]>
Commit | Line | Data |
---|---|---|
489d5531 | 1 | /************************************************************************* |
2 | * Copyright(c) 1998-2008, ALICE Experiment at CERN, All rights reserved. * | |
3 | * * | |
4 | * Author: The ALICE Off-line Project. * | |
5 | * Contributors are mentioned in the code where appropriate. * | |
6 | * * | |
7 | * Permission to use, copy, modify and distribute this software and its * | |
8 | * documentation strictly for non-commercial purposes is hereby granted * | |
9 | * without fee, provided that the above copyright notice appears in all * | |
10 | * copies and that both the copyright notice and this permission notice * | |
11 | * appear in the supporting documentation. The authors make no claims * | |
12 | * about the suitability of this software for any purpose. It is * | |
13 | * provided "as is" without express or implied warranty. * | |
14 | **************************************************************************/ | |
15 | ||
16 | /********************************** | |
17 | * flow analysis with Q-cumulants * | |
18 | * * | |
ff70ca91 | 19 | * author: Ante Bilandzic * |
20 | * (abilandzic@gmail.com) * | |
489d5531 | 21 | *********************************/ |
22 | ||
23 | #define AliFlowAnalysisWithQCumulants_cxx | |
24 | ||
25 | #include "Riostream.h" | |
26 | #include "AliFlowCommonConstants.h" | |
27 | #include "AliFlowCommonHist.h" | |
28 | #include "AliFlowCommonHistResults.h" | |
29 | #include "TChain.h" | |
30 | ||
31 | #include "TFile.h" | |
32 | #include "TList.h" | |
33 | #include "TGraph.h" | |
34 | #include "TParticle.h" | |
35 | #include "TRandom3.h" | |
36 | #include "TStyle.h" | |
37 | #include "TProfile.h" | |
38 | #include "TProfile2D.h" | |
489d5531 | 39 | #include "TMath.h" |
40 | #include "TArrow.h" | |
41 | #include "TPaveLabel.h" | |
42 | #include "TCanvas.h" | |
43 | #include "AliFlowEventSimple.h" | |
44 | #include "AliFlowTrackSimple.h" | |
45 | #include "AliFlowAnalysisWithQCumulants.h" | |
46 | #include "TArrayD.h" | |
47 | #include "TRandom.h" | |
48 | #include "TF1.h" | |
49 | ||
50 | class TH1; | |
51 | class TH2; | |
52 | class TGraph; | |
53 | class TPave; | |
54 | class TLatex; | |
55 | class TMarker; | |
56 | class TRandom3; | |
57 | class TObjArray; | |
58 | class TList; | |
59 | class TCanvas; | |
60 | class TSystem; | |
61 | class TROOT; | |
62 | class AliFlowVector; | |
63 | class TVector; | |
64 | ||
489d5531 | 65 | //================================================================================================================ |
66 | ||
3a7af7bd | 67 | using std::endl; |
68 | using std::cout; | |
69 | using std::flush; | |
489d5531 | 70 | ClassImp(AliFlowAnalysisWithQCumulants) |
71 | ||
72 | AliFlowAnalysisWithQCumulants::AliFlowAnalysisWithQCumulants(): | |
73 | // 0.) base: | |
74 | fHistList(NULL), | |
75 | // 1.) common: | |
53884472 | 76 | fBookOnlyBasicCCH(kTRUE), |
489d5531 | 77 | fCommonHists(NULL), |
78 | fCommonHists2nd(NULL), | |
79 | fCommonHists4th(NULL), | |
80 | fCommonHists6th(NULL), | |
81 | fCommonHists8th(NULL), | |
82 | fCommonHistsResults2nd(NULL), | |
83 | fCommonHistsResults4th(NULL), | |
84 | fCommonHistsResults6th(NULL), | |
85 | fCommonHistsResults8th(NULL), | |
86 | fnBinsPhi(0), | |
87 | fPhiMin(0), | |
88 | fPhiMax(0), | |
89 | fPhiBinWidth(0), | |
90 | fnBinsPt(0), | |
91 | fPtMin(0), | |
92 | fPtMax(0), | |
93 | fPtBinWidth(0), | |
94 | fnBinsEta(0), | |
95 | fEtaMin(0), | |
96 | fEtaMax(0), | |
97 | fEtaBinWidth(0), | |
1268c371 | 98 | fCommonConstants(NULL), |
dd442cd2 | 99 | fFillMultipleControlHistograms(kFALSE), |
489d5531 | 100 | fHarmonic(2), |
101 | fAnalysisLabel(NULL), | |
102 | // 2a.) particle weights: | |
103 | fWeightsList(NULL), | |
104 | fUsePhiWeights(kFALSE), | |
105 | fUsePtWeights(kFALSE), | |
106 | fUseEtaWeights(kFALSE), | |
403e3389 | 107 | fUseTrackWeights(kFALSE), |
489d5531 | 108 | fUseParticleWeights(NULL), |
109 | fPhiWeights(NULL), | |
110 | fPtWeights(NULL), | |
111 | fEtaWeights(NULL), | |
112 | // 2b.) event weights: | |
113 | fMultiplicityWeight(NULL), | |
114 | // 3.) integrated flow: | |
115 | fIntFlowList(NULL), | |
116 | fIntFlowProfiles(NULL), | |
117 | fIntFlowResults(NULL), | |
3435cacb | 118 | fIntFlowAllCorrelationsVsM(NULL), |
489d5531 | 119 | fIntFlowFlags(NULL), |
b92ea2b9 | 120 | fApplyCorrectionForNUA(kFALSE), |
2001bc3a | 121 | fApplyCorrectionForNUAVsM(kFALSE), |
9da1a4f3 | 122 | fnBinsMult(10000), |
067e9bc8 | 123 | fMinMult(0.), |
124 | fMaxMult(10000.), | |
b77b6434 | 125 | fPropagateErrorAlsoFromNIT(kFALSE), |
8ed4edc7 | 126 | fCalculateCumulantsVsM(kFALSE), |
3435cacb | 127 | fCalculateAllCorrelationsVsM(kFALSE), |
0dd3b008 | 128 | fMinimumBiasReferenceFlow(kTRUE), |
e5834fcb | 129 | fForgetAboutCovariances(kFALSE), |
130 | fStorePhiDistributionForOneEvent(kFALSE), | |
489d5531 | 131 | fReQ(NULL), |
132 | fImQ(NULL), | |
1268c371 | 133 | fSpk(NULL), |
489d5531 | 134 | fIntFlowCorrelationsEBE(NULL), |
135 | fIntFlowEventWeightsForCorrelationsEBE(NULL), | |
136 | fIntFlowCorrelationsAllEBE(NULL), | |
e5834fcb | 137 | fReferenceMultiplicityEBE(0.), |
489d5531 | 138 | fAvMultiplicity(NULL), |
139 | fIntFlowCorrelationsPro(NULL), | |
b40a910e | 140 | fIntFlowSquaredCorrelationsPro(NULL), |
489d5531 | 141 | fIntFlowCorrelationsAllPro(NULL), |
142 | fIntFlowExtraCorrelationsPro(NULL), | |
143 | fIntFlowProductOfCorrelationsPro(NULL), | |
0328db2d | 144 | fIntFlowProductOfCorrectionTermsForNUAPro(NULL), |
489d5531 | 145 | fIntFlowCorrelationsHist(NULL), |
146 | fIntFlowCorrelationsAllHist(NULL), | |
147 | fIntFlowCovariances(NULL), | |
148 | fIntFlowSumOfProductOfEventWeights(NULL), | |
0328db2d | 149 | fIntFlowCovariancesNUA(NULL), |
150 | fIntFlowSumOfProductOfEventWeightsNUA(NULL), | |
489d5531 | 151 | fIntFlowQcumulants(NULL), |
b92ea2b9 | 152 | fIntFlowQcumulantsRebinnedInM(NULL), |
153 | fIntFlowQcumulantsErrorSquaredRatio(NULL), | |
489d5531 | 154 | fIntFlow(NULL), |
b3dacf6b | 155 | fIntFlowRebinnedInM(NULL), |
2001bc3a | 156 | fIntFlowDetectorBias(NULL), |
489d5531 | 157 | // 4.) differential flow: |
158 | fDiffFlowList(NULL), | |
159 | fDiffFlowProfiles(NULL), | |
160 | fDiffFlowResults(NULL), | |
1268c371 | 161 | fDiffFlow2D(NULL), |
489d5531 | 162 | fDiffFlowFlags(NULL), |
1268c371 | 163 | fCalculateDiffFlow(kTRUE), |
164 | fCalculate2DDiffFlow(kFALSE), | |
62e36168 | 165 | fCalculateDiffFlowVsEta(kTRUE), |
64e500e3 | 166 | // 5.) other differential correlators: |
167 | fOtherDiffCorrelatorsList(NULL), | |
168 | // 6.) distributions: | |
57340a27 | 169 | fDistributionsList(NULL), |
170 | fDistributionsFlags(NULL), | |
489d5531 | 171 | fStoreDistributions(kFALSE), |
64e500e3 | 172 | // 7.) various: |
e5834fcb | 173 | fVariousList(NULL), |
174 | fPhiDistributionForOneEvent(NULL), | |
489d5531 | 175 | // x.) debugging and cross-checking: |
176 | fNestedLoopsList(NULL), | |
177 | fEvaluateIntFlowNestedLoops(kFALSE), | |
178 | fEvaluateDiffFlowNestedLoops(kFALSE), | |
179 | fMaxAllowedMultiplicity(10), | |
180 | fEvaluateNestedLoops(NULL), | |
181 | fIntFlowDirectCorrelations(NULL), | |
182 | fIntFlowExtraDirectCorrelations(NULL), | |
183 | fCrossCheckInPtBinNo(10), | |
3b552efe | 184 | fCrossCheckInEtaBinNo(20), |
489d5531 | 185 | fNoOfParticlesInBin(NULL) |
186 | { | |
187 | // constructor | |
188 | ||
189 | // base list to hold all output objects: | |
190 | fHistList = new TList(); | |
191 | fHistList->SetName("cobjQC"); | |
192 | fHistList->SetOwner(kTRUE); | |
193 | ||
194 | // list to hold histograms with phi, pt and eta weights: | |
195 | fWeightsList = new TList(); | |
196 | ||
197 | // multiplicity weight: | |
198 | fMultiplicityWeight = new TString("combinations"); | |
199 | ||
200 | // analysis label; | |
201 | fAnalysisLabel = new TString(); | |
202 | ||
203 | // initialize all arrays: | |
204 | this->InitializeArraysForIntFlow(); | |
205 | this->InitializeArraysForDiffFlow(); | |
206 | this->InitializeArraysForDistributions(); | |
e5834fcb | 207 | this->InitializeArraysForVarious(); |
489d5531 | 208 | this->InitializeArraysForNestedLoops(); |
209 | ||
210 | } // end of constructor | |
211 | ||
489d5531 | 212 | //================================================================================================================ |
213 | ||
489d5531 | 214 | AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants() |
215 | { | |
216 | // destructor | |
217 | ||
218 | delete fHistList; | |
219 | ||
220 | } // end of AliFlowAnalysisWithQCumulants::~AliFlowAnalysisWithQCumulants() | |
221 | ||
489d5531 | 222 | //================================================================================================================ |
223 | ||
489d5531 | 224 | void AliFlowAnalysisWithQCumulants::Init() |
225 | { | |
3b552efe | 226 | // a) Cross check if the settings make sense before starting the QC adventure; |
489d5531 | 227 | // b) Access all common constants; |
228 | // c) Book all objects; | |
3b552efe | 229 | // d) Store flags for integrated and differential flow; |
489d5531 | 230 | // e) Store flags for distributions of corelations; |
231 | // f) Store harmonic which will be estimated. | |
3b552efe | 232 | |
489d5531 | 233 | //save old value and prevent histograms from being added to directory |
234 | //to avoid name clashes in case multiple analaysis objects are used | |
235 | //in an analysis | |
236 | Bool_t oldHistAddStatus = TH1::AddDirectoryStatus(); | |
237 | TH1::AddDirectory(kFALSE); | |
238 | ||
3b552efe | 239 | // a) Cross check if the settings make sense before starting the QC adventure; |
489d5531 | 240 | this->CrossCheckSettings(); |
1268c371 | 241 | // b) Access all common constants and book a profile to hold them: |
242 | this->CommonConstants("Init"); | |
489d5531 | 243 | // c) Book all objects: |
1268c371 | 244 | this->BookAndFillWeightsHistograms(); |
489d5531 | 245 | this->BookAndNestAllLists(); |
246 | this->BookCommonHistograms(); | |
247 | this->BookEverythingForIntegratedFlow(); | |
248 | this->BookEverythingForDifferentialFlow(); | |
1268c371 | 249 | this->BookEverythingFor2DDifferentialFlow(); |
489d5531 | 250 | this->BookEverythingForDistributions(); |
e5834fcb | 251 | this->BookEverythingForVarious(); |
489d5531 | 252 | this->BookEverythingForNestedLoops(); |
253 | // d) Store flags for integrated and differential flow: | |
254 | this->StoreIntFlowFlags(); | |
3b552efe | 255 | this->StoreDiffFlowFlags(); |
489d5531 | 256 | // e) Store flags for distributions of corelations: |
257 | this->StoreFlagsForDistributions(); | |
258 | // f) Store harmonic which will be estimated: | |
259 | this->StoreHarmonic(); | |
260 | ||
261 | TH1::AddDirectory(oldHistAddStatus); | |
262 | } // end of void AliFlowAnalysisWithQCumulants::Init() | |
263 | ||
489d5531 | 264 | //================================================================================================================ |
265 | ||
489d5531 | 266 | void AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent) |
267 | { | |
268 | // Running over data only in this method. | |
269 | ||
b3dacf6b | 270 | // a) Check all pointers used in this method; |
271 | // b) Define local variables; | |
272 | // c) Fill the common control histograms and call the method to fill fAvMultiplicity; | |
1268c371 | 273 | // d) Loop over data and calculate e-b-e quantities Q_{n,k}, S_{p,k} and s_{p,k}; |
274 | // e) Calculate the final expressions for S_{p,k} and s_{p,k} (important !!!!); | |
275 | // f) Call the methods which calculate correlations for reference flow; | |
276 | // g) Call the methods which calculate correlations for differential flow; | |
277 | // h) Call the methods which calculate correlations for 2D differential flow; | |
64e500e3 | 278 | // i) Call the methods which calculate other differential correlators; |
279 | // j) Distributions of correlations; | |
280 | // k) Store phi distribution for one event to illustrate flow; | |
281 | // l) Cross-check with nested loops correlators for reference flow; | |
282 | // m) Cross-check with nested loops correlators for differential flow; | |
283 | // n) Reset all event-by-event quantities (very important !!!!). | |
489d5531 | 284 | |
b3dacf6b | 285 | // a) Check all pointers used in this method: |
286 | this->CheckPointersUsedInMake(); | |
287 | ||
288 | // b) Define local variables: | |
489d5531 | 289 | Double_t dPhi = 0.; // azimuthal angle in the laboratory frame |
290 | Double_t dPt = 0.; // transverse momentum | |
291 | Double_t dEta = 0.; // pseudorapidity | |
489d5531 | 292 | Double_t wPhi = 1.; // phi weight |
293 | Double_t wPt = 1.; // pt weight | |
294 | Double_t wEta = 1.; // eta weight | |
38a1e8b3 | 295 | Double_t wTrack = 1.; // track weight |
1268c371 | 296 | Int_t nRP = anEvent->GetEventNSelTracksRP(); // number of RPs (i.e. number of reference particles) |
e5834fcb | 297 | fReferenceMultiplicityEBE = anEvent->GetReferenceMultiplicity(); // reference multiplicity for current event |
1268c371 | 298 | Double_t ptEta[2] = {0.,0.}; // 0 = dPt, 1 = dEta |
9f33751d | 299 | |
b3dacf6b | 300 | // c) Fill the common control histograms and call the method to fill fAvMultiplicity: |
489d5531 | 301 | this->FillCommonControlHistograms(anEvent); |
302 | this->FillAverageMultiplicities(nRP); | |
303 | ||
1268c371 | 304 | // d) Loop over data and calculate e-b-e quantities Q_{n,k}, S_{p,k} and s_{p,k}: |
9f33751d | 305 | Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = total number of primary tracks, i.e. nPrim = nRP + nPOI where: |
1268c371 | 306 | // nRP = # of reference particles; |
307 | // nPOI = # of particles of interest. | |
489d5531 | 308 | AliFlowTrackSimple *aftsTrack = NULL; |
1268c371 | 309 | Int_t n = fHarmonic; // shortcut for the harmonic |
489d5531 | 310 | for(Int_t i=0;i<nPrim;i++) |
311 | { | |
312 | aftsTrack=anEvent->GetTrack(i); | |
313 | if(aftsTrack) | |
314 | { | |
1268c371 | 315 | if(!(aftsTrack->InRPSelection() || aftsTrack->InPOISelection())){continue;} // safety measure: consider only tracks which are RPs or POIs |
489d5531 | 316 | if(aftsTrack->InRPSelection()) // RP condition: |
317 | { | |
318 | dPhi = aftsTrack->Phi(); | |
319 | dPt = aftsTrack->Pt(); | |
320 | dEta = aftsTrack->Eta(); | |
321 | if(fUsePhiWeights && fPhiWeights && fnBinsPhi) // determine phi weight for this particle: | |
322 | { | |
323 | wPhi = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(dPhi*fnBinsPhi/TMath::TwoPi()))); | |
324 | } | |
325 | if(fUsePtWeights && fPtWeights && fnBinsPt) // determine pt weight for this particle: | |
326 | { | |
327 | wPt = fPtWeights->GetBinContent(1+(Int_t)(TMath::Floor((dPt-fPtMin)/fPtBinWidth))); | |
328 | } | |
329 | if(fUseEtaWeights && fEtaWeights && fEtaBinWidth) // determine eta weight for this particle: | |
330 | { | |
331 | wEta = fEtaWeights->GetBinContent(1+(Int_t)(TMath::Floor((dEta-fEtaMin)/fEtaBinWidth))); | |
38a1e8b3 | 332 | } |
333 | // Access track weight: | |
403e3389 | 334 | if(fUseTrackWeights) |
335 | { | |
336 | wTrack = aftsTrack->Weight(); | |
337 | } | |
1268c371 | 338 | // Calculate Re[Q_{m*n,k}] and Im[Q_{m*n,k}] for this event (m = 1,2,...,6, k = 0,1,...,8): |
339 | for(Int_t m=0;m<6;m++) // to be improved - hardwired 6 | |
489d5531 | 340 | { |
1268c371 | 341 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 |
489d5531 | 342 | { |
38a1e8b3 | 343 | (*fReQ)(m,k)+=pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1)*n*dPhi); |
344 | (*fImQ)(m,k)+=pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1)*n*dPhi); | |
489d5531 | 345 | } |
346 | } | |
1268c371 | 347 | // Calculate S_{p,k} for this event (Remark: final calculation of S_{p,k} follows after the loop over data bellow): |
489d5531 | 348 | for(Int_t p=0;p<8;p++) |
349 | { | |
350 | for(Int_t k=0;k<9;k++) | |
351 | { | |
38a1e8b3 | 352 | (*fSpk)(p,k)+=pow(wPhi*wPt*wEta*wTrack,k); |
489d5531 | 353 | } |
354 | } | |
1268c371 | 355 | // Differential flow: |
356 | if(fCalculateDiffFlow || fCalculate2DDiffFlow) | |
489d5531 | 357 | { |
1268c371 | 358 | ptEta[0] = dPt; |
359 | ptEta[1] = dEta; | |
360 | // Calculate r_{m*n,k} and s_{p,k} (r_{m,k} is 'p-vector' for RPs): | |
361 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
489d5531 | 362 | { |
1268c371 | 363 | for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 |
489d5531 | 364 | { |
1268c371 | 365 | if(fCalculateDiffFlow) |
366 | { | |
62e36168 | 367 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
1268c371 | 368 | { |
38a1e8b3 | 369 | fReRPQ1dEBE[0][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
370 | fImRPQ1dEBE[0][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 371 | if(m==0) // s_{p,k} does not depend on index m |
372 | { | |
38a1e8b3 | 373 | fs1dEBE[0][pe][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k),1.); |
1268c371 | 374 | } // end of if(m==0) // s_{p,k} does not depend on index m |
375 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
376 | } // end of if(fCalculateDiffFlow) | |
377 | if(fCalculate2DDiffFlow) | |
378 | { | |
38a1e8b3 | 379 | fReRPQ2dEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
380 | fImRPQ2dEBE[0][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 381 | if(m==0) // s_{p,k} does not depend on index m |
382 | { | |
38a1e8b3 | 383 | fs2dEBE[0][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k),1.); |
1268c371 | 384 | } // end of if(m==0) // s_{p,k} does not depend on index m |
385 | } // end of if(fCalculate2DDiffFlow) | |
386 | } // end of for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 | |
387 | } // end of for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
388 | // Checking if RP particle is also POI particle: | |
389 | if(aftsTrack->InPOISelection()) | |
489d5531 | 390 | { |
1268c371 | 391 | // Calculate q_{m*n,k} and s_{p,k} ('q-vector' and 's' for RPs && POIs): |
392 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
489d5531 | 393 | { |
1268c371 | 394 | for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 |
489d5531 | 395 | { |
1268c371 | 396 | if(fCalculateDiffFlow) |
397 | { | |
62e36168 | 398 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
1268c371 | 399 | { |
38a1e8b3 | 400 | fReRPQ1dEBE[2][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
401 | fImRPQ1dEBE[2][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 402 | if(m==0) // s_{p,k} does not depend on index m |
403 | { | |
38a1e8b3 | 404 | fs1dEBE[2][pe][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k),1.); |
1268c371 | 405 | } // end of if(m==0) // s_{p,k} does not depend on index m |
406 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
407 | } // end of if(fCalculateDiffFlow) | |
408 | if(fCalculate2DDiffFlow) | |
409 | { | |
38a1e8b3 | 410 | fReRPQ2dEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
411 | fImRPQ2dEBE[2][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 412 | if(m==0) // s_{p,k} does not depend on index m |
413 | { | |
38a1e8b3 | 414 | fs2dEBE[2][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k),1.); |
1268c371 | 415 | } // end of if(m==0) // s_{p,k} does not depend on index m |
416 | } // end of if(fCalculate2DDiffFlow) | |
417 | } // end of for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 | |
418 | } // end of for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
419 | } // end of if(aftsTrack->InPOISelection()) | |
420 | } // end of if(fCalculateDiffFlow || fCalculate2DDiffFlow) | |
489d5531 | 421 | } // end of if(pTrack->InRPSelection()) |
489d5531 | 422 | if(aftsTrack->InPOISelection()) |
423 | { | |
424 | dPhi = aftsTrack->Phi(); | |
425 | dPt = aftsTrack->Pt(); | |
426 | dEta = aftsTrack->Eta(); | |
38a1e8b3 | 427 | wPhi = 1.; |
428 | wPt = 1.; | |
429 | wEta = 1.; | |
430 | wTrack = 1.; | |
431 | if(fUsePhiWeights && fPhiWeights && fnBinsPhi && aftsTrack->InRPSelection()) // determine phi weight for POI && RP particle: | |
432 | { | |
433 | wPhi = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(dPhi*fnBinsPhi/TMath::TwoPi()))); | |
434 | } | |
435 | if(fUsePtWeights && fPtWeights && fnBinsPt && aftsTrack->InRPSelection()) // determine pt weight for POI && RP particle: | |
436 | { | |
437 | wPt = fPtWeights->GetBinContent(1+(Int_t)(TMath::Floor((dPt-fPtMin)/fPtBinWidth))); | |
438 | } | |
439 | if(fUseEtaWeights && fEtaWeights && fEtaBinWidth && aftsTrack->InRPSelection()) // determine eta weight for POI && RP particle: | |
440 | { | |
441 | wEta = fEtaWeights->GetBinContent(1+(Int_t)(TMath::Floor((dEta-fEtaMin)/fEtaBinWidth))); | |
442 | } | |
443 | // Access track weight for POI && RP particle: | |
403e3389 | 444 | if(aftsTrack->InRPSelection() && fUseTrackWeights) |
38a1e8b3 | 445 | { |
446 | wTrack = aftsTrack->Weight(); | |
447 | } | |
1268c371 | 448 | ptEta[0] = dPt; |
449 | ptEta[1] = dEta; | |
450 | // Calculate p_{m*n,k} ('p-vector' for POIs): | |
451 | for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
489d5531 | 452 | { |
1268c371 | 453 | for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 |
489d5531 | 454 | { |
1268c371 | 455 | if(fCalculateDiffFlow) |
456 | { | |
62e36168 | 457 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
1268c371 | 458 | { |
38a1e8b3 | 459 | fReRPQ1dEBE[1][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
460 | fImRPQ1dEBE[1][pe][m][k]->Fill(ptEta[pe],pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 461 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta |
462 | } // end of if(fCalculateDiffFlow) | |
463 | if(fCalculate2DDiffFlow) | |
464 | { | |
38a1e8b3 | 465 | fReRPQ2dEBE[1][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Cos((m+1.)*n*dPhi),1.); |
466 | fImRPQ2dEBE[1][m][k]->Fill(dPt,dEta,pow(wPhi*wPt*wEta*wTrack,k)*TMath::Sin((m+1.)*n*dPhi),1.); | |
1268c371 | 467 | } // end of if(fCalculate2DDiffFlow) |
468 | } // end of for(Int_t m=0;m<4;m++) // to be improved - hardwired 4 | |
469 | } // end of for(Int_t k=0;k<9;k++) // to be improved - hardwired 9 | |
b77b6434 | 470 | } // end of if(pTrack->InPOISelection()) |
489d5531 | 471 | } else // to if(aftsTrack) |
472 | { | |
38a1e8b3 | 473 | printf("\n WARNING (QC): No particle (i.e. aftsTrack is a NULL pointer in AFAWQC::Make())!!!!\n\n"); |
489d5531 | 474 | } |
475 | } // end of for(Int_t i=0;i<nPrim;i++) | |
476 | ||
1268c371 | 477 | // e) Calculate the final expressions for S_{p,k} and s_{p,k} (important !!!!): |
489d5531 | 478 | for(Int_t p=0;p<8;p++) |
479 | { | |
480 | for(Int_t k=0;k<9;k++) | |
481 | { | |
1268c371 | 482 | (*fSpk)(p,k)=pow((*fSpk)(p,k),p+1); |
483 | // ... for the time being s_{p,k} dosn't need higher powers, so no need to finalize it here ... | |
484 | } // end of for(Int_t k=0;k<9;k++) | |
485 | } // end of for(Int_t p=0;p<8;p++) | |
489d5531 | 486 | |
1268c371 | 487 | // f) Call the methods which calculate correlations for reference flow: |
489d5531 | 488 | if(!fEvaluateIntFlowNestedLoops) |
489 | { | |
403e3389 | 490 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 491 | { |
1268c371 | 492 | if(nRP>1){this->CalculateIntFlowCorrelations();} // without using particle weights |
403e3389 | 493 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 494 | { |
1268c371 | 495 | if(nRP>1){this->CalculateIntFlowCorrelationsUsingParticleWeights();} // with using particle weights |
496 | } | |
497 | // Whether or not using particle weights the following is calculated in the same way: | |
498 | if(nRP>3){this->CalculateIntFlowProductOfCorrelations();} | |
499 | if(nRP>1){this->CalculateIntFlowSumOfEventWeights();} | |
500 | if(nRP>1){this->CalculateIntFlowSumOfProductOfEventWeights();} | |
501 | // Non-isotropic terms: | |
403e3389 | 502 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 503 | { |
1268c371 | 504 | if(nRP>0){this->CalculateIntFlowCorrectionsForNUASinTerms();} |
505 | if(nRP>0){this->CalculateIntFlowCorrectionsForNUACosTerms();} | |
403e3389 | 506 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
b92ea2b9 | 507 | { |
1268c371 | 508 | if(nRP>0){this->CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights();} |
509 | if(nRP>0){this->CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights();} | |
510 | } | |
511 | // Whether or not using particle weights the following is calculated in the same way: | |
512 | if(nRP>0){this->CalculateIntFlowProductOfCorrectionTermsForNUA();} | |
513 | if(nRP>0){this->CalculateIntFlowSumOfEventWeightsNUA();} | |
514 | if(nRP>0){this->CalculateIntFlowSumOfProductOfEventWeightsNUA();} | |
489d5531 | 515 | } // end of if(!fEvaluateIntFlowNestedLoops) |
516 | ||
1268c371 | 517 | // g) Call the methods which calculate correlations for differential flow: |
518 | if(!fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) | |
489d5531 | 519 | { |
403e3389 | 520 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 521 | { |
1268c371 | 522 | // Without using particle weights: |
489d5531 | 523 | this->CalculateDiffFlowCorrelations("RP","Pt"); |
62e36168 | 524 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrelations("RP","Eta");} |
489d5531 | 525 | this->CalculateDiffFlowCorrelations("POI","Pt"); |
62e36168 | 526 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrelations("POI","Eta");} |
1268c371 | 527 | // Non-isotropic terms: |
b92ea2b9 | 528 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Pt"); |
62e36168 | 529 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Eta");} |
b92ea2b9 | 530 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Pt"); |
62e36168 | 531 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Eta");} |
b92ea2b9 | 532 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Pt"); |
62e36168 | 533 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Eta");} |
b92ea2b9 | 534 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Pt"); |
62e36168 | 535 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Eta");} |
403e3389 | 536 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 537 | { |
1268c371 | 538 | // With using particle weights: |
489d5531 | 539 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Pt"); |
62e36168 | 540 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Eta");} |
489d5531 | 541 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Pt"); |
62e36168 | 542 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Eta");} |
1268c371 | 543 | // Non-isotropic terms: |
b92ea2b9 | 544 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Pt"); |
62e36168 | 545 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Eta");} |
b92ea2b9 | 546 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Pt"); |
62e36168 | 547 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Eta");} |
b92ea2b9 | 548 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Pt"); |
62e36168 | 549 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Eta");} |
b92ea2b9 | 550 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Pt"); |
62e36168 | 551 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Eta");} |
1268c371 | 552 | } |
553 | // Whether or not using particle weights the following is calculated in the same way: | |
489d5531 | 554 | this->CalculateDiffFlowProductOfCorrelations("RP","Pt"); |
62e36168 | 555 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowProductOfCorrelations("RP","Eta");} |
489d5531 | 556 | this->CalculateDiffFlowProductOfCorrelations("POI","Pt"); |
62e36168 | 557 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowProductOfCorrelations("POI","Eta");} |
489d5531 | 558 | this->CalculateDiffFlowSumOfEventWeights("RP","Pt"); |
62e36168 | 559 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowSumOfEventWeights("RP","Eta");} |
489d5531 | 560 | this->CalculateDiffFlowSumOfEventWeights("POI","Pt"); |
62e36168 | 561 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowSumOfEventWeights("POI","Eta");} |
489d5531 | 562 | this->CalculateDiffFlowSumOfProductOfEventWeights("RP","Pt"); |
62e36168 | 563 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowSumOfProductOfEventWeights("RP","Eta");} |
489d5531 | 564 | this->CalculateDiffFlowSumOfProductOfEventWeights("POI","Pt"); |
62e36168 | 565 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowSumOfProductOfEventWeights("POI","Eta");} |
1268c371 | 566 | } // end of if(!fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) |
489d5531 | 567 | |
1268c371 | 568 | // h) Call the methods which calculate correlations for 2D differential flow: |
569 | if(!fEvaluateDiffFlowNestedLoops && fCalculate2DDiffFlow) | |
570 | { | |
403e3389 | 571 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 572 | { |
1268c371 | 573 | // Without using particle weights: |
574 | this->Calculate2DDiffFlowCorrelations("RP"); | |
575 | this->Calculate2DDiffFlowCorrelations("POI"); | |
576 | // Non-isotropic terms: | |
577 | // ... to be ctd ... | |
403e3389 | 578 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
1268c371 | 579 | { |
580 | // With using particle weights: | |
581 | // ... to be ctd ... | |
582 | // Non-isotropic terms: | |
583 | // ... to be ctd ... | |
584 | } | |
585 | // Whether or not using particle weights the following is calculated in the same way: | |
586 | // ... to be ctd ... | |
587 | } // end of if(!fEvaluateDiffFlowNestedLoops && fCalculate2DDiffFlow) | |
64e500e3 | 588 | |
589 | // i) Call the methods which calculate other differential correlators: | |
b84464d3 | 590 | if(!fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) |
64e500e3 | 591 | { |
403e3389 | 592 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
64e500e3 | 593 | { |
594 | // Without using particle weights: | |
595 | this->CalculateOtherDiffCorrelators("RP","Pt"); | |
62e36168 | 596 | if(fCalculateDiffFlowVsEta){this->CalculateOtherDiffCorrelators("RP","Eta");} |
64e500e3 | 597 | this->CalculateOtherDiffCorrelators("POI","Pt"); |
62e36168 | 598 | if(fCalculateDiffFlowVsEta){this->CalculateOtherDiffCorrelators("POI","Eta");} |
403e3389 | 599 | } else // to if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
64e500e3 | 600 | { |
601 | // With using particle weights: | |
602 | // ... to be ctd ... | |
603 | } | |
604 | // Whether or not using particle weights the following is calculated in the same way: | |
605 | // ... to be ctd ... | |
606 | } // end of if(!fEvaluateDiffFlowNestedLoops) | |
607 | ||
608 | // j) Distributions of correlations: | |
e5834fcb | 609 | if(fStoreDistributions){this->StoreDistributionsOfCorrelations();} |
610 | ||
64e500e3 | 611 | // k) Store phi distribution for one event to illustrate flow: |
e5834fcb | 612 | if(fStorePhiDistributionForOneEvent){this->StorePhiDistributionForOneEvent(anEvent);} |
1268c371 | 613 | |
64e500e3 | 614 | // l) Cross-check with nested loops correlators for reference flow: |
1268c371 | 615 | if(fEvaluateIntFlowNestedLoops){this->EvaluateIntFlowNestedLoops(anEvent);} |
616 | ||
64e500e3 | 617 | // m) Cross-check with nested loops correlators for differential flow: |
1268c371 | 618 | if(fEvaluateDiffFlowNestedLoops){this->EvaluateDiffFlowNestedLoops(anEvent);} |
489d5531 | 619 | |
64e500e3 | 620 | // n) Reset all event-by-event quantities (very important !!!!): |
489d5531 | 621 | this->ResetEventByEventQuantities(); |
622 | ||
623 | } // end of AliFlowAnalysisWithQCumulants::Make(AliFlowEventSimple* anEvent) | |
624 | ||
489d5531 | 625 | //================================================================================================================================ |
626 | ||
489d5531 | 627 | void AliFlowAnalysisWithQCumulants::Finish() |
628 | { | |
629 | // Calculate the final results. | |
489d5531 | 630 | |
b3dacf6b | 631 | // a) Check all pointers used in this method; |
632 | // b) Acces the constants; | |
633 | // c) Access the flags; | |
b92ea2b9 | 634 | // d) Calculate reference cumulants (not corrected for detector effects); |
635 | // e) Correct reference cumulants for detector effects; | |
636 | // f) Calculate reference flow; | |
b77b6434 | 637 | // g) Store results for reference flow in AliFlowCommonHistResults and print them on the screen; |
b92ea2b9 | 638 | // h) Calculate the final results for differential flow (without/with weights); |
639 | // i) Correct the results for differential flow (without/with weights) for effects of non-uniform acceptance (NUA); | |
640 | // j) Calculate the final results for integrated flow (RP/POI) and store in AliFlowCommonHistResults; | |
641 | // k) Store results for differential flow in AliFlowCommonHistResults; | |
642 | // l) Print the final results for integrated flow (RP/POI) on the screen; | |
643 | // m) Cross-checking: Results from Q-vectors vs results from nested loops. | |
b3dacf6b | 644 | |
645 | // a) Check all pointers used in this method: | |
646 | this->CheckPointersUsedInFinish(); | |
647 | ||
648 | // b) Acces the constants: | |
1268c371 | 649 | this->CommonConstants("Finish"); |
489d5531 | 650 | |
b3dacf6b | 651 | if(fCommonHists && fCommonHists->GetHarmonic()) // to be improved (moved somewhere else) |
489d5531 | 652 | { |
b3dacf6b | 653 | fHarmonic = (Int_t)(fCommonHists->GetHarmonic())->GetBinContent(1); |
489d5531 | 654 | } |
b3dacf6b | 655 | |
1268c371 | 656 | // c) Access the flags: // to be improved (implement a method for this? should I store again the flags becose they can get modified with redoFinish?) |
b3dacf6b | 657 | fUsePhiWeights = (Bool_t)fUseParticleWeights->GetBinContent(1); |
658 | fUsePtWeights = (Bool_t)fUseParticleWeights->GetBinContent(2); | |
659 | fUseEtaWeights = (Bool_t)fUseParticleWeights->GetBinContent(3); | |
403e3389 | 660 | fUseTrackWeights = (Bool_t)fUseParticleWeights->GetBinContent(4); |
b3dacf6b | 661 | fApplyCorrectionForNUA = (Bool_t)fIntFlowFlags->GetBinContent(3); |
662 | fPrintFinalResults[0] = (Bool_t)fIntFlowFlags->GetBinContent(4); | |
663 | fPrintFinalResults[1] = (Bool_t)fIntFlowFlags->GetBinContent(5); | |
664 | fPrintFinalResults[2] = (Bool_t)fIntFlowFlags->GetBinContent(6); | |
665 | fPrintFinalResults[3] = (Bool_t)fIntFlowFlags->GetBinContent(7); | |
666 | fApplyCorrectionForNUAVsM = (Bool_t)fIntFlowFlags->GetBinContent(8); | |
b77b6434 | 667 | fPropagateErrorAlsoFromNIT = (Bool_t)fIntFlowFlags->GetBinContent(9); |
0dd3b008 | 668 | fCalculateCumulantsVsM = (Bool_t)fIntFlowFlags->GetBinContent(10); |
669 | fMinimumBiasReferenceFlow = (Bool_t)fIntFlowFlags->GetBinContent(11); | |
e5834fcb | 670 | fForgetAboutCovariances = (Bool_t)fIntFlowFlags->GetBinContent(12); |
671 | fStorePhiDistributionForOneEvent = (Bool_t)fIntFlowFlags->GetBinContent(13); | |
3435cacb | 672 | fFillMultipleControlHistograms = (Bool_t)fIntFlowFlags->GetBinContent(14); |
673 | fCalculateAllCorrelationsVsM = (Bool_t)fIntFlowFlags->GetBinContent(15); | |
b3dacf6b | 674 | fEvaluateIntFlowNestedLoops = (Bool_t)fEvaluateNestedLoops->GetBinContent(1); |
675 | fEvaluateDiffFlowNestedLoops = (Bool_t)fEvaluateNestedLoops->GetBinContent(2); | |
489d5531 | 676 | fCrossCheckInPtBinNo = (Int_t)fEvaluateNestedLoops->GetBinContent(3); |
677 | fCrossCheckInEtaBinNo = (Int_t)fEvaluateNestedLoops->GetBinContent(4); | |
1268c371 | 678 | |
b92ea2b9 | 679 | // d) Calculate reference cumulants (not corrected for detector effects): |
489d5531 | 680 | this->FinalizeCorrelationsIntFlow(); |
681 | this->CalculateCovariancesIntFlow(); | |
682 | this->CalculateCumulantsIntFlow(); | |
489d5531 | 683 | |
b92ea2b9 | 684 | // e) Correct reference cumulants for detector effects: |
685 | this->FinalizeCorrectionTermsForNUAIntFlow(); | |
686 | this->CalculateCovariancesNUAIntFlow(); | |
687 | this->CalculateQcumulantsCorrectedForNUAIntFlow(); | |
688 | ||
689 | // f) Calculate reference flow: | |
690 | this->CalculateReferenceFlow(); | |
489d5531 | 691 | |
b77b6434 | 692 | // g) Store results for reference flow in AliFlowCommonHistResults and print them on the screen: |
489d5531 | 693 | this->FillCommonHistResultsIntFlow(); |
b3dacf6b | 694 | if(fPrintFinalResults[0]){this->PrintFinalResultsForIntegratedFlow("RF");} |
695 | if(fPrintFinalResults[3] && fCalculateCumulantsVsM){this->PrintFinalResultsForIntegratedFlow("RF, rebinned in M");} | |
489d5531 | 696 | |
1268c371 | 697 | // h) Calculate the final results for differential flow (without/with weights): |
698 | if(fCalculateDiffFlow) | |
699 | { | |
700 | this->FinalizeReducedCorrelations("RP","Pt"); | |
62e36168 | 701 | if(fCalculateDiffFlowVsEta){this->FinalizeReducedCorrelations("RP","Eta");} |
1268c371 | 702 | this->FinalizeReducedCorrelations("POI","Pt"); |
62e36168 | 703 | if(fCalculateDiffFlowVsEta){this->FinalizeReducedCorrelations("POI","Eta");} |
1268c371 | 704 | this->CalculateDiffFlowCovariances("RP","Pt"); |
62e36168 | 705 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCovariances("RP","Eta");} |
1268c371 | 706 | this->CalculateDiffFlowCovariances("POI","Pt"); |
62e36168 | 707 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCovariances("POI","Eta");} |
1268c371 | 708 | this->CalculateDiffFlowCumulants("RP","Pt"); |
62e36168 | 709 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCumulants("RP","Eta");} |
1268c371 | 710 | this->CalculateDiffFlowCumulants("POI","Pt"); |
62e36168 | 711 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCumulants("POI","Eta");} |
1268c371 | 712 | this->CalculateDiffFlow("RP","Pt"); |
62e36168 | 713 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlow("RP","Eta");} |
1268c371 | 714 | this->CalculateDiffFlow("POI","Pt"); |
62e36168 | 715 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlow("POI","Eta");} |
1268c371 | 716 | } // if(fCalculateDiffFlow) |
717 | ||
718 | // i) Correct the results for differential flow (without/with weights) for effects of non-uniform acceptance (NUA): | |
719 | if(fCalculateDiffFlow) | |
489d5531 | 720 | { |
721 | this->FinalizeCorrectionTermsForNUADiffFlow("RP","Pt"); | |
62e36168 | 722 | if(fCalculateDiffFlowVsEta){this->FinalizeCorrectionTermsForNUADiffFlow("RP","Eta");} |
489d5531 | 723 | this->FinalizeCorrectionTermsForNUADiffFlow("POI","Pt"); |
62e36168 | 724 | if(fCalculateDiffFlowVsEta){this->FinalizeCorrectionTermsForNUADiffFlow("POI","Eta");} |
489d5531 | 725 | this->CalculateDiffFlowCumulantsCorrectedForNUA("RP","Pt"); |
62e36168 | 726 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCumulantsCorrectedForNUA("RP","Eta");} |
489d5531 | 727 | this->CalculateDiffFlowCumulantsCorrectedForNUA("POI","Pt"); |
62e36168 | 728 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCumulantsCorrectedForNUA("POI","Eta");} |
1268c371 | 729 | if(fApplyCorrectionForNUA) |
730 | { | |
731 | this->CalculateDiffFlowCorrectedForNUA("RP","Pt"); | |
62e36168 | 732 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectedForNUA("RP","Eta");} |
1268c371 | 733 | this->CalculateDiffFlowCorrectedForNUA("POI","Pt"); |
62e36168 | 734 | if(fCalculateDiffFlowVsEta){this->CalculateDiffFlowCorrectedForNUA("POI","Eta");} |
1268c371 | 735 | } |
736 | } // end of if(fCalculateDiffFlow && fApplyCorrectionForNUA) | |
737 | ||
738 | // i) Calcualate final results for 2D differential flow: | |
739 | if(fCalculate2DDiffFlow) | |
740 | { | |
741 | this->Calculate2DDiffFlowCumulants("RP"); | |
742 | this->Calculate2DDiffFlowCumulants("POI"); | |
743 | this->Calculate2DDiffFlow("RP"); | |
744 | this->Calculate2DDiffFlow("POI"); | |
745 | } // end of if(fCalculate2DDiffFlow) | |
746 | ||
747 | // j) Calculate the final results for integrated flow (RP/POI) and store in AliFlowCommonHistResults: | |
748 | if(fCalculateDiffFlow) | |
749 | { | |
750 | this->CalculateFinalResultsForRPandPOIIntegratedFlow("RP"); | |
751 | this->CalculateFinalResultsForRPandPOIIntegratedFlow("POI"); | |
3b552efe | 752 | } |
489d5531 | 753 | |
1268c371 | 754 | // k) Store results for differential flow in AliFlowCommonHistResults: |
755 | if(fCalculateDiffFlow) | |
756 | { | |
757 | this->FillCommonHistResultsDiffFlow("RP"); | |
758 | this->FillCommonHistResultsDiffFlow("POI"); | |
759 | } | |
760 | ||
761 | // l) Print the final results for integrated flow (RP/POI) on the screen: | |
762 | if(fPrintFinalResults[1] && fCalculateDiffFlow){this->PrintFinalResultsForIntegratedFlow("RP");} | |
763 | if(fPrintFinalResults[2] && fCalculateDiffFlow){this->PrintFinalResultsForIntegratedFlow("POI");} | |
764 | ||
765 | // m) Cross-checking: Results from Q-vectors vs results from nested loops: | |
766 | // m1) Reference flow: | |
489d5531 | 767 | if(fEvaluateIntFlowNestedLoops) |
768 | { | |
769 | this->CrossCheckIntFlowCorrelations(); | |
770 | this->CrossCheckIntFlowCorrectionTermsForNUA(); | |
403e3389 | 771 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights){this->CrossCheckIntFlowExtraCorrelations();} |
489d5531 | 772 | } // end of if(fEvaluateIntFlowNestedLoops) |
1268c371 | 773 | // m2) Differential flow: |
774 | if(fEvaluateDiffFlowNestedLoops && fCalculateDiffFlow) | |
489d5531 | 775 | { |
b3dacf6b | 776 | // Correlations: |
489d5531 | 777 | this->PrintNumberOfParticlesInSelectedBin(); |
778 | this->CrossCheckDiffFlowCorrelations("RP","Pt"); | |
62e36168 | 779 | if(fCalculateDiffFlowVsEta){this->CrossCheckDiffFlowCorrelations("RP","Eta");} |
489d5531 | 780 | this->CrossCheckDiffFlowCorrelations("POI","Pt"); |
62e36168 | 781 | if(fCalculateDiffFlowVsEta){this->CrossCheckDiffFlowCorrelations("POI","Eta");} |
b3dacf6b | 782 | // Correction terms for non-uniform acceptance: |
489d5531 | 783 | this->CrossCheckDiffFlowCorrectionTermsForNUA("RP","Pt"); |
62e36168 | 784 | if(fCalculateDiffFlowVsEta){this->CrossCheckDiffFlowCorrectionTermsForNUA("RP","Eta");} |
489d5531 | 785 | this->CrossCheckDiffFlowCorrectionTermsForNUA("POI","Pt"); |
62e36168 | 786 | if(fCalculateDiffFlowVsEta){this->CrossCheckDiffFlowCorrectionTermsForNUA("POI","Eta");} |
64e500e3 | 787 | // Other differential correlators: |
788 | this->CrossCheckOtherDiffCorrelators("RP","Pt"); | |
62e36168 | 789 | if(fCalculateDiffFlowVsEta){this->CrossCheckOtherDiffCorrelators("RP","Eta");} |
64e500e3 | 790 | this->CrossCheckOtherDiffCorrelators("POI","Pt"); |
62e36168 | 791 | if(fCalculateDiffFlowVsEta){this->CrossCheckOtherDiffCorrelators("POI","Eta");} |
489d5531 | 792 | } // end of if(fEvaluateDiffFlowNestedLoops) |
793 | ||
794 | } // end of AliFlowAnalysisWithQCumulants::Finish() | |
795 | ||
489d5531 | 796 | //================================================================================================================================ |
797 | ||
1268c371 | 798 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowNestedLoops(AliFlowEventSimple* anEvent) |
799 | { | |
800 | // Evalauted all correlators for reference flow with nested loops. | |
801 | ||
802 | Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = nRP + nPOI | |
803 | if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 | |
804 | { | |
805 | // Without using particle weights: | |
403e3389 | 806 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
1268c371 | 807 | { |
808 | // Correlations: | |
809 | this->CalculateIntFlowCorrelations(); // from Q-vectors | |
810 | this->EvaluateIntFlowCorrelationsWithNestedLoops(anEvent); // from nested loops (to be improved: do I have to pass here anEvent or not?) | |
811 | // Correction for non-uniform acceptance: | |
812 | this->CalculateIntFlowCorrectionsForNUASinTerms(); // from Q-vectors (sin terms) | |
813 | this->CalculateIntFlowCorrectionsForNUACosTerms(); // from Q-vectors (cos terms) | |
814 | this->EvaluateIntFlowCorrectionsForNUAWithNestedLoops(anEvent); // from nested loops (both sin and cos terms) | |
815 | } | |
816 | // Using particle weights: | |
403e3389 | 817 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
1268c371 | 818 | { |
819 | // Correlations | |
820 | this->CalculateIntFlowCorrelationsUsingParticleWeights(); // from Q-vectors | |
821 | this->EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent); // from nested loops (to be improved: do I have to pass here anEvent or not?) | |
822 | // Correction for non-uniform acceptance: | |
823 | this->CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights(); // from Q-vectors (sin terms) | |
824 | this->CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights(); // from Q-vectors (cos terms) | |
825 | this->EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(anEvent); // from nested loops (both sin and cos terms) | |
826 | } | |
827 | } else if(nPrim>fMaxAllowedMultiplicity) // to if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) | |
828 | { | |
829 | cout<<endl; | |
830 | cout<<"Skipping the event because multiplicity is "<<nPrim<<". Too high to evaluate nested loops!"<<endl; | |
831 | } else | |
832 | { | |
833 | cout<<endl; | |
834 | cout<<"Skipping the event because multiplicity is "<<nPrim<<"."<<endl; | |
835 | } | |
836 | ||
837 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowNestedLoops(AliFlowEventSimple* anEvent) | |
838 | ||
839 | //================================================================================================================================ | |
840 | ||
841 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowNestedLoops(AliFlowEventSimple* anEvent) | |
842 | { | |
843 | // Evalauted all correlators for differential flow with nested loops. | |
844 | ||
845 | if(!fCalculateDiffFlow){return;} | |
846 | ||
847 | Int_t nPrim = anEvent->NumberOfTracks(); // nPrim = nRP + nPOI | |
848 | if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 | |
849 | { | |
850 | // Without using particle weights: | |
403e3389 | 851 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
1268c371 | 852 | { |
64e500e3 | 853 | // 1.) Reduced correlations: |
1268c371 | 854 | // Q-vectors: |
855 | this->CalculateDiffFlowCorrelations("RP","Pt"); | |
856 | this->CalculateDiffFlowCorrelations("RP","Eta"); | |
857 | this->CalculateDiffFlowCorrelations("POI","Pt"); | |
858 | this->CalculateDiffFlowCorrelations("POI","Eta"); | |
859 | // Nested loops: | |
860 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"RP","Pt"); | |
861 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"RP","Eta"); | |
862 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"POI","Pt"); | |
863 | this->EvaluateDiffFlowCorrelationsWithNestedLoops(anEvent,"POI","Eta"); | |
64e500e3 | 864 | // 2.) Reduced corrections for non-uniform acceptance: |
1268c371 | 865 | // Q-vectors: |
866 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Pt"); | |
867 | this->CalculateDiffFlowCorrectionsForNUASinTerms("RP","Eta"); | |
868 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Pt"); | |
869 | this->CalculateDiffFlowCorrectionsForNUASinTerms("POI","Eta"); | |
870 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Pt"); | |
871 | this->CalculateDiffFlowCorrectionsForNUACosTerms("RP","Eta"); | |
872 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Pt"); | |
873 | this->CalculateDiffFlowCorrectionsForNUACosTerms("POI","Eta"); | |
874 | // Nested loops: | |
875 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"RP","Pt"); | |
876 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"RP","Eta"); | |
877 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"POI","Pt"); | |
878 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(anEvent,"POI","Eta"); | |
64e500e3 | 879 | // 3.) Other differential correlators: |
880 | // Q-vectors: | |
881 | this->CalculateOtherDiffCorrelators("RP","Pt"); | |
882 | this->CalculateOtherDiffCorrelators("RP","Eta"); | |
883 | this->CalculateOtherDiffCorrelators("POI","Pt"); | |
884 | this->CalculateOtherDiffCorrelators("POI","Eta"); | |
885 | // Nested loops: | |
886 | this->EvaluateOtherDiffCorrelatorsWithNestedLoops(anEvent,"RP","Pt"); | |
887 | this->EvaluateOtherDiffCorrelatorsWithNestedLoops(anEvent,"RP","Eta"); | |
888 | this->EvaluateOtherDiffCorrelatorsWithNestedLoops(anEvent,"POI","Pt"); | |
889 | this->EvaluateOtherDiffCorrelatorsWithNestedLoops(anEvent,"POI","Eta"); | |
403e3389 | 890 | } // end of if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
1268c371 | 891 | // Using particle weights: |
403e3389 | 892 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
1268c371 | 893 | { |
894 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Pt"); | |
895 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("RP","Eta"); | |
896 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Pt"); | |
897 | this->CalculateDiffFlowCorrelationsUsingParticleWeights("POI","Eta"); | |
898 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Pt"); | |
899 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("RP","Eta"); | |
900 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Pt"); | |
901 | this->CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights("POI","Eta"); | |
902 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Pt"); | |
903 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("RP","Eta"); | |
904 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Pt"); | |
905 | this->CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights("POI","Eta"); | |
906 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"RP","Pt"); | |
907 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"RP","Eta"); | |
908 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"POI","Pt"); | |
909 | this->EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(anEvent,"POI","Eta"); | |
910 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"RP","Pt"); | |
911 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"RP","Eta"); | |
912 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"POI","Pt"); | |
913 | this->EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(anEvent,"POI","Eta"); | |
403e3389 | 914 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
1268c371 | 915 | } // end of if(nPrim>0 && nPrim<=fMaxAllowedMultiplicity) // by default fMaxAllowedMultiplicity = 10 |
916 | ||
917 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowNestedLoops(AliFlowEventSimple* anEvent) | |
918 | ||
919 | //================================================================================================================================ | |
920 | ||
489d5531 | 921 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTerms() |
922 | { | |
b92ea2b9 | 923 | // Calculate correction terms for non-uniform acceptance of the detector for reference flow (cos terms). |
489d5531 | 924 | |
925 | // multiplicity: | |
1268c371 | 926 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 927 | |
928 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
929 | Double_t dReQ1n = (*fReQ)(0,0); | |
930 | Double_t dReQ2n = (*fReQ)(1,0); | |
931 | //Double_t dReQ3n = (*fReQ)(2,0); | |
932 | //Double_t dReQ4n = (*fReQ)(3,0); | |
933 | Double_t dImQ1n = (*fImQ)(0,0); | |
934 | Double_t dImQ2n = (*fImQ)(1,0); | |
935 | //Double_t dImQ3n = (*fImQ)(2,0); | |
936 | //Double_t dImQ4n = (*fImQ)(3,0); | |
937 | ||
938 | // ************************************************************* | |
939 | // **** corrections for non-uniform acceptance (cos terms): **** | |
940 | // ************************************************************* | |
941 | // | |
942 | // Remark 1: corrections for non-uniform acceptance (cos terms) calculated with non-weighted Q-vectors | |
943 | // are stored in 1D profile fQCorrectionsCos. | |
944 | // Remark 2: binning of fIntFlowCorrectionTermsForNUAPro[1] is organized as follows: | |
945 | // -------------------------------------------------------------------------------------------------------------------- | |
946 | // 1st bin: <<cos(n*(phi1))>> = cosP1n | |
947 | // 2nd bin: <<cos(n*(phi1+phi2))>> = cosP1nP1n | |
948 | // 3rd bin: <<cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1n | |
949 | // 4th bin: <<cos(n*(2phi1-phi2))>> = cosP2nM1n | |
950 | // -------------------------------------------------------------------------------------------------------------------- | |
951 | ||
952 | // 1-particle: | |
953 | Double_t cosP1n = 0.; // <<cos(n*(phi1))>> | |
954 | ||
955 | if(dMult>0) | |
956 | { | |
957 | cosP1n = dReQ1n/dMult; | |
958 | ||
959 | // average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for single event: | |
960 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(1,cosP1n); | |
0328db2d | 961 | // event weights for NUA terms: |
962 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(1,dMult); | |
489d5531 | 963 | |
964 | // final average non-weighted 1-particle correction (cos terms) for non-uniform acceptance for all events: | |
965 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(0.5,cosP1n,dMult); | |
b3dacf6b | 966 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[1][0]->Fill(dMult+0.5,cosP1n,dMult);} |
489d5531 | 967 | } |
968 | ||
969 | // 2-particle: | |
3b552efe | 970 | Double_t cosP1nP1n = 0.; // <<cos(n*(phi1+phi2))>> |
489d5531 | 971 | Double_t cosP2nM1n = 0.; // <<cos(n*(2phi1-phi2))>> |
972 | ||
973 | if(dMult>1) | |
974 | { | |
975 | cosP1nP1n = (pow(dReQ1n,2)-pow(dImQ1n,2)-dReQ2n)/(dMult*(dMult-1)); | |
976 | cosP2nM1n = (dReQ2n*dReQ1n+dImQ2n*dImQ1n-dReQ1n)/(dMult*(dMult-1)); | |
977 | ||
978 | // average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for single event: | |
3b552efe | 979 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(2,cosP1nP1n); |
489d5531 | 980 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(4,cosP2nM1n); |
0328db2d | 981 | // event weights for NUA terms: |
982 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(2,dMult*(dMult-1)); | |
983 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(4,dMult*(dMult-1)); | |
984 | ||
489d5531 | 985 | // final average non-weighted 2-particle correction (cos terms) for non-uniform acceptance for all events: |
3b552efe | 986 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(1.5,cosP1nP1n,dMult*(dMult-1)); |
489d5531 | 987 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(3.5,cosP2nM1n,dMult*(dMult-1)); |
b3dacf6b | 988 | if(fCalculateCumulantsVsM) |
989 | { | |
990 | fIntFlowCorrectionTermsForNUAVsMPro[1][1]->Fill(dMult+0.5,cosP1nP1n,dMult*(dMult-1)); | |
991 | fIntFlowCorrectionTermsForNUAVsMPro[1][3]->Fill(dMult+0.5,cosP2nM1n,dMult*(dMult-1)); | |
992 | } | |
489d5531 | 993 | } |
994 | ||
995 | // 3-particle: | |
996 | Double_t cosP1nM1nM1n = 0.; // <<cos(n*(phi1-phi2-phi3))>> | |
997 | ||
998 | if(dMult>2) | |
999 | { | |
1000 | cosP1nM1nM1n = (dReQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))-dReQ1n*dReQ2n-dImQ1n*dImQ2n-2.*(dMult-1)*dReQ1n) | |
1001 | / (dMult*(dMult-1)*(dMult-2)); | |
1002 | ||
1003 | // average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for single event: | |
1004 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(3,cosP1nM1nM1n); | |
0328db2d | 1005 | // event weights for NUA terms: |
1006 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->SetBinContent(3,dMult*(dMult-1)*(dMult-2)); | |
489d5531 | 1007 | |
1008 | // final average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for all events: | |
2001bc3a | 1009 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(2.5,cosP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); |
b3dacf6b | 1010 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[1][2]->Fill(dMult+0.5,cosP1nM1nM1n,dMult*(dMult-1)*(dMult-2));} |
489d5531 | 1011 | } |
1012 | ||
1013 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTerms() | |
1014 | ||
1015 | ||
1016 | //================================================================================================================================ | |
1017 | ||
1018 | ||
1019 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTerms() | |
1020 | { | |
1021 | // calculate corrections for non-uniform acceptance of the detector for no-name integrated flow (sin terms) | |
1022 | ||
1023 | // multiplicity: | |
1268c371 | 1024 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 1025 | |
1026 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
1027 | Double_t dReQ1n = (*fReQ)(0,0); | |
1028 | Double_t dReQ2n = (*fReQ)(1,0); | |
1029 | //Double_t dReQ3n = (*fReQ)(2,0); | |
1030 | //Double_t dReQ4n = (*fReQ)(3,0); | |
1031 | Double_t dImQ1n = (*fImQ)(0,0); | |
1032 | Double_t dImQ2n = (*fImQ)(1,0); | |
1033 | //Double_t dImQ3n = (*fImQ)(2,0); | |
1034 | //Double_t dImQ4n = (*fImQ)(3,0); | |
1035 | ||
1036 | // ************************************************************* | |
1037 | // **** corrections for non-uniform acceptance (sin terms): **** | |
1038 | // ************************************************************* | |
1039 | // | |
1040 | // Remark 1: corrections for non-uniform acceptance (sin terms) calculated with non-weighted Q-vectors | |
1041 | // are stored in 1D profile fQCorrectionsSin. | |
1042 | // Remark 2: binning of fIntFlowCorrectionTermsForNUAPro[0] is organized as follows: | |
1043 | // -------------------------------------------------------------------------------------------------------------------- | |
1044 | // 1st bin: <<sin(n*(phi1))>> = sinP1n | |
1045 | // 2nd bin: <<sin(n*(phi1+phi2))>> = sinP1nP1n | |
1046 | // 3rd bin: <<sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1n | |
1047 | // 4th bin: <<sin(n*(2phi1-phi2))>> = sinP2nM1n | |
1048 | // -------------------------------------------------------------------------------------------------------------------- | |
1049 | ||
1050 | // 1-particle: | |
1051 | Double_t sinP1n = 0.; // <sin(n*(phi1))> | |
1052 | ||
1053 | if(dMult>0) | |
1054 | { | |
1055 | sinP1n = dImQ1n/dMult; | |
1056 | ||
1057 | // average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for single event: | |
0328db2d | 1058 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(1,sinP1n); |
1059 | // event weights for NUA terms: | |
1060 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(1,dMult); | |
489d5531 | 1061 | |
1062 | // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
1063 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(0.5,sinP1n,dMult); | |
b3dacf6b | 1064 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[0][0]->Fill(dMult+0.5,sinP1n,dMult);} |
489d5531 | 1065 | } |
1066 | ||
1067 | // 2-particle: | |
1068 | Double_t sinP1nP1n = 0.; // <<sin(n*(phi1+phi2))>> | |
1069 | Double_t sinP2nM1n = 0.; // <<sin(n*(2phi1-phi2))>> | |
1070 | if(dMult>1) | |
1071 | { | |
3b552efe | 1072 | sinP1nP1n = (2.*dReQ1n*dImQ1n-dImQ2n)/(dMult*(dMult-1)); |
489d5531 | 1073 | sinP2nM1n = (dImQ2n*dReQ1n-dReQ2n*dImQ1n-dImQ1n)/(dMult*(dMult-1)); |
1074 | ||
1075 | // average non-weighted 2-particle correction (sin terms) for non-uniform acceptance for single event: | |
1076 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(2,sinP1nP1n); | |
3b552efe | 1077 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(4,sinP2nM1n); |
0328db2d | 1078 | // event weights for NUA terms: |
1079 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(2,dMult*(dMult-1)); | |
1080 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(4,dMult*(dMult-1)); | |
489d5531 | 1081 | |
1082 | // final average non-weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
1083 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(1.5,sinP1nP1n,dMult*(dMult-1)); | |
1084 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(3.5,sinP2nM1n,dMult*(dMult-1)); | |
b3dacf6b | 1085 | if(fCalculateCumulantsVsM) |
1086 | { | |
1087 | fIntFlowCorrectionTermsForNUAVsMPro[0][1]->Fill(dMult+0.5,sinP1nP1n,dMult*(dMult-1)); | |
1088 | fIntFlowCorrectionTermsForNUAVsMPro[0][3]->Fill(dMult+0.5,sinP2nM1n,dMult*(dMult-1)); | |
1089 | } | |
489d5531 | 1090 | } |
1091 | ||
1092 | // 3-particle: | |
1093 | Double_t sinP1nM1nM1n = 0.; // <<sin(n*(phi1-phi2-phi3))>> | |
1094 | ||
1095 | if(dMult>2) | |
1096 | { | |
1097 | sinP1nM1nM1n = (-dImQ1n*(pow(dReQ1n,2)+pow(dImQ1n,2))+dReQ1n*dImQ2n-dImQ1n*dReQ2n+2.*(dMult-1)*dImQ1n) | |
1098 | / (dMult*(dMult-1)*(dMult-2)); | |
1099 | ||
1100 | // average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for single event: | |
1101 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(3,sinP1nM1nM1n); | |
0328db2d | 1102 | // event weights for NUA terms: |
1103 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->SetBinContent(3,dMult*(dMult-1)*(dMult-2)); | |
489d5531 | 1104 | |
1105 | // final average non-weighted 3-particle correction (sin terms) for non-uniform acceptance for all events: | |
2001bc3a | 1106 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(2.5,sinP1nM1nM1n,dMult*(dMult-1)*(dMult-2)); |
b3dacf6b | 1107 | if(fCalculateCumulantsVsM){fIntFlowCorrectionTermsForNUAVsMPro[0][2]->Fill(dMult+0.5,sinP1nM1nM1n,dMult*(dMult-1)*(dMult-2));} |
489d5531 | 1108 | } |
1109 | ||
1110 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTerms() | |
1111 | ||
489d5531 | 1112 | //================================================================================================================================ |
1113 | ||
489d5531 | 1114 | void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos) |
1115 | { | |
1268c371 | 1116 | // a) Get pointers for common control and common result histograms; |
1117 | // b) Get pointers for histograms holding particle weights; | |
1118 | // c) Get pointers for reference flow histograms; | |
1119 | // d) Get pointers for differential flow histograms; | |
1120 | // e) Get pointers for 2D differential flow histograms; | |
64e500e3 | 1121 | // f) Get pointers for other differential correlators; |
1122 | // g) Get pointers for nested loops' histograms. | |
489d5531 | 1123 | |
1124 | if(outputListHistos) | |
3b552efe | 1125 | { |
1126 | this->SetHistList(outputListHistos); | |
1127 | if(!fHistList) | |
1128 | { | |
1268c371 | 1129 | printf("\n WARNING (QC): fHistList is NULL in AFAWQC::GOH() !!!!\n\n"); |
3b552efe | 1130 | exit(0); |
489d5531 | 1131 | } |
1132 | this->GetPointersForCommonHistograms(); | |
1133 | this->GetPointersForParticleWeightsHistograms(); | |
1134 | this->GetPointersForIntFlowHistograms(); | |
1135 | this->GetPointersForDiffFlowHistograms(); | |
1268c371 | 1136 | this->GetPointersFor2DDiffFlowHistograms(); |
64e500e3 | 1137 | this->GetPointersForOtherDiffCorrelators(); |
489d5531 | 1138 | this->GetPointersForNestedLoopsHistograms(); |
3b552efe | 1139 | } else |
1140 | { | |
1268c371 | 1141 | printf("\n WARNING (QC): outputListHistos is NULL in AFAWQC::GOH() !!!!\n\n"); |
3b552efe | 1142 | exit(0); |
489d5531 | 1143 | } |
1144 | ||
1145 | } // end of void AliFlowAnalysisWithQCumulants::GetOutputHistograms(TList *outputListHistos) | |
ad87ae62 | 1146 | |
489d5531 | 1147 | //================================================================================================================================ |
1148 | ||
489d5531 | 1149 | TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) const |
ad87ae62 | 1150 | { |
489d5531 | 1151 | // project 2D profile onto pt axis to get 1D profile |
1152 | ||
1153 | Int_t nBinsPt = profilePtEta->GetNbinsX(); | |
1154 | Double_t dPtMin = (profilePtEta->GetXaxis())->GetXmin(); | |
1155 | Double_t dPtMax = (profilePtEta->GetXaxis())->GetXmax(); | |
1156 | ||
1157 | Int_t nBinsEta = profilePtEta->GetNbinsY(); | |
1158 | ||
1159 | TProfile *profilePt = new TProfile("","",nBinsPt,dPtMin,dPtMax); | |
1160 | ||
1161 | for(Int_t p=1;p<=nBinsPt;p++) | |
1162 | { | |
1163 | Double_t contentPt = 0.; | |
1164 | Double_t entryPt = 0.; | |
1165 | Double_t spreadPt = 0.; | |
1166 | Double_t sum1 = 0.; | |
1167 | Double_t sum2 = 0.; | |
1168 | Double_t sum3 = 0.; | |
1169 | for(Int_t e=1;e<=nBinsEta;e++) | |
1170 | { | |
1171 | contentPt += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))) | |
1172 | * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1173 | entryPt += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1174 | ||
1175 | sum1 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))) | |
1176 | * (pow(profilePtEta->GetBinError(profilePtEta->GetBin(p,e)),2.) | |
1177 | + pow(profilePtEta->GetBinContent(profilePtEta->GetBin(p,e)),2.)); | |
1178 | sum2 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1179 | sum3 += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))) | |
1180 | * (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))); | |
1181 | } | |
1182 | if(sum2>0. && sum1/sum2-pow(sum3/sum2,2.) > 0.) | |
1183 | { | |
1184 | spreadPt = pow(sum1/sum2-pow(sum3/sum2,2.),0.5); | |
1185 | } | |
1186 | profilePt->SetBinContent(p,contentPt); | |
1187 | profilePt->SetBinEntries(p,entryPt); | |
1188 | { | |
1189 | profilePt->SetBinError(p,spreadPt); | |
1190 | } | |
1191 | ||
1192 | } | |
1193 | ||
1194 | return profilePt; | |
1195 | ||
1196 | } // end of TProfile* AliFlowAnalysisWithQCumulants::MakePtProjection(TProfile2D *profilePtEta) | |
1197 | ||
1198 | ||
1199 | //================================================================================================================================ | |
1200 | ||
1201 | ||
1202 | TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) const | |
1203 | { | |
1204 | // project 2D profile onto eta axis to get 1D profile | |
1205 | ||
1206 | Int_t nBinsEta = profilePtEta->GetNbinsY(); | |
1207 | Double_t dEtaMin = (profilePtEta->GetYaxis())->GetXmin(); | |
1208 | Double_t dEtaMax = (profilePtEta->GetYaxis())->GetXmax(); | |
1209 | ||
1210 | Int_t nBinsPt = profilePtEta->GetNbinsX(); | |
1211 | ||
1212 | TProfile *profileEta = new TProfile("","",nBinsEta,dEtaMin,dEtaMax); | |
1213 | ||
1214 | for(Int_t e=1;e<=nBinsEta;e++) | |
1215 | { | |
1216 | Double_t contentEta = 0.; | |
1217 | Double_t entryEta = 0.; | |
1218 | for(Int_t p=1;p<=nBinsPt;p++) | |
1219 | { | |
1220 | contentEta += (profilePtEta->GetBinContent(profilePtEta->GetBin(p,e))) | |
1221 | * (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1222 | entryEta += (profilePtEta->GetBinEntries(profilePtEta->GetBin(p,e))); | |
1223 | } | |
1224 | profileEta->SetBinContent(e,contentEta); | |
1225 | profileEta->SetBinEntries(e,entryEta); | |
1226 | } | |
1227 | ||
1228 | return profileEta; | |
1229 | ||
1230 | } // end of TProfile* AliFlowAnalysisWithQCumulants::MakeEtaProjection(TProfile2D *profilePtEta) | |
1231 | ||
489d5531 | 1232 | //================================================================================================================================ |
1233 | ||
489d5531 | 1234 | void AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type) |
1235 | { | |
2001bc3a | 1236 | // Printing on the screen the final results for integrated flow (RF, POI and RP). |
489d5531 | 1237 | |
1238 | Int_t n = fHarmonic; | |
1239 | ||
489d5531 | 1240 | Double_t dVn[4] = {0.}; // array to hold Vn{2}, Vn{4}, Vn{6} and Vn{8} |
1241 | Double_t dVnErr[4] = {0.}; // array to hold errors of Vn{2}, Vn{4}, Vn{6} and Vn{8} | |
1242 | ||
2001bc3a | 1243 | if(type == "RF") |
489d5531 | 1244 | { |
0dd3b008 | 1245 | for(Int_t b=0;b<4;b++) |
1246 | { | |
b77b6434 | 1247 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlow())->GetBinContent(1); |
1248 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlow())->GetBinError(1); | |
1249 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlow())->GetBinContent(1); | |
1250 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlow())->GetBinError(1); | |
1251 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlow())->GetBinContent(1); | |
1252 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlow())->GetBinError(1); | |
1253 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlow())->GetBinContent(1); | |
1254 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlow())->GetBinError(1); | |
0dd3b008 | 1255 | } |
489d5531 | 1256 | } else if(type == "RP") |
1257 | { | |
1258 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinContent(1); | |
1259 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowRP())->GetBinError(1); | |
1260 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinContent(1); | |
1261 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowRP())->GetBinError(1); | |
1262 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinContent(1); | |
1263 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowRP())->GetBinError(1); | |
1264 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinContent(1); | |
1265 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowRP())->GetBinError(1); | |
1266 | } else if(type == "POI") | |
1267 | { | |
1268 | dVn[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinContent(1); | |
1269 | dVnErr[0] = (fCommonHistsResults2nd->GetHistIntFlowPOI())->GetBinError(1); | |
1270 | dVn[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinContent(1); | |
1271 | dVnErr[1] = (fCommonHistsResults4th->GetHistIntFlowPOI())->GetBinError(1); | |
1272 | dVn[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinContent(1); | |
1273 | dVnErr[2] = (fCommonHistsResults6th->GetHistIntFlowPOI())->GetBinError(1); | |
1274 | dVn[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinContent(1); | |
1275 | dVnErr[3] = (fCommonHistsResults8th->GetHistIntFlowPOI())->GetBinError(1); | |
b77b6434 | 1276 | } else if(type == "RF, rebinned in M" && fCalculateCumulantsVsM) |
b3dacf6b | 1277 | { |
0dd3b008 | 1278 | for(Int_t b=0;b<4;b++) |
1279 | { | |
1280 | dVn[b] = fIntFlowRebinnedInM->GetBinContent(b+1); | |
1281 | dVnErr[b] = fIntFlowRebinnedInM->GetBinError(b+1); | |
1282 | } | |
b3dacf6b | 1283 | } |
489d5531 | 1284 | |
1285 | TString title = " flow estimates from Q-cumulants"; | |
1286 | TString subtitle = " ("; | |
b3dacf6b | 1287 | TString subtitle2 = " (rebinned in M)"; |
489d5531 | 1288 | |
b3dacf6b | 1289 | if(type != "RF, rebinned in M") |
489d5531 | 1290 | { |
403e3389 | 1291 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
b3dacf6b | 1292 | { |
1293 | subtitle.Append(type); | |
1294 | subtitle.Append(", without weights)"); | |
1295 | } else | |
1296 | { | |
1297 | subtitle.Append(type); | |
1298 | subtitle.Append(", with weights)"); | |
1299 | } | |
1300 | } else | |
489d5531 | 1301 | { |
403e3389 | 1302 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
b3dacf6b | 1303 | { |
1304 | subtitle.Append("RF"); | |
1305 | subtitle.Append(", without weights)"); | |
1306 | } else | |
1307 | { | |
1308 | subtitle.Append("RF"); | |
1309 | subtitle.Append(", with weights)"); | |
1310 | } | |
1311 | } | |
1312 | ||
489d5531 | 1313 | cout<<endl; |
1314 | cout<<"*************************************"<<endl; | |
1315 | cout<<"*************************************"<<endl; | |
1316 | cout<<title.Data()<<endl; | |
1317 | cout<<subtitle.Data()<<endl; | |
b3dacf6b | 1318 | if(type == "RF, rebinned in M"){cout<<subtitle2.Data()<<endl;} |
489d5531 | 1319 | cout<<endl; |
1320 | ||
1321 | for(Int_t i=0;i<4;i++) | |
1322 | { | |
2001bc3a | 1323 | cout<<" v_"<<n<<"{"<<2*(i+1)<<"} = "<<dVn[i]<<" +/- "<<dVnErr[i]<<endl; |
489d5531 | 1324 | } |
2001bc3a | 1325 | |
489d5531 | 1326 | cout<<endl; |
b92ea2b9 | 1327 | if(type == "RF") |
1328 | { | |
b77b6434 | 1329 | if(fApplyCorrectionForNUA) |
1330 | { | |
1331 | cout<<" detector bias (corrected for): "<<endl; | |
1332 | } else | |
1333 | { | |
1334 | cout<<" detector bias (not corrected for):"<<endl; | |
1335 | } | |
b92ea2b9 | 1336 | cout<<" to QC{2}: "<<fIntFlowDetectorBias->GetBinContent(1)<<" +/- "<<fIntFlowDetectorBias->GetBinError(1)<<endl; |
1337 | cout<<" to QC{4}: "<<fIntFlowDetectorBias->GetBinContent(2)<<" +/- "<<fIntFlowDetectorBias->GetBinError(2)<<endl; | |
1338 | cout<<endl; | |
1339 | } | |
b3dacf6b | 1340 | if(type == "RF" || type == "RF, rebinned in M") |
489d5531 | 1341 | { |
2001bc3a | 1342 | cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultRP()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultRP()->GetMean()<<endl; |
489d5531 | 1343 | } |
1344 | else if (type == "RP") | |
1345 | { | |
2001bc3a | 1346 | cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultRP()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultRP()->GetMean()<<endl; |
489d5531 | 1347 | } |
1348 | else if (type == "POI") | |
1349 | { | |
2001bc3a | 1350 | cout<<" nEvts = "<<(Int_t)fCommonHists->GetHistMultPOI()->GetEntries()<<", <M> = "<<(Double_t)fCommonHists->GetHistMultPOI()->GetMean()<<endl; |
1351 | } | |
1352 | ||
489d5531 | 1353 | cout<<"*************************************"<<endl; |
1354 | cout<<"*************************************"<<endl; | |
1355 | cout<<endl; | |
1356 | ||
2001bc3a | 1357 | }// end of AliFlowAnalysisWithQCumulants::PrintFinalResultsForIntegratedFlow(TString type="RF"); |
489d5531 | 1358 | |
1359 | //================================================================================================================================ | |
1360 | ||
489d5531 | 1361 | void AliFlowAnalysisWithQCumulants::WriteHistograms(TString outputFileName) |
1362 | { | |
1363 | //store the final results in output .root file | |
1364 | TFile *output = new TFile(outputFileName.Data(),"RECREATE"); | |
1365 | //output->WriteObject(fHistList, "cobjQC","SingleKey"); | |
1366 | fHistList->Write(fHistList->GetName(), TObject::kSingleKey); | |
1367 | delete output; | |
1368 | } | |
1369 | ||
1370 | ||
1371 | //================================================================================================================================ | |
1372 | ||
1373 | ||
1374 | void AliFlowAnalysisWithQCumulants::WriteHistograms(TDirectoryFile *outputFileName) | |
1375 | { | |
1376 | //store the final results in output .root file | |
1377 | fHistList->SetName("cobjQC"); | |
1378 | fHistList->SetOwner(kTRUE); | |
1379 | outputFileName->Add(fHistList); | |
1380 | outputFileName->Write(outputFileName->GetName(), TObject::kSingleKey); | |
1381 | } | |
1382 | ||
489d5531 | 1383 | //================================================================================================================================ |
1384 | ||
489d5531 | 1385 | void AliFlowAnalysisWithQCumulants::BookCommonHistograms() |
1386 | { | |
1387 | // Book common control histograms and common histograms for final results. | |
1268c371 | 1388 | // a) Book common control histograms; |
1389 | // b) Book common result histograms. | |
1390 | ||
1391 | // a) Book common control histograms: | |
1392 | // Common control histograms (all events): | |
489d5531 | 1393 | TString commonHistsName = "AliFlowCommonHistQC"; |
1394 | commonHistsName += fAnalysisLabel->Data(); | |
62d19320 | 1395 | fCommonHists = new AliFlowCommonHist(commonHistsName.Data(),commonHistsName.Data(),fBookOnlyBasicCCH); |
489d5531 | 1396 | fHistList->Add(fCommonHists); |
1268c371 | 1397 | // Common control histograms (selected events): |
dd442cd2 | 1398 | if(fFillMultipleControlHistograms) |
1399 | { | |
1268c371 | 1400 | // Common control histogram filled for events with 2 and more reference particles: |
dd442cd2 | 1401 | TString commonHists2ndOrderName = "AliFlowCommonHist2ndOrderQC"; |
1402 | commonHists2ndOrderName += fAnalysisLabel->Data(); | |
62d19320 | 1403 | fCommonHists2nd = new AliFlowCommonHist(commonHists2ndOrderName.Data(),commonHists2ndOrderName.Data(),fBookOnlyBasicCCH); |
dd442cd2 | 1404 | fHistList->Add(fCommonHists2nd); |
1268c371 | 1405 | // Common control histogram filled for events with 2 and more reference particles: |
dd442cd2 | 1406 | TString commonHists4thOrderName = "AliFlowCommonHist4thOrderQC"; |
1407 | commonHists4thOrderName += fAnalysisLabel->Data(); | |
62d19320 | 1408 | fCommonHists4th = new AliFlowCommonHist(commonHists4thOrderName.Data(),commonHists4thOrderName.Data(),fBookOnlyBasicCCH); |
dd442cd2 | 1409 | fHistList->Add(fCommonHists4th); |
1268c371 | 1410 | // Common control histogram filled for events with 6 and more reference particles: |
dd442cd2 | 1411 | TString commonHists6thOrderName = "AliFlowCommonHist6thOrderQC"; |
1412 | commonHists6thOrderName += fAnalysisLabel->Data(); | |
62d19320 | 1413 | fCommonHists6th = new AliFlowCommonHist(commonHists6thOrderName.Data(),commonHists6thOrderName.Data(),fBookOnlyBasicCCH); |
dd442cd2 | 1414 | fHistList->Add(fCommonHists6th); |
1268c371 | 1415 | // Common control histogram filled for events with 8 and more reference particles: |
dd442cd2 | 1416 | TString commonHists8thOrderName = "AliFlowCommonHist8thOrderQC"; |
1417 | commonHists8thOrderName += fAnalysisLabel->Data(); | |
62d19320 | 1418 | fCommonHists8th = new AliFlowCommonHist(commonHists8thOrderName.Data(),commonHists8thOrderName.Data(),fBookOnlyBasicCCH); |
dd442cd2 | 1419 | fHistList->Add(fCommonHists8th); |
1420 | } // end of if(fFillMultipleControlHistograms) | |
1421 | ||
1268c371 | 1422 | // b) Book common result histograms: |
1423 | // Common result histograms for QC{2}: | |
489d5531 | 1424 | TString commonHistResults2ndOrderName = "AliFlowCommonHistResults2ndOrderQC"; |
1425 | commonHistResults2ndOrderName += fAnalysisLabel->Data(); | |
62e36168 | 1426 | fCommonHistsResults2nd = new AliFlowCommonHistResults(commonHistResults2ndOrderName.Data(),"",fHarmonic); |
489d5531 | 1427 | fHistList->Add(fCommonHistsResults2nd); |
1268c371 | 1428 | // Common result histograms for QC{4}: |
489d5531 | 1429 | TString commonHistResults4thOrderName = "AliFlowCommonHistResults4thOrderQC"; |
1430 | commonHistResults4thOrderName += fAnalysisLabel->Data(); | |
62e36168 | 1431 | fCommonHistsResults4th = new AliFlowCommonHistResults(commonHistResults4thOrderName.Data(),"",fHarmonic); |
489d5531 | 1432 | fHistList->Add(fCommonHistsResults4th); |
1268c371 | 1433 | // Common result histograms for QC{6}: |
489d5531 | 1434 | TString commonHistResults6thOrderName = "AliFlowCommonHistResults6thOrderQC"; |
1435 | commonHistResults6thOrderName += fAnalysisLabel->Data(); | |
62e36168 | 1436 | fCommonHistsResults6th = new AliFlowCommonHistResults(commonHistResults6thOrderName.Data(),"",fHarmonic); |
489d5531 | 1437 | fHistList->Add(fCommonHistsResults6th); |
1268c371 | 1438 | // Common result histograms for QC{8}: |
489d5531 | 1439 | TString commonHistResults8thOrderName = "AliFlowCommonHistResults8thOrderQC"; |
1440 | commonHistResults8thOrderName += fAnalysisLabel->Data(); | |
62e36168 | 1441 | fCommonHistsResults8th = new AliFlowCommonHistResults(commonHistResults8thOrderName.Data(),"",fHarmonic); |
489d5531 | 1442 | fHistList->Add(fCommonHistsResults8th); |
1443 | ||
1444 | } // end of void AliFlowAnalysisWithQCumulants::BookCommonHistograms() | |
1445 | ||
489d5531 | 1446 | //================================================================================================================================ |
1447 | ||
489d5531 | 1448 | void AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms() |
1449 | { | |
1268c371 | 1450 | // Book and fill histograms which hold phi, pt and eta weights. |
489d5531 | 1451 | |
1452 | if(!fWeightsList) | |
1453 | { | |
1268c371 | 1454 | printf("\n WARNING (QC): fWeightsList is NULL in AFAWQC::BAFWH() !!!! \n\n"); |
489d5531 | 1455 | exit(0); |
1456 | } | |
1457 | ||
1458 | TString fUseParticleWeightsName = "fUseParticleWeightsQC"; | |
1459 | fUseParticleWeightsName += fAnalysisLabel->Data(); | |
403e3389 | 1460 | fUseParticleWeights = new TProfile(fUseParticleWeightsName.Data(),"0 = particle weight not used, 1 = particle weight used ",4,0,4); |
489d5531 | 1461 | fUseParticleWeights->SetLabelSize(0.06); |
1462 | (fUseParticleWeights->GetXaxis())->SetBinLabel(1,"w_{#phi}"); | |
1463 | (fUseParticleWeights->GetXaxis())->SetBinLabel(2,"w_{p_{T}}"); | |
1464 | (fUseParticleWeights->GetXaxis())->SetBinLabel(3,"w_{#eta}"); | |
403e3389 | 1465 | (fUseParticleWeights->GetXaxis())->SetBinLabel(4,"w_{track}"); |
489d5531 | 1466 | fUseParticleWeights->Fill(0.5,(Int_t)fUsePhiWeights); |
1467 | fUseParticleWeights->Fill(1.5,(Int_t)fUsePtWeights); | |
1468 | fUseParticleWeights->Fill(2.5,(Int_t)fUseEtaWeights); | |
403e3389 | 1469 | fUseParticleWeights->Fill(3.5,(Int_t)fUseTrackWeights); |
489d5531 | 1470 | fWeightsList->Add(fUseParticleWeights); |
1471 | ||
1472 | if(fUsePhiWeights) | |
1473 | { | |
1474 | if(fWeightsList->FindObject("phi_weights")) | |
1475 | { | |
1476 | fPhiWeights = dynamic_cast<TH1F*>(fWeightsList->FindObject("phi_weights")); | |
1268c371 | 1477 | if(!fPhiWeights) |
1478 | { | |
1479 | printf("\n WARNING (QC): fPhiWeights is NULL in AFAWQC::BAFWH() !!!!\n\n"); | |
1480 | exit(0); | |
1481 | } | |
489d5531 | 1482 | if(TMath::Abs(fPhiWeights->GetBinWidth(1)-fPhiBinWidth)>pow(10.,-6.)) |
1483 | { | |
1484 | cout<<endl; | |
1485 | cout<<"WARNING (QC): Inconsistent binning in histograms for phi-weights throughout the code."<<endl; | |
1486 | cout<<endl; | |
6fbbbbf1 | 1487 | //exit(0); |
489d5531 | 1488 | } |
1489 | } else | |
1490 | { | |
1491 | cout<<"WARNING: fWeightsList->FindObject(\"phi_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1492 | exit(0); | |
1493 | } | |
1494 | } // end of if(fUsePhiWeights) | |
1495 | ||
1496 | if(fUsePtWeights) | |
1497 | { | |
1498 | if(fWeightsList->FindObject("pt_weights")) | |
1499 | { | |
1500 | fPtWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("pt_weights")); | |
1268c371 | 1501 | if(!fPtWeights) |
1502 | { | |
1503 | printf("\n WARNING (QC): fPtWeights is NULL in AFAWQC::BAFWH() !!!!\n\n"); | |
1504 | exit(0); | |
1505 | } | |
489d5531 | 1506 | if(TMath::Abs(fPtWeights->GetBinWidth(1)-fPtBinWidth)>pow(10.,-6.)) |
1507 | { | |
1508 | cout<<endl; | |
1509 | cout<<"WARNING (QC): Inconsistent binning in histograms for pt-weights throughout the code."<<endl; | |
1510 | cout<<endl; | |
6fbbbbf1 | 1511 | //exit(0); |
489d5531 | 1512 | } |
1513 | } else | |
1514 | { | |
1515 | cout<<"WARNING: fWeightsList->FindObject(\"pt_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1516 | exit(0); | |
1517 | } | |
1518 | } // end of if(fUsePtWeights) | |
1519 | ||
1520 | if(fUseEtaWeights) | |
1521 | { | |
1522 | if(fWeightsList->FindObject("eta_weights")) | |
1523 | { | |
1524 | fEtaWeights = dynamic_cast<TH1D*>(fWeightsList->FindObject("eta_weights")); | |
1268c371 | 1525 | if(!fEtaWeights) |
1526 | { | |
1527 | printf("\n WARNING (QC): fEtaWeights is NULL in AFAWQC::BAFWH() !!!!\n\n"); | |
1528 | exit(0); | |
1529 | } | |
489d5531 | 1530 | if(TMath::Abs(fEtaWeights->GetBinWidth(1)-fEtaBinWidth)>pow(10.,-6.)) |
1531 | { | |
1532 | cout<<endl; | |
1533 | cout<<"WARNING (QC): Inconsistent binning in histograms for eta-weights throughout the code."<<endl; | |
1534 | cout<<endl; | |
6fbbbbf1 | 1535 | //exit(0); |
489d5531 | 1536 | } |
1537 | } else | |
1538 | { | |
1539 | cout<<"WARNING: fUseEtaWeights && fWeightsList->FindObject(\"eta_weights\") is NULL in AFAWQC::BAFWH() !!!!"<<endl; | |
1540 | exit(0); | |
1541 | } | |
1542 | } // end of if(fUseEtaWeights) | |
1543 | ||
1544 | } // end of AliFlowAnalysisWithQCumulants::BookAndFillWeightsHistograms() | |
1545 | ||
489d5531 | 1546 | //================================================================================================================================ |
1547 | ||
489d5531 | 1548 | void AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow() |
1549 | { | |
1550 | // Book all objects for integrated flow: | |
e5834fcb | 1551 | // a) Book profile to hold all flags for integrated flow; |
1552 | // b) Book event-by-event quantities; | |
1553 | // c) Book profiles; // to be improved (comment) | |
489d5531 | 1554 | // d) Book histograms holding the final results. |
1555 | ||
1556 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?) | |
1557 | TString powerFlag[2] = {"linear","quadratic"}; // to be improved (should I promote this to data members?) | |
1558 | ||
1559 | // a) Book profile to hold all flags for integrated flow: | |
1560 | TString intFlowFlagsName = "fIntFlowFlags"; | |
1561 | intFlowFlagsName += fAnalysisLabel->Data(); | |
3435cacb | 1562 | fIntFlowFlags = new TProfile(intFlowFlagsName.Data(),"Flags for Integrated Flow",15,0,15); |
489d5531 | 1563 | fIntFlowFlags->SetTickLength(-0.01,"Y"); |
1564 | fIntFlowFlags->SetMarkerStyle(25); | |
403e3389 | 1565 | fIntFlowFlags->SetLabelSize(0.04); |
489d5531 | 1566 | fIntFlowFlags->SetLabelOffset(0.02,"Y"); |
1567 | fIntFlowFlags->GetXaxis()->SetBinLabel(1,"Particle Weights"); | |
1568 | fIntFlowFlags->GetXaxis()->SetBinLabel(2,"Event Weights"); | |
1569 | fIntFlowFlags->GetXaxis()->SetBinLabel(3,"Corrected for NUA?"); | |
b3dacf6b | 1570 | fIntFlowFlags->GetXaxis()->SetBinLabel(4,"Print RF results"); |
489d5531 | 1571 | fIntFlowFlags->GetXaxis()->SetBinLabel(5,"Print RP results"); |
3b552efe | 1572 | fIntFlowFlags->GetXaxis()->SetBinLabel(6,"Print POI results"); |
b3dacf6b | 1573 | fIntFlowFlags->GetXaxis()->SetBinLabel(7,"Print RF (rebinned in M) results"); |
1574 | fIntFlowFlags->GetXaxis()->SetBinLabel(8,"Corrected for NUA vs M?"); | |
1575 | fIntFlowFlags->GetXaxis()->SetBinLabel(9,"Propagate errors to v_{n} from correlations?"); | |
1576 | fIntFlowFlags->GetXaxis()->SetBinLabel(10,"Calculate cumulants vs M"); | |
0dd3b008 | 1577 | fIntFlowFlags->GetXaxis()->SetBinLabel(11,"fMinimumBiasReferenceFlow"); |
8e1cefdd | 1578 | fIntFlowFlags->GetXaxis()->SetBinLabel(12,"fForgetAboutCovariances"); |
e5834fcb | 1579 | fIntFlowFlags->GetXaxis()->SetBinLabel(13,"fStorePhiDistributionForOneEvent"); |
dd442cd2 | 1580 | fIntFlowFlags->GetXaxis()->SetBinLabel(14,"fFillMultipleControlHistograms"); |
3435cacb | 1581 | fIntFlowFlags->GetXaxis()->SetBinLabel(15,"Calculate all correlations vs M"); |
489d5531 | 1582 | fIntFlowList->Add(fIntFlowFlags); |
1583 | ||
1584 | // b) Book event-by-event quantities: | |
1585 | // Re[Q_{m*n,k}], Im[Q_{m*n,k}] and S_{p,k}^M: | |
8ed4edc7 | 1586 | fReQ = new TMatrixD(6,9); |
1587 | fImQ = new TMatrixD(6,9); | |
1268c371 | 1588 | fSpk = new TMatrixD(8,9); |
489d5531 | 1589 | // average correlations <2>, <4>, <6> and <8> for single event (bining is the same as in fIntFlowCorrelationsPro and fIntFlowCorrelationsHist): |
1590 | TString intFlowCorrelationsEBEName = "fIntFlowCorrelationsEBE"; | |
1591 | intFlowCorrelationsEBEName += fAnalysisLabel->Data(); | |
1592 | fIntFlowCorrelationsEBE = new TH1D(intFlowCorrelationsEBEName.Data(),intFlowCorrelationsEBEName.Data(),4,0,4); | |
1593 | // weights for average correlations <2>, <4>, <6> and <8> for single event: | |
1594 | TString intFlowEventWeightsForCorrelationsEBEName = "fIntFlowEventWeightsForCorrelationsEBE"; | |
1595 | intFlowEventWeightsForCorrelationsEBEName += fAnalysisLabel->Data(); | |
1596 | fIntFlowEventWeightsForCorrelationsEBE = new TH1D(intFlowEventWeightsForCorrelationsEBEName.Data(),intFlowEventWeightsForCorrelationsEBEName.Data(),4,0,4); | |
1597 | // average all correlations for single event (bining is the same as in fIntFlowCorrelationsAllPro and fIntFlowCorrelationsAllHist): | |
1598 | TString intFlowCorrelationsAllEBEName = "fIntFlowCorrelationsAllEBE"; | |
1599 | intFlowCorrelationsAllEBEName += fAnalysisLabel->Data(); | |
403e3389 | 1600 | fIntFlowCorrelationsAllEBE = new TH1D(intFlowCorrelationsAllEBEName.Data(),intFlowCorrelationsAllEBEName.Data(),64,0,64); |
489d5531 | 1601 | // average correction terms for non-uniform acceptance for single event |
1602 | // (binning is the same as in fIntFlowCorrectionTermsForNUAPro[2] and fIntFlowCorrectionTermsForNUAHist[2]): | |
1603 | TString fIntFlowCorrectionTermsForNUAEBEName = "fIntFlowCorrectionTermsForNUAEBE"; | |
1604 | fIntFlowCorrectionTermsForNUAEBEName += fAnalysisLabel->Data(); | |
1605 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
1606 | { | |
b92ea2b9 | 1607 | fIntFlowCorrectionTermsForNUAEBE[sc] = new TH1D(Form("%s: %s terms",fIntFlowCorrectionTermsForNUAEBEName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4); |
489d5531 | 1608 | } |
0328db2d | 1609 | // event weights for terms for non-uniform acceptance: |
1610 | TString fIntFlowEventWeightForCorrectionTermsForNUAEBEName = "fIntFlowEventWeightForCorrectionTermsForNUAEBE"; | |
1611 | fIntFlowEventWeightForCorrectionTermsForNUAEBEName += fAnalysisLabel->Data(); | |
1612 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
1613 | { | |
b92ea2b9 | 1614 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc] = new TH1D(Form("%s: %s terms",fIntFlowEventWeightForCorrectionTermsForNUAEBEName.Data(),sinCosFlag[sc].Data()),Form("Event weights for terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4); // to be improved - 4 |
0328db2d | 1615 | } |
489d5531 | 1616 | // c) Book profiles: // to be improved (comment) |
1617 | // profile to hold average multiplicities and number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8: | |
1618 | TString avMultiplicityName = "fAvMultiplicity"; | |
1619 | avMultiplicityName += fAnalysisLabel->Data(); | |
403e3389 | 1620 | fAvMultiplicity = new TProfile(avMultiplicityName.Data(),"Average multiplicities of reference particles (RPs)",9,0,9); |
489d5531 | 1621 | fAvMultiplicity->SetTickLength(-0.01,"Y"); |
1622 | fAvMultiplicity->SetMarkerStyle(25); | |
1623 | fAvMultiplicity->SetLabelSize(0.05); | |
1624 | fAvMultiplicity->SetLabelOffset(0.02,"Y"); | |
403e3389 | 1625 | fAvMultiplicity->SetYTitle("Average multiplicity"); |
489d5531 | 1626 | (fAvMultiplicity->GetXaxis())->SetBinLabel(1,"all evts"); |
1627 | (fAvMultiplicity->GetXaxis())->SetBinLabel(2,"n_{RP} #geq 1"); | |
1628 | (fAvMultiplicity->GetXaxis())->SetBinLabel(3,"n_{RP} #geq 2"); | |
1629 | (fAvMultiplicity->GetXaxis())->SetBinLabel(4,"n_{RP} #geq 3"); | |
1630 | (fAvMultiplicity->GetXaxis())->SetBinLabel(5,"n_{RP} #geq 4"); | |
1631 | (fAvMultiplicity->GetXaxis())->SetBinLabel(6,"n_{RP} #geq 5"); | |
1632 | (fAvMultiplicity->GetXaxis())->SetBinLabel(7,"n_{RP} #geq 6"); | |
1633 | (fAvMultiplicity->GetXaxis())->SetBinLabel(8,"n_{RP} #geq 7"); | |
1634 | (fAvMultiplicity->GetXaxis())->SetBinLabel(9,"n_{RP} #geq 8"); | |
1635 | fIntFlowProfiles->Add(fAvMultiplicity); | |
b40a910e | 1636 | // Average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with wrong errors!): |
1637 | TString correlationFlag[4] = {"#LT#LT2#GT#GT","#LT#LT4#GT#GT","#LT#LT6#GT#GT","#LT#LT8#GT#GT"}; | |
489d5531 | 1638 | TString intFlowCorrelationsProName = "fIntFlowCorrelationsPro"; |
1639 | intFlowCorrelationsProName += fAnalysisLabel->Data(); | |
1640 | fIntFlowCorrelationsPro = new TProfile(intFlowCorrelationsProName.Data(),"Average correlations for all events",4,0,4,"s"); | |
b40a910e | 1641 | fIntFlowCorrelationsPro->Sumw2(); |
489d5531 | 1642 | fIntFlowCorrelationsPro->SetTickLength(-0.01,"Y"); |
1643 | fIntFlowCorrelationsPro->SetMarkerStyle(25); | |
1644 | fIntFlowCorrelationsPro->SetLabelSize(0.06); | |
1645 | fIntFlowCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
68a3b4b1 | 1646 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 1647 | { |
68a3b4b1 | 1648 | (fIntFlowCorrelationsPro->GetXaxis())->SetBinLabel(b+1,correlationFlag[b].Data()); |
b3dacf6b | 1649 | } |
489d5531 | 1650 | fIntFlowProfiles->Add(fIntFlowCorrelationsPro); |
b40a910e | 1651 | // Average correlations squared <<2>^2>, <<4>^2>, <<6>^2> and <<8>^2> for all events: |
1652 | TString squaredCorrelationFlag[4] = {"#LT#LT2#GT^{2}#GT","#LT#LT4#GT^{2}#GT","#LT#LT6#GT^{2}#GT","#LT#LT8#GT^{2}#GT"}; | |
1653 | TString intFlowSquaredCorrelationsProName = "fIntFlowSquaredCorrelationsPro"; | |
1654 | intFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
1655 | fIntFlowSquaredCorrelationsPro = new TProfile(intFlowSquaredCorrelationsProName.Data(),"Average squared correlations for all events",4,0,4,"s"); | |
1656 | fIntFlowSquaredCorrelationsPro->Sumw2(); | |
1657 | fIntFlowSquaredCorrelationsPro->SetTickLength(-0.01,"Y"); | |
1658 | fIntFlowSquaredCorrelationsPro->SetMarkerStyle(25); | |
1659 | fIntFlowSquaredCorrelationsPro->SetLabelSize(0.06); | |
1660 | fIntFlowSquaredCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
1661 | for(Int_t b=0;b<4;b++) | |
1662 | { | |
1663 | (fIntFlowSquaredCorrelationsPro->GetXaxis())->SetBinLabel(b+1,squaredCorrelationFlag[b].Data()); | |
1664 | } | |
1665 | fIntFlowProfiles->Add(fIntFlowSquaredCorrelationsPro); | |
b3dacf6b | 1666 | if(fCalculateCumulantsVsM) |
1667 | { | |
1668 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
1669 | { | |
b40a910e | 1670 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> versus multiplicity for all events (with wrong errors): |
b3dacf6b | 1671 | TString intFlowCorrelationsVsMProName = "fIntFlowCorrelationsVsMPro"; |
1672 | intFlowCorrelationsVsMProName += fAnalysisLabel->Data(); | |
1673 | fIntFlowCorrelationsVsMPro[ci] = new TProfile(Form("%s, %s",intFlowCorrelationsVsMProName.Data(),correlationFlag[ci].Data()), | |
1674 | Form("%s vs multiplicity",correlationFlag[ci].Data()), | |
b40a910e | 1675 | fnBinsMult,fMinMult,fMaxMult,"s"); |
1676 | fIntFlowCorrelationsVsMPro[ci]->Sumw2(); | |
b3dacf6b | 1677 | fIntFlowCorrelationsVsMPro[ci]->GetYaxis()->SetTitle(correlationFlag[ci].Data()); |
1678 | fIntFlowCorrelationsVsMPro[ci]->GetXaxis()->SetTitle("M"); | |
1679 | fIntFlowProfiles->Add(fIntFlowCorrelationsVsMPro[ci]); | |
b40a910e | 1680 | // average squared correlations <<2>^2>, <<4>^2>, <<6>^2> and <<8>^2> versus multiplicity for all events: |
1681 | TString intFlowSquaredCorrelationsVsMProName = "fIntFlowSquaredCorrelationsVsMPro"; | |
1682 | intFlowSquaredCorrelationsVsMProName += fAnalysisLabel->Data(); | |
1683 | fIntFlowSquaredCorrelationsVsMPro[ci] = new TProfile(Form("%s, %s",intFlowSquaredCorrelationsVsMProName.Data(),squaredCorrelationFlag[ci].Data()), | |
1684 | Form("%s vs multiplicity",squaredCorrelationFlag[ci].Data()), | |
1685 | fnBinsMult,fMinMult,fMaxMult,"s"); | |
1686 | fIntFlowSquaredCorrelationsVsMPro[ci]->Sumw2(); | |
1687 | fIntFlowSquaredCorrelationsVsMPro[ci]->GetYaxis()->SetTitle(squaredCorrelationFlag[ci].Data()); | |
1688 | fIntFlowSquaredCorrelationsVsMPro[ci]->GetXaxis()->SetTitle("M"); | |
1689 | fIntFlowProfiles->Add(fIntFlowSquaredCorrelationsVsMPro[ci]); | |
b3dacf6b | 1690 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index |
1691 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 1692 | // averaged all correlations for all events (with wrong errors!): |
1693 | TString intFlowCorrelationsAllProName = "fIntFlowCorrelationsAllPro"; | |
1694 | intFlowCorrelationsAllProName += fAnalysisLabel->Data(); | |
403e3389 | 1695 | fIntFlowCorrelationsAllPro = new TProfile(intFlowCorrelationsAllProName.Data(),"Average all correlations for all events",64,0,64); |
b84464d3 | 1696 | fIntFlowCorrelationsAllPro->Sumw2(); |
489d5531 | 1697 | fIntFlowCorrelationsAllPro->SetTickLength(-0.01,"Y"); |
1698 | fIntFlowCorrelationsAllPro->SetMarkerStyle(25); | |
1699 | fIntFlowCorrelationsAllPro->SetLabelSize(0.03); | |
1700 | fIntFlowCorrelationsAllPro->SetLabelOffset(0.01,"Y"); | |
1701 | // 2-p correlations: | |
403e3389 | 1702 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(1,"#LT#LT2#GT#GT_{n|n}"); |
1703 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(2,"#LT#LT2#GT#GT_{2n|2n}"); | |
1704 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(3,"#LT#LT2#GT#GT_{3n|3n}"); | |
1705 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(4,"#LT#LT2#GT#GT_{4n|4n}"); | |
489d5531 | 1706 | // 3-p correlations: |
403e3389 | 1707 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(6,"#LT#LT3#GT#GT_{2n|n,n}"); |
1708 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(7,"#LT#LT3#GT#GT_{3n|2n,n}"); | |
1709 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(8,"#LT#LT3#GT#GT_{4n|2n,2n}"); | |
1710 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(9,"#LT#LT3#GT#GT_{4n|3n,n}"); | |
489d5531 | 1711 | // 4-p correlations: |
403e3389 | 1712 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(11,"#LT#LT4#GT#GT_{n,n|n,n}"); |
1713 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(12,"#LT#LT4#GT#GT_{2n,n|2n,n}"); | |
1714 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(13,"#LT#LT4#GT#GT_{2n,2n|2n,2n}"); | |
1715 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(14,"#LT#LT4#GT#GT_{3n|n,n,n}"); | |
1716 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(15,"#LT#LT4#GT#GT_{3n,n|3n,n}"); | |
1717 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(16,"#LT#LT4#GT#GT_{3n,n|2n,2n}"); | |
1718 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(17,"#LT#LT4#GT#GT_{4n|2n,n,n}"); | |
489d5531 | 1719 | // 5-p correlations: |
403e3389 | 1720 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(19,"#LT#LT5#GT#GT_{2n,n|n,n,n}"); |
1721 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(20,"#LT#LT5#GT#GT_{2n,2n|2n,n,n}"); | |
1722 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(21,"#LT#LT5#GT#GT_{3n,n|2n,n,n}"); | |
1723 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(22,"#LT#LT5#GT#GT_{4n|n,n,n,n}"); | |
489d5531 | 1724 | // 6-p correlations: |
403e3389 | 1725 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(24,"#LT#LT6#GT#GT_{n,n,n|n,n,n}"); |
1726 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(25,"#LT#LT6#GT#GT_{2n,n,n|2n,n,n}"); | |
1727 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(26,"#LT#LT6#GT#GT_{2n,2n|n,n,n,n}"); | |
1728 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(27,"#LT#LT6#GT#GT_{3n,n|n,n,n,n}"); | |
489d5531 | 1729 | // 7-p correlations: |
403e3389 | 1730 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(29,"#LT#LT7#GT#GT_{2n,n,n|n,n,n,n}"); |
489d5531 | 1731 | // 8-p correlations: |
403e3389 | 1732 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(31,"#LT#LT8#GT#GT_{n,n,n,n|n,n,n,n}"); |
b84464d3 | 1733 | // EXTRA correlations for v3{5} study: |
403e3389 | 1734 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(33,"#LT#LT4#GT#GT_{4n,2n|3n,3n}"); |
1735 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(34,"#LT#LT5#GT#GT_{3n,3n|2n,2n,2n}"); | |
b84464d3 | 1736 | // EXTRA correlations for Teaney-Yan study: |
403e3389 | 1737 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(35,"#LT#LT2#GT#GT_{5n|5n}"); |
1738 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(36,"#LT#LT2#GT#GT_{6n|6n}"); | |
1739 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(37,"#LT#LT3#GT#GT_{5n|3n,2n}"); | |
1740 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(38,"#LT#LT3#GT#GT_{5n|4n,1n}"); | |
1741 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(39,"#LT#LT3#GT#GT_{6n|3n,3n}"); | |
1742 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(40,"#LT#LT3#GT#GT_{6n|4n,2n}"); | |
1743 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(41,"#LT#LT3#GT#GT_{6n|5n,1n}"); | |
1744 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(42,"#LT#LT4#GT#GT_{6n|3n,2n,1n}"); | |
1745 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(43,"#LT#LT4#GT#GT_{3n,2n|3n,2n}"); | |
1746 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(44,"#LT#LT4#GT#GT_{4n,1n|3n,2n}"); | |
1747 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(45,"#LT#LT4#GT#GT_{3n,3n|3n,3n}"); | |
1748 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(46,"#LT#LT4#GT#GT_{4n,2n|3n,3n}"); | |
1749 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(47,"#LT#LT4#GT#GT_{5n,1n|3n,3n}"); | |
1750 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(48,"#LT#LT4#GT#GT_{4n,2n|4n,2n}"); | |
1751 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(49,"#LT#LT4#GT#GT_{5n,1n|4n,2n}"); | |
1752 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(50,"#LT#LT4#GT#GT_{5n|3n,1n,1n}"); | |
1753 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(51,"#LT#LT4#GT#GT_{5n|2n,2n,1n}"); | |
1754 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(52,"#LT#LT4#GT#GT_{5n,1n|5n,1n}"); | |
1755 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(53,"#LT#LT5#GT#GT_{3n,3n|3n,2n,1n}"); | |
1756 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(54,"#LT#LT5#GT#GT_{4n,2n|3n,2n,1n}"); | |
1757 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(55,"#LT#LT5#GT#GT_{3n,2n|3n,1n,1n}"); | |
1758 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(56,"#LT#LT5#GT#GT_{3n,2n|2n,2n,1n}"); | |
1759 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(57,"#LT#LT5#GT#GT_{5n,1n|3n,2n,1n}"); | |
1760 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(58,"#LT#LT6#GT#GT_{3n,2n,1n|3n,2n,1n}"); | |
1761 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(59,"#LT#LT4#GT#GT_{6n|4n,1n,1n}"); | |
1762 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(60,"#LT#LT4#GT#GT_{6n|2n,2n,2n}"); | |
1763 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(61,"#LT#LT5#GT#GT_{6n|2n,2n,1n,1n}"); | |
1764 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(62,"#LT#LT5#GT#GT_{4n,1n,1n|3n,3n}"); | |
1765 | (fIntFlowCorrelationsAllPro->GetXaxis())->SetBinLabel(63,"#LT#LT6#GT#GT_{3n,3n|2n,2n,1n,1n}"); | |
489d5531 | 1766 | fIntFlowProfiles->Add(fIntFlowCorrelationsAllPro); |
3435cacb | 1767 | // average all correlations versus multiplicity (errors via Sumw2 - to be improved): |
1768 | if(fCalculateAllCorrelationsVsM) | |
1769 | { | |
1770 | // 2-p correlations vs M: | |
1771 | fIntFlowCorrelationsAllVsMPro[0] = new TProfile("two1n1n","#LT#LT2#GT#GT_{n|n}",fnBinsMult,fMinMult,fMaxMult); | |
1772 | fIntFlowCorrelationsAllVsMPro[0]->Sumw2(); | |
1773 | fIntFlowCorrelationsAllVsMPro[0]->GetXaxis()->SetTitle("M"); | |
1774 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[0]); | |
1775 | fIntFlowCorrelationsAllVsMPro[1] = new TProfile("two2n2n","#LT#LT2#GT#GT_{2n|2n}",fnBinsMult,fMinMult,fMaxMult); | |
1776 | fIntFlowCorrelationsAllVsMPro[1]->Sumw2(); | |
1777 | fIntFlowCorrelationsAllVsMPro[1]->GetXaxis()->SetTitle("M"); | |
1778 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[1]); | |
1779 | fIntFlowCorrelationsAllVsMPro[2] = new TProfile("two3n3n","#LT#LT2#GT#GT_{3n|3n}",fnBinsMult,fMinMult,fMaxMult); | |
1780 | fIntFlowCorrelationsAllVsMPro[2]->Sumw2(); | |
1781 | fIntFlowCorrelationsAllVsMPro[2]->GetXaxis()->SetTitle("M"); | |
1782 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[2]); | |
1783 | fIntFlowCorrelationsAllVsMPro[3] = new TProfile("two4n4n","#LT#LT2#GT#GT_{4n|4n}",fnBinsMult,fMinMult,fMaxMult); | |
1784 | fIntFlowCorrelationsAllVsMPro[3]->Sumw2(); | |
1785 | fIntFlowCorrelationsAllVsMPro[3]->GetXaxis()->SetTitle("M"); | |
1786 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[3]); | |
1787 | // 3-p correlations vs M: | |
1788 | fIntFlowCorrelationsAllVsMPro[5] = new TProfile("three2n1n1n","#LT#LT3#GT#GT_{2n|n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1789 | fIntFlowCorrelationsAllVsMPro[5]->Sumw2(); | |
1790 | fIntFlowCorrelationsAllVsMPro[5]->GetXaxis()->SetTitle("M"); | |
1791 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[5]); | |
1792 | fIntFlowCorrelationsAllVsMPro[6] = new TProfile("three3n2n1n","#LT#LT3#GT#GT_{3n|2n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1793 | fIntFlowCorrelationsAllVsMPro[6]->Sumw2(); | |
1794 | fIntFlowCorrelationsAllVsMPro[6]->GetXaxis()->SetTitle("M"); | |
1795 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[6]); | |
1796 | fIntFlowCorrelationsAllVsMPro[7] = new TProfile("three4n2n2n","#LT#LT3#GT#GT_{4n|2n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1797 | fIntFlowCorrelationsAllVsMPro[7]->Sumw2(); | |
1798 | fIntFlowCorrelationsAllVsMPro[7]->GetXaxis()->SetTitle("M"); | |
1799 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[7]); | |
1800 | fIntFlowCorrelationsAllVsMPro[8] = new TProfile("three4n3n1n","#LT#LT3#GT#GT_{4n|3n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1801 | fIntFlowCorrelationsAllVsMPro[8]->Sumw2(); | |
1802 | fIntFlowCorrelationsAllVsMPro[8]->GetXaxis()->SetTitle("M"); | |
1803 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[8]); | |
1804 | // 4-p correlations vs M: | |
1805 | fIntFlowCorrelationsAllVsMPro[10] = new TProfile("four1n1n1n1n","#LT#LT4#GT#GT_{n,n|n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1806 | fIntFlowCorrelationsAllVsMPro[10]->Sumw2(); | |
1807 | fIntFlowCorrelationsAllVsMPro[10]->GetXaxis()->SetTitle("M"); | |
1808 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[10]); | |
1809 | fIntFlowCorrelationsAllVsMPro[11] = new TProfile("four2n1n2n1n","#LT#LT4#GT#GT_{2n,n|2n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1810 | fIntFlowCorrelationsAllVsMPro[11]->Sumw2(); | |
1811 | fIntFlowCorrelationsAllVsMPro[11]->GetXaxis()->SetTitle("M"); | |
1812 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[11]); | |
1813 | fIntFlowCorrelationsAllVsMPro[12] = new TProfile("four2n2n2n2n","#LT#LT4#GT#GT_{2n,2n|2n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1814 | fIntFlowCorrelationsAllVsMPro[12]->Sumw2(); | |
1815 | fIntFlowCorrelationsAllVsMPro[12]->GetXaxis()->SetTitle("M"); | |
1816 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[12]); | |
1817 | fIntFlowCorrelationsAllVsMPro[13] = new TProfile("four3n1n1n1n","#LT#LT4#GT#GT_{3n|n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1818 | fIntFlowCorrelationsAllVsMPro[13]->Sumw2(); | |
1819 | fIntFlowCorrelationsAllVsMPro[13]->GetXaxis()->SetTitle("M"); | |
1820 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[13]); | |
1821 | fIntFlowCorrelationsAllVsMPro[14] = new TProfile("four3n1n3n1n","#LT#LT4#GT#GT_{3n,n|3n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1822 | fIntFlowCorrelationsAllVsMPro[14]->Sumw2(); | |
1823 | fIntFlowCorrelationsAllVsMPro[14]->GetXaxis()->SetTitle("M"); | |
1824 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[14]); | |
1825 | fIntFlowCorrelationsAllVsMPro[15] = new TProfile("four3n1n2n2n","#LT#LT4#GT#GT_{3n,n|2n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1826 | fIntFlowCorrelationsAllVsMPro[15]->Sumw2(); | |
1827 | fIntFlowCorrelationsAllVsMPro[15]->GetXaxis()->SetTitle("M"); | |
1828 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[15]); | |
1829 | fIntFlowCorrelationsAllVsMPro[16] = new TProfile("four4n2n1n1n","#LT#LT4#GT#GT_{4n|2n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1830 | fIntFlowCorrelationsAllVsMPro[16]->Sumw2(); | |
1831 | fIntFlowCorrelationsAllVsMPro[16]->GetXaxis()->SetTitle("M"); | |
1832 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[16]); | |
1833 | // 5-p correlations vs M: | |
403e3389 | 1834 | fIntFlowCorrelationsAllVsMPro[18] = new TProfile("five2n1n1n1n1n","#LT#LT5#GT#GT_{2n,n|n,n,n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1835 | fIntFlowCorrelationsAllVsMPro[18]->Sumw2(); |
1836 | fIntFlowCorrelationsAllVsMPro[18]->GetXaxis()->SetTitle("M"); | |
1837 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[18]); | |
1838 | fIntFlowCorrelationsAllVsMPro[19] = new TProfile("five2n2n2n1n1n","#LT#LT5#GT#GT_{2n,2n|2n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1839 | fIntFlowCorrelationsAllVsMPro[19]->Sumw2(); | |
1840 | fIntFlowCorrelationsAllVsMPro[19]->GetXaxis()->SetTitle("M"); | |
1841 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[19]); | |
1842 | fIntFlowCorrelationsAllVsMPro[20] = new TProfile("five3n1n2n1n1n","#LT#LT5#GT#GT_{3n,n|2n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1843 | fIntFlowCorrelationsAllVsMPro[20]->Sumw2(); | |
1844 | fIntFlowCorrelationsAllVsMPro[20]->GetXaxis()->SetTitle("M"); | |
1845 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[20]); | |
1846 | fIntFlowCorrelationsAllVsMPro[21] = new TProfile("five4n1n1n1n1n","#LT#LT5#GT#GT_{4n|n,n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1847 | fIntFlowCorrelationsAllVsMPro[21]->Sumw2(); | |
1848 | fIntFlowCorrelationsAllVsMPro[21]->GetXaxis()->SetTitle("M"); | |
1849 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[21]); | |
1850 | // 6-p correlations vs M: | |
1851 | fIntFlowCorrelationsAllVsMPro[23] = new TProfile("six1n1n1n1n1n1n","#LT#LT6#GT#GT_{n,n,n|n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1852 | fIntFlowCorrelationsAllVsMPro[23]->Sumw2(); | |
1853 | fIntFlowCorrelationsAllVsMPro[23]->GetXaxis()->SetTitle("M"); | |
1854 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[23]); | |
1855 | fIntFlowCorrelationsAllVsMPro[24] = new TProfile("six2n1n1n2n1n1n","#LT#LT6#GT#GT_{2n,n,n|2n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1856 | fIntFlowCorrelationsAllVsMPro[24]->Sumw2(); | |
1857 | fIntFlowCorrelationsAllVsMPro[24]->GetXaxis()->SetTitle("M"); | |
1858 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[24]); | |
1859 | fIntFlowCorrelationsAllVsMPro[25] = new TProfile("six2n2n1n1n1n1n","#LT#LT6#GT#GT_{2n,2n|n,n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1860 | fIntFlowCorrelationsAllVsMPro[25]->Sumw2(); | |
1861 | fIntFlowCorrelationsAllVsMPro[25]->GetXaxis()->SetTitle("M"); | |
1862 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[25]); | |
1863 | fIntFlowCorrelationsAllVsMPro[26] = new TProfile("six3n1n1n1n1n1n","#LT#LT6#GT#GT_{3n,n|n,n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1864 | fIntFlowCorrelationsAllVsMPro[26]->Sumw2(); | |
1865 | fIntFlowCorrelationsAllVsMPro[26]->GetXaxis()->SetTitle("M"); | |
1866 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[26]); | |
1867 | // 7-p correlations vs M: | |
1868 | fIntFlowCorrelationsAllVsMPro[28] = new TProfile("seven2n1n1n1n1n1n1n","#LT#LT7#GT#GT_{2n,n,n|n,n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1869 | fIntFlowCorrelationsAllVsMPro[28]->Sumw2(); | |
1870 | fIntFlowCorrelationsAllVsMPro[28]->GetXaxis()->SetTitle("M"); | |
1871 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[28]); | |
1872 | // 8-p correlations vs M: | |
1873 | fIntFlowCorrelationsAllVsMPro[30] = new TProfile("eight1n1n1n1n1n1n1n1n","#LT#LT8#GT#GT_{n,n,n,n|n,n,n,n}",fnBinsMult,fMinMult,fMaxMult); | |
1874 | fIntFlowCorrelationsAllVsMPro[30]->Sumw2(); | |
1875 | fIntFlowCorrelationsAllVsMPro[30]->GetXaxis()->SetTitle("M"); | |
1876 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[30]); | |
b84464d3 | 1877 | // EXTRA correlations vs M for v3{5} study (to be improved - put them in a right order somewhere): |
3435cacb | 1878 | fIntFlowCorrelationsAllVsMPro[32] = new TProfile("four4n2n3n3n","#LT#LT4#GT#GT_{4n,2n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); |
1879 | fIntFlowCorrelationsAllVsMPro[32]->Sumw2(); | |
1880 | fIntFlowCorrelationsAllVsMPro[32]->GetXaxis()->SetTitle("M"); | |
1881 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[32]); | |
b84464d3 | 1882 | fIntFlowCorrelationsAllVsMPro[33] = new TProfile("five3n3n2n2n2n","#LT#LT5#GT#GT_{3n,3n|2n,2n,2n}",fnBinsMult,fMinMult,fMaxMult); |
3435cacb | 1883 | fIntFlowCorrelationsAllVsMPro[33]->Sumw2(); |
1884 | fIntFlowCorrelationsAllVsMPro[33]->GetXaxis()->SetTitle("M"); | |
1885 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[33]); | |
b84464d3 | 1886 | // EXTRA correlations vs M for Teaney-Yan study (to be improved - put them in a right order somewhere): |
1887 | fIntFlowCorrelationsAllVsMPro[34] = new TProfile("two5n5n","#LT#LT2#GT#GT_{5n|5n}",fnBinsMult,fMinMult,fMaxMult); | |
1888 | fIntFlowCorrelationsAllVsMPro[34]->Sumw2(); | |
1889 | fIntFlowCorrelationsAllVsMPro[34]->GetXaxis()->SetTitle("M"); | |
1890 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[34]); | |
1891 | fIntFlowCorrelationsAllVsMPro[35] = new TProfile("two6n6n","#LT#LT2#GT#GT_{6n|6n}",fnBinsMult,fMinMult,fMaxMult); | |
1892 | fIntFlowCorrelationsAllVsMPro[35]->Sumw2(); | |
1893 | fIntFlowCorrelationsAllVsMPro[35]->GetXaxis()->SetTitle("M"); | |
1894 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[35]); | |
1895 | fIntFlowCorrelationsAllVsMPro[36] = new TProfile("three5n3n2n","#LT#LT3#GT#GT_{5n|3n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1896 | fIntFlowCorrelationsAllVsMPro[36]->Sumw2(); | |
1897 | fIntFlowCorrelationsAllVsMPro[36]->GetXaxis()->SetTitle("M"); | |
1898 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[36]); | |
1899 | fIntFlowCorrelationsAllVsMPro[37] = new TProfile("three5n4n1n","#LT#LT3#GT#GT_{5n|4n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1900 | fIntFlowCorrelationsAllVsMPro[37]->Sumw2(); | |
1901 | fIntFlowCorrelationsAllVsMPro[37]->GetXaxis()->SetTitle("M"); | |
1902 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[37]); | |
1903 | fIntFlowCorrelationsAllVsMPro[38] = new TProfile("three6n3n3n","#LT#LT3#GT#GT_{6n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); | |
1904 | fIntFlowCorrelationsAllVsMPro[38]->Sumw2(); | |
1905 | fIntFlowCorrelationsAllVsMPro[38]->GetXaxis()->SetTitle("M"); | |
1906 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[38]); | |
1907 | fIntFlowCorrelationsAllVsMPro[39] = new TProfile("three6n4n2n","#LT#LT3#GT#GT_{6n|4n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1908 | fIntFlowCorrelationsAllVsMPro[39]->Sumw2(); | |
1909 | fIntFlowCorrelationsAllVsMPro[39]->GetXaxis()->SetTitle("M"); | |
1910 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[39]); | |
1911 | fIntFlowCorrelationsAllVsMPro[40] = new TProfile("three6n5n1n","#LT#LT3#GT#GT_{6n|5n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1912 | fIntFlowCorrelationsAllVsMPro[40]->Sumw2(); | |
1913 | fIntFlowCorrelationsAllVsMPro[40]->GetXaxis()->SetTitle("M"); | |
1914 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[40]); | |
1915 | fIntFlowCorrelationsAllVsMPro[41] = new TProfile("four6n3n2n1n","#LT#LT4#GT#GT_{6n|3n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1916 | fIntFlowCorrelationsAllVsMPro[41]->Sumw2(); | |
1917 | fIntFlowCorrelationsAllVsMPro[41]->GetXaxis()->SetTitle("M"); | |
1918 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[41]); | |
1919 | fIntFlowCorrelationsAllVsMPro[42] = new TProfile("four3n2n3n2n","#LT#LT4#GT#GT_{3n,2n|3n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1920 | fIntFlowCorrelationsAllVsMPro[42]->Sumw2(); | |
1921 | fIntFlowCorrelationsAllVsMPro[42]->GetXaxis()->SetTitle("M"); | |
1922 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[42]); | |
1923 | fIntFlowCorrelationsAllVsMPro[43] = new TProfile("four4n1n3n2n","#LT#LT4#GT#GT_{4n,1n|3n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1924 | fIntFlowCorrelationsAllVsMPro[43]->Sumw2(); | |
1925 | fIntFlowCorrelationsAllVsMPro[43]->GetXaxis()->SetTitle("M"); | |
1926 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[43]); | |
1927 | fIntFlowCorrelationsAllVsMPro[44] = new TProfile("four3n3n3n3n","#LT#LT4#GT#GT_{3n,3n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); | |
1928 | fIntFlowCorrelationsAllVsMPro[44]->Sumw2(); | |
1929 | fIntFlowCorrelationsAllVsMPro[44]->GetXaxis()->SetTitle("M"); | |
1930 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[44]); | |
1931 | fIntFlowCorrelationsAllVsMPro[45] = new TProfile("four4n2n3n3n","#LT#LT4#GT#GT_{4n,2n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); | |
1932 | fIntFlowCorrelationsAllVsMPro[45]->Sumw2(); | |
1933 | fIntFlowCorrelationsAllVsMPro[45]->GetXaxis()->SetTitle("M"); | |
1934 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[45]); | |
1935 | fIntFlowCorrelationsAllVsMPro[46] = new TProfile("four5n1n3n3n","#LT#LT4#GT#GT_{5n,1n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); | |
1936 | fIntFlowCorrelationsAllVsMPro[46]->Sumw2(); | |
1937 | fIntFlowCorrelationsAllVsMPro[46]->GetXaxis()->SetTitle("M"); | |
1938 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[46]); | |
1939 | fIntFlowCorrelationsAllVsMPro[47] = new TProfile("four4n2n4n2n","#LT#LT4#GT#GT_{4n,2n|4n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1940 | fIntFlowCorrelationsAllVsMPro[47]->Sumw2(); | |
1941 | fIntFlowCorrelationsAllVsMPro[47]->GetXaxis()->SetTitle("M"); | |
1942 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[47]); | |
1943 | fIntFlowCorrelationsAllVsMPro[48] = new TProfile("four5n1n4n2n","#LT#LT4#GT#GT_{5n,1n|4n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1944 | fIntFlowCorrelationsAllVsMPro[48]->Sumw2(); | |
1945 | fIntFlowCorrelationsAllVsMPro[48]->GetXaxis()->SetTitle("M"); | |
1946 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[48]); | |
1947 | fIntFlowCorrelationsAllVsMPro[49] = new TProfile("four5n3n1n1n","#LT#LT4#GT#GT_{5n|3n,1n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1948 | fIntFlowCorrelationsAllVsMPro[49]->Sumw2(); | |
1949 | fIntFlowCorrelationsAllVsMPro[49]->GetXaxis()->SetTitle("M"); | |
1950 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[49]); | |
1951 | fIntFlowCorrelationsAllVsMPro[50] = new TProfile("four5n2n2n1n","#LT#LT4#GT#GT_{5n|2n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1952 | fIntFlowCorrelationsAllVsMPro[50]->Sumw2(); | |
1953 | fIntFlowCorrelationsAllVsMPro[50]->GetXaxis()->SetTitle("M"); | |
1954 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[50]); | |
1955 | fIntFlowCorrelationsAllVsMPro[51] = new TProfile("four5n1n5n1n","#LT#LT4#GT#GT_{5n,1n|5n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1956 | fIntFlowCorrelationsAllVsMPro[51]->Sumw2(); | |
1957 | fIntFlowCorrelationsAllVsMPro[51]->GetXaxis()->SetTitle("M"); | |
1958 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[51]); | |
1959 | fIntFlowCorrelationsAllVsMPro[52] = new TProfile("five3n3n3n2n1n","#LT#LT5#GT#GT_{3n,3n|3n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1960 | fIntFlowCorrelationsAllVsMPro[52]->Sumw2(); | |
1961 | fIntFlowCorrelationsAllVsMPro[52]->GetXaxis()->SetTitle("M"); | |
1962 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[52]); | |
1963 | fIntFlowCorrelationsAllVsMPro[53] = new TProfile("five4n2n3n2n1n","#LT#LT5#GT#GT_{4n,2n|3n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1964 | fIntFlowCorrelationsAllVsMPro[53]->Sumw2(); | |
1965 | fIntFlowCorrelationsAllVsMPro[53]->GetXaxis()->SetTitle("M"); | |
1966 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[53]); | |
1967 | fIntFlowCorrelationsAllVsMPro[54] = new TProfile("five3n2n3n1n1n","#LT#LT5#GT#GT_{3n,2n|3n,1n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1968 | fIntFlowCorrelationsAllVsMPro[54]->Sumw2(); | |
1969 | fIntFlowCorrelationsAllVsMPro[54]->GetXaxis()->SetTitle("M"); | |
1970 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[54]); | |
1971 | fIntFlowCorrelationsAllVsMPro[55] = new TProfile("five3n2n2n2n1n","#LT#LT5#GT#GT_{3n,2n|2n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1972 | fIntFlowCorrelationsAllVsMPro[55]->Sumw2(); | |
1973 | fIntFlowCorrelationsAllVsMPro[55]->GetXaxis()->SetTitle("M"); | |
1974 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[55]); | |
1975 | fIntFlowCorrelationsAllVsMPro[56] = new TProfile("five5n1n3n2n1n","#LT#LT5#GT#GT_{5n,1n|3n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1976 | fIntFlowCorrelationsAllVsMPro[56]->Sumw2(); | |
1977 | fIntFlowCorrelationsAllVsMPro[56]->GetXaxis()->SetTitle("M"); | |
1978 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[56]); | |
1979 | fIntFlowCorrelationsAllVsMPro[57] = new TProfile("six3n2n1n3n2n1n","#LT#LT6#GT#GT_{3n,2n,1n|3n,2n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1980 | fIntFlowCorrelationsAllVsMPro[57]->Sumw2(); | |
1981 | fIntFlowCorrelationsAllVsMPro[57]->GetXaxis()->SetTitle("M"); | |
403e3389 | 1982 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[57]); |
1983 | fIntFlowCorrelationsAllVsMPro[58] = new TProfile("four6n4n1n1n","#LT#LT4#GT#GT_{6n|4n,1n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1984 | fIntFlowCorrelationsAllVsMPro[58]->Sumw2(); | |
1985 | fIntFlowCorrelationsAllVsMPro[58]->GetXaxis()->SetTitle("M"); | |
1986 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[58]); | |
1987 | fIntFlowCorrelationsAllVsMPro[59] = new TProfile("four6n2n2n2n","#LT#LT4#GT#GT_{6n|2n,2n,2n}",fnBinsMult,fMinMult,fMaxMult); | |
1988 | fIntFlowCorrelationsAllVsMPro[59]->Sumw2(); | |
1989 | fIntFlowCorrelationsAllVsMPro[59]->GetXaxis()->SetTitle("M"); | |
1990 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[59]); | |
1991 | fIntFlowCorrelationsAllVsMPro[60] = new TProfile("five6n2n2n1n1n","#LT#LT5#GT#GT_{6n|2n,2n,1n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
1992 | fIntFlowCorrelationsAllVsMPro[60]->Sumw2(); | |
1993 | fIntFlowCorrelationsAllVsMPro[60]->GetXaxis()->SetTitle("M"); | |
1994 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[60]); | |
1995 | fIntFlowCorrelationsAllVsMPro[61] = new TProfile("five4n1n1n3n3n","#LT#LT5#GT#GT_{4n,1n,1n|3n,3n}",fnBinsMult,fMinMult,fMaxMult); | |
1996 | fIntFlowCorrelationsAllVsMPro[61]->Sumw2(); | |
1997 | fIntFlowCorrelationsAllVsMPro[61]->GetXaxis()->SetTitle("M"); | |
1998 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[61]); | |
1999 | fIntFlowCorrelationsAllVsMPro[62] = new TProfile("six3n3n2n2n1n1n","#LT#LT6#GT#GT_{3n,3n|2n,2n,1n,1n}",fnBinsMult,fMinMult,fMaxMult); | |
2000 | fIntFlowCorrelationsAllVsMPro[62]->Sumw2(); | |
2001 | fIntFlowCorrelationsAllVsMPro[62]->GetXaxis()->SetTitle("M"); | |
2002 | fIntFlowAllCorrelationsVsM->Add(fIntFlowCorrelationsAllVsMPro[62]); | |
3435cacb | 2003 | } // end of if(fCalculateAllCorrelationsVsM) |
489d5531 | 2004 | // when particle weights are used some extra correlations appear: |
403e3389 | 2005 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 2006 | { |
2007 | TString intFlowExtraCorrelationsProName = "fIntFlowExtraCorrelationsPro"; | |
2008 | intFlowExtraCorrelationsProName += fAnalysisLabel->Data(); | |
2009 | fIntFlowExtraCorrelationsPro = new TProfile(intFlowExtraCorrelationsProName.Data(),"Average extra correlations for all events",100,0,100,"s"); | |
2010 | fIntFlowExtraCorrelationsPro->SetTickLength(-0.01,"Y"); | |
2011 | fIntFlowExtraCorrelationsPro->SetMarkerStyle(25); | |
2012 | fIntFlowExtraCorrelationsPro->SetLabelSize(0.03); | |
2013 | fIntFlowExtraCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
2014 | // extra 2-p correlations: | |
2015 | (fIntFlowExtraCorrelationsPro->GetXaxis())->SetBinLabel(1,"<<w1^3 w2 cos(n*(phi1-phi2))>>"); | |
2016 | (fIntFlowExtraCorrelationsPro->GetXaxis())->SetBinLabel(2,"<<w1 w2 w3^2 cos(n*(phi1-phi2))>>"); | |
2017 | fIntFlowProfiles->Add(fIntFlowExtraCorrelationsPro); | |
403e3389 | 2018 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 2019 | // average product of correlations <2>, <4>, <6> and <8>: |
403e3389 | 2020 | TString productFlag[6] = {"#LT#LT2#GT#LT4#GT#GT","#LT#LT2#GT#LT6#GT#GT","#LT#LT2#GT#LT8#GT#GT", |
2021 | "#LT#LT4#GT#LT6#GT#GT","#LT#LT4#GT#LT8#GT#GT","#LT#LT6#GT#LT8#GT#GT"}; | |
489d5531 | 2022 | TString intFlowProductOfCorrelationsProName = "fIntFlowProductOfCorrelationsPro"; |
2023 | intFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
2024 | fIntFlowProductOfCorrelationsPro = new TProfile(intFlowProductOfCorrelationsProName.Data(),"Average products of correlations",6,0,6); | |
2025 | fIntFlowProductOfCorrelationsPro->SetTickLength(-0.01,"Y"); | |
2026 | fIntFlowProductOfCorrelationsPro->SetMarkerStyle(25); | |
2027 | fIntFlowProductOfCorrelationsPro->SetLabelSize(0.05); | |
2028 | fIntFlowProductOfCorrelationsPro->SetLabelOffset(0.01,"Y"); | |
68a3b4b1 | 2029 | for(Int_t b=0;b<6;b++) |
b3dacf6b | 2030 | { |
68a3b4b1 | 2031 | (fIntFlowProductOfCorrelationsPro->GetXaxis())->SetBinLabel(b+1,productFlag[b].Data()); |
b3dacf6b | 2032 | } |
2033 | fIntFlowProfiles->Add(fIntFlowProductOfCorrelationsPro); | |
ff70ca91 | 2034 | // average product of correlations <2>, <4>, <6> and <8> versus multiplicity |
2035 | // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>] | |
b3dacf6b | 2036 | if(fCalculateCumulantsVsM) |
2037 | { | |
2038 | TString intFlowProductOfCorrelationsVsMProName = "fIntFlowProductOfCorrelationsVsMPro"; | |
2039 | intFlowProductOfCorrelationsVsMProName += fAnalysisLabel->Data(); | |
2040 | for(Int_t pi=0;pi<6;pi++) | |
2041 | { | |
2042 | fIntFlowProductOfCorrelationsVsMPro[pi] = new TProfile(Form("%s, %s",intFlowProductOfCorrelationsVsMProName.Data(),productFlag[pi].Data()), | |
2043 | Form("%s versus multiplicity",productFlag[pi].Data()), | |
2044 | fnBinsMult,fMinMult,fMaxMult); | |
2045 | fIntFlowProductOfCorrelationsVsMPro[pi]->GetXaxis()->SetTitle("M"); | |
2046 | fIntFlowProfiles->Add(fIntFlowProductOfCorrelationsVsMPro[pi]); | |
2047 | } // end of for(Int_t pi=0;pi<6;pi++) | |
2048 | } // end of if(fCalculateCumulantsVsM) | |
0328db2d | 2049 | // average product of correction terms for NUA: |
2050 | TString intFlowProductOfCorrectionTermsForNUAProName = "fIntFlowProductOfCorrectionTermsForNUAPro"; | |
2051 | intFlowProductOfCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
2052 | fIntFlowProductOfCorrectionTermsForNUAPro = new TProfile(intFlowProductOfCorrectionTermsForNUAProName.Data(),"Average products of correction terms for NUA",27,0,27); | |
2053 | fIntFlowProductOfCorrectionTermsForNUAPro->SetTickLength(-0.01,"Y"); | |
2054 | fIntFlowProductOfCorrectionTermsForNUAPro->SetMarkerStyle(25); | |
403e3389 | 2055 | fIntFlowProductOfCorrectionTermsForNUAPro->SetLabelSize(0.03); |
0328db2d | 2056 | fIntFlowProductOfCorrectionTermsForNUAPro->SetLabelOffset(0.01,"Y"); |
2057 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(1,"<<2><cos(#phi)>>"); | |
2058 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(2,"<<2><sin(#phi)>>"); | |
2059 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(3,"<<cos(#phi)><sin(#phi)>>"); | |
2060 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(4,"Cov(<2>,<cos(#phi_{1}+#phi_{2})>)"); | |
2061 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(5,"Cov(<2>,<sin(#phi_{1}+#phi_{2})>)"); | |
2062 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(6,"Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2063 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(7,"Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2064 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(8,"Cov(<4>,<cos(#phi)>)"); | |
2065 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(9,"Cov(<4>,<sin(#phi)>)"); | |
2066 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(10,"Cov(<4>,<cos(#phi_{1}+#phi_{2})>)"); | |
2067 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(11,"Cov(<4>,<sin(#phi_{1}+#phi_{2})>)"); | |
2068 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(12,"Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
2069 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(13,"Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
2070 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(14,"Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
2071 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(15,"Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
2072 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(16,"Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2073 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(17,"Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2074 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(18,"Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
2075 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(19,"Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
2076 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(20,"Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2077 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(21,"Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2078 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(22,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>)"); | |
2079 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(23,"Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2080 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(24,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2081 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(25,"Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2082 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(26,"Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2083 | (fIntFlowProductOfCorrectionTermsForNUAPro->GetXaxis())->SetBinLabel(27,"Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>)"); | |
2084 | fIntFlowProfiles->Add(fIntFlowProductOfCorrectionTermsForNUAPro); | |
489d5531 | 2085 | // average correction terms for non-uniform acceptance (with wrong errors!): |
2086 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2087 | { | |
2088 | TString intFlowCorrectionTermsForNUAProName = "fIntFlowCorrectionTermsForNUAPro"; | |
2089 | intFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
b92ea2b9 | 2090 | fIntFlowCorrectionTermsForNUAPro[sc] = new TProfile(Form("%s: %s terms",intFlowCorrectionTermsForNUAProName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4,"s"); |
489d5531 | 2091 | fIntFlowCorrectionTermsForNUAPro[sc]->SetTickLength(-0.01,"Y"); |
2092 | fIntFlowCorrectionTermsForNUAPro[sc]->SetMarkerStyle(25); | |
403e3389 | 2093 | fIntFlowCorrectionTermsForNUAPro[sc]->SetLabelSize(0.05); |
489d5531 | 2094 | fIntFlowCorrectionTermsForNUAPro[sc]->SetLabelOffset(0.01,"Y"); |
403e3389 | 2095 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(1,Form("#LT#LT%s(n(#phi_{1}))#GT#GT",sinCosFlag[sc].Data())); |
2096 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(2,Form("#LT#LT%s(n(#phi_{1}+#phi_{2}))#GT#GT",sinCosFlag[sc].Data())); | |
2097 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(3,Form("#LT#LT%s(n(#phi_{1}-#phi_{2}-#phi_{3}))#GT#GT",sinCosFlag[sc].Data())); | |
2098 | (fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->SetBinLabel(4,Form("#LT#LT%s(n(2#phi_{1}-#phi_{2}))#GT#GT",sinCosFlag[sc].Data())); | |
489d5531 | 2099 | fIntFlowProfiles->Add(fIntFlowCorrectionTermsForNUAPro[sc]); |
2001bc3a | 2100 | // versus multiplicity: |
b3dacf6b | 2101 | if(fCalculateCumulantsVsM) |
2102 | { | |
2103 | TString correctionTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4 | |
2104 | for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) | |
2105 | { | |
2106 | TString intFlowCorrectionTermsForNUAVsMProName = "fIntFlowCorrectionTermsForNUAVsMPro"; | |
2107 | intFlowCorrectionTermsForNUAVsMProName += fAnalysisLabel->Data(); | |
2108 | fIntFlowCorrectionTermsForNUAVsMPro[sc][ci] = new TProfile(Form("%s: #LT#LT%s%s#GT#GT",intFlowCorrectionTermsForNUAVsMProName.Data(),sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()),Form("#LT#LT%s%s#GT#GT vs M",sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()),fnBinsMult,fMinMult,fMaxMult,"s"); | |
2109 | fIntFlowProfiles->Add(fIntFlowCorrectionTermsForNUAVsMPro[sc][ci]); | |
2110 | } | |
2111 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 2112 | } // end of for(Int_t sc=0;sc<2;sc++) |
2113 | ||
2114 | // d) Book histograms holding the final results: | |
2115 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with correct errors!): | |
2116 | TString intFlowCorrelationsHistName = "fIntFlowCorrelationsHist"; | |
2117 | intFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
2118 | fIntFlowCorrelationsHist = new TH1D(intFlowCorrelationsHistName.Data(),"Average correlations for all events",4,0,4); | |
2119 | fIntFlowCorrelationsHist->SetTickLength(-0.01,"Y"); | |
2120 | fIntFlowCorrelationsHist->SetMarkerStyle(25); | |
2121 | fIntFlowCorrelationsHist->SetLabelSize(0.06); | |
2122 | fIntFlowCorrelationsHist->SetLabelOffset(0.01,"Y"); | |
403e3389 | 2123 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(1,"#LT#LT2#GT#GT"); |
2124 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(2,"#LT#LT4#GT#GT"); | |
2125 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(3,"#LT#LT6#GT#GT"); | |
2126 | (fIntFlowCorrelationsHist->GetXaxis())->SetBinLabel(4,"#LT#LT8#GT#GT"); | |
489d5531 | 2127 | fIntFlowResults->Add(fIntFlowCorrelationsHist); |
ff70ca91 | 2128 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> for all events (with correct errors!) vs M: |
b3dacf6b | 2129 | if(fCalculateCumulantsVsM) |
2130 | { | |
2131 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2132 | { | |
2133 | TString intFlowCorrelationsVsMHistName = "fIntFlowCorrelationsVsMHist"; | |
2134 | intFlowCorrelationsVsMHistName += fAnalysisLabel->Data(); | |
2135 | fIntFlowCorrelationsVsMHist[ci] = new TH1D(Form("%s, %s",intFlowCorrelationsVsMHistName.Data(),correlationFlag[ci].Data()), | |
2136 | Form("%s vs multiplicity",correlationFlag[ci].Data()), | |
2137 | fnBinsMult,fMinMult,fMaxMult); | |
2138 | fIntFlowCorrelationsVsMHist[ci]->GetYaxis()->SetTitle(correlationFlag[ci].Data()); | |
2139 | fIntFlowCorrelationsVsMHist[ci]->GetXaxis()->SetTitle("M"); | |
2140 | fIntFlowResults->Add(fIntFlowCorrelationsVsMHist[ci]); | |
2141 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
2142 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 2143 | // average all correlations for all events (with correct errors!): |
2144 | TString intFlowCorrelationsAllHistName = "fIntFlowCorrelationsAllHist"; | |
2145 | intFlowCorrelationsAllHistName += fAnalysisLabel->Data(); | |
8ed4edc7 | 2146 | fIntFlowCorrelationsAllHist = new TH1D(intFlowCorrelationsAllHistName.Data(),"Average correlations for all events",34,0,34); |
489d5531 | 2147 | fIntFlowCorrelationsAllHist->SetTickLength(-0.01,"Y"); |
2148 | fIntFlowCorrelationsAllHist->SetMarkerStyle(25); | |
2149 | fIntFlowCorrelationsAllHist->SetLabelSize(0.03); | |
2150 | fIntFlowCorrelationsAllHist->SetLabelOffset(0.01,"Y"); | |
2151 | // 2-p correlations: | |
2152 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(1,"<<2>>_{n|n}"); | |
2153 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(2,"<<2>>_{2n|2n}"); | |
2154 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(3,"<<2>>_{3n|3n}"); | |
2155 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(4,"<<2>>_{4n|4n}"); | |
2156 | // 3-p correlations: | |
2157 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(6,"<<3>>_{2n|n,n}"); | |
2158 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(7,"<<3>>_{3n|2n,n}"); | |
2159 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(8,"<<3>>_{4n|2n,2n}"); | |
2160 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(9,"<<3>>_{4n|3n,n}"); | |
2161 | // 4-p correlations: | |
2162 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(11,"<<4>>_{n,n|n,n}"); | |
2163 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(12,"<<4>>_{2n,n|2n,n}"); | |
2164 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(13,"<<4>>_{2n,2n|2n,2n}"); | |
2165 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(14,"<<4>>_{3n|n,n,n}"); | |
2166 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(15,"<<4>>_{3n,n|3n,n}"); | |
2167 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(16,"<<4>>_{3n,n|2n,2n}"); | |
2168 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(17,"<<4>>_{4n|2n,n,n}"); | |
2169 | // 5-p correlations: | |
2170 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(19,"<<5>>_{2n|n,n,n,n}"); | |
2171 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(20,"<<5>>_{2n,2n|2n,n,n}"); | |
2172 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(21,"<<5>>_{3n,n|2n,n,n}"); | |
2173 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(22,"<<5>>_{4n|n,n,n,n}"); | |
2174 | // 6-p correlations: | |
2175 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(24,"<<6>>_{n,n,n|n,n,n}"); | |
2176 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(25,"<<6>>_{2n,n,n|2n,n,n}"); | |
2177 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(26,"<<6>>_{2n,2n|n,n,n,n}"); | |
2178 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(27,"<<6>>_{3n,n|n,n,n,n}"); | |
2179 | // 7-p correlations: | |
2180 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(29,"<<7>>_{2n,n,n|n,n,n,n}"); | |
2181 | // 8-p correlations: | |
2182 | (fIntFlowCorrelationsAllHist->GetXaxis())->SetBinLabel(31,"<<8>>_{n,n,n,n|n,n,n,n}"); | |
2183 | fIntFlowResults->Add(fIntFlowCorrelationsAllHist); | |
2184 | // average correction terms for non-uniform acceptance (with correct errors!): | |
2185 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2186 | { | |
2187 | TString intFlowCorrectionTermsForNUAHistName = "fIntFlowCorrectionTermsForNUAHist"; | |
2188 | intFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
b92ea2b9 | 2189 | fIntFlowCorrectionTermsForNUAHist[sc] = new TH1D(Form("%s: %s terms",intFlowCorrectionTermsForNUAHistName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),4,0,4); |
489d5531 | 2190 | fIntFlowCorrectionTermsForNUAHist[sc]->SetTickLength(-0.01,"Y"); |
2191 | fIntFlowCorrectionTermsForNUAHist[sc]->SetMarkerStyle(25); | |
403e3389 | 2192 | fIntFlowCorrectionTermsForNUAHist[sc]->SetLabelSize(0.05); |
489d5531 | 2193 | fIntFlowCorrectionTermsForNUAHist[sc]->SetLabelOffset(0.01,"Y"); |
b92ea2b9 | 2194 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(1,Form("#LT#LT%s(n(#phi_{1}))#GT#GT",sinCosFlag[sc].Data())); |
403e3389 | 2195 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(2,Form("#LT#LT%s(n(#phi_{1}+#phi_{2}))#GT#GT",sinCosFlag[sc].Data())); |
2196 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(3,Form("#LT#LT%s(n(#phi_{1}-#phi_{2}-#phi_{3}))#GT#GT",sinCosFlag[sc].Data())); | |
2197 | (fIntFlowCorrectionTermsForNUAHist[sc]->GetXaxis())->SetBinLabel(4,Form("#LT#LT%s(n(2#phi_{1}-#phi_{2}))#GT#GT",sinCosFlag[sc].Data())); | |
489d5531 | 2198 | fIntFlowResults->Add(fIntFlowCorrectionTermsForNUAHist[sc]); |
2199 | } // end of for(Int_t sc=0;sc<2;sc++) | |
2200 | // covariances (multiplied with weight dependent prefactor): | |
2201 | TString intFlowCovariancesName = "fIntFlowCovariances"; | |
2202 | intFlowCovariancesName += fAnalysisLabel->Data(); | |
2203 | fIntFlowCovariances = new TH1D(intFlowCovariancesName.Data(),"Covariances (multiplied with weight dependent prefactor)",6,0,6); | |
2204 | fIntFlowCovariances->SetLabelSize(0.04); | |
2205 | fIntFlowCovariances->SetMarkerStyle(25); | |
403e3389 | 2206 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(1,"Cov(#LT2#GT,#LT4#GT)"); |
2207 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(2,"Cov(#LT2#GT,#LT6#GT)"); | |
2208 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(3,"Cov(#LT2#GT,#LT8#GT)"); | |
2209 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(4,"Cov(#LT4#GT,#LT6#GT)"); | |
2210 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(5,"Cov(#LT4#GT,#LT8#GT)"); | |
2211 | (fIntFlowCovariances->GetXaxis())->SetBinLabel(6,"Cov(#LT6#GT,#LT8#GT)"); | |
489d5531 | 2212 | fIntFlowResults->Add(fIntFlowCovariances); |
2213 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8>: | |
2214 | TString intFlowSumOfEventWeightsName = "fIntFlowSumOfEventWeights"; | |
2215 | intFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
2216 | for(Int_t power=0;power<2;power++) | |
2217 | { | |
2218 | fIntFlowSumOfEventWeights[power] = new TH1D(Form("%s: %s",intFlowSumOfEventWeightsName.Data(),powerFlag[power].Data()),Form("Sum of %s event weights for correlations",powerFlag[power].Data()),4,0,4); | |
403e3389 | 2219 | fIntFlowSumOfEventWeights[power]->SetLabelSize(0.04); |
489d5531 | 2220 | fIntFlowSumOfEventWeights[power]->SetMarkerStyle(25); |
2221 | if(power == 0) | |
2222 | { | |
403e3389 | 2223 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{#LT2#GT}"); |
2224 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{#LT4#GT}"); | |
2225 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{#LT6#GT}"); | |
2226 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{#LT8#GT}"); | |
489d5531 | 2227 | } else if (power == 1) |
2228 | { | |
403e3389 | 2229 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{#LT2#GT}^{2}"); |
2230 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{#LT4#GT}^{2}"); | |
2231 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{#LT6#GT}^{2}"); | |
2232 | (fIntFlowSumOfEventWeights[power]->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{#LT8#GT}^{2}"); | |
489d5531 | 2233 | } |
2234 | fIntFlowResults->Add(fIntFlowSumOfEventWeights[power]); | |
2235 | } | |
2236 | // sum of products of event weights for correlations <2>, <4>, <6> and <8>: | |
2237 | TString intFlowSumOfProductOfEventWeightsName = "fIntFlowSumOfProductOfEventWeights"; | |
2238 | intFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
2239 | fIntFlowSumOfProductOfEventWeights = new TH1D(intFlowSumOfProductOfEventWeightsName.Data(),"Sum of product of event weights for correlations",6,0,6); | |
403e3389 | 2240 | fIntFlowSumOfProductOfEventWeights->SetLabelSize(0.04); |
489d5531 | 2241 | fIntFlowSumOfProductOfEventWeights->SetMarkerStyle(25); |
403e3389 | 2242 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LT4#GT}"); |
2243 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LT6#GT}"); | |
2244 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LT8#GT}"); | |
2245 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LT6#GT}"); | |
2246 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(5,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LT8#GT}"); | |
2247 | (fIntFlowSumOfProductOfEventWeights->GetXaxis())->SetBinLabel(6,"#sum_{i=1}^{N} w_{#LT6#GT} w_{#LT8#GT}"); | |
489d5531 | 2248 | fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeights); |
ff70ca91 | 2249 | // final result for covariances of correlations (multiplied with weight dependent prefactor) versus M |
2250 | // [0=Cov(2,4),1=Cov(2,6),2=Cov(2,8),3=Cov(4,6),4=Cov(4,8),5=Cov(6,8)]: | |
b3dacf6b | 2251 | if(fCalculateCumulantsVsM) |
ff70ca91 | 2252 | { |
b3dacf6b | 2253 | TString intFlowCovariancesVsMName = "fIntFlowCovariancesVsM"; |
2254 | intFlowCovariancesVsMName += fAnalysisLabel->Data(); | |
2255 | TString covarianceFlag[6] = {"Cov(<2>,<4>)","Cov(<2>,<6>)","Cov(<2>,<8>)","Cov(<4>,<6>)","Cov(<4>,<8>)","Cov(<6>,<8>)"}; | |
2256 | for(Int_t ci=0;ci<6;ci++) | |
2257 | { | |
2258 | fIntFlowCovariancesVsM[ci] = new TH1D(Form("%s, %s",intFlowCovariancesVsMName.Data(),covarianceFlag[ci].Data()), | |
2259 | Form("%s vs multiplicity",covarianceFlag[ci].Data()), | |
2260 | fnBinsMult,fMinMult,fMaxMult); | |
2261 | fIntFlowCovariancesVsM[ci]->GetYaxis()->SetTitle(covarianceFlag[ci].Data()); | |
2262 | fIntFlowCovariancesVsM[ci]->GetXaxis()->SetTitle("M"); | |
2263 | fIntFlowResults->Add(fIntFlowCovariancesVsM[ci]); | |
2264 | } | |
2265 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 2266 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8> versus multiplicity |
2267 | // [0=sum{w_{<2>}},1=sum{w_{<4>}},2=sum{w_{<6>}},3=sum{w_{<8>}}][0=linear 1,1=quadratic]: | |
b3dacf6b | 2268 | if(fCalculateCumulantsVsM) |
ff70ca91 | 2269 | { |
b3dacf6b | 2270 | TString intFlowSumOfEventWeightsVsMName = "fIntFlowSumOfEventWeightsVsM"; |
2271 | intFlowSumOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
2272 | TString sumFlag[2][4] = {{"#sum_{i=1}^{N} w_{<2>}","#sum_{i=1}^{N} w_{<4>}","#sum_{i=1}^{N} w_{<6>}","#sum_{i=1}^{N} w_{<8>}"}, | |
2273 | {"#sum_{i=1}^{N} w_{<2>}^{2}","#sum_{i=1}^{N} w_{<4>}^{2}","#sum_{i=1}^{N} w_{<6>}^{2}","#sum_{i=1}^{N} w_{<8>}^{2}"}}; | |
2274 | for(Int_t si=0;si<4;si++) | |
ff70ca91 | 2275 | { |
b3dacf6b | 2276 | for(Int_t power=0;power<2;power++) |
2277 | { | |
2278 | fIntFlowSumOfEventWeightsVsM[si][power] = new TH1D(Form("%s, %s",intFlowSumOfEventWeightsVsMName.Data(),sumFlag[power][si].Data()), | |
2279 | Form("%s vs multiplicity",sumFlag[power][si].Data()), | |
2280 | fnBinsMult,fMinMult,fMaxMult); | |
2281 | fIntFlowSumOfEventWeightsVsM[si][power]->GetYaxis()->SetTitle(sumFlag[power][si].Data()); | |
2282 | fIntFlowSumOfEventWeightsVsM[si][power]->GetXaxis()->SetTitle("M"); | |
2283 | fIntFlowResults->Add(fIntFlowSumOfEventWeightsVsM[si][power]); | |
2284 | } // end of for(Int_t power=0;power<2;power++) | |
2285 | } // end of for(Int_t si=0;si<4;si++) | |
2286 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 2287 | // sum of products of event weights for correlations <2>, <4>, <6> and <8> vs M |
2288 | // [0=sum{w_{<2>}w_{<4>}},1=sum{w_{<2>}w_{<6>}},2=sum{w_{<2>}w_{<8>}}, | |
2289 | // 3=sum{w_{<4>}w_{<6>}},4=sum{w_{<4>}w_{<8>}},5=sum{w_{<6>}w_{<8>}}]: | |
b3dacf6b | 2290 | if(fCalculateCumulantsVsM) |
2291 | { | |
2292 | TString intFlowSumOfProductOfEventWeightsVsMName = "fIntFlowSumOfProductOfEventWeightsVsM"; | |
2293 | intFlowSumOfProductOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
2294 | TString sopowFlag[6] = {"#sum_{i=1}^{N} w_{<2>} w_{<4>}","#sum_{i=1}^{N} w_{<2>} w_{<6>}","#sum_{i=1}^{N} w_{<2>} w_{<8>}", | |
2295 | "#sum_{i=1}^{N} w_{<4>} w_{<6>}","#sum_{i=1}^{N} w_{<4>} w_{<8>}","#sum_{i=1}^{N} w_{<6>} w_{<8>}"}; | |
2296 | for(Int_t pi=0;pi<6;pi++) | |
2297 | { | |
2298 | fIntFlowSumOfProductOfEventWeightsVsM[pi] = new TH1D(Form("%s, %s",intFlowSumOfProductOfEventWeightsVsMName.Data(),sopowFlag[pi].Data()), | |
2299 | Form("%s versus multiplicity",sopowFlag[pi].Data()), | |
2300 | fnBinsMult,fMinMult,fMaxMult); | |
2301 | fIntFlowSumOfProductOfEventWeightsVsM[pi]->GetXaxis()->SetTitle("M"); | |
2302 | fIntFlowSumOfProductOfEventWeightsVsM[pi]->GetYaxis()->SetTitle(sopowFlag[pi].Data()); | |
2303 | fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeightsVsM[pi]); | |
2304 | } // end of for(Int_t pi=0;pi<6;pi++) | |
2305 | } // end of if(fCalculateCumulantsVsM) | |
0328db2d | 2306 | // covariances of NUA terms (multiplied with weight dependent prefactor): |
2307 | TString intFlowCovariancesNUAName = "fIntFlowCovariancesNUA"; | |
2308 | intFlowCovariancesNUAName += fAnalysisLabel->Data(); | |
2309 | fIntFlowCovariancesNUA = new TH1D(intFlowCovariancesNUAName.Data(),"Covariances for NUA (multiplied with weight dependent prefactor)",27,0,27); | |
2310 | fIntFlowCovariancesNUA->SetLabelSize(0.04); | |
2311 | fIntFlowCovariancesNUA->SetMarkerStyle(25); | |
2312 | fIntFlowCovariancesNUA->GetXaxis()->SetLabelSize(0.02); | |
2313 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(1,"Cov(<2>,<cos(#phi)>"); | |
2314 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(2,"Cov(<2>,<sin(#phi)>)"); | |
2315 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(3,"Cov(<cos(#phi)>,<sin(#phi)>)"); | |
2316 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(4,"Cov(<2>,<cos(#phi_{1}+#phi_{2})>)"); | |
2317 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(5,"Cov(<2>,<sin(#phi_{1}+#phi_{2})>)"); | |
2318 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(6,"Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2319 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(7,"Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2320 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(8,"Cov(<4>,<cos(#phi)>)"); | |
2321 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(9,"Cov(<4>,<sin(#phi)>)"); | |
2322 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(10,"Cov(<4>,<cos(#phi_{1}+#phi_{2})>)"); | |
2323 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(11,"Cov(<4>,<sin(#phi_{1}+#phi_{2})>)"); | |
2324 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(12,"Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
2325 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(13,"Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>>)"); | |
2326 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(14,"Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
2327 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(15,"Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
2328 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(16,"Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2329 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(17,"Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2330 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(18,"Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>)"); | |
2331 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(19,"Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>)"); | |
2332 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(20,"Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2333 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(21,"Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2334 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(22,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>)"); | |
2335 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(23,"Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2336 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(24,"Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2337 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(25,"Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2338 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(26,"Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>)"); | |
2339 | (fIntFlowCovariancesNUA->GetXaxis())->SetBinLabel(27,"Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>)"); | |
2340 | fIntFlowResults->Add(fIntFlowCovariancesNUA); | |
2341 | // sum of linear and quadratic event weights for NUA terms: | |
2342 | TString intFlowSumOfEventWeightsNUAName = "fIntFlowSumOfEventWeightsNUA"; | |
2343 | intFlowSumOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
2344 | for(Int_t sc=0;sc<2;sc++) | |
2345 | { | |
2346 | for(Int_t power=0;power<2;power++) | |
2347 | { | |
b92ea2b9 | 2348 | fIntFlowSumOfEventWeightsNUA[sc][power] = new TH1D(Form("%s: %s, %s",intFlowSumOfEventWeightsNUAName.Data(),powerFlag[power].Data(),sinCosFlag[sc].Data()),Form("Sum of %s event weights for NUA %s terms",powerFlag[power].Data(),sinCosFlag[sc].Data()),4,0,4); // to be improved - 4 |
0328db2d | 2349 | fIntFlowSumOfEventWeightsNUA[sc][power]->SetLabelSize(0.05); |
2350 | fIntFlowSumOfEventWeightsNUA[sc][power]->SetMarkerStyle(25); | |
2351 | if(power == 0) | |
2352 | { | |
2353 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(1,Form("#sum_{i=1}^{N} w_{<%s(#phi)>}",sinCosFlag[sc].Data())); | |
2354 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(2,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}+#phi_{2})>}",sinCosFlag[sc].Data())); | |
b92ea2b9 | 2355 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(3,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}-#phi_{2}-#phi_{3})>}",sinCosFlag[sc].Data())); |
2356 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(4,Form("#sum_{i=1}^{N} w_{<%s(2#phi_{1}-#phi_{2})>}",sinCosFlag[sc].Data())); | |
0328db2d | 2357 | } else if(power == 1) |
2358 | { | |
2359 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(1,Form("#sum_{i=1}^{N} w_{<%s(#phi)>}^{2}",sinCosFlag[sc].Data())); | |
2360 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(2,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}+#phi_{2})>}^{2}",sinCosFlag[sc].Data())); | |
2361 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(3,Form("#sum_{i=1}^{N} w_{<%s(#phi_{1}-#phi_{2}-#phi_{3})>}^{2}",sinCosFlag[sc].Data())); | |
b92ea2b9 | 2362 | (fIntFlowSumOfEventWeightsNUA[sc][power]->GetXaxis())->SetBinLabel(4,Form("#sum_{i=1}^{N} w_{<%s(2#phi_{1}-#phi_{2})>}^{2}",sinCosFlag[sc].Data())); |
0328db2d | 2363 | } |
2364 | fIntFlowResults->Add(fIntFlowSumOfEventWeightsNUA[sc][power]); | |
2365 | } | |
2366 | } | |
2367 | // sum of products of event weights for NUA terms: | |
2368 | TString intFlowSumOfProductOfEventWeightsNUAName = "fIntFlowSumOfProductOfEventWeightsNUA"; | |
2369 | intFlowSumOfProductOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
2370 | fIntFlowSumOfProductOfEventWeightsNUA = new TH1D(intFlowSumOfProductOfEventWeightsNUAName.Data(),"Sum of product of event weights for NUA terms",27,0,27); | |
403e3389 | 2371 | fIntFlowSumOfProductOfEventWeightsNUA->SetLabelSize(0.02); |
0328db2d | 2372 | fIntFlowSumOfProductOfEventWeightsNUA->SetMarkerStyle(25); |
62e36168 | 2373 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(1,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LTcos(#phi)#GT}"); |
2374 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(2,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LTsin(#phi)#GT}"); | |
2375 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(3,"#sum_{i=1}^{N} w_{#LTcos(#phi)#GT} w_{#LTsin(#phi)#GT}"); | |
2376 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(4,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LTcos(#phi_{1}+#phi_{2})#GT}"); | |
2377 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(5,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LTsin(#phi_{1}+#phi_{2})#GT}"); | |
2378 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(6,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LTcos(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2379 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(7,"#sum_{i=1}^{N} w_{#LT2#GT} w_{#LTsin(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2380 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(8,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LTcos(#phi)#GT}"); | |
2381 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(9,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LTsin(#phi)#GT}"); | |
2382 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(10,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LTcos(#phi_{1}+#phi_{2})#GT}"); | |
2383 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(11,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LTsin(#phi_{1}+#phi_{2})#GT}"); | |
2384 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(12,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LTcos(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2385 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(13,"#sum_{i=1}^{N} w_{#LT4#GT} w_{#LTsin(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2386 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(14,"#sum_{i=1}^{N} w_{#LTcos(#phi)#GT} w_{#LTcos(#phi_{1}+#phi_{2})#GT}"); | |
2387 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(15,"#sum_{i=1}^{N} w_{#LTcos(#phi)#GT} w_{#LTsin(#phi_{1}+#phi_{2})#GT}"); | |
2388 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(16,"#sum_{i=1}^{N} w_{#LTcos(#phi)#GT} w_{#LTcos(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2389 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(17,"#sum_{i=1}^{N} w_{#LTcos(#phi)#GT} w_{#LTsin(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2390 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(18,"#sum_{i=1}^{N} w_{#LTsin(#phi)#GT} w_{#LTcos(#phi_{1}+#phi_{2})#GT}"); | |
2391 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(19,"#sum_{i=1}^{N} w_{#LTsin(#phi)#GT} w_{#LTsin(#phi_{1}+#phi_{2})#GT}"); | |
2392 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(20,"#sum_{i=1}^{N} w_{#LTsin(#phi)#GT} w_{#LTcos(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2393 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(21,"#sum_{i=1}^{N} w_{#LTsin(#phi)#GT} w_{#LTsin(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2394 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(22,"#sum_{i=1}^{N} w_{#LTcos(#phi_{1}+#phi_{2})#GT} w_{#LTsin(#phi_{1}+#phi_{2})#GT}"); | |
2395 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(23,"#sum_{i=1}^{N} w_{#LTcos(#phi_{1}+#phi_{2})#GT} w_{#LTcos(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2396 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(24,"#sum_{i=1}^{N} w_{#LTcos(#phi_{1}+#phi_{2})#GT} w_{#LTsin(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2397 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(25,"#sum_{i=1}^{N} w_{#LTsin(#phi_{1}+#phi_{2})#GT} w_{#LTcos(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2398 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(26,"#sum_{i=1}^{N} w_{#LTsin(#phi_{1}+#phi_{2})#GT} w_{#LTsin(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
2399 | (fIntFlowSumOfProductOfEventWeightsNUA->GetXaxis())->SetBinLabel(27,"#sum_{i=1}^{N} w_{#LTcos(#phi_{1}-#phi_{2}-#phi_{3})#GT} w_{#LTsin(#phi_{1}-#phi_{2}-#phi_{3})#GT}"); | |
0328db2d | 2400 | fIntFlowResults->Add(fIntFlowSumOfProductOfEventWeightsNUA); |
b3dacf6b | 2401 | // Final results for reference Q-cumulants: |
2402 | TString cumulantFlag[4] = {"QC{2}","QC{4}","QC{6}","QC{8}"}; | |
489d5531 | 2403 | TString intFlowQcumulantsName = "fIntFlowQcumulants"; |
2404 | intFlowQcumulantsName += fAnalysisLabel->Data(); | |
b92ea2b9 | 2405 | fIntFlowQcumulants = new TH1D(intFlowQcumulantsName.Data(),"Reference Q-cumulants",4,0,4); |
b77b6434 | 2406 | if(fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 2407 | { |
b77b6434 | 2408 | fIntFlowQcumulants->SetTitle("Reference Q-cumulants (error from non-isotropic terms also propagated)"); |
b92ea2b9 | 2409 | } |
489d5531 | 2410 | fIntFlowQcumulants->SetLabelSize(0.05); |
2411 | fIntFlowQcumulants->SetMarkerStyle(25); | |
68a3b4b1 | 2412 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2413 | { |
68a3b4b1 | 2414 | (fIntFlowQcumulants->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data()); |
b3dacf6b | 2415 | } |
489d5531 | 2416 | fIntFlowResults->Add(fIntFlowQcumulants); |
b3dacf6b | 2417 | // Final results for reference Q-cumulants rebinned in M: |
2418 | if(fCalculateCumulantsVsM) | |
2419 | { | |
2420 | TString intFlowQcumulantsRebinnedInMName = "fIntFlowQcumulantsRebinnedInM"; | |
2421 | intFlowQcumulantsRebinnedInMName += fAnalysisLabel->Data(); | |
2422 | fIntFlowQcumulantsRebinnedInM = new TH1D(intFlowQcumulantsRebinnedInMName.Data(),"Reference Q-cumulants rebinned in M",4,0,4); | |
2423 | fIntFlowQcumulantsRebinnedInM->SetLabelSize(0.05); | |
2424 | fIntFlowQcumulantsRebinnedInM->SetMarkerStyle(25); | |
68a3b4b1 | 2425 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2426 | { |
68a3b4b1 | 2427 | (fIntFlowQcumulantsRebinnedInM->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data()); |
b3dacf6b | 2428 | } |
2429 | fIntFlowResults->Add(fIntFlowQcumulantsRebinnedInM); | |
2430 | } // end of if(fCalculateCumulantsVsM) | |
b92ea2b9 | 2431 | // Ratio between error squared: with/without non-isotropic terms: |
2432 | TString intFlowQcumulantsErrorSquaredRatioName = "fIntFlowQcumulantsErrorSquaredRatio"; | |
2433 | intFlowQcumulantsErrorSquaredRatioName += fAnalysisLabel->Data(); | |
2434 | fIntFlowQcumulantsErrorSquaredRatio = new TH1D(intFlowQcumulantsErrorSquaredRatioName.Data(),"Error squared of reference Q-cumulants: #frac{with NUA terms}{without NUA terms}",4,0,4); | |
2435 | fIntFlowQcumulantsErrorSquaredRatio->SetLabelSize(0.05); | |
2436 | fIntFlowQcumulantsErrorSquaredRatio->SetMarkerStyle(25); | |
2437 | for(Int_t b=0;b<4;b++) | |
2438 | { | |
2439 | (fIntFlowQcumulantsErrorSquaredRatio->GetXaxis())->SetBinLabel(b+1,cumulantFlag[b].Data()); | |
2440 | } | |
2441 | fIntFlowResults->Add(fIntFlowQcumulantsErrorSquaredRatio); | |
ff70ca91 | 2442 | // final results for integrated Q-cumulants versus multiplicity: |
b3dacf6b | 2443 | if(fCalculateCumulantsVsM) |
2444 | { | |
2445 | TString intFlowQcumulantsVsMName = "fIntFlowQcumulantsVsM"; | |
2446 | intFlowQcumulantsVsMName += fAnalysisLabel->Data(); | |
2447 | for(Int_t co=0;co<4;co++) // cumulant order | |
2448 | { | |
2449 | fIntFlowQcumulantsVsM[co] = new TH1D(Form("%s, %s",intFlowQcumulantsVsMName.Data(),cumulantFlag[co].Data()), | |
2450 | Form("%s vs multipicity",cumulantFlag[co].Data()), | |
2451 | fnBinsMult,fMinMult,fMaxMult); | |
2452 | fIntFlowQcumulantsVsM[co]->GetXaxis()->SetTitle("M"); | |
2453 | fIntFlowQcumulantsVsM[co]->GetYaxis()->SetTitle(cumulantFlag[co].Data()); | |
2454 | fIntFlowResults->Add(fIntFlowQcumulantsVsM[co]); | |
2455 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
2456 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 2457 | // final integrated flow estimates from Q-cumulants: |
b3dacf6b | 2458 | TString flowFlag[4] = {Form("v_{%d}{2,QC}",fHarmonic),Form("v_{%d}{4,QC}",fHarmonic),Form("v_{%d}{6,QC}",fHarmonic),Form("v_{%d}{8,QC}",fHarmonic)}; |
489d5531 | 2459 | TString intFlowName = "fIntFlow"; |
2460 | intFlowName += fAnalysisLabel->Data(); | |
2461 | // integrated flow from Q-cumulants: | |
b3dacf6b | 2462 | fIntFlow = new TH1D(intFlowName.Data(),"Reference flow estimates from Q-cumulants",4,0,4); |
489d5531 | 2463 | fIntFlow->SetLabelSize(0.05); |
2464 | fIntFlow->SetMarkerStyle(25); | |
68a3b4b1 | 2465 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2466 | { |
68a3b4b1 | 2467 | (fIntFlow->GetXaxis())->SetBinLabel(b+1,flowFlag[b].Data()); |
b3dacf6b | 2468 | } |
ff70ca91 | 2469 | fIntFlowResults->Add(fIntFlow); |
b3dacf6b | 2470 | // Reference flow vs M rebinned in one huge bin: |
2471 | if(fCalculateCumulantsVsM) | |
2472 | { | |
2473 | TString intFlowRebinnedInMName = "fIntFlowRebinnedInM"; | |
2474 | intFlowRebinnedInMName += fAnalysisLabel->Data(); | |
2475 | fIntFlowRebinnedInM = new TH1D(intFlowRebinnedInMName.Data(),"Reference flow estimates from Q-cumulants (rebinned in M)",4,0,4); | |
2476 | fIntFlowRebinnedInM->SetLabelSize(0.05); | |
2477 | fIntFlowRebinnedInM->SetMarkerStyle(25); | |
68a3b4b1 | 2478 | for(Int_t b=0;b<4;b++) |
b3dacf6b | 2479 | { |
68a3b4b1 | 2480 | (fIntFlowRebinnedInM->GetXaxis())->SetBinLabel(b+1,flowFlag[b].Data()); |
b3dacf6b | 2481 | } |
2482 | fIntFlowResults->Add(fIntFlowRebinnedInM); | |
2483 | } | |
ff70ca91 | 2484 | // integrated flow from Q-cumulants: versus multiplicity: |
b3dacf6b | 2485 | if(fCalculateCumulantsVsM) |
2486 | { | |
2487 | TString intFlowVsMName = "fIntFlowVsM"; | |
2488 | intFlowVsMName += fAnalysisLabel->Data(); | |
2489 | for(Int_t co=0;co<4;co++) // cumulant order | |
2490 | { | |
2491 | fIntFlowVsM[co] = new TH1D(Form("%s, %s",intFlowVsMName.Data(),flowFlag[co].Data()), | |
2492 | Form("%s vs multipicity",flowFlag[co].Data()), | |
2493 | fnBinsMult,fMinMult,fMaxMult); | |
2494 | fIntFlowVsM[co]->GetXaxis()->SetTitle("M"); | |
2495 | fIntFlowVsM[co]->GetYaxis()->SetTitle(flowFlag[co].Data()); | |
2496 | fIntFlowResults->Add(fIntFlowVsM[co]); | |
2497 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
2498 | } // end of if(fCalculateCumulantsVsM) | |
2001bc3a | 2499 | // quantifying detector effects effects to correlations: |
2500 | TString intFlowDetectorBiasName = "fIntFlowDetectorBias"; | |
2501 | intFlowDetectorBiasName += fAnalysisLabel->Data(); | |
2502 | fIntFlowDetectorBias = new TH1D(intFlowDetectorBiasName.Data(),"Quantifying detector bias",4,0,4); | |
2503 | fIntFlowDetectorBias->SetLabelSize(0.05); | |
2504 | fIntFlowDetectorBias->SetMarkerStyle(25); | |
2505 | for(Int_t ci=0;ci<4;ci++) | |
2506 | { | |
2507 | (fIntFlowDetectorBias->GetXaxis())->SetBinLabel(ci+1,Form("#frac{corrected}{measured} %s",cumulantFlag[ci].Data())); | |
2508 | } | |
2509 | fIntFlowResults->Add(fIntFlowDetectorBias); | |
2510 | // quantifying detector effects to correlations versus multiplicity: | |
b3dacf6b | 2511 | if(fCalculateCumulantsVsM) |
2001bc3a | 2512 | { |
b3dacf6b | 2513 | TString intFlowDetectorBiasVsMName = "fIntFlowDetectorBiasVsM"; |
2514 | intFlowDetectorBiasVsMName += fAnalysisLabel->Data(); | |
2515 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2516 | { | |
2517 | fIntFlowDetectorBiasVsM[ci] = new TH1D(Form("%s for %s",intFlowDetectorBiasVsMName.Data(),cumulantFlag[ci].Data()), | |
2518 | Form("Quantifying detector bias for %s vs multipicity",cumulantFlag[ci].Data()), | |
2519 | fnBinsMult,fMinMult,fMaxMult); | |
2520 | fIntFlowDetectorBiasVsM[ci]->GetXaxis()->SetTitle("M"); | |
2521 | fIntFlowDetectorBiasVsM[ci]->GetYaxis()->SetTitle("#frac{corrected}{measured}"); | |
b77b6434 | 2522 | fIntFlowResults->Add(fIntFlowDetectorBiasVsM[ci]); |
b3dacf6b | 2523 | } // end of for(Int_t co=0;co<4;co++) // cumulant order |
2524 | } // end of if(fCalculateCumulantsVsM) | |
1268c371 | 2525 | |
489d5531 | 2526 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForIntegratedFlow() |
2527 | ||
489d5531 | 2528 | //================================================================================================================================ |
2529 | ||
489d5531 | 2530 | void AliFlowAnalysisWithQCumulants::InitializeArraysForNestedLoops() |
2531 | { | |
2532 | // Initialize arrays of all objects relevant for calculations with nested loops. | |
2533 | ||
2534 | // integrated flow: | |
2535 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2536 | { | |
2537 | fIntFlowDirectCorrectionTermsForNUA[sc] = NULL; | |
2538 | } | |
2539 | ||
2540 | // differential flow: | |
2541 | // correlations: | |
2542 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
2543 | { | |
2544 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2545 | { | |
2546 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2547 | { | |
2548 | fDiffFlowDirectCorrelations[t][pe][ci] = NULL; | |
2549 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
2550 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2551 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
2552 | // correction terms for non-uniform acceptance: | |
2553 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
2554 | { | |
2555 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2556 | { | |
2557 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2558 | { | |
2559 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
2560 | { | |
2561 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = NULL; | |
2562 | } | |
2563 | } | |
2564 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2565 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
2566 | ||
64e500e3 | 2567 | // other differential correlators: |
2568 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
2569 | { | |
2570 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2571 | { | |
2572 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2573 | { | |
2574 | for(Int_t ci=0;ci<1;ci++) // correlator index | |
2575 | { | |
2576 | fOtherDirectDiffCorrelators[t][pe][sc][ci] = NULL; | |
2577 | } | |
2578 | } | |
2579 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2580 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
489d5531 | 2581 | |
2582 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForNestedLoops() | |
2583 | ||
489d5531 | 2584 | //================================================================================================================================ |
2585 | ||
489d5531 | 2586 | void AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops() |
2587 | { | |
2588 | // Book all objects relevant for calculations with nested loops. | |
2589 | ||
2590 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?) | |
2591 | TString typeFlag[2] = {"RP","POI"}; // to be improved (should I promote this to data members?) | |
2592 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; // to be improved (should I promote this to data members?) | |
2593 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; // to be improved (should I promote this to data members?) | |
2594 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
2595 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
2596 | ||
2597 | TString evaluateNestedLoopsName = "fEvaluateNestedLoops"; | |
2598 | evaluateNestedLoopsName += fAnalysisLabel->Data(); | |
2599 | fEvaluateNestedLoops = new TProfile(evaluateNestedLoopsName.Data(),"Flags for nested loops",4,0,4); | |
2600 | fEvaluateNestedLoops->SetLabelSize(0.03); | |
2601 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(1,"fEvaluateIntFlowNestedLoops"); | |
2602 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(2,"fEvaluateDiffFlowNestedLoops"); | |
2603 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(3,"fCrossCheckInPtBinNo"); | |
2604 | (fEvaluateNestedLoops->GetXaxis())->SetBinLabel(4,"fCrossCheckInEtaBinNo"); | |
2605 | fEvaluateNestedLoops->Fill(0.5,(Int_t)fEvaluateIntFlowNestedLoops); | |
2606 | fEvaluateNestedLoops->Fill(1.5,(Int_t)fEvaluateDiffFlowNestedLoops); | |
2607 | fEvaluateNestedLoops->Fill(2.5,fCrossCheckInPtBinNo); | |
2608 | fEvaluateNestedLoops->Fill(3.5,fCrossCheckInEtaBinNo); | |
2609 | fNestedLoopsList->Add(fEvaluateNestedLoops); | |
2610 | // nested loops for integrated flow: | |
2611 | if(fEvaluateIntFlowNestedLoops) | |
2612 | { | |
2613 | // correlations: | |
2614 | TString intFlowDirectCorrelationsName = "fIntFlowDirectCorrelations"; | |
2615 | intFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
403e3389 | 2616 | fIntFlowDirectCorrelations = new TProfile(intFlowDirectCorrelationsName.Data(),"Multiparticle correlations calculated with nested loops (for int. flow)",64,0,64,"s"); |
489d5531 | 2617 | fNestedLoopsList->Add(fIntFlowDirectCorrelations); |
403e3389 | 2618 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 2619 | { |
2620 | TString intFlowExtraDirectCorrelationsName = "fIntFlowExtraDirectCorrelations"; | |
2621 | intFlowExtraDirectCorrelationsName += fAnalysisLabel->Data(); | |
2622 | fIntFlowExtraDirectCorrelations = new TProfile(intFlowExtraDirectCorrelationsName.Data(),"Extra multiparticle correlations calculated with nested loops (for int. flow)",100,0,100,"s"); | |
2623 | fNestedLoopsList->Add(fIntFlowExtraDirectCorrelations); | |
403e3389 | 2624 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 2625 | // correction terms for non-uniform acceptance: |
2626 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
2627 | { | |
2628 | TString intFlowDirectCorrectionTermsForNUAName = "fIntFlowDirectCorrectionTermsForNUA"; | |
2629 | intFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
2630 | fIntFlowDirectCorrectionTermsForNUA[sc] = new TProfile(Form("%s: %s terms",intFlowDirectCorrectionTermsForNUAName.Data(),sinCosFlag[sc].Data()),Form("Correction terms for non-uniform acceptance (%s terms)",sinCosFlag[sc].Data()),10,0,10,"s"); | |
2631 | fNestedLoopsList->Add(fIntFlowDirectCorrectionTermsForNUA[sc]); | |
2632 | } // end of for(Int_t sc=0;sc<2;sc++) | |
2633 | } // end of if(fEvaluateIntFlowNestedLoops) | |
2634 | ||
2635 | // nested loops for differential flow: | |
2636 | if(fEvaluateDiffFlowNestedLoops) | |
2637 | { | |
2638 | // reduced correlations: | |
2639 | TString diffFlowDirectCorrelationsName = "fDiffFlowDirectCorrelations"; | |
2640 | diffFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
2641 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
2642 | { | |
62e36168 | 2643 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 2644 | { |
2645 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
2646 | { | |
2647 | // reduced correlations: | |
2648 | fDiffFlowDirectCorrelations[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe],"s"); | |
2649 | fDiffFlowDirectCorrelations[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data()); | |
2650 | fNestedLoopsList->Add(fDiffFlowDirectCorrelations[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations) | |
2651 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
2652 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
2653 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
64e500e3 | 2654 | |
2655 | ||
489d5531 | 2656 | // correction terms for non-uniform acceptance: |
2657 | TString diffFlowDirectCorrectionTermsForNUAName = "fDiffFlowDirectCorrectionTermsForNUA"; | |
2658 | diffFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
2659 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
2660 | { | |
62e36168 | 2661 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 2662 | { |
2663 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
2664 | { | |
2665 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
2666 | { | |
2667 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = new TProfile(Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe],"s"); | |
2668 | fNestedLoopsList->Add(fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]); | |
2669 | } | |
2670 | } | |
2671 | } | |
64e500e3 | 2672 | } |
2673 | // other differential correlators: | |
2674 | TString otherDirectDiffCorrelatorsName = "fOtherDirectDiffCorrelators"; | |
2675 | otherDirectDiffCorrelatorsName += fAnalysisLabel->Data(); | |
2676 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
2677 | { | |
62e36168 | 2678 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
64e500e3 | 2679 | { |
2680 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
2681 | { | |
2682 | for(Int_t ci=0;ci<1;ci++) // correlator index | |
2683 | { | |
2684 | fOtherDirectDiffCorrelators[t][pe][sc][ci] = new TProfile(Form("%s, %s, %s, %s, ci = %d",otherDirectDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1),Form("%s, %s, %s, %s, ci = %d",otherDirectDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1),1,lowerPtEtaEdge[pe],upperPtEtaEdge[pe]); | |
2685 | fNestedLoopsList->Add(fOtherDirectDiffCorrelators[t][pe][sc][ci]); | |
2686 | } | |
2687 | } | |
2688 | } | |
2689 | } | |
3b552efe | 2690 | // number of RPs and POIs in selected pt and eta bins for cross-checkings: |
2691 | TString noOfParticlesInBinName = "fNoOfParticlesInBin"; | |
2692 | fNoOfParticlesInBin = new TH1D(noOfParticlesInBinName.Data(),"Number of RPs and POIs in selected p_{T} and #eta bin",4,0,4); | |
489d5531 | 2693 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(1,"# of RPs in p_{T} bin"); |
2694 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(2,"# of RPs in #eta bin"); | |
2695 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(3,"# of POIs in p_{T} bin"); | |
3b552efe | 2696 | fNoOfParticlesInBin->GetXaxis()->SetBinLabel(4,"# of POIs in #eta bin"); |
489d5531 | 2697 | fNestedLoopsList->Add(fNoOfParticlesInBin); |
2698 | } // end of if(fEvaluateDiffFlowNestedLoops) | |
2699 | ||
2700 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForNestedLoops() | |
2701 | ||
489d5531 | 2702 | //================================================================================================================================ |
2703 | ||
489d5531 | 2704 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelations() |
2705 | { | |
b84464d3 | 2706 | // Calculate in this method all multiparticle azimuthal correlations. |
2707 | // | |
2708 | // Remark 1: All multiparticle correlations are stored in TProfile fIntFlowCorrelationsAllPro; | |
2709 | // Remark 2: There is a special TProfile fIntFlowCorrelationsPro holding results | |
2710 | // only for same harmonic's correlations <<2>>, <<4>>, <<6>> and <<8>>; | |
2711 | // Remark 3: Binning of fIntFlowCorrelationsAllPro is organized as follows: | |
2712 | // -------------------------------------------------------------------------------------------------------------------- | |
2713 | // 1st bin: <2>_{1n|1n} = two1n1n = cos(1n(phi1-phi2))> | |
2714 | // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n(phi1-phi2))> | |
2715 | // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n(phi1-phi2))> | |
2716 | // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n(phi1-phi2))> | |
2717 | // 5th bin: ---- EMPTY ---- | |
2718 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n(2*phi1-phi2-phi3))> | |
2719 | // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n(3*phi1-2*phi2-phi3))> | |
2720 | // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n(4*phi1-2*phi2-2*phi3))> | |
2721 | // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n(4*phi1-3*phi2-phi3))> | |
2722 | // 10th bin: ---- EMPTY ---- | |
2723 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n(phi1+phi2-phi3-phi4))> | |
2724 | // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(n(2*phi1+phi2-2*phi3-phi4))> | |
2725 | // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(2n(phi1+phi2-phi3-phi4))> | |
2726 | // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n(3*phi1-phi2-phi3-phi4))> | |
2727 | // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n(3*phi1+phi2-3*phi3-phi4))> | |
2728 | // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n(3*phi1+phi2-2*phi3-2*phi4))> | |
2729 | // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n(4*phi1-2*phi2-phi3-phi4))> | |
2730 | // 18th bin: ---- EMPTY ---- | |
2731 | // 19th bin: <5>_{2n,1n|1n,1n,1n} = five2n1n1n1n1n = <cos(n(2*phi1+phi2-phi3-phi4-phi5))> | |
2732 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n(2*phi1+2*phi2-2*phi3-phi4-phi5))> | |
2733 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n(3*phi1+phi2-2*phi3-phi4-phi5))> | |
2734 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n(4*phi1-phi2-phi3-phi4-phi5))> | |
2735 | // 23rd bin: ---- EMPTY ---- | |
2736 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n(phi1+phi2+phi3-phi4-phi5-phi6))> | |
2737 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n(2*phi1+phi2+phi3-2*phi4-phi5-phi6))> | |
2738 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n(2*phi1+2*phi2-phi3-phi4-phi5-phi6))> | |
2739 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n(3*phi1+phi2-phi3-phi4-phi5-phi6))> | |
2740 | // 28th bin: ---- EMPTY ---- | |
2741 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n(2*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> | |
2742 | // 30th bin: ---- EMPTY ---- | |
2743 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> | |
2744 | // 32nd bin: ---- EMPTY ---- | |
2745 | // Extra correlations for v3{5} study: | |
2746 | // 33rd bin: <4>_{4n,2n|3n,3n} = four4n2n3n3n = <cos(n(4*phi1+2*phi2-3*phi3-3*phi4))> | |
2747 | // 34th bin: <5>_{3n,3n|2n,2n,2n} = five3n3n2n2n2n = <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-2*phi5))> | |
2748 | // Extra correlations for Teaney-Yan study: | |
2749 | // 35th bin: <2>_{5n|5n} = two5n5n = <cos(5n(phi1-phi2)> | |
2750 | // 36th bin: <2>_{6n|6n} = two6n6n = <cos(6n(phi1-phi2)> | |
2751 | // 37th bin: <3>_{5n|3n,2n} = three5n3n2n = <cos(n(5*phi1-3*phi2-2*phi3)> | |
2752 | // 38th bin: <3>_{5n|4n,1n} = three5n4n1n = <cos(n(5*phi1-4*phi2-1*phi3)> | |
2753 | // 39th bin: <3>_{6n|3n,3n} = three6n3n3n = <cos(n(6*phi1-3*phi2-3*phi3)> | |
2754 | // 40th bin: <3>_{6n|4n,2n} = three6n4n2n = <cos(n(6*phi1-4*phi2-2*phi3)> | |
2755 | // 41st bin: <3>_{6n|5n,1n} = three6n5n1n = <cos(n(6*phi1-5*phi2-1*phi3)> | |
2756 | // 42nd bin: <4>_{6n|3n,2n,1n} = four6n3n2n1n = <cos(n(6*phi1-3*phi2-2*phi3-1*phi4)> | |
2757 | // 43rd bin: <4>_{3n,2n|3n,2n} = four3n2n3n2n = <cos(n(3*phi1+2*phi2-3*phi3-2*phi4)> | |
2758 | // 44th bin: <4>_{4n,1n|3n,2n} = four4n1n3n2n = <cos(n(4*phi1+1*phi2-3*phi3-2*phi4)> | |
2759 | // 45th bin: <4>_{3n,3n|3n,3n} = four3n3n3n3n = <cos(3n*(phi1+phi2-phi3-phi4))> | |
2760 | // 46th bin: <4>_{4n,2n|3n,3n} = four4n2n3n3n = <cos(n(4*phi1+2*phi2-3*phi3-3*phi4)> | |
2761 | // 47th bin: <4>_{5n,1n|3n,3n} = four5n1n3n3n = <cos(n(5*phi1+1*phi2-3*phi3-3*phi4)> | |
2762 | // 48th bin: <4>_{4n,2n|4n,2n} = four4n2n4n2n = <cos(n(4*phi1+2*phi2-4*phi3-2*phi4)> | |
2763 | // 49th bin: <4>_{5n,1n|4n,2n} = four5n1n4n2n = <cos(n(5*phi1+1*phi2-4*phi3-2*phi4)> | |
2764 | // 50th bin: <4>_{5n|3n,1n,1n} = four5n3n1n1n = <cos(n(5*phi1-3*phi2-1*phi3-1*phi4)> | |
2765 | // 51st bin: <4>_{5n|2n,2n,1n} = four5n2n2n1n = <cos(n(5*phi1-2*phi2-2*phi3-1*phi4)> | |
2766 | // 52nd bin: <4>_{5n,1n|5n,1n} = four5n1n5n1n = <cos(n(5*phi1+1*phi2-5*phi3-1*phi4)> | |
2767 | // 53rd bin: <5>_{3n,3n|3n,2n,1n} = five3n3n3n2n1n = <cos(n(3*phi1+3*phi2-3*phi3-2*phi4-1*phi5)> | |
2768 | // 54th bin: <5>_{4n,2n|3n,2n,1n} = five4n2n3n2n1n = <cos(n(4*phi1+2*phi2-3*phi3-2*phi4-1*phi5)> | |
2769 | // 55th bin: <5>_{3n,2n|3n,1n,1n} = five3n2n3n1n1n = <cos(n(3*phi1+2*phi2-3*phi3-1*phi4-1*phi5)> | |
2770 | // 56th bin: <5>_{3n,2n|2n,2n,1n} = five3n2n2n2n1n = <cos(n(3*phi1+2*phi2-2*phi3-2*phi4-1*phi5)> | |
2771 | // 57th bin: <5>_{5n,1n|3n,2n,1n} = five5n1n3n2n1n = <cos(n(5*phi1+1*phi2-3*phi3-2*phi4-1*phi5)> | |
2772 | // 58th bin: <6>_{3n,2n,1n|3n,2n,1n} = six3n2n1n3n2n1n = <cos(n(3*phi1+2*phi2+1*phi3-3*phi4-2*phi5-1*phi6)> | |
403e3389 | 2773 | // Extra correlations for Teaney-Yan study (B): |
2774 | // 59th bin: <4>_{6n|4n,1n,1n} = four6n4n1n1n = <cos(n(6*phi1-4*phi2-1*phi3-1*phi4)> | |
2775 | // 60th bin: <4>_{6n|2n,2n,2n} = four6n2n2n2n = <cos(n(6*phi1-2*phi2-2*phi3-2*phi4)> | |
2776 | // 61st bin: <5>_{6n|2n,2n,1n,1n} = five6n2n2n1n1n = <cos(n(6*phi1-2*phi2-2*phi3-1*phi4-1*phi5)> | |
2777 | // 62nd bin: <5>_{4n,1n,1n|3n,3n} = five4n1n1n3n3n = <cos(n(4*phi1+1*phi2+1*phi3-3*phi4-3*phi5)> | |
2778 | // 63rd bin: <6>_{3n,3n|2n,2n,1n,1n} = six3n3n2n2n1n1n = <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-1*phi5-1*phi6)> | |
b84464d3 | 2779 | // -------------------------------------------------------------------------------------------------------------------- |
403e3389 | 2780 | |
2781 | // Multiplicity of an event: | |
1268c371 | 2782 | Double_t dMult = (*fSpk)(0,0); |
b84464d3 | 2783 | // Real parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n, 4n, 5n and 6n: |
489d5531 | 2784 | Double_t dReQ1n = (*fReQ)(0,0); |
2785 | Double_t dReQ2n = (*fReQ)(1,0); | |
2786 | Double_t dReQ3n = (*fReQ)(2,0); | |
2787 | Double_t dReQ4n = (*fReQ)(3,0); | |
b84464d3 | 2788 | Double_t dReQ5n = (*fReQ)(4,0); |
8ed4edc7 | 2789 | Double_t dReQ6n = (*fReQ)(5,0); |
b84464d3 | 2790 | // Imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n, 4n, 5n and 6n: |
489d5531 | 2791 | Double_t dImQ1n = (*fImQ)(0,0); |
2792 | Double_t dImQ2n = (*fImQ)(1,0); | |
2793 | Double_t dImQ3n = (*fImQ)(2,0); | |
2794 | Double_t dImQ4n = (*fImQ)(3,0); | |
b84464d3 | 2795 | Double_t dImQ5n = (*fImQ)(4,0); |
8ed4edc7 | 2796 | Double_t dImQ6n = (*fImQ)(5,0); |
489d5531 | 2797 | |
b84464d3 | 2798 | // Real parts of expressions involving various combinations of Q-vectors which appears |
2799 | // simultaneously in several equations for multiparticle correlations bellow: | |
2800 | // Re[Q_{2n}Q_{n}^*Q_{n}^*] | |
2801 | Double_t reQ2nQ1nstarQ1nstar = pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dReQ2n; | |
2802 | // Re[Q_{6n}Q_{3n}^*Q_{3n}^*] | |
2803 | Double_t reQ6nQ3nstarQ3nstar = pow(dReQ3n,2.)*dReQ6n+2.*dReQ3n*dImQ3n*dImQ6n-pow(dImQ3n,2.)*dReQ6n; | |
2804 | // Re[Q_{4n}Q_{2n}^*Q_{2n}^*] | |
489d5531 | 2805 | Double_t reQ4nQ2nstarQ2nstar = pow(dReQ2n,2.)*dReQ4n+2.*dReQ2n*dImQ2n*dImQ4n-pow(dImQ2n,2.)*dReQ4n; |
b84464d3 | 2806 | // Re[Q_{4n}Q_{3n}^*Q_{n}^*] |
489d5531 | 2807 | Double_t reQ4nQ3nstarQ1nstar = dReQ4n*(dReQ3n*dReQ1n-dImQ3n*dImQ1n)+dImQ4n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n); |
b84464d3 | 2808 | // Re[Q_{3n}Q_{2n}^*Q_{n}^*] |
489d5531 | 2809 | Double_t reQ3nQ2nstarQ1nstar = dReQ3n*dReQ2n*dReQ1n-dReQ3n*dImQ2n*dImQ1n+dImQ3n*dReQ2n*dImQ1n |
b84464d3 | 2810 | + dImQ3n*dImQ2n*dReQ1n; |
2811 | // Re[Q_{5n}Q_{3n}^*Q_{2n}^*] | |
2812 | Double_t reQ5nQ3nstarQ2nstar = dReQ5n*dReQ2n*dReQ3n-dReQ5n*dImQ2n*dImQ3n+dImQ5n*dReQ2n*dImQ3n | |
2813 | + dImQ5n*dImQ2n*dReQ3n; | |
2814 | // Re[Q_{5n}Q_{4n}^*Q_{1n}^*] | |
2815 | Double_t reQ5nQ4nstarQ1nstar = dReQ5n*dReQ4n*dReQ1n-dReQ5n*dImQ4n*dImQ1n+dImQ5n*dReQ4n*dImQ1n | |
2816 | + dImQ5n*dImQ4n*dReQ1n; | |
2817 | // Re[Q_{6n}Q_{5n}^*Q_{1n}^*] | |
2818 | Double_t reQ6nQ5nstarQ1nstar = dReQ6n*dReQ5n*dReQ1n-dReQ6n*dImQ5n*dImQ1n+dImQ6n*dReQ5n*dImQ1n | |
2819 | + dImQ6n*dImQ5n*dReQ1n; | |
2820 | // Re[Q_{6n}Q_{4n}^*Q_{2n}^*] | |
2821 | Double_t reQ6nQ4nstarQ2nstar = dReQ6n*dReQ4n*dReQ2n-dReQ6n*dImQ4n*dImQ2n+dImQ6n*dReQ4n*dImQ2n | |
2822 | + dImQ6n*dImQ4n*dReQ2n; | |
2823 | // Re[Q_{3n}Q_{n}Q_{2n}^*Q_{2n}^*] | |
2824 | Double_t reQ3nQ1nQ2nstarQ2nstar = (pow(dReQ2n,2.)-pow(dImQ2n,2.))*(dReQ3n*dReQ1n-dImQ3n*dImQ1n) | |
2825 | + 2.*dReQ2n*dImQ2n*(dReQ3n*dImQ1n+dImQ3n*dReQ1n); | |
2826 | // Re[Q_{3n}Q_{n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 2827 | Double_t reQ3nQ1nstarQ1nstarQ1nstar = dReQ3n*pow(dReQ1n,3)-3.*dReQ1n*dReQ3n*pow(dImQ1n,2) |
2828 | + 3.*dImQ1n*dImQ3n*pow(dReQ1n,2)-dImQ3n*pow(dImQ1n,3); | |
403e3389 | 2829 | // Re[Q_{6n}Q_{2n}^*Q_{2n}^*Q_{2n}^*] |
2830 | Double_t reQ6nQ2nstarQ2nstarQ2nstar = dReQ6n*pow(dReQ2n,3)-3.*dReQ2n*dReQ6n*pow(dImQ2n,2) | |
2831 | + 3.*dImQ2n*dImQ6n*pow(dReQ2n,2)-dImQ6n*pow(dImQ2n,3); | |
b84464d3 | 2832 | // Re[Q_{4n}Q_{2n}^*Q_{n}^*Q_{n}^*] |
2833 | Double_t reQ4nQ2nstarQ1nstarQ1nstar = (dReQ4n*dReQ2n+dImQ4n*dImQ2n)*(pow(dReQ1n,2)-pow(dImQ1n,2)) | |
2834 | + 2.*dReQ1n*dImQ1n*(dImQ4n*dReQ2n-dReQ4n*dImQ2n); | |
2835 | // Re[Q_{4n}Q_{2n}^*Q_{3n}^*Q_{3n}^*] | |
2836 | Double_t reQ4nQ2nQ3nstarQ3nstar = (dReQ4n*dReQ2n-dImQ4n*dImQ2n)*(dReQ3n*dReQ3n-dImQ3n*dImQ3n) | |
2837 | + 2.*(dReQ4n*dImQ2n+dImQ4n*dReQ2n)*dReQ3n*dImQ3n; | |
2838 | // Re[Q_{4n}Q_{n}Q_{3n}^*Q_{2n}^*] | |
2839 | Double_t reQ4nQ1nQ3nstarQ2nstar = dImQ1n*dImQ2n*dImQ3n*dImQ4n+dImQ3n*dImQ4n*dReQ1n*dReQ2n | |
2840 | + dImQ2n*dImQ4n*dReQ1n*dReQ3n-dImQ1n*dImQ4n*dReQ2n*dReQ3n | |
2841 | - dImQ2n*dImQ3n*dReQ1n*dReQ4n+dImQ1n*dImQ3n*dReQ2n*dReQ4n | |
2842 | + dImQ1n*dImQ2n*dReQ3n*dReQ4n+dReQ1n*dReQ2n*dReQ3n*dReQ4n; | |
2843 | // Re[Q_{5n}Q_{n}Q_{4n}^*Q_{2n}^*] | |
2844 | Double_t reQ5nQ1nQ4nstarQ2nstar = dImQ1n*dImQ2n*dImQ4n*dImQ5n+dImQ4n*dImQ5n*dReQ1n*dReQ2n | |
2845 | + dImQ2n*dImQ5n*dReQ1n*dReQ4n-dImQ1n*dImQ5n*dReQ2n*dReQ4n | |
2846 | - dImQ2n*dImQ4n*dReQ1n*dReQ5n+dImQ1n*dImQ4n*dReQ2n*dReQ5n | |
2847 | + dImQ1n*dImQ2n*dReQ4n*dReQ5n+dReQ1n*dReQ2n*dReQ4n*dReQ5n; | |
2848 | // Re[Q_{5n}Q_{n}Q_{3n}^*Q_{3n}^*] | |
2849 | Double_t reQ5nQ1nQ3nstarQ3nstar = dImQ1n*pow(dImQ3n,2.)*dImQ5n+2.*dImQ3n*dImQ5n*dReQ1n*dReQ3n | |
2850 | - dImQ1n*dImQ5n*pow(dReQ3n,2.)-pow(dImQ3n,2.)*dReQ1n*dReQ5n | |
2851 | + 2.*dImQ1n*dImQ3n*dReQ3n*dReQ5n+dReQ1n*pow(dReQ3n,2.)*dReQ5n; | |
2852 | // Re[Q_{5n}Q_{3n}^*Q_{n}^*Q_{n}^*] | |
2853 | Double_t reQ5nQ3nstarQ1nstarQ1nstar = -pow(dImQ1n,2.)*dImQ3n*dImQ5n+dImQ3n*dImQ5n*pow(dReQ1n,2.) | |
2854 | + 2.*dImQ1n*dImQ5n*dReQ1n*dReQ3n-2.*dImQ1n*dImQ3n*dReQ1n*dReQ5n | |
2855 | - pow(dImQ1n,2.)*dReQ3n*dReQ5n+pow(dReQ1n,2.)*dReQ3n*dReQ5n; | |
2856 | // Re[Q_{5n}Q_{2n}^*Q_{2n}^*Q_{n}^*] | |
2857 | Double_t reQ5nQ2nstarQ2nstarQ1nstar = -pow(dImQ2n,2.)*dImQ1n*dImQ5n+dImQ1n*dImQ5n*pow(dReQ2n,2.) | |
2858 | + 2.*dImQ2n*dImQ5n*dReQ2n*dReQ1n-2.*dImQ2n*dImQ1n*dReQ2n*dReQ5n | |
403e3389 | 2859 | - pow(dImQ2n,2.)*dReQ1n*dReQ5n+pow(dReQ2n,2.)*dReQ1n*dReQ5n; |
2860 | // Re[Q_{6n}Q_{4n}^*Q_{n}^*Q_{n}^*] | |
2861 | Double_t reQ6nQ4nstarQ1nstarQ1nstar = -pow(dImQ1n,2.)*dImQ4n*dImQ6n+dImQ4n*dImQ6n*pow(dReQ1n,2.) | |
2862 | + 2.*dImQ1n*dImQ6n*dReQ1n*dReQ4n-2.*dImQ1n*dImQ4n*dReQ1n*dReQ6n | |
2863 | - pow(dImQ1n,2.)*dReQ4n*dReQ6n+pow(dReQ1n,2.)*dReQ4n*dReQ6n; | |
489d5531 | 2864 | // |Q_{2n}|^2 |Q_{n}|^2 |
2865 | Double_t dQ2nQ1nQ2nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
b84464d3 | 2866 | // |Q_{4n}|^2 |Q_{2n}|^2 |
2867 | Double_t dQ4nQ2nQ4nstarQ2nstar = (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)); | |
2868 | // |Q_{3n}|^2 |Q_{2n}|^2 | |
2869 | Double_t dQ3nQ2nQ3nstarQ2nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)); | |
2870 | // |Q_{5n}|^2 |Q_{n}|^2 | |
2871 | Double_t dQ5nQ1nQ5nstarQ1nstar = (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
53884472 | 2872 | // |Q_{3n}|^2 |Q_{n}|^2 |
2873 | Double_t dQ3nQ1nQ3nstarQ1nstar = (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
b84464d3 | 2874 | // Re[Q_{2n}Q_{n}Q_{n}^*Q_{n}^*Q_{n}^*] |
489d5531 | 2875 | Double_t reQ2nQ1nQ1nstarQ1nstarQ1nstar = (dReQ2n*dReQ1n-dImQ2n*dImQ1n)*(pow(dReQ1n,3)-3.*dReQ1n*pow(dImQ1n,2)) |
b84464d3 | 2876 | + (dReQ2n*dImQ1n+dReQ1n*dImQ2n)*(3.*dImQ1n*pow(dReQ1n,2)-pow(dImQ1n,3)); |
2877 | // Re[Q_{2n}Q_{2n}Q_{2n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 2878 | Double_t reQ2nQ2nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.)) |
2879 | * (dReQ2n*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) + 2.*dImQ2n*dReQ1n*dImQ1n); | |
b84464d3 | 2880 | // Re[Q_{4n}Q_{n}^*Q_{n}^*Q_{n}^*Q_{n}^*] |
489d5531 | 2881 | Double_t reQ4nQ1nstarQ1nstarQ1nstarQ1nstar = pow(dReQ1n,4.)*dReQ4n-6.*pow(dReQ1n,2.)*dReQ4n*pow(dImQ1n,2.) |
2882 | + pow(dImQ1n,4.)*dReQ4n+4.*pow(dReQ1n,3.)*dImQ1n*dImQ4n | |
2883 | - 4.*pow(dImQ1n,3.)*dReQ1n*dImQ4n; | |
b84464d3 | 2884 | // Re[Q_{3n}Q_{n}Q_{2n}^*Q_{n}^*Q_{n}^*] |
489d5531 | 2885 | Double_t reQ3nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
b84464d3 | 2886 | * (dReQ1n*dReQ2n*dReQ3n-dReQ3n*dImQ1n*dImQ2n |
2887 | + dReQ2n*dImQ1n*dImQ3n+dReQ1n*dImQ2n*dImQ3n); | |
2888 | // Re[Q_{6n}Q_{n}Q_{3n}^*Q_{2n}^*Q_{n}^*] | |
2889 | Double_t reQ6nQ3nstarQ2nstarQ1nstar = dReQ1n*dReQ2n*dReQ3n*dReQ6n-dReQ3n*dReQ6n*dImQ1n*dImQ2n | |
2890 | - dReQ2n*dReQ6n*dImQ1n*dImQ3n-dReQ1n*dReQ6n*dImQ2n*dImQ3n | |
2891 | + dReQ2n*dReQ3n*dImQ1n*dImQ6n+dReQ1n*dReQ3n*dImQ2n*dImQ6n | |
2892 | + dReQ1n*dReQ2n*dImQ3n*dImQ6n-dImQ1n*dImQ2n*dImQ3n*dImQ6n; | |
2893 | // Re[Q_{3n}Q_{3n}Q_{3n}^*Q_{2n}^*Q_{n}^*] | |
2894 | Double_t reQ3nQ3nQ3nstarQ2nstarQ1nstar = (pow(dImQ3n,2.)+pow(dReQ3n,2.)) | |
2895 | * (dImQ2n*dImQ3n*dReQ1n+dImQ1n*dImQ3n*dReQ2n | |
2896 | - dImQ1n*dImQ2n*dReQ3n+dReQ1n*dReQ2n*dReQ3n); | |
2897 | // Re[Q_{3n}Q_{3n}Q_{2n}^*Q_{2n}^*Q_{2n}^*] | |
2898 | Double_t reQ3nQ3nQ2nstarQ2nstarQ2nstar = pow(dReQ2n,3.)*pow(dReQ3n,2.) | |
2899 | - 3.*dReQ2n*pow(dReQ3n,2.)*pow(dImQ2n,2.) | |
2900 | + 6.*pow(dReQ2n,2.)*dReQ3n*dImQ2n*dImQ3n | |
2901 | - 2.*dReQ3n*pow(dImQ2n,3.)*dImQ3n-pow(dReQ2n,3.)*pow(dImQ3n,2.) | |
2902 | + 3.*dReQ2n*pow(dImQ2n,2.)*pow(dImQ3n,2.); | |
2903 | // Re[Q_{4n}Q_{2n}Q_{3n}^*Q_{2n}^*Q_{n}^*] | |
2904 | Double_t reQ4nQ2nQ3nstarQ2nstarQ1nstar = (pow(dImQ2n,2.)+pow(dReQ2n,2.)) | |
2905 | * (dImQ3n*dImQ4n*dReQ1n+dImQ1n*dImQ4n*dReQ3n | |
2906 | - dImQ1n*dImQ3n*dReQ4n+dReQ1n*dReQ3n*dReQ4n); | |
2907 | // Re[Q_{3n}Q_{2n}Q_{3n}^*Q_{n}^*Q_{n}^*] | |
2908 | Double_t reQ3nQ2nQ3nstarQ1nstarQ1nstar = -(pow(dImQ3n,2.)+pow(dReQ3n,2.)) | |
2909 | * (-2.*dImQ1n*dImQ2n*dReQ1n+pow(dImQ1n,2.)*dReQ2n-pow(dReQ1n,2.)*dReQ2n); | |
2910 | // Re[Q_{3n}Q_{2n}Q_{2n}^*Q_{2n}^*Q_{n}^*] | |
2911 | Double_t reQ3nQ2nQ2nstarQ2nstarQ1nstar = (pow(dImQ2n,2.)+pow(dReQ2n,2.)) | |
2912 | * (dImQ2n*dImQ3n*dReQ1n+dImQ1n*dImQ3n*dReQ2n | |
2913 | - dImQ1n*dImQ2n*dReQ3n+dReQ1n*dReQ2n*dReQ3n); | |
2914 | // Re[Q_{5n}Q_{n}Q_{3n}^*Q_{2n}^*Q_{n}^*] | |
2915 | Double_t reQ5nQ1nQ3nstarQ2nstarQ1nstar = (pow(dImQ1n,2.)+pow(dReQ1n,2.)) | |
2916 | * (dImQ3n*dImQ5n*dReQ2n+dImQ2n*dImQ5n*dReQ3n | |
2917 | - dImQ2n*dImQ3n*dReQ5n+dReQ2n*dReQ3n*dReQ5n); | |
2918 | // Re[Q_{2n}Q_{2n}Q_{n}^*Q_{n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 2919 | Double_t reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)*dReQ2n-2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.) |
2920 | + dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n-pow(dImQ1n,2.)*dImQ2n) | |
2921 | * (pow(dReQ1n,2.)*dReQ2n+2.*dReQ1n*dReQ2n*dImQ1n-dReQ2n*pow(dImQ1n,2.) | |
b84464d3 | 2922 | - dImQ2n*pow(dReQ1n,2.)+2.*dReQ1n*dImQ1n*dImQ2n+pow(dImQ1n,2.)*dImQ2n); |
2923 | // Re[Q_{3n}Q_{n}Q_{n}^*Q_{n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 2924 | Double_t reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = (pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
2925 | * (pow(dReQ1n,3.)*dReQ3n-3.*dReQ1n*dReQ3n*pow(dImQ1n,2.) | |
2926 | + 3.*pow(dReQ1n,2.)*dImQ1n*dImQ3n-pow(dImQ1n,3.)*dImQ3n); | |
489d5531 | 2927 | // |Q_{2n}|^2 |Q_{n}|^4 |
b84464d3 | 2928 | Double_t dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar = (pow(dReQ2n,2.)+pow(dImQ2n,2.))*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.); |
2929 | // |Q_{3n}|^2 |Q_{2n}|^2 |Q_{n}|^2 | |
2930 | Double_t dQ3nQ2nQ1nQ3nstarQ2nstarQ1nstar = (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
2931 | * (pow(dReQ1n,2.)+pow(dImQ1n,2.)); | |
2932 | // Re[Q_{2n}Q_{n}Q_{n}Q_{n}^*Q_{n}^*Q_{n}^*Q_{n}^*] | |
489d5531 | 2933 | Double_t reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar = pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) |
2934 | * (pow(dReQ1n,2.)*dReQ2n-dReQ2n*pow(dImQ1n,2.) | |
53884472 | 2935 | + 2.*dReQ1n*dImQ1n*dImQ2n); |
2936 | // Re[Q_{6n}Q_{2n}^*Q_{2n}^*Q_{n}^*Q_{n}^*] | |
2937 | Double_t reQ6nQ2nstarQ2nstarQ1nstarQ1nstar = pow(dReQ1n*dReQ2n,2.)*dReQ6n-pow(dReQ2n*dImQ1n,2.)*dReQ6n | |
2938 | - 4.*dReQ1n*dReQ2n*dReQ6n*dImQ1n*dImQ2n | |
2939 | - pow(dReQ1n*dImQ2n,2.)*dReQ6n+pow(dImQ1n*dImQ2n,2.)*dReQ6n | |
2940 | + 2.*dReQ1n*pow(dReQ2n,2.)*dImQ1n*dImQ6n | |
2941 | + 2.*pow(dReQ1n,2.)*dReQ2n*dImQ2n*dImQ6n | |
2942 | - 2.*dReQ2n*pow(dImQ1n,2.)*dImQ2n*dImQ6n | |
2943 | - 2.*dReQ1n*dImQ1n*pow(dImQ2n,2.)*dImQ6n; | |
2944 | // Re[Q_{4n}Q_{1n}Q_{1n}Q_{3n}^*Q_{3n}^*] | |
2945 | Double_t reQ4nQ1nQ1nQ3nstarQ3nstar = pow(dReQ1n*dReQ3n,2.)*dReQ4n-pow(dReQ3n*dImQ1n,2.)*dReQ4n | |
2946 | + 4.*dReQ1n*dReQ3n*dReQ4n*dImQ1n*dImQ3n | |
2947 | - pow(dReQ1n*dImQ3n,2.)*dReQ4n+pow(dImQ1n*dImQ3n,2.)*dReQ4n | |
2948 | - 2.*dReQ1n*pow(dReQ3n,2.)*dImQ1n*dImQ4n | |
2949 | + 2.*pow(dReQ1n,2.)*dReQ3n*dImQ3n*dImQ4n | |
2950 | - 2.*dReQ3n*pow(dImQ1n,2.)*dImQ3n*dImQ4n | |
2951 | + 2.*dReQ1n*dImQ1n*pow(dImQ3n,2.)*dImQ4n; | |
2952 | // Re[Q_{3n}Q_{3n}Q_{2n}^*Q_{2n}^*Q_{1n}^*Q_{1n}^*] | |
2953 | Double_t reQ3nQ3nQ2nstarQ2nstarQ1nstarQ1nstar = (dReQ1n*dReQ2n*dReQ3n-dReQ2n*dReQ3n*dImQ1n-dReQ1n*dReQ3n*dImQ2n | |
2954 | - dReQ3n*dImQ1n*dImQ2n+dReQ1n*dReQ2n*dImQ3n+dReQ2n*dImQ1n*dImQ3n | |
2955 | + dReQ1n*dImQ2n*dImQ3n-dImQ1n*dImQ2n*dImQ3n)*(dReQ1n*dReQ2n*dReQ3n | |
2956 | + dReQ2n*dReQ3n*dImQ1n+dReQ1n*dReQ3n*dImQ2n-dReQ3n*dImQ1n*dImQ2n | |
2957 | - dReQ1n*dReQ2n*dImQ3n+dReQ2n*dImQ1n*dImQ3n+dReQ1n*dImQ2n*dImQ3n | |
2958 | + dImQ1n*dImQ2n*dImQ3n); | |
489d5531 | 2959 | |
b84464d3 | 2960 | // Results for multiparticle azimuthal correlations: |
489d5531 | 2961 | // 2-particle: |
b84464d3 | 2962 | Double_t two1n1n = 0.; // <cos(n(phi1-phi2))> |
2963 | Double_t two2n2n = 0.; // <cos(2n(phi1-phi2))> | |
2964 | Double_t two3n3n = 0.; // <cos(3n(phi1-phi2))> | |
2965 | Double_t two4n4n = 0.; // <cos(4n(phi1-phi2))> | |
489d5531 | 2966 | if(dMult>1) |
2967 | { | |
2968 | two1n1n = (pow(dReQ1n,2.)+pow(dImQ1n,2.)-dMult)/(dMult*(dMult-1.)); | |
2969 | two2n2n = (pow(dReQ2n,2.)+pow(dImQ2n,2.)-dMult)/(dMult*(dMult-1.)); | |
2970 | two3n3n = (pow(dReQ3n,2.)+pow(dImQ3n,2.)-dMult)/(dMult*(dMult-1.)); | |
2971 | two4n4n = (pow(dReQ4n,2.)+pow(dImQ4n,2.)-dMult)/(dMult*(dMult-1.)); | |
b84464d3 | 2972 | // Average 2-particle correlations for single event: |
489d5531 | 2973 | fIntFlowCorrelationsAllEBE->SetBinContent(1,two1n1n); |
2974 | fIntFlowCorrelationsAllEBE->SetBinContent(2,two2n2n); | |
2975 | fIntFlowCorrelationsAllEBE->SetBinContent(3,two3n3n); | |
b84464d3 | 2976 | fIntFlowCorrelationsAllEBE->SetBinContent(4,two4n4n); |
2977 | // Average 2-particle correlations for all events: | |
2978 | fIntFlowCorrelationsAllPro->Fill(0.5,two1n1n,dMult*(dMult-1.)); | |
2979 | fIntFlowCorrelationsAllPro->Fill(1.5,two2n2n,dMult*(dMult-1.)); | |
2980 | fIntFlowCorrelationsAllPro->Fill(2.5,two3n3n,dMult*(dMult-1.)); | |
2981 | fIntFlowCorrelationsAllPro->Fill(3.5,two4n4n,dMult*(dMult-1.)); | |
2982 | // Store separetately <2>: | |
2983 | fIntFlowCorrelationsEBE->SetBinContent(1,two1n1n); // <2> | |
2984 | // Testing other multiplicity weights: | |
489d5531 | 2985 | Double_t mWeight2p = 0.; |
2986 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
2987 | { | |
2988 | mWeight2p = dMult*(dMult-1.); | |
2989 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
2990 | { | |
2991 | mWeight2p = 1.; | |
2992 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
2993 | { | |
2994 | mWeight2p = dMult; | |
b84464d3 | 2995 | } |
489d5531 | 2996 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(1,mWeight2p); // eW_<2> |
2997 | fIntFlowCorrelationsPro->Fill(0.5,two1n1n,mWeight2p); | |
b40a910e | 2998 | fIntFlowSquaredCorrelationsPro->Fill(0.5,two1n1n*two1n1n,mWeight2p); |
2999 | if(fCalculateCumulantsVsM) | |
3000 | { | |
3001 | fIntFlowCorrelationsVsMPro[0]->Fill(dMult+0.5,two1n1n,mWeight2p); | |
3002 | fIntFlowSquaredCorrelationsVsMPro[0]->Fill(dMult+0.5,two1n1n*two1n1n,mWeight2p); | |
3003 | } | |
3435cacb | 3004 | if(fCalculateAllCorrelationsVsM) |
3005 | { | |
3006 | fIntFlowCorrelationsAllVsMPro[0]->Fill(dMult+0.5,two1n1n,mWeight2p); | |
3007 | fIntFlowCorrelationsAllVsMPro[1]->Fill(dMult+0.5,two2n2n,mWeight2p); | |
3008 | fIntFlowCorrelationsAllVsMPro[2]->Fill(dMult+0.5,two3n3n,mWeight2p); | |
3009 | fIntFlowCorrelationsAllVsMPro[3]->Fill(dMult+0.5,two4n4n,mWeight2p); | |
3010 | } | |
489d5531 | 3011 | } // end of if(dMult>1) |
3012 | ||
3013 | // 3-particle: | |
b84464d3 | 3014 | Double_t three2n1n1n = 0.; // <cos(n(2*phi1-phi2-phi3))> |
3015 | Double_t three3n2n1n = 0.; // <cos(n(3*phi1-2*phi2-phi3))> | |
3016 | Double_t three4n2n2n = 0.; // <cos(n(4*phi1-2*phi2-2*phi3))> | |
3017 | Double_t three4n3n1n = 0.; // <cos(n(4*phi1-3*phi2-phi3))> | |
489d5531 | 3018 | if(dMult>2) |
3019 | { | |
3020 | three2n1n1n = (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3021 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult) | |
3022 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3023 | three3n2n1n = (reQ3nQ2nstarQ1nstar-(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3024 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3025 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
3026 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3027 | three4n2n2n = (reQ4nQ2nstarQ2nstar-2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3028 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*dMult) | |
3029 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3030 | three4n3n1n = (reQ4nQ3nstarQ1nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3031 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3032 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
b84464d3 | 3033 | / (dMult*(dMult-1.)*(dMult-2.)); |
3034 | // Average 3-particle correlations for single event: | |
489d5531 | 3035 | fIntFlowCorrelationsAllEBE->SetBinContent(6,three2n1n1n); |
3036 | fIntFlowCorrelationsAllEBE->SetBinContent(7,three3n2n1n); | |
3037 | fIntFlowCorrelationsAllEBE->SetBinContent(8,three4n2n2n); | |
3038 | fIntFlowCorrelationsAllEBE->SetBinContent(9,three4n3n1n); | |
b84464d3 | 3039 | // Average 3-particle correlations for all events: |
489d5531 | 3040 | fIntFlowCorrelationsAllPro->Fill(5.5,three2n1n1n,dMult*(dMult-1.)*(dMult-2.)); |
3041 | fIntFlowCorrelationsAllPro->Fill(6.5,three3n2n1n,dMult*(dMult-1.)*(dMult-2.)); | |
3042 | fIntFlowCorrelationsAllPro->Fill(7.5,three4n2n2n,dMult*(dMult-1.)*(dMult-2.)); | |
3435cacb | 3043 | fIntFlowCorrelationsAllPro->Fill(8.5,three4n3n1n,dMult*(dMult-1.)*(dMult-2.)); |
b84464d3 | 3044 | // Average 3-particle correlations vs M for all events: |
3435cacb | 3045 | if(fCalculateAllCorrelationsVsM) |
3046 | { | |
3047 | fIntFlowCorrelationsAllVsMPro[5]->Fill(dMult+0.5,three2n1n1n,dMult*(dMult-1.)*(dMult-2.)); | |
3048 | fIntFlowCorrelationsAllVsMPro[6]->Fill(dMult+0.5,three3n2n1n,dMult*(dMult-1.)*(dMult-2.)); | |
3049 | fIntFlowCorrelationsAllVsMPro[7]->Fill(dMult+0.5,three4n2n2n,dMult*(dMult-1.)*(dMult-2.)); | |
3050 | fIntFlowCorrelationsAllVsMPro[8]->Fill(dMult+0.5,three4n3n1n,dMult*(dMult-1.)*(dMult-2.)); | |
3051 | } | |
489d5531 | 3052 | } // end of if(dMult>2) |
3053 | ||
3054 | // 4-particle: | |
b84464d3 | 3055 | Double_t four1n1n1n1n = 0.; // <cos(n(phi1+phi2-phi3-phi4))> |
3056 | Double_t four2n2n2n2n = 0.; // <cos(2n(phi1+phi2-phi3-phi4))> | |
3057 | Double_t four2n1n2n1n = 0.; // <cos(n(2*phi1+phi2-2*phi3-phi4))> | |
3058 | Double_t four3n1n1n1n = 0.; // <cos(n(3*phi1-phi2-phi3-phi4))> | |
3059 | Double_t four4n2n1n1n = 0.; // <cos(n(4*phi1-2*phi2-phi3-phi4))> | |
3060 | Double_t four3n1n2n2n = 0.; // <cos(n(3*phi1+phi2-2*phi3-2*phi4))> | |
3061 | Double_t four3n1n3n1n = 0.; // <cos(n(3*phi1+phi2-3*phi3-phi4))> | |
489d5531 | 3062 | if(dMult>3) |
3063 | { | |
3064 | four1n1n1n1n = (2.*dMult*(dMult-3.)+pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ1n,2.) | |
3065 | + pow(dImQ1n,2.))-2.*reQ2nQ1nstarQ1nstar+(pow(dReQ2n,2.)+pow(dImQ2n,2.))) | |
3066 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
3067 | four2n2n2n2n = (2.*dMult*(dMult-3.)+pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ2n,2.) | |
3068 | + pow(dImQ2n,2.))-2.*reQ4nQ2nstarQ2nstar+(pow(dReQ4n,2.)+pow(dImQ4n,2.))) | |
3069 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
3070 | four2n1n2n1n = (dQ2nQ1nQ2nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar-2.*reQ2nQ1nstarQ1nstar) | |
3071 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3072 | - ((dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3073 | + (dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-(pow(dReQ3n,2.)+pow(dImQ3n,2.))) | |
3074 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3075 | + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3076 | four3n1n1n1n = (reQ3nQ1nstarQ1nstarQ1nstar-3.*reQ3nQ2nstarQ1nstar-3.*reQ2nQ1nstarQ1nstar |
3077 | + 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
489d5531 | 3078 | + 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) |
3079 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3080 | four4n2n1n1n = (reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ4nQ3nstarQ1nstar-reQ4nQ2nstarQ2nstar-2.*reQ3nQ2nstarQ1nstar) | |
3081 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3082 | - (reQ2nQ1nstarQ1nstar-2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3083 | - 3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) | |
3084 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3085 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3086 | four3n1n2n2n = (reQ3nQ1nQ2nstarQ2nstar-reQ4nQ2nstarQ2nstar-reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar) |
489d5531 | 3087 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) |
b84464d3 | 3088 | - (2.*reQ2nQ1nstarQ1nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.))-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) |
489d5531 | 3089 | - 4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))) |
3090 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3091 | - 6./((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3092 | four3n1n3n1n = ((pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
b84464d3 | 3093 | - 2.*reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar |
3094 | + pow(dReQ4n,2.)+pow(dImQ4n,2.)-(dMult-4.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3095 | + pow(dReQ2n,2.)+pow(dImQ2n,2.)-(dMult-4.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3096 | + dMult*(dMult-6.)) | |
3097 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3098 | // Average 4-particle correlations for single event: | |
489d5531 | 3099 | fIntFlowCorrelationsAllEBE->SetBinContent(11,four1n1n1n1n); |
3100 | fIntFlowCorrelationsAllEBE->SetBinContent(12,four2n1n2n1n); | |
3101 | fIntFlowCorrelationsAllEBE->SetBinContent(13,four2n2n2n2n); | |
3102 | fIntFlowCorrelationsAllEBE->SetBinContent(14,four3n1n1n1n); | |
3103 | fIntFlowCorrelationsAllEBE->SetBinContent(15,four3n1n3n1n); | |
3104 | fIntFlowCorrelationsAllEBE->SetBinContent(16,four3n1n2n2n); | |
b84464d3 | 3105 | fIntFlowCorrelationsAllEBE->SetBinContent(17,four4n2n1n1n); |
3106 | // Average 4-particle correlations for all events: | |
489d5531 | 3107 | fIntFlowCorrelationsAllPro->Fill(10.5,four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
3108 | fIntFlowCorrelationsAllPro->Fill(11.5,four2n1n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3109 | fIntFlowCorrelationsAllPro->Fill(12.5,four2n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3110 | fIntFlowCorrelationsAllPro->Fill(13.5,four3n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3111 | fIntFlowCorrelationsAllPro->Fill(14.5,four3n1n3n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3112 | fIntFlowCorrelationsAllPro->Fill(15.5,four3n1n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3113 | fIntFlowCorrelationsAllPro->Fill(16.5,four4n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
3114 | // Average 4-particle correlations vs M for all events: | |
3435cacb | 3115 | if(fCalculateAllCorrelationsVsM) |
3116 | { | |
3117 | fIntFlowCorrelationsAllVsMPro[10]->Fill(dMult+0.5,four1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3118 | fIntFlowCorrelationsAllVsMPro[11]->Fill(dMult+0.5,four2n1n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3119 | fIntFlowCorrelationsAllVsMPro[12]->Fill(dMult+0.5,four2n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3120 | fIntFlowCorrelationsAllVsMPro[13]->Fill(dMult+0.5,four3n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3121 | fIntFlowCorrelationsAllVsMPro[14]->Fill(dMult+0.5,four3n1n3n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3122 | fIntFlowCorrelationsAllVsMPro[15]->Fill(dMult+0.5,four3n1n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3123 | fIntFlowCorrelationsAllVsMPro[16]->Fill(dMult+0.5,four4n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3124 | } |
3125 | // Store separetately <4>: | |
489d5531 | 3126 | fIntFlowCorrelationsEBE->SetBinContent(2,four1n1n1n1n); // <4> |
b84464d3 | 3127 | // Testing other multiplicity weights: |
489d5531 | 3128 | Double_t mWeight4p = 0.; |
3129 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
3130 | { | |
3131 | mWeight4p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
3132 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
3133 | { | |
3134 | mWeight4p = 1.; | |
3135 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
3136 | { | |
3137 | mWeight4p = dMult; | |
b84464d3 | 3138 | } |
489d5531 | 3139 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(2,mWeight4p); // eW_<4> |
3140 | fIntFlowCorrelationsPro->Fill(1.5,four1n1n1n1n,mWeight4p); | |
b40a910e | 3141 | fIntFlowSquaredCorrelationsPro->Fill(1.5,four1n1n1n1n*four1n1n1n1n,mWeight4p); |
3142 | if(fCalculateCumulantsVsM) | |
3143 | { | |
3144 | fIntFlowCorrelationsVsMPro[1]->Fill(dMult+0.5,four1n1n1n1n,mWeight4p); | |
3145 | fIntFlowSquaredCorrelationsVsMPro[1]->Fill(dMult+0.5,four1n1n1n1n*four1n1n1n1n,mWeight4p); | |
3146 | } | |
489d5531 | 3147 | } // end of if(dMult>3) |
3148 | ||
3149 | // 5-particle: | |
b84464d3 | 3150 | Double_t five2n1n1n1n1n = 0.; // <cos(n(2*phi1+phi2-phi3-phi4-phi5))> |
3151 | Double_t five2n2n2n1n1n = 0.; // <cos(n(2*phi1+2*phi2-2*phi3-phi4-phi5))> | |
3152 | Double_t five3n1n2n1n1n = 0.; // <cos(n(3*phi1+phi2-2*phi3-phi4-phi5))> | |
3153 | Double_t five4n1n1n1n1n = 0.; // <cos(n(4*phi1-phi2-phi3-phi4-phi5))> | |
489d5531 | 3154 | if(dMult>4) |
b84464d3 | 3155 | { |
3156 | five2n1n1n1n1n = (reQ2nQ1nQ1nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar+5.*reQ3nQ2nstarQ1nstar | |
3157 | - 3.*(dMult-5.)*reQ2nQ1nstarQ1nstar-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3158 | - 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3159 | + 3.*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3160 | - 3.*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
3161 | + 6.*(2.*dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult*(dMult-4.)) | |
489d5531 | 3162 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
b84464d3 | 3163 | five2n2n2n1n1n = (reQ2nQ2nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-2.*reQ3nQ1nQ2nstarQ2nstar |
3164 | + 3.*reQ4nQ2nstarQ2nstar+8.*reQ3nQ2nstarQ1nstar+2.*reQ4nQ3nstarQ1nstar | |
3165 | - 2.*(dMult-6.)*reQ2nQ1nstarQ1nstar | |
3166 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3167 | - pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.) | |
3168 | + 2.*(3.*dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3169 | - 4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3170 | + 4.*(dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*dMult*(dMult-6.)) | |
489d5531 | 3171 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
b84464d3 | 3172 | five4n1n1n1n1n = (reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ4nQ2nstarQ1nstarQ1nstar-4.*reQ3nQ1nstarQ1nstarQ1nstar |
3173 | + 8.*reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar+12.*reQ3nQ2nstarQ1nstar+12.*reQ2nQ1nstarQ1nstar | |
3174 | - 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-8.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3175 | - 12.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-24.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+24.*dMult) | |
3176 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3177 | five3n1n2n1n1n = (reQ3nQ1nQ2nstarQ1nstarQ1nstar-reQ4nQ2nstarQ1nstarQ1nstar-reQ3nQ1nstarQ1nstarQ1nstar | |
3178 | - reQ3nQ1nQ2nstarQ2nstar+4.*reQ4nQ3nstarQ1nstar+reQ4nQ2nstarQ2nstar | |
3179 | - (2.*dMult-13.)*reQ3nQ2nstarQ1nstar+7.*reQ2nQ1nstarQ1nstar | |
3180 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3181 | + 2.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3182 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3183 | + 2.*(dMult-6.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
489d5531 | 3184 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) |
3185 | - pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
b84464d3 | 3186 | + 2.*(3.*dMult-11.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*dMult*(dMult-6.)) |
3187 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3188 | // Average 5-particle correlations for single event: | |
489d5531 | 3189 | fIntFlowCorrelationsAllEBE->SetBinContent(19,five2n1n1n1n1n); |
3190 | fIntFlowCorrelationsAllEBE->SetBinContent(20,five2n2n2n1n1n); | |
3191 | fIntFlowCorrelationsAllEBE->SetBinContent(21,five3n1n2n1n1n); | |
b84464d3 | 3192 | fIntFlowCorrelationsAllEBE->SetBinContent(22,five4n1n1n1n1n); |
3193 | // Average 5-particle correlations for all events: | |
489d5531 | 3194 | fIntFlowCorrelationsAllPro->Fill(18.5,five2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
3195 | fIntFlowCorrelationsAllPro->Fill(19.5,five2n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3196 | fIntFlowCorrelationsAllPro->Fill(20.5,five3n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
b84464d3 | 3197 | fIntFlowCorrelationsAllPro->Fill(21.5,five4n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
3198 | // Average 5-particle correlations vs M for all events: | |
3435cacb | 3199 | if(fCalculateAllCorrelationsVsM) |
3200 | { | |
3201 | fIntFlowCorrelationsAllVsMPro[18]->Fill(dMult+0.5,five2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3202 | fIntFlowCorrelationsAllVsMPro[19]->Fill(dMult+0.5,five2n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3203 | fIntFlowCorrelationsAllVsMPro[20]->Fill(dMult+0.5,five3n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3204 | fIntFlowCorrelationsAllVsMPro[21]->Fill(dMult+0.5,five4n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3205 | } | |
489d5531 | 3206 | } // end of if(dMult>4) |
3207 | ||
3208 | // 6-particle: | |
b84464d3 | 3209 | Double_t six1n1n1n1n1n1n = 0.; // <cos(n(phi1+phi2+phi3-phi4-phi5-phi6))> |
3210 | Double_t six2n2n1n1n1n1n = 0.; // <cos(n(2*phi1+2*phi2-phi3-phi4-phi5-phi6))> | |
3211 | Double_t six3n1n1n1n1n1n = 0.; // <cos(n(3*phi1+phi2-phi3-phi4-phi5-phi6))> | |
3212 | Double_t six2n1n1n2n1n1n = 0.; // <cos(n(2*phi1+phi2+phi3-2*phi4-phi5-phi6))> | |
489d5531 | 3213 | if(dMult>5) |
3214 | { | |
b84464d3 | 3215 | six1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),3.)-6.*reQ2nQ1nQ1nstarQ1nstarQ1nstar |
3216 | + 4.*reQ3nQ1nstarQ1nstarQ1nstar-12.*reQ3nQ2nstarQ1nstar+18.*(dMult-4.)*reQ2nQ1nstarQ1nstar | |
3217 | + 9.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3218 | + 4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))-9.*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3219 | - 9.*(dMult-4.)*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
3220 | + 18.*(dMult*dMult-7.*dMult+10.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3221 | - 6.*dMult*(dMult*dMult-9.*dMult+20.)) | |
3222 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3223 | six2n1n1n2n1n1n = (dQ2nQ1nQ1nQ2nstarQ1nstarQ1nstar-4.*reQ3nQ1nQ2nstarQ1nstarQ1nstar | |
3224 | - 4.*reQ2nQ1nQ1nstarQ1nstarQ1nstar-2.*reQ2nQ2nQ2nstarQ1nstarQ1nstar | |
3225 | + 4.*reQ4nQ2nstarQ1nstarQ1nstar+4.*reQ3nQ1nQ2nstarQ2nstar+4.*reQ3nQ1nstarQ1nstarQ1nstar | |
3226 | - 8.*reQ4nQ3nstarQ1nstar-4.*reQ4nQ2nstarQ2nstar+4.*(2.*dMult-13.)*reQ3nQ2nstarQ1nstar | |
3227 | + 2.*(7.*dMult-34.)*reQ2nQ1nstarQ1nstar+4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3228 | - 4.*(dMult-7.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3229 | + 4.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-4.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3230 | + pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)+(2.*dMult*dMult-27.*dMult+76.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3231 | - (dMult-12.)*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
3232 | + 4.*(dMult*dMult-15.*dMult+34.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3233 | - 2.*dMult*(dMult*dMult-17.*dMult+60.)) | |
3234 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3235 | six2n2n1n1n1n1n = (reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ2nQ2nQ2nstarQ1nstarQ1nstar-reQ4nQ1nstarQ1nstarQ1nstarQ1nstar | |
3236 | - 8.*reQ2nQ1nQ1nstarQ1nstarQ1nstar+8.*reQ3nQ1nstarQ1nstarQ1nstar+6.*reQ4nQ2nstarQ1nstarQ1nstar | |
3237 | + 8.*reQ3nQ1nQ2nstarQ2nstar-40.*reQ3nQ2nstarQ1nstar-8.*reQ4nQ3nstarQ1nstar-9.*reQ4nQ2nstarQ2nstar | |
3238 | + 24.*(dMult-4.)*reQ2nQ1nstarQ1nstar+24.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3239 | + 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+16.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3240 | + 3.*pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)-12.*(2.*dMult-7.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3241 | + 12.*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)-48.*(dMult-3.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3242 | + 24.*dMult*(dMult-5.)) | |
3243 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3244 | six3n1n1n1n1n1n = (reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-6.*reQ3nQ1nQ2nstarQ1nstarQ1nstar+6.*reQ4nQ2nstarQ1nstarQ1nstar | |
3245 | - reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-4.*reQ2nQ1nQ1nstarQ1nstarQ1nstar+3.*reQ3nQ1nQ2nstarQ2nstar | |
3246 | - 4.*(dMult-5.)*reQ3nQ1nstarQ1nstarQ1nstar-14.*reQ4nQ3nstarQ1nstar | |
3247 | - 3.*reQ4nQ2nstarQ2nstar+4.*(3.*dMult-17.)*reQ3nQ2nstarQ1nstar+12.*(dMult-6.)*reQ2nQ1nstarQ1nstar | |
3248 | + 12.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3249 | + 8.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3250 | + 6.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-8.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3251 | - 12.*(dMult-5.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-48.*(dMult-3.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3252 | + 12.*pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.)+24.*dMult*(dMult-5.)) | |
3253 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3254 | // Average 6-particle correlations for single event: | |
489d5531 | 3255 | fIntFlowCorrelationsAllEBE->SetBinContent(24,six1n1n1n1n1n1n); |
3256 | fIntFlowCorrelationsAllEBE->SetBinContent(25,six2n1n1n2n1n1n); | |
3257 | fIntFlowCorrelationsAllEBE->SetBinContent(26,six2n2n1n1n1n1n); | |
3258 | fIntFlowCorrelationsAllEBE->SetBinContent(27,six3n1n1n1n1n1n); | |
b84464d3 | 3259 | // Average 6-particle correlations for all events: |
489d5531 | 3260 | fIntFlowCorrelationsAllPro->Fill(23.5,six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
3261 | fIntFlowCorrelationsAllPro->Fill(24.5,six2n1n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3262 | fIntFlowCorrelationsAllPro->Fill(25.5,six2n2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3263 | fIntFlowCorrelationsAllPro->Fill(26.5,six3n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
b84464d3 | 3264 | // Average 6-particle correlations vs M for all events: |
3435cacb | 3265 | if(fCalculateAllCorrelationsVsM) |
3266 | { | |
3267 | fIntFlowCorrelationsAllVsMPro[23]->Fill(dMult+0.5,six1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3268 | fIntFlowCorrelationsAllVsMPro[24]->Fill(dMult+0.5,six2n1n1n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3269 | fIntFlowCorrelationsAllVsMPro[25]->Fill(dMult+0.5,six2n2n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3270 | fIntFlowCorrelationsAllVsMPro[26]->Fill(dMult+0.5,six3n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
3271 | } | |
b84464d3 | 3272 | // Store separetately <6>: |
489d5531 | 3273 | fIntFlowCorrelationsEBE->SetBinContent(3,six1n1n1n1n1n1n); // <6> |
b84464d3 | 3274 | // Testing other multiplicity weights: |
489d5531 | 3275 | Double_t mWeight6p = 0.; |
3276 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
3277 | { | |
3278 | mWeight6p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.); | |
3279 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
3280 | { | |
3281 | mWeight6p = 1.; | |
3282 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
3283 | { | |
3284 | mWeight6p = dMult; | |
3285 | } | |
489d5531 | 3286 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(3,mWeight6p); // eW_<6> |
3287 | fIntFlowCorrelationsPro->Fill(2.5,six1n1n1n1n1n1n,mWeight6p); | |
b40a910e | 3288 | fIntFlowSquaredCorrelationsPro->Fill(2.5,six1n1n1n1n1n1n*six1n1n1n1n1n1n,mWeight6p); |
3289 | if(fCalculateCumulantsVsM) | |
3290 | { | |
3291 | fIntFlowCorrelationsVsMPro[2]->Fill(dMult+0.5,six1n1n1n1n1n1n,mWeight6p); | |
3292 | fIntFlowSquaredCorrelationsVsMPro[2]->Fill(dMult+0.5,six1n1n1n1n1n1n*six1n1n1n1n1n1n,mWeight6p); | |
3293 | } | |
489d5531 | 3294 | } // end of if(dMult>5) |
3295 | ||
3296 | // 7-particle: | |
b84464d3 | 3297 | Double_t seven2n1n1n1n1n1n1n = 0.; // <cos(n(2*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> |
489d5531 | 3298 | if(dMult>6) |
3299 | { | |
b84464d3 | 3300 | seven2n1n1n1n1n1n1n = (reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar-4.*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),3.) |
3301 | - reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar-2.*reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar | |
3302 | + 9.*reQ2nQ2nQ2nstarQ1nstarQ1nstar+20.*reQ3nQ1nQ2nstarQ1nstarQ1nstar | |
3303 | + 2.*reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-8.*(dMult-8.)*reQ2nQ1nQ1nstarQ1nstarQ1nstar | |
3304 | - 18.*reQ4nQ2nstarQ1nstarQ1nstar-14.*reQ3nQ1nQ2nstarQ2nstar | |
3305 | + 8.*(dMult-7.)*reQ3nQ1nstarQ1nstarQ1nstar+28.*reQ4nQ3nstarQ1nstar | |
3306 | + 12.*reQ4nQ2nstarQ2nstar-8.*(5.*dMult-31.)*reQ3nQ2nstarQ1nstar | |
3307 | + 12.*(dMult*dMult-15.*dMult+46.)*reQ2nQ1nstarQ1nstar | |
3308 | - 16.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3309 | - 6.*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),2.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3310 | - 3.*pow(pow(dReQ2n,2.)+pow(dImQ2n,2.),2.) | |
3311 | + 12.*(2.*dMult-13.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3312 | - 12.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+16.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3313 | - 12.*(dMult-8.)*(dMult-4.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3314 | + 12.*(3.*dMult-14.)*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),2.) | |
3315 | - 24.*(3.*dMult-7.)*(dMult-6.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3316 | + 24.*dMult*(dMult-5.)*(dMult-6.)) | |
3317 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)); | |
3318 | // Average 7-particle correlations for single event: | |
3319 | fIntFlowCorrelationsAllEBE->SetBinContent(29,seven2n1n1n1n1n1n1n); | |
3320 | // Average 7-particle correlations for all events: | |
3321 | fIntFlowCorrelationsAllPro->Fill(28.5,seven2n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) | |
3322 | *(dMult-4.)*(dMult-5.)*(dMult-6.)); | |
3323 | // Average 7-particle correlations vs M for all events: | |
3435cacb | 3324 | if(fCalculateAllCorrelationsVsM) |
3325 | { | |
b84464d3 | 3326 | fIntFlowCorrelationsAllVsMPro[28]->Fill(dMult+0.5,seven2n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) |
3327 | *(dMult-4.)*(dMult-5.)*(dMult-6.)); | |
3435cacb | 3328 | } |
489d5531 | 3329 | } // end of if(dMult>6) |
3330 | ||
3331 | // 8-particle: | |
b84464d3 | 3332 | Double_t eight1n1n1n1n1n1n1n1n = 0.; // <cos(n(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> |
489d5531 | 3333 | if(dMult>7) |
b84464d3 | 3334 | { |
3335 | eight1n1n1n1n1n1n1n1n = (pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),4.)-12.*reQ2nQ1nQ1nQ1nstarQ1nstarQ1nstarQ1nstar | |
3336 | + 16.*reQ3nQ1nQ1nstarQ1nstarQ1nstarQ1nstar+6.*reQ2nQ2nQ1nstarQ1nstarQ1nstarQ1nstar | |
3337 | - 12.*reQ4nQ1nstarQ1nstarQ1nstarQ1nstar-36.*reQ2nQ2nQ2nstarQ1nstarQ1nstar | |
3338 | - 96.*reQ3nQ1nQ2nstarQ1nstarQ1nstar | |
3339 | + 72.*reQ4nQ2nstarQ1nstarQ1nstar+48.*reQ3nQ1nQ2nstarQ2nstar | |
3340 | - 64.*(dMult-6.)*reQ3nQ1nstarQ1nstarQ1nstar | |
3341 | + 96.*(dMult-6.)*reQ2nQ1nQ1nstarQ1nstarQ1nstar | |
3342 | - 96.*reQ4nQ3nstarQ1nstar-36.*reQ4nQ2nstarQ2nstar | |
3343 | + 192.*(dMult-6.)*reQ3nQ2nstarQ1nstar | |
3344 | - 144.*(dMult-7.)*(dMult-4.)*reQ2nQ1nstarQ1nstar | |
3345 | + 64.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3346 | - 144.*(dMult-6.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3347 | + 72.*(dMult-7.)*(dMult-4.)*(pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3348 | - 96.*(dMult-7.)*(dMult-6.)*(dMult-2.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3349 | + 36.*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),2.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3350 | + 9.*pow(pow(dReQ2n,2.)+pow(dImQ2n,2.),2.) | |
3351 | - 64.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3352 | + 36.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3353 | - 16.*(dMult-6.)*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),3.) | |
3354 | + 24.*dMult*(dMult-7.)*(dMult-6.)*(dMult-5.)) | |
3355 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); | |
3356 | // Average 8-particle correlations for single event: | |
3357 | fIntFlowCorrelationsAllEBE->SetBinContent(31,eight1n1n1n1n1n1n1n1n); | |
3358 | // Average 8-particle correlations for all events: | |
3359 | fIntFlowCorrelationsAllPro->Fill(30.5,eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) | |
3360 | *(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); | |
3361 | // Average 8-particle correlations vs M for all events: | |
3435cacb | 3362 | if(fCalculateAllCorrelationsVsM) |
3363 | { | |
b84464d3 | 3364 | fIntFlowCorrelationsAllVsMPro[30]->Fill(dMult+0.5,eight1n1n1n1n1n1n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.) |
3365 | *(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.)); | |
3366 | } | |
3367 | // Store separetately <8>: | |
489d5531 | 3368 | fIntFlowCorrelationsEBE->SetBinContent(4,eight1n1n1n1n1n1n1n1n); // <8> |
b84464d3 | 3369 | // Testing other multiplicity weights: |
489d5531 | 3370 | Double_t mWeight8p = 0.; |
3371 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
3372 | { | |
3373 | mWeight8p = dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)*(dMult-6.)*(dMult-7.); | |
3374 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
3375 | { | |
3376 | mWeight8p = 1.; | |
3377 | } else if(!strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
3378 | { | |
3379 | mWeight8p = dMult; | |
b84464d3 | 3380 | } |
489d5531 | 3381 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(4,mWeight8p); // eW_<8> |
b40a910e | 3382 | fIntFlowCorrelationsPro->Fill(3.5,eight1n1n1n1n1n1n1n1n,mWeight8p); |
3383 | fIntFlowSquaredCorrelationsPro->Fill(3.5,eight1n1n1n1n1n1n1n1n*eight1n1n1n1n1n1n1n1n,mWeight8p); | |
3384 | if(fCalculateCumulantsVsM) | |
3385 | { | |
3386 | fIntFlowCorrelationsVsMPro[3]->Fill(dMult+0.5,eight1n1n1n1n1n1n1n1n,mWeight8p); | |
3387 | fIntFlowSquaredCorrelationsVsMPro[3]->Fill(dMult+0.5,eight1n1n1n1n1n1n1n1n*eight1n1n1n1n1n1n1n1n,mWeight8p); | |
3388 | } | |
489d5531 | 3389 | } // end of if(dMult>7) |
3390 | ||
b84464d3 | 3391 | // EXTRA correlations for v3{5} study: |
8ed4edc7 | 3392 | // 4-particle: |
b84464d3 | 3393 | Double_t four4n2n3n3n = 0.; // <cos(n(4*phi1+2*phi2-3*phi3-3*phi4))> |
8ed4edc7 | 3394 | if(dMult>3.) |
3395 | { | |
11d3e40e | 3396 | four4n2n3n3n = (reQ4nQ2nQ3nstarQ3nstar-reQ6nQ4nstarQ2nstar-reQ6nQ3nstarQ3nstar |
3397 | - 2.*reQ4nQ3nstarQ1nstar-2.*reQ3nQ2nstarQ1nstar | |
3398 | + (pow(dReQ6n,2.)+pow(dImQ6n,2.))+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3399 | + 2.*(2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3400 | + (pow(dReQ1n,2.)+pow(dImQ1n,2.))-3.*dMult)) | |
b84464d3 | 3401 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
8ed4edc7 | 3402 | fIntFlowCorrelationsAllPro->Fill(32.5,four4n2n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
b84464d3 | 3403 | // Average 4-particle correlations vs M for all events: |
3435cacb | 3404 | if(fCalculateAllCorrelationsVsM) |
3405 | { | |
3406 | fIntFlowCorrelationsAllVsMPro[32]->Fill(dMult+0.5,four4n2n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3407 | } | |
11d3e40e | 3408 | } // end of if(dMult>3.) |
8ed4edc7 | 3409 | |
3410 | // 5-particle: | |
b84464d3 | 3411 | Double_t five3n3n2n2n2n = 0.; // <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-2*phi5))> |
8ed4edc7 | 3412 | if(dMult>4.) |
3413 | { | |
b84464d3 | 3414 | five3n3n2n2n2n = (reQ3nQ3nQ2nstarQ2nstarQ2nstar-reQ6nQ2nstarQ2nstarQ2nstar-3.*reQ4nQ2nQ3nstarQ3nstar |
3415 | - 6.*reQ3nQ1nQ2nstarQ2nstar+2.*reQ6nQ3nstarQ3nstar+3.*reQ6nQ4nstarQ2nstar | |
3416 | + 6.*reQ4nQ3nstarQ1nstar+6.*reQ4nQ2nstarQ2nstar | |
3417 | + 12.*reQ3nQ2nstarQ1nstar+6.*reQ2nQ1nstarQ1nstar | |
11d3e40e | 3418 | - 2.*((pow(dReQ6n,2.)+pow(dImQ6n,2.)) |
3419 | + 3.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3420 | + 6.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3421 | + 9.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3422 | + 6.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-12.*dMult)) | |
b84464d3 | 3423 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
3424 | fIntFlowCorrelationsAllPro->Fill(33.5,five3n3n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3435cacb | 3425 | if(fCalculateAllCorrelationsVsM) |
3426 | { | |
b84464d3 | 3427 | fIntFlowCorrelationsAllVsMPro[33]->Fill(dMult+0.5,five3n3n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
3435cacb | 3428 | } |
11d3e40e | 3429 | } // end of if(dMult>4.) |
8ed4edc7 | 3430 | |
b84464d3 | 3431 | // EXTRA correlations for Teaney-Yan study: |
3432 | // 2-particle: | |
3433 | Double_t two5n5n = 0.; // <cos(5n(phi1-phi2))> | |
3434 | Double_t two6n6n = 0.; // <cos(6n(phi1-phi2))> | |
3435 | if(dMult>1) | |
3436 | { | |
3437 | two5n5n = (pow(dReQ5n,2.)+pow(dImQ5n,2.)-dMult)/(dMult*(dMult-1.)); | |
3438 | two6n6n = (pow(dReQ6n,2.)+pow(dImQ6n,2.)-dMult)/(dMult*(dMult-1.)); | |
3439 | // Average 2-particle correlations for all events: | |
3440 | fIntFlowCorrelationsAllPro->Fill(34.5,two5n5n,dMult*(dMult-1.)); | |
3441 | fIntFlowCorrelationsAllPro->Fill(35.5,two6n6n,dMult*(dMult-1.)); | |
3442 | if(fCalculateAllCorrelationsVsM) | |
3443 | { | |
3444 | fIntFlowCorrelationsAllVsMPro[34]->Fill(dMult+0.5,two5n5n,dMult*(dMult-1.)); | |
3445 | fIntFlowCorrelationsAllVsMPro[35]->Fill(dMult+0.5,two6n6n,dMult*(dMult-1.)); | |
3446 | } | |
3447 | } // end of if(dMult>1) | |
3448 | ||
3449 | // 3-particle: | |
3450 | Double_t three5n3n2n = 0.; // <cos(n(5*phi1-3*phi2-2*phi3)> | |
3451 | Double_t three5n4n1n = 0.; // <cos(n(5*phi1-4*phi2-1*phi3)> | |
3452 | Double_t three6n3n3n = 0.; // <cos(n(6*phi1-3*phi2-3*phi3)> | |
3453 | Double_t three6n4n2n = 0.; // <cos(n(6*phi1-4*phi2-2*phi3)> | |
3454 | Double_t three6n5n1n = 0.; // <cos(n(6*phi1-5*phi2-1*phi3)> | |
3455 | if(dMult>2) | |
3456 | { | |
3457 | three5n3n2n = (reQ5nQ3nstarQ2nstar-(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3458 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3459 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult) | |
3460 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3461 | three5n4n1n = (reQ5nQ4nstarQ1nstar-(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3462 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3463 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
3464 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3465 | three6n3n3n = (reQ6nQ3nstarQ3nstar-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3466 | - (pow(dReQ6n,2.)+pow(dImQ6n,2.))+2.*dMult) | |
3467 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3468 | three6n4n2n = (reQ6nQ4nstarQ2nstar-(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
3469 | - (pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3470 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*dMult) | |
3471 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3472 | three6n5n1n = (reQ6nQ5nstarQ1nstar-(pow(dReQ6n,2.)+pow(dImQ6n,2.)) | |
3473 | - (pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3474 | - (pow(dReQ1n,2.)+pow(dImQ1n,2.))+2.*dMult) | |
3475 | / (dMult*(dMult-1.)*(dMult-2.)); | |
3476 | // Average 3-particle correlations for all events: | |
3477 | fIntFlowCorrelationsAllPro->Fill(36.5,three5n3n2n,dMult*(dMult-1.)*(dMult-2.)); // <<cos(n(5*phi1-3*phi2-2*phi3)>> | |
3478 | fIntFlowCorrelationsAllPro->Fill(37.5,three5n4n1n,dMult*(dMult-1.)*(dMult-2.)); // <<cos(n(5*phi1-4*phi2-1*phi3)>> | |
3479 | fIntFlowCorrelationsAllPro->Fill(38.5,three6n3n3n,dMult*(dMult-1.)*(dMult-2.)); // <<cos(n(6*phi1-3*phi2-3*phi3)>> | |
3480 | fIntFlowCorrelationsAllPro->Fill(39.5,three6n4n2n,dMult*(dMult-1.)*(dMult-2.)); // <<cos(n(6*phi1-4*phi2-2*phi3)>> | |
3481 | fIntFlowCorrelationsAllPro->Fill(40.5,three6n5n1n,dMult*(dMult-1.)*(dMult-2.)); // <<cos(n(6*phi1-5*phi2-1*phi3)>> | |
3482 | if(fCalculateAllCorrelationsVsM) | |
3483 | { | |
3484 | fIntFlowCorrelationsAllVsMPro[36]->Fill(dMult+0.5,three5n3n2n,dMult*(dMult-1.)*(dMult-2.)); | |
3485 | fIntFlowCorrelationsAllVsMPro[37]->Fill(dMult+0.5,three5n4n1n,dMult*(dMult-1.)*(dMult-2.)); | |
3486 | fIntFlowCorrelationsAllVsMPro[38]->Fill(dMult+0.5,three6n3n3n,dMult*(dMult-1.)*(dMult-2.)); | |
3487 | fIntFlowCorrelationsAllVsMPro[39]->Fill(dMult+0.5,three6n4n2n,dMult*(dMult-1.)*(dMult-2.)); | |
3488 | fIntFlowCorrelationsAllVsMPro[40]->Fill(dMult+0.5,three6n5n1n,dMult*(dMult-1.)*(dMult-2.)); | |
3489 | } | |
3490 | } // end of if(dMult>2) | |
3491 | ||
3492 | // 4-particle: | |
3493 | Double_t four6n3n2n1n = 0.; // <cos(n(6*phi1-3*phi2-2*phi3-1*phi4)> | |
3494 | Double_t four3n2n3n2n = 0.; // <cos(n(3*phi1+2*phi2-3*phi3-2*phi4)> | |
3495 | Double_t four4n1n3n2n = 0.; // <cos(n(4*phi1+1*phi2-3*phi3-2*phi4)> | |
3496 | Double_t four3n3n3n3n = 0.; // <cos(3n(phi1+phi2-phi3-phi4))> | |
3497 | //Double_t four4n2n3n3n = 0.; // <cos(n(4*phi1+2*phi2-3*phi3-3*phi4)> // I already have this one above | |
3498 | Double_t four5n1n3n3n = 0.; // <cos(n(5*phi1+1*phi2-3*phi3-3*phi4)> | |
3499 | Double_t four4n2n4n2n = 0.; // <cos(n(4*phi1+2*phi2-4*phi3-2*phi4)> | |
3500 | Double_t four5n1n4n2n = 0.; // <cos(n(5*phi1+1*phi2-4*phi3-2*phi4)> | |
3501 | Double_t four5n3n1n1n = 0.; // <cos(n(5*phi1-3*phi2-1*phi3-1*phi4)> | |
3502 | Double_t four5n2n2n1n = 0.; // <cos(n(5*phi1-2*phi2-2*phi3-1*phi4)> | |
403e3389 | 3503 | Double_t four5n1n5n1n = 0.; // <cos(n(5*phi1+1*phi2-5*phi3-1*phi4)> |
3504 | Double_t four6n4n1n1n = 0.; // <cos(n(6*phi1-4*phi2-1*phi3-1*phi4)> | |
3505 | Double_t four6n2n2n2n = 0.; // <cos(n(6*phi1-2*phi2-2*phi3-2*phi4)> | |
b84464d3 | 3506 | if(dMult>3) |
3507 | { | |
3508 | four6n3n2n1n = (reQ6nQ3nstarQ2nstarQ1nstar-reQ6nQ4nstarQ2nstar-reQ6nQ3nstarQ3nstar-reQ6nQ5nstarQ1nstar | |
3509 | - reQ5nQ3nstarQ2nstar-reQ4nQ3nstarQ1nstar-reQ3nQ2nstarQ1nstar | |
3510 | + 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))+pow(dReQ5n,2.)+pow(dImQ5n,2.) | |
3511 | + pow(dReQ4n,2.)+pow(dImQ4n,2.)+3.*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3512 | + 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
3513 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3514 | four3n2n3n2n = (dQ3nQ2nQ3nstarQ2nstar-2.*reQ5nQ3nstarQ2nstar-2.*reQ3nQ2nstarQ1nstar | |
3515 | + pow(dReQ5n,2.)+pow(dImQ5n,2.)+pow(dReQ1n,2.)+pow(dImQ1n,2.) | |
3516 | -(dMult-4.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)+pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3517 | + dMult*(dMult-6.)) | |
3518 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3519 | four4n1n3n2n = (reQ4nQ1nQ3nstarQ2nstar-reQ5nQ3nstarQ2nstar-reQ5nQ4nstarQ1nstar-reQ4nQ3nstarQ1nstar | |
3520 | - reQ4nQ2nstarQ2nstar-reQ3nQ2nstarQ1nstar-reQ2nQ1nstarQ1nstar | |
3521 | + pow(dReQ5n,2.)+pow(dImQ5n,2.)+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3522 | + 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+3.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3523 | + 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
3524 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3525 | four3n3n3n3n = (2.*dMult*(dMult-3.)+pow((pow(dReQ3n,2.)+pow(dImQ3n,2.)),2.)-4.*(dMult-2.)*(pow(dReQ3n,2.) | |
3526 | + pow(dImQ3n,2.))-2.*reQ6nQ3nstarQ3nstar+(pow(dReQ6n,2.)+pow(dImQ6n,2.))) | |
3527 | / (dMult*(dMult-1)*(dMult-2.)*(dMult-3.)); | |
3528 | //four4n2n3n3n = ; // I already have this one above | |
3529 | four5n1n3n3n = (reQ5nQ1nQ3nstarQ3nstar-reQ6nQ5nstarQ1nstar-reQ6nQ3nstarQ3nstar-2.*reQ5nQ3nstarQ2nstar | |
3530 | - 2.*reQ3nQ2nstarQ1nstar+pow(dReQ6n,2.)+pow(dImQ6n,2.)+2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3531 | + 4.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3532 | + 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
3533 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3534 | four4n2n4n2n = (dQ4nQ2nQ4nstarQ2nstar-2.*reQ6nQ4nstarQ2nstar-2.*reQ4nQ2nstarQ2nstar) | |
3535 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3536 | - ((dMult-5.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3537 | + (dMult-4.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.))-(pow(dReQ6n,2.)+pow(dImQ6n,2.))) | |
3538 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
3539 | + (dMult-6.)/((dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3540 | four5n1n4n2n = (reQ5nQ1nQ4nstarQ2nstar-reQ6nQ5nstarQ1nstar-reQ6nQ4nstarQ2nstar-reQ5nQ4nstarQ1nstar | |
3541 | - reQ5nQ3nstarQ2nstar-reQ4nQ3nstarQ1nstar-reQ2nQ1nstarQ1nstar+pow(dReQ6n,2.)+pow(dImQ6n,2.) | |
3542 | + 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3543 | + pow(dReQ3n,2.)+pow(dImQ3n,2.)+2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3544 | + 3.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
3545 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3546 | four5n3n1n1n = (reQ5nQ3nstarQ1nstarQ1nstar-2.*reQ5nQ4nstarQ1nstar-reQ5nQ3nstarQ2nstar-2.*reQ4nQ3nstarQ1nstar | |
3547 | - reQ2nQ1nstarQ1nstar+2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))+2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3548 | + 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+pow(dReQ2n,2.)+pow(dImQ2n,2.) | |
3549 | + 4.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
3550 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3551 | four5n2n2n1n = (reQ5nQ2nstarQ2nstarQ1nstar-reQ5nQ4nstarQ1nstar-2.*reQ5nQ3nstarQ2nstar-reQ4nQ2nstarQ2nstar | |
3552 | - 2.*reQ3nQ2nstarQ1nstar+2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))+pow(dReQ4n,2.)+pow(dImQ4n,2.) | |
3553 | + 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+4.*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3554 | + 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-6.*dMult) | |
3555 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3556 | four5n1n5n1n = (dQ5nQ1nQ5nstarQ1nstar-2.*reQ6nQ5nstarQ1nstar-2.*reQ5nQ4nstarQ1nstar | |
3557 | + pow(dReQ6n,2.)+pow(dImQ6n,2.)-(dMult-4.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3558 | + pow(dReQ4n,2.)+pow(dImQ4n,2.)-(dMult-4.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))+dMult*(dMult-6.)) | |
53884472 | 3559 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
3560 | ||
3561 | // TBI: Recursive formula needed: | |
403e3389 | 3562 | four6n4n1n1n = (reQ6nQ4nstarQ1nstarQ1nstar |
3563 | - dMult*(dMult-1.)*(dMult-2.)*(three2n1n1n+2.*three5n4n1n+2.*three6n5n1n+three6n4n2n) | |
3564 | - dMult*(dMult-1.)*(2.*two1n1n+1.*two4n4n+1.*two6n6n+1.*two2n2n+2.*two5n5n) | |
3565 | - 1.*dMult) | |
3566 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
53884472 | 3567 | |
403e3389 | 3568 | four6n2n2n2n = (reQ6nQ2nstarQ2nstarQ2nstar-3.*reQ6nQ4nstarQ2nstar-3.*reQ4nQ2nstarQ2nstar |
3569 | + 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))+3.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3570 | + 6.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))-6.*dMult) | |
3571 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3572 | // Average 4-particle correlations for all events: |
3573 | fIntFlowCorrelationsAllPro->Fill(41.5,four6n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3574 | fIntFlowCorrelationsAllPro->Fill(42.5,four3n2n3n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3575 | fIntFlowCorrelationsAllPro->Fill(43.5,four4n1n3n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3576 | fIntFlowCorrelationsAllPro->Fill(44.5,four3n3n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3577 | //fIntFlowCorrelationsAllPro->Fill(45.5,four4n2n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); // I already have this one above | |
3578 | fIntFlowCorrelationsAllPro->Fill(46.5,four5n1n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3579 | fIntFlowCorrelationsAllPro->Fill(47.5,four4n2n4n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3580 | fIntFlowCorrelationsAllPro->Fill(48.5,four5n1n4n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3581 | fIntFlowCorrelationsAllPro->Fill(49.5,four5n3n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3582 | fIntFlowCorrelationsAllPro->Fill(50.5,four5n2n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3583 | fIntFlowCorrelationsAllPro->Fill(51.5,four5n1n5n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
403e3389 | 3584 | fIntFlowCorrelationsAllPro->Fill(58.5,four6n4n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
3585 | fIntFlowCorrelationsAllPro->Fill(59.5,four6n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3586 | if(fCalculateAllCorrelationsVsM) |
3587 | { | |
3588 | fIntFlowCorrelationsAllVsMPro[41]->Fill(dMult+0.5,four6n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3589 | fIntFlowCorrelationsAllVsMPro[42]->Fill(dMult+0.5,four3n2n3n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3590 | fIntFlowCorrelationsAllVsMPro[43]->Fill(dMult+0.5,four4n1n3n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3591 | fIntFlowCorrelationsAllVsMPro[44]->Fill(dMult+0.5,four3n3n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3592 | //fIntFlowCorrelationsAllVsMPro[45]->Fill(dMult+0.5,four4n2n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3593 | fIntFlowCorrelationsAllVsMPro[46]->Fill(dMult+0.5,four5n1n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3594 | fIntFlowCorrelationsAllVsMPro[47]->Fill(dMult+0.5,four4n2n4n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3595 | fIntFlowCorrelationsAllVsMPro[48]->Fill(dMult+0.5,four5n1n4n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3596 | fIntFlowCorrelationsAllVsMPro[49]->Fill(dMult+0.5,four5n3n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3597 | fIntFlowCorrelationsAllVsMPro[50]->Fill(dMult+0.5,four5n2n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
3598 | fIntFlowCorrelationsAllVsMPro[51]->Fill(dMult+0.5,four5n1n5n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
403e3389 | 3599 | fIntFlowCorrelationsAllVsMPro[58]->Fill(dMult+0.5,four6n4n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); |
3600 | fIntFlowCorrelationsAllVsMPro[59]->Fill(dMult+0.5,four6n2n2n2n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b84464d3 | 3601 | } |
3602 | } // end of if(dMult>3) | |
3603 | ||
3604 | // 5-particle: | |
3605 | Double_t five3n3n3n2n1n = 0.; // <cos(n(3*phi1+3*phi2-3*phi3-2*phi4-1*phi5)> | |
3606 | Double_t five4n2n3n2n1n = 0.; // <cos(n(4*phi1+2*phi2-3*phi3-2*phi4-1*phi5)> | |
3607 | Double_t five3n2n3n1n1n = 0.; // <cos(n(3*phi1+2*phi2-3*phi3-1*phi4-1*phi5)> | |
3608 | Double_t five3n2n2n2n1n = 0.; // <cos(n(3*phi1+2*phi2-2*phi3-2*phi4-1*phi5)> | |
3609 | Double_t five5n1n3n2n1n = 0.; // <cos(n(5*phi1+1*phi2-3*phi3-2*phi4-1*phi5)> | |
403e3389 | 3610 | Double_t five6n2n2n1n1n = 0.; // <cos(n(6*phi1-2*phi2-2*phi3-1*phi4-1*phi5)> |
3611 | Double_t five4n1n1n3n3n = 0.; // <cos(n(4*phi1+1*phi2+1*phi3-3*phi4-3*phi5)> | |
b84464d3 | 3612 | if(dMult>4) |
3613 | { | |
3614 | five3n3n3n2n1n = (reQ3nQ3nQ3nstarQ2nstarQ1nstar-reQ6nQ3nstarQ2nstarQ1nstar-reQ5nQ1nQ3nstarQ3nstar-reQ4nQ2nQ3nstarQ3nstar | |
3615 | + reQ6nQ5nstarQ1nstar+reQ6nQ4nstarQ2nstar+3.*reQ6nQ3nstarQ3nstar+4.*reQ5nQ3nstarQ2nstar+4.*reQ4nQ3nstarQ1nstar | |
3616 | - 2.*(dMult-6.)*reQ3nQ2nstarQ1nstar-2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3617 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3618 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3619 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*(3.*dMult-10.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3620 | - pow((pow(dReQ3n,2.)+pow(dImQ3n,2.)),2.)+2.*(dMult-5.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3621 | + 2.*(dMult-5.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*dMult*(dMult-6.)) | |
3622 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3623 | five4n2n3n2n1n = (reQ4nQ2nQ3nstarQ2nstarQ1nstar-reQ6nQ3nstarQ2nstarQ1nstar-reQ5nQ1nQ4nstarQ2nstar | |
3624 | - reQ4nQ2nQ3nstarQ3nstar-reQ4nQ1nQ3nstarQ2nstar-reQ4nQ2nstarQ1nstarQ1nstar | |
3625 | - reQ3nQ1nQ2nstarQ2nstar-(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3626 | + 3.*reQ6nQ4nstarQ2nstar+reQ6nQ5nstarQ1nstar+reQ6nQ3nstarQ3nstar+reQ5nQ4nstarQ1nstar | |
3627 | + 3.*reQ5nQ3nstarQ2nstar-(dMult-7.)*reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar+7.*reQ3nQ2nstarQ1nstar | |
3628 | + 4.*reQ2nQ1nstarQ1nstar-(pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3629 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3630 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3631 | + (dMult-8.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+(dMult-10.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3632 | + 2.*(dMult-7.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+(dMult-12.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3633 | - 2.*dMult*(dMult-12.)) | |
3634 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3635 | five3n2n3n1n1n = (reQ3nQ2nQ3nstarQ1nstarQ1nstar-reQ5nQ3nstarQ1nstarQ1nstar-2.*reQ4nQ1nQ3nstarQ2nstar-reQ3nQ1nstarQ1nstarQ1nstar | |
3636 | - 2.*reQ3nQ1nQ2nstarQ2nstar+2.*reQ5nQ4nstarQ1nstar+3.*reQ5nQ3nstarQ2nstar+6.*reQ4nQ3nstarQ1nstar | |
3637 | + 2.*reQ4nQ2nstarQ2nstar+9.*reQ3nQ2nstarQ1nstar-(dMult-8.)*reQ2nQ1nstarQ1nstar | |
3638 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3639 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3640 | - 2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.))-4.*(pow(dReQ4n,2.)+pow(dImQ4n,2.)) | |
3641 | + 2.*(dMult-6.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))+(dMult-12.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3642 | + 2.*(dMult-9.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-2.*dMult*(dMult-12.)) | |
3643 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3644 | five3n2n2n2n1n = (reQ3nQ2nQ2nstarQ2nstarQ1nstar-reQ5nQ2nstarQ2nstarQ1nstar-reQ4nQ1nQ3nstarQ2nstar-reQ3nQ1nQ2nstarQ2nstar | |
3645 | - 2.*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+reQ5nQ4nstarQ1nstar | |
3646 | + 4.*reQ5nQ3nstarQ2nstar+reQ4nQ3nstarQ1nstar+3.*reQ4nQ2nstarQ2nstar-2.*(dMult-6.)*reQ3nQ2nstarQ1nstar | |
3647 | + 4.*reQ2nQ1nstarQ1nstar-2.*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3648 | - 2.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+2.*(dMult-5.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3649 | - 2.*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3650 | - pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)+2.*(3.*dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3651 | + 2.*(dMult-6.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.))-4.*dMult*(dMult-6.)) | |
3652 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3653 | five5n1n3n2n1n = (reQ5nQ1nQ3nstarQ2nstarQ1nstar-reQ6nQ3nstarQ2nstarQ1nstar-reQ5nQ1nQ4nstarQ2nstar-reQ5nQ1nQ3nstarQ3nstar | |
3654 | - reQ4nQ1nQ3nstarQ2nstar-reQ5nQ3nstarQ1nstarQ1nstar-reQ5nQ2nstarQ2nstarQ1nstar | |
3655 | + 3.*reQ6nQ5nstarQ1nstar+reQ6nQ4nstarQ2nstar+reQ6nQ3nstarQ3nstar+4.*reQ5nQ4nstarQ1nstar | |
3656 | - (dMult-7.)*reQ5nQ3nstarQ2nstar+4.*reQ4nQ3nstarQ1nstar+reQ4nQ2nstarQ2nstar+6.*reQ3nQ2nstarQ1nstar | |
3657 | + 3.*reQ2nQ1nstarQ1nstar-(pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3658 | - (pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3659 | - (pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3660 | - 2.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))+(dMult-8.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3661 | - 4.*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+(dMult-10.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3662 | + (dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))+2.*(dMult-7.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3663 | - 2.*dMult*(dMult-12.)) | |
3664 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
53884472 | 3665 | |
3666 | // Peter Jochumzsen: | |
3667 | five6n2n2n1n1n = (reQ6nQ2nstarQ2nstarQ1nstarQ1nstar | |
3668 | - 12.*pow(dReQ1n,2.)-12.*pow(dImQ1n,2.) | |
3669 | - 14.*pow(dReQ2n,2.)-14.*pow(dImQ2n,2.) | |
3670 | - 8.*pow(dReQ3n,2.)-8.*pow(dImQ3n,2.) | |
3671 | - 6.*pow(dReQ4n,2.)-6.*pow(dImQ4n,2.) | |
3672 | - 4.*pow(dReQ5n,2.)-4.*pow(dImQ5n,2.) | |
3673 | - 6.*pow(dReQ6n,2.)-6.*pow(dImQ6n,2.) | |
3674 | + 2.*reQ2nQ1nstarQ1nstar + 8.*reQ3nQ2nstarQ1nstar | |
3675 | + 5.*reQ6nQ4nstarQ2nstar - reQ6nQ4nstarQ1nstarQ1nstar | |
3676 | + 2.*reQ6nQ3nstarQ3nstar - reQ6nQ2nstarQ2nstarQ2nstar | |
3677 | + 4.*reQ4nQ2nstarQ2nstar - 2.*reQ4nQ2nstarQ1nstarQ1nstar | |
3678 | + 2.*reQ5nQ4nstarQ1nstar - 2.*reQ5nQ2nstarQ2nstarQ1nstar | |
3679 | + 4.*reQ4nQ3nstarQ1nstar + 4.*reQ5nQ3nstarQ2nstar | |
3680 | + 4.*reQ6nQ5nstarQ1nstar - 4.*reQ6nQ3nstarQ2nstarQ1nstar + 24.*dMult) | |
3681 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
403e3389 | 3682 | |
53884472 | 3683 | // Peter Jochumzsen: |
3684 | /* | |
3685 | five4n1n1n3n3n = (reQ6nQ2nstarQ2nstarQ1nstarQ1nstar | |
3686 | - 12.*pow(dReQ1n,2.)-12.*pow(dImQ1n,2.) | |
3687 | - 14.*pow(dReQ2n,2.)-14.*pow(dImQ2n,2.) | |
3688 | - 8.*pow(dReQ3n,2.)-8.*pow(dImQ3n,2.) | |
3689 | - 6.*pow(dReQ4n,2.)-6.*pow(dImQ4n,2.) | |
3690 | - 4.*pow(dReQ5n,2.)-4.*pow(dImQ5n,2.) | |
3691 | - 6.*pow(dReQ6n,2.)-6.*pow(dImQ6n,2.) | |
3692 | + 2.*reQ2nQ1nstarQ1nstar + 8.*reQ3nQ2nstarQ1nstar | |
3693 | + 5.*reQ6nQ4nstarQ2nstar - reQ6nQ4nstarQ1nstarQ1nstar | |
3694 | + 2.*reQ6nQ3nstarQ3nstar - reQ6nQ2nstarQ2nstarQ2nstar | |
3695 | + 4.*reQ4nQ2nstarQ2nstar - 2.*reQ4nQ2nstarQ1nstarQ1nstar | |
3696 | + 2.*reQ5nQ4nstarQ1nstar - 2.*reQ5nQ2nstarQ2nstarQ1nstar | |
3697 | + 4.*reQ4nQ3nstarQ1nstar + 4.*reQ5nQ3nstarQ2nstar | |
3698 | + 4.*reQ6nQ5nstarQ1nstar - 4.*reQ6nQ3nstarQ2nstarQ1nstar + 24.*dMult) | |
3699 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3700 | */ | |
403e3389 | 3701 | |
b84464d3 | 3702 | // Average 5-particle correlations for all events: |
3703 | fIntFlowCorrelationsAllPro->Fill(52.5,five3n3n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3704 | fIntFlowCorrelationsAllPro->Fill(53.5,five4n2n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3705 | fIntFlowCorrelationsAllPro->Fill(54.5,five3n2n3n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3706 | fIntFlowCorrelationsAllPro->Fill(55.5,five3n2n2n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3707 | fIntFlowCorrelationsAllPro->Fill(56.5,five5n1n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
403e3389 | 3708 | fIntFlowCorrelationsAllPro->Fill(60.5,five6n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
3709 | fIntFlowCorrelationsAllPro->Fill(61.5,five4n1n1n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
b84464d3 | 3710 | if(fCalculateAllCorrelationsVsM) |
3711 | { | |
3712 | fIntFlowCorrelationsAllVsMPro[52]->Fill(dMult+0.5,five3n3n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3713 | fIntFlowCorrelationsAllVsMPro[53]->Fill(dMult+0.5,five4n2n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3714 | fIntFlowCorrelationsAllVsMPro[54]->Fill(dMult+0.5,five3n2n3n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3715 | fIntFlowCorrelationsAllVsMPro[55]->Fill(dMult+0.5,five3n2n2n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
3716 | fIntFlowCorrelationsAllVsMPro[56]->Fill(dMult+0.5,five5n1n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
403e3389 | 3717 | fIntFlowCorrelationsAllVsMPro[60]->Fill(dMult+0.5,five6n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); |
3718 | fIntFlowCorrelationsAllVsMPro[61]->Fill(dMult+0.5,five4n1n1n3n3n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)); | |
b84464d3 | 3719 | } |
3720 | } // end of if(dMult>4) | |
3721 | ||
3722 | // 6-particle: | |
3723 | Double_t six3n2n1n3n2n1n = 0.; // <cos(n(3*phi1+2*phi2+1*phi3-3*phi4-2*phi5-1*phi6)> | |
403e3389 | 3724 | Double_t six3n3n2n2n1n1n = 0.; // <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-1*phi5-1*phi6)> |
b84464d3 | 3725 | if(dMult>5.) |
3726 | { | |
3727 | six3n2n1n3n2n1n = (dQ3nQ2nQ1nQ3nstarQ2nstarQ1nstar-2.*reQ3nQ3nQ3nstarQ2nstarQ1nstar | |
3728 | - 2.*reQ3nQ2nQ2nstarQ2nstarQ1nstar-2.*reQ3nQ1nQ2nstarQ1nstarQ1nstar | |
3729 | - 2.*reQ3nQ2nQ3nstarQ1nstarQ1nstar-2.*reQ4nQ2nQ3nstarQ2nstarQ1nstar | |
3730 | - 2.*reQ5nQ1nQ3nstarQ2nstarQ1nstar+4.*reQ6nQ3nstarQ2nstarQ1nstar | |
3731 | + 2.*reQ5nQ1nQ4nstarQ2nstar+2.*reQ5nQ1nQ3nstarQ3nstar | |
3732 | + 2.*reQ4nQ2nQ3nstarQ3nstar+6.*reQ4nQ1nQ3nstarQ2nstar | |
3733 | + 2.*reQ5nQ3nstarQ1nstarQ1nstar+2.*reQ5nQ2nstarQ2nstarQ1nstar | |
3734 | + 6.*reQ3nQ1nQ2nstarQ2nstar+2.*reQ4nQ2nstarQ1nstarQ1nstar | |
3735 | - 4.*reQ6nQ5nstarQ1nstar-4.*reQ6nQ4nstarQ2nstar-6.*reQ5nQ4nstarQ1nstar | |
3736 | - 4.*reQ6nQ3nstarQ3nstar+2.*(dMult-11.)*reQ5nQ3nstarQ2nstar | |
3737 | + 2.*(dMult-13.)*reQ4nQ3nstarQ1nstar-8.*reQ4nQ2nstarQ2nstar | |
3738 | + 2.*(5.*dMult-32.)*reQ3nQ2nstarQ1nstar+2.*reQ3nQ1nstarQ1nstarQ1nstar | |
3739 | + 2.*(dMult-13.)*reQ2nQ1nstarQ1nstar | |
3740 | - (dMult-10.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3741 | + (pow(dReQ5n,2.)+pow(dImQ5n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3742 | + (pow(dReQ4n,2.)+pow(dImQ4n,2.))*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3743 | - (dMult-11.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3744 | - (dMult-10.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.))*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3745 | + 4.*(pow(dReQ6n,2.)+pow(dImQ6n,2.))-(dMult-12.)*(pow(dReQ5n,2.)+pow(dImQ5n,2.)) | |
3746 | - (dMult-16.)*(pow(dReQ4n,2.)+pow(dImQ4n,2.))+pow((pow(dReQ3n,2.)+pow(dImQ3n,2.)),2.) | |
3747 | + (dMult*dMult-19.*dMult+68.)*(pow(dReQ3n,2.)+pow(dImQ3n,2.)) | |
3748 | + (dMult*dMult-19.*dMult+72.)*(pow(dReQ2n,2.)+pow(dImQ2n,2.)) | |
3749 | + pow((pow(dReQ2n,2.)+pow(dImQ2n,2.)),2.)+pow((pow(dReQ1n,2.)+pow(dImQ1n,2.)),2.) | |
3750 | + (dMult*dMult-20.*dMult+80.)*(pow(dReQ1n,2.)+pow(dImQ1n,2.)) | |
3751 | - dMult*(dMult-12.)*(dMult-10.)) | |
3752 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
53884472 | 3753 | |
3754 | // Peter Jochumzsen: | |
3755 | six3n3n2n2n1n1n = (reQ3nQ3nQ2nstarQ2nstarQ1nstarQ1nstar | |
3756 | + (80.-16.*dMult)*pow(dReQ1n,2.)+(80.-16.*dMult)*pow(dImQ1n,2.) | |
3757 | + (78.-16.*dMult)*pow(dReQ2n,2.)+(78.-16.*dMult)*pow(dImQ2n,2.) | |
3758 | + (72.-16.*dMult)*pow(dReQ3n,2.)+(72.-16.*dMult)*pow(dImQ3n,2.) | |
3759 | + 14.*pow(dReQ4n,2.)+14.*pow(dImQ4n,2.) | |
3760 | + 8.*pow(dReQ5n,2.)+8.*pow(dImQ5n,2.) | |
3761 | + 6.*pow(dReQ6n,2.)+6.*pow(dImQ6n,2.) | |
3762 | + 1.*reQ6nQ2nstarQ2nstarQ2nstar - 1.*reQ6nQ2nstarQ2nstarQ1nstarQ1nstar | |
3763 | - 76.*reQ3nQ2nstarQ1nstar + 4.*reQ3nQ1nstarQ1nstarQ1nstar | |
3764 | - 8.*reQ3nQ2nstarQ1nstar + 8.*dQ2nQ1nQ2nstarQ1nstar | |
3765 | + 4.*reQ5nQ2nstarQ2nstarQ1nstar - 2.*reQ6nQ3nstarQ3nstar | |
3766 | + 4.*reQ6nQ3nstarQ2nstarQ1nstar - 4.*reQ5nQ4nstarQ1nstar | |
3767 | + 16.*dMult*reQ3nQ2nstarQ1nstar - 2.*reQ4nQ2nstarQ2nstar | |
3768 | - 4.*reQ3nQ3nQ3nstarQ2nstarQ1nstar -8.*reQ4nQ3nstarQ1nstar | |
3769 | - 10.*reQ4nQ2nstarQ2nstar + 4.*reQ4nQ2nstarQ1nstarQ1nstar | |
3770 | - 12.*reQ4nQ3nstarQ1nstar + 8.*dQ3nQ1nQ3nstarQ1nstar | |
3771 | + 8.*reQ3nQ1nQ2nstarQ2nstar - 4.*reQ3nQ1nQ2nstarQ1nstarQ1nstar | |
3772 | + 5.*reQ4nQ2nQ3nstarQ3nstar+2.*pow(pow(dReQ2n,2.)+pow(dImQ2n,2.),2.) | |
3773 | + 4.*reQ5nQ1nQ3nstarQ3nstar+2.*pow(pow(dReQ3n,2.)+pow(dImQ3n,2.),2.) | |
3774 | - 6.*reQ6nQ3nstarQ3nstar - 14.*reQ2nQ1nstarQ1nstar | |
3775 | - 1.*reQ3nQ3nQ2nstarQ2nstarQ2nstar-4.*reQ3nQ2nQ2nstarQ2nstarQ1nstar | |
3776 | - 1.*reQ4nQ1nQ1nQ3nstarQ3nstar-8.*reQ5nQ3nstarQ2nstar | |
3777 | + 2.*pow(pow(dReQ1n,2.)+pow(dImQ1n,2.),2.) - 10.*reQ2nQ1nstarQ1nstar | |
3778 | - 4.*reQ6nQ5nstarQ1nstar-5.*reQ6nQ4nstarQ2nstar | |
3779 | + 1.*reQ6nQ4nstarQ1nstarQ1nstar-8.*reQ5nQ3nstarQ2nstar | |
3780 | + 4.*reQ4nQ1nQ3nstarQ2nstar+8.*dQ3nQ2nQ3nstarQ2nstar | |
3781 | - 120.*dMult + 16.*dMult*dMult) | |
3782 | / (dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
403e3389 | 3783 | |
b84464d3 | 3784 | // Average 6-particle correlations for all events: |
3785 | fIntFlowCorrelationsAllPro->Fill(57.5,six3n2n1n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
403e3389 | 3786 | fIntFlowCorrelationsAllPro->Fill(62.5,six3n3n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
b84464d3 | 3787 | if(fCalculateAllCorrelationsVsM) |
3788 | { | |
3789 | fIntFlowCorrelationsAllVsMPro[57]->Fill(dMult+0.5,six3n2n1n3n2n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); | |
403e3389 | 3790 | fIntFlowCorrelationsAllVsMPro[62]->Fill(dMult+0.5,six3n3n2n2n1n1n,dMult*(dMult-1.)*(dMult-2.)*(dMult-3.)*(dMult-4.)*(dMult-5.)); |
b84464d3 | 3791 | } |
3792 | } // end of if(dMult>5.) | |
3793 | ||
489d5531 | 3794 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelations() |
3795 | ||
489d5531 | 3796 | //================================================================================================================================ |
3797 | ||
e5834fcb | 3798 | void AliFlowAnalysisWithQCumulants::StorePhiDistributionForOneEvent(AliFlowEventSimple *anEvent) |
3799 | { | |
3800 | // Store phi distribution for one event to illustrate flow. | |
3801 | ||
3802 | if(fPhiDistributionForOneEvent->GetEntries()>0){return;} // store only phi distribution for one event | |
3803 | ||
3804 | Double_t vMin = fPhiDistributionForOneEventSettings[0]; | |
3805 | Double_t vMax = fPhiDistributionForOneEventSettings[1]; | |
3806 | Double_t refMultMin = fPhiDistributionForOneEventSettings[2]; | |
3807 | Double_t refMultMax = fPhiDistributionForOneEventSettings[3]; | |
3808 | ||
3809 | Double_t vEBE = 0.; | |
3810 | Double_t cumulant4thEBE = fIntFlowCorrelationsEBE->GetBinContent(2)-2.*pow(fIntFlowCorrelationsEBE->GetBinContent(1),2.); | |
3811 | if(cumulant4thEBE<0.) | |
3812 | { | |
3813 | vEBE = pow(-1.*cumulant4thEBE,0.25); | |
3814 | if((vEBE>vMin && vEBE<vMax) && (fReferenceMultiplicityEBE>refMultMin && fReferenceMultiplicityEBE<refMultMax)) | |
3815 | { | |
3958eee6 | 3816 | fPhiDistributionForOneEvent->SetTitle(Form("v_{%i} = %f",fHarmonic,vEBE)); |
e5834fcb | 3817 | for(Int_t p=0;p<anEvent->NumberOfTracks();p++) |
3818 | { | |
3819 | if(anEvent->GetTrack(p)->InRPSelection()) | |
3820 | { | |
3821 | fPhiDistributionForOneEvent->Fill(anEvent->GetTrack(p)->Phi()); | |
3822 | } | |
3823 | } // end of for(Int_t p=0;p<anEvent->NumberOfTracks();p++) | |
3958eee6 | 3824 | } else |
3825 | { | |
3826 | fPhiDistributionForOneEvent->SetTitle(Form("v_{%i} = %f, out of specified boundaries",fHarmonic,vEBE)); | |
3827 | } | |
3828 | ||
e5834fcb | 3829 | } // end of if(cumulant4thEBE<0.) |
3830 | ||
3831 | } // end of void AliFlowAnalysisWithQCumulants::StorePhiDistributionForOneEvent(AliFlowEventSimple *anEvent) | |
3832 | ||
3833 | //================================================================================================================================ | |
489d5531 | 3834 | |
3835 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrelations() | |
3836 | { | |
0328db2d | 3837 | // Calculate averages of products of correlations for integrated flow. |
489d5531 | 3838 | |
2001bc3a | 3839 | // multiplicity: |
1268c371 | 3840 | Double_t dMult = (*fSpk)(0,0); |
2001bc3a | 3841 | |
489d5531 | 3842 | Int_t counter = 0; |
3843 | ||
3844 | for(Int_t ci1=1;ci1<4;ci1++) | |
3845 | { | |
3846 | for(Int_t ci2=ci1+1;ci2<=4;ci2++) | |
3847 | { | |
ff70ca91 | 3848 | fIntFlowProductOfCorrelationsPro->Fill(0.5+counter, |
3849 | fIntFlowCorrelationsEBE->GetBinContent(ci1)* | |
3850 | fIntFlowCorrelationsEBE->GetBinContent(ci2), | |
3851 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
3852 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); | |
3853 | // products versus multiplicity: // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>] | |
b3dacf6b | 3854 | if(fCalculateCumulantsVsM) |
3855 | { | |
3856 | fIntFlowProductOfCorrelationsVsMPro[counter]->Fill(dMult+0.5, // to be improved: dMult => sum of weights ? | |
3857 | fIntFlowCorrelationsEBE->GetBinContent(ci1)* | |
3858 | fIntFlowCorrelationsEBE->GetBinContent(ci2), | |
3859 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
3860 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); | |
3861 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 3862 | counter++; |
489d5531 | 3863 | } |
3864 | } | |
3865 | ||
3866 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrelations() | |
3867 | ||
3868 | ||
3869 | //================================================================================================================================ | |
3870 | ||
3871 | ||
0328db2d | 3872 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrectionTermsForNUA() |
3873 | { | |
3874 | // Calculate averages of products of correction terms for NUA. | |
3875 | ||
3876 | // a) Binning of fIntFlowProductOfCorrectionTermsForNUAPro is organized as follows: | |
3877 | // 1st bin: <<2><cos(phi)>> | |
3878 | // 2nd bin: <<2><sin(phi)>> | |
3879 | // 3rd bin: <<cos(phi)><sin(phi)>> | |
3880 | // 4th bin: <<2><cos(phi1+phi2)>> | |
3881 | // 5th bin: <<2><sin(phi1+phi2)>> | |
3882 | // 6th bin: <<2><cos(phi1-phi2-phi3)>> | |
3883 | // 7th bin: <<2><sin(phi1-phi2-phi3)>> | |
3884 | // 8th bin: <<4><cos(phi1)>> | |
3885 | // 9th bin: <<4><sin(phi1)>> | |
3886 | // 10th bin: <<4><cos(phi1+phi2)>> | |
3887 | // 11th bin: <<4><sin(phi1+phi2)>> | |
3888 | // 12th bin: <<4><cos(phi1-phi2-phi3)>> | |
3889 | // 13th bin: <<4><sin(phi1-phi2-phi3)>> | |
3890 | // 14th bin: <<cos(phi1)><cos(phi1+phi2)>> | |
3891 | // 15th bin: <<cos(phi1)><sin(phi1+phi2)>> | |
3892 | // 16th bin: <<cos(phi1)><cos(phi1-phi2-phi3)>> | |
3893 | // 17th bin: <<cos(phi1)><sin(phi1-phi2-phi3)>> | |
3894 | // 18th bin: <<sin(phi1)><cos(phi1+phi2)>> | |
3895 | // 19th bin: <<sin(phi1)><sin(phi1+phi2)>> | |
3896 | // 20th bin: <<sin(phi1)><cos(phi1-phi2-phi3)>> | |
3897 | // 21st bin: <<sin(phi1)><sin(phi1-phi2-phi3)>> | |
3898 | // 22nd bin: <<cos(phi1+phi2)><sin(phi1+phi2)>> | |
3899 | // 23rd bin: <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
3900 | // 24th bin: <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
3901 | // 25th bin: <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
3902 | // 26th bin: <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
3903 | // 27th bin: <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>> | |
3904 | ||
3905 | // <<2><cos(phi)>>: | |
3906 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(0.5, | |
3907 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1), | |
3908 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3909 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
3910 | // <<2><sin(phi)>>: | |
3911 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(1.5, | |
3912 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1), | |
3913 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3914 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
3915 | // <<cos(phi)><sin(phi)>>: | |
3916 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(2.5, | |
3917 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1), | |
3918 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3919 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
3920 | // <<2><cos(phi1+phi2)>>: | |
3921 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(3.5, | |
3922 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3923 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3924 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3925 | // <<2><sin(phi1+phi2)>>: | |
3926 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(4.5, | |
3927 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3928 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3929 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3930 | // <<2><cos(phi1-phi2-phi3)>>: | |
3931 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(5.5, | |
3932 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3933 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3934 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3935 | // <<2><sin(phi1-phi2-phi3)>>: | |
3936 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(6.5, | |
3937 | fIntFlowCorrelationsEBE->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3938 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1) | |
3939 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3940 | // <<4><cos(phi1)>>: | |
3941 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(7.5, | |
3942 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1), | |
3943 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3944 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
3945 | // <<4><sin(phi1)>>: | |
3946 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(8.5, | |
3947 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1), | |
3948 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3949 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
3950 | // <<4><cos(phi1+phi2)>>: | |
3951 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(9.5, | |
3952 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3953 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3954 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3955 | // <<4><sin(phi1+phi2)>>: | |
3956 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(10.5, | |
3957 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3958 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3959 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3960 | // <<4><cos(phi1-phi2-phi3)>>: | |
3961 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(11.5, | |
3962 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3963 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3964 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3965 | // <<4><sin(phi1-phi2-phi3)>>: | |
3966 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(12.5, | |
3967 | fIntFlowCorrelationsEBE->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3968 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2) | |
3969 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3970 | // <<cos(phi1)><cos(phi1+phi2)>>: | |
3971 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(13.5, | |
3972 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3973 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3974 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3975 | // <<cos(phi1)><sin(phi1+phi2)>>: | |
3976 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(14.5, | |
3977 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3978 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3979 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
3980 | // <<cos(phi1)><cos(phi1-phi2-phi3)>>: | |
3981 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(15.5, | |
3982 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
3983 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3984 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
3985 | // <<cos(phi1)><sin(phi1-phi2-phi3)>>: | |
3986 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(16.5, | |
3987 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
3988 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1) | |
3989 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
3990 | // <<sin(phi1)><cos(phi1+phi2)>>: | |
3991 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(17.5, | |
3992 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2), | |
3993 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3994 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
3995 | // <<sin(phi1)><sin(phi1+phi2)>>: | |
3996 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(18.5, | |
3997 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
3998 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
3999 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
4000 | // <<sin(phi1)><cos(phi1-phi2-phi3)>>: | |
4001 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(19.5, | |
4002 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
4003 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
4004 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
4005 | // <<sin(phi1)><sin(phi1-phi2-phi3)>>: | |
4006 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(20.5, | |
4007 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(1)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
4008 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1) | |
4009 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
4010 | // <<cos(phi1+phi2)><sin(phi1+phi2)>>: | |
4011 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(21.5, | |
4012 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2), | |
4013 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2) | |
4014 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
4015 | // <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>>: | |
4016 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(22.5, | |
4017 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
4018 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2) | |
4019 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
4020 | // <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>>: | |
4021 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(23.5, | |
4022 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
4023 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2) | |
4024 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
4025 | // <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>>: | |
4026 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(24.5, | |
4027 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3), | |
4028 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2) | |
4029 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
4030 | // <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>>: | |
4031 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(25.5, | |
4032 | fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(2)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
4033 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2) | |
4034 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
4035 | // <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>>: | |
4036 | fIntFlowProductOfCorrectionTermsForNUAPro->Fill(26.5, | |
4037 | fIntFlowCorrectionTermsForNUAEBE[1]->GetBinContent(3)*fIntFlowCorrectionTermsForNUAEBE[0]->GetBinContent(3), | |
4038 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3) | |
4039 | *fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
4040 | ||
4041 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowProductOfCorrectionTermsForNUA() | |
4042 | ||
0328db2d | 4043 | //================================================================================================================================ |
4044 | ||
489d5531 | 4045 | void AliFlowAnalysisWithQCumulants::CalculateCovariancesIntFlow() |
4046 | { | |
4047 | // a) Calculate unbiased estimators Cov(<2>,<4>), Cov(<2>,<6>), Cov(<2>,<8>), Cov(<4>,<6>), Cov(<4>,<8>) and Cov(<6>,<8>) | |
4048 | // for covariances V_(<2>,<4>), V_(<2>,<6>), V_(<2>,<8>), V_(<4>,<6>), V_(<4>,<8>) and V_(<6>,<8>). | |
4049 | // b) Store in histogram fIntFlowCovariances for instance the following: | |
4050 | // | |
4051 | // Cov(<2>,<4>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4>}_j)] | |
4052 | // | |
4053 | // where N is the number of events, w_{<2>} is event weight for <2> and w_{<4>} is event weight for <4>. | |
4054 | // c) Binning of fIntFlowCovariances is organized as follows: | |
4055 | // | |
4056 | // 1st bin: Cov(<2>,<4>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4>}_j)] | |
4057 | // 2nd bin: Cov(<2>,<6>) * (sum_{i=1}^{N} w_{<2>}_i w_{<6>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<6>}_j)] | |
4058 | // 3rd bin: Cov(<2>,<8>) * (sum_{i=1}^{N} w_{<2>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<8>}_j)] | |
4059 | // 4th bin: Cov(<4>,<6>) * (sum_{i=1}^{N} w_{<4>}_i w_{<6>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<6>}_j)] | |
4060 | // 5th bin: Cov(<4>,<8>) * (sum_{i=1}^{N} w_{<4>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<8>}_j)] | |
4061 | // 6th bin: Cov(<6>,<8>) * (sum_{i=1}^{N} w_{<6>}_i w_{<8>}_i )/[(sum_{i=1}^{N} w_{<6>}_i) * (sum_{j=1}^{N} w_{<8>}_j)] | |
b3dacf6b | 4062 | // |
489d5531 | 4063 | |
b3dacf6b | 4064 | // Average 2-, 4-, 6- and 8-particle correlations for all events: |
489d5531 | 4065 | Double_t correlation[4] = {0.}; |
4066 | for(Int_t ci=0;ci<4;ci++) | |
4067 | { | |
4068 | correlation[ci] = fIntFlowCorrelationsPro->GetBinContent(ci+1); | |
4069 | } | |
b3dacf6b | 4070 | // Average products of 2-, 4-, 6- and 8-particle correlations: |
489d5531 | 4071 | Double_t productOfCorrelations[4][4] = {{0.}}; |
4072 | Int_t productOfCorrelationsLabel = 1; | |
b3dacf6b | 4073 | // Denominators in the expressions for the unbiased estimator for covariance: |
489d5531 | 4074 | Double_t denominator[4][4] = {{0.}}; |
4075 | Int_t sumOfProductOfEventWeightsLabel1 = 1; | |
b3dacf6b | 4076 | // Weight dependent prefactor which multiply unbiased estimators for covariances: |
489d5531 | 4077 | Double_t wPrefactor[4][4] = {{0.}}; |
4078 | Int_t sumOfProductOfEventWeightsLabel2 = 1; | |
4079 | for(Int_t c1=0;c1<4;c1++) | |
4080 | { | |
4081 | for(Int_t c2=c1+1;c2<4;c2++) | |
4082 | { | |
4083 | productOfCorrelations[c1][c2] = fIntFlowProductOfCorrelationsPro->GetBinContent(productOfCorrelationsLabel); | |
b3dacf6b | 4084 | if(TMath::Abs(fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1)) > 1.e-44 && TMath::Abs(fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)) > 1.e-44) |
4085 | { | |
4086 | denominator[c1][c2] = 1.-(fIntFlowSumOfProductOfEventWeights->GetBinContent(sumOfProductOfEventWeightsLabel1)) | |
4087 | / (fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1) | |
4088 | * fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)); | |
4089 | wPrefactor[c1][c2] = fIntFlowSumOfProductOfEventWeights->GetBinContent(sumOfProductOfEventWeightsLabel2) | |
4090 | / (fIntFlowSumOfEventWeights[0]->GetBinContent(c1+1) | |
4091 | * fIntFlowSumOfEventWeights[0]->GetBinContent(c2+1)); | |
489d5531 | 4092 | } |
b3dacf6b | 4093 | productOfCorrelationsLabel++; // to be improved - do I need here all 3 counters? |
489d5531 | 4094 | sumOfProductOfEventWeightsLabel1++; |
4095 | sumOfProductOfEventWeightsLabel2++; | |
b3dacf6b | 4096 | } // end of for(Int_t c2=c1+1;c2<4;c2++) |
4097 | } // end of for(Int_t c1=0;c1<4;c1++) | |
489d5531 | 4098 | |
489d5531 | 4099 | Int_t covarianceLabel = 1; |
4100 | for(Int_t c1=0;c1<4;c1++) | |
4101 | { | |
4102 | for(Int_t c2=c1+1;c2<4;c2++) | |
4103 | { | |
b3dacf6b | 4104 | if(TMath::Abs(denominator[c1][c2]) > 1.e-44) |
489d5531 | 4105 | { |
b3dacf6b | 4106 | // Covariances: |
489d5531 | 4107 | Double_t cov = (productOfCorrelations[c1][c2]-correlation[c1]*correlation[c2])/denominator[c1][c2]; |
b3dacf6b | 4108 | // Covariances multiplied with weight dependent prefactor: |
489d5531 | 4109 | Double_t wCov = cov * wPrefactor[c1][c2]; |
4110 | fIntFlowCovariances->SetBinContent(covarianceLabel,wCov); | |
4111 | } | |
4112 | covarianceLabel++; | |
b3dacf6b | 4113 | } // end of for(Int_t c2=c1+1;c2<4;c2++) |
4114 | } // end of for(Int_t c1=0;c1<4;c1++) | |
489d5531 | 4115 | |
b3dacf6b | 4116 | // Versus multiplicity: |
4117 | if(!fCalculateCumulantsVsM){return;} | |
9da1a4f3 | 4118 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) |
4119 | for(Int_t b=1;b<=nBins;b++) | |
4120 | { | |
b3dacf6b | 4121 | // Average 2-, 4-, 6- and 8-particle correlations for all events: |
9da1a4f3 | 4122 | Double_t correlationVsM[4] = {0.}; |
4123 | for(Int_t ci=0;ci<4;ci++) | |
4124 | { | |
4125 | correlationVsM[ci] = fIntFlowCorrelationsVsMPro[ci]->GetBinContent(b); | |
4126 | } // end of for(Int_t ci=0;ci<4;ci++) | |
b3dacf6b | 4127 | // Average products of 2-, 4-, 6- and 8-particle correlations: |
9da1a4f3 | 4128 | Double_t productOfCorrelationsVsM[4][4] = {{0.}}; |
4129 | Int_t productOfCorrelationsLabelVsM = 1; | |
b3dacf6b | 4130 | // Denominators in the expressions for the unbiased estimator for covariance: |
9da1a4f3 | 4131 | Double_t denominatorVsM[4][4] = {{0.}}; |
4132 | Int_t sumOfProductOfEventWeightsLabel1VsM = 1; | |
b3dacf6b | 4133 | // Weight dependent prefactor which multiply unbiased estimators for covariances: |
9da1a4f3 | 4134 | Double_t wPrefactorVsM[4][4] = {{0.}}; |
4135 | Int_t sumOfProductOfEventWeightsLabel2VsM = 1; | |
4136 | for(Int_t c1=0;c1<4;c1++) | |
4137 | { | |
4138 | for(Int_t c2=c1+1;c2<4;c2++) | |
4139 | { | |
4140 | productOfCorrelationsVsM[c1][c2] = fIntFlowProductOfCorrelationsVsMPro[productOfCorrelationsLabelVsM-1]->GetBinContent(b); | |
b3dacf6b | 4141 | if(TMath::Abs(fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b)) > 1.e-44 && TMath::Abs(fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)) > 1.e-44) |
4142 | { | |
4143 | denominatorVsM[c1][c2] = 1.-(fIntFlowSumOfProductOfEventWeightsVsM[sumOfProductOfEventWeightsLabel1VsM-1]->GetBinContent(b)) | |
4144 | / (fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b) | |
4145 | * fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)); | |
4146 | wPrefactorVsM[c1][c2] = fIntFlowSumOfProductOfEventWeightsVsM[sumOfProductOfEventWeightsLabel2VsM-1]->GetBinContent(b) | |
4147 | / (fIntFlowSumOfEventWeightsVsM[c1][0]->GetBinContent(b) | |
4148 | * fIntFlowSumOfEventWeightsVsM[c2][0]->GetBinContent(b)); | |
9da1a4f3 | 4149 | } |
4150 | productOfCorrelationsLabelVsM++; | |
4151 | sumOfProductOfEventWeightsLabel1VsM++; | |
4152 | sumOfProductOfEventWeightsLabel2VsM++; | |
4153 | } // end of for(Int_t c1=0;c1<4;c1++) | |
4154 | } // end of for(Int_t c2=c1+1;c2<4;c2++) | |
b3dacf6b | 4155 | |
9da1a4f3 | 4156 | Int_t covarianceLabelVsM = 1; |
4157 | for(Int_t c1=0;c1<4;c1++) | |
4158 | { | |
4159 | for(Int_t c2=c1+1;c2<4;c2++) | |
4160 | { | |
b3dacf6b | 4161 | if(TMath::Abs(denominatorVsM[c1][c2]) > 1.e-44) |
9da1a4f3 | 4162 | { |
b3dacf6b | 4163 | // Covariances: |
9da1a4f3 | 4164 | Double_t covVsM = (productOfCorrelationsVsM[c1][c2]-correlationVsM[c1]*correlationVsM[c2])/denominatorVsM[c1][c2]; |
b3dacf6b | 4165 | // Covariances multiplied with weight dependent prefactor: |
9da1a4f3 | 4166 | Double_t wCovVsM = covVsM * wPrefactorVsM[c1][c2]; |
4167 | fIntFlowCovariancesVsM[covarianceLabelVsM-1]->SetBinContent(b,wCovVsM); | |
4168 | } | |
4169 | covarianceLabelVsM++; | |
b3dacf6b | 4170 | } // end of for(Int_t c2=c1+1;c2<4;c2++) |
4171 | } // end of for(Int_t c1=0;c1<4;c1++) | |
9da1a4f3 | 4172 | } // end of for(Int_t b=1;b<=nBins;b++) |
4173 | ||
489d5531 | 4174 | } // end of AliFlowAnalysisWithQCumulants::CalculateCovariancesIntFlow() |
4175 | ||
489d5531 | 4176 | //================================================================================================================================ |
4177 | ||
0328db2d | 4178 | void AliFlowAnalysisWithQCumulants::CalculateCovariancesNUAIntFlow() |
4179 | { | |
4180 | // a) Calculate unbiased estimators Cov(*,*) for true covariances V_(*,*) for NUA terms. | |
4181 | // b) Store in histogram fIntFlowCovariancesNUA for instance the following: | |
4182 | // | |
4183 | // Cov(<2>,<cos(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<cos(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<cos(phi)>}_j)] | |
4184 | // | |
4185 | // where N is the number of events, w_{<2>} is event weight for <2> and w_{<cos(phi)>} is event weight for <cos(phi)>. | |
4186 | // c) Binning of fIntFlowCovariancesNUA is organized as follows: | |
4187 | // | |
4188 | // 1st bin: Cov(<2>,<cos(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<cos(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<cos(phi)>}_j)] | |
4189 | // 2nd bin: Cov(<2>,<sin(phi)>) * (sum_{i=1}^{N} w_{<2>}_i w_{<sin(phi)>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<sin(phi)>}_j)] | |
4190 | // 3rd bin: Cov(<cos(phi)>,<sin(phi)>) * (sum_{i=1}^{N} w_{<cos(phi)>}_i w_{<sin(phi)>}_i )/[(sum_{i=1}^{N} w_{<cos(phi)>}_i) * (sum_{j=1}^{N} w_{<sin(phi)>}_j)] | |
4191 | // ... | |
4192 | ||
4193 | // Cov(<2>,<cos(phi)>): | |
4194 | Double_t product1 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(1); // <<2><cos(phi)>> | |
4195 | Double_t term1st1 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
4196 | Double_t term2nd1 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi)>> | |
4197 | Double_t sumOfW1st1 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
4198 | Double_t sumOfW2nd1 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi)>} | |
4199 | Double_t sumOfWW1 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(1); // W_{<2>} * W_{<cos(phi)>} | |
4200 | // numerator in the expression for the the unbiased estimator for covariance: | |
4201 | Double_t numerator1 = product1 - term1st1*term2nd1; | |
4202 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4203 | Double_t denominator1 = 0.; |
4204 | if(TMath::Abs(sumOfW1st1*sumOfW2nd1)>0.) | |
4205 | { | |
4206 | denominator1 = 1.-sumOfWW1/(sumOfW1st1*sumOfW2nd1); | |
4207 | if(TMath::Abs(denominator1)>0.) | |
4208 | { | |
4209 | // covariance: | |
4210 | Double_t covariance1 = numerator1/denominator1; | |
4211 | // weight dependent prefactor for covariance: | |
4212 | Double_t wPrefactor1 = sumOfWW1/(sumOfW1st1*sumOfW2nd1); | |
4213 | // finally, store "weighted" covariance: | |
4214 | fIntFlowCovariancesNUA->SetBinContent(1,wPrefactor1*covariance1); | |
4215 | } // end of if(TMath::Abs(denominator)>0.) | |
4216 | } // end of if(TMath::Abs(sumOfW1st1*sumOfW2nd1)>0.) | |
4217 | ||
0328db2d | 4218 | // Cov(<2>,<sin(phi)>): |
4219 | Double_t product2 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(2); // <<2><sin(phi)>> | |
4220 | Double_t term1st2 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
4221 | Double_t term2nd2 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi)>> | |
4222 | Double_t sumOfW1st2 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
4223 | Double_t sumOfW2nd2 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi)>} | |
4224 | Double_t sumOfWW2 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(2); // W_{<2>} * W_{<sin(phi)>} | |
4225 | // numerator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4226 | Double_t numerator2 = product2 - term1st2*term2nd2; |
0328db2d | 4227 | // denominator in the expression for the the unbiased estimator for covariance: |
b92ea2b9 | 4228 | Double_t denominator2 = 0.; |
4229 | if(TMath::Abs(sumOfW1st2*sumOfW2nd2)>0.) | |
4230 | { | |
4231 | denominator2 = 1.-sumOfWW2/(sumOfW1st2*sumOfW2nd2); | |
4232 | if(TMath::Abs(denominator2)>0.) | |
4233 | { | |
4234 | // covariance: | |
4235 | Double_t covariance2 = numerator2/denominator2; | |
4236 | // weight dependent prefactor for covariance: | |
4237 | Double_t wPrefactor2 = sumOfWW2/(sumOfW1st2*sumOfW2nd2); | |
4238 | // finally, store "weighted" covariance: | |
4239 | fIntFlowCovariancesNUA->SetBinContent(2,wPrefactor2*covariance2); | |
4240 | } // end of if(TMath::Abs(denominator2)>0.) | |
4241 | } // end of if(TMath::Abs(sumOfW1st2*sumOfW2nd2)>0.) | |
0328db2d | 4242 | |
4243 | // Cov(<cos(phi)>,<sin(phi)>): | |
4244 | Double_t product3 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(3); // <<cos(phi)><sin(phi)>> | |
4245 | Double_t term1st3 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi)>> | |
4246 | Double_t term2nd3 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi)>> | |
4247 | Double_t sumOfW1st3 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi)>} | |
4248 | Double_t sumOfW2nd3 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi)>} | |
4249 | Double_t sumOfWW3 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(3); // W_{<cos(phi)>} * W_{<sin(phi)>} | |
4250 | // numerator in the expression for the the unbiased estimator for covariance: | |
4251 | Double_t numerator3 = product3 - term1st3*term2nd3; | |
4252 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4253 | Double_t denominator3 = 0; |
4254 | if(TMath::Abs(sumOfW1st3*sumOfW2nd3)>0.) | |
4255 | { | |
4256 | denominator3 = 1.-sumOfWW3/(sumOfW1st3*sumOfW2nd3); | |
4257 | if(TMath::Abs(denominator3)>0.) | |
4258 | { | |
4259 | // covariance: | |
4260 | Double_t covariance3 = numerator3/denominator3; | |
4261 | // weight dependent prefactor for covariance: | |
4262 | Double_t wPrefactor3 = sumOfWW3/(sumOfW1st3*sumOfW2nd3); | |
4263 | // finally, store "weighted" covariance: | |
4264 | fIntFlowCovariancesNUA->SetBinContent(3,wPrefactor3*covariance3); | |
4265 | } // end of if(TMath::Abs(denominator3)>0.) | |
4266 | } // end of if(TMath::Abs(sumOfW1st3*sumOfW2nd3)>0.) | |
0328db2d | 4267 | |
4268 | // Cov(<2>,<cos(phi1+phi2)>): | |
4269 | Double_t product4 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(4); // <<2><cos(phi1+phi2)>> | |
4270 | Double_t term1st4 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
4271 | Double_t term2nd4 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
4272 | Double_t sumOfW1st4 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
4273 | Double_t sumOfW2nd4 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
4274 | Double_t sumOfWW4 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(4); // W_{<2>} * W_{<cos(phi1+phi2)>} | |
4275 | // numerator in the expression for the the unbiased estimator for covariance: | |
4276 | Double_t numerator4 = product4 - term1st4*term2nd4; | |
4277 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4278 | Double_t denominator4 = 0.; |
4279 | if(TMath::Abs(sumOfW1st4*sumOfW2nd4)>0.) | |
4280 | { | |
4281 | denominator4 = 1.-sumOfWW4/(sumOfW1st4*sumOfW2nd4); | |
4282 | if(TMath::Abs(denominator4)>0.) | |
4283 | { | |
4284 | // covariance: | |
4285 | Double_t covariance4 = numerator4/denominator4; | |
4286 | // weight dependent prefactor for covariance: | |
4287 | Double_t wPrefactor4 = sumOfWW4/(sumOfW1st4*sumOfW2nd4); | |
4288 | // finally, store "weighted" covariance: | |
4289 | fIntFlowCovariancesNUA->SetBinContent(4,wPrefactor4*covariance4); | |
4290 | } // end of if(TMath::Abs(denominator4)>0.) | |
4291 | } // end of if(TMath::Abs(sumOfW1st4*sumOfW2nd4)>0.) | |
4292 | ||
0328db2d | 4293 | // Cov(<2>,<sin(phi1+phi2)>): |
4294 | Double_t product5 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(5); // <<2><sin(phi1+phi2)>> | |
4295 | Double_t term1st5 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
4296 | Double_t term2nd5 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4297 | Double_t sumOfW1st5 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
4298 | Double_t sumOfW2nd5 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4299 | Double_t sumOfWW5 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(5); // W_{<2>} * W_{<sin(phi1+phi2)>} | |
4300 | // numerator in the expression for the the unbiased estimator for covariance: | |
4301 | Double_t numerator5 = product5 - term1st5*term2nd5; | |
4302 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4303 | Double_t denominator5 = 0.; |
4304 | if(TMath::Abs(sumOfW1st5*sumOfW2nd5)>0.) | |
4305 | { | |
4306 | denominator5 = 1.-sumOfWW5/(sumOfW1st5*sumOfW2nd5); | |
4307 | if(TMath::Abs(denominator5)>0.) | |
4308 | { | |
4309 | // covariance: | |
4310 | Double_t covariance5 = numerator5/denominator5; | |
4311 | // weight dependent prefactor for covariance: | |
4312 | Double_t wPrefactor5 = sumOfWW5/(sumOfW1st5*sumOfW2nd5); | |
4313 | // finally, store "weighted" covariance: | |
4314 | fIntFlowCovariancesNUA->SetBinContent(5,wPrefactor5*covariance5); | |
4315 | } // end of if(TMath::Abs(denominator5)>0.) | |
4316 | } // end of if(TMath::Abs(sumOfW1st5*sumOfW2nd5)>0.) | |
4317 | ||
0328db2d | 4318 | // Cov(<2>,<cos(phi1-phi2-phi3)>): |
4319 | Double_t product6 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(6); // <<2><cos(phi1-phi2-phi3)>> | |
4320 | Double_t term1st6 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
4321 | Double_t term2nd6 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
4322 | Double_t sumOfW1st6 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
4323 | Double_t sumOfW2nd6 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
4324 | Double_t sumOfWW6 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(6); // W_{<2>} * W_{<cos(phi1-phi2-phi3)>} | |
4325 | // numerator in the expression for the the unbiased estimator for covariance: | |
4326 | Double_t numerator6 = product6 - term1st6*term2nd6; | |
4327 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4328 | Double_t denominator6 = 0.; |
4329 | if(TMath::Abs(sumOfW1st6*sumOfW2nd6)>0.) | |
4330 | { | |
4331 | denominator6 = 1.-sumOfWW6/(sumOfW1st6*sumOfW2nd6); | |
4332 | if(TMath::Abs(denominator6)>0.) | |
4333 | { | |
4334 | // covariance: | |
4335 | Double_t covariance6 = numerator6/denominator6; | |
4336 | // weight dependent prefactor for covariance: | |
4337 | Double_t wPrefactor6 = sumOfWW6/(sumOfW1st6*sumOfW2nd6); | |
4338 | // finally, store "weighted" covariance: | |
4339 | fIntFlowCovariancesNUA->SetBinContent(6,wPrefactor6*covariance6); | |
4340 | } // end of if(TMath::Abs(denominator6)>0.) | |
4341 | } // end of if(TMath::Abs(sumOfW1st6*sumOfW2nd6)>0.) | |
4342 | ||
0328db2d | 4343 | // Cov(<2>,<sin(phi1-phi2-phi3)>): |
4344 | Double_t product7 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(7); // <<2><sin(phi1-phi2-phi3)>> | |
4345 | Double_t term1st7 = fIntFlowCorrelationsPro->GetBinContent(1); // <<2>> | |
4346 | Double_t term2nd7 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
4347 | Double_t sumOfW1st7 = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // W_{<2>} | |
4348 | Double_t sumOfW2nd7 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
4349 | Double_t sumOfWW7 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(7); // W_{<2>} * W_{<sin(phi1-phi2-phi3)>} | |
4350 | // numerator in the expression for the the unbiased estimator for covariance: | |
4351 | Double_t numerator7 = product7 - term1st7*term2nd7; | |
4352 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4353 | Double_t denominator7 = 0.; |
4354 | if(TMath::Abs(sumOfW1st7*sumOfW2nd7)>0.) | |
4355 | { | |
4356 | denominator7 = 1.-sumOfWW7/(sumOfW1st7*sumOfW2nd7); | |
4357 | if(TMath::Abs(denominator7)>0.) | |
4358 | { | |
4359 | // covariance: | |
4360 | Double_t covariance7 = numerator7/denominator7; | |
4361 | // weight dependent prefactor for covariance: | |
4362 | Double_t wPrefactor7 = sumOfWW7/(sumOfW1st7*sumOfW2nd7); | |
4363 | // finally, store "weighted" covariance: | |
4364 | fIntFlowCovariancesNUA->SetBinContent(7,wPrefactor7*covariance7); | |
4365 | } // end of if(TMath::Abs(denominator7)>0.) | |
4366 | } // end of if(TMath::Abs(sumOfW1st7*sumOfW2nd7)>0.) | |
4367 | ||
0328db2d | 4368 | // Cov(<4>,<cos(phi1>): |
4369 | Double_t product8 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(8); // <<4><cos(phi1)>> | |
4370 | Double_t term1st8 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
4371 | Double_t term2nd8 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
4372 | Double_t sumOfW1st8 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
4373 | Double_t sumOfW2nd8 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
4374 | Double_t sumOfWW8 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(8); // W_{<4>} * W_{<cos(phi1)>} | |
4375 | // numerator in the expression for the the unbiased estimator for covariance: | |
4376 | Double_t numerator8 = product8 - term1st8*term2nd8; | |
4377 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4378 | Double_t denominator8 = 0.; |
4379 | if(TMath::Abs(sumOfW1st8*sumOfW2nd8)>0.) | |
4380 | { | |
4381 | denominator8 = 1.-sumOfWW8/(sumOfW1st8*sumOfW2nd8); | |
4382 | if(TMath::Abs(denominator8)>0.) | |
4383 | { | |
4384 | // covariance: | |
4385 | Double_t covariance8 = numerator8/denominator8; | |
4386 | // weight dependent prefactor for covariance: | |
4387 | Double_t wPrefactor8 = sumOfWW8/(sumOfW1st8*sumOfW2nd8); | |
4388 | // finally, store "weighted" covariance: | |
4389 | fIntFlowCovariancesNUA->SetBinContent(8,wPrefactor8*covariance8); | |
4390 | } // end of if(TMath::Abs(denominator8)>0.) | |
4391 | } // end of if(TMath::Abs(sumOfW1st8*sumOfW2nd8)>0.) | |
4392 | ||
0328db2d | 4393 | // Cov(<4>,<sin(phi1)>): |
4394 | Double_t product9 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(9); // <<4><sin(phi1)>> | |
4395 | Double_t term1st9 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
4396 | Double_t term2nd9 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
4397 | Double_t sumOfW1st9 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
4398 | Double_t sumOfW2nd9 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
4399 | Double_t sumOfWW9 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(9); // W_{<4>} * W_{<sin(phi1)>} | |
4400 | // numerator in the expression for the the unbiased estimator for covariance: | |
4401 | Double_t numerator9 = product9 - term1st9*term2nd9; | |
4402 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4403 | Double_t denominator9 = 0.; |
4404 | if(TMath::Abs(sumOfW1st9*sumOfW2nd9)>0.) | |
4405 | { | |
4406 | denominator9 = 1.-sumOfWW9/(sumOfW1st9*sumOfW2nd9); | |
4407 | if(TMath::Abs(denominator9)>0.) | |
4408 | { | |
4409 | // covariance: | |
4410 | Double_t covariance9 = numerator9/denominator9; | |
4411 | // weight dependent prefactor for covariance: | |
4412 | Double_t wPrefactor9 = sumOfWW9/(sumOfW1st9*sumOfW2nd9); | |
4413 | // finally, store "weighted" covariance: | |
4414 | fIntFlowCovariancesNUA->SetBinContent(9,wPrefactor9*covariance9); | |
4415 | } | |
4416 | } // end of if(TMath::Abs(sumOfW1st9*sumOfW2nd9)>0.) | |
4417 | ||
0328db2d | 4418 | // Cov(<4>,<cos(phi1+phi2)>): |
4419 | Double_t product10 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(10); // <<4><cos(phi1+phi2)>> | |
4420 | Double_t term1st10 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
4421 | Double_t term2nd10 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
4422 | Double_t sumOfW1st10 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
4423 | Double_t sumOfW2nd10 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
4424 | Double_t sumOfWW10 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(10); // W_{<4>} * W_{<cos(phi1+phi2)>} | |
4425 | // numerator in the expression for the the unbiased estimator for covariance: | |
4426 | Double_t numerator10 = product10 - term1st10*term2nd10; | |
4427 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4428 | Double_t denominator10 = 0.; |
4429 | if(TMath::Abs(sumOfW1st10*sumOfW2nd10)>0.) | |
4430 | { | |
4431 | denominator10 = 1.-sumOfWW10/(sumOfW1st10*sumOfW2nd10); | |
4432 | if(TMath::Abs(denominator10)>0.) | |
4433 | { | |
4434 | // covariance: | |
4435 | Double_t covariance10 = numerator10/denominator10; | |
4436 | // weight dependent prefactor for covariance: | |
4437 | Double_t wPrefactor10 = sumOfWW10/(sumOfW1st10*sumOfW2nd10); | |
4438 | // finally, store "weighted" covariance: | |
4439 | fIntFlowCovariancesNUA->SetBinContent(10,wPrefactor10*covariance10); | |
4440 | } // end of if(TMath::Abs(denominator10)>0.) | |
4441 | } // end of if(TMath::Abs(sumOfW1st10*sumOfW2nd10)>0.) | |
4442 | ||
0328db2d | 4443 | // Cov(<4>,<sin(phi1+phi2)>): |
4444 | Double_t product11 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(11); // <<4><sin(phi1+phi2)>> | |
4445 | Double_t term1st11 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
4446 | Double_t term2nd11 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4447 | Double_t sumOfW1st11 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
4448 | Double_t sumOfW2nd11 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4449 | Double_t sumOfWW11 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(11); // W_{<4>} * W_{<sin(phi1+phi2)>} | |
4450 | // numerator in the expression for the the unbiased estimator for covariance: | |
4451 | Double_t numerator11 = product11 - term1st11*term2nd11; | |
4452 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4453 | Double_t denominator11 = 0.; |
4454 | if(TMath::Abs(sumOfW1st11*sumOfW2nd11)>0.) | |
4455 | { | |
4456 | denominator11 = 1.-sumOfWW11/(sumOfW1st11*sumOfW2nd11); | |
4457 | if(TMath::Abs(denominator11)>0.) | |
4458 | { | |
4459 | // covariance: | |
4460 | Double_t covariance11 = numerator11/denominator11; | |
4461 | // weight dependent prefactor for covariance: | |
4462 | Double_t wPrefactor11 = sumOfWW11/(sumOfW1st11*sumOfW2nd11); | |
4463 | // finally, store "weighted" covariance: | |
4464 | fIntFlowCovariancesNUA->SetBinContent(11,wPrefactor11*covariance11); | |
4465 | } // end of if(TMath::Abs(denominator11)>0.) | |
4466 | } // end of if(TMath::Abs(sumOfW1st11*sumOfW2nd11)>0.) | |
0328db2d | 4467 | |
4468 | // Cov(<4>,<cos(phi1-phi2-phi3)>): | |
4469 | Double_t product12 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(12); // <<4><cos(phi1-phi2-phi3)>> | |
4470 | Double_t term1st12 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
4471 | Double_t term2nd12 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
4472 | Double_t sumOfW1st12 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
4473 | Double_t sumOfW2nd12 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
4474 | Double_t sumOfWW12 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(12); // W_{<4>} * W_{<cos(phi1-phi2-phi3)>} | |
4475 | // numerator in the expression for the the unbiased estimator for covariance: | |
4476 | Double_t numerator12 = product12 - term1st12*term2nd12; | |
4477 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4478 | Double_t denominator12 = 0.; |
4479 | if(TMath::Abs(sumOfW1st12*sumOfW2nd12)>0.) | |
4480 | { | |
4481 | denominator12 = 1.-sumOfWW12/(sumOfW1st12*sumOfW2nd12); | |
4482 | if(TMath::Abs(denominator12)>0.) | |
4483 | { | |
4484 | // covariance: | |
4485 | Double_t covariance12 = numerator12/denominator12; | |
4486 | // weight dependent prefactor for covariance: | |
4487 | Double_t wPrefactor12 = sumOfWW12/(sumOfW1st12*sumOfW2nd12); | |
4488 | // finally, store "weighted" covariance: | |
4489 | fIntFlowCovariancesNUA->SetBinContent(12,wPrefactor12*covariance12); | |
4490 | } // end of if(TMath::Abs(denominator12)>0.) | |
4491 | } // end of if(TMath::Abs(sumOfW1st12*sumOfW2nd12)>0.) | |
0328db2d | 4492 | |
4493 | // Cov(<4>,<sin(phi1-phi2-phi3)>): | |
4494 | Double_t product13 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(13); // <<4><sin(phi1-phi2-phi3)>> | |
4495 | Double_t term1st13 = fIntFlowCorrelationsPro->GetBinContent(2); // <<4>> | |
4496 | Double_t term2nd13 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
4497 | Double_t sumOfW1st13 = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // W_{<4>} | |
4498 | Double_t sumOfW2nd13 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
4499 | Double_t sumOfWW13 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(13); // W_{<4>} * W_{<sin(phi1-phi2-phi3)>} | |
4500 | // numerator in the expression for the the unbiased estimator for covariance: | |
4501 | Double_t numerator13 = product13 - term1st13*term2nd13; | |
4502 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4503 | Double_t denominator13 = 0.; |
4504 | if(TMath::Abs(sumOfW1st13*sumOfW2nd13)>0.) | |
4505 | { | |
4506 | denominator13 = 1.-sumOfWW13/(sumOfW1st13*sumOfW2nd13); | |
4507 | if(TMath::Abs(denominator13)>0.) | |
4508 | { | |
4509 | // covariance: | |
4510 | Double_t covariance13 = numerator13/denominator13; | |
4511 | // weight dependent prefactor for covariance: | |
4512 | Double_t wPrefactor13 = sumOfWW13/(sumOfW1st13*sumOfW2nd13); | |
4513 | // finally, store "weighted" covariance: | |
4514 | fIntFlowCovariancesNUA->SetBinContent(13,wPrefactor13*covariance13); | |
4515 | } // end of if(TMath::Abs(denominator13)>0.) | |
4516 | } // end of if(TMath::Abs(sumOfW1st13*sumOfW2nd13)>0.) | |
0328db2d | 4517 | |
4518 | // Cov(<cos(phi1)>,<cos(phi1+phi2)>): | |
4519 | Double_t product14 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(14); // <<cos(phi1)><cos(phi1+phi2)>> | |
4520 | Double_t term1st14 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
4521 | Double_t term2nd14 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
4522 | Double_t sumOfW1st14 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
4523 | Double_t sumOfW2nd14 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
4524 | Double_t sumOfWW14 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(14); // W_{<cos(phi1)>} * W_{<cos(phi1+phi2)>} | |
4525 | // numerator in the expression for the the unbiased estimator for covariance: | |
4526 | Double_t numerator14 = product14 - term1st14*term2nd14; | |
4527 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4528 | Double_t denominator14 = 0.; |
4529 | if(TMath::Abs(sumOfW1st14*sumOfW2nd14)>0.) | |
4530 | { | |
4531 | denominator14 = 1.-sumOfWW14/(sumOfW1st14*sumOfW2nd14); | |
4532 | if(TMath::Abs(denominator14)>0.) | |
4533 | { | |
4534 | // covariance: | |
4535 | Double_t covariance14 = numerator14/denominator14; | |
4536 | // weight dependent prefactor for covariance: | |
4537 | Double_t wPrefactor14 = sumOfWW14/(sumOfW1st14*sumOfW2nd14); | |
4538 | // finally, store "weighted" covariance: | |
4539 | fIntFlowCovariancesNUA->SetBinContent(14,wPrefactor14*covariance14); | |
4540 | } // end of if(TMath::Abs(denominator14)>0.) | |
4541 | } // end of if(TMath::Abs(sumOfW1st14*sumOfW2nd14)>0.) | |
0328db2d | 4542 | |
4543 | // Cov(<cos(phi1)>,<sin(phi1+phi2)>): | |
4544 | Double_t product15 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(15); // <<cos(phi1)><sin(phi1+phi2)>> | |
4545 | Double_t term1st15 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
4546 | Double_t term2nd15 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4547 | Double_t sumOfW1st15 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
4548 | Double_t sumOfW2nd15 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4549 | Double_t sumOfWW15 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(15); // W_{<cos(phi1)>} * W_{<sin(phi1+phi2)>} | |
4550 | // numerator in the expression for the the unbiased estimator for covariance: | |
4551 | Double_t numerator15 = product15 - term1st15*term2nd15; | |
4552 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4553 | Double_t denominator15 = 0.; |
4554 | if(TMath::Abs(sumOfW1st15*sumOfW2nd15)>0.) | |
4555 | { | |
4556 | denominator15 = 1.-sumOfWW15/(sumOfW1st15*sumOfW2nd15); | |
4557 | if(TMath::Abs(denominator15)>0.) | |
4558 | { | |
4559 | // covariance: | |
4560 | Double_t covariance15 = numerator15/denominator15; | |
4561 | // weight dependent prefactor for covariance: | |
4562 | Double_t wPrefactor15 = sumOfWW15/(sumOfW1st15*sumOfW2nd15); | |
4563 | // finally, store "weighted" covariance: | |
4564 | fIntFlowCovariancesNUA->SetBinContent(15,wPrefactor15*covariance15); | |
4565 | } // end of if(TMath::Abs(denominator15)>0.) | |
4566 | } // end of if(TMath::Abs(sumOfW1st15*sumOfW2nd15)>0.) | |
4567 | ||
0328db2d | 4568 | // Cov(<cos(phi1)>,<cos(phi1-phi2-phi3)>): |
4569 | Double_t product16 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(16); // <<cos(phi1)><cos(phi1-phi2-phi3)>> | |
4570 | Double_t term1st16 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
4571 | Double_t term2nd16 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
4572 | Double_t sumOfW1st16 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
4573 | Double_t sumOfW2nd16 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
4574 | Double_t sumOfWW16 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(16); // W_{<cos(phi1)>} * W_{<cos(phi1-phi2-phi3)>} | |
4575 | // numerator in the expression for the the unbiased estimator for covariance: | |
4576 | Double_t numerator16 = product16 - term1st16*term2nd16; | |
4577 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4578 | Double_t denominator16 = 0.; |
4579 | if(TMath::Abs(sumOfW1st16*sumOfW2nd16)>0.) | |
4580 | { | |
4581 | denominator16 = 1.-sumOfWW16/(sumOfW1st16*sumOfW2nd16); | |
4582 | if(TMath::Abs(denominator16)>0.) | |
4583 | { | |
4584 | // covariance: | |
4585 | Double_t covariance16 = numerator16/denominator16; | |
4586 | // weight dependent prefactor for covariance: | |
4587 | Double_t wPrefactor16 = sumOfWW16/(sumOfW1st16*sumOfW2nd16); | |
4588 | // finally, store "weighted" covariance: | |
4589 | fIntFlowCovariancesNUA->SetBinContent(16,wPrefactor16*covariance16); | |
4590 | } // end of if(TMath::Abs(denominator16)>0.) | |
4591 | } // end ofif(TMath::Abs(sumOfW1st16*sumOfW2nd16)>0.) | |
4592 | ||
0328db2d | 4593 | // Cov(<cos(phi1)>,<sin(phi1-phi2-phi3)>): |
4594 | Double_t product17 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(17); // <<cos(phi1)><sin(phi1-phi2-phi3)>> | |
4595 | Double_t term1st17 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(1); // <<cos(phi1)>> | |
4596 | Double_t term2nd17 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
4597 | Double_t sumOfW1st17 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(1); // W_{<cos(phi1)>} | |
4598 | Double_t sumOfW2nd17 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
4599 | Double_t sumOfWW17 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(17); // W_{<cos(phi1)>} * W_{<sin(phi1-phi2-phi3)>} | |
4600 | // numerator in the expression for the the unbiased estimator for covariance: | |
4601 | Double_t numerator17 = product17 - term1st17*term2nd17; | |
4602 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4603 | Double_t denominator17 = 0.; |
4604 | if(TMath::Abs(sumOfW1st17*sumOfW2nd17)>0.) | |
4605 | { | |
4606 | denominator17 = 1.-sumOfWW17/(sumOfW1st17*sumOfW2nd17); | |
4607 | if(TMath::Abs(denominator17)>0.) | |
4608 | { | |
4609 | // covariance: | |
4610 | Double_t covariance17 = numerator17/denominator17; | |
4611 | // weight dependent prefactor for covariance: | |
4612 | Double_t wPrefactor17 = sumOfWW17/(sumOfW1st17*sumOfW2nd17); | |
4613 | // finally, store "weighted" covariance: | |
4614 | fIntFlowCovariancesNUA->SetBinContent(17,wPrefactor17*covariance17); | |
4615 | } // end of if(TMath::Abs(denominator17)>0.) | |
4616 | } // end of if(TMath::Abs(sumOfW1st17*sumOfW2nd17)>0.) | |
0328db2d | 4617 | |
4618 | // Cov(<sin(phi1)>,<cos(phi1+phi2)>): | |
4619 | Double_t product18 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(18); // <<sin(phi1)><cos(phi1+phi2)>> | |
4620 | Double_t term1st18 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
4621 | Double_t term2nd18 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
4622 | Double_t sumOfW1st18 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
4623 | Double_t sumOfW2nd18 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
4624 | Double_t sumOfWW18 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(18); // W_{<sin(phi1)>} * W_{<cos(phi1+phi2)>} | |
4625 | // numerator in the expression for the the unbiased estimator for covariance: | |
4626 | Double_t numerator18 = product18 - term1st18*term2nd18; | |
4627 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4628 | Double_t denominator18 = 0.; |
4629 | if(TMath::Abs(sumOfW1st18*sumOfW2nd18)>0.) | |
4630 | { | |
4631 | denominator18 = 1.-sumOfWW18/(sumOfW1st18*sumOfW2nd18); | |
4632 | if(TMath::Abs(denominator18)>0.) | |
4633 | { | |
4634 | // covariance: | |
4635 | Double_t covariance18 = numerator18/denominator18; | |
4636 | // weight dependent prefactor for covariance: | |
4637 | Double_t wPrefactor18 = sumOfWW18/(sumOfW1st18*sumOfW2nd18); | |
4638 | // finally, store "weighted" covariance: | |
4639 | fIntFlowCovariancesNUA->SetBinContent(18,wPrefactor18*covariance18); | |
4640 | } // end of if(TMath::Abs(denominator18)>0.) | |
4641 | } // end of if(TMath::Abs(sumOfW1st18*sumOfW2nd18)>0.) | |
0328db2d | 4642 | |
4643 | // Cov(<sin(phi1)>,<sin(phi1+phi2)>): | |
4644 | Double_t product19 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(19); // <<sin(phi1)><sin(phi1+phi2)>> | |
4645 | Double_t term1st19 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
4646 | Double_t term2nd19 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4647 | Double_t sumOfW1st19 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
4648 | Double_t sumOfW2nd19 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4649 | Double_t sumOfWW19 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(19); // W_{<sin(phi1)>} * W_{<sin(phi1+phi2)>} | |
4650 | // numerator in the expression for the the unbiased estimator for covariance: | |
4651 | Double_t numerator19 = product19 - term1st19*term2nd19; | |
4652 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4653 | Double_t denominator19 = 0.; |
4654 | if(TMath::Abs(sumOfW1st19*sumOfW2nd19)>0.) | |
4655 | { | |
4656 | denominator19 = 1.-sumOfWW19/(sumOfW1st19*sumOfW2nd19); | |
4657 | if(TMath::Abs(denominator19)>0.) | |
4658 | { | |
4659 | // covariance: | |
4660 | Double_t covariance19 = numerator19/denominator19; | |
4661 | // weight dependent prefactor for covariance: | |
4662 | Double_t wPrefactor19 = sumOfWW19/(sumOfW1st19*sumOfW2nd19); | |
4663 | // finally, store "weighted" covariance: | |
4664 | fIntFlowCovariancesNUA->SetBinContent(19,wPrefactor19*covariance19); | |
4665 | } // end of if(TMath::Abs(denominator19)>0.) | |
4666 | } // end of if(TMath::Abs(sumOfW1st19*sumOfW2nd19)>0.) | |
4667 | ||
0328db2d | 4668 | // Cov(<sin(phi1)>,<cos(phi1-phi2-phi3)>): |
4669 | Double_t product20 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(20); // <<sin(phi1)><cos(phi1-phi2-phi3)>> | |
4670 | Double_t term1st20 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
4671 | Double_t term2nd20 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
4672 | Double_t sumOfW1st20 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
4673 | Double_t sumOfW2nd20 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
4674 | Double_t sumOfWW20 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(20); // W_{<sin(phi1)>} * W_{<cos(phi1-phi2-phi3)>} | |
4675 | // numerator in the expression for the the unbiased estimator for covariance: | |
4676 | Double_t numerator20 = product20 - term1st20*term2nd20; | |
4677 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4678 | Double_t denominator20 = 0.; |
4679 | if(TMath::Abs(sumOfW1st20*sumOfW2nd20)>0.) | |
4680 | { | |
4681 | denominator20 = 1.-sumOfWW20/(sumOfW1st20*sumOfW2nd20); | |
4682 | if(TMath::Abs(denominator20)>0.) | |
4683 | { | |
4684 | // covariance: | |
4685 | Double_t covariance20 = numerator20/denominator20; | |
4686 | // weight dependent prefactor for covariance: | |
4687 | Double_t wPrefactor20 = sumOfWW20/(sumOfW1st20*sumOfW2nd20); | |
4688 | // finally, store "weighted" covariance: | |
4689 | fIntFlowCovariancesNUA->SetBinContent(20,wPrefactor20*covariance20); | |
4690 | } // end of if(TMath::Abs(denominator20)>0.) | |
4691 | } // end of if(TMath::Abs(sumOfW1st20*sumOfW2nd20)>0.) | |
0328db2d | 4692 | |
4693 | // Cov(<sin(phi1)>,<sin(phi1-phi2-phi3)>): | |
4694 | Double_t product21 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(21); // <<sin(phi1)><sin(phi1-phi2-phi3)>> | |
4695 | Double_t term1st21 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(1); // <<sin(phi1)>> | |
4696 | Double_t term2nd21 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
4697 | Double_t sumOfW1st21 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(1); // W_{<sin(phi1)>} | |
4698 | Double_t sumOfW2nd21 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
4699 | Double_t sumOfWW21 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(21); // W_{<sin(phi1)>} * W_{<sin(phi1-phi2-phi3)>} | |
4700 | // numerator in the expression for the the unbiased estimator for covariance: | |
4701 | Double_t numerator21 = product21 - term1st21*term2nd21; | |
4702 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4703 | Double_t denominator21 = 0.; |
4704 | if(TMath::Abs(sumOfW1st21*sumOfW2nd21)>0.) | |
4705 | { | |
4706 | denominator21 = 1.-sumOfWW21/(sumOfW1st21*sumOfW2nd21); | |
4707 | if(TMath::Abs(denominator21)>0.) | |
4708 | { | |
4709 | // covariance: | |
4710 | Double_t covariance21 = numerator21/denominator21; | |
4711 | // weight dependent prefactor for covariance: | |
4712 | Double_t wPrefactor21 = sumOfWW21/(sumOfW1st21*sumOfW2nd21); | |
4713 | // finally, store "weighted" covariance: | |
4714 | fIntFlowCovariancesNUA->SetBinContent(21,wPrefactor21*covariance21); | |
4715 | } // end of if(TMath::Abs(denominator21)>0.) | |
4716 | } // end of if(TMath::Abs(sumOfW1st21*sumOfW2nd21)>0.) | |
0328db2d | 4717 | |
4718 | // Cov(<cos(phi1+phi2)>,<sin(phi1+phi2)>): | |
4719 | Double_t product22 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(22); // <<cos(phi1+phi2)><sin(phi1+phi2)>> | |
4720 | Double_t term1st22 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
4721 | Double_t term2nd22 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4722 | Double_t sumOfW1st22 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
4723 | Double_t sumOfW2nd22 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4724 | Double_t sumOfWW22 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(22); // W_{<cos(phi1+phi2)>} * W_{<sin(phi1+phi2)>} | |
4725 | // numerator in the expression for the the unbiased estimator for covariance: | |
4726 | Double_t numerator22 = product22 - term1st22*term2nd22; | |
4727 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4728 | Double_t denominator22 = 0.; |
4729 | if(TMath::Abs(sumOfW1st22*sumOfW2nd22)>0.) | |
4730 | { | |
4731 | denominator22 = 1.-sumOfWW22/(sumOfW1st22*sumOfW2nd22); | |
4732 | if(TMath::Abs(denominator22)>0.) | |
4733 | { | |
4734 | // covariance: | |
4735 | Double_t covariance22 = numerator22/denominator22; | |
4736 | // weight dependent prefactor for covariance: | |
4737 | Double_t wPrefactor22 = sumOfWW22/(sumOfW1st22*sumOfW2nd22); | |
4738 | // finally, store "weighted" covariance: | |
4739 | fIntFlowCovariancesNUA->SetBinContent(22,wPrefactor22*covariance22); | |
4740 | } // end of if(TMath::Abs(denominator22)>0.) | |
4741 | } // end of if(TMath::Abs(sumOfW1st22*sumOfW2nd22)>0.) | |
0328db2d | 4742 | |
4743 | // Cov(<cos(phi1+phi2)>,<cos(phi1-phi2-phi3)>): | |
4744 | Double_t product23 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(23); // <<cos(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
4745 | Double_t term1st23 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
4746 | Double_t term2nd23 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
4747 | Double_t sumOfW1st23 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
4748 | Double_t sumOfW2nd23 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
4749 | Double_t sumOfWW23 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(23); // W_{<cos(phi1+phi2)>} * W_{<cos(phi1-phi2-phi3)>} | |
4750 | // numerator in the expression for the the unbiased estimator for covariance: | |
4751 | Double_t numerator23 = product23 - term1st23*term2nd23; | |
4752 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4753 | Double_t denominator23 = 0.; |
4754 | if(TMath::Abs(sumOfW1st23*sumOfW2nd23)>0.) | |
4755 | { | |
4756 | denominator23 = 1.-sumOfWW23/(sumOfW1st23*sumOfW2nd23); | |
4757 | if(TMath::Abs(denominator23)>0.) | |
4758 | { | |
4759 | // covariance: | |
4760 | Double_t covariance23 = numerator23/denominator23; | |
4761 | // weight dependent prefactor for covariance: | |
4762 | Double_t wPrefactor23 = sumOfWW23/(sumOfW1st23*sumOfW2nd23); | |
4763 | // finally, store "weighted" covariance: | |
4764 | fIntFlowCovariancesNUA->SetBinContent(23,wPrefactor23*covariance23); | |
4765 | } // end of if(TMath::Abs(denominator23)>0.) | |
4766 | } // end of if(TMath::Abs(sumOfW1st23*sumOfW2nd23)>0.) | |
4767 | ||
0328db2d | 4768 | // Cov(<cos(phi1+phi2)>,<sin(phi1-phi2-phi3)>): |
4769 | Double_t product24 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(24); // <<cos(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
4770 | Double_t term1st24 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(2); // <<cos(phi1+phi2)>> | |
4771 | Double_t term2nd24 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
4772 | Double_t sumOfW1st24 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(2); // W_{<cos(phi1+phi2)>} | |
4773 | Double_t sumOfW2nd24 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
4774 | Double_t sumOfWW24 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(24); // W_{<cos(phi1+phi2)>} * W_{<sin(phi1-phi2-phi3)>} | |
4775 | // numerator in the expression for the the unbiased estimator for covariance: | |
4776 | Double_t numerator24 = product24 - term1st24*term2nd24; | |
4777 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4778 | Double_t denominator24 = 0.; |
4779 | if(TMath::Abs(sumOfW1st24*sumOfW2nd24)>0.) | |
4780 | { | |
4781 | denominator24 = 1.-sumOfWW24/(sumOfW1st24*sumOfW2nd24); | |
4782 | if(TMath::Abs(denominator24)>0.) | |
4783 | { | |
4784 | // covariance: | |
4785 | Double_t covariance24 = numerator24/denominator24; | |
4786 | // weight dependent prefactor for covariance: | |
4787 | Double_t wPrefactor24 = sumOfWW24/(sumOfW1st24*sumOfW2nd24); | |
4788 | // finally, store "weighted" covariance: | |
4789 | fIntFlowCovariancesNUA->SetBinContent(24,wPrefactor24*covariance24); | |
4790 | } // end of if(TMath::Abs(denominator24)>0.) | |
4791 | } // end of if(TMath::Abs(sumOfW1st24*sumOfW2nd24)>0.) | |
0328db2d | 4792 | |
4793 | // Cov(<sin(phi1+phi2)>,<cos(phi1-phi2-phi3)>): | |
4794 | Double_t product25 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(25); // <<sin(phi1+phi2)><cos(phi1-phi2-phi3)>> | |
4795 | Double_t term1st25 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4796 | Double_t term2nd25 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> | |
4797 | Double_t sumOfW1st25 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4798 | Double_t sumOfW2nd25 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} | |
4799 | Double_t sumOfWW25 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(25); // W_{<sin(phi1+phi2)>} * W_{<cos(phi1-phi2-phi3)>} | |
4800 | // numerator in the expression for the the unbiased estimator for covariance: | |
4801 | Double_t numerator25 = product25 - term1st25*term2nd25; | |
4802 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4803 | Double_t denominator25 = 0.; |
4804 | if(TMath::Abs(sumOfW1st25*sumOfW2nd25)>0.) | |
4805 | { | |
4806 | denominator25 = 1.-sumOfWW25/(sumOfW1st25*sumOfW2nd25); | |
4807 | if(TMath::Abs(denominator25)>0.) | |
4808 | { | |
4809 | // covariance: | |
4810 | Double_t covariance25 = numerator25/denominator25; | |
4811 | // weight dependent prefactor for covariance: | |
4812 | Double_t wPrefactor25 = sumOfWW25/(sumOfW1st25*sumOfW2nd25); | |
4813 | // finally, store "weighted" covariance: | |
4814 | fIntFlowCovariancesNUA->SetBinContent(25,wPrefactor25*covariance25); | |
4815 | } // end of if(TMath::Abs(denominator25)>0.) | |
4816 | } // end of if(TMath::Abs(sumOfW1st25*sumOfW2nd25)>0.) | |
4817 | ||
0328db2d | 4818 | // Cov(<sin(phi1+phi2)>,<sin(phi1-phi2-phi3)>): |
4819 | Double_t product26 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(26); // <<sin(phi1+phi2)><sin(phi1-phi2-phi3)>> | |
4820 | Double_t term1st26 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(2); // <<sin(phi1+phi2)>> | |
4821 | Double_t term2nd26 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> | |
4822 | Double_t sumOfW1st26 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(2); // W_{<sin(phi1+phi2)>} | |
4823 | Double_t sumOfW2nd26 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} | |
4824 | Double_t sumOfWW26 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(26); // W_{<sin(phi1+phi2)>} * W_{<sin(phi1-phi2-phi3)>} | |
4825 | // numerator in the expression for the the unbiased estimator for covariance: | |
4826 | Double_t numerator26 = product26 - term1st26*term2nd26; | |
4827 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4828 | Double_t denominator26 = 0.; |
4829 | if(TMath::Abs(sumOfW1st26*sumOfW2nd26)>0.) | |
4830 | { | |
4831 | denominator26 = 1.-sumOfWW26/(sumOfW1st26*sumOfW2nd26); | |
4832 | if(TMath::Abs(denominator26)>0.) | |
4833 | { | |
4834 | // covariance: | |
4835 | Double_t covariance26 = numerator26/denominator26; | |
4836 | // weight dependent prefactor for covariance: | |
4837 | Double_t wPrefactor26 = sumOfWW26/(sumOfW1st26*sumOfW2nd26); | |
4838 | // finally, store "weighted" covariance: | |
4839 | fIntFlowCovariancesNUA->SetBinContent(26,wPrefactor26*covariance26); | |
4840 | } // end of if(TMath::Abs(denominator26)>0.) | |
4841 | } // end of if(TMath::Abs(sumOfW1st26*sumOfW2nd26)>0.) | |
4842 | ||
0328db2d | 4843 | // Cov(<cos(phi1-phi2-phi3)>,<sin(phi1-phi2-phi3)>): |
4844 | Double_t product27 = fIntFlowProductOfCorrectionTermsForNUAPro->GetBinContent(27); // <<cos(phi1-phi2-phi3)><sin(phi1-phi2-phi3)>> | |
b92ea2b9 | 4845 | Double_t term1st27 = fIntFlowCorrectionTermsForNUAPro[1]->GetBinContent(3); // <<cos(phi1-phi2-phi3)>> |
0328db2d | 4846 | Double_t term2nd27 = fIntFlowCorrectionTermsForNUAPro[0]->GetBinContent(3); // <<sin(phi1-phi2-phi3)>> |
b92ea2b9 | 4847 | Double_t sumOfW1st27 = fIntFlowSumOfEventWeightsNUA[1][0]->GetBinContent(3); // W_{<cos(phi1-phi2-phi3)>} |
0328db2d | 4848 | Double_t sumOfW2nd27 = fIntFlowSumOfEventWeightsNUA[0][0]->GetBinContent(3); // W_{<sin(phi1-phi2-phi3)>} |
4849 | Double_t sumOfWW27 = fIntFlowSumOfProductOfEventWeightsNUA->GetBinContent(27); // W_{<cos(phi1-phi2-phi3)>} * W_{<sin(phi1-phi2-phi3)>} | |
4850 | // numerator in the expression for the the unbiased estimator for covariance: | |
4851 | Double_t numerator27 = product27 - term1st27*term2nd27; | |
4852 | // denominator in the expression for the the unbiased estimator for covariance: | |
b92ea2b9 | 4853 | Double_t denominator27 = 0.; |
4854 | if(TMath::Abs(sumOfW1st27*sumOfW2nd27)>0.) | |
4855 | { | |
4856 | denominator27 = 1.-sumOfWW27/(sumOfW1st27*sumOfW2nd27); | |
4857 | if(TMath::Abs(denominator27)>0.) | |
4858 | { | |
4859 | // covariance: | |
4860 | Double_t covariance27 = numerator27/denominator27; | |
4861 | // weight dependent prefactor for covariance: | |
4862 | Double_t wPrefactor27 = sumOfWW27/(sumOfW1st27*sumOfW2nd27); | |
4863 | // finally, store "weighted" covariance: | |
4864 | fIntFlowCovariancesNUA->SetBinContent(27,wPrefactor27*covariance27); | |
4865 | } // end of if(TMath::Abs(denominator27)>0.) | |
4866 | } // end of if(TMath::Abs(sumOfW1st27*sumOfW2nd27)>0.) | |
4867 | ||
0328db2d | 4868 | } // end of AliFlowAnalysisWithQCumulants::CalculateCovariancesNUAIntFlow() |
4869 | ||
0328db2d | 4870 | //================================================================================================================================ |
4871 | ||
489d5531 | 4872 | void AliFlowAnalysisWithQCumulants::FinalizeCorrelationsIntFlow() |
4873 | { | |
4874 | // From profile fIntFlowCorrelationsPro access measured correlations and spread, | |
4875 | // correctly calculate the statistical errors and store the final results and | |
4876 | // statistical errors for correlations in histogram fIntFlowCorrelationsHist. | |
4877 | // | |
4878 | // Remark: Statistical error of correlation is calculated as: | |
4879 | // | |
4880 | // statistical error = termA * spread * termB: | |
4881 | // termA = sqrt{sum_{i=1}^{N} w^2}/(sum_{i=1}^{N} w) | |
4882 | // termB = 1/sqrt(1-termA^2) | |
b3dacf6b | 4883 | // |
4884 | ||
489d5531 | 4885 | for(Int_t ci=1;ci<=4;ci++) // correlation index |
4886 | { | |
b40a910e | 4887 | if(fIntFlowCorrelationsPro->GetBinEffectiveEntries(ci) < 2 || fIntFlowSquaredCorrelationsPro->GetBinEffectiveEntries(ci) < 2) |
4888 | { | |
4889 | fIntFlowCorrelationsPro->SetBinError(ci,0.); | |
4890 | fIntFlowSquaredCorrelationsPro->SetBinError(ci,0.); | |
4891 | continue; | |
4892 | } | |
489d5531 | 4893 | Double_t correlation = fIntFlowCorrelationsPro->GetBinContent(ci); |
b40a910e | 4894 | Double_t squaredCorrelation = fIntFlowSquaredCorrelationsPro->GetBinContent(ci); |
4895 | Double_t spread = 0.; | |
4896 | if(squaredCorrelation-correlation*correlation >= 0.) | |
4897 | { | |
4898 | spread = pow(squaredCorrelation-correlation*correlation,0.5); | |
4899 | } else | |
4900 | { | |
4901 | cout<<endl; | |
4902 | cout<<Form(" WARNING: Imaginary 'spread' for %d-particle correlation!!!! ",2*ci)<<endl; | |
4903 | cout<<endl; | |
4904 | } | |
489d5531 | 4905 | Double_t sumOfLinearEventWeights = fIntFlowSumOfEventWeights[0]->GetBinContent(ci); |
4906 | Double_t sumOfQuadraticEventWeights = fIntFlowSumOfEventWeights[1]->GetBinContent(ci); | |
4907 | Double_t termA = 0.; | |
4908 | Double_t termB = 0.; | |
b3dacf6b | 4909 | if(TMath::Abs(sumOfLinearEventWeights) > 0.) // to be improved - shall I omitt here Abs() ? |
489d5531 | 4910 | { |
4911 | termA = pow(sumOfQuadraticEventWeights,0.5)/sumOfLinearEventWeights; | |
4912 | } else | |
4913 | { | |
b3dacf6b | 4914 | cout<<endl; |
4915 | cout<<" WARNING (QC): sumOfLinearEventWeights == 0 in method FinalizeCorrelationsIntFlow() !!!!"<<endl; | |
4916 | cout<<" (for "<<2*ci<<"-particle correlation)"<<endl; | |
4917 | cout<<endl; | |
489d5531 | 4918 | } |
4919 | if(1.-pow(termA,2.) > 0.) | |
4920 | { | |
4921 | termB = 1./pow(1-pow(termA,2.),0.5); | |
4922 | } else | |
4923 | { | |
b3dacf6b | 4924 | cout<<endl; |
4925 | cout<<" WARNING (QC): 1.-pow(termA,2.) <= 0 in method FinalizeCorrelationsIntFlow() !!!!"<<endl; | |
4926 | cout<<" (for "<<2*ci<<"-particle correlation)"<<endl; | |
4927 | cout<<endl; | |
489d5531 | 4928 | } |
4929 | Double_t statisticalError = termA * spread * termB; | |
4930 | fIntFlowCorrelationsHist->SetBinContent(ci,correlation); | |
4931 | fIntFlowCorrelationsHist->SetBinError(ci,statisticalError); | |
ff70ca91 | 4932 | } // end of for(Int_t ci=1;ci<=4;ci++) // correlation index |
4933 | ||
b3dacf6b | 4934 | // Versus multiplicity: |
4935 | if(!fCalculateCumulantsVsM){return;} | |
ff70ca91 | 4936 | for(Int_t ci=0;ci<=3;ci++) // correlation index |
4937 | { | |
4938 | Int_t nBins = fIntFlowCorrelationsVsMPro[ci]->GetNbinsX(); | |
4939 | for(Int_t b=1;b<=nBins;b++) // looping over multiplicity bins | |
4940 | { | |
b40a910e | 4941 | if(fIntFlowCorrelationsVsMPro[ci]->GetBinEffectiveEntries(b) < 2 || fIntFlowSquaredCorrelationsVsMPro[ci]->GetBinEffectiveEntries(b) < 2) |
4942 | { | |
4943 | fIntFlowCorrelationsVsMPro[ci]->SetBinError(b,0.); | |
4944 | fIntFlowSquaredCorrelationsVsMPro[ci]->SetBinError(b,0.); | |
4945 | continue; | |
4946 | } | |
ff70ca91 | 4947 | Double_t correlationVsM = fIntFlowCorrelationsVsMPro[ci]->GetBinContent(b); |
b40a910e | 4948 | Double_t squaredCorrelationVsM = fIntFlowSquaredCorrelationsVsMPro[ci]->GetBinContent(b); |
4949 | Double_t spreadVsM = 0.; | |
4950 | if(squaredCorrelationVsM-correlationVsM*correlationVsM >= 0.) | |
4951 | { | |
4952 | spreadVsM = pow(squaredCorrelationVsM-correlationVsM*correlationVsM,0.5); | |
4953 | } else | |
4954 | { | |
4955 | cout<<endl; | |
4956 | cout<<Form(" WARNING (QC): Imaginary 'spreadVsM' for ci = %d, bin = %d, entries = %f !!!!", | |
4957 | ci,b,fIntFlowCorrelationsVsMPro[ci]->GetBinEffectiveEntries(b))<<endl; | |
4958 | cout<<endl; | |
4959 | } | |
ff70ca91 | 4960 | Double_t sumOfLinearEventWeightsVsM = fIntFlowSumOfEventWeightsVsM[ci][0]->GetBinContent(b); |
4961 | Double_t sumOfQuadraticEventWeightsVsM = fIntFlowSumOfEventWeightsVsM[ci][1]->GetBinContent(b); | |
4962 | Double_t termAVsM = 0.; | |
4963 | Double_t termBVsM = 0.; | |
b40a910e | 4964 | if(sumOfLinearEventWeightsVsM > 0.) |
ff70ca91 | 4965 | { |
4966 | termAVsM = pow(sumOfQuadraticEventWeightsVsM,0.5)/sumOfLinearEventWeightsVsM; | |
b3dacf6b | 4967 | } |
ff70ca91 | 4968 | if(1.-pow(termAVsM,2.) > 0.) |
4969 | { | |
4970 | termBVsM = 1./pow(1-pow(termAVsM,2.),0.5); | |
b3dacf6b | 4971 | } |
ff70ca91 | 4972 | Double_t statisticalErrorVsM = termAVsM * spreadVsM * termBVsM; |
4973 | fIntFlowCorrelationsVsMHist[ci]->SetBinContent(b,correlationVsM); | |
4974 | fIntFlowCorrelationsVsMHist[ci]->SetBinError(b,statisticalErrorVsM); | |
4975 | } // end of for(Int_t b=1;b<=nBins;b++) | |
4976 | } // end of for(Int_t ci=1;ci<=4;ci++) // correlation index | |
4977 | ||
489d5531 | 4978 | } // end of AliFlowAnalysisWithQCumulants::FinalizeCorrelationsIntFlow() |
4979 | ||
489d5531 | 4980 | //================================================================================================================================ |
4981 | ||
489d5531 | 4982 | void AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(Int_t nRP) |
4983 | { | |
b77b6434 | 4984 | // Fill profile fAverageMultiplicity to hold average multiplicities and |
4985 | // number of events for events with nRP>=0, nRP>=1, ... , and nRP>=8 | |
489d5531 | 4986 | |
4987 | // Binning of fAverageMultiplicity is organized as follows: | |
4988 | // 1st bin: all events (including the empty ones) | |
4989 | // 2nd bin: event with # of RPs greater or equal to 1 | |
4990 | // 3rd bin: event with # of RPs greater or equal to 2 | |
4991 | // 4th bin: event with # of RPs greater or equal to 3 | |
4992 | // 5th bin: event with # of RPs greater or equal to 4 | |
4993 | // 6th bin: event with # of RPs greater or equal to 5 | |
4994 | // 7th bin: event with # of RPs greater or equal to 6 | |
4995 | // 8th bin: event with # of RPs greater or equal to 7 | |
4996 | // 9th bin: event with # of RPs greater or equal to 8 | |
4997 | ||
489d5531 | 4998 | if(nRP<0) |
4999 | { | |
b77b6434 | 5000 | cout<<endl; |
5001 | cout<<" WARNING (QC): nRP<0 in in AFAWQC::FAM() !!!!"<<endl; | |
5002 | cout<<endl; | |
489d5531 | 5003 | exit(0); |
5004 | } | |
5005 | ||
5006 | for(Int_t i=0;i<9;i++) | |
5007 | { | |
b77b6434 | 5008 | if(nRP>=i){fAvMultiplicity->Fill(i+0.5,nRP,1);} |
489d5531 | 5009 | } |
5010 | ||
5011 | } // end of AliFlowAnalysisWithQCumulants::FillAverageMultiplicities(nRP) | |
5012 | ||
489d5531 | 5013 | //================================================================================================================================ |
5014 | ||
489d5531 | 5015 | void AliFlowAnalysisWithQCumulants::CalculateCumulantsIntFlow() |
b3dacf6b | 5016 | { |
b92ea2b9 | 5017 | // a) Calculate Q-cumulants from the measured multiparticle correlations; |
5018 | // b) Propagate the statistical errors from measured multiparticle correlations to statistical errors of Q-cumulants; | |
5019 | // c) Remark: Q-cumulants calculated in this method are biased by non-uniform acceptance of detector !!!! | |
5020 | // Method CalculateQcumulantsCorrectedForNUAIntFlow() is called afterwards to correct for this bias; | |
5021 | // d) Store the results and statistical error of Q-cumulants in histogram fIntFlowQcumulants. | |
5022 | // Binning of fIntFlowQcumulants is organized as follows: | |
489d5531 | 5023 | // |
b3dacf6b | 5024 | // 1st bin: QC{2} |
5025 | // 2nd bin: QC{4} | |
5026 | // 3rd bin: QC{6} | |
5027 | // 4th bin: QC{8} | |
5028 | // | |
489d5531 | 5029 | |
b3dacf6b | 5030 | // Correlations: |
489d5531 | 5031 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> |
5032 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> | |
5033 | Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> | |
5034 | Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> | |
b3dacf6b | 5035 | // Statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations: |
489d5531 | 5036 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <2> |
5037 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <4> | |
5038 | Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <6> | |
5039 | Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <8> | |
b3dacf6b | 5040 | // Covariances (multiplied by prefactor depending on weights - see comments in CalculateCovariancesIntFlow()): |
8e1cefdd | 5041 | Double_t wCov24 = 0.; // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) |
5042 | Double_t wCov26 = 0.; // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>) | |
5043 | Double_t wCov28 = 0.; // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>) | |
5044 | Double_t wCov46 = 0.; // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>) | |
5045 | Double_t wCov48 = 0.; // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>) | |
5046 | Double_t wCov68 = 0.; // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>) | |
5047 | if(!fForgetAboutCovariances) | |
5048 | { | |
5049 | wCov24 = fIntFlowCovariances->GetBinContent(1); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) | |
5050 | wCov26 = fIntFlowCovariances->GetBinContent(2); // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>) | |
5051 | wCov28 = fIntFlowCovariances->GetBinContent(3); // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>) | |
5052 | wCov46 = fIntFlowCovariances->GetBinContent(4); // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>) | |
5053 | wCov48 = fIntFlowCovariances->GetBinContent(5); // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>) | |
5054 | wCov68 = fIntFlowCovariances->GetBinContent(6); // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>) | |
5055 | } | |
489d5531 | 5056 | // Q-cumulants: |
5057 | Double_t qc2 = 0.; // QC{2} | |
5058 | Double_t qc4 = 0.; // QC{4} | |
5059 | Double_t qc6 = 0.; // QC{6} | |
5060 | Double_t qc8 = 0.; // QC{8} | |
b3dacf6b | 5061 | if(TMath::Abs(two) > 0.){qc2 = two;} |
5062 | if(TMath::Abs(four) > 0.){qc4 = four-2.*pow(two,2.);} | |
5063 | if(TMath::Abs(six) > 0.){qc6 = six-9.*two*four+12.*pow(two,3.);} | |
5064 | if(TMath::Abs(eight) > 0.){qc8 = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.);} | |
5065 | // Statistical errors of Q-cumulants: | |
489d5531 | 5066 | Double_t qc2Error = 0.; |
5067 | Double_t qc4Error = 0.; | |
5068 | Double_t qc6Error = 0.; | |
b3dacf6b | 5069 | Double_t qc8Error = 0.; |
5070 | // Squared statistical errors of Q-cumulants: | |
489d5531 | 5071 | //Double_t qc2ErrorSquared = 0.; |
5072 | Double_t qc4ErrorSquared = 0.; | |
5073 | Double_t qc6ErrorSquared = 0.; | |
b3dacf6b | 5074 | Double_t qc8ErrorSquared = 0.; |
5075 | // Statistical error of QC{2}: | |
5076 | qc2Error = twoError; | |
5077 | // Statistical error of QC{4}: | |
489d5531 | 5078 | qc4ErrorSquared = 16.*pow(two,2.)*pow(twoError,2)+pow(fourError,2.) |
5079 | - 8.*two*wCov24; | |
5080 | if(qc4ErrorSquared>0.) | |
5081 | { | |
5082 | qc4Error = pow(qc4ErrorSquared,0.5); | |
5083 | } else | |
5084 | { | |
b3dacf6b | 5085 | cout<<" WARNING (QC): Statistical error of QC{4} is imaginary !!!!"<<endl; |
5086 | } | |
5087 | // Statistical error of QC{6}: | |
489d5531 | 5088 | qc6ErrorSquared = 81.*pow(4.*pow(two,2.)-four,2.)*pow(twoError,2.) |
5089 | + 81.*pow(two,2.)*pow(fourError,2.) | |
5090 | + pow(sixError,2.) | |
5091 | - 162.*two*(4.*pow(two,2.)-four)*wCov24 | |
5092 | + 18.*(4.*pow(two,2.)-four)*wCov26 | |
b3dacf6b | 5093 | - 18.*two*wCov46; |
489d5531 | 5094 | if(qc6ErrorSquared>0.) |
5095 | { | |
5096 | qc6Error = pow(qc6ErrorSquared,0.5); | |
5097 | } else | |
5098 | { | |
b3dacf6b | 5099 | cout<<" WARNING (QC): Statistical error of QC{6} is imaginary !!!!"<<endl; |
5100 | } | |
5101 | // Statistical error of QC{8}: | |
489d5531 | 5102 | qc8ErrorSquared = 256.*pow(36.*pow(two,3.)-18.*four*two+six,2.)*pow(twoError,2.) |
5103 | + 1296.*pow(4.*pow(two,2.)-four,2.)*pow(fourError,2.) | |
5104 | + 256.*pow(two,2.)*pow(sixError,2.) | |
5105 | + pow(eightError,2.) | |
5106 | - 1152.*(36.*pow(two,3.)-18.*four*two+six)*(4.*pow(two,2.)-four)*wCov24 | |
5107 | + 512.*two*(36.*pow(two,3.)-18.*four*two+six)*wCov26 | |
5108 | - 32.*(36.*pow(two,3.)-18.*four*two+six)*wCov28 | |
5109 | - 1152.*two*(4.*pow(two,2.)-four)*wCov46 | |
5110 | + 72.*(4.*pow(two,2.)-four)*wCov48 | |
5111 | - 32.*two*wCov68; | |
5112 | if(qc8ErrorSquared>0.) | |
5113 | { | |
5114 | qc8Error = pow(qc8ErrorSquared,0.5); | |
5115 | } else | |
5116 | { | |
b3dacf6b | 5117 | cout<<"WARNING (QC): Statistical error of QC{8} is imaginary !!!!"<<endl; |
489d5531 | 5118 | } |
b3dacf6b | 5119 | // Store the results and statistical errors for Q-cumulants: |
5120 | if(TMath::Abs(qc2)>0.) | |
5121 | { | |
5122 | fIntFlowQcumulants->SetBinContent(1,qc2); | |
5123 | fIntFlowQcumulants->SetBinError(1,qc2Error); | |
5124 | } | |
5125 | if(TMath::Abs(qc4)>0.) | |
5126 | { | |
5127 | fIntFlowQcumulants->SetBinContent(2,qc4); | |
5128 | fIntFlowQcumulants->SetBinError(2,qc4Error); | |
5129 | } | |
5130 | if(TMath::Abs(qc6)>0.) | |
5131 | { | |
5132 | fIntFlowQcumulants->SetBinContent(3,qc6); | |
5133 | fIntFlowQcumulants->SetBinError(3,qc6Error); | |
5134 | } | |
5135 | if(TMath::Abs(qc8)>0.) | |
5136 | { | |
5137 | fIntFlowQcumulants->SetBinContent(4,qc8); | |
5138 | fIntFlowQcumulants->SetBinError(4,qc8Error); | |
5139 | } | |
5140 | ||
5141 | // Versus multiplicity: | |
5142 | if(!fCalculateCumulantsVsM){return;} | |
9da1a4f3 | 5143 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) |
b3dacf6b | 5144 | Double_t value[4] = {0.}; // QCs vs M |
5145 | Double_t error[4] = {0.}; // error of QCs vs M | |
5146 | Double_t dSum1[4] = {0.}; // sum value_i/(error_i)^2 | |
5147 | Double_t dSum2[4] = {0.}; // sum 1/(error_i)^2 | |
9da1a4f3 | 5148 | for(Int_t b=1;b<=nBins;b++) |
5149 | { | |
b3dacf6b | 5150 | // Correlations: |
9da1a4f3 | 5151 | two = fIntFlowCorrelationsVsMHist[0]->GetBinContent(b); // <<2>> |
5152 | four = fIntFlowCorrelationsVsMHist[1]->GetBinContent(b); // <<4>> | |
5153 | six = fIntFlowCorrelationsVsMHist[2]->GetBinContent(b); // <<6>> | |
5154 | eight = fIntFlowCorrelationsVsMHist[3]->GetBinContent(b); // <<8>> | |
b3dacf6b | 5155 | // Statistical errors of average 2-, 4-, 6- and 8-particle azimuthal correlations: |
9da1a4f3 | 5156 | twoError = fIntFlowCorrelationsVsMHist[0]->GetBinError(b); // statistical error of <2> |
5157 | fourError = fIntFlowCorrelationsVsMHist[1]->GetBinError(b); // statistical error of <4> | |
5158 | sixError = fIntFlowCorrelationsVsMHist[2]->GetBinError(b); // statistical error of <6> | |
5159 | eightError = fIntFlowCorrelationsVsMHist[3]->GetBinError(b); // statistical error of <8> | |
b3dacf6b | 5160 | // Covariances (multiplied by prefactor depending on weights - see comments in CalculateCovariancesIntFlow()): |
8e1cefdd | 5161 | if(!fForgetAboutCovariances) |
5162 | { | |
5163 | wCov24 = fIntFlowCovariancesVsM[0]->GetBinContent(b); // Cov(<2>,<4>) * prefactor(w_<2>,w_<4>) | |
5164 | wCov26 = fIntFlowCovariancesVsM[1]->GetBinContent(b); // Cov(<2>,<6>) * prefactor(w_<2>,w_<6>) | |
5165 | wCov28 = fIntFlowCovariancesVsM[2]->GetBinContent(b); // Cov(<2>,<8>) * prefactor(w_<2>,w_<8>) | |
5166 | wCov46 = fIntFlowCovariancesVsM[3]->GetBinContent(b); // Cov(<4>,<6>) * prefactor(w_<4>,w_<6>) | |
5167 | wCov48 = fIntFlowCovariancesVsM[4]->GetBinContent(b); // Cov(<4>,<8>) * prefactor(w_<4>,w_<8>) | |
5168 | wCov68 = fIntFlowCovariancesVsM[5]->GetBinContent(b); // Cov(<6>,<8>) * prefactor(w_<6>,w_<8>) | |
5169 | } | |
9da1a4f3 | 5170 | // Q-cumulants: |
5171 | qc2 = 0.; // QC{2} | |
5172 | qc4 = 0.; // QC{4} | |
5173 | qc6 = 0.; // QC{6} | |
5174 | qc8 = 0.; // QC{8} | |
b3dacf6b | 5175 | if(TMath::Abs(two) > 0.){qc2 = two;} |
5176 | if(TMath::Abs(four) > 0.){qc4 = four-2.*pow(two,2.);} | |
5177 | if(TMath::Abs(six) > 0.){qc6 = six-9.*two*four+12.*pow(two,3.);} | |
5178 | if(TMath::Abs(eight) > 0.){qc8 = eight-16.*two*six-18.*pow(four,2.)+144.*pow(two,2.)*four-144.*pow(two,4.);} | |
5179 | // Statistical errors of Q-cumulants: | |
9da1a4f3 | 5180 | qc2Error = 0.; |
5181 | qc4Error = 0.; | |
5182 | qc6Error = 0.; | |
b3dacf6b | 5183 | qc8Error = 0.; |
5184 | // Squared statistical errors of Q-cumulants: | |
9da1a4f3 | 5185 | //Double_t qc2ErrorSquared = 0.; |
5186 | qc4ErrorSquared = 0.; | |
5187 | qc6ErrorSquared = 0.; | |
b3dacf6b | 5188 | qc8ErrorSquared = 0.; |
5189 | // Statistical error of QC{2}: | |
5190 | qc2Error = twoError; | |
5191 | // Statistical error of QC{4}: | |
9da1a4f3 | 5192 | qc4ErrorSquared = 16.*pow(two,2.)*pow(twoError,2)+pow(fourError,2.) |
5193 | - 8.*two*wCov24; | |
5194 | if(qc4ErrorSquared>0.) | |
5195 | { | |
5196 | qc4Error = pow(qc4ErrorSquared,0.5); | |
5197 | } else | |
5198 | { | |
5199 | // cout<<"WARNING: Statistical error of QC{4} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl; | |
b3dacf6b | 5200 | } |
5201 | // Statistical error of QC{6}: | |
9da1a4f3 | 5202 | qc6ErrorSquared = 81.*pow(4.*pow(two,2.)-four,2.)*pow(twoError,2.) |
5203 | + 81.*pow(two,2.)*pow(fourError,2.) | |
5204 | + pow(sixError,2.) | |
5205 | - 162.*two*(4.*pow(two,2.)-four)*wCov24 | |
5206 | + 18.*(4.*pow(two,2.)-four)*wCov26 | |
b3dacf6b | 5207 | - 18.*two*wCov46; |
9da1a4f3 | 5208 | if(qc6ErrorSquared>0.) |
5209 | { | |
5210 | qc6Error = pow(qc6ErrorSquared,0.5); | |
5211 | } else | |
5212 | { | |
5213 | // cout<<"WARNING: Statistical error of QC{6} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl; | |
b3dacf6b | 5214 | } |
5215 | // Statistical error of QC{8}: | |
9da1a4f3 | 5216 | qc8ErrorSquared = 256.*pow(36.*pow(two,3.)-18.*four*two+six,2.)*pow(twoError,2.) |
5217 | + 1296.*pow(4.*pow(two,2.)-four,2.)*pow(fourError,2.) | |
5218 | + 256.*pow(two,2.)*pow(sixError,2.) | |
5219 | + pow(eightError,2.) | |
5220 | - 1152.*(36.*pow(two,3.)-18.*four*two+six)*(4.*pow(two,2.)-four)*wCov24 | |
5221 | + 512.*two*(36.*pow(two,3.)-18.*four*two+six)*wCov26 | |
5222 | - 32.*(36.*pow(two,3.)-18.*four*two+six)*wCov28 | |
5223 | - 1152.*two*(4.*pow(two,2.)-four)*wCov46 | |
5224 | + 72.*(4.*pow(two,2.)-four)*wCov48 | |
5225 | - 32.*two*wCov68; | |
5226 | if(qc8ErrorSquared>0.) | |
5227 | { | |
5228 | qc8Error = pow(qc8ErrorSquared,0.5); | |
5229 | } else | |
5230 | { | |
5231 | // cout<<"WARNING: Statistical error of QC{8} is imaginary in multiplicity bin "<<b<<" !!!!"<<endl; | |
5232 | } | |
b3dacf6b | 5233 | // Store the results and statistical errors for Q-cumulants: |
5234 | if(TMath::Abs(qc2)>0.) | |
5235 | { | |
5236 | fIntFlowQcumulantsVsM[0]->SetBinContent(b,qc2); | |
5237 | fIntFlowQcumulantsVsM[0]->SetBinError(b,qc2Error); | |
5238 | } | |
5239 | if(TMath::Abs(qc4)>0.) | |
5240 | { | |
5241 | fIntFlowQcumulantsVsM[1]->SetBinContent(b,qc4); | |
5242 | fIntFlowQcumulantsVsM[1]->SetBinError(b,qc4Error); | |
5243 | } | |
5244 | if(TMath::Abs(qc6)>0.) | |
5245 | { | |
5246 | fIntFlowQcumulantsVsM[2]->SetBinContent(b,qc6); | |
5247 | fIntFlowQcumulantsVsM[2]->SetBinError(b,qc6Error); | |
5248 | } | |
5249 | if(TMath::Abs(qc8)>0.) | |
5250 | { | |
5251 | fIntFlowQcumulantsVsM[3]->SetBinContent(b,qc8); | |
5252 | fIntFlowQcumulantsVsM[3]->SetBinError(b,qc8Error); | |
5253 | } | |
5254 | // Rebin in M: | |
5255 | for(Int_t co=0;co<4;co++) | |
5256 | { | |
b40a910e | 5257 | if(fIntFlowCorrelationsVsMPro[co]->GetBinEffectiveEntries(b)<2){continue;} |
b3dacf6b | 5258 | value[co] = fIntFlowQcumulantsVsM[co]->GetBinContent(b); |
5259 | error[co] = fIntFlowQcumulantsVsM[co]->GetBinError(b); | |
5260 | if(error[co]>0.) | |
5261 | { | |
5262 | dSum1[co]+=value[co]/(error[co]*error[co]); | |
5263 | dSum2[co]+=1./(error[co]*error[co]); | |
5264 | } | |
5265 | } // end of for(Int_t co=0;co<4;co++) | |
9da1a4f3 | 5266 | } // end of for(Int_t b=1;b<=nBins;b++) |
b3dacf6b | 5267 | // Store rebinned Q-cumulants: |
5268 | for(Int_t co=0;co<4;co++) | |
5269 | { | |
5270 | if(dSum2[co]>0.) | |
5271 | { | |
5272 | fIntFlowQcumulantsRebinnedInM->SetBinContent(co+1,dSum1[co]/dSum2[co]); | |
5273 | fIntFlowQcumulantsRebinnedInM->SetBinError(co+1,pow(1./dSum2[co],0.5)); | |
5274 | } | |
5275 | } // end of for(Int_t co=0;co<4;co++) | |
5276 | ||
489d5531 | 5277 | } // end of AliFlowAnalysisWithQCumulants::CalculateCumulantsIntFlow() |
5278 | ||
489d5531 | 5279 | //================================================================================================================================ |
5280 | ||
b92ea2b9 | 5281 | void AliFlowAnalysisWithQCumulants::CalculateReferenceFlow() |
489d5531 | 5282 | { |
b92ea2b9 | 5283 | // a) Calculate the final results for reference flow estimates from Q-cumulants; |
5284 | // b) Propagate the statistical errors to reference flow estimates from statistical error of Q-cumulants; | |
0328db2d | 5285 | // c) Store the results and statistical errors of reference flow estimates in histogram fIntFlow. |
489d5531 | 5286 | // Binning of fIntFlow is organized as follows: |
5287 | // | |
b3dacf6b | 5288 | // 1st bin: v{2,QC} |
5289 | // 2nd bin: v{4,QC} | |
5290 | // 3rd bin: v{6,QC} | |
5291 | // 4th bin: v{8,QC} | |
5292 | // | |
489d5531 | 5293 | |
b3dacf6b | 5294 | // Reference flow estimates: |
489d5531 | 5295 | Double_t v2 = 0.; // v{2,QC} |
5296 | Double_t v4 = 0.; // v{4,QC} | |
5297 | Double_t v6 = 0.; // v{6,QC} | |
5298 | Double_t v8 = 0.; // v{8,QC} | |
b3dacf6b | 5299 | // Reference flow's statistical errors: |
5300 | Double_t v2Error = 0.; // v{2,QC} stat. error | |
5301 | Double_t v4Error = 0.; // v{4,QC} stat. error | |
5302 | Double_t v6Error = 0.; // v{6,QC} stat. error | |
5303 | Double_t v8Error = 0.; // v{8,QC} stat. error | |
5304 | ||
b92ea2b9 | 5305 | // Q-cumulants: |
5306 | Double_t qc2 = fIntFlowQcumulants->GetBinContent(1); // QC{2} | |
5307 | Double_t qc4 = fIntFlowQcumulants->GetBinContent(2); // QC{4} | |
5308 | Double_t qc6 = fIntFlowQcumulants->GetBinContent(3); // QC{6} | |
5309 | Double_t qc8 = fIntFlowQcumulants->GetBinContent(4); // QC{8} | |
5310 | // Q-cumulants's statistical errors: | |
5311 | Double_t qc2Error = fIntFlowQcumulants->GetBinError(1); // QC{2} stat. error | |
5312 | Double_t qc4Error = fIntFlowQcumulants->GetBinError(2); // QC{4} stat. error | |
5313 | Double_t qc6Error = fIntFlowQcumulants->GetBinError(3); // QC{6} stat. error | |
5314 | Double_t qc8Error = fIntFlowQcumulants->GetBinError(4); // QC{8} stat. error | |
5315 | // Calculate reference flow estimates from Q-cumulants: | |
1268c371 | 5316 | if(qc2>=0.){v2 = pow(qc2,0.5);} |
b92ea2b9 | 5317 | if(qc4<=0.){v4 = pow(-1.*qc4,1./4.);} |
5318 | if(qc6>=0.){v6 = pow((1./4.)*qc6,1./6.);} | |
5319 | if(qc8<=0.){v8 = pow((-1./33.)*qc8,1./8.);} | |
5320 | // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants: | |
1268c371 | 5321 | if(qc2>0.){v2Error = (1./2.)*pow(qc2,-0.5)*qc2Error;} |
b92ea2b9 | 5322 | if(qc4<0.){v4Error = (1./4.)*pow(-qc4,-3./4.)*qc4Error;} |
5323 | if(qc6>0.){v6Error = (1./6.)*pow(2.,-1./3.)*pow(qc6,-5./6.)*qc6Error;} | |
5324 | if(qc8<0.){v8Error = (1./8.)*pow(33.,-1./8.)*pow(-qc8,-7./8.)*qc8Error;} | |
5325 | // Print warnings for the 'wrong sign' cumulants: | |
5326 | if(TMath::Abs(v2) < 1.e-44) | |
5327 | { | |
5328 | cout<<" WARNING: Wrong sign QC{2}, couldn't calculate v{2,QC} !!!!"<<endl; | |
5329 | } | |
5330 | if(TMath::Abs(v4) < 1.e-44) | |
5331 | { | |
5332 | cout<<" WARNING: Wrong sign QC{4}, couldn't calculate v{4,QC} !!!!"<<endl; | |
5333 | } | |
5334 | if(TMath::Abs(v6) < 1.e-44) | |
5335 | { | |
5336 | cout<<" WARNING: Wrong sign QC{6}, couldn't calculate v{6,QC} !!!!"<<endl; | |
5337 | } | |
5338 | if(TMath::Abs(v8) < 1.e-44) | |
5339 | { | |
5340 | cout<<" WARNING: Wrong sign QC{8}, couldn't calculate v{8,QC} !!!!"<<endl; | |
5341 | } | |
5342 | // Store the results and statistical errors of integrated flow estimates: | |
5343 | fIntFlow->SetBinContent(1,v2); | |
5344 | fIntFlow->SetBinError(1,v2Error); | |
5345 | fIntFlow->SetBinContent(2,v4); | |
5346 | fIntFlow->SetBinError(2,v4Error); | |
5347 | fIntFlow->SetBinContent(3,v6); | |
5348 | fIntFlow->SetBinError(3,v6Error); | |
5349 | fIntFlow->SetBinContent(4,v8); | |
5350 | fIntFlow->SetBinError(4,v8Error); | |
5351 | ||
5352 | // Versus multiplicity: | |
5353 | if(!fCalculateCumulantsVsM){return;} | |
5354 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) | |
5355 | for(Int_t b=1;b<=nBins;b++) | |
9da1a4f3 | 5356 | { |
5357 | // Q-cumulants: | |
b92ea2b9 | 5358 | Double_t qc2VsM = fIntFlowQcumulantsVsM[0]->GetBinContent(b); // QC{2} |
5359 | Double_t qc4VsM = fIntFlowQcumulantsVsM[1]->GetBinContent(b); // QC{4} | |
5360 | Double_t qc6VsM = fIntFlowQcumulantsVsM[2]->GetBinContent(b); // QC{6} | |
5361 | Double_t qc8VsM = fIntFlowQcumulantsVsM[3]->GetBinContent(b); // QC{8} | |
b3dacf6b | 5362 | // Q-cumulants's statistical errors: |
b92ea2b9 | 5363 | Double_t qc2ErrorVsM = fIntFlowQcumulantsVsM[0]->GetBinError(b); // QC{2} stat. error |
5364 | Double_t qc4ErrorVsM = fIntFlowQcumulantsVsM[1]->GetBinError(b); // QC{4} stat. error | |
5365 | Double_t qc6ErrorVsM = fIntFlowQcumulantsVsM[2]->GetBinError(b); // QC{6} stat. error | |
5366 | Double_t qc8ErrorVsM = fIntFlowQcumulantsVsM[3]->GetBinError(b); // QC{8} stat. error | |
b3dacf6b | 5367 | // Reference flow estimates: |
b92ea2b9 | 5368 | Double_t v2VsM = 0.; // v{2,QC} |
5369 | Double_t v4VsM = 0.; // v{4,QC} | |
5370 | Double_t v6VsM = 0.; // v{6,QC} | |
5371 | Double_t v8VsM = 0.; // v{8,QC} | |
5372 | // Reference flow estimates errors: | |
5373 | Double_t v2ErrorVsM = 0.; // v{2,QC} stat. error | |
5374 | Double_t v4ErrorVsM = 0.; // v{4,QC} stat. error | |
5375 | Double_t v6ErrorVsM = 0.; // v{6,QC} stat. error | |
5376 | Double_t v8ErrorVsM = 0.; // v{8,QC} stat. error | |
b3dacf6b | 5377 | // Calculate reference flow estimates from Q-cumulants: |
1268c371 | 5378 | if(qc2VsM>=0.){v2VsM = pow(qc2VsM,0.5);} |
b92ea2b9 | 5379 | if(qc4VsM<=0.){v4VsM = pow(-1.*qc4VsM,1./4.);} |
5380 | if(qc6VsM>=0.){v6VsM = pow((1./4.)*qc6VsM,1./6.);} | |
5381 | if(qc8VsM<=0.){v8VsM = pow((-1./33.)*qc8VsM,1./8.);} | |
b3dacf6b | 5382 | // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants: |
1268c371 | 5383 | if(qc2VsM>0.){v2ErrorVsM = (1./2.)*pow(qc2VsM,-0.5)*qc2ErrorVsM;} |
b92ea2b9 | 5384 | if(qc4VsM<0.){v4ErrorVsM = (1./4.)*pow(-qc4VsM,-3./4.)*qc4ErrorVsM;} |
5385 | if(qc6VsM>0.){v6ErrorVsM = (1./6.)*pow(2.,-1./3.)*pow(qc6VsM,-5./6.)*qc6ErrorVsM;} | |
5386 | if(qc8VsM<0.){v8ErrorVsM = (1./8.)*pow(33.,-1./8.)*pow(-qc8VsM,-7./8.)*qc8ErrorVsM;} | |
b3dacf6b | 5387 | // Store the results and statistical errors of integrated flow estimates: |
b92ea2b9 | 5388 | fIntFlowVsM[0]->SetBinContent(b,v2VsM); |
5389 | fIntFlowVsM[0]->SetBinError(b,v2ErrorVsM); | |
5390 | fIntFlowVsM[1]->SetBinContent(b,v4VsM); | |
5391 | fIntFlowVsM[1]->SetBinError(b,v4ErrorVsM); | |
5392 | fIntFlowVsM[2]->SetBinContent(b,v6VsM); | |
5393 | fIntFlowVsM[2]->SetBinError(b,v6ErrorVsM); | |
5394 | fIntFlowVsM[3]->SetBinContent(b,v8VsM); | |
5395 | fIntFlowVsM[3]->SetBinError(b,v8ErrorVsM); | |
5396 | } // end of for(Int_t b=1;b<=nBins;b++) | |
5397 | ||
5398 | // 'Rebinned in M' calculation: // to be improved - this can be implemented better: | |
5399 | // Reference flow estimates: | |
5400 | Double_t v2RebinnedInM = 0.; // v{2,QC} | |
5401 | Double_t v4RebinnedInM = 0.; // v{4,QC} | |
5402 | Double_t v6RebinnedInM = 0.; // v{6,QC} | |
5403 | Double_t v8RebinnedInM = 0.; // v{8,QC} | |
5404 | // Reference flow's statistical errors: | |
5405 | Double_t v2ErrorRebinnedInM = 0.; // v{2,QC} stat. error | |
5406 | Double_t v4ErrorRebinnedInM = 0.; // v{4,QC} stat. error | |
5407 | Double_t v6ErrorRebinnedInM = 0.; // v{6,QC} stat. error | |
5408 | Double_t v8ErrorRebinnedInM = 0.; // v{8,QC} stat. error | |
5409 | // Q-cumulants: | |
5410 | Double_t qc2RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(1); // QC{2} | |
5411 | Double_t qc4RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(2); // QC{4} | |
5412 | Double_t qc6RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(3); // QC{6} | |
5413 | Double_t qc8RebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinContent(4); // QC{8} | |
5414 | // Q-cumulants's statistical errors: | |
5415 | Double_t qc2ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(1); // QC{2} stat. error | |
5416 | Double_t qc4ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(2); // QC{4} stat. error | |
5417 | Double_t qc6ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(3); // QC{6} stat. error | |
5418 | Double_t qc8ErrorRebinnedInM = fIntFlowQcumulantsRebinnedInM->GetBinError(4); // QC{8} stat. error | |
5419 | // Calculate reference flow estimates from Q-cumulants: | |
1268c371 | 5420 | if(qc2RebinnedInM>=0.){v2RebinnedInM = pow(qc2RebinnedInM,0.5);} |
b92ea2b9 | 5421 | if(qc4RebinnedInM<=0.){v4RebinnedInM = pow(-1.*qc4RebinnedInM,1./4.);} |
5422 | if(qc6RebinnedInM>=0.){v6RebinnedInM = pow((1./4.)*qc6RebinnedInM,1./6.);} | |
5423 | if(qc8RebinnedInM<=0.){v8RebinnedInM = pow((-1./33.)*qc8RebinnedInM,1./8.);} | |
5424 | // Calculate stat. error for reference flow estimates from stat. error of Q-cumulants: | |
1268c371 | 5425 | if(qc2RebinnedInM>0.){v2ErrorRebinnedInM = (1./2.)*pow(qc2RebinnedInM,-0.5)*qc2ErrorRebinnedInM;} |
b92ea2b9 | 5426 | if(qc4RebinnedInM<0.){v4ErrorRebinnedInM = (1./4.)*pow(-qc4RebinnedInM,-3./4.)*qc4ErrorRebinnedInM;} |
5427 | if(qc6RebinnedInM>0.){v6ErrorRebinnedInM = (1./6.)*pow(2.,-1./3.)*pow(qc6RebinnedInM,-5./6.)*qc6ErrorRebinnedInM;} | |
5428 | if(qc8RebinnedInM<0.){v8ErrorRebinnedInM = (1./8.)*pow(33.,-1./8.)*pow(-qc8RebinnedInM,-7./8.)*qc8ErrorRebinnedInM;} | |
5429 | // Print warnings for the 'wrong sign' cumulants: | |
5430 | if(TMath::Abs(v2RebinnedInM) < 1.e-44) | |
5431 | { | |
5432 | cout<<" WARNING: Wrong sign QC{2} rebinned in M, couldn't calculate v{2,QC} !!!!"<<endl; | |
5433 | } | |
5434 | if(TMath::Abs(v4RebinnedInM) < 1.e-44) | |
5435 | { | |
5436 | cout<<" WARNING: Wrong sign QC{4} rebinned in M, couldn't calculate v{4,QC} !!!!"<<endl; | |
5437 | } | |
5438 | if(TMath::Abs(v6RebinnedInM) < 1.e-44) | |
5439 | { | |
5440 | cout<<" WARNING: Wrong sign QC{6} rebinned in M, couldn't calculate v{6,QC} !!!!"<<endl; | |
5441 | } | |
5442 | if(TMath::Abs(v8RebinnedInM) < 1.e-44) | |
5443 | { | |
5444 | cout<<" WARNING: Wrong sign QC{8} rebinned in M, couldn't calculate v{8,QC} !!!!"<<endl; | |
5445 | } | |
5446 | // Store the results and statistical errors of integrated flow estimates: | |
5447 | fIntFlowRebinnedInM->SetBinContent(1,v2RebinnedInM); | |
5448 | fIntFlowRebinnedInM->SetBinError(1,v2ErrorRebinnedInM); | |
5449 | fIntFlowRebinnedInM->SetBinContent(2,v4RebinnedInM); | |
5450 | fIntFlowRebinnedInM->SetBinError(2,v4ErrorRebinnedInM); | |
5451 | fIntFlowRebinnedInM->SetBinContent(3,v6RebinnedInM); | |
5452 | fIntFlowRebinnedInM->SetBinError(3,v6ErrorRebinnedInM); | |
5453 | fIntFlowRebinnedInM->SetBinContent(4,v8RebinnedInM); | |
5454 | fIntFlowRebinnedInM->SetBinError(4,v8ErrorRebinnedInM); | |
5455 | ||
5456 | } // end of AliFlowAnalysisWithQCumulants::CalculateReferenceFlow() | |
489d5531 | 5457 | |
489d5531 | 5458 | //================================================================================================================================ |
5459 | ||
489d5531 | 5460 | void AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow() |
5461 | { | |
0dd3b008 | 5462 | // Fill in AliFlowCommonHistResults histograms relevant for reference flow. |
489d5531 | 5463 | |
0dd3b008 | 5464 | // There are two possibilities here: |
5465 | // a) Store minimum bias reference flow - use SetMinimumBiasReferenceFlow(kTRUE). This result is | |
5466 | // biased by the interplay between nonflow correlations and multiplicity fluctuations and is | |
5467 | // also stored in local histogram fIntFlow; | |
5468 | // b) Store reference flow obtained from flow analysis performed at fixed multiplicity and | |
5469 | // rebinned only at the end of the day - use SetMinimumBiasReferenceFlow(kFALSE). This result | |
5470 | // is also stored in local histogram fIntFlowRebinnedInM. | |
489d5531 | 5471 | |
0dd3b008 | 5472 | // Reference flow estimates: |
5473 | Double_t v[4] = {0.}; | |
5474 | // Statistical errors of reference flow estimates: | |
5475 | Double_t vError[4] = {0.}; | |
489d5531 | 5476 | |
0dd3b008 | 5477 | for(Int_t b=0;b<4;b++) |
5478 | { | |
5479 | if(fMinimumBiasReferenceFlow) | |
5480 | { | |
5481 | v[b] = fIntFlow->GetBinContent(b+1); | |
5482 | vError[b] = fIntFlow->GetBinError(b+1); | |
5483 | } else | |
5484 | { | |
5485 | v[b] = fIntFlowRebinnedInM->GetBinContent(b+1); | |
5486 | vError[b] = fIntFlowRebinnedInM->GetBinError(b+1); | |
5487 | } | |
5488 | } // end of for(Int_t b=0;b<4;b++) | |
5489 | ||
5490 | // Fill AliFlowCommonHistResults histogram: | |
5491 | fCommonHistsResults2nd->FillIntegratedFlow(v[0],vError[0]); // to be improved (hardwired 2nd in the name) | |
5492 | fCommonHistsResults4th->FillIntegratedFlow(v[1],vError[1]); // to be improved (hardwired 4th in the name) | |
403e3389 | 5493 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) // to be improved (calculate also 6th and 8th order) |
489d5531 | 5494 | { |
0dd3b008 | 5495 | fCommonHistsResults6th->FillIntegratedFlow(v[2],vError[2]); // to be improved (hardwired 6th in the name) |
5496 | fCommonHistsResults8th->FillIntegratedFlow(v[3],vError[3]); // to be improved (hardwired 8th in the name) | |
489d5531 | 5497 | } |
5498 | ||
5499 | } // end of AliFlowAnalysisWithQCumulants::FillCommonHistResultsIntFlow() | |
5500 | ||
489d5531 | 5501 | //================================================================================================================================ |
5502 | ||
489d5531 | 5503 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelationsUsingParticleWeights() |
5504 | { | |
5505 | // Calculate all correlations needed for integrated flow using particle weights. | |
5506 | ||
5507 | // Remark 1: When particle weights are used the binning of fIntFlowCorrelationAllPro is organized as follows: | |
5508 | // | |
5509 | // 1st bin: <2>_{1n|1n} = two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))> | |
5510 | // 2nd bin: <2>_{2n|2n} = two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
5511 | // 3rd bin: <2>_{3n|3n} = two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
5512 | // 4th bin: <2>_{4n|4n} = two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
5513 | // 5th bin: ---- EMPTY ---- | |
5514 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
5515 | // 7th bin: <3>_{3n|2n,1n} = ... | |
5516 | // 8th bin: <3>_{4n|2n,2n} = ... | |
5517 | // 9th bin: <3>_{4n|3n,1n} = ... | |
5518 | // 10th bin: ---- EMPTY ---- | |
5519 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
5520 | // 12th bin: <4>_{2n,1n|2n,1n} = ... | |
5521 | // 13th bin: <4>_{2n,2n|2n,2n} = ... | |
5522 | // 14th bin: <4>_{3n|1n,1n,1n} = ... | |
5523 | // 15th bin: <4>_{3n,1n|3n,1n} = ... | |
5524 | // 16th bin: <4>_{3n,1n|2n,2n} = ... | |
5525 | // 17th bin: <4>_{4n|2n,1n,1n} = ... | |
5526 | // 18th bin: ---- EMPTY ---- | |
5527 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = ... | |
5528 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = ... | |
5529 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = ... | |
5530 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = ... | |
5531 | // 23rd bin: ---- EMPTY ---- | |
5532 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = ... | |
5533 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = ... | |
5534 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = ... | |
5535 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = ... | |
5536 | // 28th bin: ---- EMPTY ---- | |
5537 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = ... | |
5538 | // 30th bin: ---- EMPTY ---- | |
5539 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = ... | |
5540 | ||
5541 | // Remark 2: When particle weights are used there are some extra correlations. They are stored in | |
5542 | // fIntFlowExtraCorrelationsPro binning of which is organized as follows: | |
5543 | ||
5544 | // 1st bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))> | |
5545 | // 2nd bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
5546 | ||
5547 | // multiplicity (number of particles used to determine the reaction plane) | |
1268c371 | 5548 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 5549 | |
5550 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
5551 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
5552 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
5553 | Double_t dReQ3n3k = (*fReQ)(2,3); | |
5554 | Double_t dReQ4n4k = (*fReQ)(3,4); | |
5555 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
5556 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
5557 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
5558 | Double_t dImQ3n3k = (*fImQ)(2,3); | |
5559 | Double_t dImQ4n4k = (*fImQ)(3,4); | |
5560 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
5561 | ||
5562 | // dMs are variables introduced in order to simplify some Eqs. bellow: | |
5563 | //.............................................................................................. | |
1268c371 | 5564 | Double_t dM11 = (*fSpk)(1,1)-(*fSpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
5565 | Double_t dM22 = (*fSpk)(1,2)-(*fSpk)(0,4); // dM22 = sum_{i,j=1,i!=j}^M w_i^2 w_j^2 | |
5566 | Double_t dM33 = (*fSpk)(1,3)-(*fSpk)(0,6); // dM33 = sum_{i,j=1,i!=j}^M w_i^3 w_j^3 | |
5567 | Double_t dM44 = (*fSpk)(1,4)-(*fSpk)(0,8); // dM44 = sum_{i,j=1,i!=j}^M w_i^4 w_j^4 | |
5568 | Double_t dM31 = (*fSpk)(0,3)*(*fSpk)(0,1)-(*fSpk)(0,4); // dM31 = sum_{i,j=1,i!=j}^M w_i^3 w_j | |
5569 | Double_t dM211 = (*fSpk)(0,2)*(*fSpk)(1,1)-2.*(*fSpk)(0,3)*(*fSpk)(0,1) | |
5570 | - (*fSpk)(1,2)+2.*(*fSpk)(0,4); // dM211 = sum_{i,j,k=1,i!=j!=k}^M w_i^2 w_j w_k | |
5571 | Double_t dM1111 = (*fSpk)(3,1)-6.*(*fSpk)(0,2)*(*fSpk)(1,1) | |
5572 | + 8.*(*fSpk)(0,3)*(*fSpk)(0,1) | |
5573 | + 3.*(*fSpk)(1,2)-6.*(*fSpk)(0,4); // dM1111 = sum_{i,j,k,l=1,i!=j!=k!=l}^M w_i w_j w_k w_l | |
489d5531 | 5574 | //.............................................................................................. |
5575 | ||
5576 | // 2-particle correlations: | |
5577 | Double_t two1n1nW1W1 = 0.; // <w1 w2 cos(n*(phi1-phi2))> | |
5578 | Double_t two2n2nW2W2 = 0.; // <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
5579 | Double_t two3n3nW3W3 = 0.; // <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
5580 | Double_t two4n4nW4W4 = 0.; // <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
5581 | if(dMult>1) | |
5582 | { | |
5583 | if(dM11) | |
5584 | { | |
1268c371 | 5585 | two1n1nW1W1 = (pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSpk)(0,2))/dM11; |
489d5531 | 5586 | // average correlation <w1 w2 cos(n*(phi1-phi2))> for single event: |
5587 | fIntFlowCorrelationsEBE->SetBinContent(1,two1n1nW1W1); | |
5588 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(1,dM11); | |
5589 | // average correlation <w1 w2 cos(n*(phi1-phi2))> for all events: | |
b40a910e | 5590 | fIntFlowCorrelationsPro->Fill(0.5,two1n1nW1W1,dM11); |
5591 | // average squared correlation <w1 w2 cos(n*(phi1-phi2))> for all events: | |
5592 | fIntFlowSquaredCorrelationsPro->Fill(0.5,two1n1nW1W1*two1n1nW1W1,dM11); | |
489d5531 | 5593 | fIntFlowCorrelationsAllPro->Fill(0.5,two1n1nW1W1,dM11); |
5594 | } | |
5595 | if(dM22) | |
5596 | { | |
1268c371 | 5597 | two2n2nW2W2 = (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)-(*fSpk)(0,4))/dM22; |
489d5531 | 5598 | // ... |
5599 | // average correlation <w1^2 w2^2 cos(2n*(phi1-phi2))> for all events: | |
5600 | fIntFlowCorrelationsAllPro->Fill(1.5,two2n2nW2W2,dM22); | |
5601 | } | |
5602 | if(dM33) | |
5603 | { | |
1268c371 | 5604 | two3n3nW3W3 = (pow(dReQ3n3k,2)+pow(dImQ3n3k,2)-(*fSpk)(0,6))/dM33; |
489d5531 | 5605 | // ... |
5606 | // average correlation <w1^3 w2^3 cos(3n*(phi1-phi2))> for all events: | |
5607 | fIntFlowCorrelationsAllPro->Fill(2.5,two3n3nW3W3,dM33); | |
5608 | } | |
5609 | if(dM44) | |
5610 | { | |
1268c371 | 5611 | two4n4nW4W4 = (pow(dReQ4n4k,2)+pow(dImQ4n4k,2)-(*fSpk)(0,8))/dM44; |
489d5531 | 5612 | // ... |
5613 | // average correlation <w1^4 w2^4 cos(4n*(phi1-phi2))> for all events: | |
5614 | fIntFlowCorrelationsAllPro->Fill(3.5,two4n4nW4W4,dM44); | |
5615 | } | |
5616 | } // end of if(dMult>1) | |
5617 | ||
5618 | // extra 2-particle correlations: | |
5619 | Double_t two1n1nW3W1 = 0.; // <w1^3 w2 cos(n*(phi1-phi2))> | |
5620 | Double_t two1n1nW1W1W2 = 0.; // <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
5621 | if(dMult>1) | |
5622 | { | |
5623 | if(dM31) | |
5624 | { | |
1268c371 | 5625 | two1n1nW3W1 = (dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k-(*fSpk)(0,4))/dM31; |
489d5531 | 5626 | fIntFlowExtraCorrelationsPro->Fill(0.5,two1n1nW3W1,dM31); |
5627 | } | |
5628 | if(dM211) | |
5629 | { | |
1268c371 | 5630 | two1n1nW1W1W2 = ((*fSpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)-(*fSpk)(0,2)) |
489d5531 | 5631 | - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k |
1268c371 | 5632 | - (*fSpk)(0,4)))/dM211; |
489d5531 | 5633 | fIntFlowExtraCorrelationsPro->Fill(1.5,two1n1nW1W1W2,dM211); |
5634 | } | |
5635 | } // end of if(dMult>1) | |
5636 | //.............................................................................................. | |
5637 | ||
5638 | //.............................................................................................. | |
5639 | // 3-particle correlations: | |
5640 | Double_t three2n1n1nW2W1W1 = 0.; // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
5641 | ||
5642 | if(dMult>2) | |
5643 | { | |
5644 | if(dM211) | |
5645 | { | |
5646 | three2n1n1nW2W1W1 = (pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k | |
5647 | - 2.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k) | |
5648 | - pow(dReQ2n2k,2)-pow(dImQ2n2k,2) | |
1268c371 | 5649 | + 2.*(*fSpk)(0,4))/dM211; |
489d5531 | 5650 | fIntFlowCorrelationsAllPro->Fill(5.5,three2n1n1nW2W1W1,dM211); |
5651 | } | |
5652 | } // end of if(dMult>2) | |
5653 | //.............................................................................................. | |
5654 | ||
5655 | //.............................................................................................. | |
5656 | // 4-particle correlations: | |
5657 | Double_t four1n1n1n1nW1W1W1W1 = 0.; // <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
5658 | if(dMult>3) | |
5659 | { | |
5660 | if(dM1111) | |
5661 | { | |
5662 | four1n1n1n1nW1W1W1W1 = (pow(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.),2) | |
5663 | - 2.*(pow(dReQ1n1k,2.)*dReQ2n2k+2.*dReQ1n1k*dImQ1n1k*dImQ2n2k-pow(dImQ1n1k,2.)*dReQ2n2k) | |
5664 | + 8.*(dReQ1n3k*dReQ1n1k+dImQ1n3k*dImQ1n1k) | |
5665 | + (pow(dReQ2n2k,2)+pow(dImQ2n2k,2)) | |
1268c371 | 5666 | - 4.*(*fSpk)(0,2)*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
5667 | - 6.*(*fSpk)(0,4)+2.*(*fSpk)(1,2))/dM1111; | |
489d5531 | 5668 | |
5669 | // average correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for single event: | |
5670 | fIntFlowCorrelationsEBE->SetBinContent(2,four1n1n1n1nW1W1W1W1); | |
5671 | fIntFlowEventWeightsForCorrelationsEBE->SetBinContent(2,dM1111); | |
5672 | // average correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for all events: | |
5673 | fIntFlowCorrelationsPro->Fill(1.5,four1n1n1n1nW1W1W1W1,dM1111); | |
b40a910e | 5674 | // average squared correlation <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> for all events: |
5675 | fIntFlowSquaredCorrelationsPro->Fill(1.5,four1n1n1n1nW1W1W1W1*four1n1n1n1nW1W1W1W1,dM1111); | |
489d5531 | 5676 | fIntFlowCorrelationsAllPro->Fill(10.5,four1n1n1n1nW1W1W1W1,dM1111); |
5677 | } | |
5678 | } // end of if(dMult>3) | |
5679 | //.............................................................................................. | |
5680 | ||
5681 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrelationsUsingParticleWeights() | |
5682 | ||
489d5531 | 5683 | //================================================================================================================================ |
5684 | ||
489d5531 | 5685 | void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow() |
5686 | { | |
5687 | // Initialize all arrays used to calculate integrated flow. | |
5688 | ||
5689 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
5690 | { | |
5691 | fIntFlowCorrectionTermsForNUAEBE[sc] = NULL; | |
0328db2d | 5692 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc] = NULL; |
489d5531 | 5693 | fIntFlowCorrectionTermsForNUAPro[sc] = NULL; |
5694 | fIntFlowCorrectionTermsForNUAHist[sc] = NULL; | |
b92ea2b9 | 5695 | for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) |
2001bc3a | 5696 | { |
5697 | fIntFlowCorrectionTermsForNUAVsMPro[sc][ci] = NULL; | |
5698 | } | |
0328db2d | 5699 | for(Int_t power=0;power<2;power++) // linear or quadratic |
5700 | { | |
5701 | fIntFlowSumOfEventWeightsNUA[sc][power] = NULL; | |
5702 | } | |
489d5531 | 5703 | } |
5704 | for(Int_t power=0;power<2;power++) // linear or quadratic | |
5705 | { | |
5706 | fIntFlowSumOfEventWeights[power] = NULL; | |
5707 | } | |
b3dacf6b | 5708 | for(Int_t i=0;i<4;i++) // print on the screen the final results (0=RF, 1=RP, 2=POI, 3=RF (rebbined in M)) |
489d5531 | 5709 | { |
5710 | fPrintFinalResults[i] = kTRUE; | |
5711 | } | |
ff70ca91 | 5712 | for(Int_t ci=0;ci<4;ci++) // correlation index or cumulant order |
5713 | { | |
5714 | fIntFlowCorrelationsVsMPro[ci] = NULL; | |
b40a910e | 5715 | fIntFlowSquaredCorrelationsVsMPro[ci] = NULL; |
ff70ca91 | 5716 | fIntFlowCorrelationsVsMHist[ci] = NULL; |
5717 | fIntFlowQcumulantsVsM[ci] = NULL; | |
5718 | fIntFlowVsM[ci] = NULL; | |
2001bc3a | 5719 | fIntFlowDetectorBiasVsM[ci] = NULL; |
ff70ca91 | 5720 | for(Int_t lc=0;lc<2;lc++) |
5721 | { | |
5722 | fIntFlowSumOfEventWeightsVsM[ci][lc] = NULL; | |
5723 | } | |
5724 | } | |
5725 | for(Int_t pi=0;pi<6;pi++) // product or covariance index | |
5726 | { | |
5727 | fIntFlowProductOfCorrelationsVsMPro[pi] = NULL; | |
5728 | fIntFlowCovariancesVsM[pi] = NULL; | |
5729 | fIntFlowSumOfProductOfEventWeightsVsM[pi] = NULL; | |
5730 | } | |
403e3389 | 5731 | for(Int_t ci=0;ci<64;ci++) // correlation index for all correlations vs M profiles (to be improved - hardwired 64) |
3435cacb | 5732 | { |
5733 | fIntFlowCorrelationsAllVsMPro[ci] = NULL; | |
5734 | } | |
5735 | ||
489d5531 | 5736 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForIntFlow() |
5737 | ||
489d5531 | 5738 | //================================================================================================================================ |
5739 | ||
489d5531 | 5740 | void AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow() |
5741 | { | |
5742 | // Initialize all arrays needed to calculate differential flow. | |
5743 | // a) Initialize lists holding profiles; | |
5744 | // b) Initialize lists holding histograms; | |
5745 | // c) Initialize event-by-event quantities; | |
5746 | // d) Initialize profiles; | |
5747 | // e) Initialize histograms holding final results. | |
5748 | ||
5749 | // a) Initialize lists holding profiles; | |
5750 | for(Int_t t=0;t<2;t++) // type (RP, POI) | |
5751 | { | |
5752 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5753 | { | |
5754 | fDiffFlowCorrelationsProList[t][pe] = NULL; | |
5755 | fDiffFlowProductOfCorrelationsProList[t][pe] = NULL; | |
5756 | fDiffFlowCorrectionsProList[t][pe] = NULL; | |
5757 | } | |
1268c371 | 5758 | // 2D: |
5759 | f2DDiffFlowCorrelationsProList[t] = NULL; | |
489d5531 | 5760 | } |
5761 | ||
5762 | // b) Initialize lists holding histograms; | |
5763 | for(Int_t t=0;t<2;t++) // type (RP, POI) | |
5764 | { | |
5765 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5766 | { | |
5767 | fDiffFlowCorrelationsHistList[t][pe] = NULL; | |
5768 | for(Int_t power=0;power<2;power++) | |
5769 | { | |
5770 | fDiffFlowSumOfEventWeightsHistList[t][pe][power] = NULL; | |
5771 | } // end of for(Int_t power=0;power<2;power++) | |
5772 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe] = NULL; | |
5773 | fDiffFlowCorrectionsHistList[t][pe] = NULL; | |
5774 | fDiffFlowCovariancesHistList[t][pe] = NULL; | |
5775 | fDiffFlowCumulantsHistList[t][pe] = NULL; | |
1268c371 | 5776 | fDiffFlowDetectorBiasHistList[t][pe] = NULL; |
489d5531 | 5777 | fDiffFlowHistList[t][pe] = NULL; |
5778 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5779 | } // enf of for(Int_t t=0;t<2;t++) // type (RP, POI) | |
5780 | ||
5781 | // c) Initialize event-by-event quantities: | |
5782 | // 1D: | |
5783 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
5784 | { | |
5785 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5786 | { | |
5787 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
5788 | { | |
5789 | for(Int_t k=0;k<9;k++) // power of weight | |
5790 | { | |
5791 | fReRPQ1dEBE[t][pe][m][k] = NULL; | |
5792 | fImRPQ1dEBE[t][pe][m][k] = NULL; | |
5793 | fs1dEBE[t][pe][k] = NULL; // to be improved (this doesn't need to be within loop over m) | |
5794 | } | |
5795 | } | |
5796 | } | |
5797 | } | |
5798 | // 1D: | |
5799 | for(Int_t t=0;t<2;t++) // type (RP or POI) | |
5800 | { | |
5801 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5802 | { | |
5803 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
5804 | { | |
5805 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
5806 | { | |
5807 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti] = NULL; | |
5808 | } | |
5809 | } | |
5810 | } | |
5811 | } | |
5812 | // 2D: | |
5813 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
5814 | { | |
5815 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
5816 | { | |
5817 | for(Int_t k=0;k<9;k++) // power of weight | |
5818 | { | |
5819 | fReRPQ2dEBE[t][m][k] = NULL; | |
5820 | fImRPQ2dEBE[t][m][k] = NULL; | |
5821 | fs2dEBE[t][k] = NULL; // to be improved (this doesn't need to be within loop over m) | |
5822 | } | |
5823 | } | |
5824 | } | |
5825 | ||
5826 | // d) Initialize profiles: | |
5827 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
5828 | { | |
5829 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5830 | { | |
5831 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
5832 | { | |
5833 | fDiffFlowCorrelationsPro[t][pe][ci] = NULL; | |
b40a910e | 5834 | fDiffFlowSquaredCorrelationsPro[t][pe][ci] = NULL; |
489d5531 | 5835 | } // end of for(Int_t ci=0;ci<4;ci++) |
5836 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
5837 | { | |
5838 | for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index | |
5839 | { | |
5840 | fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = NULL; | |
5841 | } // end of for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index | |
5842 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
5843 | // correction terms for nua: | |
5844 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
5845 | { | |
5846 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
5847 | { | |
5848 | fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = NULL; | |
5849 | } | |
5850 | } | |
64e500e3 | 5851 | // other differential correlators: |
5852 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
5853 | { | |
5854 | for(Int_t ci=0;ci<1;ci++) // correction term index | |
5855 | { | |
5856 | fOtherDiffCorrelators[t][pe][sc][ci] = NULL; | |
5857 | } | |
5858 | } | |
489d5531 | 5859 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta |
1268c371 | 5860 | for(Int_t ci=0;ci<4;ci++) // correlation index |
5861 | { | |
5862 | f2DDiffFlowCorrelationsPro[t][ci] = NULL; | |
5863 | } | |
489d5531 | 5864 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI |
5865 | ||
5866 | // e) Initialize histograms holding final results. | |
5867 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
5868 | { | |
5869 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5870 | { | |
5871 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
5872 | { | |
5873 | fDiffFlowCorrelationsHist[t][pe][ci] = NULL; | |
5874 | fDiffFlowCumulants[t][pe][ci] = NULL; | |
1268c371 | 5875 | fDiffFlowDetectorBias[t][pe][ci] = NULL; |
489d5531 | 5876 | fDiffFlow[t][pe][ci] = NULL; |
5877 | } // end of for(Int_t ci=0;ci<4;ci++) | |
5878 | for(Int_t covarianceIndex=0;covarianceIndex<5;covarianceIndex++) | |
5879 | { | |
5880 | fDiffFlowCovariances[t][pe][covarianceIndex] = NULL; | |
5881 | } // end of for(Int_t covarianceIndex=0;covarianceIndex<5;covarianceIndex++) | |
5882 | // correction terms for nua: | |
5883 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
5884 | { | |
5885 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
5886 | { | |
5887 | fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = NULL; | |
5888 | } | |
5889 | } | |
5890 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
1268c371 | 5891 | for(Int_t ci=0;ci<4;ci++) // correlation index |
5892 | { | |
5893 | f2DDiffFlowCumulants[t][ci] = NULL; | |
5894 | f2DDiffFlow[t][ci] = NULL; | |
5895 | } | |
489d5531 | 5896 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI |
5897 | ||
5898 | // sum of event weights for reduced correlations: | |
5899 | for(Int_t t=0;t<2;t++) // type = RP or POI | |
5900 | { | |
5901 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5902 | { | |
5903 | for(Int_t p=0;p<2;p++) // power of weight is 1 or 2 | |
5904 | { | |
5905 | for(Int_t ew=0;ew<4;ew++) // event weight index for reduced correlations | |
5906 | { | |
5907 | fDiffFlowSumOfEventWeights[t][pe][p][ew] = NULL; | |
5908 | } | |
5909 | } | |
5910 | } | |
5911 | } | |
5912 | // product of event weights for both types of correlations: | |
5913 | for(Int_t t=0;t<2;t++) // type = RP or POI | |
5914 | { | |
5915 | for(Int_t pe=0;pe<2;pe++) // pt or eta | |
5916 | { | |
5917 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
5918 | { | |
5919 | for(Int_t mci2=0;mci2<8;mci2++) // mixed correlation index | |
5920 | { | |
5921 | fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = NULL; | |
5922 | } | |
5923 | } | |
5924 | } | |
5925 | } | |
1268c371 | 5926 | |
5927 | } // end of AliFlowAnalysisWithQCumulants::InitializeArraysForDiffFlow() | |
5928 | ||
5929 | //================================================================================================================================ | |
489d5531 | 5930 | |
1268c371 | 5931 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulants(TString type, TString ptOrEta) |
5932 | { | |
5933 | // Calculate differential flow cumulants from measured multiparticle correlations. | |
489d5531 | 5934 | |
1268c371 | 5935 | // REMARK: Cumulants calculated in this method are NOT corrected for non-uniform acceptance. |
5936 | // This correction, if enabled via setter SetApplyCorrectionForNUA(Bool_t), is applied | |
5937 | // in the method CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta) | |
489d5531 | 5938 | |
1268c371 | 5939 | Int_t t = 0; |
5940 | Int_t pe = 0; | |
5941 | ||
5942 | if(type == "RP") | |
5943 | { | |
5944 | t = 0; | |
5945 | } else if(type == "POI") | |
5946 | { | |
5947 | t = 1; | |
5948 | } | |
5949 | ||
5950 | if(ptOrEta == "Pt") | |
5951 | { | |
5952 | pe = 0; | |
5953 | } else if(ptOrEta == "Eta") | |
5954 | { | |
5955 | pe = 1; | |
5956 | } | |
5957 | ||
5958 | // Common: | |
5959 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
489d5531 | 5960 | |
1268c371 | 5961 | // Correlation <<2>>: |
5962 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); | |
5963 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); | |
489d5531 | 5964 | |
1268c371 | 5965 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) |
489d5531 | 5966 | { |
1268c371 | 5967 | // Reduced correlations: |
5968 | Double_t twoPrime = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); // <<2'>> | |
5969 | Double_t twoPrimeError = fDiffFlowCorrelationsHist[t][pe][0]->GetBinError(b); // stat. error of <<2'>> | |
5970 | Double_t fourPrime = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); // <<4'>> | |
5971 | Double_t fourPrimeError = fDiffFlowCorrelationsHist[t][pe][1]->GetBinError(b); // stat. error of <<4'>> | |
5972 | // Covariances: | |
5973 | Double_t wCovTwoTwoReduced = fDiffFlowCovariances[t][pe][0]->GetBinContent(b); // Cov(<2>,<2'>) * prefactor(<2>,<2'>) | |
5974 | Double_t wCovTwoFourReduced = fDiffFlowCovariances[t][pe][1]->GetBinContent(b); // Cov(<2>,<4'>) * prefactor(<2>,<4'>) | |
5975 | Double_t wCovTwoReducedFourReduced = fDiffFlowCovariances[t][pe][4]->GetBinContent(b); // Cov(<2'>,<4'>) * prefactor(<2'>,<4'>) | |
5976 | // QC{2'}: | |
5977 | Double_t qc2Prime = twoPrime; // QC{2'} | |
5978 | Double_t qc2PrimeError = twoPrimeError; // stat. error of QC{2'} | |
5979 | fDiffFlowCumulants[t][pe][0]->SetBinContent(b,qc2Prime); | |
5980 | fDiffFlowCumulants[t][pe][0]->SetBinError(b,qc2PrimeError); | |
5981 | // QC{4'}: | |
5982 | Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>> | |
5983 | Double_t qc4PrimeError = 0.; // stat. error of QC{4'} | |
5984 | Double_t qc4PrimeErrorSquared = 4.*pow(twoPrime,2.)*pow(twoError,2.) | |
5985 | + 4.*pow(two,2.)*pow(twoPrimeError,2.) | |
5986 | + pow(fourPrimeError,2.) | |
5987 | + 8.*two*twoPrime*wCovTwoTwoReduced | |
5988 | - 4.*twoPrime*wCovTwoFourReduced | |
5989 | - 4.*two*wCovTwoReducedFourReduced; | |
5990 | if(qc4PrimeErrorSquared>0.) | |
5991 | { | |
5992 | qc4PrimeError = pow(qc4PrimeErrorSquared,0.5); | |
489d5531 | 5993 | } |
1268c371 | 5994 | fDiffFlowCumulants[t][pe][1]->SetBinContent(b,qc4Prime); |
5995 | fDiffFlowCumulants[t][pe][1]->SetBinError(b,qc4PrimeError); | |
489d5531 | 5996 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
489d5531 | 5997 | |
1268c371 | 5998 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulants(TString type, Bool_t useParticleWeights, TString eventWeights); |
489d5531 | 5999 | |
6000 | //================================================================================================================================ | |
6001 | ||
1268c371 | 6002 | void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCumulants(TString type) |
489d5531 | 6003 | { |
1268c371 | 6004 | // Calculate 2D differential cumulants. |
489d5531 | 6005 | |
1268c371 | 6006 | // Remark: correction for detector effects and error propagation not implemented yet for 2D differential cumulants. |
489d5531 | 6007 | |
1268c371 | 6008 | Int_t t = 0; |
489d5531 | 6009 | |
6010 | if(type == "RP") | |
6011 | { | |
1268c371 | 6012 | t = 0; |
489d5531 | 6013 | } else if(type == "POI") |
6014 | { | |
1268c371 | 6015 | t = 1; |
6016 | } | |
6017 | ||
6018 | // Reference correlation <<2>>: | |
6019 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); | |
489d5531 | 6020 | |
1268c371 | 6021 | // Looping over all (pt,eta) bins and calculating differential flow cumulants: |
6022 | for(Int_t p=1;p<=fnBinsPt;p++) | |
489d5531 | 6023 | { |
6024 | for(Int_t e=1;e<=fnBinsEta;e++) | |
6025 | { | |
1268c371 | 6026 | // Reduced correlations: |
6027 | Double_t twoPrime = f2DDiffFlowCorrelationsPro[t][0]->GetBinContent(f2DDiffFlowCorrelationsPro[t][0]->GetBin(p,e)); // <<2'>>(pt,eta) | |
6028 | Double_t fourPrime = f2DDiffFlowCorrelationsPro[t][1]->GetBinContent(f2DDiffFlowCorrelationsPro[t][1]->GetBin(p,e)); // <<4'>>(pt,eta) | |
6029 | // Cumulants: | |
6030 | Double_t qc2Prime = twoPrime; // QC{2'} = <<2'>> | |
6031 | f2DDiffFlowCumulants[t][0]->SetBinContent(f2DDiffFlowCumulants[t][0]->GetBin(p,e),qc2Prime); | |
6032 | Double_t qc4Prime = fourPrime - 2.*twoPrime*two; // QC{4'} = <<4'>> - 2*<<2'>><<2>> | |
6033 | f2DDiffFlowCumulants[t][1]->SetBinContent(f2DDiffFlowCumulants[t][1]->GetBin(p,e),qc4Prime); | |
489d5531 | 6034 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) |
489d5531 | 6035 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
6036 | ||
1268c371 | 6037 | } // end of void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCumulants(TString type) |
489d5531 | 6038 | |
489d5531 | 6039 | //================================================================================================================================ |
6040 | ||
489d5531 | 6041 | void AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type) |
6042 | { | |
1268c371 | 6043 | // Calculate final results for integrated flow of RPs and POIs. |
489d5531 | 6044 | |
1268c371 | 6045 | // to be improved - check if the integrated flow calculation here is actually correct |
6046 | ||
6047 | Int_t t = 0; // RP = 0, POI = 1 | |
489d5531 | 6048 | |
6049 | if(type == "RP") | |
6050 | { | |
1268c371 | 6051 | t = 0; |
489d5531 | 6052 | } else if(type == "POI") |
6053 | { | |
1268c371 | 6054 | t = 1; |
6055 | } | |
489d5531 | 6056 | |
489d5531 | 6057 | // pt yield: |
6058 | TH1F *yield2ndPt = NULL; | |
6059 | TH1F *yield4thPt = NULL; | |
6060 | TH1F *yield6thPt = NULL; | |
6061 | TH1F *yield8thPt = NULL; | |
6062 | ||
6063 | if(type == "POI") | |
6064 | { | |
dd442cd2 | 6065 | if(fFillMultipleControlHistograms) |
6066 | { | |
6067 | yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtPOI())->Clone(); | |
6068 | yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtPOI())->Clone(); | |
6069 | yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtPOI())->Clone(); | |
6070 | yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtPOI())->Clone(); | |
6071 | } else | |
6072 | { | |
6073 | yield2ndPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
6074 | yield4thPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
6075 | yield6thPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
6076 | yield8thPt = (TH1F*)(fCommonHists->GetHistPtPOI())->Clone(); | |
6077 | } | |
489d5531 | 6078 | } |
6079 | else if(type == "RP") | |
6080 | { | |
dd442cd2 | 6081 | if(fFillMultipleControlHistograms) |
6082 | { | |
6083 | yield2ndPt = (TH1F*)(fCommonHists2nd->GetHistPtRP())->Clone(); | |
6084 | yield4thPt = (TH1F*)(fCommonHists4th->GetHistPtRP())->Clone(); | |
6085 | yield6thPt = (TH1F*)(fCommonHists6th->GetHistPtRP())->Clone(); | |
6086 | yield8thPt = (TH1F*)(fCommonHists8th->GetHistPtRP())->Clone(); | |
6087 | } else | |
6088 | { | |
6089 | yield2ndPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
6090 | yield4thPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
6091 | yield6thPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
6092 | yield8thPt = (TH1F*)(fCommonHists->GetHistPtRP())->Clone(); | |
6093 | } | |
489d5531 | 6094 | } |
6095 | ||
0d11c335 | 6096 | if(!yield2ndPt){return;} |
6097 | if(!yield4thPt){return;} | |
6098 | if(!yield6thPt){return;} | |
6099 | if(!yield8thPt){return;} | |
6100 | ||
489d5531 | 6101 | Int_t nBinsPt = yield2ndPt->GetNbinsX(); |
6102 | ||
6103 | TH1D *flow2ndPt = NULL; | |
6104 | TH1D *flow4thPt = NULL; | |
6105 | TH1D *flow6thPt = NULL; | |
6106 | TH1D *flow8thPt = NULL; | |
6107 | ||
6108 | // to be improved (hardwired pt index) | |
6109 | flow2ndPt = (TH1D*)fDiffFlow[t][0][0]->Clone(); | |
6110 | flow4thPt = (TH1D*)fDiffFlow[t][0][1]->Clone(); | |
6111 | flow6thPt = (TH1D*)fDiffFlow[t][0][2]->Clone(); | |
6112 | flow8thPt = (TH1D*)fDiffFlow[t][0][3]->Clone(); | |
0d11c335 | 6113 | |
6114 | if(!flow2ndPt){return;} | |
6115 | if(!flow4thPt){return;} | |
6116 | if(!flow6thPt){return;} | |
6117 | if(!flow8thPt){return;} | |
489d5531 | 6118 | |
6119 | Double_t dvn2nd = 0., dvn4th = 0., dvn6th = 0., dvn8th = 0.; // differential flow | |
6120 | Double_t dErrvn2nd = 0., dErrvn4th = 0., dErrvn6th = 0., dErrvn8th = 0.; // error on differential flow | |
6121 | ||
6122 | Double_t dVn2nd = 0., dVn4th = 0., dVn6th = 0., dVn8th = 0.; // integrated flow | |
6123 | Double_t dErrVn2nd = 0., dErrVn4th = 0., dErrVn6th = 0., dErrVn8th = 0.; // error on integrated flow | |
6124 | ||
6125 | Double_t dYield2nd = 0., dYield4th = 0., dYield6th = 0., dYield8th = 0.; // pt yield | |
6126 | Double_t dSum2nd = 0., dSum4th = 0., dSum6th = 0., dSum8th = 0.; // needed for normalizing integrated flow | |
6127 | ||
6128 | // looping over pt bins: | |
6129 | for(Int_t p=1;p<nBinsPt+1;p++) | |
6130 | { | |
6131 | dvn2nd = flow2ndPt->GetBinContent(p); | |
6132 | dvn4th = flow4thPt->GetBinContent(p); | |
6133 | dvn6th = flow6thPt->GetBinContent(p); | |
6134 | dvn8th = flow8thPt->GetBinContent(p); | |
6135 | ||
6136 | dErrvn2nd = flow2ndPt->GetBinError(p); | |
6137 | dErrvn4th = flow4thPt->GetBinError(p); | |
6138 | dErrvn6th = flow6thPt->GetBinError(p); | |
6139 | dErrvn8th = flow8thPt->GetBinError(p); | |
6140 | ||
6141 | dYield2nd = yield2ndPt->GetBinContent(p); | |
6142 | dYield4th = yield4thPt->GetBinContent(p); | |
6143 | dYield6th = yield6thPt->GetBinContent(p); | |
6144 | dYield8th = yield8thPt->GetBinContent(p); | |
6145 | ||
6146 | dVn2nd += dvn2nd*dYield2nd; | |
6147 | dVn4th += dvn4th*dYield4th; | |
6148 | dVn6th += dvn6th*dYield6th; | |
6149 | dVn8th += dvn8th*dYield8th; | |
6150 | ||
6151 | dSum2nd += dYield2nd; | |
6152 | dSum4th += dYield4th; | |
6153 | dSum6th += dYield6th; | |
6154 | dSum8th += dYield8th; | |
6155 | ||
6156 | dErrVn2nd += dYield2nd*dYield2nd*dErrvn2nd*dErrvn2nd; // ro be improved (check this relation) | |
6157 | dErrVn4th += dYield4th*dYield4th*dErrvn4th*dErrvn4th; | |
6158 | dErrVn6th += dYield6th*dYield6th*dErrvn6th*dErrvn6th; | |
6159 | dErrVn8th += dYield8th*dYield8th*dErrvn8th*dErrvn8th; | |
6160 | ||
6161 | } // end of for(Int_t p=1;p<nBinsPt+1;p++) | |
6162 | ||
6163 | // normalizing the results for integrated flow: | |
6164 | if(dSum2nd) | |
6165 | { | |
6166 | dVn2nd /= dSum2nd; | |
6167 | dErrVn2nd /= (dSum2nd*dSum2nd); | |
6168 | dErrVn2nd = TMath::Sqrt(dErrVn2nd); | |
6169 | } | |
6170 | if(dSum4th) | |
6171 | { | |
6172 | dVn4th /= dSum4th; | |
6173 | dErrVn4th /= (dSum4th*dSum4th); | |
6174 | dErrVn4th = TMath::Sqrt(dErrVn4th); | |
6175 | } | |
6176 | //if(dSum6th) dVn6th/=dSum6th; | |
6177 | //if(dSum8th) dVn8th/=dSum8th; | |
6178 | ||
6179 | // storing the results for integrated flow in common histos: (to be improved: new method for this?) | |
6180 | if(type == "POI") | |
6181 | { | |
6182 | fCommonHistsResults2nd->FillIntegratedFlowPOI(dVn2nd,dErrVn2nd); | |
6183 | fCommonHistsResults4th->FillIntegratedFlowPOI(dVn4th,dErrVn4th); | |
6184 | fCommonHistsResults6th->FillIntegratedFlowPOI(dVn6th,0.); // to be improved (errors) | |
6185 | fCommonHistsResults8th->FillIntegratedFlowPOI(dVn8th,0.); // to be improved (errors) | |
6186 | } | |
6187 | else if (type == "RP") | |
6188 | { | |
6189 | fCommonHistsResults2nd->FillIntegratedFlowRP(dVn2nd,dErrVn2nd); | |
6190 | fCommonHistsResults4th->FillIntegratedFlowRP(dVn4th,dErrVn4th); | |
6191 | fCommonHistsResults6th->FillIntegratedFlowRP(dVn6th,0.); // to be improved (errors) | |
6192 | fCommonHistsResults8th->FillIntegratedFlowRP(dVn8th,0.); // to be improved (errors) | |
6193 | } | |
6194 | ||
6195 | delete flow2ndPt; | |
6196 | delete flow4thPt; | |
6197 | //delete flow6thPt; | |
6198 | //delete flow8thPt; | |
6199 | ||
6200 | delete yield2ndPt; | |
6201 | delete yield4thPt; | |
6202 | delete yield6thPt; | |
6203 | delete yield8thPt; | |
6204 | ||
6205 | } // end of AliFlowAnalysisWithQCumulants::CalculateFinalResultsForRPandPOIIntegratedFlow(TString type) | |
6206 | ||
489d5531 | 6207 | //================================================================================================================================ |
6208 | ||
489d5531 | 6209 | void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions() |
6210 | { | |
6211 | // Initialize all arrays used for distributions. | |
6212 | ||
6213 | // a) Initialize arrays of histograms used to hold distributions of correlations; | |
6214 | // b) Initialize array to hold min and max values of correlations. | |
6215 | ||
6216 | // a) Initialize arrays of histograms used to hold distributions of correlations: | |
6217 | for(Int_t di=0;di<4;di++) // distribution index | |
6218 | { | |
6219 | fDistributions[di] = NULL; | |
6220 | } | |
6221 | ||
6222 | // b) Initialize default min and max values of correlations: | |
6223 | // (Remark: The default values bellow were chosen for v2=5% and M=500) | |
6224 | fMinValueOfCorrelation[0] = -0.01; // <2>_min | |
6225 | fMaxValueOfCorrelation[0] = 0.04; // <2>_max | |
6226 | fMinValueOfCorrelation[1] = -0.00002; // <4>_min | |
6227 | fMaxValueOfCorrelation[1] = 0.00015; // <4>_max | |
6228 | fMinValueOfCorrelation[2] = -0.0000003; // <6>_min | |
6229 | fMaxValueOfCorrelation[2] = 0.0000006; // <6>_max | |
6230 | fMinValueOfCorrelation[3] = -0.000000006; // <8>_min | |
6231 | fMaxValueOfCorrelation[3] = 0.000000003; // <8>_max | |
6232 | ||
6233 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForDistributions() | |
6234 | ||
489d5531 | 6235 | //================================================================================================================================ |
6236 | ||
e5834fcb | 6237 | void AliFlowAnalysisWithQCumulants::InitializeArraysForVarious() |
6238 | { | |
6239 | // Initialize all arrays used for various unclassified objects. | |
6240 | ||
6241 | for(Int_t p=0;p<4;p++) // [v_min,v_max,refMult_min,refMult_max] | |
6242 | { | |
6243 | fPhiDistributionForOneEventSettings[p] = 0.; | |
6244 | } | |
6245 | ||
6246 | } // end of void AliFlowAnalysisWithQCumulants::InitializeArraysForVarious() | |
6247 | ||
6248 | //================================================================================================================================ | |
489d5531 | 6249 | |
6250 | void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions() | |
6251 | { | |
6252 | // a) Book profile to hold all flags for distributions of correlations; | |
6253 | // b) Book all histograms to hold distributions of correlations. | |
6254 | ||
6255 | TString correlationIndex[4] = {"<2>","<4>","<6>","<8>"}; // to be improved (should I promote this to data members?) | |
6256 | ||
6257 | // a) Book profile to hold all flags for distributions of correlations: | |
6258 | TString distributionsFlagsName = "fDistributionsFlags"; | |
6259 | distributionsFlagsName += fAnalysisLabel->Data(); | |
6260 | fDistributionsFlags = new TProfile(distributionsFlagsName.Data(),"Flags for Distributions of Correlations",9,0,9); | |
6261 | fDistributionsFlags->SetTickLength(-0.01,"Y"); | |
6262 | fDistributionsFlags->SetMarkerStyle(25); | |
6263 | fDistributionsFlags->SetLabelSize(0.05); | |
6264 | fDistributionsFlags->SetLabelOffset(0.02,"Y"); | |
6265 | fDistributionsFlags->GetXaxis()->SetBinLabel(1,"Store or not?"); | |
6266 | fDistributionsFlags->GetXaxis()->SetBinLabel(2,"<2>_{min}"); | |
6267 | fDistributionsFlags->GetXaxis()->SetBinLabel(3,"<2>_{max}"); | |
6268 | fDistributionsFlags->GetXaxis()->SetBinLabel(4,"<4>_{min}"); | |
6269 | fDistributionsFlags->GetXaxis()->SetBinLabel(5,"<4>_{max}"); | |
6270 | fDistributionsFlags->GetXaxis()->SetBinLabel(6,"<6>_{min}"); | |
6271 | fDistributionsFlags->GetXaxis()->SetBinLabel(7,"<6>_{max}"); | |
6272 | fDistributionsFlags->GetXaxis()->SetBinLabel(8,"<8>_{min}"); | |
6273 | fDistributionsFlags->GetXaxis()->SetBinLabel(9,"<8>_{max}"); | |
6274 | fDistributionsList->Add(fDistributionsFlags); | |
6275 | ||
6276 | // b) Book all histograms to hold distributions of correlations. | |
6277 | if(fStoreDistributions) | |
6278 | { | |
6279 | TString distributionsName = "fDistributions"; | |
6280 | distributionsName += fAnalysisLabel->Data(); | |
6281 | for(Int_t di=0;di<4;di++) // distribution index | |
6282 | { | |
6283 | fDistributions[di] = new TH1D(Form("Distribution of %s",correlationIndex[di].Data()),Form("Distribution of %s",correlationIndex[di].Data()),10000,fMinValueOfCorrelation[di],fMaxValueOfCorrelation[di]); | |
6284 | fDistributions[di]->SetXTitle(correlationIndex[di].Data()); | |
6285 | fDistributionsList->Add(fDistributions[di]); | |
6286 | } // end of for(Int_t di=0;di<4;di++) // distribution index | |
6287 | } // end of if(fStoreDistributions) | |
6288 | ||
6289 | } // end of void AliFlowAnalysisWithQCumulants::BookEverythingForDistributions() | |
6290 | ||
489d5531 | 6291 | //================================================================================================================================ |
6292 | ||
e5834fcb | 6293 | void AliFlowAnalysisWithQCumulants::BookEverythingForVarious() |
6294 | { | |
6295 | // Book all objects for various unclassified quantities. | |
6296 | ||
6297 | if(!fStorePhiDistributionForOneEvent){return;} | |
6298 | ||
6299 | // a) Book histogram holding phi distribution for single event to illustrate flow. | |
6300 | ||
6301 | // a) Book histogram holding phi distribution for single event to illustrate flow: | |
6302 | fPhiDistributionForOneEvent = new TH1D("fPhiDistributionForOneEvent","",360,0.,TMath::TwoPi()); | |
6303 | fPhiDistributionForOneEvent->GetXaxis()->SetTitle("#phi"); | |
6304 | fVariousList->Add(fPhiDistributionForOneEvent); | |
6305 | ||
6306 | } // end of void AliFlowAnalysisWithQCumulants::BookEverythingForVarious() | |
6307 | ||
6308 | //================================================================================================================================ | |
489d5531 | 6309 | |
6310 | void AliFlowAnalysisWithQCumulants::StoreFlagsForDistributions() | |
6311 | { | |
6312 | // Store all flags for distributiuons of correlations in profile fDistributionsFlags. | |
6313 | ||
6314 | if(!fDistributionsFlags) | |
6315 | { | |
6316 | cout<<"WARNING: fDistributionsFlags is NULL in AFAWQC::SDF() !!!!"<<endl; | |
6317 | exit(0); | |
6318 | } | |
6319 | ||
6320 | fDistributionsFlags->Fill(0.5,(Int_t)fStoreDistributions); // histos with distributions of correlations stored or not in the output file | |
6321 | // store min and max values of correlations: | |
6322 | for(Int_t di=0;di<4;di++) // distribution index | |
6323 | { | |
6324 | fDistributionsFlags->Fill(1.5+2.*(Double_t)di,fMinValueOfCorrelation[di]); | |
6325 | fDistributionsFlags->Fill(2.5+2.*(Double_t)di,fMaxValueOfCorrelation[di]); | |
6326 | } | |
6327 | ||
6328 | } // end of void AliFlowAnalysisWithQCumulants::StoreFlagsForDistributions() | |
6329 | ||
489d5531 | 6330 | //================================================================================================================================ |
6331 | ||
489d5531 | 6332 | void AliFlowAnalysisWithQCumulants::StoreDistributionsOfCorrelations() |
6333 | { | |
6334 | // Store distributions of correlations. | |
6335 | ||
6336 | if(!(fIntFlowCorrelationsEBE && fIntFlowEventWeightsForCorrelationsEBE)) | |
6337 | { | |
6338 | cout<<"WARNING: fIntFlowCorrelationsEBE && fIntFlowEventWeightsForCorrelationsEBE"<<endl; | |
6339 | cout<<" is NULL in AFAWQC::SDOC() !!!!"<<endl; | |
6340 | exit(0); | |
6341 | } | |
6342 | ||
6343 | for(Int_t di=0;di<4;di++) // distribution index | |
6344 | { | |
6345 | if(!fDistributions[di]) | |
6346 | { | |
6347 | cout<<"WARNING: fDistributions[di] is NULL in AFAWQC::SDOC() !!!!"<<endl; | |
6348 | cout<<"di = "<<di<<endl; | |
6349 | exit(0); | |
6350 | } else | |
6351 | { | |
6352 | fDistributions[di]->Fill(fIntFlowCorrelationsEBE->GetBinContent(di+1),fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(di+1)); | |
6353 | } | |
6354 | } // end of for(Int_t di=0;di<4;di++) // distribution index | |
6355 | ||
6356 | } // end of void AliFlowAnalysisWithQCumulants::StoreDistributionsOfCorrelations() | |
6357 | ||
489d5531 | 6358 | //================================================================================================================================ |
6359 | ||
489d5531 | 6360 | void AliFlowAnalysisWithQCumulants::BookAndNestAllLists() |
6361 | { | |
6362 | // Book and nest all lists nested in the base list fHistList. | |
6363 | // a) Book and nest lists for integrated flow; | |
6364 | // b) Book and nest lists for differential flow; | |
6365 | // c) Book and nest list for particle weights; | |
6366 | // d) Book and nest list for distributions; | |
e5834fcb | 6367 | // e) Book and nest list for various unclassified objects; |
6368 | // f) Book and nest list for nested loops. | |
489d5531 | 6369 | |
6370 | // a) Book and nest all lists for integrated flow: | |
1268c371 | 6371 | // Base list for integrated flow: |
489d5531 | 6372 | fIntFlowList = new TList(); |
6373 | fIntFlowList->SetName("Integrated Flow"); | |
6374 | fIntFlowList->SetOwner(kTRUE); | |
6375 | fHistList->Add(fIntFlowList); | |
1268c371 | 6376 | // List holding profiles: |
489d5531 | 6377 | fIntFlowProfiles = new TList(); |
6378 | fIntFlowProfiles->SetName("Profiles"); | |
6379 | fIntFlowProfiles->SetOwner(kTRUE); | |
6380 | fIntFlowList->Add(fIntFlowProfiles); | |
3435cacb | 6381 | // List holding all profiles with results for correlations vs M: |
6382 | if(fCalculateAllCorrelationsVsM) | |
6383 | { | |
6384 | fIntFlowAllCorrelationsVsM = new TList(); | |
6385 | fIntFlowAllCorrelationsVsM->SetName("Correlations vs M"); | |
6386 | fIntFlowAllCorrelationsVsM->SetOwner(kTRUE); | |
6387 | fIntFlowProfiles->Add(fIntFlowAllCorrelationsVsM); | |
6388 | } // end of if(fCalculateAllCorrelationsVsM) | |
1268c371 | 6389 | // List holding histograms with results: |
489d5531 | 6390 | fIntFlowResults = new TList(); |
6391 | fIntFlowResults->SetName("Results"); | |
6392 | fIntFlowResults->SetOwner(kTRUE); | |
6393 | fIntFlowList->Add(fIntFlowResults); | |
6394 | ||
1268c371 | 6395 | // b) Book and nest lists for differential flow: |
6396 | this->BookAndNestListsForDifferentialFlow(); | |
6397 | ||
6398 | // c) Book and nest list for particle weights: | |
6399 | fWeightsList->SetName("Weights"); | |
6400 | fWeightsList->SetOwner(kTRUE); | |
6401 | fHistList->Add(fWeightsList); | |
6402 | ||
6403 | // d) Book and nest list for distributions: | |
6404 | fDistributionsList = new TList(); | |
6405 | fDistributionsList->SetName("Distributions"); | |
6406 | fDistributionsList->SetOwner(kTRUE); | |
6407 | fHistList->Add(fDistributionsList); | |
6408 | ||
6409 | // e) Book and nest list for various unclassified objects: | |
6410 | if(fStorePhiDistributionForOneEvent) | |
6411 | { | |
6412 | fVariousList = new TList(); | |
6413 | fVariousList->SetName("Various"); | |
6414 | fVariousList->SetOwner(kTRUE); | |
6415 | fHistList->Add(fVariousList); | |
6416 | } | |
6417 | ||
64e500e3 | 6418 | // f) Book and nest list for other differential correlators: |
6419 | fOtherDiffCorrelatorsList = new TList(); | |
6420 | fOtherDiffCorrelatorsList->SetName("Other differential correlators"); | |
6421 | fOtherDiffCorrelatorsList->SetOwner(kTRUE); | |
62e36168 | 6422 | if(fCalculateDiffFlow){fHistList->Add(fOtherDiffCorrelatorsList);} // TBI: Use another flag here instead of fCalculateDiffFlow |
64e500e3 | 6423 | |
6424 | // g) Book and nest list for nested loops: | |
1268c371 | 6425 | fNestedLoopsList = new TList(); |
6426 | fNestedLoopsList->SetName("Nested Loops"); | |
6427 | fNestedLoopsList->SetOwner(kTRUE); | |
6428 | fHistList->Add(fNestedLoopsList); | |
6429 | ||
6430 | } // end of void AliFlowAnalysisWithQCumulants::BookAndNestAllLists() | |
6431 | ||
6432 | //================================================================================================================================ | |
6433 | ||
6434 | void AliFlowAnalysisWithQCumulants::BookAndNestListsForDifferentialFlow() | |
6435 | { | |
6436 | // Book and nest lists for differential flow. | |
6437 | ||
6438 | // Base list for differential flow objects: | |
489d5531 | 6439 | fDiffFlowList = new TList(); |
6440 | fDiffFlowList->SetName("Differential Flow"); | |
6441 | fDiffFlowList->SetOwner(kTRUE); | |
6442 | fHistList->Add(fDiffFlowList); | |
1268c371 | 6443 | |
6444 | // Local flags: | |
6445 | TString typeFlag[2] = {"RP","POI"}; | |
6446 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
6447 | TString powerFlag[2] = {"linear","quadratic"}; | |
6448 | ||
6449 | // 2D: | |
6450 | if(fCalculate2DDiffFlow) | |
6451 | { | |
6452 | fDiffFlow2D = new TList(); | |
6453 | fDiffFlow2D->SetName("2D"); | |
6454 | fDiffFlow2D->SetOwner(kTRUE); | |
6455 | fDiffFlowList->Add(fDiffFlow2D); | |
6456 | for(Int_t t=0;t<2;t++) | |
6457 | { | |
6458 | f2DDiffFlowCorrelationsProList[t] = new TList(); | |
6459 | f2DDiffFlowCorrelationsProList[t]->SetOwner(kTRUE); | |
6460 | f2DDiffFlowCorrelationsProList[t]->SetName(Form("Profiles with 2D correlations (%s)",typeFlag[t].Data())); | |
6461 | fDiffFlow2D->Add(f2DDiffFlowCorrelationsProList[t]); | |
6462 | } // end of for(Int_t t=0;t<2;t++) | |
6463 | } // end of if(fCalculate2DDiffFlow) | |
6464 | ||
6465 | // What follows bellow in this method is relevant only for 1D differential flow: | |
6466 | if(!fCalculateDiffFlow){return;} | |
6467 | ||
6468 | // List holding profiles: | |
489d5531 | 6469 | fDiffFlowProfiles = new TList(); |
6470 | fDiffFlowProfiles->SetName("Profiles"); | |
6471 | fDiffFlowProfiles->SetOwner(kTRUE); | |
6472 | fDiffFlowList->Add(fDiffFlowProfiles); | |
1268c371 | 6473 | // List holding histograms with results: |
489d5531 | 6474 | fDiffFlowResults = new TList(); |
6475 | fDiffFlowResults->SetName("Results"); | |
6476 | fDiffFlowResults->SetOwner(kTRUE); | |
6477 | fDiffFlowList->Add(fDiffFlowResults); | |
1268c371 | 6478 | // Flags used for naming nested lists in list fDiffFlowProfiles and fDiffFlowResults: |
489d5531 | 6479 | TList list; |
6480 | list.SetOwner(kTRUE); | |
1268c371 | 6481 | // Nested lists in fDiffFlowProfiles (~/Differential Flow/Profiles): |
489d5531 | 6482 | for(Int_t t=0;t<2;t++) // type: RP or POI |
6483 | { | |
62e36168 | 6484 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 6485 | { |
6486 | // list holding profiles with correlations: | |
6487 | fDiffFlowCorrelationsProList[t][pe] = (TList*)list.Clone(); | |
6488 | fDiffFlowCorrelationsProList[t][pe]->SetName(Form("Profiles with correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6489 | fDiffFlowProfiles->Add(fDiffFlowCorrelationsProList[t][pe]); | |
6490 | // list holding profiles with products of correlations: | |
6491 | fDiffFlowProductOfCorrelationsProList[t][pe] = (TList*)list.Clone(); | |
6492 | fDiffFlowProductOfCorrelationsProList[t][pe]->SetName(Form("Profiles with products of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6493 | fDiffFlowProfiles->Add(fDiffFlowProductOfCorrelationsProList[t][pe]); | |
6494 | // list holding profiles with corrections: | |
6495 | fDiffFlowCorrectionsProList[t][pe] = (TList*)list.Clone(); | |
6496 | fDiffFlowCorrectionsProList[t][pe]->SetName(Form("Profiles with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6497 | fDiffFlowProfiles->Add(fDiffFlowCorrectionsProList[t][pe]); | |
6498 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
6499 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
6500 | // nested lists in fDiffFlowResults (~/Differential Flow/Results): | |
6501 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
6502 | { | |
62e36168 | 6503 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 6504 | { |
6505 | // list holding histograms with correlations: | |
6506 | fDiffFlowCorrelationsHistList[t][pe] = (TList*)list.Clone(); | |
6507 | fDiffFlowCorrelationsHistList[t][pe]->SetName(Form("Correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6508 | fDiffFlowResults->Add(fDiffFlowCorrelationsHistList[t][pe]); | |
6509 | // list holding histograms with corrections: | |
6510 | fDiffFlowCorrectionsHistList[t][pe] = (TList*)list.Clone(); | |
6511 | fDiffFlowCorrectionsHistList[t][pe]->SetName(Form("Histograms with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6512 | fDiffFlowResults->Add(fDiffFlowCorrectionsHistList[t][pe]); | |
6513 | for(Int_t power=0;power<2;power++) | |
6514 | { | |
6515 | // list holding histograms with sums of event weights: | |
6516 | fDiffFlowSumOfEventWeightsHistList[t][pe][power] = (TList*)list.Clone(); | |
6517 | fDiffFlowSumOfEventWeightsHistList[t][pe][power]->SetName(Form("Sum of %s event weights (%s, %s)",powerFlag[power].Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6518 | fDiffFlowResults->Add(fDiffFlowSumOfEventWeightsHistList[t][pe][power]); | |
6519 | } // end of for(Int_t power=0;power<2;power++) | |
6520 | // list holding histograms with sums of products of event weights: | |
6521 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe] = (TList*)list.Clone(); | |
6522 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]->SetName(Form("Sum of products of event weights (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6523 | fDiffFlowResults->Add(fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]); | |
6524 | // list holding histograms with covariances of correlations: | |
6525 | fDiffFlowCovariancesHistList[t][pe] = (TList*)list.Clone(); | |
6526 | fDiffFlowCovariancesHistList[t][pe]->SetName(Form("Covariances of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6527 | fDiffFlowResults->Add(fDiffFlowCovariancesHistList[t][pe]); | |
6528 | // list holding histograms with differential Q-cumulants: | |
6529 | fDiffFlowCumulantsHistList[t][pe] = (TList*)list.Clone(); | |
6530 | fDiffFlowCumulantsHistList[t][pe]->SetName(Form("Differential Q-cumulants (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6531 | fDiffFlowResults->Add(fDiffFlowCumulantsHistList[t][pe]); | |
1268c371 | 6532 | // list holding histograms which quantify detector bias to differential Q-cumulants: |
6533 | fDiffFlowDetectorBiasHistList[t][pe] = (TList*)list.Clone(); | |
6534 | fDiffFlowDetectorBiasHistList[t][pe]->SetName(Form("Detector bias (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6535 | fDiffFlowResults->Add(fDiffFlowDetectorBiasHistList[t][pe]); | |
489d5531 | 6536 | // list holding histograms with differential flow estimates from Q-cumulants: |
6537 | fDiffFlowHistList[t][pe] = (TList*)list.Clone(); | |
6538 | fDiffFlowHistList[t][pe]->SetName(Form("Differential flow (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data())); | |
6539 | fDiffFlowResults->Add(fDiffFlowHistList[t][pe]); | |
6540 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
6541 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
6542 | ||
1268c371 | 6543 | } // end of void AliFlowAnalysisWithQCumulants::BookAndNestListsForDifferentialFlow() |
489d5531 | 6544 | |
6545 | //================================================================================================================================ | |
6546 | ||
489d5531 | 6547 | void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type) |
6548 | { | |
1268c371 | 6549 | // Fill common result histograms for differential flow. |
489d5531 | 6550 | |
1268c371 | 6551 | Int_t t = 0; |
489d5531 | 6552 | |
6553 | if(type == "RP") | |
6554 | { | |
1268c371 | 6555 | t = 0; |
489d5531 | 6556 | } else if(type == "POI") |
6557 | { | |
1268c371 | 6558 | t = 1; |
489d5531 | 6559 | } |
1268c371 | 6560 | |
6561 | // to be improved - check all pointers used in this method | |
489d5531 | 6562 | |
6563 | if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th)) | |
6564 | { | |
6565 | cout<<"WARNING: fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th"<<endl; | |
6566 | cout<<" is NULL in AFAWQC::FCHRIF() !!!!"<<endl; | |
6567 | exit(0); | |
6568 | } | |
6569 | ||
6570 | // pt: | |
6571 | for(Int_t p=1;p<=fnBinsPt;p++) | |
6572 | { | |
6573 | Double_t v2 = fDiffFlow[t][0][0]->GetBinContent(p); | |
6574 | Double_t v4 = fDiffFlow[t][0][1]->GetBinContent(p); | |
6575 | Double_t v6 = fDiffFlow[t][0][2]->GetBinContent(p); | |
6576 | Double_t v8 = fDiffFlow[t][0][3]->GetBinContent(p); | |
6577 | ||
6578 | Double_t v2Error = fDiffFlow[t][0][0]->GetBinError(p); | |
6579 | Double_t v4Error = fDiffFlow[t][0][1]->GetBinError(p); | |
6580 | //Double_t v6Error = fFinalFlow1D[t][pW][nua][0][2]->GetBinError(p); | |
6581 | //Double_t v8Error = fFinalFlow1D[t][pW][nua][0][3]->GetBinError(p); | |
6582 | ||
6583 | if(type == "RP") | |
6584 | { | |
6585 | fCommonHistsResults2nd->FillDifferentialFlowPtRP(p,v2,v2Error); | |
6586 | fCommonHistsResults4th->FillDifferentialFlowPtRP(p,v4,v4Error); | |
6587 | fCommonHistsResults6th->FillDifferentialFlowPtRP(p,v6,0.); | |
6588 | fCommonHistsResults8th->FillDifferentialFlowPtRP(p,v8,0.); | |
6589 | } else if(type == "POI") | |
6590 | { | |
6591 | fCommonHistsResults2nd->FillDifferentialFlowPtPOI(p,v2,v2Error); | |
6592 | fCommonHistsResults4th->FillDifferentialFlowPtPOI(p,v4,v4Error); | |
6593 | fCommonHistsResults6th->FillDifferentialFlowPtPOI(p,v6,0.); | |
6594 | fCommonHistsResults8th->FillDifferentialFlowPtPOI(p,v8,0.); | |
6595 | } | |
6596 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
6597 | ||
6598 | // eta: | |
62e36168 | 6599 | if(!fCalculateDiffFlowVsEta){return;} |
489d5531 | 6600 | for(Int_t e=1;e<=fnBinsEta;e++) |
6601 | { | |
6602 | Double_t v2 = fDiffFlow[t][1][0]->GetBinContent(e); | |
6603 | Double_t v4 = fDiffFlow[t][1][1]->GetBinContent(e); | |
6604 | Double_t v6 = fDiffFlow[t][1][2]->GetBinContent(e); | |
6605 | Double_t v8 = fDiffFlow[t][1][3]->GetBinContent(e); | |
6606 | ||
6607 | Double_t v2Error = fDiffFlow[t][1][0]->GetBinError(e); | |
6608 | Double_t v4Error = fDiffFlow[t][1][1]->GetBinError(e); | |
6609 | //Double_t v6Error = fDiffFlow[t][1][2]->GetBinError(e); | |
6610 | //Double_t v8Error = fDiffFlow[t][1][3]->GetBinError(e); | |
6611 | ||
6612 | if(type == "RP") | |
6613 | { | |
6614 | fCommonHistsResults2nd->FillDifferentialFlowEtaRP(e,v2,v2Error); | |
6615 | fCommonHistsResults4th->FillDifferentialFlowEtaRP(e,v4,v4Error); | |
6616 | fCommonHistsResults6th->FillDifferentialFlowEtaRP(e,v6,0.); | |
6617 | fCommonHistsResults8th->FillDifferentialFlowEtaRP(e,v8,0.); | |
6618 | } else if(type == "POI") | |
6619 | { | |
6620 | fCommonHistsResults2nd->FillDifferentialFlowEtaPOI(e,v2,v2Error); | |
6621 | fCommonHistsResults4th->FillDifferentialFlowEtaPOI(e,v4,v4Error); | |
6622 | fCommonHistsResults6th->FillDifferentialFlowEtaPOI(e,v6,0.); | |
6623 | fCommonHistsResults8th->FillDifferentialFlowEtaPOI(e,v8,0.); | |
6624 | } | |
6625 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
6626 | ||
6627 | } // end of void AliFlowAnalysisWithQCumulants::FillCommonHistResultsDiffFlow(TString type, Bool_t useParticleWeights, TString eventWeights, Bool_t correctedForNUA) | |
6628 | ||
489d5531 | 6629 | //================================================================================================================================ |
6630 | ||
1268c371 | 6631 | void AliFlowAnalysisWithQCumulants::CommonConstants(TString method) |
489d5531 | 6632 | { |
1268c371 | 6633 | // Access and store common constants. |
6634 | ||
6635 | // a) If this method was called in Init() access common constants from AliFlowCommonConstants; | |
6636 | // b) If this method was called in Init() book and fill TProfile to hold constants accessed in a); | |
6637 | // c) If this method was called in Finish() access common constants from TProfile booked and filled in b). | |
6638 | ||
6639 | if(method == "Init") | |
6640 | { | |
6641 | // a) If this method was called in Init() access common constants from AliFlowCommonConstants: | |
6642 | fnBinsPhi = AliFlowCommonConstants::GetMaster()->GetNbinsPhi(); | |
6643 | fPhiMin = AliFlowCommonConstants::GetMaster()->GetPhiMin(); | |
6644 | fPhiMax = AliFlowCommonConstants::GetMaster()->GetPhiMax(); | |
6645 | if(fnBinsPhi){fPhiBinWidth = (fPhiMax-fPhiMin)/fnBinsPhi;} | |
6646 | fnBinsPt = AliFlowCommonConstants::GetMaster()->GetNbinsPt(); | |
6647 | fPtMin = AliFlowCommonConstants::GetMaster()->GetPtMin(); | |
6648 | fPtMax = AliFlowCommonConstants::GetMaster()->GetPtMax(); | |
6649 | if(fnBinsPt){fPtBinWidth = (fPtMax-fPtMin)/fnBinsPt;} | |
6650 | fnBinsEta = AliFlowCommonConstants::GetMaster()->GetNbinsEta(); | |
6651 | fEtaMin = AliFlowCommonConstants::GetMaster()->GetEtaMin(); | |
6652 | fEtaMax = AliFlowCommonConstants::GetMaster()->GetEtaMax(); | |
6653 | if(fnBinsEta){fEtaBinWidth = (fEtaMax-fEtaMin)/fnBinsEta;} | |
6654 | ||
6655 | // b) If this method was called in Init() book and fill TProfile to hold constants accessed in a): | |
6656 | TString fCommonConstantsName = "fCommonConstants"; | |
6657 | fCommonConstantsName += fAnalysisLabel->Data(); | |
6658 | fCommonConstants = new TProfile(fCommonConstantsName.Data(),"Common constants",9,0.,9.); | |
6659 | fCommonConstants->SetLabelSize(0.05); | |
6660 | fCommonConstants->GetXaxis()->SetBinLabel(1,"nBins (#phi)"); | |
6661 | fCommonConstants->Fill(0.5,fnBinsPhi); | |
6662 | fCommonConstants->GetXaxis()->SetBinLabel(2,"#phi_{min}"); | |
6663 | fCommonConstants->Fill(1.5,fPhiMin); | |
6664 | fCommonConstants->GetXaxis()->SetBinLabel(3,"#phi_{max}"); | |
6665 | fCommonConstants->Fill(2.5,fPhiMax); | |
6666 | fCommonConstants->GetXaxis()->SetBinLabel(4,"nBins (p_{t})"); | |
6667 | fCommonConstants->Fill(3.5,fnBinsPt); | |
6668 | fCommonConstants->GetXaxis()->SetBinLabel(5,"(p_{t})_{min}"); | |
6669 | fCommonConstants->Fill(4.5,fPtMin); | |
6670 | fCommonConstants->GetXaxis()->SetBinLabel(6,"(p_{t})_{max}"); | |
6671 | fCommonConstants->Fill(5.5,fPtMax); | |
6672 | fCommonConstants->GetXaxis()->SetBinLabel(7,"nBins (#eta)"); | |
6673 | fCommonConstants->Fill(6.5,fnBinsEta); | |
6674 | fCommonConstants->GetXaxis()->SetBinLabel(8,"#eta_{min}"); | |
6675 | fCommonConstants->Fill(7.5,fEtaMin); | |
6676 | fCommonConstants->GetXaxis()->SetBinLabel(9,"#eta_{max}"); | |
6677 | fCommonConstants->Fill(8.5,fEtaMax); | |
6678 | fHistList->Add(fCommonConstants); | |
6679 | } // end of if(method == "Init") | |
6680 | else if(method == "Finish") | |
6681 | { | |
6682 | // c) If this method was called in Finish() access common constants from TProfile booked and filled in b): | |
6683 | if(!fCommonConstants) | |
6684 | { | |
6685 | printf("\n WARNING (QC): fCommonConstants is NULL in AFAWQC::AC(\"%s\") !!!!\n\n",method.Data()); | |
6686 | exit(0); | |
6687 | } | |
6688 | fnBinsPhi = (Int_t)fCommonConstants->GetBinContent(1); | |
6689 | fPhiMin = fCommonConstants->GetBinContent(2); | |
6690 | fPhiMax = fCommonConstants->GetBinContent(3); | |
6691 | if(fnBinsPhi){fPhiBinWidth = (fPhiMax-fPhiMin)/fnBinsPhi;} | |
6692 | fnBinsPt = (Int_t)fCommonConstants->GetBinContent(4); | |
6693 | fPtMin = fCommonConstants->GetBinContent(5); | |
6694 | fPtMax = fCommonConstants->GetBinContent(6); | |
6695 | if(fnBinsPt){fPtBinWidth = (fPtMax-fPtMin)/fnBinsPt;} | |
6696 | fnBinsEta = (Int_t)fCommonConstants->GetBinContent(7); | |
6697 | fEtaMin = fCommonConstants->GetBinContent(8); | |
6698 | fEtaMax = fCommonConstants->GetBinContent(9); | |
6699 | if(fnBinsEta){fEtaBinWidth = (fEtaMax-fEtaMin)/fnBinsEta;} | |
6700 | } // end of else if(method == "Finish") | |
6701 | ||
6702 | } // end of void AliFlowAnalysisWithQCumulants::CommonConstants(TString method) | |
489d5531 | 6703 | |
489d5531 | 6704 | //================================================================================================================================ |
6705 | ||
489d5531 | 6706 | void AliFlowAnalysisWithQCumulants::CrossCheckSettings() |
6707 | { | |
1268c371 | 6708 | // a) Cross check if the choice for multiplicity weights make sense. |
489d5531 | 6709 | |
6710 | // a) Cross check if the choice for multiplicity weights make sense: | |
6711 | if(strcmp(fMultiplicityWeight->Data(),"combinations") && | |
6712 | strcmp(fMultiplicityWeight->Data(),"unit") && | |
6713 | strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
6714 | { | |
6715 | cout<<"WARNING (QC): Multiplicity weight can be either \"combinations\", \"unit\""<<endl; | |
6716 | cout<<" or \"multiplicity\". Certainly not \""<<fMultiplicityWeight->Data()<<"\"."<<endl; | |
6717 | exit(0); | |
6718 | } | |
6719 | ||
6720 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckSettings() | |
6721 | ||
489d5531 | 6722 | //================================================================================================================================ |
6723 | ||
489d5531 | 6724 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeights() |
6725 | { | |
0328db2d | 6726 | // Calculate sum of linear and quadratic event weights for correlations. |
2001bc3a | 6727 | |
6728 | // multiplicity: | |
1268c371 | 6729 | Double_t dMult = (*fSpk)(0,0); |
9f33751d | 6730 | |
489d5531 | 6731 | for(Int_t p=0;p<2;p++) // power-1 |
6732 | { | |
6733 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
6734 | { | |
6735 | fIntFlowSumOfEventWeights[p]->Fill(ci+0.5,pow(fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci+1),p+1)); | |
b3dacf6b | 6736 | if(fCalculateCumulantsVsM) |
6737 | { | |
6738 | fIntFlowSumOfEventWeightsVsM[ci][p]->Fill(dMult+0.5,pow(fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci+1),p+1)); // to be improved: dMult => sum of weights? | |
6739 | } | |
489d5531 | 6740 | } |
6741 | } | |
6742 | ||
6743 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeights() | |
6744 | ||
489d5531 | 6745 | //================================================================================================================================ |
6746 | ||
0328db2d | 6747 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeightsNUA() |
489d5531 | 6748 | { |
0328db2d | 6749 | // Calculate sum of linear and quadratic event weights for NUA terms. |
6750 | ||
6751 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
489d5531 | 6752 | { |
0328db2d | 6753 | for(Int_t p=0;p<2;p++) // power-1 |
6754 | { | |
b92ea2b9 | 6755 | for(Int_t ci=0;ci<4;ci++) // nua term index |
0328db2d | 6756 | { |
6757 | fIntFlowSumOfEventWeightsNUA[sc][p]->Fill(ci+0.5,pow(fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc]->GetBinContent(ci+1),p+1)); | |
489d5531 | 6758 | } |
0328db2d | 6759 | } |
6760 | } | |
6761 | ||
6762 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfEventWeightsNUA() | |
489d5531 | 6763 | |
0328db2d | 6764 | //================================================================================================================================ |
6765 | ||
0328db2d | 6766 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeights() |
6767 | { | |
ff70ca91 | 6768 | // Calculate sum of product of event weights for correlations. |
2001bc3a | 6769 | |
6770 | // multiplicity: | |
1268c371 | 6771 | Double_t dMult = (*fSpk)(0,0); |
2001bc3a | 6772 | |
489d5531 | 6773 | Int_t counter = 0; |
6774 | ||
6775 | for(Int_t ci1=1;ci1<4;ci1++) | |
6776 | { | |
6777 | for(Int_t ci2=ci1+1;ci2<=4;ci2++) | |
6778 | { | |
ff70ca91 | 6779 | fIntFlowSumOfProductOfEventWeights->Fill(0.5+counter, |
6780 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
b3dacf6b | 6781 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); |
6782 | if(fCalculateCumulantsVsM) | |
6783 | { | |
6784 | fIntFlowSumOfProductOfEventWeightsVsM[counter]->Fill(dMult+0.5, // to be improved: dMult => sum of weights? | |
6785 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci1)* | |
6786 | fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(ci2)); | |
6787 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 6788 | counter++; |
489d5531 | 6789 | } |
6790 | } | |
6791 | ||
0328db2d | 6792 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeights() |
6793 | ||
0328db2d | 6794 | //================================================================================================================================ |
6795 | ||
0328db2d | 6796 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowSumOfProductOfEventWeightsNUA() |
6797 | { | |
6798 | // Calculate sum of product of event weights for NUA terms. | |
6799 | ||
6800 | // w_{<2>} * w_{<cos(#phi)>}: | |
6801 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(0.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6802 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
6803 | // w_{<2>} * w_{<sin(#phi)>}: | |
6804 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(1.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6805 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
6806 | // w_{<cos(#phi)> * w_{<sin(#phi)>}: | |
6807 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(2.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6808 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
6809 | // w_{<2>} * w{<cos(phi1+phi2)>} | |
6810 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(3.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6811 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6812 | // w_{<2>} * w{<sin(phi1+phi2)>} | |
6813 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(4.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6814 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6815 | // w_{<2>} * w{<cos(phi1-phi2-phi3)>} | |
6816 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(5.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6817 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6818 | // w_{<2>} * w{<sin(phi1-phi2-phi3)>} | |
6819 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(6.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1)* | |
6820 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6821 | // w_{<4>} * w{<cos(phi1)>} | |
6822 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(7.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6823 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)); | |
6824 | // w_{<4>} * w{<sin(phi1)>} | |
6825 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(8.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6826 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)); | |
6827 | // w_{<4>} * w{<cos(phi1+phi2)>} | |
6828 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(9.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6829 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6830 | // w_{<4>} * w{<sin(phi1+phi2)>} | |
6831 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(10.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6832 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6833 | // w_{<4>} * w{<cos(phi1-phi2-phi3)>} | |
6834 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(11.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6835 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6836 | // w_{<4>} * w{<sin(phi1-phi2-phi3)>} | |
6837 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(12.5,fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2)* | |
6838 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6839 | // w_{<cos(phi1)>} * w{<cos(phi1+phi2)>} | |
6840 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(13.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6841 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6842 | // w_{<cos(phi1)>} * w{<sin(phi1+phi2)>} | |
6843 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(14.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6844 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6845 | // w_{<cos(phi1)>} * w{<cos(phi1-phi2-phi3)>} | |
6846 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(15.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6847 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6848 | // w_{<cos(phi1)>} * w{<sin(phi1-phi2-phi3)>} | |
6849 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(16.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(1)* | |
6850 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6851 | // w_{<sin(phi1)>} * w{<cos(phi1+phi2)>} | |
6852 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(17.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6853 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)); | |
6854 | // w_{<sin(phi1)>} * w{<sin(phi1+phi2)>} | |
6855 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(18.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6856 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6857 | // w_{<sin(phi1)>} * w{<cos(phi1-phi2-phi3)>} | |
6858 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(19.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6859 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6860 | // w_{<sin(phi1)>} * w{<sin(phi1-phi2-phi3)>} | |
6861 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(20.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(1)* | |
6862 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6863 | // w_{<cos(phi1+phi2)>} * w{<sin(phi1+phi2))>} | |
6864 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(21.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)* | |
6865 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)); | |
6866 | // w_{<cos(phi1+phi2)>} * w{<cos(phi1-phi2-phi3)>} | |
6867 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(22.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)* | |
6868 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6869 | // w_{<cos(phi1+phi2)>} * w{<sin(phi1-phi2-phi3)>} | |
6870 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(23.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(2)* | |
6871 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6872 | // w_{<sin(phi1+phi2)>} * w{<cos(phi1-phi2-phi3)>} | |
6873 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(24.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)* | |
6874 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)); | |
6875 | // w_{<sin(phi1+phi2)>} * w{<sin(phi1-phi2-phi3)>} | |
6876 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(25.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(2)* | |
6877 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6878 | // w_{<cos(phi1-phi2-phi3)>} * w{<sin(phi1-phi2-phi3)>} | |
6879 | fIntFlowSumOfProductOfEventWeightsNUA->Fill(26.5,fIntFlowEventWeightForCorrectionTermsForNUAEBE[1]->GetBinContent(3)* | |
6880 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[0]->GetBinContent(3)); | |
6881 | ||
6882 | } // end of void AliFlowAnalysisWithQCumulants::CalculateIntFlowIntFlowSumOfProductOfEventWeightsNUA() | |
489d5531 | 6883 | |
489d5531 | 6884 | //================================================================================================================================ |
6885 | ||
489d5531 | 6886 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelations(TString type, TString ptOrEta) |
6887 | { | |
1268c371 | 6888 | // Calculate reduced correlations for RPs or POIs for all pt and eta bins. |
489d5531 | 6889 | |
1268c371 | 6890 | // Multiplicity: |
6891 | Double_t dMult = (*fSpk)(0,0); | |
489d5531 | 6892 | |
6893 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
6894 | Double_t dReQ1n = (*fReQ)(0,0); | |
6895 | Double_t dReQ2n = (*fReQ)(1,0); | |
6896 | //Double_t dReQ3n = (*fReQ)(2,0); | |
6897 | //Double_t dReQ4n = (*fReQ)(3,0); | |
6898 | Double_t dImQ1n = (*fImQ)(0,0); | |
6899 | Double_t dImQ2n = (*fImQ)(1,0); | |
6900 | //Double_t dImQ3n = (*fImQ)(2,0); | |
6901 | //Double_t dImQ4n = (*fImQ)(3,0); | |
6902 | ||
6903 | // reduced correlations are stored in fDiffFlowCorrelationsPro[0=RP,1=POI][0=pt,1=eta][correlation index]. Correlation index runs as follows: | |
6904 | // | |
6905 | // 0: <<2'>> | |
6906 | // 1: <<4'>> | |
6907 | // 2: <<6'>> | |
6908 | // 3: <<8'>> | |
6909 | ||
ea239361 | 6910 | //Int_t t = 0; // type flag |
2a98ceb8 | 6911 | Int_t pe = 0; // ptEta flag |
489d5531 | 6912 | |
6913 | if(type == "RP") | |
6914 | { | |
ea239361 | 6915 | //t = 0; |
489d5531 | 6916 | } else if(type == "POI") |
6917 | { | |
ea239361 | 6918 | //t = 1; |
489d5531 | 6919 | } |
6920 | ||
6921 | if(ptOrEta == "Pt") | |
6922 | { | |
6923 | pe = 0; | |
6924 | } else if(ptOrEta == "Eta") | |
6925 | { | |
6926 | pe = 1; | |
6927 | } | |
6928 | ||
6929 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
6930 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
6931 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
6932 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
6933 | ||
6934 | // looping over all bins and calculating reduced correlations: | |
6935 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
6936 | { | |
6937 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
6938 | Double_t p1n0kRe = 0.; | |
6939 | Double_t p1n0kIm = 0.; | |
6940 | ||
6941 | // number of POIs in particular pt or eta bin: | |
6942 | Double_t mp = 0.; | |
6943 | ||
6944 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
6945 | Double_t q1n0kRe = 0.; | |
6946 | Double_t q1n0kIm = 0.; | |
6947 | Double_t q2n0kRe = 0.; | |
6948 | Double_t q2n0kIm = 0.; | |
6949 | ||
6950 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
6951 | Double_t mq = 0.; | |
6952 | ||
6953 | if(type == "POI") | |
6954 | { | |
6955 | // q_{m*n,0}: | |
6956 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
6957 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
6958 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
6959 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
6960 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
6961 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
6962 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
6963 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
6964 | ||
6965 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
6966 | } | |
6967 | else if(type == "RP") | |
6968 | { | |
6969 | // q_{m*n,0}: | |
6970 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
6971 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
6972 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
6973 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
6974 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
6975 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
6976 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
6977 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
6978 | ||
6979 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
6980 | } | |
6981 | ||
6982 | if(type == "POI") | |
6983 | { | |
6984 | // p_{m*n,0}: | |
6985 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
6986 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
6987 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
6988 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
6989 | ||
6990 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
6991 | ||
ea239361 | 6992 | //t = 1; // typeFlag = RP or POI |
489d5531 | 6993 | } |
6994 | else if(type == "RP") | |
6995 | { | |
6996 | // p_{m*n,0} = q_{m*n,0}: | |
6997 | p1n0kRe = q1n0kRe; | |
6998 | p1n0kIm = q1n0kIm; | |
6999 | ||
7000 | mp = mq; | |
7001 | ||
ea239361 | 7002 | //t = 0; // typeFlag = RP or POI |
489d5531 | 7003 | } |
7004 | ||
1268c371 | 7005 | // 2'-particle correlation for particular pt or eta bin: |
489d5531 | 7006 | Double_t two1n1nPtEta = 0.; |
b40a910e | 7007 | Double_t mWeight2pPrime = 0.; // multiplicity weight for <2'> |
489d5531 | 7008 | if(mp*dMult-mq) |
7009 | { | |
7010 | two1n1nPtEta = (p1n0kRe*dReQ1n+p1n0kIm*dImQ1n-mq) | |
7011 | / (mp*dMult-mq); | |
b40a910e | 7012 | // determine multiplicity weight: |
7013 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
7014 | { | |
7015 | mWeight2pPrime = mp*dMult-mq; | |
7016 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
7017 | { | |
7018 | mWeight2pPrime = 1.; | |
7019 | } | |
489d5531 | 7020 | if(type == "POI") // to be improved (I do not this if) |
7021 | { | |
7022 | // fill profile to get <<2'>> for POIs | |
b40a910e | 7023 | fDiffFlowCorrelationsPro[1][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta,mWeight2pPrime); |
7024 | // fill profile to get <<2'>^2> for POIs | |
7025 | fDiffFlowSquaredCorrelationsPro[1][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta*two1n1nPtEta,mWeight2pPrime); | |
489d5531 | 7026 | // histogram to store <2'> for POIs e-b-e (needed in some other methods): |
7027 | fDiffFlowCorrelationsEBE[1][pe][0]->SetBinContent(b,two1n1nPtEta); | |
b40a910e | 7028 | fDiffFlowEventWeightsForCorrelationsEBE[1][pe][0]->SetBinContent(b,mWeight2pPrime); |
489d5531 | 7029 | } |
7030 | else if(type == "RP") // to be improved (I do not this if) | |
7031 | { | |
7032 | // profile to get <<2'>> for RPs: | |
b40a910e | 7033 | fDiffFlowCorrelationsPro[0][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta,mWeight2pPrime); |
7034 | // profile to get <<2'>^2> for RPs: | |
7035 | fDiffFlowSquaredCorrelationsPro[0][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nPtEta*two1n1nPtEta,mWeight2pPrime); | |
489d5531 | 7036 | // histogram to store <2'> for RPs e-b-e (needed in some other methods): |
7037 | fDiffFlowCorrelationsEBE[0][pe][0]->SetBinContent(b,two1n1nPtEta); | |
b40a910e | 7038 | fDiffFlowEventWeightsForCorrelationsEBE[0][pe][0]->SetBinContent(b,mWeight2pPrime); |
489d5531 | 7039 | } |
7040 | } // end of if(mp*dMult-mq) | |
7041 | ||
7042 | // 4'-particle correlation: | |
7043 | Double_t four1n1n1n1nPtEta = 0.; | |
b40a910e | 7044 | Double_t mWeight4pPrime = 0.; // multiplicity weight for <4'> |
489d5531 | 7045 | if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) |
7046 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression) | |
7047 | { | |
7048 | four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
7049 | - q2n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) | |
7050 | - 2.*q2n0kIm*dReQ1n*dImQ1n | |
7051 | - p1n0kRe*(dReQ1n*dReQ2n+dImQ1n*dImQ2n) | |
7052 | + p1n0kIm*(dImQ1n*dReQ2n-dReQ1n*dImQ2n) | |
7053 | - 2.*dMult*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
7054 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*mq | |
7055 | + 6.*(q1n0kRe*dReQ1n+q1n0kIm*dImQ1n) | |
7056 | + 1.*(q2n0kRe*dReQ2n+q2n0kIm*dImQ2n) | |
7057 | + 2.*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
7058 | + 2.*mq*dMult | |
7059 | - 6.*mq) | |
7060 | / ((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
7061 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
b40a910e | 7062 | // determine multiplicity weight: |
7063 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
7064 | { | |
7065 | mWeight4pPrime = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
7066 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
7067 | { | |
7068 | mWeight4pPrime = 1.; | |
7069 | } | |
489d5531 | 7070 | if(type == "POI") |
7071 | { | |
7072 | // profile to get <<4'>> for POIs: | |
b40a910e | 7073 | fDiffFlowCorrelationsPro[1][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta,mWeight4pPrime); |
7074 | // profile to get <<4'>^2> for POIs: | |
7075 | fDiffFlowSquaredCorrelationsPro[1][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta*four1n1n1n1nPtEta,mWeight4pPrime); | |
489d5531 | 7076 | // histogram to store <4'> for POIs e-b-e (needed in some other methods): |
7077 | fDiffFlowCorrelationsEBE[1][pe][1]->SetBinContent(b,four1n1n1n1nPtEta); | |
b40a910e | 7078 | fDiffFlowEventWeightsForCorrelationsEBE[1][pe][1]->SetBinContent(b,mWeight4pPrime); |
489d5531 | 7079 | } |
7080 | else if(type == "RP") | |
7081 | { | |
7082 | // profile to get <<4'>> for RPs: | |
b40a910e | 7083 | fDiffFlowCorrelationsPro[0][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta,mWeight4pPrime); |
7084 | // profile to get <<4'>^2> for RPs: | |
7085 | fDiffFlowSquaredCorrelationsPro[0][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nPtEta*four1n1n1n1nPtEta,mWeight4pPrime); | |
489d5531 | 7086 | // histogram to store <4'> for RPs e-b-e (needed in some other methods): |
7087 | fDiffFlowCorrelationsEBE[0][pe][1]->SetBinContent(b,four1n1n1n1nPtEta); | |
b40a910e | 7088 | fDiffFlowEventWeightsForCorrelationsEBE[0][pe][1]->SetBinContent(b,mWeight4pPrime); |
489d5531 | 7089 | } |
7090 | } // end of if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
7091 | // +mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
7092 | ||
7093 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7094 | ||
7095 | ||
7096 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelations(TString type, TString ptOrEta); | |
7097 | ||
489d5531 | 7098 | //================================================================================================================================ |
7099 | ||
64e500e3 | 7100 | void AliFlowAnalysisWithQCumulants::CalculateOtherDiffCorrelators(TString type, TString ptOrEta) |
7101 | { | |
7102 | // Calculate other differential correlators for RPs or POIs for all pt and eta bins. | |
7103 | ||
7104 | // Multiplicity: | |
7105 | Double_t dMult = (*fSpk)(0,0); | |
7106 | ||
7107 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
7108 | Double_t dReQ1n = (*fReQ)(0,0); | |
7109 | Double_t dReQ2n = (*fReQ)(1,0); | |
7110 | Double_t dReQ3n = (*fReQ)(2,0); | |
7111 | //Double_t dReQ4n = (*fReQ)(3,0); | |
7112 | Double_t dImQ1n = (*fImQ)(0,0); | |
7113 | Double_t dImQ2n = (*fImQ)(1,0); | |
7114 | Double_t dImQ3n = (*fImQ)(2,0); | |
7115 | //Double_t dImQ4n = (*fImQ)(3,0); | |
7116 | ||
7117 | // Other correlations are stored in fOtherDiffCorrelators[2][2][2][1], [0=RP,1=POI][0=pt,1=eta][0=sin terms,1=cos terms][correlator index] | |
7118 | // Correlation index runs as follows: | |
7119 | // | |
7120 | // 0: <exp[in(psi1-3phi2+2phi3)]> | |
7121 | ||
7122 | Int_t t = 0; // type flag | |
7123 | Int_t pe = 0; // ptEta flag | |
7124 | ||
7125 | if(type == "RP") | |
7126 | { | |
7127 | t = 0; | |
7128 | } else if(type == "POI") | |
7129 | { | |
7130 | t = 1; | |
7131 | } | |
7132 | ||
7133 | if(ptOrEta == "Pt") | |
7134 | { | |
7135 | pe = 0; | |
7136 | } else if(ptOrEta == "Eta") | |
7137 | { | |
7138 | pe = 1; | |
7139 | } | |
7140 | ||
7141 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
7142 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
7143 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
7144 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
7145 | ||
7146 | // looping over all bins and calculating reduced correlations: | |
7147 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7148 | { | |
7149 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
7150 | Double_t p1n0kRe = 0.; | |
7151 | Double_t p1n0kIm = 0.; | |
7152 | ||
7153 | // number of POIs in particular pt or eta bin: | |
7154 | Double_t mp = 0.; | |
7155 | ||
7156 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
7157 | Double_t q1n0kRe = 0.; | |
7158 | Double_t q1n0kIm = 0.; | |
7159 | Double_t q2n0kRe = 0.; | |
7160 | Double_t q2n0kIm = 0.; | |
7161 | Double_t q3n0kRe = 0.; | |
7162 | Double_t q3n0kIm = 0.; | |
7163 | ||
7164 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
7165 | Double_t mq = 0.; | |
7166 | ||
7167 | if(type == "POI") | |
7168 | { | |
7169 | // q_{m*n,0}: | |
7170 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
7171 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
7172 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
7173 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
7174 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
7175 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
7176 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
7177 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
7178 | q3n0kRe = fReRPQ1dEBE[2][pe][2][0]->GetBinContent(fReRPQ1dEBE[2][pe][2][0]->GetBin(b)) | |
7179 | * fReRPQ1dEBE[2][pe][2][0]->GetBinEntries(fReRPQ1dEBE[2][pe][2][0]->GetBin(b)); | |
7180 | q3n0kIm = fImRPQ1dEBE[2][pe][2][0]->GetBinContent(fImRPQ1dEBE[2][pe][2][0]->GetBin(b)) | |
7181 | * fImRPQ1dEBE[2][pe][2][0]->GetBinEntries(fImRPQ1dEBE[2][pe][2][0]->GetBin(b)); | |
7182 | ||
7183 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
7184 | } | |
7185 | else if(type == "RP") | |
7186 | { | |
7187 | // q_{m*n,0}: | |
7188 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
7189 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
7190 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
7191 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
7192 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
7193 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
7194 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
7195 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
7196 | q3n0kRe = fReRPQ1dEBE[0][pe][2][0]->GetBinContent(fReRPQ1dEBE[0][pe][2][0]->GetBin(b)) | |
7197 | * fReRPQ1dEBE[0][pe][2][0]->GetBinEntries(fReRPQ1dEBE[0][pe][2][0]->GetBin(b)); | |
7198 | q3n0kIm = fImRPQ1dEBE[0][pe][2][0]->GetBinContent(fImRPQ1dEBE[0][pe][2][0]->GetBin(b)) | |
7199 | * fImRPQ1dEBE[0][pe][2][0]->GetBinEntries(fImRPQ1dEBE[0][pe][2][0]->GetBin(b)); | |
7200 | ||
7201 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
7202 | } | |
7203 | ||
7204 | if(type == "POI") | |
7205 | { | |
7206 | // p_{m*n,0}: | |
7207 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
7208 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
7209 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
7210 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
7211 | ||
7212 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
7213 | ||
7214 | t = 1; // typeFlag = RP or POI | |
7215 | } | |
7216 | else if(type == "RP") | |
7217 | { | |
7218 | // p_{m*n,0} = q_{m*n,0}: | |
7219 | p1n0kRe = q1n0kRe; | |
7220 | p1n0kIm = q1n0kIm; | |
7221 | ||
7222 | mp = mq; | |
7223 | ||
7224 | t = 0; // typeFlag = RP or POI | |
7225 | } | |
7226 | ||
7227 | // 3'-particle correlators: | |
7228 | // Taeney-Yan correlator: | |
7229 | Double_t dTaeneyYan = 0.; | |
7230 | Double_t mWeightTaeneyYan = 0.; // multiplicity weight for Taeney-Yan correlator | |
7231 | if((mp*dMult-2.*mq)*(dMult-1.) > 0.) // to be improved - is this condition fully justified? | |
7232 | { | |
7233 | dTaeneyYan = (dReQ3n*(p1n0kRe*dReQ2n-p1n0kIm*dImQ2n)+dImQ3n*(p1n0kIm*dReQ2n+p1n0kRe*dImQ2n) | |
7234 | - p1n0kRe*dReQ1n - p1n0kIm*dImQ1n | |
7235 | - q2n0kRe*dReQ2n - q2n0kIm*dImQ2n | |
7236 | - q3n0kRe*dReQ3n - q3n0kIm*dImQ3n | |
7237 | + 2.*mq) | |
7238 | / ((mp*dMult-2.*mq)*(dMult-1.)); | |
7239 | // determine multiplicity weight: | |
7240 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
7241 | { | |
7242 | mWeightTaeneyYan = (mp*dMult-2.*mq)*(dMult-1.); | |
7243 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
7244 | { | |
7245 | mWeightTaeneyYan = 1.; | |
7246 | } | |
7247 | // Fill profiles: | |
7248 | fOtherDiffCorrelators[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dTaeneyYan,mWeightTaeneyYan); | |
7249 | } // end of if((mp*dMult-2.*mq)*(dMult-1.) > 0.) | |
7250 | ||
7251 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7252 | ||
7253 | } // end of void AliFlowAnalysisWithQCumulants::CalculateOtherDiffCorrelators(TString type, TString ptOrEta) | |
7254 | ||
7255 | //================================================================================================================================ | |
7256 | ||
1268c371 | 7257 | void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCorrelations(TString type) |
7258 | { | |
7259 | // Calculate all reduced correlations needed for 2D differential flow for each (pt,eta) bin. | |
7260 | ||
7261 | // Multiplicity: | |
7262 | Double_t dMult = (*fSpk)(0,0); | |
7263 | // Real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
7264 | Double_t dReQ1n = (*fReQ)(0,0); | |
7265 | Double_t dReQ2n = (*fReQ)(1,0); | |
7266 | //Double_t dReQ3n = (*fReQ)(2,0); | |
7267 | //Double_t dReQ4n = (*fReQ)(3,0); | |
7268 | Double_t dImQ1n = (*fImQ)(0,0); | |
7269 | Double_t dImQ2n = (*fImQ)(1,0); | |
7270 | //Double_t dImQ3n = (*fImQ)(2,0); | |
7271 | //Double_t dImQ4n = (*fImQ)(3,0); | |
7272 | ||
7273 | // 2D reduced correlations are stored in TProfile2D f2DDiffFlowCorrelationsPro[0=RP,1=POI][correlation index]. | |
7274 | // Correlation index runs as follows: | |
7275 | // 0: <<2'>> | |
7276 | // 1: <<4'>> | |
7277 | // 2: <<6'>> | |
7278 | // 3: <<8'>> | |
7279 | ||
7280 | Int_t t = 0; // type flag | |
7281 | if(type == "RP") | |
7282 | { | |
7283 | t = 0; | |
7284 | } else if(type == "POI") | |
7285 | { | |
7286 | t = 1; | |
7287 | } | |
7288 | ||
7289 | // Looping over all (pt,eta) bins and calculating correlations needed for differential flow: | |
7290 | for(Int_t p=1;p<=fnBinsPt;p++) | |
7291 | { | |
7292 | for(Int_t e=1;e<=fnBinsEta;e++) | |
7293 | { | |
7294 | // Real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): | |
7295 | Double_t p1n0kRe = 0.; | |
7296 | Double_t p1n0kIm = 0.; | |
7297 | // Number of POIs in particular pt or eta bin: | |
7298 | Double_t mp = 0.; | |
7299 | // Real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for 'RP && POI particles' in particular pt or eta bin): | |
7300 | Double_t q1n0kRe = 0.; | |
7301 | Double_t q1n0kIm = 0.; | |
7302 | Double_t q2n0kRe = 0.; | |
7303 | Double_t q2n0kIm = 0.; | |
7304 | // Number of 'RP && POI particles' in particular pt or eta bin: | |
7305 | Double_t mq = 0.; | |
7306 | if(type == "POI") | |
7307 | { | |
7308 | // q_{m*n,0}: | |
7309 | q1n0kRe = fReRPQ2dEBE[2][0][0]->GetBinContent(fReRPQ2dEBE[2][0][0]->GetBin(p,e)) | |
7310 | * fReRPQ2dEBE[2][0][0]->GetBinEntries(fReRPQ2dEBE[2][0][0]->GetBin(p,e)); | |
7311 | q1n0kIm = fImRPQ2dEBE[2][0][0]->GetBinContent(fImRPQ2dEBE[2][0][0]->GetBin(p,e)) | |
7312 | * fImRPQ2dEBE[2][0][0]->GetBinEntries(fImRPQ2dEBE[2][0][0]->GetBin(p,e)); | |
7313 | q2n0kRe = fReRPQ2dEBE[2][1][0]->GetBinContent(fReRPQ2dEBE[2][1][0]->GetBin(p,e)) | |
7314 | * fReRPQ2dEBE[2][1][0]->GetBinEntries(fReRPQ2dEBE[2][1][0]->GetBin(p,e)); | |
7315 | q2n0kIm = fImRPQ2dEBE[2][1][0]->GetBinContent(fImRPQ2dEBE[2][1][0]->GetBin(p,e)) | |
7316 | * fImRPQ2dEBE[2][1][0]->GetBinEntries(fImRPQ2dEBE[2][1][0]->GetBin(p,e)); | |
7317 | // m_{q}: | |
7318 | mq = fReRPQ2dEBE[2][0][0]->GetBinEntries(fReRPQ2dEBE[2][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) | |
7319 | } // end of if(type == "POI") | |
7320 | else if(type == "RP") | |
7321 | { | |
7322 | // q_{m*n,0}: | |
7323 | q1n0kRe = fReRPQ2dEBE[0][0][0]->GetBinContent(fReRPQ2dEBE[0][0][0]->GetBin(p,e)) | |
7324 | * fReRPQ2dEBE[0][0][0]->GetBinEntries(fReRPQ2dEBE[0][0][0]->GetBin(p,e)); | |
7325 | q1n0kIm = fImRPQ2dEBE[0][0][0]->GetBinContent(fImRPQ2dEBE[0][0][0]->GetBin(p,e)) | |
7326 | * fImRPQ2dEBE[0][0][0]->GetBinEntries(fImRPQ2dEBE[0][0][0]->GetBin(p,e)); | |
7327 | q2n0kRe = fReRPQ2dEBE[0][1][0]->GetBinContent(fReRPQ2dEBE[0][1][0]->GetBin(p,e)) | |
7328 | * fReRPQ2dEBE[0][1][0]->GetBinEntries(fReRPQ2dEBE[0][1][0]->GetBin(p,e)); | |
7329 | q2n0kIm = fImRPQ2dEBE[0][1][0]->GetBinContent(fImRPQ2dEBE[0][1][0]->GetBin(p,e)) | |
7330 | * fImRPQ2dEBE[0][1][0]->GetBinEntries(fImRPQ2dEBE[0][1][0]->GetBin(p,e)); | |
7331 | // m_{q}: | |
7332 | mq = fReRPQ2dEBE[0][0][0]->GetBinEntries(fReRPQ2dEBE[0][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) | |
7333 | } // end of else if(type == "RP") | |
7334 | if(type == "POI") | |
7335 | { | |
7336 | // p_{m*n,0}: | |
7337 | p1n0kRe = fReRPQ2dEBE[1][0][0]->GetBinContent(fReRPQ2dEBE[1][0][0]->GetBin(p,e)) | |
7338 | * fReRPQ2dEBE[1][0][0]->GetBinEntries(fReRPQ2dEBE[1][0][0]->GetBin(p,e)); | |
7339 | p1n0kIm = fImRPQ2dEBE[1][0][0]->GetBinContent(fImRPQ2dEBE[1][0][0]->GetBin(p,e)) | |
7340 | * fImRPQ2dEBE[1][0][0]->GetBinEntries(fImRPQ2dEBE[1][0][0]->GetBin(p,e)); | |
7341 | // m_{p} | |
7342 | mp = fReRPQ2dEBE[1][0][0]->GetBinEntries(fReRPQ2dEBE[1][0][0]->GetBin(p,e)); // to be improved (cross-checked by accessing other profiles here) | |
7343 | ||
7344 | t = 1; // typeFlag = RP or POI | |
7345 | } // end of if(type == "POI") | |
7346 | else if(type == "RP") | |
7347 | { | |
7348 | // p_{m*n,0} = q_{m*n,0}: | |
7349 | p1n0kRe = q1n0kRe; | |
7350 | p1n0kIm = q1n0kIm; | |
7351 | // m_{p} = m_{q}: | |
7352 | mp = mq; | |
7353 | ||
7354 | t = 0; // typeFlag = RP or POI | |
7355 | } // end of if(type == "RP") | |
7356 | ||
7357 | // 2'-particle correlation for particular (pt,eta) bin: | |
7358 | Double_t two1n1nPtEta = 0.; | |
7359 | Double_t mWeight2pPrime = 0.; // multiplicity weight for <2'> | |
7360 | if(mp*dMult-mq) | |
7361 | { | |
7362 | two1n1nPtEta = (p1n0kRe*dReQ1n+p1n0kIm*dImQ1n-mq) | |
7363 | / (mp*dMult-mq); | |
7364 | // Determine multiplicity weight: | |
7365 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
7366 | { | |
7367 | mWeight2pPrime = mp*dMult-mq; | |
7368 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
7369 | { | |
7370 | mWeight2pPrime = 1.; | |
7371 | } | |
7372 | // Fill 2D profile holding <<2'>>: | |
7373 | f2DDiffFlowCorrelationsPro[t][0]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,two1n1nPtEta,mWeight2pPrime); | |
7374 | } // end of if(mp*dMult-mq) | |
7375 | ||
7376 | // 4'-particle correlation: | |
7377 | Double_t four1n1n1n1nPtEta = 0.; | |
7378 | Double_t mWeight4pPrime = 0.; // multiplicity weight for <4'> | |
7379 | if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
7380 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) // to be improved (introduce a new variable for this expression) | |
7381 | { | |
7382 | four1n1n1n1nPtEta = ((pow(dReQ1n,2.)+pow(dImQ1n,2.))*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
7383 | - q2n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.)) | |
7384 | - 2.*q2n0kIm*dReQ1n*dImQ1n | |
7385 | - p1n0kRe*(dReQ1n*dReQ2n+dImQ1n*dImQ2n) | |
7386 | + p1n0kIm*(dImQ1n*dReQ2n-dReQ1n*dImQ2n) | |
7387 | - 2.*dMult*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
7388 | - 2.*(pow(dReQ1n,2.)+pow(dImQ1n,2.))*mq | |
7389 | + 6.*(q1n0kRe*dReQ1n+q1n0kIm*dImQ1n) | |
7390 | + 1.*(q2n0kRe*dReQ2n+q2n0kIm*dImQ2n) | |
7391 | + 2.*(p1n0kRe*dReQ1n+p1n0kIm*dImQ1n) | |
7392 | + 2.*mq*dMult | |
7393 | - 6.*mq) | |
7394 | / ((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
7395 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.)); | |
7396 | // Determine multiplicity weight: | |
7397 | if(!strcmp(fMultiplicityWeight->Data(),"combinations")) | |
7398 | { | |
7399 | mWeight4pPrime = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
7400 | } else if(!strcmp(fMultiplicityWeight->Data(),"unit")) | |
7401 | { | |
7402 | mWeight4pPrime = 1.; | |
7403 | } | |
7404 | // Fill 2D profile holding <<4'>>: | |
7405 | f2DDiffFlowCorrelationsPro[t][1]->Fill(fPtMin+(p-1)*fPtBinWidth,fEtaMin+(e-1)*fEtaBinWidth,four1n1n1n1nPtEta,mWeight4pPrime); | |
7406 | } // end of if((mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
7407 | // +mq*(dMult-1.)*(dMult-2.)*(dMult-3.)) | |
7408 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
7409 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
7410 | ||
7411 | } // end of AliFlowAnalysisWithQCumulants::Calculate2DDiffFlowCorrelations(TString type) | |
7412 | ||
7413 | //================================================================================================================================ | |
7414 | ||
489d5531 | 7415 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfEventWeights(TString type, TString ptOrEta) |
7416 | { | |
7417 | // Calculate sums of various event weights for reduced correlations. | |
7418 | // (These quantitites are needed in expressions for unbiased estimators relevant for the statistical errors.) | |
7419 | ||
2a98ceb8 | 7420 | Int_t typeFlag = 0; |
7421 | Int_t ptEtaFlag = 0; | |
489d5531 | 7422 | |
7423 | if(type == "RP") | |
7424 | { | |
7425 | typeFlag = 0; | |
7426 | } else if(type == "POI") | |
7427 | { | |
7428 | typeFlag = 1; | |
7429 | } | |
7430 | ||
7431 | if(ptOrEta == "Pt") | |
7432 | { | |
7433 | ptEtaFlag = 0; | |
7434 | } else if(ptOrEta == "Eta") | |
7435 | { | |
7436 | ptEtaFlag = 1; | |
7437 | } | |
7438 | ||
7439 | // shortcuts: | |
7440 | Int_t t = typeFlag; | |
7441 | Int_t pe = ptEtaFlag; | |
7442 | ||
7443 | // binning: | |
7444 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
7445 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
7446 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
7447 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
7448 | ||
7449 | for(Int_t rpq=0;rpq<3;rpq++) | |
7450 | { | |
7451 | for(Int_t m=0;m<4;m++) | |
7452 | { | |
7453 | for(Int_t k=0;k<9;k++) | |
7454 | { | |
7455 | if(!fReRPQ1dEBE[rpq][pe][m][k]) | |
7456 | { | |
7457 | cout<<"WARNING: fReRPQ1dEBE[rpq][pe][m][k] is NULL in AFAWQC::CSAPOEWFDF() !!!!"<<endl; | |
7458 | cout<<"pe = "<<pe<<endl; | |
7459 | cout<<"rpq = "<<rpq<<endl; | |
7460 | cout<<"m = "<<m<<endl; | |
7461 | cout<<"k = "<<k<<endl; | |
7462 | exit(0); | |
7463 | } | |
7464 | } | |
7465 | } | |
7466 | } | |
7467 | ||
7468 | // multiplicities: | |
1268c371 | 7469 | Double_t dMult = (*fSpk)(0,0); // total event multiplicity |
489d5531 | 7470 | //Double_t mr = 0.; // number of RPs in particular pt or eta bin |
7471 | Double_t mp = 0.; // number of POIs in particular pt or eta bin | |
7472 | Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin | |
7473 | ||
7474 | // event weights for reduced correlations: | |
7475 | Double_t dw2 = 0.; // event weight for <2'> | |
7476 | Double_t dw4 = 0.; // event weight for <4'> | |
7477 | //Double_t dw6 = 0.; // event weight for <6'> | |
7478 | //Double_t dw8 = 0.; // event weight for <8'> | |
7479 | ||
7480 | // looping over bins: | |
7481 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7482 | { | |
7483 | if(type == "RP") | |
7484 | { | |
7485 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b); | |
7486 | mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow | |
7487 | } else if(type == "POI") | |
7488 | { | |
7489 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b); | |
7490 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); | |
7491 | } | |
7492 | ||
7493 | // event weight for <2'>: | |
7494 | dw2 = mp*dMult-mq; | |
7495 | fDiffFlowSumOfEventWeights[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2); | |
7496 | fDiffFlowSumOfEventWeights[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw2,2.)); | |
7497 | ||
7498 | // event weight for <4'>: | |
7499 | dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
7500 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
7501 | fDiffFlowSumOfEventWeights[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4); | |
7502 | fDiffFlowSumOfEventWeights[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw4,2.)); | |
7503 | ||
7504 | // event weight for <6'>: | |
7505 | //dw6 = ...; | |
7506 | //fDiffFlowSumOfEventWeights[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6); | |
7507 | //fDiffFlowSumOfEventWeights[t][pe][t][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw6,2.)); | |
7508 | ||
7509 | // event weight for <8'>: | |
7510 | //dw8 = ...; | |
7511 | //fDiffFlowSumOfEventWeights[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw8); | |
7512 | //fDiffFlowSumOfEventWeights[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],pow(dw8,2.)); | |
7513 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7514 | ||
7515 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfEventWeights() | |
7516 | ||
7517 | ||
7518 | //================================================================================================================================ | |
7519 | ||
7520 | ||
7521 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfProductOfEventWeights(TString type, TString ptOrEta) | |
7522 | { | |
7523 | // Calculate sum of products of various event weights for both types of correlations (the ones for int. and diff. flow). | |
7524 | // (These quantitites are needed in expressions for unbiased estimators relevant for the statistical errors.) | |
7525 | // | |
7526 | // Important: To fill fDiffFlowSumOfProductOfEventWeights[][][][] use bellow table (i,j) with following constraints: | |
7527 | // 1.) i<j | |
7528 | // 2.) do not store terms which DO NOT include reduced correlations; | |
7529 | // Table: | |
7530 | // [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] x [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] | |
7531 | ||
2a98ceb8 | 7532 | Int_t typeFlag = 0; |
7533 | Int_t ptEtaFlag = 0; | |
489d5531 | 7534 | |
7535 | if(type == "RP") | |
7536 | { | |
7537 | typeFlag = 0; | |
7538 | } else if(type == "POI") | |
7539 | { | |
7540 | typeFlag = 1; | |
7541 | } | |
7542 | ||
7543 | if(ptOrEta == "Pt") | |
7544 | { | |
7545 | ptEtaFlag = 0; | |
7546 | } else if(ptOrEta == "Eta") | |
7547 | { | |
7548 | ptEtaFlag = 1; | |
7549 | } | |
7550 | ||
7551 | // shortcuts: | |
7552 | Int_t t = typeFlag; | |
7553 | Int_t pe = ptEtaFlag; | |
7554 | ||
7555 | // binning: | |
7556 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
7557 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
7558 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
7559 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
7560 | ||
7561 | // protection: | |
7562 | for(Int_t rpq=0;rpq<3;rpq++) | |
7563 | { | |
7564 | for(Int_t m=0;m<4;m++) | |
7565 | { | |
7566 | for(Int_t k=0;k<9;k++) | |
7567 | { | |
7568 | if(!fReRPQ1dEBE[rpq][pe][m][k]) | |
7569 | { | |
7570 | cout<<"WARNING: fReRPQ1dEBE[rpq][pe][m][k] is NULL in AFAWQC::CSAPOEWFDF() !!!!"<<endl; | |
7571 | cout<<"pe = "<<pe<<endl; | |
7572 | cout<<"rpq = "<<rpq<<endl; | |
7573 | cout<<"m = "<<m<<endl; | |
7574 | cout<<"k = "<<k<<endl; | |
7575 | exit(0); | |
7576 | } | |
7577 | } | |
7578 | } | |
7579 | } | |
7580 | ||
7581 | // multiplicities: | |
1268c371 | 7582 | Double_t dMult = (*fSpk)(0,0); // total event multiplicity |
489d5531 | 7583 | //Double_t mr = 0.; // number of RPs in particular pt or eta bin |
7584 | Double_t mp = 0.; // number of POIs in particular pt or eta bin | |
7585 | Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin | |
7586 | ||
7587 | // event weights for correlations: | |
7588 | Double_t dW2 = dMult*(dMult-1); // event weight for <2> | |
7589 | Double_t dW4 = dMult*(dMult-1)*(dMult-2)*(dMult-3); // event weight for <4> | |
7590 | Double_t dW6 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5); // event weight for <6> | |
7591 | Double_t dW8 = dMult*(dMult-1)*(dMult-2)*(dMult-3)*(dMult-4)*(dMult-5)*(dMult-6)*(dMult-7); // event weight for <8> | |
7592 | ||
7593 | // event weights for reduced correlations: | |
7594 | Double_t dw2 = 0.; // event weight for <2'> | |
7595 | Double_t dw4 = 0.; // event weight for <4'> | |
7596 | //Double_t dw6 = 0.; // event weight for <6'> | |
7597 | //Double_t dw8 = 0.; // event weight for <8'> | |
7598 | ||
7599 | // looping over bins: | |
7600 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7601 | { | |
7602 | if(type == "RP") | |
7603 | { | |
7604 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b); | |
7605 | mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow | |
7606 | } else if(type == "POI") | |
7607 | { | |
7608 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b); | |
7609 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); | |
7610 | } | |
7611 | ||
7612 | // event weight for <2'>: | |
7613 | dw2 = mp*dMult-mq; | |
7614 | fDiffFlowSumOfProductOfEventWeights[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw2); // storing product of even weights for <2> and <2'> | |
7615 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW4); // storing product of even weights for <4> and <2'> | |
7616 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW6); // storing product of even weights for <6> and <2'> | |
7617 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dW8); // storing product of even weights for <8> and <2'> | |
7618 | ||
7619 | // event weight for <4'>: | |
7620 | dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
7621 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); | |
7622 | fDiffFlowSumOfProductOfEventWeights[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw4); // storing product of even weights for <2> and <4'> | |
7623 | fDiffFlowSumOfProductOfEventWeights[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw4); // storing product of even weights for <2'> and <4'> | |
7624 | fDiffFlowSumOfProductOfEventWeights[t][pe][2][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw4); // storing product of even weights for <4> and <4'> | |
7625 | fDiffFlowSumOfProductOfEventWeights[t][pe][3][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dW6); // storing product of even weights for <6> and <4'> | |
7626 | fDiffFlowSumOfProductOfEventWeights[t][pe][3][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dW8); // storing product of even weights for <8> and <4'> | |
7627 | ||
7628 | // event weight for <6'>: | |
7629 | //dw6 = ...; | |
7630 | //fDiffFlowSumOfProductOfEventWeights[t][pe][0][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw6); // storing product of even weights for <2> and <6'> | |
7631 | //fDiffFlowSumOfProductOfEventWeights[t][pe][1][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw6); // storing product of even weights for <2'> and <6'> | |
7632 | //fDiffFlowSumOfProductOfEventWeights[t][pe][2][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw6); // storing product of even weights for <4> and <6'> | |
7633 | //fDiffFlowSumOfProductOfEventWeights[t][pe][3][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dw6); // storing product of even weights for <4'> and <6'> | |
7634 | //fDiffFlowSumOfProductOfEventWeights[t][pe][4][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW6*dw6); // storing product of even weights for <6> and <6'> | |
7635 | //fDiffFlowSumOfProductOfEventWeights[t][pe][5][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dW8); // storing product of even weights for <6'> and <8> | |
7636 | //fDiffFlowSumOfProductOfEventWeights[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dw8); // storing product of even weights for <6'> and <8'> | |
7637 | ||
7638 | // event weight for <8'>: | |
7639 | //dw8 = ...; | |
7640 | //fDiffFlowSumOfProductOfEventWeights[t][pe][0][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW2*dw8); // storing product of even weights for <2> and <8'> | |
7641 | //fDiffFlowSumOfProductOfEventWeights[t][pe][1][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw2*dw8); // storing product of even weights for <2'> and <8'> | |
7642 | //fDiffFlowSumOfProductOfEventWeights[t][pe][2][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW4*dw8); // storing product of even weights for <4> and <8'> | |
7643 | //fDiffFlowSumOfProductOfEventWeights[t][pe][3][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw4*dw8); // storing product of even weights for <4'> and <8'> | |
7644 | //fDiffFlowSumOfProductOfEventWeights[t][pe][4][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW6*dw8); // storing product of even weights for <6> and <8'> | |
7645 | //fDiffFlowSumOfProductOfEventWeights[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dw6*dw8); // storing product of even weights for <6'> and <8'> | |
7646 | //fDiffFlowSumOfProductOfEventWeights[t][pe][6][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],dW8*dw8); // storing product of even weights for <8> and <8'> | |
7647 | ||
7648 | // Table: | |
7649 | // [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] x [0=<2>,1=<2'>,2=<4>,3=<4'>,4=<6>,5=<6'>,6=<8>,7=<8'>] | |
7650 | ||
7651 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7652 | ||
7653 | ||
7654 | ||
7655 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowSumOfProductOfEventWeights(TString type, TString ptOrEta) | |
7656 | ||
489d5531 | 7657 | //================================================================================================================================ |
7658 | ||
489d5531 | 7659 | void AliFlowAnalysisWithQCumulants::FinalizeReducedCorrelations(TString type, TString ptOrEta) |
7660 | { | |
7661 | // Transfer profiles into histograms and calculate statistical errors correctly. | |
7662 | ||
1268c371 | 7663 | Int_t t = 0; // RP or POI |
7664 | Int_t pe = 0; // pt or eta | |
489d5531 | 7665 | |
7666 | if(type == "RP") | |
7667 | { | |
1268c371 | 7668 | t = 0; |
489d5531 | 7669 | } else if(type == "POI") |
7670 | { | |
1268c371 | 7671 | t = 1; |
489d5531 | 7672 | } |
7673 | ||
7674 | if(ptOrEta == "Pt") | |
7675 | { | |
1268c371 | 7676 | pe = 0; |
489d5531 | 7677 | } else if(ptOrEta == "Eta") |
7678 | { | |
1268c371 | 7679 | pe = 1; |
489d5531 | 7680 | } |
1268c371 | 7681 | |
7682 | for(Int_t rci=0;rci<4;rci++) // to be improved - moved into the method CheckPointersUsedInFinish() | |
489d5531 | 7683 | { |
7684 | if(!fDiffFlowCorrelationsPro[t][pe][rci]) | |
7685 | { | |
7686 | cout<<"WARNING: fDiffFlowCorrelationsPro[t][pe][rci] is NULL in AFAWQC::FRC() !!!!"<<endl; | |
7687 | cout<<"t = "<<t<<endl; | |
7688 | cout<<"pe = "<<pe<<endl; | |
7689 | cout<<"rci = "<<rci<<endl; | |
7690 | exit(0); | |
7691 | } | |
b40a910e | 7692 | if(!fDiffFlowSquaredCorrelationsPro[t][pe][rci]) |
7693 | { | |
7694 | cout<<"WARNING: fDiffFlowSquaredCorrelationsPro[t][pe][rci] is NULL in AFAWQC::FRC() !!!!"<<endl; | |
7695 | cout<<"t = "<<t<<endl; | |
7696 | cout<<"pe = "<<pe<<endl; | |
7697 | cout<<"rci = "<<rci<<endl; | |
7698 | exit(0); | |
7699 | } | |
489d5531 | 7700 | for(Int_t power=0;power<2;power++) |
7701 | { | |
7702 | if(!fDiffFlowSumOfEventWeights[t][pe][power][rci]) | |
7703 | { | |
7704 | cout<<"WARNING: fDiffFlowSumOfEventWeights[t][pe][power][rci] is NULL in AFAWQC::FRC() !!!!"<<endl; | |
7705 | cout<<"t = "<<t<<endl; | |
7706 | cout<<"pe = "<<pe<<endl; | |
7707 | cout<<"power = "<<power<<endl; | |
7708 | cout<<"rci = "<<rci<<endl; | |
7709 | exit(0); | |
7710 | } | |
7711 | } // end of for(Int_t power=0;power<2;power++) | |
7712 | } // end of for(Int_t rci=0;rci<4;rci++) | |
7713 | ||
7714 | // common: | |
b40a910e | 7715 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
489d5531 | 7716 | // transfer 1D profile into 1D histogram: |
7717 | Double_t correlation = 0.; | |
b40a910e | 7718 | Double_t squaredCorrelation = 0.; |
489d5531 | 7719 | Double_t spread = 0.; |
7720 | Double_t sumOfWeights = 0.; // sum of weights for particular reduced correlations for particular pt or eta bin | |
7721 | Double_t sumOfSquaredWeights = 0.; // sum of squared weights for particular reduced correlations for particular pt or eta bin | |
7722 | Double_t error = 0.; // error = termA * spread * termB | |
7723 | // termA = (sqrt(sumOfSquaredWeights)/sumOfWeights) | |
7724 | // termB = 1/pow(1-termA^2,0.5) | |
7725 | Double_t termA = 0.; | |
7726 | Double_t termB = 0.; | |
7727 | for(Int_t rci=0;rci<4;rci++) // index of reduced correlation | |
7728 | { | |
7729 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) // number of pt or eta bins | |
7730 | { | |
b40a910e | 7731 | if(fDiffFlowCorrelationsPro[t][pe][rci]->GetBinEffectiveEntries(b) < 2 || |
7732 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->GetBinEffectiveEntries(b) < 2) | |
7733 | { | |
7734 | fDiffFlowCorrelationsPro[t][pe][rci]->SetBinError(b,0.); | |
7735 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->SetBinError(b,0.); | |
7736 | continue; // to be improved - should I ignore results in pt bins with one entry for reduced correlations or not? | |
7737 | } | |
489d5531 | 7738 | correlation = fDiffFlowCorrelationsPro[t][pe][rci]->GetBinContent(b); |
b40a910e | 7739 | squaredCorrelation = fDiffFlowSquaredCorrelationsPro[t][pe][rci]->GetBinContent(b); |
7740 | if(squaredCorrelation-correlation*correlation >= 0.) | |
7741 | { | |
7742 | spread = pow(squaredCorrelation-correlation*correlation,0.5); | |
7743 | } else | |
7744 | { | |
7745 | cout<<endl; | |
7746 | cout<<Form(" WARNING: Imaginary 'spread' for rci = %d, pe = %d, bin = %d !!!!",rci,pe,b)<<endl; | |
7747 | cout<<endl; | |
7748 | } | |
489d5531 | 7749 | sumOfWeights = fDiffFlowSumOfEventWeights[t][pe][0][rci]->GetBinContent(b); |
7750 | sumOfSquaredWeights = fDiffFlowSumOfEventWeights[t][pe][1][rci]->GetBinContent(b); | |
1268c371 | 7751 | if(TMath::Abs(sumOfWeights)>0.){termA = (pow(sumOfSquaredWeights,0.5)/sumOfWeights);} |
7752 | if(1.-pow(termA,2.)>0.){termB = 1./pow(1.-pow(termA,2.),0.5);} | |
489d5531 | 7753 | error = termA*spread*termB; // final error (unbiased estimator for standard deviation) |
7754 | fDiffFlowCorrelationsHist[t][pe][rci]->SetBinContent(b,correlation); | |
7755 | fDiffFlowCorrelationsHist[t][pe][rci]->SetBinError(b,error); | |
7756 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7757 | } // end of for(Int_t rci=0;rci<4;rci++) | |
7758 | ||
7759 | } // end of void AliFlowAnalysisWithQCumulants::FinalizeReducedCorrelations(TString type, TString ptOrEta) | |
7760 | ||
489d5531 | 7761 | //================================================================================================================================ |
7762 | ||
489d5531 | 7763 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowProductOfCorrelations(TString type, TString ptOrEta) |
7764 | { | |
7765 | // store products: <2><2'>, <2><4'>, <2><6'>, <2><8'>, <2'><4>, | |
7766 | // <2'><4'>, <2'><6>, <2'><6'>, <2'><8>, <2'><8'>, | |
7767 | // <4><4'>, <4><6'>, <4><8'>, <4'><6>, <4'><6'>, | |
7768 | // <4'><8>, <4'><8'>, <6><6'>, <6><8'>, <6'><8>, | |
7769 | // <6'><8'>, <8><8'>. | |
7770 | ||
2a98ceb8 | 7771 | Int_t typeFlag = 0; |
7772 | Int_t ptEtaFlag = 0; | |
489d5531 | 7773 | |
7774 | if(type == "RP") | |
7775 | { | |
7776 | typeFlag = 0; | |
7777 | } else if(type == "POI") | |
7778 | { | |
7779 | typeFlag = 1; | |
7780 | } | |
7781 | ||
7782 | if(ptOrEta == "Pt") | |
7783 | { | |
7784 | ptEtaFlag = 0; | |
7785 | } else if(ptOrEta == "Eta") | |
7786 | { | |
7787 | ptEtaFlag = 1; | |
7788 | } | |
7789 | ||
7790 | // shortcuts: | |
7791 | Int_t t = typeFlag; | |
7792 | Int_t pe = ptEtaFlag; | |
7793 | ||
7794 | // common: | |
7795 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
7796 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
7797 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
7798 | ||
7799 | // protections // to be improved (add protection for all pointers in this method) | |
7800 | if(!fIntFlowCorrelationsEBE) | |
7801 | { | |
7802 | cout<<"WARNING: fIntFlowCorrelationsEBE is NULL in AFAWQC::CDFPOC() !!!!"<<endl; | |
7803 | exit(0); | |
7804 | } | |
7805 | ||
7806 | /* | |
1268c371 | 7807 | Double_t dMult = (*fSpk)(0,0); // multiplicity (number of particles used to determine the reaction plane) |
489d5531 | 7808 | //Double_t mr = 0.; // number of RPs in particular pt or eta bin |
7809 | Double_t mp = 0.; // number of POIs in particular pt or eta bin | |
7810 | Double_t mq = 0.; // number of particles which are both RPs and POIs in particular pt or eta bin | |
7811 | */ | |
7812 | ||
7813 | // e-b-e correlations: | |
7814 | Double_t twoEBE = fIntFlowCorrelationsEBE->GetBinContent(1); // <2> | |
7815 | Double_t fourEBE = fIntFlowCorrelationsEBE->GetBinContent(2); // <4> | |
7816 | Double_t sixEBE = fIntFlowCorrelationsEBE->GetBinContent(3); // <6> | |
7817 | Double_t eightEBE = fIntFlowCorrelationsEBE->GetBinContent(4); // <8> | |
7818 | ||
7819 | // event weights for correlations: | |
7820 | Double_t dW2 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(1); // event weight for <2> | |
7821 | Double_t dW4 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(2); // event weight for <4> | |
7822 | Double_t dW6 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(3); // event weight for <6> | |
7823 | Double_t dW8 = fIntFlowEventWeightsForCorrelationsEBE->GetBinContent(4); // event weight for <8> | |
7824 | ||
7825 | // e-b-e reduced correlations: | |
7826 | Double_t twoReducedEBE = 0.; // <2'> | |
7827 | Double_t fourReducedEBE = 0.; // <4'> | |
ea239361 | 7828 | //Double_t sixReducedEBE = 0.; // <6'> |
7829 | //Double_t eightReducedEBE = 0.; // <8'> | |
489d5531 | 7830 | |
7831 | // event weights for reduced correlations: | |
7832 | Double_t dw2 = 0.; // event weight for <2'> | |
7833 | Double_t dw4 = 0.; // event weight for <4'> | |
7834 | //Double_t dw6 = 0.; // event weight for <6'> | |
7835 | //Double_t dw8 = 0.; // event weight for <8'> | |
7836 | ||
7837 | // looping over bins: | |
7838 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
7839 | { | |
7840 | // e-b-e reduced correlations: | |
7841 | twoReducedEBE = fDiffFlowCorrelationsEBE[t][pe][0]->GetBinContent(b); | |
7842 | fourReducedEBE = fDiffFlowCorrelationsEBE[t][pe][1]->GetBinContent(b); | |
ea239361 | 7843 | //sixReducedEBE = fDiffFlowCorrelationsEBE[t][pe][2]->GetBinContent(b); |
7844 | //eightReducedEBE = fDiffFlowCorrelationsEBE[t][pe][3]->GetBinContent(b); | |
489d5531 | 7845 | |
7846 | /* | |
7847 | // to be improved (I should not do this here again) | |
7848 | if(type == "RP") | |
7849 | { | |
7850 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(b); | |
7851 | mp = mq; // trick to use the very same Eqs. bellow both for RP's and POI's diff. flow | |
7852 | } else if(type == "POI") | |
7853 | { | |
7854 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(b); | |
7855 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(b); | |
7856 | } | |
7857 | ||
7858 | // event weights for reduced correlations: | |
7859 | dw2 = mp*dMult-mq; // weight for <2'> | |
7860 | dw4 = (mp-mq)*dMult*(dMult-1.)*(dMult-2.) | |
7861 | + mq*(dMult-1.)*(dMult-2.)*(dMult-3.); // weight for <4'> | |
7862 | //dw6 = ... | |
7863 | //dw8 = ... | |
7864 | ||
7865 | */ | |
7866 | ||
7867 | dw2 = fDiffFlowEventWeightsForCorrelationsEBE[t][pe][0]->GetBinContent(b); | |
7868 | dw4 = fDiffFlowEventWeightsForCorrelationsEBE[t][pe][1]->GetBinContent(b); | |
7869 | ||
7870 | // storing all products: | |
7871 | fDiffFlowProductOfCorrelationsPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*twoReducedEBE,dW2*dw2); // storing <2><2'> | |
7872 | fDiffFlowProductOfCorrelationsPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*twoReducedEBE,dW4*dw2); // storing <4><2'> | |
7873 | fDiffFlowProductOfCorrelationsPro[t][pe][1][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*twoReducedEBE,dW6*dw2); // storing <6><2'> | |
7874 | fDiffFlowProductOfCorrelationsPro[t][pe][1][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*twoReducedEBE,dW8*dw2); // storing <8><2'> | |
7875 | ||
7876 | // event weight for <4'>: | |
7877 | fDiffFlowProductOfCorrelationsPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*fourReducedEBE,dW2*dw4); // storing <2><4'> | |
7878 | fDiffFlowProductOfCorrelationsPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*fourReducedEBE,dw2*dw4); // storing <2'><4'> | |
7879 | fDiffFlowProductOfCorrelationsPro[t][pe][2][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*fourReducedEBE,dW4*dw4); // storing <4><4'> | |
7880 | fDiffFlowProductOfCorrelationsPro[t][pe][3][4]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*fourReducedEBE,dW6*dw4); // storing <6><4'> | |
7881 | fDiffFlowProductOfCorrelationsPro[t][pe][3][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*fourReducedEBE,dW8*dw4); // storing <8><4'> | |
7882 | ||
7883 | // event weight for <6'>: | |
7884 | //dw6 = ...; | |
7885 | //fDiffFlowProductOfCorrelationsPro[t][pe][0][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*sixReducedEBE,dW2*dw6); // storing <2><6'> | |
7886 | //fDiffFlowProductOfCorrelationsPro[t][pe][1][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*sixReducedEBE,dw2*dw6); // storing <2'><6'> | |
7887 | //fDiffFlowProductOfCorrelationsPro[t][pe][2][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*sixReducedEBE,dW4*dw6); // storing <4><6'> | |
7888 | //fDiffFlowProductOfCorrelationsPro[t][pe][3][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourReducedEBE*sixReducedEBE,dw4*dw6); // storing <4'><6'> | |
7889 | //fDiffFlowProductOfCorrelationsPro[t][pe][4][5]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*sixReducedEBE,dW6*dw6); // storing <6><6'> | |
7890 | //fDiffFlowProductOfCorrelationsPro[t][pe][5][6]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightEBE,dw6*dW8); // storing <6'><8> | |
7891 | //fDiffFlowProductOfCorrelationsPro[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightReducedEBE,dw6*dw8); // storing <6'><8'> | |
7892 | ||
7893 | // event weight for <8'>: | |
7894 | //dw8 = ...; | |
7895 | //fDiffFlowProductOfCorrelationsPro[t][pe][0][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoEBE*eightReducedEBE,dW2*dw8); // storing <2><8'> | |
7896 | //fDiffFlowProductOfCorrelationsPro[t][pe][1][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],twoReducedEBE*eightReducedEBE,dw2*dw8); // storing <2'><8'> | |
7897 | //fDiffFlowProductOfCorrelationsPro[t][pe][2][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourEBE*eightReducedEBE,dW4*dw8); // storing <4><8'> | |
7898 | //fDiffFlowProductOfCorrelationsPro[t][pe][3][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],fourReducedEBE*eightReducedEBE,dw4*dw8); // storing <4'><8'> | |
7899 | //fDiffFlowProductOfCorrelationsPro[t][pe][4][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixEBE*eightReducedEBE,dW6*dw8); // storing <6><8'> | |
7900 | //fDiffFlowProductOfCorrelationsPro[t][pe][5][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sixReducedEBE*eightReducedEBE,dw6*dw8); // storing <6'><8'> | |
7901 | //fDiffFlowProductOfCorrelationsPro[t][pe][6][7]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],eightEBE*eightReducedEBE,dW8*dw8); // storing <8><8'> | |
7902 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++ | |
7903 | ||
7904 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowProductOfCorrelations(TString type, TString ptOrEta) | |
7905 | ||
489d5531 | 7906 | //================================================================================================================================ |
7907 | ||
489d5531 | 7908 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCovariances(TString type, TString ptOrEta) // to be improved (reimplemented) |
7909 | { | |
7910 | // a) Calculate unbiased estimators Cov(<2>,<2'>), Cov(<2>,<4'>), Cov(<4>,<2'>), Cov(<4>,<4'>) and Cov(<2'>,<4'>) | |
7911 | // for covariances V(<2>,<2'>), V(<2>,<4'>), V(<4>,<2'>), V(<4>,<4'>) and V(<2'>,<4'>). | |
7912 | // b) Store in histogram fDiffFlowCovariances[t][pe][index] for instance the following: | |
7913 | // | |
7914 | // Cov(<2>,<2'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] | |
7915 | // | |
7916 | // where N is the number of events, w_{<2>} is event weight for <2> and w_{<2'>} is event weight for <2'>. | |
7917 | // c) Binning of fDiffFlowCovariances[t][pe][index] is organized as follows: | |
7918 | // | |
7919 | // 1st bin: Cov(<2>,<2'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] | |
7920 | // 2nd bin: Cov(<2>,<4'>) * (sum_{i=1}^{N} w_{<2>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<2>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] | |
7921 | // 3rd bin: Cov(<4>,<2'>) * (sum_{i=1}^{N} w_{<4>}_i w_{<2'>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<2'>}_j)] | |
7922 | // 4th bin: Cov(<4>,<4'>) * (sum_{i=1}^{N} w_{<4>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<4>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] | |
7923 | // 5th bin: Cov(<2'>,<4'>) * (sum_{i=1}^{N} w_{<2'>}_i w_{<4'>}_i )/[(sum_{i=1}^{N} w_{<2'>}_i) * (sum_{j=1}^{N} w_{<4'>}_j)] | |
7924 | // ... | |
7925 | ||
2a98ceb8 | 7926 | Int_t typeFlag = 0; |
7927 | Int_t ptEtaFlag = 0; | |
489d5531 | 7928 | |
7929 | if(type == "RP") | |
7930 | { | |
7931 | typeFlag = 0; | |
7932 | } else if(type == "POI") | |
7933 | { | |
7934 | typeFlag = 1; | |
7935 | } | |
7936 | ||
7937 | if(ptOrEta == "Pt") | |
7938 | { | |
7939 | ptEtaFlag = 0; | |
7940 | } else if(ptOrEta == "Eta") | |
7941 | { | |
7942 | ptEtaFlag = 1; | |
7943 | } | |
7944 | ||
7945 | // shortcuts: | |
7946 | Int_t t = typeFlag; | |
7947 | Int_t pe = ptEtaFlag; | |
7948 | ||
7949 | // common: | |
7950 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
7951 | //Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
7952 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
7953 | //Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
7954 | ||
7955 | // average correlations: | |
7956 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> | |
7957 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> | |
7958 | //Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> | |
7959 | //Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> | |
7960 | ||
7961 | // sum of weights for correlation: | |
7962 | Double_t sumOfWeightsForTwo = fIntFlowSumOfEventWeights[0]->GetBinContent(1); // sum_{i=1}^{N} w_{<2>} | |
7963 | Double_t sumOfWeightsForFour = fIntFlowSumOfEventWeights[0]->GetBinContent(2); // sum_{i=1}^{N} w_{<4>} | |
7964 | //Double_t sumOfWeightsForSix = fIntFlowSumOfEventWeights[0]->GetBinContent(3); // sum_{i=1}^{N} w_{<6>} | |
7965 | //Double_t sumOfWeightsForEight = fIntFlowSumOfEventWeights[0]->GetBinContent(4); // sum_{i=1}^{N} w_{<8>} | |
7966 | ||
7967 | // average reduced correlations: | |
7968 | Double_t twoReduced = 0.; // <<2'>> | |
7969 | Double_t fourReduced = 0.; // <<4'>> | |
7970 | //Double_t sixReduced = 0.; // <<6'>> | |
7971 | //Double_t eightReduced = 0.; // <<8'>> | |
7972 | ||
7973 | // sum of weights for reduced correlation: | |
7974 | Double_t sumOfWeightsForTwoReduced = 0.; // sum_{i=1}^{N} w_{<2'>} | |
7975 | Double_t sumOfWeightsForFourReduced = 0.; // sum_{i=1}^{N} w_{<4'>} | |
7976 | //Double_t sumOfWeightsForSixReduced = 0.; // sum_{i=1}^{N} w_{<6'>} | |
7977 | //Double_t sumOfWeightsForEightReduced = 0.; // sum_{i=1}^{N} w_{<8'>} | |
7978 | ||
7979 | // product of weights for reduced correlation: | |
7980 | Double_t productOfWeightsForTwoTwoReduced = 0.; // sum_{i=1}^{N} w_{<2>}w_{<2'>} | |
7981 | Double_t productOfWeightsForTwoFourReduced = 0.; // sum_{i=1}^{N} w_{<2>}w_{<4'>} | |
7982 | Double_t productOfWeightsForFourTwoReduced = 0.; // sum_{i=1}^{N} w_{<4>}w_{<2'>} | |
7983 | Double_t productOfWeightsForFourFourReduced = 0.; // sum_{i=1}^{N} w_{<4>}w_{<4'>} | |
7984 | Double_t productOfWeightsForTwoReducedFourReduced = 0.; // sum_{i=1}^{N} w_{<2'>}w_{<4'>} | |
7985 | // ... | |
7986 | ||
7987 | // products for differential flow: | |
7988 | Double_t twoTwoReduced = 0; // <<2><2'>> | |
7989 | Double_t twoFourReduced = 0; // <<2><4'>> | |
7990 | Double_t fourTwoReduced = 0; // <<4><2'>> | |
7991 | Double_t fourFourReduced = 0; // <<4><4'>> | |
7992 | Double_t twoReducedFourReduced = 0; // <<2'><4'>> | |
7993 | ||
7994 | // denominators in the expressions for the unbiased estimators for covariances: | |
7995 | // denominator = 1 - term1/(term2*term3) | |
7996 | // prefactor = term1/(term2*term3) | |
7997 | Double_t denominator = 0.; | |
7998 | Double_t prefactor = 0.; | |
7999 | Double_t term1 = 0.; | |
8000 | Double_t term2 = 0.; | |
8001 | Double_t term3 = 0.; | |
8002 | ||
8003 | // unbiased estimators for covariances for differential flow: | |
8004 | Double_t covTwoTwoReduced = 0.; // Cov(<2>,<2'>) | |
8005 | Double_t wCovTwoTwoReduced = 0.; // Cov(<2>,<2'>) * prefactor(w_{<2>},w_{<2'>}) | |
8006 | Double_t covTwoFourReduced = 0.; // Cov(<2>,<4'>) | |
8007 | Double_t wCovTwoFourReduced = 0.; // Cov(<2>,<4'>) * prefactor(w_{<2>},w_{<4'>}) | |
8008 | Double_t covFourTwoReduced = 0.; // Cov(<4>,<2'>) | |
8009 | Double_t wCovFourTwoReduced = 0.; // Cov(<4>,<2'>) * prefactor(w_{<4>},w_{<2'>}) | |
8010 | Double_t covFourFourReduced = 0.; // Cov(<4>,<4'>) | |
8011 | Double_t wCovFourFourReduced = 0.; // Cov(<4>,<4'>) * prefactor(w_{<4>},w_{<4'>}) | |
8012 | Double_t covTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) | |
8013 | Double_t wCovTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) * prefactor(w_{<2'>},w_{<4'>}) | |
8014 | ||
8015 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
8016 | { | |
8017 | // average reduced corelations: | |
8018 | twoReduced = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); | |
8019 | fourReduced = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); | |
8020 | // average products: | |
8021 | twoTwoReduced = fDiffFlowProductOfCorrelationsPro[t][pe][0][1]->GetBinContent(b); | |
8022 | twoFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][0][3]->GetBinContent(b); | |
8023 | fourTwoReduced = fDiffFlowProductOfCorrelationsPro[t][pe][1][2]->GetBinContent(b); | |
8024 | fourFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][2][3]->GetBinContent(b); | |
8025 | twoReducedFourReduced = fDiffFlowProductOfCorrelationsPro[t][pe][1][3]->GetBinContent(b); | |
8026 | // sum of weights for reduced correlations: | |
8027 | sumOfWeightsForTwoReduced = fDiffFlowSumOfEventWeights[t][pe][0][0]->GetBinContent(b); | |
8028 | sumOfWeightsForFourReduced = fDiffFlowSumOfEventWeights[t][pe][0][1]->GetBinContent(b); | |
8029 | // products of weights for correlations: | |
8030 | productOfWeightsForTwoTwoReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][0][1]->GetBinContent(b); | |
8031 | productOfWeightsForTwoFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][0][3]->GetBinContent(b); | |
8032 | productOfWeightsForFourTwoReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][1][2]->GetBinContent(b); | |
8033 | productOfWeightsForFourFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][2][3]->GetBinContent(b); | |
8034 | productOfWeightsForTwoReducedFourReduced = fDiffFlowSumOfProductOfEventWeights[t][pe][1][3]->GetBinContent(b); | |
8035 | // denominator for the unbiased estimator for covariances: 1 - term1/(term2*term3) | |
8036 | // prefactor (multiplies Cov's) = term1/(term2*term3) | |
8037 | // <2>,<2'>: | |
8038 | term1 = productOfWeightsForTwoTwoReduced; | |
8039 | term2 = sumOfWeightsForTwo; | |
8040 | term3 = sumOfWeightsForTwoReduced; | |
8041 | if(term2*term3>0.) | |
8042 | { | |
8043 | denominator = 1.-term1/(term2*term3); | |
8044 | prefactor = term1/(term2*term3); | |
1268c371 | 8045 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 8046 | { |
8047 | covTwoTwoReduced = (twoTwoReduced-two*twoReduced)/denominator; | |
8048 | wCovTwoTwoReduced = covTwoTwoReduced*prefactor; | |
8049 | fDiffFlowCovariances[t][pe][0]->SetBinContent(b,wCovTwoTwoReduced); | |
8050 | } | |
8051 | } | |
8052 | // <2>,<4'>: | |
8053 | term1 = productOfWeightsForTwoFourReduced; | |
8054 | term2 = sumOfWeightsForTwo; | |
8055 | term3 = sumOfWeightsForFourReduced; | |
8056 | if(term2*term3>0.) | |
8057 | { | |
8058 | denominator = 1.-term1/(term2*term3); | |
8059 | prefactor = term1/(term2*term3); | |
1268c371 | 8060 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 8061 | { |
8062 | covTwoFourReduced = (twoFourReduced-two*fourReduced)/denominator; | |
8063 | wCovTwoFourReduced = covTwoFourReduced*prefactor; | |
8064 | fDiffFlowCovariances[t][pe][1]->SetBinContent(b,wCovTwoFourReduced); | |
8065 | } | |
8066 | } | |
8067 | // <4>,<2'>: | |
8068 | term1 = productOfWeightsForFourTwoReduced; | |
8069 | term2 = sumOfWeightsForFour; | |
8070 | term3 = sumOfWeightsForTwoReduced; | |
8071 | if(term2*term3>0.) | |
8072 | { | |
8073 | denominator = 1.-term1/(term2*term3); | |
8074 | prefactor = term1/(term2*term3); | |
1268c371 | 8075 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 8076 | { |
8077 | covFourTwoReduced = (fourTwoReduced-four*twoReduced)/denominator; | |
8078 | wCovFourTwoReduced = covFourTwoReduced*prefactor; | |
8079 | fDiffFlowCovariances[t][pe][2]->SetBinContent(b,wCovFourTwoReduced); | |
8080 | } | |
8081 | } | |
8082 | // <4>,<4'>: | |
8083 | term1 = productOfWeightsForFourFourReduced; | |
8084 | term2 = sumOfWeightsForFour; | |
8085 | term3 = sumOfWeightsForFourReduced; | |
8086 | if(term2*term3>0.) | |
8087 | { | |
8088 | denominator = 1.-term1/(term2*term3); | |
8089 | prefactor = term1/(term2*term3); | |
1268c371 | 8090 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 8091 | { |
8092 | covFourFourReduced = (fourFourReduced-four*fourReduced)/denominator; | |
8093 | wCovFourFourReduced = covFourFourReduced*prefactor; | |
8094 | fDiffFlowCovariances[t][pe][3]->SetBinContent(b,wCovFourFourReduced); | |
8095 | } | |
8096 | } | |
8097 | // <2'>,<4'>: | |
8098 | term1 = productOfWeightsForTwoReducedFourReduced; | |
8099 | term2 = sumOfWeightsForTwoReduced; | |
8100 | term3 = sumOfWeightsForFourReduced; | |
8101 | if(term2*term3>0.) | |
8102 | { | |
8103 | denominator = 1.-term1/(term2*term3); | |
8104 | prefactor = term1/(term2*term3); | |
1268c371 | 8105 | if(TMath::Abs(denominator)>1.e-6) |
489d5531 | 8106 | { |
8107 | covTwoReducedFourReduced = (twoReducedFourReduced-twoReduced*fourReduced)/denominator; | |
8108 | wCovTwoReducedFourReduced = covTwoReducedFourReduced*prefactor; | |
8109 | fDiffFlowCovariances[t][pe][4]->SetBinContent(b,wCovTwoReducedFourReduced); | |
8110 | } | |
8111 | } | |
8112 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
8113 | ||
8114 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCovariances(TString type, TString ptOrEta) | |
8115 | ||
489d5531 | 8116 | //================================================================================================================================ |
8117 | ||
489d5531 | 8118 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, TString ptOrEta) |
8119 | { | |
1268c371 | 8120 | // Calculate final results for differential flow. |
489d5531 | 8121 | |
1268c371 | 8122 | // REMARK: Differential flow calculated in this method is NOT corrected for non-uniform acceptance. |
8123 | // This correction, if enabled via setter SetApplyCorrectionForNUA(Bool_t), is applied in the method | |
8124 | // CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta) | |
8125 | ||
8126 | Int_t t = 0; // RP or POI | |
8127 | Int_t pe = 0; // pt or eta | |
489d5531 | 8128 | |
8129 | if(type == "RP") | |
8130 | { | |
1268c371 | 8131 | t = 0; |
489d5531 | 8132 | } else if(type == "POI") |
8133 | { | |
1268c371 | 8134 | t = 1; |
489d5531 | 8135 | } |
8136 | ||
8137 | if(ptOrEta == "Pt") | |
8138 | { | |
1268c371 | 8139 | pe = 0; |
489d5531 | 8140 | } else if(ptOrEta == "Eta") |
8141 | { | |
1268c371 | 8142 | pe = 1; |
489d5531 | 8143 | } |
1268c371 | 8144 | |
8145 | // Common: | |
489d5531 | 8146 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
1268c371 | 8147 | // Correlations: |
489d5531 | 8148 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> |
1268c371 | 8149 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> |
8150 | // Statistical errors of correlations: | |
489d5531 | 8151 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); |
8152 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); | |
1268c371 | 8153 | // Reduced correlations: |
489d5531 | 8154 | Double_t twoReduced = 0.; // <<2'>> |
8155 | Double_t fourReduced = 0.; // <<4'>> | |
1268c371 | 8156 | // Statistical errors of reduced correlations: |
489d5531 | 8157 | Double_t twoReducedError = 0.; |
8158 | Double_t fourReducedError = 0.; | |
1268c371 | 8159 | // Covariances: |
8e1cefdd | 8160 | Double_t wCovTwoFour = 0.; // Cov(<2>,<4>) * prefactor(<2>,<4>) |
8161 | if(!fForgetAboutCovariances) | |
8162 | { | |
8163 | wCovTwoFour = fIntFlowCovariances->GetBinContent(1); // Cov(<2>,<4>) * prefactor(<2>,<4>) | |
8164 | } | |
489d5531 | 8165 | Double_t wCovTwoTwoReduced = 0.; // Cov(<2>,<2'>) * prefactor(<2>,<2'>) |
8166 | Double_t wCovTwoFourReduced = 0.; // Cov(<2>,<4'>) * prefactor(<2>,<4'>) | |
8167 | Double_t wCovFourTwoReduced = 0.; // Cov(<4>,<2'>) * prefactor(<4>,<2'>) | |
8168 | Double_t wCovFourFourReduced = 0.; // Cov(<4>,<4'>) * prefactor(<4>,<4'>) | |
8169 | Double_t wCovTwoReducedFourReduced = 0.; // Cov(<2'>,<4'>) * prefactor(<2'>,<4'>) | |
1268c371 | 8170 | // Differential flow: |
489d5531 | 8171 | Double_t v2Prime = 0.; // v'{2} |
8172 | Double_t v4Prime = 0.; // v'{4} | |
1268c371 | 8173 | // Statistical error of differential flow: |
489d5531 | 8174 | Double_t v2PrimeError = 0.; |
8175 | Double_t v4PrimeError = 0.; | |
1268c371 | 8176 | // Squared statistical error of differential flow: |
489d5531 | 8177 | Double_t v2PrimeErrorSquared = 0.; |
8178 | Double_t v4PrimeErrorSquared = 0.; | |
1268c371 | 8179 | // Loop over pt or eta bins: |
489d5531 | 8180 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) |
8181 | { | |
1268c371 | 8182 | // Reduced correlations and statistical errors: |
489d5531 | 8183 | twoReduced = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); |
8184 | twoReducedError = fDiffFlowCorrelationsHist[t][pe][0]->GetBinError(b); | |
8185 | fourReduced = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); | |
8186 | fourReducedError = fDiffFlowCorrelationsHist[t][pe][1]->GetBinError(b); | |
1268c371 | 8187 | // Covariances: |
8e1cefdd | 8188 | if(!fForgetAboutCovariances) |
8189 | { | |
8190 | wCovTwoTwoReduced = fDiffFlowCovariances[t][pe][0]->GetBinContent(b); | |
8191 | wCovTwoFourReduced = fDiffFlowCovariances[t][pe][1]->GetBinContent(b); | |
8192 | wCovFourTwoReduced = fDiffFlowCovariances[t][pe][2]->GetBinContent(b); | |
8193 | wCovFourFourReduced = fDiffFlowCovariances[t][pe][3]->GetBinContent(b); | |
8194 | wCovTwoReducedFourReduced = fDiffFlowCovariances[t][pe][4]->GetBinContent(b); | |
8195 | } | |
1268c371 | 8196 | // Differential flow: |
489d5531 | 8197 | // v'{2}: |
8198 | if(two>0.) | |
8199 | { | |
8200 | v2Prime = twoReduced/pow(two,0.5); | |
1268c371 | 8201 | v2PrimeErrorSquared = (1./4.)*pow(two,-3.)*(pow(twoReduced,2.)*pow(twoError,2.) |
8202 | + 4.*pow(two,2.)*pow(twoReducedError,2.) | |
8203 | - 4.*two*twoReduced*wCovTwoTwoReduced); | |
8204 | if(v2PrimeErrorSquared>0.){v2PrimeError = pow(v2PrimeErrorSquared,0.5);} | |
8205 | if(TMath::Abs(v2Prime)>0.) | |
8206 | { | |
8207 | fDiffFlow[t][pe][0]->SetBinContent(b,v2Prime); | |
8208 | fDiffFlow[t][pe][0]->SetBinError(b,v2PrimeError); | |
8209 | } | |
8210 | } // end of if(two>0.) | |
489d5531 | 8211 | // differential flow: |
8212 | // v'{4} | |
8213 | if(2.*pow(two,2.)-four > 0.) | |
8214 | { | |
8215 | v4Prime = (2.*two*twoReduced-fourReduced)/pow(2.*pow(two,2.)-four,3./4.); | |
1268c371 | 8216 | v4PrimeErrorSquared = pow(2.*pow(two,2.)-four,-7./2.) |
8217 | * (pow(2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced,2.)*pow(twoError,2.) | |
8218 | + (9./16.)*pow(2.*two*twoReduced-fourReduced,2.)*pow(fourError,2.) | |
8219 | + 4.*pow(two,2.)*pow(2.*pow(two,2.)-four,2.)*pow(twoReducedError,2.) | |
8220 | + pow(2.*pow(two,2.)-four,2.)*pow(fourReducedError,2.) | |
8221 | - (3./2.)*(2.*two*twoReduced-fourReduced) | |
8222 | * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoFour | |
8223 | - 4.*two*(2.*pow(two,2.)-four) | |
8224 | * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoTwoReduced | |
8225 | + 2.*(2.*pow(two,2.)-four) | |
8226 | * (2.*pow(two,2.)*twoReduced-3.*two*fourReduced+2.*four*twoReduced)*wCovTwoFourReduced | |
8227 | + 3.*two*(2.*pow(two,2.)-four)*(2.*two*twoReduced-fourReduced)*wCovFourTwoReduced | |
8228 | - (3./2.)*(2.*pow(two,2.)-four)*(2.*two*twoReduced-fourReduced)*wCovFourFourReduced | |
8229 | - 4.*two*pow(2.*pow(two,2.)-four,2.)*wCovTwoReducedFourReduced); | |
8230 | if(v4PrimeErrorSquared>0.){v4PrimeError = pow(v4PrimeErrorSquared,0.5);} | |
8231 | if(TMath::Abs(v4Prime)>0.) | |
8232 | { | |
8233 | fDiffFlow[t][pe][1]->SetBinContent(b,v4Prime); | |
8234 | fDiffFlow[t][pe][1]->SetBinError(b,v4PrimeError); | |
8235 | } | |
8236 | } // end of if(2.*pow(two,2.)-four > 0.) | |
489d5531 | 8237 | } // end of for(Int_t b=1;b<=fnBinsPtEta[pe];b++) |
1268c371 | 8238 | |
8239 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlow(TString type, Bool_t useParticleWeights) | |
8240 | ||
8241 | //================================================================================================================================ | |
8242 | ||
8243 | void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlow(TString type) | |
8244 | { | |
8245 | // Calculate final results for 2D diferential flow. | |
8246 | ||
8247 | // to be improved - check pointers used in this method | |
8248 | ||
8249 | Int_t t = 0; // RP or POI | |
8250 | ||
8251 | if(type == "RP") | |
8252 | { | |
8253 | t = 0; | |
8254 | } else if(type == "POI") | |
8255 | { | |
8256 | t = 1; | |
8257 | } | |
489d5531 | 8258 | |
1268c371 | 8259 | // Differential flow: |
8260 | Double_t v2Prime = 0.; // v'{2} | |
8261 | Double_t v4Prime = 0.; // v'{4} | |
8262 | // Differential cumulants: | |
8263 | Double_t qc2Prime = 0.; // QC{2'} | |
8264 | Double_t qc4Prime = 0.; // QC{4'} | |
8265 | // Looping over all (pt,eta) bins and calculating differential flow: | |
8266 | for(Int_t p=1;p<=fnBinsPt;p++) | |
489d5531 | 8267 | { |
1268c371 | 8268 | for(Int_t e=1;e<=fnBinsEta;e++) |
489d5531 | 8269 | { |
1268c371 | 8270 | // QC{2'}: |
8271 | qc2Prime = f2DDiffFlowCumulants[t][0]->GetBinContent(f2DDiffFlowCumulants[t][0]->GetBin(p,e)); | |
8272 | if(qc2Prime>=0.) | |
8273 | { | |
8274 | v2Prime = pow(qc2Prime,0.5); | |
8275 | f2DDiffFlow[t][0]->SetBinContent(f2DDiffFlow[t][0]->GetBin(p,e),v2Prime); | |
8276 | } | |
8277 | // QC{4'}: | |
8278 | qc4Prime = f2DDiffFlowCumulants[t][1]->GetBinContent(f2DDiffFlowCumulants[t][1]->GetBin(p,e)); | |
8279 | if(qc4Prime<=0.) | |
8280 | { | |
8281 | v4Prime = pow(-1.*qc4Prime,1./4.); | |
8282 | f2DDiffFlow[t][1]->SetBinContent(f2DDiffFlow[t][1]->GetBin(p,e),v4Prime); | |
8283 | } | |
8284 | } // end of for(Int_t e=1;e<=fnBinsEta;e++) | |
8285 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) | |
8286 | ||
8287 | } // end of void AliFlowAnalysisWithQCumulants::Calculate2DDiffFlow(TString type) | |
489d5531 | 8288 | |
489d5531 | 8289 | //================================================================================================================================ |
8290 | ||
489d5531 | 8291 | void AliFlowAnalysisWithQCumulants::StoreIntFlowFlags() |
8292 | { | |
8293 | // a) Store all flags for integrated flow in profile fIntFlowFlags. | |
8294 | ||
8295 | if(!fIntFlowFlags) | |
8296 | { | |
8297 | cout<<"WARNING: fIntFlowFlags is NULL in AFAWQC::SFFIF() !!!!"<<endl; | |
8298 | exit(0); | |
8299 | } | |
8300 | ||
8301 | // particle weights used or not: | |
403e3389 | 8302 | fIntFlowFlags->Fill(0.5,(Int_t)fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights); |
489d5531 | 8303 | // which event weights were used: |
8304 | if(strcmp(fMultiplicityWeight->Data(),"combinations")) | |
8305 | { | |
8306 | fIntFlowFlags->Fill(1.5,0); // 0 = "combinations" (default) | |
8307 | } else if(strcmp(fMultiplicityWeight->Data(),"unit")) | |
8308 | { | |
8309 | fIntFlowFlags->Fill(1.5,1); // 1 = "unit" | |
8310 | } else if(strcmp(fMultiplicityWeight->Data(),"multiplicity")) | |
8311 | { | |
8312 | fIntFlowFlags->Fill(1.5,2); // 2 = "multiplicity" | |
8313 | } | |
489d5531 | 8314 | fIntFlowFlags->Fill(2.5,(Int_t)fApplyCorrectionForNUA); |
8315 | fIntFlowFlags->Fill(3.5,(Int_t)fPrintFinalResults[0]); | |
8316 | fIntFlowFlags->Fill(4.5,(Int_t)fPrintFinalResults[1]); | |
8317 | fIntFlowFlags->Fill(5.5,(Int_t)fPrintFinalResults[2]); | |
b3dacf6b | 8318 | fIntFlowFlags->Fill(6.5,(Int_t)fPrintFinalResults[3]); |
8319 | fIntFlowFlags->Fill(7.5,(Int_t)fApplyCorrectionForNUAVsM); | |
b77b6434 | 8320 | fIntFlowFlags->Fill(8.5,(Int_t)fPropagateErrorAlsoFromNIT); |
b3dacf6b | 8321 | fIntFlowFlags->Fill(9.5,(Int_t)fCalculateCumulantsVsM); |
0dd3b008 | 8322 | fIntFlowFlags->Fill(10.5,(Int_t)fMinimumBiasReferenceFlow); |
8e1cefdd | 8323 | fIntFlowFlags->Fill(11.5,(Int_t)fForgetAboutCovariances); |
e5834fcb | 8324 | fIntFlowFlags->Fill(12.5,(Int_t)fStorePhiDistributionForOneEvent); |
dd442cd2 | 8325 | fIntFlowFlags->Fill(13.5,(Int_t)fFillMultipleControlHistograms); |
3435cacb | 8326 | fIntFlowFlags->Fill(14.5,(Int_t)fCalculateAllCorrelationsVsM); |
489d5531 | 8327 | } // end of void AliFlowAnalysisWithQCumulants::StoreIntFlowFlags() |
8328 | ||
489d5531 | 8329 | //================================================================================================================================ |
8330 | ||
489d5531 | 8331 | void AliFlowAnalysisWithQCumulants::StoreDiffFlowFlags() |
8332 | { | |
8333 | // Store all flags for differential flow in the profile fDiffFlowFlags. | |
8334 | ||
8335 | if(!fDiffFlowFlags) | |
8336 | { | |
1268c371 | 8337 | printf("\n WARNING (QC): fDiffFlowFlags is NULL in AFAWQC::SDFF() !!!!\n\n"); |
489d5531 | 8338 | exit(0); |
8339 | } | |
8340 | ||
1268c371 | 8341 | fDiffFlowFlags->Fill(0.5,fCalculateDiffFlow); // calculate differential flow |
403e3389 | 8342 | fDiffFlowFlags->Fill(1.5,fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights); // particle weights used or not? |
1268c371 | 8343 | //fDiffFlowFlags->Fill(2.5,""); // which event weight was used? ("combinations", "unit" or "multiplicity") to be improved - finalized |
8344 | fDiffFlowFlags->Fill(3.5,fApplyCorrectionForNUA); // corrected for non-uniform acceptance or not | |
8345 | fDiffFlowFlags->Fill(4.5,fCalculate2DDiffFlow); // calculate also 2D differential flow vs (pt,eta) | |
62e36168 | 8346 | fDiffFlowFlags->Fill(5.5,fCalculateDiffFlowVsEta); // if you set kFALSE only differential flow vs pt is calculated |
1268c371 | 8347 | |
489d5531 | 8348 | } // end of void AliFlowAnalysisWithQCumulants::StoreDiffFlowFlags() |
8349 | ||
489d5531 | 8350 | //================================================================================================================================ |
8351 | ||
489d5531 | 8352 | void AliFlowAnalysisWithQCumulants::GetPointersForCommonHistograms() |
8353 | { | |
8354 | // Access all pointers to common control and common result histograms and profiles. | |
8355 | ||
1268c371 | 8356 | TString sCommonConstantsName = "fCommonConstants"; |
8357 | sCommonConstantsName += fAnalysisLabel->Data(); | |
8358 | fCommonConstants = dynamic_cast<TProfile*>(fHistList->FindObject(sCommonConstantsName.Data())); | |
8359 | if(!fCommonConstants) | |
8360 | { | |
8361 | printf("\n WARNING (QC): fCommonConstants is NULL in AFAWQC::GPFCH() !!!!\n\n"); | |
8362 | exit(0); | |
8363 | } | |
8364 | ||
8365 | // to be improved - lines bellow can be implemented better. | |
8366 | ||
489d5531 | 8367 | TString commonHistsName = "AliFlowCommonHistQC"; |
8368 | commonHistsName += fAnalysisLabel->Data(); | |
8369 | AliFlowCommonHist *commonHist = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHistsName.Data())); | |
b77b6434 | 8370 | if(commonHist) |
8371 | { | |
8372 | this->SetCommonHists(commonHist); | |
8373 | if(fCommonHists->GetHarmonic()) | |
8374 | { | |
8375 | fHarmonic = (Int_t)(fCommonHists->GetHarmonic())->GetBinContent(1); | |
8376 | } | |
8377 | } // end of if(commonHist) | |
489d5531 | 8378 | TString commonHists2ndOrderName = "AliFlowCommonHist2ndOrderQC"; |
8379 | commonHists2ndOrderName += fAnalysisLabel->Data(); | |
8380 | AliFlowCommonHist *commonHist2nd = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists2ndOrderName.Data())); | |
8381 | if(commonHist2nd) this->SetCommonHists2nd(commonHist2nd); | |
8382 | TString commonHists4thOrderName = "AliFlowCommonHist4thOrderQC"; | |
8383 | commonHists4thOrderName += fAnalysisLabel->Data(); | |
8384 | AliFlowCommonHist *commonHist4th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists4thOrderName.Data())); | |
8385 | if(commonHist4th) this->SetCommonHists4th(commonHist4th); | |
8386 | TString commonHists6thOrderName = "AliFlowCommonHist6thOrderQC"; | |
8387 | commonHists6thOrderName += fAnalysisLabel->Data(); | |
8388 | AliFlowCommonHist *commonHist6th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists6thOrderName.Data())); | |
8389 | if(commonHist6th) this->SetCommonHists6th(commonHist6th); | |
8390 | TString commonHists8thOrderName = "AliFlowCommonHist8thOrderQC"; | |
8391 | commonHists8thOrderName += fAnalysisLabel->Data(); | |
8392 | AliFlowCommonHist *commonHist8th = dynamic_cast<AliFlowCommonHist*>(fHistList->FindObject(commonHists8thOrderName.Data())); | |
dd442cd2 | 8393 | if(commonHist8th) this->SetCommonHists8th(commonHist8th); |
8394 | ||
489d5531 | 8395 | TString commonHistResults2ndOrderName = "AliFlowCommonHistResults2ndOrderQC"; |
8396 | commonHistResults2ndOrderName += fAnalysisLabel->Data(); | |
b77b6434 | 8397 | AliFlowCommonHistResults *commonHistRes2nd = dynamic_cast<AliFlowCommonHistResults*> |
8398 | (fHistList->FindObject(commonHistResults2ndOrderName.Data())); | |
489d5531 | 8399 | if(commonHistRes2nd) this->SetCommonHistsResults2nd(commonHistRes2nd); |
8400 | TString commonHistResults4thOrderName = "AliFlowCommonHistResults4thOrderQC"; | |
8401 | commonHistResults4thOrderName += fAnalysisLabel->Data(); | |
8402 | AliFlowCommonHistResults *commonHistRes4th = dynamic_cast<AliFlowCommonHistResults*> | |
8403 | (fHistList->FindObject(commonHistResults4thOrderName.Data())); | |
8404 | if(commonHistRes4th) this->SetCommonHistsResults4th(commonHistRes4th); | |
8405 | TString commonHistResults6thOrderName = "AliFlowCommonHistResults6thOrderQC"; | |
8406 | commonHistResults6thOrderName += fAnalysisLabel->Data(); | |
8407 | AliFlowCommonHistResults *commonHistRes6th = dynamic_cast<AliFlowCommonHistResults*> | |
8408 | (fHistList->FindObject(commonHistResults6thOrderName.Data())); | |
8409 | if(commonHistRes6th) this->SetCommonHistsResults6th(commonHistRes6th); | |
8410 | TString commonHistResults8thOrderName = "AliFlowCommonHistResults8thOrderQC"; | |
8411 | commonHistResults8thOrderName += fAnalysisLabel->Data(); | |
8412 | AliFlowCommonHistResults *commonHistRes8th = dynamic_cast<AliFlowCommonHistResults*> | |
8413 | (fHistList->FindObject(commonHistResults8thOrderName.Data())); | |
8414 | if(commonHistRes8th) this->SetCommonHistsResults8th(commonHistRes8th); | |
8415 | ||
8416 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForCommonHistograms() | |
8417 | ||
489d5531 | 8418 | //================================================================================================================================ |
8419 | ||
489d5531 | 8420 | void AliFlowAnalysisWithQCumulants::GetPointersForParticleWeightsHistograms() |
8421 | { | |
8422 | // Get pointers for histograms with particle weights. | |
8423 | ||
8424 | TList *weightsList = dynamic_cast<TList*>(fHistList->FindObject("Weights")); | |
ca5f47e7 | 8425 | if(!weightsList){printf("\n WARNING (QC): weightsList is NULL in AFAWQC::GPFPWH() !!!!\n");exit(0);} |
8426 | this->SetWeightsList(weightsList); | |
489d5531 | 8427 | TString fUseParticleWeightsName = "fUseParticleWeightsQC"; // to be improved (hirdwired label QC) |
8428 | fUseParticleWeightsName += fAnalysisLabel->Data(); | |
8429 | TProfile *useParticleWeights = dynamic_cast<TProfile*>(weightsList->FindObject(fUseParticleWeightsName.Data())); | |
8430 | if(useParticleWeights) | |
8431 | { | |
8432 | this->SetUseParticleWeights(useParticleWeights); | |
8433 | fUsePhiWeights = (Int_t)fUseParticleWeights->GetBinContent(1); | |
8434 | fUsePtWeights = (Int_t)fUseParticleWeights->GetBinContent(2); | |
8435 | fUseEtaWeights = (Int_t)fUseParticleWeights->GetBinContent(3); | |
403e3389 | 8436 | fUseTrackWeights = (Int_t)fUseParticleWeights->GetBinContent(4); |
489d5531 | 8437 | } |
8438 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForParticleWeightsHistograms(); | |
8439 | ||
489d5531 | 8440 | //================================================================================================================================ |
8441 | ||
489d5531 | 8442 | void AliFlowAnalysisWithQCumulants::GetPointersForIntFlowHistograms() |
8443 | { | |
8444 | // Get pointers for histograms and profiles relevant for integrated flow: | |
8445 | // a) Get pointer to base list for integrated flow holding profile fIntFlowFlags and lists fIntFlowProfiles and fIntFlowResults. | |
8446 | // b) Get pointer to profile fIntFlowFlags holding all flags for integrated flow. | |
8447 | // c) Get pointer to list fIntFlowProfiles and pointers to all objects that she holds. | |
8448 | // d) Get pointer to list fIntFlowResults and pointers to all objects that she holds. | |
8449 | ||
8450 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data member?) | |
8451 | TString powerFlag[2] = {"linear","quadratic"}; // to be improved (should I promote this to data member?) | |
b40a910e | 8452 | TString correlationFlag[4] = {"#LT#LT2#GT#GT","#LT#LT4#GT#GT","#LT#LT6#GT#GT","#LT#LT8#GT#GT"}; // to be improved (should I promote this to data member?) |
8453 | TString squaredCorrelationFlag[4] = {"#LT#LT2#GT^{2}#GT","#LT#LT4#GT^{2}#GT","#LT#LT6#GT^{2}#GT","#LT#LT8#GT^{2}#GT"}; // to be improved (should I promote this to data member?) | |
489d5531 | 8454 | |
8455 | // a) Get pointer to base list for integrated flow holding profile fIntFlowFlags and lists fIntFlowProfiles and fIntFlowResults: | |
8456 | TList *intFlowList = NULL; | |
8457 | intFlowList = dynamic_cast<TList*>(fHistList->FindObject("Integrated Flow")); | |
8458 | if(!intFlowList) | |
8459 | { | |
8460 | cout<<"WARNING: intFlowList is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8461 | exit(0); | |
8462 | } | |
8463 | ||
b92ea2b9 | 8464 | // b) Get pointer to profile fIntFlowFlags holding all flags for integrated flow: |
8465 | TString intFlowFlagsName = "fIntFlowFlags"; | |
8466 | intFlowFlagsName += fAnalysisLabel->Data(); | |
8467 | TProfile *intFlowFlags = dynamic_cast<TProfile*>(intFlowList->FindObject(intFlowFlagsName.Data())); | |
8468 | if(intFlowFlags) | |
8469 | { | |
8470 | this->SetIntFlowFlags(intFlowFlags); | |
8471 | fApplyCorrectionForNUA = (Bool_t)intFlowFlags->GetBinContent(3); | |
8472 | fApplyCorrectionForNUAVsM = (Bool_t)intFlowFlags->GetBinContent(8); | |
8473 | fCalculateCumulantsVsM = (Bool_t)intFlowFlags->GetBinContent(10); | |
8474 | } else | |
8475 | { | |
8476 | cout<<"WARNING: intFlowFlags is NULL in FAWQC::GPFIFH() !!!!"<<endl; | |
8477 | } | |
489d5531 | 8478 | |
8479 | // c) Get pointer to list fIntFlowProfiles and pointers to all objects that she holds: | |
8480 | TList *intFlowProfiles = NULL; | |
8481 | intFlowProfiles = dynamic_cast<TList*>(intFlowList->FindObject("Profiles")); | |
8482 | if(intFlowProfiles) | |
8483 | { | |
8484 | // average multiplicities: | |
8485 | TString avMultiplicityName = "fAvMultiplicity"; | |
8486 | avMultiplicityName += fAnalysisLabel->Data(); | |
8487 | TProfile *avMultiplicity = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(avMultiplicityName.Data())); | |
8488 | if(avMultiplicity) | |
8489 | { | |
8490 | this->SetAvMultiplicity(avMultiplicity); | |
8491 | } else | |
8492 | { | |
8493 | cout<<"WARNING: avMultiplicity is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8494 | } | |
8495 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with wrong errors!): | |
8496 | TString intFlowCorrelationsProName = "fIntFlowCorrelationsPro"; | |
8497 | intFlowCorrelationsProName += fAnalysisLabel->Data(); | |
8498 | TProfile *intFlowCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowCorrelationsProName.Data())); | |
8499 | if(intFlowCorrelationsPro) | |
8500 | { | |
8501 | this->SetIntFlowCorrelationsPro(intFlowCorrelationsPro); | |
8502 | } else | |
8503 | { | |
8504 | cout<<"WARNING: intFlowCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
ff70ca91 | 8505 | } |
b40a910e | 8506 | // average squared correlations <<2>^2>, <<4>^2>, <<6>^2> and <<8^2>>: |
8507 | TString intFlowSquaredCorrelationsProName = "fIntFlowSquaredCorrelationsPro"; | |
8508 | intFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
8509 | TProfile *intFlowSquaredCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowSquaredCorrelationsProName.Data())); | |
8510 | if(intFlowSquaredCorrelationsPro) | |
8511 | { | |
8512 | this->SetIntFlowSquaredCorrelationsPro(intFlowSquaredCorrelationsPro); | |
8513 | } else | |
8514 | { | |
8515 | cout<<"WARNING: intFlowSquaredCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8516 | } | |
b3dacf6b | 8517 | if(fCalculateCumulantsVsM) |
ff70ca91 | 8518 | { |
b40a910e | 8519 | // Average correlations <<2>>, <<4>>, <<6>> and <<8>> versus multiplicity for all events (error is wrong here): |
b3dacf6b | 8520 | TString intFlowCorrelationsVsMProName = "fIntFlowCorrelationsVsMPro"; |
8521 | intFlowCorrelationsVsMProName += fAnalysisLabel->Data(); | |
8522 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
ff70ca91 | 8523 | { |
b3dacf6b | 8524 | TProfile *intFlowCorrelationsVsMPro = dynamic_cast<TProfile*> |
8525 | (intFlowProfiles->FindObject(Form("%s, %s",intFlowCorrelationsVsMProName.Data(),correlationFlag[ci].Data()))); | |
8526 | if(intFlowCorrelationsVsMPro) | |
8527 | { | |
8528 | this->SetIntFlowCorrelationsVsMPro(intFlowCorrelationsVsMPro,ci); | |
8529 | } else | |
8530 | { | |
8531 | cout<<"WARNING: "<<Form("intFlowCorrelationsVsMPro[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8532 | } | |
8533 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
b40a910e | 8534 | // Average squared correlations <<2>^2>, <<4>^2>, <<6>^2> and <<8>^2> versus multiplicity for all events: |
8535 | TString intFlowSquaredCorrelationsVsMProName = "fIntFlowSquaredCorrelationsVsMPro"; | |
8536 | intFlowSquaredCorrelationsVsMProName += fAnalysisLabel->Data(); | |
8537 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
8538 | { | |
8539 | TProfile *intFlowSquaredCorrelationsVsMPro = dynamic_cast<TProfile*> | |
8540 | (intFlowProfiles->FindObject(Form("%s, %s",intFlowSquaredCorrelationsVsMProName.Data(),squaredCorrelationFlag[ci].Data()))); | |
8541 | if(intFlowSquaredCorrelationsVsMPro) | |
8542 | { | |
8543 | this->SetIntFlowSquaredCorrelationsVsMPro(intFlowSquaredCorrelationsVsMPro,ci); | |
8544 | } else | |
8545 | { | |
8546 | cout<<"WARNING: "<<Form("intFlowSquaredCorrelationsVsMPro[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8547 | } | |
8548 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
b3dacf6b | 8549 | } // end of if(fCalculateCumulantsVsM) |
489d5531 | 8550 | // average all correlations for integrated flow (with wrong errors!): |
8551 | TString intFlowCorrelationsAllProName = "fIntFlowCorrelationsAllPro"; | |
8552 | intFlowCorrelationsAllProName += fAnalysisLabel->Data(); | |
8553 | TProfile *intFlowCorrelationsAllPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowCorrelationsAllProName.Data())); | |
8554 | if(intFlowCorrelationsAllPro) | |
8555 | { | |
8556 | this->SetIntFlowCorrelationsAllPro(intFlowCorrelationsAllPro); | |
8557 | } else | |
8558 | { | |
8559 | cout<<"WARNING: intFlowCorrelationsAllPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8560 | } | |
8561 | // average extra correlations for integrated flow (which appear only when particle weights are used): | |
8562 | // (to be improved: Weak point in implementation, I am assuming here that method GetPointersForParticleWeightsHistograms() was called) | |
403e3389 | 8563 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 8564 | { |
8565 | TString intFlowExtraCorrelationsProName = "fIntFlowExtraCorrelationsPro"; | |
8566 | intFlowExtraCorrelationsProName += fAnalysisLabel->Data(); | |
8567 | TProfile *intFlowExtraCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowExtraCorrelationsProName.Data())); | |
8568 | if(intFlowExtraCorrelationsPro) | |
8569 | { | |
8570 | this->SetIntFlowExtraCorrelationsPro(intFlowExtraCorrelationsPro); | |
8571 | } else | |
8572 | { | |
8573 | cout<<"WARNING: intFlowExtraCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8574 | } | |
403e3389 | 8575 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 8576 | // average products of correlations <2>, <4>, <6> and <8>: |
8577 | TString intFlowProductOfCorrelationsProName = "fIntFlowProductOfCorrelationsPro"; | |
8578 | intFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
8579 | TProfile *intFlowProductOfCorrelationsPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowProductOfCorrelationsProName.Data())); | |
8580 | if(intFlowProductOfCorrelationsPro) | |
8581 | { | |
8582 | this->SetIntFlowProductOfCorrelationsPro(intFlowProductOfCorrelationsPro); | |
8583 | } else | |
8584 | { | |
8585 | cout<<"WARNING: intFlowProductOfCorrelationsPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
ff70ca91 | 8586 | } |
8587 | // average product of correlations <2>, <4>, <6> and <8> versus multiplicity | |
8588 | // [0=<<2><4>>,1=<<2><6>>,2=<<2><8>>,3=<<4><6>>,4=<<4><8>>,5=<<6><8>>] | |
b3dacf6b | 8589 | if(fCalculateCumulantsVsM) |
8590 | { | |
8591 | TString intFlowProductOfCorrelationsVsMProName = "fIntFlowProductOfCorrelationsVsMPro"; | |
8592 | intFlowProductOfCorrelationsVsMProName += fAnalysisLabel->Data(); | |
403e3389 | 8593 | TString productFlag[6] = {"#LT#LT2#GT#LT4#GT#GT","#LT#LT2#GT#LT6#GT#GT","#LT#LT2#GT#LT8#GT#GT", |
8594 | "#LT#LT4#GT#LT6#GT#GT","#LT#LT4#GT#LT8#GT#GT","#LT#LT6#GT#LT8#GT#GT"}; | |
b3dacf6b | 8595 | for(Int_t pi=0;pi<6;pi++) |
8596 | { | |
8597 | TProfile *intFlowProductOfCorrelationsVsMPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(Form("%s, %s",intFlowProductOfCorrelationsVsMProName.Data(),productFlag[pi].Data()))); | |
8598 | if(intFlowProductOfCorrelationsVsMPro) | |
8599 | { | |
8600 | this->SetIntFlowProductOfCorrelationsVsMPro(intFlowProductOfCorrelationsVsMPro,pi); | |
8601 | } else | |
8602 | { | |
8603 | cout<<"WARNING: "<<Form("intFlowProductOfCorrelationsVsMPro[%d]",pi)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8604 | } | |
8605 | } // end of for(Int_t pi=0;pi<6;pi++) | |
8606 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 8607 | // average correction terms for non-uniform acceptance (with wrong errors!): |
8608 | for(Int_t sc=0;sc<2;sc++) | |
8609 | { | |
8610 | TString intFlowCorrectionTermsForNUAProName = "fIntFlowCorrectionTermsForNUAPro"; | |
8611 | intFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
8612 | TProfile *intFlowCorrectionTermsForNUAPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject((Form("%s: %s terms",intFlowCorrectionTermsForNUAProName.Data(),sinCosFlag[sc].Data())))); | |
8613 | if(intFlowCorrectionTermsForNUAPro) | |
8614 | { | |
8615 | this->SetIntFlowCorrectionTermsForNUAPro(intFlowCorrectionTermsForNUAPro,sc); | |
8616 | } else | |
8617 | { | |
8618 | cout<<"WARNING: intFlowCorrectionTermsForNUAPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8619 | cout<<"sc = "<<sc<<endl; | |
8620 | } | |
2001bc3a | 8621 | // versus multiplicity: |
b3dacf6b | 8622 | if(fCalculateCumulantsVsM) |
2001bc3a | 8623 | { |
b3dacf6b | 8624 | TString correctionTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4 |
8625 | TString intFlowCorrectionTermsForNUAVsMProName = "fIntFlowCorrectionTermsForNUAVsMPro"; | |
8626 | intFlowCorrectionTermsForNUAVsMProName += fAnalysisLabel->Data(); | |
8627 | for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) | |
2001bc3a | 8628 | { |
b3dacf6b | 8629 | TProfile *intFlowCorrectionTermsForNUAVsMPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(Form("%s: #LT#LT%s%s#GT#GT",intFlowCorrectionTermsForNUAVsMProName.Data(),sinCosFlag[sc].Data(),correctionTermFlag[ci].Data()))); |
8630 | if(intFlowCorrectionTermsForNUAVsMPro) | |
8631 | { | |
8632 | this->SetIntFlowCorrectionTermsForNUAVsMPro(intFlowCorrectionTermsForNUAVsMPro,sc,ci); | |
8633 | } else | |
8634 | { | |
8635 | cout<<"WARNING: intFlowCorrectionTermsForNUAVsMPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8636 | cout<<"sc = "<<sc<<endl; | |
8637 | cout<<"ci = "<<ci<<endl; | |
8638 | } | |
8639 | } // end of for(Int_t ci=0;ci<4;ci++) // correction term index (to be improved - hardwired 4) | |
8640 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 8641 | } // end of for(Int_t sc=0;sc<2;sc++) |
0328db2d | 8642 | // average products of correction terms for NUA: |
8643 | TString intFlowProductOfCorrectionTermsForNUAProName = "fIntFlowProductOfCorrectionTermsForNUAPro"; | |
8644 | intFlowProductOfCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
8645 | TProfile *intFlowProductOfCorrectionTermsForNUAPro = dynamic_cast<TProfile*>(intFlowProfiles->FindObject(intFlowProductOfCorrectionTermsForNUAProName.Data())); | |
8646 | if(intFlowProductOfCorrectionTermsForNUAPro) | |
8647 | { | |
8648 | this->SetIntFlowProductOfCorrectionTermsForNUAPro(intFlowProductOfCorrectionTermsForNUAPro); | |
8649 | } else | |
8650 | { | |
8651 | cout<<"WARNING: intFlowProductOfCorrectionTermsForNUAPro is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8652 | } | |
489d5531 | 8653 | } else // to if(intFlowProfiles) |
8654 | { | |
8655 | cout<<"WARNING: intFlowProfiles is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8656 | } | |
8657 | ||
8658 | // d) Get pointer to list fIntFlowResults and pointers to all objects that she holds. | |
8659 | TList *intFlowResults = NULL; | |
8660 | intFlowResults = dynamic_cast<TList*>(intFlowList->FindObject("Results")); | |
8661 | if(intFlowResults) | |
8662 | { | |
8663 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with correct errors!): | |
8664 | TString intFlowCorrelationsHistName = "fIntFlowCorrelationsHist"; | |
8665 | intFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
8666 | TH1D *intFlowCorrelationsHist = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCorrelationsHistName.Data())); | |
8667 | if(intFlowCorrelationsHist) | |
8668 | { | |
8669 | this->SetIntFlowCorrelationsHist(intFlowCorrelationsHist); | |
8670 | } else | |
8671 | { | |
8672 | cout<<"WARNING: intFlowCorrelationsHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8673 | } | |
ff70ca91 | 8674 | // average correlations <<2>>, <<4>>, <<6>> and <<8>> (with correct errors!) vs M: |
b3dacf6b | 8675 | if(fCalculateCumulantsVsM) |
ff70ca91 | 8676 | { |
b3dacf6b | 8677 | TString intFlowCorrelationsVsMHistName = "fIntFlowCorrelationsVsMHist"; |
8678 | intFlowCorrelationsVsMHistName += fAnalysisLabel->Data(); | |
8679 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
ff70ca91 | 8680 | { |
b3dacf6b | 8681 | TH1D *intFlowCorrelationsVsMHist = dynamic_cast<TH1D*> |
8682 | (intFlowResults->FindObject(Form("%s, %s",intFlowCorrelationsVsMHistName.Data(),correlationFlag[ci].Data()))); | |
8683 | if(intFlowCorrelationsVsMHist) | |
8684 | { | |
8685 | this->SetIntFlowCorrelationsVsMHist(intFlowCorrelationsVsMHist,ci); | |
8686 | } else | |
8687 | { | |
8688 | cout<<"WARNING: "<<Form("intFlowCorrelationsVsMHist[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8689 | } | |
8690 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
8691 | } // end of if(fCalculateCumulantsVsM) | |
489d5531 | 8692 | // average all correlations for integrated flow (with correct errors!): |
8693 | TString intFlowCorrelationsAllHistName = "fIntFlowCorrelationsAllHist"; | |
8694 | intFlowCorrelationsAllHistName += fAnalysisLabel->Data(); | |
8695 | TH1D *intFlowCorrelationsAllHist = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCorrelationsAllHistName.Data())); | |
8696 | if(intFlowCorrelationsAllHist) | |
8697 | { | |
8698 | this->SetIntFlowCorrelationsAllHist(intFlowCorrelationsAllHist); | |
8699 | } else | |
8700 | { | |
8701 | cout<<"WARNING: intFlowCorrelationsAllHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8702 | } | |
8703 | // average correction terms for non-uniform acceptance (with correct errors!): | |
8704 | TString intFlowCorrectionTermsForNUAHistName = "fIntFlowCorrectionTermsForNUAHist"; | |
8705 | intFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
8706 | for(Int_t sc=0;sc<2;sc++) | |
8707 | { | |
8708 | TH1D *intFlowCorrectionTermsForNUAHist = dynamic_cast<TH1D*>(intFlowResults->FindObject((Form("%s: %s terms",intFlowCorrectionTermsForNUAHistName.Data(),sinCosFlag[sc].Data())))); | |
8709 | if(intFlowCorrectionTermsForNUAHist) | |
8710 | { | |
8711 | this->SetIntFlowCorrectionTermsForNUAHist(intFlowCorrectionTermsForNUAHist,sc); | |
8712 | } else | |
8713 | { | |
8714 | cout<<"WARNING: intFlowCorrectionTermsForNUAHist is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8715 | cout<<"sc = "<<sc<<endl; | |
8716 | } | |
8717 | } // end of for(Int_t sc=0;sc<2;sc++) | |
8718 | // covariances (multiplied with weight dependent prefactor): | |
8719 | TString intFlowCovariancesName = "fIntFlowCovariances"; | |
8720 | intFlowCovariancesName += fAnalysisLabel->Data(); | |
8721 | TH1D *intFlowCovariances = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCovariancesName.Data())); | |
8722 | if(intFlowCovariances) | |
8723 | { | |
8724 | this->SetIntFlowCovariances(intFlowCovariances); | |
8725 | } else | |
8726 | { | |
8727 | cout<<"WARNING: intFlowCovariances is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8728 | } | |
8729 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8>: | |
8730 | TString intFlowSumOfEventWeightsName = "fIntFlowSumOfEventWeights"; | |
8731 | intFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
8732 | for(Int_t power=0;power<2;power++) | |
8733 | { | |
8734 | TH1D *intFlowSumOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s: %s",intFlowSumOfEventWeightsName.Data(),powerFlag[power].Data()))); | |
8735 | if(intFlowSumOfEventWeights) | |
8736 | { | |
8737 | this->SetIntFlowSumOfEventWeights(intFlowSumOfEventWeights,power); | |
8738 | } else | |
8739 | { | |
8740 | cout<<"WARNING: intFlowSumOfEventWeights is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8741 | cout<<"power = "<<power<<endl; | |
8742 | } | |
8743 | } // end of for(Int_t power=0;power<2;power++) | |
8744 | // sum of products of event weights for correlations <2>, <4>, <6> and <8>: | |
8745 | TString intFlowSumOfProductOfEventWeightsName = "fIntFlowSumOfProductOfEventWeights"; | |
8746 | intFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
8747 | TH1D *intFlowSumOfProductOfEventWeights = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowSumOfProductOfEventWeightsName.Data())); | |
8748 | if(intFlowSumOfProductOfEventWeights) | |
8749 | { | |
8750 | this->SetIntFlowSumOfProductOfEventWeights(intFlowSumOfProductOfEventWeights); | |
8751 | } else | |
8752 | { | |
8753 | cout<<"WARNING: intFlowSumOfProductOfEventWeights is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8754 | } | |
ff70ca91 | 8755 | // final result for covariances of correlations (multiplied with weight dependent prefactor) versus M |
8756 | // [0=Cov(2,4),1=Cov(2,6),2=Cov(2,8),3=Cov(4,6),4=Cov(4,8),5=Cov(6,8)]: | |
b3dacf6b | 8757 | if(fCalculateCumulantsVsM) |
ff70ca91 | 8758 | { |
b3dacf6b | 8759 | TString intFlowCovariancesVsMName = "fIntFlowCovariancesVsM"; |
8760 | intFlowCovariancesVsMName += fAnalysisLabel->Data(); | |
8761 | TString covarianceFlag[6] = {"Cov(<2>,<4>)","Cov(<2>,<6>)","Cov(<2>,<8>)","Cov(<4>,<6>)","Cov(<4>,<8>)","Cov(<6>,<8>)"}; | |
8762 | for(Int_t ci=0;ci<6;ci++) | |
8763 | { | |
8764 | TH1D *intFlowCovariancesVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowCovariancesVsMName.Data(),covarianceFlag[ci].Data()))); | |
8765 | if(intFlowCovariancesVsM) | |
ff70ca91 | 8766 | { |
b3dacf6b | 8767 | this->SetIntFlowCovariancesVsM(intFlowCovariancesVsM,ci); |
ff70ca91 | 8768 | } else |
8769 | { | |
b3dacf6b | 8770 | cout<<"WARNING: "<<Form("intFlowCovariancesVsM[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; |
ff70ca91 | 8771 | } |
b3dacf6b | 8772 | } // end of for(Int_t ci=0;ci<6;ci++) |
8773 | } // end of if(fCalculateCumulantsVsM) | |
8774 | // sum of linear and quadratic event weights for <2>, <4>, <6> and <8> versus multiplicity | |
8775 | // [0=sum{w_{<2>}},1=sum{w_{<4>}},2=sum{w_{<6>}},3=sum{w_{<8>}}][0=linear 1,1=quadratic]: | |
8776 | if(fCalculateCumulantsVsM) | |
8777 | { | |
8778 | TString intFlowSumOfEventWeightsVsMName = "fIntFlowSumOfEventWeightsVsM"; | |
8779 | intFlowSumOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
8780 | TString sumFlag[2][4] = {{"#sum_{i=1}^{N} w_{<2>}","#sum_{i=1}^{N} w_{<4>}","#sum_{i=1}^{N} w_{<6>}","#sum_{i=1}^{N} w_{<8>}"}, | |
8781 | {"#sum_{i=1}^{N} w_{<2>}^{2}","#sum_{i=1}^{N} w_{<4>}^{2}","#sum_{i=1}^{N} w_{<6>}^{2}","#sum_{i=1}^{N} w_{<8>}^{2}"}}; | |
8782 | for(Int_t si=0;si<4;si++) | |
8783 | { | |
8784 | for(Int_t power=0;power<2;power++) | |
8785 | { | |
8786 | TH1D *intFlowSumOfEventWeightsVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowSumOfEventWeightsVsMName.Data(),sumFlag[power][si].Data()))); | |
8787 | if(intFlowSumOfEventWeightsVsM) | |
8788 | { | |
8789 | this->SetIntFlowSumOfEventWeightsVsM(intFlowSumOfEventWeightsVsM,si,power); | |
8790 | } else | |
8791 | { | |
8792 | cout<<"WARNING: "<<Form("intFlowSumOfEventWeightsVsM[%d][%d]",si,power)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8793 | } | |
8794 | } // end of for(Int_t power=0;power<2;power++) | |
8795 | } // end of for(Int_t si=0;si<4;si++) | |
8796 | } // end of if(fCalculateCumulantsVsM) | |
ff70ca91 | 8797 | // sum of products of event weights for correlations <2>, <4>, <6> and <8> vs M |
8798 | // [0=sum{w_{<2>}w_{<4>}},1=sum{w_{<2>}w_{<6>}},2=sum{w_{<2>}w_{<8>}}, | |
8799 | // 3=sum{w_{<4>}w_{<6>}},4=sum{w_{<4>}w_{<8>}},5=sum{w_{<6>}w_{<8>}}]: | |
b3dacf6b | 8800 | if(fCalculateCumulantsVsM) |
ff70ca91 | 8801 | { |
b3dacf6b | 8802 | TString intFlowSumOfProductOfEventWeightsVsMName = "fIntFlowSumOfProductOfEventWeightsVsM"; |
8803 | intFlowSumOfProductOfEventWeightsVsMName += fAnalysisLabel->Data(); | |
8804 | TString sopowFlag[6] = {"#sum_{i=1}^{N} w_{<2>} w_{<4>}","#sum_{i=1}^{N} w_{<2>} w_{<6>}","#sum_{i=1}^{N} w_{<2>} w_{<8>}", | |
8805 | "#sum_{i=1}^{N} w_{<4>} w_{<6>}","#sum_{i=1}^{N} w_{<4>} w_{<8>}","#sum_{i=1}^{N} w_{<6>} w_{<8>}"}; | |
8806 | for(Int_t pi=0;pi<6;pi++) | |
ff70ca91 | 8807 | { |
b3dacf6b | 8808 | TH1D *intFlowSumOfProductOfEventWeightsVsM = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s, %s",intFlowSumOfProductOfEventWeightsVsMName.Data(),sopowFlag[pi].Data()))); |
8809 | if(intFlowSumOfProductOfEventWeightsVsM) | |
8810 | { | |
8811 | this->SetIntFlowSumOfProductOfEventWeightsVsM(intFlowSumOfProductOfEventWeightsVsM,pi); | |
8812 | } else | |
8813 | { | |
8814 | cout<<"WARNING: "<<Form("intFlowSumOfProductOfEventWeightsVsM[%d]",pi)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8815 | } | |
8816 | } // end of for(Int_t pi=0;pi<6;pi++) | |
8817 | } // end of if(fCalculateCumulantsVsM) | |
0328db2d | 8818 | // covariances for NUA (multiplied with weight dependent prefactor): |
8819 | TString intFlowCovariancesNUAName = "fIntFlowCovariancesNUA"; | |
8820 | intFlowCovariancesNUAName += fAnalysisLabel->Data(); | |
8821 | TH1D *intFlowCovariancesNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowCovariancesNUAName.Data())); | |
8822 | if(intFlowCovariancesNUA) | |
8823 | { | |
8824 | this->SetIntFlowCovariancesNUA(intFlowCovariancesNUA); | |
8825 | } else | |
8826 | { | |
8827 | cout<<"WARNING: intFlowCovariancesNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8828 | } | |
8829 | // sum of linear and quadratic event weights NUA terms: | |
8830 | TString intFlowSumOfEventWeightsNUAName = "fIntFlowSumOfEventWeightsNUA"; | |
8831 | intFlowSumOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
8832 | for(Int_t sc=0;sc<2;sc++) | |
8833 | { | |
8834 | for(Int_t power=0;power<2;power++) | |
8835 | { | |
8836 | TH1D *intFlowSumOfEventWeightsNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(Form("%s: %s, %s",intFlowSumOfEventWeightsNUAName.Data(),powerFlag[power].Data(),sinCosFlag[sc].Data()))); | |
8837 | if(intFlowSumOfEventWeightsNUA) | |
8838 | { | |
8839 | this->SetIntFlowSumOfEventWeightsNUA(intFlowSumOfEventWeightsNUA,sc,power); | |
8840 | } else | |
8841 | { | |
8842 | cout<<"WARNING: intFlowSumOfEventWeightsNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8843 | cout<<"sc = "<<sc<<endl; | |
8844 | cout<<"power = "<<power<<endl; | |
8845 | } | |
8846 | } // end of for(Int_t power=0;power<2;power++) | |
8847 | } // end of for(Int_t sc=0;sc<2;sc++) | |
8848 | // sum of products of event weights for NUA terms: | |
8849 | TString intFlowSumOfProductOfEventWeightsNUAName = "fIntFlowSumOfProductOfEventWeightsNUA"; | |
8850 | intFlowSumOfProductOfEventWeightsNUAName += fAnalysisLabel->Data(); | |
8851 | TH1D *intFlowSumOfProductOfEventWeightsNUA = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowSumOfProductOfEventWeightsNUAName.Data())); | |
8852 | if(intFlowSumOfProductOfEventWeightsNUA) | |
8853 | { | |
8854 | this->SetIntFlowSumOfProductOfEventWeightsNUA(intFlowSumOfProductOfEventWeightsNUA); | |
8855 | } else | |
8856 | { | |
8857 | cout<<"WARNING: intFlowSumOfProductOfEventWeightsNUA is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8858 | } | |
b3dacf6b | 8859 | // Final results for reference Q-cumulants: |
489d5531 | 8860 | TString intFlowQcumulantsName = "fIntFlowQcumulants"; |
8861 | intFlowQcumulantsName += fAnalysisLabel->Data(); | |
8862 | TH1D *intFlowQcumulants = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsName.Data())); | |
8863 | if(intFlowQcumulants) | |
8864 | { | |
8865 | this->SetIntFlowQcumulants(intFlowQcumulants); | |
8866 | } else | |
8867 | { | |
8868 | cout<<"WARNING: intFlowQcumulants is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8869 | } | |
b3dacf6b | 8870 | // Final results for reference Q-cumulants rebinned in M: |
8871 | if(fCalculateCumulantsVsM) | |
8872 | { | |
8873 | TString intFlowQcumulantsRebinnedInMName = "fIntFlowQcumulantsRebinnedInM"; | |
8874 | intFlowQcumulantsRebinnedInMName += fAnalysisLabel->Data(); | |
8875 | TH1D *intFlowQcumulantsRebinnedInM = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsRebinnedInMName.Data())); | |
8876 | if(intFlowQcumulantsRebinnedInM) | |
8877 | { | |
8878 | this->SetIntFlowQcumulantsRebinnedInM(intFlowQcumulantsRebinnedInM); | |
8879 | } else | |
8880 | { | |
8881 | cout<<"WARNING: intFlowQcumulantsRebinnedInM is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8882 | } | |
8883 | } // end of if(fCalculateCumulantsVsM) | |
b92ea2b9 | 8884 | // Ratio between error squared: with/without non-isotropic terms: |
8885 | TString intFlowQcumulantsErrorSquaredRatioName = "fIntFlowQcumulantsErrorSquaredRatio"; | |
8886 | intFlowQcumulantsErrorSquaredRatioName += fAnalysisLabel->Data(); | |
8887 | TH1D *intFlowQcumulantsErrorSquaredRatio = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowQcumulantsErrorSquaredRatioName.Data())); | |
8888 | if(intFlowQcumulantsErrorSquaredRatio) | |
8889 | { | |
8890 | this->SetIntFlowQcumulantsErrorSquaredRatio(intFlowQcumulantsErrorSquaredRatio); | |
8891 | } else | |
8892 | { | |
8893 | cout<<" WARNING: intntFlowQcumulantsErrorSquaredRatio is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8894 | } | |
ff70ca91 | 8895 | // final results for integrated Q-cumulants versus multiplicity: |
ff70ca91 | 8896 | TString cumulantFlag[4] = {"QC{2}","QC{4}","QC{6}","QC{8}"}; |
b3dacf6b | 8897 | if(fCalculateCumulantsVsM) |
ff70ca91 | 8898 | { |
b3dacf6b | 8899 | TString intFlowQcumulantsVsMName = "fIntFlowQcumulantsVsM"; |
8900 | intFlowQcumulantsVsMName += fAnalysisLabel->Data(); | |
8901 | for(Int_t co=0;co<4;co++) // cumulant order | |
ff70ca91 | 8902 | { |
b3dacf6b | 8903 | TH1D *intFlowQcumulantsVsM = dynamic_cast<TH1D*> |
8904 | (intFlowResults->FindObject(Form("%s, %s",intFlowQcumulantsVsMName.Data(),cumulantFlag[co].Data()))); | |
8905 | if(intFlowQcumulantsVsM) | |
8906 | { | |
8907 | this->SetIntFlowQcumulantsVsM(intFlowQcumulantsVsM,co); | |
8908 | } else | |
8909 | { | |
8910 | cout<<"WARNING: "<<Form("intFlowQcumulantsVsM[%d]",co)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8911 | } | |
8912 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
8913 | } // end of if(fCalculateCumulantsVsM) | |
8914 | // Final reference flow estimates from Q-cumulants: | |
489d5531 | 8915 | TString intFlowName = "fIntFlow"; |
8916 | intFlowName += fAnalysisLabel->Data(); | |
8917 | TH1D *intFlow = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowName.Data())); | |
8918 | if(intFlow) | |
8919 | { | |
8920 | this->SetIntFlow(intFlow); | |
8921 | } else | |
8922 | { | |
8923 | cout<<"WARNING: intFlow is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
ff70ca91 | 8924 | } |
b3dacf6b | 8925 | // Final reference flow estimates from Q-cumulants vs M rebinned in M: |
8926 | if(fCalculateCumulantsVsM) | |
ff70ca91 | 8927 | { |
b3dacf6b | 8928 | TString intFlowRebinnedInMName = "fIntFlowRebinnedInM"; |
8929 | intFlowRebinnedInMName += fAnalysisLabel->Data(); | |
8930 | TH1D *intFlowRebinnedInM = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowRebinnedInMName.Data())); | |
8931 | if(intFlowRebinnedInM) | |
ff70ca91 | 8932 | { |
b3dacf6b | 8933 | this->SetIntFlowRebinnedInM(intFlowRebinnedInM); |
8934 | } else | |
ff70ca91 | 8935 | { |
b3dacf6b | 8936 | cout<<"WARNING: intFlowRebinnedInM is NULL in AFAWQC::GPFIFH() !!!!"<<endl; |
8937 | } | |
8938 | } // end of if(fCalculateCumulantsVsM) | |
8939 | // integrated flow from Q-cumulants versus multiplicity: | |
8940 | if(fCalculateCumulantsVsM) | |
8941 | { | |
8942 | TString intFlowVsMName = "fIntFlowVsM"; | |
8943 | intFlowVsMName += fAnalysisLabel->Data(); | |
b77b6434 | 8944 | TString flowFlag[4] = {Form("v_{%d}{2,QC}",fHarmonic),Form("v_{%d}{4,QC}",fHarmonic),Form("v_{%d}{6,QC}",fHarmonic),Form("v_{%d}{8,QC}",fHarmonic)}; |
b3dacf6b | 8945 | for(Int_t co=0;co<4;co++) // cumulant order |
8946 | { | |
8947 | TH1D *intFlowVsM = dynamic_cast<TH1D*> | |
b77b6434 | 8948 | (intFlowResults->FindObject(Form("%s, %s",intFlowVsMName.Data(),flowFlag[co].Data()))); |
b3dacf6b | 8949 | if(intFlowVsM) |
8950 | { | |
8951 | this->SetIntFlowVsM(intFlowVsM,co); | |
8952 | } else | |
8953 | { | |
8954 | cout<<"WARNING: "<<Form("intFlowVsM[%d]",co)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8955 | } | |
8956 | } // end of for(Int_t co=0;co<4;co++) // cumulant order | |
8957 | } // end of if(fCalculateCumulantsVsM) | |
2001bc3a | 8958 | // quantifying detector effects effects to correlations: |
8959 | TString intFlowDetectorBiasName = "fIntFlowDetectorBias"; | |
8960 | intFlowDetectorBiasName += fAnalysisLabel->Data(); | |
8961 | TH1D *intFlowDetectorBias = dynamic_cast<TH1D*>(intFlowResults->FindObject(intFlowDetectorBiasName.Data())); | |
8962 | if(intFlowDetectorBias) | |
8963 | { | |
8964 | this->SetIntFlowDetectorBias(intFlowDetectorBias); | |
8965 | } else | |
8966 | { | |
8967 | cout<<"WARNING: intFlowDetectorBias is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8968 | } | |
8969 | // quantifying detector effects effects to correlations vs multiplicity: | |
b77b6434 | 8970 | if(fCalculateCumulantsVsM) |
2001bc3a | 8971 | { |
3c5d5752 | 8972 | TString intFlowDetectorBiasVsMName = "fIntFlowDetectorBiasVsM"; |
8973 | intFlowDetectorBiasVsMName += fAnalysisLabel->Data(); | |
8974 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
2001bc3a | 8975 | { |
3c5d5752 | 8976 | TH1D *intFlowDetectorBiasVsM = dynamic_cast<TH1D*> |
8977 | (intFlowResults->FindObject(Form("%s for %s",intFlowDetectorBiasVsMName.Data(),cumulantFlag[ci].Data()))); | |
8978 | if(intFlowDetectorBiasVsM) | |
8979 | { | |
8980 | this->SetIntFlowDetectorBiasVsM(intFlowDetectorBiasVsM,ci); | |
8981 | } else | |
8982 | { | |
8983 | cout<<"WARNING: "<<Form("intFlowDetectorBiasVsM[%d]",ci)<<" is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8984 | } | |
8985 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
b77b6434 | 8986 | } // end of if(fCalculateCumulantsVsM) |
489d5531 | 8987 | } else // to if(intFlowResults) |
8988 | { | |
8989 | cout<<"WARNING: intFlowResults is NULL in AFAWQC::GPFIFH() !!!!"<<endl; | |
8990 | } | |
ff70ca91 | 8991 | |
489d5531 | 8992 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForIntFlowHistograms() |
8993 | ||
489d5531 | 8994 | //================================================================================================================================ |
8995 | ||
1268c371 | 8996 | void AliFlowAnalysisWithQCumulants::GetPointersFor2DDiffFlowHistograms() |
8997 | { | |
8998 | // Get pointers for 2D differential flow histograms. | |
8999 | // a) Check pointers used in this method; | |
9000 | // b) Get pointers to 2D differential flow lists; | |
9001 | // c) Get pointers to 2D differential flow profiles; | |
9002 | // d) Get pointers to 2D differential flow histograms. | |
9003 | ||
9004 | // a) Check pointers used in this method: | |
9005 | if(!fDiffFlowList) | |
9006 | { | |
9007 | printf("\n WARNING (QC): fDiffFlowList is NULL in AFAWQC::GPF2DDFH() !!!!\n"); | |
9008 | printf(" Call method GetPointersForDiffFlowHistograms() first.\n\n"); | |
9009 | exit(0); | |
9010 | } | |
9011 | if(!fDiffFlowFlags) | |
9012 | { | |
9013 | printf("\n WARNING (QC): fDiffFlowFlags is NULL in AFAWQC::GPF2DDFH() !!!!\n\n"); | |
9014 | printf(" Call method GetPointersForDiffFlowHistograms() first.\n\n"); | |
9015 | exit(0); | |
9016 | } | |
9017 | ||
9018 | // b) Get pointers to 2D differential flow lists: | |
9019 | this->SetCalculate2DDiffFlow((Bool_t)fDiffFlowFlags->GetBinContent(5)); // to be improved - hardwired 5 | |
9020 | if(!fCalculate2DDiffFlow){return;} | |
9021 | TString typeFlag[2] = {"RP","POI"}; | |
9022 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
9023 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
9024 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
9025 | // Base list: | |
9026 | TString diffFlow2DListName = "2D"; | |
9027 | diffFlow2DListName += fAnalysisLabel->Data(); | |
9028 | fDiffFlow2D = dynamic_cast<TList*>(fDiffFlowList->FindObject(diffFlow2DListName.Data())); | |
9029 | if(!fDiffFlow2D) | |
9030 | { | |
9031 | printf("\n WARNING (QC): fDiffFlow2D is NULL in AFAWQC::GPFDFH() !!!!\n\n"); | |
9032 | exit(0); | |
9033 | } | |
9034 | // Lists holding profiles with 2D correlations: | |
9035 | TString s2DDiffFlowCorrelationsProListName = "Profiles with 2D correlations"; | |
9036 | s2DDiffFlowCorrelationsProListName += fAnalysisLabel->Data(); // to be improved | |
9037 | for(Int_t t=0;t<2;t++) | |
9038 | { | |
9039 | f2DDiffFlowCorrelationsProList[t] = dynamic_cast<TList*>(fDiffFlow2D->FindObject(Form("Profiles with 2D correlations (%s)",typeFlag[t].Data()))); | |
9040 | if(!f2DDiffFlowCorrelationsProList[t]) | |
9041 | { | |
9042 | printf("\n WARNING (QC): f2DDiffFlowCorrelationsProList[%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t); | |
9043 | exit(0); | |
9044 | } | |
9045 | } // end of for(Int_t t=0;t<2;t++) | |
9046 | ||
9047 | // c) Get pointers to 2D differential flow profiles: | |
9048 | TString s2DDiffFlowCorrelationsProName = "f2DDiffFlowCorrelationsPro"; | |
9049 | s2DDiffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
9050 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9051 | { | |
9052 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
9053 | { | |
9054 | f2DDiffFlowCorrelationsPro[t][rci] = dynamic_cast<TProfile2D*>(f2DDiffFlowCorrelationsProList[t]->FindObject(Form("%s, %s, %s",s2DDiffFlowCorrelationsProName.Data(),typeFlag[t].Data(),reducedCorrelationIndex[rci].Data()))); | |
9055 | if(!f2DDiffFlowCorrelationsPro[t][rci]) | |
9056 | { | |
9057 | printf("\n WARNING (QC): f2DDiffFlowCorrelationsPro[%i][%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t,rci); | |
9058 | exit(0); | |
9059 | } else | |
9060 | { | |
9061 | this->Set2DDiffFlowCorrelationsPro(f2DDiffFlowCorrelationsPro[t][rci],t,rci); | |
9062 | } | |
9063 | } // end of for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
9064 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
9065 | ||
9066 | // d) Get pointers to 2D differential flow histograms: | |
9067 | TString s2DDiffFlowCumulantsName = "f2DDiffFlowCumulants"; | |
9068 | s2DDiffFlowCumulantsName += fAnalysisLabel->Data(); | |
9069 | TString s2DDiffFlowName = "f2DDiffFlow"; | |
9070 | s2DDiffFlowName += fAnalysisLabel->Data(); | |
9071 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9072 | { | |
9073 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
9074 | { | |
9075 | // 2D differential cumulants: | |
9076 | f2DDiffFlowCumulants[t][rci] = dynamic_cast<TH2D*>(f2DDiffFlowCorrelationsProList[t]->FindObject(Form("%s, %s, %s",s2DDiffFlowCumulantsName.Data(),typeFlag[t].Data(),differentialCumulantIndex[rci].Data()))); | |
9077 | if(!f2DDiffFlowCumulants[t][rci]) | |
9078 | { | |
9079 | printf("\n WARNING (QC): f2DDiffFlowCumulants[%i][%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t,rci); | |
9080 | exit(0); | |
9081 | } else | |
9082 | { | |
9083 | this->Set2DDiffFlowCumulants(f2DDiffFlowCumulants[t][rci],t,rci); | |
9084 | } | |
9085 | // 2D differential flow: | |
9086 | f2DDiffFlow[t][rci] = dynamic_cast<TH2D*>(f2DDiffFlowCorrelationsProList[t]->FindObject(Form("%s, %s, %s",s2DDiffFlowName.Data(),typeFlag[t].Data(),differentialFlowIndex[rci].Data()))); | |
9087 | if(!f2DDiffFlow[t][rci]) | |
9088 | { | |
9089 | printf("\n WARNING (QC): f2DDiffFlow[%i][%i] is NULL in AFAWQC::GPF2DFH() !!!!\n\n",t,rci); | |
9090 | exit(0); | |
9091 | } else | |
9092 | { | |
9093 | this->Set2DDiffFlow(f2DDiffFlow[t][rci],t,rci); | |
9094 | } | |
9095 | } // end of for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
9096 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
9097 | ||
9098 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersFor2DDiffFlowHistograms() | |
9099 | ||
9100 | //================================================================================================================================ | |
9101 | ||
64e500e3 | 9102 | void AliFlowAnalysisWithQCumulants::GetPointersForOtherDiffCorrelators() |
9103 | { | |
9104 | // Get pointers for other differential correlators. | |
9105 | // a) Get pointer to list with other differential correlators; | |
9106 | // b) Declare local flags; | |
9107 | // c) Get pointers to other differential profiles. | |
9108 | ||
62e36168 | 9109 | if(!fCalculateDiffFlow){return;} // TBI: This must eventually be moved somewhere else |
9110 | ||
64e500e3 | 9111 | // a) Get pointer to list with other differential correlators: |
9112 | fOtherDiffCorrelatorsList = dynamic_cast<TList*>(fHistList->FindObject("Other differential correlators")); | |
9113 | if(!fOtherDiffCorrelatorsList) | |
9114 | { | |
9115 | printf("\n WARNING (QC): fOtherDiffCorrelatorsList is NULL in AFAWQC::GPFDFH() !!!!\n\n"); | |
9116 | exit(0); | |
9117 | } | |
9118 | ||
9119 | // b) Declare local flags: // (to be improved - promoted to data members) | |
9120 | TString typeFlag[2] = {"RP","POI"}; | |
9121 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
9122 | TString sinCosFlag[2] = {"sin","cos"}; | |
9123 | ||
9124 | // c) Get pointers to other differential profiles: | |
9125 | TString otherDiffCorrelatorsName = "fOtherDiffCorrelators"; | |
9126 | otherDiffCorrelatorsName += fAnalysisLabel->Data(); | |
9127 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
9128 | { | |
62e36168 | 9129 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
64e500e3 | 9130 | { |
9131 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9132 | { | |
9133 | for(Int_t ci=0;ci<1;ci++) // correlator index | |
9134 | { | |
9135 | fOtherDiffCorrelators[t][pe][sc][ci] = dynamic_cast<TProfile*>(fOtherDiffCorrelatorsList->FindObject(Form("%s, %s, %s, %s, ci = %d",otherDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1))); | |
9136 | if(!fOtherDiffCorrelators[t][pe][sc][ci]) | |
9137 | { | |
9138 | printf("\n WARNING (QC): fOtherDiffCorrelators[%i][%i][%i][%i] is NULL in AFAWQC::GPFODC() !!!!\n\n",t,pe,sc,ci); | |
9139 | exit(0); | |
9140 | } else | |
9141 | { | |
9142 | this->SetOtherDiffCorrelators(fOtherDiffCorrelators[t][pe][sc][ci],t,pe,sc,ci); | |
9143 | } | |
9144 | } // end of for(Int_t ci=0;ci<1;ci++) // correlator index | |
9145 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9146 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9147 | } // end of for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
9148 | ||
9149 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForOtherDiffCorrelators() | |
9150 | ||
9151 | //================================================================================================================================ | |
9152 | ||
489d5531 | 9153 | void AliFlowAnalysisWithQCumulants::GetPointersForDiffFlowHistograms() |
9154 | { | |
9155 | // Get pointer to all objects relevant for differential flow. | |
1268c371 | 9156 | // a) Get pointer to base list for differential flow fDiffFlowList; |
9157 | // b) Get pointer to profile fDiffFlowFlags holding all flags for differential flow. Access and set some flags; | |
9158 | // c) Get pointers to nested lists fDiffFlowListProfiles and fDiffFlowListResults; | |
9159 | // d) Define flags locally (to be improved: should I promote these flags to data members?); | |
9160 | // e) Get pointers to all nested lists in fDiffFlowListProfiles and to profiles which they hold; | |
9161 | // f) Get pointers to all nested lists in fDiffFlowListResults and to histograms which they hold. | |
9162 | ||
9163 | // a) Get pointer to base list for differential flow fDiffFlowList: | |
9164 | fDiffFlowList = dynamic_cast<TList*>(fHistList->FindObject("Differential Flow")); | |
9165 | if(!fDiffFlowList) | |
489d5531 | 9166 | { |
1268c371 | 9167 | printf("\n WARNING (QC): fDiffFlowList is NULL in AFAWQC::GPFDFH() !!!!\n\n"); |
489d5531 | 9168 | exit(0); |
9169 | } | |
1268c371 | 9170 | |
9171 | // b) Get pointer to profile fDiffFlowFlags holding all flags for differential flow. Access and set some flags: | |
9172 | TString diffFlowFlagsName = "fDiffFlowFlags"; | |
9173 | diffFlowFlagsName += fAnalysisLabel->Data(); | |
9174 | fDiffFlowFlags = dynamic_cast<TProfile*>(fDiffFlowList->FindObject(diffFlowFlagsName.Data())); | |
9175 | if(fDiffFlowFlags) | |
9176 | { | |
62d19320 | 9177 | this->SetCalculateDiffFlow((Bool_t)fDiffFlowFlags->GetBinContent(1)); // to be improved - hardwired 1 |
62e36168 | 9178 | this->SetCalculateDiffFlowVsEta((Bool_t)fDiffFlowFlags->GetBinContent(6)); // to be improved - hardwired 6 |
1268c371 | 9179 | } else |
9180 | { | |
9181 | printf("\n WARNING (QC): fDiffFlowFlags is NULL in AFAWQC::GPFDFH() !!!!\n\n"); | |
9182 | printf("\n Flags in method Finish() are wrong.\n\n"); | |
9183 | exit(0); | |
9184 | } | |
9185 | ||
9186 | if(!fCalculateDiffFlow){return;} // IMPORTANT: do not move this anywhere above in this method (to be improved) | |
9187 | ||
9188 | // c) Get pointers to nested lists fDiffFlowListProfiles and fDiffFlowListResults: | |
9189 | // List holding nested lists holding profiles: | |
489d5531 | 9190 | TList *diffFlowListProfiles = NULL; |
1268c371 | 9191 | diffFlowListProfiles = dynamic_cast<TList*>(fDiffFlowList->FindObject("Profiles")); |
489d5531 | 9192 | if(!diffFlowListProfiles) |
9193 | { | |
1268c371 | 9194 | printf("\n WARNING (QC): diffFlowListProfiles is NULL in AFAWQC::GPFDFH() !!!!\n\n"); |
489d5531 | 9195 | exit(0); |
9196 | } | |
1268c371 | 9197 | // List holding nested lists holding histograms with final results: |
489d5531 | 9198 | TList *diffFlowListResults = NULL; |
1268c371 | 9199 | diffFlowListResults = dynamic_cast<TList*>(fDiffFlowList->FindObject("Results")); |
489d5531 | 9200 | if(!diffFlowListResults) |
9201 | { | |
1268c371 | 9202 | printf("\n WARNING (QC): diffFlowListResults is NULL in AFAWQC::GPFDFH() !!!!\n\n"); |
489d5531 | 9203 | exit(0); |
9204 | } | |
9205 | ||
1268c371 | 9206 | // d) Define flags locally (to be improved: should I promote these flags to data members?): |
9207 | TString typeFlag[2] = {"RP","POI"}; | |
9208 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
9209 | TString powerFlag[2] = {"linear","quadratic"}; | |
9210 | TString sinCosFlag[2] = {"sin","cos"}; | |
9211 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
9212 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
9213 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
9214 | TString reducedSquaredCorrelationIndex[4] = {"<2'>^{2}","<4'>^{2}","<6'>^{2}","<8'>^{2}"}; | |
9215 | TString mixedCorrelationIndex[8] = {"<2>","<2'>","<4>","<4'>","<6>","<6'>","<8>","<8'>"}; | |
9216 | TString covarianceName[5] = {"Cov(<2>,<2'>)","Cov(<2>,<4'>)","Cov(<4>,<2'>)","Cov(<4>,<4'>)","Cov(<2'>,<4'>)"}; | |
489d5531 | 9217 | |
1268c371 | 9218 | // e) Get pointers to all nested lists in fDiffFlowListProfiles and to profiles which they hold: |
489d5531 | 9219 | // correlations: |
9220 | TList *diffFlowCorrelationsProList[2][2] = {{NULL}}; | |
9221 | TString diffFlowCorrelationsProName = "fDiffFlowCorrelationsPro"; | |
9222 | diffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
b40a910e | 9223 | TProfile *diffFlowCorrelationsPro[2][2][4] = {{{NULL}}}; |
9224 | // squared correlations: | |
9225 | TString diffFlowSquaredCorrelationsProName = "fDiffFlowSquaredCorrelationsPro"; | |
9226 | diffFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
9227 | TProfile *diffFlowSquaredCorrelationsPro[2][2][4] = {{{NULL}}}; | |
489d5531 | 9228 | // products of correlations: |
9229 | TList *diffFlowProductOfCorrelationsProList[2][2] = {{NULL}}; | |
9230 | TString diffFlowProductOfCorrelationsProName = "fDiffFlowProductOfCorrelationsPro"; | |
9231 | diffFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
9232 | TProfile *diffFlowProductOfCorrelationsPro[2][2][8][8] = {{{{NULL}}}}; | |
9233 | // corrections: | |
9234 | TList *diffFlowCorrectionsProList[2][2] = {{NULL}}; | |
9235 | TString diffFlowCorrectionTermsForNUAProName = "fDiffFlowCorrectionTermsForNUAPro"; | |
9236 | diffFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
9237 | TProfile *diffFlowCorrectionTermsForNUAPro[2][2][2][10] = {{{{NULL}}}}; | |
9238 | for(Int_t t=0;t<2;t++) | |
9239 | { | |
62e36168 | 9240 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) |
489d5531 | 9241 | { |
9242 | diffFlowCorrelationsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9243 | if(!diffFlowCorrelationsProList[t][pe]) | |
9244 | { | |
9245 | cout<<"WARNING: diffFlowCorrelationsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9246 | cout<<"t = "<<t<<endl; | |
9247 | cout<<"pe = "<<pe<<endl; | |
9248 | exit(0); | |
9249 | } | |
9250 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
9251 | { | |
b40a910e | 9252 | // reduced correlations: |
489d5531 | 9253 | diffFlowCorrelationsPro[t][pe][ci] = dynamic_cast<TProfile*>(diffFlowCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[ci].Data()))); |
9254 | if(diffFlowCorrelationsPro[t][pe][ci]) | |
9255 | { | |
9256 | this->SetDiffFlowCorrelationsPro(diffFlowCorrelationsPro[t][pe][ci],t,pe,ci); | |
9257 | } else | |
9258 | { | |
9259 | cout<<"WARNING: diffFlowCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9260 | cout<<"t = "<<t<<endl; | |
9261 | cout<<"pe = "<<pe<<endl; | |
9262 | cout<<"ci = "<<ci<<endl; | |
9263 | } | |
b40a910e | 9264 | // reduced squared correlations: |
9265 | diffFlowSquaredCorrelationsPro[t][pe][ci] = dynamic_cast<TProfile*>(diffFlowCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowSquaredCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedSquaredCorrelationIndex[ci].Data()))); | |
9266 | if(diffFlowSquaredCorrelationsPro[t][pe][ci]) | |
9267 | { | |
9268 | this->SetDiffFlowSquaredCorrelationsPro(diffFlowSquaredCorrelationsPro[t][pe][ci],t,pe,ci); | |
9269 | } else | |
9270 | { | |
9271 | cout<<"WARNING: diffFlowSquaredCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9272 | cout<<"t = "<<t<<endl; | |
9273 | cout<<"pe = "<<pe<<endl; | |
9274 | cout<<"ci = "<<ci<<endl; | |
9275 | } | |
489d5531 | 9276 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index |
9277 | // products of correlations: | |
9278 | diffFlowProductOfCorrelationsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with products of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9279 | if(!diffFlowProductOfCorrelationsProList[t][pe]) | |
9280 | { | |
9281 | cout<<"WARNING: ddiffFlowProductOfCorrelationsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9282 | cout<<"t = "<<t<<endl; | |
9283 | cout<<"pe = "<<pe<<endl; | |
9284 | exit(0); | |
9285 | } | |
9286 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
9287 | { | |
9288 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
9289 | { | |
9290 | diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = dynamic_cast<TProfile*>(diffFlowProductOfCorrelationsProList[t][pe]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()))); | |
9291 | if(diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]) | |
9292 | { | |
9293 | this->SetDiffFlowProductOfCorrelationsPro(diffFlowProductOfCorrelationsPro[t][pe][mci1][mci2],t,pe,mci1,mci2); | |
9294 | } else | |
9295 | { | |
b40a910e | 9296 | cout<<"WARNING: diffFlowProductOfCorrelationsPro[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; |
489d5531 | 9297 | cout<<"t = "<<t<<endl; |
9298 | cout<<"pe = "<<pe<<endl; | |
9299 | cout<<"mci1 = "<<mci1<<endl; | |
9300 | cout<<"mci2 = "<<mci2<<endl; | |
9301 | } | |
9302 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
9303 | } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
9304 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
9305 | // corrections: | |
9306 | diffFlowCorrectionsProList[t][pe] = dynamic_cast<TList*>(diffFlowListProfiles->FindObject(Form("Profiles with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9307 | if(!diffFlowCorrectionsProList[t][pe]) | |
9308 | { | |
9309 | cout<<"WARNING: diffFlowCorrectionsProList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9310 | cout<<"t = "<<t<<endl; | |
9311 | cout<<"pe = "<<pe<<endl; | |
9312 | exit(0); | |
9313 | } | |
9314 | // correction terms for NUA: | |
9315 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9316 | { | |
9317 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
9318 | { | |
9319 | diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = dynamic_cast<TProfile*>(diffFlowCorrectionsProList[t][pe]->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1))); | |
9320 | if(diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]) | |
9321 | { | |
9322 | this->SetDiffFlowCorrectionTermsForNUAPro(diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti],t,pe,sc,cti); | |
9323 | } else | |
9324 | { | |
9325 | cout<<"WARNING: diffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9326 | cout<<"t = "<<t<<endl; | |
9327 | cout<<"pe = "<<pe<<endl; | |
9328 | cout<<"sc = "<<sc<<endl; | |
9329 | cout<<"cti = "<<cti<<endl; | |
9330 | } | |
9331 | } // end of for(Int_t cti=0;cti<9;cti++) // correction term index | |
9332 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9333 | // ... | |
9334 | } // end of for(Int_t pe=0;pe<2;pe++) | |
9335 | } // end of for(Int_t t=0;t<2;t++) | |
9336 | ||
1268c371 | 9337 | // f) Get pointers to all nested lists in fDiffFlowListResults and to histograms which they hold: |
489d5531 | 9338 | // reduced correlations: |
9339 | TList *diffFlowCorrelationsHistList[2][2] = {{NULL}}; | |
9340 | TString diffFlowCorrelationsHistName = "fDiffFlowCorrelationsHist"; | |
9341 | diffFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
9342 | TH1D *diffFlowCorrelationsHist[2][2][4] = {{{NULL}}}; | |
9343 | // corrections for NUA: | |
9344 | TList *diffFlowCorrectionsHistList[2][2] = {{NULL}}; | |
9345 | TString diffFlowCorrectionTermsForNUAHistName = "fDiffFlowCorrectionTermsForNUAHist"; | |
9346 | diffFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
9347 | TH1D *diffFlowCorrectionTermsForNUAHist[2][2][2][10] = {{{{NULL}}}}; | |
9348 | // differential Q-cumulants: | |
9349 | TList *diffFlowCumulantsHistList[2][2] = {{NULL}}; | |
9350 | TString diffFlowCumulantsName = "fDiffFlowCumulants"; | |
9351 | diffFlowCumulantsName += fAnalysisLabel->Data(); | |
9352 | TH1D *diffFlowCumulants[2][2][4] = {{{NULL}}}; | |
1268c371 | 9353 | // detector bias to differential Q-cumulants: |
9354 | TList *diffFlowDetectorBiasHistList[2][2] = {{NULL}}; | |
9355 | TString diffFlowDetectorBiasName = "fDiffFlowDetectorBias"; | |
9356 | diffFlowDetectorBiasName += fAnalysisLabel->Data(); | |
9357 | TH1D *diffFlowDetectorBias[2][2][4] = {{{NULL}}}; | |
489d5531 | 9358 | // differential flow estimates from Q-cumulants: |
9359 | TList *diffFlowHistList[2][2] = {{NULL}}; | |
9360 | TString diffFlowName = "fDiffFlow"; | |
9361 | diffFlowName += fAnalysisLabel->Data(); | |
9362 | TH1D *diffFlow[2][2][4] = {{{NULL}}}; | |
9363 | // differential covariances: | |
9364 | TList *diffFlowCovariancesHistList[2][2] = {{NULL}}; | |
9365 | TString diffFlowCovariancesName = "fDiffFlowCovariances"; | |
9366 | diffFlowCovariancesName += fAnalysisLabel->Data(); | |
9367 | TH1D *diffFlowCovariances[2][2][5] = {{{NULL}}}; | |
9368 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9369 | { | |
62e36168 | 9370 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9371 | { |
9372 | // reduced correlations: | |
9373 | diffFlowCorrelationsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9374 | if(!diffFlowCorrelationsHistList[t][pe]) | |
9375 | { | |
9376 | cout<<"WARNING: diffFlowCorrelationsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9377 | cout<<"t = "<<t<<endl; | |
9378 | cout<<"pe = "<<pe<<endl; | |
9379 | exit(0); | |
9380 | } | |
9381 | for(Int_t index=0;index<4;index++) | |
9382 | { | |
9383 | diffFlowCorrelationsHist[t][pe][index] = dynamic_cast<TH1D*>(diffFlowCorrelationsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()))); | |
9384 | if(diffFlowCorrelationsHist[t][pe][index]) | |
9385 | { | |
9386 | this->SetDiffFlowCorrelationsHist(diffFlowCorrelationsHist[t][pe][index],t,pe,index); | |
9387 | } else | |
9388 | { | |
9389 | cout<<"WARNING: diffFlowCorrelationsHist[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9390 | cout<<"t = "<<t<<endl; | |
9391 | cout<<"pe = "<<pe<<endl; | |
9392 | cout<<"index = "<<index<<endl; | |
9393 | exit(0); | |
9394 | } | |
9395 | } // end of for(Int_t index=0;index<4;index++) | |
9396 | // corrections: | |
9397 | diffFlowCorrectionsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Histograms with correction terms for NUA (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9398 | if(!diffFlowCorrectionsHistList[t][pe]) | |
9399 | { | |
9400 | cout<<"WARNING: diffFlowCorrectionsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9401 | cout<<"t = "<<t<<endl; | |
9402 | cout<<"pe = "<<pe<<endl; | |
9403 | exit(0); | |
9404 | } | |
9405 | // correction terms for NUA: | |
9406 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9407 | { | |
9408 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
9409 | { | |
9410 | diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = dynamic_cast<TH1D*>(diffFlowCorrectionsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1))); | |
9411 | if(diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]) | |
9412 | { | |
9413 | this->SetDiffFlowCorrectionTermsForNUAHist(diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti],t,pe,sc,cti); | |
9414 | } else | |
9415 | { | |
9416 | cout<<"WARNING: diffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9417 | cout<<"t = "<<t<<endl; | |
9418 | cout<<"pe = "<<pe<<endl; | |
9419 | cout<<"sc = "<<sc<<endl; | |
9420 | cout<<"cti = "<<cti<<endl; | |
9421 | } | |
9422 | } // end of for(Int_t cti=0;cti<9;cti++) // correction term index | |
9423 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9424 | // ... | |
9425 | // differential Q-cumulants: | |
9426 | diffFlowCumulantsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Differential Q-cumulants (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9427 | if(!diffFlowCumulantsHistList[t][pe]) | |
9428 | { | |
9429 | cout<<"WARNING: diffFlowCumulantsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9430 | cout<<"t = "<<t<<endl; | |
9431 | cout<<"pe = "<<pe<<endl; | |
9432 | exit(0); | |
9433 | } | |
9434 | for(Int_t index=0;index<4;index++) | |
9435 | { | |
9436 | diffFlowCumulants[t][pe][index] = dynamic_cast<TH1D*>(diffFlowCumulantsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()))); | |
9437 | if(diffFlowCumulants[t][pe][index]) | |
9438 | { | |
9439 | this->SetDiffFlowCumulants(diffFlowCumulants[t][pe][index],t,pe,index); | |
9440 | } else | |
9441 | { | |
9442 | cout<<"WARNING: diffFlowCumulants[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9443 | cout<<"t = "<<t<<endl; | |
9444 | cout<<"pe = "<<pe<<endl; | |
9445 | cout<<"index = "<<index<<endl; | |
9446 | exit(0); | |
9447 | } | |
9448 | } // end of for(Int_t index=0;index<4;index++) | |
1268c371 | 9449 | // Detector bias to differential Q-cumulants: |
9450 | diffFlowDetectorBiasHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Detector bias (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9451 | if(!diffFlowDetectorBiasHistList[t][pe]) | |
9452 | { | |
9453 | cout<<"WARNING: diffFlowDetectorBiasHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9454 | cout<<"t = "<<t<<endl; | |
9455 | cout<<"pe = "<<pe<<endl; | |
9456 | exit(0); | |
9457 | } | |
9458 | for(Int_t index=0;index<4;index++) | |
9459 | { | |
9460 | diffFlowDetectorBias[t][pe][index] = dynamic_cast<TH1D*>(diffFlowDetectorBiasHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowDetectorBiasName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()))); | |
9461 | if(diffFlowDetectorBias[t][pe][index]) | |
9462 | { | |
9463 | this->SetDiffFlowDetectorBias(diffFlowDetectorBias[t][pe][index],t,pe,index); | |
9464 | } else | |
9465 | { | |
9466 | cout<<"WARNING: diffFlowDetectorBias[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9467 | cout<<"t = "<<t<<endl; | |
9468 | cout<<"pe = "<<pe<<endl; | |
9469 | cout<<"index = "<<index<<endl; | |
9470 | exit(0); | |
9471 | } | |
9472 | } // end of for(Int_t index=0;index<4;index++) | |
489d5531 | 9473 | // differential flow estimates from Q-cumulants: |
9474 | diffFlowHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Differential flow (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9475 | if(!diffFlowHistList[t][pe]) | |
9476 | { | |
9477 | cout<<"WARNING: diffFlowHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9478 | cout<<"t = "<<t<<endl; | |
9479 | cout<<"pe = "<<pe<<endl; | |
9480 | exit(0); | |
9481 | } | |
9482 | for(Int_t index=0;index<4;index++) | |
9483 | { | |
9484 | diffFlow[t][pe][index] = dynamic_cast<TH1D*>(diffFlowHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()))); | |
9485 | if(diffFlow[t][pe][index]) | |
9486 | { | |
9487 | this->SetDiffFlow(diffFlow[t][pe][index],t,pe,index); | |
9488 | } else | |
9489 | { | |
9490 | cout<<"WARNING: diffFlow[t][pe][index] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9491 | cout<<"t = "<<t<<endl; | |
9492 | cout<<"pe = "<<pe<<endl; | |
9493 | cout<<"index = "<<index<<endl; | |
9494 | exit(0); | |
9495 | } | |
9496 | } // end of for(Int_t index=0;index<4;index++) | |
9497 | // differential covariances: | |
9498 | diffFlowCovariancesHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Covariances of correlations (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9499 | if(!diffFlowCovariancesHistList[t][pe]) | |
9500 | { | |
9501 | cout<<"WARNING: diffFlowCovariancesHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9502 | cout<<"t = "<<t<<endl; | |
9503 | cout<<"pe = "<<pe<<endl; | |
9504 | exit(0); | |
9505 | } | |
9506 | for(Int_t covIndex=0;covIndex<5;covIndex++) | |
9507 | { | |
9508 | diffFlowCovariances[t][pe][covIndex] = dynamic_cast<TH1D*>(diffFlowCovariancesHistList[t][pe]->FindObject(Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()))); | |
9509 | if(diffFlowCovariances[t][pe][covIndex]) | |
9510 | { | |
9511 | this->SetDiffFlowCovariances(diffFlowCovariances[t][pe][covIndex],t,pe,covIndex); | |
9512 | } else | |
9513 | { | |
9514 | cout<<"WARNING: diffFlowCovariances[t][pe][covIndex] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9515 | cout<<"t = "<<t<<endl; | |
9516 | cout<<"pe = "<<pe<<endl; | |
9517 | cout<<"covIndex = "<<covIndex<<endl; | |
9518 | exit(0); | |
9519 | } | |
9520 | } // end of for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index | |
9521 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9522 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
9523 | // sum of event weights for reduced correlations: | |
9524 | TList *diffFlowSumOfEventWeightsHistList[2][2][2] = {{{NULL}}}; | |
9525 | TString diffFlowSumOfEventWeightsName = "fDiffFlowSumOfEventWeights"; | |
9526 | diffFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
9527 | TH1D *diffFlowSumOfEventWeights[2][2][2][4] = {{{{NULL}}}}; | |
9528 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
9529 | { | |
62e36168 | 9530 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9531 | { |
9532 | for(Int_t p=0;p<2;p++) // power of event weights is either 1 or 2 | |
9533 | { | |
9534 | diffFlowSumOfEventWeightsHistList[t][pe][p] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Sum of %s event weights (%s, %s)",powerFlag[p].Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9535 | if(!diffFlowSumOfEventWeightsHistList[t][pe][p]) | |
9536 | { | |
9537 | cout<<"WARNING: diffFlowSumOfEventWeightsHistList[t][pe][p] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9538 | cout<<"t = "<<t<<endl; | |
9539 | cout<<"pe = "<<pe<<endl; | |
9540 | cout<<"power = "<<p<<endl; | |
9541 | exit(0); | |
9542 | } | |
9543 | for(Int_t ew=0;ew<4;ew++) // index of reduced correlation | |
9544 | { | |
9545 | diffFlowSumOfEventWeights[t][pe][p][ew] = dynamic_cast<TH1D*>(diffFlowSumOfEventWeightsHistList[t][pe][p]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()))); | |
9546 | if(diffFlowSumOfEventWeights[t][pe][p][ew]) | |
9547 | { | |
9548 | this->SetDiffFlowSumOfEventWeights(diffFlowSumOfEventWeights[t][pe][p][ew],t,pe,p,ew); | |
9549 | } else | |
9550 | { | |
9551 | cout<<"WARNING: diffFlowSumOfEventWeights[t][pe][p][ew] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9552 | cout<<"t = "<<t<<endl; | |
9553 | cout<<"pe = "<<pe<<endl; | |
9554 | cout<<"power = "<<p<<endl; | |
9555 | cout<<"ew = "<<ew<<endl; | |
9556 | exit(0); | |
9557 | } | |
9558 | } | |
9559 | } // end of for(Int_t p=0;p<2;p++) // power of event weights is either 1 or 2 | |
9560 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9561 | } // end of for(Int_t t=0;t<2;t++) // type is RP or POI | |
9562 | // | |
9563 | TList *diffFlowSumOfProductOfEventWeightsHistList[2][2] = {{NULL}}; | |
9564 | TString diffFlowSumOfProductOfEventWeightsName = "fDiffFlowSumOfProductOfEventWeights"; | |
9565 | diffFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
9566 | TH1D *diffFlowSumOfProductOfEventWeights[2][2][8][8] = {{{{NULL}}}}; | |
9567 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
9568 | { | |
62e36168 | 9569 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9570 | { |
9571 | diffFlowSumOfProductOfEventWeightsHistList[t][pe] = dynamic_cast<TList*>(diffFlowListResults->FindObject(Form("Sum of products of event weights (%s, %s)",typeFlag[t].Data(),ptEtaFlag[pe].Data()))); | |
9572 | if(!diffFlowSumOfProductOfEventWeightsHistList[t][pe]) | |
9573 | { | |
9574 | cout<<"WARNING: diffFlowSumOfProductOfEventWeightsHistList[t][pe] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9575 | cout<<"t = "<<t<<endl; | |
9576 | cout<<"pe = "<<pe<<endl; | |
9577 | exit(0); | |
9578 | } | |
9579 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
9580 | { | |
9581 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
9582 | { | |
9583 | diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = dynamic_cast<TH1D*>(diffFlowSumOfProductOfEventWeightsHistList[t][pe]->FindObject(Form("%s, %s, %s, %s, %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()))); | |
9584 | if(diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]) | |
9585 | { | |
9586 | this->SetDiffFlowSumOfProductOfEventWeights(diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2],t,pe,mci1,mci2); | |
9587 | } else | |
9588 | { | |
9589 | cout<<"WARNING: diffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
9590 | cout<<"t = "<<t<<endl; | |
9591 | cout<<"pe = "<<pe<<endl; | |
9592 | cout<<"mci1 = "<<mci1<<endl; | |
9593 | cout<<"mci2 = "<<mci2<<endl; | |
9594 | exit(0); | |
9595 | } | |
9596 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
9597 | } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
9598 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
9599 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9600 | } // end of for(Int_t t=0;t<2;t++) // type is RP or POI | |
9601 | ||
9602 | } // end void AliFlowAnalysisWithQCumulants::GetPointersForDiffFlowHistograms() | |
9603 | ||
489d5531 | 9604 | //================================================================================================================================ |
9605 | ||
1268c371 | 9606 | void AliFlowAnalysisWithQCumulants::BookEverythingFor2DDifferentialFlow() |
9607 | { | |
9608 | // Book all objects needed for 2D differential flow. | |
9609 | // a) Define flags locally (to be improved: should I promote flags to data members?); | |
9610 | // b) Book e-b-e quantities; | |
9611 | // c) Book 2D profiles; | |
9612 | // d) Book 2D histograms. | |
9613 | ||
9614 | if(!fCalculate2DDiffFlow){return;} | |
9615 | ||
9616 | // a) Define flags locally (to be improved: should I promote flags to data members?): | |
9617 | TString typeFlag[2] = {"RP","POI"}; | |
9618 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
9619 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
9620 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
9621 | ||
9622 | // b) Book e-b-e quantities: | |
9623 | TProfile2D styleRe("typeMultiplePowerRe","typeMultiplePowerRe",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
9624 | TProfile2D styleIm("typeMultiplePowerIm","typeMultiplePowerIm",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
9625 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) | |
9626 | { | |
9627 | for(Int_t m=0;m<4;m++) | |
9628 | { | |
9629 | for(Int_t k=0;k<9;k++) | |
9630 | { | |
9631 | fReRPQ2dEBE[t][m][k] = (TProfile2D*)styleRe.Clone(Form("typeFlag%dmultiple%dpower%dRe",t,m,k)); | |
9632 | fImRPQ2dEBE[t][m][k] = (TProfile2D*)styleIm.Clone(Form("typeFlag%dmultiple%dpower%dIm",t,m,k)); | |
9633 | } | |
9634 | } | |
9635 | } | |
9636 | TProfile2D styleS("typePower","typePower",fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
9637 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) | |
9638 | { | |
9639 | for(Int_t k=0;k<9;k++) | |
9640 | { | |
9641 | fs2dEBE[t][k] = (TProfile2D*)styleS.Clone(Form("typeFlag%dpower%d",t,k)); | |
9642 | } | |
9643 | } | |
9644 | ||
9645 | // c) Book 2D profiles: | |
9646 | TString s2DDiffFlowCorrelationsProName = "f2DDiffFlowCorrelationsPro"; | |
9647 | s2DDiffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
9648 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9649 | { | |
9650 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
9651 | { | |
9652 | f2DDiffFlowCorrelationsPro[t][rci] = new TProfile2D(Form("%s, %s, %s",s2DDiffFlowCorrelationsProName.Data(),typeFlag[t].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s",s2DDiffFlowCorrelationsProName.Data(),typeFlag[t].Data(),reducedCorrelationIndex[rci].Data()),fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax,""); | |
9653 | f2DDiffFlowCorrelationsPro[t][rci]->Sumw2(); | |
9654 | f2DDiffFlowCorrelationsPro[t][rci]->SetXTitle("p_{t}"); | |
9655 | f2DDiffFlowCorrelationsPro[t][rci]->SetYTitle("#eta"); | |
9656 | f2DDiffFlowCorrelationsProList[t]->Add(f2DDiffFlowCorrelationsPro[t][rci]); | |
9657 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
9658 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POIs | |
9659 | ||
9660 | // d) Book 2D histograms: | |
9661 | TString s2DDiffFlowCumulantsName = "f2DDiffFlowCumulants"; | |
9662 | s2DDiffFlowCumulantsName += fAnalysisLabel->Data(); | |
9663 | TString s2DDiffFlowName = "f2DDiffFlow"; | |
9664 | s2DDiffFlowName += fAnalysisLabel->Data(); | |
9665 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9666 | { | |
9667 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
9668 | { | |
9669 | // 2D diferential cumulants: | |
9670 | f2DDiffFlowCumulants[t][rci] = new TH2D(Form("%s, %s, %s",s2DDiffFlowCumulantsName.Data(),typeFlag[t].Data(),differentialCumulantIndex[rci].Data()),Form("%s, %s, %s",s2DDiffFlowCumulantsName.Data(),typeFlag[t].Data(),differentialCumulantIndex[rci].Data()),fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
9671 | f2DDiffFlowCumulants[t][rci]->SetXTitle("p_{t}"); | |
9672 | f2DDiffFlowCumulants[t][rci]->SetYTitle("#eta"); | |
9673 | f2DDiffFlowCorrelationsProList[t]->Add(f2DDiffFlowCumulants[t][rci]); // to be improved - moved to another list | |
9674 | // 2D differential flow: | |
9675 | f2DDiffFlow[t][rci] = new TH2D(Form("%s, %s, %s",s2DDiffFlowName.Data(),typeFlag[t].Data(),differentialFlowIndex[rci].Data()),Form("%s, %s, %s",s2DDiffFlowName.Data(),typeFlag[t].Data(),differentialFlowIndex[rci].Data()),fnBinsPt,fPtMin,fPtMax,fnBinsEta,fEtaMin,fEtaMax); | |
9676 | f2DDiffFlow[t][rci]->SetXTitle("p_{t}"); | |
9677 | f2DDiffFlow[t][rci]->SetYTitle("#eta"); | |
9678 | f2DDiffFlowCorrelationsProList[t]->Add(f2DDiffFlow[t][rci]); // to be improved - moved to another list | |
9679 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
9680 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POIs | |
9681 | ||
9682 | } // void AliFlowAnalysisWithQCumulants::BookEverythingFor2DDifferentialFlow() | |
9683 | ||
9684 | //================================================================================================================================ | |
489d5531 | 9685 | |
9686 | void AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow() | |
9687 | { | |
9688 | // Book all histograms and profiles needed for differential flow. | |
1268c371 | 9689 | // a) Book profile to hold all flags for differential flow; |
9690 | // b) Define flags locally (to be improved: should I promote flags to data members?); | |
489d5531 | 9691 | // c) Book e-b-e quantities; |
9692 | // d) Book profiles; | |
9693 | // e) Book histograms holding final results. | |
9694 | ||
1268c371 | 9695 | // a) Book profile to hold all flags for differential flow: |
9696 | TString diffFlowFlagsName = "fDiffFlowFlags"; | |
9697 | diffFlowFlagsName += fAnalysisLabel->Data(); | |
62e36168 | 9698 | fDiffFlowFlags = new TProfile(diffFlowFlagsName.Data(),"Flags for differential flow",6,0,6); |
1268c371 | 9699 | fDiffFlowFlags->SetTickLength(-0.01,"Y"); |
9700 | fDiffFlowFlags->SetMarkerStyle(25); | |
9701 | fDiffFlowFlags->SetLabelSize(0.04,"X"); | |
9702 | fDiffFlowFlags->SetLabelOffset(0.02,"Y"); | |
9703 | fDiffFlowFlags->GetXaxis()->SetBinLabel(1,"Calculate diff. flow"); | |
9704 | fDiffFlowFlags->GetXaxis()->SetBinLabel(2,"Particle weights"); | |
9705 | fDiffFlowFlags->GetXaxis()->SetBinLabel(3,"Event weights"); | |
9706 | fDiffFlowFlags->GetXaxis()->SetBinLabel(4,"Correct for NUA"); | |
9707 | fDiffFlowFlags->GetXaxis()->SetBinLabel(5,"Calculate 2D diff. flow"); | |
62e36168 | 9708 | fDiffFlowFlags->GetXaxis()->SetBinLabel(6,"Calculate diff. flow vs eta"); |
1268c371 | 9709 | fDiffFlowList->Add(fDiffFlowFlags); |
9710 | ||
9711 | if(!fCalculateDiffFlow){return;} | |
9712 | ||
9713 | // b) Define flags locally (to be improved: should I promote flags to data members?): | |
489d5531 | 9714 | TString typeFlag[2] = {"RP","POI"}; |
9715 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; | |
9716 | TString powerFlag[2] = {"linear","quadratic"}; | |
9717 | TString sinCosFlag[2] = {"sin","cos"}; | |
9718 | TString differentialCumulantIndex[4] = {"QC{2'}","QC{4'}","QC{6'}","QC{8'}"}; | |
9719 | TString differentialFlowIndex[4] = {"v'{2}","v'{4}","v'{6}","v'{8}"}; | |
9720 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; | |
b40a910e | 9721 | TString reducedSquaredCorrelationIndex[4] = {"<2'>^{2}","<4'>^{2}","<6'>^{2}","<8'>^{2}"}; |
489d5531 | 9722 | TString mixedCorrelationIndex[8] = {"<2>","<2'>","<4>","<4'>","<6>","<6'>","<8>","<8'>"}; |
9723 | TString covarianceName[5] = {"Cov(<2>,<2'>)","Cov(<2>,<4'>)","Cov(<4>,<2'>)","Cov(<4>,<4'>)","Cov(<2'>,<4'>)"}; | |
9724 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
9725 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
9726 | Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
1268c371 | 9727 | |
489d5531 | 9728 | // c) Book e-b-e quantities: |
9729 | // Event-by-event r_{m*n,k}(pt,eta), p_{m*n,k}(pt,eta) and q_{m*n,k}(pt,eta) | |
9730 | // Explanantion of notation: | |
9731 | // 1.) n is harmonic, m is multiple of harmonic; | |
9732 | // 2.) k is power of particle weight; | |
9733 | // 3.) r_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for RPs in particular (pt,eta) bin (i-th RP is weighted with w_i^k); | |
9734 | // 4.) p_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for POIs in particular (pt,eta) bin | |
9735 | // (if i-th POI is also RP, than it is weighted with w_i^k); | |
9736 | // 5.) q_{m*n,k}(pt,eta) = Q-vector evaluated in harmonic m*n for particles which are both RPs and POIs in particular (pt,eta) bin | |
9737 | // (i-th RP&&POI is weighted with w_i^k) | |
9738 | ||
9739 | // 1D: | |
9740 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP && POI ) | |
9741 | { | |
62e36168 | 9742 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9743 | { |
9744 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
9745 | { | |
9746 | for(Int_t k=0;k<9;k++) // power of particle weight | |
9747 | { | |
9748 | fReRPQ1dEBE[t][pe][m][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%dpower%dRe",t,pe,m,k), | |
9749 | Form("TypeFlag%dpteta%dmultiple%dpower%dRe",t,pe,m,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9750 | fImRPQ1dEBE[t][pe][m][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%dpower%dIm",t,pe,m,k), | |
9751 | Form("TypeFlag%dpteta%dmultiple%dpower%dIm",t,pe,m,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9752 | } | |
9753 | } | |
9754 | } | |
9755 | } | |
9756 | // to be improved (add explanation of fs1dEBE[t][pe][k]): | |
9757 | for(Int_t t=0;t<3;t++) // typeFlag (0 = RP, 1 = POI, 2 = RP&&POI ) | |
9758 | { | |
62e36168 | 9759 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9760 | { |
9761 | for(Int_t k=0;k<9;k++) // power of particle weight | |
9762 | { | |
9763 | fs1dEBE[t][pe][k] = new TProfile(Form("TypeFlag%dpteta%dmultiple%d",t,pe,k), | |
9764 | Form("TypeFlag%dpteta%dmultiple%d",t,pe,k),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9765 | } | |
9766 | } | |
9767 | } | |
9768 | // correction terms for nua: | |
9769 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
9770 | { | |
62e36168 | 9771 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9772 | { |
9773 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9774 | { | |
9775 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
9776 | { | |
9777 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti] = new TH1D(Form("typeFlag%d pteta%d sincos%d cti%d",t,pe,sc,cti), | |
9778 | Form("typeFlag%d pteta%d sincos%d cti%d",t,pe,sc,cti),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9779 | } | |
9780 | } | |
9781 | } | |
9782 | } | |
489d5531 | 9783 | // reduced correlations e-b-e: |
9784 | TString diffFlowCorrelationsEBEName = "fDiffFlowCorrelationsEBE"; | |
9785 | diffFlowCorrelationsEBEName += fAnalysisLabel->Data(); | |
9786 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9787 | { | |
62e36168 | 9788 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9789 | { |
9790 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
9791 | { | |
9792 | fDiffFlowCorrelationsEBE[t][pe][rci] = new TH1D(Form("%s, %s, %s, %s",diffFlowCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9793 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
9794 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9795 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
9796 | // event weights for reduced correlations e-b-e: | |
9797 | TString diffFlowEventWeightsForCorrelationsEBEName = "fDiffFlowEventWeightsForCorrelationsEBE"; | |
9798 | diffFlowEventWeightsForCorrelationsEBEName += fAnalysisLabel->Data(); | |
9799 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9800 | { | |
62e36168 | 9801 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9802 | { |
9803 | for(Int_t rci=0;rci<4;rci++) // event weight for reduced correlation index | |
9804 | { | |
9805 | fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci] = new TH1D(Form("%s, %s, %s, eW for %s",diffFlowEventWeightsForCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, eW for %s",diffFlowEventWeightsForCorrelationsEBEName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9806 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
9807 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9808 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
9809 | ||
9810 | // d) Book profiles; | |
9811 | // reduced correlations: | |
9812 | TString diffFlowCorrelationsProName = "fDiffFlowCorrelationsPro"; | |
9813 | diffFlowCorrelationsProName += fAnalysisLabel->Data(); | |
b40a910e | 9814 | // reduced squared correlations: |
9815 | TString diffFlowSquaredCorrelationsProName = "fDiffFlowSquaredCorrelationsPro"; | |
9816 | diffFlowSquaredCorrelationsProName += fAnalysisLabel->Data(); | |
489d5531 | 9817 | // corrections terms: |
9818 | TString diffFlowCorrectionTermsForNUAProName = "fDiffFlowCorrectionTermsForNUAPro"; | |
9819 | diffFlowCorrectionTermsForNUAProName += fAnalysisLabel->Data(); | |
b40a910e | 9820 | // reduced correlations: |
489d5531 | 9821 | for(Int_t t=0;t<2;t++) // type: RP or POI |
9822 | { | |
62e36168 | 9823 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9824 | { |
9825 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
9826 | { | |
489d5531 | 9827 | fDiffFlowCorrelationsPro[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe],"s"); |
b40a910e | 9828 | fDiffFlowCorrelationsPro[t][pe][rci]->Sumw2(); |
489d5531 | 9829 | fDiffFlowCorrelationsPro[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data()); |
9830 | fDiffFlowCorrelationsProList[t][pe]->Add(fDiffFlowCorrelationsPro[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations) | |
9831 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
9832 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9833 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
b40a910e | 9834 | // reduced squared correlations: |
9835 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9836 | { | |
62e36168 | 9837 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
b40a910e | 9838 | { |
9839 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
9840 | { | |
9841 | fDiffFlowSquaredCorrelationsPro[t][pe][rci] = new TProfile(Form("%s, %s, %s, %s",diffFlowSquaredCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedSquaredCorrelationIndex[rci].Data()),Form("%s, %s, %s, %s",diffFlowSquaredCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedSquaredCorrelationIndex[rci].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe],"s"); | |
9842 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->Sumw2(); | |
9843 | fDiffFlowSquaredCorrelationsPro[t][pe][rci]->SetXTitle(ptEtaFlag[pe].Data()); | |
9844 | fDiffFlowCorrelationsProList[t][pe]->Add(fDiffFlowSquaredCorrelationsPro[t][pe][rci]); // to be improved (add dedicated list to hold reduced correlations) | |
9845 | } // end of for(Int_t rci=0;rci<4;rci++) // correlation index | |
9846 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9847 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
489d5531 | 9848 | // correction terms for nua: |
9849 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
9850 | { | |
62e36168 | 9851 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9852 | { |
9853 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9854 | { | |
9855 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
9856 | { | |
9857 | fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti] = new TProfile(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9858 | fDiffFlowCorrectionsProList[t][pe]->Add(fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]); | |
9859 | } | |
9860 | } | |
9861 | } | |
9862 | } | |
64e500e3 | 9863 | // Other differential correlators: |
9864 | TString otherDiffCorrelatorsName = "fOtherDiffCorrelators"; | |
9865 | otherDiffCorrelatorsName += fAnalysisLabel->Data(); | |
9866 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
9867 | { | |
62e36168 | 9868 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
64e500e3 | 9869 | { |
9870 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9871 | { | |
9872 | for(Int_t ci=0;ci<1;ci++) // correlator index | |
9873 | { | |
9874 | fOtherDiffCorrelators[t][pe][sc][ci] = new TProfile(Form("%s, %s, %s, %s, ci = %d",otherDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1),Form("%s, %s, %s, %s, ci = %d",otherDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9875 | fOtherDiffCorrelators[t][pe][sc][ci]->Sumw2(); | |
9876 | fOtherDiffCorrelatorsList->Add(fOtherDiffCorrelators[t][pe][sc][ci]); | |
9877 | } | |
9878 | } | |
9879 | } | |
9880 | } | |
489d5531 | 9881 | // e) Book histograms holding final results. |
9882 | // reduced correlations: | |
9883 | TString diffFlowCorrelationsHistName = "fDiffFlowCorrelationsHist"; | |
9884 | diffFlowCorrelationsHistName += fAnalysisLabel->Data(); | |
9885 | // corrections terms: | |
9886 | TString diffFlowCorrectionTermsForNUAHistName = "fDiffFlowCorrectionTermsForNUAHist"; | |
9887 | diffFlowCorrectionTermsForNUAHistName += fAnalysisLabel->Data(); | |
9888 | // differential covariances: | |
9889 | TString diffFlowCovariancesName = "fDiffFlowCovariances"; | |
9890 | diffFlowCovariancesName += fAnalysisLabel->Data(); | |
9891 | // differential Q-cumulants: | |
9892 | TString diffFlowCumulantsName = "fDiffFlowCumulants"; | |
9893 | diffFlowCumulantsName += fAnalysisLabel->Data(); | |
1268c371 | 9894 | // Detector bias to differential Q-cumulants: |
9895 | TString diffFlowDetectorBiasName = "fDiffFlowDetectorBias"; | |
9896 | diffFlowDetectorBiasName += fAnalysisLabel->Data(); | |
489d5531 | 9897 | // differential flow: |
9898 | TString diffFlowName = "fDiffFlow"; | |
9899 | diffFlowName += fAnalysisLabel->Data(); | |
9900 | for(Int_t t=0;t<2;t++) // type: RP or POI | |
9901 | { | |
62e36168 | 9902 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9903 | { |
9904 | for(Int_t index=0;index<4;index++) | |
9905 | { | |
9906 | // reduced correlations: | |
9907 | fDiffFlowCorrelationsHist[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowCorrelationsHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9908 | fDiffFlowCorrelationsHist[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
9909 | fDiffFlowCorrelationsHistList[t][pe]->Add(fDiffFlowCorrelationsHist[t][pe][index]); | |
9910 | // differential Q-cumulants: | |
9911 | fDiffFlowCumulants[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowCumulantsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9912 | fDiffFlowCumulants[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
9913 | fDiffFlowCumulantsHistList[t][pe]->Add(fDiffFlowCumulants[t][pe][index]); | |
1268c371 | 9914 | // Detector bias to differential Q-cumulants: |
9915 | fDiffFlowDetectorBias[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowDetectorBiasName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowDetectorBiasName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialCumulantIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9916 | fDiffFlowDetectorBias[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
9917 | fDiffFlowDetectorBias[t][pe][index]->SetTitle(Form("#frac{corrected}{measured} %s",differentialCumulantIndex[index].Data())); | |
9918 | fDiffFlowDetectorBiasHistList[t][pe]->Add(fDiffFlowDetectorBias[t][pe][index]); | |
489d5531 | 9919 | // differential flow estimates from Q-cumulants: |
9920 | fDiffFlow[t][pe][index] = new TH1D(Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()),Form("%s, %s, %s, %s",diffFlowName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),differentialFlowIndex[index].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9921 | fDiffFlow[t][pe][index]->SetXTitle(ptEtaFlag[pe].Data()); | |
9922 | fDiffFlowHistList[t][pe]->Add(fDiffFlow[t][pe][index]); | |
9923 | } // end of for(Int_t index=0;index<4;index++) | |
9924 | for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index | |
9925 | { | |
9926 | // differential covariances: | |
9927 | fDiffFlowCovariances[t][pe][covIndex] = new TH1D(Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()),Form("%s, %s, %s, %s",diffFlowCovariancesName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),covarianceName[covIndex].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9928 | fDiffFlowCovariances[t][pe][covIndex]->SetXTitle(ptEtaFlag[pe].Data()); | |
9929 | fDiffFlowCovariancesHistList[t][pe]->Add(fDiffFlowCovariances[t][pe][covIndex]); | |
9930 | } // end of for(Int_t covIndex=0;covIndex<5;covIndex++) // covariance index | |
9931 | // products of both types of correlations: | |
9932 | TString diffFlowProductOfCorrelationsProName = "fDiffFlowProductOfCorrelationsPro"; | |
9933 | diffFlowProductOfCorrelationsProName += fAnalysisLabel->Data(); | |
9934 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
9935 | { | |
9936 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
9937 | { | |
9938 | fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2] = new TProfile(Form("%s, %s, %s, %s, %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),Form("%s, %s, %s, %s #times %s",diffFlowProductOfCorrelationsProName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9939 | fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]->SetXTitle(ptEtaFlag[pe].Data()); | |
9940 | fDiffFlowProductOfCorrelationsProList[t][pe]->Add(fDiffFlowProductOfCorrelationsPro[t][pe][mci1][mci2]); | |
9941 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
9942 | } // end of for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
9943 | } // end of for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
9944 | } // end of for(Int_t pe=0;pe<2;pe++) // pt or eta | |
9945 | } // end of for(Int_t t=0;t<2;t++) // type: RP or POI | |
9946 | // sums of event weights for reduced correlations: | |
9947 | TString diffFlowSumOfEventWeightsName = "fDiffFlowSumOfEventWeights"; | |
9948 | diffFlowSumOfEventWeightsName += fAnalysisLabel->Data(); | |
9949 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
9950 | { | |
62e36168 | 9951 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9952 | { |
9953 | for(Int_t p=0;p<2;p++) // power of weights is either 1 or 2 | |
9954 | { | |
9955 | for(Int_t ew=0;ew<4;ew++) // index of reduced correlation | |
9956 | { | |
9957 | fDiffFlowSumOfEventWeights[t][pe][p][ew] = new TH1D(Form("%s, %s, %s, %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()),Form("%s, %s, %s, power = %s, %s",diffFlowSumOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),powerFlag[p].Data(),reducedCorrelationIndex[ew].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9958 | fDiffFlowSumOfEventWeights[t][pe][p][ew]->SetXTitle(ptEtaFlag[pe].Data()); | |
9959 | fDiffFlowSumOfEventWeightsHistList[t][pe][p]->Add(fDiffFlowSumOfEventWeights[t][pe][p][ew]); // to be improved (add dedicated list to hold all this) | |
9960 | } | |
9961 | } | |
9962 | } | |
9963 | } | |
9964 | // sum of products of event weights for both types of correlations: | |
9965 | TString diffFlowSumOfProductOfEventWeightsName = "fDiffFlowSumOfProductOfEventWeights"; | |
9966 | diffFlowSumOfProductOfEventWeightsName += fAnalysisLabel->Data(); | |
9967 | for(Int_t t=0;t<2;t++) // type is RP or POI | |
9968 | { | |
62e36168 | 9969 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9970 | { |
9971 | for(Int_t mci1=0;mci1<8;mci1++) // mixed correlation index | |
9972 | { | |
9973 | for(Int_t mci2=mci1+1;mci2<8;mci2++) // mixed correlation index | |
9974 | { | |
9975 | fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2] = new TH1D(Form("%s, %s, %s, %s, %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),Form("%s, %s, %s, %s #times %s",diffFlowSumOfProductOfEventWeightsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),mixedCorrelationIndex[mci1].Data(),mixedCorrelationIndex[mci2].Data()),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9976 | fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]->SetXTitle(ptEtaFlag[pe].Data()); | |
9977 | fDiffFlowSumOfProductOfEventWeightsHistList[t][pe]->Add(fDiffFlowSumOfProductOfEventWeights[t][pe][mci1][mci2]); | |
9978 | if(mci1%2 == 0) mci2++; // products which DO NOT include reduced correlations are not stored here | |
9979 | } | |
9980 | } | |
9981 | } | |
9982 | } | |
9983 | // correction terms for nua: | |
9984 | for(Int_t t=0;t<2;t++) // typeFlag (0 = RP, 1 = POI) | |
9985 | { | |
62e36168 | 9986 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 9987 | { |
9988 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
9989 | { | |
9990 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
9991 | { | |
9992 | fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti] = new TH1D(Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),Form("%s, %s, %s, %s, cti = %d",diffFlowCorrectionTermsForNUAHistName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1),nBinsPtEta[pe],minPtEta[pe],maxPtEta[pe]); | |
9993 | fDiffFlowCorrectionsHistList[t][pe]->Add(fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]); | |
9994 | } | |
9995 | } | |
9996 | } | |
9997 | } | |
9998 | ||
9999 | } // end of AliFlowAnalysisWithQCumulants::BookEverythingForDifferentialFlow() | |
10000 | ||
489d5531 | 10001 | //================================================================================================================================ |
10002 | ||
489d5531 | 10003 | void AliFlowAnalysisWithQCumulants::CalculateQcumulantsCorrectedForNUAIntFlow() |
10004 | { | |
10005 | // Calculate generalized Q-cumulants (cumulants corrected for non-unifom acceptance). | |
10006 | ||
b92ea2b9 | 10007 | // Isotropic cumulants: |
53884472 | 10008 | Double_t QC2 = fIntFlowQcumulants->GetBinContent(1); |
10009 | Double_t QC2Error = fIntFlowQcumulants->GetBinError(1); | |
10010 | Double_t QC4 = fIntFlowQcumulants->GetBinContent(2); | |
10011 | Double_t QC4Error = fIntFlowQcumulants->GetBinError(2); | |
10012 | //Double_t QC6 = fIntFlowQcumulants->GetBinContent(3); | |
10013 | //Double_t QC6Error = fIntFlowQcumulants->GetBinError(3); | |
10014 | //Double_t QC8 = fIntFlowQcumulants->GetBinContent(4); | |
10015 | //Double_t QC8Error = fIntFlowQcumulants->GetBinError(4); | |
b92ea2b9 | 10016 | |
10017 | // Measured 2-, 4-, 6- and 8-particle correlations: | |
489d5531 | 10018 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> |
b92ea2b9 | 10019 | Double_t twoError = fIntFlowCorrelationsHist->GetBinError(1); // statistical error of <<2>> |
489d5531 | 10020 | Double_t four = fIntFlowCorrelationsHist->GetBinContent(2); // <<4>> |
b92ea2b9 | 10021 | Double_t fourError = fIntFlowCorrelationsHist->GetBinError(2); // statistical error of <<4>> |
489d5531 | 10022 | //Double_t six = fIntFlowCorrelationsHist->GetBinContent(3); // <<6>> |
489d5531 | 10023 | //Double_t sixError = fIntFlowCorrelationsHist->GetBinError(3); // statistical error of <<6>> |
b92ea2b9 | 10024 | //Double_t eight = fIntFlowCorrelationsHist->GetBinContent(4); // <<8>> |
489d5531 | 10025 | //Double_t eightError = fIntFlowCorrelationsHist->GetBinError(4); // statistical error of <<8>> |
b92ea2b9 | 10026 | |
10027 | // Non-isotropic terms: | |
10028 | Double_t c1 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1); // <<cos(n*phi1)>> | |
10029 | Double_t c1Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(1); // statistical error of <<cos(n*phi1)>> | |
10030 | Double_t c2 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2); // <<cos(n*(phi1+phi2))>> | |
10031 | Double_t c2Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(2); // statistical error of <<cos(n*(phi1+phi2))>> | |
10032 | Double_t c3 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(3); // <<cos(n*(phi1-phi2-phi3))>> | |
10033 | Double_t c3Error = fIntFlowCorrectionTermsForNUAHist[1]->GetBinError(3); // statistical error of <<cos(n*(phi1-phi2-phi3))>> | |
10034 | Double_t s1 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1); // <<sin(n*phi1)>> | |
10035 | Double_t s1Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(1); // statistical error of <<sin(n*phi1)>> | |
10036 | Double_t s2 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2); // <<sin(n*(phi1+phi2))>> | |
10037 | Double_t s2Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(2); // statistical error of <<sin(n*(phi1+phi2))>> | |
10038 | Double_t s3 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(3); // <<sin(n*(phi1-phi2-phi3))>> | |
10039 | Double_t s3Error = fIntFlowCorrectionTermsForNUAHist[0]->GetBinError(3); // statistical error of <<sin(n*(phi1-phi2-phi3))>> | |
10040 | ||
10041 | // Shortcuts: | |
10042 | Double_t a1 = 2.*pow(c1,2.)+2.*pow(s1,2.)-two; | |
10043 | Double_t a2 = 6.*pow(c1,3.)-2.*c1*c2+c3+6.*c1*pow(s1,2.)-2.*s1*s2-4.*c1*two; | |
10044 | Double_t a3 = 2.*pow(s1,2.)-2.*pow(c1,2.)+c2; | |
10045 | Double_t a4 = 6.*pow(s1,3.)+6.*pow(c1,2.)*s1+2.*c2*s1-2.*c1*s2-s3-4.*s1*two; | |
10046 | Double_t a5 = 4.*c1*s1-s2; | |
10047 | ||
10048 | // Covariances (including weight dependent prefactor): | |
8e1cefdd | 10049 | Double_t wCov1 = 0.; // w*Cov(<2>,<cos(phi)) |
10050 | Double_t wCov2 = 0.; // w*Cov(<2>,<sin(phi)) | |
10051 | Double_t wCov3 = 0.; // w*Cov(<cos(phi),<sin(phi)) | |
10052 | Double_t wCov4 = 0.; // w*Cov(<2>,<4>) | |
10053 | Double_t wCov5 = 0.; // w*Cov(<2>,<cos(#phi_{1}+#phi_{2})>) | |
10054 | Double_t wCov6 = 0.; // w*Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10055 | Double_t wCov7 = 0.; // w*Cov(<2>,<sin(#phi_{1}+#phi_{2})>) | |
10056 | Double_t wCov8 = 0.; // w*Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10057 | Double_t wCov9 = 0.; // w*Cov(<4>,<cos(#phi)> | |
10058 | Double_t wCov10 = 0.; // w*Cov(<4>,<cos(#phi_{1}+#phi_{2})>) | |
10059 | Double_t wCov11 = 0.; // w*Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10060 | Double_t wCov12 = 0.; // w*Cov(<4>,<sin(#phi)> | |
10061 | Double_t wCov13 = 0.; // w*Cov(<4>,<sin(#phi_{1}+#phi_{2})>) | |
10062 | Double_t wCov14 = 0.; // w*Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10063 | Double_t wCov15 = 0.; // w*Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
10064 | Double_t wCov16 = 0.; // w*Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10065 | Double_t wCov17 = 0.; // w*Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
10066 | Double_t wCov18 = 0.; // w*Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10067 | Double_t wCov19 = 0.; // w*Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10068 | Double_t wCov20 = 0.; // w*Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
10069 | Double_t wCov21 = 0.; // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>) | |
10070 | Double_t wCov22 = 0.; // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10071 | Double_t wCov23 = 0.; // w*Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10072 | Double_t wCov24 = 0.; // w*Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10073 | Double_t wCov25 = 0.; // w*Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>) | |
10074 | Double_t wCov26 = 0.; // w*Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
10075 | Double_t wCov27 = 0.; // w*Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10076 | Double_t wCov28 = 0.; // w*Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10077 | if(!fForgetAboutCovariances) | |
10078 | { | |
10079 | wCov1 = fIntFlowCovariancesNUA->GetBinContent(1); // w*Cov(<2>,<cos(phi)) | |
10080 | wCov2 = fIntFlowCovariancesNUA->GetBinContent(2); // w*Cov(<2>,<sin(phi)) | |
10081 | wCov3 = fIntFlowCovariancesNUA->GetBinContent(3); // w*Cov(<cos(phi),<sin(phi)) | |
10082 | wCov4 = fIntFlowCovariances->GetBinContent(1); // w*Cov(<2>,<4>) | |
10083 | wCov5 = fIntFlowCovariancesNUA->GetBinContent(4); // w*Cov(<2>,<cos(#phi_{1}+#phi_{2})>) | |
10084 | wCov6 = fIntFlowCovariancesNUA->GetBinContent(6); // w*Cov(<2>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10085 | wCov7 = fIntFlowCovariancesNUA->GetBinContent(5); // w*Cov(<2>,<sin(#phi_{1}+#phi_{2})>) | |
10086 | wCov8 = fIntFlowCovariancesNUA->GetBinContent(7); // w*Cov(<2>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10087 | wCov9 = fIntFlowCovariancesNUA->GetBinContent(8); // w*Cov(<4>,<cos(#phi)> | |
10088 | wCov10 = fIntFlowCovariancesNUA->GetBinContent(10); // w*Cov(<4>,<cos(#phi_{1}+#phi_{2})>) | |
10089 | wCov11 = fIntFlowCovariancesNUA->GetBinContent(12); // w*Cov(<4>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10090 | wCov12 = fIntFlowCovariancesNUA->GetBinContent(9); // w*Cov(<4>,<sin(#phi)> | |
10091 | wCov13 = fIntFlowCovariancesNUA->GetBinContent(11); // w*Cov(<4>,<sin(#phi_{1}+#phi_{2})>) | |
10092 | wCov14 = fIntFlowCovariancesNUA->GetBinContent(13); // w*Cov(<4>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10093 | wCov15 = fIntFlowCovariancesNUA->GetBinContent(14); // w*Cov(<cos(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
10094 | wCov16 = fIntFlowCovariancesNUA->GetBinContent(16); // w*Cov(<cos(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10095 | wCov17 = fIntFlowCovariancesNUA->GetBinContent(15); // w*Cov(<cos(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
10096 | wCov18 = fIntFlowCovariancesNUA->GetBinContent(17); // w*Cov(<cos(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10097 | wCov19 = fIntFlowCovariancesNUA->GetBinContent(23); // w*Cov(<cos(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10098 | wCov20 = fIntFlowCovariancesNUA->GetBinContent(18); // w*Cov(<sin(#phi)>,<cos(#phi_{1}+#phi_{2})>) | |
10099 | wCov21 = fIntFlowCovariancesNUA->GetBinContent(22); // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}+#phi_{2})>) | |
10100 | wCov22 = fIntFlowCovariancesNUA->GetBinContent(24); // w*Cov(<cos(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10101 | wCov23 = fIntFlowCovariancesNUA->GetBinContent(20); // w*Cov(<sin(#phi)>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10102 | wCov24 = fIntFlowCovariancesNUA->GetBinContent(25); // w*Cov(<sin(#phi_{1}+#phi_{2})>,<cos(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10103 | wCov25 = fIntFlowCovariancesNUA->GetBinContent(27); // w*Cov(<cos(#phi_{1}-#phi_{2}-#phi_{3}>,<sin(#phi_{1}-#phi_{2}-#phi_{3}>) | |
10104 | wCov26 = fIntFlowCovariancesNUA->GetBinContent(19); // w*Cov(<sin(#phi)>,<sin(#phi_{1}+#phi_{2})>) | |
10105 | wCov27 = fIntFlowCovariancesNUA->GetBinContent(21); // w*Cov(<sin(#phi)>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10106 | wCov28 = fIntFlowCovariancesNUA->GetBinContent(26); // w*Cov(<sin(#phi_{1}+#phi_{2})>,<sin(#phi_{1}-#phi_{2}-#phi_{3})>) | |
10107 | } // end of if(!fForgetAboutCovariances) | |
10108 | ||
b92ea2b9 | 10109 | // Calculating generalized QC{2}: |
10110 | // Generalized QC{2}: | |
10111 | Double_t gQC2 = two - pow(c1,2.) - pow(s1,2.); | |
10112 | if(fApplyCorrectionForNUA){fIntFlowQcumulants->SetBinContent(1,gQC2);} | |
10113 | // Statistical error of generalized QC{2}: | |
10114 | Double_t gQC2ErrorSquared = pow(twoError,2.)+4.*pow(c1,2.)*pow(c1Error,2.) | |
10115 | + 4.*pow(s1,2.)*pow(s1Error,2.) | |
10116 | - 4*c1*wCov1-4*s1*wCov2 | |
10117 | + 8.*c1*s1*wCov3; | |
10118 | // Store ratio of error squared - with/without NUA terms: | |
10119 | Double_t ratioErrorSquaredQC2 = 0.; | |
10120 | if(fIntFlowQcumulants->GetBinError(1)>0.) | |
10121 | { | |
10122 | ratioErrorSquaredQC2 = (gQC2ErrorSquared/pow(fIntFlowQcumulants->GetBinError(1),2.)); | |
10123 | fIntFlowQcumulantsErrorSquaredRatio->SetBinContent(1,ratioErrorSquaredQC2); | |
10124 | } | |
10125 | // If enabled, store error by including non-isotropic terms: | |
b77b6434 | 10126 | if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 10127 | { |
10128 | if(gQC2ErrorSquared>=0.) | |
10129 | { | |
10130 | fIntFlowQcumulants->SetBinError(1,pow(gQC2ErrorSquared,0.5)); | |
10131 | } else | |
10132 | { | |
10133 | fIntFlowQcumulants->SetBinError(1,0.); | |
10134 | cout<<endl; | |
10135 | cout<<" WARNING (QC): Statistical error of generalized QC{2} is imaginary !!!!"<<endl; | |
10136 | cout<<endl; | |
10137 | } | |
b77b6434 | 10138 | } // end of if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 10139 | // Quantify detector bias to QC{2}: |
53884472 | 10140 | if(TMath::Abs(QC2)>0.) |
b92ea2b9 | 10141 | { |
53884472 | 10142 | fIntFlowDetectorBias->SetBinContent(1,gQC2/QC2); |
10143 | if(QC2Error>0.) | |
b92ea2b9 | 10144 | { |
53884472 | 10145 | Double_t errorSquared = gQC2ErrorSquared/pow(QC2,2.)+pow(gQC2,2.)*pow(QC2Error,2.)/pow(QC2,4.); |
b92ea2b9 | 10146 | if(errorSquared>0.) |
10147 | { | |
10148 | fIntFlowDetectorBias->SetBinError(1,pow(errorSquared,0.5)); | |
10149 | } | |
10150 | } | |
53884472 | 10151 | } // end of if(TMath::Abs(QC2)>0.) |
b92ea2b9 | 10152 | |
10153 | // Calculating generalized QC{4}: | |
10154 | // Generalized QC{4}: | |
10155 | Double_t gQC4 = four-2.*pow(two,2.) | |
10156 | - 4.*c1*c3+4.*s1*s3-pow(c2,2.)-pow(s2,2.) | |
10157 | + 4.*c2*(pow(c1,2.)-pow(s1,2.))+8.*s2*s1*c1 | |
10158 | + 8.*two*(pow(c1,2.)+pow(s1,2.))-6.*pow((pow(c1,2.)+pow(s1,2.)),2.); | |
10159 | if(fApplyCorrectionForNUA){fIntFlowQcumulants->SetBinContent(2,gQC4);} | |
10160 | // Statistical error of generalized QC{4}: | |
10161 | Double_t gQC4ErrorSquared = 16.*pow(a1,2.)*pow(twoError,2.)+pow(fourError,2.)+16.*pow(a2,2.)*pow(c1Error,2.) | |
10162 | + 4.*pow(a3,2.)*pow(c2Error,2.)+16.*pow(c1,2.)*pow(c3Error,2.) | |
10163 | + 16.*pow(a4,2.)*pow(s1Error,2.)+4.*pow(a5,2.)*pow(s2Error,2.) | |
10164 | + 16.*pow(s1,2.)*pow(s3Error,2.)+8.*a1*wCov4-32.*a1*a2*wCov1 | |
10165 | - 16.*a3*a1*wCov5-32.*c1*a1*wCov6-32.*a1*a4*wCov2+16.*a5*a1*wCov7 | |
10166 | + 32.*s1*a1*wCov8-8.*a2*wCov9-4.*a3*wCov10-8.*c1*wCov11-8.*a4*wCov12 | |
10167 | + 4.*a5*wCov13+8.*s1*wCov14+16.*a3*a2*wCov15+32.*c1*a2*wCov16+32.*a2*a4*wCov3 | |
10168 | - 16.*a5*a2*wCov17-32.*s1*a2*wCov18+16.*c1*a3*wCov19+16.*a3*a4*wCov20 | |
10169 | - 8.*a3*a5*wCov21-16.*s1*a3*wCov22+32.*c1*a4*wCov23-16.*c1*a5*wCov24 | |
10170 | - 32.*c1*s1*wCov25-16.*a5*a4*wCov26-32.*s1*a4*wCov27+16.*s1*a5*wCov28; | |
10171 | // Store ratio of error squared - with/without NUA terms: | |
10172 | Double_t ratioErrorSquaredQC4 = 0.; | |
10173 | if(fIntFlowQcumulants->GetBinError(2)>0.) | |
10174 | { | |
10175 | ratioErrorSquaredQC4 = (gQC4ErrorSquared/pow(fIntFlowQcumulants->GetBinError(2),2.)); | |
10176 | fIntFlowQcumulantsErrorSquaredRatio->SetBinContent(2,ratioErrorSquaredQC4); | |
10177 | } | |
b77b6434 | 10178 | if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 10179 | { |
10180 | if(gQC4ErrorSquared>=0.) | |
10181 | { | |
10182 | fIntFlowQcumulants->SetBinError(2,pow(gQC4ErrorSquared,0.5)); | |
10183 | } else | |
10184 | { | |
10185 | fIntFlowQcumulants->SetBinError(2,0.); | |
10186 | cout<<endl; | |
10187 | cout<<" WARNING (QC): Statistical error of generalized QC{4} is imaginary !!!!"<<endl; | |
10188 | cout<<endl; | |
10189 | } | |
b77b6434 | 10190 | } // end of if(fApplyCorrectionForNUA && fPropagateErrorAlsoFromNIT) |
b92ea2b9 | 10191 | // Quantify detector bias to QC{4}: |
53884472 | 10192 | if(TMath::Abs(QC4)>0.) |
b92ea2b9 | 10193 | { |
53884472 | 10194 | fIntFlowDetectorBias->SetBinContent(2,gQC4/QC4); |
10195 | if(QC4Error>0.) | |
b92ea2b9 | 10196 | { |
53884472 | 10197 | Double_t errorSquared = gQC4ErrorSquared/pow(QC4,2.)+pow(gQC4,2.)*pow(QC4Error,2.)/pow(QC4,4.); |
b92ea2b9 | 10198 | if(errorSquared>0.) |
10199 | { | |
10200 | fIntFlowDetectorBias->SetBinError(2,pow(errorSquared,0.5)); | |
10201 | } | |
10202 | } | |
53884472 | 10203 | } // end of if(TMath::Abs(QC4)>0.) |
489d5531 | 10204 | |
b92ea2b9 | 10205 | |
10206 | // .... to be improved (continued for 6th and 8th order) .... | |
10207 | ||
10208 | ||
2001bc3a | 10209 | // versus multiplicity: |
b77b6434 | 10210 | if(fCalculateCumulantsVsM) // to be improved - propagate error for nua terms vs M |
2001bc3a | 10211 | { |
10212 | Int_t nBins = fIntFlowCorrelationsVsMPro[0]->GetNbinsX(); // to be improved (hardwired 0) | |
b77b6434 | 10213 | Double_t value[4] = {0.}; // QCs vs M |
10214 | Double_t error[4] = {0.}; // error of QCs vs M | |
10215 | Double_t dSum1[4] = {0.}; // sum value_i/(error_i)^2 | |
10216 | Double_t dSum2[4] = {0.}; // sum 1/(error_i)^2 | |
2001bc3a | 10217 | for(Int_t b=1;b<=nBins;b++) |
10218 | { | |
b92ea2b9 | 10219 | // Measured correlations: |
2001bc3a | 10220 | two = fIntFlowCorrelationsVsMHist[0]->GetBinContent(b); // <<2>> vs M |
10221 | four = fIntFlowCorrelationsVsMHist[1]->GetBinContent(b); // <<4>> vs M | |
b92ea2b9 | 10222 | // Isotropic cumulants: |
53884472 | 10223 | QC2 = two; |
10224 | QC4 = four-2.*pow(two,2.); | |
b92ea2b9 | 10225 | // Non-isotropic terms: |
10226 | c1 = fIntFlowCorrectionTermsForNUAVsMPro[1][0]->GetBinContent(b); // <<cos(n*phi1)>> | |
10227 | c2 = fIntFlowCorrectionTermsForNUAVsMPro[1][1]->GetBinContent(b); // <<cos(n*(phi1+phi2))>> | |
10228 | c3 = fIntFlowCorrectionTermsForNUAVsMPro[1][2]->GetBinContent(b); // <<cos(n*(phi1-phi2-phi3))>> | |
10229 | s1 = fIntFlowCorrectionTermsForNUAVsMPro[0][0]->GetBinContent(b); // <<sin(n*phi1)>> | |
10230 | s2 = fIntFlowCorrectionTermsForNUAVsMPro[0][1]->GetBinContent(b); // <<sin(n*(phi1+phi2))>> | |
10231 | s3 = fIntFlowCorrectionTermsForNUAVsMPro[0][2]->GetBinContent(b); // <<sin(n*(phi1-phi2-phi3))>> | |
10232 | // Generalized QC{2} vs M: | |
10233 | gQC2 = two - pow(c1,2.) - pow(s1,2.); | |
b77b6434 | 10234 | if(fApplyCorrectionForNUAVsM){fIntFlowQcumulantsVsM[0]->SetBinContent(b,gQC2);} |
b92ea2b9 | 10235 | // Generalized QC{4} vs M: |
10236 | gQC4 = four-2.*pow(two,2.) | |
10237 | - 4.*c1*c3+4.*s1*s3-pow(c2,2.)-pow(s2,2.) | |
10238 | + 4.*c2*(pow(c1,2.)-pow(s1,2.))+8.*s2*s1*c1 | |
10239 | + 8.*two*(pow(c1,2.)+pow(s1,2.))-6.*pow((pow(c1,2.)+pow(s1,2.)),2.); | |
b77b6434 | 10240 | if(fApplyCorrectionForNUAVsM){fIntFlowQcumulantsVsM[1]->SetBinContent(b,gQC4);} |
b92ea2b9 | 10241 | // Detector bias vs M: |
53884472 | 10242 | if(TMath::Abs(QC2)>0.) |
b92ea2b9 | 10243 | { |
53884472 | 10244 | fIntFlowDetectorBiasVsM[0]->SetBinContent(b,gQC2/QC2); |
10245 | } // end of if(TMath::Abs(QC2)>0.) | |
10246 | if(TMath::Abs(QC4)>0.) | |
b92ea2b9 | 10247 | { |
53884472 | 10248 | fIntFlowDetectorBiasVsM[1]->SetBinContent(b,gQC4/QC4); |
10249 | } // end of if(TMath::Abs(QC4)>0.) | |
b77b6434 | 10250 | // Rebin in M: |
10251 | for(Int_t co=0;co<4;co++) | |
10252 | { | |
10253 | value[co] = fIntFlowQcumulantsVsM[co]->GetBinContent(b); | |
10254 | error[co] = fIntFlowQcumulantsVsM[co]->GetBinError(b); | |
10255 | if(error[co]>0.) | |
10256 | { | |
10257 | dSum1[co]+=value[co]/(error[co]*error[co]); | |
10258 | dSum2[co]+=1./(error[co]*error[co]); | |
10259 | } | |
10260 | } // end of for(Int_t co=0;co<4;co++) | |
10261 | } // end of for(Int_t b=1;b<=nBins;b++) | |
10262 | // Store rebinned Q-cumulants: | |
10263 | if(fApplyCorrectionForNUAVsM) | |
10264 | { | |
10265 | for(Int_t co=0;co<4;co++) | |
10266 | { | |
10267 | if(dSum2[co]>0.) | |
10268 | { | |
10269 | fIntFlowQcumulantsRebinnedInM->SetBinContent(co+1,dSum1[co]/dSum2[co]); | |
10270 | fIntFlowQcumulantsRebinnedInM->SetBinError(co+1,pow(1./dSum2[co],0.5)); | |
10271 | } | |
10272 | } // end of for(Int_t co=0;co<4;co++) | |
10273 | } // end of if(fApplyCorrectionForNUAVsM) | |
10274 | } // end of if(fCalculateCumulantsVsM) | |
2001bc3a | 10275 | |
489d5531 | 10276 | } // end of void AliFlowAnalysisWithQCumulants::CalculateQcumulantsCorrectedForNUAIntFlow() |
0328db2d | 10277 | |
489d5531 | 10278 | //================================================================================================================================ |
10279 | ||
489d5531 | 10280 | void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUAIntFlow() |
10281 | { | |
0328db2d | 10282 | // From profile fIntFlowCorrectionTermsForNUAPro[sc] access measured correction terms for NUA |
489d5531 | 10283 | // and their spread, correctly calculate the statistical errors and store the final |
0328db2d | 10284 | // results and statistical errors for correction terms for NUA in histogram fIntFlowCorrectionTermsForNUAHist[sc]. |
489d5531 | 10285 | // |
10286 | // Remark: Statistical error of correction temrs is calculated as: | |
10287 | // | |
10288 | // statistical error = termA * spread * termB: | |
10289 | // termA = sqrt{sum_{i=1}^{N} w^2}/(sum_{i=1}^{N} w) | |
10290 | // termB = 1/sqrt(1-termA^2) | |
10291 | ||
b92ea2b9 | 10292 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved - promore this to data member? |
10293 | TString nonisotropicTermFlag[4] = {"(n(phi1))","(n(phi1+phi2))","(n(phi1-phi2-phi3))","(n(2phi1-phi2))"}; // to be improved - hardwired 4 | |
10294 | ||
489d5531 | 10295 | for(Int_t sc=0;sc<2;sc++) // sin or cos correction terms |
10296 | { | |
b92ea2b9 | 10297 | for(Int_t ci=1;ci<=4;ci++) // correction term index (to be improved - hardwired 4) |
489d5531 | 10298 | { |
10299 | Double_t correction = fIntFlowCorrectionTermsForNUAPro[sc]->GetBinContent(ci); | |
0328db2d | 10300 | Double_t spread = fIntFlowCorrectionTermsForNUAPro[sc]->GetBinError(ci); |
10301 | Double_t sumOfLinearEventWeights = fIntFlowSumOfEventWeightsNUA[sc][0]->GetBinContent(ci); | |
10302 | Double_t sumOfQuadraticEventWeights = fIntFlowSumOfEventWeightsNUA[sc][1]->GetBinContent(ci); | |
10303 | Double_t termA = 0.; | |
10304 | Double_t termB = 0.; | |
b92ea2b9 | 10305 | if(TMath::Abs(sumOfLinearEventWeights)>1.e-44) |
0328db2d | 10306 | { |
10307 | termA = pow(sumOfQuadraticEventWeights,0.5)/sumOfLinearEventWeights; | |
10308 | } else | |
10309 | { | |
b92ea2b9 | 10310 | cout<<" WARNING (QC): sumOfLinearEventWeights == 0 in AFAWQC::FCTFNIF() !!!!"<<endl; |
10311 | cout<<Form(" (for <<%s[%s]>> non-isotropic term)",sinCosFlag[sc].Data(),nonisotropicTermFlag[ci-1].Data())<<endl; | |
0328db2d | 10312 | } |
489d5531 | 10313 | if(1.-pow(termA,2.) > 0.) |
10314 | { | |
10315 | termB = 1./pow(1-pow(termA,2.),0.5); | |
10316 | } else | |
10317 | { | |
b92ea2b9 | 10318 | cout<<" WARNING (QC): 1.-pow(termA,2.) <= 0 in AFAWQC::FCTFNIF() !!!!"<<endl; |
10319 | cout<<Form(" (for <<%s[%s]>> non-isotropic term)",sinCosFlag[sc].Data(),nonisotropicTermFlag[ci-1].Data())<<endl; | |
489d5531 | 10320 | } |
10321 | Double_t statisticalError = termA * spread * termB; | |
489d5531 | 10322 | fIntFlowCorrectionTermsForNUAHist[sc]->SetBinContent(ci,correction); |
0328db2d | 10323 | fIntFlowCorrectionTermsForNUAHist[sc]->SetBinError(ci,statisticalError); |
b92ea2b9 | 10324 | } // end of for(Int_t ci=1;ci<=4;ci++) // correction term index |
489d5531 | 10325 | } // end of for(Int sc=0;sc<2;sc++) // sin or cos correction terms |
10326 | ||
10327 | } // end of void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUAIntFlow() | |
10328 | ||
489d5531 | 10329 | //================================================================================================================================ |
10330 | ||
489d5531 | 10331 | void AliFlowAnalysisWithQCumulants::GetPointersForNestedLoopsHistograms() |
10332 | { | |
10333 | // Get pointers to all objects relevant for calculations with nested loops. | |
10334 | ||
10335 | TList *nestedLoopsList = dynamic_cast<TList*>(fHistList->FindObject("Nested Loops")); | |
10336 | if(nestedLoopsList) | |
10337 | { | |
10338 | this->SetNestedLoopsList(nestedLoopsList); | |
10339 | } else | |
10340 | { | |
10341 | cout<<"WARNING: nestedLoopsList is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
10342 | exit(0); | |
10343 | } | |
10344 | ||
10345 | TString sinCosFlag[2] = {"sin","cos"}; // to be improved (should I promote this to data members?) | |
10346 | TString typeFlag[2] = {"RP","POI"}; // to be improved (should I promote this to data members?) | |
10347 | TString ptEtaFlag[2] = {"p_{T}","#eta"}; // to be improved (should I promote this to data members?) | |
10348 | TString reducedCorrelationIndex[4] = {"<2'>","<4'>","<6'>","<8'>"}; // to be improved (should I promote this to data members?) | |
10349 | ||
10350 | TString evaluateNestedLoopsName = "fEvaluateNestedLoops"; | |
10351 | evaluateNestedLoopsName += fAnalysisLabel->Data(); | |
10352 | TProfile *evaluateNestedLoops = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(evaluateNestedLoopsName.Data())); | |
10353 | Bool_t bEvaluateIntFlowNestedLoops = kFALSE; | |
10354 | Bool_t bEvaluateDiffFlowNestedLoops = kFALSE; | |
10355 | if(evaluateNestedLoops) | |
10356 | { | |
10357 | this->SetEvaluateNestedLoops(evaluateNestedLoops); | |
10358 | bEvaluateIntFlowNestedLoops = (Int_t)evaluateNestedLoops->GetBinContent(1); | |
10359 | bEvaluateDiffFlowNestedLoops = (Int_t)evaluateNestedLoops->GetBinContent(2); | |
10360 | } | |
10361 | // nested loops relevant for integrated flow: | |
10362 | if(bEvaluateIntFlowNestedLoops) | |
10363 | { | |
10364 | // correlations: | |
10365 | TString intFlowDirectCorrelationsName = "fIntFlowDirectCorrelations"; | |
10366 | intFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
10367 | TProfile *intFlowDirectCorrelations = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(intFlowDirectCorrelationsName.Data())); | |
10368 | if(intFlowDirectCorrelations) | |
10369 | { | |
10370 | this->SetIntFlowDirectCorrelations(intFlowDirectCorrelations); | |
10371 | } else | |
10372 | { | |
10373 | cout<<"WARNING: intFlowDirectCorrelations is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
10374 | exit(0); | |
10375 | } | |
403e3389 | 10376 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 10377 | { |
10378 | TString intFlowExtraDirectCorrelationsName = "fIntFlowExtraDirectCorrelations"; | |
10379 | intFlowExtraDirectCorrelationsName += fAnalysisLabel->Data(); | |
10380 | TProfile *intFlowExtraDirectCorrelations = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(intFlowExtraDirectCorrelationsName.Data())); | |
10381 | if(intFlowExtraDirectCorrelations) | |
10382 | { | |
10383 | this->SetIntFlowExtraDirectCorrelations(intFlowExtraDirectCorrelations); | |
10384 | } else | |
10385 | { | |
10386 | cout<<"WARNING: intFlowExtraDirectCorrelations is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
10387 | exit(0); | |
10388 | } | |
403e3389 | 10389 | } // end of if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 10390 | // correction terms for non-uniform acceptance: |
10391 | TString intFlowDirectCorrectionTermsForNUAName = "fIntFlowDirectCorrectionTermsForNUA"; | |
10392 | intFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
10393 | TProfile *intFlowDirectCorrectionTermsForNUA[2] = {NULL}; | |
10394 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
10395 | { | |
10396 | intFlowDirectCorrectionTermsForNUA[sc] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s: %s terms",intFlowDirectCorrectionTermsForNUAName.Data(),sinCosFlag[sc].Data()))); | |
10397 | if(intFlowDirectCorrectionTermsForNUA[sc]) | |
10398 | { | |
10399 | this->SetIntFlowDirectCorrectionTermsForNUA(intFlowDirectCorrectionTermsForNUA[sc],sc); | |
10400 | } else | |
10401 | { | |
10402 | cout<<"WARNING: intFlowDirectCorrectionTermsForNUA[sc] is NULL in AFAWQC::GPFNLH() !!!!"<<endl; | |
10403 | cout<<"sc = "<<sc<<endl; | |
10404 | exit(0); | |
10405 | } | |
10406 | } // end of for(Int_t sc=0;sc<2;sc++) | |
10407 | } // end of if(bEvaluateIntFlowNestedLoops) | |
10408 | ||
10409 | // nested loops relevant for differential flow: | |
10410 | if(bEvaluateDiffFlowNestedLoops) | |
10411 | { | |
10412 | // correlations: | |
10413 | TString diffFlowDirectCorrelationsName = "fDiffFlowDirectCorrelations"; | |
10414 | diffFlowDirectCorrelationsName += fAnalysisLabel->Data(); | |
10415 | TProfile *diffFlowDirectCorrelations[2][2][4] = {{{NULL}}}; | |
10416 | for(Int_t t=0;t<2;t++) | |
10417 | { | |
10418 | for(Int_t pe=0;pe<2;pe++) | |
10419 | { | |
10420 | for(Int_t ci=0;ci<4;ci++) // correlation index | |
10421 | { | |
10422 | diffFlowDirectCorrelations[t][pe][ci] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s",diffFlowDirectCorrelationsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),reducedCorrelationIndex[ci].Data()))); | |
10423 | if(diffFlowDirectCorrelations[t][pe][ci]) | |
10424 | { | |
10425 | this->SetDiffFlowDirectCorrelations(diffFlowDirectCorrelations[t][pe][ci],t,pe,ci); | |
10426 | } else | |
10427 | { | |
10428 | cout<<"WARNING: diffFlowDirectCorrelations[t][pe][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
10429 | cout<<"t = "<<t<<endl; | |
10430 | cout<<"pe = "<<pe<<endl; | |
10431 | cout<<"ci = "<<ci<<endl; | |
10432 | } | |
10433 | } // end of for(Int_t ci=0;ci<4;ci++) // correlation index | |
10434 | } // end of for(Int_t pe=0;pe<2;pe++) | |
10435 | } // end of for(Int_t t=0;t<2;t++) | |
10436 | // correction terms for non-uniform acceptance: | |
10437 | TString diffFlowDirectCorrectionTermsForNUAName = "fDiffFlowDirectCorrectionTermsForNUA"; | |
10438 | diffFlowDirectCorrectionTermsForNUAName += fAnalysisLabel->Data(); | |
10439 | TProfile *diffFlowDirectCorrectionTermsForNUA[2][2][2][10] = {{{{NULL}}}}; | |
10440 | for(Int_t t=0;t<2;t++) | |
10441 | { | |
10442 | for(Int_t pe=0;pe<2;pe++) | |
10443 | { | |
10444 | // correction terms for NUA: | |
10445 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
10446 | { | |
10447 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
10448 | { | |
10449 | diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s, cti = %d",diffFlowDirectCorrectionTermsForNUAName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),cti+1))); | |
10450 | if(diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]) | |
10451 | { | |
10452 | this->SetDiffFlowDirectCorrectionTermsForNUA(diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti],t,pe,sc,cti); | |
10453 | } else | |
10454 | { | |
10455 | cout<<"WARNING: diffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
10456 | cout<<"t = "<<t<<endl; | |
10457 | cout<<"pe = "<<pe<<endl; | |
10458 | cout<<"sc = "<<sc<<endl; | |
10459 | cout<<"cti = "<<cti<<endl; | |
10460 | } | |
10461 | } // end of for(Int_t cti=0;cti<9;cti++) // correction term index | |
10462 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
10463 | } // end of for(Int_t pe=0;pe<2;pe++) | |
10464 | } // end of for(Int_t t=0;t<2;t++) | |
64e500e3 | 10465 | // other differential correlators: |
10466 | TString otherDirectDiffCorrelatorsName = "fOtherDirectDiffCorrelators"; | |
10467 | otherDirectDiffCorrelatorsName += fAnalysisLabel->Data(); | |
10468 | TProfile *otherDirectDiffCorrelators[2][2][2][1] = {{{{NULL}}}}; | |
10469 | for(Int_t t=0;t<2;t++) | |
10470 | { | |
10471 | for(Int_t pe=0;pe<2;pe++) | |
10472 | { | |
10473 | // correction terms for NUA: | |
10474 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
10475 | { | |
10476 | for(Int_t ci=0;ci<1;ci++) // correlator index | |
10477 | { | |
10478 | otherDirectDiffCorrelators[t][pe][sc][ci] = dynamic_cast<TProfile*>(nestedLoopsList->FindObject(Form("%s, %s, %s, %s, ci = %d",otherDirectDiffCorrelatorsName.Data(),typeFlag[t].Data(),ptEtaFlag[pe].Data(),sinCosFlag[sc].Data(),ci+1))); | |
10479 | if(otherDirectDiffCorrelators[t][pe][sc][ci]) | |
10480 | { | |
10481 | this->SetOtherDirectDiffCorrelators(otherDirectDiffCorrelators[t][pe][sc][ci],t,pe,sc,ci); | |
10482 | } else | |
10483 | { | |
10484 | cout<<"WARNING: otherDirectDiffCorrelators[t][pe][sc][ci] is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
10485 | cout<<"t = "<<t<<endl; | |
10486 | cout<<"pe = "<<pe<<endl; | |
10487 | cout<<"sc = "<<sc<<endl; | |
10488 | cout<<"ci = "<<ci<<endl; | |
10489 | } | |
10490 | } // end of for(Int_t ci=0;ci<9;ci++) // correction term index | |
10491 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
10492 | } // end of for(Int_t pe=0;pe<2;pe++) | |
10493 | } // end of for(Int_t t=0;t<2;t++) | |
489d5531 | 10494 | // number of RPs and POIs in selected pt and eta bins for cross-checkings: |
10495 | TString noOfParticlesInBinName = "fNoOfParticlesInBin"; | |
10496 | TH1D *noOfParticlesInBin = NULL; | |
10497 | noOfParticlesInBin = dynamic_cast<TH1D*>(nestedLoopsList->FindObject(noOfParticlesInBinName.Data())); | |
10498 | if(noOfParticlesInBin) | |
10499 | { | |
10500 | this->SetNoOfParticlesInBin(noOfParticlesInBin); | |
10501 | } else | |
10502 | { | |
10503 | cout<<endl; | |
10504 | cout<<" WARNING (QC): noOfParticlesInBin is NULL in AFAWQC::GPFDFH() !!!!"<<endl; | |
10505 | cout<<endl; | |
10506 | } | |
10507 | } // end of if(bEvaluateDiffFlowNestedLoops) | |
10508 | ||
10509 | } // end of void AliFlowAnalysisWithQCumulants::GetPointersForNestedLoopsHistograms() | |
10510 | ||
489d5531 | 10511 | //================================================================================================================================ |
10512 | ||
489d5531 | 10513 | void AliFlowAnalysisWithQCumulants::StoreHarmonic() |
10514 | { | |
10515 | // Store flow harmonic in common control histograms. | |
10516 | ||
10517 | (fCommonHists->GetHarmonic())->Fill(0.5,fHarmonic); | |
dd442cd2 | 10518 | if(fFillMultipleControlHistograms) |
10519 | { | |
10520 | (fCommonHists2nd->GetHarmonic())->Fill(0.5,fHarmonic); | |
10521 | (fCommonHists4th->GetHarmonic())->Fill(0.5,fHarmonic); | |
10522 | (fCommonHists6th->GetHarmonic())->Fill(0.5,fHarmonic); | |
10523 | (fCommonHists8th->GetHarmonic())->Fill(0.5,fHarmonic); | |
10524 | } | |
10525 | ||
489d5531 | 10526 | } // end of void AliFlowAnalysisWithQCumulants::StoreHarmonic() |
10527 | ||
489d5531 | 10528 | //================================================================================================================================ |
10529 | ||
489d5531 | 10530 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelationsUsingParticleWeights(TString type, TString ptOrEta) // type = RP or POI |
10531 | { | |
10532 | // Calculate all correlations needed for differential flow using particle weights. | |
10533 | ||
2a98ceb8 | 10534 | Int_t t = 0; // type flag |
10535 | Int_t pe = 0; // ptEta flag | |
489d5531 | 10536 | |
10537 | if(type == "RP") | |
10538 | { | |
10539 | t = 0; | |
10540 | } else if(type == "POI") | |
10541 | { | |
10542 | t = 1; | |
10543 | } | |
10544 | ||
10545 | if(ptOrEta == "Pt") | |
10546 | { | |
10547 | pe = 0; | |
10548 | } else if(ptOrEta == "Eta") | |
10549 | { | |
10550 | pe = 1; | |
10551 | } | |
10552 | ||
10553 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
10554 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
10555 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
10556 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
10557 | ||
10558 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
10559 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
10560 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
10561 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
10562 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
10563 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
10564 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
10565 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
10566 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
10567 | ||
1268c371 | 10568 | // S^M_{p,k} (see .h file for the definition of fSpk): |
10569 | Double_t dSM1p1k = (*fSpk)(0,1); | |
10570 | Double_t dSM1p2k = (*fSpk)(0,2); | |
10571 | Double_t dSM1p3k = (*fSpk)(0,3); | |
10572 | Double_t dSM2p1k = (*fSpk)(1,1); | |
10573 | Double_t dSM3p1k = (*fSpk)(2,1); | |
489d5531 | 10574 | |
10575 | // looping over all bins and calculating reduced correlations: | |
10576 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10577 | { | |
10578 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular (pt,eta) bin): | |
10579 | Double_t p1n0kRe = 0.; | |
10580 | Double_t p1n0kIm = 0.; | |
10581 | ||
10582 | // number of POIs in particular (pt,eta) bin): | |
10583 | Double_t mp = 0.; | |
10584 | ||
10585 | // real and imaginary parts of q_{m*n,k}: | |
10586 | // (weighted Q-vector evaluated for particles which are both RPs and POIs in particular (pt,eta) bin) | |
10587 | Double_t q1n2kRe = 0.; | |
10588 | Double_t q1n2kIm = 0.; | |
10589 | Double_t q2n1kRe = 0.; | |
10590 | Double_t q2n1kIm = 0.; | |
10591 | ||
10592 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
10593 | Double_t s1p1k = 0.; | |
10594 | Double_t s1p2k = 0.; | |
10595 | Double_t s1p3k = 0.; | |
10596 | ||
10597 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
10598 | Double_t dM0111 = 0.; | |
10599 | ||
10600 | if(type == "POI") | |
10601 | { | |
10602 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
10603 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
10604 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
10605 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
10606 | ||
10607 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10608 | ||
10609 | t = 1; // typeFlag = RP or POI | |
10610 | ||
10611 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
10612 | q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
10613 | * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
10614 | q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
10615 | * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
10616 | q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
10617 | * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
10618 | q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
10619 | * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
10620 | ||
10621 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
10622 | s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); | |
10623 | s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); | |
10624 | s1p3k = pow(fs1dEBE[2][pe][3]->GetBinContent(b)*fs1dEBE[2][pe][3]->GetBinEntries(b),1.); | |
10625 | ||
10626 | // M0111 from Eq. (118) in QC2c (to be improved (notation)): | |
10627 | dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k) | |
10628 | - 3.*(s1p1k*(dSM2p1k-dSM1p2k) | |
10629 | + 2.*(s1p3k-s1p2k*dSM1p1k)); | |
10630 | } | |
10631 | else if(type == "RP") | |
10632 | { | |
10633 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
10634 | q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
10635 | * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
10636 | q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
10637 | * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
10638 | q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
10639 | * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
10640 | q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
10641 | * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
10642 | ||
10643 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
10644 | s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); | |
10645 | s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); | |
10646 | s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); | |
10647 | ||
10648 | // to be improved (cross-checked): | |
10649 | p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
10650 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
10651 | p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
10652 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
10653 | ||
10654 | mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10655 | ||
10656 | t = 0; // typeFlag = RP or POI | |
10657 | ||
10658 | // M0111 from Eq. (118) in QC2c (to be improved (notation)): | |
10659 | dM0111 = mp*(dSM3p1k-3.*dSM1p1k*dSM1p2k+2.*dSM1p3k) | |
10660 | - 3.*(s1p1k*(dSM2p1k-dSM1p2k) | |
10661 | + 2.*(s1p3k-s1p2k*dSM1p1k)); | |
10662 | //............................................................................................... | |
10663 | } | |
10664 | ||
10665 | // 2'-particle correlation: | |
10666 | Double_t two1n1nW0W1 = 0.; | |
10667 | if(mp*dSM1p1k-s1p1k) | |
10668 | { | |
10669 | two1n1nW0W1 = (p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k-s1p1k) | |
10670 | / (mp*dSM1p1k-s1p1k); | |
10671 | ||
10672 | // fill profile to get <<2'>> | |
b40a910e | 10673 | fDiffFlowCorrelationsPro[t][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nW0W1,mp*dSM1p1k-s1p1k); |
10674 | // fill profile to get <<2'>^2> | |
10675 | fDiffFlowSquaredCorrelationsPro[t][pe][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],two1n1nW0W1*two1n1nW0W1,mp*dSM1p1k-s1p1k); | |
489d5531 | 10676 | // histogram to store <2'> e-b-e (needed in some other methods): |
10677 | fDiffFlowCorrelationsEBE[t][pe][0]->SetBinContent(b,two1n1nW0W1); | |
10678 | fDiffFlowEventWeightsForCorrelationsEBE[t][pe][0]->SetBinContent(b,mp*dSM1p1k-s1p1k); | |
10679 | } // end of if(mp*dSM1p1k-s1p1k) | |
10680 | ||
10681 | // 4'-particle correlation: | |
10682 | Double_t four1n1n1n1nW0W1W1W1 = 0.; | |
10683 | if(dM0111) | |
10684 | { | |
10685 | four1n1n1n1nW0W1W1W1 = ((pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k) | |
10686 | - q2n1kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.)) | |
10687 | - 2.*q2n1kIm*dReQ1n1k*dImQ1n1k | |
10688 | - p1n0kRe*(dReQ1n1k*dReQ2n2k+dImQ1n1k*dImQ2n2k) | |
10689 | + p1n0kIm*(dImQ1n1k*dReQ2n2k-dReQ1n1k*dImQ2n2k) | |
10690 | - 2.*dSM1p2k*(p1n0kRe*dReQ1n1k+p1n0kIm*dImQ1n1k) | |
10691 | - 2.*(pow(dReQ1n1k,2.)+pow(dImQ1n1k,2.))*s1p1k | |
10692 | + 6.*(q1n2kRe*dReQ1n1k+q1n2kIm*dImQ1n1k) | |
10693 | + 1.*(q2n1kRe*dReQ2n2k+q2n1kIm*dImQ2n2k) | |
10694 | + 2.*(p1n0kRe*dReQ1n3k+p1n0kIm*dImQ1n3k) | |
10695 | + 2.*s1p1k*dSM1p2k | |
10696 | - 6.*s1p3k) | |
10697 | / dM0111; // to be improved (notation of dM0111) | |
10698 | ||
10699 | // fill profile to get <<4'>> | |
b40a910e | 10700 | fDiffFlowCorrelationsPro[t][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nW0W1W1W1,dM0111); |
10701 | // fill profile to get <<4'>^2> | |
10702 | fDiffFlowSquaredCorrelationsPro[t][pe][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],four1n1n1n1nW0W1W1W1*four1n1n1n1nW0W1W1W1,dM0111); | |
489d5531 | 10703 | // histogram to store <4'> e-b-e (needed in some other methods): |
10704 | fDiffFlowCorrelationsEBE[t][pe][1]->SetBinContent(b,four1n1n1n1nW0W1W1W1); | |
10705 | fDiffFlowEventWeightsForCorrelationsEBE[t][pe][1]->SetBinContent(b,dM0111); | |
10706 | } // end of if(dM0111) | |
10707 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10708 | ||
10709 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrelationsUsingParticleWeights(TString type, TString ptOrEta); // type = RP or POI | |
10710 | ||
489d5531 | 10711 | //================================================================================================================================ |
10712 | ||
489d5531 | 10713 | void AliFlowAnalysisWithQCumulants::FillCommonControlHistograms(AliFlowEventSimple *anEvent) |
10714 | { | |
10715 | // Fill common control histograms. | |
10716 | ||
10717 | Int_t nRP = anEvent->GetEventNSelTracksRP(); // number of RPs (i.e. number of particles used to determine the reaction plane) | |
10718 | fCommonHists->FillControlHistograms(anEvent); | |
dd442cd2 | 10719 | if(fFillMultipleControlHistograms) |
489d5531 | 10720 | { |
dd442cd2 | 10721 | if(nRP>1) |
489d5531 | 10722 | { |
dd442cd2 | 10723 | fCommonHists2nd->FillControlHistograms(anEvent); |
10724 | if(nRP>3) | |
489d5531 | 10725 | { |
dd442cd2 | 10726 | fCommonHists4th->FillControlHistograms(anEvent); |
10727 | if(nRP>5) | |
489d5531 | 10728 | { |
dd442cd2 | 10729 | fCommonHists6th->FillControlHistograms(anEvent); |
10730 | if(nRP>7) | |
10731 | { | |
10732 | fCommonHists8th->FillControlHistograms(anEvent); | |
10733 | } // end of if(nRP>7) | |
10734 | } // end of if(nRP>5) | |
10735 | } // end of if(nRP>3) | |
10736 | } // end of if(nRP>1) | |
10737 | } // end of if(fFillMultipleControlHistograms) | |
489d5531 | 10738 | |
10739 | } // end of void AliFlowAnalysisWithQCumulants::FillCommonControlHistograms(AliFlowEventSimple *anEvent) | |
10740 | ||
489d5531 | 10741 | //================================================================================================================================ |
10742 | ||
489d5531 | 10743 | void AliFlowAnalysisWithQCumulants::ResetEventByEventQuantities() |
10744 | { | |
10745 | // Reset all event by event quantities. | |
10746 | ||
1268c371 | 10747 | // Reference flow: |
489d5531 | 10748 | fReQ->Zero(); |
10749 | fImQ->Zero(); | |
1268c371 | 10750 | fSpk->Zero(); |
489d5531 | 10751 | fIntFlowCorrelationsEBE->Reset(); |
10752 | fIntFlowEventWeightsForCorrelationsEBE->Reset(); | |
10753 | fIntFlowCorrelationsAllEBE->Reset(); | |
10754 | ||
b92ea2b9 | 10755 | for(Int_t sc=0;sc<2;sc++) |
489d5531 | 10756 | { |
b92ea2b9 | 10757 | fIntFlowCorrectionTermsForNUAEBE[sc]->Reset(); |
10758 | fIntFlowEventWeightForCorrectionTermsForNUAEBE[sc]->Reset(); | |
489d5531 | 10759 | } |
10760 | ||
1268c371 | 10761 | // Differential flow: |
10762 | if(fCalculateDiffFlow) | |
489d5531 | 10763 | { |
1268c371 | 10764 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) |
489d5531 | 10765 | { |
62e36168 | 10766 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // 1D in pt or eta |
489d5531 | 10767 | { |
1268c371 | 10768 | for(Int_t m=0;m<4;m++) // multiple of harmonic |
489d5531 | 10769 | { |
1268c371 | 10770 | for(Int_t k=0;k<9;k++) // power of weight |
10771 | { | |
10772 | if(fReRPQ1dEBE[t][pe][m][k]) fReRPQ1dEBE[t][pe][m][k]->Reset(); | |
10773 | if(fImRPQ1dEBE[t][pe][m][k]) fImRPQ1dEBE[t][pe][m][k]->Reset(); | |
10774 | } | |
10775 | } | |
489d5531 | 10776 | } |
1268c371 | 10777 | } |
10778 | for(Int_t t=0;t<3;t++) // type (0 = RP, 1 = POI, 2 = RP&&POI ) | |
10779 | { | |
62e36168 | 10780 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // 1D in pt or eta |
489d5531 | 10781 | { |
1268c371 | 10782 | for(Int_t k=0;k<9;k++) |
10783 | { | |
10784 | if(fs1dEBE[t][pe][k]) fs1dEBE[t][pe][k]->Reset(); | |
10785 | } | |
489d5531 | 10786 | } |
10787 | } | |
1268c371 | 10788 | // e-b-e reduced correlations: |
10789 | for(Int_t t=0;t<2;t++) // type (0 = RP, 1 = POI) | |
10790 | { | |
62e36168 | 10791 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 10792 | { |
1268c371 | 10793 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index |
10794 | { | |
10795 | if(fDiffFlowCorrelationsEBE[t][pe][rci]) fDiffFlowCorrelationsEBE[t][pe][rci]->Reset(); | |
10796 | if(fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci]) fDiffFlowEventWeightsForCorrelationsEBE[t][pe][rci]->Reset(); | |
10797 | } | |
489d5531 | 10798 | } |
1268c371 | 10799 | } |
10800 | // correction terms for NUA: | |
10801 | for(Int_t t=0;t<2;t++) // type (0 = RP, 1 = POI) | |
10802 | { | |
62e36168 | 10803 | for(Int_t pe=0;pe<1+(Int_t)fCalculateDiffFlowVsEta;pe++) // pt or eta |
489d5531 | 10804 | { |
1268c371 | 10805 | for(Int_t sc=0;sc<2;sc++) // sin or cos |
489d5531 | 10806 | { |
1268c371 | 10807 | for(Int_t cti=0;cti<9;cti++) // correction term index |
10808 | { | |
489d5531 | 10809 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][sc][cti]->Reset(); |
1268c371 | 10810 | } |
489d5531 | 10811 | } |
1268c371 | 10812 | } |
10813 | } | |
10814 | } // end of if(fCalculateDiffFlow) | |
10815 | ||
489d5531 | 10816 | // 2D (pt,eta) |
1268c371 | 10817 | if(fCalculate2DDiffFlow) |
489d5531 | 10818 | { |
10819 | for(Int_t t=0;t<3;t++) // type (RP, POI, POI&&RP) | |
10820 | { | |
10821 | for(Int_t m=0;m<4;m++) // multiple of harmonic | |
10822 | { | |
10823 | for(Int_t k=0;k<9;k++) // power of weight | |
10824 | { | |
b77b6434 | 10825 | if(fReRPQ2dEBE[t][m][k]){fReRPQ2dEBE[t][m][k]->Reset();} |
10826 | if(fImRPQ2dEBE[t][m][k]){fImRPQ2dEBE[t][m][k]->Reset();} | |
489d5531 | 10827 | } |
10828 | } | |
10829 | } | |
10830 | for(Int_t t=0;t<3;t++) // type (0 = RP, 1 = POI, 2 = RP&&POI ) | |
10831 | { | |
10832 | for(Int_t k=0;k<9;k++) | |
10833 | { | |
b77b6434 | 10834 | if(fs2dEBE[t][k]){fs2dEBE[t][k]->Reset();} |
489d5531 | 10835 | } |
10836 | } | |
1268c371 | 10837 | } // end of if(fCalculate2DDiffFlow) |
489d5531 | 10838 | |
10839 | } // end of void AliFlowAnalysisWithQCumulants::ResetEventByEventQuantities(); | |
10840 | ||
489d5531 | 10841 | //================================================================================================================================ |
10842 | ||
489d5531 | 10843 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTerms(TString type, TString ptOrEta) |
10844 | { | |
10845 | // Calculate correction terms for non-uniform acceptance for differential flow (sin terms). | |
10846 | ||
10847 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][0][cti], where cti runs as follows: | |
10848 | // 0: <<sin n(psi1)>> | |
10849 | // 1: <<sin n(psi1+phi2)>> | |
10850 | // 2: <<sin n(psi1+phi2-phi3)>> | |
10851 | // 3: <<sin n(psi1-phi2-phi3)>>: | |
10852 | // 4: | |
10853 | // 5: | |
10854 | // 6: | |
10855 | ||
10856 | // multiplicity: | |
1268c371 | 10857 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 10858 | |
10859 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
10860 | Double_t dReQ1n = (*fReQ)(0,0); | |
10861 | Double_t dReQ2n = (*fReQ)(1,0); | |
10862 | //Double_t dReQ3n = (*fReQ)(2,0); | |
10863 | //Double_t dReQ4n = (*fReQ)(3,0); | |
10864 | Double_t dImQ1n = (*fImQ)(0,0); | |
10865 | Double_t dImQ2n = (*fImQ)(1,0); | |
10866 | //Double_t dImQ3n = (*fImQ)(2,0); | |
10867 | //Double_t dImQ4n = (*fImQ)(3,0); | |
10868 | ||
2a98ceb8 | 10869 | Int_t t = 0; // type flag |
10870 | Int_t pe = 0; // ptEta flag | |
489d5531 | 10871 | |
10872 | if(type == "RP") | |
10873 | { | |
10874 | t = 0; | |
10875 | } else if(type == "POI") | |
10876 | { | |
10877 | t = 1; | |
10878 | } | |
10879 | ||
10880 | if(ptOrEta == "Pt") | |
10881 | { | |
10882 | pe = 0; | |
10883 | } else if(ptOrEta == "Eta") | |
10884 | { | |
10885 | pe = 1; | |
10886 | } | |
10887 | ||
10888 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
10889 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
10890 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
10891 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
10892 | ||
10893 | // looping over all bins and calculating correction terms: | |
10894 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
10895 | { | |
10896 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
10897 | Double_t p1n0kRe = 0.; | |
10898 | Double_t p1n0kIm = 0.; | |
10899 | ||
10900 | // number of POIs in particular pt or eta bin: | |
10901 | Double_t mp = 0.; | |
10902 | ||
10903 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
10904 | Double_t q1n0kRe = 0.; | |
10905 | Double_t q1n0kIm = 0.; | |
10906 | Double_t q2n0kRe = 0.; | |
10907 | Double_t q2n0kIm = 0.; | |
10908 | ||
10909 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
10910 | Double_t mq = 0.; | |
10911 | ||
10912 | if(type == "POI") | |
10913 | { | |
10914 | // q_{m*n,0}: | |
10915 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
10916 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
10917 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
10918 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
10919 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
10920 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
10921 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
10922 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
10923 | ||
10924 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10925 | } | |
10926 | else if(type == "RP") | |
10927 | { | |
10928 | // q_{m*n,0}: | |
10929 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
10930 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
10931 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
10932 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
10933 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
10934 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
10935 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
10936 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
10937 | ||
10938 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10939 | } | |
10940 | if(type == "POI") | |
10941 | { | |
10942 | // p_{m*n,0}: | |
10943 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
10944 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
10945 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
10946 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
10947 | ||
10948 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
10949 | ||
10950 | t = 1; // typeFlag = RP or POI | |
10951 | } | |
10952 | else if(type == "RP") | |
10953 | { | |
10954 | // p_{m*n,0} = q_{m*n,0}: | |
10955 | p1n0kRe = q1n0kRe; | |
10956 | p1n0kIm = q1n0kIm; | |
10957 | ||
10958 | mp = mq; | |
10959 | ||
10960 | t = 0; // typeFlag = RP or POI | |
10961 | } | |
10962 | ||
10963 | // <<sin n(psi1)>>: | |
10964 | Double_t sinP1nPsi = 0.; | |
10965 | if(mp) | |
10966 | { | |
10967 | sinP1nPsi = p1n0kIm/mp; | |
10968 | // fill profile for <<sin n(psi1)>>: | |
10969 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi,mp); | |
10970 | // histogram to store <sin n(psi1)> e-b-e (needed in some other methods): | |
10971 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][0]->SetBinContent(b,sinP1nPsi); | |
10972 | } // end of if(mp) | |
10973 | ||
10974 | // <<sin n(psi1+phi2)>>: | |
10975 | Double_t sinP1nPsiP1nPhi = 0.; | |
10976 | if(mp*dMult-mq) | |
10977 | { | |
10978 | sinP1nPsiP1nPhi = (p1n0kRe*dImQ1n+p1n0kIm*dReQ1n-q2n0kIm)/(mp*dMult-mq); | |
10979 | // fill profile for <<sin n(psi1+phi2)>>: | |
10980 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsiP1nPhi,mp*dMult-mq); | |
10981 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
10982 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][1]->SetBinContent(b,sinP1nPsiP1nPhi); | |
10983 | } // end of if(mp*dMult-mq) | |
10984 | ||
10985 | // <<sin n(psi1+phi2-phi3)>>: | |
10986 | Double_t sinP1nPsi1P1nPhi2MPhi3 = 0.; | |
10987 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
10988 | { | |
10989 | sinP1nPsi1P1nPhi2MPhi3 = (p1n0kIm*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult) | |
10990 | - 1.*(q2n0kIm*dReQ1n-q2n0kRe*dImQ1n) | |
10991 | - mq*dImQ1n+2.*q1n0kIm) | |
10992 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
10993 | // fill profile for <<sin n(psi1+phi2)>>: | |
10994 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
10995 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
10996 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][2]->SetBinContent(b,sinP1nPsi1P1nPhi2MPhi3); | |
10997 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
10998 | ||
10999 | // <<sin n(psi1-phi2-phi3)>>: | |
11000 | Double_t sinP1nPsi1M1nPhi2MPhi3 = 0.; | |
11001 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
11002 | { | |
11003 | sinP1nPsi1M1nPhi2MPhi3 = (p1n0kIm*(pow(dReQ1n,2.)-pow(dImQ1n,2.))-2.*p1n0kRe*dReQ1n*dImQ1n | |
11004 | - 1.*(p1n0kIm*dReQ2n-p1n0kRe*dImQ2n) | |
11005 | + 2.*mq*dImQ1n-2.*q1n0kIm) | |
11006 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
11007 | // fill profile for <<sin n(psi1+phi2)>>: | |
11008 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
11009 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
11010 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][3]->SetBinContent(b,sinP1nPsi1M1nPhi2MPhi3); | |
11011 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
11012 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
11013 | ||
11014 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTerms(TString type, TString ptOrEta) | |
11015 | ||
11016 | ||
11017 | //================================================================================================================================ | |
11018 | ||
11019 | ||
11020 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTerms(TString type, TString ptOrEta) | |
11021 | { | |
11022 | // Calculate correction terms for non-uniform acceptance for differential flow (cos terms). | |
11023 | ||
11024 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][1][cti], where cti runs as follows: | |
11025 | // 0: <<cos n(psi)>> | |
11026 | // 1: <<cos n(psi1+phi2)>> | |
11027 | // 2: <<cos n(psi1+phi2-phi3)>> | |
11028 | // 3: <<cos n(psi1-phi2-phi3)>> | |
11029 | // 4: | |
11030 | // 5: | |
11031 | // 6: | |
11032 | ||
11033 | // multiplicity: | |
1268c371 | 11034 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 11035 | |
11036 | // real and imaginary parts of non-weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
11037 | Double_t dReQ1n = (*fReQ)(0,0); | |
11038 | Double_t dReQ2n = (*fReQ)(1,0); | |
11039 | //Double_t dReQ3n = (*fReQ)(2,0); | |
11040 | //Double_t dReQ4n = (*fReQ)(3,0); | |
11041 | Double_t dImQ1n = (*fImQ)(0,0); | |
11042 | Double_t dImQ2n = (*fImQ)(1,0); | |
11043 | //Double_t dImQ3n = (*fImQ)(2,0); | |
11044 | //Double_t dImQ4n = (*fImQ)(3,0); | |
11045 | ||
2a98ceb8 | 11046 | Int_t t = 0; // type flag |
11047 | Int_t pe = 0; // ptEta flag | |
489d5531 | 11048 | |
11049 | if(type == "RP") | |
11050 | { | |
11051 | t = 0; | |
11052 | } else if(type == "POI") | |
11053 | { | |
11054 | t = 1; | |
11055 | } | |
11056 | ||
11057 | if(ptOrEta == "Pt") | |
11058 | { | |
11059 | pe = 0; | |
11060 | } else if(ptOrEta == "Eta") | |
11061 | { | |
11062 | pe = 1; | |
11063 | } | |
11064 | ||
11065 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
11066 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
11067 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
11068 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
11069 | ||
11070 | // looping over all bins and calculating correction terms: | |
11071 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
11072 | { | |
11073 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
11074 | Double_t p1n0kRe = 0.; | |
11075 | Double_t p1n0kIm = 0.; | |
11076 | ||
11077 | // number of POIs in particular pt or eta bin: | |
11078 | Double_t mp = 0.; | |
11079 | ||
11080 | // real and imaginary parts of q_{m*n,0} (non-weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
11081 | Double_t q1n0kRe = 0.; | |
11082 | Double_t q1n0kIm = 0.; | |
11083 | Double_t q2n0kRe = 0.; | |
11084 | Double_t q2n0kIm = 0.; | |
11085 | ||
11086 | // number of particles which are both RPs and POIs in particular pt or eta bin: | |
11087 | Double_t mq = 0.; | |
11088 | ||
11089 | if(type == "POI") | |
11090 | { | |
11091 | // q_{m*n,0}: | |
11092 | q1n0kRe = fReRPQ1dEBE[2][pe][0][0]->GetBinContent(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
11093 | * fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
11094 | q1n0kIm = fImRPQ1dEBE[2][pe][0][0]->GetBinContent(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)) | |
11095 | * fImRPQ1dEBE[2][pe][0][0]->GetBinEntries(fImRPQ1dEBE[2][pe][0][0]->GetBin(b)); | |
11096 | q2n0kRe = fReRPQ1dEBE[2][pe][1][0]->GetBinContent(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
11097 | * fReRPQ1dEBE[2][pe][1][0]->GetBinEntries(fReRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
11098 | q2n0kIm = fImRPQ1dEBE[2][pe][1][0]->GetBinContent(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)) | |
11099 | * fImRPQ1dEBE[2][pe][1][0]->GetBinEntries(fImRPQ1dEBE[2][pe][1][0]->GetBin(b)); | |
11100 | ||
11101 | mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
11102 | } | |
11103 | else if(type == "RP") | |
11104 | { | |
11105 | // q_{m*n,0}: | |
11106 | q1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
11107 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
11108 | q1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
11109 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
11110 | q2n0kRe = fReRPQ1dEBE[0][pe][1][0]->GetBinContent(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
11111 | * fReRPQ1dEBE[0][pe][1][0]->GetBinEntries(fReRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
11112 | q2n0kIm = fImRPQ1dEBE[0][pe][1][0]->GetBinContent(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)) | |
11113 | * fImRPQ1dEBE[0][pe][1][0]->GetBinEntries(fImRPQ1dEBE[0][pe][1][0]->GetBin(b)); | |
11114 | ||
11115 | mq = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
11116 | } | |
11117 | if(type == "POI") | |
11118 | { | |
11119 | // p_{m*n,0}: | |
11120 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
11121 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
11122 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
11123 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
11124 | ||
11125 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
11126 | ||
11127 | t = 1; // typeFlag = RP or POI | |
11128 | } | |
11129 | else if(type == "RP") | |
11130 | { | |
11131 | // p_{m*n,0} = q_{m*n,0}: | |
11132 | p1n0kRe = q1n0kRe; | |
11133 | p1n0kIm = q1n0kIm; | |
11134 | ||
11135 | mp = mq; | |
11136 | ||
11137 | t = 0; // typeFlag = RP or POI | |
11138 | } | |
11139 | ||
11140 | // <<cos n(psi1)>>: | |
11141 | Double_t cosP1nPsi = 0.; | |
11142 | if(mp) | |
11143 | { | |
11144 | cosP1nPsi = p1n0kRe/mp; | |
11145 | ||
11146 | // fill profile for <<cos n(psi1)>>: | |
11147 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi,mp); | |
11148 | // histogram to store <cos n(psi1)> e-b-e (needed in some other methods): | |
11149 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][0]->SetBinContent(b,cosP1nPsi); | |
11150 | } // end of if(mp) | |
11151 | ||
11152 | // <<cos n(psi1+phi2)>>: | |
11153 | Double_t cosP1nPsiP1nPhi = 0.; | |
11154 | if(mp*dMult-mq) | |
11155 | { | |
11156 | cosP1nPsiP1nPhi = (p1n0kRe*dReQ1n-p1n0kIm*dImQ1n-q2n0kRe)/(mp*dMult-mq); | |
11157 | // fill profile for <<sin n(psi1+phi2)>>: | |
11158 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsiP1nPhi,mp*dMult-mq); | |
11159 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
11160 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][1]->SetBinContent(b,cosP1nPsiP1nPhi); | |
11161 | } // end of if(mp*dMult-mq) | |
11162 | ||
11163 | // <<cos n(psi1+phi2-phi3)>>: | |
11164 | Double_t cosP1nPsi1P1nPhi2MPhi3 = 0.; | |
11165 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
11166 | { | |
11167 | cosP1nPsi1P1nPhi2MPhi3 = (p1n0kRe*(pow(dImQ1n,2.)+pow(dReQ1n,2.)-dMult) | |
11168 | - 1.*(q2n0kRe*dReQ1n+q2n0kIm*dImQ1n) | |
11169 | - mq*dReQ1n+2.*q1n0kRe) | |
11170 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
11171 | // fill profile for <<sin n(psi1+phi2)>>: | |
11172 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1P1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
11173 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
11174 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][2]->SetBinContent(b,cosP1nPsi1P1nPhi2MPhi3); | |
11175 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
11176 | ||
11177 | // <<cos n(psi1-phi2-phi3)>>: | |
11178 | Double_t cosP1nPsi1M1nPhi2MPhi3 = 0.; | |
11179 | if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
11180 | { | |
11181 | cosP1nPsi1M1nPhi2MPhi3 = (p1n0kRe*(pow(dReQ1n,2.)-pow(dImQ1n,2.))+2.*p1n0kIm*dReQ1n*dImQ1n | |
11182 | - 1.*(p1n0kRe*dReQ2n+p1n0kIm*dImQ2n) | |
11183 | - 2.*mq*dReQ1n+2.*q1n0kRe) | |
11184 | / (mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
11185 | // fill profile for <<sin n(psi1+phi2)>>: | |
11186 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1M1nPhi2MPhi3,mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)); | |
11187 | // histogram to store <sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
11188 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][3]->SetBinContent(b,cosP1nPsi1M1nPhi2MPhi3); | |
11189 | } // end of if(mq*(dMult-1.)*(dMult-2.)+(mp-mq)*dMult*(dMult-1.)) | |
11190 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
11191 | ||
11192 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTerms(TString type, TString ptOrEta) | |
11193 | ||
489d5531 | 11194 | //================================================================================================================================== |
11195 | ||
489d5531 | 11196 | void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUADiffFlow(TString type, TString ptOrEta) |
11197 | { | |
1268c371 | 11198 | // Transfer profiles into histogams and correctly propagate the error. |
489d5531 | 11199 | |
2a98ceb8 | 11200 | Int_t t = 0; // type flag |
11201 | Int_t pe = 0; // ptEta flag | |
489d5531 | 11202 | |
11203 | if(type == "RP") | |
11204 | { | |
11205 | t = 0; | |
11206 | } else if(type == "POI") | |
11207 | { | |
11208 | t = 1; | |
11209 | } | |
11210 | ||
11211 | if(ptOrEta == "Pt") | |
11212 | { | |
11213 | pe = 0; | |
11214 | } else if(ptOrEta == "Eta") | |
11215 | { | |
11216 | pe = 1; | |
11217 | } | |
11218 | ||
11219 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
11220 | //Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
11221 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
11222 | //Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
11223 | ||
11224 | for(Int_t sc=0;sc<2;sc++) // sin or cos | |
11225 | { | |
11226 | for(Int_t cti=0;cti<9;cti++) // correction term index | |
11227 | { | |
11228 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
11229 | { | |
11230 | Double_t correctionTerm = fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]->GetBinContent(b); | |
11231 | fDiffFlowCorrectionTermsForNUAHist[t][pe][sc][cti]->SetBinContent(b,correctionTerm); | |
11232 | // to be improved (propagate error correctly) | |
11233 | // ... | |
11234 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
11235 | } // correction term index | |
11236 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos | |
11237 | ||
11238 | }// end of void AliFlowAnalysisWithQCumulants::FinalizeCorrectionTermsForNUADiffFlow(TString type, TString ptOrEta) | |
11239 | ||
489d5531 | 11240 | //================================================================================================================================== |
11241 | ||
489d5531 | 11242 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta) |
11243 | { | |
1268c371 | 11244 | // Calculate generalized differential flow cumulants (corrected for non-uniform acceptance). |
11245 | ||
11246 | // to be improved - propagate error also from non-isotropic terms | |
489d5531 | 11247 | |
1268c371 | 11248 | Int_t t = 0; // RP = 0, POI = 1 |
11249 | Int_t pe = 0; // pt = 0, eta = 1 | |
489d5531 | 11250 | |
11251 | if(type == "RP") | |
11252 | { | |
1268c371 | 11253 | t = 0; |
489d5531 | 11254 | } else if(type == "POI") |
11255 | { | |
1268c371 | 11256 | t = 1; |
489d5531 | 11257 | } |
11258 | ||
11259 | if(ptOrEta == "Pt") | |
11260 | { | |
1268c371 | 11261 | pe = 0; |
489d5531 | 11262 | } else if(ptOrEta == "Eta") |
11263 | { | |
1268c371 | 11264 | pe = 1; |
489d5531 | 11265 | } |
1268c371 | 11266 | |
11267 | // Common: | |
489d5531 | 11268 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
489d5531 | 11269 | // 2-particle correlation: |
11270 | Double_t two = fIntFlowCorrelationsHist->GetBinContent(1); // <<2>> | |
1268c371 | 11271 | // sinus terms coming from reference flow: |
489d5531 | 11272 | Double_t sinP1nPhi = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(1); // <<sin(n*phi1)>> |
11273 | Double_t sinP1nPhi1P1nPhi2 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(2); // <<sin(n*(phi1+phi2))>> | |
11274 | Double_t sinP1nPhi1M1nPhi2M1nPhi3 = fIntFlowCorrectionTermsForNUAHist[0]->GetBinContent(3); // <<sin(n*(phi1-phi2-phi3))>> | |
1268c371 | 11275 | // cosinus terms coming from reference flow: |
489d5531 | 11276 | Double_t cosP1nPhi = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(1); // <<cos(n*phi1)>> |
11277 | Double_t cosP1nPhi1P1nPhi2 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(2); // <<cos(n*(phi1+phi2))>> | |
11278 | Double_t cosP1nPhi1M1nPhi2M1nPhi3 = fIntFlowCorrectionTermsForNUAHist[1]->GetBinContent(3); // <<cos(n*(phi1-phi2-phi3))>> | |
11279 | ||
11280 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
11281 | { | |
11282 | Double_t twoPrime = fDiffFlowCorrelationsHist[t][pe][0]->GetBinContent(b); // <<2'>> | |
11283 | Double_t fourPrime = fDiffFlowCorrelationsHist[t][pe][1]->GetBinContent(b); // <<4'>> | |
11284 | Double_t sinP1nPsi = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][0]->GetBinContent(b); // <<sin n(Psi)>> | |
11285 | Double_t cosP1nPsi = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][0]->GetBinContent(b); // <<cos n(Psi)>> | |
11286 | Double_t sinP1nPsi1P1nPhi2 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][1]->GetBinContent(b); // <<sin n(psi1+phi2)>> | |
11287 | Double_t cosP1nPsi1P1nPhi2 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][1]->GetBinContent(b); // <<cos n(psi1+phi2)>> | |
11288 | Double_t sinP1nPsi1P1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][2]->GetBinContent(b); // <<sin n(psi1+phi2-phi3)>> | |
11289 | Double_t cosP1nPsi1P1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][2]->GetBinContent(b); // <<cos n(psi1+phi2-phi3)>> | |
11290 | Double_t sinP1nPsi1M1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][0][3]->GetBinContent(b); // <<sin n(psi1-phi2-phi3)>> | |
11291 | Double_t cosP1nPsi1M1nPhi2M1nPhi3 = fDiffFlowCorrectionTermsForNUAHist[t][pe][1][3]->GetBinContent(b); // <<cos n(psi1-phi2-phi3)>> | |
1268c371 | 11292 | // Generalized QC{2'}: |
489d5531 | 11293 | Double_t qc2Prime = twoPrime - sinP1nPsi*sinP1nPhi - cosP1nPsi*cosP1nPhi; |
1268c371 | 11294 | if(fApplyCorrectionForNUA) |
11295 | { | |
11296 | fDiffFlowCumulants[t][pe][0]->SetBinContent(b,qc2Prime); | |
11297 | } | |
11298 | if(TMath::Abs(twoPrime)>0.) | |
11299 | { | |
11300 | fDiffFlowDetectorBias[t][pe][0]->SetBinContent(b,qc2Prime/twoPrime); // detector bias = generalized/isotropic cumulant. | |
11301 | } | |
11302 | // Generalized QC{4'}: | |
489d5531 | 11303 | Double_t qc4Prime = fourPrime-2.*twoPrime*two |
11304 | - cosP1nPsi*cosP1nPhi1M1nPhi2M1nPhi3 | |
11305 | + sinP1nPsi*sinP1nPhi1M1nPhi2M1nPhi3 | |
11306 | - cosP1nPhi*cosP1nPsi1M1nPhi2M1nPhi3 | |
11307 | + sinP1nPhi*sinP1nPsi1M1nPhi2M1nPhi3 | |
11308 | - 2.*cosP1nPhi*cosP1nPsi1P1nPhi2M1nPhi3 | |
11309 | - 2.*sinP1nPhi*sinP1nPsi1P1nPhi2M1nPhi3 | |
11310 | - cosP1nPsi1P1nPhi2*cosP1nPhi1P1nPhi2 | |
11311 | - sinP1nPsi1P1nPhi2*sinP1nPhi1P1nPhi2 | |
11312 | + 2.*cosP1nPhi1P1nPhi2*(cosP1nPsi*cosP1nPhi-sinP1nPsi*sinP1nPhi) | |
11313 | + 2.*sinP1nPhi1P1nPhi2*(cosP1nPsi*sinP1nPhi+sinP1nPsi*cosP1nPhi) | |
11314 | + 4.*two*(cosP1nPsi*cosP1nPhi+sinP1nPsi*sinP1nPhi) | |
11315 | + 2.*cosP1nPsi1P1nPhi2*(pow(cosP1nPhi,2.)-pow(sinP1nPhi,2.)) | |
11316 | + 4.*sinP1nPsi1P1nPhi2*cosP1nPhi*sinP1nPhi | |
11317 | + 4.*twoPrime*(pow(cosP1nPhi,2.)+pow(sinP1nPhi,2.)) | |
11318 | - 6.*(pow(cosP1nPhi,2.)-pow(sinP1nPhi,2.)) | |
11319 | * (cosP1nPsi*cosP1nPhi-sinP1nPsi*sinP1nPhi) | |
11320 | - 12.*cosP1nPhi*sinP1nPhi | |
11321 | * (sinP1nPsi*cosP1nPhi+cosP1nPsi*sinP1nPhi); | |
1268c371 | 11322 | if(fApplyCorrectionForNUA) |
11323 | { | |
11324 | fDiffFlowCumulants[t][pe][1]->SetBinContent(b,qc4Prime); | |
11325 | } | |
11326 | if(TMath::Abs(fourPrime-2.*twoPrime*two)>0.) | |
11327 | { | |
11328 | fDiffFlowDetectorBias[t][pe][1]->SetBinContent(b,qc4Prime/(fourPrime-2.*twoPrime*two)); // detector bias = generalized/isotropic cumulant. | |
11329 | } | |
489d5531 | 11330 | } // end of for(Int_t p=1;p<=fnBinsPt;p++) |
11331 | ||
11332 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCumulantsCorrectedForNUA(TString type, TString ptOrEta) | |
11333 | ||
1268c371 | 11334 | //================================================================================================================================== |
489d5531 | 11335 | |
11336 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta) | |
11337 | { | |
11338 | // Calculate differential flow corrected for non-uniform acceptance. | |
11339 | ||
1268c371 | 11340 | // to be improved: eventually I will have to access here masured correlations and NUA terms |
11341 | // instead of cumulants in order to propagate statistical error correctly also | |
11342 | // to NUA terms (propagating errors directly from cumulants is WRONG for | |
11343 | // differential flow becuase that doesn't account at all cross-covariance terms) | |
489d5531 | 11344 | |
1268c371 | 11345 | // REMARK: When NUA correction is apllied error for differential flow DOES NOT get corrected, |
11346 | // i.e. only value is being corrected, error is still the one relevant for isotropic | |
11347 | // case. This eventually will be resolved. | |
11348 | ||
11349 | ||
11350 | Int_t t = 0; // RP or POI | |
11351 | Int_t pe = 0; // pt or eta | |
489d5531 | 11352 | |
11353 | if(type == "RP") | |
11354 | { | |
1268c371 | 11355 | t = 0; |
489d5531 | 11356 | } else if(type == "POI") |
11357 | { | |
1268c371 | 11358 | t = 1; |
11359 | } | |
489d5531 | 11360 | if(ptOrEta == "Pt") |
11361 | { | |
1268c371 | 11362 | pe = 0; |
489d5531 | 11363 | } else if(ptOrEta == "Eta") |
11364 | { | |
1268c371 | 11365 | pe = 1; |
489d5531 | 11366 | } |
11367 | ||
1268c371 | 11368 | // Common: |
489d5531 | 11369 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; |
1268c371 | 11370 | // Reference Q-cumulants |
11371 | Double_t qc2 = fIntFlowQcumulants->GetBinContent(1); // QC{2} | |
11372 | Double_t qc4 = fIntFlowQcumulants->GetBinContent(2); // QC{4} | |
11373 | // Loop over pt or eta bins: | |
489d5531 | 11374 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) |
11375 | { | |
1268c371 | 11376 | // Differential Q-cumulants: |
11377 | Double_t qc2Prime = fDiffFlowCumulants[t][pe][0]->GetBinContent(b); // QC{2'} | |
11378 | Double_t qc4Prime = fDiffFlowCumulants[t][pe][1]->GetBinContent(b); // QC{4'} | |
489d5531 | 11379 | // v'{2}: |
1268c371 | 11380 | if(qc2>0.) |
489d5531 | 11381 | { |
1268c371 | 11382 | Double_t v2Prime = qc2Prime/pow(qc2,0.5); |
11383 | if(TMath::Abs(v2Prime)>0.){fDiffFlow[t][pe][0]->SetBinContent(b,v2Prime);} | |
489d5531 | 11384 | } |
489d5531 | 11385 | // v'{4}: |
1268c371 | 11386 | if(qc4<0.) |
489d5531 | 11387 | { |
1268c371 | 11388 | Double_t v4Prime = -qc4Prime/pow(-qc4,3./4.); |
11389 | if(TMath::Abs(v4Prime)>0.){fDiffFlow[t][pe][1]->SetBinContent(b,v4Prime);} | |
489d5531 | 11390 | } |
11391 | } // end of for(Int_t b=1;b<=fnBinsPtEta[pe];b++) | |
11392 | ||
11393 | } // end of void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectedForNUA(TString type, TString ptOrEta); | |
11394 | ||
489d5531 | 11395 | //================================================================================================================================== |
11396 | ||
0328db2d | 11397 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoops(AliFlowEventSimple * const anEvent) |
489d5531 | 11398 | { |
11399 | // Evaluate with nested loops multiparticle correlations for integrated flow (without using the particle weights). | |
11400 | ||
11401 | // Remark: Results are stored in profile fIntFlowDirectCorrelations whose binning is organized as follows: | |
11402 | // | |
11403 | // 1st bin: <2>_{1n|1n} = two1n1n = cos(n*(phi1-phi2))> | |
11404 | // 2nd bin: <2>_{2n|2n} = two2n2n = cos(2n*(phi1-phi2))> | |
11405 | // 3rd bin: <2>_{3n|3n} = two3n3n = cos(3n*(phi1-phi2))> | |
11406 | // 4th bin: <2>_{4n|4n} = two4n4n = cos(4n*(phi1-phi2))> | |
11407 | // 5th bin: ---- EMPTY ---- | |
11408 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1n = <cos(n*(2.*phi1-phi2-phi3))> | |
11409 | // 7th bin: <3>_{3n|2n,1n} = three3n2n1n = <cos(n*(3.*phi1-2.*phi2-phi3))> | |
11410 | // 8th bin: <3>_{4n|2n,2n} = three4n2n2n = <cos(n*(4.*phi1-2.*phi2-2.*phi3))> | |
11411 | // 9th bin: <3>_{4n|3n,1n} = three4n3n1n = <cos(n*(4.*phi1-3.*phi2-phi3))> | |
11412 | // 10th bin: ---- EMPTY ---- | |
11413 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1n = <cos(n*(phi1+phi2-phi3-phi4))> | |
11414 | // 12th bin: <4>_{2n,1n|2n,1n} = four2n1n2n1n = <cos(2.*n*(phi1+phi2-phi3-phi4))> | |
11415 | // 13th bin: <4>_{2n,2n|2n,2n} = four2n2n2n2n = <cos(n*(2.*phi1+phi2-2.*phi3-phi4))> | |
11416 | // 14th bin: <4>_{3n|1n,1n,1n} = four3n1n1n1n = <cos(n*(3.*phi1-phi2-phi3-phi4))> | |
11417 | // 15th bin: <4>_{3n,1n|3n,1n} = four3n1n3n1n = <cos(n*(4.*phi1-2.*phi2-phi3-phi4))> | |
11418 | // 16th bin: <4>_{3n,1n|2n,2n} = four3n1n2n2n = <cos(n*(3.*phi1+phi2-2.*phi3-2.*phi4))> | |
11419 | // 17th bin: <4>_{4n|2n,1n,1n} = four4n2n1n1n = <cos(n*(3.*phi1+phi2-3.*phi3-phi4))> | |
11420 | // 18th bin: ---- EMPTY ---- | |
11421 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = five2n1n1n1n1n = <cos(n*(2.*phi1+phi2-phi3-phi4-phi5))> | |
11422 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = five2n2n2n1n1n = <cos(n*(2.*phi1+2.*phi2-2.*phi3-phi4-phi5))> | |
11423 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = five3n1n2n1n1n = <cos(n*(3.*phi1+phi2-2.*phi3-phi4-phi5))> | |
11424 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = five4n1n1n1n1n = <cos(n*(4.*phi1-phi2-phi3-phi4-phi5))> | |
11425 | // 23rd bin: ---- EMPTY ---- | |
11426 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = six1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3-phi4-phi5-phi6))> | |
11427 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = six2n1n1n2n1n1n = <cos(n*(2.*phi1+2.*phi2-phi3-phi4-phi5-phi6))> | |
11428 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = six2n2n1n1n1n1n = <cos(n*(3.*phi1+phi2-phi3-phi4-phi5-phi6))> | |
11429 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = six3n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-2.*phi4-phi5-phi6))> | |
11430 | // 28th bin: ---- EMPTY ---- | |
11431 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = seven2n1n1n1n1n1n1n = <cos(n*(2.*phi1+phi2+phi3-phi4-phi5-phi6-phi7))> | |
11432 | // 30th bin: ---- EMPTY ---- | |
11433 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = eight1n1n1n1n1n1n1n1n = <cos(n*(phi1+phi2+phi3+phi4-phi5-phi6-phi7-phi8))> | |
8ed4edc7 | 11434 | // 32nd bin: ---- EMPTY ---- |
b84464d3 | 11435 | // Extra correlations for 3p TY study: |
8ed4edc7 | 11436 | // 33rd bin: <4>_{4n,2n|3n,3n}= four4n2n3n3n = <cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4))> |
b84464d3 | 11437 | // 34th bin: <5>_{3n,3n|2n,2n,2n} = five3n3n2n2n2n = <cos(n(3*phi1+3*phi2-2*phi3-2*phi4-2*phi5))> |
11438 | // Extra correlations for 6p TY study: | |
11439 | // 35th bin: <2>_{5n|5n} = two5n5n = <cos(5n*(phi1-phi2)> T | |
11440 | // 36th bin: <2>_{6n|6n} = two6n6n = <cos(6n*(phi1-phi2)> T | |
11441 | // 37th bin: <3>_{5n|3n,2n} = three5n3n2n = <cos(n*(5*phi1-3*phi2-2*phi3)> | |
11442 | // 38th bin: <3>_{5n|4n,1n} = three5n4n1n = <cos(n*(5*phi1-4*phi2-1*phi3)> | |
11443 | // 39th bin: <3>_{6n|3n,3n} = three6n3n3n = <cos(n*(6*phi1-3*phi2-3*phi3)> T | |
11444 | // 40th bin: <3>_{6n|4n,2n} = three6n4n2n = <cos(n*(6*phi1-4*phi2-2*phi3)> T | |
11445 | // 41st bin: <3>_{6n|5n,1n} = three6n5n1n = <cos(n*(6*phi1-5*phi2-1*phi3)> | |
11446 | // 42nd bin: <4>_{6n|3n,2n,1n} = four6n3n2n1n = <cos(n*(6*phi1-3*phi2-2*phi3-1*phi4)> | |
11447 | // 43rd bin: <4>_{3n,2n|3n,2n} = four3n2n3n2n = <cos(n*(3*phi1+2*phi2-3*phi3-2*phi4)> | |
11448 | // 44th bin: <4>_{4n,1n|3n,2n} = four4n1n3n2n = <cos(n*(4*phi1+1*phi2-3*phi3-2*phi4)> | |
11449 | // 45th bin: <4>_{3n,3n|3n,3n} = four3n3n3n3n = <cos(3.*n*(phi1+phi2-phi3-phi4))> T | |
11450 | // 46th bin: <4>_{4n,2n|3n,3n} = four4n2n3n3n = <cos(n*(4*phi1+2*phi2-3*phi3-3*phi4)> | |
11451 | // 47th bin: <4>_{5n,1n|3n,3n} = four5n1n3n3n = <cos(n*(5*phi1+1*phi2-3*phi3-3*phi4)> | |
11452 | // 48th bin: <4>_{4n,2n|4n,2n} = four4n2n4n2n = <cos(n*(4*phi1+2*phi2-4*phi3-2*phi4)> T | |
11453 | // 49th bin: <4>_{5n,1n|4n,2n} = four5n1n4n2n = <cos(n*(5*phi1+1*phi2-4*phi3-2*phi4)> | |
11454 | // 50th bin: <4>_{5n|3n,1n,1n} = four5n3n1n1n = <cos(n*(5*phi1-3*phi2-1*phi3-1*phi4)> | |
11455 | // 51st bin: <4>_{5n|2n,2n,1n} = four5n2n2n1n = <cos(n*(5*phi1-2*phi2-2*phi3-1*phi4)> | |
11456 | // 52nd bin: <4>_{5n,1n|5n,1n} = four5n1n5n1n = <cos(n*(5*phi1+1*phi2-5*phi3-1*phi4)> | |
11457 | // 53rd bin: <5>_{3n,3n|3n,2n,1n} = four3n3n3n2n1n = <cos(n*(3*phi1+3*phi2-3*phi3-2*phi4-1*phi5)> | |
11458 | // 54th bin: <5>_{4n,2n|3n,2n,1n} = four4n2n3n2n1n = <cos(n*(4*phi1+2*phi2-3*phi3-2*phi4-1*phi5)> | |
11459 | // 55th bin: <5>_{3n,2n|3n,1n,1n} = four3n2n3n1n1n = <cos(n*(3*phi1+2*phi2-3*phi3-1*phi4-1*phi5)> | |
11460 | // 56th bin: <5>_{3n,2n|2n,2n,1n} = four3n2n2n2n1n = <cos(n*(3*phi1+2*phi2-2*phi3-2*phi4-1*phi5)> | |
11461 | // 57th bin: <5>_{5n,1n|3n,2n,1n} = four5n1n3n2n1n = <cos(n*(5*phi1+1*phi2-3*phi3-2*phi4-1*phi5)> | |
11462 | // 58th bin: <6>_{3n,2n,1n|3n,2n,1n} = six3n2n1n3n2n1n = <cos(n*(3*phi1+2*phi2+1*phi3-3*phi4-2*phi5-1*phi6)> | |
8ed4edc7 | 11463 | |
489d5531 | 11464 | Int_t nPrim = anEvent->NumberOfTracks(); |
11465 | AliFlowTrackSimple *aftsTrack = NULL; | |
11466 | Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; | |
11467 | Int_t n = fHarmonic; | |
11468 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 11469 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 11470 | cout<<endl; |
11471 | cout<<"Multiparticle correlations: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
11472 | if(dMult<2) | |
11473 | { | |
11474 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
11475 | } else if (dMult>fMaxAllowedMultiplicity) | |
11476 | { | |
11477 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
11478 | } else | |
11479 | { | |
11480 | cout<<"... evaluating nested loops (without using particle weights)..."<<endl; | |
11481 | } | |
11482 | ||
11483 | // 2-particle correlations: | |
11484 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
11485 | { | |
11486 | for(Int_t i1=0;i1<nPrim;i1++) | |
11487 | { | |
11488 | aftsTrack=anEvent->GetTrack(i1); | |
11489 | if(!(aftsTrack->InRPSelection())) continue; | |
11490 | phi1=aftsTrack->Phi(); | |
11491 | for(Int_t i2=0;i2<nPrim;i2++) | |
11492 | { | |
11493 | if(i2==i1)continue; | |
11494 | aftsTrack=anEvent->GetTrack(i2); | |
11495 | if(!(aftsTrack->InRPSelection())) continue; | |
11496 | phi2=aftsTrack->Phi(); | |
11497 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
11498 | // fill the profile with 2-p correlations: | |
b84464d3 | 11499 | fIntFlowDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),1.); // <cos(n*(phi1-phi2))> |
11500 | fIntFlowDirectCorrelations->Fill(1.5,cos(2.*n*(phi1-phi2)),1.); // <cos(2n*(phi1-phi2))> | |
11501 | fIntFlowDirectCorrelations->Fill(2.5,cos(3.*n*(phi1-phi2)),1.); // <cos(3n*(phi1-phi2))> | |
11502 | fIntFlowDirectCorrelations->Fill(3.5,cos(4.*n*(phi1-phi2)),1.); // <cos(4n*(phi1-phi2))> | |
11503 | fIntFlowDirectCorrelations->Fill(34.5,cos(5.*n*(phi1-phi2)),1.); // <cos(5n*(phi1-phi2))> | |
11504 | fIntFlowDirectCorrelations->Fill(35.5,cos(6.*n*(phi1-phi2)),1.); // <cos(6n*(phi1-phi2))> | |
489d5531 | 11505 | } // end of for(Int_t i2=0;i2<nPrim;i2++) |
11506 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11507 | } // end of if(nPrim>=2) | |
11508 | ||
11509 | // 3-particle correlations: | |
11510 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
11511 | { | |
11512 | for(Int_t i1=0;i1<nPrim;i1++) | |
11513 | { | |
11514 | aftsTrack=anEvent->GetTrack(i1); | |
11515 | if(!(aftsTrack->InRPSelection())) continue; | |
11516 | phi1=aftsTrack->Phi(); | |
11517 | for(Int_t i2=0;i2<nPrim;i2++) | |
11518 | { | |
11519 | if(i2==i1)continue; | |
11520 | aftsTrack=anEvent->GetTrack(i2); | |
11521 | if(!(aftsTrack->InRPSelection())) continue; | |
11522 | phi2=aftsTrack->Phi(); | |
11523 | for(Int_t i3=0;i3<nPrim;i3++) | |
11524 | { | |
11525 | if(i3==i1||i3==i2)continue; | |
11526 | aftsTrack=anEvent->GetTrack(i3); | |
11527 | if(!(aftsTrack->InRPSelection())) continue; | |
11528 | phi3=aftsTrack->Phi(); | |
11529 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
11530 | // fill the profile with 3-p correlations: | |
b84464d3 | 11531 | fIntFlowDirectCorrelations->Fill(5.,cos(2.*n*phi1-n*(phi2+phi3)),1.); //<3>_{2n|nn,n} |
11532 | fIntFlowDirectCorrelations->Fill(6.,cos(3.*n*phi1-2.*n*phi2-n*phi3),1.); //<3>_{3n|2n,n} | |
11533 | fIntFlowDirectCorrelations->Fill(7.,cos(4.*n*phi1-2.*n*phi2-2.*n*phi3),1.); //<3>_{4n|2n,2n} | |
11534 | fIntFlowDirectCorrelations->Fill(8.,cos(4.*n*phi1-3.*n*phi2-n*phi3),1.); //<3>_{4n|3n,n} | |
11535 | fIntFlowDirectCorrelations->Fill(36.5,cos(5.*n*phi1-3.*n*phi2-2.*n*phi3),1.); //<3>_{5n|3n,2n} | |
11536 | fIntFlowDirectCorrelations->Fill(37.5,cos(5.*n*phi1-4.*n*phi2-1.*n*phi3),1.); //<3>_{5n|4n,1n} | |
11537 | fIntFlowDirectCorrelations->Fill(38.5,cos(6.*n*phi1-3.*n*phi2-3.*n*phi3),1.); //<3>_{6n|3n,3n} | |
11538 | fIntFlowDirectCorrelations->Fill(39.5,cos(6.*n*phi1-4.*n*phi2-2.*n*phi3),1.); //<3>_{6n|4n,2n} | |
11539 | fIntFlowDirectCorrelations->Fill(40.5,cos(6.*n*phi1-5.*n*phi2-1.*n*phi3),1.); //<3>_{6n|5n,1n} | |
489d5531 | 11540 | } // end of for(Int_t i3=0;i3<nPrim;i3++) |
11541 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11542 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11543 | } // end of if(nPrim>=3) | |
11544 | ||
11545 | // 4-particle correlations: | |
11546 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) | |
11547 | { | |
11548 | for(Int_t i1=0;i1<nPrim;i1++) | |
11549 | { | |
11550 | aftsTrack=anEvent->GetTrack(i1); | |
11551 | if(!(aftsTrack->InRPSelection())) continue; | |
11552 | phi1=aftsTrack->Phi(); | |
11553 | for(Int_t i2=0;i2<nPrim;i2++) | |
11554 | { | |
11555 | if(i2==i1)continue; | |
11556 | aftsTrack=anEvent->GetTrack(i2); | |
11557 | if(!(aftsTrack->InRPSelection())) continue; | |
11558 | phi2=aftsTrack->Phi(); | |
11559 | for(Int_t i3=0;i3<nPrim;i3++) | |
11560 | { | |
11561 | if(i3==i1||i3==i2)continue; | |
11562 | aftsTrack=anEvent->GetTrack(i3); | |
11563 | if(!(aftsTrack->InRPSelection())) continue; | |
11564 | phi3=aftsTrack->Phi(); | |
11565 | for(Int_t i4=0;i4<nPrim;i4++) | |
11566 | { | |
11567 | if(i4==i1||i4==i2||i4==i3)continue; | |
11568 | aftsTrack=anEvent->GetTrack(i4); | |
11569 | if(!(aftsTrack->InRPSelection())) continue; | |
11570 | phi4=aftsTrack->Phi(); | |
11571 | if(nPrim==4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; | |
11572 | // fill the profile with 4-p correlations: | |
11573 | fIntFlowDirectCorrelations->Fill(10.,cos(n*phi1+n*phi2-n*phi3-n*phi4),1.); // <4>_{n,n|n,n} | |
11574 | fIntFlowDirectCorrelations->Fill(11.,cos(2.*n*phi1+n*phi2-2.*n*phi3-n*phi4),1.); // <4>_{2n,n|2n,n} | |
11575 | fIntFlowDirectCorrelations->Fill(12.,cos(2.*n*phi1+2*n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{2n,2n|2n,2n} | |
11576 | fIntFlowDirectCorrelations->Fill(13.,cos(3.*n*phi1-n*phi2-n*phi3-n*phi4),1.); // <4>_{3n|n,n,n} | |
11577 | fIntFlowDirectCorrelations->Fill(14.,cos(3.*n*phi1+n*phi2-3.*n*phi3-n*phi4),1.); // <4>_{3n,n|3n,n} | |
11578 | fIntFlowDirectCorrelations->Fill(15.,cos(3.*n*phi1+n*phi2-2.*n*phi3-2.*n*phi4),1.); // <4>_{3n,n|2n,2n} | |
11579 | fIntFlowDirectCorrelations->Fill(16.,cos(4.*n*phi1-2.*n*phi2-n*phi3-n*phi4),1.); // <4>_{4n|2n,n,n} | |
b84464d3 | 11580 | fIntFlowDirectCorrelations->Fill(32.,cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4)),1.); // <4>_{4n,2n|3n,3n} |
11581 | fIntFlowDirectCorrelations->Fill(41.5,cos(n*(6.*phi1-3.*phi2-2.*phi3-1.*phi4)),1.); // <4>_{6n|3n,2n,1n} | |
11582 | fIntFlowDirectCorrelations->Fill(42.5,cos(n*(3.*phi1+2.*phi2-3.*phi3-2.*phi4)),1.); // <4>_{3n,2n|3n,2n} | |
11583 | fIntFlowDirectCorrelations->Fill(43.5,cos(n*(4.*phi1+1.*phi2-3.*phi3-2.*phi4)),1.); // <4>_{4n,1n|3n,2n} | |
11584 | fIntFlowDirectCorrelations->Fill(44.5,cos(n*(3.*phi1+3.*phi2-3.*phi3-3.*phi4)),1.); // <4>_{3n,3n|3n,3n} | |
11585 | fIntFlowDirectCorrelations->Fill(45.5,cos(n*(4.*phi1+2.*phi2-3.*phi3-3.*phi4)),1.); // <4>_{4n,2n|3n,3n} | |
11586 | fIntFlowDirectCorrelations->Fill(46.5,cos(n*(5.*phi1+1.*phi2-3.*phi3-3.*phi4)),1.); // <4>_{5n,1n|3n,3n} | |
11587 | fIntFlowDirectCorrelations->Fill(47.5,cos(n*(4.*phi1+2.*phi2-4.*phi3-2.*phi4)),1.); // <4>_{4n,2n|4n,2n} | |
11588 | fIntFlowDirectCorrelations->Fill(48.5,cos(n*(5.*phi1+1.*phi2-4.*phi3-2.*phi4)),1.); // <4>_{5n,1n|4n,2n} | |
11589 | fIntFlowDirectCorrelations->Fill(49.5,cos(n*(5.*phi1-3.*phi2-1.*phi3-1.*phi4)),1.); // <4>_{5n|3n,1n,1n} | |
11590 | fIntFlowDirectCorrelations->Fill(50.5,cos(n*(5.*phi1-2.*phi2-2.*phi3-1.*phi4)),1.); // <4>_{5n|2n,2n,1n} | |
403e3389 | 11591 | fIntFlowDirectCorrelations->Fill(51.5,cos(n*(5.*phi1+1.*phi2-5.*phi3-1.*phi4)),1.); // <4>_{5n,1n|5n,1n} |
11592 | fIntFlowDirectCorrelations->Fill(58.5,cos(n*(6.*phi1-4.*phi2-1.*phi3-1.*phi4)),1.); // <4>_{6n|4n,1n,1n} | |
11593 | fIntFlowDirectCorrelations->Fill(59.5,cos(n*(6.*phi1-2.*phi2-2.*phi3-2.*phi4)),1.); // <4>_{6n|2n,2n,2n} | |
489d5531 | 11594 | } // end of for(Int_t i4=0;i4<nPrim;i4++) |
11595 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11596 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11597 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11598 | } // end of if(nPrim>=) | |
11599 | ||
11600 | // 5-particle correlations: | |
11601 | if(nPrim>=5 && nPrim<=fMaxAllowedMultiplicity) | |
11602 | { | |
11603 | for(Int_t i1=0;i1<nPrim;i1++) | |
11604 | { | |
11605 | aftsTrack=anEvent->GetTrack(i1); | |
11606 | if(!(aftsTrack->InRPSelection())) continue; | |
11607 | phi1=aftsTrack->Phi(); | |
11608 | for(Int_t i2=0;i2<nPrim;i2++) | |
11609 | { | |
11610 | if(i2==i1)continue; | |
11611 | aftsTrack=anEvent->GetTrack(i2); | |
11612 | if(!(aftsTrack->InRPSelection())) continue; | |
11613 | phi2=aftsTrack->Phi(); | |
11614 | for(Int_t i3=0;i3<nPrim;i3++) | |
11615 | { | |
11616 | if(i3==i1||i3==i2)continue; | |
11617 | aftsTrack=anEvent->GetTrack(i3); | |
11618 | if(!(aftsTrack->InRPSelection())) continue; | |
11619 | phi3=aftsTrack->Phi(); | |
11620 | for(Int_t i4=0;i4<nPrim;i4++) | |
11621 | { | |
11622 | if(i4==i1||i4==i2||i4==i3)continue; | |
11623 | aftsTrack=anEvent->GetTrack(i4); | |
11624 | if(!(aftsTrack->InRPSelection())) continue; | |
11625 | phi4=aftsTrack->Phi(); | |
11626 | for(Int_t i5=0;i5<nPrim;i5++) | |
11627 | { | |
11628 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
11629 | aftsTrack=anEvent->GetTrack(i5); | |
11630 | if(!(aftsTrack->InRPSelection())) continue; | |
11631 | phi5=aftsTrack->Phi(); | |
11632 | if(nPrim==5) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<"\r"<<flush; | |
11633 | // fill the profile with 5-p correlations: | |
b84464d3 | 11634 | fIntFlowDirectCorrelations->Fill(18.,cos(2.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5),1.); // <5>_{2n,n|n,n,n} |
11635 | fIntFlowDirectCorrelations->Fill(19.,cos(2.*n*phi1+2.*n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); // <5>_{2n,2n|2n,n,n} | |
11636 | fIntFlowDirectCorrelations->Fill(20.,cos(3.*n*phi1+n*phi2-2.*n*phi3-n*phi4-n*phi5),1.); // <5>_{3n,n|2n,n,n} | |
11637 | fIntFlowDirectCorrelations->Fill(21.,cos(4.*n*phi1-n*phi2-n*phi3-n*phi4-n*phi5),1.); // <5>_{4n|n,n,n,n} | |
11638 | fIntFlowDirectCorrelations->Fill(33.,cos(3.*n*phi1+3.*n*phi2-2.*n*phi3-2.*n*phi4-2.*n*phi5),1.); // <5>_{3n,3n|2n,2n,2n} | |
11639 | fIntFlowDirectCorrelations->Fill(52.5,cos(3.*n*phi1+3.*n*phi2-3.*n*phi3-2.*n*phi4-1.*n*phi5),1.); // <5>_{3n,3n|3n,2n,1n} | |
11640 | fIntFlowDirectCorrelations->Fill(53.5,cos(4.*n*phi1+2.*n*phi2-3.*n*phi3-2.*n*phi4-1.*n*phi5),1.); // <5>_{4n,2n|3n,2n,1n} | |
11641 | fIntFlowDirectCorrelations->Fill(54.5,cos(3.*n*phi1+2.*n*phi2-3.*n*phi3-1.*n*phi4-1.*n*phi5),1.); // <5>_{3n,2n|3n,1n,1n} | |
11642 | fIntFlowDirectCorrelations->Fill(55.5,cos(3.*n*phi1+2.*n*phi2-2.*n*phi3-2.*n*phi4-1.*n*phi5),1.); // <5>_{3n,2n|2n,2n,1n} | |
11643 | fIntFlowDirectCorrelations->Fill(56.5,cos(5.*n*phi1+1.*n*phi2-3.*n*phi3-2.*n*phi4-1.*n*phi5),1.); // <5>_{5n,1n|3n,2n,1n} | |
403e3389 | 11644 | fIntFlowDirectCorrelations->Fill(60.5,cos(6.*n*phi1-2.*n*phi2-2.*n*phi3-1.*n*phi4-1.*n*phi5),1.); // <5>_{6n|2n,2n,1n,1n} |
11645 | fIntFlowDirectCorrelations->Fill(61.5,cos(4.*n*phi1+1.*n*phi2+1.*n*phi3-3.*n*phi4-3.*n*phi5),1.); // <5>_{4n,1n,1n|3n,3n} | |
489d5531 | 11646 | } // end of for(Int_t i5=0;i5<nPrim;i5++) |
11647 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
11648 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11649 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11650 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11651 | } // end of if(nPrim>=5) | |
11652 | ||
11653 | // 6-particle correlations: | |
11654 | if(nPrim>=6 && nPrim<=fMaxAllowedMultiplicity) | |
11655 | { | |
11656 | for(Int_t i1=0;i1<nPrim;i1++) | |
11657 | { | |
11658 | aftsTrack=anEvent->GetTrack(i1); | |
11659 | if(!(aftsTrack->InRPSelection())) continue; | |
11660 | phi1=aftsTrack->Phi(); | |
11661 | for(Int_t i2=0;i2<nPrim;i2++) | |
11662 | { | |
11663 | if(i2==i1)continue; | |
11664 | aftsTrack=anEvent->GetTrack(i2); | |
11665 | if(!(aftsTrack->InRPSelection())) continue; | |
11666 | phi2=aftsTrack->Phi(); | |
11667 | for(Int_t i3=0;i3<nPrim;i3++) | |
11668 | { | |
11669 | if(i3==i1||i3==i2)continue; | |
11670 | aftsTrack=anEvent->GetTrack(i3); | |
11671 | if(!(aftsTrack->InRPSelection())) continue; | |
11672 | phi3=aftsTrack->Phi(); | |
11673 | for(Int_t i4=0;i4<nPrim;i4++) | |
11674 | { | |
11675 | if(i4==i1||i4==i2||i4==i3)continue; | |
11676 | aftsTrack=anEvent->GetTrack(i4); | |
11677 | if(!(aftsTrack->InRPSelection())) continue; | |
11678 | phi4=aftsTrack->Phi(); | |
11679 | for(Int_t i5=0;i5<nPrim;i5++) | |
11680 | { | |
11681 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
11682 | aftsTrack=anEvent->GetTrack(i5); | |
11683 | if(!(aftsTrack->InRPSelection())) continue; | |
11684 | phi5=aftsTrack->Phi(); | |
11685 | for(Int_t i6=0;i6<nPrim;i6++) | |
11686 | { | |
11687 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
11688 | aftsTrack=anEvent->GetTrack(i6); | |
11689 | if(!(aftsTrack->InRPSelection())) continue; | |
11690 | phi6=aftsTrack->Phi(); | |
11691 | if(nPrim==6) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<"\r"<<flush; | |
11692 | // fill the profile with 6-p correlations: | |
403e3389 | 11693 | fIntFlowDirectCorrelations->Fill(23.,cos(n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6),1.); // <6>_{1n,1n,1n|1n,1n,1n} |
11694 | fIntFlowDirectCorrelations->Fill(24.,cos(2.*n*phi1+n*phi2+n*phi3-2.*n*phi4-n*phi5-n*phi6),1.); // <6>_{2n,1n,1n|2n,1n,1n} | |
11695 | fIntFlowDirectCorrelations->Fill(25.,cos(2.*n*phi1+2.*n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); // <6>_{2n,2n|1n,1n,1n,1n} | |
11696 | fIntFlowDirectCorrelations->Fill(26.,cos(3.*n*phi1+n*phi2-n*phi3-n*phi4-n*phi5-n*phi6),1.); // <6>_{3n,1n|1n,1n,1n,1n} | |
b84464d3 | 11697 | fIntFlowDirectCorrelations->Fill(57.5,cos(3.*n*phi1+2.*n*phi2+1.*n*phi3-3.*n*phi4-2.*n*phi5-1.*n*phi6),1.); // <6>_{3n,2n,1n|3n,2n,1n} |
403e3389 | 11698 | fIntFlowDirectCorrelations->Fill(62.5,cos(3.*n*phi1+3.*n*phi2-2.*n*phi3-2.*n*phi4-1.*n*phi5-1.*n*phi6),1.); // <6>_{3n,3n|2n,2n,1n,1n} |
489d5531 | 11699 | } // end of for(Int_t i6=0;i6<nPrim;i6++) |
11700 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
11701 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
11702 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11703 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11704 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11705 | } // end of if(nPrim>=6) | |
11706 | ||
11707 | // 7-particle correlations: | |
11708 | if(nPrim>=7 && nPrim<=fMaxAllowedMultiplicity) | |
11709 | { | |
11710 | for(Int_t i1=0;i1<nPrim;i1++) | |
11711 | { | |
11712 | aftsTrack=anEvent->GetTrack(i1); | |
11713 | if(!(aftsTrack->InRPSelection())) continue; | |
11714 | phi1=aftsTrack->Phi(); | |
11715 | for(Int_t i2=0;i2<nPrim;i2++) | |
11716 | { | |
11717 | if(i2==i1)continue; | |
11718 | aftsTrack=anEvent->GetTrack(i2); | |
11719 | if(!(aftsTrack->InRPSelection())) continue; | |
11720 | phi2=aftsTrack->Phi(); | |
11721 | for(Int_t i3=0;i3<nPrim;i3++) | |
11722 | { | |
11723 | if(i3==i1||i3==i2)continue; | |
11724 | aftsTrack=anEvent->GetTrack(i3); | |
11725 | if(!(aftsTrack->InRPSelection())) continue; | |
11726 | phi3=aftsTrack->Phi(); | |
11727 | for(Int_t i4=0;i4<nPrim;i4++) | |
11728 | { | |
11729 | if(i4==i1||i4==i2||i4==i3)continue; | |
11730 | aftsTrack=anEvent->GetTrack(i4); | |
11731 | if(!(aftsTrack->InRPSelection())) continue; | |
11732 | phi4=aftsTrack->Phi(); | |
11733 | for(Int_t i5=0;i5<nPrim;i5++) | |
11734 | { | |
11735 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
11736 | aftsTrack=anEvent->GetTrack(i5); | |
11737 | if(!(aftsTrack->InRPSelection())) continue; | |
11738 | phi5=aftsTrack->Phi(); | |
11739 | for(Int_t i6=0;i6<nPrim;i6++) | |
11740 | { | |
11741 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
11742 | aftsTrack=anEvent->GetTrack(i6); | |
11743 | if(!(aftsTrack->InRPSelection())) continue; | |
11744 | phi6=aftsTrack->Phi(); | |
11745 | for(Int_t i7=0;i7<nPrim;i7++) | |
11746 | { | |
11747 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; | |
11748 | aftsTrack=anEvent->GetTrack(i7); | |
11749 | if(!(aftsTrack->InRPSelection())) continue; | |
11750 | phi7=aftsTrack->Phi(); | |
11751 | if(nPrim==7) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<" "<<i7<<"\r"<<flush; | |
11752 | // fill the profile with 7-p correlation: | |
11753 | fIntFlowDirectCorrelations->Fill(28.,cos(2.*n*phi1+n*phi2+n*phi3-n*phi4-n*phi5-n*phi6-n*phi7),1.); // <7>_{2n,n,n|n,n,n,n} | |
11754 | } // end of for(Int_t i7=0;i7<nPrim;i7++) | |
11755 | } // end of for(Int_t i6=0;i6<nPrim;i6++) | |
11756 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
11757 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
11758 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11759 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11760 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11761 | } // end of if(nPrim>=7) | |
11762 | ||
11763 | // 8-particle correlations: | |
11764 | if(nPrim>=8 && nPrim<=fMaxAllowedMultiplicity) | |
11765 | { | |
11766 | for(Int_t i1=0;i1<nPrim;i1++) | |
11767 | { | |
11768 | aftsTrack=anEvent->GetTrack(i1); | |
11769 | if(!(aftsTrack->InRPSelection())) continue; | |
11770 | phi1=aftsTrack->Phi(); | |
11771 | for(Int_t i2=0;i2<nPrim;i2++) | |
11772 | { | |
11773 | if(i2==i1)continue; | |
11774 | aftsTrack=anEvent->GetTrack(i2); | |
11775 | if(!(aftsTrack->InRPSelection())) continue; | |
11776 | phi2=aftsTrack->Phi(); | |
11777 | for(Int_t i3=0;i3<nPrim;i3++) | |
11778 | { | |
11779 | if(i3==i1||i3==i2)continue; | |
11780 | aftsTrack=anEvent->GetTrack(i3); | |
11781 | if(!(aftsTrack->InRPSelection())) continue; | |
11782 | phi3=aftsTrack->Phi(); | |
11783 | for(Int_t i4=0;i4<nPrim;i4++) | |
11784 | { | |
11785 | if(i4==i1||i4==i2||i4==i3)continue; | |
11786 | aftsTrack=anEvent->GetTrack(i4); | |
11787 | if(!(aftsTrack->InRPSelection())) continue; | |
11788 | phi4=aftsTrack->Phi(); | |
11789 | for(Int_t i5=0;i5<nPrim;i5++) | |
11790 | { | |
11791 | if(i5==i1||i5==i2||i5==i3||i5==i4)continue; | |
11792 | aftsTrack=anEvent->GetTrack(i5); | |
11793 | if(!(aftsTrack->InRPSelection())) continue; | |
11794 | phi5=aftsTrack->Phi(); | |
11795 | for(Int_t i6=0;i6<nPrim;i6++) | |
11796 | { | |
11797 | if(i6==i1||i6==i2||i6==i3||i6==i4||i6==i5)continue; | |
11798 | aftsTrack=anEvent->GetTrack(i6); | |
11799 | if(!(aftsTrack->InRPSelection())) continue; | |
11800 | phi6=aftsTrack->Phi(); | |
11801 | for(Int_t i7=0;i7<nPrim;i7++) | |
11802 | { | |
11803 | if(i7==i1||i7==i2||i7==i3||i7==i4||i7==i5||i7==i6)continue; | |
11804 | aftsTrack=anEvent->GetTrack(i7); | |
11805 | if(!(aftsTrack->InRPSelection())) continue; | |
11806 | phi7=aftsTrack->Phi(); | |
11807 | for(Int_t i8=0;i8<nPrim;i8++) | |
11808 | { | |
11809 | if(i8==i1||i8==i2||i8==i3||i8==i4||i8==i5||i8==i6||i8==i7)continue; | |
11810 | aftsTrack=anEvent->GetTrack(i8); | |
11811 | if(!(aftsTrack->InRPSelection())) continue; | |
11812 | phi8=aftsTrack->Phi(); | |
11813 | cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<" "<<i5<<" "<<i6<<" "<<i7<<" "<<i8<<"\r"<<flush; | |
11814 | // fill the profile with 8-p correlation: | |
11815 | fIntFlowDirectCorrelations->Fill(30.,cos(n*phi1+n*phi2+n*phi3+n*phi4-n*phi5-n*phi6-n*phi7-n*phi8),1.); // <8>_{n,n,n,n|n,n,n,n} | |
11816 | } // end of for(Int_t i8=0;i8<nPrim;i8++) | |
11817 | } // end of for(Int_t i7=0;i7<nPrim;i7++) | |
11818 | } // end of for(Int_t i6=0;i6<nPrim;i6++) | |
11819 | } // end of for(Int_t i5=0;i5<nPrim;i5++) | |
11820 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
11821 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
11822 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
11823 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
11824 | } // end of if(nPrim>=8) | |
11825 | ||
11826 | cout<<endl; | |
11827 | ||
11828 | } // end of AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent) | |
11829 | ||
11830 | ||
11831 | //================================================================================================================================== | |
11832 | ||
11833 | ||
11834 | void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrelations() | |
11835 | { | |
11836 | // Cross-check results for multiparticle correlations needed for int. flow: results from Q-vectors vs results from nested loops. | |
11837 | ||
11838 | cout<<endl; | |
11839 | cout<<endl; | |
11840 | cout<<" *****************************************"<<endl; | |
11841 | cout<<" **** cross-checking the correlations ****"<<endl; | |
11842 | cout<<" **** for integrated flow ****"<<endl; | |
403e3389 | 11843 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 11844 | { |
11845 | cout<<" **** (particle weights not used) ****"<<endl; | |
11846 | } else | |
11847 | { | |
11848 | cout<<" **** (particle weights used) ****"<<endl; | |
11849 | } | |
11850 | cout<<" *****************************************"<<endl; | |
11851 | cout<<endl; | |
11852 | cout<<endl; | |
11853 | ||
403e3389 | 11854 | Int_t ciMax = 64; // to be improved (removed eventually when I calculate 6th and 8th order with particle weights) |
489d5531 | 11855 | |
403e3389 | 11856 | if(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) |
489d5531 | 11857 | { |
11858 | ciMax = 11; | |
11859 | } | |
11860 | ||
11861 | for(Int_t ci=1;ci<=ciMax;ci++) | |
11862 | { | |
11863 | if(strcmp((fIntFlowCorrelationsAllPro->GetXaxis())->GetBinLabel(ci), "") == 0) continue; // to be improved (access finalized histogram here) | |
11864 | cout<<(fIntFlowCorrelationsAllPro->GetXaxis())->GetBinLabel(ci)<<":"<<endl; // to be improved (access finalized histogram here) | |
11865 | cout<<"from Q-vectors = "<<fIntFlowCorrelationsAllPro->GetBinContent(ci)<<endl; // to be improved (access finalized histogram here) | |
11866 | cout<<"from nested loops = "<<fIntFlowDirectCorrelations->GetBinContent(ci)<<endl; | |
11867 | cout<<endl; | |
11868 | } | |
11869 | ||
11870 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrelations() | |
11871 | ||
489d5531 | 11872 | //================================================================================================================================ |
11873 | ||
489d5531 | 11874 | void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrectionTermsForNUA() |
11875 | { | |
11876 | // Cross-check results for corrections terms for non-uniform acceptance needed for int. flow: results from Q-vectors vs results from nested loops. | |
11877 | ||
11878 | cout<<endl; | |
11879 | cout<<endl; | |
11880 | cout<<" *********************************************"<<endl; | |
11881 | cout<<" **** cross-checking the correction terms ****"<<endl; | |
11882 | cout<<" **** for non-uniform acceptance relevant ****"<<endl; | |
11883 | cout<<" **** for integrated flow ****"<<endl; | |
403e3389 | 11884 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 11885 | { |
11886 | cout<<" **** (particle weights not used) ****"<<endl; | |
11887 | } else | |
11888 | { | |
11889 | cout<<" **** (particle weights used) ****"<<endl; | |
11890 | } | |
11891 | cout<<" *********************************************"<<endl; | |
11892 | cout<<endl; | |
11893 | cout<<endl; | |
11894 | ||
b92ea2b9 | 11895 | for(Int_t ci=1;ci<=4;ci++) // correction term index (to be improved - hardwired 4) |
489d5531 | 11896 | { |
11897 | for(Int_t sc=0;sc<2;sc++) // sin or cos term | |
11898 | { | |
11899 | if(strcmp((fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->GetBinLabel(ci), "") == 0) continue; // to be improved (access finalized histogram here) | |
11900 | cout<<(fIntFlowCorrectionTermsForNUAPro[sc]->GetXaxis())->GetBinLabel(ci)<<":"<<endl; // to be improved (access finalized histogram here) | |
11901 | cout<<"from Q-vectors = "<<fIntFlowCorrectionTermsForNUAPro[sc]->GetBinContent(ci)<<endl; // to be improved (access finalized histogram here) | |
11902 | cout<<"from nested loops = "<<fIntFlowDirectCorrectionTermsForNUA[sc]->GetBinContent(ci)<<endl; | |
11903 | cout<<endl; | |
11904 | } // end of for(Int_t sc=0;sc<2;sc++) // sin or cos term | |
11905 | } // end of for(Int_t ci=1;ci<=10;ci++) // correction term index | |
11906 | ||
11907 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowCorrectionTermsForNUA() | |
11908 | ||
489d5531 | 11909 | //================================================================================================================================ |
11910 | ||
0328db2d | 11911 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent) |
489d5531 | 11912 | { |
11913 | // Evaluate with nested loops multiparticle correlations for integrated flow (using the particle weights). | |
11914 | ||
11915 | // Results are stored in profile fIntFlowDirectCorrelations. | |
11916 | // Remark 1: When particle weights are used the binning of fIntFlowDirectCorrelations is organized as follows: | |
11917 | // | |
11918 | // 1st bin: <2>_{1n|1n} = two1n1nW1W1 = <w1 w2 cos(n*(phi1-phi2))> | |
11919 | // 2nd bin: <2>_{2n|2n} = two2n2nW2W2 = <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
11920 | // 3rd bin: <2>_{3n|3n} = two3n3nW3W3 = <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
11921 | // 4th bin: <2>_{4n|4n} = two4n4nW4W4 = <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
11922 | // 5th bin: ---- EMPTY ---- | |
11923 | // 6th bin: <3>_{2n|1n,1n} = three2n1n1nW2W1W1 = <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
11924 | // 7th bin: <3>_{3n|2n,1n} = ... | |
11925 | // 8th bin: <3>_{4n|2n,2n} = ... | |
11926 | // 9th bin: <3>_{4n|3n,1n} = ... | |
11927 | // 10th bin: ---- EMPTY ---- | |
11928 | // 11th bin: <4>_{1n,1n|1n,1n} = four1n1n1n1nW1W1W1W1 = <w1 w2 w3 w4 cos(n*(phi1+phi2-phi3-phi4))> | |
11929 | // 12th bin: <4>_{2n,1n|2n,1n} = ... | |
11930 | // 13th bin: <4>_{2n,2n|2n,2n} = ... | |
11931 | // 14th bin: <4>_{3n|1n,1n,1n} = ... | |
11932 | // 15th bin: <4>_{3n,1n|3n,1n} = ... | |
11933 | // 16th bin: <4>_{3n,1n|2n,2n} = ... | |
11934 | // 17th bin: <4>_{4n|2n,1n,1n} = ... | |
11935 | // 18th bin: ---- EMPTY ---- | |
11936 | // 19th bin: <5>_{2n|1n,1n,1n,1n} = ... | |
11937 | // 20th bin: <5>_{2n,2n|2n,1n,1n} = ... | |
11938 | // 21st bin: <5>_{3n,1n|2n,1n,1n} = ... | |
11939 | // 22nd bin: <5>_{4n|1n,1n,1n,1n} = ... | |
11940 | // 23rd bin: ---- EMPTY ---- | |
11941 | // 24th bin: <6>_{1n,1n,1n|1n,1n,1n} = ... | |
11942 | // 25th bin: <6>_{2n,1n,1n|2n,1n,1n} = ... | |
11943 | // 26th bin: <6>_{2n,2n|1n,1n,1n,1n} = ... | |
11944 | // 27th bin: <6>_{3n,1n|1n,1n,1n,1n} = ... | |
11945 | // 28th bin: ---- EMPTY ---- | |
11946 | // 29th bin: <7>_{2n,1n,1n|1n,1n,1n,1n} = ... | |
11947 | // 30th bin: ---- EMPTY ---- | |
11948 | // 31st bin: <8>_{1n,1n,1n,1n|1n,1n,1n,1n} = ... | |
57340a27 | 11949 | |
489d5531 | 11950 | // Remark 2: When particle weights are used there are some extra correlations. They are stored in |
11951 | // fIntFlowExtraDirectCorrelations binning of which is organized as follows: | |
57340a27 | 11952 | |
489d5531 | 11953 | // 1st bin: two1n1nW3W1 = <w1^3 w2 cos(n*(phi1-phi2))> |
11954 | // 2nd bin: two1n1nW1W1W2 = <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
11955 | // ... | |
57340a27 | 11956 | |
489d5531 | 11957 | Int_t nPrim = anEvent->NumberOfTracks(); |
11958 | AliFlowTrackSimple *aftsTrack = NULL; | |
11959 | //Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; | |
11960 | //Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
11961 | Double_t phi1=0., phi2=0., phi3=0., phi4=0.; | |
11962 | Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1.; | |
11963 | Int_t n = fHarmonic; | |
11964 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 11965 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 11966 | cout<<endl; |
11967 | cout<<"Multiparticle correlations: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
11968 | if(dMult<2) | |
11969 | { | |
11970 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
11971 | } else if (dMult>fMaxAllowedMultiplicity) | |
11972 | { | |
11973 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
11974 | } else | |
11975 | { | |
11976 | cout<<"... evaluating nested loops (using particle weights) ..."<<endl; | |
11977 | } | |
11978 | ||
11979 | // 2-particle correlations: | |
11980 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
11981 | { | |
11982 | // 2 nested loops multiparticle correlations using particle weights: | |
11983 | for(Int_t i1=0;i1<nPrim;i1++) | |
11984 | { | |
11985 | aftsTrack=anEvent->GetTrack(i1); | |
11986 | if(!(aftsTrack->InRPSelection())) continue; | |
11987 | phi1=aftsTrack->Phi(); | |
11988 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
11989 | for(Int_t i2=0;i2<nPrim;i2++) | |
11990 | { | |
11991 | if(i2==i1)continue; | |
11992 | aftsTrack=anEvent->GetTrack(i2); | |
11993 | if(!(aftsTrack->InRPSelection())) continue; | |
11994 | phi2=aftsTrack->Phi(); | |
11995 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
11996 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
11997 | // 2-p correlations using particle weights: | |
11998 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),wPhi1*wPhi2); // <w1 w2 cos( n*(phi1-phi2))> | |
11999 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(1.5,cos(2.*n*(phi1-phi2)),pow(wPhi1,2)*pow(wPhi2,2)); // <w1^2 w2^2 cos(2n*(phi1-phi2))> | |
12000 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(2.5,cos(3.*n*(phi1-phi2)),pow(wPhi1,3)*pow(wPhi2,3)); // <w1^3 w2^3 cos(3n*(phi1-phi2))> | |
12001 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(3.5,cos(4.*n*(phi1-phi2)),pow(wPhi1,4)*pow(wPhi2,4)); // <w1^4 w2^4 cos(4n*(phi1-phi2))> | |
12002 | // extra correlations: | |
12003 | // 2-p extra correlations (do not appear if particle weights are not used): | |
12004 | if(fUsePhiWeights) fIntFlowExtraDirectCorrelations->Fill(0.5,cos(n*(phi1-phi2)),pow(wPhi1,3)*wPhi2); // <w1^3 w2 cos(n*(phi1-phi2))> | |
12005 | // ... | |
12006 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
12007 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
12008 | } // end of if(nPrim>=2) | |
12009 | ||
12010 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
57340a27 | 12011 | { |
489d5531 | 12012 | // 3 nested loops multiparticle correlations using particle weights: |
12013 | for(Int_t i1=0;i1<nPrim;i1++) | |
57340a27 | 12014 | { |
489d5531 | 12015 | aftsTrack=anEvent->GetTrack(i1); |
12016 | if(!(aftsTrack->InRPSelection())) continue; | |
12017 | phi1=aftsTrack->Phi(); | |
12018 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
12019 | for(Int_t i2=0;i2<nPrim;i2++) | |
12020 | { | |
12021 | if(i2==i1)continue; | |
12022 | aftsTrack=anEvent->GetTrack(i2); | |
12023 | if(!(aftsTrack->InRPSelection())) continue; | |
12024 | phi2=aftsTrack->Phi(); | |
12025 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
12026 | for(Int_t i3=0;i3<nPrim;i3++) | |
12027 | { | |
12028 | if(i3==i1||i3==i2)continue; | |
12029 | aftsTrack=anEvent->GetTrack(i3); | |
12030 | if(!(aftsTrack->InRPSelection())) continue; | |
12031 | phi3=aftsTrack->Phi(); | |
12032 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
12033 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
12034 | // 3-p correlations using particle weights: | |
12035 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(5.5,cos(2.*n*phi1-n*(phi2+phi3)),pow(wPhi1,2)*wPhi2*wPhi3); // <w1^2 w2 w3 cos(n*(2phi1-phi2-phi3))> | |
12036 | // ... | |
12037 | // extra correlations: | |
12038 | // 2-p extra correlations (do not appear if particle weights are not used): | |
12039 | if(fUsePhiWeights) fIntFlowExtraDirectCorrelations->Fill(1.5,cos(n*(phi1-phi2)),wPhi1*wPhi2*pow(wPhi3,2)); // <w1 w2 w3^2 cos(n*(phi1-phi2))> | |
12040 | // ... | |
12041 | // 3-p extra correlations (do not appear if particle weights are not used): | |
12042 | // ... | |
12043 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
12044 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
12045 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
12046 | } // end of if(nPrim>=3) | |
57340a27 | 12047 | |
489d5531 | 12048 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) |
12049 | { | |
12050 | // 4 nested loops multiparticle correlations using particle weights: | |
12051 | for(Int_t i1=0;i1<nPrim;i1++) | |
12052 | { | |
12053 | aftsTrack=anEvent->GetTrack(i1); | |
12054 | if(!(aftsTrack->InRPSelection())) continue; | |
12055 | phi1=aftsTrack->Phi(); | |
12056 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
12057 | for(Int_t i2=0;i2<nPrim;i2++) | |
12058 | { | |
12059 | if(i2==i1)continue; | |
12060 | aftsTrack=anEvent->GetTrack(i2); | |
12061 | if(!(aftsTrack->InRPSelection())) continue; | |
12062 | phi2=aftsTrack->Phi(); | |
12063 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
12064 | for(Int_t i3=0;i3<nPrim;i3++) | |
12065 | { | |
12066 | if(i3==i1||i3==i2)continue; | |
12067 | aftsTrack=anEvent->GetTrack(i3); | |
12068 | if(!(aftsTrack->InRPSelection())) continue; | |
12069 | phi3=aftsTrack->Phi(); | |
12070 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
12071 | for(Int_t i4=0;i4<nPrim;i4++) | |
12072 | { | |
12073 | if(i4==i1||i4==i2||i4==i3)continue; | |
12074 | aftsTrack=anEvent->GetTrack(i4); | |
12075 | if(!(aftsTrack->InRPSelection())) continue; | |
12076 | phi4=aftsTrack->Phi(); | |
12077 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); | |
12078 | if(nPrim>=4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; // to be improved (replace eventually this if statement with if(nPrim==4)) | |
12079 | // 4-p correlations using particle weights: | |
12080 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(10.5,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); | |
12081 | // extra correlations: | |
12082 | // 2-p extra correlations (do not appear if particle weights are not used): | |
12083 | // ... | |
12084 | // 3-p extra correlations (do not appear if particle weights are not used): | |
12085 | // ... | |
12086 | // 4-p extra correlations (do not appear if particle weights are not used): | |
12087 | // ... | |
12088 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
12089 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
12090 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
12091 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
12092 | } // end of if(nPrim>=4) | |
57340a27 | 12093 | |
489d5531 | 12094 | cout<<endl; |
57340a27 | 12095 | |
489d5531 | 12096 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent) |
57340a27 | 12097 | |
489d5531 | 12098 | //================================================================================================================================ |
12099 | ||
489d5531 | 12100 | void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowExtraCorrelations() |
57340a27 | 12101 | { |
489d5531 | 12102 | // Cross-check results for extra multiparticle correlations needed for int. flow |
12103 | // which appear only when particle weights are used: results from Q-vectors vs results from nested loops. | |
57340a27 | 12104 | |
489d5531 | 12105 | cout<<endl; |
12106 | cout<<endl; | |
12107 | cout<<" ***********************************************"<<endl; | |
12108 | cout<<" **** cross-checking the extra correlations ****"<<endl; | |
12109 | cout<<" **** for integrated flow ****"<<endl; | |
12110 | cout<<" ***********************************************"<<endl; | |
12111 | cout<<endl; | |
12112 | cout<<endl; | |
12113 | ||
12114 | for(Int_t eci=1;eci<=2;eci++) // to be improved (increased eciMax eventually when I calculate 6th and 8th) | |
57340a27 | 12115 | { |
489d5531 | 12116 | if(strcmp((fIntFlowExtraCorrelationsPro->GetXaxis())->GetBinLabel(eci), "") == 0) continue; |
12117 | cout<<(fIntFlowExtraCorrelationsPro->GetXaxis())->GetBinLabel(eci)<<":"<<endl; | |
12118 | cout<<"from Q-vectors = "<<fIntFlowExtraCorrelationsPro->GetBinContent(eci)<<endl; | |
12119 | cout<<"from nested loops = "<<fIntFlowExtraDirectCorrelations->GetBinContent(eci)<<endl; | |
12120 | cout<<endl; | |
12121 | } | |
57340a27 | 12122 | |
489d5531 | 12123 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckIntFlowExtraCorrelations() |
57340a27 | 12124 | |
489d5531 | 12125 | //================================================================================================================================ |
3b552efe | 12126 | |
0328db2d | 12127 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoops(AliFlowEventSimple * const anEvent) |
489d5531 | 12128 | { |
12129 | // Evaluate with nested loops correction terms for non-uniform acceptance relevant for NONAME integrated flow (to be improved (name)). | |
12130 | // | |
12131 | // Remark: Both sin and cos correction terms are calculated in this method. Sin terms are stored in fIntFlowDirectCorrectionTermsForNUA[0], | |
12132 | // and cos terms in fIntFlowDirectCorrectionTermsForNUA[1]. Binning of fIntFlowDirectCorrectionTermsForNUA[sc] is organized as follows | |
12133 | // (sc stands for either sin or cos): | |
12134 | ||
12135 | // 1st bin: <<sc(n*(phi1))>> | |
12136 | // 2nd bin: <<sc(n*(phi1+phi2))>> | |
12137 | // 3rd bin: <<sc(n*(phi1-phi2-phi3))>> | |
12138 | // 4th bin: <<sc(n*(2phi1-phi2))>> | |
12139 | ||
12140 | Int_t nPrim = anEvent->NumberOfTracks(); | |
12141 | AliFlowTrackSimple *aftsTrack = NULL; | |
12142 | Double_t phi1=0., phi2=0., phi3=0.; | |
12143 | Int_t n = fHarmonic; | |
12144 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 12145 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 12146 | cout<<endl; |
12147 | cout<<"Correction terms for non-uniform acceptance: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
12148 | if(dMult<1) | |
3b552efe | 12149 | { |
489d5531 | 12150 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; |
12151 | } else if (dMult>fMaxAllowedMultiplicity) | |
3b552efe | 12152 | { |
489d5531 | 12153 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; |
12154 | } else | |
12155 | { | |
12156 | cout<<"... evaluating nested loops (without using particle weights)..."<<endl; | |
12157 | } | |
12158 | ||
12159 | if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity) | |
12160 | { | |
12161 | // 1-particle correction terms for non-uniform acceptance: | |
12162 | for(Int_t i1=0;i1<nPrim;i1++) | |
12163 | { | |
12164 | aftsTrack=anEvent->GetTrack(i1); | |
12165 | if(!(aftsTrack->InRPSelection())) continue; | |
12166 | phi1=aftsTrack->Phi(); | |
12167 | if(nPrim==1) cout<<i1<<"\r"<<flush; | |
12168 | // sin terms: | |
12169 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(0.5,sin(n*phi1),1.); // <sin(n*phi1)> | |
12170 | // cos terms: | |
12171 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(0.5,cos(n*phi1),1.); // <cos(n*phi1)> | |
12172 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
12173 | } // end of if(nPrim>=1) | |
12174 | ||
12175 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
12176 | { | |
12177 | // 2-particle correction terms for non-uniform acceptance: | |
12178 | for(Int_t i1=0;i1<nPrim;i1++) | |
12179 | { | |
12180 | aftsTrack=anEvent->GetTrack(i1); | |
12181 | if(!(aftsTrack->InRPSelection())) continue; | |
12182 | phi1=aftsTrack->Phi(); | |
12183 | for(Int_t i2=0;i2<nPrim;i2++) | |
3b552efe | 12184 | { |
489d5531 | 12185 | if(i2==i1)continue; |
12186 | aftsTrack=anEvent->GetTrack(i2); | |
12187 | if(!(aftsTrack->InRPSelection())) continue; | |
12188 | phi2=aftsTrack->Phi(); | |
12189 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
12190 | // sin terms: | |
3b552efe | 12191 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(1.5,sin(n*(phi1+phi2)),1.); // <<sin(n*(phi1+phi2))>> |
489d5531 | 12192 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(3.5,sin(n*(2*phi1-phi2)),1.); // <<sin(n*(2*phi1-phi2))>> |
12193 | // cos terms: | |
3b552efe | 12194 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(1.5,cos(n*(phi1+phi2)),1.); // <<cos(n*(phi1+phi2))>> |
489d5531 | 12195 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(3.5,cos(n*(2*phi1-phi2)),1.); // <<cos(n*(2*phi1-phi2))>> |
12196 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
12197 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
12198 | } // end of if(nPrim>=2) | |
12199 | ||
12200 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
12201 | { | |
12202 | // 3-particle correction terms for non-uniform acceptance: | |
12203 | for(Int_t i1=0;i1<nPrim;i1++) | |
12204 | { | |
12205 | aftsTrack=anEvent->GetTrack(i1); | |
12206 | if(!(aftsTrack->InRPSelection())) continue; | |
12207 | phi1=aftsTrack->Phi(); | |
12208 | for(Int_t i2=0;i2<nPrim;i2++) | |
12209 | { | |
12210 | if(i2==i1)continue; | |
12211 | aftsTrack=anEvent->GetTrack(i2); | |
12212 | if(!(aftsTrack->InRPSelection())) continue; | |
12213 | phi2=aftsTrack->Phi(); | |
12214 | for(Int_t i3=0;i3<nPrim;i3++) | |
12215 | { | |
12216 | if(i3==i1||i3==i2)continue; | |
12217 | aftsTrack=anEvent->GetTrack(i3); | |
12218 | if(!(aftsTrack->InRPSelection())) continue; | |
12219 | phi3=aftsTrack->Phi(); | |
12220 | if(nPrim>=3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; // to be improved (eventually I will change this if statement) | |
12221 | // sin terms: | |
12222 | fIntFlowDirectCorrectionTermsForNUA[0]->Fill(2.5,sin(n*(phi1-phi2-phi3)),1.); // <<sin(n*(phi1-phi2-phi3))>> | |
12223 | // cos terms: | |
12224 | fIntFlowDirectCorrectionTermsForNUA[1]->Fill(2.5,cos(n*(phi1-phi2-phi3)),1.); // <<cos(n*(phi1-phi2-phi3))>> | |
12225 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
12226 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
12227 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
12228 | } // end of if(nPrim>=3) | |
12229 | ||
12230 | cout<<endl; | |
12231 | } | |
64e500e3 | 12232 | |
489d5531 | 12233 | //================================================================================================================================ |
64e500e3 | 12234 | |
0328db2d | 12235 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 12236 | { |
12237 | // Evaluate reduced correlations with nested loops without using the particle weights. | |
12238 | ||
12239 | // Remark 1: Reduced correlations are evaluated in pt bin number fCrossCheckInPtBinNo and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
12240 | // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrelations[t][pe][ci], where indices runs as follows: | |
12241 | // [0=RP,1=POI][0=Pt,1=Eta][0=<2'>,1=<4'>,2=<6'>,3=<8'>] | |
12242 | // Remark 3: <2'> = <cos(n*(psi1-phi2))> | |
12243 | // <4'> = <cos(n*(psi1+phi2-phi3-phi4))> | |
12244 | // ... | |
12245 | ||
2a98ceb8 | 12246 | Int_t typeFlag = 0; |
12247 | Int_t ptEtaFlag = 0; | |
489d5531 | 12248 | if(type == "RP") |
12249 | { | |
12250 | typeFlag = 0; | |
12251 | } else if(type == "POI") | |
12252 | { | |
12253 | typeFlag = 1; | |
12254 | } | |
12255 | if(ptOrEta == "Pt") | |
12256 | { | |
12257 | ptEtaFlag = 0; | |
12258 | } else if(ptOrEta == "Eta") | |
12259 | { | |
12260 | ptEtaFlag = 1; | |
12261 | } | |
12262 | // shortcuts: | |
12263 | Int_t t = typeFlag; | |
12264 | Int_t pe = ptEtaFlag; | |
12265 | ||
12266 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12267 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12268 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
12269 | ||
12270 | Int_t nPrim = anEvent->NumberOfTracks(); | |
12271 | AliFlowTrackSimple *aftsTrack = NULL; | |
12272 | ||
12273 | Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
12274 | ||
3b552efe | 12275 | Int_t n = fHarmonic; |
489d5531 | 12276 | |
12277 | // 2'-particle correlations: | |
12278 | for(Int_t i1=0;i1<nPrim;i1++) | |
12279 | { | |
12280 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12281 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12282 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12283 | { |
12284 | if(ptOrEta == "Pt") | |
12285 | { | |
12286 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12287 | } else if (ptOrEta == "Eta") | |
12288 | { | |
12289 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12290 | } |
12291 | } else // this is diff flow of RPs | |
12292 | { | |
489d5531 | 12293 | if(ptOrEta == "Pt") |
12294 | { | |
12295 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12296 | } else if (ptOrEta == "Eta") | |
12297 | { | |
12298 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12299 | } |
12300 | } | |
489d5531 | 12301 | |
12302 | psi1=aftsTrack->Phi(); | |
12303 | for(Int_t i2=0;i2<nPrim;i2++) | |
12304 | { | |
12305 | if(i2==i1)continue; | |
12306 | aftsTrack=anEvent->GetTrack(i2); | |
12307 | // RP condition (!(first) particle in the correlator must be RP): | |
12308 | if(!(aftsTrack->InRPSelection()))continue; | |
12309 | phi2=aftsTrack->Phi(); | |
12310 | // 2'-particle correlations: | |
12311 | fDiffFlowDirectCorrelations[t][pe][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(1.*n*(psi1-phi2)),1.); // <cos(n*(psi1-phi2)) | |
12312 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12313 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12314 | ||
12315 | /* | |
12316 | ||
12317 | // 3'-particle correlations: | |
12318 | for(Int_t i1=0;i1<nPrim;i1++) | |
12319 | { | |
12320 | aftsTrack=anEvent->GetTrack(i1); | |
12321 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
12322 | if(ptOrEta == "Pt") | |
12323 | { | |
12324 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12325 | } else if (ptOrEta == "Eta") | |
12326 | { | |
12327 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12328 | } | |
12329 | psi1=aftsTrack->Phi(); | |
12330 | for(Int_t i2=0;i2<nPrim;i2++) | |
12331 | { | |
12332 | if(i2==i1)continue; | |
12333 | aftsTrack=anEvent->GetTrack(i2); | |
12334 | // RP condition (!(first) particle in the correlator must be RP): | |
12335 | if(!(aftsTrack->InRPSelection())) continue; | |
12336 | phi2=aftsTrack->Phi(); | |
12337 | for(Int_t i3=0;i3<nPrim;i3++) | |
12338 | { | |
12339 | if(i3==i1||i3==i2)continue; | |
12340 | aftsTrack=anEvent->GetTrack(i3); | |
12341 | // RP condition (!(first) particle in the correlator must be RP): | |
12342 | if(!(aftsTrack->InRPSelection())) continue; | |
12343 | phi3=aftsTrack->Phi(); | |
12344 | // to be improved : where to store it? ->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(2.*phi1-phi2-phi3)),1.); // <w1 w2 w3 cos(n(2psi1-phi2-phi3))> | |
12345 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
12346 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12347 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12348 | ||
12349 | */ | |
12350 | ||
12351 | // 4'-particle correlations: | |
12352 | for(Int_t i1=0;i1<nPrim;i1++) | |
12353 | { | |
12354 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12355 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12356 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12357 | { |
12358 | if(ptOrEta == "Pt") | |
12359 | { | |
12360 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12361 | } else if (ptOrEta == "Eta") | |
12362 | { | |
12363 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12364 | } |
12365 | } else // this is diff flow of RPs | |
12366 | { | |
489d5531 | 12367 | if(ptOrEta == "Pt") |
12368 | { | |
12369 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12370 | } else if (ptOrEta == "Eta") | |
12371 | { | |
12372 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12373 | } |
12374 | } | |
489d5531 | 12375 | |
12376 | psi1=aftsTrack->Phi(); | |
12377 | for(Int_t i2=0;i2<nPrim;i2++) | |
12378 | { | |
12379 | if(i2==i1) continue; | |
12380 | aftsTrack=anEvent->GetTrack(i2); | |
12381 | // RP condition (!(first) particle in the correlator must be RP): | |
12382 | if(!(aftsTrack->InRPSelection())) continue; | |
12383 | phi2=aftsTrack->Phi(); | |
12384 | for(Int_t i3=0;i3<nPrim;i3++) | |
12385 | { | |
12386 | if(i3==i1||i3==i2) continue; | |
12387 | aftsTrack=anEvent->GetTrack(i3); | |
12388 | // RP condition (!(first) particle in the correlator must be RP): | |
12389 | if(!(aftsTrack->InRPSelection())) continue; | |
12390 | phi3=aftsTrack->Phi(); | |
12391 | for(Int_t i4=0;i4<nPrim;i4++) | |
12392 | { | |
12393 | if(i4==i1||i4==i2||i4==i3) continue; | |
12394 | aftsTrack=anEvent->GetTrack(i4); | |
12395 | // RP condition (!(first) particle in the correlator must be RP): | |
12396 | if(!(aftsTrack->InRPSelection())) continue; | |
12397 | phi4=aftsTrack->Phi(); | |
12398 | // 4'-particle correlations: | |
12399 | fDiffFlowDirectCorrelations[t][pe][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3-phi4)),1.); // <cos(n(psi1+phi2-phi3-phi4))> | |
12400 | }//end of for(Int_t i4=0;i4<nPrim;i4++) | |
12401 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
12402 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12403 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12404 | ||
12405 | // count # of RPs and POIs in selected pt and eta bins for cross-checkings: | |
3b552efe | 12406 | for(Int_t i=0;i<nPrim;i++) |
12407 | { | |
12408 | aftsTrack=anEvent->GetTrack(i); | |
12409 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
12410 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12411 | { |
12412 | if(ptOrEta == "Pt") | |
12413 | { | |
12414 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12415 | } else if (ptOrEta == "Eta") | |
12416 | { | |
12417 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12418 | } |
12419 | } else // this is diff flow of RPs | |
12420 | { | |
489d5531 | 12421 | if(ptOrEta == "Pt") |
12422 | { | |
12423 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12424 | } else if (ptOrEta == "Eta") | |
12425 | { | |
12426 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12427 | } |
12428 | } | |
12429 | if(t==1)t++; | |
12430 | fNoOfParticlesInBin->Fill(t+pe+0.5); | |
489d5531 | 12431 | } |
12432 | ||
12433 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
12434 | ||
489d5531 | 12435 | //================================================================================================================================ |
12436 | ||
64e500e3 | 12437 | void AliFlowAnalysisWithQCumulants::EvaluateOtherDiffCorrelatorsWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
12438 | { | |
12439 | // Evaluate other differential correlators with nested loops without using the particle weights. | |
12440 | ||
12441 | // Remark 1: Other differential correlators are evaluated in pt bin number fCrossCheckInPtBinNo | |
12442 | // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
12443 | // Remark 2: Results are stored in 1 bin profiles fOtherDirectDiffCorrelators[t][pe][sc][ci], where indices runs as follows: | |
12444 | // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms][ci = correlator index] | |
12445 | // Remark 3: Correlator index 'ci' runs as follows: | |
12446 | // 0: <exp(n*(psi1-3phi2+2phi3))> (Teaney-Yan correlator) | |
12447 | ||
12448 | Int_t typeFlag = 0; | |
12449 | Int_t ptEtaFlag = 0; | |
12450 | if(type == "RP") | |
12451 | { | |
12452 | typeFlag = 0; | |
12453 | } else if(type == "POI") | |
12454 | { | |
12455 | typeFlag = 1; | |
12456 | } | |
12457 | if(ptOrEta == "Pt") | |
12458 | { | |
12459 | ptEtaFlag = 0; | |
12460 | } else if(ptOrEta == "Eta") | |
12461 | { | |
12462 | ptEtaFlag = 1; | |
12463 | } | |
12464 | // shortcuts: | |
12465 | Int_t t = typeFlag; | |
12466 | Int_t pe = ptEtaFlag; | |
12467 | ||
12468 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12469 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12470 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
12471 | ||
12472 | Int_t nPrim = anEvent->NumberOfTracks(); | |
12473 | AliFlowTrackSimple *aftsTrack = NULL; | |
12474 | ||
12475 | Double_t psi1=0., phi2=0., phi3=0.; | |
12476 | ||
12477 | Int_t n = fHarmonic; | |
12478 | ||
12479 | // 3-p correlators: | |
12480 | for(Int_t i1=0;i1<nPrim;i1++) | |
12481 | { | |
12482 | aftsTrack=anEvent->GetTrack(i1); | |
12483 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
12484 | if(typeFlag==1) // this is diff flow of POIs | |
12485 | { | |
12486 | if(ptOrEta == "Pt") | |
12487 | { | |
12488 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12489 | } else if (ptOrEta == "Eta") | |
12490 | { | |
12491 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12492 | } | |
12493 | } else // this is diff flow of RPs | |
12494 | { | |
12495 | if(ptOrEta == "Pt") | |
12496 | { | |
12497 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12498 | } else if (ptOrEta == "Eta") | |
12499 | { | |
12500 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12501 | } | |
12502 | } | |
12503 | psi1=aftsTrack->Phi(); | |
12504 | for(Int_t i2=0;i2<nPrim;i2++) | |
12505 | { | |
12506 | if(i2==i1) continue; | |
12507 | aftsTrack=anEvent->GetTrack(i2); | |
12508 | // RP condition (!(first) particle in the correlator must be RP): | |
12509 | if(!(aftsTrack->InRPSelection())) continue; | |
12510 | phi2=aftsTrack->Phi(); | |
12511 | for(Int_t i3=0;i3<nPrim;i3++) | |
12512 | { | |
12513 | if(i3==i1||i3==i2) continue; | |
12514 | aftsTrack=anEvent->GetTrack(i3); | |
12515 | // RP condition (!(first) particle in the correlator must be RP): | |
12516 | if(!(aftsTrack->InRPSelection())) continue; | |
12517 | phi3=aftsTrack->Phi(); | |
12518 | // Fill 3-p correlators: | |
12519 | fOtherDirectDiffCorrelators[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-3.*phi2+2.*phi3)),1.); // <cos(n(psi1-3.*phi2+2.*phi3))> | |
12520 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
12521 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12522 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12523 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateOtherDiffCorrelatorsWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) | |
12524 | ||
12525 | //================================================================================================================================ | |
489d5531 | 12526 | |
12527 | void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrelations(TString type, TString ptOrEta) | |
12528 | { | |
12529 | // Compare correlations needed for diff. flow calculated with nested loops and those calculated from Q-vectors | |
12530 | ||
2a98ceb8 | 12531 | Int_t typeFlag = 0; |
12532 | Int_t ptEtaFlag = 0; | |
489d5531 | 12533 | if(type == "RP") |
12534 | { | |
12535 | typeFlag = 0; | |
12536 | } else if(type == "POI") | |
12537 | { | |
12538 | typeFlag = 1; | |
12539 | } | |
12540 | if(ptOrEta == "Pt") | |
12541 | { | |
12542 | ptEtaFlag = 0; | |
12543 | } else if(ptOrEta == "Eta") | |
12544 | { | |
12545 | ptEtaFlag = 1; | |
12546 | } | |
12547 | // shortcuts: | |
12548 | Int_t t = typeFlag; | |
12549 | Int_t pe = ptEtaFlag; | |
12550 | ||
12551 | TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
12552 | TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
12553 | TString reducedCorrelations[4] = {"<<cos(n(psi1-phi2))>>","<<cos(n(psi1+phi2-phi3-phi4))>>","",""}; // to be improved (access this from pro or hist) | |
12554 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12555 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12556 | ||
12557 | Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo}; | |
12558 | ||
12559 | ||
12560 | cout<<endl; | |
12561 | cout<<" *****************************************"<<endl; | |
12562 | cout<<" **** cross-checking the correlations ****"<<endl; | |
12563 | cout<<" **** for differential flow ("<<rpORpoiString[t]<<") ****"<<endl; | |
403e3389 | 12564 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 12565 | { |
12566 | cout<<" **** (particle weights not used) ****"<<endl; | |
12567 | } else | |
12568 | { | |
12569 | cout<<" **** (particle weights used) ****"<<endl; | |
12570 | } | |
12571 | cout<<" *****************************************"<<endl; | |
12572 | cout<<endl; | |
12573 | cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl; | |
12574 | cout<<endl; | |
12575 | ||
12576 | for(Int_t rci=0;rci<2;rci++) // to be improved (calculate 6th and 8th order) | |
12577 | { | |
12578 | cout<<" "<<reducedCorrelations[rci].Data()<<":"<<endl; | |
12579 | cout<<" from Q-vectors = "<<fDiffFlowCorrelationsPro[t][pe][rci]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl; | |
12580 | cout<<" from nested loops = "<<fDiffFlowDirectCorrelations[t][pe][rci]->GetBinContent(1)<<endl; | |
12581 | cout<<endl; | |
12582 | } // end of for(Int_t rci=0;rci<4;rci++) | |
12583 | ||
12584 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrelations(TString type, TString ptOrEta) | |
12585 | ||
3b552efe | 12586 | //================================================================================================================================ |
12587 | ||
64e500e3 | 12588 | void AliFlowAnalysisWithQCumulants::CrossCheckOtherDiffCorrelators(TString type, TString ptOrEta) |
12589 | { | |
12590 | // Compare correlations needed for diff. flow calculated with nested loops and those calculated from Q-vectors | |
12591 | ||
12592 | Int_t typeFlag = 0; | |
12593 | Int_t ptEtaFlag = 0; | |
12594 | if(type == "RP") | |
12595 | { | |
12596 | typeFlag = 0; | |
12597 | } else if(type == "POI") | |
12598 | { | |
12599 | typeFlag = 1; | |
12600 | } | |
12601 | if(ptOrEta == "Pt") | |
12602 | { | |
12603 | ptEtaFlag = 0; | |
12604 | } else if(ptOrEta == "Eta") | |
12605 | { | |
12606 | ptEtaFlag = 1; | |
12607 | } | |
12608 | // shortcuts: | |
12609 | Int_t t = typeFlag; | |
12610 | Int_t pe = ptEtaFlag; | |
12611 | ||
12612 | TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
12613 | TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
12614 | TString otherCorrelators[1] = {"<<cos(n(psi1-3phi2+2phi3))>>"}; // to be improved (access this from pro or hist) | |
12615 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12616 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12617 | ||
12618 | Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo}; | |
12619 | ||
12620 | cout<<endl; | |
12621 | cout<<" *****************************************"<<endl; | |
12622 | cout<<" **** cross-checking the other ****"<<endl; | |
12623 | cout<<" **** diff. correlators ("<<rpORpoiString[t]<<") ****"<<endl; | |
403e3389 | 12624 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
64e500e3 | 12625 | { |
12626 | cout<<" **** (particle weights not used) ****"<<endl; | |
12627 | } else | |
12628 | { | |
12629 | cout<<" **** (particle weights used) ****"<<endl; | |
12630 | } | |
12631 | cout<<" *****************************************"<<endl; | |
12632 | cout<<endl; | |
12633 | cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl; | |
12634 | cout<<endl; | |
12635 | ||
12636 | for(Int_t ci=0;ci<1;ci++) | |
12637 | { | |
12638 | cout<<" "<<otherCorrelators[ci].Data()<<":"<<endl; | |
12639 | cout<<" from Q-vectors = "<<fOtherDiffCorrelators[t][pe][1][ci]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl; | |
12640 | cout<<" from nested loops = "<<fOtherDirectDiffCorrelators[t][pe][1][ci]->GetBinContent(1)<<endl; | |
12641 | cout<<endl; | |
12642 | } // end of for(Int_t ci=0;ci<1;ci++) | |
12643 | ||
12644 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckOtherDiffCorrelators(TString type, TString ptOrEta) | |
12645 | ||
12646 | //================================================================================================================================ | |
12647 | ||
489d5531 | 12648 | void AliFlowAnalysisWithQCumulants::PrintNumberOfParticlesInSelectedBin() |
3b552efe | 12649 | { |
12650 | // Print on the screen number of RPs and POIs in selected pt and eta bin for cross checkings. | |
12651 | ||
12652 | cout<<endl; | |
12653 | cout<<"Number of RPs in selected pt bin = "<<fNoOfParticlesInBin->GetBinContent(1)<<endl; | |
12654 | cout<<"Number of RPs in selected eta bin = "<<fNoOfParticlesInBin->GetBinContent(2)<<endl; | |
12655 | cout<<"Number of POIs in selected pt bin = "<<fNoOfParticlesInBin->GetBinContent(3)<<endl; | |
12656 | cout<<"Number of POIs in selected eta bin = "<<fNoOfParticlesInBin->GetBinContent(4)<<endl; | |
12657 | ||
489d5531 | 12658 | } // end of void AliFlowAnalysisWithQCumulants::PrintNumberOfParticlesInSelectedBin() |
12659 | ||
3b552efe | 12660 | //================================================================================================================================ |
12661 | ||
0328db2d | 12662 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 12663 | { |
12664 | // Evaluate reduced correlations with nested loops without using the particle weights. | |
12665 | ||
12666 | // Remark 1: Reduced correlations are evaluated in pt bin number fCrossCheckInPtBinNo and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
12667 | // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrelations[t][pe][ci], where indices runs as follows: | |
12668 | // [0=RP,1=POI][0=Pt,1=Eta][0=<2'>,1=<4'>,2=<6'>,3=<8'>] | |
12669 | // Remark 3: <2'> = <w2 cos(n*(psi1-phi2))> | |
12670 | // <4'> = <w2 w3 w4 cos(n*(psi1+phi2-phi3-phi4))> | |
12671 | // ... | |
12672 | ||
2a98ceb8 | 12673 | Int_t typeFlag = 0; |
12674 | Int_t ptEtaFlag = 0; | |
489d5531 | 12675 | if(type == "RP") |
12676 | { | |
12677 | typeFlag = 0; | |
12678 | } else if(type == "POI") | |
12679 | { | |
12680 | typeFlag = 1; | |
12681 | } | |
12682 | if(ptOrEta == "Pt") | |
12683 | { | |
12684 | ptEtaFlag = 0; | |
12685 | } else if(ptOrEta == "Eta") | |
12686 | { | |
12687 | ptEtaFlag = 1; | |
12688 | } | |
12689 | // shortcuts: | |
12690 | Int_t t = typeFlag; | |
12691 | Int_t pe = ptEtaFlag; | |
12692 | ||
12693 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12694 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12695 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
12696 | ||
12697 | Int_t nPrim = anEvent->NumberOfTracks(); | |
12698 | AliFlowTrackSimple *aftsTrack = NULL; | |
12699 | ||
12700 | Double_t psi1=0., phi2=0., phi3=0., phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
12701 | Double_t wPhi2=1., wPhi3=1., wPhi4=1.;// wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
12702 | ||
12703 | Int_t n = fHarmonic; | |
12704 | ||
12705 | // 2'-particle correlations: | |
12706 | for(Int_t i1=0;i1<nPrim;i1++) | |
12707 | { | |
12708 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12709 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12710 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12711 | { |
12712 | if(ptOrEta == "Pt") | |
12713 | { | |
12714 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12715 | } else if (ptOrEta == "Eta") | |
12716 | { | |
12717 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12718 | } |
12719 | } else // this is diff flow of RPs | |
12720 | { | |
489d5531 | 12721 | if(ptOrEta == "Pt") |
12722 | { | |
12723 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12724 | } else if (ptOrEta == "Eta") | |
12725 | { | |
12726 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12727 | } |
489d5531 | 12728 | } |
12729 | psi1=aftsTrack->Phi(); | |
12730 | for(Int_t i2=0;i2<nPrim;i2++) | |
12731 | { | |
12732 | if(i2==i1) continue; | |
12733 | aftsTrack=anEvent->GetTrack(i2); | |
12734 | // RP condition (!(first) particle in the correlator must be RP): | |
12735 | if(!(aftsTrack->InRPSelection())) continue; | |
12736 | phi2=aftsTrack->Phi(); | |
12737 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
12738 | // 2'-particle correlations: | |
12739 | fDiffFlowDirectCorrelations[t][pe][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(1.*n*(psi1-phi2)),wPhi2); // <w2 cos(n*(psi1-phi2)) | |
12740 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12741 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12742 | ||
12743 | // 4'-particle correlations: | |
12744 | for(Int_t i1=0;i1<nPrim;i1++) | |
12745 | { | |
12746 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12747 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12748 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12749 | { |
12750 | if(ptOrEta == "Pt") | |
12751 | { | |
12752 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12753 | } else if (ptOrEta == "Eta") | |
12754 | { | |
12755 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12756 | } |
12757 | } else // this is diff flow of RPs | |
12758 | { | |
489d5531 | 12759 | if(ptOrEta == "Pt") |
12760 | { | |
12761 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12762 | } else if (ptOrEta == "Eta") | |
12763 | { | |
12764 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12765 | } |
489d5531 | 12766 | } |
12767 | psi1=aftsTrack->Phi(); | |
12768 | for(Int_t i2=0;i2<nPrim;i2++) | |
12769 | { | |
12770 | if(i2==i1) continue; | |
12771 | aftsTrack=anEvent->GetTrack(i2); | |
12772 | // RP condition (!(first) particle in the correlator must be RP): | |
12773 | if(!(aftsTrack->InRPSelection())) continue; | |
12774 | phi2=aftsTrack->Phi(); | |
12775 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
12776 | for(Int_t i3=0;i3<nPrim;i3++) | |
12777 | { | |
12778 | if(i3==i1||i3==i2) continue; | |
12779 | aftsTrack=anEvent->GetTrack(i3); | |
12780 | // RP condition (!(first) particle in the correlator must be RP): | |
12781 | if(!(aftsTrack->InRPSelection())) continue; | |
12782 | phi3=aftsTrack->Phi(); | |
12783 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
12784 | for(Int_t i4=0;i4<nPrim;i4++) | |
12785 | { | |
12786 | if(i4==i1||i4==i2||i4==i3) continue; | |
12787 | aftsTrack=anEvent->GetTrack(i4); | |
12788 | // RP condition (!(first) particle in the correlator must be RP): | |
12789 | if(!(aftsTrack->InRPSelection())) continue; | |
12790 | phi4=aftsTrack->Phi(); | |
12791 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); | |
12792 | // 4'-particle correlations <w2 w3 w4 cos(n(psi1+phi2-phi3-phi4))>: | |
12793 | fDiffFlowDirectCorrelations[t][pe][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3-phi4)),wPhi2*wPhi3*wPhi4); | |
12794 | }//end of for(Int_t i4=0;i4<nPrim;i4++) | |
12795 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
12796 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12797 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12798 | ||
12799 | // count # of RPs and POIs in selected pt and eta bins for cross-checkings: (to be improved - moved to dedicated method) | |
3b552efe | 12800 | for(Int_t i=0;i<nPrim;i++) |
12801 | { | |
489d5531 | 12802 | aftsTrack=anEvent->GetTrack(i); |
12803 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) | |
12804 | if(typeFlag==1) // this is diff flow of POIs | |
12805 | { | |
12806 | if(ptOrEta == "Pt") | |
12807 | { | |
12808 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12809 | } else if (ptOrEta == "Eta") | |
12810 | { | |
12811 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12812 | } | |
12813 | } else // this is diff flow of RPs | |
12814 | { | |
12815 | if(ptOrEta == "Pt") | |
12816 | { | |
12817 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12818 | } else if (ptOrEta == "Eta") | |
12819 | { | |
12820 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12821 | } | |
12822 | } | |
12823 | if(t==1)t++; | |
12824 | fNoOfParticlesInBin->Fill(t+pe+0.5); | |
12825 | } | |
12826 | ||
12827 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrelationsWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
12828 | ||
489d5531 | 12829 | //================================================================================================================================ |
12830 | ||
0328db2d | 12831 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 12832 | { |
12833 | // Evaluate with nested loops correction terms for non-uniform acceptance (both sin and cos terms) relevant for differential flow. | |
12834 | ||
12835 | // Remark 1: Reduced correction terms for non-uniform acceptance are evaluated in pt bin number fCrossCheckInPtBinNo | |
12836 | // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
12837 | // Remark 2: Results are stored in 1 bin profiles fDiffFlowDirectCorrections[t][pe][sc][cti], where first three indices runs as: | |
12838 | // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms], whilst the cti (correction term index) runs as follows: | |
12839 | // cti: | |
12840 | // 0: <<sc n(psi1)>> | |
12841 | // 1: <<sc n(psi1+phi2)>> | |
12842 | // 2: <<sc n(psi1+phi2-phi3)>> | |
12843 | // 3: <<sc n(psi1-phi2-phi3)>> | |
12844 | // 4: | |
12845 | // 5: | |
12846 | // 6: | |
12847 | ||
2a98ceb8 | 12848 | Int_t typeFlag = 0; |
12849 | Int_t ptEtaFlag = 0; | |
489d5531 | 12850 | if(type == "RP") |
12851 | { | |
12852 | typeFlag = 0; | |
12853 | } else if(type == "POI") | |
12854 | { | |
12855 | typeFlag = 1; | |
12856 | } | |
12857 | if(ptOrEta == "Pt") | |
12858 | { | |
12859 | ptEtaFlag = 0; | |
12860 | } else if(ptOrEta == "Eta") | |
12861 | { | |
12862 | ptEtaFlag = 1; | |
12863 | } | |
12864 | // shortcuts: | |
12865 | Int_t t = typeFlag; | |
12866 | Int_t pe = ptEtaFlag; | |
12867 | ||
12868 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
12869 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
12870 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
12871 | ||
12872 | Int_t nPrim = anEvent->NumberOfTracks(); | |
12873 | AliFlowTrackSimple *aftsTrack = NULL; | |
12874 | ||
12875 | Double_t psi1=0., phi2=0., phi3=0.;// phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
12876 | ||
12877 | Int_t n = fHarmonic; | |
12878 | ||
12879 | // 1-particle correction terms: | |
12880 | for(Int_t i1=0;i1<nPrim;i1++) | |
12881 | { | |
12882 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12883 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12884 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12885 | { |
12886 | if(ptOrEta == "Pt") | |
12887 | { | |
12888 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12889 | } else if (ptOrEta == "Eta") | |
12890 | { | |
12891 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12892 | } |
12893 | } else // this is diff flow of RPs | |
12894 | { | |
489d5531 | 12895 | if(ptOrEta == "Pt") |
12896 | { | |
12897 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12898 | } else if (ptOrEta == "Eta") | |
12899 | { | |
12900 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12901 | } |
12902 | } | |
489d5531 | 12903 | psi1=aftsTrack->Phi(); |
12904 | // sin terms: | |
12905 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*psi1),1.); // <<sin(n*(psi1))>> | |
12906 | // cos terms: | |
12907 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*psi1),1.); // <<cos(n*(psi1))>> | |
12908 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12909 | ||
12910 | // 2-particle correction terms: | |
12911 | for(Int_t i1=0;i1<nPrim;i1++) | |
12912 | { | |
12913 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12914 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12915 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12916 | { |
12917 | if(ptOrEta == "Pt") | |
12918 | { | |
12919 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12920 | } else if (ptOrEta == "Eta") | |
12921 | { | |
12922 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12923 | } |
12924 | } else // this is diff flow of RPs | |
12925 | { | |
489d5531 | 12926 | if(ptOrEta == "Pt") |
12927 | { | |
12928 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12929 | } else if (ptOrEta == "Eta") | |
12930 | { | |
12931 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12932 | } |
489d5531 | 12933 | } |
12934 | psi1=aftsTrack->Phi(); | |
12935 | for(Int_t i2=0;i2<nPrim;i2++) | |
12936 | { | |
12937 | if(i2==i1) continue; | |
12938 | aftsTrack=anEvent->GetTrack(i2); | |
12939 | // RP condition (!(first) particle in the correlator must be RP): | |
12940 | if(!(aftsTrack->InRPSelection())) continue; | |
12941 | phi2=aftsTrack->Phi(); | |
12942 | // sin terms: | |
12943 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2)),1.); // <<sin(n*(psi1+phi2))>> | |
12944 | // cos terms: | |
12945 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2)),1.); // <<cos(n*(psi1+phi2))>> | |
12946 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12947 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12948 | ||
12949 | // 3-particle correction terms: | |
12950 | for(Int_t i1=0;i1<nPrim;i1++) | |
12951 | { | |
12952 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 12953 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
12954 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 12955 | { |
12956 | if(ptOrEta == "Pt") | |
12957 | { | |
12958 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
12959 | } else if (ptOrEta == "Eta") | |
12960 | { | |
12961 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 12962 | } |
12963 | } else // this is diff flow of RPs | |
12964 | { | |
489d5531 | 12965 | if(ptOrEta == "Pt") |
12966 | { | |
12967 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
12968 | } else if (ptOrEta == "Eta") | |
12969 | { | |
12970 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 12971 | } |
489d5531 | 12972 | } |
12973 | psi1=aftsTrack->Phi(); | |
12974 | for(Int_t i2=0;i2<nPrim;i2++) | |
12975 | { | |
12976 | if(i2==i1) continue; | |
12977 | aftsTrack=anEvent->GetTrack(i2); | |
12978 | // RP condition (!(first) particle in the correlator must be RP): | |
12979 | if(!(aftsTrack->InRPSelection())) continue; | |
12980 | phi2=aftsTrack->Phi(); | |
12981 | for(Int_t i3=0;i3<nPrim;i3++) | |
12982 | { | |
12983 | if(i3==i1||i3==i2) continue; | |
12984 | aftsTrack=anEvent->GetTrack(i3); | |
12985 | // RP condition (!(first) particle in the correlator must be RP): | |
12986 | if(!(aftsTrack->InRPSelection())) continue; | |
12987 | phi3=aftsTrack->Phi(); | |
12988 | // sin terms: | |
12989 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2-phi3)),1.); // <<sin(n*(psi1+phi2-phi3))>> | |
12990 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1-phi2-phi3)),1.); // <<sin(n*(psi1-phi2-phi3))>> | |
12991 | // cos terms: | |
12992 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3)),1.); // <<cos(n*(psi1+phi2-phi3))>> | |
12993 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-phi2-phi3)),1.); // <<cos(n*(psi1-phi2-phi3))>> | |
12994 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
12995 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
12996 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
12997 | ||
12998 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoops(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
12999 | ||
13000 | ||
13001 | //================================================================================================================================ | |
13002 | ||
13003 | ||
13004 | void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrectionTermsForNUA(TString type, TString ptOrEta) | |
13005 | { | |
13006 | // Compare corrections temrs for non-uniform acceptance needed for diff. flow calculated with nested loops and those calculated from Q-vectors | |
13007 | ||
2a98ceb8 | 13008 | Int_t typeFlag = 0; |
13009 | Int_t ptEtaFlag = 0; | |
489d5531 | 13010 | if(type == "RP") |
13011 | { | |
13012 | typeFlag = 0; | |
13013 | } else if(type == "POI") | |
13014 | { | |
13015 | typeFlag = 1; | |
13016 | } | |
13017 | if(ptOrEta == "Pt") | |
13018 | { | |
13019 | ptEtaFlag = 0; | |
13020 | } else if(ptOrEta == "Eta") | |
13021 | { | |
13022 | ptEtaFlag = 1; | |
13023 | } | |
13024 | // shortcuts: | |
13025 | Int_t t = typeFlag; | |
13026 | Int_t pe = ptEtaFlag; | |
13027 | ||
13028 | TString rpORpoiString[2] = {"RP ","POI"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
13029 | TString ptORetaString[2] = {"pt","eta"}; // to be improved (name in the same way as in the other methods, eventually promote to data member) | |
13030 | //TString sinCosFlag[2] = {"sin","cos"}; // to be improved (eventually promote to data member) | |
13031 | TString reducedCorrectionSinTerms[4] = {"<<sin(n(psi1))>>","<<sin(n(psi1+phi2))>>","<<sin(n*(psi1+phi2-phi3))>>","<<sin(n*(psi1-phi2-phi3))>>"}; // to be improved (access this from pro or hist) | |
13032 | TString reducedCorrectionCosTerms[4] = {"<<cos(n(psi1))>>","<<cos(n(psi1+phi2))>>","<<cos(n*(psi1+phi2-phi3))>>","<<cos(n*(psi1-phi2-phi3))>>"}; // to be improved (access this from pro or hist) | |
13033 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
13034 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
13035 | ||
13036 | Int_t crossCheckInPtEtaBinNo[2] = {fCrossCheckInPtBinNo,fCrossCheckInEtaBinNo}; | |
13037 | ||
13038 | cout<<endl; | |
13039 | cout<<" ******************************************"<<endl; | |
13040 | cout<<" **** cross-checking the correction ****"<<endl; | |
46b94261 | 13041 | cout<<" **** terms for non-uniform acceptance ****"<<endl; |
489d5531 | 13042 | cout<<" **** for differential flow ("<<rpORpoiString[t]<<") ****"<<endl; |
403e3389 | 13043 | if(!(fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights)) |
489d5531 | 13044 | { |
13045 | cout<<" **** (particle weights not used) ****"<<endl; | |
13046 | } else | |
13047 | { | |
13048 | cout<<" **** (particle weights used) ****"<<endl; | |
13049 | } | |
13050 | cout<<" ******************************************"<<endl; | |
13051 | cout<<endl; | |
13052 | cout<<" "<<ptORetaString[pe]<<" bin: "<<lowerPtEtaEdge[pe]<<" <= "<<ptORetaString[pe]<<" < "<<upperPtEtaEdge[pe]<<endl; | |
13053 | cout<<endl; | |
13054 | ||
13055 | for(Int_t cti=0;cti<4;cti++) // correction term index | |
13056 | { | |
13057 | for(Int_t sc=0;sc<2;sc++) // sin or cos terms | |
13058 | { | |
13059 | if(sc==0) // to be improved (this can be implemented better) | |
13060 | { | |
13061 | cout<<" "<<reducedCorrectionSinTerms[cti].Data()<<":"<<endl; | |
13062 | } else | |
13063 | { | |
13064 | cout<<" "<<reducedCorrectionCosTerms[cti].Data()<<":"<<endl; | |
13065 | } | |
13066 | cout<<" from Q-vectors = "<<fDiffFlowCorrectionTermsForNUAPro[t][pe][sc][cti]->GetBinContent(crossCheckInPtEtaBinNo[pe])<<endl; | |
13067 | cout<<" from nested loops = "<<fDiffFlowDirectCorrectionTermsForNUA[t][pe][sc][cti]->GetBinContent(1)<<endl; | |
13068 | cout<<endl; | |
13069 | } | |
13070 | } // end of for(Int_t rci=0;rci<4;rci++) | |
13071 | ||
13072 | } // end of void AliFlowAnalysisWithQCumulants::CrossCheckDiffFlowCorrectionTermsForNUA(TString type, TString ptOrEta) | |
13073 | ||
57340a27 | 13074 | //================================================================================================================================ |
13075 | ||
489d5531 | 13076 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights() |
13077 | { | |
13078 | // Calculate corrections using particle weights for non-uniform acceptance of the detector for no-name integrated flow (cos terms). | |
13079 | ||
13080 | // ********************************************************************** | |
13081 | // **** weighted corrections for non-uniform acceptance (cos terms): **** | |
13082 | // ********************************************************************** | |
57340a27 | 13083 | |
489d5531 | 13084 | // Remark 1: When particle weights are used the binning of fIntFlowCorrectionTermsForNUAPro[1] is organized as follows: |
57340a27 | 13085 | // |
489d5531 | 13086 | // 1st bin: <<w1 cos(n*(phi1))>> = cosP1nW1 |
13087 | // 2nd bin: <<w1 w2 cos(n*(phi1+phi2))>> = cosP1nP1nW1W1 | |
13088 | // 3rd bin: <<w1 w2 w3 cos(n*(phi1-phi2-phi3))>> = cosP1nM1nM1nW1W1W1 | |
13089 | // ... | |
13090 | ||
13091 | // multiplicity (number of particles used to determine the reaction plane) | |
1268c371 | 13092 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 13093 | |
13094 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
13095 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
13096 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
13097 | //Double_t dReQ3n3k = (*fReQ)(2,3); | |
13098 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
13099 | Double_t dReQ1n3k = (*fReQ)(0,3); | |
13100 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
13101 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
13102 | //Double_t dImQ3n3k = (*fImQ)(2,3); | |
13103 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
13104 | //Double_t dImQ1n3k = (*fImQ)(0,3); | |
13105 | ||
13106 | // dMs are variables introduced in order to simplify some Eqs. bellow: | |
13107 | //.............................................................................................. | |
1268c371 | 13108 | Double_t dM11 = (*fSpk)(1,1)-(*fSpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
13109 | Double_t dM111 = (*fSpk)(2,1)-3.*(*fSpk)(0,2)*(*fSpk)(0,1) | |
13110 | + 2.*(*fSpk)(0,3); // dM111 = sum_{i,j,k=1,i!=j!=k}^M w_i w_j w_k | |
489d5531 | 13111 | //.............................................................................................. |
ecac11c2 | 13112 | // 1-particle: |
489d5531 | 13113 | Double_t cosP1nW1 = 0.; // <<w1 cos(n*(phi1))>> |
13114 | ||
1268c371 | 13115 | if(dMult>0 && TMath::Abs((*fSpk)(0,1))>1.e-6) |
489d5531 | 13116 | { |
1268c371 | 13117 | cosP1nW1 = dReQ1n1k/(*fSpk)(0,1); |
489d5531 | 13118 | |
13119 | // average weighted 1-particle correction (cos terms) for non-uniform acceptance for single event: | |
13120 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(1,cosP1nW1); | |
13121 | ||
13122 | // final average weighted 1-particle correction (cos terms) for non-uniform acceptance for all events: | |
1268c371 | 13123 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(0.5,cosP1nW1,(*fSpk)(0,1)); |
489d5531 | 13124 | } |
13125 | ||
13126 | // 2-particle: | |
13127 | Double_t cosP1nP1nW1W1 = 0.; // <<w1 w2 cos(n*(phi1+phi2))>> | |
13128 | ||
1268c371 | 13129 | if(dMult>1 && TMath::Abs(dM11)>1.e-6) |
489d5531 | 13130 | { |
13131 | cosP1nP1nW1W1 = (pow(dReQ1n1k,2)-pow(dImQ1n1k,2)-dReQ2n2k)/dM11; | |
13132 | ||
13133 | // average weighted 2-particle correction (cos terms) for non-uniform acceptance for single event: | |
13134 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(2,cosP1nP1nW1W1); | |
13135 | ||
13136 | // final average weighted 2-particle correction (cos terms) for non-uniform acceptance for all events: | |
13137 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(1.5,cosP1nP1nW1W1,dM11); | |
13138 | } | |
13139 | ||
13140 | // 3-particle: | |
13141 | Double_t cosP1nM1nM1nW1W1W1 = 0.; // <<w1 w2 w3 cos(n*(phi1-phi2-phi3))>> | |
13142 | ||
1268c371 | 13143 | if(dMult>2 && TMath::Abs(dM111)>1.e-6) |
489d5531 | 13144 | { |
57340a27 | 13145 | cosP1nM1nM1nW1W1W1 = (dReQ1n1k*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
13146 | - dReQ1n1k*dReQ2n2k-dImQ1n1k*dImQ2n2k | |
1268c371 | 13147 | - 2.*((*fSpk)(0,2))*dReQ1n1k |
489d5531 | 13148 | + 2.*dReQ1n3k) |
13149 | / dM111; | |
13150 | ||
13151 | // average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for single event: | |
13152 | fIntFlowCorrectionTermsForNUAEBE[1]->SetBinContent(3,cosP1nM1nM1nW1W1W1); | |
13153 | ||
13154 | // final average non-weighted 3-particle correction (cos terms) for non-uniform acceptance for all events: | |
13155 | fIntFlowCorrectionTermsForNUAPro[1]->Fill(2.5,cosP1nM1nM1nW1W1W1,dM111); | |
13156 | } | |
13157 | ||
13158 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUACosTermsUsingParticleWeights() | |
13159 | ||
13160 | ||
13161 | //================================================================================================================================ | |
13162 | ||
13163 | ||
13164 | void AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights() | |
13165 | { | |
13166 | // calculate corrections using particle weights for non-uniform acceptance of the detector for no-name integrated flow (sin terms) | |
13167 | ||
13168 | // ********************************************************************** | |
13169 | // **** weighted corrections for non-uniform acceptance (sin terms): **** | |
13170 | // ********************************************************************** | |
13171 | ||
13172 | // Remark 1: When particle weights are used the binning of fIntFlowCorrectionTermsForNUAPro[0] is organized as follows: | |
57340a27 | 13173 | // |
489d5531 | 13174 | // 1st bin: <<w1 sin(n*(phi1))>> = sinP1nW1 |
13175 | // 2nd bin: <<w1 w2 sin(n*(phi1+phi2))>> = sinP1nP1nW1W1 | |
13176 | // 3rd bin: <<w1 w2 w3 sin(n*(phi1-phi2-phi3))>> = sinP1nM1nM1nW1W1W1 | |
13177 | // ... | |
13178 | ||
13179 | // multiplicity (number of particles used to determine the reaction plane) | |
1268c371 | 13180 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 13181 | |
13182 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
13183 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
13184 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
13185 | //Double_t dReQ3n3k = (*fReQ)(2,3); | |
13186 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
13187 | //Double_t dReQ1n3k = (*fReQ)(0,3); | |
13188 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
13189 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
13190 | //Double_t dImQ3n3k = (*fImQ)(2,3); | |
13191 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
13192 | Double_t dImQ1n3k = (*fImQ)(0,3); | |
13193 | ||
13194 | // dMs are variables introduced in order to simplify some Eqs. bellow: | |
13195 | //.............................................................................................. | |
1268c371 | 13196 | Double_t dM11 = (*fSpk)(1,1)-(*fSpk)(0,2); // dM11 = sum_{i,j=1,i!=j}^M w_i w_j |
13197 | Double_t dM111 = (*fSpk)(2,1)-3.*(*fSpk)(0,2)*(*fSpk)(0,1) | |
13198 | + 2.*(*fSpk)(0,3); // dM111 = sum_{i,j,k=1,i!=j!=k}^M w_i w_j w_k | |
489d5531 | 13199 | //.............................................................................................. |
13200 | ||
13201 | // 1-particle: | |
13202 | Double_t sinP1nW1 = 0.; // <<w1 sin(n*(phi1))>> | |
13203 | ||
1268c371 | 13204 | if(dMult>0 && TMath::Abs((*fSpk)(0,1))>1.e-6) |
489d5531 | 13205 | { |
1268c371 | 13206 | sinP1nW1 = dImQ1n1k/((*fSpk)(0,1)); |
489d5531 | 13207 | |
13208 | // average weighted 1-particle correction (sin terms) for non-uniform acceptance for single event: | |
13209 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(1,sinP1nW1); | |
13210 | ||
13211 | // final average weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
1268c371 | 13212 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(0.5,sinP1nW1,(*fSpk)(0,1)); |
489d5531 | 13213 | } |
13214 | ||
13215 | // 2-particle: | |
13216 | Double_t sinP1nP1nW1W1 = 0.; // <<w1 w2 sin(n*(phi1+phi2))>> | |
13217 | ||
1268c371 | 13218 | if(dMult>1 && TMath::Abs(dM11)>1.e-6) |
489d5531 | 13219 | { |
13220 | sinP1nP1nW1W1 = (2.*dReQ1n1k*dImQ1n1k-dImQ2n2k)/dM11; | |
13221 | ||
13222 | // average weighted 2-particle correction (sin terms) for non-uniform acceptance for single event: | |
13223 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(2,sinP1nP1nW1W1); | |
13224 | ||
13225 | // final average weighted 1-particle correction (sin terms) for non-uniform acceptance for all events: | |
13226 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(1.5,sinP1nP1nW1W1,dM11); | |
13227 | } | |
13228 | ||
13229 | // 3-particle: | |
13230 | Double_t sinP1nM1nM1nW1W1W1 = 0.; // <<w1 w2 w3 sin(n*(phi1-phi2-phi3))>> | |
13231 | ||
1268c371 | 13232 | if(dMult>2 && TMath::Abs(dM111)>1.e-6) |
489d5531 | 13233 | { |
57340a27 | 13234 | sinP1nM1nM1nW1W1W1 = (-dImQ1n1k*(pow(dReQ1n1k,2)+pow(dImQ1n1k,2)) |
13235 | + dReQ1n1k*dImQ2n2k-dImQ1n1k*dReQ2n2k | |
1268c371 | 13236 | + 2.*((*fSpk)(0,2))*dImQ1n1k |
489d5531 | 13237 | - 2.*dImQ1n3k) |
13238 | / dM111; | |
13239 | ||
13240 | // average weighted 3-particle correction (sin terms) for non-uniform acceptance for single event: | |
13241 | fIntFlowCorrectionTermsForNUAEBE[0]->SetBinContent(3,sinP1nM1nM1nW1W1W1); | |
13242 | ||
13243 | // final average weighted 3-particle correction (sin terms) for non-uniform acceptance for all events: | |
13244 | fIntFlowCorrectionTermsForNUAPro[0]->Fill(2.5,sinP1nM1nM1nW1W1W1,dM111); | |
13245 | } | |
13246 | ||
13247 | } // end of AliFlowAnalysisWithQCumulants::CalculateIntFlowCorrectionsForNUASinTermsUsingParticleWeights() | |
13248 | ||
57340a27 | 13249 | //================================================================================================================================ |
489d5531 | 13250 | |
0328db2d | 13251 | void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent) |
489d5531 | 13252 | { |
13253 | // Evaluate with nested loops correction terms for non-uniform acceptance for integrated flow (using the particle weights). | |
13254 | ||
57340a27 | 13255 | // Results are stored in profiles fIntFlowDirectCorrectionTermsForNUA[0] (sin terms) and |
13256 | // fIntFlowDirectCorrectionTermsForNUA[1] (cos terms). | |
489d5531 | 13257 | |
57340a27 | 13258 | // Remark 1: When particle weights are used the binning of fIntFlowDirectCorrectionTermsForNUA[sc] is |
489d5531 | 13259 | // organized as follows (sc stands for either sin or cos): |
13260 | // | |
13261 | // 1st bin: <<w1 sc(n*(phi1))>> = scP1nW1 | |
13262 | // 2nd bin: <<w1 w2 sc(n*(phi1+phi2))>> = scP1nP1nW1W1 | |
13263 | // 3rd bin: <<w1 w2 w3 sc(n*(phi1-phi2-phi3))>> = scP1nM1nM1nW1W1W1 | |
3b552efe | 13264 | // ... |
489d5531 | 13265 | |
13266 | Int_t nPrim = anEvent->NumberOfTracks(); | |
13267 | AliFlowTrackSimple *aftsTrack = NULL; | |
13268 | //Double_t phi1=0., phi2=0., phi3=0., phi4=0., phi5=0., phi6=0., phi7=0., phi8=0.; | |
13269 | //Double_t wPhi1=1., wPhi2=1., wPhi3=1., wPhi4=1., wPhi5=1., wPhi6=1., wPhi7=1., wPhi8=1.; | |
13270 | Double_t phi1=0., phi2=0., phi3=0.; | |
13271 | Double_t wPhi1=1., wPhi2=1., wPhi3=1.; | |
13272 | Int_t n = fHarmonic; | |
13273 | Int_t eventNo = (Int_t)fAvMultiplicity->GetBinEntries(1); // to be improved (is this casting safe in general?) | |
1268c371 | 13274 | Double_t dMult = (*fSpk)(0,0); |
489d5531 | 13275 | cout<<endl; |
13276 | cout<<"Correction terms for non-uniform acceptance: Event number: "<<eventNo<<", multiplicity is "<<dMult<<endl; | |
13277 | if(dMult<1) | |
13278 | { | |
13279 | cout<<"... skipping this event (multiplicity too low) ..."<<endl; | |
13280 | } else if (dMult>fMaxAllowedMultiplicity) | |
13281 | { | |
13282 | cout<<"... skipping this event (multiplicity too high) ..."<<endl; | |
13283 | } else | |
13284 | { | |
13285 | cout<<"... evaluating nested loops (using particle weights) ..."<<endl; | |
13286 | } | |
13287 | ||
13288 | // 1-particle correction terms using particle weights: | |
13289 | if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity) | |
13290 | { | |
13291 | for(Int_t i1=0;i1<nPrim;i1++) | |
13292 | { | |
13293 | aftsTrack=anEvent->GetTrack(i1); | |
13294 | if(!(aftsTrack->InRPSelection())) continue; | |
13295 | phi1=aftsTrack->Phi(); | |
13296 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
57340a27 | 13297 | // 1-particle correction terms using particle weights: |
489d5531 | 13298 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(0.5,sin(n*phi1),wPhi1); // <w1 sin(n*phi1)> |
13299 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(0.5,cos(n*phi1),wPhi1); // <w1 cos(n*phi1)> | |
57340a27 | 13300 | } // end of for(Int_t i1=0;i1<nPrim;i1++) |
13301 | } // end of if(nPrim>=1 && nPrim<=fMaxAllowedMultiplicity) | |
13302 | ||
489d5531 | 13303 | // 2-particle correction terms using particle weights: |
13304 | if(nPrim>=2 && nPrim<=fMaxAllowedMultiplicity) | |
13305 | { | |
13306 | for(Int_t i1=0;i1<nPrim;i1++) | |
13307 | { | |
13308 | aftsTrack=anEvent->GetTrack(i1); | |
13309 | if(!(aftsTrack->InRPSelection())) continue; | |
13310 | phi1=aftsTrack->Phi(); | |
13311 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
13312 | for(Int_t i2=0;i2<nPrim;i2++) | |
13313 | { | |
13314 | if(i2==i1)continue; | |
13315 | aftsTrack=anEvent->GetTrack(i2); | |
13316 | if(!(aftsTrack->InRPSelection())) continue; | |
13317 | phi2=aftsTrack->Phi(); | |
13318 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
13319 | if(nPrim==2) cout<<i1<<" "<<i2<<"\r"<<flush; | |
57340a27 | 13320 | // 2-p correction terms using particle weights: |
489d5531 | 13321 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(1.5,sin(n*(phi1+phi2)),wPhi1*wPhi2); // <w1 w2 sin(n*(phi1+phi2))> |
13322 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(1.5,cos(n*(phi1+phi2)),wPhi1*wPhi2); // <w1 w2 cos(n*(phi1+phi2))> | |
13323 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
13324 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
13325 | } // end of if(nPrim>=2) | |
13326 | ||
13327 | // 3-particle correction terms using particle weights: | |
13328 | if(nPrim>=3 && nPrim<=fMaxAllowedMultiplicity) | |
13329 | { | |
13330 | for(Int_t i1=0;i1<nPrim;i1++) | |
13331 | { | |
13332 | aftsTrack=anEvent->GetTrack(i1); | |
13333 | if(!(aftsTrack->InRPSelection())) continue; | |
13334 | phi1=aftsTrack->Phi(); | |
13335 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
13336 | for(Int_t i2=0;i2<nPrim;i2++) | |
13337 | { | |
13338 | if(i2==i1)continue; | |
13339 | aftsTrack=anEvent->GetTrack(i2); | |
13340 | if(!(aftsTrack->InRPSelection())) continue; | |
13341 | phi2=aftsTrack->Phi(); | |
13342 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
13343 | for(Int_t i3=0;i3<nPrim;i3++) | |
13344 | { | |
13345 | if(i3==i1||i3==i2)continue; | |
13346 | aftsTrack=anEvent->GetTrack(i3); | |
13347 | if(!(aftsTrack->InRPSelection())) continue; | |
13348 | phi3=aftsTrack->Phi(); | |
13349 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
13350 | if(nPrim==3) cout<<i1<<" "<<i2<<" "<<i3<<"\r"<<flush; | |
57340a27 | 13351 | // 3-p correction terms using particle weights: |
489d5531 | 13352 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[0]->Fill(2.5,sin(n*(phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 sin(n*(phi1-phi2-phi3))> |
13353 | if(fUsePhiWeights) fIntFlowDirectCorrectionTermsForNUA[1]->Fill(2.5,cos(n*(phi1-phi2-phi3)),wPhi1*wPhi2*wPhi3); // <w1 w2 w3 cos(n*(phi1-phi2-phi3))> | |
13354 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
13355 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
13356 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
13357 | } // end of if(nPrim>=3) | |
13358 | ||
57340a27 | 13359 | /* |
13360 | ||
489d5531 | 13361 | if(nPrim>=4 && nPrim<=fMaxAllowedMultiplicity) |
13362 | { | |
13363 | // 4 nested loops multiparticle correlations using particle weights: | |
13364 | for(Int_t i1=0;i1<nPrim;i1++) | |
13365 | { | |
13366 | aftsTrack=anEvent->GetTrack(i1); | |
13367 | if(!(aftsTrack->InRPSelection())) continue; | |
13368 | phi1=aftsTrack->Phi(); | |
13369 | if(fUsePhiWeights && fPhiWeights) wPhi1 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi1*fnBinsPhi/TMath::TwoPi()))); | |
13370 | for(Int_t i2=0;i2<nPrim;i2++) | |
13371 | { | |
13372 | if(i2==i1)continue; | |
13373 | aftsTrack=anEvent->GetTrack(i2); | |
13374 | if(!(aftsTrack->InRPSelection())) continue; | |
13375 | phi2=aftsTrack->Phi(); | |
13376 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
13377 | for(Int_t i3=0;i3<nPrim;i3++) | |
13378 | { | |
13379 | if(i3==i1||i3==i2)continue; | |
13380 | aftsTrack=anEvent->GetTrack(i3); | |
13381 | if(!(aftsTrack->InRPSelection())) continue; | |
13382 | phi3=aftsTrack->Phi(); | |
13383 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
13384 | for(Int_t i4=0;i4<nPrim;i4++) | |
13385 | { | |
13386 | if(i4==i1||i4==i2||i4==i3)continue; | |
13387 | aftsTrack=anEvent->GetTrack(i4); | |
13388 | if(!(aftsTrack->InRPSelection())) continue; | |
13389 | phi4=aftsTrack->Phi(); | |
13390 | if(fUsePhiWeights && fPhiWeights) wPhi4 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi4*fnBinsPhi/TMath::TwoPi()))); | |
13391 | if(nPrim>=4) cout<<i1<<" "<<i2<<" "<<i3<<" "<<i4<<"\r"<<flush; // to be improved (replace eventually this if statement with if(nPrim==4)) | |
13392 | // 4-p correlations using particle weights: | |
13393 | if(fUsePhiWeights) fIntFlowDirectCorrelations->Fill(10.5,cos(n*phi1+n*phi2-n*phi3-n*phi4),wPhi1*wPhi2*wPhi3*wPhi4); | |
13394 | // extra correlations: | |
13395 | // 2-p extra correlations (do not appear if particle weights are not used): | |
13396 | // ... | |
13397 | // 3-p extra correlations (do not appear if particle weights are not used): | |
13398 | // ... | |
13399 | // 4-p extra correlations (do not appear if particle weights are not used): | |
13400 | // ... | |
13401 | } // end of for(Int_t i4=0;i4<nPrim;i4++) | |
13402 | } // end of for(Int_t i3=0;i3<nPrim;i3++) | |
13403 | } // end of for(Int_t i2=0;i2<nPrim;i2++) | |
13404 | } // end of for(Int_t i1=0;i1<nPrim;i1++) | |
13405 | } // end of if(nPrim>=4) | |
13406 | ||
13407 | */ | |
13408 | ||
13409 | cout<<endl; | |
13410 | ||
13411 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateIntFlowCorrectionsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent) | |
13412 | ||
57340a27 | 13413 | //================================================================================================================================ |
489d5531 | 13414 | |
489d5531 | 13415 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights(TString type, TString ptOrEta) |
13416 | { | |
13417 | // Calculate correction terms for non-uniform acceptance for differential flow (cos terms) using particle weights. | |
57340a27 | 13418 | |
489d5531 | 13419 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][1][cti], where cti runs as follows: |
57340a27 | 13420 | // |
489d5531 | 13421 | // 0: <<cos n(psi)>> |
13422 | // 1: <<w2 cos n(psi1+phi2)>> | |
13423 | // 2: <<w2 w3 cos n(psi1+phi2-phi3)>> | |
13424 | // 3: <<w2 w3 cos n(psi1-phi2-phi3)>> | |
13425 | // 4: | |
13426 | // 5: | |
13427 | // 6: | |
13428 | ||
13429 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
13430 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
13431 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
13432 | //Double_t dReQ1n3k = (*fReQ)(0,3); | |
13433 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
13434 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
13435 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
13436 | //Double_t dImQ1n3k = (*fImQ)(0,3); | |
13437 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
13438 | ||
1268c371 | 13439 | // S^M_{p,k} (see .h file for the definition of fSpk): |
13440 | Double_t dSM1p1k = (*fSpk)(0,1); | |
13441 | Double_t dSM1p2k = (*fSpk)(0,2); | |
13442 | Double_t dSM2p1k = (*fSpk)(1,1); | |
489d5531 | 13443 | |
2a98ceb8 | 13444 | Int_t t = 0; // type flag |
13445 | Int_t pe = 0; // ptEta flag | |
489d5531 | 13446 | |
13447 | if(type == "RP") | |
13448 | { | |
13449 | t = 0; | |
13450 | } else if(type == "POI") | |
13451 | { | |
13452 | t = 1; | |
13453 | } | |
13454 | ||
13455 | if(ptOrEta == "Pt") | |
13456 | { | |
13457 | pe = 0; | |
13458 | } else if(ptOrEta == "Eta") | |
13459 | { | |
13460 | pe = 1; | |
13461 | } | |
13462 | ||
13463 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
13464 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
13465 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
13466 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
13467 | ||
13468 | // looping over all bins and calculating correction terms: | |
13469 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
13470 | { | |
13471 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
13472 | Double_t p1n0kRe = 0.; | |
13473 | Double_t p1n0kIm = 0.; | |
13474 | ||
13475 | // number of POIs in particular pt or eta bin: | |
13476 | Double_t mp = 0.; | |
13477 | ||
13478 | // real and imaginary parts of q_{m*n,0} (weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
13479 | Double_t q1n2kRe = 0.; | |
ea239361 | 13480 | //Double_t q1n2kIm = 0.; |
489d5531 | 13481 | Double_t q2n1kRe = 0.; |
13482 | Double_t q2n1kIm = 0.; | |
46b94261 | 13483 | |
489d5531 | 13484 | // s_{1,1}, s_{1,2} // to be improved (add explanation) |
13485 | Double_t s1p1k = 0.; | |
13486 | Double_t s1p2k = 0.; | |
46b94261 | 13487 | |
489d5531 | 13488 | // number of particles which are both RPs and POIs in particular pt or eta bin: |
ea239361 | 13489 | //Double_t mq = 0.; |
489d5531 | 13490 | |
13491 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
13492 | Double_t dM01 = 0.; | |
13493 | Double_t dM011 = 0.; | |
13494 | ||
13495 | if(type == "POI") | |
13496 | { | |
13497 | // q_{m*n,k}: | |
13498 | q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)) | |
13499 | * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
ea239361 | 13500 | //q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)) |
13501 | // * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
489d5531 | 13502 | q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)) |
13503 | * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
13504 | q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
13505 | * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
ea239361 | 13506 | //mq = fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) |
46b94261 | 13507 | |
489d5531 | 13508 | s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); |
13509 | s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); | |
13510 | }else if(type == "RP") | |
13511 | { | |
13512 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
13513 | q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)) | |
13514 | * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
ea239361 | 13515 | //q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)) |
13516 | // * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
489d5531 | 13517 | q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)) |
13518 | * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
13519 | q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
13520 | * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
13521 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
13522 | s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); | |
13523 | s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); | |
3b552efe | 13524 | //s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); |
13525 | ||
ea239361 | 13526 | //mq = fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) |
489d5531 | 13527 | } |
3b552efe | 13528 | |
489d5531 | 13529 | if(type == "POI") |
3b552efe | 13530 | { |
13531 | // p_{m*n,k}: | |
489d5531 | 13532 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) |
13533 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
13534 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
3b552efe | 13535 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); |
13536 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
489d5531 | 13537 | // M01 from Eq. (118) in QC2c (to be improved (notation)): |
3b552efe | 13538 | dM01 = mp*dSM1p1k-s1p1k; |
13539 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
13540 | - 2.*(s1p1k*dSM1p1k-s1p2k); | |
13541 | ||
13542 | // typeFlag = RP (0) or POI (1): | |
13543 | t = 1; | |
13544 | } else if(type == "RP") | |
489d5531 | 13545 | { |
13546 | // to be improved (cross-checked): | |
13547 | p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
13548 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
13549 | p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
13550 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
13551 | mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
13552 | // M01 from Eq. (118) in QC2c (to be improved (notation)): | |
3b552efe | 13553 | dM01 = mp*dSM1p1k-s1p1k; |
13554 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
13555 | - 2.*(s1p1k*dSM1p1k-s1p2k); | |
489d5531 | 13556 | // typeFlag = RP (0) or POI (1): |
3b552efe | 13557 | t = 0; |
13558 | } | |
489d5531 | 13559 | |
13560 | // <<cos n(psi1)>>: | |
13561 | Double_t cosP1nPsi = 0.; | |
13562 | if(mp) | |
13563 | { | |
13564 | cosP1nPsi = p1n0kRe/mp; | |
13565 | ||
13566 | // fill profile for <<cos n(psi1)>>: | |
13567 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi,mp); | |
13568 | // histogram to store <cos n(psi1)> e-b-e (needed in some other methods): | |
13569 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][0]->SetBinContent(b,cosP1nPsi); | |
46b94261 | 13570 | } // end of if(mp) |
57340a27 | 13571 | |
489d5531 | 13572 | // <<w2 cos n(psi1+phi2)>>: |
13573 | Double_t cosP1nPsiP1nPhiW2 = 0.; | |
13574 | if(dM01) | |
13575 | { | |
13576 | cosP1nPsiP1nPhiW2 = (p1n0kRe*dReQ1n1k-p1n0kIm*dImQ1n1k-q2n1kRe)/(dM01); | |
13577 | // fill profile for <<w2 cos n(psi1+phi2)>>: | |
13578 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsiP1nPhiW2,dM01); | |
13579 | // histogram to store <w2 cos n(psi1+phi2)> e-b-e (needed in some other methods): | |
13580 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][1]->SetBinContent(b,cosP1nPsiP1nPhiW2); | |
13581 | } // end of if(dM01) | |
13582 | ||
13583 | // <<w2 w3 cos n(psi1+phi2-phi3)>>: | |
13584 | Double_t cosP1nPsi1P1nPhi2MPhi3W2W3 = 0.; | |
13585 | if(dM011) | |
13586 | { | |
46b94261 | 13587 | cosP1nPsi1P1nPhi2MPhi3W2W3 = (p1n0kRe*(pow(dImQ1n1k,2.)+pow(dReQ1n1k,2.)) |
13588 | - p1n0kRe*dSM1p2k | |
13589 | - q2n1kRe*dReQ1n1k-q2n1kIm*dImQ1n1k | |
13590 | - s1p1k*dReQ1n1k | |
13591 | + 2.*q1n2kRe) | |
13592 | / dM011; | |
489d5531 | 13593 | // fill profile for <<w1 w2 w3 cos n(psi1+phi2)>>: |
13594 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1P1nPhi2MPhi3W2W3,dM011); | |
13595 | // histogram to store <w1 w2 w3 cos n(psi1+phi2)> e-b-e (needed in some other methods): | |
13596 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][2]->SetBinContent(b,cosP1nPsi1P1nPhi2MPhi3W2W3); | |
13597 | } // end of if(dM011) | |
13598 | ||
13599 | // <<w2 w3 cos n(psi1-phi2-phi3)>>: | |
13600 | Double_t cosP1nPsi1M1nPhi2MPhi3W2W3 = 0.; | |
13601 | if(dM011) | |
13602 | { | |
13603 | cosP1nPsi1M1nPhi2MPhi3W2W3 = (p1n0kRe*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))+2.*p1n0kIm*dReQ1n1k*dImQ1n1k | |
13604 | - 1.*(p1n0kRe*dReQ2n2k+p1n0kIm*dImQ2n2k) | |
46b94261 | 13605 | - 2.*s1p1k*dReQ1n1k |
489d5531 | 13606 | + 2.*q1n2kRe) |
13607 | / dM011; | |
13608 | // fill profile for <<w1 w2 w3 cos n(psi1+phi2)>>: | |
13609 | fDiffFlowCorrectionTermsForNUAPro[t][pe][1][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],cosP1nPsi1M1nPhi2MPhi3W2W3,dM011); | |
13610 | // histogram to store <w1 w2 w3 cos n(psi1+phi2)> e-b-e (needed in some other methods): | |
13611 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][1][3]->SetBinContent(b,cosP1nPsi1M1nPhi2MPhi3W2W3); | |
13612 | } // end of if(dM011) | |
13613 | ||
13614 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
46b94261 | 13615 | |
57340a27 | 13616 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUACosTermsUsingParticleWeights(TString type, TString ptOrEta) |
13617 | ||
489d5531 | 13618 | |
13619 | //================================================================================================================================ | |
13620 | ||
13621 | ||
13622 | void AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights(TString type, TString ptOrEta) | |
13623 | { | |
13624 | // Calculate correction terms for non-uniform acceptance for differential flow (sin terms). | |
13625 | ||
13626 | // Results are stored in fDiffFlowCorrectionTermsForNUAPro[t][pe][0][cti], where cti runs as follows: | |
13627 | // 0: <<sin n(psi1)>> | |
13628 | // 1: <<w2 sin n(psi1+phi2)>> | |
13629 | // 2: <<w2 w3 sin n(psi1+phi2-phi3)>> | |
13630 | // 3: <<w2 w3 sin n(psi1-phi2-phi3)>>: | |
13631 | // 4: | |
13632 | // 5: | |
13633 | // 6: | |
13634 | ||
13635 | // real and imaginary parts of weighted Q-vectors evaluated in harmonics n, 2n, 3n and 4n: | |
13636 | Double_t dReQ1n1k = (*fReQ)(0,1); | |
13637 | Double_t dReQ2n2k = (*fReQ)(1,2); | |
13638 | //Double_t dReQ1n3k = (*fReQ)(0,3); | |
13639 | //Double_t dReQ4n4k = (*fReQ)(3,4); | |
13640 | Double_t dImQ1n1k = (*fImQ)(0,1); | |
13641 | Double_t dImQ2n2k = (*fImQ)(1,2); | |
13642 | //Double_t dImQ1n3k = (*fImQ)(0,3); | |
13643 | //Double_t dImQ4n4k = (*fImQ)(3,4); | |
13644 | ||
1268c371 | 13645 | // S^M_{p,k} (see .h file for the definition of fSpk): |
13646 | Double_t dSM1p1k = (*fSpk)(0,1); | |
13647 | Double_t dSM1p2k = (*fSpk)(0,2); | |
13648 | Double_t dSM2p1k = (*fSpk)(1,1); | |
489d5531 | 13649 | |
2a98ceb8 | 13650 | Int_t t = 0; // type flag |
13651 | Int_t pe = 0; // ptEta flag | |
489d5531 | 13652 | |
13653 | if(type == "RP") | |
13654 | { | |
13655 | t = 0; | |
13656 | } else if(type == "POI") | |
13657 | { | |
13658 | t = 1; | |
13659 | } | |
13660 | ||
13661 | if(ptOrEta == "Pt") | |
13662 | { | |
13663 | pe = 0; | |
13664 | } else if(ptOrEta == "Eta") | |
13665 | { | |
13666 | pe = 1; | |
13667 | } | |
13668 | ||
13669 | Int_t nBinsPtEta[2] = {fnBinsPt,fnBinsEta}; | |
13670 | Double_t minPtEta[2] = {fPtMin,fEtaMin}; | |
13671 | //Double_t maxPtEta[2] = {fPtMax,fEtaMax}; | |
13672 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
13673 | ||
13674 | // looping over all bins and calculating correction terms: | |
13675 | for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
13676 | { | |
13677 | // real and imaginary parts of p_{m*n,0} (non-weighted Q-vector evaluated for POIs in particular pt or eta bin): | |
13678 | Double_t p1n0kRe = 0.; | |
13679 | Double_t p1n0kIm = 0.; | |
13680 | ||
13681 | // number of POIs in particular pt or eta bin: | |
13682 | Double_t mp = 0.; | |
13683 | ||
13684 | // real and imaginary parts of q_{m*n,0} (weighted Q-vector evaluated for particles which are both RPs and POIs in particular pt or eta bin): | |
ea239361 | 13685 | //Double_t q1n2kRe = 0.; |
489d5531 | 13686 | Double_t q1n2kIm = 0.; |
13687 | Double_t q2n1kRe = 0.; | |
13688 | Double_t q2n1kIm = 0.; | |
46b94261 | 13689 | |
489d5531 | 13690 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) |
13691 | Double_t s1p1k = 0.; | |
13692 | Double_t s1p2k = 0.; | |
46b94261 | 13693 | |
489d5531 | 13694 | // number of particles which are both RPs and POIs in particular pt or eta bin: |
ea239361 | 13695 | //Double_t mq = 0.; |
489d5531 | 13696 | |
13697 | // M0111 from Eq. (118) in QC2c (to be improved (notation)) | |
13698 | Double_t dM01 = 0.; | |
13699 | Double_t dM011 = 0.; | |
13700 | ||
13701 | if(type == "POI") | |
13702 | { | |
13703 | // q_{m*n,k}: | |
ea239361 | 13704 | //q1n2kRe = fReRPQ1dEBE[2][pe][0][2]->GetBinContent(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)) |
13705 | // * fReRPQ1dEBE[2][pe][0][2]->GetBinEntries(fReRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
489d5531 | 13706 | q1n2kIm = fImRPQ1dEBE[2][pe][0][2]->GetBinContent(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)) |
13707 | * fImRPQ1dEBE[2][pe][0][2]->GetBinEntries(fImRPQ1dEBE[2][pe][0][2]->GetBin(b)); | |
13708 | q2n1kRe = fReRPQ1dEBE[2][pe][1][1]->GetBinContent(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
13709 | * fReRPQ1dEBE[2][pe][1][1]->GetBinEntries(fReRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
13710 | q2n1kIm = fImRPQ1dEBE[2][pe][1][1]->GetBinContent(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)) | |
13711 | * fImRPQ1dEBE[2][pe][1][1]->GetBinEntries(fImRPQ1dEBE[2][pe][1][1]->GetBin(b)); | |
ea239361 | 13712 | //mq = fReRPQ1dEBE[2][pe][0][0]->GetBinEntries(fReRPQ1dEBE[2][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) |
46b94261 | 13713 | |
489d5531 | 13714 | s1p1k = pow(fs1dEBE[2][pe][1]->GetBinContent(b)*fs1dEBE[2][pe][1]->GetBinEntries(b),1.); |
13715 | s1p2k = pow(fs1dEBE[2][pe][2]->GetBinContent(b)*fs1dEBE[2][pe][2]->GetBinEntries(b),1.); | |
13716 | }else if(type == "RP") | |
13717 | { | |
13718 | // q_{m*n,k}: (Remark: m=1 is 0, k=0 iz zero (to be improved!)) | |
ea239361 | 13719 | //q1n2kRe = fReRPQ1dEBE[0][pe][0][2]->GetBinContent(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)) |
13720 | // * fReRPQ1dEBE[0][pe][0][2]->GetBinEntries(fReRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
489d5531 | 13721 | q1n2kIm = fImRPQ1dEBE[0][pe][0][2]->GetBinContent(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)) |
13722 | * fImRPQ1dEBE[0][pe][0][2]->GetBinEntries(fImRPQ1dEBE[0][pe][0][2]->GetBin(b)); | |
13723 | q2n1kRe = fReRPQ1dEBE[0][pe][1][1]->GetBinContent(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
13724 | * fReRPQ1dEBE[0][pe][1][1]->GetBinEntries(fReRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
13725 | q2n1kIm = fImRPQ1dEBE[0][pe][1][1]->GetBinContent(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)) | |
13726 | * fImRPQ1dEBE[0][pe][1][1]->GetBinEntries(fImRPQ1dEBE[0][pe][1][1]->GetBin(b)); | |
13727 | // s_{1,1}, s_{1,2} and s_{1,3} // to be improved (add explanation) | |
13728 | s1p1k = pow(fs1dEBE[0][pe][1]->GetBinContent(b)*fs1dEBE[0][pe][1]->GetBinEntries(b),1.); | |
13729 | s1p2k = pow(fs1dEBE[0][pe][2]->GetBinContent(b)*fs1dEBE[0][pe][2]->GetBinEntries(b),1.); | |
13730 | //s1p3k = pow(fs1dEBE[0][pe][3]->GetBinContent(b)*fs1dEBE[0][pe][3]->GetBinEntries(b),1.); | |
3b552efe | 13731 | } |
13732 | ||
13733 | if(type == "POI") | |
13734 | { | |
13735 | // p_{m*n,k}: | |
489d5531 | 13736 | p1n0kRe = fReRPQ1dEBE[1][pe][0][0]->GetBinContent(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)) |
13737 | * fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); | |
13738 | p1n0kIm = fImRPQ1dEBE[1][pe][0][0]->GetBinContent(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)) | |
3b552efe | 13739 | * fImRPQ1dEBE[1][pe][0][0]->GetBinEntries(fImRPQ1dEBE[1][pe][0][0]->GetBin(b)); |
13740 | mp = fReRPQ1dEBE[1][pe][0][0]->GetBinEntries(fReRPQ1dEBE[1][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
489d5531 | 13741 | // M01 from Eq. (118) in QC2c (to be improved (notation)): |
3b552efe | 13742 | dM01 = mp*dSM1p1k-s1p1k; |
13743 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
13744 | - 2.*(s1p1k*dSM1p1k-s1p2k); | |
13745 | // typeFlag = RP (0) or POI (1): | |
13746 | t = 1; | |
489d5531 | 13747 | } else if(type == "RP") |
3b552efe | 13748 | { |
489d5531 | 13749 | // to be improved (cross-checked): |
13750 | p1n0kRe = fReRPQ1dEBE[0][pe][0][0]->GetBinContent(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
13751 | * fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
13752 | p1n0kIm = fImRPQ1dEBE[0][pe][0][0]->GetBinContent(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)) | |
13753 | * fImRPQ1dEBE[0][pe][0][0]->GetBinEntries(fImRPQ1dEBE[0][pe][0][0]->GetBin(b)); | |
13754 | mp = fReRPQ1dEBE[0][pe][0][0]->GetBinEntries(fReRPQ1dEBE[0][pe][0][0]->GetBin(b)); // to be improved (cross-checked by accessing other profiles here) | |
13755 | // M01 from Eq. (118) in QC2c (to be improved (notation)): | |
3b552efe | 13756 | dM01 = mp*dSM1p1k-s1p1k; |
13757 | dM011 = mp*(dSM2p1k-dSM1p2k) | |
489d5531 | 13758 | - 2.*(s1p1k*dSM1p1k-s1p2k); |
13759 | // typeFlag = RP (0) or POI (1): | |
3b552efe | 13760 | t = 0; |
13761 | } | |
13762 | ||
489d5531 | 13763 | // <<sin n(psi1)>>: |
13764 | Double_t sinP1nPsi = 0.; | |
13765 | if(mp) | |
13766 | { | |
13767 | sinP1nPsi = p1n0kIm/mp; | |
13768 | ||
13769 | // fill profile for <<sin n(psi1)>>: | |
13770 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][0]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi,mp); | |
13771 | // histogram to store <sin n(psi1)> e-b-e (needed in some other methods): | |
13772 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][0]->SetBinContent(b,sinP1nPsi); | |
46b94261 | 13773 | } // end of if(mp) |
13774 | ||
489d5531 | 13775 | // <<w2 sin n(psi1+phi2)>>: |
13776 | Double_t sinP1nPsiP1nPhiW2 = 0.; | |
13777 | if(dM01) | |
13778 | { | |
13779 | sinP1nPsiP1nPhiW2 = (p1n0kRe*dImQ1n1k+p1n0kIm*dReQ1n1k-q2n1kIm)/(dM01); | |
13780 | // fill profile for <<w2 sin n(psi1+phi2)>>: | |
13781 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][1]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsiP1nPhiW2,dM01); | |
13782 | // histogram to store <w2 sin n(psi1+phi2)> e-b-e (needed in some other methods): | |
13783 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][1]->SetBinContent(b,sinP1nPsiP1nPhiW2); | |
13784 | } // end of if(mp*dMult-mq) | |
13785 | ||
13786 | // <<w2 w3 sin n(psi1+phi2-phi3)>>: | |
13787 | Double_t sinP1nPsi1P1nPhi2MPhi3W2W3 = 0.; | |
13788 | if(dM011) | |
13789 | { | |
46b94261 | 13790 | sinP1nPsi1P1nPhi2MPhi3W2W3 = (p1n0kIm*(pow(dImQ1n1k,2.)+pow(dReQ1n1k,2.)) |
13791 | - p1n0kIm*dSM1p2k | |
13792 | + q2n1kRe*dImQ1n1k-q2n1kIm*dReQ1n1k | |
13793 | - s1p1k*dImQ1n1k | |
13794 | + 2.*q1n2kIm) | |
13795 | / dM011; | |
489d5531 | 13796 | // fill profile for <<w2 w3 sin n(psi1+phi2-phi3)>>: |
13797 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][2]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1P1nPhi2MPhi3W2W3,dM011); | |
13798 | // histogram to store <w2 w3 sin n(psi1+phi2-phi3)> e-b-e (needed in some other methods): | |
13799 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][2]->SetBinContent(b,sinP1nPsi1P1nPhi2MPhi3W2W3); | |
13800 | } // end of if(dM011) | |
13801 | ||
13802 | // <<w2 w3 sin n(psi1-phi2-phi3)>>: | |
13803 | Double_t sinP1nPsi1M1nPhi2MPhi3W2W3 = 0.; | |
13804 | if(dM011) | |
13805 | { | |
13806 | sinP1nPsi1M1nPhi2MPhi3W2W3 = (p1n0kIm*(pow(dReQ1n1k,2.)-pow(dImQ1n1k,2.))-2.*p1n0kRe*dReQ1n1k*dImQ1n1k | |
13807 | + 1.*(p1n0kRe*dImQ2n2k-p1n0kIm*dReQ2n2k) | |
46b94261 | 13808 | + 2.*s1p1k*dImQ1n1k |
489d5531 | 13809 | - 2.*q1n2kIm) |
13810 | / dM011; | |
13811 | // fill profile for <<w2 w3 sin n(psi1-phi2-phi3)>>: | |
13812 | fDiffFlowCorrectionTermsForNUAPro[t][pe][0][3]->Fill(minPtEta[pe]+(b-1)*binWidthPtEta[pe],sinP1nPsi1M1nPhi2MPhi3W2W3,dM011); | |
13813 | // histogram to store <w2 w3 sin n(psi1-phi2-phi3)> e-b-e (needed in some other methods): | |
13814 | fDiffFlowCorrectionTermsForNUAEBE[t][pe][0][3]->SetBinContent(b,sinP1nPsi1M1nPhi2MPhi3W2W3); | |
13815 | } // end of if(dM011) | |
13816 | ||
13817 | } // end of for(Int_t b=1;b<=nBinsPtEta[pe];b++) | |
13818 | ||
13819 | } // end of AliFlowAnalysisWithQCumulants::CalculateDiffFlowCorrectionsForNUASinTermsUsingParticleWeights(TString type, TString ptOrEta) | |
13820 | ||
489d5531 | 13821 | //================================================================================================================================ |
489d5531 | 13822 | |
0328db2d | 13823 | void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple * const anEvent, TString type, TString ptOrEta) |
489d5531 | 13824 | { |
57340a27 | 13825 | // Evaluate with nested loops correction terms for non-uniform acceptance |
489d5531 | 13826 | // with using particle weights (both sin and cos terms) relevant for differential flow. |
13827 | ||
57340a27 | 13828 | // Remark 1: "w1" in expressions bellow is a particle weight used only for particles which were |
13829 | // flagged both as POI and RP. | |
489d5531 | 13830 | // Remark 2: Reduced correction terms for non-uniform acceptance are evaluated in pt bin number fCrossCheckInPtBinNo |
13831 | // and eta bin number fCrossCheckInEtaBinNo both for RPs and POIs. | |
13832 | // Remark 3: Results are stored in 1 bin profiles fDiffFlowDirectCorrections[t][pe][sc][cti], where first three indices runs as: | |
13833 | // [0=RP,1=POI][0=Pt,1=Eta][0=sin terms,1=cos terms], whilst the cti (correction term index) runs as follows: | |
13834 | // cti: | |
13835 | // 0: <<sc n(psi1)>> | |
13836 | // 1: <<w2 sc n(psi1+phi2)>> | |
13837 | // 2: <<w2 w3 sc n(psi1+phi2-phi3)>> | |
13838 | // 3: <<w2 w3 sc n(psi1-phi2-phi3)>> | |
13839 | // 4: | |
13840 | // 5: | |
13841 | // 6: | |
46b94261 | 13842 | |
2a98ceb8 | 13843 | Int_t typeFlag = 0; |
13844 | Int_t ptEtaFlag = 0; | |
489d5531 | 13845 | if(type == "RP") |
13846 | { | |
13847 | typeFlag = 0; | |
13848 | } else if(type == "POI") | |
13849 | { | |
13850 | typeFlag = 1; | |
13851 | } | |
13852 | if(ptOrEta == "Pt") | |
13853 | { | |
13854 | ptEtaFlag = 0; | |
13855 | } else if(ptOrEta == "Eta") | |
13856 | { | |
13857 | ptEtaFlag = 1; | |
13858 | } | |
13859 | // shortcuts: | |
13860 | Int_t t = typeFlag; | |
13861 | Int_t pe = ptEtaFlag; | |
13862 | ||
13863 | Double_t lowerPtEtaEdge[2] = {fPtMin+(fCrossCheckInPtBinNo-1)*fPtBinWidth,fEtaMin+(fCrossCheckInEtaBinNo-1)*fEtaBinWidth}; | |
13864 | Double_t upperPtEtaEdge[2] = {fPtMin+fCrossCheckInPtBinNo*fPtBinWidth,fEtaMin+fCrossCheckInEtaBinNo*fEtaBinWidth}; | |
13865 | Double_t binWidthPtEta[2] = {fPtBinWidth,fEtaBinWidth}; | |
13866 | ||
13867 | Int_t nPrim = anEvent->NumberOfTracks(); | |
13868 | AliFlowTrackSimple *aftsTrack = NULL; | |
13869 | ||
13870 | Double_t psi1=0., phi2=0., phi3=0.;// phi4=0.;// phi5=0., phi6=0., phi7=0., phi8=0.; | |
13871 | Double_t wPhi2=1., wPhi3=1.; | |
13872 | ||
13873 | Int_t n = fHarmonic; | |
13874 | ||
13875 | // 1'-particle correction terms: | |
13876 | for(Int_t i1=0;i1<nPrim;i1++) | |
13877 | { | |
13878 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 13879 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
13880 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 13881 | { |
13882 | if(ptOrEta == "Pt") | |
13883 | { | |
13884 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
13885 | } else if (ptOrEta == "Eta") | |
13886 | { | |
13887 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 13888 | } |
13889 | } else // this is diff flow of RPs | |
13890 | { | |
489d5531 | 13891 | if(ptOrEta == "Pt") |
13892 | { | |
13893 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
13894 | } else if (ptOrEta == "Eta") | |
13895 | { | |
13896 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 13897 | } |
489d5531 | 13898 | } |
13899 | psi1=aftsTrack->Phi(); | |
13900 | // sin terms: | |
13901 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*psi1),1.); // <<sin(n*(psi1))>> | |
13902 | // cos terms: | |
13903 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][0]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*psi1),1.); // <<cos(n*(psi1))>> | |
13904 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
13905 | ||
13906 | // 2'-particle correction terms: | |
13907 | for(Int_t i1=0;i1<nPrim;i1++) | |
13908 | { | |
13909 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 13910 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
13911 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 13912 | { |
13913 | if(ptOrEta == "Pt") | |
13914 | { | |
13915 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
13916 | } else if (ptOrEta == "Eta") | |
13917 | { | |
13918 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 13919 | } |
13920 | } else // this is diff flow of RPs | |
13921 | { | |
489d5531 | 13922 | if(ptOrEta == "Pt") |
13923 | { | |
13924 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
13925 | } else if (ptOrEta == "Eta") | |
13926 | { | |
13927 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 13928 | } |
489d5531 | 13929 | } |
13930 | psi1=aftsTrack->Phi(); | |
13931 | for(Int_t i2=0;i2<nPrim;i2++) | |
13932 | { | |
13933 | if(i2==i1) continue; | |
13934 | aftsTrack=anEvent->GetTrack(i2); | |
13935 | // RP condition (!(first) particle in the correlator must be RP): | |
13936 | if(!(aftsTrack->InRPSelection())) continue; | |
46b94261 | 13937 | phi2=aftsTrack->Phi(); |
489d5531 | 13938 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); |
13939 | // sin terms: | |
13940 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2)),wPhi2); // <<w2 sin(n*(psi1+phi2))>> | |
13941 | // cos terms: | |
13942 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][1]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2)),wPhi2); // <<w2 cos(n*(psi1+phi2))>> | |
13943 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
13944 | }//end of for(Int_t i1=0;i1<nPrim;i1++) | |
13945 | ||
13946 | // 3'-particle correction terms: | |
13947 | for(Int_t i1=0;i1<nPrim;i1++) | |
13948 | { | |
13949 | aftsTrack=anEvent->GetTrack(i1); | |
3b552efe | 13950 | // POI condition (first particle in the correlator must be POI): // to be improved (this can be implemented much better) |
13951 | if(typeFlag==1) // this is diff flow of POIs | |
489d5531 | 13952 | { |
13953 | if(ptOrEta == "Pt") | |
13954 | { | |
13955 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
13956 | } else if (ptOrEta == "Eta") | |
13957 | { | |
13958 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InPOISelection())))continue; | |
3b552efe | 13959 | } |
13960 | } else // this is diff flow of RPs | |
13961 | { | |
489d5531 | 13962 | if(ptOrEta == "Pt") |
13963 | { | |
13964 | if(!((aftsTrack->Pt()>=lowerPtEtaEdge[pe] && aftsTrack->Pt()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
13965 | } else if (ptOrEta == "Eta") | |
13966 | { | |
13967 | if(!((aftsTrack->Eta()>=lowerPtEtaEdge[pe] && aftsTrack->Eta()<upperPtEtaEdge[pe]) && (aftsTrack->InRPSelection())))continue; | |
3b552efe | 13968 | } |
489d5531 | 13969 | } |
13970 | psi1=aftsTrack->Phi(); | |
13971 | for(Int_t i2=0;i2<nPrim;i2++) | |
13972 | { | |
13973 | if(i2==i1) continue; | |
13974 | aftsTrack=anEvent->GetTrack(i2); | |
13975 | // RP condition (!(first) particle in the correlator must be RP): | |
13976 | if(!(aftsTrack->InRPSelection())) continue; | |
13977 | phi2=aftsTrack->Phi(); | |
13978 | if(fUsePhiWeights && fPhiWeights) wPhi2 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi2*fnBinsPhi/TMath::TwoPi()))); | |
13979 | for(Int_t i3=0;i3<nPrim;i3++) | |
13980 | { | |
13981 | if(i3==i1||i3==i2) continue; | |
13982 | aftsTrack=anEvent->GetTrack(i3); | |
13983 | // RP condition (!(first) particle in the correlator must be RP): | |
13984 | if(!(aftsTrack->InRPSelection())) continue; | |
13985 | phi3=aftsTrack->Phi(); | |
13986 | if(fUsePhiWeights && fPhiWeights) wPhi3 = fPhiWeights->GetBinContent(1+(Int_t)(TMath::Floor(phi3*fnBinsPhi/TMath::TwoPi()))); | |
13987 | // sin terms: | |
13988 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1+phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 sin(n*(psi1+phi2-phi3))>> | |
13989 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][0][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,sin(n*(psi1-phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 sin(n*(psi1-phi2-phi3))>> | |
13990 | // cos terms: | |
13991 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][2]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1+phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 cos(n*(psi1+phi2-phi3))>> | |
13992 | fDiffFlowDirectCorrectionTermsForNUA[t][pe][1][3]->Fill(lowerPtEtaEdge[pe]+binWidthPtEta[pe]/2.,cos(n*(psi1-phi2-phi3)),wPhi2*wPhi3); // <<wPhi2*wPhi3 cos(n*(psi1-phi2-phi3))>> | |
13993 | }//end of for(Int_t i3=0;i3<nPrim;i3++) | |
13994 | }//end of for(Int_t i2=0;i2<nPrim;i2++) | |
46b94261 | 13995 | }//end of for(Int_t i1=0;i1<nPrim;i1++) |
489d5531 | 13996 | |
13997 | } // end of void AliFlowAnalysisWithQCumulants::EvaluateDiffFlowCorrectionTermsForNUAWithNestedLoopsUsingParticleWeights(AliFlowEventSimple* anEvent, TString type, TString ptOrEta) | |
13998 | ||
2001bc3a | 13999 | //================================================================================================================================ |
14000 | ||
b3dacf6b | 14001 | void AliFlowAnalysisWithQCumulants::CheckPointersUsedInFinish() |
14002 | { | |
14003 | // Check all pointers used in method Finish(). | |
14004 | ||
b77b6434 | 14005 | if(!fAvMultiplicity) |
14006 | { | |
14007 | cout<<endl; | |
14008 | cout<<" WARNING (QC): fAvMultiplicity is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14009 | cout<<endl; | |
14010 | exit(0); | |
14011 | } | |
b3dacf6b | 14012 | if(!fIntFlowCorrelationsPro) |
14013 | { | |
14014 | cout<<endl; | |
14015 | cout<<" WARNING (QC): fIntFlowCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14016 | cout<<endl; | |
14017 | exit(0); | |
14018 | } | |
b40a910e | 14019 | if(!fIntFlowSquaredCorrelationsPro) |
14020 | { | |
14021 | cout<<endl; | |
14022 | cout<<" WARNING (QC): fIntFlowSquaredCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14023 | cout<<endl; | |
14024 | exit(0); | |
14025 | } | |
b3dacf6b | 14026 | if(!fIntFlowCorrelationsHist) |
14027 | { | |
14028 | cout<<endl; | |
14029 | cout<<" WARNING (QC): fIntFlowCorrelationsHist is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14030 | cout<<endl; | |
14031 | exit(0); | |
14032 | } | |
403e3389 | 14033 | if((fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) && !fIntFlowExtraCorrelationsPro) |
b77b6434 | 14034 | { |
14035 | cout<<endl; | |
14036 | cout<<" WARNING (QC): fIntFlowExtraCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14037 | cout<<endl; | |
14038 | exit(0); | |
14039 | } | |
b3dacf6b | 14040 | for(Int_t power=0;power<2;power++) |
14041 | { | |
14042 | if(!fIntFlowSumOfEventWeights[power]) | |
14043 | { | |
14044 | cout<<endl; | |
14045 | cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeights[%d] is NULL in CheckPointersUsedInFinish() !!!!",power)<<endl; | |
14046 | cout<<endl; | |
14047 | exit(0); | |
14048 | } | |
14049 | } // end of for(Int_t power=0;power<2;power++) | |
14050 | if(!fIntFlowProductOfCorrelationsPro) | |
14051 | { | |
14052 | cout<<endl; | |
14053 | cout<<" WARNING (QC): fIntFlowProductOfCorrelationsPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14054 | cout<<endl; | |
14055 | exit(0); | |
14056 | } | |
14057 | if(!fIntFlowSumOfProductOfEventWeights) | |
14058 | { | |
14059 | cout<<endl; | |
14060 | cout<<" WARNING (QC): fIntFlowSumOfProductOfEventWeights is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14061 | cout<<endl; | |
14062 | exit(0); | |
14063 | } | |
14064 | if(!fIntFlowCovariances) | |
14065 | { | |
14066 | cout<<endl; | |
14067 | cout<<" WARNING (QC): fIntFlowCovariances is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14068 | cout<<endl; | |
14069 | exit(0); | |
14070 | } | |
14071 | if(!fIntFlowQcumulants) | |
14072 | { | |
14073 | cout<<endl; | |
14074 | cout<<" WARNING (QC): fIntFlowQcumulants is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14075 | cout<<endl; | |
14076 | exit(0); | |
14077 | } | |
0dd3b008 | 14078 | if(!fIntFlow) |
14079 | { | |
14080 | cout<<endl; | |
14081 | cout<<" WARNING (QC): fIntFlow is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14082 | cout<<endl; | |
14083 | exit(0); | |
14084 | } | |
14085 | if(!fCommonHists) | |
14086 | { | |
14087 | cout<<endl; | |
14088 | cout<<" WARNING (QC): fCommonHists is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14089 | cout<<endl; | |
14090 | exit(0); | |
14091 | } | |
14092 | if(!(fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th && fCommonHistsResults8th)) | |
14093 | { | |
14094 | cout<<endl; | |
14095 | cout<<" WARNING (QC): fCommonHistsResults2nd && fCommonHistsResults4th && fCommonHistsResults6th"<<endl; | |
14096 | cout<<" && fCommonHistsResults8th is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14097 | cout<<endl; | |
14098 | exit(0); | |
14099 | } | |
b3dacf6b | 14100 | |
b92ea2b9 | 14101 | // NUA stuff: |
14102 | for(Int_t sc=0;sc<2;sc++) // sin/cos | |
14103 | { | |
14104 | if(!fIntFlowCorrectionTermsForNUAPro[sc]) | |
14105 | { | |
14106 | cout<<endl; | |
14107 | cout<<Form(" WARNING (QC): fIntFlowCorrectionTermsForNUAPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",sc)<<endl; | |
14108 | cout<<endl; | |
14109 | exit(0); | |
14110 | } | |
14111 | if(!fIntFlowCorrectionTermsForNUAHist[sc]) | |
14112 | { | |
14113 | cout<<endl; | |
14114 | cout<<Form(" WARNING (QC): fIntFlowCorrectionTermsForNUAHist[%d] is NULL in CheckPointersUsedInFinish() !!!!",sc)<<endl; | |
14115 | cout<<endl; | |
14116 | exit(0); | |
14117 | } | |
14118 | for(Int_t lq=0;lq<2;lq++) // linear/quadratic | |
14119 | { | |
14120 | if(!fIntFlowSumOfEventWeightsNUA[sc][lq]) | |
14121 | { | |
14122 | cout<<endl; | |
14123 | cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeightsNUA[%d][%d] is NULL in CheckPointersUsedInFinish() !!!!",sc,lq)<<endl; | |
14124 | cout<<endl; | |
14125 | exit(0); | |
14126 | } | |
14127 | } // end of for(Int_t lq=0;lq<2;lq++) // linear/quadratic | |
14128 | } // end of for(Int_t power=0;power<2;power++) | |
14129 | if(!fIntFlowProductOfCorrectionTermsForNUAPro) | |
14130 | { | |
14131 | cout<<endl; | |
14132 | cout<<" WARNING (QC): fIntFlowProductOfCorrectionTermsForNUAPro is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14133 | cout<<endl; | |
14134 | exit(0); | |
14135 | } | |
14136 | if(!fIntFlowSumOfProductOfEventWeightsNUA) | |
14137 | { | |
14138 | cout<<endl; | |
14139 | cout<<" WARNING (QC): fIntFlowSumOfProductOfEventWeightsNUA is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14140 | cout<<endl; | |
14141 | exit(0); | |
14142 | } | |
14143 | if(!fIntFlowCovariancesNUA) | |
14144 | { | |
14145 | cout<<endl; | |
14146 | cout<<" WARNING (QC): fIntFlowCovariancesNUA is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14147 | cout<<endl; | |
14148 | exit(0); | |
14149 | } | |
14150 | if(!fIntFlowQcumulantsErrorSquaredRatio) | |
14151 | { | |
14152 | cout<<endl; | |
14153 | cout<<" WARNING (QC): fIntFlowQcumulantsErrorSquaredRatio is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14154 | cout<<endl; | |
14155 | exit(0); | |
14156 | } | |
14157 | if(!fIntFlowDetectorBias) | |
14158 | { | |
14159 | cout<<endl; | |
14160 | cout<<" WARNING (QC): fIntFlowDetectorBias is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14161 | cout<<endl; | |
14162 | exit(0); | |
14163 | } | |
14164 | ||
b3dacf6b | 14165 | // Versus multiplicity: |
14166 | if(!fCalculateCumulantsVsM){return;} | |
b77b6434 | 14167 | for(Int_t co=0;co<=3;co++) // cumulant order |
b3dacf6b | 14168 | { |
b77b6434 | 14169 | if(!fIntFlowQcumulantsVsM[co]) |
b3dacf6b | 14170 | { |
14171 | cout<<endl; | |
b77b6434 | 14172 | cout<<Form(" WARNING (QC): fIntFlowQcumulantsVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",co)<<endl; |
b3dacf6b | 14173 | cout<<endl; |
14174 | exit(0); | |
14175 | } | |
b77b6434 | 14176 | if(!fIntFlowVsM[co]) |
b3dacf6b | 14177 | { |
14178 | cout<<endl; | |
b77b6434 | 14179 | cout<<Form(" WARNING (QC): fIntFlowVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",co)<<endl; |
14180 | cout<<endl; | |
14181 | exit(0); | |
14182 | } | |
14183 | if(!fIntFlowDetectorBiasVsM[co]) | |
14184 | { | |
14185 | cout<<endl; | |
14186 | cout<<Form(" WARNING (QC): fIntFlowDetectorBiasVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",co)<<endl; | |
14187 | cout<<endl; | |
14188 | exit(0); | |
14189 | } | |
14190 | } // end of for(Int_t c0=0;c0<=3;c0++) // cumulant order | |
14191 | for(Int_t ci=0;ci<=3;ci++) // correlation index | |
14192 | { | |
14193 | if(!fIntFlowCorrelationsVsMPro[ci]) | |
14194 | { | |
14195 | cout<<endl; | |
14196 | cout<<Form(" WARNING (QC): fIntFlowCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl; | |
b3dacf6b | 14197 | cout<<endl; |
14198 | exit(0); | |
14199 | } | |
b40a910e | 14200 | if(!fIntFlowSquaredCorrelationsVsMPro[ci]) |
14201 | { | |
14202 | cout<<endl; | |
14203 | cout<<Form(" WARNING (QC): fIntFlowSquaredCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl; | |
14204 | cout<<endl; | |
14205 | exit(0); | |
14206 | } | |
b77b6434 | 14207 | if(!fIntFlowCorrelationsVsMHist[ci]) |
b92ea2b9 | 14208 | { |
14209 | cout<<endl; | |
b77b6434 | 14210 | cout<<Form(" WARNING (QC): fIntFlowCorrelationsVsMHist[%d] is NULL in CheckPointersUsedInFinish() !!!!",ci)<<endl; |
b92ea2b9 | 14211 | cout<<endl; |
14212 | exit(0); | |
14213 | } | |
b3dacf6b | 14214 | for(Int_t power=0;power<2;power++) |
14215 | { | |
14216 | if(!fIntFlowSumOfEventWeightsVsM[ci][power]) | |
14217 | { | |
14218 | cout<<endl; | |
14219 | cout<<Form(" WARNING (QC): fIntFlowSumOfEventWeightsVsM[%d][%d] is NULL in CheckPointersUsedInFinish() !!!!",ci,power)<<endl; | |
14220 | cout<<endl; | |
14221 | exit(0); | |
14222 | } | |
14223 | } // end of for(Int_t power=0;power<2;power++) | |
14224 | } // end of for(Int_t ci=0;ci<=3;ci++) // correlation index | |
14225 | for(Int_t i=0;i<6;i++) | |
14226 | { | |
14227 | if(!fIntFlowProductOfCorrelationsVsMPro[i]) | |
14228 | { | |
14229 | cout<<endl; | |
14230 | cout<<Form(" WARNING (QC): fIntFlowProductOfCorrelationsVsMPro[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl; | |
14231 | cout<<endl; | |
14232 | exit(0); | |
14233 | } | |
14234 | if(!fIntFlowSumOfProductOfEventWeightsVsM[i]) | |
14235 | { | |
14236 | cout<<endl; | |
14237 | cout<<Form(" WARNING (QC): fIntFlowSumOfProductOfEventWeightsVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl; | |
14238 | cout<<endl; | |
14239 | exit(0); | |
14240 | } | |
14241 | if(!fIntFlowCovariancesVsM[i]) | |
14242 | { | |
14243 | cout<<endl; | |
14244 | cout<<Form(" WARNING (QC): fIntFlowCovariancesVsM[%d] is NULL in CheckPointersUsedInFinish() !!!!",i)<<endl; | |
14245 | cout<<endl; | |
14246 | exit(0); | |
14247 | } | |
14248 | } // end of for(Int_t i=0;i<6;i++) | |
14249 | if(!fIntFlowRebinnedInM) | |
14250 | { | |
14251 | cout<<endl; | |
14252 | cout<<" WARNING (QC): fIntFlowRebinnedInM is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14253 | cout<<endl; | |
14254 | exit(0); | |
14255 | } | |
14256 | if(!fIntFlowQcumulantsRebinnedInM) | |
14257 | { | |
14258 | cout<<endl; | |
14259 | cout<<" WARNING (QC): fIntFlowQcumulantsRebinnedInM is NULL in CheckPointersUsedInFinish() !!!!"<<endl; | |
14260 | cout<<endl; | |
14261 | exit(0); | |
14262 | } | |
14263 | ||
14264 | } // end of void AliFlowAnalysisWithQCumulants::CheckPointersUsedInFinish() | |
14265 | ||
14266 | //================================================================================================================================ | |
14267 | ||
14268 | void AliFlowAnalysisWithQCumulants::CheckPointersUsedInMake() | |
14269 | { | |
1268c371 | 14270 | // Check all pointers used in method Make(). // to be improved - check other pointers as well |
b3dacf6b | 14271 | |
b77b6434 | 14272 | if(!fAvMultiplicity) |
14273 | { | |
1268c371 | 14274 | printf("\n WARNING (QC): fAvMultiplicity is NULL in CheckPointersUsedInMake() !!!!\n\n"); |
b77b6434 | 14275 | exit(0); |
14276 | } | |
403e3389 | 14277 | if((fUsePhiWeights||fUsePtWeights||fUseEtaWeights||fUseTrackWeights) && !fIntFlowExtraCorrelationsPro) |
b77b6434 | 14278 | { |
1268c371 | 14279 | printf("\n WARNING (QC): fIntFlowExtraCorrelationsPro is NULL in CheckPointersUsedInMake() !!!!\n\n"); |
b77b6434 | 14280 | exit(0); |
14281 | } | |
1268c371 | 14282 | // 2D: |
14283 | if(fCalculate2DDiffFlow) | |
14284 | { | |
14285 | for(Int_t t=0;t<2;t++) // type = RP or POI | |
14286 | { | |
14287 | for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
14288 | { | |
14289 | if(!f2DDiffFlowCorrelationsPro[t][rci]) | |
14290 | { | |
14291 | printf("\n WARNING (QC): f2DDiffFlowCorrelationsPro[%i][%i] is NULL in CheckPointersUsedInMake() !!!!\n\n",t,rci); | |
14292 | exit(0); | |
14293 | } // end of if(!f2DDiffFlowCorrelationsPro[t][rci]) | |
14294 | } // end of for(Int_t rci=0;rci<4;rci++) // reduced correlation index | |
14295 | } // end of for(Int_t t=0;t<2;t++) | |
14296 | } // end of if(fCalculate2DDiffFlow) | |
b3dacf6b | 14297 | |
14298 | } // end of void AliFlowAnalysisWithQCumulants::CheckPointersUsedInMake() | |
14299 | ||
57340a27 | 14300 |