r
+ Double_t sinP1nPsiP1nPhi = 0.;\r
+ if(mp*dMult-mq)\r
+ {\r
+ sinP1nPsiP1nPhi = (p1n0kRe*dImQ1n+p1n0kIm*dReQ1n-q2n0kIm)/(mp*dMult-mq);\r
+ // fill profile for <<sin n(psi1+phi2)>>:\r
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsiP1nPhi,mp*dMult-mq);\r
+ // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods):\r
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][1]->SetBinContent(b,sinP1nPsiP1nPhi);\r
+ } // end of if(mp*dMult-mq) \r
+ \r
+ // <<sin n(psi1+phi2-phi3)>>:\r
+ Double_t sinP1nPsi1P1nPhi2MPhi3 = 0.;\r
+ if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.))\r
+ {\r
+ sinP1nPsi1P1nPhi2MPhi3 = (p1n0kIm*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult)\r
+ - 1.*(q2n0kIm*dReQ1n-q2n0kRe*dImQ1n) \r
+ - mq*dImQ1n+2.*q1n0kIm)\r
+ / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
+ // fill profile for <<sin n(psi1+phi2)>>:\r
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
+ // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods):\r
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][2]->SetBinContent(b,sinP1nPsi1P1nPhi2MPhi3);\r
+ } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) \r
+ \r
+ // <<sin n(psi1-phi2-phi3)>>:\r
+ Double_t sinP1nPsi1M1nPhi2MPhi3 = 0.;\r
+ if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.))\r
+ {\r
+ sinP1nPsi1M1nPhi2MPhi3 = (p1n0kIm*(pow(dReQ1n,2.)-pow(dImQ1n,2.))-2.*p1n0kRe*dReQ1n*dImQ1n\r
+ - 1.*(p1n0kIm*dReQ2n-p1n0kRe*dImQ2n)\r
+ + 2.*mq*dImQ1n-2.*q1n0kIm)\r
+ / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
+ // fill profile for <<sin n(psi1+phi2)>>:\r
+ fDiffFlowCorrectionTermsForNUAPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.));\r
+ // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods):\r
+ fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][3]->SetBinContent(b,sinP1nPsi1M1nPhi2MPhi3);\r
+ } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) \r
+ } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++)\r
+ \r
*/
+
+} // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights(TString type, TString ptOrEta)\r
+\r
+\r
+//================================================================================================================================\r
+\r
+ \r
+void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta)\r
+{\r
+ // Evaluate with nested loops correction terms for non-uniform acceptance
+ // with using particle weights (both sin and cos terms) relevant for differential flow.\r
+ \r
+ anEvent->NumberOfTracks(); // to be removed
+ ptOrEta+=""; // to be removed
+ type+=""; // to be removed
+
+ // Remark 1: "w1" in expressions bellow is a particle weight used only for particles which were
+ // flagged both as POI and RP.
+ // Remark 2: Reduced correction terms for non-uniform acceptance are evaluated in pt bin number fCrossCheckInPtBinNo \r
+ // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs.\r
+ // Remark 3: Results are stored in 1 bin profiles fDiffFlowDirectCorrections[t][pe][sc][cti], where first three indices runs as: \r
+ // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms], whilst the cti (correction term index) runs as follows: \r
+ // cti: \r
+ // 0: <<w1 sc n(psi1)>>\r
+ // 1: <<w1 w2 sc n(psi1+phi2)>> \r
+ // 2: <<w1 w2 w3 sc n(psi1+phi2-phi3)>>\r
+ // 3: <<w1 w2 w3 sc n(psi1-phi2-phi3)>>\r
+ // 4:\r
+ // 5:\r
+ // 6:\r
+ \r
/*
- cout<<tempPtEta->GetBinContent(3,1)<<endl;
- cout<<tempPtEta->GetBinEntries(tempPtEta->GetBin(3,1))<<endl;
- cout<<endl;
- cout<<tempPtEta->GetBinContent(1,2)<<endl;
- cout<<tempPtEta->GetBinEntries(tempPtEta->GetBin(1,2))<<endl;
- cout<<endl;
+ Int_t typeFlag = -1;\r
+ Int_t ptEtaFlag = -1;\r
+ if(type == "RP")\r
+ {\r
+ typeFlag = 0;\r
+ } else if(type == "POI")\r
+ {\r
+ typeFlag = 1;\r
+ } \r
+ if(ptOrEta == "Pt")\r
+ {\r
+ ptEtaFlag = 0;\r
+ } else if(ptOrEta == "Eta")\r
+ {\r
+ ptEtaFlag = 1;\r
+ } \r
+ // shortcuts:\r
+ Int_t t = typeFlag;\r
+ Int_t pe = ptEtaFlag;\r
+ \r
+ Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth};\r
+ Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth};\r
+ Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth};\r
+ \r
+ Int_t nPrim = anEvent->NumberOfTracks(); \r
+ AliFlowTrackSimple *aftsTrack = NULL;\r
+ \r
+ Double_t psi1=0., phi2=0., phi3=0.;// phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.;\r
+ \r
+ Int_t n = fHarmonic; \r
+ \r
+ // 1-particle correction terms:\r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
+ if(ptOrEta == "Pt")\r
+ { \r
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue;\r
+ } else if (ptOrEta == "Eta")\r
+ {\r
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue; \r
+ }\r
+ psi1=aftsTrack->Phi(); \r
+ // sin terms: \r
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*psi1),1.); // <<sin(n*(psi1))>> \r
+ // cos terms: \r
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*psi1),1.); // <<cos(n*(psi1))>> \r
+ }//end of for(Int_t i1=0;i1<nPrim;i1++)\r
+ \r
+ // 2-particle correction terms:\r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
+ if(ptOrEta == "Pt")\r
+ { \r
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue;\r
+ } else if (ptOrEta == "Eta")\r
+ {\r
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection()))) continue; \r
+ }\r
+ psi1=aftsTrack->Phi(); \r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1) continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ // RP condition (!(first) particle in the correlator must be RP):\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi(); \r
+ // sin terms: \r
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2)),1.); // <<sin(n*(psi1+phi2))>> \r
+ // cos terms: \r
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2)),1.); // <<cos(n*(psi1+phi2))>> \r
+ }//end of for(Int_t i2=0;i2<nPrim;i2++)\r
+ }//end of for(Int_t i1=0;i1<nPrim;i1++) \r
+ \r
+ // 3-particle correction terms:\r
+ for(Int_t i1=0;i1<nPrim;i1++)\r
+ {\r
+ aftsTrack=anEvent->GetTrack(i1);\r
+ // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better)\r
+ if(ptOrEta == "Pt")\r
+ { \r
+ if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue;\r
+ } else if (ptOrEta == "Eta")\r
+ {\r
+ if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; \r
+ }\r
+ psi1=aftsTrack->Phi();\r
+ for(Int_t i2=0;i2<nPrim;i2++)\r
+ {\r
+ if(i2==i1) continue;\r
+ aftsTrack=anEvent->GetTrack(i2);\r
+ // RP condition (!(first) particle in the correlator must be RP):\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi2=aftsTrack->Phi();\r
+ for(Int_t i3=0;i3<nPrim;i3++)\r
+ {\r
+ if(i3==i1||i3==i2) continue;\r
+ aftsTrack=anEvent->GetTrack(i3);\r
+ // RP condition (!(first) particle in the correlator must be RP):\r
+ if(!(aftsTrack->InRPSelection())) continue;\r
+ phi3=aftsTrack->Phi();\r
+ // sin terms: \r
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2-phi3)),1.); // <<sin(n*(psi1+phi2-phi3))>> \r
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1-phi2-phi3)),1.); // <<sin(n*(psi1-phi2-phi3))>> \r
+ // cos terms: \r
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3)),1.); // <<cos(n*(psi1+phi2-phi3))>> \r
+ fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-phi2-phi3)),1.); // <<cos(n*(psi1-phi2-phi3))>> \r
+ }//end of for(Int_t i3=0;i3<nPrim;i3++) \r
+ }//end of for(Int_t i2=0;i2<nPrim;i2++) \r
+ }//end of for(Int_t i1=0;i1<nPrim;i1++)\r
- cout<<"xy"<<endl;
- cout<<tempPt->GetBinContent(1)<<endl;
- //cout<<tempPt->GetBinEntries(1)<<endl;
- cout<<tempPt->GetBinContent(3)<<endl;
- //cout<<tempPt->GetBinEntries(3)<<endl;
- cout<<endl;
-
- cout<<tempEta->GetBinContent(1)<<endl;
- //cout<<tempEta->GetBinEntries(1)<<endl;
- cout<<tempEta->GetBinContent(2)<<endl;
- //cout<<tempEta->GetBinEntries(2)<<endl;
- cout<<endl;
-
- //tempPtEta->Draw("LEGO2");
- */
-
- //xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx
-
-
-}
-
+ */
+ \r
+} // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta)\r
+\r
+\r
-//================================================================================================================================