]>
Commit | Line | Data |
---|---|---|
489d5531 | 1 | /************************************************************************* |
2 | * Copyright(c) 1998-2008, ALICE Experiment at CERN, All rights reserved. * | |
3 | * * | |
4 | * Author: The ALICE Off-line Project. * | |
5 | * Contributors are mentioned in the code where appropriate. * | |
6 | * * | |
7 | * Permission to use, copy, modify and distribute this software and its * | |
8 | * documentation strictly for non-commercial purposes is hereby granted * | |
9 | * without fee, provided that the above copyright notice appears in all * | |
10 | * copies and that both the copyright notice and this permission notice * | |
11 | * appear in the supporting documentation. The authors make no claims * | |
12 | * about the suitability of this software for any purpose. It is * | |
13 | * provided "as is" without express or implied warranty. * | |
14 | **************************************************************************/ | |
15 | ||
16 | /********************************** | |
17 | * flow analysis with Q-cumulants * | |
18 | * * | |
ff70ca91 | 19 | * author: Ante Bilandzic * |
20 | * (abilandzic@gmail.com) * | |
489d5531 | 21 | *********************************/ |
22 | ||
23 | #define AliFlowAnalysisWithQCumulants_cxx | |
24 | ||
25 | #include "Riostream.h" | |
26 | #include "AliFlowCommonConstants.h" | |
27 | #include "AliFlowCommonHist.h" | |
28 | #include "AliFlowCommonHistResults.h" | |
29 | #include "TChain.h" | |
30 | ||
31 | #include "TFile.h" | |
32 | #include "TList.h" | |
33 | #include "TGraph.h" | |
34 | #include "TParticle.h" | |
35 | #include "TRandom3.h" | |
36 | #include "TStyle.h" | |
37 | #include "TProfile.h" | |
38 | #include "TProfile2D.h" | |
489d5531 | 39 | #include "TMath.h" |
40 | #include "TArrow.h" | |
41 | #include "TPaveLabel.h" | |
42 | #include "TCanvas.h" | |
43 | #include "AliFlowEventSimple.h" | |
44 | #include "AliFlowTrackSimple.h" | |
45 | #include "AliFlowAnalysisWithQCumulants.h" | |
46 | #include "TArrayD.h" | |
47 | #include "TRandom.h" | |
48 | #include "TF1.h" | |
49 | ||
50 | class TH1; | |
51 | class TH2; | |
52 | class TGraph; | |
53 | class TPave; | |
54 | class TLatex; | |
55 | class TMarker; | |
56 | class TRandom3; | |
57 | class TObjArray; | |
58 | class TList; | |
59 | class TCanvas; | |
60 | class TSystem; | |
61 | class TROOT; | |
62 | class AliFlowVector; | |
63 | class TVector; | |
64 | ||
489d5531 | 65 | //================================================================================================================ |
66 | ||
3a7af7bd | 67 | using std::endl; |
68 | using std::cout; | |
69 | using std::flush; | |
489d5531 | 70 | ClassImp(AliFlowAnalysisWithQCumulants) |
71 | ||
72 | AliFlowAnalysisWithQCumulants::AliFlowAnalysisWithQCumulants(): | |
73 | // 0.) base: | |
74 | fHistList(NULL), | |
75 | // 1.) common: | |
53884472 | 76 | fBookOnlyBasicCCH(kTRUE), |
489d5531 | 77 | fCommonHists(NULL), |
78 | fCommonHists2nd(NULL), | |
79 | fCommonHists4th(NULL), | |
80 | fCommonHists6th(NULL), | |
81 | fCommonHists8th(NULL), | |
82 | fCommonHistsResults2nd(NULL), | |
83 | fCommonHistsResults4th(NULL), | |
84 | fCommonHistsResults6th(NULL), | |
85 | fCommonHistsResults8th(NULL), | |
86 | fnBinsPhi(0), | |
87 | fPhiMin(0), | |
88 | fPhiMax(0), | |
89 | fPhiBinWidth(0), | |
90 | fnBinsPt(0), | |
91 | fPtMin(0), | |
92 | fPtMax(0), | |
93 | fPtBinWidth(0), | |
94 | fnBinsEta(0), | |
95 | fEtaMin(0), | |
96 | fEtaMax(0), | |
97 | fEtaBinWidth(0), | |
1268c371 | 98 | fCommonConstants(NULL), |
dd442cd2 | 99 | fFillMultipleControlHistograms(kFALSE), |
489d5531 | 100 | fHarmonic(2), |
101 | fAnalysisLabel(NULL), | |
102 | // 2a.) particle weights: | |
103 | fWeightsList(NULL), | |
104 | fUsePhiWeights(kFALSE), | |
105 | fUsePtWeights(kFALSE), | |
106 | fUseEtaWeights(kFALSE), | |
403e3389 | 107 | fUseTrackWeights(kFALSE), |
489d5531 | 108 | fUseParticleWeights(NULL), |
109 | fPhiWeights(NULL), | |
110 | fPtWeights(NULL), | |
111 | fEtaWeights(NULL), | |
112 | // 2b.) event weights: | |
113 | fMultiplicityWeight(NULL), | |
df23c5ae | 114 | fMultiplicityIs(AliFlowCommonConstants::kRP), |
489d5531 | 115 | // 3.) integrated flow: |
116 | fIntFlowList(NULL), | |
117 | fIntFlowProfiles(NULL), | |
118 | fIntFlowResults(NULL), | |
3435cacb | 119 | fIntFlowAllCorrelationsVsM(NULL), |
489d5531 | 120 | fIntFlowFlags(NULL), |
b92ea2b9 | 121 | fApplyCorrectionForNUA(kFALSE), |
2001bc3a | 122 | fApplyCorrectionForNUAVsM(kFALSE), |
9da1a4f3 | 123 | fnBinsMult(10000), |
067e9bc8 | 124 | fMinMult(0.), |
125 | fMaxMult(10000.), | |
b77b6434 | 126 | fPropagateErrorAlsoFromNIT(kFALSE), |
8ed4edc7 | 127 | fCalculateCumulantsVsM(kFALSE), |
3435cacb | 128 | fCalculateAllCorrelationsVsM(kFALSE), |
0dd3b008 | 129 | fMinimumBiasReferenceFlow(kTRUE), |
e5834fcb | 130 | fForgetAboutCovariances(kFALSE), |
131 | fStorePhiDistributionForOneEvent(kFALSE), | |
d9e6d8bb | 132 | fExactNoRPs(0), |
1db7eced | 133 | fUse2DHistograms(kFALSE), |
134 | fFillProfilesVsMUsingWeights(kTRUE), | |
135 | fUseQvectorTerms(kFALSE), | |
489d5531 | 136 | fReQ(NULL), |
137 | fImQ(NULL), | |
1268c371 | 138 | fSpk(NULL), |
489d5531 | 139 | fIntFlowCorrelationsEBE(NULL), |
140 | fIntFlowEventWeightsForCorrelationsEBE(NULL), | |
141 | fIntFlowCorrelationsAllEBE(NULL), | |
df23c5ae | 142 | fNumberOfRPsEBE(0.), |
143 | fNumberOfPOIsEBE(0.), | |
e5834fcb | 144 | fReferenceMultiplicityEBE(0.), |
489d5531 | 145 | fAvMultiplicity(NULL), |
146 | fIntFlowCorrelationsPro(NULL), | |
b40a910e | 147 | fIntFlowSquaredCorrelationsPro(NULL), |
489d5531 | 148 | fIntFlowCorrelationsAllPro(NULL), |
149 | fIntFlowExtraCorrelationsPro(NULL), | |
150 | fIntFlowProductOfCorrelationsPro(NULL), | |
0328db2d | 151 | fIntFlowProductOfCorrectionTermsForNUAPro(NULL), |
489d5531 | 152 | fIntFlowCorrelationsHist(NULL), |
153 | fIntFlowCorrelationsAllHist(NULL), | |
154 | fIntFlowCovariances(NULL), | |
155 | fIntFlowSumOfProductOfEventWeights(NULL), | |
0328db2d | 156 | fIntFlowCovariancesNUA(NULL), |
157 | fIntFlowSumOfProductOfEventWeightsNUA(NULL), | |
489d5531 | 158 | fIntFlowQcumulants(NULL), |
b92ea2b9 | 159 | fIntFlowQcumulantsRebinnedInM(NULL), |
160 | fIntFlowQcumulantsErrorSquaredRatio(NULL), | |
489d5531 | 161 | fIntFlow(NULL), |
b3dacf6b | 162 | fIntFlowRebinnedInM(NULL), |
2001bc3a | 163 | fIntFlowDetectorBias(NULL), |
489d5531 | 164 | // 4.) differential flow: |
165 | fDiffFlowList(NULL), | |
166 | fDiffFlowProfiles(NULL), | |
167 | fDiffFlowResults(NULL), | |
1268c371 | 168 | fDiffFlow2D(NULL), |
489d5531 | 169 | fDiffFlowFlags(NULL), |
1268c371 | 170 | fCalculateDiffFlow(kTRUE), |
171 | fCalculate2DDiffFlow(kFALSE), | |
62e36168 | 172 | fCalculateDiffFlowVsEta(kTRUE), |
64e500e3 | 173 | // 5.) other differential correlators: |
174 | fOtherDiffCorrelatorsList(NULL), | |
175 | // 6.) distributions: | |
57340a27 | 176 | fDistributionsList(NULL), |
177 | fDistributionsFlags(NULL), | |
489d5531 | 178 | fStoreDistributions(kFALSE), |
1db7eced | 179 | fnBinsForCorrelations(10000), |
64e500e3 | 180 | // 7.) various: |
e5834fcb | 181 | fVariousList(NULL), |
182 | fPhiDistributionForOneEvent(NULL), | |
e1d101a6 | 183 | // 8.) debugging and cross-checking: |
489d5531 | 184 | fNestedLoopsList(NULL), |
185 | fEvaluateIntFlowNestedLoops(kFALSE), | |
186 | fEvaluateDiffFlowNestedLoops(kFALSE), | |
187 | fMaxAllowedMultiplicity(10), | |
188 | fEvaluateNestedLoops(NULL), | |
189 | fIntFlowDirectCorrelations(NULL), | |
190 | fIntFlowExtraDirectCorrelations(NULL), | |
191 | fCrossCheckInPtBinNo(10), | |
3b552efe | 192 | fCrossCheckInEtaBinNo(20), |
e1d101a6 | 193 | fNoOfParticlesInBin(NULL), |
194 | fMixedHarmonicsNestedLoops(NULL), | |
195 | // 9.) mixed harmonics: | |
196 | fMixedHarmonicsList(NULL), | |
197 | fMixedHarmonicsProfiles(NULL), | |
198 | fMixedHarmonicsResults(NULL), | |
c10259fb | 199 | fMixedHarmonicsErrorPropagation(NULL), |
e1d101a6 | 200 | fMixedHarmonicsFlags(NULL), |
201 | fCalculateMixedHarmonics(kFALSE), | |
202 | fCalculateMixedHarmonicsVsM(kFALSE), | |
203 | f2pCorrelations(NULL), | |
204 | f3pCorrelations(NULL), | |
205 | f4pCorrelations(NULL), | |
206 | f5pCorrelations(NULL), | |
207 | f6pCorrelations(NULL), | |
208 | f7pCorrelations(NULL), | |
209 | f8pCorrelations(NULL), | |
210 | f2pCumulants(NULL), | |
211 | f3pCumulants(NULL), | |
212 | f4pCumulants(NULL), | |
213 | f5pCumulants(NULL), | |
214 | f6pCumulants(NULL), | |
215 | f7pCumulants(NULL), | |
c10259fb | 216 | f8pCumulants(NULL), |
217 | fMixedHarmonicProductOfEventWeights(NULL), | |
df23c5ae | 218 | fMixedHarmonicProductOfCorrelations(NULL), |
219 | // 10.) Control histograms: | |
220 | fControlHistogramsList(NULL), | |
221 | fControlHistogramsFlags(NULL), | |
222 | fStoreControlHistograms(kFALSE), | |
223 | fCorrelationNoRPsVsRefMult(NULL), | |
224 | fCorrelationNoPOIsVsRefMult(NULL), | |
225 | fCorrelationNoRPsVsNoPOIs(NULL) | |
489d5531 | 226 | { |
227 | // constructor | |
228 | ||
229 | // base list to hold all output objects: | |
230 | fHistList = new TList(); | |
231 | fHistList->SetName("cobjQC"); | |
232 | fHistList->SetOwner(kTRUE); | |
233 | ||
234 | // list to hold histograms with phi, pt and eta weights: | |
235 | fWeightsList = new TList(); | |
236 | ||
237 | // multiplicity weight: | |
238 | fMultiplicityWeight = new TString("combinations"); | |
df23c5ae | 239 | |
489d5531 | 240 | // analysis label; |
241 | fAnalysisLabel = new TString(); | |
242 | ||
243 | // initialize all arrays: | |
244 | this->InitializeArraysForIntFlow(); | |
245 | this->InitializeArraysForDiffFlow(); | |
246 | this->InitializeArraysForDistributions(); | |
e5834fcb | 247 | this->InitializeArraysForVarious(); |
489d5531 | 248 | this->InitializeArraysForNestedLoops(); |
c10259fb | 249 | this->InitializeArraysForMixedHarmonics(); |
d9e6d8bb | 250 | this->InitializeArraysForControlHistograms(); |
489d5531 | 251 | |
252 | } // end of constructor | |
253 | ||
489d5531 | 254 | //================================================================================================================ |
255 | ||
489d5531 | 256 | AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants() |
257 | { | |
258 | // destructor | |
259 | ||
260 | delete fHistList; | |
261 | ||
262 | } // end of AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants() | |
263 | ||
489d5531 | 264 | //================================================================================================================ |
265 | ||
489d5531 | 266 | void AliFlowAnalysisWithQCumulants::Init() |
267 | { | |
3b552efe | 268 | // a) Cross check if the settings make sense before starting the QC adventure; |
489d5531 | 269 | // b) Access all common constants; |
270 | // c) Book all objects; | |
3b552efe | 271 | // d) Store flags for integrated and differential flow; |
489d5531 | 272 | // e) Store flags for distributions of corelations; |
e1d101a6 | 273 | // f) Store harmonic which will be estimated; |
1db7eced | 274 | // g) Store flags for mixed harmonics; |
275 | // h) Store flags for control histograms. | |
3b552efe | 276 | |
489d5531 | 277 | //save old value and prevent histograms from being added to directory |
278 | //to avoid name clashes in case multiple analaysis objects are used | |
279 | //in an analysis | |
280 | Bool_t oldHistAddStatus = TH1::AddDirectoryStatus(); | |
281 | TH1::AddDirectory(kFALSE); | |
282 | ||
3b552efe | 283 | // a) Cross check if the settings make sense before starting the QC adventure; |
489d5531 | 284 | this->CrossCheckSettings(); |
1268c371 | 285 | // b) Access all common constants and book a profile to hold them: |
286 | this->CommonConstants("Init"); | |
489d5531 | 287 | // c) Book all objects: |
1268c371 | 288 | this->BookAndFillWeightsHistograms(); |
489d5531 | 289 | this->BookAndNestAllLists(); |
290 | this->BookCommonHistograms(); | |
291 | this->BookEverythingForIntegratedFlow(); | |
292 | this->BookEverythingForDifferentialFlow(); | |
1268c371 | 293 | this->BookEverythingFor2DDifferentialFlow(); |
489d5531 | 294 | this->BookEverythingForDistributions(); |
e5834fcb | 295 | this->BookEverythingForVarious(); |
489d5531 | 296 | this->BookEverythingForNestedLoops(); |
e1d101a6 | 297 | this->BookEverythingForMixedHarmonics(); |
df23c5ae | 298 | this->BookEverythingForControlHistograms(); |
e1d101a6 | 299 | |
489d5531 | 300 | // d) Store flags for integrated and differential flow: |
301 | this->StoreIntFlowFlags(); | |
3b552efe | 302 | this->StoreDiffFlowFlags(); |
489d5531 | 303 | // e) Store flags for distributions of corelations: |
304 | this->StoreFlagsForDistributions(); | |
305 | // f) Store harmonic which will be estimated: | |
306 | this->StoreHarmonic(); | |
e1d101a6 | 307 | // g) Store flags for mixed harmonics: |
308 | this->StoreMixedHarmonicsFlags(); | |
1db7eced | 309 | // h) Store flags for control histograms: |
310 | this->StoreControlHistogramsFlags(); | |
311 | ||
489d5531 | 312 | TH1::AddDirectory(oldHistAddStatus); |
313 | } // end of void AliFlowAnalysisWithQCumulants::Init() | |
314 | ||
489d5531 | 315 | //================================================================================================================ |
316 | ||
489d5531 | 317 | void AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent) |
318 | { | |
319 | // Running over data only in this method. | |
320 | ||
b3dacf6b | 321 | // a) Check all pointers used in this method; |
322 | // b) Define local variables; | |
323 | // c) Fill the common control histograms and call the method to fill fAvMultiplicity; | |
1268c371 | 324 | // d) Loop over data and calculate e-b-e quantities Q_{n,k}, S_{p,k} and s_{p,k}; |
325 | // e) Calculate the final expressions for S_{p,k} and s_{p,k} (important !!!!); | |
326 | // f) Call the methods which calculate correlations for reference flow; | |
327 | // g) Call the methods which calculate correlations for differential flow; | |
328 | // h) Call the methods which calculate correlations for 2D differential flow; | |
64e500e3 | 329 | // i) Call the methods which calculate other differential correlators; |
330 | // j) Distributions of correlations; | |
331 | // k) Store phi distribution for one event to illustrate flow; | |
332 | // l) Cross-check with nested loops correlators for reference flow; | |
333 | // m) Cross-check with nested loops correlators for differential flow; | |
334 | // n) Reset all event-by-event quantities (very important !!!!). | |
489d5531 | 335 | |
b3dacf6b | 336 | // a) Check all pointers used in this method: |
337 | this->CheckPointersUsedInMake(); | |
338 | ||
339 | // b) Define local variables: | |
489d5531 | 340 | Double_t dPhi = 0.; // azimuthal angle in the laboratory frame |
341 | Double_t dPt = 0.; // transverse momentum | |
342 | Double_t dEta = 0.; // pseudorapidity | |
489d5531 | 343 | Double_t wPhi = 1.; // phi weight |
344 | Double_t wPt = 1.; // pt weight | |
345 | Double_t wEta = 1.; // eta weight | |
38a1e8b3 | 346 | Double_t wTrack = 1.; // track weight |
d9e6d8bb | 347 | Int_t nCounterNoRPs = 0; // needed only for shuffling |
df23c5ae | 348 | fNumberOfRPsEBE = anEvent->GetNumberOfRPs(); // number of RPs (i.e. number of reference particles) |
d9e6d8bb | 349 | if(fExactNoRPs > 0 && fNumberOfRPsEBE<fExactNoRPs){return;} |
df23c5ae | 350 | fNumberOfPOIsEBE = anEvent->GetNumberOfPOIs(); // number of POIs (i.e. number of particles of interest) |
e5834fcb | 351 | fReferenceMultiplicityEBE = anEvent->GetReferenceMultiplicity(); // reference multiplicity for current event |
1268c371 | 352 | Double_t ptEta[2] = {0.,0.}; // 0 = dPt, 1 = dEta |
9f33751d | 353 | |
b3dacf6b | 354 | // c) Fill the common control histograms and call the method to fill fAvMultiplicity: |
489d5531 | 355 | this->FillCommonControlHistograms(anEvent); |
8d1c89ad | 356 | this->FillAverageMultiplicities((Int_t)(fNumberOfRPsEBE)); |
df23c5ae | 357 | if(fStoreControlHistograms){this->FillControlHistograms(anEvent);} |
489d5531 | 358 | |
1268c371 | 359 | // d) Loop over data and calculate e-b-e quantities Q_{n,k}, S_{p,k} and s_{p,k}: |
df23c5ae | 360 | Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = total number of primary tracks |
489d5531 | 361 | AliFlowTrackSimple *aftsTrack = NULL; |
1268c371 | 362 | Int_t n = fHarmonic; // shortcut for the harmonic |
489d5531 | 363 | for(Int_t i=0;i<nPrim;i++) |
364 | { | |
d9e6d8bb | 365 | if(fExactNoRPs > 0 && nCounterNoRPs>fExactNoRPs){continue;} |
489d5531 | 366 | aftsTrack=anEvent->GetTrack(i); |
367 | if(aftsTrack) | |
368 | { | |
1268c371 | 369 | if(!(aftsTrack->InRPSelection() || aftsTrack->InPOISelection())){continue;} // safety measure: consider only tracks which are RPs or POIs |
489d5531 | 370 | if(aftsTrack->InRPSelection()) // RP condition: |
371 | { | |
d9e6d8bb | 372 | nCounterNoRPs++; |
489d5531 | 373 | dPhi = aftsTrack->Phi(); |
374 | dPt = aftsTrack->Pt(); | |
375 | dEta = aftsTrack->Eta(); | |
376 | if(fUsePhiWeights && fPhiWeights && fnBinsPhi) // determine phi weight for this particle: | |
377 | { | |
378 | wPhi = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(dPhi*fnBinsPhi/TMath::TwoPi()))); | |
379 | } | |
380 | if(fUsePtWeights && fPtWeights && fnBinsPt) // determine pt weight for this particle: | |
381 | { | |
382 | wPt = fPtWeights->GetBinContent(1+(Int_t)(TMath::Floor((dPt-fPtMin)/fPtBinWidth))); | |
383 | } | |
384 | if(fUseEtaWeights && fEtaWeights && fEtaBinWidth) // determine eta weight for this particle: | |
385 | { | |
386 | wEta = fEtaWeights->GetBinContent(1+(Int_t)(TMath::Floor((dEta-fEtaMin)/fEtaBinWidth))); | |
38a1e8b3 | 387 | } |
388 | // Access track weight: | |
403e3389 | 389 | if(fUseTrackWeights) |
390 | { | |
391 | wTrack = aftsTrack->Weight(); | |
392 | } | |
e1d101a6 | 393 | // Calculate Re[Q_{m*n,k}] and Im[Q_{m*n,k}] for this event (m = 1,2,...,12, k = 0,1,...,8): |
394 | for(Int_t m=0;m<12;m++) // to be improved - hardwired 6 | |
489d5531 | 395 | { |
1268c371 | 396 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 |
489d5531 | 397 | { |
38a1e8b3 | 398 | (*fReQ)(m,k)+=pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1)*n*dPhi); |
399 | (*fImQ)(m,k)+=pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1)*n*dPhi); | |
489d5531 | 400 | } |
401 | } | |
1268c371 | 402 | // Calculate S_{p,k} for this event (Remark: final calculation of S_{p,k} follows after the loop over data bellow): |
489d5531 | 403 | for(Int_t p=0;p<8;p++) |
404 | { | |
405 | for(Int_t k=0;k<9;k++) | |
406 | { | |
38a1e8b3 | 407 | (*fSpk)(p,k)+=pow(wPhi*wPt*wEta*wTrack,k); |
489d5531 | 408 | } |
409 | } | |
1268c371 | 410 | // Differential flow: |
411 | if(fCalculateDiffFlow || fCalculate2DDiffFlow) | |
489d5531 | 412 | { |
1268c371 | 413 | ptEta[0] = dPt; |
414 | ptEta[1] = dEta; | |
415 | // Calculate r_{m*n,k} and s_{p,k} (r_{m,k} is 'p-vector' for RPs): | |
416 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
489d5531 | 417 | { |
1268c371 | 418 | for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 |
489d5531 | 419 | { |
1268c371 | 420 | if(fCalculateDiffFlow) |
421 | { | |
62e36168 | 422 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
1268c371 | 423 | { |
38a1e8b3 | 424 | fReRPQ1dEBE[0][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
425 | fImRPQ1dEBE[0][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 426 | if(m==0) // s_{p,k} does not depend on index m |
427 | { | |
38a1e8b3 | 428 | fs1dEBE[0][pe][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k),1.); |
1268c371 | 429 | } // end of if(m==0) // s_{p,k} does not depend on index m |
430 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
431 | } // end of if(fCalculateDiffFlow) | |
432 | if(fCalculate2DDiffFlow) | |
433 | { | |
38a1e8b3 | 434 | fReRPQ2dEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
435 | fImRPQ2dEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 436 | if(m==0) // s_{p,k} does not depend on index m |
437 | { | |
38a1e8b3 | 438 | fs2dEBE[0][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k),1.); |
1268c371 | 439 | } // end of if(m==0) // s_{p,k} does not depend on index m |
440 | } // end of if(fCalculate2DDiffFlow) | |
441 | } // end of for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 | |
442 | } // end of for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
443 | // Checking if RP particle is also POI particle: | |
444 | if(aftsTrack->InPOISelection()) | |
489d5531 | 445 | { |
1268c371 | 446 | // Calculate q_{m*n,k} and s_{p,k} ('q-vector' and 's' for RPs && POIs): |
447 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
489d5531 | 448 | { |
1268c371 | 449 | for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 |
489d5531 | 450 | { |
1268c371 | 451 | if(fCalculateDiffFlow) |
452 | { | |
62e36168 | 453 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
1268c371 | 454 | { |
38a1e8b3 | 455 | fReRPQ1dEBE[2][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
456 | fImRPQ1dEBE[2][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 457 | if(m==0) // s_{p,k} does not depend on index m |
458 | { | |
38a1e8b3 | 459 | fs1dEBE[2][pe][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k),1.); |
1268c371 | 460 | } // end of if(m==0) // s_{p,k} does not depend on index m |
461 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
462 | } // end of if(fCalculateDiffFlow) | |
463 | if(fCalculate2DDiffFlow) | |
464 | { | |
38a1e8b3 | 465 | fReRPQ2dEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
466 | fImRPQ2dEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 467 | if(m==0) // s_{p,k} does not depend on index m |
468 | { | |
38a1e8b3 | 469 | fs2dEBE[2][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k),1.); |
1268c371 | 470 | } // end of if(m==0) // s_{p,k} does not depend on index m |
471 | } // end of if(fCalculate2DDiffFlow) | |
472 | } // end of for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 | |
473 | } // end of for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
474 | } // end of if(aftsTrack->InPOISelection()) | |
475 | } // end of if(fCalculateDiffFlow || fCalculate2DDiffFlow) | |
489d5531 | 476 | } // end of if(pTrack->InRPSelection()) |
489d5531 | 477 | if(aftsTrack->InPOISelection()) |
478 | { | |
479 | dPhi = aftsTrack->Phi(); | |
480 | dPt = aftsTrack->Pt(); | |
481 | dEta = aftsTrack->Eta(); | |
38a1e8b3 | 482 | wPhi = 1.; |
483 | wPt = 1.; | |
484 | wEta = 1.; | |
485 | wTrack = 1.; | |
486 | if(fUsePhiWeights && fPhiWeights && fnBinsPhi && aftsTrack->InRPSelection()) // determine phi weight for POI && RP particle: | |
487 | { | |
488 | wPhi = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(dPhi*fnBinsPhi/TMath::TwoPi()))); | |
489 | } | |
490 | if(fUsePtWeights && fPtWeights && fnBinsPt && aftsTrack->InRPSelection()) // determine pt weight for POI && RP particle: | |
491 | { | |
492 | wPt = fPtWeights->GetBinContent(1+(Int_t)(TMath::Floor((dPt-fPtMin)/fPtBinWidth))); | |
493 | } | |
494 | if(fUseEtaWeights && fEtaWeights && fEtaBinWidth && aftsTrack->InRPSelection()) // determine eta weight for POI && RP particle: | |
495 | { | |
496 | wEta = fEtaWeights->GetBinContent(1+(Int_t)(TMath::Floor((dEta-fEtaMin)/fEtaBinWidth))); | |
497 | } | |
498 | // Access track weight for POI && RP particle: | |
403e3389 | 499 | if(aftsTrack->InRPSelection() && fUseTrackWeights) |
38a1e8b3 | 500 | { |
501 | wTrack = aftsTrack->Weight(); | |
502 | } | |
1268c371 | 503 | ptEta[0] = dPt; |
504 | ptEta[1] = dEta; | |
505 | // Calculate p_{m*n,k} ('p-vector' for POIs): | |
506 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
489d5531 | 507 | { |
1268c371 | 508 | for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 |
489d5531 | 509 | { |
1268c371 | 510 | if(fCalculateDiffFlow) |
511 | { | |
62e36168 | 512 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
1268c371 | 513 | { |
38a1e8b3 | 514 | fReRPQ1dEBE[1][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
515 | fImRPQ1dEBE[1][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 516 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta |
517 | } // end of if(fCalculateDiffFlow) | |
518 | if(fCalculate2DDiffFlow) | |
519 | { | |
38a1e8b3 | 520 | fReRPQ2dEBE[1][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
521 | fImRPQ2dEBE[1][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 522 | } // end of if(fCalculate2DDiffFlow) |
523 | } // end of for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 | |
524 | } // end of for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
b77b6434 | 525 | } // end of if(pTrack->InPOISelection()) |
489d5531 | 526 | } else // to if(aftsTrack) |
527 | { | |
38a1e8b3 | 528 | printf("\n WARNING (QC): No particle (i.e. aftsTrack is a NULL pointer in AFAWQC::Make())!!!!\n\n"); |
489d5531 | 529 | } |
530 | } // end of for(Int_t i=0;i<nPrim;i++) | |
531 | ||
1268c371 | 532 | // e) Calculate the final expressions for S_{p,k} and s_{p,k} (important !!!!): |
489d5531 | 533 | for(Int_t p=0;p<8;p++) |
534 | { | |
535 | for(Int_t k=0;k<9;k++) | |
536 | { | |
1268c371 | 537 | (*fSpk)(p,k)=pow((*fSpk)(p,k),p+1); |
538 | // ... for the time being s_{p,k} dosn't need higher powers, so no need to finalize it here ... | |
539 | } // end of for(Int_t k=0;k<9;k++) | |
540 | } // end of for(Int_t p=0;p<8;p++) | |
489d5531 | 541 | |
1268c371 | 542 | // f) Call the methods which calculate correlations for reference flow: |
489d5531 | 543 | if(!fEvaluateIntFlowNestedLoops) |
544 | { | |
403e3389 | 545 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 546 | { |
df23c5ae | 547 | if(fNumberOfRPsEBE>1){this->CalculateIntFlowCorrelations();} // without using particle weights |
403e3389 | 548 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 549 | { |
df23c5ae | 550 | if(fNumberOfRPsEBE>1){this->CalculateIntFlowCorrelationsUsingParticleWeights();} // with using particle weights |
1268c371 | 551 | } |
552 | // Whether or not using particle weights the following is calculated in the same way: | |
df23c5ae | 553 | if(fNumberOfRPsEBE>3){this->CalculateIntFlowProductOfCorrelations();} |
554 | if(fNumberOfRPsEBE>1){this->CalculateIntFlowSumOfEventWeights();} | |
555 | if(fNumberOfRPsEBE>1){this->CalculateIntFlowSumOfProductOfEventWeights();} | |
1268c371 | 556 | // Non-isotropic terms: |
403e3389 | 557 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 558 | { |
df23c5ae | 559 | if(fNumberOfRPsEBE>0){this->CalculateIntFlowCorrectionsForNUASinTerms();} |
560 | if(fNumberOfRPsEBE>0){this->CalculateIntFlowCorrectionsForNUACosTerms();} | |
403e3389 | 561 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
b92ea2b9 | 562 | { |
df23c5ae | 563 | if(fNumberOfRPsEBE>0){this->CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights();} |
564 | if(fNumberOfRPsEBE>0){this->CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights();} | |
1268c371 | 565 | } |
566 | // Whether or not using particle weights the following is calculated in the same way: | |
df23c5ae | 567 | if(fNumberOfRPsEBE>0){this->CalculateIntFlowProductOfCorrectionTermsForNUA();} |
568 | if(fNumberOfRPsEBE>0){this->CalculateIntFlowSumOfEventWeightsNUA();} | |
569 | if(fNumberOfRPsEBE>0){this->CalculateIntFlowSumOfProductOfEventWeightsNUA();} | |
e1d101a6 | 570 | // Mixed harmonics: |
571 | if(fCalculateMixedHarmonics){this->CalculateMixedHarmonics();} | |
489d5531 | 572 | } // end of if(!fEvaluateIntFlowNestedLoops) |
573 | ||
1268c371 | 574 | // g) Call the methods which calculate correlations for differential flow: |
575 | if(!fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) | |
489d5531 | 576 | { |
403e3389 | 577 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 578 | { |
1268c371 | 579 | // Without using particle weights: |
489d5531 | 580 | this->CalculateDiffFlowCorrelations("RP","Pt"); |
62e36168 | 581 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrelations("RP","Eta");} |
489d5531 | 582 | this->CalculateDiffFlowCorrelations("POI","Pt"); |
62e36168 | 583 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrelations("POI","Eta");} |
1268c371 | 584 | // Non-isotropic terms: |
b92ea2b9 | 585 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Pt"); |
62e36168 | 586 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Eta");} |
b92ea2b9 | 587 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Pt"); |
62e36168 | 588 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Eta");} |
b92ea2b9 | 589 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Pt"); |
62e36168 | 590 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Eta");} |
b92ea2b9 | 591 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Pt"); |
62e36168 | 592 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Eta");} |
403e3389 | 593 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 594 | { |
1268c371 | 595 | // With using particle weights: |
489d5531 | 596 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Pt"); |
62e36168 | 597 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Eta");} |
489d5531 | 598 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Pt"); |
62e36168 | 599 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Eta");} |
1268c371 | 600 | // Non-isotropic terms: |
b92ea2b9 | 601 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Pt"); |
62e36168 | 602 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Eta");} |
b92ea2b9 | 603 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Pt"); |
62e36168 | 604 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Eta");} |
b92ea2b9 | 605 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Pt"); |
62e36168 | 606 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Eta");} |
b92ea2b9 | 607 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Pt"); |
62e36168 | 608 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Eta");} |
1268c371 | 609 | } |
610 | // Whether or not using particle weights the following is calculated in the same way: | |
489d5531 | 611 | this->CalculateDiffFlowProductOfCorrelations("RP","Pt"); |
62e36168 | 612 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowProductOfCorrelations("RP","Eta");} |
489d5531 | 613 | this->CalculateDiffFlowProductOfCorrelations("POI","Pt"); |
62e36168 | 614 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowProductOfCorrelations("POI","Eta");} |
489d5531 | 615 | this->CalculateDiffFlowSumOfEventWeights("RP","Pt"); |
62e36168 | 616 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowSumOfEventWeights("RP","Eta");} |
489d5531 | 617 | this->CalculateDiffFlowSumOfEventWeights("POI","Pt"); |
62e36168 | 618 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowSumOfEventWeights("POI","Eta");} |
489d5531 | 619 | this->CalculateDiffFlowSumOfProductOfEventWeights("RP","Pt"); |
62e36168 | 620 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowSumOfProductOfEventWeights("RP","Eta");} |
489d5531 | 621 | this->CalculateDiffFlowSumOfProductOfEventWeights("POI","Pt"); |
62e36168 | 622 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowSumOfProductOfEventWeights("POI","Eta");} |
1268c371 | 623 | } // end of if(!fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) |
489d5531 | 624 | |
1268c371 | 625 | // h) Call the methods which calculate correlations for 2D differential flow: |
626 | if(!fEvaluateDiffFlowNestedLoops && fCalculate2DDiffFlow) | |
627 | { | |
403e3389 | 628 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 629 | { |
1268c371 | 630 | // Without using particle weights: |
631 | this->Calculate2DDiffFlowCorrelations("RP"); | |
632 | this->Calculate2DDiffFlowCorrelations("POI"); | |
633 | // Non-isotropic terms: | |
634 | // ... to be ctd ... | |
403e3389 | 635 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
1268c371 | 636 | { |
637 | // With using particle weights: | |
638 | // ... to be ctd ... | |
639 | // Non-isotropic terms: | |
640 | // ... to be ctd ... | |
641 | } | |
642 | // Whether or not using particle weights the following is calculated in the same way: | |
643 | // ... to be ctd ... | |
644 | } // end of if(!fEvaluateDiffFlowNestedLoops && fCalculate2DDiffFlow) | |
64e500e3 | 645 | |
646 | // i) Call the methods which calculate other differential correlators: | |
b84464d3 | 647 | if(!fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) |
64e500e3 | 648 | { |
403e3389 | 649 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
64e500e3 | 650 | { |
651 | // Without using particle weights: | |
652 | this->CalculateOtherDiffCorrelators("RP","Pt"); | |
62e36168 | 653 | if(fCalculateDiffFlowVsEta){this->CalculateOtherDiffCorrelators("RP","Eta");} |
64e500e3 | 654 | this->CalculateOtherDiffCorrelators("POI","Pt"); |
62e36168 | 655 | if(fCalculateDiffFlowVsEta){this->CalculateOtherDiffCorrelators("POI","Eta");} |
403e3389 | 656 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
64e500e3 | 657 | { |
658 | // With using particle weights: | |
659 | // ... to be ctd ... | |
660 | } | |
661 | // Whether or not using particle weights the following is calculated in the same way: | |
662 | // ... to be ctd ... | |
663 | } // end of if(!fEvaluateDiffFlowNestedLoops) | |
664 | ||
665 | // j) Distributions of correlations: | |
e5834fcb | 666 | if(fStoreDistributions){this->StoreDistributionsOfCorrelations();} |
667 | ||
64e500e3 | 668 | // k) Store phi distribution for one event to illustrate flow: |
e5834fcb | 669 | if(fStorePhiDistributionForOneEvent){this->StorePhiDistributionForOneEvent(anEvent);} |
1268c371 | 670 | |
64e500e3 | 671 | // l) Cross-check with nested loops correlators for reference flow: |
1268c371 | 672 | if(fEvaluateIntFlowNestedLoops){this->EvaluateIntFlowNestedLoops(anEvent);} |
673 | ||
64e500e3 | 674 | // m) Cross-check with nested loops correlators for differential flow: |
1268c371 | 675 | if(fEvaluateDiffFlowNestedLoops){this->EvaluateDiffFlowNestedLoops(anEvent);} |
489d5531 | 676 | |
64e500e3 | 677 | // n) Reset all event-by-event quantities (very important !!!!): |
489d5531 | 678 | this->ResetEventByEventQuantities(); |
679 | ||
680 | } // end of AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent) | |
681 | ||
e1d101a6 | 682 | //======================================================================================================================= |
489d5531 | 683 | |
489d5531 | 684 | void AliFlowAnalysisWithQCumulants::Finish() |
685 | { | |
686 | // Calculate the final results. | |
489d5531 | 687 | |
b3dacf6b | 688 | // a) Check all pointers used in this method; |
e1d101a6 | 689 | // b) Access the constants; |
b3dacf6b | 690 | // c) Access the flags; |
b92ea2b9 | 691 | // d) Calculate reference cumulants (not corrected for detector effects); |
692 | // e) Correct reference cumulants for detector effects; | |
693 | // f) Calculate reference flow; | |
b77b6434 | 694 | // g) Store results for reference flow in AliFlowCommonHistResults and print them on the screen; |
b92ea2b9 | 695 | // h) Calculate the final results for differential flow (without/with weights); |
696 | // i) Correct the results for differential flow (without/with weights) for effects of non-uniform acceptance (NUA); | |
697 | // j) Calculate the final results for integrated flow (RP/POI) and store in AliFlowCommonHistResults; | |
698 | // k) Store results for differential flow in AliFlowCommonHistResults; | |
699 | // l) Print the final results for integrated flow (RP/POI) on the screen; | |
e1d101a6 | 700 | // m) Cross-checking: Results from Q-vectors vs results from nested loops; |
701 | // i) Calculate cumulants for mixed harmonics. | |
702 | ||
b3dacf6b | 703 | // a) Check all pointers used in this method: |
704 | this->CheckPointersUsedInFinish(); | |
705 | ||
e1d101a6 | 706 | // b) Access the constants: |
1268c371 | 707 | this->CommonConstants("Finish"); |
489d5531 | 708 | |
b3dacf6b | 709 | if(fCommonHists && fCommonHists->GetHarmonic()) // to be improved (moved somewhere else) |
489d5531 | 710 | { |
b3dacf6b | 711 | fHarmonic = (Int_t)(fCommonHists->GetHarmonic())->GetBinContent(1); |
489d5531 | 712 | } |
b3dacf6b | 713 | |
e1d101a6 | 714 | // c) Access the flags: // to be improved (implement a method for this? should I store again the flags because they can get modified with redoFinish?) |
b3dacf6b | 715 | fUsePhiWeights = (Bool_t)fUseParticleWeights->GetBinContent(1); |
716 | fUsePtWeights = (Bool_t)fUseParticleWeights->GetBinContent(2); | |
717 | fUseEtaWeights = (Bool_t)fUseParticleWeights->GetBinContent(3); | |
403e3389 | 718 | fUseTrackWeights = (Bool_t)fUseParticleWeights->GetBinContent(4); |
b3dacf6b | 719 | fApplyCorrectionForNUA = (Bool_t)fIntFlowFlags->GetBinContent(3); |
720 | fPrintFinalResults[0] = (Bool_t)fIntFlowFlags->GetBinContent(4); | |
721 | fPrintFinalResults[1] = (Bool_t)fIntFlowFlags->GetBinContent(5); | |
722 | fPrintFinalResults[2] = (Bool_t)fIntFlowFlags->GetBinContent(6); | |
723 | fPrintFinalResults[3] = (Bool_t)fIntFlowFlags->GetBinContent(7); | |
724 | fApplyCorrectionForNUAVsM = (Bool_t)fIntFlowFlags->GetBinContent(8); | |
b77b6434 | 725 | fPropagateErrorAlsoFromNIT = (Bool_t)fIntFlowFlags->GetBinContent(9); |
0dd3b008 | 726 | fCalculateCumulantsVsM = (Bool_t)fIntFlowFlags->GetBinContent(10); |
727 | fMinimumBiasReferenceFlow = (Bool_t)fIntFlowFlags->GetBinContent(11); | |
e5834fcb | 728 | fForgetAboutCovariances = (Bool_t)fIntFlowFlags->GetBinContent(12); |
729 | fStorePhiDistributionForOneEvent = (Bool_t)fIntFlowFlags->GetBinContent(13); | |
3435cacb | 730 | fFillMultipleControlHistograms = (Bool_t)fIntFlowFlags->GetBinContent(14); |
731 | fCalculateAllCorrelationsVsM = (Bool_t)fIntFlowFlags->GetBinContent(15); | |
1db7eced | 732 | fUse2DHistograms = (Bool_t)fIntFlowFlags->GetBinContent(18); |
733 | fFillProfilesVsMUsingWeights = (Bool_t)fIntFlowFlags->GetBinContent(19); | |
734 | fUseQvectorTerms = (Bool_t)fIntFlowFlags->GetBinContent(20); | |
b3dacf6b | 735 | fEvaluateIntFlowNestedLoops = (Bool_t)fEvaluateNestedLoops->GetBinContent(1); |
736 | fEvaluateDiffFlowNestedLoops = (Bool_t)fEvaluateNestedLoops->GetBinContent(2); | |
489d5531 | 737 | fCrossCheckInPtBinNo = (Int_t)fEvaluateNestedLoops->GetBinContent(3); |
738 | fCrossCheckInEtaBinNo = (Int_t)fEvaluateNestedLoops->GetBinContent(4); | |
e1d101a6 | 739 | fCalculateMixedHarmonics = (Bool_t)fMixedHarmonicsFlags->GetBinContent(1); |
740 | //fHarmonic = (Int_t)fMixedHarmonicsFlags->GetBinContent(2); // TBI should I add inpdependent generic harmonic here? | |
741 | fCalculateMixedHarmonicsVsM = (Bool_t)fMixedHarmonicsFlags->GetBinContent(3); | |
742 | ||
b92ea2b9 | 743 | // d) Calculate reference cumulants (not corrected for detector effects): |
489d5531 | 744 | this->FinalizeCorrelationsIntFlow(); |
745 | this->CalculateCovariancesIntFlow(); | |
746 | this->CalculateCumulantsIntFlow(); | |
489d5531 | 747 | |
b92ea2b9 | 748 | // e) Correct reference cumulants for detector effects: |
749 | this->FinalizeCorrectionTermsForNUAIntFlow(); | |
750 | this->CalculateCovariancesNUAIntFlow(); | |
751 | this->CalculateQcumulantsCorrectedForNUAIntFlow(); | |
752 | ||
753 | // f) Calculate reference flow: | |
754 | this->CalculateReferenceFlow(); | |
489d5531 | 755 | |
b77b6434 | 756 | // g) Store results for reference flow in AliFlowCommonHistResults and print them on the screen: |
489d5531 | 757 | this->FillCommonHistResultsIntFlow(); |
b3dacf6b | 758 | if(fPrintFinalResults[0]){this->PrintFinalResultsForIntegratedFlow("RF");} |
759 | if(fPrintFinalResults[3] && fCalculateCumulantsVsM){this->PrintFinalResultsForIntegratedFlow("RF, rebinned in M");} | |
489d5531 | 760 | |
1268c371 | 761 | // h) Calculate the final results for differential flow (without/with weights): |
762 | if(fCalculateDiffFlow) | |
763 | { | |
764 | this->FinalizeReducedCorrelations("RP","Pt"); | |
62e36168 | 765 | if(fCalculateDiffFlowVsEta){this->FinalizeReducedCorrelations("RP","Eta");} |
1268c371 | 766 | this->FinalizeReducedCorrelations("POI","Pt"); |
62e36168 | 767 | if(fCalculateDiffFlowVsEta){this->FinalizeReducedCorrelations("POI","Eta");} |
1268c371 | 768 | this->CalculateDiffFlowCovariances("RP","Pt"); |
62e36168 | 769 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCovariances("RP","Eta");} |
1268c371 | 770 | this->CalculateDiffFlowCovariances("POI","Pt"); |
62e36168 | 771 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCovariances("POI","Eta");} |
1268c371 | 772 | this->CalculateDiffFlowCumulants("RP","Pt"); |
62e36168 | 773 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCumulants("RP","Eta");} |
1268c371 | 774 | this->CalculateDiffFlowCumulants("POI","Pt"); |
62e36168 | 775 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCumulants("POI","Eta");} |
1268c371 | 776 | this->CalculateDiffFlow("RP","Pt"); |
62e36168 | 777 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlow("RP","Eta");} |
1268c371 | 778 | this->CalculateDiffFlow("POI","Pt"); |
62e36168 | 779 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlow("POI","Eta");} |
1268c371 | 780 | } // if(fCalculateDiffFlow) |
781 | ||
782 | // i) Correct the results for differential flow (without/with weights) for effects of non-uniform acceptance (NUA): | |
783 | if(fCalculateDiffFlow) | |
489d5531 | 784 | { |
785 | this->FinalizeCorrectionTermsForNUADiffFlow("RP","Pt"); | |
62e36168 | 786 | if(fCalculateDiffFlowVsEta){this->FinalizeCorrectionTermsForNUADiffFlow("RP","Eta");} |
489d5531 | 787 | this->FinalizeCorrectionTermsForNUADiffFlow("POI","Pt"); |
62e36168 | 788 | if(fCalculateDiffFlowVsEta){this->FinalizeCorrectionTermsForNUADiffFlow("POI","Eta");} |
489d5531 | 789 | this->CalculateDiffFlowCumulantsCorrectedForNUA("RP","Pt"); |
62e36168 | 790 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCumulantsCorrectedForNUA("RP","Eta");} |
489d5531 | 791 | this->CalculateDiffFlowCumulantsCorrectedForNUA("POI","Pt"); |
62e36168 | 792 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCumulantsCorrectedForNUA("POI","Eta");} |
1268c371 | 793 | if(fApplyCorrectionForNUA) |
794 | { | |
795 | this->CalculateDiffFlowCorrectedForNUA("RP","Pt"); | |
62e36168 | 796 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectedForNUA("RP","Eta");} |
1268c371 | 797 | this->CalculateDiffFlowCorrectedForNUA("POI","Pt"); |
62e36168 | 798 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectedForNUA("POI","Eta");} |
1268c371 | 799 | } |
800 | } // end of if(fCalculateDiffFlow && fApplyCorrectionForNUA) | |
801 | ||
802 | // i) Calcualate final results for 2D differential flow: | |
803 | if(fCalculate2DDiffFlow) | |
804 | { | |
805 | this->Calculate2DDiffFlowCumulants("RP"); | |
806 | this->Calculate2DDiffFlowCumulants("POI"); | |
807 | this->Calculate2DDiffFlow("RP"); | |
808 | this->Calculate2DDiffFlow("POI"); | |
809 | } // end of if(fCalculate2DDiffFlow) | |
810 | ||
811 | // j) Calculate the final results for integrated flow (RP/POI) and store in AliFlowCommonHistResults: | |
812 | if(fCalculateDiffFlow) | |
813 | { | |
814 | this->CalculateFinalResultsForRPandPOIIntegratedFlow("RP"); | |
815 | this->CalculateFinalResultsForRPandPOIIntegratedFlow("POI"); | |
3b552efe | 816 | } |
489d5531 | 817 | |
1268c371 | 818 | // k) Store results for differential flow in AliFlowCommonHistResults: |
819 | if(fCalculateDiffFlow) | |
820 | { | |
821 | this->FillCommonHistResultsDiffFlow("RP"); | |
822 | this->FillCommonHistResultsDiffFlow("POI"); | |
823 | } | |
824 | ||
825 | // l) Print the final results for integrated flow (RP/POI) on the screen: | |
826 | if(fPrintFinalResults[1] && fCalculateDiffFlow){this->PrintFinalResultsForIntegratedFlow("RP");} | |
827 | if(fPrintFinalResults[2] && fCalculateDiffFlow){this->PrintFinalResultsForIntegratedFlow("POI");} | |
828 | ||
829 | // m) Cross-checking: Results from Q-vectors vs results from nested loops: | |
830 | // m1) Reference flow: | |
489d5531 | 831 | if(fEvaluateIntFlowNestedLoops) |
832 | { | |
833 | this->CrossCheckIntFlowCorrelations(); | |
834 | this->CrossCheckIntFlowCorrectionTermsForNUA(); | |
e1d101a6 | 835 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights){this->CrossCheckIntFlowExtraCorrelations();} |
836 | if(fCalculateMixedHarmonics){this->CrossCheckIntFlowCorrelations();} | |
489d5531 | 837 | } // end of if(fEvaluateIntFlowNestedLoops) |
1268c371 | 838 | // m2) Differential flow: |
839 | if(fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) | |
489d5531 | 840 | { |
b3dacf6b | 841 | // Correlations: |
489d5531 | 842 | this->PrintNumberOfParticlesInSelectedBin(); |
843 | this->CrossCheckDiffFlowCorrelations("RP","Pt"); | |
62e36168 | 844 | if(fCalculateDiffFlowVsEta){this->CrossCheckDiffFlowCorrelations("RP","Eta");} |
489d5531 | 845 | this->CrossCheckDiffFlowCorrelations("POI","Pt"); |
62e36168 | 846 | if(fCalculateDiffFlowVsEta){this->CrossCheckDiffFlowCorrelations("POI","Eta");} |
b3dacf6b | 847 | // Correction terms for non-uniform acceptance: |
489d5531 | 848 | this->CrossCheckDiffFlowCorrectionTermsForNUA("RP","Pt"); |
62e36168 | 849 | if(fCalculateDiffFlowVsEta){this->CrossCheckDiffFlowCorrectionTermsForNUA("RP","Eta");} |
489d5531 | 850 | this->CrossCheckDiffFlowCorrectionTermsForNUA("POI","Pt"); |
62e36168 | 851 | if(fCalculateDiffFlowVsEta){this->CrossCheckDiffFlowCorrectionTermsForNUA("POI","Eta");} |
64e500e3 | 852 | // Other differential correlators: |
853 | this->CrossCheckOtherDiffCorrelators("RP","Pt"); | |
62e36168 | 854 | if(fCalculateDiffFlowVsEta){this->CrossCheckOtherDiffCorrelators("RP","Eta");} |
64e500e3 | 855 | this->CrossCheckOtherDiffCorrelators("POI","Pt"); |
62e36168 | 856 | if(fCalculateDiffFlowVsEta){this->CrossCheckOtherDiffCorrelators("POI","Eta");} |
489d5531 | 857 | } // end of if(fEvaluateDiffFlowNestedLoops) |
e1d101a6 | 858 | |
859 | // i) Calculate cumulants for mixed harmonics: | |
860 | if(fCalculateMixedHarmonics){this->CalculateCumulantsMixedHarmonics();} | |
861 | ||
489d5531 | 862 | } // end of AliFlowAnalysisWithQCumulants::Finish() |
863 | ||
e1d101a6 | 864 | //======================================================================================================================= |
489d5531 | 865 | |
1268c371 | 866 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowNestedLoops(AliFlowEventSimple* anEvent) |
867 | { | |
e1d101a6 | 868 | // Evaluate all correlators for reference flow with nested loops. |
1268c371 | 869 | |
df23c5ae | 870 | Int_t nPrim = anEvent->NumberOfTracks(); // number of primaries |
1268c371 | 871 | if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 |
872 | { | |
873 | // Without using particle weights: | |
403e3389 | 874 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
1268c371 | 875 | { |
876 | // Correlations: | |
877 | this->CalculateIntFlowCorrelations(); // from Q-vectors | |
e1d101a6 | 878 | this->EvaluateIntFlowCorrelationsWithNestedLoops(anEvent); // from nested loops (TBI: do I have to pass here anEvent or not?) |
1268c371 | 879 | // Correction for non-uniform acceptance: |
880 | this->CalculateIntFlowCorrectionsForNUASinTerms(); // from Q-vectors (sin terms) | |
881 | this->CalculateIntFlowCorrectionsForNUACosTerms(); // from Q-vectors (cos terms) | |
882 | this->EvaluateIntFlowCorrectionsForNUAWithNestedLoops(anEvent); // from nested loops (both sin and cos terms) | |
e1d101a6 | 883 | // Mixed harmonics: |
884 | if(fCalculateMixedHarmonics) | |
885 | { | |
886 | this->CalculateMixedHarmonics(); // from Q-vectors | |
887 | this->EvaluateMixedHarmonicsWithNestedLoops(anEvent); // from nested loops (TBI: do I have to pass here anEvent or not?) | |
888 | } // end of if(fCalculateMixedHarmonics) | |
1268c371 | 889 | } |
890 | // Using particle weights: | |
403e3389 | 891 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
1268c371 | 892 | { |
893 | // Correlations | |
894 | this->CalculateIntFlowCorrelationsUsingParticleWeights(); // from Q-vectors | |
895 | this->EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent); // from nested loops (to be improved: do I have to pass here anEvent or not?) | |
896 | // Correction for non-uniform acceptance: | |
897 | this->CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights(); // from Q-vectors (sin terms) | |
898 | this->CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights(); // from Q-vectors (cos terms) | |
899 | this->EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(anEvent); // from nested loops (both sin and cos terms) | |
900 | } | |
901 | } else if(nPrim>fMaxAllowedMultiplicity) // to if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) | |
902 | { | |
903 | cout<<endl; | |
904 | cout<<"Skipping the event because multiplicity is "<<nPrim<<". Too high to evaluate nested loops!"<<endl; | |
905 | } else | |
906 | { | |
907 | cout<<endl; | |
908 | cout<<"Skipping the event because multiplicity is "<<nPrim<<"."<<endl; | |
909 | } | |
910 | ||
911 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowNestedLoops(AliFlowEventSimple* anEvent) | |
912 | ||
e1d101a6 | 913 | //======================================================================================================================= |
1268c371 | 914 | |
915 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowNestedLoops(AliFlowEventSimple* anEvent) | |
916 | { | |
917 | // Evalauted all correlators for differential flow with nested loops. | |
918 | ||
919 | if(!fCalculateDiffFlow){return;} | |
920 | ||
df23c5ae | 921 | Int_t nPrim = anEvent->NumberOfTracks(); // number of primaries |
1268c371 | 922 | if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 |
923 | { | |
924 | // Without using particle weights: | |
403e3389 | 925 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
1268c371 | 926 | { |
64e500e3 | 927 | // 1.) Reduced correlations: |
1268c371 | 928 | // Q-vectors: |
929 | this->CalculateDiffFlowCorrelations("RP","Pt"); | |
930 | this->CalculateDiffFlowCorrelations("RP","Eta"); | |
931 | this->CalculateDiffFlowCorrelations("POI","Pt"); | |
932 | this->CalculateDiffFlowCorrelations("POI","Eta"); | |
933 | // Nested loops: | |
934 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"RP","Pt"); | |
935 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"RP","Eta"); | |
936 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"POI","Pt"); | |
937 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"POI","Eta"); | |
64e500e3 | 938 | // 2.) Reduced corrections for non-uniform acceptance: |
1268c371 | 939 | // Q-vectors: |
940 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Pt"); | |
941 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Eta"); | |
942 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Pt"); | |
943 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Eta"); | |
944 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Pt"); | |
945 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Eta"); | |
946 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Pt"); | |
947 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Eta"); | |
948 | // Nested loops: | |
949 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"RP","Pt"); | |
950 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"RP","Eta"); | |
951 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"POI","Pt"); | |
952 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"POI","Eta"); | |
64e500e3 | 953 | // 3.) Other differential correlators: |
954 | // Q-vectors: | |
955 | this->CalculateOtherDiffCorrelators("RP","Pt"); | |
956 | this->CalculateOtherDiffCorrelators("RP","Eta"); | |
957 | this->CalculateOtherDiffCorrelators("POI","Pt"); | |
958 | this->CalculateOtherDiffCorrelators("POI","Eta"); | |
959 | // Nested loops: | |
960 | this->EvaluateOtherDiffCorrelatorsWithNestedLoops(anEvent,"RP","Pt"); | |
961 | this->EvaluateOtherDiffCorrelatorsWithNestedLoops(anEvent,"RP","Eta"); | |
962 | this->EvaluateOtherDiffCorrelatorsWithNestedLoops(anEvent,"POI","Pt"); | |
963 | this->EvaluateOtherDiffCorrelatorsWithNestedLoops(anEvent,"POI","Eta"); | |
403e3389 | 964 | } // end of if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
1268c371 | 965 | // Using particle weights: |
403e3389 | 966 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
1268c371 | 967 | { |
968 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Pt"); | |
969 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Eta"); | |
970 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Pt"); | |
971 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Eta"); | |
972 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Pt"); | |
973 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Eta"); | |
974 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Pt"); | |
975 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Eta"); | |
976 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Pt"); | |
977 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Eta"); | |
978 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Pt"); | |
979 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Eta"); | |
980 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"RP","Pt"); | |
981 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"RP","Eta"); | |
982 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"POI","Pt"); | |
983 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"POI","Eta"); | |
984 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"RP","Pt"); | |
985 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"RP","Eta"); | |
986 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"POI","Pt"); | |
987 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"POI","Eta"); | |
403e3389 | 988 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
1268c371 | 989 | } // end of if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 |
990 | ||
991 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowNestedLoops(AliFlowEventSimple* anEvent) | |
992 | ||
e1d101a6 | 993 | //======================================================================================================================= |
1268c371 | 994 | |
489d5531 | 995 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTerms() |
996 | { | |
b92ea2b9 | 997 | // Calculate correction terms for non-uniform acceptance of the detector for reference flow (cos terms). |
489d5531 | 998 | |
999 | // multiplicity: | |
1268c371 | 1000 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 1001 | |
1002 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
1003 | Double_t dReQ1n = (*fReQ)(0,0); | |
1004 | Double_t dReQ2n = (*fReQ)(1,0); | |
1005 | //Double_t dReQ3n = (*fReQ)(2,0); | |
1006 | //Double_t dReQ4n = (*fReQ)(3,0); | |
1007 | Double_t dImQ1n = (*fImQ)(0,0); | |
1008 | Double_t dImQ2n = (*fImQ)(1,0); | |
1009 | //Double_t dImQ3n = (*fImQ)(2,0); | |
1010 | //Double_t dImQ4n = (*fImQ)(3,0); | |
3842bdcd | 1011 | |
1012 | // Multiplicity bin of an event (relevant for all histos vs M): | |
1013 | Double_t dMultiplicityBin = 0.; | |
df23c5ae | 1014 | if(fMultiplicityIs==AliFlowCommonConstants::kRP) |
3842bdcd | 1015 | { |
df23c5ae | 1016 | dMultiplicityBin = fNumberOfRPsEBE+0.5; |
1017 | } else if(fMultiplicityIs==AliFlowCommonConstants::kExternal) | |
3842bdcd | 1018 | { |
1019 | dMultiplicityBin = fReferenceMultiplicityEBE+0.5; | |
df23c5ae | 1020 | } else if(fMultiplicityIs==AliFlowCommonConstants::kPOI) |
1021 | { | |
1022 | dMultiplicityBin = fNumberOfPOIsEBE+0.5; | |
1023 | } | |
1024 | ||
489d5531 | 1025 | // ************************************************************* |
1026 | // **** corrections for non-uniform acceptance (cos terms): **** | |
1027 | // ************************************************************* | |
1028 | // | |
1029 | // Remark 1: corrections for non-uniform acceptance (cos terms) calculated with non-weighted Q-vectors | |
1030 | // are stored in 1D profile fQCorrectionsCos. | |
1031 | // Remark 2: binning of fIntFlowCorrectionTermsForNUAPro[1] is organized as follows: | |
1032 | // -------------------------------------------------------------------------------------------------------------------- | |
1033 | // 1st bin: <<cos(n*(phi1))>> = cosP1n | |
1034 | // 2nd bin: <<cos(n*(phi1+phi2))>> = cosP1nP1n | |
1035 | // 3rd bin: <<cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1n | |
1036 | // 4th bin: <<cos(n*(2phi1-phi2))>> = cosP2nM1n | |
1037 | // -------------------------------------------------------------------------------------------------------------------- | |
1038 | ||
1039 | // 1-particle: | |
1040 | Double_t cosP1n = 0.; // <<cos(n*(phi1))>> | |
1041 | ||
1042 | if(dMult>0) | |
1043 | { | |
1044 | cosP1n = dReQ1n/dMult; | |
1045 | ||
1046 | // average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for single event: | |
1047 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(1,cosP1n); | |
0328db2d | 1048 | // event weights for NUA terms: |
1049 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(1,dMult); | |
489d5531 | 1050 | |
1051 | // final average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for all events: | |
1052 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(0.5,cosP1n,dMult); | |
3842bdcd | 1053 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[1][0]->Fill(dMultiplicityBin,cosP1n,dMult);} |
489d5531 | 1054 | } |
1055 | ||
1056 | // 2-particle: | |
3b552efe | 1057 | Double_t cosP1nP1n = 0.; // <<cos(n*(phi1+phi2))>> |
489d5531 | 1058 | Double_t cosP2nM1n = 0.; // <<cos(n*(2phi1-phi2))>> |
1059 | ||
1060 | if(dMult>1) | |
1061 | { | |
1062 | cosP1nP1n = (pow(dReQ1n,2)-pow(dImQ1n,2)-dReQ2n)/(dMult*(dMult-1)); | |
1063 | cosP2nM1n = (dReQ2n*dReQ1n+dImQ2n*dImQ1n-dReQ1n)/(dMult*(dMult-1)); | |
1064 | ||
1065 | // average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for single event: | |
3b552efe | 1066 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(2,cosP1nP1n); |
489d5531 | 1067 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(4,cosP2nM1n); |
0328db2d | 1068 | // event weights for NUA terms: |
1069 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(2,dMult*(dMult-1)); | |
1070 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(4,dMult*(dMult-1)); | |
1071 | ||
489d5531 | 1072 | // final average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for all events: |
3b552efe | 1073 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(1.5,cosP1nP1n,dMult*(dMult-1)); |
489d5531 | 1074 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(3.5,cosP2nM1n,dMult*(dMult-1)); |
b3dacf6b | 1075 | if(fCalculateCumulantsVsM) |
1076 | { | |
3842bdcd | 1077 | fIntFlowCorrectionTermsForNUAVsMPro[1][1]->Fill(dMultiplicityBin,cosP1nP1n,dMult*(dMult-1)); |
1078 | fIntFlowCorrectionTermsForNUAVsMPro[1][3]->Fill(dMultiplicityBin,cosP2nM1n,dMult*(dMult-1)); | |
b3dacf6b | 1079 | } |
489d5531 | 1080 | } |
1081 | ||
1082 | // 3-particle: | |
1083 | Double_t cosP1nM1nM1n = 0.; // <<cos(n*(phi1-phi2-phi3))>> | |
1084 | ||
1085 | if(dMult>2) | |
1086 | { | |
1087 | cosP1nM1nM1n = (dReQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))-dReQ1n*dReQ2n-dImQ1n*dImQ2n-2.*(dMult-1)*dReQ1n) | |
1088 | / (dMult*(dMult-1)*(dMult-2)); | |
1089 | ||
1090 | // average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for single event: | |
1091 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(3,cosP1nM1nM1n); | |
0328db2d | 1092 | // event weights for NUA terms: |
1093 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(3,dMult*(dMult-1)*(dMult-2)); | |
489d5531 | 1094 | |
1095 | // final average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for all events: | |
2001bc3a | 1096 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(2.5,cosP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); |
3842bdcd | 1097 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[1][2]->Fill(dMultiplicityBin,cosP1nM1nM1n,dMult*(dMult-1)*(dMult-2));} |
489d5531 | 1098 | } |
1099 | ||
1100 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTerms() | |
1101 | ||
e1d101a6 | 1102 | //======================================================================================================================= |
489d5531 | 1103 | |
489d5531 | 1104 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTerms() |
1105 | { | |
1106 | // calculate corrections for non-uniform acceptance of the detector for no-name integrated flow (sin terms) | |
1107 | ||
1108 | // multiplicity: | |
1268c371 | 1109 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 1110 | |
1111 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
1112 | Double_t dReQ1n = (*fReQ)(0,0); | |
1113 | Double_t dReQ2n = (*fReQ)(1,0); | |
1114 | //Double_t dReQ3n = (*fReQ)(2,0); | |
1115 | //Double_t dReQ4n = (*fReQ)(3,0); | |
1116 | Double_t dImQ1n = (*fImQ)(0,0); | |
1117 | Double_t dImQ2n = (*fImQ)(1,0); | |
1118 | //Double_t dImQ3n = (*fImQ)(2,0); | |
1119 | //Double_t dImQ4n = (*fImQ)(3,0); | |
1120 | ||
3842bdcd | 1121 | // Multiplicity bin of an event (relevant for all histos vs M): |
1122 | Double_t dMultiplicityBin = 0.; | |
df23c5ae | 1123 | if(fMultiplicityIs==AliFlowCommonConstants::kRP) |
3842bdcd | 1124 | { |
df23c5ae | 1125 | dMultiplicityBin = fNumberOfRPsEBE+0.5; |
1126 | } else if(fMultiplicityIs==AliFlowCommonConstants::kExternal) | |
3842bdcd | 1127 | { |
1128 | dMultiplicityBin = fReferenceMultiplicityEBE+0.5; | |
df23c5ae | 1129 | } else if(fMultiplicityIs==AliFlowCommonConstants::kPOI) |
1130 | { | |
1131 | dMultiplicityBin = fNumberOfPOIsEBE+0.5; | |
1132 | } | |
3842bdcd | 1133 | |
489d5531 | 1134 | // ************************************************************* |
1135 | // **** corrections for non-uniform acceptance (sin terms): **** | |
1136 | // ************************************************************* | |
1137 | // | |
1138 | // Remark 1: corrections for non-uniform acceptance (sin terms) calculated with non-weighted Q-vectors | |
1139 | // are stored in 1D profile fQCorrectionsSin. | |
1140 | // Remark 2: binning of fIntFlowCorrectionTermsForNUAPro[0] is organized as follows: | |
1141 | // -------------------------------------------------------------------------------------------------------------------- | |
1142 | // 1st bin: <<sin(n*(phi1))>> = sinP1n | |
1143 | // 2nd bin: <<sin(n*(phi1+phi2))>> = sinP1nP1n | |
1144 | // 3rd bin: <<sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1n | |
1145 | // 4th bin: <<sin(n*(2phi1-phi2))>> = sinP2nM1n | |
1146 | // -------------------------------------------------------------------------------------------------------------------- | |
1147 | ||
1148 | // 1-particle: | |
1149 | Double_t sinP1n = 0.; // <sin(n*(phi1))> | |
1150 | ||
1151 | if(dMult>0) | |
1152 | { | |
1153 | sinP1n = dImQ1n/dMult; | |
1154 | ||
1155 | // average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for single event: | |
0328db2d | 1156 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(1,sinP1n); |
1157 | // event weights for NUA terms: | |
1158 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(1,dMult); | |
489d5531 | 1159 | |
1160 | // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
1161 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(0.5,sinP1n,dMult); | |
3842bdcd | 1162 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[0][0]->Fill(dMultiplicityBin,sinP1n,dMult);} |
489d5531 | 1163 | } |
1164 | ||
1165 | // 2-particle: | |
1166 | Double_t sinP1nP1n = 0.; // <<sin(n*(phi1+phi2))>> | |
1167 | Double_t sinP2nM1n = 0.; // <<sin(n*(2phi1-phi2))>> | |
1168 | if(dMult>1) | |
1169 | { | |
3b552efe | 1170 | sinP1nP1n = (2.*dReQ1n*dImQ1n-dImQ2n)/(dMult*(dMult-1)); |
489d5531 | 1171 | sinP2nM1n = (dImQ2n*dReQ1n-dReQ2n*dImQ1n-dImQ1n)/(dMult*(dMult-1)); |
1172 | ||
1173 | // average non-weighted 2-particle correction (sin terms) for non-uniform acceptance for single event: | |
1174 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(2,sinP1nP1n); | |
3b552efe | 1175 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(4,sinP2nM1n); |
0328db2d | 1176 | // event weights for NUA terms: |
1177 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(2,dMult*(dMult-1)); | |
1178 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(4,dMult*(dMult-1)); | |
489d5531 | 1179 | |
1180 | // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
1181 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(1.5,sinP1nP1n,dMult*(dMult-1)); | |
1182 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(3.5,sinP2nM1n,dMult*(dMult-1)); | |
b3dacf6b | 1183 | if(fCalculateCumulantsVsM) |
1184 | { | |
3842bdcd | 1185 | fIntFlowCorrectionTermsForNUAVsMPro[0][1]->Fill(dMultiplicityBin,sinP1nP1n,dMult*(dMult-1)); |
1186 | fIntFlowCorrectionTermsForNUAVsMPro[0][3]->Fill(dMultiplicityBin,sinP2nM1n,dMult*(dMult-1)); | |
b3dacf6b | 1187 | } |
489d5531 | 1188 | } |
1189 | ||
1190 | // 3-particle: | |
1191 | Double_t sinP1nM1nM1n = 0.; // <<sin(n*(phi1-phi2-phi3))>> | |
1192 | ||
1193 | if(dMult>2) | |
1194 | { | |
1195 | sinP1nM1nM1n = (-dImQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))+dReQ1n*dImQ2n-dImQ1n*dReQ2n+2.*(dMult-1)*dImQ1n) | |
1196 | / (dMult*(dMult-1)*(dMult-2)); | |
1197 | ||
1198 | // average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for single event: | |
1199 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(3,sinP1nM1nM1n); | |
0328db2d | 1200 | // event weights for NUA terms: |
1201 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(3,dMult*(dMult-1)*(dMult-2)); | |
489d5531 | 1202 | |
1203 | // final average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for all events: | |
2001bc3a | 1204 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(2.5,sinP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); |
3842bdcd | 1205 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[0][2]->Fill(dMultiplicityBin,sinP1nM1nM1n,dMult*(dMult-1)*(dMult-2));} |
489d5531 | 1206 | } |
1207 | ||
1208 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTerms() | |
1209 | ||
e1d101a6 | 1210 | //======================================================================================================================= |
489d5531 | 1211 | |
489d5531 | 1212 | void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos) |
1213 | { | |
1268c371 | 1214 | // a) Get pointers for common control and common result histograms; |
1215 | // b) Get pointers for histograms holding particle weights; | |
1216 | // c) Get pointers for reference flow histograms; | |
1217 | // d) Get pointers for differential flow histograms; | |
1218 | // e) Get pointers for 2D differential flow histograms; | |
64e500e3 | 1219 | // f) Get pointers for other differential correlators; |
1db7eced | 1220 | // g) Get pointers for mixed harmonics histograms; |
1221 | // h) Get pointers for nested loops' histograms; | |
1222 | // i) Get pointers for control histograms. | |
489d5531 | 1223 | |
1224 | if(outputListHistos) | |
3b552efe | 1225 | { |
1226 | this->SetHistList(outputListHistos); | |
1227 | if(!fHistList) | |
1228 | { | |
1268c371 | 1229 | printf("\n WARNING (QC): fHistList is NULL in AFAWQC::GOH() !!!!\n\n"); |
3b552efe | 1230 | exit(0); |
489d5531 | 1231 | } |
1232 | this->GetPointersForCommonHistograms(); | |
1233 | this->GetPointersForParticleWeightsHistograms(); | |
1234 | this->GetPointersForIntFlowHistograms(); | |
1235 | this->GetPointersForDiffFlowHistograms(); | |
1268c371 | 1236 | this->GetPointersFor2DDiffFlowHistograms(); |
64e500e3 | 1237 | this->GetPointersForOtherDiffCorrelators(); |
e1d101a6 | 1238 | this->GetPointersForMixedHarmonicsHistograms(); |
489d5531 | 1239 | this->GetPointersForNestedLoopsHistograms(); |
1db7eced | 1240 | this->GetPointersForControlHistograms(); |
3b552efe | 1241 | } else |
1242 | { | |
1268c371 | 1243 | printf("\n WARNING (QC): outputListHistos is NULL in AFAWQC::GOH() !!!!\n\n"); |
3b552efe | 1244 | exit(0); |
489d5531 | 1245 | } |
1246 | ||
1247 | } // end of void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos) | |
ad87ae62 | 1248 | |
e1d101a6 | 1249 | //======================================================================================================================= |
489d5531 | 1250 | |
489d5531 | 1251 | TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) const |
ad87ae62 | 1252 | { |
489d5531 | 1253 | // project 2D profile onto pt axis to get 1D profile |
1254 | ||
1255 | Int_t nBinsPt = profilePtEta->GetNbinsX(); | |
1256 | Double_t dPtMin = (profilePtEta->GetXaxis())->GetXmin(); | |
1257 | Double_t dPtMax = (profilePtEta->GetXaxis())->GetXmax(); | |
1258 | ||
1259 | Int_t nBinsEta = profilePtEta->GetNbinsY(); | |
1260 | ||
1261 | TProfile *profilePt = new TProfile("","",nBinsPt,dPtMin,dPtMax); | |
1262 | ||
1263 | for(Int_t p=1;p<=nBinsPt;p++) | |
1264 | { | |
1265 | Double_t contentPt = 0.; | |
1266 | Double_t entryPt = 0.; | |
1267 | Double_t spreadPt = 0.; | |
1268 | Double_t sum1 = 0.; | |
1269 | Double_t sum2 = 0.; | |
1270 | Double_t sum3 = 0.; | |
1271 | for(Int_t e=1;e<=nBinsEta;e++) | |
1272 | { | |
1273 | contentPt += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))) | |
1274 | * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1275 | entryPt += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1276 | ||
1277 | sum1 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))) | |
1278 | * (pow(profilePtEta->GetBinError(profilePtEta->GetBin(p,e)),2.) | |
1279 | + pow(profilePtEta->GetBinContent(profilePtEta->GetBin(p,e)),2.)); | |
1280 | sum2 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1281 | sum3 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))) | |
1282 | * (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))); | |
1283 | } | |
1284 | if(sum2>0. && sum1/sum2-pow(sum3/sum2,2.) > 0.) | |
1285 | { | |
1286 | spreadPt = pow(sum1/sum2-pow(sum3/sum2,2.),0.5); | |
1287 | } | |
1288 | profilePt->SetBinContent(p,contentPt); | |
1289 | profilePt->SetBinEntries(p,entryPt); | |
1290 | { | |
1291 | profilePt->SetBinError(p,spreadPt); | |
1292 | } | |
1293 | ||
1294 | } | |
1295 | ||
1296 | return profilePt; | |
1297 | ||
1298 | } // end of TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) | |
1299 | ||
1300 | ||
e1d101a6 | 1301 | //======================================================================================================================= |
489d5531 | 1302 | |
1303 | ||
1304 | TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) const | |
1305 | { | |
1306 | // project 2D profile onto eta axis to get 1D profile | |
1307 | ||
1308 | Int_t nBinsEta = profilePtEta->GetNbinsY(); | |
1309 | Double_t dEtaMin = (profilePtEta->GetYaxis())->GetXmin(); | |
1310 | Double_t dEtaMax = (profilePtEta->GetYaxis())->GetXmax(); | |
1311 | ||
1312 | Int_t nBinsPt = profilePtEta->GetNbinsX(); | |
1313 | ||
1314 | TProfile *profileEta = new TProfile("","",nBinsEta,dEtaMin,dEtaMax); | |
1315 | ||
1316 | for(Int_t e=1;e<=nBinsEta;e++) | |
1317 | { | |
1318 | Double_t contentEta = 0.; | |
1319 | Double_t entryEta = 0.; | |
1320 | for(Int_t p=1;p<=nBinsPt;p++) | |
1321 | { | |
1322 | contentEta += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))) | |
1323 | * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1324 | entryEta += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1325 | } | |
1326 | profileEta->SetBinContent(e,contentEta); | |
1327 | profileEta->SetBinEntries(e,entryEta); | |
1328 | } | |
1329 | ||
1330 | return profileEta; | |
1331 | ||
1332 | } // end of TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) | |
1333 | ||
e1d101a6 | 1334 | //======================================================================================================================= |
489d5531 | 1335 | |
489d5531 | 1336 | void AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type) |
1337 | { | |
2001bc3a | 1338 | // Printing on the screen the final results for integrated flow (RF, POI and RP). |
489d5531 | 1339 | |
1340 | Int_t n = fHarmonic; | |
1341 | ||
489d5531 | 1342 | Double_t dVn[4] = {0.}; // array to hold Vn{2}, Vn{4}, Vn{6} and Vn{8} |
1343 | Double_t dVnErr[4] = {0.}; // array to hold errors of Vn{2}, Vn{4}, Vn{6} and Vn{8} | |
1344 | ||
2001bc3a | 1345 | if(type == "RF") |
489d5531 | 1346 | { |
0dd3b008 | 1347 | for(Int_t b=0;b<4;b++) |
1348 | { | |
b77b6434 | 1349 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlow())->GetBinContent(1); |
1350 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlow())->GetBinError(1); | |
1351 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlow())->GetBinContent(1); | |
1352 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlow())->GetBinError(1); | |
1353 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlow())->GetBinContent(1); | |
1354 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlow())->GetBinError(1); | |
1355 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlow())->GetBinContent(1); | |
1356 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlow())->GetBinError(1); | |
0dd3b008 | 1357 | } |
489d5531 | 1358 | } else if(type == "RP") |
1359 | { | |
1360 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinContent(1); | |
1361 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinError(1); | |
1362 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinContent(1); | |
1363 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinError(1); | |
1364 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinContent(1); | |
1365 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinError(1); | |
1366 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinContent(1); | |
1367 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinError(1); | |
1368 | } else if(type == "POI") | |
1369 | { | |
1370 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinContent(1); | |
1371 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinError(1); | |
1372 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinContent(1); | |
1373 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinError(1); | |
1374 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinContent(1); | |
1375 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinError(1); | |
1376 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinContent(1); | |
1377 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinError(1); | |
b77b6434 | 1378 | } else if(type == "RF, rebinned in M" && fCalculateCumulantsVsM) |
b3dacf6b | 1379 | { |
0dd3b008 | 1380 | for(Int_t b=0;b<4;b++) |
1381 | { | |
1382 | dVn[b] = fIntFlowRebinnedInM->GetBinContent(b+1); | |
1383 | dVnErr[b] = fIntFlowRebinnedInM->GetBinError(b+1); | |
1384 | } | |
b3dacf6b | 1385 | } |
489d5531 | 1386 | |
1387 | TString title = " flow estimates from Q-cumulants"; | |
1388 | TString subtitle = " ("; | |
b3dacf6b | 1389 | TString subtitle2 = " (rebinned in M)"; |
489d5531 | 1390 | |
b3dacf6b | 1391 | if(type != "RF, rebinned in M") |
489d5531 | 1392 | { |
403e3389 | 1393 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
b3dacf6b | 1394 | { |
1395 | subtitle.Append(type); | |
1396 | subtitle.Append(", without weights)"); | |
1397 | } else | |
1398 | { | |
1399 | subtitle.Append(type); | |
1400 | subtitle.Append(", with weights)"); | |
1401 | } | |
1402 | } else | |
489d5531 | 1403 | { |
403e3389 | 1404 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
b3dacf6b | 1405 | { |
1406 | subtitle.Append("RF"); | |
1407 | subtitle.Append(", without weights)"); | |
1408 | } else | |
1409 | { | |
1410 | subtitle.Append("RF"); | |
1411 | subtitle.Append(", with weights)"); | |
1412 | } | |
1413 | } | |
1414 | ||
489d5531 | 1415 | cout<<endl; |
1416 | cout<<"*************************************"<<endl; | |
1417 | cout<<"*************************************"<<endl; | |
1418 | cout<<title.Data()<<endl; | |
1419 | cout<<subtitle.Data()<<endl; | |
b3dacf6b | 1420 | if(type == "RF, rebinned in M"){cout<<subtitle2.Data()<<endl;} |
489d5531 | 1421 | cout<<endl; |
1422 | ||
1423 | for(Int_t i=0;i<4;i++) | |
1424 | { | |
2001bc3a | 1425 | cout<<" v_"<<n<<"{"<<2*(i+1)<<"} = "<<dVn[i]<<" +/- "<<dVnErr[i]<<endl; |
489d5531 | 1426 | } |
2001bc3a | 1427 | |
489d5531 | 1428 | cout<<endl; |
b92ea2b9 | 1429 | if(type == "RF") |
1430 | { | |
b77b6434 | 1431 | if(fApplyCorrectionForNUA) |
1432 | { | |
1433 | cout<<" detector bias (corrected for): "<<endl; | |
1434 | } else | |
1435 | { | |
1436 | cout<<" detector bias (not corrected for):"<<endl; | |
1437 | } | |
b92ea2b9 | 1438 | cout<<" to QC{2}: "<<fIntFlowDetectorBias->GetBinContent(1)<<" +/- "<<fIntFlowDetectorBias->GetBinError(1)<<endl; |
1439 | cout<<" to QC{4}: "<<fIntFlowDetectorBias->GetBinContent(2)<<" +/- "<<fIntFlowDetectorBias->GetBinError(2)<<endl; | |
1440 | cout<<endl; | |
1441 | } | |
b3dacf6b | 1442 | if(type == "RF" || type == "RF, rebinned in M") |
489d5531 | 1443 | { |
2001bc3a | 1444 | cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultRP()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultRP()->GetMean()<<endl; |
489d5531 | 1445 | } |
1446 | else if (type == "RP") | |
1447 | { | |
2001bc3a | 1448 | cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultRP()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultRP()->GetMean()<<endl; |
489d5531 | 1449 | } |
1450 | else if (type == "POI") | |
1451 | { | |
2001bc3a | 1452 | cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultPOI()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultPOI()->GetMean()<<endl; |
1453 | } | |
1454 | ||
489d5531 | 1455 | cout<<"*************************************"<<endl; |
1456 | cout<<"*************************************"<<endl; | |
1457 | cout<<endl; | |
1458 | ||
2001bc3a | 1459 | }// end of AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type="RF"); |
489d5531 | 1460 | |
e1d101a6 | 1461 | //======================================================================================================================= |
489d5531 | 1462 | |
489d5531 | 1463 | void AliFlowAnalysisWithQCumulants::WriteHistograms(TString outputFileName) |
1464 | { | |
1465 | //store the final results in output .root file | |
1466 | TFile *output = new TFile(outputFileName.Data(),"RECREATE"); | |
1467 | //output->WriteObject(fHistList, "cobjQC","SingleKey"); | |
1468 | fHistList->Write(fHistList->GetName(), TObject::kSingleKey); | |
1469 | delete output; | |
1470 | } | |
1471 | ||
1472 | ||
e1d101a6 | 1473 | //======================================================================================================================= |
489d5531 | 1474 | |
1475 | ||
1476 | void AliFlowAnalysisWithQCumulants::WriteHistograms(TDirectoryFile *outputFileName) | |
1477 | { | |
1478 | //store the final results in output .root file | |
1479 | fHistList->SetName("cobjQC"); | |
1480 | fHistList->SetOwner(kTRUE); | |
1481 | outputFileName->Add(fHistList); | |
1482 | outputFileName->Write(outputFileName->GetName(), TObject::kSingleKey); | |
1483 | } | |
1484 | ||
e1d101a6 | 1485 | //======================================================================================================================= |
489d5531 | 1486 | |
489d5531 | 1487 | void AliFlowAnalysisWithQCumulants::BookCommonHistograms() |
1488 | { | |
1489 | // Book common control histograms and common histograms for final results. | |
1268c371 | 1490 | // a) Book common control histograms; |
1491 | // b) Book common result histograms. | |
1492 | ||
1493 | // a) Book common control histograms: | |
1494 | // Common control histograms (all events): | |
489d5531 | 1495 | TString commonHistsName = "AliFlowCommonHistQC"; |
1496 | commonHistsName += fAnalysisLabel->Data(); | |
62d19320 | 1497 | fCommonHists = new AliFlowCommonHist(commonHistsName.Data(),commonHistsName.Data(),fBookOnlyBasicCCH); |
489d5531 | 1498 | fHistList->Add(fCommonHists); |
1268c371 | 1499 | // Common control histograms (selected events): |
dd442cd2 | 1500 | if(fFillMultipleControlHistograms) |
1501 | { | |
1268c371 | 1502 | // Common control histogram filled for events with 2 and more reference particles: |
dd442cd2 | 1503 | TString commonHists2ndOrderName = "AliFlowCommonHist2ndOrderQC"; |
1504 | commonHists2ndOrderName += fAnalysisLabel->Data(); | |
62d19320 | 1505 | fCommonHists2nd = new AliFlowCommonHist(commonHists2ndOrderName.Data(),commonHists2ndOrderName.Data(),fBookOnlyBasicCCH); |
dd442cd2 | 1506 | fHistList->Add(fCommonHists2nd); |
1268c371 | 1507 | // Common control histogram filled for events with 2 and more reference particles: |
dd442cd2 | 1508 | TString commonHists4thOrderName = "AliFlowCommonHist4thOrderQC"; |
1509 | commonHists4thOrderName += fAnalysisLabel->Data(); | |
62d19320 | 1510 | fCommonHists4th = new AliFlowCommonHist(commonHists4thOrderName.Data(),commonHists4thOrderName.Data(),fBookOnlyBasicCCH); |
dd442cd2 | 1511 | fHistList->Add(fCommonHists4th); |
1268c371 | 1512 | // Common control histogram filled for events with 6 and more reference particles: |
dd442cd2 | 1513 | TString commonHists6thOrderName = "AliFlowCommonHist6thOrderQC"; |
1514 | commonHists6thOrderName += fAnalysisLabel->Data(); | |
62d19320 | 1515 | fCommonHists6th = new AliFlowCommonHist(commonHists6thOrderName.Data(),commonHists6thOrderName.Data(),fBookOnlyBasicCCH); |
dd442cd2 | 1516 | fHistList->Add(fCommonHists6th); |
1268c371 | 1517 | // Common control histogram filled for events with 8 and more reference particles: |
dd442cd2 | 1518 | TString commonHists8thOrderName = "AliFlowCommonHist8thOrderQC"; |
1519 | commonHists8thOrderName += fAnalysisLabel->Data(); | |
62d19320 | 1520 | fCommonHists8th = new AliFlowCommonHist(commonHists8thOrderName.Data(),commonHists8thOrderName.Data(),fBookOnlyBasicCCH); |
dd442cd2 | 1521 | fHistList->Add(fCommonHists8th); |
1522 | } // end of if(fFillMultipleControlHistograms) | |
1523 | ||
1268c371 | 1524 | // b) Book common result histograms: |
1525 | // Common result histograms for QC{2}: | |
489d5531 | 1526 | TString commonHistResults2ndOrderName = "AliFlowCommonHistResults2ndOrderQC"; |
1527 | commonHistResults2ndOrderName += fAnalysisLabel->Data(); | |
62e36168 | 1528 | fCommonHistsResults2nd = new AliFlowCommonHistResults(commonHistResults2ndOrderName.Data(),"",fHarmonic); |
489d5531 | 1529 | fHistList->Add(fCommonHistsResults2nd); |
1268c371 | 1530 | // Common result histograms for QC{4}: |
489d5531 | 1531 | TString commonHistResults4thOrderName = "AliFlowCommonHistResults4thOrderQC"; |
1532 | commonHistResults4thOrderName += fAnalysisLabel->Data(); | |
62e36168 | 1533 | fCommonHistsResults4th = new AliFlowCommonHistResults(commonHistResults4thOrderName.Data(),"",fHarmonic); |
489d5531 | 1534 | fHistList->Add(fCommonHistsResults4th); |
1268c371 | 1535 | // Common result histograms for QC{6}: |
489d5531 | 1536 | TString commonHistResults6thOrderName = "AliFlowCommonHistResults6thOrderQC"; |
1537 | commonHistResults6thOrderName += fAnalysisLabel->Data(); | |
62e36168 | 1538 | fCommonHistsResults6th = new AliFlowCommonHistResults(commonHistResults6thOrderName.Data(),"",fHarmonic); |
489d5531 | 1539 | fHistList->Add(fCommonHistsResults6th); |
1268c371 | 1540 | // Common result histograms for QC{8}: |
489d5531 | 1541 | TString commonHistResults8thOrderName = "AliFlowCommonHistResults8thOrderQC"; |
1542 | commonHistResults8thOrderName += fAnalysisLabel->Data(); | |
62e36168 | 1543 | fCommonHistsResults8th = new AliFlowCommonHistResults(commonHistResults8thOrderName.Data(),"",fHarmonic); |
489d5531 | 1544 | fHistList->Add(fCommonHistsResults8th); |
1545 | ||
1546 | } // end of void AliFlowAnalysisWithQCumulants::BookCommonHistograms() | |
1547 | ||
e1d101a6 | 1548 | //======================================================================================================================= |
489d5531 | 1549 | |
489d5531 | 1550 | void AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms() |
1551 | { | |
1268c371 | 1552 | // Book and fill histograms which hold phi, pt and eta weights. |
489d5531 | 1553 | |
1554 | if(!fWeightsList) | |
1555 | { | |
1268c371 | 1556 | printf("\n WARNING (QC): fWeightsList is NULL in AFAWQC::BAFWH() !!!! \n\n"); |
489d5531 | 1557 | exit(0); |
1558 | } | |
1559 | ||
1560 | TString fUseParticleWeightsName = "fUseParticleWeightsQC"; | |
1561 | fUseParticleWeightsName += fAnalysisLabel->Data(); | |
403e3389 | 1562 | fUseParticleWeights = new TProfile(fUseParticleWeightsName.Data(),"0 = particle weight not used, 1 = particle weight used ",4,0,4); |
489d5531 | 1563 | fUseParticleWeights->SetLabelSize(0.06); |
e1d101a6 | 1564 | fUseParticleWeights->SetStats(kFALSE); |
489d5531 | 1565 | (fUseParticleWeights->GetXaxis())->SetBinLabel(1,"w_{#phi}"); |
1566 | (fUseParticleWeights->GetXaxis())->SetBinLabel(2,"w_{p_{T}}"); | |
1567 | (fUseParticleWeights->GetXaxis())->SetBinLabel(3,"w_{#eta}"); | |
403e3389 | 1568 | (fUseParticleWeights->GetXaxis())->SetBinLabel(4,"w_{track}"); |
489d5531 | 1569 | fUseParticleWeights->Fill(0.5,(Int_t)fUsePhiWeights); |
1570 | fUseParticleWeights->Fill(1.5,(Int_t)fUsePtWeights); | |
1571 | fUseParticleWeights->Fill(2.5,(Int_t)fUseEtaWeights); | |
403e3389 | 1572 | fUseParticleWeights->Fill(3.5,(Int_t)fUseTrackWeights); |
489d5531 | 1573 | fWeightsList->Add(fUseParticleWeights); |
1574 | ||
1575 | if(fUsePhiWeights) | |
1576 | { | |
1577 | if(fWeightsList->FindObject("phi_weights")) | |
1578 | { | |
1579 | fPhiWeights = dynamic_cast<TH1F*>(fWeightsList->FindObject("phi_weights")); | |
1268c371 | 1580 | if(!fPhiWeights) |
1581 | { | |
1582 | printf("\n WARNING (QC): fPhiWeights is NULL in AFAWQC::BAFWH() !!!!\n\n"); | |
1583 | exit(0); | |
1584 | } | |
489d5531 | 1585 | if(TMath::Abs(fPhiWeights->GetBinWidth(1)-fPhiBinWidth)>pow(10.,-6.)) |
1586 | { | |
1587 | cout<<endl; | |
1588 | cout<<"WARNING (QC): Inconsistent binning in histograms for phi-weights throughout the code."<<endl; | |
1589 | cout<<endl; | |
6fbbbbf1 | 1590 | //exit(0); |
489d5531 | 1591 | } |
1592 | } else | |
1593 | { | |
1594 | cout<<"WARNING: fWeightsList->FindObject(\"phi_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1595 | exit(0); | |
1596 | } | |
1597 | } // end of if(fUsePhiWeights) | |
1598 | ||
1599 | if(fUsePtWeights) | |
1600 | { | |
1601 | if(fWeightsList->FindObject("pt_weights")) | |
1602 | { | |
1603 | fPtWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("pt_weights")); | |
1268c371 | 1604 | if(!fPtWeights) |
1605 | { | |
1606 | printf("\n WARNING (QC): fPtWeights is NULL in AFAWQC::BAFWH() !!!!\n\n"); | |
1607 | exit(0); | |
1608 | } | |
489d5531 | 1609 | if(TMath::Abs(fPtWeights->GetBinWidth(1)-fPtBinWidth)>pow(10.,-6.)) |
1610 | { | |
1611 | cout<<endl; | |
1612 | cout<<"WARNING (QC): Inconsistent binning in histograms for pt-weights throughout the code."<<endl; | |
1613 | cout<<endl; | |
6fbbbbf1 | 1614 | //exit(0); |
489d5531 | 1615 | } |
1616 | } else | |
1617 | { | |
1618 | cout<<"WARNING: fWeightsList->FindObject(\"pt_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1619 | exit(0); | |
1620 | } | |
1621 | } // end of if(fUsePtWeights) | |
1622 | ||
1623 | if(fUseEtaWeights) | |
1624 | { | |
1625 | if(fWeightsList->FindObject("eta_weights")) | |
1626 | { | |
1627 | fEtaWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("eta_weights")); | |
1268c371 | 1628 | if(!fEtaWeights) |
1629 | { | |
1630 | printf("\n WARNING (QC): fEtaWeights is NULL in AFAWQC::BAFWH() !!!!\n\n"); | |
1631 | exit(0); | |
1632 | } | |
489d5531 | 1633 | if(TMath::Abs(fEtaWeights->GetBinWidth(1)-fEtaBinWidth)>pow(10.,-6.)) |
1634 | { | |
1635 | cout<<endl; | |
1636 | cout<<"WARNING (QC): Inconsistent binning in histograms for eta-weights throughout the code."<<endl; | |
1637 | cout<<endl; | |
6fbbbbf1 | 1638 | //exit(0); |
489d5531 | 1639 | } |
1640 | } else | |
1641 | { | |
1642 | cout<<"WARNING: fUseEtaWeights && fWeightsList->FindObject(\"eta_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1643 | exit(0); | |
1644 | } | |
1645 | } // end of if(fUseEtaWeights) | |
1646 | ||
1647 | } // end of AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms() | |
1648 | ||
e1d101a6 | 1649 | //======================================================================================================================= |
489d5531 | 1650 | |
489d5531 | 1651 | void AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow() |
1652 | { | |
1653 | // Book all objects for integrated flow: | |
e5834fcb | 1654 | // a) Book profile to hold all flags for integrated flow; |
1655 | // b) Book event-by-event quantities; | |
1656 | // c) Book profiles; // to be improved (comment) | |
489d5531 | 1657 | // d) Book histograms holding the final results. |
1658 | ||
1659 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?) | |
1660 | TString powerFlag[2] = {"linear","quadratic"}; // to be improved (should I promote this to data members?) | |
1661 | ||
1662 | // a) Book profile to hold all flags for integrated flow: | |
1663 | TString intFlowFlagsName = "fIntFlowFlags"; | |
1664 | intFlowFlagsName += fAnalysisLabel->Data(); | |
1db7eced | 1665 | fIntFlowFlags = new TProfile(intFlowFlagsName.Data(),"Flags for Integrated Flow",20,0.,20.); |
489d5531 | 1666 | fIntFlowFlags->SetTickLength(-0.01,"Y"); |
1667 | fIntFlowFlags->SetMarkerStyle(25); | |
403e3389 | 1668 | fIntFlowFlags->SetLabelSize(0.04); |
489d5531 | 1669 | fIntFlowFlags->SetLabelOffset(0.02,"Y"); |
e1d101a6 | 1670 | fIntFlowFlags->SetStats(kFALSE); |
489d5531 | 1671 | fIntFlowFlags->GetXaxis()->SetBinLabel(1,"Particle Weights"); |
1672 | fIntFlowFlags->GetXaxis()->SetBinLabel(2,"Event Weights"); | |
1673 | fIntFlowFlags->GetXaxis()->SetBinLabel(3,"Corrected for NUA?"); | |
b3dacf6b | 1674 | fIntFlowFlags->GetXaxis()->SetBinLabel(4,"Print RF results"); |
489d5531 | 1675 | fIntFlowFlags->GetXaxis()->SetBinLabel(5,"Print RP results"); |
3b552efe | 1676 | fIntFlowFlags->GetXaxis()->SetBinLabel(6,"Print POI results"); |
b3dacf6b | 1677 | fIntFlowFlags->GetXaxis()->SetBinLabel(7,"Print RF (rebinned in M) results"); |
1678 | fIntFlowFlags->GetXaxis()->SetBinLabel(8,"Corrected for NUA vs M?"); | |
1679 | fIntFlowFlags->GetXaxis()->SetBinLabel(9,"Propagate errors to v_{n} from correlations?"); | |
1680 | fIntFlowFlags->GetXaxis()->SetBinLabel(10,"Calculate cumulants vs M"); | |
0dd3b008 | 1681 | fIntFlowFlags->GetXaxis()->SetBinLabel(11,"fMinimumBiasReferenceFlow"); |
8e1cefdd | 1682 | fIntFlowFlags->GetXaxis()->SetBinLabel(12,"fForgetAboutCovariances"); |
e5834fcb | 1683 | fIntFlowFlags->GetXaxis()->SetBinLabel(13,"fStorePhiDistributionForOneEvent"); |
dd442cd2 | 1684 | fIntFlowFlags->GetXaxis()->SetBinLabel(14,"fFillMultipleControlHistograms"); |
3435cacb | 1685 | fIntFlowFlags->GetXaxis()->SetBinLabel(15,"Calculate all correlations vs M"); |
df23c5ae | 1686 | fIntFlowFlags->GetXaxis()->SetBinLabel(16,"fMultiplicityIs"); |
d9e6d8bb | 1687 | fIntFlowFlags->GetXaxis()->SetBinLabel(17,"fExactNoRPs"); |
1db7eced | 1688 | fIntFlowFlags->GetXaxis()->SetBinLabel(18,"fUse2DHistograms"); |
1689 | fIntFlowFlags->GetXaxis()->SetBinLabel(19,"fFillProfilesVsMUsingWeights"); | |
1690 | fIntFlowFlags->GetXaxis()->SetBinLabel(20,"fUseQvectorTerms"); | |
489d5531 | 1691 | fIntFlowList->Add(fIntFlowFlags); |
1692 | ||
1693 | // b) Book event-by-event quantities: | |
1694 | // Re[Q_{m*n,k}], Im[Q_{m*n,k}] and S_{p,k}^M: | |
e1d101a6 | 1695 | fReQ = new TMatrixD(12,9); |
1696 | fImQ = new TMatrixD(12,9); | |
1268c371 | 1697 | fSpk = new TMatrixD(8,9); |
489d5531 | 1698 | // average correlations <2>, <4>, <6> and <8> for single event (bining is the same as in fIntFlowCorrelationsPro and fIntFlowCorrelationsHist): |
1699 | TString intFlowCorrelationsEBEName = "fIntFlowCorrelationsEBE"; | |
1700 | intFlowCorrelationsEBEName += fAnalysisLabel->Data(); | |
1701 | fIntFlowCorrelationsEBE = new TH1D(intFlowCorrelationsEBEName.Data(),intFlowCorrelationsEBEName.Data(),4,0,4); | |
1702 | // weights for average correlations <2>, <4>, <6> and <8> for single event: | |
1703 | TString intFlowEventWeightsForCorrelationsEBEName = "fIntFlowEventWeightsForCorrelationsEBE"; | |
1704 | intFlowEventWeightsForCorrelationsEBEName += fAnalysisLabel->Data(); | |
1705 | fIntFlowEventWeightsForCorrelationsEBE = new TH1D(intFlowEventWeightsForCorrelationsEBEName.Data(),intFlowEventWeightsForCorrelationsEBEName.Data(),4,0,4); | |
1706 | // average all correlations for single event (bining is the same as in fIntFlowCorrelationsAllPro and fIntFlowCorrelationsAllHist): | |
1707 | TString intFlowCorrelationsAllEBEName = "fIntFlowCorrelationsAllEBE"; | |
1708 | intFlowCorrelationsAllEBEName += fAnalysisLabel->Data(); | |
403e3389 | 1709 | fIntFlowCorrelationsAllEBE = new TH1D(intFlowCorrelationsAllEBEName.Data(),intFlowCorrelationsAllEBEName.Data(),64,0,64); |
489d5531 | 1710 | // average correction terms for non-uniform acceptance for single event |
1711 | // (binning is the same as in fIntFlowCorrectionTermsForNUAPro[2] and fIntFlowCorrectionTermsForNUAHist[2]): | |
1712 | TString fIntFlowCorrectionTermsForNUAEBEName = "fIntFlowCorrectionTermsForNUAEBE"; | |
1713 | fIntFlowCorrectionTermsForNUAEBEName += fAnalysisLabel->Data(); | |
1714 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
1715 | { | |
b92ea2b9 | 1716 | fIntFlowCorrectionTermsForNUAEBE[sc] = new TH1D(Form("%s: %s terms",fIntFlowCorrectionTermsForNUAEBEName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4); |
489d5531 | 1717 | } |
0328db2d | 1718 | // event weights for terms for non-uniform acceptance: |
1719 | TString fIntFlowEventWeightForCorrectionTermsForNUAEBEName = "fIntFlowEventWeightForCorrectionTermsForNUAEBE"; | |
1720 | fIntFlowEventWeightForCorrectionTermsForNUAEBEName += fAnalysisLabel->Data(); | |
1721 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
1722 | { | |
b92ea2b9 | 1723 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc] = new TH1D(Form("%s: %s terms",fIntFlowEventWeightForCorrectionTermsForNUAEBEName.Data(),sinCosFlag[sc].Data()),Form("Event weights for terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4); // to be improved - 4 |
0328db2d | 1724 | } |
489d5531 | 1725 | // c) Book profiles: // to be improved (comment) |
1726 | // profile to hold average multiplicities and number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8: | |
1727 | TString avMultiplicityName = "fAvMultiplicity"; | |
1728 | avMultiplicityName += fAnalysisLabel->Data(); | |
403e3389 | 1729 | fAvMultiplicity = new TProfile(avMultiplicityName.Data(),"Average multiplicities of reference particles (RPs)",9,0,9); |
489d5531 | 1730 | fAvMultiplicity->SetTickLength(-0.01,"Y"); |
1731 | fAvMultiplicity->SetMarkerStyle(25); | |
1732 | fAvMultiplicity->SetLabelSize(0.05); | |
1733 | fAvMultiplicity->SetLabelOffset(0.02,"Y"); | |
403e3389 | 1734 | fAvMultiplicity->SetYTitle("Average multiplicity"); |
489d5531 | 1735 | (fAvMultiplicity->GetXaxis())->SetBinLabel(1,"all evts"); |
1736 | (fAvMultiplicity->GetXaxis())->SetBinLabel(2,"n_{RP} #geq 1"); | |
1737 | (fAvMultiplicity->GetXaxis())->SetBinLabel(3,"n_{RP} #geq 2"); | |
1738 | (fAvMultiplicity->GetXaxis())->SetBinLabel(4,"n_{RP} #geq 3"); | |
1739 | (fAvMultiplicity->GetXaxis())->SetBinLabel(5,"n_{RP} #geq 4"); | |
1740 | (fAvMultiplicity->GetXaxis())->SetBinLabel(6,"n_{RP} #geq 5"); | |
1741 | (fAvMultiplicity->GetXaxis())->SetBinLabel(7,"n_{RP} #geq 6"); | |
1742 | (fAvMultiplicity->GetXaxis())->SetBinLabel(8,"n_{RP} #geq 7"); | |
1743 | (fAvMultiplicity->GetXaxis())->SetBinLabel(9,"n_{RP} #geq 8"); | |
1744 | fIntFlowProfiles->Add(fAvMultiplicity); | |
b40a910e | 1745 | // Average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with wrong errors!): |
1746 | TString correlationFlag[4] = {"#LT#LT2#GT#GT","#LT#LT4#GT#GT","#LT#LT6#GT#GT","#LT#LT8#GT#GT"}; | |
489d5531 | 1747 | TString intFlowCorrelationsProName = "fIntFlowCorrelationsPro"; |
1748 | intFlowCorrelationsProName += fAnalysisLabel->Data(); | |
1749 | fIntFlowCorrelationsPro = new TProfile(intFlowCorrelationsProName.Data(),"Average correlations for all events",4,0,4,"s"); | |
b40a910e | 1750 | fIntFlowCorrelationsPro->Sumw2(); |
489d5531 | 1751 | fIntFlowCorrelationsPro->SetTickLength(-0.01,"Y"); |
1752 | fIntFlowCorrelationsPro->SetMarkerStyle(25); | |
1753 | fIntFlowCorrelationsPro->SetLabelSize(0.06); | |
1754 | fIntFlowCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
68a3b4b1 | 1755 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 1756 | { |
68a3b4b1 | 1757 | (fIntFlowCorrelationsPro->GetXaxis())->SetBinLabel(b+1,correlationFlag[b].Data()); |
b3dacf6b | 1758 | } |
489d5531 | 1759 | fIntFlowProfiles->Add(fIntFlowCorrelationsPro); |
b40a910e | 1760 | // Average correlations squared <<2>^2>, <<4>^2>, <<6>^2> and <<8>^2> for all events: |
1761 | TString squaredCorrelationFlag[4] = {"#LT#LT2#GT^{2}#GT","#LT#LT4#GT^{2}#GT","#LT#LT6#GT^{2}#GT","#LT#LT8#GT^{2}#GT"}; | |
1762 | TString intFlowSquaredCorrelationsProName = "fIntFlowSquaredCorrelationsPro"; | |
1763 | intFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
1764 | fIntFlowSquaredCorrelationsPro = new TProfile(intFlowSquaredCorrelationsProName.Data(),"Average squared correlations for all events",4,0,4,"s"); | |
1765 | fIntFlowSquaredCorrelationsPro->Sumw2(); | |
1766 | fIntFlowSquaredCorrelationsPro->SetTickLength(-0.01,"Y"); | |
1767 | fIntFlowSquaredCorrelationsPro->SetMarkerStyle(25); | |
1768 | fIntFlowSquaredCorrelationsPro->SetLabelSize(0.06); | |
1769 | fIntFlowSquaredCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
1770 | for(Int_t b=0;b<4;b++) | |
1771 | { | |
1772 | (fIntFlowSquaredCorrelationsPro->GetXaxis())->SetBinLabel(b+1,squaredCorrelationFlag[b].Data()); | |
1773 | } | |
1774 | fIntFlowProfiles->Add(fIntFlowSquaredCorrelationsPro); | |
b3dacf6b | 1775 | if(fCalculateCumulantsVsM) |
1776 | { | |
1777 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
1778 | { | |
b40a910e | 1779 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> versus multiplicity for all events (with wrong errors): |
b3dacf6b | 1780 | TString intFlowCorrelationsVsMProName = "fIntFlowCorrelationsVsMPro"; |
1781 | intFlowCorrelationsVsMProName += fAnalysisLabel->Data(); | |
1782 | fIntFlowCorrelationsVsMPro[ci] = new TProfile(Form("%s, %s",intFlowCorrelationsVsMProName.Data(),correlationFlag[ci].Data()), | |
1783 | Form("%s vs multiplicity",correlationFlag[ci].Data()), | |
b40a910e | 1784 | fnBinsMult,fMinMult,fMaxMult,"s"); |
1785 | fIntFlowCorrelationsVsMPro[ci]->Sumw2(); | |
b3dacf6b | 1786 | fIntFlowCorrelationsVsMPro[ci]->GetYaxis()->SetTitle(correlationFlag[ci].Data()); |
df23c5ae | 1787 | if(fMultiplicityIs==AliFlowCommonConstants::kRP) |
1788 | { | |
1789 | fIntFlowCorrelationsVsMPro[ci]->GetXaxis()->SetTitle("# RPs"); | |
1790 | } else if(fMultiplicityIs==AliFlowCommonConstants::kExternal) | |
1791 | { | |
1792 | fIntFlowCorrelationsVsMPro[ci]->GetXaxis()->SetTitle("Reference multiplicity (from ESD)"); | |
1793 | } else if(fMultiplicityIs==AliFlowCommonConstants::kPOI) | |
1794 | { | |
1795 | fIntFlowCorrelationsVsMPro[ci]->GetXaxis()->SetTitle("# POIs"); | |
1796 | } | |
b3dacf6b | 1797 | fIntFlowProfiles->Add(fIntFlowCorrelationsVsMPro[ci]); |
b40a910e | 1798 | // average squared correlations <<2>^2>, <<4>^2>, <<6>^2> and <<8>^2> versus multiplicity for all events: |
1799 | TString intFlowSquaredCorrelationsVsMProName = "fIntFlowSquaredCorrelationsVsMPro"; | |
1800 | intFlowSquaredCorrelationsVsMProName += fAnalysisLabel->Data(); | |
1801 | fIntFlowSquaredCorrelationsVsMPro[ci] = new TProfile(Form("%s, %s",intFlowSquaredCorrelationsVsMProName.Data(),squaredCorrelationFlag[ci].Data()), | |
1802 | Form("%s vs multiplicity",squaredCorrelationFlag[ci].Data()), | |
1803 | fnBinsMult,fMinMult,fMaxMult,"s"); | |
1804 | fIntFlowSquaredCorrelationsVsMPro[ci]->Sumw2(); | |
1805 | fIntFlowSquaredCorrelationsVsMPro[ci]->GetYaxis()->SetTitle(squaredCorrelationFlag[ci].Data()); | |
df23c5ae | 1806 | if(fMultiplicityIs==AliFlowCommonConstants::kRP) |
1807 | { | |
1808 | fIntFlowSquaredCorrelationsVsMPro[ci]->GetXaxis()->SetTitle("# RPs"); | |
1809 | } else if(fMultiplicityIs==AliFlowCommonConstants::kExternal) | |
1810 | { | |
1811 | fIntFlowSquaredCorrelationsVsMPro[ci]->GetXaxis()->SetTitle("Reference multiplicity (from ESD)"); | |
1812 | } else if(fMultiplicityIs==AliFlowCommonConstants::kPOI) | |
1813 | { | |
1814 | fIntFlowSquaredCorrelationsVsMPro[ci]->GetXaxis()->SetTitle("# POIs"); | |
1815 | } | |
b40a910e | 1816 | fIntFlowProfiles->Add(fIntFlowSquaredCorrelationsVsMPro[ci]); |
b3dacf6b | 1817 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index |
1818 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 1819 | // averaged all correlations for all events (with wrong errors!): |
1820 | TString intFlowCorrelationsAllProName = "fIntFlowCorrelationsAllPro"; | |
1821 | intFlowCorrelationsAllProName += fAnalysisLabel->Data(); | |
403e3389 | 1822 | fIntFlowCorrelationsAllPro = new TProfile(intFlowCorrelationsAllProName.Data(),"Average all correlations for all events",64,0,64); |
b84464d3 | 1823 | fIntFlowCorrelationsAllPro->Sumw2(); |
489d5531 | 1824 | fIntFlowCorrelationsAllPro->SetTickLength(-0.01,"Y"); |
1825 | fIntFlowCorrelationsAllPro->SetMarkerStyle(25); | |
1826 | fIntFlowCorrelationsAllPro->SetLabelSize(0.03); | |
1827 | fIntFlowCorrelationsAllPro->SetLabelOffset(0.01,"Y"); | |
1828 | // 2-p correlations: | |
403e3389 | 1829 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(1,"#LT#LT2#GT#GT_{n|n}"); |
1830 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(2,"#LT#LT2#GT#GT_{2n|2n}"); | |
1831 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(3,"#LT#LT2#GT#GT_{3n|3n}"); | |
1832 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(4,"#LT#LT2#GT#GT_{4n|4n}"); | |
489d5531 | 1833 | // 3-p correlations: |
403e3389 | 1834 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(6,"#LT#LT3#GT#GT_{2n|n,n}"); |
1835 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(7,"#LT#LT3#GT#GT_{3n|2n,n}"); | |
1836 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(8,"#LT#LT3#GT#GT_{4n|2n,2n}"); | |
1837 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(9,"#LT#LT3#GT#GT_{4n|3n,n}"); | |
489d5531 | 1838 | // 4-p correlations: |
403e3389 | 1839 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(11,"#LT#LT4#GT#GT_{n,n|n,n}"); |
1840 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(12,"#LT#LT4#GT#GT_{2n,n|2n,n}"); | |
1841 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(13,"#LT#LT4#GT#GT_{2n,2n|2n,2n}"); | |
1842 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(14,"#LT#LT4#GT#GT_{3n|n,n,n}"); | |
1843 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(15,"#LT#LT4#GT#GT_{3n,n|3n,n}"); | |
1844 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(16,"#LT#LT4#GT#GT_{3n,n|2n,2n}"); | |
1845 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(17,"#LT#LT4#GT#GT_{4n|2n,n,n}"); | |
489d5531 | 1846 | // 5-p correlations: |
403e3389 | 1847 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(19,"#LT#LT5#GT#GT_{2n,n|n,n,n}"); |
1848 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(20,"#LT#LT5#GT#GT_{2n,2n|2n,n,n}"); | |
1849 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(21,"#LT#LT5#GT#GT_{3n,n|2n,n,n}"); | |
1850 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(22,"#LT#LT5#GT#GT_{4n|n,n,n,n}"); | |
489d5531 | 1851 | // 6-p correlations: |
403e3389 | 1852 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(24,"#LT#LT6#GT#GT_{n,n,n|n,n,n}"); |
1853 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(25,"#LT#LT6#GT#GT_{2n,n,n|2n,n,n}"); | |
1854 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(26,"#LT#LT6#GT#GT_{2n,2n|n,n,n,n}"); | |
1855 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(27,"#LT#LT6#GT#GT_{3n,n|n,n,n,n}"); | |
489d5531 | 1856 | // 7-p correlations: |
403e3389 | 1857 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(29,"#LT#LT7#GT#GT_{2n,n,n|n,n,n,n}"); |
489d5531 | 1858 | // 8-p correlations: |
403e3389 | 1859 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(31,"#LT#LT8#GT#GT_{n,n,n,n|n,n,n,n}"); |
b84464d3 | 1860 | // EXTRA correlations for v3{5} study: |
403e3389 | 1861 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(33,"#LT#LT4#GT#GT_{4n,2n|3n,3n}"); |
1862 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(34,"#LT#LT5#GT#GT_{3n,3n|2n,2n,2n}"); | |
b84464d3 | 1863 | // EXTRA correlations for Teaney-Yan study: |
403e3389 | 1864 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(35,"#LT#LT2#GT#GT_{5n|5n}"); |
1865 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(36,"#LT#LT2#GT#GT_{6n|6n}"); | |
1866 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(37,"#LT#LT3#GT#GT_{5n|3n,2n}"); | |
1867 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(38,"#LT#LT3#GT#GT_{5n|4n,1n}"); | |
1868 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(39,"#LT#LT3#GT#GT_{6n|3n,3n}"); | |
1869 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(40,"#LT#LT3#GT#GT_{6n|4n,2n}"); | |
1870 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(41,"#LT#LT3#GT#GT_{6n|5n,1n}"); | |
1871 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(42,"#LT#LT4#GT#GT_{6n|3n,2n,1n}"); | |
1872 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(43,"#LT#LT4#GT#GT_{3n,2n|3n,2n}"); | |
1873 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(44,"#LT#LT4#GT#GT_{4n,1n|3n,2n}"); | |
1874 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(45,"#LT#LT4#GT#GT_{3n,3n|3n,3n}"); | |
1875 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(46,"#LT#LT4#GT#GT_{4n,2n|3n,3n}"); | |
1876 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(47,"#LT#LT4#GT#GT_{5n,1n|3n,3n}"); | |
1877 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(48,"#LT#LT4#GT#GT_{4n,2n|4n,2n}"); | |
1878 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(49,"#LT#LT4#GT#GT_{5n,1n|4n,2n}"); | |
1879 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(50,"#LT#LT4#GT#GT_{5n|3n,1n,1n}"); | |
1880 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(51,"#LT#LT4#GT#GT_{5n|2n,2n,1n}"); | |
1881 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(52,"#LT#LT4#GT#GT_{5n,1n|5n,1n}"); | |
1882 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(53,"#LT#LT5#GT#GT_{3n,3n|3n,2n,1n}"); | |
1883 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(54,"#LT#LT5#GT#GT_{4n,2n|3n,2n,1n}"); | |
1884 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(55,"#LT#LT5#GT#GT_{3n,2n|3n,1n,1n}"); | |
1885 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(56,"#LT#LT5#GT#GT_{3n,2n|2n,2n,1n}"); | |
1886 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(57,"#LT#LT5#GT#GT_{5n,1n|3n,2n,1n}"); | |
1887 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(58,"#LT#LT6#GT#GT_{3n,2n,1n|3n,2n,1n}"); | |
1888 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(59,"#LT#LT4#GT#GT_{6n|4n,1n,1n}"); | |
1889 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(60,"#LT#LT4#GT#GT_{6n|2n,2n,2n}"); | |
1890 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(61,"#LT#LT5#GT#GT_{6n|2n,2n,1n,1n}"); | |
1891 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(62,"#LT#LT5#GT#GT_{4n,1n,1n|3n,3n}"); | |
1892 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(63,"#LT#LT6#GT#GT_{3n,3n|2n,2n,1n,1n}"); | |
489d5531 | 1893 | fIntFlowProfiles->Add(fIntFlowCorrelationsAllPro); |
3435cacb | 1894 | // average all correlations versus multiplicity (errors via Sumw2 - to be improved): |
1895 | if(fCalculateAllCorrelationsVsM) | |
1896 | { | |
1897 | // 2-p correlations vs M: | |
1898 | fIntFlowCorrelationsAllVsMPro[0] = new TProfile("two1n1n","#LT#LT2#GT#GT_{n|n}",fnBinsMult,fMinMult,fMaxMult); | |
3435cacb | 1899 | fIntFlowCorrelationsAllVsMPro[1] = new TProfile("two2n2n","#LT#LT2#GT#GT_{2n|2n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1900 | fIntFlowCorrelationsAllVsMPro[2] = new TProfile("two3n3n","#LT#LT2#GT#GT_{3n|3n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1901 | fIntFlowCorrelationsAllVsMPro[3] = new TProfile("two4n4n","#LT#LT2#GT#GT_{4n|4n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1902 | // 3-p correlations vs M: |
1903 | fIntFlowCorrelationsAllVsMPro[5] = new TProfile("three2n1n1n","#LT#LT3#GT#GT_{2n|n,n}",fnBinsMult,fMinMult,fMaxMult); | |
3435cacb | 1904 | fIntFlowCorrelationsAllVsMPro[6] = new TProfile("three3n2n1n","#LT#LT3#GT#GT_{3n|2n,n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1905 | fIntFlowCorrelationsAllVsMPro[7] = new TProfile("three4n2n2n","#LT#LT3#GT#GT_{4n|2n,2n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1906 | fIntFlowCorrelationsAllVsMPro[8] = new TProfile("three4n3n1n","#LT#LT3#GT#GT_{4n|3n,n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1907 | // 4-p correlations vs M: |
1908 | fIntFlowCorrelationsAllVsMPro[10] = new TProfile("four1n1n1n1n","#LT#LT4#GT#GT_{n,n|n,n}",fnBinsMult,fMinMult,fMaxMult); | |
3435cacb | 1909 | fIntFlowCorrelationsAllVsMPro[11] = new TProfile("four2n1n2n1n","#LT#LT4#GT#GT_{2n,n|2n,n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1910 | fIntFlowCorrelationsAllVsMPro[12] = new TProfile("four2n2n2n2n","#LT#LT4#GT#GT_{2n,2n|2n,2n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1911 | fIntFlowCorrelationsAllVsMPro[13] = new TProfile("four3n1n1n1n","#LT#LT4#GT#GT_{3n|n,n,n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1912 | fIntFlowCorrelationsAllVsMPro[14] = new TProfile("four3n1n3n1n","#LT#LT4#GT#GT_{3n,n|3n,n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1913 | fIntFlowCorrelationsAllVsMPro[15] = new TProfile("four3n1n2n2n","#LT#LT4#GT#GT_{3n,n|2n,2n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1914 | fIntFlowCorrelationsAllVsMPro[16] = new TProfile("four4n2n1n1n","#LT#LT4#GT#GT_{4n|2n,n,n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1915 | // 5-p correlations vs M: |
403e3389 | 1916 | fIntFlowCorrelationsAllVsMPro[18] = new TProfile("five2n1n1n1n1n","#LT#LT5#GT#GT_{2n,n|n,n,n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1917 | fIntFlowCorrelationsAllVsMPro[19] = new TProfile("five2n2n2n1n1n","#LT#LT5#GT#GT_{2n,2n|2n,n,n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1918 | fIntFlowCorrelationsAllVsMPro[20] = new TProfile("five3n1n2n1n1n","#LT#LT5#GT#GT_{3n,n|2n,n,n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1919 | fIntFlowCorrelationsAllVsMPro[21] = new TProfile("five4n1n1n1n1n","#LT#LT5#GT#GT_{4n|n,n,n,n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1920 | // 6-p correlations vs M: |
1921 | fIntFlowCorrelationsAllVsMPro[23] = new TProfile("six1n1n1n1n1n1n","#LT#LT6#GT#GT_{n,n,n|n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
3435cacb | 1922 | fIntFlowCorrelationsAllVsMPro[24] = new TProfile("six2n1n1n2n1n1n","#LT#LT6#GT#GT_{2n,n,n|2n,n,n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1923 | fIntFlowCorrelationsAllVsMPro[25] = new TProfile("six2n2n1n1n1n1n","#LT#LT6#GT#GT_{2n,2n|n,n,n,n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1924 | fIntFlowCorrelationsAllVsMPro[26] = new TProfile("six3n1n1n1n1n1n","#LT#LT6#GT#GT_{3n,n|n,n,n,n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1925 | // 7-p correlations vs M: |
1926 | fIntFlowCorrelationsAllVsMPro[28] = new TProfile("seven2n1n1n1n1n1n1n","#LT#LT7#GT#GT_{2n,n,n|n,n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
3435cacb | 1927 | // 8-p correlations vs M: |
1928 | fIntFlowCorrelationsAllVsMPro[30] = new TProfile("eight1n1n1n1n1n1n1n1n","#LT#LT8#GT#GT_{n,n,n,n|n,n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
b84464d3 | 1929 | // EXTRA correlations vs M for v3{5} study (to be improved - put them in a right order somewhere): |
3435cacb | 1930 | fIntFlowCorrelationsAllVsMPro[32] = new TProfile("four4n2n3n3n","#LT#LT4#GT#GT_{4n,2n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1931 | fIntFlowCorrelationsAllVsMPro[33] = new TProfile("five3n3n2n2n2n","#LT#LT5#GT#GT_{3n,3n|2n,2n,2n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1932 | // EXTRA correlations vs M for Teaney-Yan study (to be improved - put them in a right order somewhere): |
1933 | fIntFlowCorrelationsAllVsMPro[34] = new TProfile("two5n5n","#LT#LT2#GT#GT_{5n|5n}",fnBinsMult,fMinMult,fMaxMult); | |
b84464d3 | 1934 | fIntFlowCorrelationsAllVsMPro[35] = new TProfile("two6n6n","#LT#LT2#GT#GT_{6n|6n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1935 | fIntFlowCorrelationsAllVsMPro[36] = new TProfile("three5n3n2n","#LT#LT3#GT#GT_{5n|3n,2n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1936 | fIntFlowCorrelationsAllVsMPro[37] = new TProfile("three5n4n1n","#LT#LT3#GT#GT_{5n|4n,1n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1937 | fIntFlowCorrelationsAllVsMPro[38] = new TProfile("three6n3n3n","#LT#LT3#GT#GT_{6n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1938 | fIntFlowCorrelationsAllVsMPro[39] = new TProfile("three6n4n2n","#LT#LT3#GT#GT_{6n|4n,2n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1939 | fIntFlowCorrelationsAllVsMPro[40] = new TProfile("three6n5n1n","#LT#LT3#GT#GT_{6n|5n,1n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1940 | fIntFlowCorrelationsAllVsMPro[41] = new TProfile("four6n3n2n1n","#LT#LT4#GT#GT_{6n|3n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1941 | fIntFlowCorrelationsAllVsMPro[42] = new TProfile("four3n2n3n2n","#LT#LT4#GT#GT_{3n,2n|3n,2n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1942 | fIntFlowCorrelationsAllVsMPro[43] = new TProfile("four4n1n3n2n","#LT#LT4#GT#GT_{4n,1n|3n,2n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1943 | fIntFlowCorrelationsAllVsMPro[44] = new TProfile("four3n3n3n3n","#LT#LT4#GT#GT_{3n,3n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1944 | fIntFlowCorrelationsAllVsMPro[45] = new TProfile("four4n2n3n3n","#LT#LT4#GT#GT_{4n,2n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1945 | fIntFlowCorrelationsAllVsMPro[46] = new TProfile("four5n1n3n3n","#LT#LT4#GT#GT_{5n,1n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1946 | fIntFlowCorrelationsAllVsMPro[47] = new TProfile("four4n2n4n2n","#LT#LT4#GT#GT_{4n,2n|4n,2n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1947 | fIntFlowCorrelationsAllVsMPro[48] = new TProfile("four5n1n4n2n","#LT#LT4#GT#GT_{5n,1n|4n,2n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1948 | fIntFlowCorrelationsAllVsMPro[49] = new TProfile("four5n3n1n1n","#LT#LT4#GT#GT_{5n|3n,1n,1n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1949 | fIntFlowCorrelationsAllVsMPro[50] = new TProfile("four5n2n2n1n","#LT#LT4#GT#GT_{5n|2n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1950 | fIntFlowCorrelationsAllVsMPro[51] = new TProfile("four5n1n5n1n","#LT#LT4#GT#GT_{5n,1n|5n,1n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1951 | fIntFlowCorrelationsAllVsMPro[52] = new TProfile("five3n3n3n2n1n","#LT#LT5#GT#GT_{3n,3n|3n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1952 | fIntFlowCorrelationsAllVsMPro[53] = new TProfile("five4n2n3n2n1n","#LT#LT5#GT#GT_{4n,2n|3n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1953 | fIntFlowCorrelationsAllVsMPro[54] = new TProfile("five3n2n3n1n1n","#LT#LT5#GT#GT_{3n,2n|3n,1n,1n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1954 | fIntFlowCorrelationsAllVsMPro[55] = new TProfile("five3n2n2n2n1n","#LT#LT5#GT#GT_{3n,2n|2n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1955 | fIntFlowCorrelationsAllVsMPro[56] = new TProfile("five5n1n3n2n1n","#LT#LT5#GT#GT_{5n,1n|3n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); |
b84464d3 | 1956 | fIntFlowCorrelationsAllVsMPro[57] = new TProfile("six3n2n1n3n2n1n","#LT#LT6#GT#GT_{3n,2n,1n|3n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); |
403e3389 | 1957 | fIntFlowCorrelationsAllVsMPro[58] = new TProfile("four6n4n1n1n","#LT#LT4#GT#GT_{6n|4n,1n,1n}",fnBinsMult,fMinMult,fMaxMult); |
403e3389 | 1958 | fIntFlowCorrelationsAllVsMPro[59] = new TProfile("four6n2n2n2n","#LT#LT4#GT#GT_{6n|2n,2n,2n}",fnBinsMult,fMinMult,fMaxMult); |
403e3389 | 1959 | fIntFlowCorrelationsAllVsMPro[60] = new TProfile("five6n2n2n1n1n","#LT#LT5#GT#GT_{6n|2n,2n,1n,1n}",fnBinsMult,fMinMult,fMaxMult); |
403e3389 | 1960 | fIntFlowCorrelationsAllVsMPro[61] = new TProfile("five4n1n1n3n3n","#LT#LT5#GT#GT_{4n,1n,1n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); |
403e3389 | 1961 | fIntFlowCorrelationsAllVsMPro[62] = new TProfile("six3n3n2n2n1n1n","#LT#LT6#GT#GT_{3n,3n|2n,2n,1n,1n}",fnBinsMult,fMinMult,fMaxMult); |
3842bdcd | 1962 | for(Int_t n=0;n<63;n++) |
1963 | { | |
1964 | if(fIntFlowCorrelationsAllVsMPro[n]) | |
1965 | { | |
1966 | fIntFlowCorrelationsAllVsMPro[n]->Sumw2(); | |
df23c5ae | 1967 | if(fMultiplicityIs==AliFlowCommonConstants::kRP) |
1968 | { | |
1969 | fIntFlowCorrelationsAllVsMPro[n]->GetXaxis()->SetTitle("# RPs"); | |
1970 | } else if(fMultiplicityIs==AliFlowCommonConstants::kExternal) | |
1971 | { | |
1972 | fIntFlowCorrelationsAllVsMPro[n]->GetXaxis()->SetTitle("Reference multiplicity (from ESD)"); | |
1973 | } else if(fMultiplicityIs==AliFlowCommonConstants::kPOI) | |
1974 | { | |
1975 | fIntFlowCorrelationsAllVsMPro[n]->GetXaxis()->SetTitle("# POIs"); | |
1976 | } | |
3842bdcd | 1977 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[n]); |
1978 | } // end of if(fIntFlowCorrelationsAllVsMPro[n]) | |
1979 | } // end of for(Int_t n=0;n<63;n++) | |
3435cacb | 1980 | } // end of if(fCalculateAllCorrelationsVsM) |
489d5531 | 1981 | // when particle weights are used some extra correlations appear: |
403e3389 | 1982 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 1983 | { |
1984 | TString intFlowExtraCorrelationsProName = "fIntFlowExtraCorrelationsPro"; | |
1985 | intFlowExtraCorrelationsProName += fAnalysisLabel->Data(); | |
1986 | fIntFlowExtraCorrelationsPro = new TProfile(intFlowExtraCorrelationsProName.Data(),"Average extra correlations for all events",100,0,100,"s"); | |
1987 | fIntFlowExtraCorrelationsPro->SetTickLength(-0.01,"Y"); | |
1988 | fIntFlowExtraCorrelationsPro->SetMarkerStyle(25); | |
1989 | fIntFlowExtraCorrelationsPro->SetLabelSize(0.03); | |
1990 | fIntFlowExtraCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
1991 | // extra 2-p correlations: | |
1992 | (fIntFlowExtraCorrelationsPro->GetXaxis())->SetBinLabel(1,"<<w1^3 w2 cos(n*(phi1-phi2))>>"); | |
1993 | (fIntFlowExtraCorrelationsPro->GetXaxis())->SetBinLabel(2,"<<w1 w2 w3^2 cos(n*(phi1-phi2))>>"); | |
1994 | fIntFlowProfiles->Add(fIntFlowExtraCorrelationsPro); | |
403e3389 | 1995 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 1996 | // average product of correlations <2>, <4>, <6> and <8>: |
403e3389 | 1997 | TString productFlag[6] = {"#LT#LT2#GT#LT4#GT#GT","#LT#LT2#GT#LT6#GT#GT","#LT#LT2#GT#LT8#GT#GT", |
1998 | "#LT#LT4#GT#LT6#GT#GT","#LT#LT4#GT#LT8#GT#GT","#LT#LT6#GT#LT8#GT#GT"}; | |
489d5531 | 1999 | TString intFlowProductOfCorrelationsProName = "fIntFlowProductOfCorrelationsPro"; |
2000 | intFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
2001 | fIntFlowProductOfCorrelationsPro = new TProfile(intFlowProductOfCorrelationsProName.Data(),"Average products of correlations",6,0,6); | |
2002 | fIntFlowProductOfCorrelationsPro->SetTickLength(-0.01,"Y"); | |
2003 | fIntFlowProductOfCorrelationsPro->SetMarkerStyle(25); | |
2004 | fIntFlowProductOfCorrelationsPro->SetLabelSize(0.05); | |
2005 | fIntFlowProductOfCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
68a3b4b1 | 2006 | for(Int_t b=0;b<6;b++) |
b3dacf6b | 2007 | { |
68a3b4b1 | 2008 | (fIntFlowProductOfCorrelationsPro->GetXaxis())->SetBinLabel(b+1,productFlag[b].Data()); |
b3dacf6b | 2009 | } |
2010 | fIntFlowProfiles->Add(fIntFlowProductOfCorrelationsPro); | |
ff70ca91 | 2011 | // average product of correlations <2>, <4>, <6> and <8> versus multiplicity |
2012 | // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>] | |
b3dacf6b | 2013 | if(fCalculateCumulantsVsM) |
2014 | { | |
2015 | TString intFlowProductOfCorrelationsVsMProName = "fIntFlowProductOfCorrelationsVsMPro"; | |
2016 | intFlowProductOfCorrelationsVsMProName += fAnalysisLabel->Data(); | |
2017 | for(Int_t pi=0;pi<6;pi++) | |
2018 | { | |
2019 | fIntFlowProductOfCorrelationsVsMPro[pi] = new TProfile(Form("%s, %s",intFlowProductOfCorrelationsVsMProName.Data(),productFlag[pi].Data()), | |
2020 | Form("%s versus multiplicity",productFlag[pi].Data()), | |
2021 | fnBinsMult,fMinMult,fMaxMult); | |
df23c5ae | 2022 | if(fMultiplicityIs==AliFlowCommonConstants::kRP) |
2023 | { | |
2024 | fIntFlowProductOfCorrelationsVsMPro[pi]->GetXaxis()->SetTitle("# RPs"); | |
2025 | } else if(fMultiplicityIs==AliFlowCommonConstants::kExternal) | |
2026 | { | |
2027 | fIntFlowProductOfCorrelationsVsMPro[pi]->GetXaxis()->SetTitle("Reference multiplicity (from ESD)"); | |
2028 | } else if(fMultiplicityIs==AliFlowCommonConstants::kPOI) | |
2029 | { | |
2030 | fIntFlowProductOfCorrelationsVsMPro[pi]->GetXaxis()->SetTitle("# POIs"); | |
2031 | } | |
b3dacf6b | 2032 | fIntFlowProfiles->Add(fIntFlowProductOfCorrelationsVsMPro[pi]); |
2033 | } // end of for(Int_t pi=0;pi<6;pi++) | |
2034 | } // end of if(fCalculateCumulantsVsM) | |
0328db2d | 2035 | // average product of correction terms for NUA: |
2036 | TString intFlowProductOfCorrectionTermsForNUAProName = "fIntFlowProductOfCorrectionTermsForNUAPro"; | |
2037 | intFlowProductOfCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
2038 | fIntFlowProductOfCorrectionTermsForNUAPro = new TProfile(intFlowProductOfCorrectionTermsForNUAProName.Data(),"Average products of correction terms for NUA",27,0,27); | |
2039 | fIntFlowProductOfCorrectionTermsForNUAPro->SetTickLength(-0.01,"Y"); | |
2040 | fIntFlowProductOfCorrectionTermsForNUAPro->SetMarkerStyle(25); | |
403e3389 | 2041 | fIntFlowProductOfCorrectionTermsForNUAPro->SetLabelSize(0.03); |
0328db2d | 2042 | fIntFlowProductOfCorrectionTermsForNUAPro->SetLabelOffset(0.01,"Y"); |
2043 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(1,"<<2><cos(#phi)>>"); | |
2044 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(2,"<<2><sin(#phi)>>"); | |
2045 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(3,"<<cos(#phi)><sin(#phi)>>"); | |
2046 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(4,"Cov(<2>,<cos(#phi_{1}+#phi_{2})>)"); | |
2047 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(5,"Cov(<2>,<sin(#phi_{1}+#phi_{2})>)"); | |
2048 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(6,"Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2049 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(7,"Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2050 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(8,"Cov(<4>,<cos(#phi)>)"); | |
2051 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(9,"Cov(<4>,<sin(#phi)>)"); | |
2052 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(10,"Cov(<4>,<cos(#phi_{1}+#phi_{2})>)"); | |
2053 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(11,"Cov(<4>,<sin(#phi_{1}+#phi_{2})>)"); | |
2054 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(12,"Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
2055 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(13,"Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
2056 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(14,"Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
2057 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(15,"Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
2058 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(16,"Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2059 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(17,"Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2060 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(18,"Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
2061 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(19,"Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
2062 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(20,"Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2063 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(21,"Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2064 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(22,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>)"); | |
2065 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(23,"Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2066 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(24,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2067 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(25,"Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2068 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(26,"Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2069 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(27,"Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>)"); | |
2070 | fIntFlowProfiles->Add(fIntFlowProductOfCorrectionTermsForNUAPro); | |
489d5531 | 2071 | // average correction terms for non-uniform acceptance (with wrong errors!): |
2072 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2073 | { | |
2074 | TString intFlowCorrectionTermsForNUAProName = "fIntFlowCorrectionTermsForNUAPro"; | |
2075 | intFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
b92ea2b9 | 2076 | fIntFlowCorrectionTermsForNUAPro[sc] = new TProfile(Form("%s: %s terms",intFlowCorrectionTermsForNUAProName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4,"s"); |
489d5531 | 2077 | fIntFlowCorrectionTermsForNUAPro[sc]->SetTickLength(-0.01,"Y"); |
2078 | fIntFlowCorrectionTermsForNUAPro[sc]->SetMarkerStyle(25); | |
403e3389 | 2079 | fIntFlowCorrectionTermsForNUAPro[sc]->SetLabelSize(0.05); |
489d5531 | 2080 | fIntFlowCorrectionTermsForNUAPro[sc]->SetLabelOffset(0.01,"Y"); |
403e3389 | 2081 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(1,Form("#LT#LT%s(n(#phi_{1}))#GT#GT",sinCosFlag[sc].Data())); |
2082 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(2,Form("#LT#LT%s(n(#phi_{1}+#phi_{2}))#GT#GT",sinCosFlag[sc].Data())); | |
2083 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(3,Form("#LT#LT%s(n(#phi_{1}-#phi_{2}-#phi_{3}))#GT#GT",sinCosFlag[sc].Data())); | |
2084 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(4,Form("#LT#LT%s(n(2#phi_{1}-#phi_{2}))#GT#GT",sinCosFlag[sc].Data())); | |
489d5531 | 2085 | fIntFlowProfiles->Add(fIntFlowCorrectionTermsForNUAPro[sc]); |
2001bc3a | 2086 | // versus multiplicity: |
b3dacf6b | 2087 | if(fCalculateCumulantsVsM) |
2088 | { | |
2089 | TString correctionTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4 | |
2090 | for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) | |
2091 | { | |
2092 | TString intFlowCorrectionTermsForNUAVsMProName = "fIntFlowCorrectionTermsForNUAVsMPro"; | |
2093 | intFlowCorrectionTermsForNUAVsMProName += fAnalysisLabel->Data(); | |
2094 | fIntFlowCorrectionTermsForNUAVsMPro[sc][ci] = new TProfile(Form("%s: #LT#LT%s%s#GT#GT",intFlowCorrectionTermsForNUAVsMProName.Data(),sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()),Form("#LT#LT%s%s#GT#GT vs M",sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()),fnBinsMult,fMinMult,fMaxMult,"s"); | |
2095 | fIntFlowProfiles->Add(fIntFlowCorrectionTermsForNUAVsMPro[sc][ci]); | |
2096 | } | |
2097 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 2098 | } // end of for(Int_t sc=0;sc<2;sc++) |
2099 | ||
2100 | // d) Book histograms holding the final results: | |
2101 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with correct errors!): | |
2102 | TString intFlowCorrelationsHistName = "fIntFlowCorrelationsHist"; | |
2103 | intFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
2104 | fIntFlowCorrelationsHist = new TH1D(intFlowCorrelationsHistName.Data(),"Average correlations for all events",4,0,4); | |
2105 | fIntFlowCorrelationsHist->SetTickLength(-0.01,"Y"); | |
2106 | fIntFlowCorrelationsHist->SetMarkerStyle(25); | |
2107 | fIntFlowCorrelationsHist->SetLabelSize(0.06); | |
2108 | fIntFlowCorrelationsHist->SetLabelOffset(0.01,"Y"); | |
403e3389 | 2109 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(1,"#LT#LT2#GT#GT"); |
2110 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(2,"#LT#LT4#GT#GT"); | |
2111 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(3,"#LT#LT6#GT#GT"); | |
2112 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(4,"#LT#LT8#GT#GT"); | |
489d5531 | 2113 | fIntFlowResults->Add(fIntFlowCorrelationsHist); |
ff70ca91 | 2114 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with correct errors!) vs M: |
b3dacf6b | 2115 | if(fCalculateCumulantsVsM) |
2116 | { | |
2117 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2118 | { | |
2119 | TString intFlowCorrelationsVsMHistName = "fIntFlowCorrelationsVsMHist"; | |
2120 | intFlowCorrelationsVsMHistName += fAnalysisLabel->Data(); | |
2121 | fIntFlowCorrelationsVsMHist[ci] = new TH1D(Form("%s, %s",intFlowCorrelationsVsMHistName.Data(),correlationFlag[ci].Data()), | |
2122 | Form("%s vs multiplicity",correlationFlag[ci].Data()), | |
2123 | fnBinsMult,fMinMult,fMaxMult); | |
2124 | fIntFlowCorrelationsVsMHist[ci]->GetYaxis()->SetTitle(correlationFlag[ci].Data()); | |
df23c5ae | 2125 | if(fMultiplicityIs==AliFlowCommonConstants::kRP) |
2126 | { | |
2127 | fIntFlowCorrelationsVsMHist[ci]->GetXaxis()->SetTitle("# RPs"); | |
2128 | } else if(fMultiplicityIs==AliFlowCommonConstants::kExternal) | |
2129 | { | |
2130 | fIntFlowCorrelationsVsMHist[ci]->GetXaxis()->SetTitle("Reference multiplicity (from ESD)"); | |
2131 | } else if(fMultiplicityIs==AliFlowCommonConstants::kPOI) | |
2132 | { | |
2133 | fIntFlowCorrelationsVsMHist[ci]->GetXaxis()->SetTitle("# POIs"); | |
2134 | } | |
b3dacf6b | 2135 | fIntFlowResults->Add(fIntFlowCorrelationsVsMHist[ci]); |
2136 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
2137 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 2138 | // average all correlations for all events (with correct errors!): |
2139 | TString intFlowCorrelationsAllHistName = "fIntFlowCorrelationsAllHist"; | |
2140 | intFlowCorrelationsAllHistName += fAnalysisLabel->Data(); | |
8ed4edc7 | 2141 | fIntFlowCorrelationsAllHist = new TH1D(intFlowCorrelationsAllHistName.Data(),"Average correlations for all events",34,0,34); |
489d5531 | 2142 | fIntFlowCorrelationsAllHist->SetTickLength(-0.01,"Y"); |
2143 | fIntFlowCorrelationsAllHist->SetMarkerStyle(25); | |
2144 | fIntFlowCorrelationsAllHist->SetLabelSize(0.03); | |
2145 | fIntFlowCorrelationsAllHist->SetLabelOffset(0.01,"Y"); | |
2146 | // 2-p correlations: | |
2147 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(1,"<<2>>_{n|n}"); | |
2148 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(2,"<<2>>_{2n|2n}"); | |
2149 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(3,"<<2>>_{3n|3n}"); | |
2150 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(4,"<<2>>_{4n|4n}"); | |
2151 | // 3-p correlations: | |
2152 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(6,"<<3>>_{2n|n,n}"); | |
2153 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}"); | |
2154 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}"); | |
2155 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}"); | |
2156 | // 4-p correlations: | |
2157 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}"); | |
2158 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}"); | |
2159 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}"); | |
2160 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}"); | |
2161 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}"); | |
2162 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}"); | |
2163 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}"); | |
2164 | // 5-p correlations: | |
2165 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}"); | |
2166 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}"); | |
2167 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}"); | |
2168 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}"); | |
2169 | // 6-p correlations: | |
2170 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}"); | |
2171 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}"); | |
2172 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}"); | |
2173 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}"); | |
2174 | // 7-p correlations: | |
2175 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}"); | |
2176 | // 8-p correlations: | |
2177 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}"); | |
2178 | fIntFlowResults->Add(fIntFlowCorrelationsAllHist); | |
2179 | // average correction terms for non-uniform acceptance (with correct errors!): | |
2180 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2181 | { | |
2182 | TString intFlowCorrectionTermsForNUAHistName = "fIntFlowCorrectionTermsForNUAHist"; | |
2183 | intFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
b92ea2b9 | 2184 | fIntFlowCorrectionTermsForNUAHist[sc] = new TH1D(Form("%s: %s terms",intFlowCorrectionTermsForNUAHistName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4); |
489d5531 | 2185 | fIntFlowCorrectionTermsForNUAHist[sc]->SetTickLength(-0.01,"Y"); |
2186 | fIntFlowCorrectionTermsForNUAHist[sc]->SetMarkerStyle(25); | |
403e3389 | 2187 | fIntFlowCorrectionTermsForNUAHist[sc]->SetLabelSize(0.05); |
489d5531 | 2188 | fIntFlowCorrectionTermsForNUAHist[sc]->SetLabelOffset(0.01,"Y"); |
b92ea2b9 | 2189 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(1,Form("#LT#LT%s(n(#phi_{1}))#GT#GT",sinCosFlag[sc].Data())); |
403e3389 | 2190 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(2,Form("#LT#LT%s(n(#phi_{1}+#phi_{2}))#GT#GT",sinCosFlag[sc].Data())); |
2191 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(3,Form("#LT#LT%s(n(#phi_{1}-#phi_{2}-#phi_{3}))#GT#GT",sinCosFlag[sc].Data())); | |
2192 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(4,Form("#LT#LT%s(n(2#phi_{1}-#phi_{2}))#GT#GT",sinCosFlag[sc].Data())); | |
489d5531 | 2193 | fIntFlowResults->Add(fIntFlowCorrectionTermsForNUAHist[sc]); |
2194 | } // end of for(Int_t sc=0;sc<2;sc++) | |
2195 | // covariances (multiplied with weight dependent prefactor): | |
2196 | TString intFlowCovariancesName = "fIntFlowCovariances"; | |
2197 | intFlowCovariancesName += fAnalysisLabel->Data(); | |
2198 | fIntFlowCovariances = new TH1D(intFlowCovariancesName.Data(),"Covariances (multiplied with weight dependent prefactor)",6,0,6); | |
2199 | fIntFlowCovariances->SetLabelSize(0.04); | |
2200 | fIntFlowCovariances->SetMarkerStyle(25); | |
403e3389 | 2201 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(1,"Cov(#LT2#GT,#LT4#GT)"); |
2202 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(2,"Cov(#LT2#GT,#LT6#GT)"); | |
2203 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(3,"Cov(#LT2#GT,#LT8#GT)"); | |
2204 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(4,"Cov(#LT4#GT,#LT6#GT)"); | |
2205 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(5,"Cov(#LT4#GT,#LT8#GT)"); | |
2206 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(6,"Cov(#LT6#GT,#LT8#GT)"); | |
489d5531 | 2207 | fIntFlowResults->Add(fIntFlowCovariances); |
2208 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8>: | |
2209 | TString intFlowSumOfEventWeightsName = "fIntFlowSumOfEventWeights"; | |
2210 | intFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
2211 | for(Int_t power=0;power<2;power++) | |
2212 | { | |
2213 | fIntFlowSumOfEventWeights[power] = new TH1D(Form("%s: %s",intFlowSumOfEventWeightsName.Data(),powerFlag[power].Data()),Form("Sum of %s event weights for correlations",powerFlag[power].Data()),4,0,4); | |
403e3389 | 2214 | fIntFlowSumOfEventWeights[power]->SetLabelSize(0.04); |
489d5531 | 2215 | fIntFlowSumOfEventWeights[power]->SetMarkerStyle(25); |
2216 | if(power == 0) | |
2217 | { | |
403e3389 | 2218 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{#LT2#GT}"); |
2219 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{#LT4#GT}"); | |
2220 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{#LT6#GT}"); | |
2221 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{#LT8#GT}"); | |
489d5531 | 2222 | } else if (power == 1) |
2223 | { | |
403e3389 | 2224 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{#LT2#GT}^{2}"); |
2225 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{#LT4#GT}^{2}"); | |
2226 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{#LT6#GT}^{2}"); | |
2227 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{#LT8#GT}^{2}"); | |
489d5531 | 2228 | } |
2229 | fIntFlowResults->Add(fIntFlowSumOfEventWeights[power]); | |
2230 | } | |
2231 | // sum of products of event weights for correlations <2>, <4>, <6> and <8>: | |
2232 | TString intFlowSumOfProductOfEventWeightsName = "fIntFlowSumOfProductOfEventWeights"; | |
2233 | intFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
2234 | fIntFlowSumOfProductOfEventWeights = new TH1D(intFlowSumOfProductOfEventWeightsName.Data(),"Sum of product of event weights for correlations",6,0,6); | |
403e3389 | 2235 | fIntFlowSumOfProductOfEventWeights->SetLabelSize(0.04); |
489d5531 | 2236 | fIntFlowSumOfProductOfEventWeights->SetMarkerStyle(25); |
403e3389 | 2237 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LT4#GT}"); |
2238 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LT6#GT}"); | |
2239 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LT8#GT}"); | |
2240 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LT6#GT}"); | |
2241 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(5,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LT8#GT}"); | |
2242 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(6,"#sum_{i=1}^{N} w_{#LT6#GT} w_{#LT8#GT}"); | |
489d5531 | 2243 | fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeights); |
ff70ca91 | 2244 | // final result for covariances of correlations (multiplied with weight dependent prefactor) versus M |
2245 | // [0=Cov(2,4),1=Cov(2,6),2=Cov(2,8),3=Cov(4,6),4=Cov(4,8),5=Cov(6,8)]: | |
b3dacf6b | 2246 | if(fCalculateCumulantsVsM) |
ff70ca91 | 2247 | { |
b3dacf6b | 2248 | TString intFlowCovariancesVsMName = "fIntFlowCovariancesVsM"; |
2249 | intFlowCovariancesVsMName += fAnalysisLabel->Data(); | |
2250 | TString covarianceFlag[6] = {"Cov(<2>,<4>)","Cov(<2>,<6>)","Cov(<2>,<8>)","Cov(<4>,<6>)","Cov(<4>,<8>)","Cov(<6>,<8>)"}; | |
2251 | for(Int_t ci=0;ci<6;ci++) | |
2252 | { | |
2253 | fIntFlowCovariancesVsM[ci] = new TH1D(Form("%s, %s",intFlowCovariancesVsMName.Data(),covarianceFlag[ci].Data()), | |
2254 | Form("%s vs multiplicity",covarianceFlag[ci].Data()), | |
2255 | fnBinsMult,fMinMult,fMaxMult); | |
2256 | fIntFlowCovariancesVsM[ci]->GetYaxis()->SetTitle(covarianceFlag[ci].Data()); | |
df23c5ae | 2257 | if(fMultiplicityIs==AliFlowCommonConstants::kRP) |
2258 | { | |
2259 | fIntFlowCovariancesVsM[ci]->GetXaxis()->SetTitle("# RPs"); | |
2260 | } else if(fMultiplicityIs==AliFlowCommonConstants::kExternal) | |
2261 | { | |
2262 | fIntFlowCovariancesVsM[ci]->GetXaxis()->SetTitle("Reference multiplicity (from ESD)"); | |
2263 | } else if(fMultiplicityIs==AliFlowCommonConstants::kPOI) | |
2264 | { | |
2265 | fIntFlowCovariancesVsM[ci]->GetXaxis()->SetTitle("# POIs"); | |
2266 | } | |
b3dacf6b | 2267 | fIntFlowResults->Add(fIntFlowCovariancesVsM[ci]); |
2268 | } | |
2269 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 2270 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8> versus multiplicity |
2271 | // [0=sum{w_{<2>}},1=sum{w_{<4>}},2=sum{w_{<6>}},3=sum{w_{<8>}}][0=linear 1,1=quadratic]: | |
b3dacf6b | 2272 | if(fCalculateCumulantsVsM) |
ff70ca91 | 2273 | { |
b3dacf6b | 2274 | TString intFlowSumOfEventWeightsVsMName = "fIntFlowSumOfEventWeightsVsM"; |
2275 | intFlowSumOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
2276 | TString sumFlag[2][4] = {{"#sum_{i=1}^{N} w_{<2>}","#sum_{i=1}^{N} w_{<4>}","#sum_{i=1}^{N} w_{<6>}","#sum_{i=1}^{N} w_{<8>}"}, | |
2277 | {"#sum_{i=1}^{N} w_{<2>}^{2}","#sum_{i=1}^{N} w_{<4>}^{2}","#sum_{i=1}^{N} w_{<6>}^{2}","#sum_{i=1}^{N} w_{<8>}^{2}"}}; | |
2278 | for(Int_t si=0;si<4;si++) | |
ff70ca91 | 2279 | { |
b3dacf6b | 2280 | for(Int_t power=0;power<2;power++) |
2281 | { | |
2282 | fIntFlowSumOfEventWeightsVsM[si][power] = new TH1D(Form("%s, %s",intFlowSumOfEventWeightsVsMName.Data(),sumFlag[power][si].Data()), | |
2283 | Form("%s vs multiplicity",sumFlag[power][si].Data()), | |
2284 | fnBinsMult,fMinMult,fMaxMult); | |
2285 | fIntFlowSumOfEventWeightsVsM[si][power]->GetYaxis()->SetTitle(sumFlag[power][si].Data()); | |
df23c5ae | 2286 | if(fMultiplicityIs==AliFlowCommonConstants::kRP) |
2287 | { | |
2288 | fIntFlowSumOfEventWeightsVsM[si][power]->GetXaxis()->SetTitle("# RPs"); | |
2289 | } else if(fMultiplicityIs==AliFlowCommonConstants::kExternal) | |
2290 | { | |
2291 | fIntFlowSumOfEventWeightsVsM[si][power]->GetXaxis()->SetTitle("Reference multiplicity (from ESD)"); | |
2292 | } else if(fMultiplicityIs==AliFlowCommonConstants::kPOI) | |
2293 | { | |
2294 | fIntFlowSumOfEventWeightsVsM[si][power]->GetXaxis()->SetTitle("# POIs"); | |
2295 | } | |
b3dacf6b | 2296 | fIntFlowResults->Add(fIntFlowSumOfEventWeightsVsM[si][power]); |
2297 | } // end of for(Int_t power=0;power<2;power++) | |
2298 | } // end of for(Int_t si=0;si<4;si++) | |
2299 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 2300 | // sum of products of event weights for correlations <2>, <4>, <6> and <8> vs M |
2301 | // [0=sum{w_{<2>}w_{<4>}},1=sum{w_{<2>}w_{<6>}},2=sum{w_{<2>}w_{<8>}}, | |
2302 | // 3=sum{w_{<4>}w_{<6>}},4=sum{w_{<4>}w_{<8>}},5=sum{w_{<6>}w_{<8>}}]: | |
b3dacf6b | 2303 | if(fCalculateCumulantsVsM) |
2304 | { | |
2305 | TString intFlowSumOfProductOfEventWeightsVsMName = "fIntFlowSumOfProductOfEventWeightsVsM"; | |
2306 | intFlowSumOfProductOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
2307 | TString sopowFlag[6] = {"#sum_{i=1}^{N} w_{<2>} w_{<4>}","#sum_{i=1}^{N} w_{<2>} w_{<6>}","#sum_{i=1}^{N} w_{<2>} w_{<8>}", | |
2308 | "#sum_{i=1}^{N} w_{<4>} w_{<6>}","#sum_{i=1}^{N} w_{<4>} w_{<8>}","#sum_{i=1}^{N} w_{<6>} w_{<8>}"}; | |
2309 | for(Int_t pi=0;pi<6;pi++) | |
2310 | { | |
2311 | fIntFlowSumOfProductOfEventWeightsVsM[pi] = new TH1D(Form("%s, %s",intFlowSumOfProductOfEventWeightsVsMName.Data(),sopowFlag[pi].Data()), | |
2312 | Form("%s versus multiplicity",sopowFlag[pi].Data()), | |
2313 | fnBinsMult,fMinMult,fMaxMult); | |
df23c5ae | 2314 | if(fMultiplicityIs==AliFlowCommonConstants::kRP) |
2315 | { | |
2316 | fIntFlowSumOfProductOfEventWeightsVsM[pi]->GetXaxis()->SetTitle("# RPs"); | |
2317 | } else if(fMultiplicityIs==AliFlowCommonConstants::kExternal) | |
2318 | { | |
2319 | fIntFlowSumOfProductOfEventWeightsVsM[pi]->GetXaxis()->SetTitle("Reference multiplicity (from ESD)"); | |
2320 | } else if(fMultiplicityIs==AliFlowCommonConstants::kPOI) | |
2321 | { | |
2322 | fIntFlowSumOfProductOfEventWeightsVsM[pi]->GetXaxis()->SetTitle("# POIs"); | |
2323 | } | |
b3dacf6b | 2324 | fIntFlowSumOfProductOfEventWeightsVsM[pi]->GetYaxis()->SetTitle(sopowFlag[pi].Data()); |
2325 | fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeightsVsM[pi]); | |
2326 | } // end of for(Int_t pi=0;pi<6;pi++) | |
2327 | } // end of if(fCalculateCumulantsVsM) | |
0328db2d | 2328 | // covariances of NUA terms (multiplied with weight dependent prefactor): |
2329 | TString intFlowCovariancesNUAName = "fIntFlowCovariancesNUA"; | |
2330 | intFlowCovariancesNUAName += fAnalysisLabel->Data(); | |
2331 | fIntFlowCovariancesNUA = new TH1D(intFlowCovariancesNUAName.Data(),"Covariances for NUA (multiplied with weight dependent prefactor)",27,0,27); | |
2332 | fIntFlowCovariancesNUA->SetLabelSize(0.04); | |
2333 | fIntFlowCovariancesNUA->SetMarkerStyle(25); | |
2334 | fIntFlowCovariancesNUA->GetXaxis()->SetLabelSize(0.02); | |
2335 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(1,"Cov(<2>,<cos(#phi)>"); | |
2336 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(2,"Cov(<2>,<sin(#phi)>)"); | |
2337 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(3,"Cov(<cos(#phi)>,<sin(#phi)>)"); | |
2338 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(4,"Cov(<2>,<cos(#phi_{1}+#phi_{2})>)"); | |
2339 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(5,"Cov(<2>,<sin(#phi_{1}+#phi_{2})>)"); | |
2340 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(6,"Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2341 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(7,"Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2342 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(8,"Cov(<4>,<cos(#phi)>)"); | |
2343 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(9,"Cov(<4>,<sin(#phi)>)"); | |
2344 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(10,"Cov(<4>,<cos(#phi_{1}+#phi_{2})>)"); | |
2345 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(11,"Cov(<4>,<sin(#phi_{1}+#phi_{2})>)"); | |
2346 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(12,"Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
2347 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(13,"Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
2348 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(14,"Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
2349 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(15,"Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
2350 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(16,"Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2351 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(17,"Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2352 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(18,"Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
2353 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(19,"Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
2354 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(20,"Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2355 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(21,"Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2356 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(22,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>)"); | |
2357 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(23,"Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2358 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(24,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2359 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(25,"Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2360 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(26,"Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2361 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(27,"Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>)"); | |
2362 | fIntFlowResults->Add(fIntFlowCovariancesNUA); | |
2363 | // sum of linear and quadratic event weights for NUA terms: | |
2364 | TString intFlowSumOfEventWeightsNUAName = "fIntFlowSumOfEventWeightsNUA"; | |
2365 | intFlowSumOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
2366 | for(Int_t sc=0;sc<2;sc++) | |
2367 | { | |
2368 | for(Int_t power=0;power<2;power++) | |
2369 | { | |
b92ea2b9 | 2370 | fIntFlowSumOfEventWeightsNUA[sc][power] = new TH1D(Form("%s: %s, %s",intFlowSumOfEventWeightsNUAName.Data(),powerFlag[power].Data(),sinCosFlag[sc].Data()),Form("Sum of %s event weights for NUA %s terms",powerFlag[power].Data(),sinCosFlag[sc].Data()),4,0,4); // to be improved - 4 |
0328db2d | 2371 | fIntFlowSumOfEventWeightsNUA[sc][power]->SetLabelSize(0.05); |
2372 | fIntFlowSumOfEventWeightsNUA[sc][power]->SetMarkerStyle(25); | |
2373 | if(power == 0) | |
2374 | { | |
2375 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(1,Form("#sum_{i=1}^{N} w_{<%s(#phi)>}",sinCosFlag[sc].Data())); | |
2376 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(2,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}+#phi_{2})>}",sinCosFlag[sc].Data())); | |
b92ea2b9 | 2377 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(3,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}-#phi_{2}-#phi_{3})>}",sinCosFlag[sc].Data())); |
2378 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(4,Form("#sum_{i=1}^{N} w_{<%s(2#phi_{1}-#phi_{2})>}",sinCosFlag[sc].Data())); | |
0328db2d | 2379 | } else if(power == 1) |
2380 | { | |
2381 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(1,Form("#sum_{i=1}^{N} w_{<%s(#phi)>}^{2}",sinCosFlag[sc].Data())); | |
2382 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(2,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}+#phi_{2})>}^{2}",sinCosFlag[sc].Data())); | |
2383 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(3,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}-#phi_{2}-#phi_{3})>}^{2}",sinCosFlag[sc].Data())); | |
b92ea2b9 | 2384 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(4,Form("#sum_{i=1}^{N} w_{<%s(2#phi_{1}-#phi_{2})>}^{2}",sinCosFlag[sc].Data())); |
0328db2d | 2385 | } |
2386 | fIntFlowResults->Add(fIntFlowSumOfEventWeightsNUA[sc][power]); | |
2387 | } | |
2388 | } | |
2389 | // sum of products of event weights for NUA terms: | |
2390 | TString intFlowSumOfProductOfEventWeightsNUAName = "fIntFlowSumOfProductOfEventWeightsNUA"; | |
2391 | intFlowSumOfProductOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
2392 | fIntFlowSumOfProductOfEventWeightsNUA = new TH1D(intFlowSumOfProductOfEventWeightsNUAName.Data(),"Sum of product of event weights for NUA terms",27,0,27); | |
403e3389 | 2393 | fIntFlowSumOfProductOfEventWeightsNUA->SetLabelSize(0.02); |
0328db2d | 2394 | fIntFlowSumOfProductOfEventWeightsNUA->SetMarkerStyle(25); |
62e36168 | 2395 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LTcos(#phi)#GT}"); |
2396 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LTsin(#phi)#GT}"); | |
2397 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{#LTcos(#phi)#GT} w_{#LTsin(#phi)#GT}"); | |
2398 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LTcos(#phi_{1}+#phi_{2})#GT}"); | |
2399 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(5,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LTsin(#phi_{1}+#phi_{2})#GT}"); | |
2400 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(6,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LTcos(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2401 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(7,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LTsin(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2402 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(8,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LTcos(#phi)#GT}"); | |
2403 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(9,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LTsin(#phi)#GT}"); | |
2404 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(10,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LTcos(#phi_{1}+#phi_{2})#GT}"); | |
2405 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(11,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LTsin(#phi_{1}+#phi_{2})#GT}"); | |
2406 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(12,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LTcos(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2407 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(13,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LTsin(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2408 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(14,"#sum_{i=1}^{N} w_{#LTcos(#phi)#GT} w_{#LTcos(#phi_{1}+#phi_{2})#GT}"); | |
2409 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(15,"#sum_{i=1}^{N} w_{#LTcos(#phi)#GT} w_{#LTsin(#phi_{1}+#phi_{2})#GT}"); | |
2410 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(16,"#sum_{i=1}^{N} w_{#LTcos(#phi)#GT} w_{#LTcos(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2411 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(17,"#sum_{i=1}^{N} w_{#LTcos(#phi)#GT} w_{#LTsin(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2412 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(18,"#sum_{i=1}^{N} w_{#LTsin(#phi)#GT} w_{#LTcos(#phi_{1}+#phi_{2})#GT}"); | |
2413 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(19,"#sum_{i=1}^{N} w_{#LTsin(#phi)#GT} w_{#LTsin(#phi_{1}+#phi_{2})#GT}"); | |
2414 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(20,"#sum_{i=1}^{N} w_{#LTsin(#phi)#GT} w_{#LTcos(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2415 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(21,"#sum_{i=1}^{N} w_{#LTsin(#phi)#GT} w_{#LTsin(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2416 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(22,"#sum_{i=1}^{N} w_{#LTcos(#phi_{1}+#phi_{2})#GT} w_{#LTsin(#phi_{1}+#phi_{2})#GT}"); | |
2417 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(23,"#sum_{i=1}^{N} w_{#LTcos(#phi_{1}+#phi_{2})#GT} w_{#LTcos(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2418 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(24,"#sum_{i=1}^{N} w_{#LTcos(#phi_{1}+#phi_{2})#GT} w_{#LTsin(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2419 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(25,"#sum_{i=1}^{N} w_{#LTsin(#phi_{1}+#phi_{2})#GT} w_{#LTcos(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2420 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(26,"#sum_{i=1}^{N} w_{#LTsin(#phi_{1}+#phi_{2})#GT} w_{#LTsin(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2421 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(27,"#sum_{i=1}^{N} w_{#LTcos(#phi_{1}-#phi_{2}-#phi_{3})#GT} w_{#LTsin(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
0328db2d | 2422 | fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeightsNUA); |
b3dacf6b | 2423 | // Final results for reference Q-cumulants: |
2424 | TString cumulantFlag[4] = {"QC{2}","QC{4}","QC{6}","QC{8}"}; | |
489d5531 | 2425 | TString intFlowQcumulantsName = "fIntFlowQcumulants"; |
2426 | intFlowQcumulantsName += fAnalysisLabel->Data(); | |
b92ea2b9 | 2427 | fIntFlowQcumulants = new TH1D(intFlowQcumulantsName.Data(),"Reference Q-cumulants",4,0,4); |
b77b6434 | 2428 | if(fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 2429 | { |
b77b6434 | 2430 | fIntFlowQcumulants->SetTitle("Reference Q-cumulants (error from non-isotropic terms also propagated)"); |
b92ea2b9 | 2431 | } |
489d5531 | 2432 | fIntFlowQcumulants->SetLabelSize(0.05); |
2433 | fIntFlowQcumulants->SetMarkerStyle(25); | |
68a3b4b1 | 2434 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2435 | { |
68a3b4b1 | 2436 | (fIntFlowQcumulants->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data()); |
b3dacf6b | 2437 | } |
489d5531 | 2438 | fIntFlowResults->Add(fIntFlowQcumulants); |
b3dacf6b | 2439 | // Final results for reference Q-cumulants rebinned in M: |
2440 | if(fCalculateCumulantsVsM) | |
2441 | { | |
2442 | TString intFlowQcumulantsRebinnedInMName = "fIntFlowQcumulantsRebinnedInM"; | |
2443 | intFlowQcumulantsRebinnedInMName += fAnalysisLabel->Data(); | |
2444 | fIntFlowQcumulantsRebinnedInM = new TH1D(intFlowQcumulantsRebinnedInMName.Data(),"Reference Q-cumulants rebinned in M",4,0,4); | |
2445 | fIntFlowQcumulantsRebinnedInM->SetLabelSize(0.05); | |
2446 | fIntFlowQcumulantsRebinnedInM->SetMarkerStyle(25); | |
68a3b4b1 | 2447 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2448 | { |
68a3b4b1 | 2449 | (fIntFlowQcumulantsRebinnedInM->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data()); |
b3dacf6b | 2450 | } |
2451 | fIntFlowResults->Add(fIntFlowQcumulantsRebinnedInM); | |
2452 | } // end of if(fCalculateCumulantsVsM) | |
b92ea2b9 | 2453 | // Ratio between error squared: with/without non-isotropic terms: |
2454 | TString intFlowQcumulantsErrorSquaredRatioName = "fIntFlowQcumulantsErrorSquaredRatio"; | |
2455 | intFlowQcumulantsErrorSquaredRatioName += fAnalysisLabel->Data(); | |
2456 | fIntFlowQcumulantsErrorSquaredRatio = new TH1D(intFlowQcumulantsErrorSquaredRatioName.Data(),"Error squared of reference Q-cumulants: #frac{with NUA terms}{without NUA terms}",4,0,4); | |
2457 | fIntFlowQcumulantsErrorSquaredRatio->SetLabelSize(0.05); | |
2458 | fIntFlowQcumulantsErrorSquaredRatio->SetMarkerStyle(25); | |
2459 | for(Int_t b=0;b<4;b++) | |
2460 | { | |
2461 | (fIntFlowQcumulantsErrorSquaredRatio->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data()); | |
2462 | } | |
2463 | fIntFlowResults->Add(fIntFlowQcumulantsErrorSquaredRatio); | |
ff70ca91 | 2464 | // final results for integrated Q-cumulants versus multiplicity: |
b3dacf6b | 2465 | if(fCalculateCumulantsVsM) |
2466 | { | |
2467 | TString intFlowQcumulantsVsMName = "fIntFlowQcumulantsVsM"; | |
2468 | intFlowQcumulantsVsMName += fAnalysisLabel->Data(); | |
2469 | for(Int_t co=0;co<4;co++) // cumulant order | |
2470 | { | |
2471 | fIntFlowQcumulantsVsM[co] = new TH1D(Form("%s, %s",intFlowQcumulantsVsMName.Data(),cumulantFlag[co].Data()), | |
3842bdcd | 2472 | Form("%s vs multiplicity",cumulantFlag[co].Data()), |
b3dacf6b | 2473 | fnBinsMult,fMinMult,fMaxMult); |
df23c5ae | 2474 | if(fMultiplicityIs==AliFlowCommonConstants::kRP) |
2475 | { | |
2476 | fIntFlowQcumulantsVsM[co]->GetXaxis()->SetTitle("# RPs"); | |
2477 | } else if(fMultiplicityIs==AliFlowCommonConstants::kExternal) | |
2478 | { | |
2479 | fIntFlowQcumulantsVsM[co]->GetXaxis()->SetTitle("Reference multiplicity (from ESD)"); | |
2480 | } else if(fMultiplicityIs==AliFlowCommonConstants::kPOI) | |
2481 | { | |
2482 | fIntFlowQcumulantsVsM[co]->GetXaxis()->SetTitle("# POIs"); | |
2483 | } | |
b3dacf6b | 2484 | fIntFlowQcumulantsVsM[co]->GetYaxis()->SetTitle(cumulantFlag[co].Data()); |
2485 | fIntFlowResults->Add(fIntFlowQcumulantsVsM[co]); | |
2486 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
2487 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 2488 | // final integrated flow estimates from Q-cumulants: |
b3dacf6b | 2489 | TString flowFlag[4] = {Form("v_{%d}{2,QC}",fHarmonic),Form("v_{%d}{4,QC}",fHarmonic),Form("v_{%d}{6,QC}",fHarmonic),Form("v_{%d}{8,QC}",fHarmonic)}; |
489d5531 | 2490 | TString intFlowName = "fIntFlow"; |
2491 | intFlowName += fAnalysisLabel->Data(); | |
2492 | // integrated flow from Q-cumulants: | |
b3dacf6b | 2493 | fIntFlow = new TH1D(intFlowName.Data(),"Reference flow estimates from Q-cumulants",4,0,4); |
489d5531 | 2494 | fIntFlow->SetLabelSize(0.05); |
2495 | fIntFlow->SetMarkerStyle(25); | |
68a3b4b1 | 2496 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2497 | { |
68a3b4b1 | 2498 | (fIntFlow->GetXaxis())->SetBinLabel(b+1,flowFlag[b].Data()); |
b3dacf6b | 2499 | } |
ff70ca91 | 2500 | fIntFlowResults->Add(fIntFlow); |
b3dacf6b | 2501 | // Reference flow vs M rebinned in one huge bin: |
2502 | if(fCalculateCumulantsVsM) | |
2503 | { | |
2504 | TString intFlowRebinnedInMName = "fIntFlowRebinnedInM"; | |
2505 | intFlowRebinnedInMName += fAnalysisLabel->Data(); | |
2506 | fIntFlowRebinnedInM = new TH1D(intFlowRebinnedInMName.Data(),"Reference flow estimates from Q-cumulants (rebinned in M)",4,0,4); | |
2507 | fIntFlowRebinnedInM->SetLabelSize(0.05); | |
2508 | fIntFlowRebinnedInM->SetMarkerStyle(25); | |
68a3b4b1 | 2509 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2510 | { |
68a3b4b1 | 2511 | (fIntFlowRebinnedInM->GetXaxis())->SetBinLabel(b+1,flowFlag[b].Data()); |
b3dacf6b | 2512 | } |
2513 | fIntFlowResults->Add(fIntFlowRebinnedInM); | |
2514 | } | |
ff70ca91 | 2515 | // integrated flow from Q-cumulants: versus multiplicity: |
b3dacf6b | 2516 | if(fCalculateCumulantsVsM) |
2517 | { | |
2518 | TString intFlowVsMName = "fIntFlowVsM"; | |
2519 | intFlowVsMName += fAnalysisLabel->Data(); | |
2520 | for(Int_t co=0;co<4;co++) // cumulant order | |
2521 | { | |
2522 | fIntFlowVsM[co] = new TH1D(Form("%s, %s",intFlowVsMName.Data(),flowFlag[co].Data()), | |
3842bdcd | 2523 | Form("%s vs multiplicity",flowFlag[co].Data()), |
b3dacf6b | 2524 | fnBinsMult,fMinMult,fMaxMult); |
df23c5ae | 2525 | if(fMultiplicityIs==AliFlowCommonConstants::kRP) |
2526 | { | |
2527 | fIntFlowVsM[co]->GetXaxis()->SetTitle("# RPs"); | |
2528 | } else if(fMultiplicityIs==AliFlowCommonConstants::kExternal) | |
2529 | { | |
2530 | fIntFlowVsM[co]->GetXaxis()->SetTitle("Reference multiplicity (from ESD)"); | |
2531 | } else if(fMultiplicityIs==AliFlowCommonConstants::kPOI) | |
2532 | { | |
2533 | fIntFlowVsM[co]->GetXaxis()->SetTitle("# POIs"); | |
2534 | } | |
b3dacf6b | 2535 | fIntFlowVsM[co]->GetYaxis()->SetTitle(flowFlag[co].Data()); |
2536 | fIntFlowResults->Add(fIntFlowVsM[co]); | |
2537 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
2538 | } // end of if(fCalculateCumulantsVsM) | |
2001bc3a | 2539 | // quantifying detector effects effects to correlations: |
2540 | TString intFlowDetectorBiasName = "fIntFlowDetectorBias"; | |
2541 | intFlowDetectorBiasName += fAnalysisLabel->Data(); | |
2542 | fIntFlowDetectorBias = new TH1D(intFlowDetectorBiasName.Data(),"Quantifying detector bias",4,0,4); | |
2543 | fIntFlowDetectorBias->SetLabelSize(0.05); | |
2544 | fIntFlowDetectorBias->SetMarkerStyle(25); | |
2545 | for(Int_t ci=0;ci<4;ci++) | |
2546 | { | |
2547 | (fIntFlowDetectorBias->GetXaxis())->SetBinLabel(ci+1,Form("#frac{corrected}{measured} %s",cumulantFlag[ci].Data())); | |
2548 | } | |
2549 | fIntFlowResults->Add(fIntFlowDetectorBias); | |
2550 | // quantifying detector effects to correlations versus multiplicity: | |
b3dacf6b | 2551 | if(fCalculateCumulantsVsM) |
2001bc3a | 2552 | { |
b3dacf6b | 2553 | TString intFlowDetectorBiasVsMName = "fIntFlowDetectorBiasVsM"; |
2554 | intFlowDetectorBiasVsMName += fAnalysisLabel->Data(); | |
2555 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2556 | { | |
2557 | fIntFlowDetectorBiasVsM[ci] = new TH1D(Form("%s for %s",intFlowDetectorBiasVsMName.Data(),cumulantFlag[ci].Data()), | |
3842bdcd | 2558 | Form("Quantifying detector bias for %s vs multiplicity",cumulantFlag[ci].Data()), |
b3dacf6b | 2559 | fnBinsMult,fMinMult,fMaxMult); |
df23c5ae | 2560 | if(fMultiplicityIs==AliFlowCommonConstants::kRP) |
2561 | { | |
2562 | fIntFlowDetectorBiasVsM[ci]->GetXaxis()->SetTitle("# RPs"); | |
2563 | } else if(fMultiplicityIs==AliFlowCommonConstants::kExternal) | |
2564 | { | |
2565 | fIntFlowDetectorBiasVsM[ci]->GetXaxis()->SetTitle("Reference multiplicity (from ESD)"); | |
2566 | } else if(fMultiplicityIs==AliFlowCommonConstants::kPOI) | |
2567 | { | |
2568 | fIntFlowDetectorBiasVsM[ci]->GetXaxis()->SetTitle("# POIs"); | |
2569 | } | |
b3dacf6b | 2570 | fIntFlowDetectorBiasVsM[ci]->GetYaxis()->SetTitle("#frac{corrected}{measured}"); |
b77b6434 | 2571 | fIntFlowResults->Add(fIntFlowDetectorBiasVsM[ci]); |
b3dacf6b | 2572 | } // end of for(Int_t co=0;co<4;co++) // cumulant order |
2573 | } // end of if(fCalculateCumulantsVsM) | |
1268c371 | 2574 | |
489d5531 | 2575 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow() |
2576 | ||
e1d101a6 | 2577 | //======================================================================================================================= |
2578 | ||
df23c5ae | 2579 | void AliFlowAnalysisWithQCumulants::BookEverythingForControlHistograms() |
2580 | { | |
2581 | // Book all objects for control histograms. | |
2582 | ||
2583 | // a) Book profile to hold all flags for control histograms; | |
2584 | // b) Book all control histograms. | |
2585 | ||
2586 | // a) Book profile to hold all flags for control histograms: | |
2587 | TString controlHistogramsFlagsName = "fControlHistogramsFlags"; | |
2588 | controlHistogramsFlagsName += fAnalysisLabel->Data(); | |
1db7eced | 2589 | fControlHistogramsFlags = new TProfile(controlHistogramsFlagsName.Data(),"Flags for Control Histograms",2,0,2); |
df23c5ae | 2590 | fControlHistogramsFlags->SetTickLength(-0.01,"Y"); |
2591 | fControlHistogramsFlags->SetMarkerStyle(25); | |
2592 | fControlHistogramsFlags->SetLabelSize(0.04); | |
2593 | fControlHistogramsFlags->SetLabelOffset(0.02,"Y"); | |
2594 | fControlHistogramsFlags->SetStats(kFALSE); | |
1db7eced | 2595 | fControlHistogramsFlags->GetXaxis()->SetBinLabel(1,"fStoreControlHistograms"); |
2596 | fControlHistogramsFlags->GetXaxis()->SetBinLabel(2,"fUseQvectorTerms"); | |
df23c5ae | 2597 | fControlHistogramsList->Add(fControlHistogramsFlags); |
2598 | ||
2599 | if(!fStoreControlHistograms){return;} | |
2600 | ||
2601 | // b) Book all control histograms: | |
2602 | // b1) Correlation between # RPs and ref. mult. determined centrally: | |
2603 | TString sCorrelationNoRPsVsRefMultName = "fCorrelationNoRPsVsRefMult"; | |
2604 | sCorrelationNoRPsVsRefMultName += fAnalysisLabel->Data(); | |
2605 | fCorrelationNoRPsVsRefMult = new TH2D(sCorrelationNoRPsVsRefMultName.Data(),"# RPs vs. Reference Multiplicity",fnBinsMult,fMinMult,fMaxMult,fnBinsMult,fMinMult,fMaxMult); | |
2606 | fCorrelationNoRPsVsRefMult->SetTickLength(-0.01,"Y"); | |
2607 | fCorrelationNoRPsVsRefMult->SetLabelSize(0.04); | |
2608 | fCorrelationNoRPsVsRefMult->SetLabelOffset(0.02,"Y"); | |
2609 | fCorrelationNoRPsVsRefMult->SetStats(kTRUE); | |
2610 | fCorrelationNoRPsVsRefMult->GetXaxis()->SetTitle("# RPs"); | |
2611 | fCorrelationNoRPsVsRefMult->GetYaxis()->SetTitle("Reference Multiplicity"); | |
2612 | fControlHistogramsList->Add(fCorrelationNoRPsVsRefMult); | |
2613 | // b2) Correlation between # POIs and ref. mult. determined centrally: | |
2614 | TString sCorrelationNoPOIsVsRefMultName = "fCorrelationNoPOIsVsRefMult"; | |
2615 | sCorrelationNoPOIsVsRefMultName += fAnalysisLabel->Data(); | |
2616 | fCorrelationNoPOIsVsRefMult = new TH2D(sCorrelationNoPOIsVsRefMultName.Data(),"# POIs vs. Reference Multiplicity",fnBinsMult,fMinMult,fMaxMult,fnBinsMult,fMinMult,fMaxMult); | |
2617 | fCorrelationNoPOIsVsRefMult->SetTickLength(-0.01,"Y"); | |
2618 | fCorrelationNoPOIsVsRefMult->SetLabelSize(0.04); | |
2619 | fCorrelationNoPOIsVsRefMult->SetLabelOffset(0.02,"Y"); | |
2620 | fCorrelationNoPOIsVsRefMult->SetStats(kTRUE); | |
2621 | fCorrelationNoPOIsVsRefMult->GetXaxis()->SetTitle("# POIs"); | |
2622 | fCorrelationNoPOIsVsRefMult->GetYaxis()->SetTitle("Reference Multiplicity"); | |
2623 | fControlHistogramsList->Add(fCorrelationNoPOIsVsRefMult); | |
2624 | // b3) Correlation between # RPs and # POIs: | |
2625 | TString sCorrelationNoRPsVsNoPOIsName = "fCorrelationNoRPsVsNoPOIs"; | |
2626 | sCorrelationNoRPsVsNoPOIsName += fAnalysisLabel->Data(); | |
2627 | fCorrelationNoRPsVsNoPOIs = new TH2D(sCorrelationNoRPsVsNoPOIsName.Data(),"# RPs vs. # POIs",fnBinsMult,fMinMult,fMaxMult,fnBinsMult,fMinMult,fMaxMult); | |
2628 | fCorrelationNoRPsVsNoPOIs->SetTickLength(-0.01,"Y"); | |
2629 | fCorrelationNoRPsVsNoPOIs->SetLabelSize(0.04); | |
2630 | fCorrelationNoRPsVsNoPOIs->SetLabelOffset(0.02,"Y"); | |
2631 | fCorrelationNoRPsVsNoPOIs->SetStats(kTRUE); | |
2632 | fCorrelationNoRPsVsNoPOIs->GetXaxis()->SetTitle("# RPs"); | |
2633 | fCorrelationNoRPsVsNoPOIs->GetYaxis()->SetTitle("# POIs"); | |
2634 | fControlHistogramsList->Add(fCorrelationNoRPsVsNoPOIs); | |
d9e6d8bb | 2635 | // b4) <2>, <4>, <6> and <8> vs multiplicity (#RPs, #POIs or external): |
2636 | TString sCorrelation[4] = {"#LT2#GT","#LT4#GT","#LT6#GT","#LT8#GT"}; | |
2637 | TString sMultiplicity = ""; | |
2638 | if(fMultiplicityIs==AliFlowCommonConstants::kRP) | |
2639 | { | |
2640 | sMultiplicity = "# RPs"; | |
2641 | } else if(fMultiplicityIs==AliFlowCommonConstants::kExternal) | |
2642 | { | |
2643 | sMultiplicity = "Reference multiplicity (from ESD)"; | |
2644 | } else if(fMultiplicityIs==AliFlowCommonConstants::kPOI) | |
2645 | { | |
2646 | sMultiplicity = "# POIs"; | |
2647 | } | |
2648 | for(Int_t ci=0;ci<4;ci++) | |
2649 | { | |
1db7eced | 2650 | fCorrelation2468VsMult[ci] = new TH2D(Form("%s vs M",sCorrelation[ci].Data()),Form("%s vs M",sCorrelation[ci].Data()),fnBinsMult,fMinMult,fMaxMult,fnBinsForCorrelations,fMinValueOfCorrelation[ci],fMaxValueOfCorrelation[ci]); |
d9e6d8bb | 2651 | fCorrelation2468VsMult[ci]->SetTickLength(-0.01,"Y"); |
2652 | fCorrelation2468VsMult[ci]->SetLabelSize(0.04); | |
2653 | fCorrelation2468VsMult[ci]->SetLabelOffset(0.02,"Y"); | |
2654 | fCorrelation2468VsMult[ci]->SetStats(kTRUE); | |
2655 | fCorrelation2468VsMult[ci]->GetXaxis()->SetTitle(sMultiplicity.Data()); | |
2656 | fCorrelation2468VsMult[ci]->GetYaxis()->SetTitle(sCorrelation[ci].Data()); | |
2657 | fControlHistogramsList->Add(fCorrelation2468VsMult[ci]); | |
2658 | } // end of for(Int_t ci=0;ci<4;ci++) | |
1db7eced | 2659 | // b5) <2><4>, <2><6>, <2><8>, <4><6> etc. vs multiplicity (#RPs, #POIs or external): |
2660 | TString sCorrelationProduct[1] = {"#LT2#GT#LT4#GT"}; // TBI: add the other ones when needed first time | |
2661 | for(Int_t cpi=0;cpi<1;cpi++) // TBI: hardwired 1 | |
2662 | { | |
2663 | fCorrelationProduct2468VsMult[cpi] = new TH2D(Form("%s vs M",sCorrelationProduct[cpi].Data()),Form("%s vs M",sCorrelationProduct[cpi].Data()),fnBinsMult,fMinMult,fMaxMult,fnBinsForCorrelations,fMinValueOfCorrelationProduct[cpi],fMaxValueOfCorrelationProduct[cpi]); | |
2664 | fCorrelationProduct2468VsMult[cpi]->SetTickLength(-0.01,"Y"); | |
2665 | fCorrelationProduct2468VsMult[cpi]->SetLabelSize(0.04); | |
2666 | fCorrelationProduct2468VsMult[cpi]->SetLabelOffset(0.02,"Y"); | |
2667 | fCorrelationProduct2468VsMult[cpi]->SetStats(kTRUE); | |
2668 | fCorrelationProduct2468VsMult[cpi]->GetXaxis()->SetTitle(sMultiplicity.Data()); | |
2669 | fCorrelationProduct2468VsMult[cpi]->GetYaxis()->SetTitle(sCorrelationProduct[cpi].Data()); | |
2670 | fControlHistogramsList->Add(fCorrelationProduct2468VsMult[cpi]); | |
2671 | } // end of for(Int_t cpi=0;cpi<4;cpi++) | |
2672 | // b6) |Qn|^2/M, |Q2n|^2/M, |Qn|^4/(M(2M-1)), Re[Q2nQn^*Qn^*]/M, ... vs multiplicity (#RPs, #POIs or external) | |
2673 | if(fUseQvectorTerms) | |
2674 | { | |
2675 | TString sQvectorTerms[4] = {"#frac{|Q_{n}|^{2}}{M}","#frac{|Q_{2n}|^{2}}{M}","#frac{|Q_{n}|^{4}}{M(2M-1)}","#frac{Re[Q_{2n}Q_{n}^{*}Q_{n}^{*}]}{M^{3/2}}"}; // TBI: add the other ones when needed first time | |
2676 | for(Int_t qvti=0;qvti<4;qvti++) // TBI: hardwired 4 | |
2677 | { | |
2678 | fQvectorTermsVsMult[qvti] = new TH2D(Form("%s vs M",sQvectorTerms[qvti].Data()),Form("%s vs M",sQvectorTerms[qvti].Data()),fnBinsMult,fMinMult,fMaxMult,fnBinsForCorrelations,-100.,100.); // TBI hardwired -100 and 100 | |
2679 | fQvectorTermsVsMult[qvti]->SetTickLength(-0.01,"Y"); | |
2680 | fQvectorTermsVsMult[qvti]->SetLabelSize(0.04); | |
2681 | fQvectorTermsVsMult[qvti]->SetLabelOffset(0.02,"Y"); | |
2682 | fQvectorTermsVsMult[qvti]->SetStats(kTRUE); | |
2683 | fQvectorTermsVsMult[qvti]->GetXaxis()->SetTitle(sMultiplicity.Data()); | |
2684 | fQvectorTermsVsMult[qvti]->GetYaxis()->SetTitle(sQvectorTerms[qvti].Data()); | |
2685 | fControlHistogramsList->Add(fQvectorTermsVsMult[qvti]); | |
2686 | } // end of for(Int_t qvti=0;qvti<4;qvti++) | |
2687 | } // end of if(fUseQvectorTerms) | |
df23c5ae | 2688 | |
2689 | } // end of void AliFlowAnalysisWithQCumulants::BookEverythingForControlHistograms() | |
2690 | ||
2691 | //======================================================================================================================= | |
2692 | ||
e1d101a6 | 2693 | void AliFlowAnalysisWithQCumulants::BookEverythingForMixedHarmonics() |
2694 | { | |
2695 | // Book all objects for mixed harmonics. | |
2696 | ||
2697 | // a) Book profile to hold all flags for mixed harmonics; | |
2698 | // b) Book all objects in TList fMixedHarmonicsProfiles; | |
c10259fb | 2699 | // c) Book all objects in TList fMixedHarmonicsResults; |
2700 | // d) Book all objects in TList fMixedHarmonicsErrorPropagation. | |
e1d101a6 | 2701 | |
2702 | // a) Book profile to hold all flags for mixed harmonics: | |
2703 | TString mixedHarmonicsFlagsName = "fMixedHarmonicsFlags"; | |
2704 | mixedHarmonicsFlagsName += fAnalysisLabel->Data(); | |
2705 | fMixedHarmonicsFlags = new TProfile(mixedHarmonicsFlagsName.Data(),"Flags for Mixed Harmonics",4,0,4); | |
2706 | fMixedHarmonicsFlags->SetTickLength(-0.01,"Y"); | |
2707 | fMixedHarmonicsFlags->SetMarkerStyle(25); | |
2708 | fMixedHarmonicsFlags->SetLabelSize(0.04); | |
2709 | fMixedHarmonicsFlags->SetLabelOffset(0.02,"Y"); | |
2710 | fMixedHarmonicsFlags->SetStats(kFALSE); | |
2711 | fMixedHarmonicsFlags->GetXaxis()->SetBinLabel(1,"Calculate Mixed Harmonics"); | |
2712 | fMixedHarmonicsFlags->GetXaxis()->SetBinLabel(2,"Generic Harmonic"); | |
2713 | fMixedHarmonicsFlags->GetXaxis()->SetBinLabel(3,"Calculate vs Multiplicity"); | |
2714 | fMixedHarmonicsFlags->GetXaxis()->SetBinLabel(4,"Multiplicity Weight"); | |
2715 | fMixedHarmonicsList->Add(fMixedHarmonicsFlags); | |
2716 | ||
2717 | if(!fCalculateMixedHarmonics){return;} | |
2718 | ||
2719 | // b) Book all objects in TList fMixedHarmonicsProfiles: | |
2720 | // b1) 2-p correlations: | |
2721 | TString s2pCorrelationsName = "f2pCorrelations"; | |
2722 | s2pCorrelationsName += fAnalysisLabel->Data(); | |
c10259fb | 2723 | f2pCorrelations = new TProfile(s2pCorrelationsName.Data(),Form("2-particle correlations (n = %d)",fHarmonic),6,0,6,"s"); |
e1d101a6 | 2724 | f2pCorrelations->SetTickLength(-0.01,"Y"); |
2725 | f2pCorrelations->SetMarkerStyle(25); | |
2726 | f2pCorrelations->SetLabelSize(0.04); | |
2727 | f2pCorrelations->SetLabelOffset(0.02,"Y"); | |
2728 | f2pCorrelations->SetStats(kFALSE); | |
2729 | f2pCorrelations->Sumw2(); | |
2730 | f2pCorrelations->GetXaxis()->SetBinLabel(1,Form("#LT#LT2#GT#GT_{%dn|%dn}",1*fHarmonic,1*fHarmonic)); | |
2731 | f2pCorrelations->GetXaxis()->SetBinLabel(2,Form("#LT#LT2#GT#GT_{%dn|%dn}",2*fHarmonic,2*fHarmonic)); | |
2732 | f2pCorrelations->GetXaxis()->SetBinLabel(3,Form("#LT#LT2#GT#GT_{%dn|%dn}",3*fHarmonic,3*fHarmonic)); | |
2733 | f2pCorrelations->GetXaxis()->SetBinLabel(4,Form("#LT#LT2#GT#GT_{%dn|%dn}",4*fHarmonic,4*fHarmonic)); | |
2734 | f2pCorrelations->GetXaxis()->SetBinLabel(5,Form("#LT#LT2#GT#GT_{%dn|%dn}",5*fHarmonic,5*fHarmonic)); | |
2735 | f2pCorrelations->GetXaxis()->SetBinLabel(6,Form("#LT#LT2#GT#GT_{%dn|%dn}",6*fHarmonic,6*fHarmonic)); | |
2736 | fMixedHarmonicsProfiles->Add(f2pCorrelations); | |
2737 | // b2) 3-p correlations (3+6): | |
2738 | TString s3pCorrelationsName = "f3pCorrelations"; | |
2739 | s3pCorrelationsName += fAnalysisLabel->Data(); | |
c10259fb | 2740 | f3pCorrelations = new TProfile(s3pCorrelationsName.Data(),Form("3-particle correlations (n = %d)",fHarmonic),10,0,10,"s"); |
e1d101a6 | 2741 | f3pCorrelations->SetTickLength(-0.01,"Y"); |
2742 | f3pCorrelations->SetMarkerStyle(25); | |
2743 | f3pCorrelations->SetLabelSize(0.04); | |
2744 | f3pCorrelations->SetLabelOffset(0.02,"Y"); | |
2745 | f3pCorrelations->SetStats(kFALSE); | |
2746 | f3pCorrelations->Sumw2(); | |
2747 | // 3-p correlations sensitive to two distinct harmonics (3): | |
2748 | f3pCorrelations->GetXaxis()->SetBinLabel(1,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",2*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
2749 | f3pCorrelations->GetXaxis()->SetBinLabel(2,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",4*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
2750 | f3pCorrelations->GetXaxis()->SetBinLabel(3,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",6*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
2751 | f3pCorrelations->GetXaxis()->SetBinLabel(4,""); // empty | |
2752 | // 3-p correlations sensitive to three distinct harmonics (6): | |
2753 | f3pCorrelations->GetXaxis()->SetBinLabel(5,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",3*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
2754 | f3pCorrelations->GetXaxis()->SetBinLabel(6,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",4*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
2755 | f3pCorrelations->GetXaxis()->SetBinLabel(7,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",5*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
2756 | f3pCorrelations->GetXaxis()->SetBinLabel(8,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",5*fHarmonic,4*fHarmonic,1*fHarmonic)); | |
2757 | f3pCorrelations->GetXaxis()->SetBinLabel(9,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",6*fHarmonic,4*fHarmonic,2*fHarmonic)); | |
2758 | f3pCorrelations->GetXaxis()->SetBinLabel(10,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",6*fHarmonic,5*fHarmonic,1*fHarmonic)); | |
2759 | fMixedHarmonicsProfiles->Add(f3pCorrelations); | |
2760 | // b3) 4-p correlations (6+15+2+10+8): | |
2761 | TString s4pCorrelationsName = "f4pCorrelations"; | |
2762 | s4pCorrelationsName += fAnalysisLabel->Data(); | |
c10259fb | 2763 | f4pCorrelations = new TProfile(s4pCorrelationsName.Data(),Form("4-particle correlations (n = %d)",fHarmonic),45,0,45,"s"); |
e1d101a6 | 2764 | f4pCorrelations->SetTickLength(-0.01,"Y"); |
2765 | f4pCorrelations->SetMarkerStyle(25); | |
2766 | f4pCorrelations->SetLabelSize(0.03); | |
2767 | f4pCorrelations->SetLabelOffset(0.02,"Y"); | |
2768 | f4pCorrelations->SetStats(kFALSE); | |
2769 | f4pCorrelations->Sumw2(); | |
2770 | // "same harmonic" (6): | |
2771 | f4pCorrelations->GetXaxis()->SetBinLabel(1,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",1*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
2772 | f4pCorrelations->GetXaxis()->SetBinLabel(2,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",2*fHarmonic,2*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
2773 | f4pCorrelations->GetXaxis()->SetBinLabel(3,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",3*fHarmonic,3*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
2774 | f4pCorrelations->GetXaxis()->SetBinLabel(4,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",4*fHarmonic,4*fHarmonic,4*fHarmonic,4*fHarmonic)); | |
2775 | f4pCorrelations->GetXaxis()->SetBinLabel(5,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,5*fHarmonic,5*fHarmonic,5*fHarmonic)); | |
2776 | f4pCorrelations->GetXaxis()->SetBinLabel(6,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,6*fHarmonic,6*fHarmonic,6*fHarmonic)); | |
2777 | f4pCorrelations->GetXaxis()->SetBinLabel(7,""); // empty | |
2778 | // "standard candles" (15): | |
2779 | f4pCorrelations->GetXaxis()->SetBinLabel(8,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",2*fHarmonic,1*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
2780 | f4pCorrelations->GetXaxis()->SetBinLabel(9,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",3*fHarmonic,1*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
2781 | f4pCorrelations->GetXaxis()->SetBinLabel(10,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",3*fHarmonic,2*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
2782 | f4pCorrelations->GetXaxis()->SetBinLabel(11,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",4*fHarmonic,1*fHarmonic,4*fHarmonic,1*fHarmonic)); | |
2783 | f4pCorrelations->GetXaxis()->SetBinLabel(12,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",4*fHarmonic,2*fHarmonic,4*fHarmonic,2*fHarmonic)); | |
2784 | f4pCorrelations->GetXaxis()->SetBinLabel(13,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",4*fHarmonic,3*fHarmonic,4*fHarmonic,3*fHarmonic)); | |
2785 | f4pCorrelations->GetXaxis()->SetBinLabel(14,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,1*fHarmonic,5*fHarmonic,1*fHarmonic)); | |
2786 | f4pCorrelations->GetXaxis()->SetBinLabel(15,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,2*fHarmonic,5*fHarmonic,2*fHarmonic)); | |
2787 | f4pCorrelations->GetXaxis()->SetBinLabel(16,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,3*fHarmonic,5*fHarmonic,3*fHarmonic)); | |
2788 | f4pCorrelations->GetXaxis()->SetBinLabel(17,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,4*fHarmonic,5*fHarmonic,4*fHarmonic)); | |
2789 | f4pCorrelations->GetXaxis()->SetBinLabel(18,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,1*fHarmonic,6*fHarmonic,1*fHarmonic)); | |
2790 | f4pCorrelations->GetXaxis()->SetBinLabel(19,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,2*fHarmonic,6*fHarmonic,2*fHarmonic)); | |
2791 | f4pCorrelations->GetXaxis()->SetBinLabel(20,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,3*fHarmonic,6*fHarmonic,3*fHarmonic)); | |
2792 | f4pCorrelations->GetXaxis()->SetBinLabel(21,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,4*fHarmonic,6*fHarmonic,4*fHarmonic)); | |
2793 | f4pCorrelations->GetXaxis()->SetBinLabel(22,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,5*fHarmonic,6*fHarmonic,5*fHarmonic)); | |
2794 | f4pCorrelations->GetXaxis()->SetBinLabel(23,""); // empty | |
2795 | // 4-p correlations sensitive to two distinct harmonics (2): | |
2796 | f4pCorrelations->GetXaxis()->SetBinLabel(24,Form("#LT#LT4#GT#GT_{%dn|%dn,%dn,%dn}",3*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
2797 | f4pCorrelations->GetXaxis()->SetBinLabel(25,Form("#LT#LT4#GT#GT_{%dn|%dn,%dn,%dn}",6*fHarmonic,2*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
2798 | f4pCorrelations->GetXaxis()->SetBinLabel(26,""); // empty | |
2799 | // 4-p correlations sensitive to three distinct harmonics (10): | |
2800 | f4pCorrelations->GetXaxis()->SetBinLabel(27,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",3*fHarmonic,1*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
2801 | f4pCorrelations->GetXaxis()->SetBinLabel(28,Form("#LT#LT4#GT#GT_{%dn|%dn,%dn,%dn}",4*fHarmonic,2*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
2802 | f4pCorrelations->GetXaxis()->SetBinLabel(29,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",4*fHarmonic,2*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
2803 | f4pCorrelations->GetXaxis()->SetBinLabel(30,Form("#LT#LT4#GT#GT_{%dn|%dn,%dn,%dn}",5*fHarmonic,2*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
2804 | f4pCorrelations->GetXaxis()->SetBinLabel(31,Form("#LT#LT4#GT#GT_{%dn|%dn,%dn,%dn}",5*fHarmonic,3*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
2805 | f4pCorrelations->GetXaxis()->SetBinLabel(32,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,1*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
2806 | f4pCorrelations->GetXaxis()->SetBinLabel(33,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,3*fHarmonic,4*fHarmonic,4*fHarmonic)); | |
2807 | f4pCorrelations->GetXaxis()->SetBinLabel(34,Form("#LT#LT4#GT#GT_{%dn|%dn,%dn,%dn}",6*fHarmonic,4*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
2808 | f4pCorrelations->GetXaxis()->SetBinLabel(35,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,2*fHarmonic,4*fHarmonic,4*fHarmonic)); | |
2809 | f4pCorrelations->GetXaxis()->SetBinLabel(36,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,4*fHarmonic,5*fHarmonic,5*fHarmonic)); | |
2810 | f4pCorrelations->GetXaxis()->SetBinLabel(37,""); // empty | |
2811 | // 4-p correlations sensitive to four distinct harmonics (8): | |
2812 | f4pCorrelations->GetXaxis()->SetBinLabel(38,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",4*fHarmonic,1*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
2813 | f4pCorrelations->GetXaxis()->SetBinLabel(39,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,1*fHarmonic,4*fHarmonic,2*fHarmonic)); | |
2814 | f4pCorrelations->GetXaxis()->SetBinLabel(40,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,2*fHarmonic,4*fHarmonic,3*fHarmonic)); | |
2815 | f4pCorrelations->GetXaxis()->SetBinLabel(41,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,1*fHarmonic,4*fHarmonic,3*fHarmonic)); | |
2816 | f4pCorrelations->GetXaxis()->SetBinLabel(42,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,1*fHarmonic,5*fHarmonic,2*fHarmonic)); | |
2817 | f4pCorrelations->GetXaxis()->SetBinLabel(43,Form("#LT#LT4#GT#GT_{%dn|%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
2818 | f4pCorrelations->GetXaxis()->SetBinLabel(44,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,2*fHarmonic,5*fHarmonic,3*fHarmonic)); | |
2819 | f4pCorrelations->GetXaxis()->SetBinLabel(45,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,3*fHarmonic,5*fHarmonic,4*fHarmonic)); | |
2820 | fMixedHarmonicsProfiles->Add(f4pCorrelations); | |
2821 | // b3) 5-p correlations (30+9+30+11+3): | |
2822 | TString s5pCorrelationsName = "f5pCorrelations"; | |
2823 | s5pCorrelationsName += fAnalysisLabel->Data(); | |
c10259fb | 2824 | f5pCorrelations = new TProfile(s5pCorrelationsName.Data(),Form("5-particle correlations (n = %d)",fHarmonic),87,0,87,"s"); |
e1d101a6 | 2825 | f5pCorrelations->SetTickLength(-0.01,"Y"); |
2826 | f5pCorrelations->SetMarkerStyle(25); | |
2827 | f5pCorrelations->SetLabelSize(0.02); | |
2828 | f5pCorrelations->SetLabelOffset(0.02,"Y"); | |
2829 | f5pCorrelations->SetStats(kFALSE); | |
2830 | f5pCorrelations->Sumw2(); | |
2831 | // "standard candles" (30): | |
2832 | f5pCorrelations->GetXaxis()->SetBinLabel(1,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",3*fHarmonic,2*fHarmonic,3*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
2833 | f5pCorrelations->GetXaxis()->SetBinLabel(2,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,1*fHarmonic,2*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
2834 | f5pCorrelations->GetXaxis()->SetBinLabel(3,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,2*fHarmonic,3*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
2835 | f5pCorrelations->GetXaxis()->SetBinLabel(4,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,3*fHarmonic,3*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
2836 | f5pCorrelations->GetXaxis()->SetBinLabel(5,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,2*fHarmonic,4*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
2837 | f5pCorrelations->GetXaxis()->SetBinLabel(6,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,3*fHarmonic,4*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
2838 | f5pCorrelations->GetXaxis()->SetBinLabel(7,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,1*fHarmonic,3*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
2839 | f5pCorrelations->GetXaxis()->SetBinLabel(8,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,2*fHarmonic,5*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
2840 | f5pCorrelations->GetXaxis()->SetBinLabel(9,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,2*fHarmonic,4*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
2841 | f5pCorrelations->GetXaxis()->SetBinLabel(10,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,3*fHarmonic,4*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
2842 | f5pCorrelations->GetXaxis()->SetBinLabel(11,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,4*fHarmonic,4*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
2843 | f5pCorrelations->GetXaxis()->SetBinLabel(12,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,3*fHarmonic,5*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
2844 | f5pCorrelations->GetXaxis()->SetBinLabel(13,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,4*fHarmonic,5*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
2845 | f5pCorrelations->GetXaxis()->SetBinLabel(14,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,4*fHarmonic,5*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
2846 | f5pCorrelations->GetXaxis()->SetBinLabel(15,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,1*fHarmonic,3*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
2847 | f5pCorrelations->GetXaxis()->SetBinLabel(16,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,2*fHarmonic,3*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
2848 | f5pCorrelations->GetXaxis()->SetBinLabel(17,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,1*fHarmonic,4*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
2849 | f5pCorrelations->GetXaxis()->SetBinLabel(18,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,4*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
2850 | f5pCorrelations->GetXaxis()->SetBinLabel(19,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,4*fHarmonic,4*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
2851 | f5pCorrelations->GetXaxis()->SetBinLabel(20,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,2*fHarmonic,5*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
2852 | f5pCorrelations->GetXaxis()->SetBinLabel(21,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,5*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
2853 | f5pCorrelations->GetXaxis()->SetBinLabel(22,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,4*fHarmonic,5*fHarmonic,4*fHarmonic,1*fHarmonic)); | |
2854 | f5pCorrelations->GetXaxis()->SetBinLabel(23,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,5*fHarmonic,5*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
2855 | f5pCorrelations->GetXaxis()->SetBinLabel(24,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,2*fHarmonic,6*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
2856 | f5pCorrelations->GetXaxis()->SetBinLabel(25,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,6*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
2857 | f5pCorrelations->GetXaxis()->SetBinLabel(26,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,4*fHarmonic,6*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
2858 | f5pCorrelations->GetXaxis()->SetBinLabel(27,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,4*fHarmonic,6*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
2859 | f5pCorrelations->GetXaxis()->SetBinLabel(28,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,5*fHarmonic,5*fHarmonic,4*fHarmonic,2*fHarmonic)); | |
2860 | f5pCorrelations->GetXaxis()->SetBinLabel(29,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,5*fHarmonic,6*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
2861 | f5pCorrelations->GetXaxis()->SetBinLabel(30,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,5*fHarmonic,6*fHarmonic,4*fHarmonic,1*fHarmonic)); | |
c10259fb | 2862 | f5pCorrelations->GetXaxis()->SetBinLabel(31,""); // empty |
e1d101a6 | 2863 | // 5-p correlations sensitive to two distinct harmonics (9): |
2864 | f5pCorrelations->GetXaxis()->SetBinLabel(32,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",2*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
2865 | f5pCorrelations->GetXaxis()->SetBinLabel(33,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",2*fHarmonic,2*fHarmonic,2*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
2866 | f5pCorrelations->GetXaxis()->SetBinLabel(34,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",3*fHarmonic,3*fHarmonic,2*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
2867 | f5pCorrelations->GetXaxis()->SetBinLabel(35,Form("#LT#LT5#GT#GT_{%dn|%dn,%dn,%dn,%dn}",4*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
2868 | f5pCorrelations->GetXaxis()->SetBinLabel(36,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,2*fHarmonic,2*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
2869 | f5pCorrelations->GetXaxis()->SetBinLabel(37,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,4*fHarmonic,4*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
2870 | f5pCorrelations->GetXaxis()->SetBinLabel(38,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,3*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
2871 | f5pCorrelations->GetXaxis()->SetBinLabel(39,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,6*fHarmonic,4*fHarmonic,4*fHarmonic,4*fHarmonic)); | |
2872 | f5pCorrelations->GetXaxis()->SetBinLabel(40,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,6*fHarmonic,6*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
c10259fb | 2873 | f5pCorrelations->GetXaxis()->SetBinLabel(41,""); // empty |
e1d101a6 | 2874 | // 5-p correlations sensitive to three distinct harmonics (30): |
2875 | f5pCorrelations->GetXaxis()->SetBinLabel(42,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",3*fHarmonic,1*fHarmonic,2*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
2876 | f5pCorrelations->GetXaxis()->SetBinLabel(43,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",3*fHarmonic,2*fHarmonic,2*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
2877 | f5pCorrelations->GetXaxis()->SetBinLabel(44,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",3*fHarmonic,3*fHarmonic,3*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
2878 | f5pCorrelations->GetXaxis()->SetBinLabel(45,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,1*fHarmonic,3*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
2879 | f5pCorrelations->GetXaxis()->SetBinLabel(46,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",4*fHarmonic,1*fHarmonic,1*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
2880 | f5pCorrelations->GetXaxis()->SetBinLabel(47,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,3*fHarmonic,3*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
2881 | f5pCorrelations->GetXaxis()->SetBinLabel(48,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,4*fHarmonic,3*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
2882 | f5pCorrelations->GetXaxis()->SetBinLabel(49,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,4*fHarmonic,4*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
2883 | f5pCorrelations->GetXaxis()->SetBinLabel(50,Form("#LT#LT5#GT#GT_{%dn|%dn,%dn,%dn,%dn}",5*fHarmonic,2*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
2884 | f5pCorrelations->GetXaxis()->SetBinLabel(51,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,1*fHarmonic,2*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
2885 | f5pCorrelations->GetXaxis()->SetBinLabel(52,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,2*fHarmonic,3*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
2886 | f5pCorrelations->GetXaxis()->SetBinLabel(53,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,3*fHarmonic,3*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
2887 | f5pCorrelations->GetXaxis()->SetBinLabel(54,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,1*fHarmonic,4*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
2888 | f5pCorrelations->GetXaxis()->SetBinLabel(55,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,4*fHarmonic,3*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
2889 | f5pCorrelations->GetXaxis()->SetBinLabel(56,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,4*fHarmonic,4*fHarmonic,4*fHarmonic,1*fHarmonic)); | |
2890 | f5pCorrelations->GetXaxis()->SetBinLabel(57,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,5*fHarmonic,4*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
2891 | f5pCorrelations->GetXaxis()->SetBinLabel(58,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,5*fHarmonic,4*fHarmonic,4*fHarmonic,2*fHarmonic)); | |
2892 | f5pCorrelations->GetXaxis()->SetBinLabel(59,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,5*fHarmonic,5*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
2893 | f5pCorrelations->GetXaxis()->SetBinLabel(60,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,5*fHarmonic,5*fHarmonic,4*fHarmonic,1*fHarmonic)); | |
2894 | f5pCorrelations->GetXaxis()->SetBinLabel(61,Form("#LT#LT5#GT#GT_{%dn|%dn,%dn,%dn,%dn}",6*fHarmonic,2*fHarmonic,2*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
2895 | f5pCorrelations->GetXaxis()->SetBinLabel(62,Form("#LT#LT5#GT#GT_{%dn|%dn,%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
2896 | f5pCorrelations->GetXaxis()->SetBinLabel(63,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",6*fHarmonic,1*fHarmonic,1*fHarmonic,4*fHarmonic,4*fHarmonic)); | |
2897 | f5pCorrelations->GetXaxis()->SetBinLabel(64,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,1*fHarmonic,5*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
2898 | f5pCorrelations->GetXaxis()->SetBinLabel(65,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,2*fHarmonic,4*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
2899 | f5pCorrelations->GetXaxis()->SetBinLabel(66,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,4*fHarmonic,4*fHarmonic,4*fHarmonic,2*fHarmonic)); | |
2900 | f5pCorrelations->GetXaxis()->SetBinLabel(67,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",6*fHarmonic,2*fHarmonic,2*fHarmonic,5*fHarmonic,5*fHarmonic)); | |
2901 | f5pCorrelations->GetXaxis()->SetBinLabel(68,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,5*fHarmonic,5*fHarmonic,5*fHarmonic,1*fHarmonic)); | |
2902 | f5pCorrelations->GetXaxis()->SetBinLabel(69,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,6*fHarmonic,5*fHarmonic,5*fHarmonic,2*fHarmonic)); | |
2903 | f5pCorrelations->GetXaxis()->SetBinLabel(70,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,6*fHarmonic,6*fHarmonic,4*fHarmonic,2*fHarmonic)); | |
2904 | f5pCorrelations->GetXaxis()->SetBinLabel(71,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,6*fHarmonic,6*fHarmonic,5*fHarmonic,1*fHarmonic)); | |
c10259fb | 2905 | f5pCorrelations->GetXaxis()->SetBinLabel(72,""); // empty |
e1d101a6 | 2906 | // 5-p correlations sensitive to four distinct harmonics (11): |
2907 | f5pCorrelations->GetXaxis()->SetBinLabel(73,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,2*fHarmonic,3*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
2908 | f5pCorrelations->GetXaxis()->SetBinLabel(74,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",5*fHarmonic,1*fHarmonic,1*fHarmonic,4*fHarmonic,3*fHarmonic)); | |
2909 | f5pCorrelations->GetXaxis()->SetBinLabel(75,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,3*fHarmonic,4*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
2910 | f5pCorrelations->GetXaxis()->SetBinLabel(76,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",5*fHarmonic,2*fHarmonic,1*fHarmonic,4*fHarmonic,4*fHarmonic)); | |
2911 | f5pCorrelations->GetXaxis()->SetBinLabel(77,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,1*fHarmonic,3*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
2912 | f5pCorrelations->GetXaxis()->SetBinLabel(78,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,4*fHarmonic,4*fHarmonic,1*fHarmonic)); | |
2913 | f5pCorrelations->GetXaxis()->SetBinLabel(79,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",6*fHarmonic,1*fHarmonic,1*fHarmonic,5*fHarmonic,3*fHarmonic)); | |
2914 | f5pCorrelations->GetXaxis()->SetBinLabel(80,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,5*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
2915 | f5pCorrelations->GetXaxis()->SetBinLabel(81,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,5*fHarmonic,4*fHarmonic,4*fHarmonic,3*fHarmonic)); | |
2916 | f5pCorrelations->GetXaxis()->SetBinLabel(82,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",6*fHarmonic,3*fHarmonic,1*fHarmonic,5*fHarmonic,5*fHarmonic)); | |
2917 | f5pCorrelations->GetXaxis()->SetBinLabel(83,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,6*fHarmonic,5*fHarmonic,4*fHarmonic,3*fHarmonic)); | |
c10259fb | 2918 | f5pCorrelations->GetXaxis()->SetBinLabel(84,""); // empty |
e1d101a6 | 2919 | // 5-p correlations sensitive to five distinct harmonics (3): |
2920 | f5pCorrelations->GetXaxis()->SetBinLabel(85,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,2*fHarmonic,4*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
2921 | f5pCorrelations->GetXaxis()->SetBinLabel(86,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",6*fHarmonic,2*fHarmonic,1*fHarmonic,5*fHarmonic,4*fHarmonic)); | |
2922 | f5pCorrelations->GetXaxis()->SetBinLabel(87,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,4*fHarmonic,5*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
2923 | fMixedHarmonicsProfiles->Add(f5pCorrelations); | |
2924 | // b4) 6-p correlations (??+??+??+??+??): | |
2925 | TString s6pCorrelationsName = "f6pCorrelations"; | |
2926 | s6pCorrelationsName += fAnalysisLabel->Data(); | |
2927 | f6pCorrelations = new TProfile(s6pCorrelationsName.Data(),Form("6-particle correlations (n = %d)",fHarmonic),1,0.,1.); | |
2928 | f6pCorrelations->SetTickLength(-0.01,"Y"); | |
2929 | f6pCorrelations->SetMarkerStyle(25); | |
2930 | f6pCorrelations->SetLabelSize(0.02); | |
2931 | f6pCorrelations->SetLabelOffset(0.02,"Y"); | |
2932 | f6pCorrelations->SetStats(kFALSE); | |
2933 | f6pCorrelations->Sumw2(); | |
2934 | //fMixedHarmonicsProfiles->Add(f6pCorrelations); // TBI | |
2935 | // b5) 7-p correlations (??+??+??+??+??): | |
2936 | TString s7pCorrelationsName = "f7pCorrelations"; | |
2937 | s7pCorrelationsName += fAnalysisLabel->Data(); | |
2938 | f7pCorrelations = new TProfile(s7pCorrelationsName.Data(),Form("7-particle correlations (n = %d)",fHarmonic),1,0.,1.); | |
2939 | f7pCorrelations->SetTickLength(-0.01,"Y"); | |
2940 | f7pCorrelations->SetMarkerStyle(25); | |
2941 | f7pCorrelations->SetLabelSize(0.02); | |
2942 | f7pCorrelations->SetLabelOffset(0.02,"Y"); | |
2943 | f7pCorrelations->SetStats(kFALSE); | |
2944 | f7pCorrelations->Sumw2(); | |
2945 | //fMixedHarmonicsProfiles->Add(f7pCorrelations); // TBI | |
2946 | // b6) 8-p correlations (??+??+??+??+??): | |
2947 | TString s8pCorrelationsName = "f8pCorrelations"; | |
2948 | s8pCorrelationsName += fAnalysisLabel->Data(); | |
2949 | f8pCorrelations = new TProfile(s8pCorrelationsName.Data(),Form("8-particle correlations (n = %d)",fHarmonic),1,0.,1.); | |
2950 | f8pCorrelations->SetTickLength(-0.01,"Y"); | |
2951 | f8pCorrelations->SetMarkerStyle(25); | |
2952 | f8pCorrelations->SetLabelSize(0.02); | |
2953 | f8pCorrelations->SetLabelOffset(0.02,"Y"); | |
2954 | f8pCorrelations->SetStats(kFALSE); | |
2955 | f8pCorrelations->Sumw2(); | |
2956 | //fMixedHarmonicsProfiles->Add(f8pCorrelations); // TBI | |
2957 | ||
2958 | // c) Book all objects in TList fMixedHarmonicsResults: | |
2959 | // QC{2}: | |
2960 | f2pCumulants = f2pCorrelations->ProjectionX("f2pCumulants"); | |
2961 | f2pCumulants->SetTitle(Form("2-particle cumulants (n = %d)",fHarmonic)); | |
2962 | f2pCumulants->SetStats(kFALSE); | |
2963 | f2pCumulants->SetMarkerStyle(kFullSquare); | |
2964 | f2pCumulants->SetMarkerColor(kBlack); | |
2965 | f2pCumulants->SetLineColor(kBlack); | |
2966 | fMixedHarmonicsResults->Add(f2pCumulants); | |
2967 | // QC{3}: | |
2968 | f3pCumulants = f3pCorrelations->ProjectionX("f3pCumulants"); | |
2969 | f3pCumulants->SetTitle(Form("3-particle cumulants (n = %d)",fHarmonic)); | |
2970 | f3pCumulants->SetStats(kFALSE); | |
2971 | f3pCumulants->SetMarkerStyle(kFullSquare); | |
2972 | f3pCumulants->SetMarkerColor(kGreen+2); | |
2973 | f3pCumulants->SetLineColor(kGreen+2); | |
2974 | fMixedHarmonicsResults->Add(f3pCumulants); | |
2975 | // QC{4}: | |
2976 | f4pCumulants = f4pCorrelations->ProjectionX("f4pCumulants"); | |
2977 | f4pCumulants->SetTitle(Form("4-particle cumulants (n = %d)",fHarmonic)); | |
2978 | f4pCumulants->SetStats(kFALSE); | |
2979 | f4pCumulants->SetMarkerStyle(kFullSquare); | |
2980 | f4pCumulants->SetMarkerColor(kRed); | |
2981 | f4pCumulants->SetLineColor(kRed); | |
2982 | fMixedHarmonicsResults->Add(f4pCumulants); | |
2983 | // QC{5}: | |
2984 | f5pCumulants = f5pCorrelations->ProjectionX("f5pCumulants"); | |
2985 | f5pCumulants->SetTitle(Form("5-particle cumulants (n = %d)",fHarmonic)); | |
2986 | f5pCumulants->SetStats(kFALSE); | |
2987 | f5pCumulants->SetMarkerStyle(kFullSquare); | |
2988 | f5pCumulants->SetMarkerColor(kBlue); | |
2989 | f5pCumulants->SetLineColor(kBlue); | |
2990 | fMixedHarmonicsResults->Add(f5pCumulants); | |
2991 | ||
c10259fb | 2992 | // d) Book all objects in TList fMixedHarmonicsErrorPropagation: |
2993 | // Sum of linear and quadratic event weights for mixed harmonics => [0=linear 1,1=quadratic]: | |
2994 | TString mixedHarmonicEventWeightsName = "fMixedHarmonicEventWeights"; | |
2995 | mixedHarmonicEventWeightsName += fAnalysisLabel->Data(); | |
2996 | TString powerFlag[2] = {"linear","quadratic"}; | |
2997 | for(Int_t power=0;power<2;power++) | |
2998 | { | |
2999 | fMixedHarmonicEventWeights[power] = new TH1D(Form("%s: %s",mixedHarmonicEventWeightsName.Data(),powerFlag[power].Data()),Form("Sum of %s event weights for correlations",powerFlag[power].Data()),8,0.,8.); | |
3000 | fMixedHarmonicEventWeights[power]->SetLabelSize(0.04); | |
3001 | fMixedHarmonicEventWeights[power]->SetMarkerStyle(25); | |
3002 | fMixedHarmonicEventWeights[power]->SetStats(kFALSE); | |
3003 | if(power == 0) | |
3004 | { | |
3005 | (fMixedHarmonicEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum w_{#LT1#GT}"); | |
3006 | (fMixedHarmonicEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum w_{#LT2#GT}"); | |
3007 | (fMixedHarmonicEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum w_{#LT3#GT}"); | |
3008 | (fMixedHarmonicEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum w_{#LT4#GT}"); | |
3009 | (fMixedHarmonicEventWeights[power]->GetXaxis())->SetBinLabel(5,"#sum w_{#LT5#GT}"); | |
3010 | (fMixedHarmonicEventWeights[power]->GetXaxis())->SetBinLabel(6,"#sum w_{#LT6#GT}"); | |
3011 | (fMixedHarmonicEventWeights[power]->GetXaxis())->SetBinLabel(7,"#sum w_{#LT7#GT}"); | |
3012 | (fMixedHarmonicEventWeights[power]->GetXaxis())->SetBinLabel(8,"#sum w_{#LT8#GT}"); | |
3013 | } else if (power == 1) | |
3014 | { | |
3015 | (fMixedHarmonicEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum w_{#LT1#GT}^{2}"); | |
3016 | (fMixedHarmonicEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum w_{#LT2#GT}^{2}"); | |
3017 | (fMixedHarmonicEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum w_{#LT3#GT}^{2}"); | |
3018 | (fMixedHarmonicEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum w_{#LT4#GT}^{2}"); | |
3019 | (fMixedHarmonicEventWeights[power]->GetXaxis())->SetBinLabel(5,"#sum w_{#LT5#GT}^{2}"); | |
3020 | (fMixedHarmonicEventWeights[power]->GetXaxis())->SetBinLabel(6,"#sum w_{#LT6#GT}^{2}"); | |
3021 | (fMixedHarmonicEventWeights[power]->GetXaxis())->SetBinLabel(7,"#sum w_{#LT7#GT}^{2}"); | |
3022 | (fMixedHarmonicEventWeights[power]->GetXaxis())->SetBinLabel(8,"#sum w_{#LT8#GT}^{2}"); | |
3023 | } | |
3024 | fMixedHarmonicsErrorPropagation->Add(fMixedHarmonicEventWeights[power]); | |
3025 | } // end of for(Int_t power=0;power<2;power++) | |
3026 | ||
3027 | // Sums of products of event weights for mixed harmonics: | |
3028 | TString mixedHarmonicProductOfEventWeightsName = "fMixedHarmonicProductOfEventWeights"; | |
3029 | mixedHarmonicProductOfEventWeightsName += fAnalysisLabel->Data(); | |
3030 | fMixedHarmonicProductOfEventWeights = new TH2D(mixedHarmonicProductOfEventWeightsName.Data(),"Sums of products of event weights",8,0.,8.,8,0.,8.); | |
3031 | fMixedHarmonicProductOfEventWeights->SetStats(kFALSE); | |
3032 | fMixedHarmonicProductOfEventWeights->GetXaxis()->SetLabelSize(0.05); | |
3033 | fMixedHarmonicProductOfEventWeights->GetYaxis()->SetLabelSize(0.05); | |
3034 | for(Int_t b=1;b<=8;b++) | |
3035 | { | |
3036 | fMixedHarmonicProductOfEventWeights->GetXaxis()->SetBinLabel(b,Form("w_{#LT%i#GT}",b)); | |
3037 | fMixedHarmonicProductOfEventWeights->GetYaxis()->SetBinLabel(b,Form("w_{#LT%i#GT}",b)); | |
3038 | } | |
3039 | fMixedHarmonicsErrorPropagation->Add(fMixedHarmonicProductOfEventWeights); | |
3040 | ||
3041 | // Averages of products of mixed harmonics correlations: | |
3042 | TString mixedHarmonicProductOfCorrelationsName = "fMixedHarmonicProductOfCorrelations"; | |
3043 | mixedHarmonicProductOfCorrelationsName += fAnalysisLabel->Data(); | |
3044 | fMixedHarmonicProductOfCorrelations = new TProfile2D(mixedHarmonicProductOfCorrelationsName.Data(),"Averages of products of mixed correlators",139,0.,139.,139,0.,139.); | |
3045 | fMixedHarmonicProductOfCorrelations->Sumw2(); | |
3046 | fMixedHarmonicProductOfCorrelations->SetStats(kFALSE); | |
3047 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetLabelSize(0.015); | |
3048 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetLabelSize(0.015); | |
3049 | // x-axis: | |
3050 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(1,Form("#LT#LT2#GT#GT_{%dn|%dn}",1*fHarmonic,1*fHarmonic)); | |
3051 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(2,Form("#LT#LT2#GT#GT_{%dn|%dn}",2*fHarmonic,2*fHarmonic)); | |
3052 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(3,Form("#LT#LT2#GT#GT_{%dn|%dn}",3*fHarmonic,3*fHarmonic)); | |
3053 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(4,Form("#LT#LT2#GT#GT_{%dn|%dn}",4*fHarmonic,4*fHarmonic)); | |
3054 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(5,Form("#LT#LT2#GT#GT_{%dn|%dn}",5*fHarmonic,5*fHarmonic)); | |
3055 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(6,Form("#LT#LT2#GT#GT_{%dn|%dn}",6*fHarmonic,6*fHarmonic)); | |
3056 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(7,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",2*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3057 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(8,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",4*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3058 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(9,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",6*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3059 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(10,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",3*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3060 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(11,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",4*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3061 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(12,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",5*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3062 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(13,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",5*fHarmonic,4*fHarmonic,1*fHarmonic)); | |
3063 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(14,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",6*fHarmonic,4*fHarmonic,2*fHarmonic)); | |
3064 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(15,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",6*fHarmonic,5*fHarmonic,1*fHarmonic)); | |
3065 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(16,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",1*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3066 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(17,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",2*fHarmonic,2*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3067 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(18,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",3*fHarmonic,3*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3068 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(19,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",4*fHarmonic,4*fHarmonic,4*fHarmonic,4*fHarmonic)); | |
3069 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(20,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,5*fHarmonic,5*fHarmonic,5*fHarmonic)); | |
3070 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(21,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,6*fHarmonic,6*fHarmonic,6*fHarmonic)); | |
3071 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(22,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",2*fHarmonic,1*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3072 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(23,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",3*fHarmonic,1*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3073 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(24,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",3*fHarmonic,2*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3074 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(25,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",4*fHarmonic,1*fHarmonic,4*fHarmonic,1*fHarmonic)); | |
3075 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(26,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",4*fHarmonic,2*fHarmonic,4*fHarmonic,2*fHarmonic)); | |
3076 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(27,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",4*fHarmonic,3*fHarmonic,4*fHarmonic,3*fHarmonic)); | |
3077 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(28,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,1*fHarmonic,5*fHarmonic,1*fHarmonic)); | |
3078 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(29,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,2*fHarmonic,5*fHarmonic,2*fHarmonic)); | |
3079 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(30,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,3*fHarmonic,5*fHarmonic,3*fHarmonic)); | |
3080 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(31,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,4*fHarmonic,5*fHarmonic,4*fHarmonic)); | |
3081 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(32,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,1*fHarmonic,6*fHarmonic,1*fHarmonic)); | |
3082 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(33,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,2*fHarmonic,6*fHarmonic,2*fHarmonic)); | |
3083 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(34,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,3*fHarmonic,6*fHarmonic,3*fHarmonic)); | |
3084 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(35,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,4*fHarmonic,6*fHarmonic,4*fHarmonic)); | |
3085 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(36,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,5*fHarmonic,6*fHarmonic,5*fHarmonic)); | |
3086 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(37,Form("#LT#LT4#GT#GT_{%dn|%dn,%dn,%dn}",3*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3087 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(38,Form("#LT#LT4#GT#GT_{%dn|%dn,%dn,%dn}",6*fHarmonic,2*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3088 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(39,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",3*fHarmonic,1*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3089 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(40,Form("#LT#LT4#GT#GT_{%dn|%dn,%dn,%dn}",4*fHarmonic,2*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3090 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(41,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",4*fHarmonic,2*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3091 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(42,Form("#LT#LT4#GT#GT_{%dn|%dn,%dn,%dn}",5*fHarmonic,2*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3092 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(43,Form("#LT#LT4#GT#GT_{%dn|%dn,%dn,%dn}",5*fHarmonic,3*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3093 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(44,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,1*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3094 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(45,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,3*fHarmonic,4*fHarmonic,4*fHarmonic)); | |
3095 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(46,Form("#LT#LT4#GT#GT_{%dn|%dn,%dn,%dn}",6*fHarmonic,4*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3096 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(47,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,2*fHarmonic,4*fHarmonic,4*fHarmonic)); | |
3097 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(48,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,4*fHarmonic,5*fHarmonic,5*fHarmonic)); | |
3098 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(49,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",4*fHarmonic,1*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3099 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(50,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,1*fHarmonic,4*fHarmonic,2*fHarmonic)); | |
3100 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(51,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,2*fHarmonic,4*fHarmonic,3*fHarmonic)); | |
3101 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(52,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,1*fHarmonic,4*fHarmonic,3*fHarmonic)); | |
3102 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(53,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,1*fHarmonic,5*fHarmonic,2*fHarmonic)); | |
3103 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(54,Form("#LT#LT4#GT#GT_{%dn|%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3104 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(55,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,2*fHarmonic,5*fHarmonic,3*fHarmonic)); | |
3105 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(56,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,3*fHarmonic,5*fHarmonic,4*fHarmonic)); | |
3106 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(57,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",3*fHarmonic,2*fHarmonic,3*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3107 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(58,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,1*fHarmonic,2*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3108 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(59,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,2*fHarmonic,3*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3109 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(60,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,3*fHarmonic,3*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3110 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(61,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,2*fHarmonic,4*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3111 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(62,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,3*fHarmonic,4*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3112 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(63,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,1*fHarmonic,3*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3113 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(64,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,2*fHarmonic,5*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3114 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(65,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,2*fHarmonic,4*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3115 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(66,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,3*fHarmonic,4*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3116 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(67,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,4*fHarmonic,4*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3117 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(68,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,3*fHarmonic,5*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3118 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(69,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,4*fHarmonic,5*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3119 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(70,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,4*fHarmonic,5*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3120 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(71,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,1*fHarmonic,3*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3121 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(72,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,2*fHarmonic,3*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3122 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(73,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,1*fHarmonic,4*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3123 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(74,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,4*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3124 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(75,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,4*fHarmonic,4*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3125 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(76,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,2*fHarmonic,5*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3126 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(77,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,5*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3127 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(78,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,4*fHarmonic,5*fHarmonic,4*fHarmonic,1*fHarmonic)); | |
3128 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(79,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,5*fHarmonic,5*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3129 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(80,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,2*fHarmonic,6*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3130 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(81,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,6*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3131 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(82,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,4*fHarmonic,6*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3132 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(83,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,4*fHarmonic,6*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3133 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(84,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,5*fHarmonic,5*fHarmonic,4*fHarmonic,2*fHarmonic)); | |
3134 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(85,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,5*fHarmonic,6*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3135 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(86,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,5*fHarmonic,6*fHarmonic,4*fHarmonic,1*fHarmonic)); | |
3136 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(87,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",2*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3137 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(88,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",2*fHarmonic,2*fHarmonic,2*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3138 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(89,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",3*fHarmonic,3*fHarmonic,2*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3139 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(90,Form("#LT#LT5#GT#GT_{%dn|%dn,%dn,%dn,%dn}",4*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3140 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(91,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,2*fHarmonic,2*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3141 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(92,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,4*fHarmonic,4*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3142 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(93,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,3*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3143 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(94,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,6*fHarmonic,4*fHarmonic,4*fHarmonic,4*fHarmonic)); | |
3144 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(95,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,6*fHarmonic,6*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3145 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(96,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",3*fHarmonic,1*fHarmonic,2*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3146 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(97,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",3*fHarmonic,2*fHarmonic,2*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3147 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(98,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",3*fHarmonic,3*fHarmonic,3*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3148 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(99,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,1*fHarmonic,3*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3149 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(100,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",4*fHarmonic,1*fHarmonic,1*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3150 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(101,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,3*fHarmonic,3*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3151 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(102,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,4*fHarmonic,3*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3152 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(103,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,4*fHarmonic,4*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3153 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(104,Form("#LT#LT5#GT#GT_{%dn|%dn,%dn,%dn,%dn}",5*fHarmonic,2*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3154 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(105,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,1*fHarmonic,2*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3155 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(106,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,2*fHarmonic,3*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3156 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(107,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,3*fHarmonic,3*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3157 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(108,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,1*fHarmonic,4*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3158 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(109,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,4*fHarmonic,3*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3159 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(110,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,4*fHarmonic,4*fHarmonic,4*fHarmonic,1*fHarmonic)); | |
3160 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(111,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,5*fHarmonic,4*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3161 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(112,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,5*fHarmonic,4*fHarmonic,4*fHarmonic,2*fHarmonic)); | |
3162 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(113,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,5*fHarmonic,5*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3163 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(114,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,5*fHarmonic,5*fHarmonic,4*fHarmonic,1*fHarmonic)); | |
3164 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(115,Form("#LT#LT5#GT#GT_{%dn|%dn,%dn,%dn,%dn}",6*fHarmonic,2*fHarmonic,2*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3165 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(116,Form("#LT#LT5#GT#GT_{%dn|%dn,%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3166 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(117,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",6*fHarmonic,1*fHarmonic,1*fHarmonic,4*fHarmonic,4*fHarmonic)); | |
3167 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(118,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,1*fHarmonic,5*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3168 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(119,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,2*fHarmonic,4*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3169 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(120,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,4*fHarmonic,4*fHarmonic,4*fHarmonic,2*fHarmonic)); | |
3170 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(121,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",6*fHarmonic,2*fHarmonic,2*fHarmonic,5*fHarmonic,5*fHarmonic)); | |
3171 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(122,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,5*fHarmonic,5*fHarmonic,5*fHarmonic,1*fHarmonic)); | |
3172 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(123,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,6*fHarmonic,5*fHarmonic,5*fHarmonic,2*fHarmonic)); | |
3173 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(124,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,6*fHarmonic,6*fHarmonic,4*fHarmonic,2*fHarmonic)); | |
3174 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(125,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,6*fHarmonic,6*fHarmonic,5*fHarmonic,1*fHarmonic)); | |
3175 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(126,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,2*fHarmonic,3*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3176 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(127,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",5*fHarmonic,1*fHarmonic,1*fHarmonic,4*fHarmonic,3*fHarmonic)); | |
3177 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(128,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,3*fHarmonic,4*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3178 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(129,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",5*fHarmonic,2*fHarmonic,1*fHarmonic,4*fHarmonic,4*fHarmonic)); | |
3179 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(130,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,1*fHarmonic,3*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3180 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(131,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,4*fHarmonic,4*fHarmonic,1*fHarmonic)); | |
3181 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(132,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",6*fHarmonic,1*fHarmonic,1*fHarmonic,5*fHarmonic,3*fHarmonic)); | |
3182 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(133,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,5*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3183 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(134,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,5*fHarmonic,4*fHarmonic,4*fHarmonic,3*fHarmonic)); | |
3184 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(135,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",6*fHarmonic,3*fHarmonic,1*fHarmonic,5*fHarmonic,5*fHarmonic)); | |
3185 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(136,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,6*fHarmonic,5*fHarmonic,4*fHarmonic,3*fHarmonic)); | |
3186 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(137,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,2*fHarmonic,4*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3187 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(138,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",6*fHarmonic,2*fHarmonic,1*fHarmonic,5*fHarmonic,4*fHarmonic)); | |
3188 | fMixedHarmonicProductOfCorrelations->GetXaxis()->SetBinLabel(139,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,4*fHarmonic,5*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3189 | // y-axis: | |
3190 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(1,Form("#LT#LT2#GT#GT_{%dn|%dn}",1*fHarmonic,1*fHarmonic)); | |
3191 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(2,Form("#LT#LT2#GT#GT_{%dn|%dn}",2*fHarmonic,2*fHarmonic)); | |
3192 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(3,Form("#LT#LT2#GT#GT_{%dn|%dn}",3*fHarmonic,3*fHarmonic)); | |
3193 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(4,Form("#LT#LT2#GT#GT_{%dn|%dn}",4*fHarmonic,4*fHarmonic)); | |
3194 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(5,Form("#LT#LT2#GT#GT_{%dn|%dn}",5*fHarmonic,5*fHarmonic)); | |
3195 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(6,Form("#LT#LT2#GT#GT_{%dn|%dn}",6*fHarmonic,6*fHarmonic)); | |
3196 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(7,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",2*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3197 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(8,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",4*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3198 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(9,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",6*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3199 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(10,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",3*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3200 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(11,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",4*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3201 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(12,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",5*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3202 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(13,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",5*fHarmonic,4*fHarmonic,1*fHarmonic)); | |
3203 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(14,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",6*fHarmonic,4*fHarmonic,2*fHarmonic)); | |
3204 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(15,Form("#LT#LT3#GT#GT_{%dn|%dn,%dn}",6*fHarmonic,5*fHarmonic,1*fHarmonic)); | |
3205 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(16,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",1*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3206 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(17,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",2*fHarmonic,2*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3207 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(18,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",3*fHarmonic,3*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3208 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(19,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",4*fHarmonic,4*fHarmonic,4*fHarmonic,4*fHarmonic)); | |
3209 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(20,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,5*fHarmonic,5*fHarmonic,5*fHarmonic)); | |
3210 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(21,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,6*fHarmonic,6*fHarmonic,6*fHarmonic)); | |
3211 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(22,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",2*fHarmonic,1*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3212 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(23,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",3*fHarmonic,1*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3213 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(24,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",3*fHarmonic,2*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3214 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(25,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",4*fHarmonic,1*fHarmonic,4*fHarmonic,1*fHarmonic)); | |
3215 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(26,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",4*fHarmonic,2*fHarmonic,4*fHarmonic,2*fHarmonic)); | |
3216 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(27,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",4*fHarmonic,3*fHarmonic,4*fHarmonic,3*fHarmonic)); | |
3217 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(28,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,1*fHarmonic,5*fHarmonic,1*fHarmonic)); | |
3218 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(29,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,2*fHarmonic,5*fHarmonic,2*fHarmonic)); | |
3219 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(30,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,3*fHarmonic,5*fHarmonic,3*fHarmonic)); | |
3220 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(31,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,4*fHarmonic,5*fHarmonic,4*fHarmonic)); | |
3221 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(32,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,1*fHarmonic,6*fHarmonic,1*fHarmonic)); | |
3222 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(33,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,2*fHarmonic,6*fHarmonic,2*fHarmonic)); | |
3223 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(34,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,3*fHarmonic,6*fHarmonic,3*fHarmonic)); | |
3224 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(35,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,4*fHarmonic,6*fHarmonic,4*fHarmonic)); | |
3225 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(36,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,5*fHarmonic,6*fHarmonic,5*fHarmonic)); | |
3226 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(37,Form("#LT#LT4#GT#GT_{%dn|%dn,%dn,%dn}",3*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3227 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(38,Form("#LT#LT4#GT#GT_{%dn|%dn,%dn,%dn}",6*fHarmonic,2*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3228 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(39,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",3*fHarmonic,1*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3229 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(40,Form("#LT#LT4#GT#GT_{%dn|%dn,%dn,%dn}",4*fHarmonic,2*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3230 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(41,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",4*fHarmonic,2*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3231 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(42,Form("#LT#LT4#GT#GT_{%dn|%dn,%dn,%dn}",5*fHarmonic,2*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3232 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(43,Form("#LT#LT4#GT#GT_{%dn|%dn,%dn,%dn}",5*fHarmonic,3*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3233 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(44,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,1*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3234 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(45,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,3*fHarmonic,4*fHarmonic,4*fHarmonic)); | |
3235 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(46,Form("#LT#LT4#GT#GT_{%dn|%dn,%dn,%dn}",6*fHarmonic,4*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3236 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(47,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,2*fHarmonic,4*fHarmonic,4*fHarmonic)); | |
3237 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(48,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,4*fHarmonic,5*fHarmonic,5*fHarmonic)); | |
3238 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(49,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",4*fHarmonic,1*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3239 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(50,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,1*fHarmonic,4*fHarmonic,2*fHarmonic)); | |
3240 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(51,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",5*fHarmonic,2*fHarmonic,4*fHarmonic,3*fHarmonic)); | |
3241 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(52,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,1*fHarmonic,4*fHarmonic,3*fHarmonic)); | |
3242 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(53,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,1*fHarmonic,5*fHarmonic,2*fHarmonic)); | |
3243 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(54,Form("#LT#LT4#GT#GT_{%dn|%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3244 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(55,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,2*fHarmonic,5*fHarmonic,3*fHarmonic)); | |
3245 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(56,Form("#LT#LT4#GT#GT_{%dn,%dn|%dn,%dn}",6*fHarmonic,3*fHarmonic,5*fHarmonic,4*fHarmonic)); | |
3246 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(57,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",3*fHarmonic,2*fHarmonic,3*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3247 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(58,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,1*fHarmonic,2*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3248 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(59,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,2*fHarmonic,3*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3249 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(60,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,3*fHarmonic,3*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3250 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(61,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,2*fHarmonic,4*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3251 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(62,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,3*fHarmonic,4*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3252 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(63,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,1*fHarmonic,3*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3253 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(64,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,2*fHarmonic,5*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3254 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(65,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,2*fHarmonic,4*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3255 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(66,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,3*fHarmonic,4*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3256 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(67,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,4*fHarmonic,4*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3257 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(68,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,3*fHarmonic,5*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3258 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(69,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,4*fHarmonic,5*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3259 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(70,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,4*fHarmonic,5*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3260 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(71,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,1*fHarmonic,3*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3261 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(72,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,2*fHarmonic,3*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3262 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(73,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,1*fHarmonic,4*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3263 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(74,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,4*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3264 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(75,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,4*fHarmonic,4*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3265 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(76,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,2*fHarmonic,5*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3266 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(77,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,5*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3267 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(78,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,4*fHarmonic,5*fHarmonic,4*fHarmonic,1*fHarmonic)); | |
3268 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(79,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,5*fHarmonic,5*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3269 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(80,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,2*fHarmonic,6*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3270 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(81,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,6*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3271 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(82,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,4*fHarmonic,6*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3272 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(83,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,4*fHarmonic,6*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3273 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(84,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,5*fHarmonic,5*fHarmonic,4*fHarmonic,2*fHarmonic)); | |
3274 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(85,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,5*fHarmonic,6*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3275 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(86,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,5*fHarmonic,6*fHarmonic,4*fHarmonic,1*fHarmonic)); | |
3276 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(87,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",2*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3277 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(88,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",2*fHarmonic,2*fHarmonic,2*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3278 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(89,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",3*fHarmonic,3*fHarmonic,2*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3279 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(90,Form("#LT#LT5#GT#GT_{%dn|%dn,%dn,%dn,%dn}",4*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3280 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(91,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,2*fHarmonic,2*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3281 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(92,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,4*fHarmonic,4*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3282 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(93,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,3*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3283 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(94,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,6*fHarmonic,4*fHarmonic,4*fHarmonic,4*fHarmonic)); | |
3284 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(95,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,6*fHarmonic,6*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3285 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(96,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",3*fHarmonic,1*fHarmonic,2*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3286 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(97,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",3*fHarmonic,2*fHarmonic,2*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3287 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(98,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",3*fHarmonic,3*fHarmonic,3*fHarmonic,2*fHarmonic,1*fHarmonic)); | |
3288 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(99,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,1*fHarmonic,3*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3289 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(100,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",4*fHarmonic,1*fHarmonic,1*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3290 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(101,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,3*fHarmonic,3*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3291 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(102,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,4*fHarmonic,3*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3292 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(103,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",4*fHarmonic,4*fHarmonic,4*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3293 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(104,Form("#LT#LT5#GT#GT_{%dn|%dn,%dn,%dn,%dn}",5*fHarmonic,2*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3294 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(105,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,1*fHarmonic,2*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3295 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(106,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,2*fHarmonic,3*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3296 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(107,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,3*fHarmonic,3*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3297 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(108,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,1*fHarmonic,4*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3298 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(109,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,4*fHarmonic,3*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3299 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(110,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,4*fHarmonic,4*fHarmonic,4*fHarmonic,1*fHarmonic)); | |
3300 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(111,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,5*fHarmonic,4*fHarmonic,3*fHarmonic,3*fHarmonic)); | |
3301 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(112,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,5*fHarmonic,4*fHarmonic,4*fHarmonic,2*fHarmonic)); | |
3302 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(113,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,5*fHarmonic,5*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3303 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(114,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,5*fHarmonic,5*fHarmonic,4*fHarmonic,1*fHarmonic)); | |
3304 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(115,Form("#LT#LT5#GT#GT_{%dn|%dn,%dn,%dn,%dn}",6*fHarmonic,2*fHarmonic,2*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3305 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(116,Form("#LT#LT5#GT#GT_{%dn|%dn,%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,1*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3306 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(117,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",6*fHarmonic,1*fHarmonic,1*fHarmonic,4*fHarmonic,4*fHarmonic)); | |
3307 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(118,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,1*fHarmonic,5*fHarmonic,1*fHarmonic,1*fHarmonic)); | |
3308 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(119,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,2*fHarmonic,4*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3309 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(120,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,4*fHarmonic,4*fHarmonic,4*fHarmonic,2*fHarmonic)); | |
3310 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(121,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",6*fHarmonic,2*fHarmonic,2*fHarmonic,5*fHarmonic,5*fHarmonic)); | |
3311 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(122,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,5*fHarmonic,5*fHarmonic,5*fHarmonic,1*fHarmonic)); | |
3312 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(123,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,6*fHarmonic,5*fHarmonic,5*fHarmonic,2*fHarmonic)); | |
3313 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(124,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,6*fHarmonic,6*fHarmonic,4*fHarmonic,2*fHarmonic)); | |
3314 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(125,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,6*fHarmonic,6*fHarmonic,5*fHarmonic,1*fHarmonic)); | |
3315 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(126,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,2*fHarmonic,3*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3316 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(127,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",5*fHarmonic,1*fHarmonic,1*fHarmonic,4*fHarmonic,3*fHarmonic)); | |
3317 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(128,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",5*fHarmonic,3*fHarmonic,4*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3318 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(129,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",5*fHarmonic,2*fHarmonic,1*fHarmonic,4*fHarmonic,4*fHarmonic)); | |
3319 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(130,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,1*fHarmonic,3*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3320 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(131,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,4*fHarmonic,4*fHarmonic,1*fHarmonic)); | |
3321 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(132,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",6*fHarmonic,1*fHarmonic,1*fHarmonic,5*fHarmonic,3*fHarmonic)); | |
3322 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(133,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,3*fHarmonic,5*fHarmonic,2*fHarmonic,2*fHarmonic)); | |
3323 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(134,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,5*fHarmonic,4*fHarmonic,4*fHarmonic,3*fHarmonic)); | |
3324 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(135,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",6*fHarmonic,3*fHarmonic,1*fHarmonic,5*fHarmonic,5*fHarmonic)); | |
3325 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(136,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,6*fHarmonic,5*fHarmonic,4*fHarmonic,3*fHarmonic)); | |
3326 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(137,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,2*fHarmonic,4*fHarmonic,3*fHarmonic,1*fHarmonic)); | |
3327 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(138,Form("#LT#LT5#GT#GT_{%dn,%dn,%dn|%dn,%dn}",6*fHarmonic,2*fHarmonic,1*fHarmonic,5*fHarmonic,4*fHarmonic)); | |
3328 | fMixedHarmonicProductOfCorrelations->GetYaxis()->SetBinLabel(139,Form("#LT#LT5#GT#GT_{%dn,%dn|%dn,%dn,%dn}",6*fHarmonic,4*fHarmonic,5*fHarmonic,3*fHarmonic,2*fHarmonic)); | |
3329 | fMixedHarmonicsErrorPropagation->Add(fMixedHarmonicProductOfCorrelations); | |
3330 | ||
e1d101a6 | 3331 | } // end of void AliFlowAnalysisWithQCumulants::BookEverythingForMixedHarmonics() |
3332 | ||
3333 | //======================================================================================================================= | |
489d5531 | 3334 | |
489d5531 | 3335 | void AliFlowAnalysisWithQCumulants::InitializeArraysForNestedLoops() |
3336 | { | |
3337 | // Initialize arrays of all objects relevant for calculations with nested loops. | |
3338 | ||
3339 | // integrated flow: | |
3340 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
3341 | { | |
3342 | fIntFlowDirectCorrectionTermsForNUA[sc] = NULL; | |
3343 | } | |
3344 | ||
3345 | // differential flow: | |
3346 | // correlations: | |
3347 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
3348 | { | |
3349 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
3350 | { | |
3351 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
3352 | { | |
3353 | fDiffFlowDirectCorrelations[t][pe][ci] = NULL; | |
3354 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
3355 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
3356 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
3357 | // correction terms for non-uniform acceptance: | |
3358 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
3359 | { | |
3360 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
3361 | { | |
3362 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
3363 | { | |
3364 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
3365 | { | |
3366 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = NULL; | |
3367 | } | |
3368 | } | |
3369 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
3370 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
3371 | ||
64e500e3 | 3372 | // other differential correlators: |
3373 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
3374 | { | |
3375 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
3376 | { | |
3377 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
3378 | { | |
3379 | for(Int_t ci=0;ci<1;ci++) // correlator index | |
3380 | { | |
3381 | fOtherDirectDiffCorrelators[t][pe][sc][ci] = NULL; | |
3382 | } | |
3383 | } | |
3384 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
3385 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
489d5531 | 3386 | |
3387 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForNestedLoops() | |
3388 | ||
e1d101a6 | 3389 | //======================================================================================================================= |
489d5531 | 3390 | |
c10259fb | 3391 | void AliFlowAnalysisWithQCumulants::InitializeArraysForMixedHarmonics() |
3392 | { | |
3393 | // Initialize arrays of all objects relevant for mixed harmonics. | |
3394 | ||
3395 | for(Int_t power=0;power<2;power++) // linear or quadratic | |
3396 | { | |
3397 | fMixedHarmonicEventWeights[power] = NULL; | |
3398 | } | |
3399 | ||
3400 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForMixedHarmonics() | |
3401 | ||
3402 | //======================================================================================================================= | |
3403 | ||
d9e6d8bb | 3404 | void AliFlowAnalysisWithQCumulants::InitializeArraysForControlHistograms() |
3405 | { | |
3406 | // Initialize arrays of all objects relevant for control histograms. | |
3407 | ||
3408 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
3409 | { | |
3410 | fCorrelation2468VsMult[ci] = NULL; | |
3411 | } | |
1db7eced | 3412 | for(Int_t cpi=0;cpi<1;cpi++) // correlation product index TBI: hardwired 1 |
3413 | { | |
3414 | fCorrelationProduct2468VsMult[cpi] = NULL; | |
3415 | } | |
3416 | for(Int_t qwti=0;qwti<4;qwti++) // q-vector terms index TBI: hardwired 4 | |
3417 | { | |
3418 | fQvectorTermsVsMult[qwti] = NULL; | |
3419 | } | |
d9e6d8bb | 3420 | |
3421 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForControlHistograms() | |
3422 | ||
3423 | //======================================================================================================================= | |
3424 | ||
489d5531 | 3425 | void AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops() |
3426 | { | |
3427 | // Book all objects relevant for calculations with nested loops. | |
3428 | ||
3429 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?) | |
3430 | TString typeFlag[2] = {"RP","POI"}; // to be improved (should I promote this to data members?) | |
3431 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; // to be improved (should I promote this to data members?) | |
3432 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; // to be improved (should I promote this to data members?) | |
3433 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
3434 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
3435 | ||
3436 | TString evaluateNestedLoopsName = "fEvaluateNestedLoops"; | |
3437 | evaluateNestedLoopsName += fAnalysisLabel->Data(); | |
3438 | fEvaluateNestedLoops = new TProfile(evaluateNestedLoopsName.Data(),"Flags for nested loops",4,0,4); | |
3439 | fEvaluateNestedLoops->SetLabelSize(0.03); | |
e1d101a6 | 3440 | fEvaluateNestedLoops->SetStats(kFALSE); |
489d5531 | 3441 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(1,"fEvaluateIntFlowNestedLoops"); |
3442 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(2,"fEvaluateDiffFlowNestedLoops"); | |
3443 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(3,"fCrossCheckInPtBinNo"); | |
3444 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(4,"fCrossCheckInEtaBinNo"); | |
3445 | fEvaluateNestedLoops->Fill(0.5,(Int_t)fEvaluateIntFlowNestedLoops); | |
3446 | fEvaluateNestedLoops->Fill(1.5,(Int_t)fEvaluateDiffFlowNestedLoops); | |
3447 | fEvaluateNestedLoops->Fill(2.5,fCrossCheckInPtBinNo); | |
3448 | fEvaluateNestedLoops->Fill(3.5,fCrossCheckInEtaBinNo); | |
3449 | fNestedLoopsList->Add(fEvaluateNestedLoops); | |
3450 | // nested loops for integrated flow: | |
3451 | if(fEvaluateIntFlowNestedLoops) | |
3452 | { | |
3453 | // correlations: | |
3454 | TString intFlowDirectCorrelationsName = "fIntFlowDirectCorrelations"; | |
3455 | intFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
403e3389 | 3456 | fIntFlowDirectCorrelations = new TProfile(intFlowDirectCorrelationsName.Data(),"Multiparticle correlations calculated with nested loops (for int. flow)",64,0,64,"s"); |
489d5531 | 3457 | fNestedLoopsList->Add(fIntFlowDirectCorrelations); |
403e3389 | 3458 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 3459 | { |
3460 | TString intFlowExtraDirectCorrelationsName = "fIntFlowExtraDirectCorrelations"; | |
3461 | intFlowExtraDirectCorrelationsName += fAnalysisLabel->Data(); | |
3462 | fIntFlowExtraDirectCorrelations = new TProfile(intFlowExtraDirectCorrelationsName.Data(),"Extra multiparticle correlations calculated with nested loops (for int. flow)",100,0,100,"s"); | |
3463 | fNestedLoopsList->Add(fIntFlowExtraDirectCorrelations); | |
403e3389 | 3464 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 3465 | // correction terms for non-uniform acceptance: |
3466 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
3467 | { | |
3468 | TString intFlowDirectCorrectionTermsForNUAName = "fIntFlowDirectCorrectionTermsForNUA"; | |
3469 | intFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
3470 | fIntFlowDirectCorrectionTermsForNUA[sc] = new TProfile(Form("%s: %s terms",intFlowDirectCorrectionTermsForNUAName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),10,0,10,"s"); | |
3471 | fNestedLoopsList->Add(fIntFlowDirectCorrectionTermsForNUA[sc]); | |
3472 | } // end of for(Int_t sc=0;sc<2;sc++) | |
e1d101a6 | 3473 | // Mixed harmonics: |
3474 | if(fCalculateMixedHarmonics) | |
3475 | { | |
3476 | TString mixedHarmonicsNestedLoopsName = "fMixedHarmonicsNestedLoops"; | |
3477 | mixedHarmonicsNestedLoopsName += fAnalysisLabel->Data(); | |
3478 | fMixedHarmonicsNestedLoops = new TProfile(mixedHarmonicsNestedLoopsName.Data(),"Mixed harmonics calculated with nested loops",200,0,200); // TBI hardwired 200 | |
3479 | fNestedLoopsList->Add(fMixedHarmonicsNestedLoops); | |
3480 | } // end of if(fCalculateMixedHarmonics) | |
489d5531 | 3481 | } // end of if(fEvaluateIntFlowNestedLoops) |
3482 | ||
3483 | // nested loops for differential flow: | |
3484 | if(fEvaluateDiffFlowNestedLoops) | |
3485 | { | |
3486 | // reduced correlations: | |
3487 | TString diffFlowDirectCorrelationsName = "fDiffFlowDirectCorrelations"; | |
3488 | diffFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
3489 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
3490 | { | |
62e36168 | 3491 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 3492 | { |
3493 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
3494 | { | |
3495 | // reduced correlations: | |
3496 | fDiffFlowDirectCorrelations[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe],"s"); | |
3497 | fDiffFlowDirectCorrelations[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data()); | |
3498 | fNestedLoopsList->Add(fDiffFlowDirectCorrelations[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations) | |
3499 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
3500 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
3501 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
64e500e3 | 3502 | |
489d5531 | 3503 | // correction terms for non-uniform acceptance: |
3504 | TString diffFlowDirectCorrectionTermsForNUAName = "fDiffFlowDirectCorrectionTermsForNUA"; | |
3505 | diffFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
3506 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
3507 | { | |
62e36168 | 3508 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 3509 | { |
3510 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
3511 | { | |
3512 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
3513 | { | |
3514 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = new TProfile(Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe],"s"); | |
3515 | fNestedLoopsList->Add(fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]); | |
3516 | } | |
3517 | } | |
3518 | } | |
64e500e3 | 3519 | } |
3520 | // other differential correlators: | |
3521 | TString otherDirectDiffCorrelatorsName = "fOtherDirectDiffCorrelators"; | |
3522 | otherDirectDiffCorrelatorsName += fAnalysisLabel->Data(); | |
3523 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
3524 | { | |
62e36168 | 3525 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
64e500e3 | 3526 | { |
3527 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
3528 | { | |
3529 | for(Int_t ci=0;ci<1;ci++) // correlator index | |
3530 | { | |
3531 | fOtherDirectDiffCorrelators[t][pe][sc][ci] = new TProfile(Form("%s, %s, %s, %s, ci = %d",otherDirectDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1),Form("%s, %s, %s, %s, ci = %d",otherDirectDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe]); | |
3532 | fNestedLoopsList->Add(fOtherDirectDiffCorrelators[t][pe][sc][ci]); | |
3533 | } | |
3534 | } | |
3535 | } | |
3536 | } | |
3b552efe | 3537 | // number of RPs and POIs in selected pt and eta bins for cross-checkings: |
3538 | TString noOfParticlesInBinName = "fNoOfParticlesInBin"; | |
3539 | fNoOfParticlesInBin = new TH1D(noOfParticlesInBinName.Data(),"Number of RPs and POIs in selected p_{T} and #eta bin",4,0,4); | |
489d5531 | 3540 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(1,"# of RPs in p_{T} bin"); |
3541 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(2,"# of RPs in #eta bin"); | |
3542 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(3,"# of POIs in p_{T} bin"); | |
3b552efe | 3543 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(4,"# of POIs in #eta bin"); |
489d5531 | 3544 | fNestedLoopsList->Add(fNoOfParticlesInBin); |
3545 | } // end of if(fEvaluateDiffFlowNestedLoops) | |
3546 | ||
3547 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops() | |
3548 | ||
e1d101a6 | 3549 | //========================================================================================================= |
489d5531 | 3550 | |
489d5531 | 3551 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelations() |
3552 | { | |
b84464d3 | 3553 | // Calculate in this method all multiparticle azimuthal correlations. |
3554 | // | |
3555 | // Remark 1: All multiparticle correlations are stored in TProfile fIntFlowCorrelationsAllPro; | |
3556 | // Remark 2: There is a special TProfile fIntFlowCorrelationsPro holding results | |
3557 | // only for same harmonic's correlations <<2>>, <<4>>, <<6>> and <<8>>; | |
3558 | // Remark 3: Binning of fIntFlowCorrelationsAllPro is organized as follows: | |
3559 | // -------------------------------------------------------------------------------------------------------------------- | |
3560 | // 1st bin: <2>_{1n|1n} = two1n1n = cos(1n(phi1-phi2))> | |
3561 | // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n(phi1-phi2))> | |
3562 | // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n(phi1-phi2))> | |
3563 | // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n(phi1-phi2))> | |
3564 | // 5th bin: ---- EMPTY ---- | |
3565 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n(2*phi1-phi2-phi3))> | |
3566 | // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n(3*phi1-2*phi2-phi3))> | |
3567 | // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n(4*phi1-2*phi2-2*phi3))> | |
3568 | // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n(4*phi1-3*phi2-phi3))> | |
3569 | // 10th bin: ---- EMPTY ---- | |
3570 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n(phi1+phi2-phi3-phi4))> | |
3571 | // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(n(2*phi1+phi2-2*phi3-phi4))> | |
3572 | // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(2n(phi1+phi2-phi3-phi4))> | |
3573 | // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n(3*phi1-phi2-phi3-phi4))> | |
3574 | // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n(3*phi1+phi2-3*phi3-phi4))> | |
3575 | // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n(3*phi1+phi2-2*phi3-2*phi4))> | |
3576 | // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n(4*phi1-2*phi2-phi3-phi4))> | |
3577 | // 18th bin: ---- EMPTY ---- | |
3578 | // 19th bin: <5>_{2n,1n|1n,1n,1n} = five2n1n1n1n1n = <cos(n(2*phi1+phi2-phi3-phi4-phi5))> | |
3579 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n(2*phi1+2*phi2-2*phi3-phi4-phi5))> | |
3580 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n(3*phi1+phi2-2*phi3-phi4-phi5))> | |
3581 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n(4*phi1-phi2-phi3-phi4-phi5))> | |
3582 | // 23rd bin: ---- EMPTY ---- | |
3583 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n(phi1+phi2+phi3-phi4-phi5-phi6))> | |
3584 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n(2*phi1+phi2+phi3-2*phi4-phi5-phi6))> | |
3585 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n(2*phi1+2*phi2-phi3-phi4-phi5-phi6))> | |
3586 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n(3*phi1+phi2-phi3-phi4-phi5-phi6))> | |
3587 | // 28th bin: ---- EMPTY ---- | |
3588 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n(2*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> | |
3589 | // 30th bin: ---- EMPTY ---- | |
3590 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> | |
3591 | // 32nd bin: ---- EMPTY ---- | |
3592 | // Extra correlations for v3{5} study: | |
3593 | // 33rd bin: <4>_{4n,2n|3n,3n} = four4n2n3n3n = <cos(n(4*phi1+2*phi2-3*phi3-3*phi4))> | |
3594 | // 34th bin: <5>_{3n,3n|2n,2n,2n} = five3n3n2n2n2n = <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-2*phi5))> | |
3595 | // Extra correlations for Teaney-Yan study: | |
3596 | // 35th bin: <2>_{5n|5n} = two5n5n = <cos(5n(phi1-phi2)> | |
3597 | // 36th bin: <2>_{6n|6n} = two6n6n = <cos(6n(phi1-phi2)> | |
3598 | // 37th bin: <3>_{5n|3n,2n} = three5n3n2n = <cos(n(5*phi1-3*phi2-2*phi3)> | |
3599 | // 38th bin: <3>_{5n|4n,1n} = three5n4n1n = <cos(n(5*phi1-4*phi2-1*phi3)> | |
3600 | // 39th bin: <3>_{6n|3n,3n} = three6n3n3n = <cos(n(6*phi1-3*phi2-3*phi3)> | |
3601 | // 40th bin: <3>_{6n|4n,2n} = three6n4n2n = <cos(n(6*phi1-4*phi2-2*phi3)> | |
3602 | // 41st bin: <3>_{6n|5n,1n} = three6n5n1n = <cos(n(6*phi1-5*phi2-1*phi3)> | |
3603 | // 42nd bin: <4>_{6n|3n,2n,1n} = four6n3n2n1n = <cos(n(6*phi1-3*phi2-2*phi3-1*phi4)> | |
3604 | // 43rd bin: <4>_{3n,2n|3n,2n} = four3n2n3n2n = <cos(n(3*phi1+2*phi2-3*phi3-2*phi4)> | |
3605 | // 44th bin: <4>_{4n,1n|3n,2n} = four4n1n3n2n = <cos(n(4*phi1+1*phi2-3*phi3-2*phi4)> | |
3606 | // 45th bin: <4>_{3n,3n|3n,3n} = four3n3n3n3n = <cos(3n*(phi1+phi2-phi3-phi4))> | |
3607 | // 46th bin: <4>_{4n,2n|3n,3n} = four4n2n3n3n = <cos(n(4*phi1+2*phi2-3*phi3-3*phi4)> | |
3608 | // 47th bin: <4>_{5n,1n|3n,3n} = four5n1n3n3n = <cos(n(5*phi1+1*phi2-3*phi3-3*phi4)> | |
3609 | // 48th bin: <4>_{4n,2n|4n,2n} = four4n2n4n2n = <cos(n(4*phi1+2*phi2-4*phi3-2*phi4)> | |
3610 | // 49th bin: <4>_{5n,1n|4n,2n} = four5n1n4n2n = <cos(n(5*phi1+1*phi2-4*phi3-2*phi4)> | |
3611 | // 50th bin: <4>_{5n|3n,1n,1n} = four5n3n1n1n = <cos(n(5*phi1-3*phi2-1*phi3-1*phi4)> | |
3612 | // 51st bin: <4>_{5n|2n,2n,1n} = four5n2n2n1n = <cos(n(5*phi1-2*phi2-2*phi3-1*phi4)> | |
3613 | // 52nd bin: <4>_{5n,1n|5n,1n} = four5n1n5n1n = <cos(n(5*phi1+1*phi2-5*phi3-1*phi4)> | |
3614 | // 53rd bin: <5>_{3n,3n|3n,2n,1n} = five3n3n3n2n1n = <cos(n(3*phi1+3*phi2-3*phi3-2*phi4-1*phi5)> | |
3615 | // 54th bin: <5>_{4n,2n|3n,2n,1n} = five4n2n3n2n1n = <cos(n(4*phi1+2*phi2-3*phi3-2*phi4-1*phi5)> | |
3616 | // 55th bin: <5>_{3n,2n|3n,1n,1n} = five3n2n3n1n1n = <cos(n(3*phi1+2*phi2-3*phi3-1*phi4-1*phi5)> | |
3617 | // 56th bin: <5>_{3n,2n|2n,2n,1n} = five3n2n2n2n1n = <cos(n(3*phi1+2*phi2-2*phi3-2*phi4-1*phi5)> | |
3618 | // 57th bin: <5>_{5n,1n|3n,2n,1n} = five5n1n3n2n1n = <cos(n(5*phi1+1*phi2-3*phi3-2*phi4-1*phi5)> | |
3619 | // 58th bin: <6>_{3n,2n,1n|3n,2n,1n} = six3n2n1n3n2n1n = <cos(n(3*phi1+2*phi2+1*phi3-3*phi4-2*phi5-1*phi6)> | |
403e3389 | 3620 | // Extra correlations for Teaney-Yan study (B): |
3621 | // 59th bin: <4>_{6n|4n,1n,1n} = four6n4n1n1n = <cos(n(6*phi1-4*phi2-1*phi3-1*phi4)> | |
3622 | // 60th bin: <4>_{6n|2n,2n,2n} = four6n2n2n2n = <cos(n(6*phi1-2*phi2-2*phi3-2*phi4)> | |
3623 | // 61st bin: <5>_{6n|2n,2n,1n,1n} = five6n2n2n1n1n = <cos(n(6*phi1-2*phi2-2*phi3-1*phi4-1*phi5)> | |
3624 | // 62nd bin: <5>_{4n,1n,1n|3n,3n} = five4n1n1n3n3n = <cos(n(4*phi1+1*phi2+1*phi3-3*phi4-3*phi5)> | |
3625 | // 63rd bin: <6>_{3n,3n|2n,2n,1n,1n} = six3n3n2n2n1n1n = <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-1*phi5-1*phi6)> | |
b84464d3 | 3626 | // -------------------------------------------------------------------------------------------------------------------- |
403e3389 | 3627 | |
3628 | // Multiplicity of an event: | |
1268c371 | 3629 | Double_t dMult = (*fSpk)(0,0); |
b84464d3 | 3630 | // Real parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n, 4n, 5n and 6n: |
489d5531 | 3631 | Double_t dReQ1n = (*fReQ)(0,0); |
3632 | Double_t dReQ2n = (*fReQ)(1,0); | |
3633 | Double_t dReQ3n = (*fReQ)(2,0); | |
3634 | Double_t dReQ4n = (*fReQ)(3,0); | |
b84464d3 | 3635 | Double_t dReQ5n = (*fReQ)(4,0); |
8ed4edc7 | 3636 | Double_t dReQ6n = (*fReQ)(5,0); |
b84464d3 | 3637 | // Imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n, 4n, 5n and 6n: |
489d5531 | 3638 | Double_t dImQ1n = (*fImQ)(0,0); |
3639 | Double_t dImQ2n = (*fImQ)(1,0); | |
3640 | Double_t dImQ3n = (*fImQ)(2,0); | |
3641 | Double_t dImQ4n = (*fImQ)(3,0); | |
b84464d3 | 3642 | Double_t dImQ5n = (*fImQ)(4,0); |
8ed4edc7 | 3643 | Double_t dImQ6n = (*fImQ)(5,0); |
3842bdcd | 3644 | |
3645 | // Multiplicity bin of an event (relevant for all histos vs M): | |
3646 | Double_t dMultiplicityBin = 0.; | |
df23c5ae | 3647 | if(fMultiplicityIs==AliFlowCommonConstants::kRP) |
3842bdcd | 3648 | { |
4aae2a93 | 3649 | //Printf("RP multiplicity: %lf",fNumberOfRPsEBE); |
3650 | dMultiplicityBin = fNumberOfRPsEBE+0.5; | |
df23c5ae | 3651 | } else if(fMultiplicityIs==AliFlowCommonConstants::kExternal) |
3842bdcd | 3652 | { |
4aae2a93 | 3653 | //Printf("Reference multiplicity: %lf",fReferenceMultiplicityEBE); |
3842bdcd | 3654 | dMultiplicityBin = fReferenceMultiplicityEBE+0.5; |
df23c5ae | 3655 | } else if(fMultiplicityIs==AliFlowCommonConstants::kPOI) |
3656 | { | |
3657 | dMultiplicityBin = fNumberOfPOIsEBE+0.5; | |
3658 | } | |
1db7eced | 3659 | |
b84464d3 | 3660 | // Real parts of expressions involving various combinations of Q-vectors which appears |
3661 | // simultaneously in several equations for multiparticle correlations bellow: | |
3662 | // Re[Q_{2n}Q_{n}^*Q_{n}^*] | |
3663 | Double_t reQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n; | |
3664 | // Re[Q_{6n}Q_{3n}^*Q_{3n}^*] | |
3665 | Double_t reQ6nQ3nstarQ3nstar = pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n; | |
3666 | // Re[Q_{4n}Q_{2n}^*Q_{2n}^*] | |
489d5531 | 3667 | Double_t reQ4nQ2nstarQ2nstar = pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n; |
b84464d3 | 3668 | // Re[Q_{4n}Q_{3n}^*Q_{n}^*] |
489d5531 | 3669 | Double_t reQ4nQ3nstarQ1nstar = dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n); |
b84464d3 | 3670 | // Re[Q_{3n}Q_{2n}^*Q_{n}^*] |
489d5531 | 3671 | Double_t reQ3nQ2nstarQ1nstar = dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n |
b84464d3 | 3672 | + dImQ3n*dImQ2n*dReQ1n; |
3673 | // Re[Q_{5n}Q_{3n}^*Q_{2n}^*] | |
3674 | Double_t reQ5nQ3nstarQ2nstar = dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n | |
3675 | + dImQ5n*dImQ2n*dReQ3n; | |
3676 | // Re[Q_{5n}Q_{4n}^*Q_{1n}^*] | |
3677 | Double_t reQ5nQ4nstarQ1nstar = dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n | |
3678 | + dImQ5n*dImQ4n*dReQ1n; | |
3679 | // Re[Q_{6n}Q_{5n}^*Q_{1n}^*] | |
3680 | Double_t reQ6nQ5nstarQ1nstar = dReQ6n*dReQ5n*dReQ1n-dReQ6n*dImQ5n*dImQ1n+dImQ6n*dReQ5n*dImQ1n | |
3681 | + dImQ6n*dImQ5n*dReQ1n; | |
3682 | // Re[Q_{6n}Q_{4n}^*Q_{2n}^*] | |
3683 | Double_t reQ6nQ4nstarQ2nstar = dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n | |
3684 | + dImQ6n*dImQ4n*dReQ2n; | |
3685 | // Re[Q_{3n}Q_{n}Q_{2n}^*Q_{2n}^*] | |
3686 | Double_t reQ3nQ1nQ2nstarQ2nstar = (pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n) | |
3687 | + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n); | |
3688 | // Re[Q_{3n}Q_{n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 3689 | Double_t reQ3nQ1nstarQ1nstarQ1nstar = dReQ3n*pow(dReQ1n,3)-3.*dReQ1n*dReQ3n*pow(dImQ1n,2) |
3690 | + 3.*dImQ1n*dImQ3n*pow(dReQ1n,2)-dImQ3n*pow(dImQ1n,3); | |
403e3389 | 3691 | // Re[Q_{6n}Q_{2n}^*Q_{2n}^*Q_{2n}^*] |
3692 | Double_t reQ6nQ2nstarQ2nstarQ2nstar = dReQ6n*pow(dReQ2n,3)-3.*dReQ2n*dReQ6n*pow(dImQ2n,2) | |
3693 | + 3.*dImQ2n*dImQ6n*pow(dReQ2n,2)-dImQ6n*pow(dImQ2n,3); | |
b84464d3 | 3694 | // Re[Q_{4n}Q_{2n}^*Q_{n}^*Q_{n}^*] |
3695 | Double_t reQ4nQ2nstarQ1nstarQ1nstar = (dReQ4n*dReQ2n+dImQ4n*dImQ2n)*(pow(dReQ1n,2)-pow(dImQ1n,2)) | |
3696 | + 2.*dReQ1n*dImQ1n*(dImQ4n*dReQ2n-dReQ4n*dImQ2n); | |
3697 | // Re[Q_{4n}Q_{2n}^*Q_{3n}^*Q_{3n}^*] | |
3698 | Double_t reQ4nQ2nQ3nstarQ3nstar = (dReQ4n*dReQ2n-dImQ4n*dImQ2n)*(dReQ3n*dReQ3n-dImQ3n*dImQ3n) | |
3699 | + 2.*(dReQ4n*dImQ2n+dImQ4n*dReQ2n)*dReQ3n*dImQ3n; | |
3700 | // Re[Q_{4n}Q_{n}Q_{3n}^*Q_{2n}^*] | |
3701 | Double_t reQ4nQ1nQ3nstarQ2nstar = dImQ1n*dImQ2n*dImQ3n*dImQ4n+dImQ3n*dImQ4n*dReQ1n*dReQ2n | |
3702 | + dImQ2n*dImQ4n*dReQ1n*dReQ3n-dImQ1n*dImQ4n*dReQ2n*dReQ3n | |
3703 | - dImQ2n*dImQ3n*dReQ1n*dReQ4n+dImQ1n*dImQ3n*dReQ2n*dReQ4n | |
3704 | + dImQ1n*dImQ2n*dReQ3n*dReQ4n+dReQ1n*dReQ2n*dReQ3n*dReQ4n; | |
3705 | // Re[Q_{5n}Q_{n}Q_{4n}^*Q_{2n}^*] | |
3706 | Double_t reQ5nQ1nQ4nstarQ2nstar = dImQ1n*dImQ2n*dImQ4n*dImQ5n+dImQ4n*dImQ5n*dReQ1n*dReQ2n | |
3707 | + dImQ2n*dImQ5n*dReQ1n*dReQ4n-dImQ1n*dImQ5n*dReQ2n*dReQ4n | |
3708 | - dImQ2n*dImQ4n*dReQ1n*dReQ5n+dImQ1n*dImQ4n*dReQ2n*dReQ5n | |
3709 | + dImQ1n*dImQ2n*dReQ4n*dReQ5n+dReQ1n*dReQ2n*dReQ4n*dReQ5n; | |
3710 | // Re[Q_{5n}Q_{n}Q_{3n}^*Q_{3n}^*] | |
3711 | Double_t reQ5nQ1nQ3nstarQ3nstar = dImQ1n*pow(dImQ3n,2.)*dImQ5n+2.*dImQ3n*dImQ5n*dReQ1n*dReQ3n | |
3712 | - dImQ1n*dImQ5n*pow(dReQ3n,2.)-pow(dImQ3n,2.)*dReQ1n*dReQ5n | |
3713 | + 2.*dImQ1n*dImQ3n*dReQ3n*dReQ5n+dReQ1n*pow(dReQ3n,2.)*dReQ5n; | |
3714 | // Re[Q_{5n}Q_{3n}^*Q_{n}^*Q_{n}^*] | |
3715 | Double_t reQ5nQ3nstarQ1nstarQ1nstar = -pow(dImQ1n,2.)*dImQ3n*dImQ5n+dImQ3n*dImQ5n*pow(dReQ1n,2.) | |
3716 | + 2.*dImQ1n*dImQ5n*dReQ1n*dReQ3n-2.*dImQ1n*dImQ3n*dReQ1n*dReQ5n | |
3717 | - pow(dImQ1n,2.)*dReQ3n*dReQ5n+pow(dReQ1n,2.)*dReQ3n*dReQ5n; | |
3718 | // Re[Q_{5n}Q_{2n}^*Q_{2n}^*Q_{n}^*] | |
3719 | Double_t reQ5nQ2nstarQ2nstarQ1nstar = -pow(dImQ2n,2.)*dImQ1n*dImQ5n+dImQ1n*dImQ5n*pow(dReQ2n,2.) | |
3720 | + 2.*dImQ2n*dImQ5n*dReQ2n*dReQ1n-2.*dImQ2n*dImQ1n*dReQ2n*dReQ5n | |
403e3389 | 3721 | - pow(dImQ2n,2.)*dReQ1n*dReQ5n+pow(dReQ2n,2.)*dReQ1n*dReQ5n; |
3722 | // Re[Q_{6n}Q_{4n}^*Q_{n}^*Q_{n}^*] | |
3723 | Double_t reQ6nQ4nstarQ1nstarQ1nstar = -pow(dImQ1n,2.)*dImQ4n*dImQ6n+dImQ4n*dImQ6n*pow(dReQ1n,2.) | |
3724 | + 2.*dImQ1n*dImQ6n*dReQ1n*dReQ4n-2.*dImQ1n*dImQ4n*dReQ1n*dReQ6n | |
3725 | - pow(dImQ1n,2.)*dReQ4n*dReQ6n+pow(dReQ1n,2.)*dReQ4n*dReQ6n; | |
489d5531 | 3726 | // |Q_{2n}|^2 |Q_{n}|^2 |
3727 | Double_t dQ2nQ1nQ2nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
b84464d3 | 3728 | // |Q_{4n}|^2 |Q_{2n}|^2 |
3729 | Double_t dQ4nQ2nQ4nstarQ2nstar = (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)); | |
3730 | // |Q_{3n}|^2 |Q_{2n}|^2 | |
3731 | Double_t dQ3nQ2nQ3nstarQ2nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)); | |
3732 | // |Q_{5n}|^2 |Q_{n}|^2 | |
3733 | Double_t dQ5nQ1nQ5nstarQ1nstar = (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
53884472 | 3734 | // |Q_{3n}|^2 |Q_{n}|^2 |
3735 | Double_t dQ3nQ1nQ3nstarQ1nstar = (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
b84464d3 | 3736 | // Re[Q_{2n}Q_{n}Q_{n}^*Q_{n}^*Q_{n}^*] |
489d5531 | 3737 | Double_t reQ2nQ1nQ1nstarQ1nstarQ1nstar = (dReQ2n*dReQ1n-dImQ2n*dImQ1n)*(pow(dReQ1n,3)-3.*dReQ1n*pow(dImQ1n,2)) |
b84464d3 | 3738 | + (dReQ2n*dImQ1n+dReQ1n*dImQ2n)*(3.*dImQ1n*pow(dReQ1n,2)-pow(dImQ1n,3)); |
3739 | // Re[Q_{2n}Q_{2n}Q_{2n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 3740 | Double_t reQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.)) |
3741 | * (dReQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) + 2.*dImQ2n*dReQ1n*dImQ1n); | |
b84464d3 | 3742 | // Re[Q_{4n}Q_{n}^*Q_{n}^*Q_{n}^*Q_{n}^*] |
489d5531 | 3743 | Double_t reQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dReQ4n-6.*pow(dReQ1n,2.)*dReQ4n*pow(dImQ1n,2.) |
3744 | + pow(dImQ1n,4.)*dReQ4n+4.*pow(dReQ1n,3.)*dImQ1n*dImQ4n | |
3745 | - 4.*pow(dImQ1n,3.)*dReQ1n*dImQ4n; | |
b84464d3 | 3746 | // Re[Q_{3n}Q_{n}Q_{2n}^*Q_{n}^*Q_{n}^*] |
489d5531 | 3747 | Double_t reQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
b84464d3 | 3748 | * (dReQ1n*dReQ2n*dReQ3n-dReQ3n*dImQ1n*dImQ2n |
3749 | + dReQ2n*dImQ1n*dImQ3n+dReQ1n*dImQ2n*dImQ3n); | |
3750 | // Re[Q_{6n}Q_{n}Q_{3n}^*Q_{2n}^*Q_{n}^*] | |
3751 | Double_t reQ6nQ3nstarQ2nstarQ1nstar = dReQ1n*dReQ2n*dReQ3n*dReQ6n-dReQ3n*dReQ6n*dImQ1n*dImQ2n | |
3752 | - dReQ2n*dReQ6n*dImQ1n*dImQ3n-dReQ1n*dReQ6n*dImQ2n*dImQ3n | |
3753 | + dReQ2n*dReQ3n*dImQ1n*dImQ6n+dReQ1n*dReQ3n*dImQ2n*dImQ6n | |
3754 | + dReQ1n*dReQ2n*dImQ3n*dImQ6n-dImQ1n*dImQ2n*dImQ3n*dImQ6n; | |
3755 | // Re[Q_{3n}Q_{3n}Q_{3n}^*Q_{2n}^*Q_{n}^*] | |
3756 | Double_t reQ3nQ3nQ3nstarQ2nstarQ1nstar = (pow(dImQ3n,2.)+pow(dReQ3n,2.)) | |
3757 | * (dImQ2n*dImQ3n*dReQ1n+dImQ1n*dImQ3n*dReQ2n | |
3758 | - dImQ1n*dImQ2n*dReQ3n+dReQ1n*dReQ2n*dReQ3n); | |
3759 | // Re[Q_{3n}Q_{3n}Q_{2n}^*Q_{2n}^*Q_{2n}^*] | |
3760 | Double_t reQ3nQ3nQ2nstarQ2nstarQ2nstar = pow(dReQ2n,3.)*pow(dReQ3n,2.) | |
3761 | - 3.*dReQ2n*pow(dReQ3n,2.)*pow(dImQ2n,2.) | |
3762 | + 6.*pow(dReQ2n,2.)*dReQ3n*dImQ2n*dImQ3n | |
3763 | - 2.*dReQ3n*pow(dImQ2n,3.)*dImQ3n-pow(dReQ2n,3.)*pow(dImQ3n,2.) | |
3764 | + 3.*dReQ2n*pow(dImQ2n,2.)*pow(dImQ3n,2.); | |
3765 | // Re[Q_{4n}Q_{2n}Q_{3n}^*Q_{2n}^*Q_{n}^*] | |
3766 | Double_t reQ4nQ2nQ3nstarQ2nstarQ1nstar = (pow(dImQ2n,2.)+pow(dReQ2n,2.)) | |
3767 | * (dImQ3n*dImQ4n*dReQ1n+dImQ1n*dImQ4n*dReQ3n | |
3768 | - dImQ1n*dImQ3n*dReQ4n+dReQ1n*dReQ3n*dReQ4n); | |
3769 | // Re[Q_{3n}Q_{2n}Q_{3n}^*Q_{n}^*Q_{n}^*] | |
3770 | Double_t reQ3nQ2nQ3nstarQ1nstarQ1nstar = -(pow(dImQ3n,2.)+pow(dReQ3n,2.)) | |
3771 | * (-2.*dImQ1n*dImQ2n*dReQ1n+pow(dImQ1n,2.)*dReQ2n-pow(dReQ1n,2.)*dReQ2n); | |
3772 | // Re[Q_{3n}Q_{2n}Q_{2n}^*Q_{2n}^*Q_{n}^*] | |
3773 | Double_t reQ3nQ2nQ2nstarQ2nstarQ1nstar = (pow(dImQ2n,2.)+pow(dReQ2n,2.)) | |
3774 | * (dImQ2n*dImQ3n*dReQ1n+dImQ1n*dImQ3n*dReQ2n | |
3775 | - dImQ1n*dImQ2n*dReQ3n+dReQ1n*dReQ2n*dReQ3n); | |
3776 | // Re[Q_{5n}Q_{n}Q_{3n}^*Q_{2n}^*Q_{n}^*] | |
3777 | Double_t reQ5nQ1nQ3nstarQ2nstarQ1nstar = (pow(dImQ1n,2.)+pow(dReQ1n,2.)) | |
3778 | * (dImQ3n*dImQ5n*dReQ2n+dImQ2n*dImQ5n*dReQ3n | |
3779 | - dImQ2n*dImQ3n*dReQ5n+dReQ2n*dReQ3n*dReQ5n); | |
3780 | // Re[Q_{2n}Q_{2n}Q_{n}^*Q_{n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 3781 | Double_t reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)*dReQ2n-2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.) |
3782 | + dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dImQ2n) | |
3783 | * (pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.) | |
b84464d3 | 3784 | - dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n+pow(dImQ1n,2.)*dImQ2n); |
3785 | // Re[Q_{3n}Q_{n}Q_{n}^*Q_{n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 3786 | Double_t reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
3787 | * (pow(dReQ1n,3.)*dReQ3n-3.*dReQ1n*dReQ3n*pow(dImQ1n,2.) | |
3788 | + 3.*pow(dReQ1n,2.)*dImQ1n*dImQ3n-pow(dImQ1n,3.)*dImQ3n); | |
489d5531 | 3789 | // |Q_{2n}|^2 |Q_{n}|^4 |
b84464d3 | 3790 | Double_t dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.); |
3791 | // |Q_{3n}|^2 |Q_{2n}|^2 |Q_{n}|^2 | |
3792 | Double_t dQ3nQ2nQ1nQ3nstarQ2nstarQ1nstar = (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3793 | * (pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
3794 | // Re[Q_{2n}Q_{n}Q_{n}Q_{n}^*Q_{n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 3795 | Double_t reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) |
3796 | * (pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.) | |
53884472 | 3797 | + 2.*dReQ1n*dImQ1n*dImQ2n); |
3798 | // Re[Q_{6n}Q_{2n}^*Q_{2n}^*Q_{n}^*Q_{n}^*] | |
3799 | Double_t reQ6nQ2nstarQ2nstarQ1nstarQ1nstar = pow(dReQ1n*dReQ2n,2.)*dReQ6n-pow(dReQ2n*dImQ1n,2.)*dReQ6n | |
3800 | - 4.*dReQ1n*dReQ2n*dReQ6n*dImQ1n*dImQ2n | |
3801 | - pow(dReQ1n*dImQ2n,2.)*dReQ6n+pow(dImQ1n*dImQ2n,2.)*dReQ6n | |
3802 | + 2.*dReQ1n*pow(dReQ2n,2.)*dImQ1n*dImQ6n | |
3803 | + 2.*pow(dReQ1n,2.)*dReQ2n*dImQ2n*dImQ6n | |
3804 | - 2.*dReQ2n*pow(dImQ1n,2.)*dImQ2n*dImQ6n | |
3805 | - 2.*dReQ1n*dImQ1n*pow(dImQ2n,2.)*dImQ6n; | |
3806 | // Re[Q_{4n}Q_{1n}Q_{1n}Q_{3n}^*Q_{3n}^*] | |
3807 | Double_t reQ4nQ1nQ1nQ3nstarQ3nstar = pow(dReQ1n*dReQ3n,2.)*dReQ4n-pow(dReQ3n*dImQ1n,2.)*dReQ4n | |
3808 | + 4.*dReQ1n*dReQ3n*dReQ4n*dImQ1n*dImQ3n | |
3809 | - pow(dReQ1n*dImQ3n,2.)*dReQ4n+pow(dImQ1n*dImQ3n,2.)*dReQ4n | |
3810 | - 2.*dReQ1n*pow(dReQ3n,2.)*dImQ1n*dImQ4n | |
3811 | + 2.*pow(dReQ1n,2.)*dReQ3n*dImQ3n*dImQ4n | |
3812 | - 2.*dReQ3n*pow(dImQ1n,2.)*dImQ3n*dImQ4n | |
3813 | + 2.*dReQ1n*dImQ1n*pow(dImQ3n,2.)*dImQ4n; | |
3814 | // Re[Q_{3n}Q_{3n}Q_{2n}^*Q_{2n}^*Q_{1n}^*Q_{1n}^*] | |
3815 | Double_t reQ3nQ3nQ2nstarQ2nstarQ1nstarQ1nstar = (dReQ1n*dReQ2n*dReQ3n-dReQ2n*dReQ3n*dImQ1n-dReQ1n*dReQ3n*dImQ2n | |
3816 | - dReQ3n*dImQ1n*dImQ2n+dReQ1n*dReQ2n*dImQ3n+dReQ2n*dImQ1n*dImQ3n | |
3817 | + dReQ1n*dImQ2n*dImQ3n-dImQ1n*dImQ2n*dImQ3n)*(dReQ1n*dReQ2n*dReQ3n | |
3818 | + dReQ2n*dReQ3n*dImQ1n+dReQ1n*dReQ3n*dImQ2n-dReQ3n*dImQ1n*dImQ2n | |
3819 | - dReQ1n*dReQ2n*dImQ3n+dReQ2n*dImQ1n*dImQ3n+dReQ1n*dImQ2n*dImQ3n | |
3820 | + dImQ1n*dImQ2n*dImQ3n); | |
489d5531 | 3821 | |
b84464d3 | 3822 | // Results for multiparticle azimuthal correlations: |
489d5531 | 3823 | // 2-particle: |
b84464d3 | 3824 | Double_t two1n1n = 0.; // <cos(n(phi1-phi2))> |
3825 | Double_t two2n2n = 0.; // <cos(2n(phi1-phi2))> | |
3826 | Double_t two3n3n = 0.; // <cos(3n(phi1-phi2))> | |
3827 | Double_t two4n4n = 0.; // <cos(4n(phi1-phi2))> | |
489d5531 | 3828 | if(dMult>1) |
3829 | { | |
3830 | two1n1n = (pow(dReQ1n,2.)+pow(dImQ1n,2.)-dMult)/(dMult*(dMult-1.)); | |
3831 | two2n2n = (pow(dReQ2n,2.)+pow(dImQ2n,2.)-dMult)/(dMult*(dMult-1.)); | |
3832 | two3n3n = (pow(dReQ3n,2.)+pow(dImQ3n,2.)-dMult)/(dMult*(dMult-1.)); | |
3833 | two4n4n = (pow(dReQ4n,2.)+pow(dImQ4n,2.)-dMult)/(dMult*(dMult-1.)); | |
b84464d3 | 3834 | // Average 2-particle correlations for single event: |
489d5531 | 3835 | fIntFlowCorrelationsAllEBE->SetBinContent(1,two1n1n); |
3836 | fIntFlowCorrelationsAllEBE->SetBinContent(2,two2n2n); | |
3837 | fIntFlowCorrelationsAllEBE->SetBinContent(3,two3n3n); | |
b84464d3 | 3838 | fIntFlowCorrelationsAllEBE->SetBinContent(4,two4n4n); |
3839 | // Average 2-particle correlations for all events: | |
3840 | fIntFlowCorrelationsAllPro->Fill(0.5,two1n1n,dMult*(dMult-1.)); | |
3841 | fIntFlowCorrelationsAllPro->Fill(1.5,two2n2n,dMult*(dMult-1.)); | |
3842 | fIntFlowCorrelationsAllPro->Fill(2.5,two3n3n,dMult*(dMult-1.)); | |
3843 | fIntFlowCorrelationsAllPro->Fill(3.5,two4n4n,dMult*(dMult-1.)); | |
3844 | // Store separetately <2>: | |
3845 | fIntFlowCorrelationsEBE->SetBinContent(1,two1n1n); // <2> | |
3846 | // Testing other multiplicity weights: | |
489d5531 | 3847 | Double_t mWeight2p = 0.; |
df23c5ae | 3848 | if(fMultiplicityWeight->Contains("combinations")) |
489d5531 | 3849 | { |
3850 | mWeight2p = dMult*(dMult-1.); | |
df23c5ae | 3851 | } else if(fMultiplicityWeight->Contains("unit")) |
489d5531 | 3852 | { |
3853 | mWeight2p = 1.; | |
df23c5ae | 3854 | } else if(fMultiplicityWeight->Contains("multiplicity")) |
489d5531 | 3855 | { |
3856 | mWeight2p = dMult; | |
b84464d3 | 3857 | } |
489d5531 | 3858 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(1,mWeight2p); // eW_<2> |
3859 | fIntFlowCorrelationsPro->Fill(0.5,two1n1n,mWeight2p); | |
b40a910e | 3860 | fIntFlowSquaredCorrelationsPro->Fill(0.5,two1n1n*two1n1n,mWeight2p); |
3861 | if(fCalculateCumulantsVsM) | |
3862 | { | |
1db7eced | 3863 | if(fFillProfilesVsMUsingWeights) |
3864 | { | |
3865 | fIntFlowCorrelationsVsMPro[0]->Fill(dMultiplicityBin,two1n1n,mWeight2p); | |
3866 | fIntFlowSquaredCorrelationsVsMPro[0]->Fill(dMultiplicityBin,two1n1n*two1n1n,mWeight2p); | |
3867 | } else | |
3868 | { | |
3869 | fIntFlowCorrelationsVsMPro[0]->Fill(dMultiplicityBin,two1n1n); | |
3870 | fIntFlowSquaredCorrelationsVsMPro[0]->Fill(dMultiplicityBin,two1n1n*two1n1n); | |
3871 | } | |
3872 | } // end of if(fCalculateCumulantsVsM) | |
3435cacb | 3873 | if(fCalculateAllCorrelationsVsM) |
3874 | { | |
3842bdcd | 3875 | fIntFlowCorrelationsAllVsMPro[0]->Fill(dMultiplicityBin,two1n1n,mWeight2p); |
3876 | fIntFlowCorrelationsAllVsMPro[1]->Fill(dMultiplicityBin,two2n2n,mWeight2p); | |
3877 | fIntFlowCorrelationsAllVsMPro[2]->Fill(dMultiplicityBin,two3n3n,mWeight2p); | |
3878 | fIntFlowCorrelationsAllVsMPro[3]->Fill(dMultiplicityBin,two4n4n,mWeight2p); | |
d9e6d8bb | 3879 | } |
3880 | if(fStoreControlHistograms) | |
3881 | { | |
3882 | fCorrelation2468VsMult[0]->Fill(dMultiplicityBin,two1n1n); | |
3883 | } | |
489d5531 | 3884 | } // end of if(dMult>1) |
3885 | ||
3886 | // 3-particle: | |
b84464d3 | 3887 | Double_t three2n1n1n = 0.; // <cos(n(2*phi1-phi2-phi3))> |
3888 | Double_t three3n2n1n = 0.; // <cos(n(3*phi1-2*phi2-phi3))> | |
3889 | Double_t three4n2n2n = 0.; // <cos(n(4*phi1-2*phi2-2*phi3))> | |
3890 | Double_t three4n3n1n = 0.; // <cos(n(4*phi1-3*phi2-phi3))> | |
489d5531 | 3891 | if(dMult>2) |
3892 | { | |
3893 | three2n1n1n = (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3894 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult) | |
3895 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3896 | three3n2n1n = (reQ3nQ2nstarQ1nstar-(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3897 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3898 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
3899 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3900 | three4n2n2n = (reQ4nQ2nstarQ2nstar-2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3901 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*dMult) | |
3902 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3903 | three4n3n1n = (reQ4nQ3nstarQ1nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3904 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3905 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
b84464d3 | 3906 | / (dMult*(dMult-1.)*(dMult-2.)); |
3907 | // Average 3-particle correlations for single event: | |
489d5531 | 3908 | fIntFlowCorrelationsAllEBE->SetBinContent(6,three2n1n1n); |
3909 | fIntFlowCorrelationsAllEBE->SetBinContent(7,three3n2n1n); | |
3910 | fIntFlowCorrelationsAllEBE->SetBinContent(8,three4n2n2n); | |
3911 | fIntFlowCorrelationsAllEBE->SetBinContent(9,three4n3n1n); | |
b84464d3 | 3912 | // Average 3-particle correlations for all events: |
489d5531 | 3913 | fIntFlowCorrelationsAllPro->Fill(5.5,three2n1n1n,dMult*(dMult-1.)*(dMult-2.)); |
3914 | fIntFlowCorrelationsAllPro->Fill(6.5,three3n2n1n,dMult*(dMult-1.)*(dMult-2.)); | |
3915 | fIntFlowCorrelationsAllPro->Fill(7.5,three4n2n2n,dMult*(dMult-1.)*(dMult-2.)); | |
3435cacb | 3916 | fIntFlowCorrelationsAllPro->Fill(8.5,three4n3n1n,dMult*(dMult-1.)*(dMult-2.)); |
b84464d3 | 3917 | // Average 3-particle correlations vs M for all events: |
3435cacb | 3918 | if(fCalculateAllCorrelationsVsM) |
3919 | { | |
3842bdcd | 3920 | fIntFlowCorrelationsAllVsMPro[5]->Fill(dMultiplicityBin,three2n1n1n,dMult*(dMult-1.)*(dMult-2.)); |
3921 | fIntFlowCorrelationsAllVsMPro[6]->Fill(dMultiplicityBin,three3n2n1n,dMult*(dMult-1.)*(dMult-2.)); | |
3922 | fIntFlowCorrelationsAllVsMPro[7]->Fill(dMultiplicityBin,three4n2n2n,dMult*(dMult-1.)*(dMult-2.)); | |
3923 | fIntFlowCorrelationsAllVsMPro[8]->Fill(dMultiplicityBin,three4n3n1n,dMult*(dMult-1.)*(dMult-2.)); | |
3435cacb | 3924 | } |
489d5531 | 3925 | } // end of if(dMult>2) |
3926 | ||
3927 | // 4-particle: | |
b84464d3 | 3928 | Double_t four1n1n1n1n = 0.; // <cos(n(phi1+phi2-phi3-phi4))> |
3929 | Double_t four2n2n2n2n = 0.; // <cos(2n(phi1+phi2-phi3-phi4))> | |
3930 | Double_t four2n1n2n1n = 0.; // <cos(n(2*phi1+phi2-2*phi3-phi4))> | |
3931 | Double_t four3n1n1n1n = 0.; // <cos(n(3*phi1-phi2-phi3-phi4))> | |
3932 | Double_t four4n2n1n1n = 0.; // <cos(n(4*phi1-2*phi2-phi3-phi4))> | |
3933 | Double_t four3n1n2n2n = 0.; // <cos(n(3*phi1+phi2-2*phi3-2*phi4))> | |
3934 | Double_t four3n1n3n1n = 0.; // <cos(n(3*phi1+phi2-3*phi3-phi4))> | |
489d5531 | 3935 | if(dMult>3) |
3936 | { | |
3937 | four1n1n1n1n = (2.*dMult*(dMult-3.)+pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ1n,2.) | |
3938 | + pow(dImQ1n,2.))-2.*reQ2nQ1nstarQ1nstar+(pow(dReQ2n,2.)+pow(dImQ2n,2.))) | |
3939 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
3940 | four2n2n2n2n = (2.*dMult*(dMult-3.)+pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ2n,2.) | |
3941 | + pow(dImQ2n,2.))-2.*reQ4nQ2nstarQ2nstar+(pow(dReQ4n,2.)+pow(dImQ4n,2.))) | |
3942 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
3943 | four2n1n2n1n = (dQ2nQ1nQ2nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar-2.*reQ2nQ1nstarQ1nstar) | |
3944 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3945 | - ((dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3946 | + (dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-(pow(dReQ3n,2.)+pow(dImQ3n,2.))) | |
3947 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3948 | + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3949 | four3n1n1n1n = (reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar-3.*reQ2nQ1nstarQ1nstar |
3950 | + 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
489d5531 | 3951 | + 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) |
3952 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3953 | four4n2n1n1n = (reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar-2.*reQ3nQ2nstarQ1nstar) | |
3954 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3955 | - (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3956 | - 3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
3957 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3958 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3959 | four3n1n2n2n = (reQ3nQ1nQ2nstarQ2nstar-reQ4nQ2nstarQ2nstar-reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar) |
489d5531 | 3960 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
b84464d3 | 3961 | - (2.*reQ2nQ1nstarQ1nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) |
489d5531 | 3962 | - 4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) |
3963 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3964 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3965 | four3n1n3n1n = ((pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
b84464d3 | 3966 | - 2.*reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar |
3967 | + pow(dReQ4n,2.)+pow(dImQ4n,2.)-(dMult-4.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3968 | + pow(dReQ2n,2.)+pow(dImQ2n,2.)-(dMult-4.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3969 | + dMult*(dMult-6.)) | |
3970 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3971 | // Average 4-particle correlations for single event: | |
489d5531 | 3972 | fIntFlowCorrelationsAllEBE->SetBinContent(11,four1n1n1n1n); |
3973 | fIntFlowCorrelationsAllEBE->SetBinContent(12,four2n1n2n1n); | |
3974 | fIntFlowCorrelationsAllEBE->SetBinContent(13,four2n2n2n2n); | |
3975 | fIntFlowCorrelationsAllEBE->SetBinContent(14,four3n1n1n1n); | |
3976 | fIntFlowCorrelationsAllEBE->SetBinContent(15,four3n1n3n1n); | |
3977 | fIntFlowCorrelationsAllEBE->SetBinContent(16,four3n1n2n2n); | |
b84464d3 | 3978 | fIntFlowCorrelationsAllEBE->SetBinContent(17,four4n2n1n1n); |
3979 | // Average 4-particle correlations for all events: | |
489d5531 | 3980 | fIntFlowCorrelationsAllPro->Fill(10.5,four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
3981 | fIntFlowCorrelationsAllPro->Fill(11.5,four2n1n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3982 | fIntFlowCorrelationsAllPro->Fill(12.5,four2n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3983 | fIntFlowCorrelationsAllPro->Fill(13.5,four3n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3984 | fIntFlowCorrelationsAllPro->Fill(14.5,four3n1n3n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3985 | fIntFlowCorrelationsAllPro->Fill(15.5,four3n1n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3986 | fIntFlowCorrelationsAllPro->Fill(16.5,four4n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
3987 | // Average 4-particle correlations vs M for all events: | |
3435cacb | 3988 | if(fCalculateAllCorrelationsVsM) |
3989 | { | |
3842bdcd | 3990 | fIntFlowCorrelationsAllVsMPro[10]->Fill(dMultiplicityBin,four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
3991 | fIntFlowCorrelationsAllVsMPro[11]->Fill(dMultiplicityBin,four2n1n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3992 | fIntFlowCorrelationsAllVsMPro[12]->Fill(dMultiplicityBin,four2n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3993 | fIntFlowCorrelationsAllVsMPro[13]->Fill(dMultiplicityBin,four3n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3994 | fIntFlowCorrelationsAllVsMPro[14]->Fill(dMultiplicityBin,four3n1n3n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3995 | fIntFlowCorrelationsAllVsMPro[15]->Fill(dMultiplicityBin,four3n1n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3996 | fIntFlowCorrelationsAllVsMPro[16]->Fill(dMultiplicityBin,four4n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3997 | } |
3998 | // Store separetately <4>: | |
489d5531 | 3999 | fIntFlowCorrelationsEBE->SetBinContent(2,four1n1n1n1n); // <4> |
b84464d3 | 4000 | // Testing other multiplicity weights: |
489d5531 | 4001 | Double_t mWeight4p = 0.; |
df23c5ae | 4002 | if(fMultiplicityWeight->Contains("combinations")) |
489d5531 | 4003 | { |
4004 | mWeight4p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
df23c5ae | 4005 | } else if(fMultiplicityWeight->Contains("unit")) |
489d5531 | 4006 | { |
4007 | mWeight4p = 1.; | |
df23c5ae | 4008 | } else if(fMultiplicityWeight->Contains("multiplicity")) |
489d5531 | 4009 | { |
4010 | mWeight4p = dMult; | |
b84464d3 | 4011 | } |
489d5531 | 4012 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(2,mWeight4p); // eW_<4> |
4013 | fIntFlowCorrelationsPro->Fill(1.5,four1n1n1n1n,mWeight4p); | |
b40a910e | 4014 | fIntFlowSquaredCorrelationsPro->Fill(1.5,four1n1n1n1n*four1n1n1n1n,mWeight4p); |
4015 | if(fCalculateCumulantsVsM) | |
4016 | { | |
1db7eced | 4017 | if(fFillProfilesVsMUsingWeights) |
4018 | { | |
4019 | fIntFlowCorrelationsVsMPro[1]->Fill(dMultiplicityBin,four1n1n1n1n,mWeight4p); | |
4020 | fIntFlowSquaredCorrelationsVsMPro[1]->Fill(dMultiplicityBin,four1n1n1n1n*four1n1n1n1n,mWeight4p); | |
4021 | } else | |
4022 | { | |
4023 | fIntFlowCorrelationsVsMPro[1]->Fill(dMultiplicityBin,four1n1n1n1n); | |
4024 | fIntFlowSquaredCorrelationsVsMPro[1]->Fill(dMultiplicityBin,four1n1n1n1n*four1n1n1n1n); | |
4025 | } | |
4026 | } // end of if(fCalculateCumulantsVsM) | |
d9e6d8bb | 4027 | if(fStoreControlHistograms) |
4028 | { | |
4029 | fCorrelation2468VsMult[1]->Fill(dMultiplicityBin,four1n1n1n1n); | |
1db7eced | 4030 | fCorrelationProduct2468VsMult[0]->Fill(dMultiplicityBin,two1n1n*four1n1n1n1n); |
d9e6d8bb | 4031 | } |
489d5531 | 4032 | } // end of if(dMult>3) |
4033 | ||
4034 | // 5-particle: | |
b84464d3 | 4035 | Double_t five2n1n1n1n1n = 0.; // <cos(n(2*phi1+phi2-phi3-phi4-phi5))> |
4036 | Double_t five2n2n2n1n1n = 0.; // <cos(n(2*phi1+2*phi2-2*phi3-phi4-phi5))> | |
4037 | Double_t five3n1n2n1n1n = 0.; // <cos(n(3*phi1+phi2-2*phi3-phi4-phi5))> | |
4038 | Double_t five4n1n1n1n1n = 0.; // <cos(n(4*phi1-phi2-phi3-phi4-phi5))> | |
489d5531 | 4039 | if(dMult>4) |
b84464d3 | 4040 | { |
4041 | five2n1n1n1n1n = (reQ2nQ1nQ1nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar+5.*reQ3nQ2nstarQ1nstar | |
4042 | - 3.*(dMult-5.)*reQ2nQ1nstarQ1nstar-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4043 | - 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4044 | + 3.*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4045 | - 3.*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
4046 | + 6.*(2.*dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult*(dMult-4.)) | |
489d5531 | 4047 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
b84464d3 | 4048 | five2n2n2n1n1n = (reQ2nQ2nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ3nQ1nQ2nstarQ2nstar |
4049 | + 3.*reQ4nQ2nstarQ2nstar+8.*reQ3nQ2nstarQ1nstar+2.*reQ4nQ3nstarQ1nstar | |
4050 | - 2.*(dMult-6.)*reQ2nQ1nstarQ1nstar | |
4051 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4052 | - pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.) | |
4053 | + 2.*(3.*dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4054 | - 4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4055 | + 4.*(dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*dMult*(dMult-6.)) | |
489d5531 | 4056 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
b84464d3 | 4057 | five4n1n1n1n1n = (reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ4nQ2nstarQ1nstarQ1nstar-4.*reQ3nQ1nstarQ1nstarQ1nstar |
4058 | + 8.*reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar+12.*reQ3nQ2nstarQ1nstar+12.*reQ2nQ1nstarQ1nstar | |
4059 | - 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-8.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4060 | - 12.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-24.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+24.*dMult) | |
4061 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4062 | five3n1n2n1n1n = (reQ3nQ1nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar | |
4063 | - reQ3nQ1nQ2nstarQ2nstar+4.*reQ4nQ3nstarQ1nstar+reQ4nQ2nstarQ2nstar | |
4064 | - (2.*dMult-13.)*reQ3nQ2nstarQ1nstar+7.*reQ2nQ1nstarQ1nstar | |
4065 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
4066 | + 2.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4067 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4068 | + 2.*(dMult-6.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
489d5531 | 4069 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
4070 | - pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
b84464d3 | 4071 | + 2.*(3.*dMult-11.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*dMult*(dMult-6.)) |
4072 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4073 | // Average 5-particle correlations for single event: | |
489d5531 | 4074 | fIntFlowCorrelationsAllEBE->SetBinContent(19,five2n1n1n1n1n); |
4075 | fIntFlowCorrelationsAllEBE->SetBinContent(20,five2n2n2n1n1n); | |
4076 | fIntFlowCorrelationsAllEBE->SetBinContent(21,five3n1n2n1n1n); | |
b84464d3 | 4077 | fIntFlowCorrelationsAllEBE->SetBinContent(22,five4n1n1n1n1n); |
4078 | // Average 5-particle correlations for all events: | |
489d5531 | 4079 | fIntFlowCorrelationsAllPro->Fill(18.5,five2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
4080 | fIntFlowCorrelationsAllPro->Fill(19.5,five2n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4081 | fIntFlowCorrelationsAllPro->Fill(20.5,five3n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
b84464d3 | 4082 | fIntFlowCorrelationsAllPro->Fill(21.5,five4n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
4083 | // Average 5-particle correlations vs M for all events: | |
3435cacb | 4084 | if(fCalculateAllCorrelationsVsM) |
4085 | { | |
3842bdcd | 4086 | fIntFlowCorrelationsAllVsMPro[18]->Fill(dMultiplicityBin,five2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
4087 | fIntFlowCorrelationsAllVsMPro[19]->Fill(dMultiplicityBin,five2n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4088 | fIntFlowCorrelationsAllVsMPro[20]->Fill(dMultiplicityBin,five3n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4089 | fIntFlowCorrelationsAllVsMPro[21]->Fill(dMultiplicityBin,five4n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3435cacb | 4090 | } |
489d5531 | 4091 | } // end of if(dMult>4) |
4092 | ||
4093 | // 6-particle: | |
b84464d3 | 4094 | Double_t six1n1n1n1n1n1n = 0.; // <cos(n(phi1+phi2+phi3-phi4-phi5-phi6))> |
4095 | Double_t six2n2n1n1n1n1n = 0.; // <cos(n(2*phi1+2*phi2-phi3-phi4-phi5-phi6))> | |
4096 | Double_t six3n1n1n1n1n1n = 0.; // <cos(n(3*phi1+phi2-phi3-phi4-phi5-phi6))> | |
4097 | Double_t six2n1n1n2n1n1n = 0.; // <cos(n(2*phi1+phi2+phi3-2*phi4-phi5-phi6))> | |
489d5531 | 4098 | if(dMult>5) |
4099 | { | |
b84464d3 | 4100 | six1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),3.)-6.*reQ2nQ1nQ1nstarQ1nstarQ1nstar |
4101 | + 4.*reQ3nQ1nstarQ1nstarQ1nstar-12.*reQ3nQ2nstarQ1nstar+18.*(dMult-4.)*reQ2nQ1nstarQ1nstar | |
4102 | + 9.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4103 | + 4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))-9.*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4104 | - 9.*(dMult-4.)*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
4105 | + 18.*(dMult*dMult-7.*dMult+10.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4106 | - 6.*dMult*(dMult*dMult-9.*dMult+20.)) | |
4107 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
4108 | six2n1n1n2n1n1n = (dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar-4.*reQ3nQ1nQ2nstarQ1nstarQ1nstar | |
4109 | - 4.*reQ2nQ1nQ1nstarQ1nstarQ1nstar-2.*reQ2nQ2nQ2nstarQ1nstarQ1nstar | |
4110 | + 4.*reQ4nQ2nstarQ1nstarQ1nstar+4.*reQ3nQ1nQ2nstarQ2nstar+4.*reQ3nQ1nstarQ1nstarQ1nstar | |
4111 | - 8.*reQ4nQ3nstarQ1nstar-4.*reQ4nQ2nstarQ2nstar+4.*(2.*dMult-13.)*reQ3nQ2nstarQ1nstar | |
4112 | + 2.*(7.*dMult-34.)*reQ2nQ1nstarQ1nstar+4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4113 | - 4.*(dMult-7.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4114 | + 4.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-4.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4115 | + pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)+(2.*dMult*dMult-27.*dMult+76.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4116 | - (dMult-12.)*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
4117 | + 4.*(dMult*dMult-15.*dMult+34.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4118 | - 2.*dMult*(dMult*dMult-17.*dMult+60.)) | |
4119 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
4120 | six2n2n1n1n1n1n = (reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ2nQ2nQ2nstarQ1nstarQ1nstar-reQ4nQ1nstarQ1nstarQ1nstarQ1nstar | |
4121 | - 8.*reQ2nQ1nQ1nstarQ1nstarQ1nstar+8.*reQ3nQ1nstarQ1nstarQ1nstar+6.*reQ4nQ2nstarQ1nstarQ1nstar | |
4122 | + 8.*reQ3nQ1nQ2nstarQ2nstar-40.*reQ3nQ2nstarQ1nstar-8.*reQ4nQ3nstarQ1nstar-9.*reQ4nQ2nstarQ2nstar | |
4123 | + 24.*(dMult-4.)*reQ2nQ1nstarQ1nstar+24.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4124 | + 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+16.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4125 | + 3.*pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)-12.*(2.*dMult-7.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4126 | + 12.*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)-48.*(dMult-3.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4127 | + 24.*dMult*(dMult-5.)) | |
4128 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
4129 | six3n1n1n1n1n1n = (reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ3nQ1nQ2nstarQ1nstarQ1nstar+6.*reQ4nQ2nstarQ1nstarQ1nstar | |
4130 | - reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-4.*reQ2nQ1nQ1nstarQ1nstarQ1nstar+3.*reQ3nQ1nQ2nstarQ2nstar | |
4131 | - 4.*(dMult-5.)*reQ3nQ1nstarQ1nstarQ1nstar-14.*reQ4nQ3nstarQ1nstar | |
4132 | - 3.*reQ4nQ2nstarQ2nstar+4.*(3.*dMult-17.)*reQ3nQ2nstarQ1nstar+12.*(dMult-6.)*reQ2nQ1nstarQ1nstar | |
4133 | + 12.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4134 | + 8.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4135 | + 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-8.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4136 | - 12.*(dMult-5.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-48.*(dMult-3.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4137 | + 12.*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)+24.*dMult*(dMult-5.)) | |
4138 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
4139 | // Average 6-particle correlations for single event: | |
489d5531 | 4140 | fIntFlowCorrelationsAllEBE->SetBinContent(24,six1n1n1n1n1n1n); |
4141 | fIntFlowCorrelationsAllEBE->SetBinContent(25,six2n1n1n2n1n1n); | |
4142 | fIntFlowCorrelationsAllEBE->SetBinContent(26,six2n2n1n1n1n1n); | |
4143 | fIntFlowCorrelationsAllEBE->SetBinContent(27,six3n1n1n1n1n1n); | |
b84464d3 | 4144 | // Average 6-particle correlations for all events: |
489d5531 | 4145 | fIntFlowCorrelationsAllPro->Fill(23.5,six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
4146 | fIntFlowCorrelationsAllPro->Fill(24.5,six2n1n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
4147 | fIntFlowCorrelationsAllPro->Fill(25.5,six2n2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
4148 | fIntFlowCorrelationsAllPro->Fill(26.5,six3n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
b84464d3 | 4149 | // Average 6-particle correlations vs M for all events: |
3435cacb | 4150 | if(fCalculateAllCorrelationsVsM) |
4151 | { | |
3842bdcd | 4152 | fIntFlowCorrelationsAllVsMPro[23]->Fill(dMultiplicityBin,six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
4153 | fIntFlowCorrelationsAllVsMPro[24]->Fill(dMultiplicityBin,six2n1n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
4154 | fIntFlowCorrelationsAllVsMPro[25]->Fill(dMultiplicityBin,six2n2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
4155 | fIntFlowCorrelationsAllVsMPro[26]->Fill(dMultiplicityBin,six3n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3435cacb | 4156 | } |
b84464d3 | 4157 | // Store separetately <6>: |
489d5531 | 4158 | fIntFlowCorrelationsEBE->SetBinContent(3,six1n1n1n1n1n1n); // <6> |
b84464d3 | 4159 | // Testing other multiplicity weights: |
489d5531 | 4160 | Double_t mWeight6p = 0.; |
df23c5ae | 4161 | if(fMultiplicityWeight->Contains("combinations")) |
489d5531 | 4162 | { |
4163 | mWeight6p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.); | |
df23c5ae | 4164 | } else if(fMultiplicityWeight->Contains("unit")) |
489d5531 | 4165 | { |
4166 | mWeight6p = 1.; | |
df23c5ae | 4167 | } else if(fMultiplicityWeight->Contains("multiplicity")) |
489d5531 | 4168 | { |
4169 | mWeight6p = dMult; | |
4170 | } | |
489d5531 | 4171 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(3,mWeight6p); // eW_<6> |
4172 | fIntFlowCorrelationsPro->Fill(2.5,six1n1n1n1n1n1n,mWeight6p); | |
b40a910e | 4173 | fIntFlowSquaredCorrelationsPro->Fill(2.5,six1n1n1n1n1n1n*six1n1n1n1n1n1n,mWeight6p); |
4174 | if(fCalculateCumulantsVsM) | |
4175 | { | |
1db7eced | 4176 | if(fFillProfilesVsMUsingWeights) |
4177 | { | |
4178 | fIntFlowCorrelationsVsMPro[2]->Fill(dMultiplicityBin,six1n1n1n1n1n1n,mWeight6p); | |
4179 | fIntFlowSquaredCorrelationsVsMPro[2]->Fill(dMultiplicityBin,six1n1n1n1n1n1n*six1n1n1n1n1n1n,mWeight6p); | |
4180 | } else | |
4181 | { | |
4182 | fIntFlowCorrelationsVsMPro[2]->Fill(dMultiplicityBin,six1n1n1n1n1n1n); | |
4183 | fIntFlowSquaredCorrelationsVsMPro[2]->Fill(dMultiplicityBin,six1n1n1n1n1n1n*six1n1n1n1n1n1n); | |
4184 | } | |
4185 | } // end of if(fCalculateCumulantsVsM) | |
d9e6d8bb | 4186 | if(fStoreControlHistograms) |
4187 | { | |
4188 | fCorrelation2468VsMult[2]->Fill(dMultiplicityBin,six1n1n1n1n1n1n); | |
4189 | } | |
489d5531 | 4190 | } // end of if(dMult>5) |
4191 | ||
4192 | // 7-particle: | |
b84464d3 | 4193 | Double_t seven2n1n1n1n1n1n1n = 0.; // <cos(n(2*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> |
489d5531 | 4194 | if(dMult>6) |
4195 | { | |
b84464d3 | 4196 | seven2n1n1n1n1n1n1n = (reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-4.*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),3.) |
4197 | - reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar-2.*reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar | |
4198 | + 9.*reQ2nQ2nQ2nstarQ1nstarQ1nstar+20.*reQ3nQ1nQ2nstarQ1nstarQ1nstar | |
4199 | + 2.*reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-8.*(dMult-8.)*reQ2nQ1nQ1nstarQ1nstarQ1nstar | |
4200 | - 18.*reQ4nQ2nstarQ1nstarQ1nstar-14.*reQ3nQ1nQ2nstarQ2nstar | |
4201 | + 8.*(dMult-7.)*reQ3nQ1nstarQ1nstarQ1nstar+28.*reQ4nQ3nstarQ1nstar | |
4202 | + 12.*reQ4nQ2nstarQ2nstar-8.*(5.*dMult-31.)*reQ3nQ2nstarQ1nstar | |
4203 | + 12.*(dMult*dMult-15.*dMult+46.)*reQ2nQ1nstarQ1nstar | |
4204 | - 16.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4205 | - 6.*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),2.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4206 | - 3.*pow(pow(dReQ2n,2.)+pow(dImQ2n,2.),2.) | |
4207 | + 12.*(2.*dMult-13.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4208 | - 12.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+16.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4209 | - 12.*(dMult-8.)*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4210 | + 12.*(3.*dMult-14.)*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),2.) | |
4211 | - 24.*(3.*dMult-7.)*(dMult-6.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4212 | + 24.*dMult*(dMult-5.)*(dMult-6.)) | |
4213 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)); | |
4214 | // Average 7-particle correlations for single event: | |
4215 | fIntFlowCorrelationsAllEBE->SetBinContent(29,seven2n1n1n1n1n1n1n); | |
4216 | // Average 7-particle correlations for all events: | |
4217 | fIntFlowCorrelationsAllPro->Fill(28.5,seven2n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) | |
4218 | *(dMult-4.)*(dMult-5.)*(dMult-6.)); | |
4219 | // Average 7-particle correlations vs M for all events: | |
3435cacb | 4220 | if(fCalculateAllCorrelationsVsM) |
4221 | { | |
3842bdcd | 4222 | fIntFlowCorrelationsAllVsMPro[28]->Fill(dMultiplicityBin,seven2n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) |
b84464d3 | 4223 | *(dMult-4.)*(dMult-5.)*(dMult-6.)); |
3435cacb | 4224 | } |
489d5531 | 4225 | } // end of if(dMult>6) |
4226 | ||
4227 | // 8-particle: | |
b84464d3 | 4228 | Double_t eight1n1n1n1n1n1n1n1n = 0.; // <cos(n(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> |
489d5531 | 4229 | if(dMult>7) |
b84464d3 | 4230 | { |
4231 | eight1n1n1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),4.)-12.*reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar | |
4232 | + 16.*reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar+6.*reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar | |
4233 | - 12.*reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-36.*reQ2nQ2nQ2nstarQ1nstarQ1nstar | |
4234 | - 96.*reQ3nQ1nQ2nstarQ1nstarQ1nstar | |
4235 | + 72.*reQ4nQ2nstarQ1nstarQ1nstar+48.*reQ3nQ1nQ2nstarQ2nstar | |
4236 | - 64.*(dMult-6.)*reQ3nQ1nstarQ1nstarQ1nstar | |
4237 | + 96.*(dMult-6.)*reQ2nQ1nQ1nstarQ1nstarQ1nstar | |
4238 | - 96.*reQ4nQ3nstarQ1nstar-36.*reQ4nQ2nstarQ2nstar | |
4239 | + 192.*(dMult-6.)*reQ3nQ2nstarQ1nstar | |
4240 | - 144.*(dMult-7.)*(dMult-4.)*reQ2nQ1nstarQ1nstar | |
4241 | + 64.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4242 | - 144.*(dMult-6.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4243 | + 72.*(dMult-7.)*(dMult-4.)*(pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4244 | - 96.*(dMult-7.)*(dMult-6.)*(dMult-2.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4245 | + 36.*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),2.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4246 | + 9.*pow(pow(dReQ2n,2.)+pow(dImQ2n,2.),2.) | |
4247 | - 64.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4248 | + 36.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
4249 | - 16.*(dMult-6.)*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),3.) | |
4250 | + 24.*dMult*(dMult-7.)*(dMult-6.)*(dMult-5.)) | |
4251 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); | |
4252 | // Average 8-particle correlations for single event: | |
4253 | fIntFlowCorrelationsAllEBE->SetBinContent(31,eight1n1n1n1n1n1n1n1n); | |
4254 | // Average 8-particle correlations for all events: | |
4255 | fIntFlowCorrelationsAllPro->Fill(30.5,eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) | |
4256 | *(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); | |
4257 | // Average 8-particle correlations vs M for all events: | |
3435cacb | 4258 | if(fCalculateAllCorrelationsVsM) |
4259 | { | |
3842bdcd | 4260 | fIntFlowCorrelationsAllVsMPro[30]->Fill(dMultiplicityBin,eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) |
b84464d3 | 4261 | *(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); |
4262 | } | |
4263 | // Store separetately <8>: | |
489d5531 | 4264 | fIntFlowCorrelationsEBE->SetBinContent(4,eight1n1n1n1n1n1n1n1n); // <8> |
b84464d3 | 4265 | // Testing other multiplicity weights: |
489d5531 | 4266 | Double_t mWeight8p = 0.; |
df23c5ae | 4267 | if(fMultiplicityWeight->Contains("combinations")) |
489d5531 | 4268 | { |
4269 | mWeight8p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.); | |
df23c5ae | 4270 | } else if(fMultiplicityWeight->Contains("unit")) |
489d5531 | 4271 | { |
4272 | mWeight8p = 1.; | |
df23c5ae | 4273 | } else if(fMultiplicityWeight->Contains("multiplicity")) |
489d5531 | 4274 | { |
4275 | mWeight8p = dMult; | |
b84464d3 | 4276 | } |
489d5531 | 4277 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(4,mWeight8p); // eW_<8> |
b40a910e | 4278 | fIntFlowCorrelationsPro->Fill(3.5,eight1n1n1n1n1n1n1n1n,mWeight8p); |
4279 | fIntFlowSquaredCorrelationsPro->Fill(3.5,eight1n1n1n1n1n1n1n1n*eight1n1n1n1n1n1n1n1n,mWeight8p); | |
4280 | if(fCalculateCumulantsVsM) | |
4281 | { | |
1db7eced | 4282 | if(fFillProfilesVsMUsingWeights) |
4283 | { | |
4284 | fIntFlowCorrelationsVsMPro[3]->Fill(dMultiplicityBin,eight1n1n1n1n1n1n1n1n,mWeight8p); | |
4285 | fIntFlowSquaredCorrelationsVsMPro[3]->Fill(dMultiplicityBin,eight1n1n1n1n1n1n1n1n*eight1n1n1n1n1n1n1n1n,mWeight8p); | |
4286 | } else | |
4287 | { | |
4288 | fIntFlowCorrelationsVsMPro[3]->Fill(dMultiplicityBin,eight1n1n1n1n1n1n1n1n); | |
4289 | fIntFlowSquaredCorrelationsVsMPro[3]->Fill(dMultiplicityBin,eight1n1n1n1n1n1n1n1n*eight1n1n1n1n1n1n1n1n); | |
4290 | } | |
4291 | } // end of if(fCalculateCumulantsVsM) | |
d9e6d8bb | 4292 | if(fStoreControlHistograms) |
4293 | { | |
4294 | fCorrelation2468VsMult[3]->Fill(dMultiplicityBin,eight1n1n1n1n1n1n1n1n); | |
1db7eced | 4295 | } // end of if(fStoreControlHistograms) |
489d5531 | 4296 | } // end of if(dMult>7) |
4297 | ||
b84464d3 | 4298 | // EXTRA correlations for v3{5} study: |
8ed4edc7 | 4299 | // 4-particle: |
b84464d3 | 4300 | Double_t four4n2n3n3n = 0.; // <cos(n(4*phi1+2*phi2-3*phi3-3*phi4))> |
8ed4edc7 | 4301 | if(dMult>3.) |
4302 | { | |
11d3e40e | 4303 | four4n2n3n3n = (reQ4nQ2nQ3nstarQ3nstar-reQ6nQ4nstarQ2nstar-reQ6nQ3nstarQ3nstar |
4304 | - 2.*reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar | |
4305 | + (pow(dReQ6n,2.)+pow(dImQ6n,2.))+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
4306 | + 2.*(2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4307 | + (pow(dReQ1n,2.)+pow(dImQ1n,2.))-3.*dMult)) | |
b84464d3 | 4308 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
8ed4edc7 | 4309 | fIntFlowCorrelationsAllPro->Fill(32.5,four4n2n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
b84464d3 | 4310 | // Average 4-particle correlations vs M for all events: |
3435cacb | 4311 | if(fCalculateAllCorrelationsVsM) |
4312 | { | |
3842bdcd | 4313 | fIntFlowCorrelationsAllVsMPro[32]->Fill(dMultiplicityBin,four4n2n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
3435cacb | 4314 | } |
11d3e40e | 4315 | } // end of if(dMult>3.) |
8ed4edc7 | 4316 | |
4317 | // 5-particle: | |
b84464d3 | 4318 | Double_t five3n3n2n2n2n = 0.; // <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-2*phi5))> |
8ed4edc7 | 4319 | if(dMult>4.) |
4320 | { | |
b84464d3 | 4321 | five3n3n2n2n2n = (reQ3nQ3nQ2nstarQ2nstarQ2nstar-reQ6nQ2nstarQ2nstarQ2nstar-3.*reQ4nQ2nQ3nstarQ3nstar |
4322 | - 6.*reQ3nQ1nQ2nstarQ2nstar+2.*reQ6nQ3nstarQ3nstar+3.*reQ6nQ4nstarQ2nstar | |
4323 | + 6.*reQ4nQ3nstarQ1nstar+6.*reQ4nQ2nstarQ2nstar | |
4324 | + 12.*reQ3nQ2nstarQ1nstar+6.*reQ2nQ1nstarQ1nstar | |
11d3e40e | 4325 | - 2.*((pow(dReQ6n,2.)+pow(dImQ6n,2.)) |
4326 | + 3.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
4327 | + 6.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4328 | + 9.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4329 | + 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-12.*dMult)) | |
b84464d3 | 4330 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
4331 | fIntFlowCorrelationsAllPro->Fill(33.5,five3n3n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3435cacb | 4332 | if(fCalculateAllCorrelationsVsM) |
4333 | { | |
3842bdcd | 4334 | fIntFlowCorrelationsAllVsMPro[33]->Fill(dMultiplicityBin,five3n3n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
3435cacb | 4335 | } |
11d3e40e | 4336 | } // end of if(dMult>4.) |
8ed4edc7 | 4337 | |
b84464d3 | 4338 | // EXTRA correlations for Teaney-Yan study: |
4339 | // 2-particle: | |
4340 | Double_t two5n5n = 0.; // <cos(5n(phi1-phi2))> | |
4341 | Double_t two6n6n = 0.; // <cos(6n(phi1-phi2))> | |
4342 | if(dMult>1) | |
4343 | { | |
4344 | two5n5n = (pow(dReQ5n,2.)+pow(dImQ5n,2.)-dMult)/(dMult*(dMult-1.)); | |
4345 | two6n6n = (pow(dReQ6n,2.)+pow(dImQ6n,2.)-dMult)/(dMult*(dMult-1.)); | |
4346 | // Average 2-particle correlations for all events: | |
4347 | fIntFlowCorrelationsAllPro->Fill(34.5,two5n5n,dMult*(dMult-1.)); | |
4348 | fIntFlowCorrelationsAllPro->Fill(35.5,two6n6n,dMult*(dMult-1.)); | |
4349 | if(fCalculateAllCorrelationsVsM) | |
4350 | { | |
3842bdcd | 4351 | fIntFlowCorrelationsAllVsMPro[34]->Fill(dMultiplicityBin,two5n5n,dMult*(dMult-1.)); |
4352 | fIntFlowCorrelationsAllVsMPro[35]->Fill(dMultiplicityBin,two6n6n,dMult*(dMult-1.)); | |
b84464d3 | 4353 | } |
4354 | } // end of if(dMult>1) | |
4355 | ||
4356 | // 3-particle: | |
4357 | Double_t three5n3n2n = 0.; // <cos(n(5*phi1-3*phi2-2*phi3)> | |
4358 | Double_t three5n4n1n = 0.; // <cos(n(5*phi1-4*phi2-1*phi3)> | |
4359 | Double_t three6n3n3n = 0.; // <cos(n(6*phi1-3*phi2-3*phi3)> | |
4360 | Double_t three6n4n2n = 0.; // <cos(n(6*phi1-4*phi2-2*phi3)> | |
4361 | Double_t three6n5n1n = 0.; // <cos(n(6*phi1-5*phi2-1*phi3)> | |
4362 | if(dMult>2) | |
4363 | { | |
4364 | three5n3n2n = (reQ5nQ3nstarQ2nstar-(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
4365 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4366 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult) | |
4367 | / (dMult*(dMult-1.)*(dMult-2.)); | |
4368 | three5n4n1n = (reQ5nQ4nstarQ1nstar-(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
4369 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
4370 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
4371 | / (dMult*(dMult-1.)*(dMult-2.)); | |
4372 | three6n3n3n = (reQ6nQ3nstarQ3nstar-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4373 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))+2.*dMult) | |
4374 | / (dMult*(dMult-1.)*(dMult-2.)); | |
4375 | three6n4n2n = (reQ6nQ4nstarQ2nstar-(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
4376 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
4377 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult) | |
4378 | / (dMult*(dMult-1.)*(dMult-2.)); | |
4379 | three6n5n1n = (reQ6nQ5nstarQ1nstar-(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
4380 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
4381 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
4382 | / (dMult*(dMult-1.)*(dMult-2.)); | |
4383 | // Average 3-particle correlations for all events: | |
4384 | fIntFlowCorrelationsAllPro->Fill(36.5,three5n3n2n,dMult*(dMult-1.)*(dMult-2.)); // <<cos(n(5*phi1-3*phi2-2*phi3)>> | |
4385 | fIntFlowCorrelationsAllPro->Fill(37.5,three5n4n1n,dMult*(dMult-1.)*(dMult-2.)); // <<cos(n(5*phi1-4*phi2-1*phi3)>> | |
4386 | fIntFlowCorrelationsAllPro->Fill(38.5,three6n3n3n,dMult*(dMult-1.)*(dMult-2.)); // <<cos(n(6*phi1-3*phi2-3*phi3)>> | |
4387 | fIntFlowCorrelationsAllPro->Fill(39.5,three6n4n2n,dMult*(dMult-1.)*(dMult-2.)); // <<cos(n(6*phi1-4*phi2-2*phi3)>> | |
4388 | fIntFlowCorrelationsAllPro->Fill(40.5,three6n5n1n,dMult*(dMult-1.)*(dMult-2.)); // <<cos(n(6*phi1-5*phi2-1*phi3)>> | |
4389 | if(fCalculateAllCorrelationsVsM) | |
4390 | { | |
3842bdcd | 4391 | fIntFlowCorrelationsAllVsMPro[36]->Fill(dMultiplicityBin,three5n3n2n,dMult*(dMult-1.)*(dMult-2.)); |
4392 | fIntFlowCorrelationsAllVsMPro[37]->Fill(dMultiplicityBin,three5n4n1n,dMult*(dMult-1.)*(dMult-2.)); | |
4393 | fIntFlowCorrelationsAllVsMPro[38]->Fill(dMultiplicityBin,three6n3n3n,dMult*(dMult-1.)*(dMult-2.)); | |
4394 | fIntFlowCorrelationsAllVsMPro[39]->Fill(dMultiplicityBin,three6n4n2n,dMult*(dMult-1.)*(dMult-2.)); | |
4395 | fIntFlowCorrelationsAllVsMPro[40]->Fill(dMultiplicityBin,three6n5n1n,dMult*(dMult-1.)*(dMult-2.)); | |
b84464d3 | 4396 | } |
4397 | } // end of if(dMult>2) | |
4398 | ||
4399 | // 4-particle: | |
4400 | Double_t four6n3n2n1n = 0.; // <cos(n(6*phi1-3*phi2-2*phi3-1*phi4)> | |
4401 | Double_t four3n2n3n2n = 0.; // <cos(n(3*phi1+2*phi2-3*phi3-2*phi4)> | |
4402 | Double_t four4n1n3n2n = 0.; // <cos(n(4*phi1+1*phi2-3*phi3-2*phi4)> | |
4403 | Double_t four3n3n3n3n = 0.; // <cos(3n(phi1+phi2-phi3-phi4))> | |
4404 | //Double_t four4n2n3n3n = 0.; // <cos(n(4*phi1+2*phi2-3*phi3-3*phi4)> // I already have this one above | |
4405 | Double_t four5n1n3n3n = 0.; // <cos(n(5*phi1+1*phi2-3*phi3-3*phi4)> | |
4406 | Double_t four4n2n4n2n = 0.; // <cos(n(4*phi1+2*phi2-4*phi3-2*phi4)> | |
4407 | Double_t four5n1n4n2n = 0.; // <cos(n(5*phi1+1*phi2-4*phi3-2*phi4)> | |
4408 | Double_t four5n3n1n1n = 0.; // <cos(n(5*phi1-3*phi2-1*phi3-1*phi4)> | |
4409 | Double_t four5n2n2n1n = 0.; // <cos(n(5*phi1-2*phi2-2*phi3-1*phi4)> | |
403e3389 | 4410 | Double_t four5n1n5n1n = 0.; // <cos(n(5*phi1+1*phi2-5*phi3-1*phi4)> |
4411 | Double_t four6n4n1n1n = 0.; // <cos(n(6*phi1-4*phi2-1*phi3-1*phi4)> | |
4412 | Double_t four6n2n2n2n = 0.; // <cos(n(6*phi1-2*phi2-2*phi3-2*phi4)> | |
b84464d3 | 4413 | if(dMult>3) |
4414 | { | |
4415 | four6n3n2n1n = (reQ6nQ3nstarQ2nstarQ1nstar-reQ6nQ4nstarQ2nstar-reQ6nQ3nstarQ3nstar-reQ6nQ5nstarQ1nstar | |
4416 | - reQ5nQ3nstarQ2nstar-reQ4nQ3nstarQ1nstar-reQ3nQ2nstarQ1nstar | |
4417 | + 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))+pow(dReQ5n,2.)+pow(dImQ5n,2.) | |
4418 | + pow(dReQ4n,2.)+pow(dImQ4n,2.)+3.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4419 | + 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
4420 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4421 | four3n2n3n2n = (dQ3nQ2nQ3nstarQ2nstar-2.*reQ5nQ3nstarQ2nstar-2.*reQ3nQ2nstarQ1nstar | |
4422 | + pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.) | |
4423 | -(dMult-4.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4424 | + dMult*(dMult-6.)) | |
4425 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4426 | four4n1n3n2n = (reQ4nQ1nQ3nstarQ2nstar-reQ5nQ3nstarQ2nstar-reQ5nQ4nstarQ1nstar-reQ4nQ3nstarQ1nstar | |
4427 | - reQ4nQ2nstarQ2nstar-reQ3nQ2nstarQ1nstar-reQ2nQ1nstarQ1nstar | |
4428 | + pow(dReQ5n,2.)+pow(dImQ5n,2.)+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
4429 | + 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4430 | + 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
4431 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4432 | four3n3n3n3n = (2.*dMult*(dMult-3.)+pow((pow(dReQ3n,2.)+pow(dImQ3n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ3n,2.) | |
4433 | + pow(dImQ3n,2.))-2.*reQ6nQ3nstarQ3nstar+(pow(dReQ6n,2.)+pow(dImQ6n,2.))) | |
4434 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
4435 | //four4n2n3n3n = ; // I already have this one above | |
4436 | four5n1n3n3n = (reQ5nQ1nQ3nstarQ3nstar-reQ6nQ5nstarQ1nstar-reQ6nQ3nstarQ3nstar-2.*reQ5nQ3nstarQ2nstar | |
4437 | - 2.*reQ3nQ2nstarQ1nstar+pow(dReQ6n,2.)+pow(dImQ6n,2.)+2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
4438 | + 4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4439 | + 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
4440 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4441 | four4n2n4n2n = (dQ4nQ2nQ4nstarQ2nstar-2.*reQ6nQ4nstarQ2nstar-2.*reQ4nQ2nstarQ2nstar) | |
4442 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
4443 | - ((dMult-5.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4444 | + (dMult-4.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-(pow(dReQ6n,2.)+pow(dImQ6n,2.))) | |
4445 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
4446 | + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4447 | four5n1n4n2n = (reQ5nQ1nQ4nstarQ2nstar-reQ6nQ5nstarQ1nstar-reQ6nQ4nstarQ2nstar-reQ5nQ4nstarQ1nstar | |
4448 | - reQ5nQ3nstarQ2nstar-reQ4nQ3nstarQ1nstar-reQ2nQ1nstarQ1nstar+pow(dReQ6n,2.)+pow(dImQ6n,2.) | |
4449 | + 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
4450 | + pow(dReQ3n,2.)+pow(dImQ3n,2.)+2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4451 | + 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
4452 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4453 | four5n3n1n1n = (reQ5nQ3nstarQ1nstarQ1nstar-2.*reQ5nQ4nstarQ1nstar-reQ5nQ3nstarQ2nstar-2.*reQ4nQ3nstarQ1nstar | |
4454 | - reQ2nQ1nstarQ1nstar+2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
4455 | + 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+pow(dReQ2n,2.)+pow(dImQ2n,2.) | |
4456 | + 4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
4457 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4458 | four5n2n2n1n = (reQ5nQ2nstarQ2nstarQ1nstar-reQ5nQ4nstarQ1nstar-2.*reQ5nQ3nstarQ2nstar-reQ4nQ2nstarQ2nstar | |
4459 | - 2.*reQ3nQ2nstarQ1nstar+2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))+pow(dReQ4n,2.)+pow(dImQ4n,2.) | |
4460 | + 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4461 | + 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
4462 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4463 | four5n1n5n1n = (dQ5nQ1nQ5nstarQ1nstar-2.*reQ6nQ5nstarQ1nstar-2.*reQ5nQ4nstarQ1nstar | |
4464 | + pow(dReQ6n,2.)+pow(dImQ6n,2.)-(dMult-4.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
4465 | + pow(dReQ4n,2.)+pow(dImQ4n,2.)-(dMult-4.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+dMult*(dMult-6.)) | |
53884472 | 4466 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
4467 | ||
4468 | // TBI: Recursive formula needed: | |
403e3389 | 4469 | four6n4n1n1n = (reQ6nQ4nstarQ1nstarQ1nstar |
4470 | - dMult*(dMult-1.)*(dMult-2.)*(three2n1n1n+2.*three5n4n1n+2.*three6n5n1n+three6n4n2n) | |
4471 | - dMult*(dMult-1.)*(2.*two1n1n+1.*two4n4n+1.*two6n6n+1.*two2n2n+2.*two5n5n) | |
4472 | - 1.*dMult) | |
4473 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
53884472 | 4474 | |
403e3389 | 4475 | four6n2n2n2n = (reQ6nQ2nstarQ2nstarQ2nstar-3.*reQ6nQ4nstarQ2nstar-3.*reQ4nQ2nstarQ2nstar |
4476 | + 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))+3.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
4477 | + 6.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-6.*dMult) | |
4478 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 4479 | // Average 4-particle correlations for all events: |
4480 | fIntFlowCorrelationsAllPro->Fill(41.5,four6n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4481 | fIntFlowCorrelationsAllPro->Fill(42.5,four3n2n3n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4482 | fIntFlowCorrelationsAllPro->Fill(43.5,four4n1n3n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4483 | fIntFlowCorrelationsAllPro->Fill(44.5,four3n3n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4484 | //fIntFlowCorrelationsAllPro->Fill(45.5,four4n2n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); // I already have this one above | |
4485 | fIntFlowCorrelationsAllPro->Fill(46.5,four5n1n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4486 | fIntFlowCorrelationsAllPro->Fill(47.5,four4n2n4n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4487 | fIntFlowCorrelationsAllPro->Fill(48.5,four5n1n4n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4488 | fIntFlowCorrelationsAllPro->Fill(49.5,four5n3n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4489 | fIntFlowCorrelationsAllPro->Fill(50.5,four5n2n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4490 | fIntFlowCorrelationsAllPro->Fill(51.5,four5n1n5n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
403e3389 | 4491 | fIntFlowCorrelationsAllPro->Fill(58.5,four6n4n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
4492 | fIntFlowCorrelationsAllPro->Fill(59.5,four6n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 4493 | if(fCalculateAllCorrelationsVsM) |
4494 | { | |
3842bdcd | 4495 | fIntFlowCorrelationsAllVsMPro[41]->Fill(dMultiplicityBin,four6n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
4496 | fIntFlowCorrelationsAllVsMPro[42]->Fill(dMultiplicityBin,four3n2n3n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4497 | fIntFlowCorrelationsAllVsMPro[43]->Fill(dMultiplicityBin,four4n1n3n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4498 | fIntFlowCorrelationsAllVsMPro[44]->Fill(dMultiplicityBin,four3n3n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4499 | //fIntFlowCorrelationsAllVsMPro[45]->Fill(dMultiplicityBin,four4n2n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4500 | fIntFlowCorrelationsAllVsMPro[46]->Fill(dMultiplicityBin,four5n1n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4501 | fIntFlowCorrelationsAllVsMPro[47]->Fill(dMultiplicityBin,four4n2n4n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4502 | fIntFlowCorrelationsAllVsMPro[48]->Fill(dMultiplicityBin,four5n1n4n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4503 | fIntFlowCorrelationsAllVsMPro[49]->Fill(dMultiplicityBin,four5n3n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4504 | fIntFlowCorrelationsAllVsMPro[50]->Fill(dMultiplicityBin,four5n2n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4505 | fIntFlowCorrelationsAllVsMPro[51]->Fill(dMultiplicityBin,four5n1n5n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4506 | fIntFlowCorrelationsAllVsMPro[58]->Fill(dMultiplicityBin,four6n4n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
4507 | fIntFlowCorrelationsAllVsMPro[59]->Fill(dMultiplicityBin,four6n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 4508 | } |
4509 | } // end of if(dMult>3) | |
4510 | ||
4511 | // 5-particle: | |
4512 | Double_t five3n3n3n2n1n = 0.; // <cos(n(3*phi1+3*phi2-3*phi3-2*phi4-1*phi5)> | |
4513 | Double_t five4n2n3n2n1n = 0.; // <cos(n(4*phi1+2*phi2-3*phi3-2*phi4-1*phi5)> | |
4514 | Double_t five3n2n3n1n1n = 0.; // <cos(n(3*phi1+2*phi2-3*phi3-1*phi4-1*phi5)> | |
4515 | Double_t five3n2n2n2n1n = 0.; // <cos(n(3*phi1+2*phi2-2*phi3-2*phi4-1*phi5)> | |
4516 | Double_t five5n1n3n2n1n = 0.; // <cos(n(5*phi1+1*phi2-3*phi3-2*phi4-1*phi5)> | |
403e3389 | 4517 | Double_t five6n2n2n1n1n = 0.; // <cos(n(6*phi1-2*phi2-2*phi3-1*phi4-1*phi5)> |
4518 | Double_t five4n1n1n3n3n = 0.; // <cos(n(4*phi1+1*phi2+1*phi3-3*phi4-3*phi5)> | |
b84464d3 | 4519 | if(dMult>4) |
4520 | { | |
4521 | five3n3n3n2n1n = (reQ3nQ3nQ3nstarQ2nstarQ1nstar-reQ6nQ3nstarQ2nstarQ1nstar-reQ5nQ1nQ3nstarQ3nstar-reQ4nQ2nQ3nstarQ3nstar | |
4522 | + reQ6nQ5nstarQ1nstar+reQ6nQ4nstarQ2nstar+3.*reQ6nQ3nstarQ3nstar+4.*reQ5nQ3nstarQ2nstar+4.*reQ4nQ3nstarQ1nstar | |
4523 | - 2.*(dMult-6.)*reQ3nQ2nstarQ1nstar-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4524 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4525 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
4526 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*(3.*dMult-10.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4527 | - pow((pow(dReQ3n,2.)+pow(dImQ3n,2.)),2.)+2.*(dMult-5.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4528 | + 2.*(dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*dMult*(dMult-6.)) | |
4529 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4530 | five4n2n3n2n1n = (reQ4nQ2nQ3nstarQ2nstarQ1nstar-reQ6nQ3nstarQ2nstarQ1nstar-reQ5nQ1nQ4nstarQ2nstar | |
4531 | - reQ4nQ2nQ3nstarQ3nstar-reQ4nQ1nQ3nstarQ2nstar-reQ4nQ2nstarQ1nstarQ1nstar | |
4532 | - reQ3nQ1nQ2nstarQ2nstar-(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4533 | + 3.*reQ6nQ4nstarQ2nstar+reQ6nQ5nstarQ1nstar+reQ6nQ3nstarQ3nstar+reQ5nQ4nstarQ1nstar | |
4534 | + 3.*reQ5nQ3nstarQ2nstar-(dMult-7.)*reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar+7.*reQ3nQ2nstarQ1nstar | |
4535 | + 4.*reQ2nQ1nstarQ1nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4536 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4537 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
4538 | + (dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+(dMult-10.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4539 | + 2.*(dMult-7.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+(dMult-12.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4540 | - 2.*dMult*(dMult-12.)) | |
4541 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4542 | five3n2n3n1n1n = (reQ3nQ2nQ3nstarQ1nstarQ1nstar-reQ5nQ3nstarQ1nstarQ1nstar-2.*reQ4nQ1nQ3nstarQ2nstar-reQ3nQ1nstarQ1nstarQ1nstar | |
4543 | - 2.*reQ3nQ1nQ2nstarQ2nstar+2.*reQ5nQ4nstarQ1nstar+3.*reQ5nQ3nstarQ2nstar+6.*reQ4nQ3nstarQ1nstar | |
4544 | + 2.*reQ4nQ2nstarQ2nstar+9.*reQ3nQ2nstarQ1nstar-(dMult-8.)*reQ2nQ1nstarQ1nstar | |
4545 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4546 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4547 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))-4.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
4548 | + 2.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+(dMult-12.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4549 | + 2.*(dMult-9.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-2.*dMult*(dMult-12.)) | |
4550 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4551 | five3n2n2n2n1n = (reQ3nQ2nQ2nstarQ2nstarQ1nstar-reQ5nQ2nstarQ2nstarQ1nstar-reQ4nQ1nQ3nstarQ2nstar-reQ3nQ1nQ2nstarQ2nstar | |
4552 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+reQ5nQ4nstarQ1nstar | |
4553 | + 4.*reQ5nQ3nstarQ2nstar+reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar-2.*(dMult-6.)*reQ3nQ2nstarQ1nstar | |
4554 | + 4.*reQ2nQ1nstarQ1nstar-2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
4555 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4556 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4557 | - pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)+2.*(3.*dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4558 | + 2.*(dMult-6.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*dMult*(dMult-6.)) | |
4559 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4560 | five5n1n3n2n1n = (reQ5nQ1nQ3nstarQ2nstarQ1nstar-reQ6nQ3nstarQ2nstarQ1nstar-reQ5nQ1nQ4nstarQ2nstar-reQ5nQ1nQ3nstarQ3nstar | |
4561 | - reQ4nQ1nQ3nstarQ2nstar-reQ5nQ3nstarQ1nstarQ1nstar-reQ5nQ2nstarQ2nstarQ1nstar | |
4562 | + 3.*reQ6nQ5nstarQ1nstar+reQ6nQ4nstarQ2nstar+reQ6nQ3nstarQ3nstar+4.*reQ5nQ4nstarQ1nstar | |
4563 | - (dMult-7.)*reQ5nQ3nstarQ2nstar+4.*reQ4nQ3nstarQ1nstar+reQ4nQ2nstarQ2nstar+6.*reQ3nQ2nstarQ1nstar | |
4564 | + 3.*reQ2nQ1nstarQ1nstar-(pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4565 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4566 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4567 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))+(dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
4568 | - 4.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+(dMult-10.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4569 | + (dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*(dMult-7.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4570 | - 2.*dMult*(dMult-12.)) | |
e1d101a6 | 4571 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
53884472 | 4572 | // Peter Jochumzsen: |
4573 | five6n2n2n1n1n = (reQ6nQ2nstarQ2nstarQ1nstarQ1nstar | |
4574 | - 12.*pow(dReQ1n,2.)-12.*pow(dImQ1n,2.) | |
4575 | - 14.*pow(dReQ2n,2.)-14.*pow(dImQ2n,2.) | |
4576 | - 8.*pow(dReQ3n,2.)-8.*pow(dImQ3n,2.) | |
4577 | - 6.*pow(dReQ4n,2.)-6.*pow(dImQ4n,2.) | |
4578 | - 4.*pow(dReQ5n,2.)-4.*pow(dImQ5n,2.) | |
4579 | - 6.*pow(dReQ6n,2.)-6.*pow(dImQ6n,2.) | |
4580 | + 2.*reQ2nQ1nstarQ1nstar + 8.*reQ3nQ2nstarQ1nstar | |
4581 | + 5.*reQ6nQ4nstarQ2nstar - reQ6nQ4nstarQ1nstarQ1nstar | |
4582 | + 2.*reQ6nQ3nstarQ3nstar - reQ6nQ2nstarQ2nstarQ2nstar | |
4583 | + 4.*reQ4nQ2nstarQ2nstar - 2.*reQ4nQ2nstarQ1nstarQ1nstar | |
4584 | + 2.*reQ5nQ4nstarQ1nstar - 2.*reQ5nQ2nstarQ2nstarQ1nstar | |
4585 | + 4.*reQ4nQ3nstarQ1nstar + 4.*reQ5nQ3nstarQ2nstar | |
4586 | + 4.*reQ6nQ5nstarQ1nstar - 4.*reQ6nQ3nstarQ2nstarQ1nstar + 24.*dMult) | |
e1d101a6 | 4587 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
4588 | // Peter Jochumzsen: | |
4589 | five4n1n1n3n3n = (reQ4nQ1nQ1nQ3nstarQ3nstar-16.*pow(dReQ1n,2.)-16.*pow(dImQ1n,2.) | |
4590 | - 10.*pow(dReQ2n,2.)-10.*pow(dImQ2n,2.)-12.*pow(dReQ3n,2.)-12.*pow(dImQ3n,2.) | |
4591 | - 6.*pow(dReQ4n,2.)-6.*pow(dImQ4n,2.)-4.*pow(dReQ5n,2.)-4.*pow(dImQ5n,2.) | |
4592 | - 2.*pow(dReQ6n,2.)-2.*pow(dImQ6n,2.)+6.*reQ2nQ1nstarQ1nstar | |
4593 | - 1.*reQ6nQ4nstarQ1nstarQ1nstar-1.*reQ4nQ2nQ3nstarQ3nstar | |
4594 | + 1.*reQ6nQ4nstarQ2nstar-2.*reQ5nQ1nQ3nstarQ3nstar | |
4595 | + 2.*reQ4nQ2nstarQ2nstar+4.*reQ4nQ3nstarQ1nstar | |
4596 | - 2.*reQ3nQ1nstarQ1nstarQ1nstar+10.*reQ3nQ2nstarQ1nstar | |
4597 | + 2.*reQ6nQ5nstarQ1nstar+2.*reQ6nQ3nstarQ3nstar | |
4598 | - 4.*reQ4nQ1nQ3nstarQ2nstar+4.*reQ5nQ4nstarQ1nstar | |
4599 | + 4.*reQ5nQ3nstarQ2nstar + 24.*dMult) | |
4600 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4601 | // Average 5-particle correlations for all events: | |
4602 | fIntFlowCorrelationsAllPro->Fill(52.5,five3n3n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4603 | fIntFlowCorrelationsAllPro->Fill(53.5,five4n2n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4604 | fIntFlowCorrelationsAllPro->Fill(54.5,five3n2n3n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4605 | fIntFlowCorrelationsAllPro->Fill(55.5,five3n2n2n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4606 | fIntFlowCorrelationsAllPro->Fill(56.5,five5n1n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4607 | fIntFlowCorrelationsAllPro->Fill(60.5,five6n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4608 | fIntFlowCorrelationsAllPro->Fill(61.5,five4n1n1n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4609 | if(fCalculateAllCorrelationsVsM) | |
4610 | { | |
3842bdcd | 4611 | fIntFlowCorrelationsAllVsMPro[52]->Fill(dMultiplicityBin,five3n3n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
4612 | fIntFlowCorrelationsAllVsMPro[53]->Fill(dMultiplicityBin,five4n2n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4613 | fIntFlowCorrelationsAllVsMPro[54]->Fill(dMultiplicityBin,five3n2n3n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4614 | fIntFlowCorrelationsAllVsMPro[55]->Fill(dMultiplicityBin,five3n2n2n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4615 | fIntFlowCorrelationsAllVsMPro[56]->Fill(dMultiplicityBin,five5n1n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4616 | fIntFlowCorrelationsAllVsMPro[60]->Fill(dMultiplicityBin,five6n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
4617 | fIntFlowCorrelationsAllVsMPro[61]->Fill(dMultiplicityBin,five4n1n1n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
e1d101a6 | 4618 | } |
4619 | } // end of if(dMult>4) | |
4620 | ||
4621 | // 6-particle: | |
4622 | Double_t six3n2n1n3n2n1n = 0.; // <cos(n(3*phi1+2*phi2+1*phi3-3*phi4-2*phi5-1*phi6)> | |
4623 | Double_t six3n3n2n2n1n1n = 0.; // <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-1*phi5-1*phi6)> | |
4624 | if(dMult>5.) | |
4625 | { | |
4626 | six3n2n1n3n2n1n = (dQ3nQ2nQ1nQ3nstarQ2nstarQ1nstar-2.*reQ3nQ3nQ3nstarQ2nstarQ1nstar | |
4627 | - 2.*reQ3nQ2nQ2nstarQ2nstarQ1nstar-2.*reQ3nQ1nQ2nstarQ1nstarQ1nstar | |
4628 | - 2.*reQ3nQ2nQ3nstarQ1nstarQ1nstar-2.*reQ4nQ2nQ3nstarQ2nstarQ1nstar | |
4629 | - 2.*reQ5nQ1nQ3nstarQ2nstarQ1nstar+4.*reQ6nQ3nstarQ2nstarQ1nstar | |
4630 | + 2.*reQ5nQ1nQ4nstarQ2nstar+2.*reQ5nQ1nQ3nstarQ3nstar | |
4631 | + 2.*reQ4nQ2nQ3nstarQ3nstar+6.*reQ4nQ1nQ3nstarQ2nstar | |
4632 | + 2.*reQ5nQ3nstarQ1nstarQ1nstar+2.*reQ5nQ2nstarQ2nstarQ1nstar | |
4633 | + 6.*reQ3nQ1nQ2nstarQ2nstar+2.*reQ4nQ2nstarQ1nstarQ1nstar | |
4634 | - 4.*reQ6nQ5nstarQ1nstar-4.*reQ6nQ4nstarQ2nstar-6.*reQ5nQ4nstarQ1nstar | |
4635 | - 4.*reQ6nQ3nstarQ3nstar+2.*(dMult-11.)*reQ5nQ3nstarQ2nstar | |
4636 | + 2.*(dMult-13.)*reQ4nQ3nstarQ1nstar-8.*reQ4nQ2nstarQ2nstar | |
4637 | + 2.*(5.*dMult-32.)*reQ3nQ2nstarQ1nstar+2.*reQ3nQ1nstarQ1nstarQ1nstar | |
4638 | + 2.*(dMult-13.)*reQ2nQ1nstarQ1nstar | |
4639 | - (dMult-10.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4640 | + (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4641 | + (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4642 | - (dMult-11.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4643 | - (dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4644 | + 4.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-(dMult-12.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
4645 | - (dMult-16.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+pow((pow(dReQ3n,2.)+pow(dImQ3n,2.)),2.) | |
4646 | + (dMult*dMult-19.*dMult+68.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
4647 | + (dMult*dMult-19.*dMult+72.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4648 | + pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)+pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
4649 | + (dMult*dMult-20.*dMult+80.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4650 | - dMult*(dMult-12.)*(dMult-10.)) | |
4651 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
4652 | ||
4653 | // Peter Jochumzsen: | |
4654 | six3n3n2n2n1n1n = (reQ3nQ3nQ2nstarQ2nstarQ1nstarQ1nstar | |
4655 | + (80.-16.*dMult)*pow(dReQ1n,2.)+(80.-16.*dMult)*pow(dImQ1n,2.) | |
4656 | + (78.-16.*dMult)*pow(dReQ2n,2.)+(78.-16.*dMult)*pow(dImQ2n,2.) | |
4657 | + (72.-16.*dMult)*pow(dReQ3n,2.)+(72.-16.*dMult)*pow(dImQ3n,2.) | |
4658 | + 14.*pow(dReQ4n,2.)+14.*pow(dImQ4n,2.) | |
4659 | + 8.*pow(dReQ5n,2.)+8.*pow(dImQ5n,2.) | |
4660 | + 6.*pow(dReQ6n,2.)+6.*pow(dImQ6n,2.) | |
4661 | + 1.*reQ6nQ2nstarQ2nstarQ2nstar - 1.*reQ6nQ2nstarQ2nstarQ1nstarQ1nstar | |
4662 | - 76.*reQ3nQ2nstarQ1nstar + 4.*reQ3nQ1nstarQ1nstarQ1nstar | |
4663 | - 8.*reQ3nQ2nstarQ1nstar + 8.*dQ2nQ1nQ2nstarQ1nstar | |
4664 | + 4.*reQ5nQ2nstarQ2nstarQ1nstar - 2.*reQ6nQ3nstarQ3nstar | |
4665 | + 4.*reQ6nQ3nstarQ2nstarQ1nstar - 4.*reQ5nQ4nstarQ1nstar | |
4666 | + 16.*dMult*reQ3nQ2nstarQ1nstar - 2.*reQ4nQ2nstarQ2nstar | |
4667 | - 4.*reQ3nQ3nQ3nstarQ2nstarQ1nstar -8.*reQ4nQ3nstarQ1nstar | |
4668 | - 10.*reQ4nQ2nstarQ2nstar + 4.*reQ4nQ2nstarQ1nstarQ1nstar | |
4669 | - 12.*reQ4nQ3nstarQ1nstar + 8.*dQ3nQ1nQ3nstarQ1nstar | |
4670 | + 8.*reQ3nQ1nQ2nstarQ2nstar - 4.*reQ3nQ1nQ2nstarQ1nstarQ1nstar | |
4671 | + 5.*reQ4nQ2nQ3nstarQ3nstar+2.*pow(pow(dReQ2n,2.)+pow(dImQ2n,2.),2.) | |
4672 | + 4.*reQ5nQ1nQ3nstarQ3nstar+2.*pow(pow(dReQ3n,2.)+pow(dImQ3n,2.),2.) | |
4673 | - 6.*reQ6nQ3nstarQ3nstar - 14.*reQ2nQ1nstarQ1nstar | |
4674 | - 1.*reQ3nQ3nQ2nstarQ2nstarQ2nstar-4.*reQ3nQ2nQ2nstarQ2nstarQ1nstar | |
4675 | - 1.*reQ4nQ1nQ1nQ3nstarQ3nstar-8.*reQ5nQ3nstarQ2nstar | |
4676 | + 2.*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),2.) - 10.*reQ2nQ1nstarQ1nstar | |
4677 | - 4.*reQ6nQ5nstarQ1nstar-5.*reQ6nQ4nstarQ2nstar | |
4678 | + 1.*reQ6nQ4nstarQ1nstarQ1nstar-8.*reQ5nQ3nstarQ2nstar | |
4679 | + 4.*reQ4nQ1nQ3nstarQ2nstar+8.*dQ3nQ2nQ3nstarQ2nstar | |
4680 | - 120.*dMult + 16.*dMult*dMult) | |
4681 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
4682 | ||
4683 | // Average 6-particle correlations for all events: | |
4684 | fIntFlowCorrelationsAllPro->Fill(57.5,six3n2n1n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
4685 | fIntFlowCorrelationsAllPro->Fill(62.5,six3n3n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
4686 | if(fCalculateAllCorrelationsVsM) | |
4687 | { | |
3842bdcd | 4688 | fIntFlowCorrelationsAllVsMPro[57]->Fill(dMultiplicityBin,six3n2n1n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
4689 | fIntFlowCorrelationsAllVsMPro[62]->Fill(dMultiplicityBin,six3n3n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
e1d101a6 | 4690 | } |
4691 | } // end of if(dMult>5.) | |
4692 | ||
1db7eced | 4693 | // |Qn|^2/M, |Q2n|^2/M, |Qn|^4/(M(2M-1)), Re[Q2nQn^*Qn^*]/M, ... vs multiplicity (#RPs, #POIs or external): |
4694 | if(fUseQvectorTerms) | |
4695 | { | |
4696 | Double_t dM = dMultiplicityBin-0.5; | |
4697 | if(dM>1.) // TBI re-think this if statement | |
4698 | { | |
4699 | fQvectorTermsVsMult[0]->Fill(dMultiplicityBin,(pow(dReQ1n,2.)+pow(dImQ1n,2.))/dM); | |
4700 | fQvectorTermsVsMult[1]->Fill(dMultiplicityBin,(pow(dReQ2n,2.)+pow(dImQ2n,2.))/dM); | |
4701 | fQvectorTermsVsMult[2]->Fill(dMultiplicityBin,(pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),2.))/(dM*(2.*dM-1.))); | |
4702 | fQvectorTermsVsMult[3]->Fill(dMultiplicityBin,reQ2nQ1nstarQ1nstar/pow(dM,1.5)); // TBI a bit of heuristic inserted here, re-think the rescaling factor | |
4703 | } // end of if(dM>1.) // TBI re-think this if statement | |
4704 | } // end of if(fUseQvectorTerms) | |
4705 | ||
e1d101a6 | 4706 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelations() |
4707 | ||
4708 | //===================================================================================================== | |
4709 | ||
4710 | void AliFlowAnalysisWithQCumulants::CalculateMixedHarmonics() | |
4711 | { | |
4712 | // Calculate in this method all multi-particle azimuthal correlations in mixed harmonics. | |
4713 | // (Remark: For completeness sake, we also calculate here again correlations in the same harmonic.) | |
4714 | ||
4715 | // a) Access Q-vectors and multiplicity of current event; | |
c10259fb | 4716 | // b) Determine multiplicity weights and fill some histos; |
e1d101a6 | 4717 | // c) Calculate 2-p correlations; |
4718 | // d) Calculate 3-p correlations; | |
4719 | // e) Calculate 4-p correlations; | |
4720 | // f) Calculate 5-p correlations; | |
4721 | // g) Calculate 6-p correlations; | |
4722 | // h) Calculate 7-p correlations; | |
c10259fb | 4723 | // i) Calculate 8-p correlations. |
e1d101a6 | 4724 | |
4725 | // a) Access Q-vectors and multiplicity of current event: | |
4726 | // Multiplicity of an event: | |
4727 | Double_t dMult = (*fSpk)(0,0); | |
4728 | // Real parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n, 4n, 5n and 6n: | |
4729 | Double_t dReQ1n = (*fReQ)(0,0); | |
4730 | Double_t dReQ2n = (*fReQ)(1,0); | |
4731 | Double_t dReQ3n = (*fReQ)(2,0); | |
4732 | Double_t dReQ4n = (*fReQ)(3,0); | |
4733 | Double_t dReQ5n = (*fReQ)(4,0); | |
4734 | Double_t dReQ6n = (*fReQ)(5,0); | |
4735 | Double_t dReQ7n = (*fReQ)(6,0); | |
4736 | Double_t dReQ8n = (*fReQ)(7,0); | |
4737 | Double_t dReQ9n = (*fReQ)(8,0); | |
4738 | Double_t dReQ10n = (*fReQ)(9,0); | |
4739 | Double_t dReQ11n = (*fReQ)(10,0); | |
4740 | Double_t dReQ12n = (*fReQ)(11,0); | |
4741 | // Imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n, 4n, 5n and 6n: | |
4742 | Double_t dImQ1n = (*fImQ)(0,0); | |
4743 | Double_t dImQ2n = (*fImQ)(1,0); | |
4744 | Double_t dImQ3n = (*fImQ)(2,0); | |
4745 | Double_t dImQ4n = (*fImQ)(3,0); | |
4746 | Double_t dImQ5n = (*fImQ)(4,0); | |
4747 | Double_t dImQ6n = (*fImQ)(5,0); | |
4748 | Double_t dImQ7n = (*fImQ)(6,0); | |
4749 | Double_t dImQ8n = (*fImQ)(7,0); | |
4750 | Double_t dImQ9n = (*fImQ)(8,0); | |
4751 | Double_t dImQ10n = (*fImQ)(9,0); | |
4752 | Double_t dImQ11n = (*fImQ)(10,0); | |
4753 | Double_t dImQ12n = (*fImQ)(11,0); | |
c10259fb | 4754 | // All mixed correlators: |
4755 | Double_t allMixedCorrelators[139] = {0.}; | |
e1d101a6 | 4756 | |
4757 | // Real parts of expressions involving various combinations of Q-vectors which appears | |
4758 | // simultaneously in several equations for multiparticle correlations bellow: | |
4759 | // Re[Q_{2n}Q_{n}^*Q_{n}^*] | |
4760 | Double_t reQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n; | |
4761 | // Re[Q_{6n}Q_{3n}^*Q_{3n}^*] | |
4762 | Double_t reQ6nQ3nstarQ3nstar = pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n; | |
4763 | // Re[Q_{4n}Q_{2n}^*Q_{2n}^*] | |
4764 | Double_t reQ4nQ2nstarQ2nstar = pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n; | |
4765 | // Re[Q_{4n}Q_{3n}^*Q_{n}^*] | |
4766 | Double_t reQ4nQ3nstarQ1nstar = dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n); | |
4767 | // Re[Q_{3n}Q_{2n}^*Q_{n}^*] | |
4768 | Double_t reQ3nQ2nstarQ1nstar = dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n | |
4769 | + dImQ3n*dImQ2n*dReQ1n; | |
4770 | // Re[Q_{5n}Q_{3n}^*Q_{2n}^*] | |
4771 | Double_t reQ5nQ3nstarQ2nstar = dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n | |
4772 | + dImQ5n*dImQ2n*dReQ3n; | |
4773 | // Re[Q_{5n}Q_{4n}^*Q_{1n}^*] | |
4774 | Double_t reQ5nQ4nstarQ1nstar = dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n | |
4775 | + dImQ5n*dImQ4n*dReQ1n; | |
4776 | // Re[Q_{6n}Q_{5n}^*Q_{1n}^*] | |
4777 | Double_t reQ6nQ5nstarQ1nstar = dReQ6n*dReQ5n*dReQ1n-dReQ6n*dImQ5n*dImQ1n+dImQ6n*dReQ5n*dImQ1n | |
4778 | + dImQ6n*dImQ5n*dReQ1n; | |
4779 | // Re[Q_{6n}Q_{4n}^*Q_{2n}^*] | |
4780 | Double_t reQ6nQ4nstarQ2nstar = dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n | |
4781 | + dImQ6n*dImQ4n*dReQ2n; | |
4782 | // Re[Q_{3n}Q_{n}Q_{2n}^*Q_{2n}^*] | |
4783 | Double_t reQ3nQ1nQ2nstarQ2nstar = (pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n) | |
4784 | + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n); | |
4785 | // Re[Q_{3n}Q_{n}^*Q_{n}^*Q_{n}^*] | |
4786 | Double_t reQ3nQ1nstarQ1nstarQ1nstar = dReQ3n*pow(dReQ1n,3)-3.*dReQ1n*dReQ3n*pow(dImQ1n,2) | |
4787 | + 3.*dImQ1n*dImQ3n*pow(dReQ1n,2)-dImQ3n*pow(dImQ1n,3); | |
4788 | // Re[Q_{6n}Q_{2n}^*Q_{2n}^*Q_{2n}^*] | |
4789 | Double_t reQ6nQ2nstarQ2nstarQ2nstar = dReQ6n*pow(dReQ2n,3)-3.*dReQ2n*dReQ6n*pow(dImQ2n,2) | |
4790 | + 3.*dImQ2n*dImQ6n*pow(dReQ2n,2)-dImQ6n*pow(dImQ2n,3); | |
4791 | // Re[Q_{4n}Q_{2n}^*Q_{n}^*Q_{n}^*] | |
4792 | Double_t reQ4nQ2nstarQ1nstarQ1nstar = (dReQ4n*dReQ2n+dImQ4n*dImQ2n)*(pow(dReQ1n,2)-pow(dImQ1n,2)) | |
4793 | + 2.*dReQ1n*dImQ1n*(dImQ4n*dReQ2n-dReQ4n*dImQ2n); | |
4794 | // Re[Q_{4n}Q_{2n}^*Q_{3n}^*Q_{3n}^*] | |
4795 | Double_t reQ4nQ2nQ3nstarQ3nstar = (dReQ4n*dReQ2n-dImQ4n*dImQ2n)*(dReQ3n*dReQ3n-dImQ3n*dImQ3n) | |
4796 | + 2.*(dReQ4n*dImQ2n+dImQ4n*dReQ2n)*dReQ3n*dImQ3n; | |
4797 | // Re[Q_{4n}Q_{n}Q_{3n}^*Q_{2n}^*] | |
4798 | Double_t reQ4nQ1nQ3nstarQ2nstar = dImQ1n*dImQ2n*dImQ3n*dImQ4n+dImQ3n*dImQ4n*dReQ1n*dReQ2n | |
4799 | + dImQ2n*dImQ4n*dReQ1n*dReQ3n-dImQ1n*dImQ4n*dReQ2n*dReQ3n | |
4800 | - dImQ2n*dImQ3n*dReQ1n*dReQ4n+dImQ1n*dImQ3n*dReQ2n*dReQ4n | |
4801 | + dImQ1n*dImQ2n*dReQ3n*dReQ4n+dReQ1n*dReQ2n*dReQ3n*dReQ4n; | |
4802 | ||
4803 | // Re[Q_{5n}Q_{n}Q_{4n}^*Q_{2n}^*] | |
4804 | Double_t reQ5nQ1nQ4nstarQ2nstar = dImQ1n*dImQ2n*dImQ4n*dImQ5n+dImQ4n*dImQ5n*dReQ1n*dReQ2n | |
4805 | + dImQ2n*dImQ5n*dReQ1n*dReQ4n-dImQ1n*dImQ5n*dReQ2n*dReQ4n | |
4806 | - dImQ2n*dImQ4n*dReQ1n*dReQ5n+dImQ1n*dImQ4n*dReQ2n*dReQ5n | |
4807 | + dImQ1n*dImQ2n*dReQ4n*dReQ5n+dReQ1n*dReQ2n*dReQ4n*dReQ5n; | |
4808 | // Re[Q_{5n}Q_{n}Q_{3n}^*Q_{3n}^*] | |
4809 | Double_t reQ5nQ1nQ3nstarQ3nstar = dImQ1n*pow(dImQ3n,2.)*dImQ5n+2.*dImQ3n*dImQ5n*dReQ1n*dReQ3n | |
4810 | - dImQ1n*dImQ5n*pow(dReQ3n,2.)-pow(dImQ3n,2.)*dReQ1n*dReQ5n | |
4811 | + 2.*dImQ1n*dImQ3n*dReQ3n*dReQ5n+dReQ1n*pow(dReQ3n,2.)*dReQ5n; | |
4812 | // Re[Q_{5n}Q_{3n}^*Q_{n}^*Q_{n}^*] | |
4813 | Double_t reQ5nQ3nstarQ1nstarQ1nstar = -pow(dImQ1n,2.)*dImQ3n*dImQ5n+dImQ3n*dImQ5n*pow(dReQ1n,2.) | |
4814 | + 2.*dImQ1n*dImQ5n*dReQ1n*dReQ3n-2.*dImQ1n*dImQ3n*dReQ1n*dReQ5n | |
4815 | - pow(dImQ1n,2.)*dReQ3n*dReQ5n+pow(dReQ1n,2.)*dReQ3n*dReQ5n; | |
4816 | // Re[Q_{5n}Q_{2n}^*Q_{2n}^*Q_{n}^*] | |
4817 | Double_t reQ5nQ2nstarQ2nstarQ1nstar = -pow(dImQ2n,2.)*dImQ1n*dImQ5n+dImQ1n*dImQ5n*pow(dReQ2n,2.) | |
4818 | + 2.*dImQ2n*dImQ5n*dReQ2n*dReQ1n-2.*dImQ2n*dImQ1n*dReQ2n*dReQ5n | |
4819 | - pow(dImQ2n,2.)*dReQ1n*dReQ5n+pow(dReQ2n,2.)*dReQ1n*dReQ5n; | |
4820 | // Re[Q_{6n}Q_{4n}^*Q_{n}^*Q_{n}^*] | |
4821 | Double_t reQ6nQ4nstarQ1nstarQ1nstar = -pow(dImQ1n,2.)*dImQ4n*dImQ6n+dImQ4n*dImQ6n*pow(dReQ1n,2.) | |
4822 | + 2.*dImQ1n*dImQ6n*dReQ1n*dReQ4n-2.*dImQ1n*dImQ4n*dReQ1n*dReQ6n | |
4823 | - pow(dImQ1n,2.)*dReQ4n*dReQ6n+pow(dReQ1n,2.)*dReQ4n*dReQ6n; | |
4824 | /*// |Q_{2n}|^2 |Q_{n}|^2 | |
4825 | Double_t dQ2nQ1nQ2nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
4826 | // |Q_{4n}|^2 |Q_{2n}|^2 | |
4827 | Double_t dQ4nQ2nQ4nstarQ2nstar = (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)); | |
4828 | // |Q_{3n}|^2 |Q_{2n}|^2 | |
4829 | Double_t dQ3nQ2nQ3nstarQ2nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)); | |
4830 | // |Q_{5n}|^2 |Q_{n}|^2 | |
4831 | Double_t dQ5nQ1nQ5nstarQ1nstar = (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
4832 | // |Q_{3n}|^2 |Q_{n}|^2 | |
4833 | Double_t dQ3nQ1nQ3nstarQ1nstar = (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.));*/ | |
4834 | // Re[Q_{2n}Q_{n}Q_{n}^*Q_{n}^*Q_{n}^*] | |
4835 | /*Double_t reQ2nQ1nQ1nstarQ1nstarQ1nstar = (dReQ2n*dReQ1n-dImQ2n*dImQ1n)*(pow(dReQ1n,3)-3.*dReQ1n*pow(dImQ1n,2)) | |
4836 | + (dReQ2n*dImQ1n+dReQ1n*dImQ2n)*(3.*dImQ1n*pow(dReQ1n,2)-pow(dImQ1n,3));*/ | |
4837 | // Re[Q_{2n}Q_{2n}Q_{2n}^*Q_{n}^*Q_{n}^*] | |
4838 | /*Double_t reQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4839 | * (dReQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) + 2.*dImQ2n*dReQ1n*dImQ1n);*/ | |
4840 | /*// Re[Q_{4n}Q_{n}^*Q_{n}^*Q_{n}^*Q_{n}^*] | |
4841 | Double_t reQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dReQ4n-6.*pow(dReQ1n,2.)*dReQ4n*pow(dImQ1n,2.) | |
4842 | + pow(dImQ1n,4.)*dReQ4n+4.*pow(dReQ1n,3.)*dImQ1n*dImQ4n | |
4843 | - 4.*pow(dImQ1n,3.)*dReQ1n*dImQ4n;*/ | |
4844 | // Re[Q_{3n}Q_{n}Q_{2n}^*Q_{n}^*Q_{n}^*] | |
4845 | /*Double_t reQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4846 | * (dReQ1n*dReQ2n*dReQ3n-dReQ3n*dImQ1n*dImQ2n | |
4847 | + dReQ2n*dImQ1n*dImQ3n+dReQ1n*dImQ2n*dImQ3n);*/ | |
4848 | // Re[Q_{6n}Q_{n}Q_{3n}^*Q_{2n}^*Q_{n}^*] | |
4849 | Double_t reQ6nQ3nstarQ2nstarQ1nstar = dReQ1n*dReQ2n*dReQ3n*dReQ6n-dReQ3n*dReQ6n*dImQ1n*dImQ2n | |
4850 | - dReQ2n*dReQ6n*dImQ1n*dImQ3n-dReQ1n*dReQ6n*dImQ2n*dImQ3n | |
4851 | + dReQ2n*dReQ3n*dImQ1n*dImQ6n+dReQ1n*dReQ3n*dImQ2n*dImQ6n | |
4852 | + dReQ1n*dReQ2n*dImQ3n*dImQ6n-dImQ1n*dImQ2n*dImQ3n*dImQ6n; | |
4853 | // Re[Q_{3n}Q_{3n}Q_{3n}^*Q_{2n}^*Q_{n}^*] | |
4854 | /*Double_t reQ3nQ3nQ3nstarQ2nstarQ1nstar = (pow(dImQ3n,2.)+pow(dReQ3n,2.)) | |
4855 | * (dImQ2n*dImQ3n*dReQ1n+dImQ1n*dImQ3n*dReQ2n | |
4856 | - dImQ1n*dImQ2n*dReQ3n+dReQ1n*dReQ2n*dReQ3n);*/ | |
4857 | /*// Re[Q_{3n}Q_{3n}Q_{2n}^*Q_{2n}^*Q_{2n}^*] | |
4858 | Double_t reQ3nQ3nQ2nstarQ2nstarQ2nstar = pow(dReQ2n,3.)*pow(dReQ3n,2.) | |
4859 | - 3.*dReQ2n*pow(dReQ3n,2.)*pow(dImQ2n,2.) | |
4860 | + 6.*pow(dReQ2n,2.)*dReQ3n*dImQ2n*dImQ3n | |
4861 | - 2.*dReQ3n*pow(dImQ2n,3.)*dImQ3n-pow(dReQ2n,3.)*pow(dImQ3n,2.) | |
4862 | + 3.*dReQ2n*pow(dImQ2n,2.)*pow(dImQ3n,2.);*/ | |
4863 | // Re[Q_{4n}Q_{2n}Q_{3n}^*Q_{2n}^*Q_{n}^*] | |
4864 | /*Double_t reQ4nQ2nQ3nstarQ2nstarQ1nstar = (pow(dImQ2n,2.)+pow(dReQ2n,2.)) | |
4865 | * (dImQ3n*dImQ4n*dReQ1n+dImQ1n*dImQ4n*dReQ3n | |
4866 | - dImQ1n*dImQ3n*dReQ4n+dReQ1n*dReQ3n*dReQ4n);*/ | |
4867 | // Re[Q_{3n}Q_{2n}Q_{3n}^*Q_{n}^*Q_{n}^*] | |
4868 | /*Double_t reQ3nQ2nQ3nstarQ1nstarQ1nstar = -(pow(dImQ3n,2.)+pow(dReQ3n,2.)) | |
4869 | * (-2.*dImQ1n*dImQ2n*dReQ1n+pow(dImQ1n,2.)*dReQ2n-pow(dReQ1n,2.)*dReQ2n);*/ | |
4870 | // Re[Q_{3n}Q_{2n}Q_{2n}^*Q_{2n}^*Q_{n}^*] | |
4871 | /*Double_t reQ3nQ2nQ2nstarQ2nstarQ1nstar = (pow(dImQ2n,2.)+pow(dReQ2n,2.)) | |
4872 | * (dImQ2n*dImQ3n*dReQ1n+dImQ1n*dImQ3n*dReQ2n | |
4873 | - dImQ1n*dImQ2n*dReQ3n+dReQ1n*dReQ2n*dReQ3n);*/ | |
4874 | /* // Re[Q_{5n}Q_{n}Q_{3n}^*Q_{2n}^*Q_{n}^*] | |
4875 | Double_t reQ5nQ1nQ3nstarQ2nstarQ1nstar = (pow(dImQ1n,2.)+pow(dReQ1n,2.)) | |
4876 | * (dImQ3n*dImQ5n*dReQ2n+dImQ2n*dImQ5n*dReQ3n | |
4877 | - dImQ2n*dImQ3n*dReQ5n+dReQ2n*dReQ3n*dReQ5n); | |
4878 | */ | |
4879 | /* | |
4880 | // Re[Q_{2n}Q_{2n}Q_{n}^*Q_{n}^*Q_{n}^*Q_{n}^*] | |
4881 | Double_t reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)*dReQ2n-2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.) | |
4882 | + dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dImQ2n) | |
4883 | * (pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.) | |
4884 | - dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n+pow(dImQ1n,2.)*dImQ2n); | |
4885 | // Re[Q_{3n}Q_{n}Q_{n}^*Q_{n}^*Q_{n}^*Q_{n}^*] | |
4886 | Double_t reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
4887 | * (pow(dReQ1n,3.)*dReQ3n-3.*dReQ1n*dReQ3n*pow(dImQ1n,2.) | |
4888 | + 3.*pow(dReQ1n,2.)*dImQ1n*dImQ3n-pow(dImQ1n,3.)*dImQ3n); | |
4889 | */ | |
4890 | // |Q_{2n}|^2 |Q_{n}|^4 | |
4891 | //Double_t dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.); | |
4892 | /* | |
4893 | // |Q_{3n}|^2 |Q_{2n}|^2 |Q_{n}|^2 | |
4894 | Double_t dQ3nQ2nQ1nQ3nstarQ2nstarQ1nstar = (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
4895 | * (pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
4896 | // Re[Q_{2n}Q_{n}Q_{n}Q_{n}^*Q_{n}^*Q_{n}^*Q_{n}^*] | |
4897 | Double_t reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
4898 | * (pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.) | |
4899 | + 2.*dReQ1n*dImQ1n*dImQ2n); | |
4900 | */ | |
4901 | // Re[Q_{6n}Q_{2n}^*Q_{2n}^*Q_{n}^*Q_{n}^*] | |
4902 | /*Double_t reQ6nQ2nstarQ2nstarQ1nstarQ1nstar = pow(dReQ1n*dReQ2n,2.)*dReQ6n-pow(dReQ2n*dImQ1n,2.)*dReQ6n | |
4903 | - 4.*dReQ1n*dReQ2n*dReQ6n*dImQ1n*dImQ2n | |
4904 | - pow(dReQ1n*dImQ2n,2.)*dReQ6n+pow(dImQ1n*dImQ2n,2.)*dReQ6n | |
4905 | + 2.*dReQ1n*pow(dReQ2n,2.)*dImQ1n*dImQ6n | |
4906 | + 2.*pow(dReQ1n,2.)*dReQ2n*dImQ2n*dImQ6n | |
4907 | - 2.*dReQ2n*pow(dImQ1n,2.)*dImQ2n*dImQ6n | |
4908 | - 2.*dReQ1n*dImQ1n*pow(dImQ2n,2.)*dImQ6n; | |
4909 | */ | |
4910 | // Re[Q_{4n}Q_{1n}Q_{1n}Q_{3n}^*Q_{3n}^*] | |
4911 | /* | |
4912 | Double_t reQ4nQ1nQ1nQ3nstarQ3nstar = pow(dReQ1n*dReQ3n,2.)*dReQ4n-pow(dReQ3n*dImQ1n,2.)*dReQ4n | |
4913 | + 4.*dReQ1n*dReQ3n*dReQ4n*dImQ1n*dImQ3n | |
4914 | - pow(dReQ1n*dImQ3n,2.)*dReQ4n+pow(dImQ1n*dImQ3n,2.)*dReQ4n | |
4915 | - 2.*dReQ1n*pow(dReQ3n,2.)*dImQ1n*dImQ4n | |
4916 | + 2.*pow(dReQ1n,2.)*dReQ3n*dImQ3n*dImQ4n | |
4917 | - 2.*dReQ3n*pow(dImQ1n,2.)*dImQ3n*dImQ4n | |
4918 | + 2.*dReQ1n*dImQ1n*pow(dImQ3n,2.)*dImQ4n;*/ | |
4919 | /* | |
4920 | // Re[Q_{3n}Q_{3n}Q_{2n}^*Q_{2n}^*Q_{1n}^*Q_{1n}^*] | |
4921 | Double_t reQ3nQ3nQ2nstarQ2nstarQ1nstarQ1nstar = (dReQ1n*dReQ2n*dReQ3n-dReQ2n*dReQ3n*dImQ1n-dReQ1n*dReQ3n*dImQ2n | |
4922 | - dReQ3n*dImQ1n*dImQ2n+dReQ1n*dReQ2n*dImQ3n+dReQ2n*dImQ1n*dImQ3n | |
4923 | + dReQ1n*dImQ2n*dImQ3n-dImQ1n*dImQ2n*dImQ3n)*(dReQ1n*dReQ2n*dReQ3n | |
4924 | + dReQ2n*dReQ3n*dImQ1n+dReQ1n*dReQ3n*dImQ2n-dReQ3n*dImQ1n*dImQ2n | |
4925 | - dReQ1n*dReQ2n*dImQ3n+dReQ2n*dImQ1n*dImQ3n+dReQ1n*dImQ2n*dImQ3n | |
4926 | + dImQ1n*dImQ2n*dImQ3n); | |
4927 | */ | |
4928 | ||
c10259fb | 4929 | // b) Determine multiplicity weights and fill some histos: |
e1d101a6 | 4930 | Double_t d2pMultiplicityWeight = 0.; // weight for <2>_{...} to get <<2>>_{...} |
4931 | Double_t d3pMultiplicityWeight = 0.; // weight for <3>_{...} to get <<3>>_{...} | |
4932 | Double_t d4pMultiplicityWeight = 0.; // weight for <4>_{...} to get <<4>>_{...} | |
4933 | Double_t d5pMultiplicityWeight = 0.; // weight for <5>_{...} to get <<5>>_{...} | |
c10259fb | 4934 | Double_t d6pMultiplicityWeight = 0.; // weight for <6>_{...} to get <<6>>_{...} |
e1d101a6 | 4935 | Double_t d7pMultiplicityWeight = 0.; // weight for <7>_{...} to get <<7>>_{...} |
c10259fb | 4936 | Double_t d8pMultiplicityWeight = 0.; // weight for <8>_{...} to get <<8>>_{...} |
df23c5ae | 4937 | if(fMultiplicityWeight->Contains("combinations")) // default multiplicity weight |
e1d101a6 | 4938 | { |
4939 | d2pMultiplicityWeight = dMult*(dMult-1.); | |
4940 | d3pMultiplicityWeight = dMult*(dMult-1.)*(dMult-2.); | |
4941 | d4pMultiplicityWeight = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
4942 | d5pMultiplicityWeight = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.); | |
c10259fb | 4943 | d6pMultiplicityWeight = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.); |
e1d101a6 | 4944 | d7pMultiplicityWeight = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.); |
c10259fb | 4945 | d8pMultiplicityWeight = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.); |
df23c5ae | 4946 | } else if(fMultiplicityWeight->Contains("unit")) |
e1d101a6 | 4947 | { |
4948 | d2pMultiplicityWeight = 1.; | |
4949 | d3pMultiplicityWeight = 1.; | |
4950 | d4pMultiplicityWeight = 1.; | |
4951 | d5pMultiplicityWeight = 1.; | |
c10259fb | 4952 | d6pMultiplicityWeight = 1.; |
e1d101a6 | 4953 | d7pMultiplicityWeight = 1.; |
c10259fb | 4954 | d8pMultiplicityWeight = 1.; |
df23c5ae | 4955 | } else if(fMultiplicityWeight->Contains("multiplicity")) |
e1d101a6 | 4956 | { |
4957 | d2pMultiplicityWeight = dMult; | |
4958 | d3pMultiplicityWeight = dMult; | |
4959 | d4pMultiplicityWeight = dMult; | |
4960 | d5pMultiplicityWeight = dMult; | |
c10259fb | 4961 | d6pMultiplicityWeight = dMult; |
e1d101a6 | 4962 | d7pMultiplicityWeight = dMult; |
c10259fb | 4963 | d8pMultiplicityWeight = dMult; |
4964 | } | |
4965 | for(Int_t p=0;p<=1;p++) // power (0=linear,1=quadratic) | |
4966 | { | |
4967 | fMixedHarmonicEventWeights[p]->Fill(0.5,pow(dMult,p+1)); | |
4968 | fMixedHarmonicEventWeights[p]->Fill(1.5,pow(d2pMultiplicityWeight,p+1)); | |
4969 | fMixedHarmonicEventWeights[p]->Fill(2.5,pow(d3pMultiplicityWeight,p+1)); | |
4970 | fMixedHarmonicEventWeights[p]->Fill(3.5,pow(d4pMultiplicityWeight,p+1)); | |
4971 | fMixedHarmonicEventWeights[p]->Fill(4.5,pow(d5pMultiplicityWeight,p+1)); | |
4972 | fMixedHarmonicEventWeights[p]->Fill(5.5,pow(d6pMultiplicityWeight,p+1)); | |
4973 | fMixedHarmonicEventWeights[p]->Fill(6.5,pow(d7pMultiplicityWeight,p+1)); | |
4974 | fMixedHarmonicEventWeights[p]->Fill(7.5,pow(d8pMultiplicityWeight,p+1)); | |
4975 | } // end of for(Int_t p=0;p<=1;p++) // power (0=linear,1=quadratic) | |
4976 | fMixedHarmonicProductOfEventWeights->Fill(0.5,0.5,dMult*dMult); | |
4977 | fMixedHarmonicProductOfEventWeights->Fill(0.5,1.5,dMult*d2pMultiplicityWeight); | |
4978 | fMixedHarmonicProductOfEventWeights->Fill(0.5,2.5,dMult*d3pMultiplicityWeight); | |
4979 | fMixedHarmonicProductOfEventWeights->Fill(0.5,3.5,dMult*d4pMultiplicityWeight); | |
4980 | fMixedHarmonicProductOfEventWeights->Fill(0.5,4.5,dMult*d5pMultiplicityWeight); | |
4981 | fMixedHarmonicProductOfEventWeights->Fill(0.5,5.5,dMult*d6pMultiplicityWeight); | |
4982 | fMixedHarmonicProductOfEventWeights->Fill(0.5,6.5,dMult*d7pMultiplicityWeight); | |
4983 | fMixedHarmonicProductOfEventWeights->Fill(0.5,7.5,dMult*d8pMultiplicityWeight); | |
4984 | fMixedHarmonicProductOfEventWeights->Fill(1.5,1.5,d2pMultiplicityWeight*d2pMultiplicityWeight); | |
4985 | fMixedHarmonicProductOfEventWeights->Fill(1.5,2.5,d2pMultiplicityWeight*d3pMultiplicityWeight); | |
4986 | fMixedHarmonicProductOfEventWeights->Fill(1.5,3.5,d2pMultiplicityWeight*d4pMultiplicityWeight); | |
4987 | fMixedHarmonicProductOfEventWeights->Fill(1.5,4.5,d2pMultiplicityWeight*d5pMultiplicityWeight); | |
4988 | fMixedHarmonicProductOfEventWeights->Fill(1.5,5.5,d2pMultiplicityWeight*d6pMultiplicityWeight); | |
4989 | fMixedHarmonicProductOfEventWeights->Fill(1.5,6.5,d2pMultiplicityWeight*d7pMultiplicityWeight); | |
4990 | fMixedHarmonicProductOfEventWeights->Fill(1.5,7.5,d2pMultiplicityWeight*d8pMultiplicityWeight); | |
4991 | fMixedHarmonicProductOfEventWeights->Fill(2.5,2.5,d3pMultiplicityWeight*d3pMultiplicityWeight); | |
4992 | fMixedHarmonicProductOfEventWeights->Fill(2.5,3.5,d3pMultiplicityWeight*d4pMultiplicityWeight); | |
4993 | fMixedHarmonicProductOfEventWeights->Fill(2.5,4.5,d3pMultiplicityWeight*d5pMultiplicityWeight); | |
4994 | fMixedHarmonicProductOfEventWeights->Fill(2.5,5.5,d3pMultiplicityWeight*d6pMultiplicityWeight); | |
4995 | fMixedHarmonicProductOfEventWeights->Fill(2.5,6.5,d3pMultiplicityWeight*d7pMultiplicityWeight); | |
4996 | fMixedHarmonicProductOfEventWeights->Fill(2.5,7.5,d3pMultiplicityWeight*d8pMultiplicityWeight); | |
4997 | fMixedHarmonicProductOfEventWeights->Fill(3.5,3.5,d4pMultiplicityWeight*d4pMultiplicityWeight); | |
4998 | fMixedHarmonicProductOfEventWeights->Fill(3.5,4.5,d4pMultiplicityWeight*d5pMultiplicityWeight); | |
4999 | fMixedHarmonicProductOfEventWeights->Fill(3.5,5.5,d4pMultiplicityWeight*d6pMultiplicityWeight); | |
5000 | fMixedHarmonicProductOfEventWeights->Fill(3.5,6.5,d4pMultiplicityWeight*d7pMultiplicityWeight); | |
5001 | fMixedHarmonicProductOfEventWeights->Fill(3.5,7.5,d4pMultiplicityWeight*d8pMultiplicityWeight); | |
5002 | fMixedHarmonicProductOfEventWeights->Fill(4.5,4.5,d5pMultiplicityWeight*d5pMultiplicityWeight); | |
5003 | fMixedHarmonicProductOfEventWeights->Fill(4.5,5.5,d5pMultiplicityWeight*d6pMultiplicityWeight); | |
5004 | fMixedHarmonicProductOfEventWeights->Fill(4.5,6.5,d5pMultiplicityWeight*d7pMultiplicityWeight); | |
5005 | fMixedHarmonicProductOfEventWeights->Fill(4.5,7.5,d5pMultiplicityWeight*d8pMultiplicityWeight); | |
5006 | fMixedHarmonicProductOfEventWeights->Fill(5.5,5.5,d6pMultiplicityWeight*d6pMultiplicityWeight); | |
5007 | fMixedHarmonicProductOfEventWeights->Fill(5.5,6.5,d6pMultiplicityWeight*d7pMultiplicityWeight); | |
5008 | fMixedHarmonicProductOfEventWeights->Fill(5.5,7.5,d6pMultiplicityWeight*d8pMultiplicityWeight); | |
5009 | fMixedHarmonicProductOfEventWeights->Fill(6.5,6.5,d7pMultiplicityWeight*d7pMultiplicityWeight); | |
5010 | fMixedHarmonicProductOfEventWeights->Fill(6.5,7.5,d7pMultiplicityWeight*d8pMultiplicityWeight); | |
5011 | fMixedHarmonicProductOfEventWeights->Fill(7.5,7.5,d8pMultiplicityWeight*d8pMultiplicityWeight); | |
5012 | ||
e1d101a6 | 5013 | // c) Calculate 2-p correlations: |
5014 | Double_t two1n1n = 0.; // <2>_{1n|1n} = <cos(1n(phi1-phi2))> | |
5015 | Double_t two2n2n = 0.; // <2>_{2n|2n} = <cos(2n(phi1-phi2))> | |
5016 | Double_t two3n3n = 0.; // <2>_{3n|3n} = <cos(3n(phi1-phi2))> | |
5017 | Double_t two4n4n = 0.; // <2>_{4n|4n} = <cos(4n(phi1-phi2))> | |
5018 | Double_t two5n5n = 0.; // <2>_{5n|5n} = <cos(5n(phi1-phi2))> | |
5019 | Double_t two6n6n = 0.; // <2>_{6n|6n} = <cos(6n(phi1-phi2))> | |
5020 | if(dMult>1.) | |
5021 | { | |
5022 | two1n1n = (pow(dReQ1n,2.)+pow(dImQ1n,2.)-dMult)/(dMult*(dMult-1.)); | |
5023 | two2n2n = (pow(dReQ2n,2.)+pow(dImQ2n,2.)-dMult)/(dMult*(dMult-1.)); | |
5024 | two3n3n = (pow(dReQ3n,2.)+pow(dImQ3n,2.)-dMult)/(dMult*(dMult-1.)); | |
5025 | two4n4n = (pow(dReQ4n,2.)+pow(dImQ4n,2.)-dMult)/(dMult*(dMult-1.)); | |
5026 | two5n5n = (pow(dReQ5n,2.)+pow(dImQ5n,2.)-dMult)/(dMult*(dMult-1.)); | |
5027 | two6n6n = (pow(dReQ6n,2.)+pow(dImQ6n,2.)-dMult)/(dMult*(dMult-1.)); | |
5028 | f2pCorrelations->Fill(0.5,two1n1n,d2pMultiplicityWeight); | |
5029 | f2pCorrelations->Fill(1.5,two2n2n,d2pMultiplicityWeight); | |
5030 | f2pCorrelations->Fill(2.5,two3n3n,d2pMultiplicityWeight); | |
5031 | f2pCorrelations->Fill(3.5,two4n4n,d2pMultiplicityWeight); | |
5032 | f2pCorrelations->Fill(4.5,two5n5n,d2pMultiplicityWeight); | |
5033 | f2pCorrelations->Fill(5.5,two6n6n,d2pMultiplicityWeight); | |
c10259fb | 5034 | allMixedCorrelators[0]=two1n1n; |
5035 | allMixedCorrelators[1]=two2n2n; | |
5036 | allMixedCorrelators[2]=two3n3n; | |
5037 | allMixedCorrelators[3]=two4n4n; | |
5038 | allMixedCorrelators[4]=two5n5n; | |
5039 | allMixedCorrelators[5]=two6n6n; | |
e1d101a6 | 5040 | } // end of if(dMult>1.) |
5041 | ||
5042 | // d) Calculate 3-p correlations: | |
5043 | // d1) Two distinct harmonics (3): | |
5044 | Double_t three2n1n1n = 0.; // <3>_{2n|1n,1n} = <cos(n(2*phi1-1*phi2-1*phi3))> | |
5045 | Double_t three4n2n2n = 0.; // <3>_{4n|2n,2n} = <cos(n(4*phi1-2*phi2-2*phi3))> | |
5046 | Double_t three6n3n3n = 0.; // <3>_{6n|3n,3n} = <cos(n(6*phi1-3*phi2-3*phi3))> | |
5047 | // d2) Three distinct harmonics (6): | |
5048 | Double_t three3n2n1n = 0.; // <3>_{3n|2n,1n} = <cos(n(3*phi1-2*phi2-1*phi3))> | |
5049 | Double_t three4n3n1n = 0.; // <3>_{4n|3n,1n} = <cos(n(4*phi1-3*phi2-1*phi3))> | |
5050 | Double_t three5n3n2n = 0.; // <3>_{5n|3n,2n} = <cos(n(5*phi1-3*phi2-2*phi3))> | |
5051 | Double_t three5n4n1n = 0.; // <3>_{5n|4n,1n} = <cos(n(5*phi1-4*phi2-1*phi3))> | |
5052 | Double_t three6n4n2n = 0.; // <3>_{6n|4n,2n} = <cos(n(6*phi1-4*phi2-2*phi3))> | |
5053 | Double_t three6n5n1n = 0.; // <3>_{6n|5n,1n} = <cos(n(6*phi1-5*phi2-1*phi3))> | |
5054 | if(dMult>2.) | |
5055 | { | |
5056 | three2n1n1n = (pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n | |
5057 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-(pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult) | |
5058 | / (dMult*(dMult-1.)*(dMult-2.)); | |
5059 | three4n2n2n = (pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n | |
5060 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-(pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*dMult) | |
5061 | / (dMult*(dMult-1.)*(dMult-2.)); | |
5062 | three6n3n3n = (reQ6nQ3nstarQ3nstar | |
c10259fb | 5063 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) |
e1d101a6 | 5064 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))+2.*dMult) |
5065 | / (dMult*(dMult-1.)*(dMult-2.)); | |
5066 | three3n2n1n = (dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n | |
5067 | + dImQ3n*dImQ2n*dReQ1n-(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5068 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))-(pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
5069 | / (dMult*(dMult-1.)*(dMult-2.)); | |
5070 | three4n3n1n = (dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n) | |
5071 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))-(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5072 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
5073 | / (dMult*(dMult-1.)*(dMult-2.)); | |
5074 | three5n3n2n = (dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n | |
5075 | + dImQ5n*dImQ2n*dReQ3n-(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
5076 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5077 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult) | |
5078 | / (dMult*(dMult-1.)*(dMult-2.)); | |
5079 | three5n4n1n = (dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n | |
5080 | + dImQ5n*dImQ4n*dReQ1n-(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
5081 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
5082 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
5083 | / (dMult*(dMult-1.)*(dMult-2.)); | |
5084 | three6n4n2n = (dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n | |
5085 | + dImQ6n*dImQ4n*dReQ2n-(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
5086 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))-(pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult) | |
5087 | / (dMult*(dMult-1.)*(dMult-2.)); | |
5088 | three6n5n1n = (dReQ6n*dReQ5n*dReQ1n-dReQ6n*dImQ5n*dImQ1n+dImQ6n*dReQ5n*dImQ1n | |
5089 | + dImQ6n*dImQ5n*dReQ1n-(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
5090 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
5091 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
5092 | / (dMult*(dMult-1.)*(dMult-2.)); | |
5093 | f3pCorrelations->Fill(0.5,three2n1n1n,d3pMultiplicityWeight); | |
5094 | f3pCorrelations->Fill(1.5,three4n2n2n,d3pMultiplicityWeight); | |
5095 | f3pCorrelations->Fill(2.5,three6n3n3n,d3pMultiplicityWeight); | |
5096 | //f3pCorrelations->Fill(3.5,0.,d3pMultiplicityWeight); // empty TBI | |
5097 | f3pCorrelations->Fill(4.5,three3n2n1n,d3pMultiplicityWeight); | |
5098 | f3pCorrelations->Fill(5.5,three4n3n1n,d3pMultiplicityWeight); | |
5099 | f3pCorrelations->Fill(6.5,three5n3n2n,d3pMultiplicityWeight); | |
5100 | f3pCorrelations->Fill(7.5,three5n4n1n,d3pMultiplicityWeight); | |
5101 | f3pCorrelations->Fill(8.5,three6n4n2n,d3pMultiplicityWeight); | |
5102 | f3pCorrelations->Fill(9.5,three6n5n1n,d3pMultiplicityWeight); | |
c10259fb | 5103 | allMixedCorrelators[6]=three2n1n1n; |
5104 | allMixedCorrelators[7]=three4n2n2n; | |
5105 | allMixedCorrelators[8]=three6n3n3n; | |
5106 | allMixedCorrelators[9]=three3n2n1n; | |
5107 | allMixedCorrelators[10]=three4n3n1n; | |
5108 | allMixedCorrelators[11]=three5n3n2n; | |
5109 | allMixedCorrelators[12]=three5n4n1n; | |
5110 | allMixedCorrelators[13]=three6n4n2n; | |
5111 | allMixedCorrelators[14]=three6n5n1n; | |
e1d101a6 | 5112 | } // end of if(dMult>2.) |
5113 | ||
5114 | // e) Calculate 4-p correlations: | |
5115 | // e1) Single harmonic (6): | |
5116 | Double_t four1n1n1n1n = 0.; // <4>_{1n,1n|1n,1n} = <cos(1*n(phi1+phi2-phi3-phi4))> | |
5117 | Double_t four2n2n2n2n = 0.; // <4>_{2n,2n|2n,2n} = <cos(2*n(phi1+phi2-phi3-phi4))> | |
5118 | Double_t four3n3n3n3n = 0.; // <4>_{3n,3n|3n,3n} = <cos(3*n(phi1+phi2-phi3-phi4))> | |
5119 | Double_t four4n4n4n4n = 0.; // <4>_{4n,4n|4n,4n} = <cos(4*n(phi1+phi2-phi3-phi4))> | |
5120 | Double_t four5n5n5n5n = 0.; // <4>_{5n,5n|5n,5n} = <cos(5*n(phi1+phi2-phi3-phi4))> | |
5121 | Double_t four6n6n6n6n = 0.; // <4>_{6n,6n|6n,6n} = <cos(6*n(phi1+phi2-phi3-phi4))> | |
5122 | // e2) "Standard candles" (15): | |
5123 | Double_t four2n1n2n1n = 0.; // <4>_{2n,1n|2n,1n} = <cos(n(2*phi1+1*phi2-2*phi3-1*phi4))> | |
5124 | Double_t four3n1n3n1n = 0.; // <4>_{3n,1n|3n,1n} = <cos(n(3*phi1+1*phi2-3*phi3-1*phi4))> | |
5125 | Double_t four3n2n3n2n = 0.; // <4>_{3n,2n|3n,2n} = <cos(n(3*phi1+2*phi2-3*phi3-2*phi4))> | |
5126 | Double_t four4n1n4n1n = 0.; // <4>_{4n,1n|4n,1n} = <cos(n(4*phi1+1*phi2-4*phi3-1*phi4))> | |
5127 | Double_t four4n2n4n2n = 0.; // <4>_{4n,2n|4n,2n} = <cos(n(4*phi1+2*phi2-4*phi3-2*phi4))> | |
5128 | Double_t four4n3n4n3n = 0.; // <4>_{4n,3n|4n,3n} = <cos(n(4*phi1+3*phi2-4*phi3-3*phi4))> | |
5129 | Double_t four5n1n5n1n = 0.; // <4>_{5n,1n|5n,1n} = <cos(n(5*phi1+1*phi2-5*phi3-1*phi4))> | |
5130 | Double_t four5n2n5n2n = 0.; // <4>_{5n,2n|5n,2n} = <cos(n(5*phi1+2*phi2-5*phi3-2*phi4))> | |
5131 | Double_t four5n3n5n3n = 0.; // <4>_{5n,3n|5n,3n} = <cos(n(5*phi1+3*phi2-5*phi3-3*phi4))> | |
5132 | Double_t four5n4n5n4n = 0.; // <4>_{5n,4n|5n,4n} = <cos(n(5*phi1+4*phi2-5*phi3-4*phi4))> | |
5133 | Double_t four6n1n6n1n = 0.; // <4>_{6n,1n|6n,1n} = <cos(n(6*phi1+1*phi2-6*phi3-1*phi4))> | |
5134 | Double_t four6n2n6n2n = 0.; // <4>_{6n,2n|6n,2n} = <cos(n(6*phi1+2*phi2-6*phi3-2*phi4))> | |
5135 | Double_t four6n3n6n3n = 0.; // <4>_{6n,3n|6n,3n} = <cos(n(6*phi1+3*phi2-6*phi3-3*phi4))> | |
5136 | Double_t four6n4n6n4n = 0.; // <4>_{6n,4n|6n,4n} = <cos(n(6*phi1+4*phi2-6*phi3-4*phi4))> | |
5137 | Double_t four6n5n6n5n = 0.; // <4>_{6n,5n|6n,5n} = <cos(n(6*phi1+5*phi2-6*phi3-5*phi4))> | |
5138 | // e3) Two distinct harmonics (2): | |
5139 | Double_t four3n1n1n1n = 0.; // <4>_{3n|1n,1n,1n} = <cos(n(3*phi1-1*phi2-1*phi3-1*phi4))> | |
5140 | Double_t four6n2n2n2n = 0.; // <4>_{6n|2n,2n,2n} = <cos(n(6*phi1-2*phi2-2*phi3-2*phi4))> | |
5141 | // e4) Three distinct harmonics (10): | |
5142 | Double_t four3n1n2n2n = 0.; // <4>_{3n,1n|2n,2n} = <cos(n(3*phi1+1*phi2-2*phi3-2*phi4))> | |
5143 | Double_t four4n2n1n1n = 0.; // <4>_{4n|2n,1n,1n} = <cos(n(4*phi1-2*phi2-1*phi3-1*phi4))> | |
5144 | Double_t four4n2n3n3n = 0.; // <4>_{4n,2n|3n,3n} = <cos(n(4*phi1+2*phi2-3*phi3-3*phi4))> | |
5145 | Double_t four5n2n2n1n = 0.; // <4>_{5n|2n,2n,1n} = <cos(n(5*phi1-2*phi2-2*phi3-1*phi4))> | |
5146 | Double_t four5n3n1n1n = 0.; // <4>_{5n|3n,1n,1n} = <cos(n(5*phi1-3*phi2-1*phi3-1*phi4))> | |
5147 | Double_t four5n1n3n3n = 0.; // <4>_{5n,1n|3n,3n} = <cos(n(5*phi1+1*phi2-3*phi3-3*phi4))> | |
5148 | Double_t four5n3n4n4n = 0.; // <4>_{5n,3n|4n,4n} = <cos(n(5*phi1+3*phi2-4*phi3-4*phi4))> | |
5149 | Double_t four6n4n1n1n = 0.; // <4>_{6n|4n,1n,1n} = <cos(n(6*phi1-4*phi2-1*phi3-1*phi4))> | |
5150 | Double_t four6n2n4n4n = 0.; // <4>_{6n,2n|4n,4n} = <cos(n(6*phi1+2*phi2-4*phi3-4*phi4))> | |
5151 | Double_t four6n4n5n5n = 0.; // <4>_{6n,4n|5n,5n} = <cos(n(6*phi1+4*phi2-5*phi3-5*phi4))> | |
5152 | // e5) Four distinct harmonics (8): | |
5153 | Double_t four4n1n3n2n = 0.; // <4>_{4n,1n|3n,2n} = <cos(n(4*phi1+1*phi2-3*phi3-2*phi4))> | |
5154 | Double_t four5n1n4n2n = 0.; // <4>_{5n,1n|4n,2n} = <cos(n(5*phi1+1*phi2-4*phi3-2*phi4))> | |
5155 | Double_t four5n2n4n3n = 0.; // <4>_{5n,2n|4n,3n} = <cos(n(5*phi1+2*phi2-4*phi3-3*phi4))> | |
5156 | Double_t four6n1n4n3n = 0.; // <4>_{6n,1n|4n,3n} = <cos(n(6*phi1+1*phi2-4*phi3-3*phi4))> | |
5157 | Double_t four6n1n5n2n = 0.; // <4>_{6n,1n|5n,2n} = <cos(n(6*phi1+1*phi2-5*phi3-2*phi4))> | |
5158 | Double_t four6n3n2n1n = 0.; // <4>_{6n|3n,2n,1n} = <cos(n(6*phi1-3*phi2-2*phi3-1*phi4))> | |
5159 | Double_t four6n2n5n3n = 0.; // <4>_{6n,2n|5n,3n} = <cos(n(6*phi1+2*phi2-5*phi3-3*phi4))> | |
5160 | Double_t four6n3n5n4n = 0.; // <4>_{6n,3n|5n,4n} = <cos(n(6*phi1+3*phi2-5*phi3-4*phi4))> | |
5161 | if(dMult>3.) | |
5162 | { | |
5163 | // Single harmonic (6): | |
5164 | four1n1n1n1n = (2.*dMult*(dMult-3.)+pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ1n,2.) | |
5165 | + pow(dImQ1n,2.))-2.*(pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
5166 | + (pow(dReQ2n,2.)+pow(dImQ2n,2.))) | |
5167 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
5168 | four2n2n2n2n = (2.*dMult*(dMult-3.)+pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ2n,2.) | |
5169 | + pow(dImQ2n,2.))-2.*(pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
5170 | + (pow(dReQ4n,2.)+pow(dImQ4n,2.))) | |
5171 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
5172 | four3n3n3n3n = (2.*dMult*(dMult-3.)+pow((pow(dReQ3n,2.)+pow(dImQ3n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ3n,2.) | |
5173 | + pow(dImQ3n,2.))-2.*(pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n) | |
5174 | + (pow(dReQ6n,2.)+pow(dImQ6n,2.))) | |
5175 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
5176 | four4n4n4n4n = (2.*dMult*(dMult-3.)+pow((pow(dReQ4n,2.)+pow(dImQ4n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ4n,2.) | |
5177 | + pow(dImQ4n,2.))-2.*(pow(dReQ4n,2.)*dReQ8n+2.*dReQ4n*dImQ4n*dImQ8n-pow(dImQ4n,2.)*dReQ8n) | |
5178 | + (pow(dReQ8n,2.)+pow(dImQ8n,2.))) | |
5179 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
5180 | four5n5n5n5n = (2.*dMult*(dMult-3.)+pow((pow(dReQ5n,2.)+pow(dImQ5n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ5n,2.) | |
5181 | + pow(dImQ5n,2.))-2.*(pow(dReQ5n,2.)*dReQ10n+2.*dReQ5n*dImQ5n*dImQ10n-pow(dImQ5n,2.)*dReQ10n) | |
5182 | + (pow(dReQ10n,2.)+pow(dImQ10n,2.))) | |
5183 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
5184 | four6n6n6n6n = (2.*dMult*(dMult-3.)+pow((pow(dReQ6n,2.)+pow(dImQ6n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ6n,2.) | |
5185 | + pow(dImQ6n,2.))-2.*(pow(dReQ6n,2.)*dReQ12n+2.*dReQ6n*dImQ6n*dImQ12n-pow(dImQ6n,2.)*dReQ12n) | |
5186 | + (pow(dReQ12n,2.)+pow(dImQ12n,2.))) | |
5187 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
5188 | // "Standard candles" (15): | |
5189 | four2n1n2n1n = ((pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
5190 | - 2.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n | |
5191 | + dImQ3n*dImQ2n*dReQ1n)-2.*(pow(dReQ1n,2.)*dReQ2n | |
5192 | + 2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n)) | |
5193 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
5194 | - ((dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
5195 | + (dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-(pow(dReQ3n,2.)+pow(dImQ3n,2.))) | |
5196 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
5197 | + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5198 | four3n1n3n1n = ((pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
5199 | - 2.*(dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
5200 | - 2.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
5201 | + pow(dReQ4n,2.)+pow(dImQ4n,2.)-(dMult-4.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5202 | + pow(dReQ2n,2.)+pow(dImQ2n,2.)-(dMult-4.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
5203 | + dMult*(dMult-6.)) | |
5204 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5205 | four3n2n3n2n = ((pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5206 | - 2.*(dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n+dImQ5n*dImQ2n*dReQ3n) | |
5207 | - 2.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
5208 | + pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.) | |
5209 | - (dMult-4.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
5210 | + dMult*(dMult-6.)) | |
5211 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5212 | four4n1n4n1n = ((pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
5213 | - 2.*(dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ1n*dImQ4n+dImQ5n*dImQ1n*dReQ4n) | |
5214 | - 2.*(dReQ3n*dReQ4n*dReQ1n+dImQ3n*dImQ4n*dReQ1n+dReQ3n*dImQ4n*dImQ1n-dImQ3n*dImQ1n*dReQ4n) | |
5215 | + pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.) | |
5216 | - (dMult-4.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
5217 | + dMult*(dMult-6.)) | |
5218 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5219 | four4n2n4n2n = ((pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
5220 | - 2.*(dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n | |
5221 | + dImQ6n*dImQ4n*dReQ2n)-2.*(pow(dReQ2n,2.)*dReQ4n | |
5222 | + 2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n)) | |
5223 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
5224 | - ((dMult-5.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
5225 | + (dMult-4.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-(pow(dReQ6n,2.)+pow(dImQ6n,2.))) | |
5226 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
5227 | + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5228 | four4n3n4n3n = ((pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5229 | - 2.*(dReQ7n*dReQ4n*dReQ3n-dReQ7n*dImQ4n*dImQ3n+dImQ7n*dReQ3n*dImQ4n+dImQ7n*dImQ3n*dReQ4n) | |
5230 | - 2.*(dReQ1n*dReQ4n*dReQ3n+dImQ1n*dImQ4n*dReQ3n+dReQ1n*dImQ4n*dImQ3n-dImQ1n*dImQ3n*dReQ4n) | |
5231 | + pow(dReQ7n,2.)+pow(dImQ7n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.) | |
5232 | - (dMult-4.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5233 | + dMult*(dMult-6.)) | |
5234 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5235 | four5n1n5n1n = (((pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
5236 | - 2.*(dReQ6n*dReQ5n*dReQ1n-dReQ6n*dImQ5n*dImQ1n+dImQ6n*dReQ5n*dImQ1n+dImQ6n*dImQ5n*dReQ1n) | |
5237 | - 2.*(dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n+dImQ5n*dImQ4n*dReQ1n) | |
5238 | + pow(dReQ6n,2.)+pow(dImQ6n,2.)-(dMult-4.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
5239 | + pow(dReQ4n,2.)+pow(dImQ4n,2.)-(dMult-4.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+dMult*(dMult-6.)) | |
5240 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5241 | four5n2n5n2n = ((pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
5242 | - 2.*(dReQ7n*dReQ5n*dReQ2n-dReQ7n*dImQ5n*dImQ2n+dImQ7n*dReQ2n*dImQ5n+dImQ7n*dImQ2n*dReQ5n) | |
5243 | - 2.*(dReQ3n*dReQ5n*dReQ2n+dImQ3n*dImQ5n*dReQ2n+dReQ3n*dImQ5n*dImQ2n-dImQ3n*dImQ2n*dReQ5n) | |
5244 | + pow(dReQ7n,2.)+pow(dImQ7n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.) | |
5245 | - (dMult-4.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
5246 | + dMult*(dMult-6.)) | |
5247 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5248 | four5n3n5n3n = ((pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5249 | - 2.*(dReQ8n*dReQ5n*dReQ3n-dReQ8n*dImQ5n*dImQ3n+dImQ8n*dReQ3n*dImQ5n+dImQ8n*dImQ3n*dReQ5n) | |
5250 | - 2.*(dReQ2n*dReQ5n*dReQ3n+dImQ2n*dImQ5n*dReQ3n+dReQ2n*dImQ5n*dImQ3n-dImQ2n*dImQ3n*dReQ5n) | |
5251 | + pow(dReQ8n,2.)+pow(dImQ8n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.) | |
5252 | - (dMult-4.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5253 | + dMult*(dMult-6.)) | |
5254 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5255 | four5n4n5n4n = ((pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
5256 | - 2.*(dReQ9n*dReQ5n*dReQ4n-dReQ9n*dImQ5n*dImQ4n+dImQ9n*dReQ4n*dImQ5n+dImQ9n*dImQ4n*dReQ5n) | |
5257 | - 2.*(dReQ1n*dReQ5n*dReQ4n+dImQ1n*dImQ5n*dReQ4n+dReQ1n*dImQ5n*dImQ4n-dImQ1n*dImQ4n*dReQ5n) | |
5258 | + pow(dReQ9n,2.)+pow(dImQ9n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.) | |
5259 | - (dMult-4.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
5260 | + dMult*(dMult-6.)) | |
5261 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5262 | four6n1n6n1n = ((pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
5263 | - 2.*(dReQ7n*dReQ6n*dReQ1n-dReQ7n*dImQ6n*dImQ1n+dImQ7n*dReQ1n*dImQ6n+dImQ7n*dImQ1n*dReQ6n) | |
5264 | - 2.*(dReQ5n*dReQ6n*dReQ1n+dImQ5n*dImQ6n*dReQ1n+dReQ5n*dImQ6n*dImQ1n-dImQ5n*dImQ1n*dReQ6n) | |
5265 | + pow(dReQ7n,2.)+pow(dImQ7n,2.)+pow(dReQ5n,2.)+pow(dImQ5n,2.) | |
5266 | - (dMult-4.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
5267 | + dMult*(dMult-6.)) | |
5268 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5269 | four6n2n6n2n = ((pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
5270 | - 2.*(dReQ8n*(dReQ6n*dReQ2n-dImQ6n*dImQ2n)+dImQ8n*(dReQ6n*dImQ2n+dImQ6n*dReQ2n)) | |
5271 | - 2.*(dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n) | |
5272 | + pow(dReQ8n,2.)+pow(dImQ8n,2.)-(dMult-4.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
5273 | + pow(dReQ4n,2.)+pow(dImQ4n,2.)-(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
5274 | + dMult*(dMult-6.)) | |
5275 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5276 | four6n3n6n3n = ((pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5277 | - 2.*(dReQ9n*dReQ6n*dReQ3n-dReQ9n*dImQ6n*dImQ3n+dImQ9n*dReQ6n*dImQ3n | |
5278 | + dImQ9n*dImQ6n*dReQ3n)-2.*(pow(dReQ3n,2.)*dReQ6n | |
5279 | + 2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n)) | |
5280 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
5281 | - ((dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5282 | + (dMult-4.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-(pow(dReQ9n,2.)+pow(dImQ9n,2.))) | |
5283 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
5284 | + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5285 | four6n4n6n4n = ((pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
5286 | - 2.*(dReQ10n*dReQ4n*dReQ6n-dReQ10n*dImQ4n*dImQ6n+dImQ10n*dReQ4n*dImQ6n+dImQ10n*dImQ4n*dReQ6n) | |
5287 | - 2.*(dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n) | |
5288 | + pow(dReQ10n,2.)+pow(dImQ10n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.) | |
5289 | - (dMult-4.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
5290 | + dMult*(dMult-6.)) | |
5291 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5292 | four6n5n6n5n = ((pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
5293 | - 2.*(dReQ11n*dReQ6n*dReQ5n-dReQ11n*dImQ6n*dImQ5n+dImQ11n*dReQ5n*dImQ6n+dImQ11n*dImQ5n*dReQ6n) | |
5294 | - 2.*(dReQ1n*dReQ6n*dReQ5n+dImQ1n*dImQ6n*dReQ5n+dReQ1n*dImQ6n*dImQ5n-dImQ1n*dImQ5n*dReQ6n) | |
5295 | + pow(dReQ11n,2.)+pow(dImQ11n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.) | |
5296 | - (dMult-4.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)+pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
5297 | + dMult*(dMult-6.)) | |
5298 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5299 | // Two distinct harmonics (2): | |
5300 | four3n1n1n1n = (dReQ3n*pow(dReQ1n,3)-3.*dReQ1n*dReQ3n*pow(dImQ1n,2) | |
5301 | + 3.*dImQ1n*dImQ3n*pow(dReQ1n,2)-dImQ3n*pow(dImQ1n,3) | |
5302 | - 3.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
5303 | - 3.*(pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
5304 | + 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
5305 | + 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
5306 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5307 | four6n2n2n2n = (dReQ6n*pow(dReQ2n,3)-3.*dReQ2n*dReQ6n*pow(dImQ2n,2) | |
5308 | + 3.*dImQ2n*dImQ6n*pow(dReQ2n,2)-dImQ6n*pow(dImQ2n,3) | |
5309 | - 3.*(dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n) | |
5310 | - 3.*(pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
5311 | + 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))+3.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
5312 | + 6.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-6.*dMult) | |
5313 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5314 | // Three distinct harmonics (10): | |
5315 | four3n1n2n2n = ((pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n) | |
5316 | + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n) | |
5317 | - (pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
5318 | - (dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
5319 | - 2.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n)) | |
5320 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
5321 | - (2.*(pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
5322 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5323 | - 4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
5324 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
5325 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5326 | four4n2n1n1n = ((dReQ4n*dReQ2n+dImQ4n*dImQ2n)*(pow(dReQ1n,2)-pow(dImQ1n,2)) | |
5327 | + 2.*dReQ1n*dImQ1n*(dImQ4n*dReQ2n-dReQ4n*dImQ2n) | |
5328 | - 2.*(dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
5329 | - (pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
5330 | - 2.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n)) | |
5331 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
5332 | - ((pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
5333 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5334 | - 3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
5335 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
5336 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5337 | four4n2n3n3n = ((dReQ4n*dReQ2n-dImQ4n*dImQ2n)*(dReQ3n*dReQ3n-dImQ3n*dImQ3n) | |
5338 | + 2.*(dReQ4n*dImQ2n+dImQ4n*dReQ2n)*dReQ3n*dImQ3n | |
5339 | - (dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n) | |
5340 | - (pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n) | |
5341 | - 2.*(dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
5342 | - 2.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
5343 | + (pow(dReQ6n,2.)+pow(dImQ6n,2.))+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
5344 | + 2.*(2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
5345 | + (pow(dReQ1n,2.)+pow(dImQ1n,2.))-3.*dMult)) | |
5346 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5347 | four5n2n2n1n = (-pow(dImQ2n,2.)*dImQ1n*dImQ5n+dImQ1n*dImQ5n*pow(dReQ2n,2.) | |
5348 | + 2.*dImQ2n*dImQ5n*dReQ2n*dReQ1n-2.*dImQ2n*dImQ1n*dReQ2n*dReQ5n | |
5349 | - pow(dImQ2n,2.)*dReQ1n*dReQ5n+pow(dReQ2n,2.)*dReQ1n*dReQ5n | |
5350 | - (dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n+dImQ5n*dImQ4n*dReQ1n) | |
5351 | - 2.*(dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n+dImQ5n*dImQ2n*dReQ3n) | |
5352 | - (pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
5353 | - 2.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
5354 | + 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))+pow(dReQ4n,2.)+pow(dImQ4n,2.) | |
5355 | + 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
5356 | + 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
5357 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5358 | four5n3n1n1n = (-pow(dImQ1n,2.)*dImQ3n*dImQ5n+dImQ3n*dImQ5n*pow(dReQ1n,2.) | |
5359 | + 2.*dImQ1n*dImQ5n*dReQ1n*dReQ3n-2.*dImQ1n*dImQ3n*dReQ1n*dReQ5n | |
5360 | - pow(dImQ1n,2.)*dReQ3n*dReQ5n+pow(dReQ1n,2.)*dReQ3n*dReQ5n | |
5361 | - 2.*(dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n+dImQ5n*dImQ4n*dReQ1n) | |
5362 | - (dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n+dImQ5n*dImQ2n*dReQ3n) | |
5363 | - 2.*(dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
5364 | - (pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
5365 | + 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
5366 | + 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+pow(dReQ2n,2.)+pow(dImQ2n,2.) | |
5367 | + 4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
5368 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5369 | four5n1n3n3n = (dImQ1n*pow(dImQ3n,2.)*dImQ5n+2.*dImQ3n*dImQ5n*dReQ1n*dReQ3n | |
5370 | - dImQ1n*dImQ5n*pow(dReQ3n,2.)-pow(dImQ3n,2.)*dReQ1n*dReQ5n | |
5371 | + 2.*dImQ1n*dImQ3n*dReQ3n*dReQ5n+dReQ1n*pow(dReQ3n,2.)*dReQ5n | |
5372 | - (dReQ6n*dReQ5n*dReQ1n-dReQ6n*dImQ5n*dImQ1n+dImQ6n*dReQ5n*dImQ1n+dImQ6n*dImQ5n*dReQ1n) | |
5373 | - (pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n) | |
5374 | - 2.*(dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n+dImQ5n*dImQ2n*dReQ3n) | |
5375 | - 2.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
5376 | + pow(dReQ6n,2.)+pow(dImQ6n,2.)+2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
5377 | + 4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
5378 | + 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
5379 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5380 | four5n3n4n4n = ((pow(dReQ4n,2.)-pow(dImQ4n,2.))*(dReQ5n*dReQ3n-dImQ5n*dImQ3n) | |
5381 | + 2.*dReQ4n*dImQ4n*(dReQ5n*dImQ3n+dImQ5n*dReQ3n) | |
5382 | - (dReQ8n*dReQ3n*dReQ5n-dReQ8n*dImQ3n*dImQ5n+dImQ8n*dReQ3n*dImQ5n+dImQ8n*dImQ3n*dReQ5n) | |
5383 | - (pow(dReQ4n,2.)*dReQ8n+2.*dReQ4n*dImQ4n*dImQ8n-pow(dImQ4n,2.)*dReQ8n) | |
5384 | - 2.*(dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n+dImQ5n*dImQ4n*dReQ1n) | |
5385 | - 2.*(dReQ4n*dReQ3n*dReQ1n-dReQ4n*dImQ3n*dImQ1n+dImQ4n*dReQ3n*dImQ1n+dImQ4n*dImQ3n*dReQ1n) | |
5386 | + pow(dReQ8n,2.)+pow(dImQ8n,2.)+2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
5387 | + 4.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5388 | + 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
5389 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5390 | four6n4n1n1n = (-pow(dImQ1n,2.)*dImQ4n*dImQ6n+dImQ4n*dImQ6n*pow(dReQ1n,2.) | |
5391 | + 2.*dImQ1n*dImQ6n*dReQ1n*dReQ4n-2.*dImQ1n*dImQ4n*dReQ1n*dReQ6n | |
5392 | - pow(dImQ1n,2.)*dReQ4n*dReQ6n+pow(dReQ1n,2.)*dReQ4n*dReQ6n | |
5393 | - 2.*(dReQ6n*dReQ5n*dReQ1n-dReQ6n*dImQ5n*dImQ1n+dImQ6n*dReQ5n*dImQ1n+dImQ6n*dImQ5n*dReQ1n) | |
5394 | - (dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n) | |
5395 | - 2.*(dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n+dImQ5n*dImQ4n*dReQ1n) | |
5396 | - (pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
5397 | + 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)+pow(dReQ5n,2.)+pow(dImQ5n,2.) | |
5398 | + pow(dReQ4n,2.)+pow(dImQ4n,2.))+pow(dReQ2n,2.)+pow(dImQ2n,2.) | |
5399 | + 4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
5400 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5401 | four6n2n4n4n = ((pow(dReQ4n,2.)-pow(dImQ4n,2.))*(dReQ6n*dReQ2n-dImQ6n*dImQ2n) | |
5402 | + 2.*dReQ4n*dImQ4n*(dReQ6n*dImQ2n+dImQ6n*dReQ2n) | |
5403 | - (pow(dReQ4n,2.)*dReQ8n+2.*dReQ4n*dImQ4n*dImQ8n-pow(dImQ4n,2.)*dReQ8n) | |
5404 | - (dReQ8n*(dReQ6n*dReQ2n-dImQ6n*dImQ2n)+dImQ8n*(dReQ6n*dImQ2n+dImQ6n*dReQ2n)) | |
5405 | - 2.*(dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n)) | |
5406 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
5407 | - (2.*(pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
5408 | - (pow(dReQ8n,2.)+pow(dImQ8n,2.))-2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
5409 | - 4.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))) | |
5410 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
5411 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5412 | four6n4n5n5n = ((pow(dReQ5n,2.)-pow(dImQ5n,2.))*(dReQ6n*dReQ4n-dImQ6n*dImQ4n) | |
5413 | + 2.*dReQ5n*dImQ5n*(dReQ6n*dImQ4n+dImQ6n*dReQ4n) | |
5414 | - (dReQ10n*dReQ4n*dReQ6n-dReQ10n*dImQ4n*dImQ6n+dImQ10n*dReQ4n*dImQ6n+dImQ10n*dImQ4n*dReQ6n) | |
5415 | - (pow(dReQ5n,2.)*dReQ10n+2.*dReQ5n*dImQ5n*dImQ10n-pow(dImQ5n,2.)*dReQ10n) | |
5416 | - 2.*(dReQ6n*dReQ5n*dReQ1n-dReQ6n*dImQ5n*dImQ1n+dImQ6n*dReQ5n*dImQ1n+dImQ6n*dImQ5n*dReQ1n) | |
5417 | - 2.*(dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n+dImQ5n*dImQ4n*dReQ1n) | |
5418 | + pow(dReQ10n,2.)+pow(dImQ10n,2.)+2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
5419 | + 4.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
5420 | + 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
5421 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5422 | // Four distinct harmonics (8): | |
5423 | four4n1n3n2n = (dImQ1n*dImQ2n*dImQ3n*dImQ4n+dImQ3n*dImQ4n*dReQ1n*dReQ2n | |
5424 | + dImQ2n*dImQ4n*dReQ1n*dReQ3n-dImQ1n*dImQ4n*dReQ2n*dReQ3n | |
5425 | - dImQ2n*dImQ3n*dReQ1n*dReQ4n+dImQ1n*dImQ3n*dReQ2n*dReQ4n | |
5426 | + dImQ1n*dImQ2n*dReQ3n*dReQ4n+dReQ1n*dReQ2n*dReQ3n*dReQ4n | |
5427 | - (dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n+dImQ5n*dImQ2n*dReQ3n) | |
5428 | - (dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n+dImQ5n*dImQ4n*dReQ1n) | |
5429 | - (dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
5430 | - (pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
5431 | - (dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
5432 | - (pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
5433 | + pow(dReQ5n,2.)+pow(dImQ5n,2.)+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
5434 | + 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
5435 | + 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
5436 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5437 | four5n1n4n2n = (dImQ1n*dImQ2n*dImQ4n*dImQ5n+dImQ4n*dImQ5n*dReQ1n*dReQ2n | |
5438 | + dImQ2n*dImQ5n*dReQ1n*dReQ4n-dImQ1n*dImQ5n*dReQ2n*dReQ4n | |
5439 | - dImQ2n*dImQ4n*dReQ1n*dReQ5n+dImQ1n*dImQ4n*dReQ2n*dReQ5n+dImQ1n*dImQ2n*dReQ4n*dReQ5n | |
5440 | + dReQ1n*dReQ2n*dReQ4n*dReQ5n | |
5441 | - (dReQ6n*dReQ5n*dReQ1n-dReQ6n*dImQ5n*dImQ1n+dImQ6n*dReQ5n*dImQ1n+dImQ6n*dImQ5n*dReQ1n) | |
5442 | - (dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n) | |
5443 | - (dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n+dImQ5n*dImQ4n*dReQ1n) | |
5444 | - (dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n+dImQ5n*dImQ2n*dReQ3n) | |
5445 | - (dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
5446 | - (pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
5447 | + pow(dReQ6n,2.)+pow(dImQ6n,2.) | |
5448 | + 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
5449 | + pow(dReQ3n,2.)+pow(dImQ3n,2.)+2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
5450 | + 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
5451 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5452 | four5n2n4n3n = (dImQ2n*dImQ3n*dImQ4n*dImQ5n+dImQ4n*dImQ5n*dReQ2n*dReQ3n | |
5453 | + dImQ3n*dImQ5n*dReQ2n*dReQ4n-dImQ2n*dImQ5n*dReQ3n*dReQ4n | |
5454 | - dImQ3n*dImQ4n*dReQ2n*dReQ5n+dImQ2n*dImQ4n*dReQ3n*dReQ5n | |
5455 | + dImQ2n*dImQ3n*dReQ4n*dReQ5n+dReQ2n*dReQ3n*dReQ4n*dReQ5n | |
5456 | - (dReQ7n*dReQ5n*dReQ2n-dReQ7n*dImQ5n*dImQ2n+dImQ7n*dReQ5n*dImQ2n+dImQ7n*dImQ5n*dReQ2n) | |
5457 | - (dReQ7n*dReQ4n*dReQ3n-dReQ7n*dImQ4n*dImQ3n+dImQ7n*dReQ4n*dImQ3n+dImQ7n*dImQ4n*dReQ3n) | |
5458 | - (dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n+dImQ5n*dImQ4n*dReQ1n) | |
5459 | - (dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n+dImQ5n*dImQ2n*dReQ3n) | |
5460 | - (pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
5461 | - (dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
5462 | + pow(dReQ7n,2.)+pow(dImQ7n,2.)+2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
5463 | + 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5464 | + 3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+pow(dReQ1n,2.)+pow(dImQ1n,2.)-6.*dMult) | |
5465 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5466 | four6n1n4n3n = (dImQ1n*dImQ3n*dImQ4n*dImQ6n+dImQ4n*dImQ6n*dReQ1n*dReQ3n | |
5467 | + dImQ3n*dImQ6n*dReQ1n*dReQ4n-dImQ1n*dImQ6n*dReQ3n*dReQ4n | |
5468 | - dImQ3n*dImQ4n*dReQ1n*dReQ6n+dImQ1n*dImQ4n*dReQ3n*dReQ6n+dImQ1n*dImQ3n*dReQ4n*dReQ6n | |
5469 | + dReQ1n*dReQ3n*dReQ4n*dReQ6n | |
5470 | - (dReQ7n*dReQ6n*dReQ1n-dReQ7n*dImQ6n*dImQ1n+dImQ7n*dReQ6n*dImQ1n+dImQ7n*dImQ6n*dReQ1n) | |
5471 | - (dReQ7n*dReQ4n*dReQ3n-dReQ7n*dImQ4n*dImQ3n+dImQ7n*dReQ4n*dImQ3n+dImQ7n*dImQ4n*dReQ3n) | |
5472 | - (dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n) | |
5473 | - (pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n) | |
5474 | - (dReQ4n*dReQ1n*dReQ3n-dReQ4n*dImQ1n*dImQ3n+dImQ4n*dReQ1n*dImQ3n+dImQ4n*dImQ1n*dReQ3n) | |
5475 | - (dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
5476 | + pow(dReQ7n,2.)+pow(dImQ7n,2.)+2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
5477 | + 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+3.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5478 | + pow(dReQ2n,2.)+pow(dImQ2n,2.)+2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
5479 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5480 | four6n1n5n2n = (dImQ1n*dImQ2n*dImQ5n*dImQ6n+dImQ5n*dImQ6n*dReQ1n*dReQ2n | |
5481 | + dImQ2n*dImQ6n*dReQ1n*dReQ5n-dImQ1n*dImQ6n*dReQ2n*dReQ5n | |
5482 | - dImQ2n*dImQ5n*dReQ1n*dReQ6n+dImQ1n*dImQ5n*dReQ2n*dReQ6n+dImQ1n*dImQ2n*dReQ5n*dReQ6n | |
5483 | + dReQ1n*dReQ2n*dReQ5n*dReQ6n | |
5484 | - (dReQ7n*dReQ6n*dReQ1n-dReQ7n*dImQ6n*dImQ1n+dImQ7n*dReQ6n*dImQ1n+dImQ7n*dImQ6n*dReQ1n) | |
5485 | - (dReQ7n*dReQ5n*dReQ2n-dReQ7n*dImQ5n*dImQ2n+dImQ7n*dReQ5n*dImQ2n+dImQ7n*dImQ5n*dReQ2n) | |
5486 | - (dReQ6n*dReQ5n*dReQ1n-dReQ6n*dImQ5n*dImQ1n+dImQ6n*dReQ5n*dImQ1n+dImQ6n*dImQ5n*dReQ1n) | |
5487 | - (dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n) | |
5488 | - (dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n+dImQ5n*dImQ4n*dReQ1n) | |
5489 | - (pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
5490 | + pow(dReQ7n,2.)+pow(dImQ7n,2.)+2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
5491 | + 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))+pow(dReQ4n,2.)+pow(dImQ4n,2.) | |
5492 | + 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
5493 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5494 | four6n3n2n1n = (dReQ1n*dReQ2n*dReQ3n*dReQ6n-dReQ3n*dReQ6n*dImQ1n*dImQ2n | |
5495 | - dReQ2n*dReQ6n*dImQ1n*dImQ3n-dReQ1n*dReQ6n*dImQ2n*dImQ3n | |
5496 | + dReQ2n*dReQ3n*dImQ1n*dImQ6n+dReQ1n*dReQ3n*dImQ2n*dImQ6n | |
5497 | + dReQ1n*dReQ2n*dImQ3n*dImQ6n-dImQ1n*dImQ2n*dImQ3n*dImQ6n | |
5498 | - (dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n) | |
5499 | - (pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n) | |
5500 | - (dReQ6n*dReQ5n*dReQ1n-dReQ6n*dImQ5n*dImQ1n+dImQ6n*dReQ5n*dImQ1n+dImQ6n*dImQ5n*dReQ1n) | |
5501 | - (dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n+dImQ5n*dImQ2n*dReQ3n) | |
5502 | - (dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
5503 | - (dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
5504 | + 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))+pow(dReQ5n,2.)+pow(dImQ5n,2.) | |
5505 | + pow(dReQ4n,2.)+pow(dImQ4n,2.)+3.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5506 | + 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
5507 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5508 | four6n2n5n3n = (dImQ2n*dImQ3n*dImQ5n*dImQ6n+dImQ5n*dImQ6n*dReQ2n*dReQ3n | |
5509 | + dImQ3n*dImQ6n*dReQ2n*dReQ5n-dImQ2n*dImQ6n*dReQ3n*dReQ5n | |
5510 | - dImQ3n*dImQ5n*dReQ2n*dReQ6n+dImQ2n*dImQ5n*dReQ3n*dReQ6n+dImQ2n*dImQ3n*dReQ5n*dReQ6n | |
5511 | + dReQ2n*dReQ3n*dReQ5n*dReQ6n | |
5512 | - (dReQ8n*dReQ6n*dReQ2n-dReQ8n*dImQ6n*dImQ2n+dImQ8n*dReQ6n*dImQ2n+dImQ8n*dImQ6n*dReQ2n) | |
5513 | - (dReQ8n*dReQ5n*dReQ3n-dReQ8n*dImQ5n*dImQ3n+dImQ8n*dReQ5n*dImQ3n+dImQ8n*dImQ5n*dReQ3n) | |
5514 | - (dReQ6n*dReQ5n*dReQ1n-dReQ6n*dImQ5n*dImQ1n+dImQ6n*dReQ5n*dImQ1n+dImQ6n*dImQ5n*dReQ1n) | |
5515 | - (pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n) | |
5516 | - (dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n+dImQ5n*dImQ2n*dReQ3n) | |
5517 | - (dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
5518 | + pow(dReQ8n,2.)+pow(dImQ8n,2.)+2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
5519 | + 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))+3.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5520 | + 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+pow(dReQ1n,2.)+pow(dImQ1n,2.)-6.*dMult) | |
5521 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5522 | four6n3n5n4n = (dImQ3n*dImQ4n*dImQ5n*dImQ6n+dImQ5n*dImQ6n*dReQ3n*dReQ4n | |
5523 | + dImQ4n*dImQ6n*dReQ3n*dReQ5n-dImQ3n*dImQ6n*dReQ4n*dReQ5n | |
5524 | - dImQ4n*dImQ5n*dReQ3n*dReQ6n+dImQ3n*dImQ5n*dReQ4n*dReQ6n+dImQ3n*dImQ4n*dReQ5n*dReQ6n | |
5525 | + dReQ3n*dReQ4n*dReQ5n*dReQ6n | |
5526 | - (dReQ9n*dReQ6n*dReQ3n-dReQ9n*dImQ6n*dImQ3n+dImQ9n*dReQ6n*dImQ3n+dImQ9n*dImQ6n*dReQ3n) | |
5527 | - (dReQ9n*dReQ5n*dReQ4n-dReQ9n*dImQ5n*dImQ4n+dImQ9n*dReQ5n*dImQ4n+dImQ9n*dImQ5n*dReQ4n) | |
5528 | - (dReQ6n*dReQ5n*dReQ1n-dReQ6n*dImQ5n*dImQ1n+dImQ6n*dReQ5n*dImQ1n+dImQ6n*dImQ5n*dReQ1n) | |
5529 | - (dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n) | |
5530 | - (dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n+dImQ5n*dImQ2n*dReQ3n) | |
5531 | - (dReQ4n*dReQ3n*dReQ1n-dReQ4n*dImQ3n*dImQ1n+dImQ4n*dReQ3n*dImQ1n+dImQ4n*dImQ3n*dReQ1n) | |
5532 | + pow(dReQ9n,2.)+pow(dImQ9n,2.)+2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
5533 | + 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
5534 | + 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+pow(dReQ2n,2.)+pow(dImQ2n,2.) | |
5535 | + pow(dReQ1n,2.)+pow(dImQ1n,2.)-6.*dMult) | |
5536 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
5537 | f4pCorrelations->Fill(0.5,four1n1n1n1n,d4pMultiplicityWeight); | |
5538 | f4pCorrelations->Fill(1.5,four2n2n2n2n,d4pMultiplicityWeight); | |
5539 | f4pCorrelations->Fill(2.5,four3n3n3n3n,d4pMultiplicityWeight); | |
5540 | f4pCorrelations->Fill(3.5,four4n4n4n4n,d4pMultiplicityWeight); | |
5541 | f4pCorrelations->Fill(4.5,four5n5n5n5n,d4pMultiplicityWeight); | |
5542 | f4pCorrelations->Fill(5.5,four6n6n6n6n,d4pMultiplicityWeight); | |
5543 | //f4pCorrelations->Fill(6.5,0.,d4pMultiplicityWeight); // empty | |
5544 | f4pCorrelations->Fill(7.5,four2n1n2n1n,d4pMultiplicityWeight); | |
5545 | f4pCorrelations->Fill(8.5,four3n1n3n1n,d4pMultiplicityWeight); | |
5546 | f4pCorrelations->Fill(9.5,four3n2n3n2n,d4pMultiplicityWeight); | |
5547 | f4pCorrelations->Fill(10.5,four4n1n4n1n,d4pMultiplicityWeight); | |
5548 | f4pCorrelations->Fill(11.5,four4n2n4n2n,d4pMultiplicityWeight); | |
5549 | f4pCorrelations->Fill(12.5,four4n3n4n3n,d4pMultiplicityWeight); | |
5550 | f4pCorrelations->Fill(13.5,four5n1n5n1n,d4pMultiplicityWeight); | |
5551 | f4pCorrelations->Fill(14.5,four5n2n5n2n,d4pMultiplicityWeight); | |
5552 | f4pCorrelations->Fill(15.5,four5n3n5n3n,d4pMultiplicityWeight); | |
5553 | f4pCorrelations->Fill(16.5,four5n4n5n4n,d4pMultiplicityWeight); | |
5554 | f4pCorrelations->Fill(17.5,four6n1n6n1n,d4pMultiplicityWeight); | |
5555 | f4pCorrelations->Fill(18.5,four6n2n6n2n,d4pMultiplicityWeight); | |
5556 | f4pCorrelations->Fill(19.5,four6n3n6n3n,d4pMultiplicityWeight); | |
5557 | f4pCorrelations->Fill(20.5,four6n4n6n4n,d4pMultiplicityWeight); | |
5558 | f4pCorrelations->Fill(21.5,four6n5n6n5n,d4pMultiplicityWeight); | |
5559 | //f4pCorrelations->Fill(22.5,0.,d4pMultiplicityWeight); // empty | |
5560 | f4pCorrelations->Fill(23.5,four3n1n1n1n,d4pMultiplicityWeight); | |
5561 | f4pCorrelations->Fill(24.5,four6n2n2n2n,d4pMultiplicityWeight); | |
5562 | //f4pCorrelations->Fill(25.5,0.,d4pMultiplicityWeight); // empty | |
5563 | f4pCorrelations->Fill(26.5,four3n1n2n2n,d4pMultiplicityWeight); | |
5564 | f4pCorrelations->Fill(27.5,four4n2n1n1n,d4pMultiplicityWeight); | |
5565 | f4pCorrelations->Fill(28.5,four4n2n3n3n,d4pMultiplicityWeight); | |
5566 | f4pCorrelations->Fill(29.5,four5n2n2n1n,d4pMultiplicityWeight); | |
5567 | f4pCorrelations->Fill(30.5,four5n3n1n1n,d4pMultiplicityWeight); | |
5568 | f4pCorrelations->Fill(31.5,four5n1n3n3n,d4pMultiplicityWeight); | |
5569 | f4pCorrelations->Fill(32.5,four5n3n4n4n,d4pMultiplicityWeight); | |
5570 | f4pCorrelations->Fill(33.5,four6n4n1n1n,d4pMultiplicityWeight); | |
5571 | f4pCorrelations->Fill(34.5,four6n2n4n4n,d4pMultiplicityWeight); | |
5572 | f4pCorrelations->Fill(35.5,four6n4n5n5n,d4pMultiplicityWeight); | |
5573 | //f4pCorrelations->Fill(36.5,0.,d4pMultiplicityWeight); // empty | |
5574 | f4pCorrelations->Fill(37.5,four4n1n3n2n,d4pMultiplicityWeight); | |
5575 | f4pCorrelations->Fill(38.5,four5n1n4n2n,d4pMultiplicityWeight); | |
5576 | f4pCorrelations->Fill(39.5,four5n2n4n3n,d4pMultiplicityWeight); | |
5577 | f4pCorrelations->Fill(40.5,four6n1n4n3n,d4pMultiplicityWeight); | |
5578 | f4pCorrelations->Fill(41.5,four6n1n5n2n,d4pMultiplicityWeight); | |
5579 | f4pCorrelations->Fill(42.5,four6n3n2n1n,d4pMultiplicityWeight); | |
5580 | f4pCorrelations->Fill(43.5,four6n2n5n3n,d4pMultiplicityWeight); | |
5581 | f4pCorrelations->Fill(44.5,four6n3n5n4n,d4pMultiplicityWeight); | |
c10259fb | 5582 | allMixedCorrelators[15]=four1n1n1n1n; |
5583 | allMixedCorrelators[16]=four2n2n2n2n; | |
5584 | allMixedCorrelators[17]=four3n3n3n3n; | |
5585 | allMixedCorrelators[18]=four4n4n4n4n; | |
5586 | allMixedCorrelators[19]=four5n5n5n5n; | |
5587 | allMixedCorrelators[20]=four6n6n6n6n; | |
5588 | allMixedCorrelators[21]=four2n1n2n1n; | |
5589 | allMixedCorrelators[22]=four3n1n3n1n; | |
5590 | allMixedCorrelators[23]=four3n2n3n2n; | |
5591 | allMixedCorrelators[24]=four4n1n4n1n; | |
5592 | allMixedCorrelators[25]=four4n2n4n2n; | |
5593 | allMixedCorrelators[26]=four4n3n4n3n; | |
5594 | allMixedCorrelators[27]=four5n1n5n1n; | |
5595 | allMixedCorrelators[28]=four5n2n5n2n; | |
5596 | allMixedCorrelators[29]=four5n3n5n3n; | |
5597 | allMixedCorrelators[30]=four5n4n5n4n; | |
5598 | allMixedCorrelators[31]=four6n1n6n1n; | |
5599 | allMixedCorrelators[32]=four6n2n6n2n; | |
5600 | allMixedCorrelators[33]=four6n3n6n3n; | |
5601 | allMixedCorrelators[34]=four6n4n6n4n; | |
5602 | allMixedCorrelators[35]=four6n5n6n5n; | |
5603 | allMixedCorrelators[36]=four3n1n1n1n; | |
5604 | allMixedCorrelators[37]=four6n2n2n2n; | |
5605 | allMixedCorrelators[38]=four3n1n2n2n; | |
5606 | allMixedCorrelators[39]=four4n2n1n1n; | |
5607 | allMixedCorrelators[40]=four4n2n3n3n; | |
5608 | allMixedCorrelators[41]=four5n2n2n1n; | |
5609 | allMixedCorrelators[42]=four5n3n1n1n; | |
5610 | allMixedCorrelators[43]=four5n1n3n3n; | |
5611 | allMixedCorrelators[44]=four5n3n4n4n; | |
5612 | allMixedCorrelators[45]=four6n4n1n1n; | |
5613 | allMixedCorrelators[46]=four6n2n4n4n; | |
5614 | allMixedCorrelators[47]=four6n4n5n5n; | |
5615 | allMixedCorrelators[48]=four4n1n3n2n; | |
5616 | allMixedCorrelators[49]=four5n1n4n2n; | |
5617 | allMixedCorrelators[50]=four5n2n4n3n; | |
5618 | allMixedCorrelators[51]=four6n1n4n3n; | |
5619 | allMixedCorrelators[52]=four6n1n5n2n; | |
5620 | allMixedCorrelators[53]=four6n3n2n1n; | |
5621 | allMixedCorrelators[54]=four6n2n5n3n; | |
5622 | allMixedCorrelators[55]=four6n3n5n4n; | |
e1d101a6 | 5623 | } // end of if(dMult>3.) |
5624 | ||
5625 | // f) Calculate 5-p correlations: | |
5626 | // f1) "Standard candles" (30): | |
5627 | Double_t five3n2n3n1n1n = 0.; // <5>_{3n,2n|3n,1n,1n} = <cos(n(3*phi1+2*phi2-3*phi3-1*phi4-1*phi5))> | |
5628 | Double_t five4n1n2n2n1n = 0.; // <5>_{4n,1n|2n,2n,1n} = <cos(n(4*phi1+1*phi2-2*phi3-2*phi4-1*phi5))> | |
5629 | Double_t five4n2n3n2n1n = 0.; // <5>_{4n,2n|3n,2n,1n} = <cos(n(4*phi1+2*phi2-3*phi3-2*phi4-1*phi5))> | |
5630 | Double_t five4n3n3n2n2n = 0.; // <5>_{4n,3n|3n,2n,2n} = <cos(n(4*phi1+3*phi2-3*phi3-2*phi4-2*phi5))> | |
5631 | Double_t five4n2n4n1n1n = 0.; // <5>_{4n,2n|4n,1n,1n} = <cos(n(4*phi1+2*phi2-4*phi3-1*phi4-1*phi5))> | |
5632 | Double_t five4n3n4n2n1n = 0.; // <5>_{4n,3n|4n,2n,1n} = <cos(n(4*phi1+3*phi2-4*phi3-2*phi4-1*phi5))> | |
5633 | Double_t five5n1n3n2n1n = 0.; // <5>_{5n,1n|3n,2n,1n} = <cos(n(5*phi1+1*phi2-3*phi3-2*phi4-1*phi5))> | |
5634 | Double_t five5n2n5n1n1n = 0.; // <5>_{5n,2n|5n,1n,1n} = <cos(n(5*phi1+2*phi2-5*phi3-1*phi4-1*phi5))> | |
5635 | Double_t five5n2n4n2n1n = 0.; // <5>_{5n,2n|4n,2n,1n} = <cos(n(5*phi1+2*phi2-4*phi3-2*phi4-1*phi5))> | |
5636 | Double_t five5n3n4n3n1n = 0.; // <5>_{5n,3n|4n,3n,1n} = <cos(n(5*phi1+3*phi2-4*phi3-3*phi4-1*phi5))> | |
5637 | Double_t five5n4n4n3n2n = 0.; // <5>_{5n,4n|4n,3n,2n} = <cos(n(5*phi1+4*phi2-4*phi3-3*phi4-2*phi5))> | |
5638 | Double_t five5n3n5n2n1n = 0.; // <5>_{5n,3n|5n,2n,1n} = <cos(n(5*phi1+3*phi2-5*phi3-2*phi4-1*phi5))> | |
5639 | Double_t five5n4n5n2n2n = 0.; // <5>_{5n,4n|5n,2n,2n} = <cos(n(5*phi1+4*phi2-5*phi3-2*phi4-2*phi5))> | |
5640 | Double_t five5n4n5n3n1n = 0.; // <5>_{5n,4n|5n,3n,1n} = <cos(n(5*phi1+4*phi2-5*phi3-3*phi4-1*phi5))> | |
5641 | Double_t five6n1n3n3n1n = 0.; // <5>_{6n,1n|3n,3n,1n} = <cos(n(6*phi1+1*phi2-3*phi3-3*phi4-1*phi5))> | |
5642 | Double_t five6n2n3n3n2n = 0.; // <5>_{6n,2n|3n,3n,2n} = <cos(n(6*phi1+2*phi2-3*phi3-3*phi4-2*phi5))> | |
5643 | Double_t five6n1n4n2n1n = 0.; // <5>_{6n,1n|4n,2n,1n} = <cos(n(6*phi1+1*phi2-4*phi3-2*phi4-1*phi5))> | |
5644 | Double_t five6n3n4n3n2n = 0.; // <5>_{6n,3n|4n,3n,2n} = <cos(n(6*phi1+3*phi2-4*phi3-3*phi4-2*phi5))> | |
5645 | Double_t five6n4n4n3n3n = 0.; // <5>_{6n,4n|4n,3n,3n} = <cos(n(6*phi1+4*phi2-4*phi3-3*phi4-3*phi5))> | |
5646 | Double_t five6n2n5n2n1n = 0.; // <5>_{6n,2n|5n,2n,1n} = <cos(n(6*phi1+2*phi2-5*phi3-2*phi4-1*phi5))> | |
5647 | Double_t five6n3n5n3n1n = 0.; // <5>_{6n,3n|5n,3n,1n} = <cos(n(6*phi1+3*phi2-5*phi3-3*phi4-1*phi5))> | |
5648 | Double_t five6n4n5n4n1n = 0.; // <5>_{6n,4n|5n,4n,1n} = <cos(n(6*phi1+4*phi2-5*phi3-4*phi4-1*phi5))> | |
5649 | Double_t five6n5n5n3n3n = 0.; // <5>_{6n,5n|5n,3n,3n} = <cos(n(6*phi1+5*phi2-5*phi3-3*phi4-3*phi5))> | |
5650 | Double_t five6n2n6n1n1n = 0.; // <5>_{6n,2n|6n,1n,1n} = <cos(n(6*phi1+2*phi2-6*phi3-1*phi4-1*phi5))> | |
5651 | Double_t five6n3n6n2n1n = 0.; // <5>_{6n,3n|6n,2n,1n} = <cos(n(6*phi1+3*phi2-6*phi3-2*phi4-1*phi5))> | |
5652 | Double_t five6n4n6n2n2n = 0.; // <5>_{6n,4n|6n,2n,2n} = <cos(n(6*phi1+4*phi2-6*phi3-2*phi4-2*phi5))> | |
5653 | Double_t five6n4n6n3n1n = 0.; // <5>_{6n,4n|6n,3n,1n} = <cos(n(6*phi1+4*phi2-6*phi3-3*phi4-1*phi5))> | |
5654 | Double_t five6n5n5n4n2n = 0.; // <5>_{6n,5n|5n,4n,2n} = <cos(n(6*phi1+5*phi2-5*phi3-4*phi4-2*phi5))> | |
5655 | Double_t five6n5n6n3n2n = 0.; // <5>_{6n,5n|6n,3n,2n} = <cos(n(6*phi1+5*phi2-6*phi3-3*phi4-2*phi5))> // TBI swap with previous | |
5656 | Double_t five6n5n6n4n1n = 0.; // <5>_{6n,5n|6n,4n,1n} = <cos(n(6*phi1+5*phi2-6*phi3-4*phi4-1*phi5))> | |
5657 | // f2) Two distinct harmonics (9): | |
5658 | Double_t five2n1n1n1n1n = 0.; // <5>_{2n,1n|1n,1n,1n} = <cos(n(2*phi1+1*phi2-1*phi3-1*phi4-1*phi5))> | |
5659 | Double_t five2n2n2n1n1n = 0.; // <5>_{2n,2n|2n,1n,1n} = <cos(n(2*phi1+2*phi2-2*phi3-1*phi4-1*phi5))> | |
5660 | Double_t five3n3n2n2n2n = 0.; // <5>_{3n,3n|2n,2n,2n} = <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-2*phi5))> | |
5661 | Double_t five4n1n1n1n1n = 0.; // <5>_{4n|1n,1n,1n,1n} = <cos(n(4*phi1-1*phi2-1*phi3-1*phi4-1*phi5))> | |
5662 | Double_t five4n2n2n2n2n = 0.; // <5>_{4n,2n|2n,2n,2n} = <cos(n(4*phi1+2*phi2-2*phi3-2*phi4-2*phi5))> | |
5663 | Double_t five4n4n4n2n2n = 0.; // <5>_{4n,4n|4n,2n,2n} = <cos(n(4*phi1+4*phi2-4*phi3-2*phi4-2*phi5))> | |
5664 | Double_t five6n3n3n3n3n = 0.; // <5>_{6n,3n|3n,3n,3n} = <cos(n(6*phi1+3*phi2-3*phi3-3*phi4-3*phi5))> | |
5665 | Double_t five6n6n4n4n4n = 0.; // <5>_{6n,6n|4n,4n,4n} = <cos(n(6*phi1+6*phi2-4*phi3-4*phi4-4*phi5))> | |
5666 | Double_t five6n6n6n3n3n = 0.; // <5>_{6n,6n|6n,3n,3n} = <cos(n(6*phi1+6*phi2-6*phi3-3*phi4-3*phi5))> | |
5667 | // f3) Three distinct harmonics (30): | |
5668 | Double_t five3n1n2n1n1n = 0.; // <5>_{3n,1n|2n,1n,1n} = <cos(n(3*phi1+1*phi2-2*phi3-1*phi4-1*phi5))> | |
5669 | Double_t five3n2n2n2n1n = 0.; // <5>_{3n,2n|2n,2n,1n} = <cos(n(3*phi1+2*phi2-2*phi3-2*phi4-1*phi5))> | |
5670 | Double_t five3n3n3n2n1n = 0.; // <5>_{3n,3n|3n,2n,1n} = <cos(n(3*phi1+3*phi2-3*phi3-2*phi4-1*phi5))> | |
5671 | Double_t five4n1n3n1n1n = 0.; // <5>_{4n,1n|3n,1n,1n} = <cos(n(4*phi1+1*phi2-3*phi3-1*phi4-1*phi5))> | |
5672 | Double_t five4n1n1n3n3n = 0.; // <5>_{4n,1n,1n|3n,3n} = <cos(n(4*phi1+1*phi2+1*phi3-3*phi4-3*phi5))> | |
5673 | Double_t five4n3n3n3n1n = 0.; // <5>_{4n,3n|3n,3n,1n} = <cos(n(4*phi1+3*phi2-3*phi3-3*phi4-1*phi5))> | |
5674 | Double_t five4n4n3n3n2n = 0.; // <5>_{4n,4n|3n,3n,2n} = <cos(n(4*phi1+4*phi2-3*phi3-3*phi4-2*phi5))> | |
5675 | Double_t five4n4n4n3n1n = 0.; // <5>_{4n,4n|4n,3n,1n} = <cos(n(4*phi1+4*phi2-4*phi3-3*phi4-1*phi5))> | |
5676 | Double_t five5n2n1n1n1n = 0.; // <5>_{5n|2n,1n,1n,1n} = <cos(n(5*phi1-2*phi2-1*phi3-1*phi4-1*phi5))> | |
5677 | Double_t five5n1n2n2n2n = 0.; // <5>_{5n,1n|2n,2n,2n} = <cos(n(5*phi1+1*phi2-2*phi3-2*phi4-2*phi5))> | |
5678 | Double_t five5n2n3n2n2n = 0.; // <5>_{5n,2n|3n,2n,2n} = <cos(n(5*phi1+2*phi2-3*phi3-2*phi4-2*phi5))> | |
5679 | Double_t five5n3n3n3n2n = 0.; // <5>_{5n,3n|3n,3n,2n} = <cos(n(5*phi1+3*phi2-3*phi3-3*phi4-2*phi5))> | |
5680 | Double_t five5n1n4n1n1n = 0.; // <5>_{5n,1n|4n,1n,1n} = <cos(n(5*phi1+1*phi2-4*phi3-1*phi4-1*phi5))> | |
5681 | Double_t five5n4n3n3n3n = 0.; // <5>_{5n,4n|3n,3n,3n} = <cos(n(5*phi1+4*phi2-3*phi3-3*phi4-3*phi5))> | |
5682 | Double_t five5n4n4n4n1n = 0.; // <5>_{5n,4n|4n,4n,1n} = <cos(n(5*phi1+4*phi2-4*phi3-4*phi4-1*phi5))> | |
5683 | Double_t five5n5n4n3n3n = 0.; // <5>_{5n,5n|4n,3n,3n} = <cos(n(5*phi1+5*phi2-4*phi3-3*phi4-3*phi5))> | |
5684 | Double_t five5n5n4n4n2n = 0.; // <5>_{5n,5n|4n,4n,2n} = <cos(n(5*phi1+5*phi2-4*phi3-4*phi4-2*phi5))> | |
5685 | Double_t five5n5n5n3n2n = 0.; // <5>_{5n,5n|5n,3n,2n} = <cos(n(5*phi1+5*phi2-5*phi3-3*phi4-2*phi5))> | |
5686 | Double_t five5n5n5n4n1n = 0.; // <5>_{5n,5n|5n,4n,1n} = <cos(n(5*phi1+5*phi2-5*phi3-4*phi4-1*phi5))> | |
5687 | Double_t five6n2n2n1n1n = 0.; // <5>_{6n|2n,2n,1n,1n} = <cos(n(6*phi1-2*phi2-2*phi3-1*phi4-1*phi5))> | |
5688 | Double_t five6n3n1n1n1n = 0.; // <5>_{6n|3n,1n,1n,1n} = <cos(n(6*phi1-3*phi2-1*phi3-1*phi4-1*phi5))> | |
5689 | Double_t five6n1n1n4n4n = 0.; // <5>_{6n,1n,1n|4n,4n} = <cos(n(6*phi1+1*phi2+1*phi3-4*phi4-4*phi5))> | |
5690 | Double_t five6n1n5n1n1n = 0.; // <5>_{6n,1n|5n,1n,1n} = <cos(n(6*phi1+1*phi2-5*phi3-1*phi4-1*phi5))> | |
5691 | Double_t five6n2n4n2n2n = 0.; // <5>_{6n,2n|4n,2n,2n} = <cos(n(6*phi1+2*phi2-4*phi3-2*phi4-2*phi5))> | |
5692 | Double_t five6n4n4n4n2n = 0.; // <5>_{6n,4n|4n,4n,2n} = <cos(n(6*phi1+4*phi2-4*phi3-4*phi4-2*phi5))> | |
5693 | Double_t five6n2n2n5n5n = 0.; // <5>_{6n,2n,2n|5n,5n} = <cos(n(6*phi1+2*phi2+2*phi3-5*phi4-5*phi5))> | |
5694 | Double_t five6n5n5n5n1n = 0.; // <5>_{6n,5n|5n,5n,1n} = <cos(n(6*phi1+5*phi2-5*phi3-5*phi4-1*phi5))> | |
5695 | Double_t five6n6n5n5n2n = 0.; // <5>_{6n,6n|5n,5n,2n} = <cos(n(6*phi1+6*phi2-5*phi3-5*phi4-2*phi5))> | |
5696 | Double_t five6n6n6n4n2n = 0.; // <5>_{6n,6n|6n,4n,2n} = <cos(n(6*phi1+6*phi2-6*phi3-4*phi4-2*phi5))> | |
5697 | Double_t five6n6n6n5n1n = 0.; // <5>_{6n,6n|6n,5n,1n} = <cos(n(6*phi1+6*phi2-6*phi3-5*phi4-1*phi5))> // TBI swap with the one above | |
5698 | // Four distinct harmonics (11): | |
5699 | Double_t five5n2n3n3n1n = 0.; // <5>_{5n,2n|3n,3n,1n} = <cos(n(5*phi1+2*phi2-3*phi3-3*phi4-1*phi5))> | |
5700 | Double_t five5n1n1n4n3n = 0.; // <5>_{5n,1n,1n|4n,3n} = <cos(n(5*phi1+1*phi2+1*phi3-4*phi4-3*phi5))> | |
5701 | Double_t five5n3n4n2n2n = 0.; // <5>_{5n,3n|4n,2n,2n} = <cos(n(5*phi1+3*phi2-4*phi3-2*phi4-2*phi5))> | |
5702 | Double_t five5n2n1n4n4n = 0.; // <5>_{5n,2n,1n|4n,4n} = <cos(n(5*phi1+2*phi2+1*phi3-4*phi4-4*phi5))> | |
5703 | Double_t five6n1n3n2n2n = 0.; // <5>_{6n,1n|3n,2n,2n} = <cos(n(6*phi1+1*phi2-3*phi3-2*phi4-2*phi5))> | |
5704 | Double_t five6n3n4n4n1n = 0.; // <5>_{6n,3n|4n,4n,1n} = <cos(n(6*phi1+3*phi2-4*phi3-4*phi4-1*phi5))> | |
5705 | Double_t five6n1n1n5n3n = 0.; // <5>_{6n,1n,1n|5n,3n} = <cos(n(6*phi1+1*phi2+1*phi3-5*phi4-3*phi5))> | |
5706 | Double_t five6n3n5n2n2n = 0.; // <5>_{6n,3n|5n,2n,2n} = <cos(n(6*phi1+3*phi2-5*phi3-2*phi4-2*phi5))> | |
5707 | Double_t five6n5n4n4n3n = 0.; // <5>_{6n,5n|4n,4n,3n} = <cos(n(6*phi1+5*phi2-4*phi3-4*phi4-3*phi5))> | |
5708 | Double_t five6n3n1n5n5n = 0.; // <5>_{6n,3n,1n|5n,5n} = <cos(n(6*phi1+3*phi2+1*phi3-5*phi4-5*phi5))> | |
5709 | Double_t five6n6n5n4n3n = 0.; // <5>_{6n,6n|5n,4n,3n} = <cos(n(6*phi1+6*phi2-5*phi3-4*phi4-3*phi5))> | |
5710 | // Five distinct harmonics (3): | |
5711 | Double_t five6n2n4n3n1n = 0.; // <5>_{6n,2n|4n,3n,1n} = <cos(n(6*phi1+2*phi2-4*phi3-3*phi4-1*phi5))> | |
5712 | Double_t five6n2n1n5n4n = 0.; // <5>_{6n,2n,1n|5n,4n} = <cos(n(6*phi1+2*phi2+1*phi3-5*phi4-4*phi5))> | |
5713 | Double_t five6n4n5n3n2n = 0.; // <5>_{6n,4n|5n,3n,2n} = <cos(n(6*phi1+4*phi2-5*phi3-3*phi4-2*phi5))> | |
5714 | if(dMult>4.) | |
5715 | { | |
5716 | five3n2n3n1n1n = (-(pow(dImQ3n,2.)+pow(dReQ3n,2.)) | |
5717 | * (-2.*dImQ1n*dImQ2n*dReQ1n+pow(dImQ1n,2.)*dReQ2n-pow(dReQ1n,2.)*dReQ2n) | |
5718 | - (-pow(dImQ1n,2.)*dImQ3n*dImQ5n+dImQ3n*dImQ5n*pow(dReQ1n,2.) | |
5719 | + 2.*dImQ1n*dImQ5n*dReQ1n*dReQ3n-2.*dImQ1n*dImQ3n*dReQ1n*dReQ5n | |
5720 | - pow(dImQ1n,2.)*dReQ3n*dReQ5n+pow(dReQ1n,2.)*dReQ3n*dReQ5n) | |
5721 | - 2.*(dImQ1n*dImQ2n*dImQ3n*dImQ4n+dImQ3n*dImQ4n*dReQ1n*dReQ2n | |
5722 | + dImQ2n*dImQ4n*dReQ1n*dReQ3n-dImQ1n*dImQ4n*dReQ2n*dReQ3n | |
5723 | - dImQ2n*dImQ3n*dReQ1n*dReQ4n+dImQ1n*dImQ3n*dReQ2n*dReQ4n | |
5724 | + dImQ1n*dImQ2n*dReQ3n*dReQ4n+dReQ1n*dReQ2n*dReQ3n*dReQ4n) | |
5725 | - (dReQ3n*pow(dReQ1n,3.)-3.*dReQ1n*dReQ3n*pow(dImQ1n,2.) | |
5726 | + 3.*dImQ1n*dImQ3n*pow(dReQ1n,2.)-dImQ3n*pow(dImQ1n,3.)) | |
5727 | - 2.*((pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n) | |
5728 | + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
5729 | + 2.*(dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n+dImQ5n*dImQ4n*dReQ1n) | |
5730 | + 3.*(dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n+dImQ5n*dImQ2n*dReQ3n) | |
5731 | + 6.*(dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
5732 | + 2.*(pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
5733 | + 9.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
5734 | - (dMult-8.)*(pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
5735 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
5736 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
5737 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))-4.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
5738 | + 2.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+(dMult-12.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
5739 | + 2.*(dMult-9.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-2.*dMult*(dMult-12.)) | |
5740 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
5741 | five4n1n2n2n1n = ((pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
5742 | * (pow(dReQ2n,2.)*dReQ4n-pow(dImQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n) | |
5743 | - 2.*(dImQ1n*dImQ2n*dImQ3n*dImQ4n+dImQ3n*dImQ4n*dReQ1n*dReQ2n | |
5744 | + dImQ2n*dImQ4n*dReQ1n*dReQ3n-dImQ1n*dImQ4n*dReQ2n*dReQ3n | |
5745 | - dImQ2n*dImQ3n*dReQ1n*dReQ4n+dImQ1n*dImQ3n*dReQ2n*dReQ4n | |
5746 | + dImQ1n*dImQ2n*dReQ3n*dReQ4n+dReQ1n*dReQ2n*dReQ3n*dReQ4n) | |
5747 | - 2.*((dReQ4n*dReQ2n+dImQ4n*dImQ2n)*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) | |
5748 | + 2.*dReQ1n*dImQ1n*(dImQ4n*dReQ2n-dReQ4n*dImQ2n)) | |
5749 | - (-pow(dImQ2n,2.)*dImQ1n*dImQ5n+dImQ1n*dImQ5n*pow(dReQ2n,2.) | |
5750 | + 2.*dImQ2n*dImQ5n*dReQ2n*dReQ1n-2.*dImQ2n*dImQ1n*dReQ2n*dReQ5n | |
5751 | - pow(dImQ2n,2.)*dReQ1n*dReQ5n+pow(dReQ2n,2.)*dReQ1n*dReQ5n) | |
5752 | - ((pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n) | |
5753 | + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
5754 | + (dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n+dImQ5n*dImQ4n*dReQ1n) | |
5755 | + 2.*(dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n+dImQ5n*dImQ2n*dReQ3n) | |
5756 | + 2.*(dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
5757 | + 2.*(pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
5758 | + 3.*(dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
5759 | + 4.*(pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
5760 | + 2.*(dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n+dImQ5n*dImQ4n*dReQ1n) | |
5761 | + 6.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
5762 | + 2.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
5763 | - (dMult-6.)*(pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
5764 | - 4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
5765 | - 4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5766 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
5767 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
5768 | + 2.*(dMult-6.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
5769 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+(dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
5770 | + 2.*(dMult-8.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-2.*dMult*(dMult-12.)) | |
5771 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
5772 | five4n2n3n2n1n = ((pow(dImQ2n,2.)+pow(dReQ2n,2.))*(dImQ3n*dImQ4n*dReQ1n+dImQ1n*dImQ4n*dReQ3n | |
5773 | - dImQ1n*dImQ3n*dReQ4n+dReQ1n*dReQ3n*dReQ4n) | |
5774 | - (dReQ1n*dReQ2n*dReQ3n*dReQ6n-dReQ3n*dReQ6n*dImQ1n*dImQ2n | |
5775 | - dReQ2n*dReQ6n*dImQ1n*dImQ3n-dReQ1n*dReQ6n*dImQ2n*dImQ3n | |
5776 | + dReQ2n*dReQ3n*dImQ1n*dImQ6n+dReQ1n*dReQ3n*dImQ2n*dImQ6n | |
5777 | + dReQ1n*dReQ2n*dImQ3n*dImQ6n-dImQ1n*dImQ2n*dImQ3n*dImQ6n) | |
5778 | - (dImQ1n*dImQ2n*dImQ4n*dImQ5n+dImQ4n*dImQ5n*dReQ1n*dReQ2n | |
5779 | + dImQ2n*dImQ5n*dReQ1n*dReQ4n-dImQ1n*dImQ5n*dReQ2n*dReQ4n | |
5780 | - dImQ2n*dImQ4n*dReQ1n*dReQ5n+dImQ1n*dImQ4n*dReQ2n*dReQ5n | |
5781 | + dImQ1n*dImQ2n*dReQ4n*dReQ5n+dReQ1n*dReQ2n*dReQ4n*dReQ5n) | |
5782 | - ((dReQ4n*dReQ2n-dImQ4n*dImQ2n)*(dReQ3n*dReQ3n-dImQ3n*dImQ3n) | |
5783 | + 2.*(dReQ4n*dImQ2n+dImQ4n*dReQ2n)*dReQ3n*dImQ3n) | |
5784 | - (dImQ1n*dImQ2n*dImQ3n*dImQ4n+dImQ3n*dImQ4n*dReQ1n*dReQ2n | |
5785 | + dImQ2n*dImQ4n*dReQ1n*dReQ3n-dImQ1n*dImQ4n*dReQ2n*dReQ3n | |
5786 | - dImQ2n*dImQ3n*dReQ1n*dReQ4n+dImQ1n*dImQ3n*dReQ2n*dReQ4n | |
5787 | + dImQ1n*dImQ2n*dReQ3n*dReQ4n+dReQ1n*dReQ2n*dReQ3n*dReQ4n) | |
5788 | - ((dReQ4n*dReQ2n+dImQ4n*dImQ2n)*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) | |
5789 | + 2.*dReQ1n*dImQ1n*(dImQ4n*dReQ2n-dReQ4n*dImQ2n)) | |
5790 | - ((pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n) | |
5791 | + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
5792 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
5793 | + 3.*(dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n) | |
5794 | + (dReQ6n*dReQ5n*dReQ1n-dReQ6n*dImQ5n*dImQ1n+dImQ6n*dReQ5n*dImQ1n+dImQ6n*dImQ5n*dReQ1n) | |
5795 | + pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n | |
5796 | + dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n+dImQ5n*dImQ4n*dReQ1n | |
5797 | + 3.*(dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n+dImQ5n*dImQ2n*dReQ3n) | |
5798 | - (dMult-7.)*(dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
5799 | + 3.*(pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
5800 | + 7.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
5801 | + 4.*(pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
5802 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
5803 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
5804 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
5805 | + (dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+(dMult-10.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5806 | + 2.*(dMult-7.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+(dMult-12.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
5807 | - 2.*dMult*(dMult-12.)) | |
5808 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
5809 | ||
5810 | // ********************************************************************* | |
5811 | Double_t reQ7nQ3nstarQ2nstarQ2nstar = (dReQ7n*dReQ3n+dImQ7n*dImQ3n)*(pow(dReQ2n,2)-pow(dImQ2n,2)) | |
5812 | + 2.*dReQ2n*dImQ2n*(dImQ7n*dReQ3n-dReQ7n*dImQ3n); | |
5813 | Double_t reQ5nQ2nQ4nstarQ3nstar = dImQ2n*dImQ3n*dImQ4n*dImQ5n+dImQ4n*dImQ5n*dReQ2n*dReQ3n | |
5814 | + dImQ3n*dImQ5n*dReQ2n*dReQ4n-dImQ2n*dImQ5n*dReQ3n*dReQ4n | |
5815 | - dImQ3n*dImQ4n*dReQ2n*dReQ5n+dImQ2n*dImQ4n*dReQ3n*dReQ5n | |
5816 | + dImQ2n*dImQ3n*dReQ4n*dReQ5n+dReQ2n*dReQ3n*dReQ4n*dReQ5n; | |
5817 | Double_t reQ7nQ4nstarQ3nstar = dReQ7n*dReQ4n*dReQ3n-dReQ7n*dImQ4n*dImQ3n+dImQ7n*dReQ4n*dImQ3n | |
5818 | + dImQ7n*dImQ4n*dReQ3n; | |
5819 | ||
5820 | ||
5821 | Double_t reQ7nQ5nstarQ2nstar = dReQ7n*dReQ5n*dReQ2n-dReQ7n*dImQ5n*dImQ2n+dImQ7n*dReQ5n*dImQ2n | |
5822 | + dImQ7n*dImQ5n*dReQ2n; | |
5823 | ||
5824 | // <5>_{6n,4n|4n,3n,3n}: | |
5825 | Double_t reQ10nQ4nstarQ3nstarQ3nstar = (dReQ10n*dReQ4n+dImQ10n*dImQ4n)*(pow(dReQ3n,2)-pow(dImQ3n,2)) | |
5826 | + 2.*dReQ3n*dImQ3n*(dImQ10n*dReQ4n-dReQ10n*dImQ4n); | |
5827 | Double_t reQ7nQ3nQ6nstarQ4nstar = dImQ3n*dImQ4n*dImQ6n*dImQ7n+dImQ6n*dImQ7n*dReQ3n*dReQ4n | |
5828 | + dImQ4n*dImQ7n*dReQ3n*dReQ6n-dImQ3n*dImQ7n*dReQ4n*dReQ6n | |
5829 | - dImQ4n*dImQ6n*dReQ3n*dReQ7n+dImQ3n*dImQ6n*dReQ4n*dReQ7n | |
5830 | + dImQ3n*dImQ4n*dReQ6n*dReQ7n+dReQ3n*dReQ4n*dReQ6n*dReQ7n; | |
5831 | Double_t reQ10nQ7nstarQ3nstar = dReQ10n*dReQ7n*dReQ3n-dReQ10n*dImQ7n*dImQ3n+dImQ10n*dReQ7n*dImQ3n | |
5832 | + dImQ10n*dImQ7n*dReQ3n; | |
5833 | Double_t reQ10nQ6nstarQ4nstar = dReQ10n*dReQ6n*dReQ4n-dReQ10n*dImQ6n*dImQ4n+dImQ10n*dReQ6n*dImQ4n | |
5834 | + dImQ10n*dImQ6n*dReQ4n; | |
5835 | Double_t reQ6nQ1nQ4nstarQ3nstar = dImQ1n*dImQ3n*dImQ4n*dImQ6n+dImQ4n*dImQ6n*dReQ1n*dReQ3n | |
5836 | + dImQ3n*dImQ6n*dReQ1n*dReQ4n-dImQ1n*dImQ6n*dReQ3n*dReQ4n | |
5837 | - dImQ3n*dImQ4n*dReQ1n*dReQ6n+dImQ1n*dImQ4n*dReQ3n*dReQ6n | |
5838 | + dImQ1n*dImQ3n*dReQ4n*dReQ6n+dReQ1n*dReQ3n*dReQ4n*dReQ6n; | |
5839 | Double_t reQ7nQ6nstarQ1nstar = dReQ7n*dReQ6n*dReQ1n-dReQ7n*dImQ6n*dImQ1n+dImQ7n*dReQ6n*dImQ1n | |
5840 | + dImQ7n*dImQ6n*dReQ1n; | |
5841 | // <5>_{6n,5n|5n,3n,3n}: | |
5842 | /*Double_t reQ11nQ5nstarQ3nstarQ3nstar = (dReQ11n*dReQ5n+dImQ11n*dImQ5n)*(pow(dReQ3n,2)-pow(dImQ3n,2)) | |
5843 | + 2.*dReQ3n*dImQ3n*(dImQ11n*dReQ5n-dReQ11n*dImQ5n); */ | |
5844 | Double_t reQ6nQ2nQ5nstarQ3nstar = dImQ2n*dImQ3n*dImQ5n*dImQ6n+dImQ5n*dImQ6n*dReQ2n*dReQ3n | |
5845 | + dImQ3n*dImQ6n*dReQ2n*dReQ5n-dImQ2n*dImQ6n*dReQ3n*dReQ5n | |
5846 | - dImQ3n*dImQ5n*dReQ2n*dReQ6n+dImQ2n*dImQ5n*dReQ3n*dReQ6n | |
5847 | + dImQ2n*dImQ3n*dReQ5n*dReQ6n+dReQ2n*dReQ3n*dReQ5n*dReQ6n; | |
5848 | Double_t reQ8nQ3nQ6nstarQ5nstar = dImQ3n*dImQ5n*dImQ6n*dImQ8n+dImQ6n*dImQ8n*dReQ3n*dReQ5n | |
5849 | + dImQ5n*dImQ8n*dReQ3n*dReQ6n-dImQ3n*dImQ8n*dReQ5n*dReQ6n | |
5850 | - dImQ5n*dImQ6n*dReQ3n*dReQ8n+dImQ3n*dImQ6n*dReQ5n*dReQ8n | |
5851 | + dImQ3n*dImQ5n*dReQ6n*dReQ8n+dReQ3n*dReQ5n*dReQ6n*dReQ8n; | |
5852 | Double_t reQ11nQ6nstarQ5nstar = dReQ11n*dReQ6n*dReQ5n-dReQ11n*dImQ6n*dImQ5n+dImQ11n*dReQ6n*dImQ5n | |
5853 | + dImQ11n*dImQ6n*dReQ5n; | |
5854 | Double_t reQ8nQ6nstarQ2nstar = dReQ8n*dReQ6n*dReQ2n-dReQ8n*dImQ6n*dImQ2n+dImQ8n*dReQ6n*dImQ2n | |
5855 | + dImQ8n*dImQ6n*dReQ2n; | |
5856 | Double_t reQ11nQ8nstarQ3nstar = dReQ11n*dReQ8n*dReQ3n-dReQ11n*dImQ8n*dImQ3n+dImQ11n*dReQ8n*dImQ3n | |
5857 | + dImQ11n*dImQ8n*dReQ3n; | |
5858 | Double_t reQ8nQ5nstarQ3nstar = dReQ8n*dReQ5n*dReQ3n-dReQ8n*dImQ5n*dImQ3n+dImQ8n*dReQ5n*dImQ3n | |
5859 | + dImQ8n*dImQ5n*dReQ3n; | |
5860 | // <5>_{5n,2n|5n,1n,1n} | |
5861 | Double_t reQ7nQ5nstarQ1nstarQ1nstar = (dReQ7n*dReQ5n+dImQ7n*dImQ5n)*(pow(dReQ1n,2)-pow(dImQ1n,2)) | |
5862 | + 2.*dReQ1n*dImQ1n*(dImQ7n*dReQ5n-dReQ7n*dImQ5n); | |
5863 | Double_t reQ6nQ1nQ5nstarQ2nstar = dImQ1n*dImQ2n*dImQ5n*dImQ6n+dImQ5n*dImQ6n*dReQ1n*dReQ2n | |
5864 | + dImQ2n*dImQ6n*dReQ1n*dReQ5n-dImQ1n*dImQ6n*dReQ2n*dReQ5n | |
5865 | - dImQ2n*dImQ5n*dReQ1n*dReQ6n+dImQ1n*dImQ5n*dReQ2n*dReQ6n | |
5866 | + dImQ1n*dImQ2n*dReQ5n*dReQ6n+dReQ1n*dReQ2n*dReQ5n*dReQ6n; | |
5867 | // <5>_{5n,4n|5n,2n,2n} | |
5868 | Double_t reQ9nQ5nstarQ2nstarQ2nstar = (dReQ9n*dReQ5n+dImQ9n*dImQ5n)*(pow(dReQ2n,2)-pow(dImQ2n,2)) | |
5869 | + 2.*dReQ2n*dImQ2n*(dImQ9n*dReQ5n-dReQ9n*dImQ5n); | |
5870 | Double_t reQ7nQ2nQ5nstarQ4nstar = dImQ2n*dImQ4n*dImQ5n*dImQ7n+dImQ5n*dImQ7n*dReQ2n*dReQ4n | |
5871 | + dImQ4n*dImQ7n*dReQ2n*dReQ5n-dImQ2n*dImQ7n*dReQ4n*dReQ5n | |
5872 | - dImQ4n*dImQ5n*dReQ2n*dReQ7n+dImQ2n*dImQ5n*dReQ4n*dReQ7n | |
5873 | + dImQ2n*dImQ4n*dReQ5n*dReQ7n+dReQ2n*dReQ4n*dReQ5n*dReQ7n; | |
5874 | Double_t reQ9nQ5nstarQ4nstar = dReQ9n*dReQ5n*dReQ4n-dReQ9n*dImQ5n*dImQ4n+dImQ9n*dReQ5n*dImQ4n | |
5875 | + dImQ9n*dImQ5n*dReQ4n; | |
5876 | Double_t reQ9nQ7nstarQ2nstar = dReQ9n*dReQ7n*dReQ2n-dReQ9n*dImQ7n*dImQ2n+dImQ9n*dReQ7n*dImQ2n | |
5877 | + dImQ9n*dImQ7n*dReQ2n; | |
5878 | // <5>_{6n,2n|6n,1n,1n} | |
5879 | Double_t reQ8nQ6nstarQ1nstarQ1nstar = (dReQ8n*dReQ6n+dImQ8n*dImQ6n)*(pow(dReQ1n,2)-pow(dImQ1n,2)) | |
5880 | + 2.*dReQ1n*dImQ1n*(dImQ8n*dReQ6n-dReQ8n*dImQ6n); | |
5881 | Double_t reQ7nQ1nQ6nstarQ2nstar = dImQ1n*dImQ2n*dImQ6n*dImQ7n+dImQ6n*dImQ7n*dReQ1n*dReQ2n | |
5882 | + dImQ2n*dImQ7n*dReQ1n*dReQ6n-dImQ1n*dImQ7n*dReQ2n*dReQ6n | |
5883 | - dImQ2n*dImQ6n*dReQ1n*dReQ7n+dImQ1n*dImQ6n*dReQ2n*dReQ7n | |
5884 | + dImQ1n*dImQ2n*dReQ6n*dReQ7n+dReQ1n*dReQ2n*dReQ6n*dReQ7n; | |
5885 | Double_t reQ8nQ7nstarQ1nstar = dReQ8n*dReQ7n*dReQ1n-dReQ8n*dImQ7n*dImQ1n+dImQ8n*dReQ7n*dImQ1n | |
5886 | + dImQ8n*dImQ7n*dReQ1n; | |
5887 | // <5>_{5n,2n|4n,2n,1n} | |
5888 | Double_t reQ5nQ2nQ4nstarQ2nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
5889 | * (dReQ1n*dReQ4n*dReQ5n-dReQ5n*dImQ1n*dImQ4n | |
5890 | + dReQ4n*dImQ1n*dImQ5n+dReQ1n*dImQ4n*dImQ5n); | |
5891 | Double_t reQ7nQ4nstarQ2nstarQ1nstar = dReQ1n*dReQ2n*dReQ4n*dReQ7n-dReQ4n*dReQ7n*dImQ1n*dImQ2n | |
5892 | - dReQ2n*dReQ7n*dImQ1n*dImQ4n-dReQ1n*dReQ7n*dImQ2n*dImQ4n | |
5893 | + dReQ2n*dReQ4n*dImQ1n*dImQ7n+dReQ1n*dReQ4n*dImQ2n*dImQ7n | |
5894 | + dReQ1n*dReQ2n*dImQ4n*dImQ7n-dImQ1n*dImQ2n*dImQ4n*dImQ7n; | |
5895 | // <5>_{4n,3n|4n,2n,1n}: | |
c10259fb | 5896 | Double_t reQ4nQ3nQ4nstarQ2nstarQ1nstar = (dReQ1n*dReQ2n*dReQ3n-dReQ3n*dImQ1n*dImQ2n |
5897 | + dReQ2n*dImQ1n*dImQ3n+dReQ1n*dImQ2n*dImQ3n) | |
5898 | * (pow(dReQ4n,2.)+pow(dImQ4n,2.)); | |
e1d101a6 | 5899 | /* |
5900 | Double_t reQ4nQ1nQ3nstarQ2nstar = dImQ1n*dImQ2n*dImQ3n*dImQ4n+dImQ3n*dImQ4n*dReQ1n*dReQ2n | |
5901 | + dImQ2n*dImQ4n*dReQ1n*dReQ3n-dImQ1n*dImQ4n*dReQ2n*dReQ3n | |
5902 | - dImQ2n*dImQ3n*dReQ1n*dReQ4n+dImQ1n*dImQ3n*dReQ2n*dReQ4n | |
5903 | + dImQ1n*dImQ2n*dReQ3n*dReQ4n+dReQ1n*dReQ2n*dReQ3n*dReQ4n; | |
5904 | */ | |
5905 | // <5>_{5n,3n|4n,3n,1n}: | |
5906 | Double_t reQ5nQ3nQ4nstarQ3nstarQ1nstar = (pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5907 | * (dReQ1n*dReQ4n*dReQ5n-dReQ5n*dImQ1n*dImQ4n | |
5908 | + dReQ4n*dImQ1n*dImQ5n+dReQ1n*dImQ4n*dImQ5n); | |
c10259fb | 5909 | Double_t reQ5nQ3nQ4nstarQ4nstar = dReQ3n*pow(dReQ4n,2.)*dReQ5n+2.*dReQ4n*dReQ5n*dImQ3n*dImQ4n |
5910 | - dReQ3n*dReQ5n*pow(dImQ4n,2.)-pow(dReQ4n,2.)*dImQ3n*dImQ5n | |
5911 | + 2.*dReQ3n*dReQ4n*dImQ4n*dImQ5n+dImQ3n*pow(dImQ4n,2.)*dImQ5n; | |
e1d101a6 | 5912 | Double_t reQ7nQ1nQ5nstarQ3nstar = dImQ1n*dImQ3n*dImQ5n*dImQ7n+dImQ5n*dImQ7n*dReQ1n*dReQ3n |
5913 | + dImQ3n*dImQ7n*dReQ1n*dReQ5n-dImQ1n*dImQ7n*dReQ3n*dReQ5n | |
5914 | - dImQ3n*dImQ5n*dReQ1n*dReQ7n+dImQ1n*dImQ5n*dReQ3n*dReQ7n | |
5915 | + dImQ1n*dImQ3n*dReQ5n*dReQ7n+dReQ1n*dReQ3n*dReQ5n*dReQ7n; | |
c10259fb | 5916 | Double_t reQ8nQ4nstarQ3nstarQ1nstar = dReQ1n*dReQ3n*dReQ4n*dReQ8n-dReQ4n*dReQ8n*dImQ1n*dImQ3n |
5917 | - dReQ3n*dReQ8n*dImQ1n*dImQ4n-dReQ1n*dReQ8n*dImQ3n*dImQ4n | |
5918 | + dReQ3n*dReQ4n*dImQ1n*dImQ8n+dReQ1n*dReQ4n*dImQ3n*dImQ8n | |
5919 | + dReQ1n*dReQ3n*dImQ4n*dImQ8n-dImQ1n*dImQ3n*dImQ4n*dImQ8n; | |
e1d101a6 | 5920 | Double_t reQ8nQ4nstarQ4nstar = pow(dReQ4n,2.)*dReQ8n-dReQ8n*pow(dImQ4n,2.)+2.*dReQ4n*dImQ4n*dImQ8n; |
5921 | // <5>_{5n,4n|4n,3n,2n}: | |
5922 | Double_t reQ5nQ4nQ4nstarQ3nstarQ2nstar = (pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
5923 | * (dReQ2n*dReQ3n*dReQ5n-dReQ5n*dImQ2n*dImQ3n | |
5924 | + dReQ3n*dImQ2n*dImQ5n+dReQ2n*dImQ3n*dImQ5n); | |
5925 | Double_t reQ6nQ3nQ5nstarQ4nstar = dImQ4n*dImQ3n*dImQ6n*dImQ5n+dImQ6n*dImQ5n*dReQ4n*dReQ3n | |
5926 | + dImQ3n*dImQ5n*dReQ4n*dReQ6n-dImQ4n*dImQ5n*dReQ3n*dReQ6n | |
5927 | - dImQ3n*dImQ6n*dReQ4n*dReQ5n+dImQ4n*dImQ6n*dReQ3n*dReQ5n | |
5928 | + dImQ4n*dImQ3n*dReQ6n*dReQ5n+dReQ4n*dReQ3n*dReQ6n*dReQ5n; | |
c10259fb | 5929 | Double_t reQ9nQ4nstarQ3nstarQ2nstar = dReQ2n*dReQ3n*dReQ4n*dReQ9n-dReQ4n*dReQ9n*dImQ2n*dImQ3n |
5930 | - dReQ3n*dReQ9n*dImQ2n*dImQ4n-dReQ2n*dReQ9n*dImQ3n*dImQ4n | |
5931 | + dReQ3n*dReQ4n*dImQ2n*dImQ9n+dReQ2n*dReQ4n*dImQ3n*dImQ9n | |
5932 | + dReQ2n*dReQ3n*dImQ4n*dImQ9n-dImQ2n*dImQ3n*dImQ4n*dImQ9n; | |
e1d101a6 | 5933 | Double_t reQ9nQ6nstarQ3nstar = dReQ9n*dReQ6n*dReQ3n-dReQ9n*dImQ6n*dImQ3n+dImQ9n*dReQ6n*dImQ3n |
5934 | + dImQ9n*dImQ6n*dReQ3n; | |
5935 | // <5>_{5n,3n|5n,2n,1n}: | |
c10259fb | 5936 | Double_t reQ5nQ3nQ5nstarQ2nstarQ1nstar = (dReQ1n*dReQ2n*dReQ3n-dReQ3n*dImQ1n*dImQ2n |
5937 | + dReQ2n*dImQ1n*dImQ3n+dReQ1n*dImQ2n*dImQ3n) | |
5938 | * (pow(dReQ5n,2.)+pow(dImQ5n,2.)); | |
5939 | Double_t reQ8nQ5nstarQ2nstarQ1nstar = dReQ1n*dReQ2n*dReQ5n*dReQ8n-dReQ5n*dReQ8n*dImQ1n*dImQ2n | |
5940 | - dReQ2n*dReQ8n*dImQ1n*dImQ5n-dReQ1n*dReQ8n*dImQ2n*dImQ5n | |
5941 | + dReQ2n*dReQ5n*dImQ1n*dImQ8n+dReQ1n*dReQ5n*dImQ2n*dImQ8n | |
5942 | + dReQ1n*dReQ2n*dImQ5n*dImQ8n-dImQ1n*dImQ2n*dImQ5n*dImQ8n; | |
e1d101a6 | 5943 | // <5>_{5n,4n|5n,3n,1n}: |
c10259fb | 5944 | Double_t reQ5nQ4nQ5nstarQ3nstarQ1nstar = (dReQ1n*dReQ3n*dReQ4n-dReQ4n*dImQ1n*dImQ3n |
5945 | + dReQ3n*dImQ1n*dImQ4n+dReQ1n*dImQ3n*dImQ4n) | |
5946 | * (pow(dReQ5n,2.)+pow(dImQ5n,2.)); | |
e1d101a6 | 5947 | Double_t reQ8nQ1nQ5nstarQ4nstar = dImQ4n*dImQ1n*dImQ8n*dImQ5n+dImQ8n*dImQ5n*dReQ4n*dReQ1n |
5948 | + dImQ1n*dImQ5n*dReQ4n*dReQ8n-dImQ4n*dImQ5n*dReQ1n*dReQ8n | |
5949 | - dImQ1n*dImQ8n*dReQ4n*dReQ5n+dImQ4n*dImQ8n*dReQ1n*dReQ5n | |
5950 | + dImQ4n*dImQ1n*dReQ8n*dReQ5n+dReQ4n*dReQ1n*dReQ8n*dReQ5n; | |
c10259fb | 5951 | Double_t reQ9nQ5nstarQ3nstarQ1nstar = dReQ1n*dReQ3n*dReQ5n*dReQ9n-dReQ5n*dReQ9n*dImQ1n*dImQ3n |
5952 | - dReQ3n*dReQ9n*dImQ1n*dImQ5n-dReQ1n*dReQ9n*dImQ3n*dImQ5n | |
5953 | + dReQ3n*dReQ5n*dImQ1n*dImQ9n+dReQ1n*dReQ5n*dImQ3n*dImQ9n | |
5954 | + dReQ1n*dReQ3n*dImQ5n*dImQ9n-dImQ1n*dImQ3n*dImQ5n*dImQ9n; | |
e1d101a6 | 5955 | Double_t reQ9nQ8nstarQ1nstar = dReQ9n*dReQ8n*dReQ1n-dReQ9n*dImQ8n*dImQ1n+dImQ9n*dReQ8n*dImQ1n |
5956 | + dImQ9n*dImQ8n*dReQ1n; | |
5957 | // <5>_{6n,1n|4n,2n,1n}: | |
c10259fb | 5958 | Double_t reQ6nQ1nQ4nstarQ2nstarQ1nstar = (dReQ2n*dReQ4n*dReQ6n-dReQ6n*dImQ2n*dImQ4n |
5959 | + dReQ4n*dImQ2n*dImQ6n+dReQ2n*dImQ4n*dImQ6n) | |
5960 | * (pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
e1d101a6 | 5961 | // <5>_{6n,3n|4n,3n,2n}: |
c10259fb | 5962 | Double_t reQ6nQ3nQ4nstarQ3nstarQ2nstar = (dReQ2n*dReQ4n*dReQ6n-dReQ6n*dImQ2n*dImQ4n |
5963 | + dReQ4n*dImQ2n*dImQ6n+dReQ2n*dImQ4n*dImQ6n) | |
5964 | * (pow(dReQ3n,2.)+pow(dImQ3n,2.)); | |
e1d101a6 | 5965 | Double_t reQ7nQ2nQ6nstarQ3nstar = dImQ3n*dImQ2n*dImQ7n*dImQ6n+dImQ7n*dImQ6n*dReQ3n*dReQ2n |
5966 | + dImQ2n*dImQ6n*dReQ3n*dReQ7n-dImQ3n*dImQ6n*dReQ2n*dReQ7n | |
5967 | - dImQ2n*dImQ7n*dReQ3n*dReQ6n+dImQ3n*dImQ7n*dReQ2n*dReQ6n | |
5968 | + dImQ3n*dImQ2n*dReQ7n*dReQ6n+dReQ3n*dReQ2n*dReQ7n*dReQ6n; | |
5969 | // <5>_{6n,2n|5n,2n,1n}: | |
5970 | Double_t reQ6nQ2nQ5nstarQ2nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
5971 | * (dReQ1n*dReQ5n*dReQ6n-dReQ6n*dImQ1n*dImQ5n | |
5972 | + dReQ5n*dImQ1n*dImQ6n+dReQ1n*dImQ5n*dImQ6n); | |
5973 | // <5>_{6n,3n|5n,3n,1n}: | |
5974 | Double_t reQ6nQ3nQ5nstarQ3nstarQ1nstar = (pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
5975 | * (dReQ1n*dReQ5n*dReQ6n-dReQ6n*dImQ1n*dImQ5n | |
5976 | + dReQ5n*dImQ1n*dImQ6n+dReQ1n*dImQ5n*dImQ6n); | |
5977 | Double_t reQ8nQ1nQ6nstarQ3nstar = dImQ3n*dImQ1n*dImQ8n*dImQ6n+dImQ8n*dImQ6n*dReQ3n*dReQ1n | |
5978 | + dImQ1n*dImQ6n*dReQ3n*dReQ8n-dImQ3n*dImQ6n*dReQ1n*dReQ8n | |
5979 | - dImQ1n*dImQ8n*dReQ3n*dReQ6n+dImQ3n*dImQ8n*dReQ1n*dReQ6n | |
5980 | + dImQ3n*dImQ1n*dReQ8n*dReQ6n+dReQ3n*dReQ1n*dReQ8n*dReQ6n; | |
5981 | // <5>_{6n,4n|5n,4n,1n}: | |
5982 | Double_t reQ6nQ4nQ5nstarQ4nstarQ1nstar = (pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
5983 | * (dReQ1n*dReQ5n*dReQ6n-dReQ6n*dImQ1n*dImQ5n | |
5984 | + dReQ5n*dImQ1n*dImQ6n+dReQ1n*dImQ5n*dImQ6n); | |
c10259fb | 5985 | Double_t reQ6nQ4nQ5nstarQ5nstar = dReQ4n*pow(dReQ5n,2.)*dReQ6n+2.*dReQ5n*dReQ6n*dImQ4n*dImQ5n |
5986 | - dReQ4n*dReQ6n*pow(dImQ5n,2.)-pow(dReQ5n,2.)*dImQ4n*dImQ6n | |
5987 | + 2.*dReQ4n*dReQ5n*dImQ5n*dImQ6n+dImQ4n*pow(dImQ5n,2.)*dImQ6n; | |
e1d101a6 | 5988 | Double_t reQ9nQ1nQ6nstarQ4nstar = dImQ4n*dImQ1n*dImQ9n*dImQ6n+dImQ9n*dImQ6n*dReQ4n*dReQ1n |
5989 | + dImQ1n*dImQ6n*dReQ4n*dReQ9n-dImQ4n*dImQ6n*dReQ1n*dReQ9n | |
5990 | - dImQ1n*dImQ9n*dReQ4n*dReQ6n+dImQ4n*dImQ9n*dReQ1n*dReQ6n | |
c10259fb | 5991 | + dImQ4n*dImQ1n*dReQ9n*dReQ6n+dReQ4n*dReQ1n*dReQ9n*dReQ6n; |
5992 | Double_t reQ10nQ5nstarQ4nstarQ1nstar = dReQ1n*dReQ4n*dReQ5n*dReQ10n-dReQ5n*dReQ10n*dImQ1n*dImQ4n | |
5993 | - dReQ4n*dReQ10n*dImQ1n*dImQ5n-dReQ1n*dReQ10n*dImQ4n*dImQ5n | |
5994 | + dReQ4n*dReQ5n*dImQ1n*dImQ10n+dReQ1n*dReQ5n*dImQ4n*dImQ10n | |
5995 | + dReQ1n*dReQ4n*dImQ5n*dImQ10n-dImQ1n*dImQ4n*dImQ5n*dImQ10n; | |
e1d101a6 | 5996 | Double_t reQ10nQ9nstarQ1nstar = dReQ10n*dReQ9n*dReQ1n-dReQ10n*dImQ9n*dImQ1n+dImQ10n*dReQ9n*dImQ1n |
5997 | + dImQ10n*dImQ9n*dReQ1n; | |
5998 | Double_t reQ10nQ5nstarQ5nstar = pow(dReQ5n,2.)*dReQ10n-dReQ10n*pow(dImQ5n,2.)+2.*dReQ5n*dImQ5n*dImQ10n; | |
5999 | // <5>_{6n,3n|6n,2n,1n}: | |
c10259fb | 6000 | Double_t reQ6nQ3nQ6nstarQ2nstarQ1nstar = (dReQ1n*dReQ2n*dReQ3n-dReQ3n*dImQ1n*dImQ2n |
6001 | + dReQ2n*dImQ1n*dImQ3n+dReQ1n*dImQ2n*dImQ3n) | |
6002 | * (pow(dReQ6n,2.)+pow(dImQ6n,2.)); | |
6003 | Double_t reQ9nQ6nstarQ2nstarQ1nstar = dReQ1n*dReQ2n*dReQ6n*dReQ9n-dReQ6n*dReQ9n*dImQ1n*dImQ2n | |
6004 | - dReQ2n*dReQ9n*dImQ1n*dImQ6n-dReQ1n*dReQ9n*dImQ2n*dImQ6n | |
6005 | + dReQ2n*dReQ6n*dImQ1n*dImQ9n+dReQ1n*dReQ6n*dImQ2n*dImQ9n | |
6006 | + dReQ1n*dReQ2n*dImQ6n*dImQ9n-dImQ1n*dImQ2n*dImQ6n*dImQ9n; | |
e1d101a6 | 6007 | // <5>_{6n,4n|6n,3n,1n}: |
c10259fb | 6008 | Double_t reQ6nQ4nQ6nstarQ3nstarQ1nstar = (dReQ1n*dReQ3n*dReQ4n-dReQ4n*dImQ1n*dImQ3n |
6009 | + dReQ3n*dImQ1n*dImQ4n+dReQ1n*dImQ3n*dImQ4n) | |
6010 | * (pow(dReQ6n,2.)+pow(dImQ6n,2.)); | |
6011 | Double_t reQ10nQ6nstarQ3nstarQ1nstar = dReQ1n*dReQ3n*dReQ6n*dReQ10n-dReQ6n*dReQ10n*dImQ1n*dImQ3n | |
6012 | - dReQ3n*dReQ10n*dImQ1n*dImQ6n-dReQ1n*dReQ10n*dImQ3n*dImQ6n | |
6013 | + dReQ3n*dReQ6n*dImQ1n*dImQ10n+dReQ1n*dReQ6n*dImQ3n*dImQ10n | |
6014 | + dReQ1n*dReQ3n*dImQ6n*dImQ10n-dImQ1n*dImQ3n*dImQ6n*dImQ10n; | |
e1d101a6 | 6015 | // <5>_{6n,5n|5n,4n,2n}: |
c10259fb | 6016 | Double_t reQ6nQ5nQ5nstarQ4nstarQ2nstar = (dReQ2n*dReQ4n*dReQ6n-dReQ6n*dImQ2n*dImQ4n |
6017 | + dReQ4n*dImQ2n*dImQ6n+dReQ2n*dImQ4n*dImQ6n) | |
6018 | * (pow(dReQ5n,2.)+pow(dImQ5n,2.)); | |
e1d101a6 | 6019 | Double_t reQ7nQ4nQ6nstarQ5nstar = dImQ5n*dImQ4n*dImQ7n*dImQ6n+dImQ7n*dImQ6n*dReQ5n*dReQ4n |
6020 | + dImQ4n*dImQ6n*dReQ5n*dReQ7n-dImQ5n*dImQ6n*dReQ4n*dReQ7n | |
6021 | - dImQ4n*dImQ7n*dReQ5n*dReQ6n+dImQ5n*dImQ7n*dReQ4n*dReQ6n | |
6022 | + dImQ5n*dImQ4n*dReQ7n*dReQ6n+dReQ5n*dReQ4n*dReQ7n*dReQ6n; | |
6023 | Double_t reQ9nQ2nQ6nstarQ5nstar = dImQ5n*dImQ2n*dImQ9n*dImQ6n+dImQ9n*dImQ6n*dReQ5n*dReQ2n | |
6024 | + dImQ2n*dImQ6n*dReQ5n*dReQ9n-dImQ5n*dImQ6n*dReQ2n*dReQ9n | |
6025 | - dImQ2n*dImQ9n*dReQ5n*dReQ6n+dImQ5n*dImQ9n*dReQ2n*dReQ6n | |
6026 | + dImQ5n*dImQ2n*dReQ9n*dReQ6n+dReQ5n*dReQ2n*dReQ9n*dReQ6n; | |
c10259fb | 6027 | Double_t reQ11nQ5nstarQ4nstarQ2nstar = dReQ2n*dReQ4n*dReQ5n*dReQ11n-dReQ5n*dReQ11n*dImQ2n*dImQ4n |
6028 | - dReQ4n*dReQ11n*dImQ2n*dImQ5n-dReQ2n*dReQ11n*dImQ4n*dImQ5n | |
6029 | + dReQ4n*dReQ5n*dImQ2n*dImQ11n+dReQ2n*dReQ5n*dImQ4n*dImQ11n | |
6030 | + dReQ2n*dReQ4n*dImQ5n*dImQ11n-dImQ2n*dImQ4n*dImQ5n*dImQ11n; | |
e1d101a6 | 6031 | Double_t reQ11nQ9nstarQ2nstar = dReQ11n*dReQ9n*dReQ2n-dReQ11n*dImQ9n*dImQ2n+dImQ11n*dReQ9n*dImQ2n |
6032 | + dImQ11n*dImQ9n*dReQ2n; | |
6033 | Double_t reQ11nQ7nstarQ4nstar = dReQ11n*dReQ7n*dReQ4n-dReQ11n*dImQ7n*dImQ4n+dImQ11n*dReQ7n*dImQ4n | |
6034 | + dImQ11n*dImQ7n*dReQ4n; | |
6035 | // <5>_{6n,5n|6n,3n,2n}: | |
c10259fb | 6036 | Double_t reQ6nQ5nQ6nstarQ3nstarQ2nstar = (dReQ2n*dReQ3n*dReQ5n-dReQ5n*dImQ2n*dImQ3n |
6037 | + dReQ3n*dImQ2n*dImQ5n+dReQ2n*dImQ3n*dImQ5n) | |
6038 | * (pow(dReQ6n,2.)+pow(dImQ6n,2.)); | |
6039 | Double_t reQ11nQ6nstarQ3nstarQ2nstar = dReQ2n*dReQ3n*dReQ6n*dReQ11n-dReQ6n*dReQ11n*dImQ2n*dImQ3n | |
6040 | - dReQ3n*dReQ11n*dImQ2n*dImQ6n-dReQ2n*dReQ11n*dImQ3n*dImQ6n | |
6041 | + dReQ3n*dReQ6n*dImQ2n*dImQ11n+dReQ2n*dReQ6n*dImQ3n*dImQ11n | |
6042 | + dReQ2n*dReQ3n*dImQ6n*dImQ11n-dImQ2n*dImQ3n*dImQ6n*dImQ11n; | |
e1d101a6 | 6043 | // <5>_{6n,5n|6n,4n,1n}: |
c10259fb | 6044 | Double_t reQ6nQ5nQ6nstarQ4nstarQ1nstar = (dReQ1n*dReQ4n*dReQ5n-dReQ5n*dImQ1n*dImQ4n |
6045 | + dReQ4n*dImQ1n*dImQ5n+dReQ1n*dImQ4n*dImQ5n) | |
6046 | * (pow(dReQ6n,2.)+pow(dImQ6n,2.)); | |
e1d101a6 | 6047 | Double_t reQ10nQ1nQ6nstarQ5nstar = dImQ5n*dImQ1n*dImQ10n*dImQ6n+dImQ10n*dImQ6n*dReQ5n*dReQ1n |
6048 | + dImQ1n*dImQ6n*dReQ5n*dReQ10n-dImQ5n*dImQ6n*dReQ1n*dReQ10n | |
6049 | - dImQ1n*dImQ10n*dReQ5n*dReQ6n+dImQ5n*dImQ10n*dReQ1n*dReQ6n | |
6050 | + dImQ5n*dImQ1n*dReQ10n*dReQ6n+dReQ5n*dReQ1n*dReQ10n*dReQ6n; | |
6051 | Double_t reQ11nQ10nstarQ1nstar = dReQ11n*dReQ10n*dReQ1n-dReQ11n*dImQ10n*dImQ1n+dImQ11n*dReQ10n*dImQ1n | |
6052 | + dImQ11n*dImQ10n*dReQ1n; | |
c10259fb | 6053 | Double_t reQ11nQ6nstarQ4nstarQ1nstar = dReQ1n*dReQ4n*dReQ6n*dReQ11n-dReQ6n*dReQ11n*dImQ1n*dImQ4n |
6054 | - dReQ4n*dReQ11n*dImQ1n*dImQ6n-dReQ1n*dReQ11n*dImQ4n*dImQ6n | |
6055 | + dReQ4n*dReQ6n*dImQ1n*dImQ11n+dReQ1n*dReQ6n*dImQ4n*dImQ11n | |
6056 | + dReQ1n*dReQ4n*dImQ6n*dImQ11n-dImQ1n*dImQ4n*dImQ6n*dImQ11n; | |
e1d101a6 | 6057 | // <5>_{4n,1n|3n,1n,1n}: |
6058 | Double_t reQ4nQ1nQ3nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6059 | * (dReQ1n*dReQ3n*dReQ4n-dReQ4n*dImQ1n*dImQ3n | |
6060 | + dReQ3n*dImQ1n*dImQ4n+dReQ1n*dImQ3n*dImQ4n); | |
6061 | Double_t reQ4nQ1nQ4nstarQ1nstar = (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
6062 | Double_t reQ3nQ1nQ3nstarQ1nstar = (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
6063 | // <5>_{4n,3n|3n,3n,1n}: | |
6064 | Double_t reQ4nQ3nQ3nstarQ3nstarQ1nstar = (pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6065 | * (dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)); | |
6066 | Double_t reQ7nQ3nstarQ3nstarQ1nstar = (dReQ7n*dReQ1n+dImQ7n*dImQ1n)*(pow(dReQ3n,2)-pow(dImQ3n,2)) | |
6067 | + 2.*dReQ3n*dImQ3n*(dImQ7n*dReQ1n-dReQ7n*dImQ1n); | |
6068 | // <5>_{4n,4n|4n,3n,1n}: | |
6069 | Double_t reQ4nQ4nQ4nstarQ3nstarQ1nstar = (pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
c10259fb | 6070 | * reQ4nQ3nstarQ1nstar; |
6071 | Double_t reQ7nQ1nQ4nstarQ4nstar = dReQ1n*pow(dReQ4n,2.)*dReQ7n+2.*dReQ4n*dReQ7n*dImQ1n*dImQ4n | |
6072 | - dReQ1n*dReQ7n*pow(dImQ4n,2.)-pow(dReQ4n,2.)*dImQ1n*dImQ7n | |
6073 | + 2.*dReQ1n*dReQ4n*dImQ4n*dImQ7n+dImQ1n*pow(dImQ4n,2.)*dImQ7n; | |
e1d101a6 | 6074 | // <5>_{5n,2n|3n,2n,2n}: |
6075 | Double_t reQ5nQ2nQ3nstarQ2nstarQ2nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
c10259fb | 6076 | * reQ5nQ3nstarQ2nstar; |
e1d101a6 | 6077 | // <5>_{5n,3n|3n,3n,2n}: |
6078 | Double_t reQ5nQ3nQ3nstarQ3nstarQ2nstar = (pow(dImQ3n,2.)+pow(dReQ3n,2.)) | |
6079 | * (dImQ3n*dImQ5n*dReQ2n+dImQ2n*dImQ5n*dReQ3n | |
6080 | - dImQ2n*dImQ3n*dReQ5n+dReQ2n*dReQ3n*dReQ5n); | |
6081 | Double_t reQ8nQ3nstarQ3nstarQ2nstar = (dReQ8n*dReQ2n+dImQ8n*dImQ2n)*(pow(dReQ3n,2)-pow(dImQ3n,2)) | |
6082 | + 2.*dReQ3n*dImQ3n*(dImQ8n*dReQ2n-dReQ8n*dImQ2n); | |
6083 | /* | |
6084 | Double_t reQ5nQ1nQ3nstarQ2nstar = dImQ2n*dImQ1n*dImQ5n*dImQ3n+dImQ5n*dImQ3n*dReQ2n*dReQ1n | |
6085 | + dImQ1n*dImQ3n*dReQ2n*dReQ5n-dImQ2n*dImQ3n*dReQ1n*dReQ5n | |
6086 | - dImQ1n*dImQ5n*dReQ2n*dReQ3n+dImQ2n*dImQ5n*dReQ1n*dReQ3n | |
6087 | + dImQ2n*dImQ1n*dReQ5n*dReQ3n+dReQ2n*dReQ1n*dReQ5n*dReQ3n; | |
6088 | */ | |
6089 | // <5>_{5n,1n|4n,1n,1n}: | |
6090 | Double_t reQ5nQ1nQ4nstarQ1nstarQ1nstar = (pow(dImQ1n,2.)+pow(dReQ1n,2.)) | |
6091 | * (dImQ1n*dImQ5n*dReQ4n+dImQ4n*dImQ5n*dReQ1n | |
6092 | - dImQ4n*dImQ1n*dReQ5n+dReQ4n*dReQ1n*dReQ5n); | |
6093 | // <5>_{5n,4n|4n,4n,1n}: | |
6094 | Double_t reQ5nQ4nQ4nstarQ4nstarQ1nstar = (pow(dImQ4n,2.)+pow(dReQ4n,2.)) | |
6095 | * (dImQ4n*dImQ5n*dReQ1n+dImQ1n*dImQ5n*dReQ4n | |
6096 | - dImQ1n*dImQ4n*dReQ5n+dReQ1n*dReQ4n*dReQ5n); | |
6097 | Double_t reQ9nQ4nstarQ4nstarQ1nstar = (dReQ9n*dReQ1n+dImQ9n*dImQ1n)*(pow(dReQ4n,2)-pow(dImQ4n,2)) | |
6098 | + 2.*dReQ4n*dImQ4n*(dImQ9n*dReQ1n-dReQ9n*dImQ1n); | |
6099 | // <5>_{5n,5n|5n,3n,2n}: | |
6100 | Double_t reQ5nQ5nQ5nstarQ3nstarQ2nstar = (pow(dImQ5n,2.)+pow(dReQ5n,2.)) | |
6101 | * (dImQ3n*dImQ5n*dReQ2n+dImQ2n*dImQ5n*dReQ3n | |
6102 | - dImQ2n*dImQ3n*dReQ5n+dReQ2n*dReQ3n*dReQ5n); | |
c10259fb | 6103 | Double_t reQ7nQ3nQ5nstarQ5nstar = dReQ3n*pow(dReQ5n,2.)*dReQ7n+2.*dReQ5n*dReQ7n*dImQ3n*dImQ5n |
6104 | - dReQ3n*dReQ7n*pow(dImQ5n,2.)-pow(dReQ5n,2.)*dImQ3n*dImQ7n | |
6105 | + 2.*dReQ3n*dReQ5n*dImQ5n*dImQ7n+dImQ3n*pow(dImQ5n,2.)*dImQ7n; | |
6106 | Double_t reQ8nQ2nQ5nstarQ5nstar = dReQ2n*pow(dReQ5n,2.)*dReQ8n+2.*dReQ5n*dReQ8n*dImQ2n*dImQ5n | |
6107 | - dReQ2n*dReQ8n*pow(dImQ5n,2.)-pow(dReQ5n,2.)*dImQ2n*dImQ8n | |
6108 | + 2.*dReQ2n*dReQ5n*dImQ5n*dImQ8n+dImQ2n*pow(dImQ5n,2.)*dImQ8n; | |
6109 | Double_t reQ10nQ5nstarQ3nstarQ2nstar = dReQ2n*dReQ3n*dReQ5n*dReQ10n-dReQ5n*dReQ10n*dImQ2n*dImQ3n | |
6110 | - dReQ3n*dReQ10n*dImQ2n*dImQ5n-dReQ2n*dReQ10n*dImQ3n*dImQ5n | |
6111 | + dReQ3n*dReQ5n*dImQ2n*dImQ10n+dReQ2n*dReQ5n*dImQ3n*dImQ10n | |
6112 | + dReQ2n*dReQ3n*dImQ5n*dImQ10n-dImQ2n*dImQ3n*dImQ5n*dImQ10n; | |
e1d101a6 | 6113 | Double_t reQ10nQ8nstarQ2nstar = dReQ10n*dReQ8n*dReQ2n-dReQ10n*dImQ8n*dImQ2n+dImQ10n*dReQ8n*dImQ2n |
6114 | + dImQ10n*dImQ8n*dReQ2n; | |
6115 | // <5>_{5n,5n|5n,4n,1n}: | |
6116 | Double_t reQ5nQ5nQ5nstarQ4nstarQ1nstar = (pow(dImQ5n,2.)+pow(dReQ5n,2.)) | |
6117 | * (dImQ4n*dImQ5n*dReQ1n+dImQ1n*dImQ5n*dReQ4n | |
6118 | - dImQ1n*dImQ4n*dReQ5n+dReQ1n*dReQ4n*dReQ5n); | |
c10259fb | 6119 | Double_t reQ9nQ1nQ5nstarQ5nstar = dReQ1n*pow(dReQ5n,2.)*dReQ9n+2.*dReQ5n*dReQ9n*dImQ1n*dImQ5n |
6120 | - dReQ1n*dReQ9n*pow(dImQ5n,2.)-pow(dReQ5n,2.)*dImQ1n*dImQ9n | |
6121 | + 2.*dReQ1n*dReQ5n*dImQ5n*dImQ9n+dImQ1n*pow(dImQ5n,2.)*dImQ9n; | |
e1d101a6 | 6122 | // <5>_{6n,1n|5n,1n,1n}: |
6123 | Double_t reQ6nQ1nQ5nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6124 | * (dReQ1n*dReQ5n*dReQ6n-dReQ6n*dImQ1n*dImQ5n | |
6125 | + dReQ5n*dImQ1n*dImQ6n+dReQ1n*dImQ5n*dImQ6n); | |
6126 | // <5>_{6n,5n|5n,5n,1n}: | |
6127 | Double_t reQ6nQ5nQ5nstarQ5nstarQ1nstar = (pow(dImQ5n,2.)+pow(dReQ5n,2.)) | |
6128 | * (dImQ5n*dImQ6n*dReQ1n+dImQ1n*dImQ6n*dReQ5n | |
6129 | - dImQ1n*dImQ5n*dReQ6n+dReQ1n*dReQ5n*dReQ6n); | |
6130 | Double_t reQ11nQ5nstarQ5nstarQ1nstar = (dReQ11n*dReQ1n+dImQ11n*dImQ1n)*(pow(dReQ5n,2)-pow(dImQ5n,2)) | |
6131 | + 2.*dReQ5n*dImQ5n*(dImQ11n*dReQ1n-dReQ11n*dImQ1n); | |
6132 | // <5>_{6n,6n|6n,5n,1n}: | |
6133 | Double_t reQ6nQ6nQ6nstarQ5nstarQ1nstar = (pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
c10259fb | 6134 | * reQ6nQ5nstarQ1nstar; |
6135 | Double_t reQ7nQ5nQ6nstarQ6nstar = dReQ5n*pow(dReQ6n,2.)*dReQ7n+2.*dReQ6n*dReQ7n*dImQ5n*dImQ6n | |
6136 | - dReQ5n*dReQ7n*pow(dImQ6n,2.)-pow(dReQ6n,2.)*dImQ5n*dImQ7n | |
6137 | + 2.*dReQ5n*dReQ6n*dImQ6n*dImQ7n+dImQ5n*pow(dImQ6n,2.)*dImQ7n; | |
6138 | Double_t reQ11nQ1nQ6nstarQ6nstar = dReQ1n*pow(dReQ6n,2.)*dReQ11n+2.*dReQ6n*dReQ11n*dImQ1n*dImQ6n | |
6139 | - dReQ1n*dReQ11n*pow(dImQ6n,2.)-pow(dReQ6n,2.)*dImQ1n*dImQ11n | |
6140 | + 2.*dReQ1n*dReQ6n*dImQ6n*dImQ11n+dImQ1n*pow(dImQ6n,2.)*dImQ11n; | |
e1d101a6 | 6141 | Double_t reQ12nQ6nstarQ6nstar = pow(dReQ6n,2.)*dReQ12n-dReQ12n*pow(dImQ6n,2.)+2.*dReQ6n*dImQ6n*dImQ12n; |
6142 | Double_t reQ12nQ11nstarQ1nstar = dReQ12n*dReQ11n*dReQ1n-dReQ12n*dImQ11n*dImQ1n+dImQ12n*dReQ11n*dImQ1n | |
6143 | + dImQ12n*dImQ11n*dReQ1n; | |
c10259fb | 6144 | Double_t reQ12nQ6nstarQ5nstarQ1nstar = dReQ1n*dReQ5n*dReQ6n*dReQ12n-dReQ6n*dReQ12n*dImQ1n*dImQ5n |
6145 | - dReQ5n*dReQ12n*dImQ1n*dImQ6n-dReQ1n*dReQ12n*dImQ5n*dImQ6n | |
6146 | + dReQ5n*dReQ6n*dImQ1n*dImQ12n+dReQ1n*dReQ6n*dImQ5n*dImQ12n | |
6147 | + dReQ1n*dReQ5n*dImQ6n*dImQ12n-dImQ1n*dImQ5n*dImQ6n*dImQ12n; | |
e1d101a6 | 6148 | Double_t reQ12nQ7nstarQ5nstar = dReQ12n*dReQ7n*dReQ5n-dReQ12n*dImQ7n*dImQ5n+dImQ12n*dReQ7n*dImQ5n |
6149 | + dImQ12n*dImQ7n*dReQ5n; | |
6150 | // <5>_{6n,2n|4n,3n,1n}: | |
c10259fb | 6151 | Double_t reQ6nQ2nQ4nstarQ3nstarQ1nstar = dReQ1n*dReQ2n*dReQ3n*dReQ4n*dReQ6n+dReQ3n*dReQ4n*dReQ6n*dImQ1n*dImQ2n |
6152 | - dReQ2n*dReQ4n*dReQ6n*dImQ1n*dImQ3n+dReQ1n*dReQ4n*dReQ6n*dImQ2n*dImQ3n | |
6153 | - dReQ2n*dReQ3n*dReQ6n*dImQ1n*dImQ4n+dReQ1n*dReQ3n*dReQ6n*dImQ2n*dImQ4n | |
6154 | - dReQ1n*dReQ2n*dReQ6n*dImQ3n*dImQ4n-dReQ6n*dImQ1n*dImQ2n*dImQ3n*dImQ4n | |
6155 | + dReQ2n*dReQ3n*dReQ4n*dImQ1n*dImQ6n-dReQ1n*dReQ3n*dReQ4n*dImQ2n*dImQ6n | |
6156 | + dReQ1n*dReQ2n*dReQ4n*dImQ3n*dImQ6n+dReQ4n*dImQ1n*dImQ2n*dImQ3n*dImQ6n | |
6157 | + dReQ1n*dReQ2n*dReQ3n*dImQ4n*dImQ6n+dReQ3n*dImQ1n*dImQ2n*dImQ4n*dImQ6n | |
6158 | - dReQ2n*dImQ1n*dImQ3n*dImQ4n*dImQ6n+dReQ1n*dImQ2n*dImQ3n*dImQ4n*dImQ6n; | |
6159 | Double_t reQ6nQ2nQ4nstarQ4nstar = dReQ2n*pow(dReQ4n,2.)*dReQ6n+2.*dReQ4n*dReQ6n*dImQ2n*dImQ4n | |
6160 | - dReQ2n*dReQ6n*pow(dImQ4n,2.)-pow(dReQ4n,2.)*dImQ2n*dImQ6n | |
6161 | + 2.*dReQ2n*dReQ4n*dImQ4n*dImQ6n+dImQ2n*pow(dImQ4n,2.)*dImQ6n; | |
e1d101a6 | 6162 | // <5>_{6n,2n,1n|5n,4n}: |
c10259fb | 6163 | Double_t reQ6nQ2nQ1nQ5nstarQ4nstar = dReQ1n*dReQ2n*dReQ4n*dReQ6n*dReQ5n - dReQ4n*dReQ6n*dReQ5n*dImQ1n*dImQ2n |
6164 | + dReQ2n*dReQ6n*dReQ5n*dImQ1n*dImQ4n + dReQ1n*dReQ6n*dReQ5n*dImQ2n*dImQ4n | |
6165 | - dReQ2n*dReQ4n*dReQ5n*dImQ1n*dImQ6n - dReQ1n*dReQ4n*dReQ5n*dImQ2n*dImQ6n | |
6166 | + dReQ1n*dReQ2n*dReQ5n*dImQ4n*dImQ6n - dReQ5n*dImQ1n*dImQ2n*dImQ4n*dImQ6n | |
6167 | + dReQ2n*dReQ4n*dReQ6n*dImQ1n*dImQ5n + dReQ1n*dReQ4n*dReQ6n*dImQ2n*dImQ5n | |
6168 | - dReQ1n*dReQ2n*dReQ6n*dImQ4n*dImQ5n + dReQ6n*dImQ1n*dImQ2n*dImQ4n*dImQ5n | |
6169 | + dReQ1n*dReQ2n*dReQ4n*dImQ6n*dImQ5n - dReQ4n*dImQ1n*dImQ2n*dImQ6n*dImQ5n | |
6170 | + dReQ2n*dImQ1n*dImQ4n*dImQ6n*dImQ5n + dReQ1n*dImQ2n*dImQ4n*dImQ6n*dImQ5n; | |
e1d101a6 | 6171 | |
6172 | // <5>_{6n,4n|5n,3n,2n}: | |
c10259fb | 6173 | Double_t reQ6nQ4nQ5nstarQ3nstarQ2nstar = dReQ2n*dReQ3n*dReQ4n*dReQ5n*dReQ6n - dReQ4n*dReQ5n*dReQ6n*dImQ2n*dImQ3n |
6174 | + dReQ3n*dReQ5n*dReQ6n*dImQ2n*dImQ4n + dReQ2n*dReQ5n*dReQ6n*dImQ3n*dImQ4n | |
6175 | - dReQ3n*dReQ4n*dReQ6n*dImQ2n*dImQ5n - dReQ2n*dReQ4n*dReQ6n*dImQ3n*dImQ5n | |
6176 | + dReQ2n*dReQ3n*dReQ6n*dImQ4n*dImQ5n - dReQ6n*dImQ2n*dImQ3n*dImQ4n*dImQ5n | |
6177 | + dReQ3n*dReQ4n*dReQ5n*dImQ2n*dImQ6n + dReQ2n*dReQ4n*dReQ5n*dImQ3n*dImQ6n | |
6178 | - dReQ2n*dReQ3n*dReQ5n*dImQ4n*dImQ6n + dReQ5n*dImQ2n*dImQ3n*dImQ4n*dImQ6n | |
6179 | + dReQ2n*dReQ3n*dReQ4n*dImQ5n*dImQ6n - dReQ4n*dImQ2n*dImQ3n*dImQ5n*dImQ6n | |
6180 | + dReQ3n*dImQ2n*dImQ4n*dImQ5n*dImQ6n + dReQ2n*dImQ3n*dImQ4n*dImQ5n*dImQ6n; | |
e1d101a6 | 6181 | Double_t reQ8nQ2nQ6nstarQ4nstar = dImQ4n*dImQ2n*dImQ8n*dImQ6n+dImQ8n*dImQ6n*dReQ4n*dReQ2n |
6182 | + dImQ2n*dImQ6n*dReQ4n*dReQ8n-dImQ4n*dImQ6n*dReQ2n*dReQ8n | |
6183 | - dImQ2n*dImQ8n*dReQ4n*dReQ6n+dImQ4n*dImQ8n*dReQ2n*dReQ6n | |
6184 | + dImQ4n*dImQ2n*dReQ8n*dReQ6n+dReQ4n*dReQ2n*dReQ8n*dReQ6n; | |
6185 | ||
6186 | // <5>_{4n,4n|3n,3n,2n}: | |
c10259fb | 6187 | Double_t reQ4nQ4nQ3nstarQ3nstarQ2nstar = dReQ2n*pow(dReQ3n,2.)*pow(dReQ4n,2.)-2.*dReQ3n*pow(dReQ4n,2.)*dImQ2n*dImQ3n |
6188 | - dReQ2n*pow(dReQ4n,2.)*pow(dImQ3n,2.)+2.*pow(dReQ3n,2.)*dReQ4n*dImQ2n*dImQ4n | |
6189 | + 4.*dReQ2n*dReQ3n*dReQ4n*dImQ3n*dImQ4n - 2.*dReQ4n*dImQ2n*pow(dImQ3n,2.)*dImQ4n | |
6190 | - dReQ2n*pow(dReQ3n,2.)*pow(dImQ4n,2.) + 2.*dReQ3n*dImQ2n*dImQ3n*pow(dImQ4n,2.) | |
6191 | + dReQ2n*pow(dImQ3n,2.)*pow(dImQ4n,2.); | |
6192 | ||
e1d101a6 | 6193 | // <5>_{5n|2n,1n,1n,1n}: |
c10259fb | 6194 | Double_t reQ5nQ2nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,3.)*dReQ2n*dReQ5n-3.*dReQ1n*dReQ2n*dReQ5n*pow(dImQ1n,2.) |
6195 | - 3.*pow(dReQ1n,2.)*dReQ5n*dImQ1n*dImQ2n+dReQ5n*pow(dImQ1n,3.)*dImQ2n | |
6196 | + 3.*pow(dReQ1n,2.)*dReQ2n*dImQ1n*dImQ5n-dReQ2n*pow(dImQ1n,3.)*dImQ5n | |
6197 | + pow(dReQ1n,3.)*dImQ2n*dImQ5n-3.*dReQ1n*pow(dImQ1n,2.)*dImQ2n*dImQ5n; | |
e1d101a6 | 6198 | |
6199 | // <5>_{5n,1n|2n,2n,2n}: | |
c10259fb | 6200 | Double_t reQ5nQ1nQ2nstarQ2nstarQ2nstar = dReQ1n*pow(dReQ2n,3.)*dReQ5n+3.*pow(dReQ2n,2.)*dReQ5n*dImQ1n*dImQ2n |
6201 | - 3.*dReQ1n*dReQ2n*dReQ5n*pow(dImQ2n,2.)-dReQ5n*dImQ1n*pow(dImQ2n,3.) | |
6202 | - pow(dReQ2n,3.)*dImQ1n*dImQ5n+3.*dReQ1n*pow(dReQ2n,2.)*dImQ2n*dImQ5n | |
6203 | + 3.*dReQ2n*dImQ1n*pow(dImQ2n,2.)*dImQ5n-dReQ1n*pow(dImQ2n,3.)*dImQ5n; | |
e1d101a6 | 6204 | |
6205 | ||
6206 | // <5>_{5n,4n|3n,3n,3n}: | |
c10259fb | 6207 | Double_t reQ5nQ4nQ3nstarQ3nstarQ3nstar = dReQ4n*pow(dReQ3n,3.)*dReQ5n+3.*pow(dReQ3n,2.)*dReQ5n*dImQ4n*dImQ3n |
6208 | - 3.*dReQ4n*dReQ3n*dReQ5n*pow(dImQ3n,2.)-dReQ5n*dImQ4n*pow(dImQ3n,3.) | |
6209 | - pow(dReQ3n,3.)*dImQ4n*dImQ5n+3.*dReQ4n*pow(dReQ3n,2.)*dImQ3n*dImQ5n | |
6210 | + 3.*dReQ3n*dImQ4n*pow(dImQ3n,2.)*dImQ5n-dReQ4n*pow(dImQ3n,3.)*dImQ5n; | |
e1d101a6 | 6211 | |
6212 | Double_t reQ9nQ3nstarQ3nstarQ3nstar = dReQ9n*pow(dReQ3n,3)-3.*dReQ3n*dReQ9n*pow(dImQ3n,2) | |
6213 | + 3.*dImQ3n*dImQ9n*pow(dReQ3n,2)-dImQ9n*pow(dImQ3n,3); | |
6214 | // <5>_{5n,5n|4n,3n,3n}: | |
c10259fb | 6215 | Double_t reQ5nQ5nQ4nstarQ3nstarQ3nstar = dReQ4n*pow(dReQ3n,2.)*pow(dReQ5n,2.) - 2.*dReQ3n*pow(dReQ5n,2.)*dImQ4n*dImQ3n |
6216 | - dReQ4n*pow(dReQ5n,2.)*pow(dImQ3n,2.) + 2.*pow(dReQ3n,2.)*dReQ5n*dImQ4n*dImQ5n | |
6217 | + 4.*dReQ4n*dReQ3n*dReQ5n*dImQ3n*dImQ5n - 2.*dReQ5n*dImQ4n*pow(dImQ3n,2.)*dImQ5n | |
6218 | - dReQ4n*pow(dReQ3n,2.)*pow(dImQ5n,2.) + 2.*dReQ3n*dImQ4n*dImQ3n*pow(dImQ5n,2.) | |
6219 | + dReQ4n*pow(dImQ3n,2.)*pow(dImQ5n,2.); | |
e1d101a6 | 6220 | |
6221 | // <5>_{5n,5n|4n,4n,2n}: | |
c10259fb | 6222 | Double_t reQ5nQ5nQ4nstarQ4nstarQ2nstar = dReQ2n*pow(dReQ4n,2.)*pow(dReQ5n,2.) - 2.*dReQ4n*pow(dReQ5n,2.)*dImQ2n*dImQ4n |
6223 | - dReQ2n*pow(dReQ5n,2.)*pow(dImQ4n,2.) + 2.*pow(dReQ4n,2.)*dReQ5n*dImQ2n*dImQ5n | |
6224 | + 4.*dReQ2n*dReQ4n*dReQ5n*dImQ4n*dImQ5n - 2.*dReQ5n*dImQ2n*pow(dImQ4n,2.)*dImQ5n | |
6225 | - dReQ2n*pow(dReQ4n,2.)*pow(dImQ5n,2.) + 2.*dReQ4n*dImQ2n*dImQ4n*pow(dImQ5n,2.) | |
6226 | + dReQ2n*pow(dImQ4n,2.)*pow(dImQ5n,2.); | |
e1d101a6 | 6227 | Double_t reQ10nQ4nstarQ4nstarQ2nstar = (dReQ10n*dReQ2n+dImQ10n*dImQ2n)*(pow(dReQ4n,2)-pow(dImQ4n,2)) |
6228 | + 2.*dReQ4n*dImQ4n*(dImQ10n*dReQ2n-dReQ10n*dImQ2n); | |
6229 | // <5>_{6n|3n,1n,1n,1n}: | |
c10259fb | 6230 | Double_t reQ6nQ3nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,3.)*dReQ3n*dReQ6n-3.*dReQ1n*dReQ3n*dReQ6n*pow(dImQ1n,2.) |
6231 | - 3.*pow(dReQ1n,2.)*dReQ6n*dImQ1n*dImQ3n+dReQ6n*pow(dImQ1n,3.)*dImQ3n | |
6232 | + 3.*pow(dReQ1n,2.)*dReQ3n*dImQ1n*dImQ6n-dReQ3n*pow(dImQ1n,3.)*dImQ6n | |
6233 | + pow(dReQ1n,3.)*dImQ3n*dImQ6n-3.*dReQ1n*pow(dImQ1n,2.)*dImQ3n*dImQ6n; | |
e1d101a6 | 6234 | // <5>_{6n,1n,1n|4n,4n}: |
c10259fb | 6235 | Double_t reQ6nQ1nQ1nQ4nstarQ4nstar = pow(dReQ1n,2.)*pow(dReQ4n,2.)*dReQ6n - pow(dReQ4n,2.)*dReQ6n*pow(dImQ1n,2.) |
6236 | + 4.*dReQ1n*dReQ4n*dReQ6n*dImQ1n*dImQ4n - pow(dReQ1n,2.)*dReQ6n*pow(dImQ4n,2.) | |
6237 | + dReQ6n*pow(dImQ1n,2.)*pow(dImQ4n,2.) - 2.*dReQ1n*pow(dReQ4n,2.)*dImQ1n*dImQ6n | |
6238 | + 2.*pow(dReQ1n,2.)*dReQ4n*dImQ4n*dImQ6n - 2.*dReQ4n*pow(dImQ1n,2.)*dImQ4n*dImQ6n | |
6239 | + 2.*dReQ1n*dImQ1n*pow(dImQ4n,2.)*dImQ6n; | |
e1d101a6 | 6240 | |
6241 | ||
6242 | // <5>_{6n,2n,2n|5n,5n}: | |
c10259fb | 6243 | Double_t reQ6nQ2nQ2nQ5nstarQ5nstar = pow(dReQ2n,2.)*pow(dReQ5n,2.)*dReQ6n - pow(dReQ5n,2.)*dReQ6n*pow(dImQ2n,2.) |
6244 | + 4.*dReQ2n*dReQ5n*dReQ6n*dImQ2n*dImQ5n - pow(dReQ2n,2.)*dReQ6n*pow(dImQ5n,2.) | |
6245 | + dReQ6n*pow(dImQ2n,2.)*pow(dImQ5n,2.) - 2.*dReQ2n*pow(dReQ5n,2.)*dImQ2n*dImQ6n | |
6246 | + 2.*pow(dReQ2n,2.)*dReQ5n*dImQ5n*dImQ6n - 2.*dReQ5n*pow(dImQ2n,2.)*dImQ5n*dImQ6n | |
6247 | + 2.*dReQ2n*dImQ2n*pow(dImQ5n,2.)*dImQ6n; | |
e1d101a6 | 6248 | Double_t reQ10nQ6nstarQ2nstarQ2nstar = (dReQ10n*dReQ6n+dImQ10n*dImQ6n)*(pow(dReQ2n,2)-pow(dImQ2n,2)) |
6249 | + 2.*dReQ2n*dImQ2n*(dImQ10n*dReQ6n-dReQ10n*dImQ6n); | |
6250 | // <5>_{6n,6n|5n,5n,2n}: | |
c10259fb | 6251 | Double_t reQ6nQ6nQ5nstarQ5nstarQ2nstar = dReQ2n*pow(dReQ5n,2.)*pow(dReQ6n,2.) - 2.*dReQ5n*pow(dReQ6n,2.)*dImQ2n*dImQ5n |
6252 | - dReQ2n*pow(dReQ6n,2.)*pow(dImQ5n,2.) + 2.*pow(dReQ5n,2.)*dReQ6n*dImQ2n*dImQ6n | |
6253 | + 4.*dReQ2n*dReQ5n*dReQ6n*dImQ5n*dImQ6n - 2.*dReQ6n*dImQ2n*pow(dImQ5n,2.)*dImQ6n | |
6254 | - dReQ2n*pow(dReQ5n,2.)*pow(dImQ6n,2.) + 2.*dReQ5n*dImQ2n*dImQ5n*pow(dImQ6n,2.) | |
6255 | + dReQ2n*pow(dImQ5n,2.)*pow(dImQ6n,2.); | |
e1d101a6 | 6256 | Double_t reQ10nQ2nQ6nstarQ6nstar = dImQ2n*pow(dImQ6n,2.)*dImQ10n+2.*dImQ6n*dImQ10n*dReQ2n*dReQ6n |
6257 | - dImQ2n*dImQ10n*pow(dReQ6n,2.)-pow(dImQ6n,2.)*dReQ2n*dReQ10n | |
6258 | + 2.*dImQ2n*dImQ6n*dReQ6n*dReQ10n+dReQ2n*pow(dReQ6n,2.)*dReQ10n; | |
e1d101a6 | 6259 | Double_t reQ12nQ5nstarQ5nstarQ2nstar = (dReQ12n*dReQ2n+dImQ12n*dImQ2n)*(pow(dReQ5n,2)-pow(dImQ5n,2)) |
6260 | + 2.*dReQ5n*dImQ5n*(dImQ12n*dReQ2n-dReQ12n*dImQ2n); | |
e1d101a6 | 6261 | Double_t reQ12nQ10nstarQ2nstar = dReQ12n*dReQ10n*dReQ2n-dReQ12n*dImQ10n*dImQ2n+dImQ12n*dReQ10n*dImQ2n |
6262 | + dImQ12n*dImQ10n*dReQ2n; | |
e1d101a6 | 6263 | // <5>_{5n,2n|3n,3n,1n}: |
c10259fb | 6264 | Double_t reQ5nQ2nQ3nstarQ3nstarQ1nstar = dReQ1n*dReQ2n*pow(dReQ3n,2.)*dReQ5n + pow(dReQ3n,2.)*dReQ5n*dImQ1n*dImQ2n |
6265 | - 2.*dReQ2n*dReQ3n*dReQ5n*dImQ1n*dImQ3n + 2.*dReQ1n*dReQ3n*dReQ5n*dImQ2n*dImQ3n | |
6266 | - dReQ1n*dReQ2n*dReQ5n*pow(dImQ3n,2.) - dReQ5n*dImQ1n*dImQ2n*pow(dImQ3n,2.) | |
6267 | + dReQ2n*pow(dReQ3n,2.)*dImQ1n*dImQ5n - dReQ1n*pow(dReQ3n,2.)*dImQ2n*dImQ5n | |
6268 | + 2.*dReQ1n*dReQ2n*dReQ3n*dImQ3n*dImQ5n + 2.*dReQ3n*dImQ1n*dImQ2n*dImQ3n*dImQ5n | |
6269 | - dReQ2n*dImQ1n*pow(dImQ3n,2.)*dImQ5n + dReQ1n*dImQ2n*pow(dImQ3n,2.)*dImQ5n; | |
e1d101a6 | 6270 | // <5>_{5n,1n,1n|4n,3n}: |
c10259fb | 6271 | Double_t reQ5nQ1nQ1nQ4nstarQ3nstar = pow(dReQ1n,2.)*dReQ3n*dReQ4n*dReQ5n - dReQ3n*dReQ4n*dReQ5n*pow(dImQ1n,2.) |
6272 | + 2.*dReQ1n*dReQ4n*dReQ5n*dImQ1n*dImQ3n + 2.*dReQ1n*dReQ3n*dReQ5n*dImQ1n*dImQ4n | |
6273 | - pow(dReQ1n,2.)*dReQ5n*dImQ3n*dImQ4n + dReQ5n*pow(dImQ1n,2.)*dImQ3n*dImQ4n | |
6274 | - 2.*dReQ1n*dReQ3n*dReQ4n*dImQ1n*dImQ5n + pow(dReQ1n,2.)*dReQ4n*dImQ3n*dImQ5n | |
6275 | - dReQ4n*pow(dImQ1n,2.)*dImQ3n*dImQ5n + pow(dReQ1n,2.)*dReQ3n*dImQ4n*dImQ5n | |
e1d101a6 | 6276 | - dReQ3n*pow(dImQ1n,2.)*dImQ4n*dImQ5n + 2.*dReQ1n*dImQ1n*dImQ3n*dImQ4n*dImQ5n; |
6277 | // <5>_{5n,3n|4n,2n,2n}: | |
c10259fb | 6278 | Double_t reQ5nQ3nQ4nstarQ2nstarQ2nstar = dReQ4n*dReQ3n*pow(dReQ2n,2.)*dReQ5n + pow(dReQ2n,2.)*dReQ5n*dImQ4n*dImQ3n |
6279 | - 2.*dReQ3n*dReQ2n*dReQ5n*dImQ4n*dImQ2n + 2.*dReQ4n*dReQ2n*dReQ5n*dImQ3n*dImQ2n | |
6280 | - dReQ4n*dReQ3n*dReQ5n*pow(dImQ2n,2.) - dReQ5n*dImQ4n*dImQ3n*pow(dImQ2n,2.) | |
6281 | + dReQ3n*pow(dReQ2n,2.)*dImQ4n*dImQ5n - dReQ4n*pow(dReQ2n,2.)*dImQ3n*dImQ5n | |
6282 | + 2.*dReQ4n*dReQ3n*dReQ2n*dImQ2n*dImQ5n + 2.*dReQ2n*dImQ4n*dImQ3n*dImQ2n*dImQ5n | |
6283 | - dReQ3n*dImQ4n*pow(dImQ2n,2.)*dImQ5n + dReQ4n*dImQ3n*pow(dImQ2n,2.)*dImQ5n; | |
e1d101a6 | 6284 | Double_t reQ8nQ4nstarQ2nstarQ2nstar = (dReQ8n*dReQ4n+dImQ8n*dImQ4n)*(pow(dReQ2n,2)-pow(dImQ2n,2)) |
6285 | + 2.*dReQ2n*dImQ2n*(dImQ8n*dReQ4n-dReQ8n*dImQ4n); | |
6286 | // <5>_{5n,2n,1n|4n,4n}: | |
c10259fb | 6287 | Double_t reQ5nQ2nQ1nQ4nstarQ4nstar = dReQ1n*dReQ2n*pow(dReQ4n,2.)*dReQ5n - pow(dReQ4n,2.)*dReQ5n*dImQ1n*dImQ2n |
6288 | + 2.*dReQ2n*dReQ4n*dReQ5n*dImQ1n*dImQ4n + 2.*dReQ1n*dReQ4n*dReQ5n*dImQ2n*dImQ4n | |
6289 | - dReQ1n*dReQ2n*dReQ5n*pow(dImQ4n,2.) + dReQ5n*dImQ1n*dImQ2n*pow(dImQ4n,2.) | |
6290 | - dReQ2n*pow(dReQ4n,2.)*dImQ1n*dImQ5n - dReQ1n*pow(dReQ4n,2.)*dImQ2n*dImQ5n | |
6291 | + 2.*dReQ1n*dReQ2n*dReQ4n*dImQ4n*dImQ5n - 2.*dReQ4n*dImQ1n*dImQ2n*dImQ4n*dImQ5n | |
6292 | + dReQ2n*dImQ1n*pow(dImQ4n,2.)*dImQ5n + dReQ1n*dImQ2n*pow(dImQ4n,2.)*dImQ5n; | |
e1d101a6 | 6293 | // <5>_{6n,1n|3n,2n,2n}: |
c10259fb | 6294 | Double_t reQ6nQ1nQ3nstarQ2nstarQ2nstar = dReQ3n*dReQ1n*pow(dReQ2n,2.)*dReQ6n + pow(dReQ2n,2.)*dReQ6n*dImQ3n*dImQ1n |
6295 | - 2.*dReQ1n*dReQ2n*dReQ6n*dImQ3n*dImQ2n + 2.*dReQ3n*dReQ2n*dReQ6n*dImQ1n*dImQ2n | |
6296 | - dReQ3n*dReQ1n*dReQ6n*pow(dImQ2n,2.) - dReQ6n*dImQ3n*dImQ1n*pow(dImQ2n,2.) | |
6297 | + dReQ1n*pow(dReQ2n,2.)*dImQ3n*dImQ6n - dReQ3n*pow(dReQ2n,2.)*dImQ1n*dImQ6n | |
6298 | + 2.*dReQ3n*dReQ1n*dReQ2n*dImQ2n*dImQ6n + 2.*dReQ2n*dImQ3n*dImQ1n*dImQ2n*dImQ6n | |
6299 | - dReQ1n*dImQ3n*pow(dImQ2n,2.)*dImQ6n + dReQ3n*dImQ1n*pow(dImQ2n,2.)*dImQ6n; | |
e1d101a6 | 6300 | |
6301 | // <5>_{6n,3n|4n,4n,1n}: | |
c10259fb | 6302 | Double_t reQ6nQ3nQ4nstarQ4nstarQ1nstar = dReQ1n*dReQ3n*pow(dReQ4n,2.)*dReQ6n + pow(dReQ4n,2.)*dReQ6n*dImQ1n*dImQ3n |
6303 | - 2.*dReQ3n*dReQ4n*dReQ6n*dImQ1n*dImQ4n + 2.*dReQ1n*dReQ4n*dReQ6n*dImQ3n*dImQ4n | |
6304 | - dReQ1n*dReQ3n*dReQ6n*pow(dImQ4n,2.) - dReQ6n*dImQ1n*dImQ3n*pow(dImQ4n,2.) | |
6305 | + dReQ3n*pow(dReQ4n,2.)*dImQ1n*dImQ6n - dReQ1n*pow(dReQ4n,2.)*dImQ3n*dImQ6n | |
6306 | + 2.*dReQ1n*dReQ3n*dReQ4n*dImQ4n*dImQ6n + 2.*dReQ4n*dImQ1n*dImQ3n*dImQ4n*dImQ6n | |
6307 | - dReQ3n*dImQ1n*pow(dImQ4n,2.)*dImQ6n + dReQ1n*dImQ3n*pow(dImQ4n,2.)*dImQ6n; | |
e1d101a6 | 6308 | |
6309 | // five6n1n1n5n3n = 0.; // <5>_{6n,1n,1n|5n,3n} = <cos(n(6*phi1+1*phi2+1*phi3-5*phi4-3*phi5))> | |
c10259fb | 6310 | Double_t reQ6nQ1nQ1nQ5nstarQ3nstar = pow(dReQ1n,2.)*dReQ3n*dReQ5n*dReQ6n - dReQ3n*dReQ5n*dReQ6n*pow(dImQ1n,2.) |
6311 | + 2.*dReQ1n*dReQ5n*dReQ6n*dImQ1n*dImQ3n + 2.*dReQ1n*dReQ3n*dReQ6n*dImQ1n*dImQ5n | |
6312 | - pow(dReQ1n,2.)*dReQ6n*dImQ3n*dImQ5n + dReQ6n*pow(dImQ1n,2.)*dImQ3n*dImQ5n | |
6313 | - 2.*dReQ1n*dReQ3n*dReQ5n*dImQ1n*dImQ6n + pow(dReQ1n,2.)*dReQ5n*dImQ3n*dImQ6n | |
6314 | - dReQ5n*pow(dImQ1n,2.)*dImQ3n*dImQ6n + pow(dReQ1n,2.)*dReQ3n*dImQ5n*dImQ6n | |
e1d101a6 | 6315 | - dReQ3n*pow(dImQ1n,2.)*dImQ5n*dImQ6n + 2.*dReQ1n*dImQ1n*dImQ3n*dImQ5n*dImQ6n; |
6316 | ||
6317 | // <5>_{6n,3n|5n,2n,2n}: | |
c10259fb | 6318 | Double_t reQ6nQ3nQ5nstarQ2nstarQ2nstar = dReQ5n*dReQ3n*pow(dReQ2n,2.)*dReQ6n + pow(dReQ2n,2.)*dReQ6n*dImQ5n*dImQ3n |
6319 | - 2.*dReQ3n*dReQ2n*dReQ6n*dImQ5n*dImQ2n + 2.*dReQ5n*dReQ2n*dReQ6n*dImQ3n*dImQ2n | |
6320 | - dReQ5n*dReQ3n*dReQ6n*pow(dImQ2n,2.) - dReQ6n*dImQ5n*dImQ3n*pow(dImQ2n,2.) | |
6321 | + dReQ3n*pow(dReQ2n,2.)*dImQ5n*dImQ6n - dReQ5n*pow(dReQ2n,2.)*dImQ3n*dImQ6n | |
6322 | + 2.*dReQ5n*dReQ3n*dReQ2n*dImQ2n*dImQ6n + 2.*dReQ2n*dImQ5n*dImQ3n*dImQ2n*dImQ6n | |
6323 | - dReQ3n*dImQ5n*pow(dImQ2n,2.)*dImQ6n + dReQ5n*dImQ3n*pow(dImQ2n,2.)*dImQ6n; | |
e1d101a6 | 6324 | |
6325 | // <5>_{6n,5n|4n,4n,3n}: | |
c10259fb | 6326 | Double_t reQ6nQ5nQ4nstarQ4nstarQ3nstar = dReQ3n*dReQ5n*pow(dReQ4n,2.)*dReQ6n + pow(dReQ4n,2.)*dReQ6n*dImQ3n*dImQ5n |
6327 | - 2.*dReQ5n*dReQ4n*dReQ6n*dImQ3n*dImQ4n + 2.*dReQ3n*dReQ4n*dReQ6n*dImQ5n*dImQ4n | |
6328 | - dReQ3n*dReQ5n*dReQ6n*pow(dImQ4n,2.) - dReQ6n*dImQ3n*dImQ5n*pow(dImQ4n,2.) | |
6329 | + dReQ5n*pow(dReQ4n,2.)*dImQ3n*dImQ6n - dReQ3n*pow(dReQ4n,2.)*dImQ5n*dImQ6n | |
6330 | + 2.*dReQ3n*dReQ5n*dReQ4n*dImQ4n*dImQ6n + 2.*dReQ4n*dImQ3n*dImQ5n*dImQ4n*dImQ6n | |
6331 | - dReQ5n*dImQ3n*pow(dImQ4n,2.)*dImQ6n + dReQ3n*dImQ5n*pow(dImQ4n,2.)*dImQ6n; | |
e1d101a6 | 6332 | Double_t reQ11nQ4nstarQ4nstarQ3nstar = (dReQ11n*dReQ3n+dImQ11n*dImQ3n)*(pow(dReQ4n,2)-pow(dImQ4n,2)) |
6333 | + 2.*dReQ4n*dImQ4n*(dImQ11n*dReQ3n-dReQ11n*dImQ3n); | |
6334 | ||
c10259fb | 6335 | // <5>_{6n,3n,1n|5n,5n}: |
6336 | Double_t reQ6nQ3nQ1nQ5nstarQ5nstar = dReQ1n*dReQ3n*pow(dReQ5n,2.)*dReQ6n - pow(dReQ5n,2.)*dReQ6n*dImQ1n*dImQ3n | |
6337 | + 2.*dReQ3n*dReQ5n*dReQ6n*dImQ1n*dImQ5n + 2.*dReQ1n*dReQ5n*dReQ6n*dImQ3n*dImQ5n | |
6338 | - dReQ1n*dReQ3n*dReQ6n*pow(dImQ5n,2.) + dReQ6n*dImQ1n*dImQ3n*pow(dImQ5n,2.) | |
6339 | - dReQ3n*pow(dReQ5n,2.)*dImQ1n*dImQ6n - dReQ1n*pow(dReQ5n,2.)*dImQ3n*dImQ6n | |
6340 | + 2.*dReQ1n*dReQ3n*dReQ5n*dImQ5n*dImQ6n - 2.*dReQ5n*dImQ1n*dImQ3n*dImQ5n*dImQ6n | |
6341 | + dReQ3n*dImQ1n*pow(dImQ5n,2.)*dImQ6n + dReQ1n*dImQ3n*pow(dImQ5n,2.)*dImQ6n; | |
e1d101a6 | 6342 | |
6343 | // <5>_{6n,6n|5n,4n,3n}: | |
c10259fb | 6344 | Double_t reQ6nQ6nQ5nstarQ4nstarQ3nstar = dReQ3n*dReQ4n*dReQ5n*pow(dReQ6n,2.) - dReQ5n*pow(dReQ6n,2.)*dImQ3n*dImQ4n |
6345 | - dReQ4n*pow(dReQ6n,2.)*dImQ3n*dImQ5n - dReQ3n*pow(dReQ6n,2.)*dImQ4n*dImQ5n | |
6346 | + 2.*dReQ4n*dReQ5n*dReQ6n*dImQ3n*dImQ6n + 2.*dReQ3n*dReQ5n*dReQ6n*dImQ4n*dImQ6n | |
6347 | + 2.*dReQ3n*dReQ4n*dReQ6n*dImQ5n*dImQ6n - 2.*dReQ6n*dImQ3n*dImQ4n*dImQ5n*dImQ6n | |
6348 | - dReQ3n*dReQ4n*dReQ5n*pow(dImQ6n,2.) + dReQ5n*dImQ3n*dImQ4n*pow(dImQ6n,2.) | |
6349 | + dReQ4n*dImQ3n*dImQ5n*pow(dImQ6n,2.) + dReQ3n*dImQ4n*dImQ5n*pow(dImQ6n,2.); | |
e1d101a6 | 6350 | |
6351 | ||
6352 | Double_t reQ8nQ4nQ6nstarQ6nstar = dImQ4n*pow(dImQ6n,2.)*dImQ8n+2.*dImQ6n*dImQ8n*dReQ4n*dReQ6n | |
6353 | - dImQ4n*dImQ8n*pow(dReQ6n,2.)-pow(dImQ6n,2.)*dReQ4n*dReQ8n | |
6354 | + 2.*dImQ4n*dImQ6n*dReQ6n*dReQ8n+dReQ4n*pow(dReQ6n,2.)*dReQ8n; | |
6355 | ||
6356 | ||
6357 | Double_t reQ9nQ3nQ6nstarQ6nstar = dImQ3n*pow(dImQ6n,2.)*dImQ9n+2.*dImQ6n*dImQ9n*dReQ3n*dReQ6n | |
6358 | - dImQ3n*dImQ9n*pow(dReQ6n,2.)-pow(dImQ6n,2.)*dReQ3n*dReQ9n | |
6359 | + 2.*dImQ3n*dImQ6n*dReQ6n*dReQ9n+dReQ3n*pow(dReQ6n,2.)*dReQ9n; | |
6360 | ||
6361 | ||
c10259fb | 6362 | Double_t reQ12nQ5nstarQ4nstarQ3nstar = dReQ3n*dReQ5n*dReQ4n*dReQ12n-dReQ4n*dReQ12n*dImQ3n*dImQ5n |
6363 | - dReQ5n*dReQ12n*dImQ3n*dImQ4n-dReQ3n*dReQ12n*dImQ5n*dImQ4n | |
6364 | + dReQ5n*dReQ4n*dImQ3n*dImQ12n+dReQ3n*dReQ4n*dImQ5n*dImQ12n | |
6365 | + dReQ3n*dReQ5n*dImQ4n*dImQ12n-dImQ3n*dImQ5n*dImQ4n*dImQ12n; | |
e1d101a6 | 6366 | Double_t reQ12nQ9nstarQ3nstar = dReQ12n*dReQ9n*dReQ3n-dReQ12n*dImQ9n*dImQ3n+dImQ12n*dReQ9n*dImQ3n |
6367 | + dImQ12n*dImQ9n*dReQ3n; | |
e1d101a6 | 6368 | Double_t reQ12nQ8nstarQ4nstar = dReQ12n*dReQ8n*dReQ4n-dReQ12n*dImQ8n*dImQ4n+dImQ12n*dReQ8n*dImQ4n |
6369 | + dImQ12n*dImQ8n*dReQ4n; | |
6370 | ||
6371 | ||
6372 | five4n3n3n2n2n = ((pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6373 | * (pow(dReQ2n,2.)*dReQ4n-pow(dImQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n) | |
6374 | - ((dReQ7n*dReQ3n+dImQ7n*dImQ3n)*(pow(dReQ2n,2.)-pow(dImQ2n,2.)) | |
6375 | + 2.*dReQ2n*dImQ2n*(dImQ7n*dReQ3n-dReQ7n*dImQ3n)) | |
6376 | - ((pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n) | |
6377 | + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
6378 | - 2.*(dImQ1n*dImQ2n*dImQ3n*dImQ4n+dImQ3n*dImQ4n*dReQ1n*dReQ2n | |
6379 | + dImQ2n*dImQ4n*dReQ1n*dReQ3n-dImQ1n*dImQ4n*dReQ2n*dReQ3n | |
6380 | - dImQ2n*dImQ3n*dReQ1n*dReQ4n+dImQ1n*dImQ3n*dReQ2n*dReQ4n | |
6381 | + dImQ1n*dImQ2n*dReQ3n*dReQ4n+dReQ1n*dReQ2n*dReQ3n*dReQ4n) | |
6382 | - 2.*(dImQ2n*dImQ3n*dImQ4n*dImQ5n+dImQ4n*dImQ5n*dReQ2n*dReQ3n | |
6383 | + dImQ3n*dImQ5n*dReQ2n*dReQ4n-dImQ2n*dImQ5n*dReQ3n*dReQ4n | |
6384 | - dImQ3n*dImQ4n*dReQ2n*dReQ5n+dImQ2n*dImQ4n*dReQ3n*dReQ5n | |
6385 | + dImQ2n*dImQ3n*dReQ4n*dReQ5n+dReQ2n*dReQ3n*dReQ4n*dReQ5n) | |
6386 | + 2.*(pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
6387 | + 1.*(dReQ7n*dReQ4n*dReQ3n-dReQ7n*dImQ4n*dImQ3n+dImQ7n*dReQ4n*dImQ3n+dImQ7n*dImQ4n*dReQ3n) | |
6388 | + 3.*(dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
6389 | + 2.*(dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n+dImQ5n*dImQ4n*dReQ1n) | |
6390 | + 2.*(dReQ7n*dReQ5n*dReQ2n-dReQ7n*dImQ5n*dImQ2n+dImQ7n*dReQ5n*dImQ2n+dImQ7n*dImQ5n*dReQ2n) | |
6391 | + 2.*(dReQ7n*dReQ4n*dReQ3n-dReQ7n*dImQ4n*dImQ3n+dImQ7n*dReQ4n*dImQ3n+dImQ7n*dImQ4n*dReQ3n) | |
6392 | + 6.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
6393 | + 6.*(dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n+dImQ5n*dImQ2n*dReQ3n) | |
6394 | - (dMult-6.)*(pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
6395 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6396 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6397 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
6398 | - 4.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6399 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6400 | - 4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6401 | + (dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6402 | + 2.*(dMult-8.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6403 | + 2.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6404 | - 2.*dMult*(dMult-12.)) | |
6405 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
6406 | five4n2n4n1n1n = ((pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6407 | * (pow(dReQ1n,2.)*dReQ2n-pow(dImQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n) | |
6408 | - reQ6nQ4nstarQ1nstarQ1nstar | |
6409 | - reQ4nQ2nstarQ1nstarQ1nstar | |
6410 | - 2.*reQ4nQ1nQ3nstarQ2nstar | |
6411 | - 2.*reQ5nQ1nQ4nstarQ2nstar | |
6412 | + 2.*reQ3nQ2nstarQ1nstar | |
6413 | + reQ6nQ4nstarQ2nstar | |
6414 | + 3.*reQ4nQ2nstarQ2nstar | |
6415 | + 2.*reQ5nQ3nstarQ2nstar | |
6416 | + 2.*reQ6nQ5nstarQ1nstar | |
6417 | + 2.*reQ6nQ4nstarQ2nstar | |
6418 | + 6.*reQ4nQ3nstarQ1nstar | |
6419 | + 6.*reQ5nQ4nstarQ1nstar | |
6420 | - (dMult-6.)*(pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
6421 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6422 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6423 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-4.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6424 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6425 | + (dMult-8.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6426 | + 2.*(dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6427 | + 2.*(dMult-6.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*dMult*(dMult-12.)) | |
6428 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
6429 | // to be polished: | |
6430 | five4n3n4n2n1n = (reQ4nQ3nQ4nstarQ2nstarQ1nstar | |
6431 | - reQ5nQ2nQ4nstarQ3nstar | |
6432 | - reQ6nQ1nQ4nstarQ3nstar | |
6433 | - reQ4nQ1nQ3nstarQ2nstar | |
6434 | - reQ7nQ4nstarQ2nstarQ1nstar | |
6435 | - reQ4nQ2nstarQ1nstarQ1nstar | |
6436 | - reQ4nQ2nQ3nstarQ3nstar | |
6437 | + reQ4nQ3nstarQ1nstar | |
6438 | + reQ7nQ4nstarQ3nstar | |
6439 | + 3.*reQ4nQ3nstarQ1nstar | |
6440 | + 2.*reQ7nQ4nstarQ3nstar | |
6441 | + reQ5nQ3nstarQ2nstar | |
6442 | + reQ7nQ5nstarQ2nstar | |
6443 | + reQ6nQ3nstarQ3nstar | |
6444 | + reQ4nQ3nstarQ1nstar | |
6445 | + reQ7nQ6nstarQ1nstar | |
6446 | + reQ2nQ1nstarQ1nstar | |
6447 | - (dMult-6.)*reQ3nQ2nstarQ1nstar | |
6448 | + 3.*reQ5nQ4nstarQ1nstar | |
6449 | + reQ4nQ3nstarQ1nstar | |
6450 | + 2.*reQ4nQ2nstarQ2nstar | |
6451 | + 3.*reQ6nQ4nstarQ2nstar | |
6452 | + reQ3nQ2nstarQ1nstar | |
6453 | + reQ4nQ2nstarQ2nstar | |
6454 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6455 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6456 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6457 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
6458 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6459 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6460 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6461 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
6462 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6463 | + (dMult-8.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6464 | + (dMult-8.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6465 | + (dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6466 | + 2.*(dMult-6.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*dMult*(dMult-12.)) | |
6467 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
6468 | five5n1n3n2n1n = ((pow(dImQ1n,2.)+pow(dReQ1n,2.))*(dImQ3n*dImQ5n*dReQ2n+dImQ2n*dImQ5n*dReQ3n | |
6469 | - dImQ2n*dImQ3n*dReQ5n+dReQ2n*dReQ3n*dReQ5n) | |
6470 | - (dReQ1n*dReQ2n*dReQ3n*dReQ6n-dReQ3n*dReQ6n*dImQ1n*dImQ2n | |
6471 | - dReQ2n*dReQ6n*dImQ1n*dImQ3n-dReQ1n*dReQ6n*dImQ2n*dImQ3n | |
6472 | + dReQ2n*dReQ3n*dImQ1n*dImQ6n+dReQ1n*dReQ3n*dImQ2n*dImQ6n | |
6473 | + dReQ1n*dReQ2n*dImQ3n*dImQ6n-dImQ1n*dImQ2n*dImQ3n*dImQ6n) | |
6474 | - (dImQ1n*dImQ2n*dImQ4n*dImQ5n+dImQ4n*dImQ5n*dReQ1n*dReQ2n | |
6475 | + dImQ2n*dImQ5n*dReQ1n*dReQ4n-dImQ1n*dImQ5n*dReQ2n*dReQ4n | |
6476 | - dImQ2n*dImQ4n*dReQ1n*dReQ5n+dImQ1n*dImQ4n*dReQ2n*dReQ5n | |
6477 | + dImQ1n*dImQ2n*dReQ4n*dReQ5n+dReQ1n*dReQ2n*dReQ4n*dReQ5n) | |
6478 | - (dImQ1n*pow(dImQ3n,2.)*dImQ5n+2.*dImQ3n*dImQ5n*dReQ1n*dReQ3n | |
6479 | - dImQ1n*dImQ5n*pow(dReQ3n,2.)-pow(dImQ3n,2.)*dReQ1n*dReQ5n | |
6480 | + 2.*dImQ1n*dImQ3n*dReQ3n*dReQ5n+dReQ1n*pow(dReQ3n,2.)*dReQ5n) | |
6481 | - (dImQ1n*dImQ2n*dImQ3n*dImQ4n+dImQ3n*dImQ4n*dReQ1n*dReQ2n | |
6482 | + dImQ2n*dImQ4n*dReQ1n*dReQ3n-dImQ1n*dImQ4n*dReQ2n*dReQ3n | |
6483 | - dImQ2n*dImQ3n*dReQ1n*dReQ4n+dImQ1n*dImQ3n*dReQ2n*dReQ4n | |
6484 | + dImQ1n*dImQ2n*dReQ3n*dReQ4n+dReQ1n*dReQ2n*dReQ3n*dReQ4n) | |
6485 | - (-pow(dImQ1n,2.)*dImQ3n*dImQ5n+dImQ3n*dImQ5n*pow(dReQ1n,2.) | |
6486 | + 2.*dImQ1n*dImQ5n*dReQ1n*dReQ3n-2.*dImQ1n*dImQ3n*dReQ1n*dReQ5n | |
6487 | - pow(dImQ1n,2.)*dReQ3n*dReQ5n+pow(dReQ1n,2.)*dReQ3n*dReQ5n) | |
6488 | - (-pow(dImQ2n,2.)*dImQ1n*dImQ5n+dImQ1n*dImQ5n*pow(dReQ2n,2.) | |
6489 | + 2.*dImQ2n*dImQ5n*dReQ2n*dReQ1n-2.*dImQ2n*dImQ1n*dReQ2n*dReQ5n | |
6490 | - pow(dImQ2n,2.)*dReQ1n*dReQ5n+pow(dReQ2n,2.)*dReQ1n*dReQ5n) | |
6491 | + 3.*(dReQ6n*dReQ5n*dReQ1n-dReQ6n*dImQ5n*dImQ1n+dImQ6n*dReQ5n*dImQ1n+dImQ6n*dImQ5n*dReQ1n) | |
6492 | + dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n | |
6493 | + pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n | |
6494 | + 4.*(dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n+dImQ5n*dImQ4n*dReQ1n) | |
6495 | - (dMult-7.)*(dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n+dImQ5n*dImQ2n*dReQ3n) | |
6496 | + 4.*(dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
6497 | + pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n | |
6498 | + 6.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
6499 | + 3.*(pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
6500 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6501 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6502 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6503 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))+(dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6504 | - 4.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+(dMult-10.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6505 | + (dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*(dMult-7.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6506 | - 2.*dMult*(dMult-12.)) | |
6507 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
6508 | // to be polished: | |
6509 | five5n2n5n1n1n = ((pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6510 | * (pow(dReQ1n,2.)*dReQ2n-pow(dImQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n) | |
6511 | - reQ7nQ5nstarQ1nstarQ1nstar | |
6512 | - reQ5nQ3nstarQ1nstarQ1nstar | |
6513 | - 2.*reQ5nQ1nQ4nstarQ2nstar | |
6514 | - 2.*reQ6nQ1nQ5nstarQ2nstar | |
6515 | + 2.*reQ4nQ3nstarQ1nstar | |
6516 | + reQ7nQ5nstarQ2nstar | |
6517 | + 3.*reQ5nQ3nstarQ2nstar | |
6518 | + 2.*reQ6nQ4nstarQ2nstar | |
6519 | + 2.*reQ7nQ6nstarQ1nstar | |
6520 | + 2.*reQ7nQ5nstarQ2nstar | |
6521 | + 6.*reQ5nQ4nstarQ1nstar | |
6522 | + 6.*reQ6nQ5nstarQ1nstar | |
6523 | - (dMult-6.)*(pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
6524 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6525 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6526 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.))-4.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
6527 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))-4.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6528 | + (dMult-8.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6529 | + 2.*(dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6530 | + 2.*(dMult-6.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.))-2.*dMult*(dMult-12.)) | |
6531 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
6532 | // to be polished: | |
6533 | five5n2n4n2n1n = (reQ5nQ2nQ4nstarQ2nstarQ1nstar | |
6534 | - reQ5nQ2nQ4nstarQ3nstar | |
6535 | - reQ6nQ1nQ5nstarQ2nstar | |
6536 | - reQ5nQ2nstarQ2nstarQ1nstar | |
6537 | - reQ7nQ4nstarQ2nstarQ1nstar | |
6538 | - reQ4nQ1nQ3nstarQ2nstar | |
6539 | - reQ5nQ1nQ4nstarQ2nstar | |
6540 | + reQ2nQ1nstarQ1nstar | |
6541 | + reQ7nQ5nstarQ2nstar | |
6542 | + 3.*reQ5nQ3nstarQ2nstar | |
6543 | + 2.*reQ7nQ5nstarQ2nstar | |
6544 | + reQ5nQ3nstarQ2nstar | |
6545 | + reQ7nQ4nstarQ3nstar | |
6546 | + reQ6nQ5nstarQ1nstar | |
6547 | + reQ2nQ1nstarQ1nstar | |
6548 | + reQ7nQ6nstarQ1nstar | |
6549 | + reQ3nQ2nstarQ1nstar | |
6550 | - (dMult-6.)*reQ5nQ4nstarQ1nstar | |
6551 | + 3.*reQ3nQ2nstarQ1nstar | |
6552 | + reQ2nQ1nstarQ1nstar | |
6553 | + 2.*reQ4nQ2nstarQ2nstar | |
6554 | + 3.*reQ6nQ4nstarQ2nstar | |
6555 | + reQ4nQ3nstarQ1nstar | |
6556 | + reQ4nQ2nstarQ2nstar | |
6557 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6558 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6559 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6560 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
6561 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6562 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6563 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6564 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
6565 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6566 | + (dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6567 | + (dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6568 | + (dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6569 | + 2.*(dMult-6.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-2.*dMult*(dMult-12.)) | |
6570 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
6571 | // to be polished: | |
6572 | five5n3n4n3n1n = (reQ5nQ3nQ4nstarQ3nstarQ1nstar | |
6573 | - reQ5nQ3nQ4nstarQ4nstar | |
6574 | - reQ7nQ1nQ5nstarQ3nstar | |
6575 | - reQ5nQ3nstarQ1nstarQ1nstar | |
6576 | - reQ8nQ4nstarQ3nstarQ1nstar | |
6577 | - reQ4nQ1nQ3nstarQ2nstar | |
6578 | - reQ5nQ2nQ4nstarQ3nstar | |
6579 | + reQ3nQ2nstarQ1nstar | |
6580 | + reQ8nQ5nstarQ3nstar | |
6581 | + 3.*reQ5nQ3nstarQ2nstar | |
6582 | + 2.*reQ8nQ5nstarQ3nstar | |
6583 | + reQ5nQ4nstarQ1nstar | |
6584 | + reQ8nQ4nstarQ4nstar | |
6585 | + reQ7nQ5nstarQ2nstar | |
6586 | + reQ3nQ2nstarQ1nstar | |
6587 | + reQ8nQ7nstarQ1nstar | |
6588 | + reQ2nQ1nstarQ1nstar | |
6589 | - (dMult-6.)*reQ5nQ4nstarQ1nstar | |
6590 | + 3.*reQ4nQ3nstarQ1nstar | |
6591 | + reQ3nQ2nstarQ1nstar | |
6592 | + 2.*reQ4nQ3nstarQ1nstar | |
6593 | + 3.*reQ7nQ4nstarQ3nstar | |
6594 | + reQ4nQ2nstarQ2nstar | |
6595 | + reQ4nQ3nstarQ1nstar | |
6596 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6597 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6598 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6599 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)) | |
6600 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6601 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6602 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6603 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
6604 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6605 | + (dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6606 | + (dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6607 | + (dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6608 | + 2.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))-2.*dMult*(dMult-12.)) | |
6609 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
6610 | // to be polished: | |
6611 | five5n4n4n3n2n = (reQ5nQ4nQ4nstarQ3nstarQ2nstar | |
6612 | - reQ6nQ3nQ5nstarQ4nstar | |
6613 | - reQ7nQ2nQ5nstarQ4nstar | |
6614 | - reQ5nQ1nQ4nstarQ2nstar | |
6615 | - reQ9nQ4nstarQ3nstarQ2nstar | |
6616 | - reQ4nQ1nQ3nstarQ2nstar | |
6617 | - reQ5nQ2nQ4nstarQ3nstar | |
6618 | + reQ4nQ2nstarQ2nstar | |
6619 | + reQ9nQ5nstarQ4nstar | |
6620 | + 3.*reQ5nQ4nstarQ1nstar | |
6621 | + 2.*reQ9nQ5nstarQ4nstar | |
6622 | + reQ6nQ5nstarQ1nstar | |
6623 | + reQ9nQ6nstarQ3nstar | |
6624 | + reQ7nQ5nstarQ2nstar | |
6625 | + reQ4nQ2nstarQ2nstar | |
6626 | + reQ9nQ7nstarQ2nstar | |
6627 | + reQ2nQ1nstarQ1nstar | |
6628 | - (dMult-6.)*reQ5nQ3nstarQ2nstar | |
6629 | + 3.*reQ6nQ4nstarQ2nstar | |
6630 | + reQ4nQ2nstarQ2nstar | |
6631 | + 2.*reQ4nQ3nstarQ1nstar | |
6632 | + 3.*reQ7nQ4nstarQ3nstar | |
6633 | + reQ3nQ2nstarQ1nstar | |
6634 | + reQ4nQ3nstarQ1nstar | |
6635 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6636 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6637 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6638 | - 2.*(pow(dReQ9n,2.)+pow(dImQ9n,2.)) | |
6639 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6640 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
6641 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6642 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
6643 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6644 | + (dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6645 | + (dMult-8.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6646 | + (dMult-8.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6647 | + 2.*(dMult-6.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*dMult*(dMult-12.)) | |
6648 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
6649 | // to be polished: | |
6650 | five5n3n5n2n1n = (reQ5nQ3nQ5nstarQ2nstarQ1nstar | |
6651 | - reQ6nQ2nQ5nstarQ3nstar | |
6652 | - reQ7nQ1nQ5nstarQ3nstar | |
6653 | - reQ5nQ1nQ3nstarQ3nstar | |
6654 | - reQ8nQ5nstarQ2nstarQ1nstar | |
6655 | - reQ5nQ2nstarQ2nstarQ1nstar | |
6656 | - reQ5nQ2nQ4nstarQ3nstar | |
6657 | + reQ5nQ4nstarQ1nstar | |
6658 | + reQ8nQ5nstarQ3nstar | |
6659 | + 3.*reQ5nQ3nstarQ2nstar | |
6660 | + 2.*reQ8nQ5nstarQ3nstar | |
6661 | + reQ6nQ3nstarQ3nstar | |
6662 | + reQ8nQ6nstarQ2nstar | |
6663 | + reQ7nQ4nstarQ3nstar | |
6664 | + reQ5nQ4nstarQ1nstar | |
6665 | + reQ8nQ7nstarQ1nstar | |
6666 | + reQ3nQ2nstarQ1nstar | |
6667 | - (dMult-6.)*reQ3nQ2nstarQ1nstar | |
6668 | + 3.*reQ6nQ5nstarQ1nstar | |
6669 | + reQ5nQ4nstarQ1nstar | |
6670 | + 2.*reQ5nQ3nstarQ2nstar | |
6671 | + 3.*reQ7nQ5nstarQ2nstar | |
6672 | + reQ4nQ2nstarQ2nstar | |
6673 | + reQ5nQ3nstarQ2nstar | |
6674 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6675 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6676 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6677 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)) | |
6678 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6679 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
6680 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6681 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
6682 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6683 | + (dMult-8.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6684 | + (dMult-8.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6685 | + (dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6686 | + 2.*(dMult-6.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.))-2.*dMult*(dMult-12.)) | |
6687 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
6688 | // to be polished: | |
6689 | five5n4n5n2n2n = ((pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6690 | * (pow(dReQ2n,2.)*dReQ4n-pow(dImQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n) | |
6691 | - reQ9nQ5nstarQ2nstarQ2nstar | |
6692 | - reQ5nQ2nstarQ2nstarQ1nstar | |
6693 | - 2.*reQ5nQ2nQ4nstarQ3nstar | |
6694 | - 2.*reQ7nQ2nQ5nstarQ4nstar | |
6695 | + 2.*reQ3nQ2nstarQ1nstar | |
6696 | + reQ9nQ5nstarQ4nstar | |
6697 | + 3.*reQ5nQ4nstarQ1nstar | |
6698 | + 2.*reQ7nQ4nstarQ3nstar | |
6699 | + 2.*reQ9nQ7nstarQ2nstar | |
6700 | + 2.*reQ9nQ5nstarQ4nstar | |
6701 | + 6.*reQ5nQ3nstarQ2nstar | |
6702 | + 6.*reQ7nQ5nstarQ2nstar | |
6703 | - (dMult-6.)*(pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
6704 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6705 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6706 | - 2.*(pow(dReQ9n,2.)+pow(dImQ9n,2.))-4.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
6707 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6708 | + (dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6709 | + 2.*(dMult-8.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6710 | + 2.*(dMult-6.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.))-2.*dMult*(dMult-12.)) | |
6711 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
6712 | // to be polished: | |
6713 | five5n4n5n3n1n = (reQ5nQ4nQ5nstarQ3nstarQ1nstar | |
6714 | - reQ6nQ3nQ5nstarQ4nstar | |
6715 | - reQ8nQ1nQ5nstarQ4nstar | |
6716 | - reQ5nQ1nQ4nstarQ2nstar | |
6717 | - reQ9nQ5nstarQ3nstarQ1nstar | |
6718 | - reQ5nQ3nstarQ1nstarQ1nstar | |
6719 | - reQ5nQ3nQ4nstarQ4nstar | |
6720 | + reQ5nQ4nstarQ1nstar | |
6721 | + reQ9nQ5nstarQ4nstar | |
6722 | + 3.*reQ5nQ4nstarQ1nstar | |
6723 | + 2.*reQ9nQ5nstarQ4nstar | |
6724 | + reQ6nQ4nstarQ2nstar | |
6725 | + reQ9nQ6nstarQ3nstar | |
6726 | + reQ8nQ4nstarQ4nstar | |
6727 | + reQ5nQ4nstarQ1nstar | |
6728 | + reQ9nQ8nstarQ1nstar | |
6729 | + reQ2nQ1nstarQ1nstar | |
6730 | - (dMult-6.)*reQ4nQ3nstarQ1nstar | |
6731 | + 3.*reQ6nQ5nstarQ1nstar | |
6732 | + reQ5nQ4nstarQ1nstar | |
6733 | + 2.*reQ5nQ3nstarQ2nstar | |
6734 | + 3.*reQ8nQ5nstarQ3nstar | |
6735 | + reQ4nQ3nstarQ1nstar | |
6736 | + reQ5nQ3nstarQ2nstar | |
6737 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6738 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6739 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6740 | - 2.*(pow(dReQ9n,2.)+pow(dImQ9n,2.)) | |
6741 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6742 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
6743 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6744 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)) | |
6745 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6746 | + (dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6747 | + (dMult-8.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6748 | + (dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6749 | + 2.*(dMult-6.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.))-2.*dMult*(dMult-12.)) | |
6750 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
6751 | five6n1n3n3n1n = ((pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6752 | * (pow(dReQ3n,2.)*dReQ6n-pow(dImQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n) | |
6753 | - 2.*(dImQ1n*dImQ3n*dImQ4n*dImQ6n+dImQ4n*dImQ6n*dReQ1n*dReQ3n | |
6754 | + dImQ3n*dImQ6n*dReQ1n*dReQ4n-dImQ1n*dImQ6n*dReQ3n*dReQ4n | |
6755 | - dImQ3n*dImQ4n*dReQ1n*dReQ6n+dImQ1n*dImQ4n*dReQ3n*dReQ6n | |
6756 | + dImQ1n*dImQ3n*dReQ4n*dReQ6n+dReQ1n*dReQ3n*dReQ4n*dReQ6n) | |
6757 | - 2.*(dReQ1n*dReQ2n*dReQ3n*dReQ6n-dReQ3n*dReQ6n*dImQ1n*dImQ2n | |
6758 | - dReQ2n*dReQ6n*dImQ1n*dImQ3n-dReQ1n*dReQ6n*dImQ2n*dImQ3n | |
6759 | + dReQ2n*dReQ3n*dImQ1n*dImQ6n+dReQ1n*dReQ3n*dImQ2n*dImQ6n | |
6760 | + dReQ1n*dReQ2n*dImQ3n*dImQ6n-dImQ1n*dImQ2n*dImQ3n*dImQ6n) | |
6761 | - (-pow(dImQ3n,2.)*dImQ1n*dImQ7n+dImQ1n*dImQ7n*pow(dReQ3n,2.) | |
6762 | + 2.*dImQ3n*dImQ7n*dReQ3n*dReQ1n-2.*dImQ3n*dImQ1n*dReQ3n*dReQ7n | |
6763 | - pow(dImQ3n,2.)*dReQ1n*dReQ7n+pow(dReQ3n,2.)*dReQ1n*dReQ7n) | |
6764 | - ((pow(dReQ3n,2.)-pow(dImQ3n,2.))*(dReQ5n*dReQ1n-dImQ5n*dImQ1n) | |
6765 | + 2.*dReQ3n*dImQ3n*(dReQ5n*dImQ1n+dImQ5n*dReQ1n)) | |
6766 | + 2.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
6767 | + (dReQ7n*dReQ6n*dReQ1n-dReQ7n*dImQ6n*dImQ1n+dImQ7n*dReQ6n*dImQ1n+dImQ7n*dImQ6n*dReQ1n) | |
6768 | + 2.*(dReQ7n*dReQ3n*dReQ4n-dReQ7n*dImQ3n*dImQ4n+dImQ7n*dReQ3n*dImQ4n+dImQ7n*dImQ3n*dReQ4n) | |
6769 | + 2.*(dReQ6n*(dReQ4n*dReQ2n-dImQ4n*dImQ2n)+dImQ6n*(dReQ4n*dImQ2n+dImQ4n*dReQ2n)) | |
6770 | + 3.*(dReQ6n*(dReQ5n*dReQ1n-dImQ5n*dImQ1n)+dImQ6n*(dReQ5n*dImQ1n+dImQ5n*dReQ1n)) | |
6771 | + 4.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
6772 | + 2.*(dReQ7n*dReQ6n*dReQ1n-dReQ7n*dImQ6n*dImQ1n+dImQ7n*dReQ6n*dImQ1n+dImQ7n*dImQ6n*dReQ1n) | |
6773 | + 6.*(dReQ4n*dReQ3n*dReQ1n-dReQ4n*dImQ3n*dImQ1n+dImQ4n*dReQ3n*dImQ1n+dImQ4n*dImQ3n*dReQ1n) | |
6774 | + 2.*(dReQ5n*dReQ3n*dReQ2n-dReQ5n*dImQ3n*dImQ2n+dImQ5n*dReQ3n*dImQ2n+dImQ5n*dImQ3n*dReQ2n) | |
6775 | - (dMult-6.)*(pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n) | |
6776 | - 4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
6777 | - 4.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6778 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6779 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6780 | + 2.*(dMult-6.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6781 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))+(dMult-8.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
6782 | + 2.*(dMult-8.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))-2.*dMult*(dMult-12.)) | |
6783 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
6784 | five6n2n3n3n2n = ((pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6785 | * (pow(dReQ3n,2.)*dReQ6n-pow(dImQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n) | |
6786 | - 2.*(dImQ2n*dImQ3n*dImQ5n*dImQ6n+dImQ5n*dImQ6n*dReQ2n*dReQ3n | |
6787 | + dImQ3n*dImQ6n*dReQ2n*dReQ5n-dImQ2n*dImQ6n*dReQ3n*dReQ5n | |
6788 | - dImQ3n*dImQ5n*dReQ2n*dReQ6n+dImQ2n*dImQ5n*dReQ3n*dReQ6n | |
6789 | + dImQ2n*dImQ3n*dReQ5n*dReQ6n+dReQ2n*dReQ3n*dReQ5n*dReQ6n) | |
6790 | - 2.*(dReQ1n*dReQ2n*dReQ3n*dReQ6n-dReQ3n*dReQ6n*dImQ1n*dImQ2n | |
6791 | - dReQ2n*dReQ6n*dImQ1n*dImQ3n-dReQ1n*dReQ6n*dImQ2n*dImQ3n | |
6792 | + dReQ2n*dReQ3n*dImQ1n*dImQ6n+dReQ1n*dReQ3n*dImQ2n*dImQ6n | |
6793 | + dReQ1n*dReQ2n*dImQ3n*dImQ6n-dImQ1n*dImQ2n*dImQ3n*dImQ6n) | |
6794 | - (-pow(dImQ3n,2.)*dImQ2n*dImQ8n+dImQ2n*dImQ8n*pow(dReQ3n,2.) | |
6795 | + 2.*dImQ3n*dImQ8n*dReQ3n*dReQ2n-2.*dImQ3n*dImQ2n*dReQ3n*dReQ8n | |
6796 | - pow(dImQ3n,2.)*dReQ2n*dReQ8n+pow(dReQ3n,2.)*dReQ2n*dReQ8n) | |
6797 | - ((pow(dReQ3n,2.)-pow(dImQ3n,2.))*(dReQ4n*dReQ2n-dImQ4n*dImQ2n) | |
6798 | + 2.*dReQ3n*dImQ3n*(dReQ4n*dImQ2n+dImQ4n*dReQ2n)) | |
6799 | + 2.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
6800 | + (dReQ8n*dReQ6n*dReQ2n-dReQ8n*dImQ6n*dImQ2n+dImQ8n*dReQ6n*dImQ2n+dImQ8n*dImQ6n*dReQ2n) | |
6801 | + 2.*(dReQ8n*dReQ3n*dReQ5n-dReQ8n*dImQ3n*dImQ5n+dImQ8n*dReQ3n*dImQ5n+dImQ8n*dImQ3n*dReQ5n) | |
6802 | + 2.*(dReQ6n*(dReQ5n*dReQ1n-dImQ5n*dImQ1n)+dImQ6n*(dReQ5n*dImQ1n+dImQ5n*dReQ1n)) | |
6803 | + 3.*(dReQ6n*(dReQ4n*dReQ2n-dImQ4n*dImQ2n)+dImQ6n*(dReQ4n*dImQ2n+dImQ4n*dReQ2n)) | |
6804 | + 4.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
6805 | + 2.*(dReQ8n*dReQ6n*dReQ2n-dReQ8n*dImQ6n*dImQ2n+dImQ8n*dReQ6n*dImQ2n+dImQ8n*dImQ6n*dReQ2n) | |
6806 | + 6.*(dReQ5n*dReQ3n*dReQ2n-dReQ5n*dImQ3n*dImQ2n+dImQ5n*dReQ3n*dImQ2n+dImQ5n*dImQ3n*dReQ2n) | |
6807 | + 2.*(dReQ4n*dReQ3n*dReQ1n-dReQ4n*dImQ3n*dImQ1n+dImQ4n*dReQ3n*dImQ1n+dImQ4n*dImQ3n*dReQ1n) | |
6808 | - (dMult-6.)*(pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n) | |
6809 | - 4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)) | |
6810 | - 4.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6811 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6812 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6813 | + 2.*(dMult-6.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6814 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+(dMult-8.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
6815 | + 2.*(dMult-8.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))-2.*dMult*(dMult-12.)) | |
6816 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
6817 | // to be polished: | |
6818 | five6n1n4n2n1n = (reQ6nQ1nQ4nstarQ2nstarQ1nstar | |
6819 | - reQ6nQ1nQ4nstarQ3nstar | |
6820 | - reQ6nQ1nQ5nstarQ2nstar | |
6821 | - reQ6nQ3nstarQ2nstarQ1nstar | |
6822 | - reQ7nQ4nstarQ2nstarQ1nstar | |
6823 | - reQ5nQ1nQ4nstarQ2nstar | |
6824 | - reQ6nQ4nstarQ1nstarQ1nstar | |
6825 | + reQ2nQ1nstarQ1nstar | |
6826 | + reQ7nQ6nstarQ1nstar | |
6827 | + 3.*reQ6nQ5nstarQ1nstar | |
6828 | + 2.*reQ7nQ6nstarQ1nstar | |
6829 | + reQ6nQ3nstarQ3nstar | |
6830 | + reQ7nQ4nstarQ3nstar | |
6831 | + reQ6nQ5nstarQ1nstar | |
6832 | + reQ2nQ1nstarQ1nstar | |
6833 | + reQ7nQ5nstarQ2nstar | |
6834 | + reQ5nQ3nstarQ2nstar | |
6835 | - (dMult-6.)*reQ6nQ4nstarQ2nstar | |
6836 | + 3.*reQ3nQ2nstarQ1nstar | |
6837 | + reQ2nQ1nstarQ1nstar | |
6838 | + 2.*reQ4nQ3nstarQ1nstar | |
6839 | + 3.*reQ5nQ4nstarQ1nstar | |
6840 | + reQ5nQ4nstarQ1nstar | |
6841 | + reQ4nQ3nstarQ1nstar | |
6842 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
6843 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6844 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6845 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
6846 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6847 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6848 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6849 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6850 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6851 | + (dMult-8.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
6852 | + (dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6853 | + (dMult-8.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6854 | + 2.*(dMult-6.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-2.*dMult*(dMult-12.)) | |
6855 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
6856 | // to be polished: | |
6857 | five6n3n4n3n2n = (reQ6nQ3nQ4nstarQ3nstarQ2nstar | |
6858 | - reQ6nQ3nQ5nstarQ4nstar | |
6859 | - reQ7nQ2nQ6nstarQ3nstar | |
6860 | - reQ6nQ3nstarQ2nstarQ1nstar | |
6861 | - reQ9nQ4nstarQ3nstarQ2nstar | |
6862 | - reQ4nQ2nQ3nstarQ3nstar | |
6863 | - reQ6nQ1nQ4nstarQ3nstar | |
6864 | + reQ3nQ2nstarQ1nstar | |
6865 | + reQ9nQ6nstarQ3nstar | |
6866 | + 3.*reQ6nQ3nstarQ3nstar | |
6867 | + 2.*reQ9nQ6nstarQ3nstar | |
6868 | + reQ6nQ5nstarQ1nstar | |
6869 | + reQ9nQ5nstarQ4nstar | |
6870 | + reQ7nQ6nstarQ1nstar | |
6871 | + reQ3nQ2nstarQ1nstar | |
6872 | + reQ9nQ7nstarQ2nstar | |
6873 | + reQ3nQ2nstarQ1nstar | |
6874 | - (dMult-6.)*reQ6nQ4nstarQ2nstar | |
6875 | + 3.*reQ5nQ3nstarQ2nstar | |
6876 | + reQ3nQ2nstarQ1nstar | |
6877 | + 2.*reQ4nQ3nstarQ1nstar | |
6878 | + 3.*reQ7nQ4nstarQ3nstar | |
6879 | + reQ4nQ3nstarQ1nstar | |
6880 | + reQ4nQ3nstarQ1nstar | |
6881 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
6882 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6883 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6884 | - 2.*(pow(dReQ9n,2.)+pow(dImQ9n,2.)) | |
6885 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6886 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6887 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6888 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
6889 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6890 | + (dMult-8.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
6891 | + (dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6892 | + (dMult-8.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6893 | + 2.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))-2.*dMult*(dMult-12.)) | |
6894 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
6895 | five6n4n4n3n3n = ((pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6896 | * (pow(dReQ3n,2.)*dReQ6n-pow(dImQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n) | |
6897 | - ((dReQ10n*dReQ4n+dImQ10n*dImQ4n)*(pow(dReQ3n,2)-pow(dImQ3n,2)) | |
6898 | + 2.*dReQ3n*dImQ3n*(dImQ10n*dReQ4n-dReQ10n*dImQ4n)) | |
6899 | - ((dReQ4n*dReQ2n-dImQ4n*dImQ2n)*(dReQ3n*dReQ3n-dImQ3n*dImQ3n) | |
6900 | + 2.*(dReQ4n*dImQ2n+dImQ4n*dReQ2n)*dReQ3n*dImQ3n) | |
6901 | - 2.*(dImQ1n*dImQ3n*dImQ4n*dImQ6n+dImQ4n*dImQ6n*dReQ1n*dReQ3n | |
6902 | + dImQ3n*dImQ6n*dReQ1n*dReQ4n-dImQ1n*dImQ6n*dReQ3n*dReQ4n | |
6903 | - dImQ3n*dImQ4n*dReQ1n*dReQ6n+dImQ1n*dImQ4n*dReQ3n*dReQ6n | |
6904 | + dImQ1n*dImQ3n*dReQ4n*dReQ6n+dReQ1n*dReQ3n*dReQ4n*dReQ6n) | |
6905 | - 2.*(dImQ3n*dImQ4n*dImQ6n*dImQ7n+dImQ6n*dImQ7n*dReQ3n*dReQ4n | |
6906 | + dImQ4n*dImQ7n*dReQ3n*dReQ6n-dImQ3n*dImQ7n*dReQ4n*dReQ6n | |
6907 | - dImQ4n*dImQ6n*dReQ3n*dReQ7n+dImQ3n*dImQ6n*dReQ4n*dReQ7n | |
6908 | + dImQ3n*dImQ4n*dReQ6n*dReQ7n+dReQ3n*dReQ4n*dReQ6n*dReQ7n) | |
6909 | + 2.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
6910 | + 1.*(dReQ10n*dReQ6n*dReQ4n-dReQ10n*dImQ6n*dImQ4n+dImQ10n*dReQ6n*dImQ4n+dImQ10n*dImQ6n*dReQ4n) | |
6911 | + 3.*(dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n) | |
6912 | + 2.*(dReQ7n*dReQ6n*dReQ1n-dReQ7n*dImQ6n*dImQ1n+dImQ7n*dReQ6n*dImQ1n+dImQ7n*dImQ6n*dReQ1n) | |
6913 | + 2.*(dReQ10n*dReQ7n*dReQ3n-dReQ10n*dImQ7n*dImQ3n+dImQ10n*dReQ7n*dImQ3n+dImQ10n*dImQ7n*dReQ3n) | |
6914 | + 2.*(dReQ10n*dReQ6n*dReQ4n-dReQ10n*dImQ6n*dImQ4n+dImQ10n*dReQ6n*dImQ4n+dImQ10n*dImQ6n*dReQ4n) | |
6915 | + 6.*(dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
6916 | + 6.*(dReQ7n*dReQ4n*dReQ3n-dReQ7n*dImQ4n*dImQ3n+dImQ7n*dReQ4n*dImQ3n+dImQ7n*dImQ4n*dReQ3n) | |
6917 | - (dMult-6.)*(pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n) | |
6918 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6919 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6920 | - 2.*(pow(dReQ10n,2.)+pow(dImQ10n,2.))-4.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
6921 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6922 | + (dMult-8.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
6923 | + 2.*(dMult-8.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6924 | + 2.*(dMult-6.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*dMult*(dMult-12.)) | |
6925 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
6926 | // to be polished: | |
6927 | five6n2n5n2n1n = (reQ6nQ2nQ5nstarQ2nstarQ1nstar | |
6928 | - reQ6nQ2nQ5nstarQ3nstar | |
6929 | - reQ7nQ1nQ6nstarQ2nstar | |
6930 | - reQ6nQ3nstarQ2nstarQ1nstar | |
6931 | - reQ8nQ5nstarQ2nstarQ1nstar | |
6932 | - reQ5nQ1nQ4nstarQ2nstar | |
6933 | - reQ6nQ1nQ5nstarQ2nstar | |
6934 | + reQ2nQ1nstarQ1nstar | |
6935 | + reQ8nQ6nstarQ2nstar | |
6936 | + 3.*reQ6nQ4nstarQ2nstar | |
6937 | + 2.*reQ8nQ6nstarQ2nstar | |
6938 | + reQ6nQ3nstarQ3nstar | |
6939 | + reQ8nQ5nstarQ3nstar | |
6940 | + reQ7nQ6nstarQ1nstar | |
6941 | + reQ2nQ1nstarQ1nstar | |
6942 | + reQ8nQ7nstarQ1nstar | |
6943 | + reQ4nQ3nstarQ1nstar | |
6944 | - (dMult-6.)*reQ6nQ5nstarQ1nstar | |
6945 | + 3.*reQ3nQ2nstarQ1nstar | |
6946 | + reQ2nQ1nstarQ1nstar | |
6947 | + 2.*reQ5nQ3nstarQ2nstar | |
6948 | + 3.*reQ7nQ5nstarQ2nstar | |
6949 | + reQ5nQ4nstarQ1nstar | |
6950 | + reQ5nQ3nstarQ2nstar | |
6951 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
6952 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6953 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6954 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)) | |
6955 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6956 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6957 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6958 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
6959 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6960 | + (dMult-8.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
6961 | + (dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6962 | + (dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6963 | + 2.*(dMult-6.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-2.*dMult*(dMult-12.)) | |
6964 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
6965 | // to be polished: | |
6966 | five6n3n5n3n1n = (reQ6nQ3nQ5nstarQ3nstarQ1nstar | |
6967 | - reQ6nQ3nQ5nstarQ4nstar | |
6968 | - reQ8nQ1nQ6nstarQ3nstar | |
6969 | - reQ6nQ3nstarQ2nstarQ1nstar | |
6970 | - reQ9nQ5nstarQ3nstarQ1nstar | |
6971 | - reQ5nQ1nQ3nstarQ3nstar | |
6972 | - reQ6nQ2nQ5nstarQ3nstar | |
6973 | + reQ3nQ2nstarQ1nstar | |
6974 | + reQ9nQ6nstarQ3nstar | |
6975 | + 3.*reQ6nQ3nstarQ3nstar | |
6976 | + 2.*reQ9nQ6nstarQ3nstar | |
6977 | + reQ6nQ4nstarQ2nstar | |
6978 | + reQ9nQ5nstarQ4nstar | |
6979 | + reQ8nQ6nstarQ2nstar | |
6980 | + reQ3nQ2nstarQ1nstar | |
6981 | + reQ9nQ8nstarQ1nstar | |
6982 | + reQ3nQ2nstarQ1nstar | |
6983 | - (dMult-6.)*reQ6nQ5nstarQ1nstar | |
6984 | + 3.*reQ4nQ3nstarQ1nstar | |
6985 | + reQ3nQ2nstarQ1nstar | |
6986 | + 2.*reQ5nQ3nstarQ2nstar | |
6987 | + 3.*reQ8nQ5nstarQ3nstar | |
6988 | + reQ5nQ3nstarQ2nstar | |
6989 | + reQ5nQ3nstarQ2nstar | |
6990 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
6991 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
6992 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
6993 | - 2.*(pow(dReQ9n,2.)+pow(dImQ9n,2.)) | |
6994 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
6995 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
6996 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6997 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)) | |
6998 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
6999 | + (dMult-8.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
7000 | + (dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7001 | + (dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7002 | + 2.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))-2.*dMult*(dMult-12.)) | |
7003 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7004 | // to be polished: | |
7005 | five6n4n5n4n1n = (reQ6nQ4nQ5nstarQ4nstarQ1nstar | |
7006 | - reQ6nQ4nQ5nstarQ5nstar | |
7007 | - reQ9nQ1nQ6nstarQ4nstar | |
7008 | - reQ6nQ4nstarQ1nstarQ1nstar | |
7009 | - reQ10nQ5nstarQ4nstarQ1nstar | |
7010 | - reQ5nQ1nQ4nstarQ2nstar | |
7011 | - reQ6nQ3nQ5nstarQ4nstar | |
7012 | + reQ4nQ3nstarQ1nstar | |
7013 | + reQ10nQ6nstarQ4nstar | |
7014 | + 3.*reQ6nQ4nstarQ2nstar | |
7015 | + 2.*reQ10nQ6nstarQ4nstar | |
7016 | + reQ6nQ5nstarQ1nstar | |
7017 | + reQ10nQ5nstarQ5nstar | |
7018 | + reQ9nQ6nstarQ3nstar | |
7019 | + reQ4nQ3nstarQ1nstar | |
7020 | + reQ10nQ9nstarQ1nstar | |
7021 | + reQ2nQ1nstarQ1nstar | |
7022 | - (dMult-6.)*reQ6nQ5nstarQ1nstar | |
7023 | + 3.*reQ5nQ4nstarQ1nstar | |
7024 | + reQ4nQ3nstarQ1nstar | |
7025 | + 2.*reQ5nQ4nstarQ1nstar | |
7026 | + 3.*reQ9nQ5nstarQ4nstar | |
7027 | + reQ5nQ3nstarQ2nstar | |
7028 | + reQ5nQ4nstarQ1nstar | |
7029 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
7030 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7031 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7032 | - 2.*(pow(dReQ10n,2.)+pow(dImQ10n,2.)) | |
7033 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7034 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7035 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7036 | - 2.*(pow(dReQ9n,2.)+pow(dImQ9n,2.)) | |
7037 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7038 | + (dMult-8.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
7039 | + (dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7040 | + (dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7041 | + 2.*(dMult-6.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*dMult*(dMult-12.)) | |
7042 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7043 | five6n5n5n3n3n = ((pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7044 | * (pow(dReQ3n,2.)*dReQ6n-pow(dImQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n) | |
7045 | - ((dReQ11n*dReQ5n+dImQ11n*dImQ5n)*(pow(dReQ3n,2)-pow(dImQ3n,2)) | |
7046 | + 2.*dReQ3n*dImQ3n*(dImQ11n*dReQ5n-dReQ11n*dImQ5n)) | |
7047 | - (dImQ1n*pow(dImQ3n,2.)*dImQ5n+2.*dImQ3n*dImQ5n*dReQ1n*dReQ3n | |
7048 | - dImQ1n*dImQ5n*pow(dReQ3n,2.)-pow(dImQ3n,2.)*dReQ1n*dReQ5n | |
7049 | + 2.*dImQ1n*dImQ3n*dReQ3n*dReQ5n+dReQ1n*pow(dReQ3n,2.)*dReQ5n) | |
7050 | - 2.*(dImQ2n*dImQ3n*dImQ5n*dImQ6n+dImQ5n*dImQ6n*dReQ2n*dReQ3n | |
7051 | + dImQ3n*dImQ6n*dReQ2n*dReQ5n-dImQ2n*dImQ6n*dReQ3n*dReQ5n | |
7052 | - dImQ3n*dImQ5n*dReQ2n*dReQ6n+dImQ2n*dImQ5n*dReQ3n*dReQ6n | |
7053 | + dImQ2n*dImQ3n*dReQ5n*dReQ6n+dReQ2n*dReQ3n*dReQ5n*dReQ6n) | |
7054 | - 2.*(dImQ3n*dImQ5n*dImQ6n*dImQ8n+dImQ6n*dImQ8n*dReQ3n*dReQ5n | |
7055 | + dImQ5n*dImQ8n*dReQ3n*dReQ6n-dImQ3n*dImQ8n*dReQ5n*dReQ6n | |
7056 | - dImQ5n*dImQ6n*dReQ3n*dReQ8n+dImQ3n*dImQ6n*dReQ5n*dReQ8n | |
7057 | + dImQ3n*dImQ5n*dReQ6n*dReQ8n+dReQ3n*dReQ5n*dReQ6n*dReQ8n) | |
7058 | + 2.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
7059 | + 1.*(dReQ11n*dReQ6n*dReQ5n-dReQ11n*dImQ6n*dImQ5n+dImQ11n*dReQ6n*dImQ5n+dImQ11n*dImQ6n*dReQ5n) | |
7060 | + 3.*(dReQ6n*dReQ5n*dReQ1n-dReQ6n*dImQ5n*dImQ1n+dImQ6n*dReQ5n*dImQ1n+dImQ6n*dImQ5n*dReQ1n) | |
7061 | + 2.*(dReQ8n*dReQ6n*dReQ2n-dReQ8n*dImQ6n*dImQ2n+dImQ8n*dReQ6n*dImQ2n+dImQ8n*dImQ6n*dReQ2n) | |
7062 | + 2.*(dReQ11n*dReQ8n*dReQ3n-dReQ11n*dImQ8n*dImQ3n+dImQ11n*dReQ8n*dImQ3n+dImQ11n*dImQ8n*dReQ3n) | |
7063 | + 2.*(dReQ11n*dReQ6n*dReQ5n-dReQ11n*dImQ6n*dImQ5n+dImQ11n*dReQ6n*dImQ5n+dImQ11n*dImQ6n*dReQ5n) | |
7064 | + 6.*(dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n+dImQ5n*dImQ2n*dReQ3n) | |
7065 | + 6.*(dReQ8n*dReQ5n*dReQ3n-dReQ8n*dImQ5n*dImQ3n+dImQ8n*dReQ5n*dImQ3n+dImQ8n*dImQ5n*dReQ3n) | |
7066 | - (dMult-6.)*(pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n) | |
7067 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7068 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7069 | - 2.*(pow(dReQ11n,2.)+pow(dImQ11n,2.))-4.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)) | |
7070 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7071 | + (dMult-8.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
7072 | + 2.*(dMult-8.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7073 | + 2.*(dMult-6.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.))-2.*dMult*(dMult-12.)) | |
7074 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7075 | // to be polished: | |
7076 | five6n2n6n1n1n = ((pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
7077 | * (pow(dReQ1n,2.)*dReQ2n-pow(dImQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n) | |
7078 | - reQ8nQ6nstarQ1nstarQ1nstar | |
7079 | - reQ6nQ4nstarQ1nstarQ1nstar | |
7080 | - 2.*reQ6nQ1nQ5nstarQ2nstar | |
7081 | - 2.*reQ7nQ1nQ6nstarQ2nstar | |
7082 | + 2.*reQ5nQ4nstarQ1nstar | |
7083 | + reQ8nQ6nstarQ2nstar | |
7084 | + 3.*reQ6nQ4nstarQ2nstar | |
7085 | + 2.*reQ7nQ5nstarQ2nstar | |
7086 | + 2.*reQ8nQ7nstarQ1nstar | |
7087 | + 2.*reQ8nQ6nstarQ2nstar | |
7088 | + 6.*reQ6nQ5nstarQ1nstar | |
7089 | + 6.*reQ7nQ6nstarQ1nstar | |
7090 | - (dMult-6.)*(pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
7091 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
7092 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
7093 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.))-4.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
7094 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-4.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7095 | + (dMult-8.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7096 | + 2.*(dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7097 | + 2.*(dMult-6.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-2.*dMult*(dMult-12.)) | |
7098 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7099 | five6n3n6n2n1n = (reQ6nQ3nQ6nstarQ2nstarQ1nstar | |
7100 | - reQ7nQ2nQ6nstarQ3nstar | |
7101 | - reQ8nQ1nQ6nstarQ3nstar | |
7102 | - reQ6nQ1nQ4nstarQ3nstar | |
7103 | - reQ9nQ6nstarQ2nstarQ1nstar | |
7104 | - reQ6nQ3nstarQ2nstarQ1nstar | |
7105 | - reQ6nQ2nQ5nstarQ3nstar | |
7106 | + reQ6nQ5nstarQ1nstar | |
7107 | + reQ9nQ6nstarQ3nstar | |
7108 | + 3.*reQ6nQ3nstarQ3nstar | |
7109 | + 2.*reQ9nQ6nstarQ3nstar | |
7110 | + reQ7nQ4nstarQ3nstar | |
7111 | + reQ9nQ7nstarQ2nstar | |
7112 | + reQ8nQ5nstarQ3nstar | |
7113 | + reQ6nQ5nstarQ1nstar | |
7114 | + reQ9nQ8nstarQ1nstar | |
7115 | + reQ4nQ3nstarQ1nstar | |
7116 | - (dMult-6.)*reQ3nQ2nstarQ1nstar | |
7117 | + 3.*reQ7nQ6nstarQ1nstar | |
7118 | + reQ6nQ5nstarQ1nstar | |
7119 | + 2.*reQ6nQ4nstarQ2nstar | |
7120 | + 3.*reQ8nQ6nstarQ2nstar | |
7121 | + reQ5nQ3nstarQ2nstar | |
7122 | + reQ6nQ4nstarQ2nstar | |
7123 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7124 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7125 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7126 | - 2.*(pow(dReQ9n,2.)+pow(dImQ9n,2.)) | |
7127 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7128 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
7129 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7130 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)) | |
7131 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7132 | + (dMult-8.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7133 | + (dMult-8.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7134 | + (dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7135 | + 2.*(dMult-6.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-2.*dMult*(dMult-12.)) | |
7136 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7137 | five6n4n6n2n2n = (-(pow(dImQ6n,2.)+pow(dReQ6n,2.)) | |
7138 | * (-2.*dImQ2n*dImQ4n*dReQ2n+pow(dImQ2n,2.)*dReQ4n-pow(dReQ2n,2.)*dReQ4n) | |
7139 | - (-pow(dImQ2n,2.)*dImQ6n*dImQ10n+dImQ6n*dImQ10n*pow(dReQ2n,2.) | |
7140 | + 2.*dImQ2n*dImQ10n*dReQ2n*dReQ6n-2.*dImQ2n*dImQ6n*dReQ2n*dReQ10n | |
7141 | - pow(dImQ2n,2.)*dReQ6n*dReQ10n+pow(dReQ2n,2.)*dReQ6n*dReQ10n) | |
7142 | - 2.*(dImQ2n*dImQ4n*dImQ6n*dImQ8n+dImQ6n*dImQ8n*dReQ2n*dReQ4n | |
7143 | + dImQ4n*dImQ8n*dReQ2n*dReQ6n-dImQ2n*dImQ8n*dReQ4n*dReQ6n | |
7144 | - dImQ4n*dImQ6n*dReQ2n*dReQ8n+dImQ2n*dImQ6n*dReQ4n*dReQ8n | |
7145 | + dImQ2n*dImQ4n*dReQ6n*dReQ8n+dReQ2n*dReQ4n*dReQ6n*dReQ8n) | |
7146 | - (dReQ6n*pow(dReQ2n,3.)-3.*dReQ2n*dReQ6n*pow(dImQ2n,2.) | |
7147 | + 3.*dImQ2n*dImQ6n*pow(dReQ2n,2.)-dImQ6n*pow(dImQ2n,3.)) | |
7148 | - 2.*((pow(dReQ4n,2.)-pow(dImQ4n,2.))*(dReQ6n*dReQ2n-dImQ6n*dImQ2n) | |
7149 | + 2.*dReQ4n*dImQ4n*(dReQ6n*dImQ2n+dImQ6n*dReQ2n)) | |
7150 | + 2.*(dReQ10n*dReQ8n*dReQ2n-dReQ10n*dImQ8n*dImQ2n+dImQ10n*dReQ8n*dImQ2n+dImQ10n*dImQ8n*dReQ2n) | |
7151 | + 3.*(dReQ10n*dReQ4n*dReQ6n-dReQ10n*dImQ4n*dImQ6n+dImQ10n*dReQ4n*dImQ6n+dImQ10n*dImQ4n*dReQ6n) | |
7152 | + 6.*(dReQ8n*(dReQ6n*dReQ2n-dImQ6n*dImQ2n)+dImQ8n*(dReQ6n*dImQ2n+dImQ6n*dReQ2n)) | |
7153 | + 2.*(pow(dReQ4n,2.)*dReQ8n+2.*dReQ4n*dImQ4n*dImQ8n-pow(dImQ4n,2.)*dReQ8n) | |
7154 | + 9.*(dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n) | |
7155 | - (dMult-8.)*(pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
7156 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7157 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7158 | - 2.*(pow(dReQ10n,2.)+pow(dImQ10n,2.))-4.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)) | |
7159 | + 2.*(dMult-6.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.))+(dMult-12.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7160 | + 2.*(dMult-9.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-2.*dMult*(dMult-12.)) | |
7161 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7162 | // to be polished: | |
7163 | five6n4n6n3n1n = (reQ6nQ4nQ6nstarQ3nstarQ1nstar | |
7164 | - reQ7nQ3nQ6nstarQ4nstar | |
7165 | - reQ9nQ1nQ6nstarQ4nstar | |
7166 | - reQ6nQ1nQ4nstarQ3nstar | |
7167 | - reQ10nQ6nstarQ3nstarQ1nstar | |
7168 | - reQ6nQ3nstarQ2nstarQ1nstar | |
7169 | - reQ6nQ3nQ5nstarQ4nstar | |
7170 | + reQ6nQ5nstarQ1nstar | |
7171 | + reQ10nQ6nstarQ4nstar | |
7172 | + 3.*reQ6nQ4nstarQ2nstar | |
7173 | + 2.*reQ10nQ6nstarQ4nstar | |
7174 | + reQ7nQ4nstarQ3nstar | |
7175 | + reQ10nQ7nstarQ3nstar | |
7176 | + reQ9nQ5nstarQ4nstar | |
7177 | + reQ6nQ5nstarQ1nstar | |
7178 | + reQ10nQ9nstarQ1nstar | |
7179 | + reQ3nQ2nstarQ1nstar | |
7180 | - (dMult-6.)*reQ4nQ3nstarQ1nstar | |
7181 | + 3.*reQ7nQ6nstarQ1nstar | |
7182 | + reQ6nQ5nstarQ1nstar | |
7183 | + 2.*reQ6nQ3nstarQ3nstar | |
7184 | + 3.*reQ9nQ6nstarQ3nstar | |
7185 | + reQ5nQ3nstarQ2nstar | |
7186 | + reQ6nQ3nstarQ3nstar | |
7187 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7188 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7189 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7190 | - 2.*(pow(dReQ10n,2.)+pow(dImQ10n,2.)) | |
7191 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7192 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
7193 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7194 | - 2.*(pow(dReQ9n,2.)+pow(dImQ9n,2.)) | |
7195 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7196 | + (dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7197 | + (dMult-8.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7198 | + (dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7199 | + 2.*(dMult-6.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-2.*dMult*(dMult-12.)) | |
7200 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7201 | // to be polished: | |
7202 | five6n5n5n4n2n = (reQ6nQ5nQ5nstarQ4nstarQ2nstar | |
7203 | - reQ7nQ4nQ6nstarQ5nstar | |
7204 | - reQ9nQ2nQ6nstarQ5nstar | |
7205 | - reQ6nQ1nQ5nstarQ2nstar | |
7206 | - reQ11nQ5nstarQ4nstarQ2nstar | |
7207 | - reQ5nQ1nQ4nstarQ2nstar | |
7208 | - reQ6nQ3nQ5nstarQ4nstar | |
7209 | + reQ5nQ3nstarQ2nstar | |
7210 | + reQ11nQ6nstarQ5nstar | |
7211 | + 3.*reQ6nQ5nstarQ1nstar | |
7212 | + 2.*reQ11nQ6nstarQ5nstar | |
7213 | + reQ7nQ6nstarQ1nstar | |
7214 | + reQ11nQ7nstarQ4nstar | |
7215 | + reQ9nQ6nstarQ3nstar | |
7216 | + reQ5nQ3nstarQ2nstar | |
7217 | + reQ11nQ9nstarQ2nstar | |
7218 | + reQ2nQ1nstarQ1nstar | |
7219 | - (dMult-6.)*reQ6nQ4nstarQ2nstar | |
7220 | + 3.*reQ7nQ5nstarQ2nstar | |
7221 | + reQ5nQ3nstarQ2nstar | |
7222 | + 2.*reQ5nQ4nstarQ1nstar | |
7223 | + 3.*reQ9nQ5nstarQ4nstar | |
7224 | + reQ4nQ3nstarQ1nstar | |
7225 | + reQ5nQ4nstarQ1nstar | |
7226 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
7227 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7228 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7229 | - 2.*(pow(dReQ11n,2.)+pow(dImQ11n,2.)) | |
7230 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7231 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
7232 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7233 | - 2.*(pow(dReQ9n,2.)+pow(dImQ9n,2.)) | |
7234 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7235 | + (dMult-8.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
7236 | + (dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7237 | + (dMult-8.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7238 | + 2.*(dMult-6.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.))-2.*dMult*(dMult-12.)) | |
7239 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7240 | // to be polished: | |
7241 | five6n5n6n3n2n = (reQ6nQ5nQ6nstarQ3nstarQ2nstar | |
7242 | - reQ8nQ3nQ6nstarQ5nstar | |
7243 | - reQ9nQ2nQ6nstarQ5nstar | |
7244 | - reQ6nQ2nQ5nstarQ3nstar | |
7245 | - reQ11nQ6nstarQ3nstarQ2nstar | |
7246 | - reQ6nQ3nstarQ2nstarQ1nstar | |
7247 | - reQ6nQ3nQ5nstarQ4nstar | |
7248 | + reQ6nQ4nstarQ2nstar | |
7249 | + reQ11nQ6nstarQ5nstar | |
7250 | + 3.*reQ6nQ5nstarQ1nstar | |
7251 | + 2.*reQ11nQ6nstarQ5nstar | |
7252 | + reQ8nQ5nstarQ3nstar | |
7253 | + reQ11nQ8nstarQ3nstar | |
7254 | + reQ9nQ5nstarQ4nstar | |
7255 | + reQ6nQ4nstarQ2nstar | |
7256 | + reQ11nQ9nstarQ2nstar | |
7257 | + reQ3nQ2nstarQ1nstar | |
7258 | - (dMult-6.)*reQ5nQ3nstarQ2nstar | |
7259 | + 3.*reQ8nQ6nstarQ2nstar | |
7260 | + reQ6nQ4nstarQ2nstar | |
7261 | + 2.*reQ6nQ3nstarQ3nstar | |
7262 | + 3.*reQ9nQ6nstarQ3nstar | |
7263 | + reQ4nQ3nstarQ1nstar | |
7264 | + reQ6nQ3nstarQ3nstar | |
7265 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7266 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7267 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7268 | - 2.*(pow(dReQ11n,2.)+pow(dImQ11n,2.)) | |
7269 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7270 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)) | |
7271 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7272 | - 2.*(pow(dReQ9n,2.)+pow(dImQ9n,2.)) | |
7273 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7274 | + (dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7275 | + (dMult-8.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7276 | + (dMult-8.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7277 | + 2.*(dMult-6.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-2.*dMult*(dMult-12.)) | |
7278 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7279 | // to be polished: | |
7280 | five6n5n6n4n1n = (reQ6nQ5nQ6nstarQ4nstarQ1nstar | |
7281 | - reQ7nQ4nQ6nstarQ5nstar | |
7282 | - reQ10nQ1nQ6nstarQ5nstar | |
7283 | - reQ6nQ1nQ5nstarQ2nstar | |
7284 | - reQ11nQ6nstarQ4nstarQ1nstar | |
7285 | - reQ6nQ4nstarQ1nstarQ1nstar | |
7286 | - reQ6nQ4nQ5nstarQ5nstar | |
7287 | + reQ6nQ5nstarQ1nstar | |
7288 | + reQ11nQ6nstarQ5nstar | |
7289 | + 3.*reQ6nQ5nstarQ1nstar | |
7290 | + 2.*reQ11nQ6nstarQ5nstar | |
7291 | + reQ7nQ5nstarQ2nstar | |
7292 | + reQ11nQ7nstarQ4nstar | |
7293 | + reQ10nQ5nstarQ5nstar | |
7294 | + reQ6nQ5nstarQ1nstar | |
7295 | + reQ11nQ10nstarQ1nstar | |
7296 | + reQ2nQ1nstarQ1nstar | |
7297 | - (dMult-6.)*reQ5nQ4nstarQ1nstar | |
7298 | + 3.*reQ7nQ6nstarQ1nstar | |
7299 | + reQ6nQ5nstarQ1nstar | |
7300 | + 2.*reQ6nQ4nstarQ2nstar | |
7301 | + 3.*reQ10nQ6nstarQ4nstar | |
7302 | + reQ5nQ4nstarQ1nstar | |
7303 | + reQ6nQ4nstarQ2nstar | |
7304 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7305 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7306 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7307 | - 2.*(pow(dReQ11n,2.)+pow(dImQ11n,2.)) | |
7308 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7309 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
7310 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7311 | - 2.*(pow(dReQ10n,2.)+pow(dImQ10n,2.)) | |
7312 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7313 | + (dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7314 | + (dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7315 | + (dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7316 | + 2.*(dMult-6.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-2.*dMult*(dMult-12.)) | |
7317 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7318 | // f2) Two distinct harmonics (9): | |
7319 | five2n1n1n1n1n = ((dReQ2n*dReQ1n-dImQ2n*dImQ1n)*(pow(dReQ1n,3)-3.*dReQ1n*pow(dImQ1n,2)) | |
7320 | + (dReQ2n*dImQ1n+dReQ1n*dImQ2n)*(3.*dImQ1n*pow(dReQ1n,2)-pow(dImQ1n,3)) | |
7321 | - (dReQ3n*pow(dReQ1n,3)-3.*dReQ1n*dReQ3n*pow(dImQ1n,2) | |
7322 | + 3.*dImQ1n*dImQ3n*pow(dReQ1n,2)-dImQ3n*pow(dImQ1n,3)) | |
7323 | + 5.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
7324 | - 3.*(dMult-5.)*(pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
7325 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7326 | - 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7327 | + 3.*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7328 | - 3.*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
7329 | + 6.*(2.*dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult*(dMult-4.)) | |
7330 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7331 | five2n2n2n1n1n = ((pow(dReQ2n,2.)+pow(dImQ2n,2.))*(dReQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.))+2.*dImQ2n*dReQ1n*dImQ1n) | |
7332 | - ((dReQ4n*dReQ2n+dImQ4n*dImQ2n)*(pow(dReQ1n,2)-pow(dImQ1n,2)) | |
7333 | + 2.*dReQ1n*dImQ1n*(dImQ4n*dReQ2n-dReQ4n*dImQ2n)) | |
7334 | - 2.*((pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n) | |
7335 | + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
7336 | + 3.*(pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
7337 | + 8.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
7338 | + 2.*(dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
7339 | - 2.*(dMult-6.)*(pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
7340 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7341 | - pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.) | |
7342 | + 2.*(3.*dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7343 | - 4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7344 | + 4.*(dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*dMult*(dMult-6.)) | |
7345 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7346 | five3n3n2n2n2n = (pow(dReQ2n,3.)*pow(dReQ3n,2.)-3.*dReQ2n*pow(dReQ3n,2.)*pow(dImQ2n,2.) | |
7347 | + 6.*pow(dReQ2n,2.)*dReQ3n*dImQ2n*dImQ3n-2.*dReQ3n*pow(dImQ2n,3.)*dImQ3n | |
7348 | - pow(dReQ2n,3.)*pow(dImQ3n,2.)+3.*dReQ2n*pow(dImQ2n,2.)*pow(dImQ3n,2.) | |
7349 | - (dReQ6n*pow(dReQ2n,3)-3.*dReQ2n*dReQ6n*pow(dImQ2n,2) | |
7350 | + 3.*dImQ2n*dImQ6n*pow(dReQ2n,2)-dImQ6n*pow(dImQ2n,3)) | |
7351 | - 3.*((dReQ4n*dReQ2n-dImQ4n*dImQ2n)*(dReQ3n*dReQ3n-dImQ3n*dImQ3n) | |
7352 | + 2.*(dReQ4n*dImQ2n+dImQ4n*dReQ2n)*dReQ3n*dImQ3n) | |
7353 | - 6.*((pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n) | |
7354 | + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
7355 | + 2.*(pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n) | |
7356 | + 3.*(dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n) | |
7357 | + 6.*(dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
7358 | + 6.*(pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
7359 | + 12.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
7360 | + 6.*(pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
7361 | - 2.*((pow(dReQ6n,2.)+pow(dImQ6n,2.))+3.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7362 | + 6.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+9.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7363 | + 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-12.*dMult)) | |
7364 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7365 | five4n1n1n1n1n = (pow(dReQ1n,4.)*dReQ4n-6.*pow(dReQ1n,2.)*dReQ4n*pow(dImQ1n,2.) | |
7366 | + pow(dImQ1n,4.)*dReQ4n+4.*pow(dReQ1n,3.)*dImQ1n*dImQ4n-4.*pow(dImQ1n,3.)*dReQ1n*dImQ4n | |
7367 | - 6.*((dReQ4n*dReQ2n+dImQ4n*dImQ2n)*(pow(dReQ1n,2)-pow(dImQ1n,2)) | |
7368 | + 2.*dReQ1n*dImQ1n*(dImQ4n*dReQ2n-dReQ4n*dImQ2n)) | |
7369 | - 4.*(dReQ3n*pow(dReQ1n,3)-3.*dReQ1n*dReQ3n*pow(dImQ1n,2) | |
7370 | + 3.*dImQ1n*dImQ3n*pow(dReQ1n,2)-dImQ3n*pow(dImQ1n,3)) | |
7371 | + 8.*(dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
7372 | + 3.*(pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
7373 | + 12.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
7374 | + 12.*(pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
7375 | - 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-8.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7376 | - 12.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-24.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+24.*dMult) | |
7377 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7378 | five4n2n2n2n2n = ((dReQ4n*dReQ2n-dImQ4n*dImQ2n)*(pow(dReQ2n,3)-3.*dReQ2n*pow(dImQ2n,2)) | |
7379 | + (dReQ4n*dImQ2n+dReQ2n*dImQ4n)*(3.*dImQ2n*pow(dReQ2n,2)-pow(dImQ2n,3)) | |
7380 | - (dReQ6n*pow(dReQ2n,3)-3.*dReQ2n*dReQ6n*pow(dImQ2n,2) | |
7381 | + 3.*dImQ2n*dImQ6n*pow(dReQ2n,2)-dImQ6n*pow(dImQ2n,3)) | |
7382 | + 5.*(dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n) | |
7383 | - 3.*(dMult-5.)*(pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
7384 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
7385 | - 3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7386 | + 3.*(dMult-4.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7387 | - 3.*pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.) | |
7388 | + 6.*(2.*dMult-5.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-6.*dMult*(dMult-4.)) | |
7389 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7390 | five4n4n4n2n2n = ((pow(dReQ4n,2.)+pow(dImQ4n,2.))*(dReQ4n*(pow(dReQ2n,2.)-pow(dImQ2n,2.))+2.*dImQ4n*dReQ2n*dImQ2n) | |
7391 | - ((dReQ8n*dReQ4n+dImQ8n*dImQ4n)*(pow(dReQ2n,2)-pow(dImQ2n,2)) | |
7392 | + 2.*dReQ2n*dImQ2n*(dImQ8n*dReQ4n-dReQ8n*dImQ4n)) | |
7393 | - 2.*((pow(dReQ4n,2.)-pow(dImQ4n,2.))*(dReQ6n*dReQ2n-dImQ6n*dImQ2n) | |
7394 | + 2.*dReQ4n*dImQ4n*(dReQ6n*dImQ2n+dImQ6n*dReQ2n)) | |
7395 | + 3.*(pow(dReQ4n,2.)*dReQ8n+2.*dReQ4n*dImQ4n*dImQ8n-pow(dImQ4n,2.)*dReQ8n) | |
7396 | + 8.*(dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n) | |
7397 | + 2.*(dReQ8n*(dReQ6n*dReQ2n-dImQ6n*dImQ2n)+dImQ8n*(dReQ6n*dImQ2n+dImQ6n*dReQ2n)) | |
7398 | - 2.*(dMult-6.)*(pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
7399 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.))-4.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
7400 | - pow((pow(dReQ4n,2.)+pow(dImQ4n,2.)),2.) | |
7401 | + 2.*(3.*dMult-10.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7402 | - 4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7403 | + 4.*(dMult-5.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*dMult*(dMult-6.)) | |
7404 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7405 | five6n3n3n3n3n = ((dReQ6n*dReQ3n-dImQ6n*dImQ3n)*(pow(dReQ3n,3)-3.*dReQ3n*pow(dImQ3n,2)) | |
7406 | + (dReQ6n*dImQ3n+dReQ3n*dImQ6n)*(3.*dImQ3n*pow(dReQ3n,2)-pow(dImQ3n,3)) | |
7407 | - (dReQ9n*pow(dReQ3n,3)-3.*dReQ3n*dReQ9n*pow(dImQ3n,2) | |
7408 | + 3.*dImQ3n*dImQ9n*pow(dReQ3n,2)-dImQ9n*pow(dImQ3n,3)) | |
7409 | + 5.*(dReQ9n*dReQ6n*dReQ3n-dReQ9n*dImQ6n*dImQ3n+dImQ9n*dReQ6n*dImQ3n+dImQ9n*dImQ6n*dReQ3n) | |
7410 | - 3.*(dMult-5.)*(pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n) | |
7411 | - 2.*(pow(dReQ9n,2.)+pow(dImQ9n,2.)) | |
7412 | - 3.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
7413 | + 3.*(dMult-4.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
7414 | - 3.*pow((pow(dReQ3n,2.)+pow(dImQ3n,2.)),2.) | |
7415 | + 6.*(2.*dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))-6.*dMult*(dMult-4.)) | |
7416 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7417 | five6n6n4n4n4n = (pow(dReQ4n,3.)*pow(dReQ6n,2.)-3.*dReQ4n*pow(dReQ6n,2.)*pow(dImQ4n,2.) | |
7418 | + 6.*pow(dReQ4n,2.)*dReQ6n*dImQ4n*dImQ6n-2.*dReQ6n*pow(dImQ4n,3.)*dImQ6n | |
7419 | - pow(dReQ4n,3.)*pow(dImQ6n,2.)+3.*dReQ4n*pow(dImQ4n,2.)*pow(dImQ6n,2.) | |
7420 | - (dReQ12n*pow(dReQ4n,3)-3.*dReQ4n*dReQ12n*pow(dImQ4n,2) | |
7421 | + 3.*dImQ4n*dImQ12n*pow(dReQ4n,2)-dImQ12n*pow(dImQ4n,3)) | |
7422 | - 3.*((dReQ8n*dReQ4n-dImQ8n*dImQ4n)*(dReQ6n*dReQ6n-dImQ6n*dImQ6n) | |
7423 | + 2.*(dReQ8n*dImQ4n+dImQ8n*dReQ4n)*dReQ6n*dImQ6n) | |
7424 | - 6.*((pow(dReQ4n,2.)-pow(dImQ4n,2.))*(dReQ6n*dReQ2n-dImQ6n*dImQ2n) | |
7425 | + 2.*dReQ4n*dImQ4n*(dReQ6n*dImQ2n+dImQ6n*dReQ2n)) | |
7426 | + 2.*(pow(dReQ6n,2.)*dReQ12n+2.*dReQ6n*dImQ6n*dImQ12n-pow(dImQ6n,2.)*dReQ12n) | |
7427 | + 3.*(dReQ12n*dReQ8n*dReQ4n-dReQ12n*dImQ8n*dImQ4n+dImQ12n*dReQ8n*dImQ4n+dImQ12n*dImQ8n*dReQ4n) | |
7428 | + 6.*(dReQ8n*(dReQ6n*dReQ2n-dImQ6n*dImQ2n)+dImQ8n*(dReQ6n*dImQ2n+dImQ6n*dReQ2n)) | |
7429 | + 6.*(pow(dReQ4n,2.)*dReQ8n+2.*dReQ4n*dImQ4n*dImQ8n-pow(dImQ4n,2.)*dReQ8n) | |
7430 | + 12.*(dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n) | |
7431 | + 6.*(pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
7432 | - 2.*((pow(dReQ12n,2.)+pow(dImQ12n,2.))+3.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)) | |
7433 | + 6.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))+9.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7434 | + 6.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-12.*dMult)) | |
7435 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7436 | five6n6n6n3n3n = ((pow(dReQ6n,2.)+pow(dImQ6n,2.))*(dReQ6n*(pow(dReQ3n,2.)-pow(dImQ3n,2.))+2.*dImQ6n*dReQ3n*dImQ3n) | |
7437 | - ((dReQ12n*dReQ6n+dImQ12n*dImQ6n)*(pow(dReQ3n,2)-pow(dImQ3n,2)) | |
7438 | + 2.*dReQ3n*dImQ3n*(dImQ12n*dReQ6n-dReQ12n*dImQ6n)) | |
7439 | - 2.*((pow(dReQ6n,2.)-pow(dImQ6n,2.))*(dReQ9n*dReQ3n-dImQ9n*dImQ3n) | |
7440 | + 2.*dReQ6n*dImQ6n*(dReQ9n*dImQ3n+dImQ9n*dReQ3n)) | |
7441 | + 3.*(pow(dReQ6n,2.)*dReQ12n+2.*dReQ6n*dImQ6n*dImQ12n-pow(dImQ6n,2.)*dReQ12n) | |
7442 | + 8.*(dReQ9n*dReQ6n*dReQ3n-dReQ9n*dImQ6n*dImQ3n+dImQ9n*dReQ6n*dImQ3n+dImQ9n*dImQ6n*dReQ3n) | |
7443 | + 2.*(dReQ12n*(dReQ9n*dReQ3n-dImQ9n*dImQ3n)+dImQ12n*(dReQ9n*dImQ3n+dImQ9n*dReQ3n)) | |
7444 | - 2.*(dMult-6.)*(pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n) | |
7445 | - 2.*(pow(dReQ12n,2.)+pow(dImQ12n,2.))-4.*(pow(dReQ9n,2.)+pow(dImQ9n,2.)) | |
7446 | - pow((pow(dReQ6n,2.)+pow(dImQ6n,2.)),2.) | |
7447 | + 2.*(3.*dMult-10.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
7448 | - 4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
7449 | + 4.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))-4.*dMult*(dMult-6.)) | |
7450 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7451 | // f3) Three distinct harmonics (30): | |
7452 | five3n1n2n1n1n = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(dReQ1n*dReQ2n*dReQ3n-dReQ3n*dImQ1n*dImQ2n | |
7453 | + dReQ2n*dImQ1n*dImQ3n+dReQ1n*dImQ2n*dImQ3n) | |
7454 | - ((dReQ4n*dReQ2n+dImQ4n*dImQ2n)*(pow(dReQ1n,2)-pow(dImQ1n,2)) | |
7455 | + 2.*dReQ1n*dImQ1n*(dImQ4n*dReQ2n-dReQ4n*dImQ2n)) | |
7456 | - (dReQ3n*pow(dReQ1n,3)-3.*dReQ1n*dReQ3n*pow(dImQ1n,2) | |
7457 | + 3.*dImQ1n*dImQ3n*pow(dReQ1n,2)-dImQ3n*pow(dImQ1n,3)) | |
7458 | - ((pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n) | |
7459 | + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
7460 | + 4.*(dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
7461 | + pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n | |
7462 | - (2.*dMult-13.)*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n | |
7463 | + dImQ3n*dImQ2n*dReQ1n) | |
7464 | + 7.*(pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
7465 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7466 | + 2.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7467 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7468 | + 2.*(dMult-6.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7469 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7470 | - pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
7471 | + 2.*(3.*dMult-11.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*dMult*(dMult-6.)) | |
7472 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7473 | five3n2n2n2n1n = ((pow(dImQ2n,2.)+pow(dReQ2n,2.))*(dImQ2n*dImQ3n*dReQ1n+dImQ1n*dImQ3n*dReQ2n | |
7474 | - dImQ1n*dImQ2n*dReQ3n+dReQ1n*dReQ2n*dReQ3n) | |
7475 | - (-pow(dImQ2n,2.)*dImQ1n*dImQ5n+dImQ1n*dImQ5n*pow(dReQ2n,2.) | |
7476 | + 2.*dImQ2n*dImQ5n*dReQ2n*dReQ1n-2.*dImQ2n*dImQ1n*dReQ2n*dReQ5n | |
7477 | - pow(dImQ2n,2.)*dReQ1n*dReQ5n+pow(dReQ2n,2.)*dReQ1n*dReQ5n) | |
7478 | - (dImQ1n*dImQ2n*dImQ3n*dImQ4n+dImQ3n*dImQ4n*dReQ1n*dReQ2n | |
7479 | + dImQ2n*dImQ4n*dReQ1n*dReQ3n-dImQ1n*dImQ4n*dReQ2n*dReQ3n | |
7480 | - dImQ2n*dImQ3n*dReQ1n*dReQ4n+dImQ1n*dImQ3n*dReQ2n*dReQ4n | |
7481 | + dImQ1n*dImQ2n*dReQ3n*dReQ4n+dReQ1n*dReQ2n*dReQ3n*dReQ4n) | |
7482 | - ((pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n) | |
7483 | + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
7484 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7485 | + (dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n+dImQ5n*dImQ4n*dReQ1n) | |
7486 | + 4.*(dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n+dImQ5n*dImQ2n*dReQ3n) | |
7487 | + dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n) | |
7488 | + 3.*(pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
7489 | - 2.*(dMult-6.)*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
7490 | + 4.*(pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
7491 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7492 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7493 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7494 | - pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)+2.*(3.*dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7495 | + 2.*(dMult-6.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*dMult*(dMult-6.)) | |
7496 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7497 | five3n3n3n2n1n = ((pow(dImQ3n,2.)+pow(dReQ3n,2.))*(dImQ2n*dImQ3n*dReQ1n+dImQ1n*dImQ3n*dReQ2n | |
7498 | - dImQ1n*dImQ2n*dReQ3n+dReQ1n*dReQ2n*dReQ3n) | |
7499 | - (dReQ1n*dReQ2n*dReQ3n*dReQ6n-dReQ3n*dReQ6n*dImQ1n*dImQ2n | |
7500 | - dReQ2n*dReQ6n*dImQ1n*dImQ3n-dReQ1n*dReQ6n*dImQ2n*dImQ3n | |
7501 | + dReQ2n*dReQ3n*dImQ1n*dImQ6n+dReQ1n*dReQ3n*dImQ2n*dImQ6n | |
7502 | + dReQ1n*dReQ2n*dImQ3n*dImQ6n-dImQ1n*dImQ2n*dImQ3n*dImQ6n) | |
7503 | - (dImQ1n*pow(dImQ3n,2.)*dImQ5n+2.*dImQ3n*dImQ5n*dReQ1n*dReQ3n | |
7504 | - dImQ1n*dImQ5n*pow(dReQ3n,2.)-pow(dImQ3n,2.)*dReQ1n*dReQ5n | |
7505 | + 2.*dImQ1n*dImQ3n*dReQ3n*dReQ5n+dReQ1n*pow(dReQ3n,2.)*dReQ5n) | |
7506 | - ((dReQ4n*dReQ2n-dImQ4n*dImQ2n)*(dReQ3n*dReQ3n-dImQ3n*dImQ3n) | |
7507 | + 2.*(dReQ4n*dImQ2n+dImQ4n*dReQ2n)*dReQ3n*dImQ3n) | |
7508 | + dReQ6n*dReQ5n*dReQ1n-dReQ6n*dImQ5n*dImQ1n+dImQ6n*dReQ5n*dImQ1n+dImQ6n*dImQ5n*dReQ1n | |
7509 | + dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n | |
7510 | + 3.*(pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n) | |
7511 | + 4.*(dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n+dImQ5n*dImQ2n*dReQ3n) | |
7512 | + 4.*(dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
7513 | - 2.*(dMult-6.)*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
7514 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7515 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7516 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7517 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*(3.*dMult-10.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7518 | - pow((pow(dReQ3n,2.)+pow(dImQ3n,2.)),2.)+2.*(dMult-5.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7519 | + 2.*(dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*dMult*(dMult-6.)) | |
7520 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7521 | five4n1n3n1n1n = (reQ4nQ1nQ3nstarQ1nstarQ1nstar | |
7522 | - reQ4nQ1nQ3nstarQ2nstar | |
7523 | - reQ4nQ1nQ4nstarQ1nstar | |
7524 | - reQ4nQ2nstarQ1nstarQ1nstar | |
7525 | - reQ5nQ3nstarQ1nstarQ1nstar | |
7526 | - reQ3nQ1nQ3nstarQ1nstar | |
7527 | - dMult*reQ4nQ3nstarQ1nstar | |
7528 | + dMult*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7529 | + reQ5nQ4nstarQ1nstar | |
7530 | + 3.*reQ4nQ3nstarQ1nstar | |
7531 | + 2.*reQ5nQ4nstarQ1nstar | |
7532 | + reQ4nQ2nstarQ2nstar | |
7533 | + reQ5nQ3nstarQ2nstar | |
7534 | + dMult*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7535 | + dMult*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7536 | + reQ5nQ4nstarQ1nstar | |
7537 | + reQ3nQ2nstarQ1nstar | |
7538 | - (dMult-6.)*reQ4nQ3nstarQ1nstar | |
7539 | + 3.*reQ2nQ1nstarQ1nstar | |
7540 | + dMult*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7541 | + 2.*reQ3nQ2nstarQ1nstar | |
7542 | + 3.*reQ4nQ3nstarQ1nstar | |
7543 | + dMult*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7544 | + reQ3nQ2nstarQ1nstar | |
7545 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7546 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7547 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7548 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7549 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7550 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7551 | - 2.*dMult*dMult | |
7552 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7553 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7554 | + (dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7555 | + (dMult-8.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7556 | + (dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7557 | + 2.*(dMult-6.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-2.*dMult*(dMult-12.)) | |
7558 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7559 | five4n1n1n3n3n = // calculated by Peter Jochumzsen | |
7560 | (pow(dReQ1n*dReQ3n,2.)*dReQ4n-pow(dReQ3n*dImQ1n,2.)*dReQ4n | |
7561 | + 4.*dReQ1n*dReQ3n*dReQ4n*dImQ1n*dImQ3n | |
7562 | - pow(dReQ1n*dImQ3n,2.)*dReQ4n+pow(dImQ1n*dImQ3n,2.)*dReQ4n | |
7563 | - 2.*dReQ1n*pow(dReQ3n,2.)*dImQ1n*dImQ4n+2.*pow(dReQ1n,2.)*dReQ3n*dImQ3n*dImQ4n | |
7564 | - 2.*dReQ3n*pow(dImQ1n,2.)*dImQ3n*dImQ4n+2.*dReQ1n*dImQ1n*pow(dImQ3n,2.)*dImQ4n | |
7565 | + 6.*(pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
7566 | - 1.*(-pow(dImQ1n,2.)*dImQ4n*dImQ6n+dImQ4n*dImQ6n*pow(dReQ1n,2.) | |
7567 | + 2.*dImQ1n*dImQ6n*dReQ1n*dReQ4n-2.*dImQ1n*dImQ4n*dReQ1n*dReQ6n | |
7568 | - pow(dImQ1n,2.)*dReQ4n*dReQ6n+pow(dReQ1n,2.)*dReQ4n*dReQ6n) | |
7569 | - 1.*((dReQ4n*dReQ2n-dImQ4n*dImQ2n)*(dReQ3n*dReQ3n-dImQ3n*dImQ3n) | |
7570 | + 2.*(dReQ4n*dImQ2n+dImQ4n*dReQ2n)*dReQ3n*dImQ3n) | |
7571 | + 1.*(dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n) | |
7572 | - 2.*(dImQ1n*pow(dImQ3n,2.)*dImQ5n+2.*dImQ3n*dImQ5n*dReQ1n*dReQ3n | |
7573 | - dImQ1n*dImQ5n*pow(dReQ3n,2.)-pow(dImQ3n,2.)*dReQ1n*dReQ5n | |
7574 | + 2.*dImQ1n*dImQ3n*dReQ3n*dReQ5n+dReQ1n*pow(dReQ3n,2.)*dReQ5n) | |
7575 | + 2.*(pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
7576 | + 4.*(dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
7577 | - 2.*(dReQ3n*pow(dReQ1n,3.)-3.*dReQ1n*dReQ3n*pow(dImQ1n,2.) | |
7578 | + 3.*dImQ1n*dImQ3n*pow(dReQ1n,2.)-dImQ3n*pow(dImQ1n,3.)) | |
7579 | + 10.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
7580 | + 2.*(dReQ6n*dReQ5n*dReQ1n-dReQ6n*dImQ5n*dImQ1n+dImQ6n*dReQ5n*dImQ1n+dImQ6n*dImQ5n*dReQ1n) | |
7581 | + 2.*(pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n) | |
7582 | - 4.*(dImQ1n*dImQ2n*dImQ3n*dImQ4n+dImQ3n*dImQ4n*dReQ1n*dReQ2n | |
7583 | + dImQ2n*dImQ4n*dReQ1n*dReQ3n-dImQ1n*dImQ4n*dReQ2n*dReQ3n | |
7584 | - dImQ2n*dImQ3n*dReQ1n*dReQ4n+dImQ1n*dImQ3n*dReQ2n*dReQ4n | |
7585 | + dImQ1n*dImQ2n*dReQ3n*dReQ4n+dReQ1n*dReQ2n*dReQ3n*dReQ4n) | |
7586 | + 4.*(dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n+dImQ5n*dImQ4n*dReQ1n) | |
7587 | + 4.*(dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n+dImQ5n*dImQ2n*dReQ3n) | |
7588 | - 16.*pow(dReQ1n,2.)-16.*pow(dImQ1n,2.) | |
7589 | - 10.*pow(dReQ2n,2.)-10.*pow(dImQ2n,2.)-12.*pow(dReQ3n,2.)-12.*pow(dImQ3n,2.) | |
7590 | - 6.*pow(dReQ4n,2.)-6.*pow(dImQ4n,2.)-4.*pow(dReQ5n,2.)-4.*pow(dImQ5n,2.) | |
7591 | - 2.*pow(dReQ6n,2.)-2.*pow(dImQ6n,2.)+24.*dMult) | |
7592 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7593 | // to be polished: | |
7594 | five4n3n3n3n1n = (reQ4nQ3nQ3nstarQ3nstarQ1nstar | |
7595 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7596 | - reQ6nQ1nQ4nstarQ3nstar | |
7597 | - dMult*reQ4nQ3nstarQ1nstar | |
7598 | - reQ7nQ3nstarQ3nstarQ1nstar | |
7599 | - reQ3nQ1nQ3nstarQ1nstar | |
7600 | - reQ4nQ2nQ3nstarQ3nstar | |
7601 | + reQ3nQ2nstarQ1nstar | |
7602 | + reQ7nQ4nstarQ3nstar | |
7603 | + 3.*reQ4nQ3nstarQ1nstar | |
7604 | + 2.*reQ7nQ4nstarQ3nstar | |
7605 | + dMult*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7606 | + reQ7nQ4nstarQ3nstar | |
7607 | + reQ6nQ4nstarQ2nstar | |
7608 | + reQ3nQ2nstarQ1nstar | |
7609 | + reQ7nQ6nstarQ1nstar | |
7610 | + dMult*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7611 | - (dMult-6.)*reQ4nQ3nstarQ1nstar | |
7612 | + 3.*reQ4nQ3nstarQ1nstar | |
7613 | + reQ3nQ2nstarQ1nstar | |
7614 | + 2.*dMult*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7615 | + 3.*reQ6nQ3nstarQ3nstar | |
7616 | + reQ3nQ2nstarQ1nstar | |
7617 | + dMult*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7618 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7619 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7620 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7621 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
7622 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7623 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7624 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7625 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
7626 | - 2.*dMult*dMult | |
7627 | + (dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7628 | + (dMult-8.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7629 | + (dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7630 | + 2.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))-2.*dMult*(dMult-12.)) | |
7631 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7632 | ||
7633 | // to be polished: | |
7634 | five4n4n3n3n2n = (reQ4nQ4nQ3nstarQ3nstarQ2nstar | |
7635 | - reQ5nQ3nQ4nstarQ4nstar-reQ5nQ3nQ4nstarQ4nstar-reQ6nQ2nQ4nstarQ4nstar | |
7636 | - reQ4nQ1nQ3nstarQ2nstar-reQ4nQ1nQ3nstarQ2nstar-reQ4nQ2nQ3nstarQ3nstar | |
7637 | - reQ8nQ3nstarQ3nstarQ2nstar-reQ4nQ2nQ3nstarQ3nstar-reQ4nQ1nQ3nstarQ2nstar-reQ4nQ1nQ3nstarQ2nstar | |
7638 | + 2.*(reQ4nQ3nstarQ1nstar+reQ4nQ2nstarQ2nstar+reQ4nQ3nstarQ1nstar+reQ8nQ4nstarQ4nstar) | |
7639 | + reQ5nQ4nstarQ1nstar+reQ5nQ4nstarQ1nstar+reQ6nQ4nstarQ2nstar | |
7640 | + reQ8nQ6nstarQ2nstar+reQ8nQ5nstarQ3nstar+reQ8nQ5nstarQ3nstar | |
7641 | + reQ5nQ4nstarQ1nstar+reQ2nQ1nstarQ1nstar+reQ3nQ2nstarQ1nstar | |
7642 | + reQ5nQ4nstarQ1nstar+reQ2nQ1nstarQ1nstar+reQ3nQ2nstarQ1nstar | |
7643 | + reQ6nQ4nstarQ2nstar+reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar | |
7644 | + 2.*(reQ6nQ3nstarQ3nstar+reQ5nQ3nstarQ2nstar+reQ5nQ3nstarQ2nstar) | |
7645 | + 2.*(reQ4nQ3nstarQ1nstar+reQ4nQ3nstarQ1nstar+reQ4nQ2nstarQ2nstar) | |
7646 | - 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7647 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7648 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
7649 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7650 | - 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7651 | + 24.*dMult) | |
7652 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7653 | ||
7654 | /* | |
7655 | // correct recursive formula, not needed for the time being. | |
7656 | five4n4n3n3n2n = (reQ4nQ4nQ3nstarQ3nstarQ2nstar | |
7657 | - dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) | |
7658 | * (2.*four4n2n3n3n+4.*four4n1n3n2n+1.*four8n3n3n2n+1.*four6n2n4n4n+2.*four5n3n4n4n) | |
7659 | - dMult*(dMult-1.)*(dMult-2.) | |
7660 | * (4.*three4n3n1n+2.*three4n2n2n+2.*three5n3n2n+1.*three6n3n3n+1.*three8n4n4n | |
7661 | + 4.*three3n2n1n+2.*three2n1n1n+1.*three8n6n2n+2.*three8n5n3n+2.*three6n4n2n+4.*three5n4n1n) | |
7662 | - dMult*(dMult-1.) | |
7663 | * (1.*two2n2n+2.*two3n3n+2.*two4n4n+2.*two5n5n+1.*two6n6n+4.*two1n1n+2.*two2n2n+1.*two8n8n) | |
7664 | - dMult) | |
7665 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7666 | */ | |
7667 | ||
7668 | // to be polished: | |
7669 | five4n4n4n3n1n = (reQ4nQ4nQ4nstarQ3nstarQ1nstar | |
7670 | - reQ5nQ3nQ4nstarQ4nstar | |
7671 | - reQ7nQ1nQ4nstarQ4nstar | |
7672 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7673 | - reQ8nQ4nstarQ3nstarQ1nstar | |
7674 | - dMult*reQ4nQ3nstarQ1nstar | |
7675 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7676 | + reQ4nQ3nstarQ1nstar | |
7677 | + reQ8nQ4nstarQ4nstar | |
7678 | + 3.*dMult*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7679 | + 2.*reQ8nQ4nstarQ4nstar | |
7680 | + reQ5nQ4nstarQ1nstar | |
7681 | + reQ8nQ5nstarQ3nstar | |
7682 | + reQ7nQ4nstarQ3nstar | |
7683 | + reQ4nQ3nstarQ1nstar | |
7684 | + reQ8nQ7nstarQ1nstar | |
7685 | + dMult*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7686 | - (dMult-6.)*reQ4nQ3nstarQ1nstar | |
7687 | + 3.*reQ5nQ4nstarQ1nstar | |
7688 | + reQ4nQ3nstarQ1nstar | |
7689 | + 2.*reQ4nQ3nstarQ1nstar | |
7690 | + 3.*reQ7nQ4nstarQ3nstar | |
7691 | + dMult*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7692 | + reQ4nQ3nstarQ1nstar | |
7693 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7694 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7695 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7696 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)) | |
7697 | - 2.*dMult*dMult | |
7698 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7699 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7700 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
7701 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7702 | + (dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7703 | + (dMult-8.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7704 | + (dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7705 | + 2.*(dMult-6.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*dMult*(dMult-12.)) | |
7706 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7707 | // to be polished: | |
7708 | five5n2n1n1n1n = (reQ5nQ2nstarQ1nstarQ1nstarQ1nstar | |
7709 | - reQ5nQ2nstarQ2nstarQ1nstar-reQ5nQ2nstarQ2nstarQ1nstar-reQ5nQ2nstarQ2nstarQ1nstar | |
7710 | - reQ5nQ3nstarQ1nstarQ1nstar-reQ5nQ3nstarQ1nstarQ1nstar-reQ5nQ3nstarQ1nstarQ1nstar | |
7711 | - reQ3nQ1nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar | |
7712 | + 2.*(reQ5nQ4nstarQ1nstar+reQ5nQ4nstarQ1nstar+reQ5nQ4nstarQ1nstar+reQ5nQ3nstarQ2nstar) | |
7713 | + reQ5nQ3nstarQ2nstar+reQ5nQ3nstarQ2nstar+reQ5nQ3nstarQ2nstar | |
7714 | + reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar | |
7715 | + reQ4nQ2nstarQ2nstar+reQ4nQ3nstarQ1nstar+reQ4nQ3nstarQ1nstar | |
7716 | + reQ4nQ2nstarQ2nstar+reQ4nQ3nstarQ1nstar+reQ4nQ3nstarQ1nstar | |
7717 | + reQ4nQ2nstarQ2nstar+reQ4nQ3nstarQ1nstar+reQ4nQ3nstarQ1nstar | |
7718 | + 2.*(reQ2nQ1nstarQ1nstar+reQ2nQ1nstarQ1nstar+reQ2nQ1nstarQ1nstar) | |
7719 | + 2.*(reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar) | |
7720 | - 6.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7721 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7722 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7723 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7724 | - 6.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7725 | + 24.*dMult) | |
7726 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7727 | // to be polished: | |
7728 | five5n1n2n2n2n = (reQ5nQ1nQ2nstarQ2nstarQ2nstar | |
7729 | - reQ5nQ1nQ4nstarQ2nstar-reQ5nQ1nQ4nstarQ2nstar-reQ5nQ1nQ4nstarQ2nstar | |
7730 | - reQ5nQ2nstarQ2nstarQ1nstar-reQ5nQ2nstarQ2nstarQ1nstar-reQ5nQ2nstarQ2nstarQ1nstar | |
7731 | - reQ6nQ2nstarQ2nstarQ2nstar-reQ3nQ1nQ2nstarQ2nstar-reQ3nQ1nQ2nstarQ2nstar-reQ3nQ1nQ2nstarQ2nstar | |
7732 | + 2.*(reQ5nQ3nstarQ2nstar+reQ5nQ3nstarQ2nstar+reQ5nQ3nstarQ2nstar+reQ6nQ5nstarQ1nstar) | |
7733 | + reQ5nQ4nstarQ1nstar+reQ5nQ4nstarQ1nstar+reQ5nQ4nstarQ1nstar | |
7734 | + reQ6nQ4nstarQ2nstar+reQ6nQ4nstarQ2nstar+reQ6nQ4nstarQ2nstar | |
7735 | + reQ4nQ3nstarQ1nstar+reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar | |
7736 | + reQ4nQ3nstarQ1nstar+reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar | |
7737 | + reQ4nQ3nstarQ1nstar+reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar | |
7738 | + 2.*(reQ4nQ2nstarQ2nstar+reQ4nQ2nstarQ2nstar+reQ4nQ2nstarQ2nstar) | |
7739 | + 2.*(reQ2nQ1nstarQ1nstar+reQ2nQ1nstarQ1nstar+reQ2nQ1nstarQ1nstar) | |
7740 | - 6.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7741 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7742 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7743 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7744 | - 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7745 | + 24.*dMult) | |
7746 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7747 | // to be polished: | |
7748 | five5n2n3n2n2n = (reQ5nQ2nQ3nstarQ2nstarQ2nstar | |
7749 | - reQ5nQ2nQ4nstarQ3nstar | |
7750 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7751 | - reQ5nQ2nstarQ2nstarQ1nstar | |
7752 | - reQ7nQ3nstarQ2nstarQ2nstar | |
7753 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7754 | - dMult*reQ5nQ3nstarQ2nstar | |
7755 | + dMult*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7756 | + reQ7nQ5nstarQ2nstar | |
7757 | + 3.*reQ5nQ3nstarQ2nstar | |
7758 | + 2.*reQ7nQ5nstarQ2nstar | |
7759 | + reQ5nQ4nstarQ1nstar | |
7760 | + reQ7nQ4nstarQ3nstar | |
7761 | + dMult*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7762 | + dMult*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7763 | + reQ7nQ5nstarQ2nstar | |
7764 | + reQ3nQ2nstarQ1nstar | |
7765 | - (dMult-6.)*reQ5nQ3nstarQ2nstar | |
7766 | + 3.*reQ4nQ2nstarQ2nstar | |
7767 | + dMult*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7768 | + 2.*reQ3nQ2nstarQ1nstar | |
7769 | + 3.*reQ5nQ3nstarQ2nstar | |
7770 | + dMult*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7771 | + reQ3nQ2nstarQ1nstar | |
7772 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7773 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7774 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7775 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
7776 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7777 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7778 | - 2.*dMult*dMult | |
7779 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7780 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7781 | + (dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7782 | + (dMult-8.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7783 | + (dMult-8.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7784 | + 2.*(dMult-6.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-2.*dMult*(dMult-12.)) | |
7785 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7786 | // to be polished: | |
7787 | five5n3n3n3n2n = (reQ5nQ3nQ3nstarQ3nstarQ2nstar | |
7788 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7789 | - reQ6nQ2nQ5nstarQ3nstar | |
7790 | - dMult*reQ5nQ3nstarQ2nstar | |
7791 | - reQ8nQ3nstarQ3nstarQ2nstar | |
7792 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7793 | - reQ5nQ1nQ3nstarQ3nstar | |
7794 | + reQ3nQ2nstarQ1nstar | |
7795 | + reQ8nQ5nstarQ3nstar | |
7796 | + 3.*reQ5nQ3nstarQ2nstar | |
7797 | + 2.*reQ8nQ5nstarQ3nstar | |
7798 | + dMult*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7799 | + reQ8nQ5nstarQ3nstar | |
7800 | + reQ6nQ5nstarQ1nstar | |
7801 | + reQ3nQ2nstarQ1nstar | |
7802 | + reQ8nQ6nstarQ2nstar | |
7803 | + dMult*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7804 | - (dMult-6.)*reQ5nQ3nstarQ2nstar | |
7805 | + 3.*reQ5nQ3nstarQ2nstar | |
7806 | + reQ3nQ2nstarQ1nstar | |
7807 | + 2.*dMult*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7808 | + 3.*reQ6nQ3nstarQ3nstar | |
7809 | + reQ3nQ2nstarQ1nstar | |
7810 | + dMult*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7811 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7812 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7813 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7814 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)) | |
7815 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7816 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7817 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7818 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
7819 | - 2.*dMult*dMult | |
7820 | + (dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7821 | + (dMult-8.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7822 | + (dMult-8.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7823 | + 2.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))-2.*dMult*(dMult-12.)) | |
7824 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7825 | // to be polished: | |
7826 | five5n1n4n1n1n = (reQ5nQ1nQ4nstarQ1nstarQ1nstar | |
7827 | - reQ5nQ1nQ4nstarQ2nstar | |
7828 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7829 | - reQ5nQ3nstarQ1nstarQ1nstar | |
7830 | - reQ6nQ4nstarQ1nstarQ1nstar | |
7831 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7832 | - dMult*reQ5nQ4nstarQ1nstar | |
7833 | + dMult*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7834 | + reQ6nQ5nstarQ1nstar | |
7835 | + 3.*reQ5nQ4nstarQ1nstar | |
7836 | + 2.*reQ6nQ5nstarQ1nstar | |
7837 | + reQ5nQ3nstarQ2nstar | |
7838 | + reQ6nQ4nstarQ2nstar | |
7839 | + dMult*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7840 | + dMult*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7841 | + reQ6nQ5nstarQ1nstar | |
7842 | + reQ4nQ3nstarQ1nstar | |
7843 | - (dMult-6.)*reQ5nQ4nstarQ1nstar | |
7844 | + 3.*reQ2nQ1nstarQ1nstar | |
7845 | + dMult*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7846 | + 2.*reQ4nQ3nstarQ1nstar | |
7847 | + 3.*reQ5nQ4nstarQ1nstar | |
7848 | + dMult*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7849 | + reQ4nQ3nstarQ1nstar | |
7850 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7851 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7852 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7853 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
7854 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7855 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7856 | - 2.*dMult*dMult | |
7857 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7858 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7859 | + (dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7860 | + (dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7861 | + (dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7862 | + 2.*(dMult-6.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-2.*dMult*(dMult-12.)) | |
7863 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7864 | // to be polished: | |
7865 | five5n4n3n3n3n = (reQ5nQ4nQ3nstarQ3nstarQ3nstar | |
7866 | - reQ6nQ3nQ5nstarQ4nstar-reQ6nQ3nQ5nstarQ4nstar-reQ6nQ3nQ5nstarQ4nstar | |
7867 | - reQ5nQ1nQ3nstarQ3nstar-reQ5nQ1nQ3nstarQ3nstar-reQ5nQ1nQ3nstarQ3nstar | |
7868 | - reQ9nQ3nstarQ3nstarQ3nstar-reQ4nQ2nQ3nstarQ3nstar-reQ4nQ2nQ3nstarQ3nstar-reQ4nQ2nQ3nstarQ3nstar | |
7869 | + 2.*(reQ5nQ3nstarQ2nstar+reQ5nQ3nstarQ2nstar+reQ5nQ3nstarQ2nstar+reQ9nQ5nstarQ4nstar) | |
7870 | + reQ6nQ5nstarQ1nstar+reQ6nQ5nstarQ1nstar+reQ6nQ5nstarQ1nstar | |
7871 | + reQ9nQ6nstarQ3nstar+reQ9nQ6nstarQ3nstar+reQ9nQ6nstarQ3nstar | |
7872 | + reQ6nQ4nstarQ2nstar+reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar | |
7873 | + reQ6nQ4nstarQ2nstar+reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar | |
7874 | + reQ6nQ4nstarQ2nstar+reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar | |
7875 | + 2.*(reQ6nQ3nstarQ3nstar+reQ6nQ3nstarQ3nstar+reQ6nQ3nstarQ3nstar) | |
7876 | + 2.*(reQ4nQ3nstarQ1nstar+reQ4nQ3nstarQ1nstar+reQ4nQ3nstarQ1nstar) | |
7877 | - 6.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7878 | - 2.*(pow(dReQ9n,2.)+pow(dImQ9n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7879 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)+pow(dReQ6n,2.)+pow(dImQ6n,2.)+pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
7880 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7881 | - 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7882 | + 24.*dMult) | |
7883 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7884 | // to be polished: | |
7885 | five5n4n4n4n1n = (reQ5nQ4nQ4nstarQ4nstarQ1nstar | |
7886 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7887 | - reQ8nQ1nQ5nstarQ4nstar | |
7888 | - dMult*reQ5nQ4nstarQ1nstar | |
7889 | - reQ9nQ4nstarQ4nstarQ1nstar | |
7890 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7891 | - reQ5nQ3nQ4nstarQ4nstar | |
7892 | + reQ4nQ3nstarQ1nstar | |
7893 | + reQ9nQ5nstarQ4nstar | |
7894 | + 3.*reQ5nQ4nstarQ1nstar | |
7895 | + 2.*reQ9nQ5nstarQ4nstar | |
7896 | + dMult*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7897 | + reQ9nQ5nstarQ4nstar | |
7898 | + reQ8nQ5nstarQ3nstar | |
7899 | + reQ4nQ3nstarQ1nstar | |
7900 | + reQ9nQ8nstarQ1nstar | |
7901 | + dMult*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7902 | - (dMult-6.)*reQ5nQ4nstarQ1nstar | |
7903 | + 3.*reQ5nQ4nstarQ1nstar | |
7904 | + reQ4nQ3nstarQ1nstar | |
7905 | + 2.*dMult*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7906 | + 3.*reQ8nQ4nstarQ4nstar | |
7907 | + reQ4nQ3nstarQ1nstar | |
7908 | + dMult*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7909 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7910 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7911 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7912 | - 2.*(pow(dReQ9n,2.)+pow(dImQ9n,2.)) | |
7913 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7914 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7915 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7916 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)) | |
7917 | - 2.*dMult*dMult | |
7918 | + (dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7919 | + (dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
7920 | + (dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7921 | + 2.*(dMult-6.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*dMult*(dMult-12.)) | |
7922 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7923 | // to be polished: | |
7924 | five5n5n4n3n3n = (reQ5nQ5nQ4nstarQ3nstarQ3nstar | |
7925 | - reQ6nQ4nQ5nstarQ5nstar-reQ7nQ3nQ5nstarQ5nstar-reQ7nQ3nQ5nstarQ5nstar | |
7926 | - reQ5nQ2nQ4nstarQ3nstar-reQ5nQ1nQ3nstarQ3nstar-reQ5nQ2nQ4nstarQ3nstar | |
7927 | - reQ10nQ4nstarQ3nstarQ3nstar-reQ5nQ2nQ4nstarQ3nstar-reQ5nQ1nQ3nstarQ3nstar-reQ5nQ2nQ4nstarQ3nstar | |
7928 | + 2.*(reQ5nQ4nstarQ1nstar+reQ5nQ3nstarQ2nstar+reQ5nQ3nstarQ2nstar+reQ10nQ5nstarQ5nstar) | |
7929 | + reQ6nQ5nstarQ1nstar+reQ7nQ5nstarQ2nstar+reQ7nQ5nstarQ2nstar | |
7930 | + reQ10nQ7nstarQ3nstar+reQ10nQ6nstarQ4nstar+reQ10nQ7nstarQ3nstar | |
7931 | + reQ6nQ5nstarQ1nstar+reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar | |
7932 | + reQ7nQ5nstarQ2nstar+reQ3nQ2nstarQ1nstar+reQ4nQ2nstarQ2nstar | |
7933 | + reQ7nQ5nstarQ2nstar+reQ3nQ2nstarQ1nstar+reQ4nQ2nstarQ2nstar | |
7934 | + 2.*(reQ7nQ4nstarQ3nstar+reQ7nQ4nstarQ3nstar+reQ6nQ3nstarQ3nstar) | |
7935 | + 2.*(reQ5nQ4nstarQ1nstar+reQ5nQ3nstarQ2nstar+reQ5nQ3nstarQ2nstar) | |
7936 | - 6.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7937 | - 2.*(pow(dReQ10n,2.)+pow(dImQ10n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7938 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)+pow(dReQ7n,2.)+pow(dImQ7n,2.)+pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
7939 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7940 | - 6.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7941 | + 24.*dMult) | |
7942 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7943 | // to be polished: | |
7944 | five5n5n4n4n2n = (reQ5nQ5nQ4nstarQ4nstarQ2nstar | |
7945 | - reQ6nQ4nQ5nstarQ5nstar-reQ6nQ4nQ5nstarQ5nstar-reQ8nQ2nQ5nstarQ5nstar | |
7946 | - reQ5nQ1nQ4nstarQ2nstar-reQ5nQ1nQ4nstarQ2nstar-reQ5nQ3nQ4nstarQ4nstar | |
7947 | - reQ10nQ4nstarQ4nstarQ2nstar-reQ5nQ3nQ4nstarQ4nstar-reQ5nQ1nQ4nstarQ2nstar-reQ5nQ1nQ4nstarQ2nstar | |
7948 | + 2.*(reQ5nQ4nstarQ1nstar+reQ5nQ3nstarQ2nstar+reQ5nQ4nstarQ1nstar+reQ10nQ5nstarQ5nstar) | |
7949 | + reQ6nQ5nstarQ1nstar+reQ6nQ5nstarQ1nstar+reQ8nQ5nstarQ3nstar | |
7950 | + reQ10nQ8nstarQ2nstar+reQ10nQ6nstarQ4nstar+reQ10nQ6nstarQ4nstar | |
7951 | + reQ6nQ5nstarQ1nstar+reQ2nQ1nstarQ1nstar+reQ4nQ3nstarQ1nstar | |
7952 | + reQ6nQ5nstarQ1nstar+reQ2nQ1nstarQ1nstar+reQ4nQ3nstarQ1nstar | |
7953 | + reQ8nQ5nstarQ3nstar+reQ4nQ3nstarQ1nstar+reQ4nQ3nstarQ1nstar | |
7954 | + 2.*(reQ8nQ4nstarQ4nstar+reQ6nQ4nstarQ2nstar+reQ6nQ4nstarQ2nstar) | |
7955 | + 2.*(reQ5nQ4nstarQ1nstar+reQ5nQ4nstarQ1nstar+reQ5nQ3nstarQ2nstar) | |
7956 | - 6.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7957 | - 2.*(pow(dReQ10n,2.)+pow(dImQ10n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7958 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)+pow(dReQ6n,2.)+pow(dImQ6n,2.)+pow(dReQ8n,2.)+pow(dImQ8n,2.)) | |
7959 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
7960 | - 6.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7961 | + 24.*dMult) | |
7962 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
7963 | // to be polished: | |
7964 | five5n5n5n3n2n = (reQ5nQ5nQ5nstarQ3nstarQ2nstar | |
7965 | - reQ7nQ3nQ5nstarQ5nstar | |
7966 | - reQ8nQ2nQ5nstarQ5nstar | |
7967 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7968 | - reQ10nQ5nstarQ3nstarQ2nstar | |
7969 | - dMult*reQ5nQ3nstarQ2nstar | |
7970 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7971 | + reQ5nQ3nstarQ2nstar | |
7972 | + reQ10nQ5nstarQ5nstar | |
7973 | + 3.*dMult*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7974 | + 2.*reQ10nQ5nstarQ5nstar | |
7975 | + reQ7nQ5nstarQ2nstar | |
7976 | + reQ10nQ7nstarQ3nstar | |
7977 | + reQ8nQ5nstarQ3nstar | |
7978 | + reQ5nQ3nstarQ2nstar | |
7979 | + reQ10nQ8nstarQ2nstar | |
7980 | + dMult*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7981 | - (dMult-6.)*reQ5nQ3nstarQ2nstar | |
7982 | + 3.*reQ7nQ5nstarQ2nstar | |
7983 | + reQ5nQ3nstarQ2nstar | |
7984 | + 2.*reQ5nQ3nstarQ2nstar | |
7985 | + 3.*reQ8nQ5nstarQ3nstar | |
7986 | + dMult*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7987 | + reQ5nQ3nstarQ2nstar | |
7988 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7989 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7990 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7991 | - 2.*(pow(dReQ10n,2.)+pow(dImQ10n,2.)) | |
7992 | - 2.*dMult*dMult | |
7993 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
7994 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7995 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)) | |
7996 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
7997 | + (dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
7998 | + (dMult-8.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
7999 | + (dMult-8.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8000 | + 2.*(dMult-6.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.))-2.*dMult*(dMult-12.)) | |
8001 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8002 | // to be polished: | |
8003 | five5n5n5n4n1n = (reQ5nQ5nQ5nstarQ4nstarQ1nstar | |
8004 | - reQ6nQ4nQ5nstarQ5nstar | |
8005 | - reQ9nQ1nQ5nstarQ5nstar | |
8006 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8007 | - reQ10nQ5nstarQ4nstarQ1nstar | |
8008 | - dMult*reQ5nQ4nstarQ1nstar | |
8009 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
8010 | + reQ5nQ4nstarQ1nstar | |
8011 | + reQ10nQ5nstarQ5nstar | |
8012 | + 3.*dMult*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8013 | + 2.*reQ10nQ5nstarQ5nstar | |
8014 | + reQ6nQ5nstarQ1nstar | |
8015 | + reQ10nQ6nstarQ4nstar | |
8016 | + reQ9nQ5nstarQ4nstar | |
8017 | + reQ5nQ4nstarQ1nstar | |
8018 | + reQ10nQ9nstarQ1nstar | |
8019 | + dMult*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8020 | - (dMult-6.)*reQ5nQ4nstarQ1nstar | |
8021 | + 3.*reQ6nQ5nstarQ1nstar | |
8022 | + reQ5nQ4nstarQ1nstar | |
8023 | + 2.*reQ5nQ4nstarQ1nstar | |
8024 | + 3.*reQ9nQ5nstarQ4nstar | |
8025 | + dMult*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
8026 | + reQ5nQ4nstarQ1nstar | |
8027 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8028 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8029 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
8030 | - 2.*(pow(dReQ10n,2.)+pow(dImQ10n,2.)) | |
8031 | - 2.*dMult*dMult | |
8032 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8033 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
8034 | - 2.*(pow(dReQ9n,2.)+pow(dImQ9n,2.)) | |
8035 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8036 | + (dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8037 | + (dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
8038 | + (dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8039 | + 2.*(dMult-6.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.))-2.*dMult*(dMult-12.)) | |
8040 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8041 | five6n2n2n1n1n = // calculated by Peter Jochumzsen | |
8042 | (pow(dReQ1n*dReQ2n,2.)*dReQ6n-pow(dReQ2n*dImQ1n,2.)*dReQ6n | |
8043 | - 4.*dReQ1n*dReQ2n*dReQ6n*dImQ1n*dImQ2n | |
8044 | - pow(dReQ1n*dImQ2n,2.)*dReQ6n+pow(dImQ1n*dImQ2n,2.)*dReQ6n | |
8045 | + 2.*dReQ1n*pow(dReQ2n,2.)*dImQ1n*dImQ6n+2.*pow(dReQ1n,2.)*dReQ2n*dImQ2n*dImQ6n | |
8046 | - 2.*dReQ2n*pow(dImQ1n,2.)*dImQ2n*dImQ6n-2.*dReQ1n*dImQ1n*pow(dImQ2n,2.)*dImQ6n | |
8047 | + 2.*(pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n) | |
8048 | + 8.*(dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n+dImQ3n*dImQ2n*dReQ1n) | |
8049 | + 5.*(dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n) | |
8050 | - (-pow(dImQ1n,2.)*dImQ4n*dImQ6n+dImQ4n*dImQ6n*pow(dReQ1n,2.) | |
8051 | + 2.*dImQ1n*dImQ6n*dReQ1n*dReQ4n-2.*dImQ1n*dImQ4n*dReQ1n*dReQ6n | |
8052 | - pow(dImQ1n,2.)*dReQ4n*dReQ6n+pow(dReQ1n,2.)*dReQ4n*dReQ6n) | |
8053 | + 2.*(pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n) | |
8054 | - (dReQ6n*pow(dReQ2n,3.)-3.*dReQ2n*dReQ6n*pow(dImQ2n,2.) | |
8055 | + 3.*dImQ2n*dImQ6n*pow(dReQ2n,2.)-dImQ6n*pow(dImQ2n,3.)) | |
8056 | + 4.*(pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
8057 | - 2.*((dReQ4n*dReQ2n+dImQ4n*dImQ2n)*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) | |
8058 | + 2.*dReQ1n*dImQ1n*(dImQ4n*dReQ2n-dReQ4n*dImQ2n)) | |
8059 | + 2.*(dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n+dImQ5n*dImQ4n*dReQ1n) | |
8060 | - 2.*(-pow(dImQ2n,2.)*dImQ1n*dImQ5n+dImQ1n*dImQ5n*pow(dReQ2n,2.) | |
8061 | + 2.*dImQ2n*dImQ5n*dReQ2n*dReQ1n-2.*dImQ2n*dImQ1n*dReQ2n*dReQ5n | |
8062 | - pow(dImQ2n,2.)*dReQ1n*dReQ5n+pow(dReQ2n,2.)*dReQ1n*dReQ5n) | |
8063 | + 4.*(dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n)) | |
8064 | + 4.*(dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n+dImQ5n*dImQ2n*dReQ3n) | |
8065 | + 4.*(dReQ6n*dReQ5n*dReQ1n-dReQ6n*dImQ5n*dImQ1n+dImQ6n*dReQ5n*dImQ1n+dImQ6n*dImQ5n*dReQ1n) | |
8066 | - 4.*(dReQ1n*dReQ2n*dReQ3n*dReQ6n-dReQ3n*dReQ6n*dImQ1n*dImQ2n | |
8067 | - dReQ2n*dReQ6n*dImQ1n*dImQ3n-dReQ1n*dReQ6n*dImQ2n*dImQ3n | |
8068 | + dReQ2n*dReQ3n*dImQ1n*dImQ6n+dReQ1n*dReQ3n*dImQ2n*dImQ6n | |
8069 | + dReQ1n*dReQ2n*dImQ3n*dImQ6n-dImQ1n*dImQ2n*dImQ3n*dImQ6n) | |
8070 | - 12.*pow(dReQ1n,2.)-12.*pow(dImQ1n,2.)-14.*pow(dReQ2n,2.)-14.*pow(dImQ2n,2.) | |
8071 | - 8.*pow(dReQ3n,2.)-8.*pow(dImQ3n,2.)-6.*pow(dReQ4n,2.)-6.*pow(dImQ4n,2.) | |
8072 | - 4.*pow(dReQ5n,2.)-4.*pow(dImQ5n,2.)-6.*pow(dReQ6n,2.)-6.*pow(dImQ6n,2.)+24.*dMult) | |
8073 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8074 | // to be polished: | |
8075 | five6n3n1n1n1n = (reQ6nQ3nstarQ1nstarQ1nstarQ1nstar | |
8076 | - reQ6nQ3nstarQ2nstarQ1nstar-reQ6nQ3nstarQ2nstarQ1nstar-reQ6nQ3nstarQ2nstarQ1nstar | |
8077 | - reQ6nQ4nstarQ1nstarQ1nstar-reQ6nQ4nstarQ1nstarQ1nstar-reQ6nQ4nstarQ1nstarQ1nstar | |
8078 | - reQ3nQ1nstarQ1nstarQ1nstar-reQ5nQ3nstarQ1nstarQ1nstar-reQ5nQ3nstarQ1nstarQ1nstar-reQ5nQ3nstarQ1nstarQ1nstar | |
8079 | + 2.*(reQ6nQ5nstarQ1nstar+reQ6nQ5nstarQ1nstar+reQ6nQ5nstarQ1nstar+reQ6nQ3nstarQ3nstar) | |
8080 | + reQ6nQ4nstarQ2nstar+reQ6nQ4nstarQ2nstar+reQ6nQ4nstarQ2nstar | |
8081 | + reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar | |
8082 | + reQ5nQ3nstarQ2nstar+reQ5nQ4nstarQ1nstar+reQ5nQ4nstarQ1nstar | |
8083 | + reQ5nQ3nstarQ2nstar+reQ5nQ4nstarQ1nstar+reQ5nQ4nstarQ1nstar | |
8084 | + reQ5nQ3nstarQ2nstar+reQ5nQ4nstarQ1nstar+reQ5nQ4nstarQ1nstar | |
8085 | + 2.*(reQ2nQ1nstarQ1nstar+reQ2nQ1nstarQ1nstar+reQ2nQ1nstarQ1nstar) | |
8086 | + 2.*(reQ4nQ3nstarQ1nstar+reQ4nQ3nstarQ1nstar+reQ4nQ3nstarQ1nstar) | |
8087 | - 6.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8088 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8089 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8090 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
8091 | - 6.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8092 | + 24.*dMult) | |
53884472 | 8093 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
e1d101a6 | 8094 | |
8095 | ||
8096 | // to be polished: | |
8097 | five6n1n1n4n4n = (reQ6nQ1nQ1nQ4nstarQ4nstar | |
8098 | - reQ6nQ2nQ4nstarQ4nstar-reQ7nQ1nQ4nstarQ4nstar-reQ7nQ1nQ4nstarQ4nstar | |
8099 | - reQ6nQ1nQ4nstarQ3nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ6nQ1nQ4nstarQ3nstar | |
8100 | - reQ8nQ6nstarQ1nstarQ1nstar-reQ6nQ1nQ4nstarQ3nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ6nQ1nQ4nstarQ3nstar | |
8101 | + 2.*(reQ6nQ4nstarQ2nstar+reQ4nQ3nstarQ1nstar+reQ4nQ3nstarQ1nstar+reQ8nQ4nstarQ4nstar) | |
8102 | + reQ4nQ2nstarQ2nstar+reQ7nQ4nstarQ3nstar+reQ7nQ4nstarQ3nstar // ?? 1st term | |
8103 | + reQ8nQ7nstarQ1nstar+reQ8nQ6nstarQ2nstar+reQ8nQ7nstarQ1nstar | |
8104 | + reQ4nQ2nstarQ2nstar+reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar | |
8105 | + reQ7nQ4nstarQ3nstar+reQ3nQ2nstarQ1nstar+reQ6nQ3nstarQ3nstar | |
8106 | + reQ7nQ4nstarQ3nstar+reQ3nQ2nstarQ1nstar+reQ6nQ3nstarQ3nstar | |
8107 | + 2.*(reQ7nQ6nstarQ1nstar+reQ7nQ6nstarQ1nstar+reQ2nQ1nstarQ1nstar) | |
8108 | + 2.*(reQ6nQ4nstarQ2nstar+reQ4nQ3nstarQ1nstar+reQ4nQ3nstarQ1nstar) | |
8109 | - 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
8110 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8111 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ7n,2.)+pow(dImQ7n,2.)+pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
8112 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8113 | - 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ6n,2.)+pow(dImQ6n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8114 | + 24.*dMult) | |
53884472 | 8115 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
403e3389 | 8116 | |
e1d101a6 | 8117 | // to be polished: |
8118 | five6n1n5n1n1n = (reQ6nQ1nQ5nstarQ1nstarQ1nstar | |
8119 | - reQ6nQ1nQ5nstarQ2nstar | |
8120 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8121 | - reQ6nQ4nstarQ1nstarQ1nstar | |
8122 | - reQ7nQ5nstarQ1nstarQ1nstar | |
8123 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8124 | - dMult*reQ6nQ5nstarQ1nstar | |
8125 | + dMult*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8126 | + reQ7nQ6nstarQ1nstar | |
8127 | + 3.*reQ6nQ5nstarQ1nstar | |
8128 | + 2.*reQ7nQ6nstarQ1nstar | |
8129 | + reQ6nQ4nstarQ2nstar | |
8130 | + reQ7nQ5nstarQ2nstar | |
8131 | + dMult*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8132 | + dMult*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8133 | + reQ7nQ6nstarQ1nstar | |
8134 | + reQ5nQ4nstarQ1nstar | |
8135 | - (dMult-6.)*reQ6nQ5nstarQ1nstar | |
8136 | + 3.*reQ2nQ1nstarQ1nstar | |
8137 | + dMult*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8138 | + 2.*reQ5nQ4nstarQ1nstar | |
8139 | + 3.*reQ6nQ5nstarQ1nstar | |
8140 | + dMult*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8141 | + reQ5nQ4nstarQ1nstar | |
8142 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8143 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8144 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8145 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
8146 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8147 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8148 | - 2.*dMult*dMult | |
8149 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8150 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
8151 | + (dMult-8.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8152 | + (dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8153 | + (dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8154 | + 2.*(dMult-6.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-2.*dMult*(dMult-12.)) | |
8155 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8156 | five6n2n4n2n2n = ((pow(dReQ2n,2.)+pow(dImQ2n,2.))*(dReQ2n*dReQ4n*dReQ6n-dReQ6n*dImQ2n*dImQ4n | |
8157 | + dReQ4n*dImQ2n*dImQ6n+dReQ2n*dImQ4n*dImQ6n) | |
8158 | - ((dReQ8n*dReQ4n+dImQ8n*dImQ4n)*(pow(dReQ2n,2)-pow(dImQ2n,2)) | |
8159 | + 2.*dReQ2n*dImQ2n*(dImQ8n*dReQ4n-dReQ8n*dImQ4n)) | |
8160 | - (dReQ6n*pow(dReQ2n,3)-3.*dReQ2n*dReQ6n*pow(dImQ2n,2) | |
8161 | + 3.*dImQ2n*dImQ6n*pow(dReQ2n,2)-dImQ6n*pow(dImQ2n,3)) | |
8162 | - ((pow(dReQ4n,2.)-pow(dImQ4n,2.))*(dReQ6n*dReQ2n-dImQ6n*dImQ2n) | |
8163 | + 2.*dReQ4n*dImQ4n*(dReQ6n*dImQ2n+dImQ6n*dReQ2n)) | |
8164 | + 4.*(dReQ8n*(dReQ6n*dReQ2n-dImQ6n*dImQ2n)+dImQ8n*(dReQ6n*dImQ2n+dImQ6n*dReQ2n)) | |
8165 | + pow(dReQ4n,2.)*dReQ8n+2.*dReQ4n*dImQ4n*dImQ8n-pow(dImQ4n,2.)*dReQ8n | |
8166 | - (2.*dMult-13.)*(dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n | |
8167 | + dImQ6n*dImQ4n*dReQ2n) | |
8168 | + 7.*(pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
8169 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)) | |
8170 | + 2.*(dMult-5.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8171 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8172 | + 2.*(dMult-6.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
8173 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8174 | - pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.) | |
8175 | + 2.*(3.*dMult-11.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*dMult*(dMult-6.)) | |
8176 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8177 | five6n4n4n4n2n = ((pow(dImQ4n,2.)+pow(dReQ4n,2.))*(dImQ4n*dImQ6n*dReQ2n+dImQ2n*dImQ6n*dReQ4n | |
8178 | - dImQ2n*dImQ4n*dReQ6n+dReQ2n*dReQ4n*dReQ6n) | |
8179 | - (-pow(dImQ4n,2.)*dImQ2n*dImQ10n+dImQ2n*dImQ10n*pow(dReQ4n,2.) | |
8180 | + 2.*dImQ4n*dImQ10n*dReQ4n*dReQ2n-2.*dImQ4n*dImQ2n*dReQ4n*dReQ10n | |
8181 | - pow(dImQ4n,2.)*dReQ2n*dReQ10n+pow(dReQ4n,2.)*dReQ2n*dReQ10n) | |
8182 | - (dImQ2n*dImQ4n*dImQ6n*dImQ8n+dImQ6n*dImQ8n*dReQ2n*dReQ4n | |
8183 | + dImQ4n*dImQ8n*dReQ2n*dReQ6n-dImQ2n*dImQ8n*dReQ4n*dReQ6n | |
8184 | - dImQ4n*dImQ6n*dReQ2n*dReQ8n+dImQ2n*dImQ6n*dReQ4n*dReQ8n | |
8185 | + dImQ2n*dImQ4n*dReQ6n*dReQ8n+dReQ2n*dReQ4n*dReQ6n*dReQ8n) | |
8186 | - ((pow(dReQ4n,2.)-pow(dImQ4n,2.))*(dReQ6n*dReQ2n-dImQ6n*dImQ2n) | |
8187 | + 2.*dReQ4n*dImQ4n*(dReQ6n*dImQ2n+dImQ6n*dReQ2n)) | |
8188 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
8189 | + (dReQ10n*dReQ8n*dReQ2n-dReQ10n*dImQ8n*dImQ2n+dImQ10n*dReQ8n*dImQ2n+dImQ10n*dImQ8n*dReQ2n) | |
8190 | + 4.*(dReQ10n*dReQ4n*dReQ6n-dReQ10n*dImQ4n*dImQ6n+dImQ10n*dReQ4n*dImQ6n+dImQ10n*dImQ4n*dReQ6n) | |
8191 | + dReQ8n*(dReQ6n*dReQ2n-dImQ6n*dImQ2n)+dImQ8n*(dReQ6n*dImQ2n+dImQ6n*dReQ2n) | |
8192 | + 3.*(pow(dReQ4n,2.)*dReQ8n+2.*dReQ4n*dImQ4n*dImQ8n-pow(dImQ4n,2.)*dReQ8n) | |
8193 | - 2.*(dMult-6.)*(dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n) | |
8194 | + 4.*(pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n) | |
8195 | - 2.*(pow(dReQ10n,2.)+pow(dImQ10n,2.)) | |
8196 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.))+2.*(dMult-5.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8197 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8198 | - pow((pow(dReQ4n,2.)+pow(dImQ4n,2.)),2.)+2.*(3.*dMult-10.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
8199 | + 2.*(dMult-6.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*dMult*(dMult-6.)) | |
8200 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8201 | // to be polished: | |
8202 | five6n2n2n5n5n = (reQ6nQ2nQ2nQ5nstarQ5nstar | |
8203 | - reQ6nQ4nQ5nstarQ5nstar-reQ8nQ2nQ5nstarQ5nstar-reQ8nQ2nQ5nstarQ5nstar | |
8204 | - reQ6nQ2nQ5nstarQ3nstar-reQ5nQ2nstarQ2nstarQ1nstar-reQ6nQ2nQ5nstarQ3nstar | |
8205 | - reQ10nQ6nstarQ2nstarQ2nstar-reQ6nQ2nQ5nstarQ3nstar-reQ5nQ2nstarQ2nstarQ1nstar-reQ6nQ2nQ5nstarQ3nstar | |
8206 | + 2.*(reQ6nQ5nstarQ1nstar+reQ5nQ3nstarQ2nstar+reQ5nQ3nstarQ2nstar+reQ10nQ5nstarQ5nstar) | |
8207 | + reQ5nQ4nstarQ1nstar+reQ8nQ5nstarQ3nstar+reQ8nQ5nstarQ3nstar | |
8208 | + reQ10nQ8nstarQ2nstar+reQ10nQ6nstarQ4nstar+reQ10nQ8nstarQ2nstar | |
8209 | + reQ5nQ4nstarQ1nstar+reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar | |
8210 | + reQ8nQ5nstarQ3nstar+reQ3nQ2nstarQ1nstar+reQ6nQ3nstarQ3nstar | |
8211 | + reQ8nQ5nstarQ3nstar+reQ3nQ2nstarQ1nstar+reQ6nQ3nstarQ3nstar | |
8212 | + 2.*(reQ8nQ6nstarQ2nstar+reQ8nQ6nstarQ2nstar+reQ4nQ2nstarQ2nstar) | |
8213 | + 2.*(reQ6nQ5nstarQ1nstar+reQ5nQ3nstarQ2nstar+reQ5nQ3nstarQ2nstar) | |
8214 | - 6.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8215 | - 2.*(pow(dReQ10n,2.)+pow(dImQ10n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8216 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ8n,2.)+pow(dImQ8n,2.)+pow(dReQ8n,2.)+pow(dImQ8n,2.)) | |
8217 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8218 | - 6.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ6n,2.)+pow(dImQ6n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8219 | + 24.*dMult) | |
8220 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8221 | // to be polished: | |
8222 | five6n5n5n5n1n = (reQ6nQ5nQ5nstarQ5nstarQ1nstar | |
8223 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8224 | - reQ10nQ1nQ6nstarQ5nstar | |
8225 | - dMult*reQ6nQ5nstarQ1nstar | |
8226 | - reQ11nQ5nstarQ5nstarQ1nstar | |
8227 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8228 | - reQ6nQ4nQ5nstarQ5nstar | |
8229 | + reQ5nQ4nstarQ1nstar | |
8230 | + reQ11nQ6nstarQ5nstar | |
8231 | + 3.*reQ6nQ5nstarQ1nstar | |
8232 | + 2.*reQ11nQ6nstarQ5nstar | |
8233 | + dMult*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8234 | + reQ11nQ6nstarQ5nstar | |
8235 | + reQ10nQ6nstarQ4nstar | |
8236 | + reQ5nQ4nstarQ1nstar | |
8237 | + reQ11nQ10nstarQ1nstar | |
8238 | + dMult*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8239 | - (dMult-6.)*reQ6nQ5nstarQ1nstar | |
8240 | + 3.*reQ6nQ5nstarQ1nstar | |
8241 | + reQ5nQ4nstarQ1nstar | |
8242 | + 2.*dMult*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8243 | + 3.*reQ10nQ5nstarQ5nstar | |
8244 | + reQ5nQ4nstarQ1nstar | |
8245 | + dMult*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8246 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8247 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8248 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8249 | - 2.*(pow(dReQ11n,2.)+pow(dImQ11n,2.)) | |
8250 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8251 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8252 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
8253 | - 2.*(pow(dReQ10n,2.)+pow(dImQ10n,2.)) | |
8254 | - 2.*dMult*dMult | |
8255 | + (dMult-8.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8256 | + (dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8257 | + (dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8258 | + 2.*(dMult-6.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.))-2.*dMult*(dMult-12.)) | |
8259 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8260 | // to be polished: | |
8261 | five6n6n5n5n2n = (reQ6nQ6nQ5nstarQ5nstarQ2nstar | |
8262 | - reQ7nQ5nQ6nstarQ6nstar-reQ7nQ5nQ6nstarQ6nstar-reQ10nQ2nQ6nstarQ6nstar | |
8263 | - reQ6nQ1nQ5nstarQ2nstar-reQ6nQ1nQ5nstarQ2nstar-reQ6nQ4nQ5nstarQ5nstar | |
8264 | - reQ12nQ5nstarQ5nstarQ2nstar-reQ6nQ4nQ5nstarQ5nstar-reQ6nQ1nQ5nstarQ2nstar-reQ6nQ1nQ5nstarQ2nstar | |
8265 | + 2.*(reQ6nQ5nstarQ1nstar+reQ6nQ4nstarQ2nstar+reQ6nQ5nstarQ1nstar+reQ12nQ6nstarQ6nstar) | |
8266 | + reQ7nQ6nstarQ1nstar+reQ7nQ6nstarQ1nstar+reQ10nQ6nstarQ4nstar | |
8267 | + reQ12nQ10nstarQ2nstar+reQ12nQ7nstarQ5nstar+reQ12nQ7nstarQ5nstar | |
8268 | + reQ7nQ6nstarQ1nstar+reQ2nQ1nstarQ1nstar+reQ5nQ4nstarQ1nstar | |
8269 | + reQ7nQ6nstarQ1nstar+reQ2nQ1nstarQ1nstar+reQ5nQ4nstarQ1nstar | |
8270 | + reQ10nQ6nstarQ4nstar+reQ5nQ4nstarQ1nstar+reQ5nQ4nstarQ1nstar | |
8271 | + 2.*(reQ10nQ5nstarQ5nstar+reQ7nQ5nstarQ2nstar+reQ7nQ5nstarQ2nstar) | |
8272 | + 2.*(reQ6nQ5nstarQ1nstar+reQ6nQ5nstarQ1nstar+reQ6nQ4nstarQ2nstar) | |
8273 | - 6.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8274 | - 2.*(pow(dReQ12n,2.)+pow(dImQ12n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8275 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)+pow(dReQ7n,2.)+pow(dImQ7n,2.)+pow(dReQ10n,2.)+pow(dImQ10n,2.)) | |
8276 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8277 | - 6.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)+pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8278 | + 24.*dMult) | |
8279 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8280 | five6n6n6n4n2n = ((pow(dImQ6n,2.)+pow(dReQ6n,2.))*(dImQ4n*dImQ6n*dReQ2n+dImQ2n*dImQ6n*dReQ4n | |
8281 | - dImQ2n*dImQ4n*dReQ6n+dReQ2n*dReQ4n*dReQ6n) | |
8282 | - (dReQ2n*dReQ4n*dReQ6n*dReQ12n-dReQ6n*dReQ12n*dImQ2n*dImQ4n | |
8283 | - dReQ4n*dReQ12n*dImQ2n*dImQ6n-dReQ2n*dReQ12n*dImQ4n*dImQ6n | |
8284 | + dReQ4n*dReQ6n*dImQ2n*dImQ12n+dReQ2n*dReQ6n*dImQ4n*dImQ12n | |
8285 | + dReQ2n*dReQ4n*dImQ6n*dImQ12n-dImQ2n*dImQ4n*dImQ6n*dImQ12n) | |
8286 | - (dImQ2n*pow(dImQ6n,2.)*dImQ10n+2.*dImQ6n*dImQ10n*dReQ2n*dReQ6n | |
8287 | - dImQ2n*dImQ10n*pow(dReQ6n,2.)-pow(dImQ6n,2.)*dReQ2n*dReQ10n | |
8288 | + 2.*dImQ2n*dImQ6n*dReQ6n*dReQ10n+dReQ2n*pow(dReQ6n,2.)*dReQ10n) | |
8289 | - ((dReQ8n*dReQ4n-dImQ8n*dImQ4n)*(dReQ6n*dReQ6n-dImQ6n*dImQ6n) | |
8290 | + 2.*(dReQ8n*dImQ4n+dImQ8n*dReQ4n)*dReQ6n*dImQ6n) | |
8291 | + dReQ12n*dReQ10n*dReQ2n-dReQ12n*dImQ10n*dImQ2n+dImQ12n*dReQ10n*dImQ2n+dImQ12n*dImQ10n*dReQ2n | |
8292 | + dReQ12n*dReQ8n*dReQ4n-dReQ12n*dImQ8n*dImQ4n+dImQ12n*dReQ8n*dImQ4n+dImQ12n*dImQ8n*dReQ4n | |
8293 | + 3.*(pow(dReQ6n,2.)*dReQ12n+2.*dReQ6n*dImQ6n*dImQ12n-pow(dImQ6n,2.)*dReQ12n) | |
8294 | + 4.*(dReQ10n*dReQ4n*dReQ6n-dReQ10n*dImQ4n*dImQ6n+dImQ10n*dReQ4n*dImQ6n+dImQ10n*dImQ4n*dReQ6n) | |
8295 | + 4.*(dReQ8n*(dReQ6n*dReQ2n-dImQ6n*dImQ2n)+dImQ8n*(dReQ6n*dImQ2n+dImQ6n*dReQ2n)) | |
8296 | - 2.*(dMult-6.)*(dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n+dImQ6n*dImQ4n*dReQ2n) | |
8297 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
8298 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8299 | - 2.*(pow(dReQ12n,2.)+pow(dImQ12n,2.))-2.*(pow(dReQ10n,2.)+pow(dImQ10n,2.)) | |
8300 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.))+2.*(3.*dMult-10.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8301 | - pow((pow(dReQ6n,2.)+pow(dImQ6n,2.)),2.)+2.*(dMult-5.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
8302 | + 2.*(dMult-5.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*dMult*(dMult-6.)) | |
8303 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8304 | // to be polished (and TBI swap with the one above): | |
8305 | five6n6n6n5n1n = (reQ6nQ6nQ6nstarQ5nstarQ1nstar | |
8306 | - reQ7nQ5nQ6nstarQ6nstar | |
8307 | - reQ11nQ1nQ6nstarQ6nstar | |
8308 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8309 | - reQ12nQ6nstarQ5nstarQ1nstar | |
8310 | - dMult*reQ6nQ5nstarQ1nstar | |
8311 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8312 | + reQ6nQ5nstarQ1nstar | |
8313 | + reQ12nQ6nstarQ6nstar | |
8314 | + 3.*dMult*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8315 | + 2.*reQ12nQ6nstarQ6nstar | |
8316 | + reQ7nQ6nstarQ1nstar | |
8317 | + reQ12nQ7nstarQ5nstar | |
8318 | + reQ11nQ6nstarQ5nstar | |
8319 | + reQ6nQ5nstarQ1nstar | |
8320 | + reQ12nQ11nstarQ1nstar | |
8321 | + dMult*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8322 | - (dMult-6.)*reQ6nQ5nstarQ1nstar | |
8323 | + 3.*reQ7nQ6nstarQ1nstar | |
8324 | + reQ6nQ5nstarQ1nstar | |
8325 | + 2.*reQ6nQ5nstarQ1nstar | |
8326 | + 3.*reQ11nQ6nstarQ5nstar | |
8327 | + dMult*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8328 | + reQ6nQ5nstarQ1nstar | |
8329 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8330 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8331 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8332 | - 2.*(pow(dReQ12n,2.)+pow(dImQ12n,2.)) | |
8333 | - 2.*dMult*dMult | |
8334 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
8335 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8336 | - 2.*(pow(dReQ11n,2.)+pow(dImQ11n,2.)) | |
8337 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8338 | + (dMult-8.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8339 | + (dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8340 | + (dMult-8.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8341 | + 2.*(dMult-6.)*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-2.*dMult*(dMult-12.)) | |
8342 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8343 | // Four distinct harmonics (11): | |
8344 | // to be polished: | |
8345 | five5n2n3n3n1n = (reQ5nQ2nQ3nstarQ3nstarQ1nstar | |
8346 | - reQ5nQ2nQ4nstarQ3nstar-reQ5nQ2nQ4nstarQ3nstar-reQ6nQ1nQ5nstarQ2nstar | |
8347 | - reQ5nQ3nstarQ1nstarQ1nstar-reQ5nQ3nstarQ1nstarQ1nstar-reQ5nQ1nQ3nstarQ3nstar | |
8348 | - reQ7nQ3nstarQ3nstarQ1nstar-reQ4nQ2nQ3nstarQ3nstar-reQ3nQ1nQ2nstarQ2nstar-reQ3nQ1nQ2nstarQ2nstar | |
8349 | + 2.*(reQ5nQ3nstarQ2nstar+reQ5nQ4nstarQ1nstar+reQ5nQ3nstarQ2nstar+reQ7nQ5nstarQ2nstar) | |
8350 | + reQ5nQ4nstarQ1nstar+reQ5nQ4nstarQ1nstar+reQ6nQ5nstarQ1nstar | |
8351 | + reQ7nQ6nstarQ1nstar+reQ7nQ4nstarQ3nstar+reQ7nQ4nstarQ3nstar | |
8352 | + reQ4nQ2nstarQ2nstar+reQ2nQ1nstarQ1nstar+reQ3nQ2nstarQ1nstar | |
8353 | + reQ4nQ2nstarQ2nstar+reQ2nQ1nstarQ1nstar+reQ3nQ2nstarQ1nstar | |
8354 | + reQ6nQ4nstarQ2nstar+reQ4nQ3nstarQ1nstar+reQ4nQ3nstarQ1nstar | |
8355 | + 2.*(reQ6nQ3nstarQ3nstar+reQ4nQ3nstarQ1nstar+reQ4nQ3nstarQ1nstar) | |
8356 | + 2.*(reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar+reQ2nQ1nstarQ1nstar) | |
8357 | - 6.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8358 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8359 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8360 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8361 | - 6.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8362 | + 24.*dMult) | |
8363 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8364 | // to be polished: | |
8365 | five5n1n1n4n3n = (reQ5nQ1nQ1nQ4nstarQ3nstar | |
8366 | - reQ5nQ2nQ4nstarQ3nstar-reQ6nQ1nQ4nstarQ3nstar-reQ6nQ1nQ4nstarQ3nstar | |
8367 | - reQ5nQ1nQ4nstarQ2nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ5nQ1nQ4nstarQ2nstar | |
8368 | - reQ7nQ5nstarQ1nstarQ1nstar-reQ5nQ1nQ3nstarQ3nstar-reQ3nQ1nstarQ1nstarQ1nstar-reQ5nQ1nQ3nstarQ3nstar | |
8369 | + 2.*(reQ5nQ4nstarQ1nstar+reQ4nQ3nstarQ1nstar+reQ4nQ3nstarQ1nstar+reQ7nQ4nstarQ3nstar) | |
8370 | + reQ4nQ2nstarQ2nstar+reQ6nQ4nstarQ2nstar+reQ6nQ4nstarQ2nstar | |
8371 | + reQ7nQ6nstarQ1nstar+reQ7nQ5nstarQ2nstar+reQ7nQ6nstarQ1nstar | |
8372 | + reQ3nQ2nstarQ1nstar+reQ2nQ1nstarQ1nstar+reQ2nQ1nstarQ1nstar | |
8373 | + reQ6nQ3nstarQ3nstar+reQ3nQ2nstarQ1nstar+reQ5nQ3nstarQ2nstar | |
8374 | + reQ6nQ3nstarQ3nstar+reQ3nQ2nstarQ1nstar+reQ5nQ3nstarQ2nstar | |
8375 | + 2.*(reQ6nQ5nstarQ1nstar+reQ6nQ5nstarQ1nstar+reQ2nQ1nstarQ1nstar) | |
8376 | + 2.*(reQ5nQ3nstarQ2nstar+reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar) | |
8377 | - 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
8378 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8379 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ6n,2.)+pow(dImQ6n,2.)+pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8380 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8381 | - 6.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8382 | + 24.*dMult) | |
8383 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8384 | // to be polished: | |
8385 | five5n3n4n2n2n = (reQ5nQ3nQ4nstarQ2nstarQ2nstar | |
8386 | - reQ5nQ3nQ4nstarQ4nstar-reQ6nQ2nQ5nstarQ3nstar-reQ6nQ2nQ5nstarQ3nstar | |
8387 | - reQ5nQ1nQ4nstarQ2nstar-reQ5nQ2nstarQ2nstarQ1nstar-reQ5nQ1nQ4nstarQ2nstar | |
8388 | - reQ8nQ4nstarQ2nstarQ2nstar-reQ4nQ2nQ3nstarQ3nstar-reQ3nQ1nQ2nstarQ2nstar-reQ4nQ2nQ3nstarQ3nstar | |
8389 | + 2.*(reQ5nQ4nstarQ1nstar+reQ5nQ3nstarQ2nstar+reQ5nQ3nstarQ2nstar+reQ8nQ5nstarQ3nstar) | |
8390 | + reQ5nQ4nstarQ1nstar+reQ6nQ5nstarQ1nstar+reQ6nQ5nstarQ1nstar | |
8391 | + reQ8nQ6nstarQ2nstar+reQ8nQ4nstarQ4nstar+reQ8nQ6nstarQ2nstar | |
8392 | + reQ4nQ3nstarQ1nstar+reQ2nQ1nstarQ1nstar+reQ2nQ1nstarQ1nstar | |
8393 | + reQ6nQ3nstarQ3nstar+reQ3nQ2nstarQ1nstar+reQ4nQ3nstarQ1nstar | |
8394 | + reQ6nQ3nstarQ3nstar+reQ3nQ2nstarQ1nstar+reQ4nQ3nstarQ1nstar | |
8395 | + 2.*(reQ6nQ4nstarQ2nstar+reQ6nQ4nstarQ2nstar+reQ4nQ2nstarQ2nstar) | |
8396 | + 2.*(reQ4nQ3nstarQ1nstar+reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar) | |
8397 | - 6.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8398 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8399 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ6n,2.)+pow(dImQ6n,2.)+pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8400 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8401 | - 6.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8402 | + 24.*dMult) | |
8403 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
b84464d3 | 8404 | |
e1d101a6 | 8405 | // to be polished!!!: |
8406 | five5n2n1n4n4n = (reQ5nQ2nQ1nQ4nstarQ4nstar | |
8407 | - reQ5nQ3nQ4nstarQ4nstar-reQ6nQ2nQ4nstarQ4nstar-reQ7nQ1nQ4nstarQ4nstar | |
8408 | - reQ5nQ1nQ4nstarQ2nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ5nQ2nQ4nstarQ3nstar | |
8409 | - reQ8nQ5nstarQ2nstarQ1nstar-reQ5nQ2nQ4nstarQ3nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ5nQ1nQ4nstarQ2nstar | |
8410 | + 2.*(reQ5nQ4nstarQ1nstar+reQ4nQ3nstarQ1nstar+reQ4nQ2nstarQ2nstar+reQ8nQ4nstarQ4nstar) | |
8411 | + reQ4nQ3nstarQ1nstar+reQ6nQ4nstarQ2nstar+reQ7nQ4nstarQ3nstar | |
8412 | + reQ8nQ7nstarQ1nstar+reQ8nQ5nstarQ3nstar+reQ8nQ6nstarQ2nstar | |
8413 | + reQ4nQ3nstarQ1nstar+reQ2nQ1nstarQ1nstar+reQ3nQ2nstarQ1nstar | |
8414 | + reQ6nQ4nstarQ2nstar+reQ2nQ1nstarQ1nstar+reQ5nQ3nstarQ2nstar | |
8415 | + reQ7nQ4nstarQ3nstar+reQ3nQ2nstarQ1nstar+reQ5nQ3nstarQ2nstar | |
8416 | + 2.*(reQ7nQ5nstarQ2nstar+reQ6nQ5nstarQ1nstar+reQ3nQ2nstarQ1nstar) | |
8417 | + 2.*(reQ5nQ4nstarQ1nstar+reQ4nQ2nstarQ2nstar+reQ4nQ3nstarQ1nstar) | |
8418 | - 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
8419 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8420 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ6n,2.)+pow(dImQ6n,2.)+pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
8421 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8422 | - 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8423 | + 24.*dMult) | |
8424 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
403e3389 | 8425 | |
e1d101a6 | 8426 | |
8427 | // to be polished: | |
8428 | five6n1n3n2n2n = (reQ6nQ1nQ3nstarQ2nstarQ2nstar | |
8429 | - reQ6nQ1nQ4nstarQ3nstar-reQ6nQ1nQ5nstarQ2nstar-reQ6nQ1nQ5nstarQ2nstar | |
8430 | - reQ6nQ3nstarQ2nstarQ1nstar-reQ6nQ2nstarQ2nstarQ2nstar-reQ6nQ3nstarQ2nstarQ1nstar | |
8431 | - reQ7nQ3nstarQ2nstarQ2nstar-reQ4nQ1nQ3nstarQ2nstar-reQ3nQ1nQ2nstarQ2nstar-reQ4nQ1nQ3nstarQ2nstar | |
8432 | + 2.*(reQ6nQ3nstarQ3nstar+reQ6nQ4nstarQ2nstar+reQ6nQ4nstarQ2nstar+reQ7nQ6nstarQ1nstar) | |
8433 | + reQ6nQ4nstarQ2nstar+reQ6nQ5nstarQ1nstar+reQ6nQ5nstarQ1nstar | |
8434 | + reQ7nQ5nstarQ2nstar+reQ7nQ4nstarQ3nstar+reQ7nQ5nstarQ2nstar | |
8435 | + reQ4nQ3nstarQ1nstar+reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar | |
8436 | + reQ5nQ4nstarQ1nstar+reQ4nQ2nstarQ2nstar+reQ4nQ3nstarQ1nstar | |
8437 | + reQ5nQ4nstarQ1nstar+reQ4nQ2nstarQ2nstar+reQ4nQ3nstarQ1nstar | |
8438 | + 2.*(reQ5nQ3nstarQ2nstar+reQ5nQ3nstarQ2nstar+reQ4nQ2nstarQ2nstar) | |
8439 | + 2.*(reQ3nQ2nstarQ1nstar+reQ2nQ1nstarQ1nstar+reQ2nQ1nstarQ1nstar) | |
8440 | - 6.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8441 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
8442 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8443 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8444 | - 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8445 | + 24.*dMult) | |
8446 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8447 | ||
8448 | ||
8449 | // to be polished: | |
8450 | five6n3n4n4n1n = (reQ6nQ3nQ4nstarQ4nstarQ1nstar | |
8451 | - reQ8nQ1nQ6nstarQ3nstar-reQ6nQ3nQ5nstarQ4nstar-reQ6nQ3nQ5nstarQ4nstar | |
8452 | - reQ6nQ4nstarQ1nstarQ1nstar-reQ6nQ2nQ4nstarQ4nstar-reQ6nQ4nstarQ1nstarQ1nstar | |
8453 | - reQ9nQ4nstarQ4nstarQ1nstar-reQ4nQ1nQ3nstarQ2nstar-reQ5nQ3nQ4nstarQ4nstar-reQ4nQ1nQ3nstarQ2nstar | |
8454 | + 2.*(reQ6nQ5nstarQ1nstar+reQ6nQ4nstarQ2nstar+reQ6nQ4nstarQ2nstar+reQ9nQ6nstarQ3nstar) | |
8455 | + reQ8nQ6nstarQ2nstar+reQ6nQ5nstarQ1nstar+reQ6nQ5nstarQ1nstar | |
8456 | + reQ9nQ5nstarQ4nstar+reQ9nQ8nstarQ1nstar+reQ9nQ5nstarQ4nstar | |
8457 | + reQ8nQ5nstarQ3nstar+reQ5nQ4nstarQ1nstar+reQ5nQ4nstarQ1nstar | |
8458 | + reQ5nQ3nstarQ2nstar+reQ4nQ2nstarQ2nstar+reQ2nQ1nstarQ1nstar | |
8459 | + reQ5nQ3nstarQ2nstar+reQ4nQ2nstarQ2nstar+reQ2nQ1nstarQ1nstar | |
8460 | + 2.*(reQ5nQ4nstarQ1nstar+reQ5nQ4nstarQ1nstar+reQ8nQ4nstarQ4nstar) | |
8461 | + 2.*(reQ3nQ2nstarQ1nstar+reQ4nQ3nstarQ1nstar+reQ4nQ3nstarQ1nstar) | |
8462 | - 6.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8463 | - 2.*(pow(dReQ9n,2.)+pow(dImQ9n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8464 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)+pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8465 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8466 | - 6.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
8467 | + 24.*dMult) | |
8468 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8469 | ||
8470 | // to be polished: | |
8471 | five6n1n1n5n3n = (reQ6nQ1nQ1nQ5nstarQ3nstar | |
8472 | - reQ6nQ2nQ5nstarQ3nstar-reQ7nQ1nQ5nstarQ3nstar-reQ7nQ1nQ5nstarQ3nstar | |
8473 | - reQ6nQ1nQ5nstarQ2nstar-reQ5nQ3nstarQ1nstarQ1nstar-reQ6nQ1nQ5nstarQ2nstar | |
8474 | - reQ8nQ6nstarQ1nstarQ1nstar-reQ6nQ1nQ4nstarQ3nstar-reQ3nQ1nstarQ1nstarQ1nstar-reQ6nQ1nQ4nstarQ3nstar | |
8475 | + 2.*(reQ6nQ5nstarQ1nstar+reQ5nQ4nstarQ1nstar+reQ5nQ4nstarQ1nstar+reQ8nQ5nstarQ3nstar) | |
8476 | + reQ5nQ3nstarQ2nstar+reQ7nQ5nstarQ2nstar+reQ7nQ5nstarQ2nstar | |
8477 | + reQ8nQ7nstarQ1nstar+reQ8nQ6nstarQ2nstar+reQ8nQ7nstarQ1nstar | |
8478 | + reQ3nQ2nstarQ1nstar+reQ2nQ1nstarQ1nstar+reQ2nQ1nstarQ1nstar | |
8479 | + reQ7nQ4nstarQ3nstar+reQ4nQ3nstarQ1nstar+reQ6nQ4nstarQ2nstar | |
8480 | + reQ7nQ4nstarQ3nstar+reQ4nQ3nstarQ1nstar+reQ6nQ4nstarQ2nstar | |
8481 | + 2.*(reQ7nQ6nstarQ1nstar+reQ7nQ6nstarQ1nstar+reQ2nQ1nstarQ1nstar) | |
8482 | + 2.*(reQ6nQ3nstarQ3nstar+reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar) | |
8483 | - 6.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8484 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8485 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ7n,2.)+pow(dImQ7n,2.)+pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
8486 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
8487 | - 6.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ6n,2.)+pow(dImQ6n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8488 | + 24.*dMult) | |
8489 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8490 | // to be polished: | |
8491 | five6n3n5n2n2n = (reQ6nQ3nQ5nstarQ2nstarQ2nstar | |
8492 | - reQ6nQ3nQ5nstarQ4nstar-reQ7nQ2nQ6nstarQ3nstar-reQ7nQ2nQ6nstarQ3nstar | |
8493 | - reQ6nQ1nQ5nstarQ2nstar-reQ6nQ2nstarQ2nstarQ2nstar-reQ6nQ1nQ5nstarQ2nstar | |
8494 | - reQ9nQ5nstarQ2nstarQ2nstar-reQ5nQ2nQ4nstarQ3nstar-reQ3nQ1nQ2nstarQ2nstar-reQ5nQ2nQ4nstarQ3nstar | |
8495 | + 2.*(reQ6nQ5nstarQ1nstar+reQ6nQ4nstarQ2nstar+reQ6nQ4nstarQ2nstar+reQ9nQ6nstarQ3nstar) | |
8496 | + reQ6nQ4nstarQ2nstar+reQ7nQ6nstarQ1nstar+reQ7nQ6nstarQ1nstar | |
8497 | + reQ9nQ7nstarQ2nstar+reQ9nQ5nstarQ4nstar+reQ9nQ7nstarQ2nstar | |
8498 | + reQ4nQ3nstarQ1nstar+reQ2nQ1nstarQ1nstar+reQ2nQ1nstarQ1nstar | |
8499 | + reQ7nQ4nstarQ3nstar+reQ4nQ2nstarQ2nstar+reQ5nQ4nstarQ1nstar | |
8500 | + reQ7nQ4nstarQ3nstar+reQ4nQ2nstarQ2nstar+reQ5nQ4nstarQ1nstar | |
8501 | + 2.*(reQ7nQ5nstarQ2nstar+reQ7nQ5nstarQ2nstar+reQ4nQ2nstarQ2nstar) | |
8502 | + 2.*(reQ5nQ3nstarQ2nstar+reQ3nQ2nstarQ1nstar+reQ3nQ2nstarQ1nstar) | |
8503 | - 6.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8504 | - 2.*(pow(dReQ9n,2.)+pow(dImQ9n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8505 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ7n,2.)+pow(dImQ7n,2.)+pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
8506 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8507 | - 6.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8508 | + 24.*dMult) | |
8509 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8510 | ||
8511 | // to be polished | |
8512 | five6n5n4n4n3n = (reQ6nQ5nQ4nstarQ4nstarQ3nstar | |
8513 | - reQ7nQ4nQ6nstarQ5nstar-reQ7nQ4nQ6nstarQ5nstar-reQ8nQ3nQ6nstarQ5nstar | |
8514 | - reQ6nQ1nQ4nstarQ3nstar-reQ6nQ1nQ4nstarQ3nstar-reQ6nQ2nQ4nstarQ4nstar | |
8515 | - reQ11nQ4nstarQ4nstarQ3nstar-reQ5nQ3nQ4nstarQ4nstar-reQ5nQ2nQ4nstarQ3nstar-reQ5nQ2nQ4nstarQ3nstar | |
8516 | + 2.*(reQ6nQ4nstarQ2nstar+reQ6nQ3nstarQ3nstar+reQ6nQ4nstarQ2nstar+reQ11nQ6nstarQ5nstar) | |
8517 | + reQ7nQ6nstarQ1nstar+reQ7nQ6nstarQ1nstar+reQ8nQ6nstarQ2nstar | |
8518 | + reQ11nQ8nstarQ3nstar+reQ11nQ7nstarQ4nstar+reQ11nQ7nstarQ4nstar | |
8519 | + reQ7nQ5nstarQ2nstar+reQ3nQ2nstarQ1nstar+reQ4nQ2nstarQ2nstar | |
8520 | + reQ7nQ5nstarQ2nstar+reQ3nQ2nstarQ1nstar+reQ4nQ2nstarQ2nstar | |
8521 | + reQ8nQ5nstarQ3nstar+reQ4nQ3nstarQ1nstar+reQ4nQ3nstarQ1nstar | |
8522 | + 2.*(reQ8nQ4nstarQ4nstar+reQ7nQ4nstarQ3nstar+reQ7nQ4nstarQ3nstar) | |
8523 | + 2.*(reQ5nQ4nstarQ1nstar+reQ5nQ4nstarQ1nstar+reQ5nQ3nstarQ2nstar) | |
8524 | - 6.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8525 | - 2.*(pow(dReQ11n,2.)+pow(dImQ11n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8526 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)+pow(dReQ7n,2.)+pow(dImQ7n,2.)+pow(dReQ8n,2.)+pow(dImQ8n,2.)) | |
8527 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8528 | - 6.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
8529 | + 24.*dMult) | |
8530 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8531 | // to be polished: | |
8532 | five6n3n1n5n5n = (reQ6nQ3nQ1nQ5nstarQ5nstar | |
8533 | - reQ6nQ4nQ5nstarQ5nstar-reQ7nQ3nQ5nstarQ5nstar-reQ9nQ1nQ5nstarQ5nstar | |
8534 | - reQ6nQ1nQ5nstarQ2nstar-reQ5nQ3nstarQ1nstarQ1nstar-reQ6nQ3nQ5nstarQ4nstar | |
8535 | - reQ10nQ6nstarQ3nstarQ1nstar-reQ6nQ3nQ5nstarQ4nstar-reQ5nQ3nstarQ1nstarQ1nstar-reQ6nQ1nQ5nstarQ2nstar | |
8536 | + 2.*(reQ6nQ5nstarQ1nstar+reQ5nQ4nstarQ1nstar+reQ5nQ3nstarQ2nstar+reQ10nQ5nstarQ5nstar) | |
8537 | + reQ5nQ4nstarQ1nstar+reQ7nQ5nstarQ2nstar+reQ9nQ5nstarQ4nstar | |
8538 | + reQ10nQ9nstarQ1nstar+reQ10nQ6nstarQ4nstar+reQ10nQ7nstarQ3nstar | |
8539 | + reQ5nQ4nstarQ1nstar+reQ2nQ1nstarQ1nstar+reQ4nQ3nstarQ1nstar | |
8540 | + reQ7nQ5nstarQ2nstar+reQ2nQ1nstarQ1nstar+reQ6nQ4nstarQ2nstar | |
8541 | + reQ9nQ5nstarQ4nstar+reQ4nQ3nstarQ1nstar+reQ6nQ4nstarQ2nstar | |
8542 | + 2.*(reQ9nQ6nstarQ3nstar+reQ7nQ6nstarQ1nstar+reQ4nQ3nstarQ1nstar) | |
8543 | + 2.*(reQ6nQ5nstarQ1nstar+reQ5nQ3nstarQ2nstar+reQ5nQ4nstarQ1nstar) | |
8544 | - 6.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8545 | - 2.*(pow(dReQ10n,2.)+pow(dImQ10n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8546 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ7n,2.)+pow(dImQ7n,2.)+pow(dReQ9n,2.)+pow(dImQ9n,2.)) | |
8547 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8548 | - 6.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ6n,2.)+pow(dImQ6n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8549 | + 24.*dMult) | |
8550 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8551 | // to be polished: | |
8552 | five6n6n5n4n3n = (reQ6nQ6nQ5nstarQ4nstarQ3nstar | |
8553 | - reQ7nQ5nQ6nstarQ6nstar-reQ8nQ4nQ6nstarQ6nstar-reQ9nQ3nQ6nstarQ6nstar | |
8554 | - reQ6nQ2nQ5nstarQ3nstar-reQ6nQ1nQ4nstarQ3nstar-reQ6nQ3nQ5nstarQ4nstar | |
8555 | - reQ12nQ5nstarQ4nstarQ3nstar-reQ6nQ3nQ5nstarQ4nstar-reQ6nQ1nQ4nstarQ3nstar-reQ6nQ2nQ5nstarQ3nstar | |
8556 | + 2.*(reQ6nQ5nstarQ1nstar+reQ6nQ3nstarQ3nstar+reQ6nQ4nstarQ2nstar+reQ12nQ6nstarQ6nstar) | |
8557 | + reQ7nQ6nstarQ1nstar+reQ8nQ6nstarQ2nstar+reQ9nQ6nstarQ3nstar | |
8558 | + reQ12nQ9nstarQ3nstar+reQ12nQ7nstarQ5nstar+reQ12nQ8nstarQ4nstar | |
8559 | + reQ7nQ6nstarQ1nstar+reQ3nQ2nstarQ1nstar+reQ4nQ3nstarQ1nstar | |
8560 | + reQ8nQ6nstarQ2nstar+reQ3nQ2nstarQ1nstar+reQ5nQ3nstarQ2nstar | |
8561 | + reQ9nQ6nstarQ3nstar+reQ4nQ3nstarQ1nstar+reQ5nQ3nstarQ2nstar | |
8562 | + 2.*(reQ9nQ5nstarQ4nstar+reQ8nQ5nstarQ3nstar+reQ7nQ4nstarQ3nstar) | |
8563 | + 2.*(reQ6nQ5nstarQ1nstar+reQ6nQ4nstarQ2nstar+reQ6nQ3nstarQ3nstar) | |
8564 | - 6.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8565 | - 2.*(pow(dReQ12n,2.)+pow(dImQ12n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8566 | - 2.*(pow(dReQ7n,2.)+pow(dImQ7n,2.)+pow(dReQ8n,2.)+pow(dImQ8n,2.)+pow(dReQ9n,2.)+pow(dImQ9n,2.)) | |
8567 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8568 | - 6.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)+pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
8569 | + 24.*dMult) | |
8570 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8571 | // Five distinct harmonics (3): | |
8572 | ||
8573 | // to be polished: | |
8574 | five6n2n4n3n1n = (reQ6nQ2nQ4nstarQ3nstarQ1nstar | |
8575 | - reQ6nQ2nQ4nstarQ4nstar-reQ6nQ2nQ5nstarQ3nstar-reQ7nQ1nQ6nstarQ2nstar | |
8576 | - reQ6nQ4nstarQ1nstarQ1nstar-reQ6nQ3nstarQ2nstarQ1nstar-reQ6nQ1nQ4nstarQ3nstar | |
8577 | - reQ8nQ4nstarQ3nstarQ1nstar-reQ5nQ2nQ4nstarQ3nstar-reQ3nQ1nQ2nstarQ2nstar-reQ4nQ1nQ3nstarQ2nstar | |
8578 | + 2.*(reQ6nQ4nstarQ2nstar+reQ6nQ5nstarQ1nstar+reQ6nQ3nstarQ3nstar+reQ8nQ6nstarQ2nstar) | |
8579 | + 1.*(reQ6nQ4nstarQ2nstar+reQ6nQ5nstarQ1nstar+reQ7nQ6nstarQ1nstar) | |
8580 | + 1.*(reQ8nQ7nstarQ1nstar+reQ8nQ4nstarQ4nstar+reQ8nQ5nstarQ3nstar) | |
8581 | + 1.*(reQ4nQ2nstarQ2nstar+reQ2nQ1nstarQ1nstar+reQ3nQ2nstarQ1nstar) | |
8582 | + 1.*(reQ5nQ3nstarQ2nstar+reQ3nQ2nstarQ1nstar+reQ4nQ3nstarQ1nstar) | |
8583 | + 1.*(reQ7nQ5nstarQ2nstar+reQ5nQ3nstarQ2nstar+reQ5nQ4nstarQ1nstar) | |
8584 | + 2.*(reQ7nQ4nstarQ3nstar+reQ5nQ4nstarQ1nstar+reQ4nQ3nstarQ1nstar) | |
8585 | + 2.*(reQ4nQ2nstarQ2nstar+reQ3nQ2nstarQ1nstar+reQ2nQ1nstarQ1nstar) // 3 - 1 | |
8586 | - 6.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8587 | - 2.*(pow(dReQ8n,2.)+pow(dImQ8n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8588 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ7n,2.)+pow(dImQ7n,2.)) | |
8589 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8590 | - 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8591 | + 24.*dMult) | |
8592 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8593 | ||
8594 | ||
8595 | // to be polished: | |
8596 | five6n2n1n5n4n = (reQ6nQ2nQ1nQ5nstarQ4nstar | |
8597 | - reQ6nQ3nQ5nstarQ4nstar-reQ7nQ2nQ5nstarQ4nstar-reQ8nQ1nQ5nstarQ4nstar | |
8598 | - reQ6nQ1nQ5nstarQ2nstar-reQ5nQ2nstarQ2nstarQ1nstar-reQ6nQ2nQ5nstarQ3nstar | |
8599 | - reQ9nQ6nstarQ2nstarQ1nstar-reQ6nQ2nQ4nstarQ4nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ6nQ1nQ4nstarQ3nstar | |
8600 | + 2.*(reQ6nQ5nstarQ1nstar+reQ5nQ4nstarQ1nstar+reQ5nQ3nstarQ2nstar+reQ9nQ5nstarQ4nstar) | |
8601 | + reQ5nQ3nstarQ2nstar+reQ7nQ5nstarQ2nstar+reQ8nQ5nstarQ3nstar | |
8602 | + reQ9nQ8nstarQ1nstar+reQ9nQ6nstarQ3nstar+reQ9nQ7nstarQ2nstar | |
8603 | + reQ4nQ3nstarQ1nstar+reQ2nQ1nstarQ1nstar+reQ3nQ2nstarQ1nstar | |
8604 | + reQ7nQ4nstarQ3nstar+reQ3nQ2nstarQ1nstar+reQ6nQ3nstarQ3nstar | |
8605 | + reQ8nQ4nstarQ4nstar+reQ4nQ2nstarQ2nstar+reQ6nQ4nstarQ2nstar | |
8606 | + 2.*(reQ8nQ6nstarQ2nstar+reQ7nQ6nstarQ1nstar+reQ3nQ2nstarQ1nstar) | |
8607 | + 2.*(reQ6nQ4nstarQ2nstar+reQ4nQ2nstarQ2nstar+reQ4nQ3nstarQ1nstar) | |
8608 | - 6.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
8609 | - 2.*(pow(dReQ9n,2.)+pow(dImQ9n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8610 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ7n,2.)+pow(dImQ7n,2.)+pow(dReQ8n,2.)+pow(dImQ8n,2.)) | |
8611 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
8612 | - 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ6n,2.)+pow(dImQ6n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8613 | + 24.*dMult) | |
8614 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8615 | ||
8616 | ||
8617 | ||
8618 | // to be polished: | |
8619 | five6n4n5n3n2n = (reQ6nQ4nQ5nstarQ3nstarQ2nstar | |
8620 | - reQ6nQ4nQ5nstarQ5nstar-reQ7nQ3nQ6nstarQ4nstar-reQ8nQ2nQ6nstarQ4nstar | |
8621 | - reQ6nQ1nQ5nstarQ2nstar-reQ6nQ3nstarQ2nstarQ1nstar-reQ6nQ2nQ5nstarQ3nstar | |
8622 | - reQ10nQ5nstarQ3nstarQ2nstar-reQ5nQ3nQ4nstarQ4nstar-reQ4nQ1nQ3nstarQ2nstar-reQ5nQ2nQ4nstarQ3nstar | |
8623 | + 2.*(reQ6nQ5nstarQ1nstar+reQ6nQ4nstarQ2nstar+reQ6nQ3nstarQ3nstar+reQ10nQ6nstarQ4nstar) | |
8624 | + 1.*(reQ6nQ5nstarQ1nstar+reQ7nQ6nstarQ1nstar+reQ8nQ6nstarQ2nstar) | |
8625 | + 1.*(reQ10nQ8nstarQ2nstar+reQ10nQ5nstarQ5nstar+reQ10nQ7nstarQ3nstar) | |
8626 | + 1.*(reQ5nQ4nstarQ1nstar+reQ2nQ1nstarQ1nstar+reQ3nQ2nstarQ1nstar) | |
8627 | + 1.*(reQ7nQ4nstarQ3nstar+reQ3nQ2nstarQ1nstar+reQ5nQ3nstarQ2nstar) | |
8628 | + 1.*(reQ8nQ4nstarQ4nstar+reQ4nQ3nstarQ1nstar+reQ5nQ4nstarQ1nstar) | |
8629 | + 2.*(reQ8nQ5nstarQ3nstar+reQ7nQ5nstarQ2nstar+reQ5nQ3nstarQ2nstar) | |
8630 | + 2.*(reQ5nQ4nstarQ1nstar+reQ4nQ3nstarQ1nstar+reQ4nQ2nstarQ2nstar) // 3 - 1 | |
8631 | - 6.*(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
8632 | - 2.*(pow(dReQ10n,2.)+pow(dImQ10n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8633 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ7n,2.)+pow(dImQ7n,2.)+pow(dReQ8n,2.)+pow(dImQ8n,2.)) | |
8634 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
8635 | - 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)+pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)+pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
8636 | + 24.*dMult) | |
8637 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
8638 | ||
8639 | ||
8640 | ||
8641 | f5pCorrelations->Fill(0.5,five3n2n3n1n1n,d5pMultiplicityWeight); | |
8642 | f5pCorrelations->Fill(1.5,five4n1n2n2n1n,d5pMultiplicityWeight); | |
8643 | f5pCorrelations->Fill(2.5,five4n2n3n2n1n,d5pMultiplicityWeight); | |
8644 | f5pCorrelations->Fill(3.5,five4n3n3n2n2n,d5pMultiplicityWeight); | |
8645 | f5pCorrelations->Fill(4.5,five4n2n4n1n1n,d5pMultiplicityWeight); | |
8646 | f5pCorrelations->Fill(5.5,five4n3n4n2n1n,d5pMultiplicityWeight); | |
8647 | f5pCorrelations->Fill(6.5,five5n1n3n2n1n,d5pMultiplicityWeight); | |
8648 | f5pCorrelations->Fill(7.5,five5n2n5n1n1n,d5pMultiplicityWeight); | |
8649 | f5pCorrelations->Fill(8.5,five5n2n4n2n1n,d5pMultiplicityWeight); | |
8650 | f5pCorrelations->Fill(9.5,five5n3n4n3n1n,d5pMultiplicityWeight); | |
8651 | f5pCorrelations->Fill(10.5,five5n4n4n3n2n,d5pMultiplicityWeight); | |
8652 | f5pCorrelations->Fill(11.5,five5n3n5n2n1n,d5pMultiplicityWeight); | |
8653 | f5pCorrelations->Fill(12.5,five5n4n5n2n2n,d5pMultiplicityWeight); | |
8654 | f5pCorrelations->Fill(13.5,five5n4n5n3n1n,d5pMultiplicityWeight); | |
8655 | f5pCorrelations->Fill(14.5,five6n1n3n3n1n,d5pMultiplicityWeight); | |
8656 | f5pCorrelations->Fill(15.5,five6n2n3n3n2n,d5pMultiplicityWeight); | |
8657 | f5pCorrelations->Fill(16.5,five6n1n4n2n1n,d5pMultiplicityWeight); | |
8658 | f5pCorrelations->Fill(17.5,five6n3n4n3n2n,d5pMultiplicityWeight); | |
8659 | f5pCorrelations->Fill(18.5,five6n4n4n3n3n,d5pMultiplicityWeight); | |
8660 | f5pCorrelations->Fill(19.5,five6n2n5n2n1n,d5pMultiplicityWeight); | |
8661 | f5pCorrelations->Fill(20.5,five6n3n5n3n1n,d5pMultiplicityWeight); | |
8662 | f5pCorrelations->Fill(21.5,five6n4n5n4n1n,d5pMultiplicityWeight); | |
8663 | f5pCorrelations->Fill(22.5,five6n5n5n3n3n,d5pMultiplicityWeight); | |
8664 | f5pCorrelations->Fill(23.5,five6n2n6n1n1n,d5pMultiplicityWeight); | |
8665 | f5pCorrelations->Fill(24.5,five6n3n6n2n1n,d5pMultiplicityWeight); | |
8666 | f5pCorrelations->Fill(25.5,five6n4n6n2n2n,d5pMultiplicityWeight); | |
8667 | f5pCorrelations->Fill(26.5,five6n4n6n3n1n,d5pMultiplicityWeight); | |
8668 | f5pCorrelations->Fill(27.5,five6n5n5n4n2n,d5pMultiplicityWeight); | |
8669 | f5pCorrelations->Fill(28.5,five6n5n6n3n2n,d5pMultiplicityWeight); | |
8670 | f5pCorrelations->Fill(29.5,five6n5n6n4n1n,d5pMultiplicityWeight); | |
8671 | //f5pCorrelations->Fill(30.5,-44.,d5pMultiplicityWeight); | |
8672 | f5pCorrelations->Fill(31.5,five2n1n1n1n1n,d5pMultiplicityWeight); | |
8673 | f5pCorrelations->Fill(32.5,five2n2n2n1n1n,d5pMultiplicityWeight); | |
8674 | f5pCorrelations->Fill(33.5,five3n3n2n2n2n,d5pMultiplicityWeight); | |
8675 | f5pCorrelations->Fill(34.5,five4n1n1n1n1n,d5pMultiplicityWeight); | |
8676 | f5pCorrelations->Fill(35.5,five4n2n2n2n2n,d5pMultiplicityWeight); | |
8677 | f5pCorrelations->Fill(36.5,five4n4n4n2n2n,d5pMultiplicityWeight); | |
8678 | f5pCorrelations->Fill(37.5,five6n3n3n3n3n,d5pMultiplicityWeight); | |
8679 | f5pCorrelations->Fill(38.5,five6n6n4n4n4n,d5pMultiplicityWeight); | |
8680 | f5pCorrelations->Fill(39.5,five6n6n6n3n3n,d5pMultiplicityWeight); | |
8681 | //f5pCorrelations->Fill(40.5,-44.,d5pMultiplicityWeight); | |
8682 | f5pCorrelations->Fill(41.5,five3n1n2n1n1n,d5pMultiplicityWeight); | |
8683 | f5pCorrelations->Fill(42.5,five3n2n2n2n1n,d5pMultiplicityWeight); | |
8684 | f5pCorrelations->Fill(43.5,five3n3n3n2n1n,d5pMultiplicityWeight); | |
8685 | f5pCorrelations->Fill(44.5,five4n1n3n1n1n,d5pMultiplicityWeight); | |
8686 | f5pCorrelations->Fill(45.5,five4n1n1n3n3n,d5pMultiplicityWeight); | |
8687 | f5pCorrelations->Fill(46.5,five4n3n3n3n1n,d5pMultiplicityWeight); | |
8688 | f5pCorrelations->Fill(47.5,five4n4n3n3n2n,d5pMultiplicityWeight); | |
8689 | f5pCorrelations->Fill(48.5,five4n4n4n3n1n,d5pMultiplicityWeight); | |
8690 | f5pCorrelations->Fill(49.5,five5n2n1n1n1n,d5pMultiplicityWeight); | |
8691 | f5pCorrelations->Fill(50.5,five5n1n2n2n2n,d5pMultiplicityWeight); | |
8692 | f5pCorrelations->Fill(51.5,five5n2n3n2n2n,d5pMultiplicityWeight); | |
8693 | f5pCorrelations->Fill(52.5,five5n3n3n3n2n,d5pMultiplicityWeight); | |
8694 | f5pCorrelations->Fill(53.5,five5n1n4n1n1n,d5pMultiplicityWeight); | |
8695 | f5pCorrelations->Fill(54.5,five5n4n3n3n3n,d5pMultiplicityWeight); | |
8696 | f5pCorrelations->Fill(55.5,five5n4n4n4n1n,d5pMultiplicityWeight); | |
8697 | f5pCorrelations->Fill(56.5,five5n5n4n3n3n,d5pMultiplicityWeight); | |
8698 | f5pCorrelations->Fill(57.5,five5n5n4n4n2n,d5pMultiplicityWeight); | |
8699 | f5pCorrelations->Fill(58.5,five5n5n5n3n2n,d5pMultiplicityWeight); | |
8700 | f5pCorrelations->Fill(59.5,five5n5n5n4n1n,d5pMultiplicityWeight); | |
8701 | f5pCorrelations->Fill(60.5,five6n2n2n1n1n,d5pMultiplicityWeight); | |
8702 | f5pCorrelations->Fill(61.5,five6n3n1n1n1n,d5pMultiplicityWeight); | |
8703 | f5pCorrelations->Fill(62.5,five6n1n1n4n4n,d5pMultiplicityWeight); | |
8704 | f5pCorrelations->Fill(63.5,five6n1n5n1n1n,d5pMultiplicityWeight); | |
8705 | f5pCorrelations->Fill(64.5,five6n2n4n2n2n,d5pMultiplicityWeight); | |
8706 | f5pCorrelations->Fill(65.5,five6n4n4n4n2n,d5pMultiplicityWeight); | |
8707 | f5pCorrelations->Fill(66.5,five6n2n2n5n5n,d5pMultiplicityWeight); | |
8708 | f5pCorrelations->Fill(67.5,five6n5n5n5n1n,d5pMultiplicityWeight); | |
8709 | f5pCorrelations->Fill(68.5,five6n6n5n5n2n,d5pMultiplicityWeight); | |
8710 | f5pCorrelations->Fill(69.5,five6n6n6n4n2n,d5pMultiplicityWeight); | |
8711 | f5pCorrelations->Fill(70.5,five6n6n6n5n1n,d5pMultiplicityWeight); | |
8712 | //f5pCorrelations->Fill(71.5,-44.,d5pMultiplicityWeight); | |
8713 | f5pCorrelations->Fill(72.5,five5n2n3n3n1n,d5pMultiplicityWeight); | |
8714 | f5pCorrelations->Fill(73.5,five5n1n1n4n3n,d5pMultiplicityWeight); | |
8715 | f5pCorrelations->Fill(74.5,five5n3n4n2n2n,d5pMultiplicityWeight); | |
8716 | f5pCorrelations->Fill(75.5,five5n2n1n4n4n,d5pMultiplicityWeight); | |
8717 | f5pCorrelations->Fill(76.5,five6n1n3n2n2n,d5pMultiplicityWeight); | |
8718 | f5pCorrelations->Fill(77.5,five6n3n4n4n1n,d5pMultiplicityWeight); | |
8719 | f5pCorrelations->Fill(78.5,five6n1n1n5n3n,d5pMultiplicityWeight); | |
8720 | f5pCorrelations->Fill(79.5,five6n3n5n2n2n,d5pMultiplicityWeight); | |
8721 | f5pCorrelations->Fill(80.5,five6n5n4n4n3n,d5pMultiplicityWeight); | |
8722 | f5pCorrelations->Fill(81.5,five6n3n1n5n5n,d5pMultiplicityWeight); | |
8723 | f5pCorrelations->Fill(82.5,five6n6n5n4n3n,d5pMultiplicityWeight); | |
8724 | //f5pCorrelations->Fill(83.5,-44.,d5pMultiplicityWeight); | |
8725 | f5pCorrelations->Fill(84.5,five6n2n4n3n1n,d5pMultiplicityWeight); | |
8726 | f5pCorrelations->Fill(85.5,five6n2n1n5n4n,d5pMultiplicityWeight); | |
8727 | f5pCorrelations->Fill(86.5,five6n4n5n3n2n,d5pMultiplicityWeight); | |
c10259fb | 8728 | allMixedCorrelators[56]=five3n2n3n1n1n; |
8729 | allMixedCorrelators[57]=five4n1n2n2n1n; | |
8730 | allMixedCorrelators[58]=five4n2n3n2n1n; | |
8731 | allMixedCorrelators[59]=five4n3n3n2n2n; | |
8732 | allMixedCorrelators[60]=five4n2n4n1n1n; | |
8733 | allMixedCorrelators[61]=five4n3n4n2n1n; | |
8734 | allMixedCorrelators[62]=five5n1n3n2n1n; | |
8735 | allMixedCorrelators[63]=five5n2n5n1n1n; | |
8736 | allMixedCorrelators[64]=five5n2n4n2n1n; | |
8737 | allMixedCorrelators[65]=five5n3n4n3n1n; | |
8738 | allMixedCorrelators[66]=five5n4n4n3n2n; | |
8739 | allMixedCorrelators[67]=five5n3n5n2n1n; | |
8740 | allMixedCorrelators[68]=five5n4n5n2n2n; | |
8741 | allMixedCorrelators[69]=five5n4n5n3n1n; | |
8742 | allMixedCorrelators[70]=five6n1n3n3n1n; | |
8743 | allMixedCorrelators[71]=five6n2n3n3n2n; | |
8744 | allMixedCorrelators[72]=five6n1n4n2n1n; | |
8745 | allMixedCorrelators[73]=five6n3n4n3n2n; | |
8746 | allMixedCorrelators[74]=five6n4n4n3n3n; | |
8747 | allMixedCorrelators[75]=five6n2n5n2n1n; | |
8748 | allMixedCorrelators[76]=five6n3n5n3n1n; | |
8749 | allMixedCorrelators[77]=five6n4n5n4n1n; | |
8750 | allMixedCorrelators[78]=five6n5n5n3n3n; | |
8751 | allMixedCorrelators[79]=five6n2n6n1n1n; | |
8752 | allMixedCorrelators[80]=five6n3n6n2n1n; | |
8753 | allMixedCorrelators[81]=five6n4n6n2n2n; | |
8754 | allMixedCorrelators[82]=five6n4n6n3n1n; | |
8755 | allMixedCorrelators[83]=five6n5n5n4n2n; | |
8756 | allMixedCorrelators[84]=five6n5n6n3n2n; | |
8757 | allMixedCorrelators[85]=five6n5n6n4n1n; | |
8758 | allMixedCorrelators[86]=five2n1n1n1n1n; | |
8759 | allMixedCorrelators[87]=five2n2n2n1n1n; | |
8760 | allMixedCorrelators[88]=five3n3n2n2n2n; | |
8761 | allMixedCorrelators[89]=five4n1n1n1n1n; | |
8762 | allMixedCorrelators[90]=five4n2n2n2n2n; | |
8763 | allMixedCorrelators[91]=five4n4n4n2n2n; | |
8764 | allMixedCorrelators[92]=five6n3n3n3n3n; | |
8765 | allMixedCorrelators[93]=five6n6n4n4n4n; | |
8766 | allMixedCorrelators[94]=five6n6n6n3n3n; | |
8767 | allMixedCorrelators[95]=five3n1n2n1n1n; | |
8768 | allMixedCorrelators[96]=five3n2n2n2n1n; | |
8769 | allMixedCorrelators[97]=five3n3n3n2n1n; | |
8770 | allMixedCorrelators[98]=five4n1n3n1n1n; | |
8771 | allMixedCorrelators[99]=five4n1n1n3n3n; | |
8772 | allMixedCorrelators[100]=five4n3n3n3n1n; | |
8773 | allMixedCorrelators[101]=five4n4n3n3n2n; | |
8774 | allMixedCorrelators[102]=five4n4n4n3n1n; | |
8775 | allMixedCorrelators[103]=five5n2n1n1n1n; | |
8776 | allMixedCorrelators[104]=five5n1n2n2n2n; | |
8777 | allMixedCorrelators[105]=five5n2n3n2n2n; | |
8778 | allMixedCorrelators[106]=five5n3n3n3n2n; | |
8779 | allMixedCorrelators[107]=five5n1n4n1n1n; | |
8780 | allMixedCorrelators[108]=five5n4n3n3n3n; | |
8781 | allMixedCorrelators[109]=five5n4n4n4n1n; | |
8782 | allMixedCorrelators[110]=five5n5n4n3n3n; | |
8783 | allMixedCorrelators[111]=five5n5n4n4n2n; | |
8784 | allMixedCorrelators[112]=five5n5n5n3n2n; | |
8785 | allMixedCorrelators[113]=five5n5n5n4n1n; | |
8786 | allMixedCorrelators[114]=five6n2n2n1n1n; | |
8787 | allMixedCorrelators[115]=five6n3n1n1n1n; | |
8788 | allMixedCorrelators[116]=five6n1n1n4n4n; | |
8789 | allMixedCorrelators[117]=five6n1n5n1n1n; | |
8790 | allMixedCorrelators[118]=five6n2n4n2n2n; | |
8791 | allMixedCorrelators[119]=five6n4n4n4n2n; | |
8792 | allMixedCorrelators[120]=five6n2n2n5n5n; | |
8793 | allMixedCorrelators[121]=five6n5n5n5n1n; | |
8794 | allMixedCorrelators[122]=five6n6n5n5n2n; | |
8795 | allMixedCorrelators[123]=five6n6n6n4n2n; | |
8796 | allMixedCorrelators[124]=five6n6n6n5n1n; | |
8797 | allMixedCorrelators[125]=five5n2n3n3n1n; | |
8798 | allMixedCorrelators[126]=five5n1n1n4n3n; | |
8799 | allMixedCorrelators[127]=five5n3n4n2n2n; | |
8800 | allMixedCorrelators[128]=five5n2n1n4n4n; | |
8801 | allMixedCorrelators[129]=five6n1n3n2n2n; | |
8802 | allMixedCorrelators[130]=five6n3n4n4n1n; | |
8803 | allMixedCorrelators[131]=five6n1n1n5n3n; | |
8804 | allMixedCorrelators[132]=five6n3n5n2n2n; | |
8805 | allMixedCorrelators[133]=five6n5n4n4n3n; | |
8806 | allMixedCorrelators[134]=five6n3n1n5n5n; | |
8807 | allMixedCorrelators[135]=five6n6n5n4n3n; | |
8808 | allMixedCorrelators[136]=five6n2n4n3n1n; | |
8809 | allMixedCorrelators[137]=five6n2n1n5n4n; | |
8810 | allMixedCorrelators[138]=five6n4n5n3n2n; | |
e1d101a6 | 8811 | } // end of if(dMult>4.) |
b84464d3 | 8812 | |
c10259fb | 8813 | // Products of mixed harmonics: |
8814 | Double_t dwx=0.; | |
8815 | Double_t dwy=0.; | |
8816 | for(Int_t x=1;x<=139;x++) | |
8817 | { | |
8818 | if(x>=1 && x<7) | |
8819 | { | |
8820 | dwx=d2pMultiplicityWeight; | |
8821 | } else if(x>=7 && x<16) | |
8822 | { | |
8823 | dwx=d3pMultiplicityWeight; | |
8824 | } else if(x>=16 && x<57) | |
8825 | { | |
8826 | dwx=d4pMultiplicityWeight; | |
8827 | } else if(x>=57 && x<140) | |
8828 | { | |
8829 | dwx=d5pMultiplicityWeight; | |
8830 | } | |
8831 | for(Int_t y=x+1;y<=139;y++) | |
8832 | { | |
8833 | if(y>=1 && y<7) | |
8834 | { | |
8835 | dwy=d2pMultiplicityWeight; | |
8836 | } else if(y>=7 && y<16) | |
8837 | { | |
8838 | dwy=d3pMultiplicityWeight; | |
8839 | } else if(y>=16 && y<57) | |
8840 | { | |
8841 | dwy=d4pMultiplicityWeight; | |
8842 | } else if(y>=57 && y<140) | |
8843 | { | |
8844 | dwy=d5pMultiplicityWeight; | |
8845 | } | |
8846 | fMixedHarmonicProductOfCorrelations->Fill(x-0.5,y-0.5,allMixedCorrelators[x-1]*allMixedCorrelators[y-1],dwx*dwy); | |
8847 | } // end of for(Int_t y=x+1;y<=139;y++) | |
8848 | } // end of for(Int_t x=1;x<=139;x++) | |
e1d101a6 | 8849 | |
8850 | } // end of void AliFlowAnalysisWithQCumulants::CalculateMixedHarmonics() | |
489d5531 | 8851 | |
e1d101a6 | 8852 | //=================================================================================================================== |
8853 | ||
8854 | void AliFlowAnalysisWithQCumulants::CalculateCumulantsMixedHarmonics() | |
8855 | { | |
8856 | // Calculate in this method all multi-particle cumulants for azimuthal correlations in mixed harmonics. | |
8857 | // (Remark: For completeness sake, we also calculate here again cumulants in the same harmonic.) | |
8858 | ||
8859 | // a) Calculate 2-p cumulants; | |
8860 | // b) Calculate 3-p cumulants; | |
8861 | // c) Calculate 4-p cumulants; | |
8862 | // d) Calculate 5-p cumulants. | |
8863 | ||
8864 | // a) Calculate 2-p cumulants: | |
8865 | for(Int_t b=1;b<=6;b++) | |
8866 | { | |
8867 | f2pCumulants->SetBinContent(b,f2pCorrelations->GetBinContent(b)); | |
c10259fb | 8868 | Double_t dSumWLinear = 0.; // sum of linear event weights |
8869 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
8870 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
8871 | Double_t dError = 0.; // weighted and unbiased estimator for error | |
8872 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
8873 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
8874 | dSpread = f2pCorrelations->GetBinError(b); | |
8875 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
8876 | { | |
8877 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
8878 | f2pCumulants->SetBinError(b,dError); | |
8879 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
e1d101a6 | 8880 | } // end of for(Int_t b=1;b<=6;b++) |
8881 | ||
8882 | // b) Calculate 3-p cumulants: | |
8883 | for(Int_t b=1;b<=10;b++) | |
8884 | { | |
8885 | f3pCumulants->SetBinContent(b,f3pCorrelations->GetBinContent(b)); | |
c10259fb | 8886 | Double_t dSumWLinear = 0.; // sum of linear event weights |
8887 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
8888 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
8889 | Double_t dError = 0.; // weighted and unbiased estimator for sigma | |
8890 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
8891 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
8892 | dSpread = f3pCorrelations->GetBinError(b); | |
8893 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
8894 | { | |
8895 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
8896 | f3pCumulants->SetBinError(b,dError); | |
8897 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
e1d101a6 | 8898 | } // end of for(Int_t b=1;b<=10;b++) |
8899 | ||
8900 | // c) Calculate 4-p cumulants: | |
8901 | // c1) "Single harmonic": | |
8902 | for(Int_t b=1;b<=6;b++) | |
8903 | { | |
8904 | f4pCumulants->SetBinContent(b,f4pCorrelations->GetBinContent(b)-2.*pow(f2pCorrelations->GetBinContent(b),2.)); | |
c10259fb | 8905 | Double_t dSumWLinearTwo = 0.; // sum of linear event weights for <2> |
8906 | Double_t dSumWQuadraticTwo = 0.; // sum of quadratic event weights <2> | |
8907 | Double_t dSpreadTwo = 0.; // weighted and biased estimator for sigma of <2> | |
8908 | Double_t dSumWLinearFour = 0.; // sum of linear event weights for <4> | |
8909 | Double_t dSumWQuadraticFour = 0.; // sum of quadratic event weights <4> | |
8910 | Double_t dSpreadFour = 0.; // weighted and biased estimator for sigma of <4> | |
8911 | dSumWLinearTwo = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
8912 | dSumWQuadraticTwo = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
8913 | dSpreadTwo = f2pCorrelations->GetBinError(b); | |
8914 | dSumWLinearFour = fMixedHarmonicEventWeights[0]->GetBinContent(4); | |
8915 | dSumWQuadraticFour = fMixedHarmonicEventWeights[1]->GetBinContent(4); | |
8916 | dSpreadFour = f4pCorrelations->GetBinError(b); | |
8917 | if(pow(dSumWLinearTwo,2.)>dSumWQuadraticTwo && pow(dSumWLinearFour,2.)>dSumWQuadraticFour) | |
8918 | { | |
8919 | Double_t dError = 16.*pow(f2pCorrelations->GetBinContent(b),2.) | |
8920 | * pow((pow(dSumWQuadraticTwo,0.5)/dSumWLinearTwo)*dSpreadTwo*pow(pow(dSumWLinearTwo,2.)/(pow(dSumWLinearTwo,2.)-dSumWQuadraticTwo),0.5),2.) | |
8921 | + pow((pow(dSumWQuadraticFour,0.5)/dSumWLinearFour)*dSpreadFour*pow(pow(dSumWLinearFour,2.)/(pow(dSumWLinearFour,2.)-dSumWQuadraticFour),0.5),2.) | |
8922 | - 8.*f2pCorrelations->GetBinContent(b) | |
8923 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
8924 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(b,b+15)) | |
8925 | - f2pCorrelations->GetBinContent(b)*f4pCorrelations->GetBinContent(b)) | |
8926 | / (dSumWLinearTwo*dSumWLinearFour-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))); | |
8927 | if(dError>0.) | |
8928 | { | |
8929 | f4pCumulants->SetBinError(b,pow(dError,0.5)); | |
8930 | } | |
8931 | } // end of if(pow(dSumWLinearTwo,2.)>dSumWQuadraticTwo && pow(dSumWLinearFour,2.)>dSumWQuadraticFour) | |
e1d101a6 | 8932 | } // end of for(Int_t b=1;b<=6;b++) |
8933 | // c2) "Standard candles": | |
c10259fb | 8934 | // <4>_{2n,1n|2n,1n}: |
e1d101a6 | 8935 | f4pCumulants->SetBinContent(8,f4pCorrelations->GetBinContent(8)-f2pCorrelations->GetBinContent(2)*f2pCorrelations->GetBinContent(1)); |
c10259fb | 8936 | { |
8937 | Double_t dSumWLinearTwo1n1n = 0.; // sum of linear event weights for <2> | |
8938 | Double_t dSumWQuadraticTwo1n1n = 0.; // sum of quadratic event weights <2> | |
8939 | Double_t dSpreadTwo1n1n = 0.; // weighted and biased estimator for sigma of <2> | |
8940 | Double_t dSumWLinearTwo2n2n = 0.; // sum of linear event weights for <2> | |
8941 | Double_t dSumWQuadraticTwo2n2n = 0.; // sum of quadratic event weights <2> | |
8942 | Double_t dSpreadTwo2n2n = 0.; // weighted and biased estimator for sigma of <2> | |
8943 | Double_t dSumWLinearFour2n1n2n1n = 0.; // sum of linear event weights for <4> | |
8944 | Double_t dSumWQuadraticFour2n1n2n1n = 0.; // sum of quadratic event weights <4> | |
8945 | Double_t dSpreadFour2n1n2n1n = 0.; // weighted and biased estimator for sigma of <4> | |
8946 | dSumWLinearTwo1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
8947 | dSumWQuadraticTwo1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
8948 | dSpreadTwo1n1n = f2pCorrelations->GetBinError(1); | |
8949 | dSumWLinearTwo2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
8950 | dSumWQuadraticTwo2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
8951 | dSpreadTwo2n2n = f2pCorrelations->GetBinError(2); | |
8952 | dSumWLinearFour2n1n2n1n = fMixedHarmonicEventWeights[0]->GetBinContent(4); | |
8953 | dSumWQuadraticFour2n1n2n1n = fMixedHarmonicEventWeights[1]->GetBinContent(4); | |
8954 | dSpreadFour2n1n2n1n = f4pCorrelations->GetBinError(8); | |
8955 | if(pow(dSumWLinearTwo1n1n,2.)>dSumWQuadraticTwo1n1n && | |
8956 | pow(dSumWLinearTwo2n2n,2.)>dSumWQuadraticTwo2n2n && | |
8957 | pow(dSumWLinearFour2n1n2n1n,2.)>dSumWQuadraticFour2n1n2n1n) | |
8958 | { | |
8959 | Double_t dError = pow(f2pCorrelations->GetBinContent(2),2.) | |
8960 | * pow((pow(dSumWQuadraticTwo1n1n,0.5)/dSumWLinearTwo1n1n) | |
8961 | * dSpreadTwo1n1n*pow(pow(dSumWLinearTwo1n1n,2.)/(pow(dSumWLinearTwo1n1n,2.)-dSumWQuadraticTwo1n1n),0.5),2.) | |
8962 | + pow(f2pCorrelations->GetBinContent(1),2.) | |
8963 | * pow((pow(dSumWQuadraticTwo2n2n,0.5)/dSumWLinearTwo2n2n) | |
8964 | * dSpreadTwo2n2n*pow(pow(dSumWLinearTwo2n2n,2.)/(pow(dSumWLinearTwo2n2n,2.)-dSumWQuadraticTwo2n2n),0.5),2.) | |
8965 | + pow((pow(dSumWQuadraticFour2n1n2n1n,0.5)/dSumWLinearFour2n1n2n1n) | |
8966 | * dSpreadFour2n1n2n1n*pow(pow(dSumWLinearFour2n1n2n1n,2.)/(pow(dSumWLinearFour2n1n2n1n,2.)-dSumWQuadraticFour2n1n2n1n),0.5),2.) | |
8967 | + 2.*f2pCorrelations->GetBinContent(2)*f2pCorrelations->GetBinContent(1) | |
8968 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2)) | |
8969 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,2)) | |
8970 | - f2pCorrelations->GetBinContent(1)*f2pCorrelations->GetBinContent(2)) | |
8971 | / (dSumWLinearTwo1n1n*dSumWLinearTwo2n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2))) | |
8972 | - 2.*f2pCorrelations->GetBinContent(2) | |
8973 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
8974 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,22)) | |
8975 | - f2pCorrelations->GetBinContent(1)*f4pCorrelations->GetBinContent(8)) | |
8976 | / (dSumWLinearTwo1n1n*dSumWLinearFour2n1n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))) | |
8977 | - 2.*f2pCorrelations->GetBinContent(1) | |
8978 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
8979 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,22)) | |
8980 | - f2pCorrelations->GetBinContent(2)*f4pCorrelations->GetBinContent(8)) | |
8981 | / (dSumWLinearTwo2n2n*dSumWLinearFour2n1n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))); | |
8982 | if(dError>0.) | |
8983 | { | |
8984 | f4pCumulants->SetBinError(8,pow(dError,0.5)); | |
8985 | } | |
8986 | } // end of if(...) | |
8987 | } // end of { | |
8988 | // <4>_{3n,1n|3n,1n}: | |
e1d101a6 | 8989 | f4pCumulants->SetBinContent(9,f4pCorrelations->GetBinContent(9)-f2pCorrelations->GetBinContent(3)*f2pCorrelations->GetBinContent(1)); |
c10259fb | 8990 | { |
8991 | Double_t dSumWLinearTwo1n1n = 0.; // sum of linear event weights for <2> | |
8992 | Double_t dSumWQuadraticTwo1n1n = 0.; // sum of quadratic event weights <2> | |
8993 | Double_t dSpreadTwo1n1n = 0.; // weighted and biased estimator for sigma of <2> | |
8994 | Double_t dSumWLinearTwo3n3n = 0.; // sum of linear event weights for <2> | |
8995 | Double_t dSumWQuadraticTwo3n3n = 0.; // sum of quadratic event weights <2> | |
8996 | Double_t dSpreadTwo3n3n = 0.; // weighted and biased estimator for sigma of <2> | |
8997 | Double_t dSumWLinearFour3n1n3n1n = 0.; // sum of linear event weights for <4> | |
8998 | Double_t dSumWQuadraticFour3n1n3n1n = 0.; // sum of quadratic event weights <4> | |
8999 | Double_t dSpreadFour3n1n3n1n = 0.; // weighted and biased estimator for sigma of <4> | |
9000 | dSumWLinearTwo1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9001 | dSumWQuadraticTwo1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9002 | dSpreadTwo1n1n = f2pCorrelations->GetBinError(1); | |
9003 | dSumWLinearTwo3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9004 | dSumWQuadraticTwo3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9005 | dSpreadTwo3n3n = f2pCorrelations->GetBinError(3); | |
9006 | dSumWLinearFour3n1n3n1n = fMixedHarmonicEventWeights[0]->GetBinContent(4); | |
9007 | dSumWQuadraticFour3n1n3n1n = fMixedHarmonicEventWeights[1]->GetBinContent(4); | |
9008 | dSpreadFour3n1n3n1n = f4pCorrelations->GetBinError(9); | |
9009 | if(pow(dSumWLinearTwo1n1n,2.)>dSumWQuadraticTwo1n1n && | |
9010 | pow(dSumWLinearTwo3n3n,2.)>dSumWQuadraticTwo3n3n && | |
9011 | pow(dSumWLinearFour3n1n3n1n,2.)>dSumWQuadraticFour3n1n3n1n) | |
9012 | { | |
9013 | Double_t dError = pow(f2pCorrelations->GetBinContent(3),2.) | |
9014 | * pow((pow(dSumWQuadraticTwo1n1n,0.5)/dSumWLinearTwo1n1n) | |
9015 | * dSpreadTwo1n1n*pow(pow(dSumWLinearTwo1n1n,2.)/(pow(dSumWLinearTwo1n1n,2.)-dSumWQuadraticTwo1n1n),0.5),2.) | |
9016 | + pow(f2pCorrelations->GetBinContent(1),2.) | |
9017 | * pow((pow(dSumWQuadraticTwo3n3n,0.5)/dSumWLinearTwo3n3n) | |
9018 | * dSpreadTwo3n3n*pow(pow(dSumWLinearTwo3n3n,2.)/(pow(dSumWLinearTwo3n3n,2.)-dSumWQuadraticTwo3n3n),0.5),2.) | |
9019 | + pow((pow(dSumWQuadraticFour3n1n3n1n,0.5)/dSumWLinearFour3n1n3n1n) | |
9020 | * dSpreadFour3n1n3n1n*pow(pow(dSumWLinearFour3n1n3n1n,2.)/(pow(dSumWLinearFour3n1n3n1n,2.)-dSumWQuadraticFour3n1n3n1n),0.5),2.) | |
9021 | + 2.*f2pCorrelations->GetBinContent(3)*f2pCorrelations->GetBinContent(1) | |
9022 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2)) | |
9023 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,3)) | |
9024 | - f2pCorrelations->GetBinContent(1)*f2pCorrelations->GetBinContent(3)) | |
9025 | / (dSumWLinearTwo1n1n*dSumWLinearTwo3n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2))) | |
9026 | - 2.*f2pCorrelations->GetBinContent(3) | |
9027 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9028 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,23)) | |
9029 | - f2pCorrelations->GetBinContent(1)*f4pCorrelations->GetBinContent(9)) | |
9030 | / (dSumWLinearTwo1n1n*dSumWLinearFour3n1n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))) | |
9031 | - 2.*f2pCorrelations->GetBinContent(1) | |
9032 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9033 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,23)) | |
9034 | - f2pCorrelations->GetBinContent(3)*f4pCorrelations->GetBinContent(9)) | |
9035 | / (dSumWLinearTwo3n3n*dSumWLinearFour3n1n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))); | |
9036 | if(dError>0.) | |
9037 | { | |
9038 | f4pCumulants->SetBinError(9,pow(dError,0.5)); | |
9039 | } | |
9040 | } // end of if(...) | |
9041 | } // end of { | |
9042 | // <4>_{3n,2n|3n,2n}: | |
e1d101a6 | 9043 | f4pCumulants->SetBinContent(10,f4pCorrelations->GetBinContent(10)-f2pCorrelations->GetBinContent(3)*f2pCorrelations->GetBinContent(2)); |
c10259fb | 9044 | { |
9045 | Double_t dSumWLinearTwo2n2n = 0.; // sum of linear event weights for <2> | |
9046 | Double_t dSumWQuadraticTwo2n2n = 0.; // sum of quadratic event weights <2> | |
9047 | Double_t dSpreadTwo2n2n = 0.; // weighted and biased estimator for sigma of <2> | |
9048 | Double_t dSumWLinearTwo3n3n = 0.; // sum of linear event weights for <2> | |
9049 | Double_t dSumWQuadraticTwo3n3n = 0.; // sum of quadratic event weights <2> | |
9050 | Double_t dSpreadTwo3n3n = 0.; // weighted and biased estimator for sigma of <2> | |
9051 | Double_t dSumWLinearFour3n2n3n2n = 0.; // sum of linear event weights for <4> | |
9052 | Double_t dSumWQuadraticFour3n2n3n2n = 0.; // sum of quadratic event weights <4> | |
9053 | Double_t dSpreadFour3n2n3n2n = 0.; // weighted and biased estimator for sigma of <4> | |
9054 | dSumWLinearTwo2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9055 | dSumWQuadraticTwo2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9056 | dSpreadTwo2n2n = f2pCorrelations->GetBinError(2); | |
9057 | dSumWLinearTwo3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9058 | dSumWQuadraticTwo3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9059 | dSpreadTwo3n3n = f2pCorrelations->GetBinError(3); | |
9060 | dSumWLinearFour3n2n3n2n = fMixedHarmonicEventWeights[0]->GetBinContent(4); | |
9061 | dSumWQuadraticFour3n2n3n2n = fMixedHarmonicEventWeights[1]->GetBinContent(4); | |
9062 | dSpreadFour3n2n3n2n = f4pCorrelations->GetBinError(10); | |
9063 | if(pow(dSumWLinearTwo2n2n,2.)>dSumWQuadraticTwo2n2n && | |
9064 | pow(dSumWLinearTwo3n3n,2.)>dSumWQuadraticTwo3n3n && | |
9065 | pow(dSumWLinearFour3n2n3n2n,2.)>dSumWQuadraticFour3n2n3n2n) | |
9066 | { | |
9067 | Double_t dError = pow(f2pCorrelations->GetBinContent(3),2.) | |
9068 | * pow((pow(dSumWQuadraticTwo2n2n,0.5)/dSumWLinearTwo2n2n) | |
9069 | * dSpreadTwo2n2n*pow(pow(dSumWLinearTwo2n2n,2.)/(pow(dSumWLinearTwo2n2n,2.)-dSumWQuadraticTwo2n2n),0.5),2.) | |
9070 | + pow(f2pCorrelations->GetBinContent(2),2.) | |
9071 | * pow((pow(dSumWQuadraticTwo3n3n,0.5)/dSumWLinearTwo3n3n) | |
9072 | * dSpreadTwo3n3n*pow(pow(dSumWLinearTwo3n3n,2.)/(pow(dSumWLinearTwo3n3n,2.)-dSumWQuadraticTwo3n3n),0.5),2.) | |
9073 | + pow((pow(dSumWQuadraticFour3n2n3n2n,0.5)/dSumWLinearFour3n2n3n2n) | |
9074 | * dSpreadFour3n2n3n2n*pow(pow(dSumWLinearFour3n2n3n2n,2.)/(pow(dSumWLinearFour3n2n3n2n,2.)-dSumWQuadraticFour3n2n3n2n),0.5),2.) | |
9075 | + 2.*f2pCorrelations->GetBinContent(3)*f2pCorrelations->GetBinContent(2) | |
9076 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2)) | |
9077 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,3)) | |
9078 | - f2pCorrelations->GetBinContent(2)*f2pCorrelations->GetBinContent(3)) | |
9079 | / (dSumWLinearTwo2n2n*dSumWLinearTwo3n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2))) | |
9080 | - 2.*f2pCorrelations->GetBinContent(3) | |
9081 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9082 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,24)) | |
9083 | - f2pCorrelations->GetBinContent(2)*f4pCorrelations->GetBinContent(10)) | |
9084 | / (dSumWLinearTwo2n2n*dSumWLinearFour3n2n3n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))) | |
9085 | - 2.*f2pCorrelations->GetBinContent(2) | |
9086 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9087 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,24)) | |
9088 | - f2pCorrelations->GetBinContent(3)*f4pCorrelations->GetBinContent(10)) | |
9089 | / (dSumWLinearTwo3n3n*dSumWLinearFour3n2n3n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))); | |
9090 | if(dError>0.) | |
9091 | { | |
9092 | f4pCumulants->SetBinError(10,pow(dError,0.5)); | |
9093 | } | |
9094 | } // end of if(...) | |
9095 | } // end of { | |
9096 | // <4>_{4n,1n|4n,1n} | |
e1d101a6 | 9097 | f4pCumulants->SetBinContent(11,f4pCorrelations->GetBinContent(11)-f2pCorrelations->GetBinContent(4)*f2pCorrelations->GetBinContent(1)); |
c10259fb | 9098 | { |
9099 | Double_t dSumWLinearTwo1n1n = 0.; // sum of linear event weights for <2> | |
9100 | Double_t dSumWQuadraticTwo1n1n = 0.; // sum of quadratic event weights <2> | |
9101 | Double_t dSpreadTwo1n1n = 0.; // weighted and biased estimator for sigma of <2> | |
9102 | Double_t dSumWLinearTwo4n4n = 0.; // sum of linear event weights for <2> | |
9103 | Double_t dSumWQuadraticTwo4n4n = 0.; // sum of quadratic event weights <2> | |
9104 | Double_t dSpreadTwo4n4n = 0.; // weighted and biased estimator for sigma of <2> | |
9105 | Double_t dSumWLinearFour4n1n4n1n = 0.; // sum of linear event weights for <4> | |
9106 | Double_t dSumWQuadraticFour4n1n4n1n = 0.; // sum of quadratic event weights <4> | |
9107 | Double_t dSpreadFour4n1n4n1n = 0.; // weighted and biased estimator for sigma of <4> | |
9108 | dSumWLinearTwo1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9109 | dSumWQuadraticTwo1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9110 | dSpreadTwo1n1n = f2pCorrelations->GetBinError(1); | |
9111 | dSumWLinearTwo4n4n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9112 | dSumWQuadraticTwo4n4n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9113 | dSpreadTwo4n4n = f2pCorrelations->GetBinError(4); | |
9114 | dSumWLinearFour4n1n4n1n = fMixedHarmonicEventWeights[0]->GetBinContent(4); | |
9115 | dSumWQuadraticFour4n1n4n1n = fMixedHarmonicEventWeights[1]->GetBinContent(4); | |
9116 | dSpreadFour4n1n4n1n = f4pCorrelations->GetBinError(11); | |
9117 | if(pow(dSumWLinearTwo1n1n,2.)>dSumWQuadraticTwo1n1n && | |
9118 | pow(dSumWLinearTwo4n4n,2.)>dSumWQuadraticTwo4n4n && | |
9119 | pow(dSumWLinearFour4n1n4n1n,2.)>dSumWQuadraticFour4n1n4n1n) | |
9120 | { | |
9121 | Double_t dError = pow(f2pCorrelations->GetBinContent(4),2.) | |
9122 | * pow((pow(dSumWQuadraticTwo1n1n,0.5)/dSumWLinearTwo1n1n) | |
9123 | * dSpreadTwo1n1n*pow(pow(dSumWLinearTwo1n1n,2.)/(pow(dSumWLinearTwo1n1n,2.)-dSumWQuadraticTwo1n1n),0.5),2.) | |
9124 | + pow(f2pCorrelations->GetBinContent(1),2.) | |
9125 | * pow((pow(dSumWQuadraticTwo4n4n,0.5)/dSumWLinearTwo4n4n) | |
9126 | * dSpreadTwo4n4n*pow(pow(dSumWLinearTwo4n4n,2.)/(pow(dSumWLinearTwo4n4n,2.)-dSumWQuadraticTwo4n4n),0.5),2.) | |
9127 | + pow((pow(dSumWQuadraticFour4n1n4n1n,0.5)/dSumWLinearFour4n1n4n1n) | |
9128 | * dSpreadFour4n1n4n1n*pow(pow(dSumWLinearFour4n1n4n1n,2.)/(pow(dSumWLinearFour4n1n4n1n,2.)-dSumWQuadraticFour4n1n4n1n),0.5),2.) | |
9129 | + 2.*f2pCorrelations->GetBinContent(4)*f2pCorrelations->GetBinContent(1) | |
9130 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2)) | |
9131 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,4)) | |
9132 | - f2pCorrelations->GetBinContent(1)*f2pCorrelations->GetBinContent(4)) | |
9133 | / (dSumWLinearTwo1n1n*dSumWLinearTwo4n4n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2))) | |
9134 | - 2.*f2pCorrelations->GetBinContent(4) | |
9135 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9136 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,25)) | |
9137 | - f2pCorrelations->GetBinContent(1)*f4pCorrelations->GetBinContent(11)) | |
9138 | / (dSumWLinearTwo1n1n*dSumWLinearFour4n1n4n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))) | |
9139 | - 2.*f2pCorrelations->GetBinContent(1) | |
9140 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9141 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,25)) | |
9142 | - f2pCorrelations->GetBinContent(4)*f4pCorrelations->GetBinContent(11)) | |
9143 | / (dSumWLinearTwo4n4n*dSumWLinearFour4n1n4n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))); | |
9144 | if(dError>0.) | |
9145 | { | |
9146 | f4pCumulants->SetBinError(11,pow(dError,0.5)); | |
9147 | } | |
9148 | } // end of if(...) | |
9149 | } // end of { | |
9150 | // <4>_{4n,2n|4n,2n} | |
e1d101a6 | 9151 | f4pCumulants->SetBinContent(12,f4pCorrelations->GetBinContent(12)-f2pCorrelations->GetBinContent(4)*f2pCorrelations->GetBinContent(2)); |
c10259fb | 9152 | { |
9153 | Double_t dSumWLinearTwo2n2n = 0.; // sum of linear event weights for <2> | |
9154 | Double_t dSumWQuadraticTwo2n2n = 0.; // sum of quadratic event weights <2> | |
9155 | Double_t dSpreadTwo2n2n = 0.; // weighted and biased estimator for sigma of <2> | |
9156 | Double_t dSumWLinearTwo4n4n = 0.; // sum of linear event weights for <2> | |
9157 | Double_t dSumWQuadraticTwo4n4n = 0.; // sum of quadratic event weights <2> | |
9158 | Double_t dSpreadTwo4n4n = 0.; // weighted and biased estimator for sigma of <2> | |
9159 | Double_t dSumWLinearFour4n2n4n2n = 0.; // sum of linear event weights for <4> | |
9160 | Double_t dSumWQuadraticFour4n2n4n2n = 0.; // sum of quadratic event weights <4> | |
9161 | Double_t dSpreadFour4n2n4n2n = 0.; // weighted and biased estimator for sigma of <4> | |
9162 | dSumWLinearTwo2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9163 | dSumWQuadraticTwo2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9164 | dSpreadTwo2n2n = f2pCorrelations->GetBinError(2); | |
9165 | dSumWLinearTwo4n4n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9166 | dSumWQuadraticTwo4n4n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9167 | dSpreadTwo4n4n = f2pCorrelations->GetBinError(4); | |
9168 | dSumWLinearFour4n2n4n2n = fMixedHarmonicEventWeights[0]->GetBinContent(4); | |
9169 | dSumWQuadraticFour4n2n4n2n = fMixedHarmonicEventWeights[1]->GetBinContent(4); | |
9170 | dSpreadFour4n2n4n2n = f4pCorrelations->GetBinError(12); | |
9171 | if(pow(dSumWLinearTwo2n2n,2.)>dSumWQuadraticTwo2n2n && | |
9172 | pow(dSumWLinearTwo4n4n,2.)>dSumWQuadraticTwo4n4n && | |
9173 | pow(dSumWLinearFour4n2n4n2n,2.)>dSumWQuadraticFour4n2n4n2n) | |
9174 | { | |
9175 | Double_t dError = pow(f2pCorrelations->GetBinContent(4),2.) | |
9176 | * pow((pow(dSumWQuadraticTwo2n2n,0.5)/dSumWLinearTwo2n2n) | |
9177 | * dSpreadTwo2n2n*pow(pow(dSumWLinearTwo2n2n,2.)/(pow(dSumWLinearTwo2n2n,2.)-dSumWQuadraticTwo2n2n),0.5),2.) | |
9178 | + pow(f2pCorrelations->GetBinContent(2),2.) | |
9179 | * pow((pow(dSumWQuadraticTwo4n4n,0.5)/dSumWLinearTwo4n4n) | |
9180 | * dSpreadTwo4n4n*pow(pow(dSumWLinearTwo4n4n,2.)/(pow(dSumWLinearTwo4n4n,2.)-dSumWQuadraticTwo4n4n),0.5),2.) | |
9181 | + pow((pow(dSumWQuadraticFour4n2n4n2n,0.5)/dSumWLinearFour4n2n4n2n) | |
9182 | * dSpreadFour4n2n4n2n*pow(pow(dSumWLinearFour4n2n4n2n,2.)/(pow(dSumWLinearFour4n2n4n2n,2.)-dSumWQuadraticFour4n2n4n2n),0.5),2.) | |
9183 | + 2.*f2pCorrelations->GetBinContent(4)*f2pCorrelations->GetBinContent(2) | |
9184 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2)) | |
9185 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,4)) | |
9186 | - f2pCorrelations->GetBinContent(2)*f2pCorrelations->GetBinContent(4)) | |
9187 | / (dSumWLinearTwo2n2n*dSumWLinearTwo4n4n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2))) | |
9188 | - 2.*f2pCorrelations->GetBinContent(4) | |
9189 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9190 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,25)) | |
9191 | - f2pCorrelations->GetBinContent(2)*f4pCorrelations->GetBinContent(12)) | |
9192 | / (dSumWLinearTwo2n2n*dSumWLinearFour4n2n4n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))) | |
9193 | - 2.*f2pCorrelations->GetBinContent(2) | |
9194 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9195 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,25)) | |
9196 | - f2pCorrelations->GetBinContent(4)*f4pCorrelations->GetBinContent(12)) | |
9197 | / (dSumWLinearTwo4n4n*dSumWLinearFour4n2n4n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))); | |
9198 | if(dError>0.) | |
9199 | { | |
9200 | f4pCumulants->SetBinError(12,pow(dError,0.5)); | |
9201 | } | |
9202 | } // end of if(...) | |
9203 | } // end of { | |
9204 | // <4>_{4n,3n|4n,3n} | |
e1d101a6 | 9205 | f4pCumulants->SetBinContent(13,f4pCorrelations->GetBinContent(13)-f2pCorrelations->GetBinContent(4)*f2pCorrelations->GetBinContent(3)); |
c10259fb | 9206 | { |
9207 | Double_t dSumWLinearTwo3n3n = 0.; // sum of linear event weights for <2> | |
9208 | Double_t dSumWQuadraticTwo3n3n = 0.; // sum of quadratic event weights <2> | |
9209 | Double_t dSpreadTwo3n3n = 0.; // weighted and biased estimator for sigma of <2> | |
9210 | Double_t dSumWLinearTwo4n4n = 0.; // sum of linear event weights for <2> | |
9211 | Double_t dSumWQuadraticTwo4n4n = 0.; // sum of quadratic event weights <2> | |
9212 | Double_t dSpreadTwo4n4n = 0.; // weighted and biased estimator for sigma of <2> | |
9213 | Double_t dSumWLinearFour4n3n4n3n = 0.; // sum of linear event weights for <4> | |
9214 | Double_t dSumWQuadraticFour4n3n4n3n = 0.; // sum of quadratic event weights <4> | |
9215 | Double_t dSpreadFour4n3n4n3n = 0.; // weighted and biased estimator for sigma of <4> | |
9216 | dSumWLinearTwo3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9217 | dSumWQuadraticTwo3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9218 | dSpreadTwo3n3n = f2pCorrelations->GetBinError(3); | |
9219 | dSumWLinearTwo4n4n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9220 | dSumWQuadraticTwo4n4n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9221 | dSpreadTwo4n4n = f2pCorrelations->GetBinError(4); | |
9222 | dSumWLinearFour4n3n4n3n = fMixedHarmonicEventWeights[0]->GetBinContent(4); | |
9223 | dSumWQuadraticFour4n3n4n3n = fMixedHarmonicEventWeights[1]->GetBinContent(4); | |
9224 | dSpreadFour4n3n4n3n = f4pCorrelations->GetBinError(13); | |
9225 | if(pow(dSumWLinearTwo3n3n,2.)>dSumWQuadraticTwo3n3n && | |
9226 | pow(dSumWLinearTwo4n4n,2.)>dSumWQuadraticTwo4n4n && | |
9227 | pow(dSumWLinearFour4n3n4n3n,2.)>dSumWQuadraticFour4n3n4n3n) | |
9228 | { | |
9229 | Double_t dError = pow(f2pCorrelations->GetBinContent(4),2.) | |
9230 | * pow((pow(dSumWQuadraticTwo3n3n,0.5)/dSumWLinearTwo3n3n) | |
9231 | * dSpreadTwo3n3n*pow(pow(dSumWLinearTwo3n3n,2.)/(pow(dSumWLinearTwo3n3n,2.)-dSumWQuadraticTwo3n3n),0.5),2.) | |
9232 | + pow(f2pCorrelations->GetBinContent(3),2.) | |
9233 | * pow((pow(dSumWQuadraticTwo4n4n,0.5)/dSumWLinearTwo4n4n) | |
9234 | * dSpreadTwo4n4n*pow(pow(dSumWLinearTwo4n4n,2.)/(pow(dSumWLinearTwo4n4n,2.)-dSumWQuadraticTwo4n4n),0.5),2.) | |
9235 | + pow((pow(dSumWQuadraticFour4n3n4n3n,0.5)/dSumWLinearFour4n3n4n3n) | |
9236 | * dSpreadFour4n3n4n3n*pow(pow(dSumWLinearFour4n3n4n3n,2.)/(pow(dSumWLinearFour4n3n4n3n,2.)-dSumWQuadraticFour4n3n4n3n),0.5),2.) | |
9237 | + 2.*f2pCorrelations->GetBinContent(4)*f2pCorrelations->GetBinContent(3) | |
9238 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2)) | |
9239 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,4)) | |
9240 | - f2pCorrelations->GetBinContent(3)*f2pCorrelations->GetBinContent(4)) | |
9241 | / (dSumWLinearTwo3n3n*dSumWLinearTwo4n4n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2))) | |
9242 | - 2.*f2pCorrelations->GetBinContent(4) | |
9243 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9244 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,26)) | |
9245 | - f2pCorrelations->GetBinContent(3)*f4pCorrelations->GetBinContent(13)) | |
9246 | / (dSumWLinearTwo3n3n*dSumWLinearFour4n3n4n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))) | |
9247 | - 2.*f2pCorrelations->GetBinContent(3) | |
9248 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9249 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,26)) | |
9250 | - f2pCorrelations->GetBinContent(4)*f4pCorrelations->GetBinContent(13)) | |
9251 | / (dSumWLinearTwo4n4n*dSumWLinearFour4n3n4n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))); | |
9252 | if(dError>0.) | |
9253 | { | |
9254 | f4pCumulants->SetBinError(13,pow(dError,0.5)); | |
9255 | } | |
9256 | } // end of if(...) | |
9257 | } // end of { | |
9258 | // <4>_{5n,1n|5n,1n} | |
e1d101a6 | 9259 | f4pCumulants->SetBinContent(14,f4pCorrelations->GetBinContent(14)-f2pCorrelations->GetBinContent(5)*f2pCorrelations->GetBinContent(1)); |
c10259fb | 9260 | { |
9261 | Double_t dSumWLinearTwo1n1n = 0.; // sum of linear event weights for <2> | |
9262 | Double_t dSumWQuadraticTwo1n1n = 0.; // sum of quadratic event weights <2> | |
9263 | Double_t dSpreadTwo1n1n = 0.; // weighted and biased estimator for sigma of <2> | |
9264 | Double_t dSumWLinearTwo5n5n = 0.; // sum of linear event weights for <2> | |
9265 | Double_t dSumWQuadraticTwo5n5n = 0.; // sum of quadratic event weights <2> | |
9266 | Double_t dSpreadTwo5n5n = 0.; // weighted and biased estimator for sigma of <2> | |
9267 | Double_t dSumWLinearFour5n1n5n1n = 0.; // sum of linear event weights for <4> | |
9268 | Double_t dSumWQuadraticFour5n1n5n1n = 0.; // sum of quadratic event weights <4> | |
9269 | Double_t dSpreadFour5n1n5n1n = 0.; // weighted and biased estimator for sigma of <4> | |
9270 | dSumWLinearTwo1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9271 | dSumWQuadraticTwo1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9272 | dSpreadTwo1n1n = f2pCorrelations->GetBinError(1); | |
9273 | dSumWLinearTwo5n5n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9274 | dSumWQuadraticTwo5n5n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9275 | dSpreadTwo5n5n = f2pCorrelations->GetBinError(5); | |
9276 | dSumWLinearFour5n1n5n1n = fMixedHarmonicEventWeights[0]->GetBinContent(4); | |
9277 | dSumWQuadraticFour5n1n5n1n = fMixedHarmonicEventWeights[1]->GetBinContent(4); | |
9278 | dSpreadFour5n1n5n1n = f4pCorrelations->GetBinError(14); | |
9279 | if(pow(dSumWLinearTwo1n1n,2.)>dSumWQuadraticTwo1n1n && | |
9280 | pow(dSumWLinearTwo5n5n,2.)>dSumWQuadraticTwo5n5n && | |
9281 | pow(dSumWLinearFour5n1n5n1n,2.)>dSumWQuadraticFour5n1n5n1n) | |
9282 | { | |
9283 | Double_t dError = pow(f2pCorrelations->GetBinContent(5),2.) | |
9284 | * pow((pow(dSumWQuadraticTwo1n1n,0.5)/dSumWLinearTwo1n1n) | |
9285 | * dSpreadTwo1n1n*pow(pow(dSumWLinearTwo1n1n,2.)/(pow(dSumWLinearTwo1n1n,2.)-dSumWQuadraticTwo1n1n),0.5),2.) | |
9286 | + pow(f2pCorrelations->GetBinContent(1),2.) | |
9287 | * pow((pow(dSumWQuadraticTwo5n5n,0.5)/dSumWLinearTwo5n5n) | |
9288 | * dSpreadTwo5n5n*pow(pow(dSumWLinearTwo5n5n,2.)/(pow(dSumWLinearTwo5n5n,2.)-dSumWQuadraticTwo5n5n),0.5),2.) | |
9289 | + pow((pow(dSumWQuadraticFour5n1n5n1n,0.5)/dSumWLinearFour5n1n5n1n) | |
9290 | * dSpreadFour5n1n5n1n*pow(pow(dSumWLinearFour5n1n5n1n,2.)/(pow(dSumWLinearFour5n1n5n1n,2.)-dSumWQuadraticFour5n1n5n1n),0.5),2.) | |
9291 | + 2.*f2pCorrelations->GetBinContent(5)*f2pCorrelations->GetBinContent(1) | |
9292 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2)) | |
9293 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,5)) | |
9294 | - f2pCorrelations->GetBinContent(1)*f2pCorrelations->GetBinContent(5)) | |
9295 | / (dSumWLinearTwo1n1n*dSumWLinearTwo5n5n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2))) | |
9296 | - 2.*f2pCorrelations->GetBinContent(5) | |
9297 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9298 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,28)) | |
9299 | - f2pCorrelations->GetBinContent(1)*f4pCorrelations->GetBinContent(14)) | |
9300 | / (dSumWLinearTwo1n1n*dSumWLinearFour5n1n5n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))) | |
9301 | - 2.*f2pCorrelations->GetBinContent(1) | |
9302 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9303 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,28)) | |
9304 | - f2pCorrelations->GetBinContent(5)*f4pCorrelations->GetBinContent(14)) | |
9305 | / (dSumWLinearTwo5n5n*dSumWLinearFour5n1n5n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))); | |
9306 | if(dError>0.) | |
9307 | { | |
9308 | f4pCumulants->SetBinError(14,pow(dError,0.5)); | |
9309 | } | |
9310 | } // end of if(...) | |
9311 | } // end of { | |
9312 | // <4>_{5n,2n|5n,2n} | |
e1d101a6 | 9313 | f4pCumulants->SetBinContent(15,f4pCorrelations->GetBinContent(15)-f2pCorrelations->GetBinContent(5)*f2pCorrelations->GetBinContent(2)); |
c10259fb | 9314 | { |
9315 | Double_t dSumWLinearTwo2n2n = 0.; // sum of linear event weights for <2> | |
9316 | Double_t dSumWQuadraticTwo2n2n = 0.; // sum of quadratic event weights <2> | |
9317 | Double_t dSpreadTwo2n2n = 0.; // weighted and biased estimator for sigma of <2> | |
9318 | Double_t dSumWLinearTwo5n5n = 0.; // sum of linear event weights for <2> | |
9319 | Double_t dSumWQuadraticTwo5n5n = 0.; // sum of quadratic event weights <2> | |
9320 | Double_t dSpreadTwo5n5n = 0.; // weighted and biased estimator for sigma of <2> | |
9321 | Double_t dSumWLinearFour5n2n5n2n = 0.; // sum of linear event weights for <4> | |
9322 | Double_t dSumWQuadraticFour5n2n5n2n = 0.; // sum of quadratic event weights <4> | |
9323 | Double_t dSpreadFour5n2n5n2n = 0.; // weighted and biased estimator for sigma of <4> | |
9324 | dSumWLinearTwo2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9325 | dSumWQuadraticTwo2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9326 | dSpreadTwo2n2n = f2pCorrelations->GetBinError(2); | |
9327 | dSumWLinearTwo5n5n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9328 | dSumWQuadraticTwo5n5n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9329 | dSpreadTwo5n5n = f2pCorrelations->GetBinError(5); | |
9330 | dSumWLinearFour5n2n5n2n = fMixedHarmonicEventWeights[0]->GetBinContent(4); | |
9331 | dSumWQuadraticFour5n2n5n2n = fMixedHarmonicEventWeights[1]->GetBinContent(4); | |
9332 | dSpreadFour5n2n5n2n = f4pCorrelations->GetBinError(15); | |
9333 | if(pow(dSumWLinearTwo2n2n,2.)>dSumWQuadraticTwo2n2n && | |
9334 | pow(dSumWLinearTwo5n5n,2.)>dSumWQuadraticTwo5n5n && | |
9335 | pow(dSumWLinearFour5n2n5n2n,2.)>dSumWQuadraticFour5n2n5n2n) | |
9336 | { | |
9337 | Double_t dError = pow(f2pCorrelations->GetBinContent(5),2.) | |
9338 | * pow((pow(dSumWQuadraticTwo2n2n,0.5)/dSumWLinearTwo2n2n) | |
9339 | * dSpreadTwo2n2n*pow(pow(dSumWLinearTwo2n2n,2.)/(pow(dSumWLinearTwo2n2n,2.)-dSumWQuadraticTwo2n2n),0.5),2.) | |
9340 | + pow(f2pCorrelations->GetBinContent(2),2.) | |
9341 | * pow((pow(dSumWQuadraticTwo5n5n,0.5)/dSumWLinearTwo5n5n) | |
9342 | * dSpreadTwo5n5n*pow(pow(dSumWLinearTwo5n5n,2.)/(pow(dSumWLinearTwo5n5n,2.)-dSumWQuadraticTwo5n5n),0.5),2.) | |
9343 | + pow((pow(dSumWQuadraticFour5n2n5n2n,0.5)/dSumWLinearFour5n2n5n2n) | |
9344 | * dSpreadFour5n2n5n2n*pow(pow(dSumWLinearFour5n2n5n2n,2.)/(pow(dSumWLinearFour5n2n5n2n,2.)-dSumWQuadraticFour5n2n5n2n),0.5),2.) | |
9345 | + 2.*f2pCorrelations->GetBinContent(5)*f2pCorrelations->GetBinContent(2) | |
9346 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2)) | |
9347 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,5)) | |
9348 | - f2pCorrelations->GetBinContent(2)*f2pCorrelations->GetBinContent(5)) | |
9349 | / (dSumWLinearTwo2n2n*dSumWLinearTwo5n5n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2))) | |
9350 | - 2.*f2pCorrelations->GetBinContent(5) | |
9351 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9352 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,29)) | |
9353 | - f2pCorrelations->GetBinContent(2)*f4pCorrelations->GetBinContent(15)) | |
9354 | / (dSumWLinearTwo2n2n*dSumWLinearFour5n2n5n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))) | |
9355 | - 2.*f2pCorrelations->GetBinContent(2) | |
9356 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9357 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,29)) | |
9358 | - f2pCorrelations->GetBinContent(5)*f4pCorrelations->GetBinContent(15)) | |
9359 | / (dSumWLinearTwo5n5n*dSumWLinearFour5n2n5n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))); | |
9360 | if(dError>0.) | |
9361 | { | |
9362 | f4pCumulants->SetBinError(15,pow(dError,0.5)); | |
9363 | } | |
9364 | } // end of if(...) | |
9365 | } // end of { | |
9366 | // <4>_{5n,3n|5n,3n} | |
e1d101a6 | 9367 | f4pCumulants->SetBinContent(16,f4pCorrelations->GetBinContent(16)-f2pCorrelations->GetBinContent(5)*f2pCorrelations->GetBinContent(3)); |
c10259fb | 9368 | { |
9369 | Double_t dSumWLinearTwo3n3n = 0.; // sum of linear event weights for <2> | |
9370 | Double_t dSumWQuadraticTwo3n3n = 0.; // sum of quadratic event weights <2> | |
9371 | Double_t dSpreadTwo3n3n = 0.; // weighted and biased estimator for sigma of <2> | |
9372 | Double_t dSumWLinearTwo5n5n = 0.; // sum of linear event weights for <2> | |
9373 | Double_t dSumWQuadraticTwo5n5n = 0.; // sum of quadratic event weights <2> | |
9374 | Double_t dSpreadTwo5n5n = 0.; // weighted and biased estimator for sigma of <2> | |
9375 | Double_t dSumWLinearFour5n3n5n3n = 0.; // sum of linear event weights for <4> | |
9376 | Double_t dSumWQuadraticFour5n3n5n3n = 0.; // sum of quadratic event weights <4> | |
9377 | Double_t dSpreadFour5n3n5n3n = 0.; // weighted and biased estimator for sigma of <4> | |
9378 | dSumWLinearTwo3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9379 | dSumWQuadraticTwo3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9380 | dSpreadTwo3n3n = f2pCorrelations->GetBinError(3); | |
9381 | dSumWLinearTwo5n5n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9382 | dSumWQuadraticTwo5n5n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9383 | dSpreadTwo5n5n = f2pCorrelations->GetBinError(5); | |
9384 | dSumWLinearFour5n3n5n3n = fMixedHarmonicEventWeights[0]->GetBinContent(4); | |
9385 | dSumWQuadraticFour5n3n5n3n = fMixedHarmonicEventWeights[1]->GetBinContent(4); | |
9386 | dSpreadFour5n3n5n3n = f4pCorrelations->GetBinError(16); | |
9387 | if(pow(dSumWLinearTwo3n3n,2.)>dSumWQuadraticTwo3n3n && | |
9388 | pow(dSumWLinearTwo5n5n,2.)>dSumWQuadraticTwo5n5n && | |
9389 | pow(dSumWLinearFour5n3n5n3n,2.)>dSumWQuadraticFour5n3n5n3n) | |
9390 | { | |
9391 | Double_t dError = pow(f2pCorrelations->GetBinContent(5),2.) | |
9392 | * pow((pow(dSumWQuadraticTwo3n3n,0.5)/dSumWLinearTwo3n3n) | |
9393 | * dSpreadTwo3n3n*pow(pow(dSumWLinearTwo3n3n,2.)/(pow(dSumWLinearTwo3n3n,2.)-dSumWQuadraticTwo3n3n),0.5),2.) | |
9394 | + pow(f2pCorrelations->GetBinContent(3),2.) | |
9395 | * pow((pow(dSumWQuadraticTwo5n5n,0.5)/dSumWLinearTwo5n5n) | |
9396 | * dSpreadTwo5n5n*pow(pow(dSumWLinearTwo5n5n,2.)/(pow(dSumWLinearTwo5n5n,2.)-dSumWQuadraticTwo5n5n),0.5),2.) | |
9397 | + pow((pow(dSumWQuadraticFour5n3n5n3n,0.5)/dSumWLinearFour5n3n5n3n) | |
9398 | * dSpreadFour5n3n5n3n*pow(pow(dSumWLinearFour5n3n5n3n,2.)/(pow(dSumWLinearFour5n3n5n3n,2.)-dSumWQuadraticFour5n3n5n3n),0.5),2.) | |
9399 | + 2.*f2pCorrelations->GetBinContent(5)*f2pCorrelations->GetBinContent(3) | |
9400 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2)) | |
9401 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,5)) | |
9402 | - f2pCorrelations->GetBinContent(3)*f2pCorrelations->GetBinContent(5)) | |
9403 | / (dSumWLinearTwo3n3n*dSumWLinearTwo5n5n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2))) | |
9404 | - 2.*f2pCorrelations->GetBinContent(5) | |
9405 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9406 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,30)) | |
9407 | - f2pCorrelations->GetBinContent(3)*f4pCorrelations->GetBinContent(16)) | |
9408 | / (dSumWLinearTwo3n3n*dSumWLinearFour5n3n5n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))) | |
9409 | - 2.*f2pCorrelations->GetBinContent(3) | |
9410 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9411 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,30)) | |
9412 | - f2pCorrelations->GetBinContent(5)*f4pCorrelations->GetBinContent(16)) | |
9413 | / (dSumWLinearTwo5n5n*dSumWLinearFour5n3n5n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))); | |
9414 | if(dError>0.) | |
9415 | { | |
9416 | f4pCumulants->SetBinError(16,pow(dError,0.5)); | |
9417 | } | |
9418 | } // end of if(...) | |
9419 | } // end of { | |
9420 | // <4>_{5n,4n|5n,4n} | |
e1d101a6 | 9421 | f4pCumulants->SetBinContent(17,f4pCorrelations->GetBinContent(17)-f2pCorrelations->GetBinContent(5)*f2pCorrelations->GetBinContent(4)); |
c10259fb | 9422 | { |
9423 | Double_t dSumWLinearTwo4n4n = 0.; // sum of linear event weights for <2> | |
9424 | Double_t dSumWQuadraticTwo4n4n = 0.; // sum of quadratic event weights <2> | |
9425 | Double_t dSpreadTwo4n4n = 0.; // weighted and biased estimator for sigma of <2> | |
9426 | Double_t dSumWLinearTwo5n5n = 0.; // sum of linear event weights for <2> | |
9427 | Double_t dSumWQuadraticTwo5n5n = 0.; // sum of quadratic event weights <2> | |
9428 | Double_t dSpreadTwo5n5n = 0.; // weighted and biased estimator for sigma of <2> | |
9429 | Double_t dSumWLinearFour5n4n5n4n = 0.; // sum of linear event weights for <4> | |
9430 | Double_t dSumWQuadraticFour5n4n5n4n = 0.; // sum of quadratic event weights <4> | |
9431 | Double_t dSpreadFour5n4n5n4n = 0.; // weighted and biased estimator for sigma of <4> | |
9432 | dSumWLinearTwo4n4n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9433 | dSumWQuadraticTwo4n4n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9434 | dSpreadTwo4n4n = f2pCorrelations->GetBinError(4); | |
9435 | dSumWLinearTwo5n5n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9436 | dSumWQuadraticTwo5n5n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9437 | dSpreadTwo5n5n = f2pCorrelations->GetBinError(5); | |
9438 | dSumWLinearFour5n4n5n4n = fMixedHarmonicEventWeights[0]->GetBinContent(4); | |
9439 | dSumWQuadraticFour5n4n5n4n = fMixedHarmonicEventWeights[1]->GetBinContent(4); | |
9440 | dSpreadFour5n4n5n4n = f4pCorrelations->GetBinError(17); | |
9441 | if(pow(dSumWLinearTwo4n4n,2.)>dSumWQuadraticTwo4n4n && | |
9442 | pow(dSumWLinearTwo5n5n,2.)>dSumWQuadraticTwo5n5n && | |
9443 | pow(dSumWLinearFour5n4n5n4n,2.)>dSumWQuadraticFour5n4n5n4n) | |
9444 | { | |
9445 | Double_t dError = pow(f2pCorrelations->GetBinContent(5),2.) | |
9446 | * pow((pow(dSumWQuadraticTwo4n4n,0.5)/dSumWLinearTwo4n4n) | |
9447 | * dSpreadTwo4n4n*pow(pow(dSumWLinearTwo4n4n,2.)/(pow(dSumWLinearTwo4n4n,2.)-dSumWQuadraticTwo4n4n),0.5),2.) | |
9448 | + pow(f2pCorrelations->GetBinContent(4),2.) | |
9449 | * pow((pow(dSumWQuadraticTwo5n5n,0.5)/dSumWLinearTwo5n5n) | |
9450 | * dSpreadTwo5n5n*pow(pow(dSumWLinearTwo5n5n,2.)/(pow(dSumWLinearTwo5n5n,2.)-dSumWQuadraticTwo5n5n),0.5),2.) | |
9451 | + pow((pow(dSumWQuadraticFour5n4n5n4n,0.5)/dSumWLinearFour5n4n5n4n) | |
9452 | * dSpreadFour5n4n5n4n*pow(pow(dSumWLinearFour5n4n5n4n,2.)/(pow(dSumWLinearFour5n4n5n4n,2.)-dSumWQuadraticFour5n4n5n4n),0.5),2.) | |
9453 | + 2.*f2pCorrelations->GetBinContent(5)*f2pCorrelations->GetBinContent(4) | |
9454 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2)) | |
9455 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,5)) | |
9456 | - f2pCorrelations->GetBinContent(4)*f2pCorrelations->GetBinContent(5)) | |
9457 | / (dSumWLinearTwo4n4n*dSumWLinearTwo5n5n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2))) | |
9458 | - 2.*f2pCorrelations->GetBinContent(5) | |
9459 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9460 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,31)) | |
9461 | - f2pCorrelations->GetBinContent(4)*f4pCorrelations->GetBinContent(17)) | |
9462 | / (dSumWLinearTwo4n4n*dSumWLinearFour5n4n5n4n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))) | |
9463 | - 2.*f2pCorrelations->GetBinContent(4) | |
9464 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9465 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,31)) | |
9466 | - f2pCorrelations->GetBinContent(5)*f4pCorrelations->GetBinContent(17)) | |
9467 | / (dSumWLinearTwo5n5n*dSumWLinearFour5n4n5n4n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))); | |
9468 | if(dError>0.) | |
9469 | { | |
9470 | f4pCumulants->SetBinError(17,pow(dError,0.5)); | |
9471 | } | |
9472 | } // end of if(...) | |
9473 | } // end of { | |
9474 | // <4>_{6n,1n|6n,1n} | |
e1d101a6 | 9475 | f4pCumulants->SetBinContent(18,f4pCorrelations->GetBinContent(18)-f2pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(1)); |
c10259fb | 9476 | { |
9477 | Double_t dSumWLinearTwo1n1n = 0.; // sum of linear event weights for <2> | |
9478 | Double_t dSumWQuadraticTwo1n1n = 0.; // sum of quadratic event weights <2> | |
9479 | Double_t dSpreadTwo1n1n = 0.; // weighted and biased estimator for sigma of <2> | |
9480 | Double_t dSumWLinearTwo6n6n = 0.; // sum of linear event weights for <2> | |
9481 | Double_t dSumWQuadraticTwo6n6n = 0.; // sum of quadratic event weights <2> | |
9482 | Double_t dSpreadTwo6n6n = 0.; // weighted and biased estimator for sigma of <2> | |
9483 | Double_t dSumWLinearFour6n1n6n1n = 0.; // sum of linear event weights for <4> | |
9484 | Double_t dSumWQuadraticFour6n1n6n1n = 0.; // sum of quadratic event weights <4> | |
9485 | Double_t dSpreadFour6n1n6n1n = 0.; // weighted and biased estimator for sigma of <4> | |
9486 | dSumWLinearTwo1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9487 | dSumWQuadraticTwo1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9488 | dSpreadTwo1n1n = f2pCorrelations->GetBinError(1); | |
9489 | dSumWLinearTwo6n6n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9490 | dSumWQuadraticTwo6n6n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9491 | dSpreadTwo6n6n = f2pCorrelations->GetBinError(6); | |
9492 | dSumWLinearFour6n1n6n1n = fMixedHarmonicEventWeights[0]->GetBinContent(4); | |
9493 | dSumWQuadraticFour6n1n6n1n = fMixedHarmonicEventWeights[1]->GetBinContent(4); | |
9494 | dSpreadFour6n1n6n1n = f4pCorrelations->GetBinError(18); | |
9495 | if(pow(dSumWLinearTwo1n1n,2.)>dSumWQuadraticTwo1n1n && | |
9496 | pow(dSumWLinearTwo6n6n,2.)>dSumWQuadraticTwo6n6n && | |
9497 | pow(dSumWLinearFour6n1n6n1n,2.)>dSumWQuadraticFour6n1n6n1n) | |
9498 | { | |
9499 | Double_t dError = pow(f2pCorrelations->GetBinContent(6),2.) | |
9500 | * pow((pow(dSumWQuadraticTwo1n1n,0.5)/dSumWLinearTwo1n1n) | |
9501 | * dSpreadTwo1n1n*pow(pow(dSumWLinearTwo1n1n,2.)/(pow(dSumWLinearTwo1n1n,2.)-dSumWQuadraticTwo1n1n),0.5),2.) | |
9502 | + pow(f2pCorrelations->GetBinContent(1),2.) | |
9503 | * pow((pow(dSumWQuadraticTwo6n6n,0.5)/dSumWLinearTwo6n6n) | |
9504 | * dSpreadTwo6n6n*pow(pow(dSumWLinearTwo6n6n,2.)/(pow(dSumWLinearTwo6n6n,2.)-dSumWQuadraticTwo6n6n),0.5),2.) | |
9505 | + pow((pow(dSumWQuadraticFour6n1n6n1n,0.5)/dSumWLinearFour6n1n6n1n) | |
9506 | * dSpreadFour6n1n6n1n*pow(pow(dSumWLinearFour6n1n6n1n,2.)/(pow(dSumWLinearFour6n1n6n1n,2.)-dSumWQuadraticFour6n1n6n1n),0.5),2.) | |
9507 | + 2.*f2pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(1) | |
9508 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2)) | |
9509 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,6)) | |
9510 | - f2pCorrelations->GetBinContent(1)*f2pCorrelations->GetBinContent(6)) | |
9511 | / (dSumWLinearTwo1n1n*dSumWLinearTwo6n6n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2))) | |
9512 | - 2.*f2pCorrelations->GetBinContent(6) | |
9513 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9514 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,32)) | |
9515 | - f2pCorrelations->GetBinContent(1)*f4pCorrelations->GetBinContent(18)) | |
9516 | / (dSumWLinearTwo1n1n*dSumWLinearFour6n1n6n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))) | |
9517 | - 2.*f2pCorrelations->GetBinContent(1) | |
9518 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9519 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,32)) | |
9520 | - f2pCorrelations->GetBinContent(6)*f4pCorrelations->GetBinContent(18)) | |
9521 | / (dSumWLinearTwo6n6n*dSumWLinearFour6n1n6n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))); | |
9522 | if(dError>0.) | |
9523 | { | |
9524 | f4pCumulants->SetBinError(18,pow(dError,0.5)); | |
9525 | } | |
9526 | } // end of if(...) | |
9527 | } // end of { | |
9528 | // <4>_{6n,2n|6n,2n} | |
e1d101a6 | 9529 | f4pCumulants->SetBinContent(19,f4pCorrelations->GetBinContent(19)-f2pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(2)); |
c10259fb | 9530 | { |
9531 | Double_t dSumWLinearTwo2n2n = 0.; // sum of linear event weights for <2> | |
9532 | Double_t dSumWQuadraticTwo2n2n = 0.; // sum of quadratic event weights <2> | |
9533 | Double_t dSpreadTwo2n2n = 0.; // weighted and biased estimator for sigma of <2> | |
9534 | Double_t dSumWLinearTwo6n6n = 0.; // sum of linear event weights for <2> | |
9535 | Double_t dSumWQuadraticTwo6n6n = 0.; // sum of quadratic event weights <2> | |
9536 | Double_t dSpreadTwo6n6n = 0.; // weighted and biased estimator for sigma of <2> | |
9537 | Double_t dSumWLinearFour6n2n6n2n = 0.; // sum of linear event weights for <4> | |
9538 | Double_t dSumWQuadraticFour6n2n6n2n = 0.; // sum of quadratic event weights <4> | |
9539 | Double_t dSpreadFour6n2n6n2n = 0.; // weighted and biased estimator for sigma of <4> | |
9540 | dSumWLinearTwo2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9541 | dSumWQuadraticTwo2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9542 | dSpreadTwo2n2n = f2pCorrelations->GetBinError(2); | |
9543 | dSumWLinearTwo6n6n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9544 | dSumWQuadraticTwo6n6n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9545 | dSpreadTwo6n6n = f2pCorrelations->GetBinError(6); | |
9546 | dSumWLinearFour6n2n6n2n = fMixedHarmonicEventWeights[0]->GetBinContent(4); | |
9547 | dSumWQuadraticFour6n2n6n2n = fMixedHarmonicEventWeights[1]->GetBinContent(4); | |
9548 | dSpreadFour6n2n6n2n = f4pCorrelations->GetBinError(19); | |
9549 | if(pow(dSumWLinearTwo2n2n,2.)>dSumWQuadraticTwo2n2n && | |
9550 | pow(dSumWLinearTwo6n6n,2.)>dSumWQuadraticTwo6n6n && | |
9551 | pow(dSumWLinearFour6n2n6n2n,2.)>dSumWQuadraticFour6n2n6n2n) | |
9552 | { | |
9553 | Double_t dError = pow(f2pCorrelations->GetBinContent(6),2.) | |
9554 | * pow((pow(dSumWQuadraticTwo2n2n,0.5)/dSumWLinearTwo2n2n) | |
9555 | * dSpreadTwo2n2n*pow(pow(dSumWLinearTwo2n2n,2.)/(pow(dSumWLinearTwo2n2n,2.)-dSumWQuadraticTwo2n2n),0.5),2.) | |
9556 | + pow(f2pCorrelations->GetBinContent(2),2.) | |
9557 | * pow((pow(dSumWQuadraticTwo6n6n,0.5)/dSumWLinearTwo6n6n) | |
9558 | * dSpreadTwo6n6n*pow(pow(dSumWLinearTwo6n6n,2.)/(pow(dSumWLinearTwo6n6n,2.)-dSumWQuadraticTwo6n6n),0.5),2.) | |
9559 | + pow((pow(dSumWQuadraticFour6n2n6n2n,0.5)/dSumWLinearFour6n2n6n2n) | |
9560 | * dSpreadFour6n2n6n2n*pow(pow(dSumWLinearFour6n2n6n2n,2.)/(pow(dSumWLinearFour6n2n6n2n,2.)-dSumWQuadraticFour6n2n6n2n),0.5),2.) | |
9561 | + 2.*f2pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(2) | |
9562 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2)) | |
9563 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,6)) | |
9564 | - f2pCorrelations->GetBinContent(2)*f2pCorrelations->GetBinContent(6)) | |
9565 | / (dSumWLinearTwo2n2n*dSumWLinearTwo6n6n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2))) | |
9566 | - 2.*f2pCorrelations->GetBinContent(6) | |
9567 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9568 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,33)) | |
9569 | - f2pCorrelations->GetBinContent(2)*f4pCorrelations->GetBinContent(19)) | |
9570 | / (dSumWLinearTwo2n2n*dSumWLinearFour6n2n6n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))) | |
9571 | - 2.*f2pCorrelations->GetBinContent(2) | |
9572 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9573 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,33)) | |
9574 | - f2pCorrelations->GetBinContent(6)*f4pCorrelations->GetBinContent(19)) | |
9575 | / (dSumWLinearTwo6n6n*dSumWLinearFour6n2n6n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))); | |
9576 | if(dError>0.) | |
9577 | { | |
9578 | f4pCumulants->SetBinError(19,pow(dError,0.5)); | |
9579 | } | |
9580 | } // end of if(...) | |
9581 | } // end of { | |
9582 | // <4>_{6n,3n|6n,3n} | |
e1d101a6 | 9583 | f4pCumulants->SetBinContent(20,f4pCorrelations->GetBinContent(20)-f2pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(3)); |
c10259fb | 9584 | { |
9585 | Double_t dSumWLinearTwo3n3n = 0.; // sum of linear event weights for <2> | |
9586 | Double_t dSumWQuadraticTwo3n3n = 0.; // sum of quadratic event weights <2> | |
9587 | Double_t dSpreadTwo3n3n = 0.; // weighted and biased estimator for sigma of <2> | |
9588 | Double_t dSumWLinearTwo6n6n = 0.; // sum of linear event weights for <2> | |
9589 | Double_t dSumWQuadraticTwo6n6n = 0.; // sum of quadratic event weights <2> | |
9590 | Double_t dSpreadTwo6n6n = 0.; // weighted and biased estimator for sigma of <2> | |
9591 | Double_t dSumWLinearFour6n3n6n3n = 0.; // sum of linear event weights for <4> | |
9592 | Double_t dSumWQuadraticFour6n3n6n3n = 0.; // sum of quadratic event weights <4> | |
9593 | Double_t dSpreadFour6n3n6n3n = 0.; // weighted and biased estimator for sigma of <4> | |
9594 | dSumWLinearTwo3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9595 | dSumWQuadraticTwo3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9596 | dSpreadTwo3n3n = f2pCorrelations->GetBinError(3); | |
9597 | dSumWLinearTwo6n6n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9598 | dSumWQuadraticTwo6n6n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9599 | dSpreadTwo6n6n = f2pCorrelations->GetBinError(6); | |
9600 | dSumWLinearFour6n3n6n3n = fMixedHarmonicEventWeights[0]->GetBinContent(4); | |
9601 | dSumWQuadraticFour6n3n6n3n = fMixedHarmonicEventWeights[1]->GetBinContent(4); | |
9602 | dSpreadFour6n3n6n3n = f4pCorrelations->GetBinError(20); | |
9603 | if(pow(dSumWLinearTwo3n3n,2.)>dSumWQuadraticTwo3n3n && | |
9604 | pow(dSumWLinearTwo6n6n,2.)>dSumWQuadraticTwo6n6n && | |
9605 | pow(dSumWLinearFour6n3n6n3n,2.)>dSumWQuadraticFour6n3n6n3n) | |
9606 | { | |
9607 | Double_t dError = pow(f2pCorrelations->GetBinContent(6),2.) | |
9608 | * pow((pow(dSumWQuadraticTwo3n3n,0.5)/dSumWLinearTwo3n3n) | |
9609 | * dSpreadTwo3n3n*pow(pow(dSumWLinearTwo3n3n,2.)/(pow(dSumWLinearTwo3n3n,2.)-dSumWQuadraticTwo3n3n),0.5),2.) | |
9610 | + pow(f2pCorrelations->GetBinContent(3),2.) | |
9611 | * pow((pow(dSumWQuadraticTwo6n6n,0.5)/dSumWLinearTwo6n6n) | |
9612 | * dSpreadTwo6n6n*pow(pow(dSumWLinearTwo6n6n,2.)/(pow(dSumWLinearTwo6n6n,2.)-dSumWQuadraticTwo6n6n),0.5),2.) | |
9613 | + pow((pow(dSumWQuadraticFour6n3n6n3n,0.5)/dSumWLinearFour6n3n6n3n) | |
9614 | * dSpreadFour6n3n6n3n*pow(pow(dSumWLinearFour6n3n6n3n,2.)/(pow(dSumWLinearFour6n3n6n3n,2.)-dSumWQuadraticFour6n3n6n3n),0.5),2.) | |
9615 | + 2.*f2pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(3) | |
9616 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2)) | |
9617 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,6)) | |
9618 | - f2pCorrelations->GetBinContent(3)*f2pCorrelations->GetBinContent(6)) | |
9619 | / (dSumWLinearTwo3n3n*dSumWLinearTwo6n6n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2))) | |
9620 | - 2.*f2pCorrelations->GetBinContent(6) | |
9621 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9622 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,34)) | |
9623 | - f2pCorrelations->GetBinContent(3)*f4pCorrelations->GetBinContent(20)) | |
9624 | / (dSumWLinearTwo3n3n*dSumWLinearFour6n3n6n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))) | |
9625 | - 2.*f2pCorrelations->GetBinContent(3) | |
9626 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9627 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,34)) | |
9628 | - f2pCorrelations->GetBinContent(6)*f4pCorrelations->GetBinContent(20)) | |
9629 | / (dSumWLinearTwo6n6n*dSumWLinearFour6n3n6n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))); | |
9630 | if(dError>0.) | |
9631 | { | |
9632 | f4pCumulants->SetBinError(20,pow(dError,0.5)); | |
9633 | } | |
9634 | } // end of if(...) | |
9635 | } // end of { | |
9636 | // <4>_{6n,4n|6n,4n} | |
e1d101a6 | 9637 | f4pCumulants->SetBinContent(21,f4pCorrelations->GetBinContent(21)-f2pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(4)); |
c10259fb | 9638 | { |
9639 | Double_t dSumWLinearTwo4n4n = 0.; // sum of linear event weights for <2> | |
9640 | Double_t dSumWQuadraticTwo4n4n = 0.; // sum of quadratic event weights <2> | |
9641 | Double_t dSpreadTwo4n4n = 0.; // weighted and biased estimator for sigma of <2> | |
9642 | Double_t dSumWLinearTwo6n6n = 0.; // sum of linear event weights for <2> | |
9643 | Double_t dSumWQuadraticTwo6n6n = 0.; // sum of quadratic event weights <2> | |
9644 | Double_t dSpreadTwo6n6n = 0.; // weighted and biased estimator for sigma of <2> | |
9645 | Double_t dSumWLinearFour6n4n6n4n = 0.; // sum of linear event weights for <4> | |
9646 | Double_t dSumWQuadraticFour6n4n6n4n = 0.; // sum of quadratic event weights <4> | |
9647 | Double_t dSpreadFour6n4n6n4n = 0.; // weighted and biased estimator for sigma of <4> | |
9648 | dSumWLinearTwo4n4n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9649 | dSumWQuadraticTwo4n4n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9650 | dSpreadTwo4n4n = f2pCorrelations->GetBinError(4); | |
9651 | dSumWLinearTwo6n6n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9652 | dSumWQuadraticTwo6n6n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9653 | dSpreadTwo6n6n = f2pCorrelations->GetBinError(6); | |
9654 | dSumWLinearFour6n4n6n4n = fMixedHarmonicEventWeights[0]->GetBinContent(4); | |
9655 | dSumWQuadraticFour6n4n6n4n = fMixedHarmonicEventWeights[1]->GetBinContent(4); | |
9656 | dSpreadFour6n4n6n4n = f4pCorrelations->GetBinError(21); | |
9657 | if(pow(dSumWLinearTwo4n4n,2.)>dSumWQuadraticTwo4n4n && | |
9658 | pow(dSumWLinearTwo6n6n,2.)>dSumWQuadraticTwo6n6n && | |
9659 | pow(dSumWLinearFour6n4n6n4n,2.)>dSumWQuadraticFour6n4n6n4n) | |
9660 | { | |
9661 | Double_t dError = pow(f2pCorrelations->GetBinContent(6),2.) | |
9662 | * pow((pow(dSumWQuadraticTwo4n4n,0.5)/dSumWLinearTwo4n4n) | |
9663 | * dSpreadTwo4n4n*pow(pow(dSumWLinearTwo4n4n,2.)/(pow(dSumWLinearTwo4n4n,2.)-dSumWQuadraticTwo4n4n),0.5),2.) | |
9664 | + pow(f2pCorrelations->GetBinContent(4),2.) | |
9665 | * pow((pow(dSumWQuadraticTwo6n6n,0.5)/dSumWLinearTwo6n6n) | |
9666 | * dSpreadTwo6n6n*pow(pow(dSumWLinearTwo6n6n,2.)/(pow(dSumWLinearTwo6n6n,2.)-dSumWQuadraticTwo6n6n),0.5),2.) | |
9667 | + pow((pow(dSumWQuadraticFour6n4n6n4n,0.5)/dSumWLinearFour6n4n6n4n) | |
9668 | * dSpreadFour6n4n6n4n*pow(pow(dSumWLinearFour6n4n6n4n,2.)/(pow(dSumWLinearFour6n4n6n4n,2.)-dSumWQuadraticFour6n4n6n4n),0.5),2.) | |
9669 | + 2.*f2pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(4) | |
9670 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2)) | |
9671 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,6)) | |
9672 | - f2pCorrelations->GetBinContent(4)*f2pCorrelations->GetBinContent(6)) | |
9673 | / (dSumWLinearTwo4n4n*dSumWLinearTwo6n6n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2))) | |
9674 | - 2.*f2pCorrelations->GetBinContent(6) | |
9675 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9676 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,35)) | |
9677 | - f2pCorrelations->GetBinContent(4)*f4pCorrelations->GetBinContent(21)) | |
9678 | / (dSumWLinearTwo4n4n*dSumWLinearFour6n4n6n4n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))) | |
9679 | - 2.*f2pCorrelations->GetBinContent(4) | |
9680 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9681 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,35)) | |
9682 | - f2pCorrelations->GetBinContent(6)*f4pCorrelations->GetBinContent(21)) | |
9683 | / (dSumWLinearTwo6n6n*dSumWLinearFour6n4n6n4n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))); | |
9684 | if(dError>0.) | |
9685 | { | |
9686 | f4pCumulants->SetBinError(21,pow(dError,0.5)); | |
9687 | } | |
9688 | } // end of if(...) | |
9689 | } // end of { | |
9690 | // <4>_{6n,5n|6n,5n} | |
e1d101a6 | 9691 | f4pCumulants->SetBinContent(22,f4pCorrelations->GetBinContent(22)-f2pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(5)); |
c10259fb | 9692 | { |
9693 | Double_t dSumWLinearTwo5n5n = 0.; // sum of linear event weights for <2> | |
9694 | Double_t dSumWQuadraticTwo5n5n = 0.; // sum of quadratic event weights <2> | |
9695 | Double_t dSpreadTwo5n5n = 0.; // weighted and biased estimator for sigma of <2> | |
9696 | Double_t dSumWLinearTwo6n6n = 0.; // sum of linear event weights for <2> | |
9697 | Double_t dSumWQuadraticTwo6n6n = 0.; // sum of quadratic event weights <2> | |
9698 | Double_t dSpreadTwo6n6n = 0.; // weighted and biased estimator for sigma of <2> | |
9699 | Double_t dSumWLinearFour6n5n6n5n = 0.; // sum of linear event weights for <4> | |
9700 | Double_t dSumWQuadraticFour6n5n6n5n = 0.; // sum of quadratic event weights <4> | |
9701 | Double_t dSpreadFour6n5n6n5n = 0.; // weighted and biased estimator for sigma of <4> | |
9702 | dSumWLinearTwo5n5n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9703 | dSumWQuadraticTwo5n5n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9704 | dSpreadTwo5n5n = f2pCorrelations->GetBinError(5); | |
9705 | dSumWLinearTwo6n6n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9706 | dSumWQuadraticTwo6n6n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9707 | dSpreadTwo6n6n = f2pCorrelations->GetBinError(6); | |
9708 | dSumWLinearFour6n5n6n5n = fMixedHarmonicEventWeights[0]->GetBinContent(4); | |
9709 | dSumWQuadraticFour6n5n6n5n = fMixedHarmonicEventWeights[1]->GetBinContent(4); | |
9710 | dSpreadFour6n5n6n5n = f4pCorrelations->GetBinError(22); | |
9711 | if(pow(dSumWLinearTwo5n5n,2.)>dSumWQuadraticTwo5n5n && | |
9712 | pow(dSumWLinearTwo6n6n,2.)>dSumWQuadraticTwo6n6n && | |
9713 | pow(dSumWLinearFour6n5n6n5n,2.)>dSumWQuadraticFour6n5n6n5n) | |
9714 | { | |
9715 | Double_t dError = pow(f2pCorrelations->GetBinContent(6),2.) | |
9716 | * pow((pow(dSumWQuadraticTwo5n5n,0.5)/dSumWLinearTwo5n5n) | |
9717 | * dSpreadTwo5n5n*pow(pow(dSumWLinearTwo5n5n,2.)/(pow(dSumWLinearTwo5n5n,2.)-dSumWQuadraticTwo5n5n),0.5),2.) | |
9718 | + pow(f2pCorrelations->GetBinContent(5),2.) | |
9719 | * pow((pow(dSumWQuadraticTwo6n6n,0.5)/dSumWLinearTwo6n6n) | |
9720 | * dSpreadTwo6n6n*pow(pow(dSumWLinearTwo6n6n,2.)/(pow(dSumWLinearTwo6n6n,2.)-dSumWQuadraticTwo6n6n),0.5),2.) | |
9721 | + pow((pow(dSumWQuadraticFour6n5n6n5n,0.5)/dSumWLinearFour6n5n6n5n) | |
9722 | * dSpreadFour6n5n6n5n*pow(pow(dSumWLinearFour6n5n6n5n,2.)/(pow(dSumWLinearFour6n5n6n5n,2.)-dSumWQuadraticFour6n5n6n5n),0.5),2.) | |
9723 | + 2.*f2pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(5) | |
9724 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2)) | |
9725 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,6)) | |
9726 | - f2pCorrelations->GetBinContent(5)*f2pCorrelations->GetBinContent(6)) | |
9727 | / (dSumWLinearTwo5n5n*dSumWLinearTwo6n6n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,2))) | |
9728 | - 2.*f2pCorrelations->GetBinContent(6) | |
9729 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9730 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,36)) | |
9731 | - f2pCorrelations->GetBinContent(5)*f4pCorrelations->GetBinContent(22)) | |
9732 | / (dSumWLinearTwo5n5n*dSumWLinearFour6n5n6n5n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))) | |
9733 | - 2.*f2pCorrelations->GetBinContent(5) | |
9734 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4)) | |
9735 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,36)) | |
9736 | - f2pCorrelations->GetBinContent(6)*f4pCorrelations->GetBinContent(22)) | |
9737 | / (dSumWLinearTwo6n6n*dSumWLinearFour6n5n6n5n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,4))); | |
9738 | if(dError>0.) | |
9739 | { | |
9740 | f4pCumulants->SetBinError(22,pow(dError,0.5)); | |
9741 | } | |
9742 | } // end of if(...) | |
9743 | } // end of { | |
9744 | ||
e1d101a6 | 9745 | // c3) "Two distinct harmonics": |
9746 | for(Int_t b=24;b<=25;b++) | |
9747 | { | |
9748 | f4pCumulants->SetBinContent(b,f4pCorrelations->GetBinContent(b)); | |
c10259fb | 9749 | Double_t dSumWLinear = 0.; // sum of linear event weights |
9750 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
9751 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
9752 | Double_t dError = 0.; // weighted and unbiased estimator for sigma | |
9753 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(4); | |
9754 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(4); | |
9755 | dSpread = f4pCorrelations->GetBinError(b); | |
9756 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
9757 | { | |
9758 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
9759 | f4pCumulants->SetBinError(b,dError); | |
9760 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
e1d101a6 | 9761 | } // end of for(Int_t b=24;b<=25;b++) |
9762 | // c4) "Three distinct harmonics": | |
9763 | for(Int_t b=27;b<=36;b++) | |
9764 | { | |
9765 | f4pCumulants->SetBinContent(b,f4pCorrelations->GetBinContent(b)); | |
c10259fb | 9766 | Double_t dSumWLinear = 0.; // sum of linear event weights |
9767 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
9768 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
9769 | Double_t dError = 0.; // weighted and unbiased estimator for sigma | |
9770 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(4); | |
9771 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(4); | |
9772 | dSpread = f4pCorrelations->GetBinError(b); | |
9773 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
9774 | { | |
9775 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
9776 | f4pCumulants->SetBinError(b,dError); | |
9777 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
e1d101a6 | 9778 | } // end of for(Int_t b=27;b<=36;b++) |
9779 | // c5) "Four distinct harmonics": | |
9780 | for(Int_t b=38;b<=45;b++) | |
9781 | { | |
9782 | f4pCumulants->SetBinContent(b,f4pCorrelations->GetBinContent(b)); | |
c10259fb | 9783 | Double_t dSumWLinear = 0.; // sum of linear event weights |
9784 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
9785 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
9786 | Double_t dError = 0.; // weighted and unbiased estimator for sigma | |
9787 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(4); | |
9788 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(4); | |
9789 | dSpread = f4pCorrelations->GetBinError(b); | |
9790 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
9791 | { | |
9792 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
9793 | f4pCumulants->SetBinError(b,dError); | |
9794 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
e1d101a6 | 9795 | } // end of for(Int_t b=38;b<=45;b++) |
9796 | ||
9797 | // d) Calculate 5-p cumulants: | |
9798 | // d1) "Standard candles": | |
9799 | f5pCumulants->SetBinContent(1,f5pCorrelations->GetBinContent(1)-f3pCorrelations->GetBinContent(1)*f2pCorrelations->GetBinContent(3)); | |
c10259fb | 9800 | { |
9801 | Double_t dSumWLinearTwo3n3n = 0.; // sum of linear event weights for <2> | |
9802 | Double_t dSumWQuadraticTwo3n3n = 0.; // sum of quadratic event weights <2> | |
9803 | Double_t dSpreadTwo3n3n = 0.; // weighted and biased estimator for sigma of <2> | |
9804 | Double_t dSumWLinearThree2n1n1n = 0.; // sum of linear event weights for <2> | |
9805 | Double_t dSumWQuadraticThree2n1n1n = 0.; // sum of quadratic event weights <2> | |
9806 | Double_t dSpreadThree2n1n1n = 0.; // weighted and biased estimator for sigma of <2> | |
9807 | Double_t dSumWLinearFive3n2n3n1n1n = 0.; // sum of linear event weights for <4> | |
9808 | Double_t dSumWQuadraticFive3n2n3n1n1n = 0.; // sum of quadratic event weights <4> | |
9809 | Double_t dSpreadFive3n2n3n1n1n = 0.; // weighted and biased estimator for sigma of <4> | |
9810 | dSumWLinearTwo3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9811 | dSumWQuadraticTwo3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9812 | dSpreadTwo3n3n = f2pCorrelations->GetBinError(3); | |
9813 | dSumWLinearThree2n1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
9814 | dSumWQuadraticThree2n1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
9815 | dSpreadThree2n1n1n = f3pCorrelations->GetBinError(1); | |
9816 | dSumWLinearFive3n2n3n1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
9817 | dSumWQuadraticFive3n2n3n1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
9818 | dSpreadFive3n2n3n1n1n = f5pCorrelations->GetBinError(1); | |
9819 | if(pow(dSumWLinearTwo3n3n,2.)>dSumWQuadraticTwo3n3n && | |
9820 | pow(dSumWLinearThree2n1n1n,2.)>dSumWQuadraticThree2n1n1n && | |
9821 | pow(dSumWLinearFive3n2n3n1n1n,2.)>dSumWQuadraticFive3n2n3n1n1n) | |
9822 | { | |
9823 | Double_t dError = pow(f3pCorrelations->GetBinContent(1),2.) | |
9824 | * pow((pow(dSumWQuadraticTwo3n3n,0.5)/dSumWLinearTwo3n3n) | |
9825 | * dSpreadTwo3n3n*pow(pow(dSumWLinearTwo3n3n,2.)/(pow(dSumWLinearTwo3n3n,2.)-dSumWQuadraticTwo3n3n),0.5),2.) | |
9826 | + pow(f2pCorrelations->GetBinContent(3),2.) | |
9827 | * pow((pow(dSumWQuadraticThree2n1n1n,0.5)/dSumWLinearThree2n1n1n) | |
9828 | * dSpreadThree2n1n1n*pow(pow(dSumWLinearThree2n1n1n,2.)/(pow(dSumWLinearThree2n1n1n,2.)-dSumWQuadraticThree2n1n1n),0.5),2.) | |
9829 | + pow((pow(dSumWQuadraticFive3n2n3n1n1n,0.5)/dSumWLinearFive3n2n3n1n1n) | |
9830 | * dSpreadFive3n2n3n1n1n*pow(pow(dSumWLinearFive3n2n3n1n1n,2.)/(pow(dSumWLinearFive3n2n3n1n1n,2.)-dSumWQuadraticFive3n2n3n1n1n),0.5),2.) | |
9831 | + 2.*f3pCorrelations->GetBinContent(1)*f2pCorrelations->GetBinContent(3) | |
9832 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
9833 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,7)) | |
9834 | - f2pCorrelations->GetBinContent(3)*f3pCorrelations->GetBinContent(1)) | |
9835 | / (dSumWLinearTwo3n3n*dSumWLinearThree2n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
9836 | - 2.*f3pCorrelations->GetBinContent(1) | |
9837 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
9838 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,57)) | |
9839 | - f2pCorrelations->GetBinContent(3)*f5pCorrelations->GetBinContent(1)) | |
9840 | / (dSumWLinearTwo3n3n*dSumWLinearFive3n2n3n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
9841 | - 2.*f2pCorrelations->GetBinContent(3) | |
9842 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
9843 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(7,57)) | |
9844 | - f3pCorrelations->GetBinContent(1)*f5pCorrelations->GetBinContent(1)) | |
9845 | / (dSumWLinearThree2n1n1n*dSumWLinearFive3n2n3n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
9846 | if(dError>0.) | |
9847 | { | |
9848 | f5pCumulants->SetBinError(1,pow(dError,0.5)); | |
9849 | } | |
9850 | } // end of if(...) | |
9851 | } // end of { | |
9852 | ||
e1d101a6 | 9853 | f5pCumulants->SetBinContent(2,f5pCorrelations->GetBinContent(2)-f3pCorrelations->GetBinContent(2)*f2pCorrelations->GetBinContent(1)); |
c10259fb | 9854 | { |
9855 | Double_t dSumWLinearTwo1n1n = 0.; // sum of linear event weights for <2> | |
9856 | Double_t dSumWQuadraticTwo1n1n = 0.; // sum of quadratic event weights <2> | |
9857 | Double_t dSpreadTwo1n1n = 0.; // weighted and biased estimator for sigma of <2> | |
9858 | Double_t dSumWLinearThree4n2n2n = 0.; // sum of linear event weights for <2> | |
9859 | Double_t dSumWQuadraticThree4n2n2n = 0.; // sum of quadratic event weights <2> | |
9860 | Double_t dSpreadThree4n2n2n = 0.; // weighted and biased estimator for sigma of <2> | |
9861 | Double_t dSumWLinearFive4n1n2n2n1n = 0.; // sum of linear event weights for <4> | |
9862 | Double_t dSumWQuadraticFive4n1n2n2n1n = 0.; // sum of quadratic event weights <4> | |
9863 | Double_t dSpreadFive4n1n2n2n1n = 0.; // weighted and biased estimator for sigma of <4> | |
9864 | dSumWLinearTwo1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9865 | dSumWQuadraticTwo1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9866 | dSpreadTwo1n1n = f2pCorrelations->GetBinError(1); | |
9867 | dSumWLinearThree4n2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
9868 | dSumWQuadraticThree4n2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
9869 | dSpreadThree4n2n2n = f3pCorrelations->GetBinError(2); | |
9870 | dSumWLinearFive4n1n2n2n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
9871 | dSumWQuadraticFive4n1n2n2n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
9872 | dSpreadFive4n1n2n2n1n = f5pCorrelations->GetBinError(2); | |
9873 | if(pow(dSumWLinearTwo1n1n,2.)>dSumWQuadraticTwo1n1n && | |
9874 | pow(dSumWLinearThree4n2n2n,2.)>dSumWQuadraticThree4n2n2n && | |
9875 | pow(dSumWLinearFive4n1n2n2n1n,2.)>dSumWQuadraticFive4n1n2n2n1n) | |
9876 | { | |
9877 | Double_t dError = pow(f3pCorrelations->GetBinContent(2),2.) | |
9878 | * pow((pow(dSumWQuadraticTwo1n1n,0.5)/dSumWLinearTwo1n1n) | |
9879 | * dSpreadTwo1n1n*pow(pow(dSumWLinearTwo1n1n,2.)/(pow(dSumWLinearTwo1n1n,2.)-dSumWQuadraticTwo1n1n),0.5),2.) | |
9880 | + pow(f2pCorrelations->GetBinContent(1),2.) | |
9881 | * pow((pow(dSumWQuadraticThree4n2n2n,0.5)/dSumWLinearThree4n2n2n) | |
9882 | * dSpreadThree4n2n2n*pow(pow(dSumWLinearThree4n2n2n,2.)/(pow(dSumWLinearThree4n2n2n,2.)-dSumWQuadraticThree4n2n2n),0.5),2.) | |
9883 | + pow((pow(dSumWQuadraticFive4n1n2n2n1n,0.5)/dSumWLinearFive4n1n2n2n1n) | |
9884 | * dSpreadFive4n1n2n2n1n*pow(pow(dSumWLinearFive4n1n2n2n1n,2.)/(pow(dSumWLinearFive4n1n2n2n1n,2.)-dSumWQuadraticFive4n1n2n2n1n),0.5),2.) | |
9885 | + 2.*f3pCorrelations->GetBinContent(2)*f2pCorrelations->GetBinContent(1) | |
9886 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
9887 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,8)) | |
9888 | - f2pCorrelations->GetBinContent(1)*f3pCorrelations->GetBinContent(2)) | |
9889 | / (dSumWLinearTwo1n1n*dSumWLinearThree4n2n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
9890 | - 2.*f3pCorrelations->GetBinContent(2) | |
9891 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
9892 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,58)) | |
9893 | - f2pCorrelations->GetBinContent(1)*f5pCorrelations->GetBinContent(2)) | |
9894 | / (dSumWLinearTwo1n1n*dSumWLinearFive4n1n2n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
9895 | - 2.*f2pCorrelations->GetBinContent(1) | |
9896 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
9897 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(8,58)) | |
9898 | - f3pCorrelations->GetBinContent(2)*f5pCorrelations->GetBinContent(2)) | |
9899 | / (dSumWLinearThree4n2n2n*dSumWLinearFive4n1n2n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
9900 | if(dError>0.) | |
9901 | { | |
9902 | f5pCumulants->SetBinError(2,pow(dError,0.5)); | |
9903 | } | |
9904 | } // end of if(...) | |
9905 | } // end of { | |
e1d101a6 | 9906 | f5pCumulants->SetBinContent(3,f5pCorrelations->GetBinContent(3)-f3pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(2)); |
c10259fb | 9907 | { |
9908 | Double_t dSumWLinearTwo2n2n = 0.; // sum of linear event weights for <2> | |
9909 | Double_t dSumWQuadraticTwo2n2n = 0.; // sum of quadratic event weights <2> | |
9910 | Double_t dSpreadTwo2n2n = 0.; // weighted and biased estimator for sigma of <2> | |
9911 | Double_t dSumWLinearThree4n3n1n = 0.; // sum of linear event weights for <2> | |
9912 | Double_t dSumWQuadraticThree4n3n1n = 0.; // sum of quadratic event weights <2> | |
9913 | Double_t dSpreadThree4n3n1n = 0.; // weighted and biased estimator for sigma of <2> | |
9914 | Double_t dSumWLinearFive4n2n3n2n1n = 0.; // sum of linear event weights for <4> | |
9915 | Double_t dSumWQuadraticFive4n2n3n2n1n = 0.; // sum of quadratic event weights <4> | |
9916 | Double_t dSpreadFive4n2n3n2n1n = 0.; // weighted and biased estimator for sigma of <4> | |
9917 | dSumWLinearTwo2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9918 | dSumWQuadraticTwo2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9919 | dSpreadTwo2n2n = f2pCorrelations->GetBinError(2); | |
9920 | dSumWLinearThree4n3n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
9921 | dSumWQuadraticThree4n3n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
9922 | dSpreadThree4n3n1n = f3pCorrelations->GetBinError(6); | |
9923 | dSumWLinearFive4n2n3n2n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
9924 | dSumWQuadraticFive4n2n3n2n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
9925 | dSpreadFive4n2n3n2n1n = f5pCorrelations->GetBinError(3); | |
9926 | if(pow(dSumWLinearTwo2n2n,2.)>dSumWQuadraticTwo2n2n && | |
9927 | pow(dSumWLinearThree4n3n1n,2.)>dSumWQuadraticThree4n3n1n && | |
9928 | pow(dSumWLinearFive4n2n3n2n1n,2.)>dSumWQuadraticFive4n2n3n2n1n) | |
9929 | { | |
9930 | Double_t dError = pow(f3pCorrelations->GetBinContent(6),2.) | |
9931 | * pow((pow(dSumWQuadraticTwo2n2n,0.5)/dSumWLinearTwo2n2n) | |
9932 | * dSpreadTwo2n2n*pow(pow(dSumWLinearTwo2n2n,2.)/(pow(dSumWLinearTwo2n2n,2.)-dSumWQuadraticTwo2n2n),0.5),2.) | |
9933 | + pow(f2pCorrelations->GetBinContent(2),2.) | |
9934 | * pow((pow(dSumWQuadraticThree4n3n1n,0.5)/dSumWLinearThree4n3n1n) | |
9935 | * dSpreadThree4n3n1n*pow(pow(dSumWLinearThree4n3n1n,2.)/(pow(dSumWLinearThree4n3n1n,2.)-dSumWQuadraticThree4n3n1n),0.5),2.) | |
9936 | + pow((pow(dSumWQuadraticFive4n2n3n2n1n,0.5)/dSumWLinearFive4n2n3n2n1n) | |
9937 | * dSpreadFive4n2n3n2n1n*pow(pow(dSumWLinearFive4n2n3n2n1n,2.)/(pow(dSumWLinearFive4n2n3n2n1n,2.)-dSumWQuadraticFive4n2n3n2n1n),0.5),2.) | |
9938 | + 2.*f3pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(2) | |
9939 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
9940 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,11)) | |
9941 | - f2pCorrelations->GetBinContent(2)*f3pCorrelations->GetBinContent(6)) | |
9942 | / (dSumWLinearTwo2n2n*dSumWLinearThree4n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
9943 | - 2.*f3pCorrelations->GetBinContent(6) | |
9944 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
9945 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,59)) | |
9946 | - f2pCorrelations->GetBinContent(2)*f5pCorrelations->GetBinContent(3)) | |
9947 | / (dSumWLinearTwo2n2n*dSumWLinearFive4n2n3n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
9948 | - 2.*f2pCorrelations->GetBinContent(2) | |
9949 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
9950 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(11,59)) | |
9951 | - f3pCorrelations->GetBinContent(6)*f5pCorrelations->GetBinContent(3)) | |
9952 | / (dSumWLinearThree4n3n1n*dSumWLinearFive4n2n3n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
9953 | if(dError>0.) | |
9954 | { | |
9955 | f5pCumulants->SetBinError(3,pow(dError,0.5)); | |
9956 | } | |
9957 | } // end of if(...) | |
9958 | } // end of { | |
e1d101a6 | 9959 | f5pCumulants->SetBinContent(4,f5pCorrelations->GetBinContent(4)-f3pCorrelations->GetBinContent(2)*f2pCorrelations->GetBinContent(3)); |
c10259fb | 9960 | { |
9961 | Double_t dSumWLinearTwo3n3n = 0.; // sum of linear event weights for <2> | |
9962 | Double_t dSumWQuadraticTwo3n3n = 0.; // sum of quadratic event weights <2> | |
9963 | Double_t dSpreadTwo3n3n = 0.; // weighted and biased estimator for sigma of <2> | |
9964 | Double_t dSumWLinearThree4n2n2n = 0.; // sum of linear event weights for <2> | |
9965 | Double_t dSumWQuadraticThree4n2n2n = 0.; // sum of quadratic event weights <2> | |
9966 | Double_t dSpreadThree4n2n2n = 0.; // weighted and biased estimator for sigma of <2> | |
9967 | Double_t dSumWLinearFive4n3n3n2n2n = 0.; // sum of linear event weights for <4> | |
9968 | Double_t dSumWQuadraticFive4n3n3n2n2n = 0.; // sum of quadratic event weights <4> | |
9969 | Double_t dSpreadFive4n3n3n2n2n = 0.; // weighted and biased estimator for sigma of <4> | |
9970 | dSumWLinearTwo3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
9971 | dSumWQuadraticTwo3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
9972 | dSpreadTwo3n3n = f2pCorrelations->GetBinError(3); | |
9973 | dSumWLinearThree4n2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
9974 | dSumWQuadraticThree4n2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
9975 | dSpreadThree4n2n2n = f3pCorrelations->GetBinError(2); | |
9976 | dSumWLinearFive4n3n3n2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
9977 | dSumWQuadraticFive4n3n3n2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
9978 | dSpreadFive4n3n3n2n2n = f5pCorrelations->GetBinError(4); | |
9979 | if(pow(dSumWLinearTwo3n3n,2.)>dSumWQuadraticTwo3n3n && | |
9980 | pow(dSumWLinearThree4n2n2n,2.)>dSumWQuadraticThree4n2n2n && | |
9981 | pow(dSumWLinearFive4n3n3n2n2n,2.)>dSumWQuadraticFive4n3n3n2n2n) | |
9982 | { | |
9983 | Double_t dError = pow(f3pCorrelations->GetBinContent(2),2.) | |
9984 | * pow((pow(dSumWQuadraticTwo3n3n,0.5)/dSumWLinearTwo3n3n) | |
9985 | * dSpreadTwo3n3n*pow(pow(dSumWLinearTwo3n3n,2.)/(pow(dSumWLinearTwo3n3n,2.)-dSumWQuadraticTwo3n3n),0.5),2.) | |
9986 | + pow(f2pCorrelations->GetBinContent(3),2.) | |
9987 | * pow((pow(dSumWQuadraticThree4n2n2n,0.5)/dSumWLinearThree4n2n2n) | |
9988 | * dSpreadThree4n2n2n*pow(pow(dSumWLinearThree4n2n2n,2.)/(pow(dSumWLinearThree4n2n2n,2.)-dSumWQuadraticThree4n2n2n),0.5),2.) | |
9989 | + pow((pow(dSumWQuadraticFive4n3n3n2n2n,0.5)/dSumWLinearFive4n3n3n2n2n) | |
9990 | * dSpreadFive4n3n3n2n2n*pow(pow(dSumWLinearFive4n3n3n2n2n,2.)/(pow(dSumWLinearFive4n3n3n2n2n,2.)-dSumWQuadraticFive4n3n3n2n2n),0.5),2.) | |
9991 | + 2.*f3pCorrelations->GetBinContent(2)*f2pCorrelations->GetBinContent(3) | |
9992 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
9993 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,8)) | |
9994 | - f2pCorrelations->GetBinContent(3)*f3pCorrelations->GetBinContent(2)) | |
9995 | / (dSumWLinearTwo3n3n*dSumWLinearThree4n2n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
9996 | - 2.*f3pCorrelations->GetBinContent(2) | |
9997 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
9998 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,60)) | |
9999 | - f2pCorrelations->GetBinContent(3)*f5pCorrelations->GetBinContent(4)) | |
10000 | / (dSumWLinearTwo3n3n*dSumWLinearFive4n3n3n2n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
10001 | - 2.*f2pCorrelations->GetBinContent(3) | |
10002 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
10003 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(8,60)) | |
10004 | - f3pCorrelations->GetBinContent(2)*f5pCorrelations->GetBinContent(4)) | |
10005 | / (dSumWLinearThree4n2n2n*dSumWLinearFive4n3n3n2n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
10006 | if(dError>0.) | |
10007 | { | |
10008 | f5pCumulants->SetBinError(4,pow(dError,0.5)); | |
10009 | } | |
10010 | } // end of if(...) | |
10011 | } // end of { | |
e1d101a6 | 10012 | f5pCumulants->SetBinContent(5,f5pCorrelations->GetBinContent(5)-f3pCorrelations->GetBinContent(1)*f2pCorrelations->GetBinContent(4)); |
c10259fb | 10013 | { |
10014 | Double_t dSumWLinearTwo4n4n = 0.; // sum of linear event weights for <2> | |
10015 | Double_t dSumWQuadraticTwo4n4n = 0.; // sum of quadratic event weights <2> | |
10016 | Double_t dSpreadTwo4n4n = 0.; // weighted and biased estimator for sigma of <2> | |
10017 | Double_t dSumWLinearThree2n1n1n = 0.; // sum of linear event weights for <2> | |
10018 | Double_t dSumWQuadraticThree2n1n1n = 0.; // sum of quadratic event weights <2> | |
10019 | Double_t dSpreadThree2n1n1n = 0.; // weighted and biased estimator for sigma of <2> | |
10020 | Double_t dSumWLinearFive4n2n4n1n1n = 0.; // sum of linear event weights for <4> | |
10021 | Double_t dSumWQuadraticFive4n2n4n1n1n = 0.; // sum of quadratic event weights <4> | |
10022 | Double_t dSpreadFive4n2n4n1n1n = 0.; // weighted and biased estimator for sigma of <4> | |
10023 | dSumWLinearTwo4n4n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
10024 | dSumWQuadraticTwo4n4n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
10025 | dSpreadTwo4n4n = f2pCorrelations->GetBinError(4); | |
10026 | dSumWLinearThree2n1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
10027 | dSumWQuadraticThree2n1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
10028 | dSpreadThree2n1n1n = f3pCorrelations->GetBinError(1); | |
10029 | dSumWLinearFive4n2n4n1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
10030 | dSumWQuadraticFive4n2n4n1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
10031 | dSpreadFive4n2n4n1n1n = f5pCorrelations->GetBinError(5); | |
10032 | if(pow(dSumWLinearTwo4n4n,2.)>dSumWQuadraticTwo4n4n && | |
10033 | pow(dSumWLinearThree2n1n1n,2.)>dSumWQuadraticThree2n1n1n && | |
10034 | pow(dSumWLinearFive4n2n4n1n1n,2.)>dSumWQuadraticFive4n2n4n1n1n) | |
10035 | { | |
10036 | Double_t dError = pow(f3pCorrelations->GetBinContent(1),2.) | |
10037 | * pow((pow(dSumWQuadraticTwo4n4n,0.5)/dSumWLinearTwo4n4n) | |
10038 | * dSpreadTwo4n4n*pow(pow(dSumWLinearTwo4n4n,2.)/(pow(dSumWLinearTwo4n4n,2.)-dSumWQuadraticTwo4n4n),0.5),2.) | |
10039 | + pow(f2pCorrelations->GetBinContent(4),2.) | |
10040 | * pow((pow(dSumWQuadraticThree2n1n1n,0.5)/dSumWLinearThree2n1n1n) | |
10041 | * dSpreadThree2n1n1n*pow(pow(dSumWLinearThree2n1n1n,2.)/(pow(dSumWLinearThree2n1n1n,2.)-dSumWQuadraticThree2n1n1n),0.5),2.) | |
10042 | + pow((pow(dSumWQuadraticFive4n2n4n1n1n,0.5)/dSumWLinearFive4n2n4n1n1n) | |
10043 | * dSpreadFive4n2n4n1n1n*pow(pow(dSumWLinearFive4n2n4n1n1n,2.)/(pow(dSumWLinearFive4n2n4n1n1n,2.)-dSumWQuadraticFive4n2n4n1n1n),0.5),2.) | |
10044 | + 2.*f3pCorrelations->GetBinContent(1)*f2pCorrelations->GetBinContent(4) | |
10045 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
10046 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,7)) | |
10047 | - f2pCorrelations->GetBinContent(4)*f3pCorrelations->GetBinContent(1)) | |
10048 | / (dSumWLinearTwo4n4n*dSumWLinearThree2n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
10049 | - 2.*f3pCorrelations->GetBinContent(1) | |
10050 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
10051 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,61)) | |
10052 | - f2pCorrelations->GetBinContent(4)*f5pCorrelations->GetBinContent(5)) | |
10053 | / (dSumWLinearTwo4n4n*dSumWLinearFive4n2n4n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
10054 | - 2.*f2pCorrelations->GetBinContent(4) | |
10055 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
10056 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(7,61)) | |
10057 | - f3pCorrelations->GetBinContent(1)*f5pCorrelations->GetBinContent(5)) | |
10058 | / (dSumWLinearThree2n1n1n*dSumWLinearFive4n2n4n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
10059 | if(dError>0.) | |
10060 | { | |
10061 | f5pCumulants->SetBinError(5,pow(dError,0.5)); | |
10062 | } | |
10063 | } // end of if(...) | |
10064 | } // end of { | |
e1d101a6 | 10065 | f5pCumulants->SetBinContent(6,f5pCorrelations->GetBinContent(6)-f3pCorrelations->GetBinContent(5)*f2pCorrelations->GetBinContent(4)); |
c10259fb | 10066 | { |
10067 | Double_t dSumWLinearTwo4n4n = 0.; // sum of linear event weights for <2> | |
10068 | Double_t dSumWQuadraticTwo4n4n = 0.; // sum of quadratic event weights <2> | |
10069 | Double_t dSpreadTwo4n4n = 0.; // weighted and biased estimator for sigma of <2> | |
10070 | Double_t dSumWLinearThree3n2n1n = 0.; // sum of linear event weights for <2> | |
10071 | Double_t dSumWQuadraticThree3n2n1n = 0.; // sum of quadratic event weights <2> | |
10072 | Double_t dSpreadThree3n2n1n = 0.; // weighted and biased estimator for sigma of <2> | |
10073 | Double_t dSumWLinearFive4n3n4n2n1n = 0.; // sum of linear event weights for <4> | |
10074 | Double_t dSumWQuadraticFive4n3n4n2n1n = 0.; // sum of quadratic event weights <4> | |
10075 | Double_t dSpreadFive4n3n4n2n1n = 0.; // weighted and biased estimator for sigma of <4> | |
10076 | dSumWLinearTwo4n4n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
10077 | dSumWQuadraticTwo4n4n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
10078 | dSpreadTwo4n4n = f2pCorrelations->GetBinError(4); | |
10079 | dSumWLinearThree3n2n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
10080 | dSumWQuadraticThree3n2n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
10081 | dSpreadThree3n2n1n = f3pCorrelations->GetBinError(5); | |
10082 | dSumWLinearFive4n3n4n2n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
10083 | dSumWQuadraticFive4n3n4n2n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
10084 | dSpreadFive4n3n4n2n1n = f5pCorrelations->GetBinError(6); | |
10085 | if(pow(dSumWLinearTwo4n4n,2.)>dSumWQuadraticTwo4n4n && | |
10086 | pow(dSumWLinearThree3n2n1n,2.)>dSumWQuadraticThree3n2n1n && | |
10087 | pow(dSumWLinearFive4n3n4n2n1n,2.)>dSumWQuadraticFive4n3n4n2n1n) | |
10088 | { | |
10089 | Double_t dError = pow(f3pCorrelations->GetBinContent(5),2.) | |
10090 | * pow((pow(dSumWQuadraticTwo4n4n,0.5)/dSumWLinearTwo4n4n) | |
10091 | * dSpreadTwo4n4n*pow(pow(dSumWLinearTwo4n4n,2.)/(pow(dSumWLinearTwo4n4n,2.)-dSumWQuadraticTwo4n4n),0.5),2.) | |
10092 | + pow(f2pCorrelations->GetBinContent(4),2.) | |
10093 | * pow((pow(dSumWQuadraticThree3n2n1n,0.5)/dSumWLinearThree3n2n1n) | |
10094 | * dSpreadThree3n2n1n*pow(pow(dSumWLinearThree3n2n1n,2.)/(pow(dSumWLinearThree3n2n1n,2.)-dSumWQuadraticThree3n2n1n),0.5),2.) | |
10095 | + pow((pow(dSumWQuadraticFive4n3n4n2n1n,0.5)/dSumWLinearFive4n3n4n2n1n) | |
10096 | * dSpreadFive4n3n4n2n1n*pow(pow(dSumWLinearFive4n3n4n2n1n,2.)/(pow(dSumWLinearFive4n3n4n2n1n,2.)-dSumWQuadraticFive4n3n4n2n1n),0.5),2.) | |
10097 | + 2.*f3pCorrelations->GetBinContent(5)*f2pCorrelations->GetBinContent(4) | |
10098 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
10099 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,10)) | |
10100 | - f2pCorrelations->GetBinContent(4)*f3pCorrelations->GetBinContent(5)) | |
10101 | / (dSumWLinearTwo4n4n*dSumWLinearThree3n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
10102 | - 2.*f3pCorrelations->GetBinContent(5) | |
10103 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
10104 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,62)) | |
10105 | - f2pCorrelations->GetBinContent(4)*f5pCorrelations->GetBinContent(6)) | |
10106 | / (dSumWLinearTwo4n4n*dSumWLinearFive4n3n4n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
10107 | - 2.*f2pCorrelations->GetBinContent(4) | |
10108 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
10109 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(10,62)) | |
10110 | - f3pCorrelations->GetBinContent(5)*f5pCorrelations->GetBinContent(6)) | |
10111 | / (dSumWLinearThree3n2n1n*dSumWLinearFive4n3n4n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
10112 | if(dError>0.) | |
10113 | { | |
10114 | f5pCumulants->SetBinError(6,pow(dError,0.5)); | |
10115 | } | |
10116 | } // end of if(...) | |
10117 | } // end of { | |
e1d101a6 | 10118 | f5pCumulants->SetBinContent(7,f5pCorrelations->GetBinContent(7)-f3pCorrelations->GetBinContent(7)*f2pCorrelations->GetBinContent(1)); |
c10259fb | 10119 | { |
10120 | Double_t dSumWLinearTwo1n1n = 0.; // sum of linear event weights for <2> | |
10121 | Double_t dSumWQuadraticTwo1n1n = 0.; // sum of quadratic event weights <2> | |
10122 | Double_t dSpreadTwo1n1n = 0.; // weighted and biased estimator for sigma of <2> | |
10123 | Double_t dSumWLinearThree5n3n2n = 0.; // sum of linear event weights for <2> | |
10124 | Double_t dSumWQuadraticThree5n3n2n = 0.; // sum of quadratic event weights <2> | |
10125 | Double_t dSpreadThree5n3n2n = 0.; // weighted and biased estimator for sigma of <2> | |
10126 | Double_t dSumWLinearFive5n1n3n2n1n = 0.; // sum of linear event weights for <4> | |
10127 | Double_t dSumWQuadraticFive5n1n3n2n1n = 0.; // sum of quadratic event weights <4> | |
10128 | Double_t dSpreadFive5n1n3n2n1n = 0.; // weighted and biased estimator for sigma of <4> | |
10129 | dSumWLinearTwo1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
10130 | dSumWQuadraticTwo1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
10131 | dSpreadTwo1n1n = f2pCorrelations->GetBinError(1); | |
10132 | dSumWLinearThree5n3n2n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
10133 | dSumWQuadraticThree5n3n2n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
10134 | dSpreadThree5n3n2n = f3pCorrelations->GetBinError(7); | |
10135 | dSumWLinearFive5n1n3n2n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
10136 | dSumWQuadraticFive5n1n3n2n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
10137 | dSpreadFive5n1n3n2n1n = f5pCorrelations->GetBinError(7); | |
10138 | if(pow(dSumWLinearTwo1n1n,2.)>dSumWQuadraticTwo1n1n && | |
10139 | pow(dSumWLinearThree5n3n2n,2.)>dSumWQuadraticThree5n3n2n && | |
10140 | pow(dSumWLinearFive5n1n3n2n1n,2.)>dSumWQuadraticFive5n1n3n2n1n) | |
10141 | { | |
10142 | Double_t dError = pow(f3pCorrelations->GetBinContent(7),2.) | |
10143 | * pow((pow(dSumWQuadraticTwo1n1n,0.5)/dSumWLinearTwo1n1n) | |
10144 | * dSpreadTwo1n1n*pow(pow(dSumWLinearTwo1n1n,2.)/(pow(dSumWLinearTwo1n1n,2.)-dSumWQuadraticTwo1n1n),0.5),2.) | |
10145 | + pow(f2pCorrelations->GetBinContent(1),2.) | |
10146 | * pow((pow(dSumWQuadraticThree5n3n2n,0.5)/dSumWLinearThree5n3n2n) | |
10147 | * dSpreadThree5n3n2n*pow(pow(dSumWLinearThree5n3n2n,2.)/(pow(dSumWLinearThree5n3n2n,2.)-dSumWQuadraticThree5n3n2n),0.5),2.) | |
10148 | + pow((pow(dSumWQuadraticFive5n1n3n2n1n,0.5)/dSumWLinearFive5n1n3n2n1n) | |
10149 | * dSpreadFive5n1n3n2n1n*pow(pow(dSumWLinearFive5n1n3n2n1n,2.)/(pow(dSumWLinearFive5n1n3n2n1n,2.)-dSumWQuadraticFive5n1n3n2n1n),0.5),2.) | |
10150 | + 2.*f3pCorrelations->GetBinContent(7)*f2pCorrelations->GetBinContent(1) | |
10151 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
10152 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,12)) | |
10153 | - f2pCorrelations->GetBinContent(1)*f3pCorrelations->GetBinContent(7)) | |
10154 | / (dSumWLinearTwo1n1n*dSumWLinearThree5n3n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
10155 | - 2.*f3pCorrelations->GetBinContent(7) | |
10156 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
10157 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,63)) | |
10158 | - f2pCorrelations->GetBinContent(1)*f5pCorrelations->GetBinContent(7)) | |
10159 | / (dSumWLinearTwo1n1n*dSumWLinearFive5n1n3n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
10160 | - 2.*f2pCorrelations->GetBinContent(1) | |
10161 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
10162 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(12,63)) | |
10163 | - f3pCorrelations->GetBinContent(7)*f5pCorrelations->GetBinContent(7)) | |
10164 | / (dSumWLinearThree5n3n2n*dSumWLinearFive5n1n3n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
10165 | if(dError>0.) | |
10166 | { | |
10167 | f5pCumulants->SetBinError(7,pow(dError,0.5)); | |
10168 | } | |
10169 | } // end of if(...) | |
10170 | } // end of { | |
e1d101a6 | 10171 | f5pCumulants->SetBinContent(8,f5pCorrelations->GetBinContent(8)-f3pCorrelations->GetBinContent(1)*f2pCorrelations->GetBinContent(5)); |
c10259fb | 10172 | { |
10173 | Double_t dSumWLinearTwo5n5n = 0.; // sum of linear event weights for <2> | |
10174 | Double_t dSumWQuadraticTwo5n5n = 0.; // sum of quadratic event weights <2> | |
10175 | Double_t dSpreadTwo5n5n = 0.; // weighted and biased estimator for sigma of <2> | |
10176 | Double_t dSumWLinearThree2n1n1n = 0.; // sum of linear event weights for <2> | |
10177 | Double_t dSumWQuadraticThree2n1n1n = 0.; // sum of quadratic event weights <2> | |
10178 | Double_t dSpreadThree2n1n1n = 0.; // weighted and biased estimator for sigma of <2> | |
10179 | Double_t dSumWLinearFive5n2n5n1n1n = 0.; // sum of linear event weights for <4> | |
10180 | Double_t dSumWQuadraticFive5n2n5n1n1n = 0.; // sum of quadratic event weights <4> | |
10181 | Double_t dSpreadFive5n2n5n1n1n = 0.; // weighted and biased estimator for sigma of <4> | |
10182 | dSumWLinearTwo5n5n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
10183 | dSumWQuadraticTwo5n5n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
10184 | dSpreadTwo5n5n = f2pCorrelations->GetBinError(5); | |
10185 | dSumWLinearThree2n1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
10186 | dSumWQuadraticThree2n1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
10187 | dSpreadThree2n1n1n = f3pCorrelations->GetBinError(1); | |
10188 | dSumWLinearFive5n2n5n1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
10189 | dSumWQuadraticFive5n2n5n1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
10190 | dSpreadFive5n2n5n1n1n = f5pCorrelations->GetBinError(8); | |
10191 | if(pow(dSumWLinearTwo5n5n,2.)>dSumWQuadraticTwo5n5n && | |
10192 | pow(dSumWLinearThree2n1n1n,2.)>dSumWQuadraticThree2n1n1n && | |
10193 | pow(dSumWLinearFive5n2n5n1n1n,2.)>dSumWQuadraticFive5n2n5n1n1n) | |
10194 | { | |
10195 | Double_t dError = pow(f3pCorrelations->GetBinContent(1),2.) | |
10196 | * pow((pow(dSumWQuadraticTwo5n5n,0.5)/dSumWLinearTwo5n5n) | |
10197 | * dSpreadTwo5n5n*pow(pow(dSumWLinearTwo5n5n,2.)/(pow(dSumWLinearTwo5n5n,2.)-dSumWQuadraticTwo5n5n),0.5),2.) | |
10198 | + pow(f2pCorrelations->GetBinContent(5),2.) | |
10199 | * pow((pow(dSumWQuadraticThree2n1n1n,0.5)/dSumWLinearThree2n1n1n) | |
10200 | * dSpreadThree2n1n1n*pow(pow(dSumWLinearThree2n1n1n,2.)/(pow(dSumWLinearThree2n1n1n,2.)-dSumWQuadraticThree2n1n1n),0.5),2.) | |
10201 | + pow((pow(dSumWQuadraticFive5n2n5n1n1n,0.5)/dSumWLinearFive5n2n5n1n1n) | |
10202 | * dSpreadFive5n2n5n1n1n*pow(pow(dSumWLinearFive5n2n5n1n1n,2.)/(pow(dSumWLinearFive5n2n5n1n1n,2.)-dSumWQuadraticFive5n2n5n1n1n),0.5),2.) | |
10203 | + 2.*f3pCorrelations->GetBinContent(1)*f2pCorrelations->GetBinContent(5) | |
10204 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
10205 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,7)) | |
10206 | - f2pCorrelations->GetBinContent(5)*f3pCorrelations->GetBinContent(1)) | |
10207 | / (dSumWLinearTwo5n5n*dSumWLinearThree2n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
10208 | - 2.*f3pCorrelations->GetBinContent(1) | |
10209 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
10210 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,64)) | |
10211 | - f2pCorrelations->GetBinContent(5)*f5pCorrelations->GetBinContent(8)) | |
10212 | / (dSumWLinearTwo5n5n*dSumWLinearFive5n2n5n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
10213 | - 2.*f2pCorrelations->GetBinContent(5) | |
10214 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
10215 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(7,64)) | |
10216 | - f3pCorrelations->GetBinContent(1)*f5pCorrelations->GetBinContent(8)) | |
10217 | / (dSumWLinearThree2n1n1n*dSumWLinearFive5n2n5n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
10218 | if(dError>0.) | |
10219 | { | |
10220 | f5pCumulants->SetBinError(8,pow(dError,0.5)); | |
10221 | } | |
10222 | } // end of if(...) | |
10223 | } // end of { | |
e1d101a6 | 10224 | f5pCumulants->SetBinContent(9,f5pCorrelations->GetBinContent(9)-f3pCorrelations->GetBinContent(8)*f2pCorrelations->GetBinContent(2)); |
c10259fb | 10225 | { |
10226 | Double_t dSumWLinearTwo2n2n = 0.; // sum of linear event weights for <2> | |
10227 | Double_t dSumWQuadraticTwo2n2n = 0.; // sum of quadratic event weights <2> | |
10228 | Double_t dSpreadTwo2n2n = 0.; // weighted and biased estimator for sigma of <2> | |
10229 | Double_t dSumWLinearThree5n4n1n = 0.; // sum of linear event weights for <2> | |
10230 | Double_t dSumWQuadraticThree5n4n1n = 0.; // sum of quadratic event weights <2> | |
10231 | Double_t dSpreadThree5n4n1n = 0.; // weighted and biased estimator for sigma of <2> | |
10232 | Double_t dSumWLinearFive5n2n4n2n1n = 0.; // sum of linear event weights for <4> | |
10233 | Double_t dSumWQuadraticFive5n2n4n2n1n = 0.; // sum of quadratic event weights <4> | |
10234 | Double_t dSpreadFive5n2n4n2n1n = 0.; // weighted and biased estimator for sigma of <4> | |
10235 | dSumWLinearTwo2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
10236 | dSumWQuadraticTwo2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
10237 | dSpreadTwo2n2n = f2pCorrelations->GetBinError(2); | |
10238 | dSumWLinearThree5n4n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
10239 | dSumWQuadraticThree5n4n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
10240 | dSpreadThree5n4n1n = f3pCorrelations->GetBinError(8); | |
10241 | dSumWLinearFive5n2n4n2n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
10242 | dSumWQuadraticFive5n2n4n2n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
10243 | dSpreadFive5n2n4n2n1n = f5pCorrelations->GetBinError(9); | |
10244 | if(pow(dSumWLinearTwo2n2n,2.)>dSumWQuadraticTwo2n2n && | |
10245 | pow(dSumWLinearThree5n4n1n,2.)>dSumWQuadraticThree5n4n1n && | |
10246 | pow(dSumWLinearFive5n2n4n2n1n,2.)>dSumWQuadraticFive5n2n4n2n1n) | |
10247 | { | |
10248 | Double_t dError = pow(f3pCorrelations->GetBinContent(8),2.) | |
10249 | * pow((pow(dSumWQuadraticTwo2n2n,0.5)/dSumWLinearTwo2n2n) | |
10250 | * dSpreadTwo2n2n*pow(pow(dSumWLinearTwo2n2n,2.)/(pow(dSumWLinearTwo2n2n,2.)-dSumWQuadraticTwo2n2n),0.5),2.) | |
10251 | + pow(f2pCorrelations->GetBinContent(2),2.) | |
10252 | * pow((pow(dSumWQuadraticThree5n4n1n,0.5)/dSumWLinearThree5n4n1n) | |
10253 | * dSpreadThree5n4n1n*pow(pow(dSumWLinearThree5n4n1n,2.)/(pow(dSumWLinearThree5n4n1n,2.)-dSumWQuadraticThree5n4n1n),0.5),2.) | |
10254 | + pow((pow(dSumWQuadraticFive5n2n4n2n1n,0.5)/dSumWLinearFive5n2n4n2n1n) | |
10255 | * dSpreadFive5n2n4n2n1n*pow(pow(dSumWLinearFive5n2n4n2n1n,2.)/(pow(dSumWLinearFive5n2n4n2n1n,2.)-dSumWQuadraticFive5n2n4n2n1n),0.5),2.) | |
10256 | + 2.*f3pCorrelations->GetBinContent(8)*f2pCorrelations->GetBinContent(2) | |
10257 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
10258 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,13)) | |
10259 | - f2pCorrelations->GetBinContent(2)*f3pCorrelations->GetBinContent(8)) | |
10260 | / (dSumWLinearTwo2n2n*dSumWLinearThree5n4n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
10261 | - 2.*f3pCorrelations->GetBinContent(8) | |
10262 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
10263 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,65)) | |
10264 | - f2pCorrelations->GetBinContent(2)*f5pCorrelations->GetBinContent(9)) | |
10265 | / (dSumWLinearTwo2n2n*dSumWLinearFive5n2n4n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
10266 | - 2.*f2pCorrelations->GetBinContent(2) | |
10267 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
10268 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(13,65)) | |
10269 | - f3pCorrelations->GetBinContent(8)*f5pCorrelations->GetBinContent(9)) | |
10270 | / (dSumWLinearThree5n4n1n*dSumWLinearFive5n2n4n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
10271 | if(dError>0.) | |
10272 | { | |
10273 | f5pCumulants->SetBinError(9,pow(dError,0.5)); | |
10274 | } | |
10275 | } // end of if(...) | |
10276 | } // end of { | |
e1d101a6 | 10277 | f5pCumulants->SetBinContent(10,f5pCorrelations->GetBinContent(10)-f3pCorrelations->GetBinContent(8)*f2pCorrelations->GetBinContent(3)); |
c10259fb | 10278 | { |
10279 | Double_t dSumWLinearTwo3n3n = 0.; // sum of linear event weights for <2> | |
10280 | Double_t dSumWQuadraticTwo3n3n = 0.; // sum of quadratic event weights <2> | |
10281 | Double_t dSpreadTwo3n3n = 0.; // weighted and biased estimator for sigma of <2> | |
10282 | Double_t dSumWLinearThree5n4n1n = 0.; // sum of linear event weights for <2> | |
10283 | Double_t dSumWQuadraticThree5n4n1n = 0.; // sum of quadratic event weights <2> | |
10284 | Double_t dSpreadThree5n4n1n = 0.; // weighted and biased estimator for sigma of <2> | |
10285 | Double_t dSumWLinearFive5n3n4n3n1n = 0.; // sum of linear event weights for <4> | |
10286 | Double_t dSumWQuadraticFive5n3n4n3n1n = 0.; // sum of quadratic event weights <4> | |
10287 | Double_t dSpreadFive5n3n4n3n1n = 0.; // weighted and biased estimator for sigma of <4> | |
10288 | dSumWLinearTwo3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
10289 | dSumWQuadraticTwo3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
10290 | dSpreadTwo3n3n = f2pCorrelations->GetBinError(3); | |
10291 | dSumWLinearThree5n4n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
10292 | dSumWQuadraticThree5n4n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
10293 | dSpreadThree5n4n1n = f3pCorrelations->GetBinError(8); | |
10294 | dSumWLinearFive5n3n4n3n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
10295 | dSumWQuadraticFive5n3n4n3n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
10296 | dSpreadFive5n3n4n3n1n = f5pCorrelations->GetBinError(10); | |
10297 | if(pow(dSumWLinearTwo3n3n,2.)>dSumWQuadraticTwo3n3n && | |
10298 | pow(dSumWLinearThree5n4n1n,2.)>dSumWQuadraticThree5n4n1n && | |
10299 | pow(dSumWLinearFive5n3n4n3n1n,2.)>dSumWQuadraticFive5n3n4n3n1n) | |
10300 | { | |
10301 | Double_t dError = pow(f3pCorrelations->GetBinContent(8),2.) | |
10302 | * pow((pow(dSumWQuadraticTwo3n3n,0.5)/dSumWLinearTwo3n3n) | |
10303 | * dSpreadTwo3n3n*pow(pow(dSumWLinearTwo3n3n,2.)/(pow(dSumWLinearTwo3n3n,2.)-dSumWQuadraticTwo3n3n),0.5),2.) | |
10304 | + pow(f2pCorrelations->GetBinContent(3),2.) | |
10305 | * pow((pow(dSumWQuadraticThree5n4n1n,0.5)/dSumWLinearThree5n4n1n) | |
10306 | * dSpreadThree5n4n1n*pow(pow(dSumWLinearThree5n4n1n,2.)/(pow(dSumWLinearThree5n4n1n,2.)-dSumWQuadraticThree5n4n1n),0.5),2.) | |
10307 | + pow((pow(dSumWQuadraticFive5n3n4n3n1n,0.5)/dSumWLinearFive5n3n4n3n1n) | |
10308 | * dSpreadFive5n3n4n3n1n*pow(pow(dSumWLinearFive5n3n4n3n1n,2.)/(pow(dSumWLinearFive5n3n4n3n1n,2.)-dSumWQuadraticFive5n3n4n3n1n),0.5),2.) | |
10309 | + 2.*f3pCorrelations->GetBinContent(8)*f2pCorrelations->GetBinContent(3) | |
10310 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
10311 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,13)) | |
10312 | - f2pCorrelations->GetBinContent(3)*f3pCorrelations->GetBinContent(8)) | |
10313 | / (dSumWLinearTwo3n3n*dSumWLinearThree5n4n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
10314 | - 2.*f3pCorrelations->GetBinContent(8) | |
10315 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
10316 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,66)) | |
10317 | - f2pCorrelations->GetBinContent(3)*f5pCorrelations->GetBinContent(10)) | |
10318 | / (dSumWLinearTwo3n3n*dSumWLinearFive5n3n4n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
10319 | - 2.*f2pCorrelations->GetBinContent(3) | |
10320 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
10321 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(13,66)) | |
10322 | - f3pCorrelations->GetBinContent(8)*f5pCorrelations->GetBinContent(10)) | |
10323 | / (dSumWLinearThree5n4n1n*dSumWLinearFive5n3n4n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
10324 | if(dError>0.) | |
10325 | { | |
10326 | f5pCumulants->SetBinError(10,pow(dError,0.5)); | |
10327 | } | |
10328 | } // end of if(...) | |
10329 | } // end of { | |
e1d101a6 | 10330 | f5pCumulants->SetBinContent(11,f5pCorrelations->GetBinContent(11)-f3pCorrelations->GetBinContent(7)*f2pCorrelations->GetBinContent(4)); |
c10259fb | 10331 | { |
10332 | Double_t dSumWLinearTwo4n4n = 0.; // sum of linear event weights for <2> | |
10333 | Double_t dSumWQuadraticTwo4n4n = 0.; // sum of quadratic event weights <2> | |
10334 | Double_t dSpreadTwo4n4n = 0.; // weighted and biased estimator for sigma of <2> | |
10335 | Double_t dSumWLinearThree5n3n2n = 0.; // sum of linear event weights for <2> | |
10336 | Double_t dSumWQuadraticThree5n3n2n = 0.; // sum of quadratic event weights <2> | |
10337 | Double_t dSpreadThree5n3n2n = 0.; // weighted and biased estimator for sigma of <2> | |
10338 | Double_t dSumWLinearFive5n4n4n3n2n = 0.; // sum of linear event weights for <4> | |
10339 | Double_t dSumWQuadraticFive5n4n4n3n2n = 0.; // sum of quadratic event weights <4> | |
10340 | Double_t dSpreadFive5n4n4n3n2n = 0.; // weighted and biased estimator for sigma of <4> | |
10341 | dSumWLinearTwo4n4n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
10342 | dSumWQuadraticTwo4n4n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
10343 | dSpreadTwo4n4n = f2pCorrelations->GetBinError(4); | |
10344 | dSumWLinearThree5n3n2n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
10345 | dSumWQuadraticThree5n3n2n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
10346 | dSpreadThree5n3n2n = f3pCorrelations->GetBinError(7); | |
10347 | dSumWLinearFive5n4n4n3n2n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
10348 | dSumWQuadraticFive5n4n4n3n2n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
10349 | dSpreadFive5n4n4n3n2n = f5pCorrelations->GetBinError(11); | |
10350 | if(pow(dSumWLinearTwo4n4n,2.)>dSumWQuadraticTwo4n4n && | |
10351 | pow(dSumWLinearThree5n3n2n,2.)>dSumWQuadraticThree5n3n2n && | |
10352 | pow(dSumWLinearFive5n4n4n3n2n,2.)>dSumWQuadraticFive5n4n4n3n2n) | |
10353 | { | |
10354 | Double_t dError = pow(f3pCorrelations->GetBinContent(7),2.) | |
10355 | * pow((pow(dSumWQuadraticTwo4n4n,0.5)/dSumWLinearTwo4n4n) | |
10356 | * dSpreadTwo4n4n*pow(pow(dSumWLinearTwo4n4n,2.)/(pow(dSumWLinearTwo4n4n,2.)-dSumWQuadraticTwo4n4n),0.5),2.) | |
10357 | + pow(f2pCorrelations->GetBinContent(4),2.) | |
10358 | * pow((pow(dSumWQuadraticThree5n3n2n,0.5)/dSumWLinearThree5n3n2n) | |
10359 | * dSpreadThree5n3n2n*pow(pow(dSumWLinearThree5n3n2n,2.)/(pow(dSumWLinearThree5n3n2n,2.)-dSumWQuadraticThree5n3n2n),0.5),2.) | |
10360 | + pow((pow(dSumWQuadraticFive5n4n4n3n2n,0.5)/dSumWLinearFive5n4n4n3n2n) | |
10361 | * dSpreadFive5n4n4n3n2n*pow(pow(dSumWLinearFive5n4n4n3n2n,2.)/(pow(dSumWLinearFive5n4n4n3n2n,2.)-dSumWQuadraticFive5n4n4n3n2n),0.5),2.) | |
10362 | + 2.*f3pCorrelations->GetBinContent(7)*f2pCorrelations->GetBinContent(4) | |
10363 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
10364 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,12)) | |
10365 | - f2pCorrelations->GetBinContent(4)*f3pCorrelations->GetBinContent(7)) | |
10366 | / (dSumWLinearTwo4n4n*dSumWLinearThree5n3n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
10367 | - 2.*f3pCorrelations->GetBinContent(7) | |
10368 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
10369 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,67)) | |
10370 | - f2pCorrelations->GetBinContent(4)*f5pCorrelations->GetBinContent(11)) | |
10371 | / (dSumWLinearTwo4n4n*dSumWLinearFive5n4n4n3n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
10372 | - 2.*f2pCorrelations->GetBinContent(4) | |
10373 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
10374 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(12,67)) | |
10375 | - f3pCorrelations->GetBinContent(7)*f5pCorrelations->GetBinContent(11)) | |
10376 | / (dSumWLinearThree5n3n2n*dSumWLinearFive5n4n4n3n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
10377 | if(dError>0.) | |
10378 | { | |
10379 | f5pCumulants->SetBinError(11,pow(dError,0.5)); | |
10380 | } | |
10381 | } // end of if(...) | |
10382 | } // end of { | |
e1d101a6 | 10383 | f5pCumulants->SetBinContent(12,f5pCorrelations->GetBinContent(12)-f3pCorrelations->GetBinContent(5)*f2pCorrelations->GetBinContent(5)); |
c10259fb | 10384 | { |
10385 | Double_t dSumWLinearTwo5n5n = 0.; // sum of linear event weights for <2> | |
10386 | Double_t dSumWQuadraticTwo5n5n = 0.; // sum of quadratic event weights <2> | |
10387 | Double_t dSpreadTwo5n5n = 0.; // weighted and biased estimator for sigma of <2> | |
10388 | Double_t dSumWLinearThree3n2n1n = 0.; // sum of linear event weights for <2> | |
10389 | Double_t dSumWQuadraticThree3n2n1n = 0.; // sum of quadratic event weights <2> | |
10390 | Double_t dSpreadThree3n2n1n = 0.; // weighted and biased estimator for sigma of <2> | |
10391 | Double_t dSumWLinearFive5n3n5n2n1n = 0.; // sum of linear event weights for <4> | |
10392 | Double_t dSumWQuadraticFive5n3n5n2n1n = 0.; // sum of quadratic event weights <4> | |
10393 | Double_t dSpreadFive5n3n5n2n1n = 0.; // weighted and biased estimator for sigma of <4> | |
10394 | dSumWLinearTwo5n5n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
10395 | dSumWQuadraticTwo5n5n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
10396 | dSpreadTwo5n5n = f2pCorrelations->GetBinError(5); | |
10397 | dSumWLinearThree3n2n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
10398 | dSumWQuadraticThree3n2n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
10399 | dSpreadThree3n2n1n = f3pCorrelations->GetBinError(5); | |
10400 | dSumWLinearFive5n3n5n2n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
10401 | dSumWQuadraticFive5n3n5n2n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
10402 | dSpreadFive5n3n5n2n1n = f5pCorrelations->GetBinError(12); | |
10403 | if(pow(dSumWLinearTwo5n5n,2.)>dSumWQuadraticTwo5n5n && | |
10404 | pow(dSumWLinearThree3n2n1n,2.)>dSumWQuadraticThree3n2n1n && | |
10405 | pow(dSumWLinearFive5n3n5n2n1n,2.)>dSumWQuadraticFive5n3n5n2n1n) | |
10406 | { | |
10407 | Double_t dError = pow(f3pCorrelations->GetBinContent(5),2.) | |
10408 | * pow((pow(dSumWQuadraticTwo5n5n,0.5)/dSumWLinearTwo5n5n) | |
10409 | * dSpreadTwo5n5n*pow(pow(dSumWLinearTwo5n5n,2.)/(pow(dSumWLinearTwo5n5n,2.)-dSumWQuadraticTwo5n5n),0.5),2.) | |
10410 | + pow(f2pCorrelations->GetBinContent(5),2.) | |
10411 | * pow((pow(dSumWQuadraticThree3n2n1n,0.5)/dSumWLinearThree3n2n1n) | |
10412 | * dSpreadThree3n2n1n*pow(pow(dSumWLinearThree3n2n1n,2.)/(pow(dSumWLinearThree3n2n1n,2.)-dSumWQuadraticThree3n2n1n),0.5),2.) | |
10413 | + pow((pow(dSumWQuadraticFive5n3n5n2n1n,0.5)/dSumWLinearFive5n3n5n2n1n) | |
10414 | * dSpreadFive5n3n5n2n1n*pow(pow(dSumWLinearFive5n3n5n2n1n,2.)/(pow(dSumWLinearFive5n3n5n2n1n,2.)-dSumWQuadraticFive5n3n5n2n1n),0.5),2.) | |
10415 | + 2.*f3pCorrelations->GetBinContent(5)*f2pCorrelations->GetBinContent(5) | |
10416 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
10417 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,10)) | |
10418 | - f2pCorrelations->GetBinContent(5)*f3pCorrelations->GetBinContent(5)) | |
10419 | / (dSumWLinearTwo5n5n*dSumWLinearThree3n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
10420 | - 2.*f3pCorrelations->GetBinContent(5) | |
10421 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
10422 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,68)) | |
10423 | - f2pCorrelations->GetBinContent(5)*f5pCorrelations->GetBinContent(12)) | |
10424 | / (dSumWLinearTwo5n5n*dSumWLinearFive5n3n5n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
10425 | - 2.*f2pCorrelations->GetBinContent(5) | |
10426 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
10427 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(10,68)) | |
10428 | - f3pCorrelations->GetBinContent(5)*f5pCorrelations->GetBinContent(12)) | |
10429 | / (dSumWLinearThree3n2n1n*dSumWLinearFive5n3n5n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
10430 | if(dError>0.) | |
10431 | { | |
10432 | f5pCumulants->SetBinError(12,pow(dError,0.5)); | |
10433 | } | |
10434 | } // end of if(...) | |
10435 | } // end of { | |
e1d101a6 | 10436 | f5pCumulants->SetBinContent(13,f5pCorrelations->GetBinContent(13)-f3pCorrelations->GetBinContent(2)*f2pCorrelations->GetBinContent(5)); |
c10259fb | 10437 | { |
10438 | Double_t dSumWLinearTwo5n5n = 0.; // sum of linear event weights for <2> | |
10439 | Double_t dSumWQuadraticTwo5n5n = 0.; // sum of quadratic event weights <2> | |
10440 | Double_t dSpreadTwo5n5n = 0.; // weighted and biased estimator for sigma of <2> | |
10441 | Double_t dSumWLinearThree4n2n2n = 0.; // sum of linear event weights for <2> | |
10442 | Double_t dSumWQuadraticThree4n2n2n = 0.; // sum of quadratic event weights <2> | |
10443 | Double_t dSpreadThree4n2n2n = 0.; // weighted and biased estimator for sigma of <2> | |
10444 | Double_t dSumWLinearFive5n4n5n2n2n = 0.; // sum of linear event weights for <4> | |
10445 | Double_t dSumWQuadraticFive5n4n5n2n2n = 0.; // sum of quadratic event weights <4> | |
10446 | Double_t dSpreadFive5n4n5n2n2n = 0.; // weighted and biased estimator for sigma of <4> | |
10447 | dSumWLinearTwo5n5n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
10448 | dSumWQuadraticTwo5n5n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
10449 | dSpreadTwo5n5n = f2pCorrelations->GetBinError(5); | |
10450 | dSumWLinearThree4n2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
10451 | dSumWQuadraticThree4n2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
10452 | dSpreadThree4n2n2n = f3pCorrelations->GetBinError(2); | |
10453 | dSumWLinearFive5n4n5n2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
10454 | dSumWQuadraticFive5n4n5n2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
10455 | dSpreadFive5n4n5n2n2n = f5pCorrelations->GetBinError(13); | |
10456 | if(pow(dSumWLinearTwo5n5n,2.)>dSumWQuadraticTwo5n5n && | |
10457 | pow(dSumWLinearThree4n2n2n,2.)>dSumWQuadraticThree4n2n2n && | |
10458 | pow(dSumWLinearFive5n4n5n2n2n,2.)>dSumWQuadraticFive5n4n5n2n2n) | |
10459 | { | |
10460 | Double_t dError = pow(f3pCorrelations->GetBinContent(2),2.) | |
10461 | * pow((pow(dSumWQuadraticTwo5n5n,0.5)/dSumWLinearTwo5n5n) | |
10462 | * dSpreadTwo5n5n*pow(pow(dSumWLinearTwo5n5n,2.)/(pow(dSumWLinearTwo5n5n,2.)-dSumWQuadraticTwo5n5n),0.5),2.) | |
10463 | + pow(f2pCorrelations->GetBinContent(5),2.) | |
10464 | * pow((pow(dSumWQuadraticThree4n2n2n,0.5)/dSumWLinearThree4n2n2n) | |
10465 | * dSpreadThree4n2n2n*pow(pow(dSumWLinearThree4n2n2n,2.)/(pow(dSumWLinearThree4n2n2n,2.)-dSumWQuadraticThree4n2n2n),0.5),2.) | |
10466 | + pow((pow(dSumWQuadraticFive5n4n5n2n2n,0.5)/dSumWLinearFive5n4n5n2n2n) | |
10467 | * dSpreadFive5n4n5n2n2n*pow(pow(dSumWLinearFive5n4n5n2n2n,2.)/(pow(dSumWLinearFive5n4n5n2n2n,2.)-dSumWQuadraticFive5n4n5n2n2n),0.5),2.) | |
10468 | + 2.*f3pCorrelations->GetBinContent(2)*f2pCorrelations->GetBinContent(5) | |
10469 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
10470 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,8)) | |
10471 | - f2pCorrelations->GetBinContent(5)*f3pCorrelations->GetBinContent(2)) | |
10472 | / (dSumWLinearTwo5n5n*dSumWLinearThree4n2n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
10473 | - 2.*f3pCorrelations->GetBinContent(2) | |
10474 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
10475 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,69)) | |
10476 | - f2pCorrelations->GetBinContent(5)*f5pCorrelations->GetBinContent(13)) | |
10477 | / (dSumWLinearTwo5n5n*dSumWLinearFive5n4n5n2n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
10478 | - 2.*f2pCorrelations->GetBinContent(5) | |
10479 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
10480 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(8,69)) | |
10481 | - f3pCorrelations->GetBinContent(2)*f5pCorrelations->GetBinContent(13)) | |
10482 | / (dSumWLinearThree4n2n2n*dSumWLinearFive5n4n5n2n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
10483 | if(dError>0.) | |
10484 | { | |
10485 | f5pCumulants->SetBinError(13,pow(dError,0.5)); | |
10486 | } | |
10487 | } // end of if(...) | |
10488 | } // end of { | |
e1d101a6 | 10489 | f5pCumulants->SetBinContent(14,f5pCorrelations->GetBinContent(14)-f3pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(5)); |
c10259fb | 10490 | { |
10491 | Double_t dSumWLinearTwo5n5n = 0.; // sum of linear event weights for <2> | |
10492 | Double_t dSumWQuadraticTwo5n5n = 0.; // sum of quadratic event weights <2> | |
10493 | Double_t dSpreadTwo5n5n = 0.; // weighted and biased estimator for sigma of <2> | |
10494 | Double_t dSumWLinearThree4n3n1n = 0.; // sum of linear event weights for <2> | |
10495 | Double_t dSumWQuadraticThree4n3n1n = 0.; // sum of quadratic event weights <2> | |
10496 | Double_t dSpreadThree4n3n1n = 0.; // weighted and biased estimator for sigma of <2> | |
10497 | Double_t dSumWLinearFive5n4n5n3n1n = 0.; // sum of linear event weights for <4> | |
10498 | Double_t dSumWQuadraticFive5n4n5n3n1n = 0.; // sum of quadratic event weights <4> | |
10499 | Double_t dSpreadFive5n4n5n3n1n = 0.; // weighted and biased estimator for sigma of <4> | |
10500 | dSumWLinearTwo5n5n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
10501 | dSumWQuadraticTwo5n5n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
10502 | dSpreadTwo5n5n = f2pCorrelations->GetBinError(5); | |
10503 | dSumWLinearThree4n3n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
10504 | dSumWQuadraticThree4n3n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
10505 | dSpreadThree4n3n1n = f3pCorrelations->GetBinError(6); | |
10506 | dSumWLinearFive5n4n5n3n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
10507 | dSumWQuadraticFive5n4n5n3n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
10508 | dSpreadFive5n4n5n3n1n = f5pCorrelations->GetBinError(14); | |
10509 | if(pow(dSumWLinearTwo5n5n,2.)>dSumWQuadraticTwo5n5n && | |
10510 | pow(dSumWLinearThree4n3n1n,2.)>dSumWQuadraticThree4n3n1n && | |
10511 | pow(dSumWLinearFive5n4n5n3n1n,2.)>dSumWQuadraticFive5n4n5n3n1n) | |
10512 | { | |
10513 | Double_t dError = pow(f3pCorrelations->GetBinContent(6),2.) | |
10514 | * pow((pow(dSumWQuadraticTwo5n5n,0.5)/dSumWLinearTwo5n5n) | |
10515 | * dSpreadTwo5n5n*pow(pow(dSumWLinearTwo5n5n,2.)/(pow(dSumWLinearTwo5n5n,2.)-dSumWQuadraticTwo5n5n),0.5),2.) | |
10516 | + pow(f2pCorrelations->GetBinContent(5),2.) | |
10517 | * pow((pow(dSumWQuadraticThree4n3n1n,0.5)/dSumWLinearThree4n3n1n) | |
10518 | * dSpreadThree4n3n1n*pow(pow(dSumWLinearThree4n3n1n,2.)/(pow(dSumWLinearThree4n3n1n,2.)-dSumWQuadraticThree4n3n1n),0.5),2.) | |
10519 | + pow((pow(dSumWQuadraticFive5n4n5n3n1n,0.5)/dSumWLinearFive5n4n5n3n1n) | |
10520 | * dSpreadFive5n4n5n3n1n*pow(pow(dSumWLinearFive5n4n5n3n1n,2.)/(pow(dSumWLinearFive5n4n5n3n1n,2.)-dSumWQuadraticFive5n4n5n3n1n),0.5),2.) | |
10521 | + 2.*f3pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(5) | |
10522 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
10523 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,11)) | |
10524 | - f2pCorrelations->GetBinContent(5)*f3pCorrelations->GetBinContent(6)) | |
10525 | / (dSumWLinearTwo5n5n*dSumWLinearThree4n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
10526 | - 2.*f3pCorrelations->GetBinContent(6) | |
10527 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
10528 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,70)) | |
10529 | - f2pCorrelations->GetBinContent(5)*f5pCorrelations->GetBinContent(14)) | |
10530 | / (dSumWLinearTwo5n5n*dSumWLinearFive5n4n5n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
10531 | - 2.*f2pCorrelations->GetBinContent(5) | |
10532 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
10533 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(11,70)) | |
10534 | - f3pCorrelations->GetBinContent(6)*f5pCorrelations->GetBinContent(14)) | |
10535 | / (dSumWLinearThree4n3n1n*dSumWLinearFive5n4n5n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
10536 | if(dError>0.) | |
10537 | { | |
10538 | f5pCumulants->SetBinError(14,pow(dError,0.5)); | |
10539 | } | |
10540 | } // end of if(...) | |
10541 | } // end of { | |
e1d101a6 | 10542 | f5pCumulants->SetBinContent(15,f5pCorrelations->GetBinContent(15)-f3pCorrelations->GetBinContent(3)*f2pCorrelations->GetBinContent(1)); |
c10259fb | 10543 | { |
10544 | Double_t dSumWLinearTwo1n1n = 0.; // sum of linear event weights for <2> | |
10545 | Double_t dSumWQuadraticTwo1n1n = 0.; // sum of quadratic event weights <2> | |
10546 | Double_t dSpreadTwo1n1n = 0.; // weighted and biased estimator for sigma of <2> | |
10547 | Double_t dSumWLinearThree6n3n3n = 0.; // sum of linear event weights for <2> | |
10548 | Double_t dSumWQuadraticThree6n3n3n = 0.; // sum of quadratic event weights <2> | |
10549 | Double_t dSpreadThree6n3n3n = 0.; // weighted and biased estimator for sigma of <2> | |
10550 | Double_t dSumWLinearFive6n1n3n3n1n = 0.; // sum of linear event weights for <4> | |
10551 | Double_t dSumWQuadraticFive6n1n3n3n1n = 0.; // sum of quadratic event weights <4> | |
10552 | Double_t dSpreadFive6n1n3n3n1n = 0.; // weighted and biased estimator for sigma of <4> | |
10553 | dSumWLinearTwo1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
10554 | dSumWQuadraticTwo1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
10555 | dSpreadTwo1n1n = f2pCorrelations->GetBinError(1); | |
10556 | dSumWLinearThree6n3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
10557 | dSumWQuadraticThree6n3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
10558 | dSpreadThree6n3n3n = f3pCorrelations->GetBinError(3); | |
10559 | dSumWLinearFive6n1n3n3n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
10560 | dSumWQuadraticFive6n1n3n3n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
10561 | dSpreadFive6n1n3n3n1n = f5pCorrelations->GetBinError(15); | |
10562 | if(pow(dSumWLinearTwo1n1n,2.)>dSumWQuadraticTwo1n1n && | |
10563 | pow(dSumWLinearThree6n3n3n,2.)>dSumWQuadraticThree6n3n3n && | |
10564 | pow(dSumWLinearFive6n1n3n3n1n,2.)>dSumWQuadraticFive6n1n3n3n1n) | |
10565 | { | |
10566 | Double_t dError = pow(f3pCorrelations->GetBinContent(3),2.) | |
10567 | * pow((pow(dSumWQuadraticTwo1n1n,0.5)/dSumWLinearTwo1n1n) | |
10568 | * dSpreadTwo1n1n*pow(pow(dSumWLinearTwo1n1n,2.)/(pow(dSumWLinearTwo1n1n,2.)-dSumWQuadraticTwo1n1n),0.5),2.) | |
10569 | + pow(f2pCorrelations->GetBinContent(1),2.) | |
10570 | * pow((pow(dSumWQuadraticThree6n3n3n,0.5)/dSumWLinearThree6n3n3n) | |
10571 | * dSpreadThree6n3n3n*pow(pow(dSumWLinearThree6n3n3n,2.)/(pow(dSumWLinearThree6n3n3n,2.)-dSumWQuadraticThree6n3n3n),0.5),2.) | |
10572 | + pow((pow(dSumWQuadraticFive6n1n3n3n1n,0.5)/dSumWLinearFive6n1n3n3n1n) | |
10573 | * dSpreadFive6n1n3n3n1n*pow(pow(dSumWLinearFive6n1n3n3n1n,2.)/(pow(dSumWLinearFive6n1n3n3n1n,2.)-dSumWQuadraticFive6n1n3n3n1n),0.5),2.) | |
10574 | + 2.*f3pCorrelations->GetBinContent(3)*f2pCorrelations->GetBinContent(1) | |
10575 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
10576 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,9)) | |
10577 | - f2pCorrelations->GetBinContent(1)*f3pCorrelations->GetBinContent(3)) | |
10578 | / (dSumWLinearTwo1n1n*dSumWLinearThree6n3n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
10579 | - 2.*f3pCorrelations->GetBinContent(3) | |
10580 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
10581 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,71)) | |
10582 | - f2pCorrelations->GetBinContent(1)*f5pCorrelations->GetBinContent(15)) | |
10583 | / (dSumWLinearTwo1n1n*dSumWLinearFive6n1n3n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
10584 | - 2.*f2pCorrelations->GetBinContent(1) | |
10585 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
10586 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(9,71)) | |
10587 | - f3pCorrelations->GetBinContent(3)*f5pCorrelations->GetBinContent(15)) | |
10588 | / (dSumWLinearThree6n3n3n*dSumWLinearFive6n1n3n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
10589 | if(dError>0.) | |
10590 | { | |
10591 | f5pCumulants->SetBinError(15,pow(dError,0.5)); | |
10592 | } | |
10593 | } // end of if(...) | |
10594 | } // end of { | |
e1d101a6 | 10595 | f5pCumulants->SetBinContent(16,f5pCorrelations->GetBinContent(16)-f3pCorrelations->GetBinContent(3)*f2pCorrelations->GetBinContent(2)); |
c10259fb | 10596 | { |
10597 | Double_t dSumWLinearTwo2n2n = 0.; // sum of linear event weights for <2> | |
10598 | Double_t dSumWQuadraticTwo2n2n = 0.; // sum of quadratic event weights <2> | |
10599 | Double_t dSpreadTwo2n2n = 0.; // weighted and biased estimator for sigma of <2> | |
10600 | Double_t dSumWLinearThree6n3n3n = 0.; // sum of linear event weights for <2> | |
10601 | Double_t dSumWQuadraticThree6n3n3n = 0.; // sum of quadratic event weights <2> | |
10602 | Double_t dSpreadThree6n3n3n = 0.; // weighted and biased estimator for sigma of <2> | |
10603 | Double_t dSumWLinearFive6n2n3n3n2n = 0.; // sum of linear event weights for <4> | |
10604 | Double_t dSumWQuadraticFive6n2n3n3n2n = 0.; // sum of quadratic event weights <4> | |
10605 | Double_t dSpreadFive6n2n3n3n2n = 0.; // weighted and biased estimator for sigma of <4> | |
10606 | dSumWLinearTwo2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
10607 | dSumWQuadraticTwo2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
10608 | dSpreadTwo2n2n = f2pCorrelations->GetBinError(2); | |
10609 | dSumWLinearThree6n3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
10610 | dSumWQuadraticThree6n3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
10611 | dSpreadThree6n3n3n = f3pCorrelations->GetBinError(3); | |
10612 | dSumWLinearFive6n2n3n3n2n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
10613 | dSumWQuadraticFive6n2n3n3n2n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
10614 | dSpreadFive6n2n3n3n2n = f5pCorrelations->GetBinError(16); | |
10615 | if(pow(dSumWLinearTwo2n2n,2.)>dSumWQuadraticTwo2n2n && | |
10616 | pow(dSumWLinearThree6n3n3n,2.)>dSumWQuadraticThree6n3n3n && | |
10617 | pow(dSumWLinearFive6n2n3n3n2n,2.)>dSumWQuadraticFive6n2n3n3n2n) | |
10618 | { | |
10619 | Double_t dError = pow(f3pCorrelations->GetBinContent(3),2.) | |
10620 | * pow((pow(dSumWQuadraticTwo2n2n,0.5)/dSumWLinearTwo2n2n) | |
10621 | * dSpreadTwo2n2n*pow(pow(dSumWLinearTwo2n2n,2.)/(pow(dSumWLinearTwo2n2n,2.)-dSumWQuadraticTwo2n2n),0.5),2.) | |
10622 | + pow(f2pCorrelations->GetBinContent(2),2.) | |
10623 | * pow((pow(dSumWQuadraticThree6n3n3n,0.5)/dSumWLinearThree6n3n3n) | |
10624 | * dSpreadThree6n3n3n*pow(pow(dSumWLinearThree6n3n3n,2.)/(pow(dSumWLinearThree6n3n3n,2.)-dSumWQuadraticThree6n3n3n),0.5),2.) | |
10625 | + pow((pow(dSumWQuadraticFive6n2n3n3n2n,0.5)/dSumWLinearFive6n2n3n3n2n) | |
10626 | * dSpreadFive6n2n3n3n2n*pow(pow(dSumWLinearFive6n2n3n3n2n,2.)/(pow(dSumWLinearFive6n2n3n3n2n,2.)-dSumWQuadraticFive6n2n3n3n2n),0.5),2.) | |
10627 | + 2.*f3pCorrelations->GetBinContent(3)*f2pCorrelations->GetBinContent(2) | |
10628 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
10629 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,9)) | |
10630 | - f2pCorrelations->GetBinContent(2)*f3pCorrelations->GetBinContent(3)) | |
10631 | / (dSumWLinearTwo2n2n*dSumWLinearThree6n3n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
10632 | - 2.*f3pCorrelations->GetBinContent(3) | |
10633 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
10634 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,72)) | |
10635 | - f2pCorrelations->GetBinContent(2)*f5pCorrelations->GetBinContent(16)) | |
10636 | / (dSumWLinearTwo2n2n*dSumWLinearFive6n2n3n3n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
10637 | - 2.*f2pCorrelations->GetBinContent(2) | |
10638 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
10639 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(9,72)) | |
10640 | - f3pCorrelations->GetBinContent(3)*f5pCorrelations->GetBinContent(16)) | |
10641 | / (dSumWLinearThree6n3n3n*dSumWLinearFive6n2n3n3n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
10642 | if(dError>0.) | |
10643 | { | |
10644 | f5pCumulants->SetBinError(16,pow(dError,0.5)); | |
10645 | } | |
10646 | } // end of if(...) | |
10647 | } // end of { | |
e1d101a6 | 10648 | f5pCumulants->SetBinContent(17,f5pCorrelations->GetBinContent(17)-f3pCorrelations->GetBinContent(9)*f2pCorrelations->GetBinContent(1)); |
c10259fb | 10649 | { |
10650 | Double_t dSumWLinearTwo1n1n = 0.; // sum of linear event weights for <2> | |
10651 | Double_t dSumWQuadraticTwo1n1n = 0.; // sum of quadratic event weights <2> | |
10652 | Double_t dSpreadTwo1n1n = 0.; // weighted and biased estimator for sigma of <2> | |
10653 | Double_t dSumWLinearThree6n4n2n = 0.; // sum of linear event weights for <2> | |
10654 | Double_t dSumWQuadraticThree6n4n2n = 0.; // sum of quadratic event weights <2> | |
10655 | Double_t dSpreadThree6n4n2n = 0.; // weighted and biased estimator for sigma of <2> | |
10656 | Double_t dSumWLinearFive6n1n4n2n1n = 0.; // sum of linear event weights for <4> | |
10657 | Double_t dSumWQuadraticFive6n1n4n2n1n = 0.; // sum of quadratic event weights <4> | |
10658 | Double_t dSpreadFive6n1n4n2n1n = 0.; // weighted and biased estimator for sigma of <4> | |
10659 | dSumWLinearTwo1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
10660 | dSumWQuadraticTwo1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
10661 | dSpreadTwo1n1n = f2pCorrelations->GetBinError(1); | |
10662 | dSumWLinearThree6n4n2n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
10663 | dSumWQuadraticThree6n4n2n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
10664 | dSpreadThree6n4n2n = f3pCorrelations->GetBinError(9); | |
10665 | dSumWLinearFive6n1n4n2n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
10666 | dSumWQuadraticFive6n1n4n2n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
10667 | dSpreadFive6n1n4n2n1n = f5pCorrelations->GetBinError(17); | |
10668 | if(pow(dSumWLinearTwo1n1n,2.)>dSumWQuadraticTwo1n1n && | |
10669 | pow(dSumWLinearThree6n4n2n,2.)>dSumWQuadraticThree6n4n2n && | |
10670 | pow(dSumWLinearFive6n1n4n2n1n,2.)>dSumWQuadraticFive6n1n4n2n1n) | |
10671 | { | |
10672 | Double_t dError = pow(f3pCorrelations->GetBinContent(9),2.) | |
10673 | * pow((pow(dSumWQuadraticTwo1n1n,0.5)/dSumWLinearTwo1n1n) | |
10674 | * dSpreadTwo1n1n*pow(pow(dSumWLinearTwo1n1n,2.)/(pow(dSumWLinearTwo1n1n,2.)-dSumWQuadraticTwo1n1n),0.5),2.) | |
10675 | + pow(f2pCorrelations->GetBinContent(1),2.) | |
10676 | * pow((pow(dSumWQuadraticThree6n4n2n,0.5)/dSumWLinearThree6n4n2n) | |
10677 | * dSpreadThree6n4n2n*pow(pow(dSumWLinearThree6n4n2n,2.)/(pow(dSumWLinearThree6n4n2n,2.)-dSumWQuadraticThree6n4n2n),0.5),2.) | |
10678 | + pow((pow(dSumWQuadraticFive6n1n4n2n1n,0.5)/dSumWLinearFive6n1n4n2n1n) | |
10679 | * dSpreadFive6n1n4n2n1n*pow(pow(dSumWLinearFive6n1n4n2n1n,2.)/(pow(dSumWLinearFive6n1n4n2n1n,2.)-dSumWQuadraticFive6n1n4n2n1n),0.5),2.) | |
10680 | + 2.*f3pCorrelations->GetBinContent(9)*f2pCorrelations->GetBinContent(1) | |
10681 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
10682 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,14)) | |
10683 | - f2pCorrelations->GetBinContent(1)*f3pCorrelations->GetBinContent(9)) | |
10684 | / (dSumWLinearTwo1n1n*dSumWLinearThree6n4n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
10685 | - 2.*f3pCorrelations->GetBinContent(9) | |
10686 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
10687 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,73)) | |
10688 | - f2pCorrelations->GetBinContent(1)*f5pCorrelations->GetBinContent(17)) | |
10689 | / (dSumWLinearTwo1n1n*dSumWLinearFive6n1n4n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
10690 | - 2.*f2pCorrelations->GetBinContent(1) | |
10691 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
10692 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(14,73)) | |
10693 | - f3pCorrelations->GetBinContent(9)*f5pCorrelations->GetBinContent(17)) | |
10694 | / (dSumWLinearThree6n4n2n*dSumWLinearFive6n1n4n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
10695 | if(dError>0.) | |
10696 | { | |
10697 | f5pCumulants->SetBinError(17,pow(dError,0.5)); | |
10698 | } | |
10699 | } // end of if(...) | |
10700 | } // end of { | |
e1d101a6 | 10701 | f5pCumulants->SetBinContent(18,f5pCorrelations->GetBinContent(18)-f3pCorrelations->GetBinContent(9)*f2pCorrelations->GetBinContent(3)); |
c10259fb | 10702 | { |
10703 | Double_t dSumWLinearTwo3n3n = 0.; // sum of linear event weights for <2> | |
10704 | Double_t dSumWQuadraticTwo3n3n = 0.; // sum of quadratic event weights <2> | |
10705 | Double_t dSpreadTwo3n3n = 0.; // weighted and biased estimator for sigma of <2> | |
10706 | Double_t dSumWLinearThree6n4n2n = 0.; // sum of linear event weights for <2> | |
10707 | Double_t dSumWQuadraticThree6n4n2n = 0.; // sum of quadratic event weights <2> | |
10708 | Double_t dSpreadThree6n4n2n = 0.; // weighted and biased estimator for sigma of <2> | |
10709 | Double_t dSumWLinearFive6n3n4n3n2n = 0.; // sum of linear event weights for <4> | |
10710 | Double_t dSumWQuadraticFive6n3n4n3n2n = 0.; // sum of quadratic event weights <4> | |
10711 | Double_t dSpreadFive6n3n4n3n2n = 0.; // weighted and biased estimator for sigma of <4> | |
10712 | dSumWLinearTwo3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
10713 | dSumWQuadraticTwo3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
10714 | dSpreadTwo3n3n = f2pCorrelations->GetBinError(3); | |
10715 | dSumWLinearThree6n4n2n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
10716 | dSumWQuadraticThree6n4n2n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
10717 | dSpreadThree6n4n2n = f3pCorrelations->GetBinError(9); | |
10718 | dSumWLinearFive6n3n4n3n2n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
10719 | dSumWQuadraticFive6n3n4n3n2n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
10720 | dSpreadFive6n3n4n3n2n = f5pCorrelations->GetBinError(18); | |
10721 | if(pow(dSumWLinearTwo3n3n,2.)>dSumWQuadraticTwo3n3n && | |
10722 | pow(dSumWLinearThree6n4n2n,2.)>dSumWQuadraticThree6n4n2n && | |
10723 | pow(dSumWLinearFive6n3n4n3n2n,2.)>dSumWQuadraticFive6n3n4n3n2n) | |
10724 | { | |
10725 | Double_t dError = pow(f3pCorrelations->GetBinContent(9),2.) | |
10726 | * pow((pow(dSumWQuadraticTwo3n3n,0.5)/dSumWLinearTwo3n3n) | |
10727 | * dSpreadTwo3n3n*pow(pow(dSumWLinearTwo3n3n,2.)/(pow(dSumWLinearTwo3n3n,2.)-dSumWQuadraticTwo3n3n),0.5),2.) | |
10728 | + pow(f2pCorrelations->GetBinContent(3),2.) | |
10729 | * pow((pow(dSumWQuadraticThree6n4n2n,0.5)/dSumWLinearThree6n4n2n) | |
10730 | * dSpreadThree6n4n2n*pow(pow(dSumWLinearThree6n4n2n,2.)/(pow(dSumWLinearThree6n4n2n,2.)-dSumWQuadraticThree6n4n2n),0.5),2.) | |
10731 | + pow((pow(dSumWQuadraticFive6n3n4n3n2n,0.5)/dSumWLinearFive6n3n4n3n2n) | |
10732 | * dSpreadFive6n3n4n3n2n*pow(pow(dSumWLinearFive6n3n4n3n2n,2.)/(pow(dSumWLinearFive6n3n4n3n2n,2.)-dSumWQuadraticFive6n3n4n3n2n),0.5),2.) | |
10733 | + 2.*f3pCorrelations->GetBinContent(9)*f2pCorrelations->GetBinContent(3) | |
10734 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
10735 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,14)) | |
10736 | - f2pCorrelations->GetBinContent(3)*f3pCorrelations->GetBinContent(9)) | |
10737 | / (dSumWLinearTwo3n3n*dSumWLinearThree6n4n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
10738 | - 2.*f3pCorrelations->GetBinContent(9) | |
10739 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
10740 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,74)) | |
10741 | - f2pCorrelations->GetBinContent(3)*f5pCorrelations->GetBinContent(18)) | |
10742 | / (dSumWLinearTwo3n3n*dSumWLinearFive6n3n4n3n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
10743 | - 2.*f2pCorrelations->GetBinContent(3) | |
10744 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
10745 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(14,74)) | |
10746 | - f3pCorrelations->GetBinContent(9)*f5pCorrelations->GetBinContent(18)) | |
10747 | / (dSumWLinearThree6n4n2n*dSumWLinearFive6n3n4n3n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
10748 | if(dError>0.) | |
10749 | { | |
10750 | f5pCumulants->SetBinError(18,pow(dError,0.5)); | |
10751 | } | |
10752 | } // end of if(...) | |
10753 | } // end of { | |
e1d101a6 | 10754 | f5pCumulants->SetBinContent(19,f5pCorrelations->GetBinContent(19)-f3pCorrelations->GetBinContent(3)*f2pCorrelations->GetBinContent(4)); |
c10259fb | 10755 | { |
10756 | Double_t dSumWLinearTwo4n4n = 0.; // sum of linear event weights for <2> | |
10757 | Double_t dSumWQuadraticTwo4n4n = 0.; // sum of quadratic event weights <2> | |
10758 | Double_t dSpreadTwo4n4n = 0.; // weighted and biased estimator for sigma of <2> | |
10759 | Double_t dSumWLinearThree6n3n3n = 0.; // sum of linear event weights for <2> | |
10760 | Double_t dSumWQuadraticThree6n3n3n = 0.; // sum of quadratic event weights <2> | |
10761 | Double_t dSpreadThree6n3n3n = 0.; // weighted and biased estimator for sigma of <2> | |
10762 | Double_t dSumWLinearFive6n4n4n3n3n = 0.; // sum of linear event weights for <4> | |
10763 | Double_t dSumWQuadraticFive6n4n4n3n3n = 0.; // sum of quadratic event weights <4> | |
10764 | Double_t dSpreadFive6n4n4n3n3n = 0.; // weighted and biased estimator for sigma of <4> | |
10765 | dSumWLinearTwo4n4n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
10766 | dSumWQuadraticTwo4n4n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
10767 | dSpreadTwo4n4n = f2pCorrelations->GetBinError(4); | |
10768 | dSumWLinearThree6n3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
10769 | dSumWQuadraticThree6n3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
10770 | dSpreadThree6n3n3n = f3pCorrelations->GetBinError(3); | |
10771 | dSumWLinearFive6n4n4n3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
10772 | dSumWQuadraticFive6n4n4n3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
10773 | dSpreadFive6n4n4n3n3n = f5pCorrelations->GetBinError(19); | |
10774 | if(pow(dSumWLinearTwo4n4n,2.)>dSumWQuadraticTwo4n4n && | |
10775 | pow(dSumWLinearThree6n3n3n,2.)>dSumWQuadraticThree6n3n3n && | |
10776 | pow(dSumWLinearFive6n4n4n3n3n,2.)>dSumWQuadraticFive6n4n4n3n3n) | |
10777 | { | |
10778 | Double_t dError = pow(f3pCorrelations->GetBinContent(3),2.) | |
10779 | * pow((pow(dSumWQuadraticTwo4n4n,0.5)/dSumWLinearTwo4n4n) | |
10780 | * dSpreadTwo4n4n*pow(pow(dSumWLinearTwo4n4n,2.)/(pow(dSumWLinearTwo4n4n,2.)-dSumWQuadraticTwo4n4n),0.5),2.) | |
10781 | + pow(f2pCorrelations->GetBinContent(4),2.) | |
10782 | * pow((pow(dSumWQuadraticThree6n3n3n,0.5)/dSumWLinearThree6n3n3n) | |
10783 | * dSpreadThree6n3n3n*pow(pow(dSumWLinearThree6n3n3n,2.)/(pow(dSumWLinearThree6n3n3n,2.)-dSumWQuadraticThree6n3n3n),0.5),2.) | |
10784 | + pow((pow(dSumWQuadraticFive6n4n4n3n3n,0.5)/dSumWLinearFive6n4n4n3n3n) | |
10785 | * dSpreadFive6n4n4n3n3n*pow(pow(dSumWLinearFive6n4n4n3n3n,2.)/(pow(dSumWLinearFive6n4n4n3n3n,2.)-dSumWQuadraticFive6n4n4n3n3n),0.5),2.) | |
10786 | + 2.*f3pCorrelations->GetBinContent(3)*f2pCorrelations->GetBinContent(4) | |
10787 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
10788 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,9)) | |
10789 | - f2pCorrelations->GetBinContent(4)*f3pCorrelations->GetBinContent(3)) | |
10790 | / (dSumWLinearTwo4n4n*dSumWLinearThree6n3n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
10791 | - 2.*f3pCorrelations->GetBinContent(3) | |
10792 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
10793 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,75)) | |
10794 | - f2pCorrelations->GetBinContent(4)*f5pCorrelations->GetBinContent(19)) | |
10795 | / (dSumWLinearTwo4n4n*dSumWLinearFive6n4n4n3n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
10796 | - 2.*f2pCorrelations->GetBinContent(4) | |
10797 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
10798 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(9,75)) | |
10799 | - f3pCorrelations->GetBinContent(3)*f5pCorrelations->GetBinContent(19)) | |
10800 | / (dSumWLinearThree6n3n3n*dSumWLinearFive6n4n4n3n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
10801 | if(dError>0.) | |
10802 | { | |
10803 | f5pCumulants->SetBinError(19,pow(dError,0.5)); | |
10804 | } | |
10805 | } // end of if(...) | |
10806 | } // end of { | |
e1d101a6 | 10807 | f5pCumulants->SetBinContent(20,f5pCorrelations->GetBinContent(20)-f3pCorrelations->GetBinContent(10)*f2pCorrelations->GetBinContent(2)); |
c10259fb | 10808 | { |
10809 | Double_t dSumWLinearTwo2n2n = 0.; // sum of linear event weights for <2> | |
10810 | Double_t dSumWQuadraticTwo2n2n = 0.; // sum of quadratic event weights <2> | |
10811 | Double_t dSpreadTwo2n2n = 0.; // weighted and biased estimator for sigma of <2> | |
10812 | Double_t dSumWLinearThree6n5n1n = 0.; // sum of linear event weights for <2> | |
10813 | Double_t dSumWQuadraticThree6n5n1n = 0.; // sum of quadratic event weights <2> | |
10814 | Double_t dSpreadThree6n5n1n = 0.; // weighted and biased estimator for sigma of <2> | |
10815 | Double_t dSumWLinearFive6n2n5n2n1n = 0.; // sum of linear event weights for <4> | |
10816 | Double_t dSumWQuadraticFive6n2n5n2n1n = 0.; // sum of quadratic event weights <4> | |
10817 | Double_t dSpreadFive6n2n5n2n1n = 0.; // weighted and biased estimator for sigma of <4> | |
10818 | dSumWLinearTwo2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
10819 | dSumWQuadraticTwo2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
10820 | dSpreadTwo2n2n = f2pCorrelations->GetBinError(2); | |
10821 | dSumWLinearThree6n5n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
10822 | dSumWQuadraticThree6n5n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
10823 | dSpreadThree6n5n1n = f3pCorrelations->GetBinError(10); | |
10824 | dSumWLinearFive6n2n5n2n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
10825 | dSumWQuadraticFive6n2n5n2n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
10826 | dSpreadFive6n2n5n2n1n = f5pCorrelations->GetBinError(20); | |
10827 | if(pow(dSumWLinearTwo2n2n,2.)>dSumWQuadraticTwo2n2n && | |
10828 | pow(dSumWLinearThree6n5n1n,2.)>dSumWQuadraticThree6n5n1n && | |
10829 | pow(dSumWLinearFive6n2n5n2n1n,2.)>dSumWQuadraticFive6n2n5n2n1n) | |
10830 | { | |
10831 | Double_t dError = pow(f3pCorrelations->GetBinContent(10),2.) | |
10832 | * pow((pow(dSumWQuadraticTwo2n2n,0.5)/dSumWLinearTwo2n2n) | |
10833 | * dSpreadTwo2n2n*pow(pow(dSumWLinearTwo2n2n,2.)/(pow(dSumWLinearTwo2n2n,2.)-dSumWQuadraticTwo2n2n),0.5),2.) | |
10834 | + pow(f2pCorrelations->GetBinContent(2),2.) | |
10835 | * pow((pow(dSumWQuadraticThree6n5n1n,0.5)/dSumWLinearThree6n5n1n) | |
10836 | * dSpreadThree6n5n1n*pow(pow(dSumWLinearThree6n5n1n,2.)/(pow(dSumWLinearThree6n5n1n,2.)-dSumWQuadraticThree6n5n1n),0.5),2.) | |
10837 | + pow((pow(dSumWQuadraticFive6n2n5n2n1n,0.5)/dSumWLinearFive6n2n5n2n1n) | |
10838 | * dSpreadFive6n2n5n2n1n*pow(pow(dSumWLinearFive6n2n5n2n1n,2.)/(pow(dSumWLinearFive6n2n5n2n1n,2.)-dSumWQuadraticFive6n2n5n2n1n),0.5),2.) | |
10839 | + 2.*f3pCorrelations->GetBinContent(10)*f2pCorrelations->GetBinContent(2) | |
10840 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
10841 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,15)) | |
10842 | - f2pCorrelations->GetBinContent(2)*f3pCorrelations->GetBinContent(10)) | |
10843 | / (dSumWLinearTwo2n2n*dSumWLinearThree6n5n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
10844 | - 2.*f3pCorrelations->GetBinContent(10) | |
10845 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
10846 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,76)) | |
10847 | - f2pCorrelations->GetBinContent(2)*f5pCorrelations->GetBinContent(20)) | |
10848 | / (dSumWLinearTwo2n2n*dSumWLinearFive6n2n5n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
10849 | - 2.*f2pCorrelations->GetBinContent(2) | |
10850 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
10851 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(15,76)) | |
10852 | - f3pCorrelations->GetBinContent(10)*f5pCorrelations->GetBinContent(20)) | |
10853 | / (dSumWLinearThree6n5n1n*dSumWLinearFive6n2n5n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
10854 | if(dError>0.) | |
10855 | { | |
10856 | f5pCumulants->SetBinError(20,pow(dError,0.5)); | |
10857 | } | |
10858 | } // end of if(...) | |
10859 | } // end of { | |
e1d101a6 | 10860 | f5pCumulants->SetBinContent(21,f5pCorrelations->GetBinContent(21)-f3pCorrelations->GetBinContent(10)*f2pCorrelations->GetBinContent(3)); |
c10259fb | 10861 | { |
10862 | Double_t dSumWLinearTwo3n3n = 0.; // sum of linear event weights for <2> | |
10863 | Double_t dSumWQuadraticTwo3n3n = 0.; // sum of quadratic event weights <2> | |
10864 | Double_t dSpreadTwo3n3n = 0.; // weighted and biased estimator for sigma of <2> | |
10865 | Double_t dSumWLinearThree6n5n1n = 0.; // sum of linear event weights for <2> | |
10866 | Double_t dSumWQuadraticThree6n5n1n = 0.; // sum of quadratic event weights <2> | |
10867 | Double_t dSpreadThree6n5n1n = 0.; // weighted and biased estimator for sigma of <2> | |
10868 | Double_t dSumWLinearFive6n3n5n3n1n = 0.; // sum of linear event weights for <4> | |
10869 | Double_t dSumWQuadraticFive6n3n5n3n1n = 0.; // sum of quadratic event weights <4> | |
10870 | Double_t dSpreadFive6n3n5n3n1n = 0.; // weighted and biased estimator for sigma of <4> | |
10871 | dSumWLinearTwo3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
10872 | dSumWQuadraticTwo3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
10873 | dSpreadTwo3n3n = f2pCorrelations->GetBinError(3); | |
10874 | dSumWLinearThree6n5n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
10875 | dSumWQuadraticThree6n5n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
10876 | dSpreadThree6n5n1n = f3pCorrelations->GetBinError(10); | |
10877 | dSumWLinearFive6n3n5n3n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
10878 | dSumWQuadraticFive6n3n5n3n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
10879 | dSpreadFive6n3n5n3n1n = f5pCorrelations->GetBinError(21); | |
10880 | if(pow(dSumWLinearTwo3n3n,2.)>dSumWQuadraticTwo3n3n && | |
10881 | pow(dSumWLinearThree6n5n1n,2.)>dSumWQuadraticThree6n5n1n && | |
10882 | pow(dSumWLinearFive6n3n5n3n1n,2.)>dSumWQuadraticFive6n3n5n3n1n) | |
10883 | { | |
10884 | Double_t dError = pow(f3pCorrelations->GetBinContent(10),2.) | |
10885 | * pow((pow(dSumWQuadraticTwo3n3n,0.5)/dSumWLinearTwo3n3n) | |
10886 | * dSpreadTwo3n3n*pow(pow(dSumWLinearTwo3n3n,2.)/(pow(dSumWLinearTwo3n3n,2.)-dSumWQuadraticTwo3n3n),0.5),2.) | |
10887 | + pow(f2pCorrelations->GetBinContent(3),2.) | |
10888 | * pow((pow(dSumWQuadraticThree6n5n1n,0.5)/dSumWLinearThree6n5n1n) | |
10889 | * dSpreadThree6n5n1n*pow(pow(dSumWLinearThree6n5n1n,2.)/(pow(dSumWLinearThree6n5n1n,2.)-dSumWQuadraticThree6n5n1n),0.5),2.) | |
10890 | + pow((pow(dSumWQuadraticFive6n3n5n3n1n,0.5)/dSumWLinearFive6n3n5n3n1n) | |
10891 | * dSpreadFive6n3n5n3n1n*pow(pow(dSumWLinearFive6n3n5n3n1n,2.)/(pow(dSumWLinearFive6n3n5n3n1n,2.)-dSumWQuadraticFive6n3n5n3n1n),0.5),2.) | |
10892 | + 2.*f3pCorrelations->GetBinContent(10)*f2pCorrelations->GetBinContent(3) | |
10893 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
10894 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,15)) | |
10895 | - f2pCorrelations->GetBinContent(3)*f3pCorrelations->GetBinContent(10)) | |
10896 | / (dSumWLinearTwo3n3n*dSumWLinearThree6n5n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
10897 | - 2.*f3pCorrelations->GetBinContent(10) | |
10898 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
10899 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,77)) | |
10900 | - f2pCorrelations->GetBinContent(3)*f5pCorrelations->GetBinContent(21)) | |
10901 | / (dSumWLinearTwo3n3n*dSumWLinearFive6n3n5n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
10902 | - 2.*f2pCorrelations->GetBinContent(3) | |
10903 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
10904 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(15,77)) | |
10905 | - f3pCorrelations->GetBinContent(10)*f5pCorrelations->GetBinContent(21)) | |
10906 | / (dSumWLinearThree6n5n1n*dSumWLinearFive6n3n5n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
10907 | if(dError>0.) | |
10908 | { | |
10909 | f5pCumulants->SetBinError(21,pow(dError,0.5)); | |
10910 | } | |
10911 | } // end of if(...) | |
10912 | } // end of { | |
e1d101a6 | 10913 | f5pCumulants->SetBinContent(22,f5pCorrelations->GetBinContent(22)-f3pCorrelations->GetBinContent(10)*f2pCorrelations->GetBinContent(4)); |
c10259fb | 10914 | { |
10915 | Double_t dSumWLinearTwo4n4n = 0.; // sum of linear event weights for <2> | |
10916 | Double_t dSumWQuadraticTwo4n4n = 0.; // sum of quadratic event weights <2> | |
10917 | Double_t dSpreadTwo4n4n = 0.; // weighted and biased estimator for sigma of <2> | |
10918 | Double_t dSumWLinearThree6n5n1n = 0.; // sum of linear event weights for <2> | |
10919 | Double_t dSumWQuadraticThree6n5n1n = 0.; // sum of quadratic event weights <2> | |
10920 | Double_t dSpreadThree6n5n1n = 0.; // weighted and biased estimator for sigma of <2> | |
10921 | Double_t dSumWLinearFive6n3n5n3n1n = 0.; // sum of linear event weights for <4> | |
10922 | Double_t dSumWQuadraticFive6n3n5n3n1n = 0.; // sum of quadratic event weights <4> | |
10923 | Double_t dSpreadFive6n3n5n3n1n = 0.; // weighted and biased estimator for sigma of <4> | |
10924 | dSumWLinearTwo4n4n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
10925 | dSumWQuadraticTwo4n4n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
10926 | dSpreadTwo4n4n = f2pCorrelations->GetBinError(4); | |
10927 | dSumWLinearThree6n5n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
10928 | dSumWQuadraticThree6n5n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
10929 | dSpreadThree6n5n1n = f3pCorrelations->GetBinError(10); | |
10930 | dSumWLinearFive6n3n5n3n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
10931 | dSumWQuadraticFive6n3n5n3n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
10932 | dSpreadFive6n3n5n3n1n = f5pCorrelations->GetBinError(22); | |
10933 | if(pow(dSumWLinearTwo4n4n,2.)>dSumWQuadraticTwo4n4n && | |
10934 | pow(dSumWLinearThree6n5n1n,2.)>dSumWQuadraticThree6n5n1n && | |
10935 | pow(dSumWLinearFive6n3n5n3n1n,2.)>dSumWQuadraticFive6n3n5n3n1n) | |
10936 | { | |
10937 | Double_t dError = pow(f3pCorrelations->GetBinContent(10),2.) | |
10938 | * pow((pow(dSumWQuadraticTwo4n4n,0.5)/dSumWLinearTwo4n4n) | |
10939 | * dSpreadTwo4n4n*pow(pow(dSumWLinearTwo4n4n,2.)/(pow(dSumWLinearTwo4n4n,2.)-dSumWQuadraticTwo4n4n),0.5),2.) | |
10940 | + pow(f2pCorrelations->GetBinContent(4),2.) | |
10941 | * pow((pow(dSumWQuadraticThree6n5n1n,0.5)/dSumWLinearThree6n5n1n) | |
10942 | * dSpreadThree6n5n1n*pow(pow(dSumWLinearThree6n5n1n,2.)/(pow(dSumWLinearThree6n5n1n,2.)-dSumWQuadraticThree6n5n1n),0.5),2.) | |
10943 | + pow((pow(dSumWQuadraticFive6n3n5n3n1n,0.5)/dSumWLinearFive6n3n5n3n1n) | |
10944 | * dSpreadFive6n3n5n3n1n*pow(pow(dSumWLinearFive6n3n5n3n1n,2.)/(pow(dSumWLinearFive6n3n5n3n1n,2.)-dSumWQuadraticFive6n3n5n3n1n),0.5),2.) | |
10945 | + 2.*f3pCorrelations->GetBinContent(10)*f2pCorrelations->GetBinContent(4) | |
10946 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
10947 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,15)) | |
10948 | - f2pCorrelations->GetBinContent(4)*f3pCorrelations->GetBinContent(10)) | |
10949 | / (dSumWLinearTwo4n4n*dSumWLinearThree6n5n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
10950 | - 2.*f3pCorrelations->GetBinContent(10) | |
10951 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
10952 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,78)) | |
10953 | - f2pCorrelations->GetBinContent(4)*f5pCorrelations->GetBinContent(22)) | |
10954 | / (dSumWLinearTwo4n4n*dSumWLinearFive6n3n5n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
10955 | - 2.*f2pCorrelations->GetBinContent(4) | |
10956 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
10957 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(15,78)) | |
10958 | - f3pCorrelations->GetBinContent(10)*f5pCorrelations->GetBinContent(22)) | |
10959 | / (dSumWLinearThree6n5n1n*dSumWLinearFive6n3n5n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
10960 | if(dError>0.) | |
10961 | { | |
10962 | f5pCumulants->SetBinError(22,pow(dError,0.5)); | |
10963 | } | |
10964 | } // end of if(...) | |
10965 | } // end of { | |
e1d101a6 | 10966 | f5pCumulants->SetBinContent(23,f5pCorrelations->GetBinContent(23)-f3pCorrelations->GetBinContent(3)*f2pCorrelations->GetBinContent(5)); |
c10259fb | 10967 | { |
10968 | Double_t dSumWLinearTwo5n5n = 0.; // sum of linear event weights for <2> | |
10969 | Double_t dSumWQuadraticTwo5n5n = 0.; // sum of quadratic event weights <2> | |
10970 | Double_t dSpreadTwo5n5n = 0.; // weighted and biased estimator for sigma of <2> | |
10971 | Double_t dSumWLinearThree6n3n3n = 0.; // sum of linear event weights for <2> | |
10972 | Double_t dSumWQuadraticThree6n3n3n = 0.; // sum of quadratic event weights <2> | |
10973 | Double_t dSpreadThree6n3n3n = 0.; // weighted and biased estimator for sigma of <2> | |
10974 | Double_t dSumWLinearFive6n5n5n3n3n = 0.; // sum of linear event weights for <4> | |
10975 | Double_t dSumWQuadraticFive6n5n5n3n3n = 0.; // sum of quadratic event weights <4> | |
10976 | Double_t dSpreadFive6n5n5n3n3n = 0.; // weighted and biased estimator for sigma of <4> | |
10977 | dSumWLinearTwo5n5n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
10978 | dSumWQuadraticTwo5n5n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
10979 | dSpreadTwo5n5n = f2pCorrelations->GetBinError(5); | |
10980 | dSumWLinearThree6n3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
10981 | dSumWQuadraticThree6n3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
10982 | dSpreadThree6n3n3n = f3pCorrelations->GetBinError(3); | |
10983 | dSumWLinearFive6n5n5n3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
10984 | dSumWQuadraticFive6n5n5n3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
10985 | dSpreadFive6n5n5n3n3n = f5pCorrelations->GetBinError(23); | |
10986 | if(pow(dSumWLinearTwo5n5n,2.)>dSumWQuadraticTwo5n5n && | |
10987 | pow(dSumWLinearThree6n3n3n,2.)>dSumWQuadraticThree6n3n3n && | |
10988 | pow(dSumWLinearFive6n5n5n3n3n,2.)>dSumWQuadraticFive6n5n5n3n3n) | |
10989 | { | |
10990 | Double_t dError = pow(f3pCorrelations->GetBinContent(3),2.) | |
10991 | * pow((pow(dSumWQuadraticTwo5n5n,0.5)/dSumWLinearTwo5n5n) | |
10992 | * dSpreadTwo5n5n*pow(pow(dSumWLinearTwo5n5n,2.)/(pow(dSumWLinearTwo5n5n,2.)-dSumWQuadraticTwo5n5n),0.5),2.) | |
10993 | + pow(f2pCorrelations->GetBinContent(5),2.) | |
10994 | * pow((pow(dSumWQuadraticThree6n3n3n,0.5)/dSumWLinearThree6n3n3n) | |
10995 | * dSpreadThree6n3n3n*pow(pow(dSumWLinearThree6n3n3n,2.)/(pow(dSumWLinearThree6n3n3n,2.)-dSumWQuadraticThree6n3n3n),0.5),2.) | |
10996 | + pow((pow(dSumWQuadraticFive6n5n5n3n3n,0.5)/dSumWLinearFive6n5n5n3n3n) | |
10997 | * dSpreadFive6n5n5n3n3n*pow(pow(dSumWLinearFive6n5n5n3n3n,2.)/(pow(dSumWLinearFive6n5n5n3n3n,2.)-dSumWQuadraticFive6n5n5n3n3n),0.5),2.) | |
10998 | + 2.*f3pCorrelations->GetBinContent(3)*f2pCorrelations->GetBinContent(5) | |
10999 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
11000 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,9)) | |
11001 | - f2pCorrelations->GetBinContent(5)*f3pCorrelations->GetBinContent(3)) | |
11002 | / (dSumWLinearTwo5n5n*dSumWLinearThree6n3n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
11003 | - 2.*f3pCorrelations->GetBinContent(3) | |
11004 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
11005 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,79)) | |
11006 | - f2pCorrelations->GetBinContent(5)*f5pCorrelations->GetBinContent(23)) | |
11007 | / (dSumWLinearTwo5n5n*dSumWLinearFive6n5n5n3n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
11008 | - 2.*f2pCorrelations->GetBinContent(5) | |
11009 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
11010 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(9,79)) | |
11011 | - f3pCorrelations->GetBinContent(3)*f5pCorrelations->GetBinContent(23)) | |
11012 | / (dSumWLinearThree6n3n3n*dSumWLinearFive6n5n5n3n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
11013 | if(dError>0.) | |
11014 | { | |
11015 | f5pCumulants->SetBinError(23,pow(dError,0.5)); | |
11016 | } | |
11017 | } // end of if(...) | |
11018 | } // end of { | |
e1d101a6 | 11019 | f5pCumulants->SetBinContent(24,f5pCorrelations->GetBinContent(24)-f3pCorrelations->GetBinContent(1)*f2pCorrelations->GetBinContent(6)); |
c10259fb | 11020 | { |
11021 | Double_t dSumWLinearTwo6n6n = 0.; // sum of linear event weights for <2> | |
11022 | Double_t dSumWQuadraticTwo6n6n = 0.; // sum of quadratic event weights <2> | |
11023 | Double_t dSpreadTwo6n6n = 0.; // weighted and biased estimator for sigma of <2> | |
11024 | Double_t dSumWLinearThree2n1n1n = 0.; // sum of linear event weights for <2> | |
11025 | Double_t dSumWQuadraticThree2n1n1n = 0.; // sum of quadratic event weights <2> | |
11026 | Double_t dSpreadThree2n1n1n = 0.; // weighted and biased estimator for sigma of <2> | |
11027 | Double_t dSumWLinearFive6n2n6n1n1n = 0.; // sum of linear event weights for <4> | |
11028 | Double_t dSumWQuadraticFive6n2n6n1n1n = 0.; // sum of quadratic event weights <4> | |
11029 | Double_t dSpreadFive6n2n6n1n1n = 0.; // weighted and biased estimator for sigma of <4> | |
11030 | dSumWLinearTwo6n6n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
11031 | dSumWQuadraticTwo6n6n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
11032 | dSpreadTwo6n6n = f2pCorrelations->GetBinError(6); | |
11033 | dSumWLinearThree2n1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
11034 | dSumWQuadraticThree2n1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
11035 | dSpreadThree2n1n1n = f3pCorrelations->GetBinError(1); | |
11036 | dSumWLinearFive6n2n6n1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
11037 | dSumWQuadraticFive6n2n6n1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
11038 | dSpreadFive6n2n6n1n1n = f5pCorrelations->GetBinError(24); | |
11039 | if(pow(dSumWLinearTwo6n6n,2.)>dSumWQuadraticTwo6n6n && | |
11040 | pow(dSumWLinearThree2n1n1n,2.)>dSumWQuadraticThree2n1n1n && | |
11041 | pow(dSumWLinearFive6n2n6n1n1n,2.)>dSumWQuadraticFive6n2n6n1n1n) | |
11042 | { | |
11043 | Double_t dError = pow(f3pCorrelations->GetBinContent(1),2.) | |
11044 | * pow((pow(dSumWQuadraticTwo6n6n,0.5)/dSumWLinearTwo6n6n) | |
11045 | * dSpreadTwo6n6n*pow(pow(dSumWLinearTwo6n6n,2.)/(pow(dSumWLinearTwo6n6n,2.)-dSumWQuadraticTwo6n6n),0.5),2.) | |
11046 | + pow(f2pCorrelations->GetBinContent(6),2.) | |
11047 | * pow((pow(dSumWQuadraticThree2n1n1n,0.5)/dSumWLinearThree2n1n1n) | |
11048 | * dSpreadThree2n1n1n*pow(pow(dSumWLinearThree2n1n1n,2.)/(pow(dSumWLinearThree2n1n1n,2.)-dSumWQuadraticThree2n1n1n),0.5),2.) | |
11049 | + pow((pow(dSumWQuadraticFive6n2n6n1n1n,0.5)/dSumWLinearFive6n2n6n1n1n) | |
11050 | * dSpreadFive6n2n6n1n1n*pow(pow(dSumWLinearFive6n2n6n1n1n,2.)/(pow(dSumWLinearFive6n2n6n1n1n,2.)-dSumWQuadraticFive6n2n6n1n1n),0.5),2.) | |
11051 | + 2.*f3pCorrelations->GetBinContent(1)*f2pCorrelations->GetBinContent(6) | |
11052 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
11053 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,7)) | |
11054 | - f2pCorrelations->GetBinContent(6)*f3pCorrelations->GetBinContent(1)) | |
11055 | / (dSumWLinearTwo6n6n*dSumWLinearThree2n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
11056 | - 2.*f3pCorrelations->GetBinContent(1) | |
11057 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
11058 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,80)) | |
11059 | - f2pCorrelations->GetBinContent(6)*f5pCorrelations->GetBinContent(24)) | |
11060 | / (dSumWLinearTwo6n6n*dSumWLinearFive6n2n6n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
11061 | - 2.*f2pCorrelations->GetBinContent(6) | |
11062 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
11063 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(7,80)) | |
11064 | - f3pCorrelations->GetBinContent(1)*f5pCorrelations->GetBinContent(24)) | |
11065 | / (dSumWLinearThree2n1n1n*dSumWLinearFive6n2n6n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
11066 | if(dError>0.) | |
11067 | { | |
11068 | f5pCumulants->SetBinError(24,pow(dError,0.5)); | |
11069 | } | |
11070 | } // end of if(...) | |
11071 | } // end of { | |
e1d101a6 | 11072 | f5pCumulants->SetBinContent(25,f5pCorrelations->GetBinContent(25)-f3pCorrelations->GetBinContent(5)*f2pCorrelations->GetBinContent(6)); |
c10259fb | 11073 | { |
11074 | Double_t dSumWLinearTwo6n6n = 0.; // sum of linear event weights for <2> | |
11075 | Double_t dSumWQuadraticTwo6n6n = 0.; // sum of quadratic event weights <2> | |
11076 | Double_t dSpreadTwo6n6n = 0.; // weighted and biased estimator for sigma of <2> | |
11077 | Double_t dSumWLinearThree3n2n1n = 0.; // sum of linear event weights for <2> | |
11078 | Double_t dSumWQuadraticThree3n2n1n = 0.; // sum of quadratic event weights <2> | |
11079 | Double_t dSpreadThree3n2n1n = 0.; // weighted and biased estimator for sigma of <2> | |
11080 | Double_t dSumWLinearFive6n3n6n2n1n = 0.; // sum of linear event weights for <4> | |
11081 | Double_t dSumWQuadraticFive6n3n6n2n1n = 0.; // sum of quadratic event weights <4> | |
11082 | Double_t dSpreadFive6n3n6n2n1n = 0.; // weighted and biased estimator for sigma of <4> | |
11083 | dSumWLinearTwo6n6n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
11084 | dSumWQuadraticTwo6n6n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
11085 | dSpreadTwo6n6n = f2pCorrelations->GetBinError(6); | |
11086 | dSumWLinearThree3n2n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
11087 | dSumWQuadraticThree3n2n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
11088 | dSpreadThree3n2n1n = f3pCorrelations->GetBinError(5); | |
11089 | dSumWLinearFive6n3n6n2n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
11090 | dSumWQuadraticFive6n3n6n2n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
11091 | dSpreadFive6n3n6n2n1n = f5pCorrelations->GetBinError(25); | |
11092 | if(pow(dSumWLinearTwo6n6n,2.)>dSumWQuadraticTwo6n6n && | |
11093 | pow(dSumWLinearThree3n2n1n,2.)>dSumWQuadraticThree3n2n1n && | |
11094 | pow(dSumWLinearFive6n3n6n2n1n,2.)>dSumWQuadraticFive6n3n6n2n1n) | |
11095 | { | |
11096 | Double_t dError = pow(f3pCorrelations->GetBinContent(5),2.) | |
11097 | * pow((pow(dSumWQuadraticTwo6n6n,0.5)/dSumWLinearTwo6n6n) | |
11098 | * dSpreadTwo6n6n*pow(pow(dSumWLinearTwo6n6n,2.)/(pow(dSumWLinearTwo6n6n,2.)-dSumWQuadraticTwo6n6n),0.5),2.) | |
11099 | + pow(f2pCorrelations->GetBinContent(6),2.) | |
11100 | * pow((pow(dSumWQuadraticThree3n2n1n,0.5)/dSumWLinearThree3n2n1n) | |
11101 | * dSpreadThree3n2n1n*pow(pow(dSumWLinearThree3n2n1n,2.)/(pow(dSumWLinearThree3n2n1n,2.)-dSumWQuadraticThree3n2n1n),0.5),2.) | |
11102 | + pow((pow(dSumWQuadraticFive6n3n6n2n1n,0.5)/dSumWLinearFive6n3n6n2n1n) | |
11103 | * dSpreadFive6n3n6n2n1n*pow(pow(dSumWLinearFive6n3n6n2n1n,2.)/(pow(dSumWLinearFive6n3n6n2n1n,2.)-dSumWQuadraticFive6n3n6n2n1n),0.5),2.) | |
11104 | + 2.*f3pCorrelations->GetBinContent(5)*f2pCorrelations->GetBinContent(6) | |
11105 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
11106 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,10)) | |
11107 | - f2pCorrelations->GetBinContent(6)*f3pCorrelations->GetBinContent(5)) | |
11108 | / (dSumWLinearTwo6n6n*dSumWLinearThree3n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
11109 | - 2.*f3pCorrelations->GetBinContent(5) | |
11110 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
11111 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,81)) | |
11112 | - f2pCorrelations->GetBinContent(6)*f5pCorrelations->GetBinContent(25)) | |
11113 | / (dSumWLinearTwo6n6n*dSumWLinearFive6n3n6n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
11114 | - 2.*f2pCorrelations->GetBinContent(6) | |
11115 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
11116 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(10,81)) | |
11117 | - f3pCorrelations->GetBinContent(5)*f5pCorrelations->GetBinContent(25)) | |
11118 | / (dSumWLinearThree3n2n1n*dSumWLinearFive6n3n6n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
11119 | if(dError>0.) | |
11120 | { | |
11121 | f5pCumulants->SetBinError(25,pow(dError,0.5)); | |
11122 | } | |
11123 | } // end of if(...) | |
11124 | } // end of { | |
e1d101a6 | 11125 | f5pCumulants->SetBinContent(26,f5pCorrelations->GetBinContent(26)-f3pCorrelations->GetBinContent(2)*f2pCorrelations->GetBinContent(6)); |
c10259fb | 11126 | { |
11127 | Double_t dSumWLinearTwo6n6n = 0.; // sum of linear event weights for <2> | |
11128 | Double_t dSumWQuadraticTwo6n6n = 0.; // sum of quadratic event weights <2> | |
11129 | Double_t dSpreadTwo6n6n = 0.; // weighted and biased estimator for sigma of <2> | |
11130 | Double_t dSumWLinearThree4n2n2n = 0.; // sum of linear event weights for <2> | |
11131 | Double_t dSumWQuadraticThree4n2n2n = 0.; // sum of quadratic event weights <2> | |
11132 | Double_t dSpreadThree4n2n2n = 0.; // weighted and biased estimator for sigma of <2> | |
11133 | Double_t dSumWLinearFive6n4n6n2n2n = 0.; // sum of linear event weights for <4> | |
11134 | Double_t dSumWQuadraticFive6n4n6n2n2n = 0.; // sum of quadratic event weights <4> | |
11135 | Double_t dSpreadFive6n4n6n2n2n = 0.; // weighted and biased estimator for sigma of <4> | |
11136 | dSumWLinearTwo6n6n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
11137 | dSumWQuadraticTwo6n6n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
11138 | dSpreadTwo6n6n = f2pCorrelations->GetBinError(6); | |
11139 | dSumWLinearThree4n2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
11140 | dSumWQuadraticThree4n2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
11141 | dSpreadThree4n2n2n = f3pCorrelations->GetBinError(2); | |
11142 | dSumWLinearFive6n4n6n2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
11143 | dSumWQuadraticFive6n4n6n2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
11144 | dSpreadFive6n4n6n2n2n = f5pCorrelations->GetBinError(26); | |
11145 | if(pow(dSumWLinearTwo6n6n,2.)>dSumWQuadraticTwo6n6n && | |
11146 | pow(dSumWLinearThree4n2n2n,2.)>dSumWQuadraticThree4n2n2n && | |
11147 | pow(dSumWLinearFive6n4n6n2n2n,2.)>dSumWQuadraticFive6n4n6n2n2n) | |
11148 | { | |
11149 | Double_t dError = pow(f3pCorrelations->GetBinContent(2),2.) | |
11150 | * pow((pow(dSumWQuadraticTwo6n6n,0.5)/dSumWLinearTwo6n6n) | |
11151 | * dSpreadTwo6n6n*pow(pow(dSumWLinearTwo6n6n,2.)/(pow(dSumWLinearTwo6n6n,2.)-dSumWQuadraticTwo6n6n),0.5),2.) | |
11152 | + pow(f2pCorrelations->GetBinContent(6),2.) | |
11153 | * pow((pow(dSumWQuadraticThree4n2n2n,0.5)/dSumWLinearThree4n2n2n) | |
11154 | * dSpreadThree4n2n2n*pow(pow(dSumWLinearThree4n2n2n,2.)/(pow(dSumWLinearThree4n2n2n,2.)-dSumWQuadraticThree4n2n2n),0.5),2.) | |
11155 | + pow((pow(dSumWQuadraticFive6n4n6n2n2n,0.5)/dSumWLinearFive6n4n6n2n2n) | |
11156 | * dSpreadFive6n4n6n2n2n*pow(pow(dSumWLinearFive6n4n6n2n2n,2.)/(pow(dSumWLinearFive6n4n6n2n2n,2.)-dSumWQuadraticFive6n4n6n2n2n),0.5),2.) | |
11157 | + 2.*f3pCorrelations->GetBinContent(2)*f2pCorrelations->GetBinContent(6) | |
11158 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
11159 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,8)) | |
11160 | - f2pCorrelations->GetBinContent(6)*f3pCorrelations->GetBinContent(2)) | |
11161 | / (dSumWLinearTwo6n6n*dSumWLinearThree4n2n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
11162 | - 2.*f3pCorrelations->GetBinContent(2) | |
11163 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
11164 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,82)) | |
11165 | - f2pCorrelations->GetBinContent(6)*f5pCorrelations->GetBinContent(26)) | |
11166 | / (dSumWLinearTwo6n6n*dSumWLinearFive6n4n6n2n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
11167 | - 2.*f2pCorrelations->GetBinContent(6) | |
11168 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
11169 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(8,82)) | |
11170 | - f3pCorrelations->GetBinContent(2)*f5pCorrelations->GetBinContent(26)) | |
11171 | / (dSumWLinearThree4n2n2n*dSumWLinearFive6n4n6n2n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
11172 | if(dError>0.) | |
11173 | { | |
11174 | f5pCumulants->SetBinError(26,pow(dError,0.5)); | |
11175 | } | |
11176 | } // end of if(...) | |
11177 | } // end of { | |
e1d101a6 | 11178 | f5pCumulants->SetBinContent(27,f5pCorrelations->GetBinContent(27)-f3pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(6)); |
c10259fb | 11179 | { |
11180 | Double_t dSumWLinearTwo6n6n = 0.; // sum of linear event weights for <2> | |
11181 | Double_t dSumWQuadraticTwo6n6n = 0.; // sum of quadratic event weights <2> | |
11182 | Double_t dSpreadTwo6n6n = 0.; // weighted and biased estimator for sigma of <2> | |
11183 | Double_t dSumWLinearThree4n3n1n = 0.; // sum of linear event weights for <2> | |
11184 | Double_t dSumWQuadraticThree4n3n1n = 0.; // sum of quadratic event weights <2> | |
11185 | Double_t dSpreadThree4n3n1n = 0.; // weighted and biased estimator for sigma of <2> | |
11186 | Double_t dSumWLinearFive6n4n6n3n1n = 0.; // sum of linear event weights for <4> | |
11187 | Double_t dSumWQuadraticFive6n4n6n3n1n = 0.; // sum of quadratic event weights <4> | |
11188 | Double_t dSpreadFive6n4n6n3n1n = 0.; // weighted and biased estimator for sigma of <4> | |
11189 | dSumWLinearTwo6n6n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
11190 | dSumWQuadraticTwo6n6n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
11191 | dSpreadTwo6n6n = f2pCorrelations->GetBinError(6); | |
11192 | dSumWLinearThree4n3n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
11193 | dSumWQuadraticThree4n3n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
11194 | dSpreadThree4n3n1n = f3pCorrelations->GetBinError(6); | |
11195 | dSumWLinearFive6n4n6n3n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
11196 | dSumWQuadraticFive6n4n6n3n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
11197 | dSpreadFive6n4n6n3n1n = f5pCorrelations->GetBinError(27); | |
11198 | if(pow(dSumWLinearTwo6n6n,2.)>dSumWQuadraticTwo6n6n && | |
11199 | pow(dSumWLinearThree4n3n1n,2.)>dSumWQuadraticThree4n3n1n && | |
11200 | pow(dSumWLinearFive6n4n6n3n1n,2.)>dSumWQuadraticFive6n4n6n3n1n) | |
11201 | { | |
11202 | Double_t dError = pow(f3pCorrelations->GetBinContent(6),2.) | |
11203 | * pow((pow(dSumWQuadraticTwo6n6n,0.5)/dSumWLinearTwo6n6n) | |
11204 | * dSpreadTwo6n6n*pow(pow(dSumWLinearTwo6n6n,2.)/(pow(dSumWLinearTwo6n6n,2.)-dSumWQuadraticTwo6n6n),0.5),2.) | |
11205 | + pow(f2pCorrelations->GetBinContent(6),2.) | |
11206 | * pow((pow(dSumWQuadraticThree4n3n1n,0.5)/dSumWLinearThree4n3n1n) | |
11207 | * dSpreadThree4n3n1n*pow(pow(dSumWLinearThree4n3n1n,2.)/(pow(dSumWLinearThree4n3n1n,2.)-dSumWQuadraticThree4n3n1n),0.5),2.) | |
11208 | + pow((pow(dSumWQuadraticFive6n4n6n3n1n,0.5)/dSumWLinearFive6n4n6n3n1n) | |
11209 | * dSpreadFive6n4n6n3n1n*pow(pow(dSumWLinearFive6n4n6n3n1n,2.)/(pow(dSumWLinearFive6n4n6n3n1n,2.)-dSumWQuadraticFive6n4n6n3n1n),0.5),2.) | |
11210 | + 2.*f3pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(6) | |
11211 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
11212 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,11)) | |
11213 | - f2pCorrelations->GetBinContent(6)*f3pCorrelations->GetBinContent(6)) | |
11214 | / (dSumWLinearTwo6n6n*dSumWLinearThree4n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
11215 | - 2.*f3pCorrelations->GetBinContent(6) | |
11216 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
11217 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,83)) | |
11218 | - f2pCorrelations->GetBinContent(6)*f5pCorrelations->GetBinContent(27)) | |
11219 | / (dSumWLinearTwo6n6n*dSumWLinearFive6n4n6n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
11220 | - 2.*f2pCorrelations->GetBinContent(6) | |
11221 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
11222 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(11,83)) | |
11223 | - f3pCorrelations->GetBinContent(6)*f5pCorrelations->GetBinContent(27)) | |
11224 | / (dSumWLinearThree4n3n1n*dSumWLinearFive6n4n6n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
11225 | if(dError>0.) | |
11226 | { | |
11227 | f5pCumulants->SetBinError(27,pow(dError,0.5)); | |
11228 | } | |
11229 | } // end of if(...) | |
11230 | } // end of { | |
e1d101a6 | 11231 | f5pCumulants->SetBinContent(28,f5pCorrelations->GetBinContent(28)-f3pCorrelations->GetBinContent(9)*f2pCorrelations->GetBinContent(5)); |
c10259fb | 11232 | { |
11233 | Double_t dSumWLinearTwo5n5n = 0.; // sum of linear event weights for <2> | |
11234 | Double_t dSumWQuadraticTwo5n5n = 0.; // sum of quadratic event weights <2> | |
11235 | Double_t dSpreadTwo5n5n = 0.; // weighted and biased estimator for sigma of <2> | |
11236 | Double_t dSumWLinearThree6n4n2n = 0.; // sum of linear event weights for <2> | |
11237 | Double_t dSumWQuadraticThree6n4n2n = 0.; // sum of quadratic event weights <2> | |
11238 | Double_t dSpreadThree6n4n2n = 0.; // weighted and biased estimator for sigma of <2> | |
11239 | Double_t dSumWLinearFive6n4n6n3n1n = 0.; // sum of linear event weights for <4> | |
11240 | Double_t dSumWQuadraticFive6n4n6n3n1n = 0.; // sum of quadratic event weights <4> | |
11241 | Double_t dSpreadFive6n4n6n3n1n = 0.; // weighted and biased estimator for sigma of <4> | |
11242 | dSumWLinearTwo5n5n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
11243 | dSumWQuadraticTwo5n5n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
11244 | dSpreadTwo5n5n = f2pCorrelations->GetBinError(5); | |
11245 | dSumWLinearThree6n4n2n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
11246 | dSumWQuadraticThree6n4n2n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
11247 | dSpreadThree6n4n2n = f3pCorrelations->GetBinError(9); | |
11248 | dSumWLinearFive6n4n6n3n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
11249 | dSumWQuadraticFive6n4n6n3n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
11250 | dSpreadFive6n4n6n3n1n = f5pCorrelations->GetBinError(28); | |
11251 | if(pow(dSumWLinearTwo5n5n,2.)>dSumWQuadraticTwo5n5n && | |
11252 | pow(dSumWLinearThree6n4n2n,2.)>dSumWQuadraticThree6n4n2n && | |
11253 | pow(dSumWLinearFive6n4n6n3n1n,2.)>dSumWQuadraticFive6n4n6n3n1n) | |
11254 | { | |
11255 | Double_t dError = pow(f3pCorrelations->GetBinContent(9),2.) | |
11256 | * pow((pow(dSumWQuadraticTwo5n5n,0.5)/dSumWLinearTwo5n5n) | |
11257 | * dSpreadTwo5n5n*pow(pow(dSumWLinearTwo5n5n,2.)/(pow(dSumWLinearTwo5n5n,2.)-dSumWQuadraticTwo5n5n),0.5),2.) | |
11258 | + pow(f2pCorrelations->GetBinContent(5),2.) | |
11259 | * pow((pow(dSumWQuadraticThree6n4n2n,0.5)/dSumWLinearThree6n4n2n) | |
11260 | * dSpreadThree6n4n2n*pow(pow(dSumWLinearThree6n4n2n,2.)/(pow(dSumWLinearThree6n4n2n,2.)-dSumWQuadraticThree6n4n2n),0.5),2.) | |
11261 | + pow((pow(dSumWQuadraticFive6n4n6n3n1n,0.5)/dSumWLinearFive6n4n6n3n1n) | |
11262 | * dSpreadFive6n4n6n3n1n*pow(pow(dSumWLinearFive6n4n6n3n1n,2.)/(pow(dSumWLinearFive6n4n6n3n1n,2.)-dSumWQuadraticFive6n4n6n3n1n),0.5),2.) | |
11263 | + 2.*f3pCorrelations->GetBinContent(9)*f2pCorrelations->GetBinContent(5) | |
11264 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
11265 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,14)) | |
11266 | - f2pCorrelations->GetBinContent(5)*f3pCorrelations->GetBinContent(9)) | |
11267 | / (dSumWLinearTwo5n5n*dSumWLinearThree6n4n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
11268 | - 2.*f3pCorrelations->GetBinContent(9) | |
11269 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
11270 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,84)) | |
11271 | - f2pCorrelations->GetBinContent(5)*f5pCorrelations->GetBinContent(28)) | |
11272 | / (dSumWLinearTwo5n5n*dSumWLinearFive6n4n6n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
11273 | - 2.*f2pCorrelations->GetBinContent(5) | |
11274 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
11275 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(14,84)) | |
11276 | - f3pCorrelations->GetBinContent(9)*f5pCorrelations->GetBinContent(28)) | |
11277 | / (dSumWLinearThree6n4n2n*dSumWLinearFive6n4n6n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
11278 | if(dError>0.) | |
11279 | { | |
11280 | f5pCumulants->SetBinError(28,pow(dError,0.5)); | |
11281 | } | |
11282 | } // end of if(...) | |
11283 | } // end of { | |
e1d101a6 | 11284 | f5pCumulants->SetBinContent(29,f5pCorrelations->GetBinContent(29)-f3pCorrelations->GetBinContent(7)*f2pCorrelations->GetBinContent(6)); |
c10259fb | 11285 | { |
11286 | Double_t dSumWLinearTwo6n6n = 0.; // sum of linear event weights for <2> | |
11287 | Double_t dSumWQuadraticTwo6n6n = 0.; // sum of quadratic event weights <2> | |
11288 | Double_t dSpreadTwo6n6n = 0.; // weighted and biased estimator for sigma of <2> | |
11289 | Double_t dSumWLinearThree5n3n2n = 0.; // sum of linear event weights for <2> | |
11290 | Double_t dSumWQuadraticThree5n3n2n = 0.; // sum of quadratic event weights <2> | |
11291 | Double_t dSpreadThree5n3n2n = 0.; // weighted and biased estimator for sigma of <2> | |
11292 | Double_t dSumWLinearFive6n5n6n3n2n = 0.; // sum of linear event weights for <4> | |
11293 | Double_t dSumWQuadraticFive6n5n6n3n2n = 0.; // sum of quadratic event weights <4> | |
11294 | Double_t dSpreadFive6n5n6n3n2n = 0.; // weighted and biased estimator for sigma of <4> | |
11295 | dSumWLinearTwo6n6n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
11296 | dSumWQuadraticTwo6n6n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
11297 | dSpreadTwo6n6n = f2pCorrelations->GetBinError(6); | |
11298 | dSumWLinearThree5n3n2n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
11299 | dSumWQuadraticThree5n3n2n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
11300 | dSpreadThree5n3n2n = f3pCorrelations->GetBinError(7); | |
11301 | dSumWLinearFive6n5n6n3n2n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
11302 | dSumWQuadraticFive6n5n6n3n2n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
11303 | dSpreadFive6n5n6n3n2n = f5pCorrelations->GetBinError(29); | |
11304 | if(pow(dSumWLinearTwo6n6n,2.)>dSumWQuadraticTwo6n6n && | |
11305 | pow(dSumWLinearThree5n3n2n,2.)>dSumWQuadraticThree5n3n2n && | |
11306 | pow(dSumWLinearFive6n5n6n3n2n,2.)>dSumWQuadraticFive6n5n6n3n2n) | |
11307 | { | |
11308 | Double_t dError = pow(f3pCorrelations->GetBinContent(7),2.) | |
11309 | * pow((pow(dSumWQuadraticTwo6n6n,0.5)/dSumWLinearTwo6n6n) | |
11310 | * dSpreadTwo6n6n*pow(pow(dSumWLinearTwo6n6n,2.)/(pow(dSumWLinearTwo6n6n,2.)-dSumWQuadraticTwo6n6n),0.5),2.) | |
11311 | + pow(f2pCorrelations->GetBinContent(6),2.) | |
11312 | * pow((pow(dSumWQuadraticThree5n3n2n,0.5)/dSumWLinearThree5n3n2n) | |
11313 | * dSpreadThree5n3n2n*pow(pow(dSumWLinearThree5n3n2n,2.)/(pow(dSumWLinearThree5n3n2n,2.)-dSumWQuadraticThree5n3n2n),0.5),2.) | |
11314 | + pow((pow(dSumWQuadraticFive6n5n6n3n2n,0.5)/dSumWLinearFive6n5n6n3n2n) | |
11315 | * dSpreadFive6n5n6n3n2n*pow(pow(dSumWLinearFive6n5n6n3n2n,2.)/(pow(dSumWLinearFive6n5n6n3n2n,2.)-dSumWQuadraticFive6n5n6n3n2n),0.5),2.) | |
11316 | + 2.*f3pCorrelations->GetBinContent(7)*f2pCorrelations->GetBinContent(6) | |
11317 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
11318 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,12)) | |
11319 | - f2pCorrelations->GetBinContent(6)*f3pCorrelations->GetBinContent(7)) | |
11320 | / (dSumWLinearTwo6n6n*dSumWLinearThree5n3n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
11321 | - 2.*f3pCorrelations->GetBinContent(7) | |
11322 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
11323 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,85)) | |
11324 | - f2pCorrelations->GetBinContent(6)*f5pCorrelations->GetBinContent(29)) | |
11325 | / (dSumWLinearTwo6n6n*dSumWLinearFive6n5n6n3n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
11326 | - 2.*f2pCorrelations->GetBinContent(6) | |
11327 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
11328 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(12,85)) | |
11329 | - f3pCorrelations->GetBinContent(7)*f5pCorrelations->GetBinContent(29)) | |
11330 | / (dSumWLinearThree5n3n2n*dSumWLinearFive6n5n6n3n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
11331 | if(dError>0.) | |
11332 | { | |
11333 | f5pCumulants->SetBinError(29,pow(dError,0.5)); | |
11334 | } | |
11335 | } // end of if(...) | |
11336 | } // end of { | |
e1d101a6 | 11337 | f5pCumulants->SetBinContent(30,f5pCorrelations->GetBinContent(30)-f3pCorrelations->GetBinContent(8)*f2pCorrelations->GetBinContent(6)); |
c10259fb | 11338 | { |
11339 | Double_t dSumWLinearTwo6n6n = 0.; // sum of linear event weights for <2> | |
11340 | Double_t dSumWQuadraticTwo6n6n = 0.; // sum of quadratic event weights <2> | |
11341 | Double_t dSpreadTwo6n6n = 0.; // weighted and biased estimator for sigma of <2> | |
11342 | Double_t dSumWLinearThree5n4n1n = 0.; // sum of linear event weights for <2> | |
11343 | Double_t dSumWQuadraticThree5n4n1n = 0.; // sum of quadratic event weights <2> | |
11344 | Double_t dSpreadThree5n4n1n = 0.; // weighted and biased estimator for sigma of <2> | |
11345 | Double_t dSumWLinearFive6n5n6n4n1n = 0.; // sum of linear event weights for <4> | |
11346 | Double_t dSumWQuadraticFive6n5n6n4n1n = 0.; // sum of quadratic event weights <4> | |
11347 | Double_t dSpreadFive6n5n6n4n1n = 0.; // weighted and biased estimator for sigma of <4> | |
11348 | dSumWLinearTwo6n6n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
11349 | dSumWQuadraticTwo6n6n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
11350 | dSpreadTwo6n6n = f2pCorrelations->GetBinError(6); | |
11351 | dSumWLinearThree5n4n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
11352 | dSumWQuadraticThree5n4n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
11353 | dSpreadThree5n4n1n = f3pCorrelations->GetBinError(8); | |
11354 | dSumWLinearFive6n5n6n4n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
11355 | dSumWQuadraticFive6n5n6n4n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
11356 | dSpreadFive6n5n6n4n1n = f5pCorrelations->GetBinError(30); | |
11357 | if(pow(dSumWLinearTwo6n6n,2.)>dSumWQuadraticTwo6n6n && | |
11358 | pow(dSumWLinearThree5n4n1n,2.)>dSumWQuadraticThree5n4n1n && | |
11359 | pow(dSumWLinearFive6n5n6n4n1n,2.)>dSumWQuadraticFive6n5n6n4n1n) | |
11360 | { | |
11361 | Double_t dError = pow(f3pCorrelations->GetBinContent(8),2.) | |
11362 | * pow((pow(dSumWQuadraticTwo6n6n,0.5)/dSumWLinearTwo6n6n) | |
11363 | * dSpreadTwo6n6n*pow(pow(dSumWLinearTwo6n6n,2.)/(pow(dSumWLinearTwo6n6n,2.)-dSumWQuadraticTwo6n6n),0.5),2.) | |
11364 | + pow(f2pCorrelations->GetBinContent(6),2.) | |
11365 | * pow((pow(dSumWQuadraticThree5n4n1n,0.5)/dSumWLinearThree5n4n1n) | |
11366 | * dSpreadThree5n4n1n*pow(pow(dSumWLinearThree5n4n1n,2.)/(pow(dSumWLinearThree5n4n1n,2.)-dSumWQuadraticThree5n4n1n),0.5),2.) | |
11367 | + pow((pow(dSumWQuadraticFive6n5n6n4n1n,0.5)/dSumWLinearFive6n5n6n4n1n) | |
11368 | * dSpreadFive6n5n6n4n1n*pow(pow(dSumWLinearFive6n5n6n4n1n,2.)/(pow(dSumWLinearFive6n5n6n4n1n,2.)-dSumWQuadraticFive6n5n6n4n1n),0.5),2.) | |
11369 | + 2.*f3pCorrelations->GetBinContent(8)*f2pCorrelations->GetBinContent(6) | |
11370 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
11371 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,13)) | |
11372 | - f2pCorrelations->GetBinContent(6)*f3pCorrelations->GetBinContent(8)) | |
11373 | / (dSumWLinearTwo6n6n*dSumWLinearThree5n4n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
11374 | - 2.*f3pCorrelations->GetBinContent(8) | |
11375 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
11376 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,86)) | |
11377 | - f2pCorrelations->GetBinContent(6)*f5pCorrelations->GetBinContent(30)) | |
11378 | / (dSumWLinearTwo6n6n*dSumWLinearFive6n5n6n4n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
11379 | - 2.*f2pCorrelations->GetBinContent(6) | |
11380 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
11381 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(13,86)) | |
11382 | - f3pCorrelations->GetBinContent(8)*f5pCorrelations->GetBinContent(30)) | |
11383 | / (dSumWLinearThree5n4n1n*dSumWLinearFive6n5n6n4n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
11384 | if(dError>0.) | |
11385 | { | |
11386 | f5pCumulants->SetBinError(30,pow(dError,0.5)); | |
11387 | } | |
11388 | } // end of if(...) | |
11389 | } // end of { | |
e1d101a6 | 11390 | // d2) "Two distinct harmonics": |
11391 | f5pCumulants->SetBinContent(32,f5pCorrelations->GetBinContent(32)-3.*f3pCorrelations->GetBinContent(1)*f2pCorrelations->GetBinContent(1)); | |
c10259fb | 11392 | { |
11393 | Double_t dSumWLinearTwo1n1n = 0.; // sum of linear event weights for <2> | |
11394 | Double_t dSumWQuadraticTwo1n1n = 0.; // sum of quadratic event weights <2> | |
11395 | Double_t dSpreadTwo1n1n = 0.; // weighted and biased estimator for sigma of <2> | |
11396 | Double_t dSumWLinearThree2n1n1n = 0.; // sum of linear event weights for <2> | |
11397 | Double_t dSumWQuadraticThree2n1n1n = 0.; // sum of quadratic event weights <2> | |
11398 | Double_t dSpreadThree2n1n1n = 0.; // weighted and biased estimator for sigma of <2> | |
11399 | Double_t dSumWLinearFive2n1n1n1n1n = 0.; // sum of linear event weights for <4> | |
11400 | Double_t dSumWQuadraticFive2n1n1n1n1n = 0.; // sum of quadratic event weights <4> | |
11401 | Double_t dSpreadFive2n1n1n1n1n = 0.; // weighted and biased estimator for sigma of <4> | |
11402 | dSumWLinearTwo1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
11403 | dSumWQuadraticTwo1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
11404 | dSpreadTwo1n1n = f2pCorrelations->GetBinError(1); | |
11405 | dSumWLinearThree2n1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
11406 | dSumWQuadraticThree2n1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
11407 | dSpreadThree2n1n1n = f3pCorrelations->GetBinError(1); | |
11408 | dSumWLinearFive2n1n1n1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
11409 | dSumWQuadraticFive2n1n1n1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
11410 | dSpreadFive2n1n1n1n1n = f5pCorrelations->GetBinError(32); | |
11411 | if(pow(dSumWLinearTwo1n1n,2.)>dSumWQuadraticTwo1n1n && | |
11412 | pow(dSumWLinearThree2n1n1n,2.)>dSumWQuadraticThree2n1n1n && | |
11413 | pow(dSumWLinearFive2n1n1n1n1n,2.)>dSumWQuadraticFive2n1n1n1n1n) | |
11414 | { | |
11415 | Double_t dError = 9.*pow(f3pCorrelations->GetBinContent(1),2.) | |
11416 | * pow((pow(dSumWQuadraticTwo1n1n,0.5)/dSumWLinearTwo1n1n) | |
11417 | * dSpreadTwo1n1n*pow(pow(dSumWLinearTwo1n1n,2.)/(pow(dSumWLinearTwo1n1n,2.)-dSumWQuadraticTwo1n1n),0.5),2.) | |
11418 | + 9.*pow(f2pCorrelations->GetBinContent(1),2.) | |
11419 | * pow((pow(dSumWQuadraticThree2n1n1n,0.5)/dSumWLinearThree2n1n1n) | |
11420 | * dSpreadThree2n1n1n*pow(pow(dSumWLinearThree2n1n1n,2.)/(pow(dSumWLinearThree2n1n1n,2.)-dSumWQuadraticThree2n1n1n),0.5),2.) | |
11421 | + pow((pow(dSumWQuadraticFive2n1n1n1n1n,0.5)/dSumWLinearFive2n1n1n1n1n) | |
11422 | * dSpreadFive2n1n1n1n1n*pow(pow(dSumWLinearFive2n1n1n1n1n,2.)/(pow(dSumWLinearFive2n1n1n1n1n,2.)-dSumWQuadraticFive2n1n1n1n1n),0.5),2.) | |
11423 | + 9.*2.*f3pCorrelations->GetBinContent(1)*f2pCorrelations->GetBinContent(1) | |
11424 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
11425 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,7)) | |
11426 | - f2pCorrelations->GetBinContent(1)*f3pCorrelations->GetBinContent(1)) | |
11427 | / (dSumWLinearTwo1n1n*dSumWLinearThree2n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
11428 | - 3.*2.*f3pCorrelations->GetBinContent(1) | |
11429 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
11430 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,87)) | |
11431 | - f2pCorrelations->GetBinContent(1)*f5pCorrelations->GetBinContent(32)) | |
11432 | / (dSumWLinearTwo1n1n*dSumWLinearFive2n1n1n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
11433 | - 3.*2.*f2pCorrelations->GetBinContent(1) | |
11434 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
11435 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(7,87)) | |
11436 | - f3pCorrelations->GetBinContent(1)*f5pCorrelations->GetBinContent(32)) | |
11437 | / (dSumWLinearThree2n1n1n*dSumWLinearFive2n1n1n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
11438 | if(dError>0.) | |
11439 | { | |
11440 | f5pCumulants->SetBinError(32,pow(dError,0.5)); | |
11441 | } | |
11442 | } // end of if(...) | |
11443 | } // end of { | |
e1d101a6 | 11444 | f5pCumulants->SetBinContent(33,f5pCorrelations->GetBinContent(33)-2.*f3pCorrelations->GetBinContent(1)*f2pCorrelations->GetBinContent(2)); |
c10259fb | 11445 | { |
11446 | Double_t dSumWLinearTwo2n2n = 0.; // sum of linear event weights for <2> | |
11447 | Double_t dSumWQuadraticTwo2n2n = 0.; // sum of quadratic event weights <2> | |
11448 | Double_t dSpreadTwo2n2n = 0.; // weighted and biased estimator for sigma of <2> | |
11449 | Double_t dSumWLinearThree2n1n1n = 0.; // sum of linear event weights for <2> | |
11450 | Double_t dSumWQuadraticThree2n1n1n = 0.; // sum of quadratic event weights <2> | |
11451 | Double_t dSpreadThree2n1n1n = 0.; // weighted and biased estimator for sigma of <2> | |
11452 | Double_t dSumWLinearFive2n2n2n1n1n = 0.; // sum of linear event weights for <4> | |
11453 | Double_t dSumWQuadraticFive2n2n2n1n1n = 0.; // sum of quadratic event weights <4> | |
11454 | Double_t dSpreadFive2n2n2n1n1n = 0.; // weighted and biased estimator for sigma of <4> | |
11455 | dSumWLinearTwo2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
11456 | dSumWQuadraticTwo2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
11457 | dSpreadTwo2n2n = f2pCorrelations->GetBinError(2); | |
11458 | dSumWLinearThree2n1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
11459 | dSumWQuadraticThree2n1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
11460 | dSpreadThree2n1n1n = f3pCorrelations->GetBinError(1); | |
11461 | dSumWLinearFive2n2n2n1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
11462 | dSumWQuadraticFive2n2n2n1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
11463 | dSpreadFive2n2n2n1n1n = f5pCorrelations->GetBinError(33); | |
11464 | if(pow(dSumWLinearTwo2n2n,2.)>dSumWQuadraticTwo2n2n && | |
11465 | pow(dSumWLinearThree2n1n1n,2.)>dSumWQuadraticThree2n1n1n && | |
11466 | pow(dSumWLinearFive2n2n2n1n1n,2.)>dSumWQuadraticFive2n2n2n1n1n) | |
11467 | { | |
11468 | Double_t dError = 4.*pow(f3pCorrelations->GetBinContent(1),2.) | |
11469 | * pow((pow(dSumWQuadraticTwo2n2n,0.5)/dSumWLinearTwo2n2n) | |
11470 | * dSpreadTwo2n2n*pow(pow(dSumWLinearTwo2n2n,2.)/(pow(dSumWLinearTwo2n2n,2.)-dSumWQuadraticTwo2n2n),0.5),2.) | |
11471 | + 4.*pow(f2pCorrelations->GetBinContent(2),2.) | |
11472 | * pow((pow(dSumWQuadraticThree2n1n1n,0.5)/dSumWLinearThree2n1n1n) | |
11473 | * dSpreadThree2n1n1n*pow(pow(dSumWLinearThree2n1n1n,2.)/(pow(dSumWLinearThree2n1n1n,2.)-dSumWQuadraticThree2n1n1n),0.5),2.) | |
11474 | + pow((pow(dSumWQuadraticFive2n2n2n1n1n,0.5)/dSumWLinearFive2n2n2n1n1n) | |
11475 | * dSpreadFive2n2n2n1n1n*pow(pow(dSumWLinearFive2n2n2n1n1n,2.)/(pow(dSumWLinearFive2n2n2n1n1n,2.)-dSumWQuadraticFive2n2n2n1n1n),0.5),2.) | |
11476 | + 4.*2.*f3pCorrelations->GetBinContent(1)*f2pCorrelations->GetBinContent(2) | |
11477 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
11478 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,7)) | |
11479 | - f2pCorrelations->GetBinContent(2)*f3pCorrelations->GetBinContent(1)) | |
11480 | / (dSumWLinearTwo2n2n*dSumWLinearThree2n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
11481 | - 2.*2.*f3pCorrelations->GetBinContent(1) | |
11482 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
11483 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,88)) | |
11484 | - f2pCorrelations->GetBinContent(2)*f5pCorrelations->GetBinContent(33)) | |
11485 | / (dSumWLinearTwo2n2n*dSumWLinearFive2n2n2n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
11486 | - 2.*2.*f2pCorrelations->GetBinContent(2) | |
11487 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
11488 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(7,88)) | |
11489 | - f3pCorrelations->GetBinContent(1)*f5pCorrelations->GetBinContent(33)) | |
11490 | / (dSumWLinearThree2n1n1n*dSumWLinearFive2n2n2n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
11491 | if(dError>0.) | |
11492 | { | |
11493 | f5pCumulants->SetBinError(33,pow(dError,0.5)); | |
11494 | } | |
11495 | } // end of if(...) | |
11496 | } // end of { | |
11497 | f5pCumulants->SetBinContent(34,f5pCorrelations->GetBinContent(34)); | |
11498 | { | |
11499 | Double_t dSumWLinear = 0.; // sum of linear event weights | |
11500 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
11501 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
11502 | Double_t dError = 0.; // weighted and unbiased estimator for sigma | |
11503 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
11504 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
11505 | dSpread = f5pCorrelations->GetBinError(34); | |
11506 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
11507 | { | |
11508 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
11509 | f5pCumulants->SetBinError(34,dError); | |
11510 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
11511 | } | |
11512 | f5pCumulants->SetBinContent(35,f5pCorrelations->GetBinContent(35)); | |
11513 | { | |
11514 | Double_t dSumWLinear = 0.; // sum of linear event weights | |
11515 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
11516 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
11517 | Double_t dError = 0.; // weighted and unbiased estimator for sigma | |
11518 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
11519 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
11520 | dSpread = f5pCorrelations->GetBinError(35); | |
11521 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
11522 | { | |
11523 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
11524 | f5pCumulants->SetBinError(35,dError); | |
11525 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
11526 | } | |
e1d101a6 | 11527 | f5pCumulants->SetBinContent(36,f5pCorrelations->GetBinContent(36)-3.*f3pCorrelations->GetBinContent(2)*f2pCorrelations->GetBinContent(2)); |
c10259fb | 11528 | { |
11529 | Double_t dSumWLinearTwo2n2n = 0.; // sum of linear event weights for <2> | |
11530 | Double_t dSumWQuadraticTwo2n2n = 0.; // sum of quadratic event weights <2> | |
11531 | Double_t dSpreadTwo2n2n = 0.; // weighted and biased estimator for sigma of <2> | |
11532 | Double_t dSumWLinearThree4n2n2n = 0.; // sum of linear event weights for <2> | |
11533 | Double_t dSumWQuadraticThree4n2n2n = 0.; // sum of quadratic event weights <2> | |
11534 | Double_t dSpreadThree4n2n2n = 0.; // weighted and biased estimator for sigma of <2> | |
11535 | Double_t dSumWLinearFive4n2n2n2n2n = 0.; // sum of linear event weights for <4> | |
11536 | Double_t dSumWQuadraticFive4n2n2n2n2n = 0.; // sum of quadratic event weights <4> | |
11537 | Double_t dSpreadFive4n2n2n2n2n = 0.; // weighted and biased estimator for sigma of <4> | |
11538 | dSumWLinearTwo2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
11539 | dSumWQuadraticTwo2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
11540 | dSpreadTwo2n2n = f2pCorrelations->GetBinError(2); | |
11541 | dSumWLinearThree4n2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
11542 | dSumWQuadraticThree4n2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
11543 | dSpreadThree4n2n2n = f3pCorrelations->GetBinError(2); | |
11544 | dSumWLinearFive4n2n2n2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
11545 | dSumWQuadraticFive4n2n2n2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
11546 | dSpreadFive4n2n2n2n2n = f5pCorrelations->GetBinError(36); | |
11547 | if(pow(dSumWLinearTwo2n2n,2.)>dSumWQuadraticTwo2n2n && | |
11548 | pow(dSumWLinearThree4n2n2n,2.)>dSumWQuadraticThree4n2n2n && | |
11549 | pow(dSumWLinearFive4n2n2n2n2n,2.)>dSumWQuadraticFive4n2n2n2n2n) | |
11550 | { | |
11551 | Double_t dError = 9.*pow(f3pCorrelations->GetBinContent(2),2.) | |
11552 | * pow((pow(dSumWQuadraticTwo2n2n,0.5)/dSumWLinearTwo2n2n) | |
11553 | * dSpreadTwo2n2n*pow(pow(dSumWLinearTwo2n2n,2.)/(pow(dSumWLinearTwo2n2n,2.)-dSumWQuadraticTwo2n2n),0.5),2.) | |
11554 | + 9.*pow(f2pCorrelations->GetBinContent(2),2.) | |
11555 | * pow((pow(dSumWQuadraticThree4n2n2n,0.5)/dSumWLinearThree4n2n2n) | |
11556 | * dSpreadThree4n2n2n*pow(pow(dSumWLinearThree4n2n2n,2.)/(pow(dSumWLinearThree4n2n2n,2.)-dSumWQuadraticThree4n2n2n),0.5),2.) | |
11557 | + pow((pow(dSumWQuadraticFive4n2n2n2n2n,0.5)/dSumWLinearFive4n2n2n2n2n) | |
11558 | * dSpreadFive4n2n2n2n2n*pow(pow(dSumWLinearFive4n2n2n2n2n,2.)/(pow(dSumWLinearFive4n2n2n2n2n,2.)-dSumWQuadraticFive4n2n2n2n2n),0.5),2.) | |
11559 | + 9.*2.*f3pCorrelations->GetBinContent(2)*f2pCorrelations->GetBinContent(2) | |
11560 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
11561 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,8)) | |
11562 | - f2pCorrelations->GetBinContent(2)*f3pCorrelations->GetBinContent(2)) | |
11563 | / (dSumWLinearTwo2n2n*dSumWLinearThree4n2n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
11564 | - 3.*2.*f3pCorrelations->GetBinContent(2) | |
11565 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
11566 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,91)) | |
11567 | - f2pCorrelations->GetBinContent(2)*f5pCorrelations->GetBinContent(36)) | |
11568 | / (dSumWLinearTwo2n2n*dSumWLinearFive4n2n2n2n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
11569 | - 3.*2.*f2pCorrelations->GetBinContent(2) | |
11570 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
11571 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(8,91)) | |
11572 | - f3pCorrelations->GetBinContent(2)*f5pCorrelations->GetBinContent(36)) | |
11573 | / (dSumWLinearThree4n2n2n*dSumWLinearFive4n2n2n2n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
11574 | if(dError>0.) | |
11575 | { | |
11576 | f5pCumulants->SetBinError(36,pow(dError,0.5)); | |
11577 | } | |
11578 | } // end of if(...) | |
11579 | } // end of { | |
e1d101a6 | 11580 | f5pCumulants->SetBinContent(37,f5pCorrelations->GetBinContent(37)-2.*f3pCorrelations->GetBinContent(2)*f2pCorrelations->GetBinContent(4)); |
c10259fb | 11581 | { |
11582 | Double_t dSumWLinearTwo4n4n = 0.; // sum of linear event weights for <2> | |
11583 | Double_t dSumWQuadraticTwo4n4n = 0.; // sum of quadratic event weights <2> | |
11584 | Double_t dSpreadTwo4n4n = 0.; // weighted and biased estimator for sigma of <2> | |
11585 | Double_t dSumWLinearThree4n2n2n = 0.; // sum of linear event weights for <2> | |
11586 | Double_t dSumWQuadraticThree4n2n2n = 0.; // sum of quadratic event weights <2> | |
11587 | Double_t dSpreadThree4n2n2n = 0.; // weighted and biased estimator for sigma of <2> | |
11588 | Double_t dSumWLinearFive4n4n4n2n2n = 0.; // sum of linear event weights for <4> | |
11589 | Double_t dSumWQuadraticFive4n4n4n2n2n = 0.; // sum of quadratic event weights <4> | |
11590 | Double_t dSpreadFive4n4n4n2n2n = 0.; // weighted and biased estimator for sigma of <4> | |
11591 | dSumWLinearTwo4n4n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
11592 | dSumWQuadraticTwo4n4n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
11593 | dSpreadTwo4n4n = f2pCorrelations->GetBinError(4); | |
11594 | dSumWLinearThree4n2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
11595 | dSumWQuadraticThree4n2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
11596 | dSpreadThree4n2n2n = f3pCorrelations->GetBinError(2); | |
11597 | dSumWLinearFive4n4n4n2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
11598 | dSumWQuadraticFive4n4n4n2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
11599 | dSpreadFive4n4n4n2n2n = f5pCorrelations->GetBinError(37); | |
11600 | if(pow(dSumWLinearTwo4n4n,2.)>dSumWQuadraticTwo4n4n && | |
11601 | pow(dSumWLinearThree4n2n2n,2.)>dSumWQuadraticThree4n2n2n && | |
11602 | pow(dSumWLinearFive4n4n4n2n2n,2.)>dSumWQuadraticFive4n4n4n2n2n) | |
11603 | { | |
11604 | Double_t dError = 4.*pow(f3pCorrelations->GetBinContent(2),2.) | |
11605 | * pow((pow(dSumWQuadraticTwo4n4n,0.5)/dSumWLinearTwo4n4n) | |
11606 | * dSpreadTwo4n4n*pow(pow(dSumWLinearTwo4n4n,2.)/(pow(dSumWLinearTwo4n4n,2.)-dSumWQuadraticTwo4n4n),0.5),2.) | |
11607 | + 4.*pow(f2pCorrelations->GetBinContent(4),2.) | |
11608 | * pow((pow(dSumWQuadraticThree4n2n2n,0.5)/dSumWLinearThree4n2n2n) | |
11609 | * dSpreadThree4n2n2n*pow(pow(dSumWLinearThree4n2n2n,2.)/(pow(dSumWLinearThree4n2n2n,2.)-dSumWQuadraticThree4n2n2n),0.5),2.) | |
11610 | + pow((pow(dSumWQuadraticFive4n4n4n2n2n,0.5)/dSumWLinearFive4n4n4n2n2n) | |
11611 | * dSpreadFive4n4n4n2n2n*pow(pow(dSumWLinearFive4n4n4n2n2n,2.)/(pow(dSumWLinearFive4n4n4n2n2n,2.)-dSumWQuadraticFive4n4n4n2n2n),0.5),2.) | |
11612 | + 4.*2.*f3pCorrelations->GetBinContent(2)*f2pCorrelations->GetBinContent(4) | |
11613 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
11614 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,8)) | |
11615 | - f2pCorrelations->GetBinContent(4)*f3pCorrelations->GetBinContent(2)) | |
11616 | / (dSumWLinearTwo4n4n*dSumWLinearThree4n2n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
11617 | - 2.*2.*f3pCorrelations->GetBinContent(2) | |
11618 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
11619 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,92)) | |
11620 | - f2pCorrelations->GetBinContent(4)*f5pCorrelations->GetBinContent(37)) | |
11621 | / (dSumWLinearTwo4n4n*dSumWLinearFive4n4n4n2n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
11622 | - 2.*2.*f2pCorrelations->GetBinContent(4) | |
11623 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
11624 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(8,92)) | |
11625 | - f3pCorrelations->GetBinContent(2)*f5pCorrelations->GetBinContent(37)) | |
11626 | / (dSumWLinearThree4n2n2n*dSumWLinearFive4n4n4n2n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
11627 | if(dError>0.) | |
11628 | { | |
11629 | f5pCumulants->SetBinError(37,pow(dError,0.5)); | |
11630 | } | |
11631 | } // end of if(...) | |
11632 | } // end of { | |
e1d101a6 | 11633 | f5pCumulants->SetBinContent(38,f5pCorrelations->GetBinContent(38)-3.*f3pCorrelations->GetBinContent(3)*f2pCorrelations->GetBinContent(3)); |
c10259fb | 11634 | { |
11635 | Double_t dSumWLinearTwo3n3n = 0.; // sum of linear event weights for <2> | |
11636 | Double_t dSumWQuadraticTwo3n3n = 0.; // sum of quadratic event weights <2> | |
11637 | Double_t dSpreadTwo3n3n = 0.; // weighted and biased estimator for sigma of <2> | |
11638 | Double_t dSumWLinearThree6n3n3n = 0.; // sum of linear event weights for <2> | |
11639 | Double_t dSumWQuadraticThree6n3n3n = 0.; // sum of quadratic event weights <2> | |
11640 | Double_t dSpreadThree6n3n3n = 0.; // weighted and biased estimator for sigma of <2> | |
11641 | Double_t dSumWLinearFive6n3n3n3n3n = 0.; // sum of linear event weights for <4> | |
11642 | Double_t dSumWQuadraticFive6n3n3n3n3n = 0.; // sum of quadratic event weights <4> | |
11643 | Double_t dSpreadFive6n3n3n3n3n = 0.; // weighted and biased estimator for sigma of <4> | |
11644 | dSumWLinearTwo3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
11645 | dSumWQuadraticTwo3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
11646 | dSpreadTwo3n3n = f2pCorrelations->GetBinError(3); | |
11647 | dSumWLinearThree6n3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
11648 | dSumWQuadraticThree6n3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
11649 | dSpreadThree6n3n3n = f3pCorrelations->GetBinError(3); | |
11650 | dSumWLinearFive6n3n3n3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
11651 | dSumWQuadraticFive6n3n3n3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
11652 | dSpreadFive6n3n3n3n3n = f5pCorrelations->GetBinError(38); | |
11653 | if(pow(dSumWLinearTwo3n3n,2.)>dSumWQuadraticTwo3n3n && | |
11654 | pow(dSumWLinearThree6n3n3n,2.)>dSumWQuadraticThree6n3n3n && | |
11655 | pow(dSumWLinearFive6n3n3n3n3n,2.)>dSumWQuadraticFive6n3n3n3n3n) | |
11656 | { | |
11657 | Double_t dError = 9.*pow(f3pCorrelations->GetBinContent(3),2.) | |
11658 | * pow((pow(dSumWQuadraticTwo3n3n,0.5)/dSumWLinearTwo3n3n) | |
11659 | * dSpreadTwo3n3n*pow(pow(dSumWLinearTwo3n3n,2.)/(pow(dSumWLinearTwo3n3n,2.)-dSumWQuadraticTwo3n3n),0.5),2.) | |
11660 | + 9.*pow(f2pCorrelations->GetBinContent(3),2.) | |
11661 | * pow((pow(dSumWQuadraticThree6n3n3n,0.5)/dSumWLinearThree6n3n3n) | |
11662 | * dSpreadThree6n3n3n*pow(pow(dSumWLinearThree6n3n3n,2.)/(pow(dSumWLinearThree6n3n3n,2.)-dSumWQuadraticThree6n3n3n),0.5),2.) | |
11663 | + pow((pow(dSumWQuadraticFive6n3n3n3n3n,0.5)/dSumWLinearFive6n3n3n3n3n) | |
11664 | * dSpreadFive6n3n3n3n3n*pow(pow(dSumWLinearFive6n3n3n3n3n,2.)/(pow(dSumWLinearFive6n3n3n3n3n,2.)-dSumWQuadraticFive6n3n3n3n3n),0.5),2.) | |
11665 | + 9.*2.*f3pCorrelations->GetBinContent(3)*f2pCorrelations->GetBinContent(3) | |
11666 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
11667 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,9)) | |
11668 | - f2pCorrelations->GetBinContent(3)*f3pCorrelations->GetBinContent(3)) | |
11669 | / (dSumWLinearTwo3n3n*dSumWLinearThree6n3n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
11670 | - 3.*2.*f3pCorrelations->GetBinContent(3) | |
11671 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
11672 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,93)) | |
11673 | - f2pCorrelations->GetBinContent(3)*f5pCorrelations->GetBinContent(38)) | |
11674 | / (dSumWLinearTwo3n3n*dSumWLinearFive6n3n3n3n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
11675 | - 3.*2.*f2pCorrelations->GetBinContent(3) | |
11676 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
11677 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(9,93)) | |
11678 | - f3pCorrelations->GetBinContent(3)*f5pCorrelations->GetBinContent(38)) | |
11679 | / (dSumWLinearThree6n3n3n*dSumWLinearFive6n3n3n3n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
11680 | if(dError>0.) | |
11681 | { | |
11682 | f5pCumulants->SetBinError(38,pow(dError,0.5)); | |
11683 | } | |
11684 | } // end of if(...) | |
11685 | } // end of { | |
11686 | f5pCumulants->SetBinContent(39,f5pCorrelations->GetBinContent(39)); | |
11687 | { | |
11688 | Double_t dSumWLinear = 0.; // sum of linear event weights | |
11689 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
11690 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
11691 | Double_t dError = 0.; // weighted and unbiased estimator for sigma | |
11692 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
11693 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
11694 | dSpread = f5pCorrelations->GetBinError(39); | |
11695 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
11696 | { | |
11697 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
11698 | f5pCumulants->SetBinError(39,dError); | |
11699 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
11700 | } | |
e1d101a6 | 11701 | f5pCumulants->SetBinContent(40,f5pCorrelations->GetBinContent(40)-2.*f3pCorrelations->GetBinContent(3)*f2pCorrelations->GetBinContent(6)); |
c10259fb | 11702 | { |
11703 | Double_t dSumWLinearTwo6n6n = 0.; // sum of linear event weights for <2> | |
11704 | Double_t dSumWQuadraticTwo6n6n = 0.; // sum of quadratic event weights <2> | |
11705 | Double_t dSpreadTwo6n6n = 0.; // weighted and biased estimator for sigma of <2> | |
11706 | Double_t dSumWLinearThree6n3n3n = 0.; // sum of linear event weights for <2> | |
11707 | Double_t dSumWQuadraticThree6n3n3n = 0.; // sum of quadratic event weights <2> | |
11708 | Double_t dSpreadThree6n3n3n = 0.; // weighted and biased estimator for sigma of <2> | |
11709 | Double_t dSumWLinearFive6n6n6n3n3n = 0.; // sum of linear event weights for <4> | |
11710 | Double_t dSumWQuadraticFive6n6n6n3n3n = 0.; // sum of quadratic event weights <4> | |
11711 | Double_t dSpreadFive6n6n6n3n3n = 0.; // weighted and biased estimator for sigma of <4> | |
11712 | dSumWLinearTwo6n6n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
11713 | dSumWQuadraticTwo6n6n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
11714 | dSpreadTwo6n6n = f2pCorrelations->GetBinError(6); | |
11715 | dSumWLinearThree6n3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
11716 | dSumWQuadraticThree6n3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
11717 | dSpreadThree6n3n3n = f3pCorrelations->GetBinError(3); | |
11718 | dSumWLinearFive6n6n6n3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
11719 | dSumWQuadraticFive6n6n6n3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
11720 | dSpreadFive6n6n6n3n3n = f5pCorrelations->GetBinError(40); | |
11721 | if(pow(dSumWLinearTwo6n6n,2.)>dSumWQuadraticTwo6n6n && | |
11722 | pow(dSumWLinearThree6n3n3n,2.)>dSumWQuadraticThree6n3n3n && | |
11723 | pow(dSumWLinearFive6n6n6n3n3n,2.)>dSumWQuadraticFive6n6n6n3n3n) | |
11724 | { | |
11725 | Double_t dError = 4.*pow(f3pCorrelations->GetBinContent(3),2.) | |
11726 | * pow((pow(dSumWQuadraticTwo6n6n,0.5)/dSumWLinearTwo6n6n) | |
11727 | * dSpreadTwo6n6n*pow(pow(dSumWLinearTwo6n6n,2.)/(pow(dSumWLinearTwo6n6n,2.)-dSumWQuadraticTwo6n6n),0.5),2.) | |
11728 | + 4.*pow(f2pCorrelations->GetBinContent(6),2.) | |
11729 | * pow((pow(dSumWQuadraticThree6n3n3n,0.5)/dSumWLinearThree6n3n3n) | |
11730 | * dSpreadThree6n3n3n*pow(pow(dSumWLinearThree6n3n3n,2.)/(pow(dSumWLinearThree6n3n3n,2.)-dSumWQuadraticThree6n3n3n),0.5),2.) | |
11731 | + pow((pow(dSumWQuadraticFive6n6n6n3n3n,0.5)/dSumWLinearFive6n6n6n3n3n) | |
11732 | * dSpreadFive6n6n6n3n3n*pow(pow(dSumWLinearFive6n6n6n3n3n,2.)/(pow(dSumWLinearFive6n6n6n3n3n,2.)-dSumWQuadraticFive6n6n6n3n3n),0.5),2.) | |
11733 | + 4.*2.*f3pCorrelations->GetBinContent(3)*f2pCorrelations->GetBinContent(6) | |
11734 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
11735 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,9)) | |
11736 | - f2pCorrelations->GetBinContent(6)*f3pCorrelations->GetBinContent(3)) | |
11737 | / (dSumWLinearTwo6n6n*dSumWLinearThree6n3n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
11738 | - 2.*2.*f3pCorrelations->GetBinContent(3) | |
11739 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
11740 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,95)) | |
11741 | - f2pCorrelations->GetBinContent(6)*f5pCorrelations->GetBinContent(40)) | |
11742 | / (dSumWLinearTwo6n6n*dSumWLinearFive6n6n6n3n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
11743 | - 2.*2.*f2pCorrelations->GetBinContent(6) | |
11744 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
11745 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(9,95)) | |
11746 | - f3pCorrelations->GetBinContent(3)*f5pCorrelations->GetBinContent(40)) | |
11747 | / (dSumWLinearThree6n3n3n*dSumWLinearFive6n6n6n3n3n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
11748 | if(dError>0.) | |
11749 | { | |
11750 | f5pCumulants->SetBinError(40,pow(dError,0.5)); | |
11751 | } | |
11752 | } // end of if(...) | |
11753 | } // end of { | |
11754 | ||
e1d101a6 | 11755 | // d2) "Three distinct harmonics": |
11756 | f5pCumulants->SetBinContent(42,f5pCorrelations->GetBinContent(42)-2.*f3pCorrelations->GetBinContent(5)*f2pCorrelations->GetBinContent(1)); | |
c10259fb | 11757 | { |
11758 | Double_t dSumWLinearTwo1n1n = 0.; // sum of linear event weights for <2> | |
11759 | Double_t dSumWQuadraticTwo1n1n = 0.; // sum of quadratic event weights <2> | |
11760 | Double_t dSpreadTwo1n1n = 0.; // weighted and biased estimator for sigma of <2> | |
11761 | Double_t dSumWLinearThree3n2n1n = 0.; // sum of linear event weights for <2> | |
11762 | Double_t dSumWQuadraticThree3n2n1n = 0.; // sum of quadratic event weights <2> | |
11763 | Double_t dSpreadThree3n2n1n = 0.; // weighted and biased estimator for sigma of <2> | |
11764 | Double_t dSumWLinearFive3n1n2n1n1n = 0.; // sum of linear event weights for <4> | |
11765 | Double_t dSumWQuadraticFive3n1n2n1n1n = 0.; // sum of quadratic event weights <4> | |
11766 | Double_t dSpreadFive3n1n2n1n1n = 0.; // weighted and biased estimator for sigma of <4> | |
11767 | dSumWLinearTwo1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
11768 | dSumWQuadraticTwo1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
11769 | dSpreadTwo1n1n = f2pCorrelations->GetBinError(1); | |
11770 | dSumWLinearThree3n2n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
11771 | dSumWQuadraticThree3n2n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
11772 | dSpreadThree3n2n1n = f3pCorrelations->GetBinError(5); | |
11773 | dSumWLinearFive3n1n2n1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
11774 | dSumWQuadraticFive3n1n2n1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
11775 | dSpreadFive3n1n2n1n1n = f5pCorrelations->GetBinError(42); | |
11776 | if(pow(dSumWLinearTwo1n1n,2.)>dSumWQuadraticTwo1n1n && | |
11777 | pow(dSumWLinearThree3n2n1n,2.)>dSumWQuadraticThree3n2n1n && | |
11778 | pow(dSumWLinearFive3n1n2n1n1n,2.)>dSumWQuadraticFive3n1n2n1n1n) | |
11779 | { | |
11780 | Double_t dError = 4.*pow(f3pCorrelations->GetBinContent(5),2.) | |
11781 | * pow((pow(dSumWQuadraticTwo1n1n,0.5)/dSumWLinearTwo1n1n) | |
11782 | * dSpreadTwo1n1n*pow(pow(dSumWLinearTwo1n1n,2.)/(pow(dSumWLinearTwo1n1n,2.)-dSumWQuadraticTwo1n1n),0.5),2.) | |
11783 | + 4.*pow(f2pCorrelations->GetBinContent(1),2.) | |
11784 | * pow((pow(dSumWQuadraticThree3n2n1n,0.5)/dSumWLinearThree3n2n1n) | |
11785 | * dSpreadThree3n2n1n*pow(pow(dSumWLinearThree3n2n1n,2.)/(pow(dSumWLinearThree3n2n1n,2.)-dSumWQuadraticThree3n2n1n),0.5),2.) | |
11786 | + pow((pow(dSumWQuadraticFive3n1n2n1n1n,0.5)/dSumWLinearFive3n1n2n1n1n) | |
11787 | * dSpreadFive3n1n2n1n1n*pow(pow(dSumWLinearFive3n1n2n1n1n,2.)/(pow(dSumWLinearFive3n1n2n1n1n,2.)-dSumWQuadraticFive3n1n2n1n1n),0.5),2.) | |
11788 | + 4.*2.*f3pCorrelations->GetBinContent(5)*f2pCorrelations->GetBinContent(1) | |
11789 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
11790 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,10)) | |
11791 | - f2pCorrelations->GetBinContent(1)*f3pCorrelations->GetBinContent(5)) | |
11792 | / (dSumWLinearTwo1n1n*dSumWLinearThree3n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
11793 | - 2.*2.*f3pCorrelations->GetBinContent(5) | |
11794 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
11795 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,96)) | |
11796 | - f2pCorrelations->GetBinContent(1)*f5pCorrelations->GetBinContent(42)) | |
11797 | / (dSumWLinearTwo1n1n*dSumWLinearFive3n1n2n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
11798 | - 2.*2.*f2pCorrelations->GetBinContent(1) | |
11799 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
11800 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(10,96)) | |
11801 | - f3pCorrelations->GetBinContent(5)*f5pCorrelations->GetBinContent(42)) | |
11802 | / (dSumWLinearThree3n2n1n*dSumWLinearFive3n1n2n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
11803 | if(dError>0.) | |
11804 | { | |
11805 | f5pCumulants->SetBinError(42,pow(dError,0.5)); | |
11806 | } | |
11807 | } // end of if(...) | |
11808 | } // end of { | |
e1d101a6 | 11809 | f5pCumulants->SetBinContent(43,f5pCorrelations->GetBinContent(43)-2.*f3pCorrelations->GetBinContent(5)*f2pCorrelations->GetBinContent(2)); |
c10259fb | 11810 | { |
11811 | Double_t dSumWLinearTwo2n2n = 0.; // sum of linear event weights for <2> | |
11812 | Double_t dSumWQuadraticTwo2n2n = 0.; // sum of quadratic event weights <2> | |
11813 | Double_t dSpreadTwo2n2n = 0.; // weighted and biased estimator for sigma of <2> | |
11814 | Double_t dSumWLinearThree3n2n1n = 0.; // sum of linear event weights for <2> | |
11815 | Double_t dSumWQuadraticThree3n2n1n = 0.; // sum of quadratic event weights <2> | |
11816 | Double_t dSpreadThree3n2n1n = 0.; // weighted and biased estimator for sigma of <2> | |
11817 | Double_t dSumWLinearFive3n2n2n2n1n = 0.; // sum of linear event weights for <4> | |
11818 | Double_t dSumWQuadraticFive3n2n2n2n1n = 0.; // sum of quadratic event weights <4> | |
11819 | Double_t dSpreadFive3n2n2n2n1n = 0.; // weighted and biased estimator for sigma of <4> | |
11820 | dSumWLinearTwo2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
11821 | dSumWQuadraticTwo2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
11822 | dSpreadTwo2n2n = f2pCorrelations->GetBinError(2); | |
11823 | dSumWLinearThree3n2n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
11824 | dSumWQuadraticThree3n2n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
11825 | dSpreadThree3n2n1n = f3pCorrelations->GetBinError(5); | |
11826 | dSumWLinearFive3n2n2n2n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
11827 | dSumWQuadraticFive3n2n2n2n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
11828 | dSpreadFive3n2n2n2n1n = f5pCorrelations->GetBinError(43); | |
11829 | if(pow(dSumWLinearTwo2n2n,2.)>dSumWQuadraticTwo2n2n && | |
11830 | pow(dSumWLinearThree3n2n1n,2.)>dSumWQuadraticThree3n2n1n && | |
11831 | pow(dSumWLinearFive3n2n2n2n1n,2.)>dSumWQuadraticFive3n2n2n2n1n) | |
11832 | { | |
11833 | Double_t dError = 4.*pow(f3pCorrelations->GetBinContent(5),2.) | |
11834 | * pow((pow(dSumWQuadraticTwo2n2n,0.5)/dSumWLinearTwo2n2n) | |
11835 | * dSpreadTwo2n2n*pow(pow(dSumWLinearTwo2n2n,2.)/(pow(dSumWLinearTwo2n2n,2.)-dSumWQuadraticTwo2n2n),0.5),2.) | |
11836 | + 4.*pow(f2pCorrelations->GetBinContent(2),2.) | |
11837 | * pow((pow(dSumWQuadraticThree3n2n1n,0.5)/dSumWLinearThree3n2n1n) | |
11838 | * dSpreadThree3n2n1n*pow(pow(dSumWLinearThree3n2n1n,2.)/(pow(dSumWLinearThree3n2n1n,2.)-dSumWQuadraticThree3n2n1n),0.5),2.) | |
11839 | + pow((pow(dSumWQuadraticFive3n2n2n2n1n,0.5)/dSumWLinearFive3n2n2n2n1n) | |
11840 | * dSpreadFive3n2n2n2n1n*pow(pow(dSumWLinearFive3n2n2n2n1n,2.)/(pow(dSumWLinearFive3n2n2n2n1n,2.)-dSumWQuadraticFive3n2n2n2n1n),0.5),2.) | |
11841 | + 4.*2.*f3pCorrelations->GetBinContent(5)*f2pCorrelations->GetBinContent(2) | |
11842 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
11843 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,10)) | |
11844 | - f2pCorrelations->GetBinContent(2)*f3pCorrelations->GetBinContent(5)) | |
11845 | / (dSumWLinearTwo2n2n*dSumWLinearThree3n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
11846 | - 2.*2.*f3pCorrelations->GetBinContent(5) | |
11847 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
11848 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,97)) | |
11849 | - f2pCorrelations->GetBinContent(2)*f5pCorrelations->GetBinContent(43)) | |
11850 | / (dSumWLinearTwo2n2n*dSumWLinearFive3n2n2n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
11851 | - 2.*2.*f2pCorrelations->GetBinContent(2) | |
11852 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
11853 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(10,97)) | |
11854 | - f3pCorrelations->GetBinContent(5)*f5pCorrelations->GetBinContent(43)) | |
11855 | / (dSumWLinearThree3n2n1n*dSumWLinearFive3n2n2n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
11856 | if(dError>0.) | |
11857 | { | |
11858 | f5pCumulants->SetBinError(43,pow(dError,0.5)); | |
11859 | } | |
11860 | } // end of if(...) | |
11861 | } // end of { | |
e1d101a6 | 11862 | f5pCumulants->SetBinContent(44,f5pCorrelations->GetBinContent(44)-2.*f3pCorrelations->GetBinContent(5)*f2pCorrelations->GetBinContent(3)); |
c10259fb | 11863 | { |
11864 | Double_t dSumWLinearTwo3n3n = 0.; // sum of linear event weights for <2> | |
11865 | Double_t dSumWQuadraticTwo3n3n = 0.; // sum of quadratic event weights <2> | |
11866 | Double_t dSpreadTwo3n3n = 0.; // weighted and biased estimator for sigma of <2> | |
11867 | Double_t dSumWLinearThree3n2n1n = 0.; // sum of linear event weights for <2> | |
11868 | Double_t dSumWQuadraticThree3n2n1n = 0.; // sum of quadratic event weights <2> | |
11869 | Double_t dSpreadThree3n2n1n = 0.; // weighted and biased estimator for sigma of <2> | |
11870 | Double_t dSumWLinearFive3n3n3n2n1n = 0.; // sum of linear event weights for <4> | |
11871 | Double_t dSumWQuadraticFive3n3n3n2n1n = 0.; // sum of quadratic event weights <4> | |
11872 | Double_t dSpreadFive3n3n3n2n1n = 0.; // weighted and biased estimator for sigma of <4> | |
11873 | dSumWLinearTwo3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
11874 | dSumWQuadraticTwo3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
11875 | dSpreadTwo3n3n = f2pCorrelations->GetBinError(3); | |
11876 | dSumWLinearThree3n2n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
11877 | dSumWQuadraticThree3n2n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
11878 | dSpreadThree3n2n1n = f3pCorrelations->GetBinError(5); | |
11879 | dSumWLinearFive3n3n3n2n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
11880 | dSumWQuadraticFive3n3n3n2n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
11881 | dSpreadFive3n3n3n2n1n = f5pCorrelations->GetBinError(44); | |
11882 | if(pow(dSumWLinearTwo3n3n,2.)>dSumWQuadraticTwo3n3n && | |
11883 | pow(dSumWLinearThree3n2n1n,2.)>dSumWQuadraticThree3n2n1n && | |
11884 | pow(dSumWLinearFive3n3n3n2n1n,2.)>dSumWQuadraticFive3n3n3n2n1n) | |
11885 | { | |
11886 | Double_t dError = 4.*pow(f3pCorrelations->GetBinContent(5),2.) | |
11887 | * pow((pow(dSumWQuadraticTwo3n3n,0.5)/dSumWLinearTwo3n3n) | |
11888 | * dSpreadTwo3n3n*pow(pow(dSumWLinearTwo3n3n,2.)/(pow(dSumWLinearTwo3n3n,2.)-dSumWQuadraticTwo3n3n),0.5),2.) | |
11889 | + 4.*pow(f2pCorrelations->GetBinContent(3),2.) | |
11890 | * pow((pow(dSumWQuadraticThree3n2n1n,0.5)/dSumWLinearThree3n2n1n) | |
11891 | * dSpreadThree3n2n1n*pow(pow(dSumWLinearThree3n2n1n,2.)/(pow(dSumWLinearThree3n2n1n,2.)-dSumWQuadraticThree3n2n1n),0.5),2.) | |
11892 | + pow((pow(dSumWQuadraticFive3n3n3n2n1n,0.5)/dSumWLinearFive3n3n3n2n1n) | |
11893 | * dSpreadFive3n3n3n2n1n*pow(pow(dSumWLinearFive3n3n3n2n1n,2.)/(pow(dSumWLinearFive3n3n3n2n1n,2.)-dSumWQuadraticFive3n3n3n2n1n),0.5),2.) | |
11894 | + 4.*2.*f3pCorrelations->GetBinContent(5)*f2pCorrelations->GetBinContent(3) | |
11895 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
11896 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,10)) | |
11897 | - f2pCorrelations->GetBinContent(3)*f3pCorrelations->GetBinContent(5)) | |
11898 | / (dSumWLinearTwo3n3n*dSumWLinearThree3n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
11899 | - 2.*2.*f3pCorrelations->GetBinContent(5) | |
11900 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
11901 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,98)) | |
11902 | - f2pCorrelations->GetBinContent(3)*f5pCorrelations->GetBinContent(44)) | |
11903 | / (dSumWLinearTwo3n3n*dSumWLinearFive3n3n3n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
11904 | - 2.*2.*f2pCorrelations->GetBinContent(3) | |
11905 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
11906 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(10,98)) | |
11907 | - f3pCorrelations->GetBinContent(5)*f5pCorrelations->GetBinContent(44)) | |
11908 | / (dSumWLinearThree3n2n1n*dSumWLinearFive3n3n3n2n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
11909 | if(dError>0.) | |
11910 | { | |
11911 | f5pCumulants->SetBinError(44,pow(dError,0.5)); | |
11912 | } | |
11913 | } // end of if(...) | |
11914 | } // end of { | |
e1d101a6 | 11915 | f5pCumulants->SetBinContent(45,f5pCorrelations->GetBinContent(45)-2.*f3pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(1)); |
c10259fb | 11916 | { |
11917 | Double_t dSumWLinearTwo1n1n = 0.; // sum of linear event weights for <2> | |
11918 | Double_t dSumWQuadraticTwo1n1n = 0.; // sum of quadratic event weights <2> | |
11919 | Double_t dSpreadTwo1n1n = 0.; // weighted and biased estimator for sigma of <2> | |
11920 | Double_t dSumWLinearThree4n3n1n = 0.; // sum of linear event weights for <2> | |
11921 | Double_t dSumWQuadraticThree4n3n1n = 0.; // sum of quadratic event weights <2> | |
11922 | Double_t dSpreadThree4n3n1n = 0.; // weighted and biased estimator for sigma of <2> | |
11923 | Double_t dSumWLinearFive4n1n3n1n1n = 0.; // sum of linear event weights for <4> | |
11924 | Double_t dSumWQuadraticFive4n1n3n1n1n = 0.; // sum of quadratic event weights <4> | |
11925 | Double_t dSpreadFive4n1n3n1n1n = 0.; // weighted and biased estimator for sigma of <4> | |
11926 | dSumWLinearTwo1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
11927 | dSumWQuadraticTwo1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
11928 | dSpreadTwo1n1n = f2pCorrelations->GetBinError(1); | |
11929 | dSumWLinearThree4n3n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
11930 | dSumWQuadraticThree4n3n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
11931 | dSpreadThree4n3n1n = f3pCorrelations->GetBinError(6); | |
11932 | dSumWLinearFive4n1n3n1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
11933 | dSumWQuadraticFive4n1n3n1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
11934 | dSpreadFive4n1n3n1n1n = f5pCorrelations->GetBinError(45); | |
11935 | if(pow(dSumWLinearTwo1n1n,2.)>dSumWQuadraticTwo1n1n && | |
11936 | pow(dSumWLinearThree4n3n1n,2.)>dSumWQuadraticThree4n3n1n && | |
11937 | pow(dSumWLinearFive4n1n3n1n1n,2.)>dSumWQuadraticFive4n1n3n1n1n) | |
11938 | { | |
11939 | Double_t dError = 4.*pow(f3pCorrelations->GetBinContent(6),2.) | |
11940 | * pow((pow(dSumWQuadraticTwo1n1n,0.5)/dSumWLinearTwo1n1n) | |
11941 | * dSpreadTwo1n1n*pow(pow(dSumWLinearTwo1n1n,2.)/(pow(dSumWLinearTwo1n1n,2.)-dSumWQuadraticTwo1n1n),0.5),2.) | |
11942 | + 4.*pow(f2pCorrelations->GetBinContent(1),2.) | |
11943 | * pow((pow(dSumWQuadraticThree4n3n1n,0.5)/dSumWLinearThree4n3n1n) | |
11944 | * dSpreadThree4n3n1n*pow(pow(dSumWLinearThree4n3n1n,2.)/(pow(dSumWLinearThree4n3n1n,2.)-dSumWQuadraticThree4n3n1n),0.5),2.) | |
11945 | + pow((pow(dSumWQuadraticFive4n1n3n1n1n,0.5)/dSumWLinearFive4n1n3n1n1n) | |
11946 | * dSpreadFive4n1n3n1n1n*pow(pow(dSumWLinearFive4n1n3n1n1n,2.)/(pow(dSumWLinearFive4n1n3n1n1n,2.)-dSumWQuadraticFive4n1n3n1n1n),0.5),2.) | |
11947 | + 4.*2.*f3pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(1) | |
11948 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
11949 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,11)) | |
11950 | - f2pCorrelations->GetBinContent(1)*f3pCorrelations->GetBinContent(6)) | |
11951 | / (dSumWLinearTwo1n1n*dSumWLinearThree4n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
11952 | - 2.*2.*f3pCorrelations->GetBinContent(6) | |
11953 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
11954 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,99)) | |
11955 | - f2pCorrelations->GetBinContent(1)*f5pCorrelations->GetBinContent(45)) | |
11956 | / (dSumWLinearTwo1n1n*dSumWLinearFive4n1n3n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
11957 | - 2.*2.*f2pCorrelations->GetBinContent(1) | |
11958 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
11959 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(11,99)) | |
11960 | - f3pCorrelations->GetBinContent(6)*f5pCorrelations->GetBinContent(45)) | |
11961 | / (dSumWLinearThree4n3n1n*dSumWLinearFive4n1n3n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
11962 | if(dError>0.) | |
11963 | { | |
11964 | f5pCumulants->SetBinError(45,pow(dError,0.5)); | |
11965 | } | |
11966 | } // end of if(...) | |
11967 | } // end of { | |
11968 | f5pCumulants->SetBinContent(46,f5pCorrelations->GetBinContent(46)); | |
11969 | { | |
11970 | Double_t dSumWLinear = 0.; // sum of linear event weights | |
11971 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
11972 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
11973 | Double_t dError = 0.; // weighted and unbiased estimator for sigma | |
11974 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
11975 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
11976 | dSpread = f5pCorrelations->GetBinError(46); | |
11977 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
11978 | { | |
11979 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
11980 | f5pCumulants->SetBinError(46,dError); | |
11981 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
11982 | } | |
e1d101a6 | 11983 | f5pCumulants->SetBinContent(47,f5pCorrelations->GetBinContent(47)-2.*f3pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(3)); |
c10259fb | 11984 | { |
11985 | Double_t dSumWLinearTwo3n3n = 0.; // sum of linear event weights for <2> | |
11986 | Double_t dSumWQuadraticTwo3n3n = 0.; // sum of quadratic event weights <2> | |
11987 | Double_t dSpreadTwo3n3n = 0.; // weighted and biased estimator for sigma of <2> | |
11988 | Double_t dSumWLinearThree4n3n1n = 0.; // sum of linear event weights for <2> | |
11989 | Double_t dSumWQuadraticThree4n3n1n = 0.; // sum of quadratic event weights <2> | |
11990 | Double_t dSpreadThree4n3n1n = 0.; // weighted and biased estimator for sigma of <2> | |
11991 | Double_t dSumWLinearFive4n3n3n3n1n = 0.; // sum of linear event weights for <4> | |
11992 | Double_t dSumWQuadraticFive4n3n3n3n1n = 0.; // sum of quadratic event weights <4> | |
11993 | Double_t dSpreadFive4n3n3n3n1n = 0.; // weighted and biased estimator for sigma of <4> | |
11994 | dSumWLinearTwo3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
11995 | dSumWQuadraticTwo3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
11996 | dSpreadTwo3n3n = f2pCorrelations->GetBinError(3); | |
11997 | dSumWLinearThree4n3n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
11998 | dSumWQuadraticThree4n3n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
11999 | dSpreadThree4n3n1n = f3pCorrelations->GetBinError(6); | |
12000 | dSumWLinearFive4n3n3n3n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12001 | dSumWQuadraticFive4n3n3n3n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12002 | dSpreadFive4n3n3n3n1n = f5pCorrelations->GetBinError(47); | |
12003 | if(pow(dSumWLinearTwo3n3n,2.)>dSumWQuadraticTwo3n3n && | |
12004 | pow(dSumWLinearThree4n3n1n,2.)>dSumWQuadraticThree4n3n1n && | |
12005 | pow(dSumWLinearFive4n3n3n3n1n,2.)>dSumWQuadraticFive4n3n3n3n1n) | |
12006 | { | |
12007 | Double_t dError = 4.*pow(f3pCorrelations->GetBinContent(6),2.) | |
12008 | * pow((pow(dSumWQuadraticTwo3n3n,0.5)/dSumWLinearTwo3n3n) | |
12009 | * dSpreadTwo3n3n*pow(pow(dSumWLinearTwo3n3n,2.)/(pow(dSumWLinearTwo3n3n,2.)-dSumWQuadraticTwo3n3n),0.5),2.) | |
12010 | + 4.*pow(f2pCorrelations->GetBinContent(3),2.) | |
12011 | * pow((pow(dSumWQuadraticThree4n3n1n,0.5)/dSumWLinearThree4n3n1n) | |
12012 | * dSpreadThree4n3n1n*pow(pow(dSumWLinearThree4n3n1n,2.)/(pow(dSumWLinearThree4n3n1n,2.)-dSumWQuadraticThree4n3n1n),0.5),2.) | |
12013 | + pow((pow(dSumWQuadraticFive4n3n3n3n1n,0.5)/dSumWLinearFive4n3n3n3n1n) | |
12014 | * dSpreadFive4n3n3n3n1n*pow(pow(dSumWLinearFive4n3n3n3n1n,2.)/(pow(dSumWLinearFive4n3n3n3n1n,2.)-dSumWQuadraticFive4n3n3n3n1n),0.5),2.) | |
12015 | + 4.*2.*f3pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(3) | |
12016 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
12017 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,11)) | |
12018 | - f2pCorrelations->GetBinContent(3)*f3pCorrelations->GetBinContent(6)) | |
12019 | / (dSumWLinearTwo3n3n*dSumWLinearThree4n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
12020 | - 2.*2.*f3pCorrelations->GetBinContent(6) | |
12021 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
12022 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,101)) | |
12023 | - f2pCorrelations->GetBinContent(3)*f5pCorrelations->GetBinContent(47)) | |
12024 | / (dSumWLinearTwo3n3n*dSumWLinearFive4n3n3n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
12025 | - 2.*2.*f2pCorrelations->GetBinContent(3) | |
12026 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
12027 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(11,101)) | |
12028 | - f3pCorrelations->GetBinContent(6)*f5pCorrelations->GetBinContent(47)) | |
12029 | / (dSumWLinearThree4n3n1n*dSumWLinearFive4n3n3n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
12030 | if(dError>0.) | |
12031 | { | |
12032 | f5pCumulants->SetBinError(47,pow(dError,0.5)); | |
12033 | } | |
12034 | } // end of if(...) | |
12035 | } // end of { | |
12036 | f5pCumulants->SetBinContent(48,f5pCorrelations->GetBinContent(48)); | |
12037 | { | |
12038 | Double_t dSumWLinear = 0.; // sum of linear event weights | |
12039 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
12040 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
12041 | Double_t dError = 0.; // weighted and unbiased estimator for sigma | |
12042 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12043 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12044 | dSpread = f5pCorrelations->GetBinError(48); | |
12045 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12046 | { | |
12047 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
12048 | f5pCumulants->SetBinError(48,dError); | |
12049 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12050 | } | |
e1d101a6 | 12051 | f5pCumulants->SetBinContent(49,f5pCorrelations->GetBinContent(49)-2.*f3pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(4)); |
c10259fb | 12052 | { |
12053 | Double_t dSumWLinearTwo4n4n = 0.; // sum of linear event weights for <2> | |
12054 | Double_t dSumWQuadraticTwo4n4n = 0.; // sum of quadratic event weights <2> | |
12055 | Double_t dSpreadTwo4n4n = 0.; // weighted and biased estimator for sigma of <2> | |
12056 | Double_t dSumWLinearThree4n3n1n = 0.; // sum of linear event weights for <2> | |
12057 | Double_t dSumWQuadraticThree4n3n1n = 0.; // sum of quadratic event weights <2> | |
12058 | Double_t dSpreadThree4n3n1n = 0.; // weighted and biased estimator for sigma of <2> | |
12059 | Double_t dSumWLinearFive4n3n3n3n1n = 0.; // sum of linear event weights for <4> | |
12060 | Double_t dSumWQuadraticFive4n3n3n3n1n = 0.; // sum of quadratic event weights <4> | |
12061 | Double_t dSpreadFive4n3n3n3n1n = 0.; // weighted and biased estimator for sigma of <4> | |
12062 | dSumWLinearTwo4n4n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
12063 | dSumWQuadraticTwo4n4n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
12064 | dSpreadTwo4n4n = f2pCorrelations->GetBinError(4); | |
12065 | dSumWLinearThree4n3n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
12066 | dSumWQuadraticThree4n3n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
12067 | dSpreadThree4n3n1n = f3pCorrelations->GetBinError(6); | |
12068 | dSumWLinearFive4n3n3n3n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12069 | dSumWQuadraticFive4n3n3n3n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12070 | dSpreadFive4n3n3n3n1n = f5pCorrelations->GetBinError(49); | |
12071 | if(pow(dSumWLinearTwo4n4n,2.)>dSumWQuadraticTwo4n4n && | |
12072 | pow(dSumWLinearThree4n3n1n,2.)>dSumWQuadraticThree4n3n1n && | |
12073 | pow(dSumWLinearFive4n3n3n3n1n,2.)>dSumWQuadraticFive4n3n3n3n1n) | |
12074 | { | |
12075 | Double_t dError = 4.*pow(f3pCorrelations->GetBinContent(6),2.) | |
12076 | * pow((pow(dSumWQuadraticTwo4n4n,0.5)/dSumWLinearTwo4n4n) | |
12077 | * dSpreadTwo4n4n*pow(pow(dSumWLinearTwo4n4n,2.)/(pow(dSumWLinearTwo4n4n,2.)-dSumWQuadraticTwo4n4n),0.5),2.) | |
12078 | + 4.*pow(f2pCorrelations->GetBinContent(4),2.) | |
12079 | * pow((pow(dSumWQuadraticThree4n3n1n,0.5)/dSumWLinearThree4n3n1n) | |
12080 | * dSpreadThree4n3n1n*pow(pow(dSumWLinearThree4n3n1n,2.)/(pow(dSumWLinearThree4n3n1n,2.)-dSumWQuadraticThree4n3n1n),0.5),2.) | |
12081 | + pow((pow(dSumWQuadraticFive4n3n3n3n1n,0.5)/dSumWLinearFive4n3n3n3n1n) | |
12082 | * dSpreadFive4n3n3n3n1n*pow(pow(dSumWLinearFive4n3n3n3n1n,2.)/(pow(dSumWLinearFive4n3n3n3n1n,2.)-dSumWQuadraticFive4n3n3n3n1n),0.5),2.) | |
12083 | + 4.*2.*f3pCorrelations->GetBinContent(6)*f2pCorrelations->GetBinContent(4) | |
12084 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
12085 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,11)) | |
12086 | - f2pCorrelations->GetBinContent(4)*f3pCorrelations->GetBinContent(6)) | |
12087 | / (dSumWLinearTwo4n4n*dSumWLinearThree4n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
12088 | - 2.*2.*f3pCorrelations->GetBinContent(6) | |
12089 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
12090 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,103)) | |
12091 | - f2pCorrelations->GetBinContent(4)*f5pCorrelations->GetBinContent(49)) | |
12092 | / (dSumWLinearTwo4n4n*dSumWLinearFive4n3n3n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
12093 | - 2.*2.*f2pCorrelations->GetBinContent(4) | |
12094 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
12095 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(11,103)) | |
12096 | - f3pCorrelations->GetBinContent(6)*f5pCorrelations->GetBinContent(49)) | |
12097 | / (dSumWLinearThree4n3n1n*dSumWLinearFive4n3n3n3n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
12098 | if(dError>0.) | |
12099 | { | |
12100 | f5pCumulants->SetBinError(49,pow(dError,0.5)); | |
12101 | } | |
12102 | } // end of if(...) | |
12103 | } // end of { | |
12104 | f5pCumulants->SetBinContent(50,f5pCorrelations->GetBinContent(50)); | |
12105 | { | |
12106 | Double_t dSumWLinear = 0.; // sum of linear event weights | |
12107 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
12108 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
12109 | Double_t dError = 0.; // weighted and unbiased estimator for sigma | |
12110 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12111 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12112 | dSpread = f5pCorrelations->GetBinError(50); | |
12113 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12114 | { | |
12115 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
12116 | f5pCumulants->SetBinError(50,dError); | |
12117 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12118 | } | |
12119 | f5pCumulants->SetBinContent(51,f5pCorrelations->GetBinContent(51)); | |
12120 | { | |
12121 | Double_t dSumWLinear = 0.; // sum of linear event weights | |
12122 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
12123 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
12124 | Double_t dError = 0.; // weighted and unbiased estimator for sigma | |
12125 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12126 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12127 | dSpread = f5pCorrelations->GetBinError(51); | |
12128 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12129 | { | |
12130 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
12131 | f5pCumulants->SetBinError(51,dError); | |
12132 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12133 | } | |
e1d101a6 | 12134 | f5pCumulants->SetBinContent(52,f5pCorrelations->GetBinContent(52)-2.*f3pCorrelations->GetBinContent(7)*f2pCorrelations->GetBinContent(2)); |
c10259fb | 12135 | { |
12136 | Double_t dSumWLinearTwo2n2n = 0.; // sum of linear event weights for <2> | |
12137 | Double_t dSumWQuadraticTwo2n2n = 0.; // sum of quadratic event weights <2> | |
12138 | Double_t dSpreadTwo2n2n = 0.; // weighted and biased estimator for sigma of <2> | |
12139 | Double_t dSumWLinearThree5n3n2n = 0.; // sum of linear event weights for <2> | |
12140 | Double_t dSumWQuadraticThree5n3n2n = 0.; // sum of quadratic event weights <2> | |
12141 | Double_t dSpreadThree5n3n2n = 0.; // weighted and biased estimator for sigma of <2> | |
12142 | Double_t dSumWLinearFive5n2n3n2n2n = 0.; // sum of linear event weights for <4> | |
12143 | Double_t dSumWQuadraticFive5n2n3n2n2n = 0.; // sum of quadratic event weights <4> | |
12144 | Double_t dSpreadFive5n2n3n2n2n = 0.; // weighted and biased estimator for sigma of <4> | |
12145 | dSumWLinearTwo2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
12146 | dSumWQuadraticTwo2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
12147 | dSpreadTwo2n2n = f2pCorrelations->GetBinError(2); | |
12148 | dSumWLinearThree5n3n2n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
12149 | dSumWQuadraticThree5n3n2n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
12150 | dSpreadThree5n3n2n = f3pCorrelations->GetBinError(7); | |
12151 | dSumWLinearFive5n2n3n2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12152 | dSumWQuadraticFive5n2n3n2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12153 | dSpreadFive5n2n3n2n2n = f5pCorrelations->GetBinError(52); | |
12154 | if(pow(dSumWLinearTwo2n2n,2.)>dSumWQuadraticTwo2n2n && | |
12155 | pow(dSumWLinearThree5n3n2n,2.)>dSumWQuadraticThree5n3n2n && | |
12156 | pow(dSumWLinearFive5n2n3n2n2n,2.)>dSumWQuadraticFive5n2n3n2n2n) | |
12157 | { | |
12158 | Double_t dError = 4.*pow(f3pCorrelations->GetBinContent(7),2.) | |
12159 | * pow((pow(dSumWQuadraticTwo2n2n,0.5)/dSumWLinearTwo2n2n) | |
12160 | * dSpreadTwo2n2n*pow(pow(dSumWLinearTwo2n2n,2.)/(pow(dSumWLinearTwo2n2n,2.)-dSumWQuadraticTwo2n2n),0.5),2.) | |
12161 | + 4.*pow(f2pCorrelations->GetBinContent(2),2.) | |
12162 | * pow((pow(dSumWQuadraticThree5n3n2n,0.5)/dSumWLinearThree5n3n2n) | |
12163 | * dSpreadThree5n3n2n*pow(pow(dSumWLinearThree5n3n2n,2.)/(pow(dSumWLinearThree5n3n2n,2.)-dSumWQuadraticThree5n3n2n),0.5),2.) | |
12164 | + pow((pow(dSumWQuadraticFive5n2n3n2n2n,0.5)/dSumWLinearFive5n2n3n2n2n) | |
12165 | * dSpreadFive5n2n3n2n2n*pow(pow(dSumWLinearFive5n2n3n2n2n,2.)/(pow(dSumWLinearFive5n2n3n2n2n,2.)-dSumWQuadraticFive5n2n3n2n2n),0.5),2.) | |
12166 | + 4.*2.*f3pCorrelations->GetBinContent(7)*f2pCorrelations->GetBinContent(2) | |
12167 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
12168 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,12)) | |
12169 | - f2pCorrelations->GetBinContent(2)*f3pCorrelations->GetBinContent(7)) | |
12170 | / (dSumWLinearTwo2n2n*dSumWLinearThree5n3n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
12171 | - 2.*2.*f3pCorrelations->GetBinContent(7) | |
12172 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
12173 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,106)) | |
12174 | - f2pCorrelations->GetBinContent(2)*f5pCorrelations->GetBinContent(52)) | |
12175 | / (dSumWLinearTwo2n2n*dSumWLinearFive5n2n3n2n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
12176 | - 2.*2.*f2pCorrelations->GetBinContent(2) | |
12177 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
12178 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(12,106)) | |
12179 | - f3pCorrelations->GetBinContent(7)*f5pCorrelations->GetBinContent(52)) | |
12180 | / (dSumWLinearThree5n3n2n*dSumWLinearFive5n2n3n2n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
12181 | if(dError>0.) | |
12182 | { | |
12183 | f5pCumulants->SetBinError(52,pow(dError,0.5)); | |
12184 | } | |
12185 | } // end of if(...) | |
12186 | } // end of { | |
e1d101a6 | 12187 | f5pCumulants->SetBinContent(53,f5pCorrelations->GetBinContent(53)-2.*f3pCorrelations->GetBinContent(7)*f2pCorrelations->GetBinContent(3)); |
c10259fb | 12188 | { |
12189 | Double_t dSumWLinearTwo3n3n = 0.; // sum of linear event weights for <2> | |
12190 | Double_t dSumWQuadraticTwo3n3n = 0.; // sum of quadratic event weights <2> | |
12191 | Double_t dSpreadTwo3n3n = 0.; // weighted and biased estimator for sigma of <2> | |
12192 | Double_t dSumWLinearThree5n3n2n = 0.; // sum of linear event weights for <2> | |
12193 | Double_t dSumWQuadraticThree5n3n2n = 0.; // sum of quadratic event weights <2> | |
12194 | Double_t dSpreadThree5n3n2n = 0.; // weighted and biased estimator for sigma of <2> | |
12195 | Double_t dSumWLinearFive5n3n3n3n2n = 0.; // sum of linear event weights for <4> | |
12196 | Double_t dSumWQuadraticFive5n3n3n3n2n = 0.; // sum of quadratic event weights <4> | |
12197 | Double_t dSpreadFive5n3n3n3n2n = 0.; // weighted and biased estimator for sigma of <4> | |
12198 | dSumWLinearTwo3n3n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
12199 | dSumWQuadraticTwo3n3n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
12200 | dSpreadTwo3n3n = f2pCorrelations->GetBinError(3); | |
12201 | dSumWLinearThree5n3n2n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
12202 | dSumWQuadraticThree5n3n2n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
12203 | dSpreadThree5n3n2n = f3pCorrelations->GetBinError(7); | |
12204 | dSumWLinearFive5n3n3n3n2n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12205 | dSumWQuadraticFive5n3n3n3n2n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12206 | dSpreadFive5n3n3n3n2n = f5pCorrelations->GetBinError(53); | |
12207 | if(pow(dSumWLinearTwo3n3n,2.)>dSumWQuadraticTwo3n3n && | |
12208 | pow(dSumWLinearThree5n3n2n,2.)>dSumWQuadraticThree5n3n2n && | |
12209 | pow(dSumWLinearFive5n3n3n3n2n,2.)>dSumWQuadraticFive5n3n3n3n2n) | |
12210 | { | |
12211 | Double_t dError = 4.*pow(f3pCorrelations->GetBinContent(7),2.) | |
12212 | * pow((pow(dSumWQuadraticTwo3n3n,0.5)/dSumWLinearTwo3n3n) | |
12213 | * dSpreadTwo3n3n*pow(pow(dSumWLinearTwo3n3n,2.)/(pow(dSumWLinearTwo3n3n,2.)-dSumWQuadraticTwo3n3n),0.5),2.) | |
12214 | + 4.*pow(f2pCorrelations->GetBinContent(3),2.) | |
12215 | * pow((pow(dSumWQuadraticThree5n3n2n,0.5)/dSumWLinearThree5n3n2n) | |
12216 | * dSpreadThree5n3n2n*pow(pow(dSumWLinearThree5n3n2n,2.)/(pow(dSumWLinearThree5n3n2n,2.)-dSumWQuadraticThree5n3n2n),0.5),2.) | |
12217 | + pow((pow(dSumWQuadraticFive5n3n3n3n2n,0.5)/dSumWLinearFive5n3n3n3n2n) | |
12218 | * dSpreadFive5n3n3n3n2n*pow(pow(dSumWLinearFive5n3n3n3n2n,2.)/(pow(dSumWLinearFive5n3n3n3n2n,2.)-dSumWQuadraticFive5n3n3n3n2n),0.5),2.) | |
12219 | + 4.*2.*f3pCorrelations->GetBinContent(7)*f2pCorrelations->GetBinContent(3) | |
12220 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
12221 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,12)) | |
12222 | - f2pCorrelations->GetBinContent(3)*f3pCorrelations->GetBinContent(7)) | |
12223 | / (dSumWLinearTwo3n3n*dSumWLinearThree5n3n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
12224 | - 2.*2.*f3pCorrelations->GetBinContent(7) | |
12225 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
12226 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(3,107)) | |
12227 | - f2pCorrelations->GetBinContent(3)*f5pCorrelations->GetBinContent(53)) | |
12228 | / (dSumWLinearTwo3n3n*dSumWLinearFive5n3n3n3n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
12229 | - 2.*2.*f2pCorrelations->GetBinContent(3) | |
12230 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
12231 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(12,107)) | |
12232 | - f3pCorrelations->GetBinContent(7)*f5pCorrelations->GetBinContent(53)) | |
12233 | / (dSumWLinearThree5n3n2n*dSumWLinearFive5n3n3n3n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
12234 | if(dError>0.) | |
12235 | { | |
12236 | f5pCumulants->SetBinError(53,pow(dError,0.5)); | |
12237 | } | |
12238 | } // end of if(...) | |
12239 | } // end of { | |
12240 | f5pCumulants->SetBinContent(54,f5pCorrelations->GetBinContent(54)-2.*f3pCorrelations->GetBinContent(8)*f2pCorrelations->GetBinContent(1)); | |
12241 | { | |
12242 | Double_t dSumWLinearTwo1n1n = 0.; // sum of linear event weights for <2> | |
12243 | Double_t dSumWQuadraticTwo1n1n = 0.; // sum of quadratic event weights <2> | |
12244 | Double_t dSpreadTwo1n1n = 0.; // weighted and biased estimator for sigma of <2> | |
12245 | Double_t dSumWLinearThree5n4n1n = 0.; // sum of linear event weights for <2> | |
12246 | Double_t dSumWQuadraticThree5n4n1n = 0.; // sum of quadratic event weights <2> | |
12247 | Double_t dSpreadThree5n4n1n = 0.; // weighted and biased estimator for sigma of <2> | |
12248 | Double_t dSumWLinearFive5n1n4n1n1n = 0.; // sum of linear event weights for <4> | |
12249 | Double_t dSumWQuadraticFive5n1n4n1n1n = 0.; // sum of quadratic event weights <4> | |
12250 | Double_t dSpreadFive5n1n4n1n1n = 0.; // weighted and biased estimator for sigma of <4> | |
12251 | dSumWLinearTwo1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
12252 | dSumWQuadraticTwo1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
12253 | dSpreadTwo1n1n = f2pCorrelations->GetBinError(1); | |
12254 | dSumWLinearThree5n4n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
12255 | dSumWQuadraticThree5n4n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
12256 | dSpreadThree5n4n1n = f3pCorrelations->GetBinError(8); | |
12257 | dSumWLinearFive5n1n4n1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12258 | dSumWQuadraticFive5n1n4n1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12259 | dSpreadFive5n1n4n1n1n = f5pCorrelations->GetBinError(54); | |
12260 | if(pow(dSumWLinearTwo1n1n,2.)>dSumWQuadraticTwo1n1n && | |
12261 | pow(dSumWLinearThree5n4n1n,2.)>dSumWQuadraticThree5n4n1n && | |
12262 | pow(dSumWLinearFive5n1n4n1n1n,2.)>dSumWQuadraticFive5n1n4n1n1n) | |
12263 | { | |
12264 | Double_t dError = 4.*pow(f3pCorrelations->GetBinContent(8),2.) | |
12265 | * pow((pow(dSumWQuadraticTwo1n1n,0.5)/dSumWLinearTwo1n1n) | |
12266 | * dSpreadTwo1n1n*pow(pow(dSumWLinearTwo1n1n,2.)/(pow(dSumWLinearTwo1n1n,2.)-dSumWQuadraticTwo1n1n),0.5),2.) | |
12267 | + 4.*pow(f2pCorrelations->GetBinContent(1),2.) | |
12268 | * pow((pow(dSumWQuadraticThree5n4n1n,0.5)/dSumWLinearThree5n4n1n) | |
12269 | * dSpreadThree5n4n1n*pow(pow(dSumWLinearThree5n4n1n,2.)/(pow(dSumWLinearThree5n4n1n,2.)-dSumWQuadraticThree5n4n1n),0.5),2.) | |
12270 | + pow((pow(dSumWQuadraticFive5n1n4n1n1n,0.5)/dSumWLinearFive5n1n4n1n1n) | |
12271 | * dSpreadFive5n1n4n1n1n*pow(pow(dSumWLinearFive5n1n4n1n1n,2.)/(pow(dSumWLinearFive5n1n4n1n1n,2.)-dSumWQuadraticFive5n1n4n1n1n),0.5),2.) | |
12272 | + 4.*2.*f3pCorrelations->GetBinContent(8)*f2pCorrelations->GetBinContent(1) | |
12273 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
12274 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,13)) | |
12275 | - f2pCorrelations->GetBinContent(1)*f3pCorrelations->GetBinContent(8)) | |
12276 | / (dSumWLinearTwo1n1n*dSumWLinearThree5n4n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
12277 | - 2.*2.*f3pCorrelations->GetBinContent(8) | |
12278 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
12279 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,108)) | |
12280 | - f2pCorrelations->GetBinContent(1)*f5pCorrelations->GetBinContent(54)) | |
12281 | / (dSumWLinearTwo1n1n*dSumWLinearFive5n1n4n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
12282 | - 2.*2.*f2pCorrelations->GetBinContent(1) | |
12283 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
12284 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(13,108)) | |
12285 | - f3pCorrelations->GetBinContent(8)*f5pCorrelations->GetBinContent(54)) | |
12286 | / (dSumWLinearThree5n4n1n*dSumWLinearFive5n1n4n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
12287 | if(dError>0.) | |
12288 | { | |
12289 | f5pCumulants->SetBinError(54,pow(dError,0.5)); | |
12290 | } | |
12291 | } // end of if(...) | |
12292 | } // end of { | |
12293 | ||
12294 | f5pCumulants->SetBinContent(55,f5pCorrelations->GetBinContent(55)); | |
12295 | { | |
12296 | Double_t dSumWLinear = 0.; // sum of linear event weights | |
12297 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
12298 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
12299 | Double_t dError = 0.; // weighted and unbiased estimator for sigma | |
12300 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12301 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12302 | dSpread = f5pCorrelations->GetBinError(55); | |
12303 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12304 | { | |
12305 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
12306 | f5pCumulants->SetBinError(55,dError); | |
12307 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12308 | } | |
12309 | f5pCumulants->SetBinContent(56,f5pCorrelations->GetBinContent(56)-2.*f3pCorrelations->GetBinContent(8)*f2pCorrelations->GetBinContent(4)); | |
12310 | { | |
12311 | Double_t dSumWLinearTwo4n4n = 0.; // sum of linear event weights for <2> | |
12312 | Double_t dSumWQuadraticTwo4n4n = 0.; // sum of quadratic event weights <2> | |
12313 | Double_t dSpreadTwo4n4n = 0.; // weighted and biased estimator for sigma of <2> | |
12314 | Double_t dSumWLinearThree5n4n1n = 0.; // sum of linear event weights for <2> | |
12315 | Double_t dSumWQuadraticThree5n4n1n = 0.; // sum of quadratic event weights <2> | |
12316 | Double_t dSpreadThree5n4n1n = 0.; // weighted and biased estimator for sigma of <2> | |
12317 | Double_t dSumWLinearFive5n4n4n4n1n = 0.; // sum of linear event weights for <4> | |
12318 | Double_t dSumWQuadraticFive5n4n4n4n1n = 0.; // sum of quadratic event weights <4> | |
12319 | Double_t dSpreadFive5n4n4n4n1n = 0.; // weighted and biased estimator for sigma of <4> | |
12320 | dSumWLinearTwo4n4n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
12321 | dSumWQuadraticTwo4n4n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
12322 | dSpreadTwo4n4n = f2pCorrelations->GetBinError(4); | |
12323 | dSumWLinearThree5n4n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
12324 | dSumWQuadraticThree5n4n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
12325 | dSpreadThree5n4n1n = f3pCorrelations->GetBinError(8); | |
12326 | dSumWLinearFive5n4n4n4n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12327 | dSumWQuadraticFive5n4n4n4n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12328 | dSpreadFive5n4n4n4n1n = f5pCorrelations->GetBinError(56); | |
12329 | if(pow(dSumWLinearTwo4n4n,2.)>dSumWQuadraticTwo4n4n && | |
12330 | pow(dSumWLinearThree5n4n1n,2.)>dSumWQuadraticThree5n4n1n && | |
12331 | pow(dSumWLinearFive5n4n4n4n1n,2.)>dSumWQuadraticFive5n4n4n4n1n) | |
12332 | { | |
12333 | Double_t dError = 4.*pow(f3pCorrelations->GetBinContent(8),2.) | |
12334 | * pow((pow(dSumWQuadraticTwo4n4n,0.5)/dSumWLinearTwo4n4n) | |
12335 | * dSpreadTwo4n4n*pow(pow(dSumWLinearTwo4n4n,2.)/(pow(dSumWLinearTwo4n4n,2.)-dSumWQuadraticTwo4n4n),0.5),2.) | |
12336 | + 4.*pow(f2pCorrelations->GetBinContent(4),2.) | |
12337 | * pow((pow(dSumWQuadraticThree5n4n1n,0.5)/dSumWLinearThree5n4n1n) | |
12338 | * dSpreadThree5n4n1n*pow(pow(dSumWLinearThree5n4n1n,2.)/(pow(dSumWLinearThree5n4n1n,2.)-dSumWQuadraticThree5n4n1n),0.5),2.) | |
12339 | + pow((pow(dSumWQuadraticFive5n4n4n4n1n,0.5)/dSumWLinearFive5n4n4n4n1n) | |
12340 | * dSpreadFive5n4n4n4n1n*pow(pow(dSumWLinearFive5n4n4n4n1n,2.)/(pow(dSumWLinearFive5n4n4n4n1n,2.)-dSumWQuadraticFive5n4n4n4n1n),0.5),2.) | |
12341 | + 4.*2.*f3pCorrelations->GetBinContent(8)*f2pCorrelations->GetBinContent(4) | |
12342 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
12343 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,13)) | |
12344 | - f2pCorrelations->GetBinContent(4)*f3pCorrelations->GetBinContent(8)) | |
12345 | / (dSumWLinearTwo4n4n*dSumWLinearThree5n4n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
12346 | - 2.*2.*f3pCorrelations->GetBinContent(8) | |
12347 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
12348 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,110)) | |
12349 | - f2pCorrelations->GetBinContent(4)*f5pCorrelations->GetBinContent(56)) | |
12350 | / (dSumWLinearTwo4n4n*dSumWLinearFive5n4n4n4n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
12351 | - 2.*2.*f2pCorrelations->GetBinContent(4) | |
12352 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
12353 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(13,110)) | |
12354 | - f3pCorrelations->GetBinContent(8)*f5pCorrelations->GetBinContent(56)) | |
12355 | / (dSumWLinearThree5n4n1n*dSumWLinearFive5n4n4n4n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
12356 | if(dError>0.) | |
12357 | { | |
12358 | f5pCumulants->SetBinError(56,pow(dError,0.5)); | |
12359 | } | |
12360 | } // end of if(...) | |
12361 | } // end of { | |
12362 | f5pCumulants->SetBinContent(57,f5pCorrelations->GetBinContent(57)); | |
12363 | { | |
12364 | Double_t dSumWLinear = 0.; // sum of linear event weights | |
12365 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
12366 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
12367 | Double_t dError = 0.; // weighted and unbiased estimator for sigma | |
12368 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12369 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12370 | dSpread = f5pCorrelations->GetBinError(57); | |
12371 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12372 | { | |
12373 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
12374 | f5pCumulants->SetBinError(57,dError); | |
12375 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12376 | } | |
12377 | f5pCumulants->SetBinContent(58,f5pCorrelations->GetBinContent(58)); | |
12378 | { | |
12379 | Double_t dSumWLinear = 0.; // sum of linear event weights | |
12380 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
12381 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
12382 | Double_t dError = 0.; // weighted and unbiased estimator for sigma | |
12383 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12384 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12385 | dSpread = f5pCorrelations->GetBinError(58); | |
12386 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12387 | { | |
12388 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
12389 | f5pCumulants->SetBinError(58,dError); | |
12390 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12391 | } | |
e1d101a6 | 12392 | f5pCumulants->SetBinContent(59,f5pCorrelations->GetBinContent(59)-2.*f3pCorrelations->GetBinContent(7)*f2pCorrelations->GetBinContent(5)); |
c10259fb | 12393 | { |
12394 | Double_t dSumWLinearTwo5n5n = 0.; // sum of linear event weights for <2> | |
12395 | Double_t dSumWQuadraticTwo5n5n = 0.; // sum of quadratic event weights <2> | |
12396 | Double_t dSpreadTwo5n5n = 0.; // weighted and biased estimator for sigma of <2> | |
12397 | Double_t dSumWLinearThree5n3n2n = 0.; // sum of linear event weights for <2> | |
12398 | Double_t dSumWQuadraticThree5n3n2n = 0.; // sum of quadratic event weights <2> | |
12399 | Double_t dSpreadThree5n3n2n = 0.; // weighted and biased estimator for sigma of <2> | |
12400 | Double_t dSumWLinearFive5n5n5n3n2n = 0.; // sum of linear event weights for <4> | |
12401 | Double_t dSumWQuadraticFive5n5n5n3n2n = 0.; // sum of quadratic event weights <4> | |
12402 | Double_t dSpreadFive5n5n5n3n2n = 0.; // weighted and biased estimator for sigma of <4> | |
12403 | dSumWLinearTwo5n5n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
12404 | dSumWQuadraticTwo5n5n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
12405 | dSpreadTwo5n5n = f2pCorrelations->GetBinError(5); | |
12406 | dSumWLinearThree5n3n2n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
12407 | dSumWQuadraticThree5n3n2n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
12408 | dSpreadThree5n3n2n = f3pCorrelations->GetBinError(7); | |
12409 | dSumWLinearFive5n5n5n3n2n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12410 | dSumWQuadraticFive5n5n5n3n2n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12411 | dSpreadFive5n5n5n3n2n = f5pCorrelations->GetBinError(59); | |
12412 | if(pow(dSumWLinearTwo5n5n,2.)>dSumWQuadraticTwo5n5n && | |
12413 | pow(dSumWLinearThree5n3n2n,2.)>dSumWQuadraticThree5n3n2n && | |
12414 | pow(dSumWLinearFive5n5n5n3n2n,2.)>dSumWQuadraticFive5n5n5n3n2n) | |
12415 | { | |
12416 | Double_t dError = 4.*pow(f3pCorrelations->GetBinContent(7),2.) | |
12417 | * pow((pow(dSumWQuadraticTwo5n5n,0.5)/dSumWLinearTwo5n5n) | |
12418 | * dSpreadTwo5n5n*pow(pow(dSumWLinearTwo5n5n,2.)/(pow(dSumWLinearTwo5n5n,2.)-dSumWQuadraticTwo5n5n),0.5),2.) | |
12419 | + 4.*pow(f2pCorrelations->GetBinContent(5),2.) | |
12420 | * pow((pow(dSumWQuadraticThree5n3n2n,0.5)/dSumWLinearThree5n3n2n) | |
12421 | * dSpreadThree5n3n2n*pow(pow(dSumWLinearThree5n3n2n,2.)/(pow(dSumWLinearThree5n3n2n,2.)-dSumWQuadraticThree5n3n2n),0.5),2.) | |
12422 | + pow((pow(dSumWQuadraticFive5n5n5n3n2n,0.5)/dSumWLinearFive5n5n5n3n2n) | |
12423 | * dSpreadFive5n5n5n3n2n*pow(pow(dSumWLinearFive5n5n5n3n2n,2.)/(pow(dSumWLinearFive5n5n5n3n2n,2.)-dSumWQuadraticFive5n5n5n3n2n),0.5),2.) | |
12424 | + 4.*2.*f3pCorrelations->GetBinContent(7)*f2pCorrelations->GetBinContent(5) | |
12425 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
12426 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,12)) | |
12427 | - f2pCorrelations->GetBinContent(5)*f3pCorrelations->GetBinContent(7)) | |
12428 | / (dSumWLinearTwo5n5n*dSumWLinearThree5n3n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
12429 | - 2.*2.*f3pCorrelations->GetBinContent(7) | |
12430 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
12431 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,113)) | |
12432 | - f2pCorrelations->GetBinContent(5)*f5pCorrelations->GetBinContent(59)) | |
12433 | / (dSumWLinearTwo5n5n*dSumWLinearFive5n5n5n3n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
12434 | - 2.*2.*f2pCorrelations->GetBinContent(5) | |
12435 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
12436 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(12,113)) | |
12437 | - f3pCorrelations->GetBinContent(7)*f5pCorrelations->GetBinContent(59)) | |
12438 | / (dSumWLinearThree5n3n2n*dSumWLinearFive5n5n5n3n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
12439 | if(dError>0.) | |
12440 | { | |
12441 | f5pCumulants->SetBinError(59,pow(dError,0.5)); | |
12442 | } | |
12443 | } // end of if(...) | |
12444 | } // end of { | |
e1d101a6 | 12445 | f5pCumulants->SetBinContent(60,f5pCorrelations->GetBinContent(60)-2.*f3pCorrelations->GetBinContent(8)*f2pCorrelations->GetBinContent(5)); |
c10259fb | 12446 | { |
12447 | Double_t dSumWLinearTwo5n5n = 0.; // sum of linear event weights for <2> | |
12448 | Double_t dSumWQuadraticTwo5n5n = 0.; // sum of quadratic event weights <2> | |
12449 | Double_t dSpreadTwo5n5n = 0.; // weighted and biased estimator for sigma of <2> | |
12450 | Double_t dSumWLinearThree5n4n1n = 0.; // sum of linear event weights for <2> | |
12451 | Double_t dSumWQuadraticThree5n4n1n = 0.; // sum of quadratic event weights <2> | |
12452 | Double_t dSpreadThree5n4n1n = 0.; // weighted and biased estimator for sigma of <2> | |
12453 | Double_t dSumWLinearFive5n5n5n4n1n = 0.; // sum of linear event weights for <4> | |
12454 | Double_t dSumWQuadraticFive5n5n5n4n1n = 0.; // sum of quadratic event weights <4> | |
12455 | Double_t dSpreadFive5n5n5n4n1n = 0.; // weighted and biased estimator for sigma of <4> | |
12456 | dSumWLinearTwo5n5n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
12457 | dSumWQuadraticTwo5n5n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
12458 | dSpreadTwo5n5n = f2pCorrelations->GetBinError(5); | |
12459 | dSumWLinearThree5n4n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
12460 | dSumWQuadraticThree5n4n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
12461 | dSpreadThree5n4n1n = f3pCorrelations->GetBinError(8); | |
12462 | dSumWLinearFive5n5n5n4n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12463 | dSumWQuadraticFive5n5n5n4n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12464 | dSpreadFive5n5n5n4n1n = f5pCorrelations->GetBinError(60); | |
12465 | if(pow(dSumWLinearTwo5n5n,2.)>dSumWQuadraticTwo5n5n && | |
12466 | pow(dSumWLinearThree5n4n1n,2.)>dSumWQuadraticThree5n4n1n && | |
12467 | pow(dSumWLinearFive5n5n5n4n1n,2.)>dSumWQuadraticFive5n5n5n4n1n) | |
12468 | { | |
12469 | Double_t dError = 4.*pow(f3pCorrelations->GetBinContent(8),2.) | |
12470 | * pow((pow(dSumWQuadraticTwo5n5n,0.5)/dSumWLinearTwo5n5n) | |
12471 | * dSpreadTwo5n5n*pow(pow(dSumWLinearTwo5n5n,2.)/(pow(dSumWLinearTwo5n5n,2.)-dSumWQuadraticTwo5n5n),0.5),2.) | |
12472 | + 4.*pow(f2pCorrelations->GetBinContent(5),2.) | |
12473 | * pow((pow(dSumWQuadraticThree5n4n1n,0.5)/dSumWLinearThree5n4n1n) | |
12474 | * dSpreadThree5n4n1n*pow(pow(dSumWLinearThree5n4n1n,2.)/(pow(dSumWLinearThree5n4n1n,2.)-dSumWQuadraticThree5n4n1n),0.5),2.) | |
12475 | + pow((pow(dSumWQuadraticFive5n5n5n4n1n,0.5)/dSumWLinearFive5n5n5n4n1n) | |
12476 | * dSpreadFive5n5n5n4n1n*pow(pow(dSumWLinearFive5n5n5n4n1n,2.)/(pow(dSumWLinearFive5n5n5n4n1n,2.)-dSumWQuadraticFive5n5n5n4n1n),0.5),2.) | |
12477 | + 4.*2.*f3pCorrelations->GetBinContent(8)*f2pCorrelations->GetBinContent(5) | |
12478 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
12479 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,13)) | |
12480 | - f2pCorrelations->GetBinContent(5)*f3pCorrelations->GetBinContent(8)) | |
12481 | / (dSumWLinearTwo5n5n*dSumWLinearThree5n4n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
12482 | - 2.*2.*f3pCorrelations->GetBinContent(8) | |
12483 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
12484 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,114)) | |
12485 | - f2pCorrelations->GetBinContent(5)*f5pCorrelations->GetBinContent(60)) | |
12486 | / (dSumWLinearTwo5n5n*dSumWLinearFive5n5n5n4n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
12487 | - 2.*2.*f2pCorrelations->GetBinContent(5) | |
12488 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
12489 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(13,114)) | |
12490 | - f3pCorrelations->GetBinContent(8)*f5pCorrelations->GetBinContent(60)) | |
12491 | / (dSumWLinearThree5n4n1n*dSumWLinearFive5n5n5n4n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
12492 | if(dError>0.) | |
12493 | { | |
12494 | f5pCumulants->SetBinError(60,pow(dError,0.5)); | |
12495 | } | |
12496 | } // end of if(...) | |
12497 | } // end of { | |
12498 | f5pCumulants->SetBinContent(61,f5pCorrelations->GetBinContent(61)); | |
12499 | { | |
12500 | Double_t dSumWLinear = 0.; // sum of linear event weights | |
12501 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
12502 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
12503 | Double_t dError = 0.; // weighted and unbiased estimator for sigma | |
12504 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12505 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12506 | dSpread = f5pCorrelations->GetBinError(61); | |
12507 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12508 | { | |
12509 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
12510 | f5pCumulants->SetBinError(61,dError); | |
12511 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12512 | } | |
12513 | f5pCumulants->SetBinContent(62,f5pCorrelations->GetBinContent(62)); | |
12514 | { | |
12515 | Double_t dSumWLinear = 0.; // sum of linear event weights | |
12516 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
12517 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
12518 | Double_t dError = 0.; // weighted and unbiased estimator for sigma | |
12519 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12520 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12521 | dSpread = f5pCorrelations->GetBinError(62); | |
12522 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12523 | { | |
12524 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
12525 | f5pCumulants->SetBinError(62,dError); | |
12526 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12527 | } | |
12528 | f5pCumulants->SetBinContent(63,f5pCorrelations->GetBinContent(63)); | |
12529 | { | |
12530 | Double_t dSumWLinear = 0.; // sum of linear event weights | |
12531 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
12532 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
12533 | Double_t dError = 0.; // weighted and unbiased estimator for sigma | |
12534 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12535 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12536 | dSpread = f5pCorrelations->GetBinError(63); | |
12537 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12538 | { | |
12539 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
12540 | f5pCumulants->SetBinError(63,dError); | |
12541 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12542 | } | |
e1d101a6 | 12543 | f5pCumulants->SetBinContent(64,f5pCorrelations->GetBinContent(64)-2.*f3pCorrelations->GetBinContent(10)*f2pCorrelations->GetBinContent(1)); |
c10259fb | 12544 | { |
12545 | Double_t dSumWLinearTwo1n1n = 0.; // sum of linear event weights for <2> | |
12546 | Double_t dSumWQuadraticTwo1n1n = 0.; // sum of quadratic event weights <2> | |
12547 | Double_t dSpreadTwo1n1n = 0.; // weighted and biased estimator for sigma of <2> | |
12548 | Double_t dSumWLinearThree6n5n1n = 0.; // sum of linear event weights for <2> | |
12549 | Double_t dSumWQuadraticThree6n5n1n = 0.; // sum of quadratic event weights <2> | |
12550 | Double_t dSpreadThree6n5n1n = 0.; // weighted and biased estimator for sigma of <2> | |
12551 | Double_t dSumWLinearFive6n1n5n1n1n = 0.; // sum of linear event weights for <4> | |
12552 | Double_t dSumWQuadraticFive6n1n5n1n1n = 0.; // sum of quadratic event weights <4> | |
12553 | Double_t dSpreadFive6n1n5n1n1n = 0.; // weighted and biased estimator for sigma of <4> | |
12554 | dSumWLinearTwo1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
12555 | dSumWQuadraticTwo1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
12556 | dSpreadTwo1n1n = f2pCorrelations->GetBinError(1); | |
12557 | dSumWLinearThree6n5n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
12558 | dSumWQuadraticThree6n5n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
12559 | dSpreadThree6n5n1n = f3pCorrelations->GetBinError(10); | |
12560 | dSumWLinearFive6n1n5n1n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12561 | dSumWQuadraticFive6n1n5n1n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12562 | dSpreadFive6n1n5n1n1n = f5pCorrelations->GetBinError(64); | |
12563 | if(pow(dSumWLinearTwo1n1n,2.)>dSumWQuadraticTwo1n1n && | |
12564 | pow(dSumWLinearThree6n5n1n,2.)>dSumWQuadraticThree6n5n1n && | |
12565 | pow(dSumWLinearFive6n1n5n1n1n,2.)>dSumWQuadraticFive6n1n5n1n1n) | |
12566 | { | |
12567 | Double_t dError = 4.*pow(f3pCorrelations->GetBinContent(10),2.) | |
12568 | * pow((pow(dSumWQuadraticTwo1n1n,0.5)/dSumWLinearTwo1n1n) | |
12569 | * dSpreadTwo1n1n*pow(pow(dSumWLinearTwo1n1n,2.)/(pow(dSumWLinearTwo1n1n,2.)-dSumWQuadraticTwo1n1n),0.5),2.) | |
12570 | + 4.*pow(f2pCorrelations->GetBinContent(1),2.) | |
12571 | * pow((pow(dSumWQuadraticThree6n5n1n,0.5)/dSumWLinearThree6n5n1n) | |
12572 | * dSpreadThree6n5n1n*pow(pow(dSumWLinearThree6n5n1n,2.)/(pow(dSumWLinearThree6n5n1n,2.)-dSumWQuadraticThree6n5n1n),0.5),2.) | |
12573 | + pow((pow(dSumWQuadraticFive6n1n5n1n1n,0.5)/dSumWLinearFive6n1n5n1n1n) | |
12574 | * dSpreadFive6n1n5n1n1n*pow(pow(dSumWLinearFive6n1n5n1n1n,2.)/(pow(dSumWLinearFive6n1n5n1n1n,2.)-dSumWQuadraticFive6n1n5n1n1n),0.5),2.) | |
12575 | + 4.*2.*f3pCorrelations->GetBinContent(10)*f2pCorrelations->GetBinContent(1) | |
12576 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
12577 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,15)) | |
12578 | - f2pCorrelations->GetBinContent(1)*f3pCorrelations->GetBinContent(10)) | |
12579 | / (dSumWLinearTwo1n1n*dSumWLinearThree6n5n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
12580 | - 2.*2.*f3pCorrelations->GetBinContent(10) | |
12581 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
12582 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(1,118)) | |
12583 | - f2pCorrelations->GetBinContent(1)*f5pCorrelations->GetBinContent(64)) | |
12584 | / (dSumWLinearTwo1n1n*dSumWLinearFive6n1n5n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
12585 | - 2.*2.*f2pCorrelations->GetBinContent(1) | |
12586 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
12587 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(15,118)) | |
12588 | - f3pCorrelations->GetBinContent(10)*f5pCorrelations->GetBinContent(64)) | |
12589 | / (dSumWLinearThree6n5n1n*dSumWLinearFive6n1n5n1n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
12590 | if(dError>0.) | |
12591 | { | |
12592 | f5pCumulants->SetBinError(64,pow(dError,0.5)); | |
12593 | } | |
12594 | } // end of if(...) | |
12595 | } // end of { | |
e1d101a6 | 12596 | f5pCumulants->SetBinContent(65,f5pCorrelations->GetBinContent(65)-2.*f3pCorrelations->GetBinContent(9)*f2pCorrelations->GetBinContent(2)); |
c10259fb | 12597 | { |
12598 | Double_t dSumWLinearTwo2n2n = 0.; // sum of linear event weights for <2> | |
12599 | Double_t dSumWQuadraticTwo2n2n = 0.; // sum of quadratic event weights <2> | |
12600 | Double_t dSpreadTwo2n2n = 0.; // weighted and biased estimator for sigma of <2> | |
12601 | Double_t dSumWLinearThree6n4n2n = 0.; // sum of linear event weights for <2> | |
12602 | Double_t dSumWQuadraticThree6n4n2n = 0.; // sum of quadratic event weights <2> | |
12603 | Double_t dSpreadThree6n4n2n = 0.; // weighted and biased estimator for sigma of <2> | |
12604 | Double_t dSumWLinearFive6n2n4n2n2n = 0.; // sum of linear event weights for <4> | |
12605 | Double_t dSumWQuadraticFive6n2n4n2n2n = 0.; // sum of quadratic event weights <4> | |
12606 | Double_t dSpreadFive6n2n4n2n2n = 0.; // weighted and biased estimator for sigma of <4> | |
12607 | dSumWLinearTwo2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
12608 | dSumWQuadraticTwo2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
12609 | dSpreadTwo2n2n = f2pCorrelations->GetBinError(2); | |
12610 | dSumWLinearThree6n4n2n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
12611 | dSumWQuadraticThree6n4n2n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
12612 | dSpreadThree6n4n2n = f3pCorrelations->GetBinError(9); | |
12613 | dSumWLinearFive6n2n4n2n2n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12614 | dSumWQuadraticFive6n2n4n2n2n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12615 | dSpreadFive6n2n4n2n2n = f5pCorrelations->GetBinError(65); | |
12616 | if(pow(dSumWLinearTwo2n2n,2.)>dSumWQuadraticTwo2n2n && | |
12617 | pow(dSumWLinearThree6n4n2n,2.)>dSumWQuadraticThree6n4n2n && | |
12618 | pow(dSumWLinearFive6n2n4n2n2n,2.)>dSumWQuadraticFive6n2n4n2n2n) | |
12619 | { | |
12620 | Double_t dError = 4.*pow(f3pCorrelations->GetBinContent(9),2.) | |
12621 | * pow((pow(dSumWQuadraticTwo2n2n,0.5)/dSumWLinearTwo2n2n) | |
12622 | * dSpreadTwo2n2n*pow(pow(dSumWLinearTwo2n2n,2.)/(pow(dSumWLinearTwo2n2n,2.)-dSumWQuadraticTwo2n2n),0.5),2.) | |
12623 | + 4.*pow(f2pCorrelations->GetBinContent(2),2.) | |
12624 | * pow((pow(dSumWQuadraticThree6n4n2n,0.5)/dSumWLinearThree6n4n2n) | |
12625 | * dSpreadThree6n4n2n*pow(pow(dSumWLinearThree6n4n2n,2.)/(pow(dSumWLinearThree6n4n2n,2.)-dSumWQuadraticThree6n4n2n),0.5),2.) | |
12626 | + pow((pow(dSumWQuadraticFive6n2n4n2n2n,0.5)/dSumWLinearFive6n2n4n2n2n) | |
12627 | * dSpreadFive6n2n4n2n2n*pow(pow(dSumWLinearFive6n2n4n2n2n,2.)/(pow(dSumWLinearFive6n2n4n2n2n,2.)-dSumWQuadraticFive6n2n4n2n2n),0.5),2.) | |
12628 | + 4.*2.*f3pCorrelations->GetBinContent(9)*f2pCorrelations->GetBinContent(2) | |
12629 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
12630 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,14)) | |
12631 | - f2pCorrelations->GetBinContent(2)*f3pCorrelations->GetBinContent(9)) | |
12632 | / (dSumWLinearTwo2n2n*dSumWLinearThree6n4n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
12633 | - 2.*2.*f3pCorrelations->GetBinContent(9) | |
12634 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
12635 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(2,119)) | |
12636 | - f2pCorrelations->GetBinContent(2)*f5pCorrelations->GetBinContent(65)) | |
12637 | / (dSumWLinearTwo2n2n*dSumWLinearFive6n2n4n2n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
12638 | - 2.*2.*f2pCorrelations->GetBinContent(2) | |
12639 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
12640 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(14,119)) | |
12641 | - f3pCorrelations->GetBinContent(9)*f5pCorrelations->GetBinContent(65)) | |
12642 | / (dSumWLinearThree6n4n2n*dSumWLinearFive6n2n4n2n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
12643 | if(dError>0.) | |
12644 | { | |
12645 | f5pCumulants->SetBinError(65,pow(dError,0.5)); | |
12646 | } | |
12647 | } // end of if(...) | |
12648 | } // end of { | |
12649 | f5pCumulants->SetBinContent(66,f5pCorrelations->GetBinContent(66)-2.*f3pCorrelations->GetBinContent(9)*f2pCorrelations->GetBinContent(4)); | |
12650 | { | |
12651 | Double_t dSumWLinearTwo4n4n = 0.; // sum of linear event weights for <2> | |
12652 | Double_t dSumWQuadraticTwo4n4n = 0.; // sum of quadratic event weights <2> | |
12653 | Double_t dSpreadTwo4n4n = 0.; // weighted and biased estimator for sigma of <2> | |
12654 | Double_t dSumWLinearThree6n4n2n = 0.; // sum of linear event weights for <2> | |
12655 | Double_t dSumWQuadraticThree6n4n2n = 0.; // sum of quadratic event weights <2> | |
12656 | Double_t dSpreadThree6n4n2n = 0.; // weighted and biased estimator for sigma of <2> | |
12657 | Double_t dSumWLinearFive6n4n4n4n2n = 0.; // sum of linear event weights for <4> | |
12658 | Double_t dSumWQuadraticFive6n4n4n4n2n = 0.; // sum of quadratic event weights <4> | |
12659 | Double_t dSpreadFive6n4n4n4n2n = 0.; // weighted and biased estimator for sigma of <4> | |
12660 | dSumWLinearTwo4n4n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
12661 | dSumWQuadraticTwo4n4n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
12662 | dSpreadTwo4n4n = f2pCorrelations->GetBinError(4); | |
12663 | dSumWLinearThree6n4n2n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
12664 | dSumWQuadraticThree6n4n2n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
12665 | dSpreadThree6n4n2n = f3pCorrelations->GetBinError(9); | |
12666 | dSumWLinearFive6n4n4n4n2n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12667 | dSumWQuadraticFive6n4n4n4n2n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12668 | dSpreadFive6n4n4n4n2n = f5pCorrelations->GetBinError(66); | |
12669 | if(pow(dSumWLinearTwo4n4n,2.)>dSumWQuadraticTwo4n4n && | |
12670 | pow(dSumWLinearThree6n4n2n,2.)>dSumWQuadraticThree6n4n2n && | |
12671 | pow(dSumWLinearFive6n4n4n4n2n,2.)>dSumWQuadraticFive6n4n4n4n2n) | |
12672 | { | |
12673 | Double_t dError = 4.*pow(f3pCorrelations->GetBinContent(9),2.) | |
12674 | * pow((pow(dSumWQuadraticTwo4n4n,0.5)/dSumWLinearTwo4n4n) | |
12675 | * dSpreadTwo4n4n*pow(pow(dSumWLinearTwo4n4n,2.)/(pow(dSumWLinearTwo4n4n,2.)-dSumWQuadraticTwo4n4n),0.5),2.) | |
12676 | + 4.*pow(f2pCorrelations->GetBinContent(4),2.) | |
12677 | * pow((pow(dSumWQuadraticThree6n4n2n,0.5)/dSumWLinearThree6n4n2n) | |
12678 | * dSpreadThree6n4n2n*pow(pow(dSumWLinearThree6n4n2n,2.)/(pow(dSumWLinearThree6n4n2n,2.)-dSumWQuadraticThree6n4n2n),0.5),2.) | |
12679 | + pow((pow(dSumWQuadraticFive6n4n4n4n2n,0.5)/dSumWLinearFive6n4n4n4n2n) | |
12680 | * dSpreadFive6n4n4n4n2n*pow(pow(dSumWLinearFive6n4n4n4n2n,2.)/(pow(dSumWLinearFive6n4n4n4n2n,2.)-dSumWQuadraticFive6n4n4n4n2n),0.5),2.) | |
12681 | + 4.*2.*f3pCorrelations->GetBinContent(9)*f2pCorrelations->GetBinContent(4) | |
12682 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
12683 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,14)) | |
12684 | - f2pCorrelations->GetBinContent(4)*f3pCorrelations->GetBinContent(9)) | |
12685 | / (dSumWLinearTwo4n4n*dSumWLinearThree6n4n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
12686 | - 2.*2.*f3pCorrelations->GetBinContent(9) | |
12687 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
12688 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(4,120)) | |
12689 | - f2pCorrelations->GetBinContent(4)*f5pCorrelations->GetBinContent(66)) | |
12690 | / (dSumWLinearTwo4n4n*dSumWLinearFive6n4n4n4n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
12691 | - 2.*2.*f2pCorrelations->GetBinContent(4) | |
12692 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
12693 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(14,120)) | |
12694 | - f3pCorrelations->GetBinContent(9)*f5pCorrelations->GetBinContent(66)) | |
12695 | / (dSumWLinearThree6n4n2n*dSumWLinearFive6n4n4n4n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
12696 | if(dError>0.) | |
12697 | { | |
12698 | f5pCumulants->SetBinError(66,pow(dError,0.5)); | |
12699 | } | |
12700 | } // end of if(...) | |
12701 | } // end of { | |
12702 | f5pCumulants->SetBinContent(67,f5pCorrelations->GetBinContent(67)); | |
12703 | { | |
12704 | Double_t dSumWLinear = 0.; // sum of linear event weights | |
12705 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
12706 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
12707 | Double_t dError = 0.; // weighted and unbiased estimator for sigma | |
12708 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12709 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12710 | dSpread = f5pCorrelations->GetBinError(67); | |
12711 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12712 | { | |
12713 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
12714 | f5pCumulants->SetBinError(67,dError); | |
12715 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12716 | } | |
e1d101a6 | 12717 | f5pCumulants->SetBinContent(68,f5pCorrelations->GetBinContent(68)-2.*f3pCorrelations->GetBinContent(10)*f2pCorrelations->GetBinContent(5)); |
c10259fb | 12718 | { |
12719 | Double_t dSumWLinearTwo5n5n = 0.; // sum of linear event weights for <2> | |
12720 | Double_t dSumWQuadraticTwo5n5n = 0.; // sum of quadratic event weights <2> | |
12721 | Double_t dSpreadTwo5n5n = 0.; // weighted and biased estimator for sigma of <2> | |
12722 | Double_t dSumWLinearThree6n5n1n = 0.; // sum of linear event weights for <2> | |
12723 | Double_t dSumWQuadraticThree6n5n1n = 0.; // sum of quadratic event weights <2> | |
12724 | Double_t dSpreadThree6n5n1n = 0.; // weighted and biased estimator for sigma of <2> | |
12725 | Double_t dSumWLinearFive6n5n5n5n1n = 0.; // sum of linear event weights for <4> | |
12726 | Double_t dSumWQuadraticFive6n5n5n5n1n = 0.; // sum of quadratic event weights <4> | |
12727 | Double_t dSpreadFive6n5n5n5n1n = 0.; // weighted and biased estimator for sigma of <4> | |
12728 | dSumWLinearTwo5n5n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
12729 | dSumWQuadraticTwo5n5n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
12730 | dSpreadTwo5n5n = f2pCorrelations->GetBinError(5); | |
12731 | dSumWLinearThree6n5n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
12732 | dSumWQuadraticThree6n5n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
12733 | dSpreadThree6n5n1n = f3pCorrelations->GetBinError(10); | |
12734 | dSumWLinearFive6n5n5n5n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12735 | dSumWQuadraticFive6n5n5n5n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12736 | dSpreadFive6n5n5n5n1n = f5pCorrelations->GetBinError(68); | |
12737 | if(pow(dSumWLinearTwo5n5n,2.)>dSumWQuadraticTwo5n5n && | |
12738 | pow(dSumWLinearThree6n5n1n,2.)>dSumWQuadraticThree6n5n1n && | |
12739 | pow(dSumWLinearFive6n5n5n5n1n,2.)>dSumWQuadraticFive6n5n5n5n1n) | |
12740 | { | |
12741 | Double_t dError = 4.*pow(f3pCorrelations->GetBinContent(10),2.) | |
12742 | * pow((pow(dSumWQuadraticTwo5n5n,0.5)/dSumWLinearTwo5n5n) | |
12743 | * dSpreadTwo5n5n*pow(pow(dSumWLinearTwo5n5n,2.)/(pow(dSumWLinearTwo5n5n,2.)-dSumWQuadraticTwo5n5n),0.5),2.) | |
12744 | + 4.*pow(f2pCorrelations->GetBinContent(5),2.) | |
12745 | * pow((pow(dSumWQuadraticThree6n5n1n,0.5)/dSumWLinearThree6n5n1n) | |
12746 | * dSpreadThree6n5n1n*pow(pow(dSumWLinearThree6n5n1n,2.)/(pow(dSumWLinearThree6n5n1n,2.)-dSumWQuadraticThree6n5n1n),0.5),2.) | |
12747 | + pow((pow(dSumWQuadraticFive6n5n5n5n1n,0.5)/dSumWLinearFive6n5n5n5n1n) | |
12748 | * dSpreadFive6n5n5n5n1n*pow(pow(dSumWLinearFive6n5n5n5n1n,2.)/(pow(dSumWLinearFive6n5n5n5n1n,2.)-dSumWQuadraticFive6n5n5n5n1n),0.5),2.) | |
12749 | + 4.*2.*f3pCorrelations->GetBinContent(10)*f2pCorrelations->GetBinContent(5) | |
12750 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
12751 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,15)) | |
12752 | - f2pCorrelations->GetBinContent(5)*f3pCorrelations->GetBinContent(10)) | |
12753 | / (dSumWLinearTwo5n5n*dSumWLinearThree6n5n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
12754 | - 2.*2.*f3pCorrelations->GetBinContent(10) | |
12755 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
12756 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(5,122)) | |
12757 | - f2pCorrelations->GetBinContent(5)*f5pCorrelations->GetBinContent(68)) | |
12758 | / (dSumWLinearTwo5n5n*dSumWLinearFive6n5n5n5n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
12759 | - 2.*2.*f2pCorrelations->GetBinContent(5) | |
12760 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
12761 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(15,122)) | |
12762 | - f3pCorrelations->GetBinContent(10)*f5pCorrelations->GetBinContent(68)) | |
12763 | / (dSumWLinearThree6n5n1n*dSumWLinearFive6n5n5n5n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
12764 | if(dError>0.) | |
12765 | { | |
12766 | f5pCumulants->SetBinError(68,pow(dError,0.5)); | |
12767 | } | |
12768 | } // end of if(...) | |
12769 | } // end of { | |
12770 | f5pCumulants->SetBinContent(69,f5pCorrelations->GetBinContent(69)); | |
12771 | { | |
12772 | Double_t dSumWLinear = 0.; // sum of linear event weights | |
12773 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
12774 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
12775 | Double_t dError = 0.; // weighted and unbiased estimator for sigma | |
12776 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12777 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12778 | dSpread = f5pCorrelations->GetBinError(69); | |
12779 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12780 | { | |
12781 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
12782 | f5pCumulants->SetBinError(69,dError); | |
12783 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12784 | } | |
e1d101a6 | 12785 | f5pCumulants->SetBinContent(70,f5pCorrelations->GetBinContent(70)-2.*f3pCorrelations->GetBinContent(9)*f2pCorrelations->GetBinContent(6)); |
c10259fb | 12786 | { |
12787 | Double_t dSumWLinearTwo6n6n = 0.; // sum of linear event weights for <2> | |
12788 | Double_t dSumWQuadraticTwo6n6n = 0.; // sum of quadratic event weights <2> | |
12789 | Double_t dSpreadTwo6n6n = 0.; // weighted and biased estimator for sigma of <2> | |
12790 | Double_t dSumWLinearThree6n4n2n = 0.; // sum of linear event weights for <2> | |
12791 | Double_t dSumWQuadraticThree6n4n2n = 0.; // sum of quadratic event weights <2> | |
12792 | Double_t dSpreadThree6n4n2n = 0.; // weighted and biased estimator for sigma of <2> | |
12793 | Double_t dSumWLinearFive6n6n6n4n2n = 0.; // sum of linear event weights for <4> | |
12794 | Double_t dSumWQuadraticFive6n6n6n4n2n = 0.; // sum of quadratic event weights <4> | |
12795 | Double_t dSpreadFive6n6n6n4n2n = 0.; // weighted and biased estimator for sigma of <4> | |
12796 | dSumWLinearTwo6n6n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
12797 | dSumWQuadraticTwo6n6n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
12798 | dSpreadTwo6n6n = f2pCorrelations->GetBinError(6); | |
12799 | dSumWLinearThree6n4n2n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
12800 | dSumWQuadraticThree6n4n2n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
12801 | dSpreadThree6n4n2n = f3pCorrelations->GetBinError(9); | |
12802 | dSumWLinearFive6n6n6n4n2n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12803 | dSumWQuadraticFive6n6n6n4n2n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12804 | dSpreadFive6n6n6n4n2n = f5pCorrelations->GetBinError(70); | |
12805 | if(pow(dSumWLinearTwo6n6n,2.)>dSumWQuadraticTwo6n6n && | |
12806 | pow(dSumWLinearThree6n4n2n,2.)>dSumWQuadraticThree6n4n2n && | |
12807 | pow(dSumWLinearFive6n6n6n4n2n,2.)>dSumWQuadraticFive6n6n6n4n2n) | |
12808 | { | |
12809 | Double_t dError = 4.*pow(f3pCorrelations->GetBinContent(9),2.) | |
12810 | * pow((pow(dSumWQuadraticTwo6n6n,0.5)/dSumWLinearTwo6n6n) | |
12811 | * dSpreadTwo6n6n*pow(pow(dSumWLinearTwo6n6n,2.)/(pow(dSumWLinearTwo6n6n,2.)-dSumWQuadraticTwo6n6n),0.5),2.) | |
12812 | + 4.*pow(f2pCorrelations->GetBinContent(6),2.) | |
12813 | * pow((pow(dSumWQuadraticThree6n4n2n,0.5)/dSumWLinearThree6n4n2n) | |
12814 | * dSpreadThree6n4n2n*pow(pow(dSumWLinearThree6n4n2n,2.)/(pow(dSumWLinearThree6n4n2n,2.)-dSumWQuadraticThree6n4n2n),0.5),2.) | |
12815 | + pow((pow(dSumWQuadraticFive6n6n6n4n2n,0.5)/dSumWLinearFive6n6n6n4n2n) | |
12816 | * dSpreadFive6n6n6n4n2n*pow(pow(dSumWLinearFive6n6n6n4n2n,2.)/(pow(dSumWLinearFive6n6n6n4n2n,2.)-dSumWQuadraticFive6n6n6n4n2n),0.5),2.) | |
12817 | + 4.*2.*f3pCorrelations->GetBinContent(9)*f2pCorrelations->GetBinContent(6) | |
12818 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
12819 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,14)) | |
12820 | - f2pCorrelations->GetBinContent(6)*f3pCorrelations->GetBinContent(9)) | |
12821 | / (dSumWLinearTwo6n6n*dSumWLinearThree6n4n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
12822 | - 2.*2.*f3pCorrelations->GetBinContent(9) | |
12823 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
12824 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,124)) | |
12825 | - f2pCorrelations->GetBinContent(6)*f5pCorrelations->GetBinContent(70)) | |
12826 | / (dSumWLinearTwo6n6n*dSumWLinearFive6n6n6n4n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
12827 | - 2.*2.*f2pCorrelations->GetBinContent(6) | |
12828 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
12829 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(14,124)) | |
12830 | - f3pCorrelations->GetBinContent(9)*f5pCorrelations->GetBinContent(70)) | |
12831 | / (dSumWLinearThree6n4n2n*dSumWLinearFive6n6n6n4n2n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
12832 | if(dError>0.) | |
12833 | { | |
12834 | f5pCumulants->SetBinError(70,pow(dError,0.5)); | |
12835 | } | |
12836 | } // end of if(...) | |
12837 | } // end of { | |
12838 | ||
12839 | ||
12840 | ||
12841 | ||
12842 | ||
e1d101a6 | 12843 | f5pCumulants->SetBinContent(71,f5pCorrelations->GetBinContent(71)-2.*f3pCorrelations->GetBinContent(10)*f2pCorrelations->GetBinContent(6)); |
c10259fb | 12844 | { |
12845 | Double_t dSumWLinearTwo6n6n = 0.; // sum of linear event weights for <2> | |
12846 | Double_t dSumWQuadraticTwo6n6n = 0.; // sum of quadratic event weights <2> | |
12847 | Double_t dSpreadTwo6n6n = 0.; // weighted and biased estimator for sigma of <2> | |
12848 | Double_t dSumWLinearThree6n5n1n = 0.; // sum of linear event weights for <2> | |
12849 | Double_t dSumWQuadraticThree6n5n1n = 0.; // sum of quadratic event weights <2> | |
12850 | Double_t dSpreadThree6n5n1n = 0.; // weighted and biased estimator for sigma of <2> | |
12851 | Double_t dSumWLinearFive6n6n6n5n1n = 0.; // sum of linear event weights for <4> | |
12852 | Double_t dSumWQuadraticFive6n6n6n5n1n = 0.; // sum of quadratic event weights <4> | |
12853 | Double_t dSpreadFive6n6n6n5n1n = 0.; // weighted and biased estimator for sigma of <4> | |
12854 | dSumWLinearTwo6n6n = fMixedHarmonicEventWeights[0]->GetBinContent(2); | |
12855 | dSumWQuadraticTwo6n6n = fMixedHarmonicEventWeights[1]->GetBinContent(2); | |
12856 | dSpreadTwo6n6n = f2pCorrelations->GetBinError(6); | |
12857 | dSumWLinearThree6n5n1n = fMixedHarmonicEventWeights[0]->GetBinContent(3); | |
12858 | dSumWQuadraticThree6n5n1n = fMixedHarmonicEventWeights[1]->GetBinContent(3); | |
12859 | dSpreadThree6n5n1n = f3pCorrelations->GetBinError(10); | |
12860 | dSumWLinearFive6n6n6n5n1n = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12861 | dSumWQuadraticFive6n6n6n5n1n = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12862 | dSpreadFive6n6n6n5n1n = f5pCorrelations->GetBinError(71); | |
12863 | if(pow(dSumWLinearTwo6n6n,2.)>dSumWQuadraticTwo6n6n && | |
12864 | pow(dSumWLinearThree6n5n1n,2.)>dSumWQuadraticThree6n5n1n && | |
12865 | pow(dSumWLinearFive6n6n6n5n1n,2.)>dSumWQuadraticFive6n6n6n5n1n) | |
12866 | { | |
12867 | Double_t dError = 4.*pow(f3pCorrelations->GetBinContent(10),2.) | |
12868 | * pow((pow(dSumWQuadraticTwo6n6n,0.5)/dSumWLinearTwo6n6n) | |
12869 | * dSpreadTwo6n6n*pow(pow(dSumWLinearTwo6n6n,2.)/(pow(dSumWLinearTwo6n6n,2.)-dSumWQuadraticTwo6n6n),0.5),2.) | |
12870 | + 4.*pow(f2pCorrelations->GetBinContent(6),2.) | |
12871 | * pow((pow(dSumWQuadraticThree6n5n1n,0.5)/dSumWLinearThree6n5n1n) | |
12872 | * dSpreadThree6n5n1n*pow(pow(dSumWLinearThree6n5n1n,2.)/(pow(dSumWLinearThree6n5n1n,2.)-dSumWQuadraticThree6n5n1n),0.5),2.) | |
12873 | + pow((pow(dSumWQuadraticFive6n6n6n5n1n,0.5)/dSumWLinearFive6n6n6n5n1n) | |
12874 | * dSpreadFive6n6n6n5n1n*pow(pow(dSumWLinearFive6n6n6n5n1n,2.)/(pow(dSumWLinearFive6n6n6n5n1n,2.)-dSumWQuadraticFive6n6n6n5n1n),0.5),2.) | |
12875 | + 4.*2.*f3pCorrelations->GetBinContent(10)*f2pCorrelations->GetBinContent(6) | |
12876 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3)) | |
12877 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,15)) | |
12878 | - f2pCorrelations->GetBinContent(6)*f3pCorrelations->GetBinContent(10)) | |
12879 | / (dSumWLinearTwo6n6n*dSumWLinearThree6n5n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,3))) | |
12880 | - 2.*2.*f3pCorrelations->GetBinContent(10) | |
12881 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5)) | |
12882 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(6,125)) | |
12883 | - f2pCorrelations->GetBinContent(6)*f5pCorrelations->GetBinContent(71)) | |
12884 | / (dSumWLinearTwo6n6n*dSumWLinearFive6n6n6n5n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(2,5))) | |
12885 | - 2.*2.*f2pCorrelations->GetBinContent(6) | |
12886 | * fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5)) | |
12887 | * (fMixedHarmonicProductOfCorrelations->GetBinContent(fMixedHarmonicProductOfCorrelations->GetBin(15,125)) | |
12888 | - f3pCorrelations->GetBinContent(10)*f5pCorrelations->GetBinContent(71)) | |
12889 | / (dSumWLinearThree6n5n1n*dSumWLinearFive6n6n6n5n1n-fMixedHarmonicProductOfEventWeights->GetBinContent(fMixedHarmonicProductOfEventWeights->GetBin(3,5))); | |
12890 | if(dError>0.) | |
12891 | { | |
12892 | f5pCumulants->SetBinError(71,pow(dError,0.5)); | |
12893 | } | |
12894 | } // end of if(...) | |
12895 | } // end of { | |
e1d101a6 | 12896 | // d3) "Four distinct harmonics": |
12897 | for(Int_t b=73;b<=83;b++) | |
12898 | { | |
12899 | f5pCumulants->SetBinContent(b,f5pCorrelations->GetBinContent(b)); | |
c10259fb | 12900 | Double_t dSumWLinear = 0.; // sum of linear event weights |
12901 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
12902 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
12903 | Double_t dError = 0.; // weighted and unbiased estimator for sigma | |
12904 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12905 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12906 | dSpread = f5pCorrelations->GetBinError(b); | |
12907 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12908 | { | |
12909 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
12910 | f5pCumulants->SetBinError(b,dError); | |
12911 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
e1d101a6 | 12912 | } // end of for(Int_t b=73;b<=83;b++) |
12913 | // d4) "Five distinct harmonics": | |
12914 | for(Int_t b=85;b<=87;b++) | |
12915 | { | |
12916 | f5pCumulants->SetBinContent(b,f5pCorrelations->GetBinContent(b)); | |
c10259fb | 12917 | Double_t dSumWLinear = 0.; // sum of linear event weights |
12918 | Double_t dSumWQuadratic = 0.; // sum of quadratic event weights | |
12919 | Double_t dSpread = 0.; // weighted and biased estimator for sigma | |
12920 | Double_t dError = 0.; // weighted and unbiased estimator for sigma | |
12921 | dSumWLinear = fMixedHarmonicEventWeights[0]->GetBinContent(5); | |
12922 | dSumWQuadratic = fMixedHarmonicEventWeights[1]->GetBinContent(5); | |
12923 | dSpread = f5pCorrelations->GetBinError(b); | |
12924 | if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
12925 | { | |
12926 | dError = (pow(dSumWQuadratic,0.5)/dSumWLinear)*dSpread*pow(pow(dSumWLinear,2.)/(pow(dSumWLinear,2.)-dSumWQuadratic),0.5); | |
12927 | f5pCumulants->SetBinError(b,dError); | |
12928 | } // end of if(pow(dSumWLinear,2.)>dSumWQuadratic) | |
e1d101a6 | 12929 | } // end of for(Int_t b=85;b<=87;b++) |
12930 | ||
12931 | } // end of void AliFlowAnalysisWithQCumulants::CalculateCumulantsMixedHarmonics() | |
12932 | ||
12933 | //=================================================================================================================== | |
489d5531 | 12934 | |
e5834fcb | 12935 | void AliFlowAnalysisWithQCumulants::StorePhiDistributionForOneEvent(AliFlowEventSimple *anEvent) |
12936 | { | |
12937 | // Store phi distribution for one event to illustrate flow. | |
12938 | ||
12939 | if(fPhiDistributionForOneEvent->GetEntries()>0){return;} // store only phi distribution for one event | |
12940 | ||
12941 | Double_t vMin = fPhiDistributionForOneEventSettings[0]; | |
12942 | Double_t vMax = fPhiDistributionForOneEventSettings[1]; | |
12943 | Double_t refMultMin = fPhiDistributionForOneEventSettings[2]; | |
12944 | Double_t refMultMax = fPhiDistributionForOneEventSettings[3]; | |
12945 | ||
12946 | Double_t vEBE = 0.; | |
12947 | Double_t cumulant4thEBE = fIntFlowCorrelationsEBE->GetBinContent(2)-2.*pow(fIntFlowCorrelationsEBE->GetBinContent(1),2.); | |
12948 | if(cumulant4thEBE<0.) | |
12949 | { | |
12950 | vEBE = pow(-1.*cumulant4thEBE,0.25); | |
12951 | if((vEBE>vMin && vEBE<vMax) && (fReferenceMultiplicityEBE>refMultMin && fReferenceMultiplicityEBE<refMultMax)) | |
12952 | { | |
3958eee6 | 12953 | fPhiDistributionForOneEvent->SetTitle(Form("v_{%i} = %f",fHarmonic,vEBE)); |
e5834fcb | 12954 | for(Int_t p=0;p<anEvent->NumberOfTracks();p++) |
12955 | { | |
12956 | if(anEvent->GetTrack(p)->InRPSelection()) | |
12957 | { | |
12958 | fPhiDistributionForOneEvent->Fill(anEvent->GetTrack(p)->Phi()); | |
12959 | } | |
12960 | } // end of for(Int_t p=0;p<anEvent->NumberOfTracks();p++) | |
3958eee6 | 12961 | } else |
12962 | { | |
12963 | fPhiDistributionForOneEvent->SetTitle(Form("v_{%i} = %f, out of specified boundaries",fHarmonic,vEBE)); | |
12964 | } | |
12965 | ||
e5834fcb | 12966 | } // end of if(cumulant4thEBE<0.) |
12967 | ||
12968 | } // end of void AliFlowAnalysisWithQCumulants::StorePhiDistributionForOneEvent(AliFlowEventSimple *anEvent) | |
12969 | ||
e1d101a6 | 12970 | //=================================================================================================================== |
489d5531 | 12971 | |
12972 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrelations() | |
12973 | { | |
0328db2d | 12974 | // Calculate averages of products of correlations for integrated flow. |
df23c5ae | 12975 | |
3842bdcd | 12976 | // Multiplicity bin of an event (relevant for all histos vs M): |
12977 | Double_t dMultiplicityBin = 0.; | |
df23c5ae | 12978 | if(fMultiplicityIs==AliFlowCommonConstants::kRP) |
3842bdcd | 12979 | { |
df23c5ae | 12980 | dMultiplicityBin = fNumberOfRPsEBE+0.5; |
12981 | } else if(fMultiplicityIs==AliFlowCommonConstants::kExternal) | |
3842bdcd | 12982 | { |
12983 | dMultiplicityBin = fReferenceMultiplicityEBE+0.5; | |
df23c5ae | 12984 | } else if(fMultiplicityIs==AliFlowCommonConstants::kPOI) |
12985 | { | |
12986 | dMultiplicityBin = fNumberOfPOIsEBE+0.5; | |
12987 | } | |
3842bdcd | 12988 | |
489d5531 | 12989 | Int_t counter = 0; |
12990 | ||
12991 | for(Int_t ci1=1;ci1<4;ci1++) | |
12992 | { | |
12993 | for(Int_t ci2=ci1+1;ci2<=4;ci2++) | |
12994 | { | |
ff70ca91 | 12995 | fIntFlowProductOfCorrelationsPro->Fill(0.5+counter, |
12996 | fIntFlowCorrelationsEBE->GetBinContent(ci1)* | |
12997 | fIntFlowCorrelationsEBE->GetBinContent(ci2), | |
12998 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
12999 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); | |
13000 | // products versus multiplicity: // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>] | |
b3dacf6b | 13001 | if(fCalculateCumulantsVsM) |
13002 | { | |
1db7eced | 13003 | if(fFillProfilesVsMUsingWeights) |
13004 | { | |
13005 | fIntFlowProductOfCorrelationsVsMPro[counter]->Fill(dMultiplicityBin, // to be improved: dMult => sum of weights ? | |
13006 | fIntFlowCorrelationsEBE->GetBinContent(ci1)* | |
13007 | fIntFlowCorrelationsEBE->GetBinContent(ci2), | |
13008 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
13009 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); | |
13010 | } else | |
13011 | { | |
13012 | fIntFlowProductOfCorrelationsVsMPro[counter]->Fill(dMultiplicityBin, // to be improved: dMult => sum of weights ? | |
13013 | fIntFlowCorrelationsEBE->GetBinContent(ci1)* | |
13014 | fIntFlowCorrelationsEBE->GetBinContent(ci2)); | |
13015 | } | |
b3dacf6b | 13016 | } // end of if(fCalculateCumulantsVsM) |
ff70ca91 | 13017 | counter++; |
489d5531 | 13018 | } |
13019 | } | |
13020 | ||
13021 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrelations() | |
13022 | ||
13023 | ||
e1d101a6 | 13024 | //======================================================================================================================= |
489d5531 | 13025 | |
13026 | ||
0328db2d | 13027 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrectionTermsForNUA() |
13028 | { | |
13029 | // Calculate averages of products of correction terms for NUA. | |
13030 | ||
13031 | // a) Binning of fIntFlowProductOfCorrectionTermsForNUAPro is organized as follows: | |
13032 | // 1st bin: <<2><cos(phi)>> | |
13033 | // 2nd bin: <<2><sin(phi)>> | |
13034 | // 3rd bin: <<cos(phi)><sin(phi)>> | |
13035 | // 4th bin: <<2><cos(phi1+phi2)>> | |
13036 | // 5th bin: <<2><sin(phi1+phi2)>> | |
13037 | // 6th bin: <<2><cos(phi1-phi2-phi3)>> | |
13038 | // 7th bin: <<2><sin(phi1-phi2-phi3)>> | |
13039 | // 8th bin: <<4><cos(phi1)>> | |
13040 | // 9th bin: <<4><sin(phi1)>> | |
13041 | // 10th bin: <<4><cos(phi1+phi2)>> | |
13042 | // 11th bin: <<4><sin(phi1+phi2)>> | |
13043 | // 12th bin: <<4><cos(phi1-phi2-phi3)>> | |
13044 | // 13th bin: <<4><sin(phi1-phi2-phi3)>> | |
13045 | // 14th bin: <<cos(phi1)><cos(phi1+phi2)>> | |
13046 | // 15th bin: <<cos(phi1)><sin(phi1+phi2)>> | |
13047 | // 16th bin: <<cos(phi1)><cos(phi1-phi2-phi3)>> | |
13048 | // 17th bin: <<cos(phi1)><sin(phi1-phi2-phi3)>> | |
13049 | // 18th bin: <<sin(phi1)><cos(phi1+phi2)>> | |
13050 | // 19th bin: <<sin(phi1)><sin(phi1+phi2)>> | |
13051 | // 20th bin: <<sin(phi1)><cos(phi1-phi2-phi3)>> | |
13052 | // 21st bin: <<sin(phi1)><sin(phi1-phi2-phi3)>> | |
13053 | // 22nd bin: <<cos(phi1+phi2)><sin(phi1+phi2)>> | |
13054 | // 23rd bin: <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
13055 | // 24th bin: <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
13056 | // 25th bin: <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
13057 | // 26th bin: <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
13058 | // 27th bin: <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>> | |
13059 | ||
13060 | // <<2><cos(phi)>>: | |
13061 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(0.5, | |
13062 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1), | |
13063 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
13064 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
13065 | // <<2><sin(phi)>>: | |
13066 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(1.5, | |
13067 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1), | |
13068 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
13069 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
13070 | // <<cos(phi)><sin(phi)>>: | |
13071 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(2.5, | |
13072 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1), | |
13073 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
13074 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
13075 | // <<2><cos(phi1+phi2)>>: | |
13076 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(3.5, | |
13077 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
13078 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
13079 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
13080 | // <<2><sin(phi1+phi2)>>: | |
13081 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(4.5, | |
13082 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
13083 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
13084 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
13085 | // <<2><cos(phi1-phi2-phi3)>>: | |
13086 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(5.5, | |
13087 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
13088 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
13089 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
13090 | // <<2><sin(phi1-phi2-phi3)>>: | |
13091 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(6.5, | |
13092 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
13093 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
13094 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
13095 | // <<4><cos(phi1)>>: | |
13096 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(7.5, | |
13097 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1), | |
13098 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
13099 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
13100 | // <<4><sin(phi1)>>: | |
13101 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(8.5, | |
13102 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1), | |
13103 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
13104 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
13105 | // <<4><cos(phi1+phi2)>>: | |
13106 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(9.5, | |
13107 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
13108 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
13109 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
13110 | // <<4><sin(phi1+phi2)>>: | |
13111 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(10.5, | |
13112 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
13113 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
13114 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
13115 | // <<4><cos(phi1-phi2-phi3)>>: | |
13116 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(11.5, | |
13117 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
13118 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
13119 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
13120 | // <<4><sin(phi1-phi2-phi3)>>: | |
13121 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(12.5, | |
13122 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
13123 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
13124 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
13125 | // <<cos(phi1)><cos(phi1+phi2)>>: | |
13126 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(13.5, | |
13127 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
13128 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
13129 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
13130 | // <<cos(phi1)><sin(phi1+phi2)>>: | |
13131 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(14.5, | |
13132 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
13133 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
13134 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
13135 | // <<cos(phi1)><cos(phi1-phi2-phi3)>>: | |
13136 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(15.5, | |
13137 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
13138 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
13139 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
13140 | // <<cos(phi1)><sin(phi1-phi2-phi3)>>: | |
13141 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(16.5, | |
13142 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
13143 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
13144 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
13145 | // <<sin(phi1)><cos(phi1+phi2)>>: | |
13146 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(17.5, | |
13147 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
13148 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
13149 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
13150 | // <<sin(phi1)><sin(phi1+phi2)>>: | |
13151 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(18.5, | |
13152 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
13153 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
13154 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
13155 | // <<sin(phi1)><cos(phi1-phi2-phi3)>>: | |
13156 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(19.5, | |
13157 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
13158 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
13159 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
13160 | // <<sin(phi1)><sin(phi1-phi2-phi3)>>: | |
13161 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(20.5, | |
13162 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
13163 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
13164 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
13165 | // <<cos(phi1+phi2)><sin(phi1+phi2)>>: | |
13166 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(21.5, | |
13167 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
13168 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2) | |
13169 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
13170 | // <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>>: | |
13171 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(22.5, | |
13172 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
13173 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2) | |
13174 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
13175 | // <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>>: | |
13176 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(23.5, | |
13177 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
13178 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2) | |
13179 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
13180 | // <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>>: | |
13181 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(24.5, | |
13182 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
13183 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2) | |
13184 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
13185 | // <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>>: | |
13186 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(25.5, | |
13187 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
13188 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2) | |
13189 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
13190 | // <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>>: | |
13191 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(26.5, | |
13192 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
13193 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3) | |
13194 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
13195 | ||
13196 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrectionTermsForNUA() | |
13197 | ||
e1d101a6 | 13198 | //======================================================================================================================= |
0328db2d | 13199 | |
489d5531 | 13200 | void AliFlowAnalysisWithQCumulants::CalculateCovariancesIntFlow() |
13201 | { | |
13202 | // a) Calculate unbiased estimators Cov(<2>,<4>), Cov(<2>,<6>), Cov(<2>,<8>), Cov(<4>,<6>), Cov(<4>,<8>) and Cov(<6>,<8>) | |
13203 | // for covariances V_(<2>,<4>), V_(<2>,<6>), V_(<2>,<8>), V_(<4>,<6>), V_(<4>,<8>) and V_(<6>,<8>). | |
13204 | // b) Store in histogram fIntFlowCovariances for instance the following: | |
13205 | // | |
13206 | // Cov(<2>,<4>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4>}_j)] | |
13207 | // | |
13208 | // where N is the number of events, w_{<2>} is event weight for <2> and w_{<4>} is event weight for <4>. | |
13209 | // c) Binning of fIntFlowCovariances is organized as follows: | |
13210 | // | |
13211 | // 1st bin: Cov(<2>,<4>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4>}_j)] | |
13212 | // 2nd bin: Cov(<2>,<6>) * (sum_{i=1}^{N} w_{<2>}_i w_{<6>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<6>}_j)] | |
13213 | // 3rd bin: Cov(<2>,<8>) * (sum_{i=1}^{N} w_{<2>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<8>}_j)] | |
13214 | // 4th bin: Cov(<4>,<6>) * (sum_{i=1}^{N} w_{<4>}_i w_{<6>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<6>}_j)] | |
13215 | // 5th bin: Cov(<4>,<8>) * (sum_{i=1}^{N} w_{<4>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<8>}_j)] | |
13216 | // 6th bin: Cov(<6>,<8>) * (sum_{i=1}^{N} w_{<6>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<6>}_i) * (sum_{j=1}^{N} w_{<8>}_j)] | |
b3dacf6b | 13217 | // |
489d5531 | 13218 | |
b3dacf6b | 13219 | // Average 2-, 4-, 6- and 8-particle correlations for all events: |
489d5531 | 13220 | Double_t correlation[4] = {0.}; |
13221 | for(Int_t ci=0;ci<4;ci++) | |
13222 | { | |
13223 | correlation[ci] = fIntFlowCorrelationsPro->GetBinContent(ci+1); | |
13224 | } | |
b3dacf6b | 13225 | // Average products of 2-, 4-, 6- and 8-particle correlations: |
489d5531 | 13226 | Double_t productOfCorrelations[4][4] = {{0.}}; |
13227 | Int_t productOfCorrelationsLabel = 1; | |
b3dacf6b | 13228 | // Denominators in the expressions for the unbiased estimator for covariance: |
489d5531 | 13229 | Double_t denominator[4][4] = {{0.}}; |
13230 | Int_t sumOfProductOfEventWeightsLabel1 = 1; | |
b3dacf6b | 13231 | // Weight dependent prefactor which multiply unbiased estimators for covariances: |
489d5531 | 13232 | Double_t wPrefactor[4][4] = {{0.}}; |
13233 | Int_t sumOfProductOfEventWeightsLabel2 = 1; | |
13234 | for(Int_t c1=0;c1<4;c1++) | |
13235 | { | |
13236 | for(Int_t c2=c1+1;c2<4;c2++) | |
13237 | { | |
13238 | productOfCorrelations[c1][c2] = fIntFlowProductOfCorrelationsPro->GetBinContent(productOfCorrelationsLabel); | |
b3dacf6b | 13239 | if(TMath::Abs(fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1)) > 1.e-44 && TMath::Abs(fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)) > 1.e-44) |
13240 | { | |
13241 | denominator[c1][c2] = 1.-(fIntFlowSumOfProductOfEventWeights->GetBinContent(sumOfProductOfEventWeightsLabel1)) | |
13242 | / (fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1) | |
13243 | * fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)); | |
13244 | wPrefactor[c1][c2] = fIntFlowSumOfProductOfEventWeights->GetBinContent(sumOfProductOfEventWeightsLabel2) | |
13245 | / (fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1) | |
13246 | * fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)); | |
489d5531 | 13247 | } |
b3dacf6b | 13248 | productOfCorrelationsLabel++; // to be improved - do I need here all 3 counters? |
489d5531 | 13249 | sumOfProductOfEventWeightsLabel1++; |
13250 | sumOfProductOfEventWeightsLabel2++; | |
b3dacf6b | 13251 | } // end of for(Int_t c2=c1+1;c2<4;c2++) |
13252 | } // end of for(Int_t c1=0;c1<4;c1++) | |
489d5531 | 13253 | |
489d5531 | 13254 | Int_t covarianceLabel = 1; |
13255 | for(Int_t c1=0;c1<4;c1++) | |
13256 | { | |
13257 | for(Int_t c2=c1+1;c2<4;c2++) | |
13258 | { | |
b3dacf6b | 13259 | if(TMath::Abs(denominator[c1][c2]) > 1.e-44) |
489d5531 | 13260 | { |
b3dacf6b | 13261 | // Covariances: |
489d5531 | 13262 | Double_t cov = (productOfCorrelations[c1][c2]-correlation[c1]*correlation[c2])/denominator[c1][c2]; |
b3dacf6b | 13263 | // Covariances multiplied with weight dependent prefactor: |
489d5531 | 13264 | Double_t wCov = cov * wPrefactor[c1][c2]; |
13265 | fIntFlowCovariances->SetBinContent(covarianceLabel,wCov); | |
13266 | } | |
13267 | covarianceLabel++; | |
b3dacf6b | 13268 | } // end of for(Int_t c2=c1+1;c2<4;c2++) |
13269 | } // end of for(Int_t c1=0;c1<4;c1++) | |
489d5531 | 13270 | |
b3dacf6b | 13271 | // Versus multiplicity: |
13272 | if(!fCalculateCumulantsVsM){return;} | |
9da1a4f3 | 13273 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) |
13274 | for(Int_t b=1;b<=nBins;b++) | |
13275 | { | |
b3dacf6b | 13276 | // Average 2-, 4-, 6- and 8-particle correlations for all events: |
9da1a4f3 | 13277 | Double_t correlationVsM[4] = {0.}; |
13278 | for(Int_t ci=0;ci<4;ci++) | |
13279 | { | |
13280 | correlationVsM[ci] = fIntFlowCorrelationsVsMPro[ci]->GetBinContent(b); | |
13281 | } // end of for(Int_t ci=0;ci<4;ci++) | |
b3dacf6b | 13282 | // Average products of 2-, 4-, 6- and 8-particle correlations: |
9da1a4f3 | 13283 | Double_t productOfCorrelationsVsM[4][4] = {{0.}}; |
13284 | Int_t productOfCorrelationsLabelVsM = 1; | |
b3dacf6b | 13285 | // Denominators in the expressions for the unbiased estimator for covariance: |
9da1a4f3 | 13286 | Double_t denominatorVsM[4][4] = {{0.}}; |
13287 | Int_t sumOfProductOfEventWeightsLabel1VsM = 1; | |
b3dacf6b | 13288 | // Weight dependent prefactor which multiply unbiased estimators for covariances: |
9da1a4f3 | 13289 | Double_t wPrefactorVsM[4][4] = {{0.}}; |
13290 | Int_t sumOfProductOfEventWeightsLabel2VsM = 1; | |
13291 | for(Int_t c1=0;c1<4;c1++) | |
13292 | { | |
13293 | for(Int_t c2=c1+1;c2<4;c2++) | |
13294 | { | |
1db7eced | 13295 | productOfCorrelationsVsM[c1][c2] = fIntFlowProductOfCorrelationsVsMPro[productOfCorrelationsLabelVsM-1]->GetBinContent(b); |
b3dacf6b | 13296 | if(TMath::Abs(fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b)) > 1.e-44 && TMath::Abs(fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)) > 1.e-44) |
13297 | { | |
13298 | denominatorVsM[c1][c2] = 1.-(fIntFlowSumOfProductOfEventWeightsVsM[sumOfProductOfEventWeightsLabel1VsM-1]->GetBinContent(b)) | |
13299 | / (fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b) | |
13300 | * fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)); | |
13301 | wPrefactorVsM[c1][c2] = fIntFlowSumOfProductOfEventWeightsVsM[sumOfProductOfEventWeightsLabel2VsM-1]->GetBinContent(b) | |
13302 | / (fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b) | |
13303 | * fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)); | |
9da1a4f3 | 13304 | } |
13305 | productOfCorrelationsLabelVsM++; | |
13306 | sumOfProductOfEventWeightsLabel1VsM++; | |
13307 | sumOfProductOfEventWeightsLabel2VsM++; | |
13308 | } // end of for(Int_t c1=0;c1<4;c1++) | |
13309 | } // end of for(Int_t c2=c1+1;c2<4;c2++) | |
b3dacf6b | 13310 | |
9da1a4f3 | 13311 | Int_t covarianceLabelVsM = 1; |
13312 | for(Int_t c1=0;c1<4;c1++) | |
13313 | { | |
13314 | for(Int_t c2=c1+1;c2<4;c2++) | |
13315 | { | |
b3dacf6b | 13316 | if(TMath::Abs(denominatorVsM[c1][c2]) > 1.e-44) |
9da1a4f3 | 13317 | { |
b3dacf6b | 13318 | // Covariances: |
9da1a4f3 | 13319 | Double_t covVsM = (productOfCorrelationsVsM[c1][c2]-correlationVsM[c1]*correlationVsM[c2])/denominatorVsM[c1][c2]; |
b3dacf6b | 13320 | // Covariances multiplied with weight dependent prefactor: |
9da1a4f3 | 13321 | Double_t wCovVsM = covVsM * wPrefactorVsM[c1][c2]; |
13322 | fIntFlowCovariancesVsM[covarianceLabelVsM-1]->SetBinContent(b,wCovVsM); | |
13323 | } | |
13324 | covarianceLabelVsM++; | |
b3dacf6b | 13325 | } // end of for(Int_t c2=c1+1;c2<4;c2++) |
13326 | } // end of for(Int_t c1=0;c1<4;c1++) | |
9da1a4f3 | 13327 | } // end of for(Int_t b=1;b<=nBins;b++) |
13328 | ||
489d5531 | 13329 | } // end of AliFlowAnalysisWithQCumulants::CalculateCovariancesIntFlow() |
13330 | ||
e1d101a6 | 13331 | //======================================================================================================================= |
489d5531 | 13332 | |
0328db2d | 13333 | void AliFlowAnalysisWithQCumulants::CalculateCovariancesNUAIntFlow() |
13334 | { | |
13335 | // a) Calculate unbiased estimators Cov(*,*) for true covariances V_(*,*) for NUA terms. | |
13336 | // b) Store in histogram fIntFlowCovariancesNUA for instance the following: | |
13337 | // | |
13338 | // Cov(<2>,<cos(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<cos(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<cos(phi)>}_j)] | |
13339 | // | |
13340 | // where N is the number of events, w_{<2>} is event weight for <2> and w_{<cos(phi)>} is event weight for <cos(phi)>. | |
13341 | // c) Binning of fIntFlowCovariancesNUA is organized as follows: | |
13342 | // | |
13343 | // 1st bin: Cov(<2>,<cos(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<cos(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<cos(phi)>}_j)] | |
13344 | // 2nd bin: Cov(<2>,<sin(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<sin(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<sin(phi)>}_j)] | |
13345 | // 3rd bin: Cov(<cos(phi)>,<sin(phi)>) * (sum_{i=1}^{N} w_{<cos(phi)>}_i w_{<sin(phi)>}_i )/[(sum_{i=1}^{N} w_{<cos(phi)>}_i) * (sum_{j=1}^{N} w_{<sin(phi)>}_j)] | |
13346 | // ... | |
13347 | ||
13348 | // Cov(<2>,<cos(phi)>): | |
13349 | Double_t product1 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(1); // <<2><cos(phi)>> | |
13350 | Double_t term1st1 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
13351 | Double_t term2nd1 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi)>> | |
13352 | Double_t sumOfW1st1 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
13353 | Double_t sumOfW2nd1 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi)>} | |
13354 | Double_t sumOfWW1 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(1); // W_{<2>} * W_{<cos(phi)>} | |
13355 | // numerator in the expression for the the unbiased estimator for covariance: | |
13356 | Double_t numerator1 = product1 - term1st1*term2nd1; | |
13357 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13358 | Double_t denominator1 = 0.; |
13359 | if(TMath::Abs(sumOfW1st1*sumOfW2nd1)>0.) | |
13360 | { | |
13361 | denominator1 = 1.-sumOfWW1/(sumOfW1st1*sumOfW2nd1); | |
13362 | if(TMath::Abs(denominator1)>0.) | |
13363 | { | |
13364 | // covariance: | |
13365 | Double_t covariance1 = numerator1/denominator1; | |
13366 | // weight dependent prefactor for covariance: | |
13367 | Double_t wPrefactor1 = sumOfWW1/(sumOfW1st1*sumOfW2nd1); | |
13368 | // finally, store "weighted" covariance: | |
13369 | fIntFlowCovariancesNUA->SetBinContent(1,wPrefactor1*covariance1); | |
13370 | } // end of if(TMath::Abs(denominator)>0.) | |
13371 | } // end of if(TMath::Abs(sumOfW1st1*sumOfW2nd1)>0.) | |
13372 | ||
0328db2d | 13373 | // Cov(<2>,<sin(phi)>): |
13374 | Double_t product2 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(2); // <<2><sin(phi)>> | |
13375 | Double_t term1st2 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
13376 | Double_t term2nd2 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi)>> | |
13377 | Double_t sumOfW1st2 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
13378 | Double_t sumOfW2nd2 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi)>} | |
13379 | Double_t sumOfWW2 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(2); // W_{<2>} * W_{<sin(phi)>} | |
13380 | // numerator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13381 | Double_t numerator2 = product2 - term1st2*term2nd2; |
0328db2d | 13382 | // denominator in the expression for the the unbiased estimator for covariance: |
b92ea2b9 | 13383 | Double_t denominator2 = 0.; |
13384 | if(TMath::Abs(sumOfW1st2*sumOfW2nd2)>0.) | |
13385 | { | |
13386 | denominator2 = 1.-sumOfWW2/(sumOfW1st2*sumOfW2nd2); | |
13387 | if(TMath::Abs(denominator2)>0.) | |
13388 | { | |
13389 | // covariance: | |
13390 | Double_t covariance2 = numerator2/denominator2; | |
13391 | // weight dependent prefactor for covariance: | |
13392 | Double_t wPrefactor2 = sumOfWW2/(sumOfW1st2*sumOfW2nd2); | |
13393 | // finally, store "weighted" covariance: | |
13394 | fIntFlowCovariancesNUA->SetBinContent(2,wPrefactor2*covariance2); | |
13395 | } // end of if(TMath::Abs(denominator2)>0.) | |
13396 | } // end of if(TMath::Abs(sumOfW1st2*sumOfW2nd2)>0.) | |
0328db2d | 13397 | |
13398 | // Cov(<cos(phi)>,<sin(phi)>): | |
13399 | Double_t product3 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(3); // <<cos(phi)><sin(phi)>> | |
13400 | Double_t term1st3 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi)>> | |
13401 | Double_t term2nd3 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi)>> | |
13402 | Double_t sumOfW1st3 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi)>} | |
13403 | Double_t sumOfW2nd3 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi)>} | |
13404 | Double_t sumOfWW3 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(3); // W_{<cos(phi)>} * W_{<sin(phi)>} | |
13405 | // numerator in the expression for the the unbiased estimator for covariance: | |
13406 | Double_t numerator3 = product3 - term1st3*term2nd3; | |
13407 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13408 | Double_t denominator3 = 0; |
13409 | if(TMath::Abs(sumOfW1st3*sumOfW2nd3)>0.) | |
13410 | { | |
13411 | denominator3 = 1.-sumOfWW3/(sumOfW1st3*sumOfW2nd3); | |
13412 | if(TMath::Abs(denominator3)>0.) | |
13413 | { | |
13414 | // covariance: | |
13415 | Double_t covariance3 = numerator3/denominator3; | |
13416 | // weight dependent prefactor for covariance: | |
13417 | Double_t wPrefactor3 = sumOfWW3/(sumOfW1st3*sumOfW2nd3); | |
13418 | // finally, store "weighted" covariance: | |
13419 | fIntFlowCovariancesNUA->SetBinContent(3,wPrefactor3*covariance3); | |
13420 | } // end of if(TMath::Abs(denominator3)>0.) | |
13421 | } // end of if(TMath::Abs(sumOfW1st3*sumOfW2nd3)>0.) | |
0328db2d | 13422 | |
13423 | // Cov(<2>,<cos(phi1+phi2)>): | |
13424 | Double_t product4 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(4); // <<2><cos(phi1+phi2)>> | |
13425 | Double_t term1st4 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
13426 | Double_t term2nd4 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
13427 | Double_t sumOfW1st4 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
13428 | Double_t sumOfW2nd4 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
13429 | Double_t sumOfWW4 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(4); // W_{<2>} * W_{<cos(phi1+phi2)>} | |
13430 | // numerator in the expression for the the unbiased estimator for covariance: | |
13431 | Double_t numerator4 = product4 - term1st4*term2nd4; | |
13432 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13433 | Double_t denominator4 = 0.; |
13434 | if(TMath::Abs(sumOfW1st4*sumOfW2nd4)>0.) | |
13435 | { | |
13436 | denominator4 = 1.-sumOfWW4/(sumOfW1st4*sumOfW2nd4); | |
13437 | if(TMath::Abs(denominator4)>0.) | |
13438 | { | |
13439 | // covariance: | |
13440 | Double_t covariance4 = numerator4/denominator4; | |
13441 | // weight dependent prefactor for covariance: | |
13442 | Double_t wPrefactor4 = sumOfWW4/(sumOfW1st4*sumOfW2nd4); | |
13443 | // finally, store "weighted" covariance: | |
13444 | fIntFlowCovariancesNUA->SetBinContent(4,wPrefactor4*covariance4); | |
13445 | } // end of if(TMath::Abs(denominator4)>0.) | |
13446 | } // end of if(TMath::Abs(sumOfW1st4*sumOfW2nd4)>0.) | |
13447 | ||
0328db2d | 13448 | // Cov(<2>,<sin(phi1+phi2)>): |
13449 | Double_t product5 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(5); // <<2><sin(phi1+phi2)>> | |
13450 | Double_t term1st5 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
13451 | Double_t term2nd5 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
13452 | Double_t sumOfW1st5 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
13453 | Double_t sumOfW2nd5 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
13454 | Double_t sumOfWW5 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(5); // W_{<2>} * W_{<sin(phi1+phi2)>} | |
13455 | // numerator in the expression for the the unbiased estimator for covariance: | |
13456 | Double_t numerator5 = product5 - term1st5*term2nd5; | |
13457 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13458 | Double_t denominator5 = 0.; |
13459 | if(TMath::Abs(sumOfW1st5*sumOfW2nd5)>0.) | |
13460 | { | |
13461 | denominator5 = 1.-sumOfWW5/(sumOfW1st5*sumOfW2nd5); | |
13462 | if(TMath::Abs(denominator5)>0.) | |
13463 | { | |
13464 | // covariance: | |
13465 | Double_t covariance5 = numerator5/denominator5; | |
13466 | // weight dependent prefactor for covariance: | |
13467 | Double_t wPrefactor5 = sumOfWW5/(sumOfW1st5*sumOfW2nd5); | |
13468 | // finally, store "weighted" covariance: | |
13469 | fIntFlowCovariancesNUA->SetBinContent(5,wPrefactor5*covariance5); | |
13470 | } // end of if(TMath::Abs(denominator5)>0.) | |
13471 | } // end of if(TMath::Abs(sumOfW1st5*sumOfW2nd5)>0.) | |
13472 | ||
0328db2d | 13473 | // Cov(<2>,<cos(phi1-phi2-phi3)>): |
13474 | Double_t product6 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(6); // <<2><cos(phi1-phi2-phi3)>> | |
13475 | Double_t term1st6 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
13476 | Double_t term2nd6 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
13477 | Double_t sumOfW1st6 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
13478 | Double_t sumOfW2nd6 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
13479 | Double_t sumOfWW6 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(6); // W_{<2>} * W_{<cos(phi1-phi2-phi3)>} | |
13480 | // numerator in the expression for the the unbiased estimator for covariance: | |
13481 | Double_t numerator6 = product6 - term1st6*term2nd6; | |
13482 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13483 | Double_t denominator6 = 0.; |
13484 | if(TMath::Abs(sumOfW1st6*sumOfW2nd6)>0.) | |
13485 | { | |
13486 | denominator6 = 1.-sumOfWW6/(sumOfW1st6*sumOfW2nd6); | |
13487 | if(TMath::Abs(denominator6)>0.) | |
13488 | { | |
13489 | // covariance: | |
13490 | Double_t covariance6 = numerator6/denominator6; | |
13491 | // weight dependent prefactor for covariance: | |
13492 | Double_t wPrefactor6 = sumOfWW6/(sumOfW1st6*sumOfW2nd6); | |
13493 | // finally, store "weighted" covariance: | |
13494 | fIntFlowCovariancesNUA->SetBinContent(6,wPrefactor6*covariance6); | |
13495 | } // end of if(TMath::Abs(denominator6)>0.) | |
13496 | } // end of if(TMath::Abs(sumOfW1st6*sumOfW2nd6)>0.) | |
13497 | ||
0328db2d | 13498 | // Cov(<2>,<sin(phi1-phi2-phi3)>): |
13499 | Double_t product7 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(7); // <<2><sin(phi1-phi2-phi3)>> | |
13500 | Double_t term1st7 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
13501 | Double_t term2nd7 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
13502 | Double_t sumOfW1st7 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
13503 | Double_t sumOfW2nd7 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
13504 | Double_t sumOfWW7 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(7); // W_{<2>} * W_{<sin(phi1-phi2-phi3)>} | |
13505 | // numerator in the expression for the the unbiased estimator for covariance: | |
13506 | Double_t numerator7 = product7 - term1st7*term2nd7; | |
13507 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13508 | Double_t denominator7 = 0.; |
13509 | if(TMath::Abs(sumOfW1st7*sumOfW2nd7)>0.) | |
13510 | { | |
13511 | denominator7 = 1.-sumOfWW7/(sumOfW1st7*sumOfW2nd7); | |
13512 | if(TMath::Abs(denominator7)>0.) | |
13513 | { | |
13514 | // covariance: | |
13515 | Double_t covariance7 = numerator7/denominator7; | |
13516 | // weight dependent prefactor for covariance: | |
13517 | Double_t wPrefactor7 = sumOfWW7/(sumOfW1st7*sumOfW2nd7); | |
13518 | // finally, store "weighted" covariance: | |
13519 | fIntFlowCovariancesNUA->SetBinContent(7,wPrefactor7*covariance7); | |
13520 | } // end of if(TMath::Abs(denominator7)>0.) | |
13521 | } // end of if(TMath::Abs(sumOfW1st7*sumOfW2nd7)>0.) | |
13522 | ||
0328db2d | 13523 | // Cov(<4>,<cos(phi1>): |
13524 | Double_t product8 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(8); // <<4><cos(phi1)>> | |
13525 | Double_t term1st8 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
13526 | Double_t term2nd8 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
13527 | Double_t sumOfW1st8 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
13528 | Double_t sumOfW2nd8 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
13529 | Double_t sumOfWW8 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(8); // W_{<4>} * W_{<cos(phi1)>} | |
13530 | // numerator in the expression for the the unbiased estimator for covariance: | |
13531 | Double_t numerator8 = product8 - term1st8*term2nd8; | |
13532 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13533 | Double_t denominator8 = 0.; |
13534 | if(TMath::Abs(sumOfW1st8*sumOfW2nd8)>0.) | |
13535 | { | |
13536 | denominator8 = 1.-sumOfWW8/(sumOfW1st8*sumOfW2nd8); | |
13537 | if(TMath::Abs(denominator8)>0.) | |
13538 | { | |
13539 | // covariance: | |
13540 | Double_t covariance8 = numerator8/denominator8; | |
13541 | // weight dependent prefactor for covariance: | |
13542 | Double_t wPrefactor8 = sumOfWW8/(sumOfW1st8*sumOfW2nd8); | |
13543 | // finally, store "weighted" covariance: | |
13544 | fIntFlowCovariancesNUA->SetBinContent(8,wPrefactor8*covariance8); | |
13545 | } // end of if(TMath::Abs(denominator8)>0.) | |
13546 | } // end of if(TMath::Abs(sumOfW1st8*sumOfW2nd8)>0.) | |
13547 | ||
0328db2d | 13548 | // Cov(<4>,<sin(phi1)>): |
13549 | Double_t product9 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(9); // <<4><sin(phi1)>> | |
13550 | Double_t term1st9 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
13551 | Double_t term2nd9 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
13552 | Double_t sumOfW1st9 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
13553 | Double_t sumOfW2nd9 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
13554 | Double_t sumOfWW9 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(9); // W_{<4>} * W_{<sin(phi1)>} | |
13555 | // numerator in the expression for the the unbiased estimator for covariance: | |
13556 | Double_t numerator9 = product9 - term1st9*term2nd9; | |
13557 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13558 | Double_t denominator9 = 0.; |
13559 | if(TMath::Abs(sumOfW1st9*sumOfW2nd9)>0.) | |
13560 | { | |
13561 | denominator9 = 1.-sumOfWW9/(sumOfW1st9*sumOfW2nd9); | |
13562 | if(TMath::Abs(denominator9)>0.) | |
13563 | { | |
13564 | // covariance: | |
13565 | Double_t covariance9 = numerator9/denominator9; | |
13566 | // weight dependent prefactor for covariance: | |
13567 | Double_t wPrefactor9 = sumOfWW9/(sumOfW1st9*sumOfW2nd9); | |
13568 | // finally, store "weighted" covariance: | |
13569 | fIntFlowCovariancesNUA->SetBinContent(9,wPrefactor9*covariance9); | |
13570 | } | |
13571 | } // end of if(TMath::Abs(sumOfW1st9*sumOfW2nd9)>0.) | |
13572 | ||
0328db2d | 13573 | // Cov(<4>,<cos(phi1+phi2)>): |
13574 | Double_t product10 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(10); // <<4><cos(phi1+phi2)>> | |
13575 | Double_t term1st10 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
13576 | Double_t term2nd10 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
13577 | Double_t sumOfW1st10 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
13578 | Double_t sumOfW2nd10 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
13579 | Double_t sumOfWW10 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(10); // W_{<4>} * W_{<cos(phi1+phi2)>} | |
13580 | // numerator in the expression for the the unbiased estimator for covariance: | |
13581 | Double_t numerator10 = product10 - term1st10*term2nd10; | |
13582 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13583 | Double_t denominator10 = 0.; |
13584 | if(TMath::Abs(sumOfW1st10*sumOfW2nd10)>0.) | |
13585 | { | |
13586 | denominator10 = 1.-sumOfWW10/(sumOfW1st10*sumOfW2nd10); | |
13587 | if(TMath::Abs(denominator10)>0.) | |
13588 | { | |
13589 | // covariance: | |
13590 | Double_t covariance10 = numerator10/denominator10; | |
13591 | // weight dependent prefactor for covariance: | |
13592 | Double_t wPrefactor10 = sumOfWW10/(sumOfW1st10*sumOfW2nd10); | |
13593 | // finally, store "weighted" covariance: | |
13594 | fIntFlowCovariancesNUA->SetBinContent(10,wPrefactor10*covariance10); | |
13595 | } // end of if(TMath::Abs(denominator10)>0.) | |
13596 | } // end of if(TMath::Abs(sumOfW1st10*sumOfW2nd10)>0.) | |
13597 | ||
0328db2d | 13598 | // Cov(<4>,<sin(phi1+phi2)>): |
13599 | Double_t product11 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(11); // <<4><sin(phi1+phi2)>> | |
13600 | Double_t term1st11 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
13601 | Double_t term2nd11 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
13602 | Double_t sumOfW1st11 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
13603 | Double_t sumOfW2nd11 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
13604 | Double_t sumOfWW11 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(11); // W_{<4>} * W_{<sin(phi1+phi2)>} | |
13605 | // numerator in the expression for the the unbiased estimator for covariance: | |
13606 | Double_t numerator11 = product11 - term1st11*term2nd11; | |
13607 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13608 | Double_t denominator11 = 0.; |
13609 | if(TMath::Abs(sumOfW1st11*sumOfW2nd11)>0.) | |
13610 | { | |
13611 | denominator11 = 1.-sumOfWW11/(sumOfW1st11*sumOfW2nd11); | |
13612 | if(TMath::Abs(denominator11)>0.) | |
13613 | { | |
13614 | // covariance: | |
13615 | Double_t covariance11 = numerator11/denominator11; | |
13616 | // weight dependent prefactor for covariance: | |
13617 | Double_t wPrefactor11 = sumOfWW11/(sumOfW1st11*sumOfW2nd11); | |
13618 | // finally, store "weighted" covariance: | |
13619 | fIntFlowCovariancesNUA->SetBinContent(11,wPrefactor11*covariance11); | |
13620 | } // end of if(TMath::Abs(denominator11)>0.) | |
13621 | } // end of if(TMath::Abs(sumOfW1st11*sumOfW2nd11)>0.) | |
0328db2d | 13622 | |
13623 | // Cov(<4>,<cos(phi1-phi2-phi3)>): | |
13624 | Double_t product12 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(12); // <<4><cos(phi1-phi2-phi3)>> | |
13625 | Double_t term1st12 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
13626 | Double_t term2nd12 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
13627 | Double_t sumOfW1st12 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
13628 | Double_t sumOfW2nd12 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
13629 | Double_t sumOfWW12 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(12); // W_{<4>} * W_{<cos(phi1-phi2-phi3)>} | |
13630 | // numerator in the expression for the the unbiased estimator for covariance: | |
13631 | Double_t numerator12 = product12 - term1st12*term2nd12; | |
13632 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13633 | Double_t denominator12 = 0.; |
13634 | if(TMath::Abs(sumOfW1st12*sumOfW2nd12)>0.) | |
13635 | { | |
13636 | denominator12 = 1.-sumOfWW12/(sumOfW1st12*sumOfW2nd12); | |
13637 | if(TMath::Abs(denominator12)>0.) | |
13638 | { | |
13639 | // covariance: | |
13640 | Double_t covariance12 = numerator12/denominator12; | |
13641 | // weight dependent prefactor for covariance: | |
13642 | Double_t wPrefactor12 = sumOfWW12/(sumOfW1st12*sumOfW2nd12); | |
13643 | // finally, store "weighted" covariance: | |
13644 | fIntFlowCovariancesNUA->SetBinContent(12,wPrefactor12*covariance12); | |
13645 | } // end of if(TMath::Abs(denominator12)>0.) | |
13646 | } // end of if(TMath::Abs(sumOfW1st12*sumOfW2nd12)>0.) | |
0328db2d | 13647 | |
13648 | // Cov(<4>,<sin(phi1-phi2-phi3)>): | |
13649 | Double_t product13 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(13); // <<4><sin(phi1-phi2-phi3)>> | |
13650 | Double_t term1st13 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
13651 | Double_t term2nd13 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
13652 | Double_t sumOfW1st13 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
13653 | Double_t sumOfW2nd13 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
13654 | Double_t sumOfWW13 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(13); // W_{<4>} * W_{<sin(phi1-phi2-phi3)>} | |
13655 | // numerator in the expression for the the unbiased estimator for covariance: | |
13656 | Double_t numerator13 = product13 - term1st13*term2nd13; | |
13657 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13658 | Double_t denominator13 = 0.; |
13659 | if(TMath::Abs(sumOfW1st13*sumOfW2nd13)>0.) | |
13660 | { | |
13661 | denominator13 = 1.-sumOfWW13/(sumOfW1st13*sumOfW2nd13); | |
13662 | if(TMath::Abs(denominator13)>0.) | |
13663 | { | |
13664 | // covariance: | |
13665 | Double_t covariance13 = numerator13/denominator13; | |
13666 | // weight dependent prefactor for covariance: | |
13667 | Double_t wPrefactor13 = sumOfWW13/(sumOfW1st13*sumOfW2nd13); | |
13668 | // finally, store "weighted" covariance: | |
13669 | fIntFlowCovariancesNUA->SetBinContent(13,wPrefactor13*covariance13); | |
13670 | } // end of if(TMath::Abs(denominator13)>0.) | |
13671 | } // end of if(TMath::Abs(sumOfW1st13*sumOfW2nd13)>0.) | |
0328db2d | 13672 | |
13673 | // Cov(<cos(phi1)>,<cos(phi1+phi2)>): | |
13674 | Double_t product14 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(14); // <<cos(phi1)><cos(phi1+phi2)>> | |
13675 | Double_t term1st14 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
13676 | Double_t term2nd14 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
13677 | Double_t sumOfW1st14 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
13678 | Double_t sumOfW2nd14 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
13679 | Double_t sumOfWW14 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(14); // W_{<cos(phi1)>} * W_{<cos(phi1+phi2)>} | |
13680 | // numerator in the expression for the the unbiased estimator for covariance: | |
13681 | Double_t numerator14 = product14 - term1st14*term2nd14; | |
13682 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13683 | Double_t denominator14 = 0.; |
13684 | if(TMath::Abs(sumOfW1st14*sumOfW2nd14)>0.) | |
13685 | { | |
13686 | denominator14 = 1.-sumOfWW14/(sumOfW1st14*sumOfW2nd14); | |
13687 | if(TMath::Abs(denominator14)>0.) | |
13688 | { | |
13689 | // covariance: | |
13690 | Double_t covariance14 = numerator14/denominator14; | |
13691 | // weight dependent prefactor for covariance: | |
13692 | Double_t wPrefactor14 = sumOfWW14/(sumOfW1st14*sumOfW2nd14); | |
13693 | // finally, store "weighted" covariance: | |
13694 | fIntFlowCovariancesNUA->SetBinContent(14,wPrefactor14*covariance14); | |
13695 | } // end of if(TMath::Abs(denominator14)>0.) | |
13696 | } // end of if(TMath::Abs(sumOfW1st14*sumOfW2nd14)>0.) | |
0328db2d | 13697 | |
13698 | // Cov(<cos(phi1)>,<sin(phi1+phi2)>): | |
13699 | Double_t product15 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(15); // <<cos(phi1)><sin(phi1+phi2)>> | |
13700 | Double_t term1st15 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
13701 | Double_t term2nd15 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
13702 | Double_t sumOfW1st15 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
13703 | Double_t sumOfW2nd15 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
13704 | Double_t sumOfWW15 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(15); // W_{<cos(phi1)>} * W_{<sin(phi1+phi2)>} | |
13705 | // numerator in the expression for the the unbiased estimator for covariance: | |
13706 | Double_t numerator15 = product15 - term1st15*term2nd15; | |
13707 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13708 | Double_t denominator15 = 0.; |
13709 | if(TMath::Abs(sumOfW1st15*sumOfW2nd15)>0.) | |
13710 | { | |
13711 | denominator15 = 1.-sumOfWW15/(sumOfW1st15*sumOfW2nd15); | |
13712 | if(TMath::Abs(denominator15)>0.) | |
13713 | { | |
13714 | // covariance: | |
13715 | Double_t covariance15 = numerator15/denominator15; | |
13716 | // weight dependent prefactor for covariance: | |
13717 | Double_t wPrefactor15 = sumOfWW15/(sumOfW1st15*sumOfW2nd15); | |
13718 | // finally, store "weighted" covariance: | |
13719 | fIntFlowCovariancesNUA->SetBinContent(15,wPrefactor15*covariance15); | |
13720 | } // end of if(TMath::Abs(denominator15)>0.) | |
13721 | } // end of if(TMath::Abs(sumOfW1st15*sumOfW2nd15)>0.) | |
13722 | ||
0328db2d | 13723 | // Cov(<cos(phi1)>,<cos(phi1-phi2-phi3)>): |
13724 | Double_t product16 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(16); // <<cos(phi1)><cos(phi1-phi2-phi3)>> | |
13725 | Double_t term1st16 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
13726 | Double_t term2nd16 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
13727 | Double_t sumOfW1st16 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
13728 | Double_t sumOfW2nd16 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
13729 | Double_t sumOfWW16 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(16); // W_{<cos(phi1)>} * W_{<cos(phi1-phi2-phi3)>} | |
13730 | // numerator in the expression for the the unbiased estimator for covariance: | |
13731 | Double_t numerator16 = product16 - term1st16*term2nd16; | |
13732 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13733 | Double_t denominator16 = 0.; |
13734 | if(TMath::Abs(sumOfW1st16*sumOfW2nd16)>0.) | |
13735 | { | |
13736 | denominator16 = 1.-sumOfWW16/(sumOfW1st16*sumOfW2nd16); | |
13737 | if(TMath::Abs(denominator16)>0.) | |
13738 | { | |
13739 | // covariance: | |
13740 | Double_t covariance16 = numerator16/denominator16; | |
13741 | // weight dependent prefactor for covariance: | |
13742 | Double_t wPrefactor16 = sumOfWW16/(sumOfW1st16*sumOfW2nd16); | |
13743 | // finally, store "weighted" covariance: | |
13744 | fIntFlowCovariancesNUA->SetBinContent(16,wPrefactor16*covariance16); | |
13745 | } // end of if(TMath::Abs(denominator16)>0.) | |
13746 | } // end ofif(TMath::Abs(sumOfW1st16*sumOfW2nd16)>0.) | |
13747 | ||
0328db2d | 13748 | // Cov(<cos(phi1)>,<sin(phi1-phi2-phi3)>): |
13749 | Double_t product17 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(17); // <<cos(phi1)><sin(phi1-phi2-phi3)>> | |
13750 | Double_t term1st17 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
13751 | Double_t term2nd17 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
13752 | Double_t sumOfW1st17 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
13753 | Double_t sumOfW2nd17 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
13754 | Double_t sumOfWW17 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(17); // W_{<cos(phi1)>} * W_{<sin(phi1-phi2-phi3)>} | |
13755 | // numerator in the expression for the the unbiased estimator for covariance: | |
13756 | Double_t numerator17 = product17 - term1st17*term2nd17; | |
13757 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13758 | Double_t denominator17 = 0.; |
13759 | if(TMath::Abs(sumOfW1st17*sumOfW2nd17)>0.) | |
13760 | { | |
13761 | denominator17 = 1.-sumOfWW17/(sumOfW1st17*sumOfW2nd17); | |
13762 | if(TMath::Abs(denominator17)>0.) | |
13763 | { | |
13764 | // covariance: | |
13765 | Double_t covariance17 = numerator17/denominator17; | |
13766 | // weight dependent prefactor for covariance: | |
13767 | Double_t wPrefactor17 = sumOfWW17/(sumOfW1st17*sumOfW2nd17); | |
13768 | // finally, store "weighted" covariance: | |
13769 | fIntFlowCovariancesNUA->SetBinContent(17,wPrefactor17*covariance17); | |
13770 | } // end of if(TMath::Abs(denominator17)>0.) | |
13771 | } // end of if(TMath::Abs(sumOfW1st17*sumOfW2nd17)>0.) | |
0328db2d | 13772 | |
13773 | // Cov(<sin(phi1)>,<cos(phi1+phi2)>): | |
13774 | Double_t product18 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(18); // <<sin(phi1)><cos(phi1+phi2)>> | |
13775 | Double_t term1st18 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
13776 | Double_t term2nd18 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
13777 | Double_t sumOfW1st18 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
13778 | Double_t sumOfW2nd18 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
13779 | Double_t sumOfWW18 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(18); // W_{<sin(phi1)>} * W_{<cos(phi1+phi2)>} | |
13780 | // numerator in the expression for the the unbiased estimator for covariance: | |
13781 | Double_t numerator18 = product18 - term1st18*term2nd18; | |
13782 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13783 | Double_t denominator18 = 0.; |
13784 | if(TMath::Abs(sumOfW1st18*sumOfW2nd18)>0.) | |
13785 | { | |
13786 | denominator18 = 1.-sumOfWW18/(sumOfW1st18*sumOfW2nd18); | |
13787 | if(TMath::Abs(denominator18)>0.) | |
13788 | { | |
13789 | // covariance: | |
13790 | Double_t covariance18 = numerator18/denominator18; | |
13791 | // weight dependent prefactor for covariance: | |
13792 | Double_t wPrefactor18 = sumOfWW18/(sumOfW1st18*sumOfW2nd18); | |
13793 | // finally, store "weighted" covariance: | |
13794 | fIntFlowCovariancesNUA->SetBinContent(18,wPrefactor18*covariance18); | |
13795 | } // end of if(TMath::Abs(denominator18)>0.) | |
13796 | } // end of if(TMath::Abs(sumOfW1st18*sumOfW2nd18)>0.) | |
0328db2d | 13797 | |
13798 | // Cov(<sin(phi1)>,<sin(phi1+phi2)>): | |
13799 | Double_t product19 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(19); // <<sin(phi1)><sin(phi1+phi2)>> | |
13800 | Double_t term1st19 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
13801 | Double_t term2nd19 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
13802 | Double_t sumOfW1st19 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
13803 | Double_t sumOfW2nd19 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
13804 | Double_t sumOfWW19 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(19); // W_{<sin(phi1)>} * W_{<sin(phi1+phi2)>} | |
13805 | // numerator in the expression for the the unbiased estimator for covariance: | |
13806 | Double_t numerator19 = product19 - term1st19*term2nd19; | |
13807 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13808 | Double_t denominator19 = 0.; |
13809 | if(TMath::Abs(sumOfW1st19*sumOfW2nd19)>0.) | |
13810 | { | |
13811 | denominator19 = 1.-sumOfWW19/(sumOfW1st19*sumOfW2nd19); | |
13812 | if(TMath::Abs(denominator19)>0.) | |
13813 | { | |
13814 | // covariance: | |
13815 | Double_t covariance19 = numerator19/denominator19; | |
13816 | // weight dependent prefactor for covariance: | |
13817 | Double_t wPrefactor19 = sumOfWW19/(sumOfW1st19*sumOfW2nd19); | |
13818 | // finally, store "weighted" covariance: | |
13819 | fIntFlowCovariancesNUA->SetBinContent(19,wPrefactor19*covariance19); | |
13820 | } // end of if(TMath::Abs(denominator19)>0.) | |
13821 | } // end of if(TMath::Abs(sumOfW1st19*sumOfW2nd19)>0.) | |
13822 | ||
0328db2d | 13823 | // Cov(<sin(phi1)>,<cos(phi1-phi2-phi3)>): |
13824 | Double_t product20 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(20); // <<sin(phi1)><cos(phi1-phi2-phi3)>> | |
13825 | Double_t term1st20 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
13826 | Double_t term2nd20 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
13827 | Double_t sumOfW1st20 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
13828 | Double_t sumOfW2nd20 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
13829 | Double_t sumOfWW20 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(20); // W_{<sin(phi1)>} * W_{<cos(phi1-phi2-phi3)>} | |
13830 | // numerator in the expression for the the unbiased estimator for covariance: | |
13831 | Double_t numerator20 = product20 - term1st20*term2nd20; | |
13832 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13833 | Double_t denominator20 = 0.; |
13834 | if(TMath::Abs(sumOfW1st20*sumOfW2nd20)>0.) | |
13835 | { | |
13836 | denominator20 = 1.-sumOfWW20/(sumOfW1st20*sumOfW2nd20); | |
13837 | if(TMath::Abs(denominator20)>0.) | |
13838 | { | |
13839 | // covariance: | |
13840 | Double_t covariance20 = numerator20/denominator20; | |
13841 | // weight dependent prefactor for covariance: | |
13842 | Double_t wPrefactor20 = sumOfWW20/(sumOfW1st20*sumOfW2nd20); | |
13843 | // finally, store "weighted" covariance: | |
13844 | fIntFlowCovariancesNUA->SetBinContent(20,wPrefactor20*covariance20); | |
13845 | } // end of if(TMath::Abs(denominator20)>0.) | |
13846 | } // end of if(TMath::Abs(sumOfW1st20*sumOfW2nd20)>0.) | |
0328db2d | 13847 | |
13848 | // Cov(<sin(phi1)>,<sin(phi1-phi2-phi3)>): | |
13849 | Double_t product21 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(21); // <<sin(phi1)><sin(phi1-phi2-phi3)>> | |
13850 | Double_t term1st21 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
13851 | Double_t term2nd21 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
13852 | Double_t sumOfW1st21 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
13853 | Double_t sumOfW2nd21 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
13854 | Double_t sumOfWW21 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(21); // W_{<sin(phi1)>} * W_{<sin(phi1-phi2-phi3)>} | |
13855 | // numerator in the expression for the the unbiased estimator for covariance: | |
13856 | Double_t numerator21 = product21 - term1st21*term2nd21; | |
13857 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13858 | Double_t denominator21 = 0.; |
13859 | if(TMath::Abs(sumOfW1st21*sumOfW2nd21)>0.) | |
13860 | { | |
13861 | denominator21 = 1.-sumOfWW21/(sumOfW1st21*sumOfW2nd21); | |
13862 | if(TMath::Abs(denominator21)>0.) | |
13863 | { | |
13864 | // covariance: | |
13865 | Double_t covariance21 = numerator21/denominator21; | |
13866 | // weight dependent prefactor for covariance: | |
13867 | Double_t wPrefactor21 = sumOfWW21/(sumOfW1st21*sumOfW2nd21); | |
13868 | // finally, store "weighted" covariance: | |
13869 | fIntFlowCovariancesNUA->SetBinContent(21,wPrefactor21*covariance21); | |
13870 | } // end of if(TMath::Abs(denominator21)>0.) | |
13871 | } // end of if(TMath::Abs(sumOfW1st21*sumOfW2nd21)>0.) | |
0328db2d | 13872 | |
13873 | // Cov(<cos(phi1+phi2)>,<sin(phi1+phi2)>): | |
13874 | Double_t product22 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(22); // <<cos(phi1+phi2)><sin(phi1+phi2)>> | |
13875 | Double_t term1st22 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
13876 | Double_t term2nd22 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
13877 | Double_t sumOfW1st22 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
13878 | Double_t sumOfW2nd22 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
13879 | Double_t sumOfWW22 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(22); // W_{<cos(phi1+phi2)>} * W_{<sin(phi1+phi2)>} | |
13880 | // numerator in the expression for the the unbiased estimator for covariance: | |
13881 | Double_t numerator22 = product22 - term1st22*term2nd22; | |
13882 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13883 | Double_t denominator22 = 0.; |
13884 | if(TMath::Abs(sumOfW1st22*sumOfW2nd22)>0.) | |
13885 | { | |
13886 | denominator22 = 1.-sumOfWW22/(sumOfW1st22*sumOfW2nd22); | |
13887 | if(TMath::Abs(denominator22)>0.) | |
13888 | { | |
13889 | // covariance: | |
13890 | Double_t covariance22 = numerator22/denominator22; | |
13891 | // weight dependent prefactor for covariance: | |
13892 | Double_t wPrefactor22 = sumOfWW22/(sumOfW1st22*sumOfW2nd22); | |
13893 | // finally, store "weighted" covariance: | |
13894 | fIntFlowCovariancesNUA->SetBinContent(22,wPrefactor22*covariance22); | |
13895 | } // end of if(TMath::Abs(denominator22)>0.) | |
13896 | } // end of if(TMath::Abs(sumOfW1st22*sumOfW2nd22)>0.) | |
0328db2d | 13897 | |
13898 | // Cov(<cos(phi1+phi2)>,<cos(phi1-phi2-phi3)>): | |
13899 | Double_t product23 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(23); // <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
13900 | Double_t term1st23 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
13901 | Double_t term2nd23 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
13902 | Double_t sumOfW1st23 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
13903 | Double_t sumOfW2nd23 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
13904 | Double_t sumOfWW23 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(23); // W_{<cos(phi1+phi2)>} * W_{<cos(phi1-phi2-phi3)>} | |
13905 | // numerator in the expression for the the unbiased estimator for covariance: | |
13906 | Double_t numerator23 = product23 - term1st23*term2nd23; | |
13907 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13908 | Double_t denominator23 = 0.; |
13909 | if(TMath::Abs(sumOfW1st23*sumOfW2nd23)>0.) | |
13910 | { | |
13911 | denominator23 = 1.-sumOfWW23/(sumOfW1st23*sumOfW2nd23); | |
13912 | if(TMath::Abs(denominator23)>0.) | |
13913 | { | |
13914 | // covariance: | |
13915 | Double_t covariance23 = numerator23/denominator23; | |
13916 | // weight dependent prefactor for covariance: | |
13917 | Double_t wPrefactor23 = sumOfWW23/(sumOfW1st23*sumOfW2nd23); | |
13918 | // finally, store "weighted" covariance: | |
13919 | fIntFlowCovariancesNUA->SetBinContent(23,wPrefactor23*covariance23); | |
13920 | } // end of if(TMath::Abs(denominator23)>0.) | |
13921 | } // end of if(TMath::Abs(sumOfW1st23*sumOfW2nd23)>0.) | |
13922 | ||
0328db2d | 13923 | // Cov(<cos(phi1+phi2)>,<sin(phi1-phi2-phi3)>): |
13924 | Double_t product24 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(24); // <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
13925 | Double_t term1st24 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
13926 | Double_t term2nd24 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
13927 | Double_t sumOfW1st24 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
13928 | Double_t sumOfW2nd24 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
13929 | Double_t sumOfWW24 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(24); // W_{<cos(phi1+phi2)>} * W_{<sin(phi1-phi2-phi3)>} | |
13930 | // numerator in the expression for the the unbiased estimator for covariance: | |
13931 | Double_t numerator24 = product24 - term1st24*term2nd24; | |
13932 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13933 | Double_t denominator24 = 0.; |
13934 | if(TMath::Abs(sumOfW1st24*sumOfW2nd24)>0.) | |
13935 | { | |
13936 | denominator24 = 1.-sumOfWW24/(sumOfW1st24*sumOfW2nd24); | |
13937 | if(TMath::Abs(denominator24)>0.) | |
13938 | { | |
13939 | // covariance: | |
13940 | Double_t covariance24 = numerator24/denominator24; | |
13941 | // weight dependent prefactor for covariance: | |
13942 | Double_t wPrefactor24 = sumOfWW24/(sumOfW1st24*sumOfW2nd24); | |
13943 | // finally, store "weighted" covariance: | |
13944 | fIntFlowCovariancesNUA->SetBinContent(24,wPrefactor24*covariance24); | |
13945 | } // end of if(TMath::Abs(denominator24)>0.) | |
13946 | } // end of if(TMath::Abs(sumOfW1st24*sumOfW2nd24)>0.) | |
0328db2d | 13947 | |
13948 | // Cov(<sin(phi1+phi2)>,<cos(phi1-phi2-phi3)>): | |
13949 | Double_t product25 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(25); // <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
13950 | Double_t term1st25 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
13951 | Double_t term2nd25 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
13952 | Double_t sumOfW1st25 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
13953 | Double_t sumOfW2nd25 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
13954 | Double_t sumOfWW25 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(25); // W_{<sin(phi1+phi2)>} * W_{<cos(phi1-phi2-phi3)>} | |
13955 | // numerator in the expression for the the unbiased estimator for covariance: | |
13956 | Double_t numerator25 = product25 - term1st25*term2nd25; | |
13957 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13958 | Double_t denominator25 = 0.; |
13959 | if(TMath::Abs(sumOfW1st25*sumOfW2nd25)>0.) | |
13960 | { | |
13961 | denominator25 = 1.-sumOfWW25/(sumOfW1st25*sumOfW2nd25); | |
13962 | if(TMath::Abs(denominator25)>0.) | |
13963 | { | |
13964 | // covariance: | |
13965 | Double_t covariance25 = numerator25/denominator25; | |
13966 | // weight dependent prefactor for covariance: | |
13967 | Double_t wPrefactor25 = sumOfWW25/(sumOfW1st25*sumOfW2nd25); | |
13968 | // finally, store "weighted" covariance: | |
13969 | fIntFlowCovariancesNUA->SetBinContent(25,wPrefactor25*covariance25); | |
13970 | } // end of if(TMath::Abs(denominator25)>0.) | |
13971 | } // end of if(TMath::Abs(sumOfW1st25*sumOfW2nd25)>0.) | |
13972 | ||
0328db2d | 13973 | // Cov(<sin(phi1+phi2)>,<sin(phi1-phi2-phi3)>): |
13974 | Double_t product26 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(26); // <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
13975 | Double_t term1st26 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
13976 | Double_t term2nd26 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
13977 | Double_t sumOfW1st26 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
13978 | Double_t sumOfW2nd26 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
13979 | Double_t sumOfWW26 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(26); // W_{<sin(phi1+phi2)>} * W_{<sin(phi1-phi2-phi3)>} | |
13980 | // numerator in the expression for the the unbiased estimator for covariance: | |
13981 | Double_t numerator26 = product26 - term1st26*term2nd26; | |
13982 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 13983 | Double_t denominator26 = 0.; |
13984 | if(TMath::Abs(sumOfW1st26*sumOfW2nd26)>0.) | |
13985 | { | |
13986 | denominator26 = 1.-sumOfWW26/(sumOfW1st26*sumOfW2nd26); | |
13987 | if(TMath::Abs(denominator26)>0.) | |
13988 | { | |
13989 | // covariance: | |
13990 | Double_t covariance26 = numerator26/denominator26; | |
13991 | // weight dependent prefactor for covariance: | |
13992 | Double_t wPrefactor26 = sumOfWW26/(sumOfW1st26*sumOfW2nd26); | |
13993 | // finally, store "weighted" covariance: | |
13994 | fIntFlowCovariancesNUA->SetBinContent(26,wPrefactor26*covariance26); | |
13995 | } // end of if(TMath::Abs(denominator26)>0.) | |
13996 | } // end of if(TMath::Abs(sumOfW1st26*sumOfW2nd26)>0.) | |
13997 | ||
0328db2d | 13998 | // Cov(<cos(phi1-phi2-phi3)>,<sin(phi1-phi2-phi3)>): |
13999 | Double_t product27 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(27); // <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>> | |
b92ea2b9 | 14000 | Double_t term1st27 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> |
0328db2d | 14001 | Double_t term2nd27 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> |
b92ea2b9 | 14002 | Double_t sumOfW1st27 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} |
0328db2d | 14003 | Double_t sumOfW2nd27 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} |
14004 | Double_t sumOfWW27 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(27); // W_{<cos(phi1-phi2-phi3)>} * W_{<sin(phi1-phi2-phi3)>} | |
14005 | // numerator in the expression for the the unbiased estimator for covariance: | |
14006 | Double_t numerator27 = product27 - term1st27*term2nd27; | |
14007 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 14008 | Double_t denominator27 = 0.; |
14009 | if(TMath::Abs(sumOfW1st27*sumOfW2nd27)>0.) | |
14010 | { | |
14011 | denominator27 = 1.-sumOfWW27/(sumOfW1st27*sumOfW2nd27); | |
14012 | if(TMath::Abs(denominator27)>0.) | |
14013 | { | |
14014 | // covariance: | |
14015 | Double_t covariance27 = numerator27/denominator27; | |
14016 | // weight dependent prefactor for covariance: | |
14017 | Double_t wPrefactor27 = sumOfWW27/(sumOfW1st27*sumOfW2nd27); | |
14018 | // finally, store "weighted" covariance: | |
14019 | fIntFlowCovariancesNUA->SetBinContent(27,wPrefactor27*covariance27); | |
14020 | } // end of if(TMath::Abs(denominator27)>0.) | |
14021 | } // end of if(TMath::Abs(sumOfW1st27*sumOfW2nd27)>0.) | |
14022 | ||
0328db2d | 14023 | } // end of AliFlowAnalysisWithQCumulants::CalculateCovariancesNUAIntFlow() |
14024 | ||
e1d101a6 | 14025 | //======================================================================================================================= |
0328db2d | 14026 | |
489d5531 | 14027 | void AliFlowAnalysisWithQCumulants::FinalizeCorrelationsIntFlow() |
14028 | { | |
14029 | // From profile fIntFlowCorrelationsPro access measured correlations and spread, | |
14030 | // correctly calculate the statistical errors and store the final results and | |
14031 | // statistical errors for correlations in histogram fIntFlowCorrelationsHist. | |
14032 | // | |
14033 | // Remark: Statistical error of correlation is calculated as: | |
14034 | // | |
14035 | // statistical error = termA * spread * termB: | |
14036 | // termA = sqrt{sum_{i=1}^{N} w^2}/(sum_{i=1}^{N} w) | |
14037 | // termB = 1/sqrt(1-termA^2) | |
b3dacf6b | 14038 | // |
14039 | ||
489d5531 | 14040 | for(Int_t ci=1;ci<=4;ci++) // correlation index |
14041 | { | |
b40a910e | 14042 | if(fIntFlowCorrelationsPro->GetBinEffectiveEntries(ci) < 2 || fIntFlowSquaredCorrelationsPro->GetBinEffectiveEntries(ci) < 2) |
14043 | { | |
14044 | fIntFlowCorrelationsPro->SetBinError(ci,0.); | |
14045 | fIntFlowSquaredCorrelationsPro->SetBinError(ci,0.); | |
14046 | continue; | |
14047 | } | |
489d5531 | 14048 | Double_t correlation = fIntFlowCorrelationsPro->GetBinContent(ci); |
b40a910e | 14049 | Double_t squaredCorrelation = fIntFlowSquaredCorrelationsPro->GetBinContent(ci); |
14050 | Double_t spread = 0.; | |
14051 | if(squaredCorrelation-correlation*correlation >= 0.) | |
14052 | { | |
14053 | spread = pow(squaredCorrelation-correlation*correlation,0.5); | |
14054 | } else | |
14055 | { | |
14056 | cout<<endl; | |
14057 | cout<<Form(" WARNING: Imaginary 'spread' for %d-particle correlation!!!! ",2*ci)<<endl; | |
14058 | cout<<endl; | |
14059 | } | |
489d5531 | 14060 | Double_t sumOfLinearEventWeights = fIntFlowSumOfEventWeights[0]->GetBinContent(ci); |
14061 | Double_t sumOfQuadraticEventWeights = fIntFlowSumOfEventWeights[1]->GetBinContent(ci); | |
14062 | Double_t termA = 0.; | |
14063 | Double_t termB = 0.; | |
b3dacf6b | 14064 | if(TMath::Abs(sumOfLinearEventWeights) > 0.) // to be improved - shall I omitt here Abs() ? |
489d5531 | 14065 | { |
14066 | termA = pow(sumOfQuadraticEventWeights,0.5)/sumOfLinearEventWeights; | |
14067 | } else | |
14068 | { | |
b3dacf6b | 14069 | cout<<endl; |
14070 | cout<<" WARNING (QC): sumOfLinearEventWeights == 0 in method FinalizeCorrelationsIntFlow() !!!!"<<endl; | |
14071 | cout<<" (for "<<2*ci<<"-particle correlation)"<<endl; | |
14072 | cout<<endl; | |
489d5531 | 14073 | } |
14074 | if(1.-pow(termA,2.) > 0.) | |
14075 | { | |
14076 | termB = 1./pow(1-pow(termA,2.),0.5); | |
14077 | } else | |
14078 | { | |
b3dacf6b | 14079 | cout<<endl; |
14080 | cout<<" WARNING (QC): 1.-pow(termA,2.) <= 0 in method FinalizeCorrelationsIntFlow() !!!!"<<endl; | |
14081 | cout<<" (for "<<2*ci<<"-particle correlation)"<<endl; | |
14082 | cout<<endl; | |
489d5531 | 14083 | } |
14084 | Double_t statisticalError = termA * spread * termB; | |
14085 | fIntFlowCorrelationsHist->SetBinContent(ci,correlation); | |
14086 | fIntFlowCorrelationsHist->SetBinError(ci,statisticalError); | |
ff70ca91 | 14087 | } // end of for(Int_t ci=1;ci<=4;ci++) // correlation index |
14088 | ||
b3dacf6b | 14089 | // Versus multiplicity: |
14090 | if(!fCalculateCumulantsVsM){return;} | |
ff70ca91 | 14091 | for(Int_t ci=0;ci<=3;ci++) // correlation index |
14092 | { | |
14093 | Int_t nBins = fIntFlowCorrelationsVsMPro[ci]->GetNbinsX(); | |
14094 | for(Int_t b=1;b<=nBins;b++) // looping over multiplicity bins | |
14095 | { | |
b40a910e | 14096 | if(fIntFlowCorrelationsVsMPro[ci]->GetBinEffectiveEntries(b) < 2 || fIntFlowSquaredCorrelationsVsMPro[ci]->GetBinEffectiveEntries(b) < 2) |
14097 | { | |
14098 | fIntFlowCorrelationsVsMPro[ci]->SetBinError(b,0.); | |
14099 | fIntFlowSquaredCorrelationsVsMPro[ci]->SetBinError(b,0.); | |
14100 | continue; | |
14101 | } | |
ff70ca91 | 14102 | Double_t correlationVsM = fIntFlowCorrelationsVsMPro[ci]->GetBinContent(b); |
b40a910e | 14103 | Double_t squaredCorrelationVsM = fIntFlowSquaredCorrelationsVsMPro[ci]->GetBinContent(b); |
14104 | Double_t spreadVsM = 0.; | |
14105 | if(squaredCorrelationVsM-correlationVsM*correlationVsM >= 0.) | |
14106 | { | |
14107 | spreadVsM = pow(squaredCorrelationVsM-correlationVsM*correlationVsM,0.5); | |
14108 | } else | |
14109 | { | |
14110 | cout<<endl; | |
14111 | cout<<Form(" WARNING (QC): Imaginary 'spreadVsM' for ci = %d, bin = %d, entries = %f !!!!", | |
14112 | ci,b,fIntFlowCorrelationsVsMPro[ci]->GetBinEffectiveEntries(b))<<endl; | |
14113 | cout<<endl; | |
14114 | } | |
ff70ca91 | 14115 | Double_t sumOfLinearEventWeightsVsM = fIntFlowSumOfEventWeightsVsM[ci][0]->GetBinContent(b); |
14116 | Double_t sumOfQuadraticEventWeightsVsM = fIntFlowSumOfEventWeightsVsM[ci][1]->GetBinContent(b); | |
14117 | Double_t termAVsM = 0.; | |
14118 | Double_t termBVsM = 0.; | |
b40a910e | 14119 | if(sumOfLinearEventWeightsVsM > 0.) |
ff70ca91 | 14120 | { |
14121 | termAVsM = pow(sumOfQuadraticEventWeightsVsM,0.5)/sumOfLinearEventWeightsVsM; | |
b3dacf6b | 14122 | } |
ff70ca91 | 14123 | if(1.-pow(termAVsM,2.) > 0.) |
14124 | { | |
14125 | termBVsM = 1./pow(1-pow(termAVsM,2.),0.5); | |
b3dacf6b | 14126 | } |
ff70ca91 | 14127 | Double_t statisticalErrorVsM = termAVsM * spreadVsM * termBVsM; |
14128 | fIntFlowCorrelationsVsMHist[ci]->SetBinContent(b,correlationVsM); | |
14129 | fIntFlowCorrelationsVsMHist[ci]->SetBinError(b,statisticalErrorVsM); | |
14130 | } // end of for(Int_t b=1;b<=nBins;b++) | |
14131 | } // end of for(Int_t ci=1;ci<=4;ci++) // correlation index | |
14132 | ||
489d5531 | 14133 | } // end of AliFlowAnalysisWithQCumulants::FinalizeCorrelationsIntFlow() |
14134 | ||
e1d101a6 | 14135 | //======================================================================================================================= |
489d5531 | 14136 | |
489d5531 | 14137 | void AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(Int_t nRP) |
14138 | { | |
b77b6434 | 14139 | // Fill profile fAverageMultiplicity to hold average multiplicities and |
14140 | // number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8 | |
489d5531 | 14141 | |
14142 | // Binning of fAverageMultiplicity is organized as follows: | |
14143 | // 1st bin: all events (including the empty ones) | |
14144 | // 2nd bin: event with # of RPs greater or equal to 1 | |
14145 | // 3rd bin: event with # of RPs greater or equal to 2 | |
14146 | // 4th bin: event with # of RPs greater or equal to 3 | |
14147 | // 5th bin: event with # of RPs greater or equal to 4 | |
14148 | // 6th bin: event with # of RPs greater or equal to 5 | |
14149 | // 7th bin: event with # of RPs greater or equal to 6 | |
14150 | // 8th bin: event with # of RPs greater or equal to 7 | |
14151 | // 9th bin: event with # of RPs greater or equal to 8 | |
14152 | ||
489d5531 | 14153 | if(nRP<0) |
14154 | { | |
b77b6434 | 14155 | cout<<endl; |
14156 | cout<<" WARNING (QC): nRP<0 in in AFAWQC::FAM() !!!!"<<endl; | |
14157 | cout<<endl; | |
489d5531 | 14158 | exit(0); |
14159 | } | |
14160 | ||
14161 | for(Int_t i=0;i<9;i++) | |
14162 | { | |
b77b6434 | 14163 | if(nRP>=i){fAvMultiplicity->Fill(i+0.5,nRP,1);} |
489d5531 | 14164 | } |
14165 | ||
14166 | } // end of AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(nRP) | |
14167 | ||
e1d101a6 | 14168 | //======================================================================================================================= |
489d5531 | 14169 | |
489d5531 | 14170 | void AliFlowAnalysisWithQCumulants::CalculateCumulantsIntFlow() |
b3dacf6b | 14171 | { |
b92ea2b9 | 14172 | // a) Calculate Q-cumulants from the measured multiparticle correlations; |
14173 | // b) Propagate the statistical errors from measured multiparticle correlations to statistical errors of Q-cumulants; | |
14174 | // c) Remark: Q-cumulants calculated in this method are biased by non-uniform acceptance of detector !!!! | |
14175 | // Method CalculateQcumulantsCorrectedForNUAIntFlow() is called afterwards to correct for this bias; | |
14176 | // d) Store the results and statistical error of Q-cumulants in histogram fIntFlowQcumulants. | |
14177 | // Binning of fIntFlowQcumulants is organized as follows: | |
489d5531 | 14178 | // |
b3dacf6b | 14179 | // 1st bin: QC{2} |
14180 | // 2nd bin: QC{4} | |
14181 | // 3rd bin: QC{6} | |
14182 | // 4th bin: QC{8} | |
14183 | // | |
489d5531 | 14184 | |
b3dacf6b | 14185 | // Correlations: |
489d5531 | 14186 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> |
14187 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> | |
14188 | Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> | |
14189 | Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> | |
b3dacf6b | 14190 | // Statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations: |
489d5531 | 14191 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <2> |
14192 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <4> | |
14193 | Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <6> | |
14194 | Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <8> | |
b3dacf6b | 14195 | // Covariances (multiplied by prefactor depending on weights - see comments in CalculateCovariancesIntFlow()): |
8e1cefdd | 14196 | Double_t wCov24 = 0.; // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) |
14197 | Double_t wCov26 = 0.; // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>) | |
14198 | Double_t wCov28 = 0.; // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>) | |
14199 | Double_t wCov46 = 0.; // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>) | |
14200 | Double_t wCov48 = 0.; // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>) | |
14201 | Double_t wCov68 = 0.; // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>) | |
14202 | if(!fForgetAboutCovariances) | |
14203 | { | |
14204 | wCov24 = fIntFlowCovariances->GetBinContent(1); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) | |
14205 | wCov26 = fIntFlowCovariances->GetBinContent(2); // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>) | |
14206 | wCov28 = fIntFlowCovariances->GetBinContent(3); // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>) | |
14207 | wCov46 = fIntFlowCovariances->GetBinContent(4); // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>) | |
14208 | wCov48 = fIntFlowCovariances->GetBinContent(5); // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>) | |
14209 | wCov68 = fIntFlowCovariances->GetBinContent(6); // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>) | |
14210 | } | |
489d5531 | 14211 | // Q-cumulants: |
14212 | Double_t qc2 = 0.; // QC{2} | |
14213 | Double_t qc4 = 0.; // QC{4} | |
14214 | Double_t qc6 = 0.; // QC{6} | |
14215 | Double_t qc8 = 0.; // QC{8} | |
b3dacf6b | 14216 | if(TMath::Abs(two) > 0.){qc2 = two;} |
14217 | if(TMath::Abs(four) > 0.){qc4 = four-2.*pow(two,2.);} | |
14218 | if(TMath::Abs(six) > 0.){qc6 = six-9.*two*four+12.*pow(two,3.);} | |
14219 | if(TMath::Abs(eight) > 0.){qc8 = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.);} | |
14220 | // Statistical errors of Q-cumulants: | |
489d5531 | 14221 | Double_t qc2Error = 0.; |
14222 | Double_t qc4Error = 0.; | |
14223 | Double_t qc6Error = 0.; | |
b3dacf6b | 14224 | Double_t qc8Error = 0.; |
14225 | // Squared statistical errors of Q-cumulants: | |
489d5531 | 14226 | //Double_t qc2ErrorSquared = 0.; |
14227 | Double_t qc4ErrorSquared = 0.; | |
14228 | Double_t qc6ErrorSquared = 0.; | |
b3dacf6b | 14229 | Double_t qc8ErrorSquared = 0.; |
14230 | // Statistical error of QC{2}: | |
14231 | qc2Error = twoError; | |
14232 | // Statistical error of QC{4}: | |
489d5531 | 14233 | qc4ErrorSquared = 16.*pow(two,2.)*pow(twoError,2)+pow(fourError,2.) |
14234 | - 8.*two*wCov24; | |
14235 | if(qc4ErrorSquared>0.) | |
14236 | { | |
14237 | qc4Error = pow(qc4ErrorSquared,0.5); | |
14238 | } else | |
14239 | { | |
b3dacf6b | 14240 | cout<<" WARNING (QC): Statistical error of QC{4} is imaginary !!!!"<<endl; |
14241 | } | |
14242 | // Statistical error of QC{6}: | |
489d5531 | 14243 | qc6ErrorSquared = 81.*pow(4.*pow(two,2.)-four,2.)*pow(twoError,2.) |
14244 | + 81.*pow(two,2.)*pow(fourError,2.) | |
14245 | + pow(sixError,2.) | |
14246 | - 162.*two*(4.*pow(two,2.)-four)*wCov24 | |
14247 | + 18.*(4.*pow(two,2.)-four)*wCov26 | |
b3dacf6b | 14248 | - 18.*two*wCov46; |
489d5531 | 14249 | if(qc6ErrorSquared>0.) |
14250 | { | |
14251 | qc6Error = pow(qc6ErrorSquared,0.5); | |
14252 | } else | |
14253 | { | |
b3dacf6b | 14254 | cout<<" WARNING (QC): Statistical error of QC{6} is imaginary !!!!"<<endl; |
14255 | } | |
14256 | // Statistical error of QC{8}: | |
489d5531 | 14257 | qc8ErrorSquared = 256.*pow(36.*pow(two,3.)-18.*four*two+six,2.)*pow(twoError,2.) |
14258 | + 1296.*pow(4.*pow(two,2.)-four,2.)*pow(fourError,2.) | |
14259 | + 256.*pow(two,2.)*pow(sixError,2.) | |
14260 | + pow(eightError,2.) | |
14261 | - 1152.*(36.*pow(two,3.)-18.*four*two+six)*(4.*pow(two,2.)-four)*wCov24 | |
14262 | + 512.*two*(36.*pow(two,3.)-18.*four*two+six)*wCov26 | |
14263 | - 32.*(36.*pow(two,3.)-18.*four*two+six)*wCov28 | |
14264 | - 1152.*two*(4.*pow(two,2.)-four)*wCov46 | |
14265 | + 72.*(4.*pow(two,2.)-four)*wCov48 | |
14266 | - 32.*two*wCov68; | |
14267 | if(qc8ErrorSquared>0.) | |
14268 | { | |
14269 | qc8Error = pow(qc8ErrorSquared,0.5); | |
14270 | } else | |
14271 | { | |
b3dacf6b | 14272 | cout<<"WARNING (QC): Statistical error of QC{8} is imaginary !!!!"<<endl; |
489d5531 | 14273 | } |
b3dacf6b | 14274 | // Store the results and statistical errors for Q-cumulants: |
14275 | if(TMath::Abs(qc2)>0.) | |
14276 | { | |
14277 | fIntFlowQcumulants->SetBinContent(1,qc2); | |
14278 | fIntFlowQcumulants->SetBinError(1,qc2Error); | |
14279 | } | |
14280 | if(TMath::Abs(qc4)>0.) | |
14281 | { | |
14282 | fIntFlowQcumulants->SetBinContent(2,qc4); | |
14283 | fIntFlowQcumulants->SetBinError(2,qc4Error); | |
14284 | } | |
14285 | if(TMath::Abs(qc6)>0.) | |
14286 | { | |
14287 | fIntFlowQcumulants->SetBinContent(3,qc6); | |
14288 | fIntFlowQcumulants->SetBinError(3,qc6Error); | |
14289 | } | |
14290 | if(TMath::Abs(qc8)>0.) | |
14291 | { | |
14292 | fIntFlowQcumulants->SetBinContent(4,qc8); | |
14293 | fIntFlowQcumulants->SetBinError(4,qc8Error); | |
14294 | } | |
14295 | ||
14296 | // Versus multiplicity: | |
14297 | if(!fCalculateCumulantsVsM){return;} | |
1db7eced | 14298 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // tbi (hardwired 0) |
b3dacf6b | 14299 | Double_t value[4] = {0.}; // QCs vs M |
14300 | Double_t error[4] = {0.}; // error of QCs vs M | |
14301 | Double_t dSum1[4] = {0.}; // sum value_i/(error_i)^2 | |
14302 | Double_t dSum2[4] = {0.}; // sum 1/(error_i)^2 | |
1db7eced | 14303 | two = 0.; // TBI can be done safer, lines below included |
14304 | twoError = 0.; | |
14305 | four = 0.; | |
14306 | fourError = 0.; | |
14307 | six = 0.; | |
14308 | sixError = 0.; | |
14309 | eight = 0.; | |
14310 | eightError = 0.; | |
14311 | wCov24 = 0.; | |
14312 | wCov26 = 0.; | |
14313 | wCov28 = 0.; | |
14314 | wCov46 = 0.; | |
14315 | wCov48 = 0.; | |
14316 | wCov68 = 0.; | |
9da1a4f3 | 14317 | for(Int_t b=1;b<=nBins;b++) |
14318 | { | |
b3dacf6b | 14319 | // Correlations: |
1db7eced | 14320 | if(!fUse2DHistograms) |
14321 | { | |
14322 | if(!fUseQvectorTerms) | |
14323 | { | |
14324 | ||
8d1c89ad | 14325 | //cout<<"TProfile"<<endl; |
1db7eced | 14326 | |
14327 | two = fIntFlowCorrelationsVsMHist[0]->GetBinContent(b); // <<2>> | |
14328 | four = fIntFlowCorrelationsVsMHist[1]->GetBinContent(b); // <<4>> | |
14329 | six = fIntFlowCorrelationsVsMHist[2]->GetBinContent(b); // <<6>> | |
14330 | eight = fIntFlowCorrelationsVsMHist[3]->GetBinContent(b); // <<8>> | |
14331 | } // end of if(!fUseQvectorTerms) | |
14332 | } else | |
14333 | { | |
14334 | // TH2D: | |
14335 | ||
14336 | cout<<"TH2D"<<endl; | |
14337 | ||
14338 | two = fCorrelation2468VsMult[0]->ProjectionY("2",b,b)->GetMean(); // <<2>> | |
14339 | four = fCorrelation2468VsMult[1]->ProjectionY("4",b,b)->GetMean(); // <<4>> | |
14340 | six = fCorrelation2468VsMult[2]->ProjectionY("6",b,b)->GetMean(); // <<6>> | |
14341 | eight = fCorrelation2468VsMult[3]->ProjectionY("8",b,b)->GetMean(); // <<8>> | |
14342 | } | |
14343 | if(fUseQvectorTerms) | |
14344 | { | |
14345 | Double_t dM = fIntFlowCorrelationsVsMPro[0]->GetBinLowEdge(b); | |
14346 | if(dM>3.) // TBI re-think this if statement | |
14347 | { | |
14348 | ||
14349 | cout<<"Q-vector terms"<<endl; | |
14350 | ||
14351 | two = (fQvectorTermsVsMult[0]->ProjectionY("qvt0a",b,b)->GetMean()-1.)/(dM-1.); | |
14352 | Double_t dTerm1 = (dM*(2.*dM-1.))*fQvectorTermsVsMult[2]->ProjectionY("qvt2",b,b)->GetMean(); | |
14353 | Double_t dTerm2 = dM*fQvectorTermsVsMult[1]->ProjectionY("qvt1",b,b)->GetMean(); | |
14354 | Double_t dTerm3 = -2.*pow(dM,1.5)*fQvectorTermsVsMult[3]->ProjectionY("qvt3",b,b)->GetMean(); | |
14355 | Double_t dTerm4 = -4.*(dM-2.)*dM*fQvectorTermsVsMult[0]->ProjectionY("qvt0b",b,b)->GetMean(); | |
14356 | Double_t dTerm5 = 2.*dM*(dM-3.); | |
14357 | four = (dTerm1+dTerm2+dTerm3+dTerm4+dTerm5)/(dM*(dM-1.)*(dM-2.)*(dM-3.)); | |
14358 | } // end of if(dM>3.) // TBI rethink this if statement | |
14359 | } // end of else if(fUseQvectorTerms) | |
b3dacf6b | 14360 | // Statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations: |
1db7eced | 14361 | if(!fUse2DHistograms) |
14362 | { | |
14363 | if(!fUseQvectorTerms) | |
14364 | { | |
14365 | twoError = fIntFlowCorrelationsVsMHist[0]->GetBinError(b); // <2> error | |
14366 | fourError = fIntFlowCorrelationsVsMHist[1]->GetBinError(b); // <4> error | |
14367 | sixError = fIntFlowCorrelationsVsMHist[2]->GetBinError(b); // <6> error | |
14368 | eightError = fIntFlowCorrelationsVsMHist[3]->GetBinError(b); // <8> error | |
14369 | } | |
14370 | } else | |
14371 | { | |
14372 | // TH2D: | |
14373 | twoError = fCorrelation2468VsMult[0]->ProjectionY("2",b,b)->GetMeanError(); // <2> error | |
14374 | fourError = fCorrelation2468VsMult[1]->ProjectionY("4",b,b)->GetMeanError(); // <4> error | |
14375 | sixError = fCorrelation2468VsMult[2]->ProjectionY("6",b,b)->GetMeanError(); // <6> error | |
14376 | eightError = fCorrelation2468VsMult[3]->ProjectionY("8",b,b)->GetMeanError(); // <8> error | |
14377 | } // end of else | |
14378 | if(fUseQvectorTerms) | |
14379 | { | |
14380 | Double_t dM = fIntFlowCorrelationsVsMPro[0]->GetBinLowEdge(b); | |
14381 | if(dM>3.) // TBI re-think this if statement | |
14382 | { | |
14383 | twoError = (fQvectorTermsVsMult[0]->ProjectionY("qvt0a",b,b)->GetMeanError())/(dM-1.); | |
14384 | } | |
14385 | } // end of if(fUseQvectorTerms) | |
14386 | ||
b3dacf6b | 14387 | // Covariances (multiplied by prefactor depending on weights - see comments in CalculateCovariancesIntFlow()): |
8e1cefdd | 14388 | if(!fForgetAboutCovariances) |
14389 | { | |
1db7eced | 14390 | if(!fUse2DHistograms) |
14391 | { | |
14392 | if(!fUseQvectorTerms) | |
14393 | { | |
14394 | wCov24 = fIntFlowCovariancesVsM[0]->GetBinContent(b); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) | |
14395 | wCov26 = fIntFlowCovariancesVsM[1]->GetBinContent(b); // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>) | |
14396 | wCov28 = fIntFlowCovariancesVsM[2]->GetBinContent(b); // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>) | |
14397 | wCov46 = fIntFlowCovariancesVsM[3]->GetBinContent(b); // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>) | |
14398 | wCov48 = fIntFlowCovariancesVsM[4]->GetBinContent(b); // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>) | |
14399 | wCov68 = fIntFlowCovariancesVsM[5]->GetBinContent(b); // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>) | |
14400 | } | |
14401 | } else | |
14402 | { | |
14403 | // TH2D: | |
8d1c89ad | 14404 | Int_t nEntries = (Int_t)(fCorrelationProduct2468VsMult[0]->ProjectionY("Cov(2,4)",b,b)->GetEntries()); |
1db7eced | 14405 | if(nEntries>0.) |
14406 | { | |
14407 | wCov24 = (fCorrelationProduct2468VsMult[0]->ProjectionY("Cov(2,4)",b,b)->GetMean() | |
14408 | - (fCorrelation2468VsMult[0]->ProjectionY("2cov",b,b)->GetMean()) | |
14409 | * (fCorrelation2468VsMult[1]->ProjectionY("4cov",b,b)->GetMean())) | |
14410 | / nEntries; // w*Cov(<2>,<4>) | |
14411 | } // end of if(nEntries>0. && dn2pCombinations>0. && dn4pCombinations>0.) | |
14412 | // ... TBI add other covariances as well | |
14413 | } | |
14414 | } // end of if(!fForgetAboutCovariances) | |
9da1a4f3 | 14415 | // Q-cumulants: |
14416 | qc2 = 0.; // QC{2} | |
14417 | qc4 = 0.; // QC{4} | |
14418 | qc6 = 0.; // QC{6} | |
14419 | qc8 = 0.; // QC{8} | |
b3dacf6b | 14420 | if(TMath::Abs(two) > 0.){qc2 = two;} |
14421 | if(TMath::Abs(four) > 0.){qc4 = four-2.*pow(two,2.);} | |
14422 | if(TMath::Abs(six) > 0.){qc6 = six-9.*two*four+12.*pow(two,3.);} | |
14423 | if(TMath::Abs(eight) > 0.){qc8 = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.);} | |
14424 | // Statistical errors of Q-cumulants: | |
9da1a4f3 | 14425 | qc2Error = 0.; |
14426 | qc4Error = 0.; | |
14427 | qc6Error = 0.; | |
b3dacf6b | 14428 | qc8Error = 0.; |
14429 | // Squared statistical errors of Q-cumulants: | |
9da1a4f3 | 14430 | //Double_t qc2ErrorSquared = 0.; |
14431 | qc4ErrorSquared = 0.; | |
14432 | qc6ErrorSquared = 0.; | |
b3dacf6b | 14433 | qc8ErrorSquared = 0.; |
14434 | // Statistical error of QC{2}: | |
14435 | qc2Error = twoError; | |
14436 | // Statistical error of QC{4}: | |
9da1a4f3 | 14437 | qc4ErrorSquared = 16.*pow(two,2.)*pow(twoError,2)+pow(fourError,2.) |
1db7eced | 14438 | - 8.*two*wCov24; |
14439 | if(fUseQvectorTerms){qc4ErrorSquared = 0.01*pow(qc4,2.);} // TBI for the time being use bootstrap and ignore this error completely, this method needs an urgent clean-up, as the code is getting fragile here :'( | |
9da1a4f3 | 14440 | if(qc4ErrorSquared>0.) |
14441 | { | |
14442 | qc4Error = pow(qc4ErrorSquared,0.5); | |
14443 | } else | |
14444 | { | |
14445 | // cout<<"WARNING: Statistical error of QC{4} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl; | |
b3dacf6b | 14446 | } |
14447 | // Statistical error of QC{6}: | |
9da1a4f3 | 14448 | qc6ErrorSquared = 81.*pow(4.*pow(two,2.)-four,2.)*pow(twoError,2.) |
14449 | + 81.*pow(two,2.)*pow(fourError,2.) | |
14450 | + pow(sixError,2.) | |
14451 | - 162.*two*(4.*pow(two,2.)-four)*wCov24 | |
14452 | + 18.*(4.*pow(two,2.)-four)*wCov26 | |
b3dacf6b | 14453 | - 18.*two*wCov46; |
9da1a4f3 | 14454 | if(qc6ErrorSquared>0.) |
14455 | { | |
14456 | qc6Error = pow(qc6ErrorSquared,0.5); | |
14457 | } else | |
14458 | { | |
14459 | // cout<<"WARNING: Statistical error of QC{6} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl; | |
b3dacf6b | 14460 | } |
14461 | // Statistical error of QC{8}: | |
9da1a4f3 | 14462 | qc8ErrorSquared = 256.*pow(36.*pow(two,3.)-18.*four*two+six,2.)*pow(twoError,2.) |
14463 | + 1296.*pow(4.*pow(two,2.)-four,2.)*pow(fourError,2.) | |
14464 | + 256.*pow(two,2.)*pow(sixError,2.) | |
14465 | + pow(eightError,2.) | |
14466 | - 1152.*(36.*pow(two,3.)-18.*four*two+six)*(4.*pow(two,2.)-four)*wCov24 | |
14467 | + 512.*two*(36.*pow(two,3.)-18.*four*two+six)*wCov26 | |
14468 | - 32.*(36.*pow(two,3.)-18.*four*two+six)*wCov28 | |
14469 | - 1152.*two*(4.*pow(two,2.)-four)*wCov46 | |
14470 | + 72.*(4.*pow(two,2.)-four)*wCov48 | |
14471 | - 32.*two*wCov68; | |
14472 | if(qc8ErrorSquared>0.) | |
14473 | { | |
14474 | qc8Error = pow(qc8ErrorSquared,0.5); | |
14475 | } else | |
14476 | { | |
14477 | // cout<<"WARNING: Statistical error of QC{8} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl; | |
14478 | } | |
b3dacf6b | 14479 | // Store the results and statistical errors for Q-cumulants: |
14480 | if(TMath::Abs(qc2)>0.) | |
14481 | { | |
14482 | fIntFlowQcumulantsVsM[0]->SetBinContent(b,qc2); | |
14483 | fIntFlowQcumulantsVsM[0]->SetBinError(b,qc2Error); | |
14484 | } | |
14485 | if(TMath::Abs(qc4)>0.) | |
14486 | { | |
14487 | fIntFlowQcumulantsVsM[1]->SetBinContent(b,qc4); | |
14488 | fIntFlowQcumulantsVsM[1]->SetBinError(b,qc4Error); | |
14489 | } | |
14490 | if(TMath::Abs(qc6)>0.) | |
14491 | { | |
14492 | fIntFlowQcumulantsVsM[2]->SetBinContent(b,qc6); | |
14493 | fIntFlowQcumulantsVsM[2]->SetBinError(b,qc6Error); | |
14494 | } | |
14495 | if(TMath::Abs(qc8)>0.) | |
14496 | { | |
14497 | fIntFlowQcumulantsVsM[3]->SetBinContent(b,qc8); | |
14498 | fIntFlowQcumulantsVsM[3]->SetBinError(b,qc8Error); | |
14499 | } | |
14500 | // Rebin in M: | |
14501 | for(Int_t co=0;co<4;co++) | |
14502 | { | |
b40a910e | 14503 | if(fIntFlowCorrelationsVsMPro[co]->GetBinEffectiveEntries(b)<2){continue;} |
b3dacf6b | 14504 | value[co] = fIntFlowQcumulantsVsM[co]->GetBinContent(b); |
14505 | error[co] = fIntFlowQcumulantsVsM[co]->GetBinError(b); | |
14506 | if(error[co]>0.) | |
14507 | { | |
14508 | dSum1[co]+=value[co]/(error[co]*error[co]); | |
14509 | dSum2[co]+=1./(error[co]*error[co]); | |
14510 | } | |
14511 | } // end of for(Int_t co=0;co<4;co++) | |
9da1a4f3 | 14512 | } // end of for(Int_t b=1;b<=nBins;b++) |
b3dacf6b | 14513 | // Store rebinned Q-cumulants: |
14514 | for(Int_t co=0;co<4;co++) | |
14515 | { | |
14516 | if(dSum2[co]>0.) | |
14517 | { | |
14518 | fIntFlowQcumulantsRebinnedInM->SetBinContent(co+1,dSum1[co]/dSum2[co]); | |
14519 | fIntFlowQcumulantsRebinnedInM->SetBinError(co+1,pow(1./dSum2[co],0.5)); | |
14520 | } | |
14521 | } // end of for(Int_t co=0;co<4;co++) | |
14522 | ||
489d5531 | 14523 | } // end of AliFlowAnalysisWithQCumulants::CalculateCumulantsIntFlow() |
14524 | ||
489d5531 | 14525 | //================================================================================================================================ |
14526 | ||
b92ea2b9 | 14527 | void AliFlowAnalysisWithQCumulants::CalculateReferenceFlow() |
489d5531 | 14528 | { |
b92ea2b9 | 14529 | // a) Calculate the final results for reference flow estimates from Q-cumulants; |
14530 | // b) Propagate the statistical errors to reference flow estimates from statistical error of Q-cumulants; | |
0328db2d | 14531 | // c) Store the results and statistical errors of reference flow estimates in histogram fIntFlow. |
489d5531 | 14532 | // Binning of fIntFlow is organized as follows: |
14533 | // | |
b3dacf6b | 14534 | // 1st bin: v{2,QC} |
14535 | // 2nd bin: v{4,QC} | |
14536 | // 3rd bin: v{6,QC} | |
14537 | // 4th bin: v{8,QC} | |
14538 | // | |
489d5531 | 14539 | |
b3dacf6b | 14540 | // Reference flow estimates: |
489d5531 | 14541 | Double_t v2 = 0.; // v{2,QC} |
14542 | Double_t v4 = 0.; // v{4,QC} | |
14543 | Double_t v6 = 0.; // v{6,QC} | |
14544 | Double_t v8 = 0.; // v{8,QC} | |
b3dacf6b | 14545 | // Reference flow's statistical errors: |
14546 | Double_t v2Error = 0.; // v{2,QC} stat. error | |
14547 | Double_t v4Error = 0.; // v{4,QC} stat. error | |
14548 | Double_t v6Error = 0.; // v{6,QC} stat. error | |
14549 | Double_t v8Error = 0.; // v{8,QC} stat. error | |
14550 | ||
b92ea2b9 | 14551 | // Q-cumulants: |
14552 | Double_t qc2 = fIntFlowQcumulants->GetBinContent(1); // QC{2} | |
14553 | Double_t qc4 = fIntFlowQcumulants->GetBinContent(2); // QC{4} | |
14554 | Double_t qc6 = fIntFlowQcumulants->GetBinContent(3); // QC{6} | |
14555 | Double_t qc8 = fIntFlowQcumulants->GetBinContent(4); // QC{8} | |
14556 | // Q-cumulants's statistical errors: | |
14557 | Double_t qc2Error = fIntFlowQcumulants->GetBinError(1); // QC{2} stat. error | |
14558 | Double_t qc4Error = fIntFlowQcumulants->GetBinError(2); // QC{4} stat. error | |
14559 | Double_t qc6Error = fIntFlowQcumulants->GetBinError(3); // QC{6} stat. error | |
14560 | Double_t qc8Error = fIntFlowQcumulants->GetBinError(4); // QC{8} stat. error | |
14561 | // Calculate reference flow estimates from Q-cumulants: | |
1268c371 | 14562 | if(qc2>=0.){v2 = pow(qc2,0.5);} |
b92ea2b9 | 14563 | if(qc4<=0.){v4 = pow(-1.*qc4,1./4.);} |
14564 | if(qc6>=0.){v6 = pow((1./4.)*qc6,1./6.);} | |
14565 | if(qc8<=0.){v8 = pow((-1./33.)*qc8,1./8.);} | |
14566 | // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants: | |
1268c371 | 14567 | if(qc2>0.){v2Error = (1./2.)*pow(qc2,-0.5)*qc2Error;} |
b92ea2b9 | 14568 | if(qc4<0.){v4Error = (1./4.)*pow(-qc4,-3./4.)*qc4Error;} |
14569 | if(qc6>0.){v6Error = (1./6.)*pow(2.,-1./3.)*pow(qc6,-5./6.)*qc6Error;} | |
14570 | if(qc8<0.){v8Error = (1./8.)*pow(33.,-1./8.)*pow(-qc8,-7./8.)*qc8Error;} | |
14571 | // Print warnings for the 'wrong sign' cumulants: | |
14572 | if(TMath::Abs(v2) < 1.e-44) | |
14573 | { | |
14574 | cout<<" WARNING: Wrong sign QC{2}, couldn't calculate v{2,QC} !!!!"<<endl; | |
14575 | } | |
14576 | if(TMath::Abs(v4) < 1.e-44) | |
14577 | { | |
14578 | cout<<" WARNING: Wrong sign QC{4}, couldn't calculate v{4,QC} !!!!"<<endl; | |
14579 | } | |
14580 | if(TMath::Abs(v6) < 1.e-44) | |
14581 | { | |
14582 | cout<<" WARNING: Wrong sign QC{6}, couldn't calculate v{6,QC} !!!!"<<endl; | |
14583 | } | |
14584 | if(TMath::Abs(v8) < 1.e-44) | |
14585 | { | |
14586 | cout<<" WARNING: Wrong sign QC{8}, couldn't calculate v{8,QC} !!!!"<<endl; | |
14587 | } | |
14588 | // Store the results and statistical errors of integrated flow estimates: | |
14589 | fIntFlow->SetBinContent(1,v2); | |
14590 | fIntFlow->SetBinError(1,v2Error); | |
14591 | fIntFlow->SetBinContent(2,v4); | |
14592 | fIntFlow->SetBinError(2,v4Error); | |
14593 | fIntFlow->SetBinContent(3,v6); | |
14594 | fIntFlow->SetBinError(3,v6Error); | |
14595 | fIntFlow->SetBinContent(4,v8); | |
14596 | fIntFlow->SetBinError(4,v8Error); | |
14597 | ||
14598 | // Versus multiplicity: | |
14599 | if(!fCalculateCumulantsVsM){return;} | |
14600 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) | |
14601 | for(Int_t b=1;b<=nBins;b++) | |
9da1a4f3 | 14602 | { |
14603 | // Q-cumulants: | |
b92ea2b9 | 14604 | Double_t qc2VsM = fIntFlowQcumulantsVsM[0]->GetBinContent(b); // QC{2} |
14605 | Double_t qc4VsM = fIntFlowQcumulantsVsM[1]->GetBinContent(b); // QC{4} | |
14606 | Double_t qc6VsM = fIntFlowQcumulantsVsM[2]->GetBinContent(b); // QC{6} | |
14607 | Double_t qc8VsM = fIntFlowQcumulantsVsM[3]->GetBinContent(b); // QC{8} | |
b3dacf6b | 14608 | // Q-cumulants's statistical errors: |
b92ea2b9 | 14609 | Double_t qc2ErrorVsM = fIntFlowQcumulantsVsM[0]->GetBinError(b); // QC{2} stat. error |
14610 | Double_t qc4ErrorVsM = fIntFlowQcumulantsVsM[1]->GetBinError(b); // QC{4} stat. error | |
14611 | Double_t qc6ErrorVsM = fIntFlowQcumulantsVsM[2]->GetBinError(b); // QC{6} stat. error | |
14612 | Double_t qc8ErrorVsM = fIntFlowQcumulantsVsM[3]->GetBinError(b); // QC{8} stat. error | |
b3dacf6b | 14613 | // Reference flow estimates: |
b92ea2b9 | 14614 | Double_t v2VsM = 0.; // v{2,QC} |
14615 | Double_t v4VsM = 0.; // v{4,QC} | |
14616 | Double_t v6VsM = 0.; // v{6,QC} | |
14617 | Double_t v8VsM = 0.; // v{8,QC} | |
14618 | // Reference flow estimates errors: | |
14619 | Double_t v2ErrorVsM = 0.; // v{2,QC} stat. error | |
14620 | Double_t v4ErrorVsM = 0.; // v{4,QC} stat. error | |
14621 | Double_t v6ErrorVsM = 0.; // v{6,QC} stat. error | |
14622 | Double_t v8ErrorVsM = 0.; // v{8,QC} stat. error | |
b3dacf6b | 14623 | // Calculate reference flow estimates from Q-cumulants: |
1268c371 | 14624 | if(qc2VsM>=0.){v2VsM = pow(qc2VsM,0.5);} |
b92ea2b9 | 14625 | if(qc4VsM<=0.){v4VsM = pow(-1.*qc4VsM,1./4.);} |
14626 | if(qc6VsM>=0.){v6VsM = pow((1./4.)*qc6VsM,1./6.);} | |
14627 | if(qc8VsM<=0.){v8VsM = pow((-1./33.)*qc8VsM,1./8.);} | |
b3dacf6b | 14628 | // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants: |
1268c371 | 14629 | if(qc2VsM>0.){v2ErrorVsM = (1./2.)*pow(qc2VsM,-0.5)*qc2ErrorVsM;} |
b92ea2b9 | 14630 | if(qc4VsM<0.){v4ErrorVsM = (1./4.)*pow(-qc4VsM,-3./4.)*qc4ErrorVsM;} |
14631 | if(qc6VsM>0.){v6ErrorVsM = (1./6.)*pow(2.,-1./3.)*pow(qc6VsM,-5./6.)*qc6ErrorVsM;} | |
14632 | if(qc8VsM<0.){v8ErrorVsM = (1./8.)*pow(33.,-1./8.)*pow(-qc8VsM,-7./8.)*qc8ErrorVsM;} | |
b3dacf6b | 14633 | // Store the results and statistical errors of integrated flow estimates: |
b92ea2b9 | 14634 | fIntFlowVsM[0]->SetBinContent(b,v2VsM); |
14635 | fIntFlowVsM[0]->SetBinError(b,v2ErrorVsM); | |
14636 | fIntFlowVsM[1]->SetBinContent(b,v4VsM); | |
14637 | fIntFlowVsM[1]->SetBinError(b,v4ErrorVsM); | |
14638 | fIntFlowVsM[2]->SetBinContent(b,v6VsM); | |
14639 | fIntFlowVsM[2]->SetBinError(b,v6ErrorVsM); | |
14640 | fIntFlowVsM[3]->SetBinContent(b,v8VsM); | |
14641 | fIntFlowVsM[3]->SetBinError(b,v8ErrorVsM); | |
14642 | } // end of for(Int_t b=1;b<=nBins;b++) | |
14643 | ||
14644 | // 'Rebinned in M' calculation: // to be improved - this can be implemented better: | |
14645 | // Reference flow estimates: | |
14646 | Double_t v2RebinnedInM = 0.; // v{2,QC} | |
14647 | Double_t v4RebinnedInM = 0.; // v{4,QC} | |
14648 | Double_t v6RebinnedInM = 0.; // v{6,QC} | |
14649 | Double_t v8RebinnedInM = 0.; // v{8,QC} | |
14650 | // Reference flow's statistical errors: | |
14651 | Double_t v2ErrorRebinnedInM = 0.; // v{2,QC} stat. error | |
14652 | Double_t v4ErrorRebinnedInM = 0.; // v{4,QC} stat. error | |
14653 | Double_t v6ErrorRebinnedInM = 0.; // v{6,QC} stat. error | |
14654 | Double_t v8ErrorRebinnedInM = 0.; // v{8,QC} stat. error | |
14655 | // Q-cumulants: | |
14656 | Double_t qc2RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(1); // QC{2} | |
14657 | Double_t qc4RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(2); // QC{4} | |
14658 | Double_t qc6RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(3); // QC{6} | |
14659 | Double_t qc8RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(4); // QC{8} | |
14660 | // Q-cumulants's statistical errors: | |
14661 | Double_t qc2ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(1); // QC{2} stat. error | |
14662 | Double_t qc4ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(2); // QC{4} stat. error | |
14663 | Double_t qc6ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(3); // QC{6} stat. error | |
14664 | Double_t qc8ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(4); // QC{8} stat. error | |
14665 | // Calculate reference flow estimates from Q-cumulants: | |
1268c371 | 14666 | if(qc2RebinnedInM>=0.){v2RebinnedInM = pow(qc2RebinnedInM,0.5);} |
b92ea2b9 | 14667 | if(qc4RebinnedInM<=0.){v4RebinnedInM = pow(-1.*qc4RebinnedInM,1./4.);} |
14668 | if(qc6RebinnedInM>=0.){v6RebinnedInM = pow((1./4.)*qc6RebinnedInM,1./6.);} | |
14669 | if(qc8RebinnedInM<=0.){v8RebinnedInM = pow((-1./33.)*qc8RebinnedInM,1./8.);} | |
14670 | // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants: | |
1268c371 | 14671 | if(qc2RebinnedInM>0.){v2ErrorRebinnedInM = (1./2.)*pow(qc2RebinnedInM,-0.5)*qc2ErrorRebinnedInM;} |
b92ea2b9 | 14672 | if(qc4RebinnedInM<0.){v4ErrorRebinnedInM = (1./4.)*pow(-qc4RebinnedInM,-3./4.)*qc4ErrorRebinnedInM;} |
14673 | if(qc6RebinnedInM>0.){v6ErrorRebinnedInM = (1./6.)*pow(2.,-1./3.)*pow(qc6RebinnedInM,-5./6.)*qc6ErrorRebinnedInM;} | |
14674 | if(qc8RebinnedInM<0.){v8ErrorRebinnedInM = (1./8.)*pow(33.,-1./8.)*pow(-qc8RebinnedInM,-7./8.)*qc8ErrorRebinnedInM;} | |
14675 | // Print warnings for the 'wrong sign' cumulants: | |
14676 | if(TMath::Abs(v2RebinnedInM) < 1.e-44) | |
14677 | { | |
14678 | cout<<" WARNING: Wrong sign QC{2} rebinned in M, couldn't calculate v{2,QC} !!!!"<<endl; | |
14679 | } | |
14680 | if(TMath::Abs(v4RebinnedInM) < 1.e-44) | |
14681 | { | |
14682 | cout<<" WARNING: Wrong sign QC{4} rebinned in M, couldn't calculate v{4,QC} !!!!"<<endl; | |
14683 | } | |
14684 | if(TMath::Abs(v6RebinnedInM) < 1.e-44) | |
14685 | { | |
14686 | cout<<" WARNING: Wrong sign QC{6} rebinned in M, couldn't calculate v{6,QC} !!!!"<<endl; | |
14687 | } | |
14688 | if(TMath::Abs(v8RebinnedInM) < 1.e-44) | |
14689 | { | |
14690 | cout<<" WARNING: Wrong sign QC{8} rebinned in M, couldn't calculate v{8,QC} !!!!"<<endl; | |
14691 | } | |
14692 | // Store the results and statistical errors of integrated flow estimates: | |
14693 | fIntFlowRebinnedInM->SetBinContent(1,v2RebinnedInM); | |
14694 | fIntFlowRebinnedInM->SetBinError(1,v2ErrorRebinnedInM); | |
14695 | fIntFlowRebinnedInM->SetBinContent(2,v4RebinnedInM); | |
14696 | fIntFlowRebinnedInM->SetBinError(2,v4ErrorRebinnedInM); | |
14697 | fIntFlowRebinnedInM->SetBinContent(3,v6RebinnedInM); | |
14698 | fIntFlowRebinnedInM->SetBinError(3,v6ErrorRebinnedInM); | |
14699 | fIntFlowRebinnedInM->SetBinContent(4,v8RebinnedInM); | |
14700 | fIntFlowRebinnedInM->SetBinError(4,v8ErrorRebinnedInM); | |
14701 | ||
14702 | } // end of AliFlowAnalysisWithQCumulants::CalculateReferenceFlow() | |
489d5531 | 14703 | |
489d5531 | 14704 | //================================================================================================================================ |
14705 | ||
489d5531 | 14706 | void AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow() |
14707 | { | |
0dd3b008 | 14708 | // Fill in AliFlowCommonHistResults histograms relevant for reference flow. |
489d5531 | 14709 | |
0dd3b008 | 14710 | // There are two possibilities here: |
14711 | // a) Store minimum bias reference flow - use SetMinimumBiasReferenceFlow(kTRUE). This result is | |
14712 | // biased by the interplay between nonflow correlations and multiplicity fluctuations and is | |
14713 | // also stored in local histogram fIntFlow; | |
14714 | // b) Store reference flow obtained from flow analysis performed at fixed multiplicity and | |
14715 | // rebinned only at the end of the day - use SetMinimumBiasReferenceFlow(kFALSE). This result | |
14716 | // is also stored in local histogram fIntFlowRebinnedInM. | |
489d5531 | 14717 | |
0dd3b008 | 14718 | // Reference flow estimates: |
14719 | Double_t v[4] = {0.}; | |
14720 | // Statistical errors of reference flow estimates: | |
14721 | Double_t vError[4] = {0.}; | |
489d5531 | 14722 | |
0dd3b008 | 14723 | for(Int_t b=0;b<4;b++) |
14724 | { | |
14725 | if(fMinimumBiasReferenceFlow) | |
14726 | { | |
14727 | v[b] = fIntFlow->GetBinContent(b+1); | |
14728 | vError[b] = fIntFlow->GetBinError(b+1); | |
14729 | } else | |
14730 | { | |
14731 | v[b] = fIntFlowRebinnedInM->GetBinContent(b+1); | |
14732 | vError[b] = fIntFlowRebinnedInM->GetBinError(b+1); | |
14733 | } | |
14734 | } // end of for(Int_t b=0;b<4;b++) | |
14735 | ||
14736 | // Fill AliFlowCommonHistResults histogram: | |
14737 | fCommonHistsResults2nd->FillIntegratedFlow(v[0],vError[0]); // to be improved (hardwired 2nd in the name) | |
14738 | fCommonHistsResults4th->FillIntegratedFlow(v[1],vError[1]); // to be improved (hardwired 4th in the name) | |
403e3389 | 14739 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) // to be improved (calculate also 6th and 8th order) |
489d5531 | 14740 | { |
0dd3b008 | 14741 | fCommonHistsResults6th->FillIntegratedFlow(v[2],vError[2]); // to be improved (hardwired 6th in the name) |
14742 | fCommonHistsResults8th->FillIntegratedFlow(v[3],vError[3]); // to be improved (hardwired 8th in the name) | |
489d5531 | 14743 | } |
14744 | ||
14745 | } // end of AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow() | |
14746 | ||
489d5531 | 14747 | //================================================================================================================================ |
14748 | ||
489d5531 | 14749 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelationsUsingParticleWeights() |
14750 | { | |
14751 | // Calculate all correlations needed for integrated flow using particle weights. | |
14752 | ||
14753 | // Remark 1: When particle weights are used the binning of fIntFlowCorrelationAllPro is organized as follows: | |
14754 | // | |
14755 | // 1st bin: <2>_{1n|1n} = two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))> | |
14756 | // 2nd bin: <2>_{2n|2n} = two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
14757 | // 3rd bin: <2>_{3n|3n} = two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
14758 | // 4th bin: <2>_{4n|4n} = two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
14759 | // 5th bin: ---- EMPTY ---- | |
14760 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
14761 | // 7th bin: <3>_{3n|2n,1n} = ... | |
14762 | // 8th bin: <3>_{4n|2n,2n} = ... | |
14763 | // 9th bin: <3>_{4n|3n,1n} = ... | |
14764 | // 10th bin: ---- EMPTY ---- | |
14765 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
14766 | // 12th bin: <4>_{2n,1n|2n,1n} = ... | |
14767 | // 13th bin: <4>_{2n,2n|2n,2n} = ... | |
14768 | // 14th bin: <4>_{3n|1n,1n,1n} = ... | |
14769 | // 15th bin: <4>_{3n,1n|3n,1n} = ... | |
14770 | // 16th bin: <4>_{3n,1n|2n,2n} = ... | |
14771 | // 17th bin: <4>_{4n|2n,1n,1n} = ... | |
14772 | // 18th bin: ---- EMPTY ---- | |
14773 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = ... | |
14774 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = ... | |
14775 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = ... | |
14776 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = ... | |
14777 | // 23rd bin: ---- EMPTY ---- | |
14778 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = ... | |
14779 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = ... | |
14780 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = ... | |
14781 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = ... | |
14782 | // 28th bin: ---- EMPTY ---- | |
14783 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = ... | |
14784 | // 30th bin: ---- EMPTY ---- | |
14785 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = ... | |
14786 | ||
14787 | // Remark 2: When particle weights are used there are some extra correlations. They are stored in | |
14788 | // fIntFlowExtraCorrelationsPro binning of which is organized as follows: | |
14789 | ||
14790 | // 1st bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))> | |
14791 | // 2nd bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
14792 | ||
14793 | // multiplicity (number of particles used to determine the reaction plane) | |
1268c371 | 14794 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 14795 | |
14796 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
14797 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
14798 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
14799 | Double_t dReQ3n3k = (*fReQ)(2,3); | |
14800 | Double_t dReQ4n4k = (*fReQ)(3,4); | |
14801 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
14802 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
14803 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
14804 | Double_t dImQ3n3k = (*fImQ)(2,3); | |
14805 | Double_t dImQ4n4k = (*fImQ)(3,4); | |
14806 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
14807 | ||
14808 | // dMs are variables introduced in order to simplify some Eqs. bellow: | |
14809 | //.............................................................................................. | |
1268c371 | 14810 | Double_t dM11 = (*fSpk)(1,1)-(*fSpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
14811 | Double_t dM22 = (*fSpk)(1,2)-(*fSpk)(0,4); // dM22 = sum_{i,j=1,i!=j}^M w_i^2 w_j^2 | |
14812 | Double_t dM33 = (*fSpk)(1,3)-(*fSpk)(0,6); // dM33 = sum_{i,j=1,i!=j}^M w_i^3 w_j^3 | |
14813 | Double_t dM44 = (*fSpk)(1,4)-(*fSpk)(0,8); // dM44 = sum_{i,j=1,i!=j}^M w_i^4 w_j^4 | |
14814 | Double_t dM31 = (*fSpk)(0,3)*(*fSpk)(0,1)-(*fSpk)(0,4); // dM31 = sum_{i,j=1,i!=j}^M w_i^3 w_j | |
14815 | Double_t dM211 = (*fSpk)(0,2)*(*fSpk)(1,1)-2.*(*fSpk)(0,3)*(*fSpk)(0,1) | |
14816 | - (*fSpk)(1,2)+2.*(*fSpk)(0,4); // dM211 = sum_{i,j,k=1,i!=j!=k}^M w_i^2 w_j w_k | |
14817 | Double_t dM1111 = (*fSpk)(3,1)-6.*(*fSpk)(0,2)*(*fSpk)(1,1) | |
14818 | + 8.*(*fSpk)(0,3)*(*fSpk)(0,1) | |
14819 | + 3.*(*fSpk)(1,2)-6.*(*fSpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l | |
489d5531 | 14820 | //.............................................................................................. |
14821 | ||
14822 | // 2-particle correlations: | |
14823 | Double_t two1n1nW1W1 = 0.; // <w1 w2 cos(n*(phi1-phi2))> | |
14824 | Double_t two2n2nW2W2 = 0.; // <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
14825 | Double_t two3n3nW3W3 = 0.; // <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
14826 | Double_t two4n4nW4W4 = 0.; // <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
14827 | if(dMult>1) | |
14828 | { | |
14829 | if(dM11) | |
14830 | { | |
1268c371 | 14831 | two1n1nW1W1 = (pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSpk)(0,2))/dM11; |
489d5531 | 14832 | // average correlation <w1 w2 cos(n*(phi1-phi2))> for single event: |
14833 | fIntFlowCorrelationsEBE->SetBinContent(1,two1n1nW1W1); | |
14834 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(1,dM11); | |
14835 | // average correlation <w1 w2 cos(n*(phi1-phi2))> for all events: | |
b40a910e | 14836 | fIntFlowCorrelationsPro->Fill(0.5,two1n1nW1W1,dM11); |
14837 | // average squared correlation <w1 w2 cos(n*(phi1-phi2))> for all events: | |
14838 | fIntFlowSquaredCorrelationsPro->Fill(0.5,two1n1nW1W1*two1n1nW1W1,dM11); | |
489d5531 | 14839 | fIntFlowCorrelationsAllPro->Fill(0.5,two1n1nW1W1,dM11); |
14840 | } | |
14841 | if(dM22) | |
14842 | { | |
1268c371 | 14843 | two2n2nW2W2 = (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)-(*fSpk)(0,4))/dM22; |
489d5531 | 14844 | // ... |
14845 | // average correlation <w1^2 w2^2 cos(2n*(phi1-phi2))> for all events: | |
14846 | fIntFlowCorrelationsAllPro->Fill(1.5,two2n2nW2W2,dM22); | |
14847 | } | |
14848 | if(dM33) | |
14849 | { | |
1268c371 | 14850 | two3n3nW3W3 = (pow(dReQ3n3k,2)+pow(dImQ3n3k,2)-(*fSpk)(0,6))/dM33; |
489d5531 | 14851 | // ... |
14852 | // average correlation <w1^3 w2^3 cos(3n*(phi1-phi2))> for all events: | |
14853 | fIntFlowCorrelationsAllPro->Fill(2.5,two3n3nW3W3,dM33); | |
14854 | } | |
14855 | if(dM44) | |
14856 | { | |
1268c371 | 14857 | two4n4nW4W4 = (pow(dReQ4n4k,2)+pow(dImQ4n4k,2)-(*fSpk)(0,8))/dM44; |
489d5531 | 14858 | // ... |
14859 | // average correlation <w1^4 w2^4 cos(4n*(phi1-phi2))> for all events: | |
14860 | fIntFlowCorrelationsAllPro->Fill(3.5,two4n4nW4W4,dM44); | |
14861 | } | |
14862 | } // end of if(dMult>1) | |
14863 | ||
14864 | // extra 2-particle correlations: | |
14865 | Double_t two1n1nW3W1 = 0.; // <w1^3 w2 cos(n*(phi1-phi2))> | |
14866 | Double_t two1n1nW1W1W2 = 0.; // <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
14867 | if(dMult>1) | |
14868 | { | |
14869 | if(dM31) | |
14870 | { | |
1268c371 | 14871 | two1n1nW3W1 = (dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k-(*fSpk)(0,4))/dM31; |
489d5531 | 14872 | fIntFlowExtraCorrelationsPro->Fill(0.5,two1n1nW3W1,dM31); |
14873 | } | |
14874 | if(dM211) | |
14875 | { | |
1268c371 | 14876 | two1n1nW1W1W2 = ((*fSpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSpk)(0,2)) |
489d5531 | 14877 | - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k |
1268c371 | 14878 | - (*fSpk)(0,4)))/dM211; |
489d5531 | 14879 | fIntFlowExtraCorrelationsPro->Fill(1.5,two1n1nW1W1W2,dM211); |
14880 | } | |
14881 | } // end of if(dMult>1) | |
14882 | //.............................................................................................. | |
14883 | ||
14884 | //.............................................................................................. | |
14885 | // 3-particle correlations: | |
14886 | Double_t three2n1n1nW2W1W1 = 0.; // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
14887 | ||
14888 | if(dMult>2) | |
14889 | { | |
14890 | if(dM211) | |
14891 | { | |
14892 | three2n1n1nW2W1W1 = (pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k | |
14893 | - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k) | |
14894 | - pow(dReQ2n2k,2)-pow(dImQ2n2k,2) | |
1268c371 | 14895 | + 2.*(*fSpk)(0,4))/dM211; |
489d5531 | 14896 | fIntFlowCorrelationsAllPro->Fill(5.5,three2n1n1nW2W1W1,dM211); |
14897 | } | |
14898 | } // end of if(dMult>2) | |
14899 | //.............................................................................................. | |
14900 | ||
14901 | //.............................................................................................. | |
14902 | // 4-particle correlations: | |
14903 | Double_t four1n1n1n1nW1W1W1W1 = 0.; // <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
14904 | if(dMult>3) | |
14905 | { | |
14906 | if(dM1111) | |
14907 | { | |
14908 | four1n1n1n1nW1W1W1W1 = (pow(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.),2) | |
14909 | - 2.*(pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k) | |
14910 | + 8.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k) | |
14911 | + (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)) | |
1268c371 | 14912 | - 4.*(*fSpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
14913 | - 6.*(*fSpk)(0,4)+2.*(*fSpk)(1,2))/dM1111; | |
489d5531 | 14914 | |
14915 | // average correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for single event: | |
14916 | fIntFlowCorrelationsEBE->SetBinContent(2,four1n1n1n1nW1W1W1W1); | |
14917 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(2,dM1111); | |
14918 | // average correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for all events: | |
14919 | fIntFlowCorrelationsPro->Fill(1.5,four1n1n1n1nW1W1W1W1,dM1111); | |
b40a910e | 14920 | // average squared correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for all events: |
14921 | fIntFlowSquaredCorrelationsPro->Fill(1.5,four1n1n1n1nW1W1W1W1*four1n1n1n1nW1W1W1W1,dM1111); | |
489d5531 | 14922 | fIntFlowCorrelationsAllPro->Fill(10.5,four1n1n1n1nW1W1W1W1,dM1111); |
14923 | } | |
14924 | } // end of if(dMult>3) | |
14925 | //.............................................................................................. | |
14926 | ||
14927 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelationsUsingParticleWeights() | |
14928 | ||
e1d101a6 | 14929 | //======================================================================================================================= |
489d5531 | 14930 | |
489d5531 | 14931 | void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow() |
14932 | { | |
14933 | // Initialize all arrays used to calculate integrated flow. | |
14934 | ||
14935 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
14936 | { | |
14937 | fIntFlowCorrectionTermsForNUAEBE[sc] = NULL; | |
0328db2d | 14938 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc] = NULL; |
489d5531 | 14939 | fIntFlowCorrectionTermsForNUAPro[sc] = NULL; |
14940 | fIntFlowCorrectionTermsForNUAHist[sc] = NULL; | |
b92ea2b9 | 14941 | for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) |
2001bc3a | 14942 | { |
14943 | fIntFlowCorrectionTermsForNUAVsMPro[sc][ci] = NULL; | |
14944 | } | |
0328db2d | 14945 | for(Int_t power=0;power<2;power++) // linear or quadratic |
14946 | { | |
14947 | fIntFlowSumOfEventWeightsNUA[sc][power] = NULL; | |
14948 | } | |
489d5531 | 14949 | } |
14950 | for(Int_t power=0;power<2;power++) // linear or quadratic | |
14951 | { | |
14952 | fIntFlowSumOfEventWeights[power] = NULL; | |
14953 | } | |
b3dacf6b | 14954 | for(Int_t i=0;i<4;i++) // print on the screen the final results (0=RF, 1=RP, 2=POI, 3=RF (rebbined in M)) |
489d5531 | 14955 | { |
14956 | fPrintFinalResults[i] = kTRUE; | |
14957 | } | |
ff70ca91 | 14958 | for(Int_t ci=0;ci<4;ci++) // correlation index or cumulant order |
14959 | { | |
14960 | fIntFlowCorrelationsVsMPro[ci] = NULL; | |
b40a910e | 14961 | fIntFlowSquaredCorrelationsVsMPro[ci] = NULL; |
ff70ca91 | 14962 | fIntFlowCorrelationsVsMHist[ci] = NULL; |
14963 | fIntFlowQcumulantsVsM[ci] = NULL; | |
14964 | fIntFlowVsM[ci] = NULL; | |
2001bc3a | 14965 | fIntFlowDetectorBiasVsM[ci] = NULL; |
ff70ca91 | 14966 | for(Int_t lc=0;lc<2;lc++) |
14967 | { | |
14968 | fIntFlowSumOfEventWeightsVsM[ci][lc] = NULL; | |
14969 | } | |
14970 | } | |
14971 | for(Int_t pi=0;pi<6;pi++) // product or covariance index | |
14972 | { | |
14973 | fIntFlowProductOfCorrelationsVsMPro[pi] = NULL; | |
14974 | fIntFlowCovariancesVsM[pi] = NULL; | |
14975 | fIntFlowSumOfProductOfEventWeightsVsM[pi] = NULL; | |
14976 | } | |
403e3389 | 14977 | for(Int_t ci=0;ci<64;ci++) // correlation index for all correlations vs M profiles (to be improved - hardwired 64) |
3435cacb | 14978 | { |
14979 | fIntFlowCorrelationsAllVsMPro[ci] = NULL; | |
14980 | } | |
14981 | ||
489d5531 | 14982 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow() |
14983 | ||
e1d101a6 | 14984 | //======================================================================================================================= |
489d5531 | 14985 | |
489d5531 | 14986 | void AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow() |
14987 | { | |
14988 | // Initialize all arrays needed to calculate differential flow. | |
14989 | // a) Initialize lists holding profiles; | |
14990 | // b) Initialize lists holding histograms; | |
14991 | // c) Initialize event-by-event quantities; | |
14992 | // d) Initialize profiles; | |
14993 | // e) Initialize histograms holding final results. | |
14994 | ||
14995 | // a) Initialize lists holding profiles; | |
14996 | for(Int_t t=0;t<2;t++) // type (RP, POI) | |
14997 | { | |
14998 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
14999 | { | |
15000 | fDiffFlowCorrelationsProList[t][pe] = NULL; | |
15001 | fDiffFlowProductOfCorrelationsProList[t][pe] = NULL; | |
15002 | fDiffFlowCorrectionsProList[t][pe] = NULL; | |
15003 | } | |
1268c371 | 15004 | // 2D: |
15005 | f2DDiffFlowCorrelationsProList[t] = NULL; | |
489d5531 | 15006 | } |
15007 | ||
15008 | // b) Initialize lists holding histograms; | |
15009 | for(Int_t t=0;t<2;t++) // type (RP, POI) | |
15010 | { | |
15011 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
15012 | { | |
15013 | fDiffFlowCorrelationsHistList[t][pe] = NULL; | |
15014 | for(Int_t power=0;power<2;power++) | |
15015 | { | |
15016 | fDiffFlowSumOfEventWeightsHistList[t][pe][power] = NULL; | |
15017 | } // end of for(Int_t power=0;power<2;power++) | |
15018 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe] = NULL; | |
15019 | fDiffFlowCorrectionsHistList[t][pe] = NULL; | |
15020 | fDiffFlowCovariancesHistList[t][pe] = NULL; | |
15021 | fDiffFlowCumulantsHistList[t][pe] = NULL; | |
1268c371 | 15022 | fDiffFlowDetectorBiasHistList[t][pe] = NULL; |
489d5531 | 15023 | fDiffFlowHistList[t][pe] = NULL; |
15024 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
15025 | } // enf of for(Int_t t=0;t<2;t++) // type (RP, POI) | |
15026 | ||
15027 | // c) Initialize event-by-event quantities: | |
15028 | // 1D: | |
15029 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
15030 | { | |
15031 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
15032 | { | |
15033 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
15034 | { | |
15035 | for(Int_t k=0;k<9;k++) // power of weight | |
15036 | { | |
15037 | fReRPQ1dEBE[t][pe][m][k] = NULL; | |
15038 | fImRPQ1dEBE[t][pe][m][k] = NULL; | |
15039 | fs1dEBE[t][pe][k] = NULL; // to be improved (this doesn't need to be within loop over m) | |
15040 | } | |
15041 | } | |
15042 | } | |
15043 | } | |
15044 | // 1D: | |
15045 | for(Int_t t=0;t<2;t++) // type (RP or POI) | |
15046 | { | |
15047 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
15048 | { | |
15049 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
15050 | { | |
15051 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
15052 | { | |
15053 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti] = NULL; | |
15054 | } | |
15055 | } | |
15056 | } | |
15057 | } | |
15058 | // 2D: | |
15059 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
15060 | { | |
15061 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
15062 | { | |
15063 | for(Int_t k=0;k<9;k++) // power of weight | |
15064 | { | |
15065 | fReRPQ2dEBE[t][m][k] = NULL; | |
15066 | fImRPQ2dEBE[t][m][k] = NULL; | |
15067 | fs2dEBE[t][k] = NULL; // to be improved (this doesn't need to be within loop over m) | |
15068 | } | |
15069 | } | |
15070 | } | |
15071 | ||
15072 | // d) Initialize profiles: | |
15073 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
15074 | { | |
15075 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
15076 | { | |
15077 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
15078 | { | |
15079 | fDiffFlowCorrelationsPro[t][pe][ci] = NULL; | |
b40a910e | 15080 | fDiffFlowSquaredCorrelationsPro[t][pe][ci] = NULL; |
489d5531 | 15081 | } // end of for(Int_t ci=0;ci<4;ci++) |
15082 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
15083 | { | |
15084 | for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index | |
15085 | { | |
15086 | fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = NULL; | |
15087 | } // end of for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index | |
15088 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
15089 | // correction terms for nua: | |
15090 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
15091 | { | |
15092 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
15093 | { | |
15094 | fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = NULL; | |
15095 | } | |
15096 | } | |
64e500e3 | 15097 | // other differential correlators: |
15098 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
15099 | { | |
15100 | for(Int_t ci=0;ci<1;ci++) // correction term index | |
15101 | { | |
15102 | fOtherDiffCorrelators[t][pe][sc][ci] = NULL; | |
15103 | } | |
15104 | } | |
489d5531 | 15105 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta |
1268c371 | 15106 | for(Int_t ci=0;ci<4;ci++) // correlation index |
15107 | { | |
15108 | f2DDiffFlowCorrelationsPro[t][ci] = NULL; | |
15109 | } | |
489d5531 | 15110 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI |
15111 | ||
15112 | // e) Initialize histograms holding final results. | |
15113 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
15114 | { | |
15115 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
15116 | { | |
15117 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
15118 | { | |
15119 | fDiffFlowCorrelationsHist[t][pe][ci] = NULL; | |
15120 | fDiffFlowCumulants[t][pe][ci] = NULL; | |
1268c371 | 15121 | fDiffFlowDetectorBias[t][pe][ci] = NULL; |
489d5531 | 15122 | fDiffFlow[t][pe][ci] = NULL; |
15123 | } // end of for(Int_t ci=0;ci<4;ci++) | |
15124 | for(Int_t covarianceIndex=0;covarianceIndex<5;covarianceIndex++) | |
15125 | { | |
15126 | fDiffFlowCovariances[t][pe][covarianceIndex] = NULL; | |
15127 | } // end of for(Int_t covarianceIndex=0;covarianceIndex<5;covarianceIndex++) | |
15128 | // correction terms for nua: | |
15129 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
15130 | { | |
15131 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
15132 | { | |
15133 | fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = NULL; | |
15134 | } | |
15135 | } | |
15136 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
1268c371 | 15137 | for(Int_t ci=0;ci<4;ci++) // correlation index |
15138 | { | |
15139 | f2DDiffFlowCumulants[t][ci] = NULL; | |
15140 | f2DDiffFlow[t][ci] = NULL; | |
15141 | } | |
489d5531 | 15142 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI |
15143 | ||
15144 | // sum of event weights for reduced correlations: | |
15145 | for(Int_t t=0;t<2;t++) // type = RP or POI | |
15146 | { | |
15147 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
15148 | { | |
15149 | for(Int_t p=0;p<2;p++) // power of weight is 1 or 2 | |
15150 | { | |
15151 | for(Int_t ew=0;ew<4;ew++) // event weight index for reduced correlations | |
15152 | { | |
15153 | fDiffFlowSumOfEventWeights[t][pe][p][ew] = NULL; | |
15154 | } | |
15155 | } | |
15156 | } | |
15157 | } | |
15158 | // product of event weights for both types of correlations: | |
15159 | for(Int_t t=0;t<2;t++) // type = RP or POI | |
15160 | { | |
15161 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
15162 | { | |
15163 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
15164 | { | |
15165 | for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index | |
15166 | { | |
15167 | fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = NULL; | |
15168 | } | |
15169 | } | |
15170 | } | |
15171 | } | |
1268c371 | 15172 | |
15173 | } // end of AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow() | |
15174 | ||
e1d101a6 | 15175 | //======================================================================================================================= |
489d5531 | 15176 | |
1268c371 | 15177 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulants(TString type, TString ptOrEta) |
15178 | { | |
15179 | // Calculate differential flow cumulants from measured multiparticle correlations. | |
489d5531 | 15180 | |
1268c371 | 15181 | // REMARK: Cumulants calculated in this method are NOT corrected for non-uniform acceptance. |
15182 | // This correction, if enabled via setter SetApplyCorrectionForNUA(Bool_t), is applied | |
15183 | // in the method CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta) | |
489d5531 | 15184 | |
1268c371 | 15185 | Int_t t = 0; |
15186 | Int_t pe = 0; | |
15187 | ||
15188 | if(type == "RP") | |
15189 | { | |
15190 | t = 0; | |
15191 | } else if(type == "POI") | |
15192 | { | |
15193 | t = 1; | |
15194 | } | |
15195 | ||
15196 | if(ptOrEta == "Pt") | |
15197 | { | |
15198 | pe = 0; | |
15199 | } else if(ptOrEta == "Eta") | |
15200 | { | |
15201 | pe = 1; | |
15202 | } | |
15203 | ||
15204 | // Common: | |
15205 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
489d5531 | 15206 | |
1268c371 | 15207 | // Correlation <<2>>: |
15208 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); | |
15209 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); | |
489d5531 | 15210 | |
1268c371 | 15211 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) |
489d5531 | 15212 | { |
1268c371 | 15213 | // Reduced correlations: |
15214 | Double_t twoPrime = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); // <<2'>> | |
15215 | Double_t twoPrimeError = fDiffFlowCorrelationsHist[t][pe][0]->GetBinError(b); // stat. error of <<2'>> | |
15216 | Double_t fourPrime = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); // <<4'>> | |
15217 | Double_t fourPrimeError = fDiffFlowCorrelationsHist[t][pe][1]->GetBinError(b); // stat. error of <<4'>> | |
15218 | // Covariances: | |
15219 | Double_t wCovTwoTwoReduced = fDiffFlowCovariances[t][pe][0]->GetBinContent(b); // Cov(<2>,<2'>) * prefactor(<2>,<2'>) | |
15220 | Double_t wCovTwoFourReduced = fDiffFlowCovariances[t][pe][1]->GetBinContent(b); // Cov(<2>,<4'>) * prefactor(<2>,<4'>) | |
15221 | Double_t wCovTwoReducedFourReduced = fDiffFlowCovariances[t][pe][4]->GetBinContent(b); // Cov(<2'>,<4'>) * prefactor(<2'>,<4'>) | |
15222 | // QC{2'}: | |
15223 | Double_t qc2Prime = twoPrime; // QC{2'} | |
15224 | Double_t qc2PrimeError = twoPrimeError; // stat. error of QC{2'} | |
15225 | fDiffFlowCumulants[t][pe][0]->SetBinContent(b,qc2Prime); | |
15226 | fDiffFlowCumulants[t][pe][0]->SetBinError(b,qc2PrimeError); | |
15227 | // QC{4'}: | |
15228 | Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>> | |
15229 | Double_t qc4PrimeError = 0.; // stat. error of QC{4'} | |
15230 | Double_t qc4PrimeErrorSquared = 4.*pow(twoPrime,2.)*pow(twoError,2.) | |
15231 | + 4.*pow(two,2.)*pow(twoPrimeError,2.) | |
15232 | + pow(fourPrimeError,2.) | |
15233 | + 8.*two*twoPrime*wCovTwoTwoReduced | |
15234 | - 4.*twoPrime*wCovTwoFourReduced | |
15235 | - 4.*two*wCovTwoReducedFourReduced; | |
15236 | if(qc4PrimeErrorSquared>0.) | |
15237 | { | |
15238 | qc4PrimeError = pow(qc4PrimeErrorSquared,0.5); | |
489d5531 | 15239 | } |
1268c371 | 15240 | fDiffFlowCumulants[t][pe][1]->SetBinContent(b,qc4Prime); |
15241 | fDiffFlowCumulants[t][pe][1]->SetBinError(b,qc4PrimeError); | |
489d5531 | 15242 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
489d5531 | 15243 | |
1268c371 | 15244 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulants(TString type, Bool_t useParticleWeights, TString eventWeights); |
489d5531 | 15245 | |
e1d101a6 | 15246 | //======================================================================================================================= |
489d5531 | 15247 | |
1268c371 | 15248 | void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCumulants(TString type) |
489d5531 | 15249 | { |
1268c371 | 15250 | // Calculate 2D differential cumulants. |
489d5531 | 15251 | |
1268c371 | 15252 | // Remark: correction for detector effects and error propagation not implemented yet for 2D differential cumulants. |
489d5531 | 15253 | |
1268c371 | 15254 | Int_t t = 0; |
489d5531 | 15255 | |
15256 | if(type == "RP") | |
15257 | { | |
1268c371 | 15258 | t = 0; |
489d5531 | 15259 | } else if(type == "POI") |
15260 | { | |
1268c371 | 15261 | t = 1; |
15262 | } | |
15263 | ||
15264 | // Reference correlation <<2>>: | |
15265 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); | |
489d5531 | 15266 | |
1268c371 | 15267 | // Looping over all (pt,eta) bins and calculating differential flow cumulants: |
15268 | for(Int_t p=1;p<=fnBinsPt;p++) | |
489d5531 | 15269 | { |
15270 | for(Int_t e=1;e<=fnBinsEta;e++) | |
15271 | { | |
1268c371 | 15272 | // Reduced correlations: |
15273 | Double_t twoPrime = f2DDiffFlowCorrelationsPro[t][0]->GetBinContent(f2DDiffFlowCorrelationsPro[t][0]->GetBin(p,e)); // <<2'>>(pt,eta) | |
15274 | Double_t fourPrime = f2DDiffFlowCorrelationsPro[t][1]->GetBinContent(f2DDiffFlowCorrelationsPro[t][1]->GetBin(p,e)); // <<4'>>(pt,eta) | |
15275 | // Cumulants: | |
15276 | Double_t qc2Prime = twoPrime; // QC{2'} = <<2'>> | |
15277 | f2DDiffFlowCumulants[t][0]->SetBinContent(f2DDiffFlowCumulants[t][0]->GetBin(p,e),qc2Prime); | |
15278 | Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>> | |
15279 | f2DDiffFlowCumulants[t][1]->SetBinContent(f2DDiffFlowCumulants[t][1]->GetBin(p,e),qc4Prime); | |
489d5531 | 15280 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) |
489d5531 | 15281 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
15282 | ||
1268c371 | 15283 | } // end of void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCumulants(TString type) |
489d5531 | 15284 | |
e1d101a6 | 15285 | //======================================================================================================================= |
489d5531 | 15286 | |
489d5531 | 15287 | void AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type) |
15288 | { | |
1268c371 | 15289 | // Calculate final results for integrated flow of RPs and POIs. |
489d5531 | 15290 | |
1268c371 | 15291 | // to be improved - check if the integrated flow calculation here is actually correct |
15292 | ||
15293 | Int_t t = 0; // RP = 0, POI = 1 | |
489d5531 | 15294 | |
15295 | if(type == "RP") | |
15296 | { | |
1268c371 | 15297 | t = 0; |
489d5531 | 15298 | } else if(type == "POI") |
15299 | { | |
1268c371 | 15300 | t = 1; |
15301 | } | |
489d5531 | 15302 | |
489d5531 | 15303 | // pt yield: |
15304 | TH1F *yield2ndPt = NULL; | |
15305 | TH1F *yield4thPt = NULL; | |
15306 | TH1F *yield6thPt = NULL; | |
15307 | TH1F *yield8thPt = NULL; | |
15308 | ||
15309 | if(type == "POI") | |
15310 | { | |
dd442cd2 | 15311 | if(fFillMultipleControlHistograms) |
15312 | { | |
15313 | yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtPOI())->Clone(); | |
15314 | yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtPOI())->Clone(); | |
15315 | yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtPOI())->Clone(); | |
15316 | yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtPOI())->Clone(); | |
15317 | } else | |
15318 | { | |
15319 | yield2ndPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
15320 | yield4thPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
15321 | yield6thPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
15322 | yield8thPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
15323 | } | |
489d5531 | 15324 | } |
15325 | else if(type == "RP") | |
15326 | { | |
dd442cd2 | 15327 | if(fFillMultipleControlHistograms) |
15328 | { | |
15329 | yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtRP())->Clone(); | |
15330 | yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtRP())->Clone(); | |
15331 | yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtRP())->Clone(); | |
15332 | yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtRP())->Clone(); | |
15333 | } else | |
15334 | { | |
15335 | yield2ndPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
15336 | yield4thPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
15337 | yield6thPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
15338 | yield8thPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
15339 | } | |
489d5531 | 15340 | } |
15341 | ||
0d11c335 | 15342 | if(!yield2ndPt){return;} |
15343 | if(!yield4thPt){return;} | |
15344 | if(!yield6thPt){return;} | |
15345 | if(!yield8thPt){return;} | |
15346 | ||
489d5531 | 15347 | Int_t nBinsPt = yield2ndPt->GetNbinsX(); |
15348 | ||
15349 | TH1D *flow2ndPt = NULL; | |
15350 | TH1D *flow4thPt = NULL; | |
15351 | TH1D *flow6thPt = NULL; | |
15352 | TH1D *flow8thPt = NULL; | |
15353 | ||
15354 | // to be improved (hardwired pt index) | |
15355 | flow2ndPt = (TH1D*)fDiffFlow[t][0][0]->Clone(); | |
15356 | flow4thPt = (TH1D*)fDiffFlow[t][0][1]->Clone(); | |
15357 | flow6thPt = (TH1D*)fDiffFlow[t][0][2]->Clone(); | |
15358 | flow8thPt = (TH1D*)fDiffFlow[t][0][3]->Clone(); | |
0d11c335 | 15359 | |
15360 | if(!flow2ndPt){return;} | |
15361 | if(!flow4thPt){return;} | |
15362 | if(!flow6thPt){return;} | |
15363 | if(!flow8thPt){return;} | |
489d5531 | 15364 | |
15365 | Double_t dvn2nd = 0., dvn4th = 0., dvn6th = 0., dvn8th = 0.; // differential flow | |
15366 | Double_t dErrvn2nd = 0., dErrvn4th = 0., dErrvn6th = 0., dErrvn8th = 0.; // error on differential flow | |
15367 | ||
15368 | Double_t dVn2nd = 0., dVn4th = 0., dVn6th = 0., dVn8th = 0.; // integrated flow | |
15369 | Double_t dErrVn2nd = 0., dErrVn4th = 0., dErrVn6th = 0., dErrVn8th = 0.; // error on integrated flow | |
15370 | ||
15371 | Double_t dYield2nd = 0., dYield4th = 0., dYield6th = 0., dYield8th = 0.; // pt yield | |
15372 | Double_t dSum2nd = 0., dSum4th = 0., dSum6th = 0., dSum8th = 0.; // needed for normalizing integrated flow | |
15373 | ||
15374 | // looping over pt bins: | |
15375 | for(Int_t p=1;p<nBinsPt+1;p++) | |
15376 | { | |
15377 | dvn2nd = flow2ndPt->GetBinContent(p); | |
15378 | dvn4th = flow4thPt->GetBinContent(p); | |
15379 | dvn6th = flow6thPt->GetBinContent(p); | |
15380 | dvn8th = flow8thPt->GetBinContent(p); | |
15381 | ||
15382 | dErrvn2nd = flow2ndPt->GetBinError(p); | |
15383 | dErrvn4th = flow4thPt->GetBinError(p); | |
15384 | dErrvn6th = flow6thPt->GetBinError(p); | |
15385 | dErrvn8th = flow8thPt->GetBinError(p); | |
15386 | ||
15387 | dYield2nd = yield2ndPt->GetBinContent(p); | |
15388 | dYield4th = yield4thPt->GetBinContent(p); | |
15389 | dYield6th = yield6thPt->GetBinContent(p); | |
15390 | dYield8th = yield8thPt->GetBinContent(p); | |
15391 | ||
15392 | dVn2nd += dvn2nd*dYield2nd; | |
15393 | dVn4th += dvn4th*dYield4th; | |
15394 | dVn6th += dvn6th*dYield6th; | |
15395 | dVn8th += dvn8th*dYield8th; | |
15396 | ||
15397 | dSum2nd += dYield2nd; | |
15398 | dSum4th += dYield4th; | |
15399 | dSum6th += dYield6th; | |
15400 | dSum8th += dYield8th; | |
15401 | ||
15402 | dErrVn2nd += dYield2nd*dYield2nd*dErrvn2nd*dErrvn2nd; // ro be improved (check this relation) | |
15403 | dErrVn4th += dYield4th*dYield4th*dErrvn4th*dErrvn4th; | |
15404 | dErrVn6th += dYield6th*dYield6th*dErrvn6th*dErrvn6th; | |
15405 | dErrVn8th += dYield8th*dYield8th*dErrvn8th*dErrvn8th; | |
15406 | ||
15407 | } // end of for(Int_t p=1;p<nBinsPt+1;p++) | |
15408 | ||
15409 | // normalizing the results for integrated flow: | |
15410 | if(dSum2nd) | |
15411 | { | |
15412 | dVn2nd /= dSum2nd; | |
15413 | dErrVn2nd /= (dSum2nd*dSum2nd); | |
15414 | dErrVn2nd = TMath::Sqrt(dErrVn2nd); | |
15415 | } | |
15416 | if(dSum4th) | |
15417 | { | |
15418 | dVn4th /= dSum4th; | |
15419 | dErrVn4th /= (dSum4th*dSum4th); | |
15420 | dErrVn4th = TMath::Sqrt(dErrVn4th); | |
15421 | } | |
15422 | //if(dSum6th) dVn6th/=dSum6th; | |
15423 | //if(dSum8th) dVn8th/=dSum8th; | |
15424 | ||
15425 | // storing the results for integrated flow in common histos: (to be improved: new method for this?) | |
15426 | if(type == "POI") | |
15427 | { | |
15428 | fCommonHistsResults2nd->FillIntegratedFlowPOI(dVn2nd,dErrVn2nd); | |
15429 | fCommonHistsResults4th->FillIntegratedFlowPOI(dVn4th,dErrVn4th); | |
15430 | fCommonHistsResults6th->FillIntegratedFlowPOI(dVn6th,0.); // to be improved (errors) | |
15431 | fCommonHistsResults8th->FillIntegratedFlowPOI(dVn8th,0.); // to be improved (errors) | |
15432 | } | |
15433 | else if (type == "RP") | |
15434 | { | |
15435 | fCommonHistsResults2nd->FillIntegratedFlowRP(dVn2nd,dErrVn2nd); | |
15436 | fCommonHistsResults4th->FillIntegratedFlowRP(dVn4th,dErrVn4th); | |
15437 | fCommonHistsResults6th->FillIntegratedFlowRP(dVn6th,0.); // to be improved (errors) | |
15438 | fCommonHistsResults8th->FillIntegratedFlowRP(dVn8th,0.); // to be improved (errors) | |
15439 | } | |
15440 | ||
15441 | delete flow2ndPt; | |
15442 | delete flow4thPt; | |
15443 | //delete flow6thPt; | |
15444 | //delete flow8thPt; | |
15445 | ||
15446 | delete yield2ndPt; | |
15447 | delete yield4thPt; | |
15448 | delete yield6thPt; | |
15449 | delete yield8thPt; | |
15450 | ||
15451 | } // end of AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type) | |
15452 | ||
e1d101a6 | 15453 | //======================================================================================================================= |
489d5531 | 15454 | |
489d5531 | 15455 | void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions() |
15456 | { | |
15457 | // Initialize all arrays used for distributions. | |
15458 | ||
15459 | // a) Initialize arrays of histograms used to hold distributions of correlations; | |
15460 | // b) Initialize array to hold min and max values of correlations. | |
15461 | ||
15462 | // a) Initialize arrays of histograms used to hold distributions of correlations: | |
15463 | for(Int_t di=0;di<4;di++) // distribution index | |
15464 | { | |
15465 | fDistributions[di] = NULL; | |
15466 | } | |
15467 | ||
15468 | // b) Initialize default min and max values of correlations: | |
15469 | // (Remark: The default values bellow were chosen for v2=5% and M=500) | |
15470 | fMinValueOfCorrelation[0] = -0.01; // <2>_min | |
15471 | fMaxValueOfCorrelation[0] = 0.04; // <2>_max | |
15472 | fMinValueOfCorrelation[1] = -0.00002; // <4>_min | |
15473 | fMaxValueOfCorrelation[1] = 0.00015; // <4>_max | |
15474 | fMinValueOfCorrelation[2] = -0.0000003; // <6>_min | |
15475 | fMaxValueOfCorrelation[2] = 0.0000006; // <6>_max | |
15476 | fMinValueOfCorrelation[3] = -0.000000006; // <8>_min | |
15477 | fMaxValueOfCorrelation[3] = 0.000000003; // <8>_max | |
1db7eced | 15478 | |
15479 | // c) Initialize default min and max values of correlation products: | |
15480 | // (Remark: The default values bellow were chosen for v2=5% and M=500) | |
15481 | fMinValueOfCorrelationProduct[0] = -0.01; // <2><4>_min | |
15482 | fMaxValueOfCorrelationProduct[0] = 0.04; // <2><4>_max | |
15483 | ||
489d5531 | 15484 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions() |
15485 | ||
e1d101a6 | 15486 | //======================================================================================================================= |
489d5531 | 15487 | |
e5834fcb | 15488 | void AliFlowAnalysisWithQCumulants::InitializeArraysForVarious() |
15489 | { | |
15490 | // Initialize all arrays used for various unclassified objects. | |
15491 | ||
15492 | for(Int_t p=0;p<4;p++) // [v_min,v_max,refMult_min,refMult_max] | |
15493 | { | |
15494 | fPhiDistributionForOneEventSettings[p] = 0.; | |
15495 | } | |
15496 | ||
15497 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForVarious() | |
15498 | ||
e1d101a6 | 15499 | //======================================================================================================================= |
489d5531 | 15500 | |
15501 | void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions() | |
15502 | { | |
15503 | // a) Book profile to hold all flags for distributions of correlations; | |
15504 | // b) Book all histograms to hold distributions of correlations. | |
15505 | ||
1db7eced | 15506 | TString correlationIndex[4] = {"#LT2#GT","#LT4#GT","#LT6#GT","#LT8#GT"}; // TBI (should I promote this to data members?) |
489d5531 | 15507 | |
15508 | // a) Book profile to hold all flags for distributions of correlations: | |
15509 | TString distributionsFlagsName = "fDistributionsFlags"; | |
15510 | distributionsFlagsName += fAnalysisLabel->Data(); | |
1db7eced | 15511 | fDistributionsFlags = new TProfile(distributionsFlagsName.Data(),"Flags for Distributions of Correlations",10,0,10); |
489d5531 | 15512 | fDistributionsFlags->SetTickLength(-0.01,"Y"); |
15513 | fDistributionsFlags->SetMarkerStyle(25); | |
15514 | fDistributionsFlags->SetLabelSize(0.05); | |
15515 | fDistributionsFlags->SetLabelOffset(0.02,"Y"); | |
e1d101a6 | 15516 | fDistributionsFlags->SetStats(kFALSE); |
489d5531 | 15517 | fDistributionsFlags->GetXaxis()->SetBinLabel(1,"Store or not?"); |
1db7eced | 15518 | fDistributionsFlags->GetXaxis()->SetBinLabel(2,"#LT2#GT_{min}"); |
15519 | fDistributionsFlags->GetXaxis()->SetBinLabel(3,"#LT2#GT_{max}"); | |
15520 | fDistributionsFlags->GetXaxis()->SetBinLabel(4,"#LT4#GT_{min}"); | |
15521 | fDistributionsFlags->GetXaxis()->SetBinLabel(5,"#LT4#GT_{max}"); | |
15522 | fDistributionsFlags->GetXaxis()->SetBinLabel(6,"#LT6#GT_{min}"); | |
15523 | fDistributionsFlags->GetXaxis()->SetBinLabel(7,"#LT6#GT_{max}"); | |
15524 | fDistributionsFlags->GetXaxis()->SetBinLabel(8,"#LT8#GT_{min}"); | |
15525 | fDistributionsFlags->GetXaxis()->SetBinLabel(9,"#LT8#GT_{max}"); | |
15526 | fDistributionsFlags->GetXaxis()->SetBinLabel(10,"fnBinsForCorrelations"); | |
489d5531 | 15527 | fDistributionsList->Add(fDistributionsFlags); |
15528 | ||
15529 | // b) Book all histograms to hold distributions of correlations. | |
15530 | if(fStoreDistributions) | |
15531 | { | |
15532 | TString distributionsName = "fDistributions"; | |
15533 | distributionsName += fAnalysisLabel->Data(); | |
15534 | for(Int_t di=0;di<4;di++) // distribution index | |
15535 | { | |
1db7eced | 15536 | fDistributions[di] = new TH1D(Form("Distribution of %s",correlationIndex[di].Data()),Form("Distribution of %s",correlationIndex[di].Data()),fnBinsForCorrelations,fMinValueOfCorrelation[di],fMaxValueOfCorrelation[di]); |
489d5531 | 15537 | fDistributions[di]->SetXTitle(correlationIndex[di].Data()); |
15538 | fDistributionsList->Add(fDistributions[di]); | |
15539 | } // end of for(Int_t di=0;di<4;di++) // distribution index | |
15540 | } // end of if(fStoreDistributions) | |
15541 | ||
15542 | } // end of void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions() | |
15543 | ||
e1d101a6 | 15544 | //======================================================================================================================= |
489d5531 | 15545 | |
e5834fcb | 15546 | void AliFlowAnalysisWithQCumulants::BookEverythingForVarious() |
15547 | { | |
15548 | // Book all objects for various unclassified quantities. | |
15549 | ||
15550 | if(!fStorePhiDistributionForOneEvent){return;} | |
15551 | ||
15552 | // a) Book histogram holding phi distribution for single event to illustrate flow. | |
15553 | ||
15554 | // a) Book histogram holding phi distribution for single event to illustrate flow: | |
15555 | fPhiDistributionForOneEvent = new TH1D("fPhiDistributionForOneEvent","",360,0.,TMath::TwoPi()); | |
15556 | fPhiDistributionForOneEvent->GetXaxis()->SetTitle("#phi"); | |
15557 | fVariousList->Add(fPhiDistributionForOneEvent); | |
15558 | ||
15559 | } // end of void AliFlowAnalysisWithQCumulants::BookEverythingForVarious() | |
15560 | ||
e1d101a6 | 15561 | //======================================================================================================================= |
489d5531 | 15562 | |
15563 | void AliFlowAnalysisWithQCumulants::StoreFlagsForDistributions() | |
15564 | { | |
15565 | // Store all flags for distributiuons of correlations in profile fDistributionsFlags. | |
15566 | ||
15567 | if(!fDistributionsFlags) | |
15568 | { | |
15569 | cout<<"WARNING: fDistributionsFlags is NULL in AFAWQC::SDF() !!!!"<<endl; | |
15570 | exit(0); | |
15571 | } | |
15572 | ||
15573 | fDistributionsFlags->Fill(0.5,(Int_t)fStoreDistributions); // histos with distributions of correlations stored or not in the output file | |
15574 | // store min and max values of correlations: | |
15575 | for(Int_t di=0;di<4;di++) // distribution index | |
15576 | { | |
15577 | fDistributionsFlags->Fill(1.5+2.*(Double_t)di,fMinValueOfCorrelation[di]); | |
15578 | fDistributionsFlags->Fill(2.5+2.*(Double_t)di,fMaxValueOfCorrelation[di]); | |
15579 | } | |
1db7eced | 15580 | fDistributionsFlags->Fill(9.5,fnBinsForCorrelations); |
489d5531 | 15581 | |
15582 | } // end of void AliFlowAnalysisWithQCumulants::StoreFlagsForDistributions() | |
15583 | ||
e1d101a6 | 15584 | //======================================================================================================================= |
489d5531 | 15585 | |
489d5531 | 15586 | void AliFlowAnalysisWithQCumulants::StoreDistributionsOfCorrelations() |
15587 | { | |
15588 | // Store distributions of correlations. | |
15589 | ||
15590 | if(!(fIntFlowCorrelationsEBE && fIntFlowEventWeightsForCorrelationsEBE)) | |
15591 | { | |
15592 | cout<<"WARNING: fIntFlowCorrelationsEBE && fIntFlowEventWeightsForCorrelationsEBE"<<endl; | |
15593 | cout<<" is NULL in AFAWQC::SDOC() !!!!"<<endl; | |
15594 | exit(0); | |
15595 | } | |
15596 | ||
15597 | for(Int_t di=0;di<4;di++) // distribution index | |
15598 | { | |
15599 | if(!fDistributions[di]) | |
15600 | { | |
15601 | cout<<"WARNING: fDistributions[di] is NULL in AFAWQC::SDOC() !!!!"<<endl; | |
15602 | cout<<"di = "<<di<<endl; | |
15603 | exit(0); | |
15604 | } else | |
15605 | { | |
15606 | fDistributions[di]->Fill(fIntFlowCorrelationsEBE->GetBinContent(di+1),fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(di+1)); | |
15607 | } | |
15608 | } // end of for(Int_t di=0;di<4;di++) // distribution index | |
15609 | ||
15610 | } // end of void AliFlowAnalysisWithQCumulants::StoreDistributionsOfCorrelations() | |
15611 | ||
e1d101a6 | 15612 | //======================================================================================================================= |
489d5531 | 15613 | |
489d5531 | 15614 | void AliFlowAnalysisWithQCumulants::BookAndNestAllLists() |
15615 | { | |
15616 | // Book and nest all lists nested in the base list fHistList. | |
15617 | // a) Book and nest lists for integrated flow; | |
15618 | // b) Book and nest lists for differential flow; | |
15619 | // c) Book and nest list for particle weights; | |
15620 | // d) Book and nest list for distributions; | |
e5834fcb | 15621 | // e) Book and nest list for various unclassified objects; |
e1d101a6 | 15622 | // f) Book and nest list for other differential correlators; |
15623 | // g) Book and nest list for nested loops; | |
df23c5ae | 15624 | // h) Book and nest lists for mixed harmonics; |
15625 | // i) Book and nest lists for control histograms. | |
489d5531 | 15626 | |
15627 | // a) Book and nest all lists for integrated flow: | |
1268c371 | 15628 | // Base list for integrated flow: |
489d5531 | 15629 | fIntFlowList = new TList(); |
15630 | fIntFlowList->SetName("Integrated Flow"); | |
15631 | fIntFlowList->SetOwner(kTRUE); | |
15632 | fHistList->Add(fIntFlowList); | |
1268c371 | 15633 | // List holding profiles: |
489d5531 | 15634 | fIntFlowProfiles = new TList(); |
15635 | fIntFlowProfiles->SetName("Profiles"); | |
15636 | fIntFlowProfiles->SetOwner(kTRUE); | |
15637 | fIntFlowList->Add(fIntFlowProfiles); | |
3435cacb | 15638 | // List holding all profiles with results for correlations vs M: |
15639 | if(fCalculateAllCorrelationsVsM) | |
15640 | { | |
15641 | fIntFlowAllCorrelationsVsM = new TList(); | |
15642 | fIntFlowAllCorrelationsVsM->SetName("Correlations vs M"); | |
15643 | fIntFlowAllCorrelationsVsM->SetOwner(kTRUE); | |
15644 | fIntFlowProfiles->Add(fIntFlowAllCorrelationsVsM); | |
15645 | } // end of if(fCalculateAllCorrelationsVsM) | |
1268c371 | 15646 | // List holding histograms with results: |
489d5531 | 15647 | fIntFlowResults = new TList(); |
15648 | fIntFlowResults->SetName("Results"); | |
15649 | fIntFlowResults->SetOwner(kTRUE); | |
15650 | fIntFlowList->Add(fIntFlowResults); | |
15651 | ||
1268c371 | 15652 | // b) Book and nest lists for differential flow: |
15653 | this->BookAndNestListsForDifferentialFlow(); | |
15654 | ||
15655 | // c) Book and nest list for particle weights: | |
15656 | fWeightsList->SetName("Weights"); | |
15657 | fWeightsList->SetOwner(kTRUE); | |
15658 | fHistList->Add(fWeightsList); | |
15659 | ||
15660 | // d) Book and nest list for distributions: | |
15661 | fDistributionsList = new TList(); | |
15662 | fDistributionsList->SetName("Distributions"); | |
15663 | fDistributionsList->SetOwner(kTRUE); | |
15664 | fHistList->Add(fDistributionsList); | |
15665 | ||
15666 | // e) Book and nest list for various unclassified objects: | |
15667 | if(fStorePhiDistributionForOneEvent) | |
15668 | { | |
15669 | fVariousList = new TList(); | |
15670 | fVariousList->SetName("Various"); | |
15671 | fVariousList->SetOwner(kTRUE); | |
15672 | fHistList->Add(fVariousList); | |
15673 | } | |
15674 | ||
64e500e3 | 15675 | // f) Book and nest list for other differential correlators: |
15676 | fOtherDiffCorrelatorsList = new TList(); | |
15677 | fOtherDiffCorrelatorsList->SetName("Other differential correlators"); | |
15678 | fOtherDiffCorrelatorsList->SetOwner(kTRUE); | |
62e36168 | 15679 | if(fCalculateDiffFlow){fHistList->Add(fOtherDiffCorrelatorsList);} // TBI: Use another flag here instead of fCalculateDiffFlow |
64e500e3 | 15680 | |
15681 | // g) Book and nest list for nested loops: | |
1268c371 | 15682 | fNestedLoopsList = new TList(); |
15683 | fNestedLoopsList->SetName("Nested Loops"); | |
15684 | fNestedLoopsList->SetOwner(kTRUE); | |
15685 | fHistList->Add(fNestedLoopsList); | |
e1d101a6 | 15686 | |
15687 | // h) Book and nest lists for mixed harmonics: | |
15688 | // Base list for mixed harmonics: | |
15689 | fMixedHarmonicsList = new TList(); | |
15690 | fMixedHarmonicsList->SetName("Mixed Harmonics"); | |
15691 | fMixedHarmonicsList->SetOwner(kTRUE); | |
15692 | fHistList->Add(fMixedHarmonicsList); | |
15693 | // List holding profiles: | |
15694 | fMixedHarmonicsProfiles = new TList(); | |
15695 | fMixedHarmonicsProfiles->SetName("Profiles"); | |
15696 | fMixedHarmonicsProfiles->SetOwner(kTRUE); | |
15697 | if(fCalculateMixedHarmonics){fMixedHarmonicsList->Add(fMixedHarmonicsProfiles);} | |
15698 | // List holding histograms with results: | |
15699 | fMixedHarmonicsResults = new TList(); | |
15700 | fMixedHarmonicsResults->SetName("Results"); | |
15701 | fMixedHarmonicsResults->SetOwner(kTRUE); | |
15702 | if(fCalculateMixedHarmonics){fMixedHarmonicsList->Add(fMixedHarmonicsResults);} | |
c10259fb | 15703 | // List holding objects for statistical error propagation of mixed harmonics: |
15704 | fMixedHarmonicsErrorPropagation = new TList(); | |
15705 | fMixedHarmonicsErrorPropagation->SetName("Error Propagation"); | |
15706 | fMixedHarmonicsErrorPropagation->SetOwner(kTRUE); | |
15707 | if(fCalculateMixedHarmonics){fMixedHarmonicsList->Add(fMixedHarmonicsErrorPropagation);} | |
e1d101a6 | 15708 | |
df23c5ae | 15709 | // i) Book and nest lists for control histograms: |
15710 | // Base list for mixed harmonics: | |
15711 | fControlHistogramsList = new TList(); | |
15712 | fControlHistogramsList->SetName("Control Histograms"); | |
15713 | fControlHistogramsList->SetOwner(kTRUE); | |
15714 | fHistList->Add(fControlHistogramsList); | |
15715 | ||
1268c371 | 15716 | } // end of void AliFlowAnalysisWithQCumulants::BookAndNestAllLists() |
15717 | ||
e1d101a6 | 15718 | //======================================================================================================================= |
1268c371 | 15719 | |
15720 | void AliFlowAnalysisWithQCumulants::BookAndNestListsForDifferentialFlow() | |
15721 | { | |
15722 | // Book and nest lists for differential flow. | |
15723 | ||
15724 | // Base list for differential flow objects: | |
489d5531 | 15725 | fDiffFlowList = new TList(); |
15726 | fDiffFlowList->SetName("Differential Flow"); | |
15727 | fDiffFlowList->SetOwner(kTRUE); | |
15728 | fHistList->Add(fDiffFlowList); | |
1268c371 | 15729 | |
15730 | // Local flags: | |
15731 | TString typeFlag[2] = {"RP","POI"}; | |
15732 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
15733 | TString powerFlag[2] = {"linear","quadratic"}; | |
15734 | ||
15735 | // 2D: | |
15736 | if(fCalculate2DDiffFlow) | |
15737 | { | |
15738 | fDiffFlow2D = new TList(); | |
15739 | fDiffFlow2D->SetName("2D"); | |
15740 | fDiffFlow2D->SetOwner(kTRUE); | |
15741 | fDiffFlowList->Add(fDiffFlow2D); | |
15742 | for(Int_t t=0;t<2;t++) | |
15743 | { | |
15744 | f2DDiffFlowCorrelationsProList[t] = new TList(); | |
15745 | f2DDiffFlowCorrelationsProList[t]->SetOwner(kTRUE); | |
15746 | f2DDiffFlowCorrelationsProList[t]->SetName(Form("Profiles with 2D correlations (%s)",typeFlag[t].Data())); | |
15747 | fDiffFlow2D->Add(f2DDiffFlowCorrelationsProList[t]); | |
15748 | } // end of for(Int_t t=0;t<2;t++) | |
15749 | } // end of if(fCalculate2DDiffFlow) | |
15750 | ||
15751 | // What follows bellow in this method is relevant only for 1D differential flow: | |
15752 | if(!fCalculateDiffFlow){return;} | |
15753 | ||
15754 | // List holding profiles: | |
489d5531 | 15755 | fDiffFlowProfiles = new TList(); |
15756 | fDiffFlowProfiles->SetName("Profiles"); | |
15757 | fDiffFlowProfiles->SetOwner(kTRUE); | |
15758 | fDiffFlowList->Add(fDiffFlowProfiles); | |
1268c371 | 15759 | // List holding histograms with results: |
489d5531 | 15760 | fDiffFlowResults = new TList(); |
15761 | fDiffFlowResults->SetName("Results"); | |
15762 | fDiffFlowResults->SetOwner(kTRUE); | |
15763 | fDiffFlowList->Add(fDiffFlowResults); | |
1268c371 | 15764 | // Flags used for naming nested lists in list fDiffFlowProfiles and fDiffFlowResults: |
489d5531 | 15765 | TList list; |
15766 | list.SetOwner(kTRUE); | |
1268c371 | 15767 | // Nested lists in fDiffFlowProfiles (~/Differential Flow/Profiles): |
489d5531 | 15768 | for(Int_t t=0;t<2;t++) // type: RP or POI |
15769 | { | |
62e36168 | 15770 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 15771 | { |
15772 | // list holding profiles with correlations: | |
15773 | fDiffFlowCorrelationsProList[t][pe] = (TList*)list.Clone(); | |
15774 | fDiffFlowCorrelationsProList[t][pe]->SetName(Form("Profiles with correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
15775 | fDiffFlowProfiles->Add(fDiffFlowCorrelationsProList[t][pe]); | |
15776 | // list holding profiles with products of correlations: | |
15777 | fDiffFlowProductOfCorrelationsProList[t][pe] = (TList*)list.Clone(); | |
15778 | fDiffFlowProductOfCorrelationsProList[t][pe]->SetName(Form("Profiles with products of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
15779 | fDiffFlowProfiles->Add(fDiffFlowProductOfCorrelationsProList[t][pe]); | |
15780 | // list holding profiles with corrections: | |
15781 | fDiffFlowCorrectionsProList[t][pe] = (TList*)list.Clone(); | |
15782 | fDiffFlowCorrectionsProList[t][pe]->SetName(Form("Profiles with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
15783 | fDiffFlowProfiles->Add(fDiffFlowCorrectionsProList[t][pe]); | |
15784 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
15785 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
15786 | // nested lists in fDiffFlowResults (~/Differential Flow/Results): | |
15787 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
15788 | { | |
62e36168 | 15789 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 15790 | { |
15791 | // list holding histograms with correlations: | |
15792 | fDiffFlowCorrelationsHistList[t][pe] = (TList*)list.Clone(); | |
15793 | fDiffFlowCorrelationsHistList[t][pe]->SetName(Form("Correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
15794 | fDiffFlowResults->Add(fDiffFlowCorrelationsHistList[t][pe]); | |
15795 | // list holding histograms with corrections: | |
15796 | fDiffFlowCorrectionsHistList[t][pe] = (TList*)list.Clone(); | |
15797 | fDiffFlowCorrectionsHistList[t][pe]->SetName(Form("Histograms with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
15798 | fDiffFlowResults->Add(fDiffFlowCorrectionsHistList[t][pe]); | |
15799 | for(Int_t power=0;power<2;power++) | |
15800 | { | |
15801 | // list holding histograms with sums of event weights: | |
15802 | fDiffFlowSumOfEventWeightsHistList[t][pe][power] = (TList*)list.Clone(); | |
15803 | fDiffFlowSumOfEventWeightsHistList[t][pe][power]->SetName(Form("Sum of %s event weights (%s, %s)",powerFlag[power].Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
15804 | fDiffFlowResults->Add(fDiffFlowSumOfEventWeightsHistList[t][pe][power]); | |
15805 | } // end of for(Int_t power=0;power<2;power++) | |
15806 | // list holding histograms with sums of products of event weights: | |
15807 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe] = (TList*)list.Clone(); | |
15808 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]->SetName(Form("Sum of products of event weights (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
15809 | fDiffFlowResults->Add(fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]); | |
15810 | // list holding histograms with covariances of correlations: | |
15811 | fDiffFlowCovariancesHistList[t][pe] = (TList*)list.Clone(); | |
15812 | fDiffFlowCovariancesHistList[t][pe]->SetName(Form("Covariances of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
15813 | fDiffFlowResults->Add(fDiffFlowCovariancesHistList[t][pe]); | |
15814 | // list holding histograms with differential Q-cumulants: | |
15815 | fDiffFlowCumulantsHistList[t][pe] = (TList*)list.Clone(); | |
15816 | fDiffFlowCumulantsHistList[t][pe]->SetName(Form("Differential Q-cumulants (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
15817 | fDiffFlowResults->Add(fDiffFlowCumulantsHistList[t][pe]); | |
1268c371 | 15818 | // list holding histograms which quantify detector bias to differential Q-cumulants: |
15819 | fDiffFlowDetectorBiasHistList[t][pe] = (TList*)list.Clone(); | |
15820 | fDiffFlowDetectorBiasHistList[t][pe]->SetName(Form("Detector bias (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
15821 | fDiffFlowResults->Add(fDiffFlowDetectorBiasHistList[t][pe]); | |
489d5531 | 15822 | // list holding histograms with differential flow estimates from Q-cumulants: |
15823 | fDiffFlowHistList[t][pe] = (TList*)list.Clone(); | |
15824 | fDiffFlowHistList[t][pe]->SetName(Form("Differential flow (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
15825 | fDiffFlowResults->Add(fDiffFlowHistList[t][pe]); | |
15826 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
15827 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
15828 | ||
1268c371 | 15829 | } // end of void AliFlowAnalysisWithQCumulants::BookAndNestListsForDifferentialFlow() |
489d5531 | 15830 | |
e1d101a6 | 15831 | //======================================================================================================================= |
489d5531 | 15832 | |
489d5531 | 15833 | void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type) |
15834 | { | |
1268c371 | 15835 | // Fill common result histograms for differential flow. |
489d5531 | 15836 | |
1268c371 | 15837 | Int_t t = 0; |
489d5531 | 15838 | |
15839 | if(type == "RP") | |
15840 | { | |
1268c371 | 15841 | t = 0; |
489d5531 | 15842 | } else if(type == "POI") |
15843 | { | |
1268c371 | 15844 | t = 1; |
489d5531 | 15845 | } |
1268c371 | 15846 | |
15847 | // to be improved - check all pointers used in this method | |
489d5531 | 15848 | |
15849 | if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th)) | |
15850 | { | |
15851 | cout<<"WARNING: fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th"<<endl; | |
15852 | cout<<" is NULL in AFAWQC::FCHRIF() !!!!"<<endl; | |
15853 | exit(0); | |
15854 | } | |
15855 | ||
15856 | // pt: | |
15857 | for(Int_t p=1;p<=fnBinsPt;p++) | |
15858 | { | |
15859 | Double_t v2 = fDiffFlow[t][0][0]->GetBinContent(p); | |
15860 | Double_t v4 = fDiffFlow[t][0][1]->GetBinContent(p); | |
15861 | Double_t v6 = fDiffFlow[t][0][2]->GetBinContent(p); | |
15862 | Double_t v8 = fDiffFlow[t][0][3]->GetBinContent(p); | |
15863 | ||
15864 | Double_t v2Error = fDiffFlow[t][0][0]->GetBinError(p); | |
15865 | Double_t v4Error = fDiffFlow[t][0][1]->GetBinError(p); | |
15866 | //Double_t v6Error = fFinalFlow1D[t][pW][nua][0][2]->GetBinError(p); | |
15867 | //Double_t v8Error = fFinalFlow1D[t][pW][nua][0][3]->GetBinError(p); | |
15868 | ||
15869 | if(type == "RP") | |
15870 | { | |
15871 | fCommonHistsResults2nd->FillDifferentialFlowPtRP(p,v2,v2Error); | |
15872 | fCommonHistsResults4th->FillDifferentialFlowPtRP(p,v4,v4Error); | |
15873 | fCommonHistsResults6th->FillDifferentialFlowPtRP(p,v6,0.); | |
15874 | fCommonHistsResults8th->FillDifferentialFlowPtRP(p,v8,0.); | |
15875 | } else if(type == "POI") | |
15876 | { | |
15877 | fCommonHistsResults2nd->FillDifferentialFlowPtPOI(p,v2,v2Error); | |
15878 | fCommonHistsResults4th->FillDifferentialFlowPtPOI(p,v4,v4Error); | |
15879 | fCommonHistsResults6th->FillDifferentialFlowPtPOI(p,v6,0.); | |
15880 | fCommonHistsResults8th->FillDifferentialFlowPtPOI(p,v8,0.); | |
15881 | } | |
15882 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
15883 | ||
15884 | // eta: | |
62e36168 | 15885 | if(!fCalculateDiffFlowVsEta){return;} |
489d5531 | 15886 | for(Int_t e=1;e<=fnBinsEta;e++) |
15887 | { | |
15888 | Double_t v2 = fDiffFlow[t][1][0]->GetBinContent(e); | |
15889 | Double_t v4 = fDiffFlow[t][1][1]->GetBinContent(e); | |
15890 | Double_t v6 = fDiffFlow[t][1][2]->GetBinContent(e); | |
15891 | Double_t v8 = fDiffFlow[t][1][3]->GetBinContent(e); | |
15892 | ||
15893 | Double_t v2Error = fDiffFlow[t][1][0]->GetBinError(e); | |
15894 | Double_t v4Error = fDiffFlow[t][1][1]->GetBinError(e); | |
15895 | //Double_t v6Error = fDiffFlow[t][1][2]->GetBinError(e); | |
15896 | //Double_t v8Error = fDiffFlow[t][1][3]->GetBinError(e); | |
15897 | ||
15898 | if(type == "RP") | |
15899 | { | |
15900 | fCommonHistsResults2nd->FillDifferentialFlowEtaRP(e,v2,v2Error); | |
15901 | fCommonHistsResults4th->FillDifferentialFlowEtaRP(e,v4,v4Error); | |
15902 | fCommonHistsResults6th->FillDifferentialFlowEtaRP(e,v6,0.); | |
15903 | fCommonHistsResults8th->FillDifferentialFlowEtaRP(e,v8,0.); | |
15904 | } else if(type == "POI") | |
15905 | { | |
15906 | fCommonHistsResults2nd->FillDifferentialFlowEtaPOI(e,v2,v2Error); | |
15907 | fCommonHistsResults4th->FillDifferentialFlowEtaPOI(e,v4,v4Error); | |
15908 | fCommonHistsResults6th->FillDifferentialFlowEtaPOI(e,v6,0.); | |
15909 | fCommonHistsResults8th->FillDifferentialFlowEtaPOI(e,v8,0.); | |
15910 | } | |
15911 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
15912 | ||
15913 | } // end of void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights, Bool_t correctedForNUA) | |
15914 | ||
e1d101a6 | 15915 | //======================================================================================================================= |
489d5531 | 15916 | |
1268c371 | 15917 | void AliFlowAnalysisWithQCumulants::CommonConstants(TString method) |
489d5531 | 15918 | { |
1268c371 | 15919 | // Access and store common constants. |
15920 | ||
15921 | // a) If this method was called in Init() access common constants from AliFlowCommonConstants; | |
15922 | // b) If this method was called in Init() book and fill TProfile to hold constants accessed in a); | |
15923 | // c) If this method was called in Finish() access common constants from TProfile booked and filled in b). | |
15924 | ||
15925 | if(method == "Init") | |
15926 | { | |
15927 | // a) If this method was called in Init() access common constants from AliFlowCommonConstants: | |
15928 | fnBinsPhi = AliFlowCommonConstants::GetMaster()->GetNbinsPhi(); | |
15929 | fPhiMin = AliFlowCommonConstants::GetMaster()->GetPhiMin(); | |
15930 | fPhiMax = AliFlowCommonConstants::GetMaster()->GetPhiMax(); | |
15931 | if(fnBinsPhi){fPhiBinWidth = (fPhiMax-fPhiMin)/fnBinsPhi;} | |
15932 | fnBinsPt = AliFlowCommonConstants::GetMaster()->GetNbinsPt(); | |
15933 | fPtMin = AliFlowCommonConstants::GetMaster()->GetPtMin(); | |
15934 | fPtMax = AliFlowCommonConstants::GetMaster()->GetPtMax(); | |
15935 | if(fnBinsPt){fPtBinWidth = (fPtMax-fPtMin)/fnBinsPt;} | |
15936 | fnBinsEta = AliFlowCommonConstants::GetMaster()->GetNbinsEta(); | |
15937 | fEtaMin = AliFlowCommonConstants::GetMaster()->GetEtaMin(); | |
15938 | fEtaMax = AliFlowCommonConstants::GetMaster()->GetEtaMax(); | |
15939 | if(fnBinsEta){fEtaBinWidth = (fEtaMax-fEtaMin)/fnBinsEta;} | |
15940 | ||
15941 | // b) If this method was called in Init() book and fill TProfile to hold constants accessed in a): | |
15942 | TString fCommonConstantsName = "fCommonConstants"; | |
15943 | fCommonConstantsName += fAnalysisLabel->Data(); | |
15944 | fCommonConstants = new TProfile(fCommonConstantsName.Data(),"Common constants",9,0.,9.); | |
15945 | fCommonConstants->SetLabelSize(0.05); | |
15946 | fCommonConstants->GetXaxis()->SetBinLabel(1,"nBins (#phi)"); | |
15947 | fCommonConstants->Fill(0.5,fnBinsPhi); | |
15948 | fCommonConstants->GetXaxis()->SetBinLabel(2,"#phi_{min}"); | |
15949 | fCommonConstants->Fill(1.5,fPhiMin); | |
15950 | fCommonConstants->GetXaxis()->SetBinLabel(3,"#phi_{max}"); | |
15951 | fCommonConstants->Fill(2.5,fPhiMax); | |
15952 | fCommonConstants->GetXaxis()->SetBinLabel(4,"nBins (p_{t})"); | |
15953 | fCommonConstants->Fill(3.5,fnBinsPt); | |
15954 | fCommonConstants->GetXaxis()->SetBinLabel(5,"(p_{t})_{min}"); | |
15955 | fCommonConstants->Fill(4.5,fPtMin); | |
15956 | fCommonConstants->GetXaxis()->SetBinLabel(6,"(p_{t})_{max}"); | |
15957 | fCommonConstants->Fill(5.5,fPtMax); | |
15958 | fCommonConstants->GetXaxis()->SetBinLabel(7,"nBins (#eta)"); | |
15959 | fCommonConstants->Fill(6.5,fnBinsEta); | |
15960 | fCommonConstants->GetXaxis()->SetBinLabel(8,"#eta_{min}"); | |
15961 | fCommonConstants->Fill(7.5,fEtaMin); | |
15962 | fCommonConstants->GetXaxis()->SetBinLabel(9,"#eta_{max}"); | |
15963 | fCommonConstants->Fill(8.5,fEtaMax); | |
15964 | fHistList->Add(fCommonConstants); | |
15965 | } // end of if(method == "Init") | |
15966 | else if(method == "Finish") | |
15967 | { | |
15968 | // c) If this method was called in Finish() access common constants from TProfile booked and filled in b): | |
15969 | if(!fCommonConstants) | |
15970 | { | |
15971 | printf("\n WARNING (QC): fCommonConstants is NULL in AFAWQC::AC(\"%s\") !!!!\n\n",method.Data()); | |
15972 | exit(0); | |
15973 | } | |
15974 | fnBinsPhi = (Int_t)fCommonConstants->GetBinContent(1); | |
15975 | fPhiMin = fCommonConstants->GetBinContent(2); | |
15976 | fPhiMax = fCommonConstants->GetBinContent(3); | |
15977 | if(fnBinsPhi){fPhiBinWidth = (fPhiMax-fPhiMin)/fnBinsPhi;} | |
15978 | fnBinsPt = (Int_t)fCommonConstants->GetBinContent(4); | |
15979 | fPtMin = fCommonConstants->GetBinContent(5); | |
15980 | fPtMax = fCommonConstants->GetBinContent(6); | |
15981 | if(fnBinsPt){fPtBinWidth = (fPtMax-fPtMin)/fnBinsPt;} | |
15982 | fnBinsEta = (Int_t)fCommonConstants->GetBinContent(7); | |
15983 | fEtaMin = fCommonConstants->GetBinContent(8); | |
15984 | fEtaMax = fCommonConstants->GetBinContent(9); | |
15985 | if(fnBinsEta){fEtaBinWidth = (fEtaMax-fEtaMin)/fnBinsEta;} | |
15986 | } // end of else if(method == "Finish") | |
15987 | ||
15988 | } // end of void AliFlowAnalysisWithQCumulants::CommonConstants(TString method) | |
489d5531 | 15989 | |
e1d101a6 | 15990 | //======================================================================================================================= |
489d5531 | 15991 | |
489d5531 | 15992 | void AliFlowAnalysisWithQCumulants::CrossCheckSettings() |
15993 | { | |
df23c5ae | 15994 | // a) Cross-check if the choice for multiplicity weights make sense; |
15995 | // b) Cross-check if the choice for multiplicity itself make sense. | |
15996 | ||
15997 | // a) Cross-check if the choice for multiplicity weights make sense: | |
15998 | if((!fMultiplicityWeight->Contains("combinations")) && | |
15999 | (!fMultiplicityWeight->Contains("unit")) && | |
16000 | (!fMultiplicityWeight->Contains("multiplicity")) ) | |
489d5531 | 16001 | { |
16002 | cout<<"WARNING (QC): Multiplicity weight can be either \"combinations\", \"unit\""<<endl; | |
16003 | cout<<" or \"multiplicity\". Certainly not \""<<fMultiplicityWeight->Data()<<"\"."<<endl; | |
16004 | exit(0); | |
16005 | } | |
df23c5ae | 16006 | |
489d5531 | 16007 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckSettings() |
16008 | ||
e1d101a6 | 16009 | //======================================================================================================================= |
489d5531 | 16010 | |
489d5531 | 16011 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeights() |
16012 | { | |
0328db2d | 16013 | // Calculate sum of linear and quadratic event weights for correlations. |
2001bc3a | 16014 | |
df23c5ae | 16015 | // TBI re-think what is the right multiplicity when particle weights are used! |
3842bdcd | 16016 | |
16017 | // Multiplicity bin of an event (relevant for all histos vs M): | |
16018 | Double_t dMultiplicityBin = 0.; | |
df23c5ae | 16019 | if(fMultiplicityIs==AliFlowCommonConstants::kRP) |
3842bdcd | 16020 | { |
df23c5ae | 16021 | dMultiplicityBin = fNumberOfRPsEBE+0.5; |
16022 | } else if(fMultiplicityIs==AliFlowCommonConstants::kExternal) | |
3842bdcd | 16023 | { |
4aae2a93 | 16024 | dMultiplicityBin = fReferenceMultiplicityEBE+0.5; |
df23c5ae | 16025 | } else if(fMultiplicityIs==AliFlowCommonConstants::kPOI) |
16026 | { | |
16027 | dMultiplicityBin = fNumberOfPOIsEBE+0.5; | |
16028 | } | |
9f33751d | 16029 | |
489d5531 | 16030 | for(Int_t p=0;p<2;p++) // power-1 |
16031 | { | |
16032 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
16033 | { | |
16034 | fIntFlowSumOfEventWeights[p]->Fill(ci+0.5,pow(fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci+1),p+1)); | |
b3dacf6b | 16035 | if(fCalculateCumulantsVsM) |
16036 | { | |
1db7eced | 16037 | if(fFillProfilesVsMUsingWeights) |
16038 | { | |
16039 | fIntFlowSumOfEventWeightsVsM[ci][p]->Fill(dMultiplicityBin,pow(fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci+1),p+1)); // to be improved: dMult => sum of weights? | |
16040 | } else | |
16041 | { | |
16042 | fIntFlowSumOfEventWeightsVsM[ci][p]->Fill(dMultiplicityBin); // to be improved: dMult => sum of weights? | |
16043 | } | |
16044 | } // end of if(fCalculateCumulantsVsM) | |
16045 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
16046 | } // end of for(Int_t p=0;p<2;p++) // power-1 | |
489d5531 | 16047 | |
16048 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeights() | |
16049 | ||
e1d101a6 | 16050 | //======================================================================================================================= |
489d5531 | 16051 | |
0328db2d | 16052 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeightsNUA() |
489d5531 | 16053 | { |
0328db2d | 16054 | // Calculate sum of linear and quadratic event weights for NUA terms. |
16055 | ||
16056 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
489d5531 | 16057 | { |
0328db2d | 16058 | for(Int_t p=0;p<2;p++) // power-1 |
16059 | { | |
b92ea2b9 | 16060 | for(Int_t ci=0;ci<4;ci++) // nua term index |
0328db2d | 16061 | { |
16062 | fIntFlowSumOfEventWeightsNUA[sc][p]->Fill(ci+0.5,pow(fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc]->GetBinContent(ci+1),p+1)); | |
489d5531 | 16063 | } |
0328db2d | 16064 | } |
16065 | } | |
16066 | ||
16067 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeightsNUA() | |
489d5531 | 16068 | |
e1d101a6 | 16069 | //======================================================================================================================= |
0328db2d | 16070 | |
0328db2d | 16071 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeights() |
16072 | { | |
ff70ca91 | 16073 | // Calculate sum of product of event weights for correlations. |
2001bc3a | 16074 | |
df23c5ae | 16075 | // TBI re-think what is the right multiplicity when particle weights are used! |
3842bdcd | 16076 | |
16077 | // Multiplicity bin of an event (relevant for all histos vs M): | |
16078 | Double_t dMultiplicityBin = 0.; | |
df23c5ae | 16079 | if(fMultiplicityIs==AliFlowCommonConstants::kRP) |
3842bdcd | 16080 | { |
df23c5ae | 16081 | dMultiplicityBin = fNumberOfRPsEBE+0.5; |
16082 | } else if(fMultiplicityIs==AliFlowCommonConstants::kExternal) | |
3842bdcd | 16083 | { |
16084 | dMultiplicityBin = fReferenceMultiplicityEBE+0.5; | |
df23c5ae | 16085 | } else if(fMultiplicityIs==AliFlowCommonConstants::kPOI) |
16086 | { | |
16087 | dMultiplicityBin = fNumberOfPOIsEBE+0.5; | |
16088 | } | |
2001bc3a | 16089 | |
489d5531 | 16090 | Int_t counter = 0; |
16091 | ||
16092 | for(Int_t ci1=1;ci1<4;ci1++) | |
16093 | { | |
16094 | for(Int_t ci2=ci1+1;ci2<=4;ci2++) | |
16095 | { | |
ff70ca91 | 16096 | fIntFlowSumOfProductOfEventWeights->Fill(0.5+counter, |
16097 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
b3dacf6b | 16098 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); |
16099 | if(fCalculateCumulantsVsM) | |
16100 | { | |
1db7eced | 16101 | if(fFillProfilesVsMUsingWeights) |
16102 | { | |
16103 | fIntFlowSumOfProductOfEventWeightsVsM[counter]->Fill(dMultiplicityBin, // to be improved: dMult => sum of weights? | |
16104 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
16105 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); | |
16106 | } else | |
16107 | { | |
16108 | fIntFlowSumOfProductOfEventWeightsVsM[counter]->Fill(dMultiplicityBin); | |
16109 | } | |
b3dacf6b | 16110 | } // end of if(fCalculateCumulantsVsM) |
ff70ca91 | 16111 | counter++; |
1db7eced | 16112 | } // end of for(Int_t ci2=ci1+1;ci2<=4;ci2++) |
16113 | } // end of for(Int_t ci1=1;ci1<4;ci1++) | |
489d5531 | 16114 | |
0328db2d | 16115 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeights() |
16116 | ||
e1d101a6 | 16117 | //======================================================================================================================= |
0328db2d | 16118 | |
0328db2d | 16119 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeightsNUA() |
16120 | { | |
16121 | // Calculate sum of product of event weights for NUA terms. | |
16122 | ||
16123 | // w_{<2>} * w_{<cos(#phi)>}: | |
16124 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(0.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
16125 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
16126 | // w_{<2>} * w_{<sin(#phi)>}: | |
16127 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(1.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
16128 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
16129 | // w_{<cos(#phi)> * w_{<sin(#phi)>}: | |
16130 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(2.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
16131 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
16132 | // w_{<2>} * w{<cos(phi1+phi2)>} | |
16133 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(3.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
16134 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
16135 | // w_{<2>} * w{<sin(phi1+phi2)>} | |
16136 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(4.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
16137 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
16138 | // w_{<2>} * w{<cos(phi1-phi2-phi3)>} | |
16139 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(5.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
16140 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
16141 | // w_{<2>} * w{<sin(phi1-phi2-phi3)>} | |
16142 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(6.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
16143 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
16144 | // w_{<4>} * w{<cos(phi1)>} | |
16145 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(7.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
16146 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
16147 | // w_{<4>} * w{<sin(phi1)>} | |
16148 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(8.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
16149 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
16150 | // w_{<4>} * w{<cos(phi1+phi2)>} | |
16151 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(9.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
16152 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
16153 | // w_{<4>} * w{<sin(phi1+phi2)>} | |
16154 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(10.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
16155 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
16156 | // w_{<4>} * w{<cos(phi1-phi2-phi3)>} | |
16157 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(11.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
16158 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
16159 | // w_{<4>} * w{<sin(phi1-phi2-phi3)>} | |
16160 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(12.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
16161 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
16162 | // w_{<cos(phi1)>} * w{<cos(phi1+phi2)>} | |
16163 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(13.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
16164 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
16165 | // w_{<cos(phi1)>} * w{<sin(phi1+phi2)>} | |
16166 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(14.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
16167 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
16168 | // w_{<cos(phi1)>} * w{<cos(phi1-phi2-phi3)>} | |
16169 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(15.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
16170 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
16171 | // w_{<cos(phi1)>} * w{<sin(phi1-phi2-phi3)>} | |
16172 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(16.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
16173 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
16174 | // w_{<sin(phi1)>} * w{<cos(phi1+phi2)>} | |
16175 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(17.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
16176 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
16177 | // w_{<sin(phi1)>} * w{<sin(phi1+phi2)>} | |
16178 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(18.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
16179 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
16180 | // w_{<sin(phi1)>} * w{<cos(phi1-phi2-phi3)>} | |
16181 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(19.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
16182 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
16183 | // w_{<sin(phi1)>} * w{<sin(phi1-phi2-phi3)>} | |
16184 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(20.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
16185 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
16186 | // w_{<cos(phi1+phi2)>} * w{<sin(phi1+phi2))>} | |
16187 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(21.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)* | |
16188 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
16189 | // w_{<cos(phi1+phi2)>} * w{<cos(phi1-phi2-phi3)>} | |
16190 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(22.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)* | |
16191 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
16192 | // w_{<cos(phi1+phi2)>} * w{<sin(phi1-phi2-phi3)>} | |
16193 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(23.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)* | |
16194 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
16195 | // w_{<sin(phi1+phi2)>} * w{<cos(phi1-phi2-phi3)>} | |
16196 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(24.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)* | |
16197 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
16198 | // w_{<sin(phi1+phi2)>} * w{<sin(phi1-phi2-phi3)>} | |
16199 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(25.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)* | |
16200 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
16201 | // w_{<cos(phi1-phi2-phi3)>} * w{<sin(phi1-phi2-phi3)>} | |
16202 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(26.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)* | |
16203 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
16204 | ||
16205 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowIntFlowSumOfProductOfEventWeightsNUA() | |
489d5531 | 16206 | |
e1d101a6 | 16207 | //======================================================================================================================= |
489d5531 | 16208 | |
489d5531 | 16209 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelations(TString type, TString ptOrEta) |
16210 | { | |
1268c371 | 16211 | // Calculate reduced correlations for RPs or POIs for all pt and eta bins. |
489d5531 | 16212 | |
1268c371 | 16213 | // Multiplicity: |
16214 | Double_t dMult = (*fSpk)(0,0); | |
489d5531 | 16215 | |
16216 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
16217 | Double_t dReQ1n = (*fReQ)(0,0); | |
16218 | Double_t dReQ2n = (*fReQ)(1,0); | |
16219 | //Double_t dReQ3n = (*fReQ)(2,0); | |
16220 | //Double_t dReQ4n = (*fReQ)(3,0); | |
16221 | Double_t dImQ1n = (*fImQ)(0,0); | |
16222 | Double_t dImQ2n = (*fImQ)(1,0); | |
16223 | //Double_t dImQ3n = (*fImQ)(2,0); | |
16224 | //Double_t dImQ4n = (*fImQ)(3,0); | |
16225 | ||
16226 | // reduced correlations are stored in fDiffFlowCorrelationsPro[0=RP,1=POI][0=pt,1=eta][correlation index]. Correlation index runs as follows: | |
16227 | // | |
16228 | // 0: <<2'>> | |
16229 | // 1: <<4'>> | |
16230 | // 2: <<6'>> | |
16231 | // 3: <<8'>> | |
16232 | ||
ea239361 | 16233 | //Int_t t = 0; // type flag |
2a98ceb8 | 16234 | Int_t pe = 0; // ptEta flag |
489d5531 | 16235 | |
16236 | if(type == "RP") | |
16237 | { | |
ea239361 | 16238 | //t = 0; |
489d5531 | 16239 | } else if(type == "POI") |
16240 | { | |
ea239361 | 16241 | //t = 1; |
489d5531 | 16242 | } |
16243 | ||
16244 | if(ptOrEta == "Pt") | |
16245 | { | |
16246 | pe = 0; | |
16247 | } else if(ptOrEta == "Eta") | |
16248 | { | |
16249 | pe = 1; | |
16250 | } | |
16251 | ||
16252 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
16253 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
16254 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
16255 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
16256 | ||
16257 | // looping over all bins and calculating reduced correlations: | |
16258 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
16259 | { | |
16260 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
16261 | Double_t p1n0kRe = 0.; | |
16262 | Double_t p1n0kIm = 0.; | |
16263 | ||
16264 | // number of POIs in particular pt or eta bin: | |
16265 | Double_t mp = 0.; | |
16266 | ||
16267 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
16268 | Double_t q1n0kRe = 0.; | |
16269 | Double_t q1n0kIm = 0.; | |
16270 | Double_t q2n0kRe = 0.; | |
16271 | Double_t q2n0kIm = 0.; | |
16272 | ||
16273 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
16274 | Double_t mq = 0.; | |
16275 | ||
16276 | if(type == "POI") | |
16277 | { | |
16278 | // q_{m*n,0}: | |
16279 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
16280 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
16281 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
16282 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
16283 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
16284 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
16285 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
16286 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
16287 | ||
16288 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
16289 | } | |
16290 | else if(type == "RP") | |
16291 | { | |
16292 | // q_{m*n,0}: | |
16293 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
16294 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
16295 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
16296 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
16297 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
16298 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
16299 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
16300 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
16301 | ||
16302 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
16303 | } | |
16304 | ||
16305 | if(type == "POI") | |
16306 | { | |
16307 | // p_{m*n,0}: | |
16308 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
16309 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
16310 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
16311 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
16312 | ||
16313 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
16314 | ||
ea239361 | 16315 | //t = 1; // typeFlag = RP or POI |
489d5531 | 16316 | } |
16317 | else if(type == "RP") | |
16318 | { | |
16319 | // p_{m*n,0} = q_{m*n,0}: | |
16320 | p1n0kRe = q1n0kRe; | |
16321 | p1n0kIm = q1n0kIm; | |
16322 | ||
16323 | mp = mq; | |
16324 | ||
ea239361 | 16325 | //t = 0; // typeFlag = RP or POI |
489d5531 | 16326 | } |
16327 | ||
1268c371 | 16328 | // 2'-particle correlation for particular pt or eta bin: |
489d5531 | 16329 | Double_t two1n1nPtEta = 0.; |
b40a910e | 16330 | Double_t mWeight2pPrime = 0.; // multiplicity weight for <2'> |
489d5531 | 16331 | if(mp*dMult-mq) |
16332 | { | |
16333 | two1n1nPtEta = (p1n0kRe*dReQ1n+p1n0kIm*dImQ1n-mq) | |
16334 | / (mp*dMult-mq); | |
b40a910e | 16335 | // determine multiplicity weight: |
df23c5ae | 16336 | if(fMultiplicityWeight->Contains("combinations")) |
b40a910e | 16337 | { |
16338 | mWeight2pPrime = mp*dMult-mq; | |
df23c5ae | 16339 | } else if(fMultiplicityWeight->Contains("unit")) |
b40a910e | 16340 | { |
16341 | mWeight2pPrime = 1.; | |
16342 | } | |
489d5531 | 16343 | if(type == "POI") // to be improved (I do not this if) |
16344 | { | |
16345 | // fill profile to get <<2'>> for POIs | |
b40a910e | 16346 | fDiffFlowCorrelationsPro[1][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta,mWeight2pPrime); |
16347 | // fill profile to get <<2'>^2> for POIs | |
16348 | fDiffFlowSquaredCorrelationsPro[1][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta*two1n1nPtEta,mWeight2pPrime); | |
489d5531 | 16349 | // histogram to store <2'> for POIs e-b-e (needed in some other methods): |
16350 | fDiffFlowCorrelationsEBE[1][pe][0]->SetBinContent(b,two1n1nPtEta); | |
b40a910e | 16351 | fDiffFlowEventWeightsForCorrelationsEBE[1][pe][0]->SetBinContent(b,mWeight2pPrime); |
489d5531 | 16352 | } |
16353 | else if(type == "RP") // to be improved (I do not this if) | |
16354 | { | |
16355 | // profile to get <<2'>> for RPs: | |
b40a910e | 16356 | fDiffFlowCorrelationsPro[0][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta,mWeight2pPrime); |
16357 | // profile to get <<2'>^2> for RPs: | |
16358 | fDiffFlowSquaredCorrelationsPro[0][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta*two1n1nPtEta,mWeight2pPrime); | |
489d5531 | 16359 | // histogram to store <2'> for RPs e-b-e (needed in some other methods): |
16360 | fDiffFlowCorrelationsEBE[0][pe][0]->SetBinContent(b,two1n1nPtEta); | |
b40a910e | 16361 | fDiffFlowEventWeightsForCorrelationsEBE[0][pe][0]->SetBinContent(b,mWeight2pPrime); |
489d5531 | 16362 | } |
16363 | } // end of if(mp*dMult-mq) | |
16364 | ||
16365 | // 4'-particle correlation: | |
16366 | Double_t four1n1n1n1nPtEta = 0.; | |
b40a910e | 16367 | Double_t mWeight4pPrime = 0.; // multiplicity weight for <4'> |
489d5531 | 16368 | if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) |
16369 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression) | |
16370 | { | |
16371 | four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
16372 | - q2n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) | |
16373 | - 2.*q2n0kIm*dReQ1n*dImQ1n | |
16374 | - p1n0kRe*(dReQ1n*dReQ2n+dImQ1n*dImQ2n) | |
16375 | + p1n0kIm*(dImQ1n*dReQ2n-dReQ1n*dImQ2n) | |
16376 | - 2.*dMult*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
16377 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*mq | |
16378 | + 6.*(q1n0kRe*dReQ1n+q1n0kIm*dImQ1n) | |
16379 | + 1.*(q2n0kRe*dReQ2n+q2n0kIm*dImQ2n) | |
16380 | + 2.*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
16381 | + 2.*mq*dMult | |
16382 | - 6.*mq) | |
16383 | / ((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
16384 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b40a910e | 16385 | // determine multiplicity weight: |
df23c5ae | 16386 | if(fMultiplicityWeight->Contains("combinations")) |
b40a910e | 16387 | { |
16388 | mWeight4pPrime = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
df23c5ae | 16389 | } else if(fMultiplicityWeight->Contains("unit")) |
b40a910e | 16390 | { |
16391 | mWeight4pPrime = 1.; | |
16392 | } | |
489d5531 | 16393 | if(type == "POI") |
16394 | { | |
16395 | // profile to get <<4'>> for POIs: | |
b40a910e | 16396 | fDiffFlowCorrelationsPro[1][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta,mWeight4pPrime); |
16397 | // profile to get <<4'>^2> for POIs: | |
16398 | fDiffFlowSquaredCorrelationsPro[1][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta*four1n1n1n1nPtEta,mWeight4pPrime); | |
489d5531 | 16399 | // histogram to store <4'> for POIs e-b-e (needed in some other methods): |
16400 | fDiffFlowCorrelationsEBE[1][pe][1]->SetBinContent(b,four1n1n1n1nPtEta); | |
b40a910e | 16401 | fDiffFlowEventWeightsForCorrelationsEBE[1][pe][1]->SetBinContent(b,mWeight4pPrime); |
489d5531 | 16402 | } |
16403 | else if(type == "RP") | |
16404 | { | |
16405 | // profile to get <<4'>> for RPs: | |
b40a910e | 16406 | fDiffFlowCorrelationsPro[0][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta,mWeight4pPrime); |
16407 | // profile to get <<4'>^2> for RPs: | |
16408 | fDiffFlowSquaredCorrelationsPro[0][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta*four1n1n1n1nPtEta,mWeight4pPrime); | |
489d5531 | 16409 | // histogram to store <4'> for RPs e-b-e (needed in some other methods): |
16410 | fDiffFlowCorrelationsEBE[0][pe][1]->SetBinContent(b,four1n1n1n1nPtEta); | |
b40a910e | 16411 | fDiffFlowEventWeightsForCorrelationsEBE[0][pe][1]->SetBinContent(b,mWeight4pPrime); |
489d5531 | 16412 | } |
16413 | } // end of if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
16414 | // +mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
16415 | ||
16416 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
16417 | ||
16418 | ||
16419 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelations(TString type, TString ptOrEta); | |
16420 | ||
e1d101a6 | 16421 | //======================================================================================================================= |
489d5531 | 16422 | |
64e500e3 | 16423 | void AliFlowAnalysisWithQCumulants::CalculateOtherDiffCorrelators(TString type, TString ptOrEta) |
16424 | { | |
16425 | // Calculate other differential correlators for RPs or POIs for all pt and eta bins. | |
16426 | ||
16427 | // Multiplicity: | |
16428 | Double_t dMult = (*fSpk)(0,0); | |
16429 | ||
16430 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
16431 | Double_t dReQ1n = (*fReQ)(0,0); | |
16432 | Double_t dReQ2n = (*fReQ)(1,0); | |
16433 | Double_t dReQ3n = (*fReQ)(2,0); | |
16434 | //Double_t dReQ4n = (*fReQ)(3,0); | |
16435 | Double_t dImQ1n = (*fImQ)(0,0); | |
16436 | Double_t dImQ2n = (*fImQ)(1,0); | |
16437 | Double_t dImQ3n = (*fImQ)(2,0); | |
16438 | //Double_t dImQ4n = (*fImQ)(3,0); | |
16439 | ||
16440 | // Other correlations are stored in fOtherDiffCorrelators[2][2][2][1], [0=RP,1=POI][0=pt,1=eta][0=sin terms,1=cos terms][correlator index] | |
16441 | // Correlation index runs as follows: | |
16442 | // | |
16443 | // 0: <exp[in(psi1-3phi2+2phi3)]> | |
16444 | ||
16445 | Int_t t = 0; // type flag | |
16446 | Int_t pe = 0; // ptEta flag | |
16447 | ||
16448 | if(type == "RP") | |
16449 | { | |
16450 | t = 0; | |
16451 | } else if(type == "POI") | |
16452 | { | |
16453 | t = 1; | |
16454 | } | |
16455 | ||
16456 | if(ptOrEta == "Pt") | |
16457 | { | |
16458 | pe = 0; | |
16459 | } else if(ptOrEta == "Eta") | |
16460 | { | |
16461 | pe = 1; | |
16462 | } | |
16463 | ||
16464 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
16465 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
16466 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
16467 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
16468 | ||
16469 | // looping over all bins and calculating reduced correlations: | |
16470 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
16471 | { | |
16472 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
16473 | Double_t p1n0kRe = 0.; | |
16474 | Double_t p1n0kIm = 0.; | |
16475 | ||
16476 | // number of POIs in particular pt or eta bin: | |
16477 | Double_t mp = 0.; | |
16478 | ||
16479 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
16480 | Double_t q1n0kRe = 0.; | |
16481 | Double_t q1n0kIm = 0.; | |
16482 | Double_t q2n0kRe = 0.; | |
16483 | Double_t q2n0kIm = 0.; | |
16484 | Double_t q3n0kRe = 0.; | |
16485 | Double_t q3n0kIm = 0.; | |
16486 | ||
16487 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
16488 | Double_t mq = 0.; | |
16489 | ||
16490 | if(type == "POI") | |
16491 | { | |
16492 | // q_{m*n,0}: | |
16493 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
16494 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
16495 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
16496 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
16497 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
16498 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
16499 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
16500 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
16501 | q3n0kRe = fReRPQ1dEBE[2][pe][2][0]->GetBinContent(fReRPQ1dEBE[2][pe][2][0]->GetBin(b)) | |
16502 | * fReRPQ1dEBE[2][pe][2][0]->GetBinEntries(fReRPQ1dEBE[2][pe][2][0]->GetBin(b)); | |
16503 | q3n0kIm = fImRPQ1dEBE[2][pe][2][0]->GetBinContent(fImRPQ1dEBE[2][pe][2][0]->GetBin(b)) | |
16504 | * fImRPQ1dEBE[2][pe][2][0]->GetBinEntries(fImRPQ1dEBE[2][pe][2][0]->GetBin(b)); | |
16505 | ||
16506 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
16507 | } | |
16508 | else if(type == "RP") | |
16509 | { | |
16510 | // q_{m*n,0}: | |
16511 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
16512 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
16513 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
16514 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
16515 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
16516 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
16517 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
16518 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
16519 | q3n0kRe = fReRPQ1dEBE[0][pe][2][0]->GetBinContent(fReRPQ1dEBE[0][pe][2][0]->GetBin(b)) | |
16520 | * fReRPQ1dEBE[0][pe][2][0]->GetBinEntries(fReRPQ1dEBE[0][pe][2][0]->GetBin(b)); | |
16521 | q3n0kIm = fImRPQ1dEBE[0][pe][2][0]->GetBinContent(fImRPQ1dEBE[0][pe][2][0]->GetBin(b)) | |
16522 | * fImRPQ1dEBE[0][pe][2][0]->GetBinEntries(fImRPQ1dEBE[0][pe][2][0]->GetBin(b)); | |
16523 | ||
16524 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
16525 | } | |
16526 | ||
16527 | if(type == "POI") | |
16528 | { | |
16529 | // p_{m*n,0}: | |
16530 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
16531 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
16532 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
16533 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
16534 | ||
16535 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
16536 | ||
16537 | t = 1; // typeFlag = RP or POI | |
16538 | } | |
16539 | else if(type == "RP") | |
16540 | { | |
16541 | // p_{m*n,0} = q_{m*n,0}: | |
16542 | p1n0kRe = q1n0kRe; | |
16543 | p1n0kIm = q1n0kIm; | |
16544 | ||
16545 | mp = mq; | |
16546 | ||
16547 | t = 0; // typeFlag = RP or POI | |
16548 | } | |
16549 | ||
16550 | // 3'-particle correlators: | |
16551 | // Taeney-Yan correlator: | |
16552 | Double_t dTaeneyYan = 0.; | |
16553 | Double_t mWeightTaeneyYan = 0.; // multiplicity weight for Taeney-Yan correlator | |
16554 | if((mp*dMult-2.*mq)*(dMult-1.) > 0.) // to be improved - is this condition fully justified? | |
16555 | { | |
16556 | dTaeneyYan = (dReQ3n*(p1n0kRe*dReQ2n-p1n0kIm*dImQ2n)+dImQ3n*(p1n0kIm*dReQ2n+p1n0kRe*dImQ2n) | |
16557 | - p1n0kRe*dReQ1n - p1n0kIm*dImQ1n | |
16558 | - q2n0kRe*dReQ2n - q2n0kIm*dImQ2n | |
16559 | - q3n0kRe*dReQ3n - q3n0kIm*dImQ3n | |
16560 | + 2.*mq) | |
16561 | / ((mp*dMult-2.*mq)*(dMult-1.)); | |
16562 | // determine multiplicity weight: | |
df23c5ae | 16563 | if(fMultiplicityWeight->Contains("combinations")) |
64e500e3 | 16564 | { |
16565 | mWeightTaeneyYan = (mp*dMult-2.*mq)*(dMult-1.); | |
df23c5ae | 16566 | } else if(fMultiplicityWeight->Contains("unit")) |
64e500e3 | 16567 | { |
16568 | mWeightTaeneyYan = 1.; | |
16569 | } | |
16570 | // Fill profiles: | |
16571 | fOtherDiffCorrelators[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dTaeneyYan,mWeightTaeneyYan); | |
16572 | } // end of if((mp*dMult-2.*mq)*(dMult-1.) > 0.) | |
16573 | ||
16574 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
16575 | ||
16576 | } // end of void AliFlowAnalysisWithQCumulants::CalculateOtherDiffCorrelators(TString type, TString ptOrEta) | |
16577 | ||
e1d101a6 | 16578 | //======================================================================================================================= |
64e500e3 | 16579 | |
1268c371 | 16580 | void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCorrelations(TString type) |
16581 | { | |
16582 | // Calculate all reduced correlations needed for 2D differential flow for each (pt,eta) bin. | |
16583 | ||
16584 | // Multiplicity: | |
16585 | Double_t dMult = (*fSpk)(0,0); | |
16586 | // Real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
16587 | Double_t dReQ1n = (*fReQ)(0,0); | |
16588 | Double_t dReQ2n = (*fReQ)(1,0); | |
16589 | //Double_t dReQ3n = (*fReQ)(2,0); | |
16590 | //Double_t dReQ4n = (*fReQ)(3,0); | |
16591 | Double_t dImQ1n = (*fImQ)(0,0); | |
16592 | Double_t dImQ2n = (*fImQ)(1,0); | |
16593 | //Double_t dImQ3n = (*fImQ)(2,0); | |
16594 | //Double_t dImQ4n = (*fImQ)(3,0); | |
16595 | ||
16596 | // 2D reduced correlations are stored in TProfile2D f2DDiffFlowCorrelationsPro[0=RP,1=POI][correlation index]. | |
16597 | // Correlation index runs as follows: | |
16598 | // 0: <<2'>> | |
16599 | // 1: <<4'>> | |
16600 | // 2: <<6'>> | |
16601 | // 3: <<8'>> | |
16602 | ||
16603 | Int_t t = 0; // type flag | |
16604 | if(type == "RP") | |
16605 | { | |
16606 | t = 0; | |
16607 | } else if(type == "POI") | |
16608 | { | |
16609 | t = 1; | |
16610 | } | |
16611 | ||
16612 | // Looping over all (pt,eta) bins and calculating correlations needed for differential flow: | |
16613 | for(Int_t p=1;p<=fnBinsPt;p++) | |
16614 | { | |
16615 | for(Int_t e=1;e<=fnBinsEta;e++) | |
16616 | { | |
16617 | // Real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): | |
16618 | Double_t p1n0kRe = 0.; | |
16619 | Double_t p1n0kIm = 0.; | |
16620 | // Number of POIs in particular pt or eta bin: | |
16621 | Double_t mp = 0.; | |
16622 | // Real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for 'RP && POI particles' in particular pt or eta bin): | |
16623 | Double_t q1n0kRe = 0.; | |
16624 | Double_t q1n0kIm = 0.; | |
16625 | Double_t q2n0kRe = 0.; | |
16626 | Double_t q2n0kIm = 0.; | |
16627 | // Number of 'RP && POI particles' in particular pt or eta bin: | |
16628 | Double_t mq = 0.; | |
16629 | if(type == "POI") | |
16630 | { | |
16631 | // q_{m*n,0}: | |
16632 | q1n0kRe = fReRPQ2dEBE[2][0][0]->GetBinContent(fReRPQ2dEBE[2][0][0]->GetBin(p,e)) | |
16633 | * fReRPQ2dEBE[2][0][0]->GetBinEntries(fReRPQ2dEBE[2][0][0]->GetBin(p,e)); | |
16634 | q1n0kIm = fImRPQ2dEBE[2][0][0]->GetBinContent(fImRPQ2dEBE[2][0][0]->GetBin(p,e)) | |
16635 | * fImRPQ2dEBE[2][0][0]->GetBinEntries(fImRPQ2dEBE[2][0][0]->GetBin(p,e)); | |
16636 | q2n0kRe = fReRPQ2dEBE[2][1][0]->GetBinContent(fReRPQ2dEBE[2][1][0]->GetBin(p,e)) | |
16637 | * fReRPQ2dEBE[2][1][0]->GetBinEntries(fReRPQ2dEBE[2][1][0]->GetBin(p,e)); | |
16638 | q2n0kIm = fImRPQ2dEBE[2][1][0]->GetBinContent(fImRPQ2dEBE[2][1][0]->GetBin(p,e)) | |
16639 | * fImRPQ2dEBE[2][1][0]->GetBinEntries(fImRPQ2dEBE[2][1][0]->GetBin(p,e)); | |
16640 | // m_{q}: | |
16641 | mq = fReRPQ2dEBE[2][0][0]->GetBinEntries(fReRPQ2dEBE[2][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) | |
16642 | } // end of if(type == "POI") | |
16643 | else if(type == "RP") | |
16644 | { | |
16645 | // q_{m*n,0}: | |
16646 | q1n0kRe = fReRPQ2dEBE[0][0][0]->GetBinContent(fReRPQ2dEBE[0][0][0]->GetBin(p,e)) | |
16647 | * fReRPQ2dEBE[0][0][0]->GetBinEntries(fReRPQ2dEBE[0][0][0]->GetBin(p,e)); | |
16648 | q1n0kIm = fImRPQ2dEBE[0][0][0]->GetBinContent(fImRPQ2dEBE[0][0][0]->GetBin(p,e)) | |
16649 | * fImRPQ2dEBE[0][0][0]->GetBinEntries(fImRPQ2dEBE[0][0][0]->GetBin(p,e)); | |
16650 | q2n0kRe = fReRPQ2dEBE[0][1][0]->GetBinContent(fReRPQ2dEBE[0][1][0]->GetBin(p,e)) | |
16651 | * fReRPQ2dEBE[0][1][0]->GetBinEntries(fReRPQ2dEBE[0][1][0]->GetBin(p,e)); | |
16652 | q2n0kIm = fImRPQ2dEBE[0][1][0]->GetBinContent(fImRPQ2dEBE[0][1][0]->GetBin(p,e)) | |
16653 | * fImRPQ2dEBE[0][1][0]->GetBinEntries(fImRPQ2dEBE[0][1][0]->GetBin(p,e)); | |
16654 | // m_{q}: | |
16655 | mq = fReRPQ2dEBE[0][0][0]->GetBinEntries(fReRPQ2dEBE[0][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) | |
16656 | } // end of else if(type == "RP") | |
16657 | if(type == "POI") | |
16658 | { | |
16659 | // p_{m*n,0}: | |
16660 | p1n0kRe = fReRPQ2dEBE[1][0][0]->GetBinContent(fReRPQ2dEBE[1][0][0]->GetBin(p,e)) | |
16661 | * fReRPQ2dEBE[1][0][0]->GetBinEntries(fReRPQ2dEBE[1][0][0]->GetBin(p,e)); | |
16662 | p1n0kIm = fImRPQ2dEBE[1][0][0]->GetBinContent(fImRPQ2dEBE[1][0][0]->GetBin(p,e)) | |
16663 | * fImRPQ2dEBE[1][0][0]->GetBinEntries(fImRPQ2dEBE[1][0][0]->GetBin(p,e)); | |
16664 | // m_{p} | |
16665 | mp = fReRPQ2dEBE[1][0][0]->GetBinEntries(fReRPQ2dEBE[1][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) | |
16666 | ||
16667 | t = 1; // typeFlag = RP or POI | |
16668 | } // end of if(type == "POI") | |
16669 | else if(type == "RP") | |
16670 | { | |
16671 | // p_{m*n,0} = q_{m*n,0}: | |
16672 | p1n0kRe = q1n0kRe; | |
16673 | p1n0kIm = q1n0kIm; | |
16674 | // m_{p} = m_{q}: | |
16675 | mp = mq; | |
16676 | ||
16677 | t = 0; // typeFlag = RP or POI | |
16678 | } // end of if(type == "RP") | |
16679 | ||
16680 | // 2'-particle correlation for particular (pt,eta) bin: | |
16681 | Double_t two1n1nPtEta = 0.; | |
16682 | Double_t mWeight2pPrime = 0.; // multiplicity weight for <2'> | |
16683 | if(mp*dMult-mq) | |
16684 | { | |
16685 | two1n1nPtEta = (p1n0kRe*dReQ1n+p1n0kIm*dImQ1n-mq) | |
16686 | / (mp*dMult-mq); | |
16687 | // Determine multiplicity weight: | |
df23c5ae | 16688 | if(fMultiplicityWeight->Contains("combinations")) |
1268c371 | 16689 | { |
16690 | mWeight2pPrime = mp*dMult-mq; | |
df23c5ae | 16691 | } else if(fMultiplicityWeight->Contains("unit")) |
1268c371 | 16692 | { |
16693 | mWeight2pPrime = 1.; | |
16694 | } | |
16695 | // Fill 2D profile holding <<2'>>: | |
16696 | f2DDiffFlowCorrelationsPro[t][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mWeight2pPrime); | |
16697 | } // end of if(mp*dMult-mq) | |
16698 | ||
16699 | // 4'-particle correlation: | |
16700 | Double_t four1n1n1n1nPtEta = 0.; | |
16701 | Double_t mWeight4pPrime = 0.; // multiplicity weight for <4'> | |
16702 | if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
16703 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression) | |
16704 | { | |
16705 | four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
16706 | - q2n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) | |
16707 | - 2.*q2n0kIm*dReQ1n*dImQ1n | |
16708 | - p1n0kRe*(dReQ1n*dReQ2n+dImQ1n*dImQ2n) | |
16709 | + p1n0kIm*(dImQ1n*dReQ2n-dReQ1n*dImQ2n) | |
16710 | - 2.*dMult*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
16711 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*mq | |
16712 | + 6.*(q1n0kRe*dReQ1n+q1n0kIm*dImQ1n) | |
16713 | + 1.*(q2n0kRe*dReQ2n+q2n0kIm*dImQ2n) | |
16714 | + 2.*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
16715 | + 2.*mq*dMult | |
16716 | - 6.*mq) | |
16717 | / ((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
16718 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
16719 | // Determine multiplicity weight: | |
df23c5ae | 16720 | if(fMultiplicityWeight->Contains("combinations")) |
1268c371 | 16721 | { |
16722 | mWeight4pPrime = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
df23c5ae | 16723 | } else if(fMultiplicityWeight->Contains("unit")) |
1268c371 | 16724 | { |
16725 | mWeight4pPrime = 1.; | |
16726 | } | |
16727 | // Fill 2D profile holding <<4'>>: | |
16728 | f2DDiffFlowCorrelationsPro[t][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta,mWeight4pPrime); | |
16729 | } // end of if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
16730 | // +mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
16731 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
16732 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
16733 | ||
16734 | } // end of AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCorrelations(TString type) | |
16735 | ||
e1d101a6 | 16736 | //======================================================================================================================= |
1268c371 | 16737 | |
489d5531 | 16738 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfEventWeights(TString type, TString ptOrEta) |
16739 | { | |
16740 | // Calculate sums of various event weights for reduced correlations. | |
16741 | // (These quantitites are needed in expressions for unbiased estimators relevant for the statistical errors.) | |
16742 | ||
2a98ceb8 | 16743 | Int_t typeFlag = 0; |
16744 | Int_t ptEtaFlag = 0; | |
489d5531 | 16745 | |
16746 | if(type == "RP") | |
16747 | { | |
16748 | typeFlag = 0; | |
16749 | } else if(type == "POI") | |
16750 | { | |
16751 | typeFlag = 1; | |
16752 | } | |
16753 | ||
16754 | if(ptOrEta == "Pt") | |
16755 | { | |
16756 | ptEtaFlag = 0; | |
16757 | } else if(ptOrEta == "Eta") | |
16758 | { | |
16759 | ptEtaFlag = 1; | |
16760 | } | |
16761 | ||
16762 | // shortcuts: | |
16763 | Int_t t = typeFlag; | |
16764 | Int_t pe = ptEtaFlag; | |
16765 | ||
16766 | // binning: | |
16767 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
16768 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
16769 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
16770 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
16771 | ||
16772 | for(Int_t rpq=0;rpq<3;rpq++) | |
16773 | { | |
16774 | for(Int_t m=0;m<4;m++) | |
16775 | { | |
16776 | for(Int_t k=0;k<9;k++) | |
16777 | { | |
16778 | if(!fReRPQ1dEBE[rpq][pe][m][k]) | |
16779 | { | |
16780 | cout<<"WARNING: fReRPQ1dEBE[rpq][pe][m][k] is NULL in AFAWQC::CSAPOEWFDF() !!!!"<<endl; | |
16781 | cout<<"pe = "<<pe<<endl; | |
16782 | cout<<"rpq = "<<rpq<<endl; | |
16783 | cout<<"m = "<<m<<endl; | |
16784 | cout<<"k = "<<k<<endl; | |
16785 | exit(0); | |
16786 | } | |
16787 | } | |
16788 | } | |
16789 | } | |
16790 | ||
16791 | // multiplicities: | |
1268c371 | 16792 | Double_t dMult = (*fSpk)(0,0); // total event multiplicity |
489d5531 | 16793 | //Double_t mr = 0.; // number of RPs in particular pt or eta bin |
16794 | Double_t mp = 0.; // number of POIs in particular pt or eta bin | |
16795 | Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin | |
16796 | ||
16797 | // event weights for reduced correlations: | |
16798 | Double_t dw2 = 0.; // event weight for <2'> | |
16799 | Double_t dw4 = 0.; // event weight for <4'> | |
16800 | //Double_t dw6 = 0.; // event weight for <6'> | |
16801 | //Double_t dw8 = 0.; // event weight for <8'> | |
16802 | ||
16803 | // looping over bins: | |
16804 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
16805 | { | |
16806 | if(type == "RP") | |
16807 | { | |
16808 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b); | |
16809 | mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow | |
16810 | } else if(type == "POI") | |
16811 | { | |
16812 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b); | |
16813 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); | |
16814 | } | |
16815 | ||
16816 | // event weight for <2'>: | |
16817 | dw2 = mp*dMult-mq; | |
16818 | fDiffFlowSumOfEventWeights[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2); | |
16819 | fDiffFlowSumOfEventWeights[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw2,2.)); | |
16820 | ||
16821 | // event weight for <4'>: | |
16822 | dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
16823 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
16824 | fDiffFlowSumOfEventWeights[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4); | |
16825 | fDiffFlowSumOfEventWeights[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw4,2.)); | |
16826 | ||
16827 | // event weight for <6'>: | |
16828 | //dw6 = ...; | |
16829 | //fDiffFlowSumOfEventWeights[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6); | |
16830 | //fDiffFlowSumOfEventWeights[t][pe][t][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw6,2.)); | |
16831 | ||
16832 | // event weight for <8'>: | |
16833 | //dw8 = ...; | |
16834 | //fDiffFlowSumOfEventWeights[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw8); | |
16835 | //fDiffFlowSumOfEventWeights[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw8,2.)); | |
16836 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
16837 | ||
16838 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfEventWeights() | |
16839 | ||
16840 | ||
e1d101a6 | 16841 | //======================================================================================================================= |
489d5531 | 16842 | |
16843 | ||
16844 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfProductOfEventWeights(TString type, TString ptOrEta) | |
16845 | { | |
16846 | // Calculate sum of products of various event weights for both types of correlations (the ones for int. and diff. flow). | |
16847 | // (These quantitites are needed in expressions for unbiased estimators relevant for the statistical errors.) | |
16848 | // | |
16849 | // Important: To fill fDiffFlowSumOfProductOfEventWeights[][][][] use bellow table (i,j) with following constraints: | |
16850 | // 1.) i<j | |
16851 | // 2.) do not store terms which DO NOT include reduced correlations; | |
16852 | // Table: | |
16853 | // [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] x [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] | |
16854 | ||
2a98ceb8 | 16855 | Int_t typeFlag = 0; |
16856 | Int_t ptEtaFlag = 0; | |
489d5531 | 16857 | |
16858 | if(type == "RP") | |
16859 | { | |
16860 | typeFlag = 0; | |
16861 | } else if(type == "POI") | |
16862 | { | |
16863 | typeFlag = 1; | |
16864 | } | |
16865 | ||
16866 | if(ptOrEta == "Pt") | |
16867 | { | |
16868 | ptEtaFlag = 0; | |
16869 | } else if(ptOrEta == "Eta") | |
16870 | { | |
16871 | ptEtaFlag = 1; | |
16872 | } | |
16873 | ||
16874 | // shortcuts: | |
16875 | Int_t t = typeFlag; | |
16876 | Int_t pe = ptEtaFlag; | |
16877 | ||
16878 | // binning: | |
16879 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
16880 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
16881 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
16882 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
16883 | ||
16884 | // protection: | |
16885 | for(Int_t rpq=0;rpq<3;rpq++) | |
16886 | { | |
16887 | for(Int_t m=0;m<4;m++) | |
16888 | { | |
16889 | for(Int_t k=0;k<9;k++) | |
16890 | { | |
16891 | if(!fReRPQ1dEBE[rpq][pe][m][k]) | |
16892 | { | |
16893 | cout<<"WARNING: fReRPQ1dEBE[rpq][pe][m][k] is NULL in AFAWQC::CSAPOEWFDF() !!!!"<<endl; | |
16894 | cout<<"pe = "<<pe<<endl; | |
16895 | cout<<"rpq = "<<rpq<<endl; | |
16896 | cout<<"m = "<<m<<endl; | |
16897 | cout<<"k = "<<k<<endl; | |
16898 | exit(0); | |
16899 | } | |
16900 | } | |
16901 | } | |
16902 | } | |
16903 | ||
16904 | // multiplicities: | |
1268c371 | 16905 | Double_t dMult = (*fSpk)(0,0); // total event multiplicity |
489d5531 | 16906 | //Double_t mr = 0.; // number of RPs in particular pt or eta bin |
16907 | Double_t mp = 0.; // number of POIs in particular pt or eta bin | |
16908 | Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin | |
16909 | ||
16910 | // event weights for correlations: | |
16911 | Double_t dW2 = dMult*(dMult-1); // event weight for <2> | |
16912 | Double_t dW4 = dMult*(dMult-1)*(dMult-2)*(dMult-3); // event weight for <4> | |
16913 | Double_t dW6 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5); // event weight for <6> | |
16914 | Double_t dW8 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)*(dMult-6)*(dMult-7); // event weight for <8> | |
16915 | ||
16916 | // event weights for reduced correlations: | |
16917 | Double_t dw2 = 0.; // event weight for <2'> | |
16918 | Double_t dw4 = 0.; // event weight for <4'> | |
16919 | //Double_t dw6 = 0.; // event weight for <6'> | |
16920 | //Double_t dw8 = 0.; // event weight for <8'> | |
16921 | ||
16922 | // looping over bins: | |
16923 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
16924 | { | |
16925 | if(type == "RP") | |
16926 | { | |
16927 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b); | |
16928 | mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow | |
16929 | } else if(type == "POI") | |
16930 | { | |
16931 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b); | |
16932 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); | |
16933 | } | |
16934 | ||
16935 | // event weight for <2'>: | |
16936 | dw2 = mp*dMult-mq; | |
16937 | fDiffFlowSumOfProductOfEventWeights[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw2); // storing product of even weights for <2> and <2'> | |
16938 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW4); // storing product of even weights for <4> and <2'> | |
16939 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW6); // storing product of even weights for <6> and <2'> | |
16940 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW8); // storing product of even weights for <8> and <2'> | |
16941 | ||
16942 | // event weight for <4'>: | |
16943 | dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
16944 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
16945 | fDiffFlowSumOfProductOfEventWeights[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw4); // storing product of even weights for <2> and <4'> | |
16946 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw4); // storing product of even weights for <2'> and <4'> | |
16947 | fDiffFlowSumOfProductOfEventWeights[t][pe][2][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw4); // storing product of even weights for <4> and <4'> | |
16948 | fDiffFlowSumOfProductOfEventWeights[t][pe][3][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dW6); // storing product of even weights for <6> and <4'> | |
16949 | fDiffFlowSumOfProductOfEventWeights[t][pe][3][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dW8); // storing product of even weights for <8> and <4'> | |
16950 | ||
16951 | // event weight for <6'>: | |
16952 | //dw6 = ...; | |
16953 | //fDiffFlowSumOfProductOfEventWeights[t][pe][0][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw6); // storing product of even weights for <2> and <6'> | |
16954 | //fDiffFlowSumOfProductOfEventWeights[t][pe][1][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw6); // storing product of even weights for <2'> and <6'> | |
16955 | //fDiffFlowSumOfProductOfEventWeights[t][pe][2][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw6); // storing product of even weights for <4> and <6'> | |
16956 | //fDiffFlowSumOfProductOfEventWeights[t][pe][3][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dw6); // storing product of even weights for <4'> and <6'> | |
16957 | //fDiffFlowSumOfProductOfEventWeights[t][pe][4][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW6*dw6); // storing product of even weights for <6> and <6'> | |
16958 | //fDiffFlowSumOfProductOfEventWeights[t][pe][5][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dW8); // storing product of even weights for <6'> and <8> | |
16959 | //fDiffFlowSumOfProductOfEventWeights[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dw8); // storing product of even weights for <6'> and <8'> | |
16960 | ||
16961 | // event weight for <8'>: | |
16962 | //dw8 = ...; | |
16963 | //fDiffFlowSumOfProductOfEventWeights[t][pe][0][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw8); // storing product of even weights for <2> and <8'> | |
16964 | //fDiffFlowSumOfProductOfEventWeights[t][pe][1][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw8); // storing product of even weights for <2'> and <8'> | |
16965 | //fDiffFlowSumOfProductOfEventWeights[t][pe][2][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw8); // storing product of even weights for <4> and <8'> | |
16966 | //fDiffFlowSumOfProductOfEventWeights[t][pe][3][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dw8); // storing product of even weights for <4'> and <8'> | |
16967 | //fDiffFlowSumOfProductOfEventWeights[t][pe][4][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW6*dw8); // storing product of even weights for <6> and <8'> | |
16968 | //fDiffFlowSumOfProductOfEventWeights[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dw8); // storing product of even weights for <6'> and <8'> | |
16969 | //fDiffFlowSumOfProductOfEventWeights[t][pe][6][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW8*dw8); // storing product of even weights for <8> and <8'> | |
16970 | ||
16971 | // Table: | |
16972 | // [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] x [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] | |
16973 | ||
16974 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
16975 | ||
16976 | ||
16977 | ||
16978 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfProductOfEventWeights(TString type, TString ptOrEta) | |
16979 | ||
e1d101a6 | 16980 | //======================================================================================================================= |
489d5531 | 16981 | |
489d5531 | 16982 | void AliFlowAnalysisWithQCumulants::FinalizeReducedCorrelations(TString type, TString ptOrEta) |
16983 | { | |
16984 | // Transfer profiles into histograms and calculate statistical errors correctly. | |
16985 | ||
1268c371 | 16986 | Int_t t = 0; // RP or POI |
16987 | Int_t pe = 0; // pt or eta | |
489d5531 | 16988 | |
16989 | if(type == "RP") | |
16990 | { | |
1268c371 | 16991 | t = 0; |
489d5531 | 16992 | } else if(type == "POI") |
16993 | { | |
1268c371 | 16994 | t = 1; |
489d5531 | 16995 | } |
16996 | ||
16997 | if(ptOrEta == "Pt") | |
16998 | { | |
1268c371 | 16999 | pe = 0; |
489d5531 | 17000 | } else if(ptOrEta == "Eta") |
17001 | { | |
1268c371 | 17002 | pe = 1; |
489d5531 | 17003 | } |
1268c371 | 17004 | |
17005 | for(Int_t rci=0;rci<4;rci++) // to be improved - moved into the method CheckPointersUsedInFinish() | |
489d5531 | 17006 | { |
17007 | if(!fDiffFlowCorrelationsPro[t][pe][rci]) | |
17008 | { | |
17009 | cout<<"WARNING: fDiffFlowCorrelationsPro[t][pe][rci] is NULL in AFAWQC::FRC() !!!!"<<endl; | |
17010 | cout<<"t = "<<t<<endl; | |
17011 | cout<<"pe = "<<pe<<endl; | |
17012 | cout<<"rci = "<<rci<<endl; | |
17013 | exit(0); | |
17014 | } | |
b40a910e | 17015 | if(!fDiffFlowSquaredCorrelationsPro[t][pe][rci]) |
17016 | { | |
17017 | cout<<"WARNING: fDiffFlowSquaredCorrelationsPro[t][pe][rci] is NULL in AFAWQC::FRC() !!!!"<<endl; | |
17018 | cout<<"t = "<<t<<endl; | |
17019 | cout<<"pe = "<<pe<<endl; | |
17020 | cout<<"rci = "<<rci<<endl; | |
17021 | exit(0); | |
17022 | } | |
489d5531 | 17023 | for(Int_t power=0;power<2;power++) |
17024 | { | |
17025 | if(!fDiffFlowSumOfEventWeights[t][pe][power][rci]) | |
17026 | { | |
17027 | cout<<"WARNING: fDiffFlowSumOfEventWeights[t][pe][power][rci] is NULL in AFAWQC::FRC() !!!!"<<endl; | |
17028 | cout<<"t = "<<t<<endl; | |
17029 | cout<<"pe = "<<pe<<endl; | |
17030 | cout<<"power = "<<power<<endl; | |
17031 | cout<<"rci = "<<rci<<endl; | |
17032 | exit(0); | |
17033 | } | |
17034 | } // end of for(Int_t power=0;power<2;power++) | |
17035 | } // end of for(Int_t rci=0;rci<4;rci++) | |
17036 | ||
17037 | // common: | |
b40a910e | 17038 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
489d5531 | 17039 | // transfer 1D profile into 1D histogram: |
17040 | Double_t correlation = 0.; | |
b40a910e | 17041 | Double_t squaredCorrelation = 0.; |
489d5531 | 17042 | Double_t spread = 0.; |
17043 | Double_t sumOfWeights = 0.; // sum of weights for particular reduced correlations for particular pt or eta bin | |
17044 | Double_t sumOfSquaredWeights = 0.; // sum of squared weights for particular reduced correlations for particular pt or eta bin | |
17045 | Double_t error = 0.; // error = termA * spread * termB | |
17046 | // termA = (sqrt(sumOfSquaredWeights)/sumOfWeights) | |
17047 | // termB = 1/pow(1-termA^2,0.5) | |
17048 | Double_t termA = 0.; | |
17049 | Double_t termB = 0.; | |
17050 | for(Int_t rci=0;rci<4;rci++) // index of reduced correlation | |
17051 | { | |
17052 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) // number of pt or eta bins | |
17053 | { | |
b40a910e | 17054 | if(fDiffFlowCorrelationsPro[t][pe][rci]->GetBinEffectiveEntries(b) < 2 || |
17055 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->GetBinEffectiveEntries(b) < 2) | |
17056 | { | |
17057 | fDiffFlowCorrelationsPro[t][pe][rci]->SetBinError(b,0.); | |
17058 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->SetBinError(b,0.); | |
17059 | continue; // to be improved - should I ignore results in pt bins with one entry for reduced correlations or not? | |
17060 | } | |
489d5531 | 17061 | correlation = fDiffFlowCorrelationsPro[t][pe][rci]->GetBinContent(b); |
b40a910e | 17062 | squaredCorrelation = fDiffFlowSquaredCorrelationsPro[t][pe][rci]->GetBinContent(b); |
17063 | if(squaredCorrelation-correlation*correlation >= 0.) | |
17064 | { | |
17065 | spread = pow(squaredCorrelation-correlation*correlation,0.5); | |
17066 | } else | |
17067 | { | |
17068 | cout<<endl; | |
17069 | cout<<Form(" WARNING: Imaginary 'spread' for rci = %d, pe = %d, bin = %d !!!!",rci,pe,b)<<endl; | |
17070 | cout<<endl; | |
17071 | } | |
489d5531 | 17072 | sumOfWeights = fDiffFlowSumOfEventWeights[t][pe][0][rci]->GetBinContent(b); |
17073 | sumOfSquaredWeights = fDiffFlowSumOfEventWeights[t][pe][1][rci]->GetBinContent(b); | |
1268c371 | 17074 | if(TMath::Abs(sumOfWeights)>0.){termA = (pow(sumOfSquaredWeights,0.5)/sumOfWeights);} |
17075 | if(1.-pow(termA,2.)>0.){termB = 1./pow(1.-pow(termA,2.),0.5);} | |
489d5531 | 17076 | error = termA*spread*termB; // final error (unbiased estimator for standard deviation) |
17077 | fDiffFlowCorrelationsHist[t][pe][rci]->SetBinContent(b,correlation); | |
17078 | fDiffFlowCorrelationsHist[t][pe][rci]->SetBinError(b,error); | |
17079 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
17080 | } // end of for(Int_t rci=0;rci<4;rci++) | |
17081 | ||
17082 | } // end of void AliFlowAnalysisWithQCumulants::FinalizeReducedCorrelations(TString type, TString ptOrEta) | |
17083 | ||
e1d101a6 | 17084 | //======================================================================================================================= |
489d5531 | 17085 | |
489d5531 | 17086 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowProductOfCorrelations(TString type, TString ptOrEta) |
17087 | { | |
17088 | // store products: <2><2'>, <2><4'>, <2><6'>, <2><8'>, <2'><4>, | |
17089 | // <2'><4'>, <2'><6>, <2'><6'>, <2'><8>, <2'><8'>, | |
17090 | // <4><4'>, <4><6'>, <4><8'>, <4'><6>, <4'><6'>, | |
17091 | // <4'><8>, <4'><8'>, <6><6'>, <6><8'>, <6'><8>, | |
17092 | // <6'><8'>, <8><8'>. | |
17093 | ||
2a98ceb8 | 17094 | Int_t typeFlag = 0; |
17095 | Int_t ptEtaFlag = 0; | |
489d5531 | 17096 | |
17097 | if(type == "RP") | |
17098 | { | |
17099 | typeFlag = 0; | |
17100 | } else if(type == "POI") | |
17101 | { | |
17102 | typeFlag = 1; | |
17103 | } | |
17104 | ||
17105 | if(ptOrEta == "Pt") | |
17106 | { | |
17107 | ptEtaFlag = 0; | |
17108 | } else if(ptOrEta == "Eta") | |
17109 | { | |
17110 | ptEtaFlag = 1; | |
17111 | } | |
17112 | ||
17113 | // shortcuts: | |
17114 | Int_t t = typeFlag; | |
17115 | Int_t pe = ptEtaFlag; | |
17116 | ||
17117 | // common: | |
17118 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
17119 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
17120 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
17121 | ||
17122 | // protections // to be improved (add protection for all pointers in this method) | |
17123 | if(!fIntFlowCorrelationsEBE) | |
17124 | { | |
17125 | cout<<"WARNING: fIntFlowCorrelationsEBE is NULL in AFAWQC::CDFPOC() !!!!"<<endl; | |
17126 | exit(0); | |
17127 | } | |
17128 | ||
17129 | /* | |
1268c371 | 17130 | Double_t dMult = (*fSpk)(0,0); // multiplicity (number of particles used to determine the reaction plane) |
489d5531 | 17131 | //Double_t mr = 0.; // number of RPs in particular pt or eta bin |
17132 | Double_t mp = 0.; // number of POIs in particular pt or eta bin | |
17133 | Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin | |
17134 | */ | |
17135 | ||
17136 | // e-b-e correlations: | |
17137 | Double_t twoEBE = fIntFlowCorrelationsEBE->GetBinContent(1); // <2> | |
17138 | Double_t fourEBE = fIntFlowCorrelationsEBE->GetBinContent(2); // <4> | |
17139 | Double_t sixEBE = fIntFlowCorrelationsEBE->GetBinContent(3); // <6> | |
17140 | Double_t eightEBE = fIntFlowCorrelationsEBE->GetBinContent(4); // <8> | |
17141 | ||
17142 | // event weights for correlations: | |
17143 | Double_t dW2 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1); // event weight for <2> | |
17144 | Double_t dW4 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2); // event weight for <4> | |
17145 | Double_t dW6 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(3); // event weight for <6> | |
17146 | Double_t dW8 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(4); // event weight for <8> | |
17147 | ||
17148 | // e-b-e reduced correlations: | |
17149 | Double_t twoReducedEBE = 0.; // <2'> | |
17150 | Double_t fourReducedEBE = 0.; // <4'> | |
ea239361 | 17151 | //Double_t sixReducedEBE = 0.; // <6'> |
17152 | //Double_t eightReducedEBE = 0.; // <8'> | |
489d5531 | 17153 | |
17154 | // event weights for reduced correlations: | |
17155 | Double_t dw2 = 0.; // event weight for <2'> | |
17156 | Double_t dw4 = 0.; // event weight for <4'> | |
17157 | //Double_t dw6 = 0.; // event weight for <6'> | |
17158 | //Double_t dw8 = 0.; // event weight for <8'> | |
17159 | ||
17160 | // looping over bins: | |
17161 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
17162 | { | |
17163 | // e-b-e reduced correlations: | |
17164 | twoReducedEBE = fDiffFlowCorrelationsEBE[t][pe][0]->GetBinContent(b); | |
17165 | fourReducedEBE = fDiffFlowCorrelationsEBE[t][pe][1]->GetBinContent(b); | |
ea239361 | 17166 | //sixReducedEBE = fDiffFlowCorrelationsEBE[t][pe][2]->GetBinContent(b); |
17167 | //eightReducedEBE = fDiffFlowCorrelationsEBE[t][pe][3]->GetBinContent(b); | |
489d5531 | 17168 | |
17169 | /* | |
17170 | // to be improved (I should not do this here again) | |
17171 | if(type == "RP") | |
17172 | { | |
17173 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b); | |
17174 | mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow | |
17175 | } else if(type == "POI") | |
17176 | { | |
17177 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b); | |
17178 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); | |
17179 | } | |
17180 | ||
17181 | // event weights for reduced correlations: | |
17182 | dw2 = mp*dMult-mq; // weight for <2'> | |
17183 | dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
17184 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); // weight for <4'> | |
17185 | //dw6 = ... | |
17186 | //dw8 = ... | |
17187 | ||
17188 | */ | |
17189 | ||
17190 | dw2 = fDiffFlowEventWeightsForCorrelationsEBE[t][pe][0]->GetBinContent(b); | |
17191 | dw4 = fDiffFlowEventWeightsForCorrelationsEBE[t][pe][1]->GetBinContent(b); | |
17192 | ||
17193 | // storing all products: | |
17194 | fDiffFlowProductOfCorrelationsPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*twoReducedEBE,dW2*dw2); // storing <2><2'> | |
17195 | fDiffFlowProductOfCorrelationsPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*twoReducedEBE,dW4*dw2); // storing <4><2'> | |
17196 | fDiffFlowProductOfCorrelationsPro[t][pe][1][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*twoReducedEBE,dW6*dw2); // storing <6><2'> | |
17197 | fDiffFlowProductOfCorrelationsPro[t][pe][1][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*twoReducedEBE,dW8*dw2); // storing <8><2'> | |
17198 | ||
17199 | // event weight for <4'>: | |
17200 | fDiffFlowProductOfCorrelationsPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*fourReducedEBE,dW2*dw4); // storing <2><4'> | |
17201 | fDiffFlowProductOfCorrelationsPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*fourReducedEBE,dw2*dw4); // storing <2'><4'> | |
17202 | fDiffFlowProductOfCorrelationsPro[t][pe][2][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*fourReducedEBE,dW4*dw4); // storing <4><4'> | |
17203 | fDiffFlowProductOfCorrelationsPro[t][pe][3][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*fourReducedEBE,dW6*dw4); // storing <6><4'> | |
17204 | fDiffFlowProductOfCorrelationsPro[t][pe][3][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*fourReducedEBE,dW8*dw4); // storing <8><4'> | |
17205 | ||
17206 | // event weight for <6'>: | |
17207 | //dw6 = ...; | |
17208 | //fDiffFlowProductOfCorrelationsPro[t][pe][0][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*sixReducedEBE,dW2*dw6); // storing <2><6'> | |
17209 | //fDiffFlowProductOfCorrelationsPro[t][pe][1][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*sixReducedEBE,dw2*dw6); // storing <2'><6'> | |
17210 | //fDiffFlowProductOfCorrelationsPro[t][pe][2][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*sixReducedEBE,dW4*dw6); // storing <4><6'> | |
17211 | //fDiffFlowProductOfCorrelationsPro[t][pe][3][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourReducedEBE*sixReducedEBE,dw4*dw6); // storing <4'><6'> | |
17212 | //fDiffFlowProductOfCorrelationsPro[t][pe][4][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*sixReducedEBE,dW6*dw6); // storing <6><6'> | |
17213 | //fDiffFlowProductOfCorrelationsPro[t][pe][5][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightEBE,dw6*dW8); // storing <6'><8> | |
17214 | //fDiffFlowProductOfCorrelationsPro[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightReducedEBE,dw6*dw8); // storing <6'><8'> | |
17215 | ||
17216 | // event weight for <8'>: | |
17217 | //dw8 = ...; | |
17218 | //fDiffFlowProductOfCorrelationsPro[t][pe][0][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*eightReducedEBE,dW2*dw8); // storing <2><8'> | |
17219 | //fDiffFlowProductOfCorrelationsPro[t][pe][1][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*eightReducedEBE,dw2*dw8); // storing <2'><8'> | |
17220 | //fDiffFlowProductOfCorrelationsPro[t][pe][2][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*eightReducedEBE,dW4*dw8); // storing <4><8'> | |
17221 | //fDiffFlowProductOfCorrelationsPro[t][pe][3][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourReducedEBE*eightReducedEBE,dw4*dw8); // storing <4'><8'> | |
17222 | //fDiffFlowProductOfCorrelationsPro[t][pe][4][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*eightReducedEBE,dW6*dw8); // storing <6><8'> | |
17223 | //fDiffFlowProductOfCorrelationsPro[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightReducedEBE,dw6*dw8); // storing <6'><8'> | |
17224 | //fDiffFlowProductOfCorrelationsPro[t][pe][6][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*eightReducedEBE,dW8*dw8); // storing <8><8'> | |
17225 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++ | |
17226 | ||
17227 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowProductOfCorrelations(TString type, TString ptOrEta) | |
17228 | ||
e1d101a6 | 17229 | //======================================================================================================================= |
489d5531 | 17230 | |
489d5531 | 17231 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCovariances(TString type, TString ptOrEta) // to be improved (reimplemented) |
17232 | { | |
17233 | // a) Calculate unbiased estimators Cov(<2>,<2'>), Cov(<2>,<4'>), Cov(<4>,<2'>), Cov(<4>,<4'>) and Cov(<2'>,<4'>) | |
17234 | // for covariances V(<2>,<2'>), V(<2>,<4'>), V(<4>,<2'>), V(<4>,<4'>) and V(<2'>,<4'>). | |
17235 | // b) Store in histogram fDiffFlowCovariances[t][pe][index] for instance the following: | |
17236 | // | |
17237 | // Cov(<2>,<2'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] | |
17238 | // | |
17239 | // where N is the number of events, w_{<2>} is event weight for <2> and w_{<2'>} is event weight for <2'>. | |
17240 | // c) Binning of fDiffFlowCovariances[t][pe][index] is organized as follows: | |
17241 | // | |
17242 | // 1st bin: Cov(<2>,<2'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] | |
17243 | // 2nd bin: Cov(<2>,<4'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] | |
17244 | // 3rd bin: Cov(<4>,<2'>) * (sum_{i=1}^{N} w_{<4>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] | |
17245 | // 4th bin: Cov(<4>,<4'>) * (sum_{i=1}^{N} w_{<4>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] | |
17246 | // 5th bin: Cov(<2'>,<4'>) * (sum_{i=1}^{N} w_{<2'>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<2'>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] | |
17247 | // ... | |
17248 | ||
2a98ceb8 | 17249 | Int_t typeFlag = 0; |
17250 | Int_t ptEtaFlag = 0; | |
489d5531 | 17251 | |
17252 | if(type == "RP") | |
17253 | { | |
17254 | typeFlag = 0; | |
17255 | } else if(type == "POI") | |
17256 | { | |
17257 | typeFlag = 1; | |
17258 | } | |
17259 | ||
17260 | if(ptOrEta == "Pt") | |
17261 | { | |
17262 | ptEtaFlag = 0; | |
17263 | } else if(ptOrEta == "Eta") | |
17264 | { | |
17265 | ptEtaFlag = 1; | |
17266 | } | |
17267 | ||
17268 | // shortcuts: | |
17269 | Int_t t = typeFlag; | |
17270 | Int_t pe = ptEtaFlag; | |
17271 | ||
17272 | // common: | |
17273 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
17274 | //Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
17275 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
17276 | //Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
17277 | ||
17278 | // average correlations: | |
17279 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> | |
17280 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> | |
17281 | //Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> | |
17282 | //Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> | |
17283 | ||
17284 | // sum of weights for correlation: | |
17285 | Double_t sumOfWeightsForTwo = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // sum_{i=1}^{N} w_{<2>} | |
17286 | Double_t sumOfWeightsForFour = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // sum_{i=1}^{N} w_{<4>} | |
17287 | //Double_t sumOfWeightsForSix = fIntFlowSumOfEventWeights[0]->GetBinContent(3); // sum_{i=1}^{N} w_{<6>} | |
17288 | //Double_t sumOfWeightsForEight = fIntFlowSumOfEventWeights[0]->GetBinContent(4); // sum_{i=1}^{N} w_{<8>} | |
17289 | ||
17290 | // average reduced correlations: | |
17291 | Double_t twoReduced = 0.; // <<2'>> | |
17292 | Double_t fourReduced = 0.; // <<4'>> | |
17293 | //Double_t sixReduced = 0.; // <<6'>> | |
17294 | //Double_t eightReduced = 0.; // <<8'>> | |
17295 | ||
17296 | // sum of weights for reduced correlation: | |
17297 | Double_t sumOfWeightsForTwoReduced = 0.; // sum_{i=1}^{N} w_{<2'>} | |
17298 | Double_t sumOfWeightsForFourReduced = 0.; // sum_{i=1}^{N} w_{<4'>} | |
17299 | //Double_t sumOfWeightsForSixReduced = 0.; // sum_{i=1}^{N} w_{<6'>} | |
17300 | //Double_t sumOfWeightsForEightReduced = 0.; // sum_{i=1}^{N} w_{<8'>} | |
17301 | ||
17302 | // product of weights for reduced correlation: | |
17303 | Double_t productOfWeightsForTwoTwoReduced = 0.; // sum_{i=1}^{N} w_{<2>}w_{<2'>} | |
17304 | Double_t productOfWeightsForTwoFourReduced = 0.; // sum_{i=1}^{N} w_{<2>}w_{<4'>} | |
17305 | Double_t productOfWeightsForFourTwoReduced = 0.; // sum_{i=1}^{N} w_{<4>}w_{<2'>} | |
17306 | Double_t productOfWeightsForFourFourReduced = 0.; // sum_{i=1}^{N} w_{<4>}w_{<4'>} | |
17307 | Double_t productOfWeightsForTwoReducedFourReduced = 0.; // sum_{i=1}^{N} w_{<2'>}w_{<4'>} | |
17308 | // ... | |
17309 | ||
17310 | // products for differential flow: | |
17311 | Double_t twoTwoReduced = 0; // <<2><2'>> | |
17312 | Double_t twoFourReduced = 0; // <<2><4'>> | |
17313 | Double_t fourTwoReduced = 0; // <<4><2'>> | |
17314 | Double_t fourFourReduced = 0; // <<4><4'>> | |
17315 | Double_t twoReducedFourReduced = 0; // <<2'><4'>> | |
17316 | ||
17317 | // denominators in the expressions for the unbiased estimators for covariances: | |
17318 | // denominator = 1 - term1/(term2*term3) | |
17319 | // prefactor = term1/(term2*term3) | |
17320 | Double_t denominator = 0.; | |
17321 | Double_t prefactor = 0.; | |
17322 | Double_t term1 = 0.; | |
17323 | Double_t term2 = 0.; | |
17324 | Double_t term3 = 0.; | |
17325 | ||
17326 | // unbiased estimators for covariances for differential flow: | |
17327 | Double_t covTwoTwoReduced = 0.; // Cov(<2>,<2'>) | |
17328 | Double_t wCovTwoTwoReduced = 0.; // Cov(<2>,<2'>) * prefactor(w_{<2>},w_{<2'>}) | |
17329 | Double_t covTwoFourReduced = 0.; // Cov(<2>,<4'>) | |
17330 | Double_t wCovTwoFourReduced = 0.; // Cov(<2>,<4'>) * prefactor(w_{<2>},w_{<4'>}) | |
17331 | Double_t covFourTwoReduced = 0.; // Cov(<4>,<2'>) | |
17332 | Double_t wCovFourTwoReduced = 0.; // Cov(<4>,<2'>) * prefactor(w_{<4>},w_{<2'>}) | |
17333 | Double_t covFourFourReduced = 0.; // Cov(<4>,<4'>) | |
17334 | Double_t wCovFourFourReduced = 0.; // Cov(<4>,<4'>) * prefactor(w_{<4>},w_{<4'>}) | |
17335 | Double_t covTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) | |
17336 | Double_t wCovTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) * prefactor(w_{<2'>},w_{<4'>}) | |
17337 | ||
17338 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
17339 | { | |
17340 | // average reduced corelations: | |
17341 | twoReduced = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); | |
17342 | fourReduced = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); | |
17343 | // average products: | |
17344 | twoTwoReduced = fDiffFlowProductOfCorrelationsPro[t][pe][0][1]->GetBinContent(b); | |
17345 | twoFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][0][3]->GetBinContent(b); | |
17346 | fourTwoReduced = fDiffFlowProductOfCorrelationsPro[t][pe][1][2]->GetBinContent(b); | |
17347 | fourFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][2][3]->GetBinContent(b); | |
17348 | twoReducedFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][1][3]->GetBinContent(b); | |
17349 | // sum of weights for reduced correlations: | |
17350 | sumOfWeightsForTwoReduced = fDiffFlowSumOfEventWeights[t][pe][0][0]->GetBinContent(b); | |
17351 | sumOfWeightsForFourReduced = fDiffFlowSumOfEventWeights[t][pe][0][1]->GetBinContent(b); | |
17352 | // products of weights for correlations: | |
17353 | productOfWeightsForTwoTwoReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][0][1]->GetBinContent(b); | |
17354 | productOfWeightsForTwoFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][0][3]->GetBinContent(b); | |
17355 | productOfWeightsForFourTwoReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][1][2]->GetBinContent(b); | |
17356 | productOfWeightsForFourFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][2][3]->GetBinContent(b); | |
17357 | productOfWeightsForTwoReducedFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][1][3]->GetBinContent(b); | |
17358 | // denominator for the unbiased estimator for covariances: 1 - term1/(term2*term3) | |
17359 | // prefactor (multiplies Cov's) = term1/(term2*term3) | |
17360 | // <2>,<2'>: | |
17361 | term1 = productOfWeightsForTwoTwoReduced; | |
17362 | term2 = sumOfWeightsForTwo; | |
17363 | term3 = sumOfWeightsForTwoReduced; | |
17364 | if(term2*term3>0.) | |
17365 | { | |
17366 | denominator = 1.-term1/(term2*term3); | |
17367 | prefactor = term1/(term2*term3); | |
1268c371 | 17368 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 17369 | { |
17370 | covTwoTwoReduced = (twoTwoReduced-two*twoReduced)/denominator; | |
17371 | wCovTwoTwoReduced = covTwoTwoReduced*prefactor; | |
17372 | fDiffFlowCovariances[t][pe][0]->SetBinContent(b,wCovTwoTwoReduced); | |
17373 | } | |
17374 | } | |
17375 | // <2>,<4'>: | |
17376 | term1 = productOfWeightsForTwoFourReduced; | |
17377 | term2 = sumOfWeightsForTwo; | |
17378 | term3 = sumOfWeightsForFourReduced; | |
17379 | if(term2*term3>0.) | |
17380 | { | |
17381 | denominator = 1.-term1/(term2*term3); | |
17382 | prefactor = term1/(term2*term3); | |
1268c371 | 17383 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 17384 | { |
17385 | covTwoFourReduced = (twoFourReduced-two*fourReduced)/denominator; | |
17386 | wCovTwoFourReduced = covTwoFourReduced*prefactor; | |
17387 | fDiffFlowCovariances[t][pe][1]->SetBinContent(b,wCovTwoFourReduced); | |
17388 | } | |
17389 | } | |
17390 | // <4>,<2'>: | |
17391 | term1 = productOfWeightsForFourTwoReduced; | |
17392 | term2 = sumOfWeightsForFour; | |
17393 | term3 = sumOfWeightsForTwoReduced; | |
17394 | if(term2*term3>0.) | |
17395 | { | |
17396 | denominator = 1.-term1/(term2*term3); | |
17397 | prefactor = term1/(term2*term3); | |
1268c371 | 17398 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 17399 | { |
17400 | covFourTwoReduced = (fourTwoReduced-four*twoReduced)/denominator; | |
17401 | wCovFourTwoReduced = covFourTwoReduced*prefactor; | |
17402 | fDiffFlowCovariances[t][pe][2]->SetBinContent(b,wCovFourTwoReduced); | |
17403 | } | |
17404 | } | |
17405 | // <4>,<4'>: | |
17406 | term1 = productOfWeightsForFourFourReduced; | |
17407 | term2 = sumOfWeightsForFour; | |
17408 | term3 = sumOfWeightsForFourReduced; | |
17409 | if(term2*term3>0.) | |
17410 | { | |
17411 | denominator = 1.-term1/(term2*term3); | |
17412 | prefactor = term1/(term2*term3); | |
1268c371 | 17413 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 17414 | { |
17415 | covFourFourReduced = (fourFourReduced-four*fourReduced)/denominator; | |
17416 | wCovFourFourReduced = covFourFourReduced*prefactor; | |
17417 | fDiffFlowCovariances[t][pe][3]->SetBinContent(b,wCovFourFourReduced); | |
17418 | } | |
17419 | } | |
17420 | // <2'>,<4'>: | |
17421 | term1 = productOfWeightsForTwoReducedFourReduced; | |
17422 | term2 = sumOfWeightsForTwoReduced; | |
17423 | term3 = sumOfWeightsForFourReduced; | |
17424 | if(term2*term3>0.) | |
17425 | { | |
17426 | denominator = 1.-term1/(term2*term3); | |
17427 | prefactor = term1/(term2*term3); | |
1268c371 | 17428 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 17429 | { |
17430 | covTwoReducedFourReduced = (twoReducedFourReduced-twoReduced*fourReduced)/denominator; | |
17431 | wCovTwoReducedFourReduced = covTwoReducedFourReduced*prefactor; | |
17432 | fDiffFlowCovariances[t][pe][4]->SetBinContent(b,wCovTwoReducedFourReduced); | |
17433 | } | |
17434 | } | |
17435 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
17436 | ||
17437 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCovariances(TString type, TString ptOrEta) | |
17438 | ||
e1d101a6 | 17439 | //======================================================================================================================= |
489d5531 | 17440 | |
489d5531 | 17441 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, TString ptOrEta) |
17442 | { | |
1268c371 | 17443 | // Calculate final results for differential flow. |
489d5531 | 17444 | |
1268c371 | 17445 | // REMARK: Differential flow calculated in this method is NOT corrected for non-uniform acceptance. |
17446 | // This correction, if enabled via setter SetApplyCorrectionForNUA(Bool_t), is applied in the method | |
17447 | // CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta) | |
17448 | ||
17449 | Int_t t = 0; // RP or POI | |
17450 | Int_t pe = 0; // pt or eta | |
489d5531 | 17451 | |
17452 | if(type == "RP") | |
17453 | { | |
1268c371 | 17454 | t = 0; |
489d5531 | 17455 | } else if(type == "POI") |
17456 | { | |
1268c371 | 17457 | t = 1; |
489d5531 | 17458 | } |
17459 | ||
17460 | if(ptOrEta == "Pt") | |
17461 | { | |
1268c371 | 17462 | pe = 0; |
489d5531 | 17463 | } else if(ptOrEta == "Eta") |
17464 | { | |
1268c371 | 17465 | pe = 1; |
489d5531 | 17466 | } |
1268c371 | 17467 | |
17468 | // Common: | |
489d5531 | 17469 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
1268c371 | 17470 | // Correlations: |
489d5531 | 17471 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> |
1268c371 | 17472 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> |
17473 | // Statistical errors of correlations: | |
489d5531 | 17474 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); |
17475 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); | |
1268c371 | 17476 | // Reduced correlations: |
489d5531 | 17477 | Double_t twoReduced = 0.; // <<2'>> |
17478 | Double_t fourReduced = 0.; // <<4'>> | |
1268c371 | 17479 | // Statistical errors of reduced correlations: |
489d5531 | 17480 | Double_t twoReducedError = 0.; |
17481 | Double_t fourReducedError = 0.; | |
1268c371 | 17482 | // Covariances: |
8e1cefdd | 17483 | Double_t wCovTwoFour = 0.; // Cov(<2>,<4>) * prefactor(<2>,<4>) |
17484 | if(!fForgetAboutCovariances) | |
17485 | { | |
17486 | wCovTwoFour = fIntFlowCovariances->GetBinContent(1); // Cov(<2>,<4>) * prefactor(<2>,<4>) | |
17487 | } | |
489d5531 | 17488 | Double_t wCovTwoTwoReduced = 0.; // Cov(<2>,<2'>) * prefactor(<2>,<2'>) |
17489 | Double_t wCovTwoFourReduced = 0.; // Cov(<2>,<4'>) * prefactor(<2>,<4'>) | |
17490 | Double_t wCovFourTwoReduced = 0.; // Cov(<4>,<2'>) * prefactor(<4>,<2'>) | |
17491 | Double_t wCovFourFourReduced = 0.; // Cov(<4>,<4'>) * prefactor(<4>,<4'>) | |
17492 | Double_t wCovTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) * prefactor(<2'>,<4'>) | |
1268c371 | 17493 | // Differential flow: |
489d5531 | 17494 | Double_t v2Prime = 0.; // v'{2} |
17495 | Double_t v4Prime = 0.; // v'{4} | |
1268c371 | 17496 | // Statistical error of differential flow: |
489d5531 | 17497 | Double_t v2PrimeError = 0.; |
17498 | Double_t v4PrimeError = 0.; | |
1268c371 | 17499 | // Squared statistical error of differential flow: |
489d5531 | 17500 | Double_t v2PrimeErrorSquared = 0.; |
17501 | Double_t v4PrimeErrorSquared = 0.; | |
1268c371 | 17502 | // Loop over pt or eta bins: |
489d5531 | 17503 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) |
17504 | { | |
1268c371 | 17505 | // Reduced correlations and statistical errors: |
489d5531 | 17506 | twoReduced = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); |
17507 | twoReducedError = fDiffFlowCorrelationsHist[t][pe][0]->GetBinError(b); | |
17508 | fourReduced = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); | |
17509 | fourReducedError = fDiffFlowCorrelationsHist[t][pe][1]->GetBinError(b); | |
1268c371 | 17510 | // Covariances: |
8e1cefdd | 17511 | if(!fForgetAboutCovariances) |
17512 | { | |
17513 | wCovTwoTwoReduced = fDiffFlowCovariances[t][pe][0]->GetBinContent(b); | |
17514 | wCovTwoFourReduced = fDiffFlowCovariances[t][pe][1]->GetBinContent(b); | |
17515 | wCovFourTwoReduced = fDiffFlowCovariances[t][pe][2]->GetBinContent(b); | |
17516 | wCovFourFourReduced = fDiffFlowCovariances[t][pe][3]->GetBinContent(b); | |
17517 | wCovTwoReducedFourReduced = fDiffFlowCovariances[t][pe][4]->GetBinContent(b); | |
17518 | } | |
1268c371 | 17519 | // Differential flow: |
489d5531 | 17520 | // v'{2}: |
17521 | if(two>0.) | |
17522 | { | |
17523 | v2Prime = twoReduced/pow(two,0.5); | |
1268c371 | 17524 | v2PrimeErrorSquared = (1./4.)*pow(two,-3.)*(pow(twoReduced,2.)*pow(twoError,2.) |
17525 | + 4.*pow(two,2.)*pow(twoReducedError,2.) | |
17526 | - 4.*two*twoReduced*wCovTwoTwoReduced); | |
17527 | if(v2PrimeErrorSquared>0.){v2PrimeError = pow(v2PrimeErrorSquared,0.5);} | |
17528 | if(TMath::Abs(v2Prime)>0.) | |
17529 | { | |
17530 | fDiffFlow[t][pe][0]->SetBinContent(b,v2Prime); | |
17531 | fDiffFlow[t][pe][0]->SetBinError(b,v2PrimeError); | |
17532 | } | |
17533 | } // end of if(two>0.) | |
489d5531 | 17534 | // differential flow: |
17535 | // v'{4} | |
17536 | if(2.*pow(two,2.)-four > 0.) | |
17537 | { | |
17538 | v4Prime = (2.*two*twoReduced-fourReduced)/pow(2.*pow(two,2.)-four,3./4.); | |
1268c371 | 17539 | v4PrimeErrorSquared = pow(2.*pow(two,2.)-four,-7./2.) |
17540 | * (pow(2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced,2.)*pow(twoError,2.) | |
17541 | + (9./16.)*pow(2.*two*twoReduced-fourReduced,2.)*pow(fourError,2.) | |
17542 | + 4.*pow(two,2.)*pow(2.*pow(two,2.)-four,2.)*pow(twoReducedError,2.) | |
17543 | + pow(2.*pow(two,2.)-four,2.)*pow(fourReducedError,2.) | |
17544 | - (3./2.)*(2.*two*twoReduced-fourReduced) | |
17545 | * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoFour | |
17546 | - 4.*two*(2.*pow(two,2.)-four) | |
17547 | * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoTwoReduced | |
17548 | + 2.*(2.*pow(two,2.)-four) | |
17549 | * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoFourReduced | |
17550 | + 3.*two*(2.*pow(two,2.)-four)*(2.*two*twoReduced-fourReduced)*wCovFourTwoReduced | |
17551 | - (3./2.)*(2.*pow(two,2.)-four)*(2.*two*twoReduced-fourReduced)*wCovFourFourReduced | |
17552 | - 4.*two*pow(2.*pow(two,2.)-four,2.)*wCovTwoReducedFourReduced); | |
17553 | if(v4PrimeErrorSquared>0.){v4PrimeError = pow(v4PrimeErrorSquared,0.5);} | |
17554 | if(TMath::Abs(v4Prime)>0.) | |
17555 | { | |
17556 | fDiffFlow[t][pe][1]->SetBinContent(b,v4Prime); | |
17557 | fDiffFlow[t][pe][1]->SetBinError(b,v4PrimeError); | |
17558 | } | |
17559 | } // end of if(2.*pow(two,2.)-four > 0.) | |
489d5531 | 17560 | } // end of for(Int_t b=1;b<=fnBinsPtEta[pe];b++) |
1268c371 | 17561 | |
17562 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, Bool_t useParticleWeights) | |
17563 | ||
e1d101a6 | 17564 | //======================================================================================================================= |
1268c371 | 17565 | |
17566 | void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlow(TString type) | |
17567 | { | |
17568 | // Calculate final results for 2D diferential flow. | |
17569 | ||
17570 | // to be improved - check pointers used in this method | |
17571 | ||
17572 | Int_t t = 0; // RP or POI | |
17573 | ||
17574 | if(type == "RP") | |
17575 | { | |
17576 | t = 0; | |
17577 | } else if(type == "POI") | |
17578 | { | |
17579 | t = 1; | |
17580 | } | |
489d5531 | 17581 | |
1268c371 | 17582 | // Differential flow: |
17583 | Double_t v2Prime = 0.; // v'{2} | |
17584 | Double_t v4Prime = 0.; // v'{4} | |
17585 | // Differential cumulants: | |
17586 | Double_t qc2Prime = 0.; // QC{2'} | |
17587 | Double_t qc4Prime = 0.; // QC{4'} | |
17588 | // Looping over all (pt,eta) bins and calculating differential flow: | |
17589 | for(Int_t p=1;p<=fnBinsPt;p++) | |
489d5531 | 17590 | { |
1268c371 | 17591 | for(Int_t e=1;e<=fnBinsEta;e++) |
489d5531 | 17592 | { |
1268c371 | 17593 | // QC{2'}: |
17594 | qc2Prime = f2DDiffFlowCumulants[t][0]->GetBinContent(f2DDiffFlowCumulants[t][0]->GetBin(p,e)); | |
17595 | if(qc2Prime>=0.) | |
17596 | { | |
17597 | v2Prime = pow(qc2Prime,0.5); | |
17598 | f2DDiffFlow[t][0]->SetBinContent(f2DDiffFlow[t][0]->GetBin(p,e),v2Prime); | |
17599 | } | |
17600 | // QC{4'}: | |
17601 | qc4Prime = f2DDiffFlowCumulants[t][1]->GetBinContent(f2DDiffFlowCumulants[t][1]->GetBin(p,e)); | |
17602 | if(qc4Prime<=0.) | |
17603 | { | |
17604 | v4Prime = pow(-1.*qc4Prime,1./4.); | |
17605 | f2DDiffFlow[t][1]->SetBinContent(f2DDiffFlow[t][1]->GetBin(p,e),v4Prime); | |
17606 | } | |
17607 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
17608 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
17609 | ||
17610 | } // end of void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlow(TString type) | |
489d5531 | 17611 | |
e1d101a6 | 17612 | //======================================================================================================================= |
489d5531 | 17613 | |
489d5531 | 17614 | void AliFlowAnalysisWithQCumulants::StoreIntFlowFlags() |
17615 | { | |
17616 | // a) Store all flags for integrated flow in profile fIntFlowFlags. | |
17617 | ||
17618 | if(!fIntFlowFlags) | |
17619 | { | |
17620 | cout<<"WARNING: fIntFlowFlags is NULL in AFAWQC::SFFIF() !!!!"<<endl; | |
17621 | exit(0); | |
17622 | } | |
17623 | ||
17624 | // particle weights used or not: | |
403e3389 | 17625 | fIntFlowFlags->Fill(0.5,(Int_t)fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights); |
489d5531 | 17626 | // which event weights were used: |
df23c5ae | 17627 | if(fMultiplicityWeight->Contains("combinations")) |
489d5531 | 17628 | { |
17629 | fIntFlowFlags->Fill(1.5,0); // 0 = "combinations" (default) | |
df23c5ae | 17630 | } else if(fMultiplicityWeight->Contains("unit")) |
489d5531 | 17631 | { |
17632 | fIntFlowFlags->Fill(1.5,1); // 1 = "unit" | |
df23c5ae | 17633 | } else if(fMultiplicityWeight->Contains("multiplicity")) |
489d5531 | 17634 | { |
17635 | fIntFlowFlags->Fill(1.5,2); // 2 = "multiplicity" | |
17636 | } | |
489d5531 | 17637 | fIntFlowFlags->Fill(2.5,(Int_t)fApplyCorrectionForNUA); |
17638 | fIntFlowFlags->Fill(3.5,(Int_t)fPrintFinalResults[0]); | |
17639 | fIntFlowFlags->Fill(4.5,(Int_t)fPrintFinalResults[1]); | |
17640 | fIntFlowFlags->Fill(5.5,(Int_t)fPrintFinalResults[2]); | |
b3dacf6b | 17641 | fIntFlowFlags->Fill(6.5,(Int_t)fPrintFinalResults[3]); |
17642 | fIntFlowFlags->Fill(7.5,(Int_t)fApplyCorrectionForNUAVsM); | |
b77b6434 | 17643 | fIntFlowFlags->Fill(8.5,(Int_t)fPropagateErrorAlsoFromNIT); |
b3dacf6b | 17644 | fIntFlowFlags->Fill(9.5,(Int_t)fCalculateCumulantsVsM); |
0dd3b008 | 17645 | fIntFlowFlags->Fill(10.5,(Int_t)fMinimumBiasReferenceFlow); |
8e1cefdd | 17646 | fIntFlowFlags->Fill(11.5,(Int_t)fForgetAboutCovariances); |
e5834fcb | 17647 | fIntFlowFlags->Fill(12.5,(Int_t)fStorePhiDistributionForOneEvent); |
dd442cd2 | 17648 | fIntFlowFlags->Fill(13.5,(Int_t)fFillMultipleControlHistograms); |
3435cacb | 17649 | fIntFlowFlags->Fill(14.5,(Int_t)fCalculateAllCorrelationsVsM); |
df23c5ae | 17650 | // which multiplicity was used: |
17651 | if(fMultiplicityIs==AliFlowCommonConstants::kRP) // # of Reference Particles | |
17652 | { | |
17653 | fIntFlowFlags->Fill(15.5,0); // 0 = # of Reference Particles | |
17654 | } else if(fMultiplicityIs==AliFlowCommonConstants::kExternal) | |
17655 | { | |
17656 | fIntFlowFlags->Fill(15.5,1); // 1 = ref. mult. from ESD | |
17657 | } else if(fMultiplicityIs==AliFlowCommonConstants::kPOI) | |
17658 | { | |
17659 | fIntFlowFlags->Fill(15.5,2); // 2 = # of Particles of Interest | |
17660 | } | |
d9e6d8bb | 17661 | fIntFlowFlags->Fill(16.5,(Int_t)fExactNoRPs); |
1db7eced | 17662 | fIntFlowFlags->Fill(17.5,(Int_t)fUse2DHistograms); |
17663 | fIntFlowFlags->Fill(18.5,(Int_t)fFillProfilesVsMUsingWeights); | |
17664 | fIntFlowFlags->Fill(19.5,(Int_t)fUseQvectorTerms); | |
df23c5ae | 17665 | |
489d5531 | 17666 | } // end of void AliFlowAnalysisWithQCumulants::StoreIntFlowFlags() |
17667 | ||
e1d101a6 | 17668 | //======================================================================================================================= |
489d5531 | 17669 | |
489d5531 | 17670 | void AliFlowAnalysisWithQCumulants::StoreDiffFlowFlags() |
17671 | { | |
17672 | // Store all flags for differential flow in the profile fDiffFlowFlags. | |
17673 | ||
17674 | if(!fDiffFlowFlags) | |
17675 | { | |
1268c371 | 17676 | printf("\n WARNING (QC): fDiffFlowFlags is NULL in AFAWQC::SDFF() !!!!\n\n"); |
489d5531 | 17677 | exit(0); |
17678 | } | |
17679 | ||
1268c371 | 17680 | fDiffFlowFlags->Fill(0.5,fCalculateDiffFlow); // calculate differential flow |
403e3389 | 17681 | fDiffFlowFlags->Fill(1.5,fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights); // particle weights used or not? |
1268c371 | 17682 | //fDiffFlowFlags->Fill(2.5,""); // which event weight was used? ("combinations", "unit" or "multiplicity") to be improved - finalized |
17683 | fDiffFlowFlags->Fill(3.5,fApplyCorrectionForNUA); // corrected for non-uniform acceptance or not | |
17684 | fDiffFlowFlags->Fill(4.5,fCalculate2DDiffFlow); // calculate also 2D differential flow vs (pt,eta) | |
62e36168 | 17685 | fDiffFlowFlags->Fill(5.5,fCalculateDiffFlowVsEta); // if you set kFALSE only differential flow vs pt is calculated |
1268c371 | 17686 | |
489d5531 | 17687 | } // end of void AliFlowAnalysisWithQCumulants::StoreDiffFlowFlags() |
17688 | ||
e1d101a6 | 17689 | //======================================================================================================================= |
17690 | ||
17691 | void AliFlowAnalysisWithQCumulants::StoreMixedHarmonicsFlags() | |
17692 | { | |
17693 | // Store all flags for mixed harmonics in profile fMixedHarmonicsFlags. | |
17694 | ||
17695 | if(!fMixedHarmonicsFlags) | |
17696 | { | |
17697 | cout<<"WARNING: fMixedHarmonicsFlags is NULL in AFAWQC::SMHF() !!!!"<<endl; | |
17698 | exit(0); | |
17699 | } | |
17700 | ||
17701 | fMixedHarmonicsFlags->Fill(0.5,(Int_t)fCalculateMixedHarmonics); | |
17702 | fMixedHarmonicsFlags->Fill(1.5,(Int_t)fHarmonic); | |
17703 | fMixedHarmonicsFlags->Fill(2.5,(Int_t)fCalculateMixedHarmonicsVsM); | |
17704 | // Which multiplicity weight was used?: | |
17705 | ||
df23c5ae | 17706 | if(fMultiplicityWeight->Contains("combinations")) |
e1d101a6 | 17707 | { |
17708 | fMixedHarmonicsFlags->Fill(3.5,0); // 0 = "combinations" (default) | |
df23c5ae | 17709 | } else if(fMultiplicityWeight->Contains("unit")) |
e1d101a6 | 17710 | { |
17711 | fMixedHarmonicsFlags->Fill(3.5,1); // 1 = "unit" | |
df23c5ae | 17712 | } else if(fMultiplicityWeight->Contains("multiplicity")) |
e1d101a6 | 17713 | { |
17714 | fMixedHarmonicsFlags->Fill(3.5,2); // 2 = "multiplicity" | |
17715 | } | |
17716 | ||
17717 | } // end of void AliFlowAnalysisWithQCumulants::StoreMixedHarmonicsFlags() | |
17718 | ||
17719 | //======================================================================================================================= | |
489d5531 | 17720 | |
1db7eced | 17721 | void AliFlowAnalysisWithQCumulants::StoreControlHistogramsFlags() |
17722 | { | |
17723 | // Store all flags for control histograms in profile fControlHistogramsFlags. | |
17724 | ||
17725 | if(!fControlHistogramsFlags) | |
17726 | { | |
17727 | cout<<"WARNING: fControlHistogramsFlags is NULL in AFAWQC::SCHF() !!!!"<<endl; | |
17728 | exit(0); | |
17729 | } | |
17730 | ||
17731 | fControlHistogramsFlags->Fill(0.5,(Int_t)fStoreControlHistograms); | |
17732 | fControlHistogramsFlags->Fill(1.5,(Int_t)fUseQvectorTerms); | |
17733 | ||
17734 | } // end of void AliFlowAnalysisWithQCumulants::StoreControlHistogramsFlags() | |
17735 | ||
17736 | //======================================================================================================================= | |
17737 | ||
489d5531 | 17738 | void AliFlowAnalysisWithQCumulants::GetPointersForCommonHistograms() |
17739 | { | |
17740 | // Access all pointers to common control and common result histograms and profiles. | |
17741 | ||
1268c371 | 17742 | TString sCommonConstantsName = "fCommonConstants"; |
17743 | sCommonConstantsName += fAnalysisLabel->Data(); | |
17744 | fCommonConstants = dynamic_cast<TProfile*>(fHistList->FindObject(sCommonConstantsName.Data())); | |
17745 | if(!fCommonConstants) | |
17746 | { | |
17747 | printf("\n WARNING (QC): fCommonConstants is NULL in AFAWQC::GPFCH() !!!!\n\n"); | |
17748 | exit(0); | |
17749 | } | |
17750 | ||
17751 | // to be improved - lines bellow can be implemented better. | |
17752 | ||
489d5531 | 17753 | TString commonHistsName = "AliFlowCommonHistQC"; |
17754 | commonHistsName += fAnalysisLabel->Data(); | |
17755 | AliFlowCommonHist *commonHist = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHistsName.Data())); | |
b77b6434 | 17756 | if(commonHist) |
17757 | { | |
17758 | this->SetCommonHists(commonHist); | |
17759 | if(fCommonHists->GetHarmonic()) | |
17760 | { | |
17761 | fHarmonic = (Int_t)(fCommonHists->GetHarmonic())->GetBinContent(1); | |
17762 | } | |
17763 | } // end of if(commonHist) | |
489d5531 | 17764 | TString commonHists2ndOrderName = "AliFlowCommonHist2ndOrderQC"; |
17765 | commonHists2ndOrderName += fAnalysisLabel->Data(); | |
17766 | AliFlowCommonHist *commonHist2nd = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists2ndOrderName.Data())); | |
17767 | if(commonHist2nd) this->SetCommonHists2nd(commonHist2nd); | |
17768 | TString commonHists4thOrderName = "AliFlowCommonHist4thOrderQC"; | |
17769 | commonHists4thOrderName += fAnalysisLabel->Data(); | |
17770 | AliFlowCommonHist *commonHist4th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists4thOrderName.Data())); | |
17771 | if(commonHist4th) this->SetCommonHists4th(commonHist4th); | |
17772 | TString commonHists6thOrderName = "AliFlowCommonHist6thOrderQC"; | |
17773 | commonHists6thOrderName += fAnalysisLabel->Data(); | |
17774 | AliFlowCommonHist *commonHist6th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists6thOrderName.Data())); | |
17775 | if(commonHist6th) this->SetCommonHists6th(commonHist6th); | |
17776 | TString commonHists8thOrderName = "AliFlowCommonHist8thOrderQC"; | |
17777 | commonHists8thOrderName += fAnalysisLabel->Data(); | |
17778 | AliFlowCommonHist *commonHist8th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists8thOrderName.Data())); | |
dd442cd2 | 17779 | if(commonHist8th) this->SetCommonHists8th(commonHist8th); |
17780 | ||
489d5531 | 17781 | TString commonHistResults2ndOrderName = "AliFlowCommonHistResults2ndOrderQC"; |
17782 | commonHistResults2ndOrderName += fAnalysisLabel->Data(); | |
b77b6434 | 17783 | AliFlowCommonHistResults *commonHistRes2nd = dynamic_cast<AliFlowCommonHistResults*> |
17784 | (fHistList->FindObject(commonHistResults2ndOrderName.Data())); | |
489d5531 | 17785 | if(commonHistRes2nd) this->SetCommonHistsResults2nd(commonHistRes2nd); |
17786 | TString commonHistResults4thOrderName = "AliFlowCommonHistResults4thOrderQC"; | |
17787 | commonHistResults4thOrderName += fAnalysisLabel->Data(); | |
17788 | AliFlowCommonHistResults *commonHistRes4th = dynamic_cast<AliFlowCommonHistResults*> | |
17789 | (fHistList->FindObject(commonHistResults4thOrderName.Data())); | |
17790 | if(commonHistRes4th) this->SetCommonHistsResults4th(commonHistRes4th); | |
17791 | TString commonHistResults6thOrderName = "AliFlowCommonHistResults6thOrderQC"; | |
17792 | commonHistResults6thOrderName += fAnalysisLabel->Data(); | |
17793 | AliFlowCommonHistResults *commonHistRes6th = dynamic_cast<AliFlowCommonHistResults*> | |
17794 | (fHistList->FindObject(commonHistResults6thOrderName.Data())); | |
17795 | if(commonHistRes6th) this->SetCommonHistsResults6th(commonHistRes6th); | |
17796 | TString commonHistResults8thOrderName = "AliFlowCommonHistResults8thOrderQC"; | |
17797 | commonHistResults8thOrderName += fAnalysisLabel->Data(); | |
17798 | AliFlowCommonHistResults *commonHistRes8th = dynamic_cast<AliFlowCommonHistResults*> | |
17799 | (fHistList->FindObject(commonHistResults8thOrderName.Data())); | |
17800 | if(commonHistRes8th) this->SetCommonHistsResults8th(commonHistRes8th); | |
17801 | ||
17802 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForCommonHistograms() | |
17803 | ||
e1d101a6 | 17804 | //======================================================================================================================= |
489d5531 | 17805 | |
489d5531 | 17806 | void AliFlowAnalysisWithQCumulants::GetPointersForParticleWeightsHistograms() |
17807 | { | |
17808 | // Get pointers for histograms with particle weights. | |
17809 | ||
17810 | TList *weightsList = dynamic_cast<TList*>(fHistList->FindObject("Weights")); | |
ca5f47e7 | 17811 | if(!weightsList){printf("\n WARNING (QC): weightsList is NULL in AFAWQC::GPFPWH() !!!!\n");exit(0);} |
17812 | this->SetWeightsList(weightsList); | |
489d5531 | 17813 | TString fUseParticleWeightsName = "fUseParticleWeightsQC"; // to be improved (hirdwired label QC) |
17814 | fUseParticleWeightsName += fAnalysisLabel->Data(); | |
17815 | TProfile *useParticleWeights = dynamic_cast<TProfile*>(weightsList->FindObject(fUseParticleWeightsName.Data())); | |
17816 | if(useParticleWeights) | |
17817 | { | |
17818 | this->SetUseParticleWeights(useParticleWeights); | |
17819 | fUsePhiWeights = (Int_t)fUseParticleWeights->GetBinContent(1); | |
17820 | fUsePtWeights = (Int_t)fUseParticleWeights->GetBinContent(2); | |
17821 | fUseEtaWeights = (Int_t)fUseParticleWeights->GetBinContent(3); | |
403e3389 | 17822 | fUseTrackWeights = (Int_t)fUseParticleWeights->GetBinContent(4); |
489d5531 | 17823 | } |
17824 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForParticleWeightsHistograms(); | |
17825 | ||
e1d101a6 | 17826 | //======================================================================================================================= |
489d5531 | 17827 | |
489d5531 | 17828 | void AliFlowAnalysisWithQCumulants::GetPointersForIntFlowHistograms() |
17829 | { | |
17830 | // Get pointers for histograms and profiles relevant for integrated flow: | |
17831 | // a) Get pointer to base list for integrated flow holding profile fIntFlowFlags and lists fIntFlowProfiles and fIntFlowResults. | |
17832 | // b) Get pointer to profile fIntFlowFlags holding all flags for integrated flow. | |
17833 | // c) Get pointer to list fIntFlowProfiles and pointers to all objects that she holds. | |
17834 | // d) Get pointer to list fIntFlowResults and pointers to all objects that she holds. | |
17835 | ||
17836 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data member?) | |
17837 | TString powerFlag[2] = {"linear","quadratic"}; // to be improved (should I promote this to data member?) | |
b40a910e | 17838 | TString correlationFlag[4] = {"#LT#LT2#GT#GT","#LT#LT4#GT#GT","#LT#LT6#GT#GT","#LT#LT8#GT#GT"}; // to be improved (should I promote this to data member?) |
17839 | TString squaredCorrelationFlag[4] = {"#LT#LT2#GT^{2}#GT","#LT#LT4#GT^{2}#GT","#LT#LT6#GT^{2}#GT","#LT#LT8#GT^{2}#GT"}; // to be improved (should I promote this to data member?) | |
489d5531 | 17840 | |
17841 | // a) Get pointer to base list for integrated flow holding profile fIntFlowFlags and lists fIntFlowProfiles and fIntFlowResults: | |
17842 | TList *intFlowList = NULL; | |
17843 | intFlowList = dynamic_cast<TList*>(fHistList->FindObject("Integrated Flow")); | |
17844 | if(!intFlowList) | |
17845 | { | |
17846 | cout<<"WARNING: intFlowList is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
17847 | exit(0); | |
17848 | } | |
17849 | ||
b92ea2b9 | 17850 | // b) Get pointer to profile fIntFlowFlags holding all flags for integrated flow: |
17851 | TString intFlowFlagsName = "fIntFlowFlags"; | |
17852 | intFlowFlagsName += fAnalysisLabel->Data(); | |
17853 | TProfile *intFlowFlags = dynamic_cast<TProfile*>(intFlowList->FindObject(intFlowFlagsName.Data())); | |
17854 | if(intFlowFlags) | |
17855 | { | |
17856 | this->SetIntFlowFlags(intFlowFlags); | |
17857 | fApplyCorrectionForNUA = (Bool_t)intFlowFlags->GetBinContent(3); | |
17858 | fApplyCorrectionForNUAVsM = (Bool_t)intFlowFlags->GetBinContent(8); | |
17859 | fCalculateCumulantsVsM = (Bool_t)intFlowFlags->GetBinContent(10); | |
17860 | } else | |
17861 | { | |
17862 | cout<<"WARNING: intFlowFlags is NULL in FAWQC::GPFIFH() !!!!"<<endl; | |
17863 | } | |
489d5531 | 17864 | |
17865 | // c) Get pointer to list fIntFlowProfiles and pointers to all objects that she holds: | |
17866 | TList *intFlowProfiles = NULL; | |
17867 | intFlowProfiles = dynamic_cast<TList*>(intFlowList->FindObject("Profiles")); | |
17868 | if(intFlowProfiles) | |
17869 | { | |
17870 | // average multiplicities: | |
17871 | TString avMultiplicityName = "fAvMultiplicity"; | |
17872 | avMultiplicityName += fAnalysisLabel->Data(); | |
17873 | TProfile *avMultiplicity = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(avMultiplicityName.Data())); | |
17874 | if(avMultiplicity) | |
17875 | { | |
17876 | this->SetAvMultiplicity(avMultiplicity); | |
17877 | } else | |
17878 | { | |
17879 | cout<<"WARNING: avMultiplicity is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
17880 | } | |
17881 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with wrong errors!): | |
17882 | TString intFlowCorrelationsProName = "fIntFlowCorrelationsPro"; | |
17883 | intFlowCorrelationsProName += fAnalysisLabel->Data(); | |
17884 | TProfile *intFlowCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowCorrelationsProName.Data())); | |
17885 | if(intFlowCorrelationsPro) | |
17886 | { | |
17887 | this->SetIntFlowCorrelationsPro(intFlowCorrelationsPro); | |
17888 | } else | |
17889 | { | |
17890 | cout<<"WARNING: intFlowCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
ff70ca91 | 17891 | } |
b40a910e | 17892 | // average squared correlations <<2>^2>, <<4>^2>, <<6>^2> and <<8^2>>: |
17893 | TString intFlowSquaredCorrelationsProName = "fIntFlowSquaredCorrelationsPro"; | |
17894 | intFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
17895 | TProfile *intFlowSquaredCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowSquaredCorrelationsProName.Data())); | |
17896 | if(intFlowSquaredCorrelationsPro) | |
17897 | { | |
17898 | this->SetIntFlowSquaredCorrelationsPro(intFlowSquaredCorrelationsPro); | |
17899 | } else | |
17900 | { | |
17901 | cout<<"WARNING: intFlowSquaredCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
17902 | } | |
b3dacf6b | 17903 | if(fCalculateCumulantsVsM) |
ff70ca91 | 17904 | { |
b40a910e | 17905 | // Average correlations <<2>>, <<4>>, <<6>> and <<8>> versus multiplicity for all events (error is wrong here): |
b3dacf6b | 17906 | TString intFlowCorrelationsVsMProName = "fIntFlowCorrelationsVsMPro"; |
17907 | intFlowCorrelationsVsMProName += fAnalysisLabel->Data(); | |
17908 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
ff70ca91 | 17909 | { |
b3dacf6b | 17910 | TProfile *intFlowCorrelationsVsMPro = dynamic_cast<TProfile*> |
17911 | (intFlowProfiles->FindObject(Form("%s, %s",intFlowCorrelationsVsMProName.Data(),correlationFlag[ci].Data()))); | |
17912 | if(intFlowCorrelationsVsMPro) | |
17913 | { | |
17914 | this->SetIntFlowCorrelationsVsMPro(intFlowCorrelationsVsMPro,ci); | |
17915 | } else | |
17916 | { | |
17917 | cout<<"WARNING: "<<Form("intFlowCorrelationsVsMPro[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
17918 | } | |
17919 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
b40a910e | 17920 | // Average squared correlations <<2>^2>, <<4>^2>, <<6>^2> and <<8>^2> versus multiplicity for all events: |
17921 | TString intFlowSquaredCorrelationsVsMProName = "fIntFlowSquaredCorrelationsVsMPro"; | |
17922 | intFlowSquaredCorrelationsVsMProName += fAnalysisLabel->Data(); | |
17923 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
17924 | { | |
17925 | TProfile *intFlowSquaredCorrelationsVsMPro = dynamic_cast<TProfile*> | |
17926 | (intFlowProfiles->FindObject(Form("%s, %s",intFlowSquaredCorrelationsVsMProName.Data(),squaredCorrelationFlag[ci].Data()))); | |
17927 | if(intFlowSquaredCorrelationsVsMPro) | |
17928 | { | |
17929 | this->SetIntFlowSquaredCorrelationsVsMPro(intFlowSquaredCorrelationsVsMPro,ci); | |
17930 | } else | |
17931 | { | |
17932 | cout<<"WARNING: "<<Form("intFlowSquaredCorrelationsVsMPro[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
17933 | } | |
17934 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
b3dacf6b | 17935 | } // end of if(fCalculateCumulantsVsM) |
489d5531 | 17936 | // average all correlations for integrated flow (with wrong errors!): |
17937 | TString intFlowCorrelationsAllProName = "fIntFlowCorrelationsAllPro"; | |
17938 | intFlowCorrelationsAllProName += fAnalysisLabel->Data(); | |
17939 | TProfile *intFlowCorrelationsAllPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowCorrelationsAllProName.Data())); | |
17940 | if(intFlowCorrelationsAllPro) | |
17941 | { | |
17942 | this->SetIntFlowCorrelationsAllPro(intFlowCorrelationsAllPro); | |
17943 | } else | |
17944 | { | |
17945 | cout<<"WARNING: intFlowCorrelationsAllPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
17946 | } | |
17947 | // average extra correlations for integrated flow (which appear only when particle weights are used): | |
17948 | // (to be improved: Weak point in implementation, I am assuming here that method GetPointersForParticleWeightsHistograms() was called) | |
403e3389 | 17949 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 17950 | { |
17951 | TString intFlowExtraCorrelationsProName = "fIntFlowExtraCorrelationsPro"; | |
17952 | intFlowExtraCorrelationsProName += fAnalysisLabel->Data(); | |
17953 | TProfile *intFlowExtraCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowExtraCorrelationsProName.Data())); | |
17954 | if(intFlowExtraCorrelationsPro) | |
17955 | { | |
17956 | this->SetIntFlowExtraCorrelationsPro(intFlowExtraCorrelationsPro); | |
17957 | } else | |
17958 | { | |
17959 | cout<<"WARNING: intFlowExtraCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
17960 | } | |
403e3389 | 17961 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 17962 | // average products of correlations <2>, <4>, <6> and <8>: |
17963 | TString intFlowProductOfCorrelationsProName = "fIntFlowProductOfCorrelationsPro"; | |
17964 | intFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
17965 | TProfile *intFlowProductOfCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowProductOfCorrelationsProName.Data())); | |
17966 | if(intFlowProductOfCorrelationsPro) | |
17967 | { | |
17968 | this->SetIntFlowProductOfCorrelationsPro(intFlowProductOfCorrelationsPro); | |
17969 | } else | |
17970 | { | |
17971 | cout<<"WARNING: intFlowProductOfCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
ff70ca91 | 17972 | } |
17973 | // average product of correlations <2>, <4>, <6> and <8> versus multiplicity | |
17974 | // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>] | |
b3dacf6b | 17975 | if(fCalculateCumulantsVsM) |
17976 | { | |
17977 | TString intFlowProductOfCorrelationsVsMProName = "fIntFlowProductOfCorrelationsVsMPro"; | |
17978 | intFlowProductOfCorrelationsVsMProName += fAnalysisLabel->Data(); | |
403e3389 | 17979 | TString productFlag[6] = {"#LT#LT2#GT#LT4#GT#GT","#LT#LT2#GT#LT6#GT#GT","#LT#LT2#GT#LT8#GT#GT", |
17980 | "#LT#LT4#GT#LT6#GT#GT","#LT#LT4#GT#LT8#GT#GT","#LT#LT6#GT#LT8#GT#GT"}; | |
b3dacf6b | 17981 | for(Int_t pi=0;pi<6;pi++) |
17982 | { | |
17983 | TProfile *intFlowProductOfCorrelationsVsMPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(Form("%s, %s",intFlowProductOfCorrelationsVsMProName.Data(),productFlag[pi].Data()))); | |
17984 | if(intFlowProductOfCorrelationsVsMPro) | |
17985 | { | |
17986 | this->SetIntFlowProductOfCorrelationsVsMPro(intFlowProductOfCorrelationsVsMPro,pi); | |
17987 | } else | |
17988 | { | |
17989 | cout<<"WARNING: "<<Form("intFlowProductOfCorrelationsVsMPro[%d]",pi)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
17990 | } | |
17991 | } // end of for(Int_t pi=0;pi<6;pi++) | |
17992 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 17993 | // average correction terms for non-uniform acceptance (with wrong errors!): |
17994 | for(Int_t sc=0;sc<2;sc++) | |
17995 | { | |
17996 | TString intFlowCorrectionTermsForNUAProName = "fIntFlowCorrectionTermsForNUAPro"; | |
17997 | intFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
17998 | TProfile *intFlowCorrectionTermsForNUAPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject((Form("%s: %s terms",intFlowCorrectionTermsForNUAProName.Data(),sinCosFlag[sc].Data())))); | |
17999 | if(intFlowCorrectionTermsForNUAPro) | |
18000 | { | |
18001 | this->SetIntFlowCorrectionTermsForNUAPro(intFlowCorrectionTermsForNUAPro,sc); | |
18002 | } else | |
18003 | { | |
18004 | cout<<"WARNING: intFlowCorrectionTermsForNUAPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18005 | cout<<"sc = "<<sc<<endl; | |
18006 | } | |
2001bc3a | 18007 | // versus multiplicity: |
b3dacf6b | 18008 | if(fCalculateCumulantsVsM) |
2001bc3a | 18009 | { |
b3dacf6b | 18010 | TString correctionTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4 |
18011 | TString intFlowCorrectionTermsForNUAVsMProName = "fIntFlowCorrectionTermsForNUAVsMPro"; | |
18012 | intFlowCorrectionTermsForNUAVsMProName += fAnalysisLabel->Data(); | |
18013 | for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) | |
2001bc3a | 18014 | { |
b3dacf6b | 18015 | TProfile *intFlowCorrectionTermsForNUAVsMPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(Form("%s: #LT#LT%s%s#GT#GT",intFlowCorrectionTermsForNUAVsMProName.Data(),sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()))); |
18016 | if(intFlowCorrectionTermsForNUAVsMPro) | |
18017 | { | |
18018 | this->SetIntFlowCorrectionTermsForNUAVsMPro(intFlowCorrectionTermsForNUAVsMPro,sc,ci); | |
18019 | } else | |
18020 | { | |
18021 | cout<<"WARNING: intFlowCorrectionTermsForNUAVsMPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18022 | cout<<"sc = "<<sc<<endl; | |
18023 | cout<<"ci = "<<ci<<endl; | |
18024 | } | |
18025 | } // end of for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) | |
18026 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 18027 | } // end of for(Int_t sc=0;sc<2;sc++) |
0328db2d | 18028 | // average products of correction terms for NUA: |
18029 | TString intFlowProductOfCorrectionTermsForNUAProName = "fIntFlowProductOfCorrectionTermsForNUAPro"; | |
18030 | intFlowProductOfCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
18031 | TProfile *intFlowProductOfCorrectionTermsForNUAPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowProductOfCorrectionTermsForNUAProName.Data())); | |
18032 | if(intFlowProductOfCorrectionTermsForNUAPro) | |
18033 | { | |
18034 | this->SetIntFlowProductOfCorrectionTermsForNUAPro(intFlowProductOfCorrectionTermsForNUAPro); | |
18035 | } else | |
18036 | { | |
18037 | cout<<"WARNING: intFlowProductOfCorrectionTermsForNUAPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18038 | } | |
489d5531 | 18039 | } else // to if(intFlowProfiles) |
18040 | { | |
18041 | cout<<"WARNING: intFlowProfiles is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18042 | } | |
18043 | ||
18044 | // d) Get pointer to list fIntFlowResults and pointers to all objects that she holds. | |
18045 | TList *intFlowResults = NULL; | |
18046 | intFlowResults = dynamic_cast<TList*>(intFlowList->FindObject("Results")); | |
18047 | if(intFlowResults) | |
18048 | { | |
18049 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with correct errors!): | |
18050 | TString intFlowCorrelationsHistName = "fIntFlowCorrelationsHist"; | |
18051 | intFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
18052 | TH1D *intFlowCorrelationsHist = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCorrelationsHistName.Data())); | |
18053 | if(intFlowCorrelationsHist) | |
18054 | { | |
18055 | this->SetIntFlowCorrelationsHist(intFlowCorrelationsHist); | |
18056 | } else | |
18057 | { | |
18058 | cout<<"WARNING: intFlowCorrelationsHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18059 | } | |
ff70ca91 | 18060 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with correct errors!) vs M: |
b3dacf6b | 18061 | if(fCalculateCumulantsVsM) |
ff70ca91 | 18062 | { |
b3dacf6b | 18063 | TString intFlowCorrelationsVsMHistName = "fIntFlowCorrelationsVsMHist"; |
18064 | intFlowCorrelationsVsMHistName += fAnalysisLabel->Data(); | |
18065 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
ff70ca91 | 18066 | { |
b3dacf6b | 18067 | TH1D *intFlowCorrelationsVsMHist = dynamic_cast<TH1D*> |
18068 | (intFlowResults->FindObject(Form("%s, %s",intFlowCorrelationsVsMHistName.Data(),correlationFlag[ci].Data()))); | |
18069 | if(intFlowCorrelationsVsMHist) | |
18070 | { | |
18071 | this->SetIntFlowCorrelationsVsMHist(intFlowCorrelationsVsMHist,ci); | |
18072 | } else | |
18073 | { | |
18074 | cout<<"WARNING: "<<Form("intFlowCorrelationsVsMHist[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18075 | } | |
18076 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
18077 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 18078 | // average all correlations for integrated flow (with correct errors!): |
18079 | TString intFlowCorrelationsAllHistName = "fIntFlowCorrelationsAllHist"; | |
18080 | intFlowCorrelationsAllHistName += fAnalysisLabel->Data(); | |
18081 | TH1D *intFlowCorrelationsAllHist = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCorrelationsAllHistName.Data())); | |
18082 | if(intFlowCorrelationsAllHist) | |
18083 | { | |
18084 | this->SetIntFlowCorrelationsAllHist(intFlowCorrelationsAllHist); | |
18085 | } else | |
18086 | { | |
18087 | cout<<"WARNING: intFlowCorrelationsAllHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18088 | } | |
18089 | // average correction terms for non-uniform acceptance (with correct errors!): | |
18090 | TString intFlowCorrectionTermsForNUAHistName = "fIntFlowCorrectionTermsForNUAHist"; | |
18091 | intFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
18092 | for(Int_t sc=0;sc<2;sc++) | |
18093 | { | |
18094 | TH1D *intFlowCorrectionTermsForNUAHist = dynamic_cast<TH1D*>(intFlowResults->FindObject((Form("%s: %s terms",intFlowCorrectionTermsForNUAHistName.Data(),sinCosFlag[sc].Data())))); | |
18095 | if(intFlowCorrectionTermsForNUAHist) | |
18096 | { | |
18097 | this->SetIntFlowCorrectionTermsForNUAHist(intFlowCorrectionTermsForNUAHist,sc); | |
18098 | } else | |
18099 | { | |
18100 | cout<<"WARNING: intFlowCorrectionTermsForNUAHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18101 | cout<<"sc = "<<sc<<endl; | |
18102 | } | |
18103 | } // end of for(Int_t sc=0;sc<2;sc++) | |
18104 | // covariances (multiplied with weight dependent prefactor): | |
18105 | TString intFlowCovariancesName = "fIntFlowCovariances"; | |
18106 | intFlowCovariancesName += fAnalysisLabel->Data(); | |
18107 | TH1D *intFlowCovariances = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCovariancesName.Data())); | |
18108 | if(intFlowCovariances) | |
18109 | { | |
18110 | this->SetIntFlowCovariances(intFlowCovariances); | |
18111 | } else | |
18112 | { | |
18113 | cout<<"WARNING: intFlowCovariances is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18114 | } | |
18115 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8>: | |
18116 | TString intFlowSumOfEventWeightsName = "fIntFlowSumOfEventWeights"; | |
18117 | intFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
18118 | for(Int_t power=0;power<2;power++) | |
18119 | { | |
18120 | TH1D *intFlowSumOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s: %s",intFlowSumOfEventWeightsName.Data(),powerFlag[power].Data()))); | |
18121 | if(intFlowSumOfEventWeights) | |
18122 | { | |
18123 | this->SetIntFlowSumOfEventWeights(intFlowSumOfEventWeights,power); | |
18124 | } else | |
18125 | { | |
18126 | cout<<"WARNING: intFlowSumOfEventWeights is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18127 | cout<<"power = "<<power<<endl; | |
18128 | } | |
18129 | } // end of for(Int_t power=0;power<2;power++) | |
18130 | // sum of products of event weights for correlations <2>, <4>, <6> and <8>: | |
18131 | TString intFlowSumOfProductOfEventWeightsName = "fIntFlowSumOfProductOfEventWeights"; | |
18132 | intFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
18133 | TH1D *intFlowSumOfProductOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowSumOfProductOfEventWeightsName.Data())); | |
18134 | if(intFlowSumOfProductOfEventWeights) | |
18135 | { | |
18136 | this->SetIntFlowSumOfProductOfEventWeights(intFlowSumOfProductOfEventWeights); | |
18137 | } else | |
18138 | { | |
18139 | cout<<"WARNING: intFlowSumOfProductOfEventWeights is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18140 | } | |
ff70ca91 | 18141 | // final result for covariances of correlations (multiplied with weight dependent prefactor) versus M |
18142 | // [0=Cov(2,4),1=Cov(2,6),2=Cov(2,8),3=Cov(4,6),4=Cov(4,8),5=Cov(6,8)]: | |
b3dacf6b | 18143 | if(fCalculateCumulantsVsM) |
ff70ca91 | 18144 | { |
b3dacf6b | 18145 | TString intFlowCovariancesVsMName = "fIntFlowCovariancesVsM"; |
18146 | intFlowCovariancesVsMName += fAnalysisLabel->Data(); | |
18147 | TString covarianceFlag[6] = {"Cov(<2>,<4>)","Cov(<2>,<6>)","Cov(<2>,<8>)","Cov(<4>,<6>)","Cov(<4>,<8>)","Cov(<6>,<8>)"}; | |
18148 | for(Int_t ci=0;ci<6;ci++) | |
18149 | { | |
18150 | TH1D *intFlowCovariancesVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowCovariancesVsMName.Data(),covarianceFlag[ci].Data()))); | |
18151 | if(intFlowCovariancesVsM) | |
ff70ca91 | 18152 | { |
b3dacf6b | 18153 | this->SetIntFlowCovariancesVsM(intFlowCovariancesVsM,ci); |
ff70ca91 | 18154 | } else |
18155 | { | |
b3dacf6b | 18156 | cout<<"WARNING: "<<Form("intFlowCovariancesVsM[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; |
ff70ca91 | 18157 | } |
b3dacf6b | 18158 | } // end of for(Int_t ci=0;ci<6;ci++) |
18159 | } // end of if(fCalculateCumulantsVsM) | |
18160 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8> versus multiplicity | |
18161 | // [0=sum{w_{<2>}},1=sum{w_{<4>}},2=sum{w_{<6>}},3=sum{w_{<8>}}][0=linear 1,1=quadratic]: | |
18162 | if(fCalculateCumulantsVsM) | |
18163 | { | |
18164 | TString intFlowSumOfEventWeightsVsMName = "fIntFlowSumOfEventWeightsVsM"; | |
18165 | intFlowSumOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
18166 | TString sumFlag[2][4] = {{"#sum_{i=1}^{N} w_{<2>}","#sum_{i=1}^{N} w_{<4>}","#sum_{i=1}^{N} w_{<6>}","#sum_{i=1}^{N} w_{<8>}"}, | |
18167 | {"#sum_{i=1}^{N} w_{<2>}^{2}","#sum_{i=1}^{N} w_{<4>}^{2}","#sum_{i=1}^{N} w_{<6>}^{2}","#sum_{i=1}^{N} w_{<8>}^{2}"}}; | |
18168 | for(Int_t si=0;si<4;si++) | |
18169 | { | |
18170 | for(Int_t power=0;power<2;power++) | |
18171 | { | |
18172 | TH1D *intFlowSumOfEventWeightsVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowSumOfEventWeightsVsMName.Data(),sumFlag[power][si].Data()))); | |
18173 | if(intFlowSumOfEventWeightsVsM) | |
18174 | { | |
18175 | this->SetIntFlowSumOfEventWeightsVsM(intFlowSumOfEventWeightsVsM,si,power); | |
18176 | } else | |
18177 | { | |
18178 | cout<<"WARNING: "<<Form("intFlowSumOfEventWeightsVsM[%d][%d]",si,power)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18179 | } | |
18180 | } // end of for(Int_t power=0;power<2;power++) | |
18181 | } // end of for(Int_t si=0;si<4;si++) | |
18182 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 18183 | // sum of products of event weights for correlations <2>, <4>, <6> and <8> vs M |
18184 | // [0=sum{w_{<2>}w_{<4>}},1=sum{w_{<2>}w_{<6>}},2=sum{w_{<2>}w_{<8>}}, | |
18185 | // 3=sum{w_{<4>}w_{<6>}},4=sum{w_{<4>}w_{<8>}},5=sum{w_{<6>}w_{<8>}}]: | |
b3dacf6b | 18186 | if(fCalculateCumulantsVsM) |
ff70ca91 | 18187 | { |
b3dacf6b | 18188 | TString intFlowSumOfProductOfEventWeightsVsMName = "fIntFlowSumOfProductOfEventWeightsVsM"; |
18189 | intFlowSumOfProductOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
18190 | TString sopowFlag[6] = {"#sum_{i=1}^{N} w_{<2>} w_{<4>}","#sum_{i=1}^{N} w_{<2>} w_{<6>}","#sum_{i=1}^{N} w_{<2>} w_{<8>}", | |
18191 | "#sum_{i=1}^{N} w_{<4>} w_{<6>}","#sum_{i=1}^{N} w_{<4>} w_{<8>}","#sum_{i=1}^{N} w_{<6>} w_{<8>}"}; | |
18192 | for(Int_t pi=0;pi<6;pi++) | |
ff70ca91 | 18193 | { |
b3dacf6b | 18194 | TH1D *intFlowSumOfProductOfEventWeightsVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowSumOfProductOfEventWeightsVsMName.Data(),sopowFlag[pi].Data()))); |
18195 | if(intFlowSumOfProductOfEventWeightsVsM) | |
18196 | { | |
18197 | this->SetIntFlowSumOfProductOfEventWeightsVsM(intFlowSumOfProductOfEventWeightsVsM,pi); | |
18198 | } else | |
18199 | { | |
18200 | cout<<"WARNING: "<<Form("intFlowSumOfProductOfEventWeightsVsM[%d]",pi)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18201 | } | |
18202 | } // end of for(Int_t pi=0;pi<6;pi++) | |
18203 | } // end of if(fCalculateCumulantsVsM) | |
0328db2d | 18204 | // covariances for NUA (multiplied with weight dependent prefactor): |
18205 | TString intFlowCovariancesNUAName = "fIntFlowCovariancesNUA"; | |
18206 | intFlowCovariancesNUAName += fAnalysisLabel->Data(); | |
18207 | TH1D *intFlowCovariancesNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCovariancesNUAName.Data())); | |
18208 | if(intFlowCovariancesNUA) | |
18209 | { | |
18210 | this->SetIntFlowCovariancesNUA(intFlowCovariancesNUA); | |
18211 | } else | |
18212 | { | |
18213 | cout<<"WARNING: intFlowCovariancesNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18214 | } | |
18215 | // sum of linear and quadratic event weights NUA terms: | |
18216 | TString intFlowSumOfEventWeightsNUAName = "fIntFlowSumOfEventWeightsNUA"; | |
18217 | intFlowSumOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
18218 | for(Int_t sc=0;sc<2;sc++) | |
18219 | { | |
18220 | for(Int_t power=0;power<2;power++) | |
18221 | { | |
18222 | TH1D *intFlowSumOfEventWeightsNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s: %s, %s",intFlowSumOfEventWeightsNUAName.Data(),powerFlag[power].Data(),sinCosFlag[sc].Data()))); | |
18223 | if(intFlowSumOfEventWeightsNUA) | |
18224 | { | |
18225 | this->SetIntFlowSumOfEventWeightsNUA(intFlowSumOfEventWeightsNUA,sc,power); | |
18226 | } else | |
18227 | { | |
18228 | cout<<"WARNING: intFlowSumOfEventWeightsNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18229 | cout<<"sc = "<<sc<<endl; | |
18230 | cout<<"power = "<<power<<endl; | |
18231 | } | |
18232 | } // end of for(Int_t power=0;power<2;power++) | |
18233 | } // end of for(Int_t sc=0;sc<2;sc++) | |
18234 | // sum of products of event weights for NUA terms: | |
18235 | TString intFlowSumOfProductOfEventWeightsNUAName = "fIntFlowSumOfProductOfEventWeightsNUA"; | |
18236 | intFlowSumOfProductOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
18237 | TH1D *intFlowSumOfProductOfEventWeightsNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowSumOfProductOfEventWeightsNUAName.Data())); | |
18238 | if(intFlowSumOfProductOfEventWeightsNUA) | |
18239 | { | |
18240 | this->SetIntFlowSumOfProductOfEventWeightsNUA(intFlowSumOfProductOfEventWeightsNUA); | |
18241 | } else | |
18242 | { | |
18243 | cout<<"WARNING: intFlowSumOfProductOfEventWeightsNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18244 | } | |
b3dacf6b | 18245 | // Final results for reference Q-cumulants: |
489d5531 | 18246 | TString intFlowQcumulantsName = "fIntFlowQcumulants"; |
18247 | intFlowQcumulantsName += fAnalysisLabel->Data(); | |
18248 | TH1D *intFlowQcumulants = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsName.Data())); | |
18249 | if(intFlowQcumulants) | |
18250 | { | |
18251 | this->SetIntFlowQcumulants(intFlowQcumulants); | |
18252 | } else | |
18253 | { | |
18254 | cout<<"WARNING: intFlowQcumulants is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18255 | } | |
b3dacf6b | 18256 | // Final results for reference Q-cumulants rebinned in M: |
18257 | if(fCalculateCumulantsVsM) | |
18258 | { | |
18259 | TString intFlowQcumulantsRebinnedInMName = "fIntFlowQcumulantsRebinnedInM"; | |
18260 | intFlowQcumulantsRebinnedInMName += fAnalysisLabel->Data(); | |
18261 | TH1D *intFlowQcumulantsRebinnedInM = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsRebinnedInMName.Data())); | |
18262 | if(intFlowQcumulantsRebinnedInM) | |
18263 | { | |
18264 | this->SetIntFlowQcumulantsRebinnedInM(intFlowQcumulantsRebinnedInM); | |
18265 | } else | |
18266 | { | |
18267 | cout<<"WARNING: intFlowQcumulantsRebinnedInM is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18268 | } | |
18269 | } // end of if(fCalculateCumulantsVsM) | |
b92ea2b9 | 18270 | // Ratio between error squared: with/without non-isotropic terms: |
18271 | TString intFlowQcumulantsErrorSquaredRatioName = "fIntFlowQcumulantsErrorSquaredRatio"; | |
18272 | intFlowQcumulantsErrorSquaredRatioName += fAnalysisLabel->Data(); | |
18273 | TH1D *intFlowQcumulantsErrorSquaredRatio = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsErrorSquaredRatioName.Data())); | |
18274 | if(intFlowQcumulantsErrorSquaredRatio) | |
18275 | { | |
18276 | this->SetIntFlowQcumulantsErrorSquaredRatio(intFlowQcumulantsErrorSquaredRatio); | |
18277 | } else | |
18278 | { | |
18279 | cout<<" WARNING: intntFlowQcumulantsErrorSquaredRatio is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18280 | } | |
ff70ca91 | 18281 | // final results for integrated Q-cumulants versus multiplicity: |
ff70ca91 | 18282 | TString cumulantFlag[4] = {"QC{2}","QC{4}","QC{6}","QC{8}"}; |
b3dacf6b | 18283 | if(fCalculateCumulantsVsM) |
ff70ca91 | 18284 | { |
b3dacf6b | 18285 | TString intFlowQcumulantsVsMName = "fIntFlowQcumulantsVsM"; |
18286 | intFlowQcumulantsVsMName += fAnalysisLabel->Data(); | |
18287 | for(Int_t co=0;co<4;co++) // cumulant order | |
ff70ca91 | 18288 | { |
b3dacf6b | 18289 | TH1D *intFlowQcumulantsVsM = dynamic_cast<TH1D*> |
18290 | (intFlowResults->FindObject(Form("%s, %s",intFlowQcumulantsVsMName.Data(),cumulantFlag[co].Data()))); | |
18291 | if(intFlowQcumulantsVsM) | |
18292 | { | |
18293 | this->SetIntFlowQcumulantsVsM(intFlowQcumulantsVsM,co); | |
18294 | } else | |
18295 | { | |
18296 | cout<<"WARNING: "<<Form("intFlowQcumulantsVsM[%d]",co)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18297 | } | |
18298 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
18299 | } // end of if(fCalculateCumulantsVsM) | |
18300 | // Final reference flow estimates from Q-cumulants: | |
489d5531 | 18301 | TString intFlowName = "fIntFlow"; |
18302 | intFlowName += fAnalysisLabel->Data(); | |
18303 | TH1D *intFlow = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowName.Data())); | |
18304 | if(intFlow) | |
18305 | { | |
18306 | this->SetIntFlow(intFlow); | |
18307 | } else | |
18308 | { | |
18309 | cout<<"WARNING: intFlow is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
ff70ca91 | 18310 | } |
b3dacf6b | 18311 | // Final reference flow estimates from Q-cumulants vs M rebinned in M: |
18312 | if(fCalculateCumulantsVsM) | |
ff70ca91 | 18313 | { |
b3dacf6b | 18314 | TString intFlowRebinnedInMName = "fIntFlowRebinnedInM"; |
18315 | intFlowRebinnedInMName += fAnalysisLabel->Data(); | |
18316 | TH1D *intFlowRebinnedInM = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowRebinnedInMName.Data())); | |
18317 | if(intFlowRebinnedInM) | |
ff70ca91 | 18318 | { |
b3dacf6b | 18319 | this->SetIntFlowRebinnedInM(intFlowRebinnedInM); |
18320 | } else | |
ff70ca91 | 18321 | { |
b3dacf6b | 18322 | cout<<"WARNING: intFlowRebinnedInM is NULL in AFAWQC::GPFIFH() !!!!"<<endl; |
18323 | } | |
18324 | } // end of if(fCalculateCumulantsVsM) | |
18325 | // integrated flow from Q-cumulants versus multiplicity: | |
18326 | if(fCalculateCumulantsVsM) | |
18327 | { | |
18328 | TString intFlowVsMName = "fIntFlowVsM"; | |
18329 | intFlowVsMName += fAnalysisLabel->Data(); | |
b77b6434 | 18330 | TString flowFlag[4] = {Form("v_{%d}{2,QC}",fHarmonic),Form("v_{%d}{4,QC}",fHarmonic),Form("v_{%d}{6,QC}",fHarmonic),Form("v_{%d}{8,QC}",fHarmonic)}; |
b3dacf6b | 18331 | for(Int_t co=0;co<4;co++) // cumulant order |
18332 | { | |
18333 | TH1D *intFlowVsM = dynamic_cast<TH1D*> | |
b77b6434 | 18334 | (intFlowResults->FindObject(Form("%s, %s",intFlowVsMName.Data(),flowFlag[co].Data()))); |
b3dacf6b | 18335 | if(intFlowVsM) |
18336 | { | |
18337 | this->SetIntFlowVsM(intFlowVsM,co); | |
18338 | } else | |
18339 | { | |
18340 | cout<<"WARNING: "<<Form("intFlowVsM[%d]",co)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18341 | } | |
18342 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
18343 | } // end of if(fCalculateCumulantsVsM) | |
2001bc3a | 18344 | // quantifying detector effects effects to correlations: |
18345 | TString intFlowDetectorBiasName = "fIntFlowDetectorBias"; | |
18346 | intFlowDetectorBiasName += fAnalysisLabel->Data(); | |
18347 | TH1D *intFlowDetectorBias = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowDetectorBiasName.Data())); | |
18348 | if(intFlowDetectorBias) | |
18349 | { | |
18350 | this->SetIntFlowDetectorBias(intFlowDetectorBias); | |
18351 | } else | |
18352 | { | |
18353 | cout<<"WARNING: intFlowDetectorBias is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18354 | } | |
18355 | // quantifying detector effects effects to correlations vs multiplicity: | |
b77b6434 | 18356 | if(fCalculateCumulantsVsM) |
2001bc3a | 18357 | { |
3c5d5752 | 18358 | TString intFlowDetectorBiasVsMName = "fIntFlowDetectorBiasVsM"; |
18359 | intFlowDetectorBiasVsMName += fAnalysisLabel->Data(); | |
18360 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2001bc3a | 18361 | { |
3c5d5752 | 18362 | TH1D *intFlowDetectorBiasVsM = dynamic_cast<TH1D*> |
18363 | (intFlowResults->FindObject(Form("%s for %s",intFlowDetectorBiasVsMName.Data(),cumulantFlag[ci].Data()))); | |
18364 | if(intFlowDetectorBiasVsM) | |
18365 | { | |
18366 | this->SetIntFlowDetectorBiasVsM(intFlowDetectorBiasVsM,ci); | |
18367 | } else | |
18368 | { | |
18369 | cout<<"WARNING: "<<Form("intFlowDetectorBiasVsM[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18370 | } | |
18371 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
b77b6434 | 18372 | } // end of if(fCalculateCumulantsVsM) |
489d5531 | 18373 | } else // to if(intFlowResults) |
18374 | { | |
18375 | cout<<"WARNING: intFlowResults is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
18376 | } | |
ff70ca91 | 18377 | |
489d5531 | 18378 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForIntFlowHistograms() |
18379 | ||
e1d101a6 | 18380 | //======================================================================================================================= |
489d5531 | 18381 | |
1268c371 | 18382 | void AliFlowAnalysisWithQCumulants::GetPointersFor2DDiffFlowHistograms() |
18383 | { | |
18384 | // Get pointers for 2D differential flow histograms. | |
18385 | // a) Check pointers used in this method; | |
18386 | // b) Get pointers to 2D differential flow lists; | |
18387 | // c) Get pointers to 2D differential flow profiles; | |
18388 | // d) Get pointers to 2D differential flow histograms. | |
18389 | ||
18390 | // a) Check pointers used in this method: | |
18391 | if(!fDiffFlowList) | |
18392 | { | |
18393 | printf("\n WARNING (QC): fDiffFlowList is NULL in AFAWQC::GPF2DDFH() !!!!\n"); | |
18394 | printf(" Call method GetPointersForDiffFlowHistograms() first.\n\n"); | |
18395 | exit(0); | |
18396 | } | |
18397 | if(!fDiffFlowFlags) | |
18398 | { | |
18399 | printf("\n WARNING (QC): fDiffFlowFlags is NULL in AFAWQC::GPF2DDFH() !!!!\n\n"); | |
18400 | printf(" Call method GetPointersForDiffFlowHistograms() first.\n\n"); | |
18401 | exit(0); | |
18402 | } | |
18403 | ||
18404 | // b) Get pointers to 2D differential flow lists: | |
18405 | this->SetCalculate2DDiffFlow((Bool_t)fDiffFlowFlags->GetBinContent(5)); // to be improved - hardwired 5 | |
18406 | if(!fCalculate2DDiffFlow){return;} | |
18407 | TString typeFlag[2] = {"RP","POI"}; | |
18408 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
18409 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
18410 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
18411 | // Base list: | |
18412 | TString diffFlow2DListName = "2D"; | |
18413 | diffFlow2DListName += fAnalysisLabel->Data(); | |
18414 | fDiffFlow2D = dynamic_cast<TList*>(fDiffFlowList->FindObject(diffFlow2DListName.Data())); | |
18415 | if(!fDiffFlow2D) | |
18416 | { | |
18417 | printf("\n WARNING (QC): fDiffFlow2D is NULL in AFAWQC::GPFDFH() !!!!\n\n"); | |
18418 | exit(0); | |
18419 | } | |
18420 | // Lists holding profiles with 2D correlations: | |
18421 | TString s2DDiffFlowCorrelationsProListName = "Profiles with 2D correlations"; | |
18422 | s2DDiffFlowCorrelationsProListName += fAnalysisLabel->Data(); // to be improved | |
18423 | for(Int_t t=0;t<2;t++) | |
18424 | { | |
18425 | f2DDiffFlowCorrelationsProList[t] = dynamic_cast<TList*>(fDiffFlow2D->FindObject(Form("Profiles with 2D correlations (%s)",typeFlag[t].Data()))); | |
18426 | if(!f2DDiffFlowCorrelationsProList[t]) | |
18427 | { | |
18428 | printf("\n WARNING (QC): f2DDiffFlowCorrelationsProList[%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t); | |
18429 | exit(0); | |
18430 | } | |
18431 | } // end of for(Int_t t=0;t<2;t++) | |
18432 | ||
18433 | // c) Get pointers to 2D differential flow profiles: | |
18434 | TString s2DDiffFlowCorrelationsProName = "f2DDiffFlowCorrelationsPro"; | |
18435 | s2DDiffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
18436 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
18437 | { | |
18438 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
18439 | { | |
18440 | f2DDiffFlowCorrelationsPro[t][rci] = dynamic_cast<TProfile2D*>(f2DDiffFlowCorrelationsProList[t]->FindObject(Form("%s, %s, %s",s2DDiffFlowCorrelationsProName.Data(),typeFlag[t].Data(),reducedCorrelationIndex[rci].Data()))); | |
18441 | if(!f2DDiffFlowCorrelationsPro[t][rci]) | |
18442 | { | |
18443 | printf("\n WARNING (QC): f2DDiffFlowCorrelationsPro[%i][%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t,rci); | |
18444 | exit(0); | |
18445 | } else | |
18446 | { | |
18447 | this->Set2DDiffFlowCorrelationsPro(f2DDiffFlowCorrelationsPro[t][rci],t,rci); | |
18448 | } | |
18449 | } // end of for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
18450 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
18451 | ||
18452 | // d) Get pointers to 2D differential flow histograms: | |
18453 | TString s2DDiffFlowCumulantsName = "f2DDiffFlowCumulants"; | |
18454 | s2DDiffFlowCumulantsName += fAnalysisLabel->Data(); | |
18455 | TString s2DDiffFlowName = "f2DDiffFlow"; | |
18456 | s2DDiffFlowName += fAnalysisLabel->Data(); | |
18457 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
18458 | { | |
18459 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
18460 | { | |
18461 | // 2D differential cumulants: | |
18462 | f2DDiffFlowCumulants[t][rci] = dynamic_cast<TH2D*>(f2DDiffFlowCorrelationsProList[t]->FindObject(Form("%s, %s, %s",s2DDiffFlowCumulantsName.Data(),typeFlag[t].Data(),differentialCumulantIndex[rci].Data()))); | |
18463 | if(!f2DDiffFlowCumulants[t][rci]) | |
18464 | { | |
18465 | printf("\n WARNING (QC): f2DDiffFlowCumulants[%i][%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t,rci); | |
18466 | exit(0); | |
18467 | } else | |
18468 | { | |
18469 | this->Set2DDiffFlowCumulants(f2DDiffFlowCumulants[t][rci],t,rci); | |
18470 | } | |
18471 | // 2D differential flow: | |
18472 | f2DDiffFlow[t][rci] = dynamic_cast<TH2D*>(f2DDiffFlowCorrelationsProList[t]->FindObject(Form("%s, %s, %s",s2DDiffFlowName.Data(),typeFlag[t].Data(),differentialFlowIndex[rci].Data()))); | |
18473 | if(!f2DDiffFlow[t][rci]) | |
18474 | { | |
18475 | printf("\n WARNING (QC): f2DDiffFlow[%i][%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t,rci); | |
18476 | exit(0); | |
18477 | } else | |
18478 | { | |
18479 | this->Set2DDiffFlow(f2DDiffFlow[t][rci],t,rci); | |
18480 | } | |
18481 | } // end of for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
18482 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
18483 | ||
18484 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersFor2DDiffFlowHistograms() | |
18485 | ||
e1d101a6 | 18486 | //======================================================================================================================= |
1268c371 | 18487 | |
64e500e3 | 18488 | void AliFlowAnalysisWithQCumulants::GetPointersForOtherDiffCorrelators() |
18489 | { | |
18490 | // Get pointers for other differential correlators. | |
18491 | // a) Get pointer to list with other differential correlators; | |
18492 | // b) Declare local flags; | |
18493 | // c) Get pointers to other differential profiles. | |
18494 | ||
62e36168 | 18495 | if(!fCalculateDiffFlow){return;} // TBI: This must eventually be moved somewhere else |
18496 | ||
64e500e3 | 18497 | // a) Get pointer to list with other differential correlators: |
18498 | fOtherDiffCorrelatorsList = dynamic_cast<TList*>(fHistList->FindObject("Other differential correlators")); | |
18499 | if(!fOtherDiffCorrelatorsList) | |
18500 | { | |
18501 | printf("\n WARNING (QC): fOtherDiffCorrelatorsList is NULL in AFAWQC::GPFDFH() !!!!\n\n"); | |
18502 | exit(0); | |
18503 | } | |
18504 | ||
18505 | // b) Declare local flags: // (to be improved - promoted to data members) | |
18506 | TString typeFlag[2] = {"RP","POI"}; | |
18507 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
18508 | TString sinCosFlag[2] = {"sin","cos"}; | |
18509 | ||
18510 | // c) Get pointers to other differential profiles: | |
18511 | TString otherDiffCorrelatorsName = "fOtherDiffCorrelators"; | |
18512 | otherDiffCorrelatorsName += fAnalysisLabel->Data(); | |
18513 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
18514 | { | |
62e36168 | 18515 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
64e500e3 | 18516 | { |
18517 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
18518 | { | |
18519 | for(Int_t ci=0;ci<1;ci++) // correlator index | |
18520 | { | |
18521 | fOtherDiffCorrelators[t][pe][sc][ci] = dynamic_cast<TProfile*>(fOtherDiffCorrelatorsList->FindObject(Form("%s, %s, %s, %s, ci = %d",otherDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1))); | |
18522 | if(!fOtherDiffCorrelators[t][pe][sc][ci]) | |
18523 | { | |
18524 | printf("\n WARNING (QC): fOtherDiffCorrelators[%i][%i][%i][%i] is NULL in AFAWQC::GPFODC() !!!!\n\n",t,pe,sc,ci); | |
18525 | exit(0); | |
18526 | } else | |
18527 | { | |
18528 | this->SetOtherDiffCorrelators(fOtherDiffCorrelators[t][pe][sc][ci],t,pe,sc,ci); | |
18529 | } | |
18530 | } // end of for(Int_t ci=0;ci<1;ci++) // correlator index | |
18531 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
18532 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
18533 | } // end of for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
18534 | ||
18535 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForOtherDiffCorrelators() | |
18536 | ||
e1d101a6 | 18537 | //======================================================================================================================= |
64e500e3 | 18538 | |
489d5531 | 18539 | void AliFlowAnalysisWithQCumulants::GetPointersForDiffFlowHistograms() |
18540 | { | |
18541 | // Get pointer to all objects relevant for differential flow. | |
1268c371 | 18542 | // a) Get pointer to base list for differential flow fDiffFlowList; |
18543 | // b) Get pointer to profile fDiffFlowFlags holding all flags for differential flow. Access and set some flags; | |
18544 | // c) Get pointers to nested lists fDiffFlowListProfiles and fDiffFlowListResults; | |
18545 | // d) Define flags locally (to be improved: should I promote these flags to data members?); | |
18546 | // e) Get pointers to all nested lists in fDiffFlowListProfiles and to profiles which they hold; | |
18547 | // f) Get pointers to all nested lists in fDiffFlowListResults and to histograms which they hold. | |
18548 | ||
18549 | // a) Get pointer to base list for differential flow fDiffFlowList: | |
18550 | fDiffFlowList = dynamic_cast<TList*>(fHistList->FindObject("Differential Flow")); | |
18551 | if(!fDiffFlowList) | |
489d5531 | 18552 | { |
1268c371 | 18553 | printf("\n WARNING (QC): fDiffFlowList is NULL in AFAWQC::GPFDFH() !!!!\n\n"); |
489d5531 | 18554 | exit(0); |
18555 | } | |
1268c371 | 18556 | |
18557 | // b) Get pointer to profile fDiffFlowFlags holding all flags for differential flow. Access and set some flags: | |
18558 | TString diffFlowFlagsName = "fDiffFlowFlags"; | |
18559 | diffFlowFlagsName += fAnalysisLabel->Data(); | |
18560 | fDiffFlowFlags = dynamic_cast<TProfile*>(fDiffFlowList->FindObject(diffFlowFlagsName.Data())); | |
18561 | if(fDiffFlowFlags) | |
18562 | { | |
62d19320 | 18563 | this->SetCalculateDiffFlow((Bool_t)fDiffFlowFlags->GetBinContent(1)); // to be improved - hardwired 1 |
62e36168 | 18564 | this->SetCalculateDiffFlowVsEta((Bool_t)fDiffFlowFlags->GetBinContent(6)); // to be improved - hardwired 6 |
1268c371 | 18565 | } else |
18566 | { | |
18567 | printf("\n WARNING (QC): fDiffFlowFlags is NULL in AFAWQC::GPFDFH() !!!!\n\n"); | |
18568 | printf("\n Flags in method Finish() are wrong.\n\n"); | |
18569 | exit(0); | |
18570 | } | |
18571 | ||
18572 | if(!fCalculateDiffFlow){return;} // IMPORTANT: do not move this anywhere above in this method (to be improved) | |
18573 | ||
18574 | // c) Get pointers to nested lists fDiffFlowListProfiles and fDiffFlowListResults: | |
18575 | // List holding nested lists holding profiles: | |
489d5531 | 18576 | TList *diffFlowListProfiles = NULL; |
1268c371 | 18577 | diffFlowListProfiles = dynamic_cast<TList*>(fDiffFlowList->FindObject("Profiles")); |
489d5531 | 18578 | if(!diffFlowListProfiles) |
18579 | { | |
1268c371 | 18580 | printf("\n WARNING (QC): diffFlowListProfiles is NULL in AFAWQC::GPFDFH() !!!!\n\n"); |
489d5531 | 18581 | exit(0); |
18582 | } | |
1268c371 | 18583 | // List holding nested lists holding histograms with final results: |
489d5531 | 18584 | TList *diffFlowListResults = NULL; |
1268c371 | 18585 | diffFlowListResults = dynamic_cast<TList*>(fDiffFlowList->FindObject("Results")); |
489d5531 | 18586 | if(!diffFlowListResults) |
18587 | { | |
1268c371 | 18588 | printf("\n WARNING (QC): diffFlowListResults is NULL in AFAWQC::GPFDFH() !!!!\n\n"); |
489d5531 | 18589 | exit(0); |
18590 | } | |
18591 | ||
1268c371 | 18592 | // d) Define flags locally (to be improved: should I promote these flags to data members?): |
18593 | TString typeFlag[2] = {"RP","POI"}; | |
18594 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
18595 | TString powerFlag[2] = {"linear","quadratic"}; | |
18596 | TString sinCosFlag[2] = {"sin","cos"}; | |
18597 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
18598 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
18599 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
18600 | TString reducedSquaredCorrelationIndex[4] = {"<2'>^{2}","<4'>^{2}","<6'>^{2}","<8'>^{2}"}; | |
18601 | TString mixedCorrelationIndex[8] = {"<2>","<2'>","<4>","<4'>","<6>","<6'>","<8>","<8'>"}; | |
18602 | TString covarianceName[5] = {"Cov(<2>,<2'>)","Cov(<2>,<4'>)","Cov(<4>,<2'>)","Cov(<4>,<4'>)","Cov(<2'>,<4'>)"}; | |
489d5531 | 18603 | |
1268c371 | 18604 | // e) Get pointers to all nested lists in fDiffFlowListProfiles and to profiles which they hold: |
489d5531 | 18605 | // correlations: |
18606 | TList *diffFlowCorrelationsProList[2][2] = {{NULL}}; | |
18607 | TString diffFlowCorrelationsProName = "fDiffFlowCorrelationsPro"; | |
18608 | diffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
b40a910e | 18609 | TProfile *diffFlowCorrelationsPro[2][2][4] = {{{NULL}}}; |
18610 | // squared correlations: | |
18611 | TString diffFlowSquaredCorrelationsProName = "fDiffFlowSquaredCorrelationsPro"; | |
18612 | diffFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
18613 | TProfile *diffFlowSquaredCorrelationsPro[2][2][4] = {{{NULL}}}; | |
489d5531 | 18614 | // products of correlations: |
18615 | TList *diffFlowProductOfCorrelationsProList[2][2] = {{NULL}}; | |
18616 | TString diffFlowProductOfCorrelationsProName = "fDiffFlowProductOfCorrelationsPro"; | |
18617 | diffFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
18618 | TProfile *diffFlowProductOfCorrelationsPro[2][2][8][8] = {{{{NULL}}}}; | |
18619 | // corrections: | |
18620 | TList *diffFlowCorrectionsProList[2][2] = {{NULL}}; | |
18621 | TString diffFlowCorrectionTermsForNUAProName = "fDiffFlowCorrectionTermsForNUAPro"; | |
18622 | diffFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
18623 | TProfile *diffFlowCorrectionTermsForNUAPro[2][2][2][10] = {{{{NULL}}}}; | |
18624 | for(Int_t t=0;t<2;t++) | |
18625 | { | |
62e36168 | 18626 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) |
489d5531 | 18627 | { |
18628 | diffFlowCorrelationsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
18629 | if(!diffFlowCorrelationsProList[t][pe]) | |
18630 | { | |
18631 | cout<<"WARNING: diffFlowCorrelationsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18632 | cout<<"t = "<<t<<endl; | |
18633 | cout<<"pe = "<<pe<<endl; | |
18634 | exit(0); | |
18635 | } | |
18636 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
18637 | { | |
b40a910e | 18638 | // reduced correlations: |
489d5531 | 18639 | diffFlowCorrelationsPro[t][pe][ci] = dynamic_cast<TProfile*>(diffFlowCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[ci].Data()))); |
18640 | if(diffFlowCorrelationsPro[t][pe][ci]) | |
18641 | { | |
18642 | this->SetDiffFlowCorrelationsPro(diffFlowCorrelationsPro[t][pe][ci],t,pe,ci); | |
18643 | } else | |
18644 | { | |
18645 | cout<<"WARNING: diffFlowCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18646 | cout<<"t = "<<t<<endl; | |
18647 | cout<<"pe = "<<pe<<endl; | |
18648 | cout<<"ci = "<<ci<<endl; | |
18649 | } | |
b40a910e | 18650 | // reduced squared correlations: |
18651 | diffFlowSquaredCorrelationsPro[t][pe][ci] = dynamic_cast<TProfile*>(diffFlowCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowSquaredCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedSquaredCorrelationIndex[ci].Data()))); | |
18652 | if(diffFlowSquaredCorrelationsPro[t][pe][ci]) | |
18653 | { | |
18654 | this->SetDiffFlowSquaredCorrelationsPro(diffFlowSquaredCorrelationsPro[t][pe][ci],t,pe,ci); | |
18655 | } else | |
18656 | { | |
18657 | cout<<"WARNING: diffFlowSquaredCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18658 | cout<<"t = "<<t<<endl; | |
18659 | cout<<"pe = "<<pe<<endl; | |
18660 | cout<<"ci = "<<ci<<endl; | |
18661 | } | |
489d5531 | 18662 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index |
18663 | // products of correlations: | |
18664 | diffFlowProductOfCorrelationsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with products of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
18665 | if(!diffFlowProductOfCorrelationsProList[t][pe]) | |
18666 | { | |
18667 | cout<<"WARNING: ddiffFlowProductOfCorrelationsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18668 | cout<<"t = "<<t<<endl; | |
18669 | cout<<"pe = "<<pe<<endl; | |
18670 | exit(0); | |
18671 | } | |
18672 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
18673 | { | |
18674 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
18675 | { | |
18676 | diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = dynamic_cast<TProfile*>(diffFlowProductOfCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()))); | |
18677 | if(diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]) | |
18678 | { | |
18679 | this->SetDiffFlowProductOfCorrelationsPro(diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2],t,pe,mci1,mci2); | |
18680 | } else | |
18681 | { | |
b40a910e | 18682 | cout<<"WARNING: diffFlowProductOfCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; |
489d5531 | 18683 | cout<<"t = "<<t<<endl; |
18684 | cout<<"pe = "<<pe<<endl; | |
18685 | cout<<"mci1 = "<<mci1<<endl; | |
18686 | cout<<"mci2 = "<<mci2<<endl; | |
18687 | } | |
18688 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
18689 | } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
18690 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
18691 | // corrections: | |
18692 | diffFlowCorrectionsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
18693 | if(!diffFlowCorrectionsProList[t][pe]) | |
18694 | { | |
18695 | cout<<"WARNING: diffFlowCorrectionsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18696 | cout<<"t = "<<t<<endl; | |
18697 | cout<<"pe = "<<pe<<endl; | |
18698 | exit(0); | |
18699 | } | |
18700 | // correction terms for NUA: | |
18701 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
18702 | { | |
18703 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
18704 | { | |
18705 | diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = dynamic_cast<TProfile*>(diffFlowCorrectionsProList[t][pe]->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1))); | |
18706 | if(diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]) | |
18707 | { | |
18708 | this->SetDiffFlowCorrectionTermsForNUAPro(diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti],t,pe,sc,cti); | |
18709 | } else | |
18710 | { | |
18711 | cout<<"WARNING: diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18712 | cout<<"t = "<<t<<endl; | |
18713 | cout<<"pe = "<<pe<<endl; | |
18714 | cout<<"sc = "<<sc<<endl; | |
18715 | cout<<"cti = "<<cti<<endl; | |
18716 | } | |
18717 | } // end of for(Int_t cti=0;cti<9;cti++) // correction term index | |
18718 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
18719 | // ... | |
18720 | } // end of for(Int_t pe=0;pe<2;pe++) | |
18721 | } // end of for(Int_t t=0;t<2;t++) | |
18722 | ||
1268c371 | 18723 | // f) Get pointers to all nested lists in fDiffFlowListResults and to histograms which they hold: |
489d5531 | 18724 | // reduced correlations: |
18725 | TList *diffFlowCorrelationsHistList[2][2] = {{NULL}}; | |
18726 | TString diffFlowCorrelationsHistName = "fDiffFlowCorrelationsHist"; | |
18727 | diffFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
18728 | TH1D *diffFlowCorrelationsHist[2][2][4] = {{{NULL}}}; | |
18729 | // corrections for NUA: | |
18730 | TList *diffFlowCorrectionsHistList[2][2] = {{NULL}}; | |
18731 | TString diffFlowCorrectionTermsForNUAHistName = "fDiffFlowCorrectionTermsForNUAHist"; | |
18732 | diffFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
18733 | TH1D *diffFlowCorrectionTermsForNUAHist[2][2][2][10] = {{{{NULL}}}}; | |
18734 | // differential Q-cumulants: | |
18735 | TList *diffFlowCumulantsHistList[2][2] = {{NULL}}; | |
18736 | TString diffFlowCumulantsName = "fDiffFlowCumulants"; | |
18737 | diffFlowCumulantsName += fAnalysisLabel->Data(); | |
18738 | TH1D *diffFlowCumulants[2][2][4] = {{{NULL}}}; | |
1268c371 | 18739 | // detector bias to differential Q-cumulants: |
18740 | TList *diffFlowDetectorBiasHistList[2][2] = {{NULL}}; | |
18741 | TString diffFlowDetectorBiasName = "fDiffFlowDetectorBias"; | |
18742 | diffFlowDetectorBiasName += fAnalysisLabel->Data(); | |
18743 | TH1D *diffFlowDetectorBias[2][2][4] = {{{NULL}}}; | |
489d5531 | 18744 | // differential flow estimates from Q-cumulants: |
18745 | TList *diffFlowHistList[2][2] = {{NULL}}; | |
18746 | TString diffFlowName = "fDiffFlow"; | |
18747 | diffFlowName += fAnalysisLabel->Data(); | |
18748 | TH1D *diffFlow[2][2][4] = {{{NULL}}}; | |
18749 | // differential covariances: | |
18750 | TList *diffFlowCovariancesHistList[2][2] = {{NULL}}; | |
18751 | TString diffFlowCovariancesName = "fDiffFlowCovariances"; | |
18752 | diffFlowCovariancesName += fAnalysisLabel->Data(); | |
18753 | TH1D *diffFlowCovariances[2][2][5] = {{{NULL}}}; | |
18754 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
18755 | { | |
62e36168 | 18756 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 18757 | { |
18758 | // reduced correlations: | |
18759 | diffFlowCorrelationsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
18760 | if(!diffFlowCorrelationsHistList[t][pe]) | |
18761 | { | |
18762 | cout<<"WARNING: diffFlowCorrelationsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18763 | cout<<"t = "<<t<<endl; | |
18764 | cout<<"pe = "<<pe<<endl; | |
18765 | exit(0); | |
18766 | } | |
18767 | for(Int_t index=0;index<4;index++) | |
18768 | { | |
18769 | diffFlowCorrelationsHist[t][pe][index] = dynamic_cast<TH1D*>(diffFlowCorrelationsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()))); | |
18770 | if(diffFlowCorrelationsHist[t][pe][index]) | |
18771 | { | |
18772 | this->SetDiffFlowCorrelationsHist(diffFlowCorrelationsHist[t][pe][index],t,pe,index); | |
18773 | } else | |
18774 | { | |
18775 | cout<<"WARNING: diffFlowCorrelationsHist[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18776 | cout<<"t = "<<t<<endl; | |
18777 | cout<<"pe = "<<pe<<endl; | |
18778 | cout<<"index = "<<index<<endl; | |
18779 | exit(0); | |
18780 | } | |
18781 | } // end of for(Int_t index=0;index<4;index++) | |
18782 | // corrections: | |
18783 | diffFlowCorrectionsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Histograms with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
18784 | if(!diffFlowCorrectionsHistList[t][pe]) | |
18785 | { | |
18786 | cout<<"WARNING: diffFlowCorrectionsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18787 | cout<<"t = "<<t<<endl; | |
18788 | cout<<"pe = "<<pe<<endl; | |
18789 | exit(0); | |
18790 | } | |
18791 | // correction terms for NUA: | |
18792 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
18793 | { | |
18794 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
18795 | { | |
18796 | diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = dynamic_cast<TH1D*>(diffFlowCorrectionsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1))); | |
18797 | if(diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]) | |
18798 | { | |
18799 | this->SetDiffFlowCorrectionTermsForNUAHist(diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti],t,pe,sc,cti); | |
18800 | } else | |
18801 | { | |
18802 | cout<<"WARNING: diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18803 | cout<<"t = "<<t<<endl; | |
18804 | cout<<"pe = "<<pe<<endl; | |
18805 | cout<<"sc = "<<sc<<endl; | |
18806 | cout<<"cti = "<<cti<<endl; | |
18807 | } | |
18808 | } // end of for(Int_t cti=0;cti<9;cti++) // correction term index | |
18809 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
18810 | // ... | |
18811 | // differential Q-cumulants: | |
18812 | diffFlowCumulantsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Differential Q-cumulants (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
18813 | if(!diffFlowCumulantsHistList[t][pe]) | |
18814 | { | |
18815 | cout<<"WARNING: diffFlowCumulantsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18816 | cout<<"t = "<<t<<endl; | |
18817 | cout<<"pe = "<<pe<<endl; | |
18818 | exit(0); | |
18819 | } | |
18820 | for(Int_t index=0;index<4;index++) | |
18821 | { | |
18822 | diffFlowCumulants[t][pe][index] = dynamic_cast<TH1D*>(diffFlowCumulantsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()))); | |
18823 | if(diffFlowCumulants[t][pe][index]) | |
18824 | { | |
18825 | this->SetDiffFlowCumulants(diffFlowCumulants[t][pe][index],t,pe,index); | |
18826 | } else | |
18827 | { | |
18828 | cout<<"WARNING: diffFlowCumulants[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18829 | cout<<"t = "<<t<<endl; | |
18830 | cout<<"pe = "<<pe<<endl; | |
18831 | cout<<"index = "<<index<<endl; | |
18832 | exit(0); | |
18833 | } | |
18834 | } // end of for(Int_t index=0;index<4;index++) | |
1268c371 | 18835 | // Detector bias to differential Q-cumulants: |
18836 | diffFlowDetectorBiasHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Detector bias (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
18837 | if(!diffFlowDetectorBiasHistList[t][pe]) | |
18838 | { | |
18839 | cout<<"WARNING: diffFlowDetectorBiasHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18840 | cout<<"t = "<<t<<endl; | |
18841 | cout<<"pe = "<<pe<<endl; | |
18842 | exit(0); | |
18843 | } | |
18844 | for(Int_t index=0;index<4;index++) | |
18845 | { | |
18846 | diffFlowDetectorBias[t][pe][index] = dynamic_cast<TH1D*>(diffFlowDetectorBiasHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowDetectorBiasName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()))); | |
18847 | if(diffFlowDetectorBias[t][pe][index]) | |
18848 | { | |
18849 | this->SetDiffFlowDetectorBias(diffFlowDetectorBias[t][pe][index],t,pe,index); | |
18850 | } else | |
18851 | { | |
18852 | cout<<"WARNING: diffFlowDetectorBias[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18853 | cout<<"t = "<<t<<endl; | |
18854 | cout<<"pe = "<<pe<<endl; | |
18855 | cout<<"index = "<<index<<endl; | |
18856 | exit(0); | |
18857 | } | |
18858 | } // end of for(Int_t index=0;index<4;index++) | |
489d5531 | 18859 | // differential flow estimates from Q-cumulants: |
18860 | diffFlowHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Differential flow (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
18861 | if(!diffFlowHistList[t][pe]) | |
18862 | { | |
18863 | cout<<"WARNING: diffFlowHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18864 | cout<<"t = "<<t<<endl; | |
18865 | cout<<"pe = "<<pe<<endl; | |
18866 | exit(0); | |
18867 | } | |
18868 | for(Int_t index=0;index<4;index++) | |
18869 | { | |
18870 | diffFlow[t][pe][index] = dynamic_cast<TH1D*>(diffFlowHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()))); | |
18871 | if(diffFlow[t][pe][index]) | |
18872 | { | |
18873 | this->SetDiffFlow(diffFlow[t][pe][index],t,pe,index); | |
18874 | } else | |
18875 | { | |
18876 | cout<<"WARNING: diffFlow[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18877 | cout<<"t = "<<t<<endl; | |
18878 | cout<<"pe = "<<pe<<endl; | |
18879 | cout<<"index = "<<index<<endl; | |
18880 | exit(0); | |
18881 | } | |
18882 | } // end of for(Int_t index=0;index<4;index++) | |
18883 | // differential covariances: | |
18884 | diffFlowCovariancesHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Covariances of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
18885 | if(!diffFlowCovariancesHistList[t][pe]) | |
18886 | { | |
18887 | cout<<"WARNING: diffFlowCovariancesHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18888 | cout<<"t = "<<t<<endl; | |
18889 | cout<<"pe = "<<pe<<endl; | |
18890 | exit(0); | |
18891 | } | |
18892 | for(Int_t covIndex=0;covIndex<5;covIndex++) | |
18893 | { | |
18894 | diffFlowCovariances[t][pe][covIndex] = dynamic_cast<TH1D*>(diffFlowCovariancesHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()))); | |
18895 | if(diffFlowCovariances[t][pe][covIndex]) | |
18896 | { | |
18897 | this->SetDiffFlowCovariances(diffFlowCovariances[t][pe][covIndex],t,pe,covIndex); | |
18898 | } else | |
18899 | { | |
18900 | cout<<"WARNING: diffFlowCovariances[t][pe][covIndex] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18901 | cout<<"t = "<<t<<endl; | |
18902 | cout<<"pe = "<<pe<<endl; | |
18903 | cout<<"covIndex = "<<covIndex<<endl; | |
18904 | exit(0); | |
18905 | } | |
18906 | } // end of for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index | |
18907 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
18908 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
18909 | // sum of event weights for reduced correlations: | |
18910 | TList *diffFlowSumOfEventWeightsHistList[2][2][2] = {{{NULL}}}; | |
18911 | TString diffFlowSumOfEventWeightsName = "fDiffFlowSumOfEventWeights"; | |
18912 | diffFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
18913 | TH1D *diffFlowSumOfEventWeights[2][2][2][4] = {{{{NULL}}}}; | |
18914 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
18915 | { | |
62e36168 | 18916 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 18917 | { |
18918 | for(Int_t p=0;p<2;p++) // power of event weights is either 1 or 2 | |
18919 | { | |
18920 | diffFlowSumOfEventWeightsHistList[t][pe][p] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Sum of %s event weights (%s, %s)",powerFlag[p].Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
18921 | if(!diffFlowSumOfEventWeightsHistList[t][pe][p]) | |
18922 | { | |
18923 | cout<<"WARNING: diffFlowSumOfEventWeightsHistList[t][pe][p] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18924 | cout<<"t = "<<t<<endl; | |
18925 | cout<<"pe = "<<pe<<endl; | |
18926 | cout<<"power = "<<p<<endl; | |
18927 | exit(0); | |
18928 | } | |
18929 | for(Int_t ew=0;ew<4;ew++) // index of reduced correlation | |
18930 | { | |
18931 | diffFlowSumOfEventWeights[t][pe][p][ew] = dynamic_cast<TH1D*>(diffFlowSumOfEventWeightsHistList[t][pe][p]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()))); | |
18932 | if(diffFlowSumOfEventWeights[t][pe][p][ew]) | |
18933 | { | |
18934 | this->SetDiffFlowSumOfEventWeights(diffFlowSumOfEventWeights[t][pe][p][ew],t,pe,p,ew); | |
18935 | } else | |
18936 | { | |
18937 | cout<<"WARNING: diffFlowSumOfEventWeights[t][pe][p][ew] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18938 | cout<<"t = "<<t<<endl; | |
18939 | cout<<"pe = "<<pe<<endl; | |
18940 | cout<<"power = "<<p<<endl; | |
18941 | cout<<"ew = "<<ew<<endl; | |
18942 | exit(0); | |
18943 | } | |
18944 | } | |
18945 | } // end of for(Int_t p=0;p<2;p++) // power of event weights is either 1 or 2 | |
18946 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
18947 | } // end of for(Int_t t=0;t<2;t++) // type is RP or POI | |
18948 | // | |
18949 | TList *diffFlowSumOfProductOfEventWeightsHistList[2][2] = {{NULL}}; | |
18950 | TString diffFlowSumOfProductOfEventWeightsName = "fDiffFlowSumOfProductOfEventWeights"; | |
18951 | diffFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
18952 | TH1D *diffFlowSumOfProductOfEventWeights[2][2][8][8] = {{{{NULL}}}}; | |
18953 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
18954 | { | |
62e36168 | 18955 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 18956 | { |
18957 | diffFlowSumOfProductOfEventWeightsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Sum of products of event weights (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
18958 | if(!diffFlowSumOfProductOfEventWeightsHistList[t][pe]) | |
18959 | { | |
18960 | cout<<"WARNING: diffFlowSumOfProductOfEventWeightsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18961 | cout<<"t = "<<t<<endl; | |
18962 | cout<<"pe = "<<pe<<endl; | |
18963 | exit(0); | |
18964 | } | |
18965 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
18966 | { | |
18967 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
18968 | { | |
18969 | diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = dynamic_cast<TH1D*>(diffFlowSumOfProductOfEventWeightsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()))); | |
18970 | if(diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]) | |
18971 | { | |
18972 | this->SetDiffFlowSumOfProductOfEventWeights(diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2],t,pe,mci1,mci2); | |
18973 | } else | |
18974 | { | |
18975 | cout<<"WARNING: diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
18976 | cout<<"t = "<<t<<endl; | |
18977 | cout<<"pe = "<<pe<<endl; | |
18978 | cout<<"mci1 = "<<mci1<<endl; | |
18979 | cout<<"mci2 = "<<mci2<<endl; | |
18980 | exit(0); | |
18981 | } | |
18982 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
18983 | } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
18984 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
18985 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
18986 | } // end of for(Int_t t=0;t<2;t++) // type is RP or POI | |
18987 | ||
18988 | } // end void AliFlowAnalysisWithQCumulants::GetPointersForDiffFlowHistograms() | |
18989 | ||
e1d101a6 | 18990 | //======================================================================================================================= |
489d5531 | 18991 | |
1268c371 | 18992 | void AliFlowAnalysisWithQCumulants::BookEverythingFor2DDifferentialFlow() |
18993 | { | |
18994 | // Book all objects needed for 2D differential flow. | |
18995 | // a) Define flags locally (to be improved: should I promote flags to data members?); | |
18996 | // b) Book e-b-e quantities; | |
18997 | // c) Book 2D profiles; | |
18998 | // d) Book 2D histograms. | |
18999 | ||
19000 | if(!fCalculate2DDiffFlow){return;} | |
19001 | ||
19002 | // a) Define flags locally (to be improved: should I promote flags to data members?): | |
19003 | TString typeFlag[2] = {"RP","POI"}; | |
19004 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
19005 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
19006 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
19007 | ||
19008 | // b) Book e-b-e quantities: | |
19009 | TProfile2D styleRe("typeMultiplePowerRe","typeMultiplePowerRe",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
19010 | TProfile2D styleIm("typeMultiplePowerIm","typeMultiplePowerIm",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
19011 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) | |
19012 | { | |
19013 | for(Int_t m=0;m<4;m++) | |
19014 | { | |
19015 | for(Int_t k=0;k<9;k++) | |
19016 | { | |
19017 | fReRPQ2dEBE[t][m][k] = (TProfile2D*)styleRe.Clone(Form("typeFlag%dmultiple%dpower%dRe",t,m,k)); | |
19018 | fImRPQ2dEBE[t][m][k] = (TProfile2D*)styleIm.Clone(Form("typeFlag%dmultiple%dpower%dIm",t,m,k)); | |
19019 | } | |
19020 | } | |
19021 | } | |
19022 | TProfile2D styleS("typePower","typePower",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
19023 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) | |
19024 | { | |
19025 | for(Int_t k=0;k<9;k++) | |
19026 | { | |
19027 | fs2dEBE[t][k] = (TProfile2D*)styleS.Clone(Form("typeFlag%dpower%d",t,k)); | |
19028 | } | |
19029 | } | |
19030 | ||
19031 | // c) Book 2D profiles: | |
19032 | TString s2DDiffFlowCorrelationsProName = "f2DDiffFlowCorrelationsPro"; | |
19033 | s2DDiffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
19034 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
19035 | { | |
19036 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
19037 | { | |
19038 | f2DDiffFlowCorrelationsPro[t][rci] = new TProfile2D(Form("%s, %s, %s",s2DDiffFlowCorrelationsProName.Data(),typeFlag[t].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s",s2DDiffFlowCorrelationsProName.Data(),typeFlag[t].Data(),reducedCorrelationIndex[rci].Data()),fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,""); | |
19039 | f2DDiffFlowCorrelationsPro[t][rci]->Sumw2(); | |
19040 | f2DDiffFlowCorrelationsPro[t][rci]->SetXTitle("p_{t}"); | |
19041 | f2DDiffFlowCorrelationsPro[t][rci]->SetYTitle("#eta"); | |
19042 | f2DDiffFlowCorrelationsProList[t]->Add(f2DDiffFlowCorrelationsPro[t][rci]); | |
19043 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
19044 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POIs | |
19045 | ||
19046 | // d) Book 2D histograms: | |
19047 | TString s2DDiffFlowCumulantsName = "f2DDiffFlowCumulants"; | |
19048 | s2DDiffFlowCumulantsName += fAnalysisLabel->Data(); | |
19049 | TString s2DDiffFlowName = "f2DDiffFlow"; | |
19050 | s2DDiffFlowName += fAnalysisLabel->Data(); | |
19051 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
19052 | { | |
19053 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
19054 | { | |
19055 | // 2D diferential cumulants: | |
19056 | f2DDiffFlowCumulants[t][rci] = new TH2D(Form("%s, %s, %s",s2DDiffFlowCumulantsName.Data(),typeFlag[t].Data(),differentialCumulantIndex[rci].Data()),Form("%s, %s, %s",s2DDiffFlowCumulantsName.Data(),typeFlag[t].Data(),differentialCumulantIndex[rci].Data()),fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
19057 | f2DDiffFlowCumulants[t][rci]->SetXTitle("p_{t}"); | |
19058 | f2DDiffFlowCumulants[t][rci]->SetYTitle("#eta"); | |
19059 | f2DDiffFlowCorrelationsProList[t]->Add(f2DDiffFlowCumulants[t][rci]); // to be improved - moved to another list | |
19060 | // 2D differential flow: | |
19061 | f2DDiffFlow[t][rci] = new TH2D(Form("%s, %s, %s",s2DDiffFlowName.Data(),typeFlag[t].Data(),differentialFlowIndex[rci].Data()),Form("%s, %s, %s",s2DDiffFlowName.Data(),typeFlag[t].Data(),differentialFlowIndex[rci].Data()),fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
19062 | f2DDiffFlow[t][rci]->SetXTitle("p_{t}"); | |
19063 | f2DDiffFlow[t][rci]->SetYTitle("#eta"); | |
19064 | f2DDiffFlowCorrelationsProList[t]->Add(f2DDiffFlow[t][rci]); // to be improved - moved to another list | |
19065 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
19066 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POIs | |
19067 | ||
19068 | } // void AliFlowAnalysisWithQCumulants::BookEverythingFor2DDifferentialFlow() | |
19069 | ||
e1d101a6 | 19070 | //======================================================================================================================= |
489d5531 | 19071 | |
19072 | void AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow() | |
19073 | { | |
19074 | // Book all histograms and profiles needed for differential flow. | |
1268c371 | 19075 | // a) Book profile to hold all flags for differential flow; |
19076 | // b) Define flags locally (to be improved: should I promote flags to data members?); | |
489d5531 | 19077 | // c) Book e-b-e quantities; |
19078 | // d) Book profiles; | |
19079 | // e) Book histograms holding final results. | |
19080 | ||
1268c371 | 19081 | // a) Book profile to hold all flags for differential flow: |
19082 | TString diffFlowFlagsName = "fDiffFlowFlags"; | |
19083 | diffFlowFlagsName += fAnalysisLabel->Data(); | |
62e36168 | 19084 | fDiffFlowFlags = new TProfile(diffFlowFlagsName.Data(),"Flags for differential flow",6,0,6); |
1268c371 | 19085 | fDiffFlowFlags->SetTickLength(-0.01,"Y"); |
19086 | fDiffFlowFlags->SetMarkerStyle(25); | |
19087 | fDiffFlowFlags->SetLabelSize(0.04,"X"); | |
19088 | fDiffFlowFlags->SetLabelOffset(0.02,"Y"); | |
e1d101a6 | 19089 | fDiffFlowFlags->SetStats(kFALSE); |
1268c371 | 19090 | fDiffFlowFlags->GetXaxis()->SetBinLabel(1,"Calculate diff. flow"); |
19091 | fDiffFlowFlags->GetXaxis()->SetBinLabel(2,"Particle weights"); | |
19092 | fDiffFlowFlags->GetXaxis()->SetBinLabel(3,"Event weights"); | |
19093 | fDiffFlowFlags->GetXaxis()->SetBinLabel(4,"Correct for NUA"); | |
19094 | fDiffFlowFlags->GetXaxis()->SetBinLabel(5,"Calculate 2D diff. flow"); | |
62e36168 | 19095 | fDiffFlowFlags->GetXaxis()->SetBinLabel(6,"Calculate diff. flow vs eta"); |
1268c371 | 19096 | fDiffFlowList->Add(fDiffFlowFlags); |
19097 | ||
19098 | if(!fCalculateDiffFlow){return;} | |
19099 | ||
19100 | // b) Define flags locally (to be improved: should I promote flags to data members?): | |
489d5531 | 19101 | TString typeFlag[2] = {"RP","POI"}; |
19102 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
19103 | TString powerFlag[2] = {"linear","quadratic"}; | |
19104 | TString sinCosFlag[2] = {"sin","cos"}; | |
19105 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
19106 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
19107 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
b40a910e | 19108 | TString reducedSquaredCorrelationIndex[4] = {"<2'>^{2}","<4'>^{2}","<6'>^{2}","<8'>^{2}"}; |
489d5531 | 19109 | TString mixedCorrelationIndex[8] = {"<2>","<2'>","<4>","<4'>","<6>","<6'>","<8>","<8'>"}; |
19110 | TString covarianceName[5] = {"Cov(<2>,<2'>)","Cov(<2>,<4'>)","Cov(<4>,<2'>)","Cov(<4>,<4'>)","Cov(<2'>,<4'>)"}; | |
19111 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
19112 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
19113 | Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
1268c371 | 19114 | |
489d5531 | 19115 | // c) Book e-b-e quantities: |
19116 | // Event-by-event r_{m*n,k}(pt,eta), p_{m*n,k}(pt,eta) and q_{m*n,k}(pt,eta) | |
19117 | // Explanantion of notation: | |
19118 | // 1.) n is harmonic, m is multiple of harmonic; | |
19119 | // 2.) k is power of particle weight; | |
19120 | // 3.) r_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for RPs in particular (pt,eta) bin (i-th RP is weighted with w_i^k); | |
19121 | // 4.) p_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for POIs in particular (pt,eta) bin | |
19122 | // (if i-th POI is also RP, than it is weighted with w_i^k); | |
19123 | // 5.) q_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for particles which are both RPs and POIs in particular (pt,eta) bin | |
19124 | // (i-th RP&&POI is weighted with w_i^k) | |
19125 | ||
19126 | // 1D: | |
19127 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP && POI ) | |
19128 | { | |
62e36168 | 19129 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 19130 | { |
19131 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
19132 | { | |
19133 | for(Int_t k=0;k<9;k++) // power of particle weight | |
19134 | { | |
19135 | fReRPQ1dEBE[t][pe][m][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%dpower%dRe",t,pe,m,k), | |
19136 | Form("TypeFlag%dpteta%dmultiple%dpower%dRe",t,pe,m,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
19137 | fImRPQ1dEBE[t][pe][m][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%dpower%dIm",t,pe,m,k), | |
19138 | Form("TypeFlag%dpteta%dmultiple%dpower%dIm",t,pe,m,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
19139 | } | |
19140 | } | |
19141 | } | |
19142 | } | |
19143 | // to be improved (add explanation of fs1dEBE[t][pe][k]): | |
19144 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) | |
19145 | { | |
62e36168 | 19146 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 19147 | { |
19148 | for(Int_t k=0;k<9;k++) // power of particle weight | |
19149 | { | |
19150 | fs1dEBE[t][pe][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%d",t,pe,k), | |
19151 | Form("TypeFlag%dpteta%dmultiple%d",t,pe,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
19152 | } | |
19153 | } | |
19154 | } | |
19155 | // correction terms for nua: | |
19156 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
19157 | { | |
62e36168 | 19158 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 19159 | { |
19160 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
19161 | { | |
19162 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
19163 | { | |
19164 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti] = new TH1D(Form("typeFlag%d pteta%d sincos%d cti%d",t,pe,sc,cti), | |
19165 | Form("typeFlag%d pteta%d sincos%d cti%d",t,pe,sc,cti),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
19166 | } | |
19167 | } | |
19168 | } | |
19169 | } | |
489d5531 | 19170 | // reduced correlations e-b-e: |
19171 | TString diffFlowCorrelationsEBEName = "fDiffFlowCorrelationsEBE"; | |
19172 | diffFlowCorrelationsEBEName += fAnalysisLabel->Data(); | |
19173 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
19174 | { | |
62e36168 | 19175 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 19176 | { |
19177 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
19178 | { | |
19179 | fDiffFlowCorrelationsEBE[t][pe][rci] = new TH1D(Form("%s, %s, %s, %s",diffFlowCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
19180 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
19181 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
19182 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
19183 | // event weights for reduced correlations e-b-e: | |
19184 | TString diffFlowEventWeightsForCorrelationsEBEName = "fDiffFlowEventWeightsForCorrelationsEBE"; | |
19185 | diffFlowEventWeightsForCorrelationsEBEName += fAnalysisLabel->Data(); | |
19186 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
19187 | { | |
62e36168 | 19188 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 19189 | { |
19190 | for(Int_t rci=0;rci<4;rci++) // event weight for reduced correlation index | |
19191 | { | |
19192 | fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci] = new TH1D(Form("%s, %s, %s, eW for %s",diffFlowEventWeightsForCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, eW for %s",diffFlowEventWeightsForCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
19193 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
19194 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
19195 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
19196 | ||
19197 | // d) Book profiles; | |
19198 | // reduced correlations: | |
19199 | TString diffFlowCorrelationsProName = "fDiffFlowCorrelationsPro"; | |
19200 | diffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
b40a910e | 19201 | // reduced squared correlations: |
19202 | TString diffFlowSquaredCorrelationsProName = "fDiffFlowSquaredCorrelationsPro"; | |
19203 | diffFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
489d5531 | 19204 | // corrections terms: |
19205 | TString diffFlowCorrectionTermsForNUAProName = "fDiffFlowCorrectionTermsForNUAPro"; | |
19206 | diffFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
b40a910e | 19207 | // reduced correlations: |
489d5531 | 19208 | for(Int_t t=0;t<2;t++) // type: RP or POI |
19209 | { | |
62e36168 | 19210 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 19211 | { |
19212 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
19213 | { | |
489d5531 | 19214 | fDiffFlowCorrelationsPro[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe],"s"); |
b40a910e | 19215 | fDiffFlowCorrelationsPro[t][pe][rci]->Sumw2(); |
489d5531 | 19216 | fDiffFlowCorrelationsPro[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data()); |
19217 | fDiffFlowCorrelationsProList[t][pe]->Add(fDiffFlowCorrelationsPro[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations) | |
19218 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
19219 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
19220 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
b40a910e | 19221 | // reduced squared correlations: |
19222 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
19223 | { | |
62e36168 | 19224 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
b40a910e | 19225 | { |
19226 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
19227 | { | |
19228 | fDiffFlowSquaredCorrelationsPro[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowSquaredCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedSquaredCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowSquaredCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedSquaredCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe],"s"); | |
19229 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->Sumw2(); | |
19230 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data()); | |
19231 | fDiffFlowCorrelationsProList[t][pe]->Add(fDiffFlowSquaredCorrelationsPro[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations) | |
19232 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
19233 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
19234 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
489d5531 | 19235 | // correction terms for nua: |
19236 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
19237 | { | |
62e36168 | 19238 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 19239 | { |
19240 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
19241 | { | |
19242 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
19243 | { | |
19244 | fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = new TProfile(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
19245 | fDiffFlowCorrectionsProList[t][pe]->Add(fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]); | |
19246 | } | |
19247 | } | |
19248 | } | |
19249 | } | |
64e500e3 | 19250 | // Other differential correlators: |
19251 | TString otherDiffCorrelatorsName = "fOtherDiffCorrelators"; | |
19252 | otherDiffCorrelatorsName += fAnalysisLabel->Data(); | |
19253 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
19254 | { | |
62e36168 | 19255 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
64e500e3 | 19256 | { |
19257 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
19258 | { | |
19259 | for(Int_t ci=0;ci<1;ci++) // correlator index | |
19260 | { | |
19261 | fOtherDiffCorrelators[t][pe][sc][ci] = new TProfile(Form("%s, %s, %s, %s, ci = %d",otherDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1),Form("%s, %s, %s, %s, ci = %d",otherDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
19262 | fOtherDiffCorrelators[t][pe][sc][ci]->Sumw2(); | |
19263 | fOtherDiffCorrelatorsList->Add(fOtherDiffCorrelators[t][pe][sc][ci]); | |
19264 | } | |
19265 | } | |
19266 | } | |
19267 | } | |
489d5531 | 19268 | // e) Book histograms holding final results. |
19269 | // reduced correlations: | |
19270 | TString diffFlowCorrelationsHistName = "fDiffFlowCorrelationsHist"; | |
19271 | diffFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
19272 | // corrections terms: | |
19273 | TString diffFlowCorrectionTermsForNUAHistName = "fDiffFlowCorrectionTermsForNUAHist"; | |
19274 | diffFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
19275 | // differential covariances: | |
19276 | TString diffFlowCovariancesName = "fDiffFlowCovariances"; | |
19277 | diffFlowCovariancesName += fAnalysisLabel->Data(); | |
19278 | // differential Q-cumulants: | |
19279 | TString diffFlowCumulantsName = "fDiffFlowCumulants"; | |
19280 | diffFlowCumulantsName += fAnalysisLabel->Data(); | |
1268c371 | 19281 | // Detector bias to differential Q-cumulants: |
19282 | TString diffFlowDetectorBiasName = "fDiffFlowDetectorBias"; | |
19283 | diffFlowDetectorBiasName += fAnalysisLabel->Data(); | |
489d5531 | 19284 | // differential flow: |
19285 | TString diffFlowName = "fDiffFlow"; | |
19286 | diffFlowName += fAnalysisLabel->Data(); | |
19287 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
19288 | { | |
62e36168 | 19289 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 19290 | { |
19291 | for(Int_t index=0;index<4;index++) | |
19292 | { | |
19293 | // reduced correlations: | |
19294 | fDiffFlowCorrelationsHist[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
19295 | fDiffFlowCorrelationsHist[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
19296 | fDiffFlowCorrelationsHistList[t][pe]->Add(fDiffFlowCorrelationsHist[t][pe][index]); | |
19297 | // differential Q-cumulants: | |
19298 | fDiffFlowCumulants[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
19299 | fDiffFlowCumulants[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
19300 | fDiffFlowCumulantsHistList[t][pe]->Add(fDiffFlowCumulants[t][pe][index]); | |
1268c371 | 19301 | // Detector bias to differential Q-cumulants: |
19302 | fDiffFlowDetectorBias[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowDetectorBiasName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowDetectorBiasName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
19303 | fDiffFlowDetectorBias[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
19304 | fDiffFlowDetectorBias[t][pe][index]->SetTitle(Form("#frac{corrected}{measured} %s",differentialCumulantIndex[index].Data())); | |
19305 | fDiffFlowDetectorBiasHistList[t][pe]->Add(fDiffFlowDetectorBias[t][pe][index]); | |
489d5531 | 19306 | // differential flow estimates from Q-cumulants: |
19307 | fDiffFlow[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
19308 | fDiffFlow[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
19309 | fDiffFlowHistList[t][pe]->Add(fDiffFlow[t][pe][index]); | |
19310 | } // end of for(Int_t index=0;index<4;index++) | |
19311 | for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index | |
19312 | { | |
19313 | // differential covariances: | |
19314 | fDiffFlowCovariances[t][pe][covIndex] = new TH1D(Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()),Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
19315 | fDiffFlowCovariances[t][pe][covIndex]->SetXTitle(ptEtaFlag[pe].Data()); | |
19316 | fDiffFlowCovariancesHistList[t][pe]->Add(fDiffFlowCovariances[t][pe][covIndex]); | |
19317 | } // end of for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index | |
19318 | // products of both types of correlations: | |
19319 | TString diffFlowProductOfCorrelationsProName = "fDiffFlowProductOfCorrelationsPro"; | |
19320 | diffFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
19321 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
19322 | { | |
19323 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
19324 | { | |
19325 | fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = new TProfile(Form("%s, %s, %s, %s, %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),Form("%s, %s, %s, %s #times %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
19326 | fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]->SetXTitle(ptEtaFlag[pe].Data()); | |
19327 | fDiffFlowProductOfCorrelationsProList[t][pe]->Add(fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]); | |
19328 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
19329 | } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
19330 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
19331 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
19332 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
19333 | // sums of event weights for reduced correlations: | |
19334 | TString diffFlowSumOfEventWeightsName = "fDiffFlowSumOfEventWeights"; | |
19335 | diffFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
19336 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
19337 | { | |
62e36168 | 19338 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 19339 | { |
19340 | for(Int_t p=0;p<2;p++) // power of weights is either 1 or 2 | |
19341 | { | |
19342 | for(Int_t ew=0;ew<4;ew++) // index of reduced correlation | |
19343 | { | |
19344 | fDiffFlowSumOfEventWeights[t][pe][p][ew] = new TH1D(Form("%s, %s, %s, %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()),Form("%s, %s, %s, power = %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
19345 | fDiffFlowSumOfEventWeights[t][pe][p][ew]->SetXTitle(ptEtaFlag[pe].Data()); | |
19346 | fDiffFlowSumOfEventWeightsHistList[t][pe][p]->Add(fDiffFlowSumOfEventWeights[t][pe][p][ew]); // to be improved (add dedicated list to hold all this) | |
19347 | } | |
19348 | } | |
19349 | } | |
19350 | } | |
19351 | // sum of products of event weights for both types of correlations: | |
19352 | TString diffFlowSumOfProductOfEventWeightsName = "fDiffFlowSumOfProductOfEventWeights"; | |
19353 | diffFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
19354 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
19355 | { | |
62e36168 | 19356 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 19357 | { |
19358 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
19359 | { | |
19360 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
19361 | { | |
19362 | fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = new TH1D(Form("%s, %s, %s, %s, %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),Form("%s, %s, %s, %s #times %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
19363 | fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]->SetXTitle(ptEtaFlag[pe].Data()); | |
19364 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]->Add(fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]); | |
19365 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
19366 | } | |
19367 | } | |
19368 | } | |
19369 | } | |
19370 | // correction terms for nua: | |
19371 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
19372 | { | |
62e36168 | 19373 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 19374 | { |
19375 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
19376 | { | |
19377 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
19378 | { | |
19379 | fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = new TH1D(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
19380 | fDiffFlowCorrectionsHistList[t][pe]->Add(fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]); | |
19381 | } | |
19382 | } | |
19383 | } | |
19384 | } | |
19385 | ||
19386 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow() | |
19387 | ||
e1d101a6 | 19388 | //======================================================================================================================= |
489d5531 | 19389 | |
489d5531 | 19390 | void AliFlowAnalysisWithQCumulants::CalculateQcumulantsCorrectedForNUAIntFlow() |
19391 | { | |
19392 | // Calculate generalized Q-cumulants (cumulants corrected for non-unifom acceptance). | |
19393 | ||
b92ea2b9 | 19394 | // Isotropic cumulants: |
53884472 | 19395 | Double_t QC2 = fIntFlowQcumulants->GetBinContent(1); |
19396 | Double_t QC2Error = fIntFlowQcumulants->GetBinError(1); | |
19397 | Double_t QC4 = fIntFlowQcumulants->GetBinContent(2); | |
19398 | Double_t QC4Error = fIntFlowQcumulants->GetBinError(2); | |
19399 | //Double_t QC6 = fIntFlowQcumulants->GetBinContent(3); | |
19400 | //Double_t QC6Error = fIntFlowQcumulants->GetBinError(3); | |
19401 | //Double_t QC8 = fIntFlowQcumulants->GetBinContent(4); | |
19402 | //Double_t QC8Error = fIntFlowQcumulants->GetBinError(4); | |
b92ea2b9 | 19403 | |
19404 | // Measured 2-, 4-, 6- and 8-particle correlations: | |
489d5531 | 19405 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> |
b92ea2b9 | 19406 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <<2>> |
489d5531 | 19407 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> |
b92ea2b9 | 19408 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <<4>> |
489d5531 | 19409 | //Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> |
489d5531 | 19410 | //Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <<6>> |
b92ea2b9 | 19411 | //Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> |
489d5531 | 19412 | //Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <<8>> |
b92ea2b9 | 19413 | |
19414 | // Non-isotropic terms: | |
19415 | Double_t c1 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1); // <<cos(n*phi1)>> | |
19416 | Double_t c1Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(1); // statistical error of <<cos(n*phi1)>> | |
19417 | Double_t c2 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2); // <<cos(n*(phi1+phi2))>> | |
19418 | Double_t c2Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(2); // statistical error of <<cos(n*(phi1+phi2))>> | |
19419 | Double_t c3 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(3); // <<cos(n*(phi1-phi2-phi3))>> | |
19420 | Double_t c3Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(3); // statistical error of <<cos(n*(phi1-phi2-phi3))>> | |
19421 | Double_t s1 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1); // <<sin(n*phi1)>> | |
19422 | Double_t s1Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(1); // statistical error of <<sin(n*phi1)>> | |
19423 | Double_t s2 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2); // <<sin(n*(phi1+phi2))>> | |
19424 | Double_t s2Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(2); // statistical error of <<sin(n*(phi1+phi2))>> | |
19425 | Double_t s3 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(3); // <<sin(n*(phi1-phi2-phi3))>> | |
19426 | Double_t s3Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(3); // statistical error of <<sin(n*(phi1-phi2-phi3))>> | |
19427 | ||
19428 | // Shortcuts: | |
19429 | Double_t a1 = 2.*pow(c1,2.)+2.*pow(s1,2.)-two; | |
19430 | Double_t a2 = 6.*pow(c1,3.)-2.*c1*c2+c3+6.*c1*pow(s1,2.)-2.*s1*s2-4.*c1*two; | |
19431 | Double_t a3 = 2.*pow(s1,2.)-2.*pow(c1,2.)+c2; | |
19432 | Double_t a4 = 6.*pow(s1,3.)+6.*pow(c1,2.)*s1+2.*c2*s1-2.*c1*s2-s3-4.*s1*two; | |
19433 | Double_t a5 = 4.*c1*s1-s2; | |
19434 | ||
19435 | // Covariances (including weight dependent prefactor): | |
8e1cefdd | 19436 | Double_t wCov1 = 0.; // w*Cov(<2>,<cos(phi)) |
19437 | Double_t wCov2 = 0.; // w*Cov(<2>,<sin(phi)) | |
19438 | Double_t wCov3 = 0.; // w*Cov(<cos(phi),<sin(phi)) | |
19439 | Double_t wCov4 = 0.; // w*Cov(<2>,<4>) | |
19440 | Double_t wCov5 = 0.; // w*Cov(<2>,<cos(#phi_{1}+#phi_{2})>) | |
19441 | Double_t wCov6 = 0.; // w*Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19442 | Double_t wCov7 = 0.; // w*Cov(<2>,<sin(#phi_{1}+#phi_{2})>) | |
19443 | Double_t wCov8 = 0.; // w*Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19444 | Double_t wCov9 = 0.; // w*Cov(<4>,<cos(#phi)> | |
19445 | Double_t wCov10 = 0.; // w*Cov(<4>,<cos(#phi_{1}+#phi_{2})>) | |
19446 | Double_t wCov11 = 0.; // w*Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19447 | Double_t wCov12 = 0.; // w*Cov(<4>,<sin(#phi)> | |
19448 | Double_t wCov13 = 0.; // w*Cov(<4>,<sin(#phi_{1}+#phi_{2})>) | |
19449 | Double_t wCov14 = 0.; // w*Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19450 | Double_t wCov15 = 0.; // w*Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
19451 | Double_t wCov16 = 0.; // w*Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19452 | Double_t wCov17 = 0.; // w*Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
19453 | Double_t wCov18 = 0.; // w*Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19454 | Double_t wCov19 = 0.; // w*Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19455 | Double_t wCov20 = 0.; // w*Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
19456 | Double_t wCov21 = 0.; // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>) | |
19457 | Double_t wCov22 = 0.; // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19458 | Double_t wCov23 = 0.; // w*Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19459 | Double_t wCov24 = 0.; // w*Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19460 | Double_t wCov25 = 0.; // w*Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>) | |
19461 | Double_t wCov26 = 0.; // w*Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
19462 | Double_t wCov27 = 0.; // w*Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19463 | Double_t wCov28 = 0.; // w*Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19464 | if(!fForgetAboutCovariances) | |
19465 | { | |
19466 | wCov1 = fIntFlowCovariancesNUA->GetBinContent(1); // w*Cov(<2>,<cos(phi)) | |
19467 | wCov2 = fIntFlowCovariancesNUA->GetBinContent(2); // w*Cov(<2>,<sin(phi)) | |
19468 | wCov3 = fIntFlowCovariancesNUA->GetBinContent(3); // w*Cov(<cos(phi),<sin(phi)) | |
19469 | wCov4 = fIntFlowCovariances->GetBinContent(1); // w*Cov(<2>,<4>) | |
19470 | wCov5 = fIntFlowCovariancesNUA->GetBinContent(4); // w*Cov(<2>,<cos(#phi_{1}+#phi_{2})>) | |
19471 | wCov6 = fIntFlowCovariancesNUA->GetBinContent(6); // w*Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19472 | wCov7 = fIntFlowCovariancesNUA->GetBinContent(5); // w*Cov(<2>,<sin(#phi_{1}+#phi_{2})>) | |
19473 | wCov8 = fIntFlowCovariancesNUA->GetBinContent(7); // w*Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19474 | wCov9 = fIntFlowCovariancesNUA->GetBinContent(8); // w*Cov(<4>,<cos(#phi)> | |
19475 | wCov10 = fIntFlowCovariancesNUA->GetBinContent(10); // w*Cov(<4>,<cos(#phi_{1}+#phi_{2})>) | |
19476 | wCov11 = fIntFlowCovariancesNUA->GetBinContent(12); // w*Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19477 | wCov12 = fIntFlowCovariancesNUA->GetBinContent(9); // w*Cov(<4>,<sin(#phi)> | |
19478 | wCov13 = fIntFlowCovariancesNUA->GetBinContent(11); // w*Cov(<4>,<sin(#phi_{1}+#phi_{2})>) | |
19479 | wCov14 = fIntFlowCovariancesNUA->GetBinContent(13); // w*Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19480 | wCov15 = fIntFlowCovariancesNUA->GetBinContent(14); // w*Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
19481 | wCov16 = fIntFlowCovariancesNUA->GetBinContent(16); // w*Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19482 | wCov17 = fIntFlowCovariancesNUA->GetBinContent(15); // w*Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
19483 | wCov18 = fIntFlowCovariancesNUA->GetBinContent(17); // w*Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19484 | wCov19 = fIntFlowCovariancesNUA->GetBinContent(23); // w*Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19485 | wCov20 = fIntFlowCovariancesNUA->GetBinContent(18); // w*Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
19486 | wCov21 = fIntFlowCovariancesNUA->GetBinContent(22); // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>) | |
19487 | wCov22 = fIntFlowCovariancesNUA->GetBinContent(24); // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19488 | wCov23 = fIntFlowCovariancesNUA->GetBinContent(20); // w*Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19489 | wCov24 = fIntFlowCovariancesNUA->GetBinContent(25); // w*Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19490 | wCov25 = fIntFlowCovariancesNUA->GetBinContent(27); // w*Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>) | |
19491 | wCov26 = fIntFlowCovariancesNUA->GetBinContent(19); // w*Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
19492 | wCov27 = fIntFlowCovariancesNUA->GetBinContent(21); // w*Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19493 | wCov28 = fIntFlowCovariancesNUA->GetBinContent(26); // w*Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
19494 | } // end of if(!fForgetAboutCovariances) | |
19495 | ||
b92ea2b9 | 19496 | // Calculating generalized QC{2}: |
19497 | // Generalized QC{2}: | |
19498 | Double_t gQC2 = two - pow(c1,2.) - pow(s1,2.); | |
19499 | if(fApplyCorrectionForNUA){fIntFlowQcumulants->SetBinContent(1,gQC2);} | |
19500 | // Statistical error of generalized QC{2}: | |
19501 | Double_t gQC2ErrorSquared = pow(twoError,2.)+4.*pow(c1,2.)*pow(c1Error,2.) | |
19502 | + 4.*pow(s1,2.)*pow(s1Error,2.) | |
19503 | - 4*c1*wCov1-4*s1*wCov2 | |
19504 | + 8.*c1*s1*wCov3; | |
19505 | // Store ratio of error squared - with/without NUA terms: | |
19506 | Double_t ratioErrorSquaredQC2 = 0.; | |
19507 | if(fIntFlowQcumulants->GetBinError(1)>0.) | |
19508 | { | |
19509 | ratioErrorSquaredQC2 = (gQC2ErrorSquared/pow(fIntFlowQcumulants->GetBinError(1),2.)); | |
19510 | fIntFlowQcumulantsErrorSquaredRatio->SetBinContent(1,ratioErrorSquaredQC2); | |
19511 | } | |
19512 | // If enabled, store error by including non-isotropic terms: | |
b77b6434 | 19513 | if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 19514 | { |
19515 | if(gQC2ErrorSquared>=0.) | |
19516 | { | |
19517 | fIntFlowQcumulants->SetBinError(1,pow(gQC2ErrorSquared,0.5)); | |
19518 | } else | |
19519 | { | |
19520 | fIntFlowQcumulants->SetBinError(1,0.); | |
19521 | cout<<endl; | |
19522 | cout<<" WARNING (QC): Statistical error of generalized QC{2} is imaginary !!!!"<<endl; | |
19523 | cout<<endl; | |
19524 | } | |
b77b6434 | 19525 | } // end of if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 19526 | // Quantify detector bias to QC{2}: |
53884472 | 19527 | if(TMath::Abs(QC2)>0.) |
b92ea2b9 | 19528 | { |
53884472 | 19529 | fIntFlowDetectorBias->SetBinContent(1,gQC2/QC2); |
19530 | if(QC2Error>0.) | |
b92ea2b9 | 19531 | { |
53884472 | 19532 | Double_t errorSquared = gQC2ErrorSquared/pow(QC2,2.)+pow(gQC2,2.)*pow(QC2Error,2.)/pow(QC2,4.); |
b92ea2b9 | 19533 | if(errorSquared>0.) |
19534 | { | |
19535 | fIntFlowDetectorBias->SetBinError(1,pow(errorSquared,0.5)); | |
19536 | } | |
19537 | } | |
53884472 | 19538 | } // end of if(TMath::Abs(QC2)>0.) |
b92ea2b9 | 19539 | |
19540 | // Calculating generalized QC{4}: | |
19541 | // Generalized QC{4}: | |
19542 | Double_t gQC4 = four-2.*pow(two,2.) | |
19543 | - 4.*c1*c3+4.*s1*s3-pow(c2,2.)-pow(s2,2.) | |
19544 | + 4.*c2*(pow(c1,2.)-pow(s1,2.))+8.*s2*s1*c1 | |
19545 | + 8.*two*(pow(c1,2.)+pow(s1,2.))-6.*pow((pow(c1,2.)+pow(s1,2.)),2.); | |
19546 | if(fApplyCorrectionForNUA){fIntFlowQcumulants->SetBinContent(2,gQC4);} | |
19547 | // Statistical error of generalized QC{4}: | |
19548 | Double_t gQC4ErrorSquared = 16.*pow(a1,2.)*pow(twoError,2.)+pow(fourError,2.)+16.*pow(a2,2.)*pow(c1Error,2.) | |
19549 | + 4.*pow(a3,2.)*pow(c2Error,2.)+16.*pow(c1,2.)*pow(c3Error,2.) | |
19550 | + 16.*pow(a4,2.)*pow(s1Error,2.)+4.*pow(a5,2.)*pow(s2Error,2.) | |
19551 | + 16.*pow(s1,2.)*pow(s3Error,2.)+8.*a1*wCov4-32.*a1*a2*wCov1 | |
19552 | - 16.*a3*a1*wCov5-32.*c1*a1*wCov6-32.*a1*a4*wCov2+16.*a5*a1*wCov7 | |
19553 | + 32.*s1*a1*wCov8-8.*a2*wCov9-4.*a3*wCov10-8.*c1*wCov11-8.*a4*wCov12 | |
19554 | + 4.*a5*wCov13+8.*s1*wCov14+16.*a3*a2*wCov15+32.*c1*a2*wCov16+32.*a2*a4*wCov3 | |
19555 | - 16.*a5*a2*wCov17-32.*s1*a2*wCov18+16.*c1*a3*wCov19+16.*a3*a4*wCov20 | |
19556 | - 8.*a3*a5*wCov21-16.*s1*a3*wCov22+32.*c1*a4*wCov23-16.*c1*a5*wCov24 | |
19557 | - 32.*c1*s1*wCov25-16.*a5*a4*wCov26-32.*s1*a4*wCov27+16.*s1*a5*wCov28; | |
19558 | // Store ratio of error squared - with/without NUA terms: | |
19559 | Double_t ratioErrorSquaredQC4 = 0.; | |
19560 | if(fIntFlowQcumulants->GetBinError(2)>0.) | |
19561 | { | |
19562 | ratioErrorSquaredQC4 = (gQC4ErrorSquared/pow(fIntFlowQcumulants->GetBinError(2),2.)); | |
19563 | fIntFlowQcumulantsErrorSquaredRatio->SetBinContent(2,ratioErrorSquaredQC4); | |
19564 | } | |
b77b6434 | 19565 | if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 19566 | { |
19567 | if(gQC4ErrorSquared>=0.) | |
19568 | { | |
19569 | fIntFlowQcumulants->SetBinError(2,pow(gQC4ErrorSquared,0.5)); | |
19570 | } else | |
19571 | { | |
19572 | fIntFlowQcumulants->SetBinError(2,0.); | |
19573 | cout<<endl; | |
19574 | cout<<" WARNING (QC): Statistical error of generalized QC{4} is imaginary !!!!"<<endl; | |
19575 | cout<<endl; | |
19576 | } | |
b77b6434 | 19577 | } // end of if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 19578 | // Quantify detector bias to QC{4}: |
53884472 | 19579 | if(TMath::Abs(QC4)>0.) |
b92ea2b9 | 19580 | { |
53884472 | 19581 | fIntFlowDetectorBias->SetBinContent(2,gQC4/QC4); |
19582 | if(QC4Error>0.) | |
b92ea2b9 | 19583 | { |
53884472 | 19584 | Double_t errorSquared = gQC4ErrorSquared/pow(QC4,2.)+pow(gQC4,2.)*pow(QC4Error,2.)/pow(QC4,4.); |
b92ea2b9 | 19585 | if(errorSquared>0.) |
19586 | { | |
19587 | fIntFlowDetectorBias->SetBinError(2,pow(errorSquared,0.5)); | |
19588 | } | |
19589 | } | |
53884472 | 19590 | } // end of if(TMath::Abs(QC4)>0.) |
489d5531 | 19591 | |
b92ea2b9 | 19592 | |
19593 | // .... to be improved (continued for 6th and 8th order) .... | |
19594 | ||
19595 | ||
2001bc3a | 19596 | // versus multiplicity: |
b77b6434 | 19597 | if(fCalculateCumulantsVsM) // to be improved - propagate error for nua terms vs M |
2001bc3a | 19598 | { |
19599 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) | |
b77b6434 | 19600 | Double_t value[4] = {0.}; // QCs vs M |
19601 | Double_t error[4] = {0.}; // error of QCs vs M | |
19602 | Double_t dSum1[4] = {0.}; // sum value_i/(error_i)^2 | |
19603 | Double_t dSum2[4] = {0.}; // sum 1/(error_i)^2 | |
2001bc3a | 19604 | for(Int_t b=1;b<=nBins;b++) |
19605 | { | |
b92ea2b9 | 19606 | // Measured correlations: |
2001bc3a | 19607 | two = fIntFlowCorrelationsVsMHist[0]->GetBinContent(b); // <<2>> vs M |
19608 | four = fIntFlowCorrelationsVsMHist[1]->GetBinContent(b); // <<4>> vs M | |
b92ea2b9 | 19609 | // Isotropic cumulants: |
53884472 | 19610 | QC2 = two; |
19611 | QC4 = four-2.*pow(two,2.); | |
b92ea2b9 | 19612 | // Non-isotropic terms: |
19613 | c1 = fIntFlowCorrectionTermsForNUAVsMPro[1][0]->GetBinContent(b); // <<cos(n*phi1)>> | |
19614 | c2 = fIntFlowCorrectionTermsForNUAVsMPro[1][1]->GetBinContent(b); // <<cos(n*(phi1+phi2))>> | |
19615 | c3 = fIntFlowCorrectionTermsForNUAVsMPro[1][2]->GetBinContent(b); // <<cos(n*(phi1-phi2-phi3))>> | |
19616 | s1 = fIntFlowCorrectionTermsForNUAVsMPro[0][0]->GetBinContent(b); // <<sin(n*phi1)>> | |
19617 | s2 = fIntFlowCorrectionTermsForNUAVsMPro[0][1]->GetBinContent(b); // <<sin(n*(phi1+phi2))>> | |
19618 | s3 = fIntFlowCorrectionTermsForNUAVsMPro[0][2]->GetBinContent(b); // <<sin(n*(phi1-phi2-phi3))>> | |
19619 | // Generalized QC{2} vs M: | |
19620 | gQC2 = two - pow(c1,2.) - pow(s1,2.); | |
b77b6434 | 19621 | if(fApplyCorrectionForNUAVsM){fIntFlowQcumulantsVsM[0]->SetBinContent(b,gQC2);} |
b92ea2b9 | 19622 | // Generalized QC{4} vs M: |
19623 | gQC4 = four-2.*pow(two,2.) | |
19624 | - 4.*c1*c3+4.*s1*s3-pow(c2,2.)-pow(s2,2.) | |
19625 | + 4.*c2*(pow(c1,2.)-pow(s1,2.))+8.*s2*s1*c1 | |
19626 | + 8.*two*(pow(c1,2.)+pow(s1,2.))-6.*pow((pow(c1,2.)+pow(s1,2.)),2.); | |
b77b6434 | 19627 | if(fApplyCorrectionForNUAVsM){fIntFlowQcumulantsVsM[1]->SetBinContent(b,gQC4);} |
b92ea2b9 | 19628 | // Detector bias vs M: |
53884472 | 19629 | if(TMath::Abs(QC2)>0.) |
b92ea2b9 | 19630 | { |
53884472 | 19631 | fIntFlowDetectorBiasVsM[0]->SetBinContent(b,gQC2/QC2); |
19632 | } // end of if(TMath::Abs(QC2)>0.) | |
19633 | if(TMath::Abs(QC4)>0.) | |
b92ea2b9 | 19634 | { |
53884472 | 19635 | fIntFlowDetectorBiasVsM[1]->SetBinContent(b,gQC4/QC4); |
19636 | } // end of if(TMath::Abs(QC4)>0.) | |
b77b6434 | 19637 | // Rebin in M: |
19638 | for(Int_t co=0;co<4;co++) | |
19639 | { | |
19640 | value[co] = fIntFlowQcumulantsVsM[co]->GetBinContent(b); | |
19641 | error[co] = fIntFlowQcumulantsVsM[co]->GetBinError(b); | |
19642 | if(error[co]>0.) | |
19643 | { | |
19644 | dSum1[co]+=value[co]/(error[co]*error[co]); | |
19645 | dSum2[co]+=1./(error[co]*error[co]); | |
19646 | } | |
19647 | } // end of for(Int_t co=0;co<4;co++) | |
19648 | } // end of for(Int_t b=1;b<=nBins;b++) | |
19649 | // Store rebinned Q-cumulants: | |
19650 | if(fApplyCorrectionForNUAVsM) | |
19651 | { | |
19652 | for(Int_t co=0;co<4;co++) | |
19653 | { | |
19654 | if(dSum2[co]>0.) | |
19655 | { | |
19656 | fIntFlowQcumulantsRebinnedInM->SetBinContent(co+1,dSum1[co]/dSum2[co]); | |
19657 | fIntFlowQcumulantsRebinnedInM->SetBinError(co+1,pow(1./dSum2[co],0.5)); | |
19658 | } | |
19659 | } // end of for(Int_t co=0;co<4;co++) | |
19660 | } // end of if(fApplyCorrectionForNUAVsM) | |
19661 | } // end of if(fCalculateCumulantsVsM) | |
2001bc3a | 19662 | |
489d5531 | 19663 | } // end of void AliFlowAnalysisWithQCumulants::CalculateQcumulantsCorrectedForNUAIntFlow() |
0328db2d | 19664 | |
e1d101a6 | 19665 | //======================================================================================================================= |
489d5531 | 19666 | |
489d5531 | 19667 | void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUAIntFlow() |
19668 | { | |
0328db2d | 19669 | // From profile fIntFlowCorrectionTermsForNUAPro[sc] access measured correction terms for NUA |
489d5531 | 19670 | // and their spread, correctly calculate the statistical errors and store the final |
0328db2d | 19671 | // results and statistical errors for correction terms for NUA in histogram fIntFlowCorrectionTermsForNUAHist[sc]. |
489d5531 | 19672 | // |
19673 | // Remark: Statistical error of correction temrs is calculated as: | |
19674 | // | |
19675 | // statistical error = termA * spread * termB: | |
19676 | // termA = sqrt{sum_{i=1}^{N} w^2}/(sum_{i=1}^{N} w) | |
19677 | // termB = 1/sqrt(1-termA^2) | |
19678 | ||
b92ea2b9 | 19679 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved - promore this to data member? |
19680 | TString nonisotropicTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4 | |
19681 | ||
489d5531 | 19682 | for(Int_t sc=0;sc<2;sc++) // sin or cos correction terms |
19683 | { | |
b92ea2b9 | 19684 | for(Int_t ci=1;ci<=4;ci++) // correction term index (to be improved - hardwired 4) |
489d5531 | 19685 | { |
19686 | Double_t correction = fIntFlowCorrectionTermsForNUAPro[sc]->GetBinContent(ci); | |
0328db2d | 19687 | Double_t spread = fIntFlowCorrectionTermsForNUAPro[sc]->GetBinError(ci); |
19688 | Double_t sumOfLinearEventWeights = fIntFlowSumOfEventWeightsNUA[sc][0]->GetBinContent(ci); | |
19689 | Double_t sumOfQuadraticEventWeights = fIntFlowSumOfEventWeightsNUA[sc][1]->GetBinContent(ci); | |
19690 | Double_t termA = 0.; | |
19691 | Double_t termB = 0.; | |
b92ea2b9 | 19692 | if(TMath::Abs(sumOfLinearEventWeights)>1.e-44) |
0328db2d | 19693 | { |
19694 | termA = pow(sumOfQuadraticEventWeights,0.5)/sumOfLinearEventWeights; | |
19695 | } else | |
19696 | { | |
b92ea2b9 | 19697 | cout<<" WARNING (QC): sumOfLinearEventWeights == 0 in AFAWQC::FCTFNIF() !!!!"<<endl; |
19698 | cout<<Form(" (for <<%s[%s]>> non-isotropic term)",sinCosFlag[sc].Data(),nonisotropicTermFlag[ci-1].Data())<<endl; | |
0328db2d | 19699 | } |
489d5531 | 19700 | if(1.-pow(termA,2.) > 0.) |
19701 | { | |
19702 | termB = 1./pow(1-pow(termA,2.),0.5); | |
19703 | } else | |
19704 | { | |
b92ea2b9 | 19705 | cout<<" WARNING (QC): 1.-pow(termA,2.) <= 0 in AFAWQC::FCTFNIF() !!!!"<<endl; |
19706 | cout<<Form(" (for <<%s[%s]>> non-isotropic term)",sinCosFlag[sc].Data(),nonisotropicTermFlag[ci-1].Data())<<endl; | |
489d5531 | 19707 | } |
19708 | Double_t statisticalError = termA * spread * termB; | |
489d5531 | 19709 | fIntFlowCorrectionTermsForNUAHist[sc]->SetBinContent(ci,correction); |
0328db2d | 19710 | fIntFlowCorrectionTermsForNUAHist[sc]->SetBinError(ci,statisticalError); |
b92ea2b9 | 19711 | } // end of for(Int_t ci=1;ci<=4;ci++) // correction term index |
489d5531 | 19712 | } // end of for(Int sc=0;sc<2;sc++) // sin or cos correction terms |
19713 | ||
19714 | } // end of void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUAIntFlow() | |
19715 | ||
e1d101a6 | 19716 | //======================================================================================================================= |
489d5531 | 19717 | |
489d5531 | 19718 | void AliFlowAnalysisWithQCumulants::GetPointersForNestedLoopsHistograms() |
19719 | { | |
19720 | // Get pointers to all objects relevant for calculations with nested loops. | |
19721 | ||
19722 | TList *nestedLoopsList = dynamic_cast<TList*>(fHistList->FindObject("Nested Loops")); | |
19723 | if(nestedLoopsList) | |
19724 | { | |
19725 | this->SetNestedLoopsList(nestedLoopsList); | |
19726 | } else | |
19727 | { | |
19728 | cout<<"WARNING: nestedLoopsList is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
19729 | exit(0); | |
19730 | } | |
19731 | ||
19732 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?) | |
19733 | TString typeFlag[2] = {"RP","POI"}; // to be improved (should I promote this to data members?) | |
19734 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; // to be improved (should I promote this to data members?) | |
19735 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; // to be improved (should I promote this to data members?) | |
19736 | ||
19737 | TString evaluateNestedLoopsName = "fEvaluateNestedLoops"; | |
19738 | evaluateNestedLoopsName += fAnalysisLabel->Data(); | |
19739 | TProfile *evaluateNestedLoops = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(evaluateNestedLoopsName.Data())); | |
19740 | Bool_t bEvaluateIntFlowNestedLoops = kFALSE; | |
19741 | Bool_t bEvaluateDiffFlowNestedLoops = kFALSE; | |
19742 | if(evaluateNestedLoops) | |
19743 | { | |
19744 | this->SetEvaluateNestedLoops(evaluateNestedLoops); | |
19745 | bEvaluateIntFlowNestedLoops = (Int_t)evaluateNestedLoops->GetBinContent(1); | |
19746 | bEvaluateDiffFlowNestedLoops = (Int_t)evaluateNestedLoops->GetBinContent(2); | |
19747 | } | |
19748 | // nested loops relevant for integrated flow: | |
19749 | if(bEvaluateIntFlowNestedLoops) | |
19750 | { | |
19751 | // correlations: | |
19752 | TString intFlowDirectCorrelationsName = "fIntFlowDirectCorrelations"; | |
19753 | intFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
19754 | TProfile *intFlowDirectCorrelations = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(intFlowDirectCorrelationsName.Data())); | |
19755 | if(intFlowDirectCorrelations) | |
19756 | { | |
19757 | this->SetIntFlowDirectCorrelations(intFlowDirectCorrelations); | |
19758 | } else | |
19759 | { | |
19760 | cout<<"WARNING: intFlowDirectCorrelations is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
19761 | exit(0); | |
19762 | } | |
403e3389 | 19763 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 19764 | { |
19765 | TString intFlowExtraDirectCorrelationsName = "fIntFlowExtraDirectCorrelations"; | |
19766 | intFlowExtraDirectCorrelationsName += fAnalysisLabel->Data(); | |
19767 | TProfile *intFlowExtraDirectCorrelations = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(intFlowExtraDirectCorrelationsName.Data())); | |
19768 | if(intFlowExtraDirectCorrelations) | |
19769 | { | |
19770 | this->SetIntFlowExtraDirectCorrelations(intFlowExtraDirectCorrelations); | |
19771 | } else | |
19772 | { | |
19773 | cout<<"WARNING: intFlowExtraDirectCorrelations is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
19774 | exit(0); | |
19775 | } | |
403e3389 | 19776 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 19777 | // correction terms for non-uniform acceptance: |
19778 | TString intFlowDirectCorrectionTermsForNUAName = "fIntFlowDirectCorrectionTermsForNUA"; | |
19779 | intFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
19780 | TProfile *intFlowDirectCorrectionTermsForNUA[2] = {NULL}; | |
19781 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
19782 | { | |
19783 | intFlowDirectCorrectionTermsForNUA[sc] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s: %s terms",intFlowDirectCorrectionTermsForNUAName.Data(),sinCosFlag[sc].Data()))); | |
19784 | if(intFlowDirectCorrectionTermsForNUA[sc]) | |
19785 | { | |
19786 | this->SetIntFlowDirectCorrectionTermsForNUA(intFlowDirectCorrectionTermsForNUA[sc],sc); | |
19787 | } else | |
19788 | { | |
19789 | cout<<"WARNING: intFlowDirectCorrectionTermsForNUA[sc] is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
19790 | cout<<"sc = "<<sc<<endl; | |
19791 | exit(0); | |
19792 | } | |
19793 | } // end of for(Int_t sc=0;sc<2;sc++) | |
e1d101a6 | 19794 | // Mixed harmonics: |
19795 | if(fCalculateMixedHarmonics) | |
19796 | { | |
19797 | TString mixedHarmonicsNestedLoopsName = "fMixedHarmonicsNestedLoops"; | |
19798 | mixedHarmonicsNestedLoopsName += fAnalysisLabel->Data(); | |
19799 | TProfile *mixedHarmonicsNestedLoops = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(mixedHarmonicsNestedLoopsName.Data())); | |
19800 | if(mixedHarmonicsNestedLoops) | |
19801 | { | |
19802 | this->SetMixedHarmonicsNestedLoops(mixedHarmonicsNestedLoops); | |
19803 | } else | |
19804 | { | |
19805 | cout<<"WARNING: mixedHarmonicsNestedLoops is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
19806 | exit(0); | |
19807 | } | |
19808 | } // end of if(fCalculateMixedHarmonics) | |
489d5531 | 19809 | } // end of if(bEvaluateIntFlowNestedLoops) |
19810 | ||
19811 | // nested loops relevant for differential flow: | |
19812 | if(bEvaluateDiffFlowNestedLoops) | |
19813 | { | |
19814 | // correlations: | |
19815 | TString diffFlowDirectCorrelationsName = "fDiffFlowDirectCorrelations"; | |
19816 | diffFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
19817 | TProfile *diffFlowDirectCorrelations[2][2][4] = {{{NULL}}}; | |
19818 | for(Int_t t=0;t<2;t++) | |
19819 | { | |
19820 | for(Int_t pe=0;pe<2;pe++) | |
19821 | { | |
19822 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
19823 | { | |
19824 | diffFlowDirectCorrelations[t][pe][ci] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[ci].Data()))); | |
19825 | if(diffFlowDirectCorrelations[t][pe][ci]) | |
19826 | { | |
19827 | this->SetDiffFlowDirectCorrelations(diffFlowDirectCorrelations[t][pe][ci],t,pe,ci); | |
19828 | } else | |
19829 | { | |
19830 | cout<<"WARNING: diffFlowDirectCorrelations[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
19831 | cout<<"t = "<<t<<endl; | |
19832 | cout<<"pe = "<<pe<<endl; | |
19833 | cout<<"ci = "<<ci<<endl; | |
19834 | } | |
19835 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
19836 | } // end of for(Int_t pe=0;pe<2;pe++) | |
19837 | } // end of for(Int_t t=0;t<2;t++) | |
19838 | // correction terms for non-uniform acceptance: | |
19839 | TString diffFlowDirectCorrectionTermsForNUAName = "fDiffFlowDirectCorrectionTermsForNUA"; | |
19840 | diffFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
19841 | TProfile *diffFlowDirectCorrectionTermsForNUA[2][2][2][10] = {{{{NULL}}}}; | |
19842 | for(Int_t t=0;t<2;t++) | |
19843 | { | |
19844 | for(Int_t pe=0;pe<2;pe++) | |
19845 | { | |
19846 | // correction terms for NUA: | |
19847 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
19848 | { | |
19849 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
19850 | { | |
19851 | diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1))); | |
19852 | if(diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]) | |
19853 | { | |
19854 | this->SetDiffFlowDirectCorrectionTermsForNUA(diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti],t,pe,sc,cti); | |
19855 | } else | |
19856 | { | |
19857 | cout<<"WARNING: diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
19858 | cout<<"t = "<<t<<endl; | |
19859 | cout<<"pe = "<<pe<<endl; | |
19860 | cout<<"sc = "<<sc<<endl; | |
19861 | cout<<"cti = "<<cti<<endl; | |
19862 | } | |
19863 | } // end of for(Int_t cti=0;cti<9;cti++) // correction term index | |
19864 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
19865 | } // end of for(Int_t pe=0;pe<2;pe++) | |
19866 | } // end of for(Int_t t=0;t<2;t++) | |
64e500e3 | 19867 | // other differential correlators: |
19868 | TString otherDirectDiffCorrelatorsName = "fOtherDirectDiffCorrelators"; | |
19869 | otherDirectDiffCorrelatorsName += fAnalysisLabel->Data(); | |
19870 | TProfile *otherDirectDiffCorrelators[2][2][2][1] = {{{{NULL}}}}; | |
19871 | for(Int_t t=0;t<2;t++) | |
19872 | { | |
e1d101a6 | 19873 | for(Int_t pe=0;pe<2;pe++) |
19874 | { | |
19875 | // correction terms for NUA: | |
19876 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
19877 | { | |
19878 | for(Int_t ci=0;ci<1;ci++) // correlator index | |
19879 | { | |
19880 | otherDirectDiffCorrelators[t][pe][sc][ci] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s, ci = %d",otherDirectDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1))); | |
19881 | if(otherDirectDiffCorrelators[t][pe][sc][ci]) | |
19882 | { | |
19883 | this->SetOtherDirectDiffCorrelators(otherDirectDiffCorrelators[t][pe][sc][ci],t,pe,sc,ci); | |
19884 | } else | |
19885 | { | |
19886 | cout<<"WARNING: otherDirectDiffCorrelators[t][pe][sc][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
19887 | cout<<"t = "<<t<<endl; | |
19888 | cout<<"pe = "<<pe<<endl; | |
19889 | cout<<"sc = "<<sc<<endl; | |
19890 | cout<<"ci = "<<ci<<endl; | |
19891 | } | |
19892 | } // end of for(Int_t ci=0;ci<9;ci++) // correction term index | |
19893 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
19894 | } // end of for(Int_t pe=0;pe<2;pe++) | |
19895 | } // end of for(Int_t t=0;t<2;t++) | |
19896 | // number of RPs and POIs in selected pt and eta bins for cross-checkings: | |
19897 | TString noOfParticlesInBinName = "fNoOfParticlesInBin"; | |
19898 | TH1D *noOfParticlesInBin = NULL; | |
19899 | noOfParticlesInBin = dynamic_cast<TH1D*>(nestedLoopsList->FindObject(noOfParticlesInBinName.Data())); | |
19900 | if(noOfParticlesInBin) | |
19901 | { | |
19902 | this->SetNoOfParticlesInBin(noOfParticlesInBin); | |
19903 | } else | |
19904 | { | |
19905 | cout<<endl; | |
19906 | cout<<" WARNING (QC): noOfParticlesInBin is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
19907 | cout<<endl; | |
19908 | } | |
19909 | } // end of if(bEvaluateDiffFlowNestedLoops) | |
19910 | ||
19911 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForNestedLoopsHistograms() | |
19912 | ||
19913 | //======================================================================================================================= | |
19914 | ||
19915 | void AliFlowAnalysisWithQCumulants::GetPointersForMixedHarmonicsHistograms() | |
19916 | { | |
19917 | // Get pointers to all objects relevant for mixed harmonics. | |
19918 | ||
19919 | // a) Get pointer to base list for mixed harmonics; | |
19920 | // b) Get pointer to TProfile fMixedHarmonicsFlags holding all flags for mixed harmonics; | |
19921 | // c) Get pointer to list fMixedHarmonicsProfiles and pointers to all objects that she holds; | |
c10259fb | 19922 | // d) Get pointer to list fMixedHarmonicsResults and pointers to all objects that she holds; |
19923 | // e) Get pointer to list fMixedHarmonicsErrorPropagation and pointers to all objects that she holds. | |
e1d101a6 | 19924 | |
19925 | // a) Get pointer to base list for mixed harmonics: | |
19926 | TList *mixedHarmonicsList = dynamic_cast<TList*>(fHistList->FindObject("Mixed Harmonics")); | |
19927 | if(mixedHarmonicsList) | |
19928 | { | |
19929 | this->SetMixedHarmonicsList(mixedHarmonicsList); | |
19930 | } else | |
19931 | { | |
19932 | cout<<"WARNING: mixedHarmonicsList is NULL in AFAWQC::GPFMHH() !!!!"<<endl; | |
19933 | exit(0); | |
19934 | } | |
19935 | ||
19936 | // b) Get pointer to TProfile fMixedHarmonicsFlags holding all flags for mixed harmonics: | |
19937 | TString mixedHarmonicsFlagsName = "fMixedHarmonicsFlags"; | |
19938 | mixedHarmonicsFlagsName += fAnalysisLabel->Data(); | |
19939 | TProfile *mixedHarmonicsFlags = dynamic_cast<TProfile*> | |
19940 | (mixedHarmonicsList->FindObject(mixedHarmonicsFlagsName.Data())); | |
19941 | if(mixedHarmonicsFlags) | |
19942 | { | |
19943 | this->SetMixedHarmonicsFlags(mixedHarmonicsFlags); | |
19944 | fCalculateMixedHarmonics = (Bool_t)mixedHarmonicsFlags->GetBinContent(1); | |
19945 | fCalculateMixedHarmonicsVsM = (Bool_t)mixedHarmonicsFlags->GetBinContent(3); | |
19946 | } else | |
19947 | { | |
19948 | cout<<"WARNING: mixedHarmonicsFlags is NULL in AFAWQC::GPFMHH() !!!!"<<endl; | |
19949 | exit(0); | |
19950 | } | |
19951 | ||
19952 | if(!fCalculateMixedHarmonics){return;} | |
19953 | ||
19954 | // c) Get pointer to list fMixedHarmonicsProfiles and pointers to all objects that she holds: | |
19955 | TList *mixedHarmonicsProfiles = NULL; | |
19956 | mixedHarmonicsProfiles = dynamic_cast<TList*>(mixedHarmonicsList->FindObject("Profiles")); | |
19957 | if(mixedHarmonicsProfiles) | |
19958 | { | |
19959 | // 2p: | |
19960 | TString s2pCorrelationsName = "f2pCorrelations"; | |
19961 | s2pCorrelationsName += fAnalysisLabel->Data(); | |
19962 | TProfile *p2pCorrelations = dynamic_cast<TProfile*>(mixedHarmonicsProfiles->FindObject(s2pCorrelationsName.Data())); | |
19963 | if(p2pCorrelations) | |
19964 | { | |
19965 | this->Set2pCorrelations(p2pCorrelations); | |
19966 | } else | |
19967 | { | |
19968 | cout<<"WARNING: p2pCorrelations is NULL in AFAWQC::GPFMHH() !!!!"<<endl; | |
19969 | exit(0); | |
19970 | } | |
19971 | // 3p: | |
19972 | TString s3pCorrelationsName = "f3pCorrelations"; | |
19973 | s3pCorrelationsName += fAnalysisLabel->Data(); | |
19974 | TProfile *p3pCorrelations = dynamic_cast<TProfile*>(mixedHarmonicsProfiles->FindObject(s3pCorrelationsName.Data())); | |
19975 | if(p3pCorrelations) | |
19976 | { | |
19977 | this->Set3pCorrelations(p3pCorrelations); | |
19978 | } else | |
19979 | { | |
19980 | cout<<"WARNING: p3pCorrelations is NULL in AFAWQC::GPFMHH() !!!!"<<endl; | |
19981 | exit(0); | |
19982 | } | |
19983 | // 4p: | |
19984 | TString s4pCorrelationsName = "f4pCorrelations"; | |
19985 | s4pCorrelationsName += fAnalysisLabel->Data(); | |
19986 | TProfile *p4pCorrelations = dynamic_cast<TProfile*>(mixedHarmonicsProfiles->FindObject(s4pCorrelationsName.Data())); | |
19987 | if(p4pCorrelations) | |
19988 | { | |
19989 | this->Set4pCorrelations(p4pCorrelations); | |
19990 | } else | |
19991 | { | |
19992 | cout<<"WARNING: p4pCorrelations is NULL in AFAWQC::GPFMHH() !!!!"<<endl; | |
19993 | exit(0); | |
19994 | } | |
19995 | // 5p: | |
19996 | TString s5pCorrelationsName = "f5pCorrelations"; | |
19997 | s5pCorrelationsName += fAnalysisLabel->Data(); | |
19998 | TProfile *p5pCorrelations = dynamic_cast<TProfile*>(mixedHarmonicsProfiles->FindObject(s5pCorrelationsName.Data())); | |
19999 | if(p5pCorrelations) | |
20000 | { | |
20001 | this->Set5pCorrelations(p5pCorrelations); | |
20002 | } else | |
20003 | { | |
20004 | cout<<"WARNING: p5pCorrelations is NULL in AFAWQC::GPFMHH() !!!!"<<endl; | |
20005 | exit(0); | |
20006 | } | |
20007 | /* TBI not needed for the time being | |
20008 | // 6p: | |
20009 | TString s6pCorrelationsName = "f6pCorrelations"; | |
20010 | s6pCorrelationsName += fAnalysisLabel->Data(); | |
20011 | TProfile *p6pCorrelations = dynamic_cast<TProfile*>(mixedHarmonicsProfiles->FindObject(s6pCorrelationsName.Data())); | |
20012 | if(p6pCorrelations) | |
20013 | { | |
20014 | this->Set6pCorrelations(p6pCorrelations); | |
20015 | } else | |
20016 | { | |
20017 | cout<<"WARNING: p6pCorrelations is NULL in AFAWQC::GPFMHH() !!!!"<<endl; | |
20018 | exit(0); | |
20019 | } | |
20020 | // 7p: | |
20021 | TString s7pCorrelationsName = "f7pCorrelations"; | |
20022 | s7pCorrelationsName += fAnalysisLabel->Data(); | |
20023 | TProfile *p7pCorrelations = dynamic_cast<TProfile*>(mixedHarmonicsProfiles->FindObject(s7pCorrelationsName.Data())); | |
20024 | if(p7pCorrelations) | |
20025 | { | |
20026 | this->Set7pCorrelations(p7pCorrelations); | |
20027 | } else | |
20028 | { | |
20029 | cout<<"WARNING: p7pCorrelations is NULL in AFAWQC::GPFMHH() !!!!"<<endl; | |
20030 | exit(0); | |
20031 | } | |
20032 | // 8p: | |
20033 | TString s8pCorrelationsName = "f8pCorrelations"; | |
20034 | s8pCorrelationsName += fAnalysisLabel->Data(); | |
20035 | TProfile *p8pCorrelations = dynamic_cast<TProfile*>(mixedHarmonicsProfiles->FindObject(s8pCorrelationsName.Data())); | |
20036 | if(p8pCorrelations) | |
20037 | { | |
20038 | this->Set8pCorrelations(p8pCorrelations); | |
20039 | } else | |
20040 | { | |
20041 | cout<<"WARNING: p8pCorrelations is NULL in AFAWQC::GPFMHH() !!!!"<<endl; | |
20042 | exit(0); | |
20043 | } | |
20044 | */ | |
20045 | } else // to if(mixedHarmonicsProfiles) | |
20046 | { | |
20047 | cout<<"WARNING: mixedHarmonicsProfiles is NULL in FAWQC::GPFMHH() !!!!"<<endl; | |
20048 | exit(0); | |
20049 | } | |
20050 | ||
20051 | // d) Get pointer to list fMixedHarmonicsResults and pointers to all objects that she holds. | |
20052 | TList *mixedHarmonicsResults = NULL; | |
20053 | mixedHarmonicsResults = dynamic_cast<TList*>(mixedHarmonicsList->FindObject("Results")); | |
20054 | if(mixedHarmonicsResults) | |
20055 | { | |
20056 | // 2p: | |
20057 | TString s2pCumulantsName = "f2pCumulants"; | |
20058 | s2pCumulantsName += fAnalysisLabel->Data(); | |
20059 | TH1D *p2pCumulants = dynamic_cast<TH1D*>(mixedHarmonicsResults->FindObject(s2pCumulantsName.Data())); | |
20060 | if(p2pCumulants) | |
20061 | { | |
20062 | this->Set2pCumulants(p2pCumulants); | |
20063 | } else | |
64e500e3 | 20064 | { |
e1d101a6 | 20065 | cout<<"WARNING: p2pCumulants is NULL in AFAWQC::GPFMHH() !!!!"<<endl; |
20066 | exit(0); | |
20067 | } | |
20068 | // 3p: | |
20069 | TString s3pCumulantsName = "f3pCumulants"; | |
20070 | s3pCumulantsName += fAnalysisLabel->Data(); | |
20071 | TH1D *p3pCumulants = dynamic_cast<TH1D*>(mixedHarmonicsResults->FindObject(s3pCumulantsName.Data())); | |
20072 | if(p3pCumulants) | |
20073 | { | |
20074 | this->Set3pCumulants(p3pCumulants); | |
20075 | } else | |
20076 | { | |
20077 | cout<<"WARNING: p3pCumulants is NULL in AFAWQC::GPFMHH() !!!!"<<endl; | |
20078 | exit(0); | |
20079 | } | |
20080 | // 4p: | |
20081 | TString s4pCumulantsName = "f4pCumulants"; | |
20082 | s4pCumulantsName += fAnalysisLabel->Data(); | |
20083 | TH1D *p4pCumulants = dynamic_cast<TH1D*>(mixedHarmonicsResults->FindObject(s4pCumulantsName.Data())); | |
20084 | if(p4pCumulants) | |
20085 | { | |
20086 | this->Set4pCumulants(p4pCumulants); | |
20087 | } else | |
20088 | { | |
20089 | cout<<"WARNING: p4pCumulants is NULL in AFAWQC::GPFMHH() !!!!"<<endl; | |
20090 | exit(0); | |
20091 | } | |
20092 | // 5p: | |
20093 | TString s5pCumulantsName = "f5pCumulants"; | |
20094 | s5pCumulantsName += fAnalysisLabel->Data(); | |
20095 | TH1D *p5pCumulants = dynamic_cast<TH1D*>(mixedHarmonicsResults->FindObject(s5pCumulantsName.Data())); | |
20096 | if(p5pCumulants) | |
20097 | { | |
20098 | this->Set5pCumulants(p5pCumulants); | |
20099 | } else | |
20100 | { | |
20101 | cout<<"WARNING: p5pCumulants is NULL in AFAWQC::GPFMHH() !!!!"<<endl; | |
20102 | exit(0); | |
20103 | } | |
20104 | } else // to if(mixedHarmonicsResults) | |
489d5531 | 20105 | { |
e1d101a6 | 20106 | cout<<"WARNING: mixedHarmonicsResults is NULL in FAWQC::GPFMHH() !!!!"<<endl; |
20107 | } | |
489d5531 | 20108 | |
c10259fb | 20109 | // e) Get pointer to list fMixedHarmonicsErrorPropagation and pointers to all objects that she holds: |
20110 | TList *mixedHarmonicsErrorPropagation = NULL; | |
20111 | mixedHarmonicsErrorPropagation = dynamic_cast<TList*>(mixedHarmonicsList->FindObject("Error Propagation")); | |
20112 | if(mixedHarmonicsErrorPropagation) | |
20113 | { | |
20114 | TString sMixedHarmonicEventWeightsName = "fMixedHarmonicEventWeights"; | |
20115 | sMixedHarmonicEventWeightsName += fAnalysisLabel->Data(); | |
20116 | TString powerFlag[2] = {"linear","quadratic"}; | |
20117 | for(Int_t power=0;power<2;power++) | |
20118 | { | |
20119 | TH1D *hMixedHarmonicEventWeights = dynamic_cast<TH1D*>(mixedHarmonicsErrorPropagation->FindObject(Form("%s: %s",sMixedHarmonicEventWeightsName.Data(),powerFlag[power].Data()))); | |
20120 | if(hMixedHarmonicEventWeights) | |
20121 | { | |
20122 | this->SetMixedHarmonicEventWeights(hMixedHarmonicEventWeights,power); | |
20123 | } else | |
20124 | { | |
20125 | cout<<"WARNING: hMixedHarmonicEventWeights is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
20126 | cout<<"power = "<<power<<endl; | |
20127 | exit(0); | |
20128 | } | |
20129 | } // end of for(Int_t power=0;power<2;power++) | |
20130 | TString sMixedHarmonicProductOfEventWeightsName = "fMixedHarmonicProductOfEventWeights"; | |
20131 | sMixedHarmonicProductOfEventWeightsName += fAnalysisLabel->Data(); | |
20132 | TH2D *hMixedHarmonicProductOfEventWeights = dynamic_cast<TH2D*>(mixedHarmonicsErrorPropagation->FindObject(sMixedHarmonicProductOfEventWeightsName.Data())); | |
20133 | if(hMixedHarmonicProductOfEventWeights) | |
20134 | { | |
20135 | this->SetMixedHarmonicProductOfEventWeights(hMixedHarmonicProductOfEventWeights); | |
20136 | } else | |
20137 | { | |
20138 | cout<<"WARNING: hMixedHarmonicProductOfEventWeights is NULL in AFAWQC::GPFMHH() !!!!"<<endl; | |
20139 | exit(0); | |
20140 | } | |
20141 | TString sMixedHarmonicProductOfCorrelationsName = "fMixedHarmonicProductOfCorrelations"; | |
20142 | sMixedHarmonicProductOfCorrelationsName += fAnalysisLabel->Data(); | |
20143 | TProfile2D *hMixedHarmonicProductOfCorrelations = dynamic_cast<TProfile2D*>(mixedHarmonicsErrorPropagation->FindObject(sMixedHarmonicProductOfCorrelationsName.Data())); | |
20144 | if(hMixedHarmonicProductOfCorrelations) | |
20145 | { | |
20146 | this->SetMixedHarmonicProductOfCorrelations(hMixedHarmonicProductOfCorrelations); | |
20147 | } else | |
20148 | { | |
20149 | cout<<"WARNING: hMixedHarmonicProductOfCorrelations is NULL in AFAWQC::GPFMHH() !!!!"<<endl; | |
20150 | exit(0); | |
20151 | } | |
20152 | } // end of if(mixedHarmonicsErrorPropagation) | |
20153 | ||
e1d101a6 | 20154 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForMixedHarmonicsHistograms() |
489d5531 | 20155 | |
e1d101a6 | 20156 | //======================================================================================================================= |
489d5531 | 20157 | |
1db7eced | 20158 | void AliFlowAnalysisWithQCumulants::GetPointersForControlHistograms() |
20159 | { | |
20160 | // Get pointers to all control histograms. | |
20161 | ||
20162 | // a) Get pointer to base list for control histograms; | |
20163 | // b) Get pointer to TProfile fControlHistogramsFlags holding all flags for control histograms; | |
20164 | // c) Get pointers to TH2D *fCorrelation2468VsMult[4], TH2D *fCorrelationProduct2468VsMult[1] and TH2D *fQvectorTermsVsMult[4]. | |
20165 | ||
20166 | // a) Get pointer to base list for control histograms: | |
20167 | TList *controlHistogramsList = dynamic_cast<TList*>(fHistList->FindObject("Control Histograms")); | |
20168 | if(controlHistogramsList) | |
20169 | { | |
20170 | this->SetControlHistogramsList(controlHistogramsList); | |
20171 | } else | |
20172 | { | |
20173 | cout<<"WARNING: controlHistogramsList is NULL in AFAWQC::GPFMHH() !!!!"<<endl; | |
20174 | exit(0); | |
20175 | } | |
20176 | ||
20177 | // b) Get pointer to TProfile fControlHistogramsFlags holding all flags for control histograms: | |
20178 | TString controlHistogramsFlagsName = "fControlHistogramsFlags"; | |
20179 | controlHistogramsFlagsName += fAnalysisLabel->Data(); | |
20180 | TProfile *controlHistogramsFlags = dynamic_cast<TProfile*> | |
20181 | (controlHistogramsList->FindObject(controlHistogramsFlagsName.Data())); | |
20182 | if(controlHistogramsFlags) | |
20183 | { | |
20184 | this->SetControlHistogramsFlags(controlHistogramsFlags); | |
20185 | fStoreControlHistograms = (Bool_t)controlHistogramsFlags->GetBinContent(1); | |
20186 | fUseQvectorTerms = (Bool_t)controlHistogramsFlags->GetBinContent(2); | |
20187 | } else | |
20188 | { | |
20189 | cout<<"WARNING: controlHistogramsFlags is NULL in AFAWQC::GPFMHH() !!!!"<<endl; | |
20190 | exit(0); | |
20191 | } | |
20192 | ||
20193 | if(!fStoreControlHistograms){return;} | |
20194 | ||
20195 | // c) Get pointers to TH2D *fCorrelation2468VsMult[4], TH2D *fCorrelationProduct2468VsMult[1] and TH2D *fQvectorTermsVsMult[4]: | |
20196 | TString sCorrelation[4] = {"#LT2#GT","#LT4#GT","#LT6#GT","#LT8#GT"}; | |
20197 | TString sCorrelation2468VsMultName = "fCorrelation2468VsMult"; | |
20198 | sCorrelation2468VsMultName += fAnalysisLabel->Data(); | |
20199 | for(Int_t ci=0;ci<4;ci++) | |
20200 | { | |
20201 | TH2D *hCorrelation2468VsMult = dynamic_cast<TH2D*>(controlHistogramsList->FindObject(Form("%s vs M",sCorrelation[ci].Data()))); | |
20202 | if(hCorrelation2468VsMult) | |
20203 | { | |
20204 | this->SetCorrelation2468VsMult(hCorrelation2468VsMult,ci); | |
20205 | } else | |
20206 | { | |
20207 | cout<<"WARNING: hCorrelation2468VsMult is NULL in AFAWQC::GPFCH() !!!!"<<endl; | |
20208 | cout<<"ci = "<<ci<<endl; | |
20209 | exit(0); | |
20210 | } | |
20211 | } // end of for(Int_t ci=0;ci<4;ci++) | |
20212 | TString sCorrelationProduct[1] = {"#LT2#GT#LT4#GT"}; // TBI: add the other ones when needed first time | |
20213 | TString sCorrelationProduct2468VsMultName = "fCorrelationProduct2468VsMult"; | |
20214 | sCorrelationProduct2468VsMultName += fAnalysisLabel->Data(); | |
20215 | for(Int_t cpi=0;cpi<1;cpi++) // TBI: hardwired 1 | |
20216 | { | |
20217 | TH2D *hCorrelationProduct2468VsMult = dynamic_cast<TH2D*>(controlHistogramsList->FindObject(Form("%s vs M",sCorrelationProduct[cpi].Data()))); | |
20218 | if(hCorrelationProduct2468VsMult) | |
20219 | { | |
20220 | this->SetCorrelationProduct2468VsMult(hCorrelationProduct2468VsMult,cpi); | |
20221 | } else | |
20222 | { | |
20223 | cout<<"WARNING: hCorrelationProduct2468VsMult is NULL in AFAWQC::GPFCH() !!!!"<<endl; | |
20224 | cout<<"cpi = "<<cpi<<endl; | |
20225 | exit(0); | |
20226 | } | |
20227 | } // end of for(Int_t cpi=0;cpi<1;cpi++) // TBI: hardwired 1 | |
20228 | ||
20229 | if(!fUseQvectorTerms){return;} | |
20230 | TString sQvectorTerms[4] = {"#frac{|Q_{n}|^{2}}{M}","#frac{|Q_{2n}|^{2}}{M}","#frac{|Q_{n}|^{4}}{M(2M-1)}","#frac{Re[Q_{2n}Q_{n}^{*}Q_{n}^{*}]}{M^{3/2}}"}; | |
20231 | TString sQvectorTermsVsMultName = "fQvectorTermsVsMult"; | |
20232 | sQvectorTermsVsMultName += fAnalysisLabel->Data(); | |
20233 | for(Int_t qwti=0;qwti<4;qwti++) // TBI: hardwired 4 | |
20234 | { | |
20235 | TH2D *hQvectorTermsVsMult = dynamic_cast<TH2D*>(controlHistogramsList->FindObject(Form("%s vs M",sQvectorTerms[qwti].Data()))); | |
20236 | if(hQvectorTermsVsMult) | |
20237 | { | |
20238 | this->SetQvectorTermsVsMult(hQvectorTermsVsMult,qwti); | |
20239 | } else | |
20240 | { | |
20241 | cout<<"WARNING: hQvectorTermsVsMult is NULL in AFAWQC::GPFCH() !!!!"<<endl; | |
20242 | cout<<"qwti = "<<qwti<<endl; | |
20243 | exit(0); | |
20244 | } | |
20245 | } // end of for(Int_t qwti=0;qwti<1;qwti++) // TBI: hardwired 4 | |
20246 | ||
20247 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForControlHistograms() | |
20248 | ||
20249 | //======================================================================================================================= | |
20250 | ||
489d5531 | 20251 | void AliFlowAnalysisWithQCumulants::StoreHarmonic() |
20252 | { | |
20253 | // Store flow harmonic in common control histograms. | |
20254 | ||
20255 | (fCommonHists->GetHarmonic())->Fill(0.5,fHarmonic); | |
dd442cd2 | 20256 | if(fFillMultipleControlHistograms) |
20257 | { | |
20258 | (fCommonHists2nd->GetHarmonic())->Fill(0.5,fHarmonic); | |
20259 | (fCommonHists4th->GetHarmonic())->Fill(0.5,fHarmonic); | |
20260 | (fCommonHists6th->GetHarmonic())->Fill(0.5,fHarmonic); | |
20261 | (fCommonHists8th->GetHarmonic())->Fill(0.5,fHarmonic); | |
20262 | } | |
20263 | ||
489d5531 | 20264 | } // end of void AliFlowAnalysisWithQCumulants::StoreHarmonic() |
20265 | ||
e1d101a6 | 20266 | //======================================================================================================================= |
489d5531 | 20267 | |
489d5531 | 20268 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelationsUsingParticleWeights(TString type, TString ptOrEta) // type = RP or POI |
20269 | { | |
20270 | // Calculate all correlations needed for differential flow using particle weights. | |
20271 | ||
2a98ceb8 | 20272 | Int_t t = 0; // type flag |
20273 | Int_t pe = 0; // ptEta flag | |
489d5531 | 20274 | |
20275 | if(type == "RP") | |
20276 | { | |
20277 | t = 0; | |
20278 | } else if(type == "POI") | |
20279 | { | |
20280 | t = 1; | |
20281 | } | |
20282 | ||
20283 | if(ptOrEta == "Pt") | |
20284 | { | |
20285 | pe = 0; | |
20286 | } else if(ptOrEta == "Eta") | |
20287 | { | |
20288 | pe = 1; | |
20289 | } | |
20290 | ||
20291 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
20292 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
20293 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
20294 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
20295 | ||
20296 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
20297 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
20298 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
20299 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
20300 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
20301 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
20302 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
20303 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
20304 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
20305 | ||
1268c371 | 20306 | // S^M_{p,k} (see .h file for the definition of fSpk): |
20307 | Double_t dSM1p1k = (*fSpk)(0,1); | |
20308 | Double_t dSM1p2k = (*fSpk)(0,2); | |
20309 | Double_t dSM1p3k = (*fSpk)(0,3); | |
20310 | Double_t dSM2p1k = (*fSpk)(1,1); | |
20311 | Double_t dSM3p1k = (*fSpk)(2,1); | |
489d5531 | 20312 | |
20313 | // looping over all bins and calculating reduced correlations: | |
20314 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
20315 | { | |
20316 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): | |
20317 | Double_t p1n0kRe = 0.; | |
20318 | Double_t p1n0kIm = 0.; | |
20319 | ||
20320 | // number of POIs in particular (pt,eta) bin): | |
20321 | Double_t mp = 0.; | |
20322 | ||
20323 | // real and imaginary parts of q_{m*n,k}: | |
20324 | // (weighted Q-vector evaluated for particles which are both RPs and POIs in particular (pt,eta) bin) | |
20325 | Double_t q1n2kRe = 0.; | |
20326 | Double_t q1n2kIm = 0.; | |
20327 | Double_t q2n1kRe = 0.; | |
20328 | Double_t q2n1kIm = 0.; | |
20329 | ||
20330 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
20331 | Double_t s1p1k = 0.; | |
20332 | Double_t s1p2k = 0.; | |
20333 | Double_t s1p3k = 0.; | |
20334 | ||
20335 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
20336 | Double_t dM0111 = 0.; | |
20337 | ||
20338 | if(type == "POI") | |
20339 | { | |
20340 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
20341 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
20342 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
20343 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
20344 | ||
20345 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
20346 | ||
20347 | t = 1; // typeFlag = RP or POI | |
20348 | ||
20349 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
20350 | q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
20351 | * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
20352 | q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
20353 | * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
20354 | q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
20355 | * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
20356 | q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
20357 | * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
20358 | ||
20359 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
20360 | s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); | |
20361 | s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); | |
20362 | s1p3k = pow(fs1dEBE[2][pe][3]->GetBinContent(b)*fs1dEBE[2][pe][3]->GetBinEntries(b),1.); | |
20363 | ||
20364 | // M0111 from Eq. (118) in QC2c (to be improved (notation)): | |
20365 | dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k) | |
20366 | - 3.*(s1p1k*(dSM2p1k-dSM1p2k) | |
20367 | + 2.*(s1p3k-s1p2k*dSM1p1k)); | |
20368 | } | |
20369 | else if(type == "RP") | |
20370 | { | |
20371 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
20372 | q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
20373 | * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
20374 | q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
20375 | * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
20376 | q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
20377 | * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
20378 | q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
20379 | * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
20380 | ||
20381 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
20382 | s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); | |
20383 | s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); | |
20384 | s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); | |
20385 | ||
20386 | // to be improved (cross-checked): | |
20387 | p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
20388 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
20389 | p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
20390 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
20391 | ||
20392 | mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
20393 | ||
20394 | t = 0; // typeFlag = RP or POI | |
20395 | ||
20396 | // M0111 from Eq. (118) in QC2c (to be improved (notation)): | |
20397 | dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k) | |
20398 | - 3.*(s1p1k*(dSM2p1k-dSM1p2k) | |
20399 | + 2.*(s1p3k-s1p2k*dSM1p1k)); | |
20400 | //............................................................................................... | |
20401 | } | |
20402 | ||
20403 | // 2'-particle correlation: | |
20404 | Double_t two1n1nW0W1 = 0.; | |
20405 | if(mp*dSM1p1k-s1p1k) | |
20406 | { | |
20407 | two1n1nW0W1 = (p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k-s1p1k) | |
20408 | / (mp*dSM1p1k-s1p1k); | |
20409 | ||
20410 | // fill profile to get <<2'>> | |
b40a910e | 20411 | fDiffFlowCorrelationsPro[t][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nW0W1,mp*dSM1p1k-s1p1k); |
20412 | // fill profile to get <<2'>^2> | |
20413 | fDiffFlowSquaredCorrelationsPro[t][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nW0W1*two1n1nW0W1,mp*dSM1p1k-s1p1k); | |
489d5531 | 20414 | // histogram to store <2'> e-b-e (needed in some other methods): |
20415 | fDiffFlowCorrelationsEBE[t][pe][0]->SetBinContent(b,two1n1nW0W1); | |
20416 | fDiffFlowEventWeightsForCorrelationsEBE[t][pe][0]->SetBinContent(b,mp*dSM1p1k-s1p1k); | |
20417 | } // end of if(mp*dSM1p1k-s1p1k) | |
20418 | ||
20419 | // 4'-particle correlation: | |
20420 | Double_t four1n1n1n1nW0W1W1W1 = 0.; | |
20421 | if(dM0111) | |
20422 | { | |
20423 | four1n1n1n1nW0W1W1W1 = ((pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k) | |
20424 | - q2n1kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.)) | |
20425 | - 2.*q2n1kIm*dReQ1n1k*dImQ1n1k | |
20426 | - p1n0kRe*(dReQ1n1k*dReQ2n2k+dImQ1n1k*dImQ2n2k) | |
20427 | + p1n0kIm*(dImQ1n1k*dReQ2n2k-dReQ1n1k*dImQ2n2k) | |
20428 | - 2.*dSM1p2k*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k) | |
20429 | - 2.*(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*s1p1k | |
20430 | + 6.*(q1n2kRe*dReQ1n1k+q1n2kIm*dImQ1n1k) | |
20431 | + 1.*(q2n1kRe*dReQ2n2k+q2n1kIm*dImQ2n2k) | |
20432 | + 2.*(p1n0kRe*dReQ1n3k+p1n0kIm*dImQ1n3k) | |
20433 | + 2.*s1p1k*dSM1p2k | |
20434 | - 6.*s1p3k) | |
20435 | / dM0111; // to be improved (notation of dM0111) | |
20436 | ||
20437 | // fill profile to get <<4'>> | |
b40a910e | 20438 | fDiffFlowCorrelationsPro[t][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nW0W1W1W1,dM0111); |
20439 | // fill profile to get <<4'>^2> | |
20440 | fDiffFlowSquaredCorrelationsPro[t][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nW0W1W1W1*four1n1n1n1nW0W1W1W1,dM0111); | |
489d5531 | 20441 | // histogram to store <4'> e-b-e (needed in some other methods): |
20442 | fDiffFlowCorrelationsEBE[t][pe][1]->SetBinContent(b,four1n1n1n1nW0W1W1W1); | |
20443 | fDiffFlowEventWeightsForCorrelationsEBE[t][pe][1]->SetBinContent(b,dM0111); | |
20444 | } // end of if(dM0111) | |
20445 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
20446 | ||
20447 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelationsUsingParticleWeights(TString type, TString ptOrEta); // type = RP or POI | |
20448 | ||
e1d101a6 | 20449 | //======================================================================================================================= |
489d5531 | 20450 | |
489d5531 | 20451 | void AliFlowAnalysisWithQCumulants::FillCommonControlHistograms(AliFlowEventSimple *anEvent) |
20452 | { | |
20453 | // Fill common control histograms. | |
20454 | ||
df23c5ae | 20455 | Int_t nRP = anEvent->GetNumberOfRPs(); // number of Reference Particles |
489d5531 | 20456 | fCommonHists->FillControlHistograms(anEvent); |
dd442cd2 | 20457 | if(fFillMultipleControlHistograms) |
489d5531 | 20458 | { |
dd442cd2 | 20459 | if(nRP>1) |
489d5531 | 20460 | { |
dd442cd2 | 20461 | fCommonHists2nd->FillControlHistograms(anEvent); |
20462 | if(nRP>3) | |
489d5531 | 20463 | { |
dd442cd2 | 20464 | fCommonHists4th->FillControlHistograms(anEvent); |
20465 | if(nRP>5) | |
489d5531 | 20466 | { |
dd442cd2 | 20467 | fCommonHists6th->FillControlHistograms(anEvent); |
20468 | if(nRP>7) | |
20469 | { | |
20470 | fCommonHists8th->FillControlHistograms(anEvent); | |
20471 | } // end of if(nRP>7) | |
20472 | } // end of if(nRP>5) | |
20473 | } // end of if(nRP>3) | |
20474 | } // end of if(nRP>1) | |
20475 | } // end of if(fFillMultipleControlHistograms) | |
489d5531 | 20476 | |
20477 | } // end of void AliFlowAnalysisWithQCumulants::FillCommonControlHistograms(AliFlowEventSimple *anEvent) | |
20478 | ||
e1d101a6 | 20479 | //======================================================================================================================= |
489d5531 | 20480 | |
df23c5ae | 20481 | void AliFlowAnalysisWithQCumulants::FillControlHistograms(AliFlowEventSimple *anEvent) |
20482 | { | |
20483 | // Fill common control histograms. | |
20484 | ||
20485 | Int_t nRPs = anEvent->GetNumberOfRPs(); // number of Reference Particles | |
20486 | Int_t nPOIs = anEvent->GetNumberOfPOIs(); // number of Particles Of Interest | |
20487 | Int_t nRefMult = anEvent->GetReferenceMultiplicity(); // reference multiplicity for current event (TBI: This call is not really needed here, use fReferenceMultiplicityEBE instead) | |
20488 | ||
20489 | fCorrelationNoRPsVsRefMult->Fill(nRPs,nRefMult); | |
20490 | fCorrelationNoPOIsVsRefMult->Fill(nPOIs,nRefMult); | |
20491 | fCorrelationNoRPsVsNoPOIs->Fill(nRPs,nPOIs); | |
20492 | ||
20493 | } // end of void AliFlowAnalysisWithQCumulants::FillControlHistograms(AliFlowEventSimple *anEvent) | |
20494 | ||
20495 | //======================================================================================================================= | |
20496 | ||
489d5531 | 20497 | void AliFlowAnalysisWithQCumulants::ResetEventByEventQuantities() |
20498 | { | |
20499 | // Reset all event by event quantities. | |
20500 | ||
1268c371 | 20501 | // Reference flow: |
489d5531 | 20502 | fReQ->Zero(); |
20503 | fImQ->Zero(); | |
1268c371 | 20504 | fSpk->Zero(); |
489d5531 | 20505 | fIntFlowCorrelationsEBE->Reset(); |
20506 | fIntFlowEventWeightsForCorrelationsEBE->Reset(); | |
20507 | fIntFlowCorrelationsAllEBE->Reset(); | |
20508 | ||
b92ea2b9 | 20509 | for(Int_t sc=0;sc<2;sc++) |
489d5531 | 20510 | { |
b92ea2b9 | 20511 | fIntFlowCorrectionTermsForNUAEBE[sc]->Reset(); |
20512 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc]->Reset(); | |
489d5531 | 20513 | } |
20514 | ||
1268c371 | 20515 | // Differential flow: |
20516 | if(fCalculateDiffFlow) | |
489d5531 | 20517 | { |
1268c371 | 20518 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) |
489d5531 | 20519 | { |
62e36168 | 20520 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // 1D in pt or eta |
489d5531 | 20521 | { |
1268c371 | 20522 | for(Int_t m=0;m<4;m++) // multiple of harmonic |
489d5531 | 20523 | { |
1268c371 | 20524 | for(Int_t k=0;k<9;k++) // power of weight |
20525 | { | |
20526 | if(fReRPQ1dEBE[t][pe][m][k]) fReRPQ1dEBE[t][pe][m][k]->Reset(); | |
20527 | if(fImRPQ1dEBE[t][pe][m][k]) fImRPQ1dEBE[t][pe][m][k]->Reset(); | |
20528 | } | |
20529 | } | |
489d5531 | 20530 | } |
1268c371 | 20531 | } |
20532 | for(Int_t t=0;t<3;t++) // type (0 = RP, 1 = POI, 2 = RP&&POI ) | |
20533 | { | |
62e36168 | 20534 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // 1D in pt or eta |
489d5531 | 20535 | { |
1268c371 | 20536 | for(Int_t k=0;k<9;k++) |
20537 | { | |
20538 | if(fs1dEBE[t][pe][k]) fs1dEBE[t][pe][k]->Reset(); | |
20539 | } | |
489d5531 | 20540 | } |
20541 | } | |
1268c371 | 20542 | // e-b-e reduced correlations: |
20543 | for(Int_t t=0;t<2;t++) // type (0 = RP, 1 = POI) | |
20544 | { | |
62e36168 | 20545 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 20546 | { |
1268c371 | 20547 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index |
20548 | { | |
20549 | if(fDiffFlowCorrelationsEBE[t][pe][rci]) fDiffFlowCorrelationsEBE[t][pe][rci]->Reset(); | |
20550 | if(fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci]) fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci]->Reset(); | |
20551 | } | |
489d5531 | 20552 | } |
1268c371 | 20553 | } |
20554 | // correction terms for NUA: | |
20555 | for(Int_t t=0;t<2;t++) // type (0 = RP, 1 = POI) | |
20556 | { | |
62e36168 | 20557 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 20558 | { |
1268c371 | 20559 | for(Int_t sc=0;sc<2;sc++) // sin or cos |
489d5531 | 20560 | { |
1268c371 | 20561 | for(Int_t cti=0;cti<9;cti++) // correction term index |
20562 | { | |
489d5531 | 20563 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti]->Reset(); |
1268c371 | 20564 | } |
489d5531 | 20565 | } |
1268c371 | 20566 | } |
20567 | } | |
20568 | } // end of if(fCalculateDiffFlow) | |
20569 | ||
489d5531 | 20570 | // 2D (pt,eta) |
1268c371 | 20571 | if(fCalculate2DDiffFlow) |
489d5531 | 20572 | { |
20573 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
20574 | { | |
20575 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
20576 | { | |
20577 | for(Int_t k=0;k<9;k++) // power of weight | |
20578 | { | |
b77b6434 | 20579 | if(fReRPQ2dEBE[t][m][k]){fReRPQ2dEBE[t][m][k]->Reset();} |
20580 | if(fImRPQ2dEBE[t][m][k]){fImRPQ2dEBE[t][m][k]->Reset();} | |
489d5531 | 20581 | } |
20582 | } | |
20583 | } | |
20584 | for(Int_t t=0;t<3;t++) // type (0 = RP, 1 = POI, 2 = RP&&POI ) | |
20585 | { | |
20586 | for(Int_t k=0;k<9;k++) | |
20587 | { | |
b77b6434 | 20588 | if(fs2dEBE[t][k]){fs2dEBE[t][k]->Reset();} |
489d5531 | 20589 | } |
20590 | } | |
1268c371 | 20591 | } // end of if(fCalculate2DDiffFlow) |
489d5531 | 20592 | |
20593 | } // end of void AliFlowAnalysisWithQCumulants::ResetEventByEventQuantities(); | |
20594 | ||
e1d101a6 | 20595 | //======================================================================================================================= |
489d5531 | 20596 | |
489d5531 | 20597 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTerms(TString type, TString ptOrEta) |
20598 | { | |
20599 | // Calculate correction terms for non-uniform acceptance for differential flow (sin terms). | |
20600 | ||
20601 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][0][cti], where cti runs as follows: | |
20602 | // 0: <<sin n(psi1)>> | |
20603 | // 1: <<sin n(psi1+phi2)>> | |
20604 | // 2: <<sin n(psi1+phi2-phi3)>> | |
20605 | // 3: <<sin n(psi1-phi2-phi3)>>: | |
20606 | // 4: | |
20607 | // 5: | |
20608 | // 6: | |
20609 | ||
20610 | // multiplicity: | |
1268c371 | 20611 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 20612 | |
20613 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
20614 | Double_t dReQ1n = (*fReQ)(0,0); | |
20615 | Double_t dReQ2n = (*fReQ)(1,0); | |
20616 | //Double_t dReQ3n = (*fReQ)(2,0); | |
20617 | //Double_t dReQ4n = (*fReQ)(3,0); | |
20618 | Double_t dImQ1n = (*fImQ)(0,0); | |
20619 | Double_t dImQ2n = (*fImQ)(1,0); | |
20620 | //Double_t dImQ3n = (*fImQ)(2,0); | |
20621 | //Double_t dImQ4n = (*fImQ)(3,0); | |
20622 | ||
2a98ceb8 | 20623 | Int_t t = 0; // type flag |
20624 | Int_t pe = 0; // ptEta flag | |
489d5531 | 20625 | |
20626 | if(type == "RP") | |
20627 | { | |
20628 | t = 0; | |
20629 | } else if(type == "POI") | |
20630 | { | |
20631 | t = 1; | |
20632 | } | |
20633 | ||
20634 | if(ptOrEta == "Pt") | |
20635 | { | |
20636 | pe = 0; | |
20637 | } else if(ptOrEta == "Eta") | |
20638 | { | |
20639 | pe = 1; | |
20640 | } | |
20641 | ||
20642 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
20643 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
20644 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
20645 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
20646 | ||
20647 | // looping over all bins and calculating correction terms: | |
20648 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
20649 | { | |
20650 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
20651 | Double_t p1n0kRe = 0.; | |
20652 | Double_t p1n0kIm = 0.; | |
20653 | ||
20654 | // number of POIs in particular pt or eta bin: | |
20655 | Double_t mp = 0.; | |
20656 | ||
20657 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
20658 | Double_t q1n0kRe = 0.; | |
20659 | Double_t q1n0kIm = 0.; | |
20660 | Double_t q2n0kRe = 0.; | |
20661 | Double_t q2n0kIm = 0.; | |
20662 | ||
20663 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
20664 | Double_t mq = 0.; | |
20665 | ||
20666 | if(type == "POI") | |
20667 | { | |
20668 | // q_{m*n,0}: | |
20669 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
20670 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
20671 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
20672 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
20673 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
20674 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
20675 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
20676 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
20677 | ||
20678 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
20679 | } | |
20680 | else if(type == "RP") | |
20681 | { | |
20682 | // q_{m*n,0}: | |
20683 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
20684 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
20685 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
20686 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
20687 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
20688 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
20689 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
20690 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
20691 | ||
20692 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
20693 | } | |
20694 | if(type == "POI") | |
20695 | { | |
20696 | // p_{m*n,0}: | |
20697 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
20698 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
20699 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
20700 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
20701 | ||
20702 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
20703 | ||
20704 | t = 1; // typeFlag = RP or POI | |
20705 | } | |
20706 | else if(type == "RP") | |
20707 | { | |
20708 | // p_{m*n,0} = q_{m*n,0}: | |
20709 | p1n0kRe = q1n0kRe; | |
20710 | p1n0kIm = q1n0kIm; | |
20711 | ||
20712 | mp = mq; | |
20713 | ||
20714 | t = 0; // typeFlag = RP or POI | |
20715 | } | |
20716 | ||
20717 | // <<sin n(psi1)>>: | |
20718 | Double_t sinP1nPsi = 0.; | |
20719 | if(mp) | |
20720 | { | |
20721 | sinP1nPsi = p1n0kIm/mp; | |
20722 | // fill profile for <<sin n(psi1)>>: | |
20723 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi,mp); | |
20724 | // histogram to store <sin n(psi1)> e-b-e (needed in some other methods): | |
20725 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][0]->SetBinContent(b,sinP1nPsi); | |
20726 | } // end of if(mp) | |
20727 | ||
20728 | // <<sin n(psi1+phi2)>>: | |
20729 | Double_t sinP1nPsiP1nPhi = 0.; | |
20730 | if(mp*dMult-mq) | |
20731 | { | |
20732 | sinP1nPsiP1nPhi = (p1n0kRe*dImQ1n+p1n0kIm*dReQ1n-q2n0kIm)/(mp*dMult-mq); | |
20733 | // fill profile for <<sin n(psi1+phi2)>>: | |
20734 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsiP1nPhi,mp*dMult-mq); | |
20735 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
20736 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][1]->SetBinContent(b,sinP1nPsiP1nPhi); | |
20737 | } // end of if(mp*dMult-mq) | |
20738 | ||
20739 | // <<sin n(psi1+phi2-phi3)>>: | |
20740 | Double_t sinP1nPsi1P1nPhi2MPhi3 = 0.; | |
20741 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
20742 | { | |
20743 | sinP1nPsi1P1nPhi2MPhi3 = (p1n0kIm*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult) | |
20744 | - 1.*(q2n0kIm*dReQ1n-q2n0kRe*dImQ1n) | |
20745 | - mq*dImQ1n+2.*q1n0kIm) | |
20746 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
20747 | // fill profile for <<sin n(psi1+phi2)>>: | |
20748 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
20749 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
20750 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][2]->SetBinContent(b,sinP1nPsi1P1nPhi2MPhi3); | |
20751 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
20752 | ||
20753 | // <<sin n(psi1-phi2-phi3)>>: | |
20754 | Double_t sinP1nPsi1M1nPhi2MPhi3 = 0.; | |
20755 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
20756 | { | |
20757 | sinP1nPsi1M1nPhi2MPhi3 = (p1n0kIm*(pow(dReQ1n,2.)-pow(dImQ1n,2.))-2.*p1n0kRe*dReQ1n*dImQ1n | |
20758 | - 1.*(p1n0kIm*dReQ2n-p1n0kRe*dImQ2n) | |
20759 | + 2.*mq*dImQ1n-2.*q1n0kIm) | |
20760 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
20761 | // fill profile for <<sin n(psi1+phi2)>>: | |
20762 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
20763 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
20764 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][3]->SetBinContent(b,sinP1nPsi1M1nPhi2MPhi3); | |
20765 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
20766 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
20767 | ||
20768 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTerms(TString type, TString ptOrEta) | |
20769 | ||
20770 | ||
e1d101a6 | 20771 | //======================================================================================================================= |
489d5531 | 20772 | |
20773 | ||
20774 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTerms(TString type, TString ptOrEta) | |
20775 | { | |
20776 | // Calculate correction terms for non-uniform acceptance for differential flow (cos terms). | |
20777 | ||
20778 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][1][cti], where cti runs as follows: | |
20779 | // 0: <<cos n(psi)>> | |
20780 | // 1: <<cos n(psi1+phi2)>> | |
20781 | // 2: <<cos n(psi1+phi2-phi3)>> | |
20782 | // 3: <<cos n(psi1-phi2-phi3)>> | |
20783 | // 4: | |
20784 | // 5: | |
20785 | // 6: | |
20786 | ||
20787 | // multiplicity: | |
1268c371 | 20788 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 20789 | |
20790 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
20791 | Double_t dReQ1n = (*fReQ)(0,0); | |
20792 | Double_t dReQ2n = (*fReQ)(1,0); | |
20793 | //Double_t dReQ3n = (*fReQ)(2,0); | |
20794 | //Double_t dReQ4n = (*fReQ)(3,0); | |
20795 | Double_t dImQ1n = (*fImQ)(0,0); | |
20796 | Double_t dImQ2n = (*fImQ)(1,0); | |
20797 | //Double_t dImQ3n = (*fImQ)(2,0); | |
20798 | //Double_t dImQ4n = (*fImQ)(3,0); | |
20799 | ||
2a98ceb8 | 20800 | Int_t t = 0; // type flag |
20801 | Int_t pe = 0; // ptEta flag | |
489d5531 | 20802 | |
20803 | if(type == "RP") | |
20804 | { | |
20805 | t = 0; | |
20806 | } else if(type == "POI") | |
20807 | { | |
20808 | t = 1; | |
20809 | } | |
20810 | ||
20811 | if(ptOrEta == "Pt") | |
20812 | { | |
20813 | pe = 0; | |
20814 | } else if(ptOrEta == "Eta") | |
20815 | { | |
20816 | pe = 1; | |
20817 | } | |
20818 | ||
20819 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
20820 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
20821 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
20822 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
20823 | ||
20824 | // looping over all bins and calculating correction terms: | |
20825 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
20826 | { | |
20827 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
20828 | Double_t p1n0kRe = 0.; | |
20829 | Double_t p1n0kIm = 0.; | |
20830 | ||
20831 | // number of POIs in particular pt or eta bin: | |
20832 | Double_t mp = 0.; | |
20833 | ||
20834 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
20835 | Double_t q1n0kRe = 0.; | |
20836 | Double_t q1n0kIm = 0.; | |
20837 | Double_t q2n0kRe = 0.; | |
20838 | Double_t q2n0kIm = 0.; | |
20839 | ||
20840 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
20841 | Double_t mq = 0.; | |
20842 | ||
20843 | if(type == "POI") | |
20844 | { | |
20845 | // q_{m*n,0}: | |
20846 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
20847 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
20848 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
20849 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
20850 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
20851 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
20852 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
20853 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
20854 | ||
20855 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
20856 | } | |
20857 | else if(type == "RP") | |
20858 | { | |
20859 | // q_{m*n,0}: | |
20860 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
20861 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
20862 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
20863 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
20864 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
20865 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
20866 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
20867 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
20868 | ||
20869 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
20870 | } | |
20871 | if(type == "POI") | |
20872 | { | |
20873 | // p_{m*n,0}: | |
20874 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
20875 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
20876 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
20877 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
20878 | ||
20879 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
20880 | ||
20881 | t = 1; // typeFlag = RP or POI | |
20882 | } | |
20883 | else if(type == "RP") | |
20884 | { | |
20885 | // p_{m*n,0} = q_{m*n,0}: | |
20886 | p1n0kRe = q1n0kRe; | |
20887 | p1n0kIm = q1n0kIm; | |
20888 | ||
20889 | mp = mq; | |
20890 | ||
20891 | t = 0; // typeFlag = RP or POI | |
20892 | } | |
20893 | ||
20894 | // <<cos n(psi1)>>: | |
20895 | Double_t cosP1nPsi = 0.; | |
20896 | if(mp) | |
20897 | { | |
20898 | cosP1nPsi = p1n0kRe/mp; | |
20899 | ||
20900 | // fill profile for <<cos n(psi1)>>: | |
20901 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi,mp); | |
20902 | // histogram to store <cos n(psi1)> e-b-e (needed in some other methods): | |
20903 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][0]->SetBinContent(b,cosP1nPsi); | |
20904 | } // end of if(mp) | |
20905 | ||
20906 | // <<cos n(psi1+phi2)>>: | |
20907 | Double_t cosP1nPsiP1nPhi = 0.; | |
20908 | if(mp*dMult-mq) | |
20909 | { | |
20910 | cosP1nPsiP1nPhi = (p1n0kRe*dReQ1n-p1n0kIm*dImQ1n-q2n0kRe)/(mp*dMult-mq); | |
20911 | // fill profile for <<sin n(psi1+phi2)>>: | |
20912 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsiP1nPhi,mp*dMult-mq); | |
20913 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
20914 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][1]->SetBinContent(b,cosP1nPsiP1nPhi); | |
20915 | } // end of if(mp*dMult-mq) | |
20916 | ||
20917 | // <<cos n(psi1+phi2-phi3)>>: | |
20918 | Double_t cosP1nPsi1P1nPhi2MPhi3 = 0.; | |
20919 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
20920 | { | |
20921 | cosP1nPsi1P1nPhi2MPhi3 = (p1n0kRe*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult) | |
20922 | - 1.*(q2n0kRe*dReQ1n+q2n0kIm*dImQ1n) | |
20923 | - mq*dReQ1n+2.*q1n0kRe) | |
20924 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
20925 | // fill profile for <<sin n(psi1+phi2)>>: | |
20926 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
20927 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
20928 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][2]->SetBinContent(b,cosP1nPsi1P1nPhi2MPhi3); | |
20929 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
20930 | ||
20931 | // <<cos n(psi1-phi2-phi3)>>: | |
20932 | Double_t cosP1nPsi1M1nPhi2MPhi3 = 0.; | |
20933 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
20934 | { | |
20935 | cosP1nPsi1M1nPhi2MPhi3 = (p1n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.))+2.*p1n0kIm*dReQ1n*dImQ1n | |
20936 | - 1.*(p1n0kRe*dReQ2n+p1n0kIm*dImQ2n) | |
20937 | - 2.*mq*dReQ1n+2.*q1n0kRe) | |
20938 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
20939 | // fill profile for <<sin n(psi1+phi2)>>: | |
20940 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
20941 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
20942 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][3]->SetBinContent(b,cosP1nPsi1M1nPhi2MPhi3); | |
20943 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
20944 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
20945 | ||
20946 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTerms(TString type, TString ptOrEta) | |
20947 | ||
e1d101a6 | 20948 | //========================================================================================================================= |
489d5531 | 20949 | |
489d5531 | 20950 | void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUADiffFlow(TString type, TString ptOrEta) |
20951 | { | |
1268c371 | 20952 | // Transfer profiles into histogams and correctly propagate the error. |
489d5531 | 20953 | |
2a98ceb8 | 20954 | Int_t t = 0; // type flag |
20955 | Int_t pe = 0; // ptEta flag | |
489d5531 | 20956 | |
20957 | if(type == "RP") | |
20958 | { | |
20959 | t = 0; | |
20960 | } else if(type == "POI") | |
20961 | { | |
20962 | t = 1; | |
20963 | } | |
20964 | ||
20965 | if(ptOrEta == "Pt") | |
20966 | { | |
20967 | pe = 0; | |
20968 | } else if(ptOrEta == "Eta") | |
20969 | { | |
20970 | pe = 1; | |
20971 | } | |
20972 | ||
20973 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
20974 | //Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
20975 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
20976 | //Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
20977 | ||
20978 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
20979 | { | |
20980 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
20981 | { | |
20982 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
20983 | { | |
20984 | Double_t correctionTerm = fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]->GetBinContent(b); | |
20985 | fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]->SetBinContent(b,correctionTerm); | |
20986 | // to be improved (propagate error correctly) | |
20987 | // ... | |
20988 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
20989 | } // correction term index | |
20990 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
20991 | ||
20992 | }// end of void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUADiffFlow(TString type, TString ptOrEta) | |
20993 | ||
e1d101a6 | 20994 | //========================================================================================================================= |
489d5531 | 20995 | |
489d5531 | 20996 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta) |
20997 | { | |
1268c371 | 20998 | // Calculate generalized differential flow cumulants (corrected for non-uniform acceptance). |
20999 | ||
21000 | // to be improved - propagate error also from non-isotropic terms | |
489d5531 | 21001 | |
1268c371 | 21002 | Int_t t = 0; // RP = 0, POI = 1 |
21003 | Int_t pe = 0; // pt = 0, eta = 1 | |
489d5531 | 21004 | |
21005 | if(type == "RP") | |
21006 | { | |
1268c371 | 21007 | t = 0; |
489d5531 | 21008 | } else if(type == "POI") |
21009 | { | |
1268c371 | 21010 | t = 1; |
489d5531 | 21011 | } |
21012 | ||
21013 | if(ptOrEta == "Pt") | |
21014 | { | |
1268c371 | 21015 | pe = 0; |
489d5531 | 21016 | } else if(ptOrEta == "Eta") |
21017 | { | |
1268c371 | 21018 | pe = 1; |
489d5531 | 21019 | } |
1268c371 | 21020 | |
21021 | // Common: | |
489d5531 | 21022 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
489d5531 | 21023 | // 2-particle correlation: |
21024 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> | |
1268c371 | 21025 | // sinus terms coming from reference flow: |
489d5531 | 21026 | Double_t sinP1nPhi = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1); // <<sin(n*phi1)>> |
21027 | Double_t sinP1nPhi1P1nPhi2 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2); // <<sin(n*(phi1+phi2))>> | |
21028 | Double_t sinP1nPhi1M1nPhi2M1nPhi3 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(3); // <<sin(n*(phi1-phi2-phi3))>> | |
1268c371 | 21029 | // cosinus terms coming from reference flow: |
489d5531 | 21030 | Double_t cosP1nPhi = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1); // <<cos(n*phi1)>> |
21031 | Double_t cosP1nPhi1P1nPhi2 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2); // <<cos(n*(phi1+phi2))>> | |
21032 | Double_t cosP1nPhi1M1nPhi2M1nPhi3 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(3); // <<cos(n*(phi1-phi2-phi3))>> | |
21033 | ||
21034 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
21035 | { | |
21036 | Double_t twoPrime = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); // <<2'>> | |
21037 | Double_t fourPrime = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); // <<4'>> | |
21038 | Double_t sinP1nPsi = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][0]->GetBinContent(b); // <<sin n(Psi)>> | |
21039 | Double_t cosP1nPsi = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][0]->GetBinContent(b); // <<cos n(Psi)>> | |
21040 | Double_t sinP1nPsi1P1nPhi2 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][1]->GetBinContent(b); // <<sin n(psi1+phi2)>> | |
21041 | Double_t cosP1nPsi1P1nPhi2 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][1]->GetBinContent(b); // <<cos n(psi1+phi2)>> | |
21042 | Double_t sinP1nPsi1P1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][2]->GetBinContent(b); // <<sin n(psi1+phi2-phi3)>> | |
21043 | Double_t cosP1nPsi1P1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][2]->GetBinContent(b); // <<cos n(psi1+phi2-phi3)>> | |
21044 | Double_t sinP1nPsi1M1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][3]->GetBinContent(b); // <<sin n(psi1-phi2-phi3)>> | |
21045 | Double_t cosP1nPsi1M1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][3]->GetBinContent(b); // <<cos n(psi1-phi2-phi3)>> | |
1268c371 | 21046 | // Generalized QC{2'}: |
489d5531 | 21047 | Double_t qc2Prime = twoPrime - sinP1nPsi*sinP1nPhi - cosP1nPsi*cosP1nPhi; |
1268c371 | 21048 | if(fApplyCorrectionForNUA) |
21049 | { | |
21050 | fDiffFlowCumulants[t][pe][0]->SetBinContent(b,qc2Prime); | |
21051 | } | |
21052 | if(TMath::Abs(twoPrime)>0.) | |
21053 | { | |
21054 | fDiffFlowDetectorBias[t][pe][0]->SetBinContent(b,qc2Prime/twoPrime); // detector bias = generalized/isotropic cumulant. | |
21055 | } | |
21056 | // Generalized QC{4'}: | |
489d5531 | 21057 | Double_t qc4Prime = fourPrime-2.*twoPrime*two |
21058 | - cosP1nPsi*cosP1nPhi1M1nPhi2M1nPhi3 | |
21059 | + sinP1nPsi*sinP1nPhi1M1nPhi2M1nPhi3 | |
21060 | - cosP1nPhi*cosP1nPsi1M1nPhi2M1nPhi3 | |
21061 | + sinP1nPhi*sinP1nPsi1M1nPhi2M1nPhi3 | |
21062 | - 2.*cosP1nPhi*cosP1nPsi1P1nPhi2M1nPhi3 | |
21063 | - 2.*sinP1nPhi*sinP1nPsi1P1nPhi2M1nPhi3 | |
21064 | - cosP1nPsi1P1nPhi2*cosP1nPhi1P1nPhi2 | |
21065 | - sinP1nPsi1P1nPhi2*sinP1nPhi1P1nPhi2 | |
21066 | + 2.*cosP1nPhi1P1nPhi2*(cosP1nPsi*cosP1nPhi-sinP1nPsi*sinP1nPhi) | |
21067 | + 2.*sinP1nPhi1P1nPhi2*(cosP1nPsi*sinP1nPhi+sinP1nPsi*cosP1nPhi) | |
21068 | + 4.*two*(cosP1nPsi*cosP1nPhi+sinP1nPsi*sinP1nPhi) | |
21069 | + 2.*cosP1nPsi1P1nPhi2*(pow(cosP1nPhi,2.)-pow(sinP1nPhi,2.)) | |
21070 | + 4.*sinP1nPsi1P1nPhi2*cosP1nPhi*sinP1nPhi | |
21071 | + 4.*twoPrime*(pow(cosP1nPhi,2.)+pow(sinP1nPhi,2.)) | |
21072 | - 6.*(pow(cosP1nPhi,2.)-pow(sinP1nPhi,2.)) | |
21073 | * (cosP1nPsi*cosP1nPhi-sinP1nPsi*sinP1nPhi) | |
21074 | - 12.*cosP1nPhi*sinP1nPhi | |
21075 | * (sinP1nPsi*cosP1nPhi+cosP1nPsi*sinP1nPhi); | |
1268c371 | 21076 | if(fApplyCorrectionForNUA) |
21077 | { | |
21078 | fDiffFlowCumulants[t][pe][1]->SetBinContent(b,qc4Prime); | |
21079 | } | |
21080 | if(TMath::Abs(fourPrime-2.*twoPrime*two)>0.) | |
21081 | { | |
21082 | fDiffFlowDetectorBias[t][pe][1]->SetBinContent(b,qc4Prime/(fourPrime-2.*twoPrime*two)); // detector bias = generalized/isotropic cumulant. | |
21083 | } | |
489d5531 | 21084 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
21085 | ||
21086 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta) | |
21087 | ||
1268c371 | 21088 | //================================================================================================================================== |
489d5531 | 21089 | |
21090 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta) | |
21091 | { | |
21092 | // Calculate differential flow corrected for non-uniform acceptance. | |
21093 | ||
1268c371 | 21094 | // to be improved: eventually I will have to access here masured correlations and NUA terms |
21095 | // instead of cumulants in order to propagate statistical error correctly also | |
21096 | // to NUA terms (propagating errors directly from cumulants is WRONG for | |
21097 | // differential flow becuase that doesn't account at all cross-covariance terms) | |
489d5531 | 21098 | |
1268c371 | 21099 | // REMARK: When NUA correction is apllied error for differential flow DOES NOT get corrected, |
21100 | // i.e. only value is being corrected, error is still the one relevant for isotropic | |
21101 | // case. This eventually will be resolved. | |
21102 | ||
21103 | ||
21104 | Int_t t = 0; // RP or POI | |
21105 | Int_t pe = 0; // pt or eta | |
489d5531 | 21106 | |
21107 | if(type == "RP") | |
21108 | { | |
1268c371 | 21109 | t = 0; |
489d5531 | 21110 | } else if(type == "POI") |
21111 | { | |
1268c371 | 21112 | t = 1; |
21113 | } | |
489d5531 | 21114 | if(ptOrEta == "Pt") |
21115 | { | |
1268c371 | 21116 | pe = 0; |
489d5531 | 21117 | } else if(ptOrEta == "Eta") |
21118 | { | |
1268c371 | 21119 | pe = 1; |
489d5531 | 21120 | } |
21121 | ||
1268c371 | 21122 | // Common: |
489d5531 | 21123 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
1268c371 | 21124 | // Reference Q-cumulants |
21125 | Double_t qc2 = fIntFlowQcumulants->GetBinContent(1); // QC{2} | |
21126 | Double_t qc4 = fIntFlowQcumulants->GetBinContent(2); // QC{4} | |
21127 | // Loop over pt or eta bins: | |
489d5531 | 21128 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) |
21129 | { | |
1268c371 | 21130 | // Differential Q-cumulants: |
21131 | Double_t qc2Prime = fDiffFlowCumulants[t][pe][0]->GetBinContent(b); // QC{2'} | |
21132 | Double_t qc4Prime = fDiffFlowCumulants[t][pe][1]->GetBinContent(b); // QC{4'} | |
489d5531 | 21133 | // v'{2}: |
1268c371 | 21134 | if(qc2>0.) |
489d5531 | 21135 | { |
1268c371 | 21136 | Double_t v2Prime = qc2Prime/pow(qc2,0.5); |
21137 | if(TMath::Abs(v2Prime)>0.){fDiffFlow[t][pe][0]->SetBinContent(b,v2Prime);} | |
489d5531 | 21138 | } |
489d5531 | 21139 | // v'{4}: |
1268c371 | 21140 | if(qc4<0.) |
489d5531 | 21141 | { |
1268c371 | 21142 | Double_t v4Prime = -qc4Prime/pow(-qc4,3./4.); |
21143 | if(TMath::Abs(v4Prime)>0.){fDiffFlow[t][pe][1]->SetBinContent(b,v4Prime);} | |
489d5531 | 21144 | } |
21145 | } // end of for(Int_t b=1;b<=fnBinsPtEta[pe];b++) | |
21146 | ||
21147 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta); | |
21148 | ||
e1d101a6 | 21149 | //========================================================================================================================= |
489d5531 | 21150 | |
0328db2d | 21151 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoops(AliFlowEventSimple * const anEvent) |
489d5531 | 21152 | { |
21153 | // Evaluate with nested loops multiparticle correlations for integrated flow (without using the particle weights). | |
21154 | ||
21155 | // Remark: Results are stored in profile fIntFlowDirectCorrelations whose binning is organized as follows: | |
21156 | // | |
21157 | // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))> | |
21158 | // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))> | |
21159 | // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))> | |
21160 | // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))> | |
21161 | // 5th bin: ---- EMPTY ---- | |
21162 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))> | |
21163 | // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))> | |
21164 | // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))> | |
21165 | // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))> | |
21166 | // 10th bin: ---- EMPTY ---- | |
21167 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))> | |
21168 | // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))> | |
21169 | // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))> | |
21170 | // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))> | |
21171 | // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))> | |
21172 | // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))> | |
21173 | // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> | |
21174 | // 18th bin: ---- EMPTY ---- | |
21175 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))> | |
21176 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))> | |
21177 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))> | |
21178 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))> | |
21179 | // 23rd bin: ---- EMPTY ---- | |
21180 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> | |
21181 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))> | |
21182 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))> | |
21183 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))> | |
21184 | // 28th bin: ---- EMPTY ---- | |
21185 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> | |
21186 | // 30th bin: ---- EMPTY ---- | |
21187 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> | |
8ed4edc7 | 21188 | // 32nd bin: ---- EMPTY ---- |
b84464d3 | 21189 | // Extra correlations for 3p TY study: |
8ed4edc7 | 21190 | // 33rd bin: <4>_{4n,2n|3n,3n}= four4n2n3n3n = <cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4))> |
b84464d3 | 21191 | // 34th bin: <5>_{3n,3n|2n,2n,2n} = five3n3n2n2n2n = <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-2*phi5))> |
21192 | // Extra correlations for 6p TY study: | |
21193 | // 35th bin: <2>_{5n|5n} = two5n5n = <cos(5n*(phi1-phi2)> T | |
21194 | // 36th bin: <2>_{6n|6n} = two6n6n = <cos(6n*(phi1-phi2)> T | |
21195 | // 37th bin: <3>_{5n|3n,2n} = three5n3n2n = <cos(n*(5*phi1-3*phi2-2*phi3)> | |
21196 | // 38th bin: <3>_{5n|4n,1n} = three5n4n1n = <cos(n*(5*phi1-4*phi2-1*phi3)> | |
21197 | // 39th bin: <3>_{6n|3n,3n} = three6n3n3n = <cos(n*(6*phi1-3*phi2-3*phi3)> T | |
21198 | // 40th bin: <3>_{6n|4n,2n} = three6n4n2n = <cos(n*(6*phi1-4*phi2-2*phi3)> T | |
21199 | // 41st bin: <3>_{6n|5n,1n} = three6n5n1n = <cos(n*(6*phi1-5*phi2-1*phi3)> | |
21200 | // 42nd bin: <4>_{6n|3n,2n,1n} = four6n3n2n1n = <cos(n*(6*phi1-3*phi2-2*phi3-1*phi4)> | |
21201 | // 43rd bin: <4>_{3n,2n|3n,2n} = four3n2n3n2n = <cos(n*(3*phi1+2*phi2-3*phi3-2*phi4)> | |
21202 | // 44th bin: <4>_{4n,1n|3n,2n} = four4n1n3n2n = <cos(n*(4*phi1+1*phi2-3*phi3-2*phi4)> | |
21203 | // 45th bin: <4>_{3n,3n|3n,3n} = four3n3n3n3n = <cos(3.*n*(phi1+phi2-phi3-phi4))> T | |
21204 | // 46th bin: <4>_{4n,2n|3n,3n} = four4n2n3n3n = <cos(n*(4*phi1+2*phi2-3*phi3-3*phi4)> | |
21205 | // 47th bin: <4>_{5n,1n|3n,3n} = four5n1n3n3n = <cos(n*(5*phi1+1*phi2-3*phi3-3*phi4)> | |
21206 | // 48th bin: <4>_{4n,2n|4n,2n} = four4n2n4n2n = <cos(n*(4*phi1+2*phi2-4*phi3-2*phi4)> T | |
21207 | // 49th bin: <4>_{5n,1n|4n,2n} = four5n1n4n2n = <cos(n*(5*phi1+1*phi2-4*phi3-2*phi4)> | |
21208 | // 50th bin: <4>_{5n|3n,1n,1n} = four5n3n1n1n = <cos(n*(5*phi1-3*phi2-1*phi3-1*phi4)> | |
21209 | // 51st bin: <4>_{5n|2n,2n,1n} = four5n2n2n1n = <cos(n*(5*phi1-2*phi2-2*phi3-1*phi4)> | |
21210 | // 52nd bin: <4>_{5n,1n|5n,1n} = four5n1n5n1n = <cos(n*(5*phi1+1*phi2-5*phi3-1*phi4)> | |
21211 | // 53rd bin: <5>_{3n,3n|3n,2n,1n} = four3n3n3n2n1n = <cos(n*(3*phi1+3*phi2-3*phi3-2*phi4-1*phi5)> | |
21212 | // 54th bin: <5>_{4n,2n|3n,2n,1n} = four4n2n3n2n1n = <cos(n*(4*phi1+2*phi2-3*phi3-2*phi4-1*phi5)> | |
21213 | // 55th bin: <5>_{3n,2n|3n,1n,1n} = four3n2n3n1n1n = <cos(n*(3*phi1+2*phi2-3*phi3-1*phi4-1*phi5)> | |
21214 | // 56th bin: <5>_{3n,2n|2n,2n,1n} = four3n2n2n2n1n = <cos(n*(3*phi1+2*phi2-2*phi3-2*phi4-1*phi5)> | |
21215 | // 57th bin: <5>_{5n,1n|3n,2n,1n} = four5n1n3n2n1n = <cos(n*(5*phi1+1*phi2-3*phi3-2*phi4-1*phi5)> | |
21216 | // 58th bin: <6>_{3n,2n,1n|3n,2n,1n} = six3n2n1n3n2n1n = <cos(n*(3*phi1+2*phi2+1*phi3-3*phi4-2*phi5-1*phi6)> | |
8ed4edc7 | 21217 | |
489d5531 | 21218 | Int_t nPrim = anEvent->NumberOfTracks(); |
21219 | AliFlowTrackSimple *aftsTrack = NULL; | |
21220 | Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; | |
21221 | Int_t n = fHarmonic; | |
21222 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 21223 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 21224 | cout<<endl; |
21225 | cout<<"Multiparticle correlations: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
21226 | if(dMult<2) | |
21227 | { | |
21228 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
21229 | } else if (dMult>fMaxAllowedMultiplicity) | |
21230 | { | |
21231 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
21232 | } else | |
21233 | { | |
21234 | cout<<"... evaluating nested loops (without using particle weights)..."<<endl; | |
21235 | } | |
21236 | ||
21237 | // 2-particle correlations: | |
21238 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
21239 | { | |
21240 | for(Int_t i1=0;i1<nPrim;i1++) | |
21241 | { | |
21242 | aftsTrack=anEvent->GetTrack(i1); | |
21243 | if(!(aftsTrack->InRPSelection())) continue; | |
21244 | phi1=aftsTrack->Phi(); | |
21245 | for(Int_t i2=0;i2<nPrim;i2++) | |
21246 | { | |
21247 | if(i2==i1)continue; | |
21248 | aftsTrack=anEvent->GetTrack(i2); | |
21249 | if(!(aftsTrack->InRPSelection())) continue; | |
21250 | phi2=aftsTrack->Phi(); | |
21251 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
21252 | // fill the profile with 2-p correlations: | |
b84464d3 | 21253 | fIntFlowDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),1.); // <cos(n*(phi1-phi2))> |
21254 | fIntFlowDirectCorrelations->Fill(1.5,cos(2.*n*(phi1-phi2)),1.); // <cos(2n*(phi1-phi2))> | |
21255 | fIntFlowDirectCorrelations->Fill(2.5,cos(3.*n*(phi1-phi2)),1.); // <cos(3n*(phi1-phi2))> | |
21256 | fIntFlowDirectCorrelations->Fill(3.5,cos(4.*n*(phi1-phi2)),1.); // <cos(4n*(phi1-phi2))> | |
21257 | fIntFlowDirectCorrelations->Fill(34.5,cos(5.*n*(phi1-phi2)),1.); // <cos(5n*(phi1-phi2))> | |
21258 | fIntFlowDirectCorrelations->Fill(35.5,cos(6.*n*(phi1-phi2)),1.); // <cos(6n*(phi1-phi2))> | |
489d5531 | 21259 | } // end of for(Int_t i2=0;i2<nPrim;i2++) |
21260 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
21261 | } // end of if(nPrim>=2) | |
21262 | ||
21263 | // 3-particle correlations: | |
21264 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
21265 | { | |
21266 | for(Int_t i1=0;i1<nPrim;i1++) | |
21267 | { | |
21268 | aftsTrack=anEvent->GetTrack(i1); | |
21269 | if(!(aftsTrack->InRPSelection())) continue; | |
21270 | phi1=aftsTrack->Phi(); | |
21271 | for(Int_t i2=0;i2<nPrim;i2++) | |
21272 | { | |
21273 | if(i2==i1)continue; | |
21274 | aftsTrack=anEvent->GetTrack(i2); | |
21275 | if(!(aftsTrack->InRPSelection())) continue; | |
21276 | phi2=aftsTrack->Phi(); | |
21277 | for(Int_t i3=0;i3<nPrim;i3++) | |
21278 | { | |
21279 | if(i3==i1||i3==i2)continue; | |
21280 | aftsTrack=anEvent->GetTrack(i3); | |
21281 | if(!(aftsTrack->InRPSelection())) continue; | |
21282 | phi3=aftsTrack->Phi(); | |
21283 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
21284 | // fill the profile with 3-p correlations: | |
b84464d3 | 21285 | fIntFlowDirectCorrelations->Fill(5.,cos(2.*n*phi1-n*(phi2+phi3)),1.); //<3>_{2n|nn,n} |
21286 | fIntFlowDirectCorrelations->Fill(6.,cos(3.*n*phi1-2.*n*phi2-n*phi3),1.); //<3>_{3n|2n,n} | |
21287 | fIntFlowDirectCorrelations->Fill(7.,cos(4.*n*phi1-2.*n*phi2-2.*n*phi3),1.); //<3>_{4n|2n,2n} | |
21288 | fIntFlowDirectCorrelations->Fill(8.,cos(4.*n*phi1-3.*n*phi2-n*phi3),1.); //<3>_{4n|3n,n} | |
21289 | fIntFlowDirectCorrelations->Fill(36.5,cos(5.*n*phi1-3.*n*phi2-2.*n*phi3),1.); //<3>_{5n|3n,2n} | |
21290 | fIntFlowDirectCorrelations->Fill(37.5,cos(5.*n*phi1-4.*n*phi2-1.*n*phi3),1.); //<3>_{5n|4n,1n} | |
21291 | fIntFlowDirectCorrelations->Fill(38.5,cos(6.*n*phi1-3.*n*phi2-3.*n*phi3),1.); //<3>_{6n|3n,3n} | |
21292 | fIntFlowDirectCorrelations->Fill(39.5,cos(6.*n*phi1-4.*n*phi2-2.*n*phi3),1.); //<3>_{6n|4n,2n} | |
21293 | fIntFlowDirectCorrelations->Fill(40.5,cos(6.*n*phi1-5.*n*phi2-1.*n*phi3),1.); //<3>_{6n|5n,1n} | |
489d5531 | 21294 | } // end of for(Int_t i3=0;i3<nPrim;i3++) |
21295 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
21296 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
21297 | } // end of if(nPrim>=3) | |
21298 | ||
21299 | // 4-particle correlations: | |
21300 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) | |
21301 | { | |
21302 | for(Int_t i1=0;i1<nPrim;i1++) | |
21303 | { | |
21304 | aftsTrack=anEvent->GetTrack(i1); | |
21305 | if(!(aftsTrack->InRPSelection())) continue; | |
21306 | phi1=aftsTrack->Phi(); | |
21307 | for(Int_t i2=0;i2<nPrim;i2++) | |
21308 | { | |
21309 | if(i2==i1)continue; | |
21310 | aftsTrack=anEvent->GetTrack(i2); | |
21311 | if(!(aftsTrack->InRPSelection())) continue; | |
21312 | phi2=aftsTrack->Phi(); | |
21313 | for(Int_t i3=0;i3<nPrim;i3++) | |
21314 | { | |
21315 | if(i3==i1||i3==i2)continue; | |
21316 | aftsTrack=anEvent->GetTrack(i3); | |
21317 | if(!(aftsTrack->InRPSelection())) continue; | |
21318 | phi3=aftsTrack->Phi(); | |
21319 | for(Int_t i4=0;i4<nPrim;i4++) | |
21320 | { | |
21321 | if(i4==i1||i4==i2||i4==i3)continue; | |
21322 | aftsTrack=anEvent->GetTrack(i4); | |
21323 | if(!(aftsTrack->InRPSelection())) continue; | |
21324 | phi4=aftsTrack->Phi(); | |
21325 | if(nPrim==4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; | |
21326 | // fill the profile with 4-p correlations: | |
21327 | fIntFlowDirectCorrelations->Fill(10.,cos(n*phi1+n*phi2-n*phi3-n*phi4),1.); // <4>_{n,n|n,n} | |
21328 | fIntFlowDirectCorrelations->Fill(11.,cos(2.*n*phi1+n*phi2-2.*n*phi3-n*phi4),1.); // <4>_{2n,n|2n,n} | |
21329 | fIntFlowDirectCorrelations->Fill(12.,cos(2.*n*phi1+2*n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{2n,2n|2n,2n} | |
21330 | fIntFlowDirectCorrelations->Fill(13.,cos(3.*n*phi1-n*phi2-n*phi3-n*phi4),1.); // <4>_{3n|n,n,n} | |
21331 | fIntFlowDirectCorrelations->Fill(14.,cos(3.*n*phi1+n*phi2-3.*n*phi3-n*phi4),1.); // <4>_{3n,n|3n,n} | |
21332 | fIntFlowDirectCorrelations->Fill(15.,cos(3.*n*phi1+n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{3n,n|2n,2n} | |
21333 | fIntFlowDirectCorrelations->Fill(16.,cos(4.*n*phi1-2.*n*phi2-n*phi3-n*phi4),1.); // <4>_{4n|2n,n,n} | |
b84464d3 | 21334 | fIntFlowDirectCorrelations->Fill(32.,cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4)),1.); // <4>_{4n,2n|3n,3n} |
21335 | fIntFlowDirectCorrelations->Fill(41.5,cos(n*(6.*phi1-3.*phi2-2.*phi3-1.*phi4)),1.); // <4>_{6n|3n,2n,1n} | |
21336 | fIntFlowDirectCorrelations->Fill(42.5,cos(n*(3.*phi1+2.*phi2-3.*phi3-2.*phi4)),1.); // <4>_{3n,2n|3n,2n} | |
21337 | fIntFlowDirectCorrelations->Fill(43.5,cos(n*(4.*phi1+1.*phi2-3.*phi3-2.*phi4)),1.); // <4>_{4n,1n|3n,2n} | |
21338 | fIntFlowDirectCorrelations->Fill(44.5,cos(n*(3.*phi1+3.*phi2-3.*phi3-3.*phi4)),1.); // <4>_{3n,3n|3n,3n} | |
21339 | fIntFlowDirectCorrelations->Fill(45.5,cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4)),1.); // <4>_{4n,2n|3n,3n} | |
21340 | fIntFlowDirectCorrelations->Fill(46.5,cos(n*(5.*phi1+1.*phi2-3.*phi3-3.*phi4)),1.); // <4>_{5n,1n|3n,3n} | |
21341 | fIntFlowDirectCorrelations->Fill(47.5,cos(n*(4.*phi1+2.*phi2-4.*phi3-2.*phi4)),1.); // <4>_{4n,2n|4n,2n} | |
21342 | fIntFlowDirectCorrelations->Fill(48.5,cos(n*(5.*phi1+1.*phi2-4.*phi3-2.*phi4)),1.); // <4>_{5n,1n|4n,2n} | |
21343 | fIntFlowDirectCorrelations->Fill(49.5,cos(n*(5.*phi1-3.*phi2-1.*phi3-1.*phi4)),1.); // <4>_{5n|3n,1n,1n} | |
21344 | fIntFlowDirectCorrelations->Fill(50.5,cos(n*(5.*phi1-2.*phi2-2.*phi3-1.*phi4)),1.); // <4>_{5n|2n,2n,1n} | |
403e3389 | 21345 | fIntFlowDirectCorrelations->Fill(51.5,cos(n*(5.*phi1+1.*phi2-5.*phi3-1.*phi4)),1.); // <4>_{5n,1n|5n,1n} |
21346 | fIntFlowDirectCorrelations->Fill(58.5,cos(n*(6.*phi1-4.*phi2-1.*phi3-1.*phi4)),1.); // <4>_{6n|4n,1n,1n} | |
21347 | fIntFlowDirectCorrelations->Fill(59.5,cos(n*(6.*phi1-2.*phi2-2.*phi3-2.*phi4)),1.); // <4>_{6n|2n,2n,2n} | |
489d5531 | 21348 | } // end of for(Int_t i4=0;i4<nPrim;i4++) |
21349 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
21350 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
21351 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
21352 | } // end of if(nPrim>=) | |
21353 | ||
21354 | // 5-particle correlations: | |
21355 | if(nPrim>=5 && nPrim<=fMaxAllowedMultiplicity) | |
21356 | { | |
21357 | for(Int_t i1=0;i1<nPrim;i1++) | |
21358 | { | |
21359 | aftsTrack=anEvent->GetTrack(i1); | |
21360 | if(!(aftsTrack->InRPSelection())) continue; | |
21361 | phi1=aftsTrack->Phi(); | |
21362 | for(Int_t i2=0;i2<nPrim;i2++) | |
21363 | { | |
21364 | if(i2==i1)continue; | |
21365 | aftsTrack=anEvent->GetTrack(i2); | |
21366 | if(!(aftsTrack->InRPSelection())) continue; | |
21367 | phi2=aftsTrack->Phi(); | |
21368 | for(Int_t i3=0;i3<nPrim;i3++) | |
21369 | { | |
21370 | if(i3==i1||i3==i2)continue; | |
21371 | aftsTrack=anEvent->GetTrack(i3); | |
21372 | if(!(aftsTrack->InRPSelection())) continue; | |
21373 | phi3=aftsTrack->Phi(); | |
21374 | for(Int_t i4=0;i4<nPrim;i4++) | |
21375 | { | |
21376 | if(i4==i1||i4==i2||i4==i3)continue; | |
21377 | aftsTrack=anEvent->GetTrack(i4); | |
21378 | if(!(aftsTrack->InRPSelection())) continue; | |
21379 | phi4=aftsTrack->Phi(); | |
21380 | for(Int_t i5=0;i5<nPrim;i5++) | |
21381 | { | |
21382 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
21383 | aftsTrack=anEvent->GetTrack(i5); | |
21384 | if(!(aftsTrack->InRPSelection())) continue; | |
21385 | phi5=aftsTrack->Phi(); | |
21386 | if(nPrim==5) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<"\r"<<flush; | |
21387 | // fill the profile with 5-p correlations: | |
b84464d3 | 21388 | fIntFlowDirectCorrelations->Fill(18.,cos(2.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5),1.); // <5>_{2n,n|n,n,n} |
21389 | fIntFlowDirectCorrelations->Fill(19.,cos(2.*n*phi1+2.*n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); // <5>_{2n,2n|2n,n,n} | |
21390 | fIntFlowDirectCorrelations->Fill(20.,cos(3.*n*phi1+n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); // <5>_{3n,n|2n,n,n} | |
21391 | fIntFlowDirectCorrelations->Fill(21.,cos(4.*n*phi1-n*phi2-n*phi3-n*phi4-n*phi5),1.); // <5>_{4n|n,n,n,n} | |
21392 | fIntFlowDirectCorrelations->Fill(33.,cos(3.*n*phi1+3.*n*phi2-2.*n*phi3-2.*n*phi4-2.*n*phi5),1.); // <5>_{3n,3n|2n,2n,2n} | |
21393 | fIntFlowDirectCorrelations->Fill(52.5,cos(3.*n*phi1+3.*n*phi2-3.*n*phi3-2.*n*phi4-1.*n*phi5),1.); // <5>_{3n,3n|3n,2n,1n} | |
21394 | fIntFlowDirectCorrelations->Fill(53.5,cos(4.*n*phi1+2.*n*phi2-3.*n*phi3-2.*n*phi4-1.*n*phi5),1.); // <5>_{4n,2n|3n,2n,1n} | |
21395 | fIntFlowDirectCorrelations->Fill(54.5,cos(3.*n*phi1+2.*n*phi2-3.*n*phi3-1.*n*phi4-1.*n*phi5),1.); // <5>_{3n,2n|3n,1n,1n} | |
21396 | fIntFlowDirectCorrelations->Fill(55.5,cos(3.*n*phi1+2.*n*phi2-2.*n*phi3-2.*n*phi4-1.*n*phi5),1.); // <5>_{3n,2n|2n,2n,1n} | |
21397 | fIntFlowDirectCorrelations->Fill(56.5,cos(5.*n*phi1+1.*n*phi2-3.*n*phi3-2.*n*phi4-1.*n*phi5),1.); // <5>_{5n,1n|3n,2n,1n} | |
403e3389 | 21398 | fIntFlowDirectCorrelations->Fill(60.5,cos(6.*n*phi1-2.*n*phi2-2.*n*phi3-1.*n*phi4-1.*n*phi5),1.); // <5>_{6n|2n,2n,1n,1n} |
21399 | fIntFlowDirectCorrelations->Fill(61.5,cos(4.*n*phi1+1.*n*phi2+1.*n*phi3-3.*n*phi4-3.*n*phi5),1.); // <5>_{4n,1n,1n|3n,3n} | |
489d5531 | 21400 | } // end of for(Int_t i5=0;i5<nPrim;i5++) |
21401 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
21402 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
21403 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
21404 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
21405 | } // end of if(nPrim>=5) | |
21406 | ||
21407 | // 6-particle correlations: | |
21408 | if(nPrim>=6 && nPrim<=fMaxAllowedMultiplicity) | |
21409 | { | |
21410 | for(Int_t i1=0;i1<nPrim;i1++) | |
21411 | { | |
21412 | aftsTrack=anEvent->GetTrack(i1); | |
21413 | if(!(aftsTrack->InRPSelection())) continue; | |
21414 | phi1=aftsTrack->Phi(); | |
21415 | for(Int_t i2=0;i2<nPrim;i2++) | |
21416 | { | |
21417 | if(i2==i1)continue; | |
21418 | aftsTrack=anEvent->GetTrack(i2); | |
21419 | if(!(aftsTrack->InRPSelection())) continue; | |
21420 | phi2=aftsTrack->Phi(); | |
21421 | for(Int_t i3=0;i3<nPrim;i3++) | |
21422 | { | |
21423 | if(i3==i1||i3==i2)continue; | |
21424 | aftsTrack=anEvent->GetTrack(i3); | |
21425 | if(!(aftsTrack->InRPSelection())) continue; | |
21426 | phi3=aftsTrack->Phi(); | |
21427 | for(Int_t i4=0;i4<nPrim;i4++) | |
21428 | { | |
21429 | if(i4==i1||i4==i2||i4==i3)continue; | |
21430 | aftsTrack=anEvent->GetTrack(i4); | |
21431 | if(!(aftsTrack->InRPSelection())) continue; | |
21432 | phi4=aftsTrack->Phi(); | |
21433 | for(Int_t i5=0;i5<nPrim;i5++) | |
21434 | { | |
21435 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
21436 | aftsTrack=anEvent->GetTrack(i5); | |
21437 | if(!(aftsTrack->InRPSelection())) continue; | |
21438 | phi5=aftsTrack->Phi(); | |
21439 | for(Int_t i6=0;i6<nPrim;i6++) | |
21440 | { | |
21441 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
21442 | aftsTrack=anEvent->GetTrack(i6); | |
21443 | if(!(aftsTrack->InRPSelection())) continue; | |
21444 | phi6=aftsTrack->Phi(); | |
21445 | if(nPrim==6) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<"\r"<<flush; | |
21446 | // fill the profile with 6-p correlations: | |
403e3389 | 21447 | fIntFlowDirectCorrelations->Fill(23.,cos(n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6),1.); // <6>_{1n,1n,1n|1n,1n,1n} |
21448 | fIntFlowDirectCorrelations->Fill(24.,cos(2.*n*phi1+n*phi2+n*phi3-2.*n*phi4-n*phi5-n*phi6),1.); // <6>_{2n,1n,1n|2n,1n,1n} | |
21449 | fIntFlowDirectCorrelations->Fill(25.,cos(2.*n*phi1+2.*n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); // <6>_{2n,2n|1n,1n,1n,1n} | |
21450 | fIntFlowDirectCorrelations->Fill(26.,cos(3.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); // <6>_{3n,1n|1n,1n,1n,1n} | |
b84464d3 | 21451 | fIntFlowDirectCorrelations->Fill(57.5,cos(3.*n*phi1+2.*n*phi2+1.*n*phi3-3.*n*phi4-2.*n*phi5-1.*n*phi6),1.); // <6>_{3n,2n,1n|3n,2n,1n} |
403e3389 | 21452 | fIntFlowDirectCorrelations->Fill(62.5,cos(3.*n*phi1+3.*n*phi2-2.*n*phi3-2.*n*phi4-1.*n*phi5-1.*n*phi6),1.); // <6>_{3n,3n|2n,2n,1n,1n} |
489d5531 | 21453 | } // end of for(Int_t i6=0;i6<nPrim;i6++) |
21454 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
21455 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
21456 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
21457 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
21458 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
21459 | } // end of if(nPrim>=6) | |
21460 | ||
21461 | // 7-particle correlations: | |
21462 | if(nPrim>=7 && nPrim<=fMaxAllowedMultiplicity) | |
21463 | { | |
21464 | for(Int_t i1=0;i1<nPrim;i1++) | |
21465 | { | |
21466 | aftsTrack=anEvent->GetTrack(i1); | |
21467 | if(!(aftsTrack->InRPSelection())) continue; | |
21468 | phi1=aftsTrack->Phi(); | |
21469 | for(Int_t i2=0;i2<nPrim;i2++) | |
21470 | { | |
21471 | if(i2==i1)continue; | |
21472 | aftsTrack=anEvent->GetTrack(i2); | |
21473 | if(!(aftsTrack->InRPSelection())) continue; | |
21474 | phi2=aftsTrack->Phi(); | |
21475 | for(Int_t i3=0;i3<nPrim;i3++) | |
21476 | { | |
21477 | if(i3==i1||i3==i2)continue; | |
21478 | aftsTrack=anEvent->GetTrack(i3); | |
21479 | if(!(aftsTrack->InRPSelection())) continue; | |
21480 | phi3=aftsTrack->Phi(); | |
21481 | for(Int_t i4=0;i4<nPrim;i4++) | |
21482 | { | |
21483 | if(i4==i1||i4==i2||i4==i3)continue; | |
21484 | aftsTrack=anEvent->GetTrack(i4); | |
21485 | if(!(aftsTrack->InRPSelection())) continue; | |
21486 | phi4=aftsTrack->Phi(); | |
21487 | for(Int_t i5=0;i5<nPrim;i5++) | |
21488 | { | |
21489 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
21490 | aftsTrack=anEvent->GetTrack(i5); | |
21491 | if(!(aftsTrack->InRPSelection())) continue; | |
21492 | phi5=aftsTrack->Phi(); | |
21493 | for(Int_t i6=0;i6<nPrim;i6++) | |
21494 | { | |
21495 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
21496 | aftsTrack=anEvent->GetTrack(i6); | |
21497 | if(!(aftsTrack->InRPSelection())) continue; | |
21498 | phi6=aftsTrack->Phi(); | |
21499 | for(Int_t i7=0;i7<nPrim;i7++) | |
21500 | { | |
21501 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; | |
21502 | aftsTrack=anEvent->GetTrack(i7); | |
21503 | if(!(aftsTrack->InRPSelection())) continue; | |
21504 | phi7=aftsTrack->Phi(); | |
21505 | if(nPrim==7) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<" "<<i7<<"\r"<<flush; | |
21506 | // fill the profile with 7-p correlation: | |
21507 | fIntFlowDirectCorrelations->Fill(28.,cos(2.*n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6-n*phi7),1.); // <7>_{2n,n,n|n,n,n,n} | |
21508 | } // end of for(Int_t i7=0;i7<nPrim;i7++) | |
21509 | } // end of for(Int_t i6=0;i6<nPrim;i6++) | |
21510 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
21511 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
21512 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
21513 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
21514 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
21515 | } // end of if(nPrim>=7) | |
21516 | ||
21517 | // 8-particle correlations: | |
21518 | if(nPrim>=8 && nPrim<=fMaxAllowedMultiplicity) | |
21519 | { | |
21520 | for(Int_t i1=0;i1<nPrim;i1++) | |
21521 | { | |
21522 | aftsTrack=anEvent->GetTrack(i1); | |
21523 | if(!(aftsTrack->InRPSelection())) continue; | |
21524 | phi1=aftsTrack->Phi(); | |
21525 | for(Int_t i2=0;i2<nPrim;i2++) | |
21526 | { | |
21527 | if(i2==i1)continue; | |
21528 | aftsTrack=anEvent->GetTrack(i2); | |
21529 | if(!(aftsTrack->InRPSelection())) continue; | |
21530 | phi2=aftsTrack->Phi(); | |
21531 | for(Int_t i3=0;i3<nPrim;i3++) | |
21532 | { | |
21533 | if(i3==i1||i3==i2)continue; | |
21534 | aftsTrack=anEvent->GetTrack(i3); | |
21535 | if(!(aftsTrack->InRPSelection())) continue; | |
21536 | phi3=aftsTrack->Phi(); | |
21537 | for(Int_t i4=0;i4<nPrim;i4++) | |
21538 | { | |
21539 | if(i4==i1||i4==i2||i4==i3)continue; | |
21540 | aftsTrack=anEvent->GetTrack(i4); | |
21541 | if(!(aftsTrack->InRPSelection())) continue; | |
21542 | phi4=aftsTrack->Phi(); | |
21543 | for(Int_t i5=0;i5<nPrim;i5++) | |
21544 | { | |
21545 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
21546 | aftsTrack=anEvent->GetTrack(i5); | |
21547 | if(!(aftsTrack->InRPSelection())) continue; | |
21548 | phi5=aftsTrack->Phi(); | |
21549 | for(Int_t i6=0;i6<nPrim;i6++) | |
21550 | { | |
21551 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
21552 | aftsTrack=anEvent->GetTrack(i6); | |
21553 | if(!(aftsTrack->InRPSelection())) continue; | |
21554 | phi6=aftsTrack->Phi(); | |
21555 | for(Int_t i7=0;i7<nPrim;i7++) | |
21556 | { | |
21557 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; | |
21558 | aftsTrack=anEvent->GetTrack(i7); | |
21559 | if(!(aftsTrack->InRPSelection())) continue; | |
21560 | phi7=aftsTrack->Phi(); | |
21561 | for(Int_t i8=0;i8<nPrim;i8++) | |
21562 | { | |
21563 | if(i8==i1||i8==i2||i8==i3||i8==i4||i8==i5||i8==i6||i8==i7)continue; | |
21564 | aftsTrack=anEvent->GetTrack(i8); | |
21565 | if(!(aftsTrack->InRPSelection())) continue; | |
21566 | phi8=aftsTrack->Phi(); | |
21567 | cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<" "<<i7<<" "<<i8<<"\r"<<flush; | |
21568 | // fill the profile with 8-p correlation: | |
21569 | fIntFlowDirectCorrelations->Fill(30.,cos(n*phi1+n*phi2+n*phi3+n*phi4-n*phi5-n*phi6-n*phi7-n*phi8),1.); // <8>_{n,n,n,n|n,n,n,n} | |
21570 | } // end of for(Int_t i8=0;i8<nPrim;i8++) | |
21571 | } // end of for(Int_t i7=0;i7<nPrim;i7++) | |
21572 | } // end of for(Int_t i6=0;i6<nPrim;i6++) | |
21573 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
21574 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
21575 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
21576 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
21577 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
21578 | } // end of if(nPrim>=8) | |
21579 | ||
21580 | cout<<endl; | |
21581 | ||
21582 | } // end of AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent) | |
21583 | ||
e1d101a6 | 21584 | //================================================================================================================ |
21585 | ||
21586 | void AliFlowAnalysisWithQCumulants::EvaluateMixedHarmonicsWithNestedLoops(AliFlowEventSimple * const anEvent) | |
21587 | { | |
21588 | // Evaluate with nested loops multi-particle correlations for mixed harmonics. | |
21589 | ||
21590 | Int_t nPrim = anEvent->NumberOfTracks(); | |
21591 | AliFlowTrackSimple *aftsTrack = NULL; | |
21592 | Double_t phi1=0.; | |
21593 | Double_t phi2=0.; | |
21594 | Double_t phi3=0.; | |
21595 | Double_t phi4=0.; | |
21596 | Double_t phi5=0.; | |
21597 | /*Double_t phi6=0.; | |
21598 | Double_t phi7=0.; | |
21599 | Double_t phi8=0.;*/ | |
21600 | Int_t n = fHarmonic; | |
21601 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // TBI: is such casting safe in general? | |
21602 | Double_t dMult = (*fSpk)(0,0); | |
21603 | cout<<endl; | |
21604 | cout<<"Multiparticle correlations: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
21605 | if(dMult<2) | |
21606 | { | |
21607 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
21608 | } else if (dMult>fMaxAllowedMultiplicity) | |
21609 | { | |
21610 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
21611 | } else | |
21612 | { | |
21613 | cout<<"... evaluating nested loops (without using particle weights)..."<<endl; | |
21614 | } | |
21615 | ||
21616 | // 2-particle correlations: | |
21617 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
21618 | { | |
21619 | for(Int_t i1=0;i1<nPrim;i1++) | |
21620 | { | |
21621 | aftsTrack=anEvent->GetTrack(i1); | |
21622 | if(!(aftsTrack->InRPSelection())) continue; | |
21623 | phi1=aftsTrack->Phi(); | |
21624 | for(Int_t i2=0;i2<nPrim;i2++) | |
21625 | { | |
21626 | if(i2==i1)continue; | |
21627 | aftsTrack=anEvent->GetTrack(i2); | |
21628 | if(!(aftsTrack->InRPSelection())) continue; | |
21629 | phi2=aftsTrack->Phi(); | |
21630 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
21631 | // Fill the profile fMixedHarmonicsNestedLoops with 2-p correlations: | |
21632 | fMixedHarmonicsNestedLoops->Fill(0.5,cos(1.*n*(phi1-phi2)),1.); // <cos(1n*(phi1-phi2))> | |
21633 | fMixedHarmonicsNestedLoops->Fill(1.5,cos(2.*n*(phi1-phi2)),1.); // <cos(2n*(phi1-phi2))> | |
21634 | fMixedHarmonicsNestedLoops->Fill(2.5,cos(3.*n*(phi1-phi2)),1.); // <cos(3n*(phi1-phi2))> | |
21635 | fMixedHarmonicsNestedLoops->Fill(3.5,cos(4.*n*(phi1-phi2)),1.); // <cos(4n*(phi1-phi2))> | |
21636 | fMixedHarmonicsNestedLoops->Fill(4.5,cos(5.*n*(phi1-phi2)),1.); // <cos(5n*(phi1-phi2))> | |
21637 | fMixedHarmonicsNestedLoops->Fill(5.5,cos(6.*n*(phi1-phi2)),1.); // <cos(6n*(phi1-phi2))> | |
21638 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
21639 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
21640 | } // end of if(nPrim>=2) | |
21641 | ||
21642 | // 3-particle correlations: | |
21643 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
21644 | { | |
21645 | for(Int_t i1=0;i1<nPrim;i1++) | |
21646 | { | |
21647 | aftsTrack=anEvent->GetTrack(i1); | |
21648 | if(!(aftsTrack->InRPSelection())) continue; | |
21649 | phi1=aftsTrack->Phi(); | |
21650 | for(Int_t i2=0;i2<nPrim;i2++) | |
21651 | { | |
21652 | if(i2==i1)continue; | |
21653 | aftsTrack=anEvent->GetTrack(i2); | |
21654 | if(!(aftsTrack->InRPSelection())) continue; | |
21655 | phi2=aftsTrack->Phi(); | |
21656 | for(Int_t i3=0;i3<nPrim;i3++) | |
21657 | { | |
21658 | if(i3==i1||i3==i2)continue; | |
21659 | aftsTrack=anEvent->GetTrack(i3); | |
21660 | if(!(aftsTrack->InRPSelection())) continue; | |
21661 | phi3=aftsTrack->Phi(); | |
21662 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
21663 | // Fill the profile fMixedHarmonicsNestedLoops with 3-p correlations: | |
21664 | fMixedHarmonicsNestedLoops->Fill( 6.5,cos(2.*n*phi1-n*(phi2+phi3)),1.); // <3>_{2n|1n,1n} | |
21665 | fMixedHarmonicsNestedLoops->Fill( 7.5,cos(4.*n*phi1-2.*n*phi2-2.*n*phi3),1.); // <3>_{4n|2n,2n} | |
21666 | fMixedHarmonicsNestedLoops->Fill( 8.5,cos(6.*n*phi1-3.*n*phi2-3.*n*phi3),1.); // <3>_{6n|3n,3n} | |
21667 | fMixedHarmonicsNestedLoops->Fill(10.5,cos(3.*n*phi1-2.*n*phi2-n*phi3),1.); // <3>_{3n|2n,1n} | |
21668 | fMixedHarmonicsNestedLoops->Fill(11.5,cos(4.*n*phi1-3.*n*phi2-1.*n*phi3),1.); // <3>_{4n|3n,1n} | |
21669 | fMixedHarmonicsNestedLoops->Fill(12.5,cos(5.*n*phi1-3.*n*phi2-2.*n*phi3),1.); // <3>_{5n|3n,2n} | |
21670 | fMixedHarmonicsNestedLoops->Fill(13.5,cos(5.*n*phi1-4.*n*phi2-1.*n*phi3),1.); // <3>_{5n|4n,1n} | |
21671 | fMixedHarmonicsNestedLoops->Fill(14.5,cos(6.*n*phi1-4.*n*phi2-2.*n*phi3),1.); // <3>_{6n|4n,2n} | |
21672 | fMixedHarmonicsNestedLoops->Fill(15.5,cos(6.*n*phi1-5.*n*phi2-1.*n*phi3),1.); // <3>_{6n|5n,1n} | |
21673 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
21674 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
21675 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
21676 | } // end of if(nPrim>=3) | |
21677 | ||
21678 | // 4-particle correlations: | |
21679 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) | |
21680 | { | |
21681 | for(Int_t i1=0;i1<nPrim;i1++) | |
21682 | { | |
21683 | aftsTrack=anEvent->GetTrack(i1); | |
21684 | if(!(aftsTrack->InRPSelection())) continue; | |
21685 | phi1=aftsTrack->Phi(); | |
21686 | for(Int_t i2=0;i2<nPrim;i2++) | |
21687 | { | |
21688 | if(i2==i1)continue; | |
21689 | aftsTrack=anEvent->GetTrack(i2); | |
21690 | if(!(aftsTrack->InRPSelection())) continue; | |
21691 | phi2=aftsTrack->Phi(); | |
21692 | for(Int_t i3=0;i3<nPrim;i3++) | |
21693 | { | |
21694 | if(i3==i1||i3==i2)continue; | |
21695 | aftsTrack=anEvent->GetTrack(i3); | |
21696 | if(!(aftsTrack->InRPSelection())) continue; | |
21697 | phi3=aftsTrack->Phi(); | |
21698 | for(Int_t i4=0;i4<nPrim;i4++) | |
21699 | { | |
21700 | if(i4==i1||i4==i2||i4==i3)continue; | |
21701 | aftsTrack=anEvent->GetTrack(i4); | |
21702 | if(!(aftsTrack->InRPSelection())) continue; | |
21703 | phi4=aftsTrack->Phi(); | |
21704 | if(nPrim==4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; | |
21705 | // fill the profile with 4-p correlations: | |
21706 | fMixedHarmonicsNestedLoops->Fill(16.5,cos(1.*n*(phi1+phi2-phi3-phi4)),1.); // <4>_{1n,1n|1n,1n} | |
21707 | fMixedHarmonicsNestedLoops->Fill(17.5,cos(2.*n*(phi1+phi2-phi3-phi4)),1.); // <4>_{2n,2n|2n,2n} | |
21708 | fMixedHarmonicsNestedLoops->Fill(18.5,cos(3.*n*(phi1+phi2-phi3-phi4)),1.); // <4>_{3n,3n|3n,3n} | |
21709 | fMixedHarmonicsNestedLoops->Fill(19.5,cos(4.*n*(phi1+phi2-phi3-phi4)),1.); // <4>_{4n,4n|4n,4n} | |
21710 | fMixedHarmonicsNestedLoops->Fill(20.5,cos(5.*n*(phi1+phi2-phi3-phi4)),1.); // <4>_{5n,5n|5n,5n} | |
21711 | fMixedHarmonicsNestedLoops->Fill(21.5,cos(6.*n*(phi1+phi2-phi3-phi4)),1.); // <4>_{6n,6n|6n,6n} | |
21712 | fMixedHarmonicsNestedLoops->Fill(23.5,cos(n*(2.*phi1+1.*phi2-2.*phi3-1.*phi4)),1.); // <4>_{2n,1n|2n,1n} | |
21713 | fMixedHarmonicsNestedLoops->Fill(24.5,cos(n*(3.*phi1+1.*phi2-3.*phi3-1.*phi4)),1.); // <4>_{3n,1n|3n,1n} | |
21714 | fMixedHarmonicsNestedLoops->Fill(25.5,cos(n*(3.*phi1+2.*phi2-3.*phi3-2.*phi4)),1.); // <4>_{3n,2n|3n,2n} | |
21715 | fMixedHarmonicsNestedLoops->Fill(26.5,cos(n*(4.*phi1+1.*phi2-4.*phi3-1.*phi4)),1.); // <4>_{4n,1n|4n,1n} | |
21716 | fMixedHarmonicsNestedLoops->Fill(27.5,cos(n*(4.*phi1+2.*phi2-4.*phi3-2.*phi4)),1.); // <4>_{4n,2n|4n,2n} | |
21717 | fMixedHarmonicsNestedLoops->Fill(28.5,cos(n*(4.*phi1+3.*phi2-4.*phi3-3.*phi4)),1.); // <4>_{4n,3n|4n,3n} | |
21718 | fMixedHarmonicsNestedLoops->Fill(29.5,cos(n*(5.*phi1+1.*phi2-5.*phi3-1.*phi4)),1.); // <4>_{5n,1n|5n,1n} | |
21719 | fMixedHarmonicsNestedLoops->Fill(30.5,cos(n*(5.*phi1+2.*phi2-5.*phi3-2.*phi4)),1.); // <4>_{5n,2n|5n,2n} | |
21720 | fMixedHarmonicsNestedLoops->Fill(31.5,cos(n*(5.*phi1+3.*phi2-5.*phi3-3.*phi4)),1.); // <4>_{5n,3n|5n,3n} | |
21721 | fMixedHarmonicsNestedLoops->Fill(32.5,cos(n*(5.*phi1+4.*phi2-5.*phi3-4.*phi4)),1.); // <4>_{5n,4n|5n,4n} | |
21722 | fMixedHarmonicsNestedLoops->Fill(33.5,cos(n*(6.*phi1+1.*phi2-6.*phi3-1.*phi4)),1.); // <4>_{6n,1n|6n,1n} | |
21723 | fMixedHarmonicsNestedLoops->Fill(34.5,cos(n*(6.*phi1+2.*phi2-6.*phi3-2.*phi4)),1.); // <4>_{6n,2n|6n,2n} | |
21724 | fMixedHarmonicsNestedLoops->Fill(35.5,cos(n*(6.*phi1+3.*phi2-6.*phi3-3.*phi4)),1.); // <4>_{6n,3n|6n,3n} | |
21725 | fMixedHarmonicsNestedLoops->Fill(36.5,cos(n*(6.*phi1+4.*phi2-6.*phi3-4.*phi4)),1.); // <4>_{6n,4n|6n,4n} | |
21726 | fMixedHarmonicsNestedLoops->Fill(37.5,cos(n*(6.*phi1+5.*phi2-6.*phi3-5.*phi4)),1.); // <4>_{6n,5n|6n,5n} | |
21727 | fMixedHarmonicsNestedLoops->Fill(39.5,cos(n*(3.*phi1-1.*phi2-1.*phi3-1.*phi4)),1.); // <4>_{3n|1n,1n,1n} | |
21728 | fMixedHarmonicsNestedLoops->Fill(40.5,cos(n*(6.*phi1-2.*phi2-2.*phi3-2.*phi4)),1.); // <4>_{6n|2n,2n,2n} | |
21729 | fMixedHarmonicsNestedLoops->Fill(42.5,cos(n*(3.*phi1+1.*phi2-2.*phi3-2.*phi4)),1.); // <4>_{3n,1n|2n,2n} | |
21730 | fMixedHarmonicsNestedLoops->Fill(43.5,cos(n*(4.*phi1-2.*phi2-1.*phi3-1.*phi4)),1.); // <4>_{4n|2n,1n,1n} | |
21731 | fMixedHarmonicsNestedLoops->Fill(44.5,cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4)),1.); // <4>_{4n,2n|3n,3n} | |
21732 | fMixedHarmonicsNestedLoops->Fill(45.5,cos(n*(5.*phi1-2.*phi2-2.*phi3-1.*phi4)),1.); // <4>_{5n|2n,2n,1n} | |
21733 | fMixedHarmonicsNestedLoops->Fill(46.5,cos(n*(5.*phi1-3.*phi2-1.*phi3-1.*phi4)),1.); // <4>_{5n|3n,1n,1n} | |
21734 | fMixedHarmonicsNestedLoops->Fill(47.5,cos(n*(5.*phi1+1.*phi2-3.*phi3-3.*phi4)),1.); // <4>_{5n,1n|3n,3n} | |
21735 | fMixedHarmonicsNestedLoops->Fill(48.5,cos(n*(5.*phi1+3.*phi2-4.*phi3-4.*phi4)),1.); // <4>_{5n,3n|4n,4n} | |
21736 | fMixedHarmonicsNestedLoops->Fill(49.5,cos(n*(6.*phi1-4.*phi2-1.*phi3-1.*phi4)),1.); // <4>_{6n|4n,1n,1n} | |
21737 | fMixedHarmonicsNestedLoops->Fill(50.5,cos(n*(6.*phi1+2.*phi2-4.*phi3-4.*phi4)),1.); // <4>_{6n,2n|4n,4n} | |
21738 | fMixedHarmonicsNestedLoops->Fill(51.5,cos(n*(6.*phi1+4.*phi2-5.*phi3-5.*phi4)),1.); // <4>_{6n,4n|5n,5n} | |
21739 | fMixedHarmonicsNestedLoops->Fill(53.5,cos(n*(4.*phi1+1.*phi2-3.*phi3-2.*phi4)),1.); // <4>_{4n,1n|3n,2n} | |
21740 | fMixedHarmonicsNestedLoops->Fill(54.5,cos(n*(5.*phi1+1.*phi2-4.*phi3-2.*phi4)),1.); // <4>_{5n,1n|4n,2n} | |
21741 | fMixedHarmonicsNestedLoops->Fill(55.5,cos(n*(5.*phi1+2.*phi2-4.*phi3-3.*phi4)),1.); // <4>_{5n,2n|4n,3n} | |
21742 | fMixedHarmonicsNestedLoops->Fill(56.5,cos(n*(6.*phi1+1.*phi2-4.*phi3-3.*phi4)),1.); // <4>_{6n,1n|4n,3n} | |
21743 | fMixedHarmonicsNestedLoops->Fill(57.5,cos(n*(6.*phi1+1.*phi2-5.*phi3-2.*phi4)),1.); // <4>_{6n,1n|5n,2n} | |
21744 | fMixedHarmonicsNestedLoops->Fill(58.5,cos(n*(6.*phi1-3.*phi2-2.*phi3-1.*phi4)),1.); // <4>_{6n|3n,2n,1n} | |
21745 | fMixedHarmonicsNestedLoops->Fill(59.5,cos(n*(6.*phi1+2.*phi2-5.*phi3-3.*phi4)),1.); // <4>_{6n,2n|5n,3n} | |
21746 | fMixedHarmonicsNestedLoops->Fill(60.5,cos(n*(6.*phi1+3.*phi2-5.*phi3-4.*phi4)),1.); // <4>_{6n,3n|5n,4n} | |
21747 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
21748 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
21749 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
21750 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
21751 | } // end of if(nPrim>=) | |
21752 | ||
21753 | // 5-particle correlations: | |
21754 | if(nPrim>=5 && nPrim<=fMaxAllowedMultiplicity) | |
21755 | { | |
21756 | for(Int_t i1=0;i1<nPrim;i1++) | |
21757 | { | |
21758 | aftsTrack=anEvent->GetTrack(i1); | |
21759 | if(!(aftsTrack->InRPSelection())) continue; | |
21760 | phi1=aftsTrack->Phi(); | |
21761 | for(Int_t i2=0;i2<nPrim;i2++) | |
21762 | { | |
21763 | if(i2==i1)continue; | |
21764 | aftsTrack=anEvent->GetTrack(i2); | |
21765 | if(!(aftsTrack->InRPSelection())) continue; | |
21766 | phi2=aftsTrack->Phi(); | |
21767 | for(Int_t i3=0;i3<nPrim;i3++) | |
21768 | { | |
21769 | if(i3==i1||i3==i2)continue; | |
21770 | aftsTrack=anEvent->GetTrack(i3); | |
21771 | if(!(aftsTrack->InRPSelection())) continue; | |
21772 | phi3=aftsTrack->Phi(); | |
21773 | for(Int_t i4=0;i4<nPrim;i4++) | |
21774 | { | |
21775 | if(i4==i1||i4==i2||i4==i3)continue; | |
21776 | aftsTrack=anEvent->GetTrack(i4); | |
21777 | if(!(aftsTrack->InRPSelection())) continue; | |
21778 | phi4=aftsTrack->Phi(); | |
21779 | for(Int_t i5=0;i5<nPrim;i5++) | |
21780 | { | |
21781 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
21782 | aftsTrack=anEvent->GetTrack(i5); | |
21783 | if(!(aftsTrack->InRPSelection())) continue; | |
21784 | phi5=aftsTrack->Phi(); | |
21785 | if(nPrim==5) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<"\r"<<flush; | |
21786 | // fill the profile with 5-p correlations: | |
21787 | fMixedHarmonicsNestedLoops->Fill(61.5,cos(n*(3.*phi1+2.*phi2-3.*phi3-1.*phi4-1.*phi5)),1.); // <cos(n(3*phi1+2*phi2-3*phi3-1*phi4-1*phi5))> | |
21788 | fMixedHarmonicsNestedLoops->Fill(62.5,cos(n*(4.*phi1+1.*phi2-2.*phi3-2.*phi4-1.*phi5)),1.); // <cos(n(4*phi1+1*phi2-2*phi3-2*phi4-1*phi5))> | |
21789 | fMixedHarmonicsNestedLoops->Fill(63.5,cos(n*(4.*phi1+2.*phi2-3.*phi3-2.*phi4-1.*phi5)),1.); // <cos(n(4*phi1+2*phi2-3*phi3-2*phi4-1*phi5))> | |
21790 | fMixedHarmonicsNestedLoops->Fill(64.5,cos(n*(4.*phi1+3.*phi2-3.*phi3-2.*phi4-2.*phi5)),1.); // <cos(n(4*phi1+3*phi2-3*phi3-2*phi4-2*phi5))> | |
21791 | fMixedHarmonicsNestedLoops->Fill(65.5,cos(n*(4.*phi1+2.*phi2-4.*phi3-1.*phi4-1.*phi5)),1.); // <cos(n(4*phi1+2*phi2-4*phi3-1*phi4-1*phi5))> | |
21792 | fMixedHarmonicsNestedLoops->Fill(66.5,cos(n*(4.*phi1+3.*phi2-4.*phi3-2.*phi4-1.*phi5)),1.); // <cos(n(4*phi1+3*phi2-4*phi3-2*phi4-1*phi5))> | |
21793 | fMixedHarmonicsNestedLoops->Fill(67.5,cos(n*(5.*phi1+1.*phi2-3.*phi3-2.*phi4-1.*phi5)),1.); // <cos(n(5*phi1+1*phi2-3*phi3-2*phi4-1*phi5))> | |
21794 | fMixedHarmonicsNestedLoops->Fill(68.5,cos(n*(5.*phi1+2.*phi2-5.*phi3-1.*phi4-1.*phi5)),1.); // <cos(n(5*phi1+2*phi2-5*phi3-1*phi4-1*phi5))> | |
21795 | fMixedHarmonicsNestedLoops->Fill(69.5,cos(n*(5.*phi1+2.*phi2-4.*phi3-2.*phi4-1.*phi5)),1.); // <cos(n(5*phi1+2*phi2-4*phi3-2*phi4-1*phi5))> | |
21796 | fMixedHarmonicsNestedLoops->Fill(70.5,cos(n*(5.*phi1+3.*phi2-4.*phi3-3.*phi4-1.*phi5)),1.); // <cos(n(5*phi1+3*phi2-4*phi3-3*phi4-1*phi5))> | |
21797 | fMixedHarmonicsNestedLoops->Fill(71.5,cos(n*(5.*phi1+4.*phi2-4.*phi3-3.*phi4-2.*phi5)),1.); // <cos(n(5*phi1+4*phi2-4*phi3-3*phi4-2*phi5))> | |
21798 | fMixedHarmonicsNestedLoops->Fill(72.5,cos(n*(5.*phi1+3.*phi2-5.*phi3-2.*phi4-1.*phi5)),1.); // <cos(n(5*phi1+3*phi2-5*phi3-2*phi4-1*phi5))> | |
21799 | fMixedHarmonicsNestedLoops->Fill(73.5,cos(n*(5.*phi1+4.*phi2-5.*phi3-2.*phi4-2.*phi5)),1.); // <cos(n(5*phi1+4*phi2-5*phi3-2*phi4-2*phi5))> | |
21800 | fMixedHarmonicsNestedLoops->Fill(74.5,cos(n*(5.*phi1+4.*phi2-5.*phi3-3.*phi4-1.*phi5)),1.); // <cos(n(5*phi1+4*phi2-5*phi3-3*phi4-1*phi5))> | |
21801 | fMixedHarmonicsNestedLoops->Fill(75.5,cos(n*(6.*phi1+1.*phi2-3.*phi3-3.*phi4-1.*phi5)),1.); // <cos(n(6*phi1+1*phi2-3*phi3-3*phi4-1*phi5))> | |
21802 | fMixedHarmonicsNestedLoops->Fill(76.5,cos(n*(6.*phi1+2.*phi2-3.*phi3-3.*phi4-2.*phi5)),1.); // <cos(n(6*phi1+2*phi2-3*phi3-3*phi4-2*phi5))> | |
21803 | fMixedHarmonicsNestedLoops->Fill(77.5,cos(n*(6.*phi1+1.*phi2-4.*phi3-2.*phi4-1.*phi5)),1.); // <cos(n(6*phi1+1*phi2-4*phi3-2*phi4-1*phi5))> | |
21804 | fMixedHarmonicsNestedLoops->Fill(78.5,cos(n*(6.*phi1+3.*phi2-4.*phi3-3.*phi4-2.*phi5)),1.); // <cos(n(6*phi1+3*phi2-4*phi3-3*phi4-2*phi5))> | |
21805 | fMixedHarmonicsNestedLoops->Fill(79.5,cos(n*(6.*phi1+4.*phi2-4.*phi3-3.*phi4-3.*phi5)),1.); // <cos(n(6*phi1+4*phi2-4*phi3-3*phi4-3*phi5))> | |
21806 | fMixedHarmonicsNestedLoops->Fill(80.5,cos(n*(6.*phi1+2.*phi2-5.*phi3-2.*phi4-1.*phi5)),1.); // <cos(n(6*phi1+2*phi2-5*phi3-2*phi4-1*phi5))> | |
21807 | fMixedHarmonicsNestedLoops->Fill(81.5,cos(n*(6.*phi1+3.*phi2-5.*phi3-3.*phi4-1.*phi5)),1.); // <cos(n(6*phi1+3*phi2-5*phi3-3*phi4-1*phi5))> | |
21808 | fMixedHarmonicsNestedLoops->Fill(82.5,cos(n*(6.*phi1+4.*phi2-5.*phi3-4.*phi4-1.*phi5)),1.); // <cos(n(6*phi1+4*phi2-5*phi3-4*phi4-1*phi5))> | |
21809 | fMixedHarmonicsNestedLoops->Fill(83.5,cos(n*(6.*phi1+5.*phi2-5.*phi3-3.*phi4-3.*phi5)),1.); // <cos(n(6*phi1+5*phi2-5*phi3-3*phi4-3*phi5))> | |
21810 | fMixedHarmonicsNestedLoops->Fill(84.5,cos(n*(6.*phi1+2.*phi2-6.*phi3-1.*phi4-1.*phi5)),1.); // <cos(n(6*phi1+2*phi2-6*phi3-1*phi4-1*phi5))> | |
21811 | fMixedHarmonicsNestedLoops->Fill(85.5,cos(n*(6.*phi1+3.*phi2-6.*phi3-2.*phi4-1.*phi5)),1.); // <cos(n(6*phi1+3*phi2-6*phi3-2*phi4-1*phi5))> | |
21812 | fMixedHarmonicsNestedLoops->Fill(86.5,cos(n*(6.*phi1+4.*phi2-6.*phi3-2.*phi4-2.*phi5)),1.); // <cos(n(6*phi1+4*phi2-6*phi3-2*phi4-2*phi5))> | |
21813 | fMixedHarmonicsNestedLoops->Fill(87.5,cos(n*(6.*phi1+4.*phi2-6.*phi3-3.*phi4-1.*phi5)),1.); // <cos(n(6*phi1+4*phi2-6*phi3-3*phi4-1*phi5))> | |
21814 | fMixedHarmonicsNestedLoops->Fill(88.5,cos(n*(6.*phi1+5.*phi2-5.*phi3-4.*phi4-2.*phi5)),1.); // <cos(n(6*phi1+5*phi2-5*phi3-4*phi4-2*phi5))> | |
21815 | fMixedHarmonicsNestedLoops->Fill(89.5,cos(n*(6.*phi1+5.*phi2-6.*phi3-3.*phi4-2.*phi5)),1.); // <cos(n(6*phi1+5*phi2-6*phi3-3*phi4-2*phi5))> | |
21816 | fMixedHarmonicsNestedLoops->Fill(90.5,cos(n*(6.*phi1+5.*phi2-6.*phi3-4.*phi4-1.*phi5)),1.); // <cos(n(6*phi1+5*phi2-6*phi3-4*phi4-1*phi5))> | |
21817 | //fMixedHarmonicsNestedLoops->Fill(91.5,-44.,1.); // empty | |
21818 | fMixedHarmonicsNestedLoops->Fill(92.5,cos(n*(2.*phi1+1.*phi2-1.*phi3-1.*phi4-1.*phi5)),1.); // <cos(n(2*phi1+1*phi2-1*phi3-1*phi4-1*phi5))> | |
21819 | fMixedHarmonicsNestedLoops->Fill(93.5,cos(n*(2.*phi1+2.*phi2-2.*phi3-1.*phi4-1.*phi5)),1.); // <cos(n(2*phi1+2*phi2-2*phi3-1*phi4-1*phi5))> | |
21820 | fMixedHarmonicsNestedLoops->Fill(94.5,cos(n*(3.*phi1+3.*phi2-2.*phi3-2.*phi4-2.*phi5)),1.); // <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-2*phi5))> | |
21821 | fMixedHarmonicsNestedLoops->Fill(95.5,cos(n*(4.*phi1-1.*phi2-1.*phi3-1.*phi4-1.*phi5)),1.); // <cos(n(4*phi1-1*phi2-1*phi3-1*phi4-1*phi5))> | |
21822 | fMixedHarmonicsNestedLoops->Fill(96.5,cos(n*(4.*phi1+2.*phi2-2.*phi3-2.*phi4-2.*phi5)),1.); // <cos(n(4*phi1+2*phi2-2*phi3-2*phi4-2*phi5))> | |
21823 | fMixedHarmonicsNestedLoops->Fill(97.5,cos(n*(4.*phi1+4.*phi2-4.*phi3-2.*phi4-2.*phi5)),1.); // <cos(n(4*phi1+4*phi2-4*phi3-2*phi4-2*phi5))> | |
21824 | fMixedHarmonicsNestedLoops->Fill(98.5,cos(n*(6.*phi1+3.*phi2-3.*phi3-3.*phi4-3.*phi5)),1.); // <cos(n(6*phi1+3*phi2-3*phi3-3*phi4-3*phi5))> | |
21825 | fMixedHarmonicsNestedLoops->Fill(99.5,cos(n*(6.*phi1+6.*phi2-4.*phi3-4.*phi4-4.*phi5)),1.); // <cos(n(6*phi1+6*phi2-4*phi3-4*phi4-4*phi5))> | |
21826 | fMixedHarmonicsNestedLoops->Fill(100.5,cos(n*(6.*phi1+6.*phi2-6.*phi3-3.*phi4-3.*phi5)),1.); // <cos(n(6*phi1+6*phi2-6*phi3-3*phi4-3*phi5))> | |
21827 | //fMixedHarmonicsNestedLoops->Fill(101.5,-44.,1.); // empty | |
21828 | fMixedHarmonicsNestedLoops->Fill(102.5,cos(n*(3.*phi1+1.*phi2-2.*phi3-1.*phi4-1.*phi5)),1.); // <cos(n(3*phi1+1*phi2-2*phi3-1*phi4-1*phi5))> | |
21829 | fMixedHarmonicsNestedLoops->Fill(103.5,cos(n*(3.*phi1+2.*phi2-2.*phi3-2.*phi4-1.*phi5)),1.); // <cos(n(3*phi1+2*phi2-2*phi3-2*phi4-1*phi5))> | |
21830 | fMixedHarmonicsNestedLoops->Fill(104.5,cos(n*(3.*phi1+3.*phi2-3.*phi3-2.*phi4-1.*phi5)),1.); // <cos(n(3*phi1+3*phi2-3*phi3-2*phi4-1*phi5))> | |
21831 | fMixedHarmonicsNestedLoops->Fill(105.5,cos(n*(4.*phi1+1.*phi2-3.*phi3-1.*phi4-1.*phi5)),1.); // <cos(n(4*phi1+1*phi2-3*phi3-1*phi4-1*phi5))> | |
21832 | fMixedHarmonicsNestedLoops->Fill(106.5,cos(n*(4.*phi1+1.*phi2+1.*phi3-3.*phi4-3.*phi5)),1.); // <cos(n(4*phi1+1*phi2+1*phi3-3*phi4-3*phi5))> | |
21833 | fMixedHarmonicsNestedLoops->Fill(107.5,cos(n*(4.*phi1+3.*phi2-3.*phi3-3.*phi4-1.*phi5)),1.); // <cos(n(4*phi1+3*phi2-3*phi3-3*phi4-1*phi5))> | |
21834 | fMixedHarmonicsNestedLoops->Fill(108.5,cos(n*(4.*phi1+4.*phi2-3.*phi3-3.*phi4-2.*phi5)),1.); // <cos(n(4*phi1+4*phi2-3*phi3-3*phi4-2*phi5))> | |
21835 | fMixedHarmonicsNestedLoops->Fill(109.5,cos(n*(4.*phi1+4.*phi2-4.*phi3-3.*phi4-1.*phi5)),1.); // <cos(n(4*phi1+4*phi2-4*phi3-3*phi4-1*phi5))> | |
21836 | fMixedHarmonicsNestedLoops->Fill(110.5,cos(n*(5.*phi1-2.*phi2-1.*phi3-1.*phi4-1.*phi5)),1.); // <cos(n(5*phi1-2*phi2-1*phi3-1*phi4-1*phi5))> | |
21837 | fMixedHarmonicsNestedLoops->Fill(111.5,cos(n*(5.*phi1+1.*phi2-2.*phi3-2.*phi4-2.*phi5)),1.); // <cos(n(5*phi1+1*phi2-2*phi3-2*phi4-2*phi5))> | |
21838 | fMixedHarmonicsNestedLoops->Fill(112.5,cos(n*(5.*phi1+2.*phi2-3.*phi3-2.*phi4-2.*phi5)),1.); // <cos(n(5*phi1+2*phi2-3*phi3-2*phi4-2*phi5))> | |
21839 | fMixedHarmonicsNestedLoops->Fill(113.5,cos(n*(5.*phi1+3.*phi2-3.*phi3-3.*phi4-2.*phi5)),1.); // <cos(n(5*phi1+3*phi2-3*phi3-3*phi4-2*phi5))> | |
21840 | fMixedHarmonicsNestedLoops->Fill(114.5,cos(n*(5.*phi1+1.*phi2-4.*phi3-1.*phi4-1.*phi5)),1.); // <cos(n(5*phi1+1*phi2-4*phi3-1*phi4-1*phi5))> | |
21841 | fMixedHarmonicsNestedLoops->Fill(115.5,cos(n*(5.*phi1+4.*phi2-3.*phi3-3.*phi4-3.*phi5)),1.); // <cos(n(5*phi1+4*phi2-3*phi3-3*phi4-3*phi5))> | |
21842 | fMixedHarmonicsNestedLoops->Fill(116.5,cos(n*(5.*phi1+4.*phi2-4.*phi3-4.*phi4-1.*phi5)),1.); // <cos(n(5*phi1+4*phi2-4*phi3-4*phi4-1*phi5))> | |
21843 | fMixedHarmonicsNestedLoops->Fill(117.5,cos(n*(5.*phi1+5.*phi2-4.*phi3-3.*phi4-3.*phi5)),1.); // <cos(n(5*phi1+5*phi2-4*phi3-3*phi4-3*phi5))> | |
21844 | fMixedHarmonicsNestedLoops->Fill(118.5,cos(n*(5.*phi1+5.*phi2-4.*phi3-4.*phi4-2.*phi5)),1.); // <cos(n(5*phi1+5*phi2-4*phi3-4*phi4-2*phi5))> | |
21845 | fMixedHarmonicsNestedLoops->Fill(119.5,cos(n*(5.*phi1+5.*phi2-5.*phi3-3.*phi4-2.*phi5)),1.); // <cos(n(5*phi1+5*phi2-5*phi3-3*phi4-2*phi5))> | |
21846 | fMixedHarmonicsNestedLoops->Fill(120.5,cos(n*(5.*phi1+5.*phi2-5.*phi3-4.*phi4-1.*phi5)),1.); // <cos(n(5*phi1+5*phi2-5*phi3-4*phi4-1*phi5))> | |
21847 | fMixedHarmonicsNestedLoops->Fill(121.5,cos(n*(6.*phi1-2.*phi2-2.*phi3-1.*phi4-1.*phi5)),1.); // <cos(n(6*phi1-2*phi2-2*phi3-1*phi4-1*phi5))> | |
21848 | fMixedHarmonicsNestedLoops->Fill(122.5,cos(n*(6.*phi1-3.*phi2-1.*phi3-1.*phi4-1.*phi5)),1.); // <cos(n(6*phi1-3*phi2-1*phi3-1*phi4-1*phi5))> | |
21849 | fMixedHarmonicsNestedLoops->Fill(123.5,cos(n*(6.*phi1+1.*phi2+1.*phi3-4.*phi4-4.*phi5)),1.); // <cos(n(6*phi1+1*phi2+1*phi3-4*phi4-4*phi5))> | |
21850 | fMixedHarmonicsNestedLoops->Fill(124.5,cos(n*(6.*phi1+1.*phi2-5.*phi3-1.*phi4-1.*phi5)),1.); // <cos(n(6*phi1+1*phi2-5*phi3-1*phi4-1*phi5))> | |
21851 | fMixedHarmonicsNestedLoops->Fill(125.5,cos(n*(6.*phi1+2.*phi2-4.*phi3-2.*phi4-2.*phi5)),1.); // <cos(n(6*phi1+2*phi2-4*phi3-2*phi4-2*phi5))> | |
21852 | fMixedHarmonicsNestedLoops->Fill(126.5,cos(n*(6.*phi1+4.*phi2-4.*phi3-4.*phi4-2.*phi5)),1.); // <cos(n(6*phi1+4*phi2-4*phi3-4*phi4-2*phi5))> | |
21853 | fMixedHarmonicsNestedLoops->Fill(127.5,cos(n*(6.*phi1+2.*phi2+2.*phi3-5.*phi4-5.*phi5)),1.); // <cos(n(6*phi1+2*phi2+2*phi3-5*phi4-5*phi5))> | |
21854 | fMixedHarmonicsNestedLoops->Fill(128.5,cos(n*(6.*phi1+5.*phi2-5.*phi3-5.*phi4-1.*phi5)),1.); // <cos(n(6*phi1+5*phi2-5*phi3-5*phi4-1*phi5))> | |
21855 | fMixedHarmonicsNestedLoops->Fill(129.5,cos(n*(6.*phi1+6.*phi2-5.*phi3-5.*phi4-2.*phi5)),1.); // <cos(n(6*phi1+6*phi2-5*phi3-5*phi4-2*phi5))> | |
21856 | fMixedHarmonicsNestedLoops->Fill(130.5,cos(n*(6.*phi1+6.*phi2-6.*phi3-4.*phi4-2.*phi5)),1.); // <cos(n(6*phi1+6*phi2-6*phi3-4*phi4-2*phi5))> | |
21857 | fMixedHarmonicsNestedLoops->Fill(131.5,cos(n*(6.*phi1+6.*phi2-6.*phi3-5.*phi4-1.*phi5)),1.); // <cos(n(6*phi1+6*phi2-6*phi3-5*phi4-1*phi5))> // TBI swap with the one above | |
21858 | //fMixedHarmonicsNestedLoops->Fill(132.5,-44.,1.); // empty | |
21859 | fMixedHarmonicsNestedLoops->Fill(133.5,cos(n*(5.*phi1+2.*phi2-3.*phi3-3.*phi4-1.*phi5)),1.); // <cos(n(5*phi1+2*phi2-3*phi3-3*phi4-1*phi5))> | |
21860 | fMixedHarmonicsNestedLoops->Fill(134.5,cos(n*(5.*phi1+1.*phi2+1.*phi3-4.*phi4-3.*phi5)),1.); // <cos(n(5*phi1+1*phi2+1*phi3-4*phi4-3*phi5))> | |
21861 | fMixedHarmonicsNestedLoops->Fill(135.5,cos(n*(5.*phi1+3.*phi2-4.*phi3-2.*phi4-2.*phi5)),1.); // <cos(n(5*phi1+3*phi2-4*phi3-2*phi4-2*phi5))> | |
21862 | fMixedHarmonicsNestedLoops->Fill(136.5,cos(n*(5.*phi1+2.*phi2+1.*phi3-4.*phi4-4.*phi5)),1.); // <cos(n(5*phi1+2*phi2+1*phi3-4*phi4-4*phi5))> | |
21863 | fMixedHarmonicsNestedLoops->Fill(137.5,cos(n*(6.*phi1+1.*phi2-3.*phi3-2.*phi4-2.*phi5)),1.); // <cos(n(6*phi1+1*phi2-3*phi3-2*phi4-2*phi5))> | |
21864 | fMixedHarmonicsNestedLoops->Fill(138.5,cos(n*(6.*phi1+3.*phi2-4.*phi3-4.*phi4-1.*phi5)),1.); // <cos(n(6*phi1+3*phi2-4*phi3-4*phi4-1*phi5))> | |
21865 | fMixedHarmonicsNestedLoops->Fill(139.5,cos(n*(6.*phi1+1.*phi2+1.*phi3-5.*phi4-3.*phi5)),1.); // <cos(n(6*phi1+1*phi2+1*phi3-5*phi4-3*phi5))> | |
21866 | fMixedHarmonicsNestedLoops->Fill(140.5,cos(n*(6.*phi1+3.*phi2-5.*phi3-2.*phi4-2.*phi5)),1.); // <cos(n(6*phi1+3*phi2-5*phi3-2*phi4-2*phi5))> | |
21867 | fMixedHarmonicsNestedLoops->Fill(141.5,cos(n*(6.*phi1+5.*phi2-4.*phi3-4.*phi4-3.*phi5)),1.); // <cos(n(6*phi1+5*phi2-4*phi3-4*phi4-3*phi5))> | |
21868 | fMixedHarmonicsNestedLoops->Fill(142.5,cos(n*(6.*phi1+3.*phi2+1.*phi3-5.*phi4-5.*phi5)),1.); // <cos(n(6*phi1+3*phi2+1*phi3-5*phi4-5*phi5))> | |
21869 | fMixedHarmonicsNestedLoops->Fill(143.5,cos(n*(6.*phi1+6.*phi2-5.*phi3-4.*phi4-3.*phi5)),1.); // <cos(n(6*phi1+6*phi2-5*phi3-4*phi4-3*phi5))> | |
21870 | //fMixedHarmonicsNestedLoops->Fill(144.5,-44.,1.); // empty | |
21871 | fMixedHarmonicsNestedLoops->Fill(145.5,cos(n*(6.*phi1+2.*phi2-4.*phi3-3.*phi4-1.*phi5)),1.); // <cos(n(6*phi1+2*phi2-4*phi3-3*phi4-1*phi5))> | |
21872 | fMixedHarmonicsNestedLoops->Fill(146.5,cos(n*(6.*phi1+2.*phi2+1.*phi3-5.*phi4-4.*phi5)),1.); // <cos(n(6*phi1+2*phi2+1*phi3-5*phi4-4*phi5))> | |
21873 | fMixedHarmonicsNestedLoops->Fill(147.5,cos(n*(6.*phi1+4.*phi2-5.*phi3-3.*phi4-2.*phi5)),1.); // <cos(n(6*phi1+4*phi2-5*phi3-3*phi4-2*phi5))> | |
21874 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
21875 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
21876 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
21877 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
21878 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
21879 | } // end of if(nPrim>=5) | |
21880 | ||
21881 | // QW44 | |
489d5531 | 21882 | |
e1d101a6 | 21883 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateMixedHarmonicsWithNestedLoops(AliFlowEventSimple * const anEvent) |
489d5531 | 21884 | |
e1d101a6 | 21885 | //================================================================================================================ |
489d5531 | 21886 | |
21887 | void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrelations() | |
21888 | { | |
21889 | // Cross-check results for multiparticle correlations needed for int. flow: results from Q-vectors vs results from nested loops. | |
21890 | ||
21891 | cout<<endl; | |
21892 | cout<<endl; | |
21893 | cout<<" *****************************************"<<endl; | |
21894 | cout<<" **** cross-checking the correlations ****"<<endl; | |
21895 | cout<<" **** for integrated flow ****"<<endl; | |
403e3389 | 21896 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 21897 | { |
21898 | cout<<" **** (particle weights not used) ****"<<endl; | |
21899 | } else | |
21900 | { | |
21901 | cout<<" **** (particle weights used) ****"<<endl; | |
21902 | } | |
21903 | cout<<" *****************************************"<<endl; | |
21904 | cout<<endl; | |
21905 | cout<<endl; | |
21906 | ||
403e3389 | 21907 | Int_t ciMax = 64; // to be improved (removed eventually when I calculate 6th and 8th order with particle weights) |
489d5531 | 21908 | |
403e3389 | 21909 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 21910 | { |
21911 | ciMax = 11; | |
21912 | } | |
21913 | ||
21914 | for(Int_t ci=1;ci<=ciMax;ci++) | |
21915 | { | |
21916 | if(strcmp((fIntFlowCorrelationsAllPro->GetXaxis())->GetBinLabel(ci), "") == 0) continue; // to be improved (access finalized histogram here) | |
21917 | cout<<(fIntFlowCorrelationsAllPro->GetXaxis())->GetBinLabel(ci)<<":"<<endl; // to be improved (access finalized histogram here) | |
21918 | cout<<"from Q-vectors = "<<fIntFlowCorrelationsAllPro->GetBinContent(ci)<<endl; // to be improved (access finalized histogram here) | |
21919 | cout<<"from nested loops = "<<fIntFlowDirectCorrelations->GetBinContent(ci)<<endl; | |
21920 | cout<<endl; | |
21921 | } | |
e1d101a6 | 21922 | |
21923 | if(!fCalculateMixedHarmonics){return;} | |
21924 | ||
21925 | cout<<endl; | |
21926 | cout<<endl; | |
21927 | cout<<" *****************************************"<<endl; | |
21928 | cout<<" **** cross-checking the correlations ****"<<endl; | |
21929 | cout<<" **** for mixed harmonics ****"<<endl; | |
21930 | cout<<" *****************************************"<<endl; | |
21931 | cout<<endl; | |
21932 | cout<<endl; | |
21933 | ||
21934 | // 2-p: | |
21935 | for(Int_t ci=1;ci<=6;ci++) | |
21936 | { | |
21937 | cout<<(f2pCorrelations->GetXaxis())->GetBinLabel(ci)<<":"<<endl; | |
21938 | cout<<"from Q-vectors = "<<f2pCorrelations->GetBinContent(ci)<<endl; | |
21939 | cout<<"from nested loops = "<<fMixedHarmonicsNestedLoops->GetBinContent(ci)<<endl; | |
21940 | cout<<endl; | |
21941 | } // end of for(Int_t ci=1;ci<=6;ci++) | |
21942 | ||
21943 | // 3-p: | |
21944 | for(Int_t ci=1;ci<=10;ci++) | |
21945 | { | |
21946 | if(4==ci){continue;} // skipping the empty bins | |
21947 | cout<<(f3pCorrelations->GetXaxis())->GetBinLabel(ci)<<":"<<endl; | |
21948 | cout<<"from Q-vectors = "<<f3pCorrelations->GetBinContent(ci)<<endl; | |
21949 | cout<<"from nested loops = "<<fMixedHarmonicsNestedLoops->GetBinContent(ci+6)<<endl; | |
21950 | cout<<endl; | |
21951 | } // end of for(Int_t ci=1;ci<=10;ci++) | |
21952 | ||
21953 | // 4-p: | |
21954 | for(Int_t ci=1;ci<=45;ci++) | |
21955 | { | |
21956 | if(7==ci||23==ci||26==ci||37==ci){continue;} // skipping the empty bins | |
21957 | cout<<(f4pCorrelations->GetXaxis())->GetBinLabel(ci)<<":"<<endl; | |
21958 | cout<<"from Q-vectors = "<<f4pCorrelations->GetBinContent(ci)<<endl; | |
21959 | cout<<"from nested loops = "<<fMixedHarmonicsNestedLoops->GetBinContent(ci+6+10)<<endl; | |
21960 | //if(TMath::Abs(f4pCorrelations->GetBinContent(ci)-fMixedHarmonicsNestedLoops->GetBinContent(ci+6+10)) | |
21961 | // > 1.e-10){exit(0);} | |
21962 | cout<<endl; | |
21963 | } // end of for(Int_t ci=1;ci<=45;ci++) | |
21964 | ||
21965 | for(Int_t ci=1;ci<=87;ci++) | |
21966 | { | |
21967 | if(31==ci||41==ci||72==ci||84==ci){continue;} // skipping the empty bins | |
21968 | cout<<(f5pCorrelations->GetXaxis())->GetBinLabel(ci)<<":"<<endl; | |
21969 | cout<<"from Q-vectors = "<<f5pCorrelations->GetBinContent(ci)<<endl; | |
21970 | cout<<"from nested loops = "<<fMixedHarmonicsNestedLoops->GetBinContent(ci+6+10+45)<<endl; | |
21971 | if(TMath::Abs(f5pCorrelations->GetBinContent(ci)-fMixedHarmonicsNestedLoops->GetBinContent(ci+6+10+45)) | |
21972 | > 1.e-10){exit(0);} | |
21973 | cout<<endl; | |
21974 | } // end of for(Int_t ci=1;ci<=87;ci++) | |
21975 | ||
21976 | return; | |
21977 | ||
489d5531 | 21978 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrelations() |
21979 | ||
e1d101a6 | 21980 | //======================================================================================================================= |
489d5531 | 21981 | |
489d5531 | 21982 | void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrectionTermsForNUA() |
21983 | { | |
21984 | // Cross-check results for corrections terms for non-uniform acceptance needed for int. flow: results from Q-vectors vs results from nested loops. | |
21985 | ||
21986 | cout<<endl; | |
21987 | cout<<endl; | |
21988 | cout<<" *********************************************"<<endl; | |
21989 | cout<<" **** cross-checking the correction terms ****"<<endl; | |
21990 | cout<<" **** for non-uniform acceptance relevant ****"<<endl; | |
21991 | cout<<" **** for integrated flow ****"<<endl; | |
403e3389 | 21992 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 21993 | { |
21994 | cout<<" **** (particle weights not used) ****"<<endl; | |
21995 | } else | |
21996 | { | |
21997 | cout<<" **** (particle weights used) ****"<<endl; | |
21998 | } | |
21999 | cout<<" *********************************************"<<endl; | |
22000 | cout<<endl; | |
22001 | cout<<endl; | |
22002 | ||
b92ea2b9 | 22003 | for(Int_t ci=1;ci<=4;ci++) // correction term index (to be improved - hardwired 4) |
489d5531 | 22004 | { |
22005 | for(Int_t sc=0;sc<2;sc++) // sin or cos term | |
22006 | { | |
22007 | if(strcmp((fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->GetBinLabel(ci), "") == 0) continue; // to be improved (access finalized histogram here) | |
22008 | cout<<(fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->GetBinLabel(ci)<<":"<<endl; // to be improved (access finalized histogram here) | |
22009 | cout<<"from Q-vectors = "<<fIntFlowCorrectionTermsForNUAPro[sc]->GetBinContent(ci)<<endl; // to be improved (access finalized histogram here) | |
22010 | cout<<"from nested loops = "<<fIntFlowDirectCorrectionTermsForNUA[sc]->GetBinContent(ci)<<endl; | |
22011 | cout<<endl; | |
22012 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos term | |
22013 | } // end of for(Int_t ci=1;ci<=10;ci++) // correction term index | |
22014 | ||
22015 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrectionTermsForNUA() | |
22016 | ||
e1d101a6 | 22017 | //======================================================================================================================= |
489d5531 | 22018 | |
0328db2d | 22019 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent) |
489d5531 | 22020 | { |
22021 | // Evaluate with nested loops multiparticle correlations for integrated flow (using the particle weights). | |
22022 | ||
22023 | // Results are stored in profile fIntFlowDirectCorrelations. | |
22024 | // Remark 1: When particle weights are used the binning of fIntFlowDirectCorrelations is organized as follows: | |
22025 | // | |
22026 | // 1st bin: <2>_{1n|1n} = two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))> | |
22027 | // 2nd bin: <2>_{2n|2n} = two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
22028 | // 3rd bin: <2>_{3n|3n} = two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
22029 | // 4th bin: <2>_{4n|4n} = two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
22030 | // 5th bin: ---- EMPTY ---- | |
22031 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
22032 | // 7th bin: <3>_{3n|2n,1n} = ... | |
22033 | // 8th bin: <3>_{4n|2n,2n} = ... | |
22034 | // 9th bin: <3>_{4n|3n,1n} = ... | |
22035 | // 10th bin: ---- EMPTY ---- | |
22036 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
22037 | // 12th bin: <4>_{2n,1n|2n,1n} = ... | |
22038 | // 13th bin: <4>_{2n,2n|2n,2n} = ... | |
22039 | // 14th bin: <4>_{3n|1n,1n,1n} = ... | |
22040 | // 15th bin: <4>_{3n,1n|3n,1n} = ... | |
22041 | // 16th bin: <4>_{3n,1n|2n,2n} = ... | |
22042 | // 17th bin: <4>_{4n|2n,1n,1n} = ... | |
22043 | // 18th bin: ---- EMPTY ---- | |
22044 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = ... | |
22045 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = ... | |
22046 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = ... | |
22047 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = ... | |
22048 | // 23rd bin: ---- EMPTY ---- | |
22049 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = ... | |
22050 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = ... | |
22051 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = ... | |
22052 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = ... | |
22053 | // 28th bin: ---- EMPTY ---- | |
22054 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = ... | |
22055 | // 30th bin: ---- EMPTY ---- | |
22056 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = ... | |
57340a27 | 22057 | |
489d5531 | 22058 | // Remark 2: When particle weights are used there are some extra correlations. They are stored in |
22059 | // fIntFlowExtraDirectCorrelations binning of which is organized as follows: | |
57340a27 | 22060 | |
489d5531 | 22061 | // 1st bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))> |
22062 | // 2nd bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
22063 | // ... | |
57340a27 | 22064 | |
489d5531 | 22065 | Int_t nPrim = anEvent->NumberOfTracks(); |
22066 | AliFlowTrackSimple *aftsTrack = NULL; | |
22067 | //Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; | |
22068 | //Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
22069 | Double_t phi1=0., phi2=0., phi3=0., phi4=0.; | |
22070 | Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1.; | |
22071 | Int_t n = fHarmonic; | |
22072 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 22073 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 22074 | cout<<endl; |
22075 | cout<<"Multiparticle correlations: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
22076 | if(dMult<2) | |
22077 | { | |
22078 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
22079 | } else if (dMult>fMaxAllowedMultiplicity) | |
22080 | { | |
22081 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
22082 | } else | |
22083 | { | |
22084 | cout<<"... evaluating nested loops (using particle weights) ..."<<endl; | |
22085 | } | |
22086 | ||
22087 | // 2-particle correlations: | |
22088 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
22089 | { | |
22090 | // 2 nested loops multiparticle correlations using particle weights: | |
22091 | for(Int_t i1=0;i1<nPrim;i1++) | |
22092 | { | |
22093 | aftsTrack=anEvent->GetTrack(i1); | |
22094 | if(!(aftsTrack->InRPSelection())) continue; | |
22095 | phi1=aftsTrack->Phi(); | |
22096 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
22097 | for(Int_t i2=0;i2<nPrim;i2++) | |
22098 | { | |
22099 | if(i2==i1)continue; | |
22100 | aftsTrack=anEvent->GetTrack(i2); | |
22101 | if(!(aftsTrack->InRPSelection())) continue; | |
22102 | phi2=aftsTrack->Phi(); | |
22103 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
22104 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
22105 | // 2-p correlations using particle weights: | |
22106 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),wPhi1*wPhi2); // <w1 w2 cos( n*(phi1-phi2))> | |
22107 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(1.5,cos(2.*n*(phi1-phi2)),pow(wPhi1,2)*pow(wPhi2,2)); // <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
22108 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(2.5,cos(3.*n*(phi1-phi2)),pow(wPhi1,3)*pow(wPhi2,3)); // <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
22109 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(3.5,cos(4.*n*(phi1-phi2)),pow(wPhi1,4)*pow(wPhi2,4)); // <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
22110 | // extra correlations: | |
22111 | // 2-p extra correlations (do not appear if particle weights are not used): | |
22112 | if(fUsePhiWeights) fIntFlowExtraDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),pow(wPhi1,3)*wPhi2); // <w1^3 w2 cos(n*(phi1-phi2))> | |
22113 | // ... | |
22114 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
22115 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
22116 | } // end of if(nPrim>=2) | |
22117 | ||
22118 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
57340a27 | 22119 | { |
489d5531 | 22120 | // 3 nested loops multiparticle correlations using particle weights: |
22121 | for(Int_t i1=0;i1<nPrim;i1++) | |
57340a27 | 22122 | { |
489d5531 | 22123 | aftsTrack=anEvent->GetTrack(i1); |
22124 | if(!(aftsTrack->InRPSelection())) continue; | |
22125 | phi1=aftsTrack->Phi(); | |
22126 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
22127 | for(Int_t i2=0;i2<nPrim;i2++) | |
22128 | { | |
22129 | if(i2==i1)continue; | |
22130 | aftsTrack=anEvent->GetTrack(i2); | |
22131 | if(!(aftsTrack->InRPSelection())) continue; | |
22132 | phi2=aftsTrack->Phi(); | |
22133 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
22134 | for(Int_t i3=0;i3<nPrim;i3++) | |
22135 | { | |
22136 | if(i3==i1||i3==i2)continue; | |
22137 | aftsTrack=anEvent->GetTrack(i3); | |
22138 | if(!(aftsTrack->InRPSelection())) continue; | |
22139 | phi3=aftsTrack->Phi(); | |
22140 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
22141 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
22142 | // 3-p correlations using particle weights: | |
22143 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(5.5,cos(2.*n*phi1-n*(phi2+phi3)),pow(wPhi1,2)*wPhi2*wPhi3); // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
22144 | // ... | |
22145 | // extra correlations: | |
22146 | // 2-p extra correlations (do not appear if particle weights are not used): | |
22147 | if(fUsePhiWeights) fIntFlowExtraDirectCorrelations->Fill(1.5,cos(n*(phi1-phi2)),wPhi1*wPhi2*pow(wPhi3,2)); // <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
22148 | // ... | |
22149 | // 3-p extra correlations (do not appear if particle weights are not used): | |
22150 | // ... | |
22151 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
22152 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
22153 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
22154 | } // end of if(nPrim>=3) | |
57340a27 | 22155 | |
489d5531 | 22156 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) |
22157 | { | |
22158 | // 4 nested loops multiparticle correlations using particle weights: | |
22159 | for(Int_t i1=0;i1<nPrim;i1++) | |
22160 | { | |
22161 | aftsTrack=anEvent->GetTrack(i1); | |
22162 | if(!(aftsTrack->InRPSelection())) continue; | |
22163 | phi1=aftsTrack->Phi(); | |
22164 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
22165 | for(Int_t i2=0;i2<nPrim;i2++) | |
22166 | { | |
22167 | if(i2==i1)continue; | |
22168 | aftsTrack=anEvent->GetTrack(i2); | |
22169 | if(!(aftsTrack->InRPSelection())) continue; | |
22170 | phi2=aftsTrack->Phi(); | |
22171 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
22172 | for(Int_t i3=0;i3<nPrim;i3++) | |
22173 | { | |
22174 | if(i3==i1||i3==i2)continue; | |
22175 | aftsTrack=anEvent->GetTrack(i3); | |
22176 | if(!(aftsTrack->InRPSelection())) continue; | |
22177 | phi3=aftsTrack->Phi(); | |
22178 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
22179 | for(Int_t i4=0;i4<nPrim;i4++) | |
22180 | { | |
22181 | if(i4==i1||i4==i2||i4==i3)continue; | |
22182 | aftsTrack=anEvent->GetTrack(i4); | |
22183 | if(!(aftsTrack->InRPSelection())) continue; | |
22184 | phi4=aftsTrack->Phi(); | |
22185 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); | |
22186 | if(nPrim>=4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; // to be improved (replace eventually this if statement with if(nPrim==4)) | |
22187 | // 4-p correlations using particle weights: | |
22188 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(10.5,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); | |
22189 | // extra correlations: | |
22190 | // 2-p extra correlations (do not appear if particle weights are not used): | |
22191 | // ... | |
22192 | // 3-p extra correlations (do not appear if particle weights are not used): | |
22193 | // ... | |
22194 | // 4-p extra correlations (do not appear if particle weights are not used): | |
22195 | // ... | |
22196 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
22197 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
22198 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
22199 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
22200 | } // end of if(nPrim>=4) | |
57340a27 | 22201 | |
489d5531 | 22202 | cout<<endl; |
57340a27 | 22203 | |
489d5531 | 22204 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent) |
57340a27 | 22205 | |
e1d101a6 | 22206 | //======================================================================================================================= |
489d5531 | 22207 | |
489d5531 | 22208 | void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowExtraCorrelations() |
57340a27 | 22209 | { |
489d5531 | 22210 | // Cross-check results for extra multiparticle correlations needed for int. flow |
22211 | // which appear only when particle weights are used: results from Q-vectors vs results from nested loops. | |
57340a27 | 22212 | |
489d5531 | 22213 | cout<<endl; |
22214 | cout<<endl; | |
22215 | cout<<" ***********************************************"<<endl; | |
22216 | cout<<" **** cross-checking the extra correlations ****"<<endl; | |
22217 | cout<<" **** for integrated flow ****"<<endl; | |
22218 | cout<<" ***********************************************"<<endl; | |
22219 | cout<<endl; | |
22220 | cout<<endl; | |
22221 | ||
22222 | for(Int_t eci=1;eci<=2;eci++) // to be improved (increased eciMax eventually when I calculate 6th and 8th) | |
57340a27 | 22223 | { |
489d5531 | 22224 | if(strcmp((fIntFlowExtraCorrelationsPro->GetXaxis())->GetBinLabel(eci), "") == 0) continue; |
22225 | cout<<(fIntFlowExtraCorrelationsPro->GetXaxis())->GetBinLabel(eci)<<":"<<endl; | |
22226 | cout<<"from Q-vectors = "<<fIntFlowExtraCorrelationsPro->GetBinContent(eci)<<endl; | |
22227 | cout<<"from nested loops = "<<fIntFlowExtraDirectCorrelations->GetBinContent(eci)<<endl; | |
22228 | cout<<endl; | |
22229 | } | |
57340a27 | 22230 | |
489d5531 | 22231 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowExtraCorrelations() |
57340a27 | 22232 | |
e1d101a6 | 22233 | //======================================================================================================================= |
3b552efe | 22234 | |
0328db2d | 22235 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoops(AliFlowEventSimple * const anEvent) |
489d5531 | 22236 | { |
22237 | // Evaluate with nested loops correction terms for non-uniform acceptance relevant for NONAME integrated flow (to be improved (name)). | |
22238 | // | |
22239 | // Remark: Both sin and cos correction terms are calculated in this method. Sin terms are stored in fIntFlowDirectCorrectionTermsForNUA[0], | |
22240 | // and cos terms in fIntFlowDirectCorrectionTermsForNUA[1]. Binning of fIntFlowDirectCorrectionTermsForNUA[sc] is organized as follows | |
22241 | // (sc stands for either sin or cos): | |
22242 | ||
22243 | // 1st bin: <<sc(n*(phi1))>> | |
22244 | // 2nd bin: <<sc(n*(phi1+phi2))>> | |
22245 | // 3rd bin: <<sc(n*(phi1-phi2-phi3))>> | |
22246 | // 4th bin: <<sc(n*(2phi1-phi2))>> | |
22247 | ||
22248 | Int_t nPrim = anEvent->NumberOfTracks(); | |
22249 | AliFlowTrackSimple *aftsTrack = NULL; | |
22250 | Double_t phi1=0., phi2=0., phi3=0.; | |
22251 | Int_t n = fHarmonic; | |
22252 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 22253 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 22254 | cout<<endl; |
22255 | cout<<"Correction terms for non-uniform acceptance: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
22256 | if(dMult<1) | |
3b552efe | 22257 | { |
489d5531 | 22258 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; |
22259 | } else if (dMult>fMaxAllowedMultiplicity) | |
3b552efe | 22260 | { |
489d5531 | 22261 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; |
22262 | } else | |
22263 | { | |
22264 | cout<<"... evaluating nested loops (without using particle weights)..."<<endl; | |
22265 | } | |
22266 | ||
22267 | if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity) | |
22268 | { | |
22269 | // 1-particle correction terms for non-uniform acceptance: | |
22270 | for(Int_t i1=0;i1<nPrim;i1++) | |
22271 | { | |
22272 | aftsTrack=anEvent->GetTrack(i1); | |
22273 | if(!(aftsTrack->InRPSelection())) continue; | |
22274 | phi1=aftsTrack->Phi(); | |
22275 | if(nPrim==1) cout<<i1<<"\r"<<flush; | |
22276 | // sin terms: | |
22277 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(0.5,sin(n*phi1),1.); // <sin(n*phi1)> | |
22278 | // cos terms: | |
22279 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(0.5,cos(n*phi1),1.); // <cos(n*phi1)> | |
22280 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
22281 | } // end of if(nPrim>=1) | |
22282 | ||
22283 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
22284 | { | |
22285 | // 2-particle correction terms for non-uniform acceptance: | |
22286 | for(Int_t i1=0;i1<nPrim;i1++) | |
22287 | { | |
22288 | aftsTrack=anEvent->GetTrack(i1); | |
22289 | if(!(aftsTrack->InRPSelection())) continue; | |
22290 | phi1=aftsTrack->Phi(); | |
22291 | for(Int_t i2=0;i2<nPrim;i2++) | |
3b552efe | 22292 | { |
489d5531 | 22293 | if(i2==i1)continue; |
22294 | aftsTrack=anEvent->GetTrack(i2); | |
22295 | if(!(aftsTrack->InRPSelection())) continue; | |
22296 | phi2=aftsTrack->Phi(); | |
22297 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
22298 | // sin terms: | |
3b552efe | 22299 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(1.5,sin(n*(phi1+phi2)),1.); // <<sin(n*(phi1+phi2))>> |
489d5531 | 22300 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(3.5,sin(n*(2*phi1-phi2)),1.); // <<sin(n*(2*phi1-phi2))>> |
22301 | // cos terms: | |
3b552efe | 22302 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(1.5,cos(n*(phi1+phi2)),1.); // <<cos(n*(phi1+phi2))>> |
489d5531 | 22303 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(3.5,cos(n*(2*phi1-phi2)),1.); // <<cos(n*(2*phi1-phi2))>> |
22304 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
22305 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
22306 | } // end of if(nPrim>=2) | |
22307 | ||
22308 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
22309 | { | |
22310 | // 3-particle correction terms for non-uniform acceptance: | |
22311 | for(Int_t i1=0;i1<nPrim;i1++) | |
22312 | { | |
22313 | aftsTrack=anEvent->GetTrack(i1); | |
22314 | if(!(aftsTrack->InRPSelection())) continue; | |
22315 | phi1=aftsTrack->Phi(); | |
22316 | for(Int_t i2=0;i2<nPrim;i2++) | |
22317 | { | |
22318 | if(i2==i1)continue; | |
22319 | aftsTrack=anEvent->GetTrack(i2); | |
22320 | if(!(aftsTrack->InRPSelection())) continue; | |
22321 | phi2=aftsTrack->Phi(); | |
22322 | for(Int_t i3=0;i3<nPrim;i3++) | |
22323 | { | |
22324 | if(i3==i1||i3==i2)continue; | |
22325 | aftsTrack=anEvent->GetTrack(i3); | |
22326 | if(!(aftsTrack->InRPSelection())) continue; | |
22327 | phi3=aftsTrack->Phi(); | |
22328 | if(nPrim>=3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; // to be improved (eventually I will change this if statement) | |
22329 | // sin terms: | |
22330 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(2.5,sin(n*(phi1-phi2-phi3)),1.); // <<sin(n*(phi1-phi2-phi3))>> | |
22331 | // cos terms: | |
22332 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(2.5,cos(n*(phi1-phi2-phi3)),1.); // <<cos(n*(phi1-phi2-phi3))>> | |
22333 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
22334 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
22335 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
22336 | } // end of if(nPrim>=3) | |
22337 | ||
22338 | cout<<endl; | |
22339 | } | |
64e500e3 | 22340 | |
e1d101a6 | 22341 | //======================================================================================================================= |
64e500e3 | 22342 | |
0328db2d | 22343 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 22344 | { |
22345 | // Evaluate reduced correlations with nested loops without using the particle weights. | |
22346 | ||
22347 | // Remark 1: Reduced correlations are evaluated in pt bin number fCrossCheckInPtBinNo and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
22348 | // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrelations[t][pe][ci], where indices runs as follows: | |
22349 | // [0=RP,1=POI][0=Pt,1=Eta][0=<2'>,1=<4'>,2=<6'>,3=<8'>] | |
22350 | // Remark 3: <2'> = <cos(n*(psi1-phi2))> | |
22351 | // <4'> = <cos(n*(psi1+phi2-phi3-phi4))> | |
22352 | // ... | |
22353 | ||
2a98ceb8 | 22354 | Int_t typeFlag = 0; |
22355 | Int_t ptEtaFlag = 0; | |
489d5531 | 22356 | if(type == "RP") |
22357 | { | |
22358 | typeFlag = 0; | |
22359 | } else if(type == "POI") | |
22360 | { | |
22361 | typeFlag = 1; | |
22362 | } | |
22363 | if(ptOrEta == "Pt") | |
22364 | { | |
22365 | ptEtaFlag = 0; | |
22366 | } else if(ptOrEta == "Eta") | |
22367 | { | |
22368 | ptEtaFlag = 1; | |
22369 | } | |
22370 | // shortcuts: | |
22371 | Int_t t = typeFlag; | |
22372 | Int_t pe = ptEtaFlag; | |
22373 | ||
22374 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
22375 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
22376 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
22377 | ||
22378 | Int_t nPrim = anEvent->NumberOfTracks(); | |
22379 | AliFlowTrackSimple *aftsTrack = NULL; | |
22380 | ||
22381 | Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
22382 | ||
3b552efe | 22383 | Int_t n = fHarmonic; |
489d5531 | 22384 | |
22385 | // 2'-particle correlations: | |
22386 | for(Int_t i1=0;i1<nPrim;i1++) | |
22387 | { | |
22388 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 22389 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
22390 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 22391 | { |
22392 | if(ptOrEta == "Pt") | |
22393 | { | |
22394 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
22395 | } else if (ptOrEta == "Eta") | |
22396 | { | |
22397 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 22398 | } |
22399 | } else // this is diff flow of RPs | |
22400 | { | |
489d5531 | 22401 | if(ptOrEta == "Pt") |
22402 | { | |
22403 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
22404 | } else if (ptOrEta == "Eta") | |
22405 | { | |
22406 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 22407 | } |
22408 | } | |
489d5531 | 22409 | |
22410 | psi1=aftsTrack->Phi(); | |
22411 | for(Int_t i2=0;i2<nPrim;i2++) | |
22412 | { | |
22413 | if(i2==i1)continue; | |
22414 | aftsTrack=anEvent->GetTrack(i2); | |
22415 | // RP condition (!(first) particle in the correlator must be RP): | |
22416 | if(!(aftsTrack->InRPSelection()))continue; | |
22417 | phi2=aftsTrack->Phi(); | |
22418 | // 2'-particle correlations: | |
22419 | fDiffFlowDirectCorrelations[t][pe][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(1.*n*(psi1-phi2)),1.); // <cos(n*(psi1-phi2)) | |
22420 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
22421 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
22422 | ||
22423 | /* | |
22424 | ||
22425 | // 3'-particle correlations: | |
22426 | for(Int_t i1=0;i1<nPrim;i1++) | |
22427 | { | |
22428 | aftsTrack=anEvent->GetTrack(i1); | |
22429 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
22430 | if(ptOrEta == "Pt") | |
22431 | { | |
22432 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
22433 | } else if (ptOrEta == "Eta") | |
22434 | { | |
22435 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
22436 | } | |
22437 | psi1=aftsTrack->Phi(); | |
22438 | for(Int_t i2=0;i2<nPrim;i2++) | |
22439 | { | |
22440 | if(i2==i1)continue; | |
22441 | aftsTrack=anEvent->GetTrack(i2); | |
22442 | // RP condition (!(first) particle in the correlator must be RP): | |
22443 | if(!(aftsTrack->InRPSelection())) continue; | |
22444 | phi2=aftsTrack->Phi(); | |
22445 | for(Int_t i3=0;i3<nPrim;i3++) | |
22446 | { | |
22447 | if(i3==i1||i3==i2)continue; | |
22448 | aftsTrack=anEvent->GetTrack(i3); | |
22449 | // RP condition (!(first) particle in the correlator must be RP): | |
22450 | if(!(aftsTrack->InRPSelection())) continue; | |
22451 | phi3=aftsTrack->Phi(); | |
22452 | // to be improved : where to store it? ->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(2.*phi1-phi2-phi3)),1.); // <w1 w2 w3 cos(n(2psi1-phi2-phi3))> | |
22453 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
22454 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
22455 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
22456 | ||
22457 | */ | |
22458 | ||
22459 | // 4'-particle correlations: | |
22460 | for(Int_t i1=0;i1<nPrim;i1++) | |
22461 | { | |
22462 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 22463 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
22464 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 22465 | { |
22466 | if(ptOrEta == "Pt") | |
22467 | { | |
22468 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
22469 | } else if (ptOrEta == "Eta") | |
22470 | { | |
22471 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 22472 | } |
22473 | } else // this is diff flow of RPs | |
22474 | { | |
489d5531 | 22475 | if(ptOrEta == "Pt") |
22476 | { | |
22477 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
22478 | } else if (ptOrEta == "Eta") | |
22479 | { | |
22480 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 22481 | } |
22482 | } | |
489d5531 | 22483 | |
22484 | psi1=aftsTrack->Phi(); | |
22485 | for(Int_t i2=0;i2<nPrim;i2++) | |
22486 | { | |
22487 | if(i2==i1) continue; | |
22488 | aftsTrack=anEvent->GetTrack(i2); | |
22489 | // RP condition (!(first) particle in the correlator must be RP): | |
22490 | if(!(aftsTrack->InRPSelection())) continue; | |
22491 | phi2=aftsTrack->Phi(); | |
22492 | for(Int_t i3=0;i3<nPrim;i3++) | |
22493 | { | |
22494 | if(i3==i1||i3==i2) continue; | |
22495 | aftsTrack=anEvent->GetTrack(i3); | |
22496 | // RP condition (!(first) particle in the correlator must be RP): | |
22497 | if(!(aftsTrack->InRPSelection())) continue; | |
22498 | phi3=aftsTrack->Phi(); | |
22499 | for(Int_t i4=0;i4<nPrim;i4++) | |
22500 | { | |
22501 | if(i4==i1||i4==i2||i4==i3) continue; | |
22502 | aftsTrack=anEvent->GetTrack(i4); | |
22503 | // RP condition (!(first) particle in the correlator must be RP): | |
22504 | if(!(aftsTrack->InRPSelection())) continue; | |
22505 | phi4=aftsTrack->Phi(); | |
22506 | // 4'-particle correlations: | |
22507 | fDiffFlowDirectCorrelations[t][pe][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3-phi4)),1.); // <cos(n(psi1+phi2-phi3-phi4))> | |
22508 | }//end of for(Int_t i4=0;i4<nPrim;i4++) | |
22509 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
22510 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
22511 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
22512 | ||
22513 | // count # of RPs and POIs in selected pt and eta bins for cross-checkings: | |
3b552efe | 22514 | for(Int_t i=0;i<nPrim;i++) |
22515 | { | |
22516 | aftsTrack=anEvent->GetTrack(i); | |
22517 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
22518 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 22519 | { |
22520 | if(ptOrEta == "Pt") | |
22521 | { | |
22522 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
22523 | } else if (ptOrEta == "Eta") | |
22524 | { | |
22525 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 22526 | } |
22527 | } else // this is diff flow of RPs | |
22528 | { | |
489d5531 | 22529 | if(ptOrEta == "Pt") |
22530 | { | |
22531 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
22532 | } else if (ptOrEta == "Eta") | |
22533 | { | |
22534 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 22535 | } |
22536 | } | |
22537 | if(t==1)t++; | |
22538 | fNoOfParticlesInBin->Fill(t+pe+0.5); | |
489d5531 | 22539 | } |
22540 | ||
22541 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
22542 | ||
e1d101a6 | 22543 | //======================================================================================================================= |
489d5531 | 22544 | |
64e500e3 | 22545 | void AliFlowAnalysisWithQCumulants::EvaluateOtherDiffCorrelatorsWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
22546 | { | |
22547 | // Evaluate other differential correlators with nested loops without using the particle weights. | |
22548 | ||
22549 | // Remark 1: Other differential correlators are evaluated in pt bin number fCrossCheckInPtBinNo | |
22550 | // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
22551 | // Remark 2: Results are stored in 1 bin profiles fOtherDirectDiffCorrelators[t][pe][sc][ci], where indices runs as follows: | |
22552 | // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms][ci = correlator index] | |
22553 | // Remark 3: Correlator index 'ci' runs as follows: | |
22554 | // 0: <exp(n*(psi1-3phi2+2phi3))> (Teaney-Yan correlator) | |
22555 | ||
22556 | Int_t typeFlag = 0; | |
22557 | Int_t ptEtaFlag = 0; | |
22558 | if(type == "RP") | |
22559 | { | |
22560 | typeFlag = 0; | |
22561 | } else if(type == "POI") | |
22562 | { | |
22563 | typeFlag = 1; | |
22564 | } | |
22565 | if(ptOrEta == "Pt") | |
22566 | { | |
22567 | ptEtaFlag = 0; | |
22568 | } else if(ptOrEta == "Eta") | |
22569 | { | |
22570 | ptEtaFlag = 1; | |
22571 | } | |
22572 | // shortcuts: | |
22573 | Int_t t = typeFlag; | |
22574 | Int_t pe = ptEtaFlag; | |
22575 | ||
22576 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
22577 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
22578 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
22579 | ||
22580 | Int_t nPrim = anEvent->NumberOfTracks(); | |
22581 | AliFlowTrackSimple *aftsTrack = NULL; | |
22582 | ||
22583 | Double_t psi1=0., phi2=0., phi3=0.; | |
22584 | ||
22585 | Int_t n = fHarmonic; | |
22586 | ||
22587 | // 3-p correlators: | |
22588 | for(Int_t i1=0;i1<nPrim;i1++) | |
22589 | { | |
22590 | aftsTrack=anEvent->GetTrack(i1); | |
22591 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
22592 | if(typeFlag==1) // this is diff flow of POIs | |
22593 | { | |
22594 | if(ptOrEta == "Pt") | |
22595 | { | |
22596 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
22597 | } else if (ptOrEta == "Eta") | |
22598 | { | |
22599 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
22600 | } | |
22601 | } else // this is diff flow of RPs | |
22602 | { | |
22603 | if(ptOrEta == "Pt") | |
22604 | { | |
22605 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
22606 | } else if (ptOrEta == "Eta") | |
22607 | { | |
22608 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
22609 | } | |
22610 | } | |
22611 | psi1=aftsTrack->Phi(); | |
22612 | for(Int_t i2=0;i2<nPrim;i2++) | |
22613 | { | |
22614 | if(i2==i1) continue; | |
22615 | aftsTrack=anEvent->GetTrack(i2); | |
22616 | // RP condition (!(first) particle in the correlator must be RP): | |
22617 | if(!(aftsTrack->InRPSelection())) continue; | |
22618 | phi2=aftsTrack->Phi(); | |
22619 | for(Int_t i3=0;i3<nPrim;i3++) | |
22620 | { | |
22621 | if(i3==i1||i3==i2) continue; | |
22622 | aftsTrack=anEvent->GetTrack(i3); | |
22623 | // RP condition (!(first) particle in the correlator must be RP): | |
22624 | if(!(aftsTrack->InRPSelection())) continue; | |
22625 | phi3=aftsTrack->Phi(); | |
22626 | // Fill 3-p correlators: | |
22627 | fOtherDirectDiffCorrelators[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-3.*phi2+2.*phi3)),1.); // <cos(n(psi1-3.*phi2+2.*phi3))> | |
22628 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
22629 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
22630 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
22631 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateOtherDiffCorrelatorsWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) | |
22632 | ||
e1d101a6 | 22633 | //======================================================================================================================= |
489d5531 | 22634 | |
22635 | void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrelations(TString type, TString ptOrEta) | |
22636 | { | |
22637 | // Compare correlations needed for diff. flow calculated with nested loops and those calculated from Q-vectors | |
22638 | ||
2a98ceb8 | 22639 | Int_t typeFlag = 0; |
22640 | Int_t ptEtaFlag = 0; | |
489d5531 | 22641 | if(type == "RP") |
22642 | { | |
22643 | typeFlag = 0; | |
22644 | } else if(type == "POI") | |
22645 | { | |
22646 | typeFlag = 1; | |
22647 | } | |
22648 | if(ptOrEta == "Pt") | |
22649 | { | |
22650 | ptEtaFlag = 0; | |
22651 | } else if(ptOrEta == "Eta") | |
22652 | { | |
22653 | ptEtaFlag = 1; | |
22654 | } | |
22655 | // shortcuts: | |
22656 | Int_t t = typeFlag; | |
22657 | Int_t pe = ptEtaFlag; | |
22658 | ||
22659 | TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
22660 | TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
22661 | TString reducedCorrelations[4] = {"<<cos(n(psi1-phi2))>>","<<cos(n(psi1+phi2-phi3-phi4))>>","",""}; // to be improved (access this from pro or hist) | |
22662 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
22663 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
22664 | ||
22665 | Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo}; | |
22666 | ||
22667 | ||
22668 | cout<<endl; | |
22669 | cout<<" *****************************************"<<endl; | |
22670 | cout<<" **** cross-checking the correlations ****"<<endl; | |
22671 | cout<<" **** for differential flow ("<<rpORpoiString[t]<<") ****"<<endl; | |
403e3389 | 22672 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 22673 | { |
22674 | cout<<" **** (particle weights not used) ****"<<endl; | |
22675 | } else | |
22676 | { | |
22677 | cout<<" **** (particle weights used) ****"<<endl; | |
22678 | } | |
22679 | cout<<" *****************************************"<<endl; | |
22680 | cout<<endl; | |
22681 | cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl; | |
22682 | cout<<endl; | |
22683 | ||
22684 | for(Int_t rci=0;rci<2;rci++) // to be improved (calculate 6th and 8th order) | |
22685 | { | |
22686 | cout<<" "<<reducedCorrelations[rci].Data()<<":"<<endl; | |
22687 | cout<<" from Q-vectors = "<<fDiffFlowCorrelationsPro[t][pe][rci]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl; | |
22688 | cout<<" from nested loops = "<<fDiffFlowDirectCorrelations[t][pe][rci]->GetBinContent(1)<<endl; | |
22689 | cout<<endl; | |
22690 | } // end of for(Int_t rci=0;rci<4;rci++) | |
22691 | ||
22692 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrelations(TString type, TString ptOrEta) | |
22693 | ||
e1d101a6 | 22694 | //======================================================================================================================= |
3b552efe | 22695 | |
64e500e3 | 22696 | void AliFlowAnalysisWithQCumulants::CrossCheckOtherDiffCorrelators(TString type, TString ptOrEta) |
22697 | { | |
22698 | // Compare correlations needed for diff. flow calculated with nested loops and those calculated from Q-vectors | |
22699 | ||
22700 | Int_t typeFlag = 0; | |
22701 | Int_t ptEtaFlag = 0; | |
22702 | if(type == "RP") | |
22703 | { | |
22704 | typeFlag = 0; | |
22705 | } else if(type == "POI") | |
22706 | { | |
22707 | typeFlag = 1; | |
22708 | } | |
22709 | if(ptOrEta == "Pt") | |
22710 | { | |
22711 | ptEtaFlag = 0; | |
22712 | } else if(ptOrEta == "Eta") | |
22713 | { | |
22714 | ptEtaFlag = 1; | |
22715 | } | |
22716 | // shortcuts: | |
22717 | Int_t t = typeFlag; | |
22718 | Int_t pe = ptEtaFlag; | |
22719 | ||
22720 | TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
22721 | TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
22722 | TString otherCorrelators[1] = {"<<cos(n(psi1-3phi2+2phi3))>>"}; // to be improved (access this from pro or hist) | |
22723 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
22724 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
22725 | ||
22726 | Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo}; | |
22727 | ||
22728 | cout<<endl; | |
22729 | cout<<" *****************************************"<<endl; | |
22730 | cout<<" **** cross-checking the other ****"<<endl; | |
22731 | cout<<" **** diff. correlators ("<<rpORpoiString[t]<<") ****"<<endl; | |
403e3389 | 22732 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
64e500e3 | 22733 | { |
22734 | cout<<" **** (particle weights not used) ****"<<endl; | |
22735 | } else | |
22736 | { | |
22737 | cout<<" **** (particle weights used) ****"<<endl; | |
22738 | } | |
22739 | cout<<" *****************************************"<<endl; | |
22740 | cout<<endl; | |
22741 | cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl; | |
22742 | cout<<endl; | |
22743 | ||
22744 | for(Int_t ci=0;ci<1;ci++) | |
22745 | { | |
22746 | cout<<" "<<otherCorrelators[ci].Data()<<":"<<endl; | |
22747 | cout<<" from Q-vectors = "<<fOtherDiffCorrelators[t][pe][1][ci]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl; | |
22748 | cout<<" from nested loops = "<<fOtherDirectDiffCorrelators[t][pe][1][ci]->GetBinContent(1)<<endl; | |
22749 | cout<<endl; | |
22750 | } // end of for(Int_t ci=0;ci<1;ci++) | |
22751 | ||
22752 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckOtherDiffCorrelators(TString type, TString ptOrEta) | |
22753 | ||
e1d101a6 | 22754 | //======================================================================================================================= |
64e500e3 | 22755 | |
489d5531 | 22756 | void AliFlowAnalysisWithQCumulants::PrintNumberOfParticlesInSelectedBin() |
3b552efe | 22757 | { |
22758 | // Print on the screen number of RPs and POIs in selected pt and eta bin for cross checkings. | |
22759 | ||
22760 | cout<<endl; | |
22761 | cout<<"Number of RPs in selected pt bin = "<<fNoOfParticlesInBin->GetBinContent(1)<<endl; | |
22762 | cout<<"Number of RPs in selected eta bin = "<<fNoOfParticlesInBin->GetBinContent(2)<<endl; | |
22763 | cout<<"Number of POIs in selected pt bin = "<<fNoOfParticlesInBin->GetBinContent(3)<<endl; | |
22764 | cout<<"Number of POIs in selected eta bin = "<<fNoOfParticlesInBin->GetBinContent(4)<<endl; | |
22765 | ||
489d5531 | 22766 | } // end of void AliFlowAnalysisWithQCumulants::PrintNumberOfParticlesInSelectedBin() |
22767 | ||
e1d101a6 | 22768 | //======================================================================================================================= |
3b552efe | 22769 | |
0328db2d | 22770 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 22771 | { |
22772 | // Evaluate reduced correlations with nested loops without using the particle weights. | |
22773 | ||
22774 | // Remark 1: Reduced correlations are evaluated in pt bin number fCrossCheckInPtBinNo and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
22775 | // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrelations[t][pe][ci], where indices runs as follows: | |
22776 | // [0=RP,1=POI][0=Pt,1=Eta][0=<2'>,1=<4'>,2=<6'>,3=<8'>] | |
22777 | // Remark 3: <2'> = <w2 cos(n*(psi1-phi2))> | |
22778 | // <4'> = <w2 w3 w4 cos(n*(psi1+phi2-phi3-phi4))> | |
22779 | // ... | |
22780 | ||
2a98ceb8 | 22781 | Int_t typeFlag = 0; |
22782 | Int_t ptEtaFlag = 0; | |
489d5531 | 22783 | if(type == "RP") |
22784 | { | |
22785 | typeFlag = 0; | |
22786 | } else if(type == "POI") | |
22787 | { | |
22788 | typeFlag = 1; | |
22789 | } | |
22790 | if(ptOrEta == "Pt") | |
22791 | { | |
22792 | ptEtaFlag = 0; | |
22793 | } else if(ptOrEta == "Eta") | |
22794 | { | |
22795 | ptEtaFlag = 1; | |
22796 | } | |
22797 | // shortcuts: | |
22798 | Int_t t = typeFlag; | |
22799 | Int_t pe = ptEtaFlag; | |
22800 | ||
22801 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
22802 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
22803 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
22804 | ||
22805 | Int_t nPrim = anEvent->NumberOfTracks(); | |
22806 | AliFlowTrackSimple *aftsTrack = NULL; | |
22807 | ||
22808 | Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
22809 | Double_t wPhi2=1., wPhi3=1., wPhi4=1.;// wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
22810 | ||
22811 | Int_t n = fHarmonic; | |
22812 | ||
22813 | // 2'-particle correlations: | |
22814 | for(Int_t i1=0;i1<nPrim;i1++) | |
22815 | { | |
22816 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 22817 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
22818 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 22819 | { |
22820 | if(ptOrEta == "Pt") | |
22821 | { | |
22822 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
22823 | } else if (ptOrEta == "Eta") | |
22824 | { | |
22825 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 22826 | } |
22827 | } else // this is diff flow of RPs | |
22828 | { | |
489d5531 | 22829 | if(ptOrEta == "Pt") |
22830 | { | |
22831 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
22832 | } else if (ptOrEta == "Eta") | |
22833 | { | |
22834 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 22835 | } |
489d5531 | 22836 | } |
22837 | psi1=aftsTrack->Phi(); | |
22838 | for(Int_t i2=0;i2<nPrim;i2++) | |
22839 | { | |
22840 | if(i2==i1) continue; | |
22841 | aftsTrack=anEvent->GetTrack(i2); | |
22842 | // RP condition (!(first) particle in the correlator must be RP): | |
22843 | if(!(aftsTrack->InRPSelection())) continue; | |
22844 | phi2=aftsTrack->Phi(); | |
22845 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
22846 | // 2'-particle correlations: | |
22847 | fDiffFlowDirectCorrelations[t][pe][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(1.*n*(psi1-phi2)),wPhi2); // <w2 cos(n*(psi1-phi2)) | |
22848 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
22849 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
22850 | ||
22851 | // 4'-particle correlations: | |
22852 | for(Int_t i1=0;i1<nPrim;i1++) | |
22853 | { | |
22854 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 22855 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
22856 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 22857 | { |
22858 | if(ptOrEta == "Pt") | |
22859 | { | |
22860 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
22861 | } else if (ptOrEta == "Eta") | |
22862 | { | |
22863 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 22864 | } |
22865 | } else // this is diff flow of RPs | |
22866 | { | |
489d5531 | 22867 | if(ptOrEta == "Pt") |
22868 | { | |
22869 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
22870 | } else if (ptOrEta == "Eta") | |
22871 | { | |
22872 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 22873 | } |
489d5531 | 22874 | } |
22875 | psi1=aftsTrack->Phi(); | |
22876 | for(Int_t i2=0;i2<nPrim;i2++) | |
22877 | { | |
22878 | if(i2==i1) continue; | |
22879 | aftsTrack=anEvent->GetTrack(i2); | |
22880 | // RP condition (!(first) particle in the correlator must be RP): | |
22881 | if(!(aftsTrack->InRPSelection())) continue; | |
22882 | phi2=aftsTrack->Phi(); | |
22883 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
22884 | for(Int_t i3=0;i3<nPrim;i3++) | |
22885 | { | |
22886 | if(i3==i1||i3==i2) continue; | |
22887 | aftsTrack=anEvent->GetTrack(i3); | |
22888 | // RP condition (!(first) particle in the correlator must be RP): | |
22889 | if(!(aftsTrack->InRPSelection())) continue; | |
22890 | phi3=aftsTrack->Phi(); | |
22891 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
22892 | for(Int_t i4=0;i4<nPrim;i4++) | |
22893 | { | |
22894 | if(i4==i1||i4==i2||i4==i3) continue; | |
22895 | aftsTrack=anEvent->GetTrack(i4); | |
22896 | // RP condition (!(first) particle in the correlator must be RP): | |
22897 | if(!(aftsTrack->InRPSelection())) continue; | |
22898 | phi4=aftsTrack->Phi(); | |
22899 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); | |
22900 | // 4'-particle correlations <w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))>: | |
22901 | fDiffFlowDirectCorrelations[t][pe][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3-phi4)),wPhi2*wPhi3*wPhi4); | |
22902 | }//end of for(Int_t i4=0;i4<nPrim;i4++) | |
22903 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
22904 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
22905 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
22906 | ||
22907 | // count # of RPs and POIs in selected pt and eta bins for cross-checkings: (to be improved - moved to dedicated method) | |
3b552efe | 22908 | for(Int_t i=0;i<nPrim;i++) |
22909 | { | |
489d5531 | 22910 | aftsTrack=anEvent->GetTrack(i); |
22911 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
22912 | if(typeFlag==1) // this is diff flow of POIs | |
22913 | { | |
22914 | if(ptOrEta == "Pt") | |
22915 | { | |
22916 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
22917 | } else if (ptOrEta == "Eta") | |
22918 | { | |
22919 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
22920 | } | |
22921 | } else // this is diff flow of RPs | |
22922 | { | |
22923 | if(ptOrEta == "Pt") | |
22924 | { | |
22925 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
22926 | } else if (ptOrEta == "Eta") | |
22927 | { | |
22928 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
22929 | } | |
22930 | } | |
22931 | if(t==1)t++; | |
22932 | fNoOfParticlesInBin->Fill(t+pe+0.5); | |
22933 | } | |
22934 | ||
22935 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
22936 | ||
e1d101a6 | 22937 | //======================================================================================================================= |
489d5531 | 22938 | |
0328db2d | 22939 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 22940 | { |
22941 | // Evaluate with nested loops correction terms for non-uniform acceptance (both sin and cos terms) relevant for differential flow. | |
22942 | ||
22943 | // Remark 1: Reduced correction terms for non-uniform acceptance are evaluated in pt bin number fCrossCheckInPtBinNo | |
22944 | // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
22945 | // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrections[t][pe][sc][cti], where first three indices runs as: | |
22946 | // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms], whilst the cti (correction term index) runs as follows: | |
22947 | // cti: | |
22948 | // 0: <<sc n(psi1)>> | |
22949 | // 1: <<sc n(psi1+phi2)>> | |
22950 | // 2: <<sc n(psi1+phi2-phi3)>> | |
22951 | // 3: <<sc n(psi1-phi2-phi3)>> | |
22952 | // 4: | |
22953 | // 5: | |
22954 | // 6: | |
22955 | ||
2a98ceb8 | 22956 | Int_t typeFlag = 0; |
22957 | Int_t ptEtaFlag = 0; | |
489d5531 | 22958 | if(type == "RP") |
22959 | { | |
22960 | typeFlag = 0; | |
22961 | } else if(type == "POI") | |
22962 | { | |
22963 | typeFlag = 1; | |
22964 | } | |
22965 | if(ptOrEta == "Pt") | |
22966 | { | |
22967 | ptEtaFlag = 0; | |
22968 | } else if(ptOrEta == "Eta") | |
22969 | { | |
22970 | ptEtaFlag = 1; | |
22971 | } | |
22972 | // shortcuts: | |
22973 | Int_t t = typeFlag; | |
22974 | Int_t pe = ptEtaFlag; | |
22975 | ||
22976 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
22977 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
22978 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
22979 | ||
22980 | Int_t nPrim = anEvent->NumberOfTracks(); | |
22981 | AliFlowTrackSimple *aftsTrack = NULL; | |
22982 | ||
22983 | Double_t psi1=0., phi2=0., phi3=0.;// phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
22984 | ||
22985 | Int_t n = fHarmonic; | |
22986 | ||
22987 | // 1-particle correction terms: | |
22988 | for(Int_t i1=0;i1<nPrim;i1++) | |
22989 | { | |
22990 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 22991 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
22992 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 22993 | { |
22994 | if(ptOrEta == "Pt") | |
22995 | { | |
22996 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
22997 | } else if (ptOrEta == "Eta") | |
22998 | { | |
22999 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 23000 | } |
23001 | } else // this is diff flow of RPs | |
23002 | { | |
489d5531 | 23003 | if(ptOrEta == "Pt") |
23004 | { | |
23005 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
23006 | } else if (ptOrEta == "Eta") | |
23007 | { | |
23008 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 23009 | } |
23010 | } | |
489d5531 | 23011 | psi1=aftsTrack->Phi(); |
23012 | // sin terms: | |
23013 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*psi1),1.); // <<sin(n*(psi1))>> | |
23014 | // cos terms: | |
23015 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*psi1),1.); // <<cos(n*(psi1))>> | |
23016 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
23017 | ||
23018 | // 2-particle correction terms: | |
23019 | for(Int_t i1=0;i1<nPrim;i1++) | |
23020 | { | |
23021 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 23022 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
23023 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 23024 | { |
23025 | if(ptOrEta == "Pt") | |
23026 | { | |
23027 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
23028 | } else if (ptOrEta == "Eta") | |
23029 | { | |
23030 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 23031 | } |
23032 | } else // this is diff flow of RPs | |
23033 | { | |
489d5531 | 23034 | if(ptOrEta == "Pt") |
23035 | { | |
23036 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
23037 | } else if (ptOrEta == "Eta") | |
23038 | { | |
23039 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 23040 | } |
489d5531 | 23041 | } |
23042 | psi1=aftsTrack->Phi(); | |
23043 | for(Int_t i2=0;i2<nPrim;i2++) | |
23044 | { | |
23045 | if(i2==i1) continue; | |
23046 | aftsTrack=anEvent->GetTrack(i2); | |
23047 | // RP condition (!(first) particle in the correlator must be RP): | |
23048 | if(!(aftsTrack->InRPSelection())) continue; | |
23049 | phi2=aftsTrack->Phi(); | |
23050 | // sin terms: | |
23051 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2)),1.); // <<sin(n*(psi1+phi2))>> | |
23052 | // cos terms: | |
23053 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2)),1.); // <<cos(n*(psi1+phi2))>> | |
23054 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
23055 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
23056 | ||
23057 | // 3-particle correction terms: | |
23058 | for(Int_t i1=0;i1<nPrim;i1++) | |
23059 | { | |
23060 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 23061 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
23062 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 23063 | { |
23064 | if(ptOrEta == "Pt") | |
23065 | { | |
23066 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
23067 | } else if (ptOrEta == "Eta") | |
23068 | { | |
23069 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 23070 | } |
23071 | } else // this is diff flow of RPs | |
23072 | { | |
489d5531 | 23073 | if(ptOrEta == "Pt") |
23074 | { | |
23075 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
23076 | } else if (ptOrEta == "Eta") | |
23077 | { | |
23078 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 23079 | } |
489d5531 | 23080 | } |
23081 | psi1=aftsTrack->Phi(); | |
23082 | for(Int_t i2=0;i2<nPrim;i2++) | |
23083 | { | |
23084 | if(i2==i1) continue; | |
23085 | aftsTrack=anEvent->GetTrack(i2); | |
23086 | // RP condition (!(first) particle in the correlator must be RP): | |
23087 | if(!(aftsTrack->InRPSelection())) continue; | |
23088 | phi2=aftsTrack->Phi(); | |
23089 | for(Int_t i3=0;i3<nPrim;i3++) | |
23090 | { | |
23091 | if(i3==i1||i3==i2) continue; | |
23092 | aftsTrack=anEvent->GetTrack(i3); | |
23093 | // RP condition (!(first) particle in the correlator must be RP): | |
23094 | if(!(aftsTrack->InRPSelection())) continue; | |
23095 | phi3=aftsTrack->Phi(); | |
23096 | // sin terms: | |
23097 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2-phi3)),1.); // <<sin(n*(psi1+phi2-phi3))>> | |
23098 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1-phi2-phi3)),1.); // <<sin(n*(psi1-phi2-phi3))>> | |
23099 | // cos terms: | |
23100 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3)),1.); // <<cos(n*(psi1+phi2-phi3))>> | |
23101 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-phi2-phi3)),1.); // <<cos(n*(psi1-phi2-phi3))>> | |
23102 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
23103 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
23104 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
23105 | ||
23106 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
23107 | ||
23108 | ||
e1d101a6 | 23109 | //======================================================================================================================= |
489d5531 | 23110 | |
23111 | ||
23112 | void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrectionTermsForNUA(TString type, TString ptOrEta) | |
23113 | { | |
23114 | // Compare corrections temrs for non-uniform acceptance needed for diff. flow calculated with nested loops and those calculated from Q-vectors | |
23115 | ||
2a98ceb8 | 23116 | Int_t typeFlag = 0; |
23117 | Int_t ptEtaFlag = 0; | |
489d5531 | 23118 | if(type == "RP") |
23119 | { | |
23120 | typeFlag = 0; | |
23121 | } else if(type == "POI") | |
23122 | { | |
23123 | typeFlag = 1; | |
23124 | } | |
23125 | if(ptOrEta == "Pt") | |
23126 | { | |
23127 | ptEtaFlag = 0; | |
23128 | } else if(ptOrEta == "Eta") | |
23129 | { | |
23130 | ptEtaFlag = 1; | |
23131 | } | |
23132 | // shortcuts: | |
23133 | Int_t t = typeFlag; | |
23134 | Int_t pe = ptEtaFlag; | |
23135 | ||
23136 | TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
23137 | TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
23138 | //TString sinCosFlag[2] = {"sin","cos"}; // to be improved (eventually promote to data member) | |
23139 | TString reducedCorrectionSinTerms[4] = {"<<sin(n(psi1))>>","<<sin(n(psi1+phi2))>>","<<sin(n*(psi1+phi2-phi3))>>","<<sin(n*(psi1-phi2-phi3))>>"}; // to be improved (access this from pro or hist) | |
23140 | TString reducedCorrectionCosTerms[4] = {"<<cos(n(psi1))>>","<<cos(n(psi1+phi2))>>","<<cos(n*(psi1+phi2-phi3))>>","<<cos(n*(psi1-phi2-phi3))>>"}; // to be improved (access this from pro or hist) | |
23141 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
23142 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
23143 | ||
23144 | Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo}; | |
23145 | ||
23146 | cout<<endl; | |
23147 | cout<<" ******************************************"<<endl; | |
23148 | cout<<" **** cross-checking the correction ****"<<endl; | |
46b94261 | 23149 | cout<<" **** terms for non-uniform acceptance ****"<<endl; |
489d5531 | 23150 | cout<<" **** for differential flow ("<<rpORpoiString[t]<<") ****"<<endl; |
403e3389 | 23151 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 23152 | { |
23153 | cout<<" **** (particle weights not used) ****"<<endl; | |
23154 | } else | |
23155 | { | |
23156 | cout<<" **** (particle weights used) ****"<<endl; | |
23157 | } | |
23158 | cout<<" ******************************************"<<endl; | |
23159 | cout<<endl; | |
23160 | cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl; | |
23161 | cout<<endl; | |
23162 | ||
23163 | for(Int_t cti=0;cti<4;cti++) // correction term index | |
23164 | { | |
23165 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
23166 | { | |
23167 | if(sc==0) // to be improved (this can be implemented better) | |
23168 | { | |
23169 | cout<<" "<<reducedCorrectionSinTerms[cti].Data()<<":"<<endl; | |
23170 | } else | |
23171 | { | |
23172 | cout<<" "<<reducedCorrectionCosTerms[cti].Data()<<":"<<endl; | |
23173 | } | |
23174 | cout<<" from Q-vectors = "<<fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl; | |
23175 | cout<<" from nested loops = "<<fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]->GetBinContent(1)<<endl; | |
23176 | cout<<endl; | |
23177 | } | |
23178 | } // end of for(Int_t rci=0;rci<4;rci++) | |
23179 | ||
23180 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrectionTermsForNUA(TString type, TString ptOrEta) | |
23181 | ||
e1d101a6 | 23182 | //======================================================================================================================= |
57340a27 | 23183 | |
489d5531 | 23184 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights() |
23185 | { | |
23186 | // Calculate corrections using particle weights for non-uniform acceptance of the detector for no-name integrated flow (cos terms). | |
23187 | ||
23188 | // ********************************************************************** | |
23189 | // **** weighted corrections for non-uniform acceptance (cos terms): **** | |
23190 | // ********************************************************************** | |
57340a27 | 23191 | |
489d5531 | 23192 | // Remark 1: When particle weights are used the binning of fIntFlowCorrectionTermsForNUAPro[1] is organized as follows: |
57340a27 | 23193 | // |
489d5531 | 23194 | // 1st bin: <<w1 cos(n*(phi1))>> = cosP1nW1 |
23195 | // 2nd bin: <<w1 w2 cos(n*(phi1+phi2))>> = cosP1nP1nW1W1 | |
23196 | // 3rd bin: <<w1 w2 w3 cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1nW1W1W1 | |
23197 | // ... | |
23198 | ||
23199 | // multiplicity (number of particles used to determine the reaction plane) | |
1268c371 | 23200 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 23201 | |
23202 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
23203 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
23204 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
23205 | //Double_t dReQ3n3k = (*fReQ)(2,3); | |
23206 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
23207 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
23208 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
23209 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
23210 | //Double_t dImQ3n3k = (*fImQ)(2,3); | |
23211 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
23212 | //Double_t dImQ1n3k = (*fImQ)(0,3); | |
23213 | ||
23214 | // dMs are variables introduced in order to simplify some Eqs. bellow: | |
23215 | //.............................................................................................. | |
1268c371 | 23216 | Double_t dM11 = (*fSpk)(1,1)-(*fSpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
23217 | Double_t dM111 = (*fSpk)(2,1)-3.*(*fSpk)(0,2)*(*fSpk)(0,1) | |
23218 | + 2.*(*fSpk)(0,3); // dM111 = sum_{i,j,k=1,i!=j!=k}^M w_i w_j w_k | |
489d5531 | 23219 | //.............................................................................................. |
ecac11c2 | 23220 | // 1-particle: |
489d5531 | 23221 | Double_t cosP1nW1 = 0.; // <<w1 cos(n*(phi1))>> |
23222 | ||
1268c371 | 23223 | if(dMult>0 && TMath::Abs((*fSpk)(0,1))>1.e-6) |
489d5531 | 23224 | { |
1268c371 | 23225 | cosP1nW1 = dReQ1n1k/(*fSpk)(0,1); |
489d5531 | 23226 | |
23227 | // average weighted 1-particle correction (cos terms) for non-uniform acceptance for single event: | |
23228 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(1,cosP1nW1); | |
23229 | ||
23230 | // final average weighted 1-particle correction (cos terms) for non-uniform acceptance for all events: | |
1268c371 | 23231 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(0.5,cosP1nW1,(*fSpk)(0,1)); |
489d5531 | 23232 | } |
23233 | ||
23234 | // 2-particle: | |
23235 | Double_t cosP1nP1nW1W1 = 0.; // <<w1 w2 cos(n*(phi1+phi2))>> | |
23236 | ||
1268c371 | 23237 | if(dMult>1 && TMath::Abs(dM11)>1.e-6) |
489d5531 | 23238 | { |
23239 | cosP1nP1nW1W1 = (pow(dReQ1n1k,2)-pow(dImQ1n1k,2)-dReQ2n2k)/dM11; | |
23240 | ||
23241 | // average weighted 2-particle correction (cos terms) for non-uniform acceptance for single event: | |
23242 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(2,cosP1nP1nW1W1); | |
23243 | ||
23244 | // final average weighted 2-particle correction (cos terms) for non-uniform acceptance for all events: | |
23245 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(1.5,cosP1nP1nW1W1,dM11); | |
23246 | } | |
23247 | ||
23248 | // 3-particle: | |
23249 | Double_t cosP1nM1nM1nW1W1W1 = 0.; // <<w1 w2 w3 cos(n*(phi1-phi2-phi3))>> | |
23250 | ||
1268c371 | 23251 | if(dMult>2 && TMath::Abs(dM111)>1.e-6) |
489d5531 | 23252 | { |
57340a27 | 23253 | cosP1nM1nM1nW1W1W1 = (dReQ1n1k*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
23254 | - dReQ1n1k*dReQ2n2k-dImQ1n1k*dImQ2n2k | |
1268c371 | 23255 | - 2.*((*fSpk)(0,2))*dReQ1n1k |
489d5531 | 23256 | + 2.*dReQ1n3k) |
23257 | / dM111; | |
23258 | ||
23259 | // average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for single event: | |
23260 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(3,cosP1nM1nM1nW1W1W1); | |
23261 | ||
23262 | // final average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for all events: | |
23263 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(2.5,cosP1nM1nM1nW1W1W1,dM111); | |
23264 | } | |
23265 | ||
23266 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights() | |
23267 | ||
23268 | ||
e1d101a6 | 23269 | //======================================================================================================================= |
489d5531 | 23270 | |
23271 | ||
23272 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights() | |
23273 | { | |
23274 | // calculate corrections using particle weights for non-uniform acceptance of the detector for no-name integrated flow (sin terms) | |
23275 | ||
23276 | // ********************************************************************** | |
23277 | // **** weighted corrections for non-uniform acceptance (sin terms): **** | |
23278 | // ********************************************************************** | |
23279 | ||
23280 | // Remark 1: When particle weights are used the binning of fIntFlowCorrectionTermsForNUAPro[0] is organized as follows: | |
57340a27 | 23281 | // |
489d5531 | 23282 | // 1st bin: <<w1 sin(n*(phi1))>> = sinP1nW1 |
23283 | // 2nd bin: <<w1 w2 sin(n*(phi1+phi2))>> = sinP1nP1nW1W1 | |
23284 | // 3rd bin: <<w1 w2 w3 sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1nW1W1W1 | |
23285 | // ... | |
23286 | ||
23287 | // multiplicity (number of particles used to determine the reaction plane) | |
1268c371 | 23288 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 23289 | |
23290 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
23291 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
23292 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
23293 | //Double_t dReQ3n3k = (*fReQ)(2,3); | |
23294 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
23295 | //Double_t dReQ1n3k = (*fReQ)(0,3); | |
23296 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
23297 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
23298 | //Double_t dImQ3n3k = (*fImQ)(2,3); | |
23299 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
23300 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
23301 | ||
23302 | // dMs are variables introduced in order to simplify some Eqs. bellow: | |
23303 | //.............................................................................................. | |
1268c371 | 23304 | Double_t dM11 = (*fSpk)(1,1)-(*fSpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
23305 | Double_t dM111 = (*fSpk)(2,1)-3.*(*fSpk)(0,2)*(*fSpk)(0,1) | |
23306 | + 2.*(*fSpk)(0,3); // dM111 = sum_{i,j,k=1,i!=j!=k}^M w_i w_j w_k | |
489d5531 | 23307 | //.............................................................................................. |
23308 | ||
23309 | // 1-particle: | |
23310 | Double_t sinP1nW1 = 0.; // <<w1 sin(n*(phi1))>> | |
23311 | ||
1268c371 | 23312 | if(dMult>0 && TMath::Abs((*fSpk)(0,1))>1.e-6) |
489d5531 | 23313 | { |
1268c371 | 23314 | sinP1nW1 = dImQ1n1k/((*fSpk)(0,1)); |
489d5531 | 23315 | |
23316 | // average weighted 1-particle correction (sin terms) for non-uniform acceptance for single event: | |
23317 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(1,sinP1nW1); | |
23318 | ||
23319 | // final average weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
1268c371 | 23320 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(0.5,sinP1nW1,(*fSpk)(0,1)); |
489d5531 | 23321 | } |
23322 | ||
23323 | // 2-particle: | |
23324 | Double_t sinP1nP1nW1W1 = 0.; // <<w1 w2 sin(n*(phi1+phi2))>> | |
23325 | ||
1268c371 | 23326 | if(dMult>1 && TMath::Abs(dM11)>1.e-6) |
489d5531 | 23327 | { |
23328 | sinP1nP1nW1W1 = (2.*dReQ1n1k*dImQ1n1k-dImQ2n2k)/dM11; | |
23329 | ||
23330 | // average weighted 2-particle correction (sin terms) for non-uniform acceptance for single event: | |
23331 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(2,sinP1nP1nW1W1); | |
23332 | ||
23333 | // final average weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
23334 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(1.5,sinP1nP1nW1W1,dM11); | |
23335 | } | |
23336 | ||
23337 | // 3-particle: | |
23338 | Double_t sinP1nM1nM1nW1W1W1 = 0.; // <<w1 w2 w3 sin(n*(phi1-phi2-phi3))>> | |
23339 | ||
1268c371 | 23340 | if(dMult>2 && TMath::Abs(dM111)>1.e-6) |
489d5531 | 23341 | { |
57340a27 | 23342 | sinP1nM1nM1nW1W1W1 = (-dImQ1n1k*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
23343 | + dReQ1n1k*dImQ2n2k-dImQ1n1k*dReQ2n2k | |
1268c371 | 23344 | + 2.*((*fSpk)(0,2))*dImQ1n1k |
489d5531 | 23345 | - 2.*dImQ1n3k) |
23346 | / dM111; | |
23347 | ||
23348 | // average weighted 3-particle correction (sin terms) for non-uniform acceptance for single event: | |
23349 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(3,sinP1nM1nM1nW1W1W1); | |
23350 | ||
23351 | // final average weighted 3-particle correction (sin terms) for non-uniform acceptance for all events: | |
23352 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(2.5,sinP1nM1nM1nW1W1W1,dM111); | |
23353 | } | |
23354 | ||
23355 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights() | |
23356 | ||
e1d101a6 | 23357 | //======================================================================================================================= |
489d5531 | 23358 | |
0328db2d | 23359 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent) |
489d5531 | 23360 | { |
23361 | // Evaluate with nested loops correction terms for non-uniform acceptance for integrated flow (using the particle weights). | |
23362 | ||
57340a27 | 23363 | // Results are stored in profiles fIntFlowDirectCorrectionTermsForNUA[0] (sin terms) and |
23364 | // fIntFlowDirectCorrectionTermsForNUA[1] (cos terms). | |
489d5531 | 23365 | |
57340a27 | 23366 | // Remark 1: When particle weights are used the binning of fIntFlowDirectCorrectionTermsForNUA[sc] is |
489d5531 | 23367 | // organized as follows (sc stands for either sin or cos): |
23368 | // | |
23369 | // 1st bin: <<w1 sc(n*(phi1))>> = scP1nW1 | |
23370 | // 2nd bin: <<w1 w2 sc(n*(phi1+phi2))>> = scP1nP1nW1W1 | |
23371 | // 3rd bin: <<w1 w2 w3 sc(n*(phi1-phi2-phi3))>> = scP1nM1nM1nW1W1W1 | |
3b552efe | 23372 | // ... |
489d5531 | 23373 | |
23374 | Int_t nPrim = anEvent->NumberOfTracks(); | |
23375 | AliFlowTrackSimple *aftsTrack = NULL; | |
23376 | //Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; | |
23377 | //Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
23378 | Double_t phi1=0., phi2=0., phi3=0.; | |
23379 | Double_t wPhi1=1., wPhi2=1., wPhi3=1.; | |
23380 | Int_t n = fHarmonic; | |
23381 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 23382 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 23383 | cout<<endl; |
23384 | cout<<"Correction terms for non-uniform acceptance: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
23385 | if(dMult<1) | |
23386 | { | |
23387 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
23388 | } else if (dMult>fMaxAllowedMultiplicity) | |
23389 | { | |
23390 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
23391 | } else | |
23392 | { | |
23393 | cout<<"... evaluating nested loops (using particle weights) ..."<<endl; | |
23394 | } | |
23395 | ||
23396 | // 1-particle correction terms using particle weights: | |
23397 | if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity) | |
23398 | { | |
23399 | for(Int_t i1=0;i1<nPrim;i1++) | |
23400 | { | |
23401 | aftsTrack=anEvent->GetTrack(i1); | |
23402 | if(!(aftsTrack->InRPSelection())) continue; | |
23403 | phi1=aftsTrack->Phi(); | |
23404 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
57340a27 | 23405 | // 1-particle correction terms using particle weights: |
489d5531 | 23406 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(0.5,sin(n*phi1),wPhi1); // <w1 sin(n*phi1)> |
23407 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(0.5,cos(n*phi1),wPhi1); // <w1 cos(n*phi1)> | |
57340a27 | 23408 | } // end of for(Int_t i1=0;i1<nPrim;i1++) |
23409 | } // end of if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity) | |
23410 | ||
489d5531 | 23411 | // 2-particle correction terms using particle weights: |
23412 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
23413 | { | |
23414 | for(Int_t i1=0;i1<nPrim;i1++) | |
23415 | { | |
23416 | aftsTrack=anEvent->GetTrack(i1); | |
23417 | if(!(aftsTrack->InRPSelection())) continue; | |
23418 | phi1=aftsTrack->Phi(); | |
23419 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
23420 | for(Int_t i2=0;i2<nPrim;i2++) | |
23421 | { | |
23422 | if(i2==i1)continue; | |
23423 | aftsTrack=anEvent->GetTrack(i2); | |
23424 | if(!(aftsTrack->InRPSelection())) continue; | |
23425 | phi2=aftsTrack->Phi(); | |
23426 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
23427 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
57340a27 | 23428 | // 2-p correction terms using particle weights: |
489d5531 | 23429 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(1.5,sin(n*(phi1+phi2)),wPhi1*wPhi2); // <w1 w2 sin(n*(phi1+phi2))> |
23430 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(1.5,cos(n*(phi1+phi2)),wPhi1*wPhi2); // <w1 w2 cos(n*(phi1+phi2))> | |
23431 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
23432 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
23433 | } // end of if(nPrim>=2) | |
23434 | ||
23435 | // 3-particle correction terms using particle weights: | |
23436 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
23437 | { | |
23438 | for(Int_t i1=0;i1<nPrim;i1++) | |
23439 | { | |
23440 | aftsTrack=anEvent->GetTrack(i1); | |
23441 | if(!(aftsTrack->InRPSelection())) continue; | |
23442 | phi1=aftsTrack->Phi(); | |
23443 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
23444 | for(Int_t i2=0;i2<nPrim;i2++) | |
23445 | { | |
23446 | if(i2==i1)continue; | |
23447 | aftsTrack=anEvent->GetTrack(i2); | |
23448 | if(!(aftsTrack->InRPSelection())) continue; | |
23449 | phi2=aftsTrack->Phi(); | |
23450 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
23451 | for(Int_t i3=0;i3<nPrim;i3++) | |
23452 | { | |
23453 | if(i3==i1||i3==i2)continue; | |
23454 | aftsTrack=anEvent->GetTrack(i3); | |
23455 | if(!(aftsTrack->InRPSelection())) continue; | |
23456 | phi3=aftsTrack->Phi(); | |
23457 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
23458 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
57340a27 | 23459 | // 3-p correction terms using particle weights: |
489d5531 | 23460 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(2.5,sin(n*(phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 sin(n*(phi1-phi2-phi3))> |
23461 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(2.5,cos(n*(phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 cos(n*(phi1-phi2-phi3))> | |
23462 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
23463 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
23464 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
23465 | } // end of if(nPrim>=3) | |
23466 | ||
57340a27 | 23467 | /* |
23468 | ||
489d5531 | 23469 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) |
23470 | { | |
23471 | // 4 nested loops multiparticle correlations using particle weights: | |
23472 | for(Int_t i1=0;i1<nPrim;i1++) | |
23473 | { | |
23474 | aftsTrack=anEvent->GetTrack(i1); | |
23475 | if(!(aftsTrack->InRPSelection())) continue; | |
23476 | phi1=aftsTrack->Phi(); | |
23477 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
23478 | for(Int_t i2=0;i2<nPrim;i2++) | |
23479 | { | |
23480 | if(i2==i1)continue; | |
23481 | aftsTrack=anEvent->GetTrack(i2); | |
23482 | if(!(aftsTrack->InRPSelection())) continue; | |
23483 | phi2=aftsTrack->Phi(); | |
23484 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
23485 | for(Int_t i3=0;i3<nPrim;i3++) | |
23486 | { | |
23487 | if(i3==i1||i3==i2)continue; | |
23488 | aftsTrack=anEvent->GetTrack(i3); | |
23489 | if(!(aftsTrack->InRPSelection())) continue; | |
23490 | phi3=aftsTrack->Phi(); | |
23491 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
23492 | for(Int_t i4=0;i4<nPrim;i4++) | |
23493 | { | |
23494 | if(i4==i1||i4==i2||i4==i3)continue; | |
23495 | aftsTrack=anEvent->GetTrack(i4); | |
23496 | if(!(aftsTrack->InRPSelection())) continue; | |
23497 | phi4=aftsTrack->Phi(); | |
23498 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); | |
23499 | if(nPrim>=4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; // to be improved (replace eventually this if statement with if(nPrim==4)) | |
23500 | // 4-p correlations using particle weights: | |
23501 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(10.5,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); | |
23502 | // extra correlations: | |
23503 | // 2-p extra correlations (do not appear if particle weights are not used): | |
23504 | // ... | |
23505 | // 3-p extra correlations (do not appear if particle weights are not used): | |
23506 | // ... | |
23507 | // 4-p extra correlations (do not appear if particle weights are not used): | |
23508 | // ... | |
23509 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
23510 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
23511 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
23512 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
23513 | } // end of if(nPrim>=4) | |
23514 | ||
23515 | */ | |
23516 | ||
23517 | cout<<endl; | |
23518 | ||
23519 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent) | |
23520 | ||
e1d101a6 | 23521 | //======================================================================================================================= |
489d5531 | 23522 | |
489d5531 | 23523 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights(TString type, TString ptOrEta) |
23524 | { | |
23525 | // Calculate correction terms for non-uniform acceptance for differential flow (cos terms) using particle weights. | |
57340a27 | 23526 | |
489d5531 | 23527 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][1][cti], where cti runs as follows: |
57340a27 | 23528 | // |
489d5531 | 23529 | // 0: <<cos n(psi)>> |
23530 | // 1: <<w2 cos n(psi1+phi2)>> | |
23531 | // 2: <<w2 w3 cos n(psi1+phi2-phi3)>> | |
23532 | // 3: <<w2 w3 cos n(psi1-phi2-phi3)>> | |
23533 | // 4: | |
23534 | // 5: | |
23535 | // 6: | |
23536 | ||
23537 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
23538 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
23539 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
23540 | //Double_t dReQ1n3k = (*fReQ)(0,3); | |
23541 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
23542 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
23543 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
23544 | //Double_t dImQ1n3k = (*fImQ)(0,3); | |
23545 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
23546 | ||
1268c371 | 23547 | // S^M_{p,k} (see .h file for the definition of fSpk): |
23548 | Double_t dSM1p1k = (*fSpk)(0,1); | |
23549 | Double_t dSM1p2k = (*fSpk)(0,2); | |
23550 | Double_t dSM2p1k = (*fSpk)(1,1); | |
489d5531 | 23551 | |
2a98ceb8 | 23552 | Int_t t = 0; // type flag |
23553 | Int_t pe = 0; // ptEta flag | |
489d5531 | 23554 | |
23555 | if(type == "RP") | |
23556 | { | |
23557 | t = 0; | |
23558 | } else if(type == "POI") | |
23559 | { | |
23560 | t = 1; | |
23561 | } | |
23562 | ||
23563 | if(ptOrEta == "Pt") | |
23564 | { | |
23565 | pe = 0; | |
23566 | } else if(ptOrEta == "Eta") | |
23567 | { | |
23568 | pe = 1; | |
23569 | } | |
23570 | ||
23571 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
23572 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
23573 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
23574 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
23575 | ||
23576 | // looping over all bins and calculating correction terms: | |
23577 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
23578 | { | |
23579 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
23580 | Double_t p1n0kRe = 0.; | |
23581 | Double_t p1n0kIm = 0.; | |
23582 | ||
23583 | // number of POIs in particular pt or eta bin: | |
23584 | Double_t mp = 0.; | |
23585 | ||
23586 | // real and imaginary parts of q_{m*n,0} (weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
23587 | Double_t q1n2kRe = 0.; | |
ea239361 | 23588 | //Double_t q1n2kIm = 0.; |
489d5531 | 23589 | Double_t q2n1kRe = 0.; |
23590 | Double_t q2n1kIm = 0.; | |
46b94261 | 23591 | |
489d5531 | 23592 | // s_{1,1}, s_{1,2} // to be improved (add explanation) |
23593 | Double_t s1p1k = 0.; | |
23594 | Double_t s1p2k = 0.; | |
46b94261 | 23595 | |
489d5531 | 23596 | // number of particles which are both RPs and POIs in particular pt or eta bin: |
ea239361 | 23597 | //Double_t mq = 0.; |
489d5531 | 23598 | |
23599 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
23600 | Double_t dM01 = 0.; | |
23601 | Double_t dM011 = 0.; | |
23602 | ||
23603 | if(type == "POI") | |
23604 | { | |
23605 | // q_{m*n,k}: | |
23606 | q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
23607 | * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
ea239361 | 23608 | //q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)) |
23609 | // * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
489d5531 | 23610 | q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)) |
23611 | * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
23612 | q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
23613 | * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
ea239361 | 23614 | //mq = fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) |
46b94261 | 23615 | |
489d5531 | 23616 | s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); |
23617 | s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); | |
23618 | }else if(type == "RP") | |
23619 | { | |
23620 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
23621 | q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
23622 | * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
ea239361 | 23623 | //q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)) |
23624 | // * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
489d5531 | 23625 | q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)) |
23626 | * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
23627 | q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
23628 | * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
23629 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
23630 | s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); | |
23631 | s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); | |
3b552efe | 23632 | //s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); |
23633 | ||
ea239361 | 23634 | //mq = fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) |
489d5531 | 23635 | } |
3b552efe | 23636 | |
489d5531 | 23637 | if(type == "POI") |
3b552efe | 23638 | { |
23639 | // p_{m*n,k}: | |
489d5531 | 23640 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) |
23641 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
23642 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
3b552efe | 23643 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); |
23644 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
489d5531 | 23645 | // M01 from Eq. (118) in QC2c (to be improved (notation)): |
3b552efe | 23646 | dM01 = mp*dSM1p1k-s1p1k; |
23647 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
23648 | - 2.*(s1p1k*dSM1p1k-s1p2k); | |
23649 | ||
23650 | // typeFlag = RP (0) or POI (1): | |
23651 | t = 1; | |
23652 | } else if(type == "RP") | |
489d5531 | 23653 | { |
23654 | // to be improved (cross-checked): | |
23655 | p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
23656 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
23657 | p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
23658 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
23659 | mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
23660 | // M01 from Eq. (118) in QC2c (to be improved (notation)): | |
3b552efe | 23661 | dM01 = mp*dSM1p1k-s1p1k; |
23662 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
23663 | - 2.*(s1p1k*dSM1p1k-s1p2k); | |
489d5531 | 23664 | // typeFlag = RP (0) or POI (1): |
3b552efe | 23665 | t = 0; |
23666 | } | |
489d5531 | 23667 | |
23668 | // <<cos n(psi1)>>: | |
23669 | Double_t cosP1nPsi = 0.; | |
23670 | if(mp) | |
23671 | { | |
23672 | cosP1nPsi = p1n0kRe/mp; | |
23673 | ||
23674 | // fill profile for <<cos n(psi1)>>: | |
23675 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi,mp); | |
23676 | // histogram to store <cos n(psi1)> e-b-e (needed in some other methods): | |
23677 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][0]->SetBinContent(b,cosP1nPsi); | |
46b94261 | 23678 | } // end of if(mp) |
57340a27 | 23679 | |
489d5531 | 23680 | // <<w2 cos n(psi1+phi2)>>: |
23681 | Double_t cosP1nPsiP1nPhiW2 = 0.; | |
23682 | if(dM01) | |
23683 | { | |
23684 | cosP1nPsiP1nPhiW2 = (p1n0kRe*dReQ1n1k-p1n0kIm*dImQ1n1k-q2n1kRe)/(dM01); | |
23685 | // fill profile for <<w2 cos n(psi1+phi2)>>: | |
23686 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsiP1nPhiW2,dM01); | |
23687 | // histogram to store <w2 cos n(psi1+phi2)> e-b-e (needed in some other methods): | |
23688 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][1]->SetBinContent(b,cosP1nPsiP1nPhiW2); | |
23689 | } // end of if(dM01) | |
23690 | ||
23691 | // <<w2 w3 cos n(psi1+phi2-phi3)>>: | |
23692 | Double_t cosP1nPsi1P1nPhi2MPhi3W2W3 = 0.; | |
23693 | if(dM011) | |
23694 | { | |
46b94261 | 23695 | cosP1nPsi1P1nPhi2MPhi3W2W3 = (p1n0kRe*(pow(dImQ1n1k,2.)+pow(dReQ1n1k,2.)) |
23696 | - p1n0kRe*dSM1p2k | |
23697 | - q2n1kRe*dReQ1n1k-q2n1kIm*dImQ1n1k | |
23698 | - s1p1k*dReQ1n1k | |
23699 | + 2.*q1n2kRe) | |
23700 | / dM011; | |
489d5531 | 23701 | // fill profile for <<w1 w2 w3 cos n(psi1+phi2)>>: |
23702 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1P1nPhi2MPhi3W2W3,dM011); | |
23703 | // histogram to store <w1 w2 w3 cos n(psi1+phi2)> e-b-e (needed in some other methods): | |
23704 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][2]->SetBinContent(b,cosP1nPsi1P1nPhi2MPhi3W2W3); | |
23705 | } // end of if(dM011) | |
23706 | ||
23707 | // <<w2 w3 cos n(psi1-phi2-phi3)>>: | |
23708 | Double_t cosP1nPsi1M1nPhi2MPhi3W2W3 = 0.; | |
23709 | if(dM011) | |
23710 | { | |
23711 | cosP1nPsi1M1nPhi2MPhi3W2W3 = (p1n0kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))+2.*p1n0kIm*dReQ1n1k*dImQ1n1k | |
23712 | - 1.*(p1n0kRe*dReQ2n2k+p1n0kIm*dImQ2n2k) | |
46b94261 | 23713 | - 2.*s1p1k*dReQ1n1k |
489d5531 | 23714 | + 2.*q1n2kRe) |
23715 | / dM011; | |
23716 | // fill profile for <<w1 w2 w3 cos n(psi1+phi2)>>: | |
23717 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1M1nPhi2MPhi3W2W3,dM011); | |
23718 | // histogram to store <w1 w2 w3 cos n(psi1+phi2)> e-b-e (needed in some other methods): | |
23719 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][3]->SetBinContent(b,cosP1nPsi1M1nPhi2MPhi3W2W3); | |
23720 | } // end of if(dM011) | |
23721 | ||
23722 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
46b94261 | 23723 | |
57340a27 | 23724 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights(TString type, TString ptOrEta) |
23725 | ||
489d5531 | 23726 | |
e1d101a6 | 23727 | //======================================================================================================================= |
489d5531 | 23728 | |
23729 | ||
23730 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights(TString type, TString ptOrEta) | |
23731 | { | |
23732 | // Calculate correction terms for non-uniform acceptance for differential flow (sin terms). | |
23733 | ||
23734 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][0][cti], where cti runs as follows: | |
23735 | // 0: <<sin n(psi1)>> | |
23736 | // 1: <<w2 sin n(psi1+phi2)>> | |
23737 | // 2: <<w2 w3 sin n(psi1+phi2-phi3)>> | |
23738 | // 3: <<w2 w3 sin n(psi1-phi2-phi3)>>: | |
23739 | // 4: | |
23740 | // 5: | |
23741 | // 6: | |
23742 | ||
23743 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
23744 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
23745 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
23746 | //Double_t dReQ1n3k = (*fReQ)(0,3); | |
23747 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
23748 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
23749 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
23750 | //Double_t dImQ1n3k = (*fImQ)(0,3); | |
23751 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
23752 | ||
1268c371 | 23753 | // S^M_{p,k} (see .h file for the definition of fSpk): |
23754 | Double_t dSM1p1k = (*fSpk)(0,1); | |
23755 | Double_t dSM1p2k = (*fSpk)(0,2); | |
23756 | Double_t dSM2p1k = (*fSpk)(1,1); | |
489d5531 | 23757 | |
2a98ceb8 | 23758 | Int_t t = 0; // type flag |
23759 | Int_t pe = 0; // ptEta flag | |
489d5531 | 23760 | |
23761 | if(type == "RP") | |
23762 | { | |
23763 | t = 0; | |
23764 | } else if(type == "POI") | |
23765 | { | |
23766 | t = 1; | |
23767 | } | |
23768 | ||
23769 | if(ptOrEta == "Pt") | |
23770 | { | |
23771 | pe = 0; | |
23772 | } else if(ptOrEta == "Eta") | |
23773 | { | |
23774 | pe = 1; | |
23775 | } | |
23776 | ||
23777 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
23778 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
23779 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
23780 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
23781 | ||
23782 | // looping over all bins and calculating correction terms: | |
23783 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
23784 | { | |
23785 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
23786 | Double_t p1n0kRe = 0.; | |
23787 | Double_t p1n0kIm = 0.; | |
23788 | ||
23789 | // number of POIs in particular pt or eta bin: | |
23790 | Double_t mp = 0.; | |
23791 | ||
23792 | // real and imaginary parts of q_{m*n,0} (weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
ea239361 | 23793 | //Double_t q1n2kRe = 0.; |
489d5531 | 23794 | Double_t q1n2kIm = 0.; |
23795 | Double_t q2n1kRe = 0.; | |
23796 | Double_t q2n1kIm = 0.; | |
46b94261 | 23797 | |
489d5531 | 23798 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) |
23799 | Double_t s1p1k = 0.; | |
23800 | Double_t s1p2k = 0.; | |
46b94261 | 23801 | |
489d5531 | 23802 | // number of particles which are both RPs and POIs in particular pt or eta bin: |
ea239361 | 23803 | //Double_t mq = 0.; |
489d5531 | 23804 | |
23805 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
23806 | Double_t dM01 = 0.; | |
23807 | Double_t dM011 = 0.; | |
23808 | ||
23809 | if(type == "POI") | |
23810 | { | |
23811 | // q_{m*n,k}: | |
ea239361 | 23812 | //q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)) |
23813 | // * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
489d5531 | 23814 | q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)) |
23815 | * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
23816 | q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
23817 | * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
23818 | q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
23819 | * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
ea239361 | 23820 | //mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) |
46b94261 | 23821 | |
489d5531 | 23822 | s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); |
23823 | s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); | |
23824 | }else if(type == "RP") | |
23825 | { | |
23826 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
ea239361 | 23827 | //q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)) |
23828 | // * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
489d5531 | 23829 | q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)) |
23830 | * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
23831 | q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
23832 | * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
23833 | q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
23834 | * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
23835 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
23836 | s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); | |
23837 | s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); | |
23838 | //s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); | |
3b552efe | 23839 | } |
23840 | ||
23841 | if(type == "POI") | |
23842 | { | |
23843 | // p_{m*n,k}: | |
489d5531 | 23844 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) |
23845 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
23846 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
3b552efe | 23847 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); |
23848 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
489d5531 | 23849 | // M01 from Eq. (118) in QC2c (to be improved (notation)): |
3b552efe | 23850 | dM01 = mp*dSM1p1k-s1p1k; |
23851 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
23852 | - 2.*(s1p1k*dSM1p1k-s1p2k); | |
23853 | // typeFlag = RP (0) or POI (1): | |
23854 | t = 1; | |
489d5531 | 23855 | } else if(type == "RP") |
3b552efe | 23856 | { |
489d5531 | 23857 | // to be improved (cross-checked): |
23858 | p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
23859 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
23860 | p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
23861 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
23862 | mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
23863 | // M01 from Eq. (118) in QC2c (to be improved (notation)): | |
3b552efe | 23864 | dM01 = mp*dSM1p1k-s1p1k; |
23865 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
489d5531 | 23866 | - 2.*(s1p1k*dSM1p1k-s1p2k); |
23867 | // typeFlag = RP (0) or POI (1): | |
3b552efe | 23868 | t = 0; |
23869 | } | |
23870 | ||
489d5531 | 23871 | // <<sin n(psi1)>>: |
23872 | Double_t sinP1nPsi = 0.; | |
23873 | if(mp) | |
23874 | { | |
23875 | sinP1nPsi = p1n0kIm/mp; | |
23876 | ||
23877 | // fill profile for <<sin n(psi1)>>: | |
23878 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi,mp); | |
23879 | // histogram to store <sin n(psi1)> e-b-e (needed in some other methods): | |
23880 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][0]->SetBinContent(b,sinP1nPsi); | |
46b94261 | 23881 | } // end of if(mp) |
23882 | ||
489d5531 | 23883 | // <<w2 sin n(psi1+phi2)>>: |
23884 | Double_t sinP1nPsiP1nPhiW2 = 0.; | |
23885 | if(dM01) | |
23886 | { | |
23887 | sinP1nPsiP1nPhiW2 = (p1n0kRe*dImQ1n1k+p1n0kIm*dReQ1n1k-q2n1kIm)/(dM01); | |
23888 | // fill profile for <<w2 sin n(psi1+phi2)>>: | |
23889 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsiP1nPhiW2,dM01); | |
23890 | // histogram to store <w2 sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
23891 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][1]->SetBinContent(b,sinP1nPsiP1nPhiW2); | |
23892 | } // end of if(mp*dMult-mq) | |
23893 | ||
23894 | // <<w2 w3 sin n(psi1+phi2-phi3)>>: | |
23895 | Double_t sinP1nPsi1P1nPhi2MPhi3W2W3 = 0.; | |
23896 | if(dM011) | |
23897 | { | |
46b94261 | 23898 | sinP1nPsi1P1nPhi2MPhi3W2W3 = (p1n0kIm*(pow(dImQ1n1k,2.)+pow(dReQ1n1k,2.)) |
23899 | - p1n0kIm*dSM1p2k | |
23900 | + q2n1kRe*dImQ1n1k-q2n1kIm*dReQ1n1k | |
23901 | - s1p1k*dImQ1n1k | |
23902 | + 2.*q1n2kIm) | |
23903 | / dM011; | |
489d5531 | 23904 | // fill profile for <<w2 w3 sin n(psi1+phi2-phi3)>>: |
23905 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1P1nPhi2MPhi3W2W3,dM011); | |
23906 | // histogram to store <w2 w3 sin n(psi1+phi2-phi3)> e-b-e (needed in some other methods): | |
23907 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][2]->SetBinContent(b,sinP1nPsi1P1nPhi2MPhi3W2W3); | |
23908 | } // end of if(dM011) | |
23909 | ||
23910 | // <<w2 w3 sin n(psi1-phi2-phi3)>>: | |
23911 | Double_t sinP1nPsi1M1nPhi2MPhi3W2W3 = 0.; | |
23912 | if(dM011) | |
23913 | { | |
23914 | sinP1nPsi1M1nPhi2MPhi3W2W3 = (p1n0kIm*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))-2.*p1n0kRe*dReQ1n1k*dImQ1n1k | |
23915 | + 1.*(p1n0kRe*dImQ2n2k-p1n0kIm*dReQ2n2k) | |
46b94261 | 23916 | + 2.*s1p1k*dImQ1n1k |
489d5531 | 23917 | - 2.*q1n2kIm) |
23918 | / dM011; | |
23919 | // fill profile for <<w2 w3 sin n(psi1-phi2-phi3)>>: | |
23920 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1M1nPhi2MPhi3W2W3,dM011); | |
23921 | // histogram to store <w2 w3 sin n(psi1-phi2-phi3)> e-b-e (needed in some other methods): | |
23922 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][3]->SetBinContent(b,sinP1nPsi1M1nPhi2MPhi3W2W3); | |
23923 | } // end of if(dM011) | |
23924 | ||
23925 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
23926 | ||
23927 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights(TString type, TString ptOrEta) | |
23928 | ||
e1d101a6 | 23929 | //======================================================================================================================= |
489d5531 | 23930 | |
0328db2d | 23931 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 23932 | { |
57340a27 | 23933 | // Evaluate with nested loops correction terms for non-uniform acceptance |
489d5531 | 23934 | // with using particle weights (both sin and cos terms) relevant for differential flow. |
23935 | ||
57340a27 | 23936 | // Remark 1: "w1" in expressions bellow is a particle weight used only for particles which were |
23937 | // flagged both as POI and RP. | |
489d5531 | 23938 | // Remark 2: Reduced correction terms for non-uniform acceptance are evaluated in pt bin number fCrossCheckInPtBinNo |
23939 | // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
23940 | // Remark 3: Results are stored in 1 bin profiles fDiffFlowDirectCorrections[t][pe][sc][cti], where first three indices runs as: | |
23941 | // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms], whilst the cti (correction term index) runs as follows: | |
23942 | // cti: | |
23943 | // 0: <<sc n(psi1)>> | |
23944 | // 1: <<w2 sc n(psi1+phi2)>> | |
23945 | // 2: <<w2 w3 sc n(psi1+phi2-phi3)>> | |
23946 | // 3: <<w2 w3 sc n(psi1-phi2-phi3)>> | |
23947 | // 4: | |
23948 | // 5: | |
23949 | // 6: | |
46b94261 | 23950 | |
2a98ceb8 | 23951 | Int_t typeFlag = 0; |
23952 | Int_t ptEtaFlag = 0; | |
489d5531 | 23953 | if(type == "RP") |
23954 | { | |
23955 | typeFlag = 0; | |
23956 | } else if(type == "POI") | |
23957 | { | |
23958 | typeFlag = 1; | |
23959 | } | |
23960 | if(ptOrEta == "Pt") | |
23961 | { | |
23962 | ptEtaFlag = 0; | |
23963 | } else if(ptOrEta == "Eta") | |
23964 | { | |
23965 | ptEtaFlag = 1; | |
23966 | } | |
23967 | // shortcuts: | |
23968 | Int_t t = typeFlag; | |
23969 | Int_t pe = ptEtaFlag; | |
23970 | ||
23971 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
23972 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
23973 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
23974 | ||
23975 | Int_t nPrim = anEvent->NumberOfTracks(); | |
23976 | AliFlowTrackSimple *aftsTrack = NULL; | |
23977 | ||
23978 | Double_t psi1=0., phi2=0., phi3=0.;// phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
23979 | Double_t wPhi2=1., wPhi3=1.; | |
23980 | ||
23981 | Int_t n = fHarmonic; | |
23982 | ||
23983 | // 1'-particle correction terms: | |
23984 | for(Int_t i1=0;i1<nPrim;i1++) | |
23985 | { | |
23986 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 23987 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
23988 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 23989 | { |
23990 | if(ptOrEta == "Pt") | |
23991 | { | |
23992 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
23993 | } else if (ptOrEta == "Eta") | |
23994 | { | |
23995 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 23996 | } |
23997 | } else // this is diff flow of RPs | |
23998 | { | |
489d5531 | 23999 | if(ptOrEta == "Pt") |
24000 | { | |
24001 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
24002 | } else if (ptOrEta == "Eta") | |
24003 | { | |
24004 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 24005 | } |
489d5531 | 24006 | } |
24007 | psi1=aftsTrack->Phi(); | |
24008 | // sin terms: | |
24009 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*psi1),1.); // <<sin(n*(psi1))>> | |
24010 | // cos terms: | |
24011 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*psi1),1.); // <<cos(n*(psi1))>> | |
24012 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
24013 | ||
24014 | // 2'-particle correction terms: | |
24015 | for(Int_t i1=0;i1<nPrim;i1++) | |
24016 | { | |
24017 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 24018 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
24019 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 24020 | { |
24021 | if(ptOrEta == "Pt") | |
24022 | { | |
24023 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
24024 | } else if (ptOrEta == "Eta") | |
24025 | { | |
24026 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 24027 | } |
24028 | } else // this is diff flow of RPs | |
24029 | { | |
489d5531 | 24030 | if(ptOrEta == "Pt") |
24031 | { | |
24032 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
24033 | } else if (ptOrEta == "Eta") | |
24034 | { | |
24035 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 24036 | } |
489d5531 | 24037 | } |
24038 | psi1=aftsTrack->Phi(); | |
24039 | for(Int_t i2=0;i2<nPrim;i2++) | |
24040 | { | |
24041 | if(i2==i1) continue; | |
24042 | aftsTrack=anEvent->GetTrack(i2); | |
24043 | // RP condition (!(first) particle in the correlator must be RP): | |
24044 | if(!(aftsTrack->InRPSelection())) continue; | |
46b94261 | 24045 | phi2=aftsTrack->Phi(); |
489d5531 | 24046 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); |
24047 | // sin terms: | |
24048 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2)),wPhi2); // <<w2 sin(n*(psi1+phi2))>> | |
24049 | // cos terms: | |
24050 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2)),wPhi2); // <<w2 cos(n*(psi1+phi2))>> | |
24051 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
24052 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
24053 | ||
24054 | // 3'-particle correction terms: | |
24055 | for(Int_t i1=0;i1<nPrim;i1++) | |
24056 | { | |
24057 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 24058 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
24059 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 24060 | { |
24061 | if(ptOrEta == "Pt") | |
24062 | { | |
24063 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
24064 | } else if (ptOrEta == "Eta") | |
24065 | { | |
24066 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 24067 | } |
24068 | } else // this is diff flow of RPs | |
24069 | { | |
489d5531 | 24070 | if(ptOrEta == "Pt") |
24071 | { | |
24072 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
24073 | } else if (ptOrEta == "Eta") | |
24074 | { | |
24075 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 24076 | } |
489d5531 | 24077 | } |
24078 | psi1=aftsTrack->Phi(); | |
24079 | for(Int_t i2=0;i2<nPrim;i2++) | |
24080 | { | |
24081 | if(i2==i1) continue; | |
24082 | aftsTrack=anEvent->GetTrack(i2); | |
24083 | // RP condition (!(first) particle in the correlator must be RP): | |
24084 | if(!(aftsTrack->InRPSelection())) continue; | |
24085 | phi2=aftsTrack->Phi(); | |
24086 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
24087 | for(Int_t i3=0;i3<nPrim;i3++) | |
24088 | { | |
24089 | if(i3==i1||i3==i2) continue; | |
24090 | aftsTrack=anEvent->GetTrack(i3); | |
24091 | // RP condition (!(first) particle in the correlator must be RP): | |
24092 | if(!(aftsTrack->InRPSelection())) continue; | |
24093 | phi3=aftsTrack->Phi(); | |
24094 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
24095 | // sin terms: | |
24096 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 sin(n*(psi1+phi2-phi3))>> | |
24097 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1-phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 sin(n*(psi1-phi2-phi3))>> | |
24098 | // cos terms: | |
24099 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 cos(n*(psi1+phi2-phi3))>> | |
24100 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 cos(n*(psi1-phi2-phi3))>> | |
24101 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
24102 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
46b94261 | 24103 | }//end of for(Int_t i1=0;i1<nPrim;i1++) |
489d5531 | 24104 | |
24105 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
24106 | ||
e1d101a6 | 24107 | //======================================================================================================================= |
2001bc3a | 24108 | |
b3dacf6b | 24109 | void AliFlowAnalysisWithQCumulants::CheckPointersUsedInFinish() |
24110 | { | |
24111 | // Check all pointers used in method Finish(). | |
24112 | ||
b77b6434 | 24113 | if(!fAvMultiplicity) |
24114 | { | |
24115 | cout<<endl; | |
24116 | cout<<" WARNING (QC): fAvMultiplicity is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24117 | cout<<endl; | |
24118 | exit(0); | |
24119 | } | |
b3dacf6b | 24120 | if(!fIntFlowCorrelationsPro) |
24121 | { | |
24122 | cout<<endl; | |
24123 | cout<<" WARNING (QC): fIntFlowCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24124 | cout<<endl; | |
24125 | exit(0); | |
24126 | } | |
b40a910e | 24127 | if(!fIntFlowSquaredCorrelationsPro) |
24128 | { | |
24129 | cout<<endl; | |
24130 | cout<<" WARNING (QC): fIntFlowSquaredCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24131 | cout<<endl; | |
24132 | exit(0); | |
24133 | } | |
b3dacf6b | 24134 | if(!fIntFlowCorrelationsHist) |
24135 | { | |
24136 | cout<<endl; | |
24137 | cout<<" WARNING (QC): fIntFlowCorrelationsHist is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24138 | cout<<endl; | |
24139 | exit(0); | |
24140 | } | |
403e3389 | 24141 | if((fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) && !fIntFlowExtraCorrelationsPro) |
b77b6434 | 24142 | { |
24143 | cout<<endl; | |
24144 | cout<<" WARNING (QC): fIntFlowExtraCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24145 | cout<<endl; | |
24146 | exit(0); | |
24147 | } | |
b3dacf6b | 24148 | for(Int_t power=0;power<2;power++) |
24149 | { | |
24150 | if(!fIntFlowSumOfEventWeights[power]) | |
24151 | { | |
24152 | cout<<endl; | |
24153 | cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeights[%d] is NULL in CheckPointersUsedInFinish() !!!!",power)<<endl; | |
24154 | cout<<endl; | |
24155 | exit(0); | |
24156 | } | |
24157 | } // end of for(Int_t power=0;power<2;power++) | |
24158 | if(!fIntFlowProductOfCorrelationsPro) | |
24159 | { | |
24160 | cout<<endl; | |
24161 | cout<<" WARNING (QC): fIntFlowProductOfCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24162 | cout<<endl; | |
24163 | exit(0); | |
24164 | } | |
24165 | if(!fIntFlowSumOfProductOfEventWeights) | |
24166 | { | |
24167 | cout<<endl; | |
24168 | cout<<" WARNING (QC): fIntFlowSumOfProductOfEventWeights is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24169 | cout<<endl; | |
24170 | exit(0); | |
24171 | } | |
24172 | if(!fIntFlowCovariances) | |
24173 | { | |
24174 | cout<<endl; | |
24175 | cout<<" WARNING (QC): fIntFlowCovariances is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24176 | cout<<endl; | |
24177 | exit(0); | |
24178 | } | |
24179 | if(!fIntFlowQcumulants) | |
24180 | { | |
24181 | cout<<endl; | |
24182 | cout<<" WARNING (QC): fIntFlowQcumulants is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24183 | cout<<endl; | |
24184 | exit(0); | |
24185 | } | |
0dd3b008 | 24186 | if(!fIntFlow) |
24187 | { | |
24188 | cout<<endl; | |
24189 | cout<<" WARNING (QC): fIntFlow is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24190 | cout<<endl; | |
24191 | exit(0); | |
24192 | } | |
24193 | if(!fCommonHists) | |
24194 | { | |
24195 | cout<<endl; | |
24196 | cout<<" WARNING (QC): fCommonHists is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24197 | cout<<endl; | |
24198 | exit(0); | |
24199 | } | |
24200 | if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th)) | |
24201 | { | |
24202 | cout<<endl; | |
24203 | cout<<" WARNING (QC): fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th"<<endl; | |
24204 | cout<<" && fCommonHistsResults8th is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24205 | cout<<endl; | |
24206 | exit(0); | |
24207 | } | |
e1d101a6 | 24208 | |
b92ea2b9 | 24209 | // NUA stuff: |
24210 | for(Int_t sc=0;sc<2;sc++) // sin/cos | |
24211 | { | |
24212 | if(!fIntFlowCorrectionTermsForNUAPro[sc]) | |
24213 | { | |
24214 | cout<<endl; | |
24215 | cout<<Form(" WARNING (QC): fIntFlowCorrectionTermsForNUAPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",sc)<<endl; | |
24216 | cout<<endl; | |
24217 | exit(0); | |
24218 | } | |
24219 | if(!fIntFlowCorrectionTermsForNUAHist[sc]) | |
24220 | { | |
24221 | cout<<endl; | |
24222 | cout<<Form(" WARNING (QC): fIntFlowCorrectionTermsForNUAHist[%d] is NULL in CheckPointersUsedInFinish() !!!!",sc)<<endl; | |
24223 | cout<<endl; | |
24224 | exit(0); | |
24225 | } | |
24226 | for(Int_t lq=0;lq<2;lq++) // linear/quadratic | |
24227 | { | |
24228 | if(!fIntFlowSumOfEventWeightsNUA[sc][lq]) | |
24229 | { | |
24230 | cout<<endl; | |
24231 | cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeightsNUA[%d][%d] is NULL in CheckPointersUsedInFinish() !!!!",sc,lq)<<endl; | |
24232 | cout<<endl; | |
24233 | exit(0); | |
24234 | } | |
24235 | } // end of for(Int_t lq=0;lq<2;lq++) // linear/quadratic | |
24236 | } // end of for(Int_t power=0;power<2;power++) | |
24237 | if(!fIntFlowProductOfCorrectionTermsForNUAPro) | |
24238 | { | |
24239 | cout<<endl; | |
24240 | cout<<" WARNING (QC): fIntFlowProductOfCorrectionTermsForNUAPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24241 | cout<<endl; | |
24242 | exit(0); | |
24243 | } | |
24244 | if(!fIntFlowSumOfProductOfEventWeightsNUA) | |
24245 | { | |
24246 | cout<<endl; | |
24247 | cout<<" WARNING (QC): fIntFlowSumOfProductOfEventWeightsNUA is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24248 | cout<<endl; | |
24249 | exit(0); | |
24250 | } | |
24251 | if(!fIntFlowCovariancesNUA) | |
24252 | { | |
24253 | cout<<endl; | |
24254 | cout<<" WARNING (QC): fIntFlowCovariancesNUA is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24255 | cout<<endl; | |
24256 | exit(0); | |
24257 | } | |
24258 | if(!fIntFlowQcumulantsErrorSquaredRatio) | |
24259 | { | |
24260 | cout<<endl; | |
24261 | cout<<" WARNING (QC): fIntFlowQcumulantsErrorSquaredRatio is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24262 | cout<<endl; | |
24263 | exit(0); | |
24264 | } | |
24265 | if(!fIntFlowDetectorBias) | |
24266 | { | |
24267 | cout<<endl; | |
24268 | cout<<" WARNING (QC): fIntFlowDetectorBias is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24269 | cout<<endl; | |
24270 | exit(0); | |
24271 | } | |
24272 | ||
e1d101a6 | 24273 | if(fCalculateMixedHarmonics) |
24274 | { | |
24275 | if(!(fMixedHarmonicsFlags)) | |
24276 | { | |
24277 | cout<<endl; | |
24278 | cout<<" WARNING (QC): fMixedHarmonicsFlags is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24279 | cout<<endl; | |
24280 | exit(0); | |
24281 | } | |
24282 | if(!(f2pCorrelations && f3pCorrelations && f4pCorrelations && f5pCorrelations)) | |
24283 | { | |
24284 | cout<<endl; | |
24285 | cout<<" WARNING (QC): f2pCorrelations && f3pCorrelations && f4pCorrelations && f5pCorrelations is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24286 | cout<<endl; | |
24287 | exit(0); | |
24288 | } | |
24289 | if(!(f2pCumulants && f3pCumulants && f4pCumulants && f5pCumulants)) | |
24290 | { | |
24291 | cout<<endl; | |
24292 | cout<<" WARNING (QC): f2pCumulants && f3pCumulants && f4pCumulants && f5pCumulants is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24293 | cout<<endl; | |
24294 | exit(0); | |
24295 | } | |
c10259fb | 24296 | for(Int_t power=0;power<2;power++) |
24297 | { | |
24298 | if(!fMixedHarmonicEventWeights[power]) | |
24299 | { | |
24300 | cout<<endl; | |
24301 | cout<<Form(" WARNING (QC): fMixedHarmonicEventWeights[%d] is NULL in CheckPointersUsedInFinish() !!!!",power)<<endl; | |
24302 | cout<<endl; | |
24303 | exit(0); | |
24304 | } | |
24305 | } // end of for(Int_t power=0;power<2;power++) | |
24306 | if(!(fMixedHarmonicProductOfEventWeights)) | |
24307 | { | |
24308 | cout<<endl; | |
24309 | cout<<" WARNING (QC): fMixedHarmonicProductOfEventWeights is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24310 | cout<<endl; | |
24311 | exit(0); | |
24312 | } | |
24313 | if(!(fMixedHarmonicProductOfCorrelations)) | |
24314 | { | |
24315 | cout<<endl; | |
24316 | cout<<" WARNING (QC): fMixedHarmonicProductOfCorrelations is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24317 | cout<<endl; | |
24318 | exit(0); | |
24319 | } | |
e1d101a6 | 24320 | } // end of if(fCalculateMixedHarmonics) |
24321 | ||
b3dacf6b | 24322 | // Versus multiplicity: |
24323 | if(!fCalculateCumulantsVsM){return;} | |
b77b6434 | 24324 | for(Int_t co=0;co<=3;co++) // cumulant order |
b3dacf6b | 24325 | { |
b77b6434 | 24326 | if(!fIntFlowQcumulantsVsM[co]) |
b3dacf6b | 24327 | { |
24328 | cout<<endl; | |
b77b6434 | 24329 | cout<<Form(" WARNING (QC): fIntFlowQcumulantsVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",co)<<endl; |
b3dacf6b | 24330 | cout<<endl; |
24331 | exit(0); | |
24332 | } | |
b77b6434 | 24333 | if(!fIntFlowVsM[co]) |
b3dacf6b | 24334 | { |
24335 | cout<<endl; | |
b77b6434 | 24336 | cout<<Form(" WARNING (QC): fIntFlowVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",co)<<endl; |
24337 | cout<<endl; | |
24338 | exit(0); | |
24339 | } | |
24340 | if(!fIntFlowDetectorBiasVsM[co]) | |
24341 | { | |
24342 | cout<<endl; | |
24343 | cout<<Form(" WARNING (QC): fIntFlowDetectorBiasVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",co)<<endl; | |
24344 | cout<<endl; | |
24345 | exit(0); | |
24346 | } | |
24347 | } // end of for(Int_t c0=0;c0<=3;c0++) // cumulant order | |
24348 | for(Int_t ci=0;ci<=3;ci++) // correlation index | |
24349 | { | |
24350 | if(!fIntFlowCorrelationsVsMPro[ci]) | |
24351 | { | |
24352 | cout<<endl; | |
24353 | cout<<Form(" WARNING (QC): fIntFlowCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl; | |
b3dacf6b | 24354 | cout<<endl; |
24355 | exit(0); | |
24356 | } | |
b40a910e | 24357 | if(!fIntFlowSquaredCorrelationsVsMPro[ci]) |
24358 | { | |
24359 | cout<<endl; | |
24360 | cout<<Form(" WARNING (QC): fIntFlowSquaredCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl; | |
24361 | cout<<endl; | |
24362 | exit(0); | |
24363 | } | |
b77b6434 | 24364 | if(!fIntFlowCorrelationsVsMHist[ci]) |
b92ea2b9 | 24365 | { |
24366 | cout<<endl; | |
b77b6434 | 24367 | cout<<Form(" WARNING (QC): fIntFlowCorrelationsVsMHist[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl; |
b92ea2b9 | 24368 | cout<<endl; |
24369 | exit(0); | |
24370 | } | |
b3dacf6b | 24371 | for(Int_t power=0;power<2;power++) |
24372 | { | |
24373 | if(!fIntFlowSumOfEventWeightsVsM[ci][power]) | |
24374 | { | |
24375 | cout<<endl; | |
24376 | cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeightsVsM[%d][%d] is NULL in CheckPointersUsedInFinish() !!!!",ci,power)<<endl; | |
24377 | cout<<endl; | |
24378 | exit(0); | |
24379 | } | |
24380 | } // end of for(Int_t power=0;power<2;power++) | |
24381 | } // end of for(Int_t ci=0;ci<=3;ci++) // correlation index | |
24382 | for(Int_t i=0;i<6;i++) | |
24383 | { | |
24384 | if(!fIntFlowProductOfCorrelationsVsMPro[i]) | |
24385 | { | |
24386 | cout<<endl; | |
24387 | cout<<Form(" WARNING (QC): fIntFlowProductOfCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl; | |
24388 | cout<<endl; | |
24389 | exit(0); | |
24390 | } | |
24391 | if(!fIntFlowSumOfProductOfEventWeightsVsM[i]) | |
24392 | { | |
24393 | cout<<endl; | |
24394 | cout<<Form(" WARNING (QC): fIntFlowSumOfProductOfEventWeightsVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl; | |
24395 | cout<<endl; | |
24396 | exit(0); | |
24397 | } | |
24398 | if(!fIntFlowCovariancesVsM[i]) | |
24399 | { | |
24400 | cout<<endl; | |
24401 | cout<<Form(" WARNING (QC): fIntFlowCovariancesVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl; | |
24402 | cout<<endl; | |
24403 | exit(0); | |
24404 | } | |
24405 | } // end of for(Int_t i=0;i<6;i++) | |
24406 | if(!fIntFlowRebinnedInM) | |
24407 | { | |
24408 | cout<<endl; | |
24409 | cout<<" WARNING (QC): fIntFlowRebinnedInM is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24410 | cout<<endl; | |
24411 | exit(0); | |
24412 | } | |
24413 | if(!fIntFlowQcumulantsRebinnedInM) | |
24414 | { | |
24415 | cout<<endl; | |
24416 | cout<<" WARNING (QC): fIntFlowQcumulantsRebinnedInM is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
24417 | cout<<endl; | |
24418 | exit(0); | |
24419 | } | |
24420 | ||
24421 | } // end of void AliFlowAnalysisWithQCumulants::CheckPointersUsedInFinish() | |
24422 | ||
e1d101a6 | 24423 | //======================================================================================================================= |
b3dacf6b | 24424 | |
24425 | void AliFlowAnalysisWithQCumulants::CheckPointersUsedInMake() | |
24426 | { | |
1268c371 | 24427 | // Check all pointers used in method Make(). // to be improved - check other pointers as well |
b3dacf6b | 24428 | |
b77b6434 | 24429 | if(!fAvMultiplicity) |
24430 | { | |
1268c371 | 24431 | printf("\n WARNING (QC): fAvMultiplicity is NULL in CheckPointersUsedInMake() !!!!\n\n"); |
b77b6434 | 24432 | exit(0); |
24433 | } | |
403e3389 | 24434 | if((fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) && !fIntFlowExtraCorrelationsPro) |
b77b6434 | 24435 | { |
1268c371 | 24436 | printf("\n WARNING (QC): fIntFlowExtraCorrelationsPro is NULL in CheckPointersUsedInMake() !!!!\n\n"); |
b77b6434 | 24437 | exit(0); |
24438 | } | |
1268c371 | 24439 | // 2D: |
24440 | if(fCalculate2DDiffFlow) | |
24441 | { | |
24442 | for(Int_t t=0;t<2;t++) // type = RP or POI | |
24443 | { | |
24444 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
24445 | { | |
24446 | if(!f2DDiffFlowCorrelationsPro[t][rci]) | |
24447 | { | |
24448 | printf("\n WARNING (QC): f2DDiffFlowCorrelationsPro[%i][%i] is NULL in CheckPointersUsedInMake() !!!!\n\n",t,rci); | |
24449 | exit(0); | |
24450 | } // end of if(!f2DDiffFlowCorrelationsPro[t][rci]) | |
24451 | } // end of for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
24452 | } // end of for(Int_t t=0;t<2;t++) | |
24453 | } // end of if(fCalculate2DDiffFlow) | |
b3dacf6b | 24454 | |
24455 | } // end of void AliFlowAnalysisWithQCumulants::CheckPointersUsedInMake() | |
24456 | ||
57340a27 | 24457 |